max_stars_repo_path
stringlengths 4
286
| max_stars_repo_name
stringlengths 5
119
| max_stars_count
int64 0
191k
| id
stringlengths 1
7
| content
stringlengths 6
1.03M
| content_cleaned
stringlengths 6
1.03M
| language
stringclasses 111
values | language_score
float64 0.03
1
| comments
stringlengths 0
556k
| edu_score
float64 0.32
5.03
| edu_int_score
int64 0
5
|
---|---|---|---|---|---|---|---|---|---|---|
6.爬取豆瓣排行榜电影数据(含GUI界面版)/main.py | shengqiangzhang/examples-of-web-crawlers | 12,023 | 2800 | <reponame>shengqiangzhang/examples-of-web-crawlers
# -*- coding:utf-8 -*-
from uiObject import uiObject
# main入口
if __name__ == '__main__':
ui = uiObject()
ui.ui_process() | # -*- coding:utf-8 -*-
from uiObject import uiObject
# main入口
if __name__ == '__main__':
ui = uiObject()
ui.ui_process() | zh | 0.450421 | # -*- coding:utf-8 -*- # main入口 | 1.003967 | 1 |
photos/models.py | eude313/vault | 0 | 2801 | from django.db import models
from cloudinary.models import CloudinaryField
# Create your models here.
class Category(models.Model):
name = models.CharField( max_length=200, null=False, blank=False )
def __str__(self):
return self.name
class Photo(models.Model):
category = models.ForeignKey( Category, on_delete=models.SET_NULL, null=True, blank=True )
image = CloudinaryField('image', default='')
description = models.TextField()
def __str__(self):
return self.description | from django.db import models
from cloudinary.models import CloudinaryField
# Create your models here.
class Category(models.Model):
name = models.CharField( max_length=200, null=False, blank=False )
def __str__(self):
return self.name
class Photo(models.Model):
category = models.ForeignKey( Category, on_delete=models.SET_NULL, null=True, blank=True )
image = CloudinaryField('image', default='')
description = models.TextField()
def __str__(self):
return self.description | en | 0.963489 | # Create your models here. | 2.372454 | 2 |
server/djangoapp/restapis.py | christiansencq/ibm_capstone | 0 | 2802 | <reponame>christiansencq/ibm_capstone
import requests
import json
# import related models here
from .models import CarDealer, DealerReview
from requests.auth import HTTPBasicAuth
import logging
logger = logging.getLogger(__name__)
# Create a `get_request` to make HTTP GET requests
# e.g., response = requests.get(url, params=params, headers={'Content-Type': 'application/json'},
# auth=HTTPBasicAuth('apikey', api_key))
def get_request(url, api_key, **kwargs):
print("GET from {}".format(url))
print(kwargs)
try:
if api_key is not None:
response = requests.get(url, headers={'Content-Type': 'application/json'}, params=kwargs, auth=HTTPBasicAuth('apikey', api_key))
else:
response = requests.get(url, headers={'Content-Type': 'application/json'}, params=kwargs)
except:
print("Network Error")
status_code = response.status_code
print("With status code {}".format(status_code))
json_data = json.loads(response.text)
return json_data, status_code
# Create a `post_request` to make HTTP POST requests
# e.g., response = requests.post(url, params=kwargs, json=payload)
def post_request(url, json_payload, **kwargs):
print("Post to url: {} ".format(url))
print(kwargs)
print(json_payload)
response = requests.post(url, headers={'Content-Type': 'application/json'}, params=kwargs, json=json_payload)
status_code = response.status_code
print("With status code {}".format(status_code))
json_data = json.loads(response.text)
return json_data, status_code
# Create a get_dealers_from_cf method to get dealers from a cloud function
def get_dealers_from_cf(url, **kwargs):
info = []
result = "ok"
# - Call get_request() with specified arguments
logger.info("Get Dealers from CF Called!")
json_result, status_code = get_request(url, None)
if status_code == 200 and json_result:
dealers = json_result['rows']
logger.info(len(dealers))
for dealer in dealers:
dlr_data = dealer['doc']
#print('ADDRESS', dlr_data["address"])
if dlr_data.get('address'):
# Create a CarDealer object with values in `doc` object
dealer_obj = CarDealer(address=dlr_data.get("address"), city=dlr_data.get("city"), full_name=dlr_data.get("full_name"),
id=dlr_data.get("id"), lat=dlr_data.get("lat"), long=dlr_data.get("long"),
short_name=dlr_data.get("short_name"), state=dlr_data.get("state"),
st=dlr_data.get("st"), zip=dlr_data.get("zip"))
# dealer_obj = CarDealer(address=dealer["doc"]["address"], city=dealer["doc"]["city"], full_name=dealer["doc"]["full_name"],
# id=dealer["doc"]["id"], lat=dealer["doc"]["lat"], long=dealer["doc"]["long"],
# short_name=dealer["doc"]["short_name"],
# st=dealer["doc"]["st"], state=dealer["doc"]["state"], zip=dealer["doc"]["zip"])
info.append(dealer_obj)
elif json_result:
result = json_result["message"]
else:
result = "Unknown error"
return info, result
def get_dealer_by_id(url, dealerId):
# Call get_request with a URL parameter
info = None
result = "ok"
json_result, status_code = get_request(url, None, dealerId=dealerId)
# json_result, status_code = get_request(url, None, dealerId=dealerId)
if status_code == 200 and json_result:
# Get the row list in JSON as dealers
dealers = json_result["rows"]
for dealer in dealers:
# Create a CarDealer object with values in `doc` object
info = CarDealer(address=dealer.get("address"), city=dealer.get("city"), full_name=dealer.get("full_name"),
id=dealer.get("id"), lat=dealer.get("lat"), long=dealer.get("long"),
short_name=dealer.get("short_name"),
st=dealer.get("st"), state=dealer.get("state"), zip=dealer.get("zip"))
# info = CarDealer(address=dealer["address"], city=dealer["city"], full_name=dealer["full_name"],
# id=dealer["id"], lat=dealer["lat"], long=dealer["long"],
# short_name=dealer["short_name"], state=dealer["state"],
# st=dealer["st"], zip=dealer["zip"])
elif json_result:
result = json_result["message"]
else:
result = "Unknown error"
return info, result
def get_dealers_by_state (url, state):
info = []
result = "ok"
# Call get_request with a URL parameter
json_result, status_code = get_request(url, None, state=state)
if status_code == 200 and json_result:
# Get the row list in JSON as dealers
dealers = json_result["rows"]
# For each dealer object
for dealer in dealers:
# dlr_data = dealer["doc"]
# Create a CarDealer object with values in `doc` object
dealer_obj = CarDealer(address=dealer.get("address"), city=dealer.get("city"), full_name=dealer.get("full_name"),
id=dealer.get("id"), lat=dealer.get("lat"), long=dealer.get("long"),
short_name=dealer.get("short_name"), state=dealer.get("state"),
st=dealer.get("st"), zip=dealer.get("zip"))
# dealer_obj = CarDealer(address=dlr_data.get("address"), city=dlr_data.get("city"), full_name=dlr_data.get("full_name"),
# id=dlr_data.get("id"), lat=dlr_data.get("lat"), long=dlr_data.get("long"),
# short_name=dlr_data.get("short_name"), state=dlr_data.get("state"),
# st=dlr_data.get("st"), zip=dlr_data.get("zip"))
info.append(dealer_obj)
elif json_result:
result = json_result["message"]
else:
result = "Unknown error"
return info, result
def get_dealer_reviews_from_cf (url, dealerId):
info = []
result = "ok"
# Call get_request with a URL parameter
json_result, status_code = get_request(url, None, dealerId=dealerId)
if status_code == 200 and json_result:
# Get the row list in JSON as reviews
reviews = json_result["body"]["data"]
# For each review object
for review in reviews:
if (dealerId == review.get("dealership")):
# Create a DealerReview object with values in object
#sentiment = analyze_review_sentiments(review["review"])
review_obj = DealerReview( id=review.get("id"), name=review.get("name"), review=review.get("review"),
purchase=review.get("purchase"), car_make=review.get("car_make", None),
car_model=review.get("car_model", None), car_year=review.get("car_year", None),
purchase_date=review.get("purchase_date", None))
info.append(review_obj)
elif json_result:
result = json_result["message"]
else:
result = "Unknown error"
return info, result
# Create an `analyze_review_sentiments` method to call Watson NLU and analyze text
# def analyze_review_sentiments(text):
# - Call get_request() with specified arguments
# - Get the returned sentiment label such as Positive or Negative
| import requests
import json
# import related models here
from .models import CarDealer, DealerReview
from requests.auth import HTTPBasicAuth
import logging
logger = logging.getLogger(__name__)
# Create a `get_request` to make HTTP GET requests
# e.g., response = requests.get(url, params=params, headers={'Content-Type': 'application/json'},
# auth=HTTPBasicAuth('apikey', api_key))
def get_request(url, api_key, **kwargs):
print("GET from {}".format(url))
print(kwargs)
try:
if api_key is not None:
response = requests.get(url, headers={'Content-Type': 'application/json'}, params=kwargs, auth=HTTPBasicAuth('apikey', api_key))
else:
response = requests.get(url, headers={'Content-Type': 'application/json'}, params=kwargs)
except:
print("Network Error")
status_code = response.status_code
print("With status code {}".format(status_code))
json_data = json.loads(response.text)
return json_data, status_code
# Create a `post_request` to make HTTP POST requests
# e.g., response = requests.post(url, params=kwargs, json=payload)
def post_request(url, json_payload, **kwargs):
print("Post to url: {} ".format(url))
print(kwargs)
print(json_payload)
response = requests.post(url, headers={'Content-Type': 'application/json'}, params=kwargs, json=json_payload)
status_code = response.status_code
print("With status code {}".format(status_code))
json_data = json.loads(response.text)
return json_data, status_code
# Create a get_dealers_from_cf method to get dealers from a cloud function
def get_dealers_from_cf(url, **kwargs):
info = []
result = "ok"
# - Call get_request() with specified arguments
logger.info("Get Dealers from CF Called!")
json_result, status_code = get_request(url, None)
if status_code == 200 and json_result:
dealers = json_result['rows']
logger.info(len(dealers))
for dealer in dealers:
dlr_data = dealer['doc']
#print('ADDRESS', dlr_data["address"])
if dlr_data.get('address'):
# Create a CarDealer object with values in `doc` object
dealer_obj = CarDealer(address=dlr_data.get("address"), city=dlr_data.get("city"), full_name=dlr_data.get("full_name"),
id=dlr_data.get("id"), lat=dlr_data.get("lat"), long=dlr_data.get("long"),
short_name=dlr_data.get("short_name"), state=dlr_data.get("state"),
st=dlr_data.get("st"), zip=dlr_data.get("zip"))
# dealer_obj = CarDealer(address=dealer["doc"]["address"], city=dealer["doc"]["city"], full_name=dealer["doc"]["full_name"],
# id=dealer["doc"]["id"], lat=dealer["doc"]["lat"], long=dealer["doc"]["long"],
# short_name=dealer["doc"]["short_name"],
# st=dealer["doc"]["st"], state=dealer["doc"]["state"], zip=dealer["doc"]["zip"])
info.append(dealer_obj)
elif json_result:
result = json_result["message"]
else:
result = "Unknown error"
return info, result
def get_dealer_by_id(url, dealerId):
# Call get_request with a URL parameter
info = None
result = "ok"
json_result, status_code = get_request(url, None, dealerId=dealerId)
# json_result, status_code = get_request(url, None, dealerId=dealerId)
if status_code == 200 and json_result:
# Get the row list in JSON as dealers
dealers = json_result["rows"]
for dealer in dealers:
# Create a CarDealer object with values in `doc` object
info = CarDealer(address=dealer.get("address"), city=dealer.get("city"), full_name=dealer.get("full_name"),
id=dealer.get("id"), lat=dealer.get("lat"), long=dealer.get("long"),
short_name=dealer.get("short_name"),
st=dealer.get("st"), state=dealer.get("state"), zip=dealer.get("zip"))
# info = CarDealer(address=dealer["address"], city=dealer["city"], full_name=dealer["full_name"],
# id=dealer["id"], lat=dealer["lat"], long=dealer["long"],
# short_name=dealer["short_name"], state=dealer["state"],
# st=dealer["st"], zip=dealer["zip"])
elif json_result:
result = json_result["message"]
else:
result = "Unknown error"
return info, result
def get_dealers_by_state (url, state):
info = []
result = "ok"
# Call get_request with a URL parameter
json_result, status_code = get_request(url, None, state=state)
if status_code == 200 and json_result:
# Get the row list in JSON as dealers
dealers = json_result["rows"]
# For each dealer object
for dealer in dealers:
# dlr_data = dealer["doc"]
# Create a CarDealer object with values in `doc` object
dealer_obj = CarDealer(address=dealer.get("address"), city=dealer.get("city"), full_name=dealer.get("full_name"),
id=dealer.get("id"), lat=dealer.get("lat"), long=dealer.get("long"),
short_name=dealer.get("short_name"), state=dealer.get("state"),
st=dealer.get("st"), zip=dealer.get("zip"))
# dealer_obj = CarDealer(address=dlr_data.get("address"), city=dlr_data.get("city"), full_name=dlr_data.get("full_name"),
# id=dlr_data.get("id"), lat=dlr_data.get("lat"), long=dlr_data.get("long"),
# short_name=dlr_data.get("short_name"), state=dlr_data.get("state"),
# st=dlr_data.get("st"), zip=dlr_data.get("zip"))
info.append(dealer_obj)
elif json_result:
result = json_result["message"]
else:
result = "Unknown error"
return info, result
def get_dealer_reviews_from_cf (url, dealerId):
info = []
result = "ok"
# Call get_request with a URL parameter
json_result, status_code = get_request(url, None, dealerId=dealerId)
if status_code == 200 and json_result:
# Get the row list in JSON as reviews
reviews = json_result["body"]["data"]
# For each review object
for review in reviews:
if (dealerId == review.get("dealership")):
# Create a DealerReview object with values in object
#sentiment = analyze_review_sentiments(review["review"])
review_obj = DealerReview( id=review.get("id"), name=review.get("name"), review=review.get("review"),
purchase=review.get("purchase"), car_make=review.get("car_make", None),
car_model=review.get("car_model", None), car_year=review.get("car_year", None),
purchase_date=review.get("purchase_date", None))
info.append(review_obj)
elif json_result:
result = json_result["message"]
else:
result = "Unknown error"
return info, result
# Create an `analyze_review_sentiments` method to call Watson NLU and analyze text
# def analyze_review_sentiments(text):
# - Call get_request() with specified arguments
# - Get the returned sentiment label such as Positive or Negative | en | 0.446107 | # import related models here # Create a `get_request` to make HTTP GET requests # e.g., response = requests.get(url, params=params, headers={'Content-Type': 'application/json'}, # auth=HTTPBasicAuth('apikey', api_key)) # Create a `post_request` to make HTTP POST requests # e.g., response = requests.post(url, params=kwargs, json=payload) # Create a get_dealers_from_cf method to get dealers from a cloud function # - Call get_request() with specified arguments #print('ADDRESS', dlr_data["address"]) # Create a CarDealer object with values in `doc` object # dealer_obj = CarDealer(address=dealer["doc"]["address"], city=dealer["doc"]["city"], full_name=dealer["doc"]["full_name"], # id=dealer["doc"]["id"], lat=dealer["doc"]["lat"], long=dealer["doc"]["long"], # short_name=dealer["doc"]["short_name"], # st=dealer["doc"]["st"], state=dealer["doc"]["state"], zip=dealer["doc"]["zip"]) # Call get_request with a URL parameter # json_result, status_code = get_request(url, None, dealerId=dealerId) # Get the row list in JSON as dealers # Create a CarDealer object with values in `doc` object # info = CarDealer(address=dealer["address"], city=dealer["city"], full_name=dealer["full_name"], # id=dealer["id"], lat=dealer["lat"], long=dealer["long"], # short_name=dealer["short_name"], state=dealer["state"], # st=dealer["st"], zip=dealer["zip"]) # Call get_request with a URL parameter # Get the row list in JSON as dealers # For each dealer object # dlr_data = dealer["doc"] # Create a CarDealer object with values in `doc` object # dealer_obj = CarDealer(address=dlr_data.get("address"), city=dlr_data.get("city"), full_name=dlr_data.get("full_name"), # id=dlr_data.get("id"), lat=dlr_data.get("lat"), long=dlr_data.get("long"), # short_name=dlr_data.get("short_name"), state=dlr_data.get("state"), # st=dlr_data.get("st"), zip=dlr_data.get("zip")) # Call get_request with a URL parameter # Get the row list in JSON as reviews # For each review object # Create a DealerReview object with values in object #sentiment = analyze_review_sentiments(review["review"]) # Create an `analyze_review_sentiments` method to call Watson NLU and analyze text # def analyze_review_sentiments(text): # - Call get_request() with specified arguments # - Get the returned sentiment label such as Positive or Negative | 2.487169 | 2 |
examples/python/upload.py | oslokommune/okdata-data-uploader | 0 | 2803 | import logging
from configparser import ConfigParser
from sdk.data_uploader import DataUploader
logging.basicConfig(level=logging.INFO)
log = logging.getLogger()
config = ConfigParser()
config.read("config.ini")
#####
# Datasets to be added to metadata API
datasetData = {
"title": "Test",
"description": "Test data",
"keywords": ["test"],
"accessRights": "non-public",
"objective": "Formålsbeskrivelse",
"contactPoint": {
"name": "Tim",
"email": "<EMAIL>",
"phone": "12345678",
},
"publisher": "Tim",
}
datasetVersionData = {"version": "6", "schema": {}, "transformation": {}}
datasetVersionEditionData = {
"edition": "2019-05-28T15:37:00+02:00",
"description": "Data for one hour",
"startTime": "2018-12-21T08:00:00+01:00",
"endTime": "2018-12-21T09:00:00+01:00",
}
######
# The dataset* variables are optional, if these are set in config.ini this script will
# not run the relevant DataUploader function
datasetId = config.get("dataUploader", "datasetId", fallback=None)
datasetVersion = config.get("dataUploader", "datasetVersion", fallback=None)
datasetVersionEdition = config.get(
"dataUploader", "datasetVersionEdition", fallback=None
)
upload = DataUploader(config)
try:
log.info("Uploading a file to S3")
upload.login()
if datasetId is None:
upload.createDataset(datasetData)
if datasetVersion is None:
upload.createVersion(datasetVersionData)
if datasetVersionEdition is None:
upload.createEdition(datasetVersionEditionData)
log.info(f"Dataset: {upload.datasetId}")
log.info(f"Version: {upload.datasetVersion}")
log.info(f"Edition: {upload.datasetVersionEdition}")
if upload.upload("README.md"):
log.info("Done... go brew some coffee")
else:
log.error("Could not upload file....")
except Exception as e:
log.exception(f">> Something went horrible wrong:\n{e}")
# To upload with curl: cmd = upload.curl("tmp3.zip")
# Max upload size for now is 5GB
| import logging
from configparser import ConfigParser
from sdk.data_uploader import DataUploader
logging.basicConfig(level=logging.INFO)
log = logging.getLogger()
config = ConfigParser()
config.read("config.ini")
#####
# Datasets to be added to metadata API
datasetData = {
"title": "Test",
"description": "Test data",
"keywords": ["test"],
"accessRights": "non-public",
"objective": "Formålsbeskrivelse",
"contactPoint": {
"name": "Tim",
"email": "<EMAIL>",
"phone": "12345678",
},
"publisher": "Tim",
}
datasetVersionData = {"version": "6", "schema": {}, "transformation": {}}
datasetVersionEditionData = {
"edition": "2019-05-28T15:37:00+02:00",
"description": "Data for one hour",
"startTime": "2018-12-21T08:00:00+01:00",
"endTime": "2018-12-21T09:00:00+01:00",
}
######
# The dataset* variables are optional, if these are set in config.ini this script will
# not run the relevant DataUploader function
datasetId = config.get("dataUploader", "datasetId", fallback=None)
datasetVersion = config.get("dataUploader", "datasetVersion", fallback=None)
datasetVersionEdition = config.get(
"dataUploader", "datasetVersionEdition", fallback=None
)
upload = DataUploader(config)
try:
log.info("Uploading a file to S3")
upload.login()
if datasetId is None:
upload.createDataset(datasetData)
if datasetVersion is None:
upload.createVersion(datasetVersionData)
if datasetVersionEdition is None:
upload.createEdition(datasetVersionEditionData)
log.info(f"Dataset: {upload.datasetId}")
log.info(f"Version: {upload.datasetVersion}")
log.info(f"Edition: {upload.datasetVersionEdition}")
if upload.upload("README.md"):
log.info("Done... go brew some coffee")
else:
log.error("Could not upload file....")
except Exception as e:
log.exception(f">> Something went horrible wrong:\n{e}")
# To upload with curl: cmd = upload.curl("tmp3.zip")
# Max upload size for now is 5GB
| en | 0.789355 | ##### # Datasets to be added to metadata API ###### # The dataset* variables are optional, if these are set in config.ini this script will # not run the relevant DataUploader function # To upload with curl: cmd = upload.curl("tmp3.zip") # Max upload size for now is 5GB | 2.279253 | 2 |
doc/examples.py | Enerccio/mahjong | 254 | 2804 | <gh_stars>100-1000
from mahjong.hand_calculating.hand import HandCalculator
from mahjong.meld import Meld
from mahjong.hand_calculating.hand_config import HandConfig, OptionalRules
from mahjong.shanten import Shanten
from mahjong.tile import TilesConverter
calculator = HandCalculator()
# useful helper
def print_hand_result(hand_result):
print(hand_result.han, hand_result.fu)
print(hand_result.cost['main'])
print(hand_result.yaku)
for fu_item in hand_result.fu_details:
print(fu_item)
print('')
####################################################################
# Tanyao hand by ron #
####################################################################
# we had to use all 14 tiles in that array
tiles = TilesConverter.string_to_136_array(man='22444', pin='333567', sou='444')
win_tile = TilesConverter.string_to_136_array(sou='4')[0]
result = calculator.estimate_hand_value(tiles, win_tile)
print_hand_result(result)
####################################################################
# Tanyao hand by tsumo #
####################################################################
result = calculator.estimate_hand_value(tiles, win_tile, config=HandConfig(is_tsumo=True))
print_hand_result(result)
####################################################################
# Add open set to hand #
####################################################################
melds = [Meld(meld_type=Meld.PON, tiles=TilesConverter.string_to_136_array(man='444'))]
result = calculator.estimate_hand_value(tiles, win_tile, melds=melds, config=HandConfig(options=OptionalRules(has_open_tanyao=True)))
print_hand_result(result)
####################################################################
# Shanten calculation #
####################################################################
shanten = Shanten()
tiles = TilesConverter.string_to_34_array(man='13569', pin='123459', sou='443')
result = shanten.calculate_shanten(tiles)
print(result)
####################################################################
# Kazoe as a sanbaiman #
####################################################################
tiles = TilesConverter.string_to_136_array(man='22244466677788')
win_tile = TilesConverter.string_to_136_array(man='7')[0]
melds = [
Meld(Meld.KAN, TilesConverter.string_to_136_array(man='2222'), False)
]
dora_indicators = [
TilesConverter.string_to_136_array(man='1')[0],
TilesConverter.string_to_136_array(man='1')[0],
TilesConverter.string_to_136_array(man='1')[0],
TilesConverter.string_to_136_array(man='1')[0],
]
config = HandConfig(is_riichi=True, options=OptionalRules(kazoe=HandConfig.KAZOE_SANBAIMAN))
result = calculator.estimate_hand_value(tiles, win_tile, melds, dora_indicators, config)
print_hand_result(result)
####################################################################
# Change the cost of yaku #
####################################################################
config = HandConfig(is_renhou=True)
# renhou as an yakuman - old style
config.yaku.renhou.han_closed = 13
tiles = TilesConverter.string_to_136_array(man='22444', pin='333567', sou='444')
win_tile = TilesConverter.string_to_136_array(sou='4')[0]
result = calculator.estimate_hand_value(tiles, win_tile, config=config)
print_hand_result(result)
| from mahjong.hand_calculating.hand import HandCalculator
from mahjong.meld import Meld
from mahjong.hand_calculating.hand_config import HandConfig, OptionalRules
from mahjong.shanten import Shanten
from mahjong.tile import TilesConverter
calculator = HandCalculator()
# useful helper
def print_hand_result(hand_result):
print(hand_result.han, hand_result.fu)
print(hand_result.cost['main'])
print(hand_result.yaku)
for fu_item in hand_result.fu_details:
print(fu_item)
print('')
####################################################################
# Tanyao hand by ron #
####################################################################
# we had to use all 14 tiles in that array
tiles = TilesConverter.string_to_136_array(man='22444', pin='333567', sou='444')
win_tile = TilesConverter.string_to_136_array(sou='4')[0]
result = calculator.estimate_hand_value(tiles, win_tile)
print_hand_result(result)
####################################################################
# Tanyao hand by tsumo #
####################################################################
result = calculator.estimate_hand_value(tiles, win_tile, config=HandConfig(is_tsumo=True))
print_hand_result(result)
####################################################################
# Add open set to hand #
####################################################################
melds = [Meld(meld_type=Meld.PON, tiles=TilesConverter.string_to_136_array(man='444'))]
result = calculator.estimate_hand_value(tiles, win_tile, melds=melds, config=HandConfig(options=OptionalRules(has_open_tanyao=True)))
print_hand_result(result)
####################################################################
# Shanten calculation #
####################################################################
shanten = Shanten()
tiles = TilesConverter.string_to_34_array(man='13569', pin='123459', sou='443')
result = shanten.calculate_shanten(tiles)
print(result)
####################################################################
# Kazoe as a sanbaiman #
####################################################################
tiles = TilesConverter.string_to_136_array(man='22244466677788')
win_tile = TilesConverter.string_to_136_array(man='7')[0]
melds = [
Meld(Meld.KAN, TilesConverter.string_to_136_array(man='2222'), False)
]
dora_indicators = [
TilesConverter.string_to_136_array(man='1')[0],
TilesConverter.string_to_136_array(man='1')[0],
TilesConverter.string_to_136_array(man='1')[0],
TilesConverter.string_to_136_array(man='1')[0],
]
config = HandConfig(is_riichi=True, options=OptionalRules(kazoe=HandConfig.KAZOE_SANBAIMAN))
result = calculator.estimate_hand_value(tiles, win_tile, melds, dora_indicators, config)
print_hand_result(result)
####################################################################
# Change the cost of yaku #
####################################################################
config = HandConfig(is_renhou=True)
# renhou as an yakuman - old style
config.yaku.renhou.han_closed = 13
tiles = TilesConverter.string_to_136_array(man='22444', pin='333567', sou='444')
win_tile = TilesConverter.string_to_136_array(sou='4')[0]
result = calculator.estimate_hand_value(tiles, win_tile, config=config)
print_hand_result(result) | de | 0.776076 | # useful helper #################################################################### # Tanyao hand by ron # #################################################################### # we had to use all 14 tiles in that array #################################################################### # Tanyao hand by tsumo # #################################################################### #################################################################### # Add open set to hand # #################################################################### #################################################################### # Shanten calculation # #################################################################### #################################################################### # Kazoe as a sanbaiman # #################################################################### #################################################################### # Change the cost of yaku # #################################################################### # renhou as an yakuman - old style | 2.355716 | 2 |
src/infi/mount_utils/solaris/mounter.py | Infinidat/mount-utils | 0 | 2805 | from ..base.mounter import MounterMixin, execute_mount
class SolarisMounterMixin(MounterMixin):
def _get_fstab_path(self):
return "/etc/fstab"
def _get_entry_format(self, entry):
return entry.get_format_solaris()
def mount_entry(self, entry):
args = ["-F", entry.get_typename(), entry.get_fsname(), entry.get_dirname()]
args.extend(self._format_options(entry))
execute_mount(args)
| from ..base.mounter import MounterMixin, execute_mount
class SolarisMounterMixin(MounterMixin):
def _get_fstab_path(self):
return "/etc/fstab"
def _get_entry_format(self, entry):
return entry.get_format_solaris()
def mount_entry(self, entry):
args = ["-F", entry.get_typename(), entry.get_fsname(), entry.get_dirname()]
args.extend(self._format_options(entry))
execute_mount(args)
| none | 1 | 2.152988 | 2 |
|
sdk/python/pulumi_oci/database/get_external_non_container_database.py | EladGabay/pulumi-oci | 5 | 2806 | <reponame>EladGabay/pulumi-oci
# coding=utf-8
# *** WARNING: this file was generated by the Pulumi Terraform Bridge (tfgen) Tool. ***
# *** Do not edit by hand unless you're certain you know what you are doing! ***
import warnings
import pulumi
import pulumi.runtime
from typing import Any, Mapping, Optional, Sequence, Union, overload
from .. import _utilities
from . import outputs
__all__ = [
'GetExternalNonContainerDatabaseResult',
'AwaitableGetExternalNonContainerDatabaseResult',
'get_external_non_container_database',
]
@pulumi.output_type
class GetExternalNonContainerDatabaseResult:
"""
A collection of values returned by getExternalNonContainerDatabase.
"""
def __init__(__self__, character_set=None, compartment_id=None, database_configuration=None, database_edition=None, database_management_config=None, database_version=None, db_id=None, db_packs=None, db_unique_name=None, defined_tags=None, display_name=None, external_non_container_database_id=None, freeform_tags=None, id=None, lifecycle_details=None, ncharacter_set=None, operations_insights_config=None, state=None, time_created=None, time_zone=None):
if character_set and not isinstance(character_set, str):
raise TypeError("Expected argument 'character_set' to be a str")
pulumi.set(__self__, "character_set", character_set)
if compartment_id and not isinstance(compartment_id, str):
raise TypeError("Expected argument 'compartment_id' to be a str")
pulumi.set(__self__, "compartment_id", compartment_id)
if database_configuration and not isinstance(database_configuration, str):
raise TypeError("Expected argument 'database_configuration' to be a str")
pulumi.set(__self__, "database_configuration", database_configuration)
if database_edition and not isinstance(database_edition, str):
raise TypeError("Expected argument 'database_edition' to be a str")
pulumi.set(__self__, "database_edition", database_edition)
if database_management_config and not isinstance(database_management_config, dict):
raise TypeError("Expected argument 'database_management_config' to be a dict")
pulumi.set(__self__, "database_management_config", database_management_config)
if database_version and not isinstance(database_version, str):
raise TypeError("Expected argument 'database_version' to be a str")
pulumi.set(__self__, "database_version", database_version)
if db_id and not isinstance(db_id, str):
raise TypeError("Expected argument 'db_id' to be a str")
pulumi.set(__self__, "db_id", db_id)
if db_packs and not isinstance(db_packs, str):
raise TypeError("Expected argument 'db_packs' to be a str")
pulumi.set(__self__, "db_packs", db_packs)
if db_unique_name and not isinstance(db_unique_name, str):
raise TypeError("Expected argument 'db_unique_name' to be a str")
pulumi.set(__self__, "db_unique_name", db_unique_name)
if defined_tags and not isinstance(defined_tags, dict):
raise TypeError("Expected argument 'defined_tags' to be a dict")
pulumi.set(__self__, "defined_tags", defined_tags)
if display_name and not isinstance(display_name, str):
raise TypeError("Expected argument 'display_name' to be a str")
pulumi.set(__self__, "display_name", display_name)
if external_non_container_database_id and not isinstance(external_non_container_database_id, str):
raise TypeError("Expected argument 'external_non_container_database_id' to be a str")
pulumi.set(__self__, "external_non_container_database_id", external_non_container_database_id)
if freeform_tags and not isinstance(freeform_tags, dict):
raise TypeError("Expected argument 'freeform_tags' to be a dict")
pulumi.set(__self__, "freeform_tags", freeform_tags)
if id and not isinstance(id, str):
raise TypeError("Expected argument 'id' to be a str")
pulumi.set(__self__, "id", id)
if lifecycle_details and not isinstance(lifecycle_details, str):
raise TypeError("Expected argument 'lifecycle_details' to be a str")
pulumi.set(__self__, "lifecycle_details", lifecycle_details)
if ncharacter_set and not isinstance(ncharacter_set, str):
raise TypeError("Expected argument 'ncharacter_set' to be a str")
pulumi.set(__self__, "ncharacter_set", ncharacter_set)
if operations_insights_config and not isinstance(operations_insights_config, dict):
raise TypeError("Expected argument 'operations_insights_config' to be a dict")
pulumi.set(__self__, "operations_insights_config", operations_insights_config)
if state and not isinstance(state, str):
raise TypeError("Expected argument 'state' to be a str")
pulumi.set(__self__, "state", state)
if time_created and not isinstance(time_created, str):
raise TypeError("Expected argument 'time_created' to be a str")
pulumi.set(__self__, "time_created", time_created)
if time_zone and not isinstance(time_zone, str):
raise TypeError("Expected argument 'time_zone' to be a str")
pulumi.set(__self__, "time_zone", time_zone)
@property
@pulumi.getter(name="characterSet")
def character_set(self) -> str:
"""
The character set of the external database.
"""
return pulumi.get(self, "character_set")
@property
@pulumi.getter(name="compartmentId")
def compartment_id(self) -> str:
"""
The [OCID](https://docs.cloud.oracle.com/iaas/Content/General/Concepts/identifiers.htm) of the compartment.
"""
return pulumi.get(self, "compartment_id")
@property
@pulumi.getter(name="databaseConfiguration")
def database_configuration(self) -> str:
"""
The Oracle Database configuration
"""
return pulumi.get(self, "database_configuration")
@property
@pulumi.getter(name="databaseEdition")
def database_edition(self) -> str:
"""
The Oracle Database edition.
"""
return pulumi.get(self, "database_edition")
@property
@pulumi.getter(name="databaseManagementConfig")
def database_management_config(self) -> 'outputs.GetExternalNonContainerDatabaseDatabaseManagementConfigResult':
"""
The configuration of the Database Management service.
"""
return pulumi.get(self, "database_management_config")
@property
@pulumi.getter(name="databaseVersion")
def database_version(self) -> str:
"""
The Oracle Database version.
"""
return pulumi.get(self, "database_version")
@property
@pulumi.getter(name="dbId")
def db_id(self) -> str:
"""
The Oracle Database ID, which identifies an Oracle Database located outside of Oracle Cloud.
"""
return pulumi.get(self, "db_id")
@property
@pulumi.getter(name="dbPacks")
def db_packs(self) -> str:
"""
The database packs licensed for the external Oracle Database.
"""
return pulumi.get(self, "db_packs")
@property
@pulumi.getter(name="dbUniqueName")
def db_unique_name(self) -> str:
"""
The `DB_UNIQUE_NAME` of the external database.
"""
return pulumi.get(self, "db_unique_name")
@property
@pulumi.getter(name="definedTags")
def defined_tags(self) -> Mapping[str, Any]:
"""
Defined tags for this resource. Each key is predefined and scoped to a namespace. For more information, see [Resource Tags](https://docs.cloud.oracle.com/iaas/Content/General/Concepts/resourcetags.htm).
"""
return pulumi.get(self, "defined_tags")
@property
@pulumi.getter(name="displayName")
def display_name(self) -> str:
"""
The user-friendly name for the external database. The name does not have to be unique.
"""
return pulumi.get(self, "display_name")
@property
@pulumi.getter(name="externalNonContainerDatabaseId")
def external_non_container_database_id(self) -> str:
return pulumi.get(self, "external_non_container_database_id")
@property
@pulumi.getter(name="freeformTags")
def freeform_tags(self) -> Mapping[str, Any]:
"""
Free-form tags for this resource. Each tag is a simple key-value pair with no predefined name, type, or namespace. For more information, see [Resource Tags](https://docs.cloud.oracle.com/iaas/Content/General/Concepts/resourcetags.htm). Example: `{"Department": "Finance"}`
"""
return pulumi.get(self, "freeform_tags")
@property
@pulumi.getter
def id(self) -> str:
"""
The [OCID](https://docs.cloud.oracle.com/iaas/Content/General/Concepts/identifiers.htm) of the Oracle Cloud Infrastructure external database resource.
"""
return pulumi.get(self, "id")
@property
@pulumi.getter(name="lifecycleDetails")
def lifecycle_details(self) -> str:
"""
Additional information about the current lifecycle state.
"""
return pulumi.get(self, "lifecycle_details")
@property
@pulumi.getter(name="ncharacterSet")
def ncharacter_set(self) -> str:
"""
The national character of the external database.
"""
return pulumi.get(self, "ncharacter_set")
@property
@pulumi.getter(name="operationsInsightsConfig")
def operations_insights_config(self) -> 'outputs.GetExternalNonContainerDatabaseOperationsInsightsConfigResult':
"""
The configuration of Operations Insights for the external database
"""
return pulumi.get(self, "operations_insights_config")
@property
@pulumi.getter
def state(self) -> str:
"""
The current state of the Oracle Cloud Infrastructure external database resource.
"""
return pulumi.get(self, "state")
@property
@pulumi.getter(name="timeCreated")
def time_created(self) -> str:
"""
The date and time the database was created.
"""
return pulumi.get(self, "time_created")
@property
@pulumi.getter(name="timeZone")
def time_zone(self) -> str:
"""
The time zone of the external database. It is a time zone offset (a character type in the format '[+|-]TZH:TZM') or a time zone region name, depending on how the time zone value was specified when the database was created / last altered.
"""
return pulumi.get(self, "time_zone")
class AwaitableGetExternalNonContainerDatabaseResult(GetExternalNonContainerDatabaseResult):
# pylint: disable=using-constant-test
def __await__(self):
if False:
yield self
return GetExternalNonContainerDatabaseResult(
character_set=self.character_set,
compartment_id=self.compartment_id,
database_configuration=self.database_configuration,
database_edition=self.database_edition,
database_management_config=self.database_management_config,
database_version=self.database_version,
db_id=self.db_id,
db_packs=self.db_packs,
db_unique_name=self.db_unique_name,
defined_tags=self.defined_tags,
display_name=self.display_name,
external_non_container_database_id=self.external_non_container_database_id,
freeform_tags=self.freeform_tags,
id=self.id,
lifecycle_details=self.lifecycle_details,
ncharacter_set=self.ncharacter_set,
operations_insights_config=self.operations_insights_config,
state=self.state,
time_created=self.time_created,
time_zone=self.time_zone)
def get_external_non_container_database(external_non_container_database_id: Optional[str] = None,
opts: Optional[pulumi.InvokeOptions] = None) -> AwaitableGetExternalNonContainerDatabaseResult:
"""
This data source provides details about a specific External Non Container Database resource in Oracle Cloud Infrastructure Database service.
Gets information about a specific external non-container database.
## Example Usage
```python
import pulumi
import pulumi_oci as oci
test_external_non_container_database = oci.database.get_external_non_container_database(external_non_container_database_id=oci_database_external_non_container_database["test_external_non_container_database"]["id"])
```
:param str external_non_container_database_id: The external non-container database [OCID](https://docs.cloud.oracle.com/iaas/Content/General/Concepts/identifiers.htm).
"""
__args__ = dict()
__args__['externalNonContainerDatabaseId'] = external_non_container_database_id
if opts is None:
opts = pulumi.InvokeOptions()
if opts.version is None:
opts.version = _utilities.get_version()
__ret__ = pulumi.runtime.invoke('oci:database/getExternalNonContainerDatabase:getExternalNonContainerDatabase', __args__, opts=opts, typ=GetExternalNonContainerDatabaseResult).value
return AwaitableGetExternalNonContainerDatabaseResult(
character_set=__ret__.character_set,
compartment_id=__ret__.compartment_id,
database_configuration=__ret__.database_configuration,
database_edition=__ret__.database_edition,
database_management_config=__ret__.database_management_config,
database_version=__ret__.database_version,
db_id=__ret__.db_id,
db_packs=__ret__.db_packs,
db_unique_name=__ret__.db_unique_name,
defined_tags=__ret__.defined_tags,
display_name=__ret__.display_name,
external_non_container_database_id=__ret__.external_non_container_database_id,
freeform_tags=__ret__.freeform_tags,
id=__ret__.id,
lifecycle_details=__ret__.lifecycle_details,
ncharacter_set=__ret__.ncharacter_set,
operations_insights_config=__ret__.operations_insights_config,
state=__ret__.state,
time_created=__ret__.time_created,
time_zone=__ret__.time_zone)
| # coding=utf-8
# *** WARNING: this file was generated by the Pulumi Terraform Bridge (tfgen) Tool. ***
# *** Do not edit by hand unless you're certain you know what you are doing! ***
import warnings
import pulumi
import pulumi.runtime
from typing import Any, Mapping, Optional, Sequence, Union, overload
from .. import _utilities
from . import outputs
__all__ = [
'GetExternalNonContainerDatabaseResult',
'AwaitableGetExternalNonContainerDatabaseResult',
'get_external_non_container_database',
]
@pulumi.output_type
class GetExternalNonContainerDatabaseResult:
"""
A collection of values returned by getExternalNonContainerDatabase.
"""
def __init__(__self__, character_set=None, compartment_id=None, database_configuration=None, database_edition=None, database_management_config=None, database_version=None, db_id=None, db_packs=None, db_unique_name=None, defined_tags=None, display_name=None, external_non_container_database_id=None, freeform_tags=None, id=None, lifecycle_details=None, ncharacter_set=None, operations_insights_config=None, state=None, time_created=None, time_zone=None):
if character_set and not isinstance(character_set, str):
raise TypeError("Expected argument 'character_set' to be a str")
pulumi.set(__self__, "character_set", character_set)
if compartment_id and not isinstance(compartment_id, str):
raise TypeError("Expected argument 'compartment_id' to be a str")
pulumi.set(__self__, "compartment_id", compartment_id)
if database_configuration and not isinstance(database_configuration, str):
raise TypeError("Expected argument 'database_configuration' to be a str")
pulumi.set(__self__, "database_configuration", database_configuration)
if database_edition and not isinstance(database_edition, str):
raise TypeError("Expected argument 'database_edition' to be a str")
pulumi.set(__self__, "database_edition", database_edition)
if database_management_config and not isinstance(database_management_config, dict):
raise TypeError("Expected argument 'database_management_config' to be a dict")
pulumi.set(__self__, "database_management_config", database_management_config)
if database_version and not isinstance(database_version, str):
raise TypeError("Expected argument 'database_version' to be a str")
pulumi.set(__self__, "database_version", database_version)
if db_id and not isinstance(db_id, str):
raise TypeError("Expected argument 'db_id' to be a str")
pulumi.set(__self__, "db_id", db_id)
if db_packs and not isinstance(db_packs, str):
raise TypeError("Expected argument 'db_packs' to be a str")
pulumi.set(__self__, "db_packs", db_packs)
if db_unique_name and not isinstance(db_unique_name, str):
raise TypeError("Expected argument 'db_unique_name' to be a str")
pulumi.set(__self__, "db_unique_name", db_unique_name)
if defined_tags and not isinstance(defined_tags, dict):
raise TypeError("Expected argument 'defined_tags' to be a dict")
pulumi.set(__self__, "defined_tags", defined_tags)
if display_name and not isinstance(display_name, str):
raise TypeError("Expected argument 'display_name' to be a str")
pulumi.set(__self__, "display_name", display_name)
if external_non_container_database_id and not isinstance(external_non_container_database_id, str):
raise TypeError("Expected argument 'external_non_container_database_id' to be a str")
pulumi.set(__self__, "external_non_container_database_id", external_non_container_database_id)
if freeform_tags and not isinstance(freeform_tags, dict):
raise TypeError("Expected argument 'freeform_tags' to be a dict")
pulumi.set(__self__, "freeform_tags", freeform_tags)
if id and not isinstance(id, str):
raise TypeError("Expected argument 'id' to be a str")
pulumi.set(__self__, "id", id)
if lifecycle_details and not isinstance(lifecycle_details, str):
raise TypeError("Expected argument 'lifecycle_details' to be a str")
pulumi.set(__self__, "lifecycle_details", lifecycle_details)
if ncharacter_set and not isinstance(ncharacter_set, str):
raise TypeError("Expected argument 'ncharacter_set' to be a str")
pulumi.set(__self__, "ncharacter_set", ncharacter_set)
if operations_insights_config and not isinstance(operations_insights_config, dict):
raise TypeError("Expected argument 'operations_insights_config' to be a dict")
pulumi.set(__self__, "operations_insights_config", operations_insights_config)
if state and not isinstance(state, str):
raise TypeError("Expected argument 'state' to be a str")
pulumi.set(__self__, "state", state)
if time_created and not isinstance(time_created, str):
raise TypeError("Expected argument 'time_created' to be a str")
pulumi.set(__self__, "time_created", time_created)
if time_zone and not isinstance(time_zone, str):
raise TypeError("Expected argument 'time_zone' to be a str")
pulumi.set(__self__, "time_zone", time_zone)
@property
@pulumi.getter(name="characterSet")
def character_set(self) -> str:
"""
The character set of the external database.
"""
return pulumi.get(self, "character_set")
@property
@pulumi.getter(name="compartmentId")
def compartment_id(self) -> str:
"""
The [OCID](https://docs.cloud.oracle.com/iaas/Content/General/Concepts/identifiers.htm) of the compartment.
"""
return pulumi.get(self, "compartment_id")
@property
@pulumi.getter(name="databaseConfiguration")
def database_configuration(self) -> str:
"""
The Oracle Database configuration
"""
return pulumi.get(self, "database_configuration")
@property
@pulumi.getter(name="databaseEdition")
def database_edition(self) -> str:
"""
The Oracle Database edition.
"""
return pulumi.get(self, "database_edition")
@property
@pulumi.getter(name="databaseManagementConfig")
def database_management_config(self) -> 'outputs.GetExternalNonContainerDatabaseDatabaseManagementConfigResult':
"""
The configuration of the Database Management service.
"""
return pulumi.get(self, "database_management_config")
@property
@pulumi.getter(name="databaseVersion")
def database_version(self) -> str:
"""
The Oracle Database version.
"""
return pulumi.get(self, "database_version")
@property
@pulumi.getter(name="dbId")
def db_id(self) -> str:
"""
The Oracle Database ID, which identifies an Oracle Database located outside of Oracle Cloud.
"""
return pulumi.get(self, "db_id")
@property
@pulumi.getter(name="dbPacks")
def db_packs(self) -> str:
"""
The database packs licensed for the external Oracle Database.
"""
return pulumi.get(self, "db_packs")
@property
@pulumi.getter(name="dbUniqueName")
def db_unique_name(self) -> str:
"""
The `DB_UNIQUE_NAME` of the external database.
"""
return pulumi.get(self, "db_unique_name")
@property
@pulumi.getter(name="definedTags")
def defined_tags(self) -> Mapping[str, Any]:
"""
Defined tags for this resource. Each key is predefined and scoped to a namespace. For more information, see [Resource Tags](https://docs.cloud.oracle.com/iaas/Content/General/Concepts/resourcetags.htm).
"""
return pulumi.get(self, "defined_tags")
@property
@pulumi.getter(name="displayName")
def display_name(self) -> str:
"""
The user-friendly name for the external database. The name does not have to be unique.
"""
return pulumi.get(self, "display_name")
@property
@pulumi.getter(name="externalNonContainerDatabaseId")
def external_non_container_database_id(self) -> str:
return pulumi.get(self, "external_non_container_database_id")
@property
@pulumi.getter(name="freeformTags")
def freeform_tags(self) -> Mapping[str, Any]:
"""
Free-form tags for this resource. Each tag is a simple key-value pair with no predefined name, type, or namespace. For more information, see [Resource Tags](https://docs.cloud.oracle.com/iaas/Content/General/Concepts/resourcetags.htm). Example: `{"Department": "Finance"}`
"""
return pulumi.get(self, "freeform_tags")
@property
@pulumi.getter
def id(self) -> str:
"""
The [OCID](https://docs.cloud.oracle.com/iaas/Content/General/Concepts/identifiers.htm) of the Oracle Cloud Infrastructure external database resource.
"""
return pulumi.get(self, "id")
@property
@pulumi.getter(name="lifecycleDetails")
def lifecycle_details(self) -> str:
"""
Additional information about the current lifecycle state.
"""
return pulumi.get(self, "lifecycle_details")
@property
@pulumi.getter(name="ncharacterSet")
def ncharacter_set(self) -> str:
"""
The national character of the external database.
"""
return pulumi.get(self, "ncharacter_set")
@property
@pulumi.getter(name="operationsInsightsConfig")
def operations_insights_config(self) -> 'outputs.GetExternalNonContainerDatabaseOperationsInsightsConfigResult':
"""
The configuration of Operations Insights for the external database
"""
return pulumi.get(self, "operations_insights_config")
@property
@pulumi.getter
def state(self) -> str:
"""
The current state of the Oracle Cloud Infrastructure external database resource.
"""
return pulumi.get(self, "state")
@property
@pulumi.getter(name="timeCreated")
def time_created(self) -> str:
"""
The date and time the database was created.
"""
return pulumi.get(self, "time_created")
@property
@pulumi.getter(name="timeZone")
def time_zone(self) -> str:
"""
The time zone of the external database. It is a time zone offset (a character type in the format '[+|-]TZH:TZM') or a time zone region name, depending on how the time zone value was specified when the database was created / last altered.
"""
return pulumi.get(self, "time_zone")
class AwaitableGetExternalNonContainerDatabaseResult(GetExternalNonContainerDatabaseResult):
# pylint: disable=using-constant-test
def __await__(self):
if False:
yield self
return GetExternalNonContainerDatabaseResult(
character_set=self.character_set,
compartment_id=self.compartment_id,
database_configuration=self.database_configuration,
database_edition=self.database_edition,
database_management_config=self.database_management_config,
database_version=self.database_version,
db_id=self.db_id,
db_packs=self.db_packs,
db_unique_name=self.db_unique_name,
defined_tags=self.defined_tags,
display_name=self.display_name,
external_non_container_database_id=self.external_non_container_database_id,
freeform_tags=self.freeform_tags,
id=self.id,
lifecycle_details=self.lifecycle_details,
ncharacter_set=self.ncharacter_set,
operations_insights_config=self.operations_insights_config,
state=self.state,
time_created=self.time_created,
time_zone=self.time_zone)
def get_external_non_container_database(external_non_container_database_id: Optional[str] = None,
opts: Optional[pulumi.InvokeOptions] = None) -> AwaitableGetExternalNonContainerDatabaseResult:
"""
This data source provides details about a specific External Non Container Database resource in Oracle Cloud Infrastructure Database service.
Gets information about a specific external non-container database.
## Example Usage
```python
import pulumi
import pulumi_oci as oci
test_external_non_container_database = oci.database.get_external_non_container_database(external_non_container_database_id=oci_database_external_non_container_database["test_external_non_container_database"]["id"])
```
:param str external_non_container_database_id: The external non-container database [OCID](https://docs.cloud.oracle.com/iaas/Content/General/Concepts/identifiers.htm).
"""
__args__ = dict()
__args__['externalNonContainerDatabaseId'] = external_non_container_database_id
if opts is None:
opts = pulumi.InvokeOptions()
if opts.version is None:
opts.version = _utilities.get_version()
__ret__ = pulumi.runtime.invoke('oci:database/getExternalNonContainerDatabase:getExternalNonContainerDatabase', __args__, opts=opts, typ=GetExternalNonContainerDatabaseResult).value
return AwaitableGetExternalNonContainerDatabaseResult(
character_set=__ret__.character_set,
compartment_id=__ret__.compartment_id,
database_configuration=__ret__.database_configuration,
database_edition=__ret__.database_edition,
database_management_config=__ret__.database_management_config,
database_version=__ret__.database_version,
db_id=__ret__.db_id,
db_packs=__ret__.db_packs,
db_unique_name=__ret__.db_unique_name,
defined_tags=__ret__.defined_tags,
display_name=__ret__.display_name,
external_non_container_database_id=__ret__.external_non_container_database_id,
freeform_tags=__ret__.freeform_tags,
id=__ret__.id,
lifecycle_details=__ret__.lifecycle_details,
ncharacter_set=__ret__.ncharacter_set,
operations_insights_config=__ret__.operations_insights_config,
state=__ret__.state,
time_created=__ret__.time_created,
time_zone=__ret__.time_zone) | en | 0.693311 | # coding=utf-8 # *** WARNING: this file was generated by the Pulumi Terraform Bridge (tfgen) Tool. *** # *** Do not edit by hand unless you're certain you know what you are doing! *** A collection of values returned by getExternalNonContainerDatabase. The character set of the external database. The [OCID](https://docs.cloud.oracle.com/iaas/Content/General/Concepts/identifiers.htm) of the compartment. The Oracle Database configuration The Oracle Database edition. The configuration of the Database Management service. The Oracle Database version. The Oracle Database ID, which identifies an Oracle Database located outside of Oracle Cloud. The database packs licensed for the external Oracle Database. The `DB_UNIQUE_NAME` of the external database. Defined tags for this resource. Each key is predefined and scoped to a namespace. For more information, see [Resource Tags](https://docs.cloud.oracle.com/iaas/Content/General/Concepts/resourcetags.htm). The user-friendly name for the external database. The name does not have to be unique. Free-form tags for this resource. Each tag is a simple key-value pair with no predefined name, type, or namespace. For more information, see [Resource Tags](https://docs.cloud.oracle.com/iaas/Content/General/Concepts/resourcetags.htm). Example: `{"Department": "Finance"}` The [OCID](https://docs.cloud.oracle.com/iaas/Content/General/Concepts/identifiers.htm) of the Oracle Cloud Infrastructure external database resource. Additional information about the current lifecycle state. The national character of the external database. The configuration of Operations Insights for the external database The current state of the Oracle Cloud Infrastructure external database resource. The date and time the database was created. The time zone of the external database. It is a time zone offset (a character type in the format '[+|-]TZH:TZM') or a time zone region name, depending on how the time zone value was specified when the database was created / last altered. # pylint: disable=using-constant-test This data source provides details about a specific External Non Container Database resource in Oracle Cloud Infrastructure Database service. Gets information about a specific external non-container database. ## Example Usage ```python import pulumi import pulumi_oci as oci test_external_non_container_database = oci.database.get_external_non_container_database(external_non_container_database_id=oci_database_external_non_container_database["test_external_non_container_database"]["id"]) ``` :param str external_non_container_database_id: The external non-container database [OCID](https://docs.cloud.oracle.com/iaas/Content/General/Concepts/identifiers.htm). | 1.654502 | 2 |
setup.py | xmedius/xmedius-mailrelayserver | 0 | 2807 | from setuptools import setup
from setuptools.command.install import install
class PostInstallCommand(install):
user_options = install.user_options + [
('noservice', None, None),
]
def initialize_options(self):
install.initialize_options(self)
self.noservice = None
def finalize_options(self):
install.finalize_options(self)
def run(self):
install.run(self)
if not self.noservice:
from xmediusmailrelayserver import console
console.install_service(['--startup', 'auto', 'install'])
setup(
name='xmediusmailrelayserver',
version='1.0.0',
description='The Python module to be used to relay mail to different servers depending on patterns',
long_description='See https://github.com/xmedius/xmedius-mailrelayserver for more information',
url='https://github.com/xmedius/xmedius-mailrelayserver/',
author='<NAME>',
license='MIT',
classifiers=[
'Programming Language :: Python :: 3.6',
'Environment :: Win32 (MS Windows)',
'Operating System :: Microsoft :: Windows'
],
cmdclass={
'install': PostInstallCommand
},
packages=['xmediusmailrelayserver'],
package_data={'xmediusmailrelayserver': ['config.yml']},
install_requires=['pyyaml', 'aiosmtpd'],
dependency_links=[]
)
| from setuptools import setup
from setuptools.command.install import install
class PostInstallCommand(install):
user_options = install.user_options + [
('noservice', None, None),
]
def initialize_options(self):
install.initialize_options(self)
self.noservice = None
def finalize_options(self):
install.finalize_options(self)
def run(self):
install.run(self)
if not self.noservice:
from xmediusmailrelayserver import console
console.install_service(['--startup', 'auto', 'install'])
setup(
name='xmediusmailrelayserver',
version='1.0.0',
description='The Python module to be used to relay mail to different servers depending on patterns',
long_description='See https://github.com/xmedius/xmedius-mailrelayserver for more information',
url='https://github.com/xmedius/xmedius-mailrelayserver/',
author='<NAME>',
license='MIT',
classifiers=[
'Programming Language :: Python :: 3.6',
'Environment :: Win32 (MS Windows)',
'Operating System :: Microsoft :: Windows'
],
cmdclass={
'install': PostInstallCommand
},
packages=['xmediusmailrelayserver'],
package_data={'xmediusmailrelayserver': ['config.yml']},
install_requires=['pyyaml', 'aiosmtpd'],
dependency_links=[]
)
| none | 1 | 1.914 | 2 |
|
143.py | tsbxmw/leetcode | 0 | 2808 | # 143. 重排链表
# 给定一个单链表 L:L0→L1→…→Ln-1→Ln ,
# 将其重新排列后变为: L0→Ln→L1→Ln-1→L2→Ln-2→…
# 你不能只是单纯的改变节点内部的值,而是需要实际的进行节点交换。
# 示例 1:
# 给定链表 1->2->3->4, 重新排列为 1->4->2->3.
# 示例 2:
# 给定链表 1->2->3->4->5, 重新排列为 1->5->2->4->3.
# Definition for singly-linked list.
# class ListNode:
# def __init__(self, x):
# self.val = x
# self.next = None
# Definition for singly-linked list.
# class ListNode:
# def __init__(self, x):
# self.val = x
# self.next = None
## 整体上是交换,使用递归,先找到最后节点
## 1 -》 2 -》 3 -》 4 -》 5
## | |
## temp = 1.next == 2
## 1.next = 4.next == 5
## 4.next = None
## 1.next.next == 5.next = 2
## now = 2
## last = 3.next
class Solution:
def reorderList(self, head: ListNode) -> None:
"""
Do not return anything, modify head in-place instead.
"""
if not head:
return
self.pre = head
self.flag = True
def test(node):
if not node.next: # 如果 node.next 是 None,就不需要交换了
return
test(node.next)
if not self.flag:
return
if not self.pre.next:
self.flag = False
return
if self.pre == node:
self.flag = False
return
temp = self.pre.next
self.pre.next = node.next
self.pre.next.next = temp
self.pre = temp
node.next = None
test(self.pre) | # 143. 重排链表
# 给定一个单链表 L:L0→L1→…→Ln-1→Ln ,
# 将其重新排列后变为: L0→Ln→L1→Ln-1→L2→Ln-2→…
# 你不能只是单纯的改变节点内部的值,而是需要实际的进行节点交换。
# 示例 1:
# 给定链表 1->2->3->4, 重新排列为 1->4->2->3.
# 示例 2:
# 给定链表 1->2->3->4->5, 重新排列为 1->5->2->4->3.
# Definition for singly-linked list.
# class ListNode:
# def __init__(self, x):
# self.val = x
# self.next = None
# Definition for singly-linked list.
# class ListNode:
# def __init__(self, x):
# self.val = x
# self.next = None
## 整体上是交换,使用递归,先找到最后节点
## 1 -》 2 -》 3 -》 4 -》 5
## | |
## temp = 1.next == 2
## 1.next = 4.next == 5
## 4.next = None
## 1.next.next == 5.next = 2
## now = 2
## last = 3.next
class Solution:
def reorderList(self, head: ListNode) -> None:
"""
Do not return anything, modify head in-place instead.
"""
if not head:
return
self.pre = head
self.flag = True
def test(node):
if not node.next: # 如果 node.next 是 None,就不需要交换了
return
test(node.next)
if not self.flag:
return
if not self.pre.next:
self.flag = False
return
if self.pre == node:
self.flag = False
return
temp = self.pre.next
self.pre.next = node.next
self.pre.next.next = temp
self.pre = temp
node.next = None
test(self.pre) | zh | 0.467177 | # 143. 重排链表 # 给定一个单链表 L:L0→L1→…→Ln-1→Ln , # 将其重新排列后变为: L0→Ln→L1→Ln-1→L2→Ln-2→… # 你不能只是单纯的改变节点内部的值,而是需要实际的进行节点交换。 # 示例 1: # 给定链表 1->2->3->4, 重新排列为 1->4->2->3. # 示例 2: # 给定链表 1->2->3->4->5, 重新排列为 1->5->2->4->3. # Definition for singly-linked list. # class ListNode: # def __init__(self, x): # self.val = x # self.next = None # Definition for singly-linked list. # class ListNode: # def __init__(self, x): # self.val = x # self.next = None ## 整体上是交换,使用递归,先找到最后节点 ## 1 -》 2 -》 3 -》 4 -》 5 ## | | ## temp = 1.next == 2 ## 1.next = 4.next == 5 ## 4.next = None ## 1.next.next == 5.next = 2 ## now = 2 ## last = 3.next Do not return anything, modify head in-place instead. # 如果 node.next 是 None,就不需要交换了 | 3.728364 | 4 |
CraftProtocol/NBT/NBTTagList.py | Toranktto/CraftProtocol | 21 | 2809 | #!/usr/bin/env python
from CraftProtocol.NBT.NBTBase import NBTBase
from CraftProtocol.NBT.NBTProvider import NBTProvider
from CraftProtocol.StreamIO import StreamIO
class NBTTagList(NBTBase):
TYPE_ID = 0x09
def __init__(self, tag_type, values=None):
NBTBase.__init__(self)
if values is None:
values = []
self._tag_type = tag_type
self._values = list(values)
def get(self):
return self._values
def get_tag_type(self):
return self._tag_type
def __getitem__(self, i):
return self._values.__getitem__(i)
def __setitem__(self, i, o):
assert isinstance(o, self._tag_type), "value must be " + self._tag_type.__name__
self._values.__setitem__(i, o)
def __delitem__(self, i):
self._values.__delitem__(i)
def __iter__(self):
return self._values.__iter__()
def __contains__(self, o):
return self._values.__contains__(o)
def __len__(self):
return self._values.__len__()
def append(self, x):
assert isinstance(x, self._tag_type), "arg must be " + self._tag_type.__name__
self._values.append(x)
def remove(self, x):
assert isinstance(x, self._tag_type), "arg must be " + self._tag_type.__name__
self._values.remove(x)
@staticmethod
def write(stream, tag):
StreamIO.write_ubyte(stream, tag.get_tag_type().TYPE_ID)
StreamIO.write_int(stream, len(tag))
for i in tag:
tag.get_tag_type().write(stream, i)
@staticmethod
def read(stream):
tag_type_id = StreamIO.read_ubyte(stream)
tag_type = NBTProvider.get_tag_class(tag_type_id)
values = []
len = StreamIO.read_int(stream)
for i in xrange(len):
values.append(tag_type.read(stream))
return NBTTagList(tag_type, values)
| #!/usr/bin/env python
from CraftProtocol.NBT.NBTBase import NBTBase
from CraftProtocol.NBT.NBTProvider import NBTProvider
from CraftProtocol.StreamIO import StreamIO
class NBTTagList(NBTBase):
TYPE_ID = 0x09
def __init__(self, tag_type, values=None):
NBTBase.__init__(self)
if values is None:
values = []
self._tag_type = tag_type
self._values = list(values)
def get(self):
return self._values
def get_tag_type(self):
return self._tag_type
def __getitem__(self, i):
return self._values.__getitem__(i)
def __setitem__(self, i, o):
assert isinstance(o, self._tag_type), "value must be " + self._tag_type.__name__
self._values.__setitem__(i, o)
def __delitem__(self, i):
self._values.__delitem__(i)
def __iter__(self):
return self._values.__iter__()
def __contains__(self, o):
return self._values.__contains__(o)
def __len__(self):
return self._values.__len__()
def append(self, x):
assert isinstance(x, self._tag_type), "arg must be " + self._tag_type.__name__
self._values.append(x)
def remove(self, x):
assert isinstance(x, self._tag_type), "arg must be " + self._tag_type.__name__
self._values.remove(x)
@staticmethod
def write(stream, tag):
StreamIO.write_ubyte(stream, tag.get_tag_type().TYPE_ID)
StreamIO.write_int(stream, len(tag))
for i in tag:
tag.get_tag_type().write(stream, i)
@staticmethod
def read(stream):
tag_type_id = StreamIO.read_ubyte(stream)
tag_type = NBTProvider.get_tag_class(tag_type_id)
values = []
len = StreamIO.read_int(stream)
for i in xrange(len):
values.append(tag_type.read(stream))
return NBTTagList(tag_type, values)
| ru | 0.26433 | #!/usr/bin/env python | 2.129056 | 2 |
examples/0b02b172-ad67-449b-b4a2-ff645b28c508.py | lapaniku/GAS | 37 | 2810 | <reponame>lapaniku/GAS<gh_stars>10-100
# This program was generated by "Generative Art Synthesizer"
# Generation date: 2021-11-28 09:21:40 UTC
# GAS change date: 2021-11-28 09:20:21 UTC
# GAS md5 hash: ad55481e87ca5a7e9a8e92cd336d1cad
# Python version: 3.7.9 (tags/v3.7.9:13c94747c7, Aug 17 2020, 18:58:18) [MSC v.1900 64 bit (AMD64)]
# For more information visit: https://github.com/volotat/GAS
#import python libraries
import os #OS version: default
import numpy as np #Numpy version: 1.19.5
from PIL import Image #PIL version: 8.1.2
#set initial params
SIZE = 768
GRID_CHANNELS = 16
def test_values(arr):
if np.isnan(arr).any():
raise Exception('Array has None elements!')
if np.amin(arr) < -1 or np.amax(arr) > 1:
raise Exception('Values went to far! [ %.2f : %.2f ]'%(np.amin(arr), np.amax(arr)) )
return arr
#define grid transformation methods
def transit(x, t_indx, s_indx, alphas):
res = x.copy()
res[:,:,t_indx] = np.sum(x[:,:,s_indx] * alphas, axis = -1)
return test_values(res.clip(-1,1))
def sin(x, t_indx, s_indx, scale = 1, shift = 0):
res = x.copy()
res[:,:,t_indx] = np.sin(x[:,:,s_indx] * 0.5 * np.pi * scale + shift)
return test_values(res)
def magnitude(x, t_indx, s_indx, ord = 2):
res = x.copy()
res[:,:,t_indx] = np.linalg.norm(x[:,:,s_indx], axis = -1, ord = ord) / np.sqrt(len(s_indx))
return test_values(res)
def shift(x, t_indx, s_indx, shift):
res = x.copy()
if shift > 0: res[:,:,t_indx] = (-np.abs(((x[:,:,s_indx] + 1) / 2) ** (1 + shift) - 1) ** (1 / (1 + shift)) + 1) * 2 - 1
if shift < 0: res[:,:,t_indx] = np.abs((1 - (x[:,:,s_indx] + 1) / 2) ** (1 - shift) - 1) ** (1 / (1 - shift)) * 2 - 1
return test_values(res)
def inverse(x, t_indx, s_indx):
res = x.copy()
res[:,:,t_indx] = -x[:,:,s_indx]
return test_values(res)
def smooth_max(x, t_indx, s1_indx, s2_indx, p = 10):
res = x.copy()
res[:,:,t_indx] = np.log((np.exp(x[:,:,s1_indx] * p) + np.exp(x[:,:,s2_indx] * p)) ** (1/p)) / 1.07
return test_values(res)
def smooth_min(x, t_indx, s1_indx, s2_indx, p = 10):
res = x.copy()
res[:,:,t_indx] = -np.log((np.exp(-x[:,:,s1_indx] * p) + np.exp(-x[:,:,s2_indx] * p)) ** (1/p)) / 1.07
return test_values(res)
def prod(x, t_indx, s_indx):
res = x.copy()
res[:,:,t_indx] = np.prod(x[:,:,s_indx], -1)
return test_values(res)
def power(x, t_indx, s_indx, p = 1):
res = x.copy()
res[:,:,t_indx] = np.sign(x[:,:,s_indx]) * np.abs(x[:,:,s_indx]) ** p
return test_values(res)
#set initial grid
grid = np.zeros((SIZE, SIZE, GRID_CHANNELS))
x = ((np.arange(SIZE)/(SIZE-1) - 0.5) * 2).reshape((1, SIZE)).repeat(SIZE, 0)
y = ((np.arange(SIZE)/(SIZE-1) - 0.5) * 2).reshape((SIZE, 1)).repeat(SIZE, 1)
grid[:,:,0] = (x * 0.9386329219527516 + y * -0.45147169454413794) / 2
grid[:,:,1] = (x * 0.8090860808441245 + y * 0.2914526739617249) / 2
grid[:,:,2] = (x * 0.9804797761207309 + y * -0.5063344373124843) / 2
grid[:,:,3] = (x * -0.8484277738516293 + y * -0.5155435342135386) / 2
grid[:,:,4] = (x * -0.6644350461377522 + y * 0.1739322518414499) / 2
grid[:,:,5] = (x * -0.5986715486203882 + y * 0.9515468928881716) / 2
grid[:,:,6] = (x * 0.2265055481768512 + y * 0.4365452266748293) / 2
grid[:,:,7] = (x * 0.5049774961793401 + y * 0.05113255120007798) / 2
grid[:,:,8] = (x * -0.3391983246964396 + y * -0.5135707069423852) / 2
grid[:,:,9] = (x * -0.4075423366723827 + y * 0.5388833863473126) / 2
grid[:,:,10] = (x * -0.4262457935185371 + y * -0.6817079327248272) / 2
grid[:,:,11] = (x * 0.8435706697714382 + y * 0.7746597063144072) / 2
grid[:,:,12] = (x * -0.5303146721156469 + y * -0.41048419195488317) / 2
grid[:,:,13] = (x * -0.5864100240508576 + y * -0.9425245660964123) / 2
grid[:,:,14] = (x * -0.7665883618456049 + y * -0.3867357840809138) / 2
grid[:,:,15] = (x * 0.49037959172682255 + y * -0.7671554143072785) / 2
#apply transformations to the grid
grid = transit(grid, 4, [7, 6, 12, 8, 9, 0, 1], [0.05863158300898051, 0.3467981515651057, 0.262107802795733, 0.038001653167336905, 0.2112967596903696, 0.002128256606899112, 0.08103579316557531])
grid = shift(grid, 3, 3, 2.4622222565241207)
grid = sin(grid, 10, 0, 0.5112825397666086, 37.95950546335726)
grid = sin(grid, 12, 13, 3.6938747278005737, 76.37702042567852)
grid = magnitude(grid, 15, [5, 3, 8, 0, 15], 2)
grid = prod(grid, 2, [3, 11, 1])
grid = smooth_min(grid, 3, 2, 7)
grid = smooth_max(grid, 8, 10, 6)
grid = prod(grid, 3, [2, 6, 10, 7, 4])
grid = smooth_min(grid, 7, 12, 0)
grid = transit(grid, 2, [1, 2], [0.9078557995211777, 0.09214420047882232])
grid = smooth_max(grid, 1, 0, 1)
grid = sin(grid, 9, 4, 3.0281102269529683, 11.185401112275173)
grid = sin(grid, 10, 4, 1.2844464834351186, -45.836492724169695)
grid = sin(grid, 1, 2, -1.5301674594368837, -60.29431568717391)
grid = transit(grid, 2, [13, 11, 5], [0.421270391024163, 0.5054038923567993, 0.07332571661903758])
grid = transit(grid, 11, [1, 15, 5, 0, 6, 12, 2, 7, 4], [0.03047869593495055, 0.024092687676923453, 0.02665655056773558, 0.17667886361751853, 0.15211061797378253, 0.016462544099609754, 0.0072484377164178625, 0.4477791048998878, 0.11849249751317383])
grid = transit(grid, 10, [5, 11, 15, 8, 2, 13, 12, 3, 6], [0.1020239434902293, 0.05405846145210329, 0.11525379082942891, 0.11556721863292163, 0.12372657123165616, 0.1356897031789931, 0.20047556686480725, 0.09921434949484752, 0.05399039482501285])
grid = transit(grid, 9, [5], [1.0])
grid = transit(grid, 15, [12, 0, 1, 11], [0.01847979792505241, 0.33442336387003857, 0.15192425697494277, 0.4951725812299663])
grid = sin(grid, 4, 8, 3.386521226555936, 60.95572898751007)
grid = shift(grid, 14, 2, 2.55681173849493)
grid = sin(grid, 10, 14, 0.8649185298731181, 3.1973516320924773)
grid = sin(grid, 9, 7, -2.4657577404884132, 72.95418196004374)
grid = transit(grid, 12, [7, 4, 10, 5], [0.5076634403621766, 0.003404332378773421, 0.04142944289977586, 0.4475027843592742])
grid = inverse(grid, 4, 5)
grid = transit(grid, 1, [4, 14, 0, 13], [0.2785496566747933, 0.004915230889640017, 0.30146401859790545, 0.4150710938376613])
grid = sin(grid, 3, 11, -6.496603906160505, -73.75617586359363)
grid = transit(grid, 6, [6, 14], [0.7201753385758813, 0.2798246614241187])
grid = prod(grid, 4, [10, 0, 2, 4, 8, 5, 6, 7])
grid = transit(grid, 8, [3], [1.0])
grid = inverse(grid, 8, 5)
grid = smooth_max(grid, 10, 5, 13)
grid = sin(grid, 9, 10, -1.8565532127479274, -54.75186223635349)
grid = transit(grid, 10, [14], [1.0])
grid = transit(grid, 15, [11, 4, 10], [0.6926745567135898, 0.1831142410590532, 0.12421120222735695])
grid = magnitude(grid, 7, [6, 12, 7, 13, 8], 2)
grid = transit(grid, 8, [3, 15, 9, 6, 11], [0.036102265915692405, 0.1224495166624379, 0.2384660328868578, 0.3357862916746864, 0.2671958928603256])
grid = smooth_min(grid, 1, 1, 11)
grid = transit(grid, 5, [11, 4, 2, 1, 13, 12, 0, 8], [0.08486049729383285, 0.15069099224942706, 0.024923245737924458, 0.07191051851248272, 0.25942601829807205, 0.16834508849259286, 0.14540219911263502, 0.094441440303033])
grid = transit(grid, 11, [12], [1.0])
grid = power(grid, 3, 5, 0.10200689258338674)
grid = transit(grid, 2, [10, 11, 4, 15, 0, 6], [0.24973877983541862, 0.3378766591098989, 0.15974656746239488, 0.027776085211312595, 0.02330072841260748, 0.20156117996836745])
grid = smooth_min(grid, 0, 5, 1)
grid = magnitude(grid, 0, [5, 0], 2)
grid = transit(grid, 6, [15, 8], [0.5303803951305812, 0.4696196048694189])
grid = inverse(grid, 0, 0)
grid = magnitude(grid, 13, [8], 2)
grid = transit(grid, 13, [15, 5, 9, 4, 6, 12], [0.18067242214638962, 0.12939497982917472, 0.08164480089591167, 0.24583958083442445, 0.2244518823086713, 0.13799633398542827])
grid = transit(grid, 11, [0], [1.0])
grid = magnitude(grid, 0, [4, 13], 2)
grid = transit(grid, 8, [5, 4, 15, 6, 14, 0, 3, 11], [0.13835365002720226, 0.008781149737259792, 0.24627334258742545, 0.04870190081124998, 0.049950480577274, 0.15123046752435387, 0.31255198044446264, 0.04415702829077187])
grid = transit(grid, 1, [3], [1.0])
grid = magnitude(grid, 14, [4], 2)
grid = sin(grid, 1, 5, 8.18216846853571, -6.729427492311089)
grid = magnitude(grid, 11, [8, 2], 2)
grid = transit(grid, 7, [12, 11, 13, 4], [0.1713900685471786, 0.14082681623065177, 0.19859698568682838, 0.4891861295353413])
grid = transit(grid, 13, [12, 15, 9, 2, 0, 1, 5], [0.18796556626817826, 0.19260744772691155, 0.11226112831146452, 0.08161640805634696, 0.08706050582840198, 0.2243337708440404, 0.11415517296465624])
grid = sin(grid, 11, 13, -6.909579361872105, 70.84834564082374)
grid = transit(grid, 2, [11, 7, 13], [0.3629247592109436, 0.10073172896374764, 0.5363435118253088])
grid = sin(grid, 1, 5, 0.6814927249849106, 30.75954926767548)
grid = inverse(grid, 8, 7)
grid = prod(grid, 10, [5, 2])
grid = transit(grid, 15, [0, 3], [0.29345909580747953, 0.7065409041925205])
grid = sin(grid, 12, 4, -1.6398586072056767, 84.51374680259704)
grid = sin(grid, 1, 1, -0.183401440709518, -88.40242580975152)
grid = transit(grid, 12, [3, 13, 2, 9, 0], [0.24803411847529433, 0.2425397323068922, 0.0904752958055755, 0.11683555248582808, 0.30211530092641004])
grid = sin(grid, 5, 2, -2.2972705471452146, -12.522748365129786)
grid = smooth_min(grid, 12, 9, 11)
grid = sin(grid, 4, 15, -1.9527829039221054, 20.537776250912316)
grid = transit(grid, 7, [11, 9, 2], [0.5001532946669459, 0.42070604285213226, 0.07914066248092186])
grid = inverse(grid, 5, 12)
grid = sin(grid, 10, 2, 0.9155140652310594, -34.1653400637653)
grid = transit(grid, 8, [14], [1.0])
grid = transit(grid, 4, [1, 12, 15, 13, 3], [0.32356965941479515, 0.022696478437764827, 0.2132573540073865, 0.11957266769813353, 0.3209038404419199])
grid = transit(grid, 6, [1, 7, 0, 2, 9, 4, 8], [0.06904450551777742, 0.12680650314665426, 0.1756104206123629, 0.013987480750913602, 0.1337935702206657, 0.39097327478734406, 0.08978424496428203])
grid = smooth_min(grid, 9, 9, 10)
grid = shift(grid, 8, 1, -0.2952350240798842)
grid = sin(grid, 11, 6, 1.576100090732909, -21.508000199215132)
grid = shift(grid, 11, 5, 1.0526879494498724)
grid = transit(grid, 1, [14], [1.0])
grid = transit(grid, 8, [9, 10, 2, 15, 13], [0.3265190472987195, 0.21568397721657098, 0.06226802479442838, 0.0028158122366541832, 0.39271313845362693])
grid = magnitude(grid, 11, [13, 10, 12, 2, 11, 14], 2)
grid = transit(grid, 12, [8, 11, 3], [0.2717231795161624, 0.38648847983305307, 0.3417883406507845])
grid = transit(grid, 15, [7, 3], [0.9172074355564371, 0.08279256444356292])
grid = transit(grid, 13, [1, 2, 7, 5, 8, 9, 15], [0.085742434722219, 0.4119764535375412, 0.08377067725345017, 0.13045782410775286, 0.02917564277599849, 0.12489006625007311, 0.13398690135296518])
grid = transit(grid, 2, [2, 0, 11, 10, 5, 4, 15, 13], [0.1869735689344564, 0.06343641920215143, 0.038951322931441136, 0.04613309733662021, 0.19750663742298355, 0.16072124228620793, 0.15869932715876592, 0.14757838472737334])
grid = transit(grid, 2, [1, 7], [0.18247956114317448, 0.8175204388568255])
grid = transit(grid, 8, [11, 15, 0], [0.08195235243098883, 0.6796005904358621, 0.23844705713314918])
grid = power(grid, 14, 0, 0.10854801586669052)
grid = shift(grid, 8, 9, 2.766857264282361)
grid = transit(grid, 3, [6, 14, 0, 3, 15, 4, 2, 11, 13], [0.03597236183123865, 0.04938629068404894, 0.08457069101219464, 0.014801187461296406, 0.3649334871683411, 0.28062233683539095, 0.08637063851194285, 0.06076815802338077, 0.022574848472165728])
grid = transit(grid, 4, [11, 4, 15, 10, 8, 5, 2, 3], [0.23701292672659616, 0.08316792464084911, 0.017867439461611043, 0.36417402420248035, 0.02841485585755143, 0.19916101840344472, 0.03422984110049058, 0.03597196960697647])
grid = magnitude(grid, 13, [11, 7], 2)
grid = sin(grid, 4, 8, 4.28026157040775, -75.14180284322572)
grid = prod(grid, 3, [14, 15])
grid = inverse(grid, 5, 5)
grid = transit(grid, 4, [8, 4, 15, 9, 10], [0.10267794314653868, 0.019022820046952493, 0.061606568183823145, 0.4832751235896067, 0.33341754503307897])
grid = transit(grid, 13, [10, 8, 9, 12, 2], [0.031587088727564654, 0.024264739611302585, 0.0306940545567164, 0.19611241111174804, 0.7173417059926683])
grid = transit(grid, 0, [7, 1, 11, 0, 15], [0.036901331671075975, 0.5054281720479712, 0.13288430351514774, 0.10820806749406277, 0.21657812527174225])
grid = transit(grid, 3, [7, 3, 12, 9], [0.13643904772292245, 0.38438336340747, 0.15936221296996333, 0.31981537589964426])
grid = sin(grid, 10, 3, -2.5681840787633137, -30.256455817944243)
grid = sin(grid, 8, 2, 3.501615294498545, -75.50049353340206)
grid = prod(grid, 9, [1, 4, 0, 6])
grid = transit(grid, 8, [9, 3], [0.30088974760959275, 0.6991102523904072])
grid = transit(grid, 8, [2, 11, 15, 4, 1, 0, 14], [0.29712982335534416, 0.2526657169525107, 0.08415696601637544, 0.18541009701166816, 0.011062110917544764, 0.017334502896306194, 0.1522407828502505])
grid = prod(grid, 2, [8, 7, 11, 10, 15, 0, 5])
grid = transit(grid, 11, [7, 2, 3, 9, 5], [0.24039798004748805, 0.2886075990223525, 0.18742374307846998, 0.11615833154358073, 0.16741234630810867])
grid = prod(grid, 0, [0, 1, 2, 14])
grid = prod(grid, 9, [10, 11, 8, 15, 0, 12, 3])
grid = transit(grid, 13, [5, 15, 10], [0.13237609957996088, 0.22944646977966682, 0.6381774306403722])
grid = transit(grid, 6, [15], [1.0])
grid = sin(grid, 15, 0, -0.033265790773207085, 51.94880270063618)
grid = smooth_min(grid, 13, 10, 15)
grid = transit(grid, 1, [12, 8, 10, 4, 2], [0.43102537693091664, 0.25433300797798253, 0.21618454566402304, 0.046743011673522995, 0.05171405775355483])
grid = sin(grid, 10, 10, 0.9558311639914843, -47.618914508652054)
grid = shift(grid, 9, 8, -1.1449289879251126)
grid = transit(grid, 7, [4, 10, 1, 13, 5, 0, 7, 8, 9, 12, 6, 11, 14], [0.10006330804326793, 0.03891760159161208, 0.005474465860804227, 0.12962618248625338, 0.03090992138168193, 0.016043163973997736, 0.13259375374543056, 0.09920705802758992, 0.1415090600653345, 0.09597789664069131, 0.06106766497801195, 0.14032187015082653, 0.008288053054498123])
grid = prod(grid, 15, [12, 15])
grid = prod(grid, 8, [11, 7, 4, 12])
grid = transit(grid, 7, [15, 6, 2, 7], [0.45073658968521574, 0.16060948991238613, 0.12949271785123345, 0.2591612025511646])
grid = transit(grid, 10, [11, 4, 2, 8, 14], [0.3705316303566195, 0.1755951969700656, 0.043989590834687294, 0.22866693087969006, 0.1812166509589377])
grid = sin(grid, 4, 2, -3.329894296119046, -76.41676919069447)
grid = smooth_min(grid, 11, 8, 12)
grid = transit(grid, 1, [1, 14, 8], [0.38986786543390084, 0.40057743619803005, 0.20955469836806906])
grid = transit(grid, 9, [5], [1.0])
grid = shift(grid, 9, 13, -5.367438086043798)
grid = magnitude(grid, 13, [2, 0], 2)
grid = transit(grid, 13, [6, 2, 3, 15, 5, 7], [0.06492287400539203, 0.21223490901058306, 0.36311130408652753, 0.09994467226348329, 0.12833432959710458, 0.1314519110369097])
grid = transit(grid, 8, [6, 2], [0.6857167761482571, 0.31428322385174284])
grid = shift(grid, 6, 15, 4.115946851379848)
grid = transit(grid, 15, [13, 3], [0.5897775709748927, 0.41022242902510725])
grid = sin(grid, 12, 14, 1.097917736937588, 58.87772371184383)
grid = transit(grid, 11, [9, 11], [0.37033495928182997, 0.6296650407181701])
grid = smooth_min(grid, 4, 1, 8)
grid = sin(grid, 4, 4, 3.47544933993972, -37.11795195118333)
grid = sin(grid, 11, 7, -0.3409112713023047, 75.93313567333723)
grid = transit(grid, 11, [5, 10, 7], [0.22694849313985146, 0.5162695719847235, 0.25678193487542517])
grid = sin(grid, 9, 9, -4.261918262131112, 18.680580924548693)
grid = smooth_max(grid, 2, 2, 11)
grid = sin(grid, 13, 13, 7.718114740496995, 55.242200715207815)
grid = sin(grid, 12, 10, -3.1151555334821888, 17.571856948335267)
grid = prod(grid, 6, [2, 4, 13])
grid = transit(grid, 5, [1, 9, 3, 10, 4], [0.24075568684771534, 0.02527375632067568, 0.4828116495090197, 0.09546712897709621, 0.15569177834549294])
grid = sin(grid, 6, 3, -0.1377650382373763, -96.34412250071645)
grid = sin(grid, 7, 3, 1.6405444007982959, -37.09230830685477)
grid = transit(grid, 9, [8], [1.0])
grid = sin(grid, 5, 10, -1.5052434957207308, 24.900059771988836)
grid = sin(grid, 8, 10, 2.5947698108630664, -90.74050288622541)
grid = sin(grid, 9, 8, -0.8743741598911887, 15.92872484723533)
grid = transit(grid, 4, [3, 13, 9, 8, 5, 2, 12], [0.05731677054419865, 0.08527765171582982, 0.33929504571762287, 0.1932983536368378, 0.0036374435750729187, 0.12289545051895708, 0.19827928429148084])
grid = transit(grid, 8, [13, 9, 5, 7, 14], [0.05801706264076675, 0.341923243761946, 0.0494872820880747, 0.29583940098242745, 0.2547330105267852])
grid = inverse(grid, 11, 5)
grid = magnitude(grid, 14, [4, 6, 1, 0], 2)
grid = transit(grid, 13, [11, 0], [0.6569516962992897, 0.3430483037007103])
grid = sin(grid, 14, 5, 0.053526366336325744, 4.147364704932215)
grid = transit(grid, 4, [3], [1.0])
grid = sin(grid, 3, 12, -4.078686662791614, 24.459526349523884)
grid = inverse(grid, 15, 10)
grid = shift(grid, 6, 1, -1.115193397983063)
grid = smooth_max(grid, 13, 3, 8)
grid = transit(grid, 13, [13, 0, 5, 14], [0.09662806703796267, 0.1621478194912538, 0.21548762580464817, 0.5257364876661353])
grid = inverse(grid, 1, 0)
grid = smooth_max(grid, 1, 15, 12)
grid = prod(grid, 11, [3])
grid = smooth_max(grid, 8, 11, 15)
grid = sin(grid, 12, 6, -3.621533174445339, 24.02414911462421)
grid = sin(grid, 1, 11, 0.5071121900678415, 10.950101187785563)
grid = shift(grid, 13, 3, 5.677279514103952)
grid = transit(grid, 3, [15, 11, 2, 8, 0], [0.28772794692354614, 0.1935939805514465, 0.06024872230823076, 0.13457223936247906, 0.32385711085429764])
grid = transit(grid, 1, [7, 2, 6, 1, 4, 0], [0.2070905138265326, 0.06562120796792839, 0.17355051228662716, 0.05514926535269553, 0.0829726599151083, 0.41561584065110807])
grid = transit(grid, 2, [0, 4, 2], [0.010597803396528332, 0.7371576932264431, 0.25224450337702853])
grid = sin(grid, 11, 8, 4.303514875116891, -67.11152580467314)
grid = prod(grid, 5, [3, 9, 2])
grid = sin(grid, 5, 1, 2.0751861425380627, 63.37681521624819)
grid = smooth_min(grid, 11, 10, 9)
grid = sin(grid, 13, 2, 4.295107938126156, 57.378601701270014)
grid = sin(grid, 10, 2, -0.010214061334835559, 20.43114218394348)
grid = transit(grid, 8, [1], [1.0])
grid = sin(grid, 4, 9, 0.2366252211469413, -40.63773874328931)
grid = sin(grid, 9, 15, -2.507870105026106, -89.43842740853354)
grid = transit(grid, 0, [12, 6, 4, 9, 1, 0, 14], [0.36336761526831185, 0.17372789204937897, 0.08036453739500136, 0.09747098994785518, 0.040818441056887325, 0.16796111771248814, 0.07628940657007711])
grid = transit(grid, 3, [11, 1, 12, 9, 0, 8, 15, 2, 10, 14], [0.20381942291270427, 0.07753380798970702, 0.11445683149439734, 0.08475226158626031, 0.1416941580568898, 0.020968563089492034, 0.0847896752697893, 0.0921589665387646, 0.008240731277180186, 0.17158558178481512])
grid = transit(grid, 5, [11, 10], [0.9817011300708863, 0.018298869929113594])
grid = sin(grid, 14, 8, -0.4693746108213766, -98.17810769380118)
grid = sin(grid, 12, 10, 3.6427863324838423, 99.297524709649)
grid = sin(grid, 5, 14, -1.45141083652418, -99.85812912291547)
grid = transit(grid, 0, [4, 3, 8], [0.23275058190778222, 0.49901982570530873, 0.2682295923869092])
grid = magnitude(grid, 8, [10, 9, 12, 4, 7, 15], 2)
grid = sin(grid, 12, 7, 1.439019575760617, 13.126437741104823)
grid = transit(grid, 10, [15, 8, 13, 2], [0.32464063956303774, 0.20922781529873477, 0.16179927966914437, 0.30433226546908315])
grid = magnitude(grid, 6, [14, 5, 13, 11, 2, 9], 2)
grid = sin(grid, 9, 5, -5.606152225672729, -35.928477282758536)
grid = transit(grid, 0, [7, 11, 15, 8, 12, 0, 4, 14, 3, 5], [0.11084510086381213, 0.003439701966452383, 0.10819642722960272, 0.15371289739415475, 0.25812192912399506, 0.005727171643985687, 0.14633649245899077, 0.033890406689391105, 0.05550396325806974, 0.1242259093715456])
grid = smooth_max(grid, 10, 15, 10)
grid = transit(grid, 11, [9, 0, 11, 7, 3, 8], [0.03500911832175082, 0.03265868671024263, 0.3248025339288217, 0.4234363710484886, 0.13338109758306646, 0.050712192407629864])
grid = transit(grid, 7, [14, 2, 13, 1, 11, 3, 8, 7], [0.207462236904601, 0.11516125867317799, 0.12240760599022518, 0.05066197369764289, 0.13869178538077429, 0.09948828746526778, 0.16686217850764798, 0.09926467338066268])
grid = transit(grid, 6, [6, 13, 7], [0.16813621041531998, 0.42150135317124293, 0.410362436413437])
grid = inverse(grid, 6, 6)
grid = sin(grid, 7, 15, -4.9164570678736865, 86.15931416043557)
grid = sin(grid, 1, 7, 1.6265187305620117, -97.13150019385894)
grid = transit(grid, 11, [0, 9], [0.1290607634325389, 0.8709392365674611])
grid = transit(grid, 14, [14, 13, 15], [0.530662002197574, 0.1082014600047566, 0.36113653779766947])
grid = transit(grid, 14, [10, 14, 4, 9, 13, 6], [0.3199750359220948, 0.07376266150860299, 0.03622483092076182, 0.09070212266434277, 0.4030414045204916, 0.07629394446370606])
grid = magnitude(grid, 13, [7, 4, 15], 2)
grid = transit(grid, 13, [6, 15, 11, 9, 12], [0.21908823570589997, 0.1636179110868493, 0.03797238284324163, 0.29532957711092916, 0.2839918932530799])
grid = sin(grid, 4, 3, 2.634465399239887, 62.07538440217337)
grid = sin(grid, 7, 2, 3.41043792019894, 65.36615977552518)
grid = transit(grid, 0, [14, 3, 11, 10, 7], [0.5203714128788618, 0.068511863728177, 0.10141059844877331, 0.2728285912351676, 0.036877533709020166])
grid = transit(grid, 7, [11], [1.0])
grid = transit(grid, 5, [9, 13, 3, 14], [0.28064413535886806, 0.5181512474389621, 0.1504742947642479, 0.050730322437922])
grid = prod(grid, 1, [12, 13])
grid = sin(grid, 6, 14, -1.927951619591129, -65.3028706482776)
grid = prod(grid, 14, [13])
grid = sin(grid, 1, 12, -0.5111321725063378, 18.261359970959475)
grid = power(grid, 6, 5, 0.9223892145169746)
grid = transit(grid, 2, [9, 11, 10], [0.2662646690994658, 0.2460545507972383, 0.4876807801032959])
grid = transit(grid, 2, [7], [1.0])
grid = sin(grid, 10, 9, 6.219381309190064, -71.03631884776823)
grid = sin(grid, 9, 6, 1.6821417847846682, -64.12547446801875)
grid = sin(grid, 13, 3, -0.15800274281797377, 90.63950889076133)
grid = sin(grid, 14, 14, -1.842523240371888, 74.23947694195837)
grid = inverse(grid, 7, 8)
grid = smooth_max(grid, 10, 3, 15)
grid = magnitude(grid, 9, [15, 7], 2)
grid = transit(grid, 4, [4, 12, 14, 15, 7, 1], [0.20378471182464508, 0.038241020379710625, 0.16903312106740406, 0.3387613981701764, 0.11303295854369695, 0.13714679001436697])
grid = transit(grid, 4, [14, 11, 12, 13, 4, 7], [0.23221079251346607, 0.3307147367708056, 0.26199556841553734, 0.018127231672754242, 0.13788777275073352, 0.01906389787670339])
grid = sin(grid, 4, 7, 3.7705302330112063, 56.91558505626969)
grid = sin(grid, 3, 9, 1.4275963527158242, -76.78247379244436)
grid = sin(grid, 2, 5, -5.225820110717917, 57.71107021356826)
grid = transit(grid, 2, [12], [1.0])
grid = prod(grid, 14, [11, 10])
grid = transit(grid, 2, [0, 15, 10], [0.005204838856346087, 0.5116602651328436, 0.48313489601081044])
grid = transit(grid, 10, [10], [1.0])
grid = transit(grid, 1, [8, 10, 15, 14, 9], [0.33493798319460544, 0.14040206011900094, 0.3010385316537353, 0.07412413198773361, 0.14949729304492473])
grid = magnitude(grid, 10, [11, 0, 5], 2)
grid = magnitude(grid, 9, [15, 3, 11, 0, 14], 2)
grid = sin(grid, 4, 5, -1.8457292172108153, -53.43885199947502)
grid = sin(grid, 10, 0, 7.741409383532979, -12.082110529508299)
grid = prod(grid, 11, [9])
grid = sin(grid, 4, 3, 0.10154488887533689, 12.479110491961137)
grid = magnitude(grid, 1, [7], 2)
grid = smooth_min(grid, 7, 4, 13)
grid = magnitude(grid, 5, [7], 2)
grid = transit(grid, 6, [9, 11, 2, 13], [0.381505247910628, 0.12073241493361198, 0.3454992433435407, 0.15226309381221942])
grid = magnitude(grid, 10, [7, 15, 5], 2)
grid = magnitude(grid, 9, [12, 14, 4], 2)
grid = shift(grid, 3, 9, 3.0393348894939773)
grid = shift(grid, 2, 4, 2.1961962516242517)
grid = prod(grid, 15, [3, 5, 0, 1])
grid = sin(grid, 6, 11, -0.7697482296056479, 23.55348445076298)
grid = sin(grid, 7, 7, 0.5492744322205282, 35.873568370773654)
grid = transit(grid, 7, [13], [1.0])
grid = sin(grid, 3, 12, 6.470760426148978, -53.62090724330151)
grid = sin(grid, 10, 10, 0.7827958631857042, -90.82177259964699)
grid = transit(grid, 6, [8, 6, 5, 7, 4, 2], [0.39579476392315127, 0.3200094081197146, 0.06439062651950353, 0.03284446726347166, 0.04732779189481446, 0.13963294227934445])
grid = smooth_min(grid, 0, 13, 15)
grid = smooth_max(grid, 5, 8, 4)
grid = transit(grid, 10, [1], [1.0])
grid = transit(grid, 15, [15], [1.0])
grid = prod(grid, 13, [6, 3, 7])
grid = sin(grid, 0, 3, -3.561651028660104, 11.539889679902203)
grid = power(grid, 10, 5, 0.12539493928522222)
grid = power(grid, 0, 12, 2.5526439221510495)
grid = sin(grid, 4, 10, -3.680544885171134, 30.633332441673872)
grid = transit(grid, 11, [12, 6, 9], [0.1597221050818672, 0.523275926379751, 0.31700196853838186])
grid = sin(grid, 14, 7, 5.409920766787869, -58.09956716630187)
grid = sin(grid, 2, 15, -2.5319898824657017, -45.01904701883333)
grid = shift(grid, 5, 5, 3.1584260780059252)
grid = transit(grid, 10, [9, 8], [0.7777441717493406, 0.22225582825065934])
grid = transit(grid, 3, [9], [1.0])
grid = transit(grid, 11, [2], [1.0])
#create color space
def shift_colors(x, shift):
res = x.copy()
for i in range(x.shape[-1]):
if shift[i] > 0: res[:,:,i] = (-np.abs(((x[:,:,i] + 1) / 2) ** (1 + shift[i]) - 1) ** (1 / (1 + shift[i])) + 1) * 2 - 1
if shift[i] < 0: res[:,:,i] = np.abs((1 - (x [:,:,i]+ 1) / 2) ** (1 - shift[i]) - 1) ** (1 / (1 - shift[i])) * 2 - 1
return test_values(res)
res = np.zeros((SIZE, SIZE, 3))
res += shift_colors(grid[:,:,0:1].repeat(3, -1), [1.9355805467383669, 1.4677093499726706, 1.2451388311186942])
res = res / 1
res = ((res + 1) / 2 * 255).clip(0,255)
#save results
im = Image.fromarray(np.uint8(res))
im.save(os.path.basename(__file__) + '.png')
#save layers
img = np.zeros((SIZE * 4, SIZE * 4))
for j in range(GRID_CHANNELS):
x = j % 4
y = j // 4
img[x*SIZE:(x + 1)*SIZE, y*SIZE:(y+1)*SIZE] = grid[:,:,j]
img = (img + 1) * 127.5
im = Image.fromarray(np.uint8(img))
im.save(os.path.basename(__file__) + '_layers.png')
| # This program was generated by "Generative Art Synthesizer"
# Generation date: 2021-11-28 09:21:40 UTC
# GAS change date: 2021-11-28 09:20:21 UTC
# GAS md5 hash: ad55481e87ca5a7e9a8e92cd336d1cad
# Python version: 3.7.9 (tags/v3.7.9:13c94747c7, Aug 17 2020, 18:58:18) [MSC v.1900 64 bit (AMD64)]
# For more information visit: https://github.com/volotat/GAS
#import python libraries
import os #OS version: default
import numpy as np #Numpy version: 1.19.5
from PIL import Image #PIL version: 8.1.2
#set initial params
SIZE = 768
GRID_CHANNELS = 16
def test_values(arr):
if np.isnan(arr).any():
raise Exception('Array has None elements!')
if np.amin(arr) < -1 or np.amax(arr) > 1:
raise Exception('Values went to far! [ %.2f : %.2f ]'%(np.amin(arr), np.amax(arr)) )
return arr
#define grid transformation methods
def transit(x, t_indx, s_indx, alphas):
res = x.copy()
res[:,:,t_indx] = np.sum(x[:,:,s_indx] * alphas, axis = -1)
return test_values(res.clip(-1,1))
def sin(x, t_indx, s_indx, scale = 1, shift = 0):
res = x.copy()
res[:,:,t_indx] = np.sin(x[:,:,s_indx] * 0.5 * np.pi * scale + shift)
return test_values(res)
def magnitude(x, t_indx, s_indx, ord = 2):
res = x.copy()
res[:,:,t_indx] = np.linalg.norm(x[:,:,s_indx], axis = -1, ord = ord) / np.sqrt(len(s_indx))
return test_values(res)
def shift(x, t_indx, s_indx, shift):
res = x.copy()
if shift > 0: res[:,:,t_indx] = (-np.abs(((x[:,:,s_indx] + 1) / 2) ** (1 + shift) - 1) ** (1 / (1 + shift)) + 1) * 2 - 1
if shift < 0: res[:,:,t_indx] = np.abs((1 - (x[:,:,s_indx] + 1) / 2) ** (1 - shift) - 1) ** (1 / (1 - shift)) * 2 - 1
return test_values(res)
def inverse(x, t_indx, s_indx):
res = x.copy()
res[:,:,t_indx] = -x[:,:,s_indx]
return test_values(res)
def smooth_max(x, t_indx, s1_indx, s2_indx, p = 10):
res = x.copy()
res[:,:,t_indx] = np.log((np.exp(x[:,:,s1_indx] * p) + np.exp(x[:,:,s2_indx] * p)) ** (1/p)) / 1.07
return test_values(res)
def smooth_min(x, t_indx, s1_indx, s2_indx, p = 10):
res = x.copy()
res[:,:,t_indx] = -np.log((np.exp(-x[:,:,s1_indx] * p) + np.exp(-x[:,:,s2_indx] * p)) ** (1/p)) / 1.07
return test_values(res)
def prod(x, t_indx, s_indx):
res = x.copy()
res[:,:,t_indx] = np.prod(x[:,:,s_indx], -1)
return test_values(res)
def power(x, t_indx, s_indx, p = 1):
res = x.copy()
res[:,:,t_indx] = np.sign(x[:,:,s_indx]) * np.abs(x[:,:,s_indx]) ** p
return test_values(res)
#set initial grid
grid = np.zeros((SIZE, SIZE, GRID_CHANNELS))
x = ((np.arange(SIZE)/(SIZE-1) - 0.5) * 2).reshape((1, SIZE)).repeat(SIZE, 0)
y = ((np.arange(SIZE)/(SIZE-1) - 0.5) * 2).reshape((SIZE, 1)).repeat(SIZE, 1)
grid[:,:,0] = (x * 0.9386329219527516 + y * -0.45147169454413794) / 2
grid[:,:,1] = (x * 0.8090860808441245 + y * 0.2914526739617249) / 2
grid[:,:,2] = (x * 0.9804797761207309 + y * -0.5063344373124843) / 2
grid[:,:,3] = (x * -0.8484277738516293 + y * -0.5155435342135386) / 2
grid[:,:,4] = (x * -0.6644350461377522 + y * 0.1739322518414499) / 2
grid[:,:,5] = (x * -0.5986715486203882 + y * 0.9515468928881716) / 2
grid[:,:,6] = (x * 0.2265055481768512 + y * 0.4365452266748293) / 2
grid[:,:,7] = (x * 0.5049774961793401 + y * 0.05113255120007798) / 2
grid[:,:,8] = (x * -0.3391983246964396 + y * -0.5135707069423852) / 2
grid[:,:,9] = (x * -0.4075423366723827 + y * 0.5388833863473126) / 2
grid[:,:,10] = (x * -0.4262457935185371 + y * -0.6817079327248272) / 2
grid[:,:,11] = (x * 0.8435706697714382 + y * 0.7746597063144072) / 2
grid[:,:,12] = (x * -0.5303146721156469 + y * -0.41048419195488317) / 2
grid[:,:,13] = (x * -0.5864100240508576 + y * -0.9425245660964123) / 2
grid[:,:,14] = (x * -0.7665883618456049 + y * -0.3867357840809138) / 2
grid[:,:,15] = (x * 0.49037959172682255 + y * -0.7671554143072785) / 2
#apply transformations to the grid
grid = transit(grid, 4, [7, 6, 12, 8, 9, 0, 1], [0.05863158300898051, 0.3467981515651057, 0.262107802795733, 0.038001653167336905, 0.2112967596903696, 0.002128256606899112, 0.08103579316557531])
grid = shift(grid, 3, 3, 2.4622222565241207)
grid = sin(grid, 10, 0, 0.5112825397666086, 37.95950546335726)
grid = sin(grid, 12, 13, 3.6938747278005737, 76.37702042567852)
grid = magnitude(grid, 15, [5, 3, 8, 0, 15], 2)
grid = prod(grid, 2, [3, 11, 1])
grid = smooth_min(grid, 3, 2, 7)
grid = smooth_max(grid, 8, 10, 6)
grid = prod(grid, 3, [2, 6, 10, 7, 4])
grid = smooth_min(grid, 7, 12, 0)
grid = transit(grid, 2, [1, 2], [0.9078557995211777, 0.09214420047882232])
grid = smooth_max(grid, 1, 0, 1)
grid = sin(grid, 9, 4, 3.0281102269529683, 11.185401112275173)
grid = sin(grid, 10, 4, 1.2844464834351186, -45.836492724169695)
grid = sin(grid, 1, 2, -1.5301674594368837, -60.29431568717391)
grid = transit(grid, 2, [13, 11, 5], [0.421270391024163, 0.5054038923567993, 0.07332571661903758])
grid = transit(grid, 11, [1, 15, 5, 0, 6, 12, 2, 7, 4], [0.03047869593495055, 0.024092687676923453, 0.02665655056773558, 0.17667886361751853, 0.15211061797378253, 0.016462544099609754, 0.0072484377164178625, 0.4477791048998878, 0.11849249751317383])
grid = transit(grid, 10, [5, 11, 15, 8, 2, 13, 12, 3, 6], [0.1020239434902293, 0.05405846145210329, 0.11525379082942891, 0.11556721863292163, 0.12372657123165616, 0.1356897031789931, 0.20047556686480725, 0.09921434949484752, 0.05399039482501285])
grid = transit(grid, 9, [5], [1.0])
grid = transit(grid, 15, [12, 0, 1, 11], [0.01847979792505241, 0.33442336387003857, 0.15192425697494277, 0.4951725812299663])
grid = sin(grid, 4, 8, 3.386521226555936, 60.95572898751007)
grid = shift(grid, 14, 2, 2.55681173849493)
grid = sin(grid, 10, 14, 0.8649185298731181, 3.1973516320924773)
grid = sin(grid, 9, 7, -2.4657577404884132, 72.95418196004374)
grid = transit(grid, 12, [7, 4, 10, 5], [0.5076634403621766, 0.003404332378773421, 0.04142944289977586, 0.4475027843592742])
grid = inverse(grid, 4, 5)
grid = transit(grid, 1, [4, 14, 0, 13], [0.2785496566747933, 0.004915230889640017, 0.30146401859790545, 0.4150710938376613])
grid = sin(grid, 3, 11, -6.496603906160505, -73.75617586359363)
grid = transit(grid, 6, [6, 14], [0.7201753385758813, 0.2798246614241187])
grid = prod(grid, 4, [10, 0, 2, 4, 8, 5, 6, 7])
grid = transit(grid, 8, [3], [1.0])
grid = inverse(grid, 8, 5)
grid = smooth_max(grid, 10, 5, 13)
grid = sin(grid, 9, 10, -1.8565532127479274, -54.75186223635349)
grid = transit(grid, 10, [14], [1.0])
grid = transit(grid, 15, [11, 4, 10], [0.6926745567135898, 0.1831142410590532, 0.12421120222735695])
grid = magnitude(grid, 7, [6, 12, 7, 13, 8], 2)
grid = transit(grid, 8, [3, 15, 9, 6, 11], [0.036102265915692405, 0.1224495166624379, 0.2384660328868578, 0.3357862916746864, 0.2671958928603256])
grid = smooth_min(grid, 1, 1, 11)
grid = transit(grid, 5, [11, 4, 2, 1, 13, 12, 0, 8], [0.08486049729383285, 0.15069099224942706, 0.024923245737924458, 0.07191051851248272, 0.25942601829807205, 0.16834508849259286, 0.14540219911263502, 0.094441440303033])
grid = transit(grid, 11, [12], [1.0])
grid = power(grid, 3, 5, 0.10200689258338674)
grid = transit(grid, 2, [10, 11, 4, 15, 0, 6], [0.24973877983541862, 0.3378766591098989, 0.15974656746239488, 0.027776085211312595, 0.02330072841260748, 0.20156117996836745])
grid = smooth_min(grid, 0, 5, 1)
grid = magnitude(grid, 0, [5, 0], 2)
grid = transit(grid, 6, [15, 8], [0.5303803951305812, 0.4696196048694189])
grid = inverse(grid, 0, 0)
grid = magnitude(grid, 13, [8], 2)
grid = transit(grid, 13, [15, 5, 9, 4, 6, 12], [0.18067242214638962, 0.12939497982917472, 0.08164480089591167, 0.24583958083442445, 0.2244518823086713, 0.13799633398542827])
grid = transit(grid, 11, [0], [1.0])
grid = magnitude(grid, 0, [4, 13], 2)
grid = transit(grid, 8, [5, 4, 15, 6, 14, 0, 3, 11], [0.13835365002720226, 0.008781149737259792, 0.24627334258742545, 0.04870190081124998, 0.049950480577274, 0.15123046752435387, 0.31255198044446264, 0.04415702829077187])
grid = transit(grid, 1, [3], [1.0])
grid = magnitude(grid, 14, [4], 2)
grid = sin(grid, 1, 5, 8.18216846853571, -6.729427492311089)
grid = magnitude(grid, 11, [8, 2], 2)
grid = transit(grid, 7, [12, 11, 13, 4], [0.1713900685471786, 0.14082681623065177, 0.19859698568682838, 0.4891861295353413])
grid = transit(grid, 13, [12, 15, 9, 2, 0, 1, 5], [0.18796556626817826, 0.19260744772691155, 0.11226112831146452, 0.08161640805634696, 0.08706050582840198, 0.2243337708440404, 0.11415517296465624])
grid = sin(grid, 11, 13, -6.909579361872105, 70.84834564082374)
grid = transit(grid, 2, [11, 7, 13], [0.3629247592109436, 0.10073172896374764, 0.5363435118253088])
grid = sin(grid, 1, 5, 0.6814927249849106, 30.75954926767548)
grid = inverse(grid, 8, 7)
grid = prod(grid, 10, [5, 2])
grid = transit(grid, 15, [0, 3], [0.29345909580747953, 0.7065409041925205])
grid = sin(grid, 12, 4, -1.6398586072056767, 84.51374680259704)
grid = sin(grid, 1, 1, -0.183401440709518, -88.40242580975152)
grid = transit(grid, 12, [3, 13, 2, 9, 0], [0.24803411847529433, 0.2425397323068922, 0.0904752958055755, 0.11683555248582808, 0.30211530092641004])
grid = sin(grid, 5, 2, -2.2972705471452146, -12.522748365129786)
grid = smooth_min(grid, 12, 9, 11)
grid = sin(grid, 4, 15, -1.9527829039221054, 20.537776250912316)
grid = transit(grid, 7, [11, 9, 2], [0.5001532946669459, 0.42070604285213226, 0.07914066248092186])
grid = inverse(grid, 5, 12)
grid = sin(grid, 10, 2, 0.9155140652310594, -34.1653400637653)
grid = transit(grid, 8, [14], [1.0])
grid = transit(grid, 4, [1, 12, 15, 13, 3], [0.32356965941479515, 0.022696478437764827, 0.2132573540073865, 0.11957266769813353, 0.3209038404419199])
grid = transit(grid, 6, [1, 7, 0, 2, 9, 4, 8], [0.06904450551777742, 0.12680650314665426, 0.1756104206123629, 0.013987480750913602, 0.1337935702206657, 0.39097327478734406, 0.08978424496428203])
grid = smooth_min(grid, 9, 9, 10)
grid = shift(grid, 8, 1, -0.2952350240798842)
grid = sin(grid, 11, 6, 1.576100090732909, -21.508000199215132)
grid = shift(grid, 11, 5, 1.0526879494498724)
grid = transit(grid, 1, [14], [1.0])
grid = transit(grid, 8, [9, 10, 2, 15, 13], [0.3265190472987195, 0.21568397721657098, 0.06226802479442838, 0.0028158122366541832, 0.39271313845362693])
grid = magnitude(grid, 11, [13, 10, 12, 2, 11, 14], 2)
grid = transit(grid, 12, [8, 11, 3], [0.2717231795161624, 0.38648847983305307, 0.3417883406507845])
grid = transit(grid, 15, [7, 3], [0.9172074355564371, 0.08279256444356292])
grid = transit(grid, 13, [1, 2, 7, 5, 8, 9, 15], [0.085742434722219, 0.4119764535375412, 0.08377067725345017, 0.13045782410775286, 0.02917564277599849, 0.12489006625007311, 0.13398690135296518])
grid = transit(grid, 2, [2, 0, 11, 10, 5, 4, 15, 13], [0.1869735689344564, 0.06343641920215143, 0.038951322931441136, 0.04613309733662021, 0.19750663742298355, 0.16072124228620793, 0.15869932715876592, 0.14757838472737334])
grid = transit(grid, 2, [1, 7], [0.18247956114317448, 0.8175204388568255])
grid = transit(grid, 8, [11, 15, 0], [0.08195235243098883, 0.6796005904358621, 0.23844705713314918])
grid = power(grid, 14, 0, 0.10854801586669052)
grid = shift(grid, 8, 9, 2.766857264282361)
grid = transit(grid, 3, [6, 14, 0, 3, 15, 4, 2, 11, 13], [0.03597236183123865, 0.04938629068404894, 0.08457069101219464, 0.014801187461296406, 0.3649334871683411, 0.28062233683539095, 0.08637063851194285, 0.06076815802338077, 0.022574848472165728])
grid = transit(grid, 4, [11, 4, 15, 10, 8, 5, 2, 3], [0.23701292672659616, 0.08316792464084911, 0.017867439461611043, 0.36417402420248035, 0.02841485585755143, 0.19916101840344472, 0.03422984110049058, 0.03597196960697647])
grid = magnitude(grid, 13, [11, 7], 2)
grid = sin(grid, 4, 8, 4.28026157040775, -75.14180284322572)
grid = prod(grid, 3, [14, 15])
grid = inverse(grid, 5, 5)
grid = transit(grid, 4, [8, 4, 15, 9, 10], [0.10267794314653868, 0.019022820046952493, 0.061606568183823145, 0.4832751235896067, 0.33341754503307897])
grid = transit(grid, 13, [10, 8, 9, 12, 2], [0.031587088727564654, 0.024264739611302585, 0.0306940545567164, 0.19611241111174804, 0.7173417059926683])
grid = transit(grid, 0, [7, 1, 11, 0, 15], [0.036901331671075975, 0.5054281720479712, 0.13288430351514774, 0.10820806749406277, 0.21657812527174225])
grid = transit(grid, 3, [7, 3, 12, 9], [0.13643904772292245, 0.38438336340747, 0.15936221296996333, 0.31981537589964426])
grid = sin(grid, 10, 3, -2.5681840787633137, -30.256455817944243)
grid = sin(grid, 8, 2, 3.501615294498545, -75.50049353340206)
grid = prod(grid, 9, [1, 4, 0, 6])
grid = transit(grid, 8, [9, 3], [0.30088974760959275, 0.6991102523904072])
grid = transit(grid, 8, [2, 11, 15, 4, 1, 0, 14], [0.29712982335534416, 0.2526657169525107, 0.08415696601637544, 0.18541009701166816, 0.011062110917544764, 0.017334502896306194, 0.1522407828502505])
grid = prod(grid, 2, [8, 7, 11, 10, 15, 0, 5])
grid = transit(grid, 11, [7, 2, 3, 9, 5], [0.24039798004748805, 0.2886075990223525, 0.18742374307846998, 0.11615833154358073, 0.16741234630810867])
grid = prod(grid, 0, [0, 1, 2, 14])
grid = prod(grid, 9, [10, 11, 8, 15, 0, 12, 3])
grid = transit(grid, 13, [5, 15, 10], [0.13237609957996088, 0.22944646977966682, 0.6381774306403722])
grid = transit(grid, 6, [15], [1.0])
grid = sin(grid, 15, 0, -0.033265790773207085, 51.94880270063618)
grid = smooth_min(grid, 13, 10, 15)
grid = transit(grid, 1, [12, 8, 10, 4, 2], [0.43102537693091664, 0.25433300797798253, 0.21618454566402304, 0.046743011673522995, 0.05171405775355483])
grid = sin(grid, 10, 10, 0.9558311639914843, -47.618914508652054)
grid = shift(grid, 9, 8, -1.1449289879251126)
grid = transit(grid, 7, [4, 10, 1, 13, 5, 0, 7, 8, 9, 12, 6, 11, 14], [0.10006330804326793, 0.03891760159161208, 0.005474465860804227, 0.12962618248625338, 0.03090992138168193, 0.016043163973997736, 0.13259375374543056, 0.09920705802758992, 0.1415090600653345, 0.09597789664069131, 0.06106766497801195, 0.14032187015082653, 0.008288053054498123])
grid = prod(grid, 15, [12, 15])
grid = prod(grid, 8, [11, 7, 4, 12])
grid = transit(grid, 7, [15, 6, 2, 7], [0.45073658968521574, 0.16060948991238613, 0.12949271785123345, 0.2591612025511646])
grid = transit(grid, 10, [11, 4, 2, 8, 14], [0.3705316303566195, 0.1755951969700656, 0.043989590834687294, 0.22866693087969006, 0.1812166509589377])
grid = sin(grid, 4, 2, -3.329894296119046, -76.41676919069447)
grid = smooth_min(grid, 11, 8, 12)
grid = transit(grid, 1, [1, 14, 8], [0.38986786543390084, 0.40057743619803005, 0.20955469836806906])
grid = transit(grid, 9, [5], [1.0])
grid = shift(grid, 9, 13, -5.367438086043798)
grid = magnitude(grid, 13, [2, 0], 2)
grid = transit(grid, 13, [6, 2, 3, 15, 5, 7], [0.06492287400539203, 0.21223490901058306, 0.36311130408652753, 0.09994467226348329, 0.12833432959710458, 0.1314519110369097])
grid = transit(grid, 8, [6, 2], [0.6857167761482571, 0.31428322385174284])
grid = shift(grid, 6, 15, 4.115946851379848)
grid = transit(grid, 15, [13, 3], [0.5897775709748927, 0.41022242902510725])
grid = sin(grid, 12, 14, 1.097917736937588, 58.87772371184383)
grid = transit(grid, 11, [9, 11], [0.37033495928182997, 0.6296650407181701])
grid = smooth_min(grid, 4, 1, 8)
grid = sin(grid, 4, 4, 3.47544933993972, -37.11795195118333)
grid = sin(grid, 11, 7, -0.3409112713023047, 75.93313567333723)
grid = transit(grid, 11, [5, 10, 7], [0.22694849313985146, 0.5162695719847235, 0.25678193487542517])
grid = sin(grid, 9, 9, -4.261918262131112, 18.680580924548693)
grid = smooth_max(grid, 2, 2, 11)
grid = sin(grid, 13, 13, 7.718114740496995, 55.242200715207815)
grid = sin(grid, 12, 10, -3.1151555334821888, 17.571856948335267)
grid = prod(grid, 6, [2, 4, 13])
grid = transit(grid, 5, [1, 9, 3, 10, 4], [0.24075568684771534, 0.02527375632067568, 0.4828116495090197, 0.09546712897709621, 0.15569177834549294])
grid = sin(grid, 6, 3, -0.1377650382373763, -96.34412250071645)
grid = sin(grid, 7, 3, 1.6405444007982959, -37.09230830685477)
grid = transit(grid, 9, [8], [1.0])
grid = sin(grid, 5, 10, -1.5052434957207308, 24.900059771988836)
grid = sin(grid, 8, 10, 2.5947698108630664, -90.74050288622541)
grid = sin(grid, 9, 8, -0.8743741598911887, 15.92872484723533)
grid = transit(grid, 4, [3, 13, 9, 8, 5, 2, 12], [0.05731677054419865, 0.08527765171582982, 0.33929504571762287, 0.1932983536368378, 0.0036374435750729187, 0.12289545051895708, 0.19827928429148084])
grid = transit(grid, 8, [13, 9, 5, 7, 14], [0.05801706264076675, 0.341923243761946, 0.0494872820880747, 0.29583940098242745, 0.2547330105267852])
grid = inverse(grid, 11, 5)
grid = magnitude(grid, 14, [4, 6, 1, 0], 2)
grid = transit(grid, 13, [11, 0], [0.6569516962992897, 0.3430483037007103])
grid = sin(grid, 14, 5, 0.053526366336325744, 4.147364704932215)
grid = transit(grid, 4, [3], [1.0])
grid = sin(grid, 3, 12, -4.078686662791614, 24.459526349523884)
grid = inverse(grid, 15, 10)
grid = shift(grid, 6, 1, -1.115193397983063)
grid = smooth_max(grid, 13, 3, 8)
grid = transit(grid, 13, [13, 0, 5, 14], [0.09662806703796267, 0.1621478194912538, 0.21548762580464817, 0.5257364876661353])
grid = inverse(grid, 1, 0)
grid = smooth_max(grid, 1, 15, 12)
grid = prod(grid, 11, [3])
grid = smooth_max(grid, 8, 11, 15)
grid = sin(grid, 12, 6, -3.621533174445339, 24.02414911462421)
grid = sin(grid, 1, 11, 0.5071121900678415, 10.950101187785563)
grid = shift(grid, 13, 3, 5.677279514103952)
grid = transit(grid, 3, [15, 11, 2, 8, 0], [0.28772794692354614, 0.1935939805514465, 0.06024872230823076, 0.13457223936247906, 0.32385711085429764])
grid = transit(grid, 1, [7, 2, 6, 1, 4, 0], [0.2070905138265326, 0.06562120796792839, 0.17355051228662716, 0.05514926535269553, 0.0829726599151083, 0.41561584065110807])
grid = transit(grid, 2, [0, 4, 2], [0.010597803396528332, 0.7371576932264431, 0.25224450337702853])
grid = sin(grid, 11, 8, 4.303514875116891, -67.11152580467314)
grid = prod(grid, 5, [3, 9, 2])
grid = sin(grid, 5, 1, 2.0751861425380627, 63.37681521624819)
grid = smooth_min(grid, 11, 10, 9)
grid = sin(grid, 13, 2, 4.295107938126156, 57.378601701270014)
grid = sin(grid, 10, 2, -0.010214061334835559, 20.43114218394348)
grid = transit(grid, 8, [1], [1.0])
grid = sin(grid, 4, 9, 0.2366252211469413, -40.63773874328931)
grid = sin(grid, 9, 15, -2.507870105026106, -89.43842740853354)
grid = transit(grid, 0, [12, 6, 4, 9, 1, 0, 14], [0.36336761526831185, 0.17372789204937897, 0.08036453739500136, 0.09747098994785518, 0.040818441056887325, 0.16796111771248814, 0.07628940657007711])
grid = transit(grid, 3, [11, 1, 12, 9, 0, 8, 15, 2, 10, 14], [0.20381942291270427, 0.07753380798970702, 0.11445683149439734, 0.08475226158626031, 0.1416941580568898, 0.020968563089492034, 0.0847896752697893, 0.0921589665387646, 0.008240731277180186, 0.17158558178481512])
grid = transit(grid, 5, [11, 10], [0.9817011300708863, 0.018298869929113594])
grid = sin(grid, 14, 8, -0.4693746108213766, -98.17810769380118)
grid = sin(grid, 12, 10, 3.6427863324838423, 99.297524709649)
grid = sin(grid, 5, 14, -1.45141083652418, -99.85812912291547)
grid = transit(grid, 0, [4, 3, 8], [0.23275058190778222, 0.49901982570530873, 0.2682295923869092])
grid = magnitude(grid, 8, [10, 9, 12, 4, 7, 15], 2)
grid = sin(grid, 12, 7, 1.439019575760617, 13.126437741104823)
grid = transit(grid, 10, [15, 8, 13, 2], [0.32464063956303774, 0.20922781529873477, 0.16179927966914437, 0.30433226546908315])
grid = magnitude(grid, 6, [14, 5, 13, 11, 2, 9], 2)
grid = sin(grid, 9, 5, -5.606152225672729, -35.928477282758536)
grid = transit(grid, 0, [7, 11, 15, 8, 12, 0, 4, 14, 3, 5], [0.11084510086381213, 0.003439701966452383, 0.10819642722960272, 0.15371289739415475, 0.25812192912399506, 0.005727171643985687, 0.14633649245899077, 0.033890406689391105, 0.05550396325806974, 0.1242259093715456])
grid = smooth_max(grid, 10, 15, 10)
grid = transit(grid, 11, [9, 0, 11, 7, 3, 8], [0.03500911832175082, 0.03265868671024263, 0.3248025339288217, 0.4234363710484886, 0.13338109758306646, 0.050712192407629864])
grid = transit(grid, 7, [14, 2, 13, 1, 11, 3, 8, 7], [0.207462236904601, 0.11516125867317799, 0.12240760599022518, 0.05066197369764289, 0.13869178538077429, 0.09948828746526778, 0.16686217850764798, 0.09926467338066268])
grid = transit(grid, 6, [6, 13, 7], [0.16813621041531998, 0.42150135317124293, 0.410362436413437])
grid = inverse(grid, 6, 6)
grid = sin(grid, 7, 15, -4.9164570678736865, 86.15931416043557)
grid = sin(grid, 1, 7, 1.6265187305620117, -97.13150019385894)
grid = transit(grid, 11, [0, 9], [0.1290607634325389, 0.8709392365674611])
grid = transit(grid, 14, [14, 13, 15], [0.530662002197574, 0.1082014600047566, 0.36113653779766947])
grid = transit(grid, 14, [10, 14, 4, 9, 13, 6], [0.3199750359220948, 0.07376266150860299, 0.03622483092076182, 0.09070212266434277, 0.4030414045204916, 0.07629394446370606])
grid = magnitude(grid, 13, [7, 4, 15], 2)
grid = transit(grid, 13, [6, 15, 11, 9, 12], [0.21908823570589997, 0.1636179110868493, 0.03797238284324163, 0.29532957711092916, 0.2839918932530799])
grid = sin(grid, 4, 3, 2.634465399239887, 62.07538440217337)
grid = sin(grid, 7, 2, 3.41043792019894, 65.36615977552518)
grid = transit(grid, 0, [14, 3, 11, 10, 7], [0.5203714128788618, 0.068511863728177, 0.10141059844877331, 0.2728285912351676, 0.036877533709020166])
grid = transit(grid, 7, [11], [1.0])
grid = transit(grid, 5, [9, 13, 3, 14], [0.28064413535886806, 0.5181512474389621, 0.1504742947642479, 0.050730322437922])
grid = prod(grid, 1, [12, 13])
grid = sin(grid, 6, 14, -1.927951619591129, -65.3028706482776)
grid = prod(grid, 14, [13])
grid = sin(grid, 1, 12, -0.5111321725063378, 18.261359970959475)
grid = power(grid, 6, 5, 0.9223892145169746)
grid = transit(grid, 2, [9, 11, 10], [0.2662646690994658, 0.2460545507972383, 0.4876807801032959])
grid = transit(grid, 2, [7], [1.0])
grid = sin(grid, 10, 9, 6.219381309190064, -71.03631884776823)
grid = sin(grid, 9, 6, 1.6821417847846682, -64.12547446801875)
grid = sin(grid, 13, 3, -0.15800274281797377, 90.63950889076133)
grid = sin(grid, 14, 14, -1.842523240371888, 74.23947694195837)
grid = inverse(grid, 7, 8)
grid = smooth_max(grid, 10, 3, 15)
grid = magnitude(grid, 9, [15, 7], 2)
grid = transit(grid, 4, [4, 12, 14, 15, 7, 1], [0.20378471182464508, 0.038241020379710625, 0.16903312106740406, 0.3387613981701764, 0.11303295854369695, 0.13714679001436697])
grid = transit(grid, 4, [14, 11, 12, 13, 4, 7], [0.23221079251346607, 0.3307147367708056, 0.26199556841553734, 0.018127231672754242, 0.13788777275073352, 0.01906389787670339])
grid = sin(grid, 4, 7, 3.7705302330112063, 56.91558505626969)
grid = sin(grid, 3, 9, 1.4275963527158242, -76.78247379244436)
grid = sin(grid, 2, 5, -5.225820110717917, 57.71107021356826)
grid = transit(grid, 2, [12], [1.0])
grid = prod(grid, 14, [11, 10])
grid = transit(grid, 2, [0, 15, 10], [0.005204838856346087, 0.5116602651328436, 0.48313489601081044])
grid = transit(grid, 10, [10], [1.0])
grid = transit(grid, 1, [8, 10, 15, 14, 9], [0.33493798319460544, 0.14040206011900094, 0.3010385316537353, 0.07412413198773361, 0.14949729304492473])
grid = magnitude(grid, 10, [11, 0, 5], 2)
grid = magnitude(grid, 9, [15, 3, 11, 0, 14], 2)
grid = sin(grid, 4, 5, -1.8457292172108153, -53.43885199947502)
grid = sin(grid, 10, 0, 7.741409383532979, -12.082110529508299)
grid = prod(grid, 11, [9])
grid = sin(grid, 4, 3, 0.10154488887533689, 12.479110491961137)
grid = magnitude(grid, 1, [7], 2)
grid = smooth_min(grid, 7, 4, 13)
grid = magnitude(grid, 5, [7], 2)
grid = transit(grid, 6, [9, 11, 2, 13], [0.381505247910628, 0.12073241493361198, 0.3454992433435407, 0.15226309381221942])
grid = magnitude(grid, 10, [7, 15, 5], 2)
grid = magnitude(grid, 9, [12, 14, 4], 2)
grid = shift(grid, 3, 9, 3.0393348894939773)
grid = shift(grid, 2, 4, 2.1961962516242517)
grid = prod(grid, 15, [3, 5, 0, 1])
grid = sin(grid, 6, 11, -0.7697482296056479, 23.55348445076298)
grid = sin(grid, 7, 7, 0.5492744322205282, 35.873568370773654)
grid = transit(grid, 7, [13], [1.0])
grid = sin(grid, 3, 12, 6.470760426148978, -53.62090724330151)
grid = sin(grid, 10, 10, 0.7827958631857042, -90.82177259964699)
grid = transit(grid, 6, [8, 6, 5, 7, 4, 2], [0.39579476392315127, 0.3200094081197146, 0.06439062651950353, 0.03284446726347166, 0.04732779189481446, 0.13963294227934445])
grid = smooth_min(grid, 0, 13, 15)
grid = smooth_max(grid, 5, 8, 4)
grid = transit(grid, 10, [1], [1.0])
grid = transit(grid, 15, [15], [1.0])
grid = prod(grid, 13, [6, 3, 7])
grid = sin(grid, 0, 3, -3.561651028660104, 11.539889679902203)
grid = power(grid, 10, 5, 0.12539493928522222)
grid = power(grid, 0, 12, 2.5526439221510495)
grid = sin(grid, 4, 10, -3.680544885171134, 30.633332441673872)
grid = transit(grid, 11, [12, 6, 9], [0.1597221050818672, 0.523275926379751, 0.31700196853838186])
grid = sin(grid, 14, 7, 5.409920766787869, -58.09956716630187)
grid = sin(grid, 2, 15, -2.5319898824657017, -45.01904701883333)
grid = shift(grid, 5, 5, 3.1584260780059252)
grid = transit(grid, 10, [9, 8], [0.7777441717493406, 0.22225582825065934])
grid = transit(grid, 3, [9], [1.0])
grid = transit(grid, 11, [2], [1.0])
#create color space
def shift_colors(x, shift):
res = x.copy()
for i in range(x.shape[-1]):
if shift[i] > 0: res[:,:,i] = (-np.abs(((x[:,:,i] + 1) / 2) ** (1 + shift[i]) - 1) ** (1 / (1 + shift[i])) + 1) * 2 - 1
if shift[i] < 0: res[:,:,i] = np.abs((1 - (x [:,:,i]+ 1) / 2) ** (1 - shift[i]) - 1) ** (1 / (1 - shift[i])) * 2 - 1
return test_values(res)
res = np.zeros((SIZE, SIZE, 3))
res += shift_colors(grid[:,:,0:1].repeat(3, -1), [1.9355805467383669, 1.4677093499726706, 1.2451388311186942])
res = res / 1
res = ((res + 1) / 2 * 255).clip(0,255)
#save results
im = Image.fromarray(np.uint8(res))
im.save(os.path.basename(__file__) + '.png')
#save layers
img = np.zeros((SIZE * 4, SIZE * 4))
for j in range(GRID_CHANNELS):
x = j % 4
y = j // 4
img[x*SIZE:(x + 1)*SIZE, y*SIZE:(y+1)*SIZE] = grid[:,:,j]
img = (img + 1) * 127.5
im = Image.fromarray(np.uint8(img))
im.save(os.path.basename(__file__) + '_layers.png') | en | 0.601262 | # This program was generated by "Generative Art Synthesizer" # Generation date: 2021-11-28 09:21:40 UTC # GAS change date: 2021-11-28 09:20:21 UTC # GAS md5 hash: ad55481e87ca5a7e9a8e92cd336d1cad # Python version: 3.7.9 (tags/v3.7.9:13c94747c7, Aug 17 2020, 18:58:18) [MSC v.1900 64 bit (AMD64)] # For more information visit: https://github.com/volotat/GAS #import python libraries #OS version: default #Numpy version: 1.19.5 #PIL version: 8.1.2 #set initial params #define grid transformation methods #set initial grid #apply transformations to the grid #create color space #save results #save layers | 2.283936 | 2 |
onmt/bin/build_vocab.py | comydream/OpenNMT-py | 1 | 2811 | #!/usr/bin/env python
"""Get vocabulary coutings from transformed corpora samples."""
from onmt.utils.logging import init_logger
from onmt.utils.misc import set_random_seed, check_path
from onmt.utils.parse import ArgumentParser
from onmt.opts import dynamic_prepare_opts
from onmt.inputters.corpus import build_vocab
from onmt.transforms import make_transforms, get_transforms_cls
def build_vocab_main(opts):
"""Apply transforms to samples of specified data and build vocab from it.
Transforms that need vocab will be disabled in this.
Built vocab is saved in plain text format as following and can be pass as
`-src_vocab` (and `-tgt_vocab`) when training:
```
<tok_0>\t<count_0>
<tok_1>\t<count_1>
```
"""
ArgumentParser.validate_prepare_opts(opts, build_vocab_only=True)
assert opts.n_sample == -1 or opts.n_sample > 1, \
f"Illegal argument n_sample={opts.n_sample}."
logger = init_logger()
set_random_seed(opts.seed, False)
transforms_cls = get_transforms_cls(opts._all_transform)
fields = None
transforms = make_transforms(opts, transforms_cls, fields)
logger.info(f"Counter vocab from {opts.n_sample} samples.")
src_counter, tgt_counter, src_feats_counter = build_vocab(
opts, transforms, n_sample=opts.n_sample)
logger.info(f"Counters src:{len(src_counter)}")
logger.info(f"Counters tgt:{len(tgt_counter)}")
for feat_name, feat_counter in src_feats_counter.items():
logger.info(f"Counters {feat_name}:{len(feat_counter)}")
def save_counter(counter, save_path):
check_path(save_path, exist_ok=opts.overwrite, log=logger.warning)
with open(save_path, "w", encoding="utf8") as fo:
for tok, count in counter.most_common():
fo.write(tok + "\t" + str(count) + "\n")
if opts.share_vocab:
src_counter += tgt_counter
tgt_counter = src_counter
logger.info(f"Counters after share:{len(src_counter)}")
save_counter(src_counter, opts.src_vocab)
else:
save_counter(src_counter, opts.src_vocab)
save_counter(tgt_counter, opts.tgt_vocab)
for k, v in src_feats_counter.items():
save_counter(v, opts.src_feats_vocab[k])
def _get_parser():
parser = ArgumentParser(description='build_vocab.py')
dynamic_prepare_opts(parser, build_vocab_only=True)
return parser
def main():
parser = _get_parser()
opts, unknown = parser.parse_known_args()
build_vocab_main(opts)
if __name__ == '__main__':
main()
| #!/usr/bin/env python
"""Get vocabulary coutings from transformed corpora samples."""
from onmt.utils.logging import init_logger
from onmt.utils.misc import set_random_seed, check_path
from onmt.utils.parse import ArgumentParser
from onmt.opts import dynamic_prepare_opts
from onmt.inputters.corpus import build_vocab
from onmt.transforms import make_transforms, get_transforms_cls
def build_vocab_main(opts):
"""Apply transforms to samples of specified data and build vocab from it.
Transforms that need vocab will be disabled in this.
Built vocab is saved in plain text format as following and can be pass as
`-src_vocab` (and `-tgt_vocab`) when training:
```
<tok_0>\t<count_0>
<tok_1>\t<count_1>
```
"""
ArgumentParser.validate_prepare_opts(opts, build_vocab_only=True)
assert opts.n_sample == -1 or opts.n_sample > 1, \
f"Illegal argument n_sample={opts.n_sample}."
logger = init_logger()
set_random_seed(opts.seed, False)
transforms_cls = get_transforms_cls(opts._all_transform)
fields = None
transforms = make_transforms(opts, transforms_cls, fields)
logger.info(f"Counter vocab from {opts.n_sample} samples.")
src_counter, tgt_counter, src_feats_counter = build_vocab(
opts, transforms, n_sample=opts.n_sample)
logger.info(f"Counters src:{len(src_counter)}")
logger.info(f"Counters tgt:{len(tgt_counter)}")
for feat_name, feat_counter in src_feats_counter.items():
logger.info(f"Counters {feat_name}:{len(feat_counter)}")
def save_counter(counter, save_path):
check_path(save_path, exist_ok=opts.overwrite, log=logger.warning)
with open(save_path, "w", encoding="utf8") as fo:
for tok, count in counter.most_common():
fo.write(tok + "\t" + str(count) + "\n")
if opts.share_vocab:
src_counter += tgt_counter
tgt_counter = src_counter
logger.info(f"Counters after share:{len(src_counter)}")
save_counter(src_counter, opts.src_vocab)
else:
save_counter(src_counter, opts.src_vocab)
save_counter(tgt_counter, opts.tgt_vocab)
for k, v in src_feats_counter.items():
save_counter(v, opts.src_feats_vocab[k])
def _get_parser():
parser = ArgumentParser(description='build_vocab.py')
dynamic_prepare_opts(parser, build_vocab_only=True)
return parser
def main():
parser = _get_parser()
opts, unknown = parser.parse_known_args()
build_vocab_main(opts)
if __name__ == '__main__':
main()
| en | 0.871826 | #!/usr/bin/env python Get vocabulary coutings from transformed corpora samples. Apply transforms to samples of specified data and build vocab from it. Transforms that need vocab will be disabled in this. Built vocab is saved in plain text format as following and can be pass as `-src_vocab` (and `-tgt_vocab`) when training: ``` <tok_0>\t<count_0> <tok_1>\t<count_1> ``` | 2.6296 | 3 |
schools3/ml/experiments/feat_pruning_experiment.py | dssg/mlpolicylab_fall20_schools3_public | 0 | 2812 | <filename>schools3/ml/experiments/feat_pruning_experiment.py
import numpy as np
import pandas as pd
from schools3.ml.experiments.models_experiment import ModelsExperiment
from schools3.data.base.cohort import Cohort
from schools3.config import main_config
from schools3.config import global_config
from schools3.data.datasets.dataset import Dataset
from schools3.ml.experiments.feat_importances_experiment import FeatureImportancesExperiment
from schools3.ml.experiments.single_dataset_experiment import SingleDatasetExperiment
from schools3.ml.models.tfkeras_model import TFKerasModel
from schools3.ml.models.sklearn_model import SklearnModel
import schools3.config.ml.experiments.feat_pruning_experiment_config as config
from schools3.config.data.datasets import dataset_config
# an experiment that trains models with subsets of the features according to their permutation importance rank
# like SingleDatasetExperiment, this works on a specific grade
class FeaturePruningExperiment(ModelsExperiment):
def __init__(
self, name='ignore',
features_list=main_config.features,
labels=main_config.labels,
models=main_config.models,
metrics=main_config.metrics,
use_cache=main_config.use_cache
):
super(FeaturePruningExperiment, self).__init__(
name, features_list, labels, models, metrics, use_cache=use_cache
)
def perform(
self, grade=main_config.single_grade,
train_years=main_config.train_years,
test_years=main_config.test_years,
compute_train_metrics=False, **kwargs
):
train_cohort = Cohort(grade, train_years)
df = pd.DataFrame()
for model in self.models:
if not (isinstance(model, SklearnModel) or isinstance(model, TFKerasModel)):
continue
train_data = Dataset(train_cohort, self.features_list, model.get_feature_processor(), self.labels)
model.train(train_data)
feats_exp = FeatureImportancesExperiment('ignore', self.features_list, self.labels, [model], self.metrics)
feature_names, _, sorted_idxs = feats_exp.get_feature_importances(model, train_data)
feats = np.flip(feature_names[sorted_idxs])
for i in config.num_feats:
dataset_config.feat_whitelist.clear()
for feat in feats[:i]:
dataset_config.feat_whitelist.append(feat)
exp = SingleDatasetExperiment('ignore', self.features_list, self.labels, [model], self.metrics)
cur_df = exp.perform(grade, train_years, test_years, compute_train_metrics=compute_train_metrics, **kwargs)
cur_df['num_feats'] = i
df = pd.concat([df, cur_df], ignore_index=True)
return df
| <filename>schools3/ml/experiments/feat_pruning_experiment.py
import numpy as np
import pandas as pd
from schools3.ml.experiments.models_experiment import ModelsExperiment
from schools3.data.base.cohort import Cohort
from schools3.config import main_config
from schools3.config import global_config
from schools3.data.datasets.dataset import Dataset
from schools3.ml.experiments.feat_importances_experiment import FeatureImportancesExperiment
from schools3.ml.experiments.single_dataset_experiment import SingleDatasetExperiment
from schools3.ml.models.tfkeras_model import TFKerasModel
from schools3.ml.models.sklearn_model import SklearnModel
import schools3.config.ml.experiments.feat_pruning_experiment_config as config
from schools3.config.data.datasets import dataset_config
# an experiment that trains models with subsets of the features according to their permutation importance rank
# like SingleDatasetExperiment, this works on a specific grade
class FeaturePruningExperiment(ModelsExperiment):
def __init__(
self, name='ignore',
features_list=main_config.features,
labels=main_config.labels,
models=main_config.models,
metrics=main_config.metrics,
use_cache=main_config.use_cache
):
super(FeaturePruningExperiment, self).__init__(
name, features_list, labels, models, metrics, use_cache=use_cache
)
def perform(
self, grade=main_config.single_grade,
train_years=main_config.train_years,
test_years=main_config.test_years,
compute_train_metrics=False, **kwargs
):
train_cohort = Cohort(grade, train_years)
df = pd.DataFrame()
for model in self.models:
if not (isinstance(model, SklearnModel) or isinstance(model, TFKerasModel)):
continue
train_data = Dataset(train_cohort, self.features_list, model.get_feature_processor(), self.labels)
model.train(train_data)
feats_exp = FeatureImportancesExperiment('ignore', self.features_list, self.labels, [model], self.metrics)
feature_names, _, sorted_idxs = feats_exp.get_feature_importances(model, train_data)
feats = np.flip(feature_names[sorted_idxs])
for i in config.num_feats:
dataset_config.feat_whitelist.clear()
for feat in feats[:i]:
dataset_config.feat_whitelist.append(feat)
exp = SingleDatasetExperiment('ignore', self.features_list, self.labels, [model], self.metrics)
cur_df = exp.perform(grade, train_years, test_years, compute_train_metrics=compute_train_metrics, **kwargs)
cur_df['num_feats'] = i
df = pd.concat([df, cur_df], ignore_index=True)
return df
| en | 0.930169 | # an experiment that trains models with subsets of the features according to their permutation importance rank # like SingleDatasetExperiment, this works on a specific grade | 2.546182 | 3 |
network/dataset/image_loading.py | imsb-uke/podometric_u_net | 0 | 2813 | import os
import numpy as np
from skimage.io import imread
def get_file_count(paths, image_format='.tif'):
total_count = 0
for path in paths:
try:
path_list = [_ for _ in os.listdir(path) if _.endswith(image_format)]
total_count += len(path_list)
except OSError:
print("Directory does not exist. Returned file count for this path will be 0")
return total_count
# Function to load image
def load_image(img_path):
img = imread(img_path)
if img.shape[2] == 4:
img = img[:, :, :-1]
# img = np.roll(img, shift=1, axis=2) # CHECK IMAGE FORMAT
return img
# Function to load mask
def load_mask(mask_path):
mask = imread(mask_path)
return mask
def load_mask_from_img(cfg, img_path, img_name, suffixes):
a_mask = imread(os.path.join(img_path, img_name + suffixes[0]))
msk = np.zeros((a_mask.shape[0], a_mask.shape[1], len(suffixes) * cfg.NUMBER_MSK_CHANNELS))
i = 0
for suffix in suffixes:
msk_channel = imread(os.path.join(img_path, img_name + suffix))
if len(msk_channel.shape) == 2:
msk_channel = np.expand_dims(msk_channel, axis=-1)
if len(msk_channel.shape) != 3:
raise ValueError("Mask must be 3-dim here. Does your mask have 1 or more than 3 dimensions? "
"Check the masks.")
msk[:, :, i:i+cfg.NUMBER_MSK_CHANNELS] = msk_channel
i += cfg.NUMBER_MSK_CHANNELS
# print(msk, msk.shape)
return msk
def load_weights(cfg, img_path, img_name, weight_suffixes):
a_weights = np.load(os.path.join(img_path, img_name + weight_suffixes[0]))
weights = np.zeros((a_weights.shape[0], a_weights.shape[1], len(weight_suffixes) * cfg.NUMBER_MSK_CHANNELS))
i = 0
for suffix in weight_suffixes:
weights_channel = np.load(os.path.join(img_path, img_name + suffix))
if len(weights_channel.shape) == 2:
weights_channel = np.expand_dims(weights_channel, axis=-1)
if len(weights_channel.shape) != 3:
raise ValueError("Weights must be 3-dim here. Has your weights 1 or more than 3 dimensions? Check the weights.")
weights[:, :, i:i+cfg.NUMBER_MSK_CHANNELS] = weights_channel
i += cfg.NUMBER_MSK_CHANNELS
return weights | import os
import numpy as np
from skimage.io import imread
def get_file_count(paths, image_format='.tif'):
total_count = 0
for path in paths:
try:
path_list = [_ for _ in os.listdir(path) if _.endswith(image_format)]
total_count += len(path_list)
except OSError:
print("Directory does not exist. Returned file count for this path will be 0")
return total_count
# Function to load image
def load_image(img_path):
img = imread(img_path)
if img.shape[2] == 4:
img = img[:, :, :-1]
# img = np.roll(img, shift=1, axis=2) # CHECK IMAGE FORMAT
return img
# Function to load mask
def load_mask(mask_path):
mask = imread(mask_path)
return mask
def load_mask_from_img(cfg, img_path, img_name, suffixes):
a_mask = imread(os.path.join(img_path, img_name + suffixes[0]))
msk = np.zeros((a_mask.shape[0], a_mask.shape[1], len(suffixes) * cfg.NUMBER_MSK_CHANNELS))
i = 0
for suffix in suffixes:
msk_channel = imread(os.path.join(img_path, img_name + suffix))
if len(msk_channel.shape) == 2:
msk_channel = np.expand_dims(msk_channel, axis=-1)
if len(msk_channel.shape) != 3:
raise ValueError("Mask must be 3-dim here. Does your mask have 1 or more than 3 dimensions? "
"Check the masks.")
msk[:, :, i:i+cfg.NUMBER_MSK_CHANNELS] = msk_channel
i += cfg.NUMBER_MSK_CHANNELS
# print(msk, msk.shape)
return msk
def load_weights(cfg, img_path, img_name, weight_suffixes):
a_weights = np.load(os.path.join(img_path, img_name + weight_suffixes[0]))
weights = np.zeros((a_weights.shape[0], a_weights.shape[1], len(weight_suffixes) * cfg.NUMBER_MSK_CHANNELS))
i = 0
for suffix in weight_suffixes:
weights_channel = np.load(os.path.join(img_path, img_name + suffix))
if len(weights_channel.shape) == 2:
weights_channel = np.expand_dims(weights_channel, axis=-1)
if len(weights_channel.shape) != 3:
raise ValueError("Weights must be 3-dim here. Has your weights 1 or more than 3 dimensions? Check the weights.")
weights[:, :, i:i+cfg.NUMBER_MSK_CHANNELS] = weights_channel
i += cfg.NUMBER_MSK_CHANNELS
return weights | en | 0.490656 | # Function to load image # img = np.roll(img, shift=1, axis=2) # CHECK IMAGE FORMAT # Function to load mask # print(msk, msk.shape) | 2.82606 | 3 |
series/simple/numeric_series.py | kefir/snakee | 0 | 2814 | from typing import Optional, Callable
try: # Assume we're a sub-module in a package.
from series import series_classes as sc
from utils import numeric as nm
except ImportError: # Apparently no higher-level package has been imported, fall back to a local import.
from .. import series_classes as sc
from ...utils import numeric as nm
Native = sc.AnySeries
DEFAULT_NUMERIC = True
WINDOW_DEFAULT = (-1, 0, 1)
WINDOW_WO_CENTER = (-2, -1, 0, 1, 2)
WINDOW_NEIGHBORS = (-1, 0)
class NumericSeries(sc.AnySeries):
def __init__(
self,
values=[],
validate=False,
name=None,
):
super().__init__(
values=values,
validate=validate,
name=name,
)
@staticmethod
def get_distance_func():
return nm.diff
def get_errors(self):
yield from super().get_errors()
if not self.has_valid_items():
yield 'Values of {} must be numeric'.format(self.get_class_name())
def has_valid_items(self):
for v in self.get_values():
if not isinstance(v, (int, float)):
return False
return True
def is_numeric(self, check=False):
if check:
return self.has_valid_items()
else:
return DEFAULT_NUMERIC
def get_sum(self):
return sum(
self.filter_values_defined().get_values(),
)
def get_mean(self):
values_defined = self.filter_values_defined().get_values()
if values_defined:
return sum(values_defined) / len(values_defined)
def norm(self, rate=None, default=None):
if rate is None:
rate = self.get_mean()
return self.map_values(lambda v: v / rate if rate else default)
def divide(self, series, default=None, extend=False):
return self.map_optionally_extend_zip_values(
lambda x, y: x / y if y else default,
extend,
series,
)
def subtract(self, series, default=None, extend=False):
return self.map_optionally_extend_zip_values(
lambda x, y: x - y if x is not None and y is not None else default,
extend,
series,
)
def derivative(self, extend=False, default=0):
if extend:
return self.preface(None).subtract(
self,
extend=True,
default=default,
).crop(0, 1)
else:
return self.slice(0, -1).subtract(
self.shift(-1)
)
def get_sliding_window(self, window=WINDOW_DEFAULT, extend=True, default=None, as_series=True):
if extend:
n_min = 0
n_max = self.get_count()
else:
n_min = - min(window)
n_max = self.get_count() - max(window)
for center in range(n_min, n_max):
sliding_window = [center + n for n in window]
if as_series:
yield self.value_series().items_no(sliding_window, extend=extend, default=default)
else:
yield self.value_series().get_items_no(sliding_window, extend=extend, default=default)
def apply_window_func(
self, function: Callable,
window=WINDOW_DEFAULT, extend=True, default=None, as_series=False,
inplace: bool = False,
) -> Optional[Native]:
values = map(function, self.get_sliding_window(window, extend=extend, default=default, as_series=as_series))
return self.set_values(values, inplace=inplace)
def mark_local_extremums(self, local_min=True, local_max=True):
return self.apply_window_func(
lambda a: nm.is_local_extremum(*a, local_min=local_min, local_max=local_max),
window=WINDOW_DEFAULT,
extend=True,
default=False,
)
def mark_local_max(self):
return self.mark_local_extremums(local_min=False, local_max=True)
def mark_local_min(self):
return self.mark_local_extremums(local_min=True, local_max=False)
def deviation_from_neighbors(self, window=WINDOW_NEIGHBORS, rel=False):
smoothed_series = self.smooth(window=window)
deviation = self.subtract(smoothed_series)
if rel:
deviation = deviation.divide(smoothed_series, default=0)
return deviation
# @deprecated
def smooth_simple_linear(self, window_len=3, exclude_center=False):
center = int((window_len - 1) / 2)
count = self.get_count()
result = self.new()
for n in self.get_range_numbers():
is_edge = n < center or n >= count - center
if is_edge:
result.append(self.get_item_no(n), inplace=True)
else:
sub_series = self.slice(n - center, n + center + 1)
if exclude_center:
sub_series = sub_series.drop_item_no(center)
result.append(sub_series.get_mean(), inplace=True)
return result
def smooth(self, how='linear', *args, **kwargs):
method_name = 'smooth_{}'.format(how)
smooth_method = self.__getattribute__(method_name)
return smooth_method(*args, **kwargs)
def smooth_multiple(self, list_kwargs=[]):
series = self
for kwargs in list_kwargs:
series = series.smooth(**kwargs)
return series
def smooth_linear(self, window=WINDOW_DEFAULT):
return self.apply_window_func(
lambda s: s.get_mean(),
window=window, extend=True, default=None,
as_series=True,
)
def smooth_spikes(self, threshold, window=WINDOW_WO_CENTER, local_min=False, local_max=True, whitelist=None):
spikes = self.mark_spikes(threshold, local_min=local_min, local_max=local_max)
if whitelist:
spikes = spikes.map_zip_values(
lambda a, b: a and not b,
whitelist,
)
return self.map_zip_values(
lambda v, t, s: s if t else v,
spikes,
self.smooth(window=window),
)
def mark_spikes(self, threshold, window=WINDOW_NEIGHBORS, local_min=False, local_max=True):
deviation = self.deviation_from_neighbors(window=window, rel=True)
if local_min or local_max:
deviation = deviation.map_zip_values(
lambda x, m: x if m else None,
self.mark_local_extremums(local_min=local_min, local_max=local_max),
)
spikes = deviation.map_values(
lambda x: abs(x or 0) > threshold,
)
return spikes
def plot(self, fmt='-'):
nm.plot(self.get_range_numbers(), self.get_values(), fmt=fmt)
| from typing import Optional, Callable
try: # Assume we're a sub-module in a package.
from series import series_classes as sc
from utils import numeric as nm
except ImportError: # Apparently no higher-level package has been imported, fall back to a local import.
from .. import series_classes as sc
from ...utils import numeric as nm
Native = sc.AnySeries
DEFAULT_NUMERIC = True
WINDOW_DEFAULT = (-1, 0, 1)
WINDOW_WO_CENTER = (-2, -1, 0, 1, 2)
WINDOW_NEIGHBORS = (-1, 0)
class NumericSeries(sc.AnySeries):
def __init__(
self,
values=[],
validate=False,
name=None,
):
super().__init__(
values=values,
validate=validate,
name=name,
)
@staticmethod
def get_distance_func():
return nm.diff
def get_errors(self):
yield from super().get_errors()
if not self.has_valid_items():
yield 'Values of {} must be numeric'.format(self.get_class_name())
def has_valid_items(self):
for v in self.get_values():
if not isinstance(v, (int, float)):
return False
return True
def is_numeric(self, check=False):
if check:
return self.has_valid_items()
else:
return DEFAULT_NUMERIC
def get_sum(self):
return sum(
self.filter_values_defined().get_values(),
)
def get_mean(self):
values_defined = self.filter_values_defined().get_values()
if values_defined:
return sum(values_defined) / len(values_defined)
def norm(self, rate=None, default=None):
if rate is None:
rate = self.get_mean()
return self.map_values(lambda v: v / rate if rate else default)
def divide(self, series, default=None, extend=False):
return self.map_optionally_extend_zip_values(
lambda x, y: x / y if y else default,
extend,
series,
)
def subtract(self, series, default=None, extend=False):
return self.map_optionally_extend_zip_values(
lambda x, y: x - y if x is not None and y is not None else default,
extend,
series,
)
def derivative(self, extend=False, default=0):
if extend:
return self.preface(None).subtract(
self,
extend=True,
default=default,
).crop(0, 1)
else:
return self.slice(0, -1).subtract(
self.shift(-1)
)
def get_sliding_window(self, window=WINDOW_DEFAULT, extend=True, default=None, as_series=True):
if extend:
n_min = 0
n_max = self.get_count()
else:
n_min = - min(window)
n_max = self.get_count() - max(window)
for center in range(n_min, n_max):
sliding_window = [center + n for n in window]
if as_series:
yield self.value_series().items_no(sliding_window, extend=extend, default=default)
else:
yield self.value_series().get_items_no(sliding_window, extend=extend, default=default)
def apply_window_func(
self, function: Callable,
window=WINDOW_DEFAULT, extend=True, default=None, as_series=False,
inplace: bool = False,
) -> Optional[Native]:
values = map(function, self.get_sliding_window(window, extend=extend, default=default, as_series=as_series))
return self.set_values(values, inplace=inplace)
def mark_local_extremums(self, local_min=True, local_max=True):
return self.apply_window_func(
lambda a: nm.is_local_extremum(*a, local_min=local_min, local_max=local_max),
window=WINDOW_DEFAULT,
extend=True,
default=False,
)
def mark_local_max(self):
return self.mark_local_extremums(local_min=False, local_max=True)
def mark_local_min(self):
return self.mark_local_extremums(local_min=True, local_max=False)
def deviation_from_neighbors(self, window=WINDOW_NEIGHBORS, rel=False):
smoothed_series = self.smooth(window=window)
deviation = self.subtract(smoothed_series)
if rel:
deviation = deviation.divide(smoothed_series, default=0)
return deviation
# @deprecated
def smooth_simple_linear(self, window_len=3, exclude_center=False):
center = int((window_len - 1) / 2)
count = self.get_count()
result = self.new()
for n in self.get_range_numbers():
is_edge = n < center or n >= count - center
if is_edge:
result.append(self.get_item_no(n), inplace=True)
else:
sub_series = self.slice(n - center, n + center + 1)
if exclude_center:
sub_series = sub_series.drop_item_no(center)
result.append(sub_series.get_mean(), inplace=True)
return result
def smooth(self, how='linear', *args, **kwargs):
method_name = 'smooth_{}'.format(how)
smooth_method = self.__getattribute__(method_name)
return smooth_method(*args, **kwargs)
def smooth_multiple(self, list_kwargs=[]):
series = self
for kwargs in list_kwargs:
series = series.smooth(**kwargs)
return series
def smooth_linear(self, window=WINDOW_DEFAULT):
return self.apply_window_func(
lambda s: s.get_mean(),
window=window, extend=True, default=None,
as_series=True,
)
def smooth_spikes(self, threshold, window=WINDOW_WO_CENTER, local_min=False, local_max=True, whitelist=None):
spikes = self.mark_spikes(threshold, local_min=local_min, local_max=local_max)
if whitelist:
spikes = spikes.map_zip_values(
lambda a, b: a and not b,
whitelist,
)
return self.map_zip_values(
lambda v, t, s: s if t else v,
spikes,
self.smooth(window=window),
)
def mark_spikes(self, threshold, window=WINDOW_NEIGHBORS, local_min=False, local_max=True):
deviation = self.deviation_from_neighbors(window=window, rel=True)
if local_min or local_max:
deviation = deviation.map_zip_values(
lambda x, m: x if m else None,
self.mark_local_extremums(local_min=local_min, local_max=local_max),
)
spikes = deviation.map_values(
lambda x: abs(x or 0) > threshold,
)
return spikes
def plot(self, fmt='-'):
nm.plot(self.get_range_numbers(), self.get_values(), fmt=fmt)
| en | 0.813764 | # Assume we're a sub-module in a package. # Apparently no higher-level package has been imported, fall back to a local import. # @deprecated | 2.367053 | 2 |
app/internal/module/video/database.py | kuropengin/SHINtube-video-api | 0 | 2815 | import glob
import pathlib
from .filemanager import filemanager_class
class database_class(filemanager_class):
def __init__(self):
filemanager_class.__init__(self)
async def update_info(self, year, cid, vid, title, explanation):
# 既存のjsonを読み込み
json_file = "/".join([self.video_dir, str(year),
cid, vid, "info.json"])
_dict = await self.read_json(json_file)
if not _dict:
return False
# jsonの更新
_dict["title"] = title
_dict["explanation"] = explanation
# jsonの書き込み
if self.write_json(json_file, _dict):
return True
return False
async def encode_result(self, folderpath, resolution, result=True):
# 既存のjsonを読み込み
json_file = "/".join([folderpath, "info.json"])
_dict = await self.read_json(json_file)
if not _dict:
return False
if result:
# 画質の追加
_dict["resolution"].append(f"{resolution}p")
_dict["encode_tasks"].remove(f"{resolution}p")
else:
_dict["encode_error"].append(f"{resolution}p")
_dict["encode_tasks"].remove(f"{resolution}p")
# jsonの書き込み
self.write_json(json_file, _dict)
# プレイリストに書き込み
playlist = "/".join([folderpath, "playlist.m3u8"])
await self.write_playlist(playlist, resolution)
async def encode_task(self, folderpath, resolution):
# 既存のjsonを読み込み
json_file = "/".join([folderpath, "info.json"])
_dict = await self.read_json(json_file)
if not _dict:
return False
if f"{resolution}p" in _dict["resolution"]:
return True
# 画質の追加
_dict["encode_tasks"].append(f"{resolution}p")
# jsonの書き込み
if self.write_json(json_file, _dict):
return True
return False
async def encode_error(self, folderpath, message):
# 既存のjsonを読み込み
json_file = "/".join([folderpath, "info.json"])
_dict = await self.read_json(json_file)
if not _dict:
return False
# 画質の追加
_dict["encode_error"].append(f"{message}")
# jsonの書き込み
if self.write_json(json_file, _dict):
return True
return False
async def get_all_info(self):
json_files_path = await self.async_wrap(glob.glob)(
f"./{self.video_dir}/**/info.json",
recursive=True)
result = []
for json_file in json_files_path:
temp = await self.read_json(json_file)
directory = "/".join(json_file.split("/")[:-1])
temp["video_directory"] = directory
try:
temp["video_file_name"] = glob.glob(
f"{directory}/1.*")[0].split("/")[-1]
except IndexError:
temp["video_file_name"] = None
result.append(temp)
return result
async def get_encode_tasks(self):
video_info = await self.get_all_info()
result = []
for info in video_info:
if len(info["encode_tasks"]) > 0:
result.append(info)
return result
async def list_video_id(self, year, cid):
_video_dir = "/".join([self.video_dir, str(year), cid])
temp = await self.async_wrap(glob.glob)(f"{_video_dir}/*")
return [video_id.split("/")[-1]
for video_id in temp]
async def list_link(self, year, cid):
_video_dir = "/".join([self.video_dir, str(year), cid])
temp = await self.async_wrap(glob.glob)(f"{_video_dir}/*")
result = {}
for link_path in temp:
json_file = link_path + "/info.json"
_dict = await self.read_json(json_file)
if not _dict:
pass
else:
result[link_path.split("/")[-1]] = _dict
return result
async def get_all_info(self):
json_files_path = await self.async_wrap(glob.glob)(
f"./{self.video_dir}/**/info.json",
recursive=True)
result = []
for json_file in json_files_path:
temp = await self.read_json(json_file)
directory = "/".join(json_file.split("/")[:-1])
temp["video_directory"] = directory
try:
temp["video_file_name"] = glob.glob(
f"{directory}/1.*")[0].split("/")[-1]
except IndexError:
temp["video_file_name"] = None
result.append(temp)
return result
async def get_encode_tasks(self):
video_info = await self.get_all_info()
result = []
for info in video_info:
if len(info["encode_tasks"]) > 0:
result.append(info)
return result
database = database_class()
| import glob
import pathlib
from .filemanager import filemanager_class
class database_class(filemanager_class):
def __init__(self):
filemanager_class.__init__(self)
async def update_info(self, year, cid, vid, title, explanation):
# 既存のjsonを読み込み
json_file = "/".join([self.video_dir, str(year),
cid, vid, "info.json"])
_dict = await self.read_json(json_file)
if not _dict:
return False
# jsonの更新
_dict["title"] = title
_dict["explanation"] = explanation
# jsonの書き込み
if self.write_json(json_file, _dict):
return True
return False
async def encode_result(self, folderpath, resolution, result=True):
# 既存のjsonを読み込み
json_file = "/".join([folderpath, "info.json"])
_dict = await self.read_json(json_file)
if not _dict:
return False
if result:
# 画質の追加
_dict["resolution"].append(f"{resolution}p")
_dict["encode_tasks"].remove(f"{resolution}p")
else:
_dict["encode_error"].append(f"{resolution}p")
_dict["encode_tasks"].remove(f"{resolution}p")
# jsonの書き込み
self.write_json(json_file, _dict)
# プレイリストに書き込み
playlist = "/".join([folderpath, "playlist.m3u8"])
await self.write_playlist(playlist, resolution)
async def encode_task(self, folderpath, resolution):
# 既存のjsonを読み込み
json_file = "/".join([folderpath, "info.json"])
_dict = await self.read_json(json_file)
if not _dict:
return False
if f"{resolution}p" in _dict["resolution"]:
return True
# 画質の追加
_dict["encode_tasks"].append(f"{resolution}p")
# jsonの書き込み
if self.write_json(json_file, _dict):
return True
return False
async def encode_error(self, folderpath, message):
# 既存のjsonを読み込み
json_file = "/".join([folderpath, "info.json"])
_dict = await self.read_json(json_file)
if not _dict:
return False
# 画質の追加
_dict["encode_error"].append(f"{message}")
# jsonの書き込み
if self.write_json(json_file, _dict):
return True
return False
async def get_all_info(self):
json_files_path = await self.async_wrap(glob.glob)(
f"./{self.video_dir}/**/info.json",
recursive=True)
result = []
for json_file in json_files_path:
temp = await self.read_json(json_file)
directory = "/".join(json_file.split("/")[:-1])
temp["video_directory"] = directory
try:
temp["video_file_name"] = glob.glob(
f"{directory}/1.*")[0].split("/")[-1]
except IndexError:
temp["video_file_name"] = None
result.append(temp)
return result
async def get_encode_tasks(self):
video_info = await self.get_all_info()
result = []
for info in video_info:
if len(info["encode_tasks"]) > 0:
result.append(info)
return result
async def list_video_id(self, year, cid):
_video_dir = "/".join([self.video_dir, str(year), cid])
temp = await self.async_wrap(glob.glob)(f"{_video_dir}/*")
return [video_id.split("/")[-1]
for video_id in temp]
async def list_link(self, year, cid):
_video_dir = "/".join([self.video_dir, str(year), cid])
temp = await self.async_wrap(glob.glob)(f"{_video_dir}/*")
result = {}
for link_path in temp:
json_file = link_path + "/info.json"
_dict = await self.read_json(json_file)
if not _dict:
pass
else:
result[link_path.split("/")[-1]] = _dict
return result
async def get_all_info(self):
json_files_path = await self.async_wrap(glob.glob)(
f"./{self.video_dir}/**/info.json",
recursive=True)
result = []
for json_file in json_files_path:
temp = await self.read_json(json_file)
directory = "/".join(json_file.split("/")[:-1])
temp["video_directory"] = directory
try:
temp["video_file_name"] = glob.glob(
f"{directory}/1.*")[0].split("/")[-1]
except IndexError:
temp["video_file_name"] = None
result.append(temp)
return result
async def get_encode_tasks(self):
video_info = await self.get_all_info()
result = []
for info in video_info:
if len(info["encode_tasks"]) > 0:
result.append(info)
return result
database = database_class()
| ja | 0.897194 | # 既存のjsonを読み込み # jsonの更新 # jsonの書き込み # 既存のjsonを読み込み # 画質の追加 # jsonの書き込み # プレイリストに書き込み # 既存のjsonを読み込み # 画質の追加 # jsonの書き込み # 既存のjsonを読み込み # 画質の追加 # jsonの書き込み | 2.714126 | 3 |
python/OpenGeoTile.py | scoofy/open-geotiling | 0 | 2816 | <gh_stars>0
from openlocationcode import openlocationcode as olc
from enum import Enum
import math, re
class TileSize(Enum):
''' An area of 20° x 20°. The side length of this tile varies with its location on the globe,
but can be up to approximately 2200km. Tile addresses will be 2 characters long.'''
GLOBAL = (2, 20.0)
''' An area of 1° x 1°. The side length of this tile varies with its location on the globe,
but can be up to approximately 110km. Tile addresses will be 4 characters long.'''
REGION = (4, 1.0)
''' An area of 0.05° x 0.05°. The side length of this tile varies with its location on the
globe, but can be up to approximately 5.5km. Tile addresses will be 6 characters long.'''
DISTRICT = (6, 0.05)
''' An area of 0.0025° x 0.0025°. The side length of this tile varies with its location on
the globe, but can be up to approximately 275m.
Tile addresses will be 8 characters long.'''
NEIGHBORHOOD = (8, 0.0025)
''' An area of 0.000125° x 0.000125°. The side length of this tile varies with its location
on the globe, but can be up to approximately 14m.
Tile addresses will be 10 characters long.'''
PINPOINT = (10, 0.000125)
def __init__(self, code_length, coordinate_increment):
self.code_length = code_length
self.coordinate_increment = coordinate_increment
def getCodeLength(self):
'''get 0th value'''
return self.code_length
def getCoordinateIncrement(self):
'''get 1th value'''
return self.coordinate_increment
# Copy from OpenLocationCode.java
# A separator used to break the code into two parts to aid memorability.
SEPARATOR = '+'
# Copy from OpenLocationCode.java
# The character used to pad codes.
PADDING_CHARACTER = '0'
PADDING_2 = "00"
PADDING_4 = "0000"
PADDING_6 = "000000"
CODE_ALPHABET = olc.CODE_ALPHABET_
BASE_20_SET = {x+y for x in CODE_ALPHABET for y in CODE_ALPHABET}
BASE_20_BORDER_SET = {x for x in BASE_20_SET if x[0] in ['2', 'X'] or x[1] in ['2', 'X']}
NORTH_DIGITS = {x for x in BASE_20_BORDER_SET if x[0] == 'X'}
EAST_DIGITS = {x for x in BASE_20_BORDER_SET if x[1] == 'X'}
SOUTH_DIGITS = {x for x in BASE_20_BORDER_SET if x[0] == '2'}
WEST_DIGITS = {x for x in BASE_20_BORDER_SET if x[1] == '2'}
memoized_digit_dict = {
"N1": NORTH_DIGITS,
"E1": EAST_DIGITS,
"S1": SOUTH_DIGITS,
"W1": WEST_DIGITS,
}
def is_padded(plus_code):
return plus_code.find(PADDING_CHARACTER) != -1
def is_tile_address(plus_code):
return plus_code.find(SEPARATOR) == -1
def return_code_of_tile_size(too_precise_plus_code, desired_tile_size):
code = too_precise_plus_code
if not is_tile_address(code):
code = code.replace(SEPARATOR, '')
if is_padded(code):
if code.find(PADDING_CHARACTER) < desired_tile_size.getCodeLength():
raise Exception("OLC padding larger than allowed by desired_tile_size")
code_address = code[:desired_tile_size.getCodeLength()]
full_length = TileSize.PINPOINT.getCodeLength()
code = code_address + ("0" * (full_length - len(code_address)))
if desired_tile_size == TileSize.PINPOINT:
code = code[:-2] + SEPARATOR + code[-2:]
else:
code = code[:-2] + SEPARATOR
return code
def return_set_of_subaddresses(set_of_addresses):
for address in set_of_addresses:
if len(address) == TileSize.PINPOINT.getCodeLength():
''' address already minimum possible size '''
return None
return {address+base for address in set_of_addresses for base in BASE_20_SET}
class OpenGeoTile():
'''
/**
* A wrapper around an {@code OpenLocationCode} object, focusing on the area identified by a prefix
* of the given OpenLocationCode.
*
* Using this wrapper class allows to determine whether two locations are in the same or adjacent
* "tiles", to determine all neighboring tiles of a given one, to calculate a distance in tiles etc.
*
* Open Location Code is a technology developed by Google and licensed under the Apache License 2.0.
* For more information, see https://github.com/google/open-location-code
*
* @author <NAME>
* @version 0.1.0
*/
Ported by scoofy on 08.31.21
'''
def __init__(self,
code=None,
tile_size=None,
lat=None,
long=None,
):
if not (code or (code and tile_size) or (lat and long)):
raise Exception("Invalid OpenGeoTile constructor arguments")
if lat and long:
self.constructTileFromLatLong(lat, long, tile_size)
elif code and tile_size:
self.constructTileFromCodeAndSize(code, tile_size)
elif code:
if is_tile_address(code):
self.constructTileFromTileAddress(code)
else:
self.constructTileFromCode(code)
self.tile_address = self.code.replace(SEPARATOR, "")[0: self.tile_size.getCodeLength()]
def constructTileFromCode(self, plus_code):
'''/**
* Creates a new OpenGeoTile from an existing
* {@link com.google.openlocationcode.OpenLocationCode}.
* @param olc OpenLocationCode for the current location. This can be a padded code, in which
* case the resulting OpenGeoTile will have a larger TileSize.
* @throws IllegalArgumentException if olc is not a full code
*/'''
if not olc.isFull(plus_code):
raise Exception("Only full OLC supported. Use olc.recoverNearest().")
self.code = plus_code.upper()
if is_padded(plus_code):
code_length = plus_code.find(PADDING_CHARACTER)
else:
code_length = min(len(plus_code)-1, 10)
if code_length == TileSize.GLOBAL.getCodeLength():
self.tile_size = TileSize.GLOBAL
elif code_length == TileSize.REGION.getCodeLength():
self.tile_size = TileSize.REGION
elif code_length == TileSize.DISTRICT.getCodeLength():
self.tile_size = TileSize.DISTRICT
elif code_length == TileSize.NEIGHBORHOOD.getCodeLength():
self.tile_size = TileSize.NEIGHBORHOOD
elif code_length == TileSize.PINPOINT.getCodeLength():
self.tile_size = TileSize.PINPOINT
else:
raise Exception("Too precise, sort this later")
def constructTileFromCodeAndSize(self, plus_code, tile_size):
'''
Creates a new OpenGeoTile from an existing
{@link com.google.openlocationcode.OpenLocationCode}.
@param olc OpenLocationCode for the current location
@param tile_size tile size to use for this OpenGeoTile
@throws IllegalArgumentException when trying to pass a short (non-full) OLC, or if OLC has
too much padding for given tile_size
'''
if not olc.isFull(plus_code):
raise Exception("Only full OLC supported. Use recover().")
modified_plus_code = return_code_of_tile_size(plus_code, tile_size)
self.code = modified_plus_code.upper()
self.tile_size = tile_size
def constructTileFromLatLong(self, lat: float, long: float, tile_size=None):
'''/**
* Creates a new OpenGeoTile from lat/long coordinates.
* @param latitude latitude of the location
* @param longitude longitude of the location
* @param tile_size tile size to use for this OpenGeoTile
* @throws IllegalArgumentException passed through from
* {@link OpenLocationCode#OpenLocationCode(double, double, int)}
*/'''
if not tile_size:
tile_size = TileSize.PINPOINT
self.code = olc.encode(lat, long, tile_size.getCodeLength()).upper()
self.tile_size = tile_size
def constructTileFromTileAddress(self, tileAddress):
'''/**
* Creates a new OpenGeoTile from a tile address.
* @param tileAddress a tile address is a [2/4/6/8/10]-character string that corresponds to a
* valid {@link com.google.openlocationcode.OpenLocationCode} after removing
* '+' and an additional number of trailing characters; tile size is
* determined by the length of this address
* @throws IllegalArgumentException passed through from
* {@link OpenLocationCode#OpenLocationCode(String)} or thrown if tileAddress is of
* invalid length
*/'''
detectedTileSize = None
olcBuilder = ""
if len(tileAddress) == TileSize.GLOBAL.getCodeLength():
detectedTileSize = TileSize.GLOBAL
olcBuilder += tileAddress + PADDING_6 + SEPARATOR
if len(tileAddress) == TileSize.REGION.getCodeLength():
detectedTileSize = TileSize.REGION
olcBuilder += tileAddress + PADDING_4 + SEPARATOR
if len(tileAddress) == TileSize.DISTRICT.getCodeLength():
detectedTileSize = TileSize.DISTRICT
olcBuilder += tileAddress + PADDING_2 + SEPARATOR
if len(tileAddress) == TileSize.NEIGHBORHOOD.getCodeLength():
detectedTileSize = TileSize.NEIGHBORHOOD
olcBuilder += tileAddress + SEPARATOR
if len(tileAddress) == TileSize.PINPOINT.getCodeLength():
detectedTileSize = TileSize.PINPOINT
olcBuilder += tileAddress[0:8] + SEPARATOR + tileAddress[8:10]
if detectedTileSize == None:
print(tileAddress)
raise Exception("Invalid tile address")
self.tile_size = detectedTileSize
self.code = olcBuilder.upper()
def getWrappedOpenLocationCode(self):
# this code is effectively redundant as python has no wrapping
'''/**
* The exact {@link com.google.openlocationcode.OpenLocationCode} wrapped by this OpenGeoTile.
* For the plus code of the whole tile, see {@link #getTileOpenLocationCode()}.
* @return the exact plus code wrapped by this OpenGeoTile
*/'''
return self.code
def returnCode(self):
return self.code
def getTileSize(self):
'''/**
* Get the {@link TileSize} of this OpenGeoTile.
* @return the {@link TileSize} of this OpenGeoTile
*/'''
return self.tile_size
def getTileAddress(self):
'''/**
* A tile address is a string of length 2, 4, 6, 8, or 10, which corresponds to a valid
* {@link com.google.openlocationcode.OpenLocationCode} after padding with an appropriate
* number of '0' and '+' characters. Example: Address "CVXW" corresponds to OLC "CVXW0000+"
* @return the tile address of this OpenGeoTile;
*/'''
return self.tile_address
def getTileAddressPrefix(self):
'''/**
* The prefix of a tile address is the address of the next biggest tile at this location.
* @return this tile's address with the final two characters removed. In case of a GLOBAL tile,
* returns the empty string.
*/'''
if self.tile_size == TileSize.GLOBAL:
return ""
else:
return self.getTileAddress()[0: self.tile_size.getCodeLength()-2]
def getParentTileAddress(self):
return self.getTileAddressPrefix()
def getTileOpenLocationCode(self):
# this code is redundant
'''/**
* The full {@link com.google.openlocationcode.OpenLocationCode} for this tile. Other than
* {@link #getWrappedOpenLocationCode()}, this will return a full plus code for the whole tile.
* @return a plus code for the whole tile, probably padded with '0' characters
*/'''
return self.getWrappedOpenLocationCode()
def getNeighbors(self, eight_point_direction=None):
'''/**
* Get an array of the typically 8 neighboring tiles of the same size.
* @return an array of the typically 8 neighboring tiles of the same size;
* may return less than 8 neighbors for tiles near the poles.
*/'''
# deltas = [20.0, 1.0, 0.05, 0.0025, 0.000125]
delta = self.getTileSize().getCoordinateIncrement()
code_area = olc.decode(self.code)
latitude = code_area.latitudeCenter
longitude = code_area.longitudeCenter
'''directions_list included to keep ordered data'''
directions_list = ["NW", "N", "NE", "E", "SE", "S", "SW", "W"]
direction_dict = {
"NW": [+1, -1], "N": [+1, 0], "NE": [+1, +1],
"W": [ 0, -1], "E": [ 0, +1],
"SW": [-1, -1], "S": [-1, 0], "SE": [-1, +1],
}
#lat_diff = [+1, +1, +1, 0, -1, -1, -1, 0]
#long_diff = [-1, 0, +1, +1, +1, 0, -1, -1]
if not type(eight_point_direction) in [type(None), list, str]:
raise Exception("eight_point_direction must be of type list or str")
if eight_point_direction is None:
directions = directions_list
elif isinstance(eight_point_direction, str):
directions = []
if eight_point_direction.upper() in directions_list:
directions.append(eight_point_direction.upper())
else:
''' this list construction keeps directions in the order above '''
uppercase_input_directions = [d.upper() for d in eight_point_direction]
directions = [direction for direction in directions_list if direction in uppercase_input_directions]
neighbors = set()
for direction in directions:
lat_diff, long_diff = direction_dict.get(direction)
''' //OLC constructor clips and normalizes,
//so we don't have to deal with invalid lat/long values directly'''
neighborLatitude = latitude + (delta * lat_diff)
neighborLongitude = longitude + (delta * long_diff)
new_OpenGeoTile = OpenGeoTile(lat=neighborLatitude, long=neighborLongitude, tile_size=self.getTileSize())
if not self.isSameTile(new_OpenGeoTile):
'''//don't add tiles that are the same as this one due to clipping near the poles'''
neighbors.add(new_OpenGeoTile)
return neighbors
def isSameTile(self, potentialSameTile):
'''/**
* Check if a tile describes the same area as this one.
* @param potentialSameTile the OpenGeoTile to check
* @return true if tile sizes and addresses are the same; false if not
*/'''
if potentialSameTile.getTileSize() != self.getTileSize():
return False
return potentialSameTile.getTileAddress() == self.getTileAddress()
def isNeighbor(self, potentialNeighbor):
'''/**
* Check if a tile is neighboring this one.
* @param potentialNeighbor the OpenGeoTile to check
* @return true if this and potentialNeighbor are adjacent (8-neighborhood);
* false if not
*/'''
if potentialNeighbor.getTileSize() == self.getTileSize():
'''//avoid iterating over neighbors for same tile'''
if self.isSameTile(potentialNeighbor):
return False
neighbors = self.getNeighbors()
for neighbor in neighbors:
if potentialNeighbor.isSameTile(neighbor):
return True
return False
else:
'''//tiles of different size are adjacent if at least one neighbor of the smaller tile,
//but not the smaller tile itself, is contained within the bigger tile'''
if potentialNeighbor.getTileSize().getCodeLength() > self.tile_size.getCodeLength():
smallerTile = potentialNeighbor
biggerTile = self
else:
smallerTile = self
biggerTile = potentialNeighbor
if biggerTile.contains(smallerTile):
return False
neighbors = smallerTile.getNeighbors()
for neighbor in neighbors:
if biggerTile.contains(neighbor):
return True
return False
def contains(self, potentialMember):
'''/**
* Check if this tile contains another one.
* @param potentialMember the OpenGeoTile to check
* @return true if the area potentialMember falls within the area of this tile, including cases
* where both are the same; false if not
*/'''
# //if A contains B, then B's address has A's address as a prefix
return potentialMember.getTileAddress().startswith(self.getTileAddress())
def getManhattanTileDistanceTo(self, otherTile):
'''/**
* Calculates the Manhattan (city block) distance between this and another tile of the same size.
* @param otherTile another tile of the same size as this one
* @return an integer value corresponding to the number of tiles of the given size that need to
* be traversed getting from one to the other tile
* @throws IllegalArgumentException thrown if otherTile has different {@link TileSize}
*/'''
if otherTile.getTileSize() != self.getTileSize():
raise Exception("Tile sizes don't match")
return self.getLatitudinalTileDistance(otherTile, True) + self.getLongitudinalTileDistance(otherTile, True)
def getChebyshevTileDistanceTo(self, otherTile):
'''/**
* Calculates the Chebyshev (chessboard) distance between this and another tile of the same size.
* @param otherTile another tile of the same size as this one
* @return an integer value corresponding to the number of tiles of the given size that need to
* be traversed getting from one to the other tile
* @throws IllegalArgumentException thrown if otherTile has different {@link TileSize}
*/'''
if otherTile.getTileSize() != self.getTileSize():
raise Exception("Tile sizes don't match")
return max(self.getLatitudinalTileDistance(otherTile, True),
self.getLongitudinalTileDistance(otherTile, True))
def getDirection(self, otherTile):
'''/**
* Returns the approximate direction of the other tile relative to this. The return value can
* have a large margin of error, especially for big or far away tiles, so this should only be
* interpreted as a very rough approximation and used as such.
* @param otherTile another tile of the same size as this one
* @return an angle in radians, 0 being an eastward direction, +/- PI being westward direction
* @throws IllegalArgumentException thrown if otherTile has different {@link TileSize}
*/'''
if otherTile.getTileSize() != self.getTileSize():
raise Exception("Tile sizes don't match")
xDiff = int(self.getLongitudinalTileDistance(otherTile, False))
yDiff = int(self.getLatitudinalTileDistance(otherTile, False))
return math.atan2(yDiff, xDiff)
def getEightPointDirectionOfNeighbor(self, neighborTile):
''' returns neighbor's direction, to assist in expanding tile areas '''
if not self.isNeighbor(neighborTile):
raise Exception("neighborTile must be neighbor")
if neighborTile.getTileSize() != self.getTileSize():
raise Exception("Tile sizes don't match")
self_tile_x = self.getTileAddress()[-2]
self_tile_y = self.getTileAddress()[-1]
other_tile_x = neighborTile.getTileAddress()[-2]
other_tile_y = neighborTile.getTileAddress()[-1]
direction = ""
north_south = None
if self_tile_x != other_tile_x:
''' one tile is above the other '''
if CODE_ALPHABET.find(self_tile_x) in [0, len(CODE_ALPHABET)-1] and CODE_ALPHABET.find(other_tile_x) in [0, len(CODE_ALPHABET)-1]:
''' ajacent parent tiles '''
if CODE_ALPHABET.find(other_tile_x) == 0:
''' other tile is above -> neighborTile is north '''
direction = direction + 'N'
else:
direction = direction + 'S'
else:
if CODE_ALPHABET.find(self_tile_x) < CODE_ALPHABET.find(other_tile_x):
''' other tile is above -> neighborTile is north '''
direction = direction + 'N'
else:
''' other tile is below -> neighborTile is south '''
direction = direction + 'S'
if self_tile_y != other_tile_y:
''' one tile is above the other '''
if CODE_ALPHABET.find(self_tile_y) in [0, len(CODE_ALPHABET)-1] and CODE_ALPHABET.find(other_tile_y) in [0, len(CODE_ALPHABET)-1]:
''' ajacent parent tiles '''
if CODE_ALPHABET.find(other_tile_y) == 0:
''' other tile is right -> neighborTile is east '''
direction = direction + 'E'
else:
''' other tile is left -> neighborTile is west '''
direction = direction + 'W'
else:
if CODE_ALPHABET.find(self_tile_y) < CODE_ALPHABET.find(other_tile_y):
''' other tile is right -> neighborTile is east '''
direction = direction + 'E'
else:
''' other tile is left -> neighborTile is west '''
direction = direction + 'W'
return direction
def getCharacterIndex(self, c):
'''//following definitions copied from OpenLocationCode.java'''
index = "23456789CFGHJMPQRVWX".find(c.upper())
if index == -1:
raise Exception("Character does not exist in alphabet")
return index
def characterDistance(self, c1, c2):
return self.getCharacterIndex(c1) - self.getCharacterIndex(c2)
def getLatitudinalTileDistance(self, otherTile, absolute_value_bool):
if otherTile.getTileSize() != self.getTileSize():
raise Exception("Tile sizes don't match")
numIterations = self.tile_size.getCodeLength()/2 #1..5
tileDistance = 0
for i in range(int(numIterations)):
tileDistance *= 20
c1 = self.getTileAddress()[i*2]
c2 = otherTile.getTileAddress()[i*2]
tileDistance += self.characterDistance(c1,c2)
if absolute_value_bool:
return abs(tileDistance)
return tileDistance
def getLongitudinalTileDistance(self, otherTile, absolute_value_bool):
if otherTile.getTileSize() != self.getTileSize():
raise Exception("Tile sizes don't match")
numIterations = self.tile_size.getCodeLength()/2 #; //1..5
tileDistance = 0
for i in range(int(numIterations)):
tileDistance *= 20
c1 = self.getTileAddress()[i*2 + 1]
c2 = otherTile.getTileAddress()[i*2 + 1]
if i == 0:
'''//for the first longitudinal value, we need to take care of wrapping - basically,
//if it's shorter to go the other way around, do so'''
firstDiff = self.characterDistance(c1, c2)
NUM_CHARACTERS_USED = 18 #; //360°/20° = 18
if abs(firstDiff) > NUM_CHARACTERS_USED/2:
if firstDiff > 0:
firstDiff -= NUM_CHARACTERS_USED
else:
firstDiff += NUM_CHARACTERS_USED
tileDistance += firstDiff
else:
tileDistance += self.characterDistance(c1, c2)
if absolute_value_bool:
return abs(tileDistance)
return tileDistance
def returnSetOfSubtiles(self, desired_tile_size=TileSize.PINPOINT):
if self.tile_size.getCodeLength() == desired_tile_size.getCodeLength():
''' tile is desired size '''
return self
elif self.tile_size.getCodeLength() > desired_tile_size.getCodeLength():
'desired_tile_size is too big'
raise Exception("OLC padding larger than allowed by desired_tile_size")
iterations_needed = desired_tile_size.getCodeLength()/2 - self.tile_size.getCodeLength()/2
address_set = set([self.getTileAddress()])
for i in range(int(iterations_needed)):
address_set = return_set_of_subaddresses(address_set)
tile_set = {OpenGeoTile(address) for address in address_set}
return tile_set
def returnSetOfBorderSubtiles(self, desired_tile_size=TileSize.PINPOINT, eight_point_direction=None):
address = self.getTileAddress()
if len(address) == TileSize.PINPOINT.getCodeLength():
''' address already minimum possible size '''
return None
elif self.tile_size.getCodeLength() > desired_tile_size.getCodeLength():
'desired_tile_size is too big'
raise Exception("OLC padding larger than allowed by desired_tile_size")
iterations_needed = int(desired_tile_size.getCodeLength()/2 - self.tile_size.getCodeLength()/2)
north_set = set()
east_set = set()
south_set = set()
west_set = set()
if isinstance(eight_point_direction, str):
eight_point_direction = eight_point_direction.upper()
set_of_border_subaddresses = set()
if eight_point_direction is None:
''' all borders '''
''' traveling salesman problem '''
''' let's do it once, and try to reduce by swaping digits '''
all_border_set = memoized_digit_dict.get(f"A{iterations_needed}")
if not all_border_set:
north_base_set = memoized_digit_dict.get(f"N{iterations_needed}")
if not north_base_set:
self.memoizeDigitDict("N", iterations_needed)
north_set = memoized_digit_dict.get(f"N{iterations_needed}")
east_set = memoized_digit_dict.get(f"E{iterations_needed}", set())
south_set = memoized_digit_dict.get(f"S{iterations_needed}", set())
west_set = memoized_digit_dict.get(f"W{iterations_needed}", set())
east_exists = east_set != set()
south_exists = south_set != set()
west_exists = west_set != set()
for base in north_set:
east_base = ""
south_base = ""
west_base = ""
base_tuple_list = re.findall('..', base)
''' north will be Xd
east dX
south 2d
west d2'''
for n_tuple in base_tuple_list:
relevant_digit = n_tuple[1]
if not east_exists:
east_base += relevant_digit + "X"
if not south_exists:
south_base += "2" + relevant_digit
if not west_exists:
west_base += relevant_digit + "2"
if not east_exists:
east_set.add(east_base)
if not south_exists:
south_set.add(south_base)
if not west_exists:
west_set.add(west_base)
memoized_digit_dict[f"E{iterations_needed}"] = east_set
memoized_digit_dict[f"S{iterations_needed}"] = south_set
memoized_digit_dict[f"W{iterations_needed}"] = west_set
all_border_set = north_set | east_set | south_set | west_set
memoized_digit_dict[f"A{iterations_needed}"] = all_border_set
return {OpenGeoTile(address+base) for base in all_border_set}
elif len(eight_point_direction) == 1:
''' North, South, East, or West '''
base_set = memoized_digit_dict.get(f"{eight_point_direction}{iterations_needed}")
if not base_set:
self.memoizeDigitDict(eight_point_direction, iterations_needed)
base_set = memoized_digit_dict.get(f'{eight_point_direction}{iterations_needed}')
return {OpenGeoTile(address + base) for base in base_set}
elif len(eight_point_direction) == 2:
''' NW, NE, SW, SE... should return only one tile'''
ordinal_digit_dict = {
'NW': 'X2',
'NE': 'XX',
'SE': '2X',
'SW': '22'
}
base = ''
for i in range(iterations_needed):
base += ordinal_digit_dict.get(eight_point_direction)
return {OpenGeoTile(address + base)}
def memoizeDigitDict(self, eight_point_direction, iterations_needed):
base_set = memoized_digit_dict.get(f"{eight_point_direction}{iterations_needed}")
if not base_set:
quickest_i = 0
for i in reversed(range(iterations_needed)):
if memoized_digit_dict.get(f"{eight_point_direction}{i + 1}"):
quickest_i = i
break
for i in range(quickest_i, iterations_needed):
existing_bases = memoized_digit_dict.get(f"{eight_point_direction}{i + 1}")
next_set = {existing_base + base for existing_base in existing_bases for base in memoized_digit_dict.get(f"{eight_point_direction}1")}
memoized_digit_dict[f"{eight_point_direction}{i + 2}"] = next_set
| from openlocationcode import openlocationcode as olc
from enum import Enum
import math, re
class TileSize(Enum):
''' An area of 20° x 20°. The side length of this tile varies with its location on the globe,
but can be up to approximately 2200km. Tile addresses will be 2 characters long.'''
GLOBAL = (2, 20.0)
''' An area of 1° x 1°. The side length of this tile varies with its location on the globe,
but can be up to approximately 110km. Tile addresses will be 4 characters long.'''
REGION = (4, 1.0)
''' An area of 0.05° x 0.05°. The side length of this tile varies with its location on the
globe, but can be up to approximately 5.5km. Tile addresses will be 6 characters long.'''
DISTRICT = (6, 0.05)
''' An area of 0.0025° x 0.0025°. The side length of this tile varies with its location on
the globe, but can be up to approximately 275m.
Tile addresses will be 8 characters long.'''
NEIGHBORHOOD = (8, 0.0025)
''' An area of 0.000125° x 0.000125°. The side length of this tile varies with its location
on the globe, but can be up to approximately 14m.
Tile addresses will be 10 characters long.'''
PINPOINT = (10, 0.000125)
def __init__(self, code_length, coordinate_increment):
self.code_length = code_length
self.coordinate_increment = coordinate_increment
def getCodeLength(self):
'''get 0th value'''
return self.code_length
def getCoordinateIncrement(self):
'''get 1th value'''
return self.coordinate_increment
# Copy from OpenLocationCode.java
# A separator used to break the code into two parts to aid memorability.
SEPARATOR = '+'
# Copy from OpenLocationCode.java
# The character used to pad codes.
PADDING_CHARACTER = '0'
PADDING_2 = "00"
PADDING_4 = "0000"
PADDING_6 = "000000"
CODE_ALPHABET = olc.CODE_ALPHABET_
BASE_20_SET = {x+y for x in CODE_ALPHABET for y in CODE_ALPHABET}
BASE_20_BORDER_SET = {x for x in BASE_20_SET if x[0] in ['2', 'X'] or x[1] in ['2', 'X']}
NORTH_DIGITS = {x for x in BASE_20_BORDER_SET if x[0] == 'X'}
EAST_DIGITS = {x for x in BASE_20_BORDER_SET if x[1] == 'X'}
SOUTH_DIGITS = {x for x in BASE_20_BORDER_SET if x[0] == '2'}
WEST_DIGITS = {x for x in BASE_20_BORDER_SET if x[1] == '2'}
memoized_digit_dict = {
"N1": NORTH_DIGITS,
"E1": EAST_DIGITS,
"S1": SOUTH_DIGITS,
"W1": WEST_DIGITS,
}
def is_padded(plus_code):
return plus_code.find(PADDING_CHARACTER) != -1
def is_tile_address(plus_code):
return plus_code.find(SEPARATOR) == -1
def return_code_of_tile_size(too_precise_plus_code, desired_tile_size):
code = too_precise_plus_code
if not is_tile_address(code):
code = code.replace(SEPARATOR, '')
if is_padded(code):
if code.find(PADDING_CHARACTER) < desired_tile_size.getCodeLength():
raise Exception("OLC padding larger than allowed by desired_tile_size")
code_address = code[:desired_tile_size.getCodeLength()]
full_length = TileSize.PINPOINT.getCodeLength()
code = code_address + ("0" * (full_length - len(code_address)))
if desired_tile_size == TileSize.PINPOINT:
code = code[:-2] + SEPARATOR + code[-2:]
else:
code = code[:-2] + SEPARATOR
return code
def return_set_of_subaddresses(set_of_addresses):
for address in set_of_addresses:
if len(address) == TileSize.PINPOINT.getCodeLength():
''' address already minimum possible size '''
return None
return {address+base for address in set_of_addresses for base in BASE_20_SET}
class OpenGeoTile():
'''
/**
* A wrapper around an {@code OpenLocationCode} object, focusing on the area identified by a prefix
* of the given OpenLocationCode.
*
* Using this wrapper class allows to determine whether two locations are in the same or adjacent
* "tiles", to determine all neighboring tiles of a given one, to calculate a distance in tiles etc.
*
* Open Location Code is a technology developed by Google and licensed under the Apache License 2.0.
* For more information, see https://github.com/google/open-location-code
*
* @author <NAME>
* @version 0.1.0
*/
Ported by scoofy on 08.31.21
'''
def __init__(self,
code=None,
tile_size=None,
lat=None,
long=None,
):
if not (code or (code and tile_size) or (lat and long)):
raise Exception("Invalid OpenGeoTile constructor arguments")
if lat and long:
self.constructTileFromLatLong(lat, long, tile_size)
elif code and tile_size:
self.constructTileFromCodeAndSize(code, tile_size)
elif code:
if is_tile_address(code):
self.constructTileFromTileAddress(code)
else:
self.constructTileFromCode(code)
self.tile_address = self.code.replace(SEPARATOR, "")[0: self.tile_size.getCodeLength()]
def constructTileFromCode(self, plus_code):
'''/**
* Creates a new OpenGeoTile from an existing
* {@link com.google.openlocationcode.OpenLocationCode}.
* @param olc OpenLocationCode for the current location. This can be a padded code, in which
* case the resulting OpenGeoTile will have a larger TileSize.
* @throws IllegalArgumentException if olc is not a full code
*/'''
if not olc.isFull(plus_code):
raise Exception("Only full OLC supported. Use olc.recoverNearest().")
self.code = plus_code.upper()
if is_padded(plus_code):
code_length = plus_code.find(PADDING_CHARACTER)
else:
code_length = min(len(plus_code)-1, 10)
if code_length == TileSize.GLOBAL.getCodeLength():
self.tile_size = TileSize.GLOBAL
elif code_length == TileSize.REGION.getCodeLength():
self.tile_size = TileSize.REGION
elif code_length == TileSize.DISTRICT.getCodeLength():
self.tile_size = TileSize.DISTRICT
elif code_length == TileSize.NEIGHBORHOOD.getCodeLength():
self.tile_size = TileSize.NEIGHBORHOOD
elif code_length == TileSize.PINPOINT.getCodeLength():
self.tile_size = TileSize.PINPOINT
else:
raise Exception("Too precise, sort this later")
def constructTileFromCodeAndSize(self, plus_code, tile_size):
'''
Creates a new OpenGeoTile from an existing
{@link com.google.openlocationcode.OpenLocationCode}.
@param olc OpenLocationCode for the current location
@param tile_size tile size to use for this OpenGeoTile
@throws IllegalArgumentException when trying to pass a short (non-full) OLC, or if OLC has
too much padding for given tile_size
'''
if not olc.isFull(plus_code):
raise Exception("Only full OLC supported. Use recover().")
modified_plus_code = return_code_of_tile_size(plus_code, tile_size)
self.code = modified_plus_code.upper()
self.tile_size = tile_size
def constructTileFromLatLong(self, lat: float, long: float, tile_size=None):
'''/**
* Creates a new OpenGeoTile from lat/long coordinates.
* @param latitude latitude of the location
* @param longitude longitude of the location
* @param tile_size tile size to use for this OpenGeoTile
* @throws IllegalArgumentException passed through from
* {@link OpenLocationCode#OpenLocationCode(double, double, int)}
*/'''
if not tile_size:
tile_size = TileSize.PINPOINT
self.code = olc.encode(lat, long, tile_size.getCodeLength()).upper()
self.tile_size = tile_size
def constructTileFromTileAddress(self, tileAddress):
'''/**
* Creates a new OpenGeoTile from a tile address.
* @param tileAddress a tile address is a [2/4/6/8/10]-character string that corresponds to a
* valid {@link com.google.openlocationcode.OpenLocationCode} after removing
* '+' and an additional number of trailing characters; tile size is
* determined by the length of this address
* @throws IllegalArgumentException passed through from
* {@link OpenLocationCode#OpenLocationCode(String)} or thrown if tileAddress is of
* invalid length
*/'''
detectedTileSize = None
olcBuilder = ""
if len(tileAddress) == TileSize.GLOBAL.getCodeLength():
detectedTileSize = TileSize.GLOBAL
olcBuilder += tileAddress + PADDING_6 + SEPARATOR
if len(tileAddress) == TileSize.REGION.getCodeLength():
detectedTileSize = TileSize.REGION
olcBuilder += tileAddress + PADDING_4 + SEPARATOR
if len(tileAddress) == TileSize.DISTRICT.getCodeLength():
detectedTileSize = TileSize.DISTRICT
olcBuilder += tileAddress + PADDING_2 + SEPARATOR
if len(tileAddress) == TileSize.NEIGHBORHOOD.getCodeLength():
detectedTileSize = TileSize.NEIGHBORHOOD
olcBuilder += tileAddress + SEPARATOR
if len(tileAddress) == TileSize.PINPOINT.getCodeLength():
detectedTileSize = TileSize.PINPOINT
olcBuilder += tileAddress[0:8] + SEPARATOR + tileAddress[8:10]
if detectedTileSize == None:
print(tileAddress)
raise Exception("Invalid tile address")
self.tile_size = detectedTileSize
self.code = olcBuilder.upper()
def getWrappedOpenLocationCode(self):
# this code is effectively redundant as python has no wrapping
'''/**
* The exact {@link com.google.openlocationcode.OpenLocationCode} wrapped by this OpenGeoTile.
* For the plus code of the whole tile, see {@link #getTileOpenLocationCode()}.
* @return the exact plus code wrapped by this OpenGeoTile
*/'''
return self.code
def returnCode(self):
return self.code
def getTileSize(self):
'''/**
* Get the {@link TileSize} of this OpenGeoTile.
* @return the {@link TileSize} of this OpenGeoTile
*/'''
return self.tile_size
def getTileAddress(self):
'''/**
* A tile address is a string of length 2, 4, 6, 8, or 10, which corresponds to a valid
* {@link com.google.openlocationcode.OpenLocationCode} after padding with an appropriate
* number of '0' and '+' characters. Example: Address "CVXW" corresponds to OLC "CVXW0000+"
* @return the tile address of this OpenGeoTile;
*/'''
return self.tile_address
def getTileAddressPrefix(self):
'''/**
* The prefix of a tile address is the address of the next biggest tile at this location.
* @return this tile's address with the final two characters removed. In case of a GLOBAL tile,
* returns the empty string.
*/'''
if self.tile_size == TileSize.GLOBAL:
return ""
else:
return self.getTileAddress()[0: self.tile_size.getCodeLength()-2]
def getParentTileAddress(self):
return self.getTileAddressPrefix()
def getTileOpenLocationCode(self):
# this code is redundant
'''/**
* The full {@link com.google.openlocationcode.OpenLocationCode} for this tile. Other than
* {@link #getWrappedOpenLocationCode()}, this will return a full plus code for the whole tile.
* @return a plus code for the whole tile, probably padded with '0' characters
*/'''
return self.getWrappedOpenLocationCode()
def getNeighbors(self, eight_point_direction=None):
'''/**
* Get an array of the typically 8 neighboring tiles of the same size.
* @return an array of the typically 8 neighboring tiles of the same size;
* may return less than 8 neighbors for tiles near the poles.
*/'''
# deltas = [20.0, 1.0, 0.05, 0.0025, 0.000125]
delta = self.getTileSize().getCoordinateIncrement()
code_area = olc.decode(self.code)
latitude = code_area.latitudeCenter
longitude = code_area.longitudeCenter
'''directions_list included to keep ordered data'''
directions_list = ["NW", "N", "NE", "E", "SE", "S", "SW", "W"]
direction_dict = {
"NW": [+1, -1], "N": [+1, 0], "NE": [+1, +1],
"W": [ 0, -1], "E": [ 0, +1],
"SW": [-1, -1], "S": [-1, 0], "SE": [-1, +1],
}
#lat_diff = [+1, +1, +1, 0, -1, -1, -1, 0]
#long_diff = [-1, 0, +1, +1, +1, 0, -1, -1]
if not type(eight_point_direction) in [type(None), list, str]:
raise Exception("eight_point_direction must be of type list or str")
if eight_point_direction is None:
directions = directions_list
elif isinstance(eight_point_direction, str):
directions = []
if eight_point_direction.upper() in directions_list:
directions.append(eight_point_direction.upper())
else:
''' this list construction keeps directions in the order above '''
uppercase_input_directions = [d.upper() for d in eight_point_direction]
directions = [direction for direction in directions_list if direction in uppercase_input_directions]
neighbors = set()
for direction in directions:
lat_diff, long_diff = direction_dict.get(direction)
''' //OLC constructor clips and normalizes,
//so we don't have to deal with invalid lat/long values directly'''
neighborLatitude = latitude + (delta * lat_diff)
neighborLongitude = longitude + (delta * long_diff)
new_OpenGeoTile = OpenGeoTile(lat=neighborLatitude, long=neighborLongitude, tile_size=self.getTileSize())
if not self.isSameTile(new_OpenGeoTile):
'''//don't add tiles that are the same as this one due to clipping near the poles'''
neighbors.add(new_OpenGeoTile)
return neighbors
def isSameTile(self, potentialSameTile):
'''/**
* Check if a tile describes the same area as this one.
* @param potentialSameTile the OpenGeoTile to check
* @return true if tile sizes and addresses are the same; false if not
*/'''
if potentialSameTile.getTileSize() != self.getTileSize():
return False
return potentialSameTile.getTileAddress() == self.getTileAddress()
def isNeighbor(self, potentialNeighbor):
'''/**
* Check if a tile is neighboring this one.
* @param potentialNeighbor the OpenGeoTile to check
* @return true if this and potentialNeighbor are adjacent (8-neighborhood);
* false if not
*/'''
if potentialNeighbor.getTileSize() == self.getTileSize():
'''//avoid iterating over neighbors for same tile'''
if self.isSameTile(potentialNeighbor):
return False
neighbors = self.getNeighbors()
for neighbor in neighbors:
if potentialNeighbor.isSameTile(neighbor):
return True
return False
else:
'''//tiles of different size are adjacent if at least one neighbor of the smaller tile,
//but not the smaller tile itself, is contained within the bigger tile'''
if potentialNeighbor.getTileSize().getCodeLength() > self.tile_size.getCodeLength():
smallerTile = potentialNeighbor
biggerTile = self
else:
smallerTile = self
biggerTile = potentialNeighbor
if biggerTile.contains(smallerTile):
return False
neighbors = smallerTile.getNeighbors()
for neighbor in neighbors:
if biggerTile.contains(neighbor):
return True
return False
def contains(self, potentialMember):
'''/**
* Check if this tile contains another one.
* @param potentialMember the OpenGeoTile to check
* @return true if the area potentialMember falls within the area of this tile, including cases
* where both are the same; false if not
*/'''
# //if A contains B, then B's address has A's address as a prefix
return potentialMember.getTileAddress().startswith(self.getTileAddress())
def getManhattanTileDistanceTo(self, otherTile):
'''/**
* Calculates the Manhattan (city block) distance between this and another tile of the same size.
* @param otherTile another tile of the same size as this one
* @return an integer value corresponding to the number of tiles of the given size that need to
* be traversed getting from one to the other tile
* @throws IllegalArgumentException thrown if otherTile has different {@link TileSize}
*/'''
if otherTile.getTileSize() != self.getTileSize():
raise Exception("Tile sizes don't match")
return self.getLatitudinalTileDistance(otherTile, True) + self.getLongitudinalTileDistance(otherTile, True)
def getChebyshevTileDistanceTo(self, otherTile):
'''/**
* Calculates the Chebyshev (chessboard) distance between this and another tile of the same size.
* @param otherTile another tile of the same size as this one
* @return an integer value corresponding to the number of tiles of the given size that need to
* be traversed getting from one to the other tile
* @throws IllegalArgumentException thrown if otherTile has different {@link TileSize}
*/'''
if otherTile.getTileSize() != self.getTileSize():
raise Exception("Tile sizes don't match")
return max(self.getLatitudinalTileDistance(otherTile, True),
self.getLongitudinalTileDistance(otherTile, True))
def getDirection(self, otherTile):
'''/**
* Returns the approximate direction of the other tile relative to this. The return value can
* have a large margin of error, especially for big or far away tiles, so this should only be
* interpreted as a very rough approximation and used as such.
* @param otherTile another tile of the same size as this one
* @return an angle in radians, 0 being an eastward direction, +/- PI being westward direction
* @throws IllegalArgumentException thrown if otherTile has different {@link TileSize}
*/'''
if otherTile.getTileSize() != self.getTileSize():
raise Exception("Tile sizes don't match")
xDiff = int(self.getLongitudinalTileDistance(otherTile, False))
yDiff = int(self.getLatitudinalTileDistance(otherTile, False))
return math.atan2(yDiff, xDiff)
def getEightPointDirectionOfNeighbor(self, neighborTile):
''' returns neighbor's direction, to assist in expanding tile areas '''
if not self.isNeighbor(neighborTile):
raise Exception("neighborTile must be neighbor")
if neighborTile.getTileSize() != self.getTileSize():
raise Exception("Tile sizes don't match")
self_tile_x = self.getTileAddress()[-2]
self_tile_y = self.getTileAddress()[-1]
other_tile_x = neighborTile.getTileAddress()[-2]
other_tile_y = neighborTile.getTileAddress()[-1]
direction = ""
north_south = None
if self_tile_x != other_tile_x:
''' one tile is above the other '''
if CODE_ALPHABET.find(self_tile_x) in [0, len(CODE_ALPHABET)-1] and CODE_ALPHABET.find(other_tile_x) in [0, len(CODE_ALPHABET)-1]:
''' ajacent parent tiles '''
if CODE_ALPHABET.find(other_tile_x) == 0:
''' other tile is above -> neighborTile is north '''
direction = direction + 'N'
else:
direction = direction + 'S'
else:
if CODE_ALPHABET.find(self_tile_x) < CODE_ALPHABET.find(other_tile_x):
''' other tile is above -> neighborTile is north '''
direction = direction + 'N'
else:
''' other tile is below -> neighborTile is south '''
direction = direction + 'S'
if self_tile_y != other_tile_y:
''' one tile is above the other '''
if CODE_ALPHABET.find(self_tile_y) in [0, len(CODE_ALPHABET)-1] and CODE_ALPHABET.find(other_tile_y) in [0, len(CODE_ALPHABET)-1]:
''' ajacent parent tiles '''
if CODE_ALPHABET.find(other_tile_y) == 0:
''' other tile is right -> neighborTile is east '''
direction = direction + 'E'
else:
''' other tile is left -> neighborTile is west '''
direction = direction + 'W'
else:
if CODE_ALPHABET.find(self_tile_y) < CODE_ALPHABET.find(other_tile_y):
''' other tile is right -> neighborTile is east '''
direction = direction + 'E'
else:
''' other tile is left -> neighborTile is west '''
direction = direction + 'W'
return direction
def getCharacterIndex(self, c):
'''//following definitions copied from OpenLocationCode.java'''
index = "23456789CFGHJMPQRVWX".find(c.upper())
if index == -1:
raise Exception("Character does not exist in alphabet")
return index
def characterDistance(self, c1, c2):
return self.getCharacterIndex(c1) - self.getCharacterIndex(c2)
def getLatitudinalTileDistance(self, otherTile, absolute_value_bool):
if otherTile.getTileSize() != self.getTileSize():
raise Exception("Tile sizes don't match")
numIterations = self.tile_size.getCodeLength()/2 #1..5
tileDistance = 0
for i in range(int(numIterations)):
tileDistance *= 20
c1 = self.getTileAddress()[i*2]
c2 = otherTile.getTileAddress()[i*2]
tileDistance += self.characterDistance(c1,c2)
if absolute_value_bool:
return abs(tileDistance)
return tileDistance
def getLongitudinalTileDistance(self, otherTile, absolute_value_bool):
if otherTile.getTileSize() != self.getTileSize():
raise Exception("Tile sizes don't match")
numIterations = self.tile_size.getCodeLength()/2 #; //1..5
tileDistance = 0
for i in range(int(numIterations)):
tileDistance *= 20
c1 = self.getTileAddress()[i*2 + 1]
c2 = otherTile.getTileAddress()[i*2 + 1]
if i == 0:
'''//for the first longitudinal value, we need to take care of wrapping - basically,
//if it's shorter to go the other way around, do so'''
firstDiff = self.characterDistance(c1, c2)
NUM_CHARACTERS_USED = 18 #; //360°/20° = 18
if abs(firstDiff) > NUM_CHARACTERS_USED/2:
if firstDiff > 0:
firstDiff -= NUM_CHARACTERS_USED
else:
firstDiff += NUM_CHARACTERS_USED
tileDistance += firstDiff
else:
tileDistance += self.characterDistance(c1, c2)
if absolute_value_bool:
return abs(tileDistance)
return tileDistance
def returnSetOfSubtiles(self, desired_tile_size=TileSize.PINPOINT):
if self.tile_size.getCodeLength() == desired_tile_size.getCodeLength():
''' tile is desired size '''
return self
elif self.tile_size.getCodeLength() > desired_tile_size.getCodeLength():
'desired_tile_size is too big'
raise Exception("OLC padding larger than allowed by desired_tile_size")
iterations_needed = desired_tile_size.getCodeLength()/2 - self.tile_size.getCodeLength()/2
address_set = set([self.getTileAddress()])
for i in range(int(iterations_needed)):
address_set = return_set_of_subaddresses(address_set)
tile_set = {OpenGeoTile(address) for address in address_set}
return tile_set
def returnSetOfBorderSubtiles(self, desired_tile_size=TileSize.PINPOINT, eight_point_direction=None):
address = self.getTileAddress()
if len(address) == TileSize.PINPOINT.getCodeLength():
''' address already minimum possible size '''
return None
elif self.tile_size.getCodeLength() > desired_tile_size.getCodeLength():
'desired_tile_size is too big'
raise Exception("OLC padding larger than allowed by desired_tile_size")
iterations_needed = int(desired_tile_size.getCodeLength()/2 - self.tile_size.getCodeLength()/2)
north_set = set()
east_set = set()
south_set = set()
west_set = set()
if isinstance(eight_point_direction, str):
eight_point_direction = eight_point_direction.upper()
set_of_border_subaddresses = set()
if eight_point_direction is None:
''' all borders '''
''' traveling salesman problem '''
''' let's do it once, and try to reduce by swaping digits '''
all_border_set = memoized_digit_dict.get(f"A{iterations_needed}")
if not all_border_set:
north_base_set = memoized_digit_dict.get(f"N{iterations_needed}")
if not north_base_set:
self.memoizeDigitDict("N", iterations_needed)
north_set = memoized_digit_dict.get(f"N{iterations_needed}")
east_set = memoized_digit_dict.get(f"E{iterations_needed}", set())
south_set = memoized_digit_dict.get(f"S{iterations_needed}", set())
west_set = memoized_digit_dict.get(f"W{iterations_needed}", set())
east_exists = east_set != set()
south_exists = south_set != set()
west_exists = west_set != set()
for base in north_set:
east_base = ""
south_base = ""
west_base = ""
base_tuple_list = re.findall('..', base)
''' north will be Xd
east dX
south 2d
west d2'''
for n_tuple in base_tuple_list:
relevant_digit = n_tuple[1]
if not east_exists:
east_base += relevant_digit + "X"
if not south_exists:
south_base += "2" + relevant_digit
if not west_exists:
west_base += relevant_digit + "2"
if not east_exists:
east_set.add(east_base)
if not south_exists:
south_set.add(south_base)
if not west_exists:
west_set.add(west_base)
memoized_digit_dict[f"E{iterations_needed}"] = east_set
memoized_digit_dict[f"S{iterations_needed}"] = south_set
memoized_digit_dict[f"W{iterations_needed}"] = west_set
all_border_set = north_set | east_set | south_set | west_set
memoized_digit_dict[f"A{iterations_needed}"] = all_border_set
return {OpenGeoTile(address+base) for base in all_border_set}
elif len(eight_point_direction) == 1:
''' North, South, East, or West '''
base_set = memoized_digit_dict.get(f"{eight_point_direction}{iterations_needed}")
if not base_set:
self.memoizeDigitDict(eight_point_direction, iterations_needed)
base_set = memoized_digit_dict.get(f'{eight_point_direction}{iterations_needed}')
return {OpenGeoTile(address + base) for base in base_set}
elif len(eight_point_direction) == 2:
''' NW, NE, SW, SE... should return only one tile'''
ordinal_digit_dict = {
'NW': 'X2',
'NE': 'XX',
'SE': '2X',
'SW': '22'
}
base = ''
for i in range(iterations_needed):
base += ordinal_digit_dict.get(eight_point_direction)
return {OpenGeoTile(address + base)}
def memoizeDigitDict(self, eight_point_direction, iterations_needed):
base_set = memoized_digit_dict.get(f"{eight_point_direction}{iterations_needed}")
if not base_set:
quickest_i = 0
for i in reversed(range(iterations_needed)):
if memoized_digit_dict.get(f"{eight_point_direction}{i + 1}"):
quickest_i = i
break
for i in range(quickest_i, iterations_needed):
existing_bases = memoized_digit_dict.get(f"{eight_point_direction}{i + 1}")
next_set = {existing_base + base for existing_base in existing_bases for base in memoized_digit_dict.get(f"{eight_point_direction}1")}
memoized_digit_dict[f"{eight_point_direction}{i + 2}"] = next_set | en | 0.813351 | An area of 20° x 20°. The side length of this tile varies with its location on the globe, but can be up to approximately 2200km. Tile addresses will be 2 characters long. An area of 1° x 1°. The side length of this tile varies with its location on the globe, but can be up to approximately 110km. Tile addresses will be 4 characters long. An area of 0.05° x 0.05°. The side length of this tile varies with its location on the globe, but can be up to approximately 5.5km. Tile addresses will be 6 characters long. An area of 0.0025° x 0.0025°. The side length of this tile varies with its location on the globe, but can be up to approximately 275m. Tile addresses will be 8 characters long. An area of 0.000125° x 0.000125°. The side length of this tile varies with its location on the globe, but can be up to approximately 14m. Tile addresses will be 10 characters long. get 0th value get 1th value # Copy from OpenLocationCode.java # A separator used to break the code into two parts to aid memorability. # Copy from OpenLocationCode.java # The character used to pad codes. address already minimum possible size /** * A wrapper around an {@code OpenLocationCode} object, focusing on the area identified by a prefix * of the given OpenLocationCode. * * Using this wrapper class allows to determine whether two locations are in the same or adjacent * "tiles", to determine all neighboring tiles of a given one, to calculate a distance in tiles etc. * * Open Location Code is a technology developed by Google and licensed under the Apache License 2.0. * For more information, see https://github.com/google/open-location-code * * @author <NAME> * @version 0.1.0 */ Ported by scoofy on 08.31.21 /** * Creates a new OpenGeoTile from an existing * {@link com.google.openlocationcode.OpenLocationCode}. * @param olc OpenLocationCode for the current location. This can be a padded code, in which * case the resulting OpenGeoTile will have a larger TileSize. * @throws IllegalArgumentException if olc is not a full code */ Creates a new OpenGeoTile from an existing {@link com.google.openlocationcode.OpenLocationCode}. @param olc OpenLocationCode for the current location @param tile_size tile size to use for this OpenGeoTile @throws IllegalArgumentException when trying to pass a short (non-full) OLC, or if OLC has too much padding for given tile_size /** * Creates a new OpenGeoTile from lat/long coordinates. * @param latitude latitude of the location * @param longitude longitude of the location * @param tile_size tile size to use for this OpenGeoTile * @throws IllegalArgumentException passed through from * {@link OpenLocationCode#OpenLocationCode(double, double, int)} */ /** * Creates a new OpenGeoTile from a tile address. * @param tileAddress a tile address is a [2/4/6/8/10]-character string that corresponds to a * valid {@link com.google.openlocationcode.OpenLocationCode} after removing * '+' and an additional number of trailing characters; tile size is * determined by the length of this address * @throws IllegalArgumentException passed through from * {@link OpenLocationCode#OpenLocationCode(String)} or thrown if tileAddress is of * invalid length */ # this code is effectively redundant as python has no wrapping /** * The exact {@link com.google.openlocationcode.OpenLocationCode} wrapped by this OpenGeoTile. * For the plus code of the whole tile, see {@link #getTileOpenLocationCode()}. * @return the exact plus code wrapped by this OpenGeoTile */ /** * Get the {@link TileSize} of this OpenGeoTile. * @return the {@link TileSize} of this OpenGeoTile */ /** * A tile address is a string of length 2, 4, 6, 8, or 10, which corresponds to a valid * {@link com.google.openlocationcode.OpenLocationCode} after padding with an appropriate * number of '0' and '+' characters. Example: Address "CVXW" corresponds to OLC "CVXW0000+" * @return the tile address of this OpenGeoTile; */ /** * The prefix of a tile address is the address of the next biggest tile at this location. * @return this tile's address with the final two characters removed. In case of a GLOBAL tile, * returns the empty string. */ # this code is redundant /** * The full {@link com.google.openlocationcode.OpenLocationCode} for this tile. Other than * {@link #getWrappedOpenLocationCode()}, this will return a full plus code for the whole tile. * @return a plus code for the whole tile, probably padded with '0' characters */ /** * Get an array of the typically 8 neighboring tiles of the same size. * @return an array of the typically 8 neighboring tiles of the same size; * may return less than 8 neighbors for tiles near the poles. */ # deltas = [20.0, 1.0, 0.05, 0.0025, 0.000125] directions_list included to keep ordered data #lat_diff = [+1, +1, +1, 0, -1, -1, -1, 0] #long_diff = [-1, 0, +1, +1, +1, 0, -1, -1] this list construction keeps directions in the order above //OLC constructor clips and normalizes, //so we don't have to deal with invalid lat/long values directly //don't add tiles that are the same as this one due to clipping near the poles /** * Check if a tile describes the same area as this one. * @param potentialSameTile the OpenGeoTile to check * @return true if tile sizes and addresses are the same; false if not */ /** * Check if a tile is neighboring this one. * @param potentialNeighbor the OpenGeoTile to check * @return true if this and potentialNeighbor are adjacent (8-neighborhood); * false if not */ //avoid iterating over neighbors for same tile //tiles of different size are adjacent if at least one neighbor of the smaller tile, //but not the smaller tile itself, is contained within the bigger tile /** * Check if this tile contains another one. * @param potentialMember the OpenGeoTile to check * @return true if the area potentialMember falls within the area of this tile, including cases * where both are the same; false if not */ # //if A contains B, then B's address has A's address as a prefix /** * Calculates the Manhattan (city block) distance between this and another tile of the same size. * @param otherTile another tile of the same size as this one * @return an integer value corresponding to the number of tiles of the given size that need to * be traversed getting from one to the other tile * @throws IllegalArgumentException thrown if otherTile has different {@link TileSize} */ /** * Calculates the Chebyshev (chessboard) distance between this and another tile of the same size. * @param otherTile another tile of the same size as this one * @return an integer value corresponding to the number of tiles of the given size that need to * be traversed getting from one to the other tile * @throws IllegalArgumentException thrown if otherTile has different {@link TileSize} */ /** * Returns the approximate direction of the other tile relative to this. The return value can * have a large margin of error, especially for big or far away tiles, so this should only be * interpreted as a very rough approximation and used as such. * @param otherTile another tile of the same size as this one * @return an angle in radians, 0 being an eastward direction, +/- PI being westward direction * @throws IllegalArgumentException thrown if otherTile has different {@link TileSize} */ returns neighbor's direction, to assist in expanding tile areas one tile is above the other ajacent parent tiles other tile is above -> neighborTile is north other tile is above -> neighborTile is north other tile is below -> neighborTile is south one tile is above the other ajacent parent tiles other tile is right -> neighborTile is east other tile is left -> neighborTile is west other tile is right -> neighborTile is east other tile is left -> neighborTile is west //following definitions copied from OpenLocationCode.java #1..5 #; //1..5 //for the first longitudinal value, we need to take care of wrapping - basically, //if it's shorter to go the other way around, do so #; //360°/20° = 18 tile is desired size address already minimum possible size all borders traveling salesman problem let's do it once, and try to reduce by swaping digits north will be Xd east dX south 2d west d2 North, South, East, or West NW, NE, SW, SE... should return only one tile | 3.147942 | 3 |
deep-rl/lib/python2.7/site-packages/OpenGL/arrays/arraydatatype.py | ShujaKhalid/deep-rl | 87 | 2817 | """Array data-type implementations (abstraction points for GL array types"""
import ctypes
import OpenGL
from OpenGL.raw.GL import _types
from OpenGL import plugins
from OpenGL.arrays import formathandler, _arrayconstants as GL_1_1
from OpenGL import logs
_log = logs.getLog( 'OpenGL.arrays.arraydatatype' )
from OpenGL import acceleratesupport
ADT = None
if acceleratesupport.ACCELERATE_AVAILABLE:
try:
from OpenGL_accelerate.arraydatatype import ArrayDatatype as ADT
except ImportError as err:
_log.warn(
"Unable to load ArrayDatatype accelerator from OpenGL_accelerate"
)
if ADT is None:
# Python-coded version
class HandlerRegistry( dict ):
GENERIC_OUTPUT_PREFERENCES = ['numpy','ctypesarrays']
def __init__( self, plugin_match ):
self.match = plugin_match
self.output_handler = None
self.preferredOutput = None
self.all_output_handlers = []
def __call__( self, value ):
"""Lookup of handler for given value"""
try:
typ = value.__class__
except AttributeError as err:
typ = type(value)
handler = self.get( typ )
if not handler:
if hasattr( typ, '__mro__' ):
for base in typ.__mro__:
handler = self.get( base )
if not handler:
handler = self.match( base )
if handler:
handler = handler.load()
if handler:
handler = handler()
if handler:
self[ typ ] = handler
if hasattr( handler, 'registerEquivalent' ):
handler.registerEquivalent( typ, base )
return handler
raise TypeError(
"""No array-type handler for type %s.%s (value: %s) registered"""%(
typ.__module__, type.__name__, repr(value)[:50]
)
)
return handler
def handler_by_plugin_name( self, name ):
plugin = plugins.FormatHandler.by_name( name )
if plugin:
try:
return plugin.load()
except ImportError as err:
return None
else:
raise RuntimeError( 'No handler of name %s found'%(name,))
def get_output_handler( self ):
"""Fast-path lookup for output handler object"""
if self.output_handler is None:
if self.preferredOutput is not None:
self.output_handler = self.handler_by_plugin_name( self.preferredOutput )
if not self.output_handler:
for preferred in self.GENERIC_OUTPUT_PREFERENCES:
self.output_handler = self.handler_by_plugin_name( preferred )
if self.output_handler:
break
if not self.output_handler:
raise RuntimeError(
"""Unable to find any output handler at all (not even ctypes/numpy ones!)"""
)
return self.output_handler
def register( self, handler, types=None ):
"""Register this class as handler for given set of types"""
if not isinstance( types, (list,tuple)):
types = [ types ]
for type in types:
self[ type ] = handler
if handler.isOutput:
self.all_output_handlers.append( handler )
def registerReturn( self, handler ):
"""Register this handler as the default return-type handler"""
if isinstance( handler, (str,unicode)):
self.preferredOutput = handler
self.output_handler = None
else:
self.preferredOutput = None
self.output_handler = handler
GLOBAL_REGISTRY = HandlerRegistry( plugins.FormatHandler.match)
formathandler.FormatHandler.TYPE_REGISTRY = GLOBAL_REGISTRY
class ArrayDatatype( object ):
"""Mix-in for array datatype classes
The ArrayDatatype marker essentially is used to mark a particular argument
as having an "array" type, which means that it is eligible for handling
via the arrays sub-package and its registered handlers.
"""
typeConstant = None
handler = GLOBAL_REGISTRY
getHandler = GLOBAL_REGISTRY.__call__
returnHandler = GLOBAL_REGISTRY.get_output_handler
isAccelerated = False
@classmethod
def getRegistry( cls ):
"""Get our handler registry"""
return cls.handler
def from_param( cls, value, typeConstant=None ):
"""Given a value in a known data-pointer type, convert to a ctypes pointer"""
return cls.getHandler(value).from_param( value, cls.typeConstant )
from_param = classmethod( logs.logOnFail( from_param, _log ) )
def dataPointer( cls, value ):
"""Given a value in a known data-pointer type, return long for pointer"""
try:
return cls.getHandler(value).dataPointer( value )
except Exception as err:
_log.warn(
"""Failure in dataPointer for %s instance %s""", type(value), value,
)
raise
dataPointer = classmethod( logs.logOnFail( dataPointer, _log ) )
def voidDataPointer( cls, value ):
"""Given value in a known data-pointer type, return void_p for pointer"""
pointer = cls.dataPointer( value )
try:
return ctypes.c_void_p(pointer)
except TypeError as err:
return pointer
voidDataPointer = classmethod( logs.logOnFail( voidDataPointer, _log ) )
def typedPointer( cls, value ):
"""Return a pointer-to-base-type pointer for given value"""
return ctypes.cast( cls.dataPointer(value), ctypes.POINTER( cls.baseType ))
typedPointer = classmethod( typedPointer )
def asArray( cls, value, typeCode=None ):
"""Given a value, convert to preferred array representation"""
return cls.getHandler(value).asArray( value, typeCode or cls.typeConstant )
asArray = classmethod( logs.logOnFail( asArray, _log ) )
def arrayToGLType( cls, value ):
"""Given a data-value, guess the OpenGL type of the corresponding pointer
Note: this is not currently used in PyOpenGL and may be removed
eventually.
"""
return cls.getHandler(value).arrayToGLType( value )
arrayToGLType = classmethod( logs.logOnFail( arrayToGLType, _log ) )
def arraySize( cls, value, typeCode = None ):
"""Given a data-value, calculate dimensions for the array (number-of-units)"""
return cls.getHandler(value).arraySize( value, typeCode or cls.typeConstant )
arraySize = classmethod( logs.logOnFail( arraySize, _log ) )
def unitSize( cls, value, typeCode=None ):
"""Determine unit size of an array (if possible)
Uses our local type if defined, otherwise asks the handler to guess...
"""
return cls.getHandler(value).unitSize( value, typeCode or cls.typeConstant )
unitSize = classmethod( logs.logOnFail( unitSize, _log ) )
def zeros( cls, dims, typeCode=None ):
"""Allocate a return array of the given dimensions filled with zeros"""
return cls.returnHandler().zeros( dims, typeCode or cls.typeConstant )
zeros = classmethod( logs.logOnFail( zeros, _log ) )
def dimensions( cls, value ):
"""Given a data-value, get the dimensions (assumes full structure info)"""
return cls.getHandler(value).dimensions( value )
dimensions = classmethod( logs.logOnFail( dimensions, _log ) )
def arrayByteCount( cls, value ):
"""Given a data-value, try to determine number of bytes it's final form occupies
For most data-types this is arraySize() * atomic-unit-size
"""
return cls.getHandler(value).arrayByteCount( value )
arrayByteCount = classmethod( logs.logOnFail( arrayByteCount, _log ) )
# the final array data-type classes...
class GLclampdArray( ArrayDatatype, ctypes.POINTER(_types.GLclampd )):
"""Array datatype for GLclampd types"""
baseType = _types.GLclampd
typeConstant = _types.GL_DOUBLE
class GLclampfArray( ArrayDatatype, ctypes.POINTER(_types.GLclampf )):
"""Array datatype for GLclampf types"""
baseType = _types.GLclampf
typeConstant = _types.GL_FLOAT
class GLfloatArray( ArrayDatatype, ctypes.POINTER(_types.GLfloat )):
"""Array datatype for GLfloat types"""
baseType = _types.GLfloat
typeConstant = _types.GL_FLOAT
class GLdoubleArray( ArrayDatatype, ctypes.POINTER(_types.GLdouble )):
"""Array datatype for GLdouble types"""
baseType = _types.GLdouble
typeConstant = _types.GL_DOUBLE
class GLbyteArray( ArrayDatatype, ctypes.POINTER(_types.GLbyte )):
"""Array datatype for GLbyte types"""
baseType = _types.GLbyte
typeConstant = _types.GL_BYTE
class GLcharArray( ArrayDatatype, ctypes.c_char_p):
"""Array datatype for ARB extension pointers-to-arrays"""
baseType = _types.GLchar
typeConstant = _types.GL_BYTE
GLcharARBArray = GLcharArray
class GLshortArray( ArrayDatatype, ctypes.POINTER(_types.GLshort )):
"""Array datatype for GLshort types"""
baseType = _types.GLshort
typeConstant = _types.GL_SHORT
class GLintArray( ArrayDatatype, ctypes.POINTER(_types.GLint )):
"""Array datatype for GLint types"""
baseType = _types.GLint
typeConstant = _types.GL_INT
class GLubyteArray( ArrayDatatype, ctypes.POINTER(_types.GLubyte )):
"""Array datatype for GLubyte types"""
baseType = _types.GLubyte
typeConstant = _types.GL_UNSIGNED_BYTE
GLbooleanArray = GLubyteArray
class GLushortArray( ArrayDatatype, ctypes.POINTER(_types.GLushort )):
"""Array datatype for GLushort types"""
baseType = _types.GLushort
typeConstant = _types.GL_UNSIGNED_SHORT
class GLuintArray( ArrayDatatype, ctypes.POINTER(_types.GLuint )):
"""Array datatype for GLuint types"""
baseType = _types.GLuint
typeConstant = _types.GL_UNSIGNED_INT
class GLint64Array( ArrayDatatype, ctypes.POINTER(_types.GLint64 )):
"""Array datatype for GLuint types"""
baseType = _types.GLint64
typeConstant = None # TODO: find out what this should be!
class GLuint64Array( ArrayDatatype, ctypes.POINTER(_types.GLuint64 )):
"""Array datatype for GLuint types"""
baseType = _types.GLuint64
typeConstant = _types.GL_UNSIGNED_INT64
class GLenumArray( ArrayDatatype, ctypes.POINTER(_types.GLenum )):
"""Array datatype for GLenum types"""
baseType = _types.GLenum
typeConstant = _types.GL_UNSIGNED_INT
class GLsizeiArray( ArrayDatatype, ctypes.POINTER(_types.GLsizei )):
"""Array datatype for GLsizei types"""
baseType = _types.GLsizei
typeConstant = _types.GL_INT
class GLvoidpArray( ArrayDatatype, ctypes.POINTER(_types.GLvoid )):
"""Array datatype for GLenum types"""
baseType = _types.GLvoidp
typeConstant = _types.GL_VOID_P
else:
# Cython-coded array handler
_log.info( 'Using accelerated ArrayDatatype' )
ArrayDatatype = ADT( None, None )
GLclampdArray = ADT( GL_1_1.GL_DOUBLE, _types.GLclampd )
GLclampfArray = ADT( GL_1_1.GL_FLOAT, _types.GLclampf )
GLdoubleArray = ADT( GL_1_1.GL_DOUBLE, _types.GLdouble )
GLfloatArray = ADT( GL_1_1.GL_FLOAT, _types.GLfloat )
GLbyteArray = ADT( GL_1_1.GL_BYTE, _types.GLbyte )
GLcharArray = GLcharARBArray = ADT( GL_1_1.GL_BYTE, _types.GLchar )
GLshortArray = ADT( GL_1_1.GL_SHORT, _types.GLshort )
GLintArray = ADT( GL_1_1.GL_INT, _types.GLint )
GLubyteArray = GLbooleanArray = ADT( GL_1_1.GL_UNSIGNED_BYTE, _types.GLubyte )
GLushortArray = ADT( GL_1_1.GL_UNSIGNED_SHORT, _types.GLushort )
GLuintArray = ADT( GL_1_1.GL_UNSIGNED_INT, _types.GLuint )
GLint64Array = ADT( None, _types.GLint64 )
GLuint64Array = ADT( GL_1_1.GL_UNSIGNED_INT64, _types.GLuint64 )
GLenumArray = ADT( GL_1_1.GL_UNSIGNED_INT, _types.GLenum )
GLsizeiArray = ADT( GL_1_1.GL_INT, _types.GLsizei )
GLvoidpArray = ADT( _types.GL_VOID_P, _types.GLvoidp )
GL_CONSTANT_TO_ARRAY_TYPE = {
GL_1_1.GL_DOUBLE : GLclampdArray,
GL_1_1.GL_FLOAT : GLclampfArray,
GL_1_1.GL_FLOAT : GLfloatArray,
GL_1_1.GL_DOUBLE : GLdoubleArray,
GL_1_1.GL_BYTE : GLbyteArray,
GL_1_1.GL_SHORT : GLshortArray,
GL_1_1.GL_INT : GLintArray,
GL_1_1.GL_UNSIGNED_BYTE : GLubyteArray,
GL_1_1.GL_UNSIGNED_SHORT : GLushortArray,
GL_1_1.GL_UNSIGNED_INT : GLuintArray,
#GL_1_1.GL_UNSIGNED_INT : GLenumArray,
}
| """Array data-type implementations (abstraction points for GL array types"""
import ctypes
import OpenGL
from OpenGL.raw.GL import _types
from OpenGL import plugins
from OpenGL.arrays import formathandler, _arrayconstants as GL_1_1
from OpenGL import logs
_log = logs.getLog( 'OpenGL.arrays.arraydatatype' )
from OpenGL import acceleratesupport
ADT = None
if acceleratesupport.ACCELERATE_AVAILABLE:
try:
from OpenGL_accelerate.arraydatatype import ArrayDatatype as ADT
except ImportError as err:
_log.warn(
"Unable to load ArrayDatatype accelerator from OpenGL_accelerate"
)
if ADT is None:
# Python-coded version
class HandlerRegistry( dict ):
GENERIC_OUTPUT_PREFERENCES = ['numpy','ctypesarrays']
def __init__( self, plugin_match ):
self.match = plugin_match
self.output_handler = None
self.preferredOutput = None
self.all_output_handlers = []
def __call__( self, value ):
"""Lookup of handler for given value"""
try:
typ = value.__class__
except AttributeError as err:
typ = type(value)
handler = self.get( typ )
if not handler:
if hasattr( typ, '__mro__' ):
for base in typ.__mro__:
handler = self.get( base )
if not handler:
handler = self.match( base )
if handler:
handler = handler.load()
if handler:
handler = handler()
if handler:
self[ typ ] = handler
if hasattr( handler, 'registerEquivalent' ):
handler.registerEquivalent( typ, base )
return handler
raise TypeError(
"""No array-type handler for type %s.%s (value: %s) registered"""%(
typ.__module__, type.__name__, repr(value)[:50]
)
)
return handler
def handler_by_plugin_name( self, name ):
plugin = plugins.FormatHandler.by_name( name )
if plugin:
try:
return plugin.load()
except ImportError as err:
return None
else:
raise RuntimeError( 'No handler of name %s found'%(name,))
def get_output_handler( self ):
"""Fast-path lookup for output handler object"""
if self.output_handler is None:
if self.preferredOutput is not None:
self.output_handler = self.handler_by_plugin_name( self.preferredOutput )
if not self.output_handler:
for preferred in self.GENERIC_OUTPUT_PREFERENCES:
self.output_handler = self.handler_by_plugin_name( preferred )
if self.output_handler:
break
if not self.output_handler:
raise RuntimeError(
"""Unable to find any output handler at all (not even ctypes/numpy ones!)"""
)
return self.output_handler
def register( self, handler, types=None ):
"""Register this class as handler for given set of types"""
if not isinstance( types, (list,tuple)):
types = [ types ]
for type in types:
self[ type ] = handler
if handler.isOutput:
self.all_output_handlers.append( handler )
def registerReturn( self, handler ):
"""Register this handler as the default return-type handler"""
if isinstance( handler, (str,unicode)):
self.preferredOutput = handler
self.output_handler = None
else:
self.preferredOutput = None
self.output_handler = handler
GLOBAL_REGISTRY = HandlerRegistry( plugins.FormatHandler.match)
formathandler.FormatHandler.TYPE_REGISTRY = GLOBAL_REGISTRY
class ArrayDatatype( object ):
"""Mix-in for array datatype classes
The ArrayDatatype marker essentially is used to mark a particular argument
as having an "array" type, which means that it is eligible for handling
via the arrays sub-package and its registered handlers.
"""
typeConstant = None
handler = GLOBAL_REGISTRY
getHandler = GLOBAL_REGISTRY.__call__
returnHandler = GLOBAL_REGISTRY.get_output_handler
isAccelerated = False
@classmethod
def getRegistry( cls ):
"""Get our handler registry"""
return cls.handler
def from_param( cls, value, typeConstant=None ):
"""Given a value in a known data-pointer type, convert to a ctypes pointer"""
return cls.getHandler(value).from_param( value, cls.typeConstant )
from_param = classmethod( logs.logOnFail( from_param, _log ) )
def dataPointer( cls, value ):
"""Given a value in a known data-pointer type, return long for pointer"""
try:
return cls.getHandler(value).dataPointer( value )
except Exception as err:
_log.warn(
"""Failure in dataPointer for %s instance %s""", type(value), value,
)
raise
dataPointer = classmethod( logs.logOnFail( dataPointer, _log ) )
def voidDataPointer( cls, value ):
"""Given value in a known data-pointer type, return void_p for pointer"""
pointer = cls.dataPointer( value )
try:
return ctypes.c_void_p(pointer)
except TypeError as err:
return pointer
voidDataPointer = classmethod( logs.logOnFail( voidDataPointer, _log ) )
def typedPointer( cls, value ):
"""Return a pointer-to-base-type pointer for given value"""
return ctypes.cast( cls.dataPointer(value), ctypes.POINTER( cls.baseType ))
typedPointer = classmethod( typedPointer )
def asArray( cls, value, typeCode=None ):
"""Given a value, convert to preferred array representation"""
return cls.getHandler(value).asArray( value, typeCode or cls.typeConstant )
asArray = classmethod( logs.logOnFail( asArray, _log ) )
def arrayToGLType( cls, value ):
"""Given a data-value, guess the OpenGL type of the corresponding pointer
Note: this is not currently used in PyOpenGL and may be removed
eventually.
"""
return cls.getHandler(value).arrayToGLType( value )
arrayToGLType = classmethod( logs.logOnFail( arrayToGLType, _log ) )
def arraySize( cls, value, typeCode = None ):
"""Given a data-value, calculate dimensions for the array (number-of-units)"""
return cls.getHandler(value).arraySize( value, typeCode or cls.typeConstant )
arraySize = classmethod( logs.logOnFail( arraySize, _log ) )
def unitSize( cls, value, typeCode=None ):
"""Determine unit size of an array (if possible)
Uses our local type if defined, otherwise asks the handler to guess...
"""
return cls.getHandler(value).unitSize( value, typeCode or cls.typeConstant )
unitSize = classmethod( logs.logOnFail( unitSize, _log ) )
def zeros( cls, dims, typeCode=None ):
"""Allocate a return array of the given dimensions filled with zeros"""
return cls.returnHandler().zeros( dims, typeCode or cls.typeConstant )
zeros = classmethod( logs.logOnFail( zeros, _log ) )
def dimensions( cls, value ):
"""Given a data-value, get the dimensions (assumes full structure info)"""
return cls.getHandler(value).dimensions( value )
dimensions = classmethod( logs.logOnFail( dimensions, _log ) )
def arrayByteCount( cls, value ):
"""Given a data-value, try to determine number of bytes it's final form occupies
For most data-types this is arraySize() * atomic-unit-size
"""
return cls.getHandler(value).arrayByteCount( value )
arrayByteCount = classmethod( logs.logOnFail( arrayByteCount, _log ) )
# the final array data-type classes...
class GLclampdArray( ArrayDatatype, ctypes.POINTER(_types.GLclampd )):
"""Array datatype for GLclampd types"""
baseType = _types.GLclampd
typeConstant = _types.GL_DOUBLE
class GLclampfArray( ArrayDatatype, ctypes.POINTER(_types.GLclampf )):
"""Array datatype for GLclampf types"""
baseType = _types.GLclampf
typeConstant = _types.GL_FLOAT
class GLfloatArray( ArrayDatatype, ctypes.POINTER(_types.GLfloat )):
"""Array datatype for GLfloat types"""
baseType = _types.GLfloat
typeConstant = _types.GL_FLOAT
class GLdoubleArray( ArrayDatatype, ctypes.POINTER(_types.GLdouble )):
"""Array datatype for GLdouble types"""
baseType = _types.GLdouble
typeConstant = _types.GL_DOUBLE
class GLbyteArray( ArrayDatatype, ctypes.POINTER(_types.GLbyte )):
"""Array datatype for GLbyte types"""
baseType = _types.GLbyte
typeConstant = _types.GL_BYTE
class GLcharArray( ArrayDatatype, ctypes.c_char_p):
"""Array datatype for ARB extension pointers-to-arrays"""
baseType = _types.GLchar
typeConstant = _types.GL_BYTE
GLcharARBArray = GLcharArray
class GLshortArray( ArrayDatatype, ctypes.POINTER(_types.GLshort )):
"""Array datatype for GLshort types"""
baseType = _types.GLshort
typeConstant = _types.GL_SHORT
class GLintArray( ArrayDatatype, ctypes.POINTER(_types.GLint )):
"""Array datatype for GLint types"""
baseType = _types.GLint
typeConstant = _types.GL_INT
class GLubyteArray( ArrayDatatype, ctypes.POINTER(_types.GLubyte )):
"""Array datatype for GLubyte types"""
baseType = _types.GLubyte
typeConstant = _types.GL_UNSIGNED_BYTE
GLbooleanArray = GLubyteArray
class GLushortArray( ArrayDatatype, ctypes.POINTER(_types.GLushort )):
"""Array datatype for GLushort types"""
baseType = _types.GLushort
typeConstant = _types.GL_UNSIGNED_SHORT
class GLuintArray( ArrayDatatype, ctypes.POINTER(_types.GLuint )):
"""Array datatype for GLuint types"""
baseType = _types.GLuint
typeConstant = _types.GL_UNSIGNED_INT
class GLint64Array( ArrayDatatype, ctypes.POINTER(_types.GLint64 )):
"""Array datatype for GLuint types"""
baseType = _types.GLint64
typeConstant = None # TODO: find out what this should be!
class GLuint64Array( ArrayDatatype, ctypes.POINTER(_types.GLuint64 )):
"""Array datatype for GLuint types"""
baseType = _types.GLuint64
typeConstant = _types.GL_UNSIGNED_INT64
class GLenumArray( ArrayDatatype, ctypes.POINTER(_types.GLenum )):
"""Array datatype for GLenum types"""
baseType = _types.GLenum
typeConstant = _types.GL_UNSIGNED_INT
class GLsizeiArray( ArrayDatatype, ctypes.POINTER(_types.GLsizei )):
"""Array datatype for GLsizei types"""
baseType = _types.GLsizei
typeConstant = _types.GL_INT
class GLvoidpArray( ArrayDatatype, ctypes.POINTER(_types.GLvoid )):
"""Array datatype for GLenum types"""
baseType = _types.GLvoidp
typeConstant = _types.GL_VOID_P
else:
# Cython-coded array handler
_log.info( 'Using accelerated ArrayDatatype' )
ArrayDatatype = ADT( None, None )
GLclampdArray = ADT( GL_1_1.GL_DOUBLE, _types.GLclampd )
GLclampfArray = ADT( GL_1_1.GL_FLOAT, _types.GLclampf )
GLdoubleArray = ADT( GL_1_1.GL_DOUBLE, _types.GLdouble )
GLfloatArray = ADT( GL_1_1.GL_FLOAT, _types.GLfloat )
GLbyteArray = ADT( GL_1_1.GL_BYTE, _types.GLbyte )
GLcharArray = GLcharARBArray = ADT( GL_1_1.GL_BYTE, _types.GLchar )
GLshortArray = ADT( GL_1_1.GL_SHORT, _types.GLshort )
GLintArray = ADT( GL_1_1.GL_INT, _types.GLint )
GLubyteArray = GLbooleanArray = ADT( GL_1_1.GL_UNSIGNED_BYTE, _types.GLubyte )
GLushortArray = ADT( GL_1_1.GL_UNSIGNED_SHORT, _types.GLushort )
GLuintArray = ADT( GL_1_1.GL_UNSIGNED_INT, _types.GLuint )
GLint64Array = ADT( None, _types.GLint64 )
GLuint64Array = ADT( GL_1_1.GL_UNSIGNED_INT64, _types.GLuint64 )
GLenumArray = ADT( GL_1_1.GL_UNSIGNED_INT, _types.GLenum )
GLsizeiArray = ADT( GL_1_1.GL_INT, _types.GLsizei )
GLvoidpArray = ADT( _types.GL_VOID_P, _types.GLvoidp )
GL_CONSTANT_TO_ARRAY_TYPE = {
GL_1_1.GL_DOUBLE : GLclampdArray,
GL_1_1.GL_FLOAT : GLclampfArray,
GL_1_1.GL_FLOAT : GLfloatArray,
GL_1_1.GL_DOUBLE : GLdoubleArray,
GL_1_1.GL_BYTE : GLbyteArray,
GL_1_1.GL_SHORT : GLshortArray,
GL_1_1.GL_INT : GLintArray,
GL_1_1.GL_UNSIGNED_BYTE : GLubyteArray,
GL_1_1.GL_UNSIGNED_SHORT : GLushortArray,
GL_1_1.GL_UNSIGNED_INT : GLuintArray,
#GL_1_1.GL_UNSIGNED_INT : GLenumArray,
}
| en | 0.664448 | Array data-type implementations (abstraction points for GL array types # Python-coded version Lookup of handler for given value No array-type handler for type %s.%s (value: %s) registered Fast-path lookup for output handler object Unable to find any output handler at all (not even ctypes/numpy ones!) Register this class as handler for given set of types Register this handler as the default return-type handler Mix-in for array datatype classes The ArrayDatatype marker essentially is used to mark a particular argument as having an "array" type, which means that it is eligible for handling via the arrays sub-package and its registered handlers. Get our handler registry Given a value in a known data-pointer type, convert to a ctypes pointer Given a value in a known data-pointer type, return long for pointer Failure in dataPointer for %s instance %s Given value in a known data-pointer type, return void_p for pointer Return a pointer-to-base-type pointer for given value Given a value, convert to preferred array representation Given a data-value, guess the OpenGL type of the corresponding pointer Note: this is not currently used in PyOpenGL and may be removed eventually. Given a data-value, calculate dimensions for the array (number-of-units) Determine unit size of an array (if possible) Uses our local type if defined, otherwise asks the handler to guess... Allocate a return array of the given dimensions filled with zeros Given a data-value, get the dimensions (assumes full structure info) Given a data-value, try to determine number of bytes it's final form occupies For most data-types this is arraySize() * atomic-unit-size # the final array data-type classes... Array datatype for GLclampd types Array datatype for GLclampf types Array datatype for GLfloat types Array datatype for GLdouble types Array datatype for GLbyte types Array datatype for ARB extension pointers-to-arrays Array datatype for GLshort types Array datatype for GLint types Array datatype for GLubyte types Array datatype for GLushort types Array datatype for GLuint types Array datatype for GLuint types # TODO: find out what this should be! Array datatype for GLuint types Array datatype for GLenum types Array datatype for GLsizei types Array datatype for GLenum types # Cython-coded array handler #GL_1_1.GL_UNSIGNED_INT : GLenumArray, | 2.465229 | 2 |
tensorflow_probability/python/build_defs.bzl | jbergmanster/probability | 0 | 2818 | <filename>tensorflow_probability/python/build_defs.bzl
# Copyright 2019 The TensorFlow Probability Authors.
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS,
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
# See the License for the specific language governing permissions and
# limitations under the License.
# ============================================================================
"""Build defs for TF/NumPy/JAX-variadic libraries & tests."""
# [internal] load python3.bzl
NO_REWRITE_NEEDED = [
"internal:all_util",
"internal:docstring_util",
"internal:reparameterization",
"layers",
"platform_google",
]
REWRITER_TARGET = "//tensorflow_probability/substrates/meta:rewrite"
RUNFILES_ROOT = "tensorflow_probability/"
def _substrate_src(src, substrate):
"""Rewrite a single src filename for the given substrate."""
return "_{}/_generated_{}".format(substrate, src)
def _substrate_srcs(srcs, substrate):
"""Rewrite src filenames for the given substrate."""
return [_substrate_src(src, substrate) for src in srcs]
def _substrate_dep(dep, substrate):
"""Convert a single dep to one appropriate for the given substrate."""
dep_to_check = dep
if dep.startswith(":"):
dep_to_check = "{}{}".format(native.package_name(), dep)
for no_rewrite in NO_REWRITE_NEEDED:
if no_rewrite in dep_to_check:
return dep
if "tensorflow_probability/" in dep or dep.startswith(":"):
if "internal/backend" in dep:
return dep
if ":" in dep:
return "{}.{}".format(dep, substrate)
return "{}:{}.{}".format(dep, dep.split("/")[-1], substrate)
return dep
def _substrate_deps(deps, substrate):
"""Convert deps to those appropriate for the given substrate."""
new_deps = [_substrate_dep(dep, substrate) for dep in deps]
backend_dep = "//tensorflow_probability/python/internal/backend/{}".format(substrate)
if backend_dep not in new_deps:
new_deps.append(backend_dep)
return new_deps
# This is needed for the transitional period during which we have the internal
# py2and3_test and py_test comingling in BUILD files. Otherwise the OSS export
# rewrite process becomes irreversible.
def py3_test(*args, **kwargs):
"""Internal/external reversibility, denotes py3-only vs py2+3 tests.
Args:
*args: Passed to underlying py_test.
**kwargs: Passed to underlying py_test. srcs_version and python_version
are added (with value `"PY3"`) if not specified.
"""
kwargs = dict(kwargs)
if "srcs_version" not in kwargs:
kwargs["srcs_version"] = "PY3"
if "python_version" not in kwargs:
kwargs["python_version"] = "PY3"
native.py_test(*args, **kwargs)
def _resolve_omit_dep(dep):
"""Resolves a `substrates_omit_deps` item to full target."""
if ":" not in dep:
dep = "{}:{}".format(dep, dep.split("/")[-1])
if dep.startswith(":"):
dep = "{}{}".format(native.package_name(), dep)
return dep
def _substrate_runfiles_symlinks_impl(ctx):
"""A custom BUILD rule to generate python runfiles symlinks.
A custom build rule which adds runfiles symlinks for files matching a
substrate genrule file pattern, i.e. `'_jax/_generated_normal.py'`.
This rule will aggregate and pass along deps while adding the given
symlinks to the runfiles structure.
Build rule attributes:
- substrate: One of 'jax' or 'numpy'; which substrate this applies to.
- deps: A list of py_library labels. These are passed along.
Args:
ctx: Rule analysis context.
Returns:
Info objects to propagate deps and add runfiles symlinks.
"""
# Aggregate the depset inputs to resolve transitive dependencies.
transitive_sources = []
uses_shared_libraries = []
imports = []
has_py2_only_sources = []
has_py3_only_sources = []
cc_infos = []
for dep in ctx.attr.deps:
if PyInfo in dep:
transitive_sources.append(dep[PyInfo].transitive_sources)
uses_shared_libraries.append(dep[PyInfo].uses_shared_libraries)
imports.append(dep[PyInfo].imports)
has_py2_only_sources.append(dep[PyInfo].has_py2_only_sources)
has_py3_only_sources.append(dep[PyInfo].has_py3_only_sources)
# if PyCcLinkParamsProvider in dep: # DisableOnExport
# cc_infos.append(dep[PyCcLinkParamsProvider].cc_info) # DisableOnExport
if CcInfo in dep:
cc_infos.append(dep[CcInfo])
# Determine the set of symlinks to generate.
transitive_sources = depset(transitive = transitive_sources)
runfiles_dict = {}
substrate = ctx.attr.substrate
file_substr = "_{}/_generated_".format(substrate)
for f in transitive_sources.to_list():
if "tensorflow_probability" in f.dirname and file_substr in f.short_path:
pre, post = f.short_path.split("/python/")
out_path = "{}/substrates/{}/{}".format(
pre,
substrate,
post.replace(file_substr, ""),
)
runfiles_dict[RUNFILES_ROOT + out_path] = f
# Construct the output structures to pass along Python srcs/deps/etc.
py_info = PyInfo(
transitive_sources = transitive_sources,
uses_shared_libraries = any(uses_shared_libraries),
imports = depset(transitive = imports),
has_py2_only_sources = any(has_py2_only_sources),
has_py3_only_sources = any(has_py3_only_sources),
)
py_cc_link_info = cc_common.merge_cc_infos(cc_infos = cc_infos)
py_runfiles = depset(
transitive = [depset(transitive = [
dep[DefaultInfo].data_runfiles.files,
dep[DefaultInfo].default_runfiles.files,
]) for dep in ctx.attr.deps],
)
runfiles = DefaultInfo(runfiles = ctx.runfiles(
transitive_files = py_runfiles,
root_symlinks = runfiles_dict,
))
return py_info, py_cc_link_info, runfiles
# See documentation at:
# https://docs.bazel.build/versions/3.4.0/skylark/rules.html
substrate_runfiles_symlinks = rule(
implementation = _substrate_runfiles_symlinks_impl,
attrs = {
"substrate": attr.string(),
"deps": attr.label_list(),
},
)
def multi_substrate_py_library(
name,
srcs = [],
deps = [],
substrates_omit_deps = [],
jax_omit_deps = [],
numpy_omit_deps = [],
testonly = 0,
srcs_version = "PY2AND3"):
"""A TFP `py_library` for each of TF, NumPy, and JAX.
Args:
name: The TF `py_library` name. NumPy and JAX libraries have '.numpy' and
'.jax' appended.
srcs: As with `py_library`. A `genrule` is used to rewrite srcs for NumPy
and JAX substrates.
deps: As with `py_library`. The list is rewritten to depend on
substrate-specific libraries for substrate variants.
substrates_omit_deps: List of deps to omit if those libraries are not
rewritten for the substrates.
jax_omit_deps: List of deps to omit for the JAX substrate.
numpy_omit_deps: List of deps to omit for the NumPy substrate.
testonly: As with `py_library`.
srcs_version: As with `py_library`.
"""
native.py_library(
name = name,
srcs = srcs,
deps = deps,
srcs_version = srcs_version,
testonly = testonly,
)
remove_deps = [
"//third_party/py/tensorflow",
"//third_party/py/tensorflow:tensorflow",
]
trimmed_deps = [dep for dep in deps if (dep not in substrates_omit_deps and
dep not in remove_deps)]
resolved_omit_deps_numpy = [
_resolve_omit_dep(dep)
for dep in substrates_omit_deps + numpy_omit_deps
]
for src in srcs:
native.genrule(
name = "rewrite_{}_numpy".format(src.replace(".", "_")),
srcs = [src],
outs = [_substrate_src(src, "numpy")],
cmd = "$(location {}) $(SRCS) --omit_deps={} > $@".format(
REWRITER_TARGET,
",".join(resolved_omit_deps_numpy),
),
tools = [REWRITER_TARGET],
)
native.py_library(
name = "{}.numpy.raw".format(name),
srcs = _substrate_srcs(srcs, "numpy"),
deps = _substrate_deps(trimmed_deps, "numpy"),
srcs_version = srcs_version,
testonly = testonly,
)
# Add symlinks under tfp/substrates/numpy.
substrate_runfiles_symlinks(
name = "{}.numpy".format(name),
substrate = "numpy",
deps = [":{}.numpy.raw".format(name)],
testonly = testonly,
)
resolved_omit_deps_jax = [
_resolve_omit_dep(dep)
for dep in substrates_omit_deps + jax_omit_deps
]
jax_srcs = _substrate_srcs(srcs, "jax")
for src in srcs:
native.genrule(
name = "rewrite_{}_jax".format(src.replace(".", "_")),
srcs = [src],
outs = [_substrate_src(src, "jax")],
cmd = "$(location {}) $(SRCS) --omit_deps={} --numpy_to_jax > $@".format(
REWRITER_TARGET,
",".join(resolved_omit_deps_jax),
),
tools = [REWRITER_TARGET],
)
native.py_library(
name = "{}.jax.raw".format(name),
srcs = jax_srcs,
deps = _substrate_deps(trimmed_deps, "jax"),
srcs_version = srcs_version,
testonly = testonly,
)
# Add symlinks under tfp/substrates/jax.
substrate_runfiles_symlinks(
name = "{}.jax".format(name),
substrate = "jax",
deps = [":{}.jax.raw".format(name)],
testonly = testonly,
)
def multi_substrate_py_test(
name,
size = "small",
jax_size = None,
numpy_size = None,
srcs = [],
deps = [],
tags = [],
numpy_tags = [],
jax_tags = [],
disabled_substrates = [],
srcs_version = "PY2AND3",
timeout = None,
shard_count = None):
"""A TFP `py2and3_test` for each of TF, NumPy, and JAX.
Args:
name: Name of the `test_suite` which covers TF, NumPy and JAX variants
of the test. Each substrate will have a dedicated `py2and3_test`
suffixed with '.tf', '.numpy', or '.jax' as appropriate.
size: As with `py_test`.
jax_size: A size override for the JAX target.
numpy_size: A size override for the numpy target.
srcs: As with `py_test`. These will have a `genrule` emitted to rewrite
NumPy and JAX variants, writing the test file into a subdirectory.
deps: As with `py_test`. The list is rewritten to depend on
substrate-specific libraries for substrate variants.
tags: Tags global to this test target. NumPy also gets a `'tfp_numpy'`
tag, and JAX gets a `'tfp_jax'` tag. A `f'_{name}'` tag is used
to produce the `test_suite`.
numpy_tags: Tags specific to the NumPy test. (e.g. `"notap"`).
jax_tags: Tags specific to the JAX test. (e.g. `"notap"`).
disabled_substrates: Iterable of substrates to disable, items from
["numpy", "jax"].
srcs_version: As with `py_test`.
timeout: As with `py_test`.
shard_count: As with `py_test`.
"""
name_tag = "_{}".format(name)
tags = [t for t in tags]
tags.append(name_tag)
tags.append("multi_substrate")
native.py_test(
name = "{}.tf".format(name),
size = size,
srcs = srcs,
main = "{}.py".format(name),
deps = deps,
tags = tags,
srcs_version = srcs_version,
timeout = timeout,
shard_count = shard_count,
)
if "numpy" not in disabled_substrates:
numpy_srcs = _substrate_srcs(srcs, "numpy")
native.genrule(
name = "rewrite_{}_numpy".format(name),
srcs = srcs,
outs = numpy_srcs,
cmd = "$(location {}) $(SRCS) > $@".format(REWRITER_TARGET),
tools = [REWRITER_TARGET],
)
py3_test(
name = "{}.numpy".format(name),
size = numpy_size or size,
srcs = numpy_srcs,
main = _substrate_src("{}.py".format(name), "numpy"),
deps = _substrate_deps(deps, "numpy"),
tags = tags + ["tfp_numpy"] + numpy_tags,
srcs_version = srcs_version,
python_version = "PY3",
timeout = timeout,
shard_count = shard_count,
)
if "jax" not in disabled_substrates:
jax_srcs = _substrate_srcs(srcs, "jax")
native.genrule(
name = "rewrite_{}_jax".format(name),
srcs = srcs,
outs = jax_srcs,
cmd = "$(location {}) $(SRCS) --numpy_to_jax > $@".format(REWRITER_TARGET),
tools = [REWRITER_TARGET],
)
jax_deps = _substrate_deps(deps, "jax")
# [internal] Add JAX build dep
py3_test(
name = "{}.jax".format(name),
size = jax_size or size,
srcs = jax_srcs,
main = _substrate_src("{}.py".format(name), "jax"),
deps = jax_deps,
tags = tags + ["tfp_jax"] + jax_tags,
srcs_version = srcs_version,
python_version = "PY3",
timeout = timeout,
shard_count = shard_count,
)
native.test_suite(
name = name,
tags = [name_tag],
)
| <filename>tensorflow_probability/python/build_defs.bzl
# Copyright 2019 The TensorFlow Probability Authors.
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS,
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
# See the License for the specific language governing permissions and
# limitations under the License.
# ============================================================================
"""Build defs for TF/NumPy/JAX-variadic libraries & tests."""
# [internal] load python3.bzl
NO_REWRITE_NEEDED = [
"internal:all_util",
"internal:docstring_util",
"internal:reparameterization",
"layers",
"platform_google",
]
REWRITER_TARGET = "//tensorflow_probability/substrates/meta:rewrite"
RUNFILES_ROOT = "tensorflow_probability/"
def _substrate_src(src, substrate):
"""Rewrite a single src filename for the given substrate."""
return "_{}/_generated_{}".format(substrate, src)
def _substrate_srcs(srcs, substrate):
"""Rewrite src filenames for the given substrate."""
return [_substrate_src(src, substrate) for src in srcs]
def _substrate_dep(dep, substrate):
"""Convert a single dep to one appropriate for the given substrate."""
dep_to_check = dep
if dep.startswith(":"):
dep_to_check = "{}{}".format(native.package_name(), dep)
for no_rewrite in NO_REWRITE_NEEDED:
if no_rewrite in dep_to_check:
return dep
if "tensorflow_probability/" in dep or dep.startswith(":"):
if "internal/backend" in dep:
return dep
if ":" in dep:
return "{}.{}".format(dep, substrate)
return "{}:{}.{}".format(dep, dep.split("/")[-1], substrate)
return dep
def _substrate_deps(deps, substrate):
"""Convert deps to those appropriate for the given substrate."""
new_deps = [_substrate_dep(dep, substrate) for dep in deps]
backend_dep = "//tensorflow_probability/python/internal/backend/{}".format(substrate)
if backend_dep not in new_deps:
new_deps.append(backend_dep)
return new_deps
# This is needed for the transitional period during which we have the internal
# py2and3_test and py_test comingling in BUILD files. Otherwise the OSS export
# rewrite process becomes irreversible.
def py3_test(*args, **kwargs):
"""Internal/external reversibility, denotes py3-only vs py2+3 tests.
Args:
*args: Passed to underlying py_test.
**kwargs: Passed to underlying py_test. srcs_version and python_version
are added (with value `"PY3"`) if not specified.
"""
kwargs = dict(kwargs)
if "srcs_version" not in kwargs:
kwargs["srcs_version"] = "PY3"
if "python_version" not in kwargs:
kwargs["python_version"] = "PY3"
native.py_test(*args, **kwargs)
def _resolve_omit_dep(dep):
"""Resolves a `substrates_omit_deps` item to full target."""
if ":" not in dep:
dep = "{}:{}".format(dep, dep.split("/")[-1])
if dep.startswith(":"):
dep = "{}{}".format(native.package_name(), dep)
return dep
def _substrate_runfiles_symlinks_impl(ctx):
"""A custom BUILD rule to generate python runfiles symlinks.
A custom build rule which adds runfiles symlinks for files matching a
substrate genrule file pattern, i.e. `'_jax/_generated_normal.py'`.
This rule will aggregate and pass along deps while adding the given
symlinks to the runfiles structure.
Build rule attributes:
- substrate: One of 'jax' or 'numpy'; which substrate this applies to.
- deps: A list of py_library labels. These are passed along.
Args:
ctx: Rule analysis context.
Returns:
Info objects to propagate deps and add runfiles symlinks.
"""
# Aggregate the depset inputs to resolve transitive dependencies.
transitive_sources = []
uses_shared_libraries = []
imports = []
has_py2_only_sources = []
has_py3_only_sources = []
cc_infos = []
for dep in ctx.attr.deps:
if PyInfo in dep:
transitive_sources.append(dep[PyInfo].transitive_sources)
uses_shared_libraries.append(dep[PyInfo].uses_shared_libraries)
imports.append(dep[PyInfo].imports)
has_py2_only_sources.append(dep[PyInfo].has_py2_only_sources)
has_py3_only_sources.append(dep[PyInfo].has_py3_only_sources)
# if PyCcLinkParamsProvider in dep: # DisableOnExport
# cc_infos.append(dep[PyCcLinkParamsProvider].cc_info) # DisableOnExport
if CcInfo in dep:
cc_infos.append(dep[CcInfo])
# Determine the set of symlinks to generate.
transitive_sources = depset(transitive = transitive_sources)
runfiles_dict = {}
substrate = ctx.attr.substrate
file_substr = "_{}/_generated_".format(substrate)
for f in transitive_sources.to_list():
if "tensorflow_probability" in f.dirname and file_substr in f.short_path:
pre, post = f.short_path.split("/python/")
out_path = "{}/substrates/{}/{}".format(
pre,
substrate,
post.replace(file_substr, ""),
)
runfiles_dict[RUNFILES_ROOT + out_path] = f
# Construct the output structures to pass along Python srcs/deps/etc.
py_info = PyInfo(
transitive_sources = transitive_sources,
uses_shared_libraries = any(uses_shared_libraries),
imports = depset(transitive = imports),
has_py2_only_sources = any(has_py2_only_sources),
has_py3_only_sources = any(has_py3_only_sources),
)
py_cc_link_info = cc_common.merge_cc_infos(cc_infos = cc_infos)
py_runfiles = depset(
transitive = [depset(transitive = [
dep[DefaultInfo].data_runfiles.files,
dep[DefaultInfo].default_runfiles.files,
]) for dep in ctx.attr.deps],
)
runfiles = DefaultInfo(runfiles = ctx.runfiles(
transitive_files = py_runfiles,
root_symlinks = runfiles_dict,
))
return py_info, py_cc_link_info, runfiles
# See documentation at:
# https://docs.bazel.build/versions/3.4.0/skylark/rules.html
substrate_runfiles_symlinks = rule(
implementation = _substrate_runfiles_symlinks_impl,
attrs = {
"substrate": attr.string(),
"deps": attr.label_list(),
},
)
def multi_substrate_py_library(
name,
srcs = [],
deps = [],
substrates_omit_deps = [],
jax_omit_deps = [],
numpy_omit_deps = [],
testonly = 0,
srcs_version = "PY2AND3"):
"""A TFP `py_library` for each of TF, NumPy, and JAX.
Args:
name: The TF `py_library` name. NumPy and JAX libraries have '.numpy' and
'.jax' appended.
srcs: As with `py_library`. A `genrule` is used to rewrite srcs for NumPy
and JAX substrates.
deps: As with `py_library`. The list is rewritten to depend on
substrate-specific libraries for substrate variants.
substrates_omit_deps: List of deps to omit if those libraries are not
rewritten for the substrates.
jax_omit_deps: List of deps to omit for the JAX substrate.
numpy_omit_deps: List of deps to omit for the NumPy substrate.
testonly: As with `py_library`.
srcs_version: As with `py_library`.
"""
native.py_library(
name = name,
srcs = srcs,
deps = deps,
srcs_version = srcs_version,
testonly = testonly,
)
remove_deps = [
"//third_party/py/tensorflow",
"//third_party/py/tensorflow:tensorflow",
]
trimmed_deps = [dep for dep in deps if (dep not in substrates_omit_deps and
dep not in remove_deps)]
resolved_omit_deps_numpy = [
_resolve_omit_dep(dep)
for dep in substrates_omit_deps + numpy_omit_deps
]
for src in srcs:
native.genrule(
name = "rewrite_{}_numpy".format(src.replace(".", "_")),
srcs = [src],
outs = [_substrate_src(src, "numpy")],
cmd = "$(location {}) $(SRCS) --omit_deps={} > $@".format(
REWRITER_TARGET,
",".join(resolved_omit_deps_numpy),
),
tools = [REWRITER_TARGET],
)
native.py_library(
name = "{}.numpy.raw".format(name),
srcs = _substrate_srcs(srcs, "numpy"),
deps = _substrate_deps(trimmed_deps, "numpy"),
srcs_version = srcs_version,
testonly = testonly,
)
# Add symlinks under tfp/substrates/numpy.
substrate_runfiles_symlinks(
name = "{}.numpy".format(name),
substrate = "numpy",
deps = [":{}.numpy.raw".format(name)],
testonly = testonly,
)
resolved_omit_deps_jax = [
_resolve_omit_dep(dep)
for dep in substrates_omit_deps + jax_omit_deps
]
jax_srcs = _substrate_srcs(srcs, "jax")
for src in srcs:
native.genrule(
name = "rewrite_{}_jax".format(src.replace(".", "_")),
srcs = [src],
outs = [_substrate_src(src, "jax")],
cmd = "$(location {}) $(SRCS) --omit_deps={} --numpy_to_jax > $@".format(
REWRITER_TARGET,
",".join(resolved_omit_deps_jax),
),
tools = [REWRITER_TARGET],
)
native.py_library(
name = "{}.jax.raw".format(name),
srcs = jax_srcs,
deps = _substrate_deps(trimmed_deps, "jax"),
srcs_version = srcs_version,
testonly = testonly,
)
# Add symlinks under tfp/substrates/jax.
substrate_runfiles_symlinks(
name = "{}.jax".format(name),
substrate = "jax",
deps = [":{}.jax.raw".format(name)],
testonly = testonly,
)
def multi_substrate_py_test(
name,
size = "small",
jax_size = None,
numpy_size = None,
srcs = [],
deps = [],
tags = [],
numpy_tags = [],
jax_tags = [],
disabled_substrates = [],
srcs_version = "PY2AND3",
timeout = None,
shard_count = None):
"""A TFP `py2and3_test` for each of TF, NumPy, and JAX.
Args:
name: Name of the `test_suite` which covers TF, NumPy and JAX variants
of the test. Each substrate will have a dedicated `py2and3_test`
suffixed with '.tf', '.numpy', or '.jax' as appropriate.
size: As with `py_test`.
jax_size: A size override for the JAX target.
numpy_size: A size override for the numpy target.
srcs: As with `py_test`. These will have a `genrule` emitted to rewrite
NumPy and JAX variants, writing the test file into a subdirectory.
deps: As with `py_test`. The list is rewritten to depend on
substrate-specific libraries for substrate variants.
tags: Tags global to this test target. NumPy also gets a `'tfp_numpy'`
tag, and JAX gets a `'tfp_jax'` tag. A `f'_{name}'` tag is used
to produce the `test_suite`.
numpy_tags: Tags specific to the NumPy test. (e.g. `"notap"`).
jax_tags: Tags specific to the JAX test. (e.g. `"notap"`).
disabled_substrates: Iterable of substrates to disable, items from
["numpy", "jax"].
srcs_version: As with `py_test`.
timeout: As with `py_test`.
shard_count: As with `py_test`.
"""
name_tag = "_{}".format(name)
tags = [t for t in tags]
tags.append(name_tag)
tags.append("multi_substrate")
native.py_test(
name = "{}.tf".format(name),
size = size,
srcs = srcs,
main = "{}.py".format(name),
deps = deps,
tags = tags,
srcs_version = srcs_version,
timeout = timeout,
shard_count = shard_count,
)
if "numpy" not in disabled_substrates:
numpy_srcs = _substrate_srcs(srcs, "numpy")
native.genrule(
name = "rewrite_{}_numpy".format(name),
srcs = srcs,
outs = numpy_srcs,
cmd = "$(location {}) $(SRCS) > $@".format(REWRITER_TARGET),
tools = [REWRITER_TARGET],
)
py3_test(
name = "{}.numpy".format(name),
size = numpy_size or size,
srcs = numpy_srcs,
main = _substrate_src("{}.py".format(name), "numpy"),
deps = _substrate_deps(deps, "numpy"),
tags = tags + ["tfp_numpy"] + numpy_tags,
srcs_version = srcs_version,
python_version = "PY3",
timeout = timeout,
shard_count = shard_count,
)
if "jax" not in disabled_substrates:
jax_srcs = _substrate_srcs(srcs, "jax")
native.genrule(
name = "rewrite_{}_jax".format(name),
srcs = srcs,
outs = jax_srcs,
cmd = "$(location {}) $(SRCS) --numpy_to_jax > $@".format(REWRITER_TARGET),
tools = [REWRITER_TARGET],
)
jax_deps = _substrate_deps(deps, "jax")
# [internal] Add JAX build dep
py3_test(
name = "{}.jax".format(name),
size = jax_size or size,
srcs = jax_srcs,
main = _substrate_src("{}.py".format(name), "jax"),
deps = jax_deps,
tags = tags + ["tfp_jax"] + jax_tags,
srcs_version = srcs_version,
python_version = "PY3",
timeout = timeout,
shard_count = shard_count,
)
native.test_suite(
name = name,
tags = [name_tag],
)
| en | 0.729919 | # Copyright 2019 The TensorFlow Probability Authors. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # ============================================================================ Build defs for TF/NumPy/JAX-variadic libraries & tests. # [internal] load python3.bzl Rewrite a single src filename for the given substrate. Rewrite src filenames for the given substrate. Convert a single dep to one appropriate for the given substrate. Convert deps to those appropriate for the given substrate. # This is needed for the transitional period during which we have the internal # py2and3_test and py_test comingling in BUILD files. Otherwise the OSS export # rewrite process becomes irreversible. Internal/external reversibility, denotes py3-only vs py2+3 tests. Args: *args: Passed to underlying py_test. **kwargs: Passed to underlying py_test. srcs_version and python_version are added (with value `"PY3"`) if not specified. Resolves a `substrates_omit_deps` item to full target. A custom BUILD rule to generate python runfiles symlinks. A custom build rule which adds runfiles symlinks for files matching a substrate genrule file pattern, i.e. `'_jax/_generated_normal.py'`. This rule will aggregate and pass along deps while adding the given symlinks to the runfiles structure. Build rule attributes: - substrate: One of 'jax' or 'numpy'; which substrate this applies to. - deps: A list of py_library labels. These are passed along. Args: ctx: Rule analysis context. Returns: Info objects to propagate deps and add runfiles symlinks. # Aggregate the depset inputs to resolve transitive dependencies. # if PyCcLinkParamsProvider in dep: # DisableOnExport # cc_infos.append(dep[PyCcLinkParamsProvider].cc_info) # DisableOnExport # Determine the set of symlinks to generate. # Construct the output structures to pass along Python srcs/deps/etc. # See documentation at: # https://docs.bazel.build/versions/3.4.0/skylark/rules.html A TFP `py_library` for each of TF, NumPy, and JAX. Args: name: The TF `py_library` name. NumPy and JAX libraries have '.numpy' and '.jax' appended. srcs: As with `py_library`. A `genrule` is used to rewrite srcs for NumPy and JAX substrates. deps: As with `py_library`. The list is rewritten to depend on substrate-specific libraries for substrate variants. substrates_omit_deps: List of deps to omit if those libraries are not rewritten for the substrates. jax_omit_deps: List of deps to omit for the JAX substrate. numpy_omit_deps: List of deps to omit for the NumPy substrate. testonly: As with `py_library`. srcs_version: As with `py_library`. # Add symlinks under tfp/substrates/numpy. # Add symlinks under tfp/substrates/jax. A TFP `py2and3_test` for each of TF, NumPy, and JAX. Args: name: Name of the `test_suite` which covers TF, NumPy and JAX variants of the test. Each substrate will have a dedicated `py2and3_test` suffixed with '.tf', '.numpy', or '.jax' as appropriate. size: As with `py_test`. jax_size: A size override for the JAX target. numpy_size: A size override for the numpy target. srcs: As with `py_test`. These will have a `genrule` emitted to rewrite NumPy and JAX variants, writing the test file into a subdirectory. deps: As with `py_test`. The list is rewritten to depend on substrate-specific libraries for substrate variants. tags: Tags global to this test target. NumPy also gets a `'tfp_numpy'` tag, and JAX gets a `'tfp_jax'` tag. A `f'_{name}'` tag is used to produce the `test_suite`. numpy_tags: Tags specific to the NumPy test. (e.g. `"notap"`). jax_tags: Tags specific to the JAX test. (e.g. `"notap"`). disabled_substrates: Iterable of substrates to disable, items from ["numpy", "jax"]. srcs_version: As with `py_test`. timeout: As with `py_test`. shard_count: As with `py_test`. # [internal] Add JAX build dep | 1.739457 | 2 |
src/wikidated/wikidata/wikidata_dump.py | lschmelzeisen/wikidata-history-analyzer | 6 | 2819 | <filename>src/wikidated/wikidata/wikidata_dump.py<gh_stars>1-10
#
# Copyright 2021 <NAME>
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS,
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
# See the License for the specific language governing permissions and
# limitations under the License.
#
from __future__ import annotations
import json
from datetime import date, datetime
from logging import getLogger
from pathlib import Path
from typing import Mapping, MutableSequence, Sequence, Type, TypeVar
import requests
from pydantic import BaseModel as PydanticModel
from pydantic import validator
from tqdm import tqdm # type: ignore
from typing_extensions import Final
from wikidated._utils import RangeMap
from wikidated.wikidata.wikidata_dump_file import WikidataDumpFile
from wikidated.wikidata.wikidata_dump_pages_meta_history import (
WikidataDumpPagesMetaHistory,
)
from wikidated.wikidata.wikidata_dump_sites_table import WikidataDumpSitesTable
_LOGGER = getLogger(__name__)
_T_WikidataDumpFile = TypeVar("_T_WikidataDumpFile", bound=WikidataDumpFile)
class WikidataDump:
def __init__(
self,
dump_dir: Path,
version: date,
*,
mirror: str = "https://dumps.wikimedia.org",
) -> None:
self._dump_dir = dump_dir
self.version: Final = version
self.mirror: Final = mirror
self._dump_status = _WikidataDumpStatus.load(
self._dump_dir, self.version, self.mirror
)
self.sites_table: Final = self._construct_dumps(
WikidataDumpSitesTable, "sitestable"
)[0]
self.pages_meta_history: Final = RangeMap[WikidataDumpPagesMetaHistory]()
for dump_file in self._construct_dumps(
WikidataDumpPagesMetaHistory, "metahistory7zdump"
):
self.pages_meta_history[dump_file.page_ids] = dump_file
def download(
self, *, sites_table: bool = True, pages_meta_history: bool = True
) -> None:
_LOGGER.info(
f"Downloading Wikidata dump {self.version:%4Y%2m%2d} from '{self.mirror}'."
)
dump_files: MutableSequence[WikidataDumpFile] = []
if sites_table:
dump_files.append(self.sites_table)
if pages_meta_history:
dump_files.extend(self.pages_meta_history.values())
with tqdm(
desc=f"Wikidata dump {self.version:%4Y%2m%2d} files",
total=len(dump_files),
dynamic_ncols=True,
position=1,
) as progress_bar_files, tqdm(
desc=f"Wikidata dump {self.version:%4Y%2m%2d} bytes",
total=sum(dump_file.size for dump_file in dump_files),
dynamic_ncols=True,
position=2,
unit="B",
unit_scale=True,
unit_divisor=1024,
) as progress_bar_size:
for dump_file in dump_files:
dump_file.download()
progress_bar_files.update(1)
progress_bar_size.update(dump_file.size)
_LOGGER.info(f"Done downloading Wikidata dump {self.version:%4Y%2m%2d}.")
def _construct_dumps(
self, dump_type: Type[_T_WikidataDumpFile], dump_type_id: str
) -> Sequence[_T_WikidataDumpFile]:
return [
dump_type(
path=self._dump_dir / path,
url=self.mirror + dump_status_file.url,
sha1=dump_status_file.sha1,
size=dump_status_file.size,
)
for path, dump_status_file in self._dump_status.jobs[
dump_type_id
].files.items()
]
class _WikidataDumpStatusFile(PydanticModel):
size: int
url: str
md5: str
sha1: str
class _WikidataDumpStatusJob(PydanticModel):
status: str
updated: datetime
files: Mapping[str, _WikidataDumpStatusFile]
@validator("updated", pre=True)
def _parse_datetime(cls, value: str) -> datetime: # noqa: N805
return datetime.strptime(value, "%Y-%m-%d %H:%M:%S")
class _WikidataDumpStatus(PydanticModel):
jobs: Mapping[str, _WikidataDumpStatusJob]
version: str
@classmethod
def load(cls, dump_dir: Path, version: date, mirror: str) -> _WikidataDumpStatus:
path = dump_dir / f"wikidatawiki-{version:%4Y%2m%2d}-dumpstatus.json"
if not path.exists():
url = f"{mirror}/wikidatawiki/{version:%4Y%2m%2d}/dumpstatus.json"
_LOGGER.debug(f"Downloading Wikidata dump status from '{url}'.")
response = requests.get(url)
response.raise_for_status()
path.parent.mkdir(exist_ok=True, parents=True)
with path.open("w", encoding="UTF-8") as fd:
fd.write(json.dumps(response.json(), indent=2) + "\n")
_LOGGER.debug("Done downloading Wikidata dump status.")
dump_status = _WikidataDumpStatus.parse_file(path)
for job_name, job in dump_status.jobs.items():
if job.status != "done":
path.unlink()
raise Exception(f"Job '{job_name}' is not 'done', but '{job.status}'.")
return dump_status
| <filename>src/wikidated/wikidata/wikidata_dump.py<gh_stars>1-10
#
# Copyright 2021 <NAME>
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS,
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
# See the License for the specific language governing permissions and
# limitations under the License.
#
from __future__ import annotations
import json
from datetime import date, datetime
from logging import getLogger
from pathlib import Path
from typing import Mapping, MutableSequence, Sequence, Type, TypeVar
import requests
from pydantic import BaseModel as PydanticModel
from pydantic import validator
from tqdm import tqdm # type: ignore
from typing_extensions import Final
from wikidated._utils import RangeMap
from wikidated.wikidata.wikidata_dump_file import WikidataDumpFile
from wikidated.wikidata.wikidata_dump_pages_meta_history import (
WikidataDumpPagesMetaHistory,
)
from wikidated.wikidata.wikidata_dump_sites_table import WikidataDumpSitesTable
_LOGGER = getLogger(__name__)
_T_WikidataDumpFile = TypeVar("_T_WikidataDumpFile", bound=WikidataDumpFile)
class WikidataDump:
def __init__(
self,
dump_dir: Path,
version: date,
*,
mirror: str = "https://dumps.wikimedia.org",
) -> None:
self._dump_dir = dump_dir
self.version: Final = version
self.mirror: Final = mirror
self._dump_status = _WikidataDumpStatus.load(
self._dump_dir, self.version, self.mirror
)
self.sites_table: Final = self._construct_dumps(
WikidataDumpSitesTable, "sitestable"
)[0]
self.pages_meta_history: Final = RangeMap[WikidataDumpPagesMetaHistory]()
for dump_file in self._construct_dumps(
WikidataDumpPagesMetaHistory, "metahistory7zdump"
):
self.pages_meta_history[dump_file.page_ids] = dump_file
def download(
self, *, sites_table: bool = True, pages_meta_history: bool = True
) -> None:
_LOGGER.info(
f"Downloading Wikidata dump {self.version:%4Y%2m%2d} from '{self.mirror}'."
)
dump_files: MutableSequence[WikidataDumpFile] = []
if sites_table:
dump_files.append(self.sites_table)
if pages_meta_history:
dump_files.extend(self.pages_meta_history.values())
with tqdm(
desc=f"Wikidata dump {self.version:%4Y%2m%2d} files",
total=len(dump_files),
dynamic_ncols=True,
position=1,
) as progress_bar_files, tqdm(
desc=f"Wikidata dump {self.version:%4Y%2m%2d} bytes",
total=sum(dump_file.size for dump_file in dump_files),
dynamic_ncols=True,
position=2,
unit="B",
unit_scale=True,
unit_divisor=1024,
) as progress_bar_size:
for dump_file in dump_files:
dump_file.download()
progress_bar_files.update(1)
progress_bar_size.update(dump_file.size)
_LOGGER.info(f"Done downloading Wikidata dump {self.version:%4Y%2m%2d}.")
def _construct_dumps(
self, dump_type: Type[_T_WikidataDumpFile], dump_type_id: str
) -> Sequence[_T_WikidataDumpFile]:
return [
dump_type(
path=self._dump_dir / path,
url=self.mirror + dump_status_file.url,
sha1=dump_status_file.sha1,
size=dump_status_file.size,
)
for path, dump_status_file in self._dump_status.jobs[
dump_type_id
].files.items()
]
class _WikidataDumpStatusFile(PydanticModel):
size: int
url: str
md5: str
sha1: str
class _WikidataDumpStatusJob(PydanticModel):
status: str
updated: datetime
files: Mapping[str, _WikidataDumpStatusFile]
@validator("updated", pre=True)
def _parse_datetime(cls, value: str) -> datetime: # noqa: N805
return datetime.strptime(value, "%Y-%m-%d %H:%M:%S")
class _WikidataDumpStatus(PydanticModel):
jobs: Mapping[str, _WikidataDumpStatusJob]
version: str
@classmethod
def load(cls, dump_dir: Path, version: date, mirror: str) -> _WikidataDumpStatus:
path = dump_dir / f"wikidatawiki-{version:%4Y%2m%2d}-dumpstatus.json"
if not path.exists():
url = f"{mirror}/wikidatawiki/{version:%4Y%2m%2d}/dumpstatus.json"
_LOGGER.debug(f"Downloading Wikidata dump status from '{url}'.")
response = requests.get(url)
response.raise_for_status()
path.parent.mkdir(exist_ok=True, parents=True)
with path.open("w", encoding="UTF-8") as fd:
fd.write(json.dumps(response.json(), indent=2) + "\n")
_LOGGER.debug("Done downloading Wikidata dump status.")
dump_status = _WikidataDumpStatus.parse_file(path)
for job_name, job in dump_status.jobs.items():
if job.status != "done":
path.unlink()
raise Exception(f"Job '{job_name}' is not 'done', but '{job.status}'.")
return dump_status
| en | 0.832599 | # # Copyright 2021 <NAME> # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # # type: ignore # noqa: N805 | 2.194141 | 2 |
tcapygen/layoutgen.py | Ahrvo-Trading-Systems/tcapy | 189 | 2820 | from __future__ import division, print_function
__author__ = 'saeedamen' # <NAME> / <EMAIL>
#
# Copyright 2017 Cuemacro Ltd. - http//www.cuemacro.com / @cuemacro
#
# See the License for the specific language governing permissions and limitations under the License.
#
## Web server components
import dash_core_components as dcc
import dash_html_components as html
import base64
import os
## Date/time components
import pandas as pd
import datetime
from datetime import timedelta
from collections import OrderedDict
from pandas.tseries.offsets import *
from tcapy.vis.layoutdash import LayoutDash
########################################################################################################################
class LayoutDashImplGen(LayoutDash):
"""This implements the LayoutDash abstract class, to create the web based GUI for the tcapy application. It creates two
web pages
- detailed_page - for doing detailed tcapy analysis for a specific currency pair
- aggregated_page - for more aggregated style analysis across multiple currency pairs and over multiple time periods
"""
def __init__(self, app=None, constants=None, url_prefix=''):
super(LayoutDashImplGen, self).__init__(app=app, constants=constants, url_prefix=url_prefix)
available_dates = pd.date_range(
datetime.datetime.today().date() - timedelta(days=self._constants.gui_lookback_window),
datetime.datetime.today().date(), freq=BDay())
times = pd.date_range("0:00", "23:59", freq="15min")
### create the possible values for drop down boxes on both pages
# Reverse date list (for both detailed and aggregated pages)
self.available_dates = [x.date() for x in available_dates[::-1]]
# For detailed page only
self.available_times = [t.strftime("%H:%M") for t in times]
self.available_tickers = self._constants.available_tickers_dictionary['All']
self.available_venues = self._constants.available_venues_dictionary['All']
self.available_brokers = self._constants.available_brokers_dictionary['All']
self.available_algos = self._constants.available_algos_dictionary['All']
self.available_market_data = self._constants.available_market_data
self.available_order_plot_lines = ['candlestick', 'mid', 'bid', 'ask', 'arrival', 'twap', 'vwap',
'buy trade', 'sell trade']
self.available_execution_plot_lines = ['candlestick', 'mid', 'bid', 'ask', 'buy trade', 'sell trade']
self.available_slippage_bounds = ['0.25', '0.5', '1.0', '1.25', '1.5', '2.0', 'bid/ask']
# For aggregated page only
self.available_grouped_tickers = self._flatten_dictionary(self._constants.available_tickers_dictionary)
self.available_grouped_venues = self._flatten_dictionary(self._constants.available_venues_dictionary)
self.available_grouped_brokers = self._flatten_dictionary(self._constants.available_brokers_dictionary)
self.available_grouped_algos = self._flatten_dictionary(self._constants.available_algos_dictionary)
self.available_event_types = self._constants.available_event_types
self.available_metrics = self._constants.available_metrics
self.available_reload = ['no', 'yes']
self.available_visualization = ['yes', 'no']
self.construct_layout()
def _flatten_dictionary(self, dictionary):
available = dictionary['All']
available_groups = self._util_func.dict_key_list(dictionary.keys())
return self.flatten_list_of_strings([available_groups, available])
def construct_layout(self):
self.page_content = html.Div([
dcc.Location(id='url', refresh=False),
html.Div(id='page-content')
])
link_bar_dict = {'Detailed' : 'detailed',
'Aggregated' : 'aggregated',
'Compliance' : 'compliance'}
trade_outliers_cols = ['Date', 'ticker', 'side', 'notional cur', 'benchmark', 'exec not',
'exec not in rep cur', 'slippage']
broker_cols = ['Date', 'by broker notional (rep cur)']
# Main page for detailed analysing of (eg. over the course of a few days)
self.pages['detailed'] = html.Div([
self._sc.header_bar('FX: Detailed - Trader Analysis', img='logo.png'),
self._sc.link_bar(link_bar_dict),
self._sc.width_row_cell(html.B("Status: ok", id='detailed-status'), margin_left=5),
self._sc.horizontal_bar(),
# Dropdown selection boxes
html.Div([
self._sc.drop_down(caption='Start Date', id={'start-date-val' : self.available_dates,
'start-time-val' : self.available_times},
prefix_id='detailed'),
self._sc.drop_down(caption='Finish Date', id=OrderedDict([('finish-date-val', self.available_dates),
('finish-time-val', self.available_times)]),
prefix_id='detailed'),
self._sc.drop_down(caption='Ticker', id='ticker-val', prefix_id='detailed',
drop_down_values=self.available_tickers),
self._sc.drop_down(caption='Broker', id='broker-val', prefix_id='detailed',
drop_down_values=self.available_grouped_brokers),
self._sc.drop_down(caption='Algo', id='algo-val', prefix_id='detailed',
drop_down_values=self.available_grouped_algos),
self._sc.drop_down(caption='Venue', id='venue-val', prefix_id='detailed',
drop_down_values=self.available_grouped_venues),
self._sc.drop_down(caption='Market Data', id='market-data-val', prefix_id='detailed',
drop_down_values=self.available_market_data),
self._sc.drop_down(caption='Metric', id='metric-val', prefix_id='detailed',
drop_down_values=self.available_metrics)
]),
self._sc.horizontal_bar(),
self._sc.button(caption='Calculate', id='calculation-button', prefix_id='detailed'),
# self.button(caption = 'Print PDF', id = 'detailed-print-pdf-button', className = 'no-print'),
# Orders
self._sc.horizontal_bar(),
self._sc.plot(caption='Orders: Timeline', id='order-candle-timeline-plot', prefix_id='detailed',
element_add=self._sc.timeline_dropdown('detailed-order-candle-timeline-plot',
self.available_order_plot_lines),
downloadplot_caption='Download CSV',
downloadplot_tag='order-candle-timeline-download-link',
download_file='download_order_candle_timeline', height=500),
self._sc.plot(caption='Orders: Markout', id='order-markout-plot', prefix_id='detailed', height=500),
self._sc.plot(caption='Orders: Histogram vs PDF fit', id='order-dist-plot', prefix_id='detailed', height=500),
# Execution trades
self._sc.horizontal_bar(),
self._sc.plot(caption='Executions: Timeline', id='execution-candle-timeline-plot', prefix_id='detailed',
element_add=self._sc.timeline_dropdown('detailed-execution-candle-timeline-plot',
self.available_execution_plot_lines),
downloadplot_caption='Download CSV',
downloadplot_tag='execution-candle-timeline-download-link',
download_file='download_execution_candle_timeline.csv', height=500),
self._sc.plot(caption='Executions: Markout', id='execution-markout-plot', prefix_id='detailed', height=500),
self._sc.plot(caption='Executions: Histogram vs PDF fit', id='execution-dist-plot', prefix_id='detailed', height=500),
# Detailed tcapy markout table for executions
html.Div([
html.H3('Executions: Markout Table'),
html.Div(id='detailed-execution-table')
],
style={'width': '1000px', 'display': 'inline-block', 'marginBottom': 5, 'marginTop': 5, 'marginLeft': 5,
'marginRight': 5}),
],
style={'width': '1000px', 'marginRight': 'auto', 'marginLeft': 'auto'})
################################################################################################################
# Secondary page for analysing aggregated statistics over long periods of time, eg. who is the best broker?
self.pages['aggregated'] = html.Div([
self._sc.header_bar('FX: Aggregated - Trader Analysis', img='logo.png'),
self._sc.link_bar(link_bar_dict),
self._sc.width_row_cell(html.B("Status: ok", id='aggregated-status'), margin_left=5),
self._sc.horizontal_bar(),
# dropdown selection boxes
html.Div([
self._sc.drop_down(caption='Start Date', id='start-date-val', prefix_id='aggregated',
drop_down_values=self.available_dates),
self._sc.drop_down(caption='Finish Date', id='finish-date-val', prefix_id='aggregated',
drop_down_values=self.available_dates),
self._sc.drop_down(caption='Ticker', id='ticker-val', prefix_id='aggregated',
drop_down_values=self.available_grouped_tickers, multiselect=True),
self._sc.drop_down(caption='Broker', id='broker-val', prefix_id='aggregated',
drop_down_values=self.available_grouped_brokers, multiselect=True),
self._sc.drop_down(caption='Algo', id='algo-val', prefix_id='aggregated',
drop_down_values=self.available_grouped_algos, multiselect=True),
self._sc.drop_down(caption='Venue', id='venue-val', prefix_id='aggregated',
drop_down_values=self.available_grouped_venues, multiselect=True),
self._sc.drop_down(caption='Reload', id='reload-val', prefix_id='aggregated',
drop_down_values=self.available_reload),
self._sc.drop_down(caption='Market Data', id='market-data-val', prefix_id='aggregated',
drop_down_values=self.available_market_data),
self._sc.drop_down(caption='Event Type', id='event-type-val', prefix_id='aggregated',
drop_down_values=self.available_event_types),
self._sc.drop_down(caption='Metric', id='metric-val', prefix_id='aggregated',
drop_down_values=self.available_metrics),
]),
self._sc.horizontal_bar(),
self._sc.button(caption='Calculate', id='calculation-button', prefix_id='aggregated'),
# , msg_id='aggregated-status'),
self._sc.horizontal_bar(),
# self.date_picker_range(caption='Start/Finish Dates', id='aggregated-date-val', offset=[-7,-1]),
self._sc.plot(caption='Aggregated Trader: Summary',
id=['execution-by-ticker-bar-plot', 'execution-by-venue-bar-plot'], prefix_id='aggregated', height=500),
self._sc.horizontal_bar(),
self._sc.plot(caption='Aggregated Trader: Timeline', id='execution-by-ticker-timeline-plot',
prefix_id='aggregated', height=500),
self._sc.horizontal_bar(),
self._sc.plot(caption='Aggregated Trader: PDF fit (' + self._constants.reporting_currency + ' notional)', id=['execution-by-ticker-dist-plot',
'execution-by-venue-dist-plot'],
prefix_id='aggregated', height=500),
self._sc.horizontal_bar()
],
style={'width': '1000px', 'marginRight': 'auto', 'marginLeft': 'auto'})
################################################################################################################
self.pages['compliance'] = html.Div([
self._sc.header_bar('FX: Compliance Analysis', img='logo.png'),
self._sc.link_bar(link_bar_dict),
self._sc.width_row_cell(html.B("Status: ok", id='compliance-status'), margin_left=5),
self._sc.horizontal_bar(),
# Dropdown selection boxes
html.Div([
self._sc.drop_down(caption='Start Date', id='start-date-val', prefix_id='compliance',
drop_down_values=self.available_dates),
self._sc.drop_down(caption='Finish Date', id='finish-date-val', prefix_id='compliance',
drop_down_values=self.available_dates),
self._sc.drop_down(caption='Ticker', id='ticker-val', prefix_id='compliance',
drop_down_values=self.available_grouped_tickers, multiselect=True),
self._sc.drop_down(caption='Broker', id='broker-val', prefix_id='compliance',
drop_down_values=self.available_grouped_brokers, multiselect=True),
self._sc.drop_down(caption='Algo', id='algo-val', prefix_id='compliance',
drop_down_values=self.available_grouped_algos, multiselect=True),
self._sc.drop_down(caption='Venue', id='venue-val', prefix_id='compliance',
drop_down_values=self.available_grouped_venues, multiselect=True),
self._sc.drop_down(caption='Reload', id='reload-val', prefix_id='compliance',
drop_down_values=self.available_reload),
self._sc.drop_down(caption='Market Data', id='market-data-val', prefix_id='compliance',
drop_down_values=self.available_market_data),
self._sc.drop_down(caption='Filter by Time', id='filter-time-of-day-val', prefix_id='compliance',
drop_down_values=self.available_reload),
self._sc.drop_down(caption='Start Time of Day', id='start-time-of-day-val', prefix_id='compliance',
drop_down_values=self.available_times),
self._sc.drop_down(caption='Finish Time of Day', id='finish-time-of-day-val', prefix_id='compliance',
drop_down_values=self.available_times),
self._sc.drop_down(caption='Slippage to Mid (bp)', id='slippage-bounds-val', prefix_id='compliance',
drop_down_values=self.available_slippage_bounds),
self._sc.drop_down(caption='Visualization', id='visualization-val', prefix_id='compliance',
drop_down_values=self.available_visualization)
]),
self._sc.horizontal_bar(),
html.Div([
self._sc.button(caption='Calculate', id='calculation-button', prefix_id='compliance'),
# self.date_picker(caption='Start Date', id='start-date-dtpicker', prefix_id='compliance'),
# self.date_picker(caption='Finish Date', id='finish-date-dtpicker', prefix_id='compliance'),
]),
self._sc.horizontal_bar(),
self._sc.table(caption='Compliance: Trade Outliers', id='execution-by-anomalous-table', prefix_id='compliance',
columns=trade_outliers_cols,
downloadplot_caption='Trade outliers CSV',
downloadplot_tag='execution-by-anomalous-download-link',
download_file='download_execution_by_anomalous.csv'),
self._sc.table(caption='Compliance: Totals by Broker', id='summary-by-broker-table', prefix_id='compliance',
columns=broker_cols,
downloadplot_caption='Download broker CSV',
downloadplot_tag='summary-by-broker-download-link',
download_file='download_broker.csv'
),
self._sc.horizontal_bar()
],
style={'width': '1000px', 'marginRight': 'auto', 'marginLeft': 'auto'})
# ID flags
self.id_flags = {
# Detailed trader page
# 'timeline_trade_orders' : {'client-orders': 'order', 'executions': 'trade'},
# 'markout_trade_orders' : {'client-orders': 'order_df', 'executions': 'trade_df'},
'detailed_candle_timeline_trade_order': {'execution': 'sparse_market_trade_df',
'order': 'sparse_market_order_df'},
'detailed_markout_trade_order': {'execution': 'trade_df', 'order': 'order_df'},
'detailed_table_trade_order': {'execution': 'table_trade_df_markout_by_all'},
'detailed_dist_trade_order': {'execution': 'dist_trade_df_by/pdf/side', 'order': 'dist_order_df_by/pdf/side'},
'detailed_download_link_trade_order': {'execution-candle-timeline': 'sparse_market_trade_df',
'order-candle-timeline': 'sparse_market_order_df'},
# Aggregated trader page
'aggregated_bar_trade_order': {'execution-by-ticker': 'bar_trade_df_by/mean/ticker',
'execution-by-venue': 'bar_trade_df_by/mean/venue'},
'aggregated_timeline_trade_order': {'execution-by-ticker': 'timeline_trade_df_by/mean_date/ticker',
'execution-by-venue': 'timeline_trade_df_by/mean_date/venue'},
'aggregated_dist_trade_order': {'execution-by-ticker': 'dist_trade_df_by/pdf/ticker',
'execution-by-venue': 'dist_trade_df_by/pdf/venue'},
# Compliance page
'compliance_metric_table_trade_order':
{'execution-by-anomalous': 'table_trade_df_slippage_by_worst_all',
'summary-by-broker': 'bar_trade_df_executed_notional_in_reporting_currency_by_broker_id'},
'compliance_download_link_trade_order':
{'execution-by-anomalous': 'table_trade_df_slippage_by_worst_all',
'summary-by-broker': 'bar_trade_df_executed_notional_in_reporting_currency_by_broker_id'},
}
| from __future__ import division, print_function
__author__ = 'saeedamen' # <NAME> / <EMAIL>
#
# Copyright 2017 Cuemacro Ltd. - http//www.cuemacro.com / @cuemacro
#
# See the License for the specific language governing permissions and limitations under the License.
#
## Web server components
import dash_core_components as dcc
import dash_html_components as html
import base64
import os
## Date/time components
import pandas as pd
import datetime
from datetime import timedelta
from collections import OrderedDict
from pandas.tseries.offsets import *
from tcapy.vis.layoutdash import LayoutDash
########################################################################################################################
class LayoutDashImplGen(LayoutDash):
"""This implements the LayoutDash abstract class, to create the web based GUI for the tcapy application. It creates two
web pages
- detailed_page - for doing detailed tcapy analysis for a specific currency pair
- aggregated_page - for more aggregated style analysis across multiple currency pairs and over multiple time periods
"""
def __init__(self, app=None, constants=None, url_prefix=''):
super(LayoutDashImplGen, self).__init__(app=app, constants=constants, url_prefix=url_prefix)
available_dates = pd.date_range(
datetime.datetime.today().date() - timedelta(days=self._constants.gui_lookback_window),
datetime.datetime.today().date(), freq=BDay())
times = pd.date_range("0:00", "23:59", freq="15min")
### create the possible values for drop down boxes on both pages
# Reverse date list (for both detailed and aggregated pages)
self.available_dates = [x.date() for x in available_dates[::-1]]
# For detailed page only
self.available_times = [t.strftime("%H:%M") for t in times]
self.available_tickers = self._constants.available_tickers_dictionary['All']
self.available_venues = self._constants.available_venues_dictionary['All']
self.available_brokers = self._constants.available_brokers_dictionary['All']
self.available_algos = self._constants.available_algos_dictionary['All']
self.available_market_data = self._constants.available_market_data
self.available_order_plot_lines = ['candlestick', 'mid', 'bid', 'ask', 'arrival', 'twap', 'vwap',
'buy trade', 'sell trade']
self.available_execution_plot_lines = ['candlestick', 'mid', 'bid', 'ask', 'buy trade', 'sell trade']
self.available_slippage_bounds = ['0.25', '0.5', '1.0', '1.25', '1.5', '2.0', 'bid/ask']
# For aggregated page only
self.available_grouped_tickers = self._flatten_dictionary(self._constants.available_tickers_dictionary)
self.available_grouped_venues = self._flatten_dictionary(self._constants.available_venues_dictionary)
self.available_grouped_brokers = self._flatten_dictionary(self._constants.available_brokers_dictionary)
self.available_grouped_algos = self._flatten_dictionary(self._constants.available_algos_dictionary)
self.available_event_types = self._constants.available_event_types
self.available_metrics = self._constants.available_metrics
self.available_reload = ['no', 'yes']
self.available_visualization = ['yes', 'no']
self.construct_layout()
def _flatten_dictionary(self, dictionary):
available = dictionary['All']
available_groups = self._util_func.dict_key_list(dictionary.keys())
return self.flatten_list_of_strings([available_groups, available])
def construct_layout(self):
self.page_content = html.Div([
dcc.Location(id='url', refresh=False),
html.Div(id='page-content')
])
link_bar_dict = {'Detailed' : 'detailed',
'Aggregated' : 'aggregated',
'Compliance' : 'compliance'}
trade_outliers_cols = ['Date', 'ticker', 'side', 'notional cur', 'benchmark', 'exec not',
'exec not in rep cur', 'slippage']
broker_cols = ['Date', 'by broker notional (rep cur)']
# Main page for detailed analysing of (eg. over the course of a few days)
self.pages['detailed'] = html.Div([
self._sc.header_bar('FX: Detailed - Trader Analysis', img='logo.png'),
self._sc.link_bar(link_bar_dict),
self._sc.width_row_cell(html.B("Status: ok", id='detailed-status'), margin_left=5),
self._sc.horizontal_bar(),
# Dropdown selection boxes
html.Div([
self._sc.drop_down(caption='Start Date', id={'start-date-val' : self.available_dates,
'start-time-val' : self.available_times},
prefix_id='detailed'),
self._sc.drop_down(caption='Finish Date', id=OrderedDict([('finish-date-val', self.available_dates),
('finish-time-val', self.available_times)]),
prefix_id='detailed'),
self._sc.drop_down(caption='Ticker', id='ticker-val', prefix_id='detailed',
drop_down_values=self.available_tickers),
self._sc.drop_down(caption='Broker', id='broker-val', prefix_id='detailed',
drop_down_values=self.available_grouped_brokers),
self._sc.drop_down(caption='Algo', id='algo-val', prefix_id='detailed',
drop_down_values=self.available_grouped_algos),
self._sc.drop_down(caption='Venue', id='venue-val', prefix_id='detailed',
drop_down_values=self.available_grouped_venues),
self._sc.drop_down(caption='Market Data', id='market-data-val', prefix_id='detailed',
drop_down_values=self.available_market_data),
self._sc.drop_down(caption='Metric', id='metric-val', prefix_id='detailed',
drop_down_values=self.available_metrics)
]),
self._sc.horizontal_bar(),
self._sc.button(caption='Calculate', id='calculation-button', prefix_id='detailed'),
# self.button(caption = 'Print PDF', id = 'detailed-print-pdf-button', className = 'no-print'),
# Orders
self._sc.horizontal_bar(),
self._sc.plot(caption='Orders: Timeline', id='order-candle-timeline-plot', prefix_id='detailed',
element_add=self._sc.timeline_dropdown('detailed-order-candle-timeline-plot',
self.available_order_plot_lines),
downloadplot_caption='Download CSV',
downloadplot_tag='order-candle-timeline-download-link',
download_file='download_order_candle_timeline', height=500),
self._sc.plot(caption='Orders: Markout', id='order-markout-plot', prefix_id='detailed', height=500),
self._sc.plot(caption='Orders: Histogram vs PDF fit', id='order-dist-plot', prefix_id='detailed', height=500),
# Execution trades
self._sc.horizontal_bar(),
self._sc.plot(caption='Executions: Timeline', id='execution-candle-timeline-plot', prefix_id='detailed',
element_add=self._sc.timeline_dropdown('detailed-execution-candle-timeline-plot',
self.available_execution_plot_lines),
downloadplot_caption='Download CSV',
downloadplot_tag='execution-candle-timeline-download-link',
download_file='download_execution_candle_timeline.csv', height=500),
self._sc.plot(caption='Executions: Markout', id='execution-markout-plot', prefix_id='detailed', height=500),
self._sc.plot(caption='Executions: Histogram vs PDF fit', id='execution-dist-plot', prefix_id='detailed', height=500),
# Detailed tcapy markout table for executions
html.Div([
html.H3('Executions: Markout Table'),
html.Div(id='detailed-execution-table')
],
style={'width': '1000px', 'display': 'inline-block', 'marginBottom': 5, 'marginTop': 5, 'marginLeft': 5,
'marginRight': 5}),
],
style={'width': '1000px', 'marginRight': 'auto', 'marginLeft': 'auto'})
################################################################################################################
# Secondary page for analysing aggregated statistics over long periods of time, eg. who is the best broker?
self.pages['aggregated'] = html.Div([
self._sc.header_bar('FX: Aggregated - Trader Analysis', img='logo.png'),
self._sc.link_bar(link_bar_dict),
self._sc.width_row_cell(html.B("Status: ok", id='aggregated-status'), margin_left=5),
self._sc.horizontal_bar(),
# dropdown selection boxes
html.Div([
self._sc.drop_down(caption='Start Date', id='start-date-val', prefix_id='aggregated',
drop_down_values=self.available_dates),
self._sc.drop_down(caption='Finish Date', id='finish-date-val', prefix_id='aggregated',
drop_down_values=self.available_dates),
self._sc.drop_down(caption='Ticker', id='ticker-val', prefix_id='aggregated',
drop_down_values=self.available_grouped_tickers, multiselect=True),
self._sc.drop_down(caption='Broker', id='broker-val', prefix_id='aggregated',
drop_down_values=self.available_grouped_brokers, multiselect=True),
self._sc.drop_down(caption='Algo', id='algo-val', prefix_id='aggregated',
drop_down_values=self.available_grouped_algos, multiselect=True),
self._sc.drop_down(caption='Venue', id='venue-val', prefix_id='aggregated',
drop_down_values=self.available_grouped_venues, multiselect=True),
self._sc.drop_down(caption='Reload', id='reload-val', prefix_id='aggregated',
drop_down_values=self.available_reload),
self._sc.drop_down(caption='Market Data', id='market-data-val', prefix_id='aggregated',
drop_down_values=self.available_market_data),
self._sc.drop_down(caption='Event Type', id='event-type-val', prefix_id='aggregated',
drop_down_values=self.available_event_types),
self._sc.drop_down(caption='Metric', id='metric-val', prefix_id='aggregated',
drop_down_values=self.available_metrics),
]),
self._sc.horizontal_bar(),
self._sc.button(caption='Calculate', id='calculation-button', prefix_id='aggregated'),
# , msg_id='aggregated-status'),
self._sc.horizontal_bar(),
# self.date_picker_range(caption='Start/Finish Dates', id='aggregated-date-val', offset=[-7,-1]),
self._sc.plot(caption='Aggregated Trader: Summary',
id=['execution-by-ticker-bar-plot', 'execution-by-venue-bar-plot'], prefix_id='aggregated', height=500),
self._sc.horizontal_bar(),
self._sc.plot(caption='Aggregated Trader: Timeline', id='execution-by-ticker-timeline-plot',
prefix_id='aggregated', height=500),
self._sc.horizontal_bar(),
self._sc.plot(caption='Aggregated Trader: PDF fit (' + self._constants.reporting_currency + ' notional)', id=['execution-by-ticker-dist-plot',
'execution-by-venue-dist-plot'],
prefix_id='aggregated', height=500),
self._sc.horizontal_bar()
],
style={'width': '1000px', 'marginRight': 'auto', 'marginLeft': 'auto'})
################################################################################################################
self.pages['compliance'] = html.Div([
self._sc.header_bar('FX: Compliance Analysis', img='logo.png'),
self._sc.link_bar(link_bar_dict),
self._sc.width_row_cell(html.B("Status: ok", id='compliance-status'), margin_left=5),
self._sc.horizontal_bar(),
# Dropdown selection boxes
html.Div([
self._sc.drop_down(caption='Start Date', id='start-date-val', prefix_id='compliance',
drop_down_values=self.available_dates),
self._sc.drop_down(caption='Finish Date', id='finish-date-val', prefix_id='compliance',
drop_down_values=self.available_dates),
self._sc.drop_down(caption='Ticker', id='ticker-val', prefix_id='compliance',
drop_down_values=self.available_grouped_tickers, multiselect=True),
self._sc.drop_down(caption='Broker', id='broker-val', prefix_id='compliance',
drop_down_values=self.available_grouped_brokers, multiselect=True),
self._sc.drop_down(caption='Algo', id='algo-val', prefix_id='compliance',
drop_down_values=self.available_grouped_algos, multiselect=True),
self._sc.drop_down(caption='Venue', id='venue-val', prefix_id='compliance',
drop_down_values=self.available_grouped_venues, multiselect=True),
self._sc.drop_down(caption='Reload', id='reload-val', prefix_id='compliance',
drop_down_values=self.available_reload),
self._sc.drop_down(caption='Market Data', id='market-data-val', prefix_id='compliance',
drop_down_values=self.available_market_data),
self._sc.drop_down(caption='Filter by Time', id='filter-time-of-day-val', prefix_id='compliance',
drop_down_values=self.available_reload),
self._sc.drop_down(caption='Start Time of Day', id='start-time-of-day-val', prefix_id='compliance',
drop_down_values=self.available_times),
self._sc.drop_down(caption='Finish Time of Day', id='finish-time-of-day-val', prefix_id='compliance',
drop_down_values=self.available_times),
self._sc.drop_down(caption='Slippage to Mid (bp)', id='slippage-bounds-val', prefix_id='compliance',
drop_down_values=self.available_slippage_bounds),
self._sc.drop_down(caption='Visualization', id='visualization-val', prefix_id='compliance',
drop_down_values=self.available_visualization)
]),
self._sc.horizontal_bar(),
html.Div([
self._sc.button(caption='Calculate', id='calculation-button', prefix_id='compliance'),
# self.date_picker(caption='Start Date', id='start-date-dtpicker', prefix_id='compliance'),
# self.date_picker(caption='Finish Date', id='finish-date-dtpicker', prefix_id='compliance'),
]),
self._sc.horizontal_bar(),
self._sc.table(caption='Compliance: Trade Outliers', id='execution-by-anomalous-table', prefix_id='compliance',
columns=trade_outliers_cols,
downloadplot_caption='Trade outliers CSV',
downloadplot_tag='execution-by-anomalous-download-link',
download_file='download_execution_by_anomalous.csv'),
self._sc.table(caption='Compliance: Totals by Broker', id='summary-by-broker-table', prefix_id='compliance',
columns=broker_cols,
downloadplot_caption='Download broker CSV',
downloadplot_tag='summary-by-broker-download-link',
download_file='download_broker.csv'
),
self._sc.horizontal_bar()
],
style={'width': '1000px', 'marginRight': 'auto', 'marginLeft': 'auto'})
# ID flags
self.id_flags = {
# Detailed trader page
# 'timeline_trade_orders' : {'client-orders': 'order', 'executions': 'trade'},
# 'markout_trade_orders' : {'client-orders': 'order_df', 'executions': 'trade_df'},
'detailed_candle_timeline_trade_order': {'execution': 'sparse_market_trade_df',
'order': 'sparse_market_order_df'},
'detailed_markout_trade_order': {'execution': 'trade_df', 'order': 'order_df'},
'detailed_table_trade_order': {'execution': 'table_trade_df_markout_by_all'},
'detailed_dist_trade_order': {'execution': 'dist_trade_df_by/pdf/side', 'order': 'dist_order_df_by/pdf/side'},
'detailed_download_link_trade_order': {'execution-candle-timeline': 'sparse_market_trade_df',
'order-candle-timeline': 'sparse_market_order_df'},
# Aggregated trader page
'aggregated_bar_trade_order': {'execution-by-ticker': 'bar_trade_df_by/mean/ticker',
'execution-by-venue': 'bar_trade_df_by/mean/venue'},
'aggregated_timeline_trade_order': {'execution-by-ticker': 'timeline_trade_df_by/mean_date/ticker',
'execution-by-venue': 'timeline_trade_df_by/mean_date/venue'},
'aggregated_dist_trade_order': {'execution-by-ticker': 'dist_trade_df_by/pdf/ticker',
'execution-by-venue': 'dist_trade_df_by/pdf/venue'},
# Compliance page
'compliance_metric_table_trade_order':
{'execution-by-anomalous': 'table_trade_df_slippage_by_worst_all',
'summary-by-broker': 'bar_trade_df_executed_notional_in_reporting_currency_by_broker_id'},
'compliance_download_link_trade_order':
{'execution-by-anomalous': 'table_trade_df_slippage_by_worst_all',
'summary-by-broker': 'bar_trade_df_executed_notional_in_reporting_currency_by_broker_id'},
}
| en | 0.419409 | # <NAME> / <EMAIL> # # Copyright 2017 Cuemacro Ltd. - http//www.cuemacro.com / @cuemacro # # See the License for the specific language governing permissions and limitations under the License. # ## Web server components ## Date/time components ######################################################################################################################## This implements the LayoutDash abstract class, to create the web based GUI for the tcapy application. It creates two web pages - detailed_page - for doing detailed tcapy analysis for a specific currency pair - aggregated_page - for more aggregated style analysis across multiple currency pairs and over multiple time periods ### create the possible values for drop down boxes on both pages # Reverse date list (for both detailed and aggregated pages) # For detailed page only # For aggregated page only # Main page for detailed analysing of (eg. over the course of a few days) # Dropdown selection boxes # self.button(caption = 'Print PDF', id = 'detailed-print-pdf-button', className = 'no-print'), # Orders # Execution trades # Detailed tcapy markout table for executions ################################################################################################################ # Secondary page for analysing aggregated statistics over long periods of time, eg. who is the best broker? # dropdown selection boxes # , msg_id='aggregated-status'), # self.date_picker_range(caption='Start/Finish Dates', id='aggregated-date-val', offset=[-7,-1]), ################################################################################################################ # Dropdown selection boxes # self.date_picker(caption='Start Date', id='start-date-dtpicker', prefix_id='compliance'), # self.date_picker(caption='Finish Date', id='finish-date-dtpicker', prefix_id='compliance'), # ID flags # Detailed trader page # 'timeline_trade_orders' : {'client-orders': 'order', 'executions': 'trade'}, # 'markout_trade_orders' : {'client-orders': 'order_df', 'executions': 'trade_df'}, # Aggregated trader page # Compliance page | 2.260981 | 2 |
tests/molecular/molecules/molecule/fixtures/cof/periodic_kagome.py | andrewtarzia/stk | 21 | 2821 | import pytest
import stk
from ...case_data import CaseData
@pytest.fixture(
scope='session',
params=(
lambda name: CaseData(
molecule=stk.ConstructedMolecule(
topology_graph=stk.cof.PeriodicKagome(
building_blocks=(
stk.BuildingBlock(
smiles='BrC1=C(Br)[C+]=N1',
functional_groups=[stk.BromoFactory()],
),
stk.BuildingBlock(
smiles=(
'Br[C+]1C2(Br)[C+]=N[C+]2[C+](Br)[C+]('
'Br)[C+2]1'
),
functional_groups=[stk.BromoFactory()],
),
),
lattice_size=(2, 2, 1),
),
),
smiles=(
'[C+]1=NC2=C1[C+]1[C+]3[C+2][C+]4C5=C(N=[C+]5)C56[C+]='
'N[C+]5[C+]5C7=C([C+]=N7)[C+]7[C+]8[C+2][C+]9C%10=C(N='
'[C+]%10)[C+]%10[C+2][C+]%11C%12=C([C+]=N%12)[C+]%12[C'
'+]%13[C+2][C+]%14C%15=C(N=[C+]%15)C%15%16[C+]=N[C+]%1'
'5[C+]%15C%17=C([C+]=N%17)[C+]%17[C+]%18[C+2][C+]%19C%'
'20=C(N=[C+]%20)[C+]%20[C+2][C+]2[C+]2C%21=C([C+]=N%21'
')[C+]%21[C+]([C+2][C+](C%22=C(N=[C+]%22)[C+]%16[C+2]['
'C+]%15C%15=C([C+]=N%15)[C+]%15[C+]([C+2][C+](C%16=C(N'
'=[C+]%16)C%10%16[C+]=N[C+]%16[C+]%11C%10=C([C+]=N%10)'
'[C+]%10[C+]([C+2][C+](C%11=C(N=[C+]%11)[C+]6[C+2][C+]'
'5C5=C([C+]=N5)[C+]5[C+]([C+2][C+](C6=C(N=[C+]6)C%206['
'C+]=N[C+]26)C2([C+]=N[C+]52)C2=C%18N=[C+]2)C2=C(N=[C+'
']2)C92[C+]=N[C+]72)C2([C+]=N[C+]%102)C2=C%13[C+]=N2)C'
'2=C([C+]=N2)C42[C+]=N[C+]12)C1([C+]=N[C+]%151)C1=C8N='
'[C+]1)C1=C(N=[C+]1)C%191[C+]=N[C+]%171)C1([C+]=N[C+]%'
'211)C1=C3[C+]=N1)C1=C([C+]=N1)C%141[C+]=N[C+]%121'
),
name=name,
),
lambda name: CaseData(
molecule=stk.ConstructedMolecule(
topology_graph=stk.cof.PeriodicKagome(
building_blocks=(
stk.BuildingBlock(
smiles='BrC1=C(Br)[C+]=N1',
functional_groups=[stk.BromoFactory()],
),
stk.BuildingBlock(
smiles=(
'Br[C+]1C2(Br)[C+]=N[C+]2[C+](Br)[C+]('
'Br)[C+2]1'
),
functional_groups=[stk.BromoFactory()],
),
),
lattice_size=(2, 2, 1),
optimizer=stk.PeriodicCollapser(),
),
),
smiles=(
'[C+]1=NC2=C1[C+]1[C+]3[C+2][C+]4C5=C(N=[C+]5)C56[C+]='
'N[C+]5[C+]5C7=C([C+]=N7)[C+]7[C+]8[C+2][C+]9C%10=C(N='
'[C+]%10)[C+]%10[C+2][C+]%11C%12=C([C+]=N%12)[C+]%12[C'
'+]%13[C+2][C+]%14C%15=C(N=[C+]%15)C%15%16[C+]=N[C+]%1'
'5[C+]%15C%17=C([C+]=N%17)[C+]%17[C+]%18[C+2][C+]%19C%'
'20=C(N=[C+]%20)[C+]%20[C+2][C+]2[C+]2C%21=C([C+]=N%21'
')[C+]%21[C+]([C+2][C+](C%22=C(N=[C+]%22)[C+]%16[C+2]['
'C+]%15C%15=C([C+]=N%15)[C+]%15[C+]([C+2][C+](C%16=C(N'
'=[C+]%16)C%10%16[C+]=N[C+]%16[C+]%11C%10=C([C+]=N%10)'
'[C+]%10[C+]([C+2][C+](C%11=C(N=[C+]%11)[C+]6[C+2][C+]'
'5C5=C([C+]=N5)[C+]5[C+]([C+2][C+](C6=C(N=[C+]6)C%206['
'C+]=N[C+]26)C2([C+]=N[C+]52)C2=C%18N=[C+]2)C2=C(N=[C+'
']2)C92[C+]=N[C+]72)C2([C+]=N[C+]%102)C2=C%13[C+]=N2)C'
'2=C([C+]=N2)C42[C+]=N[C+]12)C1([C+]=N[C+]%151)C1=C8N='
'[C+]1)C1=C(N=[C+]1)C%191[C+]=N[C+]%171)C1([C+]=N[C+]%'
'211)C1=C3[C+]=N1)C1=C([C+]=N1)C%141[C+]=N[C+]%121'
),
name=name,
),
),
)
def cof_periodic_kagome(request) -> CaseData:
return request.param(
f'{request.fixturename}{request.param_index}',
)
| import pytest
import stk
from ...case_data import CaseData
@pytest.fixture(
scope='session',
params=(
lambda name: CaseData(
molecule=stk.ConstructedMolecule(
topology_graph=stk.cof.PeriodicKagome(
building_blocks=(
stk.BuildingBlock(
smiles='BrC1=C(Br)[C+]=N1',
functional_groups=[stk.BromoFactory()],
),
stk.BuildingBlock(
smiles=(
'Br[C+]1C2(Br)[C+]=N[C+]2[C+](Br)[C+]('
'Br)[C+2]1'
),
functional_groups=[stk.BromoFactory()],
),
),
lattice_size=(2, 2, 1),
),
),
smiles=(
'[C+]1=NC2=C1[C+]1[C+]3[C+2][C+]4C5=C(N=[C+]5)C56[C+]='
'N[C+]5[C+]5C7=C([C+]=N7)[C+]7[C+]8[C+2][C+]9C%10=C(N='
'[C+]%10)[C+]%10[C+2][C+]%11C%12=C([C+]=N%12)[C+]%12[C'
'+]%13[C+2][C+]%14C%15=C(N=[C+]%15)C%15%16[C+]=N[C+]%1'
'5[C+]%15C%17=C([C+]=N%17)[C+]%17[C+]%18[C+2][C+]%19C%'
'20=C(N=[C+]%20)[C+]%20[C+2][C+]2[C+]2C%21=C([C+]=N%21'
')[C+]%21[C+]([C+2][C+](C%22=C(N=[C+]%22)[C+]%16[C+2]['
'C+]%15C%15=C([C+]=N%15)[C+]%15[C+]([C+2][C+](C%16=C(N'
'=[C+]%16)C%10%16[C+]=N[C+]%16[C+]%11C%10=C([C+]=N%10)'
'[C+]%10[C+]([C+2][C+](C%11=C(N=[C+]%11)[C+]6[C+2][C+]'
'5C5=C([C+]=N5)[C+]5[C+]([C+2][C+](C6=C(N=[C+]6)C%206['
'C+]=N[C+]26)C2([C+]=N[C+]52)C2=C%18N=[C+]2)C2=C(N=[C+'
']2)C92[C+]=N[C+]72)C2([C+]=N[C+]%102)C2=C%13[C+]=N2)C'
'2=C([C+]=N2)C42[C+]=N[C+]12)C1([C+]=N[C+]%151)C1=C8N='
'[C+]1)C1=C(N=[C+]1)C%191[C+]=N[C+]%171)C1([C+]=N[C+]%'
'211)C1=C3[C+]=N1)C1=C([C+]=N1)C%141[C+]=N[C+]%121'
),
name=name,
),
lambda name: CaseData(
molecule=stk.ConstructedMolecule(
topology_graph=stk.cof.PeriodicKagome(
building_blocks=(
stk.BuildingBlock(
smiles='BrC1=C(Br)[C+]=N1',
functional_groups=[stk.BromoFactory()],
),
stk.BuildingBlock(
smiles=(
'Br[C+]1C2(Br)[C+]=N[C+]2[C+](Br)[C+]('
'Br)[C+2]1'
),
functional_groups=[stk.BromoFactory()],
),
),
lattice_size=(2, 2, 1),
optimizer=stk.PeriodicCollapser(),
),
),
smiles=(
'[C+]1=NC2=C1[C+]1[C+]3[C+2][C+]4C5=C(N=[C+]5)C56[C+]='
'N[C+]5[C+]5C7=C([C+]=N7)[C+]7[C+]8[C+2][C+]9C%10=C(N='
'[C+]%10)[C+]%10[C+2][C+]%11C%12=C([C+]=N%12)[C+]%12[C'
'+]%13[C+2][C+]%14C%15=C(N=[C+]%15)C%15%16[C+]=N[C+]%1'
'5[C+]%15C%17=C([C+]=N%17)[C+]%17[C+]%18[C+2][C+]%19C%'
'20=C(N=[C+]%20)[C+]%20[C+2][C+]2[C+]2C%21=C([C+]=N%21'
')[C+]%21[C+]([C+2][C+](C%22=C(N=[C+]%22)[C+]%16[C+2]['
'C+]%15C%15=C([C+]=N%15)[C+]%15[C+]([C+2][C+](C%16=C(N'
'=[C+]%16)C%10%16[C+]=N[C+]%16[C+]%11C%10=C([C+]=N%10)'
'[C+]%10[C+]([C+2][C+](C%11=C(N=[C+]%11)[C+]6[C+2][C+]'
'5C5=C([C+]=N5)[C+]5[C+]([C+2][C+](C6=C(N=[C+]6)C%206['
'C+]=N[C+]26)C2([C+]=N[C+]52)C2=C%18N=[C+]2)C2=C(N=[C+'
']2)C92[C+]=N[C+]72)C2([C+]=N[C+]%102)C2=C%13[C+]=N2)C'
'2=C([C+]=N2)C42[C+]=N[C+]12)C1([C+]=N[C+]%151)C1=C8N='
'[C+]1)C1=C(N=[C+]1)C%191[C+]=N[C+]%171)C1([C+]=N[C+]%'
'211)C1=C3[C+]=N1)C1=C([C+]=N1)C%141[C+]=N[C+]%121'
),
name=name,
),
),
)
def cof_periodic_kagome(request) -> CaseData:
return request.param(
f'{request.fixturename}{request.param_index}',
)
| none | 1 | 1.879869 | 2 |
|
projects/MAE/utils/weight_convert.py | Oneflow-Inc/libai | 55 | 2822 | <reponame>Oneflow-Inc/libai
# coding=utf-8
# Copyright 2021 The OneFlow Authors. All rights reserved.
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS,
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
# See the License for the specific language governing permissions and
# limitations under the License.
import logging
import oneflow as flow
import torch
logger = logging.getLogger(__name__)
def convert_qkv_weight(cfg, value):
"""
Convert qkv.weight to be compatible with LiBai transformer layer
Args:
cfg: config file
value: qkv.weight in the loaded checkpoint
"""
num_heads = cfg.model.num_heads
hidden_size = cfg.model.embed_dim
head_size = int(hidden_size / num_heads)
qkv_weight = (
value.view([3, num_heads, head_size, hidden_size])
.permute(1, 0, 2, 3)
.contiguous()
.view(hidden_size * 3, hidden_size)
)
return qkv_weight
def convert_qkv_bias(cfg, value):
"""
Convert qkv.bias to be compatible with LiBai transformer layer
Args:
cfg: config file
value: qkv.bias in the loaded checkpoint
"""
num_heads = cfg.model.num_heads
hidden_size = cfg.model.embed_dim
head_size = int(hidden_size / num_heads)
qkv_bias = (
value.view(3, num_heads, head_size).permute(1, 0, 2).contiguous().view(hidden_size * 3)
)
return qkv_bias
def filter_keys(key, value, cfg):
"""
Filtering the state_dict keys and values to match LiBai's MAE model
"""
if "norm1" in key:
key = key.replace("norm1", "input_layernorm")
elif "attn.qkv" in key:
key = key.replace("attn.qkv", "self_attention.query_key_value")
if "weight" in key:
value = convert_qkv_weight(cfg, value)
if "bias" in key:
value = convert_qkv_bias(cfg, value)
elif "attn.proj" in key:
key = key.replace("attn.proj", "self_attention.dense")
elif "norm2" in key:
key = key.replace("norm2", "post_attention_layernorm")
elif "mlp.fc1" in key:
key = key.replace("mlp.fc1", "mlp.dense_h_to_4h")
elif "mlp.fc2" in key:
key = key.replace("mlp.fc2", "mlp.dense_4h_to_h")
elif "fc_norm" in key:
key = key.replace("fc_norm", "norm")
return key, value
def load_torch_checkpoint(model, cfg, path="./mae_finetuned_vit_base.pth", strict=False):
"""
Load checkpoint from the given torch weights.
Torch weight can be downloaded from the original repo:
https://github.com/facebookresearch/mae
"""
torch_dict = torch.load(path, map_location="cpu")["model"]
parameters = torch_dict
new_parameters = dict()
for key, value in parameters.items():
if "num_batches_tracked" not in key:
# to global tensor
key, val = filter_keys(key, value, cfg)
val = val.detach().cpu().numpy()
val = flow.tensor(val).to_global(
sbp=flow.sbp.broadcast, placement=flow.placement("cuda", ranks=[0])
)
new_parameters[key] = val
model.load_state_dict(new_parameters, strict=strict)
print("Successfully load torch mae checkpoint.")
return model
| # coding=utf-8
# Copyright 2021 The OneFlow Authors. All rights reserved.
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS,
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
# See the License for the specific language governing permissions and
# limitations under the License.
import logging
import oneflow as flow
import torch
logger = logging.getLogger(__name__)
def convert_qkv_weight(cfg, value):
"""
Convert qkv.weight to be compatible with LiBai transformer layer
Args:
cfg: config file
value: qkv.weight in the loaded checkpoint
"""
num_heads = cfg.model.num_heads
hidden_size = cfg.model.embed_dim
head_size = int(hidden_size / num_heads)
qkv_weight = (
value.view([3, num_heads, head_size, hidden_size])
.permute(1, 0, 2, 3)
.contiguous()
.view(hidden_size * 3, hidden_size)
)
return qkv_weight
def convert_qkv_bias(cfg, value):
"""
Convert qkv.bias to be compatible with LiBai transformer layer
Args:
cfg: config file
value: qkv.bias in the loaded checkpoint
"""
num_heads = cfg.model.num_heads
hidden_size = cfg.model.embed_dim
head_size = int(hidden_size / num_heads)
qkv_bias = (
value.view(3, num_heads, head_size).permute(1, 0, 2).contiguous().view(hidden_size * 3)
)
return qkv_bias
def filter_keys(key, value, cfg):
"""
Filtering the state_dict keys and values to match LiBai's MAE model
"""
if "norm1" in key:
key = key.replace("norm1", "input_layernorm")
elif "attn.qkv" in key:
key = key.replace("attn.qkv", "self_attention.query_key_value")
if "weight" in key:
value = convert_qkv_weight(cfg, value)
if "bias" in key:
value = convert_qkv_bias(cfg, value)
elif "attn.proj" in key:
key = key.replace("attn.proj", "self_attention.dense")
elif "norm2" in key:
key = key.replace("norm2", "post_attention_layernorm")
elif "mlp.fc1" in key:
key = key.replace("mlp.fc1", "mlp.dense_h_to_4h")
elif "mlp.fc2" in key:
key = key.replace("mlp.fc2", "mlp.dense_4h_to_h")
elif "fc_norm" in key:
key = key.replace("fc_norm", "norm")
return key, value
def load_torch_checkpoint(model, cfg, path="./mae_finetuned_vit_base.pth", strict=False):
"""
Load checkpoint from the given torch weights.
Torch weight can be downloaded from the original repo:
https://github.com/facebookresearch/mae
"""
torch_dict = torch.load(path, map_location="cpu")["model"]
parameters = torch_dict
new_parameters = dict()
for key, value in parameters.items():
if "num_batches_tracked" not in key:
# to global tensor
key, val = filter_keys(key, value, cfg)
val = val.detach().cpu().numpy()
val = flow.tensor(val).to_global(
sbp=flow.sbp.broadcast, placement=flow.placement("cuda", ranks=[0])
)
new_parameters[key] = val
model.load_state_dict(new_parameters, strict=strict)
print("Successfully load torch mae checkpoint.")
return model | en | 0.79656 | # coding=utf-8 # Copyright 2021 The OneFlow Authors. All rights reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. Convert qkv.weight to be compatible with LiBai transformer layer Args: cfg: config file value: qkv.weight in the loaded checkpoint Convert qkv.bias to be compatible with LiBai transformer layer Args: cfg: config file value: qkv.bias in the loaded checkpoint Filtering the state_dict keys and values to match LiBai's MAE model Load checkpoint from the given torch weights. Torch weight can be downloaded from the original repo: https://github.com/facebookresearch/mae # to global tensor | 1.724788 | 2 |
dthm4kaiako/events/__init__.py | taskmaker1/dthm4kaiako | 3 | 2823 | """Module for events application."""
| """Module for events application."""
| en | 0.848727 | Module for events application. | 1.087641 | 1 |
spot/level1.py | K0gata/SGLI_Python_output_tool | 1 | 2824 | <filename>spot/level1.py
import numpy as np
import logging
from decimal import Decimal, ROUND_HALF_UP
from abc import ABC, abstractmethod, abstractproperty
from spot.utility import bilin_2d
from spot.config import PROJ_TYPE
# =============================
# Level-1 template class
# =============================
class L1Interface(ABC):
@property
@abstractmethod
def PROJECTION_TYPE(self):
raise NotImplementedError()
@property
@abstractmethod
def ALLOW_PROJECTION_TYPE(self):
return NotImplementedError()
def __init__(self, h5_file, product_id):
self.h5_file = h5_file
self.product_id = product_id
geo_data_grp_attrs = self.h5_file['Geometry_data'].attrs
self.geo_n_pix = geo_data_grp_attrs['Number_of_pixels'][0]
self.geo_n_lin = geo_data_grp_attrs['Number_of_lines'][0]
img_data_grp_attrs = self.h5_file['Image_data'].attrs
self.img_n_pix = img_data_grp_attrs['Number_of_pixels'][0]
self.img_n_lin = img_data_grp_attrs['Number_of_lines'][0]
def get_product_data(self, prod_name:str):
dset = self.h5_file['Image_data/' + prod_name]
# Return uint16 type data if the product is QA_flag or Line_tai93
if 'QA_flag' == prod_name or 'Line_tai93' == prod_name:
return dset[:]
# Validate
data = dset[:].astype(np.float32)
if 'Error_DN' in dset.attrs:
data[data == dset.attrs['Error_DN'][0]] = np.NaN
with np.warnings.catch_warnings():
np.warnings.filterwarnings('ignore', r'invalid value encountered in (greater|less)')
if 'Maximum_valid_DN' in dset.attrs:
data[data > dset.attrs['Maximum_valid_DN'][0]] = np.NaN
if 'Minimum_valid_DN' in dset.attrs:
data[data < dset.attrs['Minimum_valid_DN'][0]] = np.NaN
# Convert DN to physical value
data = data * dset.attrs['Slope'][0] + dset.attrs['Offset'][0]
return data
@abstractmethod
def get_geometry_data(self, data_name:str, **kwargs):
raise NotImplementedError()
@abstractmethod
def get_geometry_data_list(self):
raise NotImplementedError()
def get_product_data_list(self):
return list(self.h5_file['/Image_data'].keys())
def get_unit(self, prod_name: str):
if 'Rt_' in prod_name:
return 'NA'
# Get attrs set
unit_name = 'Unit'
attrs = self.h5_file['/Image_data/' + prod_name].attrs
# Get unit
if unit_name not in attrs:
return 'NA'
return attrs[unit_name][0].decode('UTF-8')
# =============================
# Level-1 map-projection class
# =============================
class Scene(L1Interface):
PROJECTION_TYPE = PROJ_TYPE.SCENE.name
ALLOW_PROJECTION_TYPE = [PROJECTION_TYPE, PROJ_TYPE.EQR.name]
def __init__(self, h5_file, product_id):
super().__init__(h5_file, product_id)
self.scene_number = h5_file['/Global_attributes'].attrs['Scene_number'][0]
self.path_number = h5_file['/Global_attributes'].attrs['RSP_path_number'][0]
img_data_grp_attrs = self.h5_file['Image_data'].attrs
self.img_spatial_reso = img_data_grp_attrs['Grid_interval'][0]
def get_geometry_data(self, data_name: str, **kwargs):
interval = kwargs['interval']
dset = self.h5_file['Geometry_data/' + data_name]
data = dset[:]
if 'Latitude' is not data_name and 'Longitude' is not data_name:
data = data.astype(np.float32) * dset.attrs['Slope'][0] + dset.attrs['Offset'][0]
# Finish if interval is none
if interval is None or interval == 'none':
return data
# Interpolate raw data
if interval == 'auto':
interp_interval = dset.attrs['Resampling_interval'][0]
else:
interp_interval = interval
lon_mode = False
if 'Longitude' == data_name:
lon_mode = True
if interp_interval > 1:
data = bilin_2d(data, interp_interval, lon_mode)
# Trim away the excess pixel/line
(data_size_lin, data_size_pxl) = data.shape
if (kwargs['fit_img_size'] is True) and (self.img_n_lin <= data_size_lin) and (self.img_n_pix <= data_size_pxl):
data = data[:self.img_n_lin, :self.img_n_pix]
return data
def get_geometry_data_list(self):
return list(self.h5_file['/Geometry_data'].keys())
def get_allow_projection_type(self):
return self.ALLOW_PROJECTION_TYPE
# =============================
# Level-1 sub-processing level class
# =============================
class L1B(Scene):
# -----------------------------
# Public
# -----------------------------
def get_product_data(self, prod_name:str):
if 'Land_water_flag' in prod_name:
return self._get_land_water_flag()
if 'Lt_' in prod_name:
return self._get_Lt(prod_name)
if 'Rt_' in prod_name:
return self._get_Rt(prod_name)
if 'Stray_light_correction_flag_' in prod_name:
return self._get_stray_light_correction_flag(prod_name)
return super().get_product_data(prod_name)
# -----------------------------
# Private
# -----------------------------
def _get_land_water_flag(self):
dset = self.h5_file['Image_data/Land_water_flag']
data = dset[:].astype(np.float32)
if 'Error_DN' in dset.attrs:
data[data == dset.attrs['Error_value'][0]] = np.NaN
with np.warnings.catch_warnings():
np.warnings.filterwarnings('ignore', r'invalid value encountered in (greater|less)')
data[data > dset.attrs['Maximum_valid_value'][0]] = np.NaN
data[data < dset.attrs['Minimum_valid_value'][0]] = np.NaN
return data
def _get_Lt(self, prod_name):
dset = self.h5_file['Image_data/' + prod_name]
dn_data = dset[:]
mask = dset.attrs['Mask'][0]
data = np.bitwise_and(dn_data, mask).astype(np.float32)
data = data * dset.attrs['Slope'] + dset.attrs['Offset']
data[dn_data == dset.attrs['Error_DN']] = np.NaN
with np.warnings.catch_warnings():
np.warnings.filterwarnings('ignore', r'invalid value encountered in (greater|less)')
data[data > dset.attrs['Maximum_valid_DN'][0]] = np.NaN
data[data < dset.attrs['Minimum_valid_DN'][0]] = np.NaN
return data
def _get_Rt(self, prod_name):
prod_name = prod_name.replace('Rt_', 'Lt_')
dset = self.h5_file['Image_data/' + prod_name]
dn_data = dset[:]
mask = dset.attrs['Mask'][0]
data = np.bitwise_and(dn_data, mask).astype(np.float32)
data = data * dset.attrs['Slope_reflectance'] + dset.attrs['Offset_reflectance']
data[dn_data == dset.attrs['Error_DN']] = np.NaN
with np.warnings.catch_warnings():
np.warnings.filterwarnings('ignore', r'invalid value encountered in (greater|less)')
data[data > dset.attrs['Maximum_valid_DN'][0]] = np.NaN
data[data < dset.attrs['Minimum_valid_DN'][0]] = np.NaN
cos_theta_0 = np.cos(np.deg2rad(self.get_geometry_data('Solar_zenith', interval='auto', fit_img_size=True)))
data = data / cos_theta_0
return data
def _get_stray_light_correction_flag(self, prod_name):
prod_name = prod_name.replace('Stray_light_correction_flag_', 'Lt_')
dset = self.h5_file['Image_data/' + prod_name]
dn_data = dset[:]
data = np.bitwise_and(dn_data, 0x8000)
data[dn_data == dset.attrs['Error_DN']] = 0
return data > 0
class VNRL1B(L1B):
def get_product_data_list(self):
prod_list = super().get_product_data_list()
for prod in prod_list:
if 'Lt_' in prod:
prod_list.append(prod.replace('Lt', 'Rt'))
prod_list.append(prod.replace('Lt', 'Stray_light_correction_flag'))
prod_list = sorted(prod_list)
return prod_list
class IRSL1B(L1B):
def get_product_data_list(self):
prod_list = super().get_product_data_list()
for prod in prod_list:
if 'Lt_SW' in prod:
prod_list.append(prod.replace('Lt', 'Rt'))
prod_list.append(prod.replace('Lt', 'Stray_light_correction_flag'))
prod_list = sorted(prod_list)
return prod_list
# EOF
| <filename>spot/level1.py
import numpy as np
import logging
from decimal import Decimal, ROUND_HALF_UP
from abc import ABC, abstractmethod, abstractproperty
from spot.utility import bilin_2d
from spot.config import PROJ_TYPE
# =============================
# Level-1 template class
# =============================
class L1Interface(ABC):
@property
@abstractmethod
def PROJECTION_TYPE(self):
raise NotImplementedError()
@property
@abstractmethod
def ALLOW_PROJECTION_TYPE(self):
return NotImplementedError()
def __init__(self, h5_file, product_id):
self.h5_file = h5_file
self.product_id = product_id
geo_data_grp_attrs = self.h5_file['Geometry_data'].attrs
self.geo_n_pix = geo_data_grp_attrs['Number_of_pixels'][0]
self.geo_n_lin = geo_data_grp_attrs['Number_of_lines'][0]
img_data_grp_attrs = self.h5_file['Image_data'].attrs
self.img_n_pix = img_data_grp_attrs['Number_of_pixels'][0]
self.img_n_lin = img_data_grp_attrs['Number_of_lines'][0]
def get_product_data(self, prod_name:str):
dset = self.h5_file['Image_data/' + prod_name]
# Return uint16 type data if the product is QA_flag or Line_tai93
if 'QA_flag' == prod_name or 'Line_tai93' == prod_name:
return dset[:]
# Validate
data = dset[:].astype(np.float32)
if 'Error_DN' in dset.attrs:
data[data == dset.attrs['Error_DN'][0]] = np.NaN
with np.warnings.catch_warnings():
np.warnings.filterwarnings('ignore', r'invalid value encountered in (greater|less)')
if 'Maximum_valid_DN' in dset.attrs:
data[data > dset.attrs['Maximum_valid_DN'][0]] = np.NaN
if 'Minimum_valid_DN' in dset.attrs:
data[data < dset.attrs['Minimum_valid_DN'][0]] = np.NaN
# Convert DN to physical value
data = data * dset.attrs['Slope'][0] + dset.attrs['Offset'][0]
return data
@abstractmethod
def get_geometry_data(self, data_name:str, **kwargs):
raise NotImplementedError()
@abstractmethod
def get_geometry_data_list(self):
raise NotImplementedError()
def get_product_data_list(self):
return list(self.h5_file['/Image_data'].keys())
def get_unit(self, prod_name: str):
if 'Rt_' in prod_name:
return 'NA'
# Get attrs set
unit_name = 'Unit'
attrs = self.h5_file['/Image_data/' + prod_name].attrs
# Get unit
if unit_name not in attrs:
return 'NA'
return attrs[unit_name][0].decode('UTF-8')
# =============================
# Level-1 map-projection class
# =============================
class Scene(L1Interface):
PROJECTION_TYPE = PROJ_TYPE.SCENE.name
ALLOW_PROJECTION_TYPE = [PROJECTION_TYPE, PROJ_TYPE.EQR.name]
def __init__(self, h5_file, product_id):
super().__init__(h5_file, product_id)
self.scene_number = h5_file['/Global_attributes'].attrs['Scene_number'][0]
self.path_number = h5_file['/Global_attributes'].attrs['RSP_path_number'][0]
img_data_grp_attrs = self.h5_file['Image_data'].attrs
self.img_spatial_reso = img_data_grp_attrs['Grid_interval'][0]
def get_geometry_data(self, data_name: str, **kwargs):
interval = kwargs['interval']
dset = self.h5_file['Geometry_data/' + data_name]
data = dset[:]
if 'Latitude' is not data_name and 'Longitude' is not data_name:
data = data.astype(np.float32) * dset.attrs['Slope'][0] + dset.attrs['Offset'][0]
# Finish if interval is none
if interval is None or interval == 'none':
return data
# Interpolate raw data
if interval == 'auto':
interp_interval = dset.attrs['Resampling_interval'][0]
else:
interp_interval = interval
lon_mode = False
if 'Longitude' == data_name:
lon_mode = True
if interp_interval > 1:
data = bilin_2d(data, interp_interval, lon_mode)
# Trim away the excess pixel/line
(data_size_lin, data_size_pxl) = data.shape
if (kwargs['fit_img_size'] is True) and (self.img_n_lin <= data_size_lin) and (self.img_n_pix <= data_size_pxl):
data = data[:self.img_n_lin, :self.img_n_pix]
return data
def get_geometry_data_list(self):
return list(self.h5_file['/Geometry_data'].keys())
def get_allow_projection_type(self):
return self.ALLOW_PROJECTION_TYPE
# =============================
# Level-1 sub-processing level class
# =============================
class L1B(Scene):
# -----------------------------
# Public
# -----------------------------
def get_product_data(self, prod_name:str):
if 'Land_water_flag' in prod_name:
return self._get_land_water_flag()
if 'Lt_' in prod_name:
return self._get_Lt(prod_name)
if 'Rt_' in prod_name:
return self._get_Rt(prod_name)
if 'Stray_light_correction_flag_' in prod_name:
return self._get_stray_light_correction_flag(prod_name)
return super().get_product_data(prod_name)
# -----------------------------
# Private
# -----------------------------
def _get_land_water_flag(self):
dset = self.h5_file['Image_data/Land_water_flag']
data = dset[:].astype(np.float32)
if 'Error_DN' in dset.attrs:
data[data == dset.attrs['Error_value'][0]] = np.NaN
with np.warnings.catch_warnings():
np.warnings.filterwarnings('ignore', r'invalid value encountered in (greater|less)')
data[data > dset.attrs['Maximum_valid_value'][0]] = np.NaN
data[data < dset.attrs['Minimum_valid_value'][0]] = np.NaN
return data
def _get_Lt(self, prod_name):
dset = self.h5_file['Image_data/' + prod_name]
dn_data = dset[:]
mask = dset.attrs['Mask'][0]
data = np.bitwise_and(dn_data, mask).astype(np.float32)
data = data * dset.attrs['Slope'] + dset.attrs['Offset']
data[dn_data == dset.attrs['Error_DN']] = np.NaN
with np.warnings.catch_warnings():
np.warnings.filterwarnings('ignore', r'invalid value encountered in (greater|less)')
data[data > dset.attrs['Maximum_valid_DN'][0]] = np.NaN
data[data < dset.attrs['Minimum_valid_DN'][0]] = np.NaN
return data
def _get_Rt(self, prod_name):
prod_name = prod_name.replace('Rt_', 'Lt_')
dset = self.h5_file['Image_data/' + prod_name]
dn_data = dset[:]
mask = dset.attrs['Mask'][0]
data = np.bitwise_and(dn_data, mask).astype(np.float32)
data = data * dset.attrs['Slope_reflectance'] + dset.attrs['Offset_reflectance']
data[dn_data == dset.attrs['Error_DN']] = np.NaN
with np.warnings.catch_warnings():
np.warnings.filterwarnings('ignore', r'invalid value encountered in (greater|less)')
data[data > dset.attrs['Maximum_valid_DN'][0]] = np.NaN
data[data < dset.attrs['Minimum_valid_DN'][0]] = np.NaN
cos_theta_0 = np.cos(np.deg2rad(self.get_geometry_data('Solar_zenith', interval='auto', fit_img_size=True)))
data = data / cos_theta_0
return data
def _get_stray_light_correction_flag(self, prod_name):
prod_name = prod_name.replace('Stray_light_correction_flag_', 'Lt_')
dset = self.h5_file['Image_data/' + prod_name]
dn_data = dset[:]
data = np.bitwise_and(dn_data, 0x8000)
data[dn_data == dset.attrs['Error_DN']] = 0
return data > 0
class VNRL1B(L1B):
def get_product_data_list(self):
prod_list = super().get_product_data_list()
for prod in prod_list:
if 'Lt_' in prod:
prod_list.append(prod.replace('Lt', 'Rt'))
prod_list.append(prod.replace('Lt', 'Stray_light_correction_flag'))
prod_list = sorted(prod_list)
return prod_list
class IRSL1B(L1B):
def get_product_data_list(self):
prod_list = super().get_product_data_list()
for prod in prod_list:
if 'Lt_SW' in prod:
prod_list.append(prod.replace('Lt', 'Rt'))
prod_list.append(prod.replace('Lt', 'Stray_light_correction_flag'))
prod_list = sorted(prod_list)
return prod_list
# EOF
| en | 0.367162 | # ============================= # Level-1 template class # ============================= # Return uint16 type data if the product is QA_flag or Line_tai93 # Validate # Convert DN to physical value # Get attrs set # Get unit # ============================= # Level-1 map-projection class # ============================= # Finish if interval is none # Interpolate raw data # Trim away the excess pixel/line # ============================= # Level-1 sub-processing level class # ============================= # ----------------------------- # Public # ----------------------------- # ----------------------------- # Private # ----------------------------- # EOF | 2.174064 | 2 |
168. Excel Sheet Column Title.py | Alvin1994/leetcode-python3- | 0 | 2825 | class Solution:
# @return a string
def convertToTitle(self, n: int) -> str:
capitals = [chr(x) for x in range(ord('A'), ord('Z')+1)]
result = []
while n > 0:
result.insert(0, capitals[(n-1)%len(capitals)])
n = (n-1) % len(capitals)
# result.reverse()
return ''.join(result) | class Solution:
# @return a string
def convertToTitle(self, n: int) -> str:
capitals = [chr(x) for x in range(ord('A'), ord('Z')+1)]
result = []
while n > 0:
result.insert(0, capitals[(n-1)%len(capitals)])
n = (n-1) % len(capitals)
# result.reverse()
return ''.join(result) | el | 0.054074 | # @return a string # result.reverse() | 3.531184 | 4 |
devil/devil/utils/cmd_helper.py | Martijnve23/catapult | 1,894 | 2826 | <gh_stars>1000+
# Copyright (c) 2012 The Chromium Authors. All rights reserved.
# Use of this source code is governed by a BSD-style license that can be
# found in the LICENSE file.
"""A wrapper for subprocess to make calling shell commands easier."""
import codecs
import logging
import os
import pipes
import select
import signal
import string
import subprocess
import sys
import time
CATAPULT_ROOT_PATH = os.path.abspath(
os.path.join(os.path.dirname(__file__), '..', '..', '..'))
SIX_PATH = os.path.join(CATAPULT_ROOT_PATH, 'third_party', 'six')
if SIX_PATH not in sys.path:
sys.path.append(SIX_PATH)
import six
from devil import base_error
logger = logging.getLogger(__name__)
_SafeShellChars = frozenset(string.ascii_letters + string.digits + '@%_-+=:,./')
# Cache the string-escape codec to ensure subprocess can find it
# later. Return value doesn't matter.
if six.PY2:
codecs.lookup('string-escape')
def SingleQuote(s):
"""Return an shell-escaped version of the string using single quotes.
Reliably quote a string which may contain unsafe characters (e.g. space,
quote, or other special characters such as '$').
The returned value can be used in a shell command line as one token that gets
to be interpreted literally.
Args:
s: The string to quote.
Return:
The string quoted using single quotes.
"""
return pipes.quote(s)
def DoubleQuote(s):
"""Return an shell-escaped version of the string using double quotes.
Reliably quote a string which may contain unsafe characters (e.g. space
or quote characters), while retaining some shell features such as variable
interpolation.
The returned value can be used in a shell command line as one token that gets
to be further interpreted by the shell.
The set of characters that retain their special meaning may depend on the
shell implementation. This set usually includes: '$', '`', '\', '!', '*',
and '@'.
Args:
s: The string to quote.
Return:
The string quoted using double quotes.
"""
if not s:
return '""'
elif all(c in _SafeShellChars for c in s):
return s
else:
return '"' + s.replace('"', '\\"') + '"'
def ShrinkToSnippet(cmd_parts, var_name, var_value):
"""Constructs a shell snippet for a command using a variable to shrink it.
Takes into account all quoting that needs to happen.
Args:
cmd_parts: A list of command arguments.
var_name: The variable that holds var_value.
var_value: The string to replace in cmd_parts with $var_name
Returns:
A shell snippet that does not include setting the variable.
"""
def shrink(value):
parts = (x and SingleQuote(x) for x in value.split(var_value))
with_substitutions = ('"$%s"' % var_name).join(parts)
return with_substitutions or "''"
return ' '.join(shrink(part) for part in cmd_parts)
def Popen(args,
stdin=None,
stdout=None,
stderr=None,
shell=None,
cwd=None,
env=None):
# preexec_fn isn't supported on windows.
# pylint: disable=unexpected-keyword-arg
if sys.platform == 'win32':
close_fds = (stdin is None and stdout is None and stderr is None)
preexec_fn = None
else:
close_fds = True
preexec_fn = lambda: signal.signal(signal.SIGPIPE, signal.SIG_DFL)
if six.PY2:
return subprocess.Popen(
args=args,
cwd=cwd,
stdin=stdin,
stdout=stdout,
stderr=stderr,
shell=shell,
close_fds=close_fds,
env=env,
preexec_fn=preexec_fn
)
else:
# opens stdout in text mode, so that caller side always get 'str',
# and there will be no type mismatch error.
# Ignore any decoding error, so that caller will not crash due to
# uncaught exception. Decoding errors are unavoidable, as we
# do not know the encoding of the output, and in some output there
# will be multiple encodings (e.g. adb logcat)
return subprocess.Popen(
args=args,
cwd=cwd,
stdin=stdin,
stdout=stdout,
stderr=stderr,
shell=shell,
close_fds=close_fds,
env=env,
preexec_fn=preexec_fn,
universal_newlines=True,
encoding='utf-8',
errors='ignore'
)
def Call(args, stdout=None, stderr=None, shell=None, cwd=None, env=None):
pipe = Popen(
args, stdout=stdout, stderr=stderr, shell=shell, cwd=cwd, env=env)
pipe.communicate()
return pipe.wait()
def RunCmd(args, cwd=None):
"""Opens a subprocess to execute a program and returns its return value.
Args:
args: A string or a sequence of program arguments. The program to execute is
the string or the first item in the args sequence.
cwd: If not None, the subprocess's current directory will be changed to
|cwd| before it's executed.
Returns:
Return code from the command execution.
"""
logger.debug(str(args) + ' ' + (cwd or ''))
return Call(args, cwd=cwd)
def GetCmdOutput(args, cwd=None, shell=False, env=None):
"""Open a subprocess to execute a program and returns its output.
Args:
args: A string or a sequence of program arguments. The program to execute is
the string or the first item in the args sequence.
cwd: If not None, the subprocess's current directory will be changed to
|cwd| before it's executed.
shell: Whether to execute args as a shell command.
env: If not None, a mapping that defines environment variables for the
subprocess.
Returns:
Captures and returns the command's stdout.
Prints the command's stderr to logger (which defaults to stdout).
"""
(_, output) = GetCmdStatusAndOutput(args, cwd, shell, env)
return output
def _ValidateAndLogCommand(args, cwd, shell):
if isinstance(args, six.string_types):
if not shell:
raise Exception('string args must be run with shell=True')
else:
if shell:
raise Exception('array args must be run with shell=False')
args = ' '.join(SingleQuote(str(c)) for c in args)
if cwd is None:
cwd = ''
else:
cwd = ':' + cwd
logger.debug('[host]%s> %s', cwd, args)
return args
def GetCmdStatusAndOutput(args,
cwd=None,
shell=False,
env=None,
merge_stderr=False):
"""Executes a subprocess and returns its exit code and output.
Args:
args: A string or a sequence of program arguments. The program to execute is
the string or the first item in the args sequence.
cwd: If not None, the subprocess's current directory will be changed to
|cwd| before it's executed.
shell: Whether to execute args as a shell command. Must be True if args
is a string and False if args is a sequence.
env: If not None, a mapping that defines environment variables for the
subprocess.
merge_stderr: If True, captures stderr as part of stdout.
Returns:
The 2-tuple (exit code, stdout).
"""
status, stdout, stderr = GetCmdStatusOutputAndError(
args, cwd=cwd, shell=shell, env=env, merge_stderr=merge_stderr)
if stderr:
logger.critical('STDERR: %s', stderr)
logger.debug('STDOUT: %s%s', stdout[:4096].rstrip(),
'<truncated>' if len(stdout) > 4096 else '')
return (status, stdout)
def StartCmd(args, cwd=None, shell=False, env=None):
"""Starts a subprocess and returns a handle to the process.
Args:
args: A string or a sequence of program arguments. The program to execute is
the string or the first item in the args sequence.
cwd: If not None, the subprocess's current directory will be changed to
|cwd| before it's executed.
shell: Whether to execute args as a shell command. Must be True if args
is a string and False if args is a sequence.
env: If not None, a mapping that defines environment variables for the
subprocess.
Returns:
A process handle from subprocess.Popen.
"""
_ValidateAndLogCommand(args, cwd, shell)
return Popen(
args,
stdout=subprocess.PIPE,
stderr=subprocess.PIPE,
shell=shell,
cwd=cwd,
env=env)
def GetCmdStatusOutputAndError(args,
cwd=None,
shell=False,
env=None,
merge_stderr=False):
"""Executes a subprocess and returns its exit code, output, and errors.
Args:
args: A string or a sequence of program arguments. The program to execute is
the string or the first item in the args sequence.
cwd: If not None, the subprocess's current directory will be changed to
|cwd| before it's executed.
shell: Whether to execute args as a shell command. Must be True if args
is a string and False if args is a sequence.
env: If not None, a mapping that defines environment variables for the
subprocess.
merge_stderr: If True, captures stderr as part of stdout.
Returns:
The 3-tuple (exit code, stdout, stderr).
"""
_ValidateAndLogCommand(args, cwd, shell)
stderr = subprocess.STDOUT if merge_stderr else subprocess.PIPE
pipe = Popen(
args,
stdout=subprocess.PIPE,
stderr=stderr,
shell=shell,
cwd=cwd,
env=env)
stdout, stderr = pipe.communicate()
return (pipe.returncode, stdout, stderr)
class TimeoutError(base_error.BaseError):
"""Module-specific timeout exception."""
def __init__(self, output=None):
super(TimeoutError, self).__init__('Timeout')
self._output = output
@property
def output(self):
return self._output
def _read_and_decode(fd, buffer_size):
data = os.read(fd, buffer_size)
if data and six.PY3:
data = data.decode('utf-8', errors='ignore')
return data
def _IterProcessStdoutFcntl(process,
iter_timeout=None,
timeout=None,
buffer_size=4096,
poll_interval=1):
"""An fcntl-based implementation of _IterProcessStdout."""
# pylint: disable=too-many-nested-blocks
import fcntl
try:
# Enable non-blocking reads from the child's stdout.
child_fd = process.stdout.fileno()
fl = fcntl.fcntl(child_fd, fcntl.F_GETFL)
fcntl.fcntl(child_fd, fcntl.F_SETFL, fl | os.O_NONBLOCK)
end_time = (time.time() + timeout) if timeout else None
iter_end_time = (time.time() + iter_timeout) if iter_timeout else None
while True:
if end_time and time.time() > end_time:
raise TimeoutError()
if iter_end_time and time.time() > iter_end_time:
yield None
iter_end_time = time.time() + iter_timeout
if iter_end_time:
iter_aware_poll_interval = min(poll_interval,
max(0, iter_end_time - time.time()))
else:
iter_aware_poll_interval = poll_interval
read_fds, _, _ = select.select([child_fd], [], [],
iter_aware_poll_interval)
if child_fd in read_fds:
data = _read_and_decode(child_fd, buffer_size)
if not data:
break
yield data
if process.poll() is not None:
# If process is closed, keep checking for output data (because of timing
# issues).
while True:
read_fds, _, _ = select.select([child_fd], [], [],
iter_aware_poll_interval)
if child_fd in read_fds:
data = _read_and_decode(child_fd, buffer_size)
if data:
yield data
continue
break
break
finally:
try:
if process.returncode is None:
# Make sure the process doesn't stick around if we fail with an
# exception.
process.kill()
except OSError:
pass
process.wait()
def _IterProcessStdoutQueue(process,
iter_timeout=None,
timeout=None,
buffer_size=4096,
poll_interval=1):
"""A Queue.Queue-based implementation of _IterProcessStdout.
TODO(jbudorick): Evaluate whether this is a suitable replacement for
_IterProcessStdoutFcntl on all platforms.
"""
# pylint: disable=unused-argument
if six.PY3:
import queue
else:
import Queue as queue
import threading
stdout_queue = queue.Queue()
def read_process_stdout():
# TODO(jbudorick): Pick an appropriate read size here.
while True:
try:
output_chunk = _read_and_decode(process.stdout.fileno(), buffer_size)
except IOError:
break
stdout_queue.put(output_chunk, True)
if not output_chunk and process.poll() is not None:
break
reader_thread = threading.Thread(target=read_process_stdout)
reader_thread.start()
end_time = (time.time() + timeout) if timeout else None
try:
while True:
if end_time and time.time() > end_time:
raise TimeoutError()
try:
s = stdout_queue.get(True, iter_timeout)
if not s:
break
yield s
except queue.Empty:
yield None
finally:
try:
if process.returncode is None:
# Make sure the process doesn't stick around if we fail with an
# exception.
process.kill()
except OSError:
pass
process.wait()
reader_thread.join()
_IterProcessStdout = (_IterProcessStdoutQueue
if sys.platform == 'win32' else _IterProcessStdoutFcntl)
"""Iterate over a process's stdout.
This is intentionally not public.
Args:
process: The process in question.
iter_timeout: An optional length of time, in seconds, to wait in
between each iteration. If no output is received in the given
time, this generator will yield None.
timeout: An optional length of time, in seconds, during which
the process must finish. If it fails to do so, a TimeoutError
will be raised.
buffer_size: The maximum number of bytes to read (and thus yield) at once.
poll_interval: The length of time to wait in calls to `select.select`.
If iter_timeout is set, the remaining length of time in the iteration
may take precedence.
Raises:
TimeoutError: if timeout is set and the process does not complete.
Yields:
basestrings of data or None.
"""
def GetCmdStatusAndOutputWithTimeout(args,
timeout,
cwd=None,
shell=False,
logfile=None,
env=None):
"""Executes a subprocess with a timeout.
Args:
args: List of arguments to the program, the program to execute is the first
element.
timeout: the timeout in seconds or None to wait forever.
cwd: If not None, the subprocess's current directory will be changed to
|cwd| before it's executed.
shell: Whether to execute args as a shell command. Must be True if args
is a string and False if args is a sequence.
logfile: Optional file-like object that will receive output from the
command as it is running.
env: If not None, a mapping that defines environment variables for the
subprocess.
Returns:
The 2-tuple (exit code, output).
Raises:
TimeoutError on timeout.
"""
_ValidateAndLogCommand(args, cwd, shell)
output = six.StringIO()
process = Popen(
args,
cwd=cwd,
shell=shell,
stdout=subprocess.PIPE,
stderr=subprocess.STDOUT,
env=env)
try:
for data in _IterProcessStdout(process, timeout=timeout):
if logfile:
logfile.write(data)
output.write(data)
except TimeoutError:
raise TimeoutError(output.getvalue())
str_output = output.getvalue()
logger.debug('STDOUT+STDERR: %s%s', str_output[:4096].rstrip(),
'<truncated>' if len(str_output) > 4096 else '')
return process.returncode, str_output
def IterCmdOutputLines(args,
iter_timeout=None,
timeout=None,
cwd=None,
shell=False,
env=None,
check_status=True):
"""Executes a subprocess and continuously yields lines from its output.
Args:
args: List of arguments to the program, the program to execute is the first
element.
iter_timeout: Timeout for each iteration, in seconds.
timeout: Timeout for the entire command, in seconds.
cwd: If not None, the subprocess's current directory will be changed to
|cwd| before it's executed.
shell: Whether to execute args as a shell command. Must be True if args
is a string and False if args is a sequence.
env: If not None, a mapping that defines environment variables for the
subprocess.
check_status: A boolean indicating whether to check the exit status of the
process after all output has been read.
Yields:
The output of the subprocess, line by line.
Raises:
CalledProcessError if check_status is True and the process exited with a
non-zero exit status.
"""
cmd = _ValidateAndLogCommand(args, cwd, shell)
process = Popen(
args,
cwd=cwd,
shell=shell,
env=env,
stdout=subprocess.PIPE,
stderr=subprocess.STDOUT)
return _IterCmdOutputLines(
process,
cmd,
iter_timeout=iter_timeout,
timeout=timeout,
check_status=check_status)
def _IterCmdOutputLines(process,
cmd,
iter_timeout=None,
timeout=None,
check_status=True):
buffer_output = ''
iter_end = None
cur_iter_timeout = None
if iter_timeout:
iter_end = time.time() + iter_timeout
cur_iter_timeout = iter_timeout
for data in _IterProcessStdout(
process, iter_timeout=cur_iter_timeout, timeout=timeout):
if iter_timeout:
# Check whether the current iteration has timed out.
cur_iter_timeout = iter_end - time.time()
if data is None or cur_iter_timeout < 0:
yield None
iter_end = time.time() + iter_timeout
continue
else:
assert data is not None, (
'Iteration received no data despite no iter_timeout being set. '
'cmd: %s' % cmd)
# Construct lines to yield from raw data.
buffer_output += data
has_incomplete_line = buffer_output[-1] not in '\r\n'
lines = buffer_output.splitlines()
buffer_output = lines.pop() if has_incomplete_line else ''
for line in lines:
yield line
if iter_timeout:
iter_end = time.time() + iter_timeout
if buffer_output:
yield buffer_output
if check_status and process.returncode:
raise subprocess.CalledProcessError(process.returncode, cmd)
| # Copyright (c) 2012 The Chromium Authors. All rights reserved.
# Use of this source code is governed by a BSD-style license that can be
# found in the LICENSE file.
"""A wrapper for subprocess to make calling shell commands easier."""
import codecs
import logging
import os
import pipes
import select
import signal
import string
import subprocess
import sys
import time
CATAPULT_ROOT_PATH = os.path.abspath(
os.path.join(os.path.dirname(__file__), '..', '..', '..'))
SIX_PATH = os.path.join(CATAPULT_ROOT_PATH, 'third_party', 'six')
if SIX_PATH not in sys.path:
sys.path.append(SIX_PATH)
import six
from devil import base_error
logger = logging.getLogger(__name__)
_SafeShellChars = frozenset(string.ascii_letters + string.digits + '@%_-+=:,./')
# Cache the string-escape codec to ensure subprocess can find it
# later. Return value doesn't matter.
if six.PY2:
codecs.lookup('string-escape')
def SingleQuote(s):
"""Return an shell-escaped version of the string using single quotes.
Reliably quote a string which may contain unsafe characters (e.g. space,
quote, or other special characters such as '$').
The returned value can be used in a shell command line as one token that gets
to be interpreted literally.
Args:
s: The string to quote.
Return:
The string quoted using single quotes.
"""
return pipes.quote(s)
def DoubleQuote(s):
"""Return an shell-escaped version of the string using double quotes.
Reliably quote a string which may contain unsafe characters (e.g. space
or quote characters), while retaining some shell features such as variable
interpolation.
The returned value can be used in a shell command line as one token that gets
to be further interpreted by the shell.
The set of characters that retain their special meaning may depend on the
shell implementation. This set usually includes: '$', '`', '\', '!', '*',
and '@'.
Args:
s: The string to quote.
Return:
The string quoted using double quotes.
"""
if not s:
return '""'
elif all(c in _SafeShellChars for c in s):
return s
else:
return '"' + s.replace('"', '\\"') + '"'
def ShrinkToSnippet(cmd_parts, var_name, var_value):
"""Constructs a shell snippet for a command using a variable to shrink it.
Takes into account all quoting that needs to happen.
Args:
cmd_parts: A list of command arguments.
var_name: The variable that holds var_value.
var_value: The string to replace in cmd_parts with $var_name
Returns:
A shell snippet that does not include setting the variable.
"""
def shrink(value):
parts = (x and SingleQuote(x) for x in value.split(var_value))
with_substitutions = ('"$%s"' % var_name).join(parts)
return with_substitutions or "''"
return ' '.join(shrink(part) for part in cmd_parts)
def Popen(args,
stdin=None,
stdout=None,
stderr=None,
shell=None,
cwd=None,
env=None):
# preexec_fn isn't supported on windows.
# pylint: disable=unexpected-keyword-arg
if sys.platform == 'win32':
close_fds = (stdin is None and stdout is None and stderr is None)
preexec_fn = None
else:
close_fds = True
preexec_fn = lambda: signal.signal(signal.SIGPIPE, signal.SIG_DFL)
if six.PY2:
return subprocess.Popen(
args=args,
cwd=cwd,
stdin=stdin,
stdout=stdout,
stderr=stderr,
shell=shell,
close_fds=close_fds,
env=env,
preexec_fn=preexec_fn
)
else:
# opens stdout in text mode, so that caller side always get 'str',
# and there will be no type mismatch error.
# Ignore any decoding error, so that caller will not crash due to
# uncaught exception. Decoding errors are unavoidable, as we
# do not know the encoding of the output, and in some output there
# will be multiple encodings (e.g. adb logcat)
return subprocess.Popen(
args=args,
cwd=cwd,
stdin=stdin,
stdout=stdout,
stderr=stderr,
shell=shell,
close_fds=close_fds,
env=env,
preexec_fn=preexec_fn,
universal_newlines=True,
encoding='utf-8',
errors='ignore'
)
def Call(args, stdout=None, stderr=None, shell=None, cwd=None, env=None):
pipe = Popen(
args, stdout=stdout, stderr=stderr, shell=shell, cwd=cwd, env=env)
pipe.communicate()
return pipe.wait()
def RunCmd(args, cwd=None):
"""Opens a subprocess to execute a program and returns its return value.
Args:
args: A string or a sequence of program arguments. The program to execute is
the string or the first item in the args sequence.
cwd: If not None, the subprocess's current directory will be changed to
|cwd| before it's executed.
Returns:
Return code from the command execution.
"""
logger.debug(str(args) + ' ' + (cwd or ''))
return Call(args, cwd=cwd)
def GetCmdOutput(args, cwd=None, shell=False, env=None):
"""Open a subprocess to execute a program and returns its output.
Args:
args: A string or a sequence of program arguments. The program to execute is
the string or the first item in the args sequence.
cwd: If not None, the subprocess's current directory will be changed to
|cwd| before it's executed.
shell: Whether to execute args as a shell command.
env: If not None, a mapping that defines environment variables for the
subprocess.
Returns:
Captures and returns the command's stdout.
Prints the command's stderr to logger (which defaults to stdout).
"""
(_, output) = GetCmdStatusAndOutput(args, cwd, shell, env)
return output
def _ValidateAndLogCommand(args, cwd, shell):
if isinstance(args, six.string_types):
if not shell:
raise Exception('string args must be run with shell=True')
else:
if shell:
raise Exception('array args must be run with shell=False')
args = ' '.join(SingleQuote(str(c)) for c in args)
if cwd is None:
cwd = ''
else:
cwd = ':' + cwd
logger.debug('[host]%s> %s', cwd, args)
return args
def GetCmdStatusAndOutput(args,
cwd=None,
shell=False,
env=None,
merge_stderr=False):
"""Executes a subprocess and returns its exit code and output.
Args:
args: A string or a sequence of program arguments. The program to execute is
the string or the first item in the args sequence.
cwd: If not None, the subprocess's current directory will be changed to
|cwd| before it's executed.
shell: Whether to execute args as a shell command. Must be True if args
is a string and False if args is a sequence.
env: If not None, a mapping that defines environment variables for the
subprocess.
merge_stderr: If True, captures stderr as part of stdout.
Returns:
The 2-tuple (exit code, stdout).
"""
status, stdout, stderr = GetCmdStatusOutputAndError(
args, cwd=cwd, shell=shell, env=env, merge_stderr=merge_stderr)
if stderr:
logger.critical('STDERR: %s', stderr)
logger.debug('STDOUT: %s%s', stdout[:4096].rstrip(),
'<truncated>' if len(stdout) > 4096 else '')
return (status, stdout)
def StartCmd(args, cwd=None, shell=False, env=None):
"""Starts a subprocess and returns a handle to the process.
Args:
args: A string or a sequence of program arguments. The program to execute is
the string or the first item in the args sequence.
cwd: If not None, the subprocess's current directory will be changed to
|cwd| before it's executed.
shell: Whether to execute args as a shell command. Must be True if args
is a string and False if args is a sequence.
env: If not None, a mapping that defines environment variables for the
subprocess.
Returns:
A process handle from subprocess.Popen.
"""
_ValidateAndLogCommand(args, cwd, shell)
return Popen(
args,
stdout=subprocess.PIPE,
stderr=subprocess.PIPE,
shell=shell,
cwd=cwd,
env=env)
def GetCmdStatusOutputAndError(args,
cwd=None,
shell=False,
env=None,
merge_stderr=False):
"""Executes a subprocess and returns its exit code, output, and errors.
Args:
args: A string or a sequence of program arguments. The program to execute is
the string or the first item in the args sequence.
cwd: If not None, the subprocess's current directory will be changed to
|cwd| before it's executed.
shell: Whether to execute args as a shell command. Must be True if args
is a string and False if args is a sequence.
env: If not None, a mapping that defines environment variables for the
subprocess.
merge_stderr: If True, captures stderr as part of stdout.
Returns:
The 3-tuple (exit code, stdout, stderr).
"""
_ValidateAndLogCommand(args, cwd, shell)
stderr = subprocess.STDOUT if merge_stderr else subprocess.PIPE
pipe = Popen(
args,
stdout=subprocess.PIPE,
stderr=stderr,
shell=shell,
cwd=cwd,
env=env)
stdout, stderr = pipe.communicate()
return (pipe.returncode, stdout, stderr)
class TimeoutError(base_error.BaseError):
"""Module-specific timeout exception."""
def __init__(self, output=None):
super(TimeoutError, self).__init__('Timeout')
self._output = output
@property
def output(self):
return self._output
def _read_and_decode(fd, buffer_size):
data = os.read(fd, buffer_size)
if data and six.PY3:
data = data.decode('utf-8', errors='ignore')
return data
def _IterProcessStdoutFcntl(process,
iter_timeout=None,
timeout=None,
buffer_size=4096,
poll_interval=1):
"""An fcntl-based implementation of _IterProcessStdout."""
# pylint: disable=too-many-nested-blocks
import fcntl
try:
# Enable non-blocking reads from the child's stdout.
child_fd = process.stdout.fileno()
fl = fcntl.fcntl(child_fd, fcntl.F_GETFL)
fcntl.fcntl(child_fd, fcntl.F_SETFL, fl | os.O_NONBLOCK)
end_time = (time.time() + timeout) if timeout else None
iter_end_time = (time.time() + iter_timeout) if iter_timeout else None
while True:
if end_time and time.time() > end_time:
raise TimeoutError()
if iter_end_time and time.time() > iter_end_time:
yield None
iter_end_time = time.time() + iter_timeout
if iter_end_time:
iter_aware_poll_interval = min(poll_interval,
max(0, iter_end_time - time.time()))
else:
iter_aware_poll_interval = poll_interval
read_fds, _, _ = select.select([child_fd], [], [],
iter_aware_poll_interval)
if child_fd in read_fds:
data = _read_and_decode(child_fd, buffer_size)
if not data:
break
yield data
if process.poll() is not None:
# If process is closed, keep checking for output data (because of timing
# issues).
while True:
read_fds, _, _ = select.select([child_fd], [], [],
iter_aware_poll_interval)
if child_fd in read_fds:
data = _read_and_decode(child_fd, buffer_size)
if data:
yield data
continue
break
break
finally:
try:
if process.returncode is None:
# Make sure the process doesn't stick around if we fail with an
# exception.
process.kill()
except OSError:
pass
process.wait()
def _IterProcessStdoutQueue(process,
iter_timeout=None,
timeout=None,
buffer_size=4096,
poll_interval=1):
"""A Queue.Queue-based implementation of _IterProcessStdout.
TODO(jbudorick): Evaluate whether this is a suitable replacement for
_IterProcessStdoutFcntl on all platforms.
"""
# pylint: disable=unused-argument
if six.PY3:
import queue
else:
import Queue as queue
import threading
stdout_queue = queue.Queue()
def read_process_stdout():
# TODO(jbudorick): Pick an appropriate read size here.
while True:
try:
output_chunk = _read_and_decode(process.stdout.fileno(), buffer_size)
except IOError:
break
stdout_queue.put(output_chunk, True)
if not output_chunk and process.poll() is not None:
break
reader_thread = threading.Thread(target=read_process_stdout)
reader_thread.start()
end_time = (time.time() + timeout) if timeout else None
try:
while True:
if end_time and time.time() > end_time:
raise TimeoutError()
try:
s = stdout_queue.get(True, iter_timeout)
if not s:
break
yield s
except queue.Empty:
yield None
finally:
try:
if process.returncode is None:
# Make sure the process doesn't stick around if we fail with an
# exception.
process.kill()
except OSError:
pass
process.wait()
reader_thread.join()
_IterProcessStdout = (_IterProcessStdoutQueue
if sys.platform == 'win32' else _IterProcessStdoutFcntl)
"""Iterate over a process's stdout.
This is intentionally not public.
Args:
process: The process in question.
iter_timeout: An optional length of time, in seconds, to wait in
between each iteration. If no output is received in the given
time, this generator will yield None.
timeout: An optional length of time, in seconds, during which
the process must finish. If it fails to do so, a TimeoutError
will be raised.
buffer_size: The maximum number of bytes to read (and thus yield) at once.
poll_interval: The length of time to wait in calls to `select.select`.
If iter_timeout is set, the remaining length of time in the iteration
may take precedence.
Raises:
TimeoutError: if timeout is set and the process does not complete.
Yields:
basestrings of data or None.
"""
def GetCmdStatusAndOutputWithTimeout(args,
timeout,
cwd=None,
shell=False,
logfile=None,
env=None):
"""Executes a subprocess with a timeout.
Args:
args: List of arguments to the program, the program to execute is the first
element.
timeout: the timeout in seconds or None to wait forever.
cwd: If not None, the subprocess's current directory will be changed to
|cwd| before it's executed.
shell: Whether to execute args as a shell command. Must be True if args
is a string and False if args is a sequence.
logfile: Optional file-like object that will receive output from the
command as it is running.
env: If not None, a mapping that defines environment variables for the
subprocess.
Returns:
The 2-tuple (exit code, output).
Raises:
TimeoutError on timeout.
"""
_ValidateAndLogCommand(args, cwd, shell)
output = six.StringIO()
process = Popen(
args,
cwd=cwd,
shell=shell,
stdout=subprocess.PIPE,
stderr=subprocess.STDOUT,
env=env)
try:
for data in _IterProcessStdout(process, timeout=timeout):
if logfile:
logfile.write(data)
output.write(data)
except TimeoutError:
raise TimeoutError(output.getvalue())
str_output = output.getvalue()
logger.debug('STDOUT+STDERR: %s%s', str_output[:4096].rstrip(),
'<truncated>' if len(str_output) > 4096 else '')
return process.returncode, str_output
def IterCmdOutputLines(args,
iter_timeout=None,
timeout=None,
cwd=None,
shell=False,
env=None,
check_status=True):
"""Executes a subprocess and continuously yields lines from its output.
Args:
args: List of arguments to the program, the program to execute is the first
element.
iter_timeout: Timeout for each iteration, in seconds.
timeout: Timeout for the entire command, in seconds.
cwd: If not None, the subprocess's current directory will be changed to
|cwd| before it's executed.
shell: Whether to execute args as a shell command. Must be True if args
is a string and False if args is a sequence.
env: If not None, a mapping that defines environment variables for the
subprocess.
check_status: A boolean indicating whether to check the exit status of the
process after all output has been read.
Yields:
The output of the subprocess, line by line.
Raises:
CalledProcessError if check_status is True and the process exited with a
non-zero exit status.
"""
cmd = _ValidateAndLogCommand(args, cwd, shell)
process = Popen(
args,
cwd=cwd,
shell=shell,
env=env,
stdout=subprocess.PIPE,
stderr=subprocess.STDOUT)
return _IterCmdOutputLines(
process,
cmd,
iter_timeout=iter_timeout,
timeout=timeout,
check_status=check_status)
def _IterCmdOutputLines(process,
cmd,
iter_timeout=None,
timeout=None,
check_status=True):
buffer_output = ''
iter_end = None
cur_iter_timeout = None
if iter_timeout:
iter_end = time.time() + iter_timeout
cur_iter_timeout = iter_timeout
for data in _IterProcessStdout(
process, iter_timeout=cur_iter_timeout, timeout=timeout):
if iter_timeout:
# Check whether the current iteration has timed out.
cur_iter_timeout = iter_end - time.time()
if data is None or cur_iter_timeout < 0:
yield None
iter_end = time.time() + iter_timeout
continue
else:
assert data is not None, (
'Iteration received no data despite no iter_timeout being set. '
'cmd: %s' % cmd)
# Construct lines to yield from raw data.
buffer_output += data
has_incomplete_line = buffer_output[-1] not in '\r\n'
lines = buffer_output.splitlines()
buffer_output = lines.pop() if has_incomplete_line else ''
for line in lines:
yield line
if iter_timeout:
iter_end = time.time() + iter_timeout
if buffer_output:
yield buffer_output
if check_status and process.returncode:
raise subprocess.CalledProcessError(process.returncode, cmd) | en | 0.836196 | # Copyright (c) 2012 The Chromium Authors. All rights reserved. # Use of this source code is governed by a BSD-style license that can be # found in the LICENSE file. A wrapper for subprocess to make calling shell commands easier. # Cache the string-escape codec to ensure subprocess can find it # later. Return value doesn't matter. Return an shell-escaped version of the string using single quotes. Reliably quote a string which may contain unsafe characters (e.g. space, quote, or other special characters such as '$'). The returned value can be used in a shell command line as one token that gets to be interpreted literally. Args: s: The string to quote. Return: The string quoted using single quotes. Return an shell-escaped version of the string using double quotes. Reliably quote a string which may contain unsafe characters (e.g. space or quote characters), while retaining some shell features such as variable interpolation. The returned value can be used in a shell command line as one token that gets to be further interpreted by the shell. The set of characters that retain their special meaning may depend on the shell implementation. This set usually includes: '$', '`', '\', '!', '*', and '@'. Args: s: The string to quote. Return: The string quoted using double quotes. Constructs a shell snippet for a command using a variable to shrink it. Takes into account all quoting that needs to happen. Args: cmd_parts: A list of command arguments. var_name: The variable that holds var_value. var_value: The string to replace in cmd_parts with $var_name Returns: A shell snippet that does not include setting the variable. # preexec_fn isn't supported on windows. # pylint: disable=unexpected-keyword-arg # opens stdout in text mode, so that caller side always get 'str', # and there will be no type mismatch error. # Ignore any decoding error, so that caller will not crash due to # uncaught exception. Decoding errors are unavoidable, as we # do not know the encoding of the output, and in some output there # will be multiple encodings (e.g. adb logcat) Opens a subprocess to execute a program and returns its return value. Args: args: A string or a sequence of program arguments. The program to execute is the string or the first item in the args sequence. cwd: If not None, the subprocess's current directory will be changed to |cwd| before it's executed. Returns: Return code from the command execution. Open a subprocess to execute a program and returns its output. Args: args: A string or a sequence of program arguments. The program to execute is the string or the first item in the args sequence. cwd: If not None, the subprocess's current directory will be changed to |cwd| before it's executed. shell: Whether to execute args as a shell command. env: If not None, a mapping that defines environment variables for the subprocess. Returns: Captures and returns the command's stdout. Prints the command's stderr to logger (which defaults to stdout). Executes a subprocess and returns its exit code and output. Args: args: A string or a sequence of program arguments. The program to execute is the string or the first item in the args sequence. cwd: If not None, the subprocess's current directory will be changed to |cwd| before it's executed. shell: Whether to execute args as a shell command. Must be True if args is a string and False if args is a sequence. env: If not None, a mapping that defines environment variables for the subprocess. merge_stderr: If True, captures stderr as part of stdout. Returns: The 2-tuple (exit code, stdout). Starts a subprocess and returns a handle to the process. Args: args: A string or a sequence of program arguments. The program to execute is the string or the first item in the args sequence. cwd: If not None, the subprocess's current directory will be changed to |cwd| before it's executed. shell: Whether to execute args as a shell command. Must be True if args is a string and False if args is a sequence. env: If not None, a mapping that defines environment variables for the subprocess. Returns: A process handle from subprocess.Popen. Executes a subprocess and returns its exit code, output, and errors. Args: args: A string or a sequence of program arguments. The program to execute is the string or the first item in the args sequence. cwd: If not None, the subprocess's current directory will be changed to |cwd| before it's executed. shell: Whether to execute args as a shell command. Must be True if args is a string and False if args is a sequence. env: If not None, a mapping that defines environment variables for the subprocess. merge_stderr: If True, captures stderr as part of stdout. Returns: The 3-tuple (exit code, stdout, stderr). Module-specific timeout exception. An fcntl-based implementation of _IterProcessStdout. # pylint: disable=too-many-nested-blocks # Enable non-blocking reads from the child's stdout. # If process is closed, keep checking for output data (because of timing # issues). # Make sure the process doesn't stick around if we fail with an # exception. A Queue.Queue-based implementation of _IterProcessStdout. TODO(jbudorick): Evaluate whether this is a suitable replacement for _IterProcessStdoutFcntl on all platforms. # pylint: disable=unused-argument # TODO(jbudorick): Pick an appropriate read size here. # Make sure the process doesn't stick around if we fail with an # exception. Iterate over a process's stdout. This is intentionally not public. Args: process: The process in question. iter_timeout: An optional length of time, in seconds, to wait in between each iteration. If no output is received in the given time, this generator will yield None. timeout: An optional length of time, in seconds, during which the process must finish. If it fails to do so, a TimeoutError will be raised. buffer_size: The maximum number of bytes to read (and thus yield) at once. poll_interval: The length of time to wait in calls to `select.select`. If iter_timeout is set, the remaining length of time in the iteration may take precedence. Raises: TimeoutError: if timeout is set and the process does not complete. Yields: basestrings of data or None. Executes a subprocess with a timeout. Args: args: List of arguments to the program, the program to execute is the first element. timeout: the timeout in seconds or None to wait forever. cwd: If not None, the subprocess's current directory will be changed to |cwd| before it's executed. shell: Whether to execute args as a shell command. Must be True if args is a string and False if args is a sequence. logfile: Optional file-like object that will receive output from the command as it is running. env: If not None, a mapping that defines environment variables for the subprocess. Returns: The 2-tuple (exit code, output). Raises: TimeoutError on timeout. Executes a subprocess and continuously yields lines from its output. Args: args: List of arguments to the program, the program to execute is the first element. iter_timeout: Timeout for each iteration, in seconds. timeout: Timeout for the entire command, in seconds. cwd: If not None, the subprocess's current directory will be changed to |cwd| before it's executed. shell: Whether to execute args as a shell command. Must be True if args is a string and False if args is a sequence. env: If not None, a mapping that defines environment variables for the subprocess. check_status: A boolean indicating whether to check the exit status of the process after all output has been read. Yields: The output of the subprocess, line by line. Raises: CalledProcessError if check_status is True and the process exited with a non-zero exit status. # Check whether the current iteration has timed out. # Construct lines to yield from raw data. | 2.454651 | 2 |
services/server/server/apps/checkout/migrations/0001_initial.py | AyanSamanta23/moni-moni | 0 | 2827 | <filename>services/server/server/apps/checkout/migrations/0001_initial.py
# Generated by Django 4.0.2 on 2022-02-26 15:52
from django.db import migrations, models
class Migration(migrations.Migration):
initial = True
dependencies = [
]
operations = [
migrations.CreateModel(
name='FundingOptions',
fields=[
('id', models.BigAutoField(auto_created=True, primary_key=True, serialize=False, verbose_name='ID')),
('funding_name', models.CharField(help_text='Required', max_length=255, verbose_name='funding_name')),
('funding_price', models.DecimalField(decimal_places=2, help_text='Required', max_digits=1000, verbose_name='funding price')),
('funding_timeframe', models.CharField(help_text='Required', max_length=255, verbose_name='funding timeframe')),
('funding_window', models.CharField(help_text='Required', max_length=255, verbose_name='funding window')),
],
options={
'verbose_name': 'Funding Option',
'verbose_name_plural': 'Funding Options',
},
),
migrations.CreateModel(
name='PaymentSelections',
fields=[
('id', models.BigAutoField(auto_created=True, primary_key=True, serialize=False, verbose_name='ID')),
('name', models.CharField(help_text='Required', max_length=255, verbose_name='name')),
('is_active', models.BooleanField(default=True)),
],
options={
'verbose_name': 'Payment Selection',
'verbose_name_plural': 'Payment Selections',
},
),
]
| <filename>services/server/server/apps/checkout/migrations/0001_initial.py
# Generated by Django 4.0.2 on 2022-02-26 15:52
from django.db import migrations, models
class Migration(migrations.Migration):
initial = True
dependencies = [
]
operations = [
migrations.CreateModel(
name='FundingOptions',
fields=[
('id', models.BigAutoField(auto_created=True, primary_key=True, serialize=False, verbose_name='ID')),
('funding_name', models.CharField(help_text='Required', max_length=255, verbose_name='funding_name')),
('funding_price', models.DecimalField(decimal_places=2, help_text='Required', max_digits=1000, verbose_name='funding price')),
('funding_timeframe', models.CharField(help_text='Required', max_length=255, verbose_name='funding timeframe')),
('funding_window', models.CharField(help_text='Required', max_length=255, verbose_name='funding window')),
],
options={
'verbose_name': 'Funding Option',
'verbose_name_plural': 'Funding Options',
},
),
migrations.CreateModel(
name='PaymentSelections',
fields=[
('id', models.BigAutoField(auto_created=True, primary_key=True, serialize=False, verbose_name='ID')),
('name', models.CharField(help_text='Required', max_length=255, verbose_name='name')),
('is_active', models.BooleanField(default=True)),
],
options={
'verbose_name': 'Payment Selection',
'verbose_name_plural': 'Payment Selections',
},
),
]
| en | 0.850642 | # Generated by Django 4.0.2 on 2022-02-26 15:52 | 1.751985 | 2 |
api/to_astm.py | urchinpro/L2-forms | 0 | 2828 | <filename>api/to_astm.py
import itertools
from astm import codec
from collections import defaultdict
from django.utils import timezone
import directions.models as directions
import directory.models as directory
import api.models as api
import simplejson as json
def get_astm_header() -> list:
return ['H|\\^&', None, None, ['1', '2.00'], None, None, None, None, None, None, 'P', '1.00', timezone.now().strftime("%Y%m%d%H%M%S")]
def get_leave() -> list:
return ['L', 1, 'N']
def get_patient() -> list:
return ['P', 1]
def get_iss_direction(direction: directions.Napravleniya, analyzer: api.Analyzer, full=False) -> list:
r = []
n = 0
iss_list = directions.Issledovaniya.objects.filter(napravleniye=direction)
if not full:
iss_list = iss_list.filter(doc_confirmation__isnull=True)
for i in iss_list:
researches = defaultdict(list)
for fraction in directory.Fractions.objects.filter(research=i.research, relationfractionastm__analyzer=analyzer, hide=False):
rel = api.RelationFractionASTM.objects.filter(fraction=fraction, analyzer=analyzer)
if not rel.exists():
continue
rel = rel[0]
tube = directions.TubesRegistration.objects.filter(type__fractions=fraction)
if not tube.exists():
continue
tube = tube[0]
researches[tube.pk].append(rel.astm_field)
for tpk in researches:
n += 1
r.append(['O', n, tpk, None, [[None, x, None, None] for x in researches[tpk]]])
return r
def encode(m) -> str:
return codec.iter_encode(m)
def get_astm(directions_list, analyzer: api.Analyzer, full=False, out=None) -> str:
iss = [get_iss_direction(x, analyzer, full) for x in directions_list]
m = [get_astm_header(), get_patient()]
m = list(itertools.chain(m, *iss))
m.append(get_leave())
if out:
out.write(json.dumps(m))
return encode(m)
def get_iss_astm(issledovaniya: list, app: api.Application, need_astm=False):
m = [get_astm_header(), get_patient()]
n = 0
researches = defaultdict(list)
for row in issledovaniya:
k = row["pk"]
i = row["iss"]
for fraction in directory.Fractions.objects.filter(research=i.research, relationfractionastm__application_api=app, hide=False):
rel = api.RelationFractionASTM.objects.filter(fraction=fraction, application_api=app)
if not rel.exists():
continue
rel = rel[0]
if rel.is_code:
researches[k].append([None, None, None, rel.astm_field])
else:
researches[k].append([None, rel.astm_field, None, None])
for tpk in researches:
n += 1
m.append(['O', n, tpk, None, researches[tpk]])
m.append(get_leave())
return encode(m)
| <filename>api/to_astm.py
import itertools
from astm import codec
from collections import defaultdict
from django.utils import timezone
import directions.models as directions
import directory.models as directory
import api.models as api
import simplejson as json
def get_astm_header() -> list:
return ['H|\\^&', None, None, ['1', '2.00'], None, None, None, None, None, None, 'P', '1.00', timezone.now().strftime("%Y%m%d%H%M%S")]
def get_leave() -> list:
return ['L', 1, 'N']
def get_patient() -> list:
return ['P', 1]
def get_iss_direction(direction: directions.Napravleniya, analyzer: api.Analyzer, full=False) -> list:
r = []
n = 0
iss_list = directions.Issledovaniya.objects.filter(napravleniye=direction)
if not full:
iss_list = iss_list.filter(doc_confirmation__isnull=True)
for i in iss_list:
researches = defaultdict(list)
for fraction in directory.Fractions.objects.filter(research=i.research, relationfractionastm__analyzer=analyzer, hide=False):
rel = api.RelationFractionASTM.objects.filter(fraction=fraction, analyzer=analyzer)
if not rel.exists():
continue
rel = rel[0]
tube = directions.TubesRegistration.objects.filter(type__fractions=fraction)
if not tube.exists():
continue
tube = tube[0]
researches[tube.pk].append(rel.astm_field)
for tpk in researches:
n += 1
r.append(['O', n, tpk, None, [[None, x, None, None] for x in researches[tpk]]])
return r
def encode(m) -> str:
return codec.iter_encode(m)
def get_astm(directions_list, analyzer: api.Analyzer, full=False, out=None) -> str:
iss = [get_iss_direction(x, analyzer, full) for x in directions_list]
m = [get_astm_header(), get_patient()]
m = list(itertools.chain(m, *iss))
m.append(get_leave())
if out:
out.write(json.dumps(m))
return encode(m)
def get_iss_astm(issledovaniya: list, app: api.Application, need_astm=False):
m = [get_astm_header(), get_patient()]
n = 0
researches = defaultdict(list)
for row in issledovaniya:
k = row["pk"]
i = row["iss"]
for fraction in directory.Fractions.objects.filter(research=i.research, relationfractionastm__application_api=app, hide=False):
rel = api.RelationFractionASTM.objects.filter(fraction=fraction, application_api=app)
if not rel.exists():
continue
rel = rel[0]
if rel.is_code:
researches[k].append([None, None, None, rel.astm_field])
else:
researches[k].append([None, rel.astm_field, None, None])
for tpk in researches:
n += 1
m.append(['O', n, tpk, None, researches[tpk]])
m.append(get_leave())
return encode(m)
| none | 1 | 2.264713 | 2 |
|
test/unit/test_som_rom_parser.py | CospanDesign/nysa | 15 | 2829 | #!/usr/bin/python
import unittest
import json
import sys
import os
import string
sys.path.append(os.path.join(os.path.dirname(__file__),
os.pardir,
os.pardir))
from nysa.cbuilder import sdb_component as sdbc
from nysa.cbuilder import sdb_object_model as som
from nysa.cbuilder.som_rom_parser import parse_rom_image
from nysa.cbuilder.som_rom_generator import generate_rom_image
from nysa.cbuilder.sdb import SDBInfo
from nysa.cbuilder.sdb import SDBWarning
from nysa.cbuilder.sdb import SDBError
from nysa.common.status import StatusLevel
from nysa.common.status import Status
class Test (unittest.TestCase):
"""Unit test SDB Tree"""
def setUp(self):
pass
'''
def test_simple_rom(self):
rom_in = ROM1
som = parse_rom_image(rom_in)
rom_out = generate_rom_image(som)
rom_out = sdbc.convert_rom_to_32bit_buffer(rom_out)
self.assertEqual(rom_in, rom_out)
'''
def test_full_dionysus_read(self):
from nysa.host.platform_scanner import PlatformScanner
pscanner = PlatformScanner()
platform_dict = pscanner.get_platforms()
platform_names = platform_dict.keys()
if "dionysus" not in platform_names:
return
s = Status()
platform_instance = platform_dict["dionysus"](s)
platforms = platform_instance.scan()
if len(platforms) == 0:
return
dionysus = platforms[platforms.keys()[0]]
#print "Found Dionysus"
s.set_level("fatal")
s.Verbose("Read SDB")
dionysus.read_sdb()
def test_full_bus(self):
sm = som.SOM()
sm.initialize_root()
root = sm.get_root()
peripheral = sm.insert_bus()
peripheral.set_name("peripheral")
memory = sm.insert_bus()
memory.set_name("memory")
d1 = sdbc.create_device_record(name = "device 1", size = 0x100)
d2 = sdbc.create_device_record(name = "device 2", size = 0x100)
m1 = sdbc.create_device_record(name = "memory 1", size = 0x10000)
m2 = sdbc.create_device_record(name = "memory 2", size = 0x20000)
peripheral.set_child_spacing(0x0010000000)
root.set_child_spacing (0x0100000000)
sm.insert_component(peripheral, d1)
sm.insert_component(peripheral, d2)
sm.insert_component(memory, m1)
sm.insert_component(memory, m2)
rom = generate_rom_image(sm)
rom_in = sdbc.convert_rom_to_32bit_buffer(rom)
#rom_in = ROM2
#print_sdb_rom(rom_in)
sm = parse_rom_image(rom_in)
rom_out = generate_rom_image(sm)
rom_out = sdbc.convert_rom_to_32bit_buffer(rom_out)
#print_sdb_rom(rom_out)
self.assertEqual(rom_in, rom_out)
def test_full_bus_with_integration(self):
sm = som.SOM()
sm.initialize_root()
root = sm.get_root()
peripheral = sm.insert_bus()
peripheral.set_name("peripheral")
memory = sm.insert_bus()
memory.set_name("memory")
d1 = sdbc.create_device_record(name = "device 1", size = 0x100)
d2 = sdbc.create_device_record(name = "device 2", size = 0x100)
m1 = sdbc.create_device_record(name = "memory 1", size = 0x10000)
m2 = sdbc.create_device_record(name = "memory 2", size = 0x20000)
intr = sdbc.create_integration_record("Integration Data",
vendor_id = 0x800BEAF15DEADC03,
device_id = 0x00000000)
peripheral.set_child_spacing(0x0100000000)
sm.insert_component(peripheral, intr)
sm.insert_component(peripheral, d1)
sm.insert_component(peripheral, d2)
sm.insert_component(memory, m1)
sm.insert_component(memory, m2)
rom = generate_rom_image(sm)
rom_in = sdbc.convert_rom_to_32bit_buffer(rom)
#rom_in = ROM2
#print_sdb_rom(rom_in)
sm = parse_rom_image(rom_in)
rom_out = generate_rom_image(sm)
rom_out = sdbc.convert_rom_to_32bit_buffer(rom_out)
#print_sdb_rom(rom_out)
#compare_roms(rom_in, rom_out)
self.assertEqual(rom_in, rom_out)
def test_generate_one_sub_bus_with_url(self):
sm = som.SOM()
sm.initialize_root()
root = sm.get_root()
peripheral = sm.insert_bus()
peripheral.set_name("peripheral")
memory = sm.insert_bus()
memory.set_name("memory")
d1 = sdbc.create_device_record(name = "device 1", size = 0x100)
d2 = sdbc.create_device_record(name = "device 2", size = 0x100)
m1 = sdbc.create_device_record(name = "memory 1", size = 0x10000)
m2 = sdbc.create_device_record(name = "memory 2", size = 0x20000)
intr = sdbc.create_integration_record("Integration Data",
vendor_id = 0x800BEAF15DEADC03,
device_id = 0x00000000)
url = sdbc.create_repo_url_record("http://www.geocities.com")
sm.insert_component(root, url)
peripheral.set_child_spacing(0x0100000000)
sm.insert_component(peripheral, intr)
sm.insert_component(peripheral, d1)
sm.insert_component(peripheral, d2)
sm.insert_component(memory, m1)
sm.insert_component(memory, m2)
rom = generate_rom_image(sm)
rom_in = sdbc.convert_rom_to_32bit_buffer(rom)
#print_sdb(rom)
sm = parse_rom_image(rom_in)
rom_out = generate_rom_image(sm)
rom_out = sdbc.convert_rom_to_32bit_buffer(rom_out)
#print_sdb_rom(rom_out)
#compare_roms(rom_in, rom_out)
self.assertEqual(rom_in, rom_out)
def test_generate_one_sub_bus_with_url(self):
sm = som.SOM()
sm.initialize_root()
root = sm.get_root()
peripheral = sm.insert_bus()
peripheral.set_name("peripheral")
memory = sm.insert_bus()
memory.set_name("memory")
d1 = sdbc.create_device_record(name = "device 1", size = 0x100)
d2 = sdbc.create_device_record(name = "device 2", size = 0x100)
m1 = sdbc.create_device_record(name = "memory 1", size = 0x10000)
m2 = sdbc.create_device_record(name = "memory 2", size = 0x20000)
intr = sdbc.create_integration_record("Integration Data",
vendor_id = 0x800BEAF15DEADC03,
device_id = 0x00000000)
url = sdbc.create_repo_url_record("http://www.geocities.com")
synthesis = sdbc.create_synthesis_record("Synthesis Name", 123, "cool tool", 1.0, "jeff")
sm.insert_component(root, url)
sm.insert_component(root, synthesis)
peripheral.set_child_spacing(0x0100000000)
sm.insert_component(peripheral, intr)
sm.insert_component(peripheral, d1)
sm.insert_component(peripheral, d2)
sm.insert_component(memory, m1)
sm.insert_component(memory, m2)
rom = generate_rom_image(sm)
rom_in = sdbc.convert_rom_to_32bit_buffer(rom)
#print_sdb(rom)
sm = parse_rom_image(rom_in)
rom_out = generate_rom_image(sm)
rom_out = sdbc.convert_rom_to_32bit_buffer(rom_out)
#print_sdb_rom(rom_out)
#compare_roms(rom_in, rom_out)
self.assertEqual(rom_in, rom_out)
def test_generate_one_sub_bus_with_url(self):
rom_in = ROMD
#print_sdb(rom)
sm = parse_rom_image(rom_in)
rom_out = generate_rom_image(sm)
rom_out = sdbc.convert_rom_to_32bit_buffer(rom_out)
print_sdb_rom(rom_out)
#compare_roms(rom_in, rom_out)
self.assertEqual(rom_in, rom_out)
def compare_roms(rom_in, rom_out):
if len(rom_in) != len(rom_out):
print "Length of rom is not equal!"
return
rom_in = rom_in.splitlines()
rom_out = rom_out.splitlines()
for i in range (0, len(rom_in), 4):
if (i % 16 == 0):
magic = "0x%s" % (rom_in[i].lower())
last_val = int(rom_in[i + 15], 16) & 0xFF
print ""
if (magic == hex(sdbc.SDB_INTERCONNECT_MAGIC) and last_val == 0):
print "Interconnect"
elif last_val == 0x01:
print "Device"
elif last_val == 0x02:
print "Bridge"
elif last_val == 0x80:
print "Integration"
elif last_val == 0x81:
print "URL"
elif last_val == 0x82:
print "Synthesis"
elif last_val == 0xFF:
print "Empty"
else:
print "???"
if rom_in[i] == rom_out[i] and rom_in[i + 1] == rom_out[i + 1] and rom_in[i + 2] == rom_out[i + 2] and rom_in[i + 3] == rom_out[i + 3]:
print "%s %s : %s %s" % (rom_in[i], rom_in[i + 1], rom_in[i + 2], rom_in[i + 3])
else:
print "%s %s : %s %s != %s %s : %s %s" % (rom_in[i], rom_in[i + 1], rom_in[i + 2], rom_in[i + 3], rom_out[i], rom_out[i + 1], rom_out[i + 2], rom_out[i + 3])
def print_sdb_rom(rom):
#rom = sdbc.convert_rom_to_32bit_buffer(rom)
rom = rom.splitlines()
print "ROM"
for i in range (0, len(rom), 4):
if (i % 16 == 0):
magic = "0x%s" % (rom[i].lower())
last_val = int(rom[i + 15], 16) & 0xFF
print ""
if (magic == hex(sdbc.SDB_INTERCONNECT_MAGIC) and last_val == 0):
print "Interconnect"
elif last_val == 0x01:
print "Device"
elif last_val == 0x02:
print "Bridge"
elif last_val == 0x80:
print "Integration"
elif last_val == 0x81:
print "URL"
elif last_val == 0x82:
print "Synthesis"
elif last_val == 0xFF:
print "Empty"
else:
print "???"
print "%s %s : %s %s" % (rom[i], rom[i + 1], rom[i + 2], rom[i + 3])
ROM1 = "5344422D\n"\
"00010100\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000100\n"\
"80000000\n"\
"0000C594\n"\
"00000001\n"\
"00000001\n"\
"140F0105\n"\
"746F7000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000207\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000100\n"\
"80000000\n"\
"00000000\n"\
"00000000\n"\
"00000001\n"\
"140F0105\n"\
"64657669\n"\
"63652031\n"\
"00000000\n"\
"00000000\n"\
"00000001\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"000000FF"
ROM2 = "5344422D\n"\
"00020100\n"\
"00000000\n"\
"00000000\n"\
"03000000\n"\
"00000000\n"\
"80000000\n"\
"0000C594\n"\
"00000001\n"\
"00000001\n"\
"140F0105\n"\
"746F7000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000020\n"\
"00000000\n"\
"00000000\n"\
"00000100\n"\
"00000000\n"\
"80000000\n"\
"0000C594\n"\
"00000001\n"\
"00000001\n"\
"140F0105\n"\
"70657269\n"\
"70686572\n"\
"616C0000\n"\
"00000000\n"\
"00000002\n"\
"00000000\n"\
"00000040\n"\
"00000100\n"\
"00000000\n"\
"00000200\n"\
"00030000\n"\
"80000000\n"\
"0000C594\n"\
"00000001\n"\
"00000001\n"\
"140F0105\n"\
"6D656D6F\n"\
"72790000\n"\
"00000000\n"\
"00000000\n"\
"00000002\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"000000FF\n"\
"5344422D\n"\
"00020100\n"\
"00000000\n"\
"00000000\n"\
"00000100\n"\
"00000000\n"\
"80000000\n"\
"0000C594\n"\
"00000001\n"\
"00000001\n"\
"140F0105\n"\
"70657269\n"\
"70686572\n"\
"616C0000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000207\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000100\n"\
"80000000\n"\
"00000000\n"\
"00000000\n"\
"00000001\n"\
"140F0105\n"\
"64657669\n"\
"63652031\n"\
"00000000\n"\
"00000000\n"\
"00000001\n"\
"00000000\n"\
"00000207\n"\
"00000001\n"\
"00000000\n"\
"00000003\n"\
"00000100\n"\
"80000000\n"\
"00000000\n"\
"00000000\n"\
"00000001\n"\
"140F0105\n"\
"64657669\n"\
"63652032\n"\
"00000000\n"\
"00000000\n"\
"00000001\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"000000FF\n"\
"5344422D\n"\
"00020100\n"\
"00000100\n"\
"00000000\n"\
"00000200\n"\
"00030000\n"\
"80000000\n"\
"0000C594\n"\
"00000001\n"\
"00000001\n"\
"140F0105\n"\
"6D656D6F\n"\
"72790000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000207\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00010000\n"\
"80000000\n"\
"00000000\n"\
"00000000\n"\
"00000001\n"\
"140F0105\n"\
"6D656D6F\n"\
"72792031\n"\
"00000000\n"\
"00000000\n"\
"00000001\n"\
"00000000\n"\
"00000207\n"\
"00000000\n"\
"00010000\n"\
"00000000\n"\
"00030000\n"\
"80000000\n"\
"00000000\n"\
"00000000\n"\
"00000001\n"\
"140F0105\n"\
"6D656D6F\n"\
"72792032\n"\
"00000000\n"\
"00000000\n"\
"00000001\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"000000FF"
ROMD = "5344422D\n"\
"00020100\n"\
"00000000\n"\
"00000000\n"\
"00000002\n"\
"00000000\n"\
"80000000\n"\
"0000C594\n"\
"00000001\n"\
"00000001\n"\
"140F0106\n"\
"746F7000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000020\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"20000000\n"\
"80000000\n"\
"0000C594\n"\
"00000001\n"\
"00000001\n"\
"140F0106\n"\
"70657269\n"\
"70686572\n"\
"616C0000\n"\
"00000000\n"\
"00000002\n"\
"00000000\n"\
"00000040\n"\
"00000001\n"\
"00000000\n"\
"00000001\n"\
"00800000\n"\
"80000000\n"\
"0000C594\n"\
"00000001\n"\
"00000001\n"\
"140F0106\n"\
"6D656D6F\n"\
"72790000\n"\
"00000000\n"\
"00000000\n"\
"00000002\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"000000FF\n"\
"5344422D\n"\
"00020100\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"20000000\n"\
"80000000\n"\
"0000C594\n"\
"00000001\n"\
"00000001\n"\
"140F0106\n"\
"70657269\n"\
"70686572\n"\
"616C0000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000207\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000340\n"\
"80000000\n"\
"00000000\n"\
"00000000\n"\
"00000001\n"\
"140F0106\n"\
"53444200\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000001\n"\
"00000101\n"\
"00000207\n"\
"00000000\n"\
"10000000\n"\
"00000000\n"\
"10000008\n"\
"80000000\n"\
"0000C594\n"\
"00000000\n"\
"00000001\n"\
"140F0107\n"\
"77625F67\n"\
"70696F00\n"\
"00000000\n"\
"00000000\n"\
"00000001\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"000000FF\n"\
"5344422D\n"\
"00010100\n"\
"00000001\n"\
"00000000\n"\
"00000001\n"\
"00800000\n"\
"80000000\n"\
"0000C594\n"\
"00000001\n"\
"00000001\n"\
"140F0106\n"\
"6D656D6F\n"\
"72790000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000502\n"\
"00000207\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00800000\n"\
"80000000\n"\
"0000C594\n"\
"00000000\n"\
"00000001\n"\
"140F0107\n"\
"77625F73\n"\
"6472616D\n"\
"00000000\n"\
"00000000\n"\
"00000001\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"000000FF"
| #!/usr/bin/python
import unittest
import json
import sys
import os
import string
sys.path.append(os.path.join(os.path.dirname(__file__),
os.pardir,
os.pardir))
from nysa.cbuilder import sdb_component as sdbc
from nysa.cbuilder import sdb_object_model as som
from nysa.cbuilder.som_rom_parser import parse_rom_image
from nysa.cbuilder.som_rom_generator import generate_rom_image
from nysa.cbuilder.sdb import SDBInfo
from nysa.cbuilder.sdb import SDBWarning
from nysa.cbuilder.sdb import SDBError
from nysa.common.status import StatusLevel
from nysa.common.status import Status
class Test (unittest.TestCase):
"""Unit test SDB Tree"""
def setUp(self):
pass
'''
def test_simple_rom(self):
rom_in = ROM1
som = parse_rom_image(rom_in)
rom_out = generate_rom_image(som)
rom_out = sdbc.convert_rom_to_32bit_buffer(rom_out)
self.assertEqual(rom_in, rom_out)
'''
def test_full_dionysus_read(self):
from nysa.host.platform_scanner import PlatformScanner
pscanner = PlatformScanner()
platform_dict = pscanner.get_platforms()
platform_names = platform_dict.keys()
if "dionysus" not in platform_names:
return
s = Status()
platform_instance = platform_dict["dionysus"](s)
platforms = platform_instance.scan()
if len(platforms) == 0:
return
dionysus = platforms[platforms.keys()[0]]
#print "Found Dionysus"
s.set_level("fatal")
s.Verbose("Read SDB")
dionysus.read_sdb()
def test_full_bus(self):
sm = som.SOM()
sm.initialize_root()
root = sm.get_root()
peripheral = sm.insert_bus()
peripheral.set_name("peripheral")
memory = sm.insert_bus()
memory.set_name("memory")
d1 = sdbc.create_device_record(name = "device 1", size = 0x100)
d2 = sdbc.create_device_record(name = "device 2", size = 0x100)
m1 = sdbc.create_device_record(name = "memory 1", size = 0x10000)
m2 = sdbc.create_device_record(name = "memory 2", size = 0x20000)
peripheral.set_child_spacing(0x0010000000)
root.set_child_spacing (0x0100000000)
sm.insert_component(peripheral, d1)
sm.insert_component(peripheral, d2)
sm.insert_component(memory, m1)
sm.insert_component(memory, m2)
rom = generate_rom_image(sm)
rom_in = sdbc.convert_rom_to_32bit_buffer(rom)
#rom_in = ROM2
#print_sdb_rom(rom_in)
sm = parse_rom_image(rom_in)
rom_out = generate_rom_image(sm)
rom_out = sdbc.convert_rom_to_32bit_buffer(rom_out)
#print_sdb_rom(rom_out)
self.assertEqual(rom_in, rom_out)
def test_full_bus_with_integration(self):
sm = som.SOM()
sm.initialize_root()
root = sm.get_root()
peripheral = sm.insert_bus()
peripheral.set_name("peripheral")
memory = sm.insert_bus()
memory.set_name("memory")
d1 = sdbc.create_device_record(name = "device 1", size = 0x100)
d2 = sdbc.create_device_record(name = "device 2", size = 0x100)
m1 = sdbc.create_device_record(name = "memory 1", size = 0x10000)
m2 = sdbc.create_device_record(name = "memory 2", size = 0x20000)
intr = sdbc.create_integration_record("Integration Data",
vendor_id = 0x800BEAF15DEADC03,
device_id = 0x00000000)
peripheral.set_child_spacing(0x0100000000)
sm.insert_component(peripheral, intr)
sm.insert_component(peripheral, d1)
sm.insert_component(peripheral, d2)
sm.insert_component(memory, m1)
sm.insert_component(memory, m2)
rom = generate_rom_image(sm)
rom_in = sdbc.convert_rom_to_32bit_buffer(rom)
#rom_in = ROM2
#print_sdb_rom(rom_in)
sm = parse_rom_image(rom_in)
rom_out = generate_rom_image(sm)
rom_out = sdbc.convert_rom_to_32bit_buffer(rom_out)
#print_sdb_rom(rom_out)
#compare_roms(rom_in, rom_out)
self.assertEqual(rom_in, rom_out)
def test_generate_one_sub_bus_with_url(self):
sm = som.SOM()
sm.initialize_root()
root = sm.get_root()
peripheral = sm.insert_bus()
peripheral.set_name("peripheral")
memory = sm.insert_bus()
memory.set_name("memory")
d1 = sdbc.create_device_record(name = "device 1", size = 0x100)
d2 = sdbc.create_device_record(name = "device 2", size = 0x100)
m1 = sdbc.create_device_record(name = "memory 1", size = 0x10000)
m2 = sdbc.create_device_record(name = "memory 2", size = 0x20000)
intr = sdbc.create_integration_record("Integration Data",
vendor_id = 0x800BEAF15DEADC03,
device_id = 0x00000000)
url = sdbc.create_repo_url_record("http://www.geocities.com")
sm.insert_component(root, url)
peripheral.set_child_spacing(0x0100000000)
sm.insert_component(peripheral, intr)
sm.insert_component(peripheral, d1)
sm.insert_component(peripheral, d2)
sm.insert_component(memory, m1)
sm.insert_component(memory, m2)
rom = generate_rom_image(sm)
rom_in = sdbc.convert_rom_to_32bit_buffer(rom)
#print_sdb(rom)
sm = parse_rom_image(rom_in)
rom_out = generate_rom_image(sm)
rom_out = sdbc.convert_rom_to_32bit_buffer(rom_out)
#print_sdb_rom(rom_out)
#compare_roms(rom_in, rom_out)
self.assertEqual(rom_in, rom_out)
def test_generate_one_sub_bus_with_url(self):
sm = som.SOM()
sm.initialize_root()
root = sm.get_root()
peripheral = sm.insert_bus()
peripheral.set_name("peripheral")
memory = sm.insert_bus()
memory.set_name("memory")
d1 = sdbc.create_device_record(name = "device 1", size = 0x100)
d2 = sdbc.create_device_record(name = "device 2", size = 0x100)
m1 = sdbc.create_device_record(name = "memory 1", size = 0x10000)
m2 = sdbc.create_device_record(name = "memory 2", size = 0x20000)
intr = sdbc.create_integration_record("Integration Data",
vendor_id = 0x800BEAF15DEADC03,
device_id = 0x00000000)
url = sdbc.create_repo_url_record("http://www.geocities.com")
synthesis = sdbc.create_synthesis_record("Synthesis Name", 123, "cool tool", 1.0, "jeff")
sm.insert_component(root, url)
sm.insert_component(root, synthesis)
peripheral.set_child_spacing(0x0100000000)
sm.insert_component(peripheral, intr)
sm.insert_component(peripheral, d1)
sm.insert_component(peripheral, d2)
sm.insert_component(memory, m1)
sm.insert_component(memory, m2)
rom = generate_rom_image(sm)
rom_in = sdbc.convert_rom_to_32bit_buffer(rom)
#print_sdb(rom)
sm = parse_rom_image(rom_in)
rom_out = generate_rom_image(sm)
rom_out = sdbc.convert_rom_to_32bit_buffer(rom_out)
#print_sdb_rom(rom_out)
#compare_roms(rom_in, rom_out)
self.assertEqual(rom_in, rom_out)
def test_generate_one_sub_bus_with_url(self):
rom_in = ROMD
#print_sdb(rom)
sm = parse_rom_image(rom_in)
rom_out = generate_rom_image(sm)
rom_out = sdbc.convert_rom_to_32bit_buffer(rom_out)
print_sdb_rom(rom_out)
#compare_roms(rom_in, rom_out)
self.assertEqual(rom_in, rom_out)
def compare_roms(rom_in, rom_out):
if len(rom_in) != len(rom_out):
print "Length of rom is not equal!"
return
rom_in = rom_in.splitlines()
rom_out = rom_out.splitlines()
for i in range (0, len(rom_in), 4):
if (i % 16 == 0):
magic = "0x%s" % (rom_in[i].lower())
last_val = int(rom_in[i + 15], 16) & 0xFF
print ""
if (magic == hex(sdbc.SDB_INTERCONNECT_MAGIC) and last_val == 0):
print "Interconnect"
elif last_val == 0x01:
print "Device"
elif last_val == 0x02:
print "Bridge"
elif last_val == 0x80:
print "Integration"
elif last_val == 0x81:
print "URL"
elif last_val == 0x82:
print "Synthesis"
elif last_val == 0xFF:
print "Empty"
else:
print "???"
if rom_in[i] == rom_out[i] and rom_in[i + 1] == rom_out[i + 1] and rom_in[i + 2] == rom_out[i + 2] and rom_in[i + 3] == rom_out[i + 3]:
print "%s %s : %s %s" % (rom_in[i], rom_in[i + 1], rom_in[i + 2], rom_in[i + 3])
else:
print "%s %s : %s %s != %s %s : %s %s" % (rom_in[i], rom_in[i + 1], rom_in[i + 2], rom_in[i + 3], rom_out[i], rom_out[i + 1], rom_out[i + 2], rom_out[i + 3])
def print_sdb_rom(rom):
#rom = sdbc.convert_rom_to_32bit_buffer(rom)
rom = rom.splitlines()
print "ROM"
for i in range (0, len(rom), 4):
if (i % 16 == 0):
magic = "0x%s" % (rom[i].lower())
last_val = int(rom[i + 15], 16) & 0xFF
print ""
if (magic == hex(sdbc.SDB_INTERCONNECT_MAGIC) and last_val == 0):
print "Interconnect"
elif last_val == 0x01:
print "Device"
elif last_val == 0x02:
print "Bridge"
elif last_val == 0x80:
print "Integration"
elif last_val == 0x81:
print "URL"
elif last_val == 0x82:
print "Synthesis"
elif last_val == 0xFF:
print "Empty"
else:
print "???"
print "%s %s : %s %s" % (rom[i], rom[i + 1], rom[i + 2], rom[i + 3])
ROM1 = "5344422D\n"\
"00010100\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000100\n"\
"80000000\n"\
"0000C594\n"\
"00000001\n"\
"00000001\n"\
"140F0105\n"\
"746F7000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000207\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000100\n"\
"80000000\n"\
"00000000\n"\
"00000000\n"\
"00000001\n"\
"140F0105\n"\
"64657669\n"\
"63652031\n"\
"00000000\n"\
"00000000\n"\
"00000001\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"000000FF"
ROM2 = "5344422D\n"\
"00020100\n"\
"00000000\n"\
"00000000\n"\
"03000000\n"\
"00000000\n"\
"80000000\n"\
"0000C594\n"\
"00000001\n"\
"00000001\n"\
"140F0105\n"\
"746F7000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000020\n"\
"00000000\n"\
"00000000\n"\
"00000100\n"\
"00000000\n"\
"80000000\n"\
"0000C594\n"\
"00000001\n"\
"00000001\n"\
"140F0105\n"\
"70657269\n"\
"70686572\n"\
"616C0000\n"\
"00000000\n"\
"00000002\n"\
"00000000\n"\
"00000040\n"\
"00000100\n"\
"00000000\n"\
"00000200\n"\
"00030000\n"\
"80000000\n"\
"0000C594\n"\
"00000001\n"\
"00000001\n"\
"140F0105\n"\
"6D656D6F\n"\
"72790000\n"\
"00000000\n"\
"00000000\n"\
"00000002\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"000000FF\n"\
"5344422D\n"\
"00020100\n"\
"00000000\n"\
"00000000\n"\
"00000100\n"\
"00000000\n"\
"80000000\n"\
"0000C594\n"\
"00000001\n"\
"00000001\n"\
"140F0105\n"\
"70657269\n"\
"70686572\n"\
"616C0000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000207\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000100\n"\
"80000000\n"\
"00000000\n"\
"00000000\n"\
"00000001\n"\
"140F0105\n"\
"64657669\n"\
"63652031\n"\
"00000000\n"\
"00000000\n"\
"00000001\n"\
"00000000\n"\
"00000207\n"\
"00000001\n"\
"00000000\n"\
"00000003\n"\
"00000100\n"\
"80000000\n"\
"00000000\n"\
"00000000\n"\
"00000001\n"\
"140F0105\n"\
"64657669\n"\
"63652032\n"\
"00000000\n"\
"00000000\n"\
"00000001\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"000000FF\n"\
"5344422D\n"\
"00020100\n"\
"00000100\n"\
"00000000\n"\
"00000200\n"\
"00030000\n"\
"80000000\n"\
"0000C594\n"\
"00000001\n"\
"00000001\n"\
"140F0105\n"\
"6D656D6F\n"\
"72790000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000207\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00010000\n"\
"80000000\n"\
"00000000\n"\
"00000000\n"\
"00000001\n"\
"140F0105\n"\
"6D656D6F\n"\
"72792031\n"\
"00000000\n"\
"00000000\n"\
"00000001\n"\
"00000000\n"\
"00000207\n"\
"00000000\n"\
"00010000\n"\
"00000000\n"\
"00030000\n"\
"80000000\n"\
"00000000\n"\
"00000000\n"\
"00000001\n"\
"140F0105\n"\
"6D656D6F\n"\
"72792032\n"\
"00000000\n"\
"00000000\n"\
"00000001\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"000000FF"
ROMD = "5344422D\n"\
"00020100\n"\
"00000000\n"\
"00000000\n"\
"00000002\n"\
"00000000\n"\
"80000000\n"\
"0000C594\n"\
"00000001\n"\
"00000001\n"\
"140F0106\n"\
"746F7000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000020\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"20000000\n"\
"80000000\n"\
"0000C594\n"\
"00000001\n"\
"00000001\n"\
"140F0106\n"\
"70657269\n"\
"70686572\n"\
"616C0000\n"\
"00000000\n"\
"00000002\n"\
"00000000\n"\
"00000040\n"\
"00000001\n"\
"00000000\n"\
"00000001\n"\
"00800000\n"\
"80000000\n"\
"0000C594\n"\
"00000001\n"\
"00000001\n"\
"140F0106\n"\
"6D656D6F\n"\
"72790000\n"\
"00000000\n"\
"00000000\n"\
"00000002\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"000000FF\n"\
"5344422D\n"\
"00020100\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"20000000\n"\
"80000000\n"\
"0000C594\n"\
"00000001\n"\
"00000001\n"\
"140F0106\n"\
"70657269\n"\
"70686572\n"\
"616C0000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000207\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000340\n"\
"80000000\n"\
"00000000\n"\
"00000000\n"\
"00000001\n"\
"140F0106\n"\
"53444200\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000001\n"\
"00000101\n"\
"00000207\n"\
"00000000\n"\
"10000000\n"\
"00000000\n"\
"10000008\n"\
"80000000\n"\
"0000C594\n"\
"00000000\n"\
"00000001\n"\
"140F0107\n"\
"77625F67\n"\
"70696F00\n"\
"00000000\n"\
"00000000\n"\
"00000001\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"000000FF\n"\
"5344422D\n"\
"00010100\n"\
"00000001\n"\
"00000000\n"\
"00000001\n"\
"00800000\n"\
"80000000\n"\
"0000C594\n"\
"00000001\n"\
"00000001\n"\
"140F0106\n"\
"6D656D6F\n"\
"72790000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000502\n"\
"00000207\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00800000\n"\
"80000000\n"\
"0000C594\n"\
"00000000\n"\
"00000001\n"\
"140F0107\n"\
"77625F73\n"\
"6472616D\n"\
"00000000\n"\
"00000000\n"\
"00000001\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"00000000\n"\
"000000FF"
| da | 0.069062 | #!/usr/bin/python Unit test SDB Tree def test_simple_rom(self): rom_in = ROM1 som = parse_rom_image(rom_in) rom_out = generate_rom_image(som) rom_out = sdbc.convert_rom_to_32bit_buffer(rom_out) self.assertEqual(rom_in, rom_out) #print "Found Dionysus" #rom_in = ROM2 #print_sdb_rom(rom_in) #print_sdb_rom(rom_out) #rom_in = ROM2 #print_sdb_rom(rom_in) #print_sdb_rom(rom_out) #compare_roms(rom_in, rom_out) #print_sdb(rom) #print_sdb_rom(rom_out) #compare_roms(rom_in, rom_out) #print_sdb(rom) #print_sdb_rom(rom_out) #compare_roms(rom_in, rom_out) #print_sdb(rom) #compare_roms(rom_in, rom_out) #rom = sdbc.convert_rom_to_32bit_buffer(rom) | 2.165167 | 2 |
src/TF-gui/tftrain.py | jeetsagar/turbojet | 0 | 2830 | #!python3
import os
import pandas as pd
import tensorflow as tf
from tensorflow.keras import layers
os.environ["CUDA_VISIBLE_DEVICES"] = "0"
# gpu_devices = tf.config.experimental.list_physical_devices("GPU")
# for device in gpu_devices:
# tf.config.experimental.set_memory_growth(device, True)
def trainModel(data_in, params_in):
data_in = data_in.take(2048)
data_in = data_in.shuffle(24)
data_in = data_in.batch(1024)
arch = params_in["Architecture"]
dropout = params_in["Dropout"]
lr = params_in["LearningRate"]
attrs = params_in["Attrs"]
epochs = params_in["Epochs"]
if arch == "BaseCNN":
if params_in["BatchNorm"]:
model = tf.keras.Sequential([
layers.Conv1D(filters=10, kernel_size=5, padding="same", activation="relu", input_shape=(1, 50, attrs)),
layers.Dropout(dropout),
layers.Conv1D(filters=10, kernel_size=5, padding="same", activation="relu"),
layers.Dropout(dropout),
layers.Conv1D(filters=1, kernel_size=5, padding="same", activation="relu"),
layers.Dropout(dropout),
layers.BatchNormalization(),
layers.Flatten(),
layers.Dense(50, "relu"),
layers.Dense(1)
])
else:
model = tf.keras.Sequential([
layers.Conv1D(filters=10, kernel_size=5, padding="same", activation="relu", input_shape=(1, 50, attrs)),
layers.Dropout(dropout),
layers.Conv1D(filters=10, kernel_size=5, padding="same", activation="relu"),
layers.Dropout(dropout),
layers.Conv1D(filters=1, kernel_size=5, padding="same", activation="relu"),
layers.Dropout(dropout),
layers.Flatten(),
layers.Dense(50, "relu"),
layers.Dense(1)
])
elif arch == "CNN-LSTM":
if params_in["BatchNorm"]:
model = tf.keras.Sequential([
layers.Conv1D(filters=10, kernel_size=5, padding="same", activation="relu", input_shape=(1, 50, attrs)),
layers.Dropout(dropout),
layers.Conv1D(filters=10, kernel_size=5, padding="same", activation="relu"),
layers.Dropout(dropout),
layers.Conv1D(filters=1, kernel_size=5, padding="same", activation="relu"),
layers.Dropout(dropout),
layers.BatchNormalization(),
layers.Reshape((5, 10)),
layers.LSTM(30, return_sequences=False),
layers.Dense(50, "relu"),
layers.Dense(1)
])
else:
model = tf.keras.Sequential([
layers.Conv1D(filters=10, kernel_size=5, padding="same", activation="relu", input_shape=(1, 50, attrs)),
layers.Dropout(dropout),
layers.Conv1D(filters=10, kernel_size=5, padding="same", activation="relu"),
layers.Dropout(dropout),
layers.Conv1D(filters=1, kernel_size=5, padding="same", activation="relu"),
layers.Dropout(dropout),
layers.Reshape((5, 10)),
layers.LSTM(30, return_sequences=False),
layers.Dense(50, "relu"),
layers.Dense(1)
])
elif arch == "CNN-2LSTM":
if params_in["BatchNorm"]:
model = tf.keras.Sequential([
layers.Conv1D(filters=10, kernel_size=5, padding="same", activation="relu", input_shape=(1, 50, attrs)),
layers.Dropout(dropout),
layers.Conv1D(filters=10, kernel_size=5, padding="same", activation="relu"),
layers.Dropout(dropout),
layers.Conv1D(filters=1, kernel_size=5, padding="same", activation="relu"),
layers.Dropout(dropout),
layers.BatchNormalization(),
layers.Reshape((5, 10)),
layers.LSTM(30, return_sequences=True),
layers.LSTM(30, return_sequences=False),
layers.Dense(1)
])
else:
model = tf.keras.Sequential([
layers.Conv1D(filters=10, kernel_size=5, padding="same", activation="relu", input_shape=(1, 50, attrs)),
layers.Dropout(dropout),
layers.Conv1D(filters=10, kernel_size=5, padding="same", activation="relu"),
layers.Dropout(dropout),
layers.Conv1D(filters=1, kernel_size=5, padding="same", activation="relu"),
layers.Dropout(dropout),
layers.Reshape((5, 10)),
layers.LSTM(30, return_sequences=True),
layers.LSTM(30, return_sequences=False),
layers.Dense(1)
])
model.compile(loss=tf.losses.MeanSquaredError(), optimizer=tf.optimizers.Adam(learning_rate=lr, amsgrad=True))
filepath = "./checkpoints/Model_in-" + arch + str(attrs) + ".h5"
losses = []
class CustomModelCheckPoint(tf.keras.callbacks.Callback):
def __init__(self, **kargs):
super(CustomModelCheckPoint, self).__init__(**kargs)
self.epoch_loss = {} # accuracy at given epoch
def on_epoch_begin(self, epoch, logs={}):
# Things done on beginning of epoch.
return
def on_epoch_end(self, epoch, logs={}):
# things done on end of the epoch
self.epoch_loss[epoch] = logs.get("loss")
losses.append(self.epoch_loss[epoch])
if params_in["ResumeTraining"]:
model.load_weights(filepath)
checkpoint2 = CustomModelCheckPoint()
checkpoint = tf.keras.callbacks.ModelCheckpoint(filepath, monitor='loss', verbos=0, save_best_only=True,
save_freq='epoch')
model.fit(data_in, epochs=epochs, callbacks=[checkpoint, checkpoint2])
df_loss = pd.DataFrame()
df_loss["Epochs"] = list(range(1, epochs + 1))
df_loss["Loss"] = losses
df_loss.to_csv("./losses/lossTrend.csv", index=False)
| #!python3
import os
import pandas as pd
import tensorflow as tf
from tensorflow.keras import layers
os.environ["CUDA_VISIBLE_DEVICES"] = "0"
# gpu_devices = tf.config.experimental.list_physical_devices("GPU")
# for device in gpu_devices:
# tf.config.experimental.set_memory_growth(device, True)
def trainModel(data_in, params_in):
data_in = data_in.take(2048)
data_in = data_in.shuffle(24)
data_in = data_in.batch(1024)
arch = params_in["Architecture"]
dropout = params_in["Dropout"]
lr = params_in["LearningRate"]
attrs = params_in["Attrs"]
epochs = params_in["Epochs"]
if arch == "BaseCNN":
if params_in["BatchNorm"]:
model = tf.keras.Sequential([
layers.Conv1D(filters=10, kernel_size=5, padding="same", activation="relu", input_shape=(1, 50, attrs)),
layers.Dropout(dropout),
layers.Conv1D(filters=10, kernel_size=5, padding="same", activation="relu"),
layers.Dropout(dropout),
layers.Conv1D(filters=1, kernel_size=5, padding="same", activation="relu"),
layers.Dropout(dropout),
layers.BatchNormalization(),
layers.Flatten(),
layers.Dense(50, "relu"),
layers.Dense(1)
])
else:
model = tf.keras.Sequential([
layers.Conv1D(filters=10, kernel_size=5, padding="same", activation="relu", input_shape=(1, 50, attrs)),
layers.Dropout(dropout),
layers.Conv1D(filters=10, kernel_size=5, padding="same", activation="relu"),
layers.Dropout(dropout),
layers.Conv1D(filters=1, kernel_size=5, padding="same", activation="relu"),
layers.Dropout(dropout),
layers.Flatten(),
layers.Dense(50, "relu"),
layers.Dense(1)
])
elif arch == "CNN-LSTM":
if params_in["BatchNorm"]:
model = tf.keras.Sequential([
layers.Conv1D(filters=10, kernel_size=5, padding="same", activation="relu", input_shape=(1, 50, attrs)),
layers.Dropout(dropout),
layers.Conv1D(filters=10, kernel_size=5, padding="same", activation="relu"),
layers.Dropout(dropout),
layers.Conv1D(filters=1, kernel_size=5, padding="same", activation="relu"),
layers.Dropout(dropout),
layers.BatchNormalization(),
layers.Reshape((5, 10)),
layers.LSTM(30, return_sequences=False),
layers.Dense(50, "relu"),
layers.Dense(1)
])
else:
model = tf.keras.Sequential([
layers.Conv1D(filters=10, kernel_size=5, padding="same", activation="relu", input_shape=(1, 50, attrs)),
layers.Dropout(dropout),
layers.Conv1D(filters=10, kernel_size=5, padding="same", activation="relu"),
layers.Dropout(dropout),
layers.Conv1D(filters=1, kernel_size=5, padding="same", activation="relu"),
layers.Dropout(dropout),
layers.Reshape((5, 10)),
layers.LSTM(30, return_sequences=False),
layers.Dense(50, "relu"),
layers.Dense(1)
])
elif arch == "CNN-2LSTM":
if params_in["BatchNorm"]:
model = tf.keras.Sequential([
layers.Conv1D(filters=10, kernel_size=5, padding="same", activation="relu", input_shape=(1, 50, attrs)),
layers.Dropout(dropout),
layers.Conv1D(filters=10, kernel_size=5, padding="same", activation="relu"),
layers.Dropout(dropout),
layers.Conv1D(filters=1, kernel_size=5, padding="same", activation="relu"),
layers.Dropout(dropout),
layers.BatchNormalization(),
layers.Reshape((5, 10)),
layers.LSTM(30, return_sequences=True),
layers.LSTM(30, return_sequences=False),
layers.Dense(1)
])
else:
model = tf.keras.Sequential([
layers.Conv1D(filters=10, kernel_size=5, padding="same", activation="relu", input_shape=(1, 50, attrs)),
layers.Dropout(dropout),
layers.Conv1D(filters=10, kernel_size=5, padding="same", activation="relu"),
layers.Dropout(dropout),
layers.Conv1D(filters=1, kernel_size=5, padding="same", activation="relu"),
layers.Dropout(dropout),
layers.Reshape((5, 10)),
layers.LSTM(30, return_sequences=True),
layers.LSTM(30, return_sequences=False),
layers.Dense(1)
])
model.compile(loss=tf.losses.MeanSquaredError(), optimizer=tf.optimizers.Adam(learning_rate=lr, amsgrad=True))
filepath = "./checkpoints/Model_in-" + arch + str(attrs) + ".h5"
losses = []
class CustomModelCheckPoint(tf.keras.callbacks.Callback):
def __init__(self, **kargs):
super(CustomModelCheckPoint, self).__init__(**kargs)
self.epoch_loss = {} # accuracy at given epoch
def on_epoch_begin(self, epoch, logs={}):
# Things done on beginning of epoch.
return
def on_epoch_end(self, epoch, logs={}):
# things done on end of the epoch
self.epoch_loss[epoch] = logs.get("loss")
losses.append(self.epoch_loss[epoch])
if params_in["ResumeTraining"]:
model.load_weights(filepath)
checkpoint2 = CustomModelCheckPoint()
checkpoint = tf.keras.callbacks.ModelCheckpoint(filepath, monitor='loss', verbos=0, save_best_only=True,
save_freq='epoch')
model.fit(data_in, epochs=epochs, callbacks=[checkpoint, checkpoint2])
df_loss = pd.DataFrame()
df_loss["Epochs"] = list(range(1, epochs + 1))
df_loss["Loss"] = losses
df_loss.to_csv("./losses/lossTrend.csv", index=False)
| en | 0.639206 | #!python3 # gpu_devices = tf.config.experimental.list_physical_devices("GPU") # for device in gpu_devices: # tf.config.experimental.set_memory_growth(device, True) # accuracy at given epoch # Things done on beginning of epoch. # things done on end of the epoch | 2.538388 | 3 |
library/kong_api.py | sebastienc/ansible-kong-module | 34 | 2831 | <reponame>sebastienc/ansible-kong-module<filename>library/kong_api.py<gh_stars>10-100
#!/usr/bin/python
DOCUMENTATION = '''
---
module: kong
short_description: Configure a Kong API Gateway
'''
EXAMPLES = '''
- name: Register a site
kong:
kong_admin_uri: http://127.0.0.1:8001/apis/
name: "Mockbin"
taget_url: "http://mockbin.com"
request_host: "mockbin.com"
state: present
- name: Delete a site
kong:
kong_admin_uri: http://127.0.0.1:8001/apis/
name: "Mockbin"
state: absent
'''
import json, requests, os
class KongAPI:
def __init__(self, base_url, auth_username=None, auth_password=<PASSWORD>):
self.base_url = base_url
if auth_username is not None and auth_password is not None:
self.auth = (auth_username, auth_password)
else:
self.auth = None
def __url(self, path):
return "{}{}" . format (self.base_url, path)
def _api_exists(self, name, api_list):
for api in api_list:
if name == api.get("name", None):
return True
return False
def add_or_update(self, name, upstream_url, request_host=None, request_path=None, strip_request_path=False, preserve_host=False):
method = "post"
url = self.__url("/apis/")
api_list = self.list().json().get("data", [])
api_exists = self._api_exists(name, api_list)
if api_exists:
method = "patch"
url = "{}{}" . format (url, name)
data = {
"name": name,
"upstream_url": upstream_url,
"strip_request_path": strip_request_path,
"preserve_host": preserve_host
}
if request_host is not None:
data['request_host'] = request_host
if request_path is not None:
data['request_path'] = request_path
return getattr(requests, method)(url, data, auth=self.auth)
def list(self):
url = self.__url("/apis")
return requests.get(url, auth=self.auth)
def info(self, id):
url = self.__url("/apis/{}" . format (id))
return requests.get(url, auth=self.auth)
def delete_by_name(self, name):
info = self.info(name)
id = info.json().get("id")
return self.delete(id)
def delete(self, id):
path = "/apis/{}" . format (id)
url = self.__url(path)
return requests.delete(url, auth=self.auth)
class ModuleHelper:
def __init__(self, fields):
self.fields = fields
def get_module(self):
args = dict(
kong_admin_uri = dict(required=False, type='str'),
kong_admin_username = dict(required=False, type='str'),
kong_admin_password = dict(required=False, type='str'),
name = dict(required=False, type='str'),
upstream_url = dict(required=False, type='str'),
request_host = dict(required=False, type='str'),
request_path = dict(required=False, type='str'),
strip_request_path = dict(required=False, default=False, type='bool'),
preserve_host = dict(required=False, default=False, type='bool'),
state = dict(required=False, default="present", choices=['present', 'absent', 'latest', 'list', 'info'], type='str'),
)
return AnsibleModule(argument_spec=args,supports_check_mode=False)
def prepare_inputs(self, module):
url = module.params['kong_admin_uri']
auth_user = module.params['kong_admin_username']
auth_password = <PASSWORD>.params['<PASSWORD>']
state = module.params['state']
data = {}
for field in self.fields:
value = module.params.get(field, None)
if value is not None:
data[field] = value
return (url, data, state, auth_user, auth_password)
def get_response(self, response, state):
if state == "present":
meta = response.json()
has_changed = response.status_code in [201, 200]
if state == "absent":
meta = {}
has_changed = response.status_code == 204
if state == "list":
meta = response.json()
has_changed = False
return (has_changed, meta)
def main():
fields = [
'name',
'upstream_url',
'request_host',
'request_path',
'strip_request_path',
'preserve_host'
]
helper = ModuleHelper(fields)
global module # might not need this
module = helper.get_module()
base_url, data, state, auth_user, auth_password = helper.prepare_inputs(module)
api = KongAPI(base_url, auth_user, auth_password)
if state == "present":
response = api.add_or_update(**data)
if state == "absent":
response = api.delete_by_name(data.get("name"))
if state == "list":
response = api.list()
if response.status_code == 401:
module.fail_json(msg="Please specify kong_admin_username and kong_admin_password", meta=response.json())
elif response.status_code == 403:
module.fail_json(msg="Please check kong_admin_username and kong_admin_password", meta=response.json())
else:
has_changed, meta = helper.get_response(response, state)
module.exit_json(changed=has_changed, meta=meta)
from ansible.module_utils.basic import *
from ansible.module_utils.urls import *
if __name__ == '__main__':
main()
| #!/usr/bin/python
DOCUMENTATION = '''
---
module: kong
short_description: Configure a Kong API Gateway
'''
EXAMPLES = '''
- name: Register a site
kong:
kong_admin_uri: http://127.0.0.1:8001/apis/
name: "Mockbin"
taget_url: "http://mockbin.com"
request_host: "mockbin.com"
state: present
- name: Delete a site
kong:
kong_admin_uri: http://127.0.0.1:8001/apis/
name: "Mockbin"
state: absent
'''
import json, requests, os
class KongAPI:
def __init__(self, base_url, auth_username=None, auth_password=<PASSWORD>):
self.base_url = base_url
if auth_username is not None and auth_password is not None:
self.auth = (auth_username, auth_password)
else:
self.auth = None
def __url(self, path):
return "{}{}" . format (self.base_url, path)
def _api_exists(self, name, api_list):
for api in api_list:
if name == api.get("name", None):
return True
return False
def add_or_update(self, name, upstream_url, request_host=None, request_path=None, strip_request_path=False, preserve_host=False):
method = "post"
url = self.__url("/apis/")
api_list = self.list().json().get("data", [])
api_exists = self._api_exists(name, api_list)
if api_exists:
method = "patch"
url = "{}{}" . format (url, name)
data = {
"name": name,
"upstream_url": upstream_url,
"strip_request_path": strip_request_path,
"preserve_host": preserve_host
}
if request_host is not None:
data['request_host'] = request_host
if request_path is not None:
data['request_path'] = request_path
return getattr(requests, method)(url, data, auth=self.auth)
def list(self):
url = self.__url("/apis")
return requests.get(url, auth=self.auth)
def info(self, id):
url = self.__url("/apis/{}" . format (id))
return requests.get(url, auth=self.auth)
def delete_by_name(self, name):
info = self.info(name)
id = info.json().get("id")
return self.delete(id)
def delete(self, id):
path = "/apis/{}" . format (id)
url = self.__url(path)
return requests.delete(url, auth=self.auth)
class ModuleHelper:
def __init__(self, fields):
self.fields = fields
def get_module(self):
args = dict(
kong_admin_uri = dict(required=False, type='str'),
kong_admin_username = dict(required=False, type='str'),
kong_admin_password = dict(required=False, type='str'),
name = dict(required=False, type='str'),
upstream_url = dict(required=False, type='str'),
request_host = dict(required=False, type='str'),
request_path = dict(required=False, type='str'),
strip_request_path = dict(required=False, default=False, type='bool'),
preserve_host = dict(required=False, default=False, type='bool'),
state = dict(required=False, default="present", choices=['present', 'absent', 'latest', 'list', 'info'], type='str'),
)
return AnsibleModule(argument_spec=args,supports_check_mode=False)
def prepare_inputs(self, module):
url = module.params['kong_admin_uri']
auth_user = module.params['kong_admin_username']
auth_password = <PASSWORD>.params['<PASSWORD>']
state = module.params['state']
data = {}
for field in self.fields:
value = module.params.get(field, None)
if value is not None:
data[field] = value
return (url, data, state, auth_user, auth_password)
def get_response(self, response, state):
if state == "present":
meta = response.json()
has_changed = response.status_code in [201, 200]
if state == "absent":
meta = {}
has_changed = response.status_code == 204
if state == "list":
meta = response.json()
has_changed = False
return (has_changed, meta)
def main():
fields = [
'name',
'upstream_url',
'request_host',
'request_path',
'strip_request_path',
'preserve_host'
]
helper = ModuleHelper(fields)
global module # might not need this
module = helper.get_module()
base_url, data, state, auth_user, auth_password = helper.prepare_inputs(module)
api = KongAPI(base_url, auth_user, auth_password)
if state == "present":
response = api.add_or_update(**data)
if state == "absent":
response = api.delete_by_name(data.get("name"))
if state == "list":
response = api.list()
if response.status_code == 401:
module.fail_json(msg="Please specify kong_admin_username and kong_admin_password", meta=response.json())
elif response.status_code == 403:
module.fail_json(msg="Please check kong_admin_username and kong_admin_password", meta=response.json())
else:
has_changed, meta = helper.get_response(response, state)
module.exit_json(changed=has_changed, meta=meta)
from ansible.module_utils.basic import *
from ansible.module_utils.urls import *
if __name__ == '__main__':
main() | en | 0.579579 | #!/usr/bin/python --- module: kong short_description: Configure a Kong API Gateway - name: Register a site kong: kong_admin_uri: http://127.0.0.1:8001/apis/ name: "Mockbin" taget_url: "http://mockbin.com" request_host: "mockbin.com" state: present - name: Delete a site kong: kong_admin_uri: http://127.0.0.1:8001/apis/ name: "Mockbin" state: absent # might not need this | 2.311579 | 2 |
src/compas_plotters/artists/lineartist.py | XingxinHE/compas | 0 | 2832 | <reponame>XingxinHE/compas<filename>src/compas_plotters/artists/lineartist.py
from compas_plotters.artists import Artist
from matplotlib.lines import Line2D
from compas.geometry import intersection_line_box_xy
__all__ = ['LineArtist']
class LineArtist(Artist):
""""""
zorder = 1000
def __init__(self, line, draw_points=False, draw_as_segment=False, linewidth=1.0, linestyle='solid', color=(0, 0, 0)):
super(LineArtist, self).__init__(line)
self._mpl_line = None
self._start_artist = None
self._end_artist = None
self._segment_artist = None
self._draw_points = draw_points
self._draw_as_segment = draw_as_segment
self.line = line
self.linewidth = linewidth
self.linestyle = linestyle
self.color = color
def clip(self):
xlim, ylim = self.plotter.viewbox
xmin, xmax = xlim
ymin, ymax = ylim
box = [[xmin, ymin], [xmax, ymin], [xmax, ymax], [xmin, ymax]]
return intersection_line_box_xy(self.line, box)
@property
def data(self):
return [self.line.start[:2], self.line.end[:2]]
def draw(self):
if self._draw_as_segment:
x0, y0 = self.line.start[:2]
x1, y1 = self.line.end[:2]
line2d = Line2D([x0, x1], [y0, y1],
linewidth=self.linewidth,
linestyle=self.linestyle,
color=self.color,
zorder=self.zorder)
self._mpl_line = self.plotter.axes.add_line(line2d)
if self._draw_points:
self._start_artist = self.plotter.add(self.line.start)
self._end_artist = self.plotter.add(self.line.end)
else:
points = self.clip()
if points:
p0, p1 = points
x0, y0 = p0[:2]
x1, y1 = p1[:2]
line2d = Line2D([x0, x1], [y0, y1],
linewidth=self.linewidth,
linestyle=self.linestyle,
color=self.color,
zorder=self.zorder)
self._mpl_line = self.plotter.axes.add_line(line2d)
if self._draw_points:
self._start_artist = self.plotter.add(self.line.start)
self._end_artist = self.plotter.add(self.line.end)
def redraw(self):
if self._draw_as_segment:
x0, y0 = self.line.start[:2]
x1, y1 = self.line.end[:2]
self._mpl_line.set_xdata([x0, x1])
self._mpl_line.set_ydata([y0, y1])
self._mpl_line.set_color(self.color)
self._mpl_line.set_linewidth(self.linewidth)
else:
points = self.clip()
if points:
p0, p1 = points
x0, y0 = p0[:2]
x1, y1 = p1[:2]
self._mpl_line.set_xdata([x0, x1])
self._mpl_line.set_ydata([y0, y1])
self._mpl_line.set_color(self.color)
self._mpl_line.set_linewidth(self.linewidth)
| from compas_plotters.artists import Artist
from matplotlib.lines import Line2D
from compas.geometry import intersection_line_box_xy
__all__ = ['LineArtist']
class LineArtist(Artist):
""""""
zorder = 1000
def __init__(self, line, draw_points=False, draw_as_segment=False, linewidth=1.0, linestyle='solid', color=(0, 0, 0)):
super(LineArtist, self).__init__(line)
self._mpl_line = None
self._start_artist = None
self._end_artist = None
self._segment_artist = None
self._draw_points = draw_points
self._draw_as_segment = draw_as_segment
self.line = line
self.linewidth = linewidth
self.linestyle = linestyle
self.color = color
def clip(self):
xlim, ylim = self.plotter.viewbox
xmin, xmax = xlim
ymin, ymax = ylim
box = [[xmin, ymin], [xmax, ymin], [xmax, ymax], [xmin, ymax]]
return intersection_line_box_xy(self.line, box)
@property
def data(self):
return [self.line.start[:2], self.line.end[:2]]
def draw(self):
if self._draw_as_segment:
x0, y0 = self.line.start[:2]
x1, y1 = self.line.end[:2]
line2d = Line2D([x0, x1], [y0, y1],
linewidth=self.linewidth,
linestyle=self.linestyle,
color=self.color,
zorder=self.zorder)
self._mpl_line = self.plotter.axes.add_line(line2d)
if self._draw_points:
self._start_artist = self.plotter.add(self.line.start)
self._end_artist = self.plotter.add(self.line.end)
else:
points = self.clip()
if points:
p0, p1 = points
x0, y0 = p0[:2]
x1, y1 = p1[:2]
line2d = Line2D([x0, x1], [y0, y1],
linewidth=self.linewidth,
linestyle=self.linestyle,
color=self.color,
zorder=self.zorder)
self._mpl_line = self.plotter.axes.add_line(line2d)
if self._draw_points:
self._start_artist = self.plotter.add(self.line.start)
self._end_artist = self.plotter.add(self.line.end)
def redraw(self):
if self._draw_as_segment:
x0, y0 = self.line.start[:2]
x1, y1 = self.line.end[:2]
self._mpl_line.set_xdata([x0, x1])
self._mpl_line.set_ydata([y0, y1])
self._mpl_line.set_color(self.color)
self._mpl_line.set_linewidth(self.linewidth)
else:
points = self.clip()
if points:
p0, p1 = points
x0, y0 = p0[:2]
x1, y1 = p1[:2]
self._mpl_line.set_xdata([x0, x1])
self._mpl_line.set_ydata([y0, y1])
self._mpl_line.set_color(self.color)
self._mpl_line.set_linewidth(self.linewidth) | none | 1 | 2.650954 | 3 |
|
plot2d_artificial_dataset1_silvq.py | manome/python-silvq | 0 | 2833 | # -*- encoding: utf8 -*-
import numpy as np
from sklearn.metrics import accuracy_score
from sklearn.model_selection import train_test_split
from lvq import SilvqModel
from lvq.utils import plot2d
def main():
# Load dataset
dataset = np.loadtxt('data/artificial_dataset1.csv', delimiter=',')
x = dataset[:, :-1].astype('float64')
y = dataset[:, -1].astype('int64')
# Split dataset into training set and test set
x_train, x_test, y_train, y_test = train_test_split(x, y, test_size=0.2, random_state=3, shuffle=True, stratify=y)
# Generating model
model = SilvqModel(x.shape[1], theta=0.8, bias_type='ls')
# Training the model
model.fit(x_train, y_train, epochs=30)
# Predict the response for test dataset
y_predict = model.predict(x_test)
# Evaluating the model
print('Accuracy: %.3f' %accuracy_score(y_test, y_predict))
# Plot prediction results and prototypes
plot2d(model, x, y, title='Artificial dataset1')
if __name__ == '__main__':
main()
| # -*- encoding: utf8 -*-
import numpy as np
from sklearn.metrics import accuracy_score
from sklearn.model_selection import train_test_split
from lvq import SilvqModel
from lvq.utils import plot2d
def main():
# Load dataset
dataset = np.loadtxt('data/artificial_dataset1.csv', delimiter=',')
x = dataset[:, :-1].astype('float64')
y = dataset[:, -1].astype('int64')
# Split dataset into training set and test set
x_train, x_test, y_train, y_test = train_test_split(x, y, test_size=0.2, random_state=3, shuffle=True, stratify=y)
# Generating model
model = SilvqModel(x.shape[1], theta=0.8, bias_type='ls')
# Training the model
model.fit(x_train, y_train, epochs=30)
# Predict the response for test dataset
y_predict = model.predict(x_test)
# Evaluating the model
print('Accuracy: %.3f' %accuracy_score(y_test, y_predict))
# Plot prediction results and prototypes
plot2d(model, x, y, title='Artificial dataset1')
if __name__ == '__main__':
main()
| en | 0.795133 | # -*- encoding: utf8 -*- # Load dataset # Split dataset into training set and test set # Generating model # Training the model # Predict the response for test dataset # Evaluating the model # Plot prediction results and prototypes | 3.303898 | 3 |
classification_experiments/Fine-Tuned-ResNet-50/Fine-Tuned-ResNet-50.py | ifr1m/hyper-kvasir | 38 | 2834 | #!/usr/bin/env python
# coding: utf-8
# In[ ]:
#Importing all required libraries
# In[ ]:
from __future__ import absolute_import, division, print_function, unicode_literals
# In[ ]:
#Checking for correct cuda and tf versions
from tensorflow.python.platform import build_info as tf_build_info
print(tf_build_info.cuda_version_number)
# 9.0 in v1.10.0
print(tf_build_info.cudnn_version_number)
# 7 in v1.10.0
# In[ ]:
import tensorflow as tf
import pathlib
from tensorflow.keras.models import Sequential
from tensorflow.keras.layers import Dense, Conv2D, Flatten, Dropout, MaxPooling2D
from tensorflow.keras.preprocessing.image import ImageDataGenerator
import os
import numpy as np
import matplotlib.pyplot as plt
# In[ ]:
AUTOTUNE = tf.data.experimental.AUTOTUNE
# In[ ]:
import IPython.display as display
from PIL import Image
import numpy as np
import matplotlib.pyplot as plt
import os
# In[ ]:
tf.__version__
# In[ ]:
#Train and test data folder
train_data_dir = "\\hyper-kvasir\\splits\\all\\1"
test_data_dir = "\\hyper-kvasir\\splits\\all\\0"
# In[ ]:
train_data_dir = pathlib.Path(train_data_dir)
test_data_dir = pathlib.Path(test_data_dir)
# In[ ]:
#count how many images are there
image_count = len(list(train_data_dir.glob('*/*.jpg')))
image_count
# In[ ]:
total_train = len(list(train_data_dir.glob('*/*.jpg')))
total_val = len(list(test_data_dir.glob('*/*.jpg')))
# In[ ]:
#get the class names
CLASS_NAMES = np.array([item.name for item in train_data_dir.glob('*') if item.name != "LICENSE.txt"])
CLASS_NAMES
# In[ ]:
#Define parameter for training
batch_size = 32
IMG_HEIGHT = 224
IMG_WIDTH = 224
STEPS_PER_EPOCH = np.ceil(image_count/batch_size)
epochs = 8
num_classes = len(CLASS_NAMES) #23
# In[ ]:
#We use image data generators to load the images and prepare them for the training
train_image_generator = ImageDataGenerator() # Generator for our training data
validation_image_generator = ImageDataGenerator() # Generator for our validation data
train_data_gen = train_image_generator.flow_from_directory(directory=str(train_data_dir),
batch_size=batch_size,
shuffle=True,
target_size=(IMG_HEIGHT, IMG_WIDTH),
classes = list(CLASS_NAMES),
class_mode='categorical'
)
val_data_gen = validation_image_generator.flow_from_directory(directory=str(test_data_dir),
batch_size=batch_size,
shuffle=True,
target_size=(IMG_HEIGHT, IMG_WIDTH),
class_mode='categorical',
classes = list(CLASS_NAMES)
)
#get class order from directories
print(train_data_gen.class_indices.keys())
print(val_data_gen.class_indices.keys())
# In[ ]:
IMG_SIZE = 224
IMG_SHAPE = (IMG_SIZE, IMG_SIZE, 3)
# base model from the pre-trained model. Resnet 50 in this case
base_model = tf.keras.applications.ResNet50(input_shape=IMG_SHAPE,
include_top=False,
weights='imagenet')
base_model.trainable = False
# In[ ]:
#add new classification layer
x = base_model.output
x = tf.keras.layers.GlobalAveragePooling2D()(x)
x = tf.keras.layers.Dense(num_classes,activation='softmax')(x)
model = tf.keras.models.Model(inputs=base_model.input, outputs=x)
base_learning_rate = 0.001
model.compile(optimizer=tf.keras.optimizers.Adam(lr=base_learning_rate),
loss='categorical_crossentropy',
metrics=['accuracy'])
# In[ ]:
#fit the model
history = model.fit_generator(
train_data_gen,
steps_per_epoch=total_train // batch_size,
epochs=epochs,
validation_data=val_data_gen,
validation_steps=total_val // batch_size
)
# In[ ]:
#create training plots
history
acc = history.history['accuracy']
val_acc = history.history['val_accuracy']
loss = history.history['loss']
val_loss = history.history['val_loss']
epochs_range = range(epochs)
plt.figure(figsize=(8, 8))
plt.subplot(1, 2, 1)
plt.plot(epochs_range, acc, label='Training Accuracy')
plt.plot(epochs_range, val_acc, label='Validation Accuracy')
plt.legend(loc='lower right')
plt.title('Training and Validation Accuracy')
plt.subplot(1, 2, 2)
plt.plot(epochs_range, loss, label='Training Loss')
plt.plot(epochs_range, val_loss, label='Validation Loss')
plt.legend(loc='upper right')
plt.title('Training and Validation Loss')
plt.show()
# In[ ]:
base_model.trainable = True #now we want to train the base model
# In[ ]:
# How many layers are in the base model
print("Layers base model: ", len(base_model.layers))
# Fine tune from layer x
fine_tune_at = 100
# Freeze all the layers before the fine tune starting layer
for layer in base_model.layers[:fine_tune_at]:
layer.trainable = False
# In[ ]:
model.compile(loss='categorical_crossentropy',
optimizer = tf.keras.optimizers.RMSprop(lr=base_learning_rate/10),
metrics=['accuracy'])
# In[ ]:
model.summary()
# In[ ]:
#Fine tune step
initial_epochs = 7
fine_tune_epochs = 3
total_epochs = initial_epochs + fine_tune_epochs
train_batches = total_train // batch_size
print(total_val // batch_size)
validation_batches = total_val // batch_size
history_fine = model.fit_generator(
train_data_gen,
steps_per_epoch=total_train // batch_size,
epochs=total_epochs,
initial_epoch = history.epoch[-1],
validation_data=val_data_gen,
validation_steps=total_val // batch_size
)
# In[ ]:
acc += history_fine.history['accuracy']
val_acc += history_fine.history['val_accuracy']
loss += history_fine.history['loss']
val_loss += history_fine.history['val_loss']
# In[ ]:
#Plot fine tuning
plt.figure(figsize=(8, 8))
plt.subplot(2, 1, 1)
plt.plot(acc, label='Training Accuracy')
plt.plot(val_acc, label='Validation Accuracy')
plt.ylim([0.8, 1])
plt.plot([initial_epochs-1,initial_epochs-1],
plt.ylim(), label='Start Fine Tuning')
plt.legend(loc='lower right')
plt.title('Training and Validation Accuracy')
plt.subplot(2, 1, 2)
plt.plot(loss, label='Training Loss')
plt.plot(val_loss, label='Validation Loss')
plt.ylim([0, 1.0])
plt.plot([initial_epochs-1,initial_epochs-1],
plt.ylim(), label='Start Fine Tuning')
plt.legend(loc='upper right')
plt.title('Training and Validation Loss')
plt.xlabel('epoch')
plt.show()
# In[ ]:
#model save and load
import os
# In[ ]:
#some time stamp
from datetime import datetime
# current date and time.
now = datetime.now()
timestamp = datetime.timestamp(now)
print("timestamp =", timestamp)
# In[ ]:
mode_filename = str(timestamp)+'mymodel.h5'
model.save(model_filename)
# In[ ]:
#To apply the model on new data
new_model = tf.keras.models.load_model(model_filename)
# Show the model architecture
new_model.summary()
# In[ ]:
from tensorflow.keras.preprocessing import image
#image directory containing images to test
img_dir="\\polyps"
for i,img in enumerate(os.listdir(img_dir)):
tmpimage = image.load_img(os.path.join(img_dir,img), target_size=(IMG_SIZE,IMG_SIZE))
tmpimage = np.expand_dims(tmpimage, axis=0).astype('float32')
result_class=new_model.predict(tmpimage)
print(img,";",CLASS_NAMES[result_class.argmax(axis=-1)])
| #!/usr/bin/env python
# coding: utf-8
# In[ ]:
#Importing all required libraries
# In[ ]:
from __future__ import absolute_import, division, print_function, unicode_literals
# In[ ]:
#Checking for correct cuda and tf versions
from tensorflow.python.platform import build_info as tf_build_info
print(tf_build_info.cuda_version_number)
# 9.0 in v1.10.0
print(tf_build_info.cudnn_version_number)
# 7 in v1.10.0
# In[ ]:
import tensorflow as tf
import pathlib
from tensorflow.keras.models import Sequential
from tensorflow.keras.layers import Dense, Conv2D, Flatten, Dropout, MaxPooling2D
from tensorflow.keras.preprocessing.image import ImageDataGenerator
import os
import numpy as np
import matplotlib.pyplot as plt
# In[ ]:
AUTOTUNE = tf.data.experimental.AUTOTUNE
# In[ ]:
import IPython.display as display
from PIL import Image
import numpy as np
import matplotlib.pyplot as plt
import os
# In[ ]:
tf.__version__
# In[ ]:
#Train and test data folder
train_data_dir = "\\hyper-kvasir\\splits\\all\\1"
test_data_dir = "\\hyper-kvasir\\splits\\all\\0"
# In[ ]:
train_data_dir = pathlib.Path(train_data_dir)
test_data_dir = pathlib.Path(test_data_dir)
# In[ ]:
#count how many images are there
image_count = len(list(train_data_dir.glob('*/*.jpg')))
image_count
# In[ ]:
total_train = len(list(train_data_dir.glob('*/*.jpg')))
total_val = len(list(test_data_dir.glob('*/*.jpg')))
# In[ ]:
#get the class names
CLASS_NAMES = np.array([item.name for item in train_data_dir.glob('*') if item.name != "LICENSE.txt"])
CLASS_NAMES
# In[ ]:
#Define parameter for training
batch_size = 32
IMG_HEIGHT = 224
IMG_WIDTH = 224
STEPS_PER_EPOCH = np.ceil(image_count/batch_size)
epochs = 8
num_classes = len(CLASS_NAMES) #23
# In[ ]:
#We use image data generators to load the images and prepare them for the training
train_image_generator = ImageDataGenerator() # Generator for our training data
validation_image_generator = ImageDataGenerator() # Generator for our validation data
train_data_gen = train_image_generator.flow_from_directory(directory=str(train_data_dir),
batch_size=batch_size,
shuffle=True,
target_size=(IMG_HEIGHT, IMG_WIDTH),
classes = list(CLASS_NAMES),
class_mode='categorical'
)
val_data_gen = validation_image_generator.flow_from_directory(directory=str(test_data_dir),
batch_size=batch_size,
shuffle=True,
target_size=(IMG_HEIGHT, IMG_WIDTH),
class_mode='categorical',
classes = list(CLASS_NAMES)
)
#get class order from directories
print(train_data_gen.class_indices.keys())
print(val_data_gen.class_indices.keys())
# In[ ]:
IMG_SIZE = 224
IMG_SHAPE = (IMG_SIZE, IMG_SIZE, 3)
# base model from the pre-trained model. Resnet 50 in this case
base_model = tf.keras.applications.ResNet50(input_shape=IMG_SHAPE,
include_top=False,
weights='imagenet')
base_model.trainable = False
# In[ ]:
#add new classification layer
x = base_model.output
x = tf.keras.layers.GlobalAveragePooling2D()(x)
x = tf.keras.layers.Dense(num_classes,activation='softmax')(x)
model = tf.keras.models.Model(inputs=base_model.input, outputs=x)
base_learning_rate = 0.001
model.compile(optimizer=tf.keras.optimizers.Adam(lr=base_learning_rate),
loss='categorical_crossentropy',
metrics=['accuracy'])
# In[ ]:
#fit the model
history = model.fit_generator(
train_data_gen,
steps_per_epoch=total_train // batch_size,
epochs=epochs,
validation_data=val_data_gen,
validation_steps=total_val // batch_size
)
# In[ ]:
#create training plots
history
acc = history.history['accuracy']
val_acc = history.history['val_accuracy']
loss = history.history['loss']
val_loss = history.history['val_loss']
epochs_range = range(epochs)
plt.figure(figsize=(8, 8))
plt.subplot(1, 2, 1)
plt.plot(epochs_range, acc, label='Training Accuracy')
plt.plot(epochs_range, val_acc, label='Validation Accuracy')
plt.legend(loc='lower right')
plt.title('Training and Validation Accuracy')
plt.subplot(1, 2, 2)
plt.plot(epochs_range, loss, label='Training Loss')
plt.plot(epochs_range, val_loss, label='Validation Loss')
plt.legend(loc='upper right')
plt.title('Training and Validation Loss')
plt.show()
# In[ ]:
base_model.trainable = True #now we want to train the base model
# In[ ]:
# How many layers are in the base model
print("Layers base model: ", len(base_model.layers))
# Fine tune from layer x
fine_tune_at = 100
# Freeze all the layers before the fine tune starting layer
for layer in base_model.layers[:fine_tune_at]:
layer.trainable = False
# In[ ]:
model.compile(loss='categorical_crossentropy',
optimizer = tf.keras.optimizers.RMSprop(lr=base_learning_rate/10),
metrics=['accuracy'])
# In[ ]:
model.summary()
# In[ ]:
#Fine tune step
initial_epochs = 7
fine_tune_epochs = 3
total_epochs = initial_epochs + fine_tune_epochs
train_batches = total_train // batch_size
print(total_val // batch_size)
validation_batches = total_val // batch_size
history_fine = model.fit_generator(
train_data_gen,
steps_per_epoch=total_train // batch_size,
epochs=total_epochs,
initial_epoch = history.epoch[-1],
validation_data=val_data_gen,
validation_steps=total_val // batch_size
)
# In[ ]:
acc += history_fine.history['accuracy']
val_acc += history_fine.history['val_accuracy']
loss += history_fine.history['loss']
val_loss += history_fine.history['val_loss']
# In[ ]:
#Plot fine tuning
plt.figure(figsize=(8, 8))
plt.subplot(2, 1, 1)
plt.plot(acc, label='Training Accuracy')
plt.plot(val_acc, label='Validation Accuracy')
plt.ylim([0.8, 1])
plt.plot([initial_epochs-1,initial_epochs-1],
plt.ylim(), label='Start Fine Tuning')
plt.legend(loc='lower right')
plt.title('Training and Validation Accuracy')
plt.subplot(2, 1, 2)
plt.plot(loss, label='Training Loss')
plt.plot(val_loss, label='Validation Loss')
plt.ylim([0, 1.0])
plt.plot([initial_epochs-1,initial_epochs-1],
plt.ylim(), label='Start Fine Tuning')
plt.legend(loc='upper right')
plt.title('Training and Validation Loss')
plt.xlabel('epoch')
plt.show()
# In[ ]:
#model save and load
import os
# In[ ]:
#some time stamp
from datetime import datetime
# current date and time.
now = datetime.now()
timestamp = datetime.timestamp(now)
print("timestamp =", timestamp)
# In[ ]:
mode_filename = str(timestamp)+'mymodel.h5'
model.save(model_filename)
# In[ ]:
#To apply the model on new data
new_model = tf.keras.models.load_model(model_filename)
# Show the model architecture
new_model.summary()
# In[ ]:
from tensorflow.keras.preprocessing import image
#image directory containing images to test
img_dir="\\polyps"
for i,img in enumerate(os.listdir(img_dir)):
tmpimage = image.load_img(os.path.join(img_dir,img), target_size=(IMG_SIZE,IMG_SIZE))
tmpimage = np.expand_dims(tmpimage, axis=0).astype('float32')
result_class=new_model.predict(tmpimage)
print(img,";",CLASS_NAMES[result_class.argmax(axis=-1)])
| en | 0.699921 | #!/usr/bin/env python # coding: utf-8 # In[ ]: #Importing all required libraries # In[ ]: # In[ ]: #Checking for correct cuda and tf versions # 9.0 in v1.10.0 # 7 in v1.10.0 # In[ ]: # In[ ]: # In[ ]: # In[ ]: # In[ ]: #Train and test data folder # In[ ]: # In[ ]: #count how many images are there # In[ ]: # In[ ]: #get the class names # In[ ]: #Define parameter for training #23 # In[ ]: #We use image data generators to load the images and prepare them for the training # Generator for our training data # Generator for our validation data #get class order from directories # In[ ]: # base model from the pre-trained model. Resnet 50 in this case # In[ ]: #add new classification layer # In[ ]: #fit the model # In[ ]: #create training plots # In[ ]: #now we want to train the base model # In[ ]: # How many layers are in the base model # Fine tune from layer x # Freeze all the layers before the fine tune starting layer # In[ ]: # In[ ]: # In[ ]: #Fine tune step # In[ ]: # In[ ]: #Plot fine tuning # In[ ]: #model save and load # In[ ]: #some time stamp # current date and time. # In[ ]: # In[ ]: #To apply the model on new data # Show the model architecture # In[ ]: #image directory containing images to test | 2.465904 | 2 |
tools/android/android_tools.gyp | SlimKatLegacy/android_external_chromium_org | 2 | 2835 | <reponame>SlimKatLegacy/android_external_chromium_org
# Copyright (c) 2012 The Chromium Authors. All rights reserved.
# Use of this source code is governed by a BSD-style license that can be
# found in the LICENSE file.
{
'targets': [
# Intermediate target grouping the android tools needed to run native
# unittests and instrumentation test apks.
{
'target_name': 'android_tools',
'type': 'none',
'dependencies': [
'adb_reboot/adb_reboot.gyp:adb_reboot',
'forwarder2/forwarder.gyp:forwarder2',
'md5sum/md5sum.gyp:md5sum',
'purge_ashmem/purge_ashmem.gyp:purge_ashmem',
],
},
{
'target_name': 'memdump',
'type': 'none',
'dependencies': [
'memdump/memdump.gyp:memdump',
],
},
{
'target_name': 'memconsumer',
'type': 'none',
'dependencies': [
'memconsumer/memconsumer.gyp:memconsumer',
],
},
],
}
| # Copyright (c) 2012 The Chromium Authors. All rights reserved.
# Use of this source code is governed by a BSD-style license that can be
# found in the LICENSE file.
{
'targets': [
# Intermediate target grouping the android tools needed to run native
# unittests and instrumentation test apks.
{
'target_name': 'android_tools',
'type': 'none',
'dependencies': [
'adb_reboot/adb_reboot.gyp:adb_reboot',
'forwarder2/forwarder.gyp:forwarder2',
'md5sum/md5sum.gyp:md5sum',
'purge_ashmem/purge_ashmem.gyp:purge_ashmem',
],
},
{
'target_name': 'memdump',
'type': 'none',
'dependencies': [
'memdump/memdump.gyp:memdump',
],
},
{
'target_name': 'memconsumer',
'type': 'none',
'dependencies': [
'memconsumer/memconsumer.gyp:memconsumer',
],
},
],
} | en | 0.85756 | # Copyright (c) 2012 The Chromium Authors. All rights reserved. # Use of this source code is governed by a BSD-style license that can be # found in the LICENSE file. # Intermediate target grouping the android tools needed to run native # unittests and instrumentation test apks. | 1.2835 | 1 |
test/functional/fantasygold_opcall.py | FantasyGold/FantasyGold-Core | 13 | 2836 | <reponame>FantasyGold/FantasyGold-Core
#!/usr/bin/env python3
# Copyright (c) 2015-2016 The Bitcoin Core developers
# Distributed under the MIT software license, see the accompanying
# file COPYING or http://www.opensource.org/licenses/mit-license.php.
from test_framework.test_framework import BitcoinTestFramework
from test_framework.util import *
from test_framework.script import *
from test_framework.mininode import *
from test_framework.fantasygold import *
from test_framework.fantasygoldconfig import *
import sys
class OpCallTest(BitcoinTestFramework):
def set_test_params(self):
self.setup_clean_chain = True
self.num_nodes = 2
self.extra_args = [['-txindex=1']]*2
def send_one_op_call_tx_with_counter_check(self, outputs, counter_should_increase_by=0, input_value=500000000, should_throw=False):
# 61bc221a counter()
old_out = int(self.node.callcontract(self.contract_address, "61bc221a")['executionResult']['output'], 16)
inpt = make_vin(self.node, input_value)
tx = make_transaction(self.node, [inpt], outputs)
if should_throw:
try:
self.node.sendrawtransaction(tx)
assert(False)
except JSONRPCException as e:
print(e)
pass
else:
self.node.sendrawtransaction(tx)
self.node.generate(1)
sync_blocks(self.nodes)
for i in range(2):
# 61bc221a counter()
out = int(self.nodes[i].callcontract(self.contract_address, "61bc221a")['executionResult']['output'], 16)
assert(out-old_out == counter_should_increase_by)
def send_multiple_op_call_txs_with_counter_check(self, num_txs, outputs, counter_should_increase_by):
# 61bc221a counter()
old_out = int(self.node.callcontract(self.contract_address, "61bc221a")['executionResult']['output'], 16)
i = 0
unspents = self.node.listunspent()
while i < num_txs and len(unspents) > 0:
# Select as input a tx which has at least 5 fantasygold spendable
for tx_i in range(len(unspents)):
if int(unspents[tx_i]['amount']*COIN) == 1000000*FGC_MIN_GAS_PRICE and unspents[tx_i]['spendable']:
break
else:
assert(False)
inpt = CTxIn(COutPoint(int(unspents[tx_i]['txid'], 16), unspents[tx_i]['vout']), nSequence=0)
tx = make_transaction(self.node, [inpt], outputs)
txid = self.node.sendrawtransaction(tx)
unspents = self.node.listunspent()
i += 1
self.node.generate(1)
sync_blocks(self.nodes)
for i in range(2):
# 61bc221a counter()
out = int(self.nodes[i].callcontract(self.contract_address, "61bc221a")['executionResult']['output'], 16)
assert(out-old_out == counter_should_increase_by)
# Deploy the testing contract
def create_contract_test(self):
"""
pragma solidity ^0.4.10;
contract Example {
uint public counter;
function inc() public {
counter += 1;
}
function getBalance() public {
return this.balance;
}
}
"""
contract_data = self.node.createcontract("6060604052341561000c57fe5b5b61011e8061001c6000396000f30060606040526000357c0100000000000000000000000000000000000000000000000000000000900463ffffffff16806312065fe0146058578063371303c014607b57806361bc221a14608a578063d0e30db01460ad575bfe5b3415605f57fe5b606560b5565b6040518082815260200191505060405180910390f35b3415608257fe5b608860d5565b005b3415609157fe5b609760e9565b6040518082815260200191505060405180910390f35b60b360ef565b005b60003073ffffffffffffffffffffffffffffffffffffffff163190505b90565b60016000600082825401925050819055505b565b60005481565b5b5600a165627a7a72305820fe93d8cc66557a2a6c8347f481f6d334402a7f90f8b2288668a874c34416a4dc0029", 1000000)
self.contract_address = contract_data['address']
block_height = self.node.getblockcount()
self.node.generate(1)
sync_blocks(self.nodes)
for i in range(2):
assert(self.nodes[i].getblockcount() == block_height+1)
assert(len(self.nodes[i].listcontracts()) == 1+NUM_DEFAULT_DGP_CONTRACTS)
# Sends a tx containing 2 op_call outputs calling inc()
def many_calls_in_same_tx_test(self):
outputs = []
outputs.append(make_op_call_output(0, b"\x04", CScriptNum(1000000), CScriptNum(FGC_MIN_GAS_PRICE), bytes.fromhex("371303c0"), bytes.fromhex(self.contract_address)))
outputs.append(make_op_call_output(0, b"\x04", CScriptNum(1000000), CScriptNum(FGC_MIN_GAS_PRICE), bytes.fromhex("371303c0"), bytes.fromhex(self.contract_address)))
self.send_one_op_call_tx_with_counter_check(outputs, counter_should_increase_by=2, input_value=2*1000000*FGC_MIN_GAS_PRICE)
# Sends a normal raw op_call tx with a single output.
def normal_op_call_output_test(self):
outputs = []
outputs.append(make_op_call_output(0, b"\x04", b"\xff\x7f", CScriptNum(FGC_MIN_GAS_PRICE), bytes.fromhex("371303c0"), bytes.fromhex(self.contract_address)))
self.send_one_op_call_tx_with_counter_check(outputs, counter_should_increase_by=1, input_value=0x7fff*FGC_MIN_GAS_PRICE)
# Sends a tx containing 1 op_call output where txfee == gas_price*gas_limit.
def gas_equal_to_tx_fee_test(self):
outputs = []
outputs.append(make_op_call_output(0, b"\x04", CScriptNum(1000000), CScriptNum(FGC_MIN_GAS_PRICE), bytes.fromhex("371303c0"), bytes.fromhex(self.contract_address)))
self.send_one_op_call_tx_with_counter_check(outputs, counter_should_increase_by=1, input_value=1000000*FGC_MIN_GAS_PRICE)
# Sends a tx containing 1 op_call output where txfee < gas_price*gas_limit.
def gas_exceeding_tx_fee_100001_1_test(self):
outputs = []
outputs.append(make_op_call_output(0, b"\x04", CScriptNum(10000001), CScriptNum(FGC_MIN_GAS_PRICE), bytes.fromhex("371303c0"), bytes.fromhex(self.contract_address)))
self.send_one_op_call_tx_with_counter_check(outputs, input_value=1000001*FGC_MIN_GAS_PRICE-1, should_throw=True)
# Sends a tx containing 1 op_call output where txfee < gas_price*gas_limit.
def gas_exceeding_tx_fee_100001_2_test(self):
outputs = []
outputs.append(make_op_call_output(0, b"\x04", CScriptNum(1000001), CScriptNum(FGC_MIN_GAS_PRICE), bytes.fromhex("371303c0"), bytes.fromhex(self.contract_address)))
self.send_one_op_call_tx_with_counter_check(outputs, input_value=1000000*FGC_MIN_GAS_PRICE, should_throw=True)
# Sends a tx containing 2 op_call outputs that has a combined gas_price*gas_limit exceeding the tx fee.
# This tx should be rejected since executing such a tx would be unable to pay for its potential execution costs in the same way as a tx with one output where txfee < gas_price*gas_limit.
def two_calls_in_same_tx_exceeding_tx_fee_test(self):
outputs = []
outputs.append(make_op_call_output(0, b"\x04", CScriptNum(1000000), CScriptNum(FGC_MIN_GAS_PRICE), bytes.fromhex("371303c0"), bytes.fromhex(self.contract_address)))
outputs.append(make_op_call_output(0, b"\x04", CScriptNum(1000000), CScriptNum(FGC_MIN_GAS_PRICE), bytes.fromhex("371303c0"), bytes.fromhex(self.contract_address)))
self.send_one_op_call_tx_with_counter_check(outputs, input_value=2000000*FGC_MIN_GAS_PRICE-1, should_throw=True)
# sends a tx containing 1 op_call output with a (if interpreted with a signed integer) negative gas limit calling inc()
def gas_limit_signedness_test(self):
outputs = []
gas_limit = b"\xff"
while len(gas_limit) < 20:
outputs.append(make_op_call_output(0, b"\x04", gas_limit, CScriptNum(FGC_MIN_GAS_PRICE), bytes.fromhex("371303c0"), bytes.fromhex(self.contract_address)))
self.send_one_op_call_tx_with_counter_check(outputs, should_throw=True, input_value=min(max(int(bytes_to_hex_str(gas_limit), 16)*FGC_MIN_GAS_PRICE, 10000000), 1000000000))
gas_limit += b"\xff"
# sends a tx containing 1 op_call output with a (if interpreted with a signed integer) negative gas limit calling inc()
def gas_limit_signedness_one_valid_test(self):
outputs = []
gas_limit = b"\xff"
outputs.append(make_op_call_output(0, b"\x04", b"\xff\xff\x00", CScriptNum(FGC_MIN_GAS_PRICE), bytes.fromhex("371303c0"), bytes.fromhex(self.contract_address)))
outputs.append(make_op_call_output(0, b"\x04", b"\xff\xff", CScriptNum(FGC_MIN_GAS_PRICE), bytes.fromhex("371303c0"), bytes.fromhex(self.contract_address)))
self.send_one_op_call_tx_with_counter_check(outputs, should_throw=True, input_value=2*0xffff*FGC_MIN_GAS_PRICE)
# sends a tx containing 1 op_call output with a (if interpreted with a signed integer) negative gas price calling inc()
def gas_price_signedness_test(self):
outputs = []
outputs.append(make_op_call_output(0, b"\x04", b"\x01\x00", b"\xff\xff", bytes.fromhex("371303c0"), bytes.fromhex(self.contract_address)))
self.send_one_op_call_tx_with_counter_check(outputs, should_throw=True, input_value=10000000)
# sends a tx containing 1 op_call output with a possible negative gas limit and price calling inc()
def gas_limit_and_price_signedness_test(self):
outputs = []
outputs.append(make_op_call_output(0, b"\x04", b"\xff\xff", b"\xff", bytes.fromhex("371303c0"), bytes.fromhex(self.contract_address)))
self.send_one_op_call_tx_with_counter_check(outputs, should_throw=True, input_value=0xff*0xffff)
# Sends 100 valid op_call txs
def send_100_txs_test(self):
outputs = []
outputs.append(make_op_call_output(0, b"\x04", CScriptNum(1000000), CScriptNum(FGC_MIN_GAS_PRICE), bytes.fromhex("371303c0"), bytes.fromhex(self.contract_address)))
self.send_multiple_op_call_txs_with_counter_check(100, outputs, 100)
def send_tx_with_value_test(self):
outputs = []
# d0e30db0 deposit()
outputs.append(make_op_call_output(100000000, b"\x04", CScriptNum(1000000), CScriptNum(FGC_MIN_GAS_PRICE), bytes.fromhex("d0e30db0"), bytes.fromhex(self.contract_address)))
self.send_one_op_call_tx_with_counter_check(outputs, counter_should_increase_by=0, input_value=100000000+1000000*FGC_MIN_GAS_PRICE)
# 12065fe0 getBalance()
balance = int(self.node.callcontract(self.contract_address, "12065fe0")['executionResult']['output'], 16)
assert(balance == 100000000)
def run_test(self):
self.node = self.nodes[0]
connect_nodes(self.nodes[0], 1)
self.nodes[0].generate(200+COINBASE_MATURITY)
self.node.sendmany("", {self.node.getnewaddress(): 1000000*FGC_MIN_GAS_PRICE / Decimal('100000000') for i in range(200)})
print("Creating contract")
self.create_contract_test()
print("Calling inc() in two outputs")
self.many_calls_in_same_tx_test()
print("Calling inc() in one output")
self.normal_op_call_output_test()
print("Calling inc() in one output with txfee equal to gas_limit*gas_price")
self.gas_equal_to_tx_fee_test()
print("Calling inc() in one output with txfee < gas_limit*gas_price")
self.gas_exceeding_tx_fee_100001_1_test()
print("Second test of inc() in one outputs with txfee < gas_limit*gas_price")
self.gas_exceeding_tx_fee_100001_2_test()
print("Second test of inc() in one output with txfee < gas_limit*gas_price")
self.two_calls_in_same_tx_exceeding_tx_fee_test()
print("Mining a block with 100 txs each with an output calling inc()")
self.send_100_txs_test()
print("Checking that the value of txs are correctly updated")
self.send_tx_with_value_test()
print("Checking gas limit signedness where one tx is valid")
self.gas_limit_signedness_one_valid_test()
print("Checking gas limit signedness")
self.gas_limit_signedness_test()
print("Checking gas price signedness")
self.gas_price_signedness_test()
print("Checking gas limit and gas price signedness")
self.gas_limit_and_price_signedness_test()
if __name__ == '__main__':
OpCallTest().main() | #!/usr/bin/env python3
# Copyright (c) 2015-2016 The Bitcoin Core developers
# Distributed under the MIT software license, see the accompanying
# file COPYING or http://www.opensource.org/licenses/mit-license.php.
from test_framework.test_framework import BitcoinTestFramework
from test_framework.util import *
from test_framework.script import *
from test_framework.mininode import *
from test_framework.fantasygold import *
from test_framework.fantasygoldconfig import *
import sys
class OpCallTest(BitcoinTestFramework):
def set_test_params(self):
self.setup_clean_chain = True
self.num_nodes = 2
self.extra_args = [['-txindex=1']]*2
def send_one_op_call_tx_with_counter_check(self, outputs, counter_should_increase_by=0, input_value=500000000, should_throw=False):
# 61bc221a counter()
old_out = int(self.node.callcontract(self.contract_address, "61bc221a")['executionResult']['output'], 16)
inpt = make_vin(self.node, input_value)
tx = make_transaction(self.node, [inpt], outputs)
if should_throw:
try:
self.node.sendrawtransaction(tx)
assert(False)
except JSONRPCException as e:
print(e)
pass
else:
self.node.sendrawtransaction(tx)
self.node.generate(1)
sync_blocks(self.nodes)
for i in range(2):
# 61bc221a counter()
out = int(self.nodes[i].callcontract(self.contract_address, "61bc221a")['executionResult']['output'], 16)
assert(out-old_out == counter_should_increase_by)
def send_multiple_op_call_txs_with_counter_check(self, num_txs, outputs, counter_should_increase_by):
# 61bc221a counter()
old_out = int(self.node.callcontract(self.contract_address, "61bc221a")['executionResult']['output'], 16)
i = 0
unspents = self.node.listunspent()
while i < num_txs and len(unspents) > 0:
# Select as input a tx which has at least 5 fantasygold spendable
for tx_i in range(len(unspents)):
if int(unspents[tx_i]['amount']*COIN) == 1000000*FGC_MIN_GAS_PRICE and unspents[tx_i]['spendable']:
break
else:
assert(False)
inpt = CTxIn(COutPoint(int(unspents[tx_i]['txid'], 16), unspents[tx_i]['vout']), nSequence=0)
tx = make_transaction(self.node, [inpt], outputs)
txid = self.node.sendrawtransaction(tx)
unspents = self.node.listunspent()
i += 1
self.node.generate(1)
sync_blocks(self.nodes)
for i in range(2):
# 61bc221a counter()
out = int(self.nodes[i].callcontract(self.contract_address, "61bc221a")['executionResult']['output'], 16)
assert(out-old_out == counter_should_increase_by)
# Deploy the testing contract
def create_contract_test(self):
"""
pragma solidity ^0.4.10;
contract Example {
uint public counter;
function inc() public {
counter += 1;
}
function getBalance() public {
return this.balance;
}
}
"""
contract_data = self.node.createcontract("6060604052341561000c57fe5b5b61011e8061001c6000396000f30060606040526000357c0100000000000000000000000000000000000000000000000000000000900463ffffffff16806312065fe0146058578063371303c014607b57806361bc221a14608a578063d0e30db01460ad575bfe5b3415605f57fe5b606560b5565b6040518082815260200191505060405180910390f35b3415608257fe5b608860d5565b005b3415609157fe5b609760e9565b6040518082815260200191505060405180910390f35b60b360ef565b005b60003073ffffffffffffffffffffffffffffffffffffffff163190505b90565b60016000600082825401925050819055505b565b60005481565b5b5600a165627a7a72305820fe93d8cc66557a2a6c8347f481f6d334402a7f90f8b2288668a874c34416a4dc0029", 1000000)
self.contract_address = contract_data['address']
block_height = self.node.getblockcount()
self.node.generate(1)
sync_blocks(self.nodes)
for i in range(2):
assert(self.nodes[i].getblockcount() == block_height+1)
assert(len(self.nodes[i].listcontracts()) == 1+NUM_DEFAULT_DGP_CONTRACTS)
# Sends a tx containing 2 op_call outputs calling inc()
def many_calls_in_same_tx_test(self):
outputs = []
outputs.append(make_op_call_output(0, b"\x04", CScriptNum(1000000), CScriptNum(FGC_MIN_GAS_PRICE), bytes.fromhex("371303c0"), bytes.fromhex(self.contract_address)))
outputs.append(make_op_call_output(0, b"\x04", CScriptNum(1000000), CScriptNum(FGC_MIN_GAS_PRICE), bytes.fromhex("371303c0"), bytes.fromhex(self.contract_address)))
self.send_one_op_call_tx_with_counter_check(outputs, counter_should_increase_by=2, input_value=2*1000000*FGC_MIN_GAS_PRICE)
# Sends a normal raw op_call tx with a single output.
def normal_op_call_output_test(self):
outputs = []
outputs.append(make_op_call_output(0, b"\x04", b"\xff\x7f", CScriptNum(FGC_MIN_GAS_PRICE), bytes.fromhex("371303c0"), bytes.fromhex(self.contract_address)))
self.send_one_op_call_tx_with_counter_check(outputs, counter_should_increase_by=1, input_value=0x7fff*FGC_MIN_GAS_PRICE)
# Sends a tx containing 1 op_call output where txfee == gas_price*gas_limit.
def gas_equal_to_tx_fee_test(self):
outputs = []
outputs.append(make_op_call_output(0, b"\x04", CScriptNum(1000000), CScriptNum(FGC_MIN_GAS_PRICE), bytes.fromhex("371303c0"), bytes.fromhex(self.contract_address)))
self.send_one_op_call_tx_with_counter_check(outputs, counter_should_increase_by=1, input_value=1000000*FGC_MIN_GAS_PRICE)
# Sends a tx containing 1 op_call output where txfee < gas_price*gas_limit.
def gas_exceeding_tx_fee_100001_1_test(self):
outputs = []
outputs.append(make_op_call_output(0, b"\x04", CScriptNum(10000001), CScriptNum(FGC_MIN_GAS_PRICE), bytes.fromhex("371303c0"), bytes.fromhex(self.contract_address)))
self.send_one_op_call_tx_with_counter_check(outputs, input_value=1000001*FGC_MIN_GAS_PRICE-1, should_throw=True)
# Sends a tx containing 1 op_call output where txfee < gas_price*gas_limit.
def gas_exceeding_tx_fee_100001_2_test(self):
outputs = []
outputs.append(make_op_call_output(0, b"\x04", CScriptNum(1000001), CScriptNum(FGC_MIN_GAS_PRICE), bytes.fromhex("371303c0"), bytes.fromhex(self.contract_address)))
self.send_one_op_call_tx_with_counter_check(outputs, input_value=1000000*FGC_MIN_GAS_PRICE, should_throw=True)
# Sends a tx containing 2 op_call outputs that has a combined gas_price*gas_limit exceeding the tx fee.
# This tx should be rejected since executing such a tx would be unable to pay for its potential execution costs in the same way as a tx with one output where txfee < gas_price*gas_limit.
def two_calls_in_same_tx_exceeding_tx_fee_test(self):
outputs = []
outputs.append(make_op_call_output(0, b"\x04", CScriptNum(1000000), CScriptNum(FGC_MIN_GAS_PRICE), bytes.fromhex("371303c0"), bytes.fromhex(self.contract_address)))
outputs.append(make_op_call_output(0, b"\x04", CScriptNum(1000000), CScriptNum(FGC_MIN_GAS_PRICE), bytes.fromhex("371303c0"), bytes.fromhex(self.contract_address)))
self.send_one_op_call_tx_with_counter_check(outputs, input_value=2000000*FGC_MIN_GAS_PRICE-1, should_throw=True)
# sends a tx containing 1 op_call output with a (if interpreted with a signed integer) negative gas limit calling inc()
def gas_limit_signedness_test(self):
outputs = []
gas_limit = b"\xff"
while len(gas_limit) < 20:
outputs.append(make_op_call_output(0, b"\x04", gas_limit, CScriptNum(FGC_MIN_GAS_PRICE), bytes.fromhex("371303c0"), bytes.fromhex(self.contract_address)))
self.send_one_op_call_tx_with_counter_check(outputs, should_throw=True, input_value=min(max(int(bytes_to_hex_str(gas_limit), 16)*FGC_MIN_GAS_PRICE, 10000000), 1000000000))
gas_limit += b"\xff"
# sends a tx containing 1 op_call output with a (if interpreted with a signed integer) negative gas limit calling inc()
def gas_limit_signedness_one_valid_test(self):
outputs = []
gas_limit = b"\xff"
outputs.append(make_op_call_output(0, b"\x04", b"\xff\xff\x00", CScriptNum(FGC_MIN_GAS_PRICE), bytes.fromhex("371303c0"), bytes.fromhex(self.contract_address)))
outputs.append(make_op_call_output(0, b"\x04", b"\xff\xff", CScriptNum(FGC_MIN_GAS_PRICE), bytes.fromhex("371303c0"), bytes.fromhex(self.contract_address)))
self.send_one_op_call_tx_with_counter_check(outputs, should_throw=True, input_value=2*0xffff*FGC_MIN_GAS_PRICE)
# sends a tx containing 1 op_call output with a (if interpreted with a signed integer) negative gas price calling inc()
def gas_price_signedness_test(self):
outputs = []
outputs.append(make_op_call_output(0, b"\x04", b"\x01\x00", b"\xff\xff", bytes.fromhex("371303c0"), bytes.fromhex(self.contract_address)))
self.send_one_op_call_tx_with_counter_check(outputs, should_throw=True, input_value=10000000)
# sends a tx containing 1 op_call output with a possible negative gas limit and price calling inc()
def gas_limit_and_price_signedness_test(self):
outputs = []
outputs.append(make_op_call_output(0, b"\x04", b"\xff\xff", b"\xff", bytes.fromhex("371303c0"), bytes.fromhex(self.contract_address)))
self.send_one_op_call_tx_with_counter_check(outputs, should_throw=True, input_value=0xff*0xffff)
# Sends 100 valid op_call txs
def send_100_txs_test(self):
outputs = []
outputs.append(make_op_call_output(0, b"\x04", CScriptNum(1000000), CScriptNum(FGC_MIN_GAS_PRICE), bytes.fromhex("371303c0"), bytes.fromhex(self.contract_address)))
self.send_multiple_op_call_txs_with_counter_check(100, outputs, 100)
def send_tx_with_value_test(self):
outputs = []
# d0e30db0 deposit()
outputs.append(make_op_call_output(100000000, b"\x04", CScriptNum(1000000), CScriptNum(FGC_MIN_GAS_PRICE), bytes.fromhex("d0e30db0"), bytes.fromhex(self.contract_address)))
self.send_one_op_call_tx_with_counter_check(outputs, counter_should_increase_by=0, input_value=100000000+1000000*FGC_MIN_GAS_PRICE)
# 12065fe0 getBalance()
balance = int(self.node.callcontract(self.contract_address, "12065fe0")['executionResult']['output'], 16)
assert(balance == 100000000)
def run_test(self):
self.node = self.nodes[0]
connect_nodes(self.nodes[0], 1)
self.nodes[0].generate(200+COINBASE_MATURITY)
self.node.sendmany("", {self.node.getnewaddress(): 1000000*FGC_MIN_GAS_PRICE / Decimal('100000000') for i in range(200)})
print("Creating contract")
self.create_contract_test()
print("Calling inc() in two outputs")
self.many_calls_in_same_tx_test()
print("Calling inc() in one output")
self.normal_op_call_output_test()
print("Calling inc() in one output with txfee equal to gas_limit*gas_price")
self.gas_equal_to_tx_fee_test()
print("Calling inc() in one output with txfee < gas_limit*gas_price")
self.gas_exceeding_tx_fee_100001_1_test()
print("Second test of inc() in one outputs with txfee < gas_limit*gas_price")
self.gas_exceeding_tx_fee_100001_2_test()
print("Second test of inc() in one output with txfee < gas_limit*gas_price")
self.two_calls_in_same_tx_exceeding_tx_fee_test()
print("Mining a block with 100 txs each with an output calling inc()")
self.send_100_txs_test()
print("Checking that the value of txs are correctly updated")
self.send_tx_with_value_test()
print("Checking gas limit signedness where one tx is valid")
self.gas_limit_signedness_one_valid_test()
print("Checking gas limit signedness")
self.gas_limit_signedness_test()
print("Checking gas price signedness")
self.gas_price_signedness_test()
print("Checking gas limit and gas price signedness")
self.gas_limit_and_price_signedness_test()
if __name__ == '__main__':
OpCallTest().main() | en | 0.736731 | #!/usr/bin/env python3 # Copyright (c) 2015-2016 The Bitcoin Core developers # Distributed under the MIT software license, see the accompanying # file COPYING or http://www.opensource.org/licenses/mit-license.php. # 61bc221a counter() # 61bc221a counter() # 61bc221a counter() # Select as input a tx which has at least 5 fantasygold spendable # 61bc221a counter() # Deploy the testing contract pragma solidity ^0.4.10; contract Example { uint public counter; function inc() public { counter += 1; } function getBalance() public { return this.balance; } } # Sends a tx containing 2 op_call outputs calling inc() # Sends a normal raw op_call tx with a single output. # Sends a tx containing 1 op_call output where txfee == gas_price*gas_limit. # Sends a tx containing 1 op_call output where txfee < gas_price*gas_limit. # Sends a tx containing 1 op_call output where txfee < gas_price*gas_limit. # Sends a tx containing 2 op_call outputs that has a combined gas_price*gas_limit exceeding the tx fee. # This tx should be rejected since executing such a tx would be unable to pay for its potential execution costs in the same way as a tx with one output where txfee < gas_price*gas_limit. # sends a tx containing 1 op_call output with a (if interpreted with a signed integer) negative gas limit calling inc() # sends a tx containing 1 op_call output with a (if interpreted with a signed integer) negative gas limit calling inc() # sends a tx containing 1 op_call output with a (if interpreted with a signed integer) negative gas price calling inc() # sends a tx containing 1 op_call output with a possible negative gas limit and price calling inc() # Sends 100 valid op_call txs # d0e30db0 deposit() # 12065fe0 getBalance() | 2.020485 | 2 |
intake_sklearn/source.py | AlbertDeFusco/intake-sklearn | 1 | 2837 | <reponame>AlbertDeFusco/intake-sklearn<gh_stars>1-10
from intake.source.base import DataSource, Schema
import joblib
import fsspec
import sklearn
import re
from . import __version__
class SklearnModelSource(DataSource):
container = 'python'
name = 'sklearn'
version = __version__
partition_access = False
def __init__(self, urlpath, storage_options=None, metadata=None):
"""
Parameters
----------
urlpath: str, location of model pkl file
Either the absolute or relative path to the file or URL to be
opened. Some examples:
- ``{{ CATALOG_DIR }}/models/model.pkl``
- ``s3://some-bucket/models/model.pkl``
"""
self._urlpath = urlpath
self._storage_options = storage_options or {}
super().__init__(metadata=metadata)
def _load(self):
with fsspec.open(self._urlpath, mode='rb', **self._storage_options) as f:
return f.read()
def _get_schema(self):
as_binary = self._load()
s = re.search(b'_sklearn_versionq(.*\x00)((\d+\.)?(\d+\.)?(\*|\d+))q', as_binary)
if s:
sklearn_version = s.group(2).decode()
else:
sklearn_version = None
self._schema = Schema(
npartitions=1,
extra_metadata={
'sklearn_version':sklearn_version
}
)
return self._schema
def read(self):
self._load_metadata()
if not self.metadata['sklearn_version'] == sklearn.__version__:
msg = ('The model was created with Scikit-Learn version {} '
'but version {} has been installed in your current environment.'
).format(self.metadata['sklearn_version'], sklearn.__version__)
raise RuntimeError(msg)
with fsspec.open(self._urlpath, **self._storage_options) as f:
return joblib.load(f)
| from intake.source.base import DataSource, Schema
import joblib
import fsspec
import sklearn
import re
from . import __version__
class SklearnModelSource(DataSource):
container = 'python'
name = 'sklearn'
version = __version__
partition_access = False
def __init__(self, urlpath, storage_options=None, metadata=None):
"""
Parameters
----------
urlpath: str, location of model pkl file
Either the absolute or relative path to the file or URL to be
opened. Some examples:
- ``{{ CATALOG_DIR }}/models/model.pkl``
- ``s3://some-bucket/models/model.pkl``
"""
self._urlpath = urlpath
self._storage_options = storage_options or {}
super().__init__(metadata=metadata)
def _load(self):
with fsspec.open(self._urlpath, mode='rb', **self._storage_options) as f:
return f.read()
def _get_schema(self):
as_binary = self._load()
s = re.search(b'_sklearn_versionq(.*\x00)((\d+\.)?(\d+\.)?(\*|\d+))q', as_binary)
if s:
sklearn_version = s.group(2).decode()
else:
sklearn_version = None
self._schema = Schema(
npartitions=1,
extra_metadata={
'sklearn_version':sklearn_version
}
)
return self._schema
def read(self):
self._load_metadata()
if not self.metadata['sklearn_version'] == sklearn.__version__:
msg = ('The model was created with Scikit-Learn version {} '
'but version {} has been installed in your current environment.'
).format(self.metadata['sklearn_version'], sklearn.__version__)
raise RuntimeError(msg)
with fsspec.open(self._urlpath, **self._storage_options) as f:
return joblib.load(f) | en | 0.645498 | Parameters ---------- urlpath: str, location of model pkl file Either the absolute or relative path to the file or URL to be opened. Some examples: - ``{{ CATALOG_DIR }}/models/model.pkl`` - ``s3://some-bucket/models/model.pkl`` | 2.113229 | 2 |
jedi/evaluate/dynamic.py | hatamov/jedi | 0 | 2838 | """
One of the really important features of |jedi| is to have an option to
understand code like this::
def foo(bar):
bar. # completion here
foo(1)
There's no doubt wheter bar is an ``int`` or not, but if there's also a call
like ``foo('str')``, what would happen? Well, we'll just show both. Because
that's what a human would expect.
It works as follows:
- |Jedi| sees a param
- search for function calls named ``foo``
- execute these calls and check the input. This work with a ``ParamListener``.
"""
from itertools import chain
from jedi._compatibility import unicode
from jedi.parser import tree as pr
from jedi import settings
from jedi import debug
from jedi.evaluate.cache import memoize_default
from jedi.evaluate import imports
class ParamListener(object):
"""
This listener is used to get the params for a function.
"""
def __init__(self):
self.param_possibilities = []
def execute(self, params):
self.param_possibilities += params
@debug.increase_indent
def search_params(evaluator, param):
"""
A dynamic search for param values. If you try to complete a type:
>>> def func(foo):
... foo
>>> func(1)
>>> func("")
It is not known what the type ``foo`` without analysing the whole code. You
have to look for all calls to ``func`` to find out what ``foo`` possibly
is.
"""
if not settings.dynamic_params:
return []
debug.dbg('Dynamic param search for %s', param)
func = param.get_parent_until(pr.Function)
# Compare the param names.
names = [n for n in search_function_call(evaluator, func)
if n.value == param.name.value]
# Evaluate the ExecutedParams to types.
result = list(chain.from_iterable(n.parent.eval(evaluator) for n in names))
debug.dbg('Dynamic param result %s', result)
return result
@memoize_default([], evaluator_is_first_arg=True)
def search_function_call(evaluator, func):
"""
Returns a list of param names.
"""
from jedi.evaluate import representation as er
def get_params_for_module(module):
"""
Returns the values of a param, or an empty array.
"""
@memoize_default([], evaluator_is_first_arg=True)
def get_posibilities(evaluator, module, func_name):
try:
names = module.used_names[func_name]
except KeyError:
return []
for name in names:
parent = name.parent
if pr.is_node(parent, 'trailer'):
parent = parent.parent
trailer = None
if pr.is_node(parent, 'power'):
for t in parent.children[1:]:
if t == '**':
break
if t.start_pos > name.start_pos and t.children[0] == '(':
trailer = t
break
if trailer is not None:
types = evaluator.goto_definition(name)
# We have to remove decorators, because they are not the
# "original" functions, this way we can easily compare.
# At the same time we also have to remove InstanceElements.
undec = []
for escope in types:
if escope.isinstance(er.Function, er.Instance) \
and escope.decorates is not None:
undec.append(escope.decorates)
elif isinstance(escope, er.InstanceElement):
undec.append(escope.var)
else:
undec.append(escope)
if er.wrap(evaluator, compare) in undec:
# Only if we have the correct function we execute
# it, otherwise just ignore it.
evaluator.eval_trailer(types, trailer)
return listener.param_possibilities
return get_posibilities(evaluator, module, func_name)
current_module = func.get_parent_until()
func_name = unicode(func.name)
compare = func
if func_name == '__init__':
cls = func.get_parent_scope()
if isinstance(cls, pr.Class):
func_name = unicode(cls.name)
compare = cls
# add the listener
listener = ParamListener()
func.listeners.add(listener)
try:
result = []
# This is like backtracking: Get the first possible result.
for mod in imports.get_modules_containing_name(evaluator, [current_module], func_name):
result = get_params_for_module(mod)
if result:
break
finally:
# cleanup: remove the listener; important: should not stick.
func.listeners.remove(listener)
return result
| """
One of the really important features of |jedi| is to have an option to
understand code like this::
def foo(bar):
bar. # completion here
foo(1)
There's no doubt wheter bar is an ``int`` or not, but if there's also a call
like ``foo('str')``, what would happen? Well, we'll just show both. Because
that's what a human would expect.
It works as follows:
- |Jedi| sees a param
- search for function calls named ``foo``
- execute these calls and check the input. This work with a ``ParamListener``.
"""
from itertools import chain
from jedi._compatibility import unicode
from jedi.parser import tree as pr
from jedi import settings
from jedi import debug
from jedi.evaluate.cache import memoize_default
from jedi.evaluate import imports
class ParamListener(object):
"""
This listener is used to get the params for a function.
"""
def __init__(self):
self.param_possibilities = []
def execute(self, params):
self.param_possibilities += params
@debug.increase_indent
def search_params(evaluator, param):
"""
A dynamic search for param values. If you try to complete a type:
>>> def func(foo):
... foo
>>> func(1)
>>> func("")
It is not known what the type ``foo`` without analysing the whole code. You
have to look for all calls to ``func`` to find out what ``foo`` possibly
is.
"""
if not settings.dynamic_params:
return []
debug.dbg('Dynamic param search for %s', param)
func = param.get_parent_until(pr.Function)
# Compare the param names.
names = [n for n in search_function_call(evaluator, func)
if n.value == param.name.value]
# Evaluate the ExecutedParams to types.
result = list(chain.from_iterable(n.parent.eval(evaluator) for n in names))
debug.dbg('Dynamic param result %s', result)
return result
@memoize_default([], evaluator_is_first_arg=True)
def search_function_call(evaluator, func):
"""
Returns a list of param names.
"""
from jedi.evaluate import representation as er
def get_params_for_module(module):
"""
Returns the values of a param, or an empty array.
"""
@memoize_default([], evaluator_is_first_arg=True)
def get_posibilities(evaluator, module, func_name):
try:
names = module.used_names[func_name]
except KeyError:
return []
for name in names:
parent = name.parent
if pr.is_node(parent, 'trailer'):
parent = parent.parent
trailer = None
if pr.is_node(parent, 'power'):
for t in parent.children[1:]:
if t == '**':
break
if t.start_pos > name.start_pos and t.children[0] == '(':
trailer = t
break
if trailer is not None:
types = evaluator.goto_definition(name)
# We have to remove decorators, because they are not the
# "original" functions, this way we can easily compare.
# At the same time we also have to remove InstanceElements.
undec = []
for escope in types:
if escope.isinstance(er.Function, er.Instance) \
and escope.decorates is not None:
undec.append(escope.decorates)
elif isinstance(escope, er.InstanceElement):
undec.append(escope.var)
else:
undec.append(escope)
if er.wrap(evaluator, compare) in undec:
# Only if we have the correct function we execute
# it, otherwise just ignore it.
evaluator.eval_trailer(types, trailer)
return listener.param_possibilities
return get_posibilities(evaluator, module, func_name)
current_module = func.get_parent_until()
func_name = unicode(func.name)
compare = func
if func_name == '__init__':
cls = func.get_parent_scope()
if isinstance(cls, pr.Class):
func_name = unicode(cls.name)
compare = cls
# add the listener
listener = ParamListener()
func.listeners.add(listener)
try:
result = []
# This is like backtracking: Get the first possible result.
for mod in imports.get_modules_containing_name(evaluator, [current_module], func_name):
result = get_params_for_module(mod)
if result:
break
finally:
# cleanup: remove the listener; important: should not stick.
func.listeners.remove(listener)
return result
| en | 0.879129 | One of the really important features of |jedi| is to have an option to understand code like this:: def foo(bar): bar. # completion here foo(1) There's no doubt wheter bar is an ``int`` or not, but if there's also a call like ``foo('str')``, what would happen? Well, we'll just show both. Because that's what a human would expect. It works as follows: - |Jedi| sees a param - search for function calls named ``foo`` - execute these calls and check the input. This work with a ``ParamListener``. This listener is used to get the params for a function. A dynamic search for param values. If you try to complete a type: >>> def func(foo): ... foo >>> func(1) >>> func("") It is not known what the type ``foo`` without analysing the whole code. You have to look for all calls to ``func`` to find out what ``foo`` possibly is. # Compare the param names. # Evaluate the ExecutedParams to types. Returns a list of param names. Returns the values of a param, or an empty array. # We have to remove decorators, because they are not the # "original" functions, this way we can easily compare. # At the same time we also have to remove InstanceElements. # Only if we have the correct function we execute # it, otherwise just ignore it. # add the listener # This is like backtracking: Get the first possible result. # cleanup: remove the listener; important: should not stick. | 3.719317 | 4 |
steamcheck/views.py | moird/linux-game-report | 0 | 2839 | from steamcheck import app
from flask import jsonify, render_template
import os
import steamapi
import json
@app.route('/')
def index():
return render_template("index.html")
@app.route('/report/<name>')
def report(name=None):
"""
This will generate the report based on the users Steam ID. Returns JSON
:param name: Steam ID (either numerical ID or vanity url: steamcommunity.com/id/moird
:return: Json object that contains listing of all linux games and general information about them:
{
"steamuser": "real steam name",
"image": "steam user image url",
"games": [{'gametitle', {"linux":true}}]
"error": ""
}
"""
process_report = {}
try:
# See if we are running on heroku or not. Could probably set an environment variable for this as well.
if os.path.exists('/app/assets/GAMES.json'):
linux_game_list = '/app/assets/GAMES.json'
winehq_list = '/app/assets/winehq.json'
else:
linux_game_list = './assets/GAMES.json'
winehq_list = './assets/winehq.json'
with open(linux_game_list) as linux_game_list_raw:
linux_games = json.load(linux_game_list_raw)
with open(winehq_list) as winehq_raw:
winehq_apps = json.load(winehq_raw)
steam_connection = steamapi.core.APIConnection(api_key=os.environ['steam_api_key'])
try:
user = steamapi.user.SteamUser(userid=int(name))
except ValueError:
# When we get further this as a fallback will be taken out, really don't want to do this.
user = steamapi.user.SteamUser(userurl=name)
process_report['steamuser'] = user.name
process_report['image'] = user.avatar
process_report['games'] = {}
for game in user.games:
linux = False
winehq = False
if str(game.id) in linux_games:
linux = True
if game.name in winehq_apps:
winehq = winehq_apps[game.name]
process_report['games'][game.id] = {"name": game.name, "linux": linux, "winehq":winehq}
except Exception as e:
process_report['error'] = e
return jsonify(**process_report) | from steamcheck import app
from flask import jsonify, render_template
import os
import steamapi
import json
@app.route('/')
def index():
return render_template("index.html")
@app.route('/report/<name>')
def report(name=None):
"""
This will generate the report based on the users Steam ID. Returns JSON
:param name: Steam ID (either numerical ID or vanity url: steamcommunity.com/id/moird
:return: Json object that contains listing of all linux games and general information about them:
{
"steamuser": "real steam name",
"image": "steam user image url",
"games": [{'gametitle', {"linux":true}}]
"error": ""
}
"""
process_report = {}
try:
# See if we are running on heroku or not. Could probably set an environment variable for this as well.
if os.path.exists('/app/assets/GAMES.json'):
linux_game_list = '/app/assets/GAMES.json'
winehq_list = '/app/assets/winehq.json'
else:
linux_game_list = './assets/GAMES.json'
winehq_list = './assets/winehq.json'
with open(linux_game_list) as linux_game_list_raw:
linux_games = json.load(linux_game_list_raw)
with open(winehq_list) as winehq_raw:
winehq_apps = json.load(winehq_raw)
steam_connection = steamapi.core.APIConnection(api_key=os.environ['steam_api_key'])
try:
user = steamapi.user.SteamUser(userid=int(name))
except ValueError:
# When we get further this as a fallback will be taken out, really don't want to do this.
user = steamapi.user.SteamUser(userurl=name)
process_report['steamuser'] = user.name
process_report['image'] = user.avatar
process_report['games'] = {}
for game in user.games:
linux = False
winehq = False
if str(game.id) in linux_games:
linux = True
if game.name in winehq_apps:
winehq = winehq_apps[game.name]
process_report['games'][game.id] = {"name": game.name, "linux": linux, "winehq":winehq}
except Exception as e:
process_report['error'] = e
return jsonify(**process_report) | en | 0.884436 | This will generate the report based on the users Steam ID. Returns JSON :param name: Steam ID (either numerical ID or vanity url: steamcommunity.com/id/moird :return: Json object that contains listing of all linux games and general information about them: { "steamuser": "real steam name", "image": "steam user image url", "games": [{'gametitle', {"linux":true}}] "error": "" } # See if we are running on heroku or not. Could probably set an environment variable for this as well. # When we get further this as a fallback will be taken out, really don't want to do this. | 2.675109 | 3 |
validator/delphi_validator/run.py | benjaminysmith/covidcast-indicators | 0 | 2840 | <reponame>benjaminysmith/covidcast-indicators<filename>validator/delphi_validator/run.py
# -*- coding: utf-8 -*-
"""Functions to call when running the tool.
This module should contain a function called `run_module`, that is executed
when the module is run with `python -m delphi_validator`.
"""
from delphi_utils import read_params
from .validate import Validator
def run_module():
"""Run the validator as a module."""
parent_params = read_params()
params = parent_params['validation']
validator = Validator(params)
validator.validate(parent_params["export_dir"]).print_and_exit()
| # -*- coding: utf-8 -*-
"""Functions to call when running the tool.
This module should contain a function called `run_module`, that is executed
when the module is run with `python -m delphi_validator`.
"""
from delphi_utils import read_params
from .validate import Validator
def run_module():
"""Run the validator as a module."""
parent_params = read_params()
params = parent_params['validation']
validator = Validator(params)
validator.validate(parent_params["export_dir"]).print_and_exit() | en | 0.790166 | # -*- coding: utf-8 -*- Functions to call when running the tool. This module should contain a function called `run_module`, that is executed when the module is run with `python -m delphi_validator`. Run the validator as a module. | 2.404209 | 2 |
datasets/validation_folders.py | zenithfang/supervised_dispnet | 39 | 2841 | import torch.utils.data as data
import numpy as np
from imageio import imread
from path import Path
import pdb
def crawl_folders(folders_list):
imgs = []
depth = []
for folder in folders_list:
current_imgs = sorted(folder.files('*.jpg'))
current_depth = []
for img in current_imgs:
d = img.dirname()/(img.name[:-4] + '.npy')
assert(d.isfile()), "depth file {} not found".format(str(d))
depth.append(d)
imgs.extend(current_imgs)
depth.extend(current_depth)
return imgs, depth
def load_as_float(path):
return imread(path).astype(np.float32)
class ValidationSet(data.Dataset):
"""A sequence data loader where the files are arranged in this way:
root/scene_1/0000000.jpg
root/scene_1/0000000.npy
root/scene_1/0000001.jpg
root/scene_1/0000001.npy
..
root/scene_2/0000000.jpg
root/scene_2/0000000.npy
.
transform functions must take in a list a images and a numpy array which can be None
"""
def __init__(self, root, transform=None):
self.root = Path(root)
scene_list_path = self.root/'val.txt'
self.scenes = [self.root/folder[:-1] for folder in open(scene_list_path)]
self.imgs, self.depth = crawl_folders(self.scenes)
self.transform = transform
def __getitem__(self, index):
img = load_as_float(self.imgs[index])
depth = np.load(self.depth[index]).astype(np.float32) #;pdb.set_trace()
if self.transform is not None:
img, _, _ = self.transform([img], depth, None); #this depth is just used to fill the compose transform that is shared(no need for the result)
img = img[0]
return img, depth
def __len__(self):
return len(self.imgs)
| import torch.utils.data as data
import numpy as np
from imageio import imread
from path import Path
import pdb
def crawl_folders(folders_list):
imgs = []
depth = []
for folder in folders_list:
current_imgs = sorted(folder.files('*.jpg'))
current_depth = []
for img in current_imgs:
d = img.dirname()/(img.name[:-4] + '.npy')
assert(d.isfile()), "depth file {} not found".format(str(d))
depth.append(d)
imgs.extend(current_imgs)
depth.extend(current_depth)
return imgs, depth
def load_as_float(path):
return imread(path).astype(np.float32)
class ValidationSet(data.Dataset):
"""A sequence data loader where the files are arranged in this way:
root/scene_1/0000000.jpg
root/scene_1/0000000.npy
root/scene_1/0000001.jpg
root/scene_1/0000001.npy
..
root/scene_2/0000000.jpg
root/scene_2/0000000.npy
.
transform functions must take in a list a images and a numpy array which can be None
"""
def __init__(self, root, transform=None):
self.root = Path(root)
scene_list_path = self.root/'val.txt'
self.scenes = [self.root/folder[:-1] for folder in open(scene_list_path)]
self.imgs, self.depth = crawl_folders(self.scenes)
self.transform = transform
def __getitem__(self, index):
img = load_as_float(self.imgs[index])
depth = np.load(self.depth[index]).astype(np.float32) #;pdb.set_trace()
if self.transform is not None:
img, _, _ = self.transform([img], depth, None); #this depth is just used to fill the compose transform that is shared(no need for the result)
img = img[0]
return img, depth
def __len__(self):
return len(self.imgs)
| en | 0.736474 | A sequence data loader where the files are arranged in this way: root/scene_1/0000000.jpg root/scene_1/0000000.npy root/scene_1/0000001.jpg root/scene_1/0000001.npy .. root/scene_2/0000000.jpg root/scene_2/0000000.npy . transform functions must take in a list a images and a numpy array which can be None #;pdb.set_trace() #this depth is just used to fill the compose transform that is shared(no need for the result) | 2.707672 | 3 |
secretpy/ciphers/rot18.py | tigertv/crypt | 51 | 2842 | <gh_stars>10-100
#!/usr/bin/python
from .rot13 import Rot13
import secretpy.alphabets as al
class Rot18:
"""
The Rot18 Cipher
"""
__rot13 = Rot13()
def __init__(self):
alphabet = al.ENGLISH
half = len(alphabet) >> 1
self.__alphabet = alphabet[:half] + al.DECIMAL[:5] + alphabet[half:] + al.DECIMAL[5:]
def __crypt(self, text, alphabet):
return self.__rot13.encrypt(text, alphabet=self.__alphabet)
def encrypt(self, text, key=None, alphabet=None):
"""
Encryption method
:param text: Text to encrypt
:param key: is not used
:param alphabet: is not used
:type text: string
:type key: integer
:type alphabet: string
:return: text
:rtype: string
"""
return self.__crypt(text, self.__alphabet)
def decrypt(self, text, key=None, alphabet=None):
"""
Decryption method
:param text: Text to decrypt
:param key: is not used
:param alphabet: is not used
:type text: string
:type key: integer
:type alphabet: string
:return: text
:rtype: string
"""
return self.__crypt(text, self.__alphabet)
def get_fixed_alphabet(self):
return self.__alphabet
| #!/usr/bin/python
from .rot13 import Rot13
import secretpy.alphabets as al
class Rot18:
"""
The Rot18 Cipher
"""
__rot13 = Rot13()
def __init__(self):
alphabet = al.ENGLISH
half = len(alphabet) >> 1
self.__alphabet = alphabet[:half] + al.DECIMAL[:5] + alphabet[half:] + al.DECIMAL[5:]
def __crypt(self, text, alphabet):
return self.__rot13.encrypt(text, alphabet=self.__alphabet)
def encrypt(self, text, key=None, alphabet=None):
"""
Encryption method
:param text: Text to encrypt
:param key: is not used
:param alphabet: is not used
:type text: string
:type key: integer
:type alphabet: string
:return: text
:rtype: string
"""
return self.__crypt(text, self.__alphabet)
def decrypt(self, text, key=None, alphabet=None):
"""
Decryption method
:param text: Text to decrypt
:param key: is not used
:param alphabet: is not used
:type text: string
:type key: integer
:type alphabet: string
:return: text
:rtype: string
"""
return self.__crypt(text, self.__alphabet)
def get_fixed_alphabet(self):
return self.__alphabet | en | 0.423472 | #!/usr/bin/python The Rot18 Cipher Encryption method :param text: Text to encrypt :param key: is not used :param alphabet: is not used :type text: string :type key: integer :type alphabet: string :return: text :rtype: string Decryption method :param text: Text to decrypt :param key: is not used :param alphabet: is not used :type text: string :type key: integer :type alphabet: string :return: text :rtype: string | 3.706856 | 4 |
pysaurus/database/special_properties.py | notoraptor/pysaurus | 0 | 2843 | <reponame>notoraptor/pysaurus
from abc import abstractmethod
from pysaurus.database.properties import PropType
from pysaurus.database.video import Video
class SpecialPropType(PropType):
__slots__ = ()
@abstractmethod
def get(self, video: Video):
raise NotImplementedError()
class PropError(SpecialPropType):
__slots__ = ()
def __init__(self):
super().__init__("<error>", "", True)
def get(self, video: Video):
return sorted(set(video.errors) | set(video.properties.get(self.name, ())))
class SpecialProperties:
properties = [PropError()]
@classmethod
def install(cls, database):
to_save = False
for expected in cls.properties:
if (
not database.has_prop_type(expected.name)
or database.get_prop_type(expected.name) != expected
):
database.remove_prop_type(expected.name)
database.add_prop_type(expected)
to_save = True
if to_save:
database.save()
@classmethod
def all_in(cls, video: Video):
return all(prop.name in video.properties for prop in cls.properties)
@classmethod
def set(cls, video: Video):
for prop in cls.properties:
video.properties[prop.name] = prop.get(video)
| from abc import abstractmethod
from pysaurus.database.properties import PropType
from pysaurus.database.video import Video
class SpecialPropType(PropType):
__slots__ = ()
@abstractmethod
def get(self, video: Video):
raise NotImplementedError()
class PropError(SpecialPropType):
__slots__ = ()
def __init__(self):
super().__init__("<error>", "", True)
def get(self, video: Video):
return sorted(set(video.errors) | set(video.properties.get(self.name, ())))
class SpecialProperties:
properties = [PropError()]
@classmethod
def install(cls, database):
to_save = False
for expected in cls.properties:
if (
not database.has_prop_type(expected.name)
or database.get_prop_type(expected.name) != expected
):
database.remove_prop_type(expected.name)
database.add_prop_type(expected)
to_save = True
if to_save:
database.save()
@classmethod
def all_in(cls, video: Video):
return all(prop.name in video.properties for prop in cls.properties)
@classmethod
def set(cls, video: Video):
for prop in cls.properties:
video.properties[prop.name] = prop.get(video) | none | 1 | 2.626792 | 3 |
|
patrole_tempest_plugin/rbac_utils.py | openstack/patrole | 14 | 2844 | # Copyright 2017 AT&T Corporation.
# All Rights Reserved.
#
# Licensed under the Apache License, Version 2.0 (the "License"); you may
# not use this file except in compliance with the License. You may obtain
# a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS, WITHOUT
# WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the
# License for the specific language governing permissions and limitations
# under the License.
import contextlib
import sys
import time
from oslo_log import log as logging
from oslo_utils import excutils
from tempest import config
from tempest.lib import exceptions as lib_exc
from patrole_tempest_plugin import rbac_exceptions
CONF = config.CONF
LOG = logging.getLogger(__name__)
class _ValidateListContext(object):
"""Context class responsible for validation of the list functions.
This class is used in ``override_role_and_validate_list`` function and
the result of a list function must be assigned to the ``ctx.resources``
variable.
Example::
with self.override_role_and_validate_list(...) as ctx:
ctx.resources = list_function()
"""
def __init__(self, admin_resources=None, admin_resource_id=None):
"""Constructor for ``ValidateListContext``.
Either ``admin_resources`` or ``admin_resource_id`` should be used,
not both.
:param list admin_resources: The list of resources received before
calling the ``override_role_and_validate_list`` function. To
validate will be used the ``_validate_len`` function.
:param UUID admin_resource_id: An ID of a resource created before
calling the ``override_role_and_validate_list`` function. To
validate will be used the ``_validate_resource`` function.
:raises RbacValidateListException: if both ``admin_resources`` and
``admin_resource_id`` are set or unset.
"""
self.resources = None
if admin_resources is not None and not admin_resource_id:
self._admin_len = len(admin_resources)
if not self._admin_len:
raise rbac_exceptions.RbacValidateListException(
reason="the list of admin resources cannot be empty")
self._validate_func = self._validate_len
elif admin_resource_id and admin_resources is None:
self._admin_resource_id = admin_resource_id
self._validate_func = self._validate_resource
else:
raise rbac_exceptions.RbacValidateListException(
reason="admin_resources and admin_resource_id are mutually "
"exclusive")
def _validate_len(self):
"""Validates that the number of resources is less than admin resources.
"""
if not len(self.resources):
raise rbac_exceptions.RbacEmptyResponseBody()
elif self._admin_len > len(self.resources):
raise rbac_exceptions.RbacPartialResponseBody(body=self.resources)
def _validate_resource(self):
"""Validates that the admin resource is present in the resources.
"""
for resource in self.resources:
if resource['id'] == self._admin_resource_id:
return
raise rbac_exceptions.RbacPartialResponseBody(body=self.resources)
def _validate(self):
"""Calls the proper validation function.
:raises RbacValidateListException: if the ``ctx.resources`` variable is
not assigned.
"""
if self.resources is None:
raise rbac_exceptions.RbacValidateListException(
reason="ctx.resources is not assigned")
self._validate_func()
class RbacUtilsMixin(object):
"""Utility mixin responsible for switching ``os_primary`` role.
Should be used as a mixin class alongside an instance of
:py:class:`tempest.test.BaseTestCase` to perform Patrole class setup for a
base RBAC class. Child classes should not use this mixin.
Example::
class BaseRbacTest(rbac_utils.RbacUtilsMixin, base.BaseV2ComputeTest):
@classmethod
def setup_clients(cls):
super(BaseRbacTest, cls).setup_clients()
cls.hosts_client = cls.os_primary.hosts_client
...
This class is responsible for overriding the value of the primary Tempest
credential's role (i.e. ``os_primary`` role). By doing so, it is possible
to seamlessly swap between admin credentials, needed for setup and clean
up, and primary credentials, needed to perform the API call which does
policy enforcement. The primary credentials always cycle between roles
defined by ``CONF.identity.admin_role`` and
``CONF.patrole.rbac_test_roles``.
"""
credentials = ['primary', 'admin']
def __init__(self, *args, **kwargs):
super(RbacUtilsMixin, self).__init__(*args, **kwargs)
# Shows if override_role was called.
self.__override_role_called = False
# Shows if exception raised during override_role.
self.__override_role_caught_exc = False
_admin_role_id = None
_rbac_role_ids = None
_project_id = None
_user_id = None
_role_map = None
_role_inferences_mapping = None
_orig_roles = []
admin_roles_client = None
@classmethod
def restore_roles(cls):
if cls._orig_roles:
LOG.info("Restoring original roles %s", cls._orig_roles)
roles_already_present = cls._list_and_clear_user_roles_on_project(
cls._orig_roles)
if not roles_already_present:
cls._create_user_role_on_project(cls._orig_roles)
@classmethod
def setup_clients(cls):
if CONF.identity_feature_enabled.api_v3:
admin_roles_client = cls.os_admin.roles_v3_client
else:
raise lib_exc.InvalidConfiguration(
"Patrole role overriding only supports v3 identity API.")
cls.admin_roles_client = admin_roles_client
cls._project_id = cls.os_primary.credentials.tenant_id
cls._user_id = cls.os_primary.credentials.user_id
cls._role_inferences_mapping = cls._prepare_role_inferences_mapping()
cls._init_roles()
# Store the user's original roles and rollback after testing.
roles = cls.admin_roles_client.list_user_roles_on_project(
cls._project_id, cls._user_id)['roles']
cls._orig_roles = [role['id'] for role in roles]
cls.addClassResourceCleanup(cls.restore_roles)
# Change default role to admin
cls._override_role(False)
super(RbacUtilsMixin, cls).setup_clients()
@classmethod
def _prepare_role_inferences_mapping(cls):
"""Preparing roles mapping to support role inferences
Making query to `list-all-role-inference-rules`_ keystone API
returns all inference rules, which makes it possible to prepare
roles mapping.
It walks recursively through the raw data::
{"role_inferences": [
{
"implies": [{"id": "3", "name": "reader"}],
"prior_role": {"id": "2", "name": "member"}
},
{
"implies": [{"id": "2", "name": "member"}],
"prior_role": {"id": "1", "name": "admin"}
}
]
}
and converts it to the mapping::
{
"2": ["3"], # "member": ["reader"],
"1": ["2", "3"] # "admin": ["member", "reader"]
}
.. _list-all-role-inference-rules: https://docs.openstack.org/api-ref/identity/v3/#list-all-role-inference-rules
""" # noqa: E501
def process_roles(role_id, data):
roles = data.get(role_id, set())
for rid in roles.copy():
roles.update(process_roles(rid, data))
return roles
def convert_data(data):
res = {}
for rule in data:
prior_role = rule['prior_role']['id']
implies = {r['id'] for r in rule['implies']}
res[prior_role] = implies
return res
raw_data = cls.admin_roles_client.list_all_role_inference_rules()
data = convert_data(raw_data['role_inferences'])
res = {}
for role_id in data:
res[role_id] = process_roles(role_id, data)
return res
def get_all_needed_roles(self, roles):
"""Extending given roles with roles from mapping
Examples::
["admin"] >> ["admin", "member", "reader"]
["member"] >> ["member", "reader"]
["reader"] >> ["reader"]
["custom_role"] >> ["custom_role"]
:param roles: list of roles
:return: extended list of roles
"""
res = set(r for r in roles)
for role in res.copy():
role_id = self.__class__._role_map.get(role)
implied_roles = self.__class__._role_inferences_mapping.get(
role_id, set())
role_names = {self.__class__._role_map[rid]
for rid in implied_roles}
res.update(role_names)
LOG.debug('All needed roles: %s; Base roles: %s', res, roles)
return list(res)
@contextlib.contextmanager
def override_role(self):
"""Override the role used by ``os_primary`` Tempest credentials.
Temporarily change the role used by ``os_primary`` credentials to:
* ``[patrole] rbac_test_roles`` before test execution
* ``[identity] admin_role`` after test execution
Automatically switches to admin role after test execution.
:returns: None
.. warning::
This function can alter user roles for pre-provisioned credentials.
Work is underway to safely clean up after this function.
Example::
@rbac_rule_validation.action(service='test',
rules=['a:test:rule'])
def test_foo(self):
# Allocate test-level resources here.
with self.override_role():
# The role for `os_primary` has now been overridden. Within
# this block, call the API endpoint that enforces the
# expected policy specified by "rule" in the decorator.
self.foo_service.bar_api_call()
# The role is switched back to admin automatically. Note that
# if the API call above threw an exception, any code below this
# point in the test is not executed.
"""
self._set_override_role_called()
self._override_role(True)
try:
# Execute the test.
yield
finally:
# Check whether an exception was raised. If so, remember that
# for future validation.
exc = sys.exc_info()[0]
if exc is not None:
self._set_override_role_caught_exc()
# This code block is always executed, no matter the result of the
# test. Automatically switch back to the admin role for test clean
# up.
self._override_role(False)
@classmethod
def _override_role(cls, toggle_rbac_role=False):
"""Private helper for overriding ``os_primary`` Tempest credentials.
:param toggle_rbac_role: Boolean value that controls the role that
overrides default role of ``os_primary`` credentials.
* If True: role is set to ``[patrole] rbac_test_role``
* If False: role is set to ``[identity] admin_role``
"""
LOG.debug('Overriding role to: %s.', toggle_rbac_role)
roles_already_present = False
try:
target_roles = (cls._rbac_role_ids
if toggle_rbac_role else [cls._admin_role_id])
roles_already_present = cls._list_and_clear_user_roles_on_project(
target_roles)
# Do not override roles if `target_role` already exists.
if not roles_already_present:
cls._create_user_role_on_project(target_roles)
except Exception as exp:
with excutils.save_and_reraise_exception():
LOG.exception(exp)
finally:
auth_providers = cls.get_auth_providers()
for provider in auth_providers:
provider.clear_auth()
# Fernet tokens are not subsecond aware so sleep to ensure we are
# passing the second boundary before attempting to authenticate.
# Only sleep if a token revocation occurred as a result of role
# overriding. This will optimize test runtime in the case where
# ``[identity] admin_role`` == ``[patrole] rbac_test_roles``.
if not roles_already_present:
time.sleep(1)
for provider in auth_providers:
provider.set_auth()
@classmethod
def _init_roles(cls):
available_roles = cls.admin_roles_client.list_roles()['roles']
cls._role_map = {r['name']: r['id'] for r in available_roles}
LOG.debug('Available roles: %s', cls._role_map.keys())
rbac_role_ids = []
roles = CONF.patrole.rbac_test_roles
# TODO(vegasq) drop once CONF.patrole.rbac_test_role is removed
if CONF.patrole.rbac_test_role:
if not roles:
roles.append(CONF.patrole.rbac_test_role)
for role_name in roles:
rbac_role_ids.append(cls._role_map.get(role_name))
admin_role_id = cls._role_map.get(CONF.identity.admin_role)
if not all([admin_role_id, all(rbac_role_ids)]):
missing_roles = []
msg = ("Could not find `[patrole] rbac_test_roles` or "
"`[identity] admin_role`, both of which are required for "
"RBAC testing.")
if not admin_role_id:
missing_roles.append(CONF.identity.admin_role)
if not all(rbac_role_ids):
missing_roles += [role_name for role_name in roles
if role_name not in cls._role_map]
msg += " Following roles were not found: %s." % (
", ".join(missing_roles))
msg += " Available roles: %s." % ", ".join(cls._role_map)
raise rbac_exceptions.RbacResourceSetupFailed(msg)
cls._admin_role_id = admin_role_id
cls._rbac_role_ids = rbac_role_ids
# Adding backward mapping
cls._role_map.update({v: k for k, v in cls._role_map.items()})
@classmethod
def _create_user_role_on_project(cls, role_ids):
for role_id in role_ids:
cls.admin_roles_client.create_user_role_on_project(
cls._project_id, cls._user_id, role_id)
@classmethod
def _list_and_clear_user_roles_on_project(cls, role_ids):
roles = cls.admin_roles_client.list_user_roles_on_project(
cls._project_id, cls._user_id)['roles']
all_role_ids = [role['id'] for role in roles]
# NOTE(felipemonteiro): We do not use ``role_id in all_role_ids`` here
# to avoid over-permission errors: if the current list of roles on the
# project includes "admin" and "Member", and we are switching to the
# "Member" role, then we must delete the "admin" role. Thus, we only
# return early if the user's roles on the project are an exact match.
if set(role_ids) == set(all_role_ids):
return True
for role in roles:
cls.admin_roles_client.delete_role_from_user_on_project(
cls._project_id, cls._user_id, role['id'])
return False
@contextlib.contextmanager
def override_role_and_validate_list(self,
admin_resources=None,
admin_resource_id=None):
"""Call ``override_role`` and validate RBAC for a list API action.
List actions usually do soft authorization: partial or empty response
bodies are returned instead of exceptions. This helper validates
that unauthorized roles only return a subset of the available
resources.
Should only be used for validating list API actions.
:param test_obj: Instance of ``tempest.test.BaseTestCase``.
:param list admin_resources: The list of resources received before
calling the ``override_role_and_validate_list`` function.
:param UUID admin_resource_id: An ID of a resource created before
calling the ``override_role_and_validate_list`` function.
:return: py:class:`_ValidateListContext` object.
Example::
# the resource created by admin
admin_resource_id = (
self.ntp_client.create_dscp_marking_rule()
["dscp_marking_rule"]["id'])
with self.override_role_and_validate_list(
admin_resource_id=admin_resource_id) as ctx:
# the list of resources available for member role
ctx.resources = self.ntp_client.list_dscp_marking_rules(
policy_id=self.policy_id)["dscp_marking_rules"]
"""
ctx = _ValidateListContext(admin_resources, admin_resource_id)
with self.override_role():
yield ctx
ctx._validate()
@classmethod
def get_auth_providers(cls):
"""Returns list of auth_providers used within test.
Tests may redefine this method to include their own or third party
client auth_providers.
"""
return [cls.os_primary.auth_provider]
def _set_override_role_called(self):
"""Helper for tracking whether ``override_role`` was called."""
self.__override_role_called = True
def _set_override_role_caught_exc(self):
"""Helper for tracking whether exception was thrown inside
``override_role``.
"""
self.__override_role_caught_exc = True
def _validate_override_role_called(self):
"""Idempotently validate that ``override_role`` is called and reset
its value to False for sequential tests.
"""
was_called = self.__override_role_called
self.__override_role_called = False
return was_called
def _validate_override_role_caught_exc(self):
"""Idempotently validate that exception was caught inside
``override_role``, so that, by process of elimination, it can be
determined whether one was thrown outside (which is invalid).
"""
caught_exception = self.__override_role_caught_exc
self.__override_role_caught_exc = False
return caught_exception
def is_admin():
"""Verifies whether the current test role equals the admin role.
:returns: True if ``rbac_test_roles`` contain the admin role.
"""
roles = CONF.patrole.rbac_test_roles
# TODO(vegasq) drop once CONF.patrole.rbac_test_role is removed
if CONF.patrole.rbac_test_role:
roles.append(CONF.patrole.rbac_test_role)
roles = list(set(roles))
# TODO(felipemonteiro): Make this more robust via a context is admin
# lookup.
return CONF.identity.admin_role in roles
| # Copyright 2017 AT&T Corporation.
# All Rights Reserved.
#
# Licensed under the Apache License, Version 2.0 (the "License"); you may
# not use this file except in compliance with the License. You may obtain
# a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS, WITHOUT
# WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the
# License for the specific language governing permissions and limitations
# under the License.
import contextlib
import sys
import time
from oslo_log import log as logging
from oslo_utils import excutils
from tempest import config
from tempest.lib import exceptions as lib_exc
from patrole_tempest_plugin import rbac_exceptions
CONF = config.CONF
LOG = logging.getLogger(__name__)
class _ValidateListContext(object):
"""Context class responsible for validation of the list functions.
This class is used in ``override_role_and_validate_list`` function and
the result of a list function must be assigned to the ``ctx.resources``
variable.
Example::
with self.override_role_and_validate_list(...) as ctx:
ctx.resources = list_function()
"""
def __init__(self, admin_resources=None, admin_resource_id=None):
"""Constructor for ``ValidateListContext``.
Either ``admin_resources`` or ``admin_resource_id`` should be used,
not both.
:param list admin_resources: The list of resources received before
calling the ``override_role_and_validate_list`` function. To
validate will be used the ``_validate_len`` function.
:param UUID admin_resource_id: An ID of a resource created before
calling the ``override_role_and_validate_list`` function. To
validate will be used the ``_validate_resource`` function.
:raises RbacValidateListException: if both ``admin_resources`` and
``admin_resource_id`` are set or unset.
"""
self.resources = None
if admin_resources is not None and not admin_resource_id:
self._admin_len = len(admin_resources)
if not self._admin_len:
raise rbac_exceptions.RbacValidateListException(
reason="the list of admin resources cannot be empty")
self._validate_func = self._validate_len
elif admin_resource_id and admin_resources is None:
self._admin_resource_id = admin_resource_id
self._validate_func = self._validate_resource
else:
raise rbac_exceptions.RbacValidateListException(
reason="admin_resources and admin_resource_id are mutually "
"exclusive")
def _validate_len(self):
"""Validates that the number of resources is less than admin resources.
"""
if not len(self.resources):
raise rbac_exceptions.RbacEmptyResponseBody()
elif self._admin_len > len(self.resources):
raise rbac_exceptions.RbacPartialResponseBody(body=self.resources)
def _validate_resource(self):
"""Validates that the admin resource is present in the resources.
"""
for resource in self.resources:
if resource['id'] == self._admin_resource_id:
return
raise rbac_exceptions.RbacPartialResponseBody(body=self.resources)
def _validate(self):
"""Calls the proper validation function.
:raises RbacValidateListException: if the ``ctx.resources`` variable is
not assigned.
"""
if self.resources is None:
raise rbac_exceptions.RbacValidateListException(
reason="ctx.resources is not assigned")
self._validate_func()
class RbacUtilsMixin(object):
"""Utility mixin responsible for switching ``os_primary`` role.
Should be used as a mixin class alongside an instance of
:py:class:`tempest.test.BaseTestCase` to perform Patrole class setup for a
base RBAC class. Child classes should not use this mixin.
Example::
class BaseRbacTest(rbac_utils.RbacUtilsMixin, base.BaseV2ComputeTest):
@classmethod
def setup_clients(cls):
super(BaseRbacTest, cls).setup_clients()
cls.hosts_client = cls.os_primary.hosts_client
...
This class is responsible for overriding the value of the primary Tempest
credential's role (i.e. ``os_primary`` role). By doing so, it is possible
to seamlessly swap between admin credentials, needed for setup and clean
up, and primary credentials, needed to perform the API call which does
policy enforcement. The primary credentials always cycle between roles
defined by ``CONF.identity.admin_role`` and
``CONF.patrole.rbac_test_roles``.
"""
credentials = ['primary', 'admin']
def __init__(self, *args, **kwargs):
super(RbacUtilsMixin, self).__init__(*args, **kwargs)
# Shows if override_role was called.
self.__override_role_called = False
# Shows if exception raised during override_role.
self.__override_role_caught_exc = False
_admin_role_id = None
_rbac_role_ids = None
_project_id = None
_user_id = None
_role_map = None
_role_inferences_mapping = None
_orig_roles = []
admin_roles_client = None
@classmethod
def restore_roles(cls):
if cls._orig_roles:
LOG.info("Restoring original roles %s", cls._orig_roles)
roles_already_present = cls._list_and_clear_user_roles_on_project(
cls._orig_roles)
if not roles_already_present:
cls._create_user_role_on_project(cls._orig_roles)
@classmethod
def setup_clients(cls):
if CONF.identity_feature_enabled.api_v3:
admin_roles_client = cls.os_admin.roles_v3_client
else:
raise lib_exc.InvalidConfiguration(
"Patrole role overriding only supports v3 identity API.")
cls.admin_roles_client = admin_roles_client
cls._project_id = cls.os_primary.credentials.tenant_id
cls._user_id = cls.os_primary.credentials.user_id
cls._role_inferences_mapping = cls._prepare_role_inferences_mapping()
cls._init_roles()
# Store the user's original roles and rollback after testing.
roles = cls.admin_roles_client.list_user_roles_on_project(
cls._project_id, cls._user_id)['roles']
cls._orig_roles = [role['id'] for role in roles]
cls.addClassResourceCleanup(cls.restore_roles)
# Change default role to admin
cls._override_role(False)
super(RbacUtilsMixin, cls).setup_clients()
@classmethod
def _prepare_role_inferences_mapping(cls):
"""Preparing roles mapping to support role inferences
Making query to `list-all-role-inference-rules`_ keystone API
returns all inference rules, which makes it possible to prepare
roles mapping.
It walks recursively through the raw data::
{"role_inferences": [
{
"implies": [{"id": "3", "name": "reader"}],
"prior_role": {"id": "2", "name": "member"}
},
{
"implies": [{"id": "2", "name": "member"}],
"prior_role": {"id": "1", "name": "admin"}
}
]
}
and converts it to the mapping::
{
"2": ["3"], # "member": ["reader"],
"1": ["2", "3"] # "admin": ["member", "reader"]
}
.. _list-all-role-inference-rules: https://docs.openstack.org/api-ref/identity/v3/#list-all-role-inference-rules
""" # noqa: E501
def process_roles(role_id, data):
roles = data.get(role_id, set())
for rid in roles.copy():
roles.update(process_roles(rid, data))
return roles
def convert_data(data):
res = {}
for rule in data:
prior_role = rule['prior_role']['id']
implies = {r['id'] for r in rule['implies']}
res[prior_role] = implies
return res
raw_data = cls.admin_roles_client.list_all_role_inference_rules()
data = convert_data(raw_data['role_inferences'])
res = {}
for role_id in data:
res[role_id] = process_roles(role_id, data)
return res
def get_all_needed_roles(self, roles):
"""Extending given roles with roles from mapping
Examples::
["admin"] >> ["admin", "member", "reader"]
["member"] >> ["member", "reader"]
["reader"] >> ["reader"]
["custom_role"] >> ["custom_role"]
:param roles: list of roles
:return: extended list of roles
"""
res = set(r for r in roles)
for role in res.copy():
role_id = self.__class__._role_map.get(role)
implied_roles = self.__class__._role_inferences_mapping.get(
role_id, set())
role_names = {self.__class__._role_map[rid]
for rid in implied_roles}
res.update(role_names)
LOG.debug('All needed roles: %s; Base roles: %s', res, roles)
return list(res)
@contextlib.contextmanager
def override_role(self):
"""Override the role used by ``os_primary`` Tempest credentials.
Temporarily change the role used by ``os_primary`` credentials to:
* ``[patrole] rbac_test_roles`` before test execution
* ``[identity] admin_role`` after test execution
Automatically switches to admin role after test execution.
:returns: None
.. warning::
This function can alter user roles for pre-provisioned credentials.
Work is underway to safely clean up after this function.
Example::
@rbac_rule_validation.action(service='test',
rules=['a:test:rule'])
def test_foo(self):
# Allocate test-level resources here.
with self.override_role():
# The role for `os_primary` has now been overridden. Within
# this block, call the API endpoint that enforces the
# expected policy specified by "rule" in the decorator.
self.foo_service.bar_api_call()
# The role is switched back to admin automatically. Note that
# if the API call above threw an exception, any code below this
# point in the test is not executed.
"""
self._set_override_role_called()
self._override_role(True)
try:
# Execute the test.
yield
finally:
# Check whether an exception was raised. If so, remember that
# for future validation.
exc = sys.exc_info()[0]
if exc is not None:
self._set_override_role_caught_exc()
# This code block is always executed, no matter the result of the
# test. Automatically switch back to the admin role for test clean
# up.
self._override_role(False)
@classmethod
def _override_role(cls, toggle_rbac_role=False):
"""Private helper for overriding ``os_primary`` Tempest credentials.
:param toggle_rbac_role: Boolean value that controls the role that
overrides default role of ``os_primary`` credentials.
* If True: role is set to ``[patrole] rbac_test_role``
* If False: role is set to ``[identity] admin_role``
"""
LOG.debug('Overriding role to: %s.', toggle_rbac_role)
roles_already_present = False
try:
target_roles = (cls._rbac_role_ids
if toggle_rbac_role else [cls._admin_role_id])
roles_already_present = cls._list_and_clear_user_roles_on_project(
target_roles)
# Do not override roles if `target_role` already exists.
if not roles_already_present:
cls._create_user_role_on_project(target_roles)
except Exception as exp:
with excutils.save_and_reraise_exception():
LOG.exception(exp)
finally:
auth_providers = cls.get_auth_providers()
for provider in auth_providers:
provider.clear_auth()
# Fernet tokens are not subsecond aware so sleep to ensure we are
# passing the second boundary before attempting to authenticate.
# Only sleep if a token revocation occurred as a result of role
# overriding. This will optimize test runtime in the case where
# ``[identity] admin_role`` == ``[patrole] rbac_test_roles``.
if not roles_already_present:
time.sleep(1)
for provider in auth_providers:
provider.set_auth()
@classmethod
def _init_roles(cls):
available_roles = cls.admin_roles_client.list_roles()['roles']
cls._role_map = {r['name']: r['id'] for r in available_roles}
LOG.debug('Available roles: %s', cls._role_map.keys())
rbac_role_ids = []
roles = CONF.patrole.rbac_test_roles
# TODO(vegasq) drop once CONF.patrole.rbac_test_role is removed
if CONF.patrole.rbac_test_role:
if not roles:
roles.append(CONF.patrole.rbac_test_role)
for role_name in roles:
rbac_role_ids.append(cls._role_map.get(role_name))
admin_role_id = cls._role_map.get(CONF.identity.admin_role)
if not all([admin_role_id, all(rbac_role_ids)]):
missing_roles = []
msg = ("Could not find `[patrole] rbac_test_roles` or "
"`[identity] admin_role`, both of which are required for "
"RBAC testing.")
if not admin_role_id:
missing_roles.append(CONF.identity.admin_role)
if not all(rbac_role_ids):
missing_roles += [role_name for role_name in roles
if role_name not in cls._role_map]
msg += " Following roles were not found: %s." % (
", ".join(missing_roles))
msg += " Available roles: %s." % ", ".join(cls._role_map)
raise rbac_exceptions.RbacResourceSetupFailed(msg)
cls._admin_role_id = admin_role_id
cls._rbac_role_ids = rbac_role_ids
# Adding backward mapping
cls._role_map.update({v: k for k, v in cls._role_map.items()})
@classmethod
def _create_user_role_on_project(cls, role_ids):
for role_id in role_ids:
cls.admin_roles_client.create_user_role_on_project(
cls._project_id, cls._user_id, role_id)
@classmethod
def _list_and_clear_user_roles_on_project(cls, role_ids):
roles = cls.admin_roles_client.list_user_roles_on_project(
cls._project_id, cls._user_id)['roles']
all_role_ids = [role['id'] for role in roles]
# NOTE(felipemonteiro): We do not use ``role_id in all_role_ids`` here
# to avoid over-permission errors: if the current list of roles on the
# project includes "admin" and "Member", and we are switching to the
# "Member" role, then we must delete the "admin" role. Thus, we only
# return early if the user's roles on the project are an exact match.
if set(role_ids) == set(all_role_ids):
return True
for role in roles:
cls.admin_roles_client.delete_role_from_user_on_project(
cls._project_id, cls._user_id, role['id'])
return False
@contextlib.contextmanager
def override_role_and_validate_list(self,
admin_resources=None,
admin_resource_id=None):
"""Call ``override_role`` and validate RBAC for a list API action.
List actions usually do soft authorization: partial or empty response
bodies are returned instead of exceptions. This helper validates
that unauthorized roles only return a subset of the available
resources.
Should only be used for validating list API actions.
:param test_obj: Instance of ``tempest.test.BaseTestCase``.
:param list admin_resources: The list of resources received before
calling the ``override_role_and_validate_list`` function.
:param UUID admin_resource_id: An ID of a resource created before
calling the ``override_role_and_validate_list`` function.
:return: py:class:`_ValidateListContext` object.
Example::
# the resource created by admin
admin_resource_id = (
self.ntp_client.create_dscp_marking_rule()
["dscp_marking_rule"]["id'])
with self.override_role_and_validate_list(
admin_resource_id=admin_resource_id) as ctx:
# the list of resources available for member role
ctx.resources = self.ntp_client.list_dscp_marking_rules(
policy_id=self.policy_id)["dscp_marking_rules"]
"""
ctx = _ValidateListContext(admin_resources, admin_resource_id)
with self.override_role():
yield ctx
ctx._validate()
@classmethod
def get_auth_providers(cls):
"""Returns list of auth_providers used within test.
Tests may redefine this method to include their own or third party
client auth_providers.
"""
return [cls.os_primary.auth_provider]
def _set_override_role_called(self):
"""Helper for tracking whether ``override_role`` was called."""
self.__override_role_called = True
def _set_override_role_caught_exc(self):
"""Helper for tracking whether exception was thrown inside
``override_role``.
"""
self.__override_role_caught_exc = True
def _validate_override_role_called(self):
"""Idempotently validate that ``override_role`` is called and reset
its value to False for sequential tests.
"""
was_called = self.__override_role_called
self.__override_role_called = False
return was_called
def _validate_override_role_caught_exc(self):
"""Idempotently validate that exception was caught inside
``override_role``, so that, by process of elimination, it can be
determined whether one was thrown outside (which is invalid).
"""
caught_exception = self.__override_role_caught_exc
self.__override_role_caught_exc = False
return caught_exception
def is_admin():
"""Verifies whether the current test role equals the admin role.
:returns: True if ``rbac_test_roles`` contain the admin role.
"""
roles = CONF.patrole.rbac_test_roles
# TODO(vegasq) drop once CONF.patrole.rbac_test_role is removed
if CONF.patrole.rbac_test_role:
roles.append(CONF.patrole.rbac_test_role)
roles = list(set(roles))
# TODO(felipemonteiro): Make this more robust via a context is admin
# lookup.
return CONF.identity.admin_role in roles
| en | 0.774662 | # Copyright 2017 AT&T Corporation. # All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); you may # not use this file except in compliance with the License. You may obtain # a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, WITHOUT # WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the # License for the specific language governing permissions and limitations # under the License. Context class responsible for validation of the list functions. This class is used in ``override_role_and_validate_list`` function and the result of a list function must be assigned to the ``ctx.resources`` variable. Example:: with self.override_role_and_validate_list(...) as ctx: ctx.resources = list_function() Constructor for ``ValidateListContext``. Either ``admin_resources`` or ``admin_resource_id`` should be used, not both. :param list admin_resources: The list of resources received before calling the ``override_role_and_validate_list`` function. To validate will be used the ``_validate_len`` function. :param UUID admin_resource_id: An ID of a resource created before calling the ``override_role_and_validate_list`` function. To validate will be used the ``_validate_resource`` function. :raises RbacValidateListException: if both ``admin_resources`` and ``admin_resource_id`` are set or unset. Validates that the number of resources is less than admin resources. Validates that the admin resource is present in the resources. Calls the proper validation function. :raises RbacValidateListException: if the ``ctx.resources`` variable is not assigned. Utility mixin responsible for switching ``os_primary`` role. Should be used as a mixin class alongside an instance of :py:class:`tempest.test.BaseTestCase` to perform Patrole class setup for a base RBAC class. Child classes should not use this mixin. Example:: class BaseRbacTest(rbac_utils.RbacUtilsMixin, base.BaseV2ComputeTest): @classmethod def setup_clients(cls): super(BaseRbacTest, cls).setup_clients() cls.hosts_client = cls.os_primary.hosts_client ... This class is responsible for overriding the value of the primary Tempest credential's role (i.e. ``os_primary`` role). By doing so, it is possible to seamlessly swap between admin credentials, needed for setup and clean up, and primary credentials, needed to perform the API call which does policy enforcement. The primary credentials always cycle between roles defined by ``CONF.identity.admin_role`` and ``CONF.patrole.rbac_test_roles``. # Shows if override_role was called. # Shows if exception raised during override_role. # Store the user's original roles and rollback after testing. # Change default role to admin Preparing roles mapping to support role inferences Making query to `list-all-role-inference-rules`_ keystone API returns all inference rules, which makes it possible to prepare roles mapping. It walks recursively through the raw data:: {"role_inferences": [ { "implies": [{"id": "3", "name": "reader"}], "prior_role": {"id": "2", "name": "member"} }, { "implies": [{"id": "2", "name": "member"}], "prior_role": {"id": "1", "name": "admin"} } ] } and converts it to the mapping:: { "2": ["3"], # "member": ["reader"], "1": ["2", "3"] # "admin": ["member", "reader"] } .. _list-all-role-inference-rules: https://docs.openstack.org/api-ref/identity/v3/#list-all-role-inference-rules # noqa: E501 Extending given roles with roles from mapping Examples:: ["admin"] >> ["admin", "member", "reader"] ["member"] >> ["member", "reader"] ["reader"] >> ["reader"] ["custom_role"] >> ["custom_role"] :param roles: list of roles :return: extended list of roles Override the role used by ``os_primary`` Tempest credentials. Temporarily change the role used by ``os_primary`` credentials to: * ``[patrole] rbac_test_roles`` before test execution * ``[identity] admin_role`` after test execution Automatically switches to admin role after test execution. :returns: None .. warning:: This function can alter user roles for pre-provisioned credentials. Work is underway to safely clean up after this function. Example:: @rbac_rule_validation.action(service='test', rules=['a:test:rule']) def test_foo(self): # Allocate test-level resources here. with self.override_role(): # The role for `os_primary` has now been overridden. Within # this block, call the API endpoint that enforces the # expected policy specified by "rule" in the decorator. self.foo_service.bar_api_call() # The role is switched back to admin automatically. Note that # if the API call above threw an exception, any code below this # point in the test is not executed. # Execute the test. # Check whether an exception was raised. If so, remember that # for future validation. # This code block is always executed, no matter the result of the # test. Automatically switch back to the admin role for test clean # up. Private helper for overriding ``os_primary`` Tempest credentials. :param toggle_rbac_role: Boolean value that controls the role that overrides default role of ``os_primary`` credentials. * If True: role is set to ``[patrole] rbac_test_role`` * If False: role is set to ``[identity] admin_role`` # Do not override roles if `target_role` already exists. # Fernet tokens are not subsecond aware so sleep to ensure we are # passing the second boundary before attempting to authenticate. # Only sleep if a token revocation occurred as a result of role # overriding. This will optimize test runtime in the case where # ``[identity] admin_role`` == ``[patrole] rbac_test_roles``. # TODO(vegasq) drop once CONF.patrole.rbac_test_role is removed # Adding backward mapping # NOTE(felipemonteiro): We do not use ``role_id in all_role_ids`` here # to avoid over-permission errors: if the current list of roles on the # project includes "admin" and "Member", and we are switching to the # "Member" role, then we must delete the "admin" role. Thus, we only # return early if the user's roles on the project are an exact match. Call ``override_role`` and validate RBAC for a list API action. List actions usually do soft authorization: partial or empty response bodies are returned instead of exceptions. This helper validates that unauthorized roles only return a subset of the available resources. Should only be used for validating list API actions. :param test_obj: Instance of ``tempest.test.BaseTestCase``. :param list admin_resources: The list of resources received before calling the ``override_role_and_validate_list`` function. :param UUID admin_resource_id: An ID of a resource created before calling the ``override_role_and_validate_list`` function. :return: py:class:`_ValidateListContext` object. Example:: # the resource created by admin admin_resource_id = ( self.ntp_client.create_dscp_marking_rule() ["dscp_marking_rule"]["id']) with self.override_role_and_validate_list( admin_resource_id=admin_resource_id) as ctx: # the list of resources available for member role ctx.resources = self.ntp_client.list_dscp_marking_rules( policy_id=self.policy_id)["dscp_marking_rules"] Returns list of auth_providers used within test. Tests may redefine this method to include their own or third party client auth_providers. Helper for tracking whether ``override_role`` was called. Helper for tracking whether exception was thrown inside ``override_role``. Idempotently validate that ``override_role`` is called and reset its value to False for sequential tests. Idempotently validate that exception was caught inside ``override_role``, so that, by process of elimination, it can be determined whether one was thrown outside (which is invalid). Verifies whether the current test role equals the admin role. :returns: True if ``rbac_test_roles`` contain the admin role. # TODO(vegasq) drop once CONF.patrole.rbac_test_role is removed # TODO(felipemonteiro): Make this more robust via a context is admin # lookup. | 2.100171 | 2 |
core/my_widgets/drug_picker.py | kimera1999/pmpktn | 0 | 2845 | from initialize import *
from core.db.db_func import query_linedrug_list
import os
import wx
class DrugPopup(wx.ComboPopup):
def __init__(self, parent):
super().__init__()
self.lc = None
self.mv = parent.mv
self.init_d_l = query_linedrug_list(self.mv.sess).all()
self.d_l = []
def Create(self, parent):
self.lc = wx.ListCtrl(
parent,
style=wx.LC_REPORT | wx.LC_SINGLE_SEL | wx.SIMPLE_BORDER)
self.lc.AppendColumn('Thuốc', width=200)
self.lc.AppendColumn('Thành phần', width=150)
self.lc.AppendColumn('Số lượng')
self.lc.AppendColumn('Đơn giá')
self.lc.AppendColumn('Cách dùng', width=100)
self.lc.Bind(wx.EVT_MOTION, self.OnMotion)
self.lc.Bind(wx.EVT_LEFT_DOWN, self.OnLeftDown)
self.lc.Bind(wx.EVT_KEY_DOWN, self.onKeyPress)
self.Update()
return True
def Init(self):
self.value = -1
self.curitem = -1
def GetControl(self):
return self.lc
def SetStringValue(self, val):
idx = self.lc.FindItem(-1, val)
if idx != wx.NOT_FOUND:
self.lc.Select(idx)
def GetStringValue(self):
if self.value >= 0:
return self.lc.GetItemText(self.value, col=0)
return ""
def GetAdjustedSize(self, minWidth, prefHeight, maxHeight):
return super().GetAdjustedSize(*popup_size)
def Update(self, s=''):
self.lc.DeleteAllItems()
self.d_l = list(filter(
lambda x: s.casefold() in x.name.casefold() or s.casefold() in x.element.casefold(),
self.init_d_l))
for index, item in enumerate(self.d_l):
self.lc.Append(
[item.name, item.element, item.quantity, item.sale_price, item.usage])
if item.quantity <= user_setting["so_luong_thuoc_toi_thieu_de_bao_dong_do"]:
self.lc.SetItemTextColour(index, wx.Colour(252, 3, 57, 255))
def OnMotion(self, e):
item, flags = self.lc.HitTest(e.GetPosition())
if item >= 0:
self.lc.Select(item)
self.curitem = item
def OnLeftDown(self, e):
try:
self.value = self.curitem
self.ComboCtrl.drugWH = self.d_l[self.value]
self.Dismiss()
self.ComboCtrl.SelectAll()
self.ComboCtrl.SetInsertionPointEnd()
except IndexError:
self.Dismiss()
def OnPopup(self):
self.Init()
self.Update(self.ComboCtrl.Value)
if self.lc.ItemCount > 0:
if self.curitem < (self.lc.ItemCount - 1):
self.curitem += 1
self.lc.Select(self.curitem)
self.lc.EnsureVisible(self.curitem)
def KeyDown(self):
if self.lc.ItemCount > 0:
if self.curitem < (self.lc.ItemCount - 1):
self.curitem += 1
self.lc.Select(self.curitem)
self.lc.EnsureVisible(self.curitem)
def KeyUp(self):
if self.lc.ItemCount > 0:
if self.curitem > 0:
self.curitem -= 1
self.lc.Select(self.curitem)
self.lc.EnsureVisible(self.curitem)
else:
self.KeyESC()
def KeyESC(self):
a = self.ComboCtrl.Value
self.Dismiss()
self.ComboCtrl.ChangeValue(a)
self.ComboCtrl.SetInsertionPointEnd()
def KeyReturn(self):
self.OnLeftDown(None)
def onKeyPress(self, e):
c = e.GetKeyCode()
if c == wx.WXK_DOWN:
self.KeyDown()
elif c == wx.WXK_UP:
self.KeyUp()
elif c == wx.WXK_ESCAPE:
self.KeyESC()
elif c == wx.WXK_RETURN:
self.KeyReturn()
class DrugPicker(wx.ComboCtrl):
def __init__(self, parent):
super().__init__(parent, size=drugctrl_size, style=wx.TE_PROCESS_ENTER)
self.mv = parent.mv
self.drug_popup = DrugPopup(self)
self.SetPopupControl(self.drug_popup)
self.Bind(wx.EVT_KEY_DOWN, self.onKeyPress)
self.Bind(wx.EVT_TEXT, self.onTextChange)
self.SetHint("Nhấn Enter để search thuốc")
self._drugWH = None
self.EnablePopupAnimation(enable=False)
@property
def drugWH(self):
return self._drugWH
@drugWH.setter
def drugWH(self, dwh):
self._drugWH = dwh
pg = self.Parent
if dwh:
pg.usage_unit.Label = dwh.usage_unit + " "
pg.sale_unit.Label = dwh.sale_unit + " "
else:
self.ChangeValue('')
pg.dosage_per.ChangeValue('')
pg.usage_unit.Label = '{Đơn vị} '
pg.times.ChangeValue("")
pg.quantity.ChangeValue("")
pg.sale_unit.Label = '{Đơn vị} '
pg.usage.ChangeValue("")
def onKeyPress(self, e):
if os.name == "posix":
if e.GetKeyCode() in [wx.WXK_RETURN, wx.WXK_DOWN]:
if not self.IsPopupShown():
self.Popup()
else:
e.Skip()
else:
if e.GetKeyCode() not in [wx.WXK_RETURN,
wx.WXK_UP,
wx.WXK_DOWN,
wx.WXK_ESCAPE]:
if self.IsPopupShown():
a = self.Value
self.Dismiss()
self.ChangeValue(a)
self.SetInsertionPointEnd()
e.Skip()
def onTextChange(self, e):
if os.name == "nt":
if e.String == "":
self.Clear()
elif len(e.String) >= 1:
if not self.IsPopupShown():
self.Popup()
self.SetInsertionPointEnd()
if os.name == "posix":
if e.String == "":
self.Clear()
def Clear(self):
self.drugWH = None
def refreshPopup(self):
self.drug_popup.init_d_l = query_linedrug_list(self.mv.sess).all()
| from initialize import *
from core.db.db_func import query_linedrug_list
import os
import wx
class DrugPopup(wx.ComboPopup):
def __init__(self, parent):
super().__init__()
self.lc = None
self.mv = parent.mv
self.init_d_l = query_linedrug_list(self.mv.sess).all()
self.d_l = []
def Create(self, parent):
self.lc = wx.ListCtrl(
parent,
style=wx.LC_REPORT | wx.LC_SINGLE_SEL | wx.SIMPLE_BORDER)
self.lc.AppendColumn('Thuốc', width=200)
self.lc.AppendColumn('Thành phần', width=150)
self.lc.AppendColumn('Số lượng')
self.lc.AppendColumn('Đơn giá')
self.lc.AppendColumn('Cách dùng', width=100)
self.lc.Bind(wx.EVT_MOTION, self.OnMotion)
self.lc.Bind(wx.EVT_LEFT_DOWN, self.OnLeftDown)
self.lc.Bind(wx.EVT_KEY_DOWN, self.onKeyPress)
self.Update()
return True
def Init(self):
self.value = -1
self.curitem = -1
def GetControl(self):
return self.lc
def SetStringValue(self, val):
idx = self.lc.FindItem(-1, val)
if idx != wx.NOT_FOUND:
self.lc.Select(idx)
def GetStringValue(self):
if self.value >= 0:
return self.lc.GetItemText(self.value, col=0)
return ""
def GetAdjustedSize(self, minWidth, prefHeight, maxHeight):
return super().GetAdjustedSize(*popup_size)
def Update(self, s=''):
self.lc.DeleteAllItems()
self.d_l = list(filter(
lambda x: s.casefold() in x.name.casefold() or s.casefold() in x.element.casefold(),
self.init_d_l))
for index, item in enumerate(self.d_l):
self.lc.Append(
[item.name, item.element, item.quantity, item.sale_price, item.usage])
if item.quantity <= user_setting["so_luong_thuoc_toi_thieu_de_bao_dong_do"]:
self.lc.SetItemTextColour(index, wx.Colour(252, 3, 57, 255))
def OnMotion(self, e):
item, flags = self.lc.HitTest(e.GetPosition())
if item >= 0:
self.lc.Select(item)
self.curitem = item
def OnLeftDown(self, e):
try:
self.value = self.curitem
self.ComboCtrl.drugWH = self.d_l[self.value]
self.Dismiss()
self.ComboCtrl.SelectAll()
self.ComboCtrl.SetInsertionPointEnd()
except IndexError:
self.Dismiss()
def OnPopup(self):
self.Init()
self.Update(self.ComboCtrl.Value)
if self.lc.ItemCount > 0:
if self.curitem < (self.lc.ItemCount - 1):
self.curitem += 1
self.lc.Select(self.curitem)
self.lc.EnsureVisible(self.curitem)
def KeyDown(self):
if self.lc.ItemCount > 0:
if self.curitem < (self.lc.ItemCount - 1):
self.curitem += 1
self.lc.Select(self.curitem)
self.lc.EnsureVisible(self.curitem)
def KeyUp(self):
if self.lc.ItemCount > 0:
if self.curitem > 0:
self.curitem -= 1
self.lc.Select(self.curitem)
self.lc.EnsureVisible(self.curitem)
else:
self.KeyESC()
def KeyESC(self):
a = self.ComboCtrl.Value
self.Dismiss()
self.ComboCtrl.ChangeValue(a)
self.ComboCtrl.SetInsertionPointEnd()
def KeyReturn(self):
self.OnLeftDown(None)
def onKeyPress(self, e):
c = e.GetKeyCode()
if c == wx.WXK_DOWN:
self.KeyDown()
elif c == wx.WXK_UP:
self.KeyUp()
elif c == wx.WXK_ESCAPE:
self.KeyESC()
elif c == wx.WXK_RETURN:
self.KeyReturn()
class DrugPicker(wx.ComboCtrl):
def __init__(self, parent):
super().__init__(parent, size=drugctrl_size, style=wx.TE_PROCESS_ENTER)
self.mv = parent.mv
self.drug_popup = DrugPopup(self)
self.SetPopupControl(self.drug_popup)
self.Bind(wx.EVT_KEY_DOWN, self.onKeyPress)
self.Bind(wx.EVT_TEXT, self.onTextChange)
self.SetHint("Nhấn Enter để search thuốc")
self._drugWH = None
self.EnablePopupAnimation(enable=False)
@property
def drugWH(self):
return self._drugWH
@drugWH.setter
def drugWH(self, dwh):
self._drugWH = dwh
pg = self.Parent
if dwh:
pg.usage_unit.Label = dwh.usage_unit + " "
pg.sale_unit.Label = dwh.sale_unit + " "
else:
self.ChangeValue('')
pg.dosage_per.ChangeValue('')
pg.usage_unit.Label = '{Đơn vị} '
pg.times.ChangeValue("")
pg.quantity.ChangeValue("")
pg.sale_unit.Label = '{Đơn vị} '
pg.usage.ChangeValue("")
def onKeyPress(self, e):
if os.name == "posix":
if e.GetKeyCode() in [wx.WXK_RETURN, wx.WXK_DOWN]:
if not self.IsPopupShown():
self.Popup()
else:
e.Skip()
else:
if e.GetKeyCode() not in [wx.WXK_RETURN,
wx.WXK_UP,
wx.WXK_DOWN,
wx.WXK_ESCAPE]:
if self.IsPopupShown():
a = self.Value
self.Dismiss()
self.ChangeValue(a)
self.SetInsertionPointEnd()
e.Skip()
def onTextChange(self, e):
if os.name == "nt":
if e.String == "":
self.Clear()
elif len(e.String) >= 1:
if not self.IsPopupShown():
self.Popup()
self.SetInsertionPointEnd()
if os.name == "posix":
if e.String == "":
self.Clear()
def Clear(self):
self.drugWH = None
def refreshPopup(self):
self.drug_popup.init_d_l = query_linedrug_list(self.mv.sess).all()
| none | 1 | 2.094506 | 2 |
|
em Python/Roteiro4/Roteiro4__grafos.py | GuilhermeEsdras/Grafos | 0 | 2846 | <reponame>GuilhermeEsdras/Grafos<gh_stars>0
from Roteiro4.Roteiro4__funcoes import Grafo
class Grafos:
# Grafo da Paraíba
paraiba = Grafo(['J', 'C', 'E', 'P', 'M', 'T', 'Z'])
for aresta in ['J-C', 'C-E', 'C-E', 'C-P', 'C-P', 'C-M', 'C-T', 'M-T', 'T-Z']:
paraiba.adicionaAresta(aresta)
# --- #
# Grafo Completo
grafo_completo = Grafo(['J', 'C', 'E', 'P'])
for aresta in ['J-C', 'J-P', 'J-E', 'C-E', 'C-P', 'P-E']:
grafo_completo.adicionaAresta(aresta)
# --- #
# K3
k3 = Grafo(['A', 'B', 'C'])
for aresta in ['A-B', 'B-C', 'C-A']:
k3.adicionaAresta(aresta)
# --- #
| from Roteiro4.Roteiro4__funcoes import Grafo
class Grafos:
# Grafo da Paraíba
paraiba = Grafo(['J', 'C', 'E', 'P', 'M', 'T', 'Z'])
for aresta in ['J-C', 'C-E', 'C-E', 'C-P', 'C-P', 'C-M', 'C-T', 'M-T', 'T-Z']:
paraiba.adicionaAresta(aresta)
# --- #
# Grafo Completo
grafo_completo = Grafo(['J', 'C', 'E', 'P'])
for aresta in ['J-C', 'J-P', 'J-E', 'C-E', 'C-P', 'P-E']:
grafo_completo.adicionaAresta(aresta)
# --- #
# K3
k3 = Grafo(['A', 'B', 'C'])
for aresta in ['A-B', 'B-C', 'C-A']:
k3.adicionaAresta(aresta)
# --- # | en | 0.646492 | # Grafo da Paraíba # --- # # Grafo Completo # --- # # K3 # --- # | 2.638725 | 3 |
fuzzybee/joboard/views.py | youtaya/knight | 0 | 2847 | <filename>fuzzybee/joboard/views.py
# -*- coding: utf-8 -*-
from django.shortcuts import get_object_or_404, render_to_response, render
from django.http import HttpResponseRedirect, HttpResponse
from django.core.urlresolvers import reverse
from django.shortcuts import redirect
from joboard.models import Factory
from joboard.forms import FactoryForm
from django.template import RequestContext
from django.core.exceptions import ObjectDoesNotExist
from urllib import urlopen, urlencode
import urllib2
from fuzzybee.conf import b_url, b_ak, geo_table, l_url, app_id, app_key
from utils.pack_json import toJSON, fromJSON
from django.contrib.auth.decorators import login_required
from people.models import People
import logging
logger = logging.getLogger(__name__)
@login_required
def index(request):
form = None
if request.method == 'POST':
form = FactoryForm(request.POST)
print form
if form.is_valid():
factory = form.cleaned_data
logger.debug("lat: " + str(factory['fact_lat']))
logger.debug("addr: " + factory['fact_addr'])
#save factory in model
factmodel = form.save(commit=False)
print request.user
factmodel.fact_maintainer = People.objects.get(user=request.user)
factmodel.save()
factid = factmodel.id
#save in public server: leancloud and baidu
save_factory_cloud(factory, factid)
return HttpResponseRedirect(reverse('board:detail', args=(factid,)))
else:
form = FactoryForm()
return render_to_response('board/new.html', {'form': form}, context_instance=RequestContext(request))
@login_required
def detail(request, fact_id):
print fact_id
info = get_object_or_404(Factory, pk=fact_id)
return render(request, 'board/detail.html', {'info':info})
@login_required
def manager(request):
print "manager..."
try:
people = People.objects.get(user=request.user)
factory = Factory.objects.get(fact_maintainer=people)
except ObjectDoesNotExist:
print 'no hire action...'
return redirect(reverse('joboard.views.index', args=[]))
return render(request, 'board/manager.html', {'info':factory})
def save_factory_cloud(fact_info, fact_id):
title = fact_info['fact_name']
address = fact_info['fact_addr']
lat = fact_info['fact_lat']
lng = fact_info['fact_lng']
num = fact_info['hire_num']
data = {
'title': title.encode("utf-8"),
'address': address.encode("utf-8"),
'latitude': lat,
'longitude': lng,
'job_num': num,
'factory_id': fact_id,
}
head = {
'X-AVOSCloud-Application-Id': app_id,
'X-AVOSCloud-Application-Key': app_key,
'Content-Type': 'application/json',
}
req = urllib2.Request(l_url, toJSON(data), head)
print str(req)
response = urllib2.urlopen(req)
#print respone.read()
lean_response = fromJSON(response.read())
print lean_response
lean_objectId = lean_response['objectId']
# save in Baidu Map
params = urlencode({
'title': title.encode("utf-8"),
'address': address.encode("utf-8"),
'latitude': lat,
'longitude': lng,
'coord_type': 3,
'geotable_id': geo_table,
'ak': b_ak,
'job_num': num,
'lean_id': lean_objectId,
})
req = urllib2.Request(b_url, params)
#print str(req)
response = urllib2.urlopen(req)
#print respone.read()
| <filename>fuzzybee/joboard/views.py
# -*- coding: utf-8 -*-
from django.shortcuts import get_object_or_404, render_to_response, render
from django.http import HttpResponseRedirect, HttpResponse
from django.core.urlresolvers import reverse
from django.shortcuts import redirect
from joboard.models import Factory
from joboard.forms import FactoryForm
from django.template import RequestContext
from django.core.exceptions import ObjectDoesNotExist
from urllib import urlopen, urlencode
import urllib2
from fuzzybee.conf import b_url, b_ak, geo_table, l_url, app_id, app_key
from utils.pack_json import toJSON, fromJSON
from django.contrib.auth.decorators import login_required
from people.models import People
import logging
logger = logging.getLogger(__name__)
@login_required
def index(request):
form = None
if request.method == 'POST':
form = FactoryForm(request.POST)
print form
if form.is_valid():
factory = form.cleaned_data
logger.debug("lat: " + str(factory['fact_lat']))
logger.debug("addr: " + factory['fact_addr'])
#save factory in model
factmodel = form.save(commit=False)
print request.user
factmodel.fact_maintainer = People.objects.get(user=request.user)
factmodel.save()
factid = factmodel.id
#save in public server: leancloud and baidu
save_factory_cloud(factory, factid)
return HttpResponseRedirect(reverse('board:detail', args=(factid,)))
else:
form = FactoryForm()
return render_to_response('board/new.html', {'form': form}, context_instance=RequestContext(request))
@login_required
def detail(request, fact_id):
print fact_id
info = get_object_or_404(Factory, pk=fact_id)
return render(request, 'board/detail.html', {'info':info})
@login_required
def manager(request):
print "manager..."
try:
people = People.objects.get(user=request.user)
factory = Factory.objects.get(fact_maintainer=people)
except ObjectDoesNotExist:
print 'no hire action...'
return redirect(reverse('joboard.views.index', args=[]))
return render(request, 'board/manager.html', {'info':factory})
def save_factory_cloud(fact_info, fact_id):
title = fact_info['fact_name']
address = fact_info['fact_addr']
lat = fact_info['fact_lat']
lng = fact_info['fact_lng']
num = fact_info['hire_num']
data = {
'title': title.encode("utf-8"),
'address': address.encode("utf-8"),
'latitude': lat,
'longitude': lng,
'job_num': num,
'factory_id': fact_id,
}
head = {
'X-AVOSCloud-Application-Id': app_id,
'X-AVOSCloud-Application-Key': app_key,
'Content-Type': 'application/json',
}
req = urllib2.Request(l_url, toJSON(data), head)
print str(req)
response = urllib2.urlopen(req)
#print respone.read()
lean_response = fromJSON(response.read())
print lean_response
lean_objectId = lean_response['objectId']
# save in Baidu Map
params = urlencode({
'title': title.encode("utf-8"),
'address': address.encode("utf-8"),
'latitude': lat,
'longitude': lng,
'coord_type': 3,
'geotable_id': geo_table,
'ak': b_ak,
'job_num': num,
'lean_id': lean_objectId,
})
req = urllib2.Request(b_url, params)
#print str(req)
response = urllib2.urlopen(req)
#print respone.read()
| en | 0.575574 | # -*- coding: utf-8 -*- #save factory in model #save in public server: leancloud and baidu #print respone.read() # save in Baidu Map #print str(req) #print respone.read() | 1.949445 | 2 |
flask/app.py | yatsu/react-flask-graphql-example | 21 | 2848 | from flask import Flask
from flask_cors import CORS
from flask_graphql import GraphQLView
from schema import Schema
def create_app(**kwargs):
app = Flask(__name__)
app.debug = True
app.add_url_rule(
'/graphql',
view_func=GraphQLView.as_view('graphql', schema=Schema, **kwargs)
)
return app
if __name__ == '__main__':
app = create_app(graphiql=True)
CORS(app, resources={r'/graphql': {'origins': '*'}})
app.run()
| from flask import Flask
from flask_cors import CORS
from flask_graphql import GraphQLView
from schema import Schema
def create_app(**kwargs):
app = Flask(__name__)
app.debug = True
app.add_url_rule(
'/graphql',
view_func=GraphQLView.as_view('graphql', schema=Schema, **kwargs)
)
return app
if __name__ == '__main__':
app = create_app(graphiql=True)
CORS(app, resources={r'/graphql': {'origins': '*'}})
app.run()
| none | 1 | 2.149721 | 2 |
|
mortgagetvm/mortgageOptions.py | AndrewChap/mortgagetvm | 0 | 2849 | # Factory-like class for mortgage options
class MortgageOptions:
def __init__(self,kind,**inputOptions):
self.set_default_options()
self.set_kind_options(kind = kind)
self.set_input_options(**inputOptions)
def set_default_options(self):
self.optionList = dict()
self.optionList['commonDefaults'] = dict(
name = None ,
label = None ,
color = [0,0,0],
houseCost = '100%', # how much you are paying for the house
mortgageRate = '0.0%', # Mortgage annual interest rate
mortgageLength = '30Y' , # Mortgage length (in years)
downPayment = '0%' , # Percentage of house cost paid upfront
startingCash = '100%', # Amount of money you have before purchase
tvmRate = '7.0%', # Annual rate of return of savings
inflationRate = '1.8%', # Annual rate of inflation - NOT IMPLEMENTED
appreciationRate = '5.0%', # Annual rate of increase in value of house
houseValue = '100%', # how much the house is worth when you bought it
originationFees = '0.0%', # Mortgage fees as a percentage of the loan
otherMortgageFees = '0.0%', # Other fees as a percentage of the loan
otherPurchaseFees = '0.0%', # Other fees as a percentage of home value
paymentsPerYear = '12' , # Number of mortgage payments per year
taxRate = '0.0%', # Annual taxes as percentage of home value
insuranceRate = '0.0%', # Annual insurance as percentage of home value
listingFee = '0.0%', # Cost of selling the house
capitalGainsTax = '0.0%', # Paid if selling house within two years
capitalGainsPeriod = '0' , # Years after which cap gains tax is not applied
rentalIncome = '0.0%', # Monthly rental price as percentage of home value
rentalPayment = '0.0%', # Monthly rental price as percentage of home value
)
self.optionList['mortgageDefaults'] = dict(
name = 'mortgage',
label = 'Mortgage',
mortgageRate = '4.5%', # Mortgage annual interest rate
mortgageLength = '30Y' , # Mortgage length (in years)
downPayment = '20%' , # Percentage of house cost paid upfront
startingCash = '100%', # Amount of money you have before purchase
originationFees = '0.5%', # Mortgage fees as a percentage of the loan
otherMortgageFees = '0.5%', # Other fees as a percentage of the loan
otherPurchaseFees = '0.5%', # Other fees as a percentage of home value
paymentsPerYear = '12' , # Number of mortgage payments per year
taxRate = '0.6%', # Annual taxes as percentage of home value
insuranceRate = '0.4%', # Annual insurance as percentage of home value
listingFee = '6.0%', # Cost of selling the house
capitalGainsTax = '15%' , # Paid if selling house within two years
capitalGainsPeriod = '2' , # Years after which cap gains tax is not applied
)
self.optionList['rentalDefaults'] = dict(
rentalPayment = '0.6%', # Monthly rental price as percentage of home value
)
self.optionList['investmentPropertyDefaults'] = dict(
mortgageRate = '4.5%', # Mortgage annual interest rate
mortgageLength = '30Y' , # Mortgage length (in years)
downPayment = '20%' , # Percentage of house cost paid upfront
startingCash = '100%', # Amount of money you have before purchase
tvmRate = '7.0%', # Annual rate of return of savings
inflationRate = '1.8%', # Annual rate of inflation - NOT IMPLEMENTED
appreciationRate = '5.0%', # Annual rate of increase in value of house
houseValue = '100%', # how much the house is worth when you bought it
originationFees = '0.5%', # Mortgage fees as a percentage of the loan
otherMortgageFees = '0.5%', # Other fees as a percentage of the loan
otherPurchaseFees = '0.5%', # Other fees as a percentage of home value
paymentsPerYear = '12' , # Number of mortgage payments per year
taxRate = '0.6%', # Annual taxes as percentage of home value
insuranceRate = '0.4%', # Annual insurance as percentage of home value
listingFee = '6.0%', # Cost of selling the house
capitalGainsTax = '15%' , # Paid if selling house within two years
capitalGainsPeriod = '2' , # Years after which cap gains tax is not applied
rentalIncome = '0.6%', # Monthly rental price as percentage of home value
)
def set_kind_options(self,kind,**inputOptions):
self.options = self.optionList['commonDefaults']
if kind == None:
pass
elif kind == 'mortgage':
for key,val in self.optionList['mortgageDefaults'].items():
self.options[key] = val
elif kind == 'rental':
for key,val in self.optionList['rentalDefaults'].items():
self.options[key] = val
elif kind == 'investmentProperty':
for key,val in self.optionList['investmentPropertyDefaults'].items():
self.options[key] = val
def set_input_options(self,**inputOptions):
for key,val in inputOptions.items():
self.options[key] = val
| # Factory-like class for mortgage options
class MortgageOptions:
def __init__(self,kind,**inputOptions):
self.set_default_options()
self.set_kind_options(kind = kind)
self.set_input_options(**inputOptions)
def set_default_options(self):
self.optionList = dict()
self.optionList['commonDefaults'] = dict(
name = None ,
label = None ,
color = [0,0,0],
houseCost = '100%', # how much you are paying for the house
mortgageRate = '0.0%', # Mortgage annual interest rate
mortgageLength = '30Y' , # Mortgage length (in years)
downPayment = '0%' , # Percentage of house cost paid upfront
startingCash = '100%', # Amount of money you have before purchase
tvmRate = '7.0%', # Annual rate of return of savings
inflationRate = '1.8%', # Annual rate of inflation - NOT IMPLEMENTED
appreciationRate = '5.0%', # Annual rate of increase in value of house
houseValue = '100%', # how much the house is worth when you bought it
originationFees = '0.0%', # Mortgage fees as a percentage of the loan
otherMortgageFees = '0.0%', # Other fees as a percentage of the loan
otherPurchaseFees = '0.0%', # Other fees as a percentage of home value
paymentsPerYear = '12' , # Number of mortgage payments per year
taxRate = '0.0%', # Annual taxes as percentage of home value
insuranceRate = '0.0%', # Annual insurance as percentage of home value
listingFee = '0.0%', # Cost of selling the house
capitalGainsTax = '0.0%', # Paid if selling house within two years
capitalGainsPeriod = '0' , # Years after which cap gains tax is not applied
rentalIncome = '0.0%', # Monthly rental price as percentage of home value
rentalPayment = '0.0%', # Monthly rental price as percentage of home value
)
self.optionList['mortgageDefaults'] = dict(
name = 'mortgage',
label = 'Mortgage',
mortgageRate = '4.5%', # Mortgage annual interest rate
mortgageLength = '30Y' , # Mortgage length (in years)
downPayment = '20%' , # Percentage of house cost paid upfront
startingCash = '100%', # Amount of money you have before purchase
originationFees = '0.5%', # Mortgage fees as a percentage of the loan
otherMortgageFees = '0.5%', # Other fees as a percentage of the loan
otherPurchaseFees = '0.5%', # Other fees as a percentage of home value
paymentsPerYear = '12' , # Number of mortgage payments per year
taxRate = '0.6%', # Annual taxes as percentage of home value
insuranceRate = '0.4%', # Annual insurance as percentage of home value
listingFee = '6.0%', # Cost of selling the house
capitalGainsTax = '15%' , # Paid if selling house within two years
capitalGainsPeriod = '2' , # Years after which cap gains tax is not applied
)
self.optionList['rentalDefaults'] = dict(
rentalPayment = '0.6%', # Monthly rental price as percentage of home value
)
self.optionList['investmentPropertyDefaults'] = dict(
mortgageRate = '4.5%', # Mortgage annual interest rate
mortgageLength = '30Y' , # Mortgage length (in years)
downPayment = '20%' , # Percentage of house cost paid upfront
startingCash = '100%', # Amount of money you have before purchase
tvmRate = '7.0%', # Annual rate of return of savings
inflationRate = '1.8%', # Annual rate of inflation - NOT IMPLEMENTED
appreciationRate = '5.0%', # Annual rate of increase in value of house
houseValue = '100%', # how much the house is worth when you bought it
originationFees = '0.5%', # Mortgage fees as a percentage of the loan
otherMortgageFees = '0.5%', # Other fees as a percentage of the loan
otherPurchaseFees = '0.5%', # Other fees as a percentage of home value
paymentsPerYear = '12' , # Number of mortgage payments per year
taxRate = '0.6%', # Annual taxes as percentage of home value
insuranceRate = '0.4%', # Annual insurance as percentage of home value
listingFee = '6.0%', # Cost of selling the house
capitalGainsTax = '15%' , # Paid if selling house within two years
capitalGainsPeriod = '2' , # Years after which cap gains tax is not applied
rentalIncome = '0.6%', # Monthly rental price as percentage of home value
)
def set_kind_options(self,kind,**inputOptions):
self.options = self.optionList['commonDefaults']
if kind == None:
pass
elif kind == 'mortgage':
for key,val in self.optionList['mortgageDefaults'].items():
self.options[key] = val
elif kind == 'rental':
for key,val in self.optionList['rentalDefaults'].items():
self.options[key] = val
elif kind == 'investmentProperty':
for key,val in self.optionList['investmentPropertyDefaults'].items():
self.options[key] = val
def set_input_options(self,**inputOptions):
for key,val in inputOptions.items():
self.options[key] = val
| en | 0.959709 | # Factory-like class for mortgage options # how much you are paying for the house # Mortgage annual interest rate # Mortgage length (in years) # Percentage of house cost paid upfront # Amount of money you have before purchase # Annual rate of return of savings # Annual rate of inflation - NOT IMPLEMENTED # Annual rate of increase in value of house # how much the house is worth when you bought it # Mortgage fees as a percentage of the loan # Other fees as a percentage of the loan # Other fees as a percentage of home value # Number of mortgage payments per year # Annual taxes as percentage of home value # Annual insurance as percentage of home value # Cost of selling the house # Paid if selling house within two years # Years after which cap gains tax is not applied # Monthly rental price as percentage of home value # Monthly rental price as percentage of home value # Mortgage annual interest rate # Mortgage length (in years) # Percentage of house cost paid upfront # Amount of money you have before purchase # Mortgage fees as a percentage of the loan # Other fees as a percentage of the loan # Other fees as a percentage of home value # Number of mortgage payments per year # Annual taxes as percentage of home value # Annual insurance as percentage of home value # Cost of selling the house # Paid if selling house within two years # Years after which cap gains tax is not applied # Monthly rental price as percentage of home value # Mortgage annual interest rate # Mortgage length (in years) # Percentage of house cost paid upfront # Amount of money you have before purchase # Annual rate of return of savings # Annual rate of inflation - NOT IMPLEMENTED # Annual rate of increase in value of house # how much the house is worth when you bought it # Mortgage fees as a percentage of the loan # Other fees as a percentage of the loan # Other fees as a percentage of home value # Number of mortgage payments per year # Annual taxes as percentage of home value # Annual insurance as percentage of home value # Cost of selling the house # Paid if selling house within two years # Years after which cap gains tax is not applied # Monthly rental price as percentage of home value | 2.940657 | 3 |
DD/Terrain.py | CodingBullywug/DDreshape | 2 | 2850 | from DD.utils import PoolByteArray2NumpyArray, NumpyArray2PoolByteArray
from DD.Entity import Entity
import numpy as np
class Terrain(Entity):
def __init__(self, json, width, height, scale=4, terrain_types=4):
super(Terrain, self).__init__(json)
self._scale = scale
self.terrain_types = terrain_types
self.splat = PoolByteArray2NumpyArray(self._json['splat']).reshape(height*self._scale, width*self._scale, self.terrain_types, order='C')
def get_json(self):
json = self._json
json['splat'] = NumpyArray2PoolByteArray(self.splat.reshape(np.prod(self.splat.shape), order='C'))
return json
def pad(self, top, bottom, left, right):
self.splat = np.pad(self.splat,
((top*self._scale, bottom*self._scale), (left*self._scale, right*self._scale), (0,0)),
mode='edge')
def crop(self, top, bottom, left, right):
self.splat = self._crop_map_safe(self.splat, top, bottom, left, right, self._scale)
def fliplr(self, width):
self.splat = np.fliplr(self.splat)
def flipud(self, height):
self.splat = np.flipud(self.splat)
def rot90(self, width, height):
self.splat = self._rot90_map(self.splat)
def rot180(self, width, height):
self.splat = self._rot180_map(self.splat)
def rot270(self, width, height):
self.splat = self._rot270_map(self.splat)
| from DD.utils import PoolByteArray2NumpyArray, NumpyArray2PoolByteArray
from DD.Entity import Entity
import numpy as np
class Terrain(Entity):
def __init__(self, json, width, height, scale=4, terrain_types=4):
super(Terrain, self).__init__(json)
self._scale = scale
self.terrain_types = terrain_types
self.splat = PoolByteArray2NumpyArray(self._json['splat']).reshape(height*self._scale, width*self._scale, self.terrain_types, order='C')
def get_json(self):
json = self._json
json['splat'] = NumpyArray2PoolByteArray(self.splat.reshape(np.prod(self.splat.shape), order='C'))
return json
def pad(self, top, bottom, left, right):
self.splat = np.pad(self.splat,
((top*self._scale, bottom*self._scale), (left*self._scale, right*self._scale), (0,0)),
mode='edge')
def crop(self, top, bottom, left, right):
self.splat = self._crop_map_safe(self.splat, top, bottom, left, right, self._scale)
def fliplr(self, width):
self.splat = np.fliplr(self.splat)
def flipud(self, height):
self.splat = np.flipud(self.splat)
def rot90(self, width, height):
self.splat = self._rot90_map(self.splat)
def rot180(self, width, height):
self.splat = self._rot180_map(self.splat)
def rot270(self, width, height):
self.splat = self._rot270_map(self.splat)
| none | 1 | 2.397592 | 2 |
|
bluesky/tests/utils.py | AbbyGi/bluesky | 43 | 2851 | <reponame>AbbyGi/bluesky<filename>bluesky/tests/utils.py<gh_stars>10-100
from collections import defaultdict
import contextlib
import tempfile
import sys
import threading
import asyncio
@contextlib.contextmanager
def _print_redirect():
old_stdout = sys.stdout
try:
fout = tempfile.TemporaryFile(mode="w+", encoding="utf-8")
sys.stdout = fout
yield fout
finally:
sys.stdout = old_stdout
class MsgCollector:
def __init__(self, msg_hook=None):
self.msgs = []
self.msg_hook = msg_hook
def __call__(self, msg):
self.msgs.append(msg)
if self.msg_hook:
self.msg_hook(msg)
class DocCollector:
def __init__(self):
self.start = []
self.stop = {}
self.descriptor = defaultdict(list)
self.event = {}
def insert(self, name, doc):
if name == "start":
self.start.append(doc)
elif name == "stop":
self.stop[doc["run_start"]] = doc
elif name == "descriptor":
self.descriptor[doc["run_start"]].append(doc)
self.event[doc["uid"]] = []
elif name == 'bulk_events':
for k, v in doc.items():
self.event[k].extend(v)
else:
self.event[doc["descriptor"]].append(doc)
def _fabricate_asycio_event(loop):
th_ev = threading.Event()
aio_event = None
def really_make_the_event():
nonlocal aio_event
aio_event = asyncio.Event()
th_ev.set()
h = loop.call_soon_threadsafe(really_make_the_event)
if not th_ev.wait(0.1):
h.cancel()
raise Exception("failed to make asyncio event")
return aio_event
| from collections import defaultdict
import contextlib
import tempfile
import sys
import threading
import asyncio
@contextlib.contextmanager
def _print_redirect():
old_stdout = sys.stdout
try:
fout = tempfile.TemporaryFile(mode="w+", encoding="utf-8")
sys.stdout = fout
yield fout
finally:
sys.stdout = old_stdout
class MsgCollector:
def __init__(self, msg_hook=None):
self.msgs = []
self.msg_hook = msg_hook
def __call__(self, msg):
self.msgs.append(msg)
if self.msg_hook:
self.msg_hook(msg)
class DocCollector:
def __init__(self):
self.start = []
self.stop = {}
self.descriptor = defaultdict(list)
self.event = {}
def insert(self, name, doc):
if name == "start":
self.start.append(doc)
elif name == "stop":
self.stop[doc["run_start"]] = doc
elif name == "descriptor":
self.descriptor[doc["run_start"]].append(doc)
self.event[doc["uid"]] = []
elif name == 'bulk_events':
for k, v in doc.items():
self.event[k].extend(v)
else:
self.event[doc["descriptor"]].append(doc)
def _fabricate_asycio_event(loop):
th_ev = threading.Event()
aio_event = None
def really_make_the_event():
nonlocal aio_event
aio_event = asyncio.Event()
th_ev.set()
h = loop.call_soon_threadsafe(really_make_the_event)
if not th_ev.wait(0.1):
h.cancel()
raise Exception("failed to make asyncio event")
return aio_event | none | 1 | 2.368826 | 2 |
|
cli/check_json.py | MJJojo97/openslides-backend | 0 | 2852 | import json
import sys
from openslides_backend.models.checker import Checker, CheckException
def main() -> int:
files = sys.argv[1:]
if not files:
print("No files specified.")
return 1
possible_modes = tuple(f"--{mode}" for mode in Checker.modes)
modes = tuple(mode[2:] for mode in possible_modes if mode in files)
if len(modes) == 0:
mode = "all"
elif len(modes) > 1:
print(f"You can only choose one mode of {', '.join(possible_modes)}.")
exit(1)
else:
mode = modes[0]
if len(modes):
files = [x for x in files if x not in possible_modes]
failed = False
for f in files:
with open(f) as data:
try:
Checker(
json.load(data),
mode=mode,
).run_check()
except CheckException as e:
print(f"Check for {f} failed:\n", e)
failed = True
else:
print(f"Check for {f} successful.")
return 1 if failed else 0
if __name__ == "__main__":
sys.exit(main())
| import json
import sys
from openslides_backend.models.checker import Checker, CheckException
def main() -> int:
files = sys.argv[1:]
if not files:
print("No files specified.")
return 1
possible_modes = tuple(f"--{mode}" for mode in Checker.modes)
modes = tuple(mode[2:] for mode in possible_modes if mode in files)
if len(modes) == 0:
mode = "all"
elif len(modes) > 1:
print(f"You can only choose one mode of {', '.join(possible_modes)}.")
exit(1)
else:
mode = modes[0]
if len(modes):
files = [x for x in files if x not in possible_modes]
failed = False
for f in files:
with open(f) as data:
try:
Checker(
json.load(data),
mode=mode,
).run_check()
except CheckException as e:
print(f"Check for {f} failed:\n", e)
failed = True
else:
print(f"Check for {f} successful.")
return 1 if failed else 0
if __name__ == "__main__":
sys.exit(main())
| none | 1 | 2.814673 | 3 |
|
utils/mgmt.py | robinagist/manic | 2 | 2853 | <filename>utils/mgmt.py
from utils.data import load_memfile_configs
from utils.server import plain_response
from sanic import response
def get_mappedfile_configs():
cfgs = load_memfile_configs()
return response.json(plain_response(cfgs, 0), status=200)
def created_mapped_file():
pass
def delete_mapped_file():
pass | <filename>utils/mgmt.py
from utils.data import load_memfile_configs
from utils.server import plain_response
from sanic import response
def get_mappedfile_configs():
cfgs = load_memfile_configs()
return response.json(plain_response(cfgs, 0), status=200)
def created_mapped_file():
pass
def delete_mapped_file():
pass | none | 1 | 1.839647 | 2 |
|
datasets/medicalImage.py | UpCoder/YNe | 0 | 2854 | # -*- coding=utf-8 -*-
import SimpleITK as itk
import pydicom
import numpy as np
from PIL import Image, ImageDraw
import gc
from skimage.morphology import disk, dilation
import nipy
import os
from glob import glob
import scipy
import cv2
from xml.dom.minidom import Document
typenames = ['CYST', 'FNH', 'HCC', 'HEM', 'METS']
typeids = [0, 1, 2, 3, 4]
def get_voxel_size(file_path):
load_image_obj = nipy.load_image(file_path)
header = load_image_obj.header
x_size = header['srow_x'][0]
y_size = header['srow_y'][1]
z_size = header['srow_z'][2]
return [x_size, y_size, z_size]
def read_nii(file_path):
return nipy.load_image(file_path).get_data()
def read_nii_with_header(file_path):
img_obj = nipy.load_image(file_path)
header_obj = img_obj.header
res_dict = {}
res_dict['voxel_spacing'] = [header_obj['srow_x'][0], header_obj['srow_y'][1], header_obj['srow_z'][2]]
img_arr = img_obj.get_data()
return img_arr, res_dict
# 读取文件序列
def read_dicom_series(dir_name):
reader = itk.ImageSeriesReader()
dicom_series = reader.GetGDCMSeriesFileNames(dir_name)
reader.SetFileNames(dicom_series)
images = reader.Execute()
image_array = itk.GetArrayFromImage(images)
return image_array
# 将DICOM序列转化成MHD文件
def convert_dicomseries2mhd(dicom_series_dir, save_path):
data = read_dicom_series(dicom_series_dir)
save_mhd_image(data, save_path)
# 读取单个DICOM文件
def read_dicom_file(file_name):
header = pydicom.read_file(file_name)
image = header.pixel_array
image = header.RescaleSlope * image + header.RescaleIntercept
return image
# 读取mhd文件
def read_mhd_image(file_path, rejust=False):
header = itk.ReadImage(file_path)
image = np.array(itk.GetArrayFromImage(header))
if rejust:
image[image < -70] = -70
image[image > 180] = 180
image = image + 70
return np.array(image)
# 保存mhd文件
def save_mhd_image(image, file_name):
header = itk.GetImageFromArray(image)
itk.WriteImage(header, file_name)
# 根据文件名返回期项名
def return_phasename(file_name):
phasenames = ['NC', 'ART', 'PV']
for phasename in phasenames:
if file_name.find(phasename) != -1:
return phasename
# 读取DICOM文件中包含的病例ID信息
def read_patientId(dicom_file_path):
ds = pydicom.read_file(dicom_file_path)
return ds.PatientID
# 返回病灶类型和ID的字典类型的数据 key是typename value是typeid
def return_type_nameid():
res = {}
res['CYST'] = 0
res['FNH'] = 1
res['HCC'] = 2
res['HEM'] = 3
res['METS'] = 4
return res
# 返回病灶类型ID和名称的字典类型的数据 key是typeid value是typename
def return_type_idname():
res = {}
res[0] = 'CYST'
res[1] = 'FNH'
res[2] = 'HCC'
res[3] = 'HEM'
res[4] = 'METS'
return res
# 根据病灶类型的ID返回类型的字符串
def return_typename_byid(typeid):
idname_dict = return_type_idname()
return idname_dict[typeid]
# 根据病灶类型的name返回id的字符串
def return_typeid_byname(typename):
nameid_dict = return_type_nameid()
return nameid_dict[typename]
# 填充图像
def fill_region(image):
# image.show()
from scipy import ndimage
image = ndimage.binary_fill_holes(image).astype(np.uint8)
return image
def close_operation(binary_image, kernel_size=5):
kernel = cv2.getStructuringElement(cv2.MORPH_RECT, (kernel_size, kernel_size))
close_r = cv2.morphologyEx(binary_image, cv2.MORPH_CLOSE, kernel)
return close_r
def open_operation(slice_image, kernel_size=3):
opening = cv2.morphologyEx(slice_image, cv2.MORPH_OPEN,
cv2.getStructuringElement(cv2.MORPH_ELLIPSE, (kernel_size, kernel_size)))
return opening
def get_kernel_filters(kernel_size):
'''
返回进行kernel操作的5个模版 (1个是正常的dilated操作,还有四个是分别对四个方向进行单独进行dilated的操作)
:param kernel_size:
:return: [5, kernel_size, kernel_size]
'''
kernel_whole = np.ones([kernel_size, kernel_size], np.uint8)
half_size = kernel_size // 2
kernel_left = np.copy(kernel_whole)
kernel_left[:, half_size + 1:] = 0
kernel_right = np.copy(kernel_whole)
kernel_right[:, :half_size] = 0
kernel_top = np.copy(kernel_whole)
kernel_top[half_size + 1:, :] = 0
kernel_bottom = np.copy(kernel_whole)
kernel_bottom[:half_size, :] = 0
return np.concatenate([
np.expand_dims(kernel_whole, axis=0),
np.expand_dims(kernel_left, axis=0),
np.expand_dims(kernel_right, axis=0),
np.expand_dims(kernel_top, axis=0),
np.expand_dims(kernel_bottom, axis=0),
], axis=0)
def image_erode(img, kernel_size=5):
import cv2
import numpy as np
kernel = np.ones((kernel_size, kernel_size), np.uint8)
erosion = cv2.erode(img, kernel, iterations=1)
return erosion
def image_expand(img, kernel_size=5):
kernel = cv2.getStructuringElement(cv2.MORPH_ELLIPSE, (kernel_size, kernel_size))
image = cv2.dilate(img, kernel)
return image
def image_erode(img, kernel_size=5):
kernel = cv2.getStructuringElement(cv2.MORPH_ELLIPSE, (kernel_size, kernel_size))
image = cv2.erode(img, kernel)
return image
# 图像膨胀
# def image_expand(image, size):
#
def find_significant_layer(mask_image):
'''
找到显著层
:param mask_image: [depth, width, height]
:return: idx
'''
sum_res = np.sum(np.sum(mask_image, axis=1), axis=1)
return np.argmax(sum_res)
# 将一个矩阵保存为图片
def save_image(image_arr, save_path):
image = Image.fromarray(np.asarray(image_arr, np.uint8))
image.save(save_path)
def show_image(image):
img = np.asarray(image, np.uint8)
import matplotlib.pyplot as plt
plt.figure("Image")
# 这里必须加 cmap='gray' ,否则尽管原图像是灰度图(下图1),但是显示的是伪彩色图像(下图2)(如果不加的话)
plt.imshow(img, cmap='gray')
plt.axis('on')
plt.title('image')
plt.show()
# 将图像画出来,并且画出标记的病灶
def save_image_with_mask(image_arr, mask_image, save_path):
image_arr[image_arr < -70] = -70
image_arr[image_arr > 180] = 180
image_arr = image_arr + 70
shape = list(np.shape(image_arr))
image_arr_rgb = np.zeros(shape=[shape[0], shape[1], 3])
image_arr_rgb[:, :, 0] = image_arr
image_arr_rgb[:, :, 1] = image_arr
image_arr_rgb[:, :, 2] = image_arr
image = Image.fromarray(np.asarray(image_arr_rgb, np.uint8))
image_draw = ImageDraw.Draw(image)
[ys, xs] = np.where(mask_image != 0)
miny = np.min(ys)
maxy = np.max(ys)
minx = np.min(xs)
maxx = np.max(xs)
ROI = image_arr_rgb[miny - 1:maxy + 1, minx - 1:maxx + 1, :]
ROI_Image = Image.fromarray(np.asarray(ROI, np.uint8))
for index, y in enumerate(ys):
image_draw.point([xs[index], y], fill=(255, 0, 0))
if save_path is None:
image.show()
else:
image.save(save_path)
ROI_Image.save(os.path.join(os.path.dirname(save_path), os.path.basename(save_path).split('.')[0] + '_ROI.jpg'))
del image, ROI_Image
gc.collect()
def compress22dim(image):
'''
将一个矩阵如果可能,压缩到三维的空间
'''
shape = list(np.shape(image))
if len(shape) == 3:
return np.squeeze(image)
return image
def extract_ROI(image, mask_image):
'''
提取一幅图像中的ROI
'''
xs, ys = np.where(mask_image == 1)
xs_min = np.min(xs)
xs_max = np.max(xs)
ys_min = np.min(ys)
ys_max = np.max(ys)
return image[xs_min: xs_max + 1, ys_min: ys_max + 1]
def resize_image(image, size):
image = Image.fromarray(np.asarray(image, np.uint8))
return image.resize((size, size))
# def image_expand(mask_image, r):
# return dilation(mask_image, disk(r))
'''
将形式如(512, 512)格式的图像转化为(1, 512, 512)形式的图片
'''
def expand23D(mask_image):
shape = list(np.shape(mask_image))
if len(shape) == 2:
mask_image = np.expand_dims(mask_image, axis=0)
print('after expand23D', np.shape(mask_image))
return mask_image
'''
返回一个mask图像的中心,是对xyz坐标计算平均值之后的结果
'''
def find_centroid3D(image, flag):
[x, y, z] = np.where(image == flag)
centroid_x = int(np.mean(x))
centroid_y = int(np.mean(y))
centroid_z = int(np.mean(z))
return centroid_x, centroid_y, centroid_z
'''
将[w, h, d]reshape为[d, w, h]
'''
def convert2depthfirst(image):
image = np.array(image)
shape = np.shape(image)
new_image = np.zeros([shape[2], shape[0], shape[1]])
for i in range(shape[2]):
new_image[i, :, :] = image[:, :, i]
return new_image
# def test_convert2depthfirst():
# zeros = np.zeros([100, 100, 30])
# after_zeros = convert2depthfirst(zeros)
# print np.shape(after_zeros)
# test_convert2depthfirst()
'''
将[d, w, h]reshape为[w, h, d]
'''
def convert2depthlastest(image):
image = np.array(image)
shape = np.shape(image)
new_image = np.zeros([shape[1], shape[2], shape[0]])
for i in range(shape[0]):
new_image[:, :, i] = image[i, :, :]
return new_image
def read_image_file(file_path):
if file_path.endswith('.nii'):
return read_nil(file_path)
if file_path.endswith('.mhd'):
return read_mhd_image(file_path)
print('the format of image is not support in this version')
return None
def processing(image, size_training):
image = np.array(image)
# numpy_clip
bottom = -300.
top = 500.
image = np.clip(image, bottom, top)
# to float
minval = -350
interv = 500 - (-350)
image -= minval
# scale down to 0 - 2
image /= (interv / 2)
# zoom
desired_size = [size_training, size_training]
desired_size = np.asarray(desired_size, dtype=np.int)
zooms = desired_size / np.array(image[:, :, 0].shape, dtype=np.float)
print(zooms)
after_zoom = np.zeros([size_training, size_training, np.shape(image)[2]])
for i in range(np.shape(after_zoom)[2]):
after_zoom[:, :, i] = scipy.ndimage.zoom(image[:, :, i], zooms, order=1) # order = 1 => biliniear interpolation
return after_zoom
def preprocessing_agumentation(image, size_training):
image = np.array(image)
# numpy_clip
c_minimum = -300.
c_maximum = 500.
s_maximum = 255.
image = np.clip(image, c_minimum, c_maximum)
interv = float(c_maximum - c_minimum)
image = (image - c_minimum) / interv * s_maximum
minval = 0.
maxval = 255.
image -= minval
interv = maxval - minval
# print('static scaler 0', interv)
# scale down to 0 - 2
# image /= (interv / 2)
image = np.asarray(image, np.float32)
image = image / interv
image = image * 2.0
# zoom
desired_size = [size_training, size_training]
desired_size = np.asarray(desired_size, dtype=np.int)
zooms = desired_size / np.array(image[:, :, 0].shape, dtype=np.float)
print(zooms)
after_zoom = np.zeros([size_training, size_training, np.shape(image)[2]])
for i in range(np.shape(after_zoom)[2]):
after_zoom[:, :, i] = scipy.ndimage.zoom(image[:, :, i], zooms, order=1) # order = 1 => biliniear interpolation
return after_zoom
def MICCAI2018_Iterator(image_dir, execute_func, *parameters):
'''
遍历MICCAI2018文件夹的框架
:param execute_func:
:return:
'''
for sub_name in ['train', 'val', 'test']:
names = os.listdir(os.path.join(image_dir, sub_name))
for name in names:
cur_slice_dir = os.path.join(image_dir, sub_name, name)
execute_func(cur_slice_dir, *parameters)
def dicom2jpg_singlephase(slice_dir, save_dir, phase_name='PV'):
mhd_image_path = glob(os.path.join(slice_dir, phase_name+'_Image*.mhd'))[0]
mhd_mask_path = glob(os.path.join(slice_dir, phase_name + '_Mask*.mhd'))[0]
mhd_image = read_mhd_image(mhd_image_path)
mask_image = read_mhd_image(mhd_mask_path)
mhd_image = np.asarray(np.squeeze(mhd_image), np.float32)
mhd_image = np.expand_dims(mhd_image, axis=2)
mhd_image = np.concatenate([mhd_image, mhd_image, mhd_image], axis=2)
mask_image = np.asarray(np.squeeze(mask_image), np.uint8)
max_v = 300.
min_v = -350.
mhd_image[mhd_image > max_v] = max_v
mhd_image[mhd_image < min_v] = min_v
print(np.mean(mhd_image, dtype=np.float32))
mhd_image -= np.mean(mhd_image)
min_v = np.min(mhd_image)
max_v = np.max(mhd_image)
interv = max_v - min_v
mhd_image = (mhd_image - min_v) / interv
file_name = os.path.basename(slice_dir)
dataset_name = os.path.basename(os.path.dirname(slice_dir))
save_path = os.path.join(save_dir, phase_name, dataset_name, file_name+'.jpg')
if not os.path.exists(os.path.dirname(save_path)):
os.makedirs(os.path.dirname(save_path))
print('the shape of mhd_image is ', np.shape(mhd_image), np.min(mhd_image), np.max(mhd_image))
cv2.imwrite(save_path, mhd_image * 255)
xml_save_dir = os.path.join(save_dir, phase_name, dataset_name+'_xml')
if not os.path.exists(xml_save_dir):
os.makedirs(xml_save_dir)
evulate_gt_dir = os.path.join(save_dir, phase_name, dataset_name+'_gt')
if not os.path.exists(evulate_gt_dir):
os.makedirs(evulate_gt_dir)
xml_save_path = os.path.join(xml_save_dir, file_name + '.xml')
gt_save_path = os.path.join(evulate_gt_dir, file_name + '.txt') # for evulate
doc = Document()
root_node = doc.createElement('annotation')
doc.appendChild(root_node)
folder_name = os.path.basename(save_dir) + '/' + phase_name
folder_node = doc.createElement('folder')
root_node.appendChild(folder_node)
folder_txt_node = doc.createTextNode(folder_name)
folder_node.appendChild(folder_txt_node)
file_name = file_name + '.jpg'
filename_node = doc.createElement('filename')
root_node.appendChild(filename_node)
filename_txt_node = doc.createTextNode(file_name)
filename_node.appendChild(filename_txt_node)
shape = list(np.shape(mhd_image))
size_node = doc.createElement('size')
root_node.appendChild(size_node)
width_node = doc.createElement('width')
width_node.appendChild(doc.createTextNode(str(shape[0])))
height_node = doc.createElement('height')
height_node.appendChild(doc.createTextNode(str(shape[1])))
depth_node = doc.createElement('depth')
depth_node.appendChild(doc.createTextNode(str(3)))
size_node.appendChild(width_node)
size_node.appendChild(height_node)
size_node.appendChild(depth_node)
mask_image[mask_image != 1] = 0
xs, ys = np.where(mask_image == 1)
min_x = np.min(xs)
min_y = np.min(ys)
max_x = np.max(xs)
max_y = np.max(ys)
object_node = doc.createElement('object')
root_node.appendChild(object_node)
name_node = doc.createElement('name')
name_node.appendChild(doc.createTextNode('Cyst'))
object_node.appendChild(name_node)
truncated_node = doc.createElement('truncated')
object_node.appendChild(truncated_node)
truncated_node.appendChild(doc.createTextNode('0'))
difficult_node = doc.createElement('difficult')
object_node.appendChild(difficult_node)
difficult_node.appendChild(doc.createTextNode('0'))
bndbox_node = doc.createElement('bndbox')
object_node.appendChild(bndbox_node)
xmin_node = doc.createElement('xmin')
xmin_node.appendChild(doc.createTextNode(str(min_y)))
bndbox_node.appendChild(xmin_node)
ymin_node = doc.createElement('ymin')
ymin_node.appendChild(doc.createTextNode(str(min_x)))
bndbox_node.appendChild(ymin_node)
xmax_node = doc.createElement('xmax')
xmax_node.appendChild(doc.createTextNode(str(max_y)))
bndbox_node.appendChild(xmax_node)
ymax_node = doc.createElement('ymax')
ymax_node.appendChild(doc.createTextNode(str(max_x)))
bndbox_node.appendChild(ymax_node)
with open(xml_save_path, 'wb') as f:
f.write(doc.toprettyxml(indent='\t', encoding='utf-8'))
line = '%s %d %d %d %d\n' % ('Cyst', min_y, min_x, max_y, max_x)
print(line)
lines = []
lines.append(line)
with open(gt_save_path, 'w') as f:
f.writelines(lines)
f.close()
def dicom2jpg_multiphase(slice_dir, save_dir, phasenames=['NC', 'ART', 'PV'], target_phase='PV', suffix_name='npy'):
target_mask = None
mhd_images = []
for phase_name in phasenames:
mhd_image_path = glob(os.path.join(slice_dir, 'Image_%s*.mhd' % phase_name))[0]
mhd_mask_path = glob(os.path.join(slice_dir, 'Mask_%s*.mhd' % phase_name))[0]
mhd_image = read_mhd_image(mhd_image_path)
mask_image = read_mhd_image(mhd_mask_path)
mhd_image = np.asarray(np.squeeze(mhd_image), np.float32)
mhd_images.append(mhd_image)
mask_image = np.asarray(np.squeeze(mask_image), np.uint8)
if phase_name == target_phase:
target_mask = mask_image
print(np.shape(mhd_images))
mask_image = target_mask
mask_image_shape = list(np.shape(mask_image))
if len(mask_image_shape) == 3:
mask_image = mask_image[1, :, :]
print('the mask image shape is ', np.shape(mask_image))
if suffix_name == 'jpg':
mhd_images = np.transpose(np.asarray(mhd_images, np.float32), axes=[1, 2, 0])
mhd_image = mhd_images
elif suffix_name == 'npy':
mhd_images = np.concatenate(np.asarray(mhd_images, np.float), axis=0)
mhd_images = np.transpose(np.asarray(mhd_images, np.float32), axes=[1, 2, 0])
mhd_image = mhd_images
else:
print('the suffix name does not support')
assert False
max_v = 300.
min_v = -350.
mhd_image[mhd_image > max_v] = max_v
mhd_image[mhd_image < min_v] = min_v
print(np.mean(mhd_image, dtype=np.float32))
mhd_image -= np.mean(mhd_image)
min_v = np.min(mhd_image)
max_v = np.max(mhd_image)
interv = max_v - min_v
mhd_image = (mhd_image - min_v) / interv
file_name = os.path.basename(slice_dir)
dataset_name = os.path.basename(os.path.dirname(slice_dir))
phase_name = ''.join(phasenames)
save_path = os.path.join(save_dir, phase_name, dataset_name, file_name+'.' + suffix_name)
if not os.path.exists(os.path.dirname(save_path)):
os.makedirs(os.path.dirname(save_path))
print('the shape of mhd_image is ', np.shape(mhd_image), np.min(mhd_image), np.max(mhd_image))
#cv2.imwrite(save_path, mhd_image * 255)
np.save(save_path, mhd_image * 255)
xml_save_dir = os.path.join(save_dir, phase_name, dataset_name+'_xml')
if not os.path.exists(xml_save_dir):
os.makedirs(xml_save_dir)
evulate_gt_dir = os.path.join(save_dir, phase_name, dataset_name+'_gt')
if not os.path.exists(evulate_gt_dir):
os.makedirs(evulate_gt_dir)
xml_save_path = os.path.join(xml_save_dir, file_name + '.xml')
gt_save_path = os.path.join(evulate_gt_dir, file_name + '.txt') # for evulate
doc = Document()
root_node = doc.createElement('annotation')
doc.appendChild(root_node)
folder_name = os.path.basename(save_dir) + '/' + phase_name
folder_node = doc.createElement('folder')
root_node.appendChild(folder_node)
folder_txt_node = doc.createTextNode(folder_name)
folder_node.appendChild(folder_txt_node)
file_name = file_name + '.jpg'
filename_node = doc.createElement('filename')
root_node.appendChild(filename_node)
filename_txt_node = doc.createTextNode(file_name)
filename_node.appendChild(filename_txt_node)
shape = list(np.shape(mhd_image))
size_node = doc.createElement('size')
root_node.appendChild(size_node)
width_node = doc.createElement('width')
width_node.appendChild(doc.createTextNode(str(shape[0])))
height_node = doc.createElement('height')
height_node.appendChild(doc.createTextNode(str(shape[1])))
depth_node = doc.createElement('depth')
depth_node.appendChild(doc.createTextNode(str(3)))
size_node.appendChild(width_node)
size_node.appendChild(height_node)
size_node.appendChild(depth_node)
mask_image[mask_image != 1] = 0
xs, ys = np.where(mask_image == 1)
print(xs, ys)
min_x = np.min(xs)
min_y = np.min(ys)
max_x = np.max(xs)
max_y = np.max(ys)
object_node = doc.createElement('object')
root_node.appendChild(object_node)
name_node = doc.createElement('name')
name_node.appendChild(doc.createTextNode('Cyst'))
object_node.appendChild(name_node)
truncated_node = doc.createElement('truncated')
object_node.appendChild(truncated_node)
truncated_node.appendChild(doc.createTextNode('0'))
difficult_node = doc.createElement('difficult')
object_node.appendChild(difficult_node)
difficult_node.appendChild(doc.createTextNode('0'))
bndbox_node = doc.createElement('bndbox')
object_node.appendChild(bndbox_node)
xmin_node = doc.createElement('xmin')
xmin_node.appendChild(doc.createTextNode(str(min_y)))
bndbox_node.appendChild(xmin_node)
ymin_node = doc.createElement('ymin')
ymin_node.appendChild(doc.createTextNode(str(min_x)))
bndbox_node.appendChild(ymin_node)
xmax_node = doc.createElement('xmax')
xmax_node.appendChild(doc.createTextNode(str(max_y)))
bndbox_node.appendChild(xmax_node)
ymax_node = doc.createElement('ymax')
ymax_node.appendChild(doc.createTextNode(str(max_x)))
bndbox_node.appendChild(ymax_node)
with open(xml_save_path, 'wb') as f:
f.write(doc.toprettyxml(indent='\t', encoding='utf-8'))
line = '%s %d %d %d %d\n' % ('Cyst', min_y, min_x, max_y, max_x)
print(line)
lines = []
lines.append(line)
with open(gt_save_path, 'w') as f:
f.writelines(lines)
f.close()
def static_pixel_num(image_dir, target_phase='PV'):
# {0: 217784361, 1: 1392043, 2: 209128, 3: 1486676, 4: 458278, 5: 705482}
# {0: 1.0, 156, 1041, 146, 475, 308}
static_res = {
0: 0,
1: 0,
2: 0,
3: 0,
4: 0,
5: 0
}
from convert2jpg import extract_bboxs_mask_from_mask
from config import pixel2type, type2pixel
for sub_name in ['train', 'val', 'test']:
names = os.listdir(os.path.join(image_dir, sub_name))
for name in names:
cur_slice_dir = os.path.join(image_dir, sub_name, name)
mhd_mask_path = glob(os.path.join(cur_slice_dir, 'Mask_%s*.mhd' % target_phase))[0]
mask_image = read_mhd_image(mhd_mask_path)
min_xs, min_ys, max_xs, max_ys, names, mask = extract_bboxs_mask_from_mask(mask_image,
os.path.join(cur_slice_dir,
'tumor_types'))
for key in pixel2type.keys():
mask[mask == key] = type2pixel[pixel2type[key]][0]
pixel_value_set = np.unique(mask)
print pixel_value_set
for value in list(pixel_value_set):
static_res[value] += np.sum(mask == value)
print(static_res)
def convertCase2PNGs(volume_path, seg_path, save_dir=None, z_axis=5.0, short_edge=64):
'''
将nii转化成PNG
:param volume_path: nii的路径
:param seg_path:
:return:
'''
from skimage.measure import label
volume, header = read_nii_with_header(volume_path)
# volume = np.transpose(volume, [1, 0, 2])
volume = np.asarray(volume, np.float32)
max_v = 250.
min_v = -200.
# max_v = 180
# min_v = -70
volume[volume > max_v] = max_v
volume[volume < min_v] = min_v
volume -= np.mean(volume)
min_v = np.min(volume)
max_v = np.max(volume)
interv = max_v - min_v
volume = (volume - min_v) / interv
z_axis_case = header['voxel_spacing'][-1]
slice_num = int(z_axis / z_axis_case)
if slice_num == 0:
slice_num = 1
seg = read_nii(seg_path)
# print np.shape(volume), np.shape(seg)
[_, _, channel] = np.shape(volume)
imgs = []
names = []
masks = []
tumor_weakly_masks = []
liver_masks = []
i = slice_num + 1
pos_slice_num = np.sum(np.sum(np.sum(seg == 2, axis=0), axis=0) != 0)
total_slice_num = np.shape(seg)[-1]
print('pos_slice_num is ', pos_slice_num, total_slice_num)
neg_rate = (3.0 * pos_slice_num) / total_slice_num # 正样本是负样本的
if neg_rate > 1.0:
neg_rate = 1.0
for i in range(channel):
seg_slice = seg[:, :, i]
mid_slice = np.expand_dims(volume[:, :, i], axis=0)
pre_slice = []
# pre_end = i - slice_num / 2
# pre_end = i
# for j in range(1, slice_num + 1):
# z = pre_end - j
# if z < 0:
# z = 0
# pre_slice.append(volume[:, :, z])
if (i - 1) < 0:
pre_slice = np.expand_dims(volume[:, :, i], axis=0)
else:
pre_slice = np.expand_dims(volume[:, :, i-1], axis=0)
next_slice = []
# next_start = i + slice_num / 2
# next_start = i
# for j in range(1, slice_num + 1):
# z = next_start + j
# if z >= channel:
# z = channel - 1
# next_slice.append(volume[:, :, z])
if (i + 1) >= channel:
next_slice = np.expand_dims(volume[:, :, i], axis=0)
else:
next_slice = np.expand_dims(volume[:, :, i+1], axis=0)
# pre_slice = np.mean(pre_slice, axis=0, keepdims=True)
# next_slice = np.mean(next_slice, axis=0, keepdims=True)
imgs.append(
np.transpose(np.concatenate([pre_slice, mid_slice, next_slice], axis=0),
axes=[1, 2, 0]))
names.append(os.path.basename(volume_path).split('.')[0].split('-')[1] + '-' + str(i))
binary_seg_slice = np.asarray(seg_slice == 2, np.uint8)
# print np.max(binary_seg_slice)
masks.append(binary_seg_slice)
labeled_mask = label(binary_seg_slice)
weakly_label_mask = np.zeros_like(binary_seg_slice, np.uint8)
for idx in range(1, np.max(labeled_mask) + 1):
xs, ys = np.where(labeled_mask == idx)
min_xs = np.min(xs)
max_xs = np.max(xs)
min_ys = np.min(ys)
max_ys = np.max(ys)
weakly_label_mask[min_xs: max_xs, min_ys: max_ys] = 1
liver_masks.append(np.asarray(seg_slice == 1, np.uint8))
tumor_weakly_masks.append(weakly_label_mask)
# i += 1
return np.asarray(imgs, np.float32), np.asarray(masks, np.uint8), np.asarray(liver_masks, np.uint8), np.asarray(
tumor_weakly_masks, np.uint8)
def statics_num_slices_lesion(nii_dir):
'''
统计每个case,有多少slice具有病灶
:param nii_dir:
:return:
'''
mask_nii_paths = glob(os.path.join(nii_dir, 'segmentation-*.nii'))
for mask_nii_path in mask_nii_paths:
mask_img = read_nii(mask_nii_path)
has_lesion = np.asarray(np.sum(np.sum(mask_img == 2, axis=0), axis=0)>0, np.bool)
num_lesion_slices = np.sum(has_lesion)
print os.path.basename(mask_nii_path), num_lesion_slices, np.shape(mask_img)[-1]
if __name__ == '__main__':
# for phasename in ['NC', 'ART', 'PV']:
# convert_dicomseries2mhd(
# '/home/give/github/Cascaded-FCN-Tensorflow/Cascaded-FCN/tensorflow-unet/z_testdata/304176-2802027/' + phasename,
# '/home/give/github/Cascaded-FCN-Tensorflow/Cascaded-FCN/tensorflow-unet/z_testdata/304176-2802027/MHD/' + phasename + '.mhd'
# )
# names = os.listdir('/home/give/Documents/dataset/ISBI2017/media/nas/01_Datasets/CT/LITS/Training_Batch_2')
# for name in names:
# path = os.path.join('/home/give/Documents/dataset/ISBI2017/media/nas/01_Datasets/CT/LITS/Training_Batch_2', name)
# image = read_nil(path)
# print(np.shape(image))
# conver2JPG single phase
# image_dir = '/home/give/Documents/dataset/MICCAI2018/Slices/crossvalidation/0'
# save_dir = '/home/give/Documents/dataset/MICCAI2018_Detection/SinglePhase'
# phase_name = 'NC'
# MICCAI2018_Iterator(image_dir, dicom2jpg_singlephase, save_dir, phase_name)
# conver2JPG multi phase
# image_dir = '/home/give/Documents/dataset/LiverLesionDetection_Splited/0'
# static_pixel_num(image_dir, 'PV')
statics_num_slices_lesion('/media/give/CBMIR/ld/dataset/ISBI2017/media/nas/01_Datasets/CT/LITS/Training_Batch_2') | # -*- coding=utf-8 -*-
import SimpleITK as itk
import pydicom
import numpy as np
from PIL import Image, ImageDraw
import gc
from skimage.morphology import disk, dilation
import nipy
import os
from glob import glob
import scipy
import cv2
from xml.dom.minidom import Document
typenames = ['CYST', 'FNH', 'HCC', 'HEM', 'METS']
typeids = [0, 1, 2, 3, 4]
def get_voxel_size(file_path):
load_image_obj = nipy.load_image(file_path)
header = load_image_obj.header
x_size = header['srow_x'][0]
y_size = header['srow_y'][1]
z_size = header['srow_z'][2]
return [x_size, y_size, z_size]
def read_nii(file_path):
return nipy.load_image(file_path).get_data()
def read_nii_with_header(file_path):
img_obj = nipy.load_image(file_path)
header_obj = img_obj.header
res_dict = {}
res_dict['voxel_spacing'] = [header_obj['srow_x'][0], header_obj['srow_y'][1], header_obj['srow_z'][2]]
img_arr = img_obj.get_data()
return img_arr, res_dict
# 读取文件序列
def read_dicom_series(dir_name):
reader = itk.ImageSeriesReader()
dicom_series = reader.GetGDCMSeriesFileNames(dir_name)
reader.SetFileNames(dicom_series)
images = reader.Execute()
image_array = itk.GetArrayFromImage(images)
return image_array
# 将DICOM序列转化成MHD文件
def convert_dicomseries2mhd(dicom_series_dir, save_path):
data = read_dicom_series(dicom_series_dir)
save_mhd_image(data, save_path)
# 读取单个DICOM文件
def read_dicom_file(file_name):
header = pydicom.read_file(file_name)
image = header.pixel_array
image = header.RescaleSlope * image + header.RescaleIntercept
return image
# 读取mhd文件
def read_mhd_image(file_path, rejust=False):
header = itk.ReadImage(file_path)
image = np.array(itk.GetArrayFromImage(header))
if rejust:
image[image < -70] = -70
image[image > 180] = 180
image = image + 70
return np.array(image)
# 保存mhd文件
def save_mhd_image(image, file_name):
header = itk.GetImageFromArray(image)
itk.WriteImage(header, file_name)
# 根据文件名返回期项名
def return_phasename(file_name):
phasenames = ['NC', 'ART', 'PV']
for phasename in phasenames:
if file_name.find(phasename) != -1:
return phasename
# 读取DICOM文件中包含的病例ID信息
def read_patientId(dicom_file_path):
ds = pydicom.read_file(dicom_file_path)
return ds.PatientID
# 返回病灶类型和ID的字典类型的数据 key是typename value是typeid
def return_type_nameid():
res = {}
res['CYST'] = 0
res['FNH'] = 1
res['HCC'] = 2
res['HEM'] = 3
res['METS'] = 4
return res
# 返回病灶类型ID和名称的字典类型的数据 key是typeid value是typename
def return_type_idname():
res = {}
res[0] = 'CYST'
res[1] = 'FNH'
res[2] = 'HCC'
res[3] = 'HEM'
res[4] = 'METS'
return res
# 根据病灶类型的ID返回类型的字符串
def return_typename_byid(typeid):
idname_dict = return_type_idname()
return idname_dict[typeid]
# 根据病灶类型的name返回id的字符串
def return_typeid_byname(typename):
nameid_dict = return_type_nameid()
return nameid_dict[typename]
# 填充图像
def fill_region(image):
# image.show()
from scipy import ndimage
image = ndimage.binary_fill_holes(image).astype(np.uint8)
return image
def close_operation(binary_image, kernel_size=5):
kernel = cv2.getStructuringElement(cv2.MORPH_RECT, (kernel_size, kernel_size))
close_r = cv2.morphologyEx(binary_image, cv2.MORPH_CLOSE, kernel)
return close_r
def open_operation(slice_image, kernel_size=3):
opening = cv2.morphologyEx(slice_image, cv2.MORPH_OPEN,
cv2.getStructuringElement(cv2.MORPH_ELLIPSE, (kernel_size, kernel_size)))
return opening
def get_kernel_filters(kernel_size):
'''
返回进行kernel操作的5个模版 (1个是正常的dilated操作,还有四个是分别对四个方向进行单独进行dilated的操作)
:param kernel_size:
:return: [5, kernel_size, kernel_size]
'''
kernel_whole = np.ones([kernel_size, kernel_size], np.uint8)
half_size = kernel_size // 2
kernel_left = np.copy(kernel_whole)
kernel_left[:, half_size + 1:] = 0
kernel_right = np.copy(kernel_whole)
kernel_right[:, :half_size] = 0
kernel_top = np.copy(kernel_whole)
kernel_top[half_size + 1:, :] = 0
kernel_bottom = np.copy(kernel_whole)
kernel_bottom[:half_size, :] = 0
return np.concatenate([
np.expand_dims(kernel_whole, axis=0),
np.expand_dims(kernel_left, axis=0),
np.expand_dims(kernel_right, axis=0),
np.expand_dims(kernel_top, axis=0),
np.expand_dims(kernel_bottom, axis=0),
], axis=0)
def image_erode(img, kernel_size=5):
import cv2
import numpy as np
kernel = np.ones((kernel_size, kernel_size), np.uint8)
erosion = cv2.erode(img, kernel, iterations=1)
return erosion
def image_expand(img, kernel_size=5):
kernel = cv2.getStructuringElement(cv2.MORPH_ELLIPSE, (kernel_size, kernel_size))
image = cv2.dilate(img, kernel)
return image
def image_erode(img, kernel_size=5):
kernel = cv2.getStructuringElement(cv2.MORPH_ELLIPSE, (kernel_size, kernel_size))
image = cv2.erode(img, kernel)
return image
# 图像膨胀
# def image_expand(image, size):
#
def find_significant_layer(mask_image):
'''
找到显著层
:param mask_image: [depth, width, height]
:return: idx
'''
sum_res = np.sum(np.sum(mask_image, axis=1), axis=1)
return np.argmax(sum_res)
# 将一个矩阵保存为图片
def save_image(image_arr, save_path):
image = Image.fromarray(np.asarray(image_arr, np.uint8))
image.save(save_path)
def show_image(image):
img = np.asarray(image, np.uint8)
import matplotlib.pyplot as plt
plt.figure("Image")
# 这里必须加 cmap='gray' ,否则尽管原图像是灰度图(下图1),但是显示的是伪彩色图像(下图2)(如果不加的话)
plt.imshow(img, cmap='gray')
plt.axis('on')
plt.title('image')
plt.show()
# 将图像画出来,并且画出标记的病灶
def save_image_with_mask(image_arr, mask_image, save_path):
image_arr[image_arr < -70] = -70
image_arr[image_arr > 180] = 180
image_arr = image_arr + 70
shape = list(np.shape(image_arr))
image_arr_rgb = np.zeros(shape=[shape[0], shape[1], 3])
image_arr_rgb[:, :, 0] = image_arr
image_arr_rgb[:, :, 1] = image_arr
image_arr_rgb[:, :, 2] = image_arr
image = Image.fromarray(np.asarray(image_arr_rgb, np.uint8))
image_draw = ImageDraw.Draw(image)
[ys, xs] = np.where(mask_image != 0)
miny = np.min(ys)
maxy = np.max(ys)
minx = np.min(xs)
maxx = np.max(xs)
ROI = image_arr_rgb[miny - 1:maxy + 1, minx - 1:maxx + 1, :]
ROI_Image = Image.fromarray(np.asarray(ROI, np.uint8))
for index, y in enumerate(ys):
image_draw.point([xs[index], y], fill=(255, 0, 0))
if save_path is None:
image.show()
else:
image.save(save_path)
ROI_Image.save(os.path.join(os.path.dirname(save_path), os.path.basename(save_path).split('.')[0] + '_ROI.jpg'))
del image, ROI_Image
gc.collect()
def compress22dim(image):
'''
将一个矩阵如果可能,压缩到三维的空间
'''
shape = list(np.shape(image))
if len(shape) == 3:
return np.squeeze(image)
return image
def extract_ROI(image, mask_image):
'''
提取一幅图像中的ROI
'''
xs, ys = np.where(mask_image == 1)
xs_min = np.min(xs)
xs_max = np.max(xs)
ys_min = np.min(ys)
ys_max = np.max(ys)
return image[xs_min: xs_max + 1, ys_min: ys_max + 1]
def resize_image(image, size):
image = Image.fromarray(np.asarray(image, np.uint8))
return image.resize((size, size))
# def image_expand(mask_image, r):
# return dilation(mask_image, disk(r))
'''
将形式如(512, 512)格式的图像转化为(1, 512, 512)形式的图片
'''
def expand23D(mask_image):
shape = list(np.shape(mask_image))
if len(shape) == 2:
mask_image = np.expand_dims(mask_image, axis=0)
print('after expand23D', np.shape(mask_image))
return mask_image
'''
返回一个mask图像的中心,是对xyz坐标计算平均值之后的结果
'''
def find_centroid3D(image, flag):
[x, y, z] = np.where(image == flag)
centroid_x = int(np.mean(x))
centroid_y = int(np.mean(y))
centroid_z = int(np.mean(z))
return centroid_x, centroid_y, centroid_z
'''
将[w, h, d]reshape为[d, w, h]
'''
def convert2depthfirst(image):
image = np.array(image)
shape = np.shape(image)
new_image = np.zeros([shape[2], shape[0], shape[1]])
for i in range(shape[2]):
new_image[i, :, :] = image[:, :, i]
return new_image
# def test_convert2depthfirst():
# zeros = np.zeros([100, 100, 30])
# after_zeros = convert2depthfirst(zeros)
# print np.shape(after_zeros)
# test_convert2depthfirst()
'''
将[d, w, h]reshape为[w, h, d]
'''
def convert2depthlastest(image):
image = np.array(image)
shape = np.shape(image)
new_image = np.zeros([shape[1], shape[2], shape[0]])
for i in range(shape[0]):
new_image[:, :, i] = image[i, :, :]
return new_image
def read_image_file(file_path):
if file_path.endswith('.nii'):
return read_nil(file_path)
if file_path.endswith('.mhd'):
return read_mhd_image(file_path)
print('the format of image is not support in this version')
return None
def processing(image, size_training):
image = np.array(image)
# numpy_clip
bottom = -300.
top = 500.
image = np.clip(image, bottom, top)
# to float
minval = -350
interv = 500 - (-350)
image -= minval
# scale down to 0 - 2
image /= (interv / 2)
# zoom
desired_size = [size_training, size_training]
desired_size = np.asarray(desired_size, dtype=np.int)
zooms = desired_size / np.array(image[:, :, 0].shape, dtype=np.float)
print(zooms)
after_zoom = np.zeros([size_training, size_training, np.shape(image)[2]])
for i in range(np.shape(after_zoom)[2]):
after_zoom[:, :, i] = scipy.ndimage.zoom(image[:, :, i], zooms, order=1) # order = 1 => biliniear interpolation
return after_zoom
def preprocessing_agumentation(image, size_training):
image = np.array(image)
# numpy_clip
c_minimum = -300.
c_maximum = 500.
s_maximum = 255.
image = np.clip(image, c_minimum, c_maximum)
interv = float(c_maximum - c_minimum)
image = (image - c_minimum) / interv * s_maximum
minval = 0.
maxval = 255.
image -= minval
interv = maxval - minval
# print('static scaler 0', interv)
# scale down to 0 - 2
# image /= (interv / 2)
image = np.asarray(image, np.float32)
image = image / interv
image = image * 2.0
# zoom
desired_size = [size_training, size_training]
desired_size = np.asarray(desired_size, dtype=np.int)
zooms = desired_size / np.array(image[:, :, 0].shape, dtype=np.float)
print(zooms)
after_zoom = np.zeros([size_training, size_training, np.shape(image)[2]])
for i in range(np.shape(after_zoom)[2]):
after_zoom[:, :, i] = scipy.ndimage.zoom(image[:, :, i], zooms, order=1) # order = 1 => biliniear interpolation
return after_zoom
def MICCAI2018_Iterator(image_dir, execute_func, *parameters):
'''
遍历MICCAI2018文件夹的框架
:param execute_func:
:return:
'''
for sub_name in ['train', 'val', 'test']:
names = os.listdir(os.path.join(image_dir, sub_name))
for name in names:
cur_slice_dir = os.path.join(image_dir, sub_name, name)
execute_func(cur_slice_dir, *parameters)
def dicom2jpg_singlephase(slice_dir, save_dir, phase_name='PV'):
mhd_image_path = glob(os.path.join(slice_dir, phase_name+'_Image*.mhd'))[0]
mhd_mask_path = glob(os.path.join(slice_dir, phase_name + '_Mask*.mhd'))[0]
mhd_image = read_mhd_image(mhd_image_path)
mask_image = read_mhd_image(mhd_mask_path)
mhd_image = np.asarray(np.squeeze(mhd_image), np.float32)
mhd_image = np.expand_dims(mhd_image, axis=2)
mhd_image = np.concatenate([mhd_image, mhd_image, mhd_image], axis=2)
mask_image = np.asarray(np.squeeze(mask_image), np.uint8)
max_v = 300.
min_v = -350.
mhd_image[mhd_image > max_v] = max_v
mhd_image[mhd_image < min_v] = min_v
print(np.mean(mhd_image, dtype=np.float32))
mhd_image -= np.mean(mhd_image)
min_v = np.min(mhd_image)
max_v = np.max(mhd_image)
interv = max_v - min_v
mhd_image = (mhd_image - min_v) / interv
file_name = os.path.basename(slice_dir)
dataset_name = os.path.basename(os.path.dirname(slice_dir))
save_path = os.path.join(save_dir, phase_name, dataset_name, file_name+'.jpg')
if not os.path.exists(os.path.dirname(save_path)):
os.makedirs(os.path.dirname(save_path))
print('the shape of mhd_image is ', np.shape(mhd_image), np.min(mhd_image), np.max(mhd_image))
cv2.imwrite(save_path, mhd_image * 255)
xml_save_dir = os.path.join(save_dir, phase_name, dataset_name+'_xml')
if not os.path.exists(xml_save_dir):
os.makedirs(xml_save_dir)
evulate_gt_dir = os.path.join(save_dir, phase_name, dataset_name+'_gt')
if not os.path.exists(evulate_gt_dir):
os.makedirs(evulate_gt_dir)
xml_save_path = os.path.join(xml_save_dir, file_name + '.xml')
gt_save_path = os.path.join(evulate_gt_dir, file_name + '.txt') # for evulate
doc = Document()
root_node = doc.createElement('annotation')
doc.appendChild(root_node)
folder_name = os.path.basename(save_dir) + '/' + phase_name
folder_node = doc.createElement('folder')
root_node.appendChild(folder_node)
folder_txt_node = doc.createTextNode(folder_name)
folder_node.appendChild(folder_txt_node)
file_name = file_name + '.jpg'
filename_node = doc.createElement('filename')
root_node.appendChild(filename_node)
filename_txt_node = doc.createTextNode(file_name)
filename_node.appendChild(filename_txt_node)
shape = list(np.shape(mhd_image))
size_node = doc.createElement('size')
root_node.appendChild(size_node)
width_node = doc.createElement('width')
width_node.appendChild(doc.createTextNode(str(shape[0])))
height_node = doc.createElement('height')
height_node.appendChild(doc.createTextNode(str(shape[1])))
depth_node = doc.createElement('depth')
depth_node.appendChild(doc.createTextNode(str(3)))
size_node.appendChild(width_node)
size_node.appendChild(height_node)
size_node.appendChild(depth_node)
mask_image[mask_image != 1] = 0
xs, ys = np.where(mask_image == 1)
min_x = np.min(xs)
min_y = np.min(ys)
max_x = np.max(xs)
max_y = np.max(ys)
object_node = doc.createElement('object')
root_node.appendChild(object_node)
name_node = doc.createElement('name')
name_node.appendChild(doc.createTextNode('Cyst'))
object_node.appendChild(name_node)
truncated_node = doc.createElement('truncated')
object_node.appendChild(truncated_node)
truncated_node.appendChild(doc.createTextNode('0'))
difficult_node = doc.createElement('difficult')
object_node.appendChild(difficult_node)
difficult_node.appendChild(doc.createTextNode('0'))
bndbox_node = doc.createElement('bndbox')
object_node.appendChild(bndbox_node)
xmin_node = doc.createElement('xmin')
xmin_node.appendChild(doc.createTextNode(str(min_y)))
bndbox_node.appendChild(xmin_node)
ymin_node = doc.createElement('ymin')
ymin_node.appendChild(doc.createTextNode(str(min_x)))
bndbox_node.appendChild(ymin_node)
xmax_node = doc.createElement('xmax')
xmax_node.appendChild(doc.createTextNode(str(max_y)))
bndbox_node.appendChild(xmax_node)
ymax_node = doc.createElement('ymax')
ymax_node.appendChild(doc.createTextNode(str(max_x)))
bndbox_node.appendChild(ymax_node)
with open(xml_save_path, 'wb') as f:
f.write(doc.toprettyxml(indent='\t', encoding='utf-8'))
line = '%s %d %d %d %d\n' % ('Cyst', min_y, min_x, max_y, max_x)
print(line)
lines = []
lines.append(line)
with open(gt_save_path, 'w') as f:
f.writelines(lines)
f.close()
def dicom2jpg_multiphase(slice_dir, save_dir, phasenames=['NC', 'ART', 'PV'], target_phase='PV', suffix_name='npy'):
target_mask = None
mhd_images = []
for phase_name in phasenames:
mhd_image_path = glob(os.path.join(slice_dir, 'Image_%s*.mhd' % phase_name))[0]
mhd_mask_path = glob(os.path.join(slice_dir, 'Mask_%s*.mhd' % phase_name))[0]
mhd_image = read_mhd_image(mhd_image_path)
mask_image = read_mhd_image(mhd_mask_path)
mhd_image = np.asarray(np.squeeze(mhd_image), np.float32)
mhd_images.append(mhd_image)
mask_image = np.asarray(np.squeeze(mask_image), np.uint8)
if phase_name == target_phase:
target_mask = mask_image
print(np.shape(mhd_images))
mask_image = target_mask
mask_image_shape = list(np.shape(mask_image))
if len(mask_image_shape) == 3:
mask_image = mask_image[1, :, :]
print('the mask image shape is ', np.shape(mask_image))
if suffix_name == 'jpg':
mhd_images = np.transpose(np.asarray(mhd_images, np.float32), axes=[1, 2, 0])
mhd_image = mhd_images
elif suffix_name == 'npy':
mhd_images = np.concatenate(np.asarray(mhd_images, np.float), axis=0)
mhd_images = np.transpose(np.asarray(mhd_images, np.float32), axes=[1, 2, 0])
mhd_image = mhd_images
else:
print('the suffix name does not support')
assert False
max_v = 300.
min_v = -350.
mhd_image[mhd_image > max_v] = max_v
mhd_image[mhd_image < min_v] = min_v
print(np.mean(mhd_image, dtype=np.float32))
mhd_image -= np.mean(mhd_image)
min_v = np.min(mhd_image)
max_v = np.max(mhd_image)
interv = max_v - min_v
mhd_image = (mhd_image - min_v) / interv
file_name = os.path.basename(slice_dir)
dataset_name = os.path.basename(os.path.dirname(slice_dir))
phase_name = ''.join(phasenames)
save_path = os.path.join(save_dir, phase_name, dataset_name, file_name+'.' + suffix_name)
if not os.path.exists(os.path.dirname(save_path)):
os.makedirs(os.path.dirname(save_path))
print('the shape of mhd_image is ', np.shape(mhd_image), np.min(mhd_image), np.max(mhd_image))
#cv2.imwrite(save_path, mhd_image * 255)
np.save(save_path, mhd_image * 255)
xml_save_dir = os.path.join(save_dir, phase_name, dataset_name+'_xml')
if not os.path.exists(xml_save_dir):
os.makedirs(xml_save_dir)
evulate_gt_dir = os.path.join(save_dir, phase_name, dataset_name+'_gt')
if not os.path.exists(evulate_gt_dir):
os.makedirs(evulate_gt_dir)
xml_save_path = os.path.join(xml_save_dir, file_name + '.xml')
gt_save_path = os.path.join(evulate_gt_dir, file_name + '.txt') # for evulate
doc = Document()
root_node = doc.createElement('annotation')
doc.appendChild(root_node)
folder_name = os.path.basename(save_dir) + '/' + phase_name
folder_node = doc.createElement('folder')
root_node.appendChild(folder_node)
folder_txt_node = doc.createTextNode(folder_name)
folder_node.appendChild(folder_txt_node)
file_name = file_name + '.jpg'
filename_node = doc.createElement('filename')
root_node.appendChild(filename_node)
filename_txt_node = doc.createTextNode(file_name)
filename_node.appendChild(filename_txt_node)
shape = list(np.shape(mhd_image))
size_node = doc.createElement('size')
root_node.appendChild(size_node)
width_node = doc.createElement('width')
width_node.appendChild(doc.createTextNode(str(shape[0])))
height_node = doc.createElement('height')
height_node.appendChild(doc.createTextNode(str(shape[1])))
depth_node = doc.createElement('depth')
depth_node.appendChild(doc.createTextNode(str(3)))
size_node.appendChild(width_node)
size_node.appendChild(height_node)
size_node.appendChild(depth_node)
mask_image[mask_image != 1] = 0
xs, ys = np.where(mask_image == 1)
print(xs, ys)
min_x = np.min(xs)
min_y = np.min(ys)
max_x = np.max(xs)
max_y = np.max(ys)
object_node = doc.createElement('object')
root_node.appendChild(object_node)
name_node = doc.createElement('name')
name_node.appendChild(doc.createTextNode('Cyst'))
object_node.appendChild(name_node)
truncated_node = doc.createElement('truncated')
object_node.appendChild(truncated_node)
truncated_node.appendChild(doc.createTextNode('0'))
difficult_node = doc.createElement('difficult')
object_node.appendChild(difficult_node)
difficult_node.appendChild(doc.createTextNode('0'))
bndbox_node = doc.createElement('bndbox')
object_node.appendChild(bndbox_node)
xmin_node = doc.createElement('xmin')
xmin_node.appendChild(doc.createTextNode(str(min_y)))
bndbox_node.appendChild(xmin_node)
ymin_node = doc.createElement('ymin')
ymin_node.appendChild(doc.createTextNode(str(min_x)))
bndbox_node.appendChild(ymin_node)
xmax_node = doc.createElement('xmax')
xmax_node.appendChild(doc.createTextNode(str(max_y)))
bndbox_node.appendChild(xmax_node)
ymax_node = doc.createElement('ymax')
ymax_node.appendChild(doc.createTextNode(str(max_x)))
bndbox_node.appendChild(ymax_node)
with open(xml_save_path, 'wb') as f:
f.write(doc.toprettyxml(indent='\t', encoding='utf-8'))
line = '%s %d %d %d %d\n' % ('Cyst', min_y, min_x, max_y, max_x)
print(line)
lines = []
lines.append(line)
with open(gt_save_path, 'w') as f:
f.writelines(lines)
f.close()
def static_pixel_num(image_dir, target_phase='PV'):
# {0: 217784361, 1: 1392043, 2: 209128, 3: 1486676, 4: 458278, 5: 705482}
# {0: 1.0, 156, 1041, 146, 475, 308}
static_res = {
0: 0,
1: 0,
2: 0,
3: 0,
4: 0,
5: 0
}
from convert2jpg import extract_bboxs_mask_from_mask
from config import pixel2type, type2pixel
for sub_name in ['train', 'val', 'test']:
names = os.listdir(os.path.join(image_dir, sub_name))
for name in names:
cur_slice_dir = os.path.join(image_dir, sub_name, name)
mhd_mask_path = glob(os.path.join(cur_slice_dir, 'Mask_%s*.mhd' % target_phase))[0]
mask_image = read_mhd_image(mhd_mask_path)
min_xs, min_ys, max_xs, max_ys, names, mask = extract_bboxs_mask_from_mask(mask_image,
os.path.join(cur_slice_dir,
'tumor_types'))
for key in pixel2type.keys():
mask[mask == key] = type2pixel[pixel2type[key]][0]
pixel_value_set = np.unique(mask)
print pixel_value_set
for value in list(pixel_value_set):
static_res[value] += np.sum(mask == value)
print(static_res)
def convertCase2PNGs(volume_path, seg_path, save_dir=None, z_axis=5.0, short_edge=64):
'''
将nii转化成PNG
:param volume_path: nii的路径
:param seg_path:
:return:
'''
from skimage.measure import label
volume, header = read_nii_with_header(volume_path)
# volume = np.transpose(volume, [1, 0, 2])
volume = np.asarray(volume, np.float32)
max_v = 250.
min_v = -200.
# max_v = 180
# min_v = -70
volume[volume > max_v] = max_v
volume[volume < min_v] = min_v
volume -= np.mean(volume)
min_v = np.min(volume)
max_v = np.max(volume)
interv = max_v - min_v
volume = (volume - min_v) / interv
z_axis_case = header['voxel_spacing'][-1]
slice_num = int(z_axis / z_axis_case)
if slice_num == 0:
slice_num = 1
seg = read_nii(seg_path)
# print np.shape(volume), np.shape(seg)
[_, _, channel] = np.shape(volume)
imgs = []
names = []
masks = []
tumor_weakly_masks = []
liver_masks = []
i = slice_num + 1
pos_slice_num = np.sum(np.sum(np.sum(seg == 2, axis=0), axis=0) != 0)
total_slice_num = np.shape(seg)[-1]
print('pos_slice_num is ', pos_slice_num, total_slice_num)
neg_rate = (3.0 * pos_slice_num) / total_slice_num # 正样本是负样本的
if neg_rate > 1.0:
neg_rate = 1.0
for i in range(channel):
seg_slice = seg[:, :, i]
mid_slice = np.expand_dims(volume[:, :, i], axis=0)
pre_slice = []
# pre_end = i - slice_num / 2
# pre_end = i
# for j in range(1, slice_num + 1):
# z = pre_end - j
# if z < 0:
# z = 0
# pre_slice.append(volume[:, :, z])
if (i - 1) < 0:
pre_slice = np.expand_dims(volume[:, :, i], axis=0)
else:
pre_slice = np.expand_dims(volume[:, :, i-1], axis=0)
next_slice = []
# next_start = i + slice_num / 2
# next_start = i
# for j in range(1, slice_num + 1):
# z = next_start + j
# if z >= channel:
# z = channel - 1
# next_slice.append(volume[:, :, z])
if (i + 1) >= channel:
next_slice = np.expand_dims(volume[:, :, i], axis=0)
else:
next_slice = np.expand_dims(volume[:, :, i+1], axis=0)
# pre_slice = np.mean(pre_slice, axis=0, keepdims=True)
# next_slice = np.mean(next_slice, axis=0, keepdims=True)
imgs.append(
np.transpose(np.concatenate([pre_slice, mid_slice, next_slice], axis=0),
axes=[1, 2, 0]))
names.append(os.path.basename(volume_path).split('.')[0].split('-')[1] + '-' + str(i))
binary_seg_slice = np.asarray(seg_slice == 2, np.uint8)
# print np.max(binary_seg_slice)
masks.append(binary_seg_slice)
labeled_mask = label(binary_seg_slice)
weakly_label_mask = np.zeros_like(binary_seg_slice, np.uint8)
for idx in range(1, np.max(labeled_mask) + 1):
xs, ys = np.where(labeled_mask == idx)
min_xs = np.min(xs)
max_xs = np.max(xs)
min_ys = np.min(ys)
max_ys = np.max(ys)
weakly_label_mask[min_xs: max_xs, min_ys: max_ys] = 1
liver_masks.append(np.asarray(seg_slice == 1, np.uint8))
tumor_weakly_masks.append(weakly_label_mask)
# i += 1
return np.asarray(imgs, np.float32), np.asarray(masks, np.uint8), np.asarray(liver_masks, np.uint8), np.asarray(
tumor_weakly_masks, np.uint8)
def statics_num_slices_lesion(nii_dir):
'''
统计每个case,有多少slice具有病灶
:param nii_dir:
:return:
'''
mask_nii_paths = glob(os.path.join(nii_dir, 'segmentation-*.nii'))
for mask_nii_path in mask_nii_paths:
mask_img = read_nii(mask_nii_path)
has_lesion = np.asarray(np.sum(np.sum(mask_img == 2, axis=0), axis=0)>0, np.bool)
num_lesion_slices = np.sum(has_lesion)
print os.path.basename(mask_nii_path), num_lesion_slices, np.shape(mask_img)[-1]
if __name__ == '__main__':
# for phasename in ['NC', 'ART', 'PV']:
# convert_dicomseries2mhd(
# '/home/give/github/Cascaded-FCN-Tensorflow/Cascaded-FCN/tensorflow-unet/z_testdata/304176-2802027/' + phasename,
# '/home/give/github/Cascaded-FCN-Tensorflow/Cascaded-FCN/tensorflow-unet/z_testdata/304176-2802027/MHD/' + phasename + '.mhd'
# )
# names = os.listdir('/home/give/Documents/dataset/ISBI2017/media/nas/01_Datasets/CT/LITS/Training_Batch_2')
# for name in names:
# path = os.path.join('/home/give/Documents/dataset/ISBI2017/media/nas/01_Datasets/CT/LITS/Training_Batch_2', name)
# image = read_nil(path)
# print(np.shape(image))
# conver2JPG single phase
# image_dir = '/home/give/Documents/dataset/MICCAI2018/Slices/crossvalidation/0'
# save_dir = '/home/give/Documents/dataset/MICCAI2018_Detection/SinglePhase'
# phase_name = 'NC'
# MICCAI2018_Iterator(image_dir, dicom2jpg_singlephase, save_dir, phase_name)
# conver2JPG multi phase
# image_dir = '/home/give/Documents/dataset/LiverLesionDetection_Splited/0'
# static_pixel_num(image_dir, 'PV')
statics_num_slices_lesion('/media/give/CBMIR/ld/dataset/ISBI2017/media/nas/01_Datasets/CT/LITS/Training_Batch_2') | en | 0.266009 | # -*- coding=utf-8 -*- # 读取文件序列 # 将DICOM序列转化成MHD文件 # 读取单个DICOM文件 # 读取mhd文件 # 保存mhd文件 # 根据文件名返回期项名 # 读取DICOM文件中包含的病例ID信息 # 返回病灶类型和ID的字典类型的数据 key是typename value是typeid # 返回病灶类型ID和名称的字典类型的数据 key是typeid value是typename # 根据病灶类型的ID返回类型的字符串 # 根据病灶类型的name返回id的字符串 # 填充图像 # image.show() 返回进行kernel操作的5个模版 (1个是正常的dilated操作,还有四个是分别对四个方向进行单独进行dilated的操作) :param kernel_size: :return: [5, kernel_size, kernel_size] # 图像膨胀 # def image_expand(image, size): # 找到显著层 :param mask_image: [depth, width, height] :return: idx # 将一个矩阵保存为图片 # 这里必须加 cmap='gray' ,否则尽管原图像是灰度图(下图1),但是显示的是伪彩色图像(下图2)(如果不加的话) # 将图像画出来,并且画出标记的病灶 将一个矩阵如果可能,压缩到三维的空间 提取一幅图像中的ROI # def image_expand(mask_image, r): # return dilation(mask_image, disk(r)) 将形式如(512, 512)格式的图像转化为(1, 512, 512)形式的图片 返回一个mask图像的中心,是对xyz坐标计算平均值之后的结果 将[w, h, d]reshape为[d, w, h] # def test_convert2depthfirst(): # zeros = np.zeros([100, 100, 30]) # after_zeros = convert2depthfirst(zeros) # print np.shape(after_zeros) # test_convert2depthfirst() 将[d, w, h]reshape为[w, h, d] # numpy_clip # to float # scale down to 0 - 2 # zoom # order = 1 => biliniear interpolation # numpy_clip # print('static scaler 0', interv) # scale down to 0 - 2 # image /= (interv / 2) # zoom # order = 1 => biliniear interpolation 遍历MICCAI2018文件夹的框架 :param execute_func: :return: # for evulate #cv2.imwrite(save_path, mhd_image * 255) # for evulate # {0: 217784361, 1: 1392043, 2: 209128, 3: 1486676, 4: 458278, 5: 705482} # {0: 1.0, 156, 1041, 146, 475, 308} 将nii转化成PNG :param volume_path: nii的路径 :param seg_path: :return: # volume = np.transpose(volume, [1, 0, 2]) # max_v = 180 # min_v = -70 # print np.shape(volume), np.shape(seg) # 正样本是负样本的 # pre_end = i - slice_num / 2 # pre_end = i # for j in range(1, slice_num + 1): # z = pre_end - j # if z < 0: # z = 0 # pre_slice.append(volume[:, :, z]) # next_start = i + slice_num / 2 # next_start = i # for j in range(1, slice_num + 1): # z = next_start + j # if z >= channel: # z = channel - 1 # next_slice.append(volume[:, :, z]) # pre_slice = np.mean(pre_slice, axis=0, keepdims=True) # next_slice = np.mean(next_slice, axis=0, keepdims=True) # print np.max(binary_seg_slice) # i += 1 统计每个case,有多少slice具有病灶 :param nii_dir: :return: # for phasename in ['NC', 'ART', 'PV']: # convert_dicomseries2mhd( # '/home/give/github/Cascaded-FCN-Tensorflow/Cascaded-FCN/tensorflow-unet/z_testdata/304176-2802027/' + phasename, # '/home/give/github/Cascaded-FCN-Tensorflow/Cascaded-FCN/tensorflow-unet/z_testdata/304176-2802027/MHD/' + phasename + '.mhd' # ) # names = os.listdir('/home/give/Documents/dataset/ISBI2017/media/nas/01_Datasets/CT/LITS/Training_Batch_2') # for name in names: # path = os.path.join('/home/give/Documents/dataset/ISBI2017/media/nas/01_Datasets/CT/LITS/Training_Batch_2', name) # image = read_nil(path) # print(np.shape(image)) # conver2JPG single phase # image_dir = '/home/give/Documents/dataset/MICCAI2018/Slices/crossvalidation/0' # save_dir = '/home/give/Documents/dataset/MICCAI2018_Detection/SinglePhase' # phase_name = 'NC' # MICCAI2018_Iterator(image_dir, dicom2jpg_singlephase, save_dir, phase_name) # conver2JPG multi phase # image_dir = '/home/give/Documents/dataset/LiverLesionDetection_Splited/0' # static_pixel_num(image_dir, 'PV') | 2.326783 | 2 |
setup.py | marcus-luck/zohoreader | 1 | 2855 | from setuptools import setup
def readme():
with open('README.rst') as f:
return f.read()
setup(name='zohoreader',
version='0.1',
description='A simple reader for zoho projects API to get all projects, users and timereports',
long_description=readme(),
classifiers=[
'Development Status :: 3 - Alpha',
'License :: OSI Approved :: MIT License',
'Programming Language :: Python :: 3.5',
],
keywords='zoho, API, zoho project',
url='https://github.com/marcus-luck/zohoreader',
author='<NAME>',
author_email='<EMAIL>',
license='MIT',
packages=['zohoreader'],
zip_safe=False,
install_requires=[
'requests>=2.12.4',
'python-dateutil>=2.7.2'
],
test_suite='nose.collector',
tests_require=['nose', 'nose-cover3'],
include_package_data=True
)
| from setuptools import setup
def readme():
with open('README.rst') as f:
return f.read()
setup(name='zohoreader',
version='0.1',
description='A simple reader for zoho projects API to get all projects, users and timereports',
long_description=readme(),
classifiers=[
'Development Status :: 3 - Alpha',
'License :: OSI Approved :: MIT License',
'Programming Language :: Python :: 3.5',
],
keywords='zoho, API, zoho project',
url='https://github.com/marcus-luck/zohoreader',
author='<NAME>',
author_email='<EMAIL>',
license='MIT',
packages=['zohoreader'],
zip_safe=False,
install_requires=[
'requests>=2.12.4',
'python-dateutil>=2.7.2'
],
test_suite='nose.collector',
tests_require=['nose', 'nose-cover3'],
include_package_data=True
)
| none | 1 | 1.287505 | 1 |
|
web/repositories.bzl | Ubehebe/rules_webtesting | 0 | 2856 | <gh_stars>0
# Copyright 2016 Google Inc.
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS,
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
# See the License for the specific language governing permissions and
# limitations under the License.
"""Defines external repositories needed by rules_webtesting."""
load("//web/internal:platform_http_file.bzl", "platform_http_file")
load("@bazel_gazelle//:deps.bzl", "go_repository")
load("@bazel_tools//tools/build_defs/repo:http.bzl", "http_archive")
load("@bazel_tools//tools/build_defs/repo:java.bzl", "java_import_external")
# NOTE: URLs are mirrored by an asynchronous review process. They must
# be greppable for that to happen. It's OK to submit broken mirror
# URLs, so long as they're correctly formatted. Bazel's downloader
# has fast failover.
def web_test_repositories(**kwargs):
"""Defines external repositories required by Webtesting Rules.
This function exists for other Bazel projects to call from their WORKSPACE
file when depending on rules_webtesting using http_archive. This function
makes it easy to import these transitive dependencies into the parent
workspace. This will check to see if a repository has been previously defined
before defining a new repository.
Alternatively, individual dependencies may be excluded with an
"omit_" + name parameter. This is useful for users who want to be rigorous
about declaring their own direct dependencies, or when another Bazel project
is depended upon (e.g. rules_closure) that defines the same dependencies as
this one (e.g. com_google_guava.) Alternatively, a whitelist model may be
used by calling the individual functions this method references.
Please note that while these dependencies are defined, they are not actually
downloaded, unless a target is built that depends on them.
Args:
**kwargs: omit_... parameters used to prevent importing specific
dependencies.
"""
if should_create_repository("bazel_skylib", kwargs):
bazel_skylib()
if should_create_repository("com_github_blang_semver", kwargs):
com_github_blang_semver()
if should_create_repository("com_github_gorilla_context", kwargs):
com_github_gorilla_context()
if should_create_repository("com_github_gorilla_mux", kwargs):
com_github_gorilla_mux()
if should_create_repository("com_github_tebeka_selenium", kwargs):
com_github_tebeka_selenium()
if should_create_repository("com_github_urllib3", kwargs):
com_github_urllib3()
if should_create_repository("com_google_code_findbugs_jsr305", kwargs):
com_google_code_findbugs_jsr305()
if should_create_repository("com_google_code_gson", kwargs):
com_google_code_gson()
if should_create_repository(
"com_google_errorprone_error_prone_annotations",
kwargs,
):
com_google_errorprone_error_prone_annotations()
if should_create_repository("com_google_guava", kwargs):
com_google_guava()
if should_create_repository("com_squareup_okhttp3_okhttp", kwargs):
com_squareup_okhttp3_okhttp()
if should_create_repository("com_squareup_okio", kwargs):
com_squareup_okio()
if should_create_repository("commons_codec", kwargs):
commons_codec()
if should_create_repository("commons_logging", kwargs):
commons_logging()
if should_create_repository("junit", kwargs):
junit()
if should_create_repository("net_bytebuddy", kwargs):
net_bytebuddy()
if should_create_repository("org_apache_commons_exec", kwargs):
org_apache_commons_exec()
if should_create_repository("org_apache_httpcomponents_httpclient", kwargs):
org_apache_httpcomponents_httpclient()
if should_create_repository("org_apache_httpcomponents_httpcore", kwargs):
org_apache_httpcomponents_httpcore()
if should_create_repository("org_hamcrest_core", kwargs):
org_hamcrest_core()
if should_create_repository("org_jetbrains_kotlin_stdlib", kwargs):
org_jetbrains_kotlin_stdlib()
if should_create_repository("org_json", kwargs):
org_json()
if should_create_repository("org_seleniumhq_py", kwargs):
org_seleniumhq_py()
if should_create_repository("org_seleniumhq_selenium_api", kwargs):
org_seleniumhq_selenium_api()
if should_create_repository("org_seleniumhq_selenium_remote_driver", kwargs):
org_seleniumhq_selenium_remote_driver()
if kwargs.keys():
print("The following parameters are unknown: " + str(kwargs.keys()))
def should_create_repository(name, args):
"""Returns whether the name repository should be created.
This allows creation of a repository to be disabled by either an
"omit_" _+ name parameter or by previously defining a rule for the repository.
The args dict will be mutated to remove "omit_" + name.
Args:
name: The name of the repository that should be checked.
args: A dictionary that contains "omit_...": bool pairs.
Returns:
boolean indicating whether the repository should be created.
"""
key = "omit_" + name
if key in args:
val = args.pop(key)
if val:
return False
if native.existing_rule(name):
return False
return True
def browser_repositories(firefox = False, chromium = False, sauce = False):
"""Sets up repositories for browsers defined in //browsers/....
This should only be used on an experimental basis; projects should define
their own browsers.
Args:
firefox: Configure repositories for //browsers:firefox-native.
chromium: Configure repositories for //browsers:chromium-native.
sauce: Configure repositories for //browser/sauce:chrome-win10.
"""
if chromium:
org_chromium_chromedriver()
org_chromium_chromium()
if firefox:
org_mozilla_firefox()
org_mozilla_geckodriver()
if sauce:
com_saucelabs_sauce_connect()
def bazel_skylib():
http_archive(
name = "bazel_skylib",
sha256 = "",
strip_prefix = "bazel-skylib-e9fc4750d427196754bebb0e2e1e38d68893490a",
urls = [
"https://mirror.bazel.build/github.com/bazelbuild/bazel-skylib/archive/e9fc4750d427196754bebb0e2e1e38d68893490a.tar.gz",
"https://github.com/bazelbuild/bazel-skylib/archive/e9fc4750d427196754bebb0e2e1e38d68893490a.tar.gz",
],
)
def com_github_blang_semver():
go_repository(
name = "com_github_blang_semver",
importpath = "github.com/blang/semver",
sha256 = "3d9da53f4c2d3169bfa9b25f2f36f301a37556a47259c870881524c643c69c57",
strip_prefix = "semver-3.5.1",
urls = [
"https://mirror.bazel.build/github.com/blang/semver/archive/v3.5.1.tar.gz",
"https://github.com/blang/semver/archive/v3.5.1.tar.gz",
],
)
def com_github_gorilla_context():
go_repository(
name = "com_github_gorilla_context",
importpath = "github.com/gorilla/context",
sha256 = "2dfdd051c238695bf9ebfed0bf6a8c533507ac0893bce23be5930e973736bb03",
strip_prefix = "context-1.1.1",
urls = [
"https://mirror.bazel.build/github.com/gorilla/context/archive/v1.1.1.tar.gz",
"https://github.com/gorilla/context/archive/v1.1.1.tar.gz",
],
)
def com_github_gorilla_mux():
go_repository(
name = "com_github_gorilla_mux",
importpath = "github.com/gorilla/mux",
sha256 = "0dc18fb09413efea7393e9c2bd8b5b442ce08e729058f5f7e328d912c6c3d3e3",
strip_prefix = "mux-1.6.2",
urls = [
"https://mirror.bazel.build/github.com/gorilla/mux/archive/v1.6.2.tar.gz",
"https://github.com/gorilla/mux/archive/v1.6.2.tar.gz",
],
)
def com_github_tebeka_selenium():
go_repository(
name = "com_github_tebeka_selenium",
importpath = "github.com/tebeka/selenium",
sha256 = "c506637fd690f4125136233a3ea405908b8255e2d7aa2aa9d3b746d96df50dcd",
strip_prefix = "selenium-a49cf4b98a36c2b21b1ccb012852bd142d5fc04a",
urls = [
"https://mirror.bazel.build/github.com/tebeka/selenium/archive/a49cf4b98a36c2b21b1ccb012852bd142d5fc04a.tar.gz",
"https://github.com/tebeka/selenium/archive/a49cf4b98a36c2b21b1ccb012852bd142d5fc04a.tar.gz",
],
)
def com_github_urllib3():
http_archive(
name = "com_github_urllib3",
build_file = str(Label("//build_files:com_github_urllib3.BUILD")),
sha256 = "a68ac5e15e76e7e5dd2b8f94007233e01effe3e50e8daddf69acfd81cb686baf",
strip_prefix = "urllib3-1.23",
urls = [
"https://files.pythonhosted.org/packages/3c/d2/dc5471622bd200db1cd9319e02e71bc655e9ea27b8e0ce65fc69de0dac15/urllib3-1.23.tar.gz",
],
)
def com_google_code_findbugs_jsr305():
java_import_external(
name = "com_google_code_findbugs_jsr305",
jar_urls = [
"https://mirror.bazel.build/repo1.maven.org/maven2/com/google/code/findbugs/jsr305/3.0.2/jsr305-3.0.2.jar",
"https://repo1.maven.org/maven2/com/google/code/findbugs/jsr305/3.0.2/jsr305-3.0.2.jar",
],
jar_sha256 =
"766ad2a0783f2687962c8ad74ceecc38a28b9f72a2d085ee438b7813e928d0c7",
licenses = ["notice"], # BSD 3-clause
)
def com_google_code_gson():
java_import_external(
name = "com_google_code_gson",
jar_sha256 =
"233a0149fc365c9f6edbd683cfe266b19bdc773be98eabdaf6b3c924b48e7d81",
jar_urls = [
"https://mirror.bazel.build/repo1.maven.org/maven2/com/google/code/gson/gson/2.8.5/gson-2.8.5.jar",
"https://repo1.maven.org/maven2/com/google/code/gson/gson/2.8.5/gson-2.8.5.jar",
],
licenses = ["notice"], # The Apache Software License, Version 2.0
)
def com_google_errorprone_error_prone_annotations():
java_import_external(
name = "com_google_errorprone_error_prone_annotations",
jar_sha256 =
"10a5949aa0f95c8de4fd47edfe20534d2acefd8c224f8afea1f607e112816120",
jar_urls = [
"https://mirror.bazel.build/repo1.maven.org/maven2/com/google/errorprone/error_prone_annotations/2.3.1/error_prone_annotations-2.3.1.jar",
"https://repo1.maven.org/maven2/com/google/errorprone/error_prone_annotations/2.3.1/error_prone_annotations-2.3.1.jar",
],
licenses = ["notice"], # Apache 2.0
)
def com_google_guava():
java_import_external(
name = "com_google_guava",
jar_sha256 = "a0e9cabad665bc20bcd2b01f108e5fc03f756e13aea80abaadb9f407033bea2c",
jar_urls = [
"https://mirror.bazel.build/repo1.maven.org/maven2/com/google/guava/guava/26.0-jre/guava-26.9-jre.jar",
"https://repo1.maven.org/maven2/com/google/guava/guava/26.0-jre/guava-26.0-jre.jar",
],
licenses = ["notice"], # Apache 2.0
exports = [
"@com_google_code_findbugs_jsr305",
"@com_google_errorprone_error_prone_annotations",
],
)
def com_saucelabs_sauce_connect():
platform_http_file(
name = "com_saucelabs_sauce_connect",
licenses = ["by_exception_only"], # SauceLabs EULA
amd64_sha256 = "dd53f2cdcec489fbc2443942b853b51bf44af39f230600573119cdd315ddee52",
amd64_urls = [
"https://saucelabs.com/downloads/sc-4.5.1-linux.tar.gz",
],
macos_sha256 = "920ae7bd5657bccdcd27bb596593588654a2820486043e9a12c9062700697e66",
macos_urls = [
"https://saucelabs.com/downloads/sc-4.5.1-osx.zip",
],
windows_sha256 =
"ec11b4ee029c9f0cba316820995df6ab5a4f394053102e1871b9f9589d0a9eb5",
windows_urls = [
"https://saucelabs.com/downloads/sc-4.4.12-win32.zip",
],
)
def com_squareup_okhttp3_okhttp():
java_import_external(
name = "com_squareup_okhttp3_okhttp",
jar_urls = [
"https://mirror.bazel.build/repo1.maven.org/maven2/com/squareup/okhttp3/okhttp/3.9.1/okhttp-3.9.1.jar",
"https://repo1.maven.org/maven2/com/squareup/okhttp3/okhttp/3.9.1/okhttp-3.9.1.jar",
],
jar_sha256 =
"a0d01017a42bba26e507fc6d448bb36e536f4b6e612f7c42de30bbdac2b7785e",
licenses = ["notice"], # Apache 2.0
deps = [
"@com_squareup_okio",
"@com_google_code_findbugs_jsr305",
],
)
def com_squareup_okio():
java_import_external(
name = "com_squareup_okio",
jar_sha256 = "79b948cf77504750fdf7aeaf362b5060415136ab6635e5113bd22925e0e9e737",
jar_urls = [
"https://mirror.bazel.build/repo1.maven.org/maven2/com/squareup/okio/okio/2.0.0/okio-2.0.0.jar",
"https://repo1.maven.org/maven2/com/squareup/okio/okio/2.0.0/okio-2.0.0.jar",
],
licenses = ["notice"], # Apache 2.0
deps = [
"@com_google_code_findbugs_jsr305",
"@org_jetbrains_kotlin_stdlib",
],
)
def commons_codec():
java_import_external(
name = "commons_codec",
jar_sha256 =
"e599d5318e97aa48f42136a2927e6dfa4e8881dff0e6c8e3109ddbbff51d7b7d",
jar_urls = [
"https://mirror.bazel.build/repo1.maven.org/maven2/commons-codec/commons-codec/1.11/commons-codec-1.11.jar",
"https://repo1.maven.org/maven2/commons-codec/commons-codec/1.11/commons-codec-1.11.jar",
],
licenses = ["notice"], # Apache License, Version 2.0
)
def commons_logging():
java_import_external(
name = "commons_logging",
jar_sha256 =
"daddea1ea0be0f56978ab3006b8ac92834afeefbd9b7e4e6316fca57df0fa636",
jar_urls = [
"https://mirror.bazel.build/repo1.maven.org/maven2/commons-logging/commons-logging/1.2/commons-logging-1.2.jar",
"https://repo1.maven.org/maven2/commons-logging/commons-logging/1.2/commons-logging-1.2.jar",
],
licenses = ["notice"], # The Apache Software License, Version 2.0
)
def junit():
java_import_external(
name = "junit",
jar_sha256 =
"59721f0805e223d84b90677887d9ff567dc534d7c502ca903c0c2b17f05c116a",
jar_urls = [
"https://mirror.bazel.build/repo1.maven.org/maven2/junit/junit/4.12/junit-4.12.jar",
"https://repo1.maven.org/maven2/junit/junit/4.12/junit-4.12.jar",
],
licenses = ["reciprocal"], # Eclipse Public License 1.0
testonly_ = 1,
deps = ["@org_hamcrest_core"],
)
def net_bytebuddy():
java_import_external(
name = "net_bytebuddy",
jar_sha256 = "4b87ad52a8f64a1197508e176e84076584160e3d65229ff757efee870cd4a8e2",
jar_urls = [
"https://mirror.bazel.build/repo1.maven.org/maven2/net/bytebuddy/byte-buddy/1.8.19/byte-buddy-1.8.19.jar",
"https://repo1.maven.org/maven2/net/bytebuddy/byte-buddy/1.8.19/byte-buddy-1.8.19.jar",
],
licenses = ["notice"], # Apache 2.0
deps = ["@com_google_code_findbugs_jsr305"],
)
def org_apache_commons_exec():
java_import_external(
name = "org_apache_commons_exec",
jar_sha256 =
"cb49812dc1bfb0ea4f20f398bcae1a88c6406e213e67f7524fb10d4f8ad9347b",
jar_urls = [
"https://mirror.bazel.build/repo1.maven.org/maven2/org/apache/commons/commons-exec/1.3/commons-exec-1.3.jar",
"https://repo1.maven.org/maven2/org/apache/commons/commons-exec/1.3/commons-exec-1.3.jar",
],
licenses = ["notice"], # Apache License, Version 2.0
)
def org_apache_httpcomponents_httpclient():
java_import_external(
name = "org_apache_httpcomponents_httpclient",
jar_sha256 =
"c03f813195e7a80e3608d0ddd8da80b21696a4c92a6a2298865bf149071551c7",
jar_urls = [
"https://mirror.bazel.build/repo1.maven.org/maven2/org/apache/httpcomponents/httpclient/4.5.6/httpclient-4.5.6.jar",
"https://repo1.maven.org/maven2/org/apache/httpcomponents/httpclient/4.5.6/httpclient-4.5.6.jar",
],
licenses = ["notice"], # Apache License, Version 2.0
deps = [
"@org_apache_httpcomponents_httpcore",
"@commons_logging",
"@commons_codec",
],
)
def org_apache_httpcomponents_httpcore():
java_import_external(
name = "org_apache_httpcomponents_httpcore",
jar_sha256 =
"1b4a1c0b9b4222eda70108d3c6e2befd4a6be3d9f78ff53dd7a94966fdf51fc5",
jar_urls = [
"https://mirror.bazel.build/repo1.maven.org/maven2/org/apache/httpcomponents/httpcore/4.4.9/httpcore-4.4.9.jar",
"https://repo1.maven.org/maven2/org/apache/httpcomponents/httpcore/4.4.9/httpcore-4.4.9.jar",
],
licenses = ["notice"], # Apache License, Version 2.0
)
def org_chromium_chromedriver():
platform_http_file(
name = "org_chromium_chromedriver",
licenses = ["reciprocal"], # BSD 3-clause, ICU, MPL 1.1, libpng (BSD/MIT-like), Academic Free License v. 2.0, BSD 2-clause, MIT
amd64_sha256 =
"71eafe087900dbca4bc0b354a1d172df48b31a4a502e21f7c7b156d7e76c95c7",
amd64_urls = [
"https://chromedriver.storage.googleapis.com/2.41/chromedriver_linux64.zip",
],
macos_sha256 =
"fd32a27148f44796a55f5ce3397015c89ebd9f600d9dda2bcaca54575e2497ae",
macos_urls = [
"https://chromedriver.storage.googleapis.com/2.41/chromedriver_mac64.zip",
],
windows_sha256 =
"a8fa028acebef7b931ef9cb093f02865f9f7495e49351f556e919f7be77f072e",
windows_urls = [
"https://chromedriver.storage.googleapis.com/2.38/chromedriver_win32.zip",
],
)
def org_chromium_chromium():
platform_http_file(
name = "org_chromium_chromium",
licenses = ["notice"], # BSD 3-clause (maybe more?)
amd64_sha256 =
"6933d0afce6e17304b62029fbbd246cbe9e130eb0d90d7682d3765d3dbc8e1c8",
amd64_urls = [
"https://commondatastorage.googleapis.com/chromium-browser-snapshots/Linux_x64/561732/chrome-linux.zip",
],
macos_sha256 =
"084884e91841a923d7b6e81101f0105bbc3b0026f9f6f7a3477f5b313ee89e32",
macos_urls = [
"https://commondatastorage.googleapis.com/chromium-browser-snapshots/Mac/561733/chrome-mac.zip",
],
windows_sha256 =
"d1bb728118c12ea436d8ea07dba980789e7d860aa664dd1fad78bc20e8d9391c",
windows_urls = [
"https://commondatastorage.googleapis.com/chromium-browser-snapshots/Win_x64/540270/chrome-win32.zip",
],
)
def org_hamcrest_core():
java_import_external(
name = "org_hamcrest_core",
jar_sha256 =
"66fdef91e9739348df7a096aa384a5685f4e875584cce89386a7a47251c4d8e9",
jar_urls = [
"https://mirror.bazel.build/repo1.maven.org/maven2/org/hamcrest/hamcrest-core/1.3/hamcrest-core-1.3.jar",
"https://repo1.maven.org/maven2/org/hamcrest/hamcrest-core/1.3/hamcrest-core-1.3.jar",
],
licenses = ["notice"], # New BSD License
testonly_ = 1,
)
def org_jetbrains_kotlin_stdlib():
java_import_external(
name = "org_jetbrains_kotlin_stdlib",
jar_sha256 = "62eaf9cc6e746cef4593abe7cdb4dd48694ef5f817c852e0d9fbbd11fcfc564e",
jar_urls = [
"https://mirror.bazel.build/repo1.maven.org/maven2/org/jetbrains/kotlin/kotlin-stdlib/1.2.61/kotlin-stdlib-1.2.61.jar",
"https://repo1.maven.org/maven2/org/jetbrains/kotlin/kotlin-stdlib/1.2.61/kotlin-stdlib-1.2.61.jar",
],
licenses = ["notice"], # The Apache Software License, Version 2.0
)
def org_json():
java_import_external(
name = "org_json",
jar_sha256 = "518080049ba83181914419d11a25d9bc9833a2d729b6a6e7469fa52851356da8",
jar_urls = [
"https://mirror.bazel.build/repo1.maven.org/maven2/org/json/json/20180813/json-20180813.jar",
"https://repo1.maven.org/maven2/org/json/json/20180813/json-20180813.jar",
],
licenses = ["notice"], # MIT-style license
)
def org_mozilla_firefox():
platform_http_file(
name = "org_mozilla_firefox",
licenses = ["reciprocal"], # MPL 2.0
amd64_sha256 =
"3a729ddcb1e0f5d63933177a35177ac6172f12edbf9fbbbf45305f49333608de",
amd64_urls = [
"https://mirror.bazel.build/ftp.mozilla.org/pub/firefox/releases/61.0.2/linux-x86_64/en-US/firefox-61.0.2.tar.bz2",
"https://ftp.mozilla.org/pub/firefox/releases/61.0.2/linux-x86_64/en-US/firefox-61.0.2.tar.bz2",
],
macos_sha256 =
"bf23f659ae34832605dd0576affcca060d1077b7bf7395bc9874f62b84936dc5",
macos_urls = [
"https://mirror.bazel.build/ftp.mozilla.org/pub/firefox/releases/61.0.2/mac/en-US/Firefox%2061.0.2.dmg",
"https://ftp.mozilla.org/pub/firefox/releases/61.0.2/mac/en-US/Firefox%2061.0.2.dmg",
],
)
def org_mozilla_geckodriver():
platform_http_file(
name = "org_mozilla_geckodriver",
licenses = ["reciprocal"], # MPL 2.0
amd64_sha256 =
"c9ae92348cf00aa719be6337a608fae8304691a95668e8e338d92623ba9e0ec6",
amd64_urls = [
"https://mirror.bazel.build/github.com/mozilla/geckodriver/releases/download/v0.21.0/geckodriver-v0.21.0-linux64.tar.gz",
"https://github.com/mozilla/geckodriver/releases/download/v0.21.0/geckodriver-v0.21.0-linux64.tar.gz",
],
macos_sha256 =
"ce4a3e9d706db94e8760988de1ad562630412fa8cf898819572522be584f01ce",
macos_urls = [
"https://mirror.bazel.build/github.com/mozilla/geckodriver/releases/download/v0.21.0/geckodriver-v0.21.0-macos.tar.gz",
"https://github.com/mozilla/geckodriver/releases/download/v0.21.0/geckodriver-v0.21.0-macos.tar.gz",
],
)
def org_seleniumhq_py():
http_archive(
name = "org_seleniumhq_py",
build_file = str(Label("//build_files:org_seleniumhq_py.BUILD")),
sha256 = "f9ca21919b564a0a86012cd2177923e3a7f37c4a574207086e710192452a7c40",
strip_prefix = "selenium-3.14.0",
urls = [
"https://files.pythonhosted.org/packages/af/7c/3f76140976b1c8f8a6b437ccd1f04efaed37bdc2600530e76ba981c677b9/selenium-3.14.0.tar.gz",
],
)
def org_seleniumhq_selenium_api():
java_import_external(
name = "org_seleniumhq_selenium_api",
jar_sha256 = "1fc941f86ba4fefeae9a705c1468e65beeaeb63688e19ad3fcbda74cc883ee5b",
jar_urls = [
"https://mirror.bazel.build/repo1.maven.org/maven2/org/seleniumhq/selenium/selenium-api/3.14.0/selenium-api-3.14.0.jar",
"https://repo1.maven.org/maven2/org/seleniumhq/selenium/selenium-api/3.14.0/selenium-api-3.14.0.jar",
],
licenses = ["notice"], # The Apache Software License, Version 2.0
testonly_ = 1,
)
def org_seleniumhq_selenium_remote_driver():
java_import_external(
name = "org_seleniumhq_selenium_remote_driver",
jar_sha256 =
"284cb4ea043539353bd5ecd774cbd726b705d423ea4569376c863d0b66e5eaf2",
jar_urls = [
"https://mirror.bazel.build/repo1.maven.org/maven2/org/seleniumhq/selenium/selenium-remote-driver/3.14.0/selenium-remote-driver-3.14.0.jar",
"https://repo1.maven.org/maven2/org/seleniumhq/selenium/selenium-remote-driver/3.14.0/selenium-remote-driver-3.14.0.jar",
],
licenses = ["notice"], # The Apache Software License, Version 2.0
testonly_ = 1,
deps = [
"@com_google_code_gson",
"@com_google_guava",
"@net_bytebuddy",
"@com_squareup_okhttp3_okhttp",
"@com_squareup_okio",
"@commons_codec",
"@commons_logging",
"@org_apache_commons_exec",
"@org_apache_httpcomponents_httpclient",
"@org_apache_httpcomponents_httpcore",
"@org_seleniumhq_selenium_api",
],
)
| # Copyright 2016 Google Inc.
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS,
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
# See the License for the specific language governing permissions and
# limitations under the License.
"""Defines external repositories needed by rules_webtesting."""
load("//web/internal:platform_http_file.bzl", "platform_http_file")
load("@bazel_gazelle//:deps.bzl", "go_repository")
load("@bazel_tools//tools/build_defs/repo:http.bzl", "http_archive")
load("@bazel_tools//tools/build_defs/repo:java.bzl", "java_import_external")
# NOTE: URLs are mirrored by an asynchronous review process. They must
# be greppable for that to happen. It's OK to submit broken mirror
# URLs, so long as they're correctly formatted. Bazel's downloader
# has fast failover.
def web_test_repositories(**kwargs):
"""Defines external repositories required by Webtesting Rules.
This function exists for other Bazel projects to call from their WORKSPACE
file when depending on rules_webtesting using http_archive. This function
makes it easy to import these transitive dependencies into the parent
workspace. This will check to see if a repository has been previously defined
before defining a new repository.
Alternatively, individual dependencies may be excluded with an
"omit_" + name parameter. This is useful for users who want to be rigorous
about declaring their own direct dependencies, or when another Bazel project
is depended upon (e.g. rules_closure) that defines the same dependencies as
this one (e.g. com_google_guava.) Alternatively, a whitelist model may be
used by calling the individual functions this method references.
Please note that while these dependencies are defined, they are not actually
downloaded, unless a target is built that depends on them.
Args:
**kwargs: omit_... parameters used to prevent importing specific
dependencies.
"""
if should_create_repository("bazel_skylib", kwargs):
bazel_skylib()
if should_create_repository("com_github_blang_semver", kwargs):
com_github_blang_semver()
if should_create_repository("com_github_gorilla_context", kwargs):
com_github_gorilla_context()
if should_create_repository("com_github_gorilla_mux", kwargs):
com_github_gorilla_mux()
if should_create_repository("com_github_tebeka_selenium", kwargs):
com_github_tebeka_selenium()
if should_create_repository("com_github_urllib3", kwargs):
com_github_urllib3()
if should_create_repository("com_google_code_findbugs_jsr305", kwargs):
com_google_code_findbugs_jsr305()
if should_create_repository("com_google_code_gson", kwargs):
com_google_code_gson()
if should_create_repository(
"com_google_errorprone_error_prone_annotations",
kwargs,
):
com_google_errorprone_error_prone_annotations()
if should_create_repository("com_google_guava", kwargs):
com_google_guava()
if should_create_repository("com_squareup_okhttp3_okhttp", kwargs):
com_squareup_okhttp3_okhttp()
if should_create_repository("com_squareup_okio", kwargs):
com_squareup_okio()
if should_create_repository("commons_codec", kwargs):
commons_codec()
if should_create_repository("commons_logging", kwargs):
commons_logging()
if should_create_repository("junit", kwargs):
junit()
if should_create_repository("net_bytebuddy", kwargs):
net_bytebuddy()
if should_create_repository("org_apache_commons_exec", kwargs):
org_apache_commons_exec()
if should_create_repository("org_apache_httpcomponents_httpclient", kwargs):
org_apache_httpcomponents_httpclient()
if should_create_repository("org_apache_httpcomponents_httpcore", kwargs):
org_apache_httpcomponents_httpcore()
if should_create_repository("org_hamcrest_core", kwargs):
org_hamcrest_core()
if should_create_repository("org_jetbrains_kotlin_stdlib", kwargs):
org_jetbrains_kotlin_stdlib()
if should_create_repository("org_json", kwargs):
org_json()
if should_create_repository("org_seleniumhq_py", kwargs):
org_seleniumhq_py()
if should_create_repository("org_seleniumhq_selenium_api", kwargs):
org_seleniumhq_selenium_api()
if should_create_repository("org_seleniumhq_selenium_remote_driver", kwargs):
org_seleniumhq_selenium_remote_driver()
if kwargs.keys():
print("The following parameters are unknown: " + str(kwargs.keys()))
def should_create_repository(name, args):
"""Returns whether the name repository should be created.
This allows creation of a repository to be disabled by either an
"omit_" _+ name parameter or by previously defining a rule for the repository.
The args dict will be mutated to remove "omit_" + name.
Args:
name: The name of the repository that should be checked.
args: A dictionary that contains "omit_...": bool pairs.
Returns:
boolean indicating whether the repository should be created.
"""
key = "omit_" + name
if key in args:
val = args.pop(key)
if val:
return False
if native.existing_rule(name):
return False
return True
def browser_repositories(firefox = False, chromium = False, sauce = False):
"""Sets up repositories for browsers defined in //browsers/....
This should only be used on an experimental basis; projects should define
their own browsers.
Args:
firefox: Configure repositories for //browsers:firefox-native.
chromium: Configure repositories for //browsers:chromium-native.
sauce: Configure repositories for //browser/sauce:chrome-win10.
"""
if chromium:
org_chromium_chromedriver()
org_chromium_chromium()
if firefox:
org_mozilla_firefox()
org_mozilla_geckodriver()
if sauce:
com_saucelabs_sauce_connect()
def bazel_skylib():
http_archive(
name = "bazel_skylib",
sha256 = "",
strip_prefix = "bazel-skylib-e9fc4750d427196754bebb0e2e1e38d68893490a",
urls = [
"https://mirror.bazel.build/github.com/bazelbuild/bazel-skylib/archive/e9fc4750d427196754bebb0e2e1e38d68893490a.tar.gz",
"https://github.com/bazelbuild/bazel-skylib/archive/e9fc4750d427196754bebb0e2e1e38d68893490a.tar.gz",
],
)
def com_github_blang_semver():
go_repository(
name = "com_github_blang_semver",
importpath = "github.com/blang/semver",
sha256 = "3d9da53f4c2d3169bfa9b25f2f36f301a37556a47259c870881524c643c69c57",
strip_prefix = "semver-3.5.1",
urls = [
"https://mirror.bazel.build/github.com/blang/semver/archive/v3.5.1.tar.gz",
"https://github.com/blang/semver/archive/v3.5.1.tar.gz",
],
)
def com_github_gorilla_context():
go_repository(
name = "com_github_gorilla_context",
importpath = "github.com/gorilla/context",
sha256 = "2dfdd051c238695bf9ebfed0bf6a8c533507ac0893bce23be5930e973736bb03",
strip_prefix = "context-1.1.1",
urls = [
"https://mirror.bazel.build/github.com/gorilla/context/archive/v1.1.1.tar.gz",
"https://github.com/gorilla/context/archive/v1.1.1.tar.gz",
],
)
def com_github_gorilla_mux():
go_repository(
name = "com_github_gorilla_mux",
importpath = "github.com/gorilla/mux",
sha256 = "0dc18fb09413efea7393e9c2bd8b5b442ce08e729058f5f7e328d912c6c3d3e3",
strip_prefix = "mux-1.6.2",
urls = [
"https://mirror.bazel.build/github.com/gorilla/mux/archive/v1.6.2.tar.gz",
"https://github.com/gorilla/mux/archive/v1.6.2.tar.gz",
],
)
def com_github_tebeka_selenium():
go_repository(
name = "com_github_tebeka_selenium",
importpath = "github.com/tebeka/selenium",
sha256 = "c506637fd690f4125136233a3ea405908b8255e2d7aa2aa9d3b746d96df50dcd",
strip_prefix = "selenium-a49cf4b98a36c2b21b1ccb012852bd142d5fc04a",
urls = [
"https://mirror.bazel.build/github.com/tebeka/selenium/archive/a49cf4b98a36c2b21b1ccb012852bd142d5fc04a.tar.gz",
"https://github.com/tebeka/selenium/archive/a49cf4b98a36c2b21b1ccb012852bd142d5fc04a.tar.gz",
],
)
def com_github_urllib3():
http_archive(
name = "com_github_urllib3",
build_file = str(Label("//build_files:com_github_urllib3.BUILD")),
sha256 = "a68ac5e15e76e7e5dd2b8f94007233e01effe3e50e8daddf69acfd81cb686baf",
strip_prefix = "urllib3-1.23",
urls = [
"https://files.pythonhosted.org/packages/3c/d2/dc5471622bd200db1cd9319e02e71bc655e9ea27b8e0ce65fc69de0dac15/urllib3-1.23.tar.gz",
],
)
def com_google_code_findbugs_jsr305():
java_import_external(
name = "com_google_code_findbugs_jsr305",
jar_urls = [
"https://mirror.bazel.build/repo1.maven.org/maven2/com/google/code/findbugs/jsr305/3.0.2/jsr305-3.0.2.jar",
"https://repo1.maven.org/maven2/com/google/code/findbugs/jsr305/3.0.2/jsr305-3.0.2.jar",
],
jar_sha256 =
"766ad2a0783f2687962c8ad74ceecc38a28b9f72a2d085ee438b7813e928d0c7",
licenses = ["notice"], # BSD 3-clause
)
def com_google_code_gson():
java_import_external(
name = "com_google_code_gson",
jar_sha256 =
"233a0149fc365c9f6edbd683cfe266b19bdc773be98eabdaf6b3c924b48e7d81",
jar_urls = [
"https://mirror.bazel.build/repo1.maven.org/maven2/com/google/code/gson/gson/2.8.5/gson-2.8.5.jar",
"https://repo1.maven.org/maven2/com/google/code/gson/gson/2.8.5/gson-2.8.5.jar",
],
licenses = ["notice"], # The Apache Software License, Version 2.0
)
def com_google_errorprone_error_prone_annotations():
java_import_external(
name = "com_google_errorprone_error_prone_annotations",
jar_sha256 =
"10a5949aa0f95c8de4fd47edfe20534d2acefd8c224f8afea1f607e112816120",
jar_urls = [
"https://mirror.bazel.build/repo1.maven.org/maven2/com/google/errorprone/error_prone_annotations/2.3.1/error_prone_annotations-2.3.1.jar",
"https://repo1.maven.org/maven2/com/google/errorprone/error_prone_annotations/2.3.1/error_prone_annotations-2.3.1.jar",
],
licenses = ["notice"], # Apache 2.0
)
def com_google_guava():
java_import_external(
name = "com_google_guava",
jar_sha256 = "a0e9cabad665bc20bcd2b01f108e5fc03f756e13aea80abaadb9f407033bea2c",
jar_urls = [
"https://mirror.bazel.build/repo1.maven.org/maven2/com/google/guava/guava/26.0-jre/guava-26.9-jre.jar",
"https://repo1.maven.org/maven2/com/google/guava/guava/26.0-jre/guava-26.0-jre.jar",
],
licenses = ["notice"], # Apache 2.0
exports = [
"@com_google_code_findbugs_jsr305",
"@com_google_errorprone_error_prone_annotations",
],
)
def com_saucelabs_sauce_connect():
platform_http_file(
name = "com_saucelabs_sauce_connect",
licenses = ["by_exception_only"], # SauceLabs EULA
amd64_sha256 = "dd53f2cdcec489fbc2443942b853b51bf44af39f230600573119cdd315ddee52",
amd64_urls = [
"https://saucelabs.com/downloads/sc-4.5.1-linux.tar.gz",
],
macos_sha256 = "920ae7bd5657bccdcd27bb596593588654a2820486043e9a12c9062700697e66",
macos_urls = [
"https://saucelabs.com/downloads/sc-4.5.1-osx.zip",
],
windows_sha256 =
"ec11b4ee029c9f0cba316820995df6ab5a4f394053102e1871b9f9589d0a9eb5",
windows_urls = [
"https://saucelabs.com/downloads/sc-4.4.12-win32.zip",
],
)
def com_squareup_okhttp3_okhttp():
java_import_external(
name = "com_squareup_okhttp3_okhttp",
jar_urls = [
"https://mirror.bazel.build/repo1.maven.org/maven2/com/squareup/okhttp3/okhttp/3.9.1/okhttp-3.9.1.jar",
"https://repo1.maven.org/maven2/com/squareup/okhttp3/okhttp/3.9.1/okhttp-3.9.1.jar",
],
jar_sha256 =
"a0d01017a42bba26e507fc6d448bb36e536f4b6e612f7c42de30bbdac2b7785e",
licenses = ["notice"], # Apache 2.0
deps = [
"@com_squareup_okio",
"@com_google_code_findbugs_jsr305",
],
)
def com_squareup_okio():
java_import_external(
name = "com_squareup_okio",
jar_sha256 = "79b948cf77504750fdf7aeaf362b5060415136ab6635e5113bd22925e0e9e737",
jar_urls = [
"https://mirror.bazel.build/repo1.maven.org/maven2/com/squareup/okio/okio/2.0.0/okio-2.0.0.jar",
"https://repo1.maven.org/maven2/com/squareup/okio/okio/2.0.0/okio-2.0.0.jar",
],
licenses = ["notice"], # Apache 2.0
deps = [
"@com_google_code_findbugs_jsr305",
"@org_jetbrains_kotlin_stdlib",
],
)
def commons_codec():
java_import_external(
name = "commons_codec",
jar_sha256 =
"e599d5318e97aa48f42136a2927e6dfa4e8881dff0e6c8e3109ddbbff51d7b7d",
jar_urls = [
"https://mirror.bazel.build/repo1.maven.org/maven2/commons-codec/commons-codec/1.11/commons-codec-1.11.jar",
"https://repo1.maven.org/maven2/commons-codec/commons-codec/1.11/commons-codec-1.11.jar",
],
licenses = ["notice"], # Apache License, Version 2.0
)
def commons_logging():
java_import_external(
name = "commons_logging",
jar_sha256 =
"daddea1ea0be0f56978ab3006b8ac92834afeefbd9b7e4e6316fca57df0fa636",
jar_urls = [
"https://mirror.bazel.build/repo1.maven.org/maven2/commons-logging/commons-logging/1.2/commons-logging-1.2.jar",
"https://repo1.maven.org/maven2/commons-logging/commons-logging/1.2/commons-logging-1.2.jar",
],
licenses = ["notice"], # The Apache Software License, Version 2.0
)
def junit():
java_import_external(
name = "junit",
jar_sha256 =
"59721f0805e223d84b90677887d9ff567dc534d7c502ca903c0c2b17f05c116a",
jar_urls = [
"https://mirror.bazel.build/repo1.maven.org/maven2/junit/junit/4.12/junit-4.12.jar",
"https://repo1.maven.org/maven2/junit/junit/4.12/junit-4.12.jar",
],
licenses = ["reciprocal"], # Eclipse Public License 1.0
testonly_ = 1,
deps = ["@org_hamcrest_core"],
)
def net_bytebuddy():
java_import_external(
name = "net_bytebuddy",
jar_sha256 = "4b87ad52a8f64a1197508e176e84076584160e3d65229ff757efee870cd4a8e2",
jar_urls = [
"https://mirror.bazel.build/repo1.maven.org/maven2/net/bytebuddy/byte-buddy/1.8.19/byte-buddy-1.8.19.jar",
"https://repo1.maven.org/maven2/net/bytebuddy/byte-buddy/1.8.19/byte-buddy-1.8.19.jar",
],
licenses = ["notice"], # Apache 2.0
deps = ["@com_google_code_findbugs_jsr305"],
)
def org_apache_commons_exec():
java_import_external(
name = "org_apache_commons_exec",
jar_sha256 =
"cb49812dc1bfb0ea4f20f398bcae1a88c6406e213e67f7524fb10d4f8ad9347b",
jar_urls = [
"https://mirror.bazel.build/repo1.maven.org/maven2/org/apache/commons/commons-exec/1.3/commons-exec-1.3.jar",
"https://repo1.maven.org/maven2/org/apache/commons/commons-exec/1.3/commons-exec-1.3.jar",
],
licenses = ["notice"], # Apache License, Version 2.0
)
def org_apache_httpcomponents_httpclient():
java_import_external(
name = "org_apache_httpcomponents_httpclient",
jar_sha256 =
"c03f813195e7a80e3608d0ddd8da80b21696a4c92a6a2298865bf149071551c7",
jar_urls = [
"https://mirror.bazel.build/repo1.maven.org/maven2/org/apache/httpcomponents/httpclient/4.5.6/httpclient-4.5.6.jar",
"https://repo1.maven.org/maven2/org/apache/httpcomponents/httpclient/4.5.6/httpclient-4.5.6.jar",
],
licenses = ["notice"], # Apache License, Version 2.0
deps = [
"@org_apache_httpcomponents_httpcore",
"@commons_logging",
"@commons_codec",
],
)
def org_apache_httpcomponents_httpcore():
java_import_external(
name = "org_apache_httpcomponents_httpcore",
jar_sha256 =
"1b4a1c0b9b4222eda70108d3c6e2befd4a6be3d9f78ff53dd7a94966fdf51fc5",
jar_urls = [
"https://mirror.bazel.build/repo1.maven.org/maven2/org/apache/httpcomponents/httpcore/4.4.9/httpcore-4.4.9.jar",
"https://repo1.maven.org/maven2/org/apache/httpcomponents/httpcore/4.4.9/httpcore-4.4.9.jar",
],
licenses = ["notice"], # Apache License, Version 2.0
)
def org_chromium_chromedriver():
platform_http_file(
name = "org_chromium_chromedriver",
licenses = ["reciprocal"], # BSD 3-clause, ICU, MPL 1.1, libpng (BSD/MIT-like), Academic Free License v. 2.0, BSD 2-clause, MIT
amd64_sha256 =
"71eafe087900dbca4bc0b354a1d172df48b31a4a502e21f7c7b156d7e76c95c7",
amd64_urls = [
"https://chromedriver.storage.googleapis.com/2.41/chromedriver_linux64.zip",
],
macos_sha256 =
"fd32a27148f44796a55f5ce3397015c89ebd9f600d9dda2bcaca54575e2497ae",
macos_urls = [
"https://chromedriver.storage.googleapis.com/2.41/chromedriver_mac64.zip",
],
windows_sha256 =
"a8fa028acebef7b931ef9cb093f02865f9f7495e49351f556e919f7be77f072e",
windows_urls = [
"https://chromedriver.storage.googleapis.com/2.38/chromedriver_win32.zip",
],
)
def org_chromium_chromium():
platform_http_file(
name = "org_chromium_chromium",
licenses = ["notice"], # BSD 3-clause (maybe more?)
amd64_sha256 =
"6933d0afce6e17304b62029fbbd246cbe9e130eb0d90d7682d3765d3dbc8e1c8",
amd64_urls = [
"https://commondatastorage.googleapis.com/chromium-browser-snapshots/Linux_x64/561732/chrome-linux.zip",
],
macos_sha256 =
"084884e91841a923d7b6e81101f0105bbc3b0026f9f6f7a3477f5b313ee89e32",
macos_urls = [
"https://commondatastorage.googleapis.com/chromium-browser-snapshots/Mac/561733/chrome-mac.zip",
],
windows_sha256 =
"d1bb728118c12ea436d8ea07dba980789e7d860aa664dd1fad78bc20e8d9391c",
windows_urls = [
"https://commondatastorage.googleapis.com/chromium-browser-snapshots/Win_x64/540270/chrome-win32.zip",
],
)
def org_hamcrest_core():
java_import_external(
name = "org_hamcrest_core",
jar_sha256 =
"66fdef91e9739348df7a096aa384a5685f4e875584cce89386a7a47251c4d8e9",
jar_urls = [
"https://mirror.bazel.build/repo1.maven.org/maven2/org/hamcrest/hamcrest-core/1.3/hamcrest-core-1.3.jar",
"https://repo1.maven.org/maven2/org/hamcrest/hamcrest-core/1.3/hamcrest-core-1.3.jar",
],
licenses = ["notice"], # New BSD License
testonly_ = 1,
)
def org_jetbrains_kotlin_stdlib():
java_import_external(
name = "org_jetbrains_kotlin_stdlib",
jar_sha256 = "62eaf9cc6e746cef4593abe7cdb4dd48694ef5f817c852e0d9fbbd11fcfc564e",
jar_urls = [
"https://mirror.bazel.build/repo1.maven.org/maven2/org/jetbrains/kotlin/kotlin-stdlib/1.2.61/kotlin-stdlib-1.2.61.jar",
"https://repo1.maven.org/maven2/org/jetbrains/kotlin/kotlin-stdlib/1.2.61/kotlin-stdlib-1.2.61.jar",
],
licenses = ["notice"], # The Apache Software License, Version 2.0
)
def org_json():
java_import_external(
name = "org_json",
jar_sha256 = "518080049ba83181914419d11a25d9bc9833a2d729b6a6e7469fa52851356da8",
jar_urls = [
"https://mirror.bazel.build/repo1.maven.org/maven2/org/json/json/20180813/json-20180813.jar",
"https://repo1.maven.org/maven2/org/json/json/20180813/json-20180813.jar",
],
licenses = ["notice"], # MIT-style license
)
def org_mozilla_firefox():
platform_http_file(
name = "org_mozilla_firefox",
licenses = ["reciprocal"], # MPL 2.0
amd64_sha256 =
"3a729ddcb1e0f5d63933177a35177ac6172f12edbf9fbbbf45305f49333608de",
amd64_urls = [
"https://mirror.bazel.build/ftp.mozilla.org/pub/firefox/releases/61.0.2/linux-x86_64/en-US/firefox-61.0.2.tar.bz2",
"https://ftp.mozilla.org/pub/firefox/releases/61.0.2/linux-x86_64/en-US/firefox-61.0.2.tar.bz2",
],
macos_sha256 =
"bf23f659ae34832605dd0576affcca060d1077b7bf7395bc9874f62b84936dc5",
macos_urls = [
"https://mirror.bazel.build/ftp.mozilla.org/pub/firefox/releases/61.0.2/mac/en-US/Firefox%2061.0.2.dmg",
"https://ftp.mozilla.org/pub/firefox/releases/61.0.2/mac/en-US/Firefox%2061.0.2.dmg",
],
)
def org_mozilla_geckodriver():
platform_http_file(
name = "org_mozilla_geckodriver",
licenses = ["reciprocal"], # MPL 2.0
amd64_sha256 =
"c9ae92348cf00aa719be6337a608fae8304691a95668e8e338d92623ba9e0ec6",
amd64_urls = [
"https://mirror.bazel.build/github.com/mozilla/geckodriver/releases/download/v0.21.0/geckodriver-v0.21.0-linux64.tar.gz",
"https://github.com/mozilla/geckodriver/releases/download/v0.21.0/geckodriver-v0.21.0-linux64.tar.gz",
],
macos_sha256 =
"ce4a3e9d706db94e8760988de1ad562630412fa8cf898819572522be584f01ce",
macos_urls = [
"https://mirror.bazel.build/github.com/mozilla/geckodriver/releases/download/v0.21.0/geckodriver-v0.21.0-macos.tar.gz",
"https://github.com/mozilla/geckodriver/releases/download/v0.21.0/geckodriver-v0.21.0-macos.tar.gz",
],
)
def org_seleniumhq_py():
http_archive(
name = "org_seleniumhq_py",
build_file = str(Label("//build_files:org_seleniumhq_py.BUILD")),
sha256 = "f9ca21919b564a0a86012cd2177923e3a7f37c4a574207086e710192452a7c40",
strip_prefix = "selenium-3.14.0",
urls = [
"https://files.pythonhosted.org/packages/af/7c/3f76140976b1c8f8a6b437ccd1f04efaed37bdc2600530e76ba981c677b9/selenium-3.14.0.tar.gz",
],
)
def org_seleniumhq_selenium_api():
java_import_external(
name = "org_seleniumhq_selenium_api",
jar_sha256 = "1fc941f86ba4fefeae9a705c1468e65beeaeb63688e19ad3fcbda74cc883ee5b",
jar_urls = [
"https://mirror.bazel.build/repo1.maven.org/maven2/org/seleniumhq/selenium/selenium-api/3.14.0/selenium-api-3.14.0.jar",
"https://repo1.maven.org/maven2/org/seleniumhq/selenium/selenium-api/3.14.0/selenium-api-3.14.0.jar",
],
licenses = ["notice"], # The Apache Software License, Version 2.0
testonly_ = 1,
)
def org_seleniumhq_selenium_remote_driver():
java_import_external(
name = "org_seleniumhq_selenium_remote_driver",
jar_sha256 =
"284cb4ea043539353bd5ecd774cbd726b705d423ea4569376c863d0b66e5eaf2",
jar_urls = [
"https://mirror.bazel.build/repo1.maven.org/maven2/org/seleniumhq/selenium/selenium-remote-driver/3.14.0/selenium-remote-driver-3.14.0.jar",
"https://repo1.maven.org/maven2/org/seleniumhq/selenium/selenium-remote-driver/3.14.0/selenium-remote-driver-3.14.0.jar",
],
licenses = ["notice"], # The Apache Software License, Version 2.0
testonly_ = 1,
deps = [
"@com_google_code_gson",
"@com_google_guava",
"@net_bytebuddy",
"@com_squareup_okhttp3_okhttp",
"@com_squareup_okio",
"@commons_codec",
"@commons_logging",
"@org_apache_commons_exec",
"@org_apache_httpcomponents_httpclient",
"@org_apache_httpcomponents_httpcore",
"@org_seleniumhq_selenium_api",
],
) | en | 0.790899 | # Copyright 2016 Google Inc. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. Defines external repositories needed by rules_webtesting. # NOTE: URLs are mirrored by an asynchronous review process. They must # be greppable for that to happen. It's OK to submit broken mirror # URLs, so long as they're correctly formatted. Bazel's downloader # has fast failover. Defines external repositories required by Webtesting Rules. This function exists for other Bazel projects to call from their WORKSPACE file when depending on rules_webtesting using http_archive. This function makes it easy to import these transitive dependencies into the parent workspace. This will check to see if a repository has been previously defined before defining a new repository. Alternatively, individual dependencies may be excluded with an "omit_" + name parameter. This is useful for users who want to be rigorous about declaring their own direct dependencies, or when another Bazel project is depended upon (e.g. rules_closure) that defines the same dependencies as this one (e.g. com_google_guava.) Alternatively, a whitelist model may be used by calling the individual functions this method references. Please note that while these dependencies are defined, they are not actually downloaded, unless a target is built that depends on them. Args: **kwargs: omit_... parameters used to prevent importing specific dependencies. Returns whether the name repository should be created. This allows creation of a repository to be disabled by either an "omit_" _+ name parameter or by previously defining a rule for the repository. The args dict will be mutated to remove "omit_" + name. Args: name: The name of the repository that should be checked. args: A dictionary that contains "omit_...": bool pairs. Returns: boolean indicating whether the repository should be created. Sets up repositories for browsers defined in //browsers/.... This should only be used on an experimental basis; projects should define their own browsers. Args: firefox: Configure repositories for //browsers:firefox-native. chromium: Configure repositories for //browsers:chromium-native. sauce: Configure repositories for //browser/sauce:chrome-win10. # BSD 3-clause # The Apache Software License, Version 2.0 # Apache 2.0 # Apache 2.0 # SauceLabs EULA # Apache 2.0 # Apache 2.0 # Apache License, Version 2.0 # The Apache Software License, Version 2.0 # Eclipse Public License 1.0 # Apache 2.0 # Apache License, Version 2.0 # Apache License, Version 2.0 # Apache License, Version 2.0 # BSD 3-clause, ICU, MPL 1.1, libpng (BSD/MIT-like), Academic Free License v. 2.0, BSD 2-clause, MIT # BSD 3-clause (maybe more?) # New BSD License # The Apache Software License, Version 2.0 # MIT-style license # MPL 2.0 # MPL 2.0 # The Apache Software License, Version 2.0 # The Apache Software License, Version 2.0 | 1.472682 | 1 |
code/tools/run_viz_single_task.py | santomon/taskonomy | 789 | 2857 | <gh_stars>100-1000
from __future__ import absolute_import, division, print_function
import argparse
import importlib
import itertools
import time
from multiprocessing import Pool
import numpy as np
import os
import pdb
import pickle
import subprocess
import sys
import tensorflow as tf
import tensorflow.contrib.slim as slim
import threading
import init_paths
from models.sample_models import *
target_tasks = "autoencoder colorization curvature denoise edge2d edge3d ego_motion fix_pose impainting_whole jigsaw keypoint2d keypoint3d non_fixated_pose point_match reshade rgb2depth rgb2mist rgb2sfnorm room_layout segment25d segment2d vanishing_point_well_defined segmentsemantic_rb class_selected class_1000"
list_of_tasks = target_tasks.split(" ")
ON_TEST_SET = True
IN_TRAIN_MODE = False
parser = argparse.ArgumentParser(description='Viz Single Task')
parser.add_argument('--idx', dest='idx',
help='Task to run', type=int)
parser.add_argument('--hs', dest='hs',
help='Hidden size to use', type=int)
parser.add_argument('--n-parallel', dest='n_parallel',
help='Number of models to run in parallel', type=int)
parser.set_defaults(n_parallel=1)
tf.logging.set_verbosity(tf.logging.ERROR)
ipython_std_out = sys.stdout
# Disabe
def blockPrint():
sys.stdout = open(os.devnull, 'w')
# Restore
def enablePrint():
sys.stdout = ipython_std_out
# Force Print
def forcePrint(str):
enablePrint()
print(str)
sys.stdout.flush()
blockPrint()
def remove_dups(seq):
seen = set()
seen_add = seen.add
return [x for x in seq if not (x in seen or seen_add(x))]
pairs = list(itertools.product(list_of_tasks, list_of_tasks))
args = parser.parse_args()
idx_to_run = args.idx
if idx_to_run == -1:
pairs_to_run = pairs
else:
pairs_to_run = pairs[idx_to_run:idx_to_run+1]
def run_to_task(task_to):
import general_utils
from general_utils import RuntimeDeterminedEnviromentVars
import models.architectures as architectures
from data.load_ops import resize_rescale_image
import utils
from data.task_data_loading import load_and_specify_preprocessors_for_representation_extraction
import lib.data.load_ops as load_ops
tf.logging.set_verbosity(tf.logging.ERROR)
all_outputs = {}
pickle_dir = 'viz_output_single_task.pkl'
import os
if os.path.isfile(pickle_dir):
with open( pickle_dir, 'rb') as fp:
all_outputs = pickle.load(fp)
for task in list_of_tasks:
if task in all_outputs:
print("{} already exists....\n\n\n".format(task))
continue
print("Doing {task}".format(task=task))
general_utils = importlib.reload(general_utils)
tf.reset_default_graph()
training_runners = { 'sess': tf.InteractiveSession(), 'coord': tf.train.Coordinator() }
# task = '{f}__{t}__{hs}'.format(f=task_from, t=task_to, hs=args.hs)
CONFIG_DIR = '/home/ubuntu/task-taxonomy-331b/experiments/final/{TASK}'.format(TASK=task)
############## Load Configs ##############
cfg = utils.load_config( CONFIG_DIR, nopause=True )
RuntimeDeterminedEnviromentVars.register_dict( cfg )
split_file = cfg['test_filenames'] if ON_TEST_SET else cfg['val_filenames']
cfg['train_filenames'] = split_file
cfg['val_filenames'] = split_file
cfg['test_filenames'] = split_file
cfg['num_epochs'] = 1
cfg['randomize'] = False
root_dir = cfg['root_dir']
cfg['num_read_threads'] = 1
print(cfg['log_root'])
if task == 'jigsaw':
continue
cfg['model_path'] = os.path.join(
cfg['log_root'],
task,
'model.permanent-ckpt'
)
print( cfg['model_path'])
if cfg['model_path'] is None:
continue
############## Set Up Inputs ##############
# tf.logging.set_verbosity( tf.logging.INFO )
inputs = utils.setup_input( cfg, is_training=ON_TEST_SET, use_filename_queue=False ) # is_training determines whether to use train/validaiton
RuntimeDeterminedEnviromentVars.load_dynamic_variables( inputs, cfg )
RuntimeDeterminedEnviromentVars.populate_registered_variables()
start_time = time.time()
# utils.print_start_info( cfg, inputs[ 'max_steps' ], is_training=False )
############## Set Up Model ##############
model = utils.setup_model( inputs, cfg, is_training=IN_TRAIN_MODE )
m = model[ 'model' ]
model[ 'saver_op' ].restore( training_runners[ 'sess' ], cfg[ 'model_path' ] )
############## Start dataloading workers ##############
data_prefetch_init_fn = utils.get_data_prefetch_threads_init_fn(
inputs, cfg, is_training=ON_TEST_SET, use_filename_queue=False )
prefetch_threads = threading.Thread(
target=data_prefetch_init_fn,
args=( training_runners[ 'sess' ], training_runners[ 'coord' ] ))
prefetch_threads.start()
############## Run First Batch ##############
if not hasattr(m, 'masks'):
(
input_batch, target_batch,
data_idx,
predicted, loss,
) = training_runners['sess'].run( [
m.input_images, m.targets,
model[ 'data_idxs' ],
m.decoder_output, m.total_loss] )
mask_batch = 1.
else:
(
input_batch, target_batch, mask_batch,
data_idx,
predicted, loss,
) = training_runners['sess'].run( [
m.input_images, m.targets, m.masks,
model[ 'data_idxs' ],
m.decoder_output, m.total_loss] )
if task == 'segment2d' or task == 'segment25d':
from sklearn.decomposition import PCA
x = np.zeros((32,256,256,3), dtype='float')
for i in range(predicted.shape[0]):
embedding_flattened = np.squeeze(predicted[i]).reshape((-1,64))
pca = PCA(n_components=3)
pca.fit(embedding_flattened)
lower_dim = pca.transform(embedding_flattened).reshape((256,256,-1))
lower_dim = (lower_dim - lower_dim.min()) / (lower_dim.max() - lower_dim.min())
x[i] = lower_dim
predicted = x
############## Clean Up ##############
training_runners[ 'coord' ].request_stop()
training_runners[ 'coord' ].join()
# if os.path.isfile(pickle_dir):
# with open(pickle_dir, 'rb') as fp:
# all_outputs = pickle.load(fp)
############## Store to dict ##############
to_store = {
'input': input_batch,
'target': target_batch,
'mask': mask_batch,
'data_idx':data_idx,
'output':predicted}
all_outputs[task] = to_store
print("Done: {}".format(task))
# os.system("sudo cp {d} /home/ubuntu/s3/model_log".format(d=pickle_dir))
############## Reset graph and paths ##############
tf.reset_default_graph()
training_runners['sess'].close()
try:
del sys.modules[ 'config' ]
except:
pass
sys.path = remove_dups(sys.path)
print("FINISHED: {}\n\n\n\n\n\n".format(task))
pickle_dir = 'viz_output_single_task.pkl'
with open( pickle_dir, 'wb') as fp:
pickle.dump(all_outputs, fp)
try:
subprocess.call("aws s3 cp {} s3://task-preprocessing-512-oregon/visualizations/".format(pickle_dir), shell=True)
except:
subprocess.call("sudo cp {} /home/ubuntu/s3/visualizations/".format(pickle_dir), shell=True)
return
if __name__ == '__main__':
run_to_task(None)
# with Pool(args.n_parallel) as p:
# p.map(run_to_task, list_of_tasks)
| from __future__ import absolute_import, division, print_function
import argparse
import importlib
import itertools
import time
from multiprocessing import Pool
import numpy as np
import os
import pdb
import pickle
import subprocess
import sys
import tensorflow as tf
import tensorflow.contrib.slim as slim
import threading
import init_paths
from models.sample_models import *
target_tasks = "autoencoder colorization curvature denoise edge2d edge3d ego_motion fix_pose impainting_whole jigsaw keypoint2d keypoint3d non_fixated_pose point_match reshade rgb2depth rgb2mist rgb2sfnorm room_layout segment25d segment2d vanishing_point_well_defined segmentsemantic_rb class_selected class_1000"
list_of_tasks = target_tasks.split(" ")
ON_TEST_SET = True
IN_TRAIN_MODE = False
parser = argparse.ArgumentParser(description='Viz Single Task')
parser.add_argument('--idx', dest='idx',
help='Task to run', type=int)
parser.add_argument('--hs', dest='hs',
help='Hidden size to use', type=int)
parser.add_argument('--n-parallel', dest='n_parallel',
help='Number of models to run in parallel', type=int)
parser.set_defaults(n_parallel=1)
tf.logging.set_verbosity(tf.logging.ERROR)
ipython_std_out = sys.stdout
# Disabe
def blockPrint():
sys.stdout = open(os.devnull, 'w')
# Restore
def enablePrint():
sys.stdout = ipython_std_out
# Force Print
def forcePrint(str):
enablePrint()
print(str)
sys.stdout.flush()
blockPrint()
def remove_dups(seq):
seen = set()
seen_add = seen.add
return [x for x in seq if not (x in seen or seen_add(x))]
pairs = list(itertools.product(list_of_tasks, list_of_tasks))
args = parser.parse_args()
idx_to_run = args.idx
if idx_to_run == -1:
pairs_to_run = pairs
else:
pairs_to_run = pairs[idx_to_run:idx_to_run+1]
def run_to_task(task_to):
import general_utils
from general_utils import RuntimeDeterminedEnviromentVars
import models.architectures as architectures
from data.load_ops import resize_rescale_image
import utils
from data.task_data_loading import load_and_specify_preprocessors_for_representation_extraction
import lib.data.load_ops as load_ops
tf.logging.set_verbosity(tf.logging.ERROR)
all_outputs = {}
pickle_dir = 'viz_output_single_task.pkl'
import os
if os.path.isfile(pickle_dir):
with open( pickle_dir, 'rb') as fp:
all_outputs = pickle.load(fp)
for task in list_of_tasks:
if task in all_outputs:
print("{} already exists....\n\n\n".format(task))
continue
print("Doing {task}".format(task=task))
general_utils = importlib.reload(general_utils)
tf.reset_default_graph()
training_runners = { 'sess': tf.InteractiveSession(), 'coord': tf.train.Coordinator() }
# task = '{f}__{t}__{hs}'.format(f=task_from, t=task_to, hs=args.hs)
CONFIG_DIR = '/home/ubuntu/task-taxonomy-331b/experiments/final/{TASK}'.format(TASK=task)
############## Load Configs ##############
cfg = utils.load_config( CONFIG_DIR, nopause=True )
RuntimeDeterminedEnviromentVars.register_dict( cfg )
split_file = cfg['test_filenames'] if ON_TEST_SET else cfg['val_filenames']
cfg['train_filenames'] = split_file
cfg['val_filenames'] = split_file
cfg['test_filenames'] = split_file
cfg['num_epochs'] = 1
cfg['randomize'] = False
root_dir = cfg['root_dir']
cfg['num_read_threads'] = 1
print(cfg['log_root'])
if task == 'jigsaw':
continue
cfg['model_path'] = os.path.join(
cfg['log_root'],
task,
'model.permanent-ckpt'
)
print( cfg['model_path'])
if cfg['model_path'] is None:
continue
############## Set Up Inputs ##############
# tf.logging.set_verbosity( tf.logging.INFO )
inputs = utils.setup_input( cfg, is_training=ON_TEST_SET, use_filename_queue=False ) # is_training determines whether to use train/validaiton
RuntimeDeterminedEnviromentVars.load_dynamic_variables( inputs, cfg )
RuntimeDeterminedEnviromentVars.populate_registered_variables()
start_time = time.time()
# utils.print_start_info( cfg, inputs[ 'max_steps' ], is_training=False )
############## Set Up Model ##############
model = utils.setup_model( inputs, cfg, is_training=IN_TRAIN_MODE )
m = model[ 'model' ]
model[ 'saver_op' ].restore( training_runners[ 'sess' ], cfg[ 'model_path' ] )
############## Start dataloading workers ##############
data_prefetch_init_fn = utils.get_data_prefetch_threads_init_fn(
inputs, cfg, is_training=ON_TEST_SET, use_filename_queue=False )
prefetch_threads = threading.Thread(
target=data_prefetch_init_fn,
args=( training_runners[ 'sess' ], training_runners[ 'coord' ] ))
prefetch_threads.start()
############## Run First Batch ##############
if not hasattr(m, 'masks'):
(
input_batch, target_batch,
data_idx,
predicted, loss,
) = training_runners['sess'].run( [
m.input_images, m.targets,
model[ 'data_idxs' ],
m.decoder_output, m.total_loss] )
mask_batch = 1.
else:
(
input_batch, target_batch, mask_batch,
data_idx,
predicted, loss,
) = training_runners['sess'].run( [
m.input_images, m.targets, m.masks,
model[ 'data_idxs' ],
m.decoder_output, m.total_loss] )
if task == 'segment2d' or task == 'segment25d':
from sklearn.decomposition import PCA
x = np.zeros((32,256,256,3), dtype='float')
for i in range(predicted.shape[0]):
embedding_flattened = np.squeeze(predicted[i]).reshape((-1,64))
pca = PCA(n_components=3)
pca.fit(embedding_flattened)
lower_dim = pca.transform(embedding_flattened).reshape((256,256,-1))
lower_dim = (lower_dim - lower_dim.min()) / (lower_dim.max() - lower_dim.min())
x[i] = lower_dim
predicted = x
############## Clean Up ##############
training_runners[ 'coord' ].request_stop()
training_runners[ 'coord' ].join()
# if os.path.isfile(pickle_dir):
# with open(pickle_dir, 'rb') as fp:
# all_outputs = pickle.load(fp)
############## Store to dict ##############
to_store = {
'input': input_batch,
'target': target_batch,
'mask': mask_batch,
'data_idx':data_idx,
'output':predicted}
all_outputs[task] = to_store
print("Done: {}".format(task))
# os.system("sudo cp {d} /home/ubuntu/s3/model_log".format(d=pickle_dir))
############## Reset graph and paths ##############
tf.reset_default_graph()
training_runners['sess'].close()
try:
del sys.modules[ 'config' ]
except:
pass
sys.path = remove_dups(sys.path)
print("FINISHED: {}\n\n\n\n\n\n".format(task))
pickle_dir = 'viz_output_single_task.pkl'
with open( pickle_dir, 'wb') as fp:
pickle.dump(all_outputs, fp)
try:
subprocess.call("aws s3 cp {} s3://task-preprocessing-512-oregon/visualizations/".format(pickle_dir), shell=True)
except:
subprocess.call("sudo cp {} /home/ubuntu/s3/visualizations/".format(pickle_dir), shell=True)
return
if __name__ == '__main__':
run_to_task(None)
# with Pool(args.n_parallel) as p:
# p.map(run_to_task, list_of_tasks) | en | 0.200263 | # Disabe # Restore # Force Print # task = '{f}__{t}__{hs}'.format(f=task_from, t=task_to, hs=args.hs) ############## Load Configs ############## ############## Set Up Inputs ############## # tf.logging.set_verbosity( tf.logging.INFO ) # is_training determines whether to use train/validaiton # utils.print_start_info( cfg, inputs[ 'max_steps' ], is_training=False ) ############## Set Up Model ############## ############## Start dataloading workers ############## ############## Run First Batch ############## ############## Clean Up ############## # if os.path.isfile(pickle_dir): # with open(pickle_dir, 'rb') as fp: # all_outputs = pickle.load(fp) ############## Store to dict ############## # os.system("sudo cp {d} /home/ubuntu/s3/model_log".format(d=pickle_dir)) ############## Reset graph and paths ############## # with Pool(args.n_parallel) as p: # p.map(run_to_task, list_of_tasks) | 2.039172 | 2 |
stratum/portage/build_defs.bzl | cholve/stratum | 267 | 2858 | <reponame>cholve/stratum<filename>stratum/portage/build_defs.bzl
# Copyright 2018 Google LLC
# Copyright 2018-present Open Networking Foundation
# SPDX-License-Identifier: Apache-2.0
"""A portable build system for Stratum P4 switch stack.
To use this, load() this file in a BUILD file, specifying the symbols needed.
The public symbols are the macros:
decorate(path)
sc_cc_lib Declare a portable Library.
sc_proto_lib Declare a portable .proto Library.
sc_cc_bin Declare a portable Binary.
sc_package Declare a portable tarball package.
and the variables/lists:
ALL_ARCHES All known arches.
EMBEDDED_ARCHES All embedded arches.
EMBEDDED_PPC Name of PowerPC arch - "ppc".
EMBEDDED_X86 Name of "x86" arch.
HOST_ARCH Name of default "host" arch.
HOST_ARCHES All host arches.
STRATUM_INTERNAL For declaring Stratum internal visibility.
The macros are like cc_library(), proto_library(), and cc_binary(), but with
different options and some restrictions. The key difference: you can
supply lists of architectures for which they should be compiled - defaults
to all if left unstated. Internally, libraries and binaries are generated
for every listed architecture. The names are decorated to keep them different
and allow all to be generated and addressed independently.
This aspect of the system is suboptimal - something along the lines of
augmenting context with a user defined configuration fragment would be a
much cleaner solution.
Currently supported architectures:
ppc
x86
"""
load("//tools/build_defs/label:def.bzl", "parse_label")
load(
"//devtools/build_cleaner/skylark:build_defs.bzl",
"register_extension_info",
)
load("@rules_proto//proto:defs.bzl", "proto_library")
load("@rules_cc//cc:defs.bzl", "cc_binary", "cc_library", "cc_test")
# Generic path & label helpers. ============================================
def _normpath(path):
"""Normalize a path.
Normalizes a path by removing unnecessary path-up segments and its
corresponding directories. Providing own implementation because import os
is not allowed in build defs.
For example
../../dir/to/deeply/nested/path/../../../other/path
will become
../../dir/to/other/path
Args:
path: A valid absolute or relative path to normalize.
Returns:
A path equivalent to the input path with minimal use of path-up segments.
Invalid input paths will stay invalid.
"""
sep = "/"
level = 0
result = []
for d in path.split(sep):
if d in ("", "."):
if result:
continue
elif d == "..":
if level > 0:
result.pop()
level += -1
continue
else:
level += 1
result.append(d)
return sep.join(result)
# Adds a suffix to a label, expanding implicit targets if needed.
def decorate(label, suffix):
if label.endswith(":"): # .../bar: -> .../bar
label = label[:-1]
if ":" in label: # .../bar:bat -> .../bar:bat_suffix
return "%s_%s" % (label, suffix)
elif label.startswith("//"): # //foo/bar -> //foo/bar:bar_suffix
return "%s:%s_%s" % (label, label.split("/")[-1], suffix)
else: # bar -> bar_suffix
return "%s_%s" % (label, suffix)
# Creates a relative filename from a label, replacing "//" and ":".
def _make_filename(label):
if label.startswith("//"): # //foo/bar:bat/baz -> google3_foo/bar/bat/baz
return label.replace("//", "google3/").replace(":", "/")
elif label.startswith(":"): # :bat/baz -> bat/baz
return label[1:]
else: # bat/baz -> bat/baz
return label
# Adds dquotes around a string.
def dquote(s):
return '"' + s + '"'
# Adds squotes around a string.
def squote(s):
return "'" + s + "'"
# Emulate Python 2.5+ str(startswith([prefix ...])
def starts_with(s, prefix_list):
for prefix in prefix_list:
if s.startswith(prefix):
return prefix
return None
def sc_platform_select(host = None, ppc = None, x86 = None, default = None):
"""Public macro to alter blaze rules based on the platform architecture.
Generates a blaze select(...) statement that can be used in most contexts to
alter a blaze rule based on the target platform architecture. If no selection
is provided for a given platform, {default} is used instead. A specific value
or default must be provided for every target platform.
Args:
host: The value to use for host builds.
ppc: The value to use for ppc builds.
x86: The value to use for x86 builds.
default: The value to use for any of {host,ppc,x86} that isn't specified.
Returns:
The requested selector.
"""
if default == None and (host == None or ppc == None or x86 == None):
fail("Missing a select value for at least one platform in " +
"sc_platform_select. Please add.")
config_label_prefix = "//stratum:stratum_"
return select({
"//conditions:default": (host or default),
config_label_prefix + "ppc": (ppc or default),
config_label_prefix + "x86": (x86 or default),
})
# Generates an sc_platform_select based on a textual list of arches.
def sc_platform_filter(value, default, arches):
return sc_platform_select(
host = value if "host" in arches else default,
ppc = value if "ppc" in arches else default,
x86 = value if "x86" in arches else default,
)
def sc_platform_alias(
name,
host = None,
ppc = None,
x86 = None,
default = None,
visibility = None):
"""Public macro to create an alias that changes based on target arch.
Generates a blaze alias that will select the appropriate target. If no
selection is provided for a given platform and no default is set, a
dummy default target is used instead.
Args:
name: The name of the alias target.
host: The result of the alias for host builds.
ppc: The result of the alias for ppc builds.
x86: The result of the alias for x86 builds.
default: The result of the alias for any of {host,ppc,x86} that isn't
specified.
visibility: The visibility of the alias target.
"""
native.alias(
name = name,
actual = sc_platform_select(
default = default or "//stratum/portage:dummy",
host = host,
ppc = ppc,
x86 = x86,
),
visibility = visibility,
)
# Embedded build definitions. ==============================================
EMBEDDED_PPC = "ppc"
EMBEDDED_X86 = "x86"
EMBEDDED_ARCHES = [
EMBEDDED_PPC,
EMBEDDED_X86,
]
HOST_ARCH = "host"
HOST_ARCHES = [HOST_ARCH]
ALL_ARCHES = EMBEDDED_ARCHES + HOST_ARCHES
# Identify Stratum platform arch for .pb.h shims and other portability hacks.
_ARCH_DEFINES = sc_platform_select(
default = ["STRATUM_ARCH_HOST"],
ppc = ["STRATUM_ARCH_PPC"],
x86 = ["STRATUM_ARCH_X86"],
)
STRATUM_INTERNAL = [
"//stratum:__subpackages__",
]
#
# Build options for all embedded architectures
#
# Set _TRACE_SRCS to show sources in embedded sc_cc_lib compile steps.
# This is more general than it may seem: genrule doesn't have hdrs or deps
# attributes, so all embedded dependencies appear as a `src'.
# TODO(unknown): if useful again then inject from cmdline else kill feature.
_TRACE_SRCS = False
# Used for all gcc invocations.
_EMBEDDED_FLAGS = [
"-O0", # Don't use this for program-sizing build
#-- "-Os", # Use this for program-sizing build
"-g", # Don't use this for program-sizing build
"-Wall",
"-Werror", # Warn lots, and force fixing warnings.
"-no-canonical-prefixes", # Don't mangle paths and confuse blaze.
"-fno-builtin-malloc", # We'll use tcmalloc
"-fno-builtin-calloc",
"-fno-builtin-realloc",
"-fno-builtin-free",
"-D__STDC_FORMAT_MACROS=1",
# TODO(unknown): Figure out how we can use $(CC_FLAGS) instead of this.
"-D__GOOGLE_STL_LEGACY_COMPATIBILITY",
]
# Used for C and C++ compiler invocations.
_EMBEDDED_CFLAGS = [
"-I$(GENDIR)",
]
# Used for C++ compiler invocations.
_EMBEDDED_CXXFLAGS = [
"-std=gnu++11", # Allow C++11 features _and_ GNU extensions.
]
# Used for linking binaries.
_EMBEDDED_LDFLAGS = [
# "-static", # Use this for program-sizing build
# "-Wl,--gc-sections,--no-wchar-size-warning", # Use this for program-sizing build
]
# PPC ======================================================================
_PPC_GRTE = "//unsupported_toolchains/crosstoolng_powerpc32_8540/sysroot"
# X86 ======================================================================
_X86_GRTE = "//grte/v4_x86/release/usr/grte/v4"
# Portability definitions ===================================================
def sc_cc_test(
name,
size = None,
srcs = None,
deps = None,
data = None,
defines = None,
copts = None,
linkopts = None,
visibility = None):
"""Creates a cc_test rule that interacts safely with Stratum builds.
Generates a cc_test rule that doesn't break the build when an embedded arch
is selected. During embedded builds this target will generate a dummy binary
and will not attempt to build any dependencies.
Args:
name: Analogous to cc_test name argument.
size: Analogous to cc_test size argument.
srcs: Analogous to cc_test srcs argument.
deps: Analogous to cc_test deps argument.
data: Analogous to cc_test data argument.
defines: Analogous to cc_test defines argument.
copts: Analogous to cc_test copts argument.
linkopts: Analogous to cc_test linkopts argument.
visibility: Analogous to cc_test visibility argument.
"""
cc_test(
name = name,
size = size or "small",
srcs = sc_platform_select(host = srcs or [], default = []),
deps = sc_platform_select(
host = deps or [],
default = ["//stratum/portage:dummy_with_main"],
),
data = data or [],
defines = defines,
copts = copts,
linkopts = linkopts,
visibility = visibility,
)
register_extension_info(
extension_name = "sc_cc_test",
label_regex_for_dep = "{extension_name}",
)
def sc_cc_lib(
name,
deps = None,
srcs = None,
hdrs = None,
arches = None,
copts = None,
defines = None,
includes = None,
include_prefix = None,
strip_include_prefix = None,
data = None,
testonly = None,
textual_hdrs = None,
visibility = None,
xdeps = None):
"""Creates rules for the given portable library and arches.
Args:
name: Analogous to cc_library name argument.
deps: Analogous to cc_library deps argument.
srcs: Analogous to cc_library srcs argument.
hdrs: Analogous to cc_library hdrs argument.
arches: List of architectures to generate this way.
copts: Analogous to cc_library copts argument.
defines: Symbols added as "-D" compilation options.
includes: Paths to add as "-I" compilation options.
include_prefix: Analogous to cc_library include_prefix argument.
strip_include_prefix: Analogous to cc_library strip_include_prefix argument.
data: Files to provide as data at runtime (host builds only).
testonly: Standard blaze testonly parameter.
textual_hdrs: Analogous to cc_library.
visibility: Standard blaze visibility parameter.
xdeps: External (file) dependencies of this library - no decorations
assumed, used and exported as header, not for flags, libs, etc.
"""
alwayslink = 0
deps = depset(deps or [])
srcs = depset(srcs or [])
hdrs = depset(hdrs or [])
xdeps = depset(xdeps or [])
copts = depset(copts or [])
includes = depset(includes or [])
data = depset(data or [])
textual_hdrs = depset(textual_hdrs or [])
if srcs:
if [s for s in srcs.to_list() if not s.endswith(".h")]:
alwayslink = 1
if not arches:
arches = ALL_ARCHES
defs_plus = (defines or []) + _ARCH_DEFINES
textual_plus = textual_hdrs | depset(deps.to_list())
cc_library(
name = name,
deps = sc_platform_filter(deps, [], arches),
srcs = sc_platform_filter(srcs, [], arches),
hdrs = sc_platform_filter(hdrs, [], arches),
alwayslink = alwayslink,
copts = sc_platform_filter(copts, [], arches),
defines = defs_plus,
includes = sc_platform_filter(includes, [], arches),
include_prefix = include_prefix,
strip_include_prefix = strip_include_prefix,
testonly = testonly,
textual_hdrs = sc_platform_filter(
textual_plus | xdeps,
[],
arches,
),
data = sc_platform_filter(data, [], arches),
visibility = visibility,
)
register_extension_info(
extension_name = "sc_cc_lib",
label_regex_for_dep = "{extension_name}",
)
def sc_cc_bin(
name,
deps = None,
srcs = None,
arches = None,
copts = None,
defines = None,
includes = None,
testonly = None,
visibility = None):
"""Creates rules for the given portable binary and arches.
Args:
name: Analogous to cc_binary name argument.
deps: Analogous to cc_binary deps argument.
srcs: Analogous to cc_binary srcs argument.
arches: List of architectures to generate this way.
copts: Analogous to cc_binary copts argument.
defines: Symbols added as "-D" compilation options.
includes: Paths to add as "-I" compilation options.
testonly: Standard blaze testonly parameter.
visibility: Standard blaze visibility parameter.
"""
deps = depset(deps or [])
srcs = depset(srcs or [])
if not arches:
arches = ALL_ARCHES
defs_plus = (defines or []) + _ARCH_DEFINES
cc_binary(
name = name,
deps = sc_platform_filter(
deps,
["//stratum/portage:dummy_with_main"],
arches,
),
srcs = sc_platform_filter(srcs, [], arches),
copts = copts,
defines = defs_plus,
includes = includes,
linkopts = ["-ldl", "-lutil"],
testonly = testonly,
visibility = visibility,
)
register_extension_info(
extension_name = "sc_cc_bin",
label_regex_for_dep = "{extension_name}",
)
# Protobuf =================================================================
_SC_GRPC_DEPS = [
"//sandblaze/prebuilt/grpc",
"//sandblaze/prebuilt/grpc:grpc++_codegen_base",
"//sandblaze/prebuilt/grpc:grpc++_codegen_proto_lib",
]
_PROTOC = "@com_google_protobuf//:protobuf:protoc"
_PROTOBUF = "@com_google_protobuf//:protobuf"
_SC_GRPC_PLUGIN = "//sandblaze/prebuilt/protobuf:grpc_cpp_plugin"
_GRPC_PLUGIN = "//grpc:grpc_cpp_plugin"
def _loc(target):
"""Return target location for constructing commands.
Args:
target: Blaze target name available to this build.
Returns:
$(location target)
"""
return "$(location %s)" % target
def _gen_proto_lib(
name,
srcs,
hdrs,
deps,
arch,
visibility,
testonly,
proto_include,
grpc_shim_rule):
"""Creates rules and filegroups for embedded protobuf library.
For every given ${src}.proto, generate:
:${src}_${arch}.pb rule to run protoc
${src}.proto => ${src}.${arch}.pb.{h,cc}
:${src}_${arch}.grpc.pb rule to run protoc w/ erpc plugin:
${src}.proto => ${src}.${arch}.grpc.pb.{h,cc}
:${src}_${arch}_proto_rollup collects include options for protoc:
${src}_${arch}_proto_rollup.flags
Feed each set into sc_cc_lib to wrap them them up into a usable library;
note that ${src}_${arch}_erpc_proto depends on ${src}_${arch}_proto.
Args:
name: Base name for this library.
srcs: List of proto files
hdrs: More files to build into this library, but also exported for
dependent rules to utilize.
deps: List of deps for this library
arch: Which architecture to build this library for.
visibility: Standard blaze visibility parameter, passed through to
subsequent rules.
testonly: Standard blaze testonly parameter.
proto_include: Include path for generated sc_cc_libs.
grpc_shim_rule: If needed, the name of the grpc shim for this proto lib.
"""
bash_vars = ["g3=$${PWD}"]
# TODO(unknown): Switch protobuf to using the proto_include mechanism
protoc_label = _PROTOC
protobuf_label = _PROTOBUF
protobuf_hdrs = "%s:well_known_types_srcs" % protobuf_label
protobuf_srcs = [protobuf_hdrs]
protobuf_include = "$${g3}/protobuf/src"
if arch in EMBEDDED_ARCHES:
grpc_plugin = _SC_GRPC_PLUGIN
else:
grpc_plugin = _GRPC_PLUGIN
protoc_deps = []
for dep in deps:
if dep.endswith("_proto"):
protoc_deps.append("%s_%s_headers" % (dep, arch))
name_arch = decorate(name, arch)
# We use this filegroup to accumulate the set of .proto files needed to
# compile this proto.
native.filegroup(
name = decorate(name_arch, "headers"),
srcs = hdrs + protoc_deps,
visibility = visibility,
)
my_proto_rollup = decorate(name_arch, "proto_rollup.flags")
protoc_srcs_set = (srcs + hdrs + protoc_deps +
protobuf_srcs + [my_proto_rollup])
gen_srcs = []
gen_hdrs = []
grpc_gen_hdrs = []
grpc_gen_srcs = []
tools = [protoc_label]
grpc_tools = [protoc_label, grpc_plugin]
protoc = "$${g3}/%s" % _loc(protoc_label)
grpc_plugin = "$${g3}/%s" % _loc(grpc_plugin)
cpp_out = "$${g3}/$(GENDIR)/%s/%s" % (native.package_name(), arch)
accum_flags = []
full_proto_include = None
if proto_include == ".":
full_proto_include = native.package_name()
elif proto_include:
full_proto_include = "%s/%s" % (native.package_name(), proto_include)
if full_proto_include:
temp_prefix = "%s/%s" % (cpp_out, native.package_name()[len(full_proto_include):])
# We do a bit of extra work with these include flags to avoid generating
# warnings.
accum_flags.append(
"$$(if [[ -e $(GENDIR)/%s ]]; then echo -IG3LOC/$(GENDIR)/%s; fi)" %
(full_proto_include, full_proto_include),
)
accum_flags.append(
"$$(if [[ -e %s ]]; then echo -IG3LOC/%s; fi)" %
(full_proto_include, full_proto_include),
)
else:
temp_prefix = "%s/%s" % (cpp_out, native.package_name())
proto_rollups = [
decorate(decorate(dep, arch), "proto_rollup.flags")
for dep in deps
if dep.endswith("_proto")
]
proto_rollup_cmds = ["printf '%%s\n' %s" % flag for flag in accum_flags]
proto_rollup_cmds.append("cat $(SRCS)")
proto_rollup_cmd = "{ %s; } | sort -u -o $(@)" % "; ".join(proto_rollup_cmds)
native.genrule(
name = decorate(name_arch, "proto_rollup"),
srcs = proto_rollups,
outs = [my_proto_rollup],
cmd = proto_rollup_cmd,
visibility = visibility,
testonly = testonly,
)
for src in srcs + hdrs:
if src.endswith(".proto"):
src_stem = src[0:-6]
src_arch = "%s_%s" % (src_stem, arch)
temp_stem = "%s/%s" % (temp_prefix, src_stem)
gen_stem = "%s.%s" % (src_stem, arch)
# We can't use $${PWD} until this step, because our rollup command
# might be generated on another forge server.
proto_path_cmds = ["rollup=$$(sed \"s,G3LOC,$${PWD},g\" %s)" %
_loc(my_proto_rollup)]
proto_rollup_flags = ["$${rollup}"]
if proto_include:
# We'll be cd-ing to another directory before protoc, so
# adjust our .proto path accordingly.
proto_src_loc = "%s/%s" % (native.package_name(), src)
if proto_src_loc.startswith(full_proto_include + "/"):
proto_src_loc = proto_src_loc[len(full_proto_include) + 1:]
else:
print("Invalid proto include '%s' doesn't match src %s" %
(full_proto_include, proto_src_loc))
# By cd-ing to another directory, we force protoc to produce
# different symbols. Careful, our proto might be in GENDIR!
proto_path_cmds.append("; ".join([
"if [[ -e %s ]]" % ("%s/%s" % (full_proto_include, proto_src_loc)),
"then cd %s" % full_proto_include,
"else cd $(GENDIR)/%s" % full_proto_include,
"fi",
]))
gendir_include = ["-I$${g3}/$(GENDIR)", "-I$${g3}", "-I."]
else:
proto_src_loc = "%s/%s" % (native.package_name(), src)
proto_path_cmds.append("[[ -e %s ]] || cd $(GENDIR)" % proto_src_loc)
gendir_include = ["-I$(GENDIR)", "-I."]
# Generate messages
gen_pb_h = gen_stem + ".pb.h"
gen_pb_cc = gen_stem + ".pb.cc"
gen_hdrs.append(gen_pb_h)
gen_srcs.append(gen_pb_cc)
cmds = bash_vars + [
"mkdir -p %s" % temp_prefix,
] + proto_path_cmds + [
" ".join([protoc] +
gendir_include +
proto_rollup_flags +
[
"-I%s" % protobuf_include,
"--cpp_out=%s" % cpp_out,
proto_src_loc,
]),
"cd $${g3}",
"cp %s.pb.h %s" % (temp_stem, _loc(gen_pb_h)),
"cp %s.pb.cc %s" % (temp_stem, _loc(gen_pb_cc)),
]
pb_outs = [gen_pb_h, gen_pb_cc]
native.genrule(
name = src_arch + ".pb",
srcs = protoc_srcs_set,
outs = pb_outs,
tools = tools,
cmd = " && ".join(cmds),
heuristic_label_expansion = 0,
visibility = visibility,
)
# Generate GRPC
if grpc_shim_rule:
gen_grpc_pb_h = gen_stem + ".grpc.pb.h"
gen_grpc_pb_cc = gen_stem + ".grpc.pb.cc"
grpc_gen_hdrs.append(gen_grpc_pb_h)
grpc_gen_srcs.append(gen_grpc_pb_cc)
cmds = bash_vars + [
"mkdir -p %s" % temp_prefix,
] + proto_path_cmds + [
" ".join([
protoc,
"--plugin=protoc-gen-grpc-cpp=%s" % grpc_plugin,
] +
gendir_include +
proto_rollup_flags +
[
"-I%s" % protobuf_include,
"--grpc-cpp_out=%s" % cpp_out,
proto_src_loc,
]),
"cd $${g3}",
"cp %s.grpc.pb.h %s" % (temp_stem, _loc(gen_grpc_pb_h)),
"cp %s.grpc.pb.cc %s" % (temp_stem, _loc(gen_grpc_pb_cc)),
]
grpc_pb_outs = [gen_grpc_pb_h, gen_grpc_pb_cc]
native.genrule(
name = src_arch + ".grpc.pb",
srcs = protoc_srcs_set,
outs = grpc_pb_outs,
tools = grpc_tools,
cmd = " && ".join(cmds),
heuristic_label_expansion = 0,
visibility = visibility,
)
dep_set = depset(deps) | [protobuf_label]
includes = []
if proto_include:
includes = [proto_include]
# Note: Public sc_proto_lib invokes this once per (listed) arch;
# which then calls sc_cc_lib with same name for each arch;
# multiple such calls are OK as long as the arches are disjoint.
sc_cc_lib(
name = decorate(name, arch),
deps = dep_set,
srcs = gen_srcs,
hdrs = hdrs + gen_hdrs,
arches = [arch],
copts = [],
includes = includes,
testonly = testonly,
textual_hdrs = gen_hdrs,
visibility = visibility,
)
if grpc_shim_rule:
grpc_name = name[:-6] + "_grpc_proto"
grpc_dep_set = dep_set | [name] | _SC_GRPC_DEPS
grpc_gen_hdrs_plus = grpc_gen_hdrs + gen_hdrs
sc_cc_lib(
name = decorate(grpc_name, arch),
deps = grpc_dep_set,
srcs = grpc_gen_srcs,
hdrs = hdrs + grpc_gen_hdrs_plus + [grpc_shim_rule],
arches = [arch],
copts = [],
includes = includes,
testonly = testonly,
textual_hdrs = grpc_gen_hdrs_plus,
visibility = visibility,
)
def _gen_proto_shims(name, pb_modifier, srcs, arches, visibility):
"""Macro to build .pb.h multi-arch master switch for sc_proto_lib.
For each src path.proto, generates path.pb.h consisting of:
#ifdef logic to select path.${arch}.pb.h
Also generates an alias that will select the appropriate proto target
based on the currently selected platform architecture.
Args:
name: Base name for this library.
pb_modifier: protoc plugin-dependent file extension (e.g.: .pb)
srcs: List of proto files.
arches: List of arches this shim should support.
visibility: The blaze visibility of the generated alias.
Returns:
Name of shim rule for use in follow-on hdrs and/or src lists.
"""
outs = []
cmds = []
hdr_ext = pb_modifier + ".h"
for src in srcs:
pkg, filename = parse_label(src)
if not filename.endswith(".proto"):
continue
hdr_stem = filename[0:-6]
new_hdr_name = hdr_stem + hdr_ext
outs.append(new_hdr_name)
# Generate lines for shim switch file.
# Lines expand inside squotes, so quote accordingly.
include_fmt = "#include " + dquote(pkg + "/" + hdr_stem + ".%s" + hdr_ext)
lines = [
"#if defined(STRATUM_ARCH_%s)" % "PPC",
include_fmt % "ppc",
"#elif defined(STRATUM_ARCH_%s)" % "X86",
include_fmt % "x86",
"#elif defined(STRATUM_ARCH_%s)" % "HOST",
include_fmt % "host",
"#else",
"#error Unknown STRATUM_ARCH",
"#endif",
]
gen_cmds = [("printf '%%s\\n' '%s'" % line) for line in lines]
new_hdr_loc = "$(location %s)" % new_hdr_name
cmds.append("{ %s; } > %s" % (" && ".join(gen_cmds), new_hdr_loc))
shim_rule = decorate(name, "shims")
native.genrule(
name = shim_rule,
srcs = srcs,
outs = outs,
cmd = " && ".join(cmds) or "true",
)
sc_platform_alias(
name = name,
host = decorate(name, "host") if "host" in arches else None,
ppc = decorate(name, "ppc") if "ppc" in arches else None,
x86 = decorate(name, "x86") if "x86" in arches else None,
visibility = visibility,
)
return shim_rule
def _gen_py_proto_lib(name, srcs, deps, visibility, testonly):
"""Creates a py_proto_library from the given srcs.
There's no clean way to make python protos work with sc_proto_lib's
proto_include field, so we keep this simple.
For library "name", generates:
* ${name}_default_pb, a regular proto library.
* ${name}_py, a py_proto_library based on ${name}_default_pb.
Args:
name: Standard blaze name argument.
srcs: Standard blaze srcs argument.
deps: Standard blaze deps argument.
visibility: Standard blaze visibility argument.
testonly: Standard blaze testonly argument.
"""
regular_proto_name = decorate(name, "default_pb")
py_name = decorate(name, "py")
proto_library(
name = regular_proto_name,
srcs = srcs,
deps = [decorate(dep, "default_pb") for dep in deps],
visibility = visibility,
testonly = testonly,
)
native.py_proto_library(
name = py_name,
api_version = 2,
deps = [regular_proto_name],
visibility = visibility,
testonly = testonly,
)
# TODO(unknown): Add support for depending on normal proto_library rules.
def sc_proto_lib(
name = None,
srcs = [],
hdrs = [],
deps = [],
arches = [],
visibility = None,
testonly = None,
proto_include = None,
python_support = False,
services = []):
"""Public macro to build multi-arch library from Message protobuf(s).
For library "name", generates:
* ${name}_shim aka .pb.h master switch - see _gen_proto_shims, above.
* ${name}_${arch}_pb protobuf compile rules - one for each arch.
* sc_cc_lib(name) with those as input.
* ${name}_py a py_proto_library version of this library. Only generated
if python_support == True.
Args:
name: Base name for this library.
srcs: List of .proto files - private to this library.
hdrs: As above, but also exported for dependent rules to utilize.
deps: List of deps for this library
arches: Which architectures to build this library for, None => ALL.
visibility: Standard blaze visibility parameter, passed through to
subsequent rules.
testonly: Standard blaze testonly parameter.
proto_include: Path to add to include path. This will affect the
symbols generated by protoc, as well as the include
paths used for both sc_cc_lib and sc_proto_lib rules
that depend on this rule. Typically "."
python_support: Defaults to False. If True, generate a python proto library
from this rule. Any sc_proto_lib with python support may
only depend on sc_proto_libs that also have python support,
and may not use the proto_include field in this rule.
services: List of services to enable {"grpc", "rpc"};
Only "grpc" is supported. So "rpc" and "grpc" are equivalent.
"""
if not arches:
if testonly:
arches = HOST_ARCHES
else:
arches = ALL_ARCHES
service_enable = {
"grpc": 0,
}
for service in services or []:
if service == "grpc":
service_enable["grpc"] = 1
elif service == "rpc":
service_enable["grpc"] = 1
else:
fail("service='%s' not in (grpc, rpc)" % service)
deps = depset(deps or [])
shim_rule = _gen_proto_shims(
name = name,
pb_modifier = ".pb",
srcs = srcs + hdrs,
arches = arches,
visibility = visibility,
)
grpc_shim_rule = None
if (service_enable["grpc"]):
grpc_shim_rule = _gen_proto_shims(
name = decorate(name[:-6], "grpc_proto"),
pb_modifier = ".grpc.pb",
srcs = srcs + hdrs,
arches = arches,
visibility = visibility,
)
for arch in arches:
_gen_proto_lib(
name = name,
srcs = srcs,
hdrs = [shim_rule] + hdrs,
deps = deps,
arch = arch,
visibility = visibility,
testonly = testonly,
proto_include = proto_include,
grpc_shim_rule = grpc_shim_rule,
)
if python_support:
if proto_include:
fail("Cannot use proto_include on an sc_proto_lib with python support.")
_gen_py_proto_lib(
name = name,
srcs = depset(srcs + hdrs),
deps = deps,
visibility = visibility,
testonly = testonly,
)
register_extension_info(
extension_name = "sc_proto_lib",
label_regex_for_dep = "{extension_name}",
)
def sc_package(
name = None,
bins = None,
data = None,
deps = None,
arches = None,
visibility = None):
"""Public macro to package binaries and data for deployment.
For package "name", generates:
* ${name}_${arch}_bin and ${name}_${arch}_data filesets containing
respectively all of the binaries and all of the data needed for this
package and all dependency packages.
* ${name}_${arch} fileset containing the corresponding bin and data
filesets, mapped to bin/ and share/ respectively.
* ${name}_${arch}_tarball rule builds that .tar.gz package.
Args:
name: Base name for this package.
bins: List of sc_cc_bin rules to be packaged.
data: List of files (and file producing rules) to be packaged.
deps: List of other sc_packages to add to this package.
arches: Which architectures to build this library for,
None => EMBEDDED_ARCHES (HOST_ARCHES not generally supported).
visibility: Standard blaze visibility parameter, passed through to
all filesets.
"""
bins = depset(bins or [])
data = depset(data or [])
deps = depset(deps or [])
if not arches:
arches = EMBEDDED_ARCHES
fileset_name = decorate(name, "fs")
for extension, inputs in [
("bin", ["%s.stripped" % b for b in bins.to_list()]),
("data", data),
]:
native.Fileset(
name = decorate(fileset_name, extension),
out = decorate(name, extension),
entries = [
native.FilesetEntry(
files = inputs,
),
] + [
native.FilesetEntry(srcdir = decorate(dep, extension))
for dep in deps.to_list()
],
visibility = visibility,
)
# Add any platform specific files to the final tarball.
platform_entries = sc_platform_select(
# We use a different ppc toolchain for Stratum.
# This means that we must provide portable shared libs for our ppc
# executables.
ppc = [native.FilesetEntry(
srcdir = "%s:BUILD" % _PPC_GRTE,
files = [":libs"],
destdir = "lib/stratum",
symlinks = "dereference",
)],
default = [],
)
native.Fileset(
name = fileset_name,
out = name,
entries = [
native.FilesetEntry(
srcdir = decorate(name, "bin"),
destdir = "bin",
),
native.FilesetEntry(
srcdir = decorate(name, "data"),
destdir = "share",
),
] + platform_entries,
visibility = visibility,
)
outs = ["%s.tar.gz" % name]
# Copy our files into a temporary directory and make any necessary changes
# before tarballing.
cmds = [
"TEMP_DIR=$(@D)/stratum_packaging_temp",
"mkdir $${TEMP_DIR}",
"cp -r %s $${TEMP_DIR}/tarball" % _loc(fileset_name),
"if [[ -e $${TEMP_DIR}/tarball/bin ]]",
"then for f in $${TEMP_DIR}/tarball/bin/*.stripped",
" do mv $${f} $${f%.stripped}", # rename not available.
"done",
"fi",
"tar czf %s -h -C $${TEMP_DIR}/tarball ." % _loc(name + ".tar.gz"),
"rm -rf $${TEMP_DIR}",
]
native.genrule(
name = decorate(name, "tarball"),
srcs = [":%s" % fileset_name],
outs = outs,
cmd = "; ".join(cmds),
visibility = visibility,
)
| # Copyright 2018 Google LLC
# Copyright 2018-present Open Networking Foundation
# SPDX-License-Identifier: Apache-2.0
"""A portable build system for Stratum P4 switch stack.
To use this, load() this file in a BUILD file, specifying the symbols needed.
The public symbols are the macros:
decorate(path)
sc_cc_lib Declare a portable Library.
sc_proto_lib Declare a portable .proto Library.
sc_cc_bin Declare a portable Binary.
sc_package Declare a portable tarball package.
and the variables/lists:
ALL_ARCHES All known arches.
EMBEDDED_ARCHES All embedded arches.
EMBEDDED_PPC Name of PowerPC arch - "ppc".
EMBEDDED_X86 Name of "x86" arch.
HOST_ARCH Name of default "host" arch.
HOST_ARCHES All host arches.
STRATUM_INTERNAL For declaring Stratum internal visibility.
The macros are like cc_library(), proto_library(), and cc_binary(), but with
different options and some restrictions. The key difference: you can
supply lists of architectures for which they should be compiled - defaults
to all if left unstated. Internally, libraries and binaries are generated
for every listed architecture. The names are decorated to keep them different
and allow all to be generated and addressed independently.
This aspect of the system is suboptimal - something along the lines of
augmenting context with a user defined configuration fragment would be a
much cleaner solution.
Currently supported architectures:
ppc
x86
"""
load("//tools/build_defs/label:def.bzl", "parse_label")
load(
"//devtools/build_cleaner/skylark:build_defs.bzl",
"register_extension_info",
)
load("@rules_proto//proto:defs.bzl", "proto_library")
load("@rules_cc//cc:defs.bzl", "cc_binary", "cc_library", "cc_test")
# Generic path & label helpers. ============================================
def _normpath(path):
"""Normalize a path.
Normalizes a path by removing unnecessary path-up segments and its
corresponding directories. Providing own implementation because import os
is not allowed in build defs.
For example
../../dir/to/deeply/nested/path/../../../other/path
will become
../../dir/to/other/path
Args:
path: A valid absolute or relative path to normalize.
Returns:
A path equivalent to the input path with minimal use of path-up segments.
Invalid input paths will stay invalid.
"""
sep = "/"
level = 0
result = []
for d in path.split(sep):
if d in ("", "."):
if result:
continue
elif d == "..":
if level > 0:
result.pop()
level += -1
continue
else:
level += 1
result.append(d)
return sep.join(result)
# Adds a suffix to a label, expanding implicit targets if needed.
def decorate(label, suffix):
if label.endswith(":"): # .../bar: -> .../bar
label = label[:-1]
if ":" in label: # .../bar:bat -> .../bar:bat_suffix
return "%s_%s" % (label, suffix)
elif label.startswith("//"): # //foo/bar -> //foo/bar:bar_suffix
return "%s:%s_%s" % (label, label.split("/")[-1], suffix)
else: # bar -> bar_suffix
return "%s_%s" % (label, suffix)
# Creates a relative filename from a label, replacing "//" and ":".
def _make_filename(label):
if label.startswith("//"): # //foo/bar:bat/baz -> google3_foo/bar/bat/baz
return label.replace("//", "google3/").replace(":", "/")
elif label.startswith(":"): # :bat/baz -> bat/baz
return label[1:]
else: # bat/baz -> bat/baz
return label
# Adds dquotes around a string.
def dquote(s):
return '"' + s + '"'
# Adds squotes around a string.
def squote(s):
return "'" + s + "'"
# Emulate Python 2.5+ str(startswith([prefix ...])
def starts_with(s, prefix_list):
for prefix in prefix_list:
if s.startswith(prefix):
return prefix
return None
def sc_platform_select(host = None, ppc = None, x86 = None, default = None):
"""Public macro to alter blaze rules based on the platform architecture.
Generates a blaze select(...) statement that can be used in most contexts to
alter a blaze rule based on the target platform architecture. If no selection
is provided for a given platform, {default} is used instead. A specific value
or default must be provided for every target platform.
Args:
host: The value to use for host builds.
ppc: The value to use for ppc builds.
x86: The value to use for x86 builds.
default: The value to use for any of {host,ppc,x86} that isn't specified.
Returns:
The requested selector.
"""
if default == None and (host == None or ppc == None or x86 == None):
fail("Missing a select value for at least one platform in " +
"sc_platform_select. Please add.")
config_label_prefix = "//stratum:stratum_"
return select({
"//conditions:default": (host or default),
config_label_prefix + "ppc": (ppc or default),
config_label_prefix + "x86": (x86 or default),
})
# Generates an sc_platform_select based on a textual list of arches.
def sc_platform_filter(value, default, arches):
return sc_platform_select(
host = value if "host" in arches else default,
ppc = value if "ppc" in arches else default,
x86 = value if "x86" in arches else default,
)
def sc_platform_alias(
name,
host = None,
ppc = None,
x86 = None,
default = None,
visibility = None):
"""Public macro to create an alias that changes based on target arch.
Generates a blaze alias that will select the appropriate target. If no
selection is provided for a given platform and no default is set, a
dummy default target is used instead.
Args:
name: The name of the alias target.
host: The result of the alias for host builds.
ppc: The result of the alias for ppc builds.
x86: The result of the alias for x86 builds.
default: The result of the alias for any of {host,ppc,x86} that isn't
specified.
visibility: The visibility of the alias target.
"""
native.alias(
name = name,
actual = sc_platform_select(
default = default or "//stratum/portage:dummy",
host = host,
ppc = ppc,
x86 = x86,
),
visibility = visibility,
)
# Embedded build definitions. ==============================================
EMBEDDED_PPC = "ppc"
EMBEDDED_X86 = "x86"
EMBEDDED_ARCHES = [
EMBEDDED_PPC,
EMBEDDED_X86,
]
HOST_ARCH = "host"
HOST_ARCHES = [HOST_ARCH]
ALL_ARCHES = EMBEDDED_ARCHES + HOST_ARCHES
# Identify Stratum platform arch for .pb.h shims and other portability hacks.
_ARCH_DEFINES = sc_platform_select(
default = ["STRATUM_ARCH_HOST"],
ppc = ["STRATUM_ARCH_PPC"],
x86 = ["STRATUM_ARCH_X86"],
)
STRATUM_INTERNAL = [
"//stratum:__subpackages__",
]
#
# Build options for all embedded architectures
#
# Set _TRACE_SRCS to show sources in embedded sc_cc_lib compile steps.
# This is more general than it may seem: genrule doesn't have hdrs or deps
# attributes, so all embedded dependencies appear as a `src'.
# TODO(unknown): if useful again then inject from cmdline else kill feature.
_TRACE_SRCS = False
# Used for all gcc invocations.
_EMBEDDED_FLAGS = [
"-O0", # Don't use this for program-sizing build
#-- "-Os", # Use this for program-sizing build
"-g", # Don't use this for program-sizing build
"-Wall",
"-Werror", # Warn lots, and force fixing warnings.
"-no-canonical-prefixes", # Don't mangle paths and confuse blaze.
"-fno-builtin-malloc", # We'll use tcmalloc
"-fno-builtin-calloc",
"-fno-builtin-realloc",
"-fno-builtin-free",
"-D__STDC_FORMAT_MACROS=1",
# TODO(unknown): Figure out how we can use $(CC_FLAGS) instead of this.
"-D__GOOGLE_STL_LEGACY_COMPATIBILITY",
]
# Used for C and C++ compiler invocations.
_EMBEDDED_CFLAGS = [
"-I$(GENDIR)",
]
# Used for C++ compiler invocations.
_EMBEDDED_CXXFLAGS = [
"-std=gnu++11", # Allow C++11 features _and_ GNU extensions.
]
# Used for linking binaries.
_EMBEDDED_LDFLAGS = [
# "-static", # Use this for program-sizing build
# "-Wl,--gc-sections,--no-wchar-size-warning", # Use this for program-sizing build
]
# PPC ======================================================================
_PPC_GRTE = "//unsupported_toolchains/crosstoolng_powerpc32_8540/sysroot"
# X86 ======================================================================
_X86_GRTE = "//grte/v4_x86/release/usr/grte/v4"
# Portability definitions ===================================================
def sc_cc_test(
name,
size = None,
srcs = None,
deps = None,
data = None,
defines = None,
copts = None,
linkopts = None,
visibility = None):
"""Creates a cc_test rule that interacts safely with Stratum builds.
Generates a cc_test rule that doesn't break the build when an embedded arch
is selected. During embedded builds this target will generate a dummy binary
and will not attempt to build any dependencies.
Args:
name: Analogous to cc_test name argument.
size: Analogous to cc_test size argument.
srcs: Analogous to cc_test srcs argument.
deps: Analogous to cc_test deps argument.
data: Analogous to cc_test data argument.
defines: Analogous to cc_test defines argument.
copts: Analogous to cc_test copts argument.
linkopts: Analogous to cc_test linkopts argument.
visibility: Analogous to cc_test visibility argument.
"""
cc_test(
name = name,
size = size or "small",
srcs = sc_platform_select(host = srcs or [], default = []),
deps = sc_platform_select(
host = deps or [],
default = ["//stratum/portage:dummy_with_main"],
),
data = data or [],
defines = defines,
copts = copts,
linkopts = linkopts,
visibility = visibility,
)
register_extension_info(
extension_name = "sc_cc_test",
label_regex_for_dep = "{extension_name}",
)
def sc_cc_lib(
name,
deps = None,
srcs = None,
hdrs = None,
arches = None,
copts = None,
defines = None,
includes = None,
include_prefix = None,
strip_include_prefix = None,
data = None,
testonly = None,
textual_hdrs = None,
visibility = None,
xdeps = None):
"""Creates rules for the given portable library and arches.
Args:
name: Analogous to cc_library name argument.
deps: Analogous to cc_library deps argument.
srcs: Analogous to cc_library srcs argument.
hdrs: Analogous to cc_library hdrs argument.
arches: List of architectures to generate this way.
copts: Analogous to cc_library copts argument.
defines: Symbols added as "-D" compilation options.
includes: Paths to add as "-I" compilation options.
include_prefix: Analogous to cc_library include_prefix argument.
strip_include_prefix: Analogous to cc_library strip_include_prefix argument.
data: Files to provide as data at runtime (host builds only).
testonly: Standard blaze testonly parameter.
textual_hdrs: Analogous to cc_library.
visibility: Standard blaze visibility parameter.
xdeps: External (file) dependencies of this library - no decorations
assumed, used and exported as header, not for flags, libs, etc.
"""
alwayslink = 0
deps = depset(deps or [])
srcs = depset(srcs or [])
hdrs = depset(hdrs or [])
xdeps = depset(xdeps or [])
copts = depset(copts or [])
includes = depset(includes or [])
data = depset(data or [])
textual_hdrs = depset(textual_hdrs or [])
if srcs:
if [s for s in srcs.to_list() if not s.endswith(".h")]:
alwayslink = 1
if not arches:
arches = ALL_ARCHES
defs_plus = (defines or []) + _ARCH_DEFINES
textual_plus = textual_hdrs | depset(deps.to_list())
cc_library(
name = name,
deps = sc_platform_filter(deps, [], arches),
srcs = sc_platform_filter(srcs, [], arches),
hdrs = sc_platform_filter(hdrs, [], arches),
alwayslink = alwayslink,
copts = sc_platform_filter(copts, [], arches),
defines = defs_plus,
includes = sc_platform_filter(includes, [], arches),
include_prefix = include_prefix,
strip_include_prefix = strip_include_prefix,
testonly = testonly,
textual_hdrs = sc_platform_filter(
textual_plus | xdeps,
[],
arches,
),
data = sc_platform_filter(data, [], arches),
visibility = visibility,
)
register_extension_info(
extension_name = "sc_cc_lib",
label_regex_for_dep = "{extension_name}",
)
def sc_cc_bin(
name,
deps = None,
srcs = None,
arches = None,
copts = None,
defines = None,
includes = None,
testonly = None,
visibility = None):
"""Creates rules for the given portable binary and arches.
Args:
name: Analogous to cc_binary name argument.
deps: Analogous to cc_binary deps argument.
srcs: Analogous to cc_binary srcs argument.
arches: List of architectures to generate this way.
copts: Analogous to cc_binary copts argument.
defines: Symbols added as "-D" compilation options.
includes: Paths to add as "-I" compilation options.
testonly: Standard blaze testonly parameter.
visibility: Standard blaze visibility parameter.
"""
deps = depset(deps or [])
srcs = depset(srcs or [])
if not arches:
arches = ALL_ARCHES
defs_plus = (defines or []) + _ARCH_DEFINES
cc_binary(
name = name,
deps = sc_platform_filter(
deps,
["//stratum/portage:dummy_with_main"],
arches,
),
srcs = sc_platform_filter(srcs, [], arches),
copts = copts,
defines = defs_plus,
includes = includes,
linkopts = ["-ldl", "-lutil"],
testonly = testonly,
visibility = visibility,
)
register_extension_info(
extension_name = "sc_cc_bin",
label_regex_for_dep = "{extension_name}",
)
# Protobuf =================================================================
_SC_GRPC_DEPS = [
"//sandblaze/prebuilt/grpc",
"//sandblaze/prebuilt/grpc:grpc++_codegen_base",
"//sandblaze/prebuilt/grpc:grpc++_codegen_proto_lib",
]
_PROTOC = "@com_google_protobuf//:protobuf:protoc"
_PROTOBUF = "@com_google_protobuf//:protobuf"
_SC_GRPC_PLUGIN = "//sandblaze/prebuilt/protobuf:grpc_cpp_plugin"
_GRPC_PLUGIN = "//grpc:grpc_cpp_plugin"
def _loc(target):
"""Return target location for constructing commands.
Args:
target: Blaze target name available to this build.
Returns:
$(location target)
"""
return "$(location %s)" % target
def _gen_proto_lib(
name,
srcs,
hdrs,
deps,
arch,
visibility,
testonly,
proto_include,
grpc_shim_rule):
"""Creates rules and filegroups for embedded protobuf library.
For every given ${src}.proto, generate:
:${src}_${arch}.pb rule to run protoc
${src}.proto => ${src}.${arch}.pb.{h,cc}
:${src}_${arch}.grpc.pb rule to run protoc w/ erpc plugin:
${src}.proto => ${src}.${arch}.grpc.pb.{h,cc}
:${src}_${arch}_proto_rollup collects include options for protoc:
${src}_${arch}_proto_rollup.flags
Feed each set into sc_cc_lib to wrap them them up into a usable library;
note that ${src}_${arch}_erpc_proto depends on ${src}_${arch}_proto.
Args:
name: Base name for this library.
srcs: List of proto files
hdrs: More files to build into this library, but also exported for
dependent rules to utilize.
deps: List of deps for this library
arch: Which architecture to build this library for.
visibility: Standard blaze visibility parameter, passed through to
subsequent rules.
testonly: Standard blaze testonly parameter.
proto_include: Include path for generated sc_cc_libs.
grpc_shim_rule: If needed, the name of the grpc shim for this proto lib.
"""
bash_vars = ["g3=$${PWD}"]
# TODO(unknown): Switch protobuf to using the proto_include mechanism
protoc_label = _PROTOC
protobuf_label = _PROTOBUF
protobuf_hdrs = "%s:well_known_types_srcs" % protobuf_label
protobuf_srcs = [protobuf_hdrs]
protobuf_include = "$${g3}/protobuf/src"
if arch in EMBEDDED_ARCHES:
grpc_plugin = _SC_GRPC_PLUGIN
else:
grpc_plugin = _GRPC_PLUGIN
protoc_deps = []
for dep in deps:
if dep.endswith("_proto"):
protoc_deps.append("%s_%s_headers" % (dep, arch))
name_arch = decorate(name, arch)
# We use this filegroup to accumulate the set of .proto files needed to
# compile this proto.
native.filegroup(
name = decorate(name_arch, "headers"),
srcs = hdrs + protoc_deps,
visibility = visibility,
)
my_proto_rollup = decorate(name_arch, "proto_rollup.flags")
protoc_srcs_set = (srcs + hdrs + protoc_deps +
protobuf_srcs + [my_proto_rollup])
gen_srcs = []
gen_hdrs = []
grpc_gen_hdrs = []
grpc_gen_srcs = []
tools = [protoc_label]
grpc_tools = [protoc_label, grpc_plugin]
protoc = "$${g3}/%s" % _loc(protoc_label)
grpc_plugin = "$${g3}/%s" % _loc(grpc_plugin)
cpp_out = "$${g3}/$(GENDIR)/%s/%s" % (native.package_name(), arch)
accum_flags = []
full_proto_include = None
if proto_include == ".":
full_proto_include = native.package_name()
elif proto_include:
full_proto_include = "%s/%s" % (native.package_name(), proto_include)
if full_proto_include:
temp_prefix = "%s/%s" % (cpp_out, native.package_name()[len(full_proto_include):])
# We do a bit of extra work with these include flags to avoid generating
# warnings.
accum_flags.append(
"$$(if [[ -e $(GENDIR)/%s ]]; then echo -IG3LOC/$(GENDIR)/%s; fi)" %
(full_proto_include, full_proto_include),
)
accum_flags.append(
"$$(if [[ -e %s ]]; then echo -IG3LOC/%s; fi)" %
(full_proto_include, full_proto_include),
)
else:
temp_prefix = "%s/%s" % (cpp_out, native.package_name())
proto_rollups = [
decorate(decorate(dep, arch), "proto_rollup.flags")
for dep in deps
if dep.endswith("_proto")
]
proto_rollup_cmds = ["printf '%%s\n' %s" % flag for flag in accum_flags]
proto_rollup_cmds.append("cat $(SRCS)")
proto_rollup_cmd = "{ %s; } | sort -u -o $(@)" % "; ".join(proto_rollup_cmds)
native.genrule(
name = decorate(name_arch, "proto_rollup"),
srcs = proto_rollups,
outs = [my_proto_rollup],
cmd = proto_rollup_cmd,
visibility = visibility,
testonly = testonly,
)
for src in srcs + hdrs:
if src.endswith(".proto"):
src_stem = src[0:-6]
src_arch = "%s_%s" % (src_stem, arch)
temp_stem = "%s/%s" % (temp_prefix, src_stem)
gen_stem = "%s.%s" % (src_stem, arch)
# We can't use $${PWD} until this step, because our rollup command
# might be generated on another forge server.
proto_path_cmds = ["rollup=$$(sed \"s,G3LOC,$${PWD},g\" %s)" %
_loc(my_proto_rollup)]
proto_rollup_flags = ["$${rollup}"]
if proto_include:
# We'll be cd-ing to another directory before protoc, so
# adjust our .proto path accordingly.
proto_src_loc = "%s/%s" % (native.package_name(), src)
if proto_src_loc.startswith(full_proto_include + "/"):
proto_src_loc = proto_src_loc[len(full_proto_include) + 1:]
else:
print("Invalid proto include '%s' doesn't match src %s" %
(full_proto_include, proto_src_loc))
# By cd-ing to another directory, we force protoc to produce
# different symbols. Careful, our proto might be in GENDIR!
proto_path_cmds.append("; ".join([
"if [[ -e %s ]]" % ("%s/%s" % (full_proto_include, proto_src_loc)),
"then cd %s" % full_proto_include,
"else cd $(GENDIR)/%s" % full_proto_include,
"fi",
]))
gendir_include = ["-I$${g3}/$(GENDIR)", "-I$${g3}", "-I."]
else:
proto_src_loc = "%s/%s" % (native.package_name(), src)
proto_path_cmds.append("[[ -e %s ]] || cd $(GENDIR)" % proto_src_loc)
gendir_include = ["-I$(GENDIR)", "-I."]
# Generate messages
gen_pb_h = gen_stem + ".pb.h"
gen_pb_cc = gen_stem + ".pb.cc"
gen_hdrs.append(gen_pb_h)
gen_srcs.append(gen_pb_cc)
cmds = bash_vars + [
"mkdir -p %s" % temp_prefix,
] + proto_path_cmds + [
" ".join([protoc] +
gendir_include +
proto_rollup_flags +
[
"-I%s" % protobuf_include,
"--cpp_out=%s" % cpp_out,
proto_src_loc,
]),
"cd $${g3}",
"cp %s.pb.h %s" % (temp_stem, _loc(gen_pb_h)),
"cp %s.pb.cc %s" % (temp_stem, _loc(gen_pb_cc)),
]
pb_outs = [gen_pb_h, gen_pb_cc]
native.genrule(
name = src_arch + ".pb",
srcs = protoc_srcs_set,
outs = pb_outs,
tools = tools,
cmd = " && ".join(cmds),
heuristic_label_expansion = 0,
visibility = visibility,
)
# Generate GRPC
if grpc_shim_rule:
gen_grpc_pb_h = gen_stem + ".grpc.pb.h"
gen_grpc_pb_cc = gen_stem + ".grpc.pb.cc"
grpc_gen_hdrs.append(gen_grpc_pb_h)
grpc_gen_srcs.append(gen_grpc_pb_cc)
cmds = bash_vars + [
"mkdir -p %s" % temp_prefix,
] + proto_path_cmds + [
" ".join([
protoc,
"--plugin=protoc-gen-grpc-cpp=%s" % grpc_plugin,
] +
gendir_include +
proto_rollup_flags +
[
"-I%s" % protobuf_include,
"--grpc-cpp_out=%s" % cpp_out,
proto_src_loc,
]),
"cd $${g3}",
"cp %s.grpc.pb.h %s" % (temp_stem, _loc(gen_grpc_pb_h)),
"cp %s.grpc.pb.cc %s" % (temp_stem, _loc(gen_grpc_pb_cc)),
]
grpc_pb_outs = [gen_grpc_pb_h, gen_grpc_pb_cc]
native.genrule(
name = src_arch + ".grpc.pb",
srcs = protoc_srcs_set,
outs = grpc_pb_outs,
tools = grpc_tools,
cmd = " && ".join(cmds),
heuristic_label_expansion = 0,
visibility = visibility,
)
dep_set = depset(deps) | [protobuf_label]
includes = []
if proto_include:
includes = [proto_include]
# Note: Public sc_proto_lib invokes this once per (listed) arch;
# which then calls sc_cc_lib with same name for each arch;
# multiple such calls are OK as long as the arches are disjoint.
sc_cc_lib(
name = decorate(name, arch),
deps = dep_set,
srcs = gen_srcs,
hdrs = hdrs + gen_hdrs,
arches = [arch],
copts = [],
includes = includes,
testonly = testonly,
textual_hdrs = gen_hdrs,
visibility = visibility,
)
if grpc_shim_rule:
grpc_name = name[:-6] + "_grpc_proto"
grpc_dep_set = dep_set | [name] | _SC_GRPC_DEPS
grpc_gen_hdrs_plus = grpc_gen_hdrs + gen_hdrs
sc_cc_lib(
name = decorate(grpc_name, arch),
deps = grpc_dep_set,
srcs = grpc_gen_srcs,
hdrs = hdrs + grpc_gen_hdrs_plus + [grpc_shim_rule],
arches = [arch],
copts = [],
includes = includes,
testonly = testonly,
textual_hdrs = grpc_gen_hdrs_plus,
visibility = visibility,
)
def _gen_proto_shims(name, pb_modifier, srcs, arches, visibility):
"""Macro to build .pb.h multi-arch master switch for sc_proto_lib.
For each src path.proto, generates path.pb.h consisting of:
#ifdef logic to select path.${arch}.pb.h
Also generates an alias that will select the appropriate proto target
based on the currently selected platform architecture.
Args:
name: Base name for this library.
pb_modifier: protoc plugin-dependent file extension (e.g.: .pb)
srcs: List of proto files.
arches: List of arches this shim should support.
visibility: The blaze visibility of the generated alias.
Returns:
Name of shim rule for use in follow-on hdrs and/or src lists.
"""
outs = []
cmds = []
hdr_ext = pb_modifier + ".h"
for src in srcs:
pkg, filename = parse_label(src)
if not filename.endswith(".proto"):
continue
hdr_stem = filename[0:-6]
new_hdr_name = hdr_stem + hdr_ext
outs.append(new_hdr_name)
# Generate lines for shim switch file.
# Lines expand inside squotes, so quote accordingly.
include_fmt = "#include " + dquote(pkg + "/" + hdr_stem + ".%s" + hdr_ext)
lines = [
"#if defined(STRATUM_ARCH_%s)" % "PPC",
include_fmt % "ppc",
"#elif defined(STRATUM_ARCH_%s)" % "X86",
include_fmt % "x86",
"#elif defined(STRATUM_ARCH_%s)" % "HOST",
include_fmt % "host",
"#else",
"#error Unknown STRATUM_ARCH",
"#endif",
]
gen_cmds = [("printf '%%s\\n' '%s'" % line) for line in lines]
new_hdr_loc = "$(location %s)" % new_hdr_name
cmds.append("{ %s; } > %s" % (" && ".join(gen_cmds), new_hdr_loc))
shim_rule = decorate(name, "shims")
native.genrule(
name = shim_rule,
srcs = srcs,
outs = outs,
cmd = " && ".join(cmds) or "true",
)
sc_platform_alias(
name = name,
host = decorate(name, "host") if "host" in arches else None,
ppc = decorate(name, "ppc") if "ppc" in arches else None,
x86 = decorate(name, "x86") if "x86" in arches else None,
visibility = visibility,
)
return shim_rule
def _gen_py_proto_lib(name, srcs, deps, visibility, testonly):
"""Creates a py_proto_library from the given srcs.
There's no clean way to make python protos work with sc_proto_lib's
proto_include field, so we keep this simple.
For library "name", generates:
* ${name}_default_pb, a regular proto library.
* ${name}_py, a py_proto_library based on ${name}_default_pb.
Args:
name: Standard blaze name argument.
srcs: Standard blaze srcs argument.
deps: Standard blaze deps argument.
visibility: Standard blaze visibility argument.
testonly: Standard blaze testonly argument.
"""
regular_proto_name = decorate(name, "default_pb")
py_name = decorate(name, "py")
proto_library(
name = regular_proto_name,
srcs = srcs,
deps = [decorate(dep, "default_pb") for dep in deps],
visibility = visibility,
testonly = testonly,
)
native.py_proto_library(
name = py_name,
api_version = 2,
deps = [regular_proto_name],
visibility = visibility,
testonly = testonly,
)
# TODO(unknown): Add support for depending on normal proto_library rules.
def sc_proto_lib(
name = None,
srcs = [],
hdrs = [],
deps = [],
arches = [],
visibility = None,
testonly = None,
proto_include = None,
python_support = False,
services = []):
"""Public macro to build multi-arch library from Message protobuf(s).
For library "name", generates:
* ${name}_shim aka .pb.h master switch - see _gen_proto_shims, above.
* ${name}_${arch}_pb protobuf compile rules - one for each arch.
* sc_cc_lib(name) with those as input.
* ${name}_py a py_proto_library version of this library. Only generated
if python_support == True.
Args:
name: Base name for this library.
srcs: List of .proto files - private to this library.
hdrs: As above, but also exported for dependent rules to utilize.
deps: List of deps for this library
arches: Which architectures to build this library for, None => ALL.
visibility: Standard blaze visibility parameter, passed through to
subsequent rules.
testonly: Standard blaze testonly parameter.
proto_include: Path to add to include path. This will affect the
symbols generated by protoc, as well as the include
paths used for both sc_cc_lib and sc_proto_lib rules
that depend on this rule. Typically "."
python_support: Defaults to False. If True, generate a python proto library
from this rule. Any sc_proto_lib with python support may
only depend on sc_proto_libs that also have python support,
and may not use the proto_include field in this rule.
services: List of services to enable {"grpc", "rpc"};
Only "grpc" is supported. So "rpc" and "grpc" are equivalent.
"""
if not arches:
if testonly:
arches = HOST_ARCHES
else:
arches = ALL_ARCHES
service_enable = {
"grpc": 0,
}
for service in services or []:
if service == "grpc":
service_enable["grpc"] = 1
elif service == "rpc":
service_enable["grpc"] = 1
else:
fail("service='%s' not in (grpc, rpc)" % service)
deps = depset(deps or [])
shim_rule = _gen_proto_shims(
name = name,
pb_modifier = ".pb",
srcs = srcs + hdrs,
arches = arches,
visibility = visibility,
)
grpc_shim_rule = None
if (service_enable["grpc"]):
grpc_shim_rule = _gen_proto_shims(
name = decorate(name[:-6], "grpc_proto"),
pb_modifier = ".grpc.pb",
srcs = srcs + hdrs,
arches = arches,
visibility = visibility,
)
for arch in arches:
_gen_proto_lib(
name = name,
srcs = srcs,
hdrs = [shim_rule] + hdrs,
deps = deps,
arch = arch,
visibility = visibility,
testonly = testonly,
proto_include = proto_include,
grpc_shim_rule = grpc_shim_rule,
)
if python_support:
if proto_include:
fail("Cannot use proto_include on an sc_proto_lib with python support.")
_gen_py_proto_lib(
name = name,
srcs = depset(srcs + hdrs),
deps = deps,
visibility = visibility,
testonly = testonly,
)
register_extension_info(
extension_name = "sc_proto_lib",
label_regex_for_dep = "{extension_name}",
)
def sc_package(
name = None,
bins = None,
data = None,
deps = None,
arches = None,
visibility = None):
"""Public macro to package binaries and data for deployment.
For package "name", generates:
* ${name}_${arch}_bin and ${name}_${arch}_data filesets containing
respectively all of the binaries and all of the data needed for this
package and all dependency packages.
* ${name}_${arch} fileset containing the corresponding bin and data
filesets, mapped to bin/ and share/ respectively.
* ${name}_${arch}_tarball rule builds that .tar.gz package.
Args:
name: Base name for this package.
bins: List of sc_cc_bin rules to be packaged.
data: List of files (and file producing rules) to be packaged.
deps: List of other sc_packages to add to this package.
arches: Which architectures to build this library for,
None => EMBEDDED_ARCHES (HOST_ARCHES not generally supported).
visibility: Standard blaze visibility parameter, passed through to
all filesets.
"""
bins = depset(bins or [])
data = depset(data or [])
deps = depset(deps or [])
if not arches:
arches = EMBEDDED_ARCHES
fileset_name = decorate(name, "fs")
for extension, inputs in [
("bin", ["%s.stripped" % b for b in bins.to_list()]),
("data", data),
]:
native.Fileset(
name = decorate(fileset_name, extension),
out = decorate(name, extension),
entries = [
native.FilesetEntry(
files = inputs,
),
] + [
native.FilesetEntry(srcdir = decorate(dep, extension))
for dep in deps.to_list()
],
visibility = visibility,
)
# Add any platform specific files to the final tarball.
platform_entries = sc_platform_select(
# We use a different ppc toolchain for Stratum.
# This means that we must provide portable shared libs for our ppc
# executables.
ppc = [native.FilesetEntry(
srcdir = "%s:BUILD" % _PPC_GRTE,
files = [":libs"],
destdir = "lib/stratum",
symlinks = "dereference",
)],
default = [],
)
native.Fileset(
name = fileset_name,
out = name,
entries = [
native.FilesetEntry(
srcdir = decorate(name, "bin"),
destdir = "bin",
),
native.FilesetEntry(
srcdir = decorate(name, "data"),
destdir = "share",
),
] + platform_entries,
visibility = visibility,
)
outs = ["%s.tar.gz" % name]
# Copy our files into a temporary directory and make any necessary changes
# before tarballing.
cmds = [
"TEMP_DIR=$(@D)/stratum_packaging_temp",
"mkdir $${TEMP_DIR}",
"cp -r %s $${TEMP_DIR}/tarball" % _loc(fileset_name),
"if [[ -e $${TEMP_DIR}/tarball/bin ]]",
"then for f in $${TEMP_DIR}/tarball/bin/*.stripped",
" do mv $${f} $${f%.stripped}", # rename not available.
"done",
"fi",
"tar czf %s -h -C $${TEMP_DIR}/tarball ." % _loc(name + ".tar.gz"),
"rm -rf $${TEMP_DIR}",
]
native.genrule(
name = decorate(name, "tarball"),
srcs = [":%s" % fileset_name],
outs = outs,
cmd = "; ".join(cmds),
visibility = visibility,
) | en | 0.780401 | # Copyright 2018 Google LLC # Copyright 2018-present Open Networking Foundation # SPDX-License-Identifier: Apache-2.0 A portable build system for Stratum P4 switch stack. To use this, load() this file in a BUILD file, specifying the symbols needed. The public symbols are the macros: decorate(path) sc_cc_lib Declare a portable Library. sc_proto_lib Declare a portable .proto Library. sc_cc_bin Declare a portable Binary. sc_package Declare a portable tarball package. and the variables/lists: ALL_ARCHES All known arches. EMBEDDED_ARCHES All embedded arches. EMBEDDED_PPC Name of PowerPC arch - "ppc". EMBEDDED_X86 Name of "x86" arch. HOST_ARCH Name of default "host" arch. HOST_ARCHES All host arches. STRATUM_INTERNAL For declaring Stratum internal visibility. The macros are like cc_library(), proto_library(), and cc_binary(), but with different options and some restrictions. The key difference: you can supply lists of architectures for which they should be compiled - defaults to all if left unstated. Internally, libraries and binaries are generated for every listed architecture. The names are decorated to keep them different and allow all to be generated and addressed independently. This aspect of the system is suboptimal - something along the lines of augmenting context with a user defined configuration fragment would be a much cleaner solution. Currently supported architectures: ppc x86 # Generic path & label helpers. ============================================ Normalize a path. Normalizes a path by removing unnecessary path-up segments and its corresponding directories. Providing own implementation because import os is not allowed in build defs. For example ../../dir/to/deeply/nested/path/../../../other/path will become ../../dir/to/other/path Args: path: A valid absolute or relative path to normalize. Returns: A path equivalent to the input path with minimal use of path-up segments. Invalid input paths will stay invalid. # Adds a suffix to a label, expanding implicit targets if needed. # .../bar: -> .../bar # .../bar:bat -> .../bar:bat_suffix # //foo/bar -> //foo/bar:bar_suffix # bar -> bar_suffix # Creates a relative filename from a label, replacing "//" and ":". # //foo/bar:bat/baz -> google3_foo/bar/bat/baz # :bat/baz -> bat/baz # bat/baz -> bat/baz # Adds dquotes around a string. # Adds squotes around a string. # Emulate Python 2.5+ str(startswith([prefix ...]) Public macro to alter blaze rules based on the platform architecture. Generates a blaze select(...) statement that can be used in most contexts to alter a blaze rule based on the target platform architecture. If no selection is provided for a given platform, {default} is used instead. A specific value or default must be provided for every target platform. Args: host: The value to use for host builds. ppc: The value to use for ppc builds. x86: The value to use for x86 builds. default: The value to use for any of {host,ppc,x86} that isn't specified. Returns: The requested selector. # Generates an sc_platform_select based on a textual list of arches. Public macro to create an alias that changes based on target arch. Generates a blaze alias that will select the appropriate target. If no selection is provided for a given platform and no default is set, a dummy default target is used instead. Args: name: The name of the alias target. host: The result of the alias for host builds. ppc: The result of the alias for ppc builds. x86: The result of the alias for x86 builds. default: The result of the alias for any of {host,ppc,x86} that isn't specified. visibility: The visibility of the alias target. # Embedded build definitions. ============================================== # Identify Stratum platform arch for .pb.h shims and other portability hacks. # # Build options for all embedded architectures # # Set _TRACE_SRCS to show sources in embedded sc_cc_lib compile steps. # This is more general than it may seem: genrule doesn't have hdrs or deps # attributes, so all embedded dependencies appear as a `src'. # TODO(unknown): if useful again then inject from cmdline else kill feature. # Used for all gcc invocations. # Don't use this for program-sizing build #-- "-Os", # Use this for program-sizing build # Don't use this for program-sizing build # Warn lots, and force fixing warnings. # Don't mangle paths and confuse blaze. # We'll use tcmalloc # TODO(unknown): Figure out how we can use $(CC_FLAGS) instead of this. # Used for C and C++ compiler invocations. # Used for C++ compiler invocations. # Allow C++11 features _and_ GNU extensions. # Used for linking binaries. # "-static", # Use this for program-sizing build # "-Wl,--gc-sections,--no-wchar-size-warning", # Use this for program-sizing build # PPC ====================================================================== # X86 ====================================================================== # Portability definitions =================================================== Creates a cc_test rule that interacts safely with Stratum builds. Generates a cc_test rule that doesn't break the build when an embedded arch is selected. During embedded builds this target will generate a dummy binary and will not attempt to build any dependencies. Args: name: Analogous to cc_test name argument. size: Analogous to cc_test size argument. srcs: Analogous to cc_test srcs argument. deps: Analogous to cc_test deps argument. data: Analogous to cc_test data argument. defines: Analogous to cc_test defines argument. copts: Analogous to cc_test copts argument. linkopts: Analogous to cc_test linkopts argument. visibility: Analogous to cc_test visibility argument. Creates rules for the given portable library and arches. Args: name: Analogous to cc_library name argument. deps: Analogous to cc_library deps argument. srcs: Analogous to cc_library srcs argument. hdrs: Analogous to cc_library hdrs argument. arches: List of architectures to generate this way. copts: Analogous to cc_library copts argument. defines: Symbols added as "-D" compilation options. includes: Paths to add as "-I" compilation options. include_prefix: Analogous to cc_library include_prefix argument. strip_include_prefix: Analogous to cc_library strip_include_prefix argument. data: Files to provide as data at runtime (host builds only). testonly: Standard blaze testonly parameter. textual_hdrs: Analogous to cc_library. visibility: Standard blaze visibility parameter. xdeps: External (file) dependencies of this library - no decorations assumed, used and exported as header, not for flags, libs, etc. Creates rules for the given portable binary and arches. Args: name: Analogous to cc_binary name argument. deps: Analogous to cc_binary deps argument. srcs: Analogous to cc_binary srcs argument. arches: List of architectures to generate this way. copts: Analogous to cc_binary copts argument. defines: Symbols added as "-D" compilation options. includes: Paths to add as "-I" compilation options. testonly: Standard blaze testonly parameter. visibility: Standard blaze visibility parameter. # Protobuf ================================================================= Return target location for constructing commands. Args: target: Blaze target name available to this build. Returns: $(location target) Creates rules and filegroups for embedded protobuf library. For every given ${src}.proto, generate: :${src}_${arch}.pb rule to run protoc ${src}.proto => ${src}.${arch}.pb.{h,cc} :${src}_${arch}.grpc.pb rule to run protoc w/ erpc plugin: ${src}.proto => ${src}.${arch}.grpc.pb.{h,cc} :${src}_${arch}_proto_rollup collects include options for protoc: ${src}_${arch}_proto_rollup.flags Feed each set into sc_cc_lib to wrap them them up into a usable library; note that ${src}_${arch}_erpc_proto depends on ${src}_${arch}_proto. Args: name: Base name for this library. srcs: List of proto files hdrs: More files to build into this library, but also exported for dependent rules to utilize. deps: List of deps for this library arch: Which architecture to build this library for. visibility: Standard blaze visibility parameter, passed through to subsequent rules. testonly: Standard blaze testonly parameter. proto_include: Include path for generated sc_cc_libs. grpc_shim_rule: If needed, the name of the grpc shim for this proto lib. # TODO(unknown): Switch protobuf to using the proto_include mechanism # We use this filegroup to accumulate the set of .proto files needed to # compile this proto. # We do a bit of extra work with these include flags to avoid generating # warnings. # We can't use $${PWD} until this step, because our rollup command # might be generated on another forge server. # We'll be cd-ing to another directory before protoc, so # adjust our .proto path accordingly. # By cd-ing to another directory, we force protoc to produce # different symbols. Careful, our proto might be in GENDIR! # Generate messages # Generate GRPC # Note: Public sc_proto_lib invokes this once per (listed) arch; # which then calls sc_cc_lib with same name for each arch; # multiple such calls are OK as long as the arches are disjoint. Macro to build .pb.h multi-arch master switch for sc_proto_lib. For each src path.proto, generates path.pb.h consisting of: #ifdef logic to select path.${arch}.pb.h Also generates an alias that will select the appropriate proto target based on the currently selected platform architecture. Args: name: Base name for this library. pb_modifier: protoc plugin-dependent file extension (e.g.: .pb) srcs: List of proto files. arches: List of arches this shim should support. visibility: The blaze visibility of the generated alias. Returns: Name of shim rule for use in follow-on hdrs and/or src lists. # Generate lines for shim switch file. # Lines expand inside squotes, so quote accordingly. Creates a py_proto_library from the given srcs. There's no clean way to make python protos work with sc_proto_lib's proto_include field, so we keep this simple. For library "name", generates: * ${name}_default_pb, a regular proto library. * ${name}_py, a py_proto_library based on ${name}_default_pb. Args: name: Standard blaze name argument. srcs: Standard blaze srcs argument. deps: Standard blaze deps argument. visibility: Standard blaze visibility argument. testonly: Standard blaze testonly argument. # TODO(unknown): Add support for depending on normal proto_library rules. Public macro to build multi-arch library from Message protobuf(s). For library "name", generates: * ${name}_shim aka .pb.h master switch - see _gen_proto_shims, above. * ${name}_${arch}_pb protobuf compile rules - one for each arch. * sc_cc_lib(name) with those as input. * ${name}_py a py_proto_library version of this library. Only generated if python_support == True. Args: name: Base name for this library. srcs: List of .proto files - private to this library. hdrs: As above, but also exported for dependent rules to utilize. deps: List of deps for this library arches: Which architectures to build this library for, None => ALL. visibility: Standard blaze visibility parameter, passed through to subsequent rules. testonly: Standard blaze testonly parameter. proto_include: Path to add to include path. This will affect the symbols generated by protoc, as well as the include paths used for both sc_cc_lib and sc_proto_lib rules that depend on this rule. Typically "." python_support: Defaults to False. If True, generate a python proto library from this rule. Any sc_proto_lib with python support may only depend on sc_proto_libs that also have python support, and may not use the proto_include field in this rule. services: List of services to enable {"grpc", "rpc"}; Only "grpc" is supported. So "rpc" and "grpc" are equivalent. Public macro to package binaries and data for deployment. For package "name", generates: * ${name}_${arch}_bin and ${name}_${arch}_data filesets containing respectively all of the binaries and all of the data needed for this package and all dependency packages. * ${name}_${arch} fileset containing the corresponding bin and data filesets, mapped to bin/ and share/ respectively. * ${name}_${arch}_tarball rule builds that .tar.gz package. Args: name: Base name for this package. bins: List of sc_cc_bin rules to be packaged. data: List of files (and file producing rules) to be packaged. deps: List of other sc_packages to add to this package. arches: Which architectures to build this library for, None => EMBEDDED_ARCHES (HOST_ARCHES not generally supported). visibility: Standard blaze visibility parameter, passed through to all filesets. # Add any platform specific files to the final tarball. # We use a different ppc toolchain for Stratum. # This means that we must provide portable shared libs for our ppc # executables. # Copy our files into a temporary directory and make any necessary changes # before tarballing. # rename not available. | 2.059658 | 2 |
src/genie/libs/parser/ios/tests/test_show_platform.py | miuvlad/genieparser | 0 | 2859 | <filename>src/genie/libs/parser/ios/tests/test_show_platform.py
#!/bin/env python
import unittest
from unittest.mock import Mock
from pyats.topology import Device
from genie.metaparser.util.exceptions import SchemaEmptyParserError,\
SchemaMissingKeyError
from genie.libs.parser.ios.show_platform import ShowVersion,\
Dir,\
ShowRedundancy,\
ShowInventory,\
ShowBootvar, \
ShowProcessesCpuSorted,\
ShowProcessesCpu,\
ShowVersionRp,\
ShowPlatform,\
ShowPlatformPower,\
ShowProcessesCpuHistory,\
ShowProcessesCpuPlatform,\
ShowPlatformSoftwareStatusControl,\
ShowPlatformSoftwareSlotActiveMonitorMem,\
ShowPlatformHardware,\
ShowPlatformHardwarePlim,\
ShowPlatformHardwareQfpBqsOpmMapping,\
ShowPlatformHardwareQfpBqsIpmMapping,\
ShowPlatformHardwareSerdes,\
ShowPlatformHardwareSerdesInternal,\
ShowPlatformHardwareQfpBqsStatisticsChannelAll,\
ShowPlatformHardwareQfpInterfaceIfnameStatistics,\
ShowPlatformHardwareQfpStatisticsDrop,\
ShowEnvironment,\
ShowModule,\
ShowSwitch, ShowSwitchDetail
from genie.libs.parser.iosxe.tests.test_show_platform import TestShowPlatform as test_show_platform_iosxe,\
TestShowPlatformPower as test_show_platform_power_iosxe,\
TestShowVersionRp as test_show_version_rp_iosxe,\
TestShowProcessesCpu as test_show_processes_cpu_iosxe,\
TestShowProcessesCpuHistory as test_show_processes_cpu_history_iosxe,\
TestShowProcessesCpuPlatform as test_show_processes_cpu_platform_iosxe,\
TestShowPlatformSoftwareStatusControlProcessorBrief as test_show_platform_software_status_control_processor_brief_iosxe,\
TestShowPlatformSoftwareSlotActiveMonitorMemSwap as test_show_platform_software_slot_active_monitor_Mem_iosxe,\
TestShowPlatformHardware as test_show_platform_hardware_iosxe,\
TestShowPlatformHardwarePlim as test_show_platform_hardware_plim_iosxe,\
TestShowPlatformHardwareQfpBqsOpmMapping as test_show_platform_hardware_qfp_bqs_opm_mapping_iosxe,\
TestShowPlatformHardwareQfpBqsIpmMapping as test_show_platform_hardware_qfp_bqs_ipm_mapping_iosxe,\
TestShowPlatformHardwareSerdesStatistics as test_show_platform_hardware_serdes_statistics_iosxe,\
TestShowPlatformHardwareSerdesStatisticsInternal as test_show_platform_hardware_serdes_statistics_internal_iosxe,\
ShowPlatformHardwareQfpBqsStatisticsChannelAll as show_platform_hardware_qfp_bqs_statistics_channel_all_iosxe,\
ShowPlatformHardwareQfpInterface as show_platform_hardware_qfp_interface_iosxe,\
TestShowPlatformHardwareQfpStatisticsDrop as test_show_platform_hardware_qfp_statistics_drop_iosxe,\
TestShowEnv as test_show_env_iosxe,\
TestShowModule as test_show_module_iosxe,\
TestShowSwitch as test_show_switch_iosxe,\
TestShowSwitchDetail as test_show_switch_detail_iosxe
class TestShowVersion(unittest.TestCase):
dev1 = Device(name='empty')
dev_iosv = Device(name='iosv')
empty_output = {'execute.return_value': ''}
semi_empty_output = {'execute.return_value': '''\
ROM: Bootstrap program is IOSv
'''}
golden_parsed_output_iosv = {
"version": {
"last_reload_reason": "Unknown reason",
"hostname": "N95_1",
"os": "IOS",
"version_short": "15.6",
"number_of_intfs": {
"Gigabit Ethernet": "6"
},
"version": "15.6(3)M2",
"rtr_type": "IOSv",
"chassis_sn": "9K66Z7TOKAACDEQA24N7S",
"chassis": "IOSv",
"image_id": "VIOS-ADVENTERPRISEK9-M",
'compiled_by': 'prod_rel_team',
'compiled_date': 'Wed 29-Mar-17 14:05',
"processor_type": "revision 1.0",
"platform": "IOSv",
"image_type": "production image",
'processor_board_flash': '10080K',
'returned_to_rom_by': 'reload',
"main_mem": "435457",
"mem_size": {
"non-volatile configuration": "256"
},
"system_image": "flash0:/vios-adventerprisek9-m",
"curr_config_register": "0x0",
"rom": "Bootstrap program is IOSv",
"uptime": "1 day, 16 hours, 42 minutes"
}
}
golden_output_iosv = {'execute.return_value': '''\
Cisco IOS Software, IOSv Software (VIOS-ADVENTERPRISEK9-M), Version 15.6(3)M2, RELEASE SOFTWARE (fc2)
Technical Support: http://www.cisco.com/techsupport
Copyright (c) 1986-2017 by Cisco Systems, Inc.
Compiled Wed 29-Mar-17 14:05 by prod_rel_team
ROM: Bootstrap program is IOSv
N95_1 uptime is 1 day, 16 hours, 42 minutes
System returned to ROM by reload
System image file is "flash0:/vios-adventerprisek9-m"
Last reload reason: Unknown reason
This product contains cryptographic features and is subject to United
States and local country laws governing import, export, transfer and
use. Delivery of Cisco cryptographic products does not imply
third-party authority to import, export, distribute or use encryption.
Importers, exporters, distributors and users are responsible for
compliance with U.S. and local country laws. By using this product you
agree to comply with applicable laws and regulations. If you are unable
to comply with U.S. and local laws, return this product immediately.
A summary of U.S. laws governing Cisco cryptographic products may be found at:
http://www.cisco.com/wwl/export/crypto/tool/stqrg.html
If you require further assistance please contact us by sending email to
<EMAIL>.
Cisco IOSv (revision 1.0) with with 435457K/87040K bytes of memory.
Processor board ID 9K66Z7TOKAACDEQA24N7S
6 Gigabit Ethernet interfaces
DRAM configuration is 72 bits wide with parity disabled.
256K bytes of non-volatile configuration memory.
2097152K bytes of ATA System CompactFlash 0 (Read/Write)
0K bytes of ATA CompactFlash 1 (Read/Write)
0K bytes of ATA CompactFlash 2 (Read/Write)
10080K bytes of ATA CompactFlash 3 (Read/Write)
Configuration register is 0x0'''}
golden_parsed_output_ios = {
'version': {'bootldr': 'C3750E Boot Loader (C3750X-HBOOT-M) Version '
'15.2(3r)E, RELEASE SOFTWARE (fc1)',
'chassis': 'WS-C3750X-24P',
'chassis_sn': 'FDO2028F1WK',
'curr_config_register': '0xF',
'compiled_by': 'prod_rel_team',
'compiled_date': 'Wed 26-Jun-13 09:56',
'hostname': 'R5',
'image_id': 'C3750E-UNIVERSALK9-M',
'image_type': 'production image',
'last_reload_reason': 'power-on',
'license_level': 'ipservices',
'license_type': 'Permanent',
'main_mem': '262144',
'mem_size': {'flash-simulated non-volatile configuration': '512'},
'next_reload_license_level': 'ipservices',
'number_of_intfs': {'Gigabit Ethernet': '28',
'Ten Gigabit Ethernet': '2',
'Virtual Ethernet': '2',
'Gigabit Ethernet': '28',
'FastEthernet': '1'
},
'os': 'IOS',
'platform': 'C3750E',
'processor_type': 'PowerPC405',
'returned_to_rom_by': 'power-on',
'rom': 'Bootstrap program is C3750E boot loader',
'rtr_type': 'WS-C3750X-24P',
'system_image': 'flash:c3750e-universalk9-mz',
'system_restarted_at': '12:22:21 PDT Mon Sep 10 2018',
'uptime': '9 weeks, 4 days, 2 hours, 3 minutes',
'version': '12.2(55)SE8',
'version_short': '12.2'
}
}
golden_output_ios = {'execute.return_value': '''\
Cisco IOS Software, C3750E Software (C3750E-UNIVERSALK9-M), Version 12.2(55)SE8, RELEASE SOFTWARE (fc2)
Technical Support: http://www.cisco.com/techsupport
Copyright (c) 1986-2013 by Cisco Systems, Inc.
Compiled Wed 26-Jun-13 09:56 by prod_rel_team
Image text-base: 0x00003000, data-base: 0x02800000
ROM: Bootstrap program is C3750E boot loader
BOOTLDR: C3750E Boot Loader (C3750X-HBOOT-M) Version 15.2(3r)E, RELEASE SOFTWARE (fc1)
R5 uptime is 9 weeks, 4 days, 2 hours, 3 minutes
System returned to ROM by power-on
System restarted at 12:22:21 PDT Mon Sep 10 2018
System image file is "flash:c3750e-universalk9-mz"
This product contains cryptographic features and is subject to United
States and local country laws governing import, export, transfer and
use. Delivery of Cisco cryptographic products does not imply
third-party authority to import, export, distribute or use encryption.
Importers, exporters, distributors and users are responsible for
compliance with U.S. and local country laws. By using this product you
agree to comply with applicable laws and regulations. If you are unable
to comply with U.S. and local laws, return this product immediately.
A summary of U.S. laws governing Cisco cryptographic products may be found at:
http://www.cisco.com/wwl/export/crypto/tool/stqrg.html
If you require further assistance please contact us by sending email to
<EMAIL>.
License Level: ipservices
License Type: Permanent
Next reload license Level: ipservices
cisco WS-C3750X-24P (PowerPC405) processor (revision W0) with 262144K bytes of memory.
Processor board ID FDO2028F1WK
Last reset from power-on
2 Virtual Ethernet interfaces
1 FastEthernet interface
28 Gigabit Ethernet interfaces
2 Ten Gigabit Ethernet interfaces
The password-recovery mechanism is enabled.
512K bytes of flash-simulated non-volatile configuration memory.
Base ethernet MAC Address : 84:3D:C6:FF:F1:B8
Motherboard assembly number : 73-15476-04
Motherboard serial number : FDO202907UH
Model revision number : W0
Motherboard revision number : B0
Model number : WS-C3750X-24P-L
Daughterboard assembly number : 800-32727-03
Daughterboard serial number : FDO202823P8
System serial number : FDO2028F1WK
Top Assembly Part Number : 800-38990-01
Top Assembly Revision Number : F0
Version ID : V07
CLEI Code Number : CMMPP00DRB
Hardware Board Revision Number : 0x05
Switch Ports Model SW Version SW Image
------ ----- ----- ---------- ----------
* 1 30 WS-C3750X-24P 12.2(55)SE8 C3750E-UNIVERSALK9-M
Configuration register is 0xF
'''}
golden_parsed_output_ios_cat6k = {
"version": {
"os": "IOS",
"version_short": "12.2",
"platform": "s72033_rp",
"version": "12.2(18)SXF7",
"image_id": "s72033_rp-ADVENTERPRISEK9_WAN-M",
'compiled_by': 'kellythw',
'compiled_date': 'Thu 23-Nov-06 06:26',
"image_type": "production image",
"rom": "System Bootstrap, Version 12.2(17r)S4, RELEASE SOFTWARE (fc1)",
"bootldr": "s72033_rp Software (s72033_rp-ADVENTERPRISEK9_WAN-M), Version 12.2(18)SXF7, RELEASE SOFTWARE (fc1)",
"hostname": "cat6k_tb1",
"uptime": "10 weeks, 5 days, 5 hours, 16 minutes",
"system_image": "disk0:s72033-adventerprisek9_wan-mz.122-18.SXF7",
"chassis": "WS-C6503-E",
"main_mem": "983008",
"processor_type": "R7000",
'sp_by': 'power on',
'returned_to_rom_at': '21:57:23 UTC Sat Aug 28 2010',
'returned_to_rom_by': 'power cycle',
"rtr_type": "WS-C6503-E",
"chassis_sn": "FXS1821Q2H9",
"last_reload_reason": "s/w reset",
'processor_board_flash': '65536K',
"number_of_intfs": {
"Gigabit Ethernet/IEEE 802.3": "50",
'Virtual Ethernet/IEEE 802.3': '1'
},
"mem_size": {"non-volatile configuration": "1917", "packet buffer": "8192"},
"curr_config_register": "0x2102",
}
}
golden_output_ios_cat6k = {'execute.return_value': '''
show version
Cisco Internetwork Operating System Software
IOS (tm) s72033_rp Software (s72033_rp-ADVENTERPRISEK9_WAN-M), Version 12.2(18)SXF7, RELEASE SOFTWARE (fc1)
Technical Support: http://www.cisco.com/techsupport
Copyright (c) 1986-2006 by cisco Systems, Inc.
Compiled Thu 23-Nov-06 06:26 by kellythw
Image text-base: 0x40101040, data-base: 0x42D98000
ROM: System Bootstrap, Version 12.2(17r)S4, RELEASE SOFTWARE (fc1)
BOOTLDR: s72033_rp Software (s72033_rp-ADVENTERPRISEK9_WAN-M), Version 12.2(18)SXF7, RELEASE SOFTWARE (fc1)
cat6k_tb1 uptime is 10 weeks, 5 days, 5 hours, 16 minutes
Time since cat6k_tb1 switched to active is 10 weeks, 5 days, 5 hours, 15 minutes
System returned to ROM by power cycle at 21:57:23 UTC Sat Aug 28 2010 (SP by power on)
System image file is "disk0:s72033-adventerprisek9_wan-mz.122-18.SXF7"
This product contains cryptographic features and is subject to United
States and local country laws governing import, export, transfer and
use. Delivery of Cisco cryptographic products does not imply
third-party authority to import, export, distribute or use encryption.
Importers, exporters, distributors and users are responsible for
compliance with U.S. and local country laws. By using this product you
agree to comply with applicable laws and regulations. If you are unable
to comply with U.S. and local laws, return this product immediately.
A summary of U.S. laws governing Cisco cryptographic products may be found at:
http://www.cisco.com/wwl/export/crypto/tool/stqrg.html
If you require further assistance please contact us by sending email to
<EMAIL>.
cisco WS-C6503-E (R7000) processor (revision 1.4) with 983008K/65536K bytes of memory.
Processor board ID FXS1821Q2H9
SR71000 CPU at 600Mhz, Implementation 0x504, Rev 1.2, 512KB L2 Cache
Last reset from s/w reset
SuperLAT software (copyright 1990 by Meridian Technology Corp).
X.25 software, Version 3.0.0.
Bridging software.
TN3270 Emulation software.
1 Virtual Ethernet/IEEE 802.3 interface
50 Gigabit Ethernet/IEEE 802.3 interfaces
1917K bytes of non-volatile configuration memory.
8192K bytes of packet buffer memory.
65536K bytes of Flash internal SIMM (Sector size 512K).
Configuration register is 0x2102
'''}
golden_output_ios_1 = {'execute.return_value': '''\
Cisco IOS Software, C3750E Software (C3750E-UNIVERSALK9-M), Version 15.2(2)E8, RELEASE SOFTWARE (fc1)
Technical Support: http://www.cisco.com/techsupport
Copyright (c) 1986-2018 by Cisco Systems, Inc.
Compiled Mon 22-Jan-18 04:07 by prod_rel_team
ROM: Bootstrap program is C3750E boot loader
BOOTLDR: C3750E Boot Loader (C3750X-HBOOT-M) Version 12.2(58r)SE, RELEASE SOFTWARE (fc1)
sample_switch uptime is 8 weeks, 3 days, 10 hours, 27 minutes
System returned to ROM by power-on
System restarted at 05:06:40 GMT Tue Sep 10 2019
System image file is "flash:c3750e-universalk9-mz.152-2.E8.bin"
Last reload reason: Reload command
This product contains cryptographic features and is subject to United
States and local country laws governing import, export, transfer and
use. Delivery of Cisco cryptographic products does not imply
third-party authority to import, export, distribute or use encryption.
Importers, exporters, distributors and users are responsible for
compliance with U.S. and local country laws. By using this product you
agree to comply with applicable laws and regulations. If you are unable
to comply with U.S. and local laws, return this product immediately.
A summary of U.S. laws governing Cisco cryptographic products may be found at:
http://www.cisco.com/wwl/export/crypto/tool/stqrg.html
If you require further assistance please contact us by sending email to
<EMAIL>.
License Level: ipservices
License Type: Permanent
Next reload license Level: ipservices
cisco WS-C3750X-24S (PowerPC405) processor (revision A0) with 524288K bytes of memory.
Processor board ID FDO1633Q14S
Last reset from power-on
14 Virtual Ethernet interfaces
1 FastEthernet interface
28 Gigabit Ethernet interfaces
2 Ten Gigabit Ethernet interfaces
The password-recovery mechanism is enabled.
512K bytes of flash-simulated non-volatile configuration memory.
Base ethernet MAC Address : AC:F2:C5:FF:55:E7
Motherboard assembly number : 73-13061-04
Motherboard serial number : FDO1633Q14M
Model revision number : A0
Motherboard revision number : A0
Model number : WS-C3750X-24S-E
Daughterboard assembly number : 800-32727-03
Daughterboard serial number : FDO172217ED
System serial number : FDO1633Q14S
Top Assembly Part Number : 800-33746-04
Top Assembly Revision Number : B0
Version ID : V03
CLEI Code Number : CMMFF00ARC
Hardware Board Revision Number : 0x04
Switch Ports Model SW Version SW Image
------ ----- ----- ---------- ----------
* 1 30 WS-C3750X-24S 15.2(2)E8 C3750E-UNIVERSALK9-M
Configuration register is 0xF
'''}
golden_parsed_output_ios_1 = {
'version': {'version_short': '15.2',
'platform': 'C3750E',
'version': '15.2(2)E8',
'image_id': 'C3750E-UNIVERSALK9-M',
'os': 'IOS',
'image_type': 'production image',
'compiled_date': 'Mon 22-Jan-18 04:07',
'compiled_by': 'prod_rel_team',
'rom': 'Bootstrap program is C3750E boot loader',
'bootldr': 'C3750E Boot Loader (C3750X-HBOOT-M) Version 12.2(58r)SE, RELEASE SOFTWARE (fc1)',
'hostname': 'sample_switch',
'uptime': '8 weeks, 3 days, 10 hours, 27 minutes',
'returned_to_rom_by': 'power-on',
'system_restarted_at': '05:06:40 GMT Tue Sep 10 2019',
'system_image': 'flash:c3750e-universalk9-mz.152-2.E8.bin',
'last_reload_reason': 'power-on',
'license_level': 'ipservices',
'license_type': 'Permanent',
'next_reload_license_level': 'ipservices',
'chassis': 'WS-C3750X-24S',
'main_mem': '524288',
'processor_type': 'PowerPC405',
'rtr_type': 'WS-C3750X-24S',
'chassis_sn': 'FDO1633Q14S',
'number_of_intfs': {
'Virtual Ethernet': '14',
'FastEthernet': '1',
'Gigabit Ethernet': '28',
'Ten Gigabit Ethernet': '2'
},
'mem_size': {
'flash-simulated non-volatile configuration': '512'
},
'curr_config_register': '0xF'
}
}
device_output = {'execute.return_value':'''
best-c3945-IOS3#show version
Cisco IOS Software, C3900 Software (C3900-UNIVERSALK9-M), Version 15.0(1)M7, RELEASE SOFTWARE (fc2)
Technical Support: http://www.cisco.com/techsupport
Copyright (c) 1986-2011 by Cisco Systems, Inc.
Compiled Fri 05-Aug-11 00:32 by prod_rel_team
ROM: System Bootstrap, Version 15.0(1r)M13, RELEASE SOFTWARE (fc1)
best-c3945-IOS3 uptime is 1 hour, 20 minutes
System returned to ROM by reload at 10:26:47 EST Mon Dec 9 2019
System restarted at 10:27:57 EST Mon Dec 9 2019
System image file is "flash0:c3900-universalk9-mz.SPA.150-1.M7.bin"
Last reload type: Normal Reload
Last reload reason: Reload Command
This product contains cryptographic features and is subject to United
States and local country laws governing import, export, transfer and
use. Delivery of Cisco cryptographic products does not imply
third-party authority to import, export, distribute or use encryption.
Importers, exporters, distributors and users are responsible for
compliance with U.S. and local country laws. By using this product you
agree to comply with applicable laws and regulations. If you are unable
to comply with U.S. and local laws, return this product immediately.
A summary of U.S. laws governing Cisco cryptographic products may be found at:
http://www.cisco.com/wwl/export/crypto/tool/stqrg.html
If you require further assistance please contact us by sending email to
<EMAIL>.
Cisco CISCO3945-CHASSIS (revision 1.1) with C3900-SPE150/K9 with 2027520K/69632K bytes of memory.
Processor board ID FGL161010K8
2 FastEthernet interfaces
3 Gigabit Ethernet interfaces
1 Virtual Private Network (VPN) Module
DRAM configuration is 72 bits wide with parity enabled.
255K bytes of non-volatile configuration memory.
2000880K bytes of ATA System CompactFlash 0 (Read/Write)
License Info:
License UDI:
-------------------------------------------------
Device# PID SN
-------------------------------------------------
*0 C3900-SPE150/K9 FOC16050QP6
Technology Package License Information for Module:'c3900'
-----------------------------------------------------------------
Technology Technology-package Technology-package
Current Type Next reboot
------------------------------------------------------------------
ipbase ipbasek9 Permanent ipbasek9
security securityk9 Permanent securityk9
uc None None None
data datak9 Permanent datak9
Configuration register is 0x2102
'''}
parsed_output = {
'version': {
'chassis': 'CISCO3945-CHASSIS',
'chassis_sn': 'FGL161010K8',
'compiled_by': 'prod_rel_team',
'compiled_date': 'Fri 05-Aug-11 00:32',
'curr_config_register': '0x2102',
'hostname': 'best-c3945-IOS3',
'image_id': 'C3900-UNIVERSALK9-M',
'image_type': 'production image',
'last_reload_reason': 'Reload Command',
'last_reload_type': 'Normal Reload',
'license_udi': {
'device_num': {
'*0': {
'pid': 'C3900-SPE150/K9',
'sn': 'FOC16050QP6'
}
}
},
'license_package': {
'data': {
'license_level': 'datak9',
'license_type': 'Permanent',
'next_reload_license_level': 'datak9',
},
'ipbase': {
'license_level': 'ipbasek9',
'license_type': 'Permanent',
'next_reload_license_level': 'ipbasek9',
},
'security': {
'license_level': 'securityk9',
'license_type': 'Permanent',
'next_reload_license_level': 'securityk9',
},
'uc': {
'license_level': 'None',
'license_type': 'None',
'next_reload_license_level': 'None',
},
},
'main_mem': '2027520',
'mem_size': {
'non-volatile configuration': '255',
},
'number_of_intfs': {
'FastEthernet': '2',
'Gigabit Ethernet': '3',
},
'os': 'IOS',
'platform': 'C3900',
'processor_board_flash': '2000880K',
'processor_type': 'C3900-SPE150/K9',
'returned_to_rom_at': '10:26:47 EST Mon Dec 9 2019',
'returned_to_rom_by': 'reload',
'rom': 'System Bootstrap, Version 15.0(1r)M13, RELEASE SOFTWARE (fc1)',
'rtr_type': 'CISCO3945-CHASSIS',
'system_image': 'flash0:c3900-universalk9-mz.SPA.150-1.M7.bin',
'system_restarted_at': '10:27:57 EST Mon Dec 9 2019',
'uptime': '1 hour, 20 minutes',
'version': '15.0(1)M7',
'version_short': '15.0',
},
}
def test_empty(self):
self.dev1 = Mock(**self.empty_output)
version_obj = ShowVersion(device=self.dev1)
with self.assertRaises(AttributeError):
parsered_output = version_obj.parse()
def test_semi_empty(self):
self.dev1 = Mock(**self.semi_empty_output)
version_obj = ShowVersion(device=self.dev1)
with self.assertRaises(KeyError):
parsed_output = version_obj.parse()
def test_golden_iosv(self):
self.maxDiff = None
self.dev_iosv = Mock(**self.golden_output_iosv)
version_obj = ShowVersion(device=self.dev_iosv)
parsed_output = version_obj.parse()
self.assertEqual(parsed_output, self.golden_parsed_output_iosv)
def test_golden_ios(self):
self.maxDiff = None
self.dev_iosv = Mock(**self.golden_output_ios)
version_obj = ShowVersion(device=self.dev_iosv)
parsed_output = version_obj.parse()
self.assertEqual(parsed_output, self.golden_parsed_output_ios)
def test_golden_ios_cat6k(self):
self.maxDiff = None
self.dev_iosv = Mock(**self.golden_output_ios_cat6k)
version_obj = ShowVersion(device=self.dev_iosv)
parsed_output = version_obj.parse()
self.assertEqual(parsed_output, self.golden_parsed_output_ios_cat6k)
def test_golden_ios_1(self):
self.maxDiff = None
self.dev_iosv = Mock(**self.golden_output_ios_1)
version_obj = ShowVersion(device=self.dev_iosv)
parsed_output = version_obj.parse()
self.assertEqual(parsed_output, self.golden_parsed_output_ios_1)
def test_golden_ios_2(self):
self.maxDiff = None
self.dev_iosv = Mock(**self.device_output)
version_obj = ShowVersion(device=self.dev_iosv)
parsed_output = version_obj.parse()
self.assertEqual(parsed_output, self.parsed_output)
class test_dir(unittest.TestCase):
dev1 = Device(name='empty')
dev_iosv = Device(name='iosv')
empty_output = {'execute.return_value': ''}
semi_empty_output = {'execute.return_value': '''\
Directory of flash:/
'''}
golden_parsed_output_iosv = {
"dir": {
"flash0:/": {
"files": {
"e1000_bia.txt": {
"last_modified_date": "Oct 17 2018 18:57:18 +00:00",
"index": "269",
"size": "119",
"permissions": "-rw-"
},
"config": {
"last_modified_date": "Oct 14 2013 00:00:00 +00:00",
"index": "264",
"size": "0",
"permissions": "drw-"
},
"nvram": {
"last_modified_date": "Oct 17 2018 18:57:10 +00:00",
"index": "268",
"size": "524288",
"permissions": "-rw-"
},
"boot": {
"last_modified_date": "Jan 30 2013 00:00:00 +00:00",
"index": "1",
"size": "0",
"permissions": "drw-"
},
"vios-adventerprisek9-m": {
"last_modified_date": "Mar 29 2017 00:00:00 +00:00",
"index": "267",
"size": "147988420",
"permissions": "-rw-"
}
},
"bytes_total": "2142715904",
"bytes_free": "1989595136"
},
"dir": "flash0:/"
}
}
golden_output_iosv = {'execute.return_value': '''\
Directory of flash0:/
1 drw- 0 Jan 30 2013 00:00:00 +00:00 boot
264 drw- 0 Oct 14 2013 00:00:00 +00:00 config
267 -rw- 147988420 Mar 29 2017 00:00:00 +00:00 vios-adventerprisek9-m
268 -rw- 524288 Oct 17 2018 18:57:10 +00:00 nvram
269 -rw- 119 Oct 17 2018 18:57:18 +00:00 e1000_bia.txt
2142715904 bytes total (1989595136 bytes free)
'''}
def test_empty(self):
self.dev1 = Mock(**self.empty_output)
dir_obj = Dir(device=self.dev1)
with self.assertRaises(SchemaEmptyParserError):
parsered_output = dir_obj.parse()
def test_semi_empty(self):
self.dev1 = Mock(**self.semi_empty_output)
dir_obj = Dir(device=self.dev1)
with self.assertRaises(SchemaMissingKeyError):
parsed_output = dir_obj.parse()
def test_golden_iosv(self):
self.maxDiff = None
self.dev_iosv = Mock(**self.golden_output_iosv)
dir_obj = Dir(device=self.dev_iosv)
parsed_output = dir_obj.parse()
self.assertEqual(parsed_output, self.golden_parsed_output_iosv)
class test_show_redundancy(unittest.TestCase):
dev1 = Device(name='empty')
dev_iosv = Device(name='iosv')
empty_output = {'execute.return_value': ''}
golden_parsed_output_iosv = {
"red_sys_info": {
"last_switchover_reason": "unsupported",
"maint_mode": "Disabled",
"switchovers_system_experienced": "0",
"available_system_uptime": "0 minutes",
"communications": "Down",
"hw_mode": "Simplex",
"communications_reason": "Failure",
"standby_failures": "0"
},
"slot": {
"slot 0": {
"image_ver": "Cisco IOS Software, IOSv Software (VIOS-ADVENTERPRISEK9-M), Version 15.6(3)M2, RELEASE SOFTWARE (fc2)",
"uptime_in_curr_state": "1 day, 16 hours, 42 minutes",
"config_register": "0x0",
"curr_sw_state": "ACTIVE"
}
}
}
golden_output_iosv = {'execute.return_value': '''\
Redundant System Information :
------------------------------
Available system uptime = 0 minutes
Switchovers system experienced = 0
Standby failures = 0
Last switchover reason = unsupported
Hardware Mode = Simplex
Maintenance Mode = Disabled
Communications = Down Reason: Failure
Current Processor Information :
-------------------------------
Active Location = slot 0
Current Software state = ACTIVE
Uptime in current state = 1 day, 16 hours, 42 minutes
Image Version = Cisco IOS Software, IOSv Software (VIOS-ADVENTERPRISEK9-M), Version 15.6(3)M2, RELEASE SOFTWARE (fc2)
Technical Support: http://www.cisco.com/techsupport
Copyright (c) 1986-2017 by Cisco Systems, Inc.
Compiled Wed 29-Mar-17 14:05 by prod_rel_team
Configuration register = 0x0
Peer (slot: 0) information is not available because it is in 'DISABLED' state
'''}
def test_empty(self):
self.dev1 = Mock(**self.empty_output)
redundancy_obj = ShowRedundancy(device=self.dev1)
with self.assertRaises(SchemaEmptyParserError):
parsed_output = redundancy_obj.parse()
def test_golden_iosv(self):
self.maxDiff = None
self.dev_iosv = Mock(**self.golden_output_iosv)
redundancy_obj = ShowRedundancy(device=self.dev_iosv)
parsed_output = redundancy_obj.parse()
self.assertEqual(parsed_output, self.golden_parsed_output_iosv)
class TestShowInventory(unittest.TestCase):
dev1 = Device(name='empty')
dev_iosv = Device(name='iosv')
empty_output = {'execute.return_value': ''}
golden_parsed_output_iosv = {
'main': {
'chassis': {
'IOSv': {
'descr': 'IOSv chassis, Hw Serial#: 9K66Z7TOKAACDEQA24N7S, Hw Revision: 1.0',
'name': 'IOSv',
'pid': 'IOSv',
'sn': '9K66Z7TOKAACDEQA24N7S',
'vid': '1.0',
},
},
},
}
golden_output_iosv = {'execute.return_value': '''\
NAME: "IOSv", DESCR: "IOSv chassis, Hw Serial#: 9K66Z7TOKAACDEQA24N7S, Hw Revision: 1.0"
PID: IOSv , VID: 1.0, SN: 9K66Z7TOKAACDEQA24N7S
'''}
golden_parsed_output_2 = {
"main": {
"chassis": {
"WS-C6504-E": {
"name": "WS-C6504-E",
"descr": "Cisco Systems Cisco 6500 4-slot Chassis System",
"pid": "WS-C6504-E",
"vid": "V01",
"sn": "FXS1712Q1R8",
}
}
},
"slot": {
"CLK-7600 1": {
"other": {
"CLK-7600 1": {
"name": "CLK-7600 1",
"descr": "OSR-7600 Clock FRU 1",
"pid": "CLK-7600",
"vid": "",
"sn": "FXS170802GL",
}
}
},
"CLK-7600 2": {
"other": {
"CLK-7600 2": {
"name": "CLK-7600 2",
"descr": "OSR-7600 Clock FRU 2",
"pid": "CLK-7600",
"vid": "",
"sn": "FXS170802GL",
}
}
},
"FAN-MOD-4HS 1": {
"other": {
"FAN-MOD-4HS 1": {
"name": "FAN-MOD-4HS 1",
"descr": "High Speed Fan Module for CISCO7604 1",
"pid": "FAN-MOD-4HS",
"vid": "V01",
"sn": "DCH170900PF",
}
}
},
"PS 1 PWR-2700-AC/4": {
"other": {
"PS 1 PWR-2700-AC/4": {
"name": "PS 1 PWR-2700-AC/4",
"descr": "2700W AC power supply for CISCO7604 1",
"pid": "PWR-2700-AC/4",
"vid": "V03",
"sn": "APS1707008Y",
}
}
},
"PS 2 PWR-2700-AC/4": {
"other": {
"PS 2 PWR-2700-AC/4": {
"name": "PS 2 PWR-2700-AC/4",
"descr": "2700W AC power supply for CISCO7604 2",
"pid": "PWR-2700-AC/4",
"vid": "V03",
"sn": "APS17070093",
}
}
},
"1": {
"rp": {
"VS-SUP2T-10G": {
"name": "1",
"descr": "VS-SUP2T-10G 5 ports Supervisor Engine 2T 10GE w/ CTS Rev. 1.5",
"pid": "VS-SUP2T-10G",
"vid": "V05",
"sn": "SAL17152N0F",
"subslot": {
"0": {
"VS-F6K-MSFC5": {
"descr": "VS-F6K-MSFC5 CPU Daughterboard Rev. 2.0",
"name": "msfc sub-module of 1",
"pid": "VS-F6K-MSFC5",
"sn": "SAL17142D06",
"vid": "",
},
"VS-F6K-PFC4": {
"descr": "VS-F6K-PFC4 Policy Feature Card 4 Rev. 2.0",
"name": "VS-F6K-PFC4 Policy Feature Card 4 EARL sub-module of 1",
"pid": "VS-F6K-PFC4",
"sn": "SAL17163901",
"vid": "V03",
},
},
"4": {
"X2-10GB-SR": {
"descr": "X2 Transceiver 10Gbase-SR Te1/4",
"name": "Transceiver Te1/4",
"pid": "X2-10GB-SR",
"sn": "ONT170202T1",
"vid": "V06 ",
}
},
"5": {
"X2-10GB-SR": {
"descr": "X2 Transceiver 10Gbase-SR Te1/5",
"name": "Transceiver Te1/5",
"pid": "X2-10GB-SR",
"sn": "ONT1702033D",
"vid": "V06 ",
}
},
},
}
}
},
"2": {
"lc": {
"WS-X6816-10GE": {
"name": "2",
"descr": "WS-X6816-10GE CEF720 16 port 10GE Rev. 2.0",
"pid": "WS-X6816-10GE",
"vid": "V02",
"sn": "SAL17152QB3",
"subslot": {
"0": {
"WS-F6K-DFC4-E": {
"descr": "WS-F6K-DFC4-E Distributed Forwarding Card 4 Rev. 1.2",
"name": "WS-F6K-DFC4-E Distributed Forwarding Card 4 EARL sub-module of 2",
"pid": "WS-F6K-DFC4-E",
"sn": "SAL171846RF",
"vid": "V02",
}
},
"1": {
"X2-10GB-SR": {
"descr": "X2 Transceiver 10Gbase-SR Te2/1",
"name": "Transceiver Te2/1",
"pid": "X2-10GB-SR",
"sn": "ONT17020338",
"vid": "V06 ",
}
},
"2": {
"X2-10GB-SR": {
"descr": "X2 Transceiver 10Gbase-SR Te2/2",
"name": "Transceiver Te2/2",
"pid": "X2-10GB-SR",
"sn": "ONT1702020H",
"vid": "V06 ",
}
},
"3": {
"X2-10GB-SR": {
"descr": "X2 Transceiver 10Gbase-SR Te2/3",
"name": "Transceiver Te2/3",
"pid": "X2-10GB-SR",
"sn": "ONT170202UU",
"vid": "V06 ",
}
},
"4": {
"X2-10GB-SR": {
"descr": "X2 Transceiver 10Gbase-SR Te2/4",
"name": "Transceiver Te2/4",
"pid": "X2-10GB-SR",
"sn": "ONT170202T5",
"vid": "V06 ",
}
},
"5": {
"X2-10GB-SR": {
"descr": "X2 Transceiver 10Gbase-SR Te2/5",
"name": "Transceiver Te2/5",
"pid": "X2-10GB-SR",
"sn": "AGA1515XZE2",
"vid": "V05 ",
}
},
"6": {
"X2-10GB-SR": {
"descr": "X2 Transceiver 10Gbase-SR Te2/6",
"name": "Transceiver Te2/6",
"pid": "X2-10GB-SR",
"sn": "FNS153920YJ",
"vid": "V06 ",
}
},
"16": {
"X2-10GB-SR": {
"descr": "X2 Transceiver 10Gbase-SR Te2/16",
"name": "Transceiver Te2/16",
"pid": "X2-10GB-SR",
"sn": "ONT170201TT",
"vid": "V06 ",
}
},
},
}
}
},
"3": {
"lc": {
"WS-X6824-SFP": {
"name": "3",
"descr": "WS-X6824-SFP CEF720 24 port 1000mb SFP Rev. 1.0",
"pid": "WS-X6824-SFP",
"vid": "V01",
"sn": "SAL17152EG9",
"subslot": {
"0": {
"WS-F6K-DFC4-A": {
"descr": "WS-F6K-DFC4-A Distributed Forwarding Card 4 Rev. 1.0",
"name": "WS-F6K-DFC4-A Distributed Forwarding Card 4 EARL sub-module of 3",
"pid": "WS-F6K-DFC4-A",
"sn": "SAL171848KL",
"vid": "V04",
}
}
},
}
}
},
"4": {
"lc": {
"WS-X6748-GE-TX": {
"name": "4",
"descr": "WS-X6748-GE-TX CEF720 48 port 10/100/1000mb Ethernet Rev. 3.4",
"pid": "WS-X6748-GE-TX",
"vid": "V04",
"sn": "SAL14017TWF",
"subslot": {
"0": {
"WS-F6700-CFC": {
"descr": "WS-F6700-CFC Centralized Forwarding Card Rev. 4.1",
"name": "WS-F6700-CFC Centralized Forwarding Card EARL sub-module of 4",
"pid": "WS-F6700-CFC",
"sn": "SAL13516QS8",
"vid": "V06",
}
}
},
}
}
},
},
}
golden_output_2 = {'execute.return_value': '''
NAME: "WS-C6504-E", DESCR: "Cisco Systems Cisco 6500 4-slot Chassis System"
PID: WS-C6504-E , VID: V01, SN: FXS1712Q1R8
NAME: "CLK-7600 1", DESCR: "OSR-7600 Clock FRU 1"
PID: CLK-7600 , VID: , SN: FXS170802GL
NAME: "CLK-7600 2", DESCR: "OSR-7600 Clock FRU 2"
PID: CLK-7600 , VID: , SN: FXS170802GL
NAME: "1", DESCR: "VS-SUP2T-10G 5 ports Supervisor Engine 2T 10GE w/ CTS Rev. 1.5"
PID: VS-SUP2T-10G , VID: V05, SN: SAL17152N0F
NAME: "msfc sub-module of 1", DESCR: "VS-F6K-MSFC5 CPU Daughterboard Rev. 2.0"
PID: VS-F6K-MSFC5 , VID: , SN: SAL17142D06
NAME: "VS-F6K-PFC4 Policy Feature Card 4 EARL sub-module of 1", DESCR: "VS-F6K-PFC4 Policy Feature Card 4 Rev. 2.0"
PID: VS-F6K-PFC4 , VID: V03, SN: SAL17163901
NAME: "Transceiver Te1/4", DESCR: "X2 Transceiver 10Gbase-SR Te1/4"
PID: X2-10GB-SR , VID: V06 , SN: ONT170202T1
NAME: "Transceiver Te1/5", DESCR: "X2 Transceiver 10Gbase-SR Te1/5"
PID: X2-10GB-SR , VID: V06 , SN: ONT1702033D
NAME: "2", DESCR: "WS-X6816-10GE CEF720 16 port 10GE Rev. 2.0"
PID: WS-X6816-10GE , VID: V02, SN: SAL17152QB3
NAME: "WS-F6K-DFC4-E Distributed Forwarding Card 4 EARL sub-module of 2", DESCR: "WS-F6K-DFC4-E Distributed Forwarding Card 4 Rev. 1.2"
PID: WS-F6K-DFC4-E , VID: V02, SN: SAL171846RF
NAME: "Transceiver Te2/1", DESCR: "X2 Transceiver 10Gbase-SR Te2/1"
PID: X2-10GB-SR , VID: V06 , SN: ONT17020338
NAME: "Transceiver Te2/2", DESCR: "X2 Transceiver 10Gbase-SR Te2/2"
PID: X2-10GB-SR , VID: V06 , SN: ONT1702020H
NAME: "Transceiver Te2/3", DESCR: "X2 Transceiver 10Gbase-SR Te2/3"
PID: X2-10GB-SR , VID: V06 , SN: ONT170202UU
NAME: "Transceiver Te2/4", DESCR: "X2 Transceiver 10Gbase-SR Te2/4"
PID: X2-10GB-SR , VID: V06 , SN: ONT170202T5
NAME: "Transceiver Te2/5", DESCR: "X2 Transceiver 10Gbase-SR Te2/5"
PID: X2-10GB-SR , VID: V05 , SN: AGA1515XZE2
NAME: "Transceiver Te2/6", DESCR: "X2 Transceiver 10Gbase-SR Te2/6"
PID: X2-10GB-SR , VID: V06 , SN: FNS153920YJ
NAME: "Transceiver Te2/16", DESCR: "X2 Transceiver 10Gbase-SR Te2/16"
PID: X2-10GB-SR , VID: V06 , SN: ONT170201TT
NAME: "3", DESCR: "WS-X6824-SFP CEF720 24 port 1000mb SFP Rev. 1.0"
PID: WS-X6824-SFP , VID: V01, SN: SAL17152EG9
NAME: "WS-F6K-DFC4-A Distributed Forwarding Card 4 EARL sub-module of 3", DESCR: "WS-F6K-DFC4-A Distributed Forwarding Card 4 Rev. 1.0"
PID: WS-F6K-DFC4-A , VID: V04, SN: SAL171848KL
NAME: "4", DESCR: "WS-X6748-GE-TX CEF720 48 port 10/100/1000mb Ethernet Rev. 3.4"
PID: WS-X6748-GE-TX , VID: V04, SN: SAL14017TWF
NAME: "WS-F6700-CFC Centralized Forwarding Card EARL sub-module of 4", DESCR: "WS-F6700-CFC Centralized Forwarding Card Rev. 4.1"
PID: WS-F6700-CFC , VID: V06, SN: SAL13516QS8
NAME: "FAN-MOD-4HS 1", DESCR: "High Speed Fan Module for CISCO7604 1"
PID: FAN-MOD-4HS , VID: V01, SN: DCH170900PF
NAME: "PS 1 PWR-2700-AC/4", DESCR: "2700W AC power supply for CISCO7604 1"
PID: PWR-2700-AC/4 , VID: V03, SN: APS1707008Y
NAME: "PS 2 PWR-2700-AC/4", DESCR: "2700W AC power supply for CISCO7604 2"
PID: PWR-2700-AC/4 , VID: V03, SN: APS17070093
'''}
golden_parsed_output_3 = {
"main": {
"chassis": {
"WS-C6503-E": {
"name": "WS-C6503-E",
"descr": "Cisco Systems Catalyst 6500 3-slot Chassis System",
"pid": "WS-C6503-E",
"vid": "V03",
"sn": "FXS1821Q2H9",
}
}
},
"slot": {
"CLK-7600 1": {
"other": {
"CLK-7600 1": {
"name": "CLK-7600 1",
"descr": "OSR-7600 Clock FRU 1",
"pid": "CLK-7600",
"vid": "",
"sn": "FXS181101V4",
}
}
},
"CLK-7600 2": {
"other": {
"CLK-7600 2": {
"name": "CLK-7600 2",
"descr": "OSR-7600 Clock FRU 2",
"pid": "CLK-7600",
"vid": "",
"sn": "FXS181101V4",
}
}
},
"1": {
"rp": {
"WS-SUP720-3BXL": {
"name": "1",
"descr": "WS-SUP720-3BXL 2 ports Supervisor Engine 720 Rev. 5.6",
"pid": "WS-SUP720-3BXL",
"vid": "V05",
"sn": "SAL11434P2C",
"subslot": {
"0": {
"WS-SUP720": {
"descr": "WS-SUP720 MSFC3 Daughterboard Rev. 3.1",
"name": "msfc sub-module of 1",
"pid": "WS-SUP720",
"sn": "SAL11434N9G",
"vid": "",
},
"WS-F6K-PFC3BXL": {
"descr": "WS-F6K-PFC3BXL Policy Feature Card 3 Rev. 1.8",
"name": "switching engine sub-module of 1",
"pid": "WS-F6K-PFC3BXL",
"sn": "SAL11434LYG",
"vid": "V01",
},
}
},
}
}
},
"2": {
"lc": {
"WS-X6748-GE-TX": {
"name": "2",
"descr": "WS-X6748-GE-TX CEF720 48 port 10/100/1000mb Ethernet Rev. 2.6",
"pid": "WS-X6748-GE-TX",
"vid": "V02",
"sn": "SAL1128UPQ9",
"subslot": {
"0": {
"WS-F6700-DFC3CXL": {
"descr": "WS-F6700-DFC3CXL Distributed Forwarding Card 3 Rev. 1.1",
"name": "switching engine sub-module of 2",
"pid": "WS-F6700-DFC3CXL",
"sn": "SAL1214LAG5",
"vid": "V01",
}
}
},
}
}
},
"WS-C6503-E-FAN 1": {
"other": {
"WS-C6503-E-FAN 1": {
"name": "WS-C6503-E-FAN 1",
"descr": "Enhanced 3-slot Fan Tray 1",
"pid": "WS-C6503-E-FAN",
"vid": "V02",
"sn": "DCH183500KW",
}
}
},
"PS 1 PWR-1400-AC": {
"other": {
"PS 1 PWR-1400-AC": {
"name": "PS 1 PWR-1400-AC",
"descr": "AC power supply, 1400 watt 1",
"pid": "PWR-1400-AC",
"vid": "V01",
"sn": "ABC0830J127",
}
}
},
},
}
golden_output_3 = {'execute.return_value': '''
# show inventory
NAME: "WS-C6503-E", DESCR: "Cisco Systems Catalyst 6500 3-slot Chassis System"
PID: WS-C6503-E , VID: V03, SN: FXS1821Q2H9
NAME: "CLK-7600 1", DESCR: "OSR-7600 Clock FRU 1"
PID: CLK-7600 , VID: , SN: FXS181101V4
NAME: "CLK-7600 2", DESCR: "OSR-7600 Clock FRU 2"
PID: CLK-7600 , VID: , SN: FXS181101V4
NAME: "1", DESCR: "WS-SUP720-3BXL 2 ports Supervisor Engine 720 Rev. 5.6"
PID: WS-SUP720-3BXL , VID: V05, SN: SAL11434P2C
NAME: "msfc sub-module of 1", DESCR: "WS-SUP720 MSFC3 Daughterboard Rev. 3.1"
PID: WS-SUP720 , VID: , SN: SAL11434N9G
NAME: "switching engine sub-module of 1", DESCR: "WS-F6K-PFC3BXL Policy Feature Card 3 Rev. 1.8"
PID: WS-F6K-PFC3BXL , VID: V01, SN: SAL11434LYG
NAME: "2", DESCR: "WS-X6748-GE-TX CEF720 48 port 10/100/1000mb Ethernet Rev. 2.6"
PID: WS-X6748-GE-TX , VID: V02, SN: SAL1128UPQ9
NAME: "switching engine sub-module of 2", DESCR: "WS-F6700-DFC3CXL Distributed Forwarding Card 3 Rev. 1.1"
PID: WS-F6700-DFC3CXL , VID: V01, SN: SAL1214LAG5
NAME: "WS-C6503-E-FAN 1", DESCR: "Enhanced 3-slot Fan Tray 1"
PID: WS-C6503-E-FAN , VID: V02, SN: DCH183500KW
NAME: "PS 1 PWR-1400-AC", DESCR: "AC power supply, 1400 watt 1"
PID: PWR-1400-AC , VID: V01, SN: ABC0830J127
'''}
golden_output_4 = {'execute.return_value': '''
NAME: "1", DESCR: "WS-C8888X-88"
PID: WS-C0123X-45T-S , VID: V00 , SN: FDO123R12W
NAME: "Switch 1 - Power Supply 1", DESCR: "ABC Power Supply"
PID: C3KX-PWR-350WAC , VID: V01D , SN: DTN1504L0E9
NAME: "TenGigabitEthernet1/1/1", DESCR: "SFP-10GBase-SR"
PID: SFP-10G-SR , VID: V03 , SN: SPC1519005V
NAME: "2", DESCR: "WS-C3210X-48"
PID: WS-C3210X-48T-S , VID: V02 , SN: FD5678Z90P
NAME: "Switch 2 - Power Supply 1", DESCR: "BCA Power Supply"
PID: C3KX-PWR-007CBA , VID: V01L , SN: LTP13579L3R
NAME: "TenGigabitEthernet2/1/1", DESCR: "SFP-10GBase-LR"
PID: SFP-10G-LR , VID: V02 , SN: ONT182746GZ
NAME: "1", DESCR: "WS-C1010XR-48FPS-I"
PID: WS-C1010XR-48FPS-I, VID: V05 , SN: FD2043B0K3
NAME: "Switch 1 - Power Supply 1", DESCR: "LLL Power Supply"
PID: PWR-C2-2929WAC , VID: V02L , SN: LIT03728KKK
NAME: "Switch 1 - FlexStackPlus Module", DESCR: "Stacking Module"
PID: C1010X-STACK , VID: V02 , SN: FD232323XXZ
NAME: "GigabitEthernet1/0/49", DESCR: "1000BaseSX SFP"
PID: GLC-SX-MMD , VID: V01 , SN: ACW102938VS
'''}
golden_parsed_output_4 = {
'slot': {
'1': {
'rp': {
'WS-C0123X-45T-S': {
'descr': 'WS-C8888X-88',
'name': '1',
'pid': 'WS-C0123X-45T-S',
'sn': 'FDO123R12W',
'subslot': {
'1': {
'C3KX-PWR-350WAC': {
'descr': 'ABC Power Supply',
'name': 'Switch 1 - Power Supply 1',
'pid': 'C3KX-PWR-350WAC',
'sn': 'DTN1504L0E9',
'vid': 'V01D ',
},
},
'1/1/1': {
'SFP-10G-SR': {
'descr': 'SFP-10GBase-SR',
'name': 'TenGigabitEthernet1/1/1',
'pid': 'SFP-10G-SR',
'sn': 'SPC1519005V',
'vid': 'V03 ',
},
},
},
'vid': 'V00 ',
},
'WS-C1010XR-48FPS-I': {
'descr': 'WS-C1010XR-48FPS-I',
'name': '1',
'pid': 'WS-C1010XR-48FPS-I',
'sn': 'FD2043B0K3',
'subslot': {
'1': {
'C1010X-STACK': {
'descr': 'Stacking Module',
'name': 'Switch 1 - FlexStackPlus Module',
'pid': 'C1010X-STACK',
'sn': 'FD232323XXZ',
'vid': 'V02 ',
},
'PWR-C2-2929WAC': {
'descr': 'LLL Power Supply',
'name': 'Switch 1 - Power Supply 1',
'pid': 'PWR-C2-2929WAC',
'sn': 'LIT03728KKK',
'vid': 'V02L ',
},
},
'1/0/49': {
'GLC-SX-MMD': {
'descr': '1000BaseSX SFP',
'name': 'GigabitEthernet1/0/49',
'pid': 'GLC-SX-MMD',
'sn': 'ACW102938VS',
'vid': 'V01 ',
},
},
},
'vid': 'V05 ',
},
},
},
'2': {
'rp': {
'WS-C3210X-48T-S': {
'descr': 'WS-C3210X-48',
'name': '2',
'pid': 'WS-C3210X-48T-S',
'sn': 'FD5678Z90P',
'subslot': {
'2': {
'C3KX-PWR-007CBA': {
'descr': 'BCA Power Supply',
'name': 'Switch 2 - Power Supply 1',
'pid': 'C3KX-PWR-007CBA',
'sn': 'LTP13579L3R',
'vid': 'V01L ',
},
},
'2/1/1': {
'SFP-10G-LR': {
'descr': 'SFP-10GBase-LR',
'name': 'TenGigabitEthernet2/1/1',
'pid': 'SFP-10G-LR',
'sn': 'ONT182746GZ',
'vid': 'V02 ',
},
},
},
'vid': 'V02 ',
},
},
},
},
}
golden_output_5 = {'execute.return_value': '''
best-c3945-IOS3#show inventory
NAME: "CISCO3945-CHASSIS", DESCR: "CISCO3945-CHASSIS"
PID: CISCO3945-CHASSIS , VID: V05 , SN: FGL161010K8
NAME: "Cisco Services Performance Engine 150 for Cisco 3900 ISR on Slot 0", DESCR: "Cisco Services Performance Engine 150 for Cisco 3900 ISR"
PID: C3900-SPE150/K9 , VID: V05 , SN: FOC16050QP6
NAME: "Two-Port Fast Ethernet High Speed WAN Interface Card on Slot 0 SubSlot 3", DESCR: "Two-Port Fast Ethernet High Speed WAN Interface Card"
PID: HWIC-2FE , VID: V02 , SN: FOC16062824
NAME: "C3900 AC Power Supply 1", DESCR: "C3900 AC Power Supply 1"
PID: PWR-3900-AC , VID: V03 , SN: QCS1604P0BT
'''}
golden_parsed_output_5 = {
'main': {
'chassis': {
'CISCO3945-CHASSIS': {
'descr': 'CISCO3945-CHASSIS',
'name': 'CISCO3945-CHASSIS',
'pid': 'CISCO3945-CHASSIS',
'sn': 'FGL161010K8',
'vid': 'V05 ',
},
},
},
'slot': {
'0': {
'rp': {
'C3900-SPE150/K9': {
'descr': 'Cisco Services Performance Engine 150 for Cisco 3900 ISR',
'name': 'Cisco Services Performance Engine 150 for Cisco 3900 ISR on Slot 0',
'pid': 'C3900-SPE150/K9',
'sn': 'FOC16050QP6',
'subslot': {
'3': {
'HWIC-2FE': {
'descr': 'Two-Port Fast Ethernet High Speed WAN Interface Card',
'name': 'Two-Port Fast Ethernet High Speed WAN Interface Card on Slot 0 SubSlot 3',
'pid': 'HWIC-2FE',
'sn': 'FOC16062824',
'vid': 'V02 ',
},
},
},
'vid': 'V05 ',
},
},
},
'C3900 AC Power Supply 1': {
'other': {
'C3900 AC Power Supply 1': {
'descr': 'C3900 AC Power Supply 1',
'name': 'C3900 AC Power Supply 1',
'pid': 'PWR-3900-AC',
'sn': 'QCS1604P0BT',
'vid': 'V03 ',
},
},
},
},
}
golden_output_6 = {'execute.return_value': '''
NAME: "1", DESCR: "SM-ES2-16-P"
PID: SM-ES2-16-P , VID: , SN: FOC09876NP3
'''}
golden_parsed_output_6 = {
'slot': {
'1': {
'lc': {
'SM-ES2-16-P': {
'descr': 'SM-ES2-16-P',
'name': '1',
'pid': 'SM-ES2-16-P',
'sn': 'FOC09876NP3',
'vid': '',
},
},
},
},
}
golden_output_7 = {'execute.return_value': '''
NAME: "2821 chassis", DESCR: "2821 chassis"
PID: CISCO2821 , VID: V07 , SN: FTX1234AMWT
NAME: "VWIC2-2MFT-T1/E1 - 2-Port RJ-48 Multiflex Trunk - T1/E1 on Slot 0 SubSlot 0", DESCR: "VWIC2-2MFT-T1/E1 - 2-Port RJ-48 Multiflex Trunk - T1/E1"
PID: VWIC2-2MFT-T1/E1 , VID: V01 , SN: FOC98675U0D
NAME: "VWIC2-2MFT-T1/E1 - 2-Port RJ-48 Multiflex Trunk - T1/E1 on Slot 0 SubSlot 1", DESCR: "VWIC2-2MFT-T1/E1 - 2-Port RJ-48 Multiflex Trunk - T1/E1"
PID: VWIC2-2MFT-T1/E1 , VID: V01 , SN: FOC98675W3E
NAME: "Virtual Private Network (VPN) Module on Slot 0", DESCR: "Encryption AIM Element"
PID: AIM-VPN/SSL-2 , VID: V01, SN: FOC2837465E
'''}
golden_parsed_output_7 = {
'main': {
'chassis': {
'CISCO2821': {
'descr': '2821 chassis',
'name': '2821 chassis',
'pid': 'CISCO2821',
'sn': 'FTX1234AMWT',
'vid': 'V07 ',
},
},
},
'slot': {
'0': {
'other': {
'AIM-VPN/SSL-2': {
'descr': 'Encryption AIM Element',
'name': 'Virtual Private Network (VPN) Module on Slot 0',
'pid': 'AIM-VPN/SSL-2',
'sn': 'FOC2837465E',
'vid': 'V01',
'subslot': {
'0': {
'VWIC2-2MFT-T1/E1': {
'descr': 'VWIC2-2MFT-T1/E1 - 2-Port RJ-48 Multiflex Trunk - T1/E1',
'name': 'VWIC2-2MFT-T1/E1 - 2-Port RJ-48 Multiflex Trunk - T1/E1 on Slot 0 SubSlot 0',
'pid': 'VWIC2-2MFT-T1/E1',
'sn': 'FOC98675U0D',
'vid': 'V01 ',
},
},
'1': {
'VWIC2-2MFT-T1/E1': {
'descr': 'VWIC2-2MFT-T1/E1 - 2-Port RJ-48 Multiflex Trunk - T1/E1',
'name': 'VWIC2-2MFT-T1/E1 - 2-Port RJ-48 Multiflex Trunk - T1/E1 on Slot 0 SubSlot 1',
'pid': 'VWIC2-2MFT-T1/E1',
'sn': 'FOC98675W3E',
'vid': 'V01 ',
},
},
},
},
},
},
},
}
golden_output_8 = {'execute.return_value': '''
NAME: "3825 chassis", DESCR: "3825 chassis"
PID: CISCO3825 , VID: V05 , SN: FTX7908A3RQ
NAME: "VWIC2-2MFT-T1/E1 - 2-Port RJ-48 Multiflex Trunk - T1/E1 on Slot 0 SubSlot 0", DESCR: "VWIC2-2MFT-T1/E1 - 2-Port RJ-48 Multiflex Trunk - T1/E1"
PID: VWIC2-2MFT-T1/E1 , VID: V01 , SN: FOC65428K9F
NAME: "Wan Interface Card BRI U (2091, 3086) on Slot 0 SubSlot 1", DESCR: "Wan Interface Card BRI U (2091, 3086)"
PID: WIC-1B-U-V2 , VID: V01, SN: 10293847
NAME: "PVDMII DSP SIMM with four DSPs on Slot 0 SubSlot 4", DESCR: "PVDMII DSP SIMM with four DSPs"
PID: PVDM2-64 , VID: V01 , SN: FOC63358WSI
NAME: "High Density Voice Module - 8FXS/DID on Slot 1", DESCR: "High Density Voice Module - 8FXS/DID"
PID: EVM-HD-8FXS/DID , VID: V04 , SN: FOC65798TG8
NAME: "Six port FXO voice interface daughtercard on Slot 1 SubSlot 1", DESCR: "Six port FXO voice interface daughtercard"
PID: EM-HDA-6FXO , VID: V03 , SN: FOC85389QXB
'''}
golden_parsed_output_8 = {
'main': {
'chassis': {
'CISCO3825': {
'descr': '3825 chassis',
'name': '3825 chassis',
'pid': 'CISCO3825',
'sn': 'FTX7908A3RQ',
'vid': 'V05 ',
},
},
},
'slot': {
'0': {
'rp': {
'CISCO3825': {
'subslot': {
'0': {
'VWIC2-2MFT-T1/E1': {
'descr': 'VWIC2-2MFT-T1/E1 - 2-Port RJ-48 Multiflex Trunk - T1/E1',
'name': 'VWIC2-2MFT-T1/E1 - 2-Port RJ-48 Multiflex Trunk - T1/E1 on Slot 0 SubSlot 0',
'pid': 'VWIC2-2MFT-T1/E1',
'sn': 'FOC65428K9F',
'vid': 'V01 ',
},
},
'1': {
'WIC-1B-U-V2': {
'descr': 'Wan Interface Card BRI U (2091, 3086)',
'name': 'Wan Interface Card BRI U (2091, 3086) on Slot 0 SubSlot 1',
'pid': 'WIC-1B-U-V2',
'sn': '10293847',
'vid': 'V01',
},
},
'4': {
'PVDM2-64': {
'descr': 'PVDMII DSP SIMM with four DSPs',
'name': 'PVDMII DSP SIMM with four DSPs on Slot 0 SubSlot 4',
'pid': 'PVDM2-64',
'sn': 'FOC63358WSI',
'vid': 'V01 ',
},
},
},
},
},
},
'1': {
'other': {
'EVM-HD-8FXS/DID': {
'descr': 'High Density Voice Module - 8FXS/DID',
'name': 'High Density Voice Module - 8FXS/DID on Slot 1',
'pid': 'EVM-HD-8FXS/DID',
'sn': 'FOC65798TG8',
'subslot': {
'1': {
'EM-HDA-6FXO': {
'descr': 'Six port FXO voice interface daughtercard',
'name': 'Six port FXO voice interface daughtercard on Slot 1 SubSlot 1',
'pid': 'EM-HDA-6FXO',
'sn': 'FOC85389QXB',
'vid': 'V03 ',
},
},
},
'vid': 'V04 ',
},
},
},
},
}
golden_output_9 = {'execute.return_value': '''
NAME: "3845 chassis", DESCR: "3845 chassis"
PID: CISCO3845 , VID: V05 , SN: FTX6666ARJ9
NAME: "c3845 Motherboard with Gigabit Ethernet on Slot 0", DESCR: "c3845 Motherboard with Gigabit Ethernet"
PID: CISCO3845-MB , VID: V09 , SN: FOC729346GQ
NAME: "Virtual Private Network (VPN) Module on Slot 0", DESCR: "Encryption AIM Element"
PID: AIM-VPN/SSL-3 , VID: V01, SN: FOC758693YO
NAME: "Clear/Subrate T3/E3 WAN on Slot 1", DESCR: "Clear/Subrate T3/E3 WAN"
PID: NM-1T3/E3= , VID: V01 , SN: FOC28476ADM
NAME: "16 Port 10BaseT/100BaseTX EtherSwitch on Slot 2", DESCR: "16 Port 10BaseT/100BaseTX EtherSwitch"
PID: NM-16ESW , VID: V01 , SN: FOC135464KO
NAME: "Gigabit(1000BaseT) module for EtherSwitch NM on Slot 2 SubSlot 0", DESCR: "Gigabit(1000BaseT) module for EtherSwitch NM"
PID: GE-DCARD-ESW , VID: V01 , SN: FOC91864MNN
'''}
golden_parsed_output_9 = {
'main': {
'chassis': {
'CISCO3845': {
'descr': '3845 chassis',
'name': '3845 chassis',
'pid': 'CISCO3845',
'sn': 'FTX6666ARJ9',
'vid': 'V05 ',
},
},
},
'slot': {
'0': {
'lc': {
'CISCO3845-MB': {
'descr': 'c3845 Motherboard with Gigabit Ethernet',
'name': 'c3845 Motherboard with Gigabit Ethernet on Slot 0',
'pid': 'CISCO3845-MB',
'sn': 'FOC729346GQ',
'vid': 'V09 ',
},
},
'other': {
'AIM-VPN/SSL-3': {
'descr': 'Encryption AIM Element',
'name': 'Virtual Private Network (VPN) Module on Slot 0',
'pid': 'AIM-VPN/SSL-3',
'sn': 'FOC758693YO',
'vid': 'V01',
},
},
},
'1': {
'lc': {
'NM-1T3/E3=': {
'descr': 'Clear/Subrate T3/E3 WAN',
'name': 'Clear/Subrate T3/E3 WAN on Slot 1',
'pid': 'NM-1T3/E3=',
'sn': 'FOC28476ADM',
'vid': 'V01 ',
},
},
},
'16': {
'lc': {
'NM-16ESW': {
'descr': '16 Port 10BaseT/100BaseTX EtherSwitch',
'name': '16 Port 10BaseT/100BaseTX EtherSwitch on Slot 2',
'pid': 'NM-16ESW',
'sn': 'FOC135464KO',
'subslot': {
'0': {
'GE-DCARD-ESW': {
'descr': 'Gigabit(1000BaseT) module for EtherSwitch NM',
'name': 'Gigabit(1000BaseT) module for EtherSwitch NM on Slot 2 SubSlot 0',
'pid': 'GE-DCARD-ESW',
'sn': 'FOC91864MNN',
'vid': 'V01 ',
},
},
},
'vid': 'V01 ',
},
},
},
},
}
def test_empty(self):
self.dev1 = Mock(**self.empty_output)
inventory_obj = ShowInventory(device=self.dev1)
with self.assertRaises(SchemaEmptyParserError):
parsed_output = inventory_obj.parse()
def test_golden_iosv(self):
self.maxDiff = None
self.dev_iosv = Mock(**self.golden_output_iosv)
inventory_obj = ShowInventory(device=self.dev_iosv)
parsed_output = inventory_obj.parse()
self.assertEqual(parsed_output, self.golden_parsed_output_iosv)
def test_golden_output_2(self):
self.maxDiff = None
self.device = Mock(**self.golden_output_2)
obj = ShowInventory(device=self.device)
parsed_output = obj.parse()
self.assertEqual(parsed_output, self.golden_parsed_output_2)
def test_golden_output_3(self):
self.maxDiff = None
self.device = Mock(**self.golden_output_3)
obj = ShowInventory(device=self.device)
parsed_output = obj.parse()
self.assertEqual(parsed_output, self.golden_parsed_output_3)
def test_golden_output_4(self):
self.maxDiff = None
self.device = Mock(**self.golden_output_4)
obj = ShowInventory(device=self.device)
parsed_output = obj.parse()
self.assertEqual(parsed_output, self.golden_parsed_output_4)
def test_golden_output_5(self):
self.maxDiff = None
self.device = Mock(**self.golden_output_5)
obj = ShowInventory(device=self.device)
parsed_output = obj.parse()
self.assertEqual(parsed_output, self.golden_parsed_output_5)
def test_golden_output_6(self):
self.maxDiff = None
self.device = Mock(**self.golden_output_6)
obj = ShowInventory(device=self.device)
parsed_output = obj.parse()
self.assertEqual(parsed_output, self.golden_parsed_output_6)
def test_golden_output_7(self):
self.maxDiff = None
self.device = Mock(**self.golden_output_7)
obj = ShowInventory(device=self.device)
parsed_output = obj.parse()
self.assertEqual(parsed_output, self.golden_parsed_output_7)
def test_golden_output_8(self):
self.maxDiff = None
self.device = Mock(**self.golden_output_8)
obj = ShowInventory(device=self.device)
parsed_output = obj.parse()
self.assertEqual(parsed_output, self.golden_parsed_output_8)
def test_golden_output_9(self):
self.maxDiff = None
self.device = Mock(**self.golden_output_9)
obj = ShowInventory(device=self.device)
parsed_output = obj.parse()
self.assertEqual(parsed_output, self.golden_parsed_output_9)
class test_show_bootvar(unittest.TestCase):
dev = Device(name='ios')
dev_iosv = Device(name='iosv')
empty_output = {'execute.return_value': ''}
golden_parsed_output_iosv = {
"active": {
"boot_variable": "disk0:s72033-adventerprisek9-mz.122-33.SRE0a-ssr-nxos-76k-1,12",
"configuration_register": "0x2012"
},
"next_reload_boot_variable": "disk0:s72033-adventerprisek9-mz.122-33.SRE0a-ssr-nxos-76k-1,12"
}
golden_output_iosv = {'execute.return_value': '''\
BOOT variable = disk0:s72033-adventerprisek9-mz.122-33.SRE0a-ssr-nxos-76k-1,12;
CONFIG_FILE variable =
BOOTLDR variable =
Configuration register is 0x2012
Standby not ready to show bootvar
'''}
def test_empty(self):
self.dev = Mock(**self.empty_output)
platform_obj = ShowBootvar(device=self.dev)
with self.assertRaises(SchemaEmptyParserError):
parsed_output = platform_obj.parse()
def test_golden(self):
self.maxDiff = None
self.dev_iosv = Mock(**self.golden_output_iosv)
platform_obj = ShowBootvar(device=self.dev_iosv)
parsed_output = platform_obj.parse()
self.assertEqual(parsed_output, self.golden_parsed_output_iosv)
class test_show_processes_cpu_sorted_CPU(unittest.TestCase):
dev = Device(name='c3850')
empty_output = {'execute.return_value': ''}
golden_parsed_output = {
"five_sec_cpu_total": 13,
"five_min_cpu": 15,
"one_min_cpu": 23,
"five_sec_cpu_interrupts": 0
}
golden_output = {'execute.return_value': '''\
show processes cpu sorted 5min | inc CPU
CPU utilization for five seconds: 13%/0%; one minute: 23%; five minutes: 15%
'''}
golden_parsed_output_1 = {
"sort": {
1: {
"invoked": 3321960,
"usecs": 109,
"tty": 0,
"one_min_cpu": 0.54,
"process": "PIM Process",
"five_min_cpu": 0.48,
"runtime": 362874,
"pid": 368,
"five_sec_cpu": 1.03
},
2: {
"invoked": 1466728,
"usecs": 2442,
"tty": 0,
"one_min_cpu": 0.87,
"process": "IOSv e1000",
"five_min_cpu": 2.77,
"runtime": 3582279,
"pid": 84,
"five_sec_cpu": 0.55
},
3: {
"invoked": 116196,
"usecs": 976,
"tty": 0,
"one_min_cpu": 0.07,
"process": "OSPF-1 Hello",
"five_min_cpu": 0.07,
"runtime": 113457,
"pid": 412,
"five_sec_cpu": 0.15
}
},
"five_sec_cpu_total": 4,
"five_min_cpu": 9,
"one_min_cpu": 4,
"nonzero_cpu_processes": [
"PIM Process",
"IOSv e1000",
"OSPF-1 Hello"
],
"five_sec_cpu_interrupts": 0
}
golden_output_1 = {'execute.return_value': '''
CPU utilization for five seconds: 4%/0%; one minute: 4%; five minutes: 9%
PID Runtime(ms) Invoked uSecs 5Sec 1Min 5Min TTY Process
368 362874 3321960 109 1.03% 0.54% 0.48% 0 PIM Process
84 3582279 1466728 2442 0.55% 0.87% 2.77% 0 IOSv e1000
412 113457 116196 976 0.15% 0.07% 0.07% 0 OSPF-1 Hello
'''}
def test_empty(self):
self.dev = Mock(**self.empty_output)
obj = ShowProcessesCpuSorted(device=self.dev)
with self.assertRaises(SchemaEmptyParserError):
parsered_output = obj.parse()
def test_golden(self):
self.maxDiff = None
self.dev = Mock(**self.golden_output)
obj = ShowProcessesCpuSorted(device=self.dev)
parsed_output = obj.parse(key_word='CPU', sort_time='5min')
self.assertEqual(parsed_output, self.golden_parsed_output)
def test_golden_1(self):
self.maxDiff = None
self.dev = Mock(**self.golden_output_1)
obj = ShowProcessesCpuSorted(device=self.dev)
parsed_output = obj.parse()
self.assertEqual(parsed_output, self.golden_parsed_output_1)
class test_show_processes_cpu(test_show_processes_cpu_iosxe):
def test_golden(self):
self.device = Mock(**self.golden_output)
obj = ShowProcessesCpu(device=self.device)
parsed_output = obj.parse()
self.maxDiff = None
self.assertEqual(parsed_output, self.golden_parsed_output)
def test_golden_1(self):
self.maxDiff = None
self.device = Mock(**self.golden_output_1)
obj = ShowProcessesCpu(device=self.device)
parsed_output = obj.parse(key_word='process')
self.assertEqual(parsed_output, self.golden_parsed_output_1)
def test_empty(self):
self.device1 = Mock(**self.empty_output)
obj = ShowProcessesCpu(device=self.device1)
with self.assertRaises(SchemaEmptyParserError):
parsed_output = obj.parse()
class test_show_version_rp(test_show_version_rp_iosxe):
def test_golden_active(self):
self.device = Mock(**self.golden_output_active)
obj = ShowVersionRp(device=self.device)
parsed_output = obj.parse(rp='active', status='running')
self.maxDiff = None
self.assertEqual(parsed_output, self.golden_parsed_output_active)
def test_golden_standby(self):
self.device = Mock(**self.golden_output_standby)
obj = ShowVersionRp(device=self.device)
parsed_output = obj.parse(rp='standby', status='running')
self.maxDiff = None
self.assertEqual(parsed_output, self.golden_parsed_output_standby)
def test_golden_standby_offline(self):
self.device = Mock(**self.golden_output_standby_offline)
obj = ShowVersionRp(device=self.device)
self.maxDiff = None
with self.assertRaises(SchemaEmptyParserError):
parsed_output = obj.parse(rp='standby', status='running')
def test_empty(self):
self.device1 = Mock(**self.empty_output)
obj = ShowVersionRp(device=self.device1)
with self.assertRaises(SchemaEmptyParserError):
parsed_output = obj.parse()
class test_show_platform(test_show_platform_iosxe):
def test_empty(self):
self.dev1 = Mock(**self.empty_output)
platform_obj = ShowPlatform(device=self.dev1)
with self.assertRaises(SchemaEmptyParserError):
parsed_output = platform_obj.parse()
def test_semi_empty(self):
self.dev2 = Mock(**self.semi_empty_output)
platform_obj = ShowPlatform(device=self.dev2)
with self.assertRaises(SchemaEmptyParserError):
parsed_output = platform_obj.parse()
def test_golden_c3850(self):
self.maxDiff = None
self.dev_c3850 = Mock(**self.golden_output_c3850)
platform_obj = ShowPlatform(device=self.dev_c3850)
parsed_output = platform_obj.parse()
self.assertEqual(parsed_output, self.golden_parsed_output_c3850)
def test_golden_asr1k(self):
self.maxDiff = None
self.dev_asr1k = Mock(**self.golden_output_asr1k)
platform_obj = ShowPlatform(device=self.dev_asr1k)
parsed_output = platform_obj.parse()
self.assertEqual(parsed_output, self.golden_parsed_output_asr1k)
class test_show_platform_power(test_show_platform_power_iosxe):
def test_empty(self):
self.device = Mock(**self.empty_output)
platform_obj = ShowPlatformPower(device=self.device)
with self.assertRaises(SchemaEmptyParserError):
parsed_output = platform_obj.parse()
def test_golden(self):
self.maxDiff = None
self.device = Mock(**self.golden_output)
platform_obj = ShowPlatformPower(device=self.device)
parsed_output = platform_obj.parse()
self.assertEqual(parsed_output, self.golden_parsed_output)
class test_show_processes_cpu_history(test_show_processes_cpu_history_iosxe):
def test_empty(self):
self.device = Mock(**self.empty_output)
platform_obj = ShowProcessesCpuHistory(device=self.device)
with self.assertRaises(SchemaEmptyParserError):
parsed_output = platform_obj.parse()
def test_golden(self):
self.maxDiff = None
self.device = Mock(**self.golden_output)
platform_obj = ShowProcessesCpuHistory(device=self.device)
parsed_output = platform_obj.parse()
self.assertEqual(parsed_output, self.golden_parsed_output)
class test_show_processes_cpu_platform(test_show_processes_cpu_platform_iosxe):
def test_golden(self):
self.device = Mock(**self.golden_output)
cpu_platform_obj = ShowProcessesCpuPlatform(device=self.device)
parsed_output = cpu_platform_obj.parse()
self.maxDiff = None
self.assertEqual(parsed_output, self.golden_parsed_output)
def test_empty(self):
self.device1 = Mock(**self.empty_output)
cpu_platform_obj = ShowProcessesCpuPlatform(device=self.device1)
with self.assertRaises(SchemaEmptyParserError):
parsed_output = cpu_platform_obj.parse()
class test_show_platform_software_status_control_processor_brief(test_show_platform_software_status_control_processor_brief_iosxe):
def test_empty(self):
self.dev = Mock(**self.empty_output)
obj = ShowPlatformSoftwareStatusControl(device=self.dev)
with self.assertRaises(SchemaEmptyParserError):
parsered_output = obj.parse()
def test_golden(self):
self.maxDiff = None
self.dev = Mock(**self.golden_output)
obj = ShowPlatformSoftwareStatusControl(device=self.dev)
parsed_output = obj.parse()
self.assertEqual(parsed_output, self.golden_parsed_output)
class test_show_platform_software_slot_active_monitor_Mem(test_show_platform_software_slot_active_monitor_Mem_iosxe):
def test_empty(self):
self.dev = Mock(**self.empty_output)
obj = ShowPlatformSoftwareSlotActiveMonitorMem(device=self.dev)
with self.assertRaises(SchemaEmptyParserError):
parsered_output = obj.parse()
def test_golden(self):
self.maxDiff = None
self.dev = Mock(**self.golden_output)
obj = ShowPlatformSoftwareSlotActiveMonitorMem(device=self.dev)
parsed_output = obj.parse()
self.assertEqual(parsed_output, self.golden_parsed_output)
class test_show_platform_hardware(test_show_platform_hardware_iosxe):
def test_golden_active(self):
self.device = Mock(**self.golden_output_active)
obj = ShowPlatformHardware(device=self.device)
parsed_output = obj.parse()
self.maxDiff = None
self.assertEqual(parsed_output, self.golden_parsed_output_active)
def test_empty(self):
self.device1 = Mock(**self.empty_output)
obj = ShowPlatformHardware(device=self.device1)
with self.assertRaises(SchemaEmptyParserError):
parsed_output = obj.parse()
class test_show_platform_hardware_plim(test_show_platform_hardware_plim_iosxe):
def test_golden_port(self):
self.device = Mock(**self.golden_output_port)
obj = ShowPlatformHardwarePlim(device=self.device)
parsed_output = obj.parse(port='0/0/0')
self.maxDiff = None
self.assertEqual(parsed_output, self.golden_parsed_output_port)
def test_golden_slot(self):
self.device = Mock(**self.golden_output_slot)
obj = ShowPlatformHardwarePlim(device=self.device)
parsed_output = obj.parse(slot='0')
self.maxDiff = None
self.assertEqual(parsed_output, self.golden_parsed_output_slot)
def test_golden_subslot(self):
self.device = Mock(**self.golden_output_subslot)
obj = ShowPlatformHardwarePlim(device=self.device)
parsed_output = obj.parse(subslot='0/1')
self.maxDiff = None
self.assertEqual(parsed_output, self.golden_parsed_output_subslot)
def test_golden_slot_internal(self):
self.device = Mock(**self.golden_output_slot_internal)
obj = ShowPlatformHardwarePlim(device=self.device)
parsed_output = obj.parse(slot='0', internal=True)
self.maxDiff = None
self.assertEqual(
parsed_output, self.golden_parsed_output_slot_internal)
def test_empty(self):
self.device1 = Mock(**self.empty_output)
obj = ShowPlatformHardwarePlim(device=self.device1)
with self.assertRaises(SchemaEmptyParserError):
parsed_output = obj.parse(port='0/0/0')
class test_show_platform_hardware_qfp_bqs_opm_mapping(test_show_platform_hardware_qfp_bqs_opm_mapping_iosxe):
def test_golden_active_opm(self):
self.device = Mock(**self.golden_output_active_opm)
obj = ShowPlatformHardwareQfpBqsOpmMapping(device=self.device)
parsed_output = obj.parse(status='active', slot='0')
self.maxDiff = None
self.assertEqual(parsed_output, self.golden_parsed_output_active_opm)
def test_empty(self):
self.device1 = Mock(**self.empty_output)
obj = ShowPlatformHardwareQfpBqsOpmMapping(device=self.device1)
with self.assertRaises(SchemaEmptyParserError):
parsed_output = obj.parse(status='active', slot='0')
class test_show_platform_hardware_qfp_bqs_ipm_mapping(test_show_platform_hardware_qfp_bqs_ipm_mapping_iosxe):
def test_golden_active_ipm(self):
self.device = Mock(**self.golden_output_active_ipm)
obj = ShowPlatformHardwareQfpBqsIpmMapping(device=self.device)
parsed_output = obj.parse(status='active', slot='0')
self.maxDiff = None
self.assertEqual(parsed_output, self.golden_parsed_output_active_ipm)
def test_empty(self):
self.device1 = Mock(**self.empty_output)
obj = ShowPlatformHardwareQfpBqsIpmMapping(device=self.device1)
with self.assertRaises(SchemaEmptyParserError):
parsed_output = obj.parse(status='active', slot='0')
class test_show_platform_hardware_serdes_statistics(test_show_platform_hardware_serdes_statistics_iosxe):
def test_golden_serdes(self):
self.device = Mock(**self.golden_output_serdes)
obj = ShowPlatformHardwareSerdes(device=self.device)
parsed_output = obj.parse(slot='0')
self.maxDiff = None
self.assertEqual(parsed_output, self.golden_parsed_output_serdes)
def test_empty(self):
self.device1 = Mock(**self.empty_output)
obj = ShowPlatformHardwareSerdes(device=self.device1)
with self.assertRaises(SchemaEmptyParserError):
parsed_output = obj.parse(slot='0')
class test_show_platform_hardware_serdes_statistics_internal(test_show_platform_hardware_serdes_statistics_internal_iosxe):
def test_golden(self):
self.device = Mock(**self.golden_output_serdes_internal)
obj = ShowPlatformHardwareSerdesInternal(device=self.device)
parsed_output = obj.parse(slot='0')
self.maxDiff = None
self.assertEqual(
parsed_output, self.golden_parsed_output_serdes_internal)
def test_empty(self):
self.device1 = Mock(**self.empty_output)
obj = ShowPlatformHardwareSerdesInternal(device=self.device1)
with self.assertRaises(SchemaEmptyParserError):
parsed_output = obj.parse(slot='0')
class show_platform_hardware_qfp_bqs_statistics_channel_all(show_platform_hardware_qfp_bqs_statistics_channel_all_iosxe):
def test_empty(self):
self.device = Mock(**self.empty_output)
platform_obj = ShowPlatformHardwareQfpBqsStatisticsChannelAll(
device=self.device)
with self.assertRaises(SchemaEmptyParserError):
parsed_output = platform_obj.parse(
status='active', slot='0', iotype='ipm')
def test_golden_active_ipm(self):
self.maxDiff = None
self.device = Mock(**self.golden_output_active_ipm)
platform_obj = ShowPlatformHardwareQfpBqsStatisticsChannelAll(
device=self.device)
parsed_output = platform_obj.parse(
status='active', slot='0', iotype='ipm')
self.assertEqual(parsed_output, self.golden_parsed_output_active_ipm)
def test_golden_active_opm(self):
self.maxDiff = None
self.device = Mock(**self.golden_output_active_opm)
platform_obj = ShowPlatformHardwareQfpBqsStatisticsChannelAll(
device=self.device)
parsed_output = platform_obj.parse(
status='active', slot='0', iotype='opm')
self.assertEqual(parsed_output, self.golden_parsed_output_active_opm)
class show_platform_hardware_qfp_interface(show_platform_hardware_qfp_interface_iosxe):
def test_empty(self):
self.device = Mock(**self.empty_output)
platform_obj = ShowPlatformHardwareQfpInterfaceIfnameStatistics(
device=self.device)
with self.assertRaises(SchemaEmptyParserError):
parsed_output = platform_obj.parse(
status='active', interface='gigabitEthernet 0/0/0')
def test_golden(self):
self.maxDiff = None
self.device = Mock(**self.golden_output)
platform_obj = ShowPlatformHardwareQfpInterfaceIfnameStatistics(
device=self.device)
parsed_output = platform_obj.parse(
status='active', interface='gigabitEthernet 0/0/0')
self.assertEqual(parsed_output, self.golden_parsed_output)
class test_show_platform_hardware_qfp_statistics_drop(test_show_platform_hardware_qfp_statistics_drop_iosxe):
def test_empty(self):
self.device = Mock(**self.empty_output)
platform_obj = ShowPlatformHardwareQfpStatisticsDrop(
device=self.device)
with self.assertRaises(SchemaEmptyParserError):
parsed_output = platform_obj.parse(status='active')
def test_golden_active(self):
self.maxDiff = None
self.device = Mock(**self.golden_output_active)
platform_obj = ShowPlatformHardwareQfpStatisticsDrop(
device=self.device)
parsed_output = platform_obj.parse(status='active')
self.assertEqual(parsed_output, self.golden_parsed_output_active)
class test_show_env(test_show_env_iosxe):
def test_empty(self):
self.dev = Mock(**self.empty_output)
obj = ShowEnvironment(device=self.dev)
with self.assertRaises(SchemaEmptyParserError):
parsered_output = obj.parse()
def test_golden(self):
self.maxDiff = None
self.dev = Mock(**self.golden_output)
obj = ShowEnvironment(device=self.dev)
parsed_output = obj.parse()
self.assertEqual(parsed_output, self.golden_parsed_output)
class test_show_module(test_show_module_iosxe):
def test_empty(self):
self.dev1 = Mock(**self.empty_output)
platform_obj = ShowModule(device=self.dev1)
with self.assertRaises(SchemaEmptyParserError):
parsed_output = platform_obj.parse()
def test_golden(self):
self.maxDiff = None
self.dev_c3850 = Mock(**self.golden_output_c3850)
platform_obj = ShowModule(device=self.dev_c3850)
parsed_output = platform_obj.parse()
self.assertEqual(parsed_output,self.golden_parsed_output_c3850)
class test_show_switch(test_show_switch_iosxe):
def test_empty(self):
self.dev1 = Mock(**self.empty_output)
platform_obj = ShowSwitch(device=self.dev1)
with self.assertRaises(SchemaEmptyParserError):
parsed_output = platform_obj.parse()
def test_golden(self):
self.maxDiff = None
self.dev_c3850 = Mock(**self.golden_output_c3850)
platform_obj = ShowSwitch(device=self.dev_c3850)
parsed_output = platform_obj.parse()
self.assertEqual(parsed_output,self.golden_parsed_output_c3850)
class test_show_switch_detail(test_show_switch_detail_iosxe):
def test_empty(self):
self.dev1 = Mock(**self.empty_output)
platform_obj = ShowSwitchDetail(device=self.dev1)
with self.assertRaises(SchemaEmptyParserError):
parsed_output = platform_obj.parse()
def test_golden(self):
self.maxDiff = None
self.dev_c3850 = Mock(**self.golden_output_c3850)
platform_obj = ShowSwitchDetail(device=self.dev_c3850)
parsed_output = platform_obj.parse()
self.assertEqual(parsed_output,self.golden_parsed_output_c3850)
if __name__ == '__main__':
unittest.main()
| <filename>src/genie/libs/parser/ios/tests/test_show_platform.py
#!/bin/env python
import unittest
from unittest.mock import Mock
from pyats.topology import Device
from genie.metaparser.util.exceptions import SchemaEmptyParserError,\
SchemaMissingKeyError
from genie.libs.parser.ios.show_platform import ShowVersion,\
Dir,\
ShowRedundancy,\
ShowInventory,\
ShowBootvar, \
ShowProcessesCpuSorted,\
ShowProcessesCpu,\
ShowVersionRp,\
ShowPlatform,\
ShowPlatformPower,\
ShowProcessesCpuHistory,\
ShowProcessesCpuPlatform,\
ShowPlatformSoftwareStatusControl,\
ShowPlatformSoftwareSlotActiveMonitorMem,\
ShowPlatformHardware,\
ShowPlatformHardwarePlim,\
ShowPlatformHardwareQfpBqsOpmMapping,\
ShowPlatformHardwareQfpBqsIpmMapping,\
ShowPlatformHardwareSerdes,\
ShowPlatformHardwareSerdesInternal,\
ShowPlatformHardwareQfpBqsStatisticsChannelAll,\
ShowPlatformHardwareQfpInterfaceIfnameStatistics,\
ShowPlatformHardwareQfpStatisticsDrop,\
ShowEnvironment,\
ShowModule,\
ShowSwitch, ShowSwitchDetail
from genie.libs.parser.iosxe.tests.test_show_platform import TestShowPlatform as test_show_platform_iosxe,\
TestShowPlatformPower as test_show_platform_power_iosxe,\
TestShowVersionRp as test_show_version_rp_iosxe,\
TestShowProcessesCpu as test_show_processes_cpu_iosxe,\
TestShowProcessesCpuHistory as test_show_processes_cpu_history_iosxe,\
TestShowProcessesCpuPlatform as test_show_processes_cpu_platform_iosxe,\
TestShowPlatformSoftwareStatusControlProcessorBrief as test_show_platform_software_status_control_processor_brief_iosxe,\
TestShowPlatformSoftwareSlotActiveMonitorMemSwap as test_show_platform_software_slot_active_monitor_Mem_iosxe,\
TestShowPlatformHardware as test_show_platform_hardware_iosxe,\
TestShowPlatformHardwarePlim as test_show_platform_hardware_plim_iosxe,\
TestShowPlatformHardwareQfpBqsOpmMapping as test_show_platform_hardware_qfp_bqs_opm_mapping_iosxe,\
TestShowPlatformHardwareQfpBqsIpmMapping as test_show_platform_hardware_qfp_bqs_ipm_mapping_iosxe,\
TestShowPlatformHardwareSerdesStatistics as test_show_platform_hardware_serdes_statistics_iosxe,\
TestShowPlatformHardwareSerdesStatisticsInternal as test_show_platform_hardware_serdes_statistics_internal_iosxe,\
ShowPlatformHardwareQfpBqsStatisticsChannelAll as show_platform_hardware_qfp_bqs_statistics_channel_all_iosxe,\
ShowPlatformHardwareQfpInterface as show_platform_hardware_qfp_interface_iosxe,\
TestShowPlatformHardwareQfpStatisticsDrop as test_show_platform_hardware_qfp_statistics_drop_iosxe,\
TestShowEnv as test_show_env_iosxe,\
TestShowModule as test_show_module_iosxe,\
TestShowSwitch as test_show_switch_iosxe,\
TestShowSwitchDetail as test_show_switch_detail_iosxe
class TestShowVersion(unittest.TestCase):
dev1 = Device(name='empty')
dev_iosv = Device(name='iosv')
empty_output = {'execute.return_value': ''}
semi_empty_output = {'execute.return_value': '''\
ROM: Bootstrap program is IOSv
'''}
golden_parsed_output_iosv = {
"version": {
"last_reload_reason": "Unknown reason",
"hostname": "N95_1",
"os": "IOS",
"version_short": "15.6",
"number_of_intfs": {
"Gigabit Ethernet": "6"
},
"version": "15.6(3)M2",
"rtr_type": "IOSv",
"chassis_sn": "9K66Z7TOKAACDEQA24N7S",
"chassis": "IOSv",
"image_id": "VIOS-ADVENTERPRISEK9-M",
'compiled_by': 'prod_rel_team',
'compiled_date': 'Wed 29-Mar-17 14:05',
"processor_type": "revision 1.0",
"platform": "IOSv",
"image_type": "production image",
'processor_board_flash': '10080K',
'returned_to_rom_by': 'reload',
"main_mem": "435457",
"mem_size": {
"non-volatile configuration": "256"
},
"system_image": "flash0:/vios-adventerprisek9-m",
"curr_config_register": "0x0",
"rom": "Bootstrap program is IOSv",
"uptime": "1 day, 16 hours, 42 minutes"
}
}
golden_output_iosv = {'execute.return_value': '''\
Cisco IOS Software, IOSv Software (VIOS-ADVENTERPRISEK9-M), Version 15.6(3)M2, RELEASE SOFTWARE (fc2)
Technical Support: http://www.cisco.com/techsupport
Copyright (c) 1986-2017 by Cisco Systems, Inc.
Compiled Wed 29-Mar-17 14:05 by prod_rel_team
ROM: Bootstrap program is IOSv
N95_1 uptime is 1 day, 16 hours, 42 minutes
System returned to ROM by reload
System image file is "flash0:/vios-adventerprisek9-m"
Last reload reason: Unknown reason
This product contains cryptographic features and is subject to United
States and local country laws governing import, export, transfer and
use. Delivery of Cisco cryptographic products does not imply
third-party authority to import, export, distribute or use encryption.
Importers, exporters, distributors and users are responsible for
compliance with U.S. and local country laws. By using this product you
agree to comply with applicable laws and regulations. If you are unable
to comply with U.S. and local laws, return this product immediately.
A summary of U.S. laws governing Cisco cryptographic products may be found at:
http://www.cisco.com/wwl/export/crypto/tool/stqrg.html
If you require further assistance please contact us by sending email to
<EMAIL>.
Cisco IOSv (revision 1.0) with with 435457K/87040K bytes of memory.
Processor board ID 9K66Z7TOKAACDEQA24N7S
6 Gigabit Ethernet interfaces
DRAM configuration is 72 bits wide with parity disabled.
256K bytes of non-volatile configuration memory.
2097152K bytes of ATA System CompactFlash 0 (Read/Write)
0K bytes of ATA CompactFlash 1 (Read/Write)
0K bytes of ATA CompactFlash 2 (Read/Write)
10080K bytes of ATA CompactFlash 3 (Read/Write)
Configuration register is 0x0'''}
golden_parsed_output_ios = {
'version': {'bootldr': 'C3750E Boot Loader (C3750X-HBOOT-M) Version '
'15.2(3r)E, RELEASE SOFTWARE (fc1)',
'chassis': 'WS-C3750X-24P',
'chassis_sn': 'FDO2028F1WK',
'curr_config_register': '0xF',
'compiled_by': 'prod_rel_team',
'compiled_date': 'Wed 26-Jun-13 09:56',
'hostname': 'R5',
'image_id': 'C3750E-UNIVERSALK9-M',
'image_type': 'production image',
'last_reload_reason': 'power-on',
'license_level': 'ipservices',
'license_type': 'Permanent',
'main_mem': '262144',
'mem_size': {'flash-simulated non-volatile configuration': '512'},
'next_reload_license_level': 'ipservices',
'number_of_intfs': {'Gigabit Ethernet': '28',
'Ten Gigabit Ethernet': '2',
'Virtual Ethernet': '2',
'Gigabit Ethernet': '28',
'FastEthernet': '1'
},
'os': 'IOS',
'platform': 'C3750E',
'processor_type': 'PowerPC405',
'returned_to_rom_by': 'power-on',
'rom': 'Bootstrap program is C3750E boot loader',
'rtr_type': 'WS-C3750X-24P',
'system_image': 'flash:c3750e-universalk9-mz',
'system_restarted_at': '12:22:21 PDT Mon Sep 10 2018',
'uptime': '9 weeks, 4 days, 2 hours, 3 minutes',
'version': '12.2(55)SE8',
'version_short': '12.2'
}
}
golden_output_ios = {'execute.return_value': '''\
Cisco IOS Software, C3750E Software (C3750E-UNIVERSALK9-M), Version 12.2(55)SE8, RELEASE SOFTWARE (fc2)
Technical Support: http://www.cisco.com/techsupport
Copyright (c) 1986-2013 by Cisco Systems, Inc.
Compiled Wed 26-Jun-13 09:56 by prod_rel_team
Image text-base: 0x00003000, data-base: 0x02800000
ROM: Bootstrap program is C3750E boot loader
BOOTLDR: C3750E Boot Loader (C3750X-HBOOT-M) Version 15.2(3r)E, RELEASE SOFTWARE (fc1)
R5 uptime is 9 weeks, 4 days, 2 hours, 3 minutes
System returned to ROM by power-on
System restarted at 12:22:21 PDT Mon Sep 10 2018
System image file is "flash:c3750e-universalk9-mz"
This product contains cryptographic features and is subject to United
States and local country laws governing import, export, transfer and
use. Delivery of Cisco cryptographic products does not imply
third-party authority to import, export, distribute or use encryption.
Importers, exporters, distributors and users are responsible for
compliance with U.S. and local country laws. By using this product you
agree to comply with applicable laws and regulations. If you are unable
to comply with U.S. and local laws, return this product immediately.
A summary of U.S. laws governing Cisco cryptographic products may be found at:
http://www.cisco.com/wwl/export/crypto/tool/stqrg.html
If you require further assistance please contact us by sending email to
<EMAIL>.
License Level: ipservices
License Type: Permanent
Next reload license Level: ipservices
cisco WS-C3750X-24P (PowerPC405) processor (revision W0) with 262144K bytes of memory.
Processor board ID FDO2028F1WK
Last reset from power-on
2 Virtual Ethernet interfaces
1 FastEthernet interface
28 Gigabit Ethernet interfaces
2 Ten Gigabit Ethernet interfaces
The password-recovery mechanism is enabled.
512K bytes of flash-simulated non-volatile configuration memory.
Base ethernet MAC Address : 84:3D:C6:FF:F1:B8
Motherboard assembly number : 73-15476-04
Motherboard serial number : FDO202907UH
Model revision number : W0
Motherboard revision number : B0
Model number : WS-C3750X-24P-L
Daughterboard assembly number : 800-32727-03
Daughterboard serial number : FDO202823P8
System serial number : FDO2028F1WK
Top Assembly Part Number : 800-38990-01
Top Assembly Revision Number : F0
Version ID : V07
CLEI Code Number : CMMPP00DRB
Hardware Board Revision Number : 0x05
Switch Ports Model SW Version SW Image
------ ----- ----- ---------- ----------
* 1 30 WS-C3750X-24P 12.2(55)SE8 C3750E-UNIVERSALK9-M
Configuration register is 0xF
'''}
golden_parsed_output_ios_cat6k = {
"version": {
"os": "IOS",
"version_short": "12.2",
"platform": "s72033_rp",
"version": "12.2(18)SXF7",
"image_id": "s72033_rp-ADVENTERPRISEK9_WAN-M",
'compiled_by': 'kellythw',
'compiled_date': 'Thu 23-Nov-06 06:26',
"image_type": "production image",
"rom": "System Bootstrap, Version 12.2(17r)S4, RELEASE SOFTWARE (fc1)",
"bootldr": "s72033_rp Software (s72033_rp-ADVENTERPRISEK9_WAN-M), Version 12.2(18)SXF7, RELEASE SOFTWARE (fc1)",
"hostname": "cat6k_tb1",
"uptime": "10 weeks, 5 days, 5 hours, 16 minutes",
"system_image": "disk0:s72033-adventerprisek9_wan-mz.122-18.SXF7",
"chassis": "WS-C6503-E",
"main_mem": "983008",
"processor_type": "R7000",
'sp_by': 'power on',
'returned_to_rom_at': '21:57:23 UTC Sat Aug 28 2010',
'returned_to_rom_by': 'power cycle',
"rtr_type": "WS-C6503-E",
"chassis_sn": "FXS1821Q2H9",
"last_reload_reason": "s/w reset",
'processor_board_flash': '65536K',
"number_of_intfs": {
"Gigabit Ethernet/IEEE 802.3": "50",
'Virtual Ethernet/IEEE 802.3': '1'
},
"mem_size": {"non-volatile configuration": "1917", "packet buffer": "8192"},
"curr_config_register": "0x2102",
}
}
golden_output_ios_cat6k = {'execute.return_value': '''
show version
Cisco Internetwork Operating System Software
IOS (tm) s72033_rp Software (s72033_rp-ADVENTERPRISEK9_WAN-M), Version 12.2(18)SXF7, RELEASE SOFTWARE (fc1)
Technical Support: http://www.cisco.com/techsupport
Copyright (c) 1986-2006 by cisco Systems, Inc.
Compiled Thu 23-Nov-06 06:26 by kellythw
Image text-base: 0x40101040, data-base: 0x42D98000
ROM: System Bootstrap, Version 12.2(17r)S4, RELEASE SOFTWARE (fc1)
BOOTLDR: s72033_rp Software (s72033_rp-ADVENTERPRISEK9_WAN-M), Version 12.2(18)SXF7, RELEASE SOFTWARE (fc1)
cat6k_tb1 uptime is 10 weeks, 5 days, 5 hours, 16 minutes
Time since cat6k_tb1 switched to active is 10 weeks, 5 days, 5 hours, 15 minutes
System returned to ROM by power cycle at 21:57:23 UTC Sat Aug 28 2010 (SP by power on)
System image file is "disk0:s72033-adventerprisek9_wan-mz.122-18.SXF7"
This product contains cryptographic features and is subject to United
States and local country laws governing import, export, transfer and
use. Delivery of Cisco cryptographic products does not imply
third-party authority to import, export, distribute or use encryption.
Importers, exporters, distributors and users are responsible for
compliance with U.S. and local country laws. By using this product you
agree to comply with applicable laws and regulations. If you are unable
to comply with U.S. and local laws, return this product immediately.
A summary of U.S. laws governing Cisco cryptographic products may be found at:
http://www.cisco.com/wwl/export/crypto/tool/stqrg.html
If you require further assistance please contact us by sending email to
<EMAIL>.
cisco WS-C6503-E (R7000) processor (revision 1.4) with 983008K/65536K bytes of memory.
Processor board ID FXS1821Q2H9
SR71000 CPU at 600Mhz, Implementation 0x504, Rev 1.2, 512KB L2 Cache
Last reset from s/w reset
SuperLAT software (copyright 1990 by Meridian Technology Corp).
X.25 software, Version 3.0.0.
Bridging software.
TN3270 Emulation software.
1 Virtual Ethernet/IEEE 802.3 interface
50 Gigabit Ethernet/IEEE 802.3 interfaces
1917K bytes of non-volatile configuration memory.
8192K bytes of packet buffer memory.
65536K bytes of Flash internal SIMM (Sector size 512K).
Configuration register is 0x2102
'''}
golden_output_ios_1 = {'execute.return_value': '''\
Cisco IOS Software, C3750E Software (C3750E-UNIVERSALK9-M), Version 15.2(2)E8, RELEASE SOFTWARE (fc1)
Technical Support: http://www.cisco.com/techsupport
Copyright (c) 1986-2018 by Cisco Systems, Inc.
Compiled Mon 22-Jan-18 04:07 by prod_rel_team
ROM: Bootstrap program is C3750E boot loader
BOOTLDR: C3750E Boot Loader (C3750X-HBOOT-M) Version 12.2(58r)SE, RELEASE SOFTWARE (fc1)
sample_switch uptime is 8 weeks, 3 days, 10 hours, 27 minutes
System returned to ROM by power-on
System restarted at 05:06:40 GMT Tue Sep 10 2019
System image file is "flash:c3750e-universalk9-mz.152-2.E8.bin"
Last reload reason: Reload command
This product contains cryptographic features and is subject to United
States and local country laws governing import, export, transfer and
use. Delivery of Cisco cryptographic products does not imply
third-party authority to import, export, distribute or use encryption.
Importers, exporters, distributors and users are responsible for
compliance with U.S. and local country laws. By using this product you
agree to comply with applicable laws and regulations. If you are unable
to comply with U.S. and local laws, return this product immediately.
A summary of U.S. laws governing Cisco cryptographic products may be found at:
http://www.cisco.com/wwl/export/crypto/tool/stqrg.html
If you require further assistance please contact us by sending email to
<EMAIL>.
License Level: ipservices
License Type: Permanent
Next reload license Level: ipservices
cisco WS-C3750X-24S (PowerPC405) processor (revision A0) with 524288K bytes of memory.
Processor board ID FDO1633Q14S
Last reset from power-on
14 Virtual Ethernet interfaces
1 FastEthernet interface
28 Gigabit Ethernet interfaces
2 Ten Gigabit Ethernet interfaces
The password-recovery mechanism is enabled.
512K bytes of flash-simulated non-volatile configuration memory.
Base ethernet MAC Address : AC:F2:C5:FF:55:E7
Motherboard assembly number : 73-13061-04
Motherboard serial number : FDO1633Q14M
Model revision number : A0
Motherboard revision number : A0
Model number : WS-C3750X-24S-E
Daughterboard assembly number : 800-32727-03
Daughterboard serial number : FDO172217ED
System serial number : FDO1633Q14S
Top Assembly Part Number : 800-33746-04
Top Assembly Revision Number : B0
Version ID : V03
CLEI Code Number : CMMFF00ARC
Hardware Board Revision Number : 0x04
Switch Ports Model SW Version SW Image
------ ----- ----- ---------- ----------
* 1 30 WS-C3750X-24S 15.2(2)E8 C3750E-UNIVERSALK9-M
Configuration register is 0xF
'''}
golden_parsed_output_ios_1 = {
'version': {'version_short': '15.2',
'platform': 'C3750E',
'version': '15.2(2)E8',
'image_id': 'C3750E-UNIVERSALK9-M',
'os': 'IOS',
'image_type': 'production image',
'compiled_date': 'Mon 22-Jan-18 04:07',
'compiled_by': 'prod_rel_team',
'rom': 'Bootstrap program is C3750E boot loader',
'bootldr': 'C3750E Boot Loader (C3750X-HBOOT-M) Version 12.2(58r)SE, RELEASE SOFTWARE (fc1)',
'hostname': 'sample_switch',
'uptime': '8 weeks, 3 days, 10 hours, 27 minutes',
'returned_to_rom_by': 'power-on',
'system_restarted_at': '05:06:40 GMT Tue Sep 10 2019',
'system_image': 'flash:c3750e-universalk9-mz.152-2.E8.bin',
'last_reload_reason': 'power-on',
'license_level': 'ipservices',
'license_type': 'Permanent',
'next_reload_license_level': 'ipservices',
'chassis': 'WS-C3750X-24S',
'main_mem': '524288',
'processor_type': 'PowerPC405',
'rtr_type': 'WS-C3750X-24S',
'chassis_sn': 'FDO1633Q14S',
'number_of_intfs': {
'Virtual Ethernet': '14',
'FastEthernet': '1',
'Gigabit Ethernet': '28',
'Ten Gigabit Ethernet': '2'
},
'mem_size': {
'flash-simulated non-volatile configuration': '512'
},
'curr_config_register': '0xF'
}
}
device_output = {'execute.return_value':'''
best-c3945-IOS3#show version
Cisco IOS Software, C3900 Software (C3900-UNIVERSALK9-M), Version 15.0(1)M7, RELEASE SOFTWARE (fc2)
Technical Support: http://www.cisco.com/techsupport
Copyright (c) 1986-2011 by Cisco Systems, Inc.
Compiled Fri 05-Aug-11 00:32 by prod_rel_team
ROM: System Bootstrap, Version 15.0(1r)M13, RELEASE SOFTWARE (fc1)
best-c3945-IOS3 uptime is 1 hour, 20 minutes
System returned to ROM by reload at 10:26:47 EST Mon Dec 9 2019
System restarted at 10:27:57 EST Mon Dec 9 2019
System image file is "flash0:c3900-universalk9-mz.SPA.150-1.M7.bin"
Last reload type: Normal Reload
Last reload reason: Reload Command
This product contains cryptographic features and is subject to United
States and local country laws governing import, export, transfer and
use. Delivery of Cisco cryptographic products does not imply
third-party authority to import, export, distribute or use encryption.
Importers, exporters, distributors and users are responsible for
compliance with U.S. and local country laws. By using this product you
agree to comply with applicable laws and regulations. If you are unable
to comply with U.S. and local laws, return this product immediately.
A summary of U.S. laws governing Cisco cryptographic products may be found at:
http://www.cisco.com/wwl/export/crypto/tool/stqrg.html
If you require further assistance please contact us by sending email to
<EMAIL>.
Cisco CISCO3945-CHASSIS (revision 1.1) with C3900-SPE150/K9 with 2027520K/69632K bytes of memory.
Processor board ID FGL161010K8
2 FastEthernet interfaces
3 Gigabit Ethernet interfaces
1 Virtual Private Network (VPN) Module
DRAM configuration is 72 bits wide with parity enabled.
255K bytes of non-volatile configuration memory.
2000880K bytes of ATA System CompactFlash 0 (Read/Write)
License Info:
License UDI:
-------------------------------------------------
Device# PID SN
-------------------------------------------------
*0 C3900-SPE150/K9 FOC16050QP6
Technology Package License Information for Module:'c3900'
-----------------------------------------------------------------
Technology Technology-package Technology-package
Current Type Next reboot
------------------------------------------------------------------
ipbase ipbasek9 Permanent ipbasek9
security securityk9 Permanent securityk9
uc None None None
data datak9 Permanent datak9
Configuration register is 0x2102
'''}
parsed_output = {
'version': {
'chassis': 'CISCO3945-CHASSIS',
'chassis_sn': 'FGL161010K8',
'compiled_by': 'prod_rel_team',
'compiled_date': 'Fri 05-Aug-11 00:32',
'curr_config_register': '0x2102',
'hostname': 'best-c3945-IOS3',
'image_id': 'C3900-UNIVERSALK9-M',
'image_type': 'production image',
'last_reload_reason': 'Reload Command',
'last_reload_type': 'Normal Reload',
'license_udi': {
'device_num': {
'*0': {
'pid': 'C3900-SPE150/K9',
'sn': 'FOC16050QP6'
}
}
},
'license_package': {
'data': {
'license_level': 'datak9',
'license_type': 'Permanent',
'next_reload_license_level': 'datak9',
},
'ipbase': {
'license_level': 'ipbasek9',
'license_type': 'Permanent',
'next_reload_license_level': 'ipbasek9',
},
'security': {
'license_level': 'securityk9',
'license_type': 'Permanent',
'next_reload_license_level': 'securityk9',
},
'uc': {
'license_level': 'None',
'license_type': 'None',
'next_reload_license_level': 'None',
},
},
'main_mem': '2027520',
'mem_size': {
'non-volatile configuration': '255',
},
'number_of_intfs': {
'FastEthernet': '2',
'Gigabit Ethernet': '3',
},
'os': 'IOS',
'platform': 'C3900',
'processor_board_flash': '2000880K',
'processor_type': 'C3900-SPE150/K9',
'returned_to_rom_at': '10:26:47 EST Mon Dec 9 2019',
'returned_to_rom_by': 'reload',
'rom': 'System Bootstrap, Version 15.0(1r)M13, RELEASE SOFTWARE (fc1)',
'rtr_type': 'CISCO3945-CHASSIS',
'system_image': 'flash0:c3900-universalk9-mz.SPA.150-1.M7.bin',
'system_restarted_at': '10:27:57 EST Mon Dec 9 2019',
'uptime': '1 hour, 20 minutes',
'version': '15.0(1)M7',
'version_short': '15.0',
},
}
def test_empty(self):
self.dev1 = Mock(**self.empty_output)
version_obj = ShowVersion(device=self.dev1)
with self.assertRaises(AttributeError):
parsered_output = version_obj.parse()
def test_semi_empty(self):
self.dev1 = Mock(**self.semi_empty_output)
version_obj = ShowVersion(device=self.dev1)
with self.assertRaises(KeyError):
parsed_output = version_obj.parse()
def test_golden_iosv(self):
self.maxDiff = None
self.dev_iosv = Mock(**self.golden_output_iosv)
version_obj = ShowVersion(device=self.dev_iosv)
parsed_output = version_obj.parse()
self.assertEqual(parsed_output, self.golden_parsed_output_iosv)
def test_golden_ios(self):
self.maxDiff = None
self.dev_iosv = Mock(**self.golden_output_ios)
version_obj = ShowVersion(device=self.dev_iosv)
parsed_output = version_obj.parse()
self.assertEqual(parsed_output, self.golden_parsed_output_ios)
def test_golden_ios_cat6k(self):
self.maxDiff = None
self.dev_iosv = Mock(**self.golden_output_ios_cat6k)
version_obj = ShowVersion(device=self.dev_iosv)
parsed_output = version_obj.parse()
self.assertEqual(parsed_output, self.golden_parsed_output_ios_cat6k)
def test_golden_ios_1(self):
self.maxDiff = None
self.dev_iosv = Mock(**self.golden_output_ios_1)
version_obj = ShowVersion(device=self.dev_iosv)
parsed_output = version_obj.parse()
self.assertEqual(parsed_output, self.golden_parsed_output_ios_1)
def test_golden_ios_2(self):
self.maxDiff = None
self.dev_iosv = Mock(**self.device_output)
version_obj = ShowVersion(device=self.dev_iosv)
parsed_output = version_obj.parse()
self.assertEqual(parsed_output, self.parsed_output)
class test_dir(unittest.TestCase):
dev1 = Device(name='empty')
dev_iosv = Device(name='iosv')
empty_output = {'execute.return_value': ''}
semi_empty_output = {'execute.return_value': '''\
Directory of flash:/
'''}
golden_parsed_output_iosv = {
"dir": {
"flash0:/": {
"files": {
"e1000_bia.txt": {
"last_modified_date": "Oct 17 2018 18:57:18 +00:00",
"index": "269",
"size": "119",
"permissions": "-rw-"
},
"config": {
"last_modified_date": "Oct 14 2013 00:00:00 +00:00",
"index": "264",
"size": "0",
"permissions": "drw-"
},
"nvram": {
"last_modified_date": "Oct 17 2018 18:57:10 +00:00",
"index": "268",
"size": "524288",
"permissions": "-rw-"
},
"boot": {
"last_modified_date": "Jan 30 2013 00:00:00 +00:00",
"index": "1",
"size": "0",
"permissions": "drw-"
},
"vios-adventerprisek9-m": {
"last_modified_date": "Mar 29 2017 00:00:00 +00:00",
"index": "267",
"size": "147988420",
"permissions": "-rw-"
}
},
"bytes_total": "2142715904",
"bytes_free": "1989595136"
},
"dir": "flash0:/"
}
}
golden_output_iosv = {'execute.return_value': '''\
Directory of flash0:/
1 drw- 0 Jan 30 2013 00:00:00 +00:00 boot
264 drw- 0 Oct 14 2013 00:00:00 +00:00 config
267 -rw- 147988420 Mar 29 2017 00:00:00 +00:00 vios-adventerprisek9-m
268 -rw- 524288 Oct 17 2018 18:57:10 +00:00 nvram
269 -rw- 119 Oct 17 2018 18:57:18 +00:00 e1000_bia.txt
2142715904 bytes total (1989595136 bytes free)
'''}
def test_empty(self):
self.dev1 = Mock(**self.empty_output)
dir_obj = Dir(device=self.dev1)
with self.assertRaises(SchemaEmptyParserError):
parsered_output = dir_obj.parse()
def test_semi_empty(self):
self.dev1 = Mock(**self.semi_empty_output)
dir_obj = Dir(device=self.dev1)
with self.assertRaises(SchemaMissingKeyError):
parsed_output = dir_obj.parse()
def test_golden_iosv(self):
self.maxDiff = None
self.dev_iosv = Mock(**self.golden_output_iosv)
dir_obj = Dir(device=self.dev_iosv)
parsed_output = dir_obj.parse()
self.assertEqual(parsed_output, self.golden_parsed_output_iosv)
class test_show_redundancy(unittest.TestCase):
dev1 = Device(name='empty')
dev_iosv = Device(name='iosv')
empty_output = {'execute.return_value': ''}
golden_parsed_output_iosv = {
"red_sys_info": {
"last_switchover_reason": "unsupported",
"maint_mode": "Disabled",
"switchovers_system_experienced": "0",
"available_system_uptime": "0 minutes",
"communications": "Down",
"hw_mode": "Simplex",
"communications_reason": "Failure",
"standby_failures": "0"
},
"slot": {
"slot 0": {
"image_ver": "Cisco IOS Software, IOSv Software (VIOS-ADVENTERPRISEK9-M), Version 15.6(3)M2, RELEASE SOFTWARE (fc2)",
"uptime_in_curr_state": "1 day, 16 hours, 42 minutes",
"config_register": "0x0",
"curr_sw_state": "ACTIVE"
}
}
}
golden_output_iosv = {'execute.return_value': '''\
Redundant System Information :
------------------------------
Available system uptime = 0 minutes
Switchovers system experienced = 0
Standby failures = 0
Last switchover reason = unsupported
Hardware Mode = Simplex
Maintenance Mode = Disabled
Communications = Down Reason: Failure
Current Processor Information :
-------------------------------
Active Location = slot 0
Current Software state = ACTIVE
Uptime in current state = 1 day, 16 hours, 42 minutes
Image Version = Cisco IOS Software, IOSv Software (VIOS-ADVENTERPRISEK9-M), Version 15.6(3)M2, RELEASE SOFTWARE (fc2)
Technical Support: http://www.cisco.com/techsupport
Copyright (c) 1986-2017 by Cisco Systems, Inc.
Compiled Wed 29-Mar-17 14:05 by prod_rel_team
Configuration register = 0x0
Peer (slot: 0) information is not available because it is in 'DISABLED' state
'''}
def test_empty(self):
self.dev1 = Mock(**self.empty_output)
redundancy_obj = ShowRedundancy(device=self.dev1)
with self.assertRaises(SchemaEmptyParserError):
parsed_output = redundancy_obj.parse()
def test_golden_iosv(self):
self.maxDiff = None
self.dev_iosv = Mock(**self.golden_output_iosv)
redundancy_obj = ShowRedundancy(device=self.dev_iosv)
parsed_output = redundancy_obj.parse()
self.assertEqual(parsed_output, self.golden_parsed_output_iosv)
class TestShowInventory(unittest.TestCase):
dev1 = Device(name='empty')
dev_iosv = Device(name='iosv')
empty_output = {'execute.return_value': ''}
golden_parsed_output_iosv = {
'main': {
'chassis': {
'IOSv': {
'descr': 'IOSv chassis, Hw Serial#: 9K66Z7TOKAACDEQA24N7S, Hw Revision: 1.0',
'name': 'IOSv',
'pid': 'IOSv',
'sn': '9K66Z7TOKAACDEQA24N7S',
'vid': '1.0',
},
},
},
}
golden_output_iosv = {'execute.return_value': '''\
NAME: "IOSv", DESCR: "IOSv chassis, Hw Serial#: 9K66Z7TOKAACDEQA24N7S, Hw Revision: 1.0"
PID: IOSv , VID: 1.0, SN: 9K66Z7TOKAACDEQA24N7S
'''}
golden_parsed_output_2 = {
"main": {
"chassis": {
"WS-C6504-E": {
"name": "WS-C6504-E",
"descr": "Cisco Systems Cisco 6500 4-slot Chassis System",
"pid": "WS-C6504-E",
"vid": "V01",
"sn": "FXS1712Q1R8",
}
}
},
"slot": {
"CLK-7600 1": {
"other": {
"CLK-7600 1": {
"name": "CLK-7600 1",
"descr": "OSR-7600 Clock FRU 1",
"pid": "CLK-7600",
"vid": "",
"sn": "FXS170802GL",
}
}
},
"CLK-7600 2": {
"other": {
"CLK-7600 2": {
"name": "CLK-7600 2",
"descr": "OSR-7600 Clock FRU 2",
"pid": "CLK-7600",
"vid": "",
"sn": "FXS170802GL",
}
}
},
"FAN-MOD-4HS 1": {
"other": {
"FAN-MOD-4HS 1": {
"name": "FAN-MOD-4HS 1",
"descr": "High Speed Fan Module for CISCO7604 1",
"pid": "FAN-MOD-4HS",
"vid": "V01",
"sn": "DCH170900PF",
}
}
},
"PS 1 PWR-2700-AC/4": {
"other": {
"PS 1 PWR-2700-AC/4": {
"name": "PS 1 PWR-2700-AC/4",
"descr": "2700W AC power supply for CISCO7604 1",
"pid": "PWR-2700-AC/4",
"vid": "V03",
"sn": "APS1707008Y",
}
}
},
"PS 2 PWR-2700-AC/4": {
"other": {
"PS 2 PWR-2700-AC/4": {
"name": "PS 2 PWR-2700-AC/4",
"descr": "2700W AC power supply for CISCO7604 2",
"pid": "PWR-2700-AC/4",
"vid": "V03",
"sn": "APS17070093",
}
}
},
"1": {
"rp": {
"VS-SUP2T-10G": {
"name": "1",
"descr": "VS-SUP2T-10G 5 ports Supervisor Engine 2T 10GE w/ CTS Rev. 1.5",
"pid": "VS-SUP2T-10G",
"vid": "V05",
"sn": "SAL17152N0F",
"subslot": {
"0": {
"VS-F6K-MSFC5": {
"descr": "VS-F6K-MSFC5 CPU Daughterboard Rev. 2.0",
"name": "msfc sub-module of 1",
"pid": "VS-F6K-MSFC5",
"sn": "SAL17142D06",
"vid": "",
},
"VS-F6K-PFC4": {
"descr": "VS-F6K-PFC4 Policy Feature Card 4 Rev. 2.0",
"name": "VS-F6K-PFC4 Policy Feature Card 4 EARL sub-module of 1",
"pid": "VS-F6K-PFC4",
"sn": "SAL17163901",
"vid": "V03",
},
},
"4": {
"X2-10GB-SR": {
"descr": "X2 Transceiver 10Gbase-SR Te1/4",
"name": "Transceiver Te1/4",
"pid": "X2-10GB-SR",
"sn": "ONT170202T1",
"vid": "V06 ",
}
},
"5": {
"X2-10GB-SR": {
"descr": "X2 Transceiver 10Gbase-SR Te1/5",
"name": "Transceiver Te1/5",
"pid": "X2-10GB-SR",
"sn": "ONT1702033D",
"vid": "V06 ",
}
},
},
}
}
},
"2": {
"lc": {
"WS-X6816-10GE": {
"name": "2",
"descr": "WS-X6816-10GE CEF720 16 port 10GE Rev. 2.0",
"pid": "WS-X6816-10GE",
"vid": "V02",
"sn": "SAL17152QB3",
"subslot": {
"0": {
"WS-F6K-DFC4-E": {
"descr": "WS-F6K-DFC4-E Distributed Forwarding Card 4 Rev. 1.2",
"name": "WS-F6K-DFC4-E Distributed Forwarding Card 4 EARL sub-module of 2",
"pid": "WS-F6K-DFC4-E",
"sn": "SAL171846RF",
"vid": "V02",
}
},
"1": {
"X2-10GB-SR": {
"descr": "X2 Transceiver 10Gbase-SR Te2/1",
"name": "Transceiver Te2/1",
"pid": "X2-10GB-SR",
"sn": "ONT17020338",
"vid": "V06 ",
}
},
"2": {
"X2-10GB-SR": {
"descr": "X2 Transceiver 10Gbase-SR Te2/2",
"name": "Transceiver Te2/2",
"pid": "X2-10GB-SR",
"sn": "ONT1702020H",
"vid": "V06 ",
}
},
"3": {
"X2-10GB-SR": {
"descr": "X2 Transceiver 10Gbase-SR Te2/3",
"name": "Transceiver Te2/3",
"pid": "X2-10GB-SR",
"sn": "ONT170202UU",
"vid": "V06 ",
}
},
"4": {
"X2-10GB-SR": {
"descr": "X2 Transceiver 10Gbase-SR Te2/4",
"name": "Transceiver Te2/4",
"pid": "X2-10GB-SR",
"sn": "ONT170202T5",
"vid": "V06 ",
}
},
"5": {
"X2-10GB-SR": {
"descr": "X2 Transceiver 10Gbase-SR Te2/5",
"name": "Transceiver Te2/5",
"pid": "X2-10GB-SR",
"sn": "AGA1515XZE2",
"vid": "V05 ",
}
},
"6": {
"X2-10GB-SR": {
"descr": "X2 Transceiver 10Gbase-SR Te2/6",
"name": "Transceiver Te2/6",
"pid": "X2-10GB-SR",
"sn": "FNS153920YJ",
"vid": "V06 ",
}
},
"16": {
"X2-10GB-SR": {
"descr": "X2 Transceiver 10Gbase-SR Te2/16",
"name": "Transceiver Te2/16",
"pid": "X2-10GB-SR",
"sn": "ONT170201TT",
"vid": "V06 ",
}
},
},
}
}
},
"3": {
"lc": {
"WS-X6824-SFP": {
"name": "3",
"descr": "WS-X6824-SFP CEF720 24 port 1000mb SFP Rev. 1.0",
"pid": "WS-X6824-SFP",
"vid": "V01",
"sn": "SAL17152EG9",
"subslot": {
"0": {
"WS-F6K-DFC4-A": {
"descr": "WS-F6K-DFC4-A Distributed Forwarding Card 4 Rev. 1.0",
"name": "WS-F6K-DFC4-A Distributed Forwarding Card 4 EARL sub-module of 3",
"pid": "WS-F6K-DFC4-A",
"sn": "SAL171848KL",
"vid": "V04",
}
}
},
}
}
},
"4": {
"lc": {
"WS-X6748-GE-TX": {
"name": "4",
"descr": "WS-X6748-GE-TX CEF720 48 port 10/100/1000mb Ethernet Rev. 3.4",
"pid": "WS-X6748-GE-TX",
"vid": "V04",
"sn": "SAL14017TWF",
"subslot": {
"0": {
"WS-F6700-CFC": {
"descr": "WS-F6700-CFC Centralized Forwarding Card Rev. 4.1",
"name": "WS-F6700-CFC Centralized Forwarding Card EARL sub-module of 4",
"pid": "WS-F6700-CFC",
"sn": "SAL13516QS8",
"vid": "V06",
}
}
},
}
}
},
},
}
golden_output_2 = {'execute.return_value': '''
NAME: "WS-C6504-E", DESCR: "Cisco Systems Cisco 6500 4-slot Chassis System"
PID: WS-C6504-E , VID: V01, SN: FXS1712Q1R8
NAME: "CLK-7600 1", DESCR: "OSR-7600 Clock FRU 1"
PID: CLK-7600 , VID: , SN: FXS170802GL
NAME: "CLK-7600 2", DESCR: "OSR-7600 Clock FRU 2"
PID: CLK-7600 , VID: , SN: FXS170802GL
NAME: "1", DESCR: "VS-SUP2T-10G 5 ports Supervisor Engine 2T 10GE w/ CTS Rev. 1.5"
PID: VS-SUP2T-10G , VID: V05, SN: SAL17152N0F
NAME: "msfc sub-module of 1", DESCR: "VS-F6K-MSFC5 CPU Daughterboard Rev. 2.0"
PID: VS-F6K-MSFC5 , VID: , SN: SAL17142D06
NAME: "VS-F6K-PFC4 Policy Feature Card 4 EARL sub-module of 1", DESCR: "VS-F6K-PFC4 Policy Feature Card 4 Rev. 2.0"
PID: VS-F6K-PFC4 , VID: V03, SN: SAL17163901
NAME: "Transceiver Te1/4", DESCR: "X2 Transceiver 10Gbase-SR Te1/4"
PID: X2-10GB-SR , VID: V06 , SN: ONT170202T1
NAME: "Transceiver Te1/5", DESCR: "X2 Transceiver 10Gbase-SR Te1/5"
PID: X2-10GB-SR , VID: V06 , SN: ONT1702033D
NAME: "2", DESCR: "WS-X6816-10GE CEF720 16 port 10GE Rev. 2.0"
PID: WS-X6816-10GE , VID: V02, SN: SAL17152QB3
NAME: "WS-F6K-DFC4-E Distributed Forwarding Card 4 EARL sub-module of 2", DESCR: "WS-F6K-DFC4-E Distributed Forwarding Card 4 Rev. 1.2"
PID: WS-F6K-DFC4-E , VID: V02, SN: SAL171846RF
NAME: "Transceiver Te2/1", DESCR: "X2 Transceiver 10Gbase-SR Te2/1"
PID: X2-10GB-SR , VID: V06 , SN: ONT17020338
NAME: "Transceiver Te2/2", DESCR: "X2 Transceiver 10Gbase-SR Te2/2"
PID: X2-10GB-SR , VID: V06 , SN: ONT1702020H
NAME: "Transceiver Te2/3", DESCR: "X2 Transceiver 10Gbase-SR Te2/3"
PID: X2-10GB-SR , VID: V06 , SN: ONT170202UU
NAME: "Transceiver Te2/4", DESCR: "X2 Transceiver 10Gbase-SR Te2/4"
PID: X2-10GB-SR , VID: V06 , SN: ONT170202T5
NAME: "Transceiver Te2/5", DESCR: "X2 Transceiver 10Gbase-SR Te2/5"
PID: X2-10GB-SR , VID: V05 , SN: AGA1515XZE2
NAME: "Transceiver Te2/6", DESCR: "X2 Transceiver 10Gbase-SR Te2/6"
PID: X2-10GB-SR , VID: V06 , SN: FNS153920YJ
NAME: "Transceiver Te2/16", DESCR: "X2 Transceiver 10Gbase-SR Te2/16"
PID: X2-10GB-SR , VID: V06 , SN: ONT170201TT
NAME: "3", DESCR: "WS-X6824-SFP CEF720 24 port 1000mb SFP Rev. 1.0"
PID: WS-X6824-SFP , VID: V01, SN: SAL17152EG9
NAME: "WS-F6K-DFC4-A Distributed Forwarding Card 4 EARL sub-module of 3", DESCR: "WS-F6K-DFC4-A Distributed Forwarding Card 4 Rev. 1.0"
PID: WS-F6K-DFC4-A , VID: V04, SN: SAL171848KL
NAME: "4", DESCR: "WS-X6748-GE-TX CEF720 48 port 10/100/1000mb Ethernet Rev. 3.4"
PID: WS-X6748-GE-TX , VID: V04, SN: SAL14017TWF
NAME: "WS-F6700-CFC Centralized Forwarding Card EARL sub-module of 4", DESCR: "WS-F6700-CFC Centralized Forwarding Card Rev. 4.1"
PID: WS-F6700-CFC , VID: V06, SN: SAL13516QS8
NAME: "FAN-MOD-4HS 1", DESCR: "High Speed Fan Module for CISCO7604 1"
PID: FAN-MOD-4HS , VID: V01, SN: DCH170900PF
NAME: "PS 1 PWR-2700-AC/4", DESCR: "2700W AC power supply for CISCO7604 1"
PID: PWR-2700-AC/4 , VID: V03, SN: APS1707008Y
NAME: "PS 2 PWR-2700-AC/4", DESCR: "2700W AC power supply for CISCO7604 2"
PID: PWR-2700-AC/4 , VID: V03, SN: APS17070093
'''}
golden_parsed_output_3 = {
"main": {
"chassis": {
"WS-C6503-E": {
"name": "WS-C6503-E",
"descr": "Cisco Systems Catalyst 6500 3-slot Chassis System",
"pid": "WS-C6503-E",
"vid": "V03",
"sn": "FXS1821Q2H9",
}
}
},
"slot": {
"CLK-7600 1": {
"other": {
"CLK-7600 1": {
"name": "CLK-7600 1",
"descr": "OSR-7600 Clock FRU 1",
"pid": "CLK-7600",
"vid": "",
"sn": "FXS181101V4",
}
}
},
"CLK-7600 2": {
"other": {
"CLK-7600 2": {
"name": "CLK-7600 2",
"descr": "OSR-7600 Clock FRU 2",
"pid": "CLK-7600",
"vid": "",
"sn": "FXS181101V4",
}
}
},
"1": {
"rp": {
"WS-SUP720-3BXL": {
"name": "1",
"descr": "WS-SUP720-3BXL 2 ports Supervisor Engine 720 Rev. 5.6",
"pid": "WS-SUP720-3BXL",
"vid": "V05",
"sn": "SAL11434P2C",
"subslot": {
"0": {
"WS-SUP720": {
"descr": "WS-SUP720 MSFC3 Daughterboard Rev. 3.1",
"name": "msfc sub-module of 1",
"pid": "WS-SUP720",
"sn": "SAL11434N9G",
"vid": "",
},
"WS-F6K-PFC3BXL": {
"descr": "WS-F6K-PFC3BXL Policy Feature Card 3 Rev. 1.8",
"name": "switching engine sub-module of 1",
"pid": "WS-F6K-PFC3BXL",
"sn": "SAL11434LYG",
"vid": "V01",
},
}
},
}
}
},
"2": {
"lc": {
"WS-X6748-GE-TX": {
"name": "2",
"descr": "WS-X6748-GE-TX CEF720 48 port 10/100/1000mb Ethernet Rev. 2.6",
"pid": "WS-X6748-GE-TX",
"vid": "V02",
"sn": "SAL1128UPQ9",
"subslot": {
"0": {
"WS-F6700-DFC3CXL": {
"descr": "WS-F6700-DFC3CXL Distributed Forwarding Card 3 Rev. 1.1",
"name": "switching engine sub-module of 2",
"pid": "WS-F6700-DFC3CXL",
"sn": "SAL1214LAG5",
"vid": "V01",
}
}
},
}
}
},
"WS-C6503-E-FAN 1": {
"other": {
"WS-C6503-E-FAN 1": {
"name": "WS-C6503-E-FAN 1",
"descr": "Enhanced 3-slot Fan Tray 1",
"pid": "WS-C6503-E-FAN",
"vid": "V02",
"sn": "DCH183500KW",
}
}
},
"PS 1 PWR-1400-AC": {
"other": {
"PS 1 PWR-1400-AC": {
"name": "PS 1 PWR-1400-AC",
"descr": "AC power supply, 1400 watt 1",
"pid": "PWR-1400-AC",
"vid": "V01",
"sn": "ABC0830J127",
}
}
},
},
}
golden_output_3 = {'execute.return_value': '''
# show inventory
NAME: "WS-C6503-E", DESCR: "Cisco Systems Catalyst 6500 3-slot Chassis System"
PID: WS-C6503-E , VID: V03, SN: FXS1821Q2H9
NAME: "CLK-7600 1", DESCR: "OSR-7600 Clock FRU 1"
PID: CLK-7600 , VID: , SN: FXS181101V4
NAME: "CLK-7600 2", DESCR: "OSR-7600 Clock FRU 2"
PID: CLK-7600 , VID: , SN: FXS181101V4
NAME: "1", DESCR: "WS-SUP720-3BXL 2 ports Supervisor Engine 720 Rev. 5.6"
PID: WS-SUP720-3BXL , VID: V05, SN: SAL11434P2C
NAME: "msfc sub-module of 1", DESCR: "WS-SUP720 MSFC3 Daughterboard Rev. 3.1"
PID: WS-SUP720 , VID: , SN: SAL11434N9G
NAME: "switching engine sub-module of 1", DESCR: "WS-F6K-PFC3BXL Policy Feature Card 3 Rev. 1.8"
PID: WS-F6K-PFC3BXL , VID: V01, SN: SAL11434LYG
NAME: "2", DESCR: "WS-X6748-GE-TX CEF720 48 port 10/100/1000mb Ethernet Rev. 2.6"
PID: WS-X6748-GE-TX , VID: V02, SN: SAL1128UPQ9
NAME: "switching engine sub-module of 2", DESCR: "WS-F6700-DFC3CXL Distributed Forwarding Card 3 Rev. 1.1"
PID: WS-F6700-DFC3CXL , VID: V01, SN: SAL1214LAG5
NAME: "WS-C6503-E-FAN 1", DESCR: "Enhanced 3-slot Fan Tray 1"
PID: WS-C6503-E-FAN , VID: V02, SN: DCH183500KW
NAME: "PS 1 PWR-1400-AC", DESCR: "AC power supply, 1400 watt 1"
PID: PWR-1400-AC , VID: V01, SN: ABC0830J127
'''}
golden_output_4 = {'execute.return_value': '''
NAME: "1", DESCR: "WS-C8888X-88"
PID: WS-C0123X-45T-S , VID: V00 , SN: FDO123R12W
NAME: "Switch 1 - Power Supply 1", DESCR: "ABC Power Supply"
PID: C3KX-PWR-350WAC , VID: V01D , SN: DTN1504L0E9
NAME: "TenGigabitEthernet1/1/1", DESCR: "SFP-10GBase-SR"
PID: SFP-10G-SR , VID: V03 , SN: SPC1519005V
NAME: "2", DESCR: "WS-C3210X-48"
PID: WS-C3210X-48T-S , VID: V02 , SN: FD5678Z90P
NAME: "Switch 2 - Power Supply 1", DESCR: "BCA Power Supply"
PID: C3KX-PWR-007CBA , VID: V01L , SN: LTP13579L3R
NAME: "TenGigabitEthernet2/1/1", DESCR: "SFP-10GBase-LR"
PID: SFP-10G-LR , VID: V02 , SN: ONT182746GZ
NAME: "1", DESCR: "WS-C1010XR-48FPS-I"
PID: WS-C1010XR-48FPS-I, VID: V05 , SN: FD2043B0K3
NAME: "Switch 1 - Power Supply 1", DESCR: "LLL Power Supply"
PID: PWR-C2-2929WAC , VID: V02L , SN: LIT03728KKK
NAME: "Switch 1 - FlexStackPlus Module", DESCR: "Stacking Module"
PID: C1010X-STACK , VID: V02 , SN: FD232323XXZ
NAME: "GigabitEthernet1/0/49", DESCR: "1000BaseSX SFP"
PID: GLC-SX-MMD , VID: V01 , SN: ACW102938VS
'''}
golden_parsed_output_4 = {
'slot': {
'1': {
'rp': {
'WS-C0123X-45T-S': {
'descr': 'WS-C8888X-88',
'name': '1',
'pid': 'WS-C0123X-45T-S',
'sn': 'FDO123R12W',
'subslot': {
'1': {
'C3KX-PWR-350WAC': {
'descr': 'ABC Power Supply',
'name': 'Switch 1 - Power Supply 1',
'pid': 'C3KX-PWR-350WAC',
'sn': 'DTN1504L0E9',
'vid': 'V01D ',
},
},
'1/1/1': {
'SFP-10G-SR': {
'descr': 'SFP-10GBase-SR',
'name': 'TenGigabitEthernet1/1/1',
'pid': 'SFP-10G-SR',
'sn': 'SPC1519005V',
'vid': 'V03 ',
},
},
},
'vid': 'V00 ',
},
'WS-C1010XR-48FPS-I': {
'descr': 'WS-C1010XR-48FPS-I',
'name': '1',
'pid': 'WS-C1010XR-48FPS-I',
'sn': 'FD2043B0K3',
'subslot': {
'1': {
'C1010X-STACK': {
'descr': 'Stacking Module',
'name': 'Switch 1 - FlexStackPlus Module',
'pid': 'C1010X-STACK',
'sn': 'FD232323XXZ',
'vid': 'V02 ',
},
'PWR-C2-2929WAC': {
'descr': 'LLL Power Supply',
'name': 'Switch 1 - Power Supply 1',
'pid': 'PWR-C2-2929WAC',
'sn': 'LIT03728KKK',
'vid': 'V02L ',
},
},
'1/0/49': {
'GLC-SX-MMD': {
'descr': '1000BaseSX SFP',
'name': 'GigabitEthernet1/0/49',
'pid': 'GLC-SX-MMD',
'sn': 'ACW102938VS',
'vid': 'V01 ',
},
},
},
'vid': 'V05 ',
},
},
},
'2': {
'rp': {
'WS-C3210X-48T-S': {
'descr': 'WS-C3210X-48',
'name': '2',
'pid': 'WS-C3210X-48T-S',
'sn': 'FD5678Z90P',
'subslot': {
'2': {
'C3KX-PWR-007CBA': {
'descr': 'BCA Power Supply',
'name': 'Switch 2 - Power Supply 1',
'pid': 'C3KX-PWR-007CBA',
'sn': 'LTP13579L3R',
'vid': 'V01L ',
},
},
'2/1/1': {
'SFP-10G-LR': {
'descr': 'SFP-10GBase-LR',
'name': 'TenGigabitEthernet2/1/1',
'pid': 'SFP-10G-LR',
'sn': 'ONT182746GZ',
'vid': 'V02 ',
},
},
},
'vid': 'V02 ',
},
},
},
},
}
golden_output_5 = {'execute.return_value': '''
best-c3945-IOS3#show inventory
NAME: "CISCO3945-CHASSIS", DESCR: "CISCO3945-CHASSIS"
PID: CISCO3945-CHASSIS , VID: V05 , SN: FGL161010K8
NAME: "Cisco Services Performance Engine 150 for Cisco 3900 ISR on Slot 0", DESCR: "Cisco Services Performance Engine 150 for Cisco 3900 ISR"
PID: C3900-SPE150/K9 , VID: V05 , SN: FOC16050QP6
NAME: "Two-Port Fast Ethernet High Speed WAN Interface Card on Slot 0 SubSlot 3", DESCR: "Two-Port Fast Ethernet High Speed WAN Interface Card"
PID: HWIC-2FE , VID: V02 , SN: FOC16062824
NAME: "C3900 AC Power Supply 1", DESCR: "C3900 AC Power Supply 1"
PID: PWR-3900-AC , VID: V03 , SN: QCS1604P0BT
'''}
golden_parsed_output_5 = {
'main': {
'chassis': {
'CISCO3945-CHASSIS': {
'descr': 'CISCO3945-CHASSIS',
'name': 'CISCO3945-CHASSIS',
'pid': 'CISCO3945-CHASSIS',
'sn': 'FGL161010K8',
'vid': 'V05 ',
},
},
},
'slot': {
'0': {
'rp': {
'C3900-SPE150/K9': {
'descr': 'Cisco Services Performance Engine 150 for Cisco 3900 ISR',
'name': 'Cisco Services Performance Engine 150 for Cisco 3900 ISR on Slot 0',
'pid': 'C3900-SPE150/K9',
'sn': 'FOC16050QP6',
'subslot': {
'3': {
'HWIC-2FE': {
'descr': 'Two-Port Fast Ethernet High Speed WAN Interface Card',
'name': 'Two-Port Fast Ethernet High Speed WAN Interface Card on Slot 0 SubSlot 3',
'pid': 'HWIC-2FE',
'sn': 'FOC16062824',
'vid': 'V02 ',
},
},
},
'vid': 'V05 ',
},
},
},
'C3900 AC Power Supply 1': {
'other': {
'C3900 AC Power Supply 1': {
'descr': 'C3900 AC Power Supply 1',
'name': 'C3900 AC Power Supply 1',
'pid': 'PWR-3900-AC',
'sn': 'QCS1604P0BT',
'vid': 'V03 ',
},
},
},
},
}
golden_output_6 = {'execute.return_value': '''
NAME: "1", DESCR: "SM-ES2-16-P"
PID: SM-ES2-16-P , VID: , SN: FOC09876NP3
'''}
golden_parsed_output_6 = {
'slot': {
'1': {
'lc': {
'SM-ES2-16-P': {
'descr': 'SM-ES2-16-P',
'name': '1',
'pid': 'SM-ES2-16-P',
'sn': 'FOC09876NP3',
'vid': '',
},
},
},
},
}
golden_output_7 = {'execute.return_value': '''
NAME: "2821 chassis", DESCR: "2821 chassis"
PID: CISCO2821 , VID: V07 , SN: FTX1234AMWT
NAME: "VWIC2-2MFT-T1/E1 - 2-Port RJ-48 Multiflex Trunk - T1/E1 on Slot 0 SubSlot 0", DESCR: "VWIC2-2MFT-T1/E1 - 2-Port RJ-48 Multiflex Trunk - T1/E1"
PID: VWIC2-2MFT-T1/E1 , VID: V01 , SN: FOC98675U0D
NAME: "VWIC2-2MFT-T1/E1 - 2-Port RJ-48 Multiflex Trunk - T1/E1 on Slot 0 SubSlot 1", DESCR: "VWIC2-2MFT-T1/E1 - 2-Port RJ-48 Multiflex Trunk - T1/E1"
PID: VWIC2-2MFT-T1/E1 , VID: V01 , SN: FOC98675W3E
NAME: "Virtual Private Network (VPN) Module on Slot 0", DESCR: "Encryption AIM Element"
PID: AIM-VPN/SSL-2 , VID: V01, SN: FOC2837465E
'''}
golden_parsed_output_7 = {
'main': {
'chassis': {
'CISCO2821': {
'descr': '2821 chassis',
'name': '2821 chassis',
'pid': 'CISCO2821',
'sn': 'FTX1234AMWT',
'vid': 'V07 ',
},
},
},
'slot': {
'0': {
'other': {
'AIM-VPN/SSL-2': {
'descr': 'Encryption AIM Element',
'name': 'Virtual Private Network (VPN) Module on Slot 0',
'pid': 'AIM-VPN/SSL-2',
'sn': 'FOC2837465E',
'vid': 'V01',
'subslot': {
'0': {
'VWIC2-2MFT-T1/E1': {
'descr': 'VWIC2-2MFT-T1/E1 - 2-Port RJ-48 Multiflex Trunk - T1/E1',
'name': 'VWIC2-2MFT-T1/E1 - 2-Port RJ-48 Multiflex Trunk - T1/E1 on Slot 0 SubSlot 0',
'pid': 'VWIC2-2MFT-T1/E1',
'sn': 'FOC98675U0D',
'vid': 'V01 ',
},
},
'1': {
'VWIC2-2MFT-T1/E1': {
'descr': 'VWIC2-2MFT-T1/E1 - 2-Port RJ-48 Multiflex Trunk - T1/E1',
'name': 'VWIC2-2MFT-T1/E1 - 2-Port RJ-48 Multiflex Trunk - T1/E1 on Slot 0 SubSlot 1',
'pid': 'VWIC2-2MFT-T1/E1',
'sn': 'FOC98675W3E',
'vid': 'V01 ',
},
},
},
},
},
},
},
}
golden_output_8 = {'execute.return_value': '''
NAME: "3825 chassis", DESCR: "3825 chassis"
PID: CISCO3825 , VID: V05 , SN: FTX7908A3RQ
NAME: "VWIC2-2MFT-T1/E1 - 2-Port RJ-48 Multiflex Trunk - T1/E1 on Slot 0 SubSlot 0", DESCR: "VWIC2-2MFT-T1/E1 - 2-Port RJ-48 Multiflex Trunk - T1/E1"
PID: VWIC2-2MFT-T1/E1 , VID: V01 , SN: FOC65428K9F
NAME: "Wan Interface Card BRI U (2091, 3086) on Slot 0 SubSlot 1", DESCR: "Wan Interface Card BRI U (2091, 3086)"
PID: WIC-1B-U-V2 , VID: V01, SN: 10293847
NAME: "PVDMII DSP SIMM with four DSPs on Slot 0 SubSlot 4", DESCR: "PVDMII DSP SIMM with four DSPs"
PID: PVDM2-64 , VID: V01 , SN: FOC63358WSI
NAME: "High Density Voice Module - 8FXS/DID on Slot 1", DESCR: "High Density Voice Module - 8FXS/DID"
PID: EVM-HD-8FXS/DID , VID: V04 , SN: FOC65798TG8
NAME: "Six port FXO voice interface daughtercard on Slot 1 SubSlot 1", DESCR: "Six port FXO voice interface daughtercard"
PID: EM-HDA-6FXO , VID: V03 , SN: FOC85389QXB
'''}
golden_parsed_output_8 = {
'main': {
'chassis': {
'CISCO3825': {
'descr': '3825 chassis',
'name': '3825 chassis',
'pid': 'CISCO3825',
'sn': 'FTX7908A3RQ',
'vid': 'V05 ',
},
},
},
'slot': {
'0': {
'rp': {
'CISCO3825': {
'subslot': {
'0': {
'VWIC2-2MFT-T1/E1': {
'descr': 'VWIC2-2MFT-T1/E1 - 2-Port RJ-48 Multiflex Trunk - T1/E1',
'name': 'VWIC2-2MFT-T1/E1 - 2-Port RJ-48 Multiflex Trunk - T1/E1 on Slot 0 SubSlot 0',
'pid': 'VWIC2-2MFT-T1/E1',
'sn': 'FOC65428K9F',
'vid': 'V01 ',
},
},
'1': {
'WIC-1B-U-V2': {
'descr': 'Wan Interface Card BRI U (2091, 3086)',
'name': 'Wan Interface Card BRI U (2091, 3086) on Slot 0 SubSlot 1',
'pid': 'WIC-1B-U-V2',
'sn': '10293847',
'vid': 'V01',
},
},
'4': {
'PVDM2-64': {
'descr': 'PVDMII DSP SIMM with four DSPs',
'name': 'PVDMII DSP SIMM with four DSPs on Slot 0 SubSlot 4',
'pid': 'PVDM2-64',
'sn': 'FOC63358WSI',
'vid': 'V01 ',
},
},
},
},
},
},
'1': {
'other': {
'EVM-HD-8FXS/DID': {
'descr': 'High Density Voice Module - 8FXS/DID',
'name': 'High Density Voice Module - 8FXS/DID on Slot 1',
'pid': 'EVM-HD-8FXS/DID',
'sn': 'FOC65798TG8',
'subslot': {
'1': {
'EM-HDA-6FXO': {
'descr': 'Six port FXO voice interface daughtercard',
'name': 'Six port FXO voice interface daughtercard on Slot 1 SubSlot 1',
'pid': 'EM-HDA-6FXO',
'sn': 'FOC85389QXB',
'vid': 'V03 ',
},
},
},
'vid': 'V04 ',
},
},
},
},
}
golden_output_9 = {'execute.return_value': '''
NAME: "3845 chassis", DESCR: "3845 chassis"
PID: CISCO3845 , VID: V05 , SN: FTX6666ARJ9
NAME: "c3845 Motherboard with Gigabit Ethernet on Slot 0", DESCR: "c3845 Motherboard with Gigabit Ethernet"
PID: CISCO3845-MB , VID: V09 , SN: FOC729346GQ
NAME: "Virtual Private Network (VPN) Module on Slot 0", DESCR: "Encryption AIM Element"
PID: AIM-VPN/SSL-3 , VID: V01, SN: FOC758693YO
NAME: "Clear/Subrate T3/E3 WAN on Slot 1", DESCR: "Clear/Subrate T3/E3 WAN"
PID: NM-1T3/E3= , VID: V01 , SN: FOC28476ADM
NAME: "16 Port 10BaseT/100BaseTX EtherSwitch on Slot 2", DESCR: "16 Port 10BaseT/100BaseTX EtherSwitch"
PID: NM-16ESW , VID: V01 , SN: FOC135464KO
NAME: "Gigabit(1000BaseT) module for EtherSwitch NM on Slot 2 SubSlot 0", DESCR: "Gigabit(1000BaseT) module for EtherSwitch NM"
PID: GE-DCARD-ESW , VID: V01 , SN: FOC91864MNN
'''}
golden_parsed_output_9 = {
'main': {
'chassis': {
'CISCO3845': {
'descr': '3845 chassis',
'name': '3845 chassis',
'pid': 'CISCO3845',
'sn': 'FTX6666ARJ9',
'vid': 'V05 ',
},
},
},
'slot': {
'0': {
'lc': {
'CISCO3845-MB': {
'descr': 'c3845 Motherboard with Gigabit Ethernet',
'name': 'c3845 Motherboard with Gigabit Ethernet on Slot 0',
'pid': 'CISCO3845-MB',
'sn': 'FOC729346GQ',
'vid': 'V09 ',
},
},
'other': {
'AIM-VPN/SSL-3': {
'descr': 'Encryption AIM Element',
'name': 'Virtual Private Network (VPN) Module on Slot 0',
'pid': 'AIM-VPN/SSL-3',
'sn': 'FOC758693YO',
'vid': 'V01',
},
},
},
'1': {
'lc': {
'NM-1T3/E3=': {
'descr': 'Clear/Subrate T3/E3 WAN',
'name': 'Clear/Subrate T3/E3 WAN on Slot 1',
'pid': 'NM-1T3/E3=',
'sn': 'FOC28476ADM',
'vid': 'V01 ',
},
},
},
'16': {
'lc': {
'NM-16ESW': {
'descr': '16 Port 10BaseT/100BaseTX EtherSwitch',
'name': '16 Port 10BaseT/100BaseTX EtherSwitch on Slot 2',
'pid': 'NM-16ESW',
'sn': 'FOC135464KO',
'subslot': {
'0': {
'GE-DCARD-ESW': {
'descr': 'Gigabit(1000BaseT) module for EtherSwitch NM',
'name': 'Gigabit(1000BaseT) module for EtherSwitch NM on Slot 2 SubSlot 0',
'pid': 'GE-DCARD-ESW',
'sn': 'FOC91864MNN',
'vid': 'V01 ',
},
},
},
'vid': 'V01 ',
},
},
},
},
}
def test_empty(self):
self.dev1 = Mock(**self.empty_output)
inventory_obj = ShowInventory(device=self.dev1)
with self.assertRaises(SchemaEmptyParserError):
parsed_output = inventory_obj.parse()
def test_golden_iosv(self):
self.maxDiff = None
self.dev_iosv = Mock(**self.golden_output_iosv)
inventory_obj = ShowInventory(device=self.dev_iosv)
parsed_output = inventory_obj.parse()
self.assertEqual(parsed_output, self.golden_parsed_output_iosv)
def test_golden_output_2(self):
self.maxDiff = None
self.device = Mock(**self.golden_output_2)
obj = ShowInventory(device=self.device)
parsed_output = obj.parse()
self.assertEqual(parsed_output, self.golden_parsed_output_2)
def test_golden_output_3(self):
self.maxDiff = None
self.device = Mock(**self.golden_output_3)
obj = ShowInventory(device=self.device)
parsed_output = obj.parse()
self.assertEqual(parsed_output, self.golden_parsed_output_3)
def test_golden_output_4(self):
self.maxDiff = None
self.device = Mock(**self.golden_output_4)
obj = ShowInventory(device=self.device)
parsed_output = obj.parse()
self.assertEqual(parsed_output, self.golden_parsed_output_4)
def test_golden_output_5(self):
self.maxDiff = None
self.device = Mock(**self.golden_output_5)
obj = ShowInventory(device=self.device)
parsed_output = obj.parse()
self.assertEqual(parsed_output, self.golden_parsed_output_5)
def test_golden_output_6(self):
self.maxDiff = None
self.device = Mock(**self.golden_output_6)
obj = ShowInventory(device=self.device)
parsed_output = obj.parse()
self.assertEqual(parsed_output, self.golden_parsed_output_6)
def test_golden_output_7(self):
self.maxDiff = None
self.device = Mock(**self.golden_output_7)
obj = ShowInventory(device=self.device)
parsed_output = obj.parse()
self.assertEqual(parsed_output, self.golden_parsed_output_7)
def test_golden_output_8(self):
self.maxDiff = None
self.device = Mock(**self.golden_output_8)
obj = ShowInventory(device=self.device)
parsed_output = obj.parse()
self.assertEqual(parsed_output, self.golden_parsed_output_8)
def test_golden_output_9(self):
self.maxDiff = None
self.device = Mock(**self.golden_output_9)
obj = ShowInventory(device=self.device)
parsed_output = obj.parse()
self.assertEqual(parsed_output, self.golden_parsed_output_9)
class test_show_bootvar(unittest.TestCase):
dev = Device(name='ios')
dev_iosv = Device(name='iosv')
empty_output = {'execute.return_value': ''}
golden_parsed_output_iosv = {
"active": {
"boot_variable": "disk0:s72033-adventerprisek9-mz.122-33.SRE0a-ssr-nxos-76k-1,12",
"configuration_register": "0x2012"
},
"next_reload_boot_variable": "disk0:s72033-adventerprisek9-mz.122-33.SRE0a-ssr-nxos-76k-1,12"
}
golden_output_iosv = {'execute.return_value': '''\
BOOT variable = disk0:s72033-adventerprisek9-mz.122-33.SRE0a-ssr-nxos-76k-1,12;
CONFIG_FILE variable =
BOOTLDR variable =
Configuration register is 0x2012
Standby not ready to show bootvar
'''}
def test_empty(self):
self.dev = Mock(**self.empty_output)
platform_obj = ShowBootvar(device=self.dev)
with self.assertRaises(SchemaEmptyParserError):
parsed_output = platform_obj.parse()
def test_golden(self):
self.maxDiff = None
self.dev_iosv = Mock(**self.golden_output_iosv)
platform_obj = ShowBootvar(device=self.dev_iosv)
parsed_output = platform_obj.parse()
self.assertEqual(parsed_output, self.golden_parsed_output_iosv)
class test_show_processes_cpu_sorted_CPU(unittest.TestCase):
dev = Device(name='c3850')
empty_output = {'execute.return_value': ''}
golden_parsed_output = {
"five_sec_cpu_total": 13,
"five_min_cpu": 15,
"one_min_cpu": 23,
"five_sec_cpu_interrupts": 0
}
golden_output = {'execute.return_value': '''\
show processes cpu sorted 5min | inc CPU
CPU utilization for five seconds: 13%/0%; one minute: 23%; five minutes: 15%
'''}
golden_parsed_output_1 = {
"sort": {
1: {
"invoked": 3321960,
"usecs": 109,
"tty": 0,
"one_min_cpu": 0.54,
"process": "PIM Process",
"five_min_cpu": 0.48,
"runtime": 362874,
"pid": 368,
"five_sec_cpu": 1.03
},
2: {
"invoked": 1466728,
"usecs": 2442,
"tty": 0,
"one_min_cpu": 0.87,
"process": "IOSv e1000",
"five_min_cpu": 2.77,
"runtime": 3582279,
"pid": 84,
"five_sec_cpu": 0.55
},
3: {
"invoked": 116196,
"usecs": 976,
"tty": 0,
"one_min_cpu": 0.07,
"process": "OSPF-1 Hello",
"five_min_cpu": 0.07,
"runtime": 113457,
"pid": 412,
"five_sec_cpu": 0.15
}
},
"five_sec_cpu_total": 4,
"five_min_cpu": 9,
"one_min_cpu": 4,
"nonzero_cpu_processes": [
"PIM Process",
"IOSv e1000",
"OSPF-1 Hello"
],
"five_sec_cpu_interrupts": 0
}
golden_output_1 = {'execute.return_value': '''
CPU utilization for five seconds: 4%/0%; one minute: 4%; five minutes: 9%
PID Runtime(ms) Invoked uSecs 5Sec 1Min 5Min TTY Process
368 362874 3321960 109 1.03% 0.54% 0.48% 0 PIM Process
84 3582279 1466728 2442 0.55% 0.87% 2.77% 0 IOSv e1000
412 113457 116196 976 0.15% 0.07% 0.07% 0 OSPF-1 Hello
'''}
def test_empty(self):
self.dev = Mock(**self.empty_output)
obj = ShowProcessesCpuSorted(device=self.dev)
with self.assertRaises(SchemaEmptyParserError):
parsered_output = obj.parse()
def test_golden(self):
self.maxDiff = None
self.dev = Mock(**self.golden_output)
obj = ShowProcessesCpuSorted(device=self.dev)
parsed_output = obj.parse(key_word='CPU', sort_time='5min')
self.assertEqual(parsed_output, self.golden_parsed_output)
def test_golden_1(self):
self.maxDiff = None
self.dev = Mock(**self.golden_output_1)
obj = ShowProcessesCpuSorted(device=self.dev)
parsed_output = obj.parse()
self.assertEqual(parsed_output, self.golden_parsed_output_1)
class test_show_processes_cpu(test_show_processes_cpu_iosxe):
def test_golden(self):
self.device = Mock(**self.golden_output)
obj = ShowProcessesCpu(device=self.device)
parsed_output = obj.parse()
self.maxDiff = None
self.assertEqual(parsed_output, self.golden_parsed_output)
def test_golden_1(self):
self.maxDiff = None
self.device = Mock(**self.golden_output_1)
obj = ShowProcessesCpu(device=self.device)
parsed_output = obj.parse(key_word='process')
self.assertEqual(parsed_output, self.golden_parsed_output_1)
def test_empty(self):
self.device1 = Mock(**self.empty_output)
obj = ShowProcessesCpu(device=self.device1)
with self.assertRaises(SchemaEmptyParserError):
parsed_output = obj.parse()
class test_show_version_rp(test_show_version_rp_iosxe):
def test_golden_active(self):
self.device = Mock(**self.golden_output_active)
obj = ShowVersionRp(device=self.device)
parsed_output = obj.parse(rp='active', status='running')
self.maxDiff = None
self.assertEqual(parsed_output, self.golden_parsed_output_active)
def test_golden_standby(self):
self.device = Mock(**self.golden_output_standby)
obj = ShowVersionRp(device=self.device)
parsed_output = obj.parse(rp='standby', status='running')
self.maxDiff = None
self.assertEqual(parsed_output, self.golden_parsed_output_standby)
def test_golden_standby_offline(self):
self.device = Mock(**self.golden_output_standby_offline)
obj = ShowVersionRp(device=self.device)
self.maxDiff = None
with self.assertRaises(SchemaEmptyParserError):
parsed_output = obj.parse(rp='standby', status='running')
def test_empty(self):
self.device1 = Mock(**self.empty_output)
obj = ShowVersionRp(device=self.device1)
with self.assertRaises(SchemaEmptyParserError):
parsed_output = obj.parse()
class test_show_platform(test_show_platform_iosxe):
def test_empty(self):
self.dev1 = Mock(**self.empty_output)
platform_obj = ShowPlatform(device=self.dev1)
with self.assertRaises(SchemaEmptyParserError):
parsed_output = platform_obj.parse()
def test_semi_empty(self):
self.dev2 = Mock(**self.semi_empty_output)
platform_obj = ShowPlatform(device=self.dev2)
with self.assertRaises(SchemaEmptyParserError):
parsed_output = platform_obj.parse()
def test_golden_c3850(self):
self.maxDiff = None
self.dev_c3850 = Mock(**self.golden_output_c3850)
platform_obj = ShowPlatform(device=self.dev_c3850)
parsed_output = platform_obj.parse()
self.assertEqual(parsed_output, self.golden_parsed_output_c3850)
def test_golden_asr1k(self):
self.maxDiff = None
self.dev_asr1k = Mock(**self.golden_output_asr1k)
platform_obj = ShowPlatform(device=self.dev_asr1k)
parsed_output = platform_obj.parse()
self.assertEqual(parsed_output, self.golden_parsed_output_asr1k)
class test_show_platform_power(test_show_platform_power_iosxe):
def test_empty(self):
self.device = Mock(**self.empty_output)
platform_obj = ShowPlatformPower(device=self.device)
with self.assertRaises(SchemaEmptyParserError):
parsed_output = platform_obj.parse()
def test_golden(self):
self.maxDiff = None
self.device = Mock(**self.golden_output)
platform_obj = ShowPlatformPower(device=self.device)
parsed_output = platform_obj.parse()
self.assertEqual(parsed_output, self.golden_parsed_output)
class test_show_processes_cpu_history(test_show_processes_cpu_history_iosxe):
def test_empty(self):
self.device = Mock(**self.empty_output)
platform_obj = ShowProcessesCpuHistory(device=self.device)
with self.assertRaises(SchemaEmptyParserError):
parsed_output = platform_obj.parse()
def test_golden(self):
self.maxDiff = None
self.device = Mock(**self.golden_output)
platform_obj = ShowProcessesCpuHistory(device=self.device)
parsed_output = platform_obj.parse()
self.assertEqual(parsed_output, self.golden_parsed_output)
class test_show_processes_cpu_platform(test_show_processes_cpu_platform_iosxe):
def test_golden(self):
self.device = Mock(**self.golden_output)
cpu_platform_obj = ShowProcessesCpuPlatform(device=self.device)
parsed_output = cpu_platform_obj.parse()
self.maxDiff = None
self.assertEqual(parsed_output, self.golden_parsed_output)
def test_empty(self):
self.device1 = Mock(**self.empty_output)
cpu_platform_obj = ShowProcessesCpuPlatform(device=self.device1)
with self.assertRaises(SchemaEmptyParserError):
parsed_output = cpu_platform_obj.parse()
class test_show_platform_software_status_control_processor_brief(test_show_platform_software_status_control_processor_brief_iosxe):
def test_empty(self):
self.dev = Mock(**self.empty_output)
obj = ShowPlatformSoftwareStatusControl(device=self.dev)
with self.assertRaises(SchemaEmptyParserError):
parsered_output = obj.parse()
def test_golden(self):
self.maxDiff = None
self.dev = Mock(**self.golden_output)
obj = ShowPlatformSoftwareStatusControl(device=self.dev)
parsed_output = obj.parse()
self.assertEqual(parsed_output, self.golden_parsed_output)
class test_show_platform_software_slot_active_monitor_Mem(test_show_platform_software_slot_active_monitor_Mem_iosxe):
def test_empty(self):
self.dev = Mock(**self.empty_output)
obj = ShowPlatformSoftwareSlotActiveMonitorMem(device=self.dev)
with self.assertRaises(SchemaEmptyParserError):
parsered_output = obj.parse()
def test_golden(self):
self.maxDiff = None
self.dev = Mock(**self.golden_output)
obj = ShowPlatformSoftwareSlotActiveMonitorMem(device=self.dev)
parsed_output = obj.parse()
self.assertEqual(parsed_output, self.golden_parsed_output)
class test_show_platform_hardware(test_show_platform_hardware_iosxe):
def test_golden_active(self):
self.device = Mock(**self.golden_output_active)
obj = ShowPlatformHardware(device=self.device)
parsed_output = obj.parse()
self.maxDiff = None
self.assertEqual(parsed_output, self.golden_parsed_output_active)
def test_empty(self):
self.device1 = Mock(**self.empty_output)
obj = ShowPlatformHardware(device=self.device1)
with self.assertRaises(SchemaEmptyParserError):
parsed_output = obj.parse()
class test_show_platform_hardware_plim(test_show_platform_hardware_plim_iosxe):
def test_golden_port(self):
self.device = Mock(**self.golden_output_port)
obj = ShowPlatformHardwarePlim(device=self.device)
parsed_output = obj.parse(port='0/0/0')
self.maxDiff = None
self.assertEqual(parsed_output, self.golden_parsed_output_port)
def test_golden_slot(self):
self.device = Mock(**self.golden_output_slot)
obj = ShowPlatformHardwarePlim(device=self.device)
parsed_output = obj.parse(slot='0')
self.maxDiff = None
self.assertEqual(parsed_output, self.golden_parsed_output_slot)
def test_golden_subslot(self):
self.device = Mock(**self.golden_output_subslot)
obj = ShowPlatformHardwarePlim(device=self.device)
parsed_output = obj.parse(subslot='0/1')
self.maxDiff = None
self.assertEqual(parsed_output, self.golden_parsed_output_subslot)
def test_golden_slot_internal(self):
self.device = Mock(**self.golden_output_slot_internal)
obj = ShowPlatformHardwarePlim(device=self.device)
parsed_output = obj.parse(slot='0', internal=True)
self.maxDiff = None
self.assertEqual(
parsed_output, self.golden_parsed_output_slot_internal)
def test_empty(self):
self.device1 = Mock(**self.empty_output)
obj = ShowPlatformHardwarePlim(device=self.device1)
with self.assertRaises(SchemaEmptyParserError):
parsed_output = obj.parse(port='0/0/0')
class test_show_platform_hardware_qfp_bqs_opm_mapping(test_show_platform_hardware_qfp_bqs_opm_mapping_iosxe):
def test_golden_active_opm(self):
self.device = Mock(**self.golden_output_active_opm)
obj = ShowPlatformHardwareQfpBqsOpmMapping(device=self.device)
parsed_output = obj.parse(status='active', slot='0')
self.maxDiff = None
self.assertEqual(parsed_output, self.golden_parsed_output_active_opm)
def test_empty(self):
self.device1 = Mock(**self.empty_output)
obj = ShowPlatformHardwareQfpBqsOpmMapping(device=self.device1)
with self.assertRaises(SchemaEmptyParserError):
parsed_output = obj.parse(status='active', slot='0')
class test_show_platform_hardware_qfp_bqs_ipm_mapping(test_show_platform_hardware_qfp_bqs_ipm_mapping_iosxe):
def test_golden_active_ipm(self):
self.device = Mock(**self.golden_output_active_ipm)
obj = ShowPlatformHardwareQfpBqsIpmMapping(device=self.device)
parsed_output = obj.parse(status='active', slot='0')
self.maxDiff = None
self.assertEqual(parsed_output, self.golden_parsed_output_active_ipm)
def test_empty(self):
self.device1 = Mock(**self.empty_output)
obj = ShowPlatformHardwareQfpBqsIpmMapping(device=self.device1)
with self.assertRaises(SchemaEmptyParserError):
parsed_output = obj.parse(status='active', slot='0')
class test_show_platform_hardware_serdes_statistics(test_show_platform_hardware_serdes_statistics_iosxe):
def test_golden_serdes(self):
self.device = Mock(**self.golden_output_serdes)
obj = ShowPlatformHardwareSerdes(device=self.device)
parsed_output = obj.parse(slot='0')
self.maxDiff = None
self.assertEqual(parsed_output, self.golden_parsed_output_serdes)
def test_empty(self):
self.device1 = Mock(**self.empty_output)
obj = ShowPlatformHardwareSerdes(device=self.device1)
with self.assertRaises(SchemaEmptyParserError):
parsed_output = obj.parse(slot='0')
class test_show_platform_hardware_serdes_statistics_internal(test_show_platform_hardware_serdes_statistics_internal_iosxe):
def test_golden(self):
self.device = Mock(**self.golden_output_serdes_internal)
obj = ShowPlatformHardwareSerdesInternal(device=self.device)
parsed_output = obj.parse(slot='0')
self.maxDiff = None
self.assertEqual(
parsed_output, self.golden_parsed_output_serdes_internal)
def test_empty(self):
self.device1 = Mock(**self.empty_output)
obj = ShowPlatformHardwareSerdesInternal(device=self.device1)
with self.assertRaises(SchemaEmptyParserError):
parsed_output = obj.parse(slot='0')
class show_platform_hardware_qfp_bqs_statistics_channel_all(show_platform_hardware_qfp_bqs_statistics_channel_all_iosxe):
def test_empty(self):
self.device = Mock(**self.empty_output)
platform_obj = ShowPlatformHardwareQfpBqsStatisticsChannelAll(
device=self.device)
with self.assertRaises(SchemaEmptyParserError):
parsed_output = platform_obj.parse(
status='active', slot='0', iotype='ipm')
def test_golden_active_ipm(self):
self.maxDiff = None
self.device = Mock(**self.golden_output_active_ipm)
platform_obj = ShowPlatformHardwareQfpBqsStatisticsChannelAll(
device=self.device)
parsed_output = platform_obj.parse(
status='active', slot='0', iotype='ipm')
self.assertEqual(parsed_output, self.golden_parsed_output_active_ipm)
def test_golden_active_opm(self):
self.maxDiff = None
self.device = Mock(**self.golden_output_active_opm)
platform_obj = ShowPlatformHardwareQfpBqsStatisticsChannelAll(
device=self.device)
parsed_output = platform_obj.parse(
status='active', slot='0', iotype='opm')
self.assertEqual(parsed_output, self.golden_parsed_output_active_opm)
class show_platform_hardware_qfp_interface(show_platform_hardware_qfp_interface_iosxe):
def test_empty(self):
self.device = Mock(**self.empty_output)
platform_obj = ShowPlatformHardwareQfpInterfaceIfnameStatistics(
device=self.device)
with self.assertRaises(SchemaEmptyParserError):
parsed_output = platform_obj.parse(
status='active', interface='gigabitEthernet 0/0/0')
def test_golden(self):
self.maxDiff = None
self.device = Mock(**self.golden_output)
platform_obj = ShowPlatformHardwareQfpInterfaceIfnameStatistics(
device=self.device)
parsed_output = platform_obj.parse(
status='active', interface='gigabitEthernet 0/0/0')
self.assertEqual(parsed_output, self.golden_parsed_output)
class test_show_platform_hardware_qfp_statistics_drop(test_show_platform_hardware_qfp_statistics_drop_iosxe):
def test_empty(self):
self.device = Mock(**self.empty_output)
platform_obj = ShowPlatformHardwareQfpStatisticsDrop(
device=self.device)
with self.assertRaises(SchemaEmptyParserError):
parsed_output = platform_obj.parse(status='active')
def test_golden_active(self):
self.maxDiff = None
self.device = Mock(**self.golden_output_active)
platform_obj = ShowPlatformHardwareQfpStatisticsDrop(
device=self.device)
parsed_output = platform_obj.parse(status='active')
self.assertEqual(parsed_output, self.golden_parsed_output_active)
class test_show_env(test_show_env_iosxe):
def test_empty(self):
self.dev = Mock(**self.empty_output)
obj = ShowEnvironment(device=self.dev)
with self.assertRaises(SchemaEmptyParserError):
parsered_output = obj.parse()
def test_golden(self):
self.maxDiff = None
self.dev = Mock(**self.golden_output)
obj = ShowEnvironment(device=self.dev)
parsed_output = obj.parse()
self.assertEqual(parsed_output, self.golden_parsed_output)
class test_show_module(test_show_module_iosxe):
def test_empty(self):
self.dev1 = Mock(**self.empty_output)
platform_obj = ShowModule(device=self.dev1)
with self.assertRaises(SchemaEmptyParserError):
parsed_output = platform_obj.parse()
def test_golden(self):
self.maxDiff = None
self.dev_c3850 = Mock(**self.golden_output_c3850)
platform_obj = ShowModule(device=self.dev_c3850)
parsed_output = platform_obj.parse()
self.assertEqual(parsed_output,self.golden_parsed_output_c3850)
class test_show_switch(test_show_switch_iosxe):
def test_empty(self):
self.dev1 = Mock(**self.empty_output)
platform_obj = ShowSwitch(device=self.dev1)
with self.assertRaises(SchemaEmptyParserError):
parsed_output = platform_obj.parse()
def test_golden(self):
self.maxDiff = None
self.dev_c3850 = Mock(**self.golden_output_c3850)
platform_obj = ShowSwitch(device=self.dev_c3850)
parsed_output = platform_obj.parse()
self.assertEqual(parsed_output,self.golden_parsed_output_c3850)
class test_show_switch_detail(test_show_switch_detail_iosxe):
def test_empty(self):
self.dev1 = Mock(**self.empty_output)
platform_obj = ShowSwitchDetail(device=self.dev1)
with self.assertRaises(SchemaEmptyParserError):
parsed_output = platform_obj.parse()
def test_golden(self):
self.maxDiff = None
self.dev_c3850 = Mock(**self.golden_output_c3850)
platform_obj = ShowSwitchDetail(device=self.dev_c3850)
parsed_output = platform_obj.parse()
self.assertEqual(parsed_output,self.golden_parsed_output_c3850)
if __name__ == '__main__':
unittest.main()
| en | 0.671614 | #!/bin/env python \ ROM: Bootstrap program is IOSv \ Cisco IOS Software, IOSv Software (VIOS-ADVENTERPRISEK9-M), Version 15.6(3)M2, RELEASE SOFTWARE (fc2) Technical Support: http://www.cisco.com/techsupport Copyright (c) 1986-2017 by Cisco Systems, Inc. Compiled Wed 29-Mar-17 14:05 by prod_rel_team ROM: Bootstrap program is IOSv N95_1 uptime is 1 day, 16 hours, 42 minutes System returned to ROM by reload System image file is "flash0:/vios-adventerprisek9-m" Last reload reason: Unknown reason This product contains cryptographic features and is subject to United States and local country laws governing import, export, transfer and use. Delivery of Cisco cryptographic products does not imply third-party authority to import, export, distribute or use encryption. Importers, exporters, distributors and users are responsible for compliance with U.S. and local country laws. By using this product you agree to comply with applicable laws and regulations. If you are unable to comply with U.S. and local laws, return this product immediately. A summary of U.S. laws governing Cisco cryptographic products may be found at: http://www.cisco.com/wwl/export/crypto/tool/stqrg.html If you require further assistance please contact us by sending email to <EMAIL>. Cisco IOSv (revision 1.0) with with 435457K/87040K bytes of memory. Processor board ID 9K66Z7TOKAACDEQA24N7S 6 Gigabit Ethernet interfaces DRAM configuration is 72 bits wide with parity disabled. 256K bytes of non-volatile configuration memory. 2097152K bytes of ATA System CompactFlash 0 (Read/Write) 0K bytes of ATA CompactFlash 1 (Read/Write) 0K bytes of ATA CompactFlash 2 (Read/Write) 10080K bytes of ATA CompactFlash 3 (Read/Write) Configuration register is 0x0 \ Cisco IOS Software, C3750E Software (C3750E-UNIVERSALK9-M), Version 12.2(55)SE8, RELEASE SOFTWARE (fc2) Technical Support: http://www.cisco.com/techsupport Copyright (c) 1986-2013 by Cisco Systems, Inc. Compiled Wed 26-Jun-13 09:56 by prod_rel_team Image text-base: 0x00003000, data-base: 0x02800000 ROM: Bootstrap program is C3750E boot loader BOOTLDR: C3750E Boot Loader (C3750X-HBOOT-M) Version 15.2(3r)E, RELEASE SOFTWARE (fc1) R5 uptime is 9 weeks, 4 days, 2 hours, 3 minutes System returned to ROM by power-on System restarted at 12:22:21 PDT Mon Sep 10 2018 System image file is "flash:c3750e-universalk9-mz" This product contains cryptographic features and is subject to United States and local country laws governing import, export, transfer and use. Delivery of Cisco cryptographic products does not imply third-party authority to import, export, distribute or use encryption. Importers, exporters, distributors and users are responsible for compliance with U.S. and local country laws. By using this product you agree to comply with applicable laws and regulations. If you are unable to comply with U.S. and local laws, return this product immediately. A summary of U.S. laws governing Cisco cryptographic products may be found at: http://www.cisco.com/wwl/export/crypto/tool/stqrg.html If you require further assistance please contact us by sending email to <EMAIL>. License Level: ipservices License Type: Permanent Next reload license Level: ipservices cisco WS-C3750X-24P (PowerPC405) processor (revision W0) with 262144K bytes of memory. Processor board ID FDO2028F1WK Last reset from power-on 2 Virtual Ethernet interfaces 1 FastEthernet interface 28 Gigabit Ethernet interfaces 2 Ten Gigabit Ethernet interfaces The password-recovery mechanism is enabled. 512K bytes of flash-simulated non-volatile configuration memory. Base ethernet MAC Address : 84:3D:C6:FF:F1:B8 Motherboard assembly number : 73-15476-04 Motherboard serial number : FDO202907UH Model revision number : W0 Motherboard revision number : B0 Model number : WS-C3750X-24P-L Daughterboard assembly number : 800-32727-03 Daughterboard serial number : FDO202823P8 System serial number : FDO2028F1WK Top Assembly Part Number : 800-38990-01 Top Assembly Revision Number : F0 Version ID : V07 CLEI Code Number : CMMPP00DRB Hardware Board Revision Number : 0x05 Switch Ports Model SW Version SW Image ------ ----- ----- ---------- ---------- * 1 30 WS-C3750X-24P 12.2(55)SE8 C3750E-UNIVERSALK9-M Configuration register is 0xF show version Cisco Internetwork Operating System Software IOS (tm) s72033_rp Software (s72033_rp-ADVENTERPRISEK9_WAN-M), Version 12.2(18)SXF7, RELEASE SOFTWARE (fc1) Technical Support: http://www.cisco.com/techsupport Copyright (c) 1986-2006 by cisco Systems, Inc. Compiled Thu 23-Nov-06 06:26 by kellythw Image text-base: 0x40101040, data-base: 0x42D98000 ROM: System Bootstrap, Version 12.2(17r)S4, RELEASE SOFTWARE (fc1) BOOTLDR: s72033_rp Software (s72033_rp-ADVENTERPRISEK9_WAN-M), Version 12.2(18)SXF7, RELEASE SOFTWARE (fc1) cat6k_tb1 uptime is 10 weeks, 5 days, 5 hours, 16 minutes Time since cat6k_tb1 switched to active is 10 weeks, 5 days, 5 hours, 15 minutes System returned to ROM by power cycle at 21:57:23 UTC Sat Aug 28 2010 (SP by power on) System image file is "disk0:s72033-adventerprisek9_wan-mz.122-18.SXF7" This product contains cryptographic features and is subject to United States and local country laws governing import, export, transfer and use. Delivery of Cisco cryptographic products does not imply third-party authority to import, export, distribute or use encryption. Importers, exporters, distributors and users are responsible for compliance with U.S. and local country laws. By using this product you agree to comply with applicable laws and regulations. If you are unable to comply with U.S. and local laws, return this product immediately. A summary of U.S. laws governing Cisco cryptographic products may be found at: http://www.cisco.com/wwl/export/crypto/tool/stqrg.html If you require further assistance please contact us by sending email to <EMAIL>. cisco WS-C6503-E (R7000) processor (revision 1.4) with 983008K/65536K bytes of memory. Processor board ID FXS1821Q2H9 SR71000 CPU at 600Mhz, Implementation 0x504, Rev 1.2, 512KB L2 Cache Last reset from s/w reset SuperLAT software (copyright 1990 by Meridian Technology Corp). X.25 software, Version 3.0.0. Bridging software. TN3270 Emulation software. 1 Virtual Ethernet/IEEE 802.3 interface 50 Gigabit Ethernet/IEEE 802.3 interfaces 1917K bytes of non-volatile configuration memory. 8192K bytes of packet buffer memory. 65536K bytes of Flash internal SIMM (Sector size 512K). Configuration register is 0x2102 \ Cisco IOS Software, C3750E Software (C3750E-UNIVERSALK9-M), Version 15.2(2)E8, RELEASE SOFTWARE (fc1) Technical Support: http://www.cisco.com/techsupport Copyright (c) 1986-2018 by Cisco Systems, Inc. Compiled Mon 22-Jan-18 04:07 by prod_rel_team ROM: Bootstrap program is C3750E boot loader BOOTLDR: C3750E Boot Loader (C3750X-HBOOT-M) Version 12.2(58r)SE, RELEASE SOFTWARE (fc1) sample_switch uptime is 8 weeks, 3 days, 10 hours, 27 minutes System returned to ROM by power-on System restarted at 05:06:40 GMT Tue Sep 10 2019 System image file is "flash:c3750e-universalk9-mz.152-2.E8.bin" Last reload reason: Reload command This product contains cryptographic features and is subject to United States and local country laws governing import, export, transfer and use. Delivery of Cisco cryptographic products does not imply third-party authority to import, export, distribute or use encryption. Importers, exporters, distributors and users are responsible for compliance with U.S. and local country laws. By using this product you agree to comply with applicable laws and regulations. If you are unable to comply with U.S. and local laws, return this product immediately. A summary of U.S. laws governing Cisco cryptographic products may be found at: http://www.cisco.com/wwl/export/crypto/tool/stqrg.html If you require further assistance please contact us by sending email to <EMAIL>. License Level: ipservices License Type: Permanent Next reload license Level: ipservices cisco WS-C3750X-24S (PowerPC405) processor (revision A0) with 524288K bytes of memory. Processor board ID FDO1633Q14S Last reset from power-on 14 Virtual Ethernet interfaces 1 FastEthernet interface 28 Gigabit Ethernet interfaces 2 Ten Gigabit Ethernet interfaces The password-recovery mechanism is enabled. 512K bytes of flash-simulated non-volatile configuration memory. Base ethernet MAC Address : AC:F2:C5:FF:55:E7 Motherboard assembly number : 73-13061-04 Motherboard serial number : FDO1633Q14M Model revision number : A0 Motherboard revision number : A0 Model number : WS-C3750X-24S-E Daughterboard assembly number : 800-32727-03 Daughterboard serial number : FDO172217ED System serial number : FDO1633Q14S Top Assembly Part Number : 800-33746-04 Top Assembly Revision Number : B0 Version ID : V03 CLEI Code Number : CMMFF00ARC Hardware Board Revision Number : 0x04 Switch Ports Model SW Version SW Image ------ ----- ----- ---------- ---------- * 1 30 WS-C3750X-24S 15.2(2)E8 C3750E-UNIVERSALK9-M Configuration register is 0xF best-c3945-IOS3#show version Cisco IOS Software, C3900 Software (C3900-UNIVERSALK9-M), Version 15.0(1)M7, RELEASE SOFTWARE (fc2) Technical Support: http://www.cisco.com/techsupport Copyright (c) 1986-2011 by Cisco Systems, Inc. Compiled Fri 05-Aug-11 00:32 by prod_rel_team ROM: System Bootstrap, Version 15.0(1r)M13, RELEASE SOFTWARE (fc1) best-c3945-IOS3 uptime is 1 hour, 20 minutes System returned to ROM by reload at 10:26:47 EST Mon Dec 9 2019 System restarted at 10:27:57 EST Mon Dec 9 2019 System image file is "flash0:c3900-universalk9-mz.SPA.150-1.M7.bin" Last reload type: Normal Reload Last reload reason: Reload Command This product contains cryptographic features and is subject to United States and local country laws governing import, export, transfer and use. Delivery of Cisco cryptographic products does not imply third-party authority to import, export, distribute or use encryption. Importers, exporters, distributors and users are responsible for compliance with U.S. and local country laws. By using this product you agree to comply with applicable laws and regulations. If you are unable to comply with U.S. and local laws, return this product immediately. A summary of U.S. laws governing Cisco cryptographic products may be found at: http://www.cisco.com/wwl/export/crypto/tool/stqrg.html If you require further assistance please contact us by sending email to <EMAIL>. Cisco CISCO3945-CHASSIS (revision 1.1) with C3900-SPE150/K9 with 2027520K/69632K bytes of memory. Processor board ID FGL161010K8 2 FastEthernet interfaces 3 Gigabit Ethernet interfaces 1 Virtual Private Network (VPN) Module DRAM configuration is 72 bits wide with parity enabled. 255K bytes of non-volatile configuration memory. 2000880K bytes of ATA System CompactFlash 0 (Read/Write) License Info: License UDI: ------------------------------------------------- Device# PID SN ------------------------------------------------- *0 C3900-SPE150/K9 FOC16050QP6 Technology Package License Information for Module:'c3900' ----------------------------------------------------------------- Technology Technology-package Technology-package Current Type Next reboot ------------------------------------------------------------------ ipbase ipbasek9 Permanent ipbasek9 security securityk9 Permanent securityk9 uc None None None data datak9 Permanent datak9 Configuration register is 0x2102 \ Directory of flash:/ \ Directory of flash0:/ 1 drw- 0 Jan 30 2013 00:00:00 +00:00 boot 264 drw- 0 Oct 14 2013 00:00:00 +00:00 config 267 -rw- 147988420 Mar 29 2017 00:00:00 +00:00 vios-adventerprisek9-m 268 -rw- 524288 Oct 17 2018 18:57:10 +00:00 nvram 269 -rw- 119 Oct 17 2018 18:57:18 +00:00 e1000_bia.txt 2142715904 bytes total (1989595136 bytes free) \ Redundant System Information : ------------------------------ Available system uptime = 0 minutes Switchovers system experienced = 0 Standby failures = 0 Last switchover reason = unsupported Hardware Mode = Simplex Maintenance Mode = Disabled Communications = Down Reason: Failure Current Processor Information : ------------------------------- Active Location = slot 0 Current Software state = ACTIVE Uptime in current state = 1 day, 16 hours, 42 minutes Image Version = Cisco IOS Software, IOSv Software (VIOS-ADVENTERPRISEK9-M), Version 15.6(3)M2, RELEASE SOFTWARE (fc2) Technical Support: http://www.cisco.com/techsupport Copyright (c) 1986-2017 by Cisco Systems, Inc. Compiled Wed 29-Mar-17 14:05 by prod_rel_team Configuration register = 0x0 Peer (slot: 0) information is not available because it is in 'DISABLED' state #: 9K66Z7TOKAACDEQA24N7S, Hw Revision: 1.0', \ NAME: "IOSv", DESCR: "IOSv chassis, Hw Serial#: 9K66Z7TOKAACDEQA24N7S, Hw Revision: 1.0" PID: IOSv , VID: 1.0, SN: 9K66Z7TOKAACDEQA24N7S NAME: "WS-C6504-E", DESCR: "Cisco Systems Cisco 6500 4-slot Chassis System" PID: WS-C6504-E , VID: V01, SN: FXS1712Q1R8 NAME: "CLK-7600 1", DESCR: "OSR-7600 Clock FRU 1" PID: CLK-7600 , VID: , SN: FXS170802GL NAME: "CLK-7600 2", DESCR: "OSR-7600 Clock FRU 2" PID: CLK-7600 , VID: , SN: FXS170802GL NAME: "1", DESCR: "VS-SUP2T-10G 5 ports Supervisor Engine 2T 10GE w/ CTS Rev. 1.5" PID: VS-SUP2T-10G , VID: V05, SN: SAL17152N0F NAME: "msfc sub-module of 1", DESCR: "VS-F6K-MSFC5 CPU Daughterboard Rev. 2.0" PID: VS-F6K-MSFC5 , VID: , SN: SAL17142D06 NAME: "VS-F6K-PFC4 Policy Feature Card 4 EARL sub-module of 1", DESCR: "VS-F6K-PFC4 Policy Feature Card 4 Rev. 2.0" PID: VS-F6K-PFC4 , VID: V03, SN: SAL17163901 NAME: "Transceiver Te1/4", DESCR: "X2 Transceiver 10Gbase-SR Te1/4" PID: X2-10GB-SR , VID: V06 , SN: ONT170202T1 NAME: "Transceiver Te1/5", DESCR: "X2 Transceiver 10Gbase-SR Te1/5" PID: X2-10GB-SR , VID: V06 , SN: ONT1702033D NAME: "2", DESCR: "WS-X6816-10GE CEF720 16 port 10GE Rev. 2.0" PID: WS-X6816-10GE , VID: V02, SN: SAL17152QB3 NAME: "WS-F6K-DFC4-E Distributed Forwarding Card 4 EARL sub-module of 2", DESCR: "WS-F6K-DFC4-E Distributed Forwarding Card 4 Rev. 1.2" PID: WS-F6K-DFC4-E , VID: V02, SN: SAL171846RF NAME: "Transceiver Te2/1", DESCR: "X2 Transceiver 10Gbase-SR Te2/1" PID: X2-10GB-SR , VID: V06 , SN: ONT17020338 NAME: "Transceiver Te2/2", DESCR: "X2 Transceiver 10Gbase-SR Te2/2" PID: X2-10GB-SR , VID: V06 , SN: ONT1702020H NAME: "Transceiver Te2/3", DESCR: "X2 Transceiver 10Gbase-SR Te2/3" PID: X2-10GB-SR , VID: V06 , SN: ONT170202UU NAME: "Transceiver Te2/4", DESCR: "X2 Transceiver 10Gbase-SR Te2/4" PID: X2-10GB-SR , VID: V06 , SN: ONT170202T5 NAME: "Transceiver Te2/5", DESCR: "X2 Transceiver 10Gbase-SR Te2/5" PID: X2-10GB-SR , VID: V05 , SN: AGA1515XZE2 NAME: "Transceiver Te2/6", DESCR: "X2 Transceiver 10Gbase-SR Te2/6" PID: X2-10GB-SR , VID: V06 , SN: FNS153920YJ NAME: "Transceiver Te2/16", DESCR: "X2 Transceiver 10Gbase-SR Te2/16" PID: X2-10GB-SR , VID: V06 , SN: ONT170201TT NAME: "3", DESCR: "WS-X6824-SFP CEF720 24 port 1000mb SFP Rev. 1.0" PID: WS-X6824-SFP , VID: V01, SN: SAL17152EG9 NAME: "WS-F6K-DFC4-A Distributed Forwarding Card 4 EARL sub-module of 3", DESCR: "WS-F6K-DFC4-A Distributed Forwarding Card 4 Rev. 1.0" PID: WS-F6K-DFC4-A , VID: V04, SN: SAL171848KL NAME: "4", DESCR: "WS-X6748-GE-TX CEF720 48 port 10/100/1000mb Ethernet Rev. 3.4" PID: WS-X6748-GE-TX , VID: V04, SN: SAL14017TWF NAME: "WS-F6700-CFC Centralized Forwarding Card EARL sub-module of 4", DESCR: "WS-F6700-CFC Centralized Forwarding Card Rev. 4.1" PID: WS-F6700-CFC , VID: V06, SN: SAL13516QS8 NAME: "FAN-MOD-4HS 1", DESCR: "High Speed Fan Module for CISCO7604 1" PID: FAN-MOD-4HS , VID: V01, SN: DCH170900PF NAME: "PS 1 PWR-2700-AC/4", DESCR: "2700W AC power supply for CISCO7604 1" PID: PWR-2700-AC/4 , VID: V03, SN: APS1707008Y NAME: "PS 2 PWR-2700-AC/4", DESCR: "2700W AC power supply for CISCO7604 2" PID: PWR-2700-AC/4 , VID: V03, SN: APS17070093 # show inventory NAME: "WS-C6503-E", DESCR: "Cisco Systems Catalyst 6500 3-slot Chassis System" PID: WS-C6503-E , VID: V03, SN: FXS1821Q2H9 NAME: "CLK-7600 1", DESCR: "OSR-7600 Clock FRU 1" PID: CLK-7600 , VID: , SN: FXS181101V4 NAME: "CLK-7600 2", DESCR: "OSR-7600 Clock FRU 2" PID: CLK-7600 , VID: , SN: FXS181101V4 NAME: "1", DESCR: "WS-SUP720-3BXL 2 ports Supervisor Engine 720 Rev. 5.6" PID: WS-SUP720-3BXL , VID: V05, SN: SAL11434P2C NAME: "msfc sub-module of 1", DESCR: "WS-SUP720 MSFC3 Daughterboard Rev. 3.1" PID: WS-SUP720 , VID: , SN: SAL11434N9G NAME: "switching engine sub-module of 1", DESCR: "WS-F6K-PFC3BXL Policy Feature Card 3 Rev. 1.8" PID: WS-F6K-PFC3BXL , VID: V01, SN: SAL11434LYG NAME: "2", DESCR: "WS-X6748-GE-TX CEF720 48 port 10/100/1000mb Ethernet Rev. 2.6" PID: WS-X6748-GE-TX , VID: V02, SN: SAL1128UPQ9 NAME: "switching engine sub-module of 2", DESCR: "WS-F6700-DFC3CXL Distributed Forwarding Card 3 Rev. 1.1" PID: WS-F6700-DFC3CXL , VID: V01, SN: SAL1214LAG5 NAME: "WS-C6503-E-FAN 1", DESCR: "Enhanced 3-slot Fan Tray 1" PID: WS-C6503-E-FAN , VID: V02, SN: DCH183500KW NAME: "PS 1 PWR-1400-AC", DESCR: "AC power supply, 1400 watt 1" PID: PWR-1400-AC , VID: V01, SN: ABC0830J127 NAME: "1", DESCR: "WS-C8888X-88" PID: WS-C0123X-45T-S , VID: V00 , SN: FDO123R12W NAME: "Switch 1 - Power Supply 1", DESCR: "ABC Power Supply" PID: C3KX-PWR-350WAC , VID: V01D , SN: DTN1504L0E9 NAME: "TenGigabitEthernet1/1/1", DESCR: "SFP-10GBase-SR" PID: SFP-10G-SR , VID: V03 , SN: SPC1519005V NAME: "2", DESCR: "WS-C3210X-48" PID: WS-C3210X-48T-S , VID: V02 , SN: FD5678Z90P NAME: "Switch 2 - Power Supply 1", DESCR: "BCA Power Supply" PID: C3KX-PWR-007CBA , VID: V01L , SN: LTP13579L3R NAME: "TenGigabitEthernet2/1/1", DESCR: "SFP-10GBase-LR" PID: SFP-10G-LR , VID: V02 , SN: ONT182746GZ NAME: "1", DESCR: "WS-C1010XR-48FPS-I" PID: WS-C1010XR-48FPS-I, VID: V05 , SN: FD2043B0K3 NAME: "Switch 1 - Power Supply 1", DESCR: "LLL Power Supply" PID: PWR-C2-2929WAC , VID: V02L , SN: LIT03728KKK NAME: "Switch 1 - FlexStackPlus Module", DESCR: "Stacking Module" PID: C1010X-STACK , VID: V02 , SN: FD232323XXZ NAME: "GigabitEthernet1/0/49", DESCR: "1000BaseSX SFP" PID: GLC-SX-MMD , VID: V01 , SN: ACW102938VS best-c3945-IOS3#show inventory NAME: "CISCO3945-CHASSIS", DESCR: "CISCO3945-CHASSIS" PID: CISCO3945-CHASSIS , VID: V05 , SN: FGL161010K8 NAME: "Cisco Services Performance Engine 150 for Cisco 3900 ISR on Slot 0", DESCR: "Cisco Services Performance Engine 150 for Cisco 3900 ISR" PID: C3900-SPE150/K9 , VID: V05 , SN: FOC16050QP6 NAME: "Two-Port Fast Ethernet High Speed WAN Interface Card on Slot 0 SubSlot 3", DESCR: "Two-Port Fast Ethernet High Speed WAN Interface Card" PID: HWIC-2FE , VID: V02 , SN: FOC16062824 NAME: "C3900 AC Power Supply 1", DESCR: "C3900 AC Power Supply 1" PID: PWR-3900-AC , VID: V03 , SN: QCS1604P0BT NAME: "1", DESCR: "SM-ES2-16-P" PID: SM-ES2-16-P , VID: , SN: FOC09876NP3 NAME: "2821 chassis", DESCR: "2821 chassis" PID: CISCO2821 , VID: V07 , SN: FTX1234AMWT NAME: "VWIC2-2MFT-T1/E1 - 2-Port RJ-48 Multiflex Trunk - T1/E1 on Slot 0 SubSlot 0", DESCR: "VWIC2-2MFT-T1/E1 - 2-Port RJ-48 Multiflex Trunk - T1/E1" PID: VWIC2-2MFT-T1/E1 , VID: V01 , SN: FOC98675U0D NAME: "VWIC2-2MFT-T1/E1 - 2-Port RJ-48 Multiflex Trunk - T1/E1 on Slot 0 SubSlot 1", DESCR: "VWIC2-2MFT-T1/E1 - 2-Port RJ-48 Multiflex Trunk - T1/E1" PID: VWIC2-2MFT-T1/E1 , VID: V01 , SN: FOC98675W3E NAME: "Virtual Private Network (VPN) Module on Slot 0", DESCR: "Encryption AIM Element" PID: AIM-VPN/SSL-2 , VID: V01, SN: FOC2837465E NAME: "3825 chassis", DESCR: "3825 chassis" PID: CISCO3825 , VID: V05 , SN: FTX7908A3RQ NAME: "VWIC2-2MFT-T1/E1 - 2-Port RJ-48 Multiflex Trunk - T1/E1 on Slot 0 SubSlot 0", DESCR: "VWIC2-2MFT-T1/E1 - 2-Port RJ-48 Multiflex Trunk - T1/E1" PID: VWIC2-2MFT-T1/E1 , VID: V01 , SN: FOC65428K9F NAME: "Wan Interface Card BRI U (2091, 3086) on Slot 0 SubSlot 1", DESCR: "Wan Interface Card BRI U (2091, 3086)" PID: WIC-1B-U-V2 , VID: V01, SN: 10293847 NAME: "PVDMII DSP SIMM with four DSPs on Slot 0 SubSlot 4", DESCR: "PVDMII DSP SIMM with four DSPs" PID: PVDM2-64 , VID: V01 , SN: FOC63358WSI NAME: "High Density Voice Module - 8FXS/DID on Slot 1", DESCR: "High Density Voice Module - 8FXS/DID" PID: EVM-HD-8FXS/DID , VID: V04 , SN: FOC65798TG8 NAME: "Six port FXO voice interface daughtercard on Slot 1 SubSlot 1", DESCR: "Six port FXO voice interface daughtercard" PID: EM-HDA-6FXO , VID: V03 , SN: FOC85389QXB NAME: "3845 chassis", DESCR: "3845 chassis" PID: CISCO3845 , VID: V05 , SN: FTX6666ARJ9 NAME: "c3845 Motherboard with Gigabit Ethernet on Slot 0", DESCR: "c3845 Motherboard with Gigabit Ethernet" PID: CISCO3845-MB , VID: V09 , SN: FOC729346GQ NAME: "Virtual Private Network (VPN) Module on Slot 0", DESCR: "Encryption AIM Element" PID: AIM-VPN/SSL-3 , VID: V01, SN: FOC758693YO NAME: "Clear/Subrate T3/E3 WAN on Slot 1", DESCR: "Clear/Subrate T3/E3 WAN" PID: NM-1T3/E3= , VID: V01 , SN: FOC28476ADM NAME: "16 Port 10BaseT/100BaseTX EtherSwitch on Slot 2", DESCR: "16 Port 10BaseT/100BaseTX EtherSwitch" PID: NM-16ESW , VID: V01 , SN: FOC135464KO NAME: "Gigabit(1000BaseT) module for EtherSwitch NM on Slot 2 SubSlot 0", DESCR: "Gigabit(1000BaseT) module for EtherSwitch NM" PID: GE-DCARD-ESW , VID: V01 , SN: FOC91864MNN \ BOOT variable = disk0:s72033-adventerprisek9-mz.122-33.SRE0a-ssr-nxos-76k-1,12; CONFIG_FILE variable = BOOTLDR variable = Configuration register is 0x2012 Standby not ready to show bootvar \ show processes cpu sorted 5min | inc CPU CPU utilization for five seconds: 13%/0%; one minute: 23%; five minutes: 15% CPU utilization for five seconds: 4%/0%; one minute: 4%; five minutes: 9% PID Runtime(ms) Invoked uSecs 5Sec 1Min 5Min TTY Process 368 362874 3321960 109 1.03% 0.54% 0.48% 0 PIM Process 84 3582279 1466728 2442 0.55% 0.87% 2.77% 0 IOSv e1000 412 113457 116196 976 0.15% 0.07% 0.07% 0 OSPF-1 Hello | 1.581451 | 2 |
autumn/projects/covid_19/sri_lanka/sri_lanka/project.py | emmamcbryde/AuTuMN-1 | 0 | 2860 | <filename>autumn/projects/covid_19/sri_lanka/sri_lanka/project.py
import numpy as np
from autumn.calibration.proposal_tuning import perform_all_params_proposal_tuning
from autumn.core.project import Project, ParameterSet, load_timeseries, build_rel_path, get_all_available_scenario_paths, \
use_tuned_proposal_sds
from autumn.calibration import Calibration
from autumn.calibration.priors import UniformPrior, BetaPrior,TruncNormalPrior
from autumn.calibration.targets import (
NormalTarget,
get_dispersion_priors_for_gaussian_targets,
)
from autumn.models.covid_19 import base_params, build_model
from autumn.settings import Region, Models
from autumn.projects.covid_19.sri_lanka.sri_lanka.scenario_builder import get_all_scenario_dicts
# Load and configure model parameters.
default_path = build_rel_path("params/default.yml")
#scenario_paths = [build_rel_path(f"params/scenario-{i}.yml") for i in range(7, 9)]
mle_path = build_rel_path("params/mle-params.yml")
baseline_params = base_params.update(default_path).update(mle_path, calibration_format=True)
all_scenario_dicts = get_all_scenario_dicts("LKA")
#scenario_params = [baseline_params.update(p) for p in scenario_paths]
scenario_params = [baseline_params.update(sc_dict) for sc_dict in all_scenario_dicts]
param_set = ParameterSet(baseline=baseline_params, scenarios=scenario_params)
ts_set = load_timeseries(build_rel_path("timeseries.json"))
notifications_ts = ts_set["notifications"].rolling(7).mean().loc[350::7]
death_ts = ts_set["infection_deaths"].loc[350:]
targets = [
NormalTarget(notifications_ts),
NormalTarget(death_ts),
]
priors = [
# Dispersion parameters based on targets
*get_dispersion_priors_for_gaussian_targets(targets),
*get_dispersion_priors_for_gaussian_targets(targets),
# Regional parameters
UniformPrior("contact_rate", [0.024, 0.027]),
UniformPrior("infectious_seed", [275.0, 450.0]),
# Detection
UniformPrior("testing_to_detection.assumed_cdr_parameter", [0.009, 0.025]),
UniformPrior("infection_fatality.multiplier", [0.09, 0.13]),
#VoC
UniformPrior("voc_emergence.alpha_beta.start_time", [370, 410]),
UniformPrior("voc_emergence.alpha_beta.contact_rate_multiplier", [3.2, 4.5]),
UniformPrior("voc_emergence.delta.start_time", [475, 530]),
UniformPrior("voc_emergence.delta.contact_rate_multiplier", [8.5, 11.5]),
]
# Load proposal sds from yml file
# use_tuned_proposal_sds(priors, build_rel_path("proposal_sds.yml"))
calibration = Calibration(priors, targets)
# FIXME: Replace with flexible Python plot request API.
import json
plot_spec_filepath = build_rel_path("timeseries.json")
with open(plot_spec_filepath) as f:
plot_spec = json.load(f)
project = Project(
Region.SRI_LANKA, Models.COVID_19, build_model, param_set, calibration, plots=plot_spec
)
#perform_all_params_proposal_tuning(project, calibration, priors, n_points=50, relative_likelihood_reduction=0.2) | <filename>autumn/projects/covid_19/sri_lanka/sri_lanka/project.py
import numpy as np
from autumn.calibration.proposal_tuning import perform_all_params_proposal_tuning
from autumn.core.project import Project, ParameterSet, load_timeseries, build_rel_path, get_all_available_scenario_paths, \
use_tuned_proposal_sds
from autumn.calibration import Calibration
from autumn.calibration.priors import UniformPrior, BetaPrior,TruncNormalPrior
from autumn.calibration.targets import (
NormalTarget,
get_dispersion_priors_for_gaussian_targets,
)
from autumn.models.covid_19 import base_params, build_model
from autumn.settings import Region, Models
from autumn.projects.covid_19.sri_lanka.sri_lanka.scenario_builder import get_all_scenario_dicts
# Load and configure model parameters.
default_path = build_rel_path("params/default.yml")
#scenario_paths = [build_rel_path(f"params/scenario-{i}.yml") for i in range(7, 9)]
mle_path = build_rel_path("params/mle-params.yml")
baseline_params = base_params.update(default_path).update(mle_path, calibration_format=True)
all_scenario_dicts = get_all_scenario_dicts("LKA")
#scenario_params = [baseline_params.update(p) for p in scenario_paths]
scenario_params = [baseline_params.update(sc_dict) for sc_dict in all_scenario_dicts]
param_set = ParameterSet(baseline=baseline_params, scenarios=scenario_params)
ts_set = load_timeseries(build_rel_path("timeseries.json"))
notifications_ts = ts_set["notifications"].rolling(7).mean().loc[350::7]
death_ts = ts_set["infection_deaths"].loc[350:]
targets = [
NormalTarget(notifications_ts),
NormalTarget(death_ts),
]
priors = [
# Dispersion parameters based on targets
*get_dispersion_priors_for_gaussian_targets(targets),
*get_dispersion_priors_for_gaussian_targets(targets),
# Regional parameters
UniformPrior("contact_rate", [0.024, 0.027]),
UniformPrior("infectious_seed", [275.0, 450.0]),
# Detection
UniformPrior("testing_to_detection.assumed_cdr_parameter", [0.009, 0.025]),
UniformPrior("infection_fatality.multiplier", [0.09, 0.13]),
#VoC
UniformPrior("voc_emergence.alpha_beta.start_time", [370, 410]),
UniformPrior("voc_emergence.alpha_beta.contact_rate_multiplier", [3.2, 4.5]),
UniformPrior("voc_emergence.delta.start_time", [475, 530]),
UniformPrior("voc_emergence.delta.contact_rate_multiplier", [8.5, 11.5]),
]
# Load proposal sds from yml file
# use_tuned_proposal_sds(priors, build_rel_path("proposal_sds.yml"))
calibration = Calibration(priors, targets)
# FIXME: Replace with flexible Python plot request API.
import json
plot_spec_filepath = build_rel_path("timeseries.json")
with open(plot_spec_filepath) as f:
plot_spec = json.load(f)
project = Project(
Region.SRI_LANKA, Models.COVID_19, build_model, param_set, calibration, plots=plot_spec
)
#perform_all_params_proposal_tuning(project, calibration, priors, n_points=50, relative_likelihood_reduction=0.2) | en | 0.55141 | # Load and configure model parameters. #scenario_paths = [build_rel_path(f"params/scenario-{i}.yml") for i in range(7, 9)] #scenario_params = [baseline_params.update(p) for p in scenario_paths] # Dispersion parameters based on targets # Regional parameters # Detection #VoC # Load proposal sds from yml file # use_tuned_proposal_sds(priors, build_rel_path("proposal_sds.yml")) # FIXME: Replace with flexible Python plot request API. #perform_all_params_proposal_tuning(project, calibration, priors, n_points=50, relative_likelihood_reduction=0.2) | 1.866327 | 2 |
Analytics/resources/themes/test_subthemes.py | thanosbnt/SharingCitiesDashboard | 4 | 2861 | import unittest
from http import HTTPStatus
from unittest import TestCase
import bcrypt
from flask.ctx import AppContext
from flask.testing import FlaskClient
from app import create_app
from models.theme import Theme, SubTheme
from models.users import Users
class TestSubTemes(TestCase):
"""
Unittest for the creation, renaming and deleting of Themes
"""
def setUp(self):
"""
Setup a FlaskClient for testing, creates an admin user and creates the authorization header for requests to
the Flask Client and a dummy theme
"""
self.client, self.app_context = self.create_test_client()
self.user = self.create_admin_user()
self.auth_header = self.get_auth_header()
self.theme = Theme.get_by_name("_test_add_Subtheme_")
if not self.theme:
self.theme = Theme("_test_add_Subtheme_")
self.theme.save()
self.theme.commit()
self.theme = Theme.get_by_name("_test_add_Subtheme_")
self.subtheme = self.create_dummy_subtheme()
def create_test_client(self) -> (FlaskClient, AppContext):
"""
Create flask testing client
:return: FlaskClient for tests and AppContext
"""
test_app = create_app(DATABASE_NAME='test_analysis', TESTING=True)
testing_client = test_app.test_client()
test_app_context = test_app.app_context()
test_app_context.push()
return testing_client, test_app_context
def create_dummy_subtheme(self) -> SubTheme:
"""
Create SubTheme for tests
:return: SubTheme for tests
"""
subtheme = SubTheme.get_by_name('_TEST_SUB_THEME_')
if not subtheme:
subtheme = SubTheme(self.theme.id, '_TEST_SUB_THEME_')
subtheme.save()
subtheme.commit()
subtheme = SubTheme.get_by_name('_TEST_SUB_THEME_')
return subtheme
def create_admin_user(self) -> Users:
"""
Create Admin user for tests
:return: an admin user for tests
"""
password_hash = bcrypt.hashpw("<PASSWORD>".encode("utf-8"), bcrypt.gensalt())
user = Users.find_by_email("<EMAIL>")
if not user:
user = Users("Admin", "<EMAIL>", password_hash.decode("utf8"), True, True)
try:
user.save()
user.commit()
except Exception as e:
pass
return user
def get_auth_header(self) -> {str: str}:
"""
Create an Authorization header for test
:return: An authorization header
"""
response_login = self.client.post('/login', data=dict(email=self.user.email, password="<PASSWORD>", remember=True),
follow_redirects=True)
response_login_json = response_login.get_json()
return {'Authorization': 'Bearer {}'.format(response_login_json["access_token"])}
def test_add_subtheme(self):
"""
Create a new SubTheme and check the client response status code for http status 200 (OK)
Check JSON response data for the expected message 'New theme created' and
Theme name
"""
response = self.client.post('/admin/themes/add_subtheme',
json={"theme_id": self.theme.id, "subtheme": "_TEST_SUB_THEME_2"},
headers=self.auth_header)
self.assertEqual(response.status_code, HTTPStatus.OK)
json_response = response.get_json()
self.assertEqual(json_response["message"], "sub theme created")
self.assertEqual(json_response["theme_id"], self.theme.id)
self.assertEqual(json_response["subtheme"], "_TEST_SUB_THEME_2")
def test_rename_subtheme_theme_id(self):
"""
Rename a SubTheme by theme_id and check the clients response status code for http status 200 (OK)
Check response data for the expected message 'Subtheme renamed' and the
Subtheme name has been changed
"""
if not self.subtheme:
self.subtheme = self.create_dummy_subtheme()
current_name = self.subtheme.name
response = self.client.post('/admin/themes/rename_subtheme', json={"theme_id": self.subtheme.t_id,
"current_name": current_name,
"new_name": "new_name_not_1"
}, headers=self.auth_header)
self.assertEqual(response.status_code, HTTPStatus.OK)
response = response.get_json()
self.assertEqual(response["id"], self.subtheme.id)
self.assertEqual(response["message"], "Subtheme renamed")
self.assertEqual(response["old_name"], current_name)
self.assertEqual(response["new_name"], "new_name_not_1")
def test_rename_subtheme_id(self):
"""
Rename a SubTheme by id and check the clients response status code for http status 200 (OK)
Check response data for the expected message 'Subtheme renamed' and the
Subtheme name has been changed
"""
if not self.subtheme:
self.subtheme = self.create_dummy_subtheme()
current_name = self.subtheme.name
response = self.client.post('/admin/themes/rename_subtheme', json={"id": self.subtheme.id,
"current_name": current_name,
"new_name": "new_name_not_1"
}, headers=self.auth_header)
self.assertEqual(response.status_code, HTTPStatus.OK)
response = response.get_json()
self.assertEqual(response["id"], self.subtheme.id)
self.assertEqual(response["message"], "Subtheme renamed")
self.assertEqual(response["old_name"], current_name)
self.assertEqual(response["new_name"], "new_name_not_1")
def test_rename_non_existant_subtheme(self):
"""
Rename a SubTheme that does not exist and check the clients response status code for http status 404 (OK)
"""
response = self.client.post('/admin/themes/rename_subtheme', json={"theme_id": -1,
"current_name": "a3d4f5g6h7j8k0",
"new_name": "new_name_not_1"
}, headers=self.auth_header)
self.assertEqual(response.status_code, HTTPStatus.NOT_FOUND)
def test_delete_non_exsitant_subtheme(self):
"""
Delete a SubTheme that does not exist and check the client response status code for http status 404
"""
if not self.subtheme:
self.subtheme = self.create_dummy_subtheme()
response = self.client.post('/admin/themes/delete_subtheme',
json={"name": "weA_gfj24fhurtyui", "theme_id": -1},
headers=self.auth_header)
self.assertEqual(response.status_code, HTTPStatus.NOT_FOUND)
def test_delete_subtheme_by_id(self):
"""
Delete a SubTheme by id and check the client response status code for http status 204 (NO_CONTENT)
"""
if not self.subtheme:
self.subtheme = self.create_dummy_subtheme()
response = self.client.post('/admin/themes/delete_subtheme', json={"id": self.subtheme.id},
headers=self.auth_header)
self.assertEqual(response.status_code, HTTPStatus.NO_CONTENT)
def test_delete_subtheme_by_theme_id_and_name(self):
"""
Delete a SubTheme by theme_id and name: check the client response status code for http status 204 (NO_CONTENT)
"""
if not self.subtheme:
self.subtheme = self.create_dummy_subtheme()
response = self.client.post('/admin/themes/delete_subtheme',
json={"theme_id": self.subtheme.t_id, "name": self.subtheme.name},
headers=self.auth_header)
self.assertEqual(response.status_code, HTTPStatus.NO_CONTENT)
def tearDown(self):
""" Handle the cleanup after tests"""
self.subtheme = SubTheme.get_by_name("new_name_not_1")
if not self.subtheme:
self.subtheme = SubTheme.get_by_name("_TEST_SUB_THEME_")
if self.subtheme:
self.subtheme.delete()
self.subtheme.commit()
test_sub = SubTheme.get_by_name("_TEST_SUB_THEME_2")
if test_sub:
test_sub.delete()
test_sub.commit()
if self.theme:
self.theme.delete()
self.theme.commit()
self.client.post('/logout', headers=self.auth_header)
if self.user:
self.user.delete()
self.user.commit()
self.app_context.pop()
if __name__ == '__main__':
unittest.main()
| import unittest
from http import HTTPStatus
from unittest import TestCase
import bcrypt
from flask.ctx import AppContext
from flask.testing import FlaskClient
from app import create_app
from models.theme import Theme, SubTheme
from models.users import Users
class TestSubTemes(TestCase):
"""
Unittest for the creation, renaming and deleting of Themes
"""
def setUp(self):
"""
Setup a FlaskClient for testing, creates an admin user and creates the authorization header for requests to
the Flask Client and a dummy theme
"""
self.client, self.app_context = self.create_test_client()
self.user = self.create_admin_user()
self.auth_header = self.get_auth_header()
self.theme = Theme.get_by_name("_test_add_Subtheme_")
if not self.theme:
self.theme = Theme("_test_add_Subtheme_")
self.theme.save()
self.theme.commit()
self.theme = Theme.get_by_name("_test_add_Subtheme_")
self.subtheme = self.create_dummy_subtheme()
def create_test_client(self) -> (FlaskClient, AppContext):
"""
Create flask testing client
:return: FlaskClient for tests and AppContext
"""
test_app = create_app(DATABASE_NAME='test_analysis', TESTING=True)
testing_client = test_app.test_client()
test_app_context = test_app.app_context()
test_app_context.push()
return testing_client, test_app_context
def create_dummy_subtheme(self) -> SubTheme:
"""
Create SubTheme for tests
:return: SubTheme for tests
"""
subtheme = SubTheme.get_by_name('_TEST_SUB_THEME_')
if not subtheme:
subtheme = SubTheme(self.theme.id, '_TEST_SUB_THEME_')
subtheme.save()
subtheme.commit()
subtheme = SubTheme.get_by_name('_TEST_SUB_THEME_')
return subtheme
def create_admin_user(self) -> Users:
"""
Create Admin user for tests
:return: an admin user for tests
"""
password_hash = bcrypt.hashpw("<PASSWORD>".encode("utf-8"), bcrypt.gensalt())
user = Users.find_by_email("<EMAIL>")
if not user:
user = Users("Admin", "<EMAIL>", password_hash.decode("utf8"), True, True)
try:
user.save()
user.commit()
except Exception as e:
pass
return user
def get_auth_header(self) -> {str: str}:
"""
Create an Authorization header for test
:return: An authorization header
"""
response_login = self.client.post('/login', data=dict(email=self.user.email, password="<PASSWORD>", remember=True),
follow_redirects=True)
response_login_json = response_login.get_json()
return {'Authorization': 'Bearer {}'.format(response_login_json["access_token"])}
def test_add_subtheme(self):
"""
Create a new SubTheme and check the client response status code for http status 200 (OK)
Check JSON response data for the expected message 'New theme created' and
Theme name
"""
response = self.client.post('/admin/themes/add_subtheme',
json={"theme_id": self.theme.id, "subtheme": "_TEST_SUB_THEME_2"},
headers=self.auth_header)
self.assertEqual(response.status_code, HTTPStatus.OK)
json_response = response.get_json()
self.assertEqual(json_response["message"], "sub theme created")
self.assertEqual(json_response["theme_id"], self.theme.id)
self.assertEqual(json_response["subtheme"], "_TEST_SUB_THEME_2")
def test_rename_subtheme_theme_id(self):
"""
Rename a SubTheme by theme_id and check the clients response status code for http status 200 (OK)
Check response data for the expected message 'Subtheme renamed' and the
Subtheme name has been changed
"""
if not self.subtheme:
self.subtheme = self.create_dummy_subtheme()
current_name = self.subtheme.name
response = self.client.post('/admin/themes/rename_subtheme', json={"theme_id": self.subtheme.t_id,
"current_name": current_name,
"new_name": "new_name_not_1"
}, headers=self.auth_header)
self.assertEqual(response.status_code, HTTPStatus.OK)
response = response.get_json()
self.assertEqual(response["id"], self.subtheme.id)
self.assertEqual(response["message"], "Subtheme renamed")
self.assertEqual(response["old_name"], current_name)
self.assertEqual(response["new_name"], "new_name_not_1")
def test_rename_subtheme_id(self):
"""
Rename a SubTheme by id and check the clients response status code for http status 200 (OK)
Check response data for the expected message 'Subtheme renamed' and the
Subtheme name has been changed
"""
if not self.subtheme:
self.subtheme = self.create_dummy_subtheme()
current_name = self.subtheme.name
response = self.client.post('/admin/themes/rename_subtheme', json={"id": self.subtheme.id,
"current_name": current_name,
"new_name": "new_name_not_1"
}, headers=self.auth_header)
self.assertEqual(response.status_code, HTTPStatus.OK)
response = response.get_json()
self.assertEqual(response["id"], self.subtheme.id)
self.assertEqual(response["message"], "Subtheme renamed")
self.assertEqual(response["old_name"], current_name)
self.assertEqual(response["new_name"], "new_name_not_1")
def test_rename_non_existant_subtheme(self):
"""
Rename a SubTheme that does not exist and check the clients response status code for http status 404 (OK)
"""
response = self.client.post('/admin/themes/rename_subtheme', json={"theme_id": -1,
"current_name": "a3d4f5g6h7j8k0",
"new_name": "new_name_not_1"
}, headers=self.auth_header)
self.assertEqual(response.status_code, HTTPStatus.NOT_FOUND)
def test_delete_non_exsitant_subtheme(self):
"""
Delete a SubTheme that does not exist and check the client response status code for http status 404
"""
if not self.subtheme:
self.subtheme = self.create_dummy_subtheme()
response = self.client.post('/admin/themes/delete_subtheme',
json={"name": "weA_gfj24fhurtyui", "theme_id": -1},
headers=self.auth_header)
self.assertEqual(response.status_code, HTTPStatus.NOT_FOUND)
def test_delete_subtheme_by_id(self):
"""
Delete a SubTheme by id and check the client response status code for http status 204 (NO_CONTENT)
"""
if not self.subtheme:
self.subtheme = self.create_dummy_subtheme()
response = self.client.post('/admin/themes/delete_subtheme', json={"id": self.subtheme.id},
headers=self.auth_header)
self.assertEqual(response.status_code, HTTPStatus.NO_CONTENT)
def test_delete_subtheme_by_theme_id_and_name(self):
"""
Delete a SubTheme by theme_id and name: check the client response status code for http status 204 (NO_CONTENT)
"""
if not self.subtheme:
self.subtheme = self.create_dummy_subtheme()
response = self.client.post('/admin/themes/delete_subtheme',
json={"theme_id": self.subtheme.t_id, "name": self.subtheme.name},
headers=self.auth_header)
self.assertEqual(response.status_code, HTTPStatus.NO_CONTENT)
def tearDown(self):
""" Handle the cleanup after tests"""
self.subtheme = SubTheme.get_by_name("new_name_not_1")
if not self.subtheme:
self.subtheme = SubTheme.get_by_name("_TEST_SUB_THEME_")
if self.subtheme:
self.subtheme.delete()
self.subtheme.commit()
test_sub = SubTheme.get_by_name("_TEST_SUB_THEME_2")
if test_sub:
test_sub.delete()
test_sub.commit()
if self.theme:
self.theme.delete()
self.theme.commit()
self.client.post('/logout', headers=self.auth_header)
if self.user:
self.user.delete()
self.user.commit()
self.app_context.pop()
if __name__ == '__main__':
unittest.main()
| en | 0.818775 | Unittest for the creation, renaming and deleting of Themes Setup a FlaskClient for testing, creates an admin user and creates the authorization header for requests to the Flask Client and a dummy theme Create flask testing client :return: FlaskClient for tests and AppContext Create SubTheme for tests :return: SubTheme for tests Create Admin user for tests :return: an admin user for tests Create an Authorization header for test :return: An authorization header Create a new SubTheme and check the client response status code for http status 200 (OK) Check JSON response data for the expected message 'New theme created' and Theme name Rename a SubTheme by theme_id and check the clients response status code for http status 200 (OK) Check response data for the expected message 'Subtheme renamed' and the Subtheme name has been changed Rename a SubTheme by id and check the clients response status code for http status 200 (OK) Check response data for the expected message 'Subtheme renamed' and the Subtheme name has been changed Rename a SubTheme that does not exist and check the clients response status code for http status 404 (OK) Delete a SubTheme that does not exist and check the client response status code for http status 404 Delete a SubTheme by id and check the client response status code for http status 204 (NO_CONTENT) Delete a SubTheme by theme_id and name: check the client response status code for http status 204 (NO_CONTENT) Handle the cleanup after tests | 2.745936 | 3 |
selfdrive/sensord/rawgps/structs.py | TC921/openpilot | 0 | 2862 | from struct import unpack_from, calcsize
LOG_GNSS_POSITION_REPORT = 0x1476
LOG_GNSS_GPS_MEASUREMENT_REPORT = 0x1477
LOG_GNSS_CLOCK_REPORT = 0x1478
LOG_GNSS_GLONASS_MEASUREMENT_REPORT = 0x1480
LOG_GNSS_BDS_MEASUREMENT_REPORT = 0x1756
LOG_GNSS_GAL_MEASUREMENT_REPORT = 0x1886
LOG_GNSS_OEMDRE_MEASUREMENT_REPORT = 0x14DE
LOG_GNSS_OEMDRE_SVPOLY_REPORT = 0x14E1
LOG_GNSS_ME_DPO_STATUS = 0x1838
LOG_GNSS_CD_DB_REPORT = 0x147B
LOG_GNSS_PRX_RF_HW_STATUS_REPORT = 0x147E
LOG_CGPS_SLOW_CLOCK_CLIB_REPORT = 0x1488
LOG_GNSS_CONFIGURATION_STATE = 0x1516
glonass_measurement_report = """
uint8_t version;
uint32_t f_count;
uint8_t glonass_cycle_number;
uint16_t glonass_number_of_days;
uint32_t milliseconds;
float time_bias;
float clock_time_uncertainty;
float clock_frequency_bias;
float clock_frequency_uncertainty;
uint8_t sv_count;
"""
glonass_measurement_report_sv = """
uint8_t sv_id;
int8_t frequency_index;
uint8_t observation_state; // SVObservationStates
uint8_t observations;
uint8_t good_observations;
uint8_t hemming_error_count;
uint8_t filter_stages;
uint16_t carrier_noise;
int16_t latency;
uint8_t predetect_interval;
uint16_t postdetections;
uint32_t unfiltered_measurement_integral;
float unfiltered_measurement_fraction;
float unfiltered_time_uncertainty;
float unfiltered_speed;
float unfiltered_speed_uncertainty;
uint32_t measurement_status;
uint8_t misc_status;
uint32_t multipath_estimate;
float azimuth;
float elevation;
int32_t carrier_phase_cycles_integral;
uint16_t carrier_phase_cycles_fraction;
float fine_speed;
float fine_speed_uncertainty;
uint8_t cycle_slip_count;
uint32_t pad;
"""
gps_measurement_report = """
uint8_t version;
uint32_t f_count;
uint16_t week;
uint32_t milliseconds;
float time_bias;
float clock_time_uncertainty;
float clock_frequency_bias;
float clock_frequency_uncertainty;
uint8_t sv_count;
"""
gps_measurement_report_sv = """
uint8_t sv_id;
uint8_t observation_state; // SVObservationStates
uint8_t observations;
uint8_t good_observations;
uint16_t parity_error_count;
uint8_t filter_stages;
uint16_t carrier_noise;
int16_t latency;
uint8_t predetect_interval;
uint16_t postdetections;
uint32_t unfiltered_measurement_integral;
float unfiltered_measurement_fraction;
float unfiltered_time_uncertainty;
float unfiltered_speed;
float unfiltered_speed_uncertainty;
uint32_t measurement_status;
uint8_t misc_status;
uint32_t multipath_estimate;
float azimuth;
float elevation;
int32_t carrier_phase_cycles_integral;
uint16_t carrier_phase_cycles_fraction;
float fine_speed;
float fine_speed_uncertainty;
uint8_t cycle_slip_count;
uint32_t pad;
"""
position_report = """
uint8 u_Version; /* Version number of DM log */
uint32 q_Fcount; /* Local millisecond counter */
uint8 u_PosSource; /* Source of position information */ /* 0: None 1: Weighted least-squares 2: Kalman filter 3: Externally injected 4: Internal database */
uint32 q_Reserved1; /* Reserved memory field */
uint16 w_PosVelFlag; /* Position velocity bit field: (see DM log 0x1476 documentation) */
uint32 q_PosVelFlag2; /* Position velocity 2 bit field: (see DM log 0x1476 documentation) */
uint8 u_FailureCode; /* Failure code: (see DM log 0x1476 documentation) */
uint16 w_FixEvents; /* Fix events bit field: (see DM log 0x1476 documentation) */
uint32 _fake_align_week_number;
uint16 w_GpsWeekNumber; /* GPS week number of position */
uint32 q_GpsFixTimeMs; /* GPS fix time of week of in milliseconds */
uint8 u_GloNumFourYear; /* Number of Glonass four year cycles */
uint16 w_GloNumDaysInFourYear; /* Glonass calendar day in four year cycle */
uint32 q_GloFixTimeMs; /* Glonass fix time of day in milliseconds */
uint32 q_PosCount; /* Integer count of the number of unique positions reported */
uint64 t_DblFinalPosLatLon[2]; /* Final latitude and longitude of position in radians */
uint32 q_FltFinalPosAlt; /* Final height-above-ellipsoid altitude of position */
uint32 q_FltHeadingRad; /* User heading in radians */
uint32 q_FltHeadingUncRad; /* User heading uncertainty in radians */
uint32 q_FltVelEnuMps[3]; /* User velocity in east, north, up coordinate frame. In meters per second. */
uint32 q_FltVelSigmaMps[3]; /* Gaussian 1-sigma value for east, north, up components of user velocity */
uint32 q_FltClockBiasMeters; /* Receiver clock bias in meters */
uint32 q_FltClockBiasSigmaMeters; /* Gaussian 1-sigma value for receiver clock bias in meters */
uint32 q_FltGGTBMeters; /* GPS to Glonass time bias in meters */
uint32 q_FltGGTBSigmaMeters; /* Gaussian 1-sigma value for GPS to Glonass time bias uncertainty in meters */
uint32 q_FltGBTBMeters; /* GPS to BeiDou time bias in meters */
uint32 q_FltGBTBSigmaMeters; /* Gaussian 1-sigma value for GPS to BeiDou time bias uncertainty in meters */
uint32 q_FltBGTBMeters; /* BeiDou to Glonass time bias in meters */
uint32 q_FltBGTBSigmaMeters; /* Gaussian 1-sigma value for BeiDou to Glonass time bias uncertainty in meters */
uint32 q_FltFiltGGTBMeters; /* Filtered GPS to Glonass time bias in meters */
uint32 q_FltFiltGGTBSigmaMeters; /* Filtered Gaussian 1-sigma value for GPS to Glonass time bias uncertainty in meters */
uint32 q_FltFiltGBTBMeters; /* Filtered GPS to BeiDou time bias in meters */
uint32 q_FltFiltGBTBSigmaMeters; /* Filtered Gaussian 1-sigma value for GPS to BeiDou time bias uncertainty in meters */
uint32 q_FltFiltBGTBMeters; /* Filtered BeiDou to Glonass time bias in meters */
uint32 q_FltFiltBGTBSigmaMeters; /* Filtered Gaussian 1-sigma value for BeiDou to Glonass time bias uncertainty in meters */
uint32 q_FltSftOffsetSec; /* SFT offset as computed by WLS in seconds */
uint32 q_FltSftOffsetSigmaSec; /* Gaussian 1-sigma value for SFT offset in seconds */
uint32 q_FltClockDriftMps; /* Clock drift (clock frequency bias) in meters per second */
uint32 q_FltClockDriftSigmaMps; /* Gaussian 1-sigma value for clock drift in meters per second */
uint32 q_FltFilteredAlt; /* Filtered height-above-ellipsoid altitude in meters as computed by WLS */
uint32 q_FltFilteredAltSigma; /* Gaussian 1-sigma value for filtered height-above-ellipsoid altitude in meters */
uint32 q_FltRawAlt; /* Raw height-above-ellipsoid altitude in meters as computed by WLS */
uint32 q_FltRawAltSigma; /* Gaussian 1-sigma value for raw height-above-ellipsoid altitude in meters */
uint32 align_Flt[14];
uint32 q_FltPdop; /* 3D position dilution of precision as computed from the unweighted
uint32 q_FltHdop; /* Horizontal position dilution of precision as computed from the unweighted least-squares covariance matrix */
uint32 q_FltVdop; /* Vertical position dilution of precision as computed from the unweighted least-squares covariance matrix */
uint8 u_EllipseConfidence; /* Statistical measure of the confidence (percentage) associated with the uncertainty ellipse values */
uint32 q_FltEllipseAngle; /* Angle of semimajor axis with respect to true North, with increasing angles moving clockwise from North. In units of degrees. */
uint32 q_FltEllipseSemimajorAxis; /* Semimajor axis of final horizontal position uncertainty error ellipse. In units of meters. */
uint32 q_FltEllipseSemiminorAxis; /* Semiminor axis of final horizontal position uncertainty error ellipse. In units of meters. */
uint32 q_FltPosSigmaVertical; /* Gaussian 1-sigma value for final position height-above-ellipsoid altitude in meters */
uint8 u_HorizontalReliability; /* Horizontal position reliability 0: Not set 1: Very Low 2: Low 3: Medium 4: High */
uint8 u_VerticalReliability; /* Vertical position reliability */
uint16 w_Reserved2; /* Reserved memory field */
uint32 q_FltGnssHeadingRad; /* User heading in radians derived from GNSS only solution */
uint32 q_FltGnssHeadingUncRad; /* User heading uncertainty in radians derived from GNSS only solution */
uint32 q_SensorDataUsageMask; /* Denotes which additional sensor data were used to compute this position fix. BIT[0] 0x00000001 <96> Accelerometer BIT[1] 0x00000002 <96> Gyro 0x0000FFFC - Reserved A bit set to 1 indicates that certain fields as defined by the SENSOR_AIDING_MASK were aided with sensor data*/
uint32 q_SensorAidMask; /* Denotes which component of the position report was assisted with additional sensors defined in SENSOR_DATA_USAGE_MASK BIT[0] 0x00000001 <96> Heading aided with sensor data BIT[1] 0x00000002 <96> Speed aided with sensor data BIT[2] 0x00000004 <96> Position aided with sensor data BIT[3] 0x00000008 <96> Velocity aided with sensor data 0xFFFFFFF0 <96> Reserved */
uint8 u_NumGpsSvsUsed; /* The number of GPS SVs used in the fix */
uint8 u_TotalGpsSvs; /* Total number of GPS SVs detected by searcher, including ones not used in position calculation */
uint8 u_NumGloSvsUsed; /* The number of Glonass SVs used in the fix */
uint8 u_TotalGloSvs; /* Total number of Glonass SVs detected by searcher, including ones not used in position calculation */
uint8 u_NumBdsSvsUsed; /* The number of BeiDou SVs used in the fix */
uint8 u_TotalBdsSvs; /* Total number of BeiDou SVs detected by searcher, including ones not used in position calculation */
"""
def name_to_camelcase(nam):
ret = []
i = 0
while i < len(nam):
if nam[i] == "_":
ret.append(nam[i+1].upper())
i += 2
else:
ret.append(nam[i])
i += 1
return ''.join(ret)
def parse_struct(ss):
st = "<"
nams = []
for l in ss.strip().split("\n"):
typ, nam = l.split(";")[0].split()
#print(typ, nam)
if typ == "float" or '_Flt' in nam:
st += "f"
elif typ == "double" or '_Dbl' in nam:
st += "d"
elif typ in ["uint8", "uint8_t"]:
st += "B"
elif typ in ["int8", "int8_t"]:
st += "b"
elif typ in ["uint32", "uint32_t"]:
st += "I"
elif typ in ["int32", "int32_t"]:
st += "i"
elif typ in ["uint16", "uint16_t"]:
st += "H"
elif typ in ["int16", "int16_t"]:
st += "h"
elif typ == "uint64":
st += "Q"
else:
print("unknown type", typ)
assert False
if '[' in nam:
cnt = int(nam.split("[")[1].split("]")[0])
st += st[-1]*(cnt-1)
for i in range(cnt):
nams.append("%s[%d]" % (nam.split("[")[0], i))
else:
nams.append(nam)
return st, nams
def dict_unpacker(ss, camelcase = False):
st, nams = parse_struct(ss)
if camelcase:
nams = [name_to_camelcase(x) for x in nams]
sz = calcsize(st)
return lambda x: dict(zip(nams, unpack_from(st, x))), sz
| from struct import unpack_from, calcsize
LOG_GNSS_POSITION_REPORT = 0x1476
LOG_GNSS_GPS_MEASUREMENT_REPORT = 0x1477
LOG_GNSS_CLOCK_REPORT = 0x1478
LOG_GNSS_GLONASS_MEASUREMENT_REPORT = 0x1480
LOG_GNSS_BDS_MEASUREMENT_REPORT = 0x1756
LOG_GNSS_GAL_MEASUREMENT_REPORT = 0x1886
LOG_GNSS_OEMDRE_MEASUREMENT_REPORT = 0x14DE
LOG_GNSS_OEMDRE_SVPOLY_REPORT = 0x14E1
LOG_GNSS_ME_DPO_STATUS = 0x1838
LOG_GNSS_CD_DB_REPORT = 0x147B
LOG_GNSS_PRX_RF_HW_STATUS_REPORT = 0x147E
LOG_CGPS_SLOW_CLOCK_CLIB_REPORT = 0x1488
LOG_GNSS_CONFIGURATION_STATE = 0x1516
glonass_measurement_report = """
uint8_t version;
uint32_t f_count;
uint8_t glonass_cycle_number;
uint16_t glonass_number_of_days;
uint32_t milliseconds;
float time_bias;
float clock_time_uncertainty;
float clock_frequency_bias;
float clock_frequency_uncertainty;
uint8_t sv_count;
"""
glonass_measurement_report_sv = """
uint8_t sv_id;
int8_t frequency_index;
uint8_t observation_state; // SVObservationStates
uint8_t observations;
uint8_t good_observations;
uint8_t hemming_error_count;
uint8_t filter_stages;
uint16_t carrier_noise;
int16_t latency;
uint8_t predetect_interval;
uint16_t postdetections;
uint32_t unfiltered_measurement_integral;
float unfiltered_measurement_fraction;
float unfiltered_time_uncertainty;
float unfiltered_speed;
float unfiltered_speed_uncertainty;
uint32_t measurement_status;
uint8_t misc_status;
uint32_t multipath_estimate;
float azimuth;
float elevation;
int32_t carrier_phase_cycles_integral;
uint16_t carrier_phase_cycles_fraction;
float fine_speed;
float fine_speed_uncertainty;
uint8_t cycle_slip_count;
uint32_t pad;
"""
gps_measurement_report = """
uint8_t version;
uint32_t f_count;
uint16_t week;
uint32_t milliseconds;
float time_bias;
float clock_time_uncertainty;
float clock_frequency_bias;
float clock_frequency_uncertainty;
uint8_t sv_count;
"""
gps_measurement_report_sv = """
uint8_t sv_id;
uint8_t observation_state; // SVObservationStates
uint8_t observations;
uint8_t good_observations;
uint16_t parity_error_count;
uint8_t filter_stages;
uint16_t carrier_noise;
int16_t latency;
uint8_t predetect_interval;
uint16_t postdetections;
uint32_t unfiltered_measurement_integral;
float unfiltered_measurement_fraction;
float unfiltered_time_uncertainty;
float unfiltered_speed;
float unfiltered_speed_uncertainty;
uint32_t measurement_status;
uint8_t misc_status;
uint32_t multipath_estimate;
float azimuth;
float elevation;
int32_t carrier_phase_cycles_integral;
uint16_t carrier_phase_cycles_fraction;
float fine_speed;
float fine_speed_uncertainty;
uint8_t cycle_slip_count;
uint32_t pad;
"""
position_report = """
uint8 u_Version; /* Version number of DM log */
uint32 q_Fcount; /* Local millisecond counter */
uint8 u_PosSource; /* Source of position information */ /* 0: None 1: Weighted least-squares 2: Kalman filter 3: Externally injected 4: Internal database */
uint32 q_Reserved1; /* Reserved memory field */
uint16 w_PosVelFlag; /* Position velocity bit field: (see DM log 0x1476 documentation) */
uint32 q_PosVelFlag2; /* Position velocity 2 bit field: (see DM log 0x1476 documentation) */
uint8 u_FailureCode; /* Failure code: (see DM log 0x1476 documentation) */
uint16 w_FixEvents; /* Fix events bit field: (see DM log 0x1476 documentation) */
uint32 _fake_align_week_number;
uint16 w_GpsWeekNumber; /* GPS week number of position */
uint32 q_GpsFixTimeMs; /* GPS fix time of week of in milliseconds */
uint8 u_GloNumFourYear; /* Number of Glonass four year cycles */
uint16 w_GloNumDaysInFourYear; /* Glonass calendar day in four year cycle */
uint32 q_GloFixTimeMs; /* Glonass fix time of day in milliseconds */
uint32 q_PosCount; /* Integer count of the number of unique positions reported */
uint64 t_DblFinalPosLatLon[2]; /* Final latitude and longitude of position in radians */
uint32 q_FltFinalPosAlt; /* Final height-above-ellipsoid altitude of position */
uint32 q_FltHeadingRad; /* User heading in radians */
uint32 q_FltHeadingUncRad; /* User heading uncertainty in radians */
uint32 q_FltVelEnuMps[3]; /* User velocity in east, north, up coordinate frame. In meters per second. */
uint32 q_FltVelSigmaMps[3]; /* Gaussian 1-sigma value for east, north, up components of user velocity */
uint32 q_FltClockBiasMeters; /* Receiver clock bias in meters */
uint32 q_FltClockBiasSigmaMeters; /* Gaussian 1-sigma value for receiver clock bias in meters */
uint32 q_FltGGTBMeters; /* GPS to Glonass time bias in meters */
uint32 q_FltGGTBSigmaMeters; /* Gaussian 1-sigma value for GPS to Glonass time bias uncertainty in meters */
uint32 q_FltGBTBMeters; /* GPS to BeiDou time bias in meters */
uint32 q_FltGBTBSigmaMeters; /* Gaussian 1-sigma value for GPS to BeiDou time bias uncertainty in meters */
uint32 q_FltBGTBMeters; /* BeiDou to Glonass time bias in meters */
uint32 q_FltBGTBSigmaMeters; /* Gaussian 1-sigma value for BeiDou to Glonass time bias uncertainty in meters */
uint32 q_FltFiltGGTBMeters; /* Filtered GPS to Glonass time bias in meters */
uint32 q_FltFiltGGTBSigmaMeters; /* Filtered Gaussian 1-sigma value for GPS to Glonass time bias uncertainty in meters */
uint32 q_FltFiltGBTBMeters; /* Filtered GPS to BeiDou time bias in meters */
uint32 q_FltFiltGBTBSigmaMeters; /* Filtered Gaussian 1-sigma value for GPS to BeiDou time bias uncertainty in meters */
uint32 q_FltFiltBGTBMeters; /* Filtered BeiDou to Glonass time bias in meters */
uint32 q_FltFiltBGTBSigmaMeters; /* Filtered Gaussian 1-sigma value for BeiDou to Glonass time bias uncertainty in meters */
uint32 q_FltSftOffsetSec; /* SFT offset as computed by WLS in seconds */
uint32 q_FltSftOffsetSigmaSec; /* Gaussian 1-sigma value for SFT offset in seconds */
uint32 q_FltClockDriftMps; /* Clock drift (clock frequency bias) in meters per second */
uint32 q_FltClockDriftSigmaMps; /* Gaussian 1-sigma value for clock drift in meters per second */
uint32 q_FltFilteredAlt; /* Filtered height-above-ellipsoid altitude in meters as computed by WLS */
uint32 q_FltFilteredAltSigma; /* Gaussian 1-sigma value for filtered height-above-ellipsoid altitude in meters */
uint32 q_FltRawAlt; /* Raw height-above-ellipsoid altitude in meters as computed by WLS */
uint32 q_FltRawAltSigma; /* Gaussian 1-sigma value for raw height-above-ellipsoid altitude in meters */
uint32 align_Flt[14];
uint32 q_FltPdop; /* 3D position dilution of precision as computed from the unweighted
uint32 q_FltHdop; /* Horizontal position dilution of precision as computed from the unweighted least-squares covariance matrix */
uint32 q_FltVdop; /* Vertical position dilution of precision as computed from the unweighted least-squares covariance matrix */
uint8 u_EllipseConfidence; /* Statistical measure of the confidence (percentage) associated with the uncertainty ellipse values */
uint32 q_FltEllipseAngle; /* Angle of semimajor axis with respect to true North, with increasing angles moving clockwise from North. In units of degrees. */
uint32 q_FltEllipseSemimajorAxis; /* Semimajor axis of final horizontal position uncertainty error ellipse. In units of meters. */
uint32 q_FltEllipseSemiminorAxis; /* Semiminor axis of final horizontal position uncertainty error ellipse. In units of meters. */
uint32 q_FltPosSigmaVertical; /* Gaussian 1-sigma value for final position height-above-ellipsoid altitude in meters */
uint8 u_HorizontalReliability; /* Horizontal position reliability 0: Not set 1: Very Low 2: Low 3: Medium 4: High */
uint8 u_VerticalReliability; /* Vertical position reliability */
uint16 w_Reserved2; /* Reserved memory field */
uint32 q_FltGnssHeadingRad; /* User heading in radians derived from GNSS only solution */
uint32 q_FltGnssHeadingUncRad; /* User heading uncertainty in radians derived from GNSS only solution */
uint32 q_SensorDataUsageMask; /* Denotes which additional sensor data were used to compute this position fix. BIT[0] 0x00000001 <96> Accelerometer BIT[1] 0x00000002 <96> Gyro 0x0000FFFC - Reserved A bit set to 1 indicates that certain fields as defined by the SENSOR_AIDING_MASK were aided with sensor data*/
uint32 q_SensorAidMask; /* Denotes which component of the position report was assisted with additional sensors defined in SENSOR_DATA_USAGE_MASK BIT[0] 0x00000001 <96> Heading aided with sensor data BIT[1] 0x00000002 <96> Speed aided with sensor data BIT[2] 0x00000004 <96> Position aided with sensor data BIT[3] 0x00000008 <96> Velocity aided with sensor data 0xFFFFFFF0 <96> Reserved */
uint8 u_NumGpsSvsUsed; /* The number of GPS SVs used in the fix */
uint8 u_TotalGpsSvs; /* Total number of GPS SVs detected by searcher, including ones not used in position calculation */
uint8 u_NumGloSvsUsed; /* The number of Glonass SVs used in the fix */
uint8 u_TotalGloSvs; /* Total number of Glonass SVs detected by searcher, including ones not used in position calculation */
uint8 u_NumBdsSvsUsed; /* The number of BeiDou SVs used in the fix */
uint8 u_TotalBdsSvs; /* Total number of BeiDou SVs detected by searcher, including ones not used in position calculation */
"""
def name_to_camelcase(nam):
ret = []
i = 0
while i < len(nam):
if nam[i] == "_":
ret.append(nam[i+1].upper())
i += 2
else:
ret.append(nam[i])
i += 1
return ''.join(ret)
def parse_struct(ss):
st = "<"
nams = []
for l in ss.strip().split("\n"):
typ, nam = l.split(";")[0].split()
#print(typ, nam)
if typ == "float" or '_Flt' in nam:
st += "f"
elif typ == "double" or '_Dbl' in nam:
st += "d"
elif typ in ["uint8", "uint8_t"]:
st += "B"
elif typ in ["int8", "int8_t"]:
st += "b"
elif typ in ["uint32", "uint32_t"]:
st += "I"
elif typ in ["int32", "int32_t"]:
st += "i"
elif typ in ["uint16", "uint16_t"]:
st += "H"
elif typ in ["int16", "int16_t"]:
st += "h"
elif typ == "uint64":
st += "Q"
else:
print("unknown type", typ)
assert False
if '[' in nam:
cnt = int(nam.split("[")[1].split("]")[0])
st += st[-1]*(cnt-1)
for i in range(cnt):
nams.append("%s[%d]" % (nam.split("[")[0], i))
else:
nams.append(nam)
return st, nams
def dict_unpacker(ss, camelcase = False):
st, nams = parse_struct(ss)
if camelcase:
nams = [name_to_camelcase(x) for x in nams]
sz = calcsize(st)
return lambda x: dict(zip(nams, unpack_from(st, x))), sz
| en | 0.658996 | uint8_t version; uint32_t f_count; uint8_t glonass_cycle_number; uint16_t glonass_number_of_days; uint32_t milliseconds; float time_bias; float clock_time_uncertainty; float clock_frequency_bias; float clock_frequency_uncertainty; uint8_t sv_count; uint8_t sv_id; int8_t frequency_index; uint8_t observation_state; // SVObservationStates uint8_t observations; uint8_t good_observations; uint8_t hemming_error_count; uint8_t filter_stages; uint16_t carrier_noise; int16_t latency; uint8_t predetect_interval; uint16_t postdetections; uint32_t unfiltered_measurement_integral; float unfiltered_measurement_fraction; float unfiltered_time_uncertainty; float unfiltered_speed; float unfiltered_speed_uncertainty; uint32_t measurement_status; uint8_t misc_status; uint32_t multipath_estimate; float azimuth; float elevation; int32_t carrier_phase_cycles_integral; uint16_t carrier_phase_cycles_fraction; float fine_speed; float fine_speed_uncertainty; uint8_t cycle_slip_count; uint32_t pad; uint8_t version; uint32_t f_count; uint16_t week; uint32_t milliseconds; float time_bias; float clock_time_uncertainty; float clock_frequency_bias; float clock_frequency_uncertainty; uint8_t sv_count; uint8_t sv_id; uint8_t observation_state; // SVObservationStates uint8_t observations; uint8_t good_observations; uint16_t parity_error_count; uint8_t filter_stages; uint16_t carrier_noise; int16_t latency; uint8_t predetect_interval; uint16_t postdetections; uint32_t unfiltered_measurement_integral; float unfiltered_measurement_fraction; float unfiltered_time_uncertainty; float unfiltered_speed; float unfiltered_speed_uncertainty; uint32_t measurement_status; uint8_t misc_status; uint32_t multipath_estimate; float azimuth; float elevation; int32_t carrier_phase_cycles_integral; uint16_t carrier_phase_cycles_fraction; float fine_speed; float fine_speed_uncertainty; uint8_t cycle_slip_count; uint32_t pad; uint8 u_Version; /* Version number of DM log */ uint32 q_Fcount; /* Local millisecond counter */ uint8 u_PosSource; /* Source of position information */ /* 0: None 1: Weighted least-squares 2: Kalman filter 3: Externally injected 4: Internal database */ uint32 q_Reserved1; /* Reserved memory field */ uint16 w_PosVelFlag; /* Position velocity bit field: (see DM log 0x1476 documentation) */ uint32 q_PosVelFlag2; /* Position velocity 2 bit field: (see DM log 0x1476 documentation) */ uint8 u_FailureCode; /* Failure code: (see DM log 0x1476 documentation) */ uint16 w_FixEvents; /* Fix events bit field: (see DM log 0x1476 documentation) */ uint32 _fake_align_week_number; uint16 w_GpsWeekNumber; /* GPS week number of position */ uint32 q_GpsFixTimeMs; /* GPS fix time of week of in milliseconds */ uint8 u_GloNumFourYear; /* Number of Glonass four year cycles */ uint16 w_GloNumDaysInFourYear; /* Glonass calendar day in four year cycle */ uint32 q_GloFixTimeMs; /* Glonass fix time of day in milliseconds */ uint32 q_PosCount; /* Integer count of the number of unique positions reported */ uint64 t_DblFinalPosLatLon[2]; /* Final latitude and longitude of position in radians */ uint32 q_FltFinalPosAlt; /* Final height-above-ellipsoid altitude of position */ uint32 q_FltHeadingRad; /* User heading in radians */ uint32 q_FltHeadingUncRad; /* User heading uncertainty in radians */ uint32 q_FltVelEnuMps[3]; /* User velocity in east, north, up coordinate frame. In meters per second. */ uint32 q_FltVelSigmaMps[3]; /* Gaussian 1-sigma value for east, north, up components of user velocity */ uint32 q_FltClockBiasMeters; /* Receiver clock bias in meters */ uint32 q_FltClockBiasSigmaMeters; /* Gaussian 1-sigma value for receiver clock bias in meters */ uint32 q_FltGGTBMeters; /* GPS to Glonass time bias in meters */ uint32 q_FltGGTBSigmaMeters; /* Gaussian 1-sigma value for GPS to Glonass time bias uncertainty in meters */ uint32 q_FltGBTBMeters; /* GPS to BeiDou time bias in meters */ uint32 q_FltGBTBSigmaMeters; /* Gaussian 1-sigma value for GPS to BeiDou time bias uncertainty in meters */ uint32 q_FltBGTBMeters; /* BeiDou to Glonass time bias in meters */ uint32 q_FltBGTBSigmaMeters; /* Gaussian 1-sigma value for BeiDou to Glonass time bias uncertainty in meters */ uint32 q_FltFiltGGTBMeters; /* Filtered GPS to Glonass time bias in meters */ uint32 q_FltFiltGGTBSigmaMeters; /* Filtered Gaussian 1-sigma value for GPS to Glonass time bias uncertainty in meters */ uint32 q_FltFiltGBTBMeters; /* Filtered GPS to BeiDou time bias in meters */ uint32 q_FltFiltGBTBSigmaMeters; /* Filtered Gaussian 1-sigma value for GPS to BeiDou time bias uncertainty in meters */ uint32 q_FltFiltBGTBMeters; /* Filtered BeiDou to Glonass time bias in meters */ uint32 q_FltFiltBGTBSigmaMeters; /* Filtered Gaussian 1-sigma value for BeiDou to Glonass time bias uncertainty in meters */ uint32 q_FltSftOffsetSec; /* SFT offset as computed by WLS in seconds */ uint32 q_FltSftOffsetSigmaSec; /* Gaussian 1-sigma value for SFT offset in seconds */ uint32 q_FltClockDriftMps; /* Clock drift (clock frequency bias) in meters per second */ uint32 q_FltClockDriftSigmaMps; /* Gaussian 1-sigma value for clock drift in meters per second */ uint32 q_FltFilteredAlt; /* Filtered height-above-ellipsoid altitude in meters as computed by WLS */ uint32 q_FltFilteredAltSigma; /* Gaussian 1-sigma value for filtered height-above-ellipsoid altitude in meters */ uint32 q_FltRawAlt; /* Raw height-above-ellipsoid altitude in meters as computed by WLS */ uint32 q_FltRawAltSigma; /* Gaussian 1-sigma value for raw height-above-ellipsoid altitude in meters */ uint32 align_Flt[14]; uint32 q_FltPdop; /* 3D position dilution of precision as computed from the unweighted uint32 q_FltHdop; /* Horizontal position dilution of precision as computed from the unweighted least-squares covariance matrix */ uint32 q_FltVdop; /* Vertical position dilution of precision as computed from the unweighted least-squares covariance matrix */ uint8 u_EllipseConfidence; /* Statistical measure of the confidence (percentage) associated with the uncertainty ellipse values */ uint32 q_FltEllipseAngle; /* Angle of semimajor axis with respect to true North, with increasing angles moving clockwise from North. In units of degrees. */ uint32 q_FltEllipseSemimajorAxis; /* Semimajor axis of final horizontal position uncertainty error ellipse. In units of meters. */ uint32 q_FltEllipseSemiminorAxis; /* Semiminor axis of final horizontal position uncertainty error ellipse. In units of meters. */ uint32 q_FltPosSigmaVertical; /* Gaussian 1-sigma value for final position height-above-ellipsoid altitude in meters */ uint8 u_HorizontalReliability; /* Horizontal position reliability 0: Not set 1: Very Low 2: Low 3: Medium 4: High */ uint8 u_VerticalReliability; /* Vertical position reliability */ uint16 w_Reserved2; /* Reserved memory field */ uint32 q_FltGnssHeadingRad; /* User heading in radians derived from GNSS only solution */ uint32 q_FltGnssHeadingUncRad; /* User heading uncertainty in radians derived from GNSS only solution */ uint32 q_SensorDataUsageMask; /* Denotes which additional sensor data were used to compute this position fix. BIT[0] 0x00000001 <96> Accelerometer BIT[1] 0x00000002 <96> Gyro 0x0000FFFC - Reserved A bit set to 1 indicates that certain fields as defined by the SENSOR_AIDING_MASK were aided with sensor data*/ uint32 q_SensorAidMask; /* Denotes which component of the position report was assisted with additional sensors defined in SENSOR_DATA_USAGE_MASK BIT[0] 0x00000001 <96> Heading aided with sensor data BIT[1] 0x00000002 <96> Speed aided with sensor data BIT[2] 0x00000004 <96> Position aided with sensor data BIT[3] 0x00000008 <96> Velocity aided with sensor data 0xFFFFFFF0 <96> Reserved */ uint8 u_NumGpsSvsUsed; /* The number of GPS SVs used in the fix */ uint8 u_TotalGpsSvs; /* Total number of GPS SVs detected by searcher, including ones not used in position calculation */ uint8 u_NumGloSvsUsed; /* The number of Glonass SVs used in the fix */ uint8 u_TotalGloSvs; /* Total number of Glonass SVs detected by searcher, including ones not used in position calculation */ uint8 u_NumBdsSvsUsed; /* The number of BeiDou SVs used in the fix */ uint8 u_TotalBdsSvs; /* Total number of BeiDou SVs detected by searcher, including ones not used in position calculation */ #print(typ, nam) | 1.676742 | 2 |
python2.7libs/hammer_tools/content_browser.py | anvdev/Hammer-Tools | 19 | 2863 | from __future__ import print_function
try:
from PyQt5.QtWidgets import *
from PyQt5.QtGui import *
from PyQt5.QtCore import *
except ImportError:
from PySide2.QtWidgets import *
from PySide2.QtGui import *
from PySide2.QtCore import *
import hou
from hammer_tools.utils import createAction
def isRevertToDefaultEvent(event):
return event.modifiers() == Qt.ControlModifier and event.button() == Qt.MiddleButton
class Slider(QSlider):
def __init__(self, orientation=Qt.Horizontal, parent=None):
super(Slider, self).__init__(orientation, parent)
self.defaultValue = 0
self.valueLadderMode = False
def revertToDefault(self):
self.setValue(self.defaultValue)
def setDefaultValue(self, value, reset=True):
self.defaultValue = value
if reset:
self.revertToDefault()
def mousePressEvent(self, event):
if False: # Type hint
event = QMouseEvent
if event.button() == Qt.MiddleButton:
return
elif event.button() == Qt.LeftButton:
event = QMouseEvent(QEvent.MouseButtonPress, event.pos(),
Qt.MiddleButton, Qt.MiddleButton, Qt.NoModifier)
super(Slider, self).mousePressEvent(event)
def mouseMoveEvent(self, event):
if False: # Type hint
event = QMouseEvent
if not self.valueLadderMode and event.buttons() == Qt.MiddleButton:
try:
hou.ui.openValueLadder(self.value(), self.setValue, data_type=hou.valueLadderDataType.Int)
except hou.OperationFailed:
return
else:
self.valueLadderMode = True
elif self.valueLadderMode:
hou.ui.updateValueLadder(event.globalX(), event.globalY(),
bool(event.modifiers() & Qt.AltModifier),
bool(event.modifiers() & Qt.ShiftModifier))
else:
super(Slider, self).mouseMoveEvent(event)
def mouseReleaseEvent(self, event):
if False: # Type hint
event = QMouseEvent
if self.valueLadderMode and event.button() == Qt.MiddleButton:
hou.ui.closeValueLadder()
self.valueLadderMode = False
elif isRevertToDefaultEvent(event):
self.revertToDefault()
else:
super(Slider, self).mouseReleaseEvent(event)
class SearchField(QComboBox):
def __init__(self, parent=None):
super(SearchField, self).__init__(parent)
self.setEditable(True)
edit = self.lineEdit()
edit.setPlaceholderText('Search...')
edit.installEventFilter(self)
edit.setFont(QFont('Segoe UI'))
self.setFixedHeight(26)
comp = self.completer()
comp.setCompletionMode(QCompleter.PopupCompletion)
comp.setFilterMode(Qt.MatchContains)
comp.setModelSorting(QCompleter.CaseInsensitivelySortedModel)
comp.setMaxVisibleItems(5)
popup = comp.popup()
popup.setStyleSheet(hou.qt.styleSheet())
def mouseReleaseEvent(self, event):
if False: # Type hint
event = QMouseEvent
if isRevertToDefaultEvent(event):
self.clearEditText()
def eventFilter(self, watched, event):
if False: # Type hint
watched = QObject
event = QEvent
if watched == self.lineEdit():
if event.type() == QEvent.MouseButtonRelease and isRevertToDefaultEvent(event):
self.clearEditText()
event.accept()
return True
return False
def keyPressEvent(self, event):
if False: # Type hint
event = QKeyEvent
key = event.key()
mod = event.modifiers()
if mod == Qt.NoModifier and key == Qt.Key_Escape:
self.clearEditText()
else:
super(SearchField, self).keyPressEvent(event)
def hidePopup(self):
super(SearchField, self).hidePopup()
self.lineEdit().setFocus()
link_or_state_icon = 'BUTTONS_link'
embedded_icon = 'BUTTONS_pinned'
class BrowserMode(QStandardItemModel):
def __init__(self):
super(BrowserMode, self).__init__()
class BrowserTreeView(QTreeView):
def __init__(self, parent=None):
super(BrowserTreeView, self).__init__(parent)
self.setAlternatingRowColors(True)
class BrowserTableView(QListView):
def __init__(self, parent=None):
super(BrowserTableView, self).__init__(parent)
self.setViewMode(QListView.IconMode)
self.setResizeMode(QListView.Adjust)
self.setSelectionMode(QAbstractItemView.ExtendedSelection)
self.setVerticalScrollMode(QAbstractItemView.ScrollPerPixel)
self.setIconSize(QSize(120, 90))
self.setUniformItemSizes(True)
self.setContextMenuPolicy(Qt.CustomContextMenu)
class ContentBrowser(QWidget):
def __init__(self, parent=None):
super(ContentBrowser, self).__init__(parent)
self.setWindowTitle('Content Browser')
self.setProperty('houdiniStyle', True)
topLayout = QHBoxLayout()
topLayout.setContentsMargins(4, 4, 4, 2)
topLayout.setSpacing(2)
self.refreshButton = QPushButton()
self.refreshButton.setFixedSize(26, 26)
self.refreshButton.setToolTip('Update\tF5')
self.refreshButton.setIcon(hou.qt.Icon('BUTTONS_reload', 18, 18))
self.refreshButton.setIconSize(QSize(18, 18))
topLayout.addWidget(self.refreshButton)
sep = hou.qt.Separator()
if False: # Type hint
sep = QFrame
sep.setFixedWidth(2)
sep.setFrameShape(QFrame.VLine)
topLayout.addWidget(sep)
viewModeButtonGroup = QButtonGroup(self)
viewModeButtonGroup.setExclusive(True)
self.treeViewButton = QPushButton()
self.treeViewButton.setFixedSize(26, 26)
self.treeViewButton.setToolTip('Tree View\t\tCtrl+1')
self.treeViewButton.setIcon(hou.qt.Icon('BUTTONS_tree', 18, 18))
self.treeViewButton.setIconSize(QSize(18, 18))
self.treeViewButton.setCheckable(True)
viewModeButtonGroup.addButton(self.treeViewButton)
topLayout.addWidget(self.treeViewButton)
self.tableViewButton = QPushButton()
self.tableViewButton.setFixedSize(26, 26)
self.tableViewButton.setToolTip('Table View\tCtrl+2')
self.tableViewButton.setIcon(hou.qt.Icon('NETVIEW_shape_palette', 18, 18))
self.tableViewButton.setIconSize(QSize(18, 18))
self.tableViewButton.setCheckable(True)
self.tableViewButton.toggle()
viewModeButtonGroup.addButton(self.tableViewButton)
topLayout.addWidget(self.tableViewButton)
topLayout.addWidget(sep)
self.searchField = SearchField()
self.searchField.setToolTip('Search\tCtrl+F, F3')
topLayout.addWidget(self.searchField)
searchModeButtonGroup = QButtonGroup(self)
searchModeButtonGroup.setExclusive(True)
self.wholeSearchButton = QPushButton()
self.wholeSearchButton.setFixedSize(26, 26)
self.wholeSearchButton.setCheckable(True)
self.wholeSearchButton.setToolTip('Whole word search')
self.wholeSearchButton.setIcon(hou.qt.Icon('VOP_titlecase', 18, 18))
self.wholeSearchButton.setIconSize(QSize(18, 18))
searchModeButtonGroup.addButton(self.wholeSearchButton)
topLayout.addWidget(self.wholeSearchButton)
self.fuzzySearchButton = QPushButton()
self.fuzzySearchButton.setFixedSize(26, 26)
self.fuzzySearchButton.setCheckable(True)
self.fuzzySearchButton.toggle()
self.fuzzySearchButton.setToolTip('Fuzzy search')
self.fuzzySearchButton.setIcon(hou.qt.Icon('VOP_endswith', 18, 18))
self.fuzzySearchButton.setIconSize(QSize(18, 18))
searchModeButtonGroup.addButton(self.fuzzySearchButton)
topLayout.addWidget(self.fuzzySearchButton)
self.patternSearchButton = QPushButton()
self.patternSearchButton.setFixedSize(26, 26)
self.patternSearchButton.setCheckable(True)
self.patternSearchButton.setToolTip('Search by Pattern')
self.patternSearchButton.setIcon(hou.qt.Icon('VOP_isalpha', 18, 18))
self.patternSearchButton.setIconSize(QSize(18, 18))
searchModeButtonGroup.addButton(self.patternSearchButton)
topLayout.addWidget(self.patternSearchButton)
self.regexSearchButton = QPushButton()
self.regexSearchButton.setFixedSize(26, 26)
self.regexSearchButton.setCheckable(True)
self.regexSearchButton.setToolTip('Search by Regular Expression')
self.regexSearchButton.setIcon(hou.qt.Icon('VOP_regex_match', 18, 18))
self.regexSearchButton.setIconSize(QSize(18, 18))
searchModeButtonGroup.addButton(self.regexSearchButton)
topLayout.addWidget(self.regexSearchButton)
topLayout.addWidget(sep)
topLayout.addWidget(hou.qt.HelpButton('/hammer/content_browser', 'Show Help\tF1'))
middleLayout = QHBoxLayout()
middleLayout.setContentsMargins(4, 0, 0, 4)
middleLayout.setSpacing(4)
self.viewLayout = QStackedLayout(middleLayout)
model = QFileSystemModel()
model.setRootPath('C:/')
treeView = BrowserTreeView()
treeView.setModel(model)
treeView.setRootIndex(model.index('C:/'))
self.viewLayout.addWidget(treeView)
tableView = BrowserTableView()
tableView.setModel(model)
tableView.setRootIndex(model.index('C:/'))
tableView.setSelectionModel(treeView.selectionModel())
self.viewLayout.addWidget(tableView)
self.viewLayout.setCurrentIndex(1)
self.treeViewButton.clicked.connect(self.switchToTreeView)
self.addAction(createAction(self, 'Tree View', self.switchToTreeView, shortcut='Ctrl+1'))
self.tableViewButton.clicked.connect(self.switchToTableView)
self.addAction(createAction(self, 'Table View', self.switchToTableView, shortcut='Ctrl+2'))
bottomLayout = QHBoxLayout()
bottomLayout.setContentsMargins(4, 0, 4, 4)
bottomLayout.setSpacing(2)
settingsButton = QPushButton()
settingsButton.setFixedSize(26, 26)
settingsButton.setToolTip('Settings')
settingsButton.setIcon(hou.qt.Icon('BUTTONS_gear_mini', 18, 18))
settingsButton.setIconSize(QSize(18, 18))
bottomLayout.addWidget(settingsButton)
spacer = QSpacerItem(0, 0, QSizePolicy.Expanding, QSizePolicy.Ignored)
bottomLayout.addSpacerItem(spacer)
self.scaleSlider = Slider()
self.scaleSlider.setDefaultValue(50)
self.scaleSlider.setFixedWidth(120)
self.scaleSlider.valueChanged.connect(lambda v: tableView.setIconSize(QSize(120, 90) * v / 100))
bottomLayout.addWidget(self.scaleSlider)
mainLayout = QVBoxLayout(self)
mainLayout.setContentsMargins(0, 0, 0, 0)
mainLayout.setSpacing(4)
mainLayout.addLayout(topLayout)
mainLayout.addLayout(middleLayout)
mainLayout.addLayout(bottomLayout)
def switchToTreeView(self):
self.viewLayout.setCurrentIndex(0)
self.scaleSlider.hide()
self.treeViewButton.setChecked(True)
def switchToTableView(self):
self.viewLayout.setCurrentIndex(1)
self.scaleSlider.show()
self.tableViewButton.setChecked(True)
def keyPressEvent(self, event):
if False: # Type hint
event = QKeyEvent
key = event.key()
mod = event.modifiers()
if mod == Qt.NoModifier and key == Qt.Key_F5:
pass
elif mod == Qt.ControlModifier and key == Qt.Key_F:
self.searchField.setFocus()
elif mod == Qt.NoModifier and key == Qt.Key_F3:
self.searchField.setFocus()
elif mod == Qt.ControlModifier and key == Qt.Key_Equal:
pass
elif mod == Qt.ControlModifier and key == Qt.Key_Minus:
pass
elif mod == Qt.ControlModifier and key == Qt.Key_1:
pass
elif mod == Qt.ControlModifier and key == Qt.Key_2:
pass
elif mod == Qt.NoModifier and key == Qt.Key_F1:
pass
else:
super(ContentBrowser, self).keyPressEvent(event)
if __name__ == '__main__':
app = QApplication([])
window = ContentBrowser()
window.show()
app.exec_()
| from __future__ import print_function
try:
from PyQt5.QtWidgets import *
from PyQt5.QtGui import *
from PyQt5.QtCore import *
except ImportError:
from PySide2.QtWidgets import *
from PySide2.QtGui import *
from PySide2.QtCore import *
import hou
from hammer_tools.utils import createAction
def isRevertToDefaultEvent(event):
return event.modifiers() == Qt.ControlModifier and event.button() == Qt.MiddleButton
class Slider(QSlider):
def __init__(self, orientation=Qt.Horizontal, parent=None):
super(Slider, self).__init__(orientation, parent)
self.defaultValue = 0
self.valueLadderMode = False
def revertToDefault(self):
self.setValue(self.defaultValue)
def setDefaultValue(self, value, reset=True):
self.defaultValue = value
if reset:
self.revertToDefault()
def mousePressEvent(self, event):
if False: # Type hint
event = QMouseEvent
if event.button() == Qt.MiddleButton:
return
elif event.button() == Qt.LeftButton:
event = QMouseEvent(QEvent.MouseButtonPress, event.pos(),
Qt.MiddleButton, Qt.MiddleButton, Qt.NoModifier)
super(Slider, self).mousePressEvent(event)
def mouseMoveEvent(self, event):
if False: # Type hint
event = QMouseEvent
if not self.valueLadderMode and event.buttons() == Qt.MiddleButton:
try:
hou.ui.openValueLadder(self.value(), self.setValue, data_type=hou.valueLadderDataType.Int)
except hou.OperationFailed:
return
else:
self.valueLadderMode = True
elif self.valueLadderMode:
hou.ui.updateValueLadder(event.globalX(), event.globalY(),
bool(event.modifiers() & Qt.AltModifier),
bool(event.modifiers() & Qt.ShiftModifier))
else:
super(Slider, self).mouseMoveEvent(event)
def mouseReleaseEvent(self, event):
if False: # Type hint
event = QMouseEvent
if self.valueLadderMode and event.button() == Qt.MiddleButton:
hou.ui.closeValueLadder()
self.valueLadderMode = False
elif isRevertToDefaultEvent(event):
self.revertToDefault()
else:
super(Slider, self).mouseReleaseEvent(event)
class SearchField(QComboBox):
def __init__(self, parent=None):
super(SearchField, self).__init__(parent)
self.setEditable(True)
edit = self.lineEdit()
edit.setPlaceholderText('Search...')
edit.installEventFilter(self)
edit.setFont(QFont('Segoe UI'))
self.setFixedHeight(26)
comp = self.completer()
comp.setCompletionMode(QCompleter.PopupCompletion)
comp.setFilterMode(Qt.MatchContains)
comp.setModelSorting(QCompleter.CaseInsensitivelySortedModel)
comp.setMaxVisibleItems(5)
popup = comp.popup()
popup.setStyleSheet(hou.qt.styleSheet())
def mouseReleaseEvent(self, event):
if False: # Type hint
event = QMouseEvent
if isRevertToDefaultEvent(event):
self.clearEditText()
def eventFilter(self, watched, event):
if False: # Type hint
watched = QObject
event = QEvent
if watched == self.lineEdit():
if event.type() == QEvent.MouseButtonRelease and isRevertToDefaultEvent(event):
self.clearEditText()
event.accept()
return True
return False
def keyPressEvent(self, event):
if False: # Type hint
event = QKeyEvent
key = event.key()
mod = event.modifiers()
if mod == Qt.NoModifier and key == Qt.Key_Escape:
self.clearEditText()
else:
super(SearchField, self).keyPressEvent(event)
def hidePopup(self):
super(SearchField, self).hidePopup()
self.lineEdit().setFocus()
link_or_state_icon = 'BUTTONS_link'
embedded_icon = 'BUTTONS_pinned'
class BrowserMode(QStandardItemModel):
def __init__(self):
super(BrowserMode, self).__init__()
class BrowserTreeView(QTreeView):
def __init__(self, parent=None):
super(BrowserTreeView, self).__init__(parent)
self.setAlternatingRowColors(True)
class BrowserTableView(QListView):
def __init__(self, parent=None):
super(BrowserTableView, self).__init__(parent)
self.setViewMode(QListView.IconMode)
self.setResizeMode(QListView.Adjust)
self.setSelectionMode(QAbstractItemView.ExtendedSelection)
self.setVerticalScrollMode(QAbstractItemView.ScrollPerPixel)
self.setIconSize(QSize(120, 90))
self.setUniformItemSizes(True)
self.setContextMenuPolicy(Qt.CustomContextMenu)
class ContentBrowser(QWidget):
def __init__(self, parent=None):
super(ContentBrowser, self).__init__(parent)
self.setWindowTitle('Content Browser')
self.setProperty('houdiniStyle', True)
topLayout = QHBoxLayout()
topLayout.setContentsMargins(4, 4, 4, 2)
topLayout.setSpacing(2)
self.refreshButton = QPushButton()
self.refreshButton.setFixedSize(26, 26)
self.refreshButton.setToolTip('Update\tF5')
self.refreshButton.setIcon(hou.qt.Icon('BUTTONS_reload', 18, 18))
self.refreshButton.setIconSize(QSize(18, 18))
topLayout.addWidget(self.refreshButton)
sep = hou.qt.Separator()
if False: # Type hint
sep = QFrame
sep.setFixedWidth(2)
sep.setFrameShape(QFrame.VLine)
topLayout.addWidget(sep)
viewModeButtonGroup = QButtonGroup(self)
viewModeButtonGroup.setExclusive(True)
self.treeViewButton = QPushButton()
self.treeViewButton.setFixedSize(26, 26)
self.treeViewButton.setToolTip('Tree View\t\tCtrl+1')
self.treeViewButton.setIcon(hou.qt.Icon('BUTTONS_tree', 18, 18))
self.treeViewButton.setIconSize(QSize(18, 18))
self.treeViewButton.setCheckable(True)
viewModeButtonGroup.addButton(self.treeViewButton)
topLayout.addWidget(self.treeViewButton)
self.tableViewButton = QPushButton()
self.tableViewButton.setFixedSize(26, 26)
self.tableViewButton.setToolTip('Table View\tCtrl+2')
self.tableViewButton.setIcon(hou.qt.Icon('NETVIEW_shape_palette', 18, 18))
self.tableViewButton.setIconSize(QSize(18, 18))
self.tableViewButton.setCheckable(True)
self.tableViewButton.toggle()
viewModeButtonGroup.addButton(self.tableViewButton)
topLayout.addWidget(self.tableViewButton)
topLayout.addWidget(sep)
self.searchField = SearchField()
self.searchField.setToolTip('Search\tCtrl+F, F3')
topLayout.addWidget(self.searchField)
searchModeButtonGroup = QButtonGroup(self)
searchModeButtonGroup.setExclusive(True)
self.wholeSearchButton = QPushButton()
self.wholeSearchButton.setFixedSize(26, 26)
self.wholeSearchButton.setCheckable(True)
self.wholeSearchButton.setToolTip('Whole word search')
self.wholeSearchButton.setIcon(hou.qt.Icon('VOP_titlecase', 18, 18))
self.wholeSearchButton.setIconSize(QSize(18, 18))
searchModeButtonGroup.addButton(self.wholeSearchButton)
topLayout.addWidget(self.wholeSearchButton)
self.fuzzySearchButton = QPushButton()
self.fuzzySearchButton.setFixedSize(26, 26)
self.fuzzySearchButton.setCheckable(True)
self.fuzzySearchButton.toggle()
self.fuzzySearchButton.setToolTip('Fuzzy search')
self.fuzzySearchButton.setIcon(hou.qt.Icon('VOP_endswith', 18, 18))
self.fuzzySearchButton.setIconSize(QSize(18, 18))
searchModeButtonGroup.addButton(self.fuzzySearchButton)
topLayout.addWidget(self.fuzzySearchButton)
self.patternSearchButton = QPushButton()
self.patternSearchButton.setFixedSize(26, 26)
self.patternSearchButton.setCheckable(True)
self.patternSearchButton.setToolTip('Search by Pattern')
self.patternSearchButton.setIcon(hou.qt.Icon('VOP_isalpha', 18, 18))
self.patternSearchButton.setIconSize(QSize(18, 18))
searchModeButtonGroup.addButton(self.patternSearchButton)
topLayout.addWidget(self.patternSearchButton)
self.regexSearchButton = QPushButton()
self.regexSearchButton.setFixedSize(26, 26)
self.regexSearchButton.setCheckable(True)
self.regexSearchButton.setToolTip('Search by Regular Expression')
self.regexSearchButton.setIcon(hou.qt.Icon('VOP_regex_match', 18, 18))
self.regexSearchButton.setIconSize(QSize(18, 18))
searchModeButtonGroup.addButton(self.regexSearchButton)
topLayout.addWidget(self.regexSearchButton)
topLayout.addWidget(sep)
topLayout.addWidget(hou.qt.HelpButton('/hammer/content_browser', 'Show Help\tF1'))
middleLayout = QHBoxLayout()
middleLayout.setContentsMargins(4, 0, 0, 4)
middleLayout.setSpacing(4)
self.viewLayout = QStackedLayout(middleLayout)
model = QFileSystemModel()
model.setRootPath('C:/')
treeView = BrowserTreeView()
treeView.setModel(model)
treeView.setRootIndex(model.index('C:/'))
self.viewLayout.addWidget(treeView)
tableView = BrowserTableView()
tableView.setModel(model)
tableView.setRootIndex(model.index('C:/'))
tableView.setSelectionModel(treeView.selectionModel())
self.viewLayout.addWidget(tableView)
self.viewLayout.setCurrentIndex(1)
self.treeViewButton.clicked.connect(self.switchToTreeView)
self.addAction(createAction(self, 'Tree View', self.switchToTreeView, shortcut='Ctrl+1'))
self.tableViewButton.clicked.connect(self.switchToTableView)
self.addAction(createAction(self, 'Table View', self.switchToTableView, shortcut='Ctrl+2'))
bottomLayout = QHBoxLayout()
bottomLayout.setContentsMargins(4, 0, 4, 4)
bottomLayout.setSpacing(2)
settingsButton = QPushButton()
settingsButton.setFixedSize(26, 26)
settingsButton.setToolTip('Settings')
settingsButton.setIcon(hou.qt.Icon('BUTTONS_gear_mini', 18, 18))
settingsButton.setIconSize(QSize(18, 18))
bottomLayout.addWidget(settingsButton)
spacer = QSpacerItem(0, 0, QSizePolicy.Expanding, QSizePolicy.Ignored)
bottomLayout.addSpacerItem(spacer)
self.scaleSlider = Slider()
self.scaleSlider.setDefaultValue(50)
self.scaleSlider.setFixedWidth(120)
self.scaleSlider.valueChanged.connect(lambda v: tableView.setIconSize(QSize(120, 90) * v / 100))
bottomLayout.addWidget(self.scaleSlider)
mainLayout = QVBoxLayout(self)
mainLayout.setContentsMargins(0, 0, 0, 0)
mainLayout.setSpacing(4)
mainLayout.addLayout(topLayout)
mainLayout.addLayout(middleLayout)
mainLayout.addLayout(bottomLayout)
def switchToTreeView(self):
self.viewLayout.setCurrentIndex(0)
self.scaleSlider.hide()
self.treeViewButton.setChecked(True)
def switchToTableView(self):
self.viewLayout.setCurrentIndex(1)
self.scaleSlider.show()
self.tableViewButton.setChecked(True)
def keyPressEvent(self, event):
if False: # Type hint
event = QKeyEvent
key = event.key()
mod = event.modifiers()
if mod == Qt.NoModifier and key == Qt.Key_F5:
pass
elif mod == Qt.ControlModifier and key == Qt.Key_F:
self.searchField.setFocus()
elif mod == Qt.NoModifier and key == Qt.Key_F3:
self.searchField.setFocus()
elif mod == Qt.ControlModifier and key == Qt.Key_Equal:
pass
elif mod == Qt.ControlModifier and key == Qt.Key_Minus:
pass
elif mod == Qt.ControlModifier and key == Qt.Key_1:
pass
elif mod == Qt.ControlModifier and key == Qt.Key_2:
pass
elif mod == Qt.NoModifier and key == Qt.Key_F1:
pass
else:
super(ContentBrowser, self).keyPressEvent(event)
if __name__ == '__main__':
app = QApplication([])
window = ContentBrowser()
window.show()
app.exec_()
| de | 0.430901 | # Type hint # Type hint # Type hint # Type hint # Type hint # Type hint # Type hint # Type hint | 2.365036 | 2 |
rt-thread/applications/server/udp_sender.py | luhuadong/stm32f769-disco-demo | 0 | 2864 | #!/usr/bin/python3
"""
UDP sender
"""
import socket
import time
import sys
smsg = b'\xaa\x08\xfe\x00\xc9\xe6\x5f\xee'
def main():
ip_port = ('192.168.3.188', 8888)
if len(sys.argv) < 2:
port = 8888
else:
port = int(sys.argv[1])
# 1. 创建 udp 套接字
udp_socket = socket.socket(socket.AF_INET, socket.SOCK_DGRAM)
# 2. 绑定本地信息
udp_socket.bind(('', port))
cnt = 100
loop = 4
print("send %d...", cnt*loop)
# 3. 接收发送的数据
while cnt > 0:
#loop = 10
#while loop > 0:
for i in range(0, loop):
udp_socket.sendto(smsg, ip_port)
print('.', end=' ')
#loop = loop -1
#recv_data = udp_socket.recvfrom(1024)
#print(recv_data.decode('gbk'))
#print(recv_data.decode('utf-8'))
#print('.', end=' ')
#data = recv_data.decode('utf-8')
#print('0x%x'%data)
cnt = cnt - 1
time.sleep(0.005)
print("")
print("finished")
# 7. 关闭套接字
udp_socket.close()
print("close")
if __name__ == '__main__':
main()
| #!/usr/bin/python3
"""
UDP sender
"""
import socket
import time
import sys
smsg = b'\xaa\x08\xfe\x00\xc9\xe6\x5f\xee'
def main():
ip_port = ('192.168.3.188', 8888)
if len(sys.argv) < 2:
port = 8888
else:
port = int(sys.argv[1])
# 1. 创建 udp 套接字
udp_socket = socket.socket(socket.AF_INET, socket.SOCK_DGRAM)
# 2. 绑定本地信息
udp_socket.bind(('', port))
cnt = 100
loop = 4
print("send %d...", cnt*loop)
# 3. 接收发送的数据
while cnt > 0:
#loop = 10
#while loop > 0:
for i in range(0, loop):
udp_socket.sendto(smsg, ip_port)
print('.', end=' ')
#loop = loop -1
#recv_data = udp_socket.recvfrom(1024)
#print(recv_data.decode('gbk'))
#print(recv_data.decode('utf-8'))
#print('.', end=' ')
#data = recv_data.decode('utf-8')
#print('0x%x'%data)
cnt = cnt - 1
time.sleep(0.005)
print("")
print("finished")
# 7. 关闭套接字
udp_socket.close()
print("close")
if __name__ == '__main__':
main()
| ja | 0.145463 | #!/usr/bin/python3 UDP sender # 1. 创建 udp 套接字 # 2. 绑定本地信息 # 3. 接收发送的数据 #loop = 10 #while loop > 0: #loop = loop -1 #recv_data = udp_socket.recvfrom(1024) #print(recv_data.decode('gbk')) #print(recv_data.decode('utf-8')) #print('.', end=' ') #data = recv_data.decode('utf-8') #print('0x%x'%data) # 7. 关闭套接字 | 2.811073 | 3 |
yudzuki/role.py | LunaProject-Discord/yudzuki.py | 6 | 2865 | <gh_stars>1-10
__all__ = (
"Role",
)
class Role:
def __init__(self, data):
self.data = data
self._update(data)
def _get_json(self):
return self.data
def __repr__(self):
return (
f"<Role id={self.id} name={self.name}>"
)
def __str__(self):
return (
f"{self.name}"
)
def _update(self, data):
self._id = data["id"]
self._color = data["color"]
self._managed = data["managed"]
self._name = data["name"]
self._guild_id = data["guild_id"]
self._mentionable = data["mentionable"]
self._position = data["potition"]
self._hoisted = data["hoisted"]
@property
def id(self):
return self._id
@property
def color(self):
return self._color
@property
def managed(self):
return self._managed
@property
def name(self):
return self._name
@property
def guild_id(self):
return self._guild_id
@property
def mentionable(self):
return self._mentionable
@property
def position(self):
return self._position
@property
def hoisted(self):
return self._hoisted
| __all__ = (
"Role",
)
class Role:
def __init__(self, data):
self.data = data
self._update(data)
def _get_json(self):
return self.data
def __repr__(self):
return (
f"<Role id={self.id} name={self.name}>"
)
def __str__(self):
return (
f"{self.name}"
)
def _update(self, data):
self._id = data["id"]
self._color = data["color"]
self._managed = data["managed"]
self._name = data["name"]
self._guild_id = data["guild_id"]
self._mentionable = data["mentionable"]
self._position = data["potition"]
self._hoisted = data["hoisted"]
@property
def id(self):
return self._id
@property
def color(self):
return self._color
@property
def managed(self):
return self._managed
@property
def name(self):
return self._name
@property
def guild_id(self):
return self._guild_id
@property
def mentionable(self):
return self._mentionable
@property
def position(self):
return self._position
@property
def hoisted(self):
return self._hoisted | none | 1 | 2.673772 | 3 |
|
jassen/django/project/project/urls.py | cabilangan112/intern-drf-blog | 0 | 2866 | """project URL Configuration
The `urlpatterns` list routes URLs to views. For more information please see:
https://docs.djangoproject.com/en/2.0/topics/http/urls/
Examples:
Function views
1. Add an import: from my_app import views
2. Add a URL to urlpatterns: path('', views.home, name='home')
Class-based views
1. Add an import: from other_app.views import Home
2. Add a URL to urlpatterns: path('', Home.as_view(), name='home')
Including another URLconf
1. Import the include() function: from django.urls import include, path
2. Add a URL to urlpatterns: path('blog/', include('blog.urls'))
"""
from django.conf.urls import url, include
from rest_framework import routers
from blog import views
from blog.views import PostViewSet,CommentViewSet,CategoryViewSet,TagViewSet,DraftViewSet,HideViewSet
from django.conf import settings
from django.conf.urls.static import static
router = routers.DefaultRouter()
router.register(r'hide',HideViewSet, base_name='hiddinn')
router.register(r'draft',DraftViewSet, base_name='draft')
router.register(r'post', PostViewSet, base_name='post')
router.register(r'comment', CommentViewSet, base_name='comment')
router.register(r'tags', TagViewSet, base_name='tags')
router.register(r'category', CategoryViewSet, base_name='category')
from django.contrib import admin
from django.urls import path
urlpatterns = [
path('admin/', admin.site.urls),
url(r'^', include(router.urls)),
url(r'^api-auth/', include('rest_framework.urls', namespace='rest_framework'))
]
urlpatterns.extend(
static(settings.STATIC_URL, document_root=settings.STATIC_ROOT) +
static(settings.MEDIA_URL, document_root=settings.MEDIA_ROOT)
) | """project URL Configuration
The `urlpatterns` list routes URLs to views. For more information please see:
https://docs.djangoproject.com/en/2.0/topics/http/urls/
Examples:
Function views
1. Add an import: from my_app import views
2. Add a URL to urlpatterns: path('', views.home, name='home')
Class-based views
1. Add an import: from other_app.views import Home
2. Add a URL to urlpatterns: path('', Home.as_view(), name='home')
Including another URLconf
1. Import the include() function: from django.urls import include, path
2. Add a URL to urlpatterns: path('blog/', include('blog.urls'))
"""
from django.conf.urls import url, include
from rest_framework import routers
from blog import views
from blog.views import PostViewSet,CommentViewSet,CategoryViewSet,TagViewSet,DraftViewSet,HideViewSet
from django.conf import settings
from django.conf.urls.static import static
router = routers.DefaultRouter()
router.register(r'hide',HideViewSet, base_name='hiddinn')
router.register(r'draft',DraftViewSet, base_name='draft')
router.register(r'post', PostViewSet, base_name='post')
router.register(r'comment', CommentViewSet, base_name='comment')
router.register(r'tags', TagViewSet, base_name='tags')
router.register(r'category', CategoryViewSet, base_name='category')
from django.contrib import admin
from django.urls import path
urlpatterns = [
path('admin/', admin.site.urls),
url(r'^', include(router.urls)),
url(r'^api-auth/', include('rest_framework.urls', namespace='rest_framework'))
]
urlpatterns.extend(
static(settings.STATIC_URL, document_root=settings.STATIC_ROOT) +
static(settings.MEDIA_URL, document_root=settings.MEDIA_ROOT)
) | en | 0.554183 | project URL Configuration The `urlpatterns` list routes URLs to views. For more information please see: https://docs.djangoproject.com/en/2.0/topics/http/urls/ Examples: Function views 1. Add an import: from my_app import views 2. Add a URL to urlpatterns: path('', views.home, name='home') Class-based views 1. Add an import: from other_app.views import Home 2. Add a URL to urlpatterns: path('', Home.as_view(), name='home') Including another URLconf 1. Import the include() function: from django.urls import include, path 2. Add a URL to urlpatterns: path('blog/', include('blog.urls')) | 2.630597 | 3 |
deep-learning-app/src/models/__init__.py | everbrez/Deep-Learning-based-Chemical-Graphics-Analysis-Platform | 1 | 2867 | <reponame>everbrez/Deep-Learning-based-Chemical-Graphics-Analysis-Platform
print('init') | print('init') | none | 1 | 0.890087 | 1 |
|
chemmltoolkit/tensorflow/callbacks/variableScheduler.py | Andy-Wilkinson/ChemMLToolk | 1 | 2868 | <reponame>Andy-Wilkinson/ChemMLToolk
import tensorflow as tf
class VariableScheduler(tf.keras.callbacks.Callback):
"""Schedules an arbitary variable during training.
Arguments:
variable: The variable to modify the value of.
schedule: A function that takes an epoch index (integer, indexed
from 0) and current variable value as input and returns a new
value to assign to the variable as output.
verbose: int. 0: quiet, 1: update messages.
"""
def __init__(self, variable, schedule, verbose=0):
super(VariableScheduler, self).__init__()
self.variable = variable
self.schedule = schedule
self.verbose = verbose
def on_epoch_begin(self, epoch, logs=None):
value = self.variable.read_value()
value = self.schedule(epoch, value)
self.variable.assign(value)
if self.verbose > 0:
print(f'\nEpoch {epoch + 1}: VariableScheduler assigning '
f'variable {self.variable.name} to {value}.')
| import tensorflow as tf
class VariableScheduler(tf.keras.callbacks.Callback):
"""Schedules an arbitary variable during training.
Arguments:
variable: The variable to modify the value of.
schedule: A function that takes an epoch index (integer, indexed
from 0) and current variable value as input and returns a new
value to assign to the variable as output.
verbose: int. 0: quiet, 1: update messages.
"""
def __init__(self, variable, schedule, verbose=0):
super(VariableScheduler, self).__init__()
self.variable = variable
self.schedule = schedule
self.verbose = verbose
def on_epoch_begin(self, epoch, logs=None):
value = self.variable.read_value()
value = self.schedule(epoch, value)
self.variable.assign(value)
if self.verbose > 0:
print(f'\nEpoch {epoch + 1}: VariableScheduler assigning '
f'variable {self.variable.name} to {value}.') | en | 0.741493 | Schedules an arbitary variable during training. Arguments: variable: The variable to modify the value of. schedule: A function that takes an epoch index (integer, indexed from 0) and current variable value as input and returns a new value to assign to the variable as output. verbose: int. 0: quiet, 1: update messages. | 3.341411 | 3 |
join_peaks.py | nijibabulu/chip_tools | 0 | 2869 | #! /usr/bin/env python
import os
import sys
import math
import csv
import collections
import docopt
import peakzilla_qnorm_mapq_patched as pz
__doc__ = '''
Usage: join_peaks.py [options] PEAKS CHIP INPUT [ (PEAKS CHIP INPUT) ... ]
This script finds peaks in common between multiple ChIP experiments determined
by peakzilla. For each ChIP experiment, input a PEAKS file as otuput by
peakzilla, and 2 BED files (CHIP and INPUT) as input to peakzilla.
This will output a table with 3 columns identifying the peaks (Chromosome,
Start, End, Name,'NPeaks','Spread','ChipSE','EnrichSE'). NPeaks signifies the
number of peaks that were called among all the ChIP experiments, Spread is the
difference between the biggest and smallest ChIP peak, ChipSE and EnrichSE are
the standard error on the mean among the ChIP and Enrich values for the peaks.
For each experinent "X", information about the peaks are output: 'XPZName','XPZScore',
'XPZChip','XPZInput','XPZEnrich','XPZFDR','XChip','XInput','XEnrich','XMapq'.
All 'PZ' columns are the original output from peakzilla and the remaining
columns are re-calculated in this script (also output regardless of the presence
of a peak).
Options:
--max-distance=DIST maximum summit distance to join peaks [default: 10]
'''
args = docopt.docopt(__doc__)
#np.set_printoptions(precision=1,suppress=True)
def stddev(l):
mean = sum(l)/float(len(l))
variance = sum((x-mean)**2 for x in l)/(len(l)-1)
return math.sqrt(variance)
def std_err(l):
return stddev(l)/math.sqrt(len(l))
class Peak(object):
def dist(self,other):
if self.chrom == other.chrom:
return abs(self.center-other.center)
else:
return -1
def compute_fold_enrichment(self):
self.computed_fold_enrichment = float(self.computed_chip
)/self.computed_control
class SlavePeak(Peak):
def __init__(self,set_name,center):
self.name = 'Slave'
self.set_name = set_name
self.center = center
class PZPeak(Peak):
def __init__(self,set_name,chrom,start,end,name,summit,score,chip,control,
fold_enrichment,distribution_score,fdr):
self.set_name = set_name
self.chrom = chrom
self.start = int(start)
self.end = int(end)
self.name = name
self.center = int(summit)
self.score = float(score)
self.chip = float(chip)
self.control = float(control)
self.fold_enrichment = float(fold_enrichment)
self.distribution_score = float(distribution_score)
self.fdr = float(fdr)
def width(self):
return self.end-self.start+1
class JoinedPeak(Peak):
WIDTH = 0
HEADER = ['#Chromosome','Start','End','Name','NPeaks','Spread','ChipSE','EnrichSE']
HEADER_TYPES = set()
def __init__(self,pzpeak):
self.chrom = pzpeak.chrom
self.peaks = {}
self.center = self.add(pzpeak) #pzpeak.center
def can_add(self,pzpeak):
return not pzpeak.set_name in self.peaks
def add(self,pzpeak):
self.HEADER_TYPES.add(pzpeak.set_name)
self.peaks[pzpeak.set_name] = pzpeak
return sum(p.center for p in self.peaks.values())/len(self.peaks)
def name(self):
return '%s_%d' % (self.chrom,self.center)
@classmethod
def header(cls):
s = '\t'.join(cls.HEADER) + '\t'
#'#Chromosome\tPosition\tNPeaks\tSpread\t'
for htype in cls.HEADER_TYPES:
s += '\t'.join(
htype + '_' + x for x in [
'PZName','PZScore','PZChip','PZInput','PZEnrich','PZFDR','Chip','Input','Enrich','Mapq']
) + '\t'
return s
def __str__(self):
s = ''
called_peaks = 0
peak_signals = []
peak_enrichs = []
for set_name,peak in self.peaks.items():
if hasattr(peak,'score'):
s += peak.name + '\t' + '\t'.join('%.2f' % x for x in
[peak.score,peak.chip,peak.control,peak.fold_enrichment,peak.fdr]) + '\t'
called_peaks += 1
#s += '%.1f\t%.1f\t%.1f\t%.1f\t' % (
#peak.score,peak.chip,peak.control,peak.fold_enrichment)
else:
s += 'NA\tNA\tNA\tNA\tNA\tNA\t'
if hasattr(peak,'pzpeak'):
s += '\t'.join('%.2f' % x for x in [
peak.pzpeak.nrom_signal,peak.pzpeak.norm_background,peak.pzpeak.fold_enrichment,peak.pzpeak.mapq_score
]) + '\t'
peak_signals.append(peak.pzpeak.nrom_signal)
peak_enrichs.append(peak.pzpeak.fold_enrichment)
else:
s += 'NA\tNA\tNA\tNA\tNA\t'
#peak.computed_chip,peak.computed_control,peak.computed_fold_enrichment
#s += '%.1f\t%.1f\t%.1f\t' % (
#peak.computed_chip,peak.computed_control,peak.computed_fold_enrichment)
#s += '\t'.join([str(x) for x in
#[peak.score,peak.chip,peak.fold_enrichment]])
try:
if len(peak_signals):
s = '\t'.join([self.chrom,str(self.center-self.WIDTH/2),str(self.center+self.WIDTH/2),
self.chrom+'_'+str(self.center),str(called_peaks)]) +\
'\t%.2f\t%.2f\t%.2f\t' % (
max(peak_signals)/(min(peak_signals) + sys.float_info.epsilon),
std_err(peak_signals), std_err(peak_enrichs),
) + s
else:
s = '\t'.join([self.chrom,str(self.center),
self.chrom+'_'+str(self.center),str(called_peaks)]) +\
'\tNA\tNA\tNA\t' + s
except:
print max(peak_signals),min(peak_signals)
raise
return s
class PeakScorer(pz.PeakContainer):
def __init__(self, ip_tags, control_tags, peak_size, plus_model, minus_model):
self.ip_tags = ip_tags
self.control_tags = control_tags
self.peak_size = peak_size
self.peak_shift = (peak_size - 1) / 2
self.score_threshold = 10
self.plus_model = plus_model
self.minus_model = minus_model
self.peaks = collections.defaultdict(list)
self.peak_count = 0
self.plus_window = collections.deque([])
self.minus_window = collections.deque([])
self.position = 0
def fill_scores(self,chrom,libtype,scoretype):
plus_tags = collections.deque(getattr(self,'%s_tags' % libtype).get_tags(chrom, '+'))
plus_mapq = collections.deque(getattr(self,'%s_tags' % libtype).get_mapq(chrom, '+'))
minus_tags = collections.deque(getattr(self,'%s_tags' % libtype).get_tags(chrom, '-'))
minus_mapq = collections.deque(getattr(self,'%s_tags' % libtype).get_mapq(chrom, '-'))
self.plus_window = collections.deque([])
self.minus_window = collections.deque([])
self.plus_mapq = collections.deque([])
self.minus_mapq = collections.deque([])
for peak in self.peaks[chrom]:
# fill windows
while plus_tags and plus_tags[0] <= (peak.position + self.peak_shift):
self.plus_window.append(plus_tags.popleft())
self.plus_mapq.append(plus_mapq.popleft())
while minus_tags and minus_tags[0] <= (peak.position + self.peak_shift):
self.minus_window.append(minus_tags.popleft())
self.minus_mapq.append(minus_mapq.popleft())
# get rid of old tags not fitting in the window any more
while self.plus_window and self.plus_window[0] < (peak.position - self.peak_shift):
self.plus_window.popleft()
self.plus_mapq.popleft()
while self.minus_window and self.minus_window[0] < (peak.position - self.peak_shift):
self.minus_window.popleft()
self.minus_mapq.popleft()
# calculate normalized background level
# add position to region if over threshold
self.position = peak.position
if libtype == 'ip':
peak.mapq_score = float(sum(self.plus_mapq) + sum(self.minus_mapq)
)/max(1,(len(self.plus_mapq) + len(self.minus_mapq)))
#if peak.name == 'Peak_12869':
#print zip(self.plus_window,self.plus_mapq)
#print zip(self.minus_window,self.minus_mapq)
#print sum(self.plus_mapq) , sum(self.minus_mapq), len(self.plus_mapq) , len(self.minus_mapq)
#print peak.mapq_score
setattr(peak,scoretype,self.calculate_score())
def score_peaks(self,peak_dict):
for chrom,peaks in peak_dict.items():
for jp in peaks:
jp.pzpeak = pz.Peak()
jp.pzpeak.size = self.peak_size
jp.pzpeak.shift = self.peak_shift
jp.pzpeak.position = jp.center
jp.pzpeak.name = jp.name
self.peaks[chrom].append(jp.pzpeak)
self.peak_count += 1
for chrom,peaks in self.peaks.items():
self.peaks[chrom] = sorted(self.peaks[chrom],
lambda a,b: cmp(a.position,b.position))
self.fill_scores(chrom,'ip','score')
self.fill_scores(chrom,'control','background')
self.determine_fold_enrichment(chrom)
self.determine_signal_over_background(chrom)
class FileSet(object):
def __init__(self,peakfile,chipfile,controlfile):
self.peakfile = peakfile
self.chip_file = chipfile
self.chip_tags = pz.TagContainer(store_mapq=True)
self.chip_tags(chipfile,True)
self.control_file = controlfile
self.control_tags = pz.TagContainer(store_mapq=True)
self.control_tags(controlfile,True)
#print self.chip_tags, self.control_tags
def get_file(self,type):
return getattr(self, '%s_file' % type)
def get_tagcount(self,type):
return getattr(self, '%s_tags' % type)
maxdist = int(args['--max-distance'])
peaksets = {}
filesets = {}
for peakfile,chipfile,controlfile in zip(args['PEAKS'],args['CHIP'],args['INPUT']):
set_name = os.path.basename(peakfile).split('.')[0]
peaksets[set_name] = collections.defaultdict(list)
filesets[set_name] = FileSet(peakfile,chipfile,controlfile)
r = csv.reader(open(peakfile),delimiter='\t')
r.next() # header
'''
#XXX: limit peaks
maxpeaks = 20
peakcounter = 0
for row in r:
if float(row[5]) >= 100 and float(row[8]) >= 10:
peakcounter += 1
if peakcounter > maxpeaks:
break
peaksets[set_name][row[0]].append(PZPeak(set_name,*row))
'''
for row in r:
peaksets[set_name][row[0]].append(PZPeak(set_name,*row))
JoinedPeak.WIDTH += peaksets[set_name].itervalues().next()[0].width()
JoinedPeak.WIDTH /= len(peaksets)
# find closest peak to each peak in the new set
# make new peaks when there's no qualifying one
npeaks = 0
joined_peaks = collections.defaultdict(list)
for set_name,peakset in peaksets.items():
for chrom,peaks in peakset.items():
for peak in peaks:
closest = None
for jp in joined_peaks[chrom]:
dist = jp.dist(peak)
if dist >= 0 and dist <= maxdist:
if closest is None or closest.dist(peak) > dist:
closest = jp
if closest is None or not closest.can_add(peak):
npeaks += 1
joined_peaks[chrom].append(JoinedPeak(peak))
else:
closest.add(peak)
plus_model,minus_model = pz.generate_ideal_model(JoinedPeak.WIDTH)
for set_name,fileset in filesets.items():
scorer = PeakScorer(fileset.chip_tags,fileset.control_tags,
JoinedPeak.WIDTH,plus_model,minus_model)
peaks_to_score = collections.defaultdict(list)
for chrom,peaks in joined_peaks.items():
for jp in peaks:
if set_name not in jp.peaks:
jp.peaks[set_name] = SlavePeak(set_name,jp.center)
peaks_to_score[chrom].append(jp.peaks[set_name])
scorer.score_peaks(peaks_to_score)
print JoinedPeak.header()
for chrom,peaks in joined_peaks.items():
for peak in peaks:
print peak
#plus_model,minus_model = pz.generate_ideal_model(JoinedPeak.WIDTH)
#def get_coverage(fileset,type,jp,pseudocount=0):
#score = 0
#start = max(0,jp.center-JoinedPeak.WIDTH/2)
#for aln in fileset.get_file(type).fetch(
#reference = jp.chrom, start = start,
#end = jp.center+JoinedPeak.WIDTH/2):
#if aln.is_reverse:
#score += minus_model[aln.pos-start]
#else:
#score += plus_model[aln.pos-start]
#return (score+pseudocount)*10.**6/fileset.get_tagcount(type)
#return 10.**6*fileset.get_file(type).count(
#reference = jp.chrom,
#start = max(0,jp.center-JoinedPeak.WIDTH/2),
#end = jp.center+JoinedPeak.WIDTH/2)/fileset.get_tagcount(type)
#start = jp.center,
#end = jp.center+1)
#matrix = np.zeros((npeaks,len(peaksets)*2))
#i = 0
#for chrom,peaks in joined_peaks.items():
#for jp in peaks:
#for j,set_name in enumerate(peaksets.keys()):
#control_coverage = get_coverage(filesets[set_name],'control',jp,pseudocount=1)
#chip_coverage = get_coverage(filesets[set_name],'chip',jp)
#matrix[i][j] = float(chip_coverage)
#matrix[i][j+len(peaksets)] = float(control_coverage)
#i += 1
#quantile_normalize.quantile_norm(matrix)
#i = 0
#for chrom,peaks in joined_peaks.items():
#for jp in peaks:
#for j,set_name in enumerate(peaksets.keys()):
#if set_name not in jp.peaks:
#jp.peaks[set_name] = SlavePeak(
#set_name,matrix[i][j],matrix[i][j + len(peaksets)])
#else:
#jp.peaks[set_name].computed_chip = matrix[i][j]
#jp.peaks[set_name].computed_control = matrix[i][j+len(peaksets)]
#jp.peaks[set_name].compute_fold_enrichment()
#print jp
#i += 1
'''
i = 0
for chrom,peaks in joined_peaks.items():
for jp in peaks:
for j,set_name in enumerate(filesets.keys()):
matrix[i][j] = float(jp.peaks[set_name].computed_chip)
matrix[i][j+len(peaksets)] = float(jp.peaks[set_name].computed_control)
i += 1
'''
| #! /usr/bin/env python
import os
import sys
import math
import csv
import collections
import docopt
import peakzilla_qnorm_mapq_patched as pz
__doc__ = '''
Usage: join_peaks.py [options] PEAKS CHIP INPUT [ (PEAKS CHIP INPUT) ... ]
This script finds peaks in common between multiple ChIP experiments determined
by peakzilla. For each ChIP experiment, input a PEAKS file as otuput by
peakzilla, and 2 BED files (CHIP and INPUT) as input to peakzilla.
This will output a table with 3 columns identifying the peaks (Chromosome,
Start, End, Name,'NPeaks','Spread','ChipSE','EnrichSE'). NPeaks signifies the
number of peaks that were called among all the ChIP experiments, Spread is the
difference between the biggest and smallest ChIP peak, ChipSE and EnrichSE are
the standard error on the mean among the ChIP and Enrich values for the peaks.
For each experinent "X", information about the peaks are output: 'XPZName','XPZScore',
'XPZChip','XPZInput','XPZEnrich','XPZFDR','XChip','XInput','XEnrich','XMapq'.
All 'PZ' columns are the original output from peakzilla and the remaining
columns are re-calculated in this script (also output regardless of the presence
of a peak).
Options:
--max-distance=DIST maximum summit distance to join peaks [default: 10]
'''
args = docopt.docopt(__doc__)
#np.set_printoptions(precision=1,suppress=True)
def stddev(l):
mean = sum(l)/float(len(l))
variance = sum((x-mean)**2 for x in l)/(len(l)-1)
return math.sqrt(variance)
def std_err(l):
return stddev(l)/math.sqrt(len(l))
class Peak(object):
def dist(self,other):
if self.chrom == other.chrom:
return abs(self.center-other.center)
else:
return -1
def compute_fold_enrichment(self):
self.computed_fold_enrichment = float(self.computed_chip
)/self.computed_control
class SlavePeak(Peak):
def __init__(self,set_name,center):
self.name = 'Slave'
self.set_name = set_name
self.center = center
class PZPeak(Peak):
def __init__(self,set_name,chrom,start,end,name,summit,score,chip,control,
fold_enrichment,distribution_score,fdr):
self.set_name = set_name
self.chrom = chrom
self.start = int(start)
self.end = int(end)
self.name = name
self.center = int(summit)
self.score = float(score)
self.chip = float(chip)
self.control = float(control)
self.fold_enrichment = float(fold_enrichment)
self.distribution_score = float(distribution_score)
self.fdr = float(fdr)
def width(self):
return self.end-self.start+1
class JoinedPeak(Peak):
WIDTH = 0
HEADER = ['#Chromosome','Start','End','Name','NPeaks','Spread','ChipSE','EnrichSE']
HEADER_TYPES = set()
def __init__(self,pzpeak):
self.chrom = pzpeak.chrom
self.peaks = {}
self.center = self.add(pzpeak) #pzpeak.center
def can_add(self,pzpeak):
return not pzpeak.set_name in self.peaks
def add(self,pzpeak):
self.HEADER_TYPES.add(pzpeak.set_name)
self.peaks[pzpeak.set_name] = pzpeak
return sum(p.center for p in self.peaks.values())/len(self.peaks)
def name(self):
return '%s_%d' % (self.chrom,self.center)
@classmethod
def header(cls):
s = '\t'.join(cls.HEADER) + '\t'
#'#Chromosome\tPosition\tNPeaks\tSpread\t'
for htype in cls.HEADER_TYPES:
s += '\t'.join(
htype + '_' + x for x in [
'PZName','PZScore','PZChip','PZInput','PZEnrich','PZFDR','Chip','Input','Enrich','Mapq']
) + '\t'
return s
def __str__(self):
s = ''
called_peaks = 0
peak_signals = []
peak_enrichs = []
for set_name,peak in self.peaks.items():
if hasattr(peak,'score'):
s += peak.name + '\t' + '\t'.join('%.2f' % x for x in
[peak.score,peak.chip,peak.control,peak.fold_enrichment,peak.fdr]) + '\t'
called_peaks += 1
#s += '%.1f\t%.1f\t%.1f\t%.1f\t' % (
#peak.score,peak.chip,peak.control,peak.fold_enrichment)
else:
s += 'NA\tNA\tNA\tNA\tNA\tNA\t'
if hasattr(peak,'pzpeak'):
s += '\t'.join('%.2f' % x for x in [
peak.pzpeak.nrom_signal,peak.pzpeak.norm_background,peak.pzpeak.fold_enrichment,peak.pzpeak.mapq_score
]) + '\t'
peak_signals.append(peak.pzpeak.nrom_signal)
peak_enrichs.append(peak.pzpeak.fold_enrichment)
else:
s += 'NA\tNA\tNA\tNA\tNA\t'
#peak.computed_chip,peak.computed_control,peak.computed_fold_enrichment
#s += '%.1f\t%.1f\t%.1f\t' % (
#peak.computed_chip,peak.computed_control,peak.computed_fold_enrichment)
#s += '\t'.join([str(x) for x in
#[peak.score,peak.chip,peak.fold_enrichment]])
try:
if len(peak_signals):
s = '\t'.join([self.chrom,str(self.center-self.WIDTH/2),str(self.center+self.WIDTH/2),
self.chrom+'_'+str(self.center),str(called_peaks)]) +\
'\t%.2f\t%.2f\t%.2f\t' % (
max(peak_signals)/(min(peak_signals) + sys.float_info.epsilon),
std_err(peak_signals), std_err(peak_enrichs),
) + s
else:
s = '\t'.join([self.chrom,str(self.center),
self.chrom+'_'+str(self.center),str(called_peaks)]) +\
'\tNA\tNA\tNA\t' + s
except:
print max(peak_signals),min(peak_signals)
raise
return s
class PeakScorer(pz.PeakContainer):
def __init__(self, ip_tags, control_tags, peak_size, plus_model, minus_model):
self.ip_tags = ip_tags
self.control_tags = control_tags
self.peak_size = peak_size
self.peak_shift = (peak_size - 1) / 2
self.score_threshold = 10
self.plus_model = plus_model
self.minus_model = minus_model
self.peaks = collections.defaultdict(list)
self.peak_count = 0
self.plus_window = collections.deque([])
self.minus_window = collections.deque([])
self.position = 0
def fill_scores(self,chrom,libtype,scoretype):
plus_tags = collections.deque(getattr(self,'%s_tags' % libtype).get_tags(chrom, '+'))
plus_mapq = collections.deque(getattr(self,'%s_tags' % libtype).get_mapq(chrom, '+'))
minus_tags = collections.deque(getattr(self,'%s_tags' % libtype).get_tags(chrom, '-'))
minus_mapq = collections.deque(getattr(self,'%s_tags' % libtype).get_mapq(chrom, '-'))
self.plus_window = collections.deque([])
self.minus_window = collections.deque([])
self.plus_mapq = collections.deque([])
self.minus_mapq = collections.deque([])
for peak in self.peaks[chrom]:
# fill windows
while plus_tags and plus_tags[0] <= (peak.position + self.peak_shift):
self.plus_window.append(plus_tags.popleft())
self.plus_mapq.append(plus_mapq.popleft())
while minus_tags and minus_tags[0] <= (peak.position + self.peak_shift):
self.minus_window.append(minus_tags.popleft())
self.minus_mapq.append(minus_mapq.popleft())
# get rid of old tags not fitting in the window any more
while self.plus_window and self.plus_window[0] < (peak.position - self.peak_shift):
self.plus_window.popleft()
self.plus_mapq.popleft()
while self.minus_window and self.minus_window[0] < (peak.position - self.peak_shift):
self.minus_window.popleft()
self.minus_mapq.popleft()
# calculate normalized background level
# add position to region if over threshold
self.position = peak.position
if libtype == 'ip':
peak.mapq_score = float(sum(self.plus_mapq) + sum(self.minus_mapq)
)/max(1,(len(self.plus_mapq) + len(self.minus_mapq)))
#if peak.name == 'Peak_12869':
#print zip(self.plus_window,self.plus_mapq)
#print zip(self.minus_window,self.minus_mapq)
#print sum(self.plus_mapq) , sum(self.minus_mapq), len(self.plus_mapq) , len(self.minus_mapq)
#print peak.mapq_score
setattr(peak,scoretype,self.calculate_score())
def score_peaks(self,peak_dict):
for chrom,peaks in peak_dict.items():
for jp in peaks:
jp.pzpeak = pz.Peak()
jp.pzpeak.size = self.peak_size
jp.pzpeak.shift = self.peak_shift
jp.pzpeak.position = jp.center
jp.pzpeak.name = jp.name
self.peaks[chrom].append(jp.pzpeak)
self.peak_count += 1
for chrom,peaks in self.peaks.items():
self.peaks[chrom] = sorted(self.peaks[chrom],
lambda a,b: cmp(a.position,b.position))
self.fill_scores(chrom,'ip','score')
self.fill_scores(chrom,'control','background')
self.determine_fold_enrichment(chrom)
self.determine_signal_over_background(chrom)
class FileSet(object):
def __init__(self,peakfile,chipfile,controlfile):
self.peakfile = peakfile
self.chip_file = chipfile
self.chip_tags = pz.TagContainer(store_mapq=True)
self.chip_tags(chipfile,True)
self.control_file = controlfile
self.control_tags = pz.TagContainer(store_mapq=True)
self.control_tags(controlfile,True)
#print self.chip_tags, self.control_tags
def get_file(self,type):
return getattr(self, '%s_file' % type)
def get_tagcount(self,type):
return getattr(self, '%s_tags' % type)
maxdist = int(args['--max-distance'])
peaksets = {}
filesets = {}
for peakfile,chipfile,controlfile in zip(args['PEAKS'],args['CHIP'],args['INPUT']):
set_name = os.path.basename(peakfile).split('.')[0]
peaksets[set_name] = collections.defaultdict(list)
filesets[set_name] = FileSet(peakfile,chipfile,controlfile)
r = csv.reader(open(peakfile),delimiter='\t')
r.next() # header
'''
#XXX: limit peaks
maxpeaks = 20
peakcounter = 0
for row in r:
if float(row[5]) >= 100 and float(row[8]) >= 10:
peakcounter += 1
if peakcounter > maxpeaks:
break
peaksets[set_name][row[0]].append(PZPeak(set_name,*row))
'''
for row in r:
peaksets[set_name][row[0]].append(PZPeak(set_name,*row))
JoinedPeak.WIDTH += peaksets[set_name].itervalues().next()[0].width()
JoinedPeak.WIDTH /= len(peaksets)
# find closest peak to each peak in the new set
# make new peaks when there's no qualifying one
npeaks = 0
joined_peaks = collections.defaultdict(list)
for set_name,peakset in peaksets.items():
for chrom,peaks in peakset.items():
for peak in peaks:
closest = None
for jp in joined_peaks[chrom]:
dist = jp.dist(peak)
if dist >= 0 and dist <= maxdist:
if closest is None or closest.dist(peak) > dist:
closest = jp
if closest is None or not closest.can_add(peak):
npeaks += 1
joined_peaks[chrom].append(JoinedPeak(peak))
else:
closest.add(peak)
plus_model,minus_model = pz.generate_ideal_model(JoinedPeak.WIDTH)
for set_name,fileset in filesets.items():
scorer = PeakScorer(fileset.chip_tags,fileset.control_tags,
JoinedPeak.WIDTH,plus_model,minus_model)
peaks_to_score = collections.defaultdict(list)
for chrom,peaks in joined_peaks.items():
for jp in peaks:
if set_name not in jp.peaks:
jp.peaks[set_name] = SlavePeak(set_name,jp.center)
peaks_to_score[chrom].append(jp.peaks[set_name])
scorer.score_peaks(peaks_to_score)
print JoinedPeak.header()
for chrom,peaks in joined_peaks.items():
for peak in peaks:
print peak
#plus_model,minus_model = pz.generate_ideal_model(JoinedPeak.WIDTH)
#def get_coverage(fileset,type,jp,pseudocount=0):
#score = 0
#start = max(0,jp.center-JoinedPeak.WIDTH/2)
#for aln in fileset.get_file(type).fetch(
#reference = jp.chrom, start = start,
#end = jp.center+JoinedPeak.WIDTH/2):
#if aln.is_reverse:
#score += minus_model[aln.pos-start]
#else:
#score += plus_model[aln.pos-start]
#return (score+pseudocount)*10.**6/fileset.get_tagcount(type)
#return 10.**6*fileset.get_file(type).count(
#reference = jp.chrom,
#start = max(0,jp.center-JoinedPeak.WIDTH/2),
#end = jp.center+JoinedPeak.WIDTH/2)/fileset.get_tagcount(type)
#start = jp.center,
#end = jp.center+1)
#matrix = np.zeros((npeaks,len(peaksets)*2))
#i = 0
#for chrom,peaks in joined_peaks.items():
#for jp in peaks:
#for j,set_name in enumerate(peaksets.keys()):
#control_coverage = get_coverage(filesets[set_name],'control',jp,pseudocount=1)
#chip_coverage = get_coverage(filesets[set_name],'chip',jp)
#matrix[i][j] = float(chip_coverage)
#matrix[i][j+len(peaksets)] = float(control_coverage)
#i += 1
#quantile_normalize.quantile_norm(matrix)
#i = 0
#for chrom,peaks in joined_peaks.items():
#for jp in peaks:
#for j,set_name in enumerate(peaksets.keys()):
#if set_name not in jp.peaks:
#jp.peaks[set_name] = SlavePeak(
#set_name,matrix[i][j],matrix[i][j + len(peaksets)])
#else:
#jp.peaks[set_name].computed_chip = matrix[i][j]
#jp.peaks[set_name].computed_control = matrix[i][j+len(peaksets)]
#jp.peaks[set_name].compute_fold_enrichment()
#print jp
#i += 1
'''
i = 0
for chrom,peaks in joined_peaks.items():
for jp in peaks:
for j,set_name in enumerate(filesets.keys()):
matrix[i][j] = float(jp.peaks[set_name].computed_chip)
matrix[i][j+len(peaksets)] = float(jp.peaks[set_name].computed_control)
i += 1
'''
| en | 0.604821 | #! /usr/bin/env python Usage: join_peaks.py [options] PEAKS CHIP INPUT [ (PEAKS CHIP INPUT) ... ] This script finds peaks in common between multiple ChIP experiments determined by peakzilla. For each ChIP experiment, input a PEAKS file as otuput by peakzilla, and 2 BED files (CHIP and INPUT) as input to peakzilla. This will output a table with 3 columns identifying the peaks (Chromosome, Start, End, Name,'NPeaks','Spread','ChipSE','EnrichSE'). NPeaks signifies the number of peaks that were called among all the ChIP experiments, Spread is the difference between the biggest and smallest ChIP peak, ChipSE and EnrichSE are the standard error on the mean among the ChIP and Enrich values for the peaks. For each experinent "X", information about the peaks are output: 'XPZName','XPZScore', 'XPZChip','XPZInput','XPZEnrich','XPZFDR','XChip','XInput','XEnrich','XMapq'. All 'PZ' columns are the original output from peakzilla and the remaining columns are re-calculated in this script (also output regardless of the presence of a peak). Options: --max-distance=DIST maximum summit distance to join peaks [default: 10] #np.set_printoptions(precision=1,suppress=True) #pzpeak.center #'#Chromosome\tPosition\tNPeaks\tSpread\t' #s += '%.1f\t%.1f\t%.1f\t%.1f\t' % ( #peak.score,peak.chip,peak.control,peak.fold_enrichment) #peak.computed_chip,peak.computed_control,peak.computed_fold_enrichment #s += '%.1f\t%.1f\t%.1f\t' % ( #peak.computed_chip,peak.computed_control,peak.computed_fold_enrichment) #s += '\t'.join([str(x) for x in #[peak.score,peak.chip,peak.fold_enrichment]]) # fill windows # get rid of old tags not fitting in the window any more # calculate normalized background level # add position to region if over threshold #if peak.name == 'Peak_12869': #print zip(self.plus_window,self.plus_mapq) #print zip(self.minus_window,self.minus_mapq) #print sum(self.plus_mapq) , sum(self.minus_mapq), len(self.plus_mapq) , len(self.minus_mapq) #print peak.mapq_score #print self.chip_tags, self.control_tags # header #XXX: limit peaks maxpeaks = 20 peakcounter = 0 for row in r: if float(row[5]) >= 100 and float(row[8]) >= 10: peakcounter += 1 if peakcounter > maxpeaks: break peaksets[set_name][row[0]].append(PZPeak(set_name,*row)) # find closest peak to each peak in the new set # make new peaks when there's no qualifying one #plus_model,minus_model = pz.generate_ideal_model(JoinedPeak.WIDTH) #def get_coverage(fileset,type,jp,pseudocount=0): #score = 0 #start = max(0,jp.center-JoinedPeak.WIDTH/2) #for aln in fileset.get_file(type).fetch( #reference = jp.chrom, start = start, #end = jp.center+JoinedPeak.WIDTH/2): #if aln.is_reverse: #score += minus_model[aln.pos-start] #else: #score += plus_model[aln.pos-start] #return (score+pseudocount)*10.**6/fileset.get_tagcount(type) #return 10.**6*fileset.get_file(type).count( #reference = jp.chrom, #start = max(0,jp.center-JoinedPeak.WIDTH/2), #end = jp.center+JoinedPeak.WIDTH/2)/fileset.get_tagcount(type) #start = jp.center, #end = jp.center+1) #matrix = np.zeros((npeaks,len(peaksets)*2)) #i = 0 #for chrom,peaks in joined_peaks.items(): #for jp in peaks: #for j,set_name in enumerate(peaksets.keys()): #control_coverage = get_coverage(filesets[set_name],'control',jp,pseudocount=1) #chip_coverage = get_coverage(filesets[set_name],'chip',jp) #matrix[i][j] = float(chip_coverage) #matrix[i][j+len(peaksets)] = float(control_coverage) #i += 1 #quantile_normalize.quantile_norm(matrix) #i = 0 #for chrom,peaks in joined_peaks.items(): #for jp in peaks: #for j,set_name in enumerate(peaksets.keys()): #if set_name not in jp.peaks: #jp.peaks[set_name] = SlavePeak( #set_name,matrix[i][j],matrix[i][j + len(peaksets)]) #else: #jp.peaks[set_name].computed_chip = matrix[i][j] #jp.peaks[set_name].computed_control = matrix[i][j+len(peaksets)] #jp.peaks[set_name].compute_fold_enrichment() #print jp #i += 1 i = 0 for chrom,peaks in joined_peaks.items(): for jp in peaks: for j,set_name in enumerate(filesets.keys()): matrix[i][j] = float(jp.peaks[set_name].computed_chip) matrix[i][j+len(peaksets)] = float(jp.peaks[set_name].computed_control) i += 1 | 2.845151 | 3 |
django_town/rest_swagger/views.py | uptown/django-town | 0 | 2870 | <filename>django_town/rest_swagger/views.py
from django_town.rest import RestApiView, rest_api_manager
from django_town.http import http_json_response
from django_town.cache.utlis import SimpleCache
from django_town.oauth2.swagger import swagger_authorizations_data
from django_town.social.oauth2.permissions import OAuth2Authenticated, OAuth2AuthenticatedOrReadOnly
from django_town.social.permissions import Authenticated, AuthenticatedOrReadOnly
class ApiDocsView(RestApiView):
def read(self, request, api_version):
def load_cache(api_version="alpha"):
manager = rest_api_manager(api_version)
ret = {'title': manager.name,
'description': manager.description,
'apiVersion': manager.api_version, 'swaggerVersion': "1.2", 'basePath': manager.base_url,
'resourcePath': manager.base_url, 'info': manager.info,
'authorizations': swagger_authorizations_data()}
apis = []
models = {
"Error": {
"id": "Error",
"required": ['error'],
"properties": {
"error": {
"type": "string"
},
"field": {
"type": "string"
},
"message": {
"type": "string"
},
"resource": {
"type": "string"
}
}
}
}
for view_cls in manager.api_list:
operations = []
global_params = []
path = view_cls.path()
if path == "":
continue
if '{}' in path:
path = path.replace('{}', '{pk}')
global_params.append(
{
"paramType": "path",
"name": 'pk',
"description": 'primary key for object',
"dataType": 'integer',
"format": 'int64',
"required": True,
}
)
responseMessages = [
{
'code': 404,
"message": "not_found",
"responseModel": "Error"
},
{
'code': 500,
"message": "internal_error",
"responseModel": "Error"
},
{
'code': 409,
"message": "method_not_allowed",
"responseModel": "Error"
},
{
'code': 409,
"message": "conflict",
"responseModel": "Error"
},
{
'code': 403,
"message": "forbidden",
"responseModel": "Error"
},
{
'code': 401,
"message": "permission_denied",
"responseModel": "Error"
},
{
'code': 401,
"message": "unauthorized",
"responseModel": "Error"
},
{
'code': 400,
"message": "form_invalid",
"responseModel": "Error"
},
{
'code': 400,
"message": "form_required",
"responseModel": "Error"
},
{
'code': 400,
"message": "bad_request",
"responseModel": "Error"
},
]
current_api = {
'path': path,
'description': view_cls.__doc__,
}
operations = []
if 'create' in view_cls.crud_method_names and hasattr(view_cls, 'create'):
create_op = {
'method': 'POST',
'parameters': global_params,
'responseMessages': responseMessages,
'nickname': 'create ' + path,
}
operations.append(create_op)
if 'read' in view_cls.crud_method_names and hasattr(view_cls, 'read'):
op = {
'method': 'GET',
'responseMessages': responseMessages,
'nickname': 'read ' + path
}
params = global_params.copy()
for each_permission in view_cls.permission_classes:
if issubclass(each_permission, OAuth2Authenticated):
params.append(
{
"paramType": "query",
"name": 'access_token',
"dataType": 'string',
"required": True,
}
)
if hasattr(view_cls, 'read_safe_parameters'):
for each in view_cls.read_safe_parameters:
if isinstance(each, tuple):
if each[1] == int:
params.append(
{
"paramType": "query",
"name": each[0],
"dataType": 'int',
"format": 'int64',
"required": True,
}
)
elif each[1] == float:
params.append(
{
"paramType": "query",
"name": each[0],
"dataType": 'float',
"format": 'float',
"required": True,
}
)
else:
params.append(
{
"paramType": "query",
"name": each[0],
"dataType": 'string',
"required": True,
}
)
else:
params.append(
{
"paramType": "query",
"name": each,
"dataType": 'string',
"required": True,
}
)
pass
pass
op['parameters'] = params
operations.append(op)
if 'update' in view_cls.crud_method_names and hasattr(view_cls, 'update'):
op = {
'method': 'UPDATE',
'parameters': global_params,
'responseMessages': responseMessages,
'errorResponses': [],
'nickname': 'read ' + path,
}
operations.append(op)
if 'delete' in view_cls.crud_method_names and hasattr(view_cls, 'delete'):
op = {
'method': 'DELETE',
'parameters': global_params,
'responseMessages': responseMessages,
'errorResponses': [],
'nickname': 'read ' + path,
}
operations.append(op)
current_api['operations'] = operations
apis.append(current_api)
ret['apis'] = apis
ret["models"] = models
return ret
ret = SimpleCache(key_format="api-doc:%(api_version)s", duration=60 * 60 * 24,
load_callback=load_cache).get(api_version=api_version)
response = http_json_response(ret)
response["Access-Control-Allow-Origin"] = "*"
response["Access-Control-Allow-Methods"] = "GET"
response["Access-Control-Max-Age"] = "1000"
response["Access-Control-Allow-Headers"] = "*"
return response
| <filename>django_town/rest_swagger/views.py
from django_town.rest import RestApiView, rest_api_manager
from django_town.http import http_json_response
from django_town.cache.utlis import SimpleCache
from django_town.oauth2.swagger import swagger_authorizations_data
from django_town.social.oauth2.permissions import OAuth2Authenticated, OAuth2AuthenticatedOrReadOnly
from django_town.social.permissions import Authenticated, AuthenticatedOrReadOnly
class ApiDocsView(RestApiView):
def read(self, request, api_version):
def load_cache(api_version="alpha"):
manager = rest_api_manager(api_version)
ret = {'title': manager.name,
'description': manager.description,
'apiVersion': manager.api_version, 'swaggerVersion': "1.2", 'basePath': manager.base_url,
'resourcePath': manager.base_url, 'info': manager.info,
'authorizations': swagger_authorizations_data()}
apis = []
models = {
"Error": {
"id": "Error",
"required": ['error'],
"properties": {
"error": {
"type": "string"
},
"field": {
"type": "string"
},
"message": {
"type": "string"
},
"resource": {
"type": "string"
}
}
}
}
for view_cls in manager.api_list:
operations = []
global_params = []
path = view_cls.path()
if path == "":
continue
if '{}' in path:
path = path.replace('{}', '{pk}')
global_params.append(
{
"paramType": "path",
"name": 'pk',
"description": 'primary key for object',
"dataType": 'integer',
"format": 'int64',
"required": True,
}
)
responseMessages = [
{
'code': 404,
"message": "not_found",
"responseModel": "Error"
},
{
'code': 500,
"message": "internal_error",
"responseModel": "Error"
},
{
'code': 409,
"message": "method_not_allowed",
"responseModel": "Error"
},
{
'code': 409,
"message": "conflict",
"responseModel": "Error"
},
{
'code': 403,
"message": "forbidden",
"responseModel": "Error"
},
{
'code': 401,
"message": "permission_denied",
"responseModel": "Error"
},
{
'code': 401,
"message": "unauthorized",
"responseModel": "Error"
},
{
'code': 400,
"message": "form_invalid",
"responseModel": "Error"
},
{
'code': 400,
"message": "form_required",
"responseModel": "Error"
},
{
'code': 400,
"message": "bad_request",
"responseModel": "Error"
},
]
current_api = {
'path': path,
'description': view_cls.__doc__,
}
operations = []
if 'create' in view_cls.crud_method_names and hasattr(view_cls, 'create'):
create_op = {
'method': 'POST',
'parameters': global_params,
'responseMessages': responseMessages,
'nickname': 'create ' + path,
}
operations.append(create_op)
if 'read' in view_cls.crud_method_names and hasattr(view_cls, 'read'):
op = {
'method': 'GET',
'responseMessages': responseMessages,
'nickname': 'read ' + path
}
params = global_params.copy()
for each_permission in view_cls.permission_classes:
if issubclass(each_permission, OAuth2Authenticated):
params.append(
{
"paramType": "query",
"name": 'access_token',
"dataType": 'string',
"required": True,
}
)
if hasattr(view_cls, 'read_safe_parameters'):
for each in view_cls.read_safe_parameters:
if isinstance(each, tuple):
if each[1] == int:
params.append(
{
"paramType": "query",
"name": each[0],
"dataType": 'int',
"format": 'int64',
"required": True,
}
)
elif each[1] == float:
params.append(
{
"paramType": "query",
"name": each[0],
"dataType": 'float',
"format": 'float',
"required": True,
}
)
else:
params.append(
{
"paramType": "query",
"name": each[0],
"dataType": 'string',
"required": True,
}
)
else:
params.append(
{
"paramType": "query",
"name": each,
"dataType": 'string',
"required": True,
}
)
pass
pass
op['parameters'] = params
operations.append(op)
if 'update' in view_cls.crud_method_names and hasattr(view_cls, 'update'):
op = {
'method': 'UPDATE',
'parameters': global_params,
'responseMessages': responseMessages,
'errorResponses': [],
'nickname': 'read ' + path,
}
operations.append(op)
if 'delete' in view_cls.crud_method_names and hasattr(view_cls, 'delete'):
op = {
'method': 'DELETE',
'parameters': global_params,
'responseMessages': responseMessages,
'errorResponses': [],
'nickname': 'read ' + path,
}
operations.append(op)
current_api['operations'] = operations
apis.append(current_api)
ret['apis'] = apis
ret["models"] = models
return ret
ret = SimpleCache(key_format="api-doc:%(api_version)s", duration=60 * 60 * 24,
load_callback=load_cache).get(api_version=api_version)
response = http_json_response(ret)
response["Access-Control-Allow-Origin"] = "*"
response["Access-Control-Allow-Methods"] = "GET"
response["Access-Control-Max-Age"] = "1000"
response["Access-Control-Allow-Headers"] = "*"
return response
| none | 1 | 2.123836 | 2 |
|
components/dash-core-components/tests/integration/dropdown/test_dynamic_options.py | mastermind88/dash | 0 | 2871 | from dash import Dash, Input, Output, dcc, html
from dash.exceptions import PreventUpdate
def test_dddo001_dynamic_options(dash_dcc):
dropdown_options = [
{"label": "New York City", "value": "NYC"},
{"label": "Montreal", "value": "MTL"},
{"label": "San Francisco", "value": "SF"},
]
app = Dash(__name__)
app.layout = dcc.Dropdown(id="my-dynamic-dropdown", options=[])
@app.callback(
Output("my-dynamic-dropdown", "options"),
[Input("my-dynamic-dropdown", "search_value")],
)
def update_options(search_value):
if not search_value:
raise PreventUpdate
return [o for o in dropdown_options if search_value in o["label"]]
dash_dcc.start_server(app)
# Get the inner input used for search value.
input_ = dash_dcc.find_element("#my-dynamic-dropdown input")
# Focus on the input to open the options menu
input_.send_keys("x")
# No options to be found with `x` in them, should show the empty message.
dash_dcc.wait_for_text_to_equal(".Select-noresults", "No results found")
input_.clear()
input_.send_keys("o")
options = dash_dcc.find_elements("#my-dynamic-dropdown .VirtualizedSelectOption")
# Should show all options.
assert len(options) == 3
# Searching for `on`
input_.send_keys("n")
options = dash_dcc.find_elements("#my-dynamic-dropdown .VirtualizedSelectOption")
assert len(options) == 1
print(options)
assert options[0].text == "Montreal"
assert dash_dcc.get_logs() == []
def test_dddo002_array_comma_value(dash_dcc):
app = Dash(__name__)
dropdown = dcc.Dropdown(
options=["New York, NY", "Montreal, QC", "San Francisco, CA"],
value=["San Francisco, CA"],
multi=True,
)
app.layout = html.Div(dropdown)
dash_dcc.start_server(app)
dash_dcc.wait_for_text_to_equal("#react-select-2--value-0", "San Francisco, CA\n ")
assert dash_dcc.get_logs() == []
def test_dddo003_value_no_options(dash_dcc):
app = Dash(__name__)
app.layout = html.Div(
[
dcc.Dropdown(value="foobar", id="dropdown"),
]
)
dash_dcc.start_server(app)
assert dash_dcc.get_logs() == []
dash_dcc.wait_for_element("#dropdown")
| from dash import Dash, Input, Output, dcc, html
from dash.exceptions import PreventUpdate
def test_dddo001_dynamic_options(dash_dcc):
dropdown_options = [
{"label": "New York City", "value": "NYC"},
{"label": "Montreal", "value": "MTL"},
{"label": "San Francisco", "value": "SF"},
]
app = Dash(__name__)
app.layout = dcc.Dropdown(id="my-dynamic-dropdown", options=[])
@app.callback(
Output("my-dynamic-dropdown", "options"),
[Input("my-dynamic-dropdown", "search_value")],
)
def update_options(search_value):
if not search_value:
raise PreventUpdate
return [o for o in dropdown_options if search_value in o["label"]]
dash_dcc.start_server(app)
# Get the inner input used for search value.
input_ = dash_dcc.find_element("#my-dynamic-dropdown input")
# Focus on the input to open the options menu
input_.send_keys("x")
# No options to be found with `x` in them, should show the empty message.
dash_dcc.wait_for_text_to_equal(".Select-noresults", "No results found")
input_.clear()
input_.send_keys("o")
options = dash_dcc.find_elements("#my-dynamic-dropdown .VirtualizedSelectOption")
# Should show all options.
assert len(options) == 3
# Searching for `on`
input_.send_keys("n")
options = dash_dcc.find_elements("#my-dynamic-dropdown .VirtualizedSelectOption")
assert len(options) == 1
print(options)
assert options[0].text == "Montreal"
assert dash_dcc.get_logs() == []
def test_dddo002_array_comma_value(dash_dcc):
app = Dash(__name__)
dropdown = dcc.Dropdown(
options=["New York, NY", "Montreal, QC", "San Francisco, CA"],
value=["San Francisco, CA"],
multi=True,
)
app.layout = html.Div(dropdown)
dash_dcc.start_server(app)
dash_dcc.wait_for_text_to_equal("#react-select-2--value-0", "San Francisco, CA\n ")
assert dash_dcc.get_logs() == []
def test_dddo003_value_no_options(dash_dcc):
app = Dash(__name__)
app.layout = html.Div(
[
dcc.Dropdown(value="foobar", id="dropdown"),
]
)
dash_dcc.start_server(app)
assert dash_dcc.get_logs() == []
dash_dcc.wait_for_element("#dropdown")
| en | 0.623679 | # Get the inner input used for search value. # Focus on the input to open the options menu # No options to be found with `x` in them, should show the empty message. # Should show all options. # Searching for `on` | 2.509241 | 3 |
Server.py | dipghoshraj/live-video-streming-with-web-socket | 3 | 2872 | <filename>Server.py<gh_stars>1-10
import cv2
import io
import socket
import struct
import time
import pickle
import zlib
client_socket = socket.socket(socket.AF_INET, socket.SOCK_STREAM)
client_socket.connect(('127.0.0.1', 8485))
connection = client_socket.makefile('wb')
cam = cv2.VideoCapture("E:/songs/Attention <NAME>(GabbarWorld.com) 1080p.mp4")
cam.set(3, 320)
cam.set(4, 240)
img_counter = 0
encode_param = [int(cv2.IMWRITE_JPEG_QUALITY), 90]
while True:
ret, frame = cam.read()
result, frame = cv2.imencode('.jpg', frame, encode_param)
# data = zlib.compress(pickle.dumps(frame, 0))
data = pickle.dumps(frame, 0)
size = len(data)
print("{}: {}".format(img_counter, size))
client_socket.sendall(struct.pack(">L", size) + data)
img_counter += 1
cam.release()
| <filename>Server.py<gh_stars>1-10
import cv2
import io
import socket
import struct
import time
import pickle
import zlib
client_socket = socket.socket(socket.AF_INET, socket.SOCK_STREAM)
client_socket.connect(('127.0.0.1', 8485))
connection = client_socket.makefile('wb')
cam = cv2.VideoCapture("E:/songs/Attention <NAME>(GabbarWorld.com) 1080p.mp4")
cam.set(3, 320)
cam.set(4, 240)
img_counter = 0
encode_param = [int(cv2.IMWRITE_JPEG_QUALITY), 90]
while True:
ret, frame = cam.read()
result, frame = cv2.imencode('.jpg', frame, encode_param)
# data = zlib.compress(pickle.dumps(frame, 0))
data = pickle.dumps(frame, 0)
size = len(data)
print("{}: {}".format(img_counter, size))
client_socket.sendall(struct.pack(">L", size) + data)
img_counter += 1
cam.release()
| en | 0.415691 | # data = zlib.compress(pickle.dumps(frame, 0)) | 2.598694 | 3 |
hal/agent/tf2_utils.py | gunpowder78/google-research | 1 | 2873 | <reponame>gunpowder78/google-research
# coding=utf-8
# Copyright 2022 The Google Research Authors.
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS,
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
# See the License for the specific language governing permissions and
# limitations under the License.
"""Utilities for Tensorflow 2.0.
Partially adapted from:
https://www.tensorflow.org/tutorials/text/image_captioning
"""
# Lint as: python3
# pylint: disable=invalid-name
from __future__ import absolute_import
from __future__ import division
import tensorflow as tf
def film_params(sentence_embedding, n_layer_channel):
"""Generate FiLM parameters from a sentence embedding.
Generate FiLM parameters from a sentence embedding. This method assumes a
batch dimension exists.
Args:
sentence_embedding: a tensor containing batched sentenced embedding to be
transformed
n_layer_channel: a list of integers specifying how many channels are at
each hidden layer to be FiLM'ed
Returns:
a tuple of tensors the same length as n_layer_channel. Each element
contains all gamma_i and beta_i for a single hidden layer.
"""
n_total = sum(n_layer_channel) * 2
all_params = tf.layers.dense(sentence_embedding, n_total)
all_params = tf.keras.layers.Dense(
2 * sum * (n_layer_channel), activation=tf.nn.relu)
return tf.split(all_params, [c * 2 for c in n_layer_channel], 1)
def stack_conv_layer(layer_cfg, padding='same'):
"""Stack convolution layers per layer_cfg.
Args:
layer_cfg: list of integer tuples specifying the parameter each layer;
each tuple should be (channel, kernel size, strides)
padding: what kind of padding the conv layers use
Returns:
the keras model with stacked conv layers
"""
layers = []
for cfg in layer_cfg[:-1]:
layers.append(
tf.keras.layers.Conv2D(
filters=cfg[0],
kernel_size=cfg[1],
strides=cfg[2],
activation=tf.nn.relu,
padding=padding))
final_cfg = layer_cfg[-1]
layers.append(
tf.keras.layers.Conv2D(
final_cfg[0], final_cfg[1], final_cfg[2], padding=padding))
return tf.keras.Sequential(layers)
def stack_dense_layer(layer_cfg):
"""Stack Dense layers.
Args:
layer_cfg: list of integer specifying the number of units at each layer
Returns:
the keras model with stacked dense layers
"""
layers = []
for cfg in layer_cfg[:-1]:
layers.append(tf.keras.layers.Dense(cfg, activation=tf.nn.relu))
layers.append(tf.keras.layers.Dense(layer_cfg[-1]))
return tf.keras.Sequential(layers)
def soft_variables_update(source_variables, target_variables, polyak_rate=1.0):
"""Update the target variables using exponential moving average.
Specifically, v_s' = v_s * polyak_rate + (1-polyak_rate) * v_t
Args:
source_variables: the moving average variables
target_variables: the new observations
polyak_rate: rate of moving average
Returns:
Operation that does the update
"""
updates = []
for (v_s, v_t) in zip(source_variables, target_variables):
v_t.shape.assert_is_compatible_with(v_s.shape)
def update_fn(v1, v2):
"""Update variables."""
# For not trainable variables do hard updates.
return v1.assign(polyak_rate * v1 + (1 - polyak_rate) * v2)
update = update_fn(v_t, v_s)
updates.append(update)
return updates
def vector_tensor_product(a, b):
""""Returns keras layer that perfrom a outer product between a and b."""
# a shape: [B, ?, d], b shape: [B, ?, d]
shape_layer = tf.keras.layers.Lambda(tf.shape)
shape = shape_layer(b)
shape_numpy = b.get_shape()
variable_length = shape[1] # variable_len = ?
expand_dims_layer_1 = tf.keras.layers.Reshape((-1, 1, shape_numpy[-1]))
expand_dims_layer_2 = tf.keras.layers.Reshape((-1, 1, shape_numpy[-1]))
a = expand_dims_layer_1(a) # a shape: [B, ?, 1, d]
b = expand_dims_layer_2(b) # a shape: [B, ?, 1, d]
tile_layer = tf.keras.layers.Lambda(
lambda inputs: tf.tile(inputs[0], multiples=inputs[1]))
a = tile_layer((a, [1, 1, variable_length, 1])) # a shape: [B, ?, ?, d]
b = tile_layer((b, [1, 1, variable_length, 1])) # b shape: [B, ?, ?, d]
b = tf.keras.layers.Permute((2, 1, 3))(b) # b shape: [B, ?, ?, d]
return tf.keras.layers.concatenate([a, b]) # shape: [B, ?, ?, 2*d]
class BahdanauAttention(tf.keras.Model):
"""Bahdanau Attention Layer.
Attributes:
w1: weights that process the feature
w2: weights that process the memory state
v: projection layer that project score vector to scalar
"""
def __init__(self, units):
"""Initialize Bahdanau attention layer.
Args:
units: size of the dense layers
"""
super(BahdanauAttention, self).__init__()
self.W1 = tf.keras.layers.Dense(units)
self.W2 = tf.keras.layers.Dense(units)
self.V = tf.keras.layers.Dense(1)
def call(self, features, hidden):
# features(CNN_encoder output) shape == (batch_size, 64, embedding_dim)
# hidden shape == (batch_size, hidden_size)
# hidden_with_time_axis shape == (batch_size, 1, hidden_size)
hidden_with_time_axis = tf.expand_dims(hidden, 1)
# score shape == (batch_size, 64, hidden_size)
score = tf.nn.tanh(self.W1(features) + self.W2(hidden_with_time_axis))
# attention_weights shape == (batch_size, 64, 1)
# you get 1 at the last axis because you are applying score to self.V
attention_weights = tf.nn.softmax(self.V(score), axis=1)
# context_vector shape after sum == (batch_size, hidden_size)
context_vector = attention_weights * features
context_vector = tf.reduce_sum(context_vector, axis=1)
return context_vector, attention_weights
class GRUEnecoder(tf.keras.Model):
"""TF2.0 GRE encoder.
Attributes:
embedding: word embedding matrix
gru: the GRU layer
"""
def __init__(self, embedding_dim, units, vocab_size):
"""Initialize the GRU encoder.
Args:
embedding_dim: dimension of word emebdding
units: number of units of the memory state
vocab_size: total number of vocabulary
"""
super(GRUEnecoder, self).__init__()
self._units = units
self.embedding = tf.keras.layers.Embedding(vocab_size, embedding_dim)
self.gru = tf.keras.layers.GRU(
self.units,
return_sequences=True,
return_state=True,
recurrent_initializer='glorot_uniform')
def call(self, x, hidden):
# x shape after passing through embedding == (batch_size, 1, embedding_dim)
x = self.embedding(x)
# passing the concatenated vector to the GRU
output, state = self.gru(x)
return output, state
def reset_state(self, batch_size):
return tf.zeros((batch_size, self._units))
| # coding=utf-8
# Copyright 2022 The Google Research Authors.
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS,
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
# See the License for the specific language governing permissions and
# limitations under the License.
"""Utilities for Tensorflow 2.0.
Partially adapted from:
https://www.tensorflow.org/tutorials/text/image_captioning
"""
# Lint as: python3
# pylint: disable=invalid-name
from __future__ import absolute_import
from __future__ import division
import tensorflow as tf
def film_params(sentence_embedding, n_layer_channel):
"""Generate FiLM parameters from a sentence embedding.
Generate FiLM parameters from a sentence embedding. This method assumes a
batch dimension exists.
Args:
sentence_embedding: a tensor containing batched sentenced embedding to be
transformed
n_layer_channel: a list of integers specifying how many channels are at
each hidden layer to be FiLM'ed
Returns:
a tuple of tensors the same length as n_layer_channel. Each element
contains all gamma_i and beta_i for a single hidden layer.
"""
n_total = sum(n_layer_channel) * 2
all_params = tf.layers.dense(sentence_embedding, n_total)
all_params = tf.keras.layers.Dense(
2 * sum * (n_layer_channel), activation=tf.nn.relu)
return tf.split(all_params, [c * 2 for c in n_layer_channel], 1)
def stack_conv_layer(layer_cfg, padding='same'):
"""Stack convolution layers per layer_cfg.
Args:
layer_cfg: list of integer tuples specifying the parameter each layer;
each tuple should be (channel, kernel size, strides)
padding: what kind of padding the conv layers use
Returns:
the keras model with stacked conv layers
"""
layers = []
for cfg in layer_cfg[:-1]:
layers.append(
tf.keras.layers.Conv2D(
filters=cfg[0],
kernel_size=cfg[1],
strides=cfg[2],
activation=tf.nn.relu,
padding=padding))
final_cfg = layer_cfg[-1]
layers.append(
tf.keras.layers.Conv2D(
final_cfg[0], final_cfg[1], final_cfg[2], padding=padding))
return tf.keras.Sequential(layers)
def stack_dense_layer(layer_cfg):
"""Stack Dense layers.
Args:
layer_cfg: list of integer specifying the number of units at each layer
Returns:
the keras model with stacked dense layers
"""
layers = []
for cfg in layer_cfg[:-1]:
layers.append(tf.keras.layers.Dense(cfg, activation=tf.nn.relu))
layers.append(tf.keras.layers.Dense(layer_cfg[-1]))
return tf.keras.Sequential(layers)
def soft_variables_update(source_variables, target_variables, polyak_rate=1.0):
"""Update the target variables using exponential moving average.
Specifically, v_s' = v_s * polyak_rate + (1-polyak_rate) * v_t
Args:
source_variables: the moving average variables
target_variables: the new observations
polyak_rate: rate of moving average
Returns:
Operation that does the update
"""
updates = []
for (v_s, v_t) in zip(source_variables, target_variables):
v_t.shape.assert_is_compatible_with(v_s.shape)
def update_fn(v1, v2):
"""Update variables."""
# For not trainable variables do hard updates.
return v1.assign(polyak_rate * v1 + (1 - polyak_rate) * v2)
update = update_fn(v_t, v_s)
updates.append(update)
return updates
def vector_tensor_product(a, b):
""""Returns keras layer that perfrom a outer product between a and b."""
# a shape: [B, ?, d], b shape: [B, ?, d]
shape_layer = tf.keras.layers.Lambda(tf.shape)
shape = shape_layer(b)
shape_numpy = b.get_shape()
variable_length = shape[1] # variable_len = ?
expand_dims_layer_1 = tf.keras.layers.Reshape((-1, 1, shape_numpy[-1]))
expand_dims_layer_2 = tf.keras.layers.Reshape((-1, 1, shape_numpy[-1]))
a = expand_dims_layer_1(a) # a shape: [B, ?, 1, d]
b = expand_dims_layer_2(b) # a shape: [B, ?, 1, d]
tile_layer = tf.keras.layers.Lambda(
lambda inputs: tf.tile(inputs[0], multiples=inputs[1]))
a = tile_layer((a, [1, 1, variable_length, 1])) # a shape: [B, ?, ?, d]
b = tile_layer((b, [1, 1, variable_length, 1])) # b shape: [B, ?, ?, d]
b = tf.keras.layers.Permute((2, 1, 3))(b) # b shape: [B, ?, ?, d]
return tf.keras.layers.concatenate([a, b]) # shape: [B, ?, ?, 2*d]
class BahdanauAttention(tf.keras.Model):
"""Bahdanau Attention Layer.
Attributes:
w1: weights that process the feature
w2: weights that process the memory state
v: projection layer that project score vector to scalar
"""
def __init__(self, units):
"""Initialize Bahdanau attention layer.
Args:
units: size of the dense layers
"""
super(BahdanauAttention, self).__init__()
self.W1 = tf.keras.layers.Dense(units)
self.W2 = tf.keras.layers.Dense(units)
self.V = tf.keras.layers.Dense(1)
def call(self, features, hidden):
# features(CNN_encoder output) shape == (batch_size, 64, embedding_dim)
# hidden shape == (batch_size, hidden_size)
# hidden_with_time_axis shape == (batch_size, 1, hidden_size)
hidden_with_time_axis = tf.expand_dims(hidden, 1)
# score shape == (batch_size, 64, hidden_size)
score = tf.nn.tanh(self.W1(features) + self.W2(hidden_with_time_axis))
# attention_weights shape == (batch_size, 64, 1)
# you get 1 at the last axis because you are applying score to self.V
attention_weights = tf.nn.softmax(self.V(score), axis=1)
# context_vector shape after sum == (batch_size, hidden_size)
context_vector = attention_weights * features
context_vector = tf.reduce_sum(context_vector, axis=1)
return context_vector, attention_weights
class GRUEnecoder(tf.keras.Model):
"""TF2.0 GRE encoder.
Attributes:
embedding: word embedding matrix
gru: the GRU layer
"""
def __init__(self, embedding_dim, units, vocab_size):
"""Initialize the GRU encoder.
Args:
embedding_dim: dimension of word emebdding
units: number of units of the memory state
vocab_size: total number of vocabulary
"""
super(GRUEnecoder, self).__init__()
self._units = units
self.embedding = tf.keras.layers.Embedding(vocab_size, embedding_dim)
self.gru = tf.keras.layers.GRU(
self.units,
return_sequences=True,
return_state=True,
recurrent_initializer='glorot_uniform')
def call(self, x, hidden):
# x shape after passing through embedding == (batch_size, 1, embedding_dim)
x = self.embedding(x)
# passing the concatenated vector to the GRU
output, state = self.gru(x)
return output, state
def reset_state(self, batch_size):
return tf.zeros((batch_size, self._units)) | en | 0.748091 | # coding=utf-8 # Copyright 2022 The Google Research Authors. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. Utilities for Tensorflow 2.0. Partially adapted from: https://www.tensorflow.org/tutorials/text/image_captioning # Lint as: python3 # pylint: disable=invalid-name Generate FiLM parameters from a sentence embedding. Generate FiLM parameters from a sentence embedding. This method assumes a batch dimension exists. Args: sentence_embedding: a tensor containing batched sentenced embedding to be transformed n_layer_channel: a list of integers specifying how many channels are at each hidden layer to be FiLM'ed Returns: a tuple of tensors the same length as n_layer_channel. Each element contains all gamma_i and beta_i for a single hidden layer. Stack convolution layers per layer_cfg. Args: layer_cfg: list of integer tuples specifying the parameter each layer; each tuple should be (channel, kernel size, strides) padding: what kind of padding the conv layers use Returns: the keras model with stacked conv layers Stack Dense layers. Args: layer_cfg: list of integer specifying the number of units at each layer Returns: the keras model with stacked dense layers Update the target variables using exponential moving average. Specifically, v_s' = v_s * polyak_rate + (1-polyak_rate) * v_t Args: source_variables: the moving average variables target_variables: the new observations polyak_rate: rate of moving average Returns: Operation that does the update Update variables. # For not trainable variables do hard updates. "Returns keras layer that perfrom a outer product between a and b. # a shape: [B, ?, d], b shape: [B, ?, d] # variable_len = ? # a shape: [B, ?, 1, d] # a shape: [B, ?, 1, d] # a shape: [B, ?, ?, d] # b shape: [B, ?, ?, d] # b shape: [B, ?, ?, d] # shape: [B, ?, ?, 2*d] Bahdanau Attention Layer. Attributes: w1: weights that process the feature w2: weights that process the memory state v: projection layer that project score vector to scalar Initialize Bahdanau attention layer. Args: units: size of the dense layers # features(CNN_encoder output) shape == (batch_size, 64, embedding_dim) # hidden shape == (batch_size, hidden_size) # hidden_with_time_axis shape == (batch_size, 1, hidden_size) # score shape == (batch_size, 64, hidden_size) # attention_weights shape == (batch_size, 64, 1) # you get 1 at the last axis because you are applying score to self.V # context_vector shape after sum == (batch_size, hidden_size) TF2.0 GRE encoder. Attributes: embedding: word embedding matrix gru: the GRU layer Initialize the GRU encoder. Args: embedding_dim: dimension of word emebdding units: number of units of the memory state vocab_size: total number of vocabulary # x shape after passing through embedding == (batch_size, 1, embedding_dim) # passing the concatenated vector to the GRU | 2.935197 | 3 |
wolk/logger_factory.py | Wolkabout/WolkConnect-Python- | 6 | 2874 | <reponame>Wolkabout/WolkConnect-Python-<gh_stars>1-10
"""LoggerFactory Module."""
# Copyright 2020 WolkAbout Technology s.r.o.
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS,
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
# See the License for the specific language governing permissions and
# limitations under the License.
import logging
from typing import List
from typing import Optional
class LoggerFactory:
"""Factory for issuing ready to use loggers in other modules."""
def __init__(self, level=logging.INFO, console=True, log_file=None): # type: ignore
"""
Create a factory that will give loggers through calls to get_logger().
:param level: Set the desired logging level
:type level: int or None
:param console: Should the log messages be outputted to the console
:type console: bool or None
:param log_file: Name of the log file to output to
:type log_file: str or None
"""
self.level = level
self.device_key = None
self.console = console
self.log_file = log_file
self.loggers: List[logging.Logger] = []
def set_device_key(self, device_key: str) -> None:
"""
Set device key.
:param device_key: Device key
:type device_key: str
"""
self.device_key = device_key
def get_logger(
self, name: str, level: Optional[int] = None
) -> logging.Logger:
"""
Return a ready to use logger instance.
:param name: Name of the logger
:type name: str
:param level: Override the log level
:type level: int or None
:returns: Logger instance
:rtype: logger
"""
logger = logging.getLogger(name)
if level is not None:
logger.setLevel(level)
else:
logger.setLevel(self.level)
if self.device_key is not None:
formatter = logging.Formatter(
"%(asctime)s - '"
+ str(self.device_key)
+ "' - %(levelname)s [%(filename)s:%(lineno)s"
+ " - %(funcName)s()] - %(message)s"
)
else:
formatter = logging.Formatter(
"%(asctime)s - %(levelname)s [%(filename)s:%(lineno)s"
+ " - %(funcName)s()] - %(message)s"
)
if self.console:
console_handler = logging.StreamHandler()
if level is not None:
console_handler.setLevel(level)
else:
console_handler.setLevel(self.level)
console_handler.setFormatter(formatter)
logger.addHandler(console_handler)
if self.log_file is not None:
file_handler = logging.FileHandler(self.log_file)
if level is not None:
file_handler.setLevel(level)
else:
file_handler.setLevel(self.level)
file_handler.setFormatter(formatter)
logger.addHandler(file_handler)
self.loggers.append(logger)
return logger
# Logging levels available: NOTSET, INFO, DEBUG
logger_factory = LoggerFactory(level=logging.INFO)
LEVELS = {
"debug": logging.DEBUG,
"info": logging.INFO,
"warning": logging.WARNING,
"error": logging.ERROR,
"critical": logging.CRITICAL,
"notset": logging.NOTSET,
}
def logging_config(level: str, log_file: Optional[str] = None) -> None:
"""
Set desired log level and designate a log file.
:param level: Available levels : debug, info, notset
:type level: str
:param log_file: path to log file
:type log_file: str or None
"""
if log_file is not None:
logger_factory.log_file = log_file
if level not in LEVELS:
print(f"Invalid level '{level}'")
return
if LEVELS[level] == logger_factory.level:
return
logger_factory.level = LEVELS[level]
for logger in logger_factory.loggers:
logger.setLevel(logger_factory.level)
for handler in logger.handlers:
handler.setLevel(logger_factory.level)
| """LoggerFactory Module."""
# Copyright 2020 WolkAbout Technology s.r.o.
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS,
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
# See the License for the specific language governing permissions and
# limitations under the License.
import logging
from typing import List
from typing import Optional
class LoggerFactory:
"""Factory for issuing ready to use loggers in other modules."""
def __init__(self, level=logging.INFO, console=True, log_file=None): # type: ignore
"""
Create a factory that will give loggers through calls to get_logger().
:param level: Set the desired logging level
:type level: int or None
:param console: Should the log messages be outputted to the console
:type console: bool or None
:param log_file: Name of the log file to output to
:type log_file: str or None
"""
self.level = level
self.device_key = None
self.console = console
self.log_file = log_file
self.loggers: List[logging.Logger] = []
def set_device_key(self, device_key: str) -> None:
"""
Set device key.
:param device_key: Device key
:type device_key: str
"""
self.device_key = device_key
def get_logger(
self, name: str, level: Optional[int] = None
) -> logging.Logger:
"""
Return a ready to use logger instance.
:param name: Name of the logger
:type name: str
:param level: Override the log level
:type level: int or None
:returns: Logger instance
:rtype: logger
"""
logger = logging.getLogger(name)
if level is not None:
logger.setLevel(level)
else:
logger.setLevel(self.level)
if self.device_key is not None:
formatter = logging.Formatter(
"%(asctime)s - '"
+ str(self.device_key)
+ "' - %(levelname)s [%(filename)s:%(lineno)s"
+ " - %(funcName)s()] - %(message)s"
)
else:
formatter = logging.Formatter(
"%(asctime)s - %(levelname)s [%(filename)s:%(lineno)s"
+ " - %(funcName)s()] - %(message)s"
)
if self.console:
console_handler = logging.StreamHandler()
if level is not None:
console_handler.setLevel(level)
else:
console_handler.setLevel(self.level)
console_handler.setFormatter(formatter)
logger.addHandler(console_handler)
if self.log_file is not None:
file_handler = logging.FileHandler(self.log_file)
if level is not None:
file_handler.setLevel(level)
else:
file_handler.setLevel(self.level)
file_handler.setFormatter(formatter)
logger.addHandler(file_handler)
self.loggers.append(logger)
return logger
# Logging levels available: NOTSET, INFO, DEBUG
logger_factory = LoggerFactory(level=logging.INFO)
LEVELS = {
"debug": logging.DEBUG,
"info": logging.INFO,
"warning": logging.WARNING,
"error": logging.ERROR,
"critical": logging.CRITICAL,
"notset": logging.NOTSET,
}
def logging_config(level: str, log_file: Optional[str] = None) -> None:
"""
Set desired log level and designate a log file.
:param level: Available levels : debug, info, notset
:type level: str
:param log_file: path to log file
:type log_file: str or None
"""
if log_file is not None:
logger_factory.log_file = log_file
if level not in LEVELS:
print(f"Invalid level '{level}'")
return
if LEVELS[level] == logger_factory.level:
return
logger_factory.level = LEVELS[level]
for logger in logger_factory.loggers:
logger.setLevel(logger_factory.level)
for handler in logger.handlers:
handler.setLevel(logger_factory.level) | en | 0.734271 | LoggerFactory Module. # Copyright 2020 WolkAbout Technology s.r.o. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. Factory for issuing ready to use loggers in other modules. # type: ignore Create a factory that will give loggers through calls to get_logger(). :param level: Set the desired logging level :type level: int or None :param console: Should the log messages be outputted to the console :type console: bool or None :param log_file: Name of the log file to output to :type log_file: str or None Set device key. :param device_key: Device key :type device_key: str Return a ready to use logger instance. :param name: Name of the logger :type name: str :param level: Override the log level :type level: int or None :returns: Logger instance :rtype: logger # Logging levels available: NOTSET, INFO, DEBUG Set desired log level and designate a log file. :param level: Available levels : debug, info, notset :type level: str :param log_file: path to log file :type log_file: str or None | 2.832719 | 3 |
raw.py | andre-marcos-perez/data-pipeline-demo | 3 | 2875 | import json
import gzip
import requests
from datetime import datetime
import pendulum
import boto3
from botocore.exceptions import ClientError
from util.log import Log
from settings.aws_settings import AWSSettings
from settings.telegram_settings import TelegramSettings
def lambda_handler(event: dict, context: dict) -> dict:
log = Log.setup(name='logger')
aws_settings = AWSSettings()
telegram_settings = TelegramSettings()
timezone = pendulum.timezone('America/Sao_Paulo')
date = datetime.now(tz=timezone).strftime('%Y-%m-%d')
timestamp = datetime.now(tz=timezone).strftime('%Y%m%d%H%M%S')
try:
token = telegram_settings.access_token
base_url = f"https://api.telegram.org/bot{token}"
data = json.loads(event["body"])
chat_id = data["message"]["chat"]["id"]
if chat_id == telegram_settings.chat_id:
client = boto3.client('s3')
bucket = aws_settings.raw_bucket
root_path = aws_settings.root_path
try:
with open(f"{root_path}/{timestamp}.json", mode='w', encoding='utf8') as fp:
json.dump(data, fp)
client.upload_file(f"{root_path}/{timestamp}.json", bucket, f"{date}/{timestamp}.json")
except ClientError as exc:
raise exc
else:
text = "I can't talk to strangers, sorry mate!"
data = {"text": text, "chat_id": chat_id}
data = gzip.compress(json.dumps(data).encode('utf-8'))
headers = {'content-type': 'application/json', 'content-encoding': 'gzip'}
url = base_url + "/sendMessage"
requests.post(url=url, data=data, headers=headers)
except Exception as exc:
log.error(msg=exc)
finally:
return dict(statusCode="200")
| import json
import gzip
import requests
from datetime import datetime
import pendulum
import boto3
from botocore.exceptions import ClientError
from util.log import Log
from settings.aws_settings import AWSSettings
from settings.telegram_settings import TelegramSettings
def lambda_handler(event: dict, context: dict) -> dict:
log = Log.setup(name='logger')
aws_settings = AWSSettings()
telegram_settings = TelegramSettings()
timezone = pendulum.timezone('America/Sao_Paulo')
date = datetime.now(tz=timezone).strftime('%Y-%m-%d')
timestamp = datetime.now(tz=timezone).strftime('%Y%m%d%H%M%S')
try:
token = telegram_settings.access_token
base_url = f"https://api.telegram.org/bot{token}"
data = json.loads(event["body"])
chat_id = data["message"]["chat"]["id"]
if chat_id == telegram_settings.chat_id:
client = boto3.client('s3')
bucket = aws_settings.raw_bucket
root_path = aws_settings.root_path
try:
with open(f"{root_path}/{timestamp}.json", mode='w', encoding='utf8') as fp:
json.dump(data, fp)
client.upload_file(f"{root_path}/{timestamp}.json", bucket, f"{date}/{timestamp}.json")
except ClientError as exc:
raise exc
else:
text = "I can't talk to strangers, sorry mate!"
data = {"text": text, "chat_id": chat_id}
data = gzip.compress(json.dumps(data).encode('utf-8'))
headers = {'content-type': 'application/json', 'content-encoding': 'gzip'}
url = base_url + "/sendMessage"
requests.post(url=url, data=data, headers=headers)
except Exception as exc:
log.error(msg=exc)
finally:
return dict(statusCode="200")
| none | 1 | 2.110344 | 2 |
|
v2_hier/site_stat.py | ruslan-ok/ruslan | 0 | 2876 | """Collecting statistics of site visits."""
import collections
from datetime import datetime
from functools import reduce
from django.utils.translation import gettext_lazy as _
from hier.models import IPInfo, AccessLog, SiteStat
from v2_hier.utils import APPS
def get_site_stat(user):
"""Processing a new portion of log file records.
The site applications that users have visited and information about their IP addresses will be shown.
"""
TOTAL_IP = _('total different').capitalize() + ' IP'
TOTAL_LOG = _('total log records').capitalize()
NEW_LOG = _('new log records').capitalize()
cnt = collections.Counter()
cnt[TOTAL_IP] = len(IPInfo.objects.all())
cnt[TOTAL_LOG] = len(AccessLog.objects.all())
#Determining the last previously processed log file entry
last = datetime.min
site_stat = None
if SiteStat.objects.filter(user=user.id).exists():
site_stat = SiteStat.objects.filter(user = user.id).get()
if site_stat.record and site_stat.record.event:
last = site_stat.record.event
# New records
records = AccessLog.objects.filter(event__gt=last).order_by('-event')
cnt[NEW_LOG] += len(records)
# Save last processed log record
last_rec = None
if (len(records) > 0):
last_rec = records[0]
if site_stat:
site_stat.record = last_rec
site_stat.save()
else:
SiteStat.objects.create(user=user, record=last_rec)
#raise Exception(last_rec.event)
apps = {}
for rec in records:
uri = valid_uri(rec)
if not uri:
continue
# Determining the access to the site application
a_app = list(filter(lambda x: '/{}/'.format(x) in uri, APPS))
if not a_app:
continue
app = a_app[0]
if not app in apps:
apps[app] = {}
host = str(rec.host.info())
#raise Exception('aaa = ', aaa)
if not host in apps[app]:
apps[app][host] = []
page = '{} {}'.format(rec.method, uri)
if not page in apps[app][host]:
apps[app][host].append(page)
return cnt.most_common(), apps
def valid_uri(rec):
if (rec.status >= 400) or (rec.status == 301):
return None
if 'favicon.ico' in rec.uri or '/static/' in rec.uri or '/jsi18n/' in rec.uri or '/photo/get_mini/' in rec.uri:
return None
if ('/?' in rec.uri) and (rec.method != 'POST'):
uri = rec.uri.split('?')[0]
else:
uri = rec.uri
uri = uri.replace('/ru/', '/').replace('/en/', '/')
if (uri == '/'):
return None
return uri
| """Collecting statistics of site visits."""
import collections
from datetime import datetime
from functools import reduce
from django.utils.translation import gettext_lazy as _
from hier.models import IPInfo, AccessLog, SiteStat
from v2_hier.utils import APPS
def get_site_stat(user):
"""Processing a new portion of log file records.
The site applications that users have visited and information about their IP addresses will be shown.
"""
TOTAL_IP = _('total different').capitalize() + ' IP'
TOTAL_LOG = _('total log records').capitalize()
NEW_LOG = _('new log records').capitalize()
cnt = collections.Counter()
cnt[TOTAL_IP] = len(IPInfo.objects.all())
cnt[TOTAL_LOG] = len(AccessLog.objects.all())
#Determining the last previously processed log file entry
last = datetime.min
site_stat = None
if SiteStat.objects.filter(user=user.id).exists():
site_stat = SiteStat.objects.filter(user = user.id).get()
if site_stat.record and site_stat.record.event:
last = site_stat.record.event
# New records
records = AccessLog.objects.filter(event__gt=last).order_by('-event')
cnt[NEW_LOG] += len(records)
# Save last processed log record
last_rec = None
if (len(records) > 0):
last_rec = records[0]
if site_stat:
site_stat.record = last_rec
site_stat.save()
else:
SiteStat.objects.create(user=user, record=last_rec)
#raise Exception(last_rec.event)
apps = {}
for rec in records:
uri = valid_uri(rec)
if not uri:
continue
# Determining the access to the site application
a_app = list(filter(lambda x: '/{}/'.format(x) in uri, APPS))
if not a_app:
continue
app = a_app[0]
if not app in apps:
apps[app] = {}
host = str(rec.host.info())
#raise Exception('aaa = ', aaa)
if not host in apps[app]:
apps[app][host] = []
page = '{} {}'.format(rec.method, uri)
if not page in apps[app][host]:
apps[app][host].append(page)
return cnt.most_common(), apps
def valid_uri(rec):
if (rec.status >= 400) or (rec.status == 301):
return None
if 'favicon.ico' in rec.uri or '/static/' in rec.uri or '/jsi18n/' in rec.uri or '/photo/get_mini/' in rec.uri:
return None
if ('/?' in rec.uri) and (rec.method != 'POST'):
uri = rec.uri.split('?')[0]
else:
uri = rec.uri
uri = uri.replace('/ru/', '/').replace('/en/', '/')
if (uri == '/'):
return None
return uri
| en | 0.900021 | Collecting statistics of site visits. Processing a new portion of log file records. The site applications that users have visited and information about their IP addresses will be shown. #Determining the last previously processed log file entry # New records # Save last processed log record #raise Exception(last_rec.event) # Determining the access to the site application #raise Exception('aaa = ', aaa) | 2.577343 | 3 |
cli/pcluster/utils.py | mkosmo/cfncluster | 1 | 2877 | <gh_stars>1-10
# Copyright 2018 Amazon.com, Inc. or its affiliates. All Rights Reserved.
#
# Licensed under the Apache License, Version 2.0 (the "License"). You may not use this file except in compliance with
# the License. A copy of the License is located at
#
# http://aws.amazon.com/apache2.0/
#
# or in the "LICENSE.txt" file accompanying this file. This file is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES
# OR CONDITIONS OF ANY KIND, express or implied. See the License for the specific language governing permissions and
# limitations under the License.
# fmt: off
from __future__ import absolute_import, print_function # isort:skip
from future import standard_library # isort:skip
standard_library.install_aliases()
# fmt: on
import json
import logging
import os
import sys
import time
import urllib.request
import zipfile
from io import BytesIO
import boto3
import pkg_resources
from botocore.exceptions import ClientError
LOGGER = logging.getLogger(__name__)
PCLUSTER_STACK_PREFIX = "parallelcluster-"
PCLUSTER_ISSUES_LINK = "https://github.com/aws/aws-parallelcluster/issues"
def get_stack_name(cluster_name):
return PCLUSTER_STACK_PREFIX + cluster_name
def get_region():
"""Get AWS_DEFAULT_REGION from the environment."""
return os.environ.get("AWS_DEFAULT_REGION")
def get_partition():
"""Get partition for the AWS_DEFAULT_REGION set in the environment."""
return "aws-us-gov" if get_region().startswith("us-gov") else "aws"
def paginate_boto3(method, **kwargs):
"""
Return a generator for a boto3 call, this allows pagination over an arbitrary number of responses.
:param method: boto3 method
:param kwargs: arguments to method
:return: generator with boto3 results
"""
client = method.__self__
paginator = client.get_paginator(method.__name__)
for page in paginator.paginate(**kwargs).result_key_iters():
for result in page:
yield result
def create_s3_bucket(bucket_name, region):
"""
Create a new S3 bucket.
:param bucket_name: name of the S3 bucket to create
:param region: aws region
"""
s3_client = boto3.client("s3")
""" :type : pyboto3.s3 """
try:
if region != "us-east-1":
s3_client.create_bucket(Bucket=bucket_name, CreateBucketConfiguration={"LocationConstraint": region})
else:
s3_client.create_bucket(Bucket=bucket_name)
except s3_client.exceptions.BucketAlreadyOwnedByYou:
print("Bucket already exists")
def delete_s3_bucket(bucket_name):
"""
Delete an S3 bucket together with all stored objects.
:param bucket_name: name of the S3 bucket to delete
"""
try:
bucket = boto3.resource("s3").Bucket(bucket_name)
bucket.objects.all().delete()
bucket.delete()
except boto3.client("s3").exceptions.NoSuchBucket:
pass
except ClientError:
print("Failed to delete bucket %s. Please delete it manually." % bucket_name)
def zip_dir(path):
"""
Create a zip archive containing all files and dirs rooted in path.
The archive is created in memory and a file handler is returned by the function.
:param path: directory containing the resources to archive.
:return file handler pointing to the compressed archive.
"""
file_out = BytesIO()
with zipfile.ZipFile(file_out, "w", zipfile.ZIP_DEFLATED) as ziph:
for root, _, files in os.walk(path):
for file in files:
ziph.write(os.path.join(root, file), os.path.relpath(os.path.join(root, file), start=path))
file_out.seek(0)
return file_out
def upload_resources_artifacts(bucket_name, root):
"""
Upload to the specified S3 bucket the content of the directory rooted in root path.
All dirs contained in root dir will be uploaded as zip files to $bucket_name/$dir_name/artifacts.zip.
All files contained in root dir will be uploaded to $bucket_name.
:param bucket_name: name of the S3 bucket where files are uploaded
:param root: root directory containing the resources to upload.
"""
bucket = boto3.resource("s3").Bucket(bucket_name)
for res in os.listdir(root):
if os.path.isdir(os.path.join(root, res)):
bucket.upload_fileobj(zip_dir(os.path.join(root, res)), "%s/artifacts.zip" % res)
elif os.path.isfile(os.path.join(root, res)):
bucket.upload_file(os.path.join(root, res), res)
def _get_json_from_s3(region, file_name):
"""
Get pricing file (if none) and parse content as json.
:param region: AWS Region
:param file_name the object name to get
:return: a json object representing the file content
:raises ClientError if unable to download the file
:raises ValueError if unable to decode the file content
"""
bucket_name = "{0}-aws-parallelcluster".format(region)
file_contents = boto3.resource("s3").Object(bucket_name, file_name).get()["Body"].read().decode("utf-8")
return json.loads(file_contents)
def get_supported_features(region, feature):
"""
Get a json object containing the attributes supported by a feature, for example.
{
"Features": {
"efa": {
"instances": ["c5n.18xlarge", "p3dn.24xlarge", "i3en.24xlarge"],
"baseos": ["alinux", "centos7"],
"schedulers": ["sge", "slurm", "torque"]
},
"batch": {
"instances": ["r3.8xlarge", ..., "m5.4xlarge"]
}
}
}
:param region: AWS Region
:param feature: the feature to search for, i.e. "efa" "awsbatch"
:return: json object containing all the attributes supported by feature
"""
try:
features = _get_json_from_s3(region, "features/feature_whitelist.json")
supported_features = features.get("Features").get(feature)
except (ValueError, ClientError, KeyError) as e:
if isinstance(e, ClientError):
code = e.response.get("Error").get("Code")
if code == "InvalidAccessKeyId":
error(e.response.get("Error").get("Message"))
error(
"Failed validate {0}. This is probably a bug on our end. "
"Please submit an issue {1}".format(feature, PCLUSTER_ISSUES_LINK)
)
return supported_features
def get_instance_vcpus(region, instance_type):
"""
Get number of vcpus for the given instance type.
:param region: AWS Region
:param instance_type: the instance type to search for.
:return: the number of vcpus or -1 if the instance type cannot be found
or the pricing file cannot be retrieved/parsed
"""
try:
instances = _get_json_from_s3(region, "instances/instances.json")
vcpus = int(instances[instance_type]["vcpus"])
except (KeyError, ValueError, ClientError):
vcpus = -1
return vcpus
def get_supported_os(scheduler):
"""
Return a tuple of the os supported by parallelcluster for the specific scheduler.
:param scheduler: the scheduler for which we want to know the supported os
:return: a tuple of strings of the supported os
"""
return "alinux" if scheduler == "awsbatch" else "alinux", "centos6", "centos7", "ubuntu1604", "ubuntu1804"
def get_supported_schedulers():
"""
Return a tuple of the scheduler supported by parallelcluster.
:return: a tuple of strings of the supported scheduler
"""
return "sge", "torque", "slurm", "awsbatch"
def get_stack_output_value(stack_outputs, output_key):
"""
Get output value from Cloudformation Stack Output.
:param stack_outputs: Cloudformation Stack Outputs
:param output_key: Output Key
:return: OutputValue if that output exists, otherwise None
"""
return next((o.get("OutputValue") for o in stack_outputs if o.get("OutputKey") == output_key), None)
def get_stack(stack_name, cfn_client=None):
"""
Get the output for a DescribeStacks action for the given Stack.
:param stack_name: the CFN Stack name
:param cfn_client: boto3 cloudformation client
:return: the Stack data type
"""
try:
if not cfn_client:
cfn_client = boto3.client("cloudformation")
return cfn_client.describe_stacks(StackName=stack_name).get("Stacks")[0]
except (ClientError, IndexError) as e:
error(e.response.get("Error").get("Message"))
def verify_stack_creation(stack_name, cfn_client):
"""
Wait for the stack creation to be completed and notify if the stack creation fails.
:param stack_name: the stack name that we should verify
:param cfn_client: the CloudFormation client to use to verify stack status
:return: True if the creation was successful, false otherwise.
"""
status = get_stack(stack_name, cfn_client).get("StackStatus")
resource_status = ""
while status == "CREATE_IN_PROGRESS":
status = get_stack(stack_name, cfn_client).get("StackStatus")
events = cfn_client.describe_stack_events(StackName=stack_name).get("StackEvents")[0]
resource_status = ("Status: %s - %s" % (events.get("LogicalResourceId"), events.get("ResourceStatus"))).ljust(
80
)
sys.stdout.write("\r%s" % resource_status)
sys.stdout.flush()
time.sleep(5)
# print the last status update in the logs
if resource_status != "":
LOGGER.debug(resource_status)
if status != "CREATE_COMPLETE":
LOGGER.critical("\nCluster creation failed. Failed events:")
events = cfn_client.describe_stack_events(StackName=stack_name).get("StackEvents")
for event in events:
if event.get("ResourceStatus") == "CREATE_FAILED":
LOGGER.info(
" - %s %s %s",
event.get("ResourceType"),
event.get("LogicalResourceId"),
event.get("ResourceStatusReason"),
)
return False
return True
def get_templates_bucket_path():
"""Return a string containing the path of bucket."""
region = get_region()
s3_suffix = ".cn" if region.startswith("cn") else ""
return "https://s3.{REGION}.amazonaws.com{S3_SUFFIX}/{REGION}-aws-parallelcluster/templates/".format(
REGION=region, S3_SUFFIX=s3_suffix
)
def get_installed_version():
"""Get the version of the installed aws-parallelcluster package."""
return pkg_resources.get_distribution("aws-parallelcluster").version
def check_if_latest_version():
"""Check if the current package version is the latest one."""
try:
latest = json.loads(urllib.request.urlopen("https://pypi.python.org/pypi/aws-parallelcluster/json").read())[
"info"
]["version"]
if get_installed_version() < latest:
print("Info: There is a newer version %s of AWS ParallelCluster available." % latest)
except Exception:
pass
def warn(message):
"""Print a warning message."""
print("WARNING: {0}".format(message))
def error(message, fail_on_error=True):
"""Print an error message and Raise SystemExit exception to the stderr if fail_on_error is true."""
if fail_on_error:
sys.exit("ERROR: {0}".format(message))
else:
print("ERROR: {0}".format(message))
def get_cfn_param(params, key_name):
"""
Get parameter value from Cloudformation Stack Parameters.
:param params: Cloudformation Stack Parameters
:param key_name: Parameter Key
:return: ParameterValue if that parameter exists, otherwise None
"""
param_value = next((i.get("ParameterValue") for i in params if i.get("ParameterKey") == key_name), "NONE")
return param_value.strip()
def get_efs_mount_target_id(efs_fs_id, avail_zone):
"""
Search for a Mount Target Id in given availability zone for the given EFS file system id.
:param efs_fs_id: EFS file system Id
:param avail_zone: Availability zone to verify
:return: the mount_target_id or None
"""
mount_target_id = None
if efs_fs_id:
mount_targets = boto3.client("efs").describe_mount_targets(FileSystemId=efs_fs_id)
for mount_target in mount_targets.get("MountTargets"):
# Check to see if there is an existing mt in the az of the stack
mount_target_subnet = mount_target.get("SubnetId")
if avail_zone == get_avail_zone(mount_target_subnet):
mount_target_id = mount_target.get("MountTargetId")
return mount_target_id
def get_avail_zone(subnet_id):
avail_zone = None
try:
avail_zone = (
boto3.client("ec2").describe_subnets(SubnetIds=[subnet_id]).get("Subnets")[0].get("AvailabilityZone")
)
except ClientError as e:
LOGGER.debug(
"Unable to detect availability zone for subnet {0}.\n{1}".format(
subnet_id, e.response.get("Error").get("Message")
)
)
return avail_zone
def get_latest_alinux_ami_id():
"""Get latest alinux ami id."""
try:
alinux_ami_id = (
boto3.client("ssm")
.get_parameters_by_path(Path="/aws/service/ami-amazon-linux-latest")
.get("Parameters")[0]
.get("Value")
)
except ClientError as e:
error("Unable to retrieve Amazon Linux AMI id.\n{0}".format(e.response.get("Error").get("Message")))
return alinux_ami_id
def list_ec2_instance_types():
"""Return a list of all the instance types available on EC2, independent by the region."""
return boto3.client("ec2").meta.service_model.shape_for("InstanceType").enum
def get_master_server_id(stack_name):
"""Return the physical id of the master server, or [] if no master server."""
try:
resources = boto3.client("cloudformation").describe_stack_resource(
StackName=stack_name, LogicalResourceId="MasterServer"
)
return resources.get("StackResourceDetail").get("PhysicalResourceId")
except ClientError as e:
error(e.response.get("Error").get("Message"))
def _get_master_server_ip(stack_name):
"""
Get the IP Address of the MasterServer.
:param stack_name: The name of the cloudformation stack
:param config: Config object
:return private/public ip address
"""
ec2 = boto3.client("ec2")
master_id = get_master_server_id(stack_name)
if not master_id:
error("MasterServer not running. Can't SSH")
instance = ec2.describe_instances(InstanceIds=[master_id]).get("Reservations")[0].get("Instances")[0]
ip_address = instance.get("PublicIpAddress")
if ip_address is None:
ip_address = instance.get("PrivateIpAddress")
state = instance.get("State").get("Name")
if state != "running" or ip_address is None:
error("MasterServer: %s\nCannot get ip address.", state.upper())
return ip_address
def get_master_ip_and_username(cluster_name):
cfn = boto3.client("cloudformation")
try:
stack_name = get_stack_name(cluster_name)
stack_result = cfn.describe_stacks(StackName=stack_name).get("Stacks")[0]
stack_status = stack_result.get("StackStatus")
valid_status = ["CREATE_COMPLETE", "UPDATE_COMPLETE", "UPDATE_ROLLBACK_COMPLETE"]
invalid_status = ["DELETE_COMPLETE", "DELETE_IN_PROGRESS"]
if stack_status in invalid_status:
error("Unable to retrieve master_ip and username for a stack in the status: {0}".format(stack_status))
elif stack_status in valid_status:
outputs = stack_result.get("Outputs")
master_ip = get_stack_output_value(outputs, "MasterPublicIP") or _get_master_server_ip(stack_name)
username = get_stack_output_value(outputs, "ClusterUser")
else:
# Stack is in CREATING, CREATED_FAILED, or ROLLBACK_COMPLETE but MasterServer is running
master_ip = _get_master_server_ip(stack_name)
template = cfn.get_template(StackName=stack_name)
mappings = template.get("TemplateBody").get("Mappings").get("OSFeatures")
base_os = get_cfn_param(stack_result.get("Parameters"), "BaseOS")
username = mappings.get(base_os).get("User")
if not master_ip:
error("Failed to get cluster {0} ip.".format(cluster_name))
if not username:
error("Failed to get cluster {0} username.".format(cluster_name))
except ClientError as e:
error(e.response.get("Error").get("Message"))
return master_ip, username
def get_cli_log_file():
return os.path.expanduser(os.path.join("~", ".parallelcluster", "pcluster-cli.log"))
| # Copyright 2018 Amazon.com, Inc. or its affiliates. All Rights Reserved.
#
# Licensed under the Apache License, Version 2.0 (the "License"). You may not use this file except in compliance with
# the License. A copy of the License is located at
#
# http://aws.amazon.com/apache2.0/
#
# or in the "LICENSE.txt" file accompanying this file. This file is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES
# OR CONDITIONS OF ANY KIND, express or implied. See the License for the specific language governing permissions and
# limitations under the License.
# fmt: off
from __future__ import absolute_import, print_function # isort:skip
from future import standard_library # isort:skip
standard_library.install_aliases()
# fmt: on
import json
import logging
import os
import sys
import time
import urllib.request
import zipfile
from io import BytesIO
import boto3
import pkg_resources
from botocore.exceptions import ClientError
LOGGER = logging.getLogger(__name__)
PCLUSTER_STACK_PREFIX = "parallelcluster-"
PCLUSTER_ISSUES_LINK = "https://github.com/aws/aws-parallelcluster/issues"
def get_stack_name(cluster_name):
return PCLUSTER_STACK_PREFIX + cluster_name
def get_region():
"""Get AWS_DEFAULT_REGION from the environment."""
return os.environ.get("AWS_DEFAULT_REGION")
def get_partition():
"""Get partition for the AWS_DEFAULT_REGION set in the environment."""
return "aws-us-gov" if get_region().startswith("us-gov") else "aws"
def paginate_boto3(method, **kwargs):
"""
Return a generator for a boto3 call, this allows pagination over an arbitrary number of responses.
:param method: boto3 method
:param kwargs: arguments to method
:return: generator with boto3 results
"""
client = method.__self__
paginator = client.get_paginator(method.__name__)
for page in paginator.paginate(**kwargs).result_key_iters():
for result in page:
yield result
def create_s3_bucket(bucket_name, region):
"""
Create a new S3 bucket.
:param bucket_name: name of the S3 bucket to create
:param region: aws region
"""
s3_client = boto3.client("s3")
""" :type : pyboto3.s3 """
try:
if region != "us-east-1":
s3_client.create_bucket(Bucket=bucket_name, CreateBucketConfiguration={"LocationConstraint": region})
else:
s3_client.create_bucket(Bucket=bucket_name)
except s3_client.exceptions.BucketAlreadyOwnedByYou:
print("Bucket already exists")
def delete_s3_bucket(bucket_name):
"""
Delete an S3 bucket together with all stored objects.
:param bucket_name: name of the S3 bucket to delete
"""
try:
bucket = boto3.resource("s3").Bucket(bucket_name)
bucket.objects.all().delete()
bucket.delete()
except boto3.client("s3").exceptions.NoSuchBucket:
pass
except ClientError:
print("Failed to delete bucket %s. Please delete it manually." % bucket_name)
def zip_dir(path):
"""
Create a zip archive containing all files and dirs rooted in path.
The archive is created in memory and a file handler is returned by the function.
:param path: directory containing the resources to archive.
:return file handler pointing to the compressed archive.
"""
file_out = BytesIO()
with zipfile.ZipFile(file_out, "w", zipfile.ZIP_DEFLATED) as ziph:
for root, _, files in os.walk(path):
for file in files:
ziph.write(os.path.join(root, file), os.path.relpath(os.path.join(root, file), start=path))
file_out.seek(0)
return file_out
def upload_resources_artifacts(bucket_name, root):
"""
Upload to the specified S3 bucket the content of the directory rooted in root path.
All dirs contained in root dir will be uploaded as zip files to $bucket_name/$dir_name/artifacts.zip.
All files contained in root dir will be uploaded to $bucket_name.
:param bucket_name: name of the S3 bucket where files are uploaded
:param root: root directory containing the resources to upload.
"""
bucket = boto3.resource("s3").Bucket(bucket_name)
for res in os.listdir(root):
if os.path.isdir(os.path.join(root, res)):
bucket.upload_fileobj(zip_dir(os.path.join(root, res)), "%s/artifacts.zip" % res)
elif os.path.isfile(os.path.join(root, res)):
bucket.upload_file(os.path.join(root, res), res)
def _get_json_from_s3(region, file_name):
"""
Get pricing file (if none) and parse content as json.
:param region: AWS Region
:param file_name the object name to get
:return: a json object representing the file content
:raises ClientError if unable to download the file
:raises ValueError if unable to decode the file content
"""
bucket_name = "{0}-aws-parallelcluster".format(region)
file_contents = boto3.resource("s3").Object(bucket_name, file_name).get()["Body"].read().decode("utf-8")
return json.loads(file_contents)
def get_supported_features(region, feature):
"""
Get a json object containing the attributes supported by a feature, for example.
{
"Features": {
"efa": {
"instances": ["c5n.18xlarge", "p3dn.24xlarge", "i3en.24xlarge"],
"baseos": ["alinux", "centos7"],
"schedulers": ["sge", "slurm", "torque"]
},
"batch": {
"instances": ["r3.8xlarge", ..., "m5.4xlarge"]
}
}
}
:param region: AWS Region
:param feature: the feature to search for, i.e. "efa" "awsbatch"
:return: json object containing all the attributes supported by feature
"""
try:
features = _get_json_from_s3(region, "features/feature_whitelist.json")
supported_features = features.get("Features").get(feature)
except (ValueError, ClientError, KeyError) as e:
if isinstance(e, ClientError):
code = e.response.get("Error").get("Code")
if code == "InvalidAccessKeyId":
error(e.response.get("Error").get("Message"))
error(
"Failed validate {0}. This is probably a bug on our end. "
"Please submit an issue {1}".format(feature, PCLUSTER_ISSUES_LINK)
)
return supported_features
def get_instance_vcpus(region, instance_type):
"""
Get number of vcpus for the given instance type.
:param region: AWS Region
:param instance_type: the instance type to search for.
:return: the number of vcpus or -1 if the instance type cannot be found
or the pricing file cannot be retrieved/parsed
"""
try:
instances = _get_json_from_s3(region, "instances/instances.json")
vcpus = int(instances[instance_type]["vcpus"])
except (KeyError, ValueError, ClientError):
vcpus = -1
return vcpus
def get_supported_os(scheduler):
"""
Return a tuple of the os supported by parallelcluster for the specific scheduler.
:param scheduler: the scheduler for which we want to know the supported os
:return: a tuple of strings of the supported os
"""
return "alinux" if scheduler == "awsbatch" else "alinux", "centos6", "centos7", "ubuntu1604", "ubuntu1804"
def get_supported_schedulers():
"""
Return a tuple of the scheduler supported by parallelcluster.
:return: a tuple of strings of the supported scheduler
"""
return "sge", "torque", "slurm", "awsbatch"
def get_stack_output_value(stack_outputs, output_key):
"""
Get output value from Cloudformation Stack Output.
:param stack_outputs: Cloudformation Stack Outputs
:param output_key: Output Key
:return: OutputValue if that output exists, otherwise None
"""
return next((o.get("OutputValue") for o in stack_outputs if o.get("OutputKey") == output_key), None)
def get_stack(stack_name, cfn_client=None):
"""
Get the output for a DescribeStacks action for the given Stack.
:param stack_name: the CFN Stack name
:param cfn_client: boto3 cloudformation client
:return: the Stack data type
"""
try:
if not cfn_client:
cfn_client = boto3.client("cloudformation")
return cfn_client.describe_stacks(StackName=stack_name).get("Stacks")[0]
except (ClientError, IndexError) as e:
error(e.response.get("Error").get("Message"))
def verify_stack_creation(stack_name, cfn_client):
"""
Wait for the stack creation to be completed and notify if the stack creation fails.
:param stack_name: the stack name that we should verify
:param cfn_client: the CloudFormation client to use to verify stack status
:return: True if the creation was successful, false otherwise.
"""
status = get_stack(stack_name, cfn_client).get("StackStatus")
resource_status = ""
while status == "CREATE_IN_PROGRESS":
status = get_stack(stack_name, cfn_client).get("StackStatus")
events = cfn_client.describe_stack_events(StackName=stack_name).get("StackEvents")[0]
resource_status = ("Status: %s - %s" % (events.get("LogicalResourceId"), events.get("ResourceStatus"))).ljust(
80
)
sys.stdout.write("\r%s" % resource_status)
sys.stdout.flush()
time.sleep(5)
# print the last status update in the logs
if resource_status != "":
LOGGER.debug(resource_status)
if status != "CREATE_COMPLETE":
LOGGER.critical("\nCluster creation failed. Failed events:")
events = cfn_client.describe_stack_events(StackName=stack_name).get("StackEvents")
for event in events:
if event.get("ResourceStatus") == "CREATE_FAILED":
LOGGER.info(
" - %s %s %s",
event.get("ResourceType"),
event.get("LogicalResourceId"),
event.get("ResourceStatusReason"),
)
return False
return True
def get_templates_bucket_path():
"""Return a string containing the path of bucket."""
region = get_region()
s3_suffix = ".cn" if region.startswith("cn") else ""
return "https://s3.{REGION}.amazonaws.com{S3_SUFFIX}/{REGION}-aws-parallelcluster/templates/".format(
REGION=region, S3_SUFFIX=s3_suffix
)
def get_installed_version():
"""Get the version of the installed aws-parallelcluster package."""
return pkg_resources.get_distribution("aws-parallelcluster").version
def check_if_latest_version():
"""Check if the current package version is the latest one."""
try:
latest = json.loads(urllib.request.urlopen("https://pypi.python.org/pypi/aws-parallelcluster/json").read())[
"info"
]["version"]
if get_installed_version() < latest:
print("Info: There is a newer version %s of AWS ParallelCluster available." % latest)
except Exception:
pass
def warn(message):
"""Print a warning message."""
print("WARNING: {0}".format(message))
def error(message, fail_on_error=True):
"""Print an error message and Raise SystemExit exception to the stderr if fail_on_error is true."""
if fail_on_error:
sys.exit("ERROR: {0}".format(message))
else:
print("ERROR: {0}".format(message))
def get_cfn_param(params, key_name):
"""
Get parameter value from Cloudformation Stack Parameters.
:param params: Cloudformation Stack Parameters
:param key_name: Parameter Key
:return: ParameterValue if that parameter exists, otherwise None
"""
param_value = next((i.get("ParameterValue") for i in params if i.get("ParameterKey") == key_name), "NONE")
return param_value.strip()
def get_efs_mount_target_id(efs_fs_id, avail_zone):
"""
Search for a Mount Target Id in given availability zone for the given EFS file system id.
:param efs_fs_id: EFS file system Id
:param avail_zone: Availability zone to verify
:return: the mount_target_id or None
"""
mount_target_id = None
if efs_fs_id:
mount_targets = boto3.client("efs").describe_mount_targets(FileSystemId=efs_fs_id)
for mount_target in mount_targets.get("MountTargets"):
# Check to see if there is an existing mt in the az of the stack
mount_target_subnet = mount_target.get("SubnetId")
if avail_zone == get_avail_zone(mount_target_subnet):
mount_target_id = mount_target.get("MountTargetId")
return mount_target_id
def get_avail_zone(subnet_id):
avail_zone = None
try:
avail_zone = (
boto3.client("ec2").describe_subnets(SubnetIds=[subnet_id]).get("Subnets")[0].get("AvailabilityZone")
)
except ClientError as e:
LOGGER.debug(
"Unable to detect availability zone for subnet {0}.\n{1}".format(
subnet_id, e.response.get("Error").get("Message")
)
)
return avail_zone
def get_latest_alinux_ami_id():
"""Get latest alinux ami id."""
try:
alinux_ami_id = (
boto3.client("ssm")
.get_parameters_by_path(Path="/aws/service/ami-amazon-linux-latest")
.get("Parameters")[0]
.get("Value")
)
except ClientError as e:
error("Unable to retrieve Amazon Linux AMI id.\n{0}".format(e.response.get("Error").get("Message")))
return alinux_ami_id
def list_ec2_instance_types():
"""Return a list of all the instance types available on EC2, independent by the region."""
return boto3.client("ec2").meta.service_model.shape_for("InstanceType").enum
def get_master_server_id(stack_name):
"""Return the physical id of the master server, or [] if no master server."""
try:
resources = boto3.client("cloudformation").describe_stack_resource(
StackName=stack_name, LogicalResourceId="MasterServer"
)
return resources.get("StackResourceDetail").get("PhysicalResourceId")
except ClientError as e:
error(e.response.get("Error").get("Message"))
def _get_master_server_ip(stack_name):
"""
Get the IP Address of the MasterServer.
:param stack_name: The name of the cloudformation stack
:param config: Config object
:return private/public ip address
"""
ec2 = boto3.client("ec2")
master_id = get_master_server_id(stack_name)
if not master_id:
error("MasterServer not running. Can't SSH")
instance = ec2.describe_instances(InstanceIds=[master_id]).get("Reservations")[0].get("Instances")[0]
ip_address = instance.get("PublicIpAddress")
if ip_address is None:
ip_address = instance.get("PrivateIpAddress")
state = instance.get("State").get("Name")
if state != "running" or ip_address is None:
error("MasterServer: %s\nCannot get ip address.", state.upper())
return ip_address
def get_master_ip_and_username(cluster_name):
cfn = boto3.client("cloudformation")
try:
stack_name = get_stack_name(cluster_name)
stack_result = cfn.describe_stacks(StackName=stack_name).get("Stacks")[0]
stack_status = stack_result.get("StackStatus")
valid_status = ["CREATE_COMPLETE", "UPDATE_COMPLETE", "UPDATE_ROLLBACK_COMPLETE"]
invalid_status = ["DELETE_COMPLETE", "DELETE_IN_PROGRESS"]
if stack_status in invalid_status:
error("Unable to retrieve master_ip and username for a stack in the status: {0}".format(stack_status))
elif stack_status in valid_status:
outputs = stack_result.get("Outputs")
master_ip = get_stack_output_value(outputs, "MasterPublicIP") or _get_master_server_ip(stack_name)
username = get_stack_output_value(outputs, "ClusterUser")
else:
# Stack is in CREATING, CREATED_FAILED, or ROLLBACK_COMPLETE but MasterServer is running
master_ip = _get_master_server_ip(stack_name)
template = cfn.get_template(StackName=stack_name)
mappings = template.get("TemplateBody").get("Mappings").get("OSFeatures")
base_os = get_cfn_param(stack_result.get("Parameters"), "BaseOS")
username = mappings.get(base_os).get("User")
if not master_ip:
error("Failed to get cluster {0} ip.".format(cluster_name))
if not username:
error("Failed to get cluster {0} username.".format(cluster_name))
except ClientError as e:
error(e.response.get("Error").get("Message"))
return master_ip, username
def get_cli_log_file():
return os.path.expanduser(os.path.join("~", ".parallelcluster", "pcluster-cli.log")) | en | 0.753448 | # Copyright 2018 Amazon.com, Inc. or its affiliates. All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"). You may not use this file except in compliance with # the License. A copy of the License is located at # # http://aws.amazon.com/apache2.0/ # # or in the "LICENSE.txt" file accompanying this file. This file is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES # OR CONDITIONS OF ANY KIND, express or implied. See the License for the specific language governing permissions and # limitations under the License. # fmt: off # isort:skip # isort:skip # fmt: on Get AWS_DEFAULT_REGION from the environment. Get partition for the AWS_DEFAULT_REGION set in the environment. Return a generator for a boto3 call, this allows pagination over an arbitrary number of responses. :param method: boto3 method :param kwargs: arguments to method :return: generator with boto3 results Create a new S3 bucket. :param bucket_name: name of the S3 bucket to create :param region: aws region :type : pyboto3.s3 Delete an S3 bucket together with all stored objects. :param bucket_name: name of the S3 bucket to delete Create a zip archive containing all files and dirs rooted in path. The archive is created in memory and a file handler is returned by the function. :param path: directory containing the resources to archive. :return file handler pointing to the compressed archive. Upload to the specified S3 bucket the content of the directory rooted in root path. All dirs contained in root dir will be uploaded as zip files to $bucket_name/$dir_name/artifacts.zip. All files contained in root dir will be uploaded to $bucket_name. :param bucket_name: name of the S3 bucket where files are uploaded :param root: root directory containing the resources to upload. Get pricing file (if none) and parse content as json. :param region: AWS Region :param file_name the object name to get :return: a json object representing the file content :raises ClientError if unable to download the file :raises ValueError if unable to decode the file content Get a json object containing the attributes supported by a feature, for example. { "Features": { "efa": { "instances": ["c5n.18xlarge", "p3dn.24xlarge", "i3en.24xlarge"], "baseos": ["alinux", "centos7"], "schedulers": ["sge", "slurm", "torque"] }, "batch": { "instances": ["r3.8xlarge", ..., "m5.4xlarge"] } } } :param region: AWS Region :param feature: the feature to search for, i.e. "efa" "awsbatch" :return: json object containing all the attributes supported by feature Get number of vcpus for the given instance type. :param region: AWS Region :param instance_type: the instance type to search for. :return: the number of vcpus or -1 if the instance type cannot be found or the pricing file cannot be retrieved/parsed Return a tuple of the os supported by parallelcluster for the specific scheduler. :param scheduler: the scheduler for which we want to know the supported os :return: a tuple of strings of the supported os Return a tuple of the scheduler supported by parallelcluster. :return: a tuple of strings of the supported scheduler Get output value from Cloudformation Stack Output. :param stack_outputs: Cloudformation Stack Outputs :param output_key: Output Key :return: OutputValue if that output exists, otherwise None Get the output for a DescribeStacks action for the given Stack. :param stack_name: the CFN Stack name :param cfn_client: boto3 cloudformation client :return: the Stack data type Wait for the stack creation to be completed and notify if the stack creation fails. :param stack_name: the stack name that we should verify :param cfn_client: the CloudFormation client to use to verify stack status :return: True if the creation was successful, false otherwise. # print the last status update in the logs Return a string containing the path of bucket. Get the version of the installed aws-parallelcluster package. Check if the current package version is the latest one. Print a warning message. Print an error message and Raise SystemExit exception to the stderr if fail_on_error is true. Get parameter value from Cloudformation Stack Parameters. :param params: Cloudformation Stack Parameters :param key_name: Parameter Key :return: ParameterValue if that parameter exists, otherwise None Search for a Mount Target Id in given availability zone for the given EFS file system id. :param efs_fs_id: EFS file system Id :param avail_zone: Availability zone to verify :return: the mount_target_id or None # Check to see if there is an existing mt in the az of the stack Get latest alinux ami id. Return a list of all the instance types available on EC2, independent by the region. Return the physical id of the master server, or [] if no master server. Get the IP Address of the MasterServer. :param stack_name: The name of the cloudformation stack :param config: Config object :return private/public ip address # Stack is in CREATING, CREATED_FAILED, or ROLLBACK_COMPLETE but MasterServer is running | 2.053934 | 2 |
thinkutils_plus/eventbus/sample/myeventbus.py | ThinkmanWang/thinkutils_plus | 0 | 2878 | __author__ = 'Xsank'
import time
from thinkutils_plus.eventbus.eventbus import EventBus
from myevent import GreetEvent
from myevent import ByeEvent
from mylistener import MyListener
if __name__=="__main__":
eventbus=EventBus()
eventbus.register(MyListener())
ge=GreetEvent('world')
be=ByeEvent('world')
eventbus.async_post(be)
eventbus.post(ge)
time.sleep(0.1)
eventbus.unregister(MyListener())
eventbus.destroy() | __author__ = 'Xsank'
import time
from thinkutils_plus.eventbus.eventbus import EventBus
from myevent import GreetEvent
from myevent import ByeEvent
from mylistener import MyListener
if __name__=="__main__":
eventbus=EventBus()
eventbus.register(MyListener())
ge=GreetEvent('world')
be=ByeEvent('world')
eventbus.async_post(be)
eventbus.post(ge)
time.sleep(0.1)
eventbus.unregister(MyListener())
eventbus.destroy() | none | 1 | 2.095896 | 2 |
|
tools/telemetry/telemetry/core/platform/android_device_unittest.py | kjthegod/chromium | 1 | 2879 | <filename>tools/telemetry/telemetry/core/platform/android_device_unittest.py
# Copyright 2014 The Chromium Authors. All rights reserved.
# Use of this source code is governed by a BSD-style license that can be
# found in the LICENSE file.
import unittest
from telemetry import benchmark
from telemetry.core import browser_options
from telemetry.core.platform import android_device
from telemetry.core.platform import android_platform_backend
from telemetry.unittest_util import system_stub
class AndroidDeviceTest(unittest.TestCase):
def setUp(self):
self._android_device_stub = system_stub.Override(
android_device, ['adb_commands'])
def testGetAllAttachedAndroidDevices(self):
self._android_device_stub.adb_commands.attached_devices = [
'01', '02']
self.assertEquals(
set(['01', '02']),
set(device.device_id for device in
android_device.AndroidDevice.GetAllConnectedDevices()
))
def tearDown(self):
self._android_device_stub.Restore()
class GetDeviceTest(unittest.TestCase):
def setUp(self):
self._android_device_stub = system_stub.Override(
android_device, ['adb_commands', 'os', 'subprocess', 'logging'])
self._apb_stub = system_stub.Override(
android_platform_backend, ['adb_commands'])
def tearDown(self):
self._android_device_stub.Restore()
self._apb_stub.Restore()
def testNoAdbReturnsNone(self):
finder_options = browser_options.BrowserFinderOptions()
def NoAdb(*_, **__):
raise OSError('not found')
self._android_device_stub.subprocess.Popen = NoAdb
self.assertEquals([], self._android_device_stub.logging.warnings)
self.assertIsNone(android_device.GetDevice(finder_options))
def testAdbNoDevicesReturnsNone(self):
finder_options = browser_options.BrowserFinderOptions()
self.assertEquals([], self._android_device_stub.logging.warnings)
self.assertIsNone(android_device.GetDevice(finder_options))
def testAdbPermissionsErrorReturnsNone(self):
finder_options = browser_options.BrowserFinderOptions()
self._android_device_stub.subprocess.Popen.communicate_result = (
'List of devices attached\n????????????\tno permissions\n',
'* daemon not running. starting it now on port 5037 *\n'
'* daemon started successfully *\n')
device = android_device.GetDevice(finder_options)
self.assertEquals([
'adb devices gave a permissions error. Consider running adb as root:',
' adb kill-server',
' sudo `which adb` devices\n\n'],
self._android_device_stub.logging.warnings)
self.assertIsNone(device)
def testAdbTwoDevicesReturnsNone(self):
finder_options = browser_options.BrowserFinderOptions()
self._android_device_stub.adb_commands.attached_devices = [
'015d14fec128220c', '015d14fec128220d']
device = android_device.GetDevice(finder_options)
self.assertEquals([
'Multiple devices attached. Please specify one of the following:\n'
' --device=015d14fec128220c\n'
' --device=015d14fec128220d'],
self._android_device_stub.logging.warnings)
self.assertIsNone(device)
def testAdbPickOneDeviceReturnsDeviceInstance(self):
finder_options = browser_options.BrowserFinderOptions()
finder_options.android_device = '555d14fecddddddd' # pick one
self._android_device_stub.adb_commands.attached_devices = [
'015d14fec128220c', '555d14fecddddddd']
device = android_device.GetDevice(finder_options)
self.assertEquals([], self._android_device_stub.logging.warnings)
self.assertEquals('555d14fecddddddd', device.device_id)
def testAdbOneDeviceReturnsDeviceInstance(self):
finder_options = browser_options.BrowserFinderOptions()
self._android_device_stub.adb_commands.attached_devices = (
['015d14fec128220c'])
device = android_device.GetDevice(finder_options)
self.assertEquals([], self._android_device_stub.logging.warnings)
self.assertEquals('015d14fec128220c', device.device_id)
| <filename>tools/telemetry/telemetry/core/platform/android_device_unittest.py
# Copyright 2014 The Chromium Authors. All rights reserved.
# Use of this source code is governed by a BSD-style license that can be
# found in the LICENSE file.
import unittest
from telemetry import benchmark
from telemetry.core import browser_options
from telemetry.core.platform import android_device
from telemetry.core.platform import android_platform_backend
from telemetry.unittest_util import system_stub
class AndroidDeviceTest(unittest.TestCase):
def setUp(self):
self._android_device_stub = system_stub.Override(
android_device, ['adb_commands'])
def testGetAllAttachedAndroidDevices(self):
self._android_device_stub.adb_commands.attached_devices = [
'01', '02']
self.assertEquals(
set(['01', '02']),
set(device.device_id for device in
android_device.AndroidDevice.GetAllConnectedDevices()
))
def tearDown(self):
self._android_device_stub.Restore()
class GetDeviceTest(unittest.TestCase):
def setUp(self):
self._android_device_stub = system_stub.Override(
android_device, ['adb_commands', 'os', 'subprocess', 'logging'])
self._apb_stub = system_stub.Override(
android_platform_backend, ['adb_commands'])
def tearDown(self):
self._android_device_stub.Restore()
self._apb_stub.Restore()
def testNoAdbReturnsNone(self):
finder_options = browser_options.BrowserFinderOptions()
def NoAdb(*_, **__):
raise OSError('not found')
self._android_device_stub.subprocess.Popen = NoAdb
self.assertEquals([], self._android_device_stub.logging.warnings)
self.assertIsNone(android_device.GetDevice(finder_options))
def testAdbNoDevicesReturnsNone(self):
finder_options = browser_options.BrowserFinderOptions()
self.assertEquals([], self._android_device_stub.logging.warnings)
self.assertIsNone(android_device.GetDevice(finder_options))
def testAdbPermissionsErrorReturnsNone(self):
finder_options = browser_options.BrowserFinderOptions()
self._android_device_stub.subprocess.Popen.communicate_result = (
'List of devices attached\n????????????\tno permissions\n',
'* daemon not running. starting it now on port 5037 *\n'
'* daemon started successfully *\n')
device = android_device.GetDevice(finder_options)
self.assertEquals([
'adb devices gave a permissions error. Consider running adb as root:',
' adb kill-server',
' sudo `which adb` devices\n\n'],
self._android_device_stub.logging.warnings)
self.assertIsNone(device)
def testAdbTwoDevicesReturnsNone(self):
finder_options = browser_options.BrowserFinderOptions()
self._android_device_stub.adb_commands.attached_devices = [
'015d14fec128220c', '015d14fec128220d']
device = android_device.GetDevice(finder_options)
self.assertEquals([
'Multiple devices attached. Please specify one of the following:\n'
' --device=015d14fec128220c\n'
' --device=015d14fec128220d'],
self._android_device_stub.logging.warnings)
self.assertIsNone(device)
def testAdbPickOneDeviceReturnsDeviceInstance(self):
finder_options = browser_options.BrowserFinderOptions()
finder_options.android_device = '555d14fecddddddd' # pick one
self._android_device_stub.adb_commands.attached_devices = [
'015d14fec128220c', '555d14fecddddddd']
device = android_device.GetDevice(finder_options)
self.assertEquals([], self._android_device_stub.logging.warnings)
self.assertEquals('555d14fecddddddd', device.device_id)
def testAdbOneDeviceReturnsDeviceInstance(self):
finder_options = browser_options.BrowserFinderOptions()
self._android_device_stub.adb_commands.attached_devices = (
['015d14fec128220c'])
device = android_device.GetDevice(finder_options)
self.assertEquals([], self._android_device_stub.logging.warnings)
self.assertEquals('015d14fec128220c', device.device_id)
| en | 0.920644 | # Copyright 2014 The Chromium Authors. All rights reserved. # Use of this source code is governed by a BSD-style license that can be # found in the LICENSE file. # pick one | 2.088356 | 2 |
logger.py | bekaaa/xgboost_tuner | 0 | 2880 | <reponame>bekaaa/xgboost_tuner<gh_stars>0
#! /usr/bin/env python
import logging
#---------------------------------------
class logger :
'''
A ready to use logging class.
All you need to do is set an object with the parameters (log_filename, directory to save it)
then whenever you want to add text, type obj.add("some text").
The function obj.close() is not important, I just added it for coverage.
You can edit any of the below configuration to whatever you like.
'''
def __init__(self, filename, log_dir='../data/log'):
self.log = None
self.handler = None
LOG_PATH = log_dir
assert type(filename) == str or filename != ''
self.logger = logging.getLogger();
self.logger.setLevel(logging.INFO)
filename = LOG_PATH + str(filename)
self.handler = logging.FileHandler(filename)
self.handler.setLevel(logging.INFO)
formatter = logging.Formatter(
fmt='%(asctime)s : %(message)s',
datefmt='%d-%m %H:%M'
)
self.handler.setFormatter(formatter)
self.logger.addHandler(self.handler)
return
#------------------------------------
def add(self, message):
assert type(message) == str
self.logger.info(message);
return
#------------------------------------
def close(self):
self.logger.removeHandler(self.handler)
return
#----------------------------------------
| #! /usr/bin/env python
import logging
#---------------------------------------
class logger :
'''
A ready to use logging class.
All you need to do is set an object with the parameters (log_filename, directory to save it)
then whenever you want to add text, type obj.add("some text").
The function obj.close() is not important, I just added it for coverage.
You can edit any of the below configuration to whatever you like.
'''
def __init__(self, filename, log_dir='../data/log'):
self.log = None
self.handler = None
LOG_PATH = log_dir
assert type(filename) == str or filename != ''
self.logger = logging.getLogger();
self.logger.setLevel(logging.INFO)
filename = LOG_PATH + str(filename)
self.handler = logging.FileHandler(filename)
self.handler.setLevel(logging.INFO)
formatter = logging.Formatter(
fmt='%(asctime)s : %(message)s',
datefmt='%d-%m %H:%M'
)
self.handler.setFormatter(formatter)
self.logger.addHandler(self.handler)
return
#------------------------------------
def add(self, message):
assert type(message) == str
self.logger.info(message);
return
#------------------------------------
def close(self):
self.logger.removeHandler(self.handler)
return
#---------------------------------------- | en | 0.445403 | #! /usr/bin/env python #--------------------------------------- A ready to use logging class. All you need to do is set an object with the parameters (log_filename, directory to save it) then whenever you want to add text, type obj.add("some text"). The function obj.close() is not important, I just added it for coverage. You can edit any of the below configuration to whatever you like. #------------------------------------ #------------------------------------ #---------------------------------------- | 3.269851 | 3 |
baselines/prep_baseline.py | lessleslie/slm-code-generation | 64 | 2881 | import json
import multiprocessing as mp
import re
from argparse import ArgumentParser
from enum import Enum, auto
import javalang
from functools import partial
PRED_TOKEN = 'PRED'
modifiers = ['public', 'private', 'protected', 'static']
class TargetType(Enum):
seq = auto()
tree = auto()
@staticmethod
def from_string(s):
try:
return TargetType[s]
except KeyError:
raise ValueError()
target_type = TargetType.seq
RE_WORDS = re.compile(r'''
# Find words in a string. Order matters!
[A-Z]+(?=[A-Z][a-z]) | # All upper case before a capitalized word
[A-Z]?[a-z]+ | # Capitalized words / all lower case
[A-Z]+ | # All upper case
\d+ | # Numbers
_ |
\" |
.+
''', re.VERBOSE)
TREE_SPLIT = re.compile(r'([(),])')
def split_subtokens(str):
return [subtok for subtok in RE_WORDS.findall(str) if not subtok == '_']
def subtokenize(s):
failed = False
try:
tokens = list(javalang.tokenizer.tokenize(s))
except:
try:
tokens = list(javalang.tokenizer.tokenize(s + '()'))[:-2]
except:
try:
tokens = list(javalang.tokenizer.tokenize('(' + s + ')'))[1:-1]
except:
tokens = s.split()
failed = True
if failed:
return [' _ '.join(split_subtokens(i)) for i in tokens if not i in modifiers]
else:
return [' _ '.join(split_subtokens(i.value)) for i in tokens if not i.value in modifiers]
def subtokenize_tree(s):
return ' '.join([sub for sub in re.split(TREE_SPLIT, s) if len(sub) > 0])
def process_line(target_type, max_targets, max_nodes, line):
obj = json.loads(line)
left_context = obj['left_context']
right_context = obj['right_context']
target_seq = obj['target_seq']
num_targets = obj['num_targets']
num_nodes = obj['num_nodes']
if max_targets is not None and num_targets > max_targets:
return None, None
if max_nodes is not None and num_nodes > max_nodes:
return None, None
if target_type is TargetType.seq:
target_pred = ' '.join(subtokenize(target_seq)).lower()
elif target_type is TargetType.tree:
target_pred = subtokenize_tree(obj['linearized_tree'])
source = '{} {} {}'.format(' '.join(subtokenize(left_context)[-200:]).lower(), PRED_TOKEN, ' '.join(subtokenize(right_context)[:200]).lower())
return source, target_pred
def process_file(file_path, data_file_role, dataset_name, target_type, max_targets, max_nodes):
total_examples = 0
source_output_path = '{}.{}.{}.source.txt'.format(dataset_name, target_type, data_file_role)
target_output_path = '{}.{}.{}.target.txt'.format(dataset_name, target_type, data_file_role)
with open(source_output_path, 'w') as source_output_file:
with open(target_output_path, 'w') as target_output_file:
with open(file_path, 'r') as file:
subtokenize_line = partial(process_line, target_type, max_targets, max_nodes)
with mp.Pool(64) as pool:
if data_file_role in ['test', 'val']:
examples = [process_line(target_type, max_targets, max_nodes, line) for line in file]
else:
examples = pool.imap_unordered(subtokenize_line, file, chunksize=100)
#examples = [process_line(target_type, max_targets, max_nodes, line) for line in file]
for source_seq, target_seq in examples:
if source_seq is None or target_seq is None:
continue
source_output_file.write(source_seq + '\n')
target_output_file.write(target_seq + '\n')
total_examples += 1
#print(source_seq, target_seq)
print('File: ' + file_path)
print('Total examples: ' + str(total_examples))
if __name__ == '__main__':
parser = ArgumentParser()
parser.add_argument("-trd", "--train_data", dest="train_data_path",
help="path to training data file", required=True)
parser.add_argument("-ted", "--test_data", dest="test_data_path",
help="path to test data file", required=True)
parser.add_argument("-vd", "--val_data", dest="val_data_path",
help="path to validation data file", required=True)
parser.add_argument("-o", "--output_name", dest="output_name",
help="output name - the base name for the created dataset", metavar="FILE", required=True,
default='data')
parser.add_argument("--target_type", dest="target_type", type=TargetType.from_string, choices=list(TargetType), required=True)
parser.add_argument("--max_targets", dest="max_targets", type=int, required=False, default=40)
parser.add_argument("--max_nodes", dest="max_nodes", type=int, required=False, default=None)
parser.add_argument('--local', action='store_true')
args = parser.parse_args()
train_data_path = args.train_data_path
test_data_path = args.test_data_path
val_data_path = args.val_data_path
for data_file_path, data_role in zip([train_data_path, test_data_path, val_data_path], ['train', 'test', 'val']):
process_file(file_path=data_file_path, data_file_role=data_role, dataset_name=args.output_name,
target_type=args.target_type, max_targets=args.max_targets, max_nodes=args.max_nodes)
| import json
import multiprocessing as mp
import re
from argparse import ArgumentParser
from enum import Enum, auto
import javalang
from functools import partial
PRED_TOKEN = 'PRED'
modifiers = ['public', 'private', 'protected', 'static']
class TargetType(Enum):
seq = auto()
tree = auto()
@staticmethod
def from_string(s):
try:
return TargetType[s]
except KeyError:
raise ValueError()
target_type = TargetType.seq
RE_WORDS = re.compile(r'''
# Find words in a string. Order matters!
[A-Z]+(?=[A-Z][a-z]) | # All upper case before a capitalized word
[A-Z]?[a-z]+ | # Capitalized words / all lower case
[A-Z]+ | # All upper case
\d+ | # Numbers
_ |
\" |
.+
''', re.VERBOSE)
TREE_SPLIT = re.compile(r'([(),])')
def split_subtokens(str):
return [subtok for subtok in RE_WORDS.findall(str) if not subtok == '_']
def subtokenize(s):
failed = False
try:
tokens = list(javalang.tokenizer.tokenize(s))
except:
try:
tokens = list(javalang.tokenizer.tokenize(s + '()'))[:-2]
except:
try:
tokens = list(javalang.tokenizer.tokenize('(' + s + ')'))[1:-1]
except:
tokens = s.split()
failed = True
if failed:
return [' _ '.join(split_subtokens(i)) for i in tokens if not i in modifiers]
else:
return [' _ '.join(split_subtokens(i.value)) for i in tokens if not i.value in modifiers]
def subtokenize_tree(s):
return ' '.join([sub for sub in re.split(TREE_SPLIT, s) if len(sub) > 0])
def process_line(target_type, max_targets, max_nodes, line):
obj = json.loads(line)
left_context = obj['left_context']
right_context = obj['right_context']
target_seq = obj['target_seq']
num_targets = obj['num_targets']
num_nodes = obj['num_nodes']
if max_targets is not None and num_targets > max_targets:
return None, None
if max_nodes is not None and num_nodes > max_nodes:
return None, None
if target_type is TargetType.seq:
target_pred = ' '.join(subtokenize(target_seq)).lower()
elif target_type is TargetType.tree:
target_pred = subtokenize_tree(obj['linearized_tree'])
source = '{} {} {}'.format(' '.join(subtokenize(left_context)[-200:]).lower(), PRED_TOKEN, ' '.join(subtokenize(right_context)[:200]).lower())
return source, target_pred
def process_file(file_path, data_file_role, dataset_name, target_type, max_targets, max_nodes):
total_examples = 0
source_output_path = '{}.{}.{}.source.txt'.format(dataset_name, target_type, data_file_role)
target_output_path = '{}.{}.{}.target.txt'.format(dataset_name, target_type, data_file_role)
with open(source_output_path, 'w') as source_output_file:
with open(target_output_path, 'w') as target_output_file:
with open(file_path, 'r') as file:
subtokenize_line = partial(process_line, target_type, max_targets, max_nodes)
with mp.Pool(64) as pool:
if data_file_role in ['test', 'val']:
examples = [process_line(target_type, max_targets, max_nodes, line) for line in file]
else:
examples = pool.imap_unordered(subtokenize_line, file, chunksize=100)
#examples = [process_line(target_type, max_targets, max_nodes, line) for line in file]
for source_seq, target_seq in examples:
if source_seq is None or target_seq is None:
continue
source_output_file.write(source_seq + '\n')
target_output_file.write(target_seq + '\n')
total_examples += 1
#print(source_seq, target_seq)
print('File: ' + file_path)
print('Total examples: ' + str(total_examples))
if __name__ == '__main__':
parser = ArgumentParser()
parser.add_argument("-trd", "--train_data", dest="train_data_path",
help="path to training data file", required=True)
parser.add_argument("-ted", "--test_data", dest="test_data_path",
help="path to test data file", required=True)
parser.add_argument("-vd", "--val_data", dest="val_data_path",
help="path to validation data file", required=True)
parser.add_argument("-o", "--output_name", dest="output_name",
help="output name - the base name for the created dataset", metavar="FILE", required=True,
default='data')
parser.add_argument("--target_type", dest="target_type", type=TargetType.from_string, choices=list(TargetType), required=True)
parser.add_argument("--max_targets", dest="max_targets", type=int, required=False, default=40)
parser.add_argument("--max_nodes", dest="max_nodes", type=int, required=False, default=None)
parser.add_argument('--local', action='store_true')
args = parser.parse_args()
train_data_path = args.train_data_path
test_data_path = args.test_data_path
val_data_path = args.val_data_path
for data_file_path, data_role in zip([train_data_path, test_data_path, val_data_path], ['train', 'test', 'val']):
process_file(file_path=data_file_path, data_file_role=data_role, dataset_name=args.output_name,
target_type=args.target_type, max_targets=args.max_targets, max_nodes=args.max_nodes)
| en | 0.647066 | # Find words in a string. Order matters! [A-Z]+(?=[A-Z][a-z]) | # All upper case before a capitalized word [A-Z]?[a-z]+ | # Capitalized words / all lower case [A-Z]+ | # All upper case \d+ | # Numbers _ | \" | .+ #examples = [process_line(target_type, max_targets, max_nodes, line) for line in file] #print(source_seq, target_seq) | 2.429056 | 2 |
var/spack/repos/builtin/packages/r-multicool/package.py | varioustoxins/spack | 0 | 2882 | <gh_stars>0
# Copyright 2013-2022 Lawrence Livermore National Security, LLC and other
# Spack Project Developers. See the top-level COPYRIGHT file for details.
#
# SPDX-License-Identifier: (Apache-2.0 OR MIT)
from spack import *
class RMulticool(RPackage):
"""Permutations of multisets in cool-lex order
A set of tools to permute multisets without loops or hash tables and to
generate integer partitions. The permutation functions are based on C code
from <NAME>. Cool-lex order is similar to colexicographical order.
The algorithm is described in <NAME>. (2009)
<DOI:10.1145/1496770.1496877> Loopless Generation of Multiset Permutations
by Prefix Shifts. Symposium on Discrete Algorithms, New York, United
States. The permutation code is distributed without restrictions. The code
for stable and efficient computation of multinomial coefficients comes from
<NAME>. The code can be download from
<http://tamivox.org/dave/multinomial/code.html> and is distributed without
conditions. The package also generates the integer partitions of a
positive, non-zero integer n. The C++ code for this is based on Python code
from <NAME> which can be found here
<https://jeromekelleher.net/tag/integer-partitions.html>. The C++ code and
Python code are distributed without conditions."""
homepage = "https://cloud.r-project.org/package=multicool"
url = "https://cloud.r-project.org/src/contrib/Archive/multicool/multicool_0.1-9.tar.gz"
list_url = "https://cloud.r-project.org/src/contrib/Archive/multicool/Archive/multicool"
version('0.1-10', sha256='5bb0cb0d9eb64420c862877247a79bb0afadacfe23262ec8c3fa26e5e34d6ff9')
version('0.1-9', sha256='bdf92571cef1b649952d155395a92b8683099ee13114f73a9d41fc5d7d49d329')
depends_on('[email protected]:', type=('build', 'run'))
| # Copyright 2013-2022 Lawrence Livermore National Security, LLC and other
# Spack Project Developers. See the top-level COPYRIGHT file for details.
#
# SPDX-License-Identifier: (Apache-2.0 OR MIT)
from spack import *
class RMulticool(RPackage):
"""Permutations of multisets in cool-lex order
A set of tools to permute multisets without loops or hash tables and to
generate integer partitions. The permutation functions are based on C code
from <NAME>. Cool-lex order is similar to colexicographical order.
The algorithm is described in <NAME>. (2009)
<DOI:10.1145/1496770.1496877> Loopless Generation of Multiset Permutations
by Prefix Shifts. Symposium on Discrete Algorithms, New York, United
States. The permutation code is distributed without restrictions. The code
for stable and efficient computation of multinomial coefficients comes from
<NAME>. The code can be download from
<http://tamivox.org/dave/multinomial/code.html> and is distributed without
conditions. The package also generates the integer partitions of a
positive, non-zero integer n. The C++ code for this is based on Python code
from <NAME> which can be found here
<https://jeromekelleher.net/tag/integer-partitions.html>. The C++ code and
Python code are distributed without conditions."""
homepage = "https://cloud.r-project.org/package=multicool"
url = "https://cloud.r-project.org/src/contrib/Archive/multicool/multicool_0.1-9.tar.gz"
list_url = "https://cloud.r-project.org/src/contrib/Archive/multicool/Archive/multicool"
version('0.1-10', sha256='5bb0cb0d9eb64420c862877247a79bb0afadacfe23262ec8c3fa26e5e34d6ff9')
version('0.1-9', sha256='bdf92571cef1b649952d155395a92b8683099ee13114f73a9d41fc5d7d49d329')
depends_on('[email protected]:', type=('build', 'run')) | en | 0.817994 | # Copyright 2013-2022 Lawrence Livermore National Security, LLC and other # Spack Project Developers. See the top-level COPYRIGHT file for details. # # SPDX-License-Identifier: (Apache-2.0 OR MIT) Permutations of multisets in cool-lex order A set of tools to permute multisets without loops or hash tables and to generate integer partitions. The permutation functions are based on C code from <NAME>. Cool-lex order is similar to colexicographical order. The algorithm is described in <NAME>. (2009) <DOI:10.1145/1496770.1496877> Loopless Generation of Multiset Permutations by Prefix Shifts. Symposium on Discrete Algorithms, New York, United States. The permutation code is distributed without restrictions. The code for stable and efficient computation of multinomial coefficients comes from <NAME>. The code can be download from <http://tamivox.org/dave/multinomial/code.html> and is distributed without conditions. The package also generates the integer partitions of a positive, non-zero integer n. The C++ code for this is based on Python code from <NAME> which can be found here <https://jeromekelleher.net/tag/integer-partitions.html>. The C++ code and Python code are distributed without conditions. | 1.624227 | 2 |
updatetranslations.py | erincerys/ergo | 1,122 | 2883 | <reponame>erincerys/ergo<gh_stars>1000+
#!/usr/bin/env python3
# updatetranslations.py
#
# tl;dr this script updates our translation file with the newest, coolest strings we've added!
# it manually searches the source code, extracts strings and then updates the language files.
# Written in 2018 by <NAME> <<EMAIL>>
#
# To the extent possible under law, the author(s) have dedicated all copyright
# and related and neighboring rights to this software to the public domain
# worldwide. This software is distributed without any warranty.
#
# You should have received a copy of the CC0 Public Domain Dedication along
# with this software. If not, see
# <http://creativecommons.org/publicdomain/zero/1.0/>.
"""updatetranslations.py
Usage:
updatetranslations.py run <irc-dir> <languages-dir>
updatetranslations.py --version
updatetranslations.py (-h | --help)
Options:
<irc-dir> Oragono's irc subdirectory where the Go code is kept.
<languages-dir> Languages directory."""
import os
import re
import json
from docopt import docopt
import yaml
ignored_strings = [
'none', 'saset'
]
if __name__ == '__main__':
arguments = docopt(__doc__, version="0.1.0")
if arguments['run']:
# general IRC strings
irc_strings = []
for subdir, dirs, files in os.walk(arguments['<irc-dir>']):
for fname in files:
filepath = subdir + os.sep + fname
if filepath.endswith('.go'):
content = open(filepath, 'r', encoding='UTF-8').read()
matches = re.findall(r'\.t\("((?:[^"]|\\")+)"\)', content)
for match in matches:
if match not in irc_strings:
irc_strings.append(match)
matches = re.findall(r'\.t\(\`([^\`]+)\`\)', content)
for match in matches:
if match not in irc_strings:
irc_strings.append(match)
for s in ignored_strings:
try:
irc_strings.remove(s)
except ValueError:
# ignore any that don't exist
...
print("irc strings:", len(irc_strings))
with open(os.path.join(arguments['<languages-dir>'], 'example', 'irc.lang.json'), 'w') as f:
f.write(json.dumps({k:k for k in irc_strings}, sort_keys=True, indent=2, separators=(',', ': ')))
f.write('\n')
for string in irc_strings:
if 1 < string.count('%s') + string.count('%d') + string.count('%f'):
print(' confirm:', string)
# help entries
help_strings = []
for subdir, dirs, files in os.walk(arguments['<irc-dir>']):
for fname in files:
filepath = subdir + os.sep + fname
if fname == 'help.go':
content = open(filepath, 'r', encoding='UTF-8').read()
matches = re.findall(r'\`([^\`]+)\`', content)
for match in matches:
if '\n' in match and match not in help_strings:
help_strings.append(match)
for s in ignored_strings:
try:
help_strings.remove(s)
except ValueError:
# ignore any that don't exist
...
print("help strings:", len(help_strings))
with open(os.path.join(arguments['<languages-dir>'], 'example', 'help.lang.json'), 'w') as f:
f.write(json.dumps({k:k for k in help_strings}, sort_keys=True, indent=2, separators=(',', ': ')))
f.write('\n')
for string in help_strings:
if 1 < string.count('%s') + string.count('%d') + string.count('%f'):
print(' confirm:', string.split('\n')[0])
# nickserv help entries
help_strings = []
for subdir, dirs, files in os.walk(arguments['<irc-dir>']):
for fname in files:
filepath = subdir + os.sep + fname
if fname == 'nickserv.go':
content = open(filepath, 'r', encoding='UTF-8').read()
matches = re.findall(r'\`([^\`]+)\`', content)
for match in matches:
if match not in help_strings:
help_strings.append(match)
for s in ignored_strings:
try:
help_strings.remove(s)
except ValueError:
# ignore any that don't exist
...
print("nickserv help strings:", len(help_strings))
with open(os.path.join(arguments['<languages-dir>'], 'example', 'nickserv.lang.json'), 'w') as f:
f.write(json.dumps({k:k for k in help_strings}, sort_keys=True, indent=2, separators=(',', ': ')))
f.write('\n')
for string in help_strings:
if 1 < string.count('%s') + string.count('%d') + string.count('%f'):
print(' confirm:', string)
# chanserv help entries
help_strings = []
for subdir, dirs, files in os.walk(arguments['<irc-dir>']):
for fname in files:
filepath = subdir + os.sep + fname
if fname == 'chanserv.go':
content = open(filepath, 'r', encoding='UTF-8').read()
matches = re.findall(r'\`([^\`]+)\`', content)
for match in matches:
if match not in help_strings:
help_strings.append(match)
for s in ignored_strings:
try:
help_strings.remove(s)
except ValueError:
# ignore any that don't exist
...
print("chanserv help strings:", len(help_strings))
with open(os.path.join(arguments['<languages-dir>'], 'example', 'chanserv.lang.json'), 'w') as f:
f.write(json.dumps({k:k for k in help_strings}, sort_keys=True, indent=2, separators=(',', ': ')))
f.write('\n')
for string in help_strings:
if 1 < string.count('%s') + string.count('%d') + string.count('%f'):
print(' confirm:', string)
# hostserv help entries
help_strings = []
for subdir, dirs, files in os.walk(arguments['<irc-dir>']):
for fname in files:
filepath = subdir + os.sep + fname
if fname == 'hostserv.go':
content = open(filepath, 'r', encoding='UTF-8').read()
matches = re.findall(r'\`([^\`]+)\`', content)
for match in matches:
if match not in help_strings:
help_strings.append(match)
for s in ignored_strings:
try:
help_strings.remove(s)
except ValueError:
# ignore any that don't exist
...
print("hostserv help strings:", len(help_strings))
with open(os.path.join(arguments['<languages-dir>'], 'example', 'hostserv.lang.json'), 'w') as f:
f.write(json.dumps({k:k for k in help_strings}, sort_keys=True, indent=2, separators=(',', ': ')))
f.write('\n')
for string in help_strings:
if 1 < string.count('%s') + string.count('%d') + string.count('%f'):
print(' confirm:', string)
| #!/usr/bin/env python3
# updatetranslations.py
#
# tl;dr this script updates our translation file with the newest, coolest strings we've added!
# it manually searches the source code, extracts strings and then updates the language files.
# Written in 2018 by <NAME> <<EMAIL>>
#
# To the extent possible under law, the author(s) have dedicated all copyright
# and related and neighboring rights to this software to the public domain
# worldwide. This software is distributed without any warranty.
#
# You should have received a copy of the CC0 Public Domain Dedication along
# with this software. If not, see
# <http://creativecommons.org/publicdomain/zero/1.0/>.
"""updatetranslations.py
Usage:
updatetranslations.py run <irc-dir> <languages-dir>
updatetranslations.py --version
updatetranslations.py (-h | --help)
Options:
<irc-dir> Oragono's irc subdirectory where the Go code is kept.
<languages-dir> Languages directory."""
import os
import re
import json
from docopt import docopt
import yaml
ignored_strings = [
'none', 'saset'
]
if __name__ == '__main__':
arguments = docopt(__doc__, version="0.1.0")
if arguments['run']:
# general IRC strings
irc_strings = []
for subdir, dirs, files in os.walk(arguments['<irc-dir>']):
for fname in files:
filepath = subdir + os.sep + fname
if filepath.endswith('.go'):
content = open(filepath, 'r', encoding='UTF-8').read()
matches = re.findall(r'\.t\("((?:[^"]|\\")+)"\)', content)
for match in matches:
if match not in irc_strings:
irc_strings.append(match)
matches = re.findall(r'\.t\(\`([^\`]+)\`\)', content)
for match in matches:
if match not in irc_strings:
irc_strings.append(match)
for s in ignored_strings:
try:
irc_strings.remove(s)
except ValueError:
# ignore any that don't exist
...
print("irc strings:", len(irc_strings))
with open(os.path.join(arguments['<languages-dir>'], 'example', 'irc.lang.json'), 'w') as f:
f.write(json.dumps({k:k for k in irc_strings}, sort_keys=True, indent=2, separators=(',', ': ')))
f.write('\n')
for string in irc_strings:
if 1 < string.count('%s') + string.count('%d') + string.count('%f'):
print(' confirm:', string)
# help entries
help_strings = []
for subdir, dirs, files in os.walk(arguments['<irc-dir>']):
for fname in files:
filepath = subdir + os.sep + fname
if fname == 'help.go':
content = open(filepath, 'r', encoding='UTF-8').read()
matches = re.findall(r'\`([^\`]+)\`', content)
for match in matches:
if '\n' in match and match not in help_strings:
help_strings.append(match)
for s in ignored_strings:
try:
help_strings.remove(s)
except ValueError:
# ignore any that don't exist
...
print("help strings:", len(help_strings))
with open(os.path.join(arguments['<languages-dir>'], 'example', 'help.lang.json'), 'w') as f:
f.write(json.dumps({k:k for k in help_strings}, sort_keys=True, indent=2, separators=(',', ': ')))
f.write('\n')
for string in help_strings:
if 1 < string.count('%s') + string.count('%d') + string.count('%f'):
print(' confirm:', string.split('\n')[0])
# nickserv help entries
help_strings = []
for subdir, dirs, files in os.walk(arguments['<irc-dir>']):
for fname in files:
filepath = subdir + os.sep + fname
if fname == 'nickserv.go':
content = open(filepath, 'r', encoding='UTF-8').read()
matches = re.findall(r'\`([^\`]+)\`', content)
for match in matches:
if match not in help_strings:
help_strings.append(match)
for s in ignored_strings:
try:
help_strings.remove(s)
except ValueError:
# ignore any that don't exist
...
print("nickserv help strings:", len(help_strings))
with open(os.path.join(arguments['<languages-dir>'], 'example', 'nickserv.lang.json'), 'w') as f:
f.write(json.dumps({k:k for k in help_strings}, sort_keys=True, indent=2, separators=(',', ': ')))
f.write('\n')
for string in help_strings:
if 1 < string.count('%s') + string.count('%d') + string.count('%f'):
print(' confirm:', string)
# chanserv help entries
help_strings = []
for subdir, dirs, files in os.walk(arguments['<irc-dir>']):
for fname in files:
filepath = subdir + os.sep + fname
if fname == 'chanserv.go':
content = open(filepath, 'r', encoding='UTF-8').read()
matches = re.findall(r'\`([^\`]+)\`', content)
for match in matches:
if match not in help_strings:
help_strings.append(match)
for s in ignored_strings:
try:
help_strings.remove(s)
except ValueError:
# ignore any that don't exist
...
print("chanserv help strings:", len(help_strings))
with open(os.path.join(arguments['<languages-dir>'], 'example', 'chanserv.lang.json'), 'w') as f:
f.write(json.dumps({k:k for k in help_strings}, sort_keys=True, indent=2, separators=(',', ': ')))
f.write('\n')
for string in help_strings:
if 1 < string.count('%s') + string.count('%d') + string.count('%f'):
print(' confirm:', string)
# hostserv help entries
help_strings = []
for subdir, dirs, files in os.walk(arguments['<irc-dir>']):
for fname in files:
filepath = subdir + os.sep + fname
if fname == 'hostserv.go':
content = open(filepath, 'r', encoding='UTF-8').read()
matches = re.findall(r'\`([^\`]+)\`', content)
for match in matches:
if match not in help_strings:
help_strings.append(match)
for s in ignored_strings:
try:
help_strings.remove(s)
except ValueError:
# ignore any that don't exist
...
print("hostserv help strings:", len(help_strings))
with open(os.path.join(arguments['<languages-dir>'], 'example', 'hostserv.lang.json'), 'w') as f:
f.write(json.dumps({k:k for k in help_strings}, sort_keys=True, indent=2, separators=(',', ': ')))
f.write('\n')
for string in help_strings:
if 1 < string.count('%s') + string.count('%d') + string.count('%f'):
print(' confirm:', string) | en | 0.766039 | #!/usr/bin/env python3 # updatetranslations.py # # tl;dr this script updates our translation file with the newest, coolest strings we've added! # it manually searches the source code, extracts strings and then updates the language files. # Written in 2018 by <NAME> <<EMAIL>> # # To the extent possible under law, the author(s) have dedicated all copyright # and related and neighboring rights to this software to the public domain # worldwide. This software is distributed without any warranty. # # You should have received a copy of the CC0 Public Domain Dedication along # with this software. If not, see # <http://creativecommons.org/publicdomain/zero/1.0/>. updatetranslations.py Usage: updatetranslations.py run <irc-dir> <languages-dir> updatetranslations.py --version updatetranslations.py (-h | --help) Options: <irc-dir> Oragono's irc subdirectory where the Go code is kept. <languages-dir> Languages directory. # general IRC strings # ignore any that don't exist # help entries # ignore any that don't exist # nickserv help entries # ignore any that don't exist # chanserv help entries # ignore any that don't exist # hostserv help entries # ignore any that don't exist | 2.355673 | 2 |
processing_tools/number_of_tenants.py | apanda/modeling | 3 | 2884 | <filename>processing_tools/number_of_tenants.py<gh_stars>1-10
import sys
from collections import defaultdict
def Process (fnames):
tenant_time = defaultdict(lambda: defaultdict(lambda: 0.0))
tenant_run = defaultdict(lambda: defaultdict(lambda:0))
for fname in fnames:
f = open(fname)
for l in f:
if l.startswith("tenant"):
continue
parts = l.strip().split()
tenants = int(parts[0])
priv = int(parts[1])
pub = int(parts[2])
num_machines = tenants * priv * pub
int_checks = (tenants * tenants * priv * (priv - 1)) / 2
int_time = int_checks * float(parts[3])
ext_checks = (tenants * priv) * ((tenants - 1) * pub)
ext_time = ext_checks * float(parts[4])
oext_check = (tenants * priv) * (tenants * pub)
oext_time = oext_check * float(parts[5])
total = int_time + ext_time + oext_time
tenant_time[(priv, pub)][tenants] += total
tenant_run[(priv, pub)][tenants] += 1
for k in sorted(tenant_run.keys()):
print "# ----%s------"%(str(k))
for k2 in sorted(tenant_run[k].keys()):
print "%d %d %f"%(k2, tenant_run[k][k2], \
tenant_time[k][k2]/float(tenant_run[k][k2]))
print
print
#print "%d %d %f"%(k, runs[k], machines[k]/float(runs[k]))
if __name__ == "__main__":
Process(sys.argv[1:])
| <filename>processing_tools/number_of_tenants.py<gh_stars>1-10
import sys
from collections import defaultdict
def Process (fnames):
tenant_time = defaultdict(lambda: defaultdict(lambda: 0.0))
tenant_run = defaultdict(lambda: defaultdict(lambda:0))
for fname in fnames:
f = open(fname)
for l in f:
if l.startswith("tenant"):
continue
parts = l.strip().split()
tenants = int(parts[0])
priv = int(parts[1])
pub = int(parts[2])
num_machines = tenants * priv * pub
int_checks = (tenants * tenants * priv * (priv - 1)) / 2
int_time = int_checks * float(parts[3])
ext_checks = (tenants * priv) * ((tenants - 1) * pub)
ext_time = ext_checks * float(parts[4])
oext_check = (tenants * priv) * (tenants * pub)
oext_time = oext_check * float(parts[5])
total = int_time + ext_time + oext_time
tenant_time[(priv, pub)][tenants] += total
tenant_run[(priv, pub)][tenants] += 1
for k in sorted(tenant_run.keys()):
print "# ----%s------"%(str(k))
for k2 in sorted(tenant_run[k].keys()):
print "%d %d %f"%(k2, tenant_run[k][k2], \
tenant_time[k][k2]/float(tenant_run[k][k2]))
print
print
#print "%d %d %f"%(k, runs[k], machines[k]/float(runs[k]))
if __name__ == "__main__":
Process(sys.argv[1:])
| en | 0.335122 | #print "%d %d %f"%(k, runs[k], machines[k]/float(runs[k])) | 2.593889 | 3 |
pyfisher/mpi.py | borisbolliet/pyfisher | 7 | 2885 | from __future__ import print_function
import numpy as np
import os,sys,time
"""
Copied from orphics.mpi
"""
try:
disable_mpi_env = os.environ['DISABLE_MPI']
disable_mpi = True if disable_mpi_env.lower().strip() == "true" else False
except:
disable_mpi = False
"""
Use the below cleanup stuff only for intel-mpi!
If you use it on openmpi, you will have no traceback for errors
causing hours of endless confusion and frustration! - Sincerely, past frustrated Mat
"""
# From Sigurd's enlib.mpi:
# Uncaught exceptions don't cause mpi to abort. This can lead to thousands of
# wasted CPU hours
# def cleanup(type, value, traceback):
# sys.__excepthook__(type, value, traceback)
# MPI.COMM_WORLD.Abort(1)
# sys.excepthook = cleanup
class fakeMpiComm:
"""
A Simple Fake MPI implementation
"""
def __init__(self):
pass
def Get_rank(self):
return 0
def Get_size(self):
return 1
def Barrier(self):
pass
def Abort(self,dummy):
pass
try:
if disable_mpi: raise
from mpi4py import MPI
except:
if not(disable_mpi): print("WARNING: mpi4py could not be loaded. Falling back to fake MPI. This means that if you submitted multiple processes, they will all be assigned the same rank of 0, and they are potentially doing the same thing.")
class template:
pass
MPI = template()
MPI.COMM_WORLD = fakeMpiComm()
def mpi_distribute(num_tasks,avail_cores,allow_empty=False):
# copied to mapsims.convert_noise_templates
if not(allow_empty): assert avail_cores<=num_tasks
min_each, rem = divmod(num_tasks,avail_cores)
num_each = np.array([min_each]*avail_cores) # first distribute equally
if rem>0: num_each[-rem:] += 1 # add the remainder to the last set of cores (so that rank 0 never gets extra jobs)
task_range = list(range(num_tasks)) # the full range of tasks
cumul = np.cumsum(num_each).tolist() # the end indices for each task
task_dist = [task_range[x:y] for x,y in zip([0]+cumul[:-1],cumul)] # a list containing the tasks for each core
assert sum(num_each)==num_tasks
assert len(num_each)==avail_cores
assert len(task_dist)==avail_cores
return num_each,task_dist
def distribute(njobs,verbose=True,**kwargs):
comm = MPI.COMM_WORLD
rank = comm.Get_rank()
numcores = comm.Get_size()
num_each,each_tasks = mpi_distribute(njobs,numcores,**kwargs)
if rank==0: print ("At most ", max(num_each) , " tasks...")
my_tasks = each_tasks[rank]
return comm,rank,my_tasks
| from __future__ import print_function
import numpy as np
import os,sys,time
"""
Copied from orphics.mpi
"""
try:
disable_mpi_env = os.environ['DISABLE_MPI']
disable_mpi = True if disable_mpi_env.lower().strip() == "true" else False
except:
disable_mpi = False
"""
Use the below cleanup stuff only for intel-mpi!
If you use it on openmpi, you will have no traceback for errors
causing hours of endless confusion and frustration! - Sincerely, past frustrated Mat
"""
# From Sigurd's enlib.mpi:
# Uncaught exceptions don't cause mpi to abort. This can lead to thousands of
# wasted CPU hours
# def cleanup(type, value, traceback):
# sys.__excepthook__(type, value, traceback)
# MPI.COMM_WORLD.Abort(1)
# sys.excepthook = cleanup
class fakeMpiComm:
"""
A Simple Fake MPI implementation
"""
def __init__(self):
pass
def Get_rank(self):
return 0
def Get_size(self):
return 1
def Barrier(self):
pass
def Abort(self,dummy):
pass
try:
if disable_mpi: raise
from mpi4py import MPI
except:
if not(disable_mpi): print("WARNING: mpi4py could not be loaded. Falling back to fake MPI. This means that if you submitted multiple processes, they will all be assigned the same rank of 0, and they are potentially doing the same thing.")
class template:
pass
MPI = template()
MPI.COMM_WORLD = fakeMpiComm()
def mpi_distribute(num_tasks,avail_cores,allow_empty=False):
# copied to mapsims.convert_noise_templates
if not(allow_empty): assert avail_cores<=num_tasks
min_each, rem = divmod(num_tasks,avail_cores)
num_each = np.array([min_each]*avail_cores) # first distribute equally
if rem>0: num_each[-rem:] += 1 # add the remainder to the last set of cores (so that rank 0 never gets extra jobs)
task_range = list(range(num_tasks)) # the full range of tasks
cumul = np.cumsum(num_each).tolist() # the end indices for each task
task_dist = [task_range[x:y] for x,y in zip([0]+cumul[:-1],cumul)] # a list containing the tasks for each core
assert sum(num_each)==num_tasks
assert len(num_each)==avail_cores
assert len(task_dist)==avail_cores
return num_each,task_dist
def distribute(njobs,verbose=True,**kwargs):
comm = MPI.COMM_WORLD
rank = comm.Get_rank()
numcores = comm.Get_size()
num_each,each_tasks = mpi_distribute(njobs,numcores,**kwargs)
if rank==0: print ("At most ", max(num_each) , " tasks...")
my_tasks = each_tasks[rank]
return comm,rank,my_tasks
| en | 0.77272 | Copied from orphics.mpi Use the below cleanup stuff only for intel-mpi! If you use it on openmpi, you will have no traceback for errors causing hours of endless confusion and frustration! - Sincerely, past frustrated Mat # From Sigurd's enlib.mpi: # Uncaught exceptions don't cause mpi to abort. This can lead to thousands of # wasted CPU hours # def cleanup(type, value, traceback): # sys.__excepthook__(type, value, traceback) # MPI.COMM_WORLD.Abort(1) # sys.excepthook = cleanup A Simple Fake MPI implementation # copied to mapsims.convert_noise_templates # first distribute equally # add the remainder to the last set of cores (so that rank 0 never gets extra jobs) # the full range of tasks # the end indices for each task # a list containing the tasks for each core | 2.279789 | 2 |
ebay.py | SpironoZeppeli/Magic-The-Scannening | 0 | 2886 | <reponame>SpironoZeppeli/Magic-The-Scannening
import requests
import urllib.request
import urllib.parse
import PIL
import re
import configparser
import json
from PIL import Image
from ebaysdk.trading import Connection as Trading
from ebaysdk.exception import ConnectionError
from yaml import load
from PyQt5.QtWidgets import QMessageBox
class EbaySeller:
def __init__(self):
self.api = Trading()
config = configparser.ConfigParser()
config.read('config.ini')
with open('details.yaml', 'r') as file:
self.yaml_config = load(file)
def upload_card(self, card_name, eu_card_price, us_card_price, card_id):
if us_card_price != 0:
card_price = us_card_price * 0.8
else:
card_price = eu_card_price
if card_price < 1:
card_price = 1
card_price = str(round(card_price, 2))
try:
card_image = 'http://gatherer.wizards.com/Handlers/Image.ashx?multiverseid=' + card_id + '&type=card'
except:
self.msg = QMessageBox()
self.msg.setWindowTitle("Upload Failed")
self.msg.setText("Upload Failed, wizards gatherer error")
self.msg.setStandardButtons(QMessageBox.Ok)
self.msg.exec()
urllib.request.urlretrieve(card_image, 'temp.jpg')
# Resize card
base_height = 500
img = Image.open('temp.jpg')
height_percent = (base_height / float(img.size[1]))
wsize = int((float(img.size[0]) * float(height_percent)))
img = img.resize((wsize, base_height), PIL.Image.ANTIALIAS)
img.save('temp.png')
# Upload to PictShare
files = {'file': open('temp.png', 'rb')}
try:
r = requests.post('https://pictshare.net/api/upload.php', files=files)
except:
self.msg = QMessageBox()
self.msg.setWindowTitle("Upload Failed")
self.msg.setText("Upload Failed, PictShare error")
self.msg.setStandardButtons(QMessageBox.Ok)
self.msg.exec()
print(r)
r = r.text
r = json.loads(r)
print(r)
r = r['url']
# Fix using regular expression, may not be needed at a later date
r = re.sub('\\.net', '.net/', r)
r = re.sub('\\.net//', '.net/', r)
print(r)
try:
image = self.api.execute('UploadSiteHostedPictures', {'ExternalPictureURL': r})
image = image.dict()
image = image['SiteHostedPictureDetails']['FullURL']
print(image)
# Upload to ebay
response = self.api.execute('AddFixedPriceItem', {
'Item': {'Title': card_name + ' MTG - NM/M', 'Description': card_name + ' MTG - NM/M',
'Quantity': '1', 'PictureDetails': {'PictureURL': image},
'ReturnPolicy': {'ReturnsAcceptedOption': 'ReturnsNotAccepted'}, 'DispatchTimeMax': '3',
'ConditionID': '1000', 'StartPrice': card_price, 'PostalCode': self.yaml_config["PostalCode"],
'Currency': self.yaml_config["Currency"],
'Country': 'GB', 'ListingDuration': 'Days_30', 'PaymentMethods': 'PayPal',
'PayPalEmailAddress': self.yaml_config["PayPalEmailAddress"],
'PrimaryCategory': {'CategoryID': '38292'},
'ShippingDetails': {'ShippingType': 'Flat',
'ShippingServiceOptions': {'ShippingServicePriority': '1',
'ShippingService': self.yaml_config[
"ShippingService"],
'ShippingServiceCost': '1'}}}})
print(response.dict())
print(response.reply)
self.msg = QMessageBox()
if response.reply.Ack == 'Failure':
self.msg.setWindowTitle("Upload Failed")
self.msg.setText("Upload Complete, please check log.txt")
self.msg.setStandardButtons(QMessageBox.Ok)
with open('log.txt', 'a+') as log_file:
log_file.write(response.reply)
else:
self.msg.setWindowTitle("Upload Complete")
self.msg.setText("Upload Complete, please check your ebay account to confirm")
self.msg.setStandardButtons(QMessageBox.Ok)
self.msg.exec()
except ConnectionError as e:
print(e)
print(e.response.dict())
def get_multiverse_id(self, name):
try:
name = re.sub(' ', '%20', name)
r = requests.get('https://api.scryfall.com/cards/named?exact=' + name)
r = json.loads(r.text)
return r['multiverse_ids'][0]
except:
self.msg = QMessageBox()
self.msg.setWindowTitle("Upload Failed")
self.msg.setText("Upload Failed, scryfall error")
self.msg.setStandardButtons(QMessageBox.Ok)
self.msg.exec()
def get_card_info_and_sell(self, name):
try:
multiverse_id = self.get_multiverse_id(name)
r = requests.get('http://api.cardsearch.nl/v1/prices?key=W00dw0rk$&mids[]=' + str(multiverse_id))
r = json.loads(r.text)
r = r[0]
card_name = r.get('name')
eu_card_price = r.get('price_normal')
us_card_price = r.get('us_normal')
card_set = r.get('set_id')
card_set_name = r.get('set_name')
card_id = r.get('multiverse_id')
# Display card info in CLI
print('Name: ' + card_name)
print('Set: ' + card_set)
print('Set name: ' + card_set_name)
print('Card ID: ' + str(card_id))
self.upload_card(card_name, eu_card_price, us_card_price, card_id)
except:
self.msg = QMessageBox()
self.msg.setWindowTitle("Upload Failed")
self.msg.setText("Upload Failed, card name not valid")
self.msg.setStandardButtons(QMessageBox.Ok)
self.msg.exec()
| import requests
import urllib.request
import urllib.parse
import PIL
import re
import configparser
import json
from PIL import Image
from ebaysdk.trading import Connection as Trading
from ebaysdk.exception import ConnectionError
from yaml import load
from PyQt5.QtWidgets import QMessageBox
class EbaySeller:
def __init__(self):
self.api = Trading()
config = configparser.ConfigParser()
config.read('config.ini')
with open('details.yaml', 'r') as file:
self.yaml_config = load(file)
def upload_card(self, card_name, eu_card_price, us_card_price, card_id):
if us_card_price != 0:
card_price = us_card_price * 0.8
else:
card_price = eu_card_price
if card_price < 1:
card_price = 1
card_price = str(round(card_price, 2))
try:
card_image = 'http://gatherer.wizards.com/Handlers/Image.ashx?multiverseid=' + card_id + '&type=card'
except:
self.msg = QMessageBox()
self.msg.setWindowTitle("Upload Failed")
self.msg.setText("Upload Failed, wizards gatherer error")
self.msg.setStandardButtons(QMessageBox.Ok)
self.msg.exec()
urllib.request.urlretrieve(card_image, 'temp.jpg')
# Resize card
base_height = 500
img = Image.open('temp.jpg')
height_percent = (base_height / float(img.size[1]))
wsize = int((float(img.size[0]) * float(height_percent)))
img = img.resize((wsize, base_height), PIL.Image.ANTIALIAS)
img.save('temp.png')
# Upload to PictShare
files = {'file': open('temp.png', 'rb')}
try:
r = requests.post('https://pictshare.net/api/upload.php', files=files)
except:
self.msg = QMessageBox()
self.msg.setWindowTitle("Upload Failed")
self.msg.setText("Upload Failed, PictShare error")
self.msg.setStandardButtons(QMessageBox.Ok)
self.msg.exec()
print(r)
r = r.text
r = json.loads(r)
print(r)
r = r['url']
# Fix using regular expression, may not be needed at a later date
r = re.sub('\\.net', '.net/', r)
r = re.sub('\\.net//', '.net/', r)
print(r)
try:
image = self.api.execute('UploadSiteHostedPictures', {'ExternalPictureURL': r})
image = image.dict()
image = image['SiteHostedPictureDetails']['FullURL']
print(image)
# Upload to ebay
response = self.api.execute('AddFixedPriceItem', {
'Item': {'Title': card_name + ' MTG - NM/M', 'Description': card_name + ' MTG - NM/M',
'Quantity': '1', 'PictureDetails': {'PictureURL': image},
'ReturnPolicy': {'ReturnsAcceptedOption': 'ReturnsNotAccepted'}, 'DispatchTimeMax': '3',
'ConditionID': '1000', 'StartPrice': card_price, 'PostalCode': self.yaml_config["PostalCode"],
'Currency': self.yaml_config["Currency"],
'Country': 'GB', 'ListingDuration': 'Days_30', 'PaymentMethods': 'PayPal',
'PayPalEmailAddress': self.yaml_config["PayPalEmailAddress"],
'PrimaryCategory': {'CategoryID': '38292'},
'ShippingDetails': {'ShippingType': 'Flat',
'ShippingServiceOptions': {'ShippingServicePriority': '1',
'ShippingService': self.yaml_config[
"ShippingService"],
'ShippingServiceCost': '1'}}}})
print(response.dict())
print(response.reply)
self.msg = QMessageBox()
if response.reply.Ack == 'Failure':
self.msg.setWindowTitle("Upload Failed")
self.msg.setText("Upload Complete, please check log.txt")
self.msg.setStandardButtons(QMessageBox.Ok)
with open('log.txt', 'a+') as log_file:
log_file.write(response.reply)
else:
self.msg.setWindowTitle("Upload Complete")
self.msg.setText("Upload Complete, please check your ebay account to confirm")
self.msg.setStandardButtons(QMessageBox.Ok)
self.msg.exec()
except ConnectionError as e:
print(e)
print(e.response.dict())
def get_multiverse_id(self, name):
try:
name = re.sub(' ', '%20', name)
r = requests.get('https://api.scryfall.com/cards/named?exact=' + name)
r = json.loads(r.text)
return r['multiverse_ids'][0]
except:
self.msg = QMessageBox()
self.msg.setWindowTitle("Upload Failed")
self.msg.setText("Upload Failed, scryfall error")
self.msg.setStandardButtons(QMessageBox.Ok)
self.msg.exec()
def get_card_info_and_sell(self, name):
try:
multiverse_id = self.get_multiverse_id(name)
r = requests.get('http://api.cardsearch.nl/v1/prices?key=W00dw0rk$&mids[]=' + str(multiverse_id))
r = json.loads(r.text)
r = r[0]
card_name = r.get('name')
eu_card_price = r.get('price_normal')
us_card_price = r.get('us_normal')
card_set = r.get('set_id')
card_set_name = r.get('set_name')
card_id = r.get('multiverse_id')
# Display card info in CLI
print('Name: ' + card_name)
print('Set: ' + card_set)
print('Set name: ' + card_set_name)
print('Card ID: ' + str(card_id))
self.upload_card(card_name, eu_card_price, us_card_price, card_id)
except:
self.msg = QMessageBox()
self.msg.setWindowTitle("Upload Failed")
self.msg.setText("Upload Failed, card name not valid")
self.msg.setStandardButtons(QMessageBox.Ok)
self.msg.exec() | en | 0.87393 | # Resize card # Upload to PictShare # Fix using regular expression, may not be needed at a later date # Upload to ebay # Display card info in CLI | 2.744117 | 3 |
bot/exts/github/github.py | v1nam/gurkbot | 24 | 2887 | import typing
from bot.constants import BOT_REPO_URL
from discord import Embed
from discord.ext import commands
from discord.ext.commands.cooldowns import BucketType
from . import _issues, _profile, _source
class Github(commands.Cog):
"""
Github Category cog, which contains commands related to github.
Commands:
├ profile Fetches a user's GitHub information.
├ issue Command to retrieve issue(s) from a GitHub repository.
└ source Displays information about the bot's source code.
"""
def __init__(self, bot: commands.Bot) -> None:
self.bot = bot
@commands.group(name="github", aliases=("gh",), invoke_without_command=True)
async def github_group(self, ctx: commands.Context) -> None:
"""Commands for Github."""
await ctx.send_help(ctx.command)
@github_group.command(name="profile")
@commands.cooldown(1, 10, BucketType.user)
async def profile(self, ctx: commands.Context, username: str) -> None:
"""
Fetches a user's GitHub information.
Username is optional and sends the help command if not specified.
"""
github_profile = _profile.GithubInfo(self.bot.http_session)
embed = await github_profile.get_github_info(username)
await ctx.send(embed=embed)
@github_group.command(name="issue", aliases=("pr",))
async def issue(
self,
ctx: commands.Context,
numbers: commands.Greedy[int],
repository: typing.Optional[str] = None,
) -> None:
"""Command to retrieve issue(s) from a GitHub repository."""
github_issue = _issues.Issues(self.bot.http_session)
if not numbers:
raise commands.MissingRequiredArgument(ctx.command.clean_params["numbers"])
if repository is None:
user = "gurkult"
else:
user, _, repository = repository.rpartition("/")
if user == "":
user = "gurkult"
embed = await github_issue.issue(ctx.message.channel, numbers, repository, user)
await ctx.send(embed=embed)
@github_group.command(name="source", aliases=("src", "inspect"))
async def source_command(
self, ctx: commands.Context, *, source_item: typing.Optional[str] = None
) -> None:
"""Displays information about the bot's source code."""
if source_item is None:
embed = Embed(title="Gurkbot's GitHub Repository")
embed.add_field(name="Repository", value=f"[Go to GitHub]({BOT_REPO_URL})")
embed.set_thumbnail(url=self.bot.user.avatar_url)
await ctx.send(embed=embed)
return
elif not ctx.bot.get_command(source_item):
raise commands.BadArgument(
f"Unable to convert `{source_item}` to valid command or Cog."
)
github_source = _source.Source(self.bot.http_session, self.bot.user.avatar_url)
embed = await github_source.inspect(cmd=ctx.bot.get_command(source_item))
await ctx.send(embed=embed)
def setup(bot: commands.Bot) -> None:
"""Load the Github cog."""
bot.add_cog(Github(bot))
| import typing
from bot.constants import BOT_REPO_URL
from discord import Embed
from discord.ext import commands
from discord.ext.commands.cooldowns import BucketType
from . import _issues, _profile, _source
class Github(commands.Cog):
"""
Github Category cog, which contains commands related to github.
Commands:
├ profile Fetches a user's GitHub information.
├ issue Command to retrieve issue(s) from a GitHub repository.
└ source Displays information about the bot's source code.
"""
def __init__(self, bot: commands.Bot) -> None:
self.bot = bot
@commands.group(name="github", aliases=("gh",), invoke_without_command=True)
async def github_group(self, ctx: commands.Context) -> None:
"""Commands for Github."""
await ctx.send_help(ctx.command)
@github_group.command(name="profile")
@commands.cooldown(1, 10, BucketType.user)
async def profile(self, ctx: commands.Context, username: str) -> None:
"""
Fetches a user's GitHub information.
Username is optional and sends the help command if not specified.
"""
github_profile = _profile.GithubInfo(self.bot.http_session)
embed = await github_profile.get_github_info(username)
await ctx.send(embed=embed)
@github_group.command(name="issue", aliases=("pr",))
async def issue(
self,
ctx: commands.Context,
numbers: commands.Greedy[int],
repository: typing.Optional[str] = None,
) -> None:
"""Command to retrieve issue(s) from a GitHub repository."""
github_issue = _issues.Issues(self.bot.http_session)
if not numbers:
raise commands.MissingRequiredArgument(ctx.command.clean_params["numbers"])
if repository is None:
user = "gurkult"
else:
user, _, repository = repository.rpartition("/")
if user == "":
user = "gurkult"
embed = await github_issue.issue(ctx.message.channel, numbers, repository, user)
await ctx.send(embed=embed)
@github_group.command(name="source", aliases=("src", "inspect"))
async def source_command(
self, ctx: commands.Context, *, source_item: typing.Optional[str] = None
) -> None:
"""Displays information about the bot's source code."""
if source_item is None:
embed = Embed(title="Gurkbot's GitHub Repository")
embed.add_field(name="Repository", value=f"[Go to GitHub]({BOT_REPO_URL})")
embed.set_thumbnail(url=self.bot.user.avatar_url)
await ctx.send(embed=embed)
return
elif not ctx.bot.get_command(source_item):
raise commands.BadArgument(
f"Unable to convert `{source_item}` to valid command or Cog."
)
github_source = _source.Source(self.bot.http_session, self.bot.user.avatar_url)
embed = await github_source.inspect(cmd=ctx.bot.get_command(source_item))
await ctx.send(embed=embed)
def setup(bot: commands.Bot) -> None:
"""Load the Github cog."""
bot.add_cog(Github(bot))
| en | 0.795427 | Github Category cog, which contains commands related to github. Commands: ├ profile Fetches a user's GitHub information. ├ issue Command to retrieve issue(s) from a GitHub repository. └ source Displays information about the bot's source code. Commands for Github. Fetches a user's GitHub information. Username is optional and sends the help command if not specified. Command to retrieve issue(s) from a GitHub repository. Displays information about the bot's source code. Load the Github cog. | 2.681815 | 3 |
log/slack_sender.py | SmashKs/BarBarian | 0 | 2888 | <gh_stars>0
from slackclient import SlackClient
from external import SLACK_API_KEY
class SlackBot:
API_CHAT_MSG = 'chat.postMessage'
BOT_NAME = 'News Bot'
DEFAULT_CHANNEL = 'news_notification'
def __new__(cls, *p, **k):
if '_the_instance' not in cls.__dict__:
cls._the_instance = object.__new__(cls)
return cls._the_instance
def __init__(self):
self.__slack_client = SlackClient(SLACK_API_KEY)
def send_msg_to(self, text='', channel=DEFAULT_CHANNEL):
self.__slack_client.api_call(SlackBot.API_CHAT_MSG,
username=SlackBot.BOT_NAME,
channel=channel,
text=text)
def send_formatted_msg_to(self, text='', channel=DEFAULT_CHANNEL):
self.__slack_client.api_call(SlackBot.API_CHAT_MSG,
username=SlackBot.BOT_NAME,
mrkdwn=True,
channel=channel,
text=text)
if __name__ == '__main__':
SlackBot().send_msg_to('hello world!!')
| from slackclient import SlackClient
from external import SLACK_API_KEY
class SlackBot:
API_CHAT_MSG = 'chat.postMessage'
BOT_NAME = 'News Bot'
DEFAULT_CHANNEL = 'news_notification'
def __new__(cls, *p, **k):
if '_the_instance' not in cls.__dict__:
cls._the_instance = object.__new__(cls)
return cls._the_instance
def __init__(self):
self.__slack_client = SlackClient(SLACK_API_KEY)
def send_msg_to(self, text='', channel=DEFAULT_CHANNEL):
self.__slack_client.api_call(SlackBot.API_CHAT_MSG,
username=SlackBot.BOT_NAME,
channel=channel,
text=text)
def send_formatted_msg_to(self, text='', channel=DEFAULT_CHANNEL):
self.__slack_client.api_call(SlackBot.API_CHAT_MSG,
username=SlackBot.BOT_NAME,
mrkdwn=True,
channel=channel,
text=text)
if __name__ == '__main__':
SlackBot().send_msg_to('hello world!!') | none | 1 | 2.625916 | 3 |
|
src/pytezos/block/forge.py | miracle2k/pytezos | 98 | 2889 | from typing import Any, Dict, List, Tuple
from pytezos.michelson.forge import forge_array, forge_base58, optimize_timestamp
def bump_fitness(fitness: Tuple[str, str]) -> Tuple[str, str]:
if len(fitness) == 0:
major = 0
minor = 1
else:
major = int.from_bytes(bytes.fromhex(fitness[0]), 'big')
minor = int.from_bytes(bytes.fromhex(fitness[1]), 'big') + 1
return major.to_bytes(1, 'big').hex(), minor.to_bytes(8, 'big').hex()
def forge_int_fixed(value: int, length: int) -> bytes:
return value.to_bytes(length, 'big')
def forge_command(command: str) -> bytes:
if command == 'activate':
return b'\x00'
raise NotImplementedError(command)
def forge_fitness(fitness: List[str]) -> bytes:
return forge_array(b''.join(map(lambda x: forge_array(bytes.fromhex(x)), fitness)))
def forge_priority(priority: int) -> bytes:
return priority.to_bytes(2, 'big')
def forge_content(content: Dict[str, Any]) -> bytes:
res = b''
res += forge_command(content['command'])
res += forge_base58(content['hash'])
res += forge_fitness(content['fitness'])
res += bytes.fromhex(content['protocol_parameters'])
return res
def forge_protocol_data(protocol_data: Dict[str, Any]) -> bytes:
res = b''
if protocol_data.get('content'):
res += forge_content(protocol_data['content'])
else:
res += forge_priority(protocol_data['priority'])
res += bytes.fromhex(protocol_data['proof_of_work_nonce'])
if protocol_data.get('seed_nonce_hash'):
res += b'\xFF'
res += forge_base58(protocol_data['seed_nonce_hash'])
else:
res += b'\x00'
res += b'\xFF' if protocol_data['liquidity_baking_escape_vote'] else b'\x00'
return res
def forge_block_header(shell_header: Dict[str, Any]) -> bytes:
res = forge_int_fixed(shell_header['level'], 4)
res += forge_int_fixed(shell_header['proto'], 1)
res += forge_base58(shell_header['predecessor'])
res += forge_int_fixed(optimize_timestamp(shell_header['timestamp']), 8)
res += forge_int_fixed(shell_header['validation_pass'], 1)
res += forge_base58(shell_header['operations_hash'])
res += forge_fitness(shell_header['fitness'])
res += forge_base58(shell_header['context'])
res += bytes.fromhex(shell_header['protocol_data'])
return res
| from typing import Any, Dict, List, Tuple
from pytezos.michelson.forge import forge_array, forge_base58, optimize_timestamp
def bump_fitness(fitness: Tuple[str, str]) -> Tuple[str, str]:
if len(fitness) == 0:
major = 0
minor = 1
else:
major = int.from_bytes(bytes.fromhex(fitness[0]), 'big')
minor = int.from_bytes(bytes.fromhex(fitness[1]), 'big') + 1
return major.to_bytes(1, 'big').hex(), minor.to_bytes(8, 'big').hex()
def forge_int_fixed(value: int, length: int) -> bytes:
return value.to_bytes(length, 'big')
def forge_command(command: str) -> bytes:
if command == 'activate':
return b'\x00'
raise NotImplementedError(command)
def forge_fitness(fitness: List[str]) -> bytes:
return forge_array(b''.join(map(lambda x: forge_array(bytes.fromhex(x)), fitness)))
def forge_priority(priority: int) -> bytes:
return priority.to_bytes(2, 'big')
def forge_content(content: Dict[str, Any]) -> bytes:
res = b''
res += forge_command(content['command'])
res += forge_base58(content['hash'])
res += forge_fitness(content['fitness'])
res += bytes.fromhex(content['protocol_parameters'])
return res
def forge_protocol_data(protocol_data: Dict[str, Any]) -> bytes:
res = b''
if protocol_data.get('content'):
res += forge_content(protocol_data['content'])
else:
res += forge_priority(protocol_data['priority'])
res += bytes.fromhex(protocol_data['proof_of_work_nonce'])
if protocol_data.get('seed_nonce_hash'):
res += b'\xFF'
res += forge_base58(protocol_data['seed_nonce_hash'])
else:
res += b'\x00'
res += b'\xFF' if protocol_data['liquidity_baking_escape_vote'] else b'\x00'
return res
def forge_block_header(shell_header: Dict[str, Any]) -> bytes:
res = forge_int_fixed(shell_header['level'], 4)
res += forge_int_fixed(shell_header['proto'], 1)
res += forge_base58(shell_header['predecessor'])
res += forge_int_fixed(optimize_timestamp(shell_header['timestamp']), 8)
res += forge_int_fixed(shell_header['validation_pass'], 1)
res += forge_base58(shell_header['operations_hash'])
res += forge_fitness(shell_header['fitness'])
res += forge_base58(shell_header['context'])
res += bytes.fromhex(shell_header['protocol_data'])
return res
| none | 1 | 2.29234 | 2 |
|
python/paddle/fluid/tests/unittests/test_roi_pool_op.py | jichangjichang/Paddle | 9 | 2890 | # Copyright (c) 2018 PaddlePaddle Authors. All Rights Reserved.
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS,
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
# See the License for the specific language governing permissions and
# limitations under the License.
from __future__ import print_function
import unittest
import numpy as np
import math
import sys
import paddle.compat as cpt
from op_test import OpTest
class TestROIPoolOp(OpTest):
def set_data(self):
self.init_test_case()
self.make_rois()
self.calc_roi_pool()
self.inputs = {'X': self.x, 'ROIs': (self.rois[:, 1:5], self.rois_lod)}
self.attrs = {
'spatial_scale': self.spatial_scale,
'pooled_height': self.pooled_height,
'pooled_width': self.pooled_width
}
self.outputs = {'Out': self.outs, 'Argmax': self.argmaxes}
def init_test_case(self):
self.batch_size = 3
self.channels = 3
self.height = 6
self.width = 4
# n, c, h, w
self.x_dim = (self.batch_size, self.channels, self.height, self.width)
self.spatial_scale = 1.0 / 4.0
self.pooled_height = 2
self.pooled_width = 2
self.x = np.random.random(self.x_dim).astype('float32')
def calc_roi_pool(self):
out_data = np.zeros((self.rois_num, self.channels, self.pooled_height,
self.pooled_width))
argmax_data = np.zeros((self.rois_num, self.channels,
self.pooled_height, self.pooled_width))
for i in range(self.rois_num):
roi = self.rois[i]
roi_batch_id = roi[0]
roi_start_w = int(cpt.round(roi[1] * self.spatial_scale))
roi_start_h = int(cpt.round(roi[2] * self.spatial_scale))
roi_end_w = int(cpt.round(roi[3] * self.spatial_scale))
roi_end_h = int(cpt.round(roi[4] * self.spatial_scale))
roi_height = int(max(roi_end_h - roi_start_h + 1, 1))
roi_width = int(max(roi_end_w - roi_start_w + 1, 1))
x_i = self.x[roi_batch_id]
bin_size_h = float(roi_height) / float(self.pooled_height)
bin_size_w = float(roi_width) / float(self.pooled_width)
for c in range(self.channels):
for ph in range(self.pooled_height):
for pw in range(self.pooled_width):
hstart = int(math.floor(ph * bin_size_h))
wstart = int(math.floor(pw * bin_size_w))
hend = int(math.ceil((ph + 1) * bin_size_h))
wend = int(math.ceil((pw + 1) * bin_size_w))
hstart = min(max(hstart + roi_start_h, 0), self.height)
hend = min(max(hend + roi_start_h, 0), self.height)
wstart = min(max(wstart + roi_start_w, 0), self.width)
wend = min(max(wend + roi_start_w, 0), self.width)
is_empty = (hend <= hstart) or (wend <= wstart)
if is_empty:
out_data[i, c, ph, pw] = 0
else:
out_data[i, c, ph, pw] = -sys.float_info.max
argmax_data[i, c, ph, pw] = -1
for h in range(hstart, hend):
for w in range(wstart, wend):
if x_i[c, h, w] > out_data[i, c, ph, pw]:
out_data[i, c, ph, pw] = x_i[c, h, w]
argmax_data[i, c, ph,
pw] = h * self.width + w
self.outs = out_data.astype('float32')
self.argmaxes = argmax_data.astype('int64')
def make_rois(self):
rois = []
self.rois_lod = [[]]
for bno in range(self.batch_size):
self.rois_lod[0].append(bno + 1)
for i in range(bno + 1):
x1 = np.random.random_integers(
0, self.width // self.spatial_scale - self.pooled_width)
y1 = np.random.random_integers(
0, self.height // self.spatial_scale - self.pooled_height)
x2 = np.random.random_integers(x1 + self.pooled_width,
self.width // self.spatial_scale)
y2 = np.random.random_integers(
y1 + self.pooled_height, self.height // self.spatial_scale)
roi = [bno, x1, y1, x2, y2]
rois.append(roi)
self.rois_num = len(rois)
self.rois = np.array(rois).astype("int64")
def setUp(self):
self.op_type = "roi_pool"
self.set_data()
def test_check_output(self):
self.check_output()
def test_check_grad(self):
self.check_grad(['X'], 'Out')
if __name__ == '__main__':
unittest.main()
| # Copyright (c) 2018 PaddlePaddle Authors. All Rights Reserved.
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS,
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
# See the License for the specific language governing permissions and
# limitations under the License.
from __future__ import print_function
import unittest
import numpy as np
import math
import sys
import paddle.compat as cpt
from op_test import OpTest
class TestROIPoolOp(OpTest):
def set_data(self):
self.init_test_case()
self.make_rois()
self.calc_roi_pool()
self.inputs = {'X': self.x, 'ROIs': (self.rois[:, 1:5], self.rois_lod)}
self.attrs = {
'spatial_scale': self.spatial_scale,
'pooled_height': self.pooled_height,
'pooled_width': self.pooled_width
}
self.outputs = {'Out': self.outs, 'Argmax': self.argmaxes}
def init_test_case(self):
self.batch_size = 3
self.channels = 3
self.height = 6
self.width = 4
# n, c, h, w
self.x_dim = (self.batch_size, self.channels, self.height, self.width)
self.spatial_scale = 1.0 / 4.0
self.pooled_height = 2
self.pooled_width = 2
self.x = np.random.random(self.x_dim).astype('float32')
def calc_roi_pool(self):
out_data = np.zeros((self.rois_num, self.channels, self.pooled_height,
self.pooled_width))
argmax_data = np.zeros((self.rois_num, self.channels,
self.pooled_height, self.pooled_width))
for i in range(self.rois_num):
roi = self.rois[i]
roi_batch_id = roi[0]
roi_start_w = int(cpt.round(roi[1] * self.spatial_scale))
roi_start_h = int(cpt.round(roi[2] * self.spatial_scale))
roi_end_w = int(cpt.round(roi[3] * self.spatial_scale))
roi_end_h = int(cpt.round(roi[4] * self.spatial_scale))
roi_height = int(max(roi_end_h - roi_start_h + 1, 1))
roi_width = int(max(roi_end_w - roi_start_w + 1, 1))
x_i = self.x[roi_batch_id]
bin_size_h = float(roi_height) / float(self.pooled_height)
bin_size_w = float(roi_width) / float(self.pooled_width)
for c in range(self.channels):
for ph in range(self.pooled_height):
for pw in range(self.pooled_width):
hstart = int(math.floor(ph * bin_size_h))
wstart = int(math.floor(pw * bin_size_w))
hend = int(math.ceil((ph + 1) * bin_size_h))
wend = int(math.ceil((pw + 1) * bin_size_w))
hstart = min(max(hstart + roi_start_h, 0), self.height)
hend = min(max(hend + roi_start_h, 0), self.height)
wstart = min(max(wstart + roi_start_w, 0), self.width)
wend = min(max(wend + roi_start_w, 0), self.width)
is_empty = (hend <= hstart) or (wend <= wstart)
if is_empty:
out_data[i, c, ph, pw] = 0
else:
out_data[i, c, ph, pw] = -sys.float_info.max
argmax_data[i, c, ph, pw] = -1
for h in range(hstart, hend):
for w in range(wstart, wend):
if x_i[c, h, w] > out_data[i, c, ph, pw]:
out_data[i, c, ph, pw] = x_i[c, h, w]
argmax_data[i, c, ph,
pw] = h * self.width + w
self.outs = out_data.astype('float32')
self.argmaxes = argmax_data.astype('int64')
def make_rois(self):
rois = []
self.rois_lod = [[]]
for bno in range(self.batch_size):
self.rois_lod[0].append(bno + 1)
for i in range(bno + 1):
x1 = np.random.random_integers(
0, self.width // self.spatial_scale - self.pooled_width)
y1 = np.random.random_integers(
0, self.height // self.spatial_scale - self.pooled_height)
x2 = np.random.random_integers(x1 + self.pooled_width,
self.width // self.spatial_scale)
y2 = np.random.random_integers(
y1 + self.pooled_height, self.height // self.spatial_scale)
roi = [bno, x1, y1, x2, y2]
rois.append(roi)
self.rois_num = len(rois)
self.rois = np.array(rois).astype("int64")
def setUp(self):
self.op_type = "roi_pool"
self.set_data()
def test_check_output(self):
self.check_output()
def test_check_grad(self):
self.check_grad(['X'], 'Out')
if __name__ == '__main__':
unittest.main()
| en | 0.854024 | # Copyright (c) 2018 PaddlePaddle Authors. All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # n, c, h, w | 1.950215 | 2 |
testproject/testapp/tests/__init__.py | movermeyer/django-firestone | 1 | 2891 | <reponame>movermeyer/django-firestone
from test_proxy import *
from test_serializers import *
from test_deserializers import *
from test_exceptions import *
from test_authentication import *
from test_whole_flow import *
from test_handlers_metaclass_magic import *
from test_handlers_serialize_to_python import *
from test_handlers_is_method_allowed import *
from test_handlers_data_control import *
from test_handlers_package import *
from test_handlers_finalize_pending import *
from test_handlers_cleanse_body import *
from test_handlers_validate import *
from test_handlers_clean_models import *
from test_handlers_get import *
from test_handlers_is_catastrophic import *
from test_handlers_post import *
from test_handlers_put import *
from test_handlers_delete import *
from test_handlers_patch_response import *
from test_handlers_authentication_hook import *
from test_handlers_filter_data import *
from test_handlers_order import *
from test_handlers_order_data import *
from test_handlers_paginate import *
from test_handlers_paginate_data import *
from test_handlers_inject_data_hook import *
from test_handlers_handle_exception import *
from test_handlers_deserialize_body import *
| from test_proxy import *
from test_serializers import *
from test_deserializers import *
from test_exceptions import *
from test_authentication import *
from test_whole_flow import *
from test_handlers_metaclass_magic import *
from test_handlers_serialize_to_python import *
from test_handlers_is_method_allowed import *
from test_handlers_data_control import *
from test_handlers_package import *
from test_handlers_finalize_pending import *
from test_handlers_cleanse_body import *
from test_handlers_validate import *
from test_handlers_clean_models import *
from test_handlers_get import *
from test_handlers_is_catastrophic import *
from test_handlers_post import *
from test_handlers_put import *
from test_handlers_delete import *
from test_handlers_patch_response import *
from test_handlers_authentication_hook import *
from test_handlers_filter_data import *
from test_handlers_order import *
from test_handlers_order_data import *
from test_handlers_paginate import *
from test_handlers_paginate_data import *
from test_handlers_inject_data_hook import *
from test_handlers_handle_exception import *
from test_handlers_deserialize_body import * | none | 1 | 1.567973 | 2 |
|
Day20.py | SheepiCagio/Advent-of-Code-2021 | 0 | 2892 | <gh_stars>0
import numpy as np
raw = open("inputs/20.txt","r").readlines()
input_array= [(i.replace('\n', '').replace('.','0').replace('#', '1')) for i in raw]
test_raw = open("inputs/20_test.txt","r").readlines()
test_array= [(i.replace('\n', '').replace('.','0').replace('#', '1')) for i in test_raw]
def addLayerZero(grid):
#if sum(np.asarray(grid)[:,0]) > 0:
grid = np.hstack((np.zeros(len(grid), dtype=int)[:, np.newaxis],grid))
#if sum(np.asarray(grid)[0,:]) > 0:
grid = np.vstack((np.zeros(len(grid[0]), dtype=int)[np.newaxis,:],grid))
# if sum(np.asarray(grid)[:,-1]) > 0:
grid = np.hstack((grid,np.zeros(len(grid), dtype=int)[:, np.newaxis]))
# if sum(np.asarray(grid)[-1,:]) > 0:
grid = np.vstack((grid, np.zeros(len(grid[0]), dtype=int)[np.newaxis,:]))
return grid
def addLayerOnes(grid):
#if sum(np.asarray(grid)[:,0]) > 0:
grid = np.hstack((np.ones(len(grid), dtype=int)[:, np.newaxis],grid))
#if sum(np.asarray(grid)[0,:]) > 0:
grid = np.vstack((np.ones(len(grid[0]), dtype=int)[np.newaxis,:],grid))
# if sum(np.asarray(grid)[:,-1]) > 0:
grid = np.hstack((grid,np.ones(len(grid), dtype=int)[:, np.newaxis]))
# if sum(np.asarray(grid)[-1,:]) > 0:
grid = np.vstack((grid, np.ones(len(grid[0]), dtype=int)[np.newaxis,:]))
return grid
def pictureEnhancer(input_array,iter):
splitvalue = False
index_string = ''
grid = []
for i in input_array:
if i == '':
splitvalue = True
continue
if not splitvalue:
index_string += i
else:
grid.append(list(i))
grid = [[int(i) for i in row] for row in grid]
for x in range(1,iter+1):
grid = enhancer(grid, index_string,x)
print('The number of lit pixels is:', sum(sum(grid)))
def enhancer(grid, index_string,iter):
print(iter)
if iter == 1 or index_string[0] == '0' or (iter % 2 == 1 and index_string[511] == '0'):
grid = addLayerZero(grid)
output_grid = np.zeros((len(grid),len(grid[0])),dtype=int)
grid = addLayerZero(grid)
elif (index_string[0] == '1' and index_string [511] == '1') or (iter % 2 == 0 and index_string[511] == '0'):
grid = addLayerOnes(grid)
output_grid = np.ones((len(grid),len(grid[0])),dtype=int)
grid = addLayerOnes(grid)
for i in range(1,len(grid)-1):
for j in range(1, len(grid[i])-1):
binStr = ''
for k in range(-1,2):
for l in range(-1,2):
binStr += str(grid[i+k][j+l])
output_grid[i-1][j-1] = index_string[int(binStr,2)]
return output_grid
#pictureEnhancer(test_array,2)
#pictureEnhancer(input_array,2)
pictureEnhancer(test_array,50)
pictureEnhancer(input_array,50) | import numpy as np
raw = open("inputs/20.txt","r").readlines()
input_array= [(i.replace('\n', '').replace('.','0').replace('#', '1')) for i in raw]
test_raw = open("inputs/20_test.txt","r").readlines()
test_array= [(i.replace('\n', '').replace('.','0').replace('#', '1')) for i in test_raw]
def addLayerZero(grid):
#if sum(np.asarray(grid)[:,0]) > 0:
grid = np.hstack((np.zeros(len(grid), dtype=int)[:, np.newaxis],grid))
#if sum(np.asarray(grid)[0,:]) > 0:
grid = np.vstack((np.zeros(len(grid[0]), dtype=int)[np.newaxis,:],grid))
# if sum(np.asarray(grid)[:,-1]) > 0:
grid = np.hstack((grid,np.zeros(len(grid), dtype=int)[:, np.newaxis]))
# if sum(np.asarray(grid)[-1,:]) > 0:
grid = np.vstack((grid, np.zeros(len(grid[0]), dtype=int)[np.newaxis,:]))
return grid
def addLayerOnes(grid):
#if sum(np.asarray(grid)[:,0]) > 0:
grid = np.hstack((np.ones(len(grid), dtype=int)[:, np.newaxis],grid))
#if sum(np.asarray(grid)[0,:]) > 0:
grid = np.vstack((np.ones(len(grid[0]), dtype=int)[np.newaxis,:],grid))
# if sum(np.asarray(grid)[:,-1]) > 0:
grid = np.hstack((grid,np.ones(len(grid), dtype=int)[:, np.newaxis]))
# if sum(np.asarray(grid)[-1,:]) > 0:
grid = np.vstack((grid, np.ones(len(grid[0]), dtype=int)[np.newaxis,:]))
return grid
def pictureEnhancer(input_array,iter):
splitvalue = False
index_string = ''
grid = []
for i in input_array:
if i == '':
splitvalue = True
continue
if not splitvalue:
index_string += i
else:
grid.append(list(i))
grid = [[int(i) for i in row] for row in grid]
for x in range(1,iter+1):
grid = enhancer(grid, index_string,x)
print('The number of lit pixels is:', sum(sum(grid)))
def enhancer(grid, index_string,iter):
print(iter)
if iter == 1 or index_string[0] == '0' or (iter % 2 == 1 and index_string[511] == '0'):
grid = addLayerZero(grid)
output_grid = np.zeros((len(grid),len(grid[0])),dtype=int)
grid = addLayerZero(grid)
elif (index_string[0] == '1' and index_string [511] == '1') or (iter % 2 == 0 and index_string[511] == '0'):
grid = addLayerOnes(grid)
output_grid = np.ones((len(grid),len(grid[0])),dtype=int)
grid = addLayerOnes(grid)
for i in range(1,len(grid)-1):
for j in range(1, len(grid[i])-1):
binStr = ''
for k in range(-1,2):
for l in range(-1,2):
binStr += str(grid[i+k][j+l])
output_grid[i-1][j-1] = index_string[int(binStr,2)]
return output_grid
#pictureEnhancer(test_array,2)
#pictureEnhancer(input_array,2)
pictureEnhancer(test_array,50)
pictureEnhancer(input_array,50) | pl | 0.181603 | #if sum(np.asarray(grid)[:,0]) > 0: #if sum(np.asarray(grid)[0,:]) > 0: # if sum(np.asarray(grid)[:,-1]) > 0: # if sum(np.asarray(grid)[-1,:]) > 0: #if sum(np.asarray(grid)[:,0]) > 0: #if sum(np.asarray(grid)[0,:]) > 0: # if sum(np.asarray(grid)[:,-1]) > 0: # if sum(np.asarray(grid)[-1,:]) > 0: #pictureEnhancer(test_array,2) #pictureEnhancer(input_array,2) | 2.710834 | 3 |
questions/53349623/main.py | sesu089/stackoverflow | 302 | 2893 | <gh_stars>100-1000
import sys
from PyQt5 import QtCore, QtGui, QtWidgets
class Demo(QtWidgets.QWidget):
def __init__(self):
super(Demo, self).__init__()
self.button = QtWidgets.QPushButton()
self.label = QtWidgets.QLabel(alignment=QtCore.Qt.AlignCenter)
self.combo = QtWidgets.QComboBox(self)
self.combo.currentIndexChanged.connect(self.change_func)
self.trans = QtCore.QTranslator(self)
self.v_layout = QtWidgets.QVBoxLayout(self)
self.v_layout.addWidget(self.combo)
self.v_layout.addWidget(self.button)
self.v_layout.addWidget(self.label)
options = ([('English', ''), ('français', 'eng-fr' ), ('中文', 'eng-chs'), ])
for i, (text, lang) in enumerate(options):
self.combo.addItem(text)
self.combo.setItemData(i, lang)
self.retranslateUi()
@QtCore.pyqtSlot(int)
def change_func(self, index):
data = self.combo.itemData(index)
if data:
self.trans.load(data)
QtWidgets.QApplication.instance().installTranslator(self.trans)
else:
QtWidgets.QApplication.instance().removeTranslator(self.trans)
def changeEvent(self, event):
if event.type() == QtCore.QEvent.LanguageChange:
self.retranslateUi()
super(Demo, self).changeEvent(event)
def retranslateUi(self):
self.button.setText(QtWidgets.QApplication.translate('Demo', 'Start'))
self.label.setText(QtWidgets.QApplication.translate('Demo', 'Hello, World'))
if __name__ == '__main__':
app = QtWidgets.QApplication(sys.argv)
demo = Demo()
demo.show()
sys.exit(app.exec_()) | import sys
from PyQt5 import QtCore, QtGui, QtWidgets
class Demo(QtWidgets.QWidget):
def __init__(self):
super(Demo, self).__init__()
self.button = QtWidgets.QPushButton()
self.label = QtWidgets.QLabel(alignment=QtCore.Qt.AlignCenter)
self.combo = QtWidgets.QComboBox(self)
self.combo.currentIndexChanged.connect(self.change_func)
self.trans = QtCore.QTranslator(self)
self.v_layout = QtWidgets.QVBoxLayout(self)
self.v_layout.addWidget(self.combo)
self.v_layout.addWidget(self.button)
self.v_layout.addWidget(self.label)
options = ([('English', ''), ('français', 'eng-fr' ), ('中文', 'eng-chs'), ])
for i, (text, lang) in enumerate(options):
self.combo.addItem(text)
self.combo.setItemData(i, lang)
self.retranslateUi()
@QtCore.pyqtSlot(int)
def change_func(self, index):
data = self.combo.itemData(index)
if data:
self.trans.load(data)
QtWidgets.QApplication.instance().installTranslator(self.trans)
else:
QtWidgets.QApplication.instance().removeTranslator(self.trans)
def changeEvent(self, event):
if event.type() == QtCore.QEvent.LanguageChange:
self.retranslateUi()
super(Demo, self).changeEvent(event)
def retranslateUi(self):
self.button.setText(QtWidgets.QApplication.translate('Demo', 'Start'))
self.label.setText(QtWidgets.QApplication.translate('Demo', 'Hello, World'))
if __name__ == '__main__':
app = QtWidgets.QApplication(sys.argv)
demo = Demo()
demo.show()
sys.exit(app.exec_()) | none | 1 | 2.491554 | 2 |
|
tests/test_error_descriptions_from_raises.py | iterait/apistrap | 6 | 2894 | import pytest
from apistrap.flask import FlaskApistrap
from apistrap.schemas import ErrorResponse
@pytest.fixture()
def app_with_raises(app):
oapi = FlaskApistrap()
@app.route("/", methods=["GET"])
def view():
"""
Something something.
:raises KeyError: KeyError description
"""
oapi.init_app(app)
@pytest.fixture()
def app_with_raises_and_handler(app):
oapi = FlaskApistrap()
oapi.add_error_handler(KeyError, 515, lambda e: ErrorResponse())
@app.route("/", methods=["GET"])
def view():
"""
Something something.
:raises KeyError: KeyError description
"""
oapi.init_app(app)
def test_error_descriptions_from_raises(app_with_raises, client):
response = client.get("/spec.json")
assert response.json["paths"]["/"]["get"]["responses"] == {
"500": {
"description": "KeyError description",
"content": {
"application/json": {
"schema": {
"$ref": "#/components/schemas/ErrorResponse"
}
}
}
}
}
def test_http_code_from_handler(app_with_raises_and_handler, client):
response = client.get("/spec.json")
assert response.json["paths"]["/"]["get"]["responses"] == {
"515": {
"description": "KeyError description",
"content": {
"application/json": {
"schema": {
"$ref": "#/components/schemas/ErrorResponse"
}
}
}
}
}
| import pytest
from apistrap.flask import FlaskApistrap
from apistrap.schemas import ErrorResponse
@pytest.fixture()
def app_with_raises(app):
oapi = FlaskApistrap()
@app.route("/", methods=["GET"])
def view():
"""
Something something.
:raises KeyError: KeyError description
"""
oapi.init_app(app)
@pytest.fixture()
def app_with_raises_and_handler(app):
oapi = FlaskApistrap()
oapi.add_error_handler(KeyError, 515, lambda e: ErrorResponse())
@app.route("/", methods=["GET"])
def view():
"""
Something something.
:raises KeyError: KeyError description
"""
oapi.init_app(app)
def test_error_descriptions_from_raises(app_with_raises, client):
response = client.get("/spec.json")
assert response.json["paths"]["/"]["get"]["responses"] == {
"500": {
"description": "KeyError description",
"content": {
"application/json": {
"schema": {
"$ref": "#/components/schemas/ErrorResponse"
}
}
}
}
}
def test_http_code_from_handler(app_with_raises_and_handler, client):
response = client.get("/spec.json")
assert response.json["paths"]["/"]["get"]["responses"] == {
"515": {
"description": "KeyError description",
"content": {
"application/json": {
"schema": {
"$ref": "#/components/schemas/ErrorResponse"
}
}
}
}
}
| en | 0.508582 | Something something. :raises KeyError: KeyError description Something something. :raises KeyError: KeyError description | 2.437352 | 2 |
projects/api/UsersApi.py | chamathshashika/projects-python-wrappers | 0 | 2895 | <reponame>chamathshashika/projects-python-wrappers
#$Id$
from projects.util.ZohoHttpClient import ZohoHttpClient
from projects.api.Api import Api
from projects.parser.UsersParser import UsersParser
base_url = Api().base_url
zoho_http_client = ZohoHttpClient()
parser = UsersParser()
class UsersApi:
"""Users Api class is used to
1.Get all the users in the given project.
"""
def __init__(self, authtoken, portal_id):
"""Initialize Users api using user's authtoken and portal id.
Args:
authtoken(str): User's authtoken.
portal_id(str): User's portal id.
"""
self.details = {
'authtoken': authtoken
}
self.portal_id = portal_id
def get_users(self, project_id):
"""Get all the users in the given project.
Args:
project_id(long): Project id.
Returns:
list of instance: List of users object.
"""
url = base_url + 'portal/' + str(self.portal_id) + '/projects/' + str(project_id) + '/users/'
response = zoho_http_client.get(url, self.details)
return parser.get_users(response)
| #$Id$
from projects.util.ZohoHttpClient import ZohoHttpClient
from projects.api.Api import Api
from projects.parser.UsersParser import UsersParser
base_url = Api().base_url
zoho_http_client = ZohoHttpClient()
parser = UsersParser()
class UsersApi:
"""Users Api class is used to
1.Get all the users in the given project.
"""
def __init__(self, authtoken, portal_id):
"""Initialize Users api using user's authtoken and portal id.
Args:
authtoken(str): User's authtoken.
portal_id(str): User's portal id.
"""
self.details = {
'authtoken': authtoken
}
self.portal_id = portal_id
def get_users(self, project_id):
"""Get all the users in the given project.
Args:
project_id(long): Project id.
Returns:
list of instance: List of users object.
"""
url = base_url + 'portal/' + str(self.portal_id) + '/projects/' + str(project_id) + '/users/'
response = zoho_http_client.get(url, self.details)
return parser.get_users(response) | en | 0.678647 | #$Id$ Users Api class is used to 1.Get all the users in the given project. Initialize Users api using user's authtoken and portal id. Args: authtoken(str): User's authtoken. portal_id(str): User's portal id. Get all the users in the given project. Args: project_id(long): Project id. Returns: list of instance: List of users object. | 2.814191 | 3 |
useless/tuck_arms.py | leader1313/Baxter_teleoperation_system | 0 | 2896 | #!/usr/bin/env python
# Copyright (c) 2013-2015, Rethink Robotics
# All rights reserved.
#
# Redistribution and use in source and binary forms, with or without
# modification, are permitted provided that the following conditions are met:
#
# 1. Redistributions of source code must retain the above copyright notice,
# this list of conditions and the following disclaimer.
# 2. Redistributions in binary form must reproduce the above copyright
# notice, this list of conditions and the following disclaimer in the
# documentation and/or other materials provided with the distribution.
# 3. Neither the name of the Rethink Robotics nor the names of its
# contributors may be used to endorse or promote products derived from
# this software without specific prior written permission.
#
# THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS"
# AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE
# IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE
# ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE
# LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR
# CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF
# SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS
# INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN
# CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE)
# ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE
# POSSIBILITY OF SUCH DAMAGE.
"""
Tool to tuck/untuck Baxter's arms to/from the shipping pose
"""
import argparse
from copy import deepcopy
import rospy
from std_msgs.msg import (
Empty,
Bool,
)
import baxter_interface
from baxter_core_msgs.msg import (
CollisionAvoidanceState,
)
from baxter_interface import CHECK_VERSION
class Tuck(object):
def __init__(self, tuck_cmd):
self._done = False
self._limbs = ('left', 'right')
self._arms = {
'left': baxter_interface.Limb('left'),
'right': baxter_interface.Limb('right'),
}
self._tuck = tuck_cmd
self._tuck_rate = rospy.Rate(20.0) # Hz
self._tuck_threshold = 0.2 # radians
self._peak_angle = -1.6 # radians
self._arm_state = {
'tuck': {'left': 'none', 'right': 'none'},
'collide': {'left': False, 'right': False},
'flipped': {'left': False, 'right': False}
}
self._joint_moves = {
'tuck': {
'left': [-1.0, -2.07, 3.0, 2.55, 0.0, 0.01, 0.0],
'right': [1.0, -2.07, -3.0, 2.55, -0.0, 0.01, 0.0]
},
'untuck': {
'left': [-0.08, -1.0, -1.19, 1.94, 0.67, 1.03, -0.50],
'right': [0.08, -1.0, 1.19, 1.94, -0.67, 1.03, 0.50]
}
}
self._collide_lsub = rospy.Subscriber(
'robot/limb/left/collision_avoidance_state',
CollisionAvoidanceState,
self._update_collision, 'left')
self._collide_rsub = rospy.Subscriber(
'robot/limb/right/collision_avoidance_state',
CollisionAvoidanceState,
self._update_collision, 'right')
self._disable_pub = {
'left': rospy.Publisher(
'robot/limb/left/suppress_collision_avoidance',
Empty, queue_size=10),
'right': rospy.Publisher(
'robot/limb/right/suppress_collision_avoidance',
Empty, queue_size=10)
}
self._rs = baxter_interface.RobotEnable(CHECK_VERSION)
self._enable_pub = rospy.Publisher('robot/set_super_enable',
Bool, queue_size=10)
def _update_collision(self, data, limb):
self._arm_state['collide'][limb] = len(data.collision_object) > 0
self._check_arm_state()
def _check_arm_state(self):
"""
Check for goals and behind collision field.
If s1 joint is over the peak, collision will need to be disabled
to get the arm around the head-arm collision force-field.
"""
diff_check = lambda a, b: abs(a - b) <= self._tuck_threshold
for limb in self._limbs:
angles = [self._arms[limb].joint_angle(joint)
for joint in self._arms[limb].joint_names()]
# Check if in a goal position
untuck_goal = map(diff_check, angles,
self._joint_moves['untuck'][limb])
tuck_goal = map(diff_check, angles[0:2],
self._joint_moves['tuck'][limb][0:2])
if all(untuck_goal):
self._arm_state['tuck'][limb] = 'untuck'
elif all(tuck_goal):
self._arm_state['tuck'][limb] = 'tuck'
else:
self._arm_state['tuck'][limb] = 'none'
# Check if shoulder is flipped over peak
self._arm_state['flipped'][limb] = (
self._arms[limb].joint_angle(limb + '_s1') <= self._peak_angle)
def _prepare_to_tuck(self):
# If arms are in "tucked" state, disable collision avoidance
# before enabling robot, to avoid arm jerking from "force-field".
head = baxter_interface.Head()
start_disabled = not self._rs.state().enabled
at_goal = lambda: (abs(head.pan()) <=
baxter_interface.settings.HEAD_PAN_ANGLE_TOLERANCE)
rospy.loginfo("Moving head to neutral position")
while not at_goal() and not rospy.is_shutdown():
if start_disabled:
[pub.publish(Empty()) for pub in self._disable_pub.values()]
if not self._rs.state().enabled:
self._enable_pub.publish(True)
head.set_pan(0.0, 0.5, timeout=0)
self._tuck_rate.sleep()
if start_disabled:
while self._rs.state().enabled == True and not rospy.is_shutdown():
[pub.publish(Empty()) for pub in self._disable_pub.values()]
self._enable_pub.publish(False)
self._tuck_rate.sleep()
def _move_to(self, tuck, disabled):
if any(disabled.values()):
[pub.publish(Empty()) for pub in self._disable_pub.values()]
while (any(self._arm_state['tuck'][limb] != goal
for limb, goal in tuck.viewitems())
and not rospy.is_shutdown()):
if self._rs.state().enabled == False:
self._enable_pub.publish(True)
for limb in self._limbs:
if disabled[limb]:
self._disable_pub[limb].publish(Empty())
if limb in tuck:
self._arms[limb].set_joint_positions(dict(zip(
self._arms[limb].joint_names(),
self._joint_moves[tuck[limb]][limb])))
self._check_arm_state()
self._tuck_rate.sleep()
if any(self._arm_state['collide'].values()):
self._rs.disable()
return
def supervised_tuck(self):
# Update our starting state to check if arms are tucked
self._prepare_to_tuck()
self._check_arm_state()
# Tuck Arms
if self._tuck == True:
# If arms are already tucked, report this to user and exit.
if all(self._arm_state['tuck'][limb] == 'tuck'
for limb in self._limbs):
rospy.loginfo("Tucking: Arms already in 'Tucked' position.")
self._done = True
return
else:
rospy.loginfo("Tucking: One or more arms not Tucked.")
any_flipped = not all(self._arm_state['flipped'].values())
if any_flipped:
rospy.loginfo(
"Moving to neutral start position with collision %s.",
"on" if any_flipped else "off")
# Move to neutral pose before tucking arms to avoid damage
self._check_arm_state()
actions = dict()
disabled = {'left': True, 'right': True}
for limb in self._limbs:
if not self._arm_state['flipped'][limb]:
actions[limb] = 'untuck'
disabled[limb] = False
self._move_to(actions, disabled)
# Disable collision and Tuck Arms
rospy.loginfo("Tucking: Tucking with collision avoidance off.")
actions = {'left': 'tuck', 'right': 'tuck'}
disabled = {'left': True, 'right': True}
self._move_to(actions, disabled)
self._done = True
return
# Untuck Arms
else:
# If arms are tucked disable collision and untuck arms
if any(self._arm_state['flipped'].values()):
rospy.loginfo("Untucking: One or more arms Tucked;"
" Disabling Collision Avoidance and untucking.")
self._check_arm_state()
suppress = deepcopy(self._arm_state['flipped'])
actions = {'left': 'untuck', 'right': 'untuck'}
self._move_to(actions, suppress)
self._done = True
return
# If arms already untucked, move to neutral location
else:
rospy.loginfo("Untucking: Arms already Untucked;"
" Moving to neutral position.")
self._check_arm_state()
suppress = deepcopy(self._arm_state['flipped'])
actions = {'left': 'untuck', 'right': 'untuck'}
self._move_to(actions, suppress)
self._done = True
return
def clean_shutdown(self):
"""Handles ROS shutdown (Ctrl-C) safely."""
if not self._done:
rospy.logwarn('Aborting: Shutting down safely...')
if any(self._arm_state['collide'].values()):
while self._rs.state().enabled != False:
[pub.publish(Empty()) for pub in self._disable_pub.values()]
self._enable_pub.publish(False)
self._tuck_rate.sleep()
def main():
parser = argparse.ArgumentParser()
tuck_group = parser.add_mutually_exclusive_group(required=True)
tuck_group.add_argument("-t","--tuck", dest="tuck",
action='store_true', default=False, help="tuck arms")
tuck_group.add_argument("-u", "--untuck", dest="untuck",
action='store_true', default=False, help="untuck arms")
args = parser.parse_args(rospy.myargv()[1:])
tuck = args.tuck
rospy.loginfo("Initializing node... ")
rospy.init_node("rsdk_tuck_arms")
rospy.loginfo("%sucking arms" % ("T" if tuck else "Unt",))
tucker = Tuck(tuck)
rospy.on_shutdown(tucker.clean_shutdown)
tucker.supervised_tuck()
rospy.loginfo("Finished tuck")
if __name__ == "__main__":
main()
| #!/usr/bin/env python
# Copyright (c) 2013-2015, Rethink Robotics
# All rights reserved.
#
# Redistribution and use in source and binary forms, with or without
# modification, are permitted provided that the following conditions are met:
#
# 1. Redistributions of source code must retain the above copyright notice,
# this list of conditions and the following disclaimer.
# 2. Redistributions in binary form must reproduce the above copyright
# notice, this list of conditions and the following disclaimer in the
# documentation and/or other materials provided with the distribution.
# 3. Neither the name of the Rethink Robotics nor the names of its
# contributors may be used to endorse or promote products derived from
# this software without specific prior written permission.
#
# THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS"
# AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE
# IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE
# ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE
# LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR
# CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF
# SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS
# INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN
# CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE)
# ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE
# POSSIBILITY OF SUCH DAMAGE.
"""
Tool to tuck/untuck Baxter's arms to/from the shipping pose
"""
import argparse
from copy import deepcopy
import rospy
from std_msgs.msg import (
Empty,
Bool,
)
import baxter_interface
from baxter_core_msgs.msg import (
CollisionAvoidanceState,
)
from baxter_interface import CHECK_VERSION
class Tuck(object):
def __init__(self, tuck_cmd):
self._done = False
self._limbs = ('left', 'right')
self._arms = {
'left': baxter_interface.Limb('left'),
'right': baxter_interface.Limb('right'),
}
self._tuck = tuck_cmd
self._tuck_rate = rospy.Rate(20.0) # Hz
self._tuck_threshold = 0.2 # radians
self._peak_angle = -1.6 # radians
self._arm_state = {
'tuck': {'left': 'none', 'right': 'none'},
'collide': {'left': False, 'right': False},
'flipped': {'left': False, 'right': False}
}
self._joint_moves = {
'tuck': {
'left': [-1.0, -2.07, 3.0, 2.55, 0.0, 0.01, 0.0],
'right': [1.0, -2.07, -3.0, 2.55, -0.0, 0.01, 0.0]
},
'untuck': {
'left': [-0.08, -1.0, -1.19, 1.94, 0.67, 1.03, -0.50],
'right': [0.08, -1.0, 1.19, 1.94, -0.67, 1.03, 0.50]
}
}
self._collide_lsub = rospy.Subscriber(
'robot/limb/left/collision_avoidance_state',
CollisionAvoidanceState,
self._update_collision, 'left')
self._collide_rsub = rospy.Subscriber(
'robot/limb/right/collision_avoidance_state',
CollisionAvoidanceState,
self._update_collision, 'right')
self._disable_pub = {
'left': rospy.Publisher(
'robot/limb/left/suppress_collision_avoidance',
Empty, queue_size=10),
'right': rospy.Publisher(
'robot/limb/right/suppress_collision_avoidance',
Empty, queue_size=10)
}
self._rs = baxter_interface.RobotEnable(CHECK_VERSION)
self._enable_pub = rospy.Publisher('robot/set_super_enable',
Bool, queue_size=10)
def _update_collision(self, data, limb):
self._arm_state['collide'][limb] = len(data.collision_object) > 0
self._check_arm_state()
def _check_arm_state(self):
"""
Check for goals and behind collision field.
If s1 joint is over the peak, collision will need to be disabled
to get the arm around the head-arm collision force-field.
"""
diff_check = lambda a, b: abs(a - b) <= self._tuck_threshold
for limb in self._limbs:
angles = [self._arms[limb].joint_angle(joint)
for joint in self._arms[limb].joint_names()]
# Check if in a goal position
untuck_goal = map(diff_check, angles,
self._joint_moves['untuck'][limb])
tuck_goal = map(diff_check, angles[0:2],
self._joint_moves['tuck'][limb][0:2])
if all(untuck_goal):
self._arm_state['tuck'][limb] = 'untuck'
elif all(tuck_goal):
self._arm_state['tuck'][limb] = 'tuck'
else:
self._arm_state['tuck'][limb] = 'none'
# Check if shoulder is flipped over peak
self._arm_state['flipped'][limb] = (
self._arms[limb].joint_angle(limb + '_s1') <= self._peak_angle)
def _prepare_to_tuck(self):
# If arms are in "tucked" state, disable collision avoidance
# before enabling robot, to avoid arm jerking from "force-field".
head = baxter_interface.Head()
start_disabled = not self._rs.state().enabled
at_goal = lambda: (abs(head.pan()) <=
baxter_interface.settings.HEAD_PAN_ANGLE_TOLERANCE)
rospy.loginfo("Moving head to neutral position")
while not at_goal() and not rospy.is_shutdown():
if start_disabled:
[pub.publish(Empty()) for pub in self._disable_pub.values()]
if not self._rs.state().enabled:
self._enable_pub.publish(True)
head.set_pan(0.0, 0.5, timeout=0)
self._tuck_rate.sleep()
if start_disabled:
while self._rs.state().enabled == True and not rospy.is_shutdown():
[pub.publish(Empty()) for pub in self._disable_pub.values()]
self._enable_pub.publish(False)
self._tuck_rate.sleep()
def _move_to(self, tuck, disabled):
if any(disabled.values()):
[pub.publish(Empty()) for pub in self._disable_pub.values()]
while (any(self._arm_state['tuck'][limb] != goal
for limb, goal in tuck.viewitems())
and not rospy.is_shutdown()):
if self._rs.state().enabled == False:
self._enable_pub.publish(True)
for limb in self._limbs:
if disabled[limb]:
self._disable_pub[limb].publish(Empty())
if limb in tuck:
self._arms[limb].set_joint_positions(dict(zip(
self._arms[limb].joint_names(),
self._joint_moves[tuck[limb]][limb])))
self._check_arm_state()
self._tuck_rate.sleep()
if any(self._arm_state['collide'].values()):
self._rs.disable()
return
def supervised_tuck(self):
# Update our starting state to check if arms are tucked
self._prepare_to_tuck()
self._check_arm_state()
# Tuck Arms
if self._tuck == True:
# If arms are already tucked, report this to user and exit.
if all(self._arm_state['tuck'][limb] == 'tuck'
for limb in self._limbs):
rospy.loginfo("Tucking: Arms already in 'Tucked' position.")
self._done = True
return
else:
rospy.loginfo("Tucking: One or more arms not Tucked.")
any_flipped = not all(self._arm_state['flipped'].values())
if any_flipped:
rospy.loginfo(
"Moving to neutral start position with collision %s.",
"on" if any_flipped else "off")
# Move to neutral pose before tucking arms to avoid damage
self._check_arm_state()
actions = dict()
disabled = {'left': True, 'right': True}
for limb in self._limbs:
if not self._arm_state['flipped'][limb]:
actions[limb] = 'untuck'
disabled[limb] = False
self._move_to(actions, disabled)
# Disable collision and Tuck Arms
rospy.loginfo("Tucking: Tucking with collision avoidance off.")
actions = {'left': 'tuck', 'right': 'tuck'}
disabled = {'left': True, 'right': True}
self._move_to(actions, disabled)
self._done = True
return
# Untuck Arms
else:
# If arms are tucked disable collision and untuck arms
if any(self._arm_state['flipped'].values()):
rospy.loginfo("Untucking: One or more arms Tucked;"
" Disabling Collision Avoidance and untucking.")
self._check_arm_state()
suppress = deepcopy(self._arm_state['flipped'])
actions = {'left': 'untuck', 'right': 'untuck'}
self._move_to(actions, suppress)
self._done = True
return
# If arms already untucked, move to neutral location
else:
rospy.loginfo("Untucking: Arms already Untucked;"
" Moving to neutral position.")
self._check_arm_state()
suppress = deepcopy(self._arm_state['flipped'])
actions = {'left': 'untuck', 'right': 'untuck'}
self._move_to(actions, suppress)
self._done = True
return
def clean_shutdown(self):
"""Handles ROS shutdown (Ctrl-C) safely."""
if not self._done:
rospy.logwarn('Aborting: Shutting down safely...')
if any(self._arm_state['collide'].values()):
while self._rs.state().enabled != False:
[pub.publish(Empty()) for pub in self._disable_pub.values()]
self._enable_pub.publish(False)
self._tuck_rate.sleep()
def main():
parser = argparse.ArgumentParser()
tuck_group = parser.add_mutually_exclusive_group(required=True)
tuck_group.add_argument("-t","--tuck", dest="tuck",
action='store_true', default=False, help="tuck arms")
tuck_group.add_argument("-u", "--untuck", dest="untuck",
action='store_true', default=False, help="untuck arms")
args = parser.parse_args(rospy.myargv()[1:])
tuck = args.tuck
rospy.loginfo("Initializing node... ")
rospy.init_node("rsdk_tuck_arms")
rospy.loginfo("%sucking arms" % ("T" if tuck else "Unt",))
tucker = Tuck(tuck)
rospy.on_shutdown(tucker.clean_shutdown)
tucker.supervised_tuck()
rospy.loginfo("Finished tuck")
if __name__ == "__main__":
main()
| en | 0.737285 | #!/usr/bin/env python # Copyright (c) 2013-2015, Rethink Robotics # All rights reserved. # # Redistribution and use in source and binary forms, with or without # modification, are permitted provided that the following conditions are met: # # 1. Redistributions of source code must retain the above copyright notice, # this list of conditions and the following disclaimer. # 2. Redistributions in binary form must reproduce the above copyright # notice, this list of conditions and the following disclaimer in the # documentation and/or other materials provided with the distribution. # 3. Neither the name of the Rethink Robotics nor the names of its # contributors may be used to endorse or promote products derived from # this software without specific prior written permission. # # THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" # AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE # IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE # ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE # LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR # CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF # SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS # INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN # CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) # ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE # POSSIBILITY OF SUCH DAMAGE. Tool to tuck/untuck Baxter's arms to/from the shipping pose # Hz # radians # radians Check for goals and behind collision field. If s1 joint is over the peak, collision will need to be disabled to get the arm around the head-arm collision force-field. # Check if in a goal position # Check if shoulder is flipped over peak # If arms are in "tucked" state, disable collision avoidance # before enabling robot, to avoid arm jerking from "force-field". # Update our starting state to check if arms are tucked # Tuck Arms # If arms are already tucked, report this to user and exit. # Move to neutral pose before tucking arms to avoid damage # Disable collision and Tuck Arms # Untuck Arms # If arms are tucked disable collision and untuck arms # If arms already untucked, move to neutral location Handles ROS shutdown (Ctrl-C) safely. | 1.540211 | 2 |
django-system/src/tsm_api/serializers.py | Deepak-Kharah/ioe-project | 0 | 2897 | <filename>django-system/src/tsm_api/serializers.py
from rest_framework import serializers
from .models import Measurement
class MeasurementSerializer(serializers.ModelSerializer):
class Meta:
model = Measurement
fields = '__all__'
| <filename>django-system/src/tsm_api/serializers.py
from rest_framework import serializers
from .models import Measurement
class MeasurementSerializer(serializers.ModelSerializer):
class Meta:
model = Measurement
fields = '__all__'
| none | 1 | 1.487343 | 1 |
|
src/GalaxyDynamicsFromVc/units.py | pabferde/galaxy_dynamics_from_Vc | 0 | 2898 | <gh_stars>0
_Msun_kpc3_to_GeV_cm3_factor = 0.3/8.0e6
def Msun_kpc3_to_GeV_cm3(value):
return value*_Msun_kpc3_to_GeV_cm3_factor
| _Msun_kpc3_to_GeV_cm3_factor = 0.3/8.0e6
def Msun_kpc3_to_GeV_cm3(value):
return value*_Msun_kpc3_to_GeV_cm3_factor | none | 1 | 1.38297 | 1 |
|
Python/leetcode.031.next-permutation.py | tedye/leetcode | 4 | 2899 | <reponame>tedye/leetcode<gh_stars>1-10
class Solution(object):
def nextPermutation(self, nums):
"""
:type nums: List[int]
:rtype: void Do not return anything, modify nums in-place instead.
"""
if not nums: return
n = len(nums)-1
while n > 0 and nums[n-1] >= nums[n]:
n -= 1
t = n
if t == 0:
nums[:] = nums[::-1]
return
x = nums[n-1]
while t < len(nums) and x < nums[t]:
t += 1
temp = nums[t-1]
nums[t-1] = nums[n-1]
nums[n-1] = temp
nums[n:] = nums[n:][::-1]
return | class Solution(object):
def nextPermutation(self, nums):
"""
:type nums: List[int]
:rtype: void Do not return anything, modify nums in-place instead.
"""
if not nums: return
n = len(nums)-1
while n > 0 and nums[n-1] >= nums[n]:
n -= 1
t = n
if t == 0:
nums[:] = nums[::-1]
return
x = nums[n-1]
while t < len(nums) and x < nums[t]:
t += 1
temp = nums[t-1]
nums[t-1] = nums[n-1]
nums[n-1] = temp
nums[n:] = nums[n:][::-1]
return | en | 0.370268 | :type nums: List[int] :rtype: void Do not return anything, modify nums in-place instead. | 3.380309 | 3 |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.