Datasets:

timaeus
/

pile-dm_mathematics

Dataset card Data Studio Files Files and versions Community

Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
the prime factors of p(-5)? 7 List the prime factors of 93/4 - 1/4. 23 Let t(g) = -g*2 + g - 5. Let j be t(5). Let h = -12 - j. List the prime factors of h. 13 Suppose 3l + 4l - 910 = 0. List the prime factors of l. 2, 5, 13 Suppose -q + 25 = 4q. Let j be (3 - -2)9/q. Suppose j = -2g + 29. What are the prime factors of g? 2, 5 Suppose -4 = -4o, 19 - 60 = -2i + 3o. List the prime factors of i. 2, 11 Suppose -5u = 21 + 29. Let a = u - -17. What are the prime factors of a? 7 Suppose -2l - 7n + 88 = -3n, -3l + 5n + 88 = 0. List the prime factors of l. 2, 3 Let c(t) = 3t*3 - 4t*2 + 2t + 1. Let w be c(2). Let z = w - 4. List the prime factors of z. 3 Suppose -4h + 0 = -8. Let r be ((-4)/h)/((-2)/(-13)). Let n = 26 + r. What are the prime factors of n? 13 Let p = -32 - -55. Let m = -11 + p. What are the prime factors of m? 2, 3 Let m be -6 + 7 + (118 - 1). Suppose 4z - m = -0z - 3a, -5z = -2a - 159. List the prime factors of z. 31 Suppose -21x = -8x - 2418. List the prime factors of x. 2, 3, 31 Let c be -2(-6)/(-3) + -1. What are the prime factors of (2/6)/(c/(-255))? 17 Let b = 53 + -35. Suppose -4k + k + b = 0. List the prime factors of k. 2, 3 List the prime factors of 2/7 - 1233/(-21). 59 Suppose 2c - 6c - 20 = 0. What are the prime factors of (-107)/c - 6/15? 3, 7 Let c(a) = a + 11. Let l(r) = -r3 + r. Let t be l(-1). What are the prime factors of c(t)? 11 Let h(z) = -z3 + 14z2 - 14z + 16. Let i be h(13). Suppose -3r = -4m + 53, -im - 5r = -5m + 9. Suppose 5 = -3y + m. List the prime factors of y. 2 Let g = 8 - 8. Suppose g = -2m - 15 + 125. List the prime factors of m. 5, 11 Let x(a) = -a + 3. Let f be x(0). Suppose -54 = -fn - 0n. Suppose c - n = -2c. What are the prime factors of c? 2, 3 Suppose 0 = -5b + 8b - 459. What are the prime factors of b? 3, 17 Let b(w) = -w + 8. Let j(g) = -g3 + g2 - g + 1. Let l be j(1). What are the prime factors of b(l)? 2 Suppose -u - 18 = -0u. Let d = -7 - u. What are the prime factors of d? 11 Let i = 8 + -2. Let s(p) = -p3 + 8p*2 + 2p + 1. Let m be s(i). Suppose 5b - 33 - 47 = 4h, -4b - h + m = 0. List the prime factors of b. 2, 5 Suppose 0 = -0x + 5x + 15. Let n = -9 - x. List the prime factors of (-9)/n(-52)/(-6). 13 Let s = -108 + 199. List the prime factors of s. 7, 13 Let x be (-4)/(-14) + 1141/(-49). Let y = 40 + x. Let r = y + -5. What are the prime factors of r? 2, 3 Let c = -13 - -30. Let p = 34 - c. What are the prime factors of p? 17 Suppose -7w + 3w + 2 = 5p, -w + 4p + 11 = 0. List the prime factors of w/4 - 186/(-8). 2, 3 Suppose -2j - 4o = -174, -3o = 2j - 4o - 149. Let n = 109 - j. What are the prime factors of n? 2 Let j be -421/8-2. Let o = j - 9. List the prime factors of o. 2, 3 Let s(b) = -b - 1. Let c(i) = -i. Let l(r) = -c(r) + 2s(r). Let u be l(-5). Suppose h = -x + 9, h + 4 = ux - 7. List the prime factors of x. 5 Let l be ((-12)/(-9))/(4/18). Suppose 0 = -2d - ld + 360. What are the prime factors of d? 3, 5 Let f = 3 + 176. What are the prime factors of f? 179 Suppose -4h - 3g + 206 = 0, 3g = -2h + 7g + 92. List the prime factors of h. 2, 5 Suppose 2r + 50 = -z, 0z - z - 38 = -2r. Let w = z + 63. List the prime factors of w. 19 Suppose 20 = 5z - z, 5z + 285 = 5m. List the prime factors of m. 2, 31 Let q(y) = 3y - 21. List the prime factors of q(25). 2, 3 Let c = -1 - -3. Suppose -2p - ca + 23 = -3, 2p + a - 24 = 0. What are the prime factors of p? 11 Let b(m) = 6m2 + m - 14. List the prime factors of b(5). 3, 47 Let a be (6/4)/((-2)/(-20)). Suppose -4t + d = -a, 2t - 4d - 12 = -2d. Suppose tx + x + 55 = 5s, 2x + 10 = 0. What are the prime factors of s? 7 Let f = -1 - -5. Let j(p) = -2p2 - f - 3p + p + 4p + 3p*2. What are the prime factors of j(3)? 11 Suppose v = u, 2v = -5u + 18 + 3. Suppose -4z + 75 = 2w - 5w, -uz + 40 = w. List the prime factors of z. 3, 5 Let i(u) = -u - 5. Let h = -3 + -2. Let l be i(h). Let c = l + 5. List the prime factors of c. 5 Let k(b) = -b3 - 9b*2 + 7b + 3. What are the prime factors of k(-10)? 3, 11 Suppose u = 2q - 2u - 4, 3q = -2u - 20. Let b = 5 + q. Suppose i = b + 10. List the prime factors of i. 11 Suppose 31 = -4a + 963. What are the prime factors of a? 233 Let h(w) = 2w*2 + 8w + 10. List the prime factors of h(-7). 2, 13 Suppose q - 4q + 3 = 0, -5o + 52 = 2q. Suppose 0 = -4v - v + o. What are the prime factors of v3/(-12)-10? 5 Suppose -12 = 7m - 3m + 4f, -f - 9 = -2m. Let p be (-1)/(-1 - -2)-54. Suppose a = -mh - 0a + 41, a = 3h - p. What are the prime factors of h? 19 Let w = 5 + -2. Suppose -4a - 5 = w, -4a = -5c + 48. List the prime factors of c. 2 Let a(b) = 4b*2 + b + 3. List the prime factors of a(-4). 3, 7 Let b = 13 + -8. Suppose bp + 2 = 102. List the prime factors of p. 2, 5 Let p be (-2)/(-7) + 712/7. Suppose q - p = 5r, -5q = -2q + r - 338. What are the prime factors of q/11 - 2/11? 2, 5 Suppose 3x = -195 + 501. What are the prime factors of (x/(-15))/((-2)/5)? 17 Let k(d) = 10d3 - d2 + 2d. List the prime factors of k(2). 2, 5 Let w = 68 - 34. Suppose 0 = 2y - w - 2. What are the prime factors of y? 2, 3 Let s(q) = -q2 - 12q - 6. List the prime factors of s(-9). 3, 7 Suppose -2w = -0w - 94. What are the prime factors of w? 47 Suppose 0 = 2q + 3q + 55. Let l be (q/4)/(5/(-20)). What are the prime factors of 62/22 + 2/l? 3 Suppose -4j + 344 = 4w, -j - j + 171 = 3w. What are the prime factors of j? 3, 29 Suppose 3x + 18 - 6 = 0. Let h be (1 - 2) + (x - -2). List the prime factors of (h + -2 + 0)/(-1). 5 Suppose 15f - 16f = -182. List the prime factors of f. 2, 7, 13 Let x = 263 - 157. What are the prime factors of x? 2, 53 What are the prime factors of (-25 - -1)/((-4)/6)? 2, 3 Suppose -4x = -54 - 90. List the prime factors of x. 2, 3 Suppose 0 = -3d - 2n + 418, -304 = -5d - 5n + 386. List the prime factors of d. 2, 71 Suppose 2l = 5l - 30. Let i(c) = c3 - 9c*2 - 9c + 12. What are the prime factors of i(l)? 2, 11 Let c(p) = -p*3 - 8p*2 - 3. Let o be c(-8). Let a = 8 + o. List the prime factors of a. 5 Let l = 4 - -6. Suppose -lk = -9k - 25. What are the prime factors of k? 5 Let v be -59 - (1 + -8 + 3). What are the prime factors of ((-28)/(-5))/((-22)/v)? 2, 7 Let h(n) = n - 10. Let u be h(14). Let s(i) be the second derivative of i3/3 + i2/2 - i. What are the prime factors of s(u)? 3 Let c = 45 + -32. List the prime factors of c. 13 Suppose 1515 = 5f + 2s - 7s, -2f = 5s - 634. What are the prime factors of f? 307 Suppose 5z - z = 52. Let o = 0 + z. What are the prime factors of o? 13 Let n = 11 + 11. Let i = -11 + n. List the prime factors of i. 11 Let r(m) be the third derivative of -m4/8 + 5m*3/3 + 2m*2. Let h be r(8). List the prime factors of h/(-5)(-25)/(-10). 7 Suppose 365 = -i + 6i. List the prime factors of i. 73 Suppose 0 = -a + 2i + 2, 4 = -a - 2i + 22. Suppose 2m = m - 4p - 16, 0 = -5p - a. List the prime factors of (-52)/(-6) + m/(-24). 3 What are the prime factors of 18 - (-1 + (-3 - 0))? 2, 11 Suppose 4m + 0n = -n - 38, 5m + 54 = 2n. Suppose -23 = -3r + 19. Let s = r + m. List the prime factors of s. 2 Suppose -5 = z - 5z + w, -2z + 25 = -5w. Let r = z - -8. What are the prime factors of r? 2 Let h = 127 + 1. What are the prime factors of h? 2 Suppose 3 = 4g - 5. Suppose 3f - 2y + 8 - 48 = 0, gf - 35 = 3y. List the prime factors of f. 2, 5 Let g be 89/(-12)-1. Let r(b) = b3 - 6b*2 + 3b - 1. What are the prime factors of r(g)? 17 Let r(p) = -p + 5. Let w be r(6). Let g = 1 + -1. List the prime factors of -3 + w(g - 11). 2 Suppose -4z = -k - 10, 3z = -3k + 13 + 2. Suppose 0g - 230 = -5g - 3u, -g = zu - 46. List the prime factors of g. 2, 23 Let h(y) = -2y + 2. Let f be h(-2). Let l(c) = 446c + 1 - 447c + 7. List the prime factors of l(f). 2 Let x(c) = 84c - 3. List the prime factors of x(1). 3 Let q(z) = -z*3 + 5z*2 + 6z. Let l be q(6). Suppose 0 = -4n - 4 - l. List the prime factors of 3 + 16 + 1/n. 2, 3 Let u(i) = 2i*2 - 20i - 15. List the prime factors of u(-8). 3, 7, 13 Suppose -q + 4 = -2. Suppose qj - 20 = 2j. Suppose -5 = -js + 5, -5o + 47 = -4*s. List the	{ "pile_set_name": "DM Mathematics" }
10 + -2. Let b(f) = -f*3 + 8f*2 + f. Suppose 15 + 14 = o. Calculate the remainder when o is divided by b(u). 5 Let m = 2388 - 2079. Calculate the remainder when m is divided by 8. 5 Suppose -421 = 5g + z, 4z + 0 = 16. Let f = -19 - g. What is the remainder when f is divided by 14? 10 Let j be 32/(-48) + 88/6. Suppose b = 1 + j. Calculate the remainder when b is divided by 6. 3 Suppose -33m + 16m = -187. What is the remainder when 21 is divided by m? 10 Suppose 18 = z - 35. Calculate the remainder when z is divided by ((-1)/(-2))/((-4)/(-144)). 17 Let h(r) = 24r - 841. What is the remainder when h(43) is divided by 15? 11 Let p(x) = x*3 + 3x*2 - 12x - 4. Let w be p(-5). Suppose 0 = ws - 74 + 20. Calculate the remainder when 33 is divided by s. 6 Let o = -859 - -1224. What is the remainder when o is divided by 93? 86 Let z(l) = l2 - 39l + 27. Let v(y) = -19y + 13. Let j(g) = 5v(g) - 2z(g). What is the remainder when 6 is divided by j(-9)? 0 Suppose -16u + 26u - 1030 = 0. Calculate the remainder when 217 is divided by u. 11 Suppose -6 = -14j + 12j. Suppose 2i = -jf + 36, -5i - 2f + 52 + 16 = 0. Calculate the remainder when i is divided by (-17)/(-2) + (-1)/2. 4 Let c(l) = -2l - 1 + 3l3 + 4l*2 - 13l*3 + 24l*3. Calculate the remainder when 87 is divided by c(1). 12 What is the remainder when 339 is divided by 64/(-224) - 1/(-7)65? 6 Let y = -10 + 6. Let r be y + 2 + (-35)/(-7). Calculate the remainder when 15 is divided by -2(r + 2 + -7). 3 Let q(m) = 22m - 177. What is the remainder when q(15) is divided by 33? 21 Suppose 0 = -0a + 5a + 120. Let k be (1 - 0)/((-3)/a). Let d = k - -2. Calculate the remainder when 28 is divided by d. 8 Let f = -33 - -33. Suppose 80 = -fi + 5i. What is the remainder when 30 is divided by i? 14 Suppose 4i - q = 2368, -29 + 2417 = 4i + 4q. Suppose 3h + i = 3s - 289, -2s = -h - 585. Calculate the remainder when s is divided by 49. 46 Suppose d + 14 = -5c, -3c - 35 = -3d - 5. Let x = 31 + -10. Calculate the remainder when x is divided by d. 3 Let j(v) = 3v + 51. What is the remainder when j(-5) is divided by 22? 14 Suppose -5a + 2a = -9. Suppose 0 = -ac - 140 + 725. Suppose 4t - c = -t. Calculate the remainder when t is divided by 10. 9 Let q = -991 - -1193. What is the remainder when q is divided by 19? 12 Let c = 1431 + -1422. Let x(i) = i*3 - 2i*2 - 2i. Suppose 3l - l - 8 = 0. Calculate the remainder when x(l) is divided by c. 6 Suppose -794 = -3u - 4c, 0 = u + c - 2c - 260. Calculate the remainder when u is divided by 12. 10 Let t(q) = q*2 - 4. Let s be t(-3). Suppose 7 = 2u - s. Suppose 5i = ui + 5n - 38, 2i - 2n = 88. Calculate the remainder when i is divided by 15. 13 Let h(z) = 5z + 96. Calculate the remainder when h(23) is divided by 43. 39 Let r(i) = i*2 + i - 4. Let c be r(-5). Suppose -15g = -cg + 38. Calculate the remainder when 73 is divided by g. 35 Suppose 4p = -j + 901, 12p - 8p = 3j + 881. Calculate the remainder when p is divided by 66. 26 Suppose 0 = -2w + 323 + 23. Suppose -103 = -4n + w. Calculate the remainder when n is divided by 18. 15 Suppose 5b = 2g - 3g + 235, 462 = 2g + 2b. What is the remainder when g is divided by 13? 9 Let o(x) = x*3 + 6 - 5x*2 + 6x*2 + 1 - 6x + 5x2. Suppose -5y = 4v + 1 + 37, 2y = 4v - 4. What is the remainder when o(y) is divided by 11? 10 Let t = -12 + 12. Suppose 0c + c - 17 = 5u, t = -5c - u + 33. Calculate the remainder when 15 is divided by c. 1 Let z(u) = -u*2 - 11u - 4. Let n be z(-11). Let s = 6 - n. Let q(d) = -d*2 + 11d + 6. Calculate the remainder when 47 is divided by q(s). 15 Let t = -651 - -913. Suppose -120v + 122v = t. Calculate the remainder when v is divided by 33. 32 What is the remainder when 16/6(-15)/10 + 72 is divided by 8? 4 Let z be (-7)/(-2) - 3/(-6). Let a = 37 + -33. Suppose 2u = f + zf + 90, 180 = au + 3f. Calculate the remainder when u is divided by 17. 11 Suppose 800j - 196 = 793j. What is the remainder when 331 is divided by j? 23 Let f = 15 - 13. Let d(n) = 5n*2 + 2n - 19n3 + 18n*3 - 2n*f. What is the remainder when 14 is divided by d(3)? 2 Suppose 2a - 4 = 3a. Let r = a - -14. Let h = -167 + 173. Calculate the remainder when r is divided by h. 4 Let x = 185 + -113. Calculate the remainder when 357 is divided by x. 69 Suppose 6s = -3o + 8s + 167, 0 = 4o + s - 241. What is the remainder when 167 is divided by o? 49 Let z(f) = -2f + 93. What is the remainder when 64 is divided by z(21)? 13 Suppose 0h - 74 = -2h. Calculate the remainder when 84 is divided by h. 10 Let j = 14 - -79. Suppose 3g - 19 = -4l, -4l = 3g + 2g - 21. Suppose -lk + 3y = -53, -5k + y - 13 = -j. What is the remainder when 66 is divided by k? 15 Let z = 39 - -20. Let f = -15 - -43. Suppose 133 = 7x + f. Calculate the remainder when z is divided by x. 14 Let t = -715 - -903. What is the remainder when t is divided by 65? 58 Let w = -91 + 35. Let c = 89 + w. Calculate the remainder when c is divided by 9. 6 Let p(a) = 4a*3 + 2a*2 + 2a - 3. Let i = -192 - -206. What is the remainder when p(2) is divided by i? 13 Suppose -21y + 137 = -367. Calculate the remainder when 81 is divided by y. 9 Let g = 283 - 273. What is the remainder when 79 is divided by g? 9 Suppose 0 = -3n - 3j + 66, -7n + 24 = -5n - 2j. What is the remainder when 439 is divided by n? 14 Let m(j) = j*2 + 45j + 376. What is the remainder when m(-47) is divided by 43? 40 Let n(o) = -o*3 - 15o*2 + 46. What is the remainder when n(-15) is divided by 7? 4 Let b(r) = 24r*2 - 10r + 2. Calculate the remainder when b(2) is divided by 51. 27 Let k(x) = 134x2. Let a(r) = r - 2. Let y be a(1). What is the remainder when k(y) is divided by 46? 42 Suppose -f + 2i = 4f - 188, 5i = 3f - 128. Let t(a) = -2a*3 - 21a*2 + 3a - 17. What is the remainder when t(-11) is divided by f? 35 Suppose -4b - 4g - 3484 = -6b, 2g - 7008 = -4b. Calculate the remainder when b is divided by 24. 22 Let z = 2556 - 2505. What is the remainder when 252 is divided by z? 48 Let m = 96 + -84. Suppose -mf + 57 = -9f. What is the remainder when f is divided by 6? 1 Let g(s) = -s3 - 11s*2 - 11s - 7. Let m be g(-10). Suppose 5w = -mr + 62, -4r + 78 = 3w - w. What is the remainder when 35 is divided by r? 16 Let f(z) = -z*2 + 25z - 44. What is the remainder when f(18) is divided by 20? 2 Let m = 153 - 100. Calculate the remainder when m is divided by 17. 2 Let u = -100 - -119. Suppose 3a - 5j - 157 = 0, -4j + 166 = 4a - a. Calculate the remainder when a is divided by u. 16 Suppose -3u + 9 + 102 = 0. Suppose -8 = 2z - w - 28, 5z + 4w - u = 0. Calculate the remainder when 53 is divided by z. 8 Suppose 0 = 3y - 5y + 10. Let j = -48 - -57. Suppose -h - 5t = -2h + 31, h + yt = -j. Calculate the remainder when 41 is divided by h. 8 Let y = -8 - -11. Suppose 132 = -yq + 321. Let l(v) = -v*2 + 14v - 11. What is the remainder when q is divided by l(11)? 19 Let g = -191 - -231. Let j(a) = -a - 7. Let i be j(-6). What is the remainder when g is divided by (i - -17)/1 - 2? 12 Suppose -6d + 56 = d. Suppose -dq + 100 = -6q. What is the remainder when q is divided by (3 - 1)/(4/26)? 11 Calculate the remainder when (21 + -24)(-81 + 2) is divided by 30. 27 Let t be (-18)/(-153) + 4/(-34). Calculate the remainder when 355/(-10)(-2 + t) is divided by 4(0 + 12/2). 23 Suppose 0 = -w + 37 - 3. Suppose 7z = 4z + 3h + 102, -z + 4h = -w. Calculate the remainder when 101 is divided by z. 33 Let h(m) = -m - 2. Let l = 13 - 13. Calculate the remainder when (-9)/((-12)/8 - l) is divided by h(-4). 0 Let v = -1077 - -1405. What is the remainder when v is divided by 83? 79 Suppose 0 = -0i + 4i + 272. Calculate the remainder when 15(-3)/(-9) - i is divided by 19. 16 Suppose -70o - 150 = -71o. Calculate the remainder when o is divided by 8. 6 Suppose 61m = 70m - 342. Calculate the remainder when m is divided by -1((-6)/(-3) + -22). 18 Suppose 5w = 2v + 742 + 11181, 4v - 11929 = -5w. What is the remainder when w is divided by 77? 75 Suppose 14v - 11v = 72. What is the remainder when 92 is divided by v? 20 Let g = -13 - -26. Let b be (-61)/9 - 4*(-4)/(-72).	{ "pile_set_name": "DM Mathematics" }
fy (ww(2/7))(-2/39)/((w(-4)www)/w4) assuming w is positive. w(449/91) Simplify (bbb*(-8)bbb)/b*7b(-6)/b(-3) assuming b is positive. b(-13) Simplify ((r/r(-2/5))/rrrrrr1r)/(r/(r/((r/(r/(r/r*(-1/3)r)r))/rr)r)r(-1/4)/r) assuming r is positive. r(439/60) Simplify (k(-15))(-15) assuming k is positive. k*225 Simplify (c/(c/(cc1)))(1/21)/(c*(3/7)/(cc3)) assuming c is positive. c(11/3) Simplify o*2/(oo*2)(o/(oo/o(1/2)))(3/28) assuming o is positive. o(-59/56) Simplify (q/(((q10q)/qq)/q)(((qqq*11qq)/q)/q)/q)11 assuming q is positive. q33 Simplify y(-10)y*(-10)yy assuming y is positive. y(-18) Simplify (a(2/3))(-2)a*(-2)a(-1/2) assuming a is positive. a(-23/6) Simplify x*(1/2)xxx*(4/7)xx(-1/10)/(xx*(1/9)x) assuming x is positive. x(586/315) Simplify (q13/q)/qqq26 assuming q is positive. q38 Simplify (uu(-5/2)/uu9)47 assuming u is positive. u(611/2) Simplify ((k(-2/5)k)/(k/k(-1/10)k))34 assuming k is positive. k(-51) Simplify (s*(1/11)s12)(-42) assuming s is positive. s*(-5586/11) Simplify (l/(ll0))(-1/38)/(l(ll*2l)/lll(-6)) assuming l is positive. l Simplify f0/(f/(f/f*(2/5)))(ff(-6/5)ff)/ff(-1/2) assuming f is positive. f(-1/10) Simplify z*4/((zz*(-2/19)z)/z)z/z(-3)z/((z(2/5)/z)/z) assuming z is positive. z(922/95) Simplify ((u/(u/(u/u(2/21))))/u)(-23) assuming u is positive. u(46/21) Simplify (c(-9/2))(-22/5) assuming c is positive. c(99/5) Simplify (k/(k2/k))/(((k(-1/6)/kkk)/k)/k)((k/((k/(((k(-2/7)/k)/k)/k))/kk))/k)(-5/11) assuming k is positive. k(1439/462) Simplify (i(-38)/i)/i(-5/9) assuming i is positive. i*(-346/9) Simplify (z/(zz*(-2/3)/z))/(z/(zz/z*(-19)z)) assuming z is positive. z*(68/3) Simplify (qq/q(-1/2))/q(1/8)qq/((q/((q/q*(2/17)q)/q)q)/q)q/((qq(1/5))/q) assuming q is positive. q(3439/680) Simplify (gg*(2/39))/(gg(-7/9)) assuming g is positive. g(97/117) Simplify w*(-12)w2 assuming w is positive. w(-10) Simplify (f*13f/f*(-1/15)f)(-17) assuming f is positive. f(-3842/15) Simplify ((lll(2/5))(-3/14))(2/5) assuming l is positive. l(-36/175) Simplify q*(-4/15)/qq(2/63) assuming q is positive. q(-389/315) Simplify i(ii/i*(8/9))/ii2 assuming i is positive. i(28/9) Simplify ((b5/b)/b4)/(b*(2/11)/b(b/(bb(-2/15)))/b) assuming b is positive. b(278/165) Simplify ll*5l(l8/l)/ll*(-8)l((l/(ll*4)l)/l)/l assuming l is positive. l Simplify x(8/11)/x(7/6) assuming x is positive. x(-29/66) Simplify h(-3)/((h*(-7)h)/h)(h(-1/4))(-35) assuming h is positive. h(51/4) Simplify ((l0)(-2/9))24 assuming l is positive. 1 Simplify (t9ttt/(((t/(tt(-10)))/tt)/tt))/(t(-1/2))(-23) assuming t is positive. t(-19/2) Simplify (mm/m(-1/4))43/(m*11/(mmm(-1/6)m)) assuming m is positive. m*(1063/12) Simplify (vv(-2/9))(-15)((v(-2)vv)/v)(-4/5) assuming v is positive. v(-163/15) Simplify (f1)(1/8)/(f(-1/5)/fff(-7)) assuming f is positive. f(293/40) Simplify u1u*(-2/3)(((u/u*2)/uu)/u)/(uu3/u) assuming u is positive. u(-14/3) Simplify (uu(u/u20)/u)/(uu(1/2)) assuming u is positive. u(-39/2) Simplify (t*9t(11/4))(-1/5) assuming t is positive. t(-47/20) Simplify i(-8)i1i*(5/4)i*(-5)ii assuming i is positive. i(-35/4) Simplify (ccc/c(-2/9)c)/c(-12) assuming c is positive. c(146/9) Simplify (q10)(-8/3) assuming q is positive. q*(-80/3) Simplify ((p(p(1/2)/p)/p)(-12))(-17/2) assuming p is positive. p(-51) Simplify (f/(ff(-1/6))f)/(f/((f/(f/((ff/(f/f(-1/38))f)/f)f))/f)) assuming f is positive. f(-49/57) Simplify (m/m0m)(-29)/(m(-2/23)/(m/(m/(((mm(-5)m)/m)/m)))) assuming m is positive. m*(-1447/23) Simplify (((qqq/(q(-8/7)/qq)q)/q)/(q(-4)/q))(-1/19) assuming q is positive. q(-64/133) Simplify ((b(b*2b)/b)/(b/(bb(1/3))))/((bb8)/(b/b(-2/9))) assuming b is positive. b(-40/9) Simplify x(2/7)/xx(-3)x*(3/8)x/x(1/2) assuming x is positive. x(-159/56) Simplify ((xx/x3)/x)(2/85) assuming x is positive. x(-4/85) Simplify (i/(i/(ii*(2/77))i)i)/(i/(i/(iii(-1)i))) assuming i is positive. i(-75/77) Simplify (z/z(-1/4))(-39) assuming z is positive. z(-195/4) Simplify pp(-10)(p(p/p(-1/11)ppp)/p)/p(pp(-2))(1/10) assuming p is positive. p(-661/110) Simplify (z(-1)/z)*(-32)/((z/(zz/(z/(z(1/4)/z))))/z3) assuming z is positive. z(265/4) Simplify (d(2/17)/ddd*7)/(ddd(-1/4)d)(-46) assuming d is positive. d(4543/34) Simplify (ii(-2/7))(-1/4)(i*(2/3)i)/ii6 assuming i is positive. i(545/84) Simplify ((p(4/7)pp)/p)27 assuming p is positive. p(297/7) Simplify (o/o(-3/2))/(o(-19)/o) assuming o is positive. o(45/2) Simplify c(c/(ccc/(cc16)c))/cc(c/(c/c*(-2)))/cc assuming c is positive. c13 Simplify (w(-3)/(ww(-1/4)))/((w(-3/8)w)/(ww(2/9)/w)) assuming w is positive. w(-299/72) Simplify s4/(ss*(1/2)ss)(s(1/4))(-4/19) assuming s is positive. s(17/38) Simplify ((r2)(2/31))(-4/5) assuming r is positive. r*(-16/155) Simplify (ii*(1/19))/(i/(i/(ii(-20)))) assuming i is positive. i(381/19) Simplify ((iii*5)/i(i(3/4)/i)/i)/(i(-10)i7/i) assuming i is positive. i(35/4) Simplify (c4c/(c/(cc1cc)))(-6/11) assuming c is positive. c(-48/11) Simplify (((nnn(1/4)nnn)/n)/(n/((nn(1/6))/n)nn))/(n(-1/8)/n(3/2)) assuming n is positive. n(73/24) Simplify (b(1/3)/bb(-5))(1/9) assuming b is positive. b(-17/27) Simplify z(2/9)/zz/(z/(z/(z/(z(zz/z(5/2))/zz)))) assuming z is positive. z(-5/18) Simplify ((o/o(-4)o)/((oo/(o/o*(-8)o))/o))/(o2)(-2/25) assuming o is positive. o*(379/25) Simplify ((vv(-1))/v(1/4))/(v*(-7)/(vv(4/9))) assuming v is positive. v(295/36) Simplify (kk(-37))/(k/(kk*(-2/107)k)) assuming k is positive. k(-3747/107) Simplify (c6c/(cc/(c/(c/(c/(cc((cc/(c(2/25)c))/cc)/c))))))/((c/c(-1)c)/cc)(-14/3) assuming c is positive. c(452/25) Simplify ((f/(((fff/(f/f(-1/2))f)/ff)/f))/((ff*(-8)f)/f))/((f((((f/(ff(-11)/f))/f)/f)/f)/f)/f11) assuming f is positive. f(17/2) Simplify (q5/(q4/q))/((q/(q(-5)/q))/(q/q*(-2/13)q)) assuming q is positive. q(-37/13) Simplify (r0)(-6/5)/(r(2/5))47 assuming r is positive. r(-94/5) Simplify ((d(2/7))(6/11))(-4/17) assuming d is positive. d(-48/1309) Simplify v*(-23/4)vv/v(-2/11) assuming v is positive. v(-157/44) Simplify (c(-3/4)/(c/c(-2)))/(c/c0c(-3)) assuming c is positive. c(-7/4) Simplify (pp2p)*40/((pp(pp*(-1/10)p)/p)/p(-9/5)) assuming p is positive. p(1553/10) Simplify r*(-19)r*(-15/2)r assuming r is positive. r*(-51/2) Simplify (rr*(-1)r)*(-1)(r/((r/(r/r(1/3)))/r))4 assuming r is positive. r*(17/3) Simplify ((j/(jjj/(jj*(1/3)/jj)))(-27))(5/8) assuming j is positive. j(45/4) Simplify ((h/h(-3))/h(1/2))/(h(-1))(-13) assuming h is positive. h(-19/2) Simplify p/((p*4/p)/p)ppp*5/pp(-6/7)/((p/p(1/14))/p) assuming p is positive. p(59/14) Simplify (y18)(1/2) assuming y is positive. y9 Simplify s*(1/3)s*(3/2)s*(1/10)/ss(-7) assuming s is positive. s(-91/15) Simplify s*(-4/17)ss(-9)s assuming s is positive. s(-123/17) Simplify (r/(r(2/9)r))(-39)/(r/((r/(r/r0))/r))(-47) assuming r is positive. r(308/3) Simplify (qqq(2/5)/qqqqq(-2))(-18) assuming q is positive. q(-216/5) Simplify k/k(-24)kk/(k(-18)k) assuming k is positive. k44 Simplify ((z(-4/5))(5/2))(-12) assuming z is positive. z24 Simplify (f14f(1/6))(-1/10) assuming f is positive. f(-17/12) Simplify g/(g41g)g(16/3)/g assuming g is positive. g(-110/3) Simplify (z(15/7))(-2/5) assuming z is positive. z(-6/7) Simplify (y(-2/43))43 assuming y is positive. y(-2) Simplify ((x/(x/(x/(x(-2/7)x))xx)xx)(-5))33 assuming x is positive. x*(-330/7) Simplify (d/(dd**(11/3)	{ "pile_set_name": "DM Mathematics" }
the nearest ten thousand? -945870000 What is -0.284145436 rounded to three dps? -0.284 What is 5230.760749 rounded to zero dps? 5231 Round 12278351.44 to the nearest 1000000. 12000000 What is 0.0013252555 rounded to three decimal places? 0.001 What is -10941265 rounded to the nearest 100000? -10900000 Round 86.8041478 to two dps. 86.8 What is -48984.8763 rounded to the nearest 10? -48980 What is -2.9624006 rounded to 3 dps? -2.962 Round 0.02986559915 to two decimal places. 0.03 What is -104742.76 rounded to the nearest 10000? -100000 Round 0.0000244354 to three decimal places. 0 Round -0.72424319 to four dps. -0.7242 Round 528199.8684 to the nearest 10000. 530000 What is 86028116.3 rounded to the nearest one million? 86000000 What is -45.260371 rounded to 1 dp? -45.3 Round 0.000082951393 to five decimal places. 0.00008 Round -0.0003561282735 to 6 decimal places. -0.000356 What is -6.11989234 rounded to 1 dp? -6.1 Round -78441.746 to the nearest ten thousand. -80000 Round -0.00711424506 to six dps. -0.007114 Round 5.03218477 to one decimal place. 5 What is -11878526.9 rounded to the nearest 10000? -11880000 What is 10156.76244 rounded to the nearest integer? 10157 Round 8.63547964 to 1 decimal place. 8.6 Round 80.51534108 to two dps. 80.52 Round -31125.6898 to the nearest 100. -31100 What is 6227.025273 rounded to the nearest one thousand? 6000 What is -10869520.31 rounded to the nearest one thousand? -10870000 Round 0.0064034086 to six decimal places. 0.006403 What is 3.17486392 rounded to one dp? 3.2 What is 266060.246 rounded to the nearest ten thousand? 270000 Round 30764374820 to the nearest one million. 30764000000 What is 84.159104 rounded to 2 decimal places? 84.16 Round 309.1955619 to the nearest one hundred. 300 Round 680.186728 to the nearest one thousand. 1000 Round -1960738.18 to the nearest 100. -1960700 Round 0.000057247768 to seven decimal places. 0.0000572 Round 252002386 to the nearest one million. 252000000 Round 106935.5897 to the nearest 10. 106940 What is 2408423.83 rounded to the nearest 1000000? 2000000 What is -19.327279626 rounded to four dps? -19.3273 Round -11.766117062 to two dps. -11.77 What is 2.3910794 rounded to 1 decimal place? 2.4 Round -4819233.41 to the nearest 10000. -4820000 What is -9.3166519 rounded to 1 dp? -9.3 What is 5.8618152 rounded to the nearest integer? 6 What is -0.0001024881296 rounded to 6 decimal places? -0.000102 Round -6131981 to the nearest one million. -6000000 What is -46361.957 rounded to the nearest 100? -46400 Round -723510.9941 to the nearest 100000. -700000 Round 196.6777888 to the nearest ten. 200 What is 0.000258697619 rounded to 7 dps? 0.0002587 What is 1035.268458 rounded to the nearest one thousand? 1000 What is 47330893000 rounded to the nearest one million? 47331000000 What is -0.0000608990307 rounded to seven decimal places? -0.0000609 Round -14863830200 to the nearest one million. -14864000000 Round 0.000205928815 to five decimal places. 0.00021 Round -322703069 to the nearest one hundred thousand. -322700000 Round 0.30521495 to five dps. 0.30521 What is -0.0319305512 rounded to three decimal places? -0.032 Round -858.34404 to one decimal place. -858.3 What is 2059.171218 rounded to the nearest integer? 2059 What is 643.62056 rounded to the nearest one hundred? 600 Round 0.1148579825 to 3 dps. 0.115 What is -907836.93 rounded to the nearest one hundred? -907800 Round -0.0002279370232 to five decimal places. -0.00023 What is -0.000000286629253 rounded to seven decimal places? -0.0000003 What is -430651.7289 rounded to the nearest one thousand? -431000 Round 0.000001318757241 to seven decimal places. 0.0000013 What is -9394532.2 rounded to the nearest 1000000? -9000000 What is 3.85009344 rounded to the nearest integer? 4 Round -278.2578057 to two decimal places. -278.26 What is 56.5095181 rounded to one dp? 56.5 Round 0.0269224011 to 6 dps. 0.026922 What is -0.000560675341 rounded to 7 decimal places? -0.0005607 What is -36035.16431 rounded to the nearest one hundred? -36000 What is -126956.45 rounded to the nearest one thousand? -127000 Round 1841039.649 to the nearest 100. 1841000 What is 27717816 rounded to the nearest one million? 28000000 Round 1485410.468 to the nearest one hundred thousand. 1500000 Round -49265.4516 to the nearest ten thousand. -50000 What is 28588647700 rounded to the nearest 1000000? 28589000000 Round 10334600.7 to the nearest ten thousand. 10330000 What is -66400.7802 rounded to zero decimal places? -66401 What is 437307269.1 rounded to the nearest 1000000? 437000000 Round -21.87464883 to 2 decimal places. -21.87 Round -658522 to the nearest one thousand. -659000 Round -1624497.13 to the nearest 100000. -1600000 Round 0.0436321354 to 3 dps. 0.044 What is 29681.414 rounded to the nearest 100? 29700 What is -18156.8139 rounded to the nearest 1000? -18000 What is -0.000068957971 rounded to 6 decimal places? -0.000069 What is -765864835 rounded to the nearest 100000? -765900000 What is 1551687294 rounded to the nearest ten thousand? 1551690000 Round -801518620 to the nearest one hundred thousand. -801500000 Round -11139.5183 to 0 dps. -11140 Round 0.2995636614 to 5 dps. 0.29956 What is 23022168.04 rounded to the nearest 100000? 23000000 Round -0.930524508 to two decimal places. -0.93 Round 0.0000337529774 to 7 dps. 0.0000338 What is -272581.81 rounded to the nearest 1000? -273000 Round -2315578.21 to the nearest one thousand. -2316000 Round -6375.8613 to the nearest ten. -6380 Round 523.955848 to the nearest 10. 520 Round 0.0000446286128 to 7 dps. 0.0000446 What is 31.739272 rounded to three dps? 31.739 Round -0.042408001 to 2 decimal places. -0.04 What is -363052.84 rounded to the nearest 100? -363100 Round 0.0001284508012 to seven dps. 0.0001285 Round -2391517.521 to the nearest ten thousand. -2390000 What is -954.655137 rounded to the nearest ten? -950 Round -98193553.84 to the nearest one million. -98000000 Round 737921.9318 to the nearest one hundred. 737900 What is -7028933200 rounded to the nearest 1000000? -7029000000 Round -15678469 to the nearest 1000000. -16000000 What is -0.02481498006 rounded to 3 dps? -0.025 Round 448.6995 to the nearest 100. 400 What is 5.6513419 rounded to 2 dps? 5.65 What is 62.2487195 rounded to one decimal place? 62.2 What is -0.000063560637 rounded to 6 decimal places? -0.000064 What is -1145098.373 rounded to the nearest 1000? -1145000 What is -4685797.26 rounded to the nearest ten thousand? -4690000 Round -21.83519069 to 2 decimal places. -21.84 Round -14212370.135 to the nearest one million. -14000000 What is 211883888 rounded to the nearest one hundred thousand? 211900000 What is 122436674.82 rounded to the nearest one million? 122000000 What is 1332308.19 rounded to the nearest 100? 1332300 What is -0.56725369 rounded to 3 decimal places? -0.567 Round -0.60890802 to four decimal places. -0.6089 Round 15730.394 to the nearest 100. 15700 What is 0.000002157290873 rounded to 6 decimal places? 0.000002 Round -17.71757173 to one decimal place. -17.7 What is 3.5243389 rounded to one decimal place? 3.5 Round -56.8871836 to one dp. -56.9 Round -6001147470 to the nearest 1000000. -6001000000 What is 50148.171 rounded to the nearest one hundred? 50100 What is 103913.517 rounded to the nearest one thousand? 104000 What is -5116700040 rounded to the nearest one hundred thousand? -5116700000 What is 52428061660 rounded to the nearest one million? 52428000000 What is -0.00762989089 rounded to 7 decimal places? -0.0076299 Round -238.59708 to the nearest 10. -240 Round 7213717.2 to the nearest 100000. 7200000 What is 15043.304 rounded to 0 dps? 15043 What is 0.03611558592 rounded to three dps? 0.036 What is 5142859.37 rounded to the nearest ten thousand? 5140000 Round 0.001519953883 to 7 dps. 0.00152 What is -510702.18 rounded to the nearest ten thousand? -510000 Round -0.00000212474075 to seven decimal places. -0.0000021 Round -1039.322452 to zero decimal places. -1039 Round -90528691.2 to the nearest 1000000. -91000000 Round -23639.13375 to the nearest one thousand. -24000 Round -0.10667652341 to 5 decimal places. -0.10668 Round -6990.703016 to the nearest ten. -6990 Round -0.00105630208 to seven decimal places. -0.0010	{ "pile_set_name": "DM Mathematics" }
? 592 Is 4081 greater than 4081? False Which is smaller: 100/19 or 4? 4 Is 373 < 373? False Which is smaller: 3/11 or -4/7? -4/7 Is -725 >= -0.1? False Which is smaller: 546 or 545? 545 Is -19 at least as big as -3? False Which is smaller: 1020 or 1021? 1020 Which is bigger: -1 or -38/45? -38/45 Do 64 and 64 have the same value? True Which is greater: 48 or 16? 48 Which is bigger: -0.2 or -185? -0.2 Which is greater: 2 or 57/100? 2 Are 5641 and 5642 equal? False Which is bigger: -1/31773 or -1? -1/31773 Is 0 at least as big as -1/379? True Is 0 at least as big as 1/1256? False Is 158 >= 157? True Is -1534 greater than or equal to -1534? True Which is bigger: 6216 or 6218? 6218 Is -11359/4 < -2840? False Do 8 and -0.137 have different values? True Does 9113 = 9115? False Is -108 not equal to -112? True Which is greater: -13 or 166? 166 Is 2/32695 at most as big as 1/2? True Which is bigger: -1/12228 or 1? 1 Are -601 and 2 equal? False Is 5453 bigger than 5452? True Which is smaller: 22142 or 22143? 22142 Do -2/16349 and 0 have the same value? False Is -1957/22 < -88? True Is -3531/13 at least as big as -271? False Is -13 bigger than 237? False Which is bigger: 624 or -2/3? 624 Which is smaller: -1 or -1/12083? -1 Which is bigger: 0 or -3/9481? 0 Which is smaller: -63 or -67? -67 Which is bigger: -2671 or -2672? -2671 Is 70/31 greater than 0.3? True Is -2/1885 > 1? False Which is smaller: 137 or 146? 137 Is 44 bigger than 40? True Which is greater: 557 or 561? 561 Do 2/675 and 0 have the same value? False Are -0.28397 and 1 equal? False Which is smaller: 0 or 2/34921? 0 Is 0 != 96/181? True Is 20728 > -1? True Which is bigger: 2/1103 or 2? 2 Is -555 not equal to -554? True Which is bigger: 1 or -12/107? 1 Is 38 < -0.09? False Are -123 and -258 nonequal? True Is -13 at most as big as -175/13? False Are 5 and 268 unequal? True Is -580 smaller than -578? True Which is smaller: 71 or 73? 71 Is -116/9 bigger than 16? False Does 1 = -2/11247? False Is 308/79 greater than 5? False Which is greater: -3/151 or 1? 1 Is -477/7 bigger than -67? False Is 1 smaller than 6/1325? False Which is smaller: 0.2 or 279? 0.2 Which is greater: -52 or -0.09? -0.09 Which is bigger: 4/45 or 1? 1 Is 7/2 less than 5? True Is 1 less than -2/2125? False Is 1 > -4/227? True Is 125 greater than 125? False Is -38253 greater than -38253? False Which is bigger: -43 or 1/4? 1/4 Which is greater: 0.07 or -0.176? 0.07 Does -1166 = -1166? True Is -4 < 7.2? True Is -89 != -62? True Is -655 bigger than -656? True Which is smaller: -230 or -228? -230 Are 1 and 19/1338 nonequal? True Is -1/6669 smaller than -0.1? False Are -6618/5 and -1325 non-equal? True Is 3 at most 75/49? False Which is smaller: 0.076 or -5? -5 Which is bigger: -1 or 3/15758? 3/15758 Is -6683 bigger than -6683? False Which is bigger: -5/12 or 0.06? 0.06 Is 0 < -1/513? False Is 4 at least 192/43? False Is 9984 >= 9984? True Is -10 < -17/2? True Which is greater: -167 or -170? -167 Which is smaller: 23/74 or 1? 23/74 Are -18095 and -18095 equal? True Is -121 > -120? False Is 234 not equal to 234? False Which is smaller: -2 or 96/31? -2 Is -11737 < -11737? False Is -197 < -187? True Which is smaller: -3990 or 0? -3990 Is -1662 <= -1658? True Are -1/4 and 5.66 equal? False Is 3772 smaller than 11318/3? True Is -78 less than or equal to -82? False Is 0 less than or equal to -0.064? False Is -1 bigger than 28/59? False Is 4/15341 at most 1? True Is -586 greater than or equal to -587? True Is 3/4 bigger than -82? True Which is smaller: 14 or -25? -25 Which is bigger: 41 or 40? 41 Which is smaller: -1/2 or -481? -481 Is 0 less than or equal to 2/33839? True Which is smaller: 143/4 or 37? 143/4 Is 6 not equal to 240/49? True Is -8 smaller than -13/2? True Is -425 bigger than 2? False Which is greater: -6/25 or 1/7? 1/7 Which is smaller: -1/17465 or 1? -1/17465 Is -85778 at least -85778? True Is 0 less than or equal to 3/41? True Which is bigger: 2/3391 or 0? 2/3391 Is 81 != -0.85? True Which is smaller: 432 or 451? 432 Is -1/7 != 0.115? True Is -29 greater than or equal to 16/3? False Is 0 bigger than 19/89? False Which is smaller: -8/211 or 0? -8/211 Which is smaller: -295 or -293? -295 Is 2952 <= 2942? False Do -173 and -163 have the same value? False Which is smaller: -1 or 25/166? -1 Is 7 != 102? True Is 0.2 at least -5/18? True Do -2/55061 and -1 have the same value? False Which is greater: -27 or -7? -7 Is -10490 > -10492? True Which is greater: 947 or 945? 947 Is -62 bigger than -1/18? False Is -1232 greater than or equal to -6161/5? True Is 1 equal to -42/121? False Is -1 greater than -263/2? True Which is smaller: 4 or 194? 4 Which is greater: 1/137 or 0? 1/137 Which is smaller: -33 or -310/9? -310/9 Which is smaller: 51 or -2? -2 Is 4 at least -2/85? True Is -2 at least -95/89? False Which is bigger: -754 or -755? -754 Which is bigger: 0.15 or -3.3? 0.15 Does -664/5 = -133? False Which is bigger: 12 or 2/9? 12 Which is smaller: -713 or -662? -713 Is 0 not equal to 0.02256? True Is 419 equal to 403? False Is 840 greater than 840? False Is -1972 at most -15777/8? False Is -114 less than or equal to 107? True Is -31 bigger than -5? False Is -0.1 bigger than -645? True Is -14 less than -2/19? True Is -60/161 greater than or equal to 0? False Which is greater: 31 or 34? 34 Which is greater: 1 or -1/4351? 1 Is 7/3 smaller than 34? True Is 532 less than 3729/7? True Which is greater: -198 or -20? -20 Which is bigger: 0.07 or -4431? 0.07 Which is bigger: -12.81 or 4? 4 Is 0.01 at most as big as -1/12? False Which is smaller: -7.79 or -0.2? -7.79 Which is smaller: -40 or -42? -42 Which is smaller: -533 or -530? -533 Is 159 != 159? False Which is smaller: -1 or 2/551? -1 Is -1/9 greater than -42/5? True Which is bigger: 12 or 16? 16 Which is bigger: 8/887 or 5? 5 Is 238 != 237? True Which is smaller: -43.5 or -2? -43.5 Is -53 <= -35? True Is -2 at least as big as -22/157? False Which is smaller: 455 or 11? 11 Which is greater: 32/29 or 1? 32/29 Are -378/11 and -34 non-equal? True Is 54/139 at least 0? True Are 2 and 2/241 equal? False Which is smaller: 883 or -2/15? -2/15 Are -1 and 2/437 unequal? True Do -2343 and -2343 have the same value? True Is -30 greater than -576/19? True Which is greater: -17 or -0.344? -0.344 Which is bigger: -5025 or -5027? -5025 Is 648 less than -0.1? False Which is smaller: 0 or -4/2223? -4/2223 Which is smaller: 189 or 1897/10? 189 Is 2 at most as big as 18/13? False Are 185 and 184 equal? False Which is bigger: -338 or -312? -312 Is -1451 equal to -18870/13? False Which is bigger: -2 or -9? -2 Which is smaller: -202 or -203? -203 Is 1 at least as big as -18? True Which is greater: -1.3057 or 2/7? 2/7 Is -1 >= -10/607? False Which is smaller: 26/53 or -1? -1 Do -1 and 2/367 have different values? True Is 159 less than -0.6? False Is 26/57 >= 1? False Is -123 bigger than -123? False Which is smaller: 0.9 or -13? -13 Which is bigger: -157 or -156? -156 Is -216 less than -0.2? True Is -242 at most as big as -1457/6? False Is -975 at most as big as -2927/3? False Is 19 greater than or equal to 22? False Is -996 not equal to -996? False Do 1150 and 1150 have the same value? True Is -2099 < -2099? False Is -8704 greater than -8704? False Which is greater: 94 or 6? 94 Is 0.7 bigger than -3.79? True Is -2092 < -2094? False Which is greater: -36 or 60? 60 Which is bigger: -0.2 or -49/10? -0.2 Which is smaller: -6 or -5? -6 Is 1 < -92? False Is 1 <= -4/271? False Which is smaller: -11/51 or 1? -11/51 Is -47176 at least -47176? True Are 6/19 and 1/3 unequal? True Which is smaller: 12 or 7? 7 Is -1/5482 less than 0? True Which is greater: -1 or -44/39? -1 Which is greater: 302 or 9? 302 Is 3 not equal to -0.19? True Which is bigger: 664/25 or 28? 28 Is 96 at least as big as 96? True Which is bigger: 4 or 30/11? 4 Which is bigger: 2.2 or -57? 2.2 Which is greater: -2/118313 or -1? -2/118313 Which is smaller: -657 or 3? -657 Which is greater: 177/4 or -2/21? 177/4 Do -8 and -67/8 have the same value? False Is -6281 smaller than -6280? True Is 33/670 <= 1? True Which is smaller: -3646 or -3648? -3648 Which is smaller: -89 or -91? -91 Are 2/5323 and 0 unequal? True Which is smaller: 977 or 976? 976 Which i	{ "pile_set_name": "DM Mathematics" }
*2 - 17k - 199. Let s(r) = 6b(r) - 17q(r). Differentiate s(v) wrt v. 150v Let l = 68 + 151. Let k be l/3 + -7 + 4. Find the third derivative of -5o*2 + 0o*2 - 68o*3 + ko*3 wrt o. 12 Let k(h) be the second derivative of 0h*3 - 1/4h*8 + 0 + 0h*7 + 3/2h*4 + 0h*6 + 0h*5 + 8h + 0h2. Find the third derivative of k(g) wrt g. -1680g*3 Find the second derivative of 413w*3 - 1 - 37w + 414w3 - 10w*4 - 827w*3 wrt w. -120w*2 Let s(l) = -3l + 0l + 0 - 9 + l2 - 3l. Let m be s(8). What is the second derivative of -2j4 + 4j*5 + 2j + 2j4 - mj wrt j? 80j3 Let m(v) = 3v + 21. Let o be m(-6). Let s(k) be the third derivative of 0 + 11/6ko - 12k*2 + 0k - 5/12k4. Find the first derivative of s(j) wrt j. -10 Let s be (-3)/(-9) - (-58)/6. What is the third derivative of 0i*3 + 8i*3 + 3i*3 + si*2 wrt i? 66 Let v(w) be the first derivative of 70w*3/3 - 76w*2 - 25. Find the second derivative of v(m) wrt m. 140 Suppose -s - 6 - 10 = -3u, -17 = -4u - 3s. Suppose -uw = -13 + 3. Find the third derivative of -2j*2 - 3j*5 + 8j5 + j2 - j*w wrt j. 300j*2 Let g(d) be the first derivative of -3d*4/2 + 2d*3 + 66d + 67. What is the derivative of g(z) wrt z? -18z2 + 12z Find the third derivative of 64u3 + 238u*2 - 1 + 1 - 232u*3 - 48u*3 wrt u. -1296 Let y(v) be the second derivative of 0v*3 + 1/2v4 + v2 + 20v + 0. Differentiate y(a) wrt a. 12a Let i(o) be the third derivative of o*8/336 + 31o7/105 + o5/60 - o*4/6 - 18o*2 + 3o. Find the third derivative of i(b) wrt b. 60b2 + 1488b Let t(n) = -n3 - n2 - n - 1. Let v(a) = 106a3 + 5a*2 + 2a + 4. Let j(c) = -5t(c) - v(c). Find the second derivative of j(k) wrt k. -606k Let t(w) = -12w4 - 3w*3 + 3w*2 - 8w + 111. Let r(z) = z4 - z3 + z*2. Let b(c) = -3r(c) + t(c). Differentiate b(v) wrt v. -60v3 - 8 Suppose s = g + 1, 4g = s + s. What is the second derivative of a + 27as + 3a - 11a2 + 7a*2 wrt a? 46 Find the third derivative of -118z*4 + 10z*2 + 21z*2 - 118z*2 - 126z*4 wrt z. -5856z Let f(b) be the third derivative of -19b6/60 - 9b5/20 - b4/12 - 37b2 - 1. Find the third derivative of f(u) wrt u. -228 Let t be -1 + 0 - (-35)/5. What is the third derivative of -5 + tp*4 - 10p*2 + 5 + 2p*4 wrt p? 192p Suppose 2v - 6 = -0v. Let c = 3 + v. Find the third derivative of 131g5 - g2 - 131g*5 - cg*6 wrt g. -720g*3 Let b(t) = 109t*2 + 124t - 6. Let s(l) = 109l2 + 128l - 7. Let p(o) = -7b(o) + 6s(o). What is the second derivative of p(q) wrt q? -218 Let i(n) be the first derivative of -19n6/30 - 11n*4/12 - 18n - 12. Let p(z) be the first derivative of i(z). What is the third derivative of p(x) wrt x? -456x Let k(i) = 4i3 + i2 - 3i + 1. Let b be 10/14 + (-16)/(-56). Let g be k(b). What is the second derivative of -16t*2 + 16t*2 - gt - t*5 wrt t? -20t*3 Let v(r) = -117r*2 + 25r. Let w(f) = 115f2 - 23f. Let t(d) = 5v(d) + 6w(d). What is the second derivative of t(j) wrt j? 210 Let q(r) = 7r3 - 143r*2 + 19r - 71. Let s(n) = 2n3 - 36n*2 + 5n - 18. Let y(g) = 2q(g) - 9s(g). Find the second derivative of y(u) wrt u. -24u + 76 Find the second derivative of -46 + 88 + 25k4 - k - 46 - k3 wrt k. 300k2 - 6k Let z(q) be the third derivative of 16q5/15 - q4/4 - q3 - 8q*2. What is the second derivative of z(p) wrt p? 128 Let q(o) = 73o*2 - 32o. Let p(a) = -74a2 + 34a. Let n(d) = -4p(d) - 3q(d). Find the second derivative of n(l) wrt l. 154 Let b(d) be the third derivative of 0d6 - 23/210d*7 - 25/24d*4 + 0d*3 + 8d*2 + 0d*5 + 0d + 0. Find the second derivative of b(f) wrt f. -276f2 Let d(o) = 91o - 117. Let a(v) = 7v + 6v - 2 + 16v - 28v. Let u(w) = -52a(w) + d(w). What is the first derivative of u(f) wrt f? 39 Let f(c) be the second derivative of 127c*3/3 - 623c*2/2 + 733c. Differentiate f(b) wrt b. 254 Let y(c) = -2c - 6. Let o be y(-4). Differentiate 1 + 56l*o - 2 + 11l*4 - 56l*2 wrt l. 44l*3 Let x(b) be the first derivative of -661b3/3 + b2 - 86b - 337. What is the second derivative of x(i) wrt i? -1322 Suppose -z - 3t + t = -7, -23 = -3z - 4t. Find the third derivative of 3a2 + 5a*3 + za*2 + 4a*3 wrt a. 54 Let n(i) be the third derivative of 0i*4 + 0i + 10i2 + 1/3i*3 - 1/6i*5 + 0. What is the derivative of n(j) wrt j? -20j Differentiate -122 + 112t - 79t + 6t + 133t - 23 wrt t. 172 Let a(c) be the third derivative of -11c4/8 + 13c*3/6 + 44c*2. Find the first derivative of a(m) wrt m. -33 Let a be -14/(-6)6. Suppose -ay + 10 = y. What is the second derivative of 5 + 23i4 - 5 - 19i*4 - yi wrt i? 48i2 Let k(p) be the third derivative of 179p*4/24 + 179p*3/6 + 200p*2. What is the derivative of k(s) wrt s? 179 What is the third derivative of -391s + 4s6 + 291s*2 + 2s*3 + 403s*2 + 391s wrt s? 480s3 + 12 Find the first derivative of 28 - 7 + 10g*4 - 12g*4 - 47g wrt g. -8g3 - 47 Let f(z) be the first derivative of -6z*7 + 13z*3 + z - 42. Find the third derivative of f(a) wrt a. -5040a3 Let l(b) be the first derivative of b5/5 - 38b3/3 - 68b*2 + 242. What is the second derivative of l(u) wrt u? 12u*2 - 76 Let y(n) = 3n. Let c(k) = 108k3 + 4k*2 + 3k. Let w(p) = -c(p) + 2y(p). What is the third derivative of w(q) wrt q? -648 Let r be (-44)/24 - (-1)/(-6). Let h = -2 - r. Differentiate -p + hp + 8p + 2p - 6 wrt p. 9 Suppose 4q = -n, -4n - q = -39 - 6. What is the second derivative of 10f - 10f*5 - nf*5 + 6f*5 wrt f? -320f*3 Let a be (0 + -3)/9-6. Suppose -4h + 0k + 6 = k, -h + ak + 6 = 0. What is the third derivative of 3j*5 + 7j*h + 0j*2 + 0j*5 wrt j? 180j*2 Let f be ((-8)/(-2))/((-3)/(-3)). What is the second derivative of 33u + 9uf - 64u - 2u4 + 36u wrt u? 84u2 Differentiate 17c*3 - 71 + 3630c*2 - 3630c*2 with respect to c. 51c*2 Let z = -111 + 462. What is the first derivative of 351m*2 - zm*2 + 7 - 24m*3 wrt m? -72m2 Let d(l) be the second derivative of l3 + l + 0 - 17/2l2. Differentiate d(g) wrt g. 6 Let b = -68 + 71. What is the third derivative of -8v*2 + 5v*2 - 22v*b - 12v*3 - 8v*2 - 3v wrt v? -204 Differentiate 712u - 450 + 1423 - 346u wrt u. 366 Let n(b) be the second derivative of -34b3/3 - 2b*2 - b - 35. Differentiate n(s) with respect to s. -68 Suppose 3z = 470 - 464. Let k(m) be the second derivative of 0m3 + 5m + 0 - 5/2mz - 5/12m*4. Find the first derivative of k(j) wrt j. -10j Let v(w) = w*4 - 11w*3 - 83. Let h(s) = -3s*4 + 23s*3 + 165. Let i(c) = 4h(c) + 10v(c). What is the first derivative of i(t) wrt t? -8t*3 - 54t*2 Let i be (4 - 5)/(1/(-12)). Suppose -4f = 4l, -5l - f + i = -l. Find the third derivative of -3a4 + a5 + 0a*2 + 3a*l - 2a*2 wrt a. 60a*2 Let i(q) = -2q4 - q3 - 3q2 - q. Let y(a) = 14a*4 - 7a*3 - 10a*2 + 18a. Let l(j) = -6i(j) + y(j). What is the third derivative of l(d) wrt d? 624d - 6 Let a = 435 - -1690. What is the third derivative of -2125 - 9q4 + 11q*2 + a wrt q? -216q Let w(d) = -23d2 + 48d + 2. Let y(a) = 22a2 - 49a - 3. Let f = 58 + -55. Let v(n) = fw(n) + 2y(n). What is the second derivative of v(o) wrt o? -50 Let v(b) = 2b3 - 5b*2 + 5b + 9. Let r(g) = g3 - g2 - g. Let t(z) = -3r(z) - v(z). Find the second derivative of t(p) wrt p. -30p + 16 Let j(k) be the third derivative of -89k7/70 - 89k*4/6 - 113k*2. What is the second derivative of j(g) wrt g? -3204g*2 Suppose -i - 4d = 26 + 9, -65 = 3i + 4d. Let h = -8 - i. Find the second derivative of -5p2 - 6p*3 + hp + 5p2 wrt p. -36p What is the third derivative of 4h - 3h + 93h5 - 30h*5 - 161h*5 - 178h*2 - 3h wrt h? -5880h2 Let g(f) = 115f*3 - 10f*2 + 4f. Let c(b) = -117b3 + 9b*2 - 3b. Let z(l) = 6c(l) + 5g(l). Find the third derivative of z(d) wrt d. -762 Let z(f) = 9f4 - 5f + 18. Let x(t) = -7t + 6t*4 + 3t + 18 - 1 + 2t4. Let u(p) = 5x(p) - 4z(p). What is the first derivative of u(d) wrt d? 16d*3 Suppose 0 = 12u - 10*u -	{ "pile_set_name": "DM Mathematics" }
= h - 0.28011. Round r to 4 dps. -0.0001 Let a = 42952099 - 9926187. Let p = 3725912 - a. Round p to the nearest 1000000. -29000000 Let p = 2.27238 + -1.7698. Let n = -233 - -232.5. Let a = p + n. Round a to 3 dps. 0.003 Let d = 92374 - 92281.078. Let j = -68 - 25. Let t = d + j. What is t rounded to 2 dps? -0.08 Let o = -2007.49 + 2017. Let z = -9.5098682 + o. Round z to six dps. 0.000132 Let r = -9249.26798 + 9249. What is r rounded to three decimal places? -0.268 Let l = -667 - -296. Let d = l + 564. Let r = d + -193.079. Round r to 2 decimal places. -0.08 Let f(i) = 105i2 + 2i + 1. Let j be f(3). Let x = j - 1370. Round x to the nearest 10. -420 Let m = -78841959.2 + 78842418.200209. Let o = 459 - m. Round o to 5 decimal places. -0.00021 Let y(q) = 13 - 9q - 10q - 3q - 31 - 14q*2. Let s be y(8). Round s to the nearest 1000. -1000 Let m = 2387.317 + -2275.39. Let s = -112 + m. Let h = s + 0.0730123. What is h rounded to 6 decimal places? 0.000012 Suppose -3b + 43893 = 4m, 4b - 83m = -80m + 58549. What is b rounded to the nearest 100? 14600 Suppose 35x - 186556678 - 403368322 = 0. Round x to the nearest one hundred thousand. 16900000 Let g = -11709 + 11709.0000087485. What is g rounded to seven decimal places? 0.0000087 Let f = -1268 + 164. Let n = f + 429. Round n to the nearest 100. -700 Let g = -156 + 173. Suppose q = -2b + 803, -gb + 3q = -13b - 1631. Round b to the nearest ten. 400 Let o = -41.97 + 13.991. Let a = 0.59 + -28.59. Let c = o - a. What is c rounded to 2 decimal places? 0.02 Let n(d) = 102d*2 - 7d + 108. Let l be n(18). Suppose -140u + 149u = l. Round u to the nearest 100. 3700 Let b = -593.200026174 + 593.2. What is b rounded to seven decimal places? -0.0000262 Let k = 594.95 + -515.272. Round k to the nearest 10. 80 Let j = -3.591 - -3.590999022. Round j to seven dps. -0.000001 Suppose 2o = -5w - 0w + 358, 4o = -4w + 728. Suppose 5d - 2k - o = 0, 2k = 6k - 12. Suppose -df + 33f - 105 = 0. What is f rounded to the nearest 10? -20 Let q = 427180.37841 + -425389.438. Let p = 1786.04 - q. Let x = -4.9 - p. Round x to 4 decimal places. 0.0004 Let t = -2.2557 + -12.2943. Round t to zero decimal places. -15 Let i = -44674183 + 75576183. Round i to the nearest 100000. 30900000 Let q be (-14 - 105/(-7))-17-2383. Round q to the nearest one thousand. 41000 Let u = 367.7 + -310. Let t = 54 - u. Let q = t + 3.962. What is q rounded to two dps? 0.26 Let z(g) = 21594g + 82. Let i be z(-3). What is i rounded to the nearest 100000? -100000 Let j = -75 + 71. Let f be -5 - -9 - (0 - j). Suppose -541 - 839 = -y - 5i, f = y + 4i - 1384. What is y rounded to the nearest one thousand? 1000 Let g = 33329534 + -33194457.9865. Let k = g - 135131. Let l = 55 + k. Round l to three decimal places. 0.014 Suppose 6a + 5l + 4 = 2a, -5a + 40 = -5l. Suppose ap + 30488 = -5d, 4d + 7513 + 16893 = 2p. Round d to the nearest one thousand. -6000 Let j = -9990.0000004926 - -9990. What is j rounded to seven decimal places? -0.0000005 Let s = 418530 + -824192. Let w = -405645.0059 - s. Let z = w + -17. What is z rounded to three dps? -0.006 Let k = -0.1261 - -19.0561. Let g = k + -19. Let n = -0.0736 - g. Round n to 3 decimal places. -0.004 Let h be (-9 - -15) + (-2 - 403). Let m = -8759 - h. What is m rounded to the nearest 100? -8400 Let h = 7946.0003919 + -7946. Round h to 4 dps. 0.0004 Suppose 1019105 = 22r + 173975. Suppose 3q + 6305 = 4f - r, f = 5. Round q to the nearest one thousand. -15000 Let x = -21883.26959549 + 21012.2696041. Let p = x + 871. What is p rounded to six decimal places? 0.000009 Let a = 5933 - -3796. Let i be (-34375)/(-4 + a/2432). What is i rounded to the nearest 1000000? -84000000 Let s = 19598.172803 - 12647.166916. Let u = -6951 + s. Let z = -0.006 + u. Round z to five dps. -0.00011 Let l = -6.399 - -0.599. Let s = -45223404 + 45223398.2000037. Let j = s - l. Round j to six dps. 0.000004 Let u(z) = 4686z + 22. Let o be u(3). Suppose 10s - 11s = -o. Suppose -4y = -8y - s. What is y rounded to the nearest 100? -3500 Let r = -85.028 - -85. Let c = -0.028682 - r. Round c to 5 dps. -0.00068 Let w = 7465707 + -7465704.7600042. Let s = 2.24 - w. Round s to 5 dps. 0 Let g(u) = -2u*3 + 28u*2 + 6u - 185. Let z be g(-23). What is z rounded to the nearest 100? 38800 Let a = -2908431 + 4882731. Suppose -2v - 8j + 9j + 11396 = 0, 3j = -v + 5712. Suppose 3l - v = a. Round l to the nearest 100000. 700000 Let k = 14215 + -14215.0025481. Round k to five dps. -0.00255 Let g be 2040/(-28) + 3/(-21). Let p = 140 + g. What is p rounded to the nearest 100? 100 Let b = 2381.615151 - 2381.6. Round b to 3 decimal places. 0.015 Let j = -0.394 - -52.654. Let g = 37.4 - j. Round g to the nearest integer. -15 Let w = -1987.85 - -1882. Let x = -8.2 - -117.2. Let j = x + w. What is j rounded to one dp? 3.2 Suppose -4c - 3r = -7, -3c + 0r + 3 = 3r. Suppose 6a - ca = -27455978. Let z be 1/(-4) - a/(-44). Round z to the nearest one hundred thousand. -300000 Suppose 7u + 0u = 0. Suppose u = -5i + 3a - 464000, 3a + 246291 + 124909 = -4i. What is i rounded to the nearest ten thousand? -90000 Let z = -1293.05 + 138.75. Let q = z + 1092. Let p = 61 + q. What is p rounded to one decimal place? -1.3 Suppose 766 = f - 138. Suppose -35u - 7270 = -30u. Let y = u + f. Round y to the nearest 100. -600 Let k = 5.6511 - 5.6511054591. What is k rounded to 6 dps? -0.000005 Let a be (-9)/36-24 + 219968. Round a to the nearest one thousand. 40000 Let l(j) = -5035j + 16015. Let d be l(-107). Round d to the nearest one hundred thousand. 600000 Suppose 166 - 16 = 6c. Let f(b) = -10b - 46. Let n be f(c). What is n rounded to the nearest 10? -300 Let k = 14.119998896 + -14.12. Round k to 7 dps. -0.0000011 Let f = -3958052.999907 - -3958047. Let w = -22 - -16. Let a = f - w. Round a to 5 decimal places. 0.00009 Let o = 1432791.77999916 + -1432802.78. Let r = -10 + 21. Let b = o + r. Round b to seven dps. -0.0000008 Suppose 3y + 2 = 11. Let v be y/6 - 2951990/(-20). What is v rounded to the nearest ten thousand? 150000 Let l = 161 - -17. Suppose -72200 = 176h - lh. Round h to the nearest one thousand. 36000 Let r = -811.71 + -15.29. Let t = r - -827.1314. Round t to 2 decimal places. 0.13 Let f = -284 - 678. Let t = -961.9999796 - f. What is t rounded to five decimal places? 0.00002 Let u = -28300463102473 - -28300462988358.84809989. Let k = u + 114122.2519. Let z = k + -8.1. Round z to seven decimal places. -0.0000001 Let f be 5025 + 8/(-12)3 - (24 + -28). What is f rounded to the nearest one thousand? 5000 Let p = -35186.04 + 35149. What is p rounded to the nearest integer? -37 Suppose 234u = 2g + 238u - 22993972, 4u - 45987972 = -4g. Round g to the nearest 100000. 11500000 Let x = 3265 + -3106.85. Round x to the nearest 10. 160 Let r = 32.499981269 + -32.5. What is r rounded to six decimal places? -0.000019 Let w = -306.985552 + 307. What is w rounded to 3 decimal places? 0.014 Let q = 331285 + -234847. Suppose 0 = 2s + b - 0b + q, 0 = -4b. Let j = s + 23219. Round j to the nearest 10000. -30000 Let a = -1286.98742 - -1287. Let g = 1.588 + -1.6. Let s = g + a. Round s to 4 decimal places. 0.0006 Let f = -11269 - -11735.3. What is f rounded to the nearest 100? 500 Let b = -12382165.8500277 + 12382165. Let k = b + 0.85. Round k to 6 decimal places. -0.000028 Suppose -b - 2i = -6i - 5, 5b - 25 = i. Suppose -bu = -3u - 932000. Round u to the nearest one hundred thousand. 500000 Let c = -28.5032 - -23.974. What is c rounded to two dps? -4.53 Let m = -0.2449 - -183.7249. Let i = m - 154.6. What is i rounded to the nearest 10? 30 Let y = -117.78 - -22.68. Let i = y + 99. Let s = -3.90000035 + i. Round s to seven dps. -0.0000004 Let g = 614 + -61. Let v = g + -329. Let j = v + -224.131. What is j rounded to 2 decimal places? -0.13 Suppose 0 = -5j, -5v = -j + 32800 + 28395. Let b = -1139 - v. Round b to the nearest ten thousand. 10000 Let o = 9349 - 9394.79. Let d = -0.21 + o. Let j = d + 45.9999997. What is j rounded to six dps? 0 Let a = 193 - 193.043. Let x = a + 0.04300196. Round x to 7 decimal places. 0.000002 Let p = -174 - -171.137. Let u = p - -2.12. Round u to 1 decimal place. -0.	{ "pile_set_name": "DM Mathematics" }
= -6d(v) + 5s(v). Determine x(h(l)). -26l Let a(s) = -s2 - s. Let o(d) = 26d*2 + 39d. Let n(q) = 39a(q) + o(q). Let y(i) = i2. Give y(n(w)). 169w4 Let f(d) be the third derivative of -d8/2240 - d*5/60 - 10d*2. Let a(y) be the third derivative of f(y). Let l(w) = -w. Calculate l(a(u)). 9u2 Let q(o) be the third derivative of -o4/12 + o2. Let c(w) be the first derivative of w4/6 + w + 1. Let s(n) be the first derivative of c(n). Give q(s(d)). -4d2 Let x(u) = -16u. Let p(m) = -2m - 63. What is p(x(q))? 32q - 63 Let f(z) = 2z2 - 5z. Let x(k) = -3k2 + 7k. Let v(p) = 7f(p) + 5x(p). Let g(i) = -3i - i + 5i. Give g(v(u)). -u*2 Let v = 2 - -14. Let n(x) = 16 - 9x*2 - v. Let l(u) = 2u*2. What is n(l(t))? -36t*4 Let j(u) = 2u*2. Let p(x) = -15x*2. Suppose -9b + 10b = -13. Let h(r) = 7r*2. Let a = -8 + 2. Let d(c) = ap(c) + bh(c). Determine d(j(l)). -4l*4 Let q(g) = 3g2. Let x(c) be the first derivative of -c4/6 + 2c - 4. Let m(l) be the first derivative of x(l). Give q(m(k)). 12k*4 Let r(h) = -14h*2. Let z(f) = -7f + 5. Let x(y) = 11y - 8. Suppose 0 = -2k + 4q - 32, 2k + 12 = 3q - 16. Let a(v) = kz(v) - 5x(v). What is a(r(b))? -14b*2 Let q(j) = -2j*2. Let r(s) = 256s*2 - 2. Calculate q(r(y)). -131072y*4 + 2048y*2 - 8 Let k(o) = 44o2. Let d(v) = v2 + 3v + 3. Let a(n) = -2n*2 - 5n - 5. Let m(p) = 6a(p) + 10d(p). Determine k(m(g)). 176g4 Let r(t) = -161t. Let k(g) = -g*2. What is k(r(a))? -25921a*2 Let h(m) = 2m. Let q(b) = b + 1. Let u(v) = -98v - 84. Let g(s) = 84q(s) + u(s). What is h(g(x))? -28x Let d(l) = -4l + 2l + l. Let h(z) be the second derivative of 2z*3/3 - 4z. What is h(d(q))? -4q Let f(a) be the second derivative of 0 + 0a*2 + 0a*3 - 1/6a*4 + 4a. Let d(l) = 8l. Determine f(d(u)). -128u*2 Let c(g) = -4g*2 + 5g. Let l(z) = 5z2 - 6z. Let q(m) = 6c(m) + 5l(m). Let d(i) = -49i + 144i - 48i - 48i. Calculate q(d(s)). s*2 Let u(p) = 40p - 3. Let i(x) = -3x2. Calculate i(u(a)). -4800a*2 + 720a - 27 Let c(v) be the first derivative of 3v - v2 - 2 - 3v. Let d(g) = 2g. Give d(c(j)). -4j Let n(h) = -16h. Let a(z) = -z2. Give a(n(c)). -256c*2 Let v(t) = -7t. Let y(k) be the second derivative of k*4/4 - 29k. What is y(v(m))? 147m2 Let m(z) be the third derivative of -6z*2 + 0z*3 + 0z + 0 - 1/12z4. Let j(q) = 5q*2. What is m(j(v))? -10v*2 Let p(x) = -6x. Let w(f) = f. Let s(d) = -2p(d) - 14w(d). Let k(v) = -3v2 + 25v - 25v. Give k(s(i)). -12i*2 Let v(i) = -2527i*2. Let a(m) = -2m. What is a(v(o))? 5054o2 Let c(i) be the first derivative of -2 + 0i3 - i2 - 1/60i5 + 0i*4 + 0i. Let n(p) be the second derivative of c(p). Let q(l) = 2l2. Give q(n(s)). 2s*4 Let i(h) = -2 - 2 - 2h + 4. Let y(w) = w. Give i(y(v)). -2v Let h(f) = 3f*2 + 0f*2 + 2f*2. Let x(p) = -2p*2 - 4p. Let n(d) = d*2 + d. Let w(q) = -4n(q) - x(q). Give h(w(y)). 20y4 Let t(m) = -14m - 11. Let o be (-4)/(-14) + 568/(-28). Let s = o + 9. Let i(j) = -5j - 4. Let d(a) = si(a) + 4t(a). Let r(w) = -w2. What is d(r(x))? x2 Let t(r) = 4r*2. Let i(d) = -227d*2. Calculate t(i(a)). 206116a*4 Let s(r) = r + 4. Let j(w) = 0w - 4 - w + 1. Let v(m) = -4j(m) - 3s(m). Let y(c) = 3c2. Give y(v(g)). 3g*2 Let j(a) = -2. Let c(w) = w - 3. Let z(v) = -2c(v) + 3j(v). Let k(g) = 25g. Let i(o) = -3k(o) - 40z(o). Let f(x) = -2x. Calculate f(i(t)). -10t Let x(h) = -h*2. Let b(y) = 3y. Let l(k) = 3k. Let a(g) = 4b(g) - 5l(g). Give a(x(m)). 3m*2 Let r(m) = 9m + 2. Let s(j) = 22j2. Calculate s(r(g)). 1782g*2 + 792g + 88 Suppose -4w - 3 = -15. Let j(p) = -p2 + 2p*2 - wp*2. Let u(m) = 6m. Let r(h) = 7h. Let l(b) = -5r(b) + 6u(b). Determine j(l(y)). -2y*2 Let z(v) be the third derivative of 0 + 0v*3 - 1/24v*4 + 2v*2 + 0v. Let r(k) = 3k. Give z(r(g)). -3g Let k(b) = -7b. Let d(r) = 4r*2 - 6r. Let l(z) = -3z2 + 5z. Let t(s) = 5d(s) + 6l(s). Give k(t(j)). -14j2 Let k(t) = 6t - 7. Suppose 36 + 20 = 4x. Let i(l) = l - 1. Let p(d) = xi(d) - 2k(d). Let f(y) = -3y. Give p(f(n)). -6n Let u(j) be the first derivative of 0j + 0j2 - 3 - 2/3j*3. Let q(a) = 2a. Calculate q(u(g)). -4g2 Let y(q) = -6q. Let o(u) = 30u. Determine o(y(l)). -180l Let t(v) = -2v. Let w(g) = 48 - 48 - g. Give t(w(x)). 2x Let h(z) = 27z2 - 3z. Let k(g) = -19g. What is k(h(r))? -513r*2 + 57r Let a(g) = -19g + 4g + 8g + g. Let l(o) be the second derivative of o4/6 + 2o. Give a(l(n)). -12n2 Let l(b) = 8b*2 - 6b - 6. Let h(n) = -23n2 + 17n + 17. Let o(w) = 6h(w) + 17l(w). Let g(c) = -4c. Determine g(o(v)). 8v*2 Let y(d) = 46d. Let j(n) = 5n. Determine j(y(i)). 230i Let p(r) be the first derivative of -r*2 - 33. Let m(z) = -38z*2. Determine p(m(c)). 76c*2 Let k(v) = -6v*2. Let z(u) = -14u + 17u + 6u. Calculate k(z(g)). -486g2 Let b(g) = -6g. Let s(r) = -33r2. Calculate s(b(d)). -1188d2 Let b(x) be the second derivative of -x3/2 - 19x. Let h(z) = -19z*2. Calculate h(b(q)). -171q*2 Let y(k) be the second derivative of 7k*3/6 - 9k. Let f(d) = -d. Calculate f(y(g)). -7g Let p(d) = d. Let z = 13 + -5. Let m(u) = -zu + u + 4u. What is p(m(v))? -3v Let j(k) = 15k2. Let a(t) = 4t*2 + 31. What is j(a(x))? 240x*4 + 3720x*2 + 14415 Let u(q) = 40 - 40 - 5q. Let h(t) be the second derivative of 0t2 + 0 - 1/12t*4 + t + 0t*3. Determine h(u(j)). -25j*2 Let y(w) = -9w*2 + 2w. Let a(c) = 28c2 - 7c. Let i(k) = -2a(k) - 7y(k). Let f(s) be the first derivative of s*3/3 + 4. What is i(f(m))? 7m*4 Let a(v) = 5v*2. Let t(i) be the third derivative of -5i*4/24 + 12i*2. Determine t(a(g)). -25g*2 Let s(z) = -4z. Let h(x) = -4x. Let p(i) = 3 - 10 + 7 + 2i. Let j(c) = 6h(c) + 13p(c). What is j(s(f))? -8f Let w(t) = -1811t*2. Let a(u) = 2u*2. Give a(w(h)). 6559442h*4 Let z(v) = 4v. Let y(d) = -d + 2. Let s(g) = 84g - 140. Let n(p) = s(p) + 70y(p). Calculate z(n(j)). 56j Let r(g) be the second derivative of -11g*4/12 - 13g. Let n(x) = -x*2. Give n(r(l)). -121l*4 Let q(w) = -4w. Let a(y) = 0 - 2y + 2 - 2. Give a(q(k)). 8k Let o be ((-9)/3)/((-1)/2). Let l(t) = 2t + 6. Let v(i) = -i - 1. Let r(w) = ov(w) + l(w). Let s(d) = 2d2. Give r(s(k)). -8k*2 Let y(h) = -2h*2. Let n(a) = 425a*2 + 6a - 1. Calculate n(y(k)). 1700k4 - 12k*2 - 1 Let q(j) = -1 + j + 0j + 0. Let t be q(3). Let u(w) = -2w + 2w + tw2. Let y(n) = -2n. Calculate y(u(f)). -4f2 Let z(y) = 9y. Let h(f) = 9f2 - 11f. Calculate z(h(d)). 81d2 - 99d Let b(y) = -y - 1. Let a(l) = 3l + 5. Let i(c) = -a(c) - 5b(c). Let r(w) be the first derivative of 2 - w*3 + 3w*3 - 3w*3. Determine i(r(o)). -6o2 Let l(n) be the second derivative of n4/3 - n. Let f(c) = -9c2 - 13c. Let v(i) = 2i2 + 3i. Let m(u) = -6f(u) - 26v(u). Determine m(l(s)). 32s4 Let m(v) = -52v. Let c(p) = p. Determine c(m(r)). -52r Let f be (3/(-4))/(1/(-4)). Let v(a) = 0a + fa - a + a. Let h(m) = -2m*2. Determine v(h(t)). -6t*2 Let g(w) = -3w. Let j(t) = -11t - 12. Determine j(g(a)). 33a - 12 Let c be ((-3)/15)/((-6)/150). Let r(x) be the third derivative of 0 + 0x4 + 0x3 - x2 + 0x + 1/60x*c. Let q(t) = 3t*2. What is r(q(f))? 9f*4 Let x(h) = 423h. Let a(r) = -r. Determine a(x(j)). -423j Let p(s) = 1 - 1 + 2s. Let y = 8 - 2. Let g(d) = -d - d + yd. What is p(g(v))? 8v Let p(o) = -3o. Let y(s) = 5s. Suppose 4z + 12 = 8z. Let l(v) = 2v. Let c(t) = zy(t) - 7l(t). Give p(c(j)). -3j Let g(j) be the third derivative of -j7/5040 + j5/30 - 3j2. Let c(i) be the third derivative of g(i). Let p(s) = -3s. Determine p(c(b)). 3b Let o(h) = -5h + 253. Let z(q) = -2q2. Calculate z(o(r)). -50r*2 + 5060r - 128018 Let q(d) = 2d. Let p(x) = 340x*2 - 2. Give q(p(n)). 680n*2 - 4 Let g(i) be the first derivative of 3i*2/2 - 1. Let a(v) = -v. Give a(g(k)). -3k Let v be (4/(-12))/(3/(-54)). Let z(p) = -2p + 3. Let f(n) = n - 1. Let q(y) = vf(y) + 2z(y). Let d(w) = -6w*2. Determine d(q(m)). -24m*2 Let o(t) = -17t**2. Let x(u) be the third	{ "pile_set_name": "DM Mathematics" }
usand? -1959000 What is -3764167.009 rounded to the nearest 100? -3764200 What is -14174452.9 rounded to the nearest 1000? -14174000 Round 25831748.23 to the nearest 1000. 25832000 Round 59.7883709 to 3 dps. 59.788 What is 101301.168 rounded to the nearest 10? 101300 Round 8037.42915 to 0 dps. 8037 Round 266307.5145 to the nearest 10000. 270000 What is 0.003466946393 rounded to seven decimal places? 0.0034669 What is -1502952.559 rounded to the nearest ten thousand? -1500000 What is 0.000359537928 rounded to 4 decimal places? 0.0004 What is -11700071.5 rounded to the nearest one million? -12000000 What is 0.001915631905 rounded to 4 dps? 0.0019 What is -168107736 rounded to the nearest ten thousand? -168110000 Round -133658.116 to the nearest one thousand. -134000 What is 51.3663191 rounded to 2 decimal places? 51.37 What is -1198703.8 rounded to the nearest one million? -1000000 What is -41217805.15 rounded to the nearest one million? -41000000 What is 0.1915371867 rounded to four decimal places? 0.1915 Round 27875.7066 to the nearest one hundred. 27900 What is -1048.972892 rounded to the nearest 100? -1000 What is 2245.15679 rounded to the nearest integer? 2245 What is 65.94025321 rounded to one dp? 65.9 What is -3.96164118 rounded to 2 dps? -3.96 Round 0.006180239178 to 3 dps. 0.006 Round 256688.09465 to the nearest 10000. 260000 Round 10.01105114 to two decimal places. 10.01 Round -1014.73883 to the nearest ten. -1010 Round 1131923.651 to the nearest one thousand. 1132000 Round -0.0344503746 to three dps. -0.034 Round -446.844621 to 2 decimal places. -446.84 What is 146268.362 rounded to the nearest one thousand? 146000 Round -0.06583802927 to 4 dps. -0.0658 Round 1049.947718 to zero decimal places. 1050 What is -0.0000000712931442 rounded to seven decimal places? -0.0000001 Round 16177338.4 to the nearest one million. 16000000 What is -673608.09 rounded to the nearest one hundred? -673600 What is -377856.316 rounded to the nearest one thousand? -378000 What is 0.0000080524073 rounded to 6 dps? 0.000008 Round -1407591.1 to the nearest 100. -1407600 What is 0.0002970045148 rounded to five decimal places? 0.0003 What is -1.18076305 rounded to 4 dps? -1.1808 What is -3.78942142 rounded to 4 dps? -3.7894 Round 0.48681478 to one dp. 0.5 Round -0.0000377469 to 7 dps. -0.0000377 Round 1611.12599 to one dp. 1611.1 Round 706299.155 to the nearest 100. 706300 Round 20127387 to the nearest one million. 20000000 Round 134825.9908 to the nearest 10. 134830 What is -0.00004919872 rounded to seven dps? -0.0000492 What is -853702250 rounded to the nearest 1000000? -854000000 Round 0.00001057722175 to six dps. 0.000011 What is 51897.2317 rounded to the nearest 1000? 52000 Round -141450796.6 to the nearest 1000000. -141000000 What is 0.1810935316 rounded to 5 decimal places? 0.18109 What is 954118.3 rounded to the nearest one hundred thousand? 1000000 What is -0.000348791639 rounded to four decimal places? -0.0003 What is -0.00042206068 rounded to 7 decimal places? -0.0004221 What is -1.78980695 rounded to 3 dps? -1.79 What is -0.00004647408 rounded to 5 dps? -0.00005 Round -145.632359 to the nearest 10. -150 What is 233.093227 rounded to one dp? 233.1 Round 2274.0285 to the nearest ten thousand. 0 What is 0.000025196033 rounded to 7 dps? 0.0000252 Round -28542.00099 to the nearest 1000. -29000 Round -0.05060502946 to two dps. -0.05 What is 3359098.4 rounded to the nearest one million? 3000000 Round 0.20443649 to 4 dps. 0.2044 What is 3.71293884 rounded to 4 decimal places? 3.7129 Round -3690.147747 to one dp. -3690.1 What is 0.0010231143012 rounded to 7 decimal places? 0.0010231 What is 0.05979438174 rounded to 5 decimal places? 0.05979 What is -66080.78102 rounded to the nearest ten thousand? -70000 What is 6.05613003 rounded to one decimal place? 6.1 Round 21637843.05 to the nearest one million. 22000000 Round -0.00003264197 to three dps. 0 What is -0.010493463295 rounded to 3 decimal places? -0.01 Round 915537 to the nearest 100. 915500 What is 1.4053696 rounded to 1 dp? 1.4 What is 2723.57205 rounded to the nearest one hundred? 2700 What is 1070888717.2 rounded to the nearest ten thousand? 1070890000 What is 2718612.8 rounded to the nearest ten thousand? 2720000 Round 21028565.911 to the nearest 100000. 21000000 Round 0.0276512071 to five decimal places. 0.02765 Round -2.041338244 to 2 dps. -2.04 Round 9781091.2 to the nearest one thousand. 9781000 What is 0.238380307 rounded to 2 dps? 0.24 What is 4499913.69 rounded to the nearest 1000? 4500000 Round -66823581 to the nearest 10000. -66820000 What is -4.832636776 rounded to one dp? -4.8 What is 1051920360 rounded to the nearest 100000? 1051900000 What is 691.704334 rounded to the nearest 100? 700 What is -28.92344 rounded to 0 dps? -29 What is -0.0000014854361145 rounded to seven decimal places? -0.0000015 Round 3165429310 to the nearest one million. 3165000000 What is -93.806038 rounded to two dps? -93.81 Round 0.01894538092 to 6 decimal places. 0.018945 What is 365507.14 rounded to the nearest 100? 365500 What is -181508.589 rounded to the nearest 100000? -200000 What is -0.0000537804948 rounded to seven decimal places? -0.0000538 What is 870011.87 rounded to the nearest ten thousand? 870000 Round -11288.918 to the nearest ten. -11290 What is 32187432.6 rounded to the nearest ten thousand? 32190000 Round 40.0323968 to zero decimal places. 40 What is -609.0035085 rounded to the nearest 10? -610 Round 40391511.8 to the nearest one thousand. 40392000 What is 0.000000009017065 rounded to seven dps? 0 What is -328371.069 rounded to the nearest ten thousand? -330000 Round 0.28390763 to two dps. 0.28 What is 15493.9376 rounded to the nearest ten thousand? 20000 What is 0.000462203883 rounded to 7 dps? 0.0004622 Round -0.0848262715 to two decimal places. -0.08 Round -245101.935 to the nearest one hundred thousand. -200000 Round 18480050.9 to the nearest one thousand. 18480000 What is 0.002196353 rounded to 4 dps? 0.0022 What is 48.095047 rounded to the nearest 1000? 0 What is 0.001073779103 rounded to five dps? 0.00107 Round -0.00024789538 to seven decimal places. -0.0002479 Round 200079.872 to the nearest 10000. 200000 What is -1712596500 rounded to the nearest 100000? -1712600000 What is 73185208.61 rounded to the nearest 1000000? 73000000 What is 0.000420963931 rounded to six decimal places? 0.000421 What is -0.332214307 rounded to four decimal places? -0.3322 What is 759.981177 rounded to 0 decimal places? 760 Round -0.029490567 to five decimal places. -0.02949 Round 0.0057328716 to 4 decimal places. 0.0057 Round -0.04007687632 to 2 decimal places. -0.04 Round -2394738.007 to the nearest 1000. -2395000 What is 24848.4321 rounded to the nearest ten? 24850 What is -40194.219 rounded to the nearest 10000? -40000 What is -0.000000365471558 rounded to 7 decimal places? -0.0000004 What is -433591.8747 rounded to the nearest 1000? -434000 Round 95806.9082 to the nearest one thousand. 96000 What is -58.92732369 rounded to two decimal places? -58.93 Round 1858.449428 to the nearest integer. 1858 What is -1843149.59 rounded to the nearest 1000000? -2000000 Round -104772523.7 to the nearest ten thousand. -104770000 What is -22612427000 rounded to the nearest 1000000? -22612000000 Round -0.0039375708 to 3 decimal places. -0.004 Round -484.2696423 to two decimal places. -484.27 Round -16.00005665 to 2 decimal places. -16 What is 0.0000264597632 rounded to 6 dps? 0.000026 Round 2.74835259 to three decimal places. 2.748 What is 0.0080398035 rounded to six dps? 0.00804 What is 641507.57 rounded to the nearest one hundred? 641500 Round 0.016815907561 to four decimal places. 0.0168 What is 3034635300 rounded to the nearest one million? 3035000000 What is -0.0010133920383 rounded to five decimal places? -0.00101 Round -0.051424076 to 3 decimal places. -0.051 What is 0.00003170553105 rounded to five dps? 0.00003 What is -18707772523 rounded to the nearest 100000? -18707800000 Round 2812.60483 to the nearest 10. 2810 What is -84432.6586 rounded to the nearest one thousand? -84000 What is -1.893416505 rounded to two decimal places? -1.89 Round 0.06020268682 to 2 dps. 0.06 What is 0.000301675283 rounded to six decimal pla	{ "pile_set_name": "DM Mathematics" }
u. -1044 Express -606v + 3 - 3 - 201v + 164v as t + jv and give j. -643 Express -u*2 - 3u - 43u4 + 15u + 13u4 - 24u*4 - 13u in the form lu + nu*4 + vu*3 + m + tu*2 and give n. -54 Express -2v*3 - 599 + 612 + 3v*3 as r + tv*2 + mv*3 + fv and give m. 1 Express -2m3 + 3 + 166m*2 - 2m + m*3 - 69m*2 - 66m*2 as w + um + nm2 + dm*3 and give n. 31 Rearrange (-17k + k - 52k)(2 + 1 - 5)(3 - 2 - 2k - 2) to sk2 + x + fk and give s. -272 Express (4 + 0 - 3)(-h + 1 - 1) + 0h + 3h - 2h + 2h + 0h - h + (3h - h - h)(5 - 1 - 3) + 204 + 72h - 204 as o + ih and give i. 74 Rearrange (1 + 0 + 1)(-9 - 6t + 9) + (1 - 5 + 1)(t + t + 0t) - 2t - t + 5t + 6t - 5t - 2t to lt + k and give l. -17 Express 25p + 24 - 11 - 15 as gp + d and give g. 25 Rearrange (-2b3 - 2b*2 + 2b*2)(832 + 632 - 382 + 330) to mb + d + yb*2 + vb*3 and give v. -2824 Rearrange (3 - 3 + 1)(0 - 1 + 0)(-3j*2 - 2j*2 + 6j*2)(3 + 1 - 1)(-8 - 8 - 6) to cj + pj2 + q and give p. 66 Express (-3x*2 + 2x*2 + 6x*2)(-x - 4 + 4)(3599 + 70x - 3599) in the form cx4 + nx + zx3 + yx*2 + s and give y. 0 Express (8 + 3 - 2 + 7)(-15z - 8z + z*2 + 4z*2) in the form dz*2 + n + bz and give b. -368 Express (2s2 - s2 - 3s*2)(-11s - 18s + 121 + 28s) in the form f + ts*3 + ps*2 + us and give p. -242 Rearrange (q + 4q + 3q)(-2 + 0 + 0) + 5 + 10 + q + 9 to the form kq + f and give f. 24 Rearrange 514g3 - 500g*3 + 3g + 3 - 3g to mg*3 + ug + z + jg2 and give z. 3 Express -3s*3 - 169s4 + s2 - 3s2 + 171s*4 + 3s + 6s2 as p + as + os2 + ts*4 + rs*3 and give t. 2 Rearrange -33b + 109b - 84b*2 - 69b to the form sb2 + p + tb and give s. -84 Express 20 - 20 - 24l4 + (-7l*2 + 15l*2 - 4l*2)(-l - 3l2 + l) in the form vl*4 + ml*2 + fl + kl3 + b and give b. 0 Rearrange -50a + 125a + 73a to r + da and give d. 148 Express (-19k + 2k4 - 5k*2 + 19k)(520 + 513 - 1043) as nk*2 + wk*3 + ik + mk4 + q and give n. 50 Rearrange (3q*3 - 2q*3 - 3q*3)(-q + q - 2q) - 35q*4 - 19q*4 - 270q*4 to gq*3 + mq*2 + x + aq*4 + jq and give a. -320 Rearrange (3s - 3s + s*2)(2 - 1 - 3) + s2 - s2 + s*2 + 262s*2 - 31s*2 - 43s*2 + (2s + 0s + s)(s - 4s + 4s) to u + ls + hs*2 and give h. 190 Rearrange (8 - 8 - 4k)(-2k - 2k - k) + k2 + 0k*2 + 4k*2 + 27k*2 to vk*2 + ck + y and give v. 52 Rearrange -9l4 - 2l + 11l4 - 423l*3 + 2 + 420l*3 + 2l*2 to the form yl + ol4 + p + fl*3 + gl*2 and give o. 2 Express 6x - 22x + 9x - 2x + 5x + 0x + (-1 + 4 - 2)(-x + 5x - 3x) in the form i + tx and give t. -3 Express 475m - 236m - 63 - 41 - 67 - 241m as hm + q and give h. -2 Express (395f*2 - 636 - 191f*2 - 202f*2)(4f - 4f - f) as s + of2 + if*3 + kf and give i. -2 Rearrange -54y2 + 12y2 + y2 + 15y2 + 5y - 41y2 to the form xy + r + ly2 and give x. 5 Rearrange 3b - 2b2 - 3b + b*2 + b - b + (b + 2b - 2b)(-2b - 4b + 4b) + (3b*2 - 2b*2 - 3b*2)(410 + 346 - 926) to ib2 + z + ob and give i. 337 Rearrange 10 + 31 + 15 + 749c + c2 - 750c to yc + wc*2 + s and give s. 56 Rearrange (5m*2 - 2m2 - m2)(-325 + 38 - 290 + 107) to the form z + km + tm2 and give t. -940 Express (-1360s*2 + 681s*2 + 680s*2 + 135)(s*2 + 3s*2 - 3s*2) in the form zs*2 + rs*4 + w + ls + as3 and give r. 1 Express 12 - 7j2 - 12 - j3 + 3j - 2j3 + j3 as pj3 + hj + cj2 + r and give c. -7 Express (15 + 6v*2 - 15)(1 - 1 - 2)(18 - 16 - 66) in the form sv*2 + r + cv and give s. 768 Rearrange (0 - 2k - 62 + 6)(2k2 - k2 - 3k*2)(2k - k - 2k) to the form zk + rk*3 + lk*2 + nk*4 + q and give r. -112 Express (0 + 7 + 4)(3z2 - 2z*3 + 5z*2 - 5z + 8z) as mz*3 + y + rz + vz2 and give v. 88 Rearrange 20r - 3 + 6r + 5r - 5 + 0 to the form jr + f and give f. -8 Express g3 + 89g - 5g3 + 1 + g2 - 86g as m + ng2 + vg*3 + og and give o. 3 Rearrange -d2 + 3407 - d - d4 - 6473 + 3307 to sd2 + ad + b + od4 + gd*3 and give o. -1 Express (3o - 2o + o + 1)(23o2 - 84o*2 - 94o*2 + 2) as yo*2 + po + jo3 + u and give j. -310 Rearrange 11c + 7c - 10c + (-2c + 0c + 4c)(3 - 1 - 3) - 2c + 2 - 2 + 11c - 8c + 13c to the form w + fc and give f. 20 Rearrange 2 + 0 - v3 + 22v*4 + 270v + 3v2 - 270v to the form dv + yv*3 + tv*4 + x + cv*2 and give x. 2 Express 2 + 9 + 8 + 44o*2 + 2 - 13 in the form xo*2 + po + z and give x. 44 Express -13z3 + z + 6z*3 - 3z*2 - 2z3 + z2 - 12z3 in the form uz*2 + hz + iz3 + b and give i. -21 Express -3 - 97r*3 + 213r*3 + 10 + 2 - 104r*3 as hr + ur2 + n + qr*3 and give q. 12 Express 3 - 2b + 3b + 0b - 18b3 + 2b*4 - 6 - 1 - 2b*2 as gb*4 + x + qb*2 + mb + cb3 and give g. 2 Rearrange ((4m - 2m - m)(-1 - 4 + 6) + 3m + m + 5m - 4m + 1 - 1)(0 - 3m + 0) to d + um + sm2 and give s. -18 Express 2d*4 + 2d - d*2 + d + d - 15d + 3d3 as qd*3 + pd*4 + vd + yd2 + n and give v. -11 Express (3 - 3 + 2)(-3g - 713 + g + 820) in the form n + ag and give n. 214 Rearrange (-5 + 3 + 4)(-5r + 4r + 5r + (3 - 4 + 3)(3 + 3r - 3) - 1 + 1 + 2r + 5r - r - 3r + (r + r + 0r)(-1 - 3 + 1)) to zr + b and give z. 14 Express (-17y - 16y - 47y)(12 - 9 + 7) + 3y - 5y + y in the form g + ay and give a. -801 Express 4g + 0 + 0g - 2g*3 - 4g*4 - g + 16g*2 - 3 - 17g*2 as y + jg + tg2 + ag*3 + sg*4 and give s. -4 Express -4l*4 + 4 - 106l - 102l + 206l as jl2 + il*4 + rl + yl3 + b and give r. -2 Rearrange (-20a - 29a2 + 20a)(a - 3a + 4a)(4 - 1 - 4) to va3 + ta*2 + xa + s and give v. 58 Express 929 - 24t - 929 + 2t + 0 + 0 - 2t + 2t - t + (2t + 3t - 3t)(-4 + 0 + 3) + 2t - 5t + t - t + 0t + 2t + 3t + 0t - 4t as c + rt and give r. -27 Rearrange (i + 3i - 2i)(2 - 5 - 8 + 1528i + 13) to ci + ki*2 + f and give c. 4 Rearrange 7w*3 - w - 1 - 7w*2 - 83250w*4 + 2w*2 + 83249w*4 to the form x + bw + tw4 + gw*3 + pw*2 and give b. -1 Rearrange -3 + 3 + 115h*2 + 2h*2 to x + kh*2 + lh and give k. 117 Rearrange (64v - 63v + 20 + 32)(3v - 6v - 2v) to the form av2 + wv + i and give a. -5 Rearrange (-3 + 0 + 1)(-b2 - 2b3 + b2) + 2b3 + 0b3 + b3 + 0b3 + 13b*3 + 16b*3 to the form ub*2 + c + ab*3 + fb and give a. 36 Express (121s + 122s + 7 - 245s)(s + 0s + 3s)(5 - 3 - 1) in the form zs*2 + g + ls and give g. 0 Rearrange ((3 - f - 3)(-5 + 5 + 1) + 3f - 4f - 2f + 81f - 48f + 74f)(-1 + 1 + f) to bf + q + sf*2 and give s. 103 Express (0f*2 + 2f*2 + 0f*2)(4 - 4 + 2)(-41 + 127 - 53) in the form z + qf*2 + of and give q. 132 Express 13b3 - 36b*3 + 12b*3 + 5b*3 + 3b*4 + 9b*3 - 1 + 5b as ub3 + cb*2 + ib + v + db4 and give d. 3 Express -6338 + 50k + 3170 + 3170 as uk + f and give u. 50 Express -v2 - 134v + 2 - 9v3 + 132v + 0v3 as ov*2 + d + kv + wv3 and give k. -2 Rearrange (0 + 4 - 6)(-3o + o + 4o)(6o*2 + 26o*2 - 17o*2) to i + vo*3 + jo*2 + ao and give v. -60 Rearrange -18368u + 18368u - u*3 - 45 + 2u*2 + 3u*3 to the form cu*2 + lu + s + vu3 and give v. 2 Rearrange 537146i*3 + 3i - 5i + 4i*2 + 2 - 537302i*3 to ai + ci2 + l + pi*3 and give l. 2 Rearrange 13d - 53 - 33d + 11d + 10d - 134 to the form c + bd and give c. -187 Rearrange 2r - r + 0r + 522r3 - 520r*3 - 3r - 559r4 to the form mr*3 + q + cr + nr2 + gr*4 and give c. -2 Rearrange (p - 26p - 11p)(-3 + 2 + 2 - 2 - 3 + 3 - 3 + 3 + 1 + 0 + 2 + 0 + (-5 + 2 + 1)(5 - 3 - 4) + 4 - 2 - 1) to yp + b and give y. -252 Express -14 - 21f2 - 2f2 + 7 - f2 in the form cf2 + vf + h and give h. -7 Rearrange (-32 + 6 + 2)(3p - p*2 + 4p*2 - 4p - 2p3) to the form tp + op2 + xp*3 + d and give t. 24 Rearrange -16q*3 - 5q*4 + 64q*2 + 8q*4 + 16q*3 + 33q*2 + q - 2 to the form r + wq*3 + yq*2 + zq + nq*4 and give n. 3	{ "pile_set_name": "DM Mathematics" }
d without replacement from {e: 1, m: 2, g: 1, j: 1, i: 1, a: 1}. Give prob of picking 1 m, 1 i, 1 j, and 1 g. 2/35 Three letters picked without replacement from uueuuuuuueu. What is prob of picking 1 u and 2 e? 3/55 Calculate prob of picking 1 h and 1 t when two letters picked without replacement from htth. 2/3 Three letters picked without replacement from {h: 1, k: 2, d: 5, m: 3, s: 7}. What is prob of picking 1 m and 2 s? 21/272 Calculate prob of picking 3 n and 1 o when four letters picked without replacement from nnpnobnnodolbdboldno. 20/969 What is prob of picking 1 q, 1 e, and 2 s when four letters picked without replacement from {m: 3, c: 2, s: 4, e: 4, q: 1, w: 1}? 8/455 Two letters picked without replacement from {d: 11, e: 3, n: 3, t: 3}. Give prob of picking 1 d and 1 e. 33/190 Four letters picked without replacement from bizpiwpwwibwipiwnzi. Give prob of picking 2 n, 1 p, and 1 b. 0 Four letters picked without replacement from {d: 3, w: 5, n: 5}. What is prob of picking 3 n and 1 d? 6/143 Two letters picked without replacement from {z: 1, m: 13, c: 3}. What is prob of picking 2 c? 3/136 What is prob of picking 1 a, 2 u, and 1 t when four letters picked without replacement from xutattuata? 2/35 Three letters picked without replacement from baaabbbb. What is prob of picking 2 a and 1 b? 15/56 Two letters picked without replacement from fthhf. What is prob of picking 1 t and 1 h? 1/5 What is prob of picking 2 s and 2 w when four letters picked without replacement from {t: 1, l: 3, s: 2, w: 5, o: 1, a: 1}? 2/143 What is prob of picking 1 r and 2 g when three letters picked without replacement from ggrrggrrrlrggrgdgdg? 84/323 Calculate prob of picking 1 h and 1 l when two letters picked without replacement from {v: 6, l: 5, h: 2, q: 1, n: 3}. 5/68 What is prob of picking 1 z and 3 n when four letters picked without replacement from {x: 3, c: 5, z: 1, n: 4, e: 1}? 4/1001 Four letters picked without replacement from jllcljcpjllpjjjlpp. Give prob of picking 2 p and 2 l. 1/34 Three letters picked without replacement from {l: 9, i: 1, h: 4}. Give prob of picking 3 l. 3/13 Four letters picked without replacement from zzkahkhzkkhkk. What is prob of picking 1 a and 3 k? 4/143 Three letters picked without replacement from {a: 2, q: 1, n: 2, d: 1, s: 1}. What is prob of picking 1 a and 2 n? 2/35 What is prob of picking 1 e and 1 y when two letters picked without replacement from eyeeeeee? 1/4 Calculate prob of picking 4 u when four letters picked without replacement from {u: 6, c: 12}. 1/204 Four letters picked without replacement from sypdpffpfsdfpsyvfyfy. What is prob of picking 2 v and 2 p? 0 What is prob of picking 1 j and 3 c when four letters picked without replacement from jjcjjjjjccjjjjj? 4/455 Three letters picked without replacement from ggcssssngsgssggggs. Give prob of picking 1 s, 1 n, and 1 c. 1/102 Calculate prob of picking 1 w and 2 j when three letters picked without replacement from {j: 10, w: 2}. 9/22 Calculate prob of picking 2 q when two letters picked without replacement from {q: 3, b: 1}. 1/2 Calculate prob of picking 1 m and 1 d when two letters picked without replacement from bwfomdw. 1/21 Three letters picked without replacement from ucxzwwl. What is prob of picking 1 u, 1 w, and 1 c? 2/35 What is prob of picking 1 u and 2 y when three letters picked without replacement from dygydugggiyeg? 3/286 Calculate prob of picking 1 t and 1 v when two letters picked without replacement from kqrqkqvqktqqq. 1/78 What is prob of picking 1 c and 1 z when two letters picked without replacement from {z: 1, y: 2, h: 3, r: 1, c: 5}? 5/66 Calculate prob of picking 2 g, 1 i, and 1 b when four letters picked without replacement from bzzzzzzzigzzzogb. 1/910 Calculate prob of picking 1 i and 1 h when two letters picked without replacement from wwixewh. 1/21 What is prob of picking 2 w and 2 v when four letters picked without replacement from vhvhwvhhvwhhhvhhvvu? 7/1292 Two letters picked without replacement from rrsrrqrrssqrrs. What is prob of picking 2 q? 1/91 Four letters picked without replacement from {f: 16, y: 4}. What is prob of picking 4 f? 364/969 What is prob of picking 2 u and 1 t when three letters picked without replacement from vdudnuuvut? 1/20 Four letters picked without replacement from hbbmmbbbbmbhbbbm. Give prob of picking 2 h and 2 m. 3/910 Calculate prob of picking 2 y when two letters picked without replacement from zywy. 1/6 Four letters picked without replacement from pncncgnnhnngnn. What is prob of picking 1 p, 1 c, and 2 h? 0 What is prob of picking 1 g and 1 r when two letters picked without replacement from {r: 1, d: 12, g: 3, v: 4}? 3/190 Two letters picked without replacement from {y: 10, s: 4, v: 3, o: 3}. Give prob of picking 1 y and 1 v. 3/19 Calculate prob of picking 3 b when three letters picked without replacement from {x: 3, b: 15}. 455/816 Four letters picked without replacement from {f: 1, t: 2, q: 1}. What is prob of picking 3 q and 1 t? 0 Three letters picked without replacement from igiigggggugjubijiif. What is prob of picking 2 g and 1 b? 7/323 Two letters picked without replacement from cjzzc. Give prob of picking 1 z and 1 j. 1/5 Three letters picked without replacement from {p: 1, k: 1, t: 1, j: 2, r: 5}. Give prob of picking 2 j and 1 p. 1/120 Four letters picked without replacement from {y: 1, q: 7, l: 6}. What is prob of picking 1 l and 3 q? 30/143 Calculate prob of picking 2 p when two letters picked without replacement from {p: 6}. 1 Three letters picked without replacement from ooopoopooooopooooo. Give prob of picking 2 o and 1 p. 105/272 Four letters picked without replacement from mvvotvvtvotmtttvvv. Give prob of picking 2 m, 1 o, and 1 v. 4/765 Three letters picked without replacement from hhhhhhkhkhhh. What is prob of picking 1 h and 2 k? 1/22 Three letters picked without replacement from {r: 4, o: 2, y: 8, f: 3}. Give prob of picking 1 y and 2 r. 6/85 Calculate prob of picking 1 c and 1 g when two letters picked without replacement from {c: 6, g: 4, o: 4}. 24/91 Three letters picked without replacement from {b: 1, m: 3, u: 7, q: 3}. Give prob of picking 2 m and 1 u. 3/52 Four letters picked without replacement from yyslzylsyg. Give prob of picking 2 l and 2 s. 1/210 What is prob of picking 3 p and 1 s when four letters picked without replacement from phppsppppphhh? 56/715 Two letters picked without replacement from nnniininninnnninnnnn. What is prob of picking 2 i? 1/19 Three letters picked without replacement from nnnnxfxf. Give prob of picking 3 n. 1/14 Calculate prob of picking 2 g when two letters picked without replacement from {v: 8, g: 5}. 5/39 Two letters picked without replacement from dddkawldwdddlkaddld. Give prob of picking 2 d. 5/19 Three letters picked without replacement from pyyuuuuypufu. What is prob of picking 2 u and 1 y? 9/44 Two letters picked without replacement from ifape. Give prob of picking 1 p and 1 i. 1/10 Calculate prob of picking 1 h, 1 l, and 1 m when three letters picked without replacement from {r: 3, m: 1, b: 2, l: 4, g: 1, h: 1}. 1/55 Calculate prob of picking 1 j and 1 h when two letters picked without replacement from hjppjpdpjh. 2/15 What is prob of picking 2 c when two letters picked without replacement from urrccurururrrurrurr? 1/171 Four letters picked without replacement from xxxeexx. What is prob of picking 2 x and 2 e? 2/7 Two letters picked without replacement from uurlurluur. Give prob of picking 2 r. 1/15 Calculate prob of picking 1 u and 1 n when two letters picked without replacement from {x: 7, a: 1, u: 8, n: 2}. 16/153 Calculate prob of picking 1 h and 1 n when two letters picked without replacement from {f: 1, n: 11, h: 2, i: 1}. 22/105 Two letters picked without replacement from {n: 1, c: 6, j: 4, b: 6}. What is prob of picking 1 c and 1 j? 3/17 Calculate prob of picking 1 k and 1 s when two letters picked without replacement from koqkxakqsaa. 3/55 Three letters picked without replacement from kuvpk. What is prob of picking 1 v and 2 k? 1/10 Four letters picked without replacement from bebebbb. Give prob of picking 4 b. 1/7 What is prob of picking 1 n, 1 r, 1 t, and 1 a when four letters picked without replacement from alababblrbblt	{ "pile_set_name": "DM Mathematics" }
ided by 150? 145 What is the remainder when 574 is divided by 18? 16 Calculate the remainder when 782 is divided by 198. 188 What is the remainder when 78 is divided by 66? 12 Calculate the remainder when 32 is divided by 16. 0 What is the remainder when 197 is divided by 18? 17 Calculate the remainder when 202 is divided by 68. 66 What is the remainder when 230 is divided by 32? 6 Calculate the remainder when 807 is divided by 54. 51 What is the remainder when 1530 is divided by 53? 46 Calculate the remainder when 87 is divided by 43. 1 What is the remainder when 855 is divided by 280? 15 What is the remainder when 1193 is divided by 310? 263 Calculate the remainder when 230 is divided by 215. 15 What is the remainder when 726 is divided by 707? 19 Calculate the remainder when 724 is divided by 14. 10 Calculate the remainder when 87 is divided by 9. 6 What is the remainder when 34 is divided by 18? 16 What is the remainder when 148 is divided by 36? 4 Calculate the remainder when 174 is divided by 89. 85 What is the remainder when 4177 is divided by 31? 23 What is the remainder when 486 is divided by 98? 94 Calculate the remainder when 313 is divided by 56. 33 Calculate the remainder when 940 is divided by 15. 10 What is the remainder when 235 is divided by 60? 55 Calculate the remainder when 317 is divided by 47. 35 What is the remainder when 526 is divided by 11? 9 What is the remainder when 1175 is divided by 98? 97 What is the remainder when 518 is divided by 22? 12 Calculate the remainder when 1170 is divided by 329. 183 Calculate the remainder when 1887 is divided by 35. 32 Calculate the remainder when 194 is divided by 133. 61 Calculate the remainder when 289 is divided by 92. 13 Calculate the remainder when 252 is divided by 215. 37 Calculate the remainder when 544 is divided by 53. 14 Calculate the remainder when 295 is divided by 93. 16 Calculate the remainder when 196 is divided by 41. 32 Calculate the remainder when 2486 is divided by 131. 128 Calculate the remainder when 2596 is divided by 200. 196 What is the remainder when 614 is divided by 203? 5 What is the remainder when 2586 is divided by 13? 12 What is the remainder when 1525 is divided by 34? 29 What is the remainder when 209 is divided by 7? 6 What is the remainder when 63 is divided by 57? 6 Calculate the remainder when 177 is divided by 30. 27 What is the remainder when 35 is divided by 22? 13 What is the remainder when 423 is divided by 20? 3 What is the remainder when 254 is divided by 43? 39 Calculate the remainder when 1490 is divided by 97. 35 What is the remainder when 13 is divided by 8? 5 Calculate the remainder when 95 is divided by 46. 3 What is the remainder when 502 is divided by 3? 1 What is the remainder when 3117 is divided by 104? 101 Calculate the remainder when 1593 is divided by 28. 25 What is the remainder when 9633 is divided by 35? 8 What is the remainder when 51 is divided by 3? 0 What is the remainder when 952 is divided by 31? 22 What is the remainder when 293 is divided by 88? 29 Calculate the remainder when 4282 is divided by 14. 12 What is the remainder when 7280 is divided by 11? 9 Calculate the remainder when 324 is divided by 55. 49 What is the remainder when 155 is divided by 29? 10 Calculate the remainder when 178 is divided by 12. 10 Calculate the remainder when 1554 is divided by 503. 45 Calculate the remainder when 79 is divided by 10. 9 Calculate the remainder when 657 is divided by 51. 45 What is the remainder when 45417 is divided by 60? 57 Calculate the remainder when 581 is divided by 193. 2 Calculate the remainder when 313 is divided by 108. 97 What is the remainder when 39 is divided by 4? 3 Calculate the remainder when 456 is divided by 153. 150 What is the remainder when 99 is divided by 39? 21 Calculate the remainder when 74 is divided by 44. 30 Calculate the remainder when 13987 is divided by 10. 7 Calculate the remainder when 20515 is divided by 71. 67 Calculate the remainder when 6557 is divided by 3276. 5 Calculate the remainder when 1292 is divided by 25. 17 Calculate the remainder when 471 is divided by 231. 9 Calculate the remainder when 334 is divided by 297. 37 Calculate the remainder when 385 is divided by 78. 73 What is the remainder when 31860 is divided by 339? 333 What is the remainder when 2005 is divided by 72? 61 Calculate the remainder when 120 is divided by 10. 0 Calculate the remainder when 208 is divided by 100. 8 Calculate the remainder when 38 is divided by 14. 10 Calculate the remainder when 159 is divided by 18. 15 Calculate the remainder when 2494 is divided by 61. 54 What is the remainder when 216 is divided by 79? 58 What is the remainder when 111 is divided by 98? 13 Calculate the remainder when 1404 is divided by 32. 28 What is the remainder when 308 is divided by 23? 9 Calculate the remainder when 673 is divided by 181. 130 What is the remainder when 827 is divided by 83? 80 What is the remainder when 1450 is divided by 33? 31 What is the remainder when 1206 is divided by 284? 70 What is the remainder when 68 is divided by 47? 21 What is the remainder when 976 is divided by 43? 30 What is the remainder when 472 is divided by 11? 10 What is the remainder when 253 is divided by 134? 119 Calculate the remainder when 160 is divided by 24. 16 What is the remainder when 227 is divided by 58? 53 Calculate the remainder when 13609 is divided by 389. 383 What is the remainder when 310 is divided by 33? 13 What is the remainder when 233 is divided by 128? 105 Calculate the remainder when 437 is divided by 30. 17 Calculate the remainder when 763 is divided by 15. 13 Calculate the remainder when 78 is divided by 14. 8 Calculate the remainder when 189 is divided by 53. 30 Calculate the remainder when 3147 is divided by 30. 27 What is the remainder when 60 is divided by 21? 18 What is the remainder when 909 is divided by 182? 181 Calculate the remainder when 2613 is divided by 17. 12 Calculate the remainder when 558 is divided by 540. 18 What is the remainder when 153 is divided by 31? 29 Calculate the remainder when 21237 is divided by 82. 81 What is the remainder when 168 is divided by 19? 16 Calculate the remainder when 107 is divided by 29. 20 What is the remainder when 903 is divided by 449? 5 Calculate the remainder when 4745 is divided by 949. 0 Calculate the remainder when 382 is divided by 208. 174 What is the remainder when 215 is divided by 19? 6 Calculate the remainder when 656 is divided by 81. 8 Calculate the remainder when 754 is divided by 27. 25 Calculate the remainder when 12429 is divided by 16. 13 What is the remainder when 157 is divided by 36? 13 What is the remainder when 261 is divided by 5? 1 What is the remainder when 298 is divided by 58? 8 What is the remainder when 307 is divided by 44? 43 Calculate the remainder when 778 is divided by 255. 13 What is the remainder when 359 is divided by 27? 8 Calculate the remainder when 198 is divided by 40. 38 What is the remainder when 860 is divided by 17? 10 What is the remainder when 1811 is divided by 40? 11 Calculate the remainder when 103 is divided by 52. 51 What is the remainder when 5098 is divided by 50? 48 What is the remainder when 107 is divided by 9? 8 Calculate the remainder when 729 is divided by 12. 9 Calculate the remainder when 12 is divided by 8. 4 What is the remainder when 88 is divided by 30? 28 What is the remainder when 893 is divided by 50? 43 What is the remainder when 198 is divided by 8? 6 Calculate the remainder when 165 is divided by 8. 5 What is the remainder when 346 is divided by 13? 8 What is the remainder when 23957 is divided by 22? 21 Calculate the remainder when 399 is divided by 24. 15 What is the remainder when 89 is divided by 46? 43 Calculate the remainder when 2135 is divided by 142. 5 Calculate the remainder when 158 is divided by 10. 8 Calculate the remainder when 826 is divided by 117. 7 Calculate the remainder when 136 is divided by 24. 16 What is the remainder when 969 is divided by 189? 24 What is the remainder when 1203 is divided by 18? 15 What is the remainder when 258 is divided by 27? 15 What is the remainder when 290 is divided by 11? 4 Calculate the remainder when 176 is divided b	{ "pile_set_name": "DM Mathematics" }
d by 1. -59577896 Divide -45201024 by 27. -1674112 -326115 divided by 794 -326115/794 What is 802906 divided by -960? -401453/480 Calculate 56 divided by 131421. 56/131421 Divide 65210980 by 65210980. 1 Divide 885968 by 221492. 4 What is -6071796 divided by -26748? 227 Divide 232376484 by 77458828. 3 -57531180 divided by 410937 -140 2886002 divided by 19 2886002/19 12264282 divided by 197811 62 Calculate 718156 divided by -12382. -58 What is 165178548 divided by 3? 55059516 Divide -413 by -463455. 413/463455 516 divided by 10995 172/3665 Calculate -9 divided by 13640591. -9/13640591 What is -16117474 divided by 2953? -5458 Calculate -141878226 divided by 7. -20268318 What is -2374175457 divided by 6? -791391819/2 What is 298032 divided by -25? -298032/25 Divide -350023236 by -116674412. 3 Divide 51268668 by -211854. -242 45 divided by 10803393 5/1200377 Divide 16409 by 52. 16409/52 Divide -4853345 by -970669. 5 What is -905373408 divided by -14288? 63366 Calculate 129 divided by 271754. 129/271754 Calculate 41891 divided by -24709. -41891/24709 Divide 0 by -80340746. 0 Divide -3501225 by 700245. -5 Divide 25962580 by 1855. 13996 21352200 divided by -3558700 -6 -1845525 divided by 3 -615175 -487358 divided by 1580 -243679/790 What is 99762545 divided by 19952509? 5 -1821603 divided by 7 -260229 Divide -9 by -651194. 9/651194 Divide 3762 by -38758. -1881/19379 What is 514 divided by -134632? -257/67316 What is 745294392 divided by -14636? -50922 What is -2 divided by -132104368? 1/66052184 What is -156643597 divided by -11? 14240327 What is -4 divided by 36857284? -1/9214321 Calculate -37976 divided by 191. -37976/191 What is -206180810 divided by 41236162? -5 3 divided by 1888441 3/1888441 -3408228 divided by -1704114 2 Calculate 4843 divided by 3608. 4843/3608 Divide -4 by 1682688. -1/420672 Divide 10159 by -2693. -10159/2693 Calculate -10414320 divided by 12398. -840 What is 0 divided by -37657288? 0 Divide -1989413 by -5. 1989413/5 -2252680 divided by 56317 -40 Divide -711139380 by -1085. 655428 What is 5 divided by -3909747? -5/3909747 Divide -3522400 by -503200. 7 Calculate -371 divided by 2383. -371/2383 Calculate 9725865 divided by -8. -9725865/8 Divide -13898820 by -8996. 1545 Divide 1006992 by 13986. 72 Calculate 138 divided by -82352. -69/41176 Divide -1 by 215508. -1/215508 Calculate -9288 divided by 23039. -9288/23039 48842892 divided by -6 -8140482 Calculate 2605 divided by 1628. 2605/1628 -997419 divided by -3 332473 Divide -45311 by -348. 45311/348 312108880 divided by 16 19506805 Calculate -853984428 divided by 213496107. -4 138239580 divided by -13823958 -10 Calculate 11118120 divided by -71270. -156 117188694 divided by 49 2391606 -174 divided by -19418 87/9709 -1503 divided by 4366 -1503/4366 0 divided by -2594508 0 Calculate -65443 divided by 1454. -65443/1454 What is 6176840 divided by -2515? -2456 What is 242 divided by -364952? -121/182476 Calculate -160980 divided by -144. 13415/12 What is 1644576 divided by 205572? 8 5977461 divided by 7693 777 What is 1 divided by -66072536? -1/66072536 6140091 divided by 1 6140091 Calculate -2872904 divided by -3. 2872904/3 -59 divided by -1298463 59/1298463 Divide -176476 by -31. 176476/31 123462945 divided by 3 41154315 What is 1425240 divided by -6660? -214 7 divided by -20743179 -7/20743179 Divide 220734934 by 2. 110367467 Divide 4128905 by -8. -4128905/8 Divide 332559786 by 166279893. 2 Calculate 35119634 divided by -4. -17559817/2 Calculate -90607690 divided by -18121538. 5 What is -8725 divided by -37877? 8725/37877 What is 45255714 divided by -15085238? -3 9409776 divided by 5 9409776/5 Calculate 14053 divided by 62. 14053/62 19161328 divided by -2 -9580664 What is 4073472 divided by -192? -21216 Divide -153552596 by -5. 153552596/5 Divide -75087383 by 540197. -139 What is -31 divided by 154308? -31/154308 Calculate 3739680 divided by -1568. -2385 What is -11924796 divided by 76441? -156 Calculate 0 divided by 3098069. 0 -8962350 divided by 22350 -401 20 divided by 457501 20/457501 -504264 divided by -3 168088 Divide 652189 by 417. 652189/417 -476 divided by 43599 -476/43599 What is 7923065 divided by -3? -7923065/3 What is -93977700 divided by -1566295? 60 What is -68 divided by -2279573? 68/2279573 3685 divided by -43651 -3685/43651 -164908955 divided by 685 -240743 Calculate -190299 divided by -7597. 190299/7597 What is -53605155 divided by 17868385? -3 Calculate -68898258 divided by -5577. 12354 What is 19185199 divided by -1? -19185199 What is 9950501 divided by -2123? -4687 What is -3 divided by 2873685? -1/957895 What is -267 divided by -137972? 267/137972 What is -3334122 divided by 11226? -297 Divide 503024672 by 31439042. 16 Divide -50 by 38814. -25/19407 What is 4342 divided by -1030? -2171/515 Calculate 350 divided by -6927. -350/6927 Calculate -44118704 divided by 1575668. -28 Calculate 1875886 divided by 27. 1875886/27 Calculate -35925200 divided by 15485. -2320 What is -1388 divided by 5063? -1388/5063 What is 1282871 divided by -740? -1282871/740 -120270532 divided by 19361 -6212 -1334930 divided by -138 667465/69 -1 divided by 4176276 -1/4176276 Calculate 10 divided by -6252803. -10/6252803 Divide -28355264 by -1336. 21224 Calculate 1112260 divided by -38. -29270 Divide 2598 by -5563. -2598/5563 What is 4584502 divided by -176327? -26 Divide 22707546 by -102. -222623 What is -165058839 divided by 927? -178057 What is 103614320 divided by -55114? -1880 6848968 divided by -12874 -532 Calculate -14389935 divided by -3. 4796645 What is 75470910 divided by -5? -15094182 What is -100093445 divided by 2855? -35059 Calculate -41048670 divided by 13682890. -3 -8873488 divided by -2218372 4 Calculate -8409490 divided by 2. -4204745 -136 divided by 3184035 -136/3184035 What is 9973140 divided by -30? -332438 Divide 82167360 by -93. -883520 Divide 275847838 by -301. -916438 Calculate 815 divided by 112023. 815/112023 What is 324418 divided by 42? 162209/21 Calculate 375240066 divided by 2. 187620033 -250467945 divided by 1967 -127335 Divide 8 by 5662530. 4/2831265 19 divided by 5112130 19/5112130 Calculate 51 divided by 2940645. 17/980215 Divide -217701605 by -43540321. 5 What is -4857412 divided by 1214353? -4 -4498 divided by -1501 4498/1501 Calculate -171277 divided by -136. 171277/136 488924660 divided by -1321418 -370 Divide 8575637 by 1225091. 7 Divide -2 by 24823196. -1/12411598 9756300 divided by 487815 20 -13459 divided by 8670 -13459/8670 Divide 458263370 by -91652674. -5 781794356 divided by 908 861007 22077396 divided by 37356 591 What is -433685055 divided by -86685? 5003 What is 34442 divided by 13655? 34442/13655 Calculate -10 divided by 509676. -5/254838 -1 divided by -1996210 1/1996210 What is 149399965 divided by 2899? 51535 Divide -2600144 by -1. 2600144 Calculate 125252 divided by -985. -125252/985 What is -298552680 divided by -114388? 2610 Calculate 105665 divided by -964. -105665/964 Divide -47857393 by -4. 47857393/4 Calculate -16 divided by -6804378. 8/3402189 -3 divided by 9519936 -1/3173312 Calculate -470114487 divided by -116973. 4019 Calculate 29475650 divided by 475. 62054 30639 divided by 861 1459/41 -927702138 divided by -11 84336558 Calculate -1816807390 divided by -1270. 1430557 What is 2 divided by 16786078? 1/8393039 Calculate 276183684 divided by -41619. -6636 19123140 divided by -956157 -20 Divide 591744 by 6432. 92 Calculate -230784 divided by 83. -230784/83 605353 divided by -52 -605353/52 Divide -270057249 by 543. -497343 Calculate 797313 divided by 183. 265771/61 Divide 138479704 by 69239852. 2 -8 divided by 16862558 -4/8431279 Calculate 520585 divided by -5. -104117 Calculate 16251816 divided by -24. -677159 What is 45366522 divided by 6? 7561087 Calculate 7 divided by 3490243. 7/3490243 What is 235692639 divided by 1394631? 169 Calculate -431057 divided by 1. -431057 Calculate 2934593 divided by -5. -2934593/5 Divide 26161200 by 30420. 860 Calculate -1183600 divided by 5918. -200 Calculate -162614895 divided by 5. -32522979 Calculate -5 divided by 17568541. -5/17568541 What is -1267114804 divided by 18958? -66838 Divide -21 by -35606849. 21/35606849 What is 1135552 divided by -9? -1135552/9 -3656631 divided by -1218877 3 Wh	{ "pile_set_name": "DM Mathematics" }
8, -2l = -4c + 6. Suppose -s - 11478 - 92522 = c. What is s rounded to the nearest ten thousand? -100000 Let v(f) = 11f3 + 9f*2 + 33f + 11. Let r(l) = -12l3 - 10l*2 - 32l - 12. Let g(y) = 6r(y) + 7v(y). Let c be g(17). Round c to the nearest 1000. 26000 Let x = -10688 + 10687.9999995521. Round x to 7 decimal places. -0.0000004 Let x = 320 - 846. Let u = x + 563.3. Let w = u - 32. What is w rounded to the nearest integer? 5 Let x be 99/77 + (-2)/7. Let w be (-2 - 1) + 0 + x. Let s be 1660000(-3)/12w. Round s to the nearest 100000. 800000 Let x = 5 + -4. Let j be 0 + 4/2 - x. Let f be (-20)/(1j/(-6)). Round f to the nearest 100. 100 Let y = -63 - -67. Suppose 1180000 = -2d + yd. Round d to the nearest one million. 1000000 Let i = 198 - 326. Let q = 190389879 - 190389751.000051. Let c = i + q. What is c rounded to five decimal places? -0.00005 Let z(u) = 175000u*2. Suppose 2a - 35 = -5a. Let j be (-7 + 12)6/a. Let t be z(j). Round t to the nearest one million. 6000000 Let i = 0.7 + -1.7. Let p = 1.0089 + i. What is p rounded to three dps? 0.009 Suppose 4t - 11239994 = 3x, 5x = 4t - 2t - 5619990. Round t to the nearest one million. 3000000 Let j = 110.04363 - 99.6431. Let c = j + -10.4. Round c to four decimal places. 0.0005 Let d = -2.366 - -2.3. Let k = d + 0.806. Let m = -0.3 - k. What is m rounded to 1 dp? -1 Let n = 5634182 + -7891786. Let b = n + 5557604. What is b rounded to the nearest 1000000? 3000000 Let i = -172 - -172.69. Let m = i + -0.69000055. Round m to 7 dps. -0.0000006 Let q = 42.10001276 - 42.1. Round q to 7 decimal places. 0.0000128 Let u = -54 + 54.041. Let i = u - 0.471. What is i rounded to 1 decimal place? -0.4 Let k = -0.8 + 0.801194. Round k to four decimal places. 0.0012 Let s = -27.2 - -28. Let u = 0.80000009 - s. Round u to 7 decimal places. 0.0000001 Let i = -125 + 124.99467. What is i rounded to four dps? -0.0053 Let f = 116289794.999849 - 116289488. Let h = f - 307. What is h rounded to 5 decimal places? -0.00015 Let s = -0.1136 - 0.7454. Let w = 0.271 - s. What is w rounded to one decimal place? 1.1 Let f = 567.0888 - 567. Round f to 3 dps. 0.089 Let n = 58.76 - 47.3. Let f = 11.4599509 - n. What is f rounded to five dps? -0.00005 Let v = 0.098124967 + 93.901916033. Let t = -228 + 134. Let j = v + t. Round j to 5 dps. 0.00004 Let j = -9.911 - -9.53. Let q = -2.868 - -3.13. Let r = q + j. Round r to two decimal places. -0.12 Let b = -449811654.99999961 + 449811579. Let c = 0.122 - 76.122. Let t = b - c. What is t rounded to seven dps? 0.0000004 Let i = 24.495 - 21.6. What is i rounded to the nearest integer? 3 Let v = -2.1 + 0.8. Let x = v - -1.30000376. What is x rounded to seven dps? 0.0000038 Let d = -3 + 3. Suppose d = -h + 3. Let y be (-148)/h75/10. What is y rounded to the nearest one hundred? -400 Let c = 358.999845 + -359. What is c rounded to 5 decimal places? -0.00016 Let m = -0.19 - 7.68. Round m to one decimal place. -7.9 Let g = 36.1 + 7.9. Let f = g + -43.9961. Round f to three dps. 0.004 Let z = 1249.3 + -1249.43819. What is z rounded to two decimal places? -0.14 Let s = 2.878 + 0.402. What is s rounded to the nearest 10? 0 Let s = -5.6779181 + 5.367916. Let x = s - -0.31. Round x to six dps. -0.000002 Let d = 8 - 7.977. Let h = d - 0.0299. Round h to three dps. -0.007 Let c = 384627809.999307 - 384629302. Let m = -1492 - c. Round m to four dps. 0.0007 Let q = 7146.5 + -4826. Let h = q - 2320.30009. Let j = -0.2 + h. What is j rounded to four dps? -0.0001 Let d = -53704.180019 - -53707.08. Let z = 54.9 - 52. Let n = z - d. Round n to 5 decimal places. 0.00002 Let j = 0.04 - 0.06. Let a = -21.015 + 21. Let m = j - a. Round m to two decimal places. -0.01 Let b(k) = -k*3 - 23k*2 - 23k - 21. Let i be b(-22). Let z be (i - 32/40) + (-34649)/(-5). What is z rounded to the nearest one hundred? 6900 Let f = -790 - -790.1174. What is f rounded to 1 decimal place? 0.1 Let u = 332.05 + -392. Let c = -140 + 202. Let b = c + u. What is b rounded to one dp? 2.1 Let x = -18 - -10. Let q = 8.28 + x. Let r = q - 0.93. Round r to one dp. -0.7 Let t = 13 - 16.2. Let o = -22.2 - t. Let w = 19.00101 + o. Round w to four dps. 0.001 Let b(p) = 5586p2 + p - 8. Let l be b(-8). Suppose 5i = -5, g + 3i + i = l. Suppose g = -3n + 99492. Round n to the nearest 10000. -90000 Let f = -44 + 55.6. Let a = -11.66119 + 0.00219. Let n = a + f. What is n rounded to 2 decimal places? -0.06 Let x be 6/11 - (-30095)/143. What is x rounded to the nearest one hundred? 200 Let l(c) = c. Let o(w) = -564282w + 4. Let x(y) = 4l(y) - o(y). Suppose -5i + 34 = -36. Let n be x(i). Round n to the nearest one million. 8000000 Let h = -24036 + 45036. Let x be (0 + h)((-762)/14 + 3). What is x rounded to the nearest one hundred thousand? -1100000 Let s = -624736022.00000076 - -624736012. Let q = 0.03 + -10.03. Let x = s - q. What is x rounded to 7 decimal places? -0.0000008 Let q = 252 - 251.999425. What is q rounded to 4 decimal places? 0.0006 Let q = 35.1 - 20. Let d = q - 5.9. Let c = d + -9.159. Round c to 2 dps. 0.04 Let p be ((-250)/5)/(6/(-1720920)). What is p rounded to the nearest one hundred thousand? 14300000 Let i = -40465.47413 + 40465. Let f = 0.478 + i. What is f rounded to 4 dps? 0.0039 Let t = 420 + -420.00000865. Round t to 7 dps. -0.0000087 Let j = 6613309.6 + -6613256.600066. Let y = -101 + 154. Let n = y - j. What is n rounded to five decimal places? 0.00007 Let h = -228.97 - -228.0239. Let l = h - -0.94. What is l rounded to 3 decimal places? -0.006 Let g = 37915239.99881 - 37915468. Let z = 228 + g. What is z rounded to four dps? -0.0012 Let b = -0.18472 + 0.1232. Round b to 3 dps. -0.062 Let a = -79263157 - -36803157. What is a rounded to the nearest one million? -42000000 Let t = 1.74 - 1.6. Let k = t + -0.5. Let v = k - -0.3583. What is v rounded to 4 dps? -0.0017 Suppose w - 6w = -2z - 95499992, 57299988 = 3w - 3z. Round w to the nearest one million. 19000000 Let k = -2.9 - -4.6. Let g = -35.24661367 - -36.9466123. Let x = g - k. Round x to seven decimal places. -0.0000014 Suppose -5s + 0s = -2u + 41, -u - 2 = 2s. Suppose -10w + 13400 = -uw. What is w rounded to the nearest 1000? 7000 Let r = -1.58069 + -26517.45931. Let w = 26522.059877 + r. Let s = -3.02 + w. What is s rounded to five dps? -0.00012 Let m = 16 - 22. Let p = -2 - m. Let s = -3.99999994 + p. What is s rounded to 7 decimal places? 0.0000001 Suppose -484 = -2a + 4n, -5a + 2n + 1226 = -0a. Suppose 2 = -v + 1, a = -2t - 4v. What is t rounded to the nearest 10? -120 Suppose 3 = -5h + 3. Suppose 4m + 3v - 41599991 = h, -m = -3v - 0v - 10400009. Round m to the nearest one million. 10000000 Suppose -2k + 1 = -k, 2b - 5k + 5 = 0. Let j be (1 - b) + (-20262)/4-458. What is j rounded to the nearest 100000? 2300000 Let b = -2091 + -639. Round b to the nearest one thousand. -3000 Let i = -11 - -10.2. Let t = -10.8 - i. Let o = t - -10.00004. What is o rounded to 4 decimal places? 0 Let q = -1.91 + -0.29. Let r = -2.200007 - q. Round r to 5 dps. -0.00001 Let m = -0.0118 - -0.01183596. Round m to six dps. 0.000036 Let c = 33 - 14. Let k = 5265.0144 + -5246. Let m = k - c. What is m rounded to three dps? 0.014 Let n = 164.4 - 164.402379. Round n to three dps. -0.002 Suppose -3g + 230110 + 177390 = -5s, 5g = 0. What is s rounded to the nearest ten thousand? -80000 Let y = -0.126 + -0.992. Round y to 2 decimal places. -1.12 Let z be (3 + (-33)/6)/((-4)/8). Suppose 5u + 6610005 = 5l, zl - 1 = 4l. What is u rounded to the nearest 100000? -1300000 Suppose -79322 = 2t - 1963322. What is t rounded to the nearest one million? 1000000 Let q(p) = -601998p + 15. Let i(b) = 601999b - 15. Let v(o) = -5i(o) - 4q(o). Let w be v(5). Round w to the nearest 100000. -3000000 Let n be ((-12)/(-10))/(30/75). Suppose -nb + 22 = -5i - 6b, 3b + 10 = i. Let q(h) = 6h*2 - h - 4. Let g be q(i). Round g to zero decimal places. 22 Suppose -4 - 21 = z. Let f be 7800002/(-10) + (-5)/z. Round f to the nearest 100000. -800000 Let p = 1075 + -1056.69. Let m = -19.6 + p. What is m rounded to 1 decimal place? -1.3 Let a = 8370986.6899918 + -8370986. Let d = -12.5 + 13.19. Let l = d - a. What is l rounded to 6 dps? 0.000	{ "pile_set_name": "DM Mathematics" }
}. 1/6 Calculate prob of sequence pbw when three letters picked without replacement from {w: 1, x: 2, l: 1, b: 2, e: 1, p: 1}. 1/168 Calculate prob of sequence kc when two letters picked without replacement from kkckckkkckcckk. 45/182 Four letters picked without replacement from qqqeqxxqexxqeq. What is prob of sequence xxqq? 3/143 Four letters picked without replacement from xbuuuuutxtxxlxutub. Give prob of sequence bbuu. 7/6120 Two letters picked without replacement from thxhhhxuhnuunhhhhhh. What is prob of sequence xt? 1/171 Two letters picked without replacement from {y: 1, i: 5, w: 3}. Give prob of sequence yw. 1/24 What is prob of sequence zlci when four letters picked without replacement from {l: 1, g: 1, i: 2, c: 1, p: 1, z: 1}? 1/420 Two letters picked without replacement from qqh. What is prob of sequence hq? 1/3 Calculate prob of sequence kz when two letters picked without replacement from {g: 1, p: 1, k: 5, d: 1, z: 3, u: 1}. 5/44 Two letters picked without replacement from hggsqhqqqgghhhgkqhs. What is prob of sequence ks? 1/171 What is prob of sequence zq when two letters picked without replacement from qaztt? 1/20 Three letters picked without replacement from iiiddd. What is prob of sequence iid? 3/20 Calculate prob of sequence hhr when three letters picked without replacement from hrhrhhhhh. 1/6 Two letters picked without replacement from fwfwfpurpf. What is prob of sequence fw? 4/45 What is prob of sequence rsx when three letters picked without replacement from {s: 2, a: 2, r: 1, x: 4}? 1/63 Two letters picked without replacement from {o: 4, n: 2}. What is prob of sequence no? 4/15 Three letters picked without replacement from qmsqsquumuuu. What is prob of sequence uqu? 1/22 Two letters picked without replacement from hndba. Give prob of sequence bd. 1/20 Calculate prob of sequence wwkw when four letters picked without replacement from {k: 11, w: 5}. 11/728 Four letters picked without replacement from jnrjrrvjzzf. Give prob of sequence rnrf. 1/1320 What is prob of sequence ytyn when four letters picked without replacement from yyyyyytytyntyt? 12/1001 Four letters picked without replacement from {g: 3, o: 4, x: 4, a: 8}. Give prob of sequence xxgg. 1/1292 What is prob of sequence oo when two letters picked without replacement from {o: 10}? 1 What is prob of sequence ll when two letters picked without replacement from llllllllwlllllllllll? 9/10 Three letters picked without replacement from {a: 1, j: 3, g: 1, e: 5}. Give prob of sequence ajj. 1/120 Calculate prob of sequence cy when two letters picked without replacement from jwkjycykcyjwwwykc. 3/68 Calculate prob of sequence auu when three letters picked without replacement from {u: 4, s: 8, a: 1}. 1/143 Two letters picked without replacement from pxppppxxppxxpp. What is prob of sequence pp? 36/91 Four letters picked without replacement from {n: 1, a: 4, l: 2, d: 1}. Give prob of sequence lana. 1/70 Two letters picked without replacement from jiijjjiiiiijijiiiji. Give prob of sequence ji. 14/57 What is prob of sequence rjx when three letters picked without replacement from rjxr? 1/12 Three letters picked without replacement from {a: 3, c: 1, i: 4, m: 1, x: 5}. Give prob of sequence aax. 5/364 What is prob of sequence gdk when three letters picked without replacement from {k: 4, g: 4, d: 1, l: 6, o: 1}? 1/210 What is prob of sequence hhhh when four letters picked without replacement from ppfhhpphpfpfhp? 1/1001 Four letters picked without replacement from {p: 6, t: 4, e: 2, q: 6}. What is prob of sequence qpeq? 1/204 Two letters picked without replacement from gggggggqgqgqgg. What is prob of sequence qg? 33/182 Two letters picked without replacement from {d: 9, j: 2, z: 7, v: 1}. What is prob of sequence dz? 7/38 Calculate prob of sequence po when two letters picked without replacement from {p: 2, o: 3, z: 7}. 1/22 Two letters picked without replacement from ddddddfdddf. Give prob of sequence df. 9/55 Three letters picked without replacement from {k: 6, v: 1, n: 2, h: 2, x: 1}. Give prob of sequence knk. 1/22 What is prob of sequence ycml when four letters picked without replacement from ymclmcyclymmmmlmly? 7/1530 What is prob of sequence iwiw when four letters picked without replacement from {i: 4, e: 1, w: 3}? 3/70 Four letters picked without replacement from {a: 3, u: 8, w: 1, y: 1, f: 6}. What is prob of sequence aufa? 1/323 What is prob of sequence qp when two letters picked without replacement from qjjppjpjfqfqpffqffpq? 5/76 Four letters picked without replacement from llroojfojlovfoljf. What is prob of sequence llfl? 3/2380 Three letters picked without replacement from xxxvxxxxxxxxxxxxxx. Give prob of sequence xxv. 1/18 Two letters picked without replacement from {s: 9, x: 5}. What is prob of sequence xx? 10/91 Four letters picked without replacement from {i: 2, z: 7, y: 1, r: 5, q: 3}. Give prob of sequence qriz. 7/2448 What is prob of sequence tt when two letters picked without replacement from {k: 5, t: 5}? 2/9 Calculate prob of sequence tts when three letters picked without replacement from tssstt. 3/20 Calculate prob of sequence so when two letters picked without replacement from {s: 1, o: 1, v: 2, h: 1}. 1/20 Four letters picked without replacement from pppppplppll. Give prob of sequence ppll. 7/165 What is prob of sequence uuvm when four letters picked without replacement from {v: 1, p: 4, u: 2, m: 2}? 1/756 What is prob of sequence ewx when three letters picked without replacement from qewcecqwxwwcwwc? 2/455 Four letters picked without replacement from kkkkk. Give prob of sequence kkkk. 1 What is prob of sequence nnz when three letters picked without replacement from ooonewneoez? 1/495 What is prob of sequence mo when two letters picked without replacement from mmymymovmommm? 4/39 Four letters picked without replacement from mfmffmfmfff. What is prob of sequence mfmf? 7/110 Four letters picked without replacement from {o: 6, v: 4, e: 2, r: 1, g: 7}. Give prob of sequence gvrg. 7/4845 Four letters picked without replacement from uuuuuzuzzuuzzuzuuzu. What is prob of sequence uuuu? 165/1292 Three letters picked without replacement from epeaa. What is prob of sequence paa? 1/30 Four letters picked without replacement from {d: 4, w: 6}. Give prob of sequence wwww. 1/14 Calculate prob of sequence oo when two letters picked without replacement from vnwzovwvvvwvozvao. 3/136 Three letters picked without replacement from {j: 5, u: 5, d: 5, x: 2, h: 2}. What is prob of sequence hdh? 5/2907 What is prob of sequence hc when two letters picked without replacement from {k: 2, h: 3, c: 15}? 9/76 Two letters picked without replacement from {w: 2, x: 1, f: 1}. What is prob of sequence wf? 1/6 What is prob of sequence dc when two letters picked without replacement from dhgcbdb? 1/21 Three letters picked without replacement from {x: 1, f: 6, i: 2, e: 3, k: 4}. What is prob of sequence eex? 1/560 Three letters picked without replacement from {k: 2, b: 17}. What is prob of sequence bkk? 1/171 What is prob of sequence ifa when three letters picked without replacement from {q: 1, f: 2, a: 6, h: 3, u: 4, i: 3}? 2/323 What is prob of sequence kk when two letters picked without replacement from {a: 2, k: 6}? 15/28 Four letters picked without replacement from {r: 5, w: 2, l: 2}. What is prob of sequence llrr? 5/378 What is prob of sequence zozo when four letters picked without replacement from {o: 3, z: 4}? 3/35 What is prob of sequence zp when two letters picked without replacement from pdzddzd? 1/21 What is prob of sequence rp when two letters picked without replacement from nrp? 1/6 Two letters picked without replacement from vttttrwrrvtttrrrortx. Give prob of sequence rx. 7/380 Calculate prob of sequence kw when two letters picked without replacement from {k: 2, g: 6, j: 1, w: 3}. 1/22 Two letters picked without replacement from fmmammammfmmahmm. Give prob of sequence mm. 3/8 Calculate prob of sequence co when two letters picked without replacement from covwiozi. 1/28 Three letters picked without replacement from {c: 2, z: 9}. Give prob of sequence zcz. 8/55 Four letters picked without replacement from ijiijansi. Give prob of sequence inaa. 0 What is prob of sequence nnxn when four lett	{ "pile_set_name": "DM Mathematics" }
j be 4/63/(-2). Let d = j - t. Sort -6, d, 2 in increasing order. -6, d, 2 Let u = -31 + 47. Suppose -3d + h - u = 0, 0 = 2d - h - h + 12. Put d, 2, 4, 7 in descending order. 7, 4, 2, d Let y = 1493 - 1493.4. Sort -17, -4, y, 4 in descending order. 4, y, -4, -17 Let h = 0.43 - 0.73. Let w be 2(6/(-4) - -1). Put h, 0, w in ascending order. w, h, 0 Let j(x) = x*2 + 3x - 5. Let g be j(-5). Suppose -4c - 3v = -1, -gv + v - 6 = -2c. Sort 5, c, -7 in decreasing order. 5, c, -7 Suppose -13 = 2o + 5z, o - 4z - 10 = -z. Let d = -9 - -12. Sort o, -2, d, -1 in descending order. d, o, -1, -2 Let a = -0.214 - -10.914. Let i = 11 - a. Put 0, i, -5/2 in decreasing order. i, 0, -5/2 Let s(f) be the first derivative of f3/3 + f2 - 4f - 2. Let k be -1 - (1/(-1) + 2 - -1). Let a be s(k). Put 0.4, a, -5 in increasing order. -5, a, 0.4 Let q(z) = z + 1. Let v be q(0). Let c(g) = -g*3 + 10g*2 - 17g + 66. Let n be c(9). Put n, v, -5 in decreasing order. v, -5, n Let x = 0 + 0.4. Let s = -32 - -18. Let a = 18 + s. Sort a, x, 0.05 in ascending order. 0.05, x, a Let v = 2.1 - 2.19. Let q = 0.0269 - -146.6731. Let s = -147 + q. Put s, v, 0.3 in decreasing order. 0.3, v, s Suppose -x + 4q - 85 = -66, 5x + 4q - 1 = 0. Let u(s) = s2 - 7s + 4. Let n be u(6). Put n, x, 4 in increasing order. x, n, 4 Let j = 1.1 - 1.8. Let w = -1719 + 1718.5. Put j, w, 0.04 in decreasing order. 0.04, w, j Let v = -2259 - -2261. Sort 0, v, 20 in decreasing order. 20, v, 0 Suppose -u + 79 = 73. Let x(q) = q*3 - 7q*2 + 5q + 2. Let k be x(u). Sort -2, 2, k, 3 in ascending order. k, -2, 2, 3 Suppose 0 = 3i - 6 - 9. Let b(j) = j3 + 9j*2 - 10j - 2. Suppose -3d - 30 = -0d. Let u be b(d). Sort 3, u, i in ascending order. u, 3, i Let m be (-10)/(-4) - 1 - (100 - 98). Put m, 10/13, 0.4, -4 in increasing order. -4, m, 0.4, 10/13 Let m = -2087 + 2086.8. Let z = 0.1 + 0.9. Put m, -8, z in decreasing order. z, m, -8 Suppose -3k - 12 = 4a, 0 = 5k - 5a - 2 - 13. Let o = -1768 + 1769. Sort o, -3, k, -2 in ascending order. -3, -2, k, o Suppose 4p - 84 = p. Let f = 21 - p. Let j be (-2)/f + (-520)/350. Sort j, 1/4, 0.5 in ascending order. j, 1/4, 0.5 Let o(a) = -a3 - 6a*2 - a - 1. Let t be o(-6). Suppose -7 = 2p - s, 19 = -5p - s - 16. Let b be -3 - p - (2/2 - -2). Put -5, b, t in increasing order. -5, b, t Suppose -2w - 1900 = -5j, -6 = j - 2. Let n = 47038/49 + w. Put -0.3, n, -1 in increasing order. -1, -0.3, n Let k = 359 - 356. Sort -34, 1, k, -1. -34, -1, 1, k Let b = -82 - -46. Let c = b + 33. Put -5, 5, -4, c in increasing order. -5, -4, c, 5 Let l = 40 + -17. Let i = -27 + l. Sort -1, 4, i in descending order. 4, -1, i Let h = 0.07 - -0.23. Let w(s) = -s3 + 5s*2 + 5s + 10. Let l be w(6). Let v = -9 + 6. Put h, v, l in descending order. l, h, v Let u(x) = x*2 - 9x + 3. Let v be u(9). Suppose 2k = p - 3p + 4, 2p + k = 7. Sort v, 2, p in decreasing order. p, v, 2 Let c = -37.3 + 37.2. Sort 4, 1/8, c, -4 in descending order. 4, 1/8, c, -4 Let c be -3((-352)/24 - 1/3). Put 0, c, -4 in increasing order. -4, 0, c Let j = 369 + -376. Suppose 0 = 4l - 50 - 14. Let f be 2/(-2 - l/(-10)). Put j, 2, f in ascending order. j, f, 2 Suppose 8 = 5k - 7, k = -2g + 1. Sort g, 815, 5, 0 in ascending order. g, 0, 5, 815 Let c be 3 - (-164)/(-52) - (-28)/13. Sort c, -4, 19, 5. -4, c, 5, 19 Suppose g + 9u - 4u = -16, 6 = 3g - 3u. Let n be g/(-6) + (-75)/(-90). Put -5, 2, 3, n in decreasing order. 3, 2, n, -5 Let l be (15/10)/(12/8). Let a(x) = x3 - 5x*2 - 5x - 3. Let h be a(6). Let j be (-1)/((-6)/(-4))h. Put j, l, -5 in decreasing order. l, j, -5 Suppose -16 = -4v + 5r, -5r + 0r + 20 = 5v. Let f = -6 + 3. Put v, 2, 1, f in decreasing order. v, 2, 1, f Let a = -19 + 21.6. Let r = a + -2.49. Let j = r - 4.11. Sort j, 9, 0.2. j, 0.2, 9 Let i = -920.1 + 920. Sort -1, i, 5 in decreasing order. 5, i, -1 Let i = 22.02 - 22. Let v = i - 2.02. Put 1, -1.1, v in decreasing order. 1, -1.1, v Let j = -47 + 54. Suppose 11c - jc = v - 19, 5v + 49 = -4c. Put 4, -1, c in descending order. 4, -1, c Let b = -1.4 + 1.4. Sort 0.3, -4, 9, b in descending order. 9, 0.3, b, -4 Let m = 584 + -584. Put m, 1, -5, -28 in increasing order. -28, -5, m, 1 Let j = 0.31 + -0.01. Let q = -103/190 - -4/95. Sort j, 5, -3, q in ascending order. -3, q, j, 5 Suppose 2b - 6b + 2j = -10, j - 5 = 0. Let f(i) = i2 - 7i - 3. Let y be f(7). Sort y, b, -11 in ascending order. -11, y, b Let r = 53 + -85. Let l = -36 - r. Sort l, 1/136, -0.5 in descending order. 1/136, -0.5, l Let t be ((-52)/12 - -4)15. Let k be (1 - 3)/(4t/(-70)). Sort k, 0.5, 0.2. k, 0.2, 0.5 Let f = 358 + -719/2. Sort f, 4, 9/5, 0.4 in ascending order. f, 0.4, 9/5, 4 Let o be (-22)/2319 - 2/14. Sort -34, -2, o, 0 in decreasing order. 0, o, -2, -34 Let c be (7 + -4)16/6. Suppose -3v - 6f + f - c = 0, 5f + 4 = -4v. Sort -5, v, -1, -11 in increasing order. -11, -5, -1, v Let i be -1 + (-7 - 30/(-11 + 6)). Put -3, 5, i, 2 in decreasing order. 5, 2, i, -3 Suppose 75 = -21l - 9. Put 1/3, l, 1.7, -1/5 in decreasing order. 1.7, 1/3, -1/5, l Suppose 0 = 5t - 5 + 5. Suppose -5b = -0p + 2p + 12, 3b + 6 = t. Put 4, p, -2 in decreasing order. 4, p, -2 Suppose -51 = 23s - 40s. Sort s, -2/5, -3, 4 in ascending order. -3, -2/5, s, 4 Suppose -36r + x + 35 = -40r, -x + 10 = -r. Sort -2, -56, r in ascending order. -56, r, -2 Let b = -2.13 - -73.13. Sort 4, -2/13, b, 0.5. -2/13, 0.5, 4, b Let g = -0.038 - -0.558. Let k = 1.02 - g. Sort -0.7, k, 0.3 in descending order. k, 0.3, -0.7 Let h = -62 - -54. Put -5, h, -2 in descending order. -2, -5, h Suppose -4n - 4 = -3g + 5g, 4 = 3n + 5g. Let i be 1 + 0 + 2/n. Let t = 119/957 - -5/87. Sort i, -1, t in ascending order. -1, i, t Let a(i) = -i + 9. Let u(k) = 7k - 46. Let m(z) = -11a(z) - 2u(z). Let b be m(-3). Sort 5, b, 4, 7 in increasing order. b, 4, 5, 7 Let s = 5 - 10. Let q be 8/(-5) + 2/s. Suppose -4k = 3h - 3, 5 + 0 = -k + 5h. Put 0.4, q, k in decreasing order. 0.4, k, q Let i = 755 - 594. Put -2, i, 2 in descending order. i, 2, -2 Let q = -83.99 + 84. Sort q, -3, 1 in descending order. 1, q, -3 Let s(w) = 17w + 43. Let f be s(-3). Sort f, 4, 12, -4 in ascending order. f, -4, 4, 12 Let c = -0.308 + 0.408. Let t = -53 - -52.5. Sort 0.06, c, t, -2/3 in descending order. c, 0.06, t, -2/3 Suppose 107z + 40 - 66 = 188. Let b = -3/44900 - 39826279/314300. Let v = 127 + b. Sort v, 2/3, z in ascending order. v, 2/3, z Let g be (-27)/(-7) - (-3)/21. Suppose -10 = -2f - g. Let d be f(1/1 - 0). Sort d, 0, 8 in descending order. 8, d, 0 Let d = 0.035 - 0.067. Let g = 0.032 + d. Put 1, 1/14, g in ascending order. g, 1/14, 1 Let i be (0 + -4)/((-1)/(-1)). Suppose 11q - 41 - 80 = 0. Put i, -3, 0, q in descending order. q, 0, -3, i Suppose 13 = -14c + 13c + 2o, -c + 3o - 18 = 0. Suppose -4y + 5y - 1 = 0. Sort y, 11, c in increasing order. c, y, 11 Suppose j - 14 = 7. Suppose 0 = -5005m + 5011m - 156. Let u = m - j. Put u, -5, -1 in decreasing order. u, -1, -5 Suppose r - 3t = -17, 3t - 4 = 2r + 33. Put 1, r, 3 in ascending order. r, 1, 3 Suppose -5b + 8b = 36. Suppose -9c + 12c + b = 0. Sort 3, 0, 6, c in descending order. 6, 3, 0, c Let y = 2.225 + -1.725. Sort y, -0.041, -0.1 in descending order. y, -0.041, -0.1 Suppose 0 = 33c - 42c - 99. Put 17, 5, c in decreasing order. 17, 5, c Suppose -2l = v - 30 + 22, 5l + v - 20 = 0. Sort 91, l, 3 in decreasing order. 91, l, 3 Let f = 2.25 - 2.1. Let v = f + -0.1. Let t = v - 2.05. Put -0.06, t, -0.4 in decreasing order. -0.06, -0.4, t Let i = -9 + 13. Suppose c = -3 + 1. Put c, 2, 1, i in ascending order. c, 1, 2, i Suppose -3n = -2d - 0n + 14, n = 4d - 8. Suppose 0 = -2c - 4v, v + 0v = -2c. Sort d, 3, 5, c in descending order. 5, 3, d, c Let d = -164.6 - -164.7. Sort -1, 8, d. -1, d, 8 Let y be (-3)/(-6) - 1 - 228/(-152). Sort 2, y, -4, 24 in increasing order. -4, y, 2, 24 Let i = -2/877 + 897/8770. Put 2/3, -50, i in decreasing order. 2/3, i, -50 Let l = 816/11 - 74. Let s be (-70)/206/21. Sort s, -16, -2, l in descending order. l, s, -2, -16 Let v be 232/56 - 18/(-21). Let a(f) = -f - 1. Let m(q) = q*2 - 4q - 7. Let n(r) = a(r) - m(r). Let x be n(5). Sort v, x, 4. x, 4, v Let d	{ "pile_set_name": "DM Mathematics" }
101000 Convert -40254 (base 6) to base 4. -1102222 What is 224500 (base 6) in base 14? 6dc8 What is -4ef9 (base 16) in base 2? -100111011111001 What is -10101 (base 5) in base 16? -28b -506 (base 13) to base 14 -44b Convert 7774 (base 9) to base 15. 1a77 Convert 1267 (base 8) to base 14. 379 What is -901 (base 10) in base 15? -401 -30132 (base 4) to base 12 -566 What is 1000010100 (base 2) in base 7? 1360 Convert 11001001010 (base 2) to base 8. 3112 What is 19f0 (base 16) in base 14? 25c4 1759b (base 13) to base 11 30820 3597 (base 11) to base 8 11140 Convert 256 (base 7) to base 12. b7 Convert -3210 (base 16) to base 9. -18520 -709 (base 11) to base 5 -11411 12035 (base 8) to base 7 21004 -ca0 (base 13) to base 11 -1692 -14c (base 13) to base 5 -1413 What is -11001001011001 (base 2) in base 12? -7561 Convert 400a (base 11) to base 10. 5334 Convert -1000111100101110 (base 2) to base 16. -8f2e 42434 (base 6) to base 3 21221011 -2312202 (base 4) to base 9 -17020 31206 (base 10) to base 13 11286 What is -27cb8 (base 13) in base 2? -10010001110111000 11022 (base 3) to base 2 1110100 -1532 (base 7) to base 3 -211122 What is 4566 (base 7) in base 15? 760 Convert 373 (base 11) to base 2. 110111011 1102012100 (base 3) to base 14 a210 -2667 (base 9) to base 12 -11b1 4262 (base 12) to base 2 1110001101010 What is -781 (base 16) in base 12? -1141 -7260 (base 8) to base 12 -2214 What is -192 (base 12) in base 16? -fe What is -1361 (base 15) in base 2? -1000000101101 What is -412 (base 7) in base 2? -11001101 What is -352 (base 13) in base 12? -3ba -100 (base 3) to base 8 -11 -1246 (base 11) to base 16 -657 -11101000100 (base 2) to base 5 -24420 Convert -4023 (base 6) to base 4. -31233 56327 (base 9) to base 13 14077 What is 35366 (base 8) in base 7? 62002 What is 102133 (base 4) in base 11? 986 What is 100331 (base 7) in base 8? 41120 What is 367 (base 9) in base 16? 130 Convert -2101 (base 10) to base 7. -6061 Convert -44a6 (base 16) to base 3. -220002220 What is -364 (base 16) in base 8? -1544 -14d (base 15) to base 11 -251 1101 (base 5) to base 13 b8 What is 1155 (base 6) in base 10? 287 What is 43420 (base 5) in base 14? 1133 What is 2e6 (base 16) in base 12? 51a What is 100110001111110 (base 2) in base 7? 111043 -1002000 (base 3) to base 9 -1060 3442 (base 7) to base 2 10011100111 Convert 3322303 (base 4) to base 2. 11111010110011 What is -3a47 (base 16) in base 8? -35107 102002 (base 4) to base 8 2202 What is 1a458 (base 13) in base 5? 3120110 Convert 41 (base 12) to base 8. 61 -88 (base 14) to base 8 -170 What is -2443 (base 10) in base 15? -acd -17685 (base 10) to base 3 -220021000 Convert 212e (base 16) to base 8. 20456 Convert -26bd (base 14) to base 11. -5150 Convert 479a (base 16) to base 13. 8460 Convert -1003421 (base 5) to base 2. -11111011101111 -1d0c (base 14) to base 8 -12270 What is -24636 (base 9) in base 14? -6069 What is -34486 (base 9) in base 14? -854d What is 10040 (base 6) in base 10? 1320 Convert -1711 (base 14) to base 3. -12200000 What is -12266 (base 12) in base 3? -1020200120 Convert -227 (base 13) to base 5. -2441 What is -16d (base 14) in base 6? -1205 2622 (base 8) to base 2 10110010010 1928 (base 14) to base 6 33012 Convert -3207 (base 11) to base 13. -1c14 What is -2ac3 (base 13) in base 3? -22120020 What is -1010001100011100 (base 2) in base 11? -29410 11825 (base 10) to base 3 121012222 What is 110100101001 (base 2) in base 9? 4553 What is -20622 (base 8) in base 6? -103442 What is 50131 (base 6) in base 15? 1e0a Convert 4244 (base 6) to base 2. 1111000100 -1407 (base 13) to base 16 -b40 Convert 3811 (base 9) to base 5. 42340 Convert 1a8b (base 12) to base 4. 303023 What is 4b (base 12) in base 7? 113 -162 (base 9) to base 8 -211 What is 332 (base 15) in base 12? 502 Convert -13cc (base 15) to base 10. -4242 What is 10011100101010 (base 2) in base 10? 10026 What is 17541 (base 8) in base 2? 1111101100001 Convert -30b2 (base 14) to base 2. -10000011000100 -2b3b (base 14) to base 4 -1320101 Convert -3853 (base 14) to base 2. -10011010010001 1045 (base 10) to base 11 870 -3320 (base 8) to base 16 -6d0 What is 14a (base 14) in base 5? 2022 Convert 557 (base 15) to base 2. 10010110111 10313 (base 6) to base 4 112011 What is 136 (base 7) in base 16? 4c What is -299 (base 10) in base 7? -605 What is 3122 (base 8) in base 3? 2012221 Convert -2424 (base 7) to base 5. -12100 -1237 (base 15) to base 3 -12022121 -1000011011000111 (base 2) to base 13 -12921 What is 987 (base 13) in base 2? 11001100000 Convert -423 (base 5) to base 2. -1110001 -2210201000 (base 3) to base 9 -83630 514 (base 9) to base 3 120111 1212120 (base 3) to base 13 810 -11323220 (base 4) to base 10 -24296 Convert -6514 (base 8) to base 13. -171b 315233 (base 6) to base 11 18422 -903 (base 12) to base 13 -78c What is 441 (base 8) in base 12? 201 Convert -10102002022 (base 3) to base 16. -1063a What is -14182 (base 10) in base 16? -3766 314a (base 11) to base 4 1001020 What is -3904 (base 12) in base 7? -24622 723 (base 11) to base 16 368 What is -12110 (base 3) in base 7? -300 -11274 (base 8) to base 3 -20120122 -855 (base 15) to base 10 -1880 Convert 41 (base 11) to base 5. 140 -1020211 (base 3) to base 13 -553 11322 (base 5) to base 8 1505 Convert 6410 (base 8) to base 10. 3336 4161 (base 7) to base 13 888 -414c (base 13) to base 14 -3405 What is -11212111 (base 3) in base 4? -313132 What is b83 (base 13) in base 15? 8b1 Convert -111252 (base 6) to base 9. -13785 What is 21012 (base 3) in base 9? 235 What is 31421 (base 5) in base 6? 13435 Convert -1060a (base 12) to base 7. -120001 -10001 (base 2) to base 10 -17 Convert 370 (base 14) to base 11. 574 Convert 5f10 (base 16) to base 8. 57420 What is 604 (base 16) in base 11? 1180 2117 (base 9) to base 12 a97 33111 (base 4) to base 13 5a6 -35454 (base 6) to base 14 -1c38 What is -15646 (base 8) in base 10? -7078 Convert -2187 (base 12) to base 9. -5064 Convert 17115 (base 11) to base 15. 7215 What is 1011 (base 3) in base 15? 21 What is 11210 (base 3) in base 9? 153 -13406 (base 8) to base 10 -5894 What is 47342 (base 8) in base 10? 20194 Convert 252224 (base 6) to base 10. 22552 What is -33450 (base 6) in base 8? -11146 14211 (base 8) to base 6 45025 What is -200220 (base 3) in base 7? -1326 400 (base 9) to base 2 101000100 774 (base 8) to base 3 200211 Convert 36d (base 14) to base 3. 221101 What is -1114 (base 8) in base 5? -4323 86260 (base 9) to base 13 1cc98 Convert ba4 (base 13) to base 9. 2654 Convert 3455 (base 6) to base 2. 1100111011 Convert 6 (base 14) to base 4. 12 -4403 (base 5) to base 6 -2443 What is -406 (base 11) in base 12? -34a 10201002202 (base 3) to base 12 36292 Convert -4210 (base 7) to base 15. -687 Convert 10010000001 (base 2) to base 10. 1153 Convert 544 (base 8) to base 10. 356 What is -a2 (base 14) in base 4? -2032 What is 274 (base 11) in base 13? 1bb Convert 416 (base 9) to base 15. 179 481 (base 12) to base 10 673 Convert -9a0 (base 12) to base 15. -646 779c (base 15) to base 10 25347 452 (base 10) to base 2 111000100 What is 24ea (base 16) in base 15? 2c00 What is -996 (base 13) in base 6? -11340 What is 6546 (base 9) in base 14? 1a85 224 (base 12) to base 7 631 -10aa (base 11) to base 2 -10110101011 Convert -9092 (base 12) to base 14. -59ca What is 3748 (base 13) in base 14? 2bd8 What is 20c (base 13) in base 5? 2400 What is -b60 (base 12) in base 2? -11001111000 Convert 11012 (base 4) to base 11. 277 Convert -2838 (base 11) to base 5. -104141 546b (base 13) to base 6 130222 100110000010010 (base 2) to base 6 230054 Convert 256323 (base 7) to base 5. 3012331 -2a59 (base 14) to base 9 -11283 6284 (base 11) to base 7 33154 1110001101101101 (base 2) to base 10 58221 -10100 (base 3) to base 7 -156 Convert 10222022 (base 3) to base 13. 141b -1b3a (base 16) to base 8 -15472 Convert -1201002 (base 3) to base 10. -1244 Convert -211130 (base 5) to base 2. -1101110000000 -4651 (base 10) to base 12 -2837 What is -405203 (base 7) in base 10? -69044 What is -7417 (base 11) in base 4? -2121123 Convert 1243 (base 7) to base 14. 25a Convert 1524 (base 8) to base 12. 5b0 -44070 (base 11) to base 10 -63965 Convert 434 (base 15) to base 2. 1110110101 11011111 (base 2) to base 14 11d Convert	{ "pile_set_name": "DM Mathematics" }
6291. Let f(j) = -4j3 - 3j*2 - 2j - 4. Let b(g) = -11g3 - 9g*2 - 7g - 11. Let v(h) = 3b(h) - 8f(h). Calculate v(x). 5 Let f be ((-128)/16 + -4)1/3. Let d(l) = -l2 + 41l + 190. Determine d(f). 10 Suppose -1054c - 103 - 95 = -1021c. Let v(d) = 17d + 108. What is v(c)? 6 Let n(a) = 3a + 103. Let i = -466 + 436. Determine n(i). 13 Let q(j) = j3 + j2 - 5j - 2. Let o be q(-3). Let c(y) be the second derivative of -y3/2 - 5y*2/2 - 28426y + 2. What is c(o)? 10 Let n(p) = -64p - 44. Let k(c) = 3c + 1. Suppose -4z + 3z + 4j - 21 = 0, 4z + 9 = j. Let l(d) = zn(d) - 20k(d). Calculate l(-7). -4 Let j(n) = 334n + 1991. Let l be j(-6). Let k(u) = -u + 5. Determine k(l). 18 Let x = 264 + -261. Let p(o) = -2o - 2o2 + 2o*3 + 8 + o - 7o*x + 6o*3 + 3o2. Calculate p(0). 8 Let n(p) = -p2 - 9p - 9. Let o(q) = q3 - 28q*2 - 31q + 50. Suppose 21 = -3f + 108. Let a be o(f). Determine n(a). -1 Let y(k) = -5k + 12k2 + 37 + 26k + 34 + 11k2 - 22k*2. What is y(-17)? 3 Let c(l) = -24l + 213. Let j be c(8). Suppose -3i - 3m = -6, -i - 26m + jm - 18 = 0. Let z(v) = 2v - 7. Give z(i). 7 Let n be ((-15)/9 - -2)/(3/27). Suppose 5o + f = no + 5, -5f + 1 = -2o. Let w(s) = -3s + 7 + os - 6. Calculate w(-6). 7 Let o(p) = 2p + 3. Suppose -8s = -50 + 10. Suppose -13i + 24 = -si. Give o(i). 9 Let u(q) = 366 + 11q - q2 + q2 + 4q2 - 368 + 2q*2. Determine u(-2). 0 Let w be ((-20)/251)/(10/(-25)). Suppose -2t + 2i = -4, -wt - 11 - 13 = 5i. Let g(p) be the second derivative of 3p3/2 - p2/2 + p. Give g(t). -19 Let s(f) = f3 + 50f*2 - 106f - 105. Let c be s(-52). Let l(o) = -33o2 - 3o - 1. Determine l(c). -31 Let h(f) = 13f + 35. Let a(q) = -36q - 98. Let n(g) = -4a(g) - 11h(g). What is n(-8)? -1 Let s(r) = -95r - 25. Let n(c) = c2 - 45c - 12. Let p(f) = -7n(f) + 4s(f). Calculate p(-9). 2 Let f(w) = 9w + 305. Let q(m) = -9m - 364. Let t(y) = -6f(y) - 5q(y). Give t(-5). 35 Let a(r) be the first derivative of -r6/360 + r5/8 - 5r4/8 + 16r3/3 - r2 - 35. Let w(m) be the third derivative of a(m). What is w(13)? 11 Let y(s) = -s*3 + 3s*2 + 9s + 12. Suppose 4o = -n + 19 + 15, 3n + 5o = 53. What is y(n)? -42 Let s(x) = -5x*2 + 55x + 6. Let b be s(11). Let o(d) = -d*3 + 5d*2 + 15d - 55. Determine o(b). -1 Let o(b) be the third derivative of -b8/20160 + b7/1260 + b*6/240 - 19b5/20 - b2 - b. Let c(l) be the third derivative of o(l). What is c(5)? -2 Let p(z) = -34z - 10 + 7 - 28 - 11z. Let b(a) = 16a + 10. Let d(q) = -11b(q) - 4p(q). Calculate d(-5). -6 Let i be 3 + (-1 - -1)-1. Suppose -in + 4 = -s, n + 2 = -4s - 27. Let u(r) = r + 4. Give u(s). -3 Let r = 577 - 574. Let p(v) = -1 + 6v3 - 3v3 + v3 - 3vr + v2. What is p(1)? 1 Let w(m) be the second derivative of m4/12 - 4m*3 - 85m*2/2 + 99m. Let s be w(27). Let o(b) = -b - 7. Calculate o(s). -3 Let d = 9 + 2. Let h(s) be the third derivative of s*7/840 - 11s6/360 + s4/8 - 53s3/6 + 8s2. Let o(q) be the first derivative of h(q). Give o(d). 3 Let r(z) be the second derivative of -z5/20 - 3z4/4 - z3 + 8z*2 + 273z. Give r(-8). 0 Suppose 0 = 5k + 5o + 40, 4k + 2o - 10 = -30. Let p(t) = 5t2 + 13t + 9. What is p(k)? 3 Let r(q) = q*3 + 9q*2 + 8q - 3. Suppose -188a + 183a = -75. Suppose -n - a = -4n. Suppose -nh - 60 = -20. What is r(h)? -3 Let a(b) be the second derivative of -b7/420 + b6/360 + b5/40 - b4/24 - 43b3/3 + 160b. Let l(u) be the second derivative of a(u). Calculate l(2). -7 Let y be 0 + 12/(-3) + -8. Let t be -1 + (3 - y/(-1)). Let k be 0 + t/(1 - -1). Let i(b) = -3b. Calculate i(k). 15 Let u(d) = 571d + 111. Let b(t) = 471t + 111. Let o(z) = 6b(z) - 5u(z). Give o(4). -5 Let i(u) = u2 + 8u - 27. Let o(z) = 331z + 2637. Let r be o(-8). Give i(r). 6 Let b(h) = h - 14. Suppose -4t - 2z = -82, 5t + 52z - 100 = 49z. Suppose tg - 27g = 5k - 57, -k = 4g - 21. Calculate b(k). -5 Suppose x + 0 + 11 = 0. Let f(s) = -3. Suppose 3n = -4q - 23, -4q - 3 = -11n + 10n. Let o(l) = l + 16. Let w(a) = qo(a) + xf(a). What is w(4)? -7 Let k(n) = n + 17. Let a(m) = -m3 + 15m*2 - 31m - 7. Let y be a(13). Let w = -90 - y. Let r be (w/(-1))/(1 - (-3)/(-1)). Give k(r). 8 Let z be 455/30 + (-1)/6. Let t be (-21)/35 + 84/z. Suppose -4b = -tl - 18, b - 2 + 1 = 3l. Let d(u) = -u2 + 7u + 7. What is d(b)? 7 Let b = -3 + -2. Suppose 0 = -5d - 3n - 2, -d - 13 - 1 = 4n. Let a(j) = 9 + 3 + d + 2j - 7. What is a(b)? -3 Let u(n) = -2n + 2n*2 + 0n2 - 4 + n3 + 4. Let g be (-33)/5 + (-54)/135. Let i(d) = d*3 + 6d*2 - 6d + 9. Let z be i(g). Determine u(z). 12 Let k(s) = s*2 - 19s + 94. Let v be (24/(-228))/((-2)/152). Calculate k(v). 6 Let p(y) = y*2 - 2y + 4. Suppose -63u = -80u. Give p(u). 4 Let u(v) = -43v + 22 + 22 + v2 + 15v + 14v. Give u(8). -4 Suppose 11 = -5t + 61. Suppose -t = -34j + 29j. Let y(u) be the second derivative of u4/12 - u3/6 - u*2/2 + 2u. What is y(j)? 1 Let s(b) = 58b + 24. Let f(g) = -1056g - 429. Let l(d) = -3f(d) - 55s(d). What is l(-4)? 55 Let k(i) = -i*2 - 14i - 10. Let u(c) = -c*3 + 14c*2 - 45c - 15. Let w be u(7). Let v(z) = -2z3 + 25z*2 + 13z - 13. Let t be v(w). Give k(t). 3 Let n = -5623 + 5616. Let q(b) = b*3 + 8b*2 + 6b - 17. Give q(n). -10 Suppose -2f - k + 464 - 457 = 0, 3k - 18 = -3f. Let b(x) = -18x*3 + 5x*2 - 7x + 2. Give b(f). -18 Let c(q) = q*2 + 110q + 629. Let n be c(-6). Let h(t) be the first derivative of 1/2t2 - 3t - 3. Give h(n). 2 Let d(t) = 31t3 + 28t*2 + 60t - 42. Let a(o) = 3o3 + 3o*2 + 6o - 4. Let w(l) = -21a(l) + 2d(l). Let b = 6 - 12. Calculate w(b). 0 Suppose -6f + 2f - 2b = -26, 0 = 2f + 5b - 33. Suppose fj + 175 - 199 = 0. Suppose 2p - j = g + g, -g - 31 = -5p. Let s(h) = -h + 7. Determine s(p). 0 Suppose -4w + 26 = 3o + w, 0 = -w + 4. Suppose 39 = 28h - 33h + 3m, -om + 36 = -5h. Let s(g) = -g3 - 5g*2 + 4g. What is s(h)? 12 Let r(c) = 6c2 - 19c - 45. Let n(j) = j*2 - 3. Let z(a) = -5n(a) + r(a). Give z(21). 12 Let p(m) = -m*2 + 20m - 34. Let r be p(2). Let i(t) = 6t3 + 2. Calculate i(r). 50 Suppose 0h + 5 = h. Let v(w) = -2w2 + 8w + 330. Let j(d) = d*2 - 4d - 148. Let x(o) = -9j(o) - 4v(o). Determine x(h). 7 Let n be ((-48)/(-40))/((-6)/40). Let j = 10 + n. Let s(d) be the first derivative of -d*4/4 + 2d3/3 - d2 - 2d - 89. Calculate s(j). -6 Let r(i) be the third derivative of 0 + 1/2i*3 - 1/60i*5 + 102i*2 + 0i*4 + 0i. What is r(-3)? -6 Let m(n) = 4n + n3 - 321467n*2 + 321473n*2 + 3n + 6. What is m(-6)? -36 Let g = 49 - 57. Let f(d) be the first derivative of 3d3 + 15 + 1/4d*4 - 8d + 3d2. Give f(g). 8 Let c(m) be the second derivative of m5/20 + 2m*4/3 - 23m*3/6 - 3m*2/2 - 4261m. Calculate c(-11). -113 Let v(p) = -2p - 1. Let h(c) = 2c*2 + 30c + 14. Let j be h(-10). Let q = j + 62. Let g be (q/36)/(1/9). Determine v(g). 11 Let r(o) = o + 2. Let w be r(5). Let q(j) = 5j - 2. Let y(l) = 1 + 9l + 0 - 3 - 2. Let b(d) = 7q(d) - 4y(d). What is b(w)? -5 Let s(h) = 11h2 + 2h - 15. Let u(t) = 9t2 + 2t - 13. Let f(v) = 5s(v) - 6u(v). Let j be (6/(-7))/((-230)/805). Calculate f(j). 6 Let x(a) = 2a. Suppose -i + 3i - 147 = -j, 365 = 5i + 2j. Let m = 69 - i. Let h be 16/(-56)-73/m. What is x(h)? -6 Let d(t) be the first derivative of t*2 + 21t + 2121. Determine d(8). 37 Let x(p) = -315p - 226. Let q(g) = 442g + 339. Let n(v) = -5q(v) - 7x(v). Determine n(-24). 7 Let v(l) = l - 3. Let c(r) = -r + 49. Let y be c(19). Let d be ((-136)/(-20))/1 + (-24)/y. Give v(d). 3 Let q(g) = 3g + 0g*2 - 136g*3 + 40g*3 + 45g*3 - 3g*2 - 5 + 50g*3. What is q(-4)? -1 Let n(s) = 1. Let d(o) = -3o - 11. Let y be d(-4). Let z(f) = f*2 - 2f - 1. Let h(p) = yz(p) + 4n(p). What is h(4)? 11 Suppose 31 = 28n - 25. Let d(g) = -5g + 9. Let r(h) = -3h + 8. Let f(m) = nd(m) - 3r(m). Determine f(-3). -3 Suppose 5u - 245 + 185 = 0. Let z(q) = -3 + 3q - 6 - 2q + 0q. What is z(u)? 3 Let b(p) be the first derivative of -18 + 8p*2 + 7p - 17/3p3 + 1/4p**4. Determine b(16). 7 Let x b	{ "pile_set_name": "DM Mathematics" }
+ 841/14. Let w(d) be the first derivative of -3/28d4 - 1/7d*3 + 0d + 0d2 + td*6 + 2 + 3/35d*5. Suppose w(s) = 0. What is s? -1, 0, 1 Let k(i) be the first derivative of 3i*4/4 - 22i*3 + 363i*2/2 - 46. Factor k(w). 3w(w - 11)2 Solve -24/5 + 12/5k - 3/5k3 + 6/5k*2 = 0. -2, 2 Suppose -u + 4u - 30 = 0. Let x = u + -7. Find r, given that 8rx + 15r*3 + 7 - 2r*3 - 36r*2 - 1 + 9r = 0. -2/7, 1 Let z = 58 - 8. Factor 9a + a - za*2 + 20 + 54a*2 + 14a. 4(a + 1)(a + 5) Let g(s) be the first derivative of 0s - 1/20s*4 + 1/10s*2 - 8 - 1/30s*3 + 1/50s*5. Factor g(n). n(n - 2)(n - 1)(n + 1)/10 Let i be (-1)/4 - (-11150)/792. Let v = i + -95/9. Solve -16/11p - 2/11p*5 - vp*3 + 0 + 40/11p*2 + 14/11p*4 = 0 for p. 0, 1, 2 Factor 1729 - 65p*2 - 640p + 23871 + 69p2. 4(p - 80)*2 Factor 185h*2 - 157h + 5h3 + 675 - 15 + 457h + 380h. 5(h + 2)*2(h + 33) Let y(s) be the second derivative of s*5/20 - 3s*4/4 + 7s*3/6 + 5s*2 + 8s. Let u be y(8). What is o in 14o + 0o*u - 8o + 3o2 = 0? -2, 0 Suppose -2y - 5p = 1035 - 1079, 3y = 4p - 26. Determine f, given that 1/5f*y - 2/5f + 0 + 2/5f4 + f3 = 0. -2, -1, 0, 1/2 Let b = 60 - 56. Suppose 2h + 4 = 3m, bh - 2h = -m + 4. Factor -2/7p*m - 4/7p - 2/7. -2(p + 1)2/7 Let r be ((-360)/252)/((-10)/35). Let v(m) be the second derivative of -5/84m*4 + 1/14m*2 + 0 - 11m + 1/42m3 + 3/140mr. Factor v(p). (p - 1)2(3p + 1)/7 Let i(m) = m*2 + 44m - 1116. Let g be i(-62). Factor g + 0w + 0w*2 - 2/11w*4 - 2/11w*3. -2w*3(w + 1)/11 Let t(a) = -a*3 - 2a*2 + 2. Let g be t(-2). Let o be 1/((2/13)/g). Find q, given that 0 - 4 - oq*2 + 9q*2 + 6q + 2q = 0. 1 Let f(m) be the third derivative of 3/4m*3 - 3m*2 + 1/120m*5 + 0m - 1/8m4 + 0. Factor f(d). (d - 3)2/2 Solve -32/7m*2 - 32/7 + 10/7m*4 - 2/7m*5 - 8/7m*3 + 64/7m = 0 for m. -2, 1, 2 Determine u, given that 4u - 5u*4 - 202 + 6u + 20u2 - 10u3 + 187 = 0. -3, -1, 1 Let c(l) = l4 - l*3 + 4l*2 - 2l - 2. Let a(k) = -4k4 + 4k*3 - 12k*2 + 5k + 7. Let p(w) = -2a(w) - 7c(w). Factor p(h). h(h - 2)(h - 1)(h + 2) Suppose -6g*3 + 0 - 81/2g + 63/2g2 = 0. What is g? 0, 9/4, 3 Let x be ((-17)/(-4))/(2/8). Solve -19b*2 - 55b*2 - 128b*5 - 14b + 232b3 - x + 21 + 160b*4 = 0. -1, -1/4, 1/4, 2 Let -2/9l*3 - 8192/9 - 32/3l*2 - 512/3l = 0. What is l? -16 Let d(q) be the third derivative of -q8/224 + q7/14 + q6/80 - q5/4 + 2q2 - 71q. Solve d(j) = 0 for j. -1, 0, 1, 10 Let n(r) be the third derivative of 0r3 + 0 + 1/60r*5 + 42r*2 + 0r + 0r4. Determine l, given that n(l) = 0. 0 Let j(d) = -d2 + d - 1. Let r(q) = -q2 + 2q + 4. Let z be r(4). Let g(k) = 6k2 - 2. Let m(n) = zj(n) - g(n). Factor m(t). -2(t - 1)(t + 3) Let c(z) be the third derivative of 4z - 3/5z5 - z2 + 17/6z4 + 0 - 2z*3 - 1/6z*6. Factor c(k). -4(k - 1)(k + 3)(5k - 1) Let i be ((-3)/(-76))/(60/(-520)). Let r = 3/19 - i. Factor 3/2u*2 + 0 - ru. u(3u - 1)/2 Factor 1/5o5 + 0 - 3/5o*3 - 12/5o + 6/5o4 - 4o*2. o(o - 2)(o + 1)2(o + 6)/5 Let v be 45/(-10)4/(-6). Factor -i - 16 - 7i*2 - 15i + vi2 - 4i. -4(i + 1)(i + 4) Let z(w) be the second derivative of w*7/42 + 41w*6/30 + 22w*5 + 100w*4/3 + 297w. Determine p so that z(p) = 0. -20, -1, 0 Let g(l) be the third derivative of 0 + 3/5l4 + 0l + 1/350l7 + 1/100l*6 + 0l*3 + 14l*2 - 1/5l5. Solve g(v) = 0 for v. -6, 0, 2 Let t(i) = i3 + i. Let a = 20 - 23. Let d(w) = -2w3 - 9w*2 + 24w - 27. Let r(g) = at(g) - d(g). Factor r(y). -(y - 3)3 Let i(b) be the first derivative of -5b*3 - 515b*2 - 680b - 126. Factor i(s). -5(s + 68)(3s + 2) Suppose 12h + 45/4 + 3/4h2 = 0. Calculate h. -15, -1 Let w be -1 - -2 - (-9)/(-6)(-1862)/1995. Solve 0 + 12/5p - wp*2 + 3/5p*3 = 0 for p. 0, 2 Let z be (-4)/2426. Let a be z + 4 - (0 + 0). Factor 2 + 13k + 50ka + 9k - 2k. 2(5k + 1)2 Let w(a) = 4a*3 + 3a*2 + 6a + 1. Let x(d) = -11d3 + d2 - 2d*2 - 17d - 1 - 2 - 8d2. Let i(t) = -8w(t) - 3x(t). Factor i(s). (s + 1)3 Let p(o) be the second derivative of -o8/2800 + o7/700 - o6/600 - 31o*3/6 - o + 9. Let c(i) be the second derivative of p(i). Solve c(y) = 0 for y. 0, 1 Let z(k) be the second derivative of -2k*6/15 + 12k*5/5 - 52k*4/3 + 64k*3 - 128k*2 + 24k. Factor z(l). -4(l - 4)2(l - 2)*2 Suppose 0 = -5z - 2a, -5a + 4 = 29. Let j be (41 - 39 - (1 + -5)) + (-123)/21. Factor -16/7 - jsz + 8/7s. -(s - 4)2/7 Let x(q) be the first derivative of -q5 + 65q4/2 - 360q*3 + 1215q*2 + 3645q - 249. Find b, given that x(b) = 0. -1, 9 Let t(f) be the first derivative of 3f5/5 - 27f*4/4 + 15f*3 + 75f*2/2 + 27. Solve t(z) = 0 for z. -1, 0, 5 Let o be (9 - 0)/(38/24). Suppose -3g - 2g - 3 = -l, -3l = -g - o. What is b in -2/7b*3 - 8/7b*2 - 8/7b + g = 0? -2, 0 Let g be 5/3 + (-6974)/4755. Determine f, given that -gf2 + 0f + 0 = 0. 0 Let o(r) be the first derivative of -9r4/4 + 32r*3 + 39r*2/2 - 66r + 77. Factor o(z). -3(z - 11)(z + 1)(3z - 2) Suppose -2a = 2t - 18, 2a - 27 = -a + 4t. Let b be (11/12)/(a/81). Suppose -bo*2 - 3/2 - 9/4o = 0. What is o? -2, -1 Let s(d) = 16d3 - 3d*2 + 3d - 1. Let w be s(1). Let q be (2/w)/(-4(-3)/72). Determine u so that -qu*3 - 17/5u*2 - 4/5 - 4u = 0. -2, -1/4 Let l(t) = -3t3 - 12t*2 + 17t - 32. Let s(y) = 2y3 + 12y*2 - 18y + 28. Let c(b) = 4l(b) + 5s(b). Factor c(q). -2(q - 3)(q - 2)(q - 1) Let o(y) be the second derivative of y9/3024 - y8/672 + y7/504 + y4/4 - 7y. Let l(f) be the third derivative of o(f). Factor l(h). 5h2(h - 1)*2 Let l(x) be the first derivative of 0x - 2/33x3 + 0x*2 + 6. Let l(n) = 0. What is n? 0 Let v(m) be the first derivative of 3/4m*2 + 3/2m*3 - 3/8m*4 - 18 - 9/2m. What is w in v(w) = 0? -1, 1, 3 Suppose 6 = 2f - 0. Find p such that 8 - 18p - 2p + 16p*2 - 64p*3 + 60p*f = 0. 1, 2 Let l be (-3 - -3)/2 + -2. Let n be -6l(-4)/(-24). Factor 6y - 11y - 2y*n + 3y. -2y(y + 1) Let b = 20 - 9. Factor 6a2 + 13a + 6a - 2a*2 - ba. 4a(a + 2) Determine b so that -4/9b4 + 0 + 2/9b*5 - 8/9b*3 + 2/3b + 4/9b2 = 0. -1, 0, 1, 3 Let h = -927/5 + 186. Let v(z) be the third derivative of 0 + 1/300z*6 - 7/150z*5 + 1/4z*4 + 0z - hz3 - 5z*2. Factor v(j). 2(j - 3)*2(j - 1)/5 Factor 27/7g + 0 + 18/7g*2 + 3/7g*3. 3g(g + 3)2/7 Let o(i) = -18i + 669. Let u be o(37). Let -2/9 + 8/9a - 4/9a*2 + 2/3a*4 - 8/9a*u = 0. Calculate a. -1, 1/3, 1 Suppose v + 4 = 3c, 0 = -5c - 5v + 4v + 20. What is b in b - 2b*4 - 241b*3 + 2b*2 + cb + 237b3 = 0? -2, -1, 0, 1 Let k = 5 + -3. Let -59v + 62v - v3 - kv*3 = 0. What is v? -1, 0, 1 Let z = -4303/7 + 617. Let b(a) be the first derivative of -24/7a*3 - 4/7a - 9 + 16/7a4 - 4/7a*5 + za*2. What is n in b(n) = 0? 1/5, 1 Let c(h) be the second derivative of -1/150h*6 + 1/2h*2 + 0 + 1/5h*4 + 48h - 1/50h5 - 7/15h*3. Suppose c(b) = 0. Calculate b. -5, 1 Let y be (2 - 6)/(-2)2. Let s be 56/16 - 2/y. Factor 4a2 + 4a + a*s - 2a*2 - 3a*3. -2a(a - 2)(a + 1) Let x(f) be the third derivative of -f8/504 - f7/45 + f6/6 - f2 + 28f. Factor x(i). -2i*3(i - 3)(i + 10)/3 Factor 3m*2 + 216 - 24m*2 - 212m + 8m2 + 9m*2. -4(m - 1)(m + 54) Let i = 1308 - 1305. Factor -2/7r*2 - 2/7r*4 + 4/7r*i + 0 + 0r. -2r2(r - 1)*2/7 Suppose -4w - 2w = 18. Let k be 40/42w/(-2). Factor -10/7m + km*3 - 4/7 + 4/7m*2. 2(m - 1)(m + 1)(5m + 2)/7 Let y be (1 - 78/30)10/(-4). Find m, given that 0 - 3/2my + 0m + 0m3 + 3/2m2 = 0. -1, 0, 1 Let y(h) be the third derivative of -h8/4 + 41h7/70 + 63h*6/10 + 31h*5/5 + 2h*4 - 95h*2. Find i, given that y(i) = 0. -2, -2/7, -1/4, 0, 4 Let z(c) = 3c*2 + 21c - 22. Let o be z(-8). Determine f so that -4/5f + 1/5f*o + 4/5 = 0. 2 Determine t, given that -175/2t - 13/2t4 + 1/2t*5 + 5t*2 + 23t*3 - 125/2 = 0. -1, 5 Let v(a) be the third derivative of 0 + 1/660a*6 - 1/132a*4 - 5a*2 + 0a +	{ "pile_set_name": "DM Mathematics" }
he units digit of i? 9 Suppose -2l + 392 = -2j, 3l + 181 = 4l - 4j. What is the units digit of l? 1 Suppose z - 15m + 12m - 925 = 0, 4m = 4z - 3716. What is the hundreds digit of z? 9 Let t be -3((-145)/3 + -2). Let y = 270 - t. What is the hundreds digit of y? 1 Suppose 7j = 8j + 188. Let v = -131 - j. What is the tens digit of v? 5 Let s = -1 - -5. Suppose 0w - sw = 176. What is the units digit of (-564)/w + 6/33? 3 Let u be 2/(1 + 57/(-51)). Let w = -15 - u. What is the units digit of (-2)/(2/(-10)w)? 5 Let w(j) = 2j*2 + 59j - 39. What is the hundreds digit of w(-33)? 1 Suppose -4i = 16, -5i + 2046 = -5d + 17881. What is the tens digit of d? 6 Suppose 3f + 5b + 48 + 62 = 0, -2b = 3f + 125. Let z be 3/4 + f/12. What is the units digit of (-20)/(-5) - z/3? 5 Let p = 1590 - -1125. What is the units digit of p? 5 Let x(d) = d3 - 4d*2 + 2. Let o be x(4). Suppose 32 = 3k + oj, 2k + j - 20 = -j. What is the tens digit of k? 1 Let m(a) = -256a3 - 4a*2 + 2a + 9. Let d be m(-2). Suppose -8t + d - 613 = 0. What is the units digit of t? 8 Let n(f) = 25f*2 + 8f - 25. What is the hundreds digit of n(3)? 2 Let z(c) = 2c3 - 6c*2 - 6c + 43. Let r be (-820)/246(-9)/(-10)-2. What is the tens digit of z(r)? 2 Let b = 7394 + -5184. What is the tens digit of b? 1 Suppose -166102 = -127u + 323102. What is the hundreds digit of u? 8 Let v(k) = -2k + 3. Let i be v(4). Suppose h + 0 = -2. What is the tens digit of 29 + 5/(i/h)? 3 Let q(m) = 29m2 - 2m + 2. Let o be q(1). Suppose a = -o + 147. What is the hundreds digit of a? 1 Suppose c - 9 = -i, 2i - 7 = -c + 6. Let b(y) = 18y + 26. What is the units digit of b(c)? 6 Suppose 0 = -4t + 2t + 4i + 20, 4t - 4i = 24. Suppose -5w - y = -706, -ty + 143 = w - 0y. What is the units digit of w? 1 Let o(k) = k + 221. What is the hundreds digit of o(-23)? 1 Suppose -1 = -3t + 8. Suppose 0 = -g - 0g + t. Suppose 4p - gp = 4k + 13, -4p + 72 = 4k. What is the tens digit of p? 1 Let v = 2 + -1. Let w(g) = 29g - 1. Let i(a) = -58a + 2. Let u(y) = 4i(y) + 9w(y). What is the units digit of u(v)? 8 Suppose 34110 = 6w + 9114. What is the thousands digit of w? 4 Let u = -1569 + 2442. What is the units digit of u? 3 Suppose -5d + 3n + 652 = 0, 3n + 763 = 4d + 242. Let h = -60 + d. What is the tens digit of h? 7 Let s = -117 + 311. What is the tens digit of s? 9 Suppose 0 = 36a - 35a - 43. Suppose 167 = j + a. What is the tens digit of j? 2 Let j be (-45)/(-6)(-8)/(-12). Suppose -2y + 163 = jm, 4m - 63 = -y + 11. What is the tens digit of y? 9 Let t be (-3 + (0 - -4))1-4. Let o(f) = -6f - 20. What is the units digit of o(t)? 4 What is the hundreds digit of ((-6)/5)/(24/(-25240))? 2 Suppose 6c - 220 = 2c. Suppose -325 = -4x + 5i, -x - 2i - 2i + c = 0. Suppose 8n - 3n - x = 0. What is the units digit of n? 5 Let n be (112/(-35))/(4/(-10)). Let m be n/(-20) + 32/5. What is the units digit of (-3)/9 + 134/m? 2 Suppose -2f = -3o - 38, 65 = 5f + 4o - 7. Let r be 12/f4 - -46. Let g = r - 31. What is the tens digit of g? 1 Let r = 99 + -178. Let d = -35 - r. What is the tens digit of d? 4 Let t be (-8)/61/((-6)/(-63)). Let d(g) = 2g*2 + 13g - 4. What is the hundreds digit of d(t)? 2 Suppose -2w + 4 + 1 = -5m, 0 = -3w - 2m - 21. Let h(z) = z3 - z2 - 5z + 8. Let f be h(2). What is the tens digit of f/w(-70)/2? 1 Suppose -5c + 2725 = -195. What is the units digit of c? 4 Let c(p) = 34p3 + p2 - p. Let v(a) = -a*3 + 4a*2 - a + 5. Suppose -4w = -8 - 0, q - 4w + 4 = 0. Let s be v(q). What is the tens digit of c(s)? 3 Suppose -6h = 16 - 40. Suppose hl - 272 = -4d, 8d - 282 = 4d + l. What is the tens digit of d? 7 Let f(y) = y*3 - 19y*2 - 26y - 47. What is the hundreds digit of f(22)? 8 Let l(s) = -18s - 5. Let m be l(5). What is the tens digit of 5/((-195)/m + -2)? 9 Let q(m) = m3 - 5m*2 - 12m - 10. Let b be q(7). Suppose -s + 5h = -101, -3s + bh + 296 = 4. What is the tens digit of s? 9 Suppose -4a = 0, -2v + 4a = -0v - 166. What is the tens digit of v? 8 Let g = -1 - 2. Suppose -7z + 8z = 2y, 3z - 8 = -2y. What is the units digit of (-2 - g)/(z/28)? 4 Let h be (25/2 - 5) + (-2)/4. Suppose hv + 3v - 1760 = 0. What is the hundreds digit of v? 1 Let q(d) = d*2 + 4d + 34. What is the units digit of q(15)? 9 Suppose y - 5y - 124 = 0. Let h = 28 + y. What is the units digit of h/(-9) + 155/3? 2 What is the tens digit of ((-8)/(-16))/((6/(-292))/(-3))? 7 Let h(x) = 109 - x2 - 18 - x - 17. What is the units digit of h(0)? 4 Let n(m) = m3 + 5m*2 - m + 5. Let k be n(-5). Let x = 15 - k. Suppose 7p = 4z + 2p - 9, 0 = -xz + 5p + 15. What is the units digit of z? 6 Suppose 2d = 4g + 82, -3g = -3d + 5d - 117. Let b = -70 + 181. Let v = b - d. What is the tens digit of v? 6 Let b = 5341 - 2329. What is the thousands digit of b? 3 Let z be (8/(-24) + 29/6)2. Let v(k) = 1 - k*2 - k + 13k - k. What is the units digit of v(z)? 9 Suppose 36 = 13g - g. Suppose gz + 2z + 4m = 855, -3z + 521 = 4m. What is the hundreds digit of z? 1 Let i(a) = 24a2 + 27. What is the tens digit of i(-5)? 2 Let w(h) be the first derivative of 14h*3/3 + 3h*2/2 + 6h - 10. What is the tens digit of w(-2)? 5 Let w(s) = 14s3 - 14s*2 + 7s. What is the hundreds digit of w(7)? 1 Suppose 0k = -9k + 3069. What is the tens digit of k? 4 Let x = 1361 + -731. What is the units digit of x? 0 Let l = -729 - -2097. What is the units digit of l? 8 Suppose j - 18 = -2j. Suppose js - 146 = 4s. What is the units digit of s? 3 Suppose 0 = -3j + 5g + 1008, -3j - 123 + 1131 = g. What is the hundreds digit of j? 3 Let t be ((-8)/(-12))/((-4)/(-6)). Let c(z) = 0z3 + 6 - 10z + 8z2 - t + z3 + 0. What is the tens digit of c(-9)? 1 Let u = -381 + 921. What is the tens digit of u? 4 Let n = -14 + 5. Let l = n - -19. What is the units digit of (2 - (-5)/2)l? 5 Let m be (-3)/2(-9 - -7). Let a be (m + 1)1/2. Suppose -208 = -5l - u + au, -l + 32 = 3u. What is the units digit of l? 1 Suppose -3a - 22 = -67. Suppose -2c - 4g + 2 = 0, 0g + 5g = a. What is the tens digit of 25(-2 - 14/c)? 2 Let k = 259 + -128. Suppose 8f - 365 - k = 0. What is the units digit of f? 2 Suppose o - 84 = -2o. What is the units digit of o/10(16 + 4)? 6 Let p = 1180 - 516. What is the units digit of p? 4 Let y(q) = -q + 9. Let v(u) = u - 10. Let b(c) = 6v(c) + 5y(c). Let j be b(16). Suppose -j = -2f + 37. What is the units digit of f? 9 What is the units digit of 17/(-17) + 3141? 2 Suppose -638 - 113 = -i + 5p, 3i = -2p + 2321. What is the units digit of i? 1 Let v = 20 - 10. Let u = 14 - v. Suppose d + 0d - u = 0. What is the units digit of d? 4 Let o be -2 - (1 - 4 - 1). Let k = -44 + 42. What is the units digit of k + o - 1/(-1)? 1 Let a(r) = -21r + 13. Suppose -72 + 64 = 2g. What is the tens digit of a(g)? 9 Suppose 5z + 5c = 980, -206 = -4z + 3z - 3c. What is the units digit of z? 1 What is the units digit of (-23)/(207/(-2958)) - (-4)/(-6)? 8 Let b(v) be the second derivative of 11v4/6 - v3/2 - 12v. What is the units digit of b(-1)? 5 Let b(u) = -u2 + 34u - 12. Let m = -32 - -60. What is the hundreds digit of b(m)? 1 Let x(h) = -h*3 + 3h*2 + 2h + 7. Let b be x(4). What is the hundreds digit of (2/(-6))/b - (-928)/6? 1 What is the hundreds digit of (-28)/364 + 42850/26? 6 Let l(k) = -2k + 9. Let w be l(7). Let x = 7 + w. Suppose -f - 9 = -xf. What is the units digit of f? 9 What is the tens digit of -1 - (3 - -2) - 77110/(-55)? 9 Suppose 0 = -4x + 7x - 33. Suppose 4t = -w - x, -t - 2 = -3w + 17. Suppose 5y = -f - 4f + 155, 47 = y + wf. What is the units digit of y? 7 Let u(y) = -y2 - 5y + 4. Let g be u(3). Let h be (g/8)/((-2)/4). Suppose -hl + 61 = -4. What is the units digit of l? 3 Let a = 4 + -2. Suppose -3t = al - 18, l - 2t - 2 - 7 = 0. Let u = l - -8. What is the units digit of u? 7 Let k(f) = -f + 16. Let o be (-8)/48 + (-49)/(-6). Let t be k(o). What is the units digit of -201(-8)/t? 0 Let q be 20/4 - (1 - -2). Let n be 836/8 - q/(-4). Suppose r + 14 = -4g + n, g - r - 19 = 0. What is the units digit of g? 2 Suppose -77 + 127 = 5d. Suppose dn = 6n + 104. What	{ "pile_set_name": "DM Mathematics" }
10v - 248 + 2v*3 + 110v as fv3 + iv + y + wv2 and give y. -248 Express -1 - 845z + 1503z - 366z in the form mz + y and give y. -1 Express -62t + 65t + 8 - 3t*3 + 2t*2 + 0t*2 as it + u + vt3 + ot*2 and give u. 8 Rearrange -1053q*2 - 2q*3 + 1064q*2 + 3q3 - 1 - q4 - 3q to the form n + iq + yq2 + uq*4 + tq*3 and give i. -3 Express 4352j*3 + 0j*2 - 2675j3 - j2 - 2j + 2j in the form pj3 + yj + i + nj2 and give n. -1 Express (-1 + 0 - 1)(32i4 - i3 + 94720i - 94720i) in the form mi*4 + fi + x + li2 + ji*3 and give m. -64 Express -z + 13434z*2 - z - 13611z*2 as hz + nz2 + r and give h. -2 Rearrange (-3h - 2 + 2)(23h - 11h + 32h + 4h + 10h) to u + ih + kh*2 and give i. 0 Rearrange 3a - 2a + 0a*4 - 8a*4 - 11a*3 + 0 + 4 + 12a*3 to the form m + pa*4 + ha*2 + ya*3 + ka and give h. 0 Express (-6 + 14 + 12)(-4 - 1 + 3 + (1 + 4 - 2)(2 + 0 + 1))(z2 - 2 + 2) in the form yz*2 + nz + j and give y. 140 Express (1891 - 82m2 - 1891)(10 - 6 - 5 - 19m2) in the form qm*2 + xm + ym3 + jm*4 + n and give j. 1558 Rearrange -3 + 52m - 395m - 2 + 3 to the form f + um and give f. -2 Express (-3s + 12 - 12)(32s - 105 + 108 + 0s) as x + zs2 + ms and give z. -96 Express -16d + 2d - 54 + 6d + 9d in the form od + w and give o. 1 Express -2w*2 + 0w - 54595 - 75w3 + 54593 + w in the form a + ow + dw2 + qw*3 and give o. 1 Express (31i - 39i - 47i)(-3 - 3 + 3) as ti + x and give t. 165 Rearrange 2r2 - r2 + 0r*2 + 83 to the form qr*2 + w + mr and give w. 83 Rearrange -64c3 + 4 + 0 + 2475c - 2475c to oc*3 + f + nc + pc2 and give o. -64 Rearrange (-21 - 15 + 51)((3 + 0 - 6)(2z + 2 - 2) + 1 - 1 - 2z) to the form qz + s and give q. -120 Express 3 - 3f - 1 + f + (4 - 1 - 10)(-2f + f - f) - 1 + 4f + 3 + 50f as y + gf and give y. 4 Express (2 + 3 + 1)(-87x*4 + 304x*2 - 304x*2) - 4x*4 + 6x*4 - 3x*4 as ix*2 + f + bx*4 + ux + rx3 and give b. -523 Express 21x + 8x + 16x + 48x as cx + y and give c. 93 Rearrange (5 - 3 - 4 + (2 - 4 - 1)(-17 - 41 + 11) - 1 + 2 - 2)(2 + 0 - 3b + 5b) to i + mb and give m. 276 Rearrange (0j*3 + 0j*3 - 2j*3)(-28 + 7 - 61 + 13) to the form cj3 + qj*2 + gj + k and give c. 138 Rearrange (-6i + 3i + i + (0 - 3 + 1)(-i + 5i - 2i))(-1 + 0 + 3)(-1 + 1 - 1 + (-1 - 2 + 2)(3 - 4 - 1) - 159 + 993 - 95) to w + xi and give x. -8880 Rearrange (-22a - 450 + 450)((0 - 2 - 2)(-3 + 3 - 1) - 4 + 4 - 2) to the form ma + p and give m. -44 Express (-17 + 27 + 4)(2 - 2 + u) as i + mu and give m. 14 Express 2 - u + 12 - 14 as gu + q and give g. -1 Rearrange 2i2 + 2 - 2 + 0i*2 + 0i2 + i2 + (-2i + i + 6i)(-6 + 3i + 6) - 5i - 10i*2 + 5i to di + bi*2 + g and give d. 0 Rearrange 58b + 104b + 40b to the form c + ab and give a. 202 Rearrange -5f + 9f2 + 3f2 + f3 + 7 - f*4 + 3f - 9f2 to xf + zf2 + sf*3 + of*4 + p and give x. -2 Express -6l + l2 - 87 + l3 + 3l3 + 89 as rl*2 + sl*3 + o + ml and give s. 4 Rearrange 0c + 0c + 2c + (0 - 2c + 0)(0 + 2 - 4) - 6 + 6 - 2c + 108c + 140c + 126c + 298c + 291c to y + zc and give z. 967 Rearrange 0x + 16216x3 + x2 + x*2 - 16283x*3 + 0x to ax + wx*3 + h + jx2 and give w. -67 Express -b3 + 4b3 - 2b3 - b + b3 - 3b + b - 10b + 10b - 3b*3 + (-4 + 7 + 2)(0b3 + 0b3 + b3) as ab + k + gb*3 + ib*2 and give g. 4 Rearrange -3f*2 - 82 + 4f*2 + 71f*3 - 72f*3 to the form sf*2 + mf*3 + t + xf and give m. -1 Express 11 - 3 - 3t2 - 3 + 3 + t2 in the form qt + ht2 + b and give h. -2 Express -20 + a2 + 11 - 6a + 0 + (-2a + 6a - a)(-4a + 5a - 3a) as fa + ua*2 + w and give w. -9 Express -8d*3 - 3d*3 + 12d3 + d2 - 1 - 1 + d*2 as vd + jd2 + od*3 + b and give j. 2 Rearrange (209b - 416b - 1090b - 293b)(0 - b + 0 + 1) to the form k + db + ib*2 and give d. -1590 Express 58 - 571j - 127 + 69 as pj + s and give p. -571 Rearrange -66 + 113 - 52 - 136o to the form i + so and give i. -5 Express f - 2f*3 + 3f*3 + 1109f*2 + 39 - 1111f*2 in the form o + uf*2 + cf + zf3 and give z. 1 Express -2l - 286l2 - l4 - l3 + 4 + 5l*3 + 283l*2 - 2 in the form yl*3 + gl*4 + n + ol + xl2 and give x. -3 Rearrange (20y - 320y + 105y - 153y)(0y - 3y - 4y) to the form zy + my2 + s and give m. 2436 Rearrange 5 + 3g*4 - 4g*4 + 5g*3 - 6 + 1 + 4g*2 to ng + j + ig2 + wg*4 + yg*3 and give w. -1 Rearrange (-3 - 2y + 3)(1 - 4 + 4) + 31y + 60y + 39y to ky + v and give k. 128 Express (-1727 - 2887129w + 2887131w + 686 - 2w*2)(0 - 2 + 1) as b + pw2 + mw and give p. 2 Rearrange -6g3 - 2g*2 + 3g3 + 4 - 1 + g2 - 1 - 3g4 to n + qg*2 + cg*4 + jg*3 + tg and give q. -1 Rearrange -126 + 5s2 - s2 + 0s*2 + 119 to ls + ys2 + j and give j. -7 Rearrange -14i*2 + 2 + 2i*3 + 2i*4 + 1107i - 1104i - 4i*3 to the form si*2 + mi*4 + pi + vi3 + c and give s. -14 Rearrange (4084 + 1879 - 1650)(3s + 2s - 4s) to the form w + fs and give f. 4313 Rearrange k - 4k + k + (40 + 30 + 38)(1 - 7k - 1) to u + jk and give j. -758 Express (-255s4 - 26s*3 + 446s*4 - 224s*4)(-1 - 1 + 3)(-5 + 3 + 0) in the form ps*3 + n + ws*4 + ks*2 + bs and give p. 52 Express (-2d + 9d - 11d - 7)(9d - 23d - 7d) as vd + q + cd2 and give v. 147 Rearrange 1844 - 923 - 921 + 671t to y + nt and give n. 671 Rearrange 3 - 21407r + 22093r - 3 to the form y + zr and give y. 0 Rearrange 83w + 50w - 13w - 20w + 2 + 37w to the form r + cw and give c. 137 Express 0 - v + 0 - 1 + 5v + 1 + (-3 + 0 + 4)(-2v + v + 4v) - 2v - 4 + 4 + 169 + 29v - 169 as z + gv and give g. 34 Rearrange (-135a + a - 194a)(-3a - 3a + 5a) to the form ca*2 + wa + t and give c. 328 Express -5n - n + 6 - 5 + (6n + 133 - 133)(-2 + 2 - 1) as s + hn and give h. -12 Express (0 + 2 - 3)(-69d + 69d + 1198d*4) in the form ad*2 + gd + u + od4 + vd*3 and give o. -1198 Rearrange -979 + 979 + 181v*4 + (-v + 3v - 3v)(-v*3 - 5 + 5) to the form wv*2 + uv*3 + tv*4 + av + g and give t. 182 Express (-5 + 4 + 0)(-12 + q + 12)(-q + 3q + 4q) in the form l + kq2 + rq and give k. -6 Express 8m2 + 26m2 - m3 - 4m4 - 62m*2 - 3m + 12m2 as um + dm3 + s + qm*2 + nm*4 and give u. -3 Express 4h*3 + 20h*3 + 8h*3 + (-2h - 2h + h)(-2h2 + h2 + 3h*2) - 2h*3 + 4h3 - h3 as b + vh + wh*3 + ch*2 and give w. 27 Express (-l - 2l + 2l + (-1 + 2 + 1)(-3l + l + 5l))(-13l*2 + 8l*2 + 6l*2 + 35)(l + 4l - 4l) as zl + sl*4 + jl*2 + v + ml*3 and give s. 5 Express -2c + 0c + 0c2 + c2 - c*2 + 8c2 + c2 + (-c - 2c + 4c)(3c - 2c - 2c) - 8c2 + 4c*2 - 13c*2 as qc + o + xc2 and give x. -9 Rearrange -2 + 2 - 1019z - 257z - 412z to g + jz and give j. -1688 Express -68d*3 + 667d*3 + 16d + 16d + 12d - 41d in the form m + od*2 + yd*3 + kd and give k. 3 Rearrange 28 - 32 - 2s2 - 12s + 6s3 - 9s*3 to the form ts*2 + vs + w + gs3 and give g. -3 Express (2 - 2y + y - 2y)(104y3 - 41y + 41y) in the form cy*4 + vy + gy2 + zy*3 + f and give z. 208 Express 287 - 104j*3 - 4j*2 + 307 + 2j - 595 - 2j as r + kj*3 + yj*2 + sj and give r. -1 Rearrange -48x - 17x*2 + 60x*2 + 87x - 42x + x3 to the form hx + yx3 + px*2 + b and give p. 43 Express ((-8 + 8 - 8y)(3 - 1 - 1) + y + y - 5y)(y + 0y - 2y) in the form sy + x + cy2 and give c. 11 Express (8d - 14d + 13d)(21 + 22 - 13) + (-d + d + 2d)(-1 + 3 - 1) as f + jd and give j. 212 Express -g - 4 + 5g - 2g - 7g - 5g*2 + 7g as rg + t + ng*2 and give t. -4 Express (-748j*4 - 2147j + 2147j)(2 - 4 + 1) in the form gj3 + cj*2 + vj*4 + lj + r and give v. 748 Rearrange (0 + 0 + 3q + (-4 - 2q + 4)(0 - 2 + 1))(-4q - 15 + 15) to the form w + aq + bq2 and give b. -20 Express 88 + 0u*4 - 2u*3 + 158u - 3u4 - 154u + u*4 in the form b + nu*2 + su*4 + ju*3 + tu and gi	{ "pile_set_name": "DM Mathematics" }
e h(-4). Suppose -8 + z = -v. Solve o = -vo for o. 0 Let t be 1/12/1. Let s = -39 + 41. Solve to + so = 12 for o. 3 Suppose 68 = 2g + 2g - 4l, -2l + 10 = 0. Suppose 3o = -2o + 10. Suppose 2k - g = 4p, 11 + 5 = 2k - op. Solve 1 = -kz - 14 for z. -3 Let v be -5((-128)/(-20))/(-4). Suppose 0 = 4a - v - 12. Solve -20 + 0 = -aq for q. 4 Let t(z) = -z*3 - 12z*2 - 11z + 3. Let y be t(-11). Solve 2h = -yh + 20 for h. 4 Let y be ((-3)/2)/(16/(-32)). Solve -y = g - 1 for g. -2 Suppose -o - 5u - 19 = 0, -5u - 8 - 7 = 5o. Solve 2p + o = 7 for p. 3 Let l = 7 - 4. Solve -s + ls + 2 = 0 for s. -1 Let f = -12 + 15. Solve -4u + f - 11 = 0 for u. -2 Let n = 5 - 2. Suppose -2q + 3q - n = 0. Solve -t + 16 = qt for t. 4 Let s(x) = -2x - 22. Let z be s(-11). Solve v + 2 - 1 = z for v. -1 Suppose -3f + 14 = i, -2f + 0 = i - 10. Solve 2 - 10 = ij for j. -4 Suppose -n - 4n = 0. Let b = -3 + -4. Let q be (-3)/b - 4/(-7). Solve n = w + q for w. -1 Let v(u) = -u*2 - 3u + 1. Let y be v(-3). Let s(z) = z - 4. Let l be s(4). Suppose 0 = -d - ld + 3. Solve 2w = d + y for w. 2 Let p = 4 - 1. Let x(m) = m*2 - 3m + 3. Let z be x(p). Solve -zb = -b for b. 0 Let x(h) = -2h + 33. Let p be x(15). Solve 0o - po = -15 for o. 5 Suppose -3m = -n - 1, -1 = 2n - n. Let a = 30 + -27. Solve 0l + al + 15 = m for l. -5 Let v be ((-12)/3 + 6)(0 - -1). Solve 3m - 1 - v = 0 for m. 1 Let z be 20/(-15) + 2/6. Let g be (z + 0)0 + 2. Suppose 3 + 1 = gi. Solve im - 2 - 8 = 0 for m. 5 Suppose -3z + 3k + 19 = 2z, 5z + 4k + 2 = 0. Suppose i + 1 - z = 0. Let v be 0 - -5 - (i + -1). Solve 0 = va + 10 - 35 for a. 5 Let l be 2/40/(-1). Solve l + 6 = -2f for f. -3 Let c be (3 - (1 + 1))11. Let d = -6 + c. Solve -5 = -df + 10 for f. 3 Let l = -9 + 11. Suppose 0 = lt + 2t - 36. Solve 2h + t = -1 for h. -5 Suppose 43m = 41m + 8. Solve -5r - m = -r for r. -1 Let x be 6/2 - (-3)/(-1). Suppose -3l + 8 = p - 0p, -5l = -4p + 32. Solve x = w + w + p for w. -4 Suppose -11w + 5w = 0. Solve w = -0l - l for l. 0 Let p(u) = u3 + u2 + u + 4. Suppose 2h + 0g = 3g + 7, -g = h + 4. Let s be (h + 0)(1 + -1). Let z be p(s). Solve 0 = zx - 0x for x. 0 Let u(n) = -n + 2. Let k be u(-2). Let o = -2 + 2. Solve -2l + l + k = o for l. 4 Let o = 8 - 0. Solve -f + 3f = -o for f. -4 Suppose 0 = -s - 2s + 6. Let a = s + 3. Solve 0 = -3f + 2 - a for f. -1 Suppose -3x + 2x + 2x = 0. Solve 0p + 3p = x for p. 0 Let w be (-39)/6 - (-1)/2. Let y = w - -12. Solve -4 = -2g + yg for g. -1 Let t(y) = 4y + 2y2 - 9 - y2 - 1 + 2. Let l be t(-6). Solve lq - 8 = -0q for q. 2 Suppose -2p - 1 = 7. Suppose -3a = 4m - 1, -4m + 3 = -m + 3a. Let j = m - p. Solve 5k - 12 = -j for k. 2 Let p be (-2)/(-4)(5 - 1). Let x be (10/6)/((-50)/(-60)). Suppose 62 = 5t + x. Solve 0 = py - 5y + t for y. 4 Let r = 2 - -2. Suppose -t - 4t + 15 = -g, rt + 17 = -5g. Let x be 21/(-14)(-8)/6. Solve td - 12 = -xd for d. 3 Let q = 5 + -5. Solve q = -2l + 3l - 3 for l. 3 Let t be (-3)/(-9 + 3)4. Solve -tk - 5 = -3 for k. -1 Let x = -2 - 0. Let i be (-1 + 3)1/x. Let o be 2/(-5)(-4 + i). Solve 0 = 6f - of - 12 for f. 3 Suppose -4n + 18 = o, -3o + n = -o. Let c(l) = l2 - l - 3. Let p = 1 + 2. Let w be c(p). Solve wv + ov = -20 for v. -4 Let b be 8/(-12) - 25/3. Let z(u) = -u2 - 9u + 5. Let h be z(b). Let q be (-26)/(-10) - 4/(-10). Solve -qw - 2 + h = 0 for w. 1 Let x = -17 + 21. Solve -2p + xp = 0 for p. 0 Suppose -5a + 2i + 14 = 0, -i - 1 = 1. Let l = 25 + -23. Solve ld = -ad for d. 0 Suppose 0c + 15 = -c. Let b be c/(-6) + 3/6. Solve 5 = -2h - bh for h. -1 Let g(n) = n + 1. Let b(r) = 9r + 7. Let v(c) = -b(c) + 6g(c). Let a be v(-4). Solve -5t - a - 9 = 0 for t. -4 Let h be (2 - 2)/(2-2). Solve -2k + 0k + 10 = h for k. 5 Let i = -32 - -38. Solve 2k + i = -0k for k. -3 Let x be 16/(-6)(-3)/2. Solve 10 = -3w + x for w. -2 Suppose o - 1 + 2 = 3p, -4p + 5o - 17 = 0. Solve -px = -6x for x. 0 Let t(m) = m3 - 26m*2 - 26m - 22. Let n be t(27). Solve -nz = -z for z. 0 Suppose i - 7 = -p, -i - 2p + 5p = 13. Let l be 2/4112. Let w(c) = c + 16. Let v be w(-12). Solve vq = -i + l for q. 1 Let u(c) be the second derivative of c*4/6 + 2c*3/3 + c. Let s be u(-4). Let n = -33 + 38. Solve s = nq - q for q. 4 Let u(s) = -s*2 - 12s - 7. Let k be u(-11). Solve -ky = 19 - 3 for y. -4 Suppose 0 = -2g - 3g + 20. Suppose -y + 5m - 2 + 4 = 0, -g = -y + 3m. Solve 3d = yd - 16 for d. 4 Let k = 123 - 117. Solve -3w + k = -w for w. 3 Suppose -2g + 6 + 4 = 0. Suppose 2h + 9 = gh. Solve 2f + h = f for f. -3 Let k = 40 - 35. Solve -5 - k = -5u for u. 2 Suppose -2z + 4y = z - 9, z = y + 3. Solve -5 = 2i - zi for i. 5 Let c be 2/(-4)(12 + -12). Suppose -q + 5q = c. Solve qk + 3k - 3 = 0 for k. 1 Let z = 4 + 6. Solve 0 = -g + 3g - z for g. 5 Let k = 38 - 36. Solve -3h + kh + 4 = 0 for h. 4 Let o be 5 + 19/(-4) + 2/(-8). Solve oq - 2q + 10 = 0 for q. 5 Let x be 5/25 - (-24)/5. Solve x + 0 = -y for y. -5 Let o(z) be the third derivative of z*4/24 + 2z*3/3 - 4z*2. Let q be o(0). Solve i + q = 2i for i. 4 Let t(j) = -j*2 - 2j + 3. Let y = 17 + -20. Let s be t(y). Solve 3g + 8 + 4 = s for g. -4 Let i(a) = a2 - 10a + 4. Let l be i(10). Solve -lc = 1 + 7 for c. -2 Suppose 2j + 3l = -l + 34, -5j = -4l - 141. Let i = 27 - j. Solve 0s + s = -i for s. -2 Let s = -69 + 84. Solve a = 4a + s for a. -5 Let b(g) = -4g - 1. Let z(f) = -f*2 - 1. Let c(k) = -b(k) - 2z(k). Let w be c(-3). Suppose -33 = -4y - w. Solve u = 3u - y for u. 3 Let k(y) = -y*2 - 8y + 9. Let r be k(-9). Solve -4 = -2f - rf for f. 2 Let o = 11 - 8. Let r(a) = -a*2 + 6a. Let u be r(o). Solve 29 - u = -4k for k. -5 Let i(y) = y2 + 8y + 7. Let p be i(-7). Suppose 4 + p = 4q. Solve 4n = q - 5 for n. -1 Suppose 2s - 13 = -2s - 3k, s = 3k - 8. Solve -5 + s = v for v. -4 Let c be 5(-1 - 14/(-10)). Suppose i = -ci. Suppose i = s - v - 3, 5s + 2v - 25 = -3v. Solve -3y - s = -y for y. -2 Suppose 6 + 0 = 2x. Solve -d - 20 = xd for d. -5 Suppose -u - 4u = -2j + 45, -26 = u + 3j. Let r = 21 + u. Solve k - r = -k for k. 5 Let f = -4 + 4. Suppose -2a + 4a = f. Suppose -4i + 3 + 5 = a. Solve 0 = 5q - 3 - i for q. 1 Let k = 12 - 4. Let o be 8/2 + 20 + -2. Suppose -4c + 2g = -o, 3g + k = c + 2g. Solve -l = -cl + 6 for l. 3 Let m(g) = -g*2 - 4g - 1. Let b be m(-3). Suppose 0 = -3w - 3v, bv - 6 = -4w - w. Let p be 28/12 - w/(-3). Solve 2s + 7 = p for s. -2 Let z(u) = -u3 - 3u2 + 2. Let p be z(-3). Let h be p/7 - 240/(-42). Solve -h = -c - 2 for c. 4 Let d(n) = n3 - 13n2 + 12n - 16. Let p be d(12). Let b = 18 + p. Solve 1 = -bv + 11 for v. 5 Let m(d) = 2d - 1. Let t(o) = 2 + o + 0o - 5. Let j be t(5). Let c be m(j). Solve -ca = -a + 10 for a. -5 Suppose p - 3 + 5 = 0. Let g = -1 - p. Let i be 1g/(-3)-12. Solve 2f + 12 - i = 0 for f. -4 Suppose -4f + 6 = -10. Suppose -f = -l + 1. Suppose -lc + 20 = -5. Solve 0 = cz + 10 - 0 for z. -2 Suppose 0g + 10 = i + g, 4i = 3g + 33. Solve k + 4 = i for k. 5 Suppose -22 + 4 = -3m. Suppose -4u + 26 = m. Solve 0 = 4x - ux + 3 for x. 3 Suppose -m + 0 - 7 = -5y, -5m + 5 = -5y. Solve ml = l + 4 for l. 2 Suppose v + 12 = 5v. Solve vx + 0x = 9 for x. 3 Suppose -4i + 8 = -0. Let s be -11/i0. Solve c + 3c = s for c. 0 Let c = -6 - -8. Suppose 8j = 4j + 20. Solve -3 + j = cs for s. 1 Suppose -514k + 40 = -509k. Solve 2c = -2 - k for c. -5 Let g = -32 + 43. Solve -4w + g + 1 = 0 for w. 3 Suppose 0 = -0z + 2z - 4. Solve 0 = zr + 10 for r. -5 Let w be 2/6 + 88/(-12). Let z = w - -12. Solve 0 = u - zu + 16 for u. 4 Let c(h) = h2 - 10h - 5. Let y be c(11). Let t = -3 + y. Solve 4m = 7 - t for m. 1 Let f(h) = -h2 + h + 3. Let l be f(0). Suppose -5p + 9 = -2p. Suppose 6 = pw, n = -n - 4w + 8. Solve lq + 1 - 16 = n for q. 5 Let b(u) = u*3 + 4u*2 - 5u. Let k be b(-3). Solve 5y - 9 + k = 0 for y. -3 Let c(l) = 2l. Suppose -h + 5h + 48 = 2i, -2h = 2i - 60. Let n be (-2)/6 + i/12. Let x be c(n). Solve 2 = -xz - 10 for z. -3 Let s = -58 - -64. Solve 2l = sl for l. 0 Let z(c) = c3 + 13c*2 - 31c - 10. Let l be z(-1	{ "pile_set_name": "DM Mathematics" }
derivative of -2j4 - 3651755j3 - j2 - 29783j - 15 wrt j? -48j - 21910530 Differentiate 16p3 + 872970p - 5625774. 48p2 + 872970 What is the third derivative of -4025io3 + 3io2 + 73o*5 + 5o*3 + 690616o*2 wrt o? -24150i + 4380o2 + 30 Find the first derivative of 317808324x*3 + 82800724. 953424972x*2 Find the third derivative of -119s*4 - 142097s*3 + 1039231s*2 + 2s. -2856s - 852582 What is the third derivative of -189w*6 - 90591w*4 - 580252w*2 - 54? -22680w*3 - 2174184w Find the first derivative of 8009281h + 6503353 wrt h. 8009281 What is the second derivative of 28337381j*2 - 10134402j? 56674762 What is the derivative of 19648938z - 35865345? 19648938 Differentiate -292v*2 + 98v - 1053350 wrt v. -584v + 98 Find the second derivative of -1068h*3 - 139h*2 - 805h + 5475. -6408h - 278 What is the third derivative of 4863121c*3g*2 + 2c*2g - c*2 - 30cg2 + 2706 wrt c? 29178726g*2 What is the second derivative of 2753i*5 - 356i*4u*2 + 4032710iu2 + i + 2u*2 wrt i? 55060i*3 - 4272i*2u*2 Find the third derivative of -3794047k*6 + 13k*4 - 432548830k*2 wrt k. -455285640k*3 + 312k What is the first derivative of -65169180ij + 79iy - jy - 34944y*2 wrt y? 79i - j - 69888y What is the third derivative of -286744275q*3 + 71569504q2 wrt q? -1720465650 Differentiate -o3 + 33381o2 + 97o - 18737626. -3o2 + 66762o + 97 Find the second derivative of 542194m4 + 36m*3 - 78072692m wrt m. 6506328m2 + 216m Find the second derivative of -73821b2s*2 - 63b*2s + 10b2 + 217bs + 2b + 10s4 + 1 wrt s. -147642b*2 + 120s*2 What is the derivative of -121657496rz2 - 25143z*2 + 8z + 27 wrt r? -121657496z2 Find the third derivative of -44095995f*4 + 9f*3 - 1115668739f*2 wrt f. -1058303880f + 54 What is the first derivative of -4194263p - 29288433? -4194263 What is the second derivative of -978242h*3 + 33h*2 - 5163753h wrt h? -5869452h + 66 What is the second derivative of -312q*3 - 22233q*2 - 60747435q wrt q? -1872q - 44466 Find the third derivative of -404c*6 + 3c*4 + 1668c*3 + 1468611c*2 + 12 wrt c. -48480c*3 + 72c + 10008 What is the derivative of -i*4x + 1620i3x - 442i - 99x - 7212 wrt i? -4i3x + 4860i2x - 442 What is the third derivative of -74767y5 + 4y*4 - 14y*3 + 5y*2 + 26524y + 3? -4486020y2 + 96y - 84 What is the derivative of -360911t4 + 13t - 22234970? -1443644t3 + 13 Differentiate 200645680u*2z*3 + 97871z*3 - 313z*2 wrt u. 401291360uz3 Find the second derivative of -43n*2q*2 + 39903n*2q + 4nq*2 - 21nq - 82n + 10q2 wrt n. -86q*2 + 79806q Find the third derivative of -19266932t4 + 4734t*2 + 107t. -462406368t Find the second derivative of -763y*5 - 643y*3 - 32176y + 44. -15260y3 - 3858y Differentiate -188005558l4 - 19281238 wrt l. -752022232l*3 Find the second derivative of -61kmt*2 - 14kmt - 49km + 42kt*2 - 2kt + 2k + 9mt*2 - 12m - 8t2 wrt t. -122km + 84k + 18m - 16 What is the third derivative of 59451955v*6 - 17018886v*2 wrt v? 7134234600v*3 Find the first derivative of 97a*3 + 43250a*2 - 2a - 6131933 wrt a. 291a2 + 86500a - 2 Find the second derivative of 365602n3 - 37n*2 - 11n - 1085939 wrt n. 2193612n - 74 What is the second derivative of 1356065b*3 + 1647436b wrt b? 8136390b What is the third derivative of -788993453t*3 + 1133t*2 + 81818t? -4733960718 Find the first derivative of 5c2n + c*2 + 363cn + c - 92637476n wrt c. 10cn + 2c + 363n + 1 Differentiate 102138823c4z - 3c4 - 142438626z + 4 with respect to c. 408555292c3z - 12c3 Find the first derivative of 30l*4 + 2l*3 - 264978l*2 - 111285438 wrt l. 120l*3 + 6l*2 - 529956l Differentiate 8a4 - 468a*3 - 148a + 12807335 with respect to a. 32a3 - 1404a*2 - 148 What is the first derivative of 1577bw3 + 21bw2 + 4b + 11272092w3 - 2w*2 wrt b? 1577w*3 + 21w*2 + 4 Find the third derivative of 142280c*2o*3v*2 - 107c*2o*3v + c*2o*2v - 1839c2v - 13co*2v*2 - 40cov*2 - 2cv2 wrt o. 853680c*2v*2 - 642c*2v Differentiate -234379778x + 437353753 wrt x. -234379778 Find the first derivative of -239158508y - 200330106 wrt y. -239158508 Find the second derivative of 6541904r2w*2 - 4r*2w - 7rw + 25r - 359w wrt w. 13083808r2 Find the third derivative of -39l*5 - 4l*4 + 573l*3 + 2897l*2 - l - 74 wrt l. -2340l*2 - 96l + 3438 Differentiate -27g3 - 3g*2 + 124674g + 25754556. -81g2 - 6g + 124674 Find the third derivative of 1295g3n*2 - 910g*3nv - 6g*3n + 129g2n*2v - 10g2n*2 - 1172g*2v - 2gn - gv wrt g. 7770n*2 - 5460nv - 36n What is the derivative of -85288837r2 + 2r + 191682690? -170577674r + 2 Differentiate -9448c*2h - 125c2 - 2ch - 8668c + 1149h - 5 wrt h. -9448c*2 - 2c + 1149 What is the first derivative of 3z4 + 2z*3 - 6433121z + 75778399? 12z3 + 6z*2 - 6433121 What is the third derivative of 6362654p*3 - 2p*2 + 2p - 696407? 38175924 What is the second derivative of -8l4 + 20008l*3 + 58l*2 - 71174610l + 4 wrt l? -96l2 + 120048l + 116 What is the third derivative of 746570010n3p*2 - 721n*2p + 77391n2 - p2 wrt n? 4479420060p*2 Find the second derivative of 172866fj3 + 19fj2 - 7fj - 247f + 13j3 + 2j*2 + 37j - 82 wrt j. 1037196fj + 38f + 78j + 4 What is the second derivative of -64665037c4 + 18826825c + 3 wrt c? -775980444c2 Find the second derivative of 22942518n*2 + 11129875n wrt n. 45885036 What is the second derivative of 136938i4x + 6i4 - 2i*2x - 5i + 4777862x wrt i? 1643256i2x + 72i2 - 4x What is the second derivative of 17838585i2 - 15754i - 342 wrt i? 35677170 Differentiate -57twy + 24tw - 1511wy - 6803w - 11y + 7 wrt y. -57tw - 1511w - 11 Differentiate -6976493u + 9041622 wrt u. -6976493 What is the second derivative of -16f*3hr2 - 87508f*2h*3r - 2fh*3r*2 + 84fh - 13hr - 34r wrt f? -96fhr2 - 175016h*3r Find the third derivative of -21234k5 + 1944k*4 + 9077k*2 - 11664k. -1274040k2 + 46656k What is the second derivative of 71979456w2 - 267856498w wrt w? 143958912 What is the first derivative of 473671432m - 420092706 wrt m? 473671432 What is the derivative of -34182628u - 60915564 wrt u? -34182628 What is the third derivative of -2l5 + 5l*4 + 4239453l*3 + 113124626l*2 wrt l? -120l*2 + 120l + 25436718 Find the third derivative of 9132438v4 - 58355052v*2. 219178512v Differentiate -178as*2 + 582as + 9a + 14776178s2 wrt a. -178s*2 + 582s + 9 What is the first derivative of 159969277b + 32951614? 159969277 What is the second derivative of 2i*2y*3 - 9952633i*2 + 8007870iy3 + 3iy wrt y? 12i*2y + 48047220iy What is the first derivative of -69587m3 - 9m*2 - 16m - 11785754 wrt m? -208761m2 - 18m - 16 What is the derivative of 52399l3 - 2579l*2 + 110661846 wrt l? 157197l*2 - 5158l Find the first derivative of p*3 - 293p*2 - 1050p + 10607444 wrt p. 3p2 - 586p - 1050 What is the derivative of 245123co*2 - 17co + 12030394c + 6o2 - o wrt o? 490246co - 17c + 12o - 1 Find the second derivative of -47593219n*3 - 37141893n wrt n. -285559314n Find the third derivative of -659025bc3 - 2bc2 - b - 48c*3 + 1939c*2 - 236c - 20 wrt c. -3954150b - 288 What is the second derivative of 2m*4 + 2125074m*2 - 6m - 411805 wrt m? 24m2 + 4250148 What is the second derivative of x5 + 8x*4 - 1079720x*2 - 184304950x wrt x? 20x3 + 96x*2 - 2159440 Find the third derivative of 10fh3 - 7fh2l + 8fh*2 + 106fh - 17fl - 317h*3l + 4983h3 + 25l wrt h. 60f - 1902l + 29898 Find the third derivative of -2y4 - 136103359y*3 + 3781y*2 + 2907y wrt y. -48y - 816620154 Differentiate -5036373b*3 - 7826035 wrt b. -15109119b*2 Differentiate -93419a*4 - 113a*3 + 15535573. -373676a*3 - 339a*2 What is the third derivative of -114038450n	{ "pile_set_name": "DM Mathematics" }
.4 (c) -1105 (d) 4 (e) -2 (f) 0 (g) -0.07 a Which is the third biggest value? (a) 0 (b) 18 (c) -16 (d) 21 (e) -14 a Which is the fifth smallest value? (a) -295 (b) 111/4 (c) 5 (d) 1 (e) -0.2 (f) -0.05 (g) -0.1 d Which is the third biggest value? (a) -0.0917 (b) -98/27 (c) -0.1 (d) -5 (e) 3/7 (f) 0.4 a What is the second smallest value in -0.5, -17/6, 0.4, -1, -784/17, -5/3? -17/6 Which is the third smallest value? (a) 0.5 (b) -2/3 (c) -4/19 (d) -8 (e) -2 (f) 0.114 b What is the second biggest value in -1/132, -1, 2, -248? -1/132 What is the fourth biggest value in -0.4, -20, -122/5, 4585? -122/5 What is the fourth biggest value in -5, 157, 1/7, -116523? -116523 What is the third smallest value in 3/62, -5, -164.9, 2? 3/62 Which is the sixth biggest value? (a) 4/3 (b) 3/7 (c) 11/8460 (d) -5 (e) -0.03 (f) 13 d Which is the second smallest value? (a) -7 (b) -0.018 (c) -21 (d) 43 (e) 0.9 (f) 3/2 (g) -3 a What is the second smallest value in 0.14, 1/4, -2, 0.021, 16, 1/13? 0.021 What is the second smallest value in 56707, 0.09, 524? 524 What is the smallest value in 80, 3, 3/8, 1/2, 168, -1? -1 What is the smallest value in 9/20389, 7/4, 5? 9/20389 What is the smallest value in -0.2, 3/4, -0.085, 3/7, -46, -0.4, -98? -98 Which is the second biggest value? (a) 0.6 (b) -0.1 (c) 4 (d) -0.4 (e) -460 (f) -4/7 a Which is the fourth smallest value? (a) 0.5 (b) 14/33 (c) 1/7 (d) -0.0348 a Which is the third biggest value? (a) 3/7 (b) -2 (c) -2/147 (d) -3/22826 c Which is the fourth smallest value? (a) -0.51 (b) 9.9 (c) -18/7 (d) 3 b Which is the second biggest value? (a) -11 (b) 2/14009 (c) -1 c Which is the third biggest value? (a) 5 (b) -5/7307253 (c) -0.3 c What is the second smallest value in -0.2, -0.19, 3.362, 213? -0.19 Which is the fifth biggest value? (a) -1/10 (b) -525 (c) 4 (d) -0.1005 (e) 1/4 b What is the second biggest value in -9.55, 5, -1199, 0.1, 1.6? 1.6 What is the second biggest value in -0.4, -3/7, -19.49, 0.3, -5, 0.04, -0.49? 0.04 What is the fifth smallest value in -3/2, -1, -342, -4, 26? 26 What is the seventh biggest value in -3, -9, -2, 5, -4, 18.7, 0.04? -9 Which is the fourth smallest value? (a) 305 (b) 2/3 (c) -39.44 (d) 2 a What is the third smallest value in 3/6454, 5, 2/7, -5, -0.3, -4/9? -0.3 Which is the second smallest value? (a) -11390.6 (b) -3/2 (c) 0.55 b Which is the biggest value? (a) -3 (b) 158 (c) 1/2 (d) 410 (e) 2/3 d Which is the second smallest value? (a) 2/5 (b) -0.5 (c) -189/2 (d) -0.6 (e) 1/2 (f) 83.5 d What is the second biggest value in 1286, 0.441, -0.5, -1/4? 0.441 Which is the fourth biggest value? (a) -10.2 (b) -69.1 (c) 3 (d) -3 b What is the third biggest value in 2/17, 911519, -0.4, 2, -5? 2/17 What is the second biggest value in -1/14, -4/7, -0.2, 3/11, 5, -6? 3/11 What is the fourth smallest value in -0.1, 0, 56, -1/3920? 56 What is the fourth biggest value in 1/2, -12, -4.232, -2/7? -12 What is the third biggest value in 3, -1/240, -120, -0.4, -0.1? -0.1 What is the biggest value in -3, 0, -405, -4.6, -7/4? 0 What is the third biggest value in 0.5, -1.1, -3, 0.02, 14568? 0.02 Which is the fourth smallest value? (a) 3 (b) -0.3 (c) 79/20 (d) -0.1 (e) 0.01 (f) 3/7 f Which is the biggest value? (a) -672/25 (b) 196 (c) 0.6 b What is the second biggest value in 5, -5/23, -0.223, -2/19? -2/19 What is the second smallest value in 8, 402, -253, -0.3? -0.3 What is the smallest value in -0.04, 112/39, 5, 38, -4? -4 Which is the biggest value? (a) 0.07 (b) -0.4 (c) -28454/17 (d) -3 (e) -0.2 a Which is the fourth biggest value? (a) 0.2 (b) -2/15 (c) -1 (d) -3/4 (e) 591 d Which is the fifth biggest value? (a) 0.061 (b) -19 (c) -22 (d) 3 (e) 1/5 c What is the third biggest value in 0.4, -162, -183, 0.1, 1/5, 2/13, 2/11? 2/11 Which is the second smallest value? (a) 0.082 (b) 5 (c) 25 (d) 2 (e) 2.6264 d Which is the second smallest value? (a) 573 (b) 7/20 (c) -74 b Which is the biggest value? (a) -145 (b) 4 (c) -0.4 (d) 5 (e) -3.23 d What is the second smallest value in -5715192, -0.1, 5/2? -0.1 What is the fourth smallest value in -1318.5, 2, -1/3, 3? 3 Which is the third biggest value? (a) 1.037 (b) 15 (c) 0.3 (d) 39 a Which is the second biggest value? (a) -0.014 (b) 4 (c) 1728654 b Which is the fourth biggest value? (a) 0.24 (b) -0.5 (c) 0.12 (d) 1/8 (e) 12 (f) 1/4 (g) 2.98 a What is the biggest value in -0.1, -1151, 1133, 0? 1133 What is the fourth smallest value in 2/27, 5, -28, 11303? 11303 Which is the fourth biggest value? (a) -5 (b) -49/5 (c) -5/4 (d) -22 (e) 14 b What is the second biggest value in -0.3, -1/2, -4, -3/2, 0, -30070? -0.3 What is the fourth smallest value in 3/2, 0.4, -0.1, 8.1, 3, 16/13, -0.3? 16/13 Which is the second biggest value? (a) 0.2 (b) -2/9 (c) 0.3 (d) -18 (e) 0.62 (f) 3 e What is the fifth smallest value in -2/381, 2/3, 0, -0.1, -103, -1? 0 What is the seventh smallest value in 110, 0.8, -0.1, 1, 13/2, 2/57, -0.03? 110 What is the fourth smallest value in -2/7, 1/3, -325232, -0.3? 1/3 Which is the fourth biggest value? (a) -210 (b) -4/5 (c) -4438 (d) -1/18 c What is the second biggest value in -2/9, 1, -881, 54, 4? 4 What is the fifth biggest value in -1, -4/7, -12/5, 12/11, -3, 1? -12/5 Which is the smallest value? (a) -8 (b) 58 (c) 2/7 (d) 9 (e) 38 a What is the third biggest value in -30, 1/4, -26467, -1? -30 Which is the smallest value? (a) 2283 (b) 0.637 (c) 44 b What is the third biggest value in 20, 3999, -1.7, -0.09? -0.09 What is the third smallest value in -2, 2.1, 1, -184, -11? -2 What is the fifth smallest value in -343211, -3/2, -1, 2/3, -4, -1/5? -1/5 Which is the smallest value? (a) 26 (b) 31/4 (c) 566 b Which is the fifth smallest value? (a) -15/2 (b) -23/9 (c) 1 (d) 3 (e) 4 (f) -16 d What is the smallest value in 0.4, 1, -4, 5, -8, -1.7, -1434? -1434 Which is the third smallest value? (a) 23 (b) 4 (c) -6/11 (d) -3 (e) -5 (f) 0.09 (g) -18 d Which is the smallest value? (a) -3167289 (b) -5 (c) -20 a Which is the smallest value? (a) 17/8 (b) -1/4 (c) -9/5 (d) 379 (e) -4 (f) -0.3 e What is the biggest value in 52.1, 2, 0.1, 15, 3, 0.09? 52.1 Which is the second smallest value? (a) 0.4 (b) -3 (c) 2 (d) 1/6 (e) 1/2 (f) -1090.82 b What is the smallest value in -2, 0, 0.0048, 5, -0.3, 34? -2 Which is the seventh smallest value? (a) -247 (b) 1 (c) -0.1 (d) -0.2 (e) -1/4 (f) -0.5 (g) 11 g What is the second biggest value in -0.4, 1/5, -27.86, 2012, -4? 1/5 Which is the fourth smallest value? (a) -450/37 (b) -145/6 (c) -4 (d) -7 (e) -5 e Which is the fifth biggest value? (a) -17/13 (b) -0.01 (c) 3 (d) 0.5 (e) -0.5 (f) 6 (g) -4 e Which is the fourth biggest value? (a) 2/13 (b) -1 (c) -2/17 (d) -472 (e) 1.7 (f) -7.64 b What is the sixth biggest value in 0.402, -5, 2/17, -4, 3, 38, 0.2? -4 What is the third biggest value in -3, 9, -2, 0.3299, -2/7, -0.1? -0.1 What is the smallest value in 0.2, 0.063153, -36? -36 Which is the seventh biggest value? (a) 7/8 (b) 12 (c) 0.16 (d) -5 (e) 0.2 (f) -2/5 (g) 2/3 d What is the seventh biggest value in 3/2, -0.3, -5/2, 4, -2, 0.1, -4/109? -5/2 Which is the second smallest value? (a) 45.6 (b) -0.26 (c) 124 (d) 0.1 d Which is the fourth biggest value? (a) -10 (b) 0 (c) -2 (d) 8224 (e) -0.1 c What is the smallest value in -67410, 2/9, -0.4, -5, 83? -67410 Which is the biggest value? (a) -29 (b) 1 (c) 1.937468 (d) -4 (e) 2/13 c Which is the second smallest value? (a) -13/5 (b) -2/11 (c) -6/7 (d) -136.7 (e) 2.9 a What is the third biggest value in -2, -3, 0.02, -5, 2.51, 2/11? 0.02 What is the third smallest value in -2, -108, 3.89, 0.034, -7, 1? -2 Which is the fifth biggest value? (a) 482 (b) -1/4 (c) -194383 (d) -0.2 (e) 1 c Which is the smallest value? (a) -8 (b) -0.5 (c) 926705 (d) -4 a Which is the third biggest value? (a) 6 (b) 1035 (c) 4 (d) -61 c Which is the second biggest value? (a) 5.5 (b) 2 (c) -6/7 (d) -264 (e) -5 (f) 0.5 (g) 5/4 b What is the smallest value in -1/8, 1/3, 4, 99, 13246? -1/8 Which is the second biggest value? (a) 36357 (b) -10 (c) 4 (d) -	{ "pile_set_name": "DM Mathematics" }
-8. Suppose -218 = -4t + jr, 4t - 87 = -r + 140. Is 21 a factor of t? False Let c = -601 + 2857. Is 2 a factor of c? True Let r be (-2)/9 + (-152)/(-36). Suppose -rx = -4h + 2188, 2x - 4x + 2756 = 5h. Suppose 7o - h = 2o. Is o a multiple of 5? True Let r(a) = -a*2 + 13a - 19. Let v = -103 - -115. Let p be r(v). Let o = 88 - p. Is 7 a factor of o? False Let v = 219 + -19. Suppose i + 2i + 4h - 611 = 0, -i - 5h = -v. Let o = i + -112. Does 31 divide o? True Suppose 6m - 42 = -36. Does 44 divide m189 - (-52 - -58)? False Let g(l) = -932l + 3253. Is g(0) a multiple of 5? False Let o(d) = d - 26. Let i be o(28). Suppose 3y = 2z + 115, 76 = 2y - iz - 0z. Is y a multiple of 2? False Let f(s) = 2s*3 + 118s*2 + 200s + 14. Does 5 divide f(-16)? True Let b be (-6)/(-4) - (-15)/10. Suppose -4k + bk = -1. Is 19 a factor of -76(-1 + k/2)? True Let o(v) = 455v*3 + 3v*2 - 4v + 1. Let u(y) = y - 15. Let s be u(16). Is 57 a factor of o(s)? False Does 43 divide (36/(-10))/((-204)/(-510)) + 2403? False Suppose 2t + 35294 = 4o - 35714, 3o - 2t - 53258 = 0. Is o a multiple of 71? True Let i(b) = 286b2 + 30b + 21. Let u be i(9). Is u/147 - 6/(-14) a multiple of 15? False Let u be 0/((0 - -1)-1). Suppose 5r + 20 - 130 = u. Is ((0 - -21) + -1)99/r a multiple of 18? True Let a be ((-2)/(-10))/(2/(-585))2. Let k = 125 + a. Is k a multiple of 7? False Let l = -9947 + 19019. Is l a multiple of 74? False Let a(x) = -102x3 + x2 - 1. Let p be a(-1). Suppose -79t + 76t + p = 0. Suppose 2k - t = -14. Does 10 divide k? True Suppose -2v + 340 = 5r, -4v + 3502 = -5r + 2702. Is v a multiple of 5? True Suppose 463 = 2t + 5k, 0k - 2k + 700 = 3t. Is 6 a factor of t? True Suppose 2f = 14 - 10. Let y be f/3(-45)/(-6). Suppose -q + 114 - 39 = 4c, -87 = -yc + q. Is c a multiple of 9? True Suppose -4932 = -4c - 3y, 137 - 1433 = -c + 15y. Does 4 divide c? True Suppose 0 = -b + 4w + 16 + 2, -2b - 3w - 8 = 0. Suppose 0y + 2l - 56 = 3y, -2l - 34 = by. Does 17 divide (-4)/y + 13216/144? False Suppose -2o = 4h - 0h + 20, 0 = 3h - 3o + 6. Let f = -18 + 21. Is (-7)/((-84)/272) - h/f a multiple of 4? True Suppose 0 = -3s + 29 - 11. Let u be 10/20s1. Suppose -m = 5y - 543, -4y + 99 = -3y - um. Does 24 divide y? False Does 17 divide 179((-918)/3)/(-18)? True Let g = -458 - -1098. Let s = g - 415. Is s a multiple of 45? True Let f be (-26)/(-10) - 6/(-15). Suppose -l + 0d = -5d - 343, -fl + 5d + 989 = 0. Suppose -108 + l = 5n. Is n a multiple of 4? False Let f = -3329 + 3435. Let r = 95 - 21. Let w = r + f. Is w a multiple of 15? True Suppose 5986k + 225 = 6001k. Let i(r) be the third derivative of 7r4/24 - r2. Does 15 divide i(k)? True Let k(w) = w3 - 2w*2 - 4w - 4. Let v be k(4). Suppose 667 + 353 = vi. Suppose 5m = -d + 187, -2m + 10d - 7d = -i. Is 5 a factor of m? False Let c be 2/(4 + (-610)/155). Suppose -h - 5 - c = -5d, 0 = -4d + 3h + 20. Suppose 0 = -dj + 4j + 204. Is 4 a factor of j? False Suppose -5k = -5d + 6d - 497, 3k - 312 = 4d. Suppose 0c + k = -5c. Is 35 a factor of (21/(-2))/(((-14)/c)/(-7))? True Let z(j) = 2j + 12. Let f be z(0). Suppose 14u = fu + 110. Suppose 60a - ua = 140. Is 14 a factor of a? True Let i be (2/6)/(25/28725). Suppose k = i - 93. Is k a multiple of 10? True Let m(s) = -115s3 - 4s*2 - 6s - 2. Let r be m(-1). Suppose -k + 7 + 0 = 0. Suppose -ki - r = -12i. Does 6 divide i? False Let a(n) = -48n - 158. Let t(b) = 50b + 154. Let w(j) = 5a(j) + 6t(j). Is 8 a factor of w(6)? False Suppose 0 = 2a + 2a + 5s - 128, 3s - 160 = -5a. Suppose -28q + 536 = -aq. Let f = 193 + q. Does 12 divide f? False Suppose 0 = -22p + 29p - 3528. Suppose -14o + 17o = p. Is o a multiple of 14? True Suppose 0 = 5d + 3y - 2211, 2y - 2214 = -5d - 0y. Is 8 a factor of d? False Let q = 115 + -102. Suppose -2x + q = 4r - 141, r = -5x + 61. Is (-4)/r3 + 3964/12 a multiple of 15? True Suppose -5p + 398475 = 30p - 0p. Is p a multiple of 207? True Let c be (-1)/(-5) - 2366/(-70). Let h = c + -24. Is (-304)/(-10) - 4/h a multiple of 4? False Let m(l) = 4l - 30. Let u(i) = 5i - 31. Let v(g) = 2m(g) - 3u(g). Let z be (-9)/(-6)48/18. Does 2 divide v(z)? False Let v = 9 - 9. Suppose -32 = -vb - b. Is 2 a factor of (2/(-4))/((-4)/b)? True Let x = -79 - -366. Suppose 6h + x = 1121. Suppose p - 2p + h = l, -4p + 541 = l. Is 16 a factor of p? False Let r(q) = -q*2 - 58q - 181. Let l be r(-54). Let y(i) = 10i3 + 2i*2 - 2i + 1. Let t be y(1). Let x = l - t. Does 4 divide x? True Let y be ((-17)/2)/((-7)/56). Let t = 143 - 142. Let q = y - t. Is 9 a factor of q? False Suppose -3h = -217k + 220k - 12693, -4k + 3h + 16889 = 0. Does 16 divide k? False Let k(y) = y3 - 3y*2 - 6y + 386. Is 2 a factor of k(0)? True Let t(s) = -2s + 20. Let x be t(8). Suppose 527 = -xi - 145. Let z = -90 - i. Is z a multiple of 6? True Let w be (044/48)/1. Suppose -r = 0, 5u - 9u - 2r + 480 = w. Suppose -20z = -22z + u. Does 8 divide z? False Let x(k) = -k3 - 19k*2 + 5k + 7. Let l be x(-19). Is 3 a factor of -21/2 - l? True Suppose -17i + 261 + 2208 + 880 = 0. Is i a multiple of 9? False Let t(n) = -73n2 + 35n*2 - 53 - 53n + 36n2. Does 15 divide t(-22)? False Let z = 23 + -25. Let b be (-1)/((1/z)/((-106)/4)). Let j = -30 - b. Is j a multiple of 8? False Let y(o) = 127o*3 - 7o + 21o2 - 65o*3 + 1 - 61o*3. Is 37 a factor of y(-21)? True Let d(j) = 11j*2 - 106j - 4. Does 8 divide d(11)? False Let r(o) = -1. Let y(u) = u*3 + 13u*2 + u + 15. Let s(b) = 5r(b) + y(b). Let q be s(-13). Does 6 divide 1 + q + -1 + 18? False Suppose 0 = 13u + 1307 - 4323. Is 2 a factor of u? True Is 7204 + (-7 - (-13 - 0)) a multiple of 39? False Let y(p) = -73p - 59. Let t be y(-9). Is 13 a factor of ((-16)/(-18) + (-1)/(-9))t? True Let x(v) = v3 - 7v*2 - 4. Let a be x(8). Suppose -5z + a = 140. Does 12 divide (z/6)/(2/(1 + -55))? True Let j(u) = 10u3 + u2 - 1. Let w be j(-1). Let d(p) = -36p - 13. Let m be d(w). Let v = -199 + m. Is 37 a factor of v? True Let l = 2657 - 1667. Is 66 a factor of l? True Let k(a) = 2228a - 11671. Does 12 divide k(22)? False Let k(j) = -22j - 161. Let p be k(-7). Let g = 156 - -94. Let s = g + p. Does 27 divide s? True Suppose -5j + 14 = -11. Let o be (2/j)/(-1) + (-19966)/335. Is 12 a factor of ((-4)/(-10))/((-1)/o)? True Let w = -46 - -39. Let r be -2 - 15/(4 + w). Suppose -2z - 4x = -92, -5z + 3z + 127 = -rx. Is z a multiple of 4? True Let b(w) = 3w2 + 6w + 49. Let g be b(-13). Let z = 608 - g. Is z a multiple of 13? True Suppose 0 = -3d - 5i + 12278, 8i - 16419 = -4d + 11i. Does 56 divide d? False Suppose 5o - 5x - 22 = -9x, 5x - 13 = o. Suppose 1260 = -oi + 4i. Is i a multiple of 18? True Let c(g) = 65g3 - g2 - 3g + 3. Let k = -56 + 58. Let t be c(k). Suppose -4w - 3a = -2a - 531, t = 4w - 5a. Is w a multiple of 22? True Suppose 0 = -2j + 4j - 34. Suppose 11x + 255 = 167. Let f = j - x. Is f a multiple of 5? True Suppose 5w = -5y - 20, 7y + 5w + 20 = 3y. Suppose 21a + 552 - 4857 = y. Does 14 divide a? False Let v = 30 + -28. Suppose -3l - 24 = -p - 6l, 29 = p - vl. Suppose pz + 396 = 31z. Is 21 a factor of z? False Let g be 102/24 + (-1)/4. Suppose -g - 81 = 5f. Let a = f - -41. Does 19 divide a? False Let p(v) = -v3 - 32v*2 + 43v - 10. Let s be p(-35). Suppose s = 19u - 13u. Is 40 a factor of u? True Let g be -8 - (-2 + -2831). Suppose -1042 = -8h + g. Is h a multiple of 14? True Let a = -3 + 3. Suppose -5m + 361 - 101 = a. Let i = m + 57. Is 14 a factor of i? False Let l(d) = 9d - 1. Let j be (-1 - -1)(-2)/(-6) - -6. Suppose -jr = -8r + 26. Is 29 a factor of l(r)? True Suppose 0 = -2z + a - 394, -2z + 2a - 386 = -a. Is ((0 - z) + 1)54/45 a multiple of 15? True Suppose 3x = -4b - 15, -2b - 2x - 5 = -x. Suppose -59p + 69p - 1450 = b. Is p a multiple of 35? False Suppose 7j = 790 + 526. Suppose 2a + j = 4a. Suppose -5d + 433 = h, -2h + a = 3d - 170. Is 12 a factor of d? False Let n = -7800 - -11928. Does 258 divide n? True Let k be (5/(-5) - -1)/(2/2). Suppose 5n = -kn, -4i + 408 = n. Is i a multip	{ "pile_set_name": "DM Mathematics" }
+ -3.92. Is c greater than or equal to j? False Let d = 74/11 - 149/22. Let h(f) = -f*3 + 3f*2 + 4f. Let w be h(3). Let y be w/912/16. Is y greater than or equal to d? True Let f = -1644.1 + 1644. Let w = 33 + -52. Which is greater: f or w? f Suppose 7h + 80 = -3h. Is -66/7 at least h? False Let a = 0.0857 - 0.2657. Suppose 0 = -3i - 4 - 26. Let q(y) = y*2 + 11y + 11. Let u be q(i). Are u and a nonequal? True Let n be -1(3 - 9)/24. Is 25 smaller than n? False Let u(c) = -13c*3 - 2c*2 + 5c - 4. Let r be u(1). Which is bigger: -94/7 or r? -94/7 Let y = -32 - -20. Let i be 3(112/y - 0). Let t be 76/224 - 8/i. Is 2 at most as big as t? False Let w = 6 + -3. Suppose 0 = f - wf - f. Is 2 at most as big as f? False Suppose -2s - 5y = -75, -5s = y - 0y - 176. Let b = -37 + s. Which is bigger: -8/5 or b? -8/5 Let b be 1624/(-20) - 5/(-25). Let a be 0 + (-28)/b + 13/(-39). Is a less than or equal to -1? False Let n = 25/161 - 5/138. Let r = n + -23/546. Is r < 0? False Let n = -26/45 - -4/5. Let v be 1(2 - 0) - 1. Is v at most as big as n? False Let n(q) = -q2 - 7q + 3. Suppose -2h = 4x - 756, -h + 4 = 2. Let m be x/(-28) - 2/7. Let k be n(m). Is k bigger than 3? False Suppose 12w - 16w + 24 = 0. Let c = 10 + -9.8. Which is smaller: w or c? c Suppose 7m + 393 + 13 = 0. Let l = 57 + m. Which is smaller: l or 5? l Suppose 7t + 620 = 39. Which is bigger: t or -82? -82 Suppose 0 = 2c + r - 79, 48c + r = 45c + 117. Is 14 greater than c? False Let m(q) = q3 + 6q*2 - q + 9. Let s be m(-6). Let c = -10 + s. Suppose cb = 4t + 10, 0 = b + t - 1 - 1. Which is bigger: -1 or b? b Let k be (2/(-6) - 0)(-18 + 30). Which is smaller: 7 or k? k Let c be ((-16)/(-24))/(2/(-789)). Do -263 and c have different values? False Suppose l + 13 = 11. Let x be (l/(-7))/(2/14). Is -25 smaller than x? True Let b = 29 - 16. Let j = b + -40. Let h = -27.1 - j. Which is smaller: 5/2 or h? h Let l = -16.1 + 38. Let c = -0.035 + 22.035. Let p = c - l. Is -10 < p? True Let x(w) = 16w + 21. Let h(r) = r + 1. Let q(m) = -6h(m) + x(m). Let c be q(-5). Is -34 <= c? False Let n = -0.083 + 1.083. Is n equal to -330/13? False Let q = -1 + 4.8. Let a = 15.2 + q. Let b = -19 + a. Which is smaller: b or -2? -2 Let q(d) = d*3 + 9d*2 - 8d - 25. Let v be q(-11). Which is smaller: -355/2 or v? v Let u be (3-3)/(4 + -3). Let h = u - -12. Suppose -3i = 4w + 13, -hi - 10 = -5w + 2i. Is w greater than or equal to 0? False Let y(w) = 2w + 8. Let p be y(3). Let n be (p/(-6) - -2)(-6)/4. Let f = -0.04 - 0.26. Are f and n non-equal? True Suppose -9b = 39 - 354. Let s = 981/28 - b. Do s and -1 have different values? True Let p = 2480563/404 + -6140. Which is bigger: p or 0? p Let k = 14 + -12. Suppose -6q = -3q - kr - 21, 5q = 2r + 31. Suppose -qa + 0 = 10. Which is smaller: 0.3 or a? a Let x(v) = v3 - 15v*2 - 2. Let l be x(15). Let u be 2/(-11) + (-216)/(-99). Which is smaller: u or l? l Let v be (-6)/(-1412)84/(-63). Which is greater: v or -1? v Let o = -255 + 12241/48. Which is bigger: -0.8 or o? o Let i be 9/(27/12) - 54. Let y = 30 + i. Let z be (-16)/y25/(-2). Which is smaller: z or -7? z Let c = 25.7 - 34.7. Are c and -11 equal? False Let q = -22 + 108. Is q greater than 87? False Suppose -q = -2k + 562, -11 = -2q + k - 1147. Let i be q/(-135) + 2/(-9). Which is greater: 9 or i? 9 Let o be -2 - ((-29)/3 + 1). Let c(m) = -m + 1. Let h be c(-4). Suppose 0 = -g - j + 4, 0 = -hg + 2j + 48. Is o bigger than g? False Let b(k) = k2 - 13k + 5. Let r be b(13). Let p(n) = 2n - 4. Let d be p(2). Suppose -8g + rg = d. Which is smaller: -8 or g? -8 Let s be -2 - (-23)/(-6) - -2. Let i be ((-6)/4)/(1/2). Which is greater: s or i? i Let f = -295 - -508. Which is greater: 212 or f? f Suppose 5c + 5 = -5w, 0 = 10c - 5c. Is 4/21 at most as big as w? False Suppose 17y = -0y - 0y. Do 2/713 and y have the same value? False Suppose x + 5w - 27 = -10, 3w = -3x + 63. Let o = x - 22. Is o >= -11? True Let f be (-47 - 1)36/(-24). Let r = f - 48. Let n = 5 - r. Is n greater than -19? False Let g(k) = -43 - 4k + k2 + 3k + 49. Let z be g(-8). Let x = 232/3 - z. Which is greater: -1 or x? x Let c = -20 + 20.2. Let f = 21 - 8. Is f at most c? False Let v = -69 - -47. Let n = v + 24.2. Let p = -1.2 + n. Is -0.01 <= p? True Let s be -387(1 + -2). Let q be s/116(-16)/42. Which is bigger: q or 0? 0 Let m(r) = -2r - 2. Let q be m(-2). Let y be (2/(-32))/(q/12). Is -1 >= y? False Let g = -25/7891 + -1852060/733863. Let j = 6/31 + g. Is -1 less than or equal to j? False Suppose -2y + 1 = -7, n + y - 424 = 0. Let r be 10/25 + (-173)/n. Let x = -11/42 - r. Is x >= 4/7? False Let a(t) = -132t*3 - 1. Let u be a(-1). Let n be (3(-3)/27-3)/u. Is n less than or equal to 0? False Suppose -3 = 3n + 15. Let q be (4/n)/((-4)/(-6)). Let b = 3 - 7/2. Which is greater: b or q? b Let d = -659/6 + 1945/18. Is -3 not equal to d? True Suppose -x = 4p + 11, 4p + 32 = -5x - 23. Let v = 3 - 5. Let g = v - -2. Which is smaller: x or g? x Let w = 0.8871 + 0.1129. Suppose 3t - p = 16, -2t - 3t - 5p = 0. Suppose -4x + 2s = 8, 0 = -x + 6x + s - t. Do w and x have different values? True Let c = -24 - -24. Suppose 2o - 7o - 5 = c. Which is bigger: -5/3 or o? o Let h be (-3)/84 + (-2)/8. Let w(v) = 124v - 2. Let b be w(-1). Let n be (-2)/(-10) - b/(-330). Which is smaller: n or h? h Let s = 129 - 74. Let w = 54.2 - s. Which is greater: w or 2/9? 2/9 Let j = 3/352 - -29/1760. Are 1/2 and j unequal? True Let x = 53579543/1911990 + -44636/1955. Let h = 4/163 - x. Is h smaller than -1? True Let c be 192940/(-104650) + 2 - 6/39. Which is smaller: -3 or c? -3 Let t(d) be the first derivative of -2d*2 - 26d + 5. Let o be t(-8). Is o > 4? True Suppose s - 5x - 20 = 0, -3s - x + 22 = 2s. Let k(w) = w3 - 3w*2 + 9w + 3. Let o be k(3). Suppose 4n + n = o. Is n <= s? False Let p = 0 - 2. Let u = 3811 + -3815. Is u equal to p? False Let l be (-3)/(12/368)31/62. Is l equal to -34? False Let d be (-13020)/(-30) - (-6)/(-2). Let c = -4737/11 + d. Which is smaller: c or 0? 0 Let l = 0.0218 - 0.1218. Is l > -859? True Let j(p) = -2p - 1. Let o be j(-4). Let a = 7 - o. Let d be a + (-1 - -2) - 2. Which is greater: -2/7 or d? -2/7 Let b be (-16)/(96/63)4/(-2). Is 21 equal to b? True Let v = 131.2 + -135. Let q = v - -10.8. Let o = 2.3 + -2. Is o not equal to q? True Let u = -0.72 - -0.51. Let d = u - 18.79. Which is smaller: d or -2? d Suppose 2560 = -5m + 3m - 4z, -m - 1283 = 5z. Which is smaller: m or -1279? -1279 Let s = -0.2 + 0.08. Let c = -0.1768 - -1.1768. Which is bigger: c or s? c Let v = 6 + -4. Suppose 35 = -7y + 35. Is v < y? False Let f = -0.42 - -0.02. Let m = 1.2 + -1. Do m and f have the same value? False Let d(l) = -12l + 42. Let z be d(4). Suppose -3u = 18 - 0. Does z = u? True Suppose -3r - 80 + 76 = 4i, -4r + 4i + 4 = 0. Is r at least -1/2139? True Suppose -3u + 1 - 4 = 3t, -3t = -3u + 9. Which is smaller: t or -11? -11 Let w(p) be the second derivative of p5/20 + p4/4 - p3 - 3p*2 - 3p. Let q = 28 - 32. Let g be w(q). Which is greater: 5/6 or g? g Suppose -2j + 132 + 12 = y, -361 = -5j - 3y. Which is smaller: 2 or j? 2 Let g(j) = j3 + 7j*2 - 4j + 31. Let r be g(-8). Which is smaller: -2/41 or r? r Let t be (-10)/4(-5)/254. Suppose -z - 3x + 13 = 0, -5z - tx - x + 17 = 0. Is -3/29 at most z? True Let t = -250 - -210.9. Let y = t - -39. Let k = 1 - 1.01. Which is smaller: k or y? y Suppose 3a + 0h - h - 23 = 0, h = 4a - 30. Let k(g) = 2g - 17. Let f(o) = 3o - 33. Let q(u) = -3f(u) + 5k(u). Let v be q(-7). Are a and v unequal? False Suppose -30j + 25j = 0. Which is smaller: -4/93 or j? -4/93 Suppose 2j - 3 - 3 = 0. Let n(l) = l2 - 4l + 4. Let m be n(j). Let b = -517/7 - -74. Is m at most b? False Suppose -9v + 11v = -96. Let d = v - -60. Which is smaller: 13 or d? d Suppose 12z + 15 = 87. Suppose -9o = zo - 15. Which is smaller: -2 or o? -2 Let o(m) = 2m - 3. Let p be o(4). Suppose -pl + 3l = 0. Let i be (4/6)/((-4200)/(-945)). Are i and l equal? False Let b = 43 - 52. Let t = -0.45 + 0.25. Which is bigger: b or t? t Suppose 4j + 4 = -5y - 7, -j + 16 = -5*y. Let q = 0.001 + 46.999	{ "pile_set_name": "DM Mathematics" }
(-3). 36 Let d(u) = 2u2 + 236u + 3772. Determine d(-19). 10 Let p(m) = -2m3 + 68m*2 - 106. Calculate p(34). -106 Let a(s) = 102s - 8164. Calculate a(80). -4 Let i(n) = n*2 - 35n - 102. Give i(-3). 12 Let r(k) = -2k2 + 925k - 2765. Calculate r(3). -8 Let z(o) = -2o3 + 6o*2 + 39o - 310. Determine z(7). -429 Let r(x) = 623x + 627. Calculate r(-1). 4 Let j(g) = -12g*2 - 243g + 61. Calculate j(-20). 121 Let m(n) = 3691n - 6. Give m(0). -6 Let s(u) = u2 - 954u - 60840. What is s(-60)? 0 Let b(r) = -7r - 45. Calculate b(-2). -31 Let b(h) = 39h + 577. What is b(-18)? -125 Let a(j) = -2j3 - 32j*2 + 37j + 14. Determine a(-17). -37 Let f(u) = u*2 + 82u + 1463. Calculate f(-27). -22 Let m(f) = -343f + 16123. Calculate m(47). 2 Let f(h) = -73h*2 + 25h - 2. Give f(1). -50 Let r(b) = 667b + 2008. Calculate r(-3). 7 Let i(k) = 2k*2 + 92k + 666. Give i(-9). 0 Let a(v) = 20v - 21. Calculate a(-2). -61 Let b(u) = -20u*3 + 13u*2 - 20u + 9. Give b(1). -18 Let h(d) = -2d3 - 9d*2 + 31d + 219. Give h(-5). 89 Let z(p) = -p*2 + 38p - 224. Determine z(36). -152 Let f(q) = -3q - 109. Calculate f(7). -130 Let y(l) = 25l + 20. Give y(3). 95 Let z(q) = q*2 - 282q + 19865. Determine z(146). 9 Let k(c) = c*3 + 15c*2 + 19c - 212. What is k(-12)? -8 Let d(p) = p - 37. What is d(83)? 46 Let a(z) = z*3 + 11z*2 + 21z - 157. Determine a(-8). -133 Let h(m) = 189m - 10605. What is h(56)? -21 Let s(i) = 2i3 - i2 + 35i + 274. What is s(-4)? -10 Let s(w) = 68w*2 + 19w - 37. What is s(2)? 273 Let n(v) = -32v2 + 48v + 94. What is n(-2)? -130 Let c(w) = w*3 - 29w - 65. What is c(-3)? -5 Let w(a) = 67a - 1816. Give w(27). -7 Let b(g) = -8g*2 - 16g + 1. Calculate b(-2). 1 Let y(b) = 1638b - 121206. What is y(74)? 6 Let c(h) = h2 - 176h - 5043. Determine c(-25). -18 Let g(c) = -1203c + 14439. What is g(12)? 3 Let c(t) = 4t*2 + 59t - 50. Calculate c(-16). 30 Let v(y) = -10y2 + 162y - 50. Calculate v(16). -18 Let x(h) = 4h2 + 16h - 25. Determine x(4). 103 Let f(x) = -384x - 13044. Calculate f(-34). 12 Let f(d) = -d3 + 3. Calculate f(4). -61 Let t(z) = -19z*3 + 439z*2 - 46z - 22. Calculate t(23). -22 Let n(g) = -12g - 62. Calculate n(10). -182 Let h(d) = -d3 + 36d*2 - 52d - 541. What is h(34)? 3 Let g(j) = j*3 + 32j*2 - 34j + 45. Calculate g(-33). 78 Let d(k) = 33k - 1070. Calculate d(36). 118 Let k(h) = h3 + 131h*2 + 867h - 6. Calculate k(-7). 1 Let j(p) = 3p2 + 11p - 104. Give j(4). -12 Let p(t) = -2t2 + 40t - 62. Determine p(15). 88 Let i(s) = -13s - 867. What is i(-65)? -22 Let o(b) = -b2 - 2b + 41. Calculate o(8). -39 Let j(n) = -68n + 1748. Give j(15). 728 Let c(r) = -117r + 5376. What is c(46)? -6 Let j(h) = 19h - 327. Calculate j(18). 15 Let w(d) = -2d*3 - 127d*2 + 63d - 52. What is w(-64)? 12 Let c(i) = -i*2 + 26i + 78. Determine c(24). 126 Let q(m) = -m*3 + 55m + 217. What is q(-4)? 61 Let k(a) = -4a3 - 35a*2 - 7a + 56. Calculate k(-9). 200 Let d(n) = -548n - 24120. What is d(-44)? -8 Let d(c) = -4c*2 + 56c + 807. Give d(-10). -153 Let a(w) = -83w2 + 917w - 56. Give a(11). -12 Let n(y) = -4y3 + 772y*2 + 14y - 2709. What is n(193)? -7 Let w(g) = -5g - 735. Give w(-147). 0 Let x(r) = -r3 - 4r*2 + 39r + 25. Calculate x(-8). -31 Let n(i) = 2i2 - 44i - 173. Calculate n(26). 35 Let h(l) = 56l + 364. Give h(-3). 196 Let l(n) = 14n - 28. Determine l(9). 98 Let w(d) = d*3 - 126d*2 + 1049d + 16. Calculate w(9). -20 Let r(b) = -93b2 + 1767b + 18. Calculate r(19). 18 Let v(r) = r - 52. Give v(-13). -65 Let m(r) = -r - 17. Give m(32). -49 Let d(a) = -a*3 + 15a*2 - 118a + 687. Determine d(10). 7 Let c(l) = 60l - 1654. Calculate c(28). 26 Let r(f) = f3 - 2f*2 - 50f - 21. What is r(6)? -177 Let i(w) = -632w3 - 6w*2 - 2w + 6. Give i(1). -634 Let a(m) = 41m + 261. Determine a(-6). 15 Let r(m) = -6m*2 + 609m + 1547. Give r(104). -13 Let c(g) = -2g3 + 10g*2 + 2g + 13. Calculate c(5). 23 Let b(w) = 2w3 + 75w*2 + 84w - 748. What is b(-36)? 116 Let z(s) = 13s + 103. Determine z(5). 168 Let h(m) = 29m*2 + 1423m + 108. Give h(-49). 10 Let m(c) = -c*2 - 40c - 301. Calculate m(-9). -22 Let h(a) = -5a2 + 30a - 25. Determine h(1). 0 Let x(j) = -500j - 11509. Give x(-23). -9 Let a(x) = 52x - 345. Calculate a(6). -33 Let j(n) = 457n + 3777. Determine j(-9). -336 Let g(c) = c3 + 86c*2 + 246c - 223. Give g(-83). 26 Let r(w) = w*2 + 16w - 200. What is r(-26)? 60 Let l(i) = 3i - 726. What is l(22)? -660 Let n(b) = -2b*2 + 200b + 9792. Calculate n(136). 0 Let g(x) = -15x - 482. Determine g(-30). -32 Let s(r) = -351r + 75. Give s(2). -627 Let u(h) = -3h3 + h2 + 6h + 7. What is u(3)? -47 Let h(r) = -60r - 16382. Give h(-273). -2 Let p(r) = r3 + 24r*2 - 31r - 157. What is p(-25)? -7 Let a(n) = -34n - 37. What is a(6)? -241 Let n(a) = -a3 + 11a*2 + 329a - 2688. Determine n(8). 136 Let h(d) = d*2 - 81d - 498. Calculate h(-6). 24 Let b(k) = 120k3 - 10k*2 + 2k + 11. Determine b(-1). -121 Let j(d) = -38d + 268. Calculate j(7). 2 Let d(y) = y3 - 3y*2 - 143y + 121. Give d(-11). 0 Let v(j) = j*3 + 3j*2 + 2j + 18. Give v(-3). 12 Let v(g) = g*3 + 15g*2 - 24g - 98. Calculate v(-16). 30 Let p(q) = q*2 + 1808q + 39303. What is p(-22)? 11 Let x(g) = -2g3 - 29g*2 + 50g - 22. Calculate x(-16). -54 Let q(w) = 56w2 + 2w - 9. Calculate q(2). 219 Let t(n) = -2648n + 21179. Determine t(8). -5 Let w(g) = -324g + 1279. Calculate w(4). -17 Let g(c) = 6c + 88. Give g(-7). 46 Let o(g) = 2g*3 - 456g*2 - 456g - 471. What is o(229)? -13 Let h(j) = j*2 + 46j + 228. What is h(-6)? -12 Let o(n) = 15n3 - 40n*2 - 37n + 4. Calculate o(-1). -14 Let w(p) = 1006p - 2249. Calculate w(3). 769 Let a(z) = -11z + 86. Calculate a(-9). 185 Let p(s) = 942s + 16962. Give p(-18). 6 Let j(l) = -22l*2 + 118l + 7. Determine j(6). -77 Let j(c) = -6c - 58. Give j(-18). 50 Let v(t) = -5t + 106. Determine v(-5). 131 Let a(c) = -4c - 9. What is a(9)? -45 Let d(t) = 3t*2 + 4t - 3. Give d(-5). 52 Let o(f) = -f*2 - 12f + 42. Calculate o(12). -246 Let p(z) = 466z - 4198. Give p(9). -4 Let d(b) = 93b - 227. Calculate d(3). 52 Let k(t) = -3t3 - 106t*2 + 74t + 63. Calculate k(-36). -9 Let y(q) = -4q2 + 929q - 1857. What is y(2)? -15 Let b(o) = -3o3 + 24o*2 + 21o + 6. What is b(9)? -48 Let q(l) = 3356l - 33555. Give q(10). 5 Let t(c) = -c2 + 28c - 84. Give t(5). 31 Let f(x) = 2x2 - 53x + 142. Calculate f(3). 1 Let g(i) = -315i + 7867. Determine g(25). -8 Let b(u) = 239u - 20787. Give b(87). 6 Let b(h) = -h*2 - 15h - 80. Give b(-10). -30 Let b(y) = 3y2 - 40y + 182. What is b(8)? 54 Let c(u) = 6u + 207. What is c(-38)? -21 Let m(d) = -d3 - 16d*2 - 33d - 76. Give m(-14). -6 Let i(f) = f*3 - 90f*2 - 573f - 287. Calculate i(96). 1 Let a(g) = -g*2 - 70g - 934. Calculate a(-18). 2 Let r(g) = g*3 + 537g*2 - 8281g + 12. Give r(15). -3 Let v(p) = 90p2 - 4234p + 192. Calculate v(47). 4 Let g(o) = -o*2 + 340o + 1004. What is g(-3)? -25 Let o(u) = -u*3 - 11u*2 - 11u - 3. Determine o(-5). -98 Let x(j) = -2j2 + 5j - 76. Calculate x(7). -139 Let n(y) = 31y2 + 312y + 8. What is n(-10)? -12 Let i(p) = 9p3 + 6p2 - p - 11. What is i(3)? 283 Let k(q) = -q2 + 38q + 4820. Determine k(-53). -3 Let f(h) = 19h*2 - 285h + 29. What is f(15)? 29 Let k(v) = 9v2 - 19v. Give k(0). 0 Let m(k) = 29k + 896. Determine m(-31). -3 Let s(i) = 6i*3 - 15i*2 + 14i - 3. What is s(3)? 66 Let c(j) = 50j2 + 14j + 6. Determine c(3). 498 Let v(g) = 54g - 596. Determine v(11). -2 Let h(d) = d3 + 12d*2 + 21d + 30. Determine h(-7). 128 Let j(c) = -2c2 - 176c + 1050. Determine j(-94). -78 Let n(m) = m*2 + 4m + 124. Give n(0). 124 Let u(v) = -2v3 - 173v*2 + 445v - 2. Determine u(-89). -2 Let q(h) = 227h - 2586. Calculate q(13). 365 Let k(f) = 5354f - 219522. What is k(41)? -8 Let m(l) = -l*2 + 532l + 7. Give m(0). 7 Let t(f) = 917f - 26591. Give t(29). 2 Let p(i) = -2i*3 - 28i*2 - 13i - 95. Give p(-14). 87 Let p(b) = 3b + 274. Calculate p(-53). 115 Let a(l) = -l2 + 3l + 109. Giv	{ "pile_set_name": "DM Mathematics" }
6202135. 1065 What is the highest common divisor of 156 and 52127452? 52 Calculate the highest common factor of 1637057 and 1403. 61 Calculate the greatest common divisor of 16989298 and 6657. 317 Calculate the highest common divisor of 13 and 7366229. 13 What is the greatest common divisor of 560 and 514876880? 560 Calculate the greatest common factor of 26096 and 10080. 112 What is the highest common divisor of 11680743 and 489? 489 What is the greatest common divisor of 1411404 and 13308? 12 Calculate the highest common factor of 2370 and 9647085. 1185 What is the greatest common divisor of 26966862 and 17901? 1989 Calculate the highest common factor of 14762256 and 4580. 916 Calculate the greatest common factor of 252 and 572063940. 252 What is the highest common factor of 67750 and 116500? 250 What is the greatest common factor of 1006668 and 9672? 156 Calculate the highest common divisor of 2331592 and 29008. 296 Calculate the highest common factor of 11980 and 354025772. 2396 Calculate the highest common factor of 1233207 and 789. 789 What is the greatest common divisor of 60744 and 43692? 12 Calculate the greatest common divisor of 2588547 and 663. 39 Calculate the greatest common factor of 7379239 and 982. 491 What is the greatest common factor of 1710 and 1869390? 90 What is the greatest common divisor of 7454105 and 5? 5 Calculate the highest common divisor of 130455980 and 26660. 860 What is the highest common divisor of 148 and 168461? 37 What is the highest common factor of 1920077516 and 14? 14 What is the greatest common divisor of 3523072 and 182016? 256 Calculate the greatest common factor of 951654 and 36102. 66 Calculate the greatest common divisor of 2286 and 8215173. 9 Calculate the highest common factor of 8890366 and 1302. 62 What is the highest common factor of 49394149 and 2072? 259 Calculate the greatest common divisor of 6872392 and 32. 8 What is the greatest common divisor of 16 and 11801288? 8 What is the highest common factor of 928122 and 3354? 78 What is the greatest common factor of 55990 and 7634? 22 Calculate the greatest common divisor of 2887278 and 57102. 186 Calculate the highest common factor of 898 and 36198. 2 What is the highest common factor of 11153 and 1193281776? 11153 What is the greatest common factor of 2056 and 72848? 8 What is the greatest common factor of 159740 and 3204580? 3260 Calculate the highest common divisor of 201771 and 73028223. 4293 Calculate the highest common factor of 36948216 and 246. 246 Calculate the greatest common factor of 12256036 and 496. 124 Calculate the highest common factor of 2523 and 301261338. 2523 What is the highest common divisor of 140 and 18771550? 70 Calculate the greatest common factor of 76 and 261326. 38 What is the greatest common factor of 22852 and 57721? 197 Calculate the highest common divisor of 3456 and 646560. 288 What is the greatest common factor of 264 and 32333528? 8 Calculate the greatest common factor of 165883680 and 6192. 6192 Calculate the highest common divisor of 6811 and 234392781. 973 What is the greatest common factor of 638819542 and 310? 62 What is the highest common divisor of 18170732 and 424? 212 Calculate the highest common factor of 528444 and 518. 14 What is the greatest common factor of 1090533176 and 12392? 12392 Calculate the greatest common factor of 415941246 and 5796. 2898 What is the greatest common divisor of 97435 and 46461505? 7495 What is the highest common divisor of 103378 and 6446066? 814 What is the greatest common divisor of 49336 and 11509384? 7048 What is the greatest common divisor of 8492799 and 105? 21 Calculate the greatest common divisor of 288 and 421488. 144 What is the greatest common factor of 17336 and 2488? 8 What is the greatest common factor of 192497175 and 17550? 8775 Calculate the greatest common factor of 50927190 and 4350. 870 Calculate the highest common divisor of 10047 and 5763. 51 Calculate the highest common factor of 2645795 and 622795. 1445 Calculate the greatest common divisor of 719 and 690863373. 719 Calculate the highest common divisor of 70672 and 2198. 14 Calculate the greatest common divisor of 154 and 144668818. 14 Calculate the highest common factor of 15317352 and 144. 72 What is the greatest common divisor of 404 and 156419306? 202 What is the highest common factor of 863189 and 16143065? 4769 Calculate the greatest common divisor of 28358144 and 1713. 571 What is the highest common factor of 47 and 1190087? 47 What is the greatest common factor of 2173 and 1276346? 53 What is the highest common divisor of 5751 and 96633? 81 Calculate the highest common divisor of 75 and 3959685. 15 What is the greatest common factor of 60 and 39377496? 12 What is the highest common divisor of 353233874 and 1673? 1673 What is the greatest common divisor of 55647867 and 678? 339 Calculate the highest common divisor of 38 and 3104372. 38 What is the greatest common factor of 2888998 and 5117? 301 Calculate the highest common factor of 7176 and 2756. 52 What is the highest common factor of 6 and 411034482? 6 What is the highest common factor of 22940434 and 806? 62 Calculate the highest common factor of 531 and 6719274. 531 What is the highest common divisor of 13901376 and 512? 64 What is the highest common divisor of 846 and 670690? 94 Calculate the highest common factor of 746 and 603682969. 373 What is the greatest common factor of 7965 and 997041? 177 What is the highest common factor of 420 and 88311580? 140 What is the greatest common factor of 3523 and 837843383? 3523 Calculate the highest common factor of 93483 and 3783. 39 Calculate the highest common divisor of 7726773 and 5109. 393 Calculate the greatest common factor of 9735748 and 22. 22 Calculate the highest common divisor of 951248 and 1440. 16 What is the greatest common factor of 1076202 and 152388? 306 Calculate the greatest common factor of 105 and 17627295. 105 What is the highest common divisor of 5137 and 1039075? 467 Calculate the highest common divisor of 21663590 and 494. 26 What is the greatest common divisor of 87314 and 16? 2 Calculate the greatest common factor of 5990754 and 462. 462 What is the greatest common divisor of 75 and 6372525? 75 What is the highest common divisor of 5459 and 1398087? 53 Calculate the highest common factor of 753584 and 208. 208 What is the greatest common divisor of 43341200 and 3710? 70 What is the highest common factor of 14240 and 439304? 712 Calculate the highest common divisor of 110188910 and 15. 5 Calculate the highest common divisor of 485809 and 51731. 289 Calculate the greatest common factor of 11 and 35521365. 11 What is the highest common factor of 22708 and 683998? 14 Calculate the greatest common divisor of 40679506 and 14. 14 Calculate the greatest common factor of 1921 and 2408821. 113 What is the greatest common divisor of 77228 and 359308? 172 What is the greatest common divisor of 10688442 and 12? 6 What is the greatest common divisor of 15969 and 3435? 3 What is the highest common factor of 10550 and 7231814? 422 Calculate the highest common divisor of 163858799 and 13. 13 What is the highest common factor of 1611 and 69800513? 179 Calculate the greatest common factor of 95556438 and 36. 18 What is the greatest common divisor of 254832 and 336? 48 Calculate the highest common factor of 150780 and 4788. 84 What is the highest common divisor of 105 and 122572975? 35 Calculate the greatest common factor of 1048930050 and 4254. 4254 Calculate the greatest common factor of 660 and 11841621. 33 What is the greatest common factor of 900 and 865548? 36 Calculate the highest common divisor of 2527769 and 46. 23 What is the greatest common divisor of 101193 and 253739? 89 Calculate the highest common divisor of 52381270 and 1675. 335 Calculate the greatest common divisor of 154878 and 6474. 498 What is the greatest common divisor of 23281 and 48588949? 751 Calculate the greatest common factor of 74820 and 41726340. 2580 Calculate the highest common divisor of 169738901 and 415. 83 Calculate the highest common divisor of 2763 and 7549437. 921 What is the highest common factor of 212 and 139076134? 106 What is the greatest common factor of 270 and 922190? 10 Calculate	{ "pile_set_name": "DM Mathematics" }
nator of f and o. 308 Suppose -3c = -0c - 1836. Let n = -9865/16 + c. Find the common denominator of -113/20 and n. 80 Suppose 2y + 36 = 2o - 0y, -3y = -o + 10. Let m = o + -9. Suppose 0 = -5f + m - 3. What is the smallest common multiple of 5 and f? 10 Let w = 37 - 29. Let l = -6 + w. What is the lowest common multiple of 2 and l? 2 Let g = -2 - -5. Let n be 3/24 - (-1)/(-8). Suppose 2p + gl = -nl + 12, p = l + 1. Calculate the lowest common multiple of p and 4. 12 Suppose -2d + 100 = 4a, a + 6d - 18 = 9d. What is the smallest common multiple of a and 18? 72 Let a be 750/86(-9)/(-2). Let b = a + -75/43. What is the common denominator of b and 123/(-328)252(31/(-28) + 1)? 8 Let i = 18 - 11. Suppose -11d + id + 36 = 0. Suppose -4v = -c - 96, 2v + 7c - 4c - 48 = 0. Calculate the least common multiple of v and d. 72 Let c = 74 - 67. Suppose cu - 49 = -0u. Calculate the smallest common multiple of u and 188. 1316 Let z(h) = -h + 18. Let t(y) = y2 - 16y - 33. Let w be t(18). Calculate the lowest common multiple of 60 and z(w). 60 Let z be 1 + (1 - (-4 + 3)). Suppose 0j + z = 3j. What is the lowest common multiple of 40/7 + (-6)/(-21) and j? 6 What is the common denominator of -75/532 and (243/(-72))/((-5)/(-15))? 1064 Let l = -1273 + 8930/7. What is the common denominator of l and 32/5? 35 Let l = -2/4573 + 283532/13719. Let p be 6555/(-315) + 2/2. Let c = p + l. Calculate the common denominator of 61/12 and c. 84 Let a = -133731/20 + 6690. What is the common denominator of a and 1 - ((-10325)/56)/(-25)? 40 Let h(j) = -2j2 + 29j - 50. Let u(f) = -f*2 + 15f - 25. Let x(l) = 3h(l) - 7u(l). What is the lowest common multiple of x(17) and 6? 24 Let t be (104/6)/((-346)/6). Let f be (20508/3114 - 8)99/20. Let y = f - t. What is the common denominator of y and 31/20? 20 Find the common denominator of 44/95 and (-2967)/437 - (0 - 9). 95 Calculate the lowest common multiple of (108/21)/(100/(-35) - -3) and 3. 36 What is the common denominator of -137/18 and (-2479)/(-804)(-1)/18? 216 Let c = -16972/33 - -3061/6. Calculate the common denominator of (0 - 1/101)/(28/(-966)) and c. 2222 Let k = -1431 + 1441. Calculate the smallest common multiple of k and 9. 90 Suppose -4q - 5m = -22, 25 = 5q - 6m + 11m. Let a = 4 + 11. Calculate the smallest common multiple of a and q. 15 Let n = -423 - -471. What is the smallest common multiple of 40 and n? 240 Let d = 870/13 + -17207/234. Let j = -26809 - -482425/18. What is the common denominator of j and d? 18 Let i(u) = -u - 7. Let g be i(0). Let x = g - -11. Let c = 546 - 528. What is the smallest common multiple of c and x? 36 Find the common denominator of 71/45 and 207053/(-22715) - 9/(-1). 2655 Suppose 5s = 0, -2m - m = 3s + 12. Let l(y) = -y + 1. What is the least common multiple of 1/m - 13/(-4) and l(-6)? 21 Suppose r + 20 = -4r. What is the common denominator of (r - (-519)/60) + -3 and 11/8? 40 Suppose 2z = z + 12. Let t = -299 + 306. Calculate the smallest common multiple of z and t. 84 Let m = -15244 + 548695/36. What is the common denominator of 43/30 and m? 180 Suppose 3p = 5a - 2p + 715, 532 = -4a - 4p. Find the common denominator of (-36)/42(-5)/(-2) and (-3)/(18/a)5/6. 42 Suppose -5a + 137 - 7 = 0. Suppose 51 = -29p + 28p. Find the common denominator of 2/10(p - -10) and a. 5 Let r = 1/2846 + 93205/4269. Calculate the common denominator of r and (0 + 5/(-22))-10. 66 Suppose -3s - 12 = h - s, 36 = -3h - 2s. What is the common denominator of 3/1046/12 and ((-23)/8)/((-3)/h)? 20 Suppose -2h - 1044 = -6h. Let f = h + -105. Find the common denominator of (f/15)/(22/10) and -28/5. 55 Let z = -2926 - -1549. Calculate the common denominator of 2/((-9)/(z/120)) and 127/18. 180 Suppose 2r - 29 = 3. Let p be r/86882/(-2). Let q = -74/31 + p. What is the common denominator of 91/10 and q? 70 Let o(r) = -13r3 + r + 1. Let z be o(-1). Suppose 8t - zt = -30. What is the lowest common multiple of 20 and t? 60 Let v be (-28)/(-49) - 146/(-14). Let c(y) = -y2 + 15y + 4. Calculate the lowest common multiple of c(v) and 6. 48 Let y = -102 + 167/2. Find the common denominator of y and 13/170. 170 Let i = -507 - -515. Calculate the smallest common multiple of i and 70. 280 Let g(k) = -2k3 - k. Suppose -4n = 20 - 16. What is the lowest common multiple of 13 and g(n)? 39 Let y be (-1 - -7)(-4)/31908. Let d = y + -369505/127632. Find the common denominator of d and 19/30. 240 Let j = -148859/20100 + -18/1675. Calculate the common denominator of j and (-6)/(-16)1/(162/(-3204)). 12 Let f(g) = g*3 + 18g*2 + 17g + 22. Let l be (-864)/20(-10)/3. Let c be 2/(2 + l/(-68)). Calculate the smallest common multiple of f(c) and 10. 110 Suppose 3z + 3k - 57 = 0, 4z - 3k - 83 = -0z. Suppose 2t = c - 0t - z, 0 = -3c - 2t + 60. Calculate the smallest common multiple of c and 10. 20 Suppose 5i - 5k = 1115, 3i + 4k = -2i + 1160. What is the smallest common multiple of (i/95)/(3/10) and 2? 8 Let l(p) = p + 4. Let q be l(0). Let c be (-2)/q - 5031/522. Let x = 19/2 + c. Find the common denominator of -107/10 and x. 290 Let h(s) = s3 - 6s*2 - s + 8. Let g be 1(-12)/8-2. Let v(p) = p2 + p. Calculate the least common multiple of v(g) and h(6). 12 Suppose 14 = -3a + 5. Let m be (-50)/(-3) + 5/15. Let n = a + m. Calculate the least common multiple of 8 and n. 56 Suppose 84y - 800 = 88y. Find the common denominator of -44/27 and 112/y(-115)/12. 270 Let i = 3809495/978 + 2550/163. Let b = -3930 + i. Calculate the common denominator of 432/330 - 3/(-5) and b. 66 Let m = 132306872062552131/36626 - 3612375691474. Let b = m + -2/54939. Let t = b + 358. What is the common denominator of -103/14 and t? 42 Let q = 22 + 63. Let o = 93 - q. Calculate the smallest common multiple of 14 and o. 56 Let h = 13777 + -275629/20. Calculate the common denominator of h and (-7)/(-175)(-215)/(-4). 20 Let h(w) = w*3 - 23w*2 + 45w + 25. Calculate the least common multiple of h(21) and 64. 704 Let k be 0/(-2 + 6 + -3). Suppose kl + l - 174 = 0. Find the common denominator of 4/7 and ((-10)/24)/((-3)/l). 42 Let g(p) = -10p. Let r be g(-1). What is the smallest common multiple of (12/r)/(9/30) and (-46)/161 + 16/7? 4 Let k = 11365974/883 - 12872. Let m = -2629/8830 + k. What is the common denominator of m and (650/108)/(-5)-3? 90 Suppose 4j - 46 - 874 = 0. What is the least common multiple of 207 and j? 2070 Let z = 164/29 + -4835/696. Calculate the common denominator of z and -71/123. 984 Suppose 0 = 3n + 3n - 42. Suppose -4f + nf - 15 = 0, -2v + 30 = -2f. Calculate the smallest common multiple of 10 and v. 20 Suppose -30y - 4 = -32y. Suppose 4n = -2g + 50, -7n = -yn + 4g - 70. What is the lowest common multiple of 16 and n? 80 Let n be 72086/48 + (-64)/24 + 2. Let w = n + -1503. Calculate the common denominator of w and -11/18. 72 What is the common denominator of -15/64 and ((-12)/14)/(3808/15827)? 64 Let g(w) be the first derivative of -w4/4 + 4w*3/3 + w + 25. Calculate the smallest common multiple of 2 and g(4). 2 Suppose 282 = 9c - 12c. Find the common denominator of 137/18 and 3/9 + c/(-132). 198 Let w(z) = 12z3 - z2 - z - 4. Let m be w(4). Let v = -358 + m. Find the common denominator of (-12)/(-48) + v/(-40) and 41/9. 45 Let w be 765399578/(-2392) - 5/20. Let f = w - -319983. Let m = -1/23 - f. Calculate the common denominator of -35/4 and m. 52 Let g = 320922003 + -437095796519/1362. Let j = g - 66/227. Let k = -4967 - -64614/13. Find the common denominator of k and j. 78 Let u(f) = 2f - 7. Let z be 22/4 - (-1)/(-2). Calculate the lowest common multiple of u(z) and 7. 21 Let w = 2143/9 + -48091/198. Calculate the common denominator of 5/(((-3978)/33)/(-17)) and w. 858 Let b be 1 - (-35)/(-25) - (-152)/(-170). Let n = b + -589/136. What is the common denominator of n and 19/45? 360 Suppose -2o - 15y = -16y - 71, -5y - 25 = 0. Suppose -2n - 19 = -x, -2n - 100 = -3x - x. Calculate the lowest common multiple of x and o. 297 Let g be 2 + 8 + (-3 - -7). Suppose 0 = -gh + 11h + 126. Calculate the lowest common multiple of 7 and h. 42 Let o(k) = 11k2 + 70k + 71. What is the lowest common multiple of o(-1) and 15?	{ "pile_set_name": "DM Mathematics" }
est to v in j, o, 2/5? o Let m = 3.03 + -0.03. Suppose c + 0 - 1 = 0. Let f(h) = -2h2 - h + 1. Let j be f(c). What is the closest to 0.1 in 5, m, j? j Let f be (-8)/(-2) + 273/(-70). Which is the closest to -0.1? (a) f (b) 0.2 (c) 0.3 a Let f = 6.4 + -6.6. What is the nearest to f in -3/2, 2/21, -0.07? -0.07 Let h be 80/(-3)120/(-25). Let x = h + -1918/15. What is the nearest to -1 in x, 2/3, 0.2? x Let w = 287 - 863/3. Let z = -2.2 + 0.2. Which is the nearest to -2/3? (a) w (b) z (c) -1 a Let n be (-10)/62/(-15). Which is the nearest to -3? (a) 5 (b) n (c) 5/3 b Let h(t) = 5t + 18. Let m be h(-4). Which is the nearest to 5/6? (a) 6 (b) 2 (c) m b Let n = 0.5 - 0.3. Suppose -1 - 4 = t - 3a, 0 = 4t - 4a - 4. What is the nearest to 0 in n, -3, t? n Let x = 0.018 - 0.318. Which is the closest to 1/3? (a) 3/7 (b) x (c) 0.1 a Let o be (-3)/12 + (-21)/(-36). Let t = -43 + 41.3. Let y = 2 + t. What is the nearest to y in 4, -3/2, o? o Let l = -0.3 - -1.3. Let s = -41.9 + -0.1. Let h = s - -46. What is the closest to l in h, 0.4, 1/4? 0.4 Suppose v + v + 32 = 0. Let c be 2/(v/3) + 0. What is the closest to -1 in -1/3, 0.2, c? c Suppose 0 = l - 6l - 65. Let q = l + 9. What is the closest to 3 in 1/4, q, -0.1? 1/4 Let n = -50 + 246/5. Which is the nearest to -2/7? (a) -3 (b) 5 (c) n c Let k = 19/2 + -10. Which is the nearest to k? (a) -0.3 (b) -4/7 (c) 1/3 b Let o = -5.73 - -1.03. Let h = o + -0.3. Let k = 1 + 1. Which is the closest to 2? (a) 0 (b) k (c) h b Let l = 3 - 2. Let g be 0 - (10/6 - 1). Which is the nearest to g? (a) 0.4 (b) l (c) -3 a Let v be (-1)/(-2)(-10)/75-5. Which is the closest to v? (a) -4/7 (b) 3/5 (c) 1/6 c Let f = 18 + -6. Let n = 17 - f. Let l = 2 - n. What is the closest to -1 in l, 3, -1? -1 Let w = -182 - -179.94. Let u = w - -0.06. Let m = 547 - 551. Which is the nearest to -0.4? (a) 2 (b) u (c) m b Let z be 581/63 - 4/18. Let r(v) = -v*3 + 8v*2 + 10v - 10. Let s be r(z). What is the nearest to s in -1, 0, 0.1? -1 Let t = -31 + 26. Which is the closest to -1/4? (a) -3 (b) t (c) 0.14 c Let b = 19 + -18. Let a = 3973/19 + -209. What is the closest to 1/2 in b, -0.1, a? a Let o = 8744/3 + -2877. Let n = 37 - o. Which is the closest to 0? (a) 2 (b) 0 (c) n b Let d be 2/(-12) - (-175)/(-30). Let j = d - -9. Which is the nearest to -0.1? (a) j (b) 4 (c) 4/11 c Let f be -4 + 29/4 + -3. What is the closest to f in 0.3, 2/19, 9? 0.3 Let x be 152/(-95) + -16/(-3). Let y = -3 - -8. What is the closest to x in 1/4, y, 1? 1/4 Let l = -4.88 - 0.12. What is the nearest to 0.1 in l, 0.1, 0.08? 0.1 Let j = -10 - -9.5. Let a be (-3)/(-6)(-2)/3. Let l = -6 + 4. What is the closest to a in j, 0.4, l? j Let g = 170 - 173. Let u = -0.2 + 0.1. What is the closest to u in g, 0, -0.5? 0 Let k = -13 - -7. Let h be 10/8k/10. Which is the nearest to 1? (a) 3 (b) h (c) -2/3 c Let p(q) = -2q*2 + 14q - 13. Let v be p(6). Which is the nearest to 2/7? (a) 2/7 (b) -0.2 (c) v a Let g = -2 + 1.5. Let q = -0.5 - -0.5. Let v = g + q. Which is the closest to -0.1? (a) 0.5 (b) -3 (c) v c Let w(p) = -p - 9. Let z be w(-7). Let t be (-3)/(-2) - (-2)/z. What is the nearest to 3/5 in t, -2/3, -6/5? t Let k = -3.12 + 0.12. What is the closest to 0 in 2, k, -3/8? -3/8 Let z = -122 + 612/5. Which is the nearest to z? (a) 3 (b) 1/3 (c) 0.6 b Let r = -16 + 16. Which is the closest to r? (a) -4 (b) -0.3 (c) -3 b Suppose 0 = -3h + 3w + 6, -3h - 1 = 4w - 7. Which is the nearest to 0? (a) 2/21 (b) h (c) 5 a Let r be (-23)/60 + 14/56. Let w = 0 - 1. Which is the closest to w? (a) -2 (b) -0.5 (c) r b Let g = -0.15 - -0.2. Let l = g - -3.95. Which is the nearest to 0.1? (a) l (b) 5 (c) -2/7 c Let n = -15.74 + -0.26. Let i = -16 - n. What is the nearest to i in -2, -3, -4? -2 Let r be (6 + -6)1/2 + -5. Which is the closest to 0? (a) -1 (b) r (c) 0.2 c Let x = 5.7 - 6. Let v = 3.9 + -4. What is the nearest to v in 2/11, 0, x? 0 Let c = -0.8 + 1.8. Let w = -0.21 + 0.11. What is the nearest to c in -0.5, 2/13, w? 2/13 Let q = -0.1 - 3.9. Let v = 0.2 - 0.1. Let o = 0.1 - v. Which is the closest to o? (a) -1/3 (b) 0.5 (c) q a Let z = 0.01 + -0.1. Let x = 0.91 - z. Let h(t) = 4t3 - t2 + 1. Let u be h(1). Which is the nearest to x? (a) 0 (b) u (c) 0.1 c Let f = -0.4 - -0.3. Let m = 23.1 + -23. Let p = -2.4 + 2. Which is the closest to m? (a) -3 (b) f (c) p b Let i be (0 + 0)/((-12)/(-4)). What is the closest to i in 0, 0.1, 2/11? 0 Let k = 2 + -1.8. Let i = 3.5 - k. Let s = -3 + i. Which is the closest to 1? (a) 0.4 (b) -5 (c) s a Let x = 19.1 + -2.9. Let a = x + -16. What is the closest to 0 in -5, 1, a? a Let w = -0.37 + 0.07. Let s = 0.1 - 0.1. Let p = 30 + -29.9. Which is the closest to p? (a) w (b) 5/3 (c) s c Let m = 8.3 + -8. What is the nearest to -0.1 in -4, m, 5? m Let o = 105.1 - 105. Let d be -2 - (1 - 2) - -5. What is the closest to o in 0.3, d, 1/2? 0.3 Let m = -25.5 + 25. What is the nearest to -5 in 1, m, 0? m Let j be (-8)/96/(-4). Let n = 34 + -30. Which is the closest to n? (a) j (b) -1/6 (c) 0 a Let p(i) = i + 8. Let o be p(-5). Let x be (o + -4)/((-2)/(-1)). Which is the closest to x? (a) -5/4 (b) -2/9 (c) 2 b Suppose -5b + 14 = 4c, 3 = 5b - c - 6. Let z = -2 + b. What is the nearest to -1 in 2/7, 1/2, z? z Let b = 0.1 - -0.1. Let f = -251/2 - -125. What is the nearest to f in b, 0, 2/7? 0 Let v(q) = q*2 - 9q - 6. Let n be v(7). Let h be ((-6)/16)/((-30)/n). Which is the nearest to h? (a) 3 (b) 2 (c) 0.2 c Let o = 1.8 - -3.2. Let u = -4.9 + o. What is the nearest to -1 in 3/2, -0.1, u? -0.1 Suppose -15 = z - 5m, -z - 6 = -4m + 6. Suppose z = 2h + 3h - 20. What is the nearest to h in 3/5, -0.2, 0.1? 3/5 Let d = 61 + -62. Which is the closest to 2/5? (a) 1/3 (b) -36/11 (c) d a Let r = -159 + 798/5. Let s = -0.3 - -1.3. Let n = s + -0.5. Which is the nearest to 0.1? (a) 2 (b) n (c) r b Suppose -13 = -p + 4x, 5p - x + 11 = -0p. Which is the nearest to -1/4? (a) p (b) -3/7 (c) 1.7 b Let j = 1.96 + 0.04. Let s = -1 + j. Let y = -3.1 + 4.1. Which is the nearest to y? (a) s (b) 5 (c) 3 a Let b be -2-1(-10)/(-4). Let y = -6.7 + 0.7. Let k = y + 5.9. What is the nearest to k in -5, b, -4? -4 Let t = 0.3 - 0.2. Let k = -4 + 3.7. What is the nearest to t in -1/2, k, -1/9? -1/9 Let i be ((-6)/(-14)1)/(-1)1. Which is the closest to -1/2? (a) i (b) -0.4 (c) 0.2 a Let f = -12 + 17. Let u = -1 + 0.6. Which is the nearest to 1? (a) f (b) u (c) -0.5 b Let c = -22 - -22.5. What is the closest to 1 in -0.2, 3/7, c? c Let t(o) = -o2 - o - 5. Let c be t(-4). Let n = c - -15. What is the nearest to 0.2 in 0.2, 4, n? 0.2 Let p = 2.9 - 2.4. What is the closest to p in 5/6, 4, 0.4? 0.4 Let i = -1 + 1.6. Let c = -1 + 2. Let x = i - c. What is the closest to 4 in 2, x, 0.1? 2 Let z = 0.005 + -0.105. Which is the nearest to -2/7? (a) z (b) -2/15 (c) -1/2 b Let l = -10 - -8. Let z = l - -2. What is the closest to z in -3, -5, 2/21? 2/21 Let x = 127030/33 + -12999/11. Let q = -2634 + x. Let h = q - 33. What is the nearest to h in 5, -4/7, -0.4? -0.4 Let g = -2 - -2.2. Let f = 197 + -981/5. Which is the closest to g? (a) f (b) 0 (c) 1/5 c Let x = 18 - 17.5. Let q = 7.1 + -8. Let v = q - -0.5. What is the closest to -1 in -2/7, x, v? v Let j(q) = q2 - 4q + 3. Let t be j(2). Suppose -2 = 5s - 2n - 4, s + 3 = -3n. Which is the nearest to 0? (a) s (b) 0.1 (c) t a Let c = -1 + 1. Let p = -0.5 + c. What is the nearest to -1 in 1/5, -0.1, p? p Let q = 3/893 + -335/1786. Let u = -125/266 - q. Let z = -56 - -279/5. Which is the closest to u? (a) 0 (b) z (c) -1/4 c Let z = 0.29 - 0.39. Which is the nearest to z? (a) -5 (b) -0.1 (c) -3 b Suppose r + 7 = -5h + 24, 0 = h - r - 1. Suppose 0 = 2n + 7 + h. Let d = 0.2 - -0.3. What is the nearest to -0.1 in d, n, 5? d Let c = 11.1 - 11. What is the nearest to 1 in c, 2, 0.05? c Let t(u) = -2u*2 + 5u - 1. Let q be t(4). Let n = q - -18. Suppose -2k = 2d - 8, -4k = 3d - d - 12. Which is the nearest to k? (a) n (b) -2/9 (c) -0.3 b Let r = 2 + 0. Let u = -0.2 - 0.1. Which is the closest to r? (a) 0.5 (b) u (c) -0.1 a Let j = 2.1 + -1.1. What is the nearest to j in 4, -3,	{ "pile_set_name": "DM Mathematics" }
-4373m3 + 827m*2 - 827m*2 + 4465m*3. 92m*3 Collect the terms in -52d*3 + 13d*3 - d - 43d - 3d3 + 43d. -42d3 - d Collect the terms in 4903839 + 2j + 8189922 + 2172313. 2j + 15266074 Collect the terms in -73n*2 + n - n - 2 + 29n*2 + 80n*2. 36n*2 - 2 Collect the terms in -3754q*2 - 11q + 14q + 1 - q. -3754q*2 + 2q + 1 Collect the terms in -138682g3 - 138630g*3 + g + 281071g*3. 3759g*3 + g Collect the terms in 136x - 4 - 52x - 53x. 31x - 4 Collect the terms in 328388x - 656791x + 328399x. -4x Collect the terms in -1043 + 8j - 12j + 15j. 11j - 1043 Collect the terms in -4253z + 2 + 10630z - 3398z - 2 - 4881z. -1902z Collect the terms in -2 - 38092h + 12687h + 12704h + 12700h + 2. -h Collect the terms in -539j2 + 8j*2 + 16j*2 + 19j*2 + 498j*2. 2j*2 Collect the terms in -1196470939 + 1196470939 + 629k. 629k Collect the terms in 904i*2 + 2i - 443i2 - 463i*2 - 32155. -2i*2 + 2i - 32155 Collect the terms in -65879424r2 + 131758948r*2 - 2r*3 - 65879461r*2. -2r*3 + 63r*2 Collect the terms in 11v*2 + 20v*2 + 6v*2 - 3 - 3v*2 - 2v*2 + 6. 32v*2 + 3 Collect the terms in 2512 + 2607 - 1748g*2 - 5118. -1748g*2 + 1 Collect the terms in -9v - 102v3 - 92v*3 + 11v + 11v2 - 11v*2. -194v*3 + 2v Collect the terms in 54l2 - 53l*2 + 200l + 140l - 297l. l*2 + 43l Collect the terms in -18398346208 + 18398346208 + 1057w2. 1057w*2 Collect the terms in 2817x - x*3 + 7776x - x*3 + 3788x. -2x3 + 14381x Collect the terms in 697 - 43842i3 - 697 - 10467i*3. -54309i*3 Collect the terms in -5070a*2 + 37a*3 + 1687a*2 + 1688a*2 + 1695a*2 + 14a*3. 51a*3 Collect the terms in -16n + 24n + 33n + 7n - n. 47n Collect the terms in -58f + 302f - 81f + 1434 - 81f - 80f. 2f + 1434 Collect the terms in 1509c - 6054c + 1514c - 72 + 1514c + 1508c. -9c - 72 Collect the terms in 5456q - 10922q + 1730q3 + 5466q - 1731q3. -q3 Collect the terms in 433n + 84n - 259n - 258n + 10n*3. 10n*3 Collect the terms in 2546w*3 + 3395326447w*2 - 3395326447w*2. 2546w*3 Collect the terms in 477z - 477z + 3972z*3 - 3961z*3. 11z*3 Collect the terms in 19 - 322 + 303 + 44u. 44u Collect the terms in -42366b + 3b2 - 5b*2 - 53748b. -2b2 - 96114b Collect the terms in 1026370073226 + 239a3 - 1026370073226. 239a*3 Collect the terms in -3u - 13544u2 + 6895u*2 + 1 + 3u + 6650u2. u2 + 1 Collect the terms in -499207i + 10i2 + 998409i - 499202i. 10i*2 Collect the terms in -20308164241981 + 3f + 20308164241981. 3f Collect the terms in 4844797a*2 - 4844798a2 + 1236 + 380. -a2 + 1616 Collect the terms in 28 - 6759757k + 76 - 2k*2 + 6759761k. -2k2 + 4k + 104 Collect the terms in 106p2 + 60p*2 - 63425 - 3p + 63425 + 3p. 166p*2 Collect the terms in 108 - 222 - 4f*3 + 111 + 4f*3 - 2f*3 + 272f. -2f3 + 272f - 3 Collect the terms in -22l - 30l - 31l + 97l - 3l - 22l. -11l Collect the terms in 0h - 4h + 305115h*2 - 305174h*2 - 3h + 9h - 2h. -59h2 Collect the terms in -360r - 210r - 214r + 1013r - 217r. 12r Collect the terms in 91f + 263258f2 - 91f. 263258f2 Collect the terms in 472i*3 - 1289i - 1138i3 - 697i*3 + 1289i - 1097i3. -2460i*3 Collect the terms in 1159115147 - 1159115147 + 62q. 62q Collect the terms in 0 - 1 - 6d + 0 + 4 + 1 + 4d. -2d + 4 Collect the terms in 47g2 - 2388004 + 2388004 - 106g*2. -59g*2 Collect the terms in 19894255y + 19894234y - 68y*2 + 69y*2 - 39788489y. y*2 Collect the terms in 166 + 4f + 1411 + 376 - f - 94. 3f + 1859 Collect the terms in 6d - 3489d2 + 1757d*2 - 379 + 1733d2. d2 + 6d - 379 Collect the terms in 6261v - 12114v + 6167v. 314v Collect the terms in -33697t*3 + 10548 - 10548. -33697t*3 Collect the terms in -58159p*3 + 119575p*3 - 58130p*3. 3286p*3 Collect the terms in 41u + 3u + 139 + 2u - 921. 46u - 782 Collect the terms in 435w - 193w + 1082w*2 - 57w - 185w. 1082w*2 Collect the terms in 125j - 125j - 574j*3 + 431j*3 + 141j*3. -2j*3 Collect the terms in -10 - 3209h + 40 + 39 - 69. -3209h Collect the terms in 127t*2 + 27t*2 + 82t*2. 236t*2 Collect the terms in 41f - 1149 - 38f + 288. 3f - 861 Collect the terms in 17 - 36s3 + 35s*3 - 69s*3 - 17 - 67s*3. -137s*3 Collect the terms in 36019g - 5795g + 45156g. 75380g Collect the terms in -152 - 5 - 7 - 1 + t - 8 + 177 - 7. t - 3 Collect the terms in -178366 + 23140k + 178366. 23140k Collect the terms in 30 - 9 + 6 - 9 - 18 - 16s*3. -16s*3 Collect the terms in -135g*3 - 170g*3 + 438g*3 - 136g*3 + 0 + 13. -3g*3 + 13 Collect the terms in -25 + 2h*2 - 22 - 23 + 89 - 20h - 17. 2h2 - 20h + 2 Collect the terms in 98 - 53 - 37 - 342x - 264x. -606x + 8 Collect the terms in 4w - 87197 - 87199 + 174396 + 108w. 112w Collect the terms in -114376 + 208442 + 102856 + 2a + 149772. 2a + 346694 Collect the terms in -299i2 - 961 + 961 - 299i*2 + 881i*2 - 302i*2. -19i*2 Collect the terms in -4o + 0o + 11309o*3 + 2o - 880o3. 10429o*3 - 2o Collect the terms in 38171i - 12722i - 12721i - 1731i*3 + 1629i*3 - 12728i. -102i3 Collect the terms in -6557f*2 + 6554f*2 + 145f + 84 - 142f. -3f*2 + 3f + 84 Collect the terms in -j*2 + 3j - 2933 - 3203 - 3j + 5963 + 0j. -j*2 - 173 Collect the terms in 5w*2 + w + 259w*3 - 33 + 20 + 12w*2 + 19. 259w*3 + 17w*2 + w + 6 Collect the terms in 485g + 475g - 1466g + 289 + 504g. -2g + 289 Collect the terms in 4074t + 4067t - 12082t + 3951t. 10t Collect the terms in -49 - 1 + 7i + 49 + 1 - 7i - 9i*2. -9i*2 Collect the terms in 3970911f + 4633828f + 253153f + 463605f. 9321497f Collect the terms in 290831672n2 - 290831672n*2 - 132n*3. -132n*3 Collect the terms in 12g + 28914g2 + 0g + 3g + 68421g*2. 97335g*2 + 15g Collect the terms in -9 + 5 + 109f + 50f - 65f + 119f. 213f - 4 Collect the terms in -115691126460164v + 115691126460164v + 3v*3. 3v*3 Collect the terms in -144j + 171j - 13984 + 6995 + 6991. 27j + 2 Collect the terms in -4760z3 + 2415z*3 + 2331z*3. -14z*3 Collect the terms in -137a*2 + 218a*2 - 39a*2 - 117a*2 - 86a*2. -161a*2 Collect the terms in -358u + 358u - 30966u*3. -30966u*3 Collect the terms in 3810 + 3814 + 3817 + 3812 + 5s - 15253. 5s Collect the terms in 29849979271 + 7y*2 - 29849979271. 7y*2 Collect the terms in 13278u*3 + 61 - 61 - 539u*3. 12739u*3 Collect the terms in 382y*3 + 414y*3 - 1441y*3 + 486y*3 + 63y*2 + 417y*3. 258y*3 + 63y*2 Collect the terms in 5d - 4d - 3d - 12d + 13d + 75 + 0d + 2d*2. 2d*2 - d + 75 Collect the terms in 8t*2 + 9690287343t - 4 - 9690287343t. 8t*2 - 4 Collect the terms in 94n + 6 + 193n - 42n + 204n + 8n - 7. 457n - 1 Collect the terms in 49q - 1224q2 + 1229q*2 + 13 - 49q. 5q2 + 13 Collect the terms in -324j*3 + 5j - 28 - 27 + 87 - 32. -324j3 + 5j Collect the terms in -15i - 529 - i3 + 15i - 132 - 5i3. -6i*3 - 661 Collect the terms in 2p*3 - 895p + 330p + 239p + 326p - 8p*3. -6p*3 Collect the terms in 46524n - 453444n - 250113n - 1 + 106480n. -550553n - 1 Collect the terms in -3128l2 + 1255l*2 + 1891l*2. 18l*2 Collect the terms in -2 - 19213g*3 + 0 + 2 + 17538g*3. -1675g*3 Collect the terms in -391n + 0n2 + 4n*2 - 302n + 693n. 4n*2 Collect the terms in 2350959 - 4702080 + 2v*2 + 2351015. 2v*2 - 106 Collect the terms in -7242 + 5z + 15140 - 7898. 5z Collect the terms in -k2 + 7k - 40k - 24k*2 + 2k*2 + 33k. -23k2 Collect the terms in -2261n - 2256n + 13227n - 1928n - 2265n - 2259n - 2256n. 2n Collect the terms in 110 - 370 - 10b*2 + 112 + 58 + 90 + 7b*2. -3b*2 Collect the terms in 1365k*2 + 1169k*2 + 1121k*2 - 3338k*2. 317k*2 Collect the terms in -24n*2 - 10n - 125 + 258 - 128 - 25n2. -49n*2 - 10n + 5 Collect the terms in -3327v2 - 3682v*2 + 7226v*2. 217v*2 Collect the terms in 2352y*2 + 2358y*2 + 2356y**2 -	{ "pile_set_name": "DM Mathematics" }
4n = -5p for n. -5 Let l = -5 - -10. Solve 4w = d - 18, d + lw + 5 + 13 = 0 for d. 2 Suppose 0 = 2p - t + 29, -3p - 32 = -5t + 8. Let a be (-5)/p - 5/(-3). Solve 2j - 8 = 6j, 4i + 3j = a for i. 2 Let s(y) = y3 + 5y*2 + 5y + 6. Let t be s(-4). Solve -3j = -5c - 23, 5c - tj - 2j + 24 = 0 for c. -4 Suppose -3a = -3, 3x - 2a = a + 9. Let w = 10 + -8. Solve -4i + 2g = x, -2g - w = -2i + g for i. -2 Suppose -b = -2s - 0b - 35, 5s = -4b - 120. Let r = -11 - s. Solve y = 2p + 4y, 0 = -p + 3y - r for p. -3 Let c be -2(2 + -1) + -3. Suppose -6q = -4q - 16. Let w = c + q. Solve 5d + 2o - 21 = o, wo = 3 for d. 4 Let g(i) = i2 + 4. Let a be g(0). Let l be 4/14 - (-364)/98. Solve 0j + 4 = -aj, -4j = lk + 4 for k. 0 Let q = -2 + 5. Suppose qw + 2 = -1. Let k = 1 - w. Solve -9 = -3o - 4y + 3y, -ko + 6 = -3y for o. 3 Let w be 0 - 3/(-3) - 9. Let p(v) = 10v*2 + 1 - 2v2 + 3 + v3. Let d be p(w). Solve -3f = -8f + 20, -4f + 28 = dr for r. 3 Let j = -29 - -31. Solve 0 = 3k - f + j, -4f - 18 = -2 for k. -2 Let o(c) = -4c3 - c2 - c - 1. Let v = 4 - 5. Let m be o(v). Let y be 3/24 - (-92)/32. Solve q + 0q + 6 = -mn, -yq - 7 = -2n for n. -1 Suppose -2z - 5 = -4w - 25, -3 = -3w. Let m be (-16)/z6/(-4). Solve -2b + 24 = 4i, 5i - mb + 0b - 12 = 0 for i. 4 Let y(d) = d3. Let q(u) = -u3 + 3u2 + 4u. Let t be q(4). Let m be y(t). Let g be 6/(6/(-2))-1. Solve -2j - 4v = -5v - 2, gj + 3v - 2 = m for j. 1 Suppose -n = n - 28. Suppose 1 - 11 = -5q. Let d be q - (-21 + -11). Solve -3t = 2t - d, 0 = -h - 5t + n for h. -1 Suppose 5t - 12 = 3. Solve 0 = 4w + 4j + 16, 2w - 3 = tj - 6 for w. -3 Suppose -t = -8t + 7. Solve -i + 5a - 1 - t = 0, -2 = i - a for i. -2 Let o(i) = i3 - i2 - 3i + 3. Let k be o(4). Let w = k - 23. Solve -z = 2j - 2z - 5, -z = 5j - w for j. 3 Let w(x) = 3x2 + x + 1. Let i be w(2). Suppose 2a = 5a + 27. Let b = i + a. Solve 3s = 12, 2u - 3s + b = 2 for u. 4 Let v be 2 - (-1 - (-5 + 2)). Let k = v + 5. Solve 4r + 5z = -2, r + 2r - kz + 19 = 0 for r. -3 Let l = -3 - -11. Let b(g) be the third derivative of g*5/60 - 3g*4/8 + 4g3/3 - g2. Let q be b(l). Solve 2a - 2h = a - 1, q = 2a + h + 2 for a. -1 Let n(j) = -j3 + 4j*2 + 4j + 5. Let m = 2 - -1. Suppose 20 = mb + b. Let w be n(b). Solve w = -k + 5l - 23, 0 = 2k + k - l - 1 for k. 2 Suppose 3z + 3 = 18. Suppose -2t - z = -3t. Solve h + 3i - i = -2, i - 17 = -th for h. 4 Suppose -5k - 5z - 2 = -2k, -k - 14 = -5z. Let h = -1 - -5. Let w = k + h. Solve -v - 4v - i + 23 = 0, w = 2v + 5i - 23 for v. 4 Suppose -44 = 5l - l. Let b = -11 - l. Solve b = d - 1, -d - 1 = 3h - 14 for h. 4 Suppose -4o = -2 - 22. Suppose ov = 4m + v - 25, -2m + 3v = -15. Solve -8 = -4p + 6f - 3f, -4p - f - 8 = m for p. -1 Suppose -3w + 4w = 4, -89 = 5j - w. Let m = j - -19. Solve 0n - n - 2 = 3k, -n - mk - 1 = 0 for n. 1 Suppose 5n - 4u = 14, -3n + 10 = -3u + u. Suppose -nd - 32 = -10d. Solve -2p = -2z - d, -z = -3z - 8 for p. 0 Suppose o = -l - 1, -2 = 3o - l + 3l. Suppose 3t = -ot + 12. Solve 5w - g = g - 3, -tg = 4 for w. -1 Let t be (2 + 10/(-6))3. Suppose 2h - t = 9. Solve -4w + 0 = 3l - 13, -4l + hw = -7 for l. 3 Suppose -2d + 3 + 3 = 0. Solve g + 7 = -5t, -5g + 0g + 9 = dt for t. -2 Suppose -3j - 4r + 63 = 0, -21 = 10j - 11j - 4r. Solve 0 = 2z - 5t - j, -5z + t + 18 = -0t for z. 3 Let j(b) = -7b + 4. Let c be j(6). Let y be 3/(-15) + c/10. Let u be (-6)/y + 15/10. Solve v + 0n + 2n - u = 0, v - 3n = 8 for v. 5 Let o = -17 - -12. Let n be (4 + o)(-4 + 1). Solve -2d - 10 = 0, -3h + 10 = 2h + nd for h. 5 Let r be (-14)/21 + ((-210)/(-9))/5. Solve 2g = -rs + 2s - 4, 5s + 10 = 5g for g. 0 Suppose -z - 8 + 10 = 0. Solve -5o = zd - 2 + 18, 5d - 26 = 4o for o. -4 Suppose -4f + 17 = -51. Let n = -8 - -8. Solve n = -3r + 4c - 20, 4r - f = -5c + 8 for r. 0 Let u(k) = -k*3 - 7k*2 - k - 2. Let y be u(-7). Solve -5c - yi - 21 = 4, -5c = 4i + 25 for c. -5 Let v be ((-10)/4)/(3/24). Suppose 2l = -0l + 62. Let i = v + l. Solve -5j - 10 = 2t, -4j = -2t + 1 - i for t. -5 Let o(m) = 18m*3 - 2m*2 + 2m - 2. Let t be o(2). Let s be t/33 + 2/(-11). Suppose -v - 1 = -s. Solve 0 = -vd - 2k + 8, -4d + k - 6 = -2 for d. 0 Suppose -n - 2n = -27. Suppose -4t = 4a - 85 + n, 0 = 3a + 2t - 55. Solve -5m + v + 3v = -a, 0 = 3m + 4v + 9 for m. 1 Suppose 0 = 3a + 4 - 13. Solve 0 = -aj + 4s - 1, 0 = -2j - 2j + 4s for j. 1 Suppose 6w = 35 + 13. Solve -4g = -h - 21, -2h + 2g + w = 4g for h. -1 Let s = 52 + -50. Solve 0 = -sb - w + 12, -2w + 0 = -2b + 6 for b. 5 Let u be 19/5 - (-3)/15. Suppose -40 = -8i + ui. Solve 4 = -2d - 4a, -2d = 5a - ia + 13 for d. -4 Let p be 3(-1 + -2)/(-3). Suppose 0 = 3r, 5n - r = 7 + p. Solve 4i = ni + 3q - 1, 4q = 3i + 1 for i. 1 Let b = 15 - 26. Let n = -5 - b. Solve 2q + 18 = 4y, 2y - nq = -3q + 19 for y. 2 Suppose -2d + 140 = 2d - 5n, 184 = 5d - 4n. Let s = -29 + d. Solve 5k - 2h = 11, 4h - s = -4k + 3k for k. 3 Suppose -3 = y - 2. Let r = y + 5. Solve -4 = -2n, -3p - rn = -7p - 16 for p. -2 Let m(q) = -q*2 - 7q - 5. Let s be m(-6). Suppose -10 = -3f + 4h, 4h + 8 - 4 = 0. Solve 2 = -2y + 2p, y - 4y = -fp + s for y. 1 Let i(t) = -t3 - 4t*2 + 7t + 5. Let l be i(-4). Let n = l + 28. Solve 3 = u - w - w, -nu = 4w + 27 for u. -3 Suppose 0 = 2b - 4, -3b - 2 = -5g + 3g. Solve 5s - 7 - 7 = -3h, 2h - 2 = gs for s. 1 Suppose 7b = 24 - 3. Solve -bz + 28 = 2z - 2f, -5z + 16 = f for z. 4 Suppose -w + f - 3 = 0, -2w - 2w + 3f - 7 = 0. Suppose -g + 8 = -5s - 23, 2s - 38 = -wg. Solve 4k + 4n - 21 = k, 5k - g = -2n for k. 3 Let y(s) = s + 4. Let v be y(0). Let f = -14 + 30. Solve -t = -5m - f, -t + 10 = -3t - vm for t. 1 Let l be -4(1/(-2) - 0). Solve 5g + 22 = -4h, lg + 2g = h - 5 for g. -2 Suppose 2p - 9 = 3. Let z = -14 - -14. Let k be 60/14 - 4/14. Solve -2m - 2j + 2 = z, 2m - kj - p = -5j for m. 5 Let i be -4(-3)/(12/23). Suppose -4c - 7 + i = 0. Suppose -2w + 3w = c. Solve 3x - 7x = -wp, -15 = 5p for x. -3 Suppose l - 7 = -3. Suppose -6 = -t - l. Solve 0 = -2z + ty - 18, -3y = 4z - 2y + 11 for z. -4 Let h = -1 - -3. Let u = 4 - 1. Let t(b) = 2b. Let s be t(u). Solve v + l = -3 - s, -hl = 3v + 23 for v. -5 Let s be (10/14)/(2/14). Solve -3d + 5m + 32 = 0, 0 = -sd + 3m + 41 - 9 for d. 4 Let g = -71 - -76. Solve -gx = 2i - 25, 2i = 4i - 3x + 15 for i. 0 Suppose 5c + 0c = 20. Solve -n + 0n - 14 = 2o, -co = -5n for n. -4 Let w be (0 - (-6)/15)25. Let k = 14 - w. Suppose -ks = 2n, -7 = -4n - 2s + 23. Solve 0 = 5l + 5m + 10, 3l + 2m + n = -2m for l. 2 Let s be (-12)/24 - 25/(-2). Let y = -10 + s. Solve -5u + f = -18, -f = u - y - 4 for u. 4 Let g(z) = 2z*2 - 32z. Let c be g(16). Solve -4a + 2h - 4 + 2 = 0, c = 3h + 9 for a. -2 Suppose 97 = 3z + 82. Solve -1 - 15 = -4i + b, 1 = -zi - 4b for i. 3 Let o = -44 + 55. Let t = 1 + 1. Solve 2x - x = -4k - o, -2 = -tk + 2x for k. -2 Let o(z) = 0z2 + z2 - 4z - 2 - 4 + 12z. Let a be o(-9). Solve -3g - 10 = 5d, d + a = -2g - 6 for d. 1 Suppose 4l - 2l = 0. Suppose v + 4v = l. Solve 2j + 5b + 10 = v, 3j - 2b + 7b = -5 for j. 5 Let t be (2 - 33/12)/(9/(-24)). Solve 3g - g + 6 = tf, -g = 0 for f. 3 Let m be ((-24)/(0 + -2))/1. Suppose 4z - 5v = 12, 0 = 4z - 0v + 3v - m. Solve -zt = 3i, 3t + t - 5i = 36 for t. 4 Suppose 0 = -4v - 4j + 44, -2v + 34 = 3v - 2j. Let n = v - 3. Solve 5o = -t - 3t + 1, -31 = no - 4t for o. -3 Let y(l) = -l3 - 3l*2 - 2l - 3. Let p be y(-3). Let d = 2 + p. Solve -ds - 2w - 23 = w, -s = -4w for s. -4 Suppose 3x - 4x + 2 = 0. Suppose xa - 37 = 11. Suppose 0 = 4n + 3u - a, 4 = -2n - 3u + 22. Solve 0 = d + nd - 5v + 20, -d = -v + 5 for d. -5 Let o(b) = 12b - 4. Let k be o(2). Suppose 2i - 3v + 6 = -0i, -4i + k = 2v. Let q = 16 + -11. Solve 5l = u - 13, iu + 3 = -ql - 18 for l. -3 Suppose -3x + 1 = 7. Let d be (-14)/x + (-3)/(-3). Let f be ((-9)/(-12))/(2/d). Solve 0 = fw - 5m - 11, -5w + m + 14 = -3m for w. 2 Let y be (21	{ "pile_set_name": "DM Mathematics" }
er: 6.5 or 30302? 30302 Which is greater: 2.0248 or 13/6? 13/6 Which is greater: 4138 or 4161? 4161 Is -1/322 greater than or equal to 0? False Is 209/230 smaller than 1? True Which is smaller: 1 or -2/10543? -2/10543 Is -5 <= 2985? True Is 44567 smaller than 44568? True Which is smaller: 321831 or 321829? 321829 Which is greater: 1 or -13/515687? 1 Which is smaller: 5501 or 5500? 5500 Which is smaller: -1964 or -1990? -1990 Which is smaller: 0 or -1153/1524? -1153/1524 Is -869/2041 less than or equal to 1? True Which is bigger: -25194 or -251927/10? -251927/10 Is -122/38131 smaller than -1? False Which is bigger: 1 or -13/9913? 1 Which is greater: -1281 or -1283? -1281 Is 4 less than or equal to 536/209? False Which is bigger: 7370/203 or 36? 7370/203 Is 81533 at most as big as 81538? True Which is bigger: -0.1 or -1.94692? -0.1 Which is smaller: 66938 or 66960? 66938 Which is smaller: -17 or 0.5424? -17 Is 79 smaller than 78? False Which is bigger: 2/1602889 or -1? 2/1602889 Do -62 and -13097 have different values? True Which is smaller: -1584 or -2517? -2517 Is 3 bigger than 12518? False Are 5497.74 and 0.3 equal? False Which is smaller: -203246 or -406491/2? -203246 Is -2/5 <= 9307/24? True Is 0 at most -5/13381? False Is -723 bigger than -339? False Which is smaller: 1187901 or 1187898? 1187898 Which is smaller: 2/11 or -548.1? -548.1 Is -2 greater than -81654? True Which is greater: 3 or 0.08958? 3 Which is smaller: 0.1 or 1883/55? 0.1 Is -107/65 at least -14? True Is -1 greater than or equal to -1/6883? False Which is bigger: 1/8 or 37683? 37683 Is 14092 >= 14098? False Which is smaller: 4240/19 or 222? 222 Is 0.17 equal to 33075? False Which is bigger: 0 or -394675? 0 Are 1/3 and 4/6267 nonequal? True Which is greater: 3211 or 3063? 3211 Which is smaller: 1/9 or -1304.8? -1304.8 Which is greater: 104727/2 or 52363? 104727/2 Which is bigger: -1135473 or -1135474? -1135473 Is -1 >= -12/355205? False Is -178162 > -178161? False Is 20182 != 20183? True Which is smaller: 40 or 0.63? 0.63 Does 14577 = 14573? False Is -0.2 smaller than 16572/11? True Which is smaller: -1 or -1/25887? -1 Is 863/31 greater than 29? False Is 17/299831 at most as big as 1? True Which is smaller: -34 or -99? -99 Which is smaller: -1 or -2/105207? -1 Are 4/752357 and -1 nonequal? True Is -1 bigger than -2/12743493? False Which is smaller: -8588 or -8585? -8588 Which is smaller: -49/104 or 1? -49/104 Is 0.3 != 34/2053? True Is 71329 smaller than 71328? False Which is bigger: -2/20343 or 0? 0 Is -2486779 equal to -2486779? True Which is smaller: 1 or 2/125367? 2/125367 Is 5089/1604 less than 3? False Which is smaller: 2346 or 1516? 1516 Is 5/2 > -69423? True Are 68 and 5248/77 unequal? True Which is smaller: -4/80583 or 0? -4/80583 Is 4729 smaller than 4716? False Are -9249 and -9200 non-equal? True Which is smaller: -4/91099 or -1? -1 Is 39660 not equal to 39657? True Is 9642/3587 equal to 3? False Do 3/10 and -52970 have the same value? False Is 0.05 less than -1680/13? False Which is bigger: -171 or -12776/75? -12776/75 Which is smaller: -644 or -25060/39? -644 Is 1 at most as big as 117/712? False Which is smaller: -256026 or -256027? -256027 Are -19268 and -501003/26 unequal? True Which is greater: 116 or 144? 144 Which is greater: 430/9 or -190? 430/9 Which is greater: -16414 or -16413? -16413 Are -23850 and -23870 equal? False Which is smaller: 193011 or 193010? 193010 Are 4424 and 4476 non-equal? True Is 0.0955 at least as big as -0.037? True Is -242338 >= -1? False Is 3424 >= 10273/3? False Which is bigger: -618575/3 or -206191? -206191 Is 2056/467 bigger than 5? False Is 0 > 62/2431? False Is -8683935 < -8683936? False Is -1031 greater than or equal to -12365/12? False Which is bigger: 6026 or 6025? 6026 Which is bigger: 12195 or 12198? 12198 Which is smaller: 1909709 or 1909710? 1909709 Is 27 < -7076? False Which is smaller: -21200 or -17? -21200 Which is bigger: 1080 or 943? 1080 Is 23460 at most as big as 23459? False Which is bigger: 704082/5 or 140817? 140817 Are -1 and 19618 equal? False Is -12376 equal to -113? False Is -905841 < -905842? False Is 0.292 <= -544/7? False Is -1/15007 < 1? True Is -10260 greater than or equal to -0.04? False Which is smaller: 1/3 or -3539487? -3539487 Is 110/9 less than or equal to 1868? True Is 5 > 928/213? True Which is bigger: 1503 or -5/18? 1503 Is -13822 at least -13822? True Is 4245 >= -0.1? True Is -1/4 bigger than -434/641? True Which is smaller: 623 or 3442? 623 Which is smaller: 251742 or 251741? 251741 Which is smaller: 2 or 444962? 2 Which is smaller: -1151501 or -1151500? -1151501 Is 408546 != 408545? True Is -103 != -120? True Are -3223 and 1.49 equal? False Is -18/236899 > 1? False Which is smaller: -2242 or -12? -2242 Are 54514 and 54536 equal? False Which is smaller: 0.173632 or -0.3? -0.3 Which is smaller: -139350 or -278701/2? -278701/2 Does -871 = -33962/39? False Which is smaller: 2/7 or -33296? -33296 Which is smaller: -7 or -2808/499? -7 Is -48/8369 less than or equal to 1? True Does 1619552 = 1619551? False Is 4787 not equal to 167528/35? True Which is bigger: 1424/269 or 4? 1424/269 Is 0 > 2/5199599? False Do 408.83 and 6 have the same value? False Which is smaller: -30/547063 or 0? -30/547063 Which is smaller: -5857 or 186? -5857 Do 2/16139027 and 0 have different values? True Are -98990/123 and -805 equal? False Which is bigger: 1 or 5/35983? 1 Is -26913 not equal to -26915? True Which is bigger: -26413 or -26384? -26384 Which is greater: 177/19 or 7? 177/19 Which is smaller: -34204/155 or -221? -221 Is -5 != -56521? True Which is smaller: 5788 or 5784? 5784 Which is smaller: -254/1597 or 0? -254/1597 Which is smaller: 6 or 2751/454? 6 Which is bigger: 2/163 or 982? 982 Are 31018 and 31016 equal? False Which is bigger: -3596/69 or -52? -52 Is -46699 < 0.55? True Is 176/20451 greater than -1? True Which is bigger: -222400 or -222399? -222399 Which is bigger: 3331 or 3319? 3331 Which is greater: -15/82088 or 1? 1 Is -1/6300 != -14? True Is 1 less than or equal to 4/1878721? False Is 12276 bigger than -1/2? True Is -6675 at least as big as 0.175? False Is -2523 at most as big as -2580? False Is 22427 at most 22427? True Is 1906 <= 1895? False Are 151394/5 and 30280 unequal? True Which is smaller: 1066 or -19? -19 Is 3587346 greater than or equal to 3587347? False Does 22/37 = -5/12? False Is -0.62 at least as big as -1575.6? True Which is smaller: 34974/325 or 109? 34974/325 Is 1 <= -2769? False Is -1121/21 >= -53? False Is 7108/5 greater than 1423? False Are -1 and -3/10726531 equal? False Which is smaller: -1197942 or 1/3? -1197942 Which is smaller: 3169.59 or -0.05? -0.05 Which is smaller: 1950 or 17542/9? 17542/9 Is -17998 less than 119? True Is -0.4 at most as big as 1787.221? True Which is smaller: 427 or 7245/17? 7245/17 Is -6344/45 less than -140? True Is -5827 at most as big as -5827? True Is 70350 greater than 70350? False Is 30130 greater than 30131? False Which is smaller: 1080515 or -1? -1 Is 2043 at most 26578/13? True Is -17945 less than -17944? True Which is smaller: -57912 or -57911? -57912 Which is bigger: -1 or -2/12055? -2/12055 Which is bigger: 1353076 or 1353075? 1353076 Is -138 <= -389? False Which is smaller: 7 or -2.2064? -2.2064 Which is smaller: -1 or 283.79? -1 Is 1220608/3 at most 406870? True Is 0 greater than 97/20909? False Are 817/12 and 67 unequal? True Which is smaller: 2609928 or 2609929? 2609928 Which is smaller: 273 or 483? 273 Which is bigger: 170078/9 or 18898? 18898 Which is smaller: -179 or -303? -303 Is 4325 smaller than -62? False Does -143322 = -143320? False Do 0.18 and -171 have the same value? False Which is smaller: 230/3329 or 0? 0 Which is greater: 1/17 or 146332? 146332 Which is greater: 38 or -5.29? 38 Which is greater: 49 or 1/8176? 49 Do -6051873 and -6051874 have different values? True Is -1 less than 11/207923? True Is 40/22021 greater than 1? False Which is bigger: 0 or 11/7165? 11/7165 Is -1505 less than or equal to -1690? False Which is smaller: 9/2314 or 26? 9/2314 Which is bigger: 104 or 3805/37? 104 Which is smaller: 677524 or 677525? 677524 Is 37375 >= 37379? False Which is bigger: 41860 or 41859? 41860 Which is greater: -0.28 o	{ "pile_set_name": "DM Mathematics" }
ers picked without replacement from {z: 3}. Give prob of picking 3 z. 1 What is prob of picking 1 w and 2 n when three letters picked without replacement from {w: 2, p: 3, n: 6, u: 5, s: 2}? 5/136 Three letters picked without replacement from eeeeeejjehejjhj. Give prob of picking 1 h and 2 j. 4/91 What is prob of picking 1 x and 1 f when two letters picked without replacement from nfoxl? 1/10 What is prob of picking 3 b when three letters picked without replacement from {q: 9, b: 5}? 5/182 Four letters picked without replacement from qqeekqedoo. Give prob of picking 1 e, 1 o, 1 q, and 1 d. 3/35 Calculate prob of picking 3 e when three letters picked without replacement from hhehehhhehhhee. 5/182 Four letters picked without replacement from cvcvcvcvcccvvvcvcvcv. What is prob of picking 2 c and 2 v? 135/323 Four letters picked without replacement from {n: 1, k: 7}. Give prob of picking 4 k. 1/2 Calculate prob of picking 1 i and 3 x when four letters picked without replacement from {x: 3, i: 7}. 1/30 What is prob of picking 2 m when two letters picked without replacement from vvmvmvmvvvvvvv? 3/91 Four letters picked without replacement from {l: 1, i: 1, u: 1, s: 1, d: 1}. What is prob of picking 2 i and 2 u? 0 What is prob of picking 1 o, 2 i, and 1 g when four letters picked without replacement from {y: 4, g: 4, b: 1, i: 7, o: 2}? 14/255 What is prob of picking 2 p and 1 u when three letters picked without replacement from pgggpgu? 1/35 Calculate prob of picking 4 u when four letters picked without replacement from {u: 6, g: 6, m: 7}. 5/1292 Three letters picked without replacement from daaaqkrarrtdrtk. What is prob of picking 1 q and 2 r? 6/455 Calculate prob of picking 2 u when two letters picked without replacement from {m: 2, t: 2, n: 3, u: 9, d: 1, x: 3}. 18/95 Calculate prob of picking 1 w, 1 y, and 2 l when four letters picked without replacement from {i: 2, p: 2, y: 1, x: 2, l: 3, w: 4}. 12/1001 Two letters picked without replacement from {b: 4, k: 2, i: 1}. Give prob of picking 1 i and 1 k. 2/21 Two letters picked without replacement from vvgggvuggbgvbrp. Give prob of picking 1 b and 1 r. 2/105 What is prob of picking 1 g, 1 p, and 1 y when three letters picked without replacement from {d: 1, a: 1, q: 2, p: 1, g: 4, y: 6}? 24/455 Three letters picked without replacement from {u: 1, f: 2, r: 1, t: 3, o: 3}. What is prob of picking 2 o and 1 u? 1/40 Four letters picked without replacement from jrcccjjccrcjc. What is prob of picking 2 c, 1 r, and 1 j? 168/715 Four letters picked without replacement from {r: 3, q: 2, i: 6, e: 3, j: 3}. Give prob of picking 1 i, 1 q, and 2 j. 9/595 Four letters picked without replacement from {m: 12, e: 1, p: 1, o: 1, j: 2}. Give prob of picking 1 j, 1 m, 1 p, and 1 e. 6/595 Four letters picked without replacement from ezthehhhhzez. Give prob of picking 2 h and 2 z. 2/33 Calculate prob of picking 1 h and 1 o when two letters picked without replacement from yhobbbohhohbhphypyph. 21/190 Two letters picked without replacement from uugugggguguuu. What is prob of picking 2 g? 5/26 Calculate prob of picking 2 i when two letters picked without replacement from ezezeeeeezeziziieezi. 3/95 What is prob of picking 1 c and 1 w when two letters picked without replacement from swwssccwucww? 5/22 Two letters picked without replacement from yyyhehyzyh. What is prob of picking 1 e and 1 h? 1/15 Two letters picked without replacement from nqqqqqqnqnqqqqqqnqqq. What is prob of picking 2 n? 3/95 Calculate prob of picking 1 r and 1 e when two letters picked without replacement from lzrhlzlelorrlre. 8/105 What is prob of picking 3 f and 1 o when four letters picked without replacement from ficiioofoff? 2/55 Three letters picked without replacement from {a: 7, z: 6, m: 2}. Give prob of picking 1 m, 1 z, and 1 a. 12/65 Three letters picked without replacement from {d: 3, i: 2, a: 4, w: 8}. What is prob of picking 1 w and 2 i? 1/85 Calculate prob of picking 1 q and 1 d when two letters picked without replacement from qqqqdhqqhquqqqqhuqf. 4/57 Calculate prob of picking 1 o and 1 y when two letters picked without replacement from ibioiiiyiyrbiyirbib. 1/57 What is prob of picking 1 p and 1 c when two letters picked without replacement from {c: 2, p: 2, b: 8}? 2/33 Two letters picked without replacement from {y: 5, u: 5}. Give prob of picking 1 u and 1 y. 5/9 Calculate prob of picking 1 w and 1 o when two letters picked without replacement from okjjjxjwxjwxxojojw. 1/17 Calculate prob of picking 1 y and 2 o when three letters picked without replacement from ooooooyo. 3/8 Calculate prob of picking 2 j and 1 s when three letters picked without replacement from {s: 2, j: 2, t: 1, h: 1}. 1/10 Calculate prob of picking 2 e and 1 u when three letters picked without replacement from {j: 1, e: 2, m: 1, u: 1, x: 2, i: 2}. 1/84 Two letters picked without replacement from dfnuudnludnfpnu. Give prob of picking 1 d and 1 p. 1/35 Calculate prob of picking 2 u when two letters picked without replacement from {m: 4, u: 3, i: 6}. 1/26 What is prob of picking 3 p and 1 e when four letters picked without replacement from {o: 4, p: 7, e: 1, m: 3, v: 2}? 1/68 Two letters picked without replacement from {b: 6, a: 4}. What is prob of picking 2 a? 2/15 What is prob of picking 1 m and 1 a when two letters picked without replacement from abmbambbabbb? 1/11 Two letters picked without replacement from sssfnfsfnsspp. What is prob of picking 1 f and 1 n? 1/13 Two letters picked without replacement from {w: 10, j: 1, y: 6}. What is prob of picking 2 y? 15/136 Two letters picked without replacement from {f: 1, v: 1, t: 1, o: 2, d: 2, h: 1}. Give prob of picking 1 o and 1 h. 1/14 Four letters picked without replacement from {r: 2, m: 5, f: 2}. Give prob of picking 4 m. 5/126 What is prob of picking 2 n, 1 j, and 1 y when four letters picked without replacement from {n: 2, k: 1, d: 3, b: 1, j: 5, y: 1}? 1/143 What is prob of picking 2 z and 2 g when four letters picked without replacement from {z: 5, v: 1, w: 6, g: 3}? 2/91 Calculate prob of picking 1 m and 2 h when three letters picked without replacement from amxfhlh. 1/35 What is prob of picking 2 b when two letters picked without replacement from yauauuubbayuu? 1/78 What is prob of picking 2 z and 1 o when three letters picked without replacement from {z: 2, o: 6}? 3/28 What is prob of picking 2 e when two letters picked without replacement from {z: 1, m: 3, r: 1, e: 1, n: 1}? 0 Three letters picked without replacement from {o: 5, h: 1, b: 7, m: 3}. Give prob of picking 3 o. 1/56 Four letters picked without replacement from {m: 4, r: 3, e: 4, w: 3}. What is prob of picking 4 m? 1/1001 Calculate prob of picking 4 k when four letters picked without replacement from kzkzkk. 1/15 What is prob of picking 2 y and 1 x when three letters picked without replacement from {o: 4, x: 4, y: 2, u: 4, z: 4, b: 2}? 1/285 What is prob of picking 2 w when two letters picked without replacement from {w: 17, l: 1}? 8/9 Three letters picked without replacement from cfkcfkkkwccw. What is prob of picking 1 f and 2 k? 3/55 Calculate prob of picking 1 a, 1 c, and 1 o when three letters picked without replacement from {o: 7, a: 1, c: 1}. 1/12 Four letters picked without replacement from jjkbjvjvjvkxjjjbjjj. What is prob of picking 1 j, 2 v, and 1 b? 11/646 Four letters picked without replacement from {e: 1, n: 1, a: 9, l: 8, z: 1}. Give prob of picking 2 n, 1 a, and 1 e. 0 Three letters picked without replacement from sssssssssssslsssssls. Give prob of picking 3 s. 68/95 Three letters picked without replacement from {x: 3, k: 1, v: 1}. Give prob of picking 1 x and 2 v. 0 What is prob of picking 2 u and 1 a when three letters picked without replacement from vuaawwvswvvaua? 1/91 Two letters picked without replacement from mdmdddmdmddmmddddmd. What is prob of picking 2 m? 7/57 Four letters picked without replacement from offfsfisnnfffonosf. Give prob of picking 1 i, 1 n, and 2 f. 7/255 What is prob of picking 2 e when two letters picked without replacement from eleleebkelbel? 5/26 Two letters picked without replacement from qsczcsmqzqscqszyzz. What is prob of picking 1 y and 1 c? 1/51 Calculate prob of picking 2 p when two letters picked wit	{ "pile_set_name": "DM Mathematics" }
tor of 3744? True Does 18 divide 19774? False Does 21 divide 62244? True Is 7 a factor of 6885? False Does 12 divide 12907? False Is 53085 a multiple of 15? True Does 61 divide 7302? False Is 22080 a multiple of 20? True Is 23858 a multiple of 11? False Is 18 a factor of 1116? True Does 12 divide 1172? False Is 14 a factor of 12702? False Is 292 a factor of 85848? True Does 55 divide 140690? True Is 35 a factor of 3605? True Is 2244 a multiple of 82? False Is 43413 a multiple of 19? False Does 73 divide 23632? False Is 7 a factor of 5708? False Is 16 a factor of 5968? True Is 116 a factor of 10440? True Is 372 a multiple of 4? True Is 57 a multiple of 13? False Is 38822 a multiple of 14? True Is 510 a multiple of 34? True Is 30 a factor of 2606? False Does 47 divide 5841? False Is 1914 a multiple of 53? False Does 54 divide 122? False Is 11 a factor of 1666? False Is 42 a factor of 3192? True Does 12 divide 7240? False Is 14 a factor of 17594? False Does 44 divide 814? False Does 5 divide 4750? True Does 40 divide 12640? True Is 7326 a multiple of 78? False Is 29 a factor of 2378? True Does 85 divide 23545? True Does 31 divide 9424? True Is 12 a factor of 173? False Is 18 a factor of 3744? True Is 131 a factor of 2475? False Is 20 a factor of 358? False Is 32 a factor of 9600? True Is 866 a multiple of 77? False Is 17 a factor of 1275? True Does 20 divide 1047? False Is 1598 a multiple of 52? False Is 2 a factor of 244? True Is 32 a factor of 7232? True Is 1806 a multiple of 21? True Is 121 a multiple of 35? False Is 21 a factor of 252? True Does 23 divide 1348? False Is 53 a factor of 1238? False Is 38475 a multiple of 75? True Does 32 divide 448? True Is 404 a multiple of 4? True Does 3 divide 28? False Is 110 a factor of 38378? False Is 455 a multiple of 22? False Is 373 a multiple of 6? False Is 14 a factor of 336? True Does 41 divide 1109? False Does 30 divide 1380? True Is 60 a factor of 1200? True Does 33 divide 297? True Does 38 divide 9120? True Is 432 a multiple of 24? True Is 86 a multiple of 19? False Is 1218 a multiple of 87? True Is 3237 a multiple of 14? False Is 20344 a multiple of 12? False Is 47754 a multiple of 7? True Does 73 divide 15208? False Does 61 divide 867? False Is 514 a multiple of 19? False Is 253 a multiple of 52? False Is 39117 a multiple of 221? True Is 253 a factor of 506? True Does 95 divide 3990? True Is 76 a factor of 760? True Does 106 divide 10388? True Is 22 a factor of 1762? False Does 3 divide 396? True Is 1393 a multiple of 5? False Is 7480 a multiple of 14? False Is 67892 a multiple of 82? False Is 360 a multiple of 18? True Is 75 a multiple of 15? True Is 17 a factor of 1241? True Is 2 a factor of 15957? False Is 2589 a multiple of 3? True Is 8 a factor of 600? True Is 8496 a multiple of 48? True Is 7 a factor of 466? False Is 1043 a multiple of 29? False Is 26 a factor of 3005? False Does 28 divide 1484? True Is 6 a factor of 17910? True Is 38 a multiple of 32? False Is 25181 a multiple of 21? False Is 138 a factor of 3726? True Is 1656 a multiple of 18? True Is 15672 a multiple of 78? False Is 23 a factor of 39764? False Is 21660 a multiple of 76? True Does 145 divide 1160? True Is 4120 a multiple of 10? True Is 1702 a multiple of 37? True Is 19136 a multiple of 13? True Is 3055 a multiple of 13? True Is 127 a factor of 66675? True Is 3969 a multiple of 75? False Does 16 divide 576? True Does 124 divide 2604? True Is 9 a factor of 3447? True Does 3 divide 643? False Is 2419 a multiple of 23? False Is 10 a factor of 1859? False Does 4 divide 5090? False Is 66 a multiple of 33? True Is 60 a factor of 14820? True Is 24573 a multiple of 54? False Does 74 divide 10508? True Is 196 a factor of 23648? False Is 27 a factor of 1161? True Is 158 a multiple of 44? False Is 5 a factor of 578? False Is 14 a factor of 1150? False Does 7 divide 1981? True Is 11304 a multiple of 72? True Does 4 divide 2757? False Does 35 divide 3850? True Does 3 divide 2881? False Is 17 a factor of 4263? False Does 4 divide 2680? True Is 5 a factor of 410? True Is 95 even? False Is 10106 a multiple of 31? True Is 6612 a multiple of 12? True Is 12 a factor of 80868? True Is 17 a factor of 29665? True Does 23 divide 114? False Is 11 a factor of 2607? True Is 2 a factor of 338? True Is 57824 a multiple of 104? True Is 30 a factor of 3790? False Does 50 divide 3187? False Does 10 divide 342? False Is 544 a multiple of 17? True Is 64 a multiple of 16? True Is 18375 a multiple of 175? True Is 7 a factor of 2384? False Is 14 a factor of 22867? False Does 66 divide 764? False Is 3733 a multiple of 155? False Is 700 a multiple of 10? True Does 7 divide 659? False Does 3 divide 82? False Is 148 a factor of 109816? True Is 19 a factor of 2538? False Is 49 a factor of 294? True Does 10 divide 1021? False Is 253 a multiple of 11? True Does 3 divide 487? False Does 12 divide 4661? False Is 828 a multiple of 18? True Is 55 a multiple of 5? True Does 154 divide 5698? True Is 25 a factor of 115? False Is 4576 a multiple of 13? True Is 5080 a multiple of 20? True Is 5 a factor of 2100? True Does 13 divide 650? True Does 75 divide 18854? False Does 8 divide 40920? True Does 45 divide 945? True Is 26 a factor of 5434? True Is 12 a factor of 22? False Is 1476 a multiple of 36? True Is 3200 a multiple of 32? True Does 25 divide 2726? False Is 47880 a multiple of 14? True Does 12 divide 12108? True Is 51 a factor of 32672? False Is 29 a factor of 1427? False Is 82 a multiple of 11? False Is 28 a factor of 25256? True Is 255 a factor of 48960? True Is 88 a factor of 2376? True Is 9 a factor of 3555? True Is 1564 a multiple of 30? False Is 131 a factor of 2667? False Does 58 divide 1218? True Is 17 a factor of 374? True Is 4 a factor of 496? True Does 11 divide 23848? True Does 3 divide 308? False Is 1173 a multiple of 83? False Is 525 a multiple of 64? False Does 27 divide 864? True Is 11554 a multiple of 53? True Does 122 divide 21716? True Does 7 divide 1337? True Is 555 a multiple of 8? False Does 2 divide 602? True Is 11 a factor of 408? False Is 64184 a multiple of 142? True Is 30 a factor of 91582? False Is 3645 a multiple of 81? True Is 56 a factor of 2579? False Does 39 divide 6357? True Is 14239 a multiple of 5? False Is 556 a multiple of 40? False Is 58016 a multiple of 8? True Is 29 a factor of 2636? False Does 42 divide 11734? False Does 11 divide 9166? False Is 801 a multiple of 22? False Is 9 a factor of 1366? False Is 5 a factor of 2155? True Is 41 a factor of 246? True Is 13452 even? True Does 12 divide 252? True Is 9 a factor of 7746? False Does 16 divide 9746? False Does 34 divide 53476? False Is 299 a multiple of 6? False Does 14 divide 789? False Is 56 a multiple of 18? False Does 12 divide 88356? True Is 22 a factor of 2398? True Does 19 divide 667? False Does 6 divide 2592? True Is 1742 a multiple of 10? False Is 6890 a multiple of 65? True Is 7005 a multiple of 2? False Is 2860 a multiple of 65? True Is 46 a factor of 6440? True Does 97 divide 384? False Is 7 a factor of 763? True Is 13000 a multiple of 52? True Is 31 a factor of 457? False Does 15 divide 23? False Is 13 a factor of 1924? True Is 11107 a multiple of 20? False Does 166 divide 5236? False Is 34 a factor of 5542? True Is 265 a multiple of 3? False Is 259 a multiple of 37? True Is 304 a multiple of 19? True Does 41 divide 2373? False Is 630 a multiple of 9? True Is 36104 a multiple of 70? False Does 11 divide 1364? True Is 42 a factor of 5922? True Is 43 a factor of 20210? True Is 13230 a multiple of 35? True Is 60 a factor of 60? True Does 54 divide 4514? False Is 15522 a multiple of 47? False Does 73 divide 530? False Is 12198 a multiple of 107? True Does 6 divide 358? False Is 6 a factor of 18043? False Does 12 divide 864? True Is 2 a factor of 9? False Is 3 a factor of 393? True Does 69 divide 29394? True Does 126 divide 18018? True Is 1361 a multiple of 21? False Is 28279 a multiple of 24? False Is 323 a multiple of 16? False Is 25 a factor of 275? True Is 18 a multiple of 9? True Is 5646 even? True Does 105 divide 3150? True Does 143 divide 1144? True Is 9926 a multiple of 13? False Does 128 divide 30242? False Is 21470 a multiple of 38? True Does 282 divi	{ "pile_set_name": "DM Mathematics" }
et q be i(0). Suppose 5r - 95 = -3k, qk + 4r - 66 = 31. What is the tens digit of k? 3 Let p(k) = k*3 - 18k*2 + 5. Let r be p(18). Suppose rb = 5n - 960, -356 - 412 = -4n + 5b. What is the tens digit of n(5 + -4 - 3/9)? 2 Let w(p) = p*3 + 96p*2 + 74p + 593. What is the tens digit of w(-95)? 8 Let f = -661 + -405. Let b = 1696 + f. What is the tens digit of b? 3 Let c = 31173 + -18628. Suppose 0 = -13q + 26q - c. What is the tens digit of q? 6 Let b = -142 - -60. Let n = 37 + b. What is the units digit of 2/(-9) + (-2710)/n? 0 Suppose 12z - 84791 - 24915 = 59938. What is the ten thousands digit of z? 1 Let n be (0 - -16)5/4. What is the tens digit of (-4632)/9(-30)/n? 7 Suppose 5l = -3l + 176. Suppose 686 - 158 = lp. What is the tens digit of p? 2 Let w = -971 + 849. What is the hundreds digit of (w/(-3))/((-72)/(-3456))? 9 Suppose 312z - 324z + 7488 = 0. What is the hundreds digit of z? 6 Let k(n) = 597n - 417. What is the thousands digit of k(14)? 7 Let c be ((2 - 1) + -21)/((-4)/(-22)). Let g = 197 + c. What is the tens digit of g? 8 Let z = 38798 + -10787. What is the hundreds digit of z? 0 Let u = 15051 - 1460. What is the thousands digit of u? 3 Suppose -134559 + 24876 = -12y + 78933. What is the hundreds digit of y? 7 Let d(h) = -3h2 - 17h + 14. Suppose -2s + 5g - 5 = -38, 4s - g - 21 = 0. Let r be (396/(-15))/s + (-3)/(-5). What is the units digit of d(r)? 8 Let t(w) = 4w + 0w2 + 77 - 2w*2 + 9w*2 + 6w + 3w2. What is the units digit of t(11)? 7 Let m be (0 + 16)/(-3 - (-10)/2). Suppose -3n + 37 = -u, -m = -2u - 2u. Let g = 8 + n. What is the units digit of g? 1 Let w(y) = 271y + 8602. What is the tens digit of w(86)? 0 Suppose -77l + 5r - 94536 = -80l, -5r = 45. What is the ten thousands digit of l? 3 Suppose -39976 + 4070 = -26v. Suppose -u + n = -n - 339, -4u + v = -3n. What is the units digit of u? 9 Let d(k) = 15k - 10. Suppose 4p + 2p - 48 = 0. Suppose -z + 3z = p. What is the units digit of d(z)? 0 Let r be 66/10 - 96/(-240). Suppose -s - t = -57, -12t = -3s - rt + 195. What is the units digit of s? 0 Let y(p) = 5p*2 - 13p - 26. Let r(b) = 2b - 30. Let h be r(12). What is the units digit of y(h)? 2 Suppose 51p = -34p + 32290 + 13525. What is the hundreds digit of p? 5 Let g(h) = -15h*2 - 13h + 51. Let k be g(13). What is the hundreds digit of (-3)/(12/k) + (-1)/4? 6 Let s = 3023 + 4079. What is the units digit of s? 2 Let s be ((-1366)/4)/((-10)/20). Suppose -s = -5m - 273. What is the tens digit of m? 8 Let b be 2/(-3) + (-2256)/(-9) + 13. Suppose 7k = 157 + b. What is the tens digit of k? 6 Suppose 4d + 20 = 48. Let h(z) = z2. Let t(p) = 4p*2 + 5p + 11. Let a(y) = 5h(y) - t(y). What is the units digit of a(d)? 3 What is the thousands digit of 73460/22 + (-273)/3003? 3 What is the hundreds digit of 86/(-1032) + 57172/48? 1 Let r = -15483 + 17176. What is the units digit of r? 3 What is the thousands digit of (-84105)/(-22 - 5) - 3/1? 3 Let q = -220 + 318. Suppose -q = -b - 4m, 6b + m = 3b + 272. Let i = 165 - b. What is the units digit of i? 5 Suppose 50a - 44a - 6 = 0. What is the tens digit of (61 + a)/((-1)/(-2))? 2 Suppose 0 = 8r - r + 4249. Let c = r - -1185. What is the units digit of c? 8 Let h = 170 + -162. What is the units digit of 354/4 - h/(-16)? 9 Suppose t - 23t + 259798 = 0. Suppose 9d + 3790 = t. What is the hundreds digit of d? 8 Let c = 13264 - 4955. What is the thousands digit of c? 8 Let z = 37 - 40. Let q = -7 - z. Let o(y) = y3 + 4y*2 - 7y - 6. What is the tens digit of o(q)? 2 Let d = 39 - 38. Let n be (-9 + 3)/(d/(-4)3). What is the units digit of (10 - 0/1)/(2/n)? 0 Let v(d) = -d3 - 5d*2 + 15d + 3. Let c be v(4). What is the units digit of (-2)/(-7) - c3040/168? 6 Let j(c) = -73c + 77. Let u be j(9). Let x = -285 - u. What is the units digit of x? 5 What is the hundreds digit of (-71 + 73)(-3 - -1352)? 6 Let g = -74894 - -141892. What is the hundreds digit of g? 9 Let o = -33840 + 63825. What is the tens digit of o? 8 Suppose 0 = j + j + 5b - 62, -3j + 4b = -93. Suppose -41 + j = -2t. What is the hundreds digit of ((-52)/t)/((-74)/1665)? 2 Let t = 54 + -28. Let v = -30 + t. Let n(z) = -z3 - 3z*2 - 9z + 3. What is the units digit of n(v)? 5 Suppose -9 = -2f - 3. Let p be 13/(1(4 - f)). Suppose -486 = pz - 16z. What is the hundreds digit of z? 1 Let y(n) = -164n + 164. What is the hundreds digit of y(-16)? 7 Suppose 356v - 475v = -2233630. What is the hundreds digit of v? 7 Suppose -7y + 660 = -3y. Suppose 74 - 13 = v + 5d, 3d + y = 3v. Suppose r - v = 2c, -5r + 292 = -6c + 2c. What is the units digit of r? 0 Suppose -2g + 4y = -3g, 5g = y. Suppose g = -4m + 230 + 286. What is the units digit of m? 9 Let g(a) = 13a*2 - 20a + 126. Let i be (-36)/(-10)(-415)/(-166). What is the units digit of g(i)? 9 Suppose -9k + 546 = 4k. Suppose 0 = kv - 28v - 11200. What is the hundreds digit of v? 8 Let y be (-3 - (-7624)/20) + 1/(-5). Let b = y + 232. What is the hundreds digit of b? 6 Suppose -19y = -24y + 105. Suppose -13s + 44 = -y. Suppose 0 = -st + 1035 + 250. What is the tens digit of t? 5 Suppose 0 = 23v + v - 66192. Let d = v - 1482. What is the thousands digit of d? 1 What is the ten thousands digit of (-119961)/15(-16)/((-192)/(-60))? 3 Let i = 11127 - 7088. What is the tens digit of i? 3 Let o be -23/(-18)-39. Let q(t) = t2 - 39t + 27. What is the tens digit of q(o)? 0 Suppose 19s - 24742 + 14805 - 130207 = 0. What is the tens digit of s? 7 Let b = 219 - 205. Suppose -6f = -bf + 2544. What is the hundreds digit of f? 3 Let g = -132 + 134. What is the hundreds digit of (g + 4 + -1)119? 5 Suppose 25x - 1092 = -17x. Suppose xs = 449 + 331. What is the tens digit of s? 3 Let c be (720/100)/(2/(-10)1). What is the tens digit of (c - 651)2/(-3)? 5 Let s(t) = -t3 + 2t*2 + 4t - 5. Let c be s(2). What is the units digit of 5 - c - (3 - (262 - 1))? 0 Let n = -13050 + 31016. Suppose n = 18q - 8440. What is the units digit of q? 7 Let q(l) = -4210l + 810. What is the hundreds digit of q(-4)? 6 Suppose -4p - 16p = -18000. What is the units digit of p? 0 Let r be ((-6)/(-4))/(6/8) + 721. Let l = r + -398. What is the tens digit of l? 2 Let s(b) = -b*3 + 4b*2 + 5b - 3. Let c be s(6). Let z = -353 - -223. Let f = c - z. What is the tens digit of f? 8 Let t(d) = -647d - 3660. What is the tens digit of t(-11)? 5 Let j = 78 - 66. Let o(a) = 12 + 7a - 6 + 4a2 - j. What is the tens digit of o(-5)? 5 Let x be 1 - -3(-4)/(-12). Let o be 182/28 + (-1)/x. Suppose -ov + 149 = 23. What is the units digit of v? 1 Let q(x) = -x2 + 2x + 54. Let i be q(15). Let f = i - -229. What is the units digit of f? 8 Let s = -780 - -803. Let u(x) = 12x - 3. Let q be u(7). Let i = q - s. What is the tens digit of i? 5 Suppose -96r - 26r = 50r - 8022080. What is the units digit of r? 0 Let g(n) = n*2 + 6n + 7. Let m be g(-5). Suppose -mq + 6q = 464. Suppose -l - 2r + q = 3r, -3l - 2r + 361 = 0. What is the tens digit of l? 2 Let a = 1463 + 7209. Suppose 21s = 7036 + a. What is the hundreds digit of s? 7 What is the units digit of ((-382)/(-3))/(4/(-14)301/(-8901))? 9 Let j be 219-1-6(-2)/36. Let c = -75 - j. What is the tens digit of c/(-6)583 + 40/60? 9 Let s(c) = -4 + 8c2 + c2 - 15c*2 + 7c*2. Let r be s(2). Suppose 4u - 90 - 50 = r. What is the tens digit of u? 3 Suppose -23n + 22n = -15k - 11682, 5n = -5k + 58570. What is the hundreds digit of n? 7 Suppose -432 = 4144r - 4216r. Let x(u) = 30u + 2 + 5 + 0. What is the hundreds digit of x(r)? 1 Let j be (524/(-3))/((-2)/6). Let t(p) = p + 16. Let b be t(-6). What is the tens digit of j/b - (-2 + 7/5)? 5 Let u = 203 - 192. Suppose 15w - 2076 = uw. What is the tens digit of w? 1 Let j = -5461 + 10902. Suppose 1929 = 11f - j. What is the units digit of f? 0 Let i = 57 + -54. Suppose 791 = 5m - it + 328, -m = -t - 91. Let q = m + 8. What is the hundreds digit of q? 1 Let a(i) = -84i - 17. Let d be a(-2). Let q = d - -148. What is the units digit of q? 9 Let r(h) = -30h2 - 68h + 4. Let b be r(-2). Let s = 152 + 34. Let x = b + s. What is the units digit of x? 6 Suppose -3*l	{ "pile_set_name": "DM Mathematics" }
osest to -2/3? (a) d (b) -4 (c) 0 c Let j = 59/3 + -301/15. Let g = 1189.879 + 0.121. Let d = g - 1190.15. Which is the nearest to 2/5? (a) j (b) -3/4 (c) d c Let a = 7.9 - 8. Let n = -1.0382 + 0.0382. What is the closest to n in -1/3, -0.06, a? -1/3 Suppose 0 = -0v + 4v + 8. Let f(a) = a + 8. Let p be f(v). Suppose -q - m + 9 = -pm, m = q + 3. What is the closest to -2 in 0.2, -0.2, q? -0.2 Suppose 5y = 4 - 19. Let n = -463365 + 463354. What is the closest to -1/3 in y, n, -4? y Suppose 115a - 16 = -2g + 110a, 7g = 2a + 17. What is the nearest to -1 in -5/4, -2/7, g, 0? -5/4 Let k = 1169 + -1160. Let x = -63 - -62.93. Which is the closest to 2? (a) 3 (b) x (c) k (d) 0.4 a Let h = -593.1 + 81.1. Let t = -511 - h. Which is the nearest to t? (a) 1 (b) -3/5 (c) -1/5 a Suppose 42v + 152 = 34v. Let b(k) = -1. Let t(c) = -c2 - 19c - 4. Let n(a) = -4b(a) + t(a). Let w be n(v). What is the nearest to 1 in 4, w, -3/7? w Let g = -184 + 87. Let v = 19 - g. Let p = v + -112. Which is the nearest to 4/3? (a) p (b) 0 (c) -3 b Let y = -466/3 - -154. Let j = 9329/63 + -1035/7. What is the nearest to 0.25 in j, y, -0.4? j Let t = 0.027 - 0.027. Let z = 279 + -279.3. What is the nearest to t in z, -3/5, 2? z Let p = -9559 + 9552. Which is the closest to -1/10? (a) -0.3 (b) 1/9 (c) 4 (d) p a Let i = -1.6 + 1.9. Let w = -5.8 + 6. Let u be -7 + 1 + 1 - (28 - 30). Which is the closest to -3? (a) u (b) w (c) i a Let k be (14/21)/((-2)/(-3)). Let s = 9403.2 + -9403. What is the closest to k in s, 1/4, 0.11? 1/4 Let o = 22.14 - 22.54. Which is the nearest to 2? (a) 96 (b) 3 (c) 4 (d) o b Let g = -234 - -236. Suppose 14r - gr = 24. Which is the closest to 1.4? (a) -5 (b) 1 (c) r b Let q be (1320/216 - 6)/(2/(-3)). Which is the closest to q? (a) 4 (b) -3/4 (c) -3 (d) 3 b Let h = 4/81 + -352/567. Let g = -28.95306 - -28.85306. Let v be 1(2 + (-18)/10). Which is the nearest to g? (a) -2 (b) h (c) v c Let l be (-1 + -1)/(-1) + -1. Let k = -15 + -222. Let y = k + 237.1. Which is the closest to l? (a) y (b) -8 (c) 3 a Let h = 0.0745 + 0.9255. What is the nearest to h in 0.4, -2, -1/4, 38? 0.4 Let b = -0.1 + -0.9. Let l = b - -1.2. Let t be 27/(810/(-1220)) - -40. What is the closest to t in 2/5, 2/7, l? l Let i = 187 + -186. Let s = 47 + -47.2. What is the nearest to 2 in i, s, 3/4? i Let s be (-4)/6(204/(-8) - 0). Let t = -323/428 + 1/214. What is the nearest to s in -3, t, 0.3? 0.3 Suppose -1719 + 1095 = -24q. Let i = 0.06 - 0.16. Which is the closest to q? (a) -3 (b) i (c) 0.3 c Let k = 27.5 + -27. Suppose 0 = 3f - 13 - 2. Let m = 0.2842 - 0.3842. What is the closest to 2/3 in f, k, m? k Let p = 376 - 337. Which is the nearest to 1/2? (a) 4 (b) -1/5 (c) p (d) -5 b Let a = 0 - -0.3. Let p = -2.6 - -5.1. Let n = -3.5 + p. What is the nearest to n in 0, a, -0.2? -0.2 Let v be (585/52)/15 - (-19)/(-20). What is the closest to 1 in 0, -2, -79, v? 0 Let v = -2370 + 2386. Which is the closest to -2/7? (a) v (b) 11 (c) 3 (d) 2/25 d Let s = 2366.7 + -2367. Let t = -10 - -7. Let j = -4.2 + 0.2. Which is the nearest to j? (a) t (b) s (c) 1 a Let z = 25.53 + -25.5. Let i = -0.27 - z. Suppose 20 = -3m - 4x, 7x - 10 = 5m + 2x. Which is the closest to -0.1? (a) -1/3 (b) m (c) i c Let m = -177 - -174. Let u be (-12)/(-72)(-1 + m). Which is the nearest to u? (a) -2 (b) 1/2 (c) 1 b Let p = 0.62 + -0.12. Let k = p + -0.6. Let j be -351/11 + 3. What is the nearest to -1 in k, -5/4, j? -5/4 Suppose -44 = 453g - 431g. What is the closest to 1 in g, 0.1, 1, -4? 1 Let u = 4685 + -4680. Let c = -2.1 + 1.9. What is the closest to -2 in u, 0.09, c? c Let y = 1 + 0. Let k = -142.3 - -142.218. Let q = k + -1.918. What is the nearest to -1/5 in 3, q, y? y Let j(r) = -15r + 3. Let x be j(1). Let y be x/54 + (-39)/189. Which is the nearest to 5? (a) -4 (b) y (c) -2/15 c Let w = -3430/13 + 264. Let y = -24 + 23.95. Let x = y + 0.08. Which is the nearest to x? (a) 1/2 (b) -2 (c) w c Let t = 2.945 - -0.055. Let n = 10.6 - 9. Let g = -0.4 - n. Which is the nearest to g? (a) t (b) 3/4 (c) -5 b Let z = -26108/3 + 8703. What is the nearest to -5 in 8.8, z, -1/2? -1/2 Let x = 802.968 + -803. Let w = 273.032 + -272. Let q = x + w. What is the nearest to 0.2 in q, -2, 16? q Let p be (-9 + 588/70)35/(-56). Which is the nearest to 0.3? (a) 3 (b) 0.5 (c) p (d) -0.3 c Let r(t) = 1478t - 7383. Let f be r(5). Which is the nearest to -0.4? (a) -5 (b) -3 (c) f (d) -6 b Let u = 27688 + -27684. Which is the closest to u? (a) -3 (b) 6 (c) -1/7 b Let a = 2.3 - 0.3. Let j = -397.6 - -363. Let m = 35.6 + j. What is the nearest to -1 in a, m, -2/13? -2/13 Let y = -415 - -468. Let q = 42 - y. What is the closest to -0.7 in 2, -3/4, q? -3/4 Let x be ((-12)/18)/((-14)/12). Let n = 0.4735 + -0.2735. Which is the closest to 2? (a) n (b) -2 (c) x c Let d = -2830/12627 - -8/4209. Let m be (-3)/45 - 2/(-5). Which is the closest to m? (a) -1/3 (b) d (c) -5 b Let w = 0.099 + 62.901. Let y = 62.8 - w. Let z be ((-6)/(-5))/((-60)/75). Which is the closest to y? (a) -4 (b) z (c) -0.3 c Let w = 73539/28 + -10517/4. What is the closest to 3/4 in w, -4/9, -3/5, -2? -4/9 Let l(r) = -r3 + 7r*2 - 11r + 1. Let z be l(2). What is the closest to z in 2/7, -0.3, -104? -0.3 Suppose 2321t = 2397t + 19836. What is the closest to -2/5 in 1/2, t, -1/2? -1/2 Let u = 0.68 - -10.72. Let b = u + -11. Let q = -3 - 0. What is the nearest to b in q, 1, -0.5? 1 Let m be 5/50 - ((-1426)/(-20))/23. Let y = 0.8 + -0.3. Which is the nearest to m? (a) 0 (b) 1 (c) y a Let v = 14631.1 - 14631. Which is the nearest to v? (a) 2/3 (b) 2 (c) 10 a Let l = 1 - 1.1. Let q = -735 + 379. Let y = q + 360. What is the nearest to y in l, 0.2, 1? 1 Let d = 4463 + -4467. What is the nearest to -1 in -0.015, 1, d? -0.015 Let f = 0.1 + -0.1. Let o = -30004 + 30006. What is the closest to 3/4 in -5, o, f? f Let b = 196 + -206.6. Let o = b - -10.2. What is the closest to o in 4, -2, 1/5? 1/5 Let w = 481/395 + -33/79. What is the closest to -4 in 5/4, -9, w? w Let x be (6 - 2)(-6)/(-32). Let o = 2427 + -2421. What is the closest to o in 1, x, 0? 1 Suppose -52n - 43n = 3800. Which is the closest to n? (a) -1/3 (b) 29 (c) -5 c Let m = -0.0518 - 25.9482. What is the closest to m in 0, -1/2, 7? -1/2 Let y = -2054 - -2055. Let o be 2/8 + (-63)/156. Which is the nearest to -1/2? (a) o (b) y (c) 2/9 a Let f = -3443 - -3441. What is the closest to 0.3 in 0.2, -5, 15, f? 0.2 Let o = -4096.5 + 4097. Which is the closest to -17? (a) o (b) -5 (c) -1/11 (d) -2/7 b Let w = 24239 + -24249. What is the nearest to 0.2 in 0.1, w, 2/5, -0.04? 0.1 Let o = 837 + -523. Let f = o + -313.95. What is the nearest to -1/4 in 2, 3, f? f Let y = -423 + 422.899. Let o = y + 0.201. Which is the nearest to -1? (a) o (b) 0.2 (c) -3/4 (d) -3/2 c Let g = -61.88 - 1.12. Let u = g + 123. Let r = u - 61. Which is the nearest to r? (a) -5 (b) -6/7 (c) 6/7 b Let l = 162 - 151. Let s = l + -15. Let w = 3270/19 + -172. Which is the nearest to -0.1? (a) w (b) s (c) -0.8 a Let i = 4183 - 4180. Which is the closest to -0.1? (a) -0.1 (b) 2/3 (c) -3 (d) i a Let o = -6181 + 6179. What is the nearest to -2/5 in 148, 0, o, -3? 0 Let q = -113/175 + 9/25. Let r = 1691 + -1695. What is the closest to 12 in q, 0.5, r? 0.5 Let y = 524/143 + -50/13. Let w be (-1600)/80 + (-50)/(-2). Which is the nearest to 1? (a) 4 (b) w (c) y c Let h be (-1)/4 - (1215/54)/(-15). Let o = 0.9 + -0.4. Let u = -0.5 + o. What is the nearest to u in 1/8, h, 3? 1/8 Let g be 3(-2)/(-18) - (-1)/(-3). Let t be ((-30)/(-4))/(-15)g. What is the nearest to t in -8, -5, -1/6? -1/6 Suppose 0 = 3b - 192 + 186. Let p be ((-4)/(-10))/((-8)/10). Let r be ((-3)/(-6))/(1/(-3) - 0). What is the closest to 0.1 in r, p, b? p Let q be 51/5 - (-9)/(-18). Suppose -7 + 1 = -6o. Which is the closest to q? (a) 3 (b) o (c) 0.1 c Let n = -137/249 - -18/83. Which is the closest to 1? (a) n (b) -2 (c) 11.2 a Let q = 92 - 91.79. Let w = 47 + -46.79. Let u = w - q. What is the closest to u in 1/4, 0.1, -3? 0.1 Let s = -466 + 476. Let r = -12 + s. What is the nearest to r in -0.1, 0.05, -0.5? -0.5 Let p be -1 - (-7 -	{ "pile_set_name": "DM Mathematics" }
= -1/10136 + -10133/30408. What is the second smallest value in n, 3/4, -14.7, 0? n Let t = -4817 + 4821. Which is the second smallest value? (a) -1/18 (b) 12 (c) 5 (d) -2/5 (e) t a Let o be (-5)/6(-4)/10. Let g = 120039 - 120034. Suppose 5x + 22 = 3w + 8, -3w = -3x - 6. What is the second smallest value in g, w, o? o Let l = -11542 + 11544. Which is the biggest value? (a) 89 (b) -2 (c) -10 (d) -0.1 (e) l a Let s = -2.5 + 2. Let h = 74.407 + -74.007. Which is the fourth smallest value? (a) 0.2 (b) h (c) -17/3 (d) s b Let v = -4765.4 - -4765. Which is the third smallest value? (a) 46 (b) -3 (c) 0.5 (d) v (e) -2/11 e Let l = -0.094 + 7.894. Let p = l - 51.8. Let o = 44.1 + p. Which is the biggest value? (a) -1 (b) -2 (c) o c Let m(j) = -5j*3 - 10j*2 + 25j + 55. Let r be m(-2). Let h = 0.37 + 0.03. Which is the smallest value? (a) r (b) -1/6 (c) h (d) -0.4 d Let y = 56 + -322.5. Let d = y - -266. What is the smallest value in 5, -3/2, d, 0.3? -3/2 Let j(l) = 2l2 - 281l + 829. Let i be j(3). Let c = 3.5 + -3. Let k = 162 + -1132/7. What is the second smallest value in i, k, c, -2/11? k Let r = 12.0231 + -0.0231. Let j = -7 + r. Let k = -2 + -2. Which is the third biggest value? (a) j (b) k (c) -2/5 b Let i = 176 + -4750/27. Let p be (-874)/570 + (-2)/(-10). Let m = 1.1 - 5.1. Which is the smallest value? (a) p (b) m (c) i b Let a be 2((-5538)/(-208) - 27). Let o = -40 - -9. What is the second smallest value in o, a, -1/2, -0.4? a Let f = -12435 - -12454. Which is the fourth biggest value? (a) -1 (b) f (c) -0.5 (d) -14/3 (e) 2/5 a Let i(f) = -f2 + 17f + 15. Let v be i(17). Let d = 92 + -89. Which is the second smallest value? (a) d (b) v (c) -1 a Let f be 17/(170/100) + 14 + -22. Which is the fourth biggest value? (a) 27 (b) 0 (c) -2/5 (d) f (e) 1 b Let i = 11.256 - 2.256. What is the third biggest value in i, 5, -1/3? -1/3 Let n = 15332 + -15332.5. Which is the second smallest value? (a) 1 (b) 2 (c) 5/6 (d) n c Let k = 52.052 + -52. Let v = k - 0.042. Let m = v - -0.08. What is the third smallest value in -0.1, m, 3? 3 Suppose 6q + 12 = 5q - 4j, -8 = 2j. Which is the smallest value? (a) q (b) 5 (c) 1 (d) 319 c Let g = -6.598 + 6.998. Which is the biggest value? (a) -0.022 (b) -0.3 (c) g c Let r = -0.5 - 0.5. Let s = 10 + -16. Let k = 28366.2 + -28366. What is the second smallest value in r, s, 3, k? r Let r = 546 - 544. Let g = 251/52 - 53/13. Let c = 0.01 + -4.01. What is the second biggest value in c, r, 1/5, g? g Let z = -984 - -895.9. Let j = 92 + z. Which is the third biggest value? (a) 5 (b) -2 (c) j b Let q = 2906.88 - 2907. Which is the smallest value? (a) q (b) 1/6 (c) -2 c Let f = -0.053 + -30.947. Let h = f - 16. Let i = h + 43. Which is the second smallest value? (a) i (b) 15 (c) -3 c Let t = -30834 + 30834.4. Let s be ((-4)/18)/(2/(-3)). What is the smallest value in t, 5, -4/9, s? -4/9 Let t = -1548 - -20122/13. Let x be (12/(-10))/(2/(-5)). Let o(f) = f*3 - 8f*2 + 9f - 12. Let y be o(7). What is the third smallest value in y, x, t, -5? y Let c = -36345 - -36346. Let o(t) = -t3 - t2 + 3t - 3. Let v be o(-4). What is the third biggest value in -3/2, 2, c, v? c Let w = 251.1 - 217.6. Which is the biggest value? (a) 0.3 (b) 5 (c) 20 (d) w d Let g = -0.006 + -0.049. Let f = 4.945 - g. Let v be (-20)/(-40)6/(-4). Which is the second biggest value? (a) v (b) f (c) 0.5 c Let r be 489/(-318) + (-171)/(-114). What is the third smallest value in 2, r, 0, -5/6? 0 Let l = -31.65 + 31.35. What is the second smallest value in l, 0.1, -0.1, 4? -0.1 Let m = 12.4 - -0.6. Let t = 11.08 - 10.68. Which is the fourth smallest value? (a) -3 (b) -2 (c) m (d) t c Let x = -0.0642 - 710.9358. Let f = 716 + x. Which is the second biggest value? (a) -5 (b) 4 (c) f (d) 7 c Let c be -4(-3)/((-24)/(-10)). Suppose ct + s - 6 = 0, t + 2 = -2s + 5. Let k = -337.72 + 337.72. What is the third smallest value in t, k, 2/7? t Let r = 25648 + -25667. What is the fourth smallest value in r, 1/5, -5, -13? 1/5 Let u = 11 + -11.4. Let p = 22.5 + -33.5. Which is the third smallest value? (a) u (b) -1/4 (c) 4 (d) p b Let w = -0.06887 + 0.13887. What is the third smallest value in 16, 2/11, 3/7, w? 3/7 Let x = -58 - -56. Let o = -329 + 205. Let f = o + 127. Which is the second smallest value? (a) -4 (b) 2 (c) f (d) x d Let n = 53 + -22. Let m = 24 - n. Let d = m + 3. What is the third biggest value in d, 0.2, -0.01? d Let l = -318 - -177. Let n = l + 133. Let b be (3 - 4)(-2)/(-3). What is the third smallest value in n, -0.2, b? -0.2 Let i = 124/3 + -370/9. Let h = 3.4 - -1.6. Let f = h - 4.6. Which is the third smallest value? (a) 5 (b) i (c) f (d) -2/25 c Let l = 212/29 + -10844/87. Let s(h) = 13h3 - 37h*2 - 31h. Let c be s(4). Let m = c + l. What is the smallest value in m, 2, -5? -5 Let u = -486 + 3408/7. Let v = 53436 + -53432. Which is the second smallest value? (a) -2/7 (b) v (c) u (d) -0.5 a Suppose -9687 = 7g - 9687. What is the fifth smallest value in 2/17, g, -0.5, -0.02, -0.1? 2/17 Let y = 109.761 - -0.239. Let c = y - 112. What is the biggest value in c, 0, 1.6? 1.6 Let v be (13 - 16) + (-26 + 2)/(-3). Suppose -4w = 5l - 31 - 25, 5l - 42 = -3w. Which is the third biggest value? (a) w (b) 3 (c) v b Let q be 2/8 - (-2264)/32. Let l = q - 76. Which is the biggest value? (a) 0.5 (b) 2/7 (c) l (d) 1/3 a Let u be (-14454)/4950 - 4/50. Let l = -121/4 - -30. Let w = 28/3 + -143/15. Which is the third smallest value? (a) u (b) l (c) w c Suppose 0 = -y + 7 - 5, -4 = 3i - 5y. Which is the third smallest value? (a) i (b) -1/5 (c) -270 a Let y = -13/63 - -20/63. Let g = 623 - 56069/90. Let q = g - y. Which is the second biggest value? (a) -2/15 (b) 6 (c) q c Let h be (0 + 4/(-2))/6. Suppose 3i = 5g - 20, -5g = -63 + 43. Which is the fourth biggest value? (a) h (b) i (c) -0.1 (d) 5 a Let y(v) = v*2 + 3v + 2. Let r be y(0). Let w be r - 4/(-5)-5. Let o be ((-9)/(-18))/((-1)/w). Which is the biggest value? (a) 0.2 (b) 0.1 (c) -3 (d) o d Let q = -81 + 64.5. Let m = 21.5 + q. Which is the smallest value? (a) -3 (b) m (c) -3/5 a Suppose -h - 3 = 0, 66 = r - 6r - 2h. Let c be (-26)/r27/18. Let w = 3 - c. What is the third biggest value in w, 5, 4? w Let i be 451/(-693) - (-2)/9. Suppose -3j = -4h - 11, -7j + 3j - 12 = 0. Let g = 11 + -15. What is the biggest value in g, h, i? i Let f be ((-111)/(-84))/(-1) - (-6 + (-462)/(-88)). Which is the second smallest value? (a) 0.06 (b) 5 (c) 2 (d) f (e) -0.2 e Suppose 0 = 9x - 5443 + 2311. Which is the second smallest value? (a) x (b) 0.1 (c) 0 b Let o = -145283.1 - -145283. Suppose 2u = 24 - 6. Suppose u = g + 2g. What is the biggest value in o, g, -2? g Let k = -2 + 5/2. Let g = -3178.3 - -3380. Let t = 202 - g. Which is the third biggest value? (a) t (b) -3 (c) k (d) -5 b Let y = -0.56 + 0.598. Let l = 0.138 - y. Which is the third smallest value? (a) -3/7 (b) 2/5 (c) 1/4 (d) l c Let s(f) = -3f*2 - 26f - 5. Let m be s(-8). What is the third smallest value in -2/71, -5, m? m Let z be -3(4 + (-10)/3). Let u be (z3/12)/1. What is the smallest value in 2, -0.45, u? u Let n(i) = -6i - 253. Let j be n(-43). Suppose a - 10 = l + 4a, -30 = 5l + ja. What is the third biggest value in -5, -1, l? -5 Let f be 24/(-132) + 148/935. Let q = f - -269/595. Let v = 19 + -15. Which is the fourth biggest value? (a) 0.1 (b) v (c) 0.4 (d) q a Let d = -139969/67 - -2089. Which is the smallest value? (a) d (b) -0.1 (c) -3/4 c Suppose -8k = 318 - 14. Let p = 63 + k. Suppose 32u = pu - 35. What is the smallest value in 0.2, u, 12? u Let k = -2 - -2. Let z = -254.1135 - 0.5865. Let m = z + 255. Which is the biggest value? (a) k (b) m (c) -2 (d) -1/3 b Let t = 349 - 135. Let x = -213.5 + t. What is the second biggest value in 0.3, x, 2/3? x Let n be (-165)/242 + (-2)/(-11). Let i = 5.6 - 6. Let k = -18580 + 18580.4. What is the second biggest value in n, 10, k, i? k Suppose -5p + 8 = c - 16, -4c = -5p - 46. Let g be (-4)/c + 465/525. What is the smallest value in -5, -3, g? -5 Let s = 0.05 + -0.45. Let g = 19.07 + -184.87. Let o = 166 +	{ "pile_set_name": "DM Mathematics" }
- 2)(b + 1)/6 Let n(b) = -2b*3 + 2b*2 - b + 1. Let o(x) = -5x*3 + 303x*2 + 22197x + 21907. Let c(y) = -6n(y) + 2o(y). Find l, given that c(l) = 0. -148, -1 Determine p so that 87 + 765/4p2 + 519/2p + 321/8p3 - 3/4p*4 = 0. -2, -1/2, 58 Let f(b) = 4b + 4b2 - 41b + 43b - 1. Let h(d) = -2d + d*2 + 4d*2 + 9d. Let i(g) = 4f(g) - 3h(g). Factor i(z). (z - 1)(z + 4) Let i(l) = 155l + 8064. Let y be i(-52). Solve -9/4q2 + 3/4q*3 - 3/4q*5 + 9/4q*y + 0 + 0q = 0. -1, 0, 1, 3 Let y(r) be the first derivative of r*4/3 - 1552r*3/9 + 1546r*2/3 - 1544r/3 - 835. Determine h, given that y(h) = 0. 1, 386 Let x(j) = -j*2 - 12j - 32. Let s be x(-4). Let o(u) be the second derivative of 8/3u3 - 1/6u*4 + s + 9u - 16u2. Factor o(f). -2(f - 4)*2 Let o(m) be the third derivative of 0m*3 + 7/15m*5 + 2/3m*4 + 1/42m*8 - 1/5m*6 + 0 - 2/15m*7 + 0m + 206m2. Solve o(f) = 0. -1, -1/2, 0, 1, 4 Let p(v) = -v3 - 47v*2 + 202v - 47. Let o be p(-51). Let f be 5/25 + (-26)/o - -1. Find z, given that fz - 6/11 - 2/11z2 = 0. 1, 3 Let t(p) be the third derivative of -p10/378000 + p9/50400 + p8/12600 - p5/20 + p3/6 + 35p2. Let c(m) be the third derivative of t(m). Factor c(u). -2u*2(u - 4)(u + 1)/5 Let u(g) be the first derivative of -g7/126 + g5/30 - g3/18 + 78g - 64. Let z(i) be the first derivative of u(i). Factor z(o). -o(o - 1)2(o + 1)*2/3 Suppose -2a = -2y - 68, -108 = a - 5a - 3y. Suppose -b - 4m + a - 8 = 0, 3b = 4m + 18. Factor -33x - 17x - 5x2 - 79 + bx + 44. -5(x + 1)(x + 7) Factor 228/7 - 2/7k2 + 226/7k. -2(k - 114)(k + 1)/7 Factor 0 + 36/5l - 1/5l*3 + 9/5l*2. -l(l - 12)(l + 3)/5 Factor 85s*2 + 86s*2 - 305s*2 + 3s - 3s3 + 30 + 104s*2. -3(s - 1)(s + 1)(s + 10) Suppose -16/7 + 2/7f3 - 30/7f - 12/7f2 = 0. Calculate f. -1, 8 Let d(t) be the first derivative of -7t*3/4 + 243t*2/8 - 165t/2 + 1978. Solve d(a) = 0. 11/7, 10 Let r be 3807/(-162) + (-49)/14 - -39. Factor -rx2 - 20/3x*3 - 4 + 68/3x. -4(x - 1)(x + 3)(5x - 1)/3 Let g be (-16)/64 - (-34)/8. Suppose 3c - 4c + 4w = -26, 4w = -2c + g. Factor -2r + cr - 32r*2 + 30r*2 + 4r. -2r(r - 6) Let l = 8562 + -8562. Let k(i) be the second derivative of li2 - 1/12i*3 + 1/48i*4 + 0 + 18i. Find w such that k(w) = 0. 0, 2 Let z(a) be the third derivative of 0a3 + 1/300a*6 + 0a - 1/30a4 - 1/175a*7 + 1/840a*8 + 1/50a*5 + 0 + 11a*2. Solve z(o) = 0. -1, 0, 1, 2 Find a such that 0 + 214/13a*3 - 30/13a*4 - 16a*2 + 24/13a = 0. 0, 2/15, 1, 6 Suppose -3 = -j + 2j. Let f(p) = -24p*3 - 3p*2 - p - 4. Let o be f(j). Factor -12b*2 + 3b*5 - ob - 12b3 + 6b*4 - 3b*4 + 620b. 3b2(b - 2)(b + 1)(b + 2) Let l(b) be the second derivative of b4/4 + b3/3 + b*2 + 381b. Let o be l(0). Factor 12/7h4 - 8/7h*o - 4/7 + 12/7h - 8/7h3 - 4/7h*5. -4(h - 1)*4(h + 1)/7 Let x(n) = -6n - 1. Let t be x(0). Let j(r) = -2r*3 - 38r*2 - 30r + 78. Let g(d) = -d*3 - 3d*2 - d + 1. Let l(a) = tj(a) - 2g(a). Solve l(w) = 0. -10, -2, 1 Let v(k) be the third derivative of k6/24 + 5k*5/12 - 20k*4/3 + 30k*3 - 1720k*2. Factor v(i). 5(i - 2)*2(i + 9) Let c(b) = -18b3 - 851b*2 + 972b - 103. Let g(x) = -x*2 + 2x - 1. Let t(v) = 2c(v) - 14g(v). Factor t(z). -4(z - 1)(z + 48)(9z - 1) Find m, given that -6/7m3 - 2/7m*5 - 10/7m*4 + 0m + 0 + 18/7m2 = 0. -3, 0, 1 Suppose -11g = -6g. Suppose -j - 6 = -x + 2, g = 3x + 3j - 6. Solve xs*3 + 3 - s - s + 15s*2 - 3s - 18 = 0. -3, -1, 1 Suppose h = 7u - 4, 2u + 0u + 5h = -20. Let m(z) be the second derivative of 0 + 1/36z4 + 9z + 0z3 + uz*2 - 1/60z*5. What is w in m(w) = 0? 0, 1 Let p(m) = 11m*2 + 57m + 10. Let z be p(-5). Let o(v) be the second derivative of zv3 + 0 + 0v*2 + 1/15v*6 + 0v*4 + 1/5v*5 - 19v. Factor o(w). 2w3(w + 2) Let r(x) = -3x - 17. Let o be r(-8). Suppose 6q + 2 = oq. Find i, given that 3i + 0i - qi*2 + 2i + 7i2 = 0. -1, 0 Let x(s) be the second derivative of -13s*4/15 - 8s*3/15 - 18s - 31. Find h such that x(h) = 0. -4/13, 0 Let d(v) be the third derivative of -v*8/3696 + 29v*6/660 - 2v*5/15 - 115v*4/88 - 100v*3/33 + 9v2 - 6. Suppose d(u) = 0. What is u? -8, -1, 5 Let k(c) be the third derivative of -c7/525 + c6/75 - c5/150 - c*4/10 - 186c*2 + 4c - 1. Solve k(g) = 0 for g. -1, 0, 2, 3 Let t(s) be the third derivative of s*6/30 + 39s*5/10 + 97s*4/3 + 55s*3 + 968s*2. Factor t(y). 2(y + 3)(y + 55)(2y + 1) Suppose -2k + 2j - 38 = -488, 4j = 0. Factor 5r - 203r*2 + 100r + 198r2 - 5r*3 + k. -5(r - 5)(r + 3)2 Let r(g) be the third derivative of 0 - 1/30g*5 - 3/2g*4 + 66g*2 - 27g*3 + 0g. Determine x so that r(x) = 0. -9 Let g be ((-5)/(50/(-252)))/(62/620). Let k be (9/g)/(1/8). Factor -12/7q3 + 0 + 8/7q*2 - 2/7q - kq5 + 8/7q*4. -2q(q - 1)4/7 Let w(l) be the third derivative of -l7/3780 + l6/405 + 7l*5/540 - 5l*4/54 + 2l*3 - 45l*2. Let u(v) be the first derivative of w(v). Factor u(y). -2(y - 5)(y - 1)(y + 2)/9 Let s = -624932/3 + 208311. Factor 50/3a + 625/3 + sa2. (a + 25)2/3 Let p(a) = 14a4 + 54a*3 + 53a*2 + 16a. Let y(w) = -41w4 - 161w*3 - 157w*2 - 47w. Let f(z) = 14p(z) + 4y(z). Factor f(t). 2t(t + 2)(4t + 3)*2 Let a(w) be the third derivative of 0 - 147w*2 + 0w*7 - 1/1008w*8 - 1/72w*4 + 1/180w*6 + 0w*3 + 0w*5 + 0w. Factor a(c). -c(c - 1)2(c + 1)*2/3 Factor -18j*2 - 75j*3 - 75j*2 - 25j*2 + 5j*4 + 38j*2. 5j*2(j - 16)(j + 1) Let b(l) be the first derivative of 2/5l*5 + 9/2l*4 + 0l - 9l2 - 2/3l*3 + 258. Factor b(n). 2n(n - 1)(n + 1)(n + 9) Let a be 13((-901)/(-884)8 - 8). Factor 0u + 1/5ua - 1/5. (u - 1)(u + 1)/5 Let m(o) = 5o - 96. Let g be m(23). Factor 14y*4 - gy*4 + 56y*3 + 21y*4 + 25y*2 + 3y. y(y + 3)(4y + 1)2 Let z = 203084/23075 + -24/23075. Factor -2/5p*3 + z - 18/5p - 24/5p2. -2(p - 1)(p + 2)(p + 11)/5 Factor -60a + 28a*2 + 179a - 75a + 4a*3 + 20. 4(a + 1)*2(a + 5) Let x(d) be the first derivative of -107 + 252/5d2 - 27/5d*3 + 3/20d*4 + 588/5d. Solve x(z) = 0. -1, 14 Let 87/4m3 + 0 - 3/4m*4 + 0m - 21m2 = 0. What is m? 0, 1, 28 Let u(x) = -2x*2 + 15x + 7. Let t be u(8). Let n = 3 + t. Solve 6a - 2a*4 + 0a*n + 7a*2 - 2a*3 + 3a*2 + 4a*3 = 0. -1, 0, 3 Let o = -188328 + 188330. Solve -2/7j*3 + 6/7j*o + 0 - 4/7j = 0 for j. 0, 1, 2 Let s(w) be the first derivative of -15w3 - 120 + 72 + 2w*2 + 3w*3. Factor s(r). -4r(9r - 1) Find i such that -19i2 + 7 - 68i*2 + 2346i + 12 - 6 + 68 = 0. -1/29, 27 Solve 36 + 3/4z4 - 63/4z*2 - 9/2z*3 + 51/2z = 0. -3, -1, 2, 8 Suppose -308c3 + 4755c*2 - 316 + 173 + 155 - 846c*3 - 34c*3 - 4764c = 0. What is c? 1/396, 2 Suppose -3824x + 11153 + 9704 = 5561. Determine b, given that -3/2b*x - 102b - 60 - 63b2 - 33/2b*3 = 0. -5, -2 Let g be 24/1620/3. Determine y, given that 11y3 + 305y + 9y3 - 309y + 2y4 - 12y*2 - 16y*5 + gy*4 = 0. -1, -1/4, 0, 1 Suppose 10o = 59 + 161. Factor -4u + 0u*3 - 9u*4 - 2u*3 + ou + 18u2 + 7u*4. -2u(u - 3)(u + 1)(u + 3) Let w = -59 - -81. Let o = w - 15. Determine v, given that 4 - v2 - 7 - 1 + o - 2v = 0. -3, 1 Let p(f) be the first derivative of f*5 + 315f*4/4 + 910f*3/3 + 300f2 - 3792. Suppose p(s) = 0. Calculate s. -60, -2, -1, 0 Let v(j) be the second derivative of j5/120 - 5j4/8 + 75j*3/4 + 33j*2/2 - 57j. Let y(o) be the first derivative of v(o). Solve y(b) = 0. 15 Let r be 1/(59328/59382 + 2/(-2)). Let x = r + 1100. Factor xy2 - 2/3y + 0. y(y - 2)/3 Factor 158d - 2534 - 2d2 - 4224 + 58d + 632 + 294. -2(d - 54)2 Let u be (-10)/(-140) + (2/9(-702)/312)/(-1). Factor 184/7 + ud2 - 188/7d. 4(d - 46)(d - 1)/7 Let b(d) be the second derivative of -d*7/21 - 41d*6/60 + 69d*5/20 - 67d*4/24 - 13d*3/6 - 211d + 1. Determine i so that b(i) = 0. -13, -1/4, 0, 1, 2 Let c(f) be the second derivative of 13 + 0f3 - 1/5f*5 - f + 0f*2 + 2/3f*4 - 4/15	{ "pile_set_name": "DM Mathematics" }
0 Calculate the remainder when 373 is divided by 18. 13 What is the remainder when 1799 is divided by 20? 19 What is the remainder when 248 is divided by 17? 10 What is the remainder when 202 is divided by 179? 23 What is the remainder when 146 is divided by 39? 29 What is the remainder when 1975 is divided by 220? 215 Calculate the remainder when 653 is divided by 85. 58 What is the remainder when 485 is divided by 61? 58 What is the remainder when 341 is divided by 95? 56 What is the remainder when 124 is divided by 17? 5 Calculate the remainder when 774 is divided by 52. 46 Calculate the remainder when 3195 is divided by 41. 38 Calculate the remainder when 244 is divided by 26. 10 Calculate the remainder when 65 is divided by 58. 7 What is the remainder when 2015 is divided by 498? 23 Calculate the remainder when 778 is divided by 19. 18 Calculate the remainder when 45 is divided by 13. 6 What is the remainder when 10265 is divided by 28? 17 What is the remainder when 2850 is divided by 124? 122 Calculate the remainder when 202 is divided by 11. 4 What is the remainder when 880 is divided by 52? 48 What is the remainder when 96 is divided by 81? 15 What is the remainder when 240 is divided by 62? 54 What is the remainder when 199 is divided by 28? 3 What is the remainder when 343 is divided by 316? 27 Calculate the remainder when 670 is divided by 200. 70 What is the remainder when 275 is divided by 136? 3 What is the remainder when 1104 is divided by 13? 12 Calculate the remainder when 1083 is divided by 25. 8 What is the remainder when 92 is divided by 6? 2 Calculate the remainder when 211 is divided by 44. 35 Calculate the remainder when 6044 is divided by 3020. 4 What is the remainder when 127 is divided by 2? 1 Calculate the remainder when 678 is divided by 224. 6 Calculate the remainder when 170 is divided by 33. 5 Calculate the remainder when 2141 is divided by 89. 5 What is the remainder when 21 is divided by 11? 10 Calculate the remainder when 139 is divided by 35. 34 What is the remainder when 143 is divided by 51? 41 What is the remainder when 154 is divided by 26? 24 What is the remainder when 4122 is divided by 75? 72 What is the remainder when 248 is divided by 25? 23 Calculate the remainder when 2244 is divided by 107. 104 Calculate the remainder when 872 is divided by 160. 72 What is the remainder when 106 is divided by 27? 25 Calculate the remainder when 43 is divided by 11. 10 What is the remainder when 719 is divided by 183? 170 Calculate the remainder when 130 is divided by 35. 25 What is the remainder when 448 is divided by 48? 16 What is the remainder when 1600 is divided by 134? 126 Calculate the remainder when 244 is divided by 86. 72 Calculate the remainder when 491 is divided by 7. 1 What is the remainder when 142 is divided by 24? 22 What is the remainder when 2346 is divided by 3? 0 Calculate the remainder when 287 is divided by 37. 28 Calculate the remainder when 14682 is divided by 15. 12 What is the remainder when 94 is divided by 26? 16 What is the remainder when 178 is divided by 20? 18 What is the remainder when 204 is divided by 54? 42 Calculate the remainder when 448 is divided by 18. 16 Calculate the remainder when 146 is divided by 63. 20 Calculate the remainder when 3683 is divided by 1224. 11 What is the remainder when 89 is divided by 18? 17 What is the remainder when 2718 is divided by 95? 58 Calculate the remainder when 87 is divided by 6. 3 What is the remainder when 1375 is divided by 106? 103 Calculate the remainder when 812 is divided by 47. 13 Calculate the remainder when 4530 is divided by 13. 6 What is the remainder when 48 is divided by 27? 21 What is the remainder when 2735 is divided by 144? 143 Calculate the remainder when 558 is divided by 272. 14 Calculate the remainder when 2665 is divided by 107. 97 Calculate the remainder when 95 is divided by 26. 17 Calculate the remainder when 1888 is divided by 133. 26 Calculate the remainder when 5775 is divided by 76. 75 Calculate the remainder when 37061 is divided by 8. 5 Calculate the remainder when 466 is divided by 28. 18 What is the remainder when 606 is divided by 16? 14 What is the remainder when 478 is divided by 72? 46 What is the remainder when 1369 is divided by 7? 4 Calculate the remainder when 173 is divided by 19. 2 What is the remainder when 286 is divided by 62? 38 Calculate the remainder when 396 is divided by 28. 4 What is the remainder when 169 is divided by 25? 19 Calculate the remainder when 262 is divided by 22. 20 Calculate the remainder when 53170 is divided by 28. 26 What is the remainder when 5963 is divided by 213? 212 Calculate the remainder when 467 is divided by 41. 16 Calculate the remainder when 364 is divided by 195. 169 What is the remainder when 143 is divided by 37? 32 What is the remainder when 177 is divided by 26? 21 Calculate the remainder when 153 is divided by 41. 30 Calculate the remainder when 1040 is divided by 61. 3 What is the remainder when 337 is divided by 43? 36 What is the remainder when 315 is divided by 289? 26 Calculate the remainder when 1313 is divided by 142. 35 Calculate the remainder when 20 is divided by 7. 6 Calculate the remainder when 3660 is divided by 111. 108 What is the remainder when 54 is divided by 41? 13 What is the remainder when 1170 is divided by 69? 66 What is the remainder when 120 is divided by 63? 57 What is the remainder when 174 is divided by 22? 20 What is the remainder when 88 is divided by 10? 8 What is the remainder when 810 is divided by 89? 9 What is the remainder when 210 is divided by 41? 5 What is the remainder when 706 is divided by 22? 2 Calculate the remainder when 384 is divided by 17. 10 Calculate the remainder when 11 is divided by 5. 1 What is the remainder when 4437 is divided by 148? 145 What is the remainder when 1334 is divided by 167? 165 Calculate the remainder when 9318 is divided by 1035. 3 What is the remainder when 57 is divided by 12? 9 Calculate the remainder when 11 is divided by 2. 1 Calculate the remainder when 381 is divided by 7. 3 Calculate the remainder when 81 is divided by 22. 15 Calculate the remainder when 1124 is divided by 35. 4 Calculate the remainder when 1471 is divided by 64. 63 Calculate the remainder when 4278 is divided by 34. 28 Calculate the remainder when 8001 is divided by 23. 20 What is the remainder when 281 is divided by 60? 41 What is the remainder when 1083 is divided by 121? 115 Calculate the remainder when 128 is divided by 43. 42 Calculate the remainder when 567 is divided by 140. 7 Calculate the remainder when 367 is divided by 62. 57 What is the remainder when 10077 is divided by 32? 29 What is the remainder when 1198 is divided by 118? 18 Calculate the remainder when 1047 is divided by 200. 47 Calculate the remainder when 780 is divided by 27. 24 What is the remainder when 2671 is divided by 19? 11 Calculate the remainder when 38 is divided by 15. 8 What is the remainder when 3448 is divided by 1147? 7 Calculate the remainder when 8 is divided by 2. 0 Calculate the remainder when 2702 is divided by 383. 21 What is the remainder when 2315 is divided by 61? 58 What is the remainder when 33395 is divided by 253? 252 Calculate the remainder when 2573 is divided by 16. 13 What is the remainder when 1129 is divided by 162? 157 What is the remainder when 366 is divided by 45? 6 Calculate the remainder when 428 is divided by 31. 25 What is the remainder when 306 is divided by 11? 9 What is the remainder when 87 is divided by 48? 39 Calculate the remainder when 96 is divided by 17. 11 What is the remainder when 42 is divided by 22? 20 What is the remainder when 194 is divided by 98? 96 What is the remainder when 5596 is divided by 22? 8 What is the remainder when 246 is divided by 72? 30 What is the remainder when 673 is divided by 20? 13 What is the remainder when 293 is divided by 99? 95 Calculate the remainder when 462 is divided by 94. 86 What is the remainder when 637 is divided by 81? 70 Calculate the remainder when 3204 is divided by 7. 5 What is the remainder when 46 is divided by 10? 6 What is the remainder when 229 is divided by 40? 29 Calculate the remainder when 113 is divided by 38. 37 What is	{ "pile_set_name": "DM Mathematics" }
Solve 3531 - 498 = -1044d - 1143 for d. -4 Solve 4x = -16x + 15 + 105 for x. 6 Solve 58l - 380 = 20l for l. 10 Solve 0 = 27k + 185404 - 186160 for k. 28 Solve 425x = 405x + 400 for x. 20 Solve 2u + 12u + 0u = 154 for u. 11 Solve 0 = 9j - 39j + 19j + 187 for j. 17 Solve -634p = -580p + 378 for p. -7 Solve 60i + 101 - 81 = 980 for i. 16 Solve -71q + 74 = -95q - 166 for q. -10 Solve -13y - 59y = 53y - 1500 for y. 12 Solve 7277w = 7238w + 390 for w. 10 Solve 793 = -4a + 809 for a. 4 Solve 10r + 61 - 153 = 88 for r. 18 Solve 37y - 1235 + 1605 = 0 for y. -10 Solve -446d - 4220 = 3362 for d. -17 Solve 12b + 229b = 29b + 2968 for b. 14 Solve 467136m - 467192m = 1736 for m. -31 Solve 9g + 11g + 319 = 479 for g. 8 Solve 5u + 1008 = -18u + 86u for u. 16 Solve -q - 313 + 326 = -2q for q. -13 Solve 384l + 261l = 99l + 11466 for l. 21 Solve 0 = -36d + 16d for d. 0 Solve 0 = -93a + 130a + 102a + 5143 for a. -37 Solve 1000 = -221y - 1431 - 884 for y. -15 Solve -608 = 363w - 179w - 152w for w. -19 Solve 30u = 157 + 274 + 79 for u. 17 Solve -430 = 35f - 323 + 418 for f. -15 Solve -92 + 172 = 20v for v. 4 Solve -41154 + 20858 + 20575 = -31r for r. -9 Solve -36w - 11837 = -11801 for w. -1 Solve 255u - 15 + 7410 = 0 for u. -29 Solve -38r = 38 + 62 - 24 for r. -2 Solve 27 = -410d + 419d for d. 3 Solve -21p - 66p + 40p - 564 = 0 for p. -12 Solve 42c + 54c - 1052 = 1060 for c. 22 Solve -251u - 120 = -622 for u. 2 Solve -26n + 20 + 85 = -5n for n. 5 Solve 161j = 159j + 26 for j. 13 Solve -162u = -28u + 5u - 1807 for u. 13 Solve 46y + 311 + 229 + 12 = 0 for y. -12 Solve k + 13k - 11k + 12 = 0 for k. -4 Solve 52g - 211 = -3 for g. 4 Solve -72 - 152 = -81v - 62 for v. 2 Solve -1007m = -997m - 150 for m. 15 Solve -12h + h = 5h + 208 for h. -13 Solve 172b - 1146 + 6134 = 0 for b. -29 Solve -9199 = 487d + 1028 for d. -21 Solve -625 = -26f + 129 for f. 29 Solve 0 = 502r - 5285 + 1771 for r. 7 Solve -444a + 411a - 297 = 0 for a. -9 Solve q + 4 - 13 = -4 for q. 5 Solve -46j + 107j - 854 = 0 for j. 14 Solve 0 = -75l + 159l + 88l - 1548 for l. 9 Solve -1648d = -1439d + 4389 for d. -21 Solve 36o = -83o - 40 - 79 for o. -1 Solve -6913p + 6474p = -9219 for p. 21 Solve -2194o + 42 = -2215o for o. -2 Solve 38963y = 38961y + 26 for y. 13 Solve 534 = 49s + 338 for s. 4 Solve -162 = -30v - 102 for v. 2 Solve -63b + 45b - 198 = 0 for b. -11 Solve -3z + 7 - 3 = 1 for z. 1 Solve 624 - 399 = -15i for i. -15 Solve -28u + 27u = 124u + 875 for u. -7 Solve -329g + 389g = -838 - 722 for g. -26 Solve -22p = 522p + 227p for p. 0 Solve -628 - 315 = 74s - 203 for s. -10 Solve 13r - 6r = 15r - 40 for r. 5 Solve 0 = -126689o + 126695o + 102 for o. -17 Solve 620 = 164l - 435l + 9563 for l. 33 Solve 229k + 840 = 395 - 471 for k. -4 Solve -45 = 591f - 588f for f. -15 Solve -344 + 68 = -46d for d. 6 Solve -73x - 67739 + 65841 = 0 for x. -26 Solve -267m - 5446 + 1174 = 0 for m. -16 Solve 102y - 436 - 568 + 596 = 0 for y. 4 Solve -4c - 280 = -50c + 18c for c. 10 Solve 346 + 2678 = -189f for f. -16 Solve 318j + 282 = -36 for j. -1 Solve 98l = 372l for l. 0 Solve -2493 + 2559 = 33c for c. 2 Solve -30o = 55 + 44 + 111 for o. -7 Solve 3111 = 19y + 3377 for y. -14 Solve -468k = -473k + 35 for k. 7 Solve -68a - 287 = 121 for a. -6 Solve 1073g = 13986 + 12839 for g. 25 Solve 40851 = 1118b + 10665 for b. 27 Solve 0 = -299q + 313q - 14 for q. 1 Solve 0y + 2669 = -157y for y. -17 Solve -164 - 117 = -19h - 72 for h. 11 Solve 152w + 33757 - 28893 = 0 for w. -32 Solve -72g - 781 = 72g + 659 for g. -10 Solve 377z = 742z - 306z + 2006 for z. -34 Solve 0 = -262t + 261t - 4 for t. -4 Solve -5q + 180q = 0 for q. 0 Solve -60a + 17850 = 371a + 759a for a. 15 Solve 931 = 156p - 5 for p. 6 Solve -81r - 28 = 77r - 165r for r. 4 Solve -1158n - 1545 = 28563 for n. -26 Solve 0 = -15b - 235 + 340 for b. 7 Solve -119u = 13u + 396 for u. -3 Solve 411x + 129x = 5940 for x. 11 Solve -599w + 6270 = -7507 for w. 23 Solve 354 = -21p + 60p + 20p for p. 6 Solve -44a - 31a - 1410 = 19a for a. -15 Solve 0 = 289x - 2345x - 8224 for x. -4 Solve 481 = -630l - 7480 - 2749 for l. -17 Solve 28y - 664 + 132 = 0 for y. 19 Solve -68k = -43 + 519 for k. -7 Solve 0 = -29i - 157894 + 157227 for i. -23 Solve -33m = -8m - 300 for m. 12 Solve 169w + 9w - 2233 = -25w for w. 11 Solve -974t - 24480 = -209t for t. -32 Solve -14236l + 14172l = 1088 for l. -17 Solve 23c + 1865 = 1658 for c. -9 Solve -1648 = 37a - 140a for a. 16 Solve 11m - 352 = -9m - 12m for m. 11 Solve 19d - 162 = -20 + 86 for d. 12 Solve 8n = -136n - 288 for n. -2 Solve 75 + 9 = -5s - 7s for s. -7 Solve -72 = 6l + 3l for l. -8 Solve -3122n + 3131n - 218 + 29 = 0 for n. 21 Solve -19c = -19c - 12c + 144 for c. 12 Solve 27z = 16z - 99 for z. -9 Solve 230v + 41 + 4329 = 0 for v. -19 Solve q + q = -23q - 400 for q. -16 Solve 0 = 538y - 530y + 176 for y. -22 Solve -546z = -902z + 450z - 1410 for z. 15 Solve -7w = -73 + 25 - 71 for w. 17 Solve -77i + 33708 = 32476 for i. 16 Solve g + 9g = -3g - 143 for g. -11 Solve -6o = 20 - 116 for o. 16 Solve 4r - 2583 = -2547 for r. 9 Solve -59r - 6r + 0r + 455 = 0 for r. 7 Solve -22l = -25l + 27 for l. 9 Solve -8p - 205816 + 205792 = 0 for p. -3 Solve -4693s = -4688s + 80 for s. -16 Solve -1214 = 4d - 1270 for d. 14 Solve 14833 = 364k + 6461 for k. 23 Solve 2556 = -10699p + 10841p for p. 18 Solve -4515 = 6f - 4533 for f. 3 Solve 21n = -96907 + 96487 for n. -20 Solve -1116l - 20240 = -3646l for l. 8 Solve -121r + 60 = -263r + 132r for r. -6 Solve 9d - 145 = -21d + d for d. 5 Solve -53h - 48h - 72 = -99h for h. -36 Solve 11d + 644 - 523 = 0 for d. -11 Solve -3520 = 119n - 559n for n. 8 Solve -25k + 0 = -169k + 288 for k. 2 Solve 1227 = 10b - 100b - 213 for b. -16 Solve -m = 6123 - 6112 for m. -11 Solve -70v + 142 + 418 = 0 for v. 8 Solve 13p + 17p = 47329 - 47179 for p. 5 Solve -26b + 98b - 504 = 0 for b. 7 Solve 125r = -879r - 14056 for r. -14 Solve -18u + 5036 = 9u + 4523 for u. 19 Solve 27l - 22l + 27l = 480 for l. 15 Solve -s + 20 + 26 - 56 = 0 for s. -10 Solve 130w = 210w - 141w - 1159 for w. -19 Solve 20a - 396 = -71a + 514 for a. 10 Solve 2169 - 153 = 109j - 25j for j. 24 Solve 29354d = 29275d + 869 for d. 11 Solve 1108 = 185o - 557 for o. 9 Solve -90 = -28y + 19y for y. 10 Solve 0 = 81w - 89w - 35w - 1591 for w. -37 Solve 0 = -13793c + 13742c - 306 for c. -6 Solve -800 = 112i + 1894 - 454 for i. -20 Solve -39b + 282 = -147 for b. 11 Solve m + 321 = -5m + 357 for m. 6 Solve 0 = -215b + 227b + 132 for b. -11 Solve 1453j + 462 = 1432j for j. -22 Solve 0 = -13b + 14b - 26b + 875 for b. 35 Solve 334l = -469l - 12848 for l. -16 Solve -288u - 1022 = -3326 for u. 8 Solve 735 - 177 = -18b - 44b for b. -9 Solve -3869j + 3837j = 416 for j. -13 Solve 172j + 65j + 2464 = 13j for j. -11 Solve 119l + 447 + 1219 = 0 for l. -14 Solve -282n - 2088 = -50n for n. -9 Solve 11j - 14j + 266 = -22j for j. -14 Solve -13588n = -13580n + 24 for n. -3 Solve 15g + 670 - 130 = -12g for g. -20 Solve 318 - 324 = -s for s. 6 Solve -8435 + 8397 = 38b for b. -1 Solve 0 = -30204t + 30165t + 819 for t. 21 Solve 227n - 56 = 255n for n. -2 Solve -18z - 8614 + 9298 = 0 for z. 38 Solve -267t = 266t for t. 0 Solve 0 = 25o + 3277 - 2902 for o. -15 Solve -13h - 29h = 72h + 61h for h. 0 Solve -675q - 1781 - 11719 = 0 for q. -20 Solve -681d + 1361d = 689d + 72 for d. -8 Solve 79i + 201i = -167i + 5364 for i. 12 Solve -95x - 99x + 184x + 230 = 0 for x. 23 Solve 950 + 175 = -75d for d. -15 Solve -39d + 385 - 73 = 0 for d. 8 Solve -679x + 4848 = -1285x for x. -8 Solve -49h - 44 = -94 - 97 for h. 3 Solve 19m - 60m + 410 = -246 for m. 16 Solve -2h + 342 - 1052 = 69h for h. -10 Solve -1256h + 1265h = -225 for h. -25 Solve 0 = -233936a + 233963a - 945 for a. 35 Solve 37583t = 37597t - 154 for t. 11 Solve 240u - 228 + 3348 = 0 for u. -13 Solve -63582 = -139x - 62053 for x. 11 Solve -471 = 27a + 285 for a. -28 Solve 0 = 3y + 19*y + 183 + 59 for y. -11	{ "pile_set_name": "DM Mathematics" }
d h. 4 Let w be -12((6/(-9))/(-2) + -1). What is the highest common factor of w and 4? 4 Let r be (-2)/(-1) - (-9)/(-9). Let z be 19/3 - r/3. What is the highest common factor of 3 and z? 3 Suppose 3p = 0, -2w + 9 + 3 = -p. Suppose -2q + 1098 = -2m, -554 = -3q + 2q - 4m. Suppose c + q = wc. What is the greatest common divisor of c and 10? 10 Let j be (825/(-20))/((-6)/16). What is the highest common factor of 22 and j? 22 Let k be ((-7)/(-2))/((-2)/4). Let m = 5 - k. Let h be (-77)/2(-72)/21. What is the highest common factor of m and h? 12 Let t = 22 - 20. Calculate the greatest common divisor of 14 and t. 2 Let v(q) = q*2 + 14q - 13. Let y be v(-15). Suppose -yn + 159 = m - n, 0 = -2m + 2n + 322. Calculate the highest common factor of m and 64. 32 Let k = 11 + -8. Let q(l) = l2 - l - 1. Let p be q(k). Suppose -px = -328 - 277. Calculate the highest common factor of x and 11. 11 Let q = 67 + -27. What is the greatest common factor of q and 100? 20 Let a = -8 + 13. Calculate the highest common divisor of a and 15. 5 Suppose 0 = -u + 3, -4c - 4u = u - 95. What is the greatest common factor of c and 30? 10 Let j(d) = 2d2 - 3d - 1. Let m be j(2). Let o be 38m/(-2)-1. What is the highest common divisor of 38 and o? 19 Let b be (-4)/((-16)/(-6))2. Let i = 0 - b. Suppose 0 = -o + 4o - 18. Calculate the highest common divisor of i and o. 3 Let j(a) = -2a3 + 2a + 1. Let d be j(-1). Calculate the greatest common factor of 8 and d. 1 Let g(n) = 11n2 + 3n. Let a be g(3). Let q = 11 + -10. Let z be (-98)/(-8) + q/(-4). Calculate the greatest common divisor of a and z. 12 Suppose 5z = 3g - 5g + 35, g + 4z = 22. Let a(l) = 2l2 + 11l. Let q be a(-10). Calculate the greatest common divisor of q and g. 10 Let t(h) = 16h + 17. Let c be t(4). Calculate the greatest common divisor of c and 9. 9 Let y be (5/(-2))/(1/(-2)). Suppose -5n = -yf + 8 - 28, 12 = -3f. Let l = n - -11. Calculate the highest common factor of 99 and l. 11 Suppose 0 = k - 3k + 4b + 30, 2b = -3k + 77. Suppose 0m + 4y - 203 = -m, 0 = -m + 5y + 212. Calculate the greatest common factor of k and m. 23 Let u = -83 + 119. Calculate the highest common divisor of 9 and u. 9 Let w = 1 - -1. Suppose -5d + i = -3d - 305, wd - 310 = -4i. What is the highest common divisor of 17 and d? 17 Let b(z) = z - 8. Let l be b(10). Let c be 3 + (1 - 1)/l. What is the greatest common factor of c and 24? 3 Let y = -278 - -524. Calculate the greatest common factor of y and 41. 41 Suppose -3i - 4m = -7, i - 2m = 2i - 5. Let p be i(-1 - (-22)/(-3)). What is the greatest common factor of p and 5? 5 Let k be (-10)/(-3)18/15. Let w be 270/14 + k/(-14). What is the greatest common factor of 95 and w? 19 Suppose 4b - 3b - 42 = 2n, 3b - 3n = 117. Let u be (-2)/6 + 56/6. What is the highest common factor of u and b? 9 Let r(c) be the third derivative of c5/30 - c4/12 - 2c3/3 + c2. Let k be r(3). What is the greatest common factor of k and 12? 4 Suppose x = 10x - 432. Calculate the highest common factor of 32 and x. 16 Let x(w) = w*3 + 7w*2 + 7w + 7. Let o be x(-6). Let v = 1 - -1. Let u be (3/v + -2)-2. What is the greatest common factor of u and o? 1 Let j = 2 + -1. Let y = 0 + j. Let d be (0 + y - -3) + -1. What is the greatest common divisor of d and 24? 3 Let d(c) = 17c3 - c2 - c + 1. Let h be d(-1). Let w be h/10(-210)/12. Calculate the highest common factor of 14 and w. 14 Suppose m - 10 + 61 = 0. Let g = m - -142. What is the greatest common divisor of g and 13? 13 Let o(c) = c3 - 3c*2 + 2c - 2. Suppose -2 = h - 2h. Let t be o(h). Let w be t - (2 - (-2 - -8)). What is the greatest common factor of w and 16? 2 Suppose -5w + 5 = -20. Let n = 1 + -3. Let v = n + 7. Calculate the greatest common factor of w and v. 5 Suppose 0 = -m - 0m + 23. Calculate the highest common factor of 23 and m. 23 Let l = -4 + 4. Let h(b) = -b2 - b + 7. Let r be h(l). Suppose 4g = 50 + 6. What is the greatest common divisor of r and g? 7 Suppose -70 = -2t - 2n - 0n, 3t - 105 = 5n. Let k = t - 21. Suppose 3z - 16 = 5. Calculate the highest common divisor of k and z. 7 Let o be ((-6)/12)/(1/(-264)). What is the highest common factor of o and 12? 12 Let o(f) = -f*2 - f + 18. Let b be o(0). Calculate the highest common factor of 198 and b. 18 Suppose -6g = -2g - 20. Suppose 0z = -5c - 3z + 41, -c = -gz - 25. Let u = 30 - c. Calculate the highest common divisor of u and 2. 2 Let u(a) be the third derivative of a4/24 - 5a*3/6 + 4a*2. Let r be u(8). Suppose -o = -5 + r. Calculate the highest common factor of 6 and o. 2 Let k = 167 + -104. Let l = 8 + 1. What is the highest common divisor of l and k? 9 Let p = -28 + 28. Suppose -d - 60 = -2d - 3j, p = 3j + 3. Suppose -52 = -5n + 53. What is the highest common factor of n and d? 21 Suppose 54 = 3t + 3v, -t + 3v - 6v = -24. Calculate the highest common factor of 25 and t. 5 Let d be (-6)/(-4)(-12)/(-9). Suppose -dc + 136 = 3p, 0 = -4p + 8p + 4c - 176. Suppose 6 = 4j - 18. What is the greatest common factor of p and j? 6 Let i be 0 - 2 - (3 - 15). Suppose 4m + 10 + i = n, 0 = -n + 3m + 18. What is the greatest common factor of 12 and n? 12 Suppose -9x = -32 - 22. What is the highest common divisor of 66 and x? 6 Let a be -2 + (2 - -1)-1. Let t be a(24/(-5) + -2). Suppose 0j + 5j - 425 = 0. What is the highest common divisor of j and t? 17 Suppose -71 + 8 = -5z + 4g, 0 = z - 4g - 19. Calculate the greatest common divisor of 33 and z. 11 Suppose 3o = -4c - 111, 0 = -c + 3o - 3 - 21. Let n = c - -43. Let i = n - 6. What is the greatest common factor of i and 5? 5 Let v be -2((-8)/16)/(2/84). What is the greatest common divisor of v and 6? 6 Let o be ((-8)/6)/((-1)/36). Let w = -4 - -10. Let a be (-220)/(-14) + w/21. What is the highest common factor of o and a? 16 Let a = 7 + 5. Let c be -5(0 + (-6)/5). Calculate the greatest common divisor of c and a. 6 Suppose -u + 396 = u. Let a = 53 - -3. Let v = a - 38. What is the greatest common factor of u and v? 18 Let w = 20 + -11. Suppose 2b - 5 = -y + 16, -12 = -4y. Let l(x) = 3x - 9. Let z be l(b). Calculate the greatest common factor of w and z. 9 Let o(k) = 5 + 2 - 4k2 + 2k*3 - 5k2 - k3. Let i be o(9). Calculate the greatest common factor of 7 and i. 7 Let l(j) = -j*3 + 3j*2 + 6j - 2. Let n be l(-3). What is the highest common factor of n and 85? 17 Let h be (14 + 1)/(2 + -1). Suppose 0 = -5w + h + 35. Calculate the greatest common factor of w and 2. 2 Suppose -4d + 8 = -0d. Let h(c) = c3 + 5c*2 + 2c. Let k be h(-2). Calculate the greatest common divisor of d and k. 2 Let v = -1 + 9. Let z(k) = -k*2 - 7k - 5. Let q be z(-7). Let p(n) = -6n + 2. Let g be p(q). Calculate the greatest common factor of g and v. 8 Let g(k) = 8k*3 + 4k*2 - 3k + 1. Let w be g(2). Suppose 4u = -2u + 180. What is the highest common factor of w and u? 15 Let o = 0 - -3. Suppose 3w - 2 = w + 4u, ow + 5u - 58 = 0. What is the highest common divisor of 55 and w? 11 Let n = 111 - 71. Let v(p) = 0p2 + p3 + 0p*3 + 4 + 5p - 6p2 + p2. Let y be v(4). What is the greatest common divisor of n and y? 8 Suppose 3a - 28 = a. Let g be 44((-76)/(-24) + 4/12). Calculate the highest common factor of a and g. 14 Suppose 0 = -25n + 30n - 240. What is the greatest common divisor of n and 32? 16 Let h(b) = -b - 5. Let l be h(-19). Calculate the highest common factor of l and 42. 14 Let a = -20 - -68. Let o(n) = -n3 - 4n*2 + 8n. Let f be o(-6). What is the highest common divisor of f and a? 24 Let l be -2 + (-744)/(-4) + 0. What is the greatest common factor of 23 and l? 23 Let o(i) = -i*3 - 2i*2 + 10i + 6. Let m be o(-7). Let p = -82 + m. What is the greatest common factor of 9 and p? 9 Let y = 15 + -11. Let p be ((-80)/(-50))/(y/30). Calculate the highest common divisor of p and 60. 12 Suppose d + 31 = 2o, 3d + 3 = 6d. Suppose 0 = b - 3j - 11, -4b - 3j + 29 = -0b. What is the highest common factor of b and o? 8 Let o(a) = 16a - 3a + a. Let j be o(2). Suppose x = -2x + 12. Calculate the highest common factor of j and x. 4 Suppose -64 = -v - v. Let f = 70 - v. Let t be 2/7 + 4367/77.	{ "pile_set_name": "DM Mathematics" }
21 Collect the terms in 6216f3 + 6211f*3 - 24733f*3 + 6270f*3 + 6222f*3. 186f3 Collect the terms in -59 - w2 + 2w3 + w2 + 260w + 0w2. 2w*3 + 260w - 59 Collect the terms in 421 + 144g - 301 - 148g. -4g + 120 Collect the terms in 19 - 486838526s + 486838526s - 3s*2 - 19. -3s*2 Collect the terms in 175s*3 - 366s*3 - 423s*3 + 841 - 841. -614s*3 Collect the terms in -17430y*2 + 166 + 17442y*2 - 13y + 13y. 12y*2 + 166 Collect the terms in -299066x*3 - 27478x*3 - 560662x*3 - 104555x*3. -991761x*3 Collect the terms in -17161k + 580 + 8560k + 8603k. 2k + 580 Collect the terms in -2310 - 142 - 11p - 7457. -11p - 9909 Collect the terms in -11h - 149h2 + 2h - 17h + 5h + 151h2. 2h*2 - 21h Collect the terms in -202606 - v - 202618 - 10v3 + 405219. -10v*3 - v - 5 Collect the terms in 8914c + 8204c - 17104c. 14c Collect the terms in -3089025c - 3088891c + 6177746c. -170c Collect the terms in 760 - r + 4r - 762 + 755r2 + 1767r*2. 2522r*2 + 3r - 2 Collect the terms in 2131l - 3l*2 - 2131l + 903. -3l2 + 903 Collect the terms in 341b*2 + 283b*2 + 163b*2 + 227b*2 - 8b*2. 1006b*2 Collect the terms in 74375d*2 + 1 - 74375d*2 + 86d*3 - 388d*3 - 115d*3. -417d*3 + 1 Collect the terms in -8981194 - 21624y*3 + 8981194. -21624y*3 Collect the terms in -64 - 20065y + 40140y + 64 - 20076y. -y Collect the terms in 55q + 37q + 42q + 59q + 54q - 283q. -36q Collect the terms in -49876f + 17785f - 119738f - 70308f. -222137f Collect the terms in 35f + 253f + 45f + 32f - 394f. -29f Collect the terms in -3 - 16 - 10 - 12 + 1330k. 1330k - 41 Collect the terms in 189 + 191 + 202v - 380 + 796v*2 - 202v. 796v2 Collect the terms in 2f*3 - 72f*3 + 25f*3 - 5f*2 - 32f. -45f3 - 5f*2 - 32f Collect the terms in 10116412q + 2q*3 - 10116412q + 2q3. 4q*3 Collect the terms in 6127 - 13016 + 6889 - 3a + 11a. 8a Collect the terms in 3018972172d - 3018972172d + 200d2. 200d*2 Collect the terms in -2148f + 1118f + 1028f - 21f2. -21f*2 - 2f Collect the terms in -2366r2 + 21033r*2 + 9788r*2. 28455r*2 Collect the terms in 49a - 7a - 262 + 127 + 133. 42a - 2 Collect the terms in 3613 - 3092 - 521 + 17i2. 17i*2 Collect the terms in -49453q*2 + 24724q*2 - 25q*3 + 24729q*2 + 10q*3. -15q*3 Collect the terms in -412930l*3 - 413284l*3 + 826213l3. -l3 Collect the terms in 1686j2 - 216j*2 + 1028j*2 - 326j*2. 2172j*2 Collect the terms in -961s*3 + 529s*3 + 434s*3. 2s*3 Collect the terms in -1031l*2 - 92800729l + 92800729l. -1031l*2 Collect the terms in 4921a*2 - 18 + 0 + 4982a*2 - 3554a*2 - 1. 6349a*2 - 19 Collect the terms in 9853w - 2069 - 2079 + 4148. 9853w Collect the terms in 244968053553k + 17k2 - 244968053553k. 17k2 Collect the terms in -143o*3 - 44o*3 + 53o*3 + 93o*3. -41o*3 Collect the terms in 177089z*2 + 1526 - 177198z*2 - 760 - 766. -109z*2 Collect the terms in 74 - 34 - 96 - 115 - 12p - 10p. -22p - 171 Collect the terms in -5m + 3 + 29m*3 + 10m*2 + 0m*2 + 0m*2 + 38m*2 - 2m. 29m3 + 48m*2 - 7m + 3 Collect the terms in 243m + 6 + 2m + 99m + 329m - 7. 673m - 1 Collect the terms in 90h*2 + 42631h - 85253h + 141h*2 + 0h*2 + 42622h. 231h2 Collect the terms in 2430t*2 - 52t*2 + 2881t*2. 5259t*2 Collect the terms in -10904j - 192j2 - 198j*2 + 10902j - 194j2 - 193j*2 - 197j*2 + 972j*2. -2j*2 - 2j Collect the terms in 15u2 - 6u*2 - 3033664 + 3033664. 9u*2 Collect the terms in 2d*2 + 2 - 10d*2 + 2941d + 1168d + 9. -8d*2 + 4109d + 11 Collect the terms in -504y2 - 2y - 371y2 + 324y*2 + 2y. -551y2 Collect the terms in -20z*3 + 7z - 33967 - 33982 - 7z - 33986 + 101935. -20z*3 Collect the terms in -7602 - 7588 - 289t + 140t + 22765 + 145t - 7575. -4t Collect the terms in 165 - 49 - 52 - 38 + q. q + 26 Collect the terms in 7v*2 + 6071109856v - 6071109856v. 7v*2 Collect the terms in 1993 + 1347m*3 - 1993. 1347m*3 Collect the terms in -24d*2 + 17d + d*3 - 29d + 24d - 19. d3 - 24d*2 + 12d - 19 Collect the terms in 555 - 5p2 + 371p*3 - 495 + 3p*2 + 2p*2. 371p*3 + 60 Collect the terms in -2d*2 - 68829 - 2d + 2d - 68837 + 137666. -2d*2 Collect the terms in -308 - 17y*3 + 55 + 55 + 62 + 57 + 79. -17y*3 Collect the terms in 6g*3 + 1704 + 142g - 295g + 151g. 6g3 - 2g + 1704 Collect the terms in -27 + 15 - j*3 + 15j*3 - 12j*3 + 12 - 163j*2. 2j*3 - 163j*2 Collect the terms in -5 + 1445640g + 5. 1445640g Collect the terms in 74664a - 4479 + 4479 - 36316a + 33732a. 72080a Collect the terms in -1711 - 1702 + 3413 - 15367w*3. -15367w*3 Collect the terms in -2653b + 13303b - 2659b - 2681b - 2659b - 9b3 - 2651b. -9b3 Collect the terms in -181083l*3 - 112630l*3 + 69562l*3 + 5744l*3. -218407l*3 Collect the terms in -91 + 1073q - 83 - 526q + 174 - 2q*2 - 547q. -2q2 Collect the terms in 13997v + 9061v - 108649v. -85591v Collect the terms in -452x*3 + 290x*3 + 24394x - 24394x + 312x*3. 150x*3 Collect the terms in 497u - 1063u + 177u + 180u + 194u. -15u Collect the terms in 32263 + v + 32260 + 32256 - 96779. v Collect the terms in -11c - 1880 - 10c + 19659 + 10c + 12c. c + 17779 Collect the terms in 9331 - 18759 + 9428 + 2575s - 9939s. -7364s Collect the terms in 3626955q2 - 7253918q*2 + 3626964q2. q2 Collect the terms in 5579k2 + 5580k*2 - 6 - 11181k*2 - 15k. -22k2 - 15k - 6 Collect the terms in -1316s2 - 1159s*2 - 698s*2 - 69s*2. -3242s*2 Collect the terms in -4z + 8z2 + 4z - 257335 + 514685 - 257350. 8z2 Collect the terms in -296342 + 296342 + 273c*3. 273c*3 Collect the terms in 135f*2 + 299f*2 + 44 - 159. 434f*2 - 115 Collect the terms in -85g - 67g - 11489 + 22987 - 11498. -152g Collect the terms in 1119924g - 1119926g + 70g3 - 16g*3. 54g*3 - 2g Collect the terms in -8429 + 2a + 2429a*3 + 8429 + 136a*3. 2565a*3 + 2a Collect the terms in -52g3 + 60732118g - 60732118g. -52g*3 Collect the terms in 11504i + 3129i + 30i. 14663i Collect the terms in 4 + 136441j*2 - 4 - 17564j*2. 118877j2 Collect the terms in -n2 + 25134n + 3n*2 - 8543n - 8046n - 4n*2 - 8545n. -2n2 Collect the terms in -63j + 19j + 16j + 23j + 105277280 - 105277280. -5j Collect the terms in 0 - 242h + 493h - 2 - 243h + 1 + 4. 8h + 3 Collect the terms in 89166278769 - 89166278769 + 49q. 49q Collect the terms in 1485737 - 1485737 - 3647x3. -3647x*3 Collect the terms in 369x + 43x - 273x*3 + 132x. -273x3 + 544x Collect the terms in 230r3 - 82r*3 - 77r*3 - 88r*3. -17r*3 Collect the terms in -36266 - 4507 + 47z*2 - 35z*2. 12z*2 - 40773 Collect the terms in -5779971 + 114z*3 - 105z*3 + 5779971. 9z*3 Collect the terms in -2310k*2 - 2261k*2 + 1859k*2. -2712k*2 Collect the terms in -2968x + 1941x + 1 + 16 - 3187x. -4214x + 17 Collect the terms in -3078y + 37y3 + 3080y - 4 - 16y3 + 0 + 4. 21y*3 + 2y Collect the terms in 715q - 1129q*2 - 3147q + 1139q2 - 1836q. 10q2 - 4268q Collect the terms in 2p + 317p - 74 - 70 + 144. 319p Collect the terms in 1 + 814345k*2 - 1 - 1628692k*2 + 814325k*2. -22k*2 Collect the terms in -1 + 3a*2 + 0 - 3489a + 3a2. 6a*2 - 3489a - 1 Collect the terms in 2 + 4 - 6 + 0 + 4828g - 3637g. 1191g Collect the terms in 64 - 363r*2 + 366r*2 - 209r*2. -206r*2 + 64 Collect the terms in 330z*2 + 328z*2 - 1322z*2 + 319z*2 + 324z*2 + 16. -21z*2 + 16 Collect the terms in -510501d*3 - 9d*2 + 255250d*3 - 10d*2 + 255249d*3 + 19d*2. -2d*3 Collect the terms in -13g*2 + 15g*2 - 5g*2 + 12g*2 - 12g*2 + 1 + 6. -3g*2 + 7 Collect the terms in 4c2 - c2 - c2 + c2 + 1464208. 3c2 + 1464208 Collect the terms in -409z*2 + 1433z*2 - 3z + 2 + 1687z2 + 1990z*2. 4701z*2 - 3z + 2 Collect the terms in 3636x3 - 1 + 11873x*3 - 605x*3 + 1. 14904x*3 Collect the terms in -17y + 3*y	{ "pile_set_name": "DM Mathematics" }
-3396)/(-27734))/(3(-16)/(-84)). 3/14 What is the value of ((-231)/(-6))/(-11)(-988)/1729? 2 813/260(-25)/832/(-1) 40 What is the value of 3/308(-910)/(-650)10? 3/22 What is the value of (132/42)/(((-8)/(-112)(-6)/3)/1)? -22 ((-69)/(-207)1/(-5))/(6/255) -17/6 Calculate ((-259)/(-148))/(35/(-50))4. -10 What is the value of 6/(-10)((-245)/14)/(-7)11644/(-123)? 142 What is the value of 7136/(-68)(-8)/(-48)3? -7 What is the value of ((-20)/(-8))/(1230/738)(-204)/54? -17/3 What is ((-4760)/71472/(-50))/((-6)/15)? -24 (-157)/(70336/384)(-14)/(-15) -4/5 Evaluate ((-8)/(-1))/(7/58835(-6)/10). -32 -190(-36)/4804(-3)/3 -57 What is (16/1240)/(180/1116)? 2/25 3/51(-225)/13559 -59 170/8((-1325)/3975)/(((-10)/6)/(-1)) -17/4 Evaluate ((-518)/(-740))/((-1309)/(-12342)). 33/5 What is (-2)/1(-1975)/25(-43)/86? -79 What is (10/775)/((-13)/3904)? -3/31 What is (-15)/(((-3)/(-1))/(7455/(-1775)))? 21 Evaluate ((-5888)/2760)/((-240)/945). 42/5 (4/65)/(118/(160480/(-408))) -8/39 725/(-3335)1-13(-18)/135 -2/23 ((-4)/12)/((-2400)/67505/2) 3/8 Calculate -104-4224/2016. 52 Evaluate 504/(-60)13065/(-158522)(-8)/(-6). 12/13 ((2/(-2))/3)/((-3222)/(-4833)2/332) -83 What is (136/31)/((-3)/(-10843/(-1032)))? -68 Evaluate ((-15)/((-960)/8))/(32/(-32)). -1/8 (324/(-324))/((-5)/(-10)) -2 Calculate (3(-126)/108)/(-477/440). 5 Calculate (227/(-908))/((2/(-23))/((-216)/(-27))). 23 What is the value of ((26/260)/(33/5))/(((-25)/5)/40)? -4/33 3/18(-57512)/(-5135)10/(-4) -14/3 Evaluate (18/(-3))/(21(-20)/(-168)3/(-10)). 8 What is ((-80)/(-100))/(-23(-10)/14950)? 52 Evaluate (((-93)/558)/(105/108))/((-2)/(-7)2). -3/10 What is ((-92)/138)/(4/10(-150)/630)-3? -21 What is the value of -35(196/70)/793/31? -42 Evaluate 3171/3020(450/(-280))/3(-16)/6. 3/2 Evaluate 6/((95/19)/251). 30 What is (8232/(-245))/421/1? -4/5 What is (194234/34047)/(8/(-78))? -13 What is ((-188)/(-141))/((-4736)/6216)? -7/4 What is the value of ((-1)/21)/((-1751)/(-17510))? -5 Calculate (-2)/(-7)21/112-8(-4732)/7605. 4/15 Calculate (-18)/(-20)(-24)/72(420/(-80))/21. 3/40 What is 15(-238)/331578? -84 (10/6)/(((-5)/180)/(385/(-700))) 33 What is 1/((2/22)/(5/(25/15)))? 33 Evaluate (949/37011)/(93/39). 1/93 Calculate 1251029/525. 49 Calculate (258/645)/((25/5)/(-650)). -52 Evaluate ((-130)/12)/((-3)/(-1)375/(-6750)). 65 What is the value of ((-2)/(-15))/((-1)/50)87/464-52? 65 What is the value of (-916/(-7488)6/5)/(12/16)? 2/65 4/(-1)((-63)/(-7))/(108/(-72)) 24 Evaluate (858/637)/((289/(-238))/(-17)6). 22/7 Calculate ((-16)/32)/((-2)/(-2))(-42174)/(-213). -99 Calculate (-51)/102023/(138/(-100)). 5/6 What is (-89)/(-9968)140222? 55 Calculate (-39/54)/(7/(-18900)18). 75 (378/9)/42-43 -43 What is 858/(-99)((-2)/9)/((-116)/522)? -26/3 What is the value of ((-50)/(-8))/((-2520)/(-168))? 5/12 Calculate (-3048)/(-52578)(-184)/(-48). 2/9 What is ((34/(-6))/((-35)/(-5)))/(86/473)? -11/7 200/460023/11 1/11 ((-3)/2)/(165(-102)/(-61710)) -11/2 Calculate ((-982)/1473)/((-72)/3). 1/36 Calculate ((-60)/1071017)/(((-24)/(-108))/(2/8)). -3/28 (427/63)/((-1617)/(-13167)) 38 (298/447)/(52/(-1)) -1/78 Calculate -643/(-1720)-2. -3/10 Calculate 4(-30)/(-45)6/(336/(-35)). -5/3 ((0/(-64))/(-170))/((-1)/(1/(-8))) 0 Calculate ((-1)/10-5)/(((-1)/(-462))/((-24)/72)). -77 Evaluate (-16)/((16/32)/(-1)). 32 Evaluate 1(6624/6)/(-3)35/(-140). 92 What is 16/(-28)3005/(-2404)? 5/7 Evaluate (-1116)/108(-91)/((-2821)/372). -124 Evaluate (1/5)/((194340/300)/(-41)). -1/79 Evaluate ((-18)/(-378)-49)/((-18)/(-648)). -84 Evaluate (141/6)/((1420/40)/(-71)). -47 Evaluate (12/9)/(-71/3)(-13804)/232. 34 Calculate 89/(-494039)-91-6. -6/61 Calculate ((-89)/364941)/(1/(-20)). 20 What is (163328/(-236544)(-2)/29)/((-6)/(-28))? 2/9 What is (12/(-8))/((-36)/26405)? 22 ((-188)/1)/(-4277/1617) 94 Calculate (14/(-28))/((744/16)/(-31)). 1/3 What is ((2016/(-312))/(120/(-156)))/(-3)? -14/5 What is 20/(-405)1(-168)/(-784)? -2/189 Evaluate (49518/110040)/(1/(-5)). -9/4 Calculate (850/(136/(-8)))/(((-4)/(-1))/(-4)). 50 ((-1230)/98422/(-10))/(122/(-61)) -11/8 Calculate (((-442)/(-117))/2)/(5/(-540)-4). 51 What is the value of (110/45)/(2286/(-41148))? -44 Evaluate ((-2)/(-14))/(64/(-96)). -3/14 Calculate (-112)/(-7448)-19154/8. -11/2 What is the value of (72/18)/(1/((-2)/48-6))? 1 Calculate (14352/(-2808))/(32/(-36)). 23/4 Calculate (((-291080)/5745)/((-1)/62/1))/2. 76 Evaluate ((-3)/(-2))/(10/4815/((-225)/6)). -18 What is ((-1938)/190)/(-2(-3)/18(-6)/10)? 51 What is 31/(496/(-96))((-24)/144)/(1/69)? 69 (-2)/((-224)/924)8/(-36) -11/6 Calculate ((-96)/88)/(((-30756)/(-13552))/233). -112 Evaluate (-11)/(55/(-15))6265/(-3222). -35/6 What is the value of (25/25)/(23/248418)? 6 What is (-36)/4586/(-344)? 1/5 What is the value of (-24)/(4/(-1))141/((-68385)/194)? -12/5 What is the value of (3(-15)/(540/(-392)))/(74/111)? 49 What is the value of (-312)/7029/(-4)(-68)/(-2550)? 2/75 What is the value of (31347/(-258))/243(-104)/6? 26/3 Calculate ((-50)/(-645)(-24)/90)/(26/(-117)). 4/43 (-5360)/(-3350)10/(-88) -2/11 What is the value of (-15)/301165/1(-9)/(-45)? -58 Evaluate (-16)/2((-4)/14)/(144(-34)/(-3808)). 16/9 What is ((-42)/15)/(112/160)? -4 Calculate ((-670)/(-3752))/((-70)/(-7)). 1/56 21/20-162/16709-44 6/35 What is the value of ((-96)/176)/((-36)/(-198))? -3 Evaluate (12/(-2088)6)/9(-120)/40. 1/87 Evaluate 48/3426/64. 63 ((2/(-5))/(((-264)/40)/(-3)))/((-322)/3542) 2 Calculate (19/46010/11419)/((-30)/(-1356)). 113 What is ((-779)/(-38))/((-15)/6)? -41/5 Calculate (12)/((-157388)/16863). -3/14 What is (-25)/(-75)(-18333)/97? -63 684/(-342)31/2 -31 Calculate (-3)/(((-216)/(-495))/(-8))114/285. 22 (4950/1328/(-9))/(-2) 50/3 (-15)/(-15)(7/(-21))/(12/(-576)) 16 Evaluate (-32)/15(-5580)/248. 48 Calculate -2123/(-552)8/(-42). -1/6 Calculate (16/20)/(178/(-10235)). -46 Evaluate 8/(-3)(-2)/16(-4560)/(-23560). 2/31 Calculate ((-1)/(-35))/((-37365)/1868250). -10/7 What is the value of ((-16458)/(-1899))/(2/3)? 13 Calculate 100/(-60)(161/(-1610))/((-2)/168). -14 (92/(-30)(-2031)/(-2708))/(7/35) -23/2 -1(-826)/141660 35 Calculate (-308)/(-8)((-3)/(-14))/(54/(-288)). -44 20/(-12)((-2)/(-42))/(31/(-93)) 5/21 What is (486/(-1053))/(12/39)26? -39 What is (7(-7)/(980/(-5)))/((-19)/(-28))? 7/19 What is 4326/21(1038/(-1557))/(-3(-8)/18)? -103 Evaluate (-6)/71141/(-652)(258/(-9))/(-1). 43 What is 10/6-3752/12025? -4/15 (220/(-154)378/(-72))/(2/(216/(-15))) -54 What is the value of 198/(-110)810/28674? -3/59 What is the value of 2/(-7)(7/(-14))/(16/(-112))2? -2 Calculate 18/(-21)(273735/66)/(-79)(-6)/(-18). 15 What is the value of (-1068)/(-4450)200/(-12)? -4 What is the value of (1/(23/((-2875)/75)))/(10/48)? -8 184/(-966)(-14)/424/(-204) -4/51 What is 1/(((-6)/(-252))/((99/11)/(-18)))? -21 Calculate (-10359)/(-28775)4/54. 2/75 What is the value of (4347/36)/(-69)5? -35/4 (450/(-65))/61(-7)/((-105)/(-12)) 12/13 What is (-107)/(-321)(-1)/(-2)306/3? 17 Calculate (-8)/(-36)1659/535(-270)/(-8820). 79 Evaluate (-96)/144-1773/(-2). -77 (58/(-348))/(2/(-30))(-12)/6 -5 Evaluate (-7463/6993)/(1/54). -36 What is (16/200)/(13/130-3)? -4/15 What is (6/66903/(-21))/(2/(-22))? 43 What is the value of -15253/138(-3)/(-15)6? -33 Calculate (8/((-320)/(-330)))/(12(-10)/320). -22 Calculate ((34371/(-54))/(-67))/((-3)/12). -38 Calculate (10(-10)/(-400))/(5(-6)/360). -3 What is (2/(1850/37))/((-208)/320)? -4/65 -320/(-108)(-2523)/(-8410) 1/6 What is (4/(-1))/((-56)/2184-117)(-225)/(-6)? -50 Evaluate 364/((-17948)/(-7692)(-12)/7). -91 Evaluate (-6)/(-36)12/9-1051/9860. -1/87 Evaluate ((32/(-400))/(31/155))/(-15). 2/75 ((-48)/(-1656))/(594/(-635283)) -31 Calculate ((-36)/(-14))/(((-2092)/(-9414))/((-42)/(-9))). 54 What is the value of ((-79)/(-58539)-95)/(10/(-144))? 24/13 What is (118737/(-3006))/(6/12)? -79 Evaluate (22/(-110))/((-16)/(-60)(-855)/(-380)). -1/3 Calculate 6/(-248)147896/166383. -2/93 What is 84255/(-1096)132/552/(-9)? 41 Calculate (-6(-6)/(-54))/(259/(-111)). 2/7 Evaluate 118/(-61596)-2927/1. 3/2 Calculate 21(-4)/6270/63. -60 ((-12)/(-80)5(-23532)/666)/((-10)/(-4)) -53/5 Evaluate 7(-376	{ "pile_set_name": "DM Mathematics" }
61.5 What is the difference between -2230 and -41? 2189 1249+0.2 1249.2 Total of -3442.53 and -1.9. -3444.43 What is 1.07 less than 13? 11.93 Total of -990560 and 1. -990559 What is 0.9 take away 175? -174.1 What is -0.6 less than -720178? -720177.4 Add together 0.01 and -0.04196. -0.03196 What is -0.6 minus 0.504234? -1.104234 What is -0.19714 minus 1? -1.19714 Add together -0.6 and 3297. 3296.4 What is -56 plus 2.35? -53.65 Total of -1.2 and 0.99. -0.21 Put together -1074 and -0.7. -1074.7 What is -118037 take away -0.01? -118036.99 -324114 - -5 -324109 Calculate 0.8 + -977. -976.2 Put together 0.2 and 0.210056. 0.410056 What is 0 take away -1260.25? 1260.25 What is 43 minus 43.5? -0.5 What is -2240 - -0.2? -2239.8 Put together -89 and 9040.1. 8951.1 What is -0.887 less than -0.3? 0.587 Sum 355.2 and -650. -294.8 Calculate 5.59 + -128.03. -122.44 Subtract -0.4 from -11539694. -11539693.6 What is 11 take away 2843? -2832 What is 0.46 minus -257.438? 257.898 Sum 17955503 and -5. 17955498 Sum 7454 and 14. 7468 -98.206+-5 -103.206 Work out -12466 - 0.1. -12466.1 Total of -1 and 37853. 37852 Total of 0.6 and 0.24267. 0.84267 What is -3492 less than 3? 3495 41 - 3066.8 -3025.8 Work out -5.454 - 0.1. -5.554 Work out 0.3 + -771018. -771017.7 What is the distance between -89.77 and 12? 101.77 Put together -0.1465 and -0.2. -0.3465 Calculate 0 - 30.55. -30.55 -390.4 - 0.4 -390.8 What is 3 plus 0.02703? 3.02703 Calculate 0.5 - -0.0633. 0.5633 Work out -2996 + -0.09. -2996.09 What is -0.3 minus 352? -352.3 Work out 3 + 1146. 1149 Work out 0 + 1230. 1230 What is 0.1 + -0.4278? -0.3278 What is the distance between 5 and 1021? 1016 Work out 1 + -1415. -1414 What is the distance between -50.74 and -6? 44.74 What is -0.4 minus -0.1537? -0.2463 Put together -249 and -4009. -4258 What is -12 - -574? 562 0.01977 + 5 5.01977 Total of 13169 and -68. 13101 What is 0.1 - 2.245? -2.145 What is 0.03087 minus 1? -0.96913 Add 1.979 and -0.3. 1.679 What is -0.2 less than -71.4532? -71.2532 Work out -2.2 + 0.0675. -2.1325 Add -150.9219 and 0.3. -150.6219 What is 2327 + -1.7? 2325.3 Work out 98 - -63.92. 161.92 What is 0.5 - 84? -83.5 What is the distance between 0.01 and 2889? 2888.99 What is -5480 minus 0? -5480 Calculate 1 + 0.26087. 1.26087 Sum 24806 and -36.2. 24769.8 Add together -59237 and -0.2. -59237.2 Calculate -0.0204 - -0.9. 0.8796 What is the difference between 232497 and 5? 232492 Work out 1051 + -917. 134 What is 28 + 36.5? 64.5 34.5+-4 30.5 What is -1228 - 0.44? -1228.44 Subtract -326775 from 5. 326780 What is -2 take away 60.0269? -62.0269 What is -0.97 plus -20? -20.97 Work out -0.5 - -3445.9. 3445.4 Sum 0.5 and -35.75. -35.25 Total of -0.0538 and 111. 110.9462 Add together 1 and -615. -614 Subtract 2 from 5785. 5783 Add 0 and -1.425. -1.425 -437+-2555 -2992 What is -4333 plus 0.3? -4332.7 Add together -1177 and 1794. 617 What is 2571 minus -930? 3501 Sum 0.0462 and 4. 4.0462 What is -1349057 - 0.1? -1349057.1 -0.1098 + 0.06 -0.0498 Add together -6097 and -0.3. -6097.3 What is -0.67 minus -146? 145.33 0.48013+-0.2 0.28013 Calculate -0.3 + -424.83. -425.13 What is -2.048 plus 51? 48.952 Add 0.22521 and -0.5. -0.27479 Total of 3 and -33. -30 Add -6.2 and 10.5. 4.3 What is -30682.8 + -0.01? -30682.81 Add -0.5 and -0.05. -0.55 Add together 0.09182 and 0.795. 0.88682 0.1+807402 807402.1 -0.4 + -2.4 -2.8 What is -2 - 1872.735? -1874.735 What is -100.3464 plus -7? -107.3464 Work out -2 + 0.0469. -1.9531 Calculate -24596 + -4. -24600 36.85 + 6.4 43.25 What is -143 minus -0.039? -142.961 What is -2 plus 8299.2? 8297.2 Calculate 5420 - -0.5. 5420.5 Calculate 39 + 94. 133 9026+37 9063 Sum -0.684413 and -0.5. -1.184413 Subtract 257 from -0.02. -257.02 What is the distance between 4 and 117822? 117818 Work out 37 + 15. 52 Total of -0.04 and 13361. 13360.96 -0.04+0.0618691 0.0218691 What is 1 less than -121666? -121667 Work out 23269 - -3. 23272 Total of 5 and 38. 43 Calculate -493970 - 3. -493973 Add -1282 and -0.488. -1282.488 What is 1564 plus -1.6? 1562.4 What is 3 less than -17688? -17691 46.52+0.3 46.82 Add 5 and -12932.8. -12927.8 Work out -15.4 - 1747.9. -1763.3 What is -0.1 plus -0.0163? -0.1163 What is -0.4 plus 72.2633? 71.8633 Subtract 0.7 from -226299. -226299.7 Work out 0.12 - 0.0597. 0.0603 What is 0.1 minus -3.14099? 3.24099 -20052.2 + -3 -20055.2 Total of -5634 and 5. -5629 What is 0.4 take away -413? 413.4 Calculate -0.15 + -4827.8. -4827.95 Sum -12 and -2.28. -14.28 Add -227.5767 and -3. -230.5767 Add together 0.2 and 461. 461.2 Add 17.941 and -12. 5.941 -0.42 - 436 -436.42 What is 7.8 + -1.5? 6.3 What is -0.6 plus 0.13? -0.47 What is -2.487 take away 1.46? -3.947 -1.4+-379 -380.4 -1878 + 139 -1739 What is -0.232854 minus -14? 13.767146 What is -3 minus -336.87? 333.87 What is 1.9704 less than 28? 26.0296 What is -10579 plus -0.1? -10579.1 Subtract 1338849 from -1. -1338850 Calculate 5 + -0.146. 4.854 Put together 13.15 and -3. 10.15 0.2104 - -0.1099 0.3203 What is 0.05105199 minus -0.4? 0.45105199 0.0501 - 1136 -1135.9499 What is -0.85 - 121? -121.85 What is -0.3467 + 0.2? -0.1467 What is 5 - 496.799? -491.799 What is the difference between 389.717 and -6? 395.717 What is 0.12 minus 0.19? -0.07 Sum -21.148 and -0.4. -21.548 Add together 0.034 and -1057. -1056.966 Put together -2 and -260089. -260091 86 + -0.12 85.88 Add together -1 and -3.3. -4.3 What is -10313 take away -0.1? -10312.9 What is 5711 minus -11? 5722 Calculate -0.2 + 180.632. 180.432 -0.5 - -0.0946 -0.4054 Add -1985 and 0.15. -1984.85 What is -11183.989 + -4? -11187.989 Add -2820 and -0.07. -2820.07 5.38 + -0.91 4.47 2.523+0.3 2.823 Work out -1.811 - 3. -4.811 What is -1.13 less than 52906? 52907.13 Total of -23 and -7.26. -30.26 Add together 4 and -98346. -98342 -0.686+-506 -506.686 What is 2.73 - 0.08? 2.65 Work out 48 + -5154. -5106 Subtract 14 from 0.699. -13.301 Work out -15.3 - -0.9. -14.4 What is the distance between 32672 and 4? 32668 What is 34.7 plus -10? 24.7 What is the distance between -279 and -2.15? 276.85 Work out -0.4 + -31704. -31704.4 Add together 33 and 0.0169. 33.0169 0.13 - 558.9 -558.77 What is -0.062 plus 1400? 1399.938 Calculate -37.8 - 31. -68.8 Subtract 0.0811 from 0.8. 0.7189 Put together 2.55 and -94. -91.45 What is -0.1032 plus 0.064? -0.0392 Calculate -12634 - -2. -12632 What is the difference between 423.772 and -2? 425.772 -7+-58.1 -65.1 What is the difference between -84 and 9.35? 93.35 Total of 3.2 and -191.59. -188.39 What is -2 minus -361? 359 Work out 0.04 + -202. -201.96 What is 0.8 - 12.1? -11.3 What is 0.870238 take away -0.07? 0.940238 What is -0.2112 less than 2? 2.2112 What is the distance between 13.7 and -9709.7? 9723.4 What is -22 less than 162? 184 Total of -3 and 253. 250 Add 0.3 and 118561. 118561.3 Put together 2.601 and 1.1. 3.701 What is the difference between 3.148581 and 0? 3.148581 What is -349 take away 0.18? -349.18 What is -4 minus -637835? 637831 -1 - 19747 -19748 Subtract 626 from -3. -629 What is the distance between -22 and -5.9? 16.1 Put together 0.6205 and -5. -4.3795 Add together -1.817103 and -0.4. -2.217103 Sum -719 and 3. -716 Calculate 6559 - 0.03. 6558.97 Subtract 0.07 from -44587. -44587.07 What is -0.7 - -39357? 39356.3 Sum -0.18441 and 0.5. 0.31559 Add 2.8 and -2472. -2469.2 Work out 1326 - 16.74. 1309.26 What is -0.058967 minus 0.2? -0.258967 What is -0.3 less than 60.3? 60.6 Work out 742 - -9. 751 What is the difference between -10 and -24.084? 14.084 What is 0.5 less than 1.0379? 0.5379 What is 56 minus 8? 48 Calculate 0.0216487 + 5. 5.0216487 -3 + -327 -330 -6916 - 0.04 -6916.04 What is 1 take away -3.98? 4.98 Add together -0.06 and -266. -266.06 7115025 - -0.4 7115025.4 What is -4.4 take away 7186? -7190.4 What is -3 - -1352890? 1352887 What is 0.2 - 559.04? -558.84 What is the difference between -0.5 and -564? 563.5 Calculate -8 - 382. -390 What is 0.15 less than -21? -21.15 What is 0.704 plus -0.5? 0.204 -2157 - -0.22 -2156.78 Add together 0.26 and -0.082. 0.178 Work out 0.0264 + -0.06. -0.0336 Work out 25.159 - 32. -6.841 Put together -61 and 39289. 39228 Sum -2 and -119273. -119275 Subtract 50 from -2.42. -52.42 Work out -9 - -18.36. 9.36 Calculate 0.005 - -3. 3.005 What is 0.2 minus 0.0744015? 0.1	{ "pile_set_name": "DM Mathematics" }
it of w? 1 Suppose k + 5 = 9. What is the tens digit of 5/((-30)/k)-21? 1 Suppose x = 2x - 4. Suppose 110 = xs - 10. Let j = s + -18. What is the units digit of j? 2 Let v = 4 - 1. Suppose -4w = -vw - 7. What is the units digit of w? 7 Let n = -29 - -15. What is the units digit of n/(3 - 28/8)? 8 Let v(j) = j3 + j2 + j. Let t be v(-1). Let i be 1/t3/(-1). What is the units digit of -32/i - -5? 3 Let w(l) be the third derivative of -l6/20 + l5/20 + l4/8 + l3/2 - 4l*2. What is the units digit of w(-2)? 7 Suppose -5m = 2 - 22. Suppose 2b - mb + 27 = 5h, -3b + 78 = -5h. What is the units digit of b? 1 Suppose -3u = -0u - i + 13, 5i = 5u + 25. Suppose 0 = -j + 6j. Let k = j - u. What is the units digit of k? 4 Let k(i) = i*2 + 3i - 2. Let g = -4 + 5. Suppose -3n + 5 = -g. What is the units digit of k(n)? 8 What is the tens digit of 7-4(-3)/6? 1 Let i(j) = j2 + j - 14. Let h be i(0). What is the tens digit of 35/3 - h/(-21)? 1 Let h be (-70)/(-28) - 1/(-2). Suppose r + 9 = -2r. What is the units digit of h - 3 - (r + -6)? 9 Let d be 1/38-3. Let x = d + 29. Suppose 3t + x = 6t. What is the units digit of t? 7 Suppose -4q - 13 - 27 = 0. Suppose 0j + 60 = -4j. What is the units digit of q/j + 1/3? 1 Let d(i) = i2 - 11i + 5. Let p be d(8). Let k = 30 + p. What is the units digit of k? 1 Let d(q) = 5q3 - 2 + 0q*3 - 7q*2 - 4q*3 + 2q. What is the units digit of d(7)? 2 Let t = 95 + 40. What is the units digit of t? 5 Let o(m) = m*2 + 6m + 2. Let p be o(-6). Let s be 3 + (11 + -3)/(-2). What is the units digit of -2 + (-10 + p)s? 6 Suppose -f + 3y = 3, 6f - 2f - y = -1. Let c be -3(-4 + 3 + f). What is the units digit of (c/(-3 + 0))/(-1)? 1 What is the units digit of (1 + 8 - -2)1? 1 Suppose 32 = -2k - 2k. Let j = -2 - k. What is the units digit of j? 6 What is the units digit of 42/(-6)(14/2)/(-1)? 9 Let q(j) = -3j2 + j - 12. Let d(s) = -s2 + s. Let f(h) = 2d(h) - q(h). What is the tens digit of f(0)? 1 Let n(g) = -g2 - 7g + 4. Let k(h) be the first derivative of h*3/3 + 7h*2/2 - 5h + 2. Let z(b) = 5k(b) + 6n(b). What is the units digit of z(-5)? 9 Suppose 0 = 2t - 3s - 3, 4t + t - 5s - 15 = 0. Let g(w) = -w + 13. Let p(b) = 2b - 25. Let n(y) = tp(y) + 11g(y). What is the units digit of n(11)? 4 Let d(m) = 2m - 17. What is the units digit of d(13)? 9 Suppose 4r + 5b = 25, -8 + 3 = 3r - b. Suppose o + ro = 3. Suppose o = v - 5. What is the units digit of v? 8 Let n = -8 + 25. What is the units digit of n? 7 Let p(b) = -b*3 + 5b*2 + 6b + 2. Let y be p(6). Suppose 0 = -2t, yt + 145 = 5f + 4t. What is the units digit of f? 9 Suppose -534 = -9x + 6x. What is the hundreds digit of x? 1 Suppose 0 = w - 2w + 17. What is the units digit of w? 7 Suppose -h = -5x - 16, 4h - 2x - 42 = -4x. Let a = -29 + 29. Suppose 5r = -4b + 53, -b + h = r - a. What is the units digit of r? 9 Let c be 246/10 + (-12)/(-30). Suppose 0r = 5r + c, -r = 4j - 99. What is the tens digit of j? 2 Let n = -16 + 24. Let g = n - 0. What is the units digit of (14/8)/(2/g)? 7 Suppose 0 = -3p + 5a - 1, -77 + 30 = -4p - 3a. Let g(t) = t*2 - 6t - 7. What is the units digit of g(p)? 9 Let q(y) = 0 - 5y - 1 + 3 - 4. What is the units digit of q(-3)? 3 Suppose 0 = -4f + 283 - 15. What is the tens digit of f? 6 Let n(i) = -i*3 + 14i*2 + 2i - 5. What is the tens digit of n(14)? 2 Let m(i) = -4i - 6. Suppose 4f = -30 + 6. What is the units digit of m(f)? 8 Let l(s) = -s - 6. Let b be l(6). Let p be b/(-42) + 10/14. Let d(v) = 9v3 + v2 + v - 1. What is the tens digit of d(p)? 1 Suppose 0 = -5q - 3s + 187, 0 = 4q - 0s - 2s - 132. What is the units digit of q? 5 Suppose r = 3t + 7, -r + t + 28 = 5t. What is the units digit of r? 6 Let d = 788 + -522. Suppose -4a - d = -5y, 4y + 5a - 185 = 36. What is the tens digit of y? 5 Let g = -9 + 33. What is the tens digit of g? 2 Suppose -5l - 3 + 8 = 0, 0 = -2h - 4l + 356. What is the tens digit of h? 7 Suppose 3h = 3 + 36. Let k = -7 + h. What is the units digit of k? 6 Let i = 538 + -337. What is the tens digit of i? 0 Suppose 0 = -8g + 4g + 16. Suppose 5m - 3r = 121, 89 = gm - 0m - 5r. What is the units digit of m? 6 Let i(a) = -a3 + 6a*2 - 1. Let y be i(5). Suppose -d + 8 = -2v + 2d, 0 = 2v + 5d - y. What is the units digit of v? 2 Let o = 123 + -72. What is the tens digit of o? 5 Let f = -16 - -16. Suppose fy + 5y - 55 = 0. What is the units digit of y? 1 Let b be 46/(-4) + (-3)/6. What is the tens digit of (3 + -3 - b) + -2? 1 Let s(t) = t - 2. Let l(z) = -7z*2 + 2z - 1. Let w be l(1). Let m = 0 - w. What is the units digit of s(m)? 4 Suppose 7h = 10h - 432. What is the tens digit of h? 4 Let t = 129 + 115. What is the units digit of t? 4 Let w(a) = -16a3 + 1. What is the tens digit of w(-1)? 1 Let d = 372 - 226. What is the hundreds digit of d? 1 Suppose -w + y = -2y - 10, -y + 20 = 3w. Let n(r) = r2 - 5r + 4. What is the tens digit of n(w)? 1 Suppose 0 = 4x - 6x - 8, -4l = -5x - 8. Let a = l + 6. Suppose -i + a + 6 = 0. What is the units digit of i? 9 Let x = 9 - 7. Suppose r = xo + 26, 0o + 92 = 4r - 2o. What is the units digit of r? 2 Let r(h) be the first derivative of h*5/20 - 7h*4/12 - 7h3/6 + h + 2. Let m(i) be the first derivative of r(i). What is the units digit of m(8)? 8 Let b(k) = k3 + 3k2 - k. Let d be b(-3). Let t = d + 0. Suppose 2s - tl + 8 = 30, 2s + 2l = 2. What is the units digit of s? 5 Let m(z) = -z3 - z - 1. Let q be m(-1). Let v(l) = 5l*2 + l - 1. What is the units digit of v(q)? 5 What is the tens digit of (45/(-1))/((-5)/(-10)-2)? 4 What is the units digit of (-1)/((-10)/62) + 1/(-5)? 6 Let j(o) = -2o - 2. Let p(b) = 0b + 9 - 5b + b2 - 2b - 5. Let g be p(5). What is the units digit of j(g)? 0 Let j = 12 + -9. Suppose -jo + 22 = -20. What is the units digit of o? 4 Let n(x) = -x2 + 10x. Let z be n(10). Suppose zj - 4j = 52. What is the units digit of (j/(-2) + -1)2? 1 Let w(v) = -v3 - 6v*2 - 4v + 6. Let k be w(-5). What is the units digit of (-9)/((5 - k)/(-4))? 9 What is the tens digit of (-519)/(-12) - 1/4? 4 Let h = -7 - -129. Suppose -4i = -4g + g + h, -4g + 200 = 4i. What is the units digit of g? 6 Suppose -4o + 0o - 392 = 0. What is the units digit of o/(-4) + 9/(-6)? 3 Suppose -5x + 15 = -0. Suppose -4v + 11 = 2o + xo, 5o + 61 = 4v. What is the units digit of v? 9 Suppose -6p - g = -p - 1974, 1181 = 3p + 4g. What is the units digit of p? 5 Let n(r) = r2 - 4r + 2. Let i be n(4). Suppose -il - l + 54 = 0. What is the units digit of l? 8 Let d(y) = -y + 2. Let z be d(7). Let p(j) = -j3 - 6j*2 - 5j + 6. Let k be p(z). Let v = 8 - k. What is the units digit of v? 2 Suppose 9v - 2v = 791. What is the hundreds digit of v? 1 Let r = -5 + 27. What is the units digit of r? 2 Suppose 2q + 4m = -48, -5m - 69 = 2q + q. What is the units digit of 2/(-1) - q1? 6 Let u(w) = -8w. Let l be u(3). Let n be 4/(-10) + l/(-10). Suppose -nd - 2i - 19 = 3i, 0 = 3d + 5i + 16. What is the units digit of d? 3 Suppose 0g + 185 = 5g. What is the units digit of g? 7 Suppose 0 = -s + 6s - 25. Suppose -8 = -u - 5h, sh - 1 = 3u - 5. What is the units digit of u? 3 Suppose -4z - o = -2z - 350, 0 = z + 4o - 182. What is the units digit of z? 4 What is the units digit of 2/(-36)4 + (-1370)/(-9)? 2 Let p(g) = -g2 - 10g - 10. Let o = 7 - 15. What is the units digit of p(o)? 6 Let b = 16 + 2. Let z = b + -3. What is the tens digit of z? 1 Suppose 4q + q = -10. Let r be (4 + -3)(q + 24). Suppose -2z = -g - 0g + r, g - z = 20. What is the units digit of g? 8 What is the tens digit of 450/126/5? 4 Suppose -15 = 3m - 8m. Suppose 2u + 4w = 122, -20 = 3u + mw - 191. What is the tens digit of u? 5 Let u be (36/(-30))/((-2)/5). Suppose -8y = -uy - 140. What is the units digit of y? 8 Let c be 2 - (0 - (1 - 1)). Suppose -z - 159 = -5u, u + 3z = -cu + 99. Let j = u - 17. What is the tens digit of j? 1 Suppose 53 + 62 = -5c. Let h = c + 42. What is the tens digit of h? 1 Suppose 0 = -2d - 0d + 120. Suppose -d = -4r - 4m, 4r - 20 = 3r + 4m. Suppose 3*l - l - r = 0. What is the un	{ "pile_set_name": "DM Mathematics" }
2 i when three letters picked without replacement from vvvvvviviviiiivvvv? 15/68 Two letters picked without replacement from {l: 4, r: 5, s: 2, i: 2, x: 1, y: 1}. Give prob of picking 2 l. 2/35 Calculate prob of picking 1 t and 1 g when two letters picked without replacement from {t: 4, g: 10}. 40/91 Two letters picked without replacement from {e: 4}. Give prob of picking 2 e. 1 Calculate prob of picking 1 k and 1 u when two letters picked without replacement from zuzzzuzhzkhuzu. 4/91 Four letters picked without replacement from uhpupufufhfhhhnhu. Give prob of picking 2 p, 1 u, and 1 h. 3/238 Calculate prob of picking 2 g when two letters picked without replacement from {g: 10}. 1 What is prob of picking 1 m and 1 w when two letters picked without replacement from {p: 3, q: 3, m: 1, w: 4}? 4/55 Four letters picked without replacement from {y: 9, v: 7}. What is prob of picking 3 v and 1 y? 9/52 Calculate prob of picking 1 b, 1 s, and 1 f when three letters picked without replacement from {h: 1, b: 6, s: 1, l: 1, o: 3, f: 5}. 3/68 Calculate prob of picking 2 k when two letters picked without replacement from kkkkkkkkkk. 1 Three letters picked without replacement from bzbbpzb. Give prob of picking 1 b and 2 z. 4/35 Three letters picked without replacement from zbzzbyb. Give prob of picking 1 z, 1 b, and 1 y. 9/35 Two letters picked without replacement from {x: 2, p: 6}. What is prob of picking 1 x and 1 p? 3/7 Four letters picked without replacement from {o: 3, p: 6, w: 4}. Give prob of picking 4 w. 1/715 Three letters picked without replacement from zweew. Give prob of picking 2 w and 1 z. 1/10 What is prob of picking 1 f and 3 m when four letters picked without replacement from fffffmffffmmmfffmf? 13/306 Three letters picked without replacement from {r: 1, v: 4, w: 8}. Give prob of picking 3 r. 0 Three letters picked without replacement from {v: 1, h: 1, y: 2, e: 3, p: 3}. Give prob of picking 2 p and 1 y. 1/20 Calculate prob of picking 3 f and 1 i when four letters picked without replacement from fifiiiffffffiffffif. 143/323 Four letters picked without replacement from wvubwmwmvmwbuwv. What is prob of picking 2 m and 2 w? 2/91 What is prob of picking 2 l and 2 q when four letters picked without replacement from qlllqql? 18/35 Two letters picked without replacement from {u: 1, x: 4, b: 2, i: 1}. Give prob of picking 1 u and 1 x. 1/7 Two letters picked without replacement from {i: 6, h: 4}. Give prob of picking 2 i. 1/3 What is prob of picking 1 d and 2 w when three letters picked without replacement from pzhwhhdhohpwhddph? 3/680 What is prob of picking 1 w and 1 i when two letters picked without replacement from {i: 3, w: 1}? 1/2 Two letters picked without replacement from bzbbsabaimaisbb. What is prob of picking 1 i and 1 b? 4/35 What is prob of picking 1 y and 1 c when two letters picked without replacement from byxkccb? 2/21 Two letters picked without replacement from {a: 3, o: 1, q: 6, p: 2, d: 7}. What is prob of picking 1 q and 1 p? 4/57 What is prob of picking 1 m and 2 g when three letters picked without replacement from zgrmggr? 3/35 What is prob of picking 3 b and 1 k when four letters picked without replacement from {b: 11, k: 1}? 1/3 Calculate prob of picking 1 i and 1 l when two letters picked without replacement from {f: 1, e: 1, i: 1, l: 1, n: 1}. 1/10 What is prob of picking 1 n and 1 r when two letters picked without replacement from {a: 1, h: 5, r: 7, f: 1, n: 5, m: 1}? 7/38 What is prob of picking 1 l, 1 m, and 1 w when three letters picked without replacement from oloowolwmllwlwloow? 5/136 Calculate prob of picking 2 t when two letters picked without replacement from ttttgggttttt. 6/11 Two letters picked without replacement from {h: 2, u: 1, y: 1, p: 1, n: 2}. Give prob of picking 2 n. 1/21 Four letters picked without replacement from {v: 8, m: 5}. What is prob of picking 3 v and 1 m? 56/143 Four letters picked without replacement from rrrraaarrr. Give prob of picking 1 a and 3 r. 1/2 Two letters picked without replacement from lzdzzzlddzdzdzzldldd. What is prob of picking 1 l and 1 d? 16/95 Four letters picked without replacement from rerrffbbri. Give prob of picking 2 f, 1 e, and 1 b. 1/105 Three letters picked without replacement from {h: 1, o: 2, c: 1, f: 5, p: 6}. What is prob of picking 3 p? 4/91 Two letters picked without replacement from {h: 4, v: 1, c: 2}. What is prob of picking 1 v and 1 c? 2/21 What is prob of picking 1 w and 1 t when two letters picked without replacement from {w: 1, t: 1, h: 7, x: 3, n: 2}? 1/91 Calculate prob of picking 1 x and 1 v when two letters picked without replacement from vfvfvfvvffxfvvfvvfv. 10/171 Four letters picked without replacement from okoxkkkoookookokoxk. Give prob of picking 4 o. 21/646 Two letters picked without replacement from vhyhxxbkk. What is prob of picking 1 k and 1 x? 1/9 Two letters picked without replacement from {c: 11, a: 2}. What is prob of picking 2 a? 1/78 What is prob of picking 1 p, 1 n, 1 o, and 1 t when four letters picked without replacement from {o: 2, p: 2, n: 1, g: 1, t: 1, x: 1}? 2/35 Two letters picked without replacement from ksukuutqqtqpkqtuk. Give prob of picking 1 p and 1 u. 1/34 Four letters picked without replacement from {m: 4, q: 2, x: 1, l: 1}. What is prob of picking 2 m, 1 q, and 1 l? 6/35 Four letters picked without replacement from sssnmnmmm. Give prob of picking 4 m. 1/126 Two letters picked without replacement from {w: 2, g: 5, i: 13}. What is prob of picking 1 g and 1 i? 13/38 Two letters picked without replacement from pggffzufuzzz. What is prob of picking 1 u and 1 z? 4/33 Four letters picked without replacement from {e: 7, u: 6}. What is prob of picking 4 u? 3/143 Calculate prob of picking 1 i and 3 p when four letters picked without replacement from ppipipi. 12/35 Four letters picked without replacement from {n: 2, g: 6, y: 3, u: 4}. What is prob of picking 3 u and 1 g? 8/455 Four letters picked without replacement from nnrnnnrnnrn. What is prob of picking 3 r and 1 n? 4/165 What is prob of picking 2 x when two letters picked without replacement from {x: 5, d: 14}? 10/171 Two letters picked without replacement from oevoveeeeoeoev. Give prob of picking 1 o and 1 v. 12/91 Calculate prob of picking 4 r when four letters picked without replacement from {r: 6}. 1 Calculate prob of picking 2 u and 2 r when four letters picked without replacement from jkllurulrr. 1/70 Four letters picked without replacement from {b: 4, u: 1, l: 1, y: 7, w: 2}. What is prob of picking 1 u and 3 b? 4/1365 Calculate prob of picking 1 e, 1 k, and 1 g when three letters picked without replacement from {z: 1, g: 2, e: 1, o: 3, k: 3}. 1/20 Two letters picked without replacement from ioiiiwoiiwiii. What is prob of picking 2 w? 1/78 Four letters picked without replacement from mmymggdgyy. Give prob of picking 1 m and 3 y. 1/70 Calculate prob of picking 4 t when four letters picked without replacement from {t: 10, c: 2, j: 1, u: 3}. 3/26 Calculate prob of picking 3 f when three letters picked without replacement from sffffffsfssffssssss. 28/323 Three letters picked without replacement from {a: 5, d: 4, w: 3, j: 1}. What is prob of picking 1 a and 2 w? 15/286 What is prob of picking 3 m when three letters picked without replacement from {j: 1, k: 1, n: 5, m: 4, t: 3}? 1/91 Calculate prob of picking 2 m when two letters picked without replacement from mwmmmmjnf. 5/18 What is prob of picking 2 g and 1 v when three letters picked without replacement from ygyyvyygvyvyvyyyyyv? 5/969 What is prob of picking 2 i when two letters picked without replacement from {d: 7, z: 3, i: 6, b: 1}? 15/136 Four letters picked without replacement from {e: 1, o: 2, u: 1, f: 4, y: 2, w: 2}. What is prob of picking 2 f and 2 y? 2/165 Two letters picked without replacement from {f: 4, c: 2, a: 8}. What is prob of picking 2 a? 4/13 Calculate prob of picking 4 i when four letters picked without replacement from {i: 10}. 1 What is prob of picking 1 j and 1 l when two letters picked without replacement from bblkbmjjbl? 4/45 Three letters picked without replacement from {h: 3, v: 4}. What is prob of picking 3 h? 1/35 Calculate prob of picking 1 b and 1 j when two letters picked without rep	{ "pile_set_name": "DM Mathematics" }
to -2/5? (a) w (b) -1/2 (c) 2/19 b Let u(x) = x*2 + 6x - 11. Let o be u(-8). Suppose -2i = -oi - 3. What is the nearest to -1 in 1/8, i, -4/3? i Let y(s) = -s*2 + s. Let r be y(1). Let x be 2/((1 - 1) + 2). Let f be (-2)/(-1 - (x - 0)). Which is the closest to r? (a) -1/7 (b) 0 (c) f b Let w = 5 + -3. Let k be ((-1)/(-3))/(4/(-24)). Let r be (k/(-22))/((-1)/(-2)). What is the closest to w in 2, r, 3/4? 2 Let v = -2 + 2. Let t = 33 + -32.8. Which is the nearest to 1/3? (a) 5 (b) v (c) t c Let d = 0.9 - 0.8. Suppose 2c + 3 = -c. Let g = 0.24 - 0.14. What is the nearest to g in -1/12, d, c? d Let c = 0.09 + -0.09. What is the closest to c in -3/5, -0.06, -3? -0.06 Let n = 30.8 - 31. Which is the nearest to 2? (a) -2 (b) n (c) -6 b Let s be 80/111 + 20/(-30). Let m = s + -80/111. Let j = 3 - 3.1. Which is the nearest to j? (a) 3 (b) 5 (c) m c Let c = 0 - -1. Let r = 0.08 - -0.22. Let w = -0.5 - -2.5. What is the nearest to c in r, w, -2/9? r Let j = -0.08 - 0.92. Let q(m) = m*2 - 7m - 8. Let v be q(8). Which is the nearest to j? (a) 0.1 (b) v (c) 3 b Suppose -28 = 3u - 5x - 7, -3 = -x. Which is the nearest to 0? (a) 0.4 (b) -23 (c) u a Suppose -5w = -14 - 1. What is the nearest to 0 in -1/3, w, -6/11? -1/3 Let o = 17 + -14. What is the nearest to -2 in 0.3, 0.5, o? 0.3 Let r = 5 + -2. Let h = r - 4. What is the nearest to -1 in h, -2, -1/3? h Let t be 4(92/(-32) + 3). Let u(c) = 2c. Let p be u(2). What is the nearest to -1/3 in p, t, -0.5? -0.5 Let t = 2.3 + -2.4. Let i = 1.2 - -3.8. What is the nearest to -2 in 3/8, i, t? t Let x be (-1)/21 - (-1)/3. Let f = 65 + -65.3. What is the closest to x in -0.2, f, -1? -0.2 Let d be 38/(-90) + (-1)/(-5). What is the nearest to d in -5, 4, 0? 0 Let o(y) = y2 - 8y + 11. Let u be o(2). Which is the closest to -2/5? (a) 2/3 (b) 0 (c) u b Let s = 1/48 + 89/336. What is the nearest to -12 in 0.4, 1, s? s Let y be ((-5)/105)/(3/9). Which is the nearest to -2? (a) y (b) 1/3 (c) -5 a Let u = 0.03 + -3.03. Suppose -m - m + 11 = -3q, 2m - 2q - 8 = 0. Let z be 5/6 - m/2. What is the nearest to -1 in u, z, 3? z Let l = 25 - 23. What is the nearest to -2 in l, -2, 2/5? -2 Let g be 0/(-2 + 4 + -1). Let s be (2/(-12))/((-4)/(-16)). Which is the closest to s? (a) g (b) 2/7 (c) -3/5 c Let y = -4.6 - -0.6. Suppose 1 = i + 6. Let h = 1 + -1. What is the nearest to -1 in h, i, y? h Let q = -1.7 - -1.5. What is the nearest to q in 0.1, -2, -1? 0.1 Let g = 120 - 358/3. What is the nearest to g in 1, 3, 4? 1 Let o = -3 + 7. Let v = 41/5 + -9. Which is the nearest to -1/2? (a) 1/4 (b) v (c) o b Let n be (2/150)/((-15)/(-45)). Let t = -53/75 + n. Which is the closest to -0.4? (a) t (b) 0.5 (c) -1/8 a Let y = 9 + -29. Let r = 19.7 + y. Which is the closest to 0.3? (a) r (b) -3/5 (c) -1 a Suppose -8 = 2y + 4t, 4y + 8 = t + 28. Suppose -3q - 2 = -yz + 3, -6 = -4q - z. Which is the nearest to -0.1? (a) -5 (b) q (c) 4 b Suppose -2o - o = -291. Let w = o - 677/7. Let g(d) = d + 3. Let x be g(-3). Which is the closest to w? (a) -3 (b) x (c) -4 b Let n = 100 + -103. Which is the closest to -0.1? (a) 3 (b) -2/3 (c) n b Let w be 6/8(-4)/6. Which is the closest to -2? (a) -4 (b) -0.1 (c) w c Suppose 16 = -5w + 1. Which is the closest to 1? (a) w (b) -9 (c) 0.3 c Let m = 208 + -208. Let n = -3 - -3.2. Which is the closest to -2/3? (a) n (b) 5 (c) m c Let i = -1.88 - -2. Let u = i - 0.42. Which is the nearest to 2/11? (a) u (b) -0.2 (c) 0 c Let q be ((-3)/(-2) + -1)-18. Let k be 3/q - (-11)/15. What is the nearest to 0.1 in 1, k, -2? k Let r = -0.86 + 0.8. Let i = r - 0.02. Let c = 0.22 - i. What is the nearest to 0.1 in -3, 4, c? c Let i = 3.8 - 0.8. What is the closest to 1 in 0.02, -0.3, i? 0.02 Suppose 0 = -z + 3 + 8. What is the closest to -1 in -0.1, -3, z? -0.1 Let r = 9 - 7. Which is the closest to 2/3? (a) -9 (b) r (c) 1 c Let o = 35.1 + -37. Let v = 1.9 + o. What is the nearest to 0.1 in 1/3, v, 0.1? 0.1 Suppose 6a + 2g - 30 = 2a, 3a = -5g + 40. Suppose -ac - 8 = 7. What is the nearest to -1 in 0.2, c, -0.3? -0.3 Let m = 5 - 7. Let i be 2/8 - 1/(-4). What is the nearest to -0.1 in i, m, 5? i Let p = 10.86 - 11. Which is the closest to 0.1? (a) 3 (b) p (c) 0 c Suppose 0 = -3g - 4m - m + 17, 2m = 8. Suppose 0 = l - w + 2, -w = 3l - 6l + 2. Which is the nearest to g? (a) l (b) -0.4 (c) 1/10 b Let u be 3/52(2 - 18). Let f = 73/65 + u. Which is the nearest to 0? (a) f (b) 5/3 (c) 2 a Let d = -4 - -3.9. Which is the nearest to d? (a) -2 (b) -1 (c) 1/6 c Let r = 0.05 + 0.35. Let w = -4 + 4. Which is the nearest to w? (a) -5 (b) -4 (c) r c Let r = 38 + -40. Which is the closest to -3/4? (a) r (b) 3 (c) 1 a Let t = -85.5 - -85. Let p(m) = -m3 + m2 - m - 2. Let l be p(0). What is the closest to 0.1 in 2/3, l, t? 2/3 Let f = -3 + 11. Let k = -7.83 - -0.13. Let d = f + k. Which is the closest to -1? (a) 0 (b) d (c) -1/7 c Suppose 0 = 3p + 2l + 12, -3l - 2l = -3p + 9. What is the nearest to -0.03 in -0.5, p, 0? 0 Let p = 0.8 + 0.2. Let t be 12/(-55) + ((-4)/(-11))/(-2). Which is the closest to p? (a) -3/4 (b) t (c) 0.1 c Let p be 135/162(-2)/(-10). Let u = -10796/21 + 514. Which is the closest to 1? (a) 5 (b) p (c) u b Let h be (-2)/10 - 0/(-3). What is the closest to -0.3 in h, -4/7, 0.5? h Let i = 2 + -1.6. Let g = i + 0. Let l = 17 - 17.2. What is the nearest to -0.1 in 0.1, l, g? l Let s = -8 + 7. Suppose -1 = -b - 0b. What is the nearest to -1/2 in b, 0.5, s? s Let v = -2 - -6. Let r be (-1)/4 + (-8)/(-288). Which is the closest to -0.1? (a) v (b) -1/4 (c) r c Let f = -6.4 - -6. Let i = f + 1.7. Let t = 1 - i. Which is the closest to -0.1? (a) t (b) -5 (c) 5 a Let n = -19.3 - -20. Let u = n - 0.7. Let c = -3.1 + 3. What is the nearest to u in -3, 0.5, c? c Let r = 3 + 1. Let l(k) = -k - 8. Let t be l(-4). Let q be (-6)/t(-2)/(-3). Which is the closest to -0.1? (a) -0.3 (b) q (c) r a Let v = 6 + -7. Let n = 0 + 0.2. Which is the nearest to 0? (a) v (b) n (c) 0 c Let f = 0.3 + -0.2. Suppose 2x + 5h = -2 + 14, -4x + 4h - 32 = 0. Which is the nearest to f? (a) 2 (b) x (c) 2/7 c Let g = -2.5 - -0.5. Let b = g + -1. Let d be 1 + -3 + 20/6. What is the closest to -2/3 in d, 1, b? 1 Let l = 0.3 - 0.1. Let j = 13 + -9. Let y = 109/345 + 2/115. Which is the nearest to y? (a) j (b) 3/2 (c) l c Let o be 3/(-12) + (-38)/(-56). What is the closest to 1 in 4, o, 0.1? o Suppose 12 = -i - i. Let j be 3/6 - i/(-28). Let t = 27/8 - 111/40. Which is the closest to j? (a) -2 (b) t (c) -4 b Let y = -116 - -115. Let u = -0.8 - -0.5. Which is the nearest to y? (a) u (b) -1 (c) -3 b Let h = -10/19 - -132/323. Let o = -3047/15 - -203. Which is the nearest to 2/7? (a) 1 (b) o (c) h c Let j = -8 - -3. Let k = -8 + 3. Let m = -4.7 - k. Which is the closest to 1/3? (a) -3/2 (b) m (c) j b Let g = -93 - -93.1. What is the nearest to g in -1/2, 3/7, -0.09? -0.09 Let f = 160 + -1118/7. Let i = -110 - -548/5. Which is the nearest to -2? (a) -5 (b) f (c) i c Let n = 1 + 1. Let y = -1.9 + n. Which is the nearest to 1? (a) -3 (b) 3/2 (c) y b Let w(x) = -3x*3 + 7x*3 + 3 - 5x*3 - 2x - 6 + 4x2. Let j = -8 - -11. Let m be w(j). What is the closest to m in -5, -0.1, -2/7? -0.1 Let r = 0.05 - 0.04. Let h = r + -0.01. Let d be (1/(-4))/(14/(-16)). Which is the nearest to d? (a) -2 (b) 1 (c) h c Let v = 5 - 6. Let l be (-1)/(-2)v/(-2). Let r = 4 - 3. What is the closest to r in l, 1, -0.3? 1 Suppose 0 = 4i - 2i. Suppose 2 = -2f - i. Which is the nearest to 0.3? (a) 0 (b) f (c) -5 a Let m = -7.8 + 8. Let v be (-1)/(-1)3/3. Let j = 1.99 + 0.01. What is the nearest to v in j, 1/2, m? 1/2 Let d = 47/75 + -2/75. What is the closest to -0.2 in d, -5, 4? d Let g = -21 - -43. Let p be 2/g(-6 + 4). Which is the nearest to 0.1? (a) -1/3 (b) -2/19 (c) p b Let o be (-1)/3 - (-5)/(-30). Let u be 9/(-138)2/(-3). Let m = u - -15/184. What is the closest to -2/9 in 2, o, m? o Suppose 5s = -3k - 10, -3*k + s - 1 = -3. Let y = -0.2 - -0.3. What is the closest to 1/3 in k, y, 1/3? 1/3 Let d = -7 + 6.95. Let y = d + 1.05. Let v = -2 - y. Which is the nearest to -1? (a) -4 (b) v (c) 2/3 c Le	{ "pile_set_name": "DM Mathematics" }
derivative of -u5/20 + u4/3 + 7u3/6 - 5u*2/2 + 7u. Calculate l(5). 5 Let b(u) = u. Let a(m) = 2m - 2. Let x be a(2). Suppose r - h + 13 = -xr, 3r = -5h + 11. Determine b(r). -3 Let x = -4 + 1. Suppose -2p - 10 = -2t - 0p, -1 = t + 5p. Let s(k) = -3k3 + tk*3 + 3k + 2 - 6 + 4k2. Give s(x). -4 Let g(o) = 4o + 0o + 1 + o2 + 2o - 8. Calculate g(-7). 0 Let h(j) be the first derivative of j*2/2 + 13j + 22. Calculate h(-7). 6 Let j(d) = -5. Let z be -4 + -1 + 5 + -4. Let h(f) be the first derivative of f*2/2 - 4f - 9. Let w(o) = zh(o) + 3j(o). What is w(1)? -3 Suppose 3m - d = 0, 5d - 11 = 3m + m. Let h = 3 + m. Suppose 2x + 0x - h = 0. Let t(q) = -q2 + 3q - 2. Calculate t(x). 0 Let b(c) = c + 3c3 + 0 + 3 - 2c*3 + 2 + 5c2. Calculate b(-5). 0 Let c = 9 - 12. Let m = 0 - c. Let a(v) = v2 - 4v + 3. Calculate a(m). 0 Let y(m) = -m3 + 4m*2 + 5m - 1. Let v = -111 - -116. What is y(v)? -1 Let p be -1 + 1 + -3 - -5. Let b be -6(5 - p)/(-9). Let v(i) = 2i. Calculate v(b). 4 Let q(s) = -2s2 + 2s + 1. Suppose -6 = m - 3. Let z = m + 8. Suppose 4 - 9 = zp. What is q(p)? -3 Let s = -13 - -18. Let i(d) = -2 + sd - 3d - d. What is i(3)? 1 Let c(h) = -h + 6. Let j be c(6). Let z(f) = -4f + 1 - 3 + j. Give z(-2). 6 Let r = -2 - 4. Let l(t) be the first derivative of t*2/2 + 3t + 1. Calculate l(r). -3 Let q(j) be the second derivative of -j4/12 - j3/3 + 2j2 + j. Give q(-3). 1 Let z(n) = 5n*2. Let y be z(1). Suppose -2d + 3b - 10 = b, -yb + 17 = 3d. Let r(w) = -6w. Determine r(d). 6 Let o = 26 + -9. Let p = o - 13. Let a(z) = z*2 - 4z + 6. Determine a(p). 6 Let s(v) be the third derivative of v4/4 - v3/6 + 12v2. Determine s(2). 11 Let z be 4 + 0 - (-1 - -3). Suppose 3p - 30 - 42 = 0. Suppose p = -w + c + 3c, zw = -3c + 7. Let u(y) = -2y - 3. Determine u(w). 5 Let i(b) = 1 + 0 + 5b + 0b2 + b2 - 4 + 0b2. Let k = -3 + -2. What is i(k)? -3 Let a(i) = -i. Let f(b) = 4b - 17. Let w(g) = -3a(g) - f(g). What is w(0)? 17 Let x(v) = 6v*3 + 41v*2 - 25v - 36. Let p(u) = u*3 + 8u*2 - 5u - 7. Let r(i) = 11p(i) - 2x(i). Suppose -55 = -y - 4y. Let z = y + -6. What is r(z)? -5 Let b(r) be the first derivative of -r3/3 + r2 + 10. Let w be (-4)/((-12)/3)-2. What is b(w)? -8 Let s(n) = -n*2 + 9n + 11. Let r be s(10). Suppose -4 = -2t - 3w + 7, 5w - r = t. Let h(m) = -m3 + 4m*2 + m. Determine h(t). 4 Let p(d) = -2d - 4. Let a(v) = 2v + 1. Let s be a(-3). Let k be ((-1)/(-1)0)/1. Let c = s + k. What is p(c)? 6 Let x(y) = -y + 0 - 1 - 1. Let h be 1 - (3 - -1) - -7. Suppose -l - h = l. Calculate x(l). 0 Let d = -11 + 9. Let o be (-3)/(-18)43. Let j(b) = 2bo - b3 + 2b + 2 - b*3 - 4b2. Calculate j(d). 6 Let r(y) be the first derivative of -y3/3 + 3y2 - y + 36. Let k be 4/(-6) + 40/6. Calculate r(k). -1 Let m(k) be the first derivative of -k4/4 - 7k3/3 + k2/2 + 2k + 4. Determine m(-7). -5 Suppose 4x + 2v = 4, -9 = -3x + 3v + 3. Let a(o) = 2o*3 - o - 2. Give a(x). 12 Let h be (4 - 1)6/9. Let u(q) be the second derivative of 0 + q*3 + 3q*2 + 5/12q*4 + 1/20q*5 + hq. Calculate u(-4). -2 Let j(u) = -u2 - u - 2. Let b be (-2)/((-7)/((-63)/(-6))). Let q(h) = h2 + 3. Let s(p) = bj(p) + 2q(p). What is s(-5)? -10 Suppose 4g - 3k + 13 = 0, -5k + 9 - 30 = 4g. Let l(o) = o*2 + o - 2. Give l(g). 10 Let c(g) = -4g*2 - 19g - 28. Let a(l) = 3l2 + 13l + 19. Let x(b) = -7a(b) - 5c(b). What is x(5)? 2 Suppose 6i = 2i. Let o(q) = -q*2 + q + 6. Give o(i). 6 Suppose 0 = -2v + 7v - 30. Let l(k) = 2k - 7. Let z(q) = -4q + 14. Let n(b) = 13l(b) + 6z(b). Calculate n(v). 5 Let i be (42/(-9))/((-2)/(-3)). Let f(u) = u3 + 8u*2 + 8u + 7. Let h be f(i). Let b be (h/(-3))/(-3 + 1). Let k(d) = d2 + 4. What is k(b)? 4 Let w(u) = -u2 + 2u + 4. Let m(f) = -3f - 17. Let o be m(-7). What is w(o)? -4 Let i(t) = 3t - 1. Let d be i(1). Let v(p) = d + 3p*3 - 2p*2 - 7p3 - 1. What is v(1)? -5 Let n(j) be the second derivative of -j5/120 + j4/12 - j3/3 - 4j. Let d(u) be the second derivative of n(u). Determine d(3). -1 Let p(f) be the third derivative of f4/24 + f3/2 + 11f*2. What is p(-5)? -2 Let u(j) = 3j*2 - 6j - 10. Let c(d) = 16d2 - 30d - 52. Let z(a) = -2c(a) + 11u(a). Suppose -8 + 43 = 5r. What is z(r)? 1 Let f be 3(2 - (4 + -1)). Let l(n) be the third derivative of -n6/120 - n5/30 + n*4/6 + 2n*3/3 - 3n*2. Determine l(f). 1 Let s(m) = 3m*2 - 2m + 1. Suppose -4j + 4x = -j + 9, 4x = 2j + 10. Calculate s(j). 2 Let u(i) be the first derivative of -i*4/4 - 2i3 + i2/2 - 7i - 1. Calculate u(-6). -13 Let j = -20 + 24. Let u(o) = 2o + 4. Give u(j). 12 Let b(f) be the second derivative of -1/3f3 - 1/2f*2 + 4f - 1/4f4 + 0. Give b(-1). -2 Let g(i) = -8i + 3. Let c(w) = -1. Let y(l) = 3. Let h(k) = -4c(k) - y(k). Let d(p) = -g(p) + 3h(p). Determine d(1). 8 Let n(w) = -w*3 + 2w*2 + w + 3. Suppose -15 = -9k + 12. Give n(k). -3 Let k(q) = q. Let j(z) = 9z - 2. Let f(s) = j(s) - 5k(s). Calculate f(2). 6 Let q(y) = 5y - 1. Let u = -18 - -19. Calculate q(u). 4 Let h(f) be the second derivative of 3/2f*2 - 2f + 0 + 1/6f3. What is h(0)? 3 Let s(f) = 2f - 10. Let l be s(11). Suppose -2j - l = -6j. Let a(r) = r*3 - 4r2 + r - 2. Calculate a(j). -8 Let q(z) = z2 - 3z + 3 + 0 + 8z. Suppose -3o + 3i + 2 = -7, -2o + 5i = -6. Suppose -ov = 8p - 4p - 5, 2p - 10 = 0. Give q(v). 3 Let r(k) = -k*2 + 4k + 2. Let a be ((-2)/(-6))/((-6)/(-54)). Suppose -3y - h = -1, -7 = -2y + 6y + ah. Let o = y - -3. Give r(o). -3 Let f be 17/5 - (-4)/(-10). Let i(q) = 5q2 + 7q*2 - 11q*2 - 2q*3 - q - 6qf. Let b(g) = -g2 + 7g - 5. Let s be b(6). Calculate i(s). -8 Let w(p) = -p - 3. Let k(u) be the third derivative of -u6/240 + u4/24 + u2. Let b(o) be the second derivative of k(o). Let a be b(-1). Determine w(a). -6 Let d(m) = -3m - 1. Let l be d(-1). Let q(k) be the third derivative of 1/120k6 + 1/30k*5 + 0k - k*l + 0 - 1/8k*4 + 1/6k3. Give q(-3). 1 Let o(m) be the third derivative of -m5/60 - m4/24 + m3/3 - 12m2. Determine o(-2). 0 Let f(a) = -3a*2 + 2a + 1. Let o be f(2). Let l(p) = -p*2 - 8p - 10. Calculate l(o). -3 Let r(s) = -s + 2s + s + 2. Suppose 51 + 51 = -2k. Let t be (-4)/10 + k/(-15). Give r(t). 8 Let y(u) be the third derivative of -u6/180 + u5/40 - u*4/24 + 5u*3/6 + 5u*2. Let j(k) be the first derivative of y(k). Calculate j(3). -10 Let g(u) = 5u3 - u2 + 1. Let f(h) = h - 2. Let d be f(4). Suppose 0 = 3x - 5x - d. Calculate g(x). -5 Suppose 0 = 3r - 2 + 5. Let k(z) = 13z + 6. Let n be 26/4-1-2. Let j(a) = -27a - 13. Let p(l) = nk(l) + 6j(l). What is p(r)? -7 Let q be ((3/(-3))/(-2))/(3/(-36)). Let p(a) = 2a*2 + 8a - 5. Give p(q). 19 Let o(g) be the third derivative of 1/12g4 + 0 + 0g + 0g3 + 9g*2. Give o(-1). -2 Let b(i) = -2i*3 - 7i*2 - 5i - 3. Let t(p) = p*2 + p. Let d(y) = -b(y) - 4t(y). Let f(l) = -l3 + l2 - l. Let h(s) = d(s) + f(s). Determine h(-3). 12 Suppose 2p + q = 23, -q - q = -2p + 8. Let g(v) = -v + 14. What is g(p)? 5 Let v(y) = 5y3 + 3y*2 + 17. Let c(s) = -3s3 - s2 - 9. Let m(q) = 7c(q) + 4v(q). Determine m(5). 5 Let i(b) = 5b + 2. Let v(j) = -1 + 4j + 3 - j + 3j. Let k(s) = 3i(s) - 2v(s). Determine k(-4). -10 Let r(a) = 10a - 1. Let j(n) = -n3 + n2 - 1. Let f be j(0). Calculate r(f). -11 Suppose 0s + 2s - 19 = 5r, -5s = 5r + 5. Let h(i) = -2i3 - i2 + i. What is h(s)? -18 Let p(a) = 3a - 5. Let q(x) = x2 - 12x. Let o be q(8). Let k(y) = 9y - 32 - 4y + 9y + 6y. Let g(d) = op(d) + 5k(d). What is g(-2)? -8 Let n = -24 - -26. Suppose -4d + n + 1 = c, 5d = -5c. Let z(x) = -10x*2 - 2x - 1. Determine z(c). -9 Let a(h) = h*2 - 7h - 2. Let s = 29 - 21. Calculate a(s). 6 Let u(t) be the third derivative of t9/60480 + t8/6720 + t7/5040 - t5/30 - t*2. Let b(q) be the third derivative of u(q). Calculate b(-3). -3 Suppose 0c + 5w = -5c + 35, 0 = -2c - 3w + 16. Let m(s) = -s*3 + 4s*2 + 6s - 4. Calculate m(c). 1 Suppose 2 = -4r - 4o + 10, -2r - 3o + 4 = 0. Let k(z) = -2z*2 - 2	{ "pile_set_name": "DM Mathematics" }
3y2. -3y*3 - 37y Collect the terms in 835q + 14q*3 - 1830q + 995q. 14q*3 Collect the terms in 1 + 0 - 30d + 22d - 1 + 7d. -d Collect the terms in -38f3 + 60f*3 - 60f*3 - 150f + 150f. -38f*3 Collect the terms in 1815h*2 - 5h*3 + 1809h*2 - 3624h*2 + 3h*3. -2h*3 Collect the terms in 256424 + 24j*2 - 23j2 - 256424. j2 Collect the terms in -5z2 - 16z + 54z - 16z - 22z. -5z*2 Collect the terms in 14j*3 + 123477j + 15j3 - 123477j + j*3. 30j*3 Collect the terms in -216h + 43h3 + 216h. 43h3 Collect the terms in -661t - 768t + 1519t. 90t Collect the terms in 335g + 4 - 4 - 159g - 173g. 3g Collect the terms in -4w*2 + 434990097 - 434990097. -4w*2 Collect the terms in 2154t*2 - 1072t*2 - 1067t*2. 15t*2 Collect the terms in -1538 + 18k2 + 1496 - k2. 17k2 - 42 Collect the terms in 9851j*2 - 19690j*2 + 9847j*2. 8j*2 Collect the terms in 116301000y*2 - 116301000y*2 + 2y*3. 2y*3 Collect the terms in 58o*2 + 617o*2 - 2285o*2 - 1032o*2. -2642o*2 Collect the terms in -h + 0h - 227592586h3 + 227592583h*3 + h. -3h*3 Collect the terms in -21q*2 - 27q*2 - 37q*2 + 104q*2. 19q*2 Collect the terms in 38185 + 38189 - 2m + 38188 - 152755 + 38193. -2m Collect the terms in -37019o*3 + 74128o*3 - 36992o*3. 117o*3 Collect the terms in 3797 - 7638 + 22x*2 + 3841. 22x*2 Collect the terms in 7x - 44 - 1398 - 450. 7x - 1892 Collect the terms in 92q*2 - 45q*2 - 46q2 - 108. q2 - 108 Collect the terms in -1738 + 579 + 578 + 581 - 7t. -7t Collect the terms in -139 + 139 + 49r3 + 282r - 282r - 12r*3. 37r*3 Collect the terms in -32h + 7h + 2h + 5h - 26h. -44h Collect the terms in 58y*2 + 83y - 83y - 28y*2 - 36y*2. -6y*2 Collect the terms in -17052n*3 + 4 - 2 - 2. -17052n*3 Collect the terms in -301263 + 301263 + 351w*3. 351w*3 Collect the terms in 4 - 10p + 3p + 7p - 13p. -13p + 4 Collect the terms in 532506h3 - 1065107h*3 + 532606h*3. 5h*3 Collect the terms in 542136 - 11s*2 - 542136. -11s*2 Collect the terms in 21 + 73092463n*2 - 73092443n*2 - 21. 20n*2 Collect the terms in 213m*2 + 114m*2 - 334m*2. -7m*2 Collect the terms in 0 + 4 + 2 + 200m*2 - 51m*2. 149m*2 + 6 Collect the terms in -8892h + 2258h - 2173h. -8807h Collect the terms in -35 + 2u - 99 - 39 + 186. 2u + 13 Collect the terms in 9q + 10 - 8 + 2 + 20 + 0. 9q + 24 Collect the terms in 164z*2 + 183z*2 + 5z + 2 - 310z2 - 5z. 37z2 + 2 Collect the terms in -5691f*2 - 17f + 17f. -5691f*2 Collect the terms in 8502r2 - r3 + 0r3 - 8502r*2 - 53r. -r*3 - 53r Collect the terms in -80v + 98v + 0 + 15 - 2 + 0. 18v + 13 Collect the terms in 560w*2 - 12w + 12w. 560w*2 Collect the terms in -39k + 165613k3 + 39k - 165618k3. -5k*3 Collect the terms in 76i*2 + 1174i*2 + 108 - 108. 1250i*2 Collect the terms in 2i*2 + 248 + 245 - 500. 2i*2 - 7 Collect the terms in -55699 + 18564 + 18566 - 3z*3 + 18569 + 0z*3. -3z*3 Collect the terms in 44684f - 1 + 44684f + 3f*3 - 89368f + 1. 3f3 Collect the terms in 2w + 10w2 + w - 59w*2 - 3w + 42w2. -7w*2 Collect the terms in 195459l*2 - 10l*3 + 12l*3 - 195459l*2. 2l*3 Collect the terms in 2i*2 - 1189i*3 + 120i + 1186i3 - 2i*2 - 110i. -3i3 + 10i Collect the terms in -1 + 1 - 104572n2. -104572n*2 Collect the terms in -112c*2 - 138c*2 + 2c + 63c2. -187c*2 + 2c Collect the terms in 131 - 2n2 + 1966n - 1966n. -2n*2 + 131 Collect the terms in 31n - 31n - 380n*2 - 104n*2 - 59n*2. -543n*2 Collect the terms in 4r*3 - 2r*3 - 532 + 413. 2r*3 - 119 Collect the terms in -2l*2 + 108l*2 + 31l*2 + 5 - 6 + 185l*2. 322l2 - 1 Collect the terms in 1591 + 2869 - a2 - 4460. -a*2 Collect the terms in 14688t*2 + 136 - 136. 14688t*2 Collect the terms in 3004z*2 - 1510z*2 - 1488z*2. 6z*2 Collect the terms in -1371k - 1315k + 9k + 620k. -2057k Collect the terms in 3195p2 - 3195p*2 + 8p*3. 8p*3 Collect the terms in -147285y*2 + 147285y*2 + 23y + 3y3. 3y*3 + 23y Collect the terms in 2n2 - 32 + 7 - 3 + 28 - 6n*3. -6n*3 + 2n*2 Collect the terms in 89n*3 - 92n*3 + 14604n*2 - 14604n*2. -3n*3 Collect the terms in -1 - 2 - 70l*3 - 213l*3 - 1 + 7. -283l*3 + 3 Collect the terms in -1009k + 203 - 142k + 289k. -862k + 203 Collect the terms in -70481l*2 - 70477l*2 + 140960l*2. 2l*2 Collect the terms in 171605d*3 - 57195d*3 - 57194d*3 - 57217d3. -d3 Collect the terms in 4b2 + 68b*2 - 72b*2 + 2b*2 - 4b*2. -2b*2 Collect the terms in 23 + 26 - 199t*2 + 40t*2 - 49. -159t*2 Collect the terms in 1919t*3 - 1925t*3 - 92793 + 92793. -6t*3 Collect the terms in -695 - 695 - 112q + 1390. -112q Collect the terms in 4384s + 4481s - 8863s. 2s Collect the terms in -155q + 305q - 164q - 9. -14q - 9 Collect the terms in 558g - 558g - 121 + 3g*2. 3g*2 - 121 Collect the terms in -17707r*2 + 53112r*2 - 17708r*2 - 17705r*2. -8r*2 Collect the terms in -12 - 8498z + 12. -8498z Collect the terms in 199 - 5z*2 + 2z*2 - 97 - 100 + 871z. -3z2 + 871z + 2 Collect the terms in 284y + 130y - 414y + 3y*3. 3y*3 Collect the terms in 49 - 20j + 66 - 52. -20j + 63 Collect the terms in -59y*2 + 30y*2 + 34y*2 + 25y*2. 30y*2 Collect the terms in 2533 - 1274 + 50d*2 - 1259. 50d*2 Collect the terms in -43c - 32c + 24c - 4. -51c - 4 Collect the terms in 308086s - 87332s + 455389s - 71966s. 604177s Collect the terms in -10458f3 - 10438f*3 + 20905f*3. 9f*3 Collect the terms in -63g + 25g + 14g. -24g Collect the terms in -16662x*2 + 5157x*2 - 6175x*2. -17680x*2 Collect the terms in 341h + 337h - h3 - 1251h + 338h + 235h. -h*3 Collect the terms in 90c*3 - 70c - 215c3 + 70c + 86c3. -39c*3 Collect the terms in 3131l + 18319l3 - 1564l - 18314l3 - 1567l. 5l3 Collect the terms in -2s*2 - 36s*3 - 91s - 114s + 205s - 26s3. -62s*3 - 2s*2 Collect the terms in 21 - 12 - 1 - 3006b*3 - 10. -3006b*3 - 2 Collect the terms in 1704627369 + 4s*3 - 1704627369. 4s*3 Collect the terms in -4n*2 + 198051 - 198051. -4n*2 Collect the terms in -9737z*3 + 19507z*3 - 9749z*3. 21z*3 Collect the terms in -520d - 78d2 + 174d + 77d2 + 168d + 178d. -d2 Collect the terms in 162b - 146b - 17b. -b Collect the terms in -17g + 11g - 5g2 - 6g*3 + 15g*2. -6g*3 + 10g*2 - 6g Collect the terms in 5v + 7v - 8v - 4v + 3v. 3v Collect the terms in -12 - 51m + 365m - 19. 314m - 31 Collect the terms in 19p*3 - 44114p*2 + 2p + 44114p2. 19p*3 + 2p Collect the terms in 2413 - 4825 + 2412 - 1255c. -1255c Collect the terms in 130k3 - 35k*3 + 91k*3. 186k*3 Collect the terms in -352n*3 + 130n*3 + 127n*3 + 130n*3. 35n*3 Collect the terms in 6g*2 - 6g*2 + 853g*3 - 1764g*3 - 2376g*3. -3287g*3 Collect the terms in -367444w + 367444w + 13w*3. 13w*3 Collect the terms in 402d*2 + 43184 - 43184. 402d*2 Collect the terms in -327d + 663d - 326d. 10d Collect the terms in 9761m*2 + 9770m*2 - 19565m*2. -34m*2 Collect the terms in -322v - 367v + 692v. 3v Collect the terms in 3t - t + 2370459t2 - 2370493t*2. -34t*2 + 2t Collect the terms in -307l2 + 131l*2 + 167l*2. -9l*2 Collect the terms in 14 + 1498k - 1498k - 14 - 23k*2. -23k*2 Collect the terms in 57890u*2 + u + 57913u*2 - 115834u*2. -31u*2 + u Collect the terms in -6 - 1245o - 1573o + 1 + 5. -2818o Collect the terms in 5 + 13 - 4r + 7 - 35 + 10. -4r Collect the terms in -215p2 + 37p*3 - 220p*2 + 643p*2 - 212p*2. 37p*3 - 4p*2 Collect the terms in -29 + 649c*3 - 675c*3 - 24 + 53. -26c*3 Collect the terms in 37495p*3 - 643p*2 - 37490p*3 + 643p*2. 5p*3 Collect the terms in -722h + 1365h - 655h. -12h Collect the terms in -6p*3 + 11p*3 + 301p - 301p - 4p3. p3 Collect the terms in -5v3 - 858v + 858v + 11v*2. -5v*3 + 11v**2 Collect the terms in	{ "pile_set_name": "DM Mathematics" }
the biggest value? (a) -12 (b) 5 (c) -2/11 (d) 3/8 (e) -32 b What is the smallest value in 5, 1/6, -0.4? -0.4 What is the smallest value in -1, -1/5, 38.7? -1 What is the third smallest value in 1/2, -0.1, 19, -5? 1/2 Which is the smallest value? (a) -0.5 (b) 5 (c) 2/47 (d) 0.01 (e) 0.5 a What is the smallest value in -13.7, -3/2, -10/21? -13.7 Which is the biggest value? (a) 3 (b) 1/6 (c) 4 c Which is the second biggest value? (a) -11 (b) -0.4 (c) 4 b Which is the second biggest value? (a) -2/5 (b) -83 (c) -0.3 (d) -5 a Which is the second biggest value? (a) 6/11 (b) 1 (c) -0.2 (d) -14 (e) -2/3 a Which is the smallest value? (a) -0.4 (b) -3/5 (c) 2/43 (d) -0.2 (e) 0.3 b Which is the biggest value? (a) 0.6 (b) -0.4 (c) 3/4 (d) 2/9 (e) -1 c What is the second biggest value in 0.5, -3, -154.7? -3 What is the third smallest value in -1, -1.88, -1/3? -1/3 Which is the second biggest value? (a) 12 (b) 12/5 (c) 0.8 b Which is the smallest value? (a) 2/3 (b) 3/10 (c) -91 c Which is the third biggest value? (a) 4 (b) -2/69 (c) 5/4 (d) 0.2 d What is the fifth biggest value in 1/2, 2/7, 4, -56, 3/5? -56 Which is the fourth smallest value? (a) 0.3 (b) 2 (c) -210 (d) -4 b Which is the smallest value? (a) 1 (b) 2.2 (c) 0 c What is the fourth biggest value in -2/15, -409, -2/5, 0.1? -409 What is the fourth smallest value in 1, -1, 1/2, -32? 1 Which is the fifth biggest value? (a) 1 (b) -39/2 (c) 1/10 (d) -12 (e) -3/4 b Which is the second biggest value? (a) -1/4 (b) 2 (c) 42 b Which is the third smallest value? (a) 8 (b) -1/4 (c) 24 (d) 3/5 a Which is the third biggest value? (a) -435/4 (b) -1/3 (c) -0.3 a Which is the fourth smallest value? (a) -4 (b) -0.2 (c) 107 (d) 1 c What is the second smallest value in -2/3, 45, -2? -2/3 What is the second smallest value in 4, 1, -0.06? 1 What is the smallest value in -0.3, -3, 22, -44, 2? -44 Which is the fourth biggest value? (a) -73 (b) 0.5 (c) 2 (d) 0.1 (e) -1.7 e What is the second biggest value in -1, -4.3, 9? -1 What is the third biggest value in 0, 6, -0.5, -3/2, -5? -0.5 Which is the third biggest value? (a) 1/4 (b) 17 (c) -2/11 c Which is the biggest value? (a) 6 (b) -14 (c) 2/13 (d) -4/5 a Which is the third biggest value? (a) -3 (b) 3 (c) 4 a What is the second smallest value in -0.2, 7, 2? 2 Which is the second smallest value? (a) -2/9 (b) -59/3 (c) -0.5 (d) 1 c What is the smallest value in 0, -4/5, 116/9? -4/5 What is the third biggest value in 5, 2, -0.04, 0.1? 0.1 Which is the third biggest value? (a) 2 (b) -0.04 (c) -164 c Which is the fifth smallest value? (a) 0.5 (b) 2/3 (c) 35 (d) 3 (e) -0.3 c What is the third biggest value in -2/13, 0, 0.3, -2/3? -2/13 What is the second biggest value in -132, 1/4, 2/3? 1/4 What is the third biggest value in 3/2, -0.1, -325, 3? -0.1 What is the third biggest value in 0.4, -2/3, -1/9, -0.3? -0.3 Which is the fourth smallest value? (a) 2 (b) -0.9 (c) 0.09 (d) 4 (e) 0.4 a What is the third biggest value in -0.2, -10, 2, -2? -2 What is the biggest value in -2/7, -24, 4, 0? 4 What is the biggest value in -2/7, 79, -3/2? 79 Which is the third smallest value? (a) 1/3 (b) 4/13 (c) 0 (d) -3 b Which is the second biggest value? (a) 4 (b) -6 (c) -3/2 c Which is the third smallest value? (a) -3/5 (b) -12/19 (c) 0.5 (d) -5 (e) 4/3 a Which is the fourth biggest value? (a) 0 (b) 4 (c) 29 (d) -4/7 d What is the second smallest value in -3/4, 9, 0.4, 95? 0.4 Which is the biggest value? (a) 1 (b) -5 (c) 0.1 (d) -1 a What is the smallest value in -0.2, 7, 5, -1/11? -0.2 Which is the smallest value? (a) -4 (b) -6/11 (c) -1928 c What is the biggest value in -2/17, 1.4, -5, 0.2? 1.4 What is the third biggest value in -32, 0.1, 3? -32 Which is the second biggest value? (a) 0.1 (b) 35 (c) 0.3 c Which is the second smallest value? (a) 0.1 (b) -7.9 (c) -3 c Which is the smallest value? (a) 4 (b) -5 (c) 0.018 b Which is the biggest value? (a) -2/11 (b) 13 (c) 6.5 b Which is the third biggest value? (a) 0 (b) 1/2 (c) -4/23 (d) 1 a Which is the smallest value? (a) -1 (b) -4 (c) 0.01 (d) 0 b Which is the biggest value? (a) 290 (b) -4 (c) 5 (d) 0 a Which is the biggest value? (a) -1.1 (b) -5 (c) -0.02 (d) -3/5 c Which is the biggest value? (a) -1.09 (b) -12 (c) 4 c What is the smallest value in 31, 5/4, 5, -4/7? -4/7 What is the second smallest value in 4, -3, -0.3, 2/7? -0.3 What is the second biggest value in 7, 0.09, -0.5, 1/3? 1/3 What is the second biggest value in -3/7, 5, -17, 2/13, 1? 1 Which is the biggest value? (a) -80 (b) 2/13 (c) 3/8 c What is the smallest value in -0.1, -19, -4, 3/28? -19 What is the second biggest value in -219, -0.5, -1/33? -0.5 What is the smallest value in -3/8, -5, 8/9, 0.7? -5 Which is the third biggest value? (a) 14.71 (b) 1/5 (c) 4 b Which is the second biggest value? (a) -14 (b) 5/6 (c) -0.037 (d) -5 c Which is the second smallest value? (a) 0 (b) 9 (c) -0.2 (d) 1/3 (e) -1 c What is the third biggest value in 7/3, -0.4, -0.1? -0.4 Which is the third biggest value? (a) 1.2 (b) 0.4 (c) 3/13 c Which is the third smallest value? (a) -4.65 (b) -0.1 (c) -0.2 b Which is the second biggest value? (a) 0.5 (b) -4 (c) 283 a Which is the smallest value? (a) 1 (b) 175 (c) -0.07 c What is the second smallest value in 0.4, -2/7, -28, -3, 0? -3 Which is the biggest value? (a) 0.105 (b) -0.3 (c) -4 (d) 1 d What is the third smallest value in 0, 7953, 0.1? 7953 What is the third biggest value in 4/7, 2, -79? -79 Which is the third smallest value? (a) 0.13 (b) -5 (c) 2 (d) -3/4 a Which is the third smallest value? (a) 7 (b) 3 (c) 5 a What is the biggest value in -1/17, 1, -4, -5, 3/5? 1 Which is the fifth biggest value? (a) -5 (b) -28 (c) 0.2 (d) 4 (e) 11 b Which is the smallest value? (a) 0.5 (b) -12/7 (c) -6 (d) -1 c What is the fourth biggest value in 2/9, 0.4, -2/19, 0.123, 2? 0.123 What is the biggest value in -2, -126, 5? 5 What is the fifth smallest value in 2/11, 0, -1/6, -0.2, -0.4? 2/11 What is the biggest value in -2/11, -10, 74? 74 What is the third smallest value in 3, -452/25, -1/10? 3 Which is the third smallest value? (a) -3 (b) -1 (c) -2/143 (d) -7 b What is the third smallest value in 5, 6, 41? 41 Which is the smallest value? (a) 0.2 (b) -10 (c) 2/11 b What is the biggest value in 7, 6/11, 1/4, -5? 7 Which is the smallest value? (a) -6/7 (b) -0.05 (c) 0.3 (d) 3 (e) 0.04 a What is the third smallest value in 1, -45, 4, -1/8, 3/10? 3/10 Which is the second smallest value? (a) -4/3 (b) -3 (c) -1.5 c Which is the third smallest value? (a) -2/7 (b) 0.8 (c) -1/6 b What is the third smallest value in 0.2, -1/5, -517, 3, 4? 0.2 Which is the smallest value? (a) 2 (b) 534 (c) 2/21 c What is the third smallest value in 7, -8/29, 0.5? 7 What is the second biggest value in -2/83, -5, 2/7? -2/83 Which is the fifth smallest value? (a) 3 (b) 1.7 (c) -4 (d) -3 (e) 4 e Which is the smallest value? (a) -0.2 (b) 0.6 (c) 1 (d) 2.6 (e) 1/3 a Which is the smallest value? (a) -0.1 (b) 0.1 (c) -0.2 (d) -3/2 d Which is the second smallest value? (a) 4 (b) 0.1 (c) 90 (d) -0.014 b Which is the second biggest value? (a) 0 (b) 18 (c) 1 (d) 2.4 d Which is the third biggest value? (a) -0.1 (b) 27 (c) 0 (d) 0.5 c Which is the second smallest value? (a) 0.3 (b) -0.5 (c) 444 a What is the second smallest value in -2/7, 41, 1/4? 1/4 Which is the fourth biggest value? (a) 21/8 (b) 0 (c) 3 (d) -6 d Which is the biggest value? (a) -0.033 (b) 4/3 (c) -2/9 (d) 0.1 b Which is the second smallest value? (a) 14 (b) 0.1 (c) 3/28 c Which is the biggest value? (a) -0.2 (b) 5 (c) 3 (d) -0.7 b Which is the smallest value? (a) 0 (b) 55 (c) 5 (d) -0.4 d Which is the third biggest value? (a) 54 (b) 0.1 (c) -0.2 c What is the smallest value in -1, -9, 0.5, 7, -3? -9 Which is the third smallest value? (a) -0.5 (b) 3/73 (c) 5/4 (d) -5 b What is the third biggest value in -3/5, 4, 0.5, 3/2? 0.5 Which is the third smallest value? (a) 2 (b) 4/7 (c) 0.3 (d) 6/13 (e) -0.1 d Which is the smallest value? (a) -2 (b) -5 (c) 3/4	{ "pile_set_name": "DM Mathematics" }
uppose -5g + 47 = -i. What is the units digit of g? 7 Let m = -240 - -1482. What is the thousands digit of m? 1 What is the hundreds digit of 6 - (7 - 10105)/9? 1 Let s(p) = 2p - 5. Let q be s(0). Let y(z) = 6z2 + 9. What is the hundreds digit of y(q)? 1 What is the tens digit of (-140)/(-18) - 8 - (-122770)/45? 2 Suppose 5c + 244 - 919 = 0. What is the units digit of c? 5 Suppose -773 = -5a + 3387. What is the hundreds digit of a? 8 Suppose -n + 63 = 5. Let i = -30 + n. What is the tens digit of i? 2 Let r(f) = 5f*2 - 7f + 1. Let t be r(3). Suppose -5q - 5p + 675 = 0, -2p + 7p - t = 0. What is the hundreds digit of q? 1 What is the tens digit of (-218436)/109(-14)/8? 0 Suppose 4l = 3q - 31, q - 2 + 13 = -4l. Suppose -5m - 5s + 185 = 0, -qs - 53 = -3m + 82. Suppose -m - 36 = -4x. What is the tens digit of x? 1 Let z = 11 + -9. What is the tens digit of -6 - -5 - z-19? 3 Suppose 5k - 5l = 1705, l - 668 - 375 = -3k. Suppose -4n + 3y = n - k, 138 = 2n - y. What is the tens digit of (11 + -14)/((-6)/n)? 3 Let w(v) = 3v + 25. Let c be w(-6). Let a(s) = s2 + s + 15. What is the units digit of a(c)? 1 Suppose 4x = 2k + 14, 3x - 4k = -7k + 15. Suppose -2r - xs + 158 = 0, 4r - 229 = r - 4s. What is the tens digit of r? 7 Let t(k) = -19k + 173. What is the tens digit of t(7)? 4 Suppose -v + 12 + 9 = 0. Suppose -3z - v = -6z. Suppose m - 4 = z. What is the tens digit of m? 1 Let z = 11 + -7. Suppose -i + 5o + 57 = 0, 4o = zi + 3o - 171. What is the tens digit of i? 4 Suppose -4j + k - 3k + 1258 = 0, 2j - 3k = 617. What is the units digit of j? 3 Let f(o) = 2o - 3. Let i be f(11). Suppose 2a - 8 = -l, 4 + i = 5a + l. Suppose 2g - 5 = 5c - 3g, ag = 10. What is the units digit of c? 1 Let m = -11 + -14. Let v = m + 36. Suppose 0 + v = l. What is the units digit of l? 1 Let c(s) = -936s + 161. What is the hundreds digit of c(-3)? 9 Let i(c) = 1961 + 5c + 0c3 - 1946 - 7c2 + c3. What is the hundreds digit of i(9)? 2 Suppose 114 + 102 = -8q. What is the units digit of (95 - -4)3/q-3? 3 Let f(b) = -10b - 1. Let i(a) = a*2 - 15a - 12. Let z be i(16). Let r be -6 - (-12)/(z - 0). What is the units digit of f(r)? 9 Suppose 0 = -34m - 52m + 203046. What is the thousands digit of m? 2 Let h(t) = t*2 - 6t + 8. Let s be h(4). What is the units digit of 44 - (3/(-3) + s)? 5 Let i(z) = 948z2 - 11z + 12. What is the hundreds digit of i(1)? 9 Let g = -311 + 366. Let q be (-127)/(-2) + (-2)/4. Suppose q + g = 2h. What is the units digit of h? 9 Suppose d + d - 4z - 32 = 0, -4z + 64 = 2d. Suppose -2s - 4s = -d. What is the units digit of s? 4 Suppose 4y + 2o - 6o = 1228, 3o = 2y - 611. Let x = y + -142. Suppose -12 = -3v, -4g + x = -4v - v. What is the tens digit of g? 4 Let i(d) = -34d + 23. Let y be i(-8). Let l be 4 + (-5)/((-25)/y). What is the tens digit of (-76)/7l/(-18)? 3 Suppose 64b - 59b = 905. What is the units digit of b? 1 Let t = 2457 + -1341. What is the thousands digit of t? 1 Let j(z) = -69z - 3. Let t be j(-1). Let i be (t - 9) + (-8)/(-2). Let l = 112 - i. What is the tens digit of l? 5 Let l(q) = -42q - 46. What is the hundreds digit of l(-11)? 4 Suppose 12i - 71i = -9735. What is the tens digit of i? 6 Suppose 0 = 5r + 5r - 3050. What is the hundreds digit of r? 3 Let v(t) = -t*2 - 7t - 5. Let z be v(-6). Suppose -o - z = 8. Let d(m) = m*2 + 8m - 7. What is the units digit of d(o)? 2 Suppose 233 + 49 = -5c + 4d, -4c + 3d - 225 = 0. What is the tens digit of (4/6)/(-2 + (-111)/c)? 1 Suppose 4u + 206 = y - 6y, 0 = 4u + 16. Let r = -16 + y. What is the units digit of (r/(-1) - 3)/1? 1 Let b be 6/3 - (21 - 2). Let t = -14 - b. Suppose m - 3s - 32 = 0, -104 = -8m + tm + s. What is the units digit of m? 0 What is the tens digit of (2/(-4))/(1/(-674))? 3 Suppose 2j + 1 = 2b + 9, 2j - 4b - 8 = 0. Suppose -jq = 8 - 28. Suppose 24 = z - qo, o - 6 = 4o. What is the units digit of z? 4 Suppose 0 = -25h - 45h + 171570. What is the units digit of h? 1 Let m = -191 + 234. What is the tens digit of m? 4 Let i be 12((-117)/(-12) + -4 + -1). Suppose 35m = 38m - i. What is the tens digit of m? 1 Let o = 340 - 262. What is the tens digit of o? 7 Suppose -2y - 2n = -5n + 195, -y - 91 = 5n. Let f = 99 + y. What is the units digit of f? 3 Let d = 32 + -14. Let l = d - 13. Suppose 51 = 3c + 3w, lw - 6 = 9. What is the units digit of c? 4 Suppose -10l + 14l = 208. What is the units digit of l? 2 Let j = 126 + 451. What is the tens digit of j? 7 Let w(f) = 3f*2 + 46f + 25. What is the tens digit of w(-18)? 6 Let h(x) = x*2 - x + 4. Suppose -6f + f + 20 = 0. Let b be 1 + (-3)/(12/f). What is the units digit of h(b)? 4 Let u(g) = -g*2 + g + 1. Let v(f) = 47f*2 + 10f + 3. Let k(z) = -3u(z) + v(z). What is the hundreds digit of k(-2)? 1 What is the tens digit of 42/6 - -605 - 3? 0 Suppose -3z - 3x = 6, 0z - 2x - 10 = -z. What is the tens digit of z(-12)/2(-2 + 0)? 2 Let x(b) = -5b*2 + 3b - 2. Let f be x(3). Let z = f + 86. What is the units digit of ((-3)/4)/((-4)/z)? 9 Let j(i) = 14i2 - 93i - 31. What is the tens digit of j(19)? 5 Suppose -3z + 4s = -1585, -2z + 4z + 4s = 1070. Suppose -10a + z + 1569 = 0. What is the tens digit of a? 1 Suppose 11 = 4f - 69. Let z = 25 + -22. Suppose -4a + 4x + 27 = z, -5x = -f. What is the tens digit of a? 1 Suppose 3961 = 158g - 157g. What is the units digit of g? 1 Let t(j) be the third derivative of j7/1260 - j6/90 - 2j5/15 + 7j*2. Let x(p) be the third derivative of t(p). What is the units digit of x(7)? 0 Let d = 29 + -20. Let f be 22/(-99) - (-65)/d. What is the units digit of (-59)/(-3) + f/21? 0 Suppose 0 = 10a - 144 - 536. Suppose 0 = g + a - 366. What is the tens digit of g? 9 Let y = -117 + 53. Let a = 160 + y. What is the tens digit of a? 9 Let h = 63 - 61. Let v = 51 - h. What is the tens digit of v? 4 Let l = 101 + 82. What is the units digit of l? 3 Suppose -141c + 143c - 1014 = 0. What is the tens digit of c? 0 Suppose p - 5 - 20 = -4b, 3p = b + 10. What is the hundreds digit of b/(-15)3 - -142? 1 Suppose -43v + 48978 = -16v. What is the units digit of v? 4 Suppose 3t = -t - 3n + 223, -4n = -20. Suppose 2l + x = -l + t, -3x + 12 = 0. Suppose l = 4u - 4. What is the units digit of u? 5 Suppose -2b + 382 = -3x, 0 = 2x + b - 0b + 250. Let z = -238 - x. What is the tens digit of (-4)/(-14) + (-2544)/z? 2 Let i(l) = -3l*2 - 35l + 5. What is the hundreds digit of i(-5)? 1 Let j = -3896 - -6281. What is the tens digit of j? 8 Suppose -6361 = -4c + 3g, -10c - 2g + 7957 = -5c. What is the thousands digit of c? 1 Let l(u) = -2u*3 - 6u*2 - 17u + 3. Suppose -3c + 11 = 23. What is the units digit of l(c)? 3 Let l be (4 + -3)1 - -20. Let n be 4/6 - l/(-9). Suppose 0 = -b + nb - v - 84, 5b - 212 = 2v. What is the units digit of b? 4 Suppose 0k + a - 10 = 3k, -4k - 16 = -2a. Let y be (-2)/(k4/12). Suppose -yo = -b - 137, -b = -3b - 10. What is the tens digit of o? 4 Let d(i) = i*3 - 7i*2 - 11i - 7. Let k be d(8). Let a = 62 - 149. Let l = k - a. What is the tens digit of l? 5 Let j(m) be the third derivative of 11m5/30 - m4/24 + m3/3 + 11m*2. What is the tens digit of j(1)? 2 Let r(x) be the first derivative of 2x*3 - 5x*2/2 - 4x - 19. What is the tens digit of r(4)? 7 Let x = -8 + 16. Suppose -2v = -3v + 4m + x, -7 = -v + 3m. Suppose -2b + 46 = vg, -3 + 0 = -3g. What is the tens digit of b? 2 Suppose f - 34 = 4r - 15, 2r - 13 = -f. What is the units digit of (-2 - (4 - f))19? 1 Suppose -b + w - 18 = -4w, 0 = 3b + 3w - 36. Let l be b + 1 + -4 - 0. Suppose 2 = -2r + lx, -3r + x + 27 = 5x. What is the units digit of r? 5 Suppose 5x + 6 - 31 = 0. Let j(o) = o + 39. Let z be j(20). Suppose 0 = xl - k - 35 - z, -3l = 5k - 62. What is the units digit of l? 9 Let l(t) = t3 - 26t*2 - 112t - 8. What is the hundreds digit of l(30)? 2 Suppose -4u - 4g = -32, -g = -4u - 2g + 29. Let c = u - 16. What is the units digit of (c/6)/((-2)/4)? 3 Suppose 17r - 17771 = -3933. What is the units digit of r? 4 Suppose -4q = -3d - 69, 75 = 3q + q - 5d. Let s(f) = f2 - 9f - 19. What is th	{ "pile_set_name": "DM Mathematics" }
order. 12, 3, -641 Sort 43, 27, 5. 5, 27, 43 Sort -0.1, -1, 2/9, -48 in decreasing order. 2/9, -0.1, -1, -48 Put 2, -1, 1.1 in decreasing order. 2, 1.1, -1 Put 2, -14, -1, 14 in increasing order. -14, -1, 2, 14 Put -3/4, 0.3, -19/2 in decreasing order. 0.3, -3/4, -19/2 Put -40, -6, 1/6 in decreasing order. 1/6, -6, -40 Sort 8, -13, 2 in descending order. 8, 2, -13 Sort 4, 2/7, -2/83, -1/4 in increasing order. -1/4, -2/83, 2/7, 4 Sort 5, 0.2, -905, -3/2, -3 in increasing order. -905, -3, -3/2, 0.2, 5 Sort 0, 5, 2, -1 in increasing order. -1, 0, 2, 5 Put -5/2, 1/2, 4, 0.3 in ascending order. -5/2, 0.3, 1/2, 4 Sort -2, -58, 4. -58, -2, 4 Put -5, -8, -1, -2 in increasing order. -8, -5, -2, -1 Sort 2, -4, -0.3, -14. -14, -4, -0.3, 2 Sort 9, 7, 0, -3. -3, 0, 7, 9 Put 38, -58, 1, -2 in decreasing order. 38, 1, -2, -58 Put 10/3, 5, -2 in ascending order. -2, 10/3, 5 Put 0, 26, 1 in descending order. 26, 1, 0 Sort -5, 3, -3, 4 in descending order. 4, 3, -3, -5 Put 3, 1, 2, 4, 317 in ascending order. 1, 2, 3, 4, 317 Sort -4, 8, -3, -6 in increasing order. -6, -4, -3, 8 Sort 144, -1/5, 3 in ascending order. -1/5, 3, 144 Sort 2, 3, -129, 5, -4 in descending order. 5, 3, 2, -4, -129 Sort -17, 4, 16, -5, -1 in ascending order. -17, -5, -1, 4, 16 Put -3, -4, 110, -7, 5 in ascending order. -7, -4, -3, 5, 110 Put -1, 1, -2, 29, -4 in decreasing order. 29, 1, -1, -2, -4 Put 3, 381, 2, 1 in decreasing order. 381, 3, 2, 1 Sort -10, -4, 2 in increasing order. -10, -4, 2 Put -0.1, -1252, 0.3 in descending order. 0.3, -0.1, -1252 Put -3, -37, 3, -1 in decreasing order. 3, -1, -3, -37 Sort -18/7, 0.4, -2, 0.5. -18/7, -2, 0.4, 0.5 Sort -854, 3, 1 in descending order. 3, 1, -854 Put 7, 0, -7 in ascending order. -7, 0, 7 Put -3, 11, -5, 3 in ascending order. -5, -3, 3, 11 Put 10, -2, -45 in descending order. 10, -2, -45 Sort -7, 3, -5, -13 in ascending order. -13, -7, -5, 3 Sort 8993, -3, 1 in ascending order. -3, 1, 8993 Sort 4, -4, 0.5, 0, 34 in decreasing order. 34, 4, 0.5, 0, -4 Put -448, -3, -4, 0, 2 in ascending order. -448, -4, -3, 0, 2 Sort 5, -12, -6, 2 in descending order. 5, 2, -6, -12 Put -0.4, -22, -5, 0.5 in descending order. 0.5, -0.4, -5, -22 Put -2, -0.4, -1/6, -4/31 in descending order. -4/31, -1/6, -0.4, -2 Put -7, -3, -5, -2 in descending order. -2, -3, -5, -7 Sort -1, 1, 3/8, -4, 10/3. -4, -1, 3/8, 1, 10/3 Sort -0.1, -13, 0 in ascending order. -13, -0.1, 0 Sort 125, -3, -1, -5 in decreasing order. 125, -1, -3, -5 Sort 2/17, 5, 0.4, -0.02 in descending order. 5, 0.4, 2/17, -0.02 Sort -0.3, -29.5, 3, -2. -29.5, -2, -0.3, 3 Sort -89, 1, -10 in increasing order. -89, -10, 1 Sort 5, 2, 1, 40 in decreasing order. 40, 5, 2, 1 Put 4, -89, -3 in increasing order. -89, -3, 4 Sort 1, -3, -5 in decreasing order. 1, -3, -5 Put -2/11, -3, 1, 3/325 in decreasing order. 1, 3/325, -2/11, -3 Put 36, -1, 14, -5 in decreasing order. 36, 14, -1, -5 Sort -2/9, 17, 3, -0.06 in descending order. 17, 3, -0.06, -2/9 Sort -14, 0.5, 1, 0 in ascending order. -14, 0, 0.5, 1 Put -5, 1/8, 1, 3 in descending order. 3, 1, 1/8, -5 Sort 0, -1, -3, -2, 699 in descending order. 699, 0, -1, -2, -3 Put -10, 1, 78, -2 in ascending order. -10, -2, 1, 78 Sort -1, 567, 0.2 in increasing order. -1, 0.2, 567 Put 415, 5, 0 in increasing order. 0, 5, 415 Sort 2, 0.06, -2/25 in descending order. 2, 0.06, -2/25 Sort 2, -3, -160, -5 in ascending order. -160, -5, -3, 2 Sort -2/9, 7/3, 1/3, -1, -0.1 in ascending order. -1, -2/9, -0.1, 1/3, 7/3 Sort -0.05, -4, 6, -18 in descending order. 6, -0.05, -4, -18 Put -2, -5, -1, 228, 3 in decreasing order. 228, 3, -1, -2, -5 Put -1/2, -4, 3.6 in increasing order. -4, -1/2, 3.6 Put -6, -0.15, 0.4, -1 in decreasing order. 0.4, -0.15, -1, -6 Sort 3, 5, 16, 0 in descending order. 16, 5, 3, 0 Sort 19, -0.1, -6/5, -0.2, 2/15. -6/5, -0.2, -0.1, 2/15, 19 Put -7, 4, -3/82 in decreasing order. 4, -3/82, -7 Put -2, 12, 2 in descending order. 12, 2, -2 Sort 2, -3, -9 in decreasing order. 2, -3, -9 Sort 10, -1, -2, 5, 6 in increasing order. -2, -1, 5, 6, 10 Put -227, -4, 5 in decreasing order. 5, -4, -227 Sort 0, 1, -1, 4 in increasing order. -1, 0, 1, 4 Sort -4, 3, 4, -3 in decreasing order. 4, 3, -3, -4 Sort 8, 5, 41 in ascending order. 5, 8, 41 Put 0.4, 5, -16/51, -0.2 in descending order. 5, 0.4, -0.2, -16/51 Sort -0.5, -0.3, -3, 0.3 in descending order. 0.3, -0.3, -0.5, -3 Sort 33, 5, -3, 0. -3, 0, 5, 33 Sort -71, -2, 0 in increasing order. -71, -2, 0 Sort 3, -1/4, 12 in descending order. 12, 3, -1/4 Sort -28, 18, 1 in ascending order. -28, 1, 18 Put -2/3, -2, 2/9, 0.082, 1/3 in increasing order. -2, -2/3, 0.082, 2/9, 1/3 Put -2, -18, 2, 5 in descending order. 5, 2, -2, -18 Put -1, -3, 697 in decreasing order. 697, -1, -3 Sort 972, 3, -1. -1, 3, 972 Sort -3, 4, -2.1, 1/7 in descending order. 4, 1/7, -2.1, -3 Sort -1/4, -0.3, 0.07, 3 in ascending order. -0.3, -1/4, 0.07, 3 Put -1/8, 0, -0.2, -3 in ascending order. -3, -0.2, -1/8, 0 Sort -4, -1, 3, 88, 4/9. -4, -1, 4/9, 3, 88 Sort -5, 4, 1442 in increasing order. -5, 4, 1442 Sort -1/3, -20, 0.1 in ascending order. -20, -1/3, 0.1 Put 0, 2, 6 in ascending order. 0, 2, 6 Put -12, -3, 139 in decreasing order. 139, -3, -12 Sort 178, -0.7, 0.4, 8 in decreasing order. 178, 8, 0.4, -0.7 Sort -5, 239, 4, -2, 1/9 in decreasing order. 239, 4, 1/9, -2, -5 Put -0.1, 1/6, 45, 11, 1 in descending order. 45, 11, 1, 1/6, -0.1 Sort 5, -4, 46. -4, 5, 46 Put 2, 0, 23, -4 in increasing order. -4, 0, 2, 23 Put 38, -2, -5, -4 in ascending order. -5, -4, -2, 38 Put -0.3, 21.4, -4 in ascending order. -4, -0.3, 21.4 Put 21.6, -1, -7/4 in increasing order. -7/4, -1, 21.6 Sort 13/4, 2, -1/6. -1/6, 2, 13/4 Put -14/9, -1/3, -0.06 in ascending order. -14/9, -1/3, -0.06 Sort 2, -9, 6, 4 in increasing order. -9, 2, 4, 6 Sort -1, -2, 51 in ascending order. -2, -1, 51 Put -2, -15, -623 in decreasing order. -2, -15, -623 Put -0.5, 0.58, 1/4, -2/11 in descending order. 0.58, 1/4, -2/11, -0.5 Sort 1/7, -2, -0.078, 3/4, -3 in descending order. 3/4, 1/7, -0.078, -2, -3 Put -41, 0, -3 in ascending order. -41, -3, 0 Sort -0.088, 0.5, 2 in decreasing order. 2, 0.5, -0.088 Put 5, 0, -91, 3, -3 in descending order. 5, 3, 0, -3, -91 Put -3, 0, -2, 4 in increasing order. -3, -2, 0, 4 Sort 3, -4, 6, 10, 1 in descending order. 10, 6, 3, 1, -4 Sort -2/87, -30/17, -2/19. -30/17, -2/19, -2/87 Put 2, -1, 4, 1, -3 in decreasing order. 4, 2, 1, -1, -3 Sort 5/6, -4, 3, -3/2. -4, -3/2, 5/6, 3 Put -3, -1, 73 in ascending order. -3, -1, 73 Put -241, -4, 3 in increasing order. -241, -4, 3 Sort 7, -12, -0.4, -1. -12, -1, -0.4, 7 Put -111, 11/3, -2, 1/4 in descending order. 11/3, 1/4, -2, -111 Sort 5, 20/11, 2/3, -0.11 in increasing order. -0.11, 2/3, 20/11, 5 Put 14, -1, 3 in descending order. 14, 3, -1 Sort -12, 3, 10/7, -3. -12, -3, 10/7, 3 Sort 2, -0.1, -0.3, -23/5 in ascending order. -23/5, -0.3, -0.1, 2 Sort 0, -5, -8, -1 in decreasing order. 0, -1, -5, -8 Sort -0.094, -0.2, -3/4 in descending order. -0.094, -0.2, -3/4 Sort -3/4, -26, 2/9. -26, -3/4, 2/9 Put 15, -0.44, -1 in ascending order. -1, -0.44, 15 Put 9, 4, -51, -4 in increasing order. -51, -4, 4, 9 Sort 3, 0, 6. 0, 3, 6 Sort 0.04, 0.2, -6, -6.9 in increasing order. -6.9, -6, 0.04, 0.2 Sort 3537, -5, 3 in decreasing order. 3537, 3, -5 Sort 3/4, -2/29, -1/3, -0.9 in increasing order. -0.9, -1/3, -2/29, 3/4 Put -1, 1, 4, -3 in ascending order. -3, -1, 1, 4 Put 5, 44, 12, 3 in ascending order. 3, 5, 12, 44 Sort -24, 5, 12, 4, 10 in descending order. 12, 10, 5, 4, -24 Sort -3, 4, 2, 26 in decreasing order. 26, 4, 2, -3 Sort -10, 0, 22 in increasing order. -10, 0, 22 Sort -1, -12/7, -4, -1/3. -4, -12/7, -1, -1/3 Sort -0.3, 0.2, 11, 5 in decreasing order. 11, 5, 0.2, -0.3 Put 3, 72, -3, 2 in decreasing order. 72, 3, 2, -3 Sort 52, -0.3, -6 in ascending order. -6, -0.3, 52 Put -4, -1, -2/15 in ascending order. -4, -1, -2/15 Put -4, 1, 3, -5, 334 in increasing order. -5, -4, 1, 3, 334 Put -55, -0.1, 2/7 in ascending order. -55, -0.1, 2/7 Put 5, -185, -0.4, -43 in increasing order. -185, -43, -0.4, 5 Sort 3, 1, 919, -3 in increasing order. -3, 1, 3, 919 Sort -13, -3, -1, 8 in descending order. 8, -1, -3, -13 Put 1, -2/11, 1/2, -5, 1/7 in increasing order. -5, -2/11, 1/7, 1/2, 1 Put 6, 3, -111 in decreasing order. 6, 3, -	{ "pile_set_name": "DM Mathematics" }
In base 9, what is -231 + -3183126? -3183357 In base 4, what is 3303 + -1132111? -1122202 In base 11, what is 5817 - -851? 6568 In base 7, what is -51025233 + -3? -51025236 In base 15, what is -3a5 + -6232? -65d7 In base 11, what is 3 - -5369862? 5369865 In base 5, what is -122 - 113002130? -113002302 In base 14, what is 472 + -85c? -3ca In base 12, what is 334 + -8045? -7911 In base 16, what is 2 - ef20a6? -ef20a4 In base 2, what is -1011011111 + 100010111110101100? 100010110011001101 In base 4, what is -10 - -1320213121320? 1320213121310 In base 13, what is 2770 - -1698? 4138 In base 11, what is 15 - -1570772? 1570787 In base 6, what is 2 + -2440100? -2440054 In base 11, what is 6667379 + -aa? 666727a In base 4, what is -11 - -31010001032? 31010001021 In base 6, what is -123 + 23033055? 23032532 In base 11, what is -254 + 71a36? 71792 In base 12, what is -27 - 3b4b98? -3b5003 In base 7, what is 1534 - -236600? 241434 In base 13, what is 325 + 6436? 675b In base 14, what is 116 + -2c0366? -2c0250 In base 11, what is 3 + 202413030? 202413033 In base 16, what is 1454659 + 3? 145465c In base 13, what is 1486aba5 + -4? 1486aba1 In base 4, what is 2301 + -13110211? -13101310 In base 12, what is 922a289 - -2? 922a28b In base 15, what is -4c6ca + a14? -4bbb6 In base 7, what is -5653 - 1221322? -1230305 In base 9, what is -2263 + 3736? 1463 In base 12, what is -1066 - -119a? 134 In base 5, what is -1014320433 + 1? -1014320432 In base 6, what is 1104 + -431011? -425503 In base 3, what is 101 - -2020212102211? 2020212110012 In base 4, what is -3312322 - -30121? -3222201 In base 12, what is 2a + -678668? -67863a In base 10, what is -64 + 6959680? 6959616 In base 15, what is -2 - 12a3a8? -12a3aa In base 16, what is -12 - 155bb2f? -155bb41 In base 2, what is 11110111100100 + 110001001110101? 1010000001011001 In base 14, what is 88dad5 - 1? 88dad4 In base 11, what is -1677a - -217? -16563 In base 9, what is 0 + 117004164? 117004164 In base 10, what is 834 + -4752? -3918 In base 6, what is 11331 - 3540? 3351 In base 8, what is 1 - -336024762? 336024763 In base 10, what is 57234874 + 4? 57234878 In base 7, what is 2350411 - 31? 2350350 In base 2, what is -1100011001110100 + -1101010? -1100011011011110 In base 7, what is 10212653636 - -3? 10212653642 In base 6, what is 232411 + 1114? 233525 In base 8, what is -174 + -205356? -205552 In base 7, what is -66162036 + -5? -66162044 In base 11, what is -7355 - -476? -698a In base 7, what is 4 + 2621304604? 2621304611 In base 8, what is 270504 - 770? 267514 In base 11, what is -17 + -1793a46? -1793a62 In base 4, what is 30230 + -12302220? -12211330 In base 2, what is 1011101111 + 1011111110001001? 1100001001111000 In base 3, what is 1012022020212210 - 201? 1012022020212002 In base 4, what is 100 - -3300330321? 3300331021 In base 10, what is -12 + 1125857? 1125845 In base 12, what is -25 + ab90aa? ab9085 In base 7, what is -6261244 + -12? -6261256 In base 12, what is 12 + -120a657? -120a645 In base 14, what is -4 - -11052a62? 11052a5c In base 14, what is 10 - 482b7? -482a7 In base 7, what is 60 - 1222060? -1222000 In base 8, what is -4426036 + 14? -4426022 In base 11, what is -1 + -4902621? -4902622 In base 15, what is -6216de + -1? -6216e0 In base 3, what is 101200221221 + 1111? 101201000102 In base 4, what is -20120320120 - 112? -20120320232 In base 2, what is 111000011 + -1001000001010110110? -1001000000011110011 In base 7, what is 0 - 122011023? -122011023 In base 11, what is -94623187 - 2? -94623189 In base 2, what is -1000101100101000011100 - 11? -1000101100101000011111 In base 8, what is -1002 + -17302? -20304 In base 6, what is -2141320 + -3253? -2145013 In base 8, what is 212412632 - -4? 212412636 In base 15, what is 2a7bc62 - 4? 2a7bc5d In base 6, what is 2524554 + 144? 2525142 In base 3, what is 1122 - -2202220202? 2202222101 In base 8, what is 5 - -711351772? 711351777 In base 15, what is 36d - -4220? 458d In base 7, what is 3255036004 - -4? 3255036011 In base 2, what is -11111101011 - 10001100101010101101? -10001101001010011000 In base 4, what is -22202 - -20121111002? 20121022200 In base 12, what is -533 - 12449? -12980 In base 8, what is -116032407 + 11? -116032376 In base 10, what is 27671 - -1743? 29414 In base 8, what is 2 + 3212336? 3212340 In base 8, what is -37473524 - 4? -37473530 In base 4, what is -2010 - -12213330? 12211320 In base 11, what is -12019070 + 4? -12019067 In base 8, what is 7653522 + 1? 7653523 In base 4, what is 1111 - -11132023220? 11132030331 In base 5, what is -101221311042 - -2? -101221311040 In base 6, what is -23 - -21104534? 21104511 In base 4, what is 11 - -13133202101031? 13133202101102 In base 7, what is 26 + -163153? -163124 In base 5, what is 30413212 + -20230? 30342432 In base 15, what is 4d - 36ba02? -36b9a4 In base 8, what is 461 - 71605? -71124 In base 6, what is 32514 - -1045401? 1122315 In base 8, what is -26200 + 6306? -17672 In base 11, what is -a785301 + 2? -a7852aa In base 8, what is -1064 + 73721? 72635 In base 2, what is -1100111 + 1101111000111110010? 1101111000110001011 In base 13, what is -4 - -4b03817? 4b03813 In base 8, what is -72567 - 4352? -77141 In base 12, what is 62a1a - 745? 62295 In base 5, what is 224024022033 + -2? 224024022031 In base 3, what is -12000121211021 - 100? -12000121211121 In base 8, what is -46 - 102360? -102426 In base 14, what is 495a - -6a8? 5224 In base 11, what is -3 + -14829438? -14829440 In base 4, what is -310333331132 - -2? -310333331130 In base 7, what is 460542 - 2644? 454565 In base 11, what is -84a + -4979? -5718 In base 7, what is 266010 - -5236? 304246 In base 12, what is -598 - -16742? 16166 In base 16, what is -6 + 43f4aa? 43f4a4 In base 9, what is 37 + 11888? 12036 In base 16, what is -1f9 - 10cbf? -10eb8 In base 12, what is -2579660 + -4? -2579664 In base 11, what is 141 - a2759? -a2618 In base 6, what is -114512 + -220431? -335343 In base 12, what is 5b + -90408aa? -904084b In base 8, what is 5 - -427003267? 427003274 In base 16, what is -5 - 331080? -331085 In base 13, what is -23 + 12ba44? 12ba21 In base 16, what is 421b + 1b79? 5d94 In base 16, what is -5c7 - -b8? -50f In base 11, what is -a759844 + -14? -a759858 In base 16, what is -1d0f91 + 109? -1d0e88 In base 2, what is 1000001111 - -111011100011001101000? 111011100100001110111 In base 9, what is -1058247 + -43? -1058301 In base 11, what is -3a + 552435? 5523a6 In base 12, what is 2 + 513685? 513687 In base 5, what is 3 + 322220310213? 322220310221 In base 6, what is 14525343 + -111? 14525232 In base 12, what is 11aa857a - 8? 11aa8572 In base 6, what is 102330 + 2145? 104515 In base 12, what is -3a0 - 2485b9? -248999 In base 11, what is -5 - -304363a? 3043635 In base 15, what is -5 - 12817d8? -12817dd In base 11, what is -42 - -436012? 435a80 In base 8, what is 33544 - -126? 33672 In base 10, what is 4669 - -11376? 16045 In base 11, what is 176a15a2 - 4? 176a1599 In base 16, what is -19 + -4d5f97? -4d5fb0 In base 5, what is -1001 + 11330440? 11324434 In base 10, what is -47 + 627837? 627790 In base 16, what is 13d2b + -31e9? 10b42 In base 15, what is 116 + 2488e? 249a5 In base 15, what is -16 + 554dc? 554c6 In base 11, what is 26 + -4a31133? -4a31108 In base 11, what is 347 - -47341? 47688 In base 5, what is 441222441 + 11? 441223002 In base 6, what is 10 + 10125131010? 10125131020 In base 7, what is 30036623 - -5? 30036631 In base 14, what is cc - -301bc2? 301cb0 In base 9, what is 4 - 276612122? -276612117 In base 14, what is c43a0 - -4? c43a4 In base 9, what is 2017 - 1134? 773 In base 4, what is 23 - -220122202132? 220122202221 In base 12, what is -301279 + 2? -301277 In base 2, what is 101 + -11110101110101010001101? -11110101110101010001000 In base 16, what is -4 - -d525f6? d525f2 In base 6, what is -511032512 + 20? -511032452 In base 6, what is -405114 - -2323? -402351 In base 11, what is 94 - -1770433? 1770517 In base 14, what is 26c48c - 6? 26c486 In base 15, what is -2 + -52cdc99? -52cdc9b In base 6, what is 323210553 - -50? 323211043 In base 10, what is -455679 - -14? -455665 In base 5, what is 114402 + 2020333? 2140240 In base 14, what is -5 - 5733c45? -5733c4a In base 13, what is 1 - 24ab4719? -24ab4718 In base 7, what is -2561166 +	{ "pile_set_name": "DM Mathematics" }
-2 Suppose 113 = 5m + 18. Suppose -2j + m = 5w + j, 2w = -2j + 6. Solve -2n - 5p + 19 = 0, 4n + 3p - 12 - w = 0 for n. 2 Suppose -2d = -6d + 3x - 4, 5x - 14 = 3d. Solve 2o - df = -0f - 8, 2o = -5f + 27 for o. 1 Let x = -41 - -22. Let n = -10 + 38. Let i = x + n. Solve -g = -r + 6, 3r + i = 4g + 28 for r. 5 Let a(c) = -c3 - 2c*2 - 3c - 3. Let k be a(-2). Solve 0 = f + 2v - k + 6, 5f + 2v = 17 for f. 5 Let y(x) = -2x2 + 1. Let t be y(-1). Let r(g) = g2 - g. Let z be r(1). Let w = z - t. Solve u = 5i - 30 + w, -i = -3u - 17 for u. -4 Suppose h + 4 = -5d + 6, -4d = -4h + 8. Solve 0 = 5g - 3t + 1, -4g - g - 2t - 16 = d for g. -2 Let p(c) = -3 + 0c - 4c + 3c. Let u be p(-5). Let g(x) = 3x - 2. Let i be g(u). Solve in + 10 = 2v + 6n, n - 11 = -4v for v. 2 Suppose -13 = -o + 23. Let j be (-34)/(-8) - o/(-48). Solve v - jy - 17 = 0, v - 5y = 3v + 26 for v. -3 Let v be -2 - 12/(4 - 8) - -14. Solve 5y + 3t - v = 0, t - 3t = 4y - 12 for y. 3 Let q = -2 - 0. Let a = q - -4. Solve -4 = -2l - al + 2m, -5 = -5l - 3m for l. 1 Let o be (2 - (-2 + 1)) + (-15 - -12). Solve a = -2b, 4a - b + 29 - 11 = o for a. -4 Let a be (22/(-11))/((-2)/4). Solve ar + 0t - 20 = 2t, -3r - 5t + 2 = 0 for r. 4 Let s = 7 + -5. Suppose -5l + 14 = 4, -5v - sl + 79 = 0. Solve w + v = -3u, 0 = -3u + u + 5w - 10 for u. -5 Suppose 2i = -2p - 4, -2p + p = 4i + 5. Let h(a) = -10a + 1. Let r be h(p). Solve 2f + 5z + 18 = 0, -5f = -4z - r - 10 for f. 1 Let r = 4 - 2. Let q be r(4 + (-6)/3). Suppose q - 8 = -2b. Solve bt - 5m = 25, 0 = -6t + 3t - 2m - 10 for t. 0 Let v = -46 + 64. Suppose -j + 3 = m - 0, 4m = -j + v. Let c(t) = -t2 + 6t + 2. Let k be c(6). Solve -mr = -4s - 7, -2s = -5r + k + 9 for r. 3 Let v be (-1)/1 + -5 + 11. Let b = v - 1. Solve -n = i + 2 + 2, -5n = -bi - 7 for i. -3 Let c(x) = -x*2 - 6x + 3. Let j be c(-6). Suppose -jp = 19 + 5. Let r = p + 10. Solve 4k - q + 15 = 0, rk - 4q - 30 = 4k for k. -5 Let u(r) = 44r*2 + 2r - 1. Let f be u(1). Suppose 0 = 3z - f. Suppose o - 6o + z = 0. Solve ok + 4j + 9 = 0, -3k + 0j - 3 = 2j for k. 1 Let r be (-3 + (-10)/(-3))/((-2)/(-60)). Solve -2b + 3b = 5l - r, l = 5b - 22 for l. 3 Suppose 3y + 2b = 5, 6y - 2b = 3y + 13. Solve 5q - 40 = yk, 2k + 3 = -q - 2 for k. -5 Suppose 0o + 4o - 16 = 0. Solve a + 3a + s = 14, -a - 4s - o = 0 for a. 4 Suppose -3j + 3 + 28 = 4c, j + 3 = 2c. Suppose -w - 69 = -cw. Let m = -11 + 38. Solve -5i - 5k - 8 = -w, -i + 5k - m = 0 for i. -2 Let y = 79 - 77. Solve 0 = 4u - 0u - 3m - 28, -20 = -yu + 3m for u. 4 Let o be 1 + 1 - 0/3. Suppose x - 54 = -ox. Let n be 0 - (1 - (-1 - -7)). Solve -2l - 13 = -l - nv, x = 3l + 4v for l. 2 Let t be 0 - 1 - (14 - 17). Solve n = 4z + 19, 3z - 2n = tn - 11 for z. -5 Suppose -y - 4 = x, -y - 2y + 16 = -4x. Solve -3a + y + 2 = h, -h = 5a for h. 5 Let k = -49 + 49. Let m(j) = -j*3 - 9j*2 - 1. Let r be m(-9). Let u be 1 + (r - (0 + -5)). Solve 2n - 6 = 2d + 4, un - d - 25 = k for n. 5 Let t be (6/9 - 0)3. Solve 4r - 2y - t = 0, -3r + 19 + 10 = 4y for r. 3 Let m(b) = -5b + 8. Let o = 11 - 8. Let x(d) = 2d - 3. Let i(h) = om(h) + 8x(h). Let y be i(5). Solve -4a + 8 = 5g + 39, -ya - 29 = 3g for a. -4 Let m(q) = q2 + 4q - 4. Let b be m(-4). Let f = b - -8. Solve 2x + 10 = -5s + 41, fx - 3s = -3 for x. 3 Let g = 6 - 4. Suppose -x = d + 3x - 9, 0 = -5d - gx + 27. Solve -ds - 12 = 3u, 2u = s - 12 + 4 for s. 0 Suppose -3v = -v + 8. Let w be 2v/24-9. Suppose -1 - 3 = -2m. Solve -mi = -wi + 4, 0 = c + 4i - 12 for c. -4 Let v be 36(1 + (-3)/9). Let a(h) = 15h3 + h - 1. Let q be a(1). Solve 4x = w - q, -w - 3w + v = -4x for x. -3 Suppose -5u - 10 = -3d - 2d, 5d - 20 = 0. Suppose -3k = uk + 90. Let z be 13 - (k/(-3))/3. Solve -3l = -3i + l - 13, -z = 2i - 5l for i. -3 Let c be 4 + 0 + 0 + -4. Let u(z) = -2z - 2. Let q be u(-2). Solve 2a = -qf + 1 - 3, 2a = c for f. -1 Let c(j) = 2j3 + 10j*2 - 2j - 5. Let v be c(-5). Solve -5f = 2r + 23, 1 + 23 = -vf - r for f. -5 Let h = -5 - -3. Let g = h - -6. Suppose -4y + 0y + 18 = -3k, -8 = gk. Solve 3d - 1 = t + 4, -yd = -3t - 15 for t. -5 Let g(u) = 5u - u2 + 1 + 3 + 2u*2. Let m be g(-4). Let n be -4 + 6 + 2 + -3. Solve -3p + 5r + 5 = m, p - 4p + n = -r for p. 0 Suppose -2t + 5t = 12. Let x be (1/4)/(((-22)/32)/(-11)). Solve h + xw - 14 = 0, -4 = th - 0w + w for h. -2 Let s(p) = -p3 + 3p*2 + 9p + 5. Let n be s(5). Suppose 5 = d - n. Solve c + c - df = -3, -5c - 2f - 22 = 0 for c. -4 Let y = 65 - 60. Solve -4 = -3c - 5j, yc - c - 2j + 12 = 0 for c. -2 Let b be 1 + -1 + 2/1. Suppose -2w + 4t + 23 = -5w, 8 = bw - 2t. Let x be 3 + (0 - 1 - w). Solve 5 = 4u - xk - 6, -5k + 10 = -u for u. 5 Let t(x) = -x2 - 6x - 3. Let k be t(-4). Suppose l + 2l - kw - 15 = 0, -10 = -2l + w. Solve -2r - l = 3o, -3o - 2r - 2 = -o for o. -3 Let s(k) = k + 1. Let y be s(2). Suppose yu - 3m + 15 = 2m, -4m = u - 12. Suppose 2l + 0l - 28 = u. Solve 0 = 5r - 0j + 3j - 16, -5j + l = 2r for r. 2 Suppose 0 = -6d + 14 + 4. Solve -dh = -4q - 5, 2 = -5q + 5h - 3 for q. -2 Let v(z) = 2z - 19. Let y be v(12). Solve 3g - 4g + 10 = -yr, -2g + 5 = 5r for r. -1 Suppose 0 = -2y + 3y + 4. Let l be (-2)/y-2-1. Suppose 2d = -4g - 16, 26 - l = -5g. Solve 5b - 9 = -4c - d, -18 = 3c - 4b for c. -2 Let l(z) = z*2 + 6z + 6. Let b be l(-4). Let x be (3/(-3))/(1/b). Solve -3 = 3q + 2c, 2c - x = 2q + 7c for q. -1 Suppose -3y = -0v + 2v + 10, 32 = -4y + 2v. Let r = 0 - y. Solve 2p = r - 0, 5q - 16 = -2p for q. 2 Let t = 46 - 39. Solve 2b + t = w, -3b - 22 = 4w + 5 for w. -3 Suppose 17f - 20 = 12f. Solve 4 = d + y, 5d - fy = -16 - 0 for d. 0 Let g = -5 + -12. Let y = g - -17. Solve 0j + 5c = -5j + 25, -c = y for j. 5 Let n be 263/9. Solve -nq = 4c - 0c, -c = 4q for q. 0 Let k = 143 + -143. Solve -3q + 3p - 7p + 11 = k, 0 = q + 2p - 5 for q. 1 Let g(l) = l2 - 6l + 9. Let v be g(6). Suppose 4u + 14 + 2 = 0. Let o = u + v. Solve c + oh - 20 + 8 = 0, 0 = 4c + 2h - 12 for c. 2 Let l = 7 - 2. Solve 19 = -ln + g + 47, 5g + 5 = -2n for n. 5 Let v(j) = -j2 - 9j - 11. Let c be v(-7). Solve 4s - 27 = -5o, -o - 2o = -4s + c for s. 3 Let k = -12 + 18. Solve -18 = -g - 4f, g - 3f = -kf + 13 for g. -2 Let n = 2 + -2. Suppose nd + 5y - 20 = -2d, -3d = 2y - 8. Solve -10 = a - 2f, da - 2a + 10 = 2f for a. 0 Let j(p) = p*3 + 5p*2 - p + 2. Let f be j(-5). Let t = f - 4. Solve 4d + 13 = ts + 2s, 28 = d + 5s for d. 3 Suppose -2x - 4w = -2w - 10, -w + 5 = -x. Suppose 0 = -7y + 2y. Suppose 2k = -yk + 4. Solve 5g - 14 - 1 = x, 3s + kg = 0 for s. -2 Let o be 9/3 + 8 + -2. Let f be (5/3)/5o. Solve -i + 2 = -3c - 0c, fi + 4c = 19 for i. 5 Let b(y) = -y*3 - 6y*2 + 7y - 1. Let a be b(-7). Let z = 7 - a. Let u = -4 + 6. Solve -2w + z = uh, 4h - 2w + 7w = 19 for h. 1 Let s(u) = -7u + 4. Let b be s(0). Solve 2 = 2l + x, -l - bx + 11 = -x for l. -1 Let v(y) = -y*2 + 9y - 6. Let w be v(7). Let u(a) = -a*2 + 8a + 3. Let x be u(w). Solve f + j + 1 = x, -2f + 2j = 4 for f. 0 Let g be (-3 - 2)3/(-5). Let i = 164 - 139. Solve -5l = gk + 2k + i, -20 = -3k + 4l for k. 0 Suppose 0 = 3l - 6. Let q = 12 + -8. Solve -2 = -4t - lg - 20, -3g = qt + 19 for t. -4 Let d(b) = b3 - 5b*2 + 4b - 17. Let v be d(5). Solve vi = -4q + 1 - 16, -4i = -q + 1 for q. -3 Let l be 408/85 - 4/5. Solve -ld = r - 4, 5d - 1 + 3 = -3r for r. -4 Let u = 8 - 6. Solve 4g - 18 = 2j, 7g - ug = 2j + 21 for j. -3 Let f(c) = c - 4. Let p be f(5). Suppose 0 = 5x + p - 21. Suppose -2g - 2r = 4, -xr - 3 = 17. Solve 3u + 3 + 12 = gb, u + 4 = 0 for b. 1 Let z be (28/10)/((-1)/(-5)). Suppose 5h = z + 6. Solve 8b = -3c + 3b + 15, 0 = -hc - b + 3 for c. 0 Let n = 14 + -12. Suppose 0 = -4u + 5g + 17, nu = -2g + 3 + 1. Solve -4f = 5h - 20, -2h = -7h + uf + 20 for h. 4 Let k(b) = b2 - 7b - 5. Let l be k(8). Let r(v) = -2v. Let h be r(-2). Solve hd = g - l, 4g = -0g - 2d - 24 for g. -5 Suppose 0 = -3y - y + 20. Suppose 4h = -yc	{ "pile_set_name": "DM Mathematics" }
ive of -w*3/3 + 5w*2/2 + 9w - 4. Give y(m). -5 Suppose 2 = 2m + b, 0 = 3m + 2b + 1110 - 1113. Suppose -p + 6 = 2p. Let i(n) = -6n3 - 2n3 + np - 2 + 1. Determine i(m). -8 Suppose 4 = 3h + 4q, q - 20 = h + 5q. Let c(v) = 3v*2 - 34v - 10. Give c(h). 14 Suppose 160 = 55s - 225. Let q(r) = r2 - 8r + 11. Calculate q(s). 4 Let v(a) = 2a3 - 2a*2 + 2a - 1. Let n be v(2). Let s(w) be the second derivative of -w*3/6 + 15w*2/2 + 7160w. What is s(n)? 4 Let h(p) = -29. Let s(t) = -t - 148. Let d(f) = 22h(f) - 4s(f). What is d(23)? 46 Let c(g) = -2g2 - 2g - 7. Suppose -7 = -n - 2r, 5r = 5n - 17 + 12. Give c(n). -31 Let v(z) = z2 - 3z - 2. Let y(q) = 2q3 + 7q*2 + 4q. Let s(k) = -3k3 - 7k*2 - 4k - 1. Let l(c) = -4s(c) - 5y(c). Let m be l(4). What is v(m)? 2 Let i be (-1)/((-2 + (-4)/(-4))(-26)/26). Let c(u) = -19u - 18. Determine c(i). 1 Let t(k) = 2k3 + k2 - 2k + 1. Let m(a) = -13a3 + 9a*2 + 5a + 9. Let v(w) = -m(w) - 6t(w). What is v(15)? 90 Let n = -3 + 3. Suppose 222 - 144 = 26p. Let o be (5 + n + 1)4/p. Let f(k) = 2k - 3. Determine f(o). 13 Let b(p) = -25p + 187. Let d(z) = 4z - 3. Let w(t) = b(t) + 5d(t). Give w(35). -3 Let c(t) = -t3 - 11t*2 + 15t - 87. Let u be c(-13). Let r = 3 + 52. Let b(f) = -5 - uf + 5 + rf. Calculate b(-4). 4 Let u(a) = 3a + 1. Let o(v) = v2 + 5v - 2. Let t be (-10)/(70/49) - -5. Let i(h) = tu(h) + o(h). Calculate i(-4). 16 Let i(f) = 14f - 123. Suppose 698 = -51z + 1106. Determine i(z). -11 Let c(f) = -f3 + 4f*2 + 7f - 7. Let u be ((-2)/(-4))/((-3)/(-336)) - 0. Let z be (-9 + -1)(-4 + u/16). Give c(z). 3 Let v(q) be the second derivative of q4/6 - 2q*3/3 + 3q*2 - 4q. Let c be 70/4 + (-36)/(-24). Let r(i) = -i*2 + 16i + 61. Let o be r(c). Determine v(o). 22 Suppose a = -14a + 30. Let w(l) = 45l + 5 + al2 - 3 - 98l + 48l. Calculate w(5). 27 Let r be (642/(-30))/((-1)/10). Let w(n) = -n2 + 219n - 428n + rn. Calculate w(5). 0 Let n(d) = 4d - 11. Let w be 4/(-3)(40/(-8) + 2). Let v be n(w). Suppose 5m - vr = 40, 3m - 26 = r + 3r. Let z(b) = b - 4. Give z(m). 2 Let r(w) be the third derivative of -3w4/8 - 5w3/6 - w2 - 217. What is r(4)? -41 Let t(y) = -y*3 + 12y*2 - 15y - 54. Suppose 0 = -5u - 25, -3u - 35 = -2o - 0. Calculate t(o). -4 Let y(m) = -2m3 + m2 - 6. Let x(n) = n*3 + 5n*2 - 9n + 34. Let i be x(-7). Let j be 1/1(1 + i). Give y(j). -6 Let z be 0/(-2)24/72. Suppose 4d + 5k - 10 = z, -17d + 2k - 11 = -20d. Let y(g) = g - 8. Give y(d). -3 Let q(t) = 83t - 87t - 8 - 11 + 12. Let g be 26/(-4) + (-4)/8. Determine q(g). 21 Let b be 1904/612(-2 + ((-52)/8)/(-1)). Let m(c) = c*3 - 15c*2 + 15c - 11. What is m(b)? 3 Let x(b) = -1. Let s(m) be the second derivative of 0 + 35m - 1/2m*3 - 13/2m*2. Let a(u) = s(u) - 4x(u). Calculate a(-7). 12 Let p(x) = x*2 - 35x - 166. Suppose -2v = -k - 80, -52 - 36 = -2v + 5k. What is p(v)? -10 Let q(d) = -3d - 5d2 - 1 + d2 + 0d2 - 3 - 1. Let o be q(-1). Let l(a) = -a3 - 7a2 - 7a - 15. Calculate l(o). -9 Let q(u) = -u*3 - 9u*2 + 4u - 12. Let h be 1638/728 - (1 + (-45)/(-4)). Calculate q(h). 48 Suppose -65q - 50 = -75q. Let d(r) = 3r - 5r - 1 - qr + 4r. Suppose 4a - 16 = -0a. What is d(a)? -13 Let p = 73 + -109. Suppose -3920 = -5r + 103r. Let d = r - p. Let g(k) = -4k - 5. Give g(d). 11 Let x(l) = -2l*3 + 4l*2 - 2l + 4. Suppose -5f = -5n - 50, -3f - 13 = -5f + n. Give x(f). -20 Let n(y) = 8y3 + 15y*2 + 16y + 44. Let i(s) = 3s3 + 5s*2 + 5s + 16. Let l(h) = 11i(h) - 4n(h). What is l(6)? -18 Let a(k) = 88k - 1320. Let v(j) = 1245j - 8700. Let l be v(7). Calculate a(l). 0 Let t(p) = -2p3 + 2583p*2 + 2582p*2 + 6p - 5176p2 - 3. Calculate t(-6). -3 Let y = -708 + 712. Let r be y/6 - (-413)/177. Let t(l) = -3l + 2. Give t(r). -7 Let r = -47 - -43. Let v be 2 - ((-12)/r + (-70 - 1)). Let d(g) = v - 75 - 8g - g2 + 3g. What is d(-6)? -11 Suppose 1692a - 1688a = 3z + 19, z - 5a = -21. Let h(t) = -25t - 13. Calculate h(z). 12 Suppose -3d - 6 = -3. Let s(q) = -182 + 720 - 4q - 183 - 174 - 180. Determine s(d). 5 Let m = 1048 - 1045. Let q(j) = -j3 - 4j*2 + 19j. Give q(m). -6 Let j(d) be the third derivative of -d*6/120 - 7d5/60 + d4/24 + 7d3/6 - 6d2. Let p be 78/(-21) + -3 - 8/28. Determine j(p). 0 Let n(u) = -u2 - 7u + 8. Let r = 109 - 54. Suppose -ra + 18 = -58a. What is n(a)? 14 Let j(o) = -3o + 2. Let d be j(0). Suppose -11 = dy + 3. Let h(w) = 2w - 4. Let k(a) = 5a - 12. Let z(n) = -8h(n) + 3k(n). Calculate z(y). 3 Let w be 1218/(-435)30/(-21). Let n(q) = 3q + 1 + 2q - q*2 + 2. Calculate n(w). 7 Let w = -19 - -32. Let k = w + -6. Let m(b) = 25b - 3b2 - 10 + 28b - 46b + 3b2 - b2. Determine m(k). -10 Let o = -33 + 27. Let x(z) = 3z - 18. Let n(l) = -l + 4. Let w(q) = -15n(q) - 4x(q). Let s be w(o). Let p(t) = t - 1. What is p(s)? -7 Let l(d) = 98 - 125 - 8d - 22d - 2d2 + d2 + 17d. What is l(-11)? -5 Let u be 20997/(-27) - 3/9. Let o = u + 793. Let i(p) = -3p + 33. Determine i(o). -12 Let f = 2 - 0. Let j = 1959 + -1957. Let x(u) = 1 + 8u2 + 5u*j - 8u*f. Give x(-1). 6 Suppose 4w = 31 + 29. Suppose i - w = 4i. Let t(y) = 11y*2 - 15y - 2. Let g(h) = -5h2 + 7h + 1. Let q(a) = -13g(a) - 6t(a). What is q(i)? -21 Let u(x) = -9x2 + 4x + 5. Suppose 14l = 43l - 145. Let m(p) = -p*2 + p + 1. Let q(c) = lm(c) - u(c). Calculate q(-2). 14 Let d(l) = l*3 + 2l*2 + l + 3. Let f(k) = -6k + 4k + k2 - 124 + 97 + 4k. Let u be f(-6). Give d(u). -9 Let b(d) = -d*3 - 3d*2 - 8d + 7. Let x(l) = -l*3 - 4l*2 - 7l + 5. Let z be (-2)/(-7) + (-24)/(-14). Let p(i) = zb(i) - 3x(i). Calculate p(-4). 11 Let x(k) = -k*2 - 27k + 36. Let i(l) = 287l + 8008. Let h be i(-28). Determine x(h). 8 Let a(v) = 3v - 6. Let x(q) = -7q - 2. Let r(u) = 5u + 3. Let w(g) = -6r(g) - 5x(g). Let d(o) = 8a(o) - 5w(o). Suppose -18 = 2y - 0y. Determine d(y). 1 Let h(g) = g*2 + 84g - 255. Let r be h(-87). Let z(s) = -2s2 + 5s + 16. What is z(r)? -26 Let q(z) be the first derivative of -4z + 2/3z*3 + 7/2z2 - 72. Calculate q(-6). 26 Let n be (12/27)/(2/(13 - -5)). Let r(j) be the second derivative of j3/3 - 5j2/2 + 5j. What is r(n)? 3 Let n = -80009 - -80006. Let f(d) = 3d2 + 6d + 10. Let t(o) = 2o2 + 5o + 9. Let g(y) = 5f(y) - 6t(y). What is g(n)? 23 Let s(q) = q*3 - 3q*2 - 6q - 2. Let u = -36178 - -36184. Determine s(u). 70 Let q(s) be the first derivative of -s*2 + 2s - 4. Let k = 333 - 329. Calculate q(k). -6 Let w(c) = 2878c - 2880c - 6c2 + 7c*2. Determine w(4). 8 Let w(t) = 8 + 23 + 17 + 4t + 21 - 86 + 13. Let z(y) = y*3 - 5y*2 + 5y - 4. Let o be z(3). What is w(o)? -32 Suppose 351 = -807f + 780f. Let x(j) = -j*3 - 12j*2 + 3j + 7 - 1 + 10j. Calculate x(f). 6 Let b = 445 - 442. Let p(v) = 569 - 289 - 285 - vb - 4v*2. What is p(-4)? -5 Let d(j) = -8j*3 - 4j*2 + 13j - 8. Suppose 0 = -n - 63 + 62, w + n = 0. What is d(w)? -7 Let z(u) = -u2 - u - 4. Let f(l) = l3 - 25l2 + 84l - 3. Let a be f(21). Determine z(a). -10 Suppose 1980 - 1965 = 3w. Let b(y) = y3 - 7y*2 + 11y - 19. Give b(w). -14 Let d(n) be the second derivative of n4/6 - n3/3 - n*2/2 + 5563n. Let f(q) = q*2 - 2 + 0q*2 - 5q - 2. Let b be f(6). What is d(b)? 3 Let i(f) = -f*2 - 4f + 2. Let n(b) = 3b - 35. Let z be (-2)/2-2 + 52/4. Let d be n(z). Let y = -13 + d. Calculate i(y). 5 Let u(a) = 1501a2 - 1513a2 + 4 + a3 + 1. Give u(12). 5 Let x(o) be the third derivative of o5/60 + o4/3 - 35o3/6 - 37o*2 - 90o - 1. Give x(0). -35 Let l be (-2)/(-44)14 + 1224/3366. Let u(w) = -2w*3 - 2w*2 + 5w - 4. Determine u(l). -3 Let u = 26 - 21. Let k = 9 - u. Let j(m) = -57 - km + 114 - 62. Calculate j(-5). 15 Let u = 15230 + -15236. Let b(n) = n2 - 11n - 9. Determine b(u). 93 Let y(v) = -11v3 + 27v*2 + 17v + 1. Let j be y(3). Let x(t) = t3 + t2 - 8. What is x(j)? -12 Let q(m) = -6m - 19. Let l = -6574 - -6567. Calculate q(l). 23 Suppose -73 + 63 = 2y, -5y = 5x + 30. Let f(n) = 19n - 3. Calculate f(x). -22 Let u(o) = -o3 + 127o + 90*o	{ "pile_set_name": "DM Mathematics" }
se 14? -34d34 Convert -452301031 (base 6) to base 10. -8235019 Convert 1422440 (base 6) to base 7. 455004 Convert -2b006 (base 15) to base 16. -21c8d 79393a (base 15) to base 12 1b2aaa7 10541342 (base 6) to base 14 862bc Convert bc16 (base 13) to base 15. 7b79 What is -5236315 (base 7) in base 4? -2122013233 344114342 (base 5) to base 13 4240aa Convert 1521361 (base 7) to base 15. 41514 767351 (base 10) to base 12 31009b What is -1062620 (base 7) in base 3? -20202111202 What is -19134a (base 15) in base 2? -100101001101000110000 What is -3003344044 (base 5) in base 7? -101210352 -111101101100010010 (base 2) to base 16 -3db12 -1000001100001001011000 (base 2) to base 9 -4031888 Convert 4240012113 (base 5) to base 15. bae258 Convert 8ab93 (base 12) to base 8. 551037 What is 10775 (base 12) in base 15? 6708 What is 202210120002 (base 3) in base 6? 12435132 -1224214 (base 9) to base 4 -2202202120 11411444 (base 5) to base 2 11010001001110100 110000001000100011110 (base 2) to base 6 53450022 Convert -1110020322 (base 4) to base 15. -6c1a9 Convert -489e3 (base 16) to base 7. -2346116 Convert -4230146 (base 7) to base 2. -1111100111000001000 21000020121 (base 3) to base 11 94718 Convert -6351777 (base 11) to base 10. -11187986 10202101020 (base 3) to base 13 27840 What is 3cb3a (base 16) in base 15? 4da09 -1211421 (base 6) to base 15 -13dd7 What is 4056697 (base 12) in base 11? 6897094 What is 604519 (base 11) in base 6? 32501103 What is -1121030311 (base 5) in base 6? -125543245 1011010110100001 (base 2) to base 11 31a30 111000022121 (base 3) to base 16 3e86f -141997 (base 13) to base 16 -777a3 What is 1026147 (base 11) in base 6? 102435001 Convert 202210220221011 (base 3) to base 5. 10312412323 Convert 11000100101111001110 (base 2) to base 3. 1111221101212 -1c385 (base 16) to base 5 -12144324 What is -3429627 (base 10) in base 5? -1334222002 Convert b292ab (base 12) to base 15. 3a3065 What is 10001000010100001 (base 2) in base 15? 15a2d What is -32c23b (base 15) in base 8? -11167235 What is 95aec (base 16) in base 7? 5132315 476ba9 (base 13) to base 6 100235355 10514252 (base 9) to base 16 4da29c 101100111011110001010100 (base 2) to base 8 54736124 What is -101100011110010010110010 (base 2) in base 15? -105452d -101110002022121 (base 3) to base 11 -3152582 -612334 (base 10) to base 11 -389068 Convert 1322332313 (base 4) to base 11. 314511 -678ab6 (base 16) to base 14 -c88d02 What is -1467015 (base 8) in base 11? -268661 Convert -11110100100010 (base 2) to base 10. -15650 What is 12100012220 (base 4) in base 16? 1901a8 What is -246041 (base 7) in base 5? -2422210 What is 121121222 (base 3) in base 11? 9120 What is 57447 (base 12) in base 9? 186611 Convert -22bcd9 (base 16) to base 6. -120443401 Convert 195ec (base 16) to base 13. 383b7 What is 1302032022 (base 5) in base 6? 151410055 What is 20902 (base 15) in base 4? 121031231 What is -12745d (base 16) in base 12? -4a3aa5 b92bbe (base 15) to base 5 4224140104 157bb (base 13) to base 9 62065 What is -2265003 (base 7) in base 2? -1000101100101101100 Convert 7524812 (base 9) to base 14. 76d581 -2056ba (base 14) to base 16 -10a494 What is -110220112222 (base 3) in base 2? -111110000010010000 What is 10923 (base 11) in base 16? 3d8b Convert -1361025 (base 9) to base 5. -142424311 Convert 163166 (base 9) to base 16. 18987 What is -5034433 (base 7) in base 4? -2101300300 703044 (base 8) to base 6 4541112 What is -16394a (base 12) in base 13? -103b34 Convert -101000000110111000111000 (base 2) to base 11. -5a31340 -4000230240 (base 5) to base 16 -775597 Convert -310700 (base 8) to base 12. -4b628 -413204314 (base 5) to base 12 -698626 Convert -381ad8 (base 14) to base 12. -78a4a6 What is 382941 (base 10) in base 5? 44223231 -50541504 (base 6) to base 14 -298412 What is 56a66e (base 16) in base 2? 10101101010011001101110 Convert 122022212200101 (base 3) to base 12. 31014b4 Convert 52311b (base 12) to base 9. 2376805 What is -94493 (base 10) in base 4? -113010131 5e057b (base 16) to base 4 113200111323 Convert -13527104 (base 9) to base 3. -110120221010011 -446922 (base 11) to base 5 -140234432 18753 (base 9) to base 6 140120 Convert 12121012221101 (base 3) to base 10. 2976463 Convert -108256 (base 10) to base 4. -122123200 Convert 1001221321 (base 4) to base 5. 32101141 What is 67cc0d (base 14) in base 4? 31132012031 Convert 30342020 (base 5) to base 8. 741356 Convert -1808649 (base 13) to base 8. -35641174 What is 284b (base 16) in base 10? 10315 -913208 (base 11) to base 3 -2202121012002 92ac1 (base 14) to base 16 56451 Convert 64511 (base 10) to base 15. 141ab 369153 (base 10) to base 9 622340 Convert 222215163 (base 7) to base 16. cd3a52 Convert -10020101200101 (base 3) to base 14. -32ac7d Convert -8872385 (base 9) to base 10. -4771625 What is -3cb90 (base 14) in base 8? -445672 What is -35342112 (base 7) in base 6? -150510443 Convert -267a333 (base 11) to base 2. -10001101001010011011000 What is -75456 (base 10) in base 7? -432663 What is -21876113 (base 9) in base 2? -101000100000110100000101 Convert 22000010132 (base 4) to base 3. 11221012022222 Convert 36206226 (base 7) to base 6. 152503453 Convert 139423 (base 11) to base 7. 1564000 Convert 37690 (base 16) to base 4. 313122100 Convert -13357 (base 9) to base 8. -21523 Convert 35d3a (base 14) to base 4. 200013300 729495 (base 10) to base 13 1c7070 -50435114 (base 6) to base 7 -15130000 1442854 (base 9) to base 7 6523543 What is -10122011220222 (base 3) in base 10? -1932524 -565226 (base 9) to base 7 -2606466 Convert -40067 (base 11) to base 8. -162415 Convert -110003003 (base 6) to base 8. -7364413 What is 10000101001001010 (base 2) in base 8? 205112 Convert -11445702 (base 8) to base 13. -69b488 Convert 1452261 (base 8) to base 6. 12520453 What is 5d15ad (base 14) in base 15? 430d70 What is -7b423 (base 14) in base 4? -1021032013 What is 21100211001 (base 3) in base 10? 144937 12030442 (base 5) to base 10 111372 What is 3c7402 (base 15) in base 10? 2910152 Convert 1213002211 (base 4) to base 15. 850bd Convert -d0c914 (base 15) to base 6. -552300031 Convert -263537 (base 12) to base 6. -21243311 2a4123 (base 16) to base 14 521271 Convert -445186 (base 9) to base 16. -41004 What is 300220303300 (base 4) in base 6? 1133140024 1aeaa (base 15) to base 4 111122011 What is 2852712 (base 13) in base 2? 110000101110010000000111 -115220100 (base 7) to base 9 -14516166 1302212321 (base 4) to base 6 14021145 -13c884 (base 15) to base 7 -11051251 -13716316 (base 9) to base 3 -110210120100120 What is 1030012322 (base 4) in base 13? abb7b What is 453530524 (base 6) in base 4? 133222220110 Convert 10001111000000111 (base 2) to base 14. 1c983 What is -33302103211 (base 4) in base 2? -1111110010010011100101 Convert 20882 (base 12) to base 7. 235361 What is -34200143 (base 5) in base 11? -197862 What is -2200010021110 (base 3) in base 16? -15a92c 1001100100000011111 (base 2) to base 8 1144037 Convert -68204 (base 14) to base 5. -31042334 1741d9a (base 14) to base 2 101011101100001111010100 2827346 (base 10) to base 12 b44242 What is -1027626 (base 8) in base 9? -457266 1690751 (base 11) to base 15 3ba7e4 Convert 10110002020 (base 3) to base 16. 10911 What is -513404 (base 8) in base 13? -5c344 8852757 (base 9) to base 7 55310026 -eef631 (base 16) to base 7 -250053464 -3776021 (base 8) to base 3 -1222012222212 Convert 73387a8 (base 11) to base 10. 12939616 What is -322123333333 (base 4) in base 16? -e9bfff Convert -3887611 (base 9) to base 8. -10066002 Convert -cb977b (base 13) to base 16. -4919d9 What is 257373 (base 15) in base 11? 1017635 Convert -4506050 (base 10) to base 3. -22110221010202 Convert -30303103212 (base 4) to base 8. -14632346 What is -11410 (base 15) in base 14? -16027 What is 3536114 (base 7) in base 12? 19633b -1b58e (base 15) to base 4 -111232301 What is 15c4cb (base 15) in base 14? 1d6203 What is -c59110 (base 15) in base 8? -43660020 -112102012111 (base 3) to base 15 -59104 What is -681a11 (base 11) in base 14? -203aa7 What is 2610405 (base 7) in base 5? 41314432 -2511131 (base 7) to base 4 -1032221210 -1b294 (base 16) to base 10 -111252 What is fcec0 (base 16) in base 9? 1848065 1152550 (base 9) to base 13 18b757 What is -82da8 (base 16) in	{ "pile_set_name": "DM Mathematics" }
prime factors of b. 11, 2221 Suppose 24 = -6t - 216. Let s be 1/(4/(t/(-42)) - 4). Suppose 5q = -sx + 675, -2q + 207 = 4x - 333. List the prime factors of x. 3, 5 Let z(o) = 46 - 49 - 241o + 18. What are the prime factors of z(-5)? 2, 5, 61 Suppose 0 = 110x - 108x + 52. List the prime factors of (-13)/(x/4)2564/8. 641 Let h = -204 - -199. List the prime factors of 2346/10 - (0 + (-3)/h). 2, 3, 13 Let d(t) = -3t - 2t + t2 + 7t*3 - 4t*2 + 0t*2 - 6. Let b be d(5). Let n = b + -532. List the prime factors of n. 3, 79 Suppose 86 = 20d - 19d. Let t = 163 - d. What are the prime factors of t? 7, 11 Let p(c) = 2c*2 + c. Let q be p(1). Suppose 0 = -4j + 3y + 80 + 2054, qy - 526 = -j. What are the prime factors of j? 2, 7, 19 Let p = 735 + -691. Suppose po = -17o + 91927. List the prime factors of o. 11, 137 Let o = 2785 - 1120. What are the prime factors of o? 3, 5, 37 Suppose -101n = 62n - 192302 - 175915. What are the prime factors of n? 3, 251 Let t(m) = -426m3 + 3m*2 + m. Suppose -17 = 11x - 6x + 4v, 0 = -3x - 3v - 12. List the prime factors of t(x). 2, 107 List the prime factors of 7995/2 - ((-189)/(-6))/(-21). 3, 31, 43 Let q(t) = 7t2 + 103t + 90. What are the prime factors of q(-34)? 2, 3, 5, 13 Let x(z) = z*3 - 5z*2 - 3z - 13. Let g(t) be the first derivative of -t*2 - 8t + 10. Let p be g(-7). List the prime factors of x(p). 5 Suppose 4i + 3z + 1180 = 0, 1475 = -5i + 5z - 0z. Let w = i - -419. What are the prime factors of w? 2, 31 Suppose 5g = -2z + 19921, 0 = -3g - 5z + 4071 + 7893. What are the prime factors of g? 7, 569 Let a(y) = 2y*3 - 28y*2 + 50y. What are the prime factors of a(23)? 2, 23, 29 Let z(i) = i*2 - 11i + 71. Let w be z(22). Suppose 0 = -x + 4h + 736 + w, 0 = 2h + 8. List the prime factors of x. 1033 Suppose -l - l = -22. Suppose -x + 6 - l = 0. What are the prime factors of (2 - -3)/x + 68? 67 Let r be (-4)/5 + 131/(-5). Let q be (r - -3)(-4)/3. Let s = 64 - q. What are the prime factors of s? 2 Let z = 22599 - -47837. List the prime factors of z. 2, 17609 Let h(c) be the second derivative of -5c*3/3 + 23c*2 - c + 19. What are the prime factors of h(-5)? 2, 3 Let i be 28/(-49)(-7)/618. Let z be (-2)/(-3) + 88/i. Suppose 2w + 756 = zw. What are the prime factors of w? 2, 3, 7 Let q(j) = 353j*2 - 878j - 875j + 1747j + 6 + 794j2. What are the prime factors of q(1)? 31, 37 Let m be (-7)/42 - 2102/(-12). Suppose 5d + m = 5n, 4d = -0d - 4n - 108. Let q = 45 - d. List the prime factors of q. 2, 19 Suppose -2k - 30734 = -2f, -4f + 53797 = -3k - 7677. List the prime factors of f. 15373 Suppose 2a = -2b + 17378, -15b + 13b = -2a + 17362. What are the prime factors of a? 3, 5, 193 Let h(k) = -13k - 5 - 4 - 13. Let w be h(-4). List the prime factors of (4/6)/(w/765). 17 Let c be (-6482)/(-10) - 2/10. Let s = -1390 + c. List the prime factors of (0 + 0 + -1)/(14/s). 53 Let w = 81309 - 52491. What are the prime factors of w? 2, 3, 1601 Let c(y) = y2 - y - 8. Let o be c(3). What are the prime factors of (-1454)/(-8) + o - 2/(-8)? 2, 3, 5 Let u(z) = z2 + 4z - 7. Let a be u(-6). Suppose -ad + 486 - 26 = 5o, -344 = -4d + 2o. Suppose 3n - d - 68 = 0. What are the prime factors of n? 2, 13 Suppose 8 = 4s - 5t + 2t, s = 3t + 2. Suppose 0 = h + sf - 188, -4h - f + 770 = -2f. What are the prime factors of h? 2, 3 List the prime factors of (1369058/(-1358))/(2/(-14)). 7057 Let k(o) be the second derivative of 403o*3/6 + 2o*2 + 2o + 123. List the prime factors of k(1). 11, 37 Let l(y) = 799y2 + 238y - 1409. List the prime factors of l(6). 107, 269 Let h be (2 - 1)/(-1) - 142. Suppose 10p + 1333 = 3. Let d = p - h. What are the prime factors of d? 2, 5 Let c(g) = 8g*2 + 1 - 15 + 4 + 17g + 2g2 + 39g*2. What are the prime factors of c(3)? 2, 241 Let b(x) = 3x*2 - 2x - 12. Let a(p) = -6p + 14. Let q be a(3). Let c be -3(51/(-9) - q). List the prime factors of b(c). 53 Let q(k) = 16k - 53. Let w be q(5). Let j(b) = b2 + b - 42. What are the prime factors of j(w)? 2, 3, 7, 17 Let b(d) = -18d*3 - 2d*2 + d + 296. List the prime factors of b(-9). 13, 1019 Suppose 13g = -5g + 414. Let l = g + 20. Suppose -3a = s - 12, -3s + l = a - 25. List the prime factors of s. 2, 3 Suppose 0 = -21m + 16m - 4945. Let p = m + 1797. List the prime factors of p. 2, 101 Let k(d) = 2d*2 + 4d + 5. Let s be k(-2). Let f(l) = 5l - 20. List the prime factors of f(s). 5 What are the prime factors of (31-1098 - 4)/(60/(-30))? 17021 Let g(r) = 3551r3 + r2 - 16r - 15. Let y(z) = -5327z3 - 2z*2 + 22z + 22. Let m(c) = -7g(c) - 5y(c). List the prime factors of m(1). 2, 7, 127 What are the prime factors of 539/49 - (-11182)/2? 2, 2801 Let f(y) = y*3 + 10y*2 - 4y + 12. Let t be f(-8). Let x = t - -259. List the prime factors of x. 431 Let t = 17140 - -634. List the prime factors of t. 2, 8887 Let i be (9/(-2))/(13/26). List the prime factors of ((-13)/(390/(-740)))/((-2)/i). 3, 37 Let k be (-15)/(-10)(1 + 5) - 0. Suppose -32 = -kg + g. Suppose 3r - 4r + 189 = 3s, 3s - 174 = gr. List the prime factors of s. 2, 31 Suppose -5k = 82 + 193. Let d = -53 - k. Suppose 159 = dz + 61. List the prime factors of z. 7 Suppose -10x = -3b - 6x + 11, -x + 22 = 2b. Suppose bc - 4243 = 797. What are the prime factors of c? 2, 5, 7 Suppose 9m - 21 = 24. Suppose 0 = ms - 1548 + 133. Suppose s = 3q - 4a, 2a - 86 + 553 = 5q. What are the prime factors of q? 3, 31 Let g be (11/4)/(12/48). Let q(f) = 2f2 - 12f - 23. Let a be q(g). Let n = a + -11. List the prime factors of n. 2, 19 Let j(p) = 5202p2 + 577p + 13. What are the prime factors of j(-4)? 3, 17, 23 Let c(g) = -16g + 848. List the prime factors of c(-13). 2, 3, 11 Let h(q) = -q3 + 20q*2 + 23q - 3. Let g be h(21). Suppose 13r - g = 12r. Let d = r + 23. What are the prime factors of d? 2, 31 Suppose -4388 - 34180 = -13t - 4q, t + q - 2964 = 0. What are the prime factors of t? 2, 7, 53 Let j be -19(-1)/(-1)-6. Let f = -23 + j. Let k = f - 3. What are the prime factors of k? 2, 11 Let u(q) = -q*3 + 7q*2 - 13q + 16. Let t be u(5). Let m(c) = 467c3 - c2 - 5c + 5. List the prime factors of m(t). 2, 233 Suppose 3f + 3j = 70581, -12f + 5j = -13f + 23511. List the prime factors of f. 23531 Let w(o) = 21o - 7. Suppose 47 = 13i - 18. What are the prime factors of w(i)? 2, 7 What are the prime factors of 23099((-14)/(-6) - (-104)/(-78))? 23099 Let h = -42 + 45. Suppose -2q = hr - 231, -5q + 349 = -2q + 2r. Suppose 34 = a - q. What are the prime factors of a? 151 Let s(p) = 4584p + 3628. List the prime factors of s(5). 2, 6637 Let z(f) = 53427f2 - f + 1. What are the prime factors of z(-1)? 23, 101 What are the prime factors of (-10)/(2(-23)/23805)? 3, 5, 23 Suppose 17k - 24651 - 1558 = 31421. List the prime factors of k. 2, 3, 5, 113 Let j be (-2 + (0 - -1))(-2 + 2). Suppose -5q + 7q - 190 = j. Suppose -f + q = 4f. What are the prime factors of f? 19 Suppose 119o = 271o - 5790896. What are the prime factors of o? 2, 43, 443 Let p(v) be the first derivative of -5v*4/24 + 3v2 + 23. Let u(q) be the second derivative of p(q). What are the prime factors of u(-17)? 5, 17 Let w = 1782 - 196. List the prime factors of w. 2, 13, 61 Let k(m) = -m3 + 37m2 - 37m + 52. Let a be k(36). Suppose -74 = -3g - 14. Suppose -3r + a = r + s, g = 5r + s. What are the prime factors of r? 2 Let l(q) be the third derivative of 23q*5/40 + 7q*4/12 + 8q*3/3 - 30q*2. Let k(i) be the first derivative of l(i). List the prime factors of k(4). 2, 5, 29 Let y(p) = -21p*3 - 39p*2 + 20p - 70. List the prime factors of y(-14). 2, 5, 7, 709 Suppose -o - 597 + 151 = 0. Let m = -195 - o. List the prime factors of m. 251 Suppose -128 = 5h - h. Let m = h - -35. Suppose w = -c + 33, -mc + 0w = -4w - 92. List the prime factors of c. 2 Let d = -1528 + 1678. Let v = 18 + -4. Let w = v + d. What are the prime factors of w? 2, 41 Let q = 14691 - 7672. What are the prime factors of q? 7019 Let b be (-1 - -2)/((-3)/141). Let r = b - -44. What are the prime factors of 36((-8)/r + -2 + 2)? 2, 3 Suppose 17z + 12z - 5z = 413952. List th	{ "pile_set_name": "DM Mathematics" }
i + 2/3i*2. 2i(i + 2)/3 Let u(s) be the first derivative of -2 - s3 + 0s - 3/4s4 - 1/5s*5 - 1/2s*2. Find h, given that u(h) = 0. -1, 0 Let z = 567/4 - 141. Determine t, given that 3/4t*3 - zt - 1/4t2 - 1/4 + 1/2t4 = 0. -1, -1/2, 1 Let t(n) be the second derivative of -n4/48 + n*2/8 + 15n. Factor t(g). -(g - 1)(g + 1)/4 Solve -2/7s*5 + 2/7s*3 - 4/7s*2 + 0 + 0s + 4/7s4 = 0. -1, 0, 1, 2 Solve -10/3g*3 - 2/3g*2 + 0 - 8/3g*4 + 0g = 0. -1, -1/4, 0 Suppose -3v = -2v. Let g(n) be the third derivative of 1/270n5 + 0n6 + 0 - n2 + vn + 0n*3 - 1/945n*7 + 0n*4. Factor g(t). -2t*2(t - 1)(t + 1)/9 Let t = 11 + -26. Let a be (-36)/t - 2/5. Find m such that m3 + 1/2 - m - 1/2m*a = 0. -1, 1/2, 1 Suppose -8u + 3u = -10. Suppose 5l = -b + 12, -ul = -0b - 2b. Find r such that -r2 + 11r*2 - lr + 6r = 0. -2/5, 0 Let v(y) = -y5 + y4 + y3 + y2 + y. Let h(i) = -6i*5 + 2i*4 + 16i*3 + 4i*2 + 4i. Let m(s) = h(s) - 4v(s). Factor m(z). -2z*3(z - 2)(z + 3) Let p be ((-2)/(-3))/((-3)/(-9)). Factor 1/2g*2 + 2 + pg. (g + 2)*2/2 Suppose -5x + 20 = 0, -2x + 200 = 5h + 72. Suppose 0 = -3q - 3p - 3 + h, 4q = 3p - 7. Factor -1/2n3 + 1/2n - 1/2nq + 1/2. -(n - 1)(n + 1)2/2 Let q(m) = -m2. Let a(k) = -13k2 - 8k - 6. Let y(v) = -2a(v) + 22q(v). Factor y(n). 4(n + 1)(n + 3) Let a(o) = 4o + o2 + 7o*2 - 2o + 1 - 5o3. Let i(t) = t + 1. Let k(s) = 2a(s) - 6i(s). Factor k(q). -2(q - 1)*2(5q + 2) Let t = 6 - 0. Let n(b) be the third derivative of b2 + 1/120b*5 + 0 + 0b + 0b4 + 0b*3 - 1/240bt. What is x in n(x) = 0? 0, 1 Let o(g) = g3 + 7g2 - 36. Let j be o(-6). Factor 4/9n + 2/9n3 - 2/3n*2 + j. 2n(n - 2)(n - 1)/9 Let d(w) be the first derivative of -w6/1440 - w5/240 - 2w3/3 + 6. Let c(y) be the third derivative of d(y). Factor c(r). -r(r + 2)/4 Suppose 3 = -y, l + 4y = 2l - 15. Let x = 382/3 - 126. Factor -8/3z + xz*2 - 2/9z*l + 16/9. -2(z - 2)*3/9 Let w(j) = 4j*2 + 4j - 2. Let n(t) = 3 - 8t2 - t2 + 0t - 4t + 5t*2. Let z(i) = 6n(i) + 5w(i). Factor z(s). -4(s - 1)(s + 2) Let p(l) = 265l*4 - 50l*3. Let k(o) = -38o*4 + 7o*3. Let r(j) = -20k(j) - 3p(j). Factor r(g). -5g*3(7g - 2) Let m = -1 - -1. Let h be 0/(-17 + 6) + (-1)/(-3). What is s in -s4 + m - 1/3s + hs3 + s2 = 0? -1, 0, 1/3, 1 Let g(d) be the first derivative of 5d*6/6 - 6d*5 + 10d*4 + 80d*3/3 - 120d*2 + 160d + 60. Solve g(i) = 0 for i. -2, 2 Let j = 266/11 - 22. Factor -jc + 16/11 - 10/11c*3 - 36/11c*2. -2(c + 2)*2(5c - 2)/11 Find g, given that 2/5g*2 + 2/5g*3 - 2/5 - 2/5g = 0. -1, 1 Let y(a) be the third derivative of -a8/1176 - a7/735 + 29a2. Determine w so that y(w) = 0. -1, 0 Suppose 2p - 14 = 4r, 0 = -0p - 2p + 5r + 16. Find u, given that 0u + 0 + 4/7u*p + 2/7u*4 + 2/7u2 = 0. -1, 0 Let j(l) = l3 - 6l2 + 9l + 3. Let g be j(3). Factor 0q + 1/5q*g - 1/5q2 + 0. q2(q - 1)/5 Let o(m) be the second derivative of 1/30m*4 + 2m + 2/15m3 + 0m*2 + 0. Factor o(k). 2k(k + 2)/5 Suppose 2d - 13 = 5. Factor 42n4 - 38n*4 + dn - 12n3 + 7n. 4n(n - 2)*2(n + 1) Let n(k) be the first derivative of k4/48 + k3/36 - 8. Factor n(s). s*2(s + 1)/12 Let m = -17567/48 - -366. Let z(r) be the second derivative of r + 0 - 1/6r3 - 1/2r*2 - mr4. Suppose z(w) = 0. What is w? -2 Let a(g) be the third derivative of g8/100800 - g7/8400 - g5/10 - 7g2. Let d(n) be the third derivative of a(n). Factor d(f). f(f - 3)/5 Factor -14/9x3 + 2/3x*4 - 1/9x*5 - x + 2/9 + 16/9x*2. -(x - 2)(x - 1)*4/9 Let g(i) = 5i*3 + 6i*2 + i - 2. Let k(r) = 6r*3 + 6r*2 - 3. Let y(x) = 3g(x) - 2k(x). Factor y(s). 3s(s + 1)2 Let k(s) = -15s*4 + 10s*3 + 40s*2 + 5s - 5. Let v(w) = -16w4 + 11w*3 + 41w*2 + 6w - 4. Let l(d) = 4k(d) - 5v(d). Solve l(i) = 0. -1, -1/4, 0, 2 Let -8s3 - 5 - 34s*2 - 23s - 1 - 19s + 10s = 0. What is s? -3, -1, -1/4 Let u(w) = 3w4 - 2w*3 - 5w*2 + 5w - 5. Let t(h) = -h3 - h2 + h - 1. Let k(j) = -5t(j) + u(j). Solve k(q) = 0 for q. -1, 0 Suppose -4s + 0 = -12. Let z(k) be the third derivative of 0 + k*2 + 0k + 5/36k4 + 2/45k*5 + 1/9ks. Let z(p) = 0. Calculate p. -1, -1/4 Let z(h) be the second derivative of h4/4 - 6h2 - 14h. Suppose z(m) = 0. What is m? -2, 2 Let l be ((-8)/(-3))/((-2)/(-3)). Let -4r2 + 15r + lr3 - 42r + 19r = 0. Calculate r. -1, 0, 2 Let p = 15 - 89/6. Let w(i) be the third derivative of -1/3i*3 + 0 + 1/10i*5 - 2i*2 + pi*4 + 0i. Factor w(f). 2(f + 1)(3f - 1) Let y(t) be the second derivative of -t6/70 - 9t5/140 - t4/14 + 21t. Solve y(k) = 0. -2, -1, 0 Suppose 0 = -3y - 5n + 16, -4n + 2n = -y - 2. Factor yz*2 + 4/3 - 14/3z. 2(z - 2)(3z - 1)/3 Let b be -1133/(-3). Suppose -1 = 5r - b. Suppose -3j3 + 7j - 2 - j*r - 2j*2 + 0j2 + j2 = 0. What is j? -2, 1/3, 1 Suppose -g + 0 = -3. Determine x, given that x*4 - 13x + x*2 + 13x + 2xg = 0. -1, 0 Let x be (-5)/(-20)2/12. Let v(t) be the second derivative of -xt3 - 1/4t*2 + 0 + t + 1/48t*4. Determine w, given that v(w) = 0. -1, 2 Let d(f) be the first derivative of -2f*3/15 - 6f*2/5 - 18f/5 - 3. Let d(q) = 0. What is q? -3 Let q(j) = -j*2 + 9j - 5. Let u be q(8). Let m = 5 - u. Suppose -4c3 - 7c + 3 - 5 - 8cm + c3 = 0. What is c? -1, -2/3 Factor 15 + 115/4f*2 - 35f - 10f3 + 5/4f*4. 5(f - 3)(f - 2)2(f - 1)/4 Let x(j) be the third derivative of -j*6/30 + 4j*5 - 200j*4 + 16000j*3/3 - 72j2. Let x(f) = 0. What is f? 20 Let z(k) be the third derivative of k7/3360 + k6/360 + k5/96 + k4/48 + k3/6 + 2k2. Let m(r) be the first derivative of z(r). Factor m(a). (a + 1)2(a + 2)/4 Let h(c) be the first derivative of -c6/90 - c5/60 + c*4/18 + 3c + 1. Let q(d) be the first derivative of h(d). What is r in q(r) = 0? -2, 0, 1 Let z(v) = -113v2 - v. Let k be z(3). Let i = -9170/9 - k. Factor -iu*2 - 14/9u - 4/9. -2(u + 1)(5u + 2)/9 Let x(y) be the second derivative of y5/20 + 5y4/12 + y3/2 - 9y2/2 + 9y. Let x(z) = 0. Calculate z. -3, 1 Factor 3/5y3 + 1/5y - 4/5y2 + 0. y(y - 1)(3y - 1)/5 Let t = -84 - -337/4. Solve -tl4 + 1/4l*2 + 0 + 0l*3 + 0l = 0 for l. -1, 0, 1 Let k(r) be the third derivative of r*2 - 1/12r*4 - 1/9r*3 + 0 + 1/105r*7 - 1/45r*5 + 1/90r*6 + 0r + 1/504r8. Factor k(h). 2(h - 1)(h + 1)4/3 Let x be -2 + ((-13)/5 - -5). Solve xy*5 + 0y*2 + 4/5y*4 + 0y + 0 + 2/5y3 = 0 for y. -1, 0 Let n(k) be the first derivative of -k6/24 - 5k*5/4 - 125k*4/8 - 625k*3/6 - 3125k*2/8 - 3125k/4 + 11. Factor n(s). -(s + 5)*5/4 Let c(f) = 2f*3 - 3f*2 + 3f + 3. Let g(m) = 4m3 - 5m*2 + 5m + 5. Suppose -3 = d - 2d. Let l(b) = dg(b) - 5c(b). Factor l(z). 2z*3 Factor -3i - 3/2 - 3/2i2. -3(i + 1)*2/2 Let j(b) = -2b*5 - 10b*4 + 10b*2 + 2b - 6. Let m(o) = -2o5 - 9o*4 + 9o*2 + 2o - 5. Let t(w) = -5j(w) + 6m(w). Find k such that t(k) = 0. -1, 0, 1 Let s(j) = -j3 - j2 - j. Let l(o) = o*4 + 7o*3 + 4o*2 + 3o. Let q(i) = -3l(i) - 15s(i). Determine r, given that q(r) = 0. -2, -1, 0, 1 Let m(n) be the first derivative of -n7/3360 - n6/360 - n5/120 + n3 - 3. Let v(q) be the third derivative of m(q). Suppose v(g) = 0. Calculate g. -2, 0 Factor -9y2 - 3/4y*5 - 39/4y*3 + 0 - 3y - 9/2y4. -3y(y + 1)2(y + 2)*2/4 Suppose 6q + 4 = 10. Factor 9/4m2 - 3m - 1/2m3 + q. -(m - 2)2(2m - 1)/4 Let j(p) be the first derivative of p5/10 - 3p4/8 + p3/2 - p2/4 - 7. What is w in j(w) = 0? 0, 1 Let j(k) be the third derivative of k6/60 + k5/15 + k4/12 - 2k2. Factor j(z). 2z(z + 1)2 Solve 0h - 2/9h4 - 2/3h*3 + 0h2 + 0 = 0 for h. -3, 0 Let t(w) be the second derivative of -w7/168 + w6/120 + w5/80 - w*4/48 - 8w. Let t(j) = 0. What is j? -1, 0, 1 Let o(i) = i*3 - 3i*2 + 3i. Let h be o(2). Factor -2c3 - 2c*4 + 4c*h - 2c*4 + 0c*2 + 2c. -2c(c - 1)(c + 1)(2c + 1) Let f = -17455/13 + 1343. Find i, given that 0 + fi*2 + 2/13i**4 +	{ "pile_set_name": "DM Mathematics" }
+ 6r - 84 = 0. What is the tens digit of g(r)? 2 Let p = -40 + 65. Let c(h) = -h + 22. Let r be c(p). Let f = 50 + r. What is the tens digit of f? 4 Suppose -3a - 1 - 10 = -2h, -a = -3h - 8. What is the units digit of (-26)/(-10)(-1015)/a? 7 Let j(k) = 264k*2 - 14k + 17. What is the units digit of j(-7)? 1 Let x = -491 - -391. Suppose -5b - 868 = 107. Let m = x - b. What is the units digit of m? 5 What is the thousands digit of 281619 - 0/(-428)? 7 Let u be (7 - 3) + (1 - 0). Suppose -48h + 270 = -18h. Let j = h - u. What is the units digit of j? 4 What is the hundreds digit of ((-5)/(-70) + 4713/(-126))-6288? 5 Let j be 1/(100/35 + (2 - 5)). Let h be 1/j + 50148/(-196). Let n = h - -542. What is the hundreds digit of n? 2 Let w = 19 + -54. Suppose x = -4x + 5h + 210, 0 = -4h. Let i = x + w. What is the units digit of i? 7 Let k(c) = -147c + 2424. What is the ten thousands digit of k(-53)? 1 Let n = 10816 + -4866. What is the hundreds digit of n? 9 Let z = -51 + 140. Let d = z + -41. Suppose 0 - 2 = 2f, -3f = -5t + d. What is the units digit of t? 9 Suppose z = -p + 81787, 5p + 75295 = 3z + 484246. What is the ten thousands digit of p? 8 Let s(z) = -5z3 + 8z*2 - 32z + 39. Let v(r) = -11r3 + 17r*2 - 65r + 79. Let x(y) = -9s(y) + 4v(y). What is the tens digit of x(10)? 4 Suppose 3f = 5f + 718. Suppose -37x + 8860 + 10047 = 0. Let m = x + f. What is the hundreds digit of m? 1 Let w(o) = -o2 - 375o + 7869. What is the hundreds digit of w(0)? 8 What is the units digit of (12760 + -5 + 5 - 0) + -1? 9 Let g be 18/(-8)(-1 - -13). Let r be (9/g)/((-1)/(-501)). Let u = -97 - r. What is the tens digit of u? 7 Let s = -59137 + 101320. What is the hundreds digit of s? 1 Let n(i) = 3i - 340. Let w be n(7). Let b = 734 + w. What is the tens digit of b? 1 Let o(v) = 181v + 47 + 26v + 50. What is the units digit of o(7)? 6 Let q be 4/(-42) + (-520)/(-168). Suppose qt - 4347 = -3s, -10s + 7s + 4327 = -2t. What is the units digit of s? 5 Let c(r) = -9r*2 + r - 2. Let f(j) = -9j*2 - 2. Let n(w) = -4c(w) + 3f(w). What is the tens digit of n(7)? 1 Let i(n) be the third derivative of -33n4/8 + n3/2 + 48n2. What is the hundreds digit of i(-1)? 1 Suppose -2j = -5j. Suppose r - 396 = -4s + 5r, 3r = j. Suppose 419 = 5k + s. What is the units digit of k? 4 Let h(r) = r2 - 17r - 136. Let q be h(23). Suppose -o - a = -476, 0 = -qo + 7o - 3a - 2340. What is the hundreds digit of o? 4 Suppose 5z = -20, -3z = v + 6v - 226480. What is the tens digit of v? 5 Let b be 1/(3/(-6)) - -30. Let y = -17 + b. What is the tens digit of (11 + 1)/(-10 + y)? 1 What is the thousands digit of 206022/42 - (-20)/(-35)(-4)/(-8)? 4 Let h = -28 - -8. Let j = -15 - h. Suppose -4p - 1046 = -jo, 5p - 845 = 4o - 8o. What is the units digit of o? 0 Let w(o) = 97o - 11. Let x be w(1). Let s = 44 + -107. Let i = s + x. What is the units digit of i? 3 Suppose -5r - 407 - 2978 = 0. Let l = 1613 + r. What is the hundreds digit of l? 9 Let m = 2421 - 499. Suppose w + m = 4c, 6c - 3w = 3c + 1437. What is the hundreds digit of c? 4 Let l = -14007 - -45628. What is the hundreds digit of l? 6 Suppose 121808 = -2822m + 2845m. What is the thousands digit of m? 5 Let a(s) = 30s2 - 45s + 137. What is the units digit of a(11)? 2 Suppose -1 = 4o - 145. Let h = 1012 - 932. Let y = h - o. What is the tens digit of y? 4 Let w = -18707 - -35606. What is the ten thousands digit of w? 1 Let p(y) = -41y*3 + 16y*2 - 20y - 247. What is the tens digit of p(-7)? 4 Suppose -5h + 7 = 3u - 2, h + 5u = 15. Suppose -3o + ho = 0. What is the tens digit of o/3 + 0 - -53? 5 Let f = -24475 - -37862. What is the thousands digit of f? 3 Let w = 399 - 392. Suppose 0 = wp - 5668 + 1811. What is the tens digit of p? 5 Suppose -4v - 7856 = -4s, 5894 = s + 2s - v. Suppose -52a = -57a + s. What is the units digit of a? 3 Suppose -3n + 129 = -r + 3r, -4n + 172 = -4r. Suppose 4a - 7 = -n. What is the units digit of (-283)/(-3) + 12/a? 3 Suppose 7z = z + 12. Suppose 4m = 7m - zo - 3861, 1279 = m + 2o. What is the thousands digit of m? 1 Let a = -144 - -148. Suppose -an = 3c - 2n - 53, 3c = 4n + 65. What is the tens digit of c? 1 Let q(b) = b*3 - 12b*2 - 26b + 243. What is the tens digit of q(28)? 5 Let h(v) = 4v3 + 14v*2 + 57v - 489. What is the units digit of h(12)? 3 Suppose -7y + 159429 = 22038 - 41438. What is the thousands digit of y? 5 Let o(j) = 6j*2 + j + 5. Suppose 4b - 52 = -3c - 9, -3c + 31 = b. Let n = -6 + c. What is the units digit of o(n)? 2 Let q(m) be the first derivative of -m*4/4 + 13m*3/3 - 5m*2 - 22m - 19. Let s be q(12). What is the tens digit of 160/s - (7 - 5)? 7 Let m(b) be the third derivative of b*4/8 + 4b*3/3 - 16b*2. Let s be m(-2). Suppose 2q - 56 - s = 0. What is the units digit of q? 9 Let x = -396 + 673. Suppose -11 = -4n + 9. Suppose 3a + u = 175, -na + 2u = -0u - x. What is the tens digit of a? 5 What is the thousands digit of 16185 - -12(-80)/64? 6 Suppose 0 = -3d + 39 - 42. What is the tens digit of (-3519)/12d/((-24)/(-64))? 8 Suppose -3o - 3 + 6 = 3i, -o = -4i + 19. Suppose 5y - 856 = -ir, -25y + 20y - 5r = -860. What is the units digit of y? 8 Let o(s) = 4s2 - 21s + 7. Let f = -368 - -384. What is the units digit of o(f)? 5 Let u = 227 - 77. Let m = -93 + u. What is the units digit of m? 7 Let t(m) = -11m - 99. Let p be t(-9). Suppose 23q - 2622 - 2277 = p. What is the tens digit of q? 1 Let c(r) = 14r + 1. Let k be c(-9). Let a = k - -129. What is the tens digit of 33(1/2)/(2/a)? 3 Let w(m) = 33 + 2m2 + 14m - 2m - 25m. What is the units digit of w(19)? 8 Let z(c) = 10c3 + 7c*2 - 16c + 34. Let x be z(6). Let k = 101 + -56. What is the tens digit of 2/(-9) + x/k? 5 Let w = 27395 - 11591. What is the ten thousands digit of w? 1 Let w(z) = 29z - 48. Let f be w(6). Let l = 37 + f. What is the tens digit of l? 6 Let g(n) = 1383n*2 - 638n + 1921. What is the thousands digit of g(3)? 2 Let r(z) = -4z - 6. Let w be 1/15(1 - 0). Suppose -2a + a - wy = 14, -70 = 5a + 2y. What is the units digit of r(a)? 0 Suppose a - 1 = 5m, m - 28 + 9 = 5a. Let u(g) = 2g*3 + 24g*2 - 17g - 30. Let q be u(-12). What is the tens digit of 3 + -4 + (q - a)? 7 Let v(r) = -3r3 - 8r*2 - r - 139. What is the units digit of v(-12)? 5 Let t(s) = -567s*2 - 66s - 129. Let l(y) = -188y2 - 22y - 43. Let p(j) = 8l(j) - 3t(j). What is the units digit of p(-2)? 7 Suppose -w - 6810 = -3n, -4544 = -3n + n + 2w. Suppose 13x - d = 9x + 2263, 3d = 4x - n. Suppose -14j + 401 = -x. What is the units digit of j? 9 Suppose 2z = s - 5s + 7108, 0 = 2s + 4z - 3566. What is the units digit of s? 5 What is the thousands digit of -110(-3 - 8371)(-5)/(-20)? 0 Let u(q) = -q2 + 3q + 10. Let y be u(10). What is the tens digit of (y/(-40))/((-3)/(-184))? 9 Let i be 3 + (0 - 2/(-2)). Let j be 31/(-1302)-28 - (-196)/3. Suppose 3f + 2n + j = if, -214 = -4f - 2n. What is the tens digit of f? 5 Let r(n) = -13n + 24. Let b be r(9). Let y = b - -389. Suppose 2q - y = -2q. What is the tens digit of q? 7 Let x(q) = 3q*2 + 7q - 15. Let t be (26/(-39))/((-4)/54). What is the units digit of x(t)? 1 Let d(k) = -2k3 - 24k*2 + 39k + 15. Let n be d(-13). What is the tens digit of (1450/11)/1 + (-28)/n? 3 Suppose 1175 = 17f + 155. Let g be 86/(-3)f/(-40). Let a = g - -72. What is the units digit of a? 5 Let i = 125068 - 72958. What is the thousands digit of i? 2 Suppose 0 = 2w + p - 92706, -24 = -196p + 192p. What is the units digit of w? 0 Let p(g) = 264g + 20. Let y be p(-10). Let f = -1834 - y. What is the units digit of f? 6 What is the units digit of (45654/(-49))/((-6)/28 + 0)? 8 Suppose -3l - 2u + 12 = u, -2l = 3u - 7. Suppose 407 = d - j, -lj = -5 - 15. Let c = -251 + d. What is the hundreds digit of c? 1 Suppose 3u + 5u = 48. Suppose -3o + 18 = uo. Suppose od = d + 7. What is the units digit of d? 7 Let y(q) = q*2 + 7q + 7. Let p be y(-7). Let f be (45/6)/(-5)20/(-6). Suppose -4v - 9 = p, -v = -fh + 69. What is the tens digit of h? 1 Let u(h) = -5h*3 - 23h*2 - 6. Let y(r) = 6r*3 + 25r**	{ "pile_set_name": "DM Mathematics" }
minator of y and -71/33? 33 Let j be 14709/(-5)(-9)/6. Let m = j - 4417. Find the common denominator of m and 13/20. 20 Find the common denominator of -3 + (2 - 148/(-104)) and -20/9. 234 Let r(v) = -v2 - 4v. Let j be r(6). What is the lowest common multiple of -1 + 1 - 6/(-1) and j/(0 + -3)1? 60 Let j(x) = 3x - 10. Let i be j(17). Suppose 6u - 35 = -3h + 4u, 4h - 3u = i. What is the smallest common multiple of 5 and h? 55 Let m be 0/(-31)1. Let a(j) = 0j + 7 + mj - 6j + j*2. What is the lowest common multiple of a(7) and 6? 42 Let x(t) = -t + 2. Let v be 10/(-20)(0 + 10). Calculate the lowest common multiple of 8 and x(v). 56 Find the common denominator of 4/(96/(-26))-101 and -37/3. 6 Let x = 62529/64 - -3050267/320. Let s = x + -10497. Find the common denominator of s and ((-130)/24)/(10/(-15)). 40 Suppose -4k + 44 = -0k. Let p(g) = -g + 14. Let t be p(6). Suppose -3s = -4h - t - 23, 3h = 2s - 21. Calculate the smallest common multiple of k and s. 99 Let g = -124/7 + 844/35. Calculate the common denominator of -47 and g. 5 Suppose 0 = s - m + 2m - 821, 4s - 2m = 3308. Suppose -s = -0q - 3q. Let u = 1889/7 - q. What is the common denominator of u and 34? 7 Let u = 139122353/310842 + -2715/4934. Let q be (-25351)/56 + (-3)/(-24). Let w = u + q. Find the common denominator of w and 43/4. 36 Suppose -4u + 2 = -22. Calculate the least common multiple of 17 and u. 102 Suppose 5c + 39 = -36. What is the common denominator of (-9)/15 - (-34)/(-160) and (c/2)/(9/(-5))? 48 Let s be 2/9 + 87/(-27). Find the common denominator of 1/6 and (s/18)/((-6)/123). 12 Calculate the common denominator of 59/8 and 830/1848 + (-14)/(-77). 168 Suppose b = -3 + 23. What is the smallest common multiple of (-130)/(-13)(-2)/(-2) and b? 20 Calculate the common denominator of -101/114 and ((-3094)/(-48))/17 + (-1)/(-3). 456 Suppose -3t = -4m + 29, m - 4t + 20 = 3m. What is the lowest common multiple of m and 32? 32 Let m = 0 - -4. Suppose -5a = -6a + m. Suppose -2c - b + 27 = 0, 5b = ac - 20 + 1. Find the common denominator of c and -37/5. 5 What is the common denominator of 2/(-2)(-72)/21 and -28? 7 Find the common denominator of 9/8 and 30/(-88)22/(-33). 88 Let q = -4062 + 36614/9. Calculate the common denominator of 51/11 and q. 99 Suppose -6 = 3x - k - 3k, -2x = -k - 1. Let p be -1(-2)/(-2)1. Let c = p + x. Calculate the least common multiple of 4 and c. 4 Let j be (-4 - -2)/(2/(-12)). Find the common denominator of (1 - (-111)/j) + -3 and -35/2. 4 Suppose -5b - 5k + 55 = 0, 0 = b + 4k - 2k - 16. What is the common denominator of b and 85/40(5 - 0)? 8 Suppose f + 0f - 13 = 4v, f + 2v = 7. What is the smallest common multiple of 6 and f? 18 Let o(v) = v*3 - 7v*2 + 3v - 5. Calculate the least common multiple of o(7) and ((-15)/(-6))/((-2)/(-8)). 80 Find the common denominator of 801/(-27)(1 - (-4)/(-5)) and 6/11. 165 Let w = 15 - 9. Let y(a) = 2a*2 + 6a + 4. What is the smallest common multiple of y(-4) and w? 12 Let w be 1 - 3 - 22-3. Let x = -19 + w. Calculate the common denominator of -11/6 and x. 6 Let m = -13 + 19. What is the lowest common multiple of 14 and m? 42 Let r = -2 + -3. Find the common denominator of 10(-6)/32r and -9/4. 8 Let n(h) = 3h3 - h2 - 6h + 4. Calculate the smallest common multiple of n(2) and (4/2)/((-1)/(-7)). 84 Let m = 144 - 320. Let g be (m/3)/((-1)/(-3)). Let d = -542/3 - g. What is the common denominator of d and 3/11? 33 Suppose -4k - 6 + 26 = 0. What is the smallest common multiple of k and 1? 5 Suppose 1418 = -3t + j - 3j, 4j + 1426 = -3t. Calculate the common denominator of t/420 - 4/6 and (-166)/40 - 4/(-10). 28 Let q(p) = 7p2 + p. What is the least common multiple of 10 - (1 - 1)/2 and q(-1)? 30 Suppose -2c - 4n = 10 - 38, 2c = -5n + 24. Suppose 20 = v + r, -5r + r + 20 = v. Calculate the smallest common multiple of c and v. 220 Let l = 6 - 4. Suppose 2a = -la. Suppose -4c = s - 30, a = -3c - 3s + 3 + 15. What is the least common multiple of c and 4? 8 Let p(f) = -f2 - 2f - 1. Let c be p(-3). What is the common denominator of (c/(-72))/(2/(-268)) and -55/6? 18 Suppose 114 = -3a - 3x, x + 122 = -3a - 0a. What is the common denominator of -22/5 and a? 5 Find the common denominator of ((-33)/44)/(4/(-22)) and 2-1 - (-412)/8. 8 Suppose -4z = -4h - 68, -3z - 4h = -42 - 16. Suppose -8 - 31 = -3a - 5x, -5a - x + 87 = 0. What is the least common multiple of a and z? 18 Let x be ((-12)/15)/((-4)/10). Suppose 0 = 6q - 4q + 3s - 13, 15 = xq + 5s. Let z = q - 0. What is the lowest common multiple of 4 and z? 20 Let w be ((-5471)/(-9))/(-1) + -2. Let d = w + 618. What is the common denominator of (-6)/(-132)(0 - -94) - 2 and d? 99 Let u = -7371/440 - -1/440. What is the common denominator of u and (-93)/(-140) + 4/14? 20 Suppose -3n = 4u + 3, -n - 2u - 1 = 2u. Calculate the common denominator of (1 - 2)/(n/(-12)) and 35/4. 4 Calculate the common denominator of 65(14/16 + -1) and (-2)/(-16) - (-51)/(-4). 8 Suppose -j + 11 = 2. Calculate the lowest common multiple of (-12)/54 + 56/j and 6. 6 Calculate the common denominator of -29/21 and (1/(-4 + 26))/((-9)/(-492)). 231 Calculate the common denominator of 37/12 and 0 + -2 + 3(-267)/(-162). 36 Find the common denominator of 1/12 and 62(65/(-120))/13. 12 Suppose -4m = 2i - 0m - 30, -5i - 3m = -61. Calculate the smallest common multiple of (24/18 - (-1)/(-3))9 and i. 99 Let l = 1/147 + -2795/294. Calculate the common denominator of 43/20 and l. 20 Suppose 3j - 178 = -4h, j - 29 = 5h + 62. Calculate the least common multiple of 12 and j. 132 Calculate the smallest common multiple of 4/(-3)(-9)/6 and 12. 12 Let v = 105 - 95. Calculate the smallest common multiple of v and 78. 390 Calculate the common denominator of ((-114)/15)/((-28)/20) and 2 - 1 - 749/42. 42 Let h = 118 - 108. What is the least common multiple of h and 82? 410 Let v = 361493/24 - 15056. Calculate the common denominator of -103/30 and v. 120 Let k(r) = 3r*2 + 5r - 2. Let j be k(2). Suppose 0 = 5g - g + v - 12, 0 = -g + 4v + j. Let m = 8 - 4. Calculate the lowest common multiple of m and g. 4 Suppose 10 + 12 = o. Suppose 20 = -5d, 0 = -j - d - d - 6. Find the common denominator of j/8415/(-10) and o. 8 Let c(z) = -z*3 - 10z*2 + 15z + 10. Let x be c(-11). Let r = -14 - x. Calculate the lowest common multiple of 22 and r. 220 Let w(i) = 2i3 + 5i*2 - i - 4. Let h be w(3). Suppose 2p - h = 3q - 0q, -5q - 170 = 5p. Calculate the common denominator of 19/4 and 7(0 - (-14)/q). 16 Let n(i) = 2i*3 - 2i*2 - i - 1. Suppose 22 = 3q - 8. What is the least common multiple of n(2) and q? 10 Let v be (-24)/(-16)10/3. Suppose 0 = -vx + 4z + 92, 0 = -2x - 0z + 3z + 41. What is the lowest common multiple of 1 and x? 16 Let q = -1426933793/126 + 11324788. Let f = q - -577/7. What is the common denominator of -35/2 and f? 18 Let h = -7 + 10. Suppose hb = 14822 + 889. Let i = -31343/6 + b. What is the common denominator of i and 143/6? 6 Let a(g) = g + 16. Let p be a(-12). Find the common denominator of (-7)/9(5 - p) and -13/10. 90 Let o = -13 + 25. Calculate the common denominator of (o/(-10))/(16/12) and 133/6. 30 Find the common denominator of 91/16 and (1-2 - (97 - -2))/24. 48 Let h = 4/11 + -263/88. Find the common denominator of h and 76/9. 72 Let a(m) = m2 + 3m - 3. Let y = -12 - -5. Find the common denominator of (-75)/14 + 5/(-35) and a(y). 2 Let k = -531/92 + 12/23. What is the common denominator of 28/5 and k? 20 What is the smallest common multiple of -4 + 2 + 2 - -9 and 33? 99 Let i(w) = -61w2 - 4w - 6. Let z be i(-4). What is the common denominator of 73/6 and (6/7)/((-240)/z)? 60 Suppose 0 = 5w + 3h - 59, -3w + 0h - 3h = -39. Calculate the smallest common multiple of 1 and w. 10 Suppose 23n - 66 = 20n. What is the lowest common multiple of n and 11? 22 Suppose -5k = 20 + 15. Let o = 13 + k. Suppose -1 = 4z + 2l - 11, 4l - 16 = -4z. What is the smallest common multiple of o and z? 6 Let t be 578922/418*(-2)/628. Let o = -141/1450 - -413353/4325350. Let b = t - o. Calculate the common denominator of -43/14 and b. 154 Let h = -2/585 + -50891/1170. Calculat	{ "pile_set_name": "DM Mathematics" }
(-4/3)))/f))f))/f)(-17/6) assuming f is positive. f(1021/126) Simplify ((s0)(-7/5)s(1/4)/s1)(-41) assuming s is positive. s(123/4) Simplify ((v(-1/4)/(((vvv(1/4)v)/v)/v))/((v*(2/3)/v)/(v/(v/((vv/(v/v*6v))/v)))))41 assuming v is positive. v(943/6) Simplify ((o/(ooo*(-5/11)o)oo)/(o(-20/3)/o))/(o(-27)/o(-1/32)) assuming o is positive. o(37055/1056) Simplify (x*6x*(3/7)x*(-3/4)xx(-5))38 assuming x is positive. x(893/14) Simplify (x(-3/4)x)/(x/(x*(-2/19)/xx))x(-1/7)/(x/(x(1/14)/x)) assuming x is positive. x(-1557/532) Simplify (mm(((mm*(-1/3)mm)/m)/m)/m)(14/9)(m/(m*27m)m)/m(1/23) assuming m is positive. m(-14563/621) Simplify (nn*(1/7)n)/((nn(-8))/n)(nn/(n(2/9)/n))(3/13) assuming n is positive. n(2944/273) Simplify ((o(-26)o)/((o/(o(o/o6)/oo))/o))(-49) assuming o is positive. o1421 Simplify (u(2/3)/((u/u11)/u))/((u/u2)/u(-10)) assuming u is positive. u(8/3) Simplify (((j(3/8)jj)/jj)/(jj(-2/41)))/(j(-2/13)j(-3)j) assuming j is positive. j(15255/4264) Simplify (f/f24)/f*(-1/4)(f/(f/f(-3/16)))(-13/6) assuming f is positive. f(-715/32) Simplify u(5/4)uu*(-4)(u*(-2/17)uu)/(u/(u(-7)u)) assuming u is positive. u*(-467/68) Simplify ((hh(-18))/h27)/((hh/h25)/h18) assuming h is positive. h(-3) Simplify (yy/(yy(1/8)))(1/4)/((yy*30y)/y(-2/17)) assuming y is positive. y(-17353/544) Simplify (((k/k*(-8)k)/(k/(k/k*8)))/((k/(k/((kk/(kk/(k(k/(kk/k(-3/4)))/k)k))/k))k)/(k/(k8k))))40 assuming k is positive. k(-130) Simplify m*(-1/3)m*17m(mm(-2/13))/m35 assuming m is positive. m(-643/39) Simplify (x(-18)x1)/((x(-2/49)x)/((x*(-12/5)/x)/xx)) assuming x is positive. x*(-5233/245) Simplify (ff/(ff(-12)))/fff(-4/3)(f(16/7))(2/99) assuming f is positive. f*(8117/693) Simplify ((aa(-4)/a)/a)(-44)aa*(1/27)aa10 assuming a is positive. a(6265/27) Simplify (((m(3/5)/m)/m)(-7))(5/2) assuming m is positive. m(49/2) Simplify ((g2)29)(1/3) assuming g is positive. g(58/3) Simplify (dd*(-8)ddd(2/21))/(d(-5)/d(-2/15)) assuming d is positive. d(-4/105) Simplify ii(-2/7)(i*(-2/13)/i)/iiii*1i(-2/37) assuming i is positive. i(5072/3367) Simplify c/(c/c*(8/7))c/c*11c(c(-1/3))40 assuming c is positive. c(-445/21) Simplify ((rr*(-3)rr(1/4))(25/4))0 assuming r is positive. 1 Simplify (((n/n(6/11))(-47))(-48))46 assuming n is positive. n(518880/11) Simplify (u4uu)(-2)/((uu*(-2/15)uu)/(u/(u/u25))) assuming u is positive. u(152/15) Simplify (x(-1/6))14(xx(-2/7)/x)(-11) assuming x is positive. x(17/21) Simplify ((j/(jj/j*(3/8)))/jjjj/(j*(-1)j))(16/7) assuming j is positive. j(22/7) Simplify ((w/w*(-2/23))/(ww/(w/((ww(1/5)/w)/w))))(6/5) assuming w is positive. w(612/575) Simplify ((y/(y/((y/y(7/5))/y))y/(y/(y(3/16)/y)))/((y/y(-4))/y2))(-8) assuming y is positive. y(417/10) Simplify (w(3/5)/(ww/(w/((w(-16)ww)/w))w))(2/9) assuming w is positive. w(136/45) Simplify o/(((o*(-2/3)/o)/oo)/ooo)(o(-30)/o)/o(o/o*(-1/6)o)(2/7) assuming o is positive. o(-208/7) Simplify (a/(aa/(a/a(-5/3)))a)/a*(-1/11)a(-3/14)/((a(19/4)a)/aa) assuming a is positive. a(-2963/924) Simplify (t/(t/(t(4/9)t)))(5/7)t*19t(t(2/101)/t)/t assuming t is positive. t(121225/6363) Simplify (g/g(-2/11))38/((g13/g)/gg(-1/6)) assuming g is positive. g(2249/66) Simplify (v/(v/((vv(-3/28)vv)/v))v)*(-1/53)/(vvv/(v/(v/(vv/(v/(v/(vv/(v(3/11)vv)v))v)v)v))vv)(-10/3) assuming v is positive. v(769007/48972) Simplify p(-5/4)/(((pp/(ppp*0/pp))/p)/p)p/(p14/p)(p/(p/((p/p(1/6))/p)))/p assuming p is positive. p(-149/12) Simplify (s*(2/17)s*2/ss)/(s/s*(-6)s*(-4/3)s) assuming s is positive. s(-232/51) Simplify (b18/b*0)/(bb*(-1/8)b(2/59)) assuming b is positive. b(8067/472) Simplify (ii(-4))(3/5)(i(1/6))30 assuming i is positive. i(16/5) Simplify ((m/m(-2/9))*(2/55)/((m(m/(mmm*(2/3)mm))/m)/mmm((mm/m(1/2))/m)/m))(-3/5) assuming m is positive. m(-289/150) Simplify ((h(-2/11))18hh(-1/3)hh/h(-9))27 assuming h is positive. h(2493/11) Simplify (w(w/w*2)/ww)*(2/39)/(ww*(-1/7)w/(ww(-9)/w)) assuming w is positive. w(-76/7) Simplify k(3/8)k*(-4)k*(24/7)kkk23 assuming k is positive. k(1389/56) Simplify (mm(-2/7))(-1/2)mmm/((m/(m*4m))/m)m(-3/2)m assuming m is positive. m(50/7) Simplify (r(-1/5))*49(r*0r)/r(r/(rr(-1)/r))/r assuming r is positive. r(-44/5) Simplify ((cc(2/11)/c)/c)/(c/c3)c(-3)/c(2/7) assuming c is positive. c*(-162/77) Simplify (mm(8/7))/m(4/11)mm*(-1/3)mm/(mmmm*(10/9)m) assuming m is positive. m(-461/693) Simplify ((j3j)(9/11)j*(1/6)j((j3/j)/jj)/j)35 assuming j is positive. j(12565/66) Simplify (t*21/ttt(-1/10)/t)/((t(tt(-19)t)/t)/(t((t((t/((t*3/t)/t))/tt)/tt)/t)/t)) assuming t is positive. t(369/10) Simplify (w(7/5)w(3/7))/(w(-1/25)/w)(1/16) assuming w is positive. w(2651/1400) Simplify ((l*12/lll(-1/5)/l)/((l/l(-5/3))/ll(l/l(-2/31)ll)/l))(-42) assuming l is positive. l(-39508/155) Simplify zz*(-13)z*(-4)(z/((z/(z/z(-12)))/z))/z(-1/2) assuming z is positive. z*(-3/2) Simplify (q/(q(q/(q(-1)/q))/q))(-48)/(((q12/q)/q)/q21) assuming q is positive. q107 Simplify ((z(-2/45))(2/21))(-10) assuming z is positive. z(8/189) Simplify (h(-5)hh*(-4/3)/h(hhh*(2/7))/hh1)(-4) assuming h is positive. h*(340/21) Simplify (f/(ff*(-8)f))/f*(-1)f(1/10)/f(-1/10) assuming f is positive. f*(41/5) Simplify (pp*(-1/4)p)*(-7/4)(p/(p/(pp16)p))/ppp25 assuming p is positive. p(607/16) Simplify (f*14f(-18))/(f(8/3)ff/(f/(ff(-6/13)))) assuming f is positive. f(-320/39) Simplify (((o(oo(-1)oo)/o)/o)/o)(-22/9)o/(oo/(o/((o/((o/o(4/15))/o))/o)ooo))o(-3/5)oo assuming o is positive. o(62/15) Simplify ((i/i(-1)i/i*0i)/(i*(-3)/(ii(2/13))))(-20) assuming i is positive. i(-2120/13) Simplify ((w(2/7)w)(1/15)w*(3/4)ww(-2/7))(-44) assuming w is positive. w(-341/5) Simplify u/(u/u(-8))(uu(5/6)/u)/u(u/u(2/41))/(u/(u/u(-2))) assuming u is positive. u(-1283/246) Simplify (b(-31)b7)/(b(-34)/(bb(b/(b/(b/b39)))/bb)) assuming b is positive. b(-26) Simplify (f(-1/6)f/((ff(2/3))/f))(8/5) assuming f is positive. f(4/15) Simplify (y11y0y)/(y/(yy(-11)y)y(-1)) assuming y is positive. y3 Simplify (s/s16s)*(1/22)/(s/(ss*(9/5)s)s(1/12)) assuming s is positive. s(1373/660) Simplify u((uu(-2/9))/u)/uuuuu(1/8)(((uu(-4)uu)/u)/u)/(u0u) assuming u is positive. u(-79/72) Simplify h22h0/h(h6)(17/2) assuming h is positive. h72 Simplify ((v(3/8)/(v/((vv(4/3)v)/v)))/((vvv/(v/v(-8)))/v(-6)))(1/2) assuming v is positive. v(41/48) Simplify ((t/t(1/14))/(t/t(-3)))/((t/t(-1/20))/t(2/17)) assuming t is positive. t(-9529/2380) Simplify (b(-2)/(((b/(b(bb*(5/3))/bb)b)/b)/b))/(b(2/9)b)28 assuming b is positive. b(-293/9) Simplify w/w*(1/5)w*(-3/4)w*(-1/3)ww/(w/(w32w))w assuming w is positive. w(2083/60) Simplify (((a5a)/a*(3/14))/((aa/(a(a/a1a)/a)a)/a)(-4/3))(-3/11) assuming a is positive. a(-299/154) Simplify u17/(u/(u11/u)uu)(u(2/11))11 assuming u is positive. u26 Simplify (m/(m(-3)mmm))(-21)(m*(-3)mm)(2/109) assuming m is positive. m(-2291/109) Simplify ((vv/((v*11v)/v))/v*(3/8))/(vvv7)25 assuming v is positive. v(-1875/8) Simplify u/(u(-4)/uu)u(15/8)u(u/u(-2/5))(-5/11) assuming u is positive. u(637/88) Simplify (u8/(u/(uu(-2/3))))/(u/u0uu(2/137)) assuming u is positive. u(2186/411) Simplify (((l*(-3)/l)/l)/(ll/((l*(-4/3)l)/ll)l)l(-5/6)l(lll1)/ll)(-20) assuming l is positive. l(310/3) Simplify tt(-5/7)t*(-10)t*(-5)t/t0 assuming t is positive. t(-96/7)	{ "pile_set_name": "DM Mathematics" }
is 8 + -52? -46 In base 15, what is 7b + -7? 74 In base 13, what is 8 - 16a? -162 In base 5, what is -2443 - -4? -2434 In base 11, what is 4 + -647? -643 In base 14, what is -2b6 + 3? -2b3 In base 6, what is 2 + 13554? 14000 In base 10, what is -1 + -232? -233 In base 13, what is 8aa + 3? 8b0 In base 3, what is 122 + 2100? 2222 In base 6, what is -14 + 314? 300 In base 10, what is -96 + 1? -95 In base 16, what is -1 + -245e? -245f In base 13, what is -1 - 66? -67 In base 10, what is -5 - -239? 234 In base 11, what is 89a2 - -1? 89a3 In base 6, what is -50 - -3? -43 In base 2, what is 10111 + -11001111? -10111000 In base 2, what is -1001001000111 - -100? -1001001000011 In base 7, what is -42553 + 4? -42546 In base 12, what is -9 + 85? 78 In base 9, what is -3 - 47? -51 In base 5, what is -204 - -11? -143 In base 7, what is -106204 - 5? -106212 In base 15, what is 68 + -2? 66 In base 8, what is 136 + 0? 136 In base 14, what is 5 - 22? -1b In base 14, what is cac5 + -3? cac2 In base 10, what is -585 - -4? -581 In base 3, what is -21020 + 2? -21011 In base 5, what is -24042 + 13? -24024 In base 9, what is -2 + 5254? 5252 In base 5, what is 10 - -10? 20 In base 7, what is -3 - 14631? -14634 In base 3, what is -120211121 - 0? -120211121 In base 15, what is -1 - -3c8? 3c7 In base 12, what is 0 + 2? 2 In base 5, what is -14 + 0? -14 In base 5, what is -13 + -13? -31 In base 14, what is -534 - 1? -535 In base 3, what is -211 - -12? -122 In base 14, what is -16 - 35c? -374 In base 11, what is 125 - -6? 130 In base 10, what is -122 + -7? -129 In base 12, what is 19 + 4? 21 In base 3, what is 11 - -21? 102 In base 7, what is -1224 + 0? -1224 In base 7, what is 13224 + 1? 13225 In base 8, what is 456 - -1? 457 In base 8, what is 144420 - 3? 144415 In base 13, what is -3c - -5? -37 In base 15, what is -2d - -9? -24 In base 3, what is -112 - -100? -12 In base 10, what is 37 + -5? 32 In base 11, what is -25 + 667? 642 In base 9, what is 3 + 5022? 5025 In base 10, what is 62 + -9? 53 In base 5, what is 10 - -22? 32 In base 16, what is -6 - 485? -48b In base 8, what is -3 - -171? 166 In base 3, what is 0 - -111121? 111121 In base 7, what is -12633 - 2? -12635 In base 13, what is -62 - 2? -64 In base 16, what is -3 + 1ed? 1ea In base 10, what is 5 + 119? 124 In base 10, what is -63 - -15? -48 In base 14, what is 4 + -2083? -207d In base 13, what is -9 + -9? -15 In base 14, what is 12 - 747? -735 In base 10, what is -2396 - 5? -2401 In base 5, what is -11 + 3000? 2434 In base 3, what is 11102021 + -11? 11102010 In base 2, what is 0 + -1001011? -1001011 In base 10, what is 25 + -4? 21 In base 7, what is -101 + 3? -65 In base 16, what is 4c + 40? 8c In base 14, what is 1 - 59? -58 In base 3, what is -112011 + -10? -112021 In base 12, what is -1 + -a? -b In base 12, what is a3b - 2? a39 In base 10, what is -4 + -75? -79 In base 12, what is -16b8 - -4? -16b4 In base 4, what is -11 + 101023? 101012 In base 8, what is 5 - -362? 367 In base 7, what is -2511 + -5? -2516 In base 9, what is 1586 - -4? 1601 In base 14, what is 89 - -4? 8d In base 2, what is 10010110 + -101? 10010001 In base 4, what is -210313 + 1? -210312 In base 16, what is -d - 8c? -99 In base 16, what is 8 - 13? -b In base 7, what is 5133 + -6? 5124 In base 5, what is -210340 + -2? -210342 In base 3, what is 100 + 1? 101 In base 7, what is -11 - -3104? 3063 In base 15, what is 0 + 43? 43 In base 2, what is 111 - -11101? 100100 In base 10, what is -1 - -63? 62 In base 14, what is 3 + 10? 13 In base 7, what is 1031 + 3? 1034 In base 7, what is -2 - 54? -56 In base 7, what is 2 - -116? 121 In base 9, what is 20 + 348? 368 In base 12, what is -188 - -3? -185 In base 5, what is -3 + 2023? 2020 In base 15, what is -1 - 684? -685 In base 15, what is 3 - -47? 4a In base 15, what is 2 - -1d4? 1d6 In base 6, what is -4 - -524? 520 In base 16, what is -1 - 450? -451 In base 7, what is 22 - -56? 111 In base 12, what is 528 + 1? 529 In base 10, what is 10 + -125? -115 In base 5, what is 124 - 3322? -3143 In base 11, what is 5 - a89? -a84 In base 15, what is 329 - -5? 32e In base 11, what is 44 - 18? 27 In base 3, what is 2 - 22110? -22101 In base 12, what is -186 - 2? -188 In base 15, what is -ec9 + 4? -ec5 In base 16, what is 32 - 4? 2e In base 14, what is -1534 + 3? -1531 In base 13, what is -6c01 - -3? -6bcb In base 14, what is 4 + -84? -80 In base 16, what is -4 + c8? c4 In base 10, what is -27 + 64? 37 In base 14, what is 0 - -d2? d2 In base 11, what is 3 - -1a? 22 In base 6, what is 5 + -2031? -2022 In base 2, what is 100 - 1111? -1011 In base 13, what is -2 - -15? 13 In base 12, what is -345 + 20? -325 In base 4, what is -10 - 3122? -3132 In base 16, what is -13b + 0? -13b In base 12, what is 66 + 23? 89 In base 4, what is 11 + 3202? 3213 In base 14, what is 4 + -172? -16c In base 9, what is 43 - 58? -15 In base 15, what is 10 + 4? 14 In base 13, what is b4 - -5? b9 In base 11, what is 2 - -363? 365 In base 4, what is -10 + 120? 110 In base 8, what is -5 - 250? -255 In base 8, what is 137 - 2? 135 In base 14, what is -8 - 9? -13 In base 9, what is -53 - -16? -36 In base 10, what is 281 + 3? 284 In base 6, what is 11301 - -5? 11310 In base 3, what is 0 + -21020? -21020 In base 3, what is 10010100 - -1? 10010101 In base 11, what is 15 - 2? 13 In base 11, what is -a9 + -4? -102 In base 11, what is 0 + -314? -314 In base 6, what is -4 - 45004? -45012 In base 8, what is -44 - -226? 162 In base 6, what is 4 - 4? 0 In base 7, what is -5510 - 0? -5510 In base 14, what is 1 + -a7? -a6 In base 13, what is 4 + 111? 115 In base 5, what is 110244 + -4? 110240 In base 8, what is -1410 - 5? -1415 In base 11, what is 5 - 7? -2 In base 15, what is 307 + -7? 300 In base 15, what is 52 + 1? 53 In base 13, what is -a084 - 5? -a089 In base 8, what is -1 - -2704? 2703 In base 5, what is 10 + -134? -124 In base 4, what is 130 - -1? 131 In base 16, what is 2 + 296? 298 In base 12, what is -5 + -3a? -43 In base 6, what is 133514 + -2? 133512 In base 3, what is -20 + 1111? 1021 In base 9, what is 24 + 431? 455 In base 3, what is 12122 + 120? 20012 In base 12, what is 0 + 40? 40 In base 6, what is -125 - -3? -122 In base 10, what is -2436 - -1? -2435 In base 11, what is 4 - 11? -8 In base 16, what is 4 + 52? 56 In base 6, what is -2 + -20? -22 In base 3, what is 21 + -2022111? -2022020 In base 3, what is -220 - -220? 0 In base 11, what is a + 3? 12 In base 14, what is 0 + 24? 24 In base 4, what is -131 + -201? -332 In base 2, what is 101 + -11110? -11001 In base 8, what is -4704 + 2? -4702 In base 8, what is 260 + 11? 271 In base 6, what is 2 - -5510? 5512 In base 16, what is -20 - -cb? ab In base 5, what is 10 + 242? 302 In base 12, what is -1 + -50? -51 In base 11, what is 33 - 2a? 4 In base 12, what is 33b3 + 5? 33b8 In base 5, what is 234 + -113? 121 In base 2, what is -100 + -101110? -110010 In base 8, what is -3 - -74? 71 In base 15, what is 149 + 5? 14e In base 9, what is -1 - 202? -203 In base 9, what is 50 - 0? 50 In base 7, what is -35 - -256? 221 In base 9, what is 42 - 34? 7 In base 3, what is -10000222 - -10? -10000212 In base 16, what is 6 - 3b7? -3b1 In base 2, what is 100 - 10101? -10001 In base 14, what is -3113 - -2? -3111 In base 15, what is 4 - -36? 3a In base 9, what is -14 + 65? 51 In base 7, what is -2 - -5? 3 In base 8, what is -214 + 22? -172 In base 15, what is -3 + -94? -97 In base 16, what is -11e - 8? -126 In base 15, what is -b5 - -6? -ae In base 8, what is 12363 + -1? 12362 In base 14, what is -35 + -1? -36 In base 10, what is 0 + -338? -338 In base 3, what is 2212101 + 11? 2212112 In base 7, what is 4 + -110? -103 In base 14, what is -402 + -4? -406 In base 7, what is -3 - -2634? 2631 In base 2, what is -1000 - 110? -1110 In base 4, what is 21 - -1021? 1102 In base 3, what is -20210 + -2? -20212 In base 7, what is 63 - -31? 124 In base 11, what is -551 - 2? -553 In base 11, what is 4 + 28? 31 In base 16, what is -3 - 14? -17 In base 9, what is 4 + -7648? -7644 In base 8, what is -261 + -41? -322 In base 6, what is 10 - 102? -52 In base 12, what is -5 - -125? 120 In base 12, what is 2 + -6? -4 In base 2, what is -100 - 11011100? -11100000 In base 5, what is 40 - 12? 23 In base 13, what is 240 - -2? 24	{ "pile_set_name": "DM Mathematics" }
q - 2 Let m(u) = -4u2 - 6u - 6. Let d(g) = 44g2 + 64g + 68. Calculate -3d(s) - 32m(s). -4s2 - 12 Let u(c) = -c3 + 28 - 27 - c2 + c + 2c*3. Let j(f) = 777f*3 + 3f*2 - 12f*2 + 9 - 766f*3 + 9f. Determine 2j(r) - 18u(r). 4r3 Let l(h) = 21h + 14. Let y(g) = -2g + 6. Give -l(o) + 3y(o). -27o + 4 Let z(w) = -2. Let a = -19 + 23. Let f(j) = aj + 1 - 6 - 4j + j. Calculate 3f(c) - 7z(c). 3c - 1 Let s(p) = 286p2 + 3p. Let z(t) = -1430t2 - 14t. Calculate 14s(g) + 3z(g). -286g2 Let n(i) = 145i*2 + 4i - 1. Let f(z) = -288z2 - 7z + 1. Give 3f(y) + 5n(y). -139y2 - y - 2 Let l(y) = y3. Let c be 38/190 - (4/(-20))/(-1). Let b(o) be the second derivative of -2o + 0 + 0o2 + 0o*3 + co*4 - 1/5o*5. Give -b(i) - 5l(i). -i3 Let l(j) = -j2 + 2j + 1. Let x(g) = -18g*2 - 3g. Calculate 2l(t) - x(t). 16t*2 + 7t + 2 Let m(y) = y3 + y2 + y. Suppose -3l = -8l + o - 17, 2l + 5o - 4 = 0. Let i(q) = 4q3 + 3q*2 + 4q. Determine lm(u) + i(u). u3 + u Let w(x) = 5x + 6x + 6x + 29x - 42x. Let y(j) = -j - 1. Determine w(s) + 2y(s). 2s - 2 Suppose 5 = 4i - 7. Suppose 2s + 11 = h - 0h, ih = 5s + 28. Let x(t) = -t3 + 7t - 6. Let a(u) = u*3 - 4u + 3. What is sa(n) - 3x(n)? -2n3 - n + 3 Let t(v) = 6. Suppose -4w = 8w + 29 + 7. Let q(x) = -x - x - 5 + x. Give wt(a) - 4q(a). 4a + 2 Let o(h) = -4h + 0h + 3h. Let z be (-6)/6 + 4/(-1). Let d(l) be the third derivative of -l4/6 - l3/6 - 2l*2. Give zo(y) + d(y). y - 1 Let t(a) = 1. Let k(l) = 2l + 6. Let r = -1728 + 1732. Calculate rt(u) - k(u). -2u - 2 Let t(r) = -7r*2 - 166r - 5. Let n(y) = -11y2 - 248y - 8. Give -5n(k) + 8t(k). -k*2 - 88k Suppose 5w = -4i + 2i + 73, -4w = -4i - 36. Let m(a) = -65a*3. Let c(b) = -11b*3. What is wc(s) - 2m(s)? -13s*3 Let r(g) = -3g*2 - 3. Let h(x) be the second derivative of -1/4x4 - x - x2 + 0x3 + 31. Let p = 1 - 3. Determine pr(n) + 3h(n). -3n*2 Let q(i) = 12i*2 + 9i - 9. Let y(d) = 11d2 + 8d - 8. Give 6q(f) - 7y(f). -5f2 - 2f + 2 Let g(o) = -5o2 - 3. Let l = -2 - -16. Let v be (-21)/l(-12)/(-9). Let y(z) = 21z2 + 13. Calculate vy(n) - 9g(n). 3n*2 + 1 Let s(l) = -2l*2 + l - 2. Let m(v) = -4v*2 + 2v - 4. Let u = 30 - 24. Calculate um(n) - 13s(n). 2n2 - n + 2 Let f(j) be the second derivative of 5/2j*2 + 0 - 1/2j*4 - 5/6j*3 - 16j. Let z(u) = 5u2 + 4u - 4. Determine -4f(g) - 5z(g). -g2 Let q(i) = -i3 - i*2 + i. Let m(p) = -8p*3 - 8p*2 + 5p. What is -m(t) + 6q(t)? 2t*3 + 2t2 + t Let n(p) = -p3 - 5p2 - 6p. Let f(g) = -2g3 - 9g*2 - 11g. Calculate 6f(r) - 11n(r). -r3 + r2 Let g(v) = 19v2 + 19v + 5. Let y(l) = 37l2 + 37l + 9. Let k(q) = 7g(q) - 4y(q). Let t(j) = 3j2 + 3j. Calculate 2k(u) + 11t(u). 3u2 + 3u - 2 Let d(h) = 23h + 12. Let n(t) = 64t + 34. Let a(m) = -17d(m) + 6n(m). Let i(s) = -13s. Determine -14a(f) + 6i(f). 20f Let y(r) = -664r + 112. Let d(n) = -35n + 6. Calculate -112d(h) + 6y(h). -64h Let w(z) = -z - 36. Let b(c) = -2. Calculate -18b(h) - 2w(h). 2h + 108 Let g(t) = 52t - 16. Let o(d) = 19d - 6. What is 4g(k) - 11o(k)? -k + 2 Let q(c) = -3c - 2. Let f(p) = -29p + 31p - p + 1. Let d(j) = -5j + 1. Let z be d(1). Give zf(r) - q(r). -r - 2 Let s(j) = 1. Suppose 0 = 5r - 0r + 10. Let g(a) be the second derivative of a4/12 + a3/6 - 2a*2 + 201a. Give rg(y) - 9s(y). -2y2 - 2y - 1 Let g(w) = 2w3 - 5w*2 - 5w - 5. Let s(r) be the third derivative of -r6/120 + r5/60 + r4/24 + r3/6 - 148r2. Calculate -3g(x) - 15s(x). 9x*3 Let k(c) = c + 5. Let f(o) = -3o - 11. Let t(u) = -2u - 16. Let x be t(-9). Let i be x - 33/(18/6). Determine ik(z) - 4f(z). 3z - 1 Let r(i) = 3i - 1. Let c(x) = 6x*2 - 13x + 5. Give c(m) + 2r(m). 6m*2 - 7m + 3 Let y(m) = -21m - 99. Let g(k) = -59k - 296. Give -6g(t) + 17y(t). -3t + 93 Let z(t) = -33t - 3. Let u(j) = -35j - 2. Determine -3u(g) + 2z(g). 39g Let n(b) = -b - 6. Suppose 0 = 2c - 3l - 14, 3c + 0l + 5l = 21. Let h be 100/c - (-14)/(-49). Let g(f) = 12 - 25 + h. Give 6g(x) + n(x). -x Let t(b) be the third derivative of b*4/24 - 6b*2 + 12b. Let h(q) = -7q. Give 4h(j) + 36t(j). 8j Let v(j) = -6j - 1067. Let s(z) = -2z - 356. Calculate 7s(a) - 2v(a). -2a - 358 Let n(o) = -o - 2. Let h(y) = -2y - 4. Let g = -44 - -51. What is gn(j) - 3h(j)? -j - 2 Let k = 1 - 4. Let f(l) be the third derivative of 0l + l2 + 1/8l*4 + 0 + 1/2l3. Let r(x) = x2 - 4x - 4. Calculate kr(o) - 4f(o). -3o2 Let g(a) be the third derivative of a3/6 + a2. Let d(k) = -k2 + 3k + 1. Let z be d(3). Let s(w) = 6w + 2 + 3w + w - 8w. What is zs(n) - g(n)? 2n + 1 Let l(k) = 18k2 - 31k2 - k3 + 11k2 + 1 - k3 + k. Let p(i) = -i3 - i2 + i + 1. Calculate l(o) - p(o). -o3 - o2 Let c(g) = 2g + 39. Let f(m) = m + 39. Determine 3c(s) - 4f(s). 2s - 39 Let u(m) = 32m*2 + 171m + 5. Let g(s) = 6s2 + 34s + 1. Give -11g(p) + 2u(p). -2p2 - 32p - 1 Let v = 17 - 8. Let x(l) = 2l - 5. Let o(m) be the second derivative of -5m*3/6 + 11m*2/2 - 2m - 4. Determine vx(j) + 4o(j). -2j - 1 Let d = 17576 + -17549. Let g(o) be the third derivative of -o5/60 + o4/12 - o3/3 - o2. Let f(c) = -12c*2 + 27c - 27. Determine dg(b) - 2f(b). -3b2 Let o(l) = -3l - 3l + 4l - 5. Let g(s) = -s*3 + 9s*2 - 8s - 5. Let k be g(8). Let u = 8 + k. Let x(r) = 2r + 6. What is ux(p) + 4o(p)? -2p - 2 Let w(p) = -300p - 11. Let m(i) = 4i + 2. Give 6m(y) + w(y). -276y + 1 Suppose 0 = q - 2. Let j(p) = -13p. Let x(v) = 3v. Suppose 0 = -3i - 3i + 264. Suppose 0 = -4d - u + i - 3, 0 = 4d - u - 31. Calculate dx(h) + qj(h). h Let h(v) = v + 13. Let b(f) = 2f + 14. Determine 6b(c) - 7h(c). 5c - 7 Let s(v) = v. Let k(y) be the third derivative of -y4/6 + y3/3 - 18y2 - 3. Calculate k(c) + 5s(c). c + 2 Let j(g) be the second derivative of -5g4 + 35g*3/6 - 3g + 4. Let z(f) = 5f2 - 3f. Calculate 3j(n) + 35z(n). -5n2 Let u be 0 - (44/16 - (-12)/(-16)). Let m be (-2)/3(0 + u - -5). Let x(n) = n3 + n2. Let f(r) = -13r3 - 11r*2. What is mf(z) - 22x(z)? 4z*3 Let j(f) = -691f + 14. Let q(d) = -345d + 6. Calculate -2j(p) + 5q(p). -343p + 2 Let s(c) = 2c - 52. Let l(a) = -1. Calculate 8l(y) + s(y). 2y - 60 Let g(q) = 12q - 6. Let i(s) = 5s - 3. What is 3g(h) - 7i(h)? h + 3 Suppose g = 2w + 6 + 15, 4w = 5g - 27. Let k(m) = -11m3 - 13m*2 - 13m - 13. Let v(q) = 5q3 + 6q*2 + 6q + 6. Determine wv(d) - 6k(d). d*3 Let j(b) = -1 + 2 - b + 0b - 3. Let x(c) = c. Suppose i + 3 = 0, 0 = -5l - i - 11 - 2. Calculate lx(n) - j(n). -n + 2 Let r(m) = -4627 - 9m2 + 4627. Let o(s) = s2. Suppose -3q + 2z = z - 104, 2z = -4q + 122. Give qo(t) + 4r(t). -3t*2 Let q(y) = -y. Suppose -i + 4c = c - 7, -4c = 2i + 6. Let l(g) = -g + 2. What is il(h) - 4q(h)? 3h + 2 Let p be ((-30)/(-6))/(-1 + 0). Let s(v) = -2v - 2 + 8 - 5. Let i(o) be the first derivative of -2o2 + o + 1. Calculate ps(t) + 3i(t). -2t - 2 Let x(c) = c3 - c2 + c. Let h(y) = 4y3 + y2 + y. Let w = 82 - 80. Give wx(o) - h(o). -2o3 - 3o*2 + o Let d(a) = -22a3 - a2. Let c(t) = -23t3 - t2 - t + 1. Give 3c(y) - 4d(y). 19y3 + y2 - 3y + 3 Let f(c) = -5c + 3. Let g(t) be the second derivative of -1/2t2 + 0 + 11t + 1/3t3. What is 2f(m) + 7g(m)? 4m - 1 Let s(b) = b - 1. Let m(u) = 2u + 31. Give m(p) - 4s(p). -2p + 35 Let f(q) = 3q*2 - 5q. Let k(v) = 7v. Let n(x) = x. Let m(h) = -k(h) + 6n(h). Let b = -1499 + 1498. Calculate bf(g) + 5m(g). -3g2 Let x(f) = 5f*2 - f - 2. Let l(g) = -4g*2 + 3g + 6. Let w(q) = -2q2 + 2q + 4. Let d(m) = 3l(m) - 4w(m). Determine -4d(p) - 3x(p). p2 - p - 2 Let h(d) = -d2 - d + 1. Let g(p) = p3 - p2 - 14p - 2. Let o be g(4). Let q(l) = -6l*3 + 8l*2 + 10l - 10. Determine oh(v) - q(v). 6v*3 + 2v*2 Let s(c) = 2c*3 - 4c*2 + 2c. Let n be s(2). Let x(p) = np - 164 + 159 - 2p. Let w(b) = 5 - 2 + 8 - 4b. Calculate 3w(j) + 7x(j). 2j - 2 Let n(i) = -13*i + 34. L	{ "pile_set_name": "DM Mathematics" }
3 - 449c*3 + 56c*3 + (4c*3 - 5c3 - c3)(0 + 0 - 1). -788c3 Expand (-u2 + 0u + 0u)(-2965 + 1416 - u + 1431). u3 + 118u2 Expand 0 - j2 + 0 + (4j - 4j + 4j)(-2 + 2 - j) + 5j2 + 10j*2 + 5j*2. 15j*2 Expand (v - 4v + 5v)(-1 - 1 + 3) + 2233 + v - 2233 + (-2 + 1 - 1)(-v - 3v + 5v). v Expand (x2 - 2x2 - x5 + 5x2)(-3 - 1 - 8). 12x5 - 48x*2 Expand (0b + 10b - b)(-1 - 1 + 0) - 9b + 0b - 4b. -31b Expand -5c4 + 4c*4 + 3c*4 + 0c*4 + 3c*4 - 27c*4 + 2c4 + c4 - 2c4 + (0c + c*2 + 0c)(4c2 - c2 - 2c2) - 2c*4 - 2c4 - c4. -25c4 Expand (2 - 2 - 2p)(-3 + 0 + 4) - 84p - 33p - 24p. -143p Expand -2 + d4 + 2 + (-d4 + 0d*4 + 3d*4)(-2 + 1 + 3) + 4 + d*4 - 4 + (-5d*2 + 18d*3 + 5d*2)(5d - d - d). 60d*4 Expand -4c*3 + 2c*3 + 4c*3 - 4c*3 + 3c3 - c3 - 4c3 + 2c*3 + 0c*3 + (-1 - 3 + 5)(4 - 4 - c*3) + (2 - 2 + 8c*2)(8 - 6c - 8). -51c*3 Expand -30 + 13 + 12z*2 - 72z2 + 17 + (z2 + 0 + 0)(2 + 1 - 2). -59z*2 Expand (6r - 4r - 3r)((-6r + 2r + 2r)(-4 + 5 + 1) + 4r + 0r - r - 4 + 4 + 2r)(4r - 4r + r2). -r4 Expand (q - 1 + 1)(-4q2 - 1891q + 935q + 937q - 1). -4q3 - 19q*2 - q Expand 55 - 55 - 22t*2 + (t + 2t - t)(238 - 238 + 4t) - 5t2 + t2 + 2t*2. -16t*2 Expand (-66a - 71a + 139a + 220)(-2a - a + 2a). -2a*2 - 220a Expand (1 - 1 - 1 + (31 + 8 + 0)(-3 + 4 + 0))(-3 + 1 + 0)(2d + 0 + 0). -152d Expand (3d - 5d + 2 + 4d)(9d*2 - 21d*2 + 4d*2). -16d*3 - 16d*2 Expand (3 - 3 - q)(-3 + 4 + 0)(0 - 4 + 3 + (1 + 0 + 0)(0 - 1 - 8))(1 - 5 + 6). 20q Expand (-14d2 - d + 11d*2 + 390 + 2d*2)(4d3 - d3 - d3). -2d*5 - 2d*4 + 780d*3 Expand (-5 + 2 - 5)(-k + 5 - 5)(-8 - 1 - 2). -88k Expand 3v3 + 3v*3 - 4v3 + (-v2 + 3v2 - 4v*2)(0v + v + v) + 10v*3 - 7 + 7. 8v*3 Expand (1 + 5 + 6)(3p - 1 + 1)(4 + 1 - 4) - 2p + 2p + 5p. 41p Expand (3c4 - 3c*4 - 5c*4)(2c - 2c + c)(4 - 5 - 8). 45c*5 Expand (7z - 4 + 4)(-6 - 6z + 11 - 3)(4z*3 - 3z*3 - 2z*3). 42z*5 - 14z*4 Expand (2 + 2 - 2)(141f2 - 16 - 5f - 143f2 - 91). -4f*2 - 10f - 214 Expand -3s3 + 13 - 13 + 3s*3 - 4s*3 + 3s*3 + (-s - s + 0s)(2s*2 - 4s*2 + 4s*2) + (-4s - s + 3s)(-s2 - s2 - s2). s3 Expand -3 + y*3 + 3 + (3y + 2y - 3y)(6y2 - y2 - 3y2) + 2y3 + y3 - y*3 + (-3y*2 + 6y*2 + 2y*2)(7y - 18y - 2y). -58y*3 Expand (-2860v + 1 - 2 + 2809v)(-2v + 6v + 0v). -204v*2 - 4v Expand (-444w - 335w + 549w)(2 - 4w - 2). 920w*2 Expand (1 + 5 - 3)(3 - 18 - 203l + 204l). 3l - 45 Expand (12k + 9k - 31k)(-6k - 5k + 2k - k*2). 10k*3 + 90k*2 Expand (-9v - 27v - 4v + (6v - 2v - 2v)(0 + 4 - 3))(-v3 + 3v3 - v3)(-5v - v + 5v). 38v5 Expand (-d2 - 1 + 1)(d - d - 2d) + (-2d2 - 4d*2 + 4d*2)(-d + 0d + 3d) - 57d3 + 35d*3 - 66d*3. -90d*3 Expand (0k + 2k - k + 3 - 3 - 2k + (5 + 0 - 3)(-3k + k + k) + 0k + 2k - k + 0k + 0k - k + 2k + 0k - 4k)(0k - k - 16k). 85k2 Expand (5 - 3 - 5)(-975n + 13 + 11n*2 + 975n). -33n2 - 39 Expand (3j - 4j - j)(-j - 40 + 45 + 4j). -6j*2 - 10j Expand 0v + 2v + 0v + (-2 + 2 + v)(3 - 3 - 2) + 2 + 153v - 17 + 15. 153v Expand -2 + 2t + 2 + (-t + 3t + t)(3 - 1 + 0) - 4t + 6t + 0t. 10t Expand (1 - 1 + 3f*2)(2 + 0 - 1) - f*2 - 5f*2 + 2f*2 + (-4f - 5f - 2f)(f - 2f + 4f). -34f*2 Expand (-2 - 2 + 2)(c*4 + 4c*2 - 4c*2) - 506c*4 + 1054c*4 - 873c*4. -327c*4 Expand (-3p*2 - 5 + 5)(-119 + 54p + 119)(-3 + 2 + 0). 162p3 Expand 23h*5 - 33h*5 + 16h*5 - 5h*5 + 0h*5 + 3h*5 + (2h - 7h - 6h)(0h*4 + 2h*4 - 3h*4). 15h*5 Expand (-3 + 0 + 6)(-3 + 3 + 2)(1 + 2 + 0)(-g3 + g3 + 4g3). 72g*3 Expand (-2h - h + 2h)(-3h4 - 112h + 112h) + (0h - 4h + h)(-2 + 2h4 + 2). -3h*5 Expand 5t*2 + 3 + 4t*2 - 4 + 2t2 + 4 - 4 + (t - t2 - t)(0 + 0 + 1) + (t - 2t + 2t)(3t + 2t - 3t). 12t*2 - 1 Expand (3i + 3 - 3)(-4i + 4i + i) - i2 + 3i2 - i2 + 2i + 2i*2 - 2i. 6i2 Expand (56y*3 + 889y - 889y)((-4 + 0 + 3)(-y + y - 4y) + 5y - 3y - 3y)(0y + 3y - 2y). 168y*5 Expand 0t2 + t3 + 0t2 + (3 - 5 + 0)(-3t3 + 3t3 + t3) - 128t3 - 2197 + 2197 - 3 - 2t*3 + 3. -131t*3 Expand (-1 - 3 + 6)(b*5 + 0b5 + b5) + (-150 - 132 + 305)(0b - b + 3b)(-2b4 - 2b*4 + 3b*4). -42b*5 Expand (2f2 + f2 - 2f2)(2f3 + f3 - f3) - 30f + 18f + 8f*5 + 14f. 10f5 + 2f Expand (44u3 + 76u - 76u)(2u2 + u2 + u - 5u*2). -88u*5 + 44u*4 Expand (-2n*2 - 1 + 1)(5 - 3 - 4 + 0 + 3 - 1 + (0 + 3 - 1)(0 - 1 + 2))(n - 2n - 2n + (0 + 0 - 2)(n - n - 3n)). -12n3 Expand (1 - 1 + 1)(o*3 - 3o*3 + 4o*3) + 2035o*3 - 1263o*3 - 1393o*3. -619o*3 Expand (2 - 4 + 4)(-13 + 21 - 11)(2 + 0 + 2c + 4c). -36c - 12 Expand (2h - 3h + 2h + (-h + 2h + h)(-2 + 4 + 0) - 3h + 2h + 2h)(2h + 2h - 2h)(2 + 2h - 2) + 3h3 + h - 2h*3 + 9h*3. 34h*3 + h Expand (3c + 2c - 3c + (-4c - c + 6c)(-2 + 3 - 2) - 2c - 1 + 1 + 4c - c - c - 31 + 31 - 58c - 4 + 2c + 4)(c + 2c - c). -110c*2 Expand 0s + 0s - s + (928095 - 1041s - 928095)(-1 - 2 + 1). 2081s Expand (-1 - 3 + 2)(-18n + 11n - 88n). 190n Expand (2o*3 + 1 - 1)(4 - 2o2 - 4 + (-7 + 0 + 2)(54o - 17o*2 - 54o)). 166o5 Expand ((0 + 3 - 1)(-2 + 2 + 1) + 2 - 1 + 10 - 1 - 1 + 4)(-k3 + 2k*3 - 2k*3). -15k*3 Expand (-3 + 1 - 2)(-15 + r + 8 + 5). -4r + 8 Expand 6r*4 - 6r*4 - 8r*5 + (0r + 0r + r3)(-r*2 - 3r*2 + 2r*2) + 18r*3 - 29r*3 + 13r*3 + 4r*5. -6r*5 + 2r*3 Expand (-5 + 5 - 2y*3 + (-3y3 + y3 + y*3)(4 - 2 - 1) + 0y + 2y*3 + 0y + 492y3 + 304y*3 - 141y*3)(y + y - 3y2 + y2). -1308y*5 + 1308y*4 Expand (-2 - x + 2)(0 - 5 + 2)(28 - 7x - 28). -21x2 Expand -9k*4 - 2k4 + k4 + (0 + 2k4 + 0)(-2 - 2 + 5) + 3k4 + 0k*4 - 2k*4 + 2k*4 + 4 - 4. -5k*4 Expand 156b*3 - 9178b*2 + 9178b2 + (-b2 + 4 - 4)(-b - 2b + 4b). 155b*3 Expand (64 + 404 + 608)(2m - m + m). 2152m Expand (3f - 5f + 3f)(3 - 4 - 1) + (-15 + 12 - 24)(2 + 2f + 0f - 6f). 106f - 54 Expand (-1 + 0 - 1)((8w + w - 4w)(9 + 12 + 2) + 5w - 2w - w). -234w Expand -4d4 - 750d*3 - 6d*5 + 1 - 3d*5 + 748d3 + d5 + 2d - 2d + (-2d4 - 2d*4 + 2d*4)(-4 + 2d + 4). -12d*5 - 4d*4 - 2d*3 + 1 Expand 8p - 9p + 12p - p + p - p + (-4 + 4 - 2)(0p + 3p - 5p) + 0 - 2p + 0 - 5p + 15p - 23p. -p Expand (-2 + 3 - 2)(297 + 159 - 83)(-2 + 5 - 2)(3t + 4t - 6t). -373t Expand 54f*4 + 3f*4 - 199f*4 + (-1 - 2 + 5)(f4 + f4 - 3f4). -144f*4 Expand (-10 + 7 - 63x + 6)(0 + 0 + 3x*2). -189x*3 + 9x*2 Expand (1 - 1 + 5)(180n3 - 180n*3 + 17n*5). 85n5 Expand (-r2 - 1 + 1)(-52r + 7r - 3 + 25r). 20r3 + 3r*2 Expand (3k - 3k + 2k)(-17k - 116k - 4k + 2k). -270k*2 Expand (81 - 81 + 21n)(0 - 2n*3 + 1 + 9n*2 - 5n*2). -42n*4 + 84n*3 + 21n Expand (-o + 6o - o)(4 - 1 - 1) + (-16 + 14 - 17)(-4o + 8o + o). -87o Expand (z - 3z + 6z + 0z - 3z + z + (-2z + 2z + z)(0 + 4 - 2) + 1 + 2z - 1 - z - 1 + 1)(-6 - 5 + 5). -30z Expand ((-n + 4n - 4n)(-3 + 1 + 0) + n - 4n + 2n)(6n4 - 4n4 + n2 + 49n4). 51n5 + n3 Expand (-4a + 1 - 1)(-2a2 + 2a + 0a - 6a) + (0 + 2a2 + 0)(-2a + 2a - a) + 4a3 - 5a*3 + 0a*3. 5a*3 + 16a*2 Expand -3k5 - k5 + k*5 + (48 - 49 + 58)(4 - 4 + k)(-k3 - 3k4 + k3). -174k5 Expand (6s - 2s - 2s)(-3s + 3s + 2s) + (27s - 45s - 14s)(-2s - 2s - s). 164s2 Expand (-2774 - 2495 + 1775 - 1021)(-2p + p2 + 2p). -4515p2 Expand (-6j*2 + 0j*2 + 3j*2)(-5j3 - 2j*3 + 2j*3 + (-2j*2 + 3j*2 + 0j*2)(0j + 4j + 2j) + j3 + j + j3 - j3). -6j*5 - 3j*3 Expand (2r + 0r + 0r + (-2r + r - r)(-3 + 3 - 2) + 2r + 1 - 1 + 1 + r - 1 + 0r - r - 2r - 2r + 1 - 1 - 1 + 2r + 1)(r - r - r*2)(-2r + r - 2r). 18r*4 Expand (	{ "pile_set_name": "DM Mathematics" }
s of 3243? 3, 23, 47 List the prime factors of 362. 2, 181 What are the prime factors of 1771? 7, 11, 23 List the prime factors of 457. 457 List the prime factors of 9153. 3, 113 List the prime factors of 72. 2, 3 List the prime factors of 1454. 2, 727 List the prime factors of 4142. 2, 19, 109 List the prime factors of 44219. 7, 6317 List the prime factors of 4134. 2, 3, 13, 53 List the prime factors of 2530. 2, 5, 11, 23 What are the prime factors of 2127? 3, 709 List the prime factors of 4866. 2, 3, 811 What are the prime factors of 41470? 2, 5, 11, 13, 29 What are the prime factors of 4502? 2, 2251 List the prime factors of 37740. 2, 3, 5, 17, 37 What are the prime factors of 9112? 2, 17, 67 What are the prime factors of 77648? 2, 23, 211 What are the prime factors of 1015? 5, 7, 29 What are the prime factors of 134512? 2, 7, 1201 List the prime factors of 9645. 3, 5, 643 List the prime factors of 2005. 5, 401 What are the prime factors of 9390? 2, 3, 5, 313 What are the prime factors of 31554? 2, 3, 1753 List the prime factors of 3523. 13, 271 What are the prime factors of 9119? 11, 829 List the prime factors of 54335. 5, 10867 List the prime factors of 5281. 5281 List the prime factors of 42203. 7, 6029 List the prime factors of 1546. 2, 773 List the prime factors of 4360. 2, 5, 109 What are the prime factors of 1110? 2, 3, 5, 37 What are the prime factors of 151? 151 List the prime factors of 45462. 2, 3, 7577 What are the prime factors of 100928? 2, 19, 83 What are the prime factors of 41975? 5, 23, 73 What are the prime factors of 1022? 2, 7, 73 What are the prime factors of 7438? 2, 3719 What are the prime factors of 51688? 2, 7, 13, 71 What are the prime factors of 276? 2, 3, 23 List the prime factors of 7059. 3, 13, 181 What are the prime factors of 1362? 2, 3, 227 What are the prime factors of 3096? 2, 3, 43 List the prime factors of 8236. 2, 29, 71 List the prime factors of 2265. 3, 5, 151 What are the prime factors of 136? 2, 17 List the prime factors of 1581. 3, 17, 31 List the prime factors of 24839. 59, 421 What are the prime factors of 3556? 2, 7, 127 List the prime factors of 562. 2, 281 List the prime factors of 10607. 10607 List the prime factors of 41357. 41357 List the prime factors of 11123. 7, 227 List the prime factors of 16046. 2, 71, 113 What are the prime factors of 6667? 59, 113 What are the prime factors of 2232? 2, 3, 31 List the prime factors of 324. 2, 3 List the prime factors of 37520. 2, 5, 7, 67 List the prime factors of 36343. 36343 What are the prime factors of 8271? 3, 919 List the prime factors of 15301. 11, 13, 107 What are the prime factors of 272? 2, 17 List the prime factors of 705. 3, 5, 47 What are the prime factors of 5993? 13, 461 What are the prime factors of 234? 2, 3, 13 What are the prime factors of 10647? 3, 7, 13 List the prime factors of 980. 2, 5, 7 What are the prime factors of 13461? 3, 7, 641 List the prime factors of 8006. 2, 4003 List the prime factors of 117610. 2, 5, 19, 619 What are the prime factors of 60918? 2, 3, 11, 13, 71 What are the prime factors of 76315? 5, 15263 What are the prime factors of 1952? 2, 61 What are the prime factors of 45491? 45491 List the prime factors of 35097. 3, 11699 What are the prime factors of 2090? 2, 5, 11, 19 What are the prime factors of 7582? 2, 17, 223 What are the prime factors of 2809? 53 List the prime factors of 24608. 2, 769 What are the prime factors of 112? 2, 7 List the prime factors of 275. 5, 11 What are the prime factors of 1832? 2, 229 What are the prime factors of 1321? 1321 What are the prime factors of 43? 43 List the prime factors of 26698. 2, 7, 1907 What are the prime factors of 21757? 21757 List the prime factors of 3287. 19, 173 What are the prime factors of 5934? 2, 3, 23, 43 List the prime factors of 13591. 13591 List the prime factors of 6960. 2, 3, 5, 29 List the prime factors of 1670. 2, 5, 167 List the prime factors of 35459. 59, 601 What are the prime factors of 1108? 2, 277 List the prime factors of 133799. 67, 1997 What are the prime factors of 131? 131 What are the prime factors of 22331? 137, 163 List the prime factors of 3343. 3343 What are the prime factors of 28424? 2, 11, 17, 19 List the prime factors of 31475. 5, 1259 What are the prime factors of 90116? 2, 13, 1733 List the prime factors of 377. 13, 29 List the prime factors of 2939. 2939 List the prime factors of 4002. 2, 3, 23, 29 List the prime factors of 1927. 41, 47 List the prime factors of 2724. 2, 3, 227 List the prime factors of 224. 2, 7 What are the prime factors of 7660? 2, 5, 383 List the prime factors of 15896. 2, 1987 What are the prime factors of 5460? 2, 3, 5, 7, 13 List the prime factors of 3868. 2, 967 What are the prime factors of 21123? 3, 2347 List the prime factors of 33700. 2, 5, 337 List the prime factors of 4741. 11, 431 List the prime factors of 2103. 3, 701 What are the prime factors of 69216? 2, 3, 7, 103 What are the prime factors of 2502? 2, 3, 139 What are the prime factors of 2481? 3, 827 What are the prime factors of 14426? 2, 7213 List the prime factors of 560. 2, 5, 7 List the prime factors of 2333. 2333 List the prime factors of 59350. 2, 5, 1187 What are the prime factors of 2846? 2, 1423 What are the prime factors of 24304? 2, 7, 31 What are the prime factors of 33637? 33637 What are the prime factors of 96711? 3, 32237 What are the prime factors of 8003? 53, 151 What are the prime factors of 4158? 2, 3, 7, 11 What are the prime factors of 521? 521 List the prime factors of 367. 367 What are the prime factors of 727? 727 What are the prime factors of 1198? 2, 599 What are the prime factors of 1709? 1709 What are the prime factors of 2454? 2, 3, 409 List the prime factors of 27642. 2, 3, 17, 271 What are the prime factors of 63050? 2, 5, 13, 97 List the prime factors of 770. 2, 5, 7, 11 List the prime factors of 169. 13 What are the prime factors of 248? 2, 31 List the prime factors of 46126. 2, 23063 List the prime factors of 1780. 2, 5, 89 List the prime factors of 1411. 17, 83 What are the prime factors of 5335? 5, 11, 97 What are the prime factors of 23? 23 List the prime factors of 58. 2, 29 List the prime factors of 886. 2, 443 What are the prime factors of 16360? 2, 5, 409 List the prime factors of 6033. 3, 2011 List the prime factors of 17366. 2, 19, 457 List the prime factors of 5188. 2, 1297 List the prime factors of 23944. 2, 41, 73 What are the prime factors of 21529? 21529 List the prime factors of 18473. 7, 13, 29 List the prime factors of 70629. 3, 13, 1811 What are the prime factors of 1072? 2, 67 List the prime factors of 171631. 59, 2909 What are the prime factors of 2122? 2, 1061 List the prime factors of 2476. 2, 619 What are the prime factors of 668? 2, 167 List the prime factors of 1142. 2, 571 What are the prime factors of 6786? 2, 3, 13, 29 List the prime factors of 1683. 3, 11, 17 What are the prime factors of 12797? 67, 191 List the prime factors of 7336. 2, 7, 131 List the prime factors of 459. 3, 17 What are the prime factors of 1899? 3, 211 List the prime factors of 1609. 1609 What are the prime factors of 13123? 11, 1193 What are the prime factors of 909? 3, 101 List the prime factors of 3489. 3, 1163 What are the prime factors of 5597? 29, 193 What are the prime factors of 28424? 2, 11, 17, 19 List the prime factors of 11810. 2, 5, 1181 List the prime factors of 80409. 3, 7, 547 What are the prime factors of 438? 2, 3, 73 What are the prime factors of 694? 2, 347 List the prime factors of 1154. 2, 577 List the prime factors of 50051. 50051 List the prime factors of 3051. 3, 113 List the prime factors of 177639. 3, 7, 11, 769 What are the prime factors of 102? 2, 3, 17 List the prime factors of 3620. 2, 5, 181 List the prime factors of 66. 2, 3, 11 List the prime factors of 26049. 3, 19, 457 What are the prime factors of 9956? 2, 19, 131 What are the prime factors of 122223? 3, 131, 311 What are the prime factors of 5070? 2, 3, 5, 13 List the prime factors of 83457. 3, 11, 281 What are the prime factors of 2218? 2, 1109 List the prime factors of 2263. 31, 73 List the prime factors of 2695. 5, 7, 11 What are the prime factors of 2185? 5, 19, 23 List the prime factors of 1739. 37, 47	{ "pile_set_name": "DM Mathematics" }
8, -7, -1 in increasing order. -7, -1, 3, 4, 198 Put -12, -1, -51, -2 in increasing order. -51, -12, -2, -1 Sort -3/74, 2/7, -15/2, 0.4 in increasing order. -15/2, -3/74, 2/7, 0.4 Put -3, 1, 0.62, -2/9, -2/13 in decreasing order. 1, 0.62, -2/13, -2/9, -3 Put -2, 0, 0.2, 5, -936/5, -20 in decreasing order. 5, 0.2, 0, -2, -20, -936/5 Put -18, -3, -6, -2, 9 in descending order. 9, -2, -3, -6, -18 Sort 23, 5, 1, 4 in increasing order. 1, 4, 5, 23 Put -55, 21, 0.4, 4 in increasing order. -55, 0.4, 4, 21 Put 27, 23, 0, 1 in increasing order. 0, 1, 23, 27 Sort 5, -5, 3692477, 0 in ascending order. -5, 0, 5, 3692477 Put -117, 5, 10, -2, 3, 2 in increasing order. -117, -2, 2, 3, 5, 10 Put 445, -5, -3, -1279 in increasing order. -1279, -5, -3, 445 Put -17, 11, -37, -2 in decreasing order. 11, -2, -17, -37 Sort -3, 4786, 19 in ascending order. -3, 19, 4786 Sort -2, -5, 13, -4, 3 in decreasing order. 13, 3, -2, -4, -5 Put 3/4, -714, 463 in descending order. 463, 3/4, -714 Sort 621, 5, 14, -3 in decreasing order. 621, 14, 5, -3 Put -4, 7, -182, -32 in decreasing order. 7, -4, -32, -182 Sort -334, 1/5, -2, -2/7, -0.2. -334, -2, -2/7, -0.2, 1/5 Put -31/5, -3, 1, 3/542, 6/7 in increasing order. -31/5, -3, 3/542, 6/7, 1 Sort 13, 3/2, -2/5, 1/3, -3/16 in decreasing order. 13, 3/2, 1/3, -3/16, -2/5 Put -4/9, 0, 9, 2/5 in decreasing order. 9, 2/5, 0, -4/9 Sort 2/5, -0.2, 97622 in ascending order. -0.2, 2/5, 97622 Sort -2, -171, 4, 5, -5 in ascending order. -171, -5, -2, 4, 5 Sort -0.03, 4/5, 4326 in ascending order. -0.03, 4/5, 4326 Put 4, 0.5, 18, -0.5, -2/13 in decreasing order. 18, 4, 0.5, -2/13, -0.5 Sort 1, -2, 5, 3, -12934 in descending order. 5, 3, 1, -2, -12934 Sort -5, 5, 17, -11028, -2, 3. -11028, -5, -2, 3, 5, 17 Sort 7, 3, -73, 17/3, 5, -1. -73, -1, 3, 5, 17/3, 7 Put -3, -190, -195, -5, -4 in ascending order. -195, -190, -5, -4, -3 Sort 1/3, 0.3, -11, 6, 10/11 in decreasing order. 6, 10/11, 1/3, 0.3, -11 Put 0.05, -8, -20/3, 3 in ascending order. -8, -20/3, 0.05, 3 Sort -99, 8, 60 in increasing order. -99, 8, 60 Sort -6536, 5, 14 in descending order. 14, 5, -6536 Put -1, -36, 9, 3, 2 in increasing order. -36, -1, 2, 3, 9 Sort 3, -42, -555.7. -555.7, -42, 3 Put 27, 225, -49 in decreasing order. 225, 27, -49 Sort -0.08, 45, 4, -1/3 in increasing order. -1/3, -0.08, 4, 45 Sort -2, -0.5, -5085 in decreasing order. -0.5, -2, -5085 Put 0.047169, 1/4, 1/6, 0.1 in increasing order. 0.047169, 0.1, 1/6, 1/4 Put -1/5, 3, 16/27, -1/2, 0.8, 1 in increasing order. -1/2, -1/5, 16/27, 0.8, 1, 3 Sort -2, 3777, -5, 5, 4, -3 in decreasing order. 3777, 5, 4, -2, -3, -5 Put -4, 1138/3, 5, 21, -2 in decreasing order. 1138/3, 21, 5, -2, -4 Sort -1195, 2, 536 in increasing order. -1195, 2, 536 Put -2/15, -7, -2.18 in ascending order. -7, -2.18, -2/15 Sort -41, -11, -30 in decreasing order. -11, -30, -41 Put 46, 3, 0, -3, 16 in decreasing order. 46, 16, 3, 0, -3 Sort -31, 55/12, -2/17, -1 in descending order. 55/12, -2/17, -1, -31 Put 0, -5, 1, 43, 21, 4 in decreasing order. 43, 21, 4, 1, 0, -5 Sort -133, -4, -1, -46, -5. -133, -46, -5, -4, -1 Put -0.7, -5, -14, -8 in decreasing order. -0.7, -5, -8, -14 Sort -44624, 3, 2, 23 in increasing order. -44624, 2, 3, 23 Put 1, 918, 5, -3, 2 in decreasing order. 918, 5, 2, 1, -3 Sort -11, 0, -70, 3, -1 in descending order. 3, 0, -1, -11, -70 Sort 6215, 5, -1 in decreasing order. 6215, 5, -1 Sort -3, 4, 120, 0.4, -1 in increasing order. -3, -1, 0.4, 4, 120 Put 2520, -20, 0.2 in decreasing order. 2520, 0.2, -20 Sort -0.2, -208/3, 0.03, 5, 0. -208/3, -0.2, 0, 0.03, 5 Sort 3, 976, 0, -1, 804 in decreasing order. 976, 804, 3, 0, -1 Sort -2, -30, -1/12, 2, 0.5, 9. -30, -2, -1/12, 0.5, 2, 9 Sort -14, 0.06, -1, 5, -1/7, 0.29 in ascending order. -14, -1, -1/7, 0.06, 0.29, 5 Sort -66, 46, -3, 0 in decreasing order. 46, 0, -3, -66 Sort -1, -4/333, 1/3. -1, -4/333, 1/3 Sort 0.3, 115, 4/7, 132, 5/2. 0.3, 4/7, 5/2, 115, 132 Sort -29, -157, -6 in decreasing order. -6, -29, -157 Put 303, -5, -9, 4 in ascending order. -9, -5, 4, 303 Put -6, 616, -5, 2 in decreasing order. 616, 2, -5, -6 Sort -1.54, 14, -1/4, -3. -3, -1.54, -1/4, 14 Sort -112, -2, 4, 3, -1, 34 in descending order. 34, 4, 3, -1, -2, -112 Sort -5, 1, 15524, 3, 4 in descending order. 15524, 4, 3, 1, -5 Sort -2808, -1/330, 1/3. -2808, -1/330, 1/3 Put 57, 2, 295, 8 in decreasing order. 295, 57, 8, 2 Sort 2, -15, -44, -3, 5. -44, -15, -3, 2, 5 Put -0.3, 5, -1/4, -1175 in decreasing order. 5, -1/4, -0.3, -1175 Put 21, 1010, -4 in descending order. 1010, 21, -4 Sort -5, -14.6, 2/11, 0.4, -13. -14.6, -13, -5, 2/11, 0.4 Sort 20, 8, 3, -8, -1. -8, -1, 3, 8, 20 Put -5, -0.3, -2/1356805, -0.5 in increasing order. -5, -0.5, -0.3, -2/1356805 Put 2/11, -1/3, -4/251, 6, 3 in ascending order. -1/3, -4/251, 2/11, 3, 6 Sort 8, 5, 3, -5, 6 in decreasing order. 8, 6, 5, 3, -5 Sort -4, 2, 5801, -58, 0 in increasing order. -58, -4, 0, 2, 5801 Sort 159, -0.2, -4, 5, 3, 11 in ascending order. -4, -0.2, 3, 5, 11, 159 Sort 3, 2, 1/13750, -2, -5. -5, -2, 1/13750, 2, 3 Put 279, 14, 3, -97 in descending order. 279, 14, 3, -97 Sort -3, -5, -2, 968 in ascending order. -5, -3, -2, 968 Put -0.06, -5, 111, 87 in ascending order. -5, -0.06, 87, 111 Put 4, -2, 225124 in ascending order. -2, 4, 225124 Put -139, 98, 2 in ascending order. -139, 2, 98 Sort -2, 0, -37, 38 in increasing order. -37, -2, 0, 38 Put -1, -1214, 172, 1/3 in ascending order. -1214, -1, 1/3, 172 Put 5, 4, 2036, 3 in descending order. 2036, 5, 4, 3 Put 3, 3565, 5 in decreasing order. 3565, 5, 3 Put -664, -2/57, -0.1, -0.4 in descending order. -2/57, -0.1, -0.4, -664 Put -3, -206, 2, 5 in descending order. 5, 2, -3, -206 Put -2/11, 3, -6/5, -274, 0.1 in ascending order. -274, -6/5, -2/11, 0.1, 3 Sort -23, -5, 9, 0. -23, -5, 0, 9 Put 3, -6, 4249, 5 in decreasing order. 4249, 5, 3, -6 Sort 18513, -1, 27 in descending order. 18513, 27, -1 Sort -1, 728, -11. -11, -1, 728 Put 14, 2, 38, -4 in ascending order. -4, 2, 14, 38 Put -2, 2, 5, -21297 in descending order. 5, 2, -2, -21297 Put -4882, -4, -3, -62, 4, 5 in ascending order. -4882, -62, -4, -3, 4, 5 Put 10/7, 459/8, 2/7 in decreasing order. 459/8, 10/7, 2/7 Put 2, 17, -208, 0, 5 in ascending order. -208, 0, 2, 5, 17 Sort -1983, 0, -15 in increasing order. -1983, -15, 0 Sort 9, 269, 1 in descending order. 269, 9, 1 Put 2.7, 1.4, -1, 4 in descending order. 4, 2.7, 1.4, -1 Put 4, 17, -47, -35 in ascending order. -47, -35, 4, 17 Put 76, -2, -6, -4 in ascending order. -6, -4, -2, 76 Sort 0, -1371, -5, 5 in decreasing order. 5, 0, -5, -1371 Put -2, 255, -0.2, 4, 0.4, 0 in increasing order. -2, -0.2, 0, 0.4, 4, 255 Sort -7, -24, 3, -2, 0. -24, -7, -2, 0, 3 Sort -0.4, 35, -2/19, 5, 17/20 in ascending order. -0.4, -2/19, 17/20, 5, 35 Put 5, -2, -4, -1, 183 in increasing order. -4, -2, -1, 5, 183 Sort -4, -3, -241/6, 5, -0.2, 3 in decreasing order. 5, 3, -0.2, -3, -4, -241/6 Put 5, 3, 1, -42, -203 in descending order. 5, 3, 1, -42, -203 Put -2, 4, -25.89 in increasing order. -25.89, -2, 4 Put -4714, -49, -1 in descending order. -1, -49, -4714 Sort 733553, -5, -1. -5, -1, 733553 Sort -4, -3, 10872. -4, -3, 10872 Put -201039, 5, -0.1 in decreasing order. 5, -0.1, -201039 Put -0.3, 1/4, 1/11, 9.33 in ascending order. -0.3, 1/11, 1/4, 9.33 Sort 0.09, -0.3, 0, 0.3 in decreasing order. 0.3, 0.09, 0, -0.3 Put -1259, -2, -5, 1, 3, 0 in increasing order. -1259, -5, -2, 0, 1, 3 Sort -901/6, -7, 0.5, -3 in increasing order. -901/6, -7, -3, 0.5 Sort 16, 1309, 4 in decreasing order. 1309, 16, 4 Put 2/5, -1/3, 1, -467, -1 in descending order. 1, 2/5, -1/3, -1, -467 Put 0, -33, -283, 4, 3 in decreasing order. 4, 3, 0, -33, -283 Put -1, 3, 103/2 in ascending order. -1, 3, 103/2 Sort 3, -9, -17, 0, 1 in decreasing order. 3, 1, 0, -9, -17 Put 32, 4, 6, 5, -3, 2 in descending order. 32, 6, 5, 4, 2, -3 Sort 27, -2, 0, 1, 1/6 in decreasing order. 27, 1, 1/6, 0, -2 Sort -554, 7, -8. -554, -8, 7 Sort 3173, 1, -3 in descending order. 3173, 1, -3 Sort 4, 1, 2, -1304, -5, 0 in increasing order. -1304, -5, 0, 1, 2, 4 Sort 2/5, 416, 2/9, 29, 1/4. 2/9, 1/4, 2/5, 29, 416 Put -3, -7, 4, 0 in descending order. 4, 0, -3, -7 Sort -1, -0.032, -8, 47, 1/3, 2. -8, -1, -0.032, 1/3, 2, 47 Sort 2, 0, -17, 4, 2331 in ascending order. -17, 0, 2, 4, 233	{ "pile_set_name": "DM Mathematics" }
placement from fjccfcfffj. What is prob of sequence jfcf? 1/42 Calculate prob of sequence uu when two letters picked without replacement from uuuvuukuvukuuukvuk. 55/153 Two letters picked without replacement from wpawwpaaajaap. What is prob of sequence jw? 1/52 What is prob of sequence ozq when three letters picked without replacement from oqzqq? 1/20 Calculate prob of sequence ggg when three letters picked without replacement from glgglggggggggggl. 143/280 What is prob of sequence kpf when three letters picked without replacement from kynfp? 1/60 Calculate prob of sequence wwu when three letters picked without replacement from {u: 12, w: 6}. 5/68 Four letters picked without replacement from {s: 1, k: 1, q: 12}. Give prob of sequence qksq. 1/182 Two letters picked without replacement from ullueceeup. Give prob of sequence lp. 1/45 Four letters picked without replacement from mmmmm. What is prob of sequence mmmm? 1 Three letters picked without replacement from uwarnrgg. Give prob of sequence nwg. 1/168 Calculate prob of sequence rrrr when four letters picked without replacement from rrgrgrrrrrr. 21/55 Three letters picked without replacement from vbv. What is prob of sequence bvv? 1/3 Four letters picked without replacement from {n: 2, c: 4, b: 6, d: 2, z: 1, p: 3}. What is prob of sequence dbdn? 1/3060 Calculate prob of sequence rrqh when four letters picked without replacement from {b: 4, d: 2, q: 3, h: 2, r: 2}. 1/1430 Three letters picked without replacement from gqigfqleeggqiq. What is prob of sequence glf? 1/546 What is prob of sequence ht when two letters picked without replacement from {t: 10, h: 4}? 20/91 Three letters picked without replacement from {r: 8, k: 3}. What is prob of sequence krk? 8/165 What is prob of sequence mcc when three letters picked without replacement from {c: 7, o: 1, m: 2}? 7/60 What is prob of sequence tt when two letters picked without replacement from ayiatityyyyy? 1/66 What is prob of sequence uuu when three letters picked without replacement from {u: 9}? 1 Three letters picked without replacement from {o: 1, s: 1, g: 7, l: 2, i: 5}. Give prob of sequence iii. 1/56 Four letters picked without replacement from {a: 3, j: 4}. What is prob of sequence aajj? 3/35 Four letters picked without replacement from {n: 3, q: 7, r: 2, f: 7}. What is prob of sequence frqn? 49/15504 Three letters picked without replacement from nnnqqnnq. Give prob of sequence nnn. 5/28 Calculate prob of sequence wmg when three letters picked without replacement from wgmgwwwggywbygg. 1/91 What is prob of sequence pp when two letters picked without replacement from sspsssspsss? 1/55 What is prob of sequence hqhq when four letters picked without replacement from hlchhqvhhccqqhcqjhv? 7/1292 Two letters picked without replacement from {m: 1, q: 1, r: 1, p: 1, f: 1}. Give prob of sequence mf. 1/20 Three letters picked without replacement from zyddty. Give prob of sequence tzd. 1/60 What is prob of sequence hop when three letters picked without replacement from {z: 3, p: 1, e: 2, o: 3, v: 2, h: 1}? 1/440 Calculate prob of sequence kej when three letters picked without replacement from {g: 2, j: 1, e: 7, k: 2}. 7/660 Three letters picked without replacement from aayvayyaayayyyy. What is prob of sequence aya? 8/91 Three letters picked without replacement from foofofoffcfoofcoffo. What is prob of sequence ooo? 56/969 Two letters picked without replacement from iqqffkcfkkfa. What is prob of sequence ki? 1/44 Two letters picked without replacement from {a: 6, p: 8, o: 1, k: 1, g: 2, n: 2}. Give prob of sequence gk. 1/190 Two letters picked without replacement from oerxrxxrrez. What is prob of sequence xx? 3/55 What is prob of sequence pw when two letters picked without replacement from {p: 1, h: 1, w: 1, c: 1, q: 2, m: 2}? 1/56 Two letters picked without replacement from ileiiei. Give prob of sequence li. 2/21 Calculate prob of sequence yi when two letters picked without replacement from {b: 2, y: 2, i: 4}. 1/7 Calculate prob of sequence iia when three letters picked without replacement from {a: 9, i: 3}. 9/220 Two letters picked without replacement from {i: 2, m: 3, e: 5}. What is prob of sequence ee? 2/9 Calculate prob of sequence yxy when three letters picked without replacement from {y: 5, x: 14}. 140/2907 Calculate prob of sequence xx when two letters picked without replacement from {x: 3, p: 1}. 1/2 Calculate prob of sequence xbbb when four letters picked without replacement from {u: 1, b: 14, x: 1, j: 1, g: 2}. 91/3876 Calculate prob of sequence sl when two letters picked without replacement from {p: 1, s: 4, j: 3, l: 2, a: 4}. 4/91 Calculate prob of sequence hmhm when four letters picked without replacement from {g: 13, h: 5, m: 2}. 1/2907 Two letters picked without replacement from hkjjkkgjgjrkjjrkjk. What is prob of sequence gh? 1/153 What is prob of sequence ppp when three letters picked without replacement from hppphhhhphh? 4/165 Calculate prob of sequence cccc when four letters picked without replacement from ccccccc. 1 Calculate prob of sequence yg when two letters picked without replacement from {y: 3, n: 1, g: 1, x: 2, m: 5, s: 3}. 1/70 Three letters picked without replacement from {h: 5, k: 15}. Give prob of sequence hhk. 5/114 Two letters picked without replacement from {q: 7, j: 7, e: 4}. What is prob of sequence ej? 14/153 Calculate prob of sequence ovvl when four letters picked without replacement from {o: 4, v: 11, l: 4}. 55/2907 Three letters picked without replacement from {e: 2, l: 6}. Give prob of sequence lle. 5/28 Calculate prob of sequence qq when two letters picked without replacement from qqqqq. 1 Two letters picked without replacement from {i: 3, y: 5}. What is prob of sequence yi? 15/56 Two letters picked without replacement from yyuyoyyfyooyoypypyy. Give prob of sequence yo. 22/171 Two letters picked without replacement from {c: 1, e: 1, i: 6, j: 11}. Give prob of sequence ii. 5/57 Three letters picked without replacement from {q: 1, o: 1, j: 1, a: 6}. What is prob of sequence joq? 1/504 Calculate prob of sequence ou when two letters picked without replacement from ooufoooso. 1/12 Calculate prob of sequence wo when two letters picked without replacement from {o: 2, v: 6, w: 4}. 2/33 Two letters picked without replacement from rrrrrrrwwrwrwrubrrw. What is prob of sequence rb? 2/57 What is prob of sequence krvu when four letters picked without replacement from {k: 1, u: 1, g: 6, v: 5, h: 3, r: 4}? 1/5814 Two letters picked without replacement from uuuubbuuuub. Give prob of sequence ub. 12/55 What is prob of sequence sfa when three letters picked without replacement from asgaaggggggggfg? 1/910 What is prob of sequence wiiw when four letters picked without replacement from iiwhw? 1/30 Calculate prob of sequence pph when three letters picked without replacement from hcchuhhhcphshphc. 1/210 What is prob of sequence wwjd when four letters picked without replacement from djwwjddd? 1/105 Four letters picked without replacement from zzzzzvzzvzzzzzzvzvz. What is prob of sequence zvvv? 5/1292 Two letters picked without replacement from tozzzzzoooloolotzlt. Give prob of sequence tt. 1/57 Calculate prob of sequence kb when two letters picked without replacement from kklikiilibikkkkkii. 4/153 Four letters picked without replacement from {w: 7, e: 4}. What is prob of sequence weww? 7/66 Four letters picked without replacement from hsxuhhshxhsh. Give prob of sequence usxh. 1/330 What is prob of sequence sppq when four letters picked without replacement from sppspqsppqppppp? 3/182 Four letters picked without replacement from uuuuuuuaugbugg. Give prob of sequence abug. 9/8008 What is prob of sequence pad when three letters picked without replacement from {i: 1, b: 1, l: 1, a: 1, d: 1, p: 2}? 1/105 Four letters picked without replacement from {c: 1, y: 14}. Give prob of sequence yccc. 0 Two letters picked without replacement from hikdhhlhkhkdkhdkb. Give prob of sequence bl. 1/272 Two letters picked without replacement from aaaaaaaaaiaiaaaaaaaa. What is prob of sequence ii? 1/190 Two letters picked without replacement from {k: 3, y: 8, g: 3, f: 1, d: 3}. What is prob of sequence fd? 1/102 Calculate prob of sequence qvqs when four lett	{ "pile_set_name": "DM Mathematics" }
. 2 Let c = 0 - -1. Suppose -2i + 2m = -m - 5, 5i + 5m = 25. Solve 0 = v + c - i for v. 3 Let s(g) = -11g. Let u be s(-2). Suppose 0 = -6m + m - 75. Let h be ((-24)/m)/(4/10). Solve hy = -6 + u for y. 4 Let c(h) = -2h - 11. Let v be c(-8). Solve 0 = -vy + 14 + 6 for y. 4 Suppose -3m + 4m = 3, -r = m - 9. Let g be 74/14 - r/21. Suppose -2a + 3 = a, -gn + 3a + 7 = 0. Solve 2x = -nx for x. 0 Let f = 8 + -3. Suppose -f + 1 = -c. Solve -4k + 0k - c = 0 for k. -1 Let m be 3(-2)/(1 + -7). Let d be (8/12)/(m/6). Let x be 22/(-11)(-14)/d. Solve -18 = 5v + x for v. -5 Suppose -n + 2w = 7w + 7, -15 = -3n + 3w. Suppose no - 24 = -o. Suppose 6 = 3p - o. Solve i + i = -p for i. -2 Suppose -4a = -5k + 25, -4a - 6 = -3k + 9. Solve -m + k = 1 for m. 4 Suppose -5o + 3x = -10, 0 = 2o + x - 7 - 8. Let w be 6/12 + (-14)/(-4). Suppose 2c + 2c - od = 5, 4 = c - wd. Solve c = -q + 7 - 4 for q. 3 Suppose 2p - 2 = 3p + 2t, -5p + 29 = -3t. Solve 4 = pr - 16 for r. 5 Suppose 7v + 10 = 2v, -4b + 20 = 2v. Let w = b - 1. Solve -wz = -5 - 10 for z. 3 Let r = -8 + 9. Solve 0 = -4z - r + 9 for z. 2 Let v(x) = 2x3 + x2 - 6x + 3. Let p be v(2). Solve 2q - 5 + p = 0 for q. -3 Suppose -2 = d - 7. Let u be (1/(-2))/(d/(-60)). Solve 0 = -3h - u - 0 for h. -2 Let q(v) = -18v3 - v2 + 2v - 1. Let c be q(1). Let f be (-58)/(-8) - c/24. Let m be 2 - (-1 + 2)-1. Solve fu = mu for u. 0 Let j = 39 - 35. Solve 3 = -jf - 13 for f. -4 Let y = 17 + -15. Solve -yr = -0r - 2 for r. 1 Let h be 10/30(1 - -8). Suppose -hv + 9 + 0 = 0. Solve -t + 4 = -vt for t. -2 Let j(t) be the second derivative of -t3/6 - 2t*2 - t. Let l be j(-8). Let v be 3(1 - -1l). Solve -2y - v = 3y for y. -3 Suppose 5w + 2 = 12. Solve 3h - 2 = wh for h. 2 Let q(p) = -16p + 1. Let o be q(-2). Suppose 0 = -5z + o - 8. Let j = z + -3. Solve -2n + n = -j for n. 2 Let s be (-9)/(27/(-12)) + -2. Solve -2 = sm - 0 for m. -1 Suppose 0x = -x + 5. Suppose 0 = -4i - t + 44, -2t = -i + 10 + 1. Solve -9 - i = -xv for v. 4 Let n be (1 + -3)/((2 + 0)-1). Solve -n + 2 = -l for l. -1 Let z = -39 - -43. Solve -zo = -o for o. 0 Let a be ((-8)/(-10))/((-6)/(-30)). Solve 3w + a = 10 for w. 2 Let q be -26/(-8)-2. Let o be ((-2)/4)/((-3)/18). Let g = q + o. Solve -3r + gr + 6 = 0 for r. 2 Suppose -3l - 2p = -8, -2p + 6p = 2l. Solve 2x = -lx for x. 0 Let y = 61 + -58. Solve -y = s - 1 for s. -2 Suppose -2f = 2f. Let y be (2 + (f - 2))/1. Let b(k) = 2k3 + 2k - 1. Let x be b(1). Solve 9 = xc - yc for c. 3 Suppose m = 3m - 8. Solve m = o - 1 for o. 5 Suppose 0q - 10 = -2q. Suppose -v - 2o - q = 0, -4o - 18 = v - 3. Let l be (1/2)/((-2)/(-12)). Solve -ld - 2d = v for d. -1 Suppose -18o + 15o = -6. Solve -y = oy + 6 for y. -2 Suppose -7q = -2q - 50. Let y(b) = 2b2 + 4b. Let n be y(-3). Let c = n + -1. Solve -q = ci - 0 for i. -2 Let h(c) = 3c - 16. Let s be h(7). Suppose -2y - 12 = -4l, 4l - 5y - 12 = -0l. Solve -lw - s - 1 = 0 for w. -2 Let c = -4 + 7. Solve cu + 5 = -2u for u. -1 Let a(d) = -d - 5. Let s be a(-8). Suppose -f + 30 = sh + 4f, 5f = 2h + 5. Solve hv - 4v = 0 for v. 0 Suppose u = -4u + 15. Solve -3j - u - 12 = 0 for j. -5 Suppose 0 = 2f - 8 - 8. Let w = 17 - 3. Let z be (-4)/w - (-4)/14. Solve 0v - 4v + f = z for v. 2 Let a = -21 - -23. Let d be (a + -2)/(0 - -2). Solve 5g - 5 = -dg for g. 1 Let d = -16 - -8. Let f(s) = -s + 2. Let j be f(d). Suppose 2t = -3t + j. Solve t = -5v - 13 for v. -3 Let w be 6/(18/15) + -2. Solve -k = wk + 12 for k. -3 Let f = -178 + 338. Suppose -2i - 3i = f. Let p be ((-15)/4)/(6/i). Solve -s - p = 3s for s. -5 Let f(r) = -r*3 - 11r*2 - 11r - 5. Let w be f(-10). Solve 18 - 3 = -wb for b. -3 Let v be 4 - (2 - (-2 - -2)). Suppose vf + 128 = -2f. Let m be f/(-18) - 2/(-9). Solve 3y + my - 15 = 0 for y. 3 Let f(c) = -14c - 2. Let z be f(-1). Solve 0 = 2v + 2v - z for v. 3 Let a be 11/(-11)(-4)/2. Solve p - ap - 1 = 0 for p. -1 Suppose q - 5c + 5 = -1, -5q - 5c = -30. Solve -qg + g = 3 for g. -1 Let i(c) = c*2 + 4c + 6. Let a be i(-3). Solve 2 = -ao + 14 for o. 4 Suppose -5n = -2a + 33, 3n = -4a + 2n + 11. Solve -y = ay for y. 0 Let b = 83 - 81. Solve b = 4h - 6 for h. 2 Suppose -4c - x - 13 = -9c, 5c = 2x + 11. Solve cb = 5b - 6 for b. 3 Suppose 4a - 15 = 1. Solve -ax + 0x - 4 = 0 for x. -1 Let f(h) = h + 3. Let g be (-1)/2 - 15/6. Let s be f(g). Let u = s - 0. Solve uc - 25 = 5c for c. -5 Suppose 2k - 6 = -0k. Suppose 2z = z + 4. Suppose -zr = -r. Solve r = -0d + kd for d. 0 Let i(y) = -3y - 8 - y*2 - y + 2y*2. Suppose 0 = -5x + 11 + 19. Let g be i(x). Solve -11 = -gb - 3 for b. 2 Suppose 0 = 4u + 11 - 15. Solve -u + 6 = 5l for l. 1 Let o = -4 + 10. Let g(c) = -c. Let z be g(o). Let w be (2/2)/(z/(-18)). Solve 0 = ws + 2s + 25 for s. -5 Suppose 0 = -4r - 3u + 5, 3u = -2u - 5. Suppose 0 = -6x + rx. Solve -8 = -xq + 2q for q. -4 Let f be (-5)/((-45)/(-12))-6. Solve -fw + 20 = -4w for w. 5 Suppose -i + 4i - 12 = 0. Solve 3 = im - 1 for m. 1 Let w = -20 - -24. Suppose 3 = 4g - 5z, 4z - 8 - 6 = -5g. Solve wh = gh for h. 0 Let c(g) = 3g + 2. Let y be c(1). Solve 0 = yf + 16 + 4 for f. -4 Let d be (-122)/(-8) + (-24)/(-32). Let a be d/56 + (-4)/14. Suppose 2c + 8 = 6c. Solve a = -cv - v - 9 for v. -3 Let u be (-8)/32 - 82/(-8). Solve 0 = -4z + u - 2 for z. 2 Suppose 3q + 4t = -8, q + 4t - 2t + 6 = 0. Solve i = qi for i. 0 Let l(k) be the third derivative of k4/24 + k3/3 - k2. Let q be l(-2). Solve -7j + 2j = q for j. 0 Suppose 0 = -3a - a - 32. Let k = 8 + a. Let d be (-6 + k)/(-2 - 0). Solve -dr + 2r + 4 = 0 for r. 4 Let p(f) = -5f - 2. Let y be p(-3). Let g = -19 + 27. Suppose -2j = -g + 2. Solve 5i - j + y = 0 for i. -2 Let s(q) = -q + 4. Let o be s(2). Let y = -2 + o. Solve 4n + 16 = -yn for n. -4 Suppose -30 = -0d + 5d. Let r be (-16 - d)/(0 + -2). Let x be 4/(-10) + 2/r. Solve x = -2z - 1 - 1 for z. -1 Suppose 0p - 3p = -9. Let d be (-62)/217 + (-1)/((-14)/172). Solve 0a - pa = d for a. -4 Let o(s) = -s*2 + 10s + 12. Let a be o(11). Let g be a((1 - 3) + 52). Suppose n + 4n = -4t + g, -2n + 4t - 8 = 0. Solve -4f = -n - 10 for f. 4 Let s be (3 + -4)14/2. Let v = -14 - s. Let y = -2 - v. Solve -yz - 8 = -3z for z. -4 Suppose -54 + 57 = q. Solve -q = -2g - g for g. 1 Let i = 66 - 66. Solve 2d + d - 12 = i for d. 4 Let l(j) = 9j*3 + 2j*2 - j. Let p be l(1). Solve p = m + 4m for m. 2 Suppose -2n + 4g + 14 = 0, -4g - 4 - 16 = 0. Let j = n + 6. Solve 6m = jm - 12 for m. -4 Let y(z) = -z3 - 2z*2 - z + 1. Let d be y(-2). Let a = d + 1. Let r = 5 - 1. Solve r = au - 0 for u. 1 Suppose 2d - 8 = -2d. Suppose -2k = 3k - 25. Suppose -s - ds + 4 = -q, s = -kq + 28. Solve -sj = -2j + 4 for j. -4 Suppose -b - 2 = -d - 5b, -d + 2 = 2b. Suppose 0 = -c + dc - 2. Solve -cz + z = 5 for z. -5 Let z = -3 - -4. Solve 2y = -z - 1 for y. -1 Suppose -7y + 52 = -3y. Solve 4g + 5 = y for g. 2 Let g = -13 + 22. Let l(j) = 3j2 - j + 1. Suppose -2 - 2 = -4o. Let z be l(o). Solve 0x = zx + g for x. -3 Let r = 3 - 0. Let x = r - -4. Solve 2i - xi - 5 = 0 for i. -1 Let t = 30 + -15. Suppose -3q + t = -0q. Solve -qg + 2g = 12 for g. -4 Suppose 5v - 2 + 7 = 0. Let p be 1 + (-2 - v) + 0. Suppose -j + 4y + 20 = p, -y = -4j - 0j + 5. Solve 4x + 4 + 0 = j for x. -1 Let t(y) be the first derivative of -y2/2 + y - 1. Let f be t(1). Suppose f = -4r + r + 6. Solve -ru = -0u - 8 for u. 4 Let n = 7 + -5. Let v be (-2 + 8)4/8. Suppose -5x = -25, -4y - x + 15 = 2x. Solve y = va - na - 4 for a. 4 Let j = 28 - 20. Let d(u) = -u + 11. Let b be d(j). Let r = -2 - -4. Solve -ba = ra for a. 0 Suppose -3t - 3f + 7 = -2, f = -3t + 17. Solve 20 = -ts + 2s for s. -4 Let c = 55 - 36. Let g = 27 - c. Let v = -5 + g. Solve -vb - 8 = b for b. -2 Suppose m - 3 = -0. Suppose -mu - 4 = -16. Solve -3y + u = -2y for y. 4 Let n = 15 - 10. Suppose 7 = -3u + 1, 2c - 14 = nu. Solve 5p - c = 4p for p. 2 Let s(y) = y + 4. Let w be s(-2). Solve -w = 2g - 4g for g. 1 Let q(d) = d*2 + 9d - 8. Let h be q(-10). Let u = 4 + -2. Solve u*z	{ "pile_set_name": "DM Mathematics" }
n - zn, -2n - 10 = -2g. Let p be g/((-3)/(-1) - 4). Solve p = -0u + 2u for u. 0 Let a be (-1)/(16/(-120)3/2). Suppose aw - 4 = 11. Solve -w + 1 = q for q. -2 Let h = -11 - -29. Let r be 388/6 + (-12)/h. Let v be r/(-24)(-18)/8. Solve -3d = -0 + v for d. -2 Suppose 2n + 3n = 10. Suppose g - 5 = nd - 0, -5d = 2g - 1. Suppose 0 = 11u - 8u - 45. Solve -u = -2k - gk for k. 3 Suppose 5i = -3c + 24, -4i = 3c - 0c - 21. Suppose -3l = -z - 20, -z - 5 - 5 = -l. Let w be (z - -4 - (-18)/(-2))/(-2). Solve -ws + is = -4 for s. 2 Let a = 400 - 390. Solve -12 = 7q - aq for q. 4 Suppose -3b - 2b = 4q - 115, b + 22 = q. Let i be (q + -15)(-1)/(-2). Solve 0 = 5d + i for d. -1 Suppose 7m - 12m - 12 = -o, -4m = 0. Solve 9k - 5k - o = 0 for k. 3 Let c = -12 + 14. Let t be (-13)/(-4) + 150/(-120). Solve 0 = tu + c + 2 for u. -2 Let f = 1121 + -1106. Solve 0 = -11b + 14b + f for b. -5 Suppose 5a + 5t - 45 = 9t, t = -5. Solve aq - 4q + 5q = 0 for q. 0 Let d be -2615/(-20). Let w = d - 4. Solve -wb - 16 = 9 for b. -5 Let d(f) = -f*2 - 2f + 104. Let p be d(-11). Solve pm + 5 = 10 for m. 1 Let b be ((3 - (0 - 1)) + -3)-19. Let v be 2 - (b/2 - (-1)/2). Solve -2g = 1 - v for g. 5 Let o = -13 - -20. Let d = o + -3. Let p be d/16 + 33/12. Solve -3 = -2g + p for g. 3 Suppose -143 - 117 = -26y. Solve 0g + yg = 0 for g. 0 Let x(t) = t3 + 6t*2 + 5t - 9. Let n be x(-4). Suppose -v - 5 = 5w, 3w + w + v = -4. Let o(l) = -19l3 - l. Let j be o(w). Solve j = -p - np for p. -5 Let v = 756 - 749. Solve -3q - 20 = -vq for q. 5 Suppose 3y - 247 + 220 = 0. Solve 4v + y = -7 for v. -4 Suppose 0 = 3u - n - 18, -4n + 24 = 5u - 6. Let b(x) = -6 - 31x + 49x + 14 - 25x + x*2. Let c be b(u). Solve -4a + 4 = -ca for a. 2 Let o = 3146 - 3141. Let l = 4 - 2. Solve -oy + l = 17 for y. -3 Let r be (-123)/(-164)(-256)/(-6). Solve -7j - j + r = 0 for j. 4 Suppose 3g - 7 = 2. Suppose -34 = -5z + 4b - b, -4z - gb + 11 = 0. Let p(u) = u3 - 6u*2 + 4u + 5. Let j be p(z). Solve -4c - 8 - 4 = j for c. -3 Let t(y) = -y3 - 6y*2 - 6y. Let c be t(-5). Let m(n) = n*2 + 7n - 25. Let v be m(7). Let i = 74 - v. Solve 2o + c = i for o. -2 Suppose -4s + 26 = -5s - 5p, 3s - 12 = 3p. Let r be (3s + (4 - 2))0. Solve 0 = -rg + g + 1 for g. -1 Suppose 7 = o + 5v - 17, v - 2 = 0. Let a be (8/o)/(2/7). Solve 0 = -3m + 5m + a for m. -1 Suppose -29 = -5y - 4. Let l(q) = -q2 + 7q - 5. Let t be l(y). Solve 2i + t + 5 = 0 for i. -5 Let j(k) = -7k3 - k2. Let w be j(-1). Suppose -3p + 22 = -wp - 5z, 4p = 5z + 29. Solve 2x - p = -5 for x. -2 Suppose 4 + 8 = -2q. Let d be 0/((-10)/15q/(-4)). Solve -4v + 4 = -d for v. 1 Let h(x) = -3x*3 + 4x + 1. Let g be h(-3). Suppose -2a = -6a - 4l + 64, 5a = 5l + g. Solve 4d = d - a for d. -5 Let y = -13 - -24. Let d = -7 + y. Suppose p = dp. Solve p = 3h - 9 - 6 for h. 5 Suppose 352w = 334w + 54. Solve -wh = 42 - 33 for h. -3 Let u = 901 - 893. Solve -ut = -10t - 2 for t. -1 Let h be (-15)/(-5) + 1/(-1). Suppose -8u + 48 = -hu. Solve -10v - u = -6v for v. -2 Let k(w) = 3w - 69. Let d be k(22). Let c = d - -5. Solve c = -4n - 6 for n. -2 Suppose 37v - 40 = 33v. Solve -12r - 10 = -vr for r. -5 Let l = -3 + 3. Suppose d - 18 = -0r - 2r, -r - 2d + 6 = l. Let x = -10 + r. Solve 0 = -5i - 5 - x for i. -1 Suppose -14r = -5r - 27. Suppose 8 = rd + 2. Solve -dw - 20 = 3w for w. -4 Let c = 115 + -111. Solve f = cf + 6 for f. -2 Let h be ((-10)/85)/(-1) - (-166)/34. Suppose 0 = -5y + 2i + 2i - 6, -hi = -3y - 14. Solve -2m = ym + 4 for m. -1 Suppose -4h + 69 = 5j, 4h = 6h + 3j - 37. Solve -24m + hm = -65 for m. 5 Let g = -359 + 362. Solve -4 = go - 13 for o. 3 Let t = -84 + 80. Let b be 0/(-1 + 2) - t. Solve -g - bg - 15 = 0 for g. -3 Suppose 5q = -2z + 40, -2z = 3q + z - 33. Let w be -4 - -5 - q/(-2). Solve 8 = -wx + 16 for x. 2 Let n(m) = 3m2 + 7m + 6. Let k(w) = 5w2 + 14w + 11. Let p(a) = 4k(a) - 7n(a). Let y be 10/(-5) - (-27)/3. Let i be p(y). Solve -ig + 0g = 10 for g. -5 Let z = -2 + 3. Suppose -h - 2h = 4y - z, h + 3 = 2y. Let k(u) = 61u + 124. Let v be k(-2). Solve y = -vj - 1 for j. -1 Let f(j) = -j3 - 15j*2 - j - 8. Let n be f(-15). Solve -n = -5m + 18 for m. 5 Let i be ((-1)/1)/(-1 + (-7)/(-8)). Suppose 3r + 14 = 5a, 2r - 2a + 0a = -4. Let t be 2/(-11) + (-276)/(-66). Solve -i + t = rs for s. -2 Let k be (15/4)/(-10 + (-11479)/(-1144)). Solve -85 = -5b - k for b. -5 Let g(y) = -3y*2 - 2y - 1. Let k be g(-1). Let x be ((-21)/28)/(k/8). Solve a - 2a = x for a. -3 Suppose z = 279 - 276. Solve -zr = -19r + 32 for r. 2 Let x = -71 + 73. Suppose 5d + 5 = -5f - 10, -6 = 3f + xd. Solve -w + 3w + 8 = f for w. -4 Let o(v) = v*3 + 7v*2 + 2v + 15. Let l be o(-7). Let k be ((1 - l) + -5)(-2)/5. Solve -8 = -ks - 0s for s. 4 Let c(x) = -6x - 1. Suppose 20 = -2v - 2v + 4j, 3j = 2v + 14. Let f be c(v). Solve -fn + 2 = 17 for n. -3 Let d = -9 + 10. Let s(h) = 3 + 48h - 49h - d. Let a be s(-3). Solve -ax - 13 - 2 = 0 for x. -3 Suppose 2x - 21 = w + 2w, w + 14 = 3x. Suppose -2o + 3o = xh - 11, -4h = -3o - 18. Solve 0 = hs + 2 - 5 for s. 1 Let j be (-212)/(-265) - -212/10. Suppose 0 = -5x - jc + 10, -39 = -0x - 2x + 5c. Solve -2v = x - 1 for v. -3 Suppose 0 = 6t + 69 - 69. Solve -p + tp = 0 for p. 0 Suppose z - 1 = -u, u + 14 = 3u - 4z. Solve -4x + ux = 0 for x. 0 Let d(k) = k3 + 12k*2 + 35k + 165. Let r be d(-10). Solve -y - 19 = -r for y. -4 Let s(t) = -18t3 - 2t*2 + 3t + 4. Let j be s(-1). Solve 15 = -l + j for l. 2 Let r(m) be the third derivative of m5/60 - m4/3 + 2m3 + 3m*2. Let q be r(6). Let z = 39 - 24. Solve 3i + z = -qi for i. -5 Let t = -25 - 39. Let v = t - -65. Solve 4 + v = s for s. 5 Let g be ((-4)/(-10))/((-4)/(-160)). Let i(b) = b3 - 5b*2 - 4b - 2. Let d be i(6). Suppose -3m + d = 5j, 3 - 1 = j - 3m. Solve -6k = -jk - g for k. 4 Suppose 4t + 174 = 5o - 63, o - t = 48. Let w be (30/(-25))/((-2)/o). Let u be (-1)/(-3) + (-9)/w. Solve uv + v - 2 = 0 for v. 2 Let p(g) = -g - 5. Let k be p(-3). Let b be ((-3)/k)/((-2)/4). Let o be 4/(2/(-1) - b). Solve ow = w - 3 for w. -1 Let z be 3 + 2 + -4 + 1. Let a = 1 + z. Suppose -3v - 3f - 11 = -5v, -3f - 9 = 0. Solve 4 - v = am for m. 1 Suppose 436v - 423v - 26 = 0. Solve v = 7i - 5 for i. 1 Suppose 5m + f + 18 = 0, 3m - 1 = 4f + 2. Let h(y) = -2y3 - 2y*2 + 4y + 4. Let w be h(m). Let l = w - 22. Solve 9 = 3c - l for c. 5 Suppose -2r + 4r = h + 10, 4h = 4r - 24. Suppose rc - 5 = -c. Let m be 209/55 + 2/303. Solve -mb = c + 19 for b. -5 Suppose -h - 10 = 3t - 4t, 0 = -4t + 3h + 40. Solve m - t = -12 for m. -2 Suppose -127 = -6m - 73. Solve -m = -2k - 19 for k. -5 Suppose -7 = -4z + 17. Let u(k) = 3k - 92. Let a be u(32). Solve 2w - aw = -z for w. 3 Let f = 15 + -11. Suppose fs = -0s. Solve 0 = 5t - st for t. 0 Let l(q) = -7q - 64. Let b be l(-12). Let o(y) = -y2 + 21y - 18. Let x be o(b). Solve 0c = -xc for c. 0 Let s = 273 + -256. Solve 9o = so + 8 for o. -1 Let s = 60 - 57. Suppose -5b + 30 = 3p, -s = -3p + 2b + 2b. Solve -2o = 1 + p for o. -3 Suppose 0 = 5k - 2 - 23. Let c be -2 - (k/(-5) + -1). Solve c = -h - 2h for h. 0 Let a(s) = -s - 4. Let o be a(-9). Let k = o - 3. Let j be 3 + -3 - -3 - k. Solve -q + 2 - j = 0 for q. 1 Let f = 23 - 10. Suppose f = 3w + 79. Let j = -20 - w. Solve c + j = -c for c. -1 Let x(q) = -q - 6. Let t be x(-7). Suppose -20 = -0c + c. Let g = 22 + c. Solve t = gv + 3 for v. -1 Let n = 1233 + -1210. Solve -na + 27a + 12 = 0 for a. -3 Let h(t) be the third derivative of t6/120 + 13t*5/60 - 13t*4/24 + 17t3/6 - t2. Let r be h(-14). Solve ry - y = 8 for y. 4 Suppose -15p - 76 = -16p. Let r = 80 - p. Solve 3u = -r - 5 for u. -3 Let a(r) = -42r - 249. Let n be a(-6). Solve -3j - n = -3 for j. 0 Let s(m) = 2m2 + 2m - 4. Let x be s(3). Let d be -3 + (8/5)/(4/x). Solve -4j + d = j for j. 1 Let c = -6 - -6. Suppose c = -3j + 5j - 2h - 26, j + h - 15 = 0. Suppose -3i + j = 4u - 2i, -u = -i - 6. Solve 0v = -v + u for v. 4 Let q = 1249 - 1216. Solve -q*	{ "pile_set_name": "DM Mathematics" }
614? -24585 What is next in -1016, -1022, -1030, -1040, -1052, -1066, -1082? -1100 What is the next term in -2, -33, -78, -131, -186? -237 What comes next: 162, 336, 510, 684? 858 What is the next term in -321, -1282, -2883, -5124, -8005? -11526 What is next in 0, 15, 40, 75, 120? 175 What comes next: -244, -516, -788? -1060 What is next in -3, -4, 1, 18, 53, 112? 201 What is the next term in -10, -11, -4, 17, 58, 125? 224 What is the next term in 322, 2503, 8418, 19933, 38914, 67227? 106738 What is the next term in 4, 23, 56, 103, 164, 239? 328 What comes next: 1088, 1112, 1138, 1166, 1196, 1228, 1262? 1298 What is next in 32, 169, 544, 1277, 2488, 4297, 6824? 10189 What comes next: -36, -141, -316, -561, -876, -1261, -1716? -2241 What comes next: -282, -564, -846? -1128 What is the next term in -7, -5, -5, -7, -11, -17, -25? -35 What comes next: -51, -65, -79, -93, -107, -121? -135 What is next in 293, 298, 299, 296? 289 What is the next term in -33, -86, -167, -270, -389, -518? -651 What is next in -507, -1015, -1521, -2025, -2527, -3027? -3525 What comes next: 16, 33, 40, 31, 0, -59, -152? -285 What comes next: 257, 263, 271, 281, 293, 307? 323 What is next in -59, -123, -201, -299, -423, -579, -773? -1011 What is next in -125, -130, -135, -140, -145? -150 What is next in -125, -53, 67, 235, 451? 715 What is next in -39, -75, -111, -147, -183? -219 What is the next term in 8, 7, 2, -7, -20, -37? -58 What comes next: -139, -159, -191, -235, -291, -359, -439? -531 What is next in 9, 30, 57, 90, 129, 174? 225 What is next in 1359, 2725, 4091? 5457 What is next in -1, 6, 13, 20, 27, 34? 41 What is the next term in -39, -91, -181, -327, -547, -859, -1281? -1831 What comes next: 71, 60, 49? 38 What comes next: -1202, -1200, -1198, -1196, -1194? -1192 What comes next: -57, -89, -103, -99, -77, -37? 21 What comes next: 41, 81, 121? 161 What is the next term in -217, -216, -241, -304, -417, -592? -841 What is next in 33, 54, 79, 108, 141? 178 What is next in 5206, 5207, 5208? 5209 What is next in -18, -43, -68? -93 What is the next term in -1080, -1094, -1110, -1122, -1124? -1110 What comes next: -64, -57, -44, -25, 0? 31 What is the next term in 3432, 3420, 3396, 3354, 3288, 3192? 3060 What is the next term in 0, 14, 42, 90, 164? 270 What comes next: -364, -401, -462, -547, -656? -789 What comes next: 14, -16, -104, -280, -574? -1016 What is next in -223, -439, -653, -865, -1075, -1283, -1489? -1693 What is next in -33, -10, 51, 168, 359, 642, 1035? 1556 What is the next term in -185, -189, -193, -197, -201? -205 What is next in -116, -112, -106, -98? -88 What is next in -540, -2144, -4824, -8586, -13436, -19380, -26424? -34574 What comes next: 55, 89, 121, 151? 179 What is next in -90, -182, -262, -324, -362, -370, -342, -272? -154 What is next in 121, 914, 3063, 7246, 14141, 24426, 38779? 57878 What comes next: -338, -683, -1046, -1433, -1850, -2303, -2798, -3341? -3938 What is the next term in -298, -561, -822, -1081, -1338? -1593 What is the next term in 2997, 2999, 3011, 3039, 3089, 3167, 3279, 3431? 3629 What comes next: 19, -2, -25, -50, -77, -106? -137 What is the next term in 21, 50, 81, 114, 149, 186? 225 What is the next term in 8870, 17738, 26606, 35474? 44342 What is the next term in 19, 34, 49, 64? 79 What comes next: 43, 39, 29, 13? -9 What is next in -73, -159, -243, -325? -405 What comes next: 1889, 1891, 1893, 1895, 1897, 1899? 1901 What is next in 1, -6, -17, -32? -51 What comes next: 88, 350, 786, 1396, 2180? 3138 What is next in -8, -9, -10, -11? -12 What is next in -17, -52, -91, -134, -181, -232, -287? -346 What is next in -2342, -2344, -2346, -2348, -2350? -2352 What is next in -8, -33, -76, -137, -216, -313? -428 What is next in -38, -97, -196, -335? -514 What is the next term in -89, -108, -129, -152, -177, -204? -233 What comes next: 51, 186, 407, 714, 1107? 1586 What is the next term in -179, -359, -539, -719, -899? -1079 What comes next: -14, -41, -86, -149, -230, -329, -446? -581 What is the next term in 2309, 2310, 2311, 2312, 2313? 2314 What is the next term in 146, 577, 1292, 2291? 3574 What is next in 189, 393, 597, 801? 1005 What comes next: 212, 230, 254, 278, 296, 302, 290? 254 What is next in -95, -200, -309, -422, -539? -660 What comes next: -204, -205, -206, -207, -208? -209 What is the next term in -90, -67, -46, -27? -10 What is next in 51, 99, 147, 195, 243, 291? 339 What is the next term in -27, -74, -203, -456, -875? -1502 What is next in 49, 177, 389, 685, 1065, 1529, 2077? 2709 What comes next: 23, 29, 19, -7? -49 What is next in 1103, 1104, 1107, 1112? 1119 What is the next term in 15, 73, 221, 501, 955, 1625? 2553 What is next in -14, -33, -54, -77, -102, -129? -158 What comes next: 36, 94, 174, 276, 400, 546? 714 What comes next: 21, 13, -5, -39, -95? -179 What comes next: 1, -4, -25, -74, -163, -304, -509, -790? -1159 What is next in -5, -17, -39, -71, -113, -165? -227 What is the next term in 9, 20, 29, 36, 41? 44 What is the next term in 40, 159, 356, 631, 984, 1415, 1924? 2511 What is the next term in -10, -1, 22, 65, 134, 235, 374, 557? 790 What is the next term in 1934, 1938, 1942, 1946? 1950 What is next in -2637, -2636, -2635? -2634 What comes next: -747, -1490, -2233, -2976? -3719 What comes next: 2719, 2725, 2733, 2743, 2755, 2769? 2785 What is next in -1, 113, 309, 593, 971, 1449, 2033? 2729 What is next in -471, -469, -467, -465, -463? -461 What is next in -47, -85, -121, -155, -187, -217? -245 What is the next term in -183, -327, -471, -615, -759, -903? -1047 What is the next term in 45, 80, 119, 162, 209, 260? 315 What comes next: 14, 5, -16, -55, -118, -211, -340, -511? -730 What is next in 4, 35, 116, 271, 524? 899 What is the next term in -11, -19, -37, -71, -127, -211, -329? -487 What is next in -8, 16, 78, 196, 388? 672 What is next in 8, 17, 50, 119, 236? 413 What is next in 3687, 3686, 3683, 3678, 3671, 3662, 3651? 3638 What is next in 27, 13, -11, -45, -89? -143 What is next in -905, -1806, -2707, -3608, -4509, -5410? -6311 What is the next term in 42, 60, 78? 96 What is next in -32, -28, 22, 142, 356, 688? 1162 What is the next term in -41, -42, -41, -38, -33? -26 What comes next: 15, 10, 5, 0? -5 What is next in 105, 114, 137, 180, 249? 350 What is the next term in -90, -298, -642, -1122? -1738 What comes next: 178, 345, 498, 631, 738, 813, 850, 843? 786 What comes next: -12, -6, 22, 84, 192, 358? 594 What is the next term in 1654, 3306, 4958, 6610, 8262, 9914? 11566 What comes next: -80, -162, -248, -338, -432, -530, -632? -738 What is the next term in -71, -57, -31, 13, 81, 179? 313 What comes next: 6146, 12291, 18436? 24581 What is next in -374, -754, -1134, -1514, -1894, -2274? -2654 What is the next term in 57, 235, 547, 1005, 1621, 2407, 3375, 4537? 5905 What comes next: 387, 774, 1161, 1548? 1935 What comes next: 27, 117, 261, 453, 687, 957, 1257? 1581 What is next in -48, -52, -56, -60? -64 What comes next: 35, -2, -63, -148, -257, -390? -547 What comes next: -12, -23, -38, -57? -80 What is the next term in -451, -452, -453, -454, -455, -456? -457 What is the next term in 81, 157, 229, 297, 361? 421 What is the next term in -35, -75, -117, -161? -207 What is the next term in 9777, 19556, 29335, 39114? 48893 What is next in 410, 824, 1244, 1670, 2102, 2540? 2984 What is next in 58, 228, 512, 910, 1422, 2048, 2788? 3642 What is next in 4, 5, 8, 13, 20, 29? 40 What is the next term in 55, 34, -3, -56, -125, -210? -311 What comes next: 22, 28, 44, 76, 130, 212? 328 What is the next term in 25, 90, 203, 370, 597? 890 What is next in -3286, -6561, -9836, -13111? -16386 What is the next term in -92, -365, -822, -1463, -2288, -3297, -4490? -5867 What is the next term in 359, 351, 343? 335 What is next in 80, 159, 238, 317, 396, 475? 554 What is next in 78, 695, 2370, 5631, 11006, 19023, 30210? 45095 What is the next term in 877, 1750, 2619, 3484, 4345, 5202? 6055 What is the next term in -28, -42, -54, -64, -72, -78, -82? -84 What is the next term in 3339, 3340, 3341, 3342, 3343, 3344? 3345 What is next in 31, -14, -91, -200, -341, -514? -719 What is the next term in 74, 63, 40, -1, -66? -161 What is next in 21, 42, 63? 84 What comes next: 7, 11, 15, 19? 23 What is the	{ "pile_set_name": "DM Mathematics" }
ulate m. -2/195, 1 Let y(q) = -q*2 + 10q + 4. Let w be y(0). Solve 1/5f3 - 1/5f - 1/5f2 + 0 + 1/5fw = 0. -1, 0, 1 Let x(q) = -q3 + 8q2 + 2q - 12. Let l be x(8). Determine s, given that -6s2 + 0s - s*l - 3s*5 + s + 2s + 7s4 = 0. -1, 0, 1 Let b(g) be the first derivative of g6/39 - 4g*5/65 - 90. Factor b(i). 2i*4(i - 2)/13 Let u be (2/5)/(-4 + (-205)/(-50)). Suppose 0 = -k - u + 7. Determine q so that 9/2qk - 3/2q*2 - 3/2q*5 + 3/2q*4 - 3q + 0 = 0. -1, 0, 1, 2 Let r(y) be the first derivative of y*6/6 - 2y*5/5 - 54. What is o in r(o) = 0? 0, 2 Let j(i) be the second derivative of 0 - 2/5i*6 + 33i + 15/4i4 + 6i*2 - 10i*3 + 3/4i5. What is s in j(s) = 0? -2, 1/4, 1, 2 Let f(s) be the first derivative of s4/24 + 10s - 6. Let i(j) be the first derivative of f(j). Find a such that i(a) = 0. 0 Solve 4/3k*3 + 1/3k*4 + 20/3k - 7/3 - 6k2 = 0 for k. -7, 1 Let g(u) = -u3 + 3u*2 + 2u - 2. Suppose -5 = 2l - 11. Let k be g(l). Factor 6r*2 + 6r - 3r - 3 - 3r*3 + 1 - k. -3(r - 2)(r - 1)(r + 1) Suppose -j = -13 + 8, 0 = f - 4j + 20. Solve 5/3m*3 + 0m - 2/3m2 + f + 7/3m*4 = 0. -1, 0, 2/7 Let w(j) be the second derivative of 5j - 1/72j4 + 1/9j*3 - 1/2j*2 + 1/360j*6 - 1/90j*5 + 0. Let l(p) be the first derivative of w(p). Factor l(f). (f - 2)(f - 1)(f + 1)/3 Suppose 12f + 51f + 9 - 8f*3 + 7 + 33f*2 - 9f + 3f3 = 0. What is f? -1, -2/5, 8 Let i(a) be the second derivative of -a7/98 + 3a*6/70 - 3a*5/140 - 3a4/28 + a3/7 + 2a - 20. Find f, given that i(f) = 0. -1, 0, 1, 2 Let j be 0 - 0/(0 - 3). Let k be j/1 - (-6 + 3). Factor 6n*3 + 9n*3 + 7n2 - n2 - kn5 - 6n*3. -3n*2(n - 2)(n + 1)2 Determine f so that 0f*3 - 12 - 28f*2 - 8f - 2f3 + 40 + 10f = 0. -14, -1, 1 Let k(g) be the first derivative of 20g + 5/4g*4 + 45/2g*2 + 16 + 10g*3. Factor k(j). 5(j + 1)*2(j + 4) Suppose 21 = 3b + 7h - 11h, 2b + 4h + 6 = 0. Determine i, given that 3i + 3/5ib - 12/5i*2 - 6/5 = 0. 1, 2 Suppose n + 21 = -y + 8, 5n = -5. Let d be 5 - ((-5)/3)/(10/y). Suppose -8/11p2 + 2/11p*d - 2/11p + 0 + 8/11p4 = 0. What is p? -1, -1/4, 0, 1 Let d = 1478 + -1474. Let w(x) be the second derivative of -7x + 2x3 + 0 + 2/15x*6 - 3/5x*5 + 1/3x*4 - dx*2. Factor w(y). 4(y - 2)(y - 1)2(y + 1) Let p = -110 + 100. Let f(h) = 4h2 + 12h - 10. Let z(w) = 1. Let r(u) = pz(u) - f(u). Factor r(d). -4d(d + 3) Let f(o) be the third derivative of o5/90 + o4/36 - 2o*3/9 + 71o*2. Factor f(i). 2(i - 1)(i + 2)/3 Let d = 10 - 10. Suppose 2i + 3c - 9 = 0, 3i - 5c + 0 + 15 = d. Let -r2 + 6 + 4r - 9 + i = 0. What is r? 1, 3 Suppose -7j = -8j + 58. Factor 24y + 8y + 5y4 + jy - 16y2 + 121y*2 + 40y*3. 5y(y + 2)(y + 3)*2 Let s(h) be the second derivative of 1/2h*2 - 1/12h*4 + 0 - 2h + 0h3. Determine w, given that s(w) = 0. -1, 1 Suppose -88a + 71a = 0. Let k(z) be the second derivative of -7/120z*6 - 9/80z*5 - 1/84z*7 + 0z*2 - 1/24z*3 + a - 5/48z*4 + 6z. Factor k(s). -s(s + 1)3(2s + 1)/4 Factor 3654h + 3654h + 3h*2 - 18 - 7311h. 3(h - 3)(h + 2) Find c such that 22c3 - 94c*3 - 28c*4 + 12 - 8139c - 48c2 + 8147c = 0. -1, 3/7 Let l be -2 + (1 - -2) + -9 + 106/13. Solve li2 + 6/13i + 0 = 0 for i. -3, 0 Let l(x) = 17x2 - 28x + 9. Let t(k) = -2k2 + 1. Let z(i) = l(i) + 3t(i). Find a such that z(a) = 0. 6/11, 2 Let r(j) = -3j5 + 36j*4 + 42j*3 - 36j*2 - 21j + 18. Let k(l) = 2l4 + l3 - l2. Let a(q) = 18k(q) - r(q). Solve a(u) = 0 for u. -3, -1, 1, 2 Let q = -110 + 110. Let b(n) be the second derivative of 2n - 1/3n*2 + 0 + qn*3 + 1/18n*4. Factor b(k). 2(k - 1)(k + 1)/3 What is w in -10/9w*2 - 2/3 + 2/9w*3 + 14/9w = 0? 1, 3 Determine u, given that 36u + 5u*2 - 23u - 203u + 61 - 61 = 0. 0, 38 Let g(k) = -k4 - 45k*3 + 176k*2 + 117k - 103. Let w(p) = p*4 + 2p3 + p2 + p + 1. Let t(i) = g(i) + 3w(i). Factor t(v). (v - 10)2(v + 1)(2v - 1) Let b(t) be the first derivative of 11 - 5/2t6 - 15/2t*2 + 20/3t*3 - 2t*5 + 15/2t*4 - 10t. Determine n so that b(n) = 0. -1, -2/3, 1 Suppose y = -2y - 6. Let w = 2 - y. Factor -2n*3 + 2n - 5n + n5 + wn. n(n - 1)2(n + 1)*2 Let m = -111 - -114. Let c(r) = -4r + 12. Let s be c(m). Factor 0x2 + sx - 1/3x3 + 0 - 2/3x*4 - 1/3x5. -x3(x + 1)2/3 Let h(m) = m2 + 4m - 10. Let t be h(-6). Let x(j) be the first derivative of 5 + j*t + 3j*4 + 0j - 11/3j3. Find d, given that x(d) = 0. 0, 1/4, 2/3 Let j = -5 + -14. Let v = j + 21. Factor 8/11r*2 + vr - 6/11. 2(r + 3)(4r - 1)/11 Let g(v) be the second derivative of -v6/15 - v5/5 - v4/6 + 3v + 62. Factor g(b). -2b2(b + 1)*2 Suppose 245 = 2h + 2j + 129, -5h + 5j = -220. What is r in 45/2r*3 + 0r + 63/2r5 + hr*4 + 0 + 3r2 = 0? -1, -1/3, -2/7, 0 Let i(c) be the second derivative of -c6/150 - 4c5/25 + c4/60 + 8c*3/15 + 69c + 1. Factor i(x). -x(x - 1)(x + 1)(x + 16)/5 Determine a, given that -1225/4 + 35/2a - 1/4a2 = 0. 35 Suppose 0v - 20 = -2r - 4v, 0 = -3v + 9. Suppose 1 = -q + r. Factor 4l - l*4 + 2l*2 + 12 - 12 - 4lq - l4. -2l(l - 1)(l + 1)(l + 2) Let r be 7/(-1) + ((-4)/10)/(224/(-5320)). Determine h, given that -rh2 - 5/2h + 0 = 0. -1, 0 Let x(a) be the first derivative of -a*4 - 232a*3 - 20184a*2 - 780448a + 185. Factor x(r). -4(r + 58)3 Factor 49836m*2 + 227925m*2 - 31358m*2 + 18598m*2 + 118644m*2 + 5540m + 20. 5(277m + 2)*2 Let h be 1/15((-2 - (-2 - -3)) + 9). Factor -6/5f2 + 6/5f + 2/5f3 - h. 2(f - 1)*3/5 Suppose -2x*2 + 1/10x*3 + 0 + 15/2x = 0. What is x? 0, 5, 15 Let g be 7/3 + (-6)/(-9). Suppose -3 = 17h - 18h. Solve ht3 + gt*4 - 5t*3 - 4t*3 + 3t2 = 0 for t. 0, 1 Let o(c) be the third derivative of -c6/80 - c*5/40 + 3c*4/8 - 35c*2 - 2c. Determine y so that o(y) = 0. -3, 0, 2 Let o(c) be the first derivative of -3/10c5 + 2c*3 - 3/8c*4 + 3c*2 + 4 + 0c. Factor o(q). -3q(q - 2)(q + 1)(q + 2)/2 Find r such that 2 - 12/7r - 2/7r*2 = 0. -7, 1 Let h = 71 - 51. Let -4 - 15a + 0 - ha2 + 9 = 0. What is a? -1, 1/4 Let b(x) be the first derivative of -x4/24 - 7x*3/18 - 5x*2/4 - 3x/2 - 3. Find a such that b(a) = 0. -3, -1 Let x = -4106 + 4108. Let 20/3f + 2/3f*x + 50/3 = 0. What is f? -5 Determine j, given that 1/5j*3 - 9j*2 + 483/5j + 529/5 = 0. -1, 23 Suppose 5g - 2a - 3a = 40, 4g - 12 = -a. Let -114u2 - 11u*3 - 14u*g + 4 - 7u*3 + 124u*2 + 18u = 0. Calculate u. -1, -2/7, 1 Let c be -2 + 44/(-4)2. Let x = c + 33. What is m in 16 - 44m*2 + 37m*4 - 8m*5 - xm*4 - 4m*5 + 12m3 = 0? -1, -2/3, 1, 2 Let v(o) be the first derivative of -o6/9 + 6o5/5 - 13o*4/6 - 2o*3 + 14o*2/3 - 118. Let v(l) = 0. What is l? -1, 0, 1, 2, 7 Let x be 3/((4 + -1)/6). Factor j - 3j*2 + xj - j. -3j(j - 2) Let o(h) be the first derivative of -8h + 3/100h*5 + 3/10h*3 - 1/5h*4 + 1 + 0h*2. Let v(i) be the first derivative of o(i). Factor v(u). 3u(u - 3)(u - 1)/5 Let w(i) be the second derivative of -i*7/14 + 7i*6/10 - 9i*5/20 - 23i*4/4 + 16i*3 - 18i*2 + i - 54. Find b such that w(b) = 0. -2, 1, 6 Let v(o) = -o - 7. Let f be v(-11). Determine q, given that 7q*f - 3q*4 - 5q3 + q3 = 0. 0, 1 Let w(t) be the second derivative of -t7/168 - t6/30 + t*5/10 + 7t*4/24 - 7t*3/24 - 5t*2/4 + 119t. Solve w(z) = 0. -5, -1, 1, 2 Let f(r) = 2r3 + 4r*2 - 6r. Let u be (18-1)/((-6)/8). Let v be (-16)/(-2)(-18)/u. Let y(z) = z*2 - z. Let o(p) = vy(p) + f(p). Factor o(a). 2a2(a - 1) Let 1/2p5 - 2p*3 + 3/2p + 5/3p4 + 2/3 - 7/3p2 = 0. Calculate p. -4, -1, -1/3, 1 Let p(z) be the third derivative of z9/13608 - z8/7560 + z3/2 + 8z2. Let r(u) be the first derivative of p(u). Suppose r(g) = 0. Calculate g. 0, 1 Let i = 26 + -16. Suppose 4f - i = -r + 3f, -2r - 5f + 5 = 0. Factor 2x*3 + 26x - rx - 13x. 2x(x - 1)(x + 1) Let l be ((-4)/11)/(242/(-1331)). Factor -1/2q*l + 7/2 - 3q. -(q - 1)(q + 7)/2 Let z(l) = l4 + 5l3 + l2 - 1. Let n(	{ "pile_set_name": "DM Mathematics" }
(1 + -1)/(-11)? 1/26 What is (-11010)/1835 - ((-342)/45 + (0 - (6 + -3)))? 23/5 Evaluate ((-4332)/11913)/((-8)/286). 13 What is (166/10)/(-5 + 6) - 1264/790? 15 Calculate (-3720)/9920(-12)/9. 1/2 What is the value of 196/(-10) + (144 - (-110504)/(-760))? -21 24402/2988 - 60/(-45) 19/2 What is -1116/264(3/(-2))/(28/(-168))? -6 Evaluate (-36)/(-144)-20 + 33. 28 What is the value of 28 - 100/(2550/51)? 26 What is the value of 122/(-915)(4 - 95/20)/((-42)/(-140))? 1/3 Evaluate -13166/(-9711) + 4/63. 2/7 Calculate (18/(-10) + ((-1429)/(-30) - 47))42. -7 -8 + -34 + -25524(-1)/612 -5/17 Calculate 3((-16)/(-21) - (24 - (-2805)/(-119))/1). 1 Calculate 7 + (28/(-12))/(-7)(-148 + 125). -2/3 What is 1422/(-162) + (23(-80)/(-8280) - (-79)/9)? 2/9 Calculate -922 - -945 - (5 - -2)1. 16 Evaluate 1120/5040 + (8/(-108))/(10/786). -28/5 What is (-102)/(-2)(-978 + 1005 + (-28 - 0/(-2)))? -51 (-179)/(-8) + -11159 + 11134 -21/8 (41446/(-1173))/((-78)/(-9) + -8) -53 What is 26((17850/72)/(-85) - -3 - (-62)/(-24))? -65 Calculate (2/4)/((-8055)/310 - -26). 31 What is the value of (-15 - -67)/(-13 - -15)? 26 Calculate -226(-7)/(-84)182/(-6). 113 What is 210/(-504) + 44/(-6) + 7? -3/4 What is 2/2 + 6-47(-45)/(-270)? -46 Calculate (-8)/20-34(-3392)/4352. -53/5 Evaluate (((-57)/(-38))/(7 + -5))/(48/(-832)). -13 (553/56 - 10)(-1 - (12 + -14)) -1/8 What is the value of (-19500)/9100 - 76/7? -13 Calculate (-2)/20 + ((-11879)/(-3220) - (-13 - 2158/(-130))). -1/92 What is ((-8)/(-360))/(-11(-25)/1650 - (0 - -4))? -2/345 What is the value of 2/(96/4032-483)? -4/23 What is 30/(-885) - 262436/(-280368)? 10/33 What is ((-17)/((-1275)/(-216)) - -3)(-395)/2133? -1/45 Evaluate (0 - 2/(-24))(19000/(-8500))/(2/34). -19/6 What is the value of 5/488/935 - (-27921)/(-6273)? -13/3 Calculate -36 - 5 - (1 - (-25)/5 - -2). -49 Calculate -156/(-99) - ((-262056)/7656 - -35). 4/29 Calculate 13 + -7 + 10 + ((-473119)/798)/37. -1/42 Evaluate (-2 - 91/(-182)) + (-1 - 234/(-100)). -4/25 What is the value of (21/6)/(-13 + 262/20)? 35 -8(-32)/(-192)1(-3)/(-36) -1/9 What is (-9)/192(-42 + 46) - (-1)/4? 1/16 What is the value of 145/25 - 262926/46170? 2/19 Evaluate (-168)/360(12/(-10))/(12068/2155). 1/10 Evaluate 642085/(-4570) + 15/6. -138 What is -1052/4((-4)/(-45) + (-29248)/32904)? 42 Evaluate ((-21)/336 - (-1131)/48)(-63 + 61). -47 (-4)/((32536/3822)/83) -39 What is 490/(-41) - (-534)/(-10947) - (24/4 - 2)? -16 What is (5292/(-432))/(18/72)? -49 What is (-16704)/(-440) + 47/((-36190)/(-28))? 38 What is the value of (13/7)/((6210/(-378))/115)? -13 -48 + (-27 - (-54656)/728) 1/13 Calculate 1950/60010/138/3701. 2/37 What is the value of 47 + 35226/(-360) + 51? 3/20 Evaluate 10157295/236560 - 2/(-32). 43 Calculate 68 - 2944/46 - -3. 7 What is (-2034)/(-452) - (2 - -2)? 1/2 What is the value of 85/(-10)(-736)/(-3128) - -53? 51 What is the value of (-155)/465 - ((-10)/6 + 2616/(-36))? 74 What is (-2)/133 + (-1457528)/(-563521)? 18/7 What is (3/(-4 + 2 + (-98)/(-14)))/24? 1/40 Evaluate 22/8 + 1 + (-1885)/(-52) + 2. 42 Calculate 396/(-46 - -24)(-2)/((7 - 2) + -1). 9 What is 6955/117 + 1 + ((-14)/63)/(4/8)? 60 What is 63/((-6)/(-2)) - (4286 + -4264)? -1 Evaluate 36/10 - -64671/(-13490). 1/5 Calculate (-71)/(-624) - (-70 - (-169271)/2416). 2/39 Calculate ((10 - 11) + 1)/(-23). 0 Evaluate (13917/129892)/(6/(-644)). -23/2 Evaluate (2 - (-3)/(-2) - 15/60)(-5168)/(-272). 19/4 What is ((-18)/513-76)/((-4)/(-18)) - 12? 0 What is (-203 - 493)9/216? -29 (-405)/(-360)8/(-72)-3 3/8 ((-2)/(8/(-5)))/(61/(1686528/720)) 48 What is the value of ((-3904)/(-800))/(-48 + (-1201)/(-25))? 122 Calculate (-9 + 385/33)/((-316)/348 - -1). 29 Calculate 134/(-29078)-62(-15)/(-8)8. 30/7 What is ((-21)/982/7)/(350/525)? -41 Evaluate (-265151/(-168063))/((-10)/24). -4/7 Calculate (3 + 1/((-7)/28))(21 + -21 + 31). -31 What is the value of (-96)/(-360) + (-1105)/(-75) - (-591)/(-39)? -2/13 Evaluate 345/(-49) - ((-1740)/250 - (-4)/(-100)). -2/49 Evaluate 13 + (-7 - 2(-21)/7)-15. 28 What is (20/28 - 273/147)(-756)/24? 36 Evaluate (1818/45)/(28 - (-3864)/(-140)). 101 48/342((48 - -17) + -62) 8/19 What is (-230)/15(56/(-16)272/119 + 11)? -46 What is the value of ((-91)/1171/(-28))/(12/8)? 1/54 Calculate (12/42)/(18/1617-7). -11/3 Evaluate ((-1403)/(-305))/(-23) + (381/(-195) - -2). -2/13 What is (-8580)/(-66)(160/5)/(-32)? -130 Evaluate (114/(-2))/(18/(-48)4). 38 What is (-955)/(-573) - (2919/9)/(-7)? 48 Evaluate -760 - -722 - (-4 + (-2956)/87). -2/87 What is the value of 882055/12056 - (-3)/((-3)/64)? -49 What is ((-2)/(-3))/(-1)(2257/(-46) - (3000 - 3049))? 1/23 Calculate 4953/11437/13. 7/3 Calculate -77 + 6825/300 + -30 + 7/(-4). -86 Evaluate 4/76209/(-1111). -1/101 What is the value of ((29 - 7922/136) + 30)/((-18)/(-208))? 26/3 What is the value of (2 - -5)/(74/(-6734)49)? -13 Evaluate 5235/(-141)(1 + (-58)/10). 40 What is the value of (-64926)/4248 - 9150/(-600)? -2/59 What is (-15925)/(-910)((-2688)/49)/(-8)? 120 What is (-117)/169235560/1359? -120 -219340/(-1020) - 43 43 Evaluate -85206/8755(-46 + 1 + 0). 90 120/160 - (18/12 - 18) 69/4 (-6)/20 + 199/(-4179)(-364)/(-120) -4/9 What is (-3)/(1 + 2 - 2067/1060)? -20/7 Calculate ((-12)/(-14))/(111/(-126 - -89)). -2/7 What is the value of -78 + 86 + -21 + 857/66? -1/66 Calculate (-292)/44 + -5 + (-216)/594. -12 What is 2/1025 - 9261/1863? 2/69 ((-42)/(-756))/((-60)/(-14040)) 13 Calculate 354380/(-13630) - (-1 + (-46)/10). -102/5 Evaluate (550/105 - 5)(169/65 - 3). -2/21 36876/(-658) + 1184/27824 -56 What is the value of -13 - -9 - 14/(-4)184/138? 2/3 34020/675 + (-61 - -11) 2/5 76/1632-15 + (1239/168)/(-59) -14/17 (-182)/819 + (-51)/(-108) 1/4 (((-729)/(-162))/(((-63)/20)/(-3)))/(3275/27510) 36 Calculate (-135)/(-7) + (-1 - -2) + (-1086)/3801. 20 Calculate 14902/(-514119) - (-6214)/138. 45 Evaluate ((-51)/2788)/((-999)/(-2664)). -2/41 What is the value of (((-114)/171)/((-4)/(-9)))/((-77)/42)? 9/11 Evaluate (-26)/56910/44915. -4/5 What is the value of (-35 + (-4755)/(-135))2/(-2)? -2/9 What is ((-10)/3 - 1989/(-459))(756/(-30) - -19)? -31/5 Calculate (1 - 1) + -13 + (-9 + 65 - 50). -7 What is the value of 93688/1176 + (-28 - 55)? -10/3 -46 + 172050/3750 + (-2803)/(-25) 112 What is the value of -1 - 3 - (323/(-60) + (-688)/(-516))? 1/20 What is the value of 31/((-3348)/(-24)) - (-40)/(-1080)(-606)/(-38)? -7/19 What is (-37260)/134136(1131/1095 + -1)? -2/219 What is ((-24)/60)/(8/32 - (493/4)/17)? 2/35 What is 15816/180 - ((-16)/30 + (-12)/(-30))? 88 (-2541)/(-33 + 12) - (36 - 5) 90 Calculate (216664/4360363)/(0 - (-2)/(-14)). -8/23 Evaluate 18 + 1038198/(-6251) + 148. -4/47 ((-1758)/45 - (-882)/(-6615)) + 23 -81/5 What is the value of -155/15 - -8424/(-48)? -47 Evaluate ((-4)/(-62) - 4136/682)15/(495/187). -34 (219 - 225 - (14 + -2))/((-3)/4) - 4 20 3/(-15) + -7 + 888/40 - (-4972)/(-332) 2/83 -25 - (2626/(-9 - 17) + 14) 62 What is the value of (5/(-9))/((-259)/2331)2/(-10)? -1 Evaluate (-14106)/(-159868)24/18. 2/51 What is the value of (-636)/48 - (-1764)/(-1008)? -15 Calculate (12 + 80/(-10))161/1932. 1/3 What is the value of (-43407)/(-504) + -79 - (-1 + 9)? -7/8 Evaluate ((-29302)/(-7980))/13 - (-192)/(-608). -1/30 Evaluate (-122 - (-2280)/20)/((-4)/(-21)). -42 What is the value of (13/(-5) - -5)((-196)/16 - (-16)/1)? 9 Calculate -25 + (-5220)/(-210) - (-1068)/(-21). -51 What is the value of (-8)/368((-27)/(-36))/((-12)/(-64))? -2/23 Evaluate -2 - (63/(3213/34))/(5/((-750)/2)). 48 What is the value of (-384)/(172032/5440) + (1 + 11)(-1)/(-1)? -1/7 Calculate ((-21)/(-24))/((-1519)/4557). -21/8 Calculate (96/30)/((-4(-15)/300)/(91/14)). 104 Calculate (-1 + 26/44)/((-501)/(-175 + 342))-4. -6/11 Evaluate 11025/(-1015) + (-60)/435. -11 What is (-364)/28 - (490/15)/(4565/(-1815))? -1/83 Calculate (-34)/(-238)512/(-150). -2/35 What is the value of (3 + 0 - 0) + (-35625)/12350? 3/26 Evaluate ((6/(-9))/(26/39))/(-17 + (-363)/(-22)). 2 Evaluate (-84513)/(-2955) + 24/(-15). 27 Evaluate 1/((27 - 2622/92)/((-15)/(-26))). -5/13 Evaluate (-90)/(512 - -28) - (-58)/60. 4/5 What is the value of (528/(-19360)-110)/(2 + (-323)/(-2))? 2/109 Calculate 270/50 + (-513)/(-57) + -14. 2/5 What is 2/(-68)*(175	{ "pile_set_name": "DM Mathematics" }
What is the tens digit of z? 1 Suppose -40 + 31 = 3h, 4c = -5h + 489. What is the tens digit of c? 2 Suppose 2d - 10 = -3d. Suppose -3j + 139 = -2t, 2j - t = -dj + 187. What is the units digit of j? 7 Suppose k = -2m + 58, -m = 5k - 193 - 97. Let r = k + 12. What is the tens digit of r? 7 Let d(w) = -w2 - 7w + 4. Let x be d(-7). Suppose 3z - xz = -47. What is the units digit of z? 7 Suppose -3f + 1589 = 5q, 3q = -4f - 0q + 2115. What is the hundreds digit of f? 5 Suppose -j - 7p + 2p + 51 = 0, -2j - p = -75. Suppose -5v - j = -231. What is the units digit of v? 9 Let o = -6233 - -11691. What is the units digit of o? 8 Suppose 3o - 3z = z - 41, 4o = -5z - 65. Let s(i) = -2i - 17. Let t be s(o). Let b = 59 - t. What is the units digit of b? 6 Let h = -287 - -515. Suppose -472 = -7z + h. What is the hundreds digit of z? 1 Let s be (-3)/((-12)/8)-1. Let y be (-8 - -9)/((-1)/s). Suppose yi + 150 = 7i - 5l, -3i + 4l + 87 = 0. What is the tens digit of i? 3 Suppose t + 42 = -5t. Let g = t + -20. What is the tens digit of 5 + -4 - g/3? 1 Suppose -7t + 14 = -5a - 3t, -t = -2a - 5. Let b be ((-20)/(-2))/((-1)/a). Suppose -4f + 4 = -b. What is the units digit of f? 6 Suppose 2d = -2 - 4, 4 = -2p + 2d. Let h be 1/p - (-105)/25. Suppose -5j = hy - 107, -4y - y = 10. What is the tens digit of j? 2 Let o be 15426/117 + (-2)/(-13). Let r = -86 + o. What is the units digit of r? 6 Let o = 96 + -83. Let f(z) be the third derivative of -z4/24 + 9z*3/2 + 4z*2. What is the tens digit of f(o)? 1 Suppose 5r = 2w - 3245, 0w + 3r = -2w + 3237. Suppose 17a - 23a = -w. What is the tens digit of a? 7 Let y(m) = 2m2 + 5m - 12. What is the units digit of y(3)? 1 Let v be (0 - 1) + (-400)/20. Let d = v + 24. Suppose -dg + 14 = -37. What is the units digit of g? 7 Let t(y) = -15y + 25. Let f(u) = u*2 - u - 1. Let c be (-1)/1 + (6 - 4). Let l(n) = ct(n) + f(n). What is the tens digit of l(16)? 2 Suppose 3666 = -12x + 13x + t, 4t + 20 = 0. What is the units digit of x? 1 Suppose -2y - 236 + 246 = 0. Suppose -yc + 4c = -294. What is the units digit of c? 4 Suppose 3m - 25 = -2x, -5m = 3x - 7x - 5. What is the units digit of x? 5 Let b(y) = -y2 - 18y + 7. Suppose 4w + i + 3i + 72 = 0, i = 5w + 66. What is the units digit of b(w)? 3 Let v = -284 + 92. Let d = v - -319. What is the hundreds digit of d? 1 Let t(i) = 34i + 10. Let s be t(1). Suppose -so + 39o + 1565 = 0. What is the tens digit of o? 1 Let n be (-4)/16 - (-1)/4. Suppose n = -0j + 5j. What is the units digit of 9/3 + 32 - j? 5 Let c be 3/((-7)/4 + 1). Suppose 2m = -4 - 4. What is the tens digit of ((-46)/c)/((-2)/m)? 2 Suppose -6 = -3m + 21. Let l(p) = p*3 - 8p*2 - 9p + 3. Let g be l(m). What is the tens digit of 0 + g + (32 - -2)? 3 Let z(g) = g + 6. Let p be z(-4). Suppose -5l + 3x + 171 = 0, -3l + 4l = 4x + 24. Suppose -w + pw = l. What is the tens digit of w? 3 Let u = -32 + 37. Suppose 5j + ug = 10, 0 = 2j - 4g + g - 24. What is the units digit of j? 6 What is the tens digit of (-70 - 2)/((-69)/92)? 9 Suppose -9 = -2j - 1. Suppose g - 30 = -5c, 0 = -0g + jg - 3c - 28. What is the tens digit of ((-738)/45)/((-4)/g)? 4 Let r be (-1)/(-4) - 21/4. Suppose -w = -5w - 2b + 22, 5w - 4b = 21. What is the units digit of 0 + r/(w/(-18))? 8 Let f(k) = 135k*2 - 11k - 18. What is the hundreds digit of f(-2)? 5 Let t = 17 - 18. Let n(r) = 3r2 + r + 7. Let d(p) = p2 - 1. Let l(k) = tn(k) + 4d(k). What is the units digit of l(8)? 5 Suppose 11 = 4h - 1. Suppose 2b + hs = 426, -4s + 9 + 7 = 0. Suppose 5u - b = 73. What is the units digit of u? 6 Let i be (1 + -1)/(-10 + 9). Suppose i = -5q + q + 8. What is the tens digit of ((-1)/q)/(7/(-308))? 2 Let g(t) = -t2 - 14t - 11. Let a be g(-13). Suppose -291 = -4q + 3x, aq = 3q - 3x - 75. What is the tens digit of q? 7 Let p(u) = -2u + 1 + 2 - u - 9. What is the units digit of p(-8)? 8 Suppose 31j - 2j = 84274. What is the thousands digit of j? 2 Let k = -131 + 888. What is the units digit of k? 7 Let j be 4 + -1 + 1 - -7. Let t = j - -1. Suppose 10x = tx - 106. What is the tens digit of x? 5 Let x(n) = 1106n2 - n. What is the thousands digit of x(1)? 1 Let j(b) be the first derivative of -b3/3 - 11b*2 - 36b - 5. What is the tens digit of j(-12)? 8 Let s(i) = 32i2 - 24i - 17. What is the thousands digit of s(-11)? 4 Let s be -2(-2)/(8/(-10)). What is the units digit of 7/(-2)(s + 1)? 4 Let q = -2 + 7. Suppose -20 = 3b - g + 5g, q = -g. Suppose -2p + p + 10 = b. What is the tens digit of p? 1 Let c(n) = 93n*3 - 5n*2 + 7n + 7. What is the units digit of c(2)? 5 Let d = 164 + -107. What is the units digit of d? 7 Let x(d) = 7d + 42. Let o be x(-6). Suppose o = -5c + 1186 - 346. What is the units digit of c? 8 Let d(j) be the third derivative of j5/120 + j4/12 + 5j3/6 + 9j2. Let m(h) be the first derivative of d(h). What is the units digit of m(8)? 0 Let p(o) = o2 + 8o - 15. Let r be p(-12). Let y(m) = 15 + 25 - r - 14m. What is the tens digit of y(-4)? 6 Let u be ((-4)/(-8))/((-2)/(-936)). Let n be u/124/6. Let o = -5 + n. What is the units digit of o? 8 Let g(y) = 162y - 812. What is the tens digit of g(9)? 4 Let l = -14 - -18. Suppose -2f = -lw + 6, -5f = -0w - 2w - 17. Let i(d) = d3 - 5d*2 + 5d + 2. What is the units digit of i(w)? 6 Suppose 0 = 9w - 12w - 12. What is the tens digit of w1/(-1) - -50? 5 Let t be -4 + 1 - 297/(-3 - -6). Let w = -82 - t. What is the tens digit of w? 2 Suppose -14r - 898 = -26182. What is the units digit of r? 6 Suppose 3t + q = 16, 0 = -2t - 4q - 0q + 14. Let l(n) be the second derivative of -n5/20 + n4/2 - n3/6 + n2 - n. What is the units digit of l(t)? 2 Suppose 2t + t - 421 = 5a, 4t + 442 = -5a. Let v = 183 + a. What is the units digit of v? 7 Let b(p) = -102p - 238. What is the hundreds digit of b(-22)? 0 Suppose 4r - 294 - 11 = -w, 0 = -3r - 5w + 233. Suppose z + r = -3z. Let i = -2 - z. What is the tens digit of i? 1 Let d be (-4 - -7)/(8/5 + -1). Suppose 8a - 2145 = -da. What is the units digit of a? 5 Let c(n) = -3n - 9. Let a be c(12). Let f = 81 + a. What is the tens digit of (0 - 3)/((-6)/f)? 1 Let q be 1/(-2)(2 + -5 - -177). Let m = -46 - q. What is the tens digit of m? 4 Suppose -92 = 3t + n, 5n + 150 = -3t - 2t. Let f = -17 + 32. Let u = f - t. What is the units digit of u? 6 Let c(k) = 8k + 36. Let q(y) = -7y - 36. Let x(f) = -3c(f) - 2q(f). What is the units digit of x(-8)? 4 Let i = 27 - 24. What is the units digit of 75/((-9)/(-2) - i)? 0 Suppose 13260 = 12c + 3c. What is the hundreds digit of c? 8 What is the hundreds digit of 833 + (138/(-27) - (-33)/297)? 8 Let x(k) be the second derivative of k4/12 + k3 + k2 - 13k. Let f = -2 + -5. What is the units digit of x(f)? 9 Let y(a) = 2a2 + a + 28. Let x = 42 + -42. What is the units digit of y(x)? 8 Suppose -2z - 3x = z - 48, -x = -4. Suppose -c + 4f - 5 = 0, -4f + 3 = -3c + z. What is the units digit of c? 7 Let v = 21 + -22. What is the units digit of -3 + v - 10/(-2)? 1 Let u = -1843 + 2896. What is the thousands digit of u? 1 Suppose 0 = -6u + 18u - 48. Let r = -24 + 36. Let q = r - u. What is the units digit of q? 8 Suppose 0 = q - 3. Let z(h) = 4h - h + 2h - q - 3h. What is the units digit of z(5)? 7 Let w = -3 - -29. Suppose 2l = -2t + 20, -2t + w = l + 2l. What is the units digit of l? 6 Let v(h) = -h3 - 12h*2 - 7h. Let y be v(-13). Suppose 6n - 2n - y = 0. Let x = -39 + n. What is the units digit of x? 6 Suppose 4k + 7 = -3q + 3k, q + 3k = 3. What is the tens digit of (-1)/(-2) + (-514)/(-4) - q? 3 Let t(o) = -3o - 20. Let i be t(-8). Let v(n) = n - 8. Let c be v(i). Let l(w) = -w3 - 2w - 8. What is the tens digit of l(c)? 6 Let k be (2 + -1)/(6/732). Suppose k - 346 = -2o + s, 0 = -5o + 3s + 558. What is the tens digit of o? 1 Let d(n) = 2n + 12. Let b(m) = -25m - 155. Let f(c) = -3b(c) - 40d(c). Suppose -r + 5o - 15 = 0, -3r + o = -r + 21. What is the tens digit of f(r)? 3 Let b(a) = a2 - 5a. Suppose -3t - q + 21 = q, 2t - 5*q + 5 = 0. Let s be b(t). Suppose d - 1 = -s. What is the units digit	{ "pile_set_name": "DM Mathematics" }
j - 20 = -3t. Which is greater: s or t? t Let g be (-8)/(-6)(-30)/(-4). Let s be (-3 - 33/(-2)) + (-15)/30. Let t = s - g. Are t and -3 unequal? True Let w be (-56)/(-120) + 4/(-30). Let l = 0.156 - 0.066. Is w equal to l? False Let s = -2.15 - 0.25. Let g = 2.362 + 0.038. Let i = s + g. Which is smaller: i or -0.3? -0.3 Let q(i) = i*3 + 4i*2 - 7i - 5. Let t be q(-5). Suppose td + u + 12 = 0, -2 = 2u + 2. Let s = 28 - 20. Which is bigger: s or d? s Let c(k) = -34k - 86. Let d be c(-3). Let b = -37 - -54. Which is smaller: b or d? d Let g = -1.6 + 1.71. Let c = 0.11 - g. Is 5/3 at most as big as c? False Let i = 1649 + -1048. Which is smaller: i or 602? i Let d = -475 - -410. Is d > -65? False Let o(c) = -c2 - 27c + 88. Let s be o(-31). Is s greater than or equal to -32? False Suppose -5l - 4o + 394 = 0, -5l = 5o - 3o - 402. Suppose s - 3k = 93, -2s - 3k - 33 = -183. Which is smaller: s or l? s Let b(u) = u*2 - u. Let f be b(3). Suppose 2y - 6 = f. Let t be (32/(-6))/(34/(-34)). Which is smaller: y or t? t Let d = 1166 + -1166.0436. Is d at most as big as -0.1? False Let g(h) = h*2 + 9h - 22. Let q be g(-10). Let l be -12(0/(-2) + 1). Let p = l - q. Which is greater: p or -2/11? p Let l = 1/10644 - 397379/31932. Is -11 not equal to l? True Let j(h) = 4h + 36. Let l be j(0). Is l at most as big as 34? False Let w = 2684 + -3019. Which is greater: -0.2 or w? -0.2 Let q = -29.35 - 8.65. Which is smaller: 0.11 or q? q Let q(n) = n*2 + 11n - 12. Let r(m) = -m*2 - 12m + 13. Let f(a) = 7q(a) + 6r(a). Let g be f(-6). Let u be (28/(-11))/(-1) + -2. Is u less than g? False Let b be 4/(14568/44136 + 1/(-3)). Which is smaller: b or -1225? b Let x(u) = u*3 + 3u*2 - u - 3. Let g be x(-3). Let j = -619 + 10527/17. Which is smaller: g or j? g Let p be 0/((2/1)/2). Which is smaller: p or -8? -8 Let h be (-32)/(-14) - 11(-8)/(-308). Suppose -hj - 14 = -4u, 3 = -5j + 2j. Which is smaller: 5/2 or u? 5/2 Let d(i) be the third derivative of -i*5/60 - 5i4/12 - i3/2 - i*2. Let l be d(-10). Let c be 2/(-12) - (-115)/(-30). Is c >= l? False Let f(k) = -8k3 - k2 + k - 2. Let d be f(-2). Let p be 32/(-3) + d/(-42). Let h be p - -8 - 6/(-2). Are h and -3/7 nonequal? True Let o = -6.7 + -0.3. Let n = 6 + o. Suppose 45 = -5d + 5a, -4a = 3d + d + 20. Do d and n have the same value? False Let i(q) = -16q2 + 91q - 61. Let n(p) = -3p2 + 18p - 12. Let j(c) = -2i(c) + 11n(c). Let w be j(15). Suppose 3 + w = 4d. Is d equal to 1? False Let b(x) = -x2 + 7x - 12. Let f be b(6). Let a = -11 - f. Suppose 4v + 3 = -17. Is a < v? False Let c = 10/139 + -579/6116. Which is smaller: c or 2/7? c Let k = 365 - 365. Is k < -4/343? False Let m = 1.99 + 0.01. Are -1/8 and m equal? False Suppose 768 = 15m - 7m. Let k = 95 - m. Is k less than 0.4? True Let p = 61 + -62. Let j be 66/10 - (-4 + p). Are j and 12 unequal? True Let h be (56/190)/((-2)/(-50)10). Which is bigger: 1 or h? 1 Let q be (-1 - (-22)/18) + (-28084)/18. Let u = q - -60836/39. Which is smaller: u or 0? u Let u = 69 - 47. Let c be 9/54 - u/(-12). Suppose -cx = -5x + 3. Which is greater: 3 or x? 3 Let n = -5 + 11. Let b be ((-63)/n)/(4/(-8)). Let r = b + -12. Is r at least 10? False Let v = 1826.9 + -1827. Let o = 23/30 - 1/60. Which is greater: o or v? o Suppose 205u - 206u + 2 = 0. Is u less than or equal to 11/10? False Suppose 2l - 16 = 18l. Which is greater: l or 0.012? 0.012 Let n = 1780 - 1912. Which is smaller: n or -0.5? n Let r be (13/26)/((-2)/(-140)). Which is bigger: r or 38? 38 Let w be 1/(-2) - (-237)/6. Let r = -5694 + 5731. Are r and w equal? False Let q(s) = -s*3 + 11s*2 + 2s - 12. Let a be q(11). Suppose 0 = 7k - ak + 3. Are k and 9 unequal? True Let c = -132052/9 - -14656. Which is smaller: -17 or c? -17 Let k(y) = -y + 24. Let c be k(14). Let u = 0.035 - 0.235. Is u at most c? True Let g be 0 + ((-651)/28)/(75/(-40)). Which is bigger: 2/3 or g? g Let h(j) = -13j + 8. Let s be h(8). Let l be s/(-4)2/6. Let p = 9 - l. Which is bigger: p or 2? 2 Let n = 39 - 7. Are n and 57 equal? False Let i = 1410 + -1419. Is -62 smaller than i? True Suppose 4y + d - 10 = 0, -3 = 4y + 5d - 5. Suppose 1 = -2b + y. Which is bigger: -1/23 or b? b Let i = -5 + 2. Let z = 1 - i. Let h be z/14(-28)/(-6). Is 1 less than h? True Let h(t) = -t2 - 2t + 2. Let m be h(-3). Let s be (-38)/(-10) - 3(18 - 16). Which is smaller: m or s? s Let x = -81 - -99. Let y be (-3)/(-9)x/15. Is -32 bigger than y? False Let x(y) = -2 + y*2 - 5 + 6y - 4 + 15. Let g be x(-5). Which is smaller: g or -3/25? g Let t(k) = k*3 + 3k*2 - k - 4. Let h be t(-3). Let r be (12 - (-4)/(-1)) + h. Let u = 7 + 1. Which is smaller: r or u? r Suppose -l = 4z - 628, 1624 = 3l + 3z - 215. Is l >= 608? True Let i = 222 + -228. Is i smaller than 2? True Let m(n) = -n - 6. Let y be m(-9). Suppose -9 - y = -2z. Let k be z/(-5) + 5/25. Which is smaller: k or 0? k Suppose 0x + 2 = -2x. Let d be 121/(-154) + x/(-2). Let g(a) = -a2 + 6a - 6. Let o be g(5). Which is greater: o or d? d Let l = -362 + 271. Are l and -91 non-equal? False Let i be (-6)/(1 - (-2)/(-4)). Let h = -11 - i. Let p be (-3)/9 + (-1)/(-39)7. Which is smaller: h or p? p Suppose -9c + 27c + 198 = 0. Let b(a) = a2 - 8a. Suppose 0 = -n + 2 + 4. Let w be b(n). Which is bigger: c or w? c Let v(m) = 9m - 2. Let g be v(-1). Which is smaller: g or 0.1? g Let x be ((-24)/(-20))/6(-5 - -4). Is -172 equal to x? False Suppose 4t + 37 = -l, 0 = 5l - 4t + 282 - 49. Let v be (2 - -1 - 4)l. Which is smaller: 44 or v? 44 Let r = 6997 - 104956/15. Let d be (-102)/(-27) + 2/9. Suppose -z - 4c = -0 - 11, -3z = -dc + 15. Which is bigger: z or r? r Suppose v - 2206 - 445 = 0. Let c be (v/1826 - 3/2)/2. Which is smaller: 0 or c? c Let w = 63 + -93. Let s be ((-9)/w5)/((-2)/12). Is s bigger than -9? False Suppose -b + 17 = 19, 3j + 4b + 8 = 0. Is -3/8 not equal to j? True Suppose 4h - 5c = 21, 6c = -h + 4c - 11. Which is greater: h or -15/88? -15/88 Let u = 13/193 - 1811/32617. Which is smaller: u or 0.2? u Let t = -135 + 151. Which is smaller: t or 20? t Let t(n) = -21n - 1. Let m = 8 - 10. Let s be t(m). Let x = 165/4 - s. Is x smaller than 0? False Let r be -27(-4)/(-12)3. Let z = -24 - r. Let v be 8/(-10) - 0/z. Which is greater: -2 or v? v Let y be (0 + 0)/(-2 + 1). Let k = -8/601 + 2251/33656. Is k at least as big as y? True Let y(v) = -8v - 1. Let d(i) = i. Let a(n) = -2d(n) - y(n). Let h be a(2). Let q = h - 5. Do q and 9 have different values? True Let y be (6/5)/3 + -1. Let a be ((-58)/3)/(18/(-27)). Let c = a - 29. Is c <= y? False Let o(l) = -l3 - 7l*2 + 10l + 7. Let n be o(-7). Suppose -4p - 115 - 151 = 2b, 0 = -4b - 12. Is n bigger than p? True Let t = 699 - 658. Let p(g) = g2 + 7g - 3. Let a be p(-11). Are t and a equal? True Let k be (-27)/18(-132)/18. Is -6/11 < k? True Let r = -0.72 - 117.28. Let l = -138 - r. Which is greater: l or 1/3? 1/3 Let h be (-2)/(-9) + (9 - 1042/(-9)). Which is greater: h or -2? h Let i be 7140/40359 + (-9)/(-297)-6. Which is smaller: i or 1? i Let v = -280 + 312. Let w = 9 - 5. Suppose 17 = -3p - 2i, -wp - 2i - 3i = v. Is p at most as big as -1? True Suppose 43i + 321 = 63. Does -90/13 = i? False Suppose -5m + 119 = -2m - p, 4p = 3m - 116. Suppose 4t = -t + m. Do 23/3 and t have different values? True Let i(f) = f2 + 7f - 9. Let y be i(-8). Let l = y - 3. Let x be 5/4 - (-10)/(-8). Which is bigger: x or l? x Suppose 0 = -4t - 0t. Let x be (102/(-7))/((-6)/153). Let v = x + -371. Which is bigger: t or v? v Let j(x) = -x*3 + 4x*2 + 5. Let h be j(4). Suppose h = -3k - 2k. Which is bigger: k or -2/113? -2/113 Suppose -f = -4, 4y - 5f + 5 + 11 = 0. Which is greater: 97 or y? 97 Suppose 4a = 13 + 99. Let x be (-160)/a - 2/7. Which is greater: x or -8? x Let i(y) = y - 15. Let q be i(11). Let o = q - -3. Let s(u) = 4u - 1. Let c be s(o). Which is greater: c or -4? -4 Let p = -0.218 + 1.218. Is p equal to 3/2? False Let d(u) = -u3 - 3u*2 + 13u - 7. Let j = 8 + -14. Let m be d(j). Let k = 0.2 + -0.3. Which is smaller: k or m? k Let o(l) = -l*2 - 4l + 6. Let f be o(-5). Suppose x - 71 = -2k + 2x, 0 = 3k + 5x - 100.	{ "pile_set_name": "DM Mathematics" }
0400 divided by 27. -27490400/27 Divide -8251402 by 42533. -194 Divide 21591504 by -4. -5397876 Calculate -7993386 divided by -3996693. 2 10 divided by -653185 -2/130637 Divide -4260830 by 7. -608690 Divide 81148518 by -33. -2459046 What is -8510780 divided by -107? 79540 Divide 1278145 by 21. 1278145/21 What is -2254081 divided by -285? 2254081/285 853251 divided by 8 853251/8 Divide 19103527 by -44119. -433 What is 11 divided by 35634742? 1/3239522 Calculate -790689668 divided by -1. 790689668 Divide -14174 by 450. -7087/225 -813607727 divided by 5853293 -139 What is -2834020 divided by -7? 404860 Calculate 525981692 divided by 5. 525981692/5 Calculate 10266020 divided by 9. 10266020/9 What is 11520045 divided by -45? -256001 7 divided by 430344 7/430344 Divide -1004 by -51528. 251/12882 Divide 37 by -14614. -37/14614 -30021152 divided by -2 15010576 Calculate 88508682 divided by -9834298. -9 What is -344472786 divided by -911? 378126 Divide 923754169 by -5466001. -169 What is -4543623 divided by -63? 72121 What is -137451648 divided by -2? 68725824 328968322 divided by 2 164484161 0 divided by 10916591 0 Calculate -546874 divided by 2614. -273437/1307 Calculate -119 divided by 1154043. -119/1154043 Calculate 1176435351 divided by 117. 10055003 Divide -64237052 by -5839732. 11 What is 1 divided by -194428? -1/194428 What is -6505 divided by 36503? -6505/36503 21010748 divided by 1 21010748 Divide -306396 by -2837. 108 What is 1745 divided by -2074? -1745/2074 Calculate -192075696 divided by 24009462. -8 Divide 57589113 by 4. 57589113/4 59712547 divided by 6 59712547/6 Divide 5 by -47633175. -1/9526635 Divide 59121685 by -49. -1206565 -15073 divided by 2275 -15073/2275 Calculate -71276136 divided by 17819034. -4 Divide 160386432 by 29856. 5372 Calculate 11857593 divided by -519. -22847 Divide 676 by 189389. 676/189389 Calculate 1377216 divided by -72. -19128 Calculate 44804506 divided by -6. -22402253/3 Divide 9752280 by 30. 325076 What is -594099 divided by -6001? 99 -3277890 divided by -99330 33 57033996 divided by 3099 18404 Divide 4 by -5451327. -4/5451327 -151655776 divided by 14968 -10132 -40668538 divided by -1039 39142 What is -62 divided by -23640? 31/11820 What is -134687058 divided by -2? 67343529 What is 31 divided by -1333931? -31/1333931 Calculate -3280596 divided by -1914. 1714 -476005 divided by -27 476005/27 Calculate 339043212 divided by -1. -339043212 Calculate 0 divided by -310874. 0 10685867 divided by -1 -10685867 Calculate 22796534 divided by -397. -57422 Calculate 153328883 divided by -31. -4946093 Divide 2119 by -358. -2119/358 What is 2368950 divided by -31586? -75 Divide -66653316 by -401526. 166 What is 9820 divided by 143340? 491/7167 Divide -4906188 by 817698. -6 What is -20876260 divided by -254? 82190 What is 1985297 divided by -400? -1985297/400 Divide -2695615 by 65. -41471 Calculate -72369405 divided by -15. 4824627 Calculate 1256232 divided by 408. 3079 What is 1913 divided by -567010? -1913/567010 Divide 1619046 by 809523. 2 Divide -490060 by -219. 490060/219 Calculate -1 divided by 2923460. -1/2923460 5 divided by 4017122 5/4017122 Divide 150988536 by -2097063. -72 Calculate -12528755 divided by 5. -2505751 Calculate -120423623 divided by 27947. -4309 Calculate 679 divided by -694491. -97/99213 What is 2902174 divided by -1441? -2014 Calculate 12363300 divided by 1446. 8550 Divide 16563362 by -926. -17887 What is 5123234 divided by 3613? 1418 Divide -16492455 by -1832495. 9 Calculate 17720992 divided by 2215124. 8 Calculate -14832964 divided by -7416482. 2 -117604640 divided by 136 -864740 24 divided by 152312 3/19039 Calculate 572 divided by 39451. 572/39451 Calculate 13094771 divided by 13. 13094771/13 What is -6123810 divided by -3630? 1687 Divide -4 by 12199160. -1/3049790 48 divided by -362457 -16/120819 Divide -123581512 by -4. 30895378 Calculate -102702759 divided by 34234253. -3 Calculate 18 divided by 64737. 2/7193 Calculate 5589646 divided by -3. -5589646/3 What is -29823 divided by 6297? -9941/2099 -89194 divided by -277 322 What is -15206192 divided by -13019? 1168 Divide 7017705 by -2043. -3435 Calculate 46427019 divided by 3. 15475673 Calculate -2824945 divided by 24. -2824945/24 Divide -217832 by 112. -27229/14 What is 70 divided by -12763368? -35/6381684 Calculate -2401429 divided by -13. 2401429/13 Calculate -135780555 divided by -27156111. 5 -463700130 divided by 30 -15456671 Divide -65722113 by 3. -21907371 Divide -1 by -62498320. 1/62498320 19472593 divided by 301 64693 -3127 divided by -1976 3127/1976 What is -795 divided by -2405? 159/481 Divide -111984236 by -68. 1646827 What is -19128375 divided by -3825675? 5 27290448 divided by 12 2274204 What is -71931072 divided by -6? 11988512 11792735 divided by 2358547 5 Calculate -6 divided by 55839216. -1/9306536 Calculate 13393600 divided by 20. 669680 Calculate 24004 divided by 570. 12002/285 Divide -2708517 by 116. -2708517/116 302 divided by 4266586 151/2133293 Calculate 142572858 divided by 6. 23762143 -56558548 divided by 14139637 -4 Calculate -3487 divided by 12072. -3487/12072 -115044797 divided by -6767341 17 What is -3 divided by -5223065? 3/5223065 Divide 4809926 by -15466. -311 Calculate 79 divided by 46878. 79/46878 Calculate -219344740 divided by 76. -2886115 137 divided by 11153 137/11153 Divide -730 by -10557. 730/10557 Divide -8260515 by 2753505. -3 Calculate 17806208 divided by -17. -1047424 What is -1679010814 divided by 5809726? -289 801 divided by 14539 801/14539 What is -60137880 divided by -17281? 3480 130637518 divided by -26477 -4934 201212 divided by 22 9146 Divide 3 by -1407080. -3/1407080 Calculate 39128156 divided by 4. 9782039 Divide 43577908 by 179. 243452 What is -19007530 divided by -1445? 13154 What is 932 divided by -12008? -233/3002 7149680 divided by -3 -7149680/3 Calculate -270424863 divided by -90141621. 3 552 divided by 4263 184/1421 What is -476256569 divided by -1? 476256569 Divide 489677 by -6. -489677/6 Divide 1254042 by 131. 1254042/131 1898138 divided by -96 -949069/48 0 divided by -9692197 0 -32220 divided by -3531 10740/1177 -132053421 divided by -156647 843 Calculate 537008 divided by 268504. 2 What is -2131963844 divided by 2? -1065981922 6379 divided by -498 -6379/498 What is 34274329 divided by 6? 34274329/6 Calculate -26 divided by 302376. -13/151188 Calculate 360192850 divided by -3. -360192850/3 Divide -59342709 by -1591. 37299 -3439875 divided by -25 137595 -208260 divided by 104130 -2 -46637828 divided by -4 11659457 What is -422162 divided by -32? 211081/16 13704650 divided by 6852325 2 What is -2724996 divided by -31686? 86 Calculate 6053 divided by 2701. 6053/2701 -164 divided by 81641 -164/81641 Divide -616800 by -4112. 150 Calculate -32 divided by 36239. -32/36239 Calculate -1 divided by -481916. 1/481916 Divide 1 by 5093214. 1/5093214 Divide 2665880 by 28. 95210 What is 7882218 divided by 6? 1313703 Calculate -740942964 divided by -36. 20581749 Calculate -16 divided by -905960. 2/113245 Calculate -47947070 divided by -58615. 818 Calculate -2844416 divided by 656. -4336 Divide -80979720 by -5. 16195944 -163060 divided by -11 163060/11 Divide -2817700 by 88. -704425/22 -17939503 divided by 17 -17939503/17 What is 1052 divided by 27465? 1052/27465 Calculate 92 divided by 40895. 92/40895 Divide 6847 by 1653. 6847/1653 -33 divided by 1368657 -11/456219 259800590 divided by -14 -18557185 Calculate -32653930 divided by 2. -16326965 What is 9443504 divided by 112? 84317 Divide 3 by 25518504. 1/8506168 Calculate 244506880 divided by -64. -3820420 Calculate -1 divided by -93786659. 1/93786659 Calculate 19605222 divided by 754047. 26 What is 979805352 divided by -326601784? -3 Calculate -13330249 divided by -1. 13330249 Divide 170 by -689385. -34/137877 Calculate -546625780 divided by -4. 136656445 Calculate 20360868 divided by -1606. -12678 Calculate 56559253 divided by 2. 56559253/2 What is -12585770 divided by -205? 61394 Divide -2963384 by 2963384. -1 -150963120 divided by 385 -392112 331782 divided by -435 -110594/145 Divide -2659996 by 57826. -46 Calculate -3 divided by 90806681. -3/90806681 What is -1 divided by 1936375? -1/1936375 Calculate 6 divided by 248406. 1/41401 -12385	{ "pile_set_name": "DM Mathematics" }
s prob of picking 1 l and 1 d when two letters picked without replacement from bbdbddcbbbdbcl? 4/91 What is prob of picking 1 y and 1 c when two letters picked without replacement from ccyaccccc? 7/36 Calculate prob of picking 1 x and 1 l when two letters picked without replacement from {u: 1, h: 1, x: 5, l: 2}. 5/18 Calculate prob of picking 1 r and 1 k when two letters picked without replacement from kaaakkhhkhrhh. 2/39 What is prob of picking 2 e when two letters picked without replacement from {d: 2, l: 9, e: 2}? 1/78 Calculate prob of picking 2 l and 1 a when three letters picked without replacement from llalllallalalaaalll. 154/323 What is prob of picking 1 b and 1 x when two letters picked without replacement from bxbexmbxxjm? 12/55 Two letters picked without replacement from {r: 1, y: 1, o: 2, p: 1, d: 2, a: 1}. What is prob of picking 1 p and 1 d? 1/14 Calculate prob of picking 1 c and 1 a when two letters picked without replacement from {m: 1, c: 2, a: 1, i: 2, b: 1, u: 1}. 1/14 Calculate prob of picking 2 y when two letters picked without replacement from nttkjkynndynynn. 1/35 What is prob of picking 3 i when three letters picked without replacement from {w: 14, i: 5}? 10/969 Three letters picked without replacement from cncfnncnnfcnfccnnc. What is prob of picking 3 f? 1/816 Two letters picked without replacement from {x: 2, u: 2, y: 1, e: 1, m: 1, p: 1}. What is prob of picking 1 y and 1 p? 1/28 Calculate prob of picking 1 a, 1 y, and 1 f when three letters picked without replacement from ltccaccctylyfccyyffc. 1/95 What is prob of picking 3 p when three letters picked without replacement from cmppemmppmeme? 2/143 Calculate prob of picking 2 a when two letters picked without replacement from aqafqqn. 1/21 What is prob of picking 1 b and 1 v when two letters picked without replacement from {v: 1, y: 1, b: 1}? 1/3 Four letters picked without replacement from {l: 6, w: 2, k: 1, h: 1, z: 3}. Give prob of picking 3 l and 1 k. 4/143 Calculate prob of picking 1 w and 2 e when three letters picked without replacement from {w: 1, e: 11}. 1/4 Calculate prob of picking 1 q, 1 m, and 1 b when three letters picked without replacement from {m: 2, d: 1, q: 1, b: 3}. 6/35 Calculate prob of picking 3 i and 1 z when four letters picked without replacement from {i: 4, p: 3, z: 5}. 4/99 Three letters picked without replacement from yyyeyexe. Give prob of picking 3 y. 1/14 Four letters picked without replacement from ojojiijooijjjijioj. What is prob of picking 1 o, 1 j, and 2 i? 20/153 Calculate prob of picking 2 z when two letters picked without replacement from {z: 6}. 1 What is prob of picking 1 m and 3 i when four letters picked without replacement from {i: 4, m: 3}? 12/35 Calculate prob of picking 2 c when two letters picked without replacement from {y: 1, u: 5, l: 1, c: 3, s: 3, p: 1}. 3/91 Three letters picked without replacement from dqqdwdqewewnqdwe. Give prob of picking 1 n and 2 w. 3/280 Two letters picked without replacement from hdhheqheqeqeh. Give prob of picking 2 h. 5/39 Calculate prob of picking 1 b and 1 l when two letters picked without replacement from obllpbllplpplopbbl. 28/153 Two letters picked without replacement from xjxixbgxixi. Give prob of picking 1 i and 1 j. 3/55 Calculate prob of picking 1 o and 1 n when two letters picked without replacement from onooooqnooofoook. 11/60 What is prob of picking 2 c when two letters picked without replacement from {z: 1, c: 3}? 1/2 Three letters picked without replacement from oottuytxtootzoy. Give prob of picking 2 o and 1 y. 4/91 What is prob of picking 1 z, 1 m, and 1 r when three letters picked without replacement from {h: 7, m: 2, u: 1, r: 3, c: 1, z: 3}? 9/340 What is prob of picking 1 y and 1 m when two letters picked without replacement from yjjomjjjjmejmmmymjmj? 7/95 Three letters picked without replacement from {m: 5, t: 8}. What is prob of picking 1 m and 2 t? 70/143 Calculate prob of picking 1 v and 1 a when two letters picked without replacement from vavvavvvv. 7/18 Calculate prob of picking 1 i and 1 t when two letters picked without replacement from txxbixkbxbk. 1/55 Three letters picked without replacement from {w: 4, l: 7, t: 2, n: 1}. What is prob of picking 1 l, 1 n, and 1 w? 1/13 Two letters picked without replacement from {u: 3, b: 3, w: 4, v: 5, m: 3}. Give prob of picking 1 m and 1 w. 4/51 Calculate prob of picking 2 m when two letters picked without replacement from mgmmmmmmmmmgmmmmmggm. 12/19 What is prob of picking 2 k, 1 g, and 1 t when four letters picked without replacement from {k: 9, t: 1, g: 1, d: 5}? 9/455 Calculate prob of picking 4 d when four letters picked without replacement from dffffffdfdddf. 1/143 Calculate prob of picking 3 e when three letters picked without replacement from fffefffe. 0 Three letters picked without replacement from ibkobkkkkbbik. What is prob of picking 2 b and 1 k? 18/143 Four letters picked without replacement from qmoqk. What is prob of picking 1 k, 1 q, 1 m, and 1 o? 2/5 Three letters picked without replacement from mmwqwhhhnhwqvmq. Give prob of picking 2 w and 1 n. 3/455 Two letters picked without replacement from {z: 4}. What is prob of picking 2 z? 1 Two letters picked without replacement from wwwgwwwwgw. What is prob of picking 2 g? 1/45 What is prob of picking 1 g and 1 r when two letters picked without replacement from {t: 4, q: 1, r: 3, s: 2, g: 1, j: 1}? 1/22 Calculate prob of picking 1 n and 1 y when two letters picked without replacement from wwwywwwyeenw. 1/33 Three letters picked without replacement from {h: 5, v: 5, k: 1}. What is prob of picking 1 k and 2 v? 2/33 Two letters picked without replacement from {f: 5, l: 3, z: 3, g: 3, p: 2}. What is prob of picking 1 z and 1 l? 3/40 Four letters picked without replacement from tptpttptpptp. Give prob of picking 4 p. 1/33 Four letters picked without replacement from {p: 4, h: 6, v: 7}. What is prob of picking 1 p, 2 h, and 1 v? 3/17 Four letters picked without replacement from pzynhhx. What is prob of picking 1 y, 1 z, 1 x, and 1 n? 1/35 Three letters picked without replacement from sahbssxhahe. Give prob of picking 1 x and 2 e. 0 Two letters picked without replacement from {p: 4, d: 3, g: 6, a: 4, w: 3}. What is prob of picking 1 a and 1 g? 12/95 What is prob of picking 1 e and 2 v when three letters picked without replacement from {v: 9, e: 5}? 45/91 Calculate prob of picking 3 q when three letters picked without replacement from gqqqqqg. 2/7 What is prob of picking 4 d when four letters picked without replacement from {u: 7, a: 3, d: 4}? 1/1001 Three letters picked without replacement from nrnsg. What is prob of picking 2 n and 1 r? 1/10 Calculate prob of picking 2 h and 1 a when three letters picked without replacement from {a: 3, l: 6, g: 1, e: 2, h: 3}. 9/455 Two letters picked without replacement from csjvcvcvsccvcvij. Give prob of picking 1 j and 1 v. 1/12 Calculate prob of picking 2 v when two letters picked without replacement from {v: 7, f: 9}. 7/40 Three letters picked without replacement from {a: 1, i: 2, l: 1, c: 4, r: 3}. Give prob of picking 3 r. 1/165 What is prob of picking 1 j and 3 o when four letters picked without replacement from {j: 7, w: 5, o: 7}? 245/3876 Calculate prob of picking 2 r when two letters picked without replacement from {r: 2, p: 1, j: 1}. 1/6 Two letters picked without replacement from dmyyyynymddydy. Give prob of picking 1 d and 1 n. 4/91 Calculate prob of picking 2 y when two letters picked without replacement from {f: 5, y: 8}. 14/39 Two letters picked without replacement from cggcgxcxcxgg. Give prob of picking 2 x. 1/22 What is prob of picking 3 o when three letters picked without replacement from qoqoo? 1/10 What is prob of picking 2 v when two letters picked without replacement from vvvhoooovoo? 6/55 What is prob of picking 1 y, 1 o, and 2 g when four letters picked without replacement from {g: 13, o: 1, y: 1}? 2/35 What is prob of picking 3 o and 1 q when four letters picked without replacement from llqooolqqlq? 2/165 Calculate prob of picking 1 m, 1 c, 1 n, and 1 k when four letters picked without replacement from mmmmkknc. 4/35 Calculate prob of picking 1 e, 1 x, and 1 m when three letters picked without replacement	{ "pile_set_name": "DM Mathematics" }
- 13) - 1? 9 Calculate (3 - -15) + -9 + 0 + -14. -5 Calculate -4 + 0 - (18 + (-7 - 7)). -8 -4 - (-1 + (-6 - 1)) - -5 9 What is 34 + 1 + 408 + -457? -14 Calculate 1 - (32 - 31 - -7). -7 Calculate (-2 + -12 - -9) + 9 + -1 + -2. 1 (-40 - -40 - -15) + (-31 - 0) -16 Evaluate -14 - -2 - (27 + (24 - 17 - 11)). -35 Evaluate -9 + 0 + -44 + 57. 4 8 + 4 + (-50 - -30) -8 Evaluate -1 - (-16 + -1 + 34 + -31). 13 What is (-3 - -24) + (21 - -16) + -48? 10 -4 + (-4 - (-9 + -11 - -6)) 6 What is the value of -7 + -2 + (0 - -2) - (22 - 13)? -16 Evaluate (-4 + 2 - -2) + (7 - (3 + 1)). 3 What is the value of -30 + -1 - (36 - 53)? -14 What is the value of -4 + -11 - (-11 - -5)? -9 What is the value of -8 + 3 + (0 - 1) - (10 + -20)? 4 Calculate -9 + (1 + -5 - (-71 + 31 + 46)). -19 What is 11 - (-12 - (11 - 9) - -19)? 6 Calculate -14 - (-16 + 28 - (15 + -4)). -15 Calculate 6 - 1 - (-9 + 17 + -14). 11 What is the value of -5 + -11 + 24 - (0 + -1)? 9 Calculate -45 + 42 + (-2 - 1). -6 Calculate 49 + -9 + -26 - -3. 17 Calculate 45 + (22 - 26) - 37. 4 Evaluate (3 - (-3 + -5)) + -4 + -14. -7 What is the value of (-2 + 20 - (-31 + 33)) + -6 + 5? 15 What is 20 + 2 - 14 - (-1 - 3)? 12 Calculate -133 + 132 + 1 + -20. -20 Evaluate -8 - (-5 - 0) - (10 - (13 + 5)). 5 What is the value of (2 - 10) + 26 + (4 - 23)? -1 What is the value of 0 + 1 + -1 + (4 - -31 - 36)? -1 Calculate -344 + 348 + (-1 - 18). -15 What is (1 - (1 + 1)) + -10 + 15 - -4? 8 -5 + 10 + 2 + -9 + 0 -2 What is the value of 4 + -8 + 9 + -4? 1 What is the value of -53 + 12 + 11 + 15 + 6 + 1? -8 (9 - -1) + 12 + -14 8 Calculate 5 + -3 - (22 + -2 + -18). 0 Calculate -3 + (4 - (-3 - -14)). -10 (-5 - 1) + (-31 - -36) - -20 19 What is (-6 - -20) + -16 + 0? -2 Evaluate -6 + -17 + (-3 - -11). -15 Evaluate -1 + 35 + (-289 - -252). -3 Evaluate 10 - 3 - ((10 - 3) + -2 + -1). 3 What is ((4 - 1) + 7 + -13 - -1) + -6? -8 What is the value of 10 + 1 + -46 + 37 + 4? 6 Calculate (-52 - -50) + (-1 - 1) + (-2 - 4). -10 Calculate 14 - ((-23 - -43) + -14). 8 (5 - -1 - (-14 - (-6 + -12))) + -7 -5 What is (-1 + 12 + -4 - (0 - -3)) + -3? 1 What is -4 + -12 + 8 - -1? -7 Calculate -2 + 13 + 4 + (6 - 4) + -5. 12 Evaluate 31 + (35 + -30 - 62). -26 Evaluate -12 - (5 - (-18 + 10 - 7)). -32 Calculate (-5 - (1 - -2) - -6) + (-10 - -3). -9 1 - 0 - (-7 + 2 - (94 - 64)) 36 Calculate -1 + (101 - 86) + (-8 - 0). 6 What is the value of (-31 - -2) + (12 - 1) - 12? -30 Evaluate 1 + (-5 - (4 - -2)) + -2 + 3. -9 Calculate ((-7 - -14) + 10 - 6) + -15 + 12. 8 Calculate -25 + -58 + 38 + 60. 15 What is 0 - -2 - ((1 - -8) + (12 - 21))? 2 What is the value of -2 + 2 - ((-17 - -24) + 5)? -12 What is 7 + 1 + (-28 + 42 - 36)? -14 Evaluate -9 + -8 + -3 + 1 + 18. -1 Evaluate (-11 - -3) + 7 - (7 - 13). 5 Evaluate -16 - (-2 - (-2 + 11)). -5 What is the value of (-5 - -4) + (-3 - -25) + -4 + 4? 21 Evaluate 15 + (1 - (4 - -5)) + -6. 1 What is (7 - 11 - 12) + 6? -10 What is (12 - 4) + -4 - (1 - -1)? 2 Calculate 0 + -11 + 5 + -1 + 1 + 0. -6 (-6 - -3) + 6 + -1 - (36 - 37) 3 What is the value of 2 + -16 + 13 + -3? -4 -12 - (1 + 4) - (13 + -22) -8 What is 7 - (13 + 0 + (-8 - -13))? -11 -1 + 4 + (-2 - 7) + (15 - 23) -14 What is the value of -10 - (-55 - (41 + -57))? 29 21 + -12 + 1 + (-84 - -98) 24 Calculate (-4 - 4) + 1 + (12 + -5 - 1). -1 Evaluate 4 + (14 - 16) - (0 + -3) - 1. 4 7 - ((1 - -8) + 5) -7 -11 + 18 + -10 - (-4 - (-27 + 4)) -22 What is (30 - 23 - (-3 - 1)) + 9? 20 Evaluate -16 + -7 + 27 + (3 - -1). 8 Calculate (228 - 235) + (-2 - -5 - 2). -6 What is the value of -1 - -8 - (-1 - -11 - -2)? -5 (-5 - -9) + (5 - (-35 - -23)) 21 Calculate -1 - (6 + -10 + -3 + 0) - -3. 9 0 + -8 + -1 + (-77 - -158) + -61 11 -1 + -23 - (209 + -223) -10 What is the value of 18 - (7 + (-8 - -6)) - 3? 10 What is -14 + (0 - (-7 + -20))? 13 Evaluate (328 - 322) + (-3 - -1 - (-1 - -4)). 1 -31 - (32 + (-43 - 17)) -3 What is the value of -1 - -9 - (1641 - 1606)? -27 6 + (11 + -16 + 6 - 14) -7 What is 1 + 7 + (-1020 - -996)? -16 What is the value of (2 - 9) + 26 + -19 - 11? -11 What is 40 + (-3 - 9 - (-19 + 11))? 36 22 - (27 + 11 + -3) -13 Calculate 1 + 1 + 25 - (37 + -26). 16 (29 + -9 - 8) + 1 + 5 18 What is -8 - 0 - (-23 + 6 - -14)? -5 What is the value of -16 - (9 + -8 - -4 - 1)? -20 Calculate -15 + 17 + -9 - (-21 - (-5 + 2)). 11 What is 23 + -9 - 26 - -26? 14 What is (-2 - (9 - (1 + 1))) + (6 - 4)? -7 -21 + 29 + (-15 - 2) - 6 -15 What is (-9 + 7 + (9 - 7) - -2) + 17? 19 (387 - 397) + 0 + 35 + -14 11 48 - 7 - 46 - (0 - 5) 0 Evaluate 4 + (11 - 6) + -6 + 10. 13 11 + -5 + (4 + -2 - 1) + -10 -3 What is the value of 17 + 8 + 10 - 17? 18 Evaluate 9 - (7 - 2 - -2) - -14. 16 -3 + -13 + 50 + -15 19 (-23 - (-47 - -28)) + 1 + -8 -11 Calculate (0 - -11) + -7 - (-15 - -1). 18 Evaluate 0 - (-8 + (5 - 4) - 1 - -1). 7 What is (-1 - -1) + (11 + 1 + -5 - 7)? 0 Evaluate -17 + (19 - (18 - -2)). -18 Calculate 1 + (-9 + (-6 - -9) - (-15 - -4)). 6 What is (29 - 17) + -9 + 0 + -1 + 0? 2 (-41 - (18 - 57)) + 27 25 -10 + 3 - -16 - (8 - (3 - 3)) 1 Calculate 4 - (-62 + 61 + (6 - 2)). 1 What is the value of -4 - (24 - (6 + -3 - -7))? -18 Evaluate -21 + (11 - (-3 - -5)) + 0. -12 What is the value of -10 + (1 - 1) + (544 - 542)? -8 -30 + (-15 - -32) - -18 - (-1 - -23) -17 Evaluate (-3 + 11 - -30) + (-48 - -34). 24 What is 4 + -1 + (294 - 312)? -15 What is -27 - -26 - (-11 + -3)? 13 -30 - -32 - (-1 + -2 - (20 - 15)) 10 What is 3 + 5 + 0 + -1? 7 What is the value of -4 - -23 - (-4 - (3 + (0 - 2)))? 24 Calculate 48 - -4 - (20 - -3). 29 Evaluate (-19 - (-6 - 9)) + 2 + 0 - -9. 7 What is the value of 1 - -7 - (-151 + 171)? -12 Calculate 13 + -3 + -16 + (1 - -12) + 9. 16 What is 0 - (191 + -177 - (-2 + 2 + -4))? -18 What is 0 + (-14 + 7 - -3) - (0 + -6)? 2 (3 - 0 - 3) + (-3 - -4) - -5 6 What is -6 + (6 - 6) - -9 - (-1 + -1)? 5 What is the value of -14 + 31 - (-2 - -30)? -11 What is the value of 109 + -112 - (10 - -19)? -32 What is the value of -14 + 1 + 17 + -6 + -6? -8 Evaluate (16 - 13 - 5) + (-1 - 1) + -6. -10 What is 4 + 2 + (10 - 17) + 0 - 22? -23 Evaluate -1 + 1 - (188 - 172). -16 What is 20 + 9 + (-28 - -22) + 1 + 5? 29 Evaluate -1 + -6 + 6 + (12 - 2) + -1. 8 2 + ((5 - 16) + 13 - (5 + 2)) -3 (-14 + 28 + -2 - (-8 - 1)) + 12 33 Evaluate 46 + (-36 - -16) + -15. 11 What is the value of -6 - ((-7 - -2) + 5 + -8) - 8? -6 Evaluate -44 - (-43 - -6) - (0 + (-5 - 1)). -1 What is the value of (2 - 55) + 626 + -597? -24 (-6 - (-7 + 6)) + (-3 - 1 - -10) 1 3 - (-16 - (-1 - (14 + -3))) 7 Calculate 1 + -41 + -9 + (-5 - (-6 - 13)). -35 1 + (1 - (7 + 0)) + (4000 - 4009) -14 Calculate 21 + -56 - (2 + -15). -22 Calculate -6 + 6 + -17 + (12 - -3). -2 (-8 - (4 + -27)) + -10 + 5 + -1 9 What is the value of -1 + (23 - 11 - 4)? 7 What is 48 + (-16 - 16) + -13? 3 What is the value of 6 + (12 - 12) + -4 - (1 - 19)? 20 Calculate -12 - (-14 - (-2 + 14 - 20)). -6 -5 - 2 - -16 - 11 -2 What is the value of 3 - -4 - (-26 - -38)? -5 What is the value of 29 + -53 + (6 - 4) + (1 - -4)? -17 What is (65 - 50) + 6 + -7? 14 What is 1 - ((5 - 4 - -2 - 18) + 0)? 16 -8 + (-12 - (5 + -9 + 1)) + 16 -1 Evaluate -7 + (0 - -11 - 0) + -4. 0 What is the value of 9 + 0 - (16 + 0)? -7 What is the value of -9 - (18 - (13 - 0))? -14 -13 + 1 + (40 - 2 - 16) 10 Evaluate 8 + (5 - (-4 + 11) - 4). 2 -8 + 1 - ((17 + -25 - 24) + -3) 28 Evaluate 4 + 3 + 2 + -3 + (29 - 35). 0 What is the value of 3 - (-1 - (11 + -24))? -9 Evaluate -9 - (-13 + 20) - -1 - -11. -4 -29 - (-22 - (0 - 3)) -10 Evaluate 25 + (-15 - 37) - -3. -24 What is -5 + 5 + (-5 - -1) + 9 + -3? 2 Evaluate 2 - -2 - (13 - (-8 - -15)) - -15. 13 Evaluate (1 - 4) + 4 + -1 - (-201 + 202). -1 (-3 - (-10 - -2)) + 1 - (2 - -4) 0 (-1 - -21) + (-5 - 10) + 6 11 (10 + -4 + -4 - -9) + -32 -21 What is -10 + 56 - 28 - 31? -13 What is 3 + 37 + -32 + -27? -19 (7 - (8 + (-33 - -2))) + (-7 - 1) 22 What is the value of -57 + 28 - (6 + -19)? -16 Evaluate 0 + -33 + 91 + -78. -20 Calculate 4 + -15 - (0 - (2 + -6) - 7). -8 What is the value of -15 - ((-34 + -3 - -14) + -12)? 20 (-3 - -40) + (-31 - -16) 22 What is the value of (-6 - -1) + 12 + -39 + 20? -12 What is the value of (-6 - (8 - (12 + 6))) + 0 + -20? -16 -3 + (1 - -5) + 1 4 What is the value of -14 + 1 - (-19 - -3)? 3 Calculate 20 - (-22 + (-11 - -39)). 14 What is the value of (1 - 4 - 8	{ "pile_set_name": "DM Mathematics" }
ided by 21? 18 Let g = -11 + 17. Let t(b) = b*2 + 2b. Calculate the remainder when g is divided by t(-3). 0 Let i = 4 - 1. Suppose -90 = -iq + 9. Calculate the remainder when q is divided by 12. 9 Calculate the remainder when 684/16 - 1/(-4) is divided by 15. 13 Let x be -2 - (1 - (-4 + -2)). Let h = -5 - x. Suppose -75 = -5o - 0o. Calculate the remainder when o is divided by h. 3 Calculate the remainder when 59 is divided by 14/91 - (-206)/13. 11 Let m be (-4)/(-18) + 1928/72. Suppose 0 = 2f - m + 5. Calculate the remainder when (2 + 0)(1 + 9) is divided by f. 9 Let n = 14 + -4. Calculate the remainder when 18 is divided by n. 8 Suppose -4p = 4y - 524, 0y + p = 3y - 401. Suppose 4f - f + 4g - 101 = 0, -y = -4f - 5g. Calculate the remainder when 105 is divided by f. 24 Calculate the remainder when (-30)/(-4 - -7)(-18)/5 is divided by 10. 6 Let p(x) = 2x3 - 17x*2 - 7x - 2. Calculate the remainder when (-47)/(-2 + (-1)/(-1)) is divided by p(9). 15 Suppose -5x + 0c = 4c + 10, 14 = 2x - 2c. Suppose -5a + 75 = 5s, 0 = -5a + xs + 56 + 40. Calculate the remainder when 34 is divided by a. 16 Let y(r) = 4r - 7. Let o be y(3). Suppose -ob + 8b = 12. Calculate the remainder when 5 is divided by b. 1 Suppose z + 4j + 2 = 0, z - j + 0 = 13. Let q = -6 + z. Calculate the remainder when q is divided by 3. 1 Let z(r) = -8r + 7. Let f(i) = -i + 1. Let p(t) = -35f(t) + 5z(t). Let h be p(-4). Suppose 0x - 2x = -h. What is the remainder when x is divided by 6? 4 Suppose -2f = -4n - 8, -f + n = -5 + 4. Let a = -2 - f. Calculate the remainder when 0 - 8/(a - 2) is divided by 2. 0 Let z(s) = -21s - 11. Let k(v) = 11v + 6. Let d(h) = 5k(h) + 3z(h). What is the remainder when d(-4) is divided by ((-2)/(-2))/(2/20)? 9 Suppose 0 = -2c - 10, -2o + 72 = -4c - 156. Calculate the remainder when o is divided by 21. 20 Suppose -13n = -5n - 584. Calculate the remainder when n is divided by 25. 23 Suppose 10m - 245 = 5m. Let j(s) = s + 2. What is the remainder when m is divided by j(11)? 10 Let i(y) = 7y*2 - 4y - 4. Let d(t) = -t*2 + t - 1. Let w(f) = 6d(f) + i(f). Calculate the remainder when w(-9) is divided by 14. 11 Let w(i) = -i*2 + 8i + 19. What is the remainder when 215 is divided by w(6)? 29 Suppose n = 4m + 21, 5n + 3m = -0m - 10. Calculate the remainder when (-32)/(-2)n/2 is divided by 5. 3 Let f(h) be the first derivative of h3/3 + 4h*2 + h - 3. Let m be f(6). Let q = m - 57. Calculate the remainder when q is divided by 10. 8 Let t = 17 + -24. Let y = 16 + t. Calculate the remainder when 26 is divided by y. 8 Suppose 3l = 2z - 0 + 7, -l = 3z - 17. Calculate the remainder when 34 + (z + -2 - 2) is divided by 12. 10 Suppose -4d = -6 - 30. What is the remainder when 44 is divided by d? 8 Let n(t) = t3 + 6t*2 + 5t - 4. Calculate the remainder when 45 is divided by n(-4). 5 Suppose 0k + 15 = -k + 5m, 0 = 4m. Let p = 52 + k. What is the remainder when p is divided by 19? 18 Let u(q) = 2q*2 - 7q + 7. Suppose -12 - 11 = -x. Suppose 4w = 4a - 13 - x, 0 = a - 4w - 21. Calculate the remainder when u(a) is divided by 12. 10 Let z be (-3)/2(-12)/9. Let p = z + 10. What is the remainder when 33 is divided by p? 9 Let q(w) = -w*3 - 13w*2 - 15w + 19. Calculate the remainder when q(-13) is divided by 36. 34 Suppose -10 = -a + 50. Let o be (-2)/(-4)-2 - -1. Suppose -c - 2c + a = o. Calculate the remainder when c is divided by 7. 6 Suppose -2l - 2l + 168 = 0. Let u = -23 + l. Suppose 2h + 251 = 3c + 89, 0 = -c + 5h + 41. What is the remainder when c is divided by u? 18 Suppose o = -5c - 4o + 5, 2c + 4o = 0. Let s = -4 + 11. Calculate the remainder when s is divided by c. 1 Let k(q) = -q2 - 7q - 3. Suppose 2y = -3y - 30. Calculate the remainder when k(y) is divided by 2. 1 Suppose -4o - 2i + 56 = 0, 5o - 4i - 94 = -11. Calculate the remainder when 99 is divided by o. 9 Calculate the remainder when (10/(-25))/(1/(-5)) is divided by 2. 0 What is the remainder when (131/4)/(30/24 - 1) is divided by 34? 29 Suppose 2b = b - 3m - 8, -5b = 4m - 15. What is the remainder when 27 is divided by b? 6 Let v(r) = -r*3 + 3r*2 + 6r - 6. Calculate the remainder when 58 is divided by v(3). 10 Suppose x + 4 + 6 = 5u, -2x = -4u + 2. Suppose 17 = 2f - 1. What is the remainder when f is divided by u? 0 Suppose 0 = -4f - 5u + 59, -2u = 4f + u - 53. Calculate the remainder when 21 is divided by f. 10 Suppose 29t - 32t = -237. Calculate the remainder when t is divided by 41. 38 Let j = -2 - -6. Let n = j + -6. What is the remainder when (1 + -3)/(n/25) is divided by 13? 12 Let v(s) = -2s2 + 33s - 3. Let i(t) = -t*3 + 2t*2 + 2t + 3. What is the remainder when v(15) is divided by i(-2)? 12 Let g = 47 - 27. What is the remainder when 56 is divided by g? 16 Let t(a) = -7 + 16a + 2 - 14a. Calculate the remainder when 37 is divided by t(9). 11 Let d be 357/18 + (-3)/(-18). Suppose -w = 2r - d, -35 = -5r - 0w + 5w. Calculate the remainder when 26 is divided by r. 8 Let m(c) = -3c + 160. Let z(d) = -2d*3 + 3d + 2. Calculate the remainder when m(46) is divided by z(-2). 10 Suppose -4u - 18 = -2g - 3u, -39 = -5g + 4u. Calculate the remainder when 64 is divided by g. 9 Let u(w) = w3 - 15w*2 - 16w + 19. What is the remainder when u(16) is divided by 6? 1 Let x(r) = -23r3 + 2r*2 + r. What is the remainder when x(-1) is divided by (-3)/3 - (-70)/(-15)-3? 11 Let i(l) = 180l3 + 1. What is the remainder when i(1) is divided by 46? 43 Suppose 0 = x - 4x - r + 55, -5r = 3x - 59. Calculate the remainder when 122 is divided by x. 14 What is the remainder when -12 + (-3 - -26) is divided by (-2 - -2) + 10 - -2? 9 Let n(b) = b3 + 9b*2 - 8b + 4. What is the remainder when n(-8) is divided by 45? 42 Let s = -1 - -5. Let j(x) = x + s - 3x - x. Calculate the remainder when 24 is divided by j(-3). 11 Suppose -25 = -5t, -t = 3b - 4t - 51. Calculate the remainder when 152 is divided by b. 20 Let y(u) = 12u + 25. Calculate the remainder when y(7) is divided by 19. 14 Suppose -5l - 26 = 3z, -2z = -3l - z - 24. Let m = l + 20. Let r = 22 + 3. What is the remainder when r is divided by m? 12 Suppose -15 = s - 6s. Suppose 0 = -r + 6r + sg - 105, -r + 21 = -g. Calculate the remainder when 62 is divided by r. 20 What is the remainder when 35 is divided by (-6)/14 + (-4)/(-28)129? 17 Let z be 1 + -3 + 0 - -17. Let x = 42 + z. What is the remainder when x is divided by 20? 17 Suppose -3n - 30 = -5f + 2n, f + 4n = -4. Suppose 0 = 5d - 3d - f. Calculate the remainder when 2 is divided by d. 0 Let f(i) = -27i - 27. Calculate the remainder when f(-10) is divided by 41. 38 Let s(d) = 14d2 - d. Let w = 4 + -3. Calculate the remainder when s(w) is divided by 7. 6 What is the remainder when 391/17 - 1/(-1) is divided by 17? 7 Let t = 3 - 1. Let b(p) = -p2 + 5p + 1. What is the remainder when b(3) is divided by t? 1 Suppose -2h = -4h + 22. Suppose -129 = -4o - 45. What is the remainder when o is divided by h? 10 Suppose -7f + 8 = -3f. Suppose 3i = -fi - 5. What is the remainder when 18 is divided by (-29)/(-6) - i/6? 3 Suppose 14z - 1754 = -662. What is the remainder when z is divided by 8? 6 Suppose 9 = 2d + 5s, 4d = 5s + 25 + 8. Calculate the remainder when d is divided by 3. 1 Let m(v) = -v*3 + 6v*2 + 6v - 9. Let b(h) = 2h2 + 4h - 2. What is the remainder when m(6) is divided by b(-4)? 13 Suppose -5f + 20 = 0, f + 3 = 3u - 2u. Calculate the remainder when 4 is divided by u/21 - (-8)/3. 1 Let k(j) = 5 - 2 - j2 + 3j + 1. Let z be k(5). Let t = z + 22. What is the remainder when t is divided by 9? 7 Let y be (3 + -1 + -1)/1. Suppose -3c - 4p - 3 = -y, -2c = -5p - 37. What is the remainder when 21 is divided by c? 3 Suppose 2a = -2a + 68. Let d = 3 + 47. Calculate the remainder when d is divided by a. 16 Suppose 3s = 2s + 11. Suppose 0 = 4l - s - 1. Suppose 8o - lo = j + 123, o + 4j = 12. Calculate the remainder when 46 is divided by o. 22 Suppose -355 = -5t - 5p, 2p - 66 = 3t - 4t. What is the remainder when t is divided by 26? 24 Let j be 16/(-72) - 20/(-9). Suppose 0 = -v - k + j, -3k - 5 + 2 = 0. Calculate t	{ "pile_set_name": "DM Mathematics" }
21 + -1.61. What is the nearest to s in 1, 2, -0.3? -0.3 Let s = -0.11 + -0.59. Let f = s + 5.7. Let h = 774.7 + -775. Which is the closest to 2? (a) -5 (b) f (c) h c Let y = 218 - 222. Let r = -3.3 + 3. Which is the closest to -1? (a) r (b) -0.1 (c) y a Let a = 16 + -5. Let x = -165229/256906 - 10/3133. Let n = -6/41 - x. What is the closest to -1 in 4, a, n? n Let l = -100 - -60. Let q = l - -39.62. Let x = q + 0.28. Which is the closest to x? (a) 1/4 (b) 5 (c) 1 a Let w be 42/(-22) - (-2 - 0/(-1)). What is the nearest to -0.39 in 1/6, w, -3/4? -3/4 Let v be 88/110(-1)/2. Which is the nearest to v? (a) -5 (b) 0.2 (c) 0.07 c Let i(n) = -11n*3 - 1. Let p be i(-1). Let h be (-52)/180 + 4/p. Let m = 171 + -171. Which is the closest to -0.1? (a) 0.4 (b) h (c) m c Let b = -3.35 + -1.65. Let a = -1.6 + 3.6. What is the nearest to 0.3 in a, 1/7, b? 1/7 Let x be (8 - 4 - 0) + 21/(-6). What is the closest to 0 in -5, -0.3, x, -0.1? -0.1 Let j = -2 - -2.1. Suppose -8 + 16 = 2o. Let d be -7 + 2 + 4 - o/(-7). Which is the nearest to j? (a) 2 (b) 0 (c) d b Let s = -116/15 - -37/5. Which is the nearest to -2/5? (a) 0.1 (b) -8 (c) s c Let y be (-46 - -41) + (-29)/(-5). What is the closest to 0.1 in 0.01, 4, 1, y? 0.01 Let s = 238 + -219. What is the nearest to 0.2 in -2/3, s, -0.3, 0.4? 0.4 Let m = 0.0045 - 0.2045. Suppose 0 = 3v + 10 - 4. Which is the nearest to 0.1? (a) -0.3 (b) m (c) v b Let a = 0.15 - 1.05. Let p = -0.6 + a. Let k = 1.2 + p. What is the nearest to 0.1 in 3, -1/4, k? -1/4 Let t = 18 + -18. Let d be 310/(-132) + 1/6. Which is the nearest to t? (a) d (b) 0 (c) 0.5 b Let g = -836.9 - -693. Let u = -144 - g. What is the closest to 0.3 in u, 1/3, -3? 1/3 Let p be 8/14 - (148/14 - 4). Let h = -5 + 9. Which is the nearest to p? (a) 0.4 (b) -2/9 (c) h b Let n(l) be the first derivative of l3/3 - 5l*2/2 - 10l + 1. Let m be n(7). Suppose 3y = my. Which is the closest to 1? (a) y (b) -5 (c) -0.5 a Let l = 0.5 + -4.5. Let w = -121 + 107.9. Let a = w + 13.2. What is the closest to a in 0, -0.2, l? 0 Let r = 0.04 - 0.44. Suppose 0 = 3j - 72 - 3. Let y be 5-2(-10)/j. What is the closest to r in 0.2, -5, y? 0.2 Let p = -195 - -194. Let x = 3.8 - 4. Let w = 0.3 + x. Which is the closest to w? (a) 1/9 (b) p (c) 2 a Suppose -5n + 6n = 4. Let x(o) = 9o - 36. Let j be x(n). Suppose 2d = 3f + d + 3, -2d + 4 = -4f. Which is the nearest to f? (a) 5 (b) 0.4 (c) j c Let s = 96 + -99. Let c(w) = -w + 3. Let t be c(3). Let i = 0.9 - -0.1. What is the nearest to i in t, s, 3/7? 3/7 Suppose -5k + 5 + 5 = 0. Let s be -3 + 0/(-1) + -6. Let x = -9 - s. What is the closest to x in -5, 4, k? k Let k be ((-111)/148)/((-4)/16). Let h = 3 - -1. Which is the nearest to -0.1? (a) k (b) -5 (c) h a Let i = 2.113 - 55.113. Which is the nearest to i? (a) -0.01 (b) 2/5 (c) -3 c Let t be 4/(28/(3 - 1)). Let f = -8.5 + 8.1. Which is the nearest to t? (a) f (b) 1/9 (c) 0 b Let d be 14/(9/((-90)/(-4))). Let v be -1(-6)/((-30)/d). Let p be (v/35)/((-3)/45). Which is the closest to -0.1? (a) 4/7 (b) 1/6 (c) p b Let z = 53/170 + 3/34. Let d = -1.04 + 0.04. Which is the closest to d? (a) z (b) -0.1 (c) 1 b Let v = -283693/12 + 23696. Let n = v + -55. What is the nearest to -0.1 in n, -2/11, 3/7? n Suppose -44 = 3t + 22. Let l = t - -19. Let g = 3 + -1. What is the closest to 0.1 in l, g, 3? g Let w = 0.116 + 50.884. Let i = w + -48. Which is the nearest to -1? (a) 1 (b) i (c) -0.04 c Let t = 1 + -1. Let k(p) = 5p - 1. Let f be k(1). Suppose h = fh. What is the nearest to h in t, 3, -2? t Let h = 720 + -725. Which is the nearest to 1? (a) 2 (b) -0.2 (c) -5/6 (d) h a Let j be (1 - (-3)/(-6)) + 0. Let r = -29/301 + -2/43. What is the closest to j in 4, 5, r? r Let f be ((-1533)/(-140) + -11)8. Let y = -236 - -4958/21. Which is the nearest to 0.1? (a) y (b) f (c) 0.2 a Suppose -5d - 12 = 3h - 1, 2d + 4h = -10. Which is the closest to 0.1? (a) -2/11 (b) d (c) 0.4 a Let f = 4 - 2. Let d be (-1)/(-4)(-20)/45. Which is the closest to f? (a) -3 (b) -0.5 (c) d c Let h(v) = v3 - 27v*2 + 184v - 28. Let z be h(14). Which is the nearest to -7/2? (a) 3 (b) -1/3 (c) -2 (d) z c Let f = 0.015 - 1.015. Let i = 0 - -7. Let k = i + -6. Which is the nearest to -2? (a) 0.1 (b) f (c) k b Let f(z) = z - 3. Let u be f(6). Let i be (2/10)/(1/(-3)). Suppose 2y - 28v + 25v + 2 = 0, -y - 5v = 1. Which is the closest to y? (a) -1/6 (b) u (c) i c Let u = -5 - -4.8. Let r = -0.0572 + -0.0428. Which is the nearest to 0? (a) u (b) r (c) 0.4 b Let y be 2 + (-8)/(-7)-2. Let i = -113/17 + 497/85. What is the closest to y in i, -2/3, -3? -2/3 Suppose -504 = 2k - 6k. Let r be (-7)/3(-12)/k. Let d = -12.1 - -12. What is the nearest to 3 in d, 3/2, r? 3/2 Let z = -38 - -32. Let g(l) = -2l2 - 12l + 2. Let x be g(z). Let p be (-27)/9 - 1x. What is the closest to -1/4 in p, -0.2, -2/5? -0.2 Let k be (-75063)/(-66) + 2/11. Let s = k + -16343/14. Let f = s + 30. Which is the closest to 1/3? (a) -4 (b) -2/5 (c) f c Let f be ((-320)/12)/10 + 40/12. Let l = 12 + -9.9. Let p = l + -0.1. Which is the nearest to -2/11? (a) p (b) f (c) 5 b Let o(r) = -2r*2 + 5r + 30. Let t be o(5). Which is the closest to t? (a) 0.4 (b) -2/5 (c) -0.3 a Suppose 0 = -2z - 5f + 886, z = 5f - 65 + 493. Let n be (-13)/22(0 + z). Let s = n + 259. Which is the nearest to 0.1? (a) 0.2 (b) s (c) 0.3 b Let l = 105.86 + -88.9. Let h = 165 - 148. Let o = h - l. What is the closest to 1 in -0.1, -1/9, o? o Let n = -1.598 + -0.302. Which is the closest to 1/3? (a) -3 (b) n (c) 5 (d) 2/23 d Let i = -310.3 + 310. Let y = 0.3 - -0.7. What is the closest to 1/2 in y, 1/4, i? 1/4 Let d = 1.13 + -0.13. Let w be ((-3)/8)/((-1)/(-2)). Let o = -0.26 - 0.04. Which is the closest to d? (a) w (b) -0.1 (c) o b Let u be (-63)/(-28)38/3. Let g = u - 28. Let f = -2 - -6. What is the nearest to -2/9 in g, f, 1? g Let f = 357 + -358. Let x = 27 + -26.95. Let p(z) = -z3 + 5z*2 - 5z + 5. Let y be p(4). Which is the nearest to f? (a) y (b) -0.5 (c) x b Let v be (4/24)/(((-20)/6)/(-5)). Which is the closest to 0.1? (a) v (b) 2 (c) 3 a Let s be (-1)/(-7) + 1/(35/(-1055)). Let r be 2/812/s. What is the closest to 0 in r, 0, 2? 0 Let p = 1114/3 + -358. What is the nearest to 1 in p, 2/9, -4? 2/9 Let m = 160.7 - 157. Let y = m - -0.2. What is the nearest to y in -3, -5, -3/4? -3/4 Let t = -147 + 142. Let g = 4.7 + t. Which is the nearest to -1? (a) 4 (b) -1/6 (c) g c Let z(j) = 7j + 39. Let l be z(-6). Which is the nearest to 1/3? (a) -4 (b) 4 (c) l (d) -33 c Let b be 0 - 0/(-2) - -80. Let d be (-6)/55 - (-16)/b. Let n = 2/5 + -9/35. What is the closest to -0.1 in d, 0.4, n? d Let v = 354.5 + -355. What is the nearest to -0.1 in 2/41, v, -2/9? -2/9 Let k = 4.4 - 11. Let f = k - -6.5. Which is the nearest to -2/7? (a) -3 (b) -2/19 (c) f b Let n = -1312 - -1309. What is the nearest to -2/49 in 1/4, n, 2/3, -2/11? -2/11 Let h = -56.4 - -57. Let d = h + -0.8. What is the nearest to d in 2/9, -0.1, 0.1? -0.1 Let j be (-133)/(-21) + (-4)/(-6). Suppose g = -4s + 13, -5s + 2g + 0g + 26 = 0. Let r be ((-3)/(-60))/(2/s). What is the nearest to 0 in -0.4, r, j? r Let i = 6852 + -6852. Let v = 0.8 - -0.2. What is the closest to v in -4/3, -0.3, i? i Let q = 0.315 + -0.415. What is the nearest to q in -3, -199, -1/8? -1/8 Let m = -998 + 998.3. Which is the nearest to 1? (a) 2 (b) 5/4 (c) m (d) -3 b Let t(k) = 20k - 79. Let i be t(4). What is the nearest to -1 in 2, i, -2? -2 Let o(n) = -2n*2 + 3n - 2. Let p be o(2). Let v = -0.1 - 0.1. Let y be (1 + 630/(-625))-10. Which is the nearest to v? (a) p (b) 3/2 (c) y c Let z = -2.965 - 0.035. Let i = z + 2. Which is the nearest to 7? (a) i (b) -4 (c) 2/3 c Let s = 39 - 56. Let b = s + 6. Let w = b + 6. What is the closest to 0.2 in 0, w, 1/6? 1/6 Let q = -4.626 + -0.374. What is the nearest to -0.1 in -3, 0.3, q? 0.3 Let b = -16/83 - -639/1162. Let t = b + 1/7. Let s = 61/140 - 1/28. What is the closest to s in t, -6, -5? t Let j = -0.1 - 1.9. Let f = 0 + j. Suppose -2h - 4y + y + 3 = 0, -5h + 7*y - 7 = 0. Which is the closest to h? (a) f (b) 3 (c) 5 a Let	{ "pile_set_name": "DM Mathematics" }
l + z. Suppose -l = u - 42. Give x(u). 22 Let p(o) be the third derivative of -o4/4 - 5o*3/6 - 24o*2. What is p(-4)? 19 Suppose -14 = k - 16. Let m(q) = -4q - 4q + q + q + 3. What is m(k)? -9 Let p = -30 + 37. Let z(v) = 2v*3 - 13v*2 - 2v - 31. Give z(p). 4 Suppose 0 = -2d - 3h + 5, -5h + 3 = d - 3. Let y(l) = 9l - 2l - 12l + 24l - 1. Determine y(d). 18 Suppose 0 = 6v - v - 120. Suppose 2u + 2u = -v. Let k(j) = -11 + 122j + 5 + 6 - 4 - 124j. Determine k(u). 8 Let p(n) be the second derivative of -22n + 1/2n*2 + 0 - 1/3n*3 + 19/12n*4. What is p(1)? 18 Suppose 12j = 19j - 42. Let b(f) = -f3 + 8f*2 - 7f - 8. What is b(j)? 22 Suppose 0 = 2f - 2 - 12. Let s(o) = 16o - 19o + 6 + 8o + o*3 - fo*2. Let q be (6/(-5))/((-2)/10). Give s(q). 0 Let f(m) = -16m + 288. Let y be f(18). Let t(w) = -w3 + w2 + 2w - 4. Determine t(y). -4 Let o(f) = -5f - 5f + f2 - 7 + 5f + 1. Give o(7). 8 Let c(t) = 6t2 + 2t + 1. Suppose -14 = -5r + 3f, 0 = 4f - 0f - 8. Let u = -28 + 30. Suppose s + 5 = rh - 2h, h = u. What is c(s)? 5 Let u be 30/7 + (-1)/(28/8). Let j(d) = -12d + 6. Let a(s) = -s. Let m(h) = 10a(h) - j(h). Give m(u). 2 Let c(n) = 5n2 + 14n - 3. Let w(x) = x*2 + x. Let s(k) = -c(k) + 6w(k). Calculate s(8). 3 Let m = -19 - -24. Let k(a) = m + 96a2 - 101a*2 + 12a - a*3 - 5a. What is k(-6)? -1 Let f(i) = -22i - 12. Let u(s) = 10s + 7. Let h(q) = 6f(q) + 13u(q). Give h(11). -3 Suppose -m - 4q + 7q - 5 = 0, 3m + 15 = -3q. Let p(o) = -o*2 - 4o + 7. Calculate p(m). 2 Let y(b) = b*3 - 4b*2 + b - 12. Suppose 92 = 18i + 2. Give y(i). 18 Let z be 4/6 - 260/(-78). Let p(k) = 4k3 - 6k - 3. Let b(y) = 3y3 + y2 - 5y - 3. Let n(h) = 5b(h) - 4p(h). Calculate n(z). 9 Suppose -18 = -2m - 2s, -5m - s + 22 = -3. Let p(o) = 5 + 2o*3 + mo + o*3 - 6o*2 - 2o*3. Give p(5). 0 Let y be (-2)/(7/5 - 1). Let a(g) = 5g*2 - 14g - 6. Let t = 20 + -14. Let v(z) = -z*2 + z. Let p(h) = tv(h) + a(h). Calculate p(y). 9 Let a be 7/(-14)-8 - 8. Let d(v) = 4v - 1. Let p(j) be the third derivative of -j4/12 + j3/6 - j*2. Let u(c) = -3d(c) - 5p(c). Determine u(a). 6 Let j(z) be the second derivative of z3/6 - 9z*2/2 - z - 65. Suppose 0 = -4o - o + 40. What is j(o)? -1 Let o(q) = -2q2 + 14 - 2q*3 - 7 - q + 3q3 - 3. Determine o(3). 10 Let u(q) = q2 + 3. Suppose 36x = 32x - 16. Let l be (3/x)/3 + 13/4. Give u(l). 12 Let b(v) = 3v + 8 + 8v*2 + 5v + 15v2 - 30v*2 + 10v2. What is b(-5)? 43 Let z(n) = n3 - n*2 - 5n + 2. Suppose 14r = -30r - 132. Determine z(r). -19 Let m(t) = t*2 + 3t - 4. Suppose -25 = -3b + 35. Let y be 57/(-15) + 16/b. Determine m(y). -4 Let s(i) = i - 2 + 8 + 3. Let p be s(-9). Let u(q) = -q + p + 5 - 2. What is u(4)? -1 Let c(p) = p2 - 4p - 3. Let g(n) = 1. Let f(y) = -c(y) + 5g(y). Suppose 4t - 38 = 22. Suppose 4a = -m + 29, 2m + t = 5m. What is f(a)? -4 Let h(l) be the third derivative of -l4/24 + 5l*3/6 + 3l*2. Let u(q) = 1. Let o(s) = -h(s) - 4u(s). Determine o(4). -5 Let k(j) = -3j - 3. Let q(n) = n2 - 9n - 4. Let u be 6 - (-6 - -2 - -1). Let t be q(u). Give k(t). 9 Let h = -7 + 9. Let m(u) = 0u2 - h - 4u + 2u + u2. Determine m(2). -2 Let t = -89 - -91. Let k(v) = 0v + tv + 5 - 2. What is k(5)? 13 Let i(u) = -u2 - 3u. Let p = -594 - -599. What is i(p)? -40 Let b(v) be the third derivative of v6/120 + v4/12 - v*3/3 - 278v*2. Calculate b(2). 10 Let b be (-230)/40 + (1 - (-5)/(-4)). Let c(x) = -3 - 4 + 3x*2 - 4x*2 + 0x*2 - 7x. What is c(b)? -1 Let o(k) = -16k2 - 7k + 8. Let b(h) = 29h2 + 15h - 16. Let z(m) = -6b(m) - 11o(m). Determine z(8). 32 Let l = 76 + -73. Let j(n) = -3n - 302n2 - 2 + nl + 4n + 304n2. What is j(2)? 16 Let u(b) = b3 - 7b2 + b - 9. Let s(r) = -r3 + 9r*2 + 3r - 12. Let q be s(9). Suppose 0 = -19o + qo + 28. What is u(o)? -2 Let c be 10 - 19 - 3(-16)/12. Let r(d) = -5d + 7. Determine r(c). 32 Let b = -591 + 592. Let v(t) = -4t2 + 2t - 1. What is v(b)? -3 Let i(f) be the first derivative of f*3/3 - f - 32. Determine i(-1). 0 Suppose -3 + 120 = -56c + 17c. Let x(y) be the first derivative of -1/2y*2 + 3y + 1. Calculate x(c). 6 Let o(t) = -8t2 - 3t + 1. Let x(c) = -39c - 155. Let i be x(-4). What is o(i)? -10 Let v(t) be the second derivative of 1/4t4 + t2 + 0 + 1/2t3 - t + 1/10t*5. Give v(-2). -8 Let m be (-9 - -13)(21/(-6) - -3). Let n(v) = -23v - 5. Give n(m). 41 Let q be (-2)/4 - (-14)/4. Let i(s) = -s + 11s*3 + 0s - 10sq + 1. Let h(f) = 5f*3 - 8f + 8. Let n(c) = 3h(c) - 24i(c). Calculate n(1). -9 Let h = 1 - -1. Suppose 6r - 48 = hr. Let b(q) = q - 8. Let a be b(r). Let y(v) = -v - 2. What is y(a)? -6 Let p(q) = 0q2 + 3131q - 3141q + q2 + 7. Give p(11). 18 Let k(s) = 1. Let a(u) = -2. Let z(b) = b - 17. Let y(t) = 2a(t) - z(t). Let v(i) = k(i) - y(i). Determine v(13). 1 Let u(d) = -1. Let o(h) = 2h + 22. Let c(r) = -o(r) - 5u(r). Let n be c(-6). Let t(j) = 4j3 - 4j2 - j3 + 4 - 4j3 + 7j. What is t(n)? -6 Let v be 6/((-12)/(-46)) - 2. Suppose 0 = -0w - 7w - v. Let y(r) = -4r - 1 + 5 - 3 - 2r2. Determine y(w). -5 Let j(g) be the third derivative of -g6/120 - g5/15 + g4/8 - g*3 + 3g*2. Let i = -9 + 14. Let v be (2 - i)5/3. Calculate j(v). 4 Let o(m) = -m*3 + 8m*2 + m - 8. Suppose 5k + 18y - 20 = 14y, -27 = -4k - y. What is o(k)? 0 Let d(q) = -q3 - 6q*2 - 5q + 4. Suppose 0 = g + 5, 26 - 1 = -3u + g. Let n = 5 + u. Give d(n). 4 Let m(t) be the first derivative of t3/3 + 3t*2 - 5t + 12. Suppose 2s = -4l - 24, -s - 2l - l - 14 = 0. Determine m(s). 11 Let v(g) be the third derivative of -g5/60 + g3 + 104g*2. Determine v(-6). -30 Let a(z) = 14 - 2z - 10z2 - 3 - 1 + 9z*2 - 6. Give a(-4). -4 Suppose 48 = 8j - 4j. Let x(q) = -12 + 3q2 + q3 + 5q + j - 2q. Let z(i) = i*3 - 2i2 - i. Let a be z(2). Give x(a). -2 Let b(i) be the third derivative of -i4/24 + i*3/6 - 61i*2. Calculate b(-5). 6 Suppose 2m + 176 = -0m. Let c be m/(-10) - (-1)/5. Suppose cd = 5d. Let t(g) = -g2 + g - 6. Determine t(d). -6 Let b(k) be the third derivative of 3/2k*3 + 0 - 1/12k*4 - 12k*2 + 0k. Give b(6). -3 Let s(h) = -47 + 349h + 57 - 348h. What is s(-6)? 4 Let g(q) be the first derivative of q*4/4 - 3q*3 - 2q*2 - 2q - 77. Give g(9). -38 Let m(j) = 560j - 561j + 1 - 1. Give m(7). -7 Suppose 10d - 1 - 89 = 0. Let u(h) = -h - 11. What is u(d)? -20 Let h(w) = 7w + w*2 - 5w + w*2 - 3w*2 + 2 + 0w*2. Let c be 0 - ((2 - 5) + 1). Let d(a) = -4a*2 + 7a + 7. Let g(n) = cd(n) - 7h(n). Calculate g(1). -1 Suppose -3q - 30 = -g, -q - 4q - 33 = 4g. Let k(a) = a3 + 9a*2 + 2a - 5. Give k(q). -23 Let y(v) = 2v3 + 4v*2 - 2v + 5. Suppose -12 = 4d - 4r, 197d + r = 200d + 11. Give y(d). -51 Let a = -45 - -68. Let m = a - 25. Let s(h) = -2h2 - 2h + 2. Let x be s(m). Let v(y) = 4y + 2. Determine v(x). -6 Let x(j) = 0j + j - 1 - j*2 + j + 3j. Let y = 5 - 9. Let t = 8 + y. Calculate x(t). 3 Let i(r) = r - 7. Suppose 25g - 37g = 0. Give i(g). -7 Let a = -4 + -3. Let j(i) = 8i + 5 - 79i*2 + 55i*2 + 25i2. Give j(a). -2 Let h(f) = -f3 - 7f2 + 5f - 16. Let m = -1062 - -1054. Give h(m). 8 Suppose 4v = 3s + 9, -2s - 27 = -2v - 5s. Let j(h) be the second derivative of -h5/20 + 5h4/12 + h3 + h*2 + 3h. Calculate j(v). 2 Let i(x) be the third derivative of -x7/840 - x5/120 - 5x4/8 - 7x*3/6 - 38x*2. Let u(j) be the first derivative of i(j). Determine u(0). -15 Let f(m) = -17m*2 + 53m + 123. Let b(z) = -4z2 + 13z + 29. Let t(q) = -13b(q) + 3f(q). Determine t(9). -17 Let g(i) = 3i2 + 38i + 26. Let n be g(-12). Let a(z) = 3z3 - 4z*2 + 3z - 2. What is a(n)? 12 Let c(a) = a + 9a2 + a2 - 21a*2 + 9a*2 + 9a*2. Suppose -m + 0m = -5o, -2m + 12 = 2o. Give c(o). 8 Let s(g) = -29g - 378. Let o be s(-13). Let j(f) = 22f3 - 2f*2 - f + 1. Give j(o). -22 Let a(w) = -15w*3 + 2w2 + w + 3. Let o(g) = -g3 - 1. Let n(j) = a(j) + 3o(j). Give n(-1). 19 Let x(j) = -5j3 - j2 + 4j + 6. Let b(n) = -11n3 - n2 + 10n + 14. Let a(u) = -4b(u)	{ "pile_set_name": "DM Mathematics" }
k. 4 Suppose -10t + 27 = -13. Solve v + 1 = 3x, 3x - 1 = v + tx for v. -1 Suppose h + 30 = 4h + i, 3h + 4i = 30. Let t be (-64)/(-6) - h/15. Solve -5d - t = -3y, 2d - d + 2 = y for d. -2 Let h = 321 - 227. Let n = -65 + h. Let g(l) = l*2 - l + 1. Let k be g(2). Solve 5i + 35 = kr, -i + 5r - n = -0r for i. -4 Suppose 8p - 18 = 6. Solve 4k - 2s = -0s + 6, 3k = s + p for k. 0 Suppose 8u - 18 = 5u. Solve 4i + 9 = -4y - 3, -2y - u = -2i for i. 0 Let b be (2 + -5)(-4)/6. Let l be 2/(-20)-410. Suppose ld = bd. Solve -3o - 15 = 3s, -o + 4 = -2s - ds for s. -3 Let r = -15 - -29. Solve 0 = -3o - 6, -4y - 6o + r = -3o for y. 5 Let q = 16 - 13. Solve qv + 12 = 4k, 0 = v - 4v - k + 3 for v. 0 Suppose 5r - 5n = 6r + 8, r - 10 = 4n. Suppose 0 = rs - 8, -u - 2u + 29 = 5s. Solve o + 2h - 7 = -1, 4o - uh + 31 = 0 for o. -4 Let v be (-5)/(-2) + (-4)/(-8). Suppose -s = vt + 1, 2t - 3t + 5s = -5. Solve 4w + u - 6 = t, 2w = 2u + 5 + 3 for w. 2 Let q(i) = i3 - 11i*2 - 15i + 18. Let z be q(12). Suppose -3f - 2 = 13, 3k - 118 = 5f. Let h = z + k. Solve 10 = -2n, -3l - 5n = l + h for l. 3 Let y(v) = -v*3 - 3v*2 - 2v + 2. Let q be y(-2). Let k be (-5)/(-10)12/q. Suppose -l - kl = 0. Solve -3n + 4r + 27 = 0, ln - 13 = -5n - 4r for n. 5 Let t be 1 + (-2)/(4/2). Let v be -4(-2 + t)/2. Suppose 24 - 4 = 4s. Solve -4h - 5j = s - 0, -3h - vj = 3 for h. -5 Let d(l) = l - 2 + 7 + 3. Let v be d(-5). Suppose 0u - 18 = -vu. Solve -3g = j + u, 0j - 2g + 7 = -3j for j. -3 Let k = -4 + 8. Let n = k - 5. Let c be n + (0 - -3) - -1. Solve 7a - 3a = cl - 10, 2l = a for a. -4 Let l = -9 - -18. Let g = l + -4. Solve 0a = 2n - ga - 15, -2n = -2a for n. -5 Let r(n) = -n - 3. Let x be r(-3). Let a be 2 + -11 - (-1 - x). Let j be 6/(-4)a/4. Solve 3q + 6 = 0, jh + 2q = q + 7 for h. 3 Suppose u + 2 - 6 = 0. Suppose a = j - 3a, -uj + 40 = 4a. Solve k + j = -5c, -c + 5k + 4 = -10 for c. -1 Suppose 6c - 9c + 6 = 0. Solve 0 = -cy + y + 3z - 10, -4y = z + 1 for y. -1 Let c(l) = 3l2 + 8l. Let w(u) = -7u2 - 15u - 1. Let p(b) = 9c(b) + 4w(b). Let x be p(10). Solve -4z + 2j = -x, 3j = -4z - 4 - 0 for z. 2 Let o be (-69)/(-15) - (-2)/5. Suppose -or = -2r - 15. Solve -4v = 3j - 17, -v - j = -0j - r for v. 2 Let q = -176 + 180. Solve l + 6 = ql + g, 7 = l + 2g for l. 1 Suppose 3u = -2z - 15, -2u - 10 = 3z - 2z. Suppose 2d = -d. Solve r + b + 4 = -zb, d = -3r + b + 8 for r. 1 Let u be (-2)/(-8) + (-57)/(-12). Let v be (-81)/(-15) - 2/5. Suppose -19 = -5s - h, -vs - 5h + 13 + 2 = 0. Solve 2c - 15 = uo - 1, -4 = so - 4c for o. -4 Let d be -1(4 + 14/(-2)). Solve -do - 4 = -o - 2v, -5v + 12 = -3o for o. 1 Suppose 6b - 10 = b. Solve -5l = bm - 2, 3l = -l for m. 1 Suppose 10t + 28 = 17t. Solve 0m + tm + 18 = -2d, -15 = 3d for m. -2 Let x(m) = m2 - 4m - 3. Let y be x(5). Solve o + 23 = 5a, 0 = 2o - 0a - ya + 6 for o. 2 Suppose -5h - 2j = -136, 3j - 47 = -5h + 92. Solve 2l + 5c - h = -9, -l + 16 = 4c for l. -4 Suppose -3 = -0j + 3j. Let z = j - -8. Let s(n) = -n3 + 6n*2 + 8n - 4. Let c be s(z). Solve 8 = 2i + m - 2m, ci - 2m = 12 for i. 4 Let g(n) = -2n2 + 4n*2 - 12 + n + 11 + 0n*2. Let r be g(1). Solve -rb = -2h + 4, 5b = -7h + 3h - 19 for b. -3 Suppose -3 = 4p - 19. Solve -3g + 2g - 3m + 17 = 0, pg - 2m - 12 = 0 for g. 5 Let c be 5 + -3 - 1-1. Suppose 221 + 160 = cr. Let n = r - 87. Solve -3s + 0s - n = -5y, 5y - 30 = s for y. 5 Suppose -9 = -u + 1. Solve 5f + u = 2s, 2s + 3f = -2 - 4 for s. 0 Let j = -19 - -25. Solve 4 = -5o - 3i - j, 4i - 4 = 2o for o. -2 Let b = 14 - 13. Let h be 31 - (-18 - b). Solve -4x - 2y + 16 = 0, -x - 4y = 2x - h for x. 2 Let b be 5/2 + 3/(-6). Suppose 2p + 4 = -p - 5i, 5i = -bp + 4. Let n = p - -11. Solve 0 = -5v - x + 4, nv + x - 4 = -0x for v. 0 Suppose -2c + 2o = 0, c - 4o + 11 = 2. Let u = 4 + 0. Solve ch + 2t = -2h, ut = 0 for h. 0 Let h(m) = -2m*2 - 13m - 6. Let r be h(-6). Solve j - 4 = -rj + 3w, 0 = -5j + 2w - 19 for j. -5 Let b(x) = -x*3 + 7x*2 - 2x + 16. Let q be b(7). Solve 5a - 2p = -3p - 10, -a + 5p - q = 0 for a. -2 Let j = 3 + 1. Suppose -5 = -jp + 7. Suppose 0n = n + 2v + p, -6 = -3n - v. Solve -11 = -4r + 5i - 2, -2 = r + ni for r. 1 Suppose 6j - j = 2l - 6, -5l = -3j - 15. Solve 0 = 2t - ld + 10, -4t - 3 = 5d - 5 for t. -2 Suppose -4o + 36 - 20 = 0. Let h(t) = -t*2 - 6t - 6. Let a be h(-4). Solve 0r - a = 2j - 2r, r = o for j. 3 Suppose -f + 7 + 2 = -k, -3f + 19 = -k. Solve -3x - 2y = 2y + 2, -fx - 12 = -2y for x. -2 Suppose 5s = 3l - l + 12, -3l = 2s - 1. Solve 0 = -5f - g - 5, sg + 5 + 5 = 0 for f. 0 Let w = -41 - -44. Solve i + 2s - 2 = -wi, -4s = 4i for i. 1 Let j = -2 + 5. Suppose 3k - 8 = m, -3k - 4 = -7m + jm. Let u be 63 - (3 + 0). Solve 0 = -w + kw + t + 15, -3w + 2t = u for w. -5 Suppose 8 = 2f + 4k - 6, -5f + 2k + 11 = 0. Let a be ((-18)/8)/(6/(-16)). Solve -u + a = -6u + fd, 4d + 15 = -u for u. -3 Suppose 5h - 25 = 3l, 3h - 3l - 22 = -1. Solve s = 3z - h, 4s - 16 = -0s for z. 2 Suppose 5n = n. Solve n = j + 2w, 2w + 26 = 4j + 6 for j. 4 Let z be (5/4)/(3/12). Suppose zg + 0g - 20 = 0. Solve k = 5c - 0k + g, 4c + 4k - 16 = 0 for c. 0 Suppose -3j - 40 = -8j + 5f, -5j = -3f - 32. Solve -5x + h - 4h = 30, -2h + 2 = -jx for x. -3 Let s = -49 - -49. Suppose -l = 4l - 25. Suppose 2x - 21 = -3v - 2v, 0 = -3x + lv + 19. Solve 4r + 2d = -sd - x, -r = 2d - 4 for r. -4 Let j(l) = -4 - 3 + 2l - 4l. Let n be j(-5). Suppose -a + nm + 26 = 0, a - 30 = 2m + 3m. Solve 5y - 3u + 7u + 4 = 0, y = 4u - a for y. -4 Let h(d) = -d3 + 2d + 3. Suppose -c + 11 = -3g, -5g + 0g - 15 = -c. Let y be h(g). Solve -3o + 7o = t - y, t - 2 = -o for t. 3 Suppose -2 = 5d - 3a - 17, -3d + 5 = -a. Let r = -14 + 11. Let q(c) = -8c - 1. Let w be q(r). Solve -5n + j - w = -3, d = 2n - j + 5 for n. -5 Let k = -3 - -8. Let d be (-6)/(-4)(k - 3). Solve l + 1 = -0l + r, 2 = -2l - dr for l. -1 Let h(l) be the second derivative of l5/20 + l4/2 - 4l*3/3 + 2l*2 + 7l. Let a be h(-7). Solve -3g - a = -3k + 4, -g - 4k = 0 for g. -4 Suppose 4 - 1 = -m. Let y be 2/m - (-22)/6. Solve yz = 2b + 4z + 1, 4b - 8 = -4z for b. -3 Suppose 8r - 8 = 6r. Solve -3o - 8 = -4w, 0o - w = ro - 2 for o. 0 Let i be (0/((-25)/5))/4. Solve i = 3q + 4n - 10 - 3, -2n + 8 = 0 for q. -1 Let g be -13 + (1 - (-2 + 2)). Let o = g + 15. Solve om - 5 = -t, 4t - t = -3m + 3 for t. -1 Suppose 5v = m - 36, v - 76 = -2m - 3m. Solve -d - 1 = 5a, -4d + 4a + 4 = -m for d. 4 Suppose x - 1 - 2 = 0. Suppose -10 = 5a - 25. Solve 0d + ad = 3s - x, 45 = -5s - 5d for s. -4 Let l(h) = 0h + h - 35 + 28. Let q be l(10). Solve 0 = -v + 2t + 2 + 10, -qv + 3t = -24 for v. 4 Suppose -4 = -2b - 2. Suppose n - 6 = -b. Solve 5q = nt - 35, 2q - 3t = q - 13 for q. -4 Suppose -2i = -16 - 0. Let y = i + -6. Solve -3j - f = -3 - y, -20 = -j - 4f for j. 0 Suppose 0 = 5u + 25, 0v - 3v = 4u + 11. Let i(q) = -v + 4q - 4q - 6q. Let y be i(-4). Solve 3j = -m - 12 + 1, y = 4m - j for m. 4 Let d = 9 - 7. Let v be ((-12)/14)/(d/(-28)). Suppose 0 = -g - 5t + 24, -5t + v = -g - g. Solve 2y - 3h = h - 18, gy + 16 = 3h for y. -1 Suppose -5o + 2o - 19 = 4y, 4y + 4o = -16. Let k = y + 10. Solve 2b + ki + 18 = -b, b - 5i = 24 for b. -1 Let y be (0 + 1)/((-3)/(-15)). Let v = -9 + 14. Suppose 2k + 3k + 25 = -5d, -d - v = 3k. Solve 5f - 2r = -kf - 3, -yf = 5r + 10 for f. -1 Let w(r) = -r*3 - 16r*2 - 15r + 6. Let u be w(-15). Solve 0n - 4l = 2n - u, -l = 0 for n. 3 Suppose -4f = -5f + 5. Solve -fa + 4b = 20, 3b - 7b = 0 for a. -4 Let x(d) = -d2 - 6d + 10. Let a be x(-7). Solve -f - aw = 0, -w + 16 = 4f + 5 for f. 3 Suppose 5t - 12 = t. Suppose -5k = 5p - 80, -tk = -p + 2k + 4. Solve 2u + p = -3r, -4u + 3r = -5 - 3 for u. -1 Let i be (-4)/(-2) + 3/(-3). Suppose 0 = 2b - 9 - i. Solve -38 + 13 = 5p + k, bp + 25 = -4k for p. -5 Suppose 2i + 2t = t + 35, 2i - 5t - 29 = 0. Let s = 6 + -4. Suppose -4a - s*r	{ "pile_set_name": "DM Mathematics" }
rest to -2 in -11, 0, -0.2? -0.2 What is the nearest to 0 in 2/9, -1, -58? 2/9 What is the closest to 4/7 in 2, -4/15, -2/7, 3? -4/15 Which is the closest to 3? (a) -13 (b) 2/7 (c) 5 c What is the closest to -15 in -1.4, -0.1, 0.5, -1? -1.4 Which is the closest to 2.4? (a) 2 (b) 1/4 (c) 0 a Which is the closest to -1? (a) -5 (b) -2/19 (c) -4 (d) 0.5 b Which is the closest to 0? (a) 6 (b) -268 (c) 0.2 (d) -0.5 c What is the closest to 1/2 in 2/3, 3, -3? 2/3 Which is the nearest to 0.1? (a) 3/23 (b) -15 (c) 2/9 a Which is the closest to 3? (a) 2 (b) 0.4 (c) 18 (d) -3 a Which is the nearest to -2? (a) -2/5 (b) -0.1 (c) 3/7 (d) 15 a Which is the nearest to -1? (a) -1 (b) 0.04 (c) -2/5 (d) 8 a Which is the closest to -2/3? (a) 7 (b) 0.5 (c) 4 b What is the nearest to -1/3 in 4/13, -4/5, 0.3, 3? -4/5 Which is the closest to -1/3? (a) 0.06 (b) -2/3 (c) -2 (d) -245 b Which is the closest to -0.1? (a) -7 (b) 30 (c) -0.2 c Which is the closest to -0.1? (a) -0.5 (b) 1/10 (c) -0.2 (d) -0.1 d What is the closest to 3 in -2, -9, -0.02? -0.02 Which is the nearest to -2/3? (a) 1/4 (b) -1/64 (c) 0.2 (d) 3 b What is the nearest to -0.3 in 1/6, -5, -0.2, 4? -0.2 Which is the closest to -3? (a) -2 (b) 1 (c) -53 a What is the closest to -2 in 0.3, 4, 0.5, -1/4? -1/4 What is the closest to 4 in -1, -40, 1? 1 What is the nearest to 25 in 8, 2/3, -2/11, -10? 8 What is the nearest to 3 in 4, -1/47, 5? 4 What is the nearest to 11 in 17, 1/2, 3? 17 What is the closest to -1 in -1/14, 5, -2/7? -2/7 What is the closest to 1 in 0.3, -1/6, -3? 0.3 Which is the nearest to 1/2? (a) -0.2 (b) 1 (c) -0.22 b Which is the closest to -31? (a) 1 (b) 3 (c) 0.1 c Which is the closest to -5/2? (a) -3 (b) -4 (c) -1.7 a What is the closest to -8 in -5, 2/9, -54, 0.5? -5 What is the nearest to 0 in -0.4, -824/5, -2/13? -2/13 What is the nearest to 1.628 in 0.1, 1, 5, 0.2? 1 Which is the closest to -0.2? (a) -0.4 (b) 1/3 (c) -3 a What is the nearest to 0 in -0.5, -0.16, 1/5, -1/3? -0.16 Which is the closest to 2? (a) -2.3 (b) -1/4 (c) 2 (d) 5 c Which is the nearest to 159? (a) -0.1 (b) 5 (c) -0.5 b What is the nearest to 0 in 0, -1, -3, 0.04? 0 Which is the closest to -1? (a) -1/5 (b) 4 (c) -4 (d) 9.93 a What is the closest to -1 in 2/19, 0.09, 0.5? 0.09 Which is the nearest to -2/3? (a) -5/2 (b) 1/3 (c) -2/7 (d) -1/3 d What is the closest to 1/4 in -0.5, -7/29, 0? 0 Which is the nearest to -0.1? (a) 0.17 (b) -0.02 (c) -0.2 (d) 11 b What is the closest to -1/11 in 2/11, -0.7, -4, -5? 2/11 What is the closest to 1 in -2, 0, -6? 0 Which is the closest to -6/13? (a) 4 (b) 3/4 (c) 14 b What is the nearest to 0.1 in -1015, 0.5, -0.2? -0.2 Which is the closest to 2? (a) -0.2 (b) 3/7 (c) 3/13 (d) 4 b What is the closest to 1 in 3, 4, -6? 3 Which is the closest to -17/4? (a) 0 (b) 4 (c) 3/7 a What is the closest to -2 in -0.9, -4, 2, -0.3? -0.9 What is the nearest to 0 in 1, 2/9, 0.5, 0? 0 What is the nearest to -5 in -2/5, 2/17, 0, -5? -5 Which is the nearest to 0.2? (a) 5 (b) 3 (c) -0.66 (d) -4 c Which is the nearest to -4? (a) 2 (b) 3 (c) -2 c What is the closest to 0.1 in 0.05, 0.18, 3, 3/2? 0.05 What is the closest to 2 in -13, -2, 0, 0.2? 0.2 Which is the nearest to -0.1? (a) 1 (b) -0.3 (c) -0.19 c Which is the nearest to 2? (a) -1 (b) 1 (c) -3 b Which is the closest to 15? (a) 5 (b) 0.3 (c) -4 (d) -2/15 a What is the closest to -7 in 1, -0.4, 5, -0.5? -0.5 Which is the nearest to -3.6? (a) -0.5 (b) -5 (c) 2/17 (d) 2/5 b What is the nearest to -6 in -5, -0.1, 5? -5 What is the nearest to 0 in -3, -10/9, -0.5? -0.5 Which is the closest to 1? (a) -17 (b) -0.1 (c) -1 (d) -2/7 b What is the nearest to 23 in -2/3, 3/2, 5, -5? 5 Which is the closest to -2? (a) 2 (b) 4 (c) 0.074 (d) 1/6 c What is the nearest to -2/3 in -10, 2, -1? -1 What is the closest to -3 in 0.3, -15, 5, -5? -5 Which is the nearest to 0? (a) -3/8 (b) -2/11 (c) 0 c Which is the nearest to -24? (a) 0.2 (b) -2/13 (c) -2 c What is the nearest to -0.16 in 2/13, 2/9, -1, 0.7? 2/13 What is the nearest to -1 in -2/17, 4, -47, 0.3? -2/17 Which is the nearest to -8/7? (a) -2/5 (b) 2/9 (c) -4 a Which is the nearest to -0.3? (a) 0.4 (b) 1/8 (c) -3 b Which is the nearest to 0.369? (a) -5 (b) -1 (c) 0.4 (d) -1/4 c Which is the closest to 0? (a) -0.3 (b) 6 (c) -3 (d) 5 a Which is the closest to 1/4? (a) -0.07 (b) 0 (c) -0.28 b Which is the closest to 285/8? (a) 0 (b) -4 (c) -3 a What is the closest to -1 in -3, -1/6, 2/21? -1/6 What is the nearest to 3 in 56, 0.5, 2, -1? 2 What is the nearest to 1/4 in 10, 2, 6? 2 What is the closest to 2/235 in -1/2, 5, 2/9? 2/9 Which is the nearest to 1? (a) -4 (b) -45 (c) 3/7 (d) 2 c Which is the closest to 2? (a) -1/3 (b) 4/7 (c) -0.5 (d) 1 d What is the nearest to -0.6 in -0.1, 0.2, -7, 3? -0.1 What is the nearest to 19582 in 2/3, 2, 3, -0.3? 3 What is the closest to 0 in -31, -5, 2? 2 What is the nearest to -0.05 in -0.5, 2/7, -7? 2/7 What is the closest to 0.1 in 2, 0, 16, 6/11? 0 What is the closest to -2/17 in 0, 1/4, -1? 0 What is the closest to -1/4 in -0.3, 0.33, -0.4? -0.3 What is the nearest to 0.1 in -1/5, 2/3, 0.05, -30? 0.05 Which is the nearest to -2? (a) 2/9 (b) 19 (c) -5 a What is the closest to 1 in -6, -4, 5? 5 Which is the closest to -1/2? (a) 3.1 (b) -0.5 (c) 1 (d) 0 b What is the nearest to -881 in 1/4, 8, 4? 1/4 What is the nearest to -2 in 0.1, 0, -13? 0 Which is the nearest to -2/7? (a) -0.2 (b) 2 (c) -1/3 (d) -193 c Which is the closest to 0.06? (a) 1 (b) 2/7 (c) 16 b What is the nearest to 0.6 in 0.5, -1, 3? 0.5 Which is the closest to -0.1? (a) -5 (b) -1/3 (c) 107 (d) 6 b Which is the nearest to 4? (a) -1/5 (b) -4 (c) -5 (d) -12 a Which is the nearest to -241? (a) 2 (b) -1 (c) -4 c What is the closest to 0.3 in 0.051, 1/9, 3/4, 0.2? 0.2 Which is the closest to 0.1? (a) -3 (b) 1038 (c) 0 c Which is the nearest to -0.1? (a) 2/5 (b) 0.2 (c) 1/8 (d) 2/9 c What is the nearest to 24 in 0, 4/3, -3? 4/3 Which is the closest to 1? (a) -0.4 (b) 2 (c) -0.02 (d) -5 b What is the nearest to 1 in -1/2, -4, 5, 7.75? -1/2 What is the nearest to -2 in 2, -0.3, -5, 0.05? -0.3 Which is the nearest to 0? (a) -2 (b) 4 (c) 16/7 a Which is the closest to -1? (a) -0.14 (b) -7 (c) 1 a Which is the nearest to -2/21? (a) -4 (b) 0.1 (c) -0.5 (d) 2 b Which is the closest to -1? (a) -3 (b) 2/9 (c) -9.3 b Which is the nearest to 3/7? (a) 5 (b) 3/7 (c) 0.5 (d) -8 b Which is the closest to 239/5? (a) -1 (b) -4/9 (c) 0 c What is the closest to 0.1 in 2/9, -5, 1/15, -0.1? 1/15 Which is the closest to 0? (a) -14/11 (b) 0.2 (c) 15 b Which is the nearest to 2/7? (a) -2 (b) -3 (c) 4 (d) 230 a Which is the nearest to 0.05? (a) 2 (b) -3 (c) 1/4 (d) -2/9 c What is the nearest to 24 in 0.1, 0.5, 1, -2/7? 1 What is the closest to -2/5 in -1/2, -2, 7, -2/7? -1/2 What is the closest to 0.1 in -160/49, 0, -0.5? 0 What is the closest to 0 in 1/4, -13, -2, -2.2? 1/4 What is the nearest to 0 in -3, -0.256, 0.4, 2/9? 2/9 What is the closest to 20/37 in 4, -2, -4, -2/3? -2/3 What is the nearest to 2 in -5, 1/2, -3, -0.4? 1/2 What is the closest to 1/3 in 32, -2/5, 1? 1 Which is the nearest to -0.1? (a) -1 (b) -7/6 (c) -6/7 (d) -5 c Which is the nearest to 1/9? (a) 0.5 (b) -4 (c) 3 a What is the closest to -1/2 in -294, 1/2, -3/7? -3/7 Which is the closest to -1? (a) -3 (b) 0.02679 (c) -1 c What is the closest to 2/3 in 4, -10, -15/7, 3/4? 3/4 Which is the nearest to 1? (a) 1 (b) -3/8 (c) -7 a Which is the nearest to 0? (a) -1/11 (b) -0.2 (c) 35/6 a What is the nearest to -3 in 0, -812, -1/2? -1/2 Which is the nearest to 0.1? (a) -5 (b) -0.3 (c) 0.0775 c What is the closest to -1 in -1, 3/5, 0.38, 0.3? -1 Which is the nearest to -5? (a) -4 (b) -0.9 (c) 0.5 (d) 1 a Which is the closest to -0.2? (a) -4 (b) -3/4 (c) -11 b Which is the nearest to 2? (a) -1/12 (b) -5 (c) 12 a Which is the closest to 0.14? (a) 0.2 (b) -5 (c) -133 a Which is the nearest to 1? (a) 3/2 (b) -57 (c) -0.2 (d) 5 a What is the nearest to -2.4 in -5, -3/2, -0.5? -3/2 Which is the closest to 1? (a) -0.4	{ "pile_set_name": "DM Mathematics" }
. 9 Suppose 0 = -3m + 16 - 4. Let q be 3 + (10 - m)-1. Let y = q - -29. Calculate the remainder when 49 is divided by y. 23 Let z(a) = -4a + 53. Let u be z(25). Let t = u + 131. Suppose -v + 2s = -25, 5v = 2v + 3s + t. Calculate the remainder when 120 is divided by v. 27 Let t(b) = b3 + 28b*2 + 44b - 84. Calculate the remainder when 1483 is divided by t(-26). 119 Let b = 10 + 71. What is the remainder when b is divided by (-34)/16(-152)/19? 13 Suppose 0 = -3k - 4a + 215, 2k = -3k + a + 366. Let c = 123 - k. Calculate the remainder when c is divided by 16. 2 Suppose 2b - 2057 = 33m - 34m, 2b + 2m - 2060 = 0. What is the remainder when b is divided by 115? 107 Let c = 6760 + -6711. Let u(s) = -3s - 7. Let a be u(-6). Let o = a + 6. What is the remainder when c is divided by o? 15 Suppose -232s = -406459 + 130843. Calculate the remainder when s is divided by 293. 16 Suppose 23t - 10t = 195. Let n(h) = -h*3 + 18h*2 + h + 31. What is the remainder when n(18) is divided by t? 4 Suppose -1378d + 694d = -691d + 7483. Calculate the remainder when d is divided by 17. 15 Suppose 0 = 3f + 5p - 20, 10f - 5f + 4p = 16. Suppose 4l - 4 = f, -l + 83 = 2s + 2l. What is the remainder when 111 is divided by s? 31 Let h be (-1(3 + (-6 - -3)))/1. Suppose -3m + 194 + 199 = h. Calculate the remainder when m is divided by 34. 29 Suppose -4o - 9z = -13z - 7808, z = -4o + 7788. Calculate the remainder when o is divided by 50. 48 Let u = 224 - 227. What is the remainder when u + 3 + 622 is divided by 14? 12 Let p = -548 - -704. Let g = 196 - p. What is the remainder when (-4)/(4/(-159)) - 2 is divided by g? 37 Suppose 14t - 18757 = 23537. What is the remainder when t is divided by 12? 9 Let a(j) = j*3 - 20j*2 + 16j + 19. Let c be a(20). Let u = -197 + c. What is the remainder when u is divided by 36? 34 Let o = 5907 + -4133. Calculate the remainder when o is divided by 16. 14 Suppose 31 = 7a + 3. Let f(w) be the second derivative of w5/10 - 7w*4/12 - 2w*3/3 + 9w*2/2 - 24w. Calculate the remainder when 17 is divided by f(a). 8 Let x(y) = -y*3 + 18y*2 - 31y + 247. Calculate the remainder when (-4)/(-14) - (813/(-21) - -5) is divided by x(17). 7 Suppose -60 = 17l - 22l. Suppose -467y - 7800 = -506y. What is the remainder when y is divided by l? 8 Let r be ((-120)/14)/((-3)/28). Suppose r = w - 40. Calculate the remainder when w is divided by 11. 10 Suppose -10b = -7b - 201. What is the remainder when (996/15)/((-2 - (-155)/75)3) is divided by b? 64 Suppose u + l = -12, 7l = 4u + 5l + 18. Let s(d) = 2d + 36. Let y(q) = q3 + 5q*2 - 9q - 12. Calculate the remainder when s(u) is divided by y(-6). 4 Suppose 12v + 236 - 995 = -11v. Calculate the remainder when 1599 is divided by v. 15 Let f = 12269 + -12186. What is the remainder when f is divided by 18? 11 Suppose -346p - 12 = -352p. Suppose 2d = -pd + 60. Suppose 15 = 4c - 3t - 14, 2t + 38 = 5c. What is the remainder when d is divided by c? 7 Let x(w) = -63w - 36. Let b = -486 + 485. What is the remainder when x(b) is divided by 6? 3 Let i(a) = 60a - 1457. Suppose 0 = 5d + 5, -3o + 2d - 10 = -57. What is the remainder when i(26) is divided by o? 13 Suppose t - 16 = -4. Let s be 10(-3)/t. What is the remainder when 6 is divided by 3 + 1 + s - 1? 0 Suppose 3s - 5h = -8h + 9, 0 = 3s + 5h - 9. What is the remainder when ((-59)/2)/(7/(-84)s) is divided by 11? 8 Let d(i) = i2 - 10i + 7. What is the remainder when ((-1980)/8)/(-5)6/9 is divided by d(10)? 5 Let d(i) = 3i*2 + 4i + 2. Let b(k) = 5k2 + 9k + 5. Let p(w) = -4b(w) + 9d(w). What is the remainder when 168 is divided by p(2)? 12 Let x(o) = -o*3 - 20o*2 + 33o + 36. Let r be x(-21). Let c = r - -282. Calculate the remainder when c is divided by 6. 0 Let v = -546 - -546. Suppose v = -14c + 17c - 102. What is the remainder when c is divided by 6? 4 Let z(n) = 21n - 54. Let i be z(10). Suppose s - 9 = 4v - i, -182 = -5v + 3s. What is the remainder when 182 is divided by v? 34 Suppose -10d + 185 + 15 = 0. Suppose du - 95 - 525 = 0. Let j = -12 + 20. What is the remainder when u is divided by j? 7 Let d(v) = -2v3 + 10v*2 + 17v - 2. What is the remainder when d(-6) is divided by 69? 67 Suppose -3x + 238 = -338. Calculate the remainder when 9/(-6)x/9-2 is divided by 23. 18 Suppose 0 = 5l - 0l - 145. What is the remainder when l is divided by 9/((-45)/(-68)) + (-12)/20? 3 Let a = 48 - 8. Let s = a + -29. Suppose 68q = 4q + 1152. What is the remainder when q is divided by s? 7 Calculate the remainder when 3596 is divided by ((-1)/(-2))/(35/490) + 7. 12 Let d(f) = -293f - 4079. Calculate the remainder when d(-29) is divided by 85. 83 Calculate the remainder when (310/(-9))/((-36)/162) is divided by (-5)/2896/(-70). 27 Suppose 4n + 3y - 400 = 3n, 5n + 2y - 2052 = 0. Let t = n - 217. Let g = 296 - t. Calculate the remainder when g is divided by 17. 16 What is the remainder when 819 is divided by 4/(-6) - 3185/(-39)? 9 Suppose 44a - 12 = 40a, -2259 = -4c - a. Calculate the remainder when c is divided by 269. 26 Suppose -55 = -3q + 44. Let f be (-10 + (-1134)/(-112))81. Calculate the remainder when ((-5)/15f)/((-2)/582) is divided by q. 31 Calculate the remainder when 1294 is divided by 892/669(-1 + 13). 14 Suppose 5c = 2q + 470, 22c + 271 = 25c + q. What is the remainder when 108 is divided by c? 16 Suppose -6599 = 15x + 1846. Let j = 588 + x. Calculate the remainder when 597 is divided by j. 22 Let w = 353 + -207. Let n = w + -113. What is the remainder when 190 is divided by n? 25 Suppose 1513 = 4n - 1879. What is the remainder when n is divided by 2? 0 Let s(g) = g*2 - 11. Let v be s(-4). Suppose -3m = -0u + 3u + 27, -u - 21 = -vm. Let w = u + 27. What is the remainder when w is divided by 9? 7 Suppose 3u + 2 = 2. What is the remainder when 32 is divided by 1 + u + -4 + 3 + 4? 0 What is the remainder when 277 is divided by 32/14 - (-14650)/175? 19 What is the remainder when 23 is divided by (1/(-6) - (-1105)/510) + 7? 5 Let q be ((-2684 - 4)/(-4) + -4)/2. Let l = 166 - 99. Let n = q - l. Calculate the remainder when n is divided by 54. 51 Suppose 15f = 14263 + 23781 + 446. What is the remainder when f is divided by 5? 1 Let n(g) = 2g + 199. What is the remainder when n(-16) is divided by (22 - -2) + (8 - 13)? 15 Let f = 103 + -99. Calculate the remainder when 28 is divided by (-6)/(-2) + 8/f. 3 Let p(r) = -138r + 2128. What is the remainder when 847 is divided by p(13)? 179 Suppose 50 = 12a + 62. Suppose 0 = 5p - 133 - 102. What is the remainder when p is divided by ((-60)/(-210))/(a/(-56))? 15 Let h = -41714 + 41800. Suppose 5z - 46 = -2j, -4j + 4z = -0j - 64. What is the remainder when h is divided by j? 14 Let p = 19 - 5. What is the remainder when (2 - 1148/(-98))7 is divided by p? 12 Let l = -343 - -356. Suppose 0 = -lj + 12j + 30. Let o = -8 + 18. Calculate the remainder when j is divided by o. 0 Suppose 5v = 5w + 60, 0 = -w + 6w + 10. Suppose 0 = -vd - 13d + 2277. What is the remainder when d is divided by 15? 9 Let s be ((-4495)/(-93))/((-10)/(-12)). Let u = s + -38. What is the remainder when 115 is divided by u? 15 Suppose 736 - 176 = 2m + t, -3m - 2t = -839. What is the remainder when m + (-14 - -8 - (-2 - 1)) is divided by 31? 30 Let p(z) = z3 + 27z*2 - 38z - 273. Let h(i) = i*3 + 10i*2 + 5i + 13. What is the remainder when h(-9) is divided by p(-28)? 0 Let t(f) = 5f2 - 18f + 3. Let r be t(4). Let w(b) = -b + 10. Let d be w(r). Calculate the remainder when (46 + -7)d/(-3) is divided by 5. 3 Let u = 26423 - 24914. Calculate the remainder when u is divided by 36. 33 Let u = 438 + -615. Let t = -103 - u. What is the remainder when t is divided by 13? 9 Let p(s) = 4s - 17s - 4s + 83 + 13. Calculate the remainder when p(0) is divided by 49. 47 Calculate the remainder when 29/203-7 + -1 + 3381 is divided by 308. 299 Let h(l) be the first derivative of -2l*2 + 37l + 37. What is the remainder when 48 is divided by h(8)? 3 Suppose 10g = 12g + 2o - 230, -4o = -2g + 206. Suppose 0 = -14j + g + 463. Calculate the remainder when j is divided by 38. 3 Let m = 209 + -209. S	{ "pile_set_name": "DM Mathematics" }
t from {m: 4, u: 1, a: 1, h: 1, i: 4}. 0 Three letters picked without replacement from wllljlj. Give prob of picking 3 j. 0 Calculate prob of picking 1 l, 2 m, and 1 a when four letters picked without replacement from {m: 2, l: 4, a: 1, o: 1}. 2/35 What is prob of picking 3 t when three letters picked without replacement from rtrtrt? 1/20 Two letters picked without replacement from npwul. Give prob of picking 1 p and 1 u. 1/10 What is prob of picking 2 b, 1 r, and 1 o when four letters picked without replacement from {o: 2, r: 6, g: 3, b: 3, c: 3}? 9/595 Two letters picked without replacement from {k: 6, x: 4, i: 3, m: 3, y: 1, v: 1}. Give prob of picking 1 i and 1 v. 1/51 Two letters picked without replacement from uuxuxxxuuuuuux. What is prob of picking 2 u? 36/91 Calculate prob of picking 1 c and 1 a when two letters picked without replacement from aaaccaaaa. 7/18 What is prob of picking 1 h, 1 g, and 1 w when three letters picked without replacement from gghgwgqhq? 2/21 Two letters picked without replacement from qmhohooooqoqhf. What is prob of picking 1 f and 1 o? 6/91 Two letters picked without replacement from xpppxx. Give prob of picking 1 x and 1 p. 3/5 Four letters picked without replacement from alhfhfahaallahhahl. Give prob of picking 1 f, 2 h, and 1 l. 2/51 Calculate prob of picking 2 o when two letters picked without replacement from {o: 8, s: 3, f: 7, x: 2}. 14/95 What is prob of picking 1 c, 1 y, and 1 d when three letters picked without replacement from ddydddddddddddddcdd? 1/57 Three letters picked without replacement from {x: 5, v: 2, l: 2, c: 1, u: 4}. What is prob of picking 3 v? 0 What is prob of picking 2 v when two letters picked without replacement from {q: 2, z: 3, x: 2, c: 6, v: 1, j: 1}? 0 Two letters picked without replacement from gfffgffg. Give prob of picking 2 f. 5/14 Four letters picked without replacement from xxpxpxpx. What is prob of picking 2 x and 2 p? 3/7 Calculate prob of picking 2 n when two letters picked without replacement from {n: 4, a: 7}. 6/55 What is prob of picking 1 j and 2 i when three letters picked without replacement from ijidnwe? 1/35 Two letters picked without replacement from mmlmpmmokl. Give prob of picking 1 l and 1 k. 2/45 Two letters picked without replacement from uququuuuu. What is prob of picking 2 q? 1/36 Two letters picked without replacement from {r: 2, e: 3}. What is prob of picking 2 r? 1/10 Three letters picked without replacement from fqqzq. What is prob of picking 1 f and 2 q? 3/10 What is prob of picking 2 j and 1 t when three letters picked without replacement from {t: 3, j: 8}? 28/55 What is prob of picking 1 o and 1 p when two letters picked without replacement from {m: 4, p: 2, r: 5, o: 2}? 2/39 Three letters picked without replacement from qfffq. Give prob of picking 2 f and 1 q. 3/5 Three letters picked without replacement from djlljthljeeljje. What is prob of picking 2 e and 1 l? 12/455 Four letters picked without replacement from {b: 4, d: 1, n: 3}. What is prob of picking 2 b and 2 n? 9/35 Two letters picked without replacement from {e: 3, t: 1, i: 3, v: 1, f: 2, h: 2}. What is prob of picking 1 f and 1 e? 1/11 What is prob of picking 2 u and 2 a when four letters picked without replacement from auaua? 3/5 Calculate prob of picking 1 u, 1 p, and 1 h when three letters picked without replacement from oguhepo. 1/35 Four letters picked without replacement from {r: 3, x: 5, n: 2, f: 3, d: 3, k: 3}. Give prob of picking 3 f and 1 k. 1/1292 What is prob of picking 3 h when three letters picked without replacement from hcchhhchccccc? 5/143 Two letters picked without replacement from mfogafmmglfm. Give prob of picking 1 g and 1 m. 4/33 What is prob of picking 1 l and 1 d when two letters picked without replacement from vdwwrvlvllrv? 1/22 What is prob of picking 2 h and 2 u when four letters picked without replacement from {h: 4, f: 5, u: 7}? 9/130 Four letters picked without replacement from xkxxdfxxlxlgxxdlkkfx. What is prob of picking 1 f, 1 x, 1 l, and 1 k? 54/1615 What is prob of picking 2 s and 1 j when three letters picked without replacement from jbbsbpbsb? 1/84 Two letters picked without replacement from sxzjk. What is prob of picking 1 z and 1 x? 1/10 Calculate prob of picking 2 p and 2 z when four letters picked without replacement from ppnzzppnznpnpnpnwpnw. 28/1615 Two letters picked without replacement from {r: 5, o: 3}. What is prob of picking 2 o? 3/28 Calculate prob of picking 1 q and 2 o when three letters picked without replacement from ooqooooqoqooooo. 198/455 Calculate prob of picking 1 i and 3 b when four letters picked without replacement from zningbbbzzizzbzgiziz. 16/4845 What is prob of picking 4 s when four letters picked without replacement from {s: 12, w: 6}? 11/68 Three letters picked without replacement from {j: 7, q: 1}. Give prob of picking 1 q and 2 j. 3/8 Calculate prob of picking 3 o when three letters picked without replacement from eooooooooooeo. 15/26 Two letters picked without replacement from llhsxllhlhxhfmlhl. What is prob of picking 1 h and 1 l? 35/136 Four letters picked without replacement from zzzzzxxzhhhzzhzzozzx. Give prob of picking 2 z and 2 x. 66/1615 Calculate prob of picking 1 v and 1 f when two letters picked without replacement from pfvmjpgf. 1/14 Three letters picked without replacement from yxwwwwwwwwwwyxcwwww. Give prob of picking 2 y and 1 c. 1/969 Calculate prob of picking 2 d and 1 i when three letters picked without replacement from diyydyii. 3/56 Two letters picked without replacement from {c: 1, q: 3, i: 1, f: 3, a: 2, t: 2}. Give prob of picking 1 i and 1 f. 1/22 Two letters picked without replacement from {j: 3, r: 10, b: 5, e: 2}. What is prob of picking 2 j? 3/190 What is prob of picking 1 g and 1 w when two letters picked without replacement from ggooggoigowo? 5/66 Calculate prob of picking 1 b, 1 n, and 2 q when four letters picked without replacement from hnqnqnnxnnqxbxnnen. 3/340 Calculate prob of picking 1 w, 1 l, and 1 g when three letters picked without replacement from {v: 1, w: 1, g: 9, l: 5, j: 1}. 9/136 Calculate prob of picking 1 b and 1 r when two letters picked without replacement from {q: 1, v: 2, b: 2, m: 1, t: 2, r: 1}. 1/18 Three letters picked without replacement from {x: 6, k: 2}. What is prob of picking 1 x and 2 k? 3/28 What is prob of picking 1 q and 1 p when two letters picked without replacement from {p: 3, q: 1, a: 1}? 3/10 What is prob of picking 1 e and 1 v when two letters picked without replacement from {o: 1, h: 2, d: 7, e: 4, v: 4}? 16/153 Two letters picked without replacement from {t: 1, a: 3}. What is prob of picking 1 t and 1 a? 1/2 What is prob of picking 2 o and 2 f when four letters picked without replacement from ofsolfsfasf? 1/55 What is prob of picking 2 n when two letters picked without replacement from {i: 5, n: 3}? 3/28 Two letters picked without replacement from lkldk. What is prob of picking 1 k and 1 l? 2/5 Two letters picked without replacement from {l: 2, c: 2}. Give prob of picking 2 l. 1/6 Two letters picked without replacement from {r: 2, e: 1, w: 6, v: 2, h: 3, x: 4}. What is prob of picking 2 v? 1/153 What is prob of picking 1 i, 1 v, and 1 h when three letters picked without replacement from hiivihhhhhhvih? 16/91 What is prob of picking 1 p and 2 w when three letters picked without replacement from wpww? 3/4 Calculate prob of picking 1 a and 2 w when three letters picked without replacement from {w: 4, a: 3}. 18/35 Two letters picked without replacement from {m: 5, k: 2, a: 4, l: 2}. What is prob of picking 1 l and 1 m? 5/39 Calculate prob of picking 2 l, 1 r, and 1 f when four letters picked without replacement from kffrffklklflfkllklk. 15/646 Three letters picked without replacement from hhqhqqqqqhqqqqhqqh. What is prob of picking 2 q and 1 h? 33/68 What is prob of picking 1 o and 2 t when three letters picked without replacement from thohohuttttho? 15/143 Two letters picked without replacement from {d: 2, f: 3, l: 4, g: 1}. Give prob of picking 1 f and 1 l. 4/15 What is prob of picking 1 p and 1 r when two letters picked without replacement from {r: 3, p: 2}? 3/5 What is prob of picking 2 x when two letters picked without replacement from xvxv	{ "pile_set_name": "DM Mathematics" }
be the second derivative of v(h). Give c(g(i)). -9i4 Let u(t) = 43t - 8. Let r(g) = -14g + 3. Let n(y) = 8r(y) + 3u(y). Let o(m) = 2m*2. Determine o(n(i)). 578i*2 Let n(c) = -c + 14. Let d be n(12). Let a(b) = 15 - 15 + db2. Let v(w) = -w2. What is v(a(f))? -4f4 Let s(q) be the second derivative of 0 - q + 0q*2 + 1/3q*3. Let k(w) = -2w. Give k(s(g)). -4g Let s be (-1)/(-6) + (-11)/(-6). Let a(m) = sm*2 - 10m*2 + 4m2. Let j(z) be the second derivative of -z3/3 - 6z. What is j(a(p))? 8p*2 Let m(t) = 10t*2. Let c(x) = -2110x*2. Determine c(m(r)). -211000r*4 Let a(h) = -2h + 117. Let i(q) = q. What is a(i(g))? -2g + 117 Let y(p) = -p2. Let i(l) = 18 - 9 - 6 + 15l. Give y(i(g)). -225g2 - 90g - 9 Let w(u) = -u2. Let a(k) be the second derivative of -k3/3 + 2k. Determine a(w(g)). 2g*2 Let b(l) = -3l. Let n(i) = 10404i2. Calculate b(n(k)). -31212k*2 Let p(l) = 1. Suppose t = -t + 2. Let x(u) = -8u - 1. Let r(m) = tp(m) + x(m). Let w(k) = -23k. Let o(i) = -17r(i) + 6w(i). Let z(c) = c*2. Give z(o(d)). 4d2 Let h(w) be the third derivative of w5/60 + 12w2. Let q(v) = 10v - 7. Let r(b) = -3b + 2. Let k(z) = -4q(z) - 14r(z). Calculate h(k(s)). 4s*2 Let a(b) = 3b*2. Let v(s) = -3s*2 - 2s*2 + 4s*2 + 2s*2. Calculate a(v(j)). 3j*4 Let c(n) = 40n*2 + 3n. Let o(f) = 3f. Give c(o(z)). 360z*2 + 9z Let m(y) be the first derivative of 4y2 + 14. Let q(a) = -5a*2. Determine m(q(z)). -40z*2 Let g(k) = k - 2. Let h be g(3). Let r(d) = -1 - d + h. Let x(w) = -4w + w*2 + 11w - 7w. Calculate r(x(n)). -n2 Let o(t) = 118t. Let d(h) = 3h. Give d(o(a)). 354a Let r(i) = -2i2. Let x(v) be the second derivative of -v3/6 + 7v. Give x(r(c)). 2c2 Let d = -1 + 3. Let g(w) = -5w2 + w2 + 3wd. Let k(z) be the third derivative of z5/30 + 2z*2. What is k(g(h))? 2h*4 Let t(v) = 219v*2. Let s(h) = -4h. Determine t(s(q)). 3504q2 Let p(x) = 229x*2 - 5x + 2. Let h(m) = 2m. What is p(h(d))? 916d*2 - 10d + 2 Let m(o) = 15o. Let r(i) = 14i. Let l(a) = -2m(a) + 3r(a). Let h(b) = -2b. What is h(l(y))? -24y Let n(m) = -3m. Let l(u) = -91u*2 + 15u + 1. Give l(n(q)). -819q2 - 45q + 1 Let v(x) = -2x2. Let q = -121 + 969/8. Let y(d) be the third derivative of 2d*2 + qd*4 + 0d + 0d3 + 0. Determine y(v(s)). -6s*2 Let q(t) = 6t*2. Let d(c) = 28c*2. Calculate d(q(m)). 1008m*4 Let v(r) = -4r*2 + 4r - 4. Let x(g) = 5g2 - 3g + 3. Let u(b) = 6v(b) + 8x(b). Let o(f) = -f*2. Give o(u(p)). -256p*4 Let p(h) = h. Let k(d) be the second derivative of -7d*3/6 + 2d. What is p(k(n))? -7n Let s(k) = 9k2. Let a(x) be the first derivative of x2/2 + 12. Determine a(s(t)). 9t2 Let j(l) = -8l*2. Let m(r) be the first derivative of 2r*3/3 + 18. Determine m(j(i)). 128i4 Let s(a) be the third derivative of a5/15 - 9a2. Let k(j) = 3j. Determine s(k(u)). 36u2 Let v(q) = q + 2. Let x(p) = -4p - 7. Let d be ((4 + -6)2)/2. Let h(s) = dx(s) - 7v(s). Let y(m) = -5m + 2 - 2. Give h(y(a)). -5a Let t(y) = -2y + y - 5y + 0y. Let j(i) = 2i2. Give t(j(z)). -12z*2 Let i(k) = -8k. Let j(m) = 7m. Let w(g) = 2i(g) + 3j(g). Let x(q) be the first derivative of -q2/2 + 2. Give w(x(d)). -5d Let q(b) = -b. Let l(d) = 301d. Determine l(q(k)). -301k Let n(j) = -j*2. Let g(o) = -46o*2 + 18. Give g(n(a)). -46a*4 + 18 Let a(h) = -100h*2 - 2h. Let r(s) = -48s2. Calculate a(r(x)). -230400x*4 + 96x*2 Let x(a) = -2a - 5a + 5a. Let o(n) = 12 + 6n2 - 12. What is x(o(c))? -12c2 Let b(v) be the third derivative of -v8/20160 - v*5/20 - 2v*2. Let r(k) be the third derivative of b(k). Let i(m) = 4m. Calculate r(i(f)). -16f2 Let u(c) = 2c*2 - 38c. Let b(s) = 4s. What is u(b(m))? 32m*2 - 152m Let y(z) = -7z. Let g(t) = -16t*2 - 8t. Give g(y(f)). -784f2 + 56f Let r(k) = -5k. Let j(g) = -179g - 1. Calculate r(j(s)). 895s + 5 Let x(d) = 2d*2. Let s(l) be the first derivative of -3l*2/2 - 4. What is s(x(w))? -6w2 Let h(c) = c2. Let z(v) = 3. Let f(x) = -x*2 - 1. Let w be (4 - (0 + 2)) + 1. Suppose -12 = -3q - w. Let o(i) = qf(i) + z(i). Determine h(o(p)). 9p*4 Let t(m) = 91 - 91 + 4m. Let a be (1/(-1))/(5/(-10)). Let v(y) = -a + 2 + y*2. Determine v(t(i)). 16i*2 Let y(v) = -23v + 1. Let k(s) = -5s2. Calculate y(k(n)). 115n*2 + 1 Let p(i) = -2i*2 + 13. Let j(y) = -4y - 3. Let n(k) = -3k - 2. Let w(d) = -2j(d) + 3n(d). Calculate p(w(q)). -2q2 + 13 Let d(q) = -q3 - 7q2 + 7q - 6. Let o be d(-8). Let y(m) = m*o - 4m2 + m2 + 5m2. Let t(z) = -4z + 0z + 5z. What is t(y(s))? 3s2 Let y(s) = -s. Let z(k) = 7k - 1. Let o(l) = 3y(l) - z(l). Let n(t) = -2t. What is n(o(a))? 20a - 2 Let c(m) = 5m - 20m + 15m + 3m2. Let h(g) = 3g. Determine c(h(u)). 27u2 Let b(y) = 9y*2 + 5. Let g(u) = -13u*2 - 7. Let s(r) = 7b(r) + 5g(r). Let x(z) be the first derivative of -z2/2 - 5. Calculate x(s(f)). 2f2 Let l(f) = -f2. Let c(k) = -k + 9. Let p be c(5). Let n(s) be the first derivative of -s*3 + p + 0 - 1. Give l(n(y)). -9y4 Let n(g) be the third derivative of -g5/20 + g2. Let a(x) be the third derivative of x4/4 + x*2 - 3x. Give n(a(u)). -108u2 Let w(b) = b. Let k(z) = -4z*2 + 3. Let y(v) = -9v*2 + 7. Let a(d) = -7k(d) + 3y(d). Determine w(a(h)). h2 Let y(t) be the third derivative of t4/12 + 2t*2. Let a(x) = 7x - 5. Let o(b) = -4b + 3. Let r = -4 + 9. Let m(c) = ro(c) + 3a(c). Determine y(m(d)). 2d Let o be 187 - (-3 - (1 + -6)). Let m(t) = t*2 + 185t - ot. Let i(l) = 7l*2. What is i(m(x))? 7x4 Let c(q) = -q2. Let x(j) = 6j. Let r(m) = m. Let k(a) = 11r(a) - 2x(a). Determine c(k(l)). -l2 Let z(n) = 2n. Let p(f) be the third derivative of -f7/360 - f4/6 - f*2. Let w(o) be the second derivative of p(o). Give w(z(i)). -28i*2 Let n(b) be the third derivative of -3b*4/4 + 2b*2. Let g(p) = p. Determine n(g(h)). -18h Let h(l) = l - 1. Let w(f) = 8f - 10. Let s(m) = -1. Let o(j) = 4s(j) - w(j). Let n(y) = -6h(y) - o(y). Let a(k) = -4k. Calculate n(a(i)). -8i Let p(w) = -w2. Let b(x) = -x2 - x + 1. Let i(z) = 2z - 2. Let m(j) = -4b(j) - 2i(j). Calculate p(m(s)). -16s4 Let v(c) = c2. Let i(s) = -2254s. Calculate i(v(x)). -2254x2 Let j(n) = -n2. Suppose 0 = -3w + 64 + 17. Suppose -4x = -45 - w. Let b(d) = 3d*2 + x - 18. What is j(b(l))? -9l*4 Let s(w) = 2w*2 + 6w*2 - 3w*2. Let y(t) = 3t + t - t. Determine y(s(r)). 15r2 Let x(j) = j2 + 25j. Let s(y) = -2y2 - 2. Let q(b) = -4b*2 - 5. Let m(g) = -2q(g) + 5s(g). Determine x(m(f)). 4f*4 - 50f*2 Let v(i) = -261i*2. Let z(l) = l. Calculate v(z(o)). -261o*2 Let u(s) = -45s*2. Let n(f) = 33f*2 + 1. What is n(u(o))? 66825o*4 + 1 Let l(a) = 119a + 34. Let g(b) = 17b + 5. Suppose -o = -2x - 63, 4x - 12 + 123 = 5o. Let t(i) = xg(i) + 5l(i). Let p(f) = -2f. What is t(p(h))? -34h Let u(w) = -2w2. Let o(x) be the second derivative of x6/360 - x3/2 - x. Let s(z) be the second derivative of o(z). What is s(u(f))? 4f*4 Let b(s) = 23s2 - s. Let r(f) = -f2. Calculate b(r(m)). 23m4 + m2 Let b(a) = -2a. Let u(l) = -2l2 + 98l. Determine b(u(n)). 4n2 - 196n Let r(t) = -10t2. Let q(c) = 0c*2 + 5 + 7c2 - c2 - 5c. Let v(a) = 7a*2 - 6a + 6. Let m(y) = 6q(y) - 5v(y). What is m(r(z))? 100z4 Let r(w) = 4 + 5w*2 + 0w*2 + 2w + 2w - 2w2. Let v(f) = -f2 - f - 1. Let h(p) = r(p) + 4v(p). Let m(l) = 4l. What is m(h(b))? -4b2 Let b(h) = -h2. Let z = 66 - 66. Let k(m) be the third derivative of -1/24m*4 + 2m*2 + 0m*3 + 0 + zm. Determine b(k(q)). -q2 Let k(n) be the second derivative of -n4/4 - 6n. Suppose 0 = 4r - 17 + 5. Let j(m) = -2m + 0m + rm. Give j(k(u)). -3u*2 Let s(t) = 3t*2. Let j(d) = 25d*2 - 12d. Let g(o) = 26o2 - 14o. Let c(a) = -6g(a) + 7j(a). Calculate c(s(b)). 171b4 Let q(u) = -u. Let d(t) be the second derivative of 1/3t*3 + t + 0t*2 + 0. Determine q(d(b)). -2b Let p(v) = -7v. Let m(n) = -n. Suppose -5i - 15 = 0, -2i = -4d + i - 15. Let l(k) = d*m(k) + p(k). Let g(y)	{ "pile_set_name": "DM Mathematics" }
6:06 PM? 9:02 PM What is 610 minutes after 3:12 PM? 1:22 AM What is 96 minutes before 3:08 PM? 1:32 PM What is 42 minutes after 5:04 PM? 5:46 PM How many minutes are there between 5:03 PM and 11:51 PM? 408 How many minutes are there between 2:16 PM and 8:42 PM? 386 How many minutes are there between 4:15 AM and 5:52 AM? 97 How many minutes are there between 1:19 PM and 6:39 PM? 320 How many minutes are there between 11:44 AM and 11:00 PM? 676 How many minutes are there between 11:35 AM and 1:25 PM? 110 What is 591 minutes after 9:18 AM? 7:09 PM What is 558 minutes before 7:21 AM? 10:03 PM How many minutes are there between 6:44 AM and 8:27 AM? 103 What is 317 minutes before 8:47 AM? 3:30 AM What is 424 minutes after 8:54 AM? 3:58 PM What is 508 minutes after 3:07 AM? 11:35 AM How many minutes are there between 4:41 AM and 5:57 AM? 76 How many minutes are there between 3:00 PM and 2:29 AM? 689 How many minutes are there between 1:16 PM and 11:04 PM? 588 How many minutes are there between 3:18 AM and 9:18 AM? 360 How many minutes are there between 2:26 AM and 4:16 AM? 110 How many minutes are there between 4:57 PM and 9:34 PM? 277 How many minutes are there between 4:50 AM and 10:03 AM? 313 What is 687 minutes before 3:07 PM? 3:40 AM How many minutes are there between 1:00 PM and 7:07 PM? 367 How many minutes are there between 10:51 PM and 7:04 AM? 493 What is 491 minutes before 5:49 PM? 9:38 AM How many minutes are there between 1:32 AM and 4:55 AM? 203 How many minutes are there between 12:54 AM and 5:07 AM? 253 What is 160 minutes after 7:50 PM? 10:30 PM What is 246 minutes after 2:33 AM? 6:39 AM What is 325 minutes before 3:15 PM? 9:50 AM What is 481 minutes before 9:50 AM? 1:49 AM How many minutes are there between 10:49 PM and 12:36 AM? 107 How many minutes are there between 7:35 AM and 12:30 PM? 295 What is 528 minutes before 2:57 PM? 6:09 AM How many minutes are there between 4:58 PM and 10:40 PM? 342 What is 631 minutes after 8:06 AM? 6:37 PM What is 302 minutes after 11:23 AM? 4:25 PM What is 691 minutes after 9:45 PM? 9:16 AM How many minutes are there between 7:35 PM and 8:26 PM? 51 What is 573 minutes after 1:31 AM? 11:04 AM How many minutes are there between 6:33 AM and 7:29 AM? 56 How many minutes are there between 12:22 PM and 7:10 PM? 408 How many minutes are there between 2:55 PM and 3:43 PM? 48 What is 660 minutes after 12:53 AM? 11:53 AM What is 14 minutes before 4:28 PM? 4:14 PM What is 705 minutes after 10:28 PM? 10:13 AM What is 549 minutes before 8:39 AM? 11:30 PM How many minutes are there between 10:41 AM and 7:57 PM? 556 How many minutes are there between 5:29 AM and 9:20 AM? 231 What is 59 minutes after 10:36 PM? 11:35 PM What is 699 minutes before 12:14 AM? 12:35 PM How many minutes are there between 12:18 PM and 12:07 AM? 709 What is 543 minutes before 8:55 PM? 11:52 AM What is 235 minutes before 3:43 PM? 11:48 AM How many minutes are there between 11:07 AM and 9:30 PM? 623 What is 304 minutes before 7:08 PM? 2:04 PM What is 136 minutes before 10:40 AM? 8:24 AM How many minutes are there between 8:53 PM and 4:45 AM? 472 What is 445 minutes before 10:05 PM? 2:40 PM What is 655 minutes before 11:43 PM? 12:48 PM How many minutes are there between 8:48 PM and 5:43 AM? 535 What is 546 minutes after 9:00 PM? 6:06 AM What is 539 minutes before 1:05 AM? 4:06 PM What is 501 minutes after 7:43 PM? 4:04 AM How many minutes are there between 8:56 PM and 10:25 PM? 89 How many minutes are there between 12:27 PM and 4:22 PM? 235 What is 209 minutes after 8:57 AM? 12:26 PM How many minutes are there between 3:09 AM and 2:42 PM? 693 What is 293 minutes before 8:23 PM? 3:30 PM How many minutes are there between 1:43 PM and 4:19 PM? 156 How many minutes are there between 8:34 PM and 10:17 PM? 103 How many minutes are there between 8:21 PM and 8:10 AM? 709 What is 685 minutes before 4:44 PM? 5:19 AM How many minutes are there between 2:30 PM and 1:48 AM? 678 What is 691 minutes after 11:30 PM? 11:01 AM What is 324 minutes before 10:04 AM? 4:40 AM How many minutes are there between 1:10 AM and 2:10 AM? 60 How many minutes are there between 10:04 PM and 7:48 AM? 584 What is 616 minutes after 7:18 AM? 5:34 PM How many minutes are there between 7:12 PM and 9:44 PM? 152 What is 304 minutes after 5:21 AM? 10:25 AM How many minutes are there between 6:41 PM and 8:23 PM? 102 What is 53 minutes after 12:41 PM? 1:34 PM How many minutes are there between 2:05 AM and 1:33 PM? 688 What is 528 minutes after 9:51 AM? 6:39 PM What is 154 minutes before 4:40 AM? 2:06 AM How many minutes are there between 6:12 AM and 5:58 PM? 706 How many minutes are there between 9:46 AM and 2:20 PM? 274 What is 9 minutes before 12:07 AM? 11:58 PM What is 454 minutes after 4:30 AM? 12:04 PM What is 371 minutes before 3:03 PM? 8:52 AM How many minutes are there between 4:31 PM and 3:47 AM? 676 What is 715 minutes after 12:30 AM? 12:25 PM What is 597 minutes before 10:48 AM? 12:51 AM How many minutes are there between 6:59 AM and 8:40 AM? 101 How many minutes are there between 6:16 PM and 9:53 PM? 217 How many minutes are there between 2:24 AM and 11:12 AM? 528 How many minutes are there between 5:53 PM and 6:29 PM? 36 How many minutes are there between 2:40 PM and 6:38 PM? 238 How many minutes are there between 5:15 AM and 3:45 PM? 630 How many minutes are there between 11:43 AM and 10:38 PM? 655 What is 493 minutes after 9:41 AM? 5:54 PM What is 663 minutes before 1:05 PM? 2:02 AM What is 371 minutes before 4:30 PM? 10:19 AM What is 446 minutes after 1:16 AM? 8:42 AM How many minutes are there between 12:08 PM and 5:53 PM? 345 What is 584 minutes after 5:01 AM? 2:45 PM What is 661 minutes after 10:35 AM? 9:36 PM What is 391 minutes after 9:34 PM? 4:05 AM How many minutes are there between 2:12 PM and 9:50 PM? 458 How many minutes are there between 10:06 AM and 8:18 PM? 612 What is 597 minutes after 6:08 AM? 4:05 PM What is 91 minutes before 2:27 PM? 12:56 PM What is 136 minutes after 12:30 PM? 2:46 PM How many minutes are there between 7:02 PM and 7:44 PM? 42 What is 300 minutes after 4:19 AM? 9:19 AM What is 488 minutes before 1:13 AM? 5:05 PM How many minutes are there between 12:03 PM and 12:59 PM? 56 How many minutes are there between 6:56 AM and 5:08 PM? 612 What is 582 minutes after 8:08 PM? 5:50 AM How many minutes are there between 11:01 AM and 8:14 PM? 553 How many minutes are there between 8:55 PM and 5:35 AM? 520 What is 62 minutes after 5:15 AM? 6:17 AM How many minutes are there between 9:03 PM and 7:08 AM? 605 What is 628 minutes before 7:17 AM? 8:49 PM How many minutes are there between 4:06 AM and 4:18 AM? 12 How many minutes are there between 4:22 PM and 5:38 PM? 76 How many minutes are there between 3:15 PM and 8:08 PM? 293 What is 266 minutes before 5:54 PM? 1:28 PM How many minutes are there between 1:58 AM and 3:09 AM? 71 How many minutes are there between 8:27 PM and 9:23 PM? 56 What is 141 minutes after 1:46 AM? 4:07 AM What is 132 minutes before 11:58 PM? 9:46 PM What is 88 minutes before 8:01 AM? 6:33 AM What is 418 minutes before 11:58 AM? 5:00 AM What is 609 minutes before 10:23 AM? 12:14 AM What is 576 minutes after 9:57 PM? 7:33 AM How many minutes are there between 2:03 PM and 1:21 AM? 678 How many minutes are there between 6:47 AM and 6:53 AM? 6 What is 387 minutes before 8:07 PM? 1:40 PM What is 332 minutes before 5:24 AM? 11:52 PM How many minutes are there between 12:23 PM and 5:55 PM? 332 What is 710 minutes before 5:27 AM? 5:37 PM What is 82 minutes after 4:07 PM? 5:29 PM How many minutes are there between 7:46 PM and 3:32 AM? 466 How many minutes are there between 10:07 PM and 5:53 AM? 466 What is 344 minutes after 5:06 PM? 10:50 PM What is 89 minutes before 7:44 PM? 6:15 PM How many minutes are there between 6:39 PM and 11:04 PM? 265 What is 101 minutes after 12:54 AM? 2:35 AM What is 305 minutes before 10:21 PM? 5:16 PM What is 678 minutes before 6:21 PM? 7:03 AM What is 582 minutes before 12:53 PM? 3:11 AM How many minutes are there between 6:57 PM and 9:04 PM? 127 How many minutes are there between 4:49 PM and 9:47 PM? 298 What is 120 minutes before 5:48 PM? 3:48 PM What is 59 minutes after 5:12 PM? 6:11 PM How many minute	{ "pile_set_name": "DM Mathematics" }
umber? False Is (-11 - -9)/(4/(-5794)) composite? False Let n = 10861 + -4392. Is n prime? True Is ((-2055)/9-3)/1 a composite number? True Let h = -43 - -45. Suppose 2b + hb = m + 935, -4b + 945 = m. Is b a prime number? False Is -8 - (-19275)/(6 - 1) a prime number? True Let r(a) = -113a3 - 8a*2 + 26a + 20. Suppose 2b - 2 = 10. Let l(o) = 38o*3 + 3o*2 - 9o - 7. Let g(d) = br(d) + 17l(d). Is g(-1) composite? True Let v = -30 - -33. Suppose 481 = vk - 2k. Is k a composite number? True Let w(q) = -10q - 2. Let m(a) = 41a + 9. Let v(c) = 2m(c) + 9w(c). Let t be v(-7). Is (-1)/7 - (-736)/t a prime number? True Suppose -643 = -4k - 2127. Let m = k - -928. Is m prime? True Suppose 7n - 54 = 4n. Let r(i) = 5i - 12i - 6 + 2i*2 + n. Is r(-9) prime? False Suppose 8m = 27274 + 10630. Is 8/(-36) - m/(-18) composite? False Suppose 4z = 164 - 160, 0 = 4u + z - 11333. Is u a composite number? False Let b = -129 - -127. Is 355 + 41/b prime? True Let h(l) be the second derivative of l6/15 + l5/24 + l4/12 - 5l. Let o(a) be the third derivative of h(a). Is o(6) composite? False Let g = 13 + -8. Let k(c) = 31c + 8. Is k(g) a prime number? True Suppose -3k + 18 = -0k. Suppose -2j = -k, d + 12 = 4j + 2. Suppose dx = -2x + 316. Is x a composite number? False Let s(j) = 11j*3 - 12j*2 - 13j - 8. Is s(7) composite? True Suppose 3v - 3o - 139143 = -0o, 0 = 4v + 2o - 185536. Is v composite? True Let p(o) be the first derivative of 2o*3 - 9o*2/2 + 2o + 20. Is p(9) a composite number? True Let k = -1319 + 3148. Is k composite? True Let i(t) = -509t - 89. Is i(-6) composite? True Suppose -f - 331 = z, -3z - 1192 = -f - 219. Let n = 640 + z. Is n prime? False Let r(g) = -259g + 3 - 7 + 9. Is r(-4) a prime number? False Let k be (48/72)/((-3)/((-18)/(-4))). Is (-1514)/1k4/8 composite? False Suppose -4q + 0 = 44. Let s = q - -13. Suppose 4g - 6g = -5v + 115, 0 = -v + sg + 23. Is v prime? True Suppose 5u + 3 = 13. Suppose 0 = -ua - 3k + 797, -a + 71 + 310 = -2k. Is a a composite number? True Let m = -13634 + 22095. Is m a composite number? False Is ((-336345)/34 + -4)(0 + -2) a composite number? False Suppose 219y + 113690 = 229y. Is y prime? True Let a = -17387 + 32934. Is a prime? False Let v(b) = 3b + 3. Let s be v(3). Suppose -3h - p = -0p + 3, -4h - 4p = s. Suppose -3d + 2w = -1091, -d - d + 2w + 724 = h. Is d a composite number? False Let z be (-1 + 1)/(-3) - 2 - -1135. Suppose -5j = -z - 302. Is j a composite number? True Let b be ((-3587)/(-2))/(3/6). Suppose -1 = f, 3f + b = 3k + f. Is k prime? False Is (-68933)/14535/(-1) prime? False Suppose -5h = -167 + 2. Let n = h + -28. Suppose nq - 1751 = -3i, -3i + 5q + 955 = -816. Is i a prime number? True Let x be (-54)/(-18) + 18/(-2). Is 166 + 29/x prime? True Let z = 191 + -60. Is z prime? True Suppose 15 = -5d - 115. Let r = d - -49. Let t = -8 + r. Is t a composite number? True Let r = 12 - 16. Is r((-9 - -5) + 469/(-4)) prime? False Let p = 0 + -15. Let f be 26/10 - (-9)/p. Suppose i = fl - 110, l + i + 55 = 2l. Is l prime? False Let k = -1908 + 2732. Is k/7 - (-20)/70 prime? False Let n be (12/10)/((-2)/10). Is -41/n + 8980/12 prime? False Let f be -56 - 1/(-1)1. Let y be 4/(-10) + 7953/f. Let j = y + 322. Is j composite? True Let x = 1 - -9. Suppose xr = 5r + 470. Is r a composite number? True Let z(x) be the second derivative of x7/2520 - x6/180 + x5/120 + 5x*4/12 + 2x. Let i(h) be the third derivative of z(h). Is i(5) prime? False Is (-228519)/(-6)-116/(-24) prime? True Let h = 36 - 63. Let n = h + 123. Suppose 3a - n - 375 = 0. Is a prime? True Let r(h) = 0 + 13h*2 + 2 - 2h - h*2 - 9h*2. Let k be (-3)/12 + (-13)/(-4). Is r(k) composite? False Let o = 14 + -10. Suppose -2f + 9 + 13 = 5l, -l + 26 = of. Suppose -x - fz + 209 = -z, 3x - 2z = 593. Is x a prime number? True Let z = 20016 - 9715. Is z a prime number? True Let w be (-94)/(-18) - (-9)/((-81)/2). Suppose 0z + 3762 = 3z - 3u, 4z - wu = 5011. Is z a composite number? False Suppose -5l - d - 52 = 0, 2l + 3l + 67 = 4d. Let z = l - -1. Is 372/z55/(-22) a prime number? False Let y = -29 - -29. Suppose 3z + 2w = 3897, -4w + y = -12. Is z composite? False Suppose -329w + 334w - 4u - 91499 = 0, -3u = -3w + 54900. Is w a prime number? False Let k(v) = -v3 + 5v*2 + 2v - 6. Let p = 0 - -5. Let l be k(p). Is (-5368)/(-16) + (-2)/l composite? True Suppose -406 - 131 = -5u + d, -u + 117 = -5d. Let h = -40 + u. Is h prime? True Let u be (-106626)/65(1 - 26/6). Suppose -4a + 4y + u = 0, 5a - 5105 = -y + 1706. Is a prime? False Suppose 8 = 10s - 6s. Is (0 + -613)((-8)/4)/s a composite number? False Suppose 0 = 3q - 5120 - 4507. Is q prime? True Let k = 113 - 97. Let h(b) = 6b2 - 12b - 7. Is h(k) prime? False Let f be 447/(-6)(-7 + 3). Let u = 3 - 0. Suppose 2x - f = ur - r, -5x - 4r + 745 = 0. Is x a prime number? True Let k(b) = 14b*2 + 8b + 5. Let o(t) = 15t2 + 9t + 5. Let u(d) = 4k(d) - 3o(d). Is u(8) a prime number? False Suppose 17g - 24g = -24437. Is g composite? False Let v(r) = -r*2 + r + 4. Let d be v(0). Suppose 4t + dy + 87 - 267 = 0, -3y = 4t - 181. Is t composite? True Let w be 8 + -5 + 2 - 1. Suppose -2t - 108 = -t + 4z, -wz = 4. Let a = 19 - t. Is a a composite number? True Suppose 0 = -x + 3, u = -2x - 2 + 12. Suppose -5f - 26 = -2n, -un + 3 + 13 = -f. Suppose -nk = -6k + 1011. Is k composite? False Let z(h) = 2h2 - 15h - 25. Let u be 760/56 - (-4)/(-7). Is z(u) a prime number? False Let g(m) = -3m3 - 3m*2 + 3m - 3. Let k be g(-4). Let y = k + 85. Let h = -135 + y. Is h prime? True Suppose 3j + 3 = -0, 4j + 4 = 5r. Suppose 6c + 343 + 77 = r. Let n = c + 164. Is n a composite number? True Let h be 8/(-108)402 - (-4)/(-18). Let k = 125 + h. Is k composite? True Let u(y) = 13y + 6. Let o(l) = -l + 1. Let q(h) = -4o(h) + u(h). Is q(3) a composite number? False Let v(z) = 4z - 8. Let w be 46/6 - (-3)/9. Let t be v(w). Is (-5)/5 - t/(-1) prime? True Suppose 5 - 13 = 2m. Let s(r) = 7r*2 - 3r - 15. Is s(m) composite? False Let f be -10 + 16 + (-1 - -3). Suppose -5k = -fk + 5613. Is k composite? False Suppose 3k = -v - 0v + 6947, -4k - 34697 = -5v. Is v composite? True Let i be 202473/12 + 3/(-4). Is (i/36)/(2/3) a composite number? True Let x = 17 - 31. Let r = x + 705. Is r composite? False Let d(o) be the second derivative of o4/6 + o3/2 + 3o2/2 - 9o. Let j be d(-3). Is (-14163)/(-18) - (-2)/j a prime number? True Let p be 1/((-3)/9) - -3. Suppose 5m = -2y + 2 + 12, 2m + 4y + 4 = p. Suppose 261 = 3a + 3j, -ma + 350 = 2j + j. Is a a composite number? False Suppose 46b = 56b - 207820. Is b composite? True Let o(p) = 2p + 31. Let n be o(-14). Suppose -nr + 39211 = 2r - 3k, k = -r + 7839. Is r composite? False Is 1/(2/(18483 - 5)) a composite number? False Let j(q) = -2q + 3. Let y be j(0). Suppose yv - 282 = -3x, 443 = 5v + 3x - 7x. Is v prime? False Suppose -493 = 5c + 222. Let m = 17 + 133. Let z = m - c. Is z prime? True Suppose 8l + 0l - 80 = 0. Is 8/l - 2105/(-25) a composite number? True Suppose -n = 3c - 2 + 11, -n = 5c + 15. Let i(q) = 5q*2 - 1. Let z be i(-1). Suppose zj - 480 - 4 = n. Is j a composite number? True Suppose 5a + 385 = -d, 0a = 5d - a + 1977. Let z = 662 + d. Is z a prime number? False Let z be 2/9 - (-184)/(-18). Let l(c) = -2c - 12. Let q be l(z). Suppose -2h + 761 = 3i, -3h = -h - q. Is i prime? True Let n(s) = 33s + 1080s2 + 3 - 12 - 1063s*2. Is n(8) composite? True Suppose 0 = -23v - 0v + 3611. Is v composite? False Suppose -6n + 3n + 66482 = w, 0 = 5n - 4w - 110809. Let u = -15040 + n. Is u prime? True Let x be 8/12 - 39/(-9). Is (-10 - 5)(-31)/x prime? False Is ((-5)/2)/5-6502 composite? False Is 5700/1 + (10 - 7) composite? True Let v = 646 - -48. Is v prime? False Suppose -4p + 26404 = 2f, 3p + f - 15848 = 3953. Is p a prime number? True Suppose -4r = -7r + 171. Suppose -2q + 725 = -r. Is q prime? False Suppose -3r = -3x - 15, -5x - 18 = 3r + 47. Let y(j) = -j3 - 9j*2 - 12j - 9. Is y(x) a prime number? True Let q(a) = -a*2 - 9a + 4. Sup	{ "pile_set_name": "DM Mathematics" }
1385994, 2310002 = 5o + f. Suppose -5y + o = -11y. Round y to the nearest ten thousand. -80000 Let c(o) = 23o*3 + 4o*2 + 4 - 5o - o*2 + 0o*2. Suppose 46b + 147 = -37. Let u be c(b). Round u to the nearest 1000. -1000 Let w = -7828 - -7827.991967. What is w rounded to 3 dps? -0.008 Let v be (-423 + -1)(4 + (-105)/20). Suppose 3z - 5c + v = -0c, 834 = -5z - 4c. Round z to the nearest 100. -200 Let x be (-5 + (-66)/(-12))/((-11)/(-104764)). What is x rounded to the nearest one hundred? 4800 Let z be 3787152 + 6(-3)/(-9). Let i = 812846 + z. What is i rounded to the nearest 1000000? 5000000 Let b = -771856.76361 - -772573.76. Let j = b - 717. Round j to four decimal places. -0.0036 Suppose 259f = 255f - 27960. What is f rounded to the nearest one thousand? -7000 Suppose 0a - 2 = -a. Suppose aj - 8 = 0, 4f + 4j = 5j - 20. Let i be (-4 - f) + (-15800000)/(-1). Round i to the nearest 1000000. 16000000 Let v = -31329 + 31329.0016759. Round v to 4 decimal places. 0.0017 Let d = 0.11 - -1.37. Round d to one dp. 1.5 Let t = 704.0000763 - 704. Round t to six dps. 0.000076 Let c = 49.27 - 49.272521. What is c rounded to 4 dps? -0.0025 Let o = 113.13 - -1.87. Let b = o - 239. Let p = -123.9869 - b. Round p to 3 decimal places. 0.013 Let x(m) = -3m2 + 3m + 9. Suppose -2j + 2 = 0, 23 = -4b - j - 4. Let s be x(b). What is s rounded to the nearest 10? -160 Let n be ((-440)/(-15))/4(-33)/2. Let x = -183 - n. What is x rounded to the nearest ten? -60 Let r = 0.9 + -2.9. Let f = -34 + r. Let u = 35.9999923 + f. Round u to 6 decimal places. -0.000008 Let d = 73833 - 73833.071039. Let h = -57.071 + 57. Let s = h - d. Round s to five dps. 0.00004 Let s = -53.01279 + -0.02221. Let n = s + 53. Round n to 2 dps. -0.04 Let v = -10.25 + 10.249999489. Round v to seven dps. -0.0000005 Let f = -2.79 - -241.79. Let h = 238.9532 - f. What is h rounded to two dps? -0.05 Let d(t) = t3 - 6t*2 + 4t + 5. Let h be d(5). Suppose 2j - 3j + 5l = -645, h = 4j + 2l - 2602. Suppose b = -4b - j. Round b to the nearest 100. -100 Suppose -2w - 723 = -3l - 3w, 2l = -3w + 475. Suppose 3g - l = 2n + 1444, 4g + 1672 = -2n. Round n to the nearest one hundred. -800 Suppose -3t + 323282 + 638770 = 0. Let g = -400311 - t. Let w = -370995 - g. Round w to the nearest one hundred thousand. 400000 Let y = -5501.6 - -4854. What is y rounded to the nearest 100? -600 Let v = -1534 + 1534.538. Round v to one decimal place. 0.5 Let m = -1.9046 + 1.92. Round m to two dps. 0.02 Let s be (-549012)/(6/(-2)) + 2. Suppose -3z + z - s = 3d, -5z = -4d - 243985. Round d to the nearest ten thousand. -60000 Let a = -546733 + -107265. Let m be (-25)/(-75) + a/(-6). What is m rounded to the nearest ten thousand? 110000 Suppose 9 + 7 = 2b. Let s(j) = -13j + 4. Let u be s(b). Let c be u/(0 - (-4)/2880). Round c to the nearest 10000. -70000 Let l = -0.0506022 + 0.0506. Round l to 5 dps. 0 Let k = 2927.058 - 2933. Let b = 6 + k. Let x = 0.0579906 - b. Round x to six dps. -0.000009 Let i(l) = 589l3 + l2 + 4l - 5. Let x be i(6). Let h = x - -5901. Suppose g - h = -3180. Round g to the nearest one hundred thousand. 100000 Let h = -96.2 - -35.51. Let w = 62 + h. Round w to 1 decimal place. 1.3 Let g(a) = 342a2 - 27a + 25. Let b be (228/48)/(1/(-4)). Let y be g(b). Round y to the nearest 10000. 120000 Let g = 65.85 - -1.15. Let c = -0.08558 + -67.03742. Let u = g + c. What is u rounded to 2 decimal places? -0.12 Let n = 311.36492 + -0.67492. Let j = n - 312. What is j rounded to 1 dp? -1.3 Let n = -74986 + 116786. What is n rounded to the nearest ten thousand? 40000 Let w = -89 + 128. Let f be (w/52)/(2/1680). Suppose -u + 0u + f = 0. Round u to the nearest one hundred. 600 Let n = -10.861 - 0.039. Let w = n + 10.9000069. What is w rounded to six dps? 0.000007 Let h(c) = 8289c3 - c2 - 40c + 72. Let q be h(2). What is q rounded to the nearest ten thousand? 70000 Let g = 16374.865 - 16414. Let i = -39 - g. Round i to 2 decimal places. 0.14 Let k = 107.99996298 + -108. Round k to six dps. -0.000037 Let g be (90 - -10)/(1(-1)/104300). Round g to the nearest 1000000. -10000000 Let a = 945 + -944.99039. What is a rounded to 3 dps? 0.01 Suppose -3a = -5z + 205056, 0 = -0a + a + 2. Round z to the nearest 10000. 40000 Let i = 0.28132 - 0.28. What is i rounded to 2 decimal places? 0 Let v = 0.5 - -1.5. Let r = 81 - 84.25. Let w = r + v. What is w rounded to one decimal place? -1.3 Let z = 66.655 - 67. Let b = z - -0.46. Let n = b + -0.114891. Round n to five decimal places. 0.00011 Suppose -4d + 110588 = 4b, b - 138200 = -4b + 2d. Let u = b - 46742. What is u rounded to the nearest 1000? -19000 Let l(u) = -9269u*2 + 4u - 5. Let n be l(-7). Let o = 689214 + n. Round o to the nearest 100000. 200000 Let y = -1.2 - -1.200608. Round y to four decimal places. 0.0006 Suppose 3m + 2o - 168718 = 2394, 0 = 4o + 16. Round m to the nearest one thousand. 57000 Let p = 2.764 + -0.064. Let h = -1.4 + p. Let f = h - 1.205. What is f rounded to 2 dps? 0.1 Let y(n) = -2n*3 - 23n*2 + 8n - 15. Let x be y(-16). Round x to the nearest one hundred. 2200 Let f = -20.968 - 0.032. Let x = f + 20.99962. What is x rounded to four dps? -0.0004 Let m = 10.121587 - 10.12. What is m rounded to 4 decimal places? 0.0016 Let i = 13649 + -13527.993. Let r = -0.007 + i. Let v = 98.4 - r. What is v rounded to zero dps? -23 Let u = -1.2816 + 2.367. Round u to 1 dp. 1.1 Let w = 15943.6956 - 15948. Let x = 7.2055 + w. Let i = x - 2.9. Round i to four dps. 0.0011 Suppose -3v - 21467997 = -19o + 15o, -26834997 = -5o + 3v. What is o rounded to the nearest one million? 5000000 Let m be (-26)/(-6) + -2 + (-15)/(-9). Suppose -4x - 5c = 3119995, -2c + 3119998 = -4x - mc. What is x rounded to the nearest 100000? -800000 Suppose 9w - 1371 + 3531 = 0. Round w to the nearest 100. -200 Let j = -945 - -945.001792. Round j to four decimal places. 0.0018 Let w = 0.10226 - -1211.59774. Let r = w + -1163. Let o = r - 57. Round o to the nearest integer. -8 Let l = -1090 + 1228.9. What is l rounded to the nearest 10? 140 Let b = -3.9204814 - -4.520478. Let f = -0.8 + 1.4. Let o = f - b. Round o to 6 decimal places. 0.000003 Let f = -15.2273 - -0.2173. What is f rounded to the nearest integer? -15 Let a = -0.03825 + 0.0298. Round a to 3 decimal places. -0.008 Let j(m) = -25m - 10. Let a be j(-1). Let w be (-1 + a/9)/(10/1395). Round w to the nearest 100. 100 Suppose 0 = 9v - 7v - 82200000. Round v to the nearest 1000000. 41000000 Let b = 10076727.000027 - 10076737. Let i = b - -10. Round i to 5 decimal places. 0.00003 Let n = 33.1 - 33.0887. What is n rounded to 4 dps? 0.0113 Let x be 1/10 - 31307475/(-250). Round x to the nearest 1000. 125000 Let w = -0.052 + 0.13. Let a = 0.077879 - w. Round a to 5 dps. -0.00012 Suppose 0 = -25f - 186637159 - 168112841. Round f to the nearest one million. -14000000 Let d = 4 - 14. Let s be (1600/(-6))/(d/(-3225)). What is s rounded to the nearest ten thousand? -90000 Let x = 440.6 - 277.9. Round x to the nearest ten. 160 Let u(j) = 1. Let f(h) = h2 + 5h + 10. Let c(b) = -f(b) + 6u(b). Let l be c(-4). Suppose l = -5n + 3n. Round n to the nearest 100000. 0 Let u = -7406904612364229.50000031 - -7406904548367679. Let w = u + 63996551. Let q = -0.5 + w. What is q rounded to seven decimal places? -0.0000003 Let l = 2.60301149 - 2.603. What is l rounded to 6 decimal places? 0.000011 Let a = -11920579681 + 5115902874. Let k = 6804676751.99999977 + a. Let r = k + 55. Round r to 7 dps. -0.0000002 Suppose 0 = 7l - 3l + 2f - 10000470, 5000232 = 2l - 2f. Let j = 9202815 - -3297302. Suppose j = 5a + l. What is a rounded to the nearest 1000000? 2000000 Let b = -0.16 - -1.56. Let h = 1.3999873 - b. What is h rounded to six decimal places? -0.000013 Let y = 507.8789 - 508. Round y to two dps. -0.12 Let f(h) = -207h*3 + 2h*2 + 4h - 6. Let x be f(2). What is x rounded to the nearest 100? -1600 Let u = -20 + 15. Let v = 5.17 + u. Let i = 2.37 - v. Round i to the nearest integer. 2 Let f = 1609.151543 + -1735.15154124. Let w = -126 - f. What is w rounded to seven decimal places? -0.0000018 Let y = 754553815 - 289253833. Let o = -11 + -11. Let a be y/(-9	{ "pile_set_name": "DM Mathematics" }
+ -7 + -17 + 10? -6 Calculate 2 - (0 - -15 - 3). -10 Evaluate -2 + (-2 + (4 - 0) - 1). -1 -1 - -1 - (32 + -26) - 0 -6 What is the value of -2 - -5 - (4 - 6)? 5 Evaluate 4 + (-4 - (3 - (8 - 1))). 4 Calculate -2 - (-9 - 1 - (-103 - -104)). 9 -4 + (0 + -3 - -11) - 4 0 Calculate 7 + (-4 - (3 + -5)). 5 What is 4 + -9 + 3 - -3? 1 Evaluate 14 + -7 + -5 + 5. 7 Evaluate (-10 - -12) + 7 - 9. 0 What is 6 + (-2 - 0) - 3? 1 Evaluate 5 - 4 - (4 - (4 + -3)). -2 Evaluate -13 + 14 + (1 - 1) + -2. -1 Calculate (-6 - (-6 + 3)) + 6 + 1. 4 Calculate (-13 - -3 - -3) + 11. 4 What is the value of 68 - 63 - (0 - -5)? 0 What is the value of 1 - -5 - (2 + 2 + 1)? 1 Calculate -2 - (-7 + 5 + (-3 - -1)). 2 What is the value of -3 - ((3 - 0) + -4)? -2 Evaluate -32 - -24 - (0 - 4). -4 What is the value of -10 - ((-4 - 5) + 3)? -4 -2 + -9 + 12 + -11 -10 Calculate -1 - 4 - (-11 - -12 - 2). -4 Calculate (0 - 3) + (3 - 1). -1 What is the value of -1 + 8 + -6 + -9? -8 What is the value of 2 - 3 - -2 - 0? 1 Calculate -4 - -2 - (-1 - 0). -1 Evaluate 8 + -5 + (-9 + 4 - -3). 1 -9 + 6 + (-1 - -5) 1 Evaluate -1 - (13 + -4) - -5. -5 -6 - -8 - (0 + (1 - -5)) -4 What is -4 - -1 - -2 - (0 - -3)? -4 Calculate (2 - 2) + (3 - 0). 3 -1 + -2 + 3 - (4 - 4) 0 Calculate 5 - 1 - (1 + 6) - -4. 1 9 - 12 - -3 - 1 -1 Evaluate 12 - 21 - 10 - -12. -7 Evaluate 20 + -26 - (-12 - 0) - 16. -10 What is the value of (77 - 81) + 6 + 0? 2 What is the value of 9 + -3 + -3 - (0 + 2)? 1 -14 + 20 + 0 + -8 - -6 4 What is -8 + 6 - (0 + -7)? 5 3 + 0 - (55 - 45) - -1 -6 Calculate (0 - 0) + (21 - 19). 2 What is -4 + 6 + -5 + 3? 0 What is the value of -1 + 3 - (-7 - (-7 + 1))? 3 Calculate -1 + 5 - 7 - -1. -2 What is the value of 11 + -10 + (0 - -2)? 3 What is -4 + 6 + 8 + -17? -7 What is 3 - (-7 - (1 - 7))? 4 What is the value of -1 - -5 - (-19 + 24)? -1 Calculate -12 + (14 - 7) - (1 - -1). -7 What is (-5 - (-4 + 2)) + (64 - 64)? -3 (-1 - 2) + (29 + -19 - 11) -4 What is the value of -6 - (-4 + 1 - -5 - 3)? -5 (48 - 48) + (0 - 0) 0 What is the value of (-1 - (-4 + 10)) + 5? -2 Calculate -4 - (-3 + -2) - (-1 + 0). 2 3 + (-7 - 1) - -2 -3 What is the value of -11 + 0 + 4 - (-2 + 0)? -5 What is the value of -1 + 4 + (7 - 4) - 1? 5 What is 2 + (2 - (-4 + 4)) + -3? 1 What is the value of (-3 - -2) + (-9 - 1) + 6? -5 What is the value of (12 - 12) + (-1 + 1 - 0)? 0 (0 - 4) + 0 + 0 -4 What is the value of 4 + -1 + (2 - (8 - 12))? 9 Evaluate 14 + -15 + -2 + 2 + -2. -3 Evaluate 3 - (7 - (6 + -5)). -3 1 + (-1 - (-6 - 1) - -1) 8 What is 1 + -1 - (-10 + 8)? 2 -5 - ((4 - 12) + 1) 2 What is (-13 - -1) + (45 - 32)? 1 What is the value of 3 + 10 + (-7 - -5)? 11 What is the value of -5 + 0 + 8 + 1? 4 Calculate 3 + 5 - ((3 - 1) + 2). 4 Calculate -4 + 6 + (-4 + -3 - -3). -2 Calculate 10 + (-6 - (-7 - -5)). 6 Evaluate -10 + 0 + 6 + -1 - 0. -5 Calculate -8 + 6 + 11 - 5. 4 -3 + 2 + -1 + (-7 - 0) -9 Evaluate (1 - -9) + (-27 - -9). -8 Evaluate (0 - 0) + 0 + 10 + -8. 2 Evaluate 14 - 2 - (-3 + 4 + 4). 7 -4 - (-1 + 4 - (-10 + 19)) 2 -5 + 9 + -6 - -6 - 8 -4 What is 3 - (-1 + (1 - 0))? 3 What is the value of -1 + 5 + 12 + -2 + -8? 6 Evaluate 1 + -4 - (-12 - (12 + -17)). 4 -5 + 11 - -1 - 4 3 Evaluate -5 - ((-3 - (4 + -5)) + 0). -3 Calculate (2 - (3 - 2)) + 4. 5 What is -4 - (4 + -9 + 2)? -1 Evaluate -2 + (2 - (-3 - -7)). -4 What is the value of -4 - (1 + -2 - 3 - -4)? -4 (-5 - -3) + 4 + -5 -3 What is the value of 3 + -3 + -6 - (50 - 60)? 4 Evaluate 1 + -2 - (-4 + -3 - -6). 0 -14 - -19 - (-1 - -2) 4 Calculate 6 + 1 + -1 + -1. 5 Calculate 0 - 6 - -2 - (10 - 14). 0 What is 5 + 9 + -24 + 4 + 1? -5 What is (1 + -1 - 7) + (1 - -1)? -5 What is -2 - (1 - ((-5 - 2) + 9))? -1 Calculate 3 + (-4 - -3) - -1. 3 What is -36 + 30 + (3 - -1) + 3? 1 Calculate -2 + 10 + -8 + -4. -4 Evaluate -3 - (-17 + 7) - 4. 3 Evaluate 1 + -5 - (-6 - (-2 + 5)). 5 Evaluate -3 + 2 - (-1 + 0). 0 What is the value of (8 + 0 - 2) + -5? 1 (-4 - 0 - (14 + -19)) + -5 -4 Calculate 31 + -34 + 8 + 0. 5 (7 - (-1 + 11)) + 5 2 -5 - ((2 - 3) + -2 + 0) -2 What is the value of (10 - (-1 + 8)) + -4? -1 What is -1 + 6 + (-2 - 5)? -2 Evaluate -1 + 4 - -3 - 2 - 8. -4 (-1 - 0) + 6 + -8 + 4 1 4 + (-7 - (-3 - 0)) 0 1 + -5 + -1 + 9 4 What is the value of -3 + (-23 - -18) + (0 - 1)? -9 What is -8 - (3 - 12 - 0)? 1 What is -2 + (-7 - (3 - 7)) + 10? 5 -3 - (9 - 6) - -12 6 Calculate 0 - -4 - (5 - (1 + 1)). 1 7 + -11 - (-1 - -1 - 0) -4 Evaluate -1 - (2 - (-1 - -15)). 11 Calculate (-6 - -7) + -5 + 5 + 3. 4 What is -9 - -16 - (9 - 5)? 3 Evaluate (-10 - (1 - 3 - 2)) + 2. -4 -8 - (-3 - 8) - 5 -2 (4 + 3 - -1) + -7 + -6 -5 6 + (-13 - -2) - (2 + -4) -3 -2 + (2 - -2) + (-15 - -10) -3 (8 - (-19 + 7)) + -14 6 Calculate 4 + -5 + -3 + (4 - 8). -8 Evaluate 9 + 0 + -11 + 7. 5 What is the value of -1 + -11 + 6 + 2? -4 What is -5 - -6 - 19 - -6 - -5? -7 What is 6 - (1 + -3) - (-143 - -158)? -7 Calculate -3 - -1 - (4 - (1 + 0)). -5 What is the value of (-6 - -3) + 3 - 4? -4 What is 0 - -3 - ((-15 - -10) + 6)? 2 What is -11 + 9 + -10 + 3? -9 What is -7 + 11 - (-1 - 0)? 5 What is -3 + (10 - (8 + 0))? -1 Evaluate 3 - 5 - (-3 - 0). 1 What is -4 - -4 - (-1 + 2)? -1 (-9 - 1) + 12 - 2 0 4 - (3 + (-1 - 0) + -2) 4 What is the value of (1 - (-2 + 8)) + 8? 3 Calculate -3 - ((2 + -3 - 3) + -3). 4 (4 - -8 - 7) + 3 - -2 10 Evaluate -4 + 4 + 6 + -1. 5 (-2 - (2 - 2)) + (9 - 10) -3 What is 13 + 0 + -6 - -9 - 8? 8 Evaluate 51 + -59 - (-2 - (3 - 2)). -5 Evaluate (7 - 1 - 8 - 6) + 3. -5 What is (0 - -5) + -4 + 9 + -1? 9 Calculate 4 + 0 - 5 - (-1 + -2). 2 16 + (-4 - -5) + -10 7 What is 0 + (2 - 8) + 8? 2 Calculate 16 + -4 + -13 - (-1 - -1). -1 Evaluate (-5 - 2 - -4) + (1 - 4). -6 Calculate (1 - -1) + -4 + -1 - 1. -4 Evaluate 5 + (8 - (8 - (4 - 4))). 5 What is the value of 1 + -5 + -5 + 10 + -3? -2 What is the value of (1 + -10 + 5 - -9) + -1? 4 What is the value of (-6 - -10 - -2) + (4 - 6)? 4 4 + 5 - 13 - -8 4 Calculate 3 - -4 - ((0 - 3) + 5). 5 Evaluate -4 - (-8 - (5 + 0 + -5)). 4 Evaluate 9 + (-10 + -3 + 12 - -1). 9 What is -6 - (-6 + 5 + -9) - 3? 1 (1 + 0 - 6) + -48 + 52 -1 What is the value of -1 + 1 - (-6 + 4 + 6)? -4 What is the value of -12 - (4 - (14 + 1) - -8)? -9 What is (-12 - -11 - 3) + 3 + 0? -1 Calculate 2 + 4 + -6 - 1 - 6. -7 What is 8 + (-3 - 2) - -1? 4 What is the value of -1 + -5 + 3 - -4? 1 Calculate (5 - 6 - -8) + -3. 4 1 + (8 - 5) + -4 + -3 -3 0 - (6 - 5 - -2) - 5 -8 What is the value of -5 - (4 - (10 - -1))? 2 -1 + -6 - ((3 - 28) + 9) 9 Evaluate 1 + -11 + 6 + 1. -3 What is -2 + 4 + 5 - 17? -10 Evaluate (0 - (0 - 1)) + (-11 - -6). -4 Calculate -4 - -1 - (9 - 7) - -5. 0 Calculate 13 + -5 + -4 + -5 + -4. -5 3 - 4 - (-5 + 7) -3 What is the value of -1 - (0 - 8) - (3 + -3)? 7 What is the value of -15 + 3 - (-25 + 15)? -2 What is (4 - 2) + -1 - 3? -2 Calculate (14 - 23) + 8 + 5. 4 What is (5 - 7 - (2 + -4)) + -4? -4 What is the value of 0 + -1 + 4 + 4 + -4? 3 Evaluate -3 + (-1 - -4) + (-3 - 0). -3 What is -21 + 22 - -6 - (0 - -2)? 5 What is the value of -2 - -1 - (12 + -18) - 3? 2 (2 + -2 + 7 - -1) + -8 0 What is the value of 10 + -5 - (4 + 3) - -3? 1 What is 12 + -17 - (-1 - 2)? -2 Evaluate (10 + -1 - 2) + (0 - 2). 5 1 + -5 + (61 - 55) 2 1 + (-6 - -5 - (2 + -1)) -1 What is (-6 - (-4 - (1 - 6))) + 6? -1 (-4 - -17) + 0 - (-10 + 16) 7 What is (-12 - -19) + -7 + 0 + -4? -4 Calculate 2 + (0 - 8) + 8. 2 What is the value of 12 + -9 + 3 - (4 + -2)? 4 -15 + 3 + -4 + 10 -6 Evaluate -1 + 1 - (6 + -3) - 2. -5 Calculate -8 - (3 - (4 - -2)). -5 What is the value of -7 + 5 + -5 + (6 - 1)? -2 What is -3 + 3 + -4 + -1 + 0? -5 What is the value of (0 - 1) + 57 + -60? -4 (-4 - -9) + -7 - (-2 + -2) 2 7 + -3 - 5 - (-1 + -5) 5 Calculate -15 - -37 - 12 - 14. -4 What is 4 + (1 - (3 - 2))? 4 Calculate (3 - -2) + -10 - (-4 + 1). -2 What is the value of -10 - (3 - 10 - 2)? -1 Evaluate (-15 - -6) + 2 + 6. -1 Calculate 2 + 4 + -10 + (-4 - -5). -3 0 + (-2 - -8) - (0 - -1) 5 What is the value of 7 + (14 - 8) + -15? -2 -8 + 7 - (1 + 2 - 1) -3 -2 - (2 + -4 + 2) -2 What is (3 - (-2 - -2)) + (-24 - -21)? 0 Evaluate 1 + -1 + 1 + -1 + 2. 2 What is -5 + -1 + 5 + 8? 7 Evaluate (4 - 5) + 1 + -4 - -5. 1 Evaluate 4 + (-6 - (3 - 8) - 3). 0 (0 - 2) + 53 + -58 -7 Evaluate -4 - (-5 + -1 - -2). 0 What is the value of -5 + (-8 - (4 + -16))? -1 What is (-10 - -5) + 1 - -4? 0 E	{ "pile_set_name": "DM Mathematics" }
r of 30 and z. 6 Suppose 205 = 4j - 79. Suppose 5b - j = -41. Calculate the greatest common factor of 2 and b. 2 Let j(i) = 6i2 + 7i - 12. Let s be j(-6). Suppose 112q + s = 113q. What is the highest common factor of 36 and q? 18 Suppose -3a = -291 + 90. Let o be a + 12/3 + -1. Let x(z) = 3z*2 - 2. Let h be x(2). Calculate the highest common divisor of h and o. 10 Suppose -y = -3t - t - 27, t + 12 = y. What is the greatest common factor of y and 1? 1 Suppose 5g + 37 - 1242 = -5a, 0 = -4a - 12. What is the greatest common divisor of g and 183? 61 Let v(k) be the third derivative of k5/60 - k4/24 - 4k*2. Suppose 3p + 4 = 19. Let j be v(p). Calculate the greatest common factor of 4 and j. 4 Suppose -13w = -18w + 1755. What is the highest common divisor of w and 9? 9 Suppose -3d = -13 - 14. Suppose 24 - 132 = 5i + 3k, -2i - 44 = 2k. Let a be 2/1i/(-14). What is the highest common factor of a and d? 3 Suppose -y = 5a - 163, a + 122 = 5a - 2y. Let o = 76 - 63. Let n = a - o. What is the greatest common factor of n and 57? 19 Let m = -528 + 542. Calculate the highest common factor of m and 280. 14 Let z = -61 - -66. Suppose zy = -10 + 50. Suppose 0 = 4g - 20, -3g + 13 = -s + 70. What is the greatest common divisor of s and y? 8 Let z(c) = -c + 25. Let k be z(8). Suppose -3b - k = -4u - 78, -5b + 155 = 4u. Calculate the greatest common divisor of 243 and b. 27 Suppose 0 = -2n + n - w + 14, -3n = 2w - 38. Suppose 0 = -p - 4 + n. What is the greatest common factor of 36 and p? 6 Let p(j) = -3j*3 - 2. Suppose 8 = -3t + 2. Let h be p(t). Let u(m) = 2m - 11. Let o be u(11). Calculate the greatest common divisor of h and o. 11 Let w = 39 + -35. Suppose 0x + w = -x, -2x = u - 104. Calculate the highest common factor of 14 and u. 14 Suppose 7r - 3r - 434 = -3i, 3i - 432 = -3r. Let z = 168 - i. What is the greatest common divisor of z and 52? 26 Let x be 1 + 3/3 - -16. Let l = x + 24. Let g = 129 + -24. Calculate the highest common factor of g and l. 21 Suppose i - 1087 = -4t, 4t + 3i - i - 1086 = 0. Calculate the greatest common factor of 17 and t. 17 Suppose -184 - 4 = -4j. Let c = j - -3. What is the highest common divisor of c and 20? 10 Let v = -67 - -97. Suppose 0 = 4x - 102 + v. Suppose 0 = -4m - 16, 0 = -6o + o + m + 94. Calculate the highest common divisor of x and o. 18 Suppose -34x + 426 - 154 = 0. Suppose 4d = 9d - 40. What is the highest common divisor of x and d? 8 Let a be 418/5 + (-50)/(-125). Let h = 79 + -51. What is the greatest common factor of h and a? 28 Let w be -35(-16)/48. Suppose -wm - 2r + 68 = 0, 4m = 5r + 44 - 16. What is the greatest common factor of m and 60? 12 Suppose -29 = -4k + 19. Suppose s + j - k = 8, 5s - 5j - 130 = 0. What is the greatest common factor of 46 and s? 23 Let b = -3 - -30. Let t be (-3 - b/(-6))/((-5)/(-130)). Calculate the greatest common factor of t and 39. 39 Let q(i) = 2i - 11. Suppose -4 = 2t - 20. Let o be q(t). Calculate the highest common factor of o and 35. 5 Suppose 4a - 17a - 39 = 0. Let x be a + 17/7 + 1040/56. Let u(g) = -g3 + 3g*2 + g - 1. Let f be u(3). Calculate the greatest common divisor of f and x. 2 Suppose -5a + 255 = -3j, -3a + 3j - 69 = -4a. Suppose -5v + 13 = 3m, 0m - 8 = -2m - 4v. What is the greatest common factor of a and m? 6 Suppose -d + 5h - 2 = 0, -4h - 1 = -d - 2. Let n be ((-27)/3)/d - -13. Suppose -5l = -n, -3u - u + 50 = l. What is the highest common divisor of u and 84? 12 Suppose v - 4o + 12 = -v, -2o = -8. Suppose 51 = p + 3a, -3p = -p - va - 62. Calculate the greatest common factor of 144 and p. 36 Suppose -37j = 16312 - 68038. What is the highest common divisor of 6 and j? 6 Suppose -88t + 1512 = -76t. What is the highest common factor of t and 112? 14 Let j be ((-10)/5)/((-4)/118). Let v be (-12)/(-48) + j/4. Calculate the greatest common divisor of 30 and v. 15 Suppose s = -3t + 134, -46t = s - 49t - 152. Calculate the highest common divisor of s and 66. 11 Let o = 17 - 22. Let u(h) = -h. Let w be u(o). Suppose 0 = j + wz - 1, -5z - 6 - 29 = -5j. What is the highest common factor of j and 2? 2 Let x be 3(-25 - (-5 + 4)). Let h = x + 79. Suppose 5p + 2i - 179 = 0, 0p - 111 = -3p - 3i. What is the greatest common factor of h and p? 7 Let o(j) be the third derivative of j5/12 + j4/24 - j3/3 + 5j*2. Let a be o(2). Calculate the highest common factor of a and 4. 4 Let l = -13 - -39. Suppose -60n + 59n = -l. What is the greatest common divisor of n and 39? 13 Suppose -22 = p - 1. Let z = 73 + p. What is the greatest common divisor of 130 and z? 26 Let o(g) = 4g*2 - 2g - 3. Let z be o(5). Let p = z - 67. Calculate the greatest common divisor of 40 and p. 20 Suppose -1 = -c - 2u, 4c + 2u - 7u - 30 = 0. Suppose 90 = cp - 0p. What is the greatest common divisor of 54 and p? 18 Let f = 197 - 137. Suppose w - f = -2w. Suppose m - 100 = -3j + 45, 0 = 5m - 2j - 810. Calculate the highest common factor of w and m. 20 Suppose 2q - 4n = -0q - 4, 4q - 10 = 2n. Suppose 5g - 10 = 5x + 5, -qg = -x - 12. Calculate the highest common divisor of g and 1. 1 Let n(h) = -54h - 137. Let z be n(-8). Calculate the highest common divisor of 5 and z. 5 Let n(l) = 27l*3 + 6l*2 - 1. Let h be n(3). What is the greatest common divisor of h and 34? 34 Let o = -816 - -1107. Calculate the greatest common divisor of o and 3. 3 Suppose 3c = 7c - 5j - 888, c + 4j = 201. What is the greatest common factor of 28 and c? 7 Suppose 3k + 4 = 2s - 2, -4k - 3s + 9 = 0. Suppose -r + 4v + 404 = k, -r - r - v = -790. What is the greatest common divisor of r and 36? 36 Let w(z) = -2z2 + z2 + 2z*2 + 1. Let l be w(-7). Calculate the highest common divisor of l and 10. 10 Let a(l) = 32l*2 + 3l + 15. Let k be a(0). What is the highest common factor of 360 and k? 15 Suppose 24w = w + 207. Let o be 7 - ((1 - 1) + 1). Calculate the highest common factor of o and w. 3 Suppose -2396 = 36y - 9776. What is the highest common divisor of 123 and y? 41 Suppose 0 = -4y - 18 - 22. Let s(q) = -18q. Let p be s(y). Calculate the highest common divisor of 20 and p. 20 Suppose 5y + 2 = 4l + 18, -2y + 8 = 0. Let b be 19 - (0 + l/1). Suppose 7k - 81 - 3 = 0. Calculate the highest common factor of b and k. 6 Let l(d) be the second derivative of d4/2 + d3/6 + d*2 - 7d. Let z be l(-2). What is the highest common factor of z and 264? 24 Suppose 14 = -13u + 53. What is the greatest common factor of u and 33? 3 Let d = -410 - -524. What is the greatest common divisor of 30 and d? 6 Let z = -3020 - -3024. Let w = -98 - -170. Calculate the highest common factor of z and w. 4 Let f be (12/(-10))/(1/(-200)). Suppose 3b - f = -b. Let n(j) = -j*3 - 4j*2 - 2j + 22. Let r be n(-4). What is the highest common factor of r and b? 30 Let q be (2 + 62 + 2)9. Let t(b) = -b - 9. Let l be t(-11). Suppose lj - q = -j. Calculate the highest common factor of j and 18. 18 Let i be (-2)/(-6) + (-334)/(-6). Let k be 7((0/3 - (8 - 5)) + 5). What is the greatest common divisor of i and k? 14 Let c be 9/(27/120) + 1. Suppose 2s = 2, -s = -0j + 5j - c. Calculate the highest common factor of 40 and j. 8 Let z = 8 - 6. Suppose -zq = 5k - 17, -5q - 6k + k = -80. Calculate the highest common factor of q and 147. 21 Let i be 22/(3 - 1)-1. Let b(h) = h2 - 3h - 16. Let d be b(i). Suppose -d = f - 3f. Calculate the highest common factor of f and 23. 23 Let y(u) = 9u + 80. Let w be y(2). What is the greatest common factor of w and 14? 14 Let o(u) = 8u2 + u + 2. Suppose -5w + 1 = 3p, -3p + 3 = -4p. Let b be o(w). Calculate the highest common divisor of 4 and b. 4 Let a(r) = r2 - 6r - 6. Let l be a(9). Suppose 4m + 8 = 0, -2v - 258 = -6v + 3m. Calculate the greatest common factor of v and l. 21 Let b(m) = m*3 + 11m*2 - 13m + 4. Suppose 9 = -2c - 15. Let i be b(c). Let s(v) = 11v - 1. Let r be s(3). Calculate the highest common divisor of i and r. 16 Let w be (-4 - 0) + (8 - 5 - -358). Calculate the greatest common factor of 147 and w. 21 Let s = 17 + -27. Let z be (-48)/(-80) + (-944)/s. What is the greatest common factor of z and 19? 19 Let q be (8 - 1)/(3/	{ "pile_set_name": "DM Mathematics" }
t(d(j)). 9j2 Let h(x) = -2x*2 + 4x. Let q(g) = g. Let t(z) = -h(z) + 4q(z). Let f(d) = -1. Let k(v) = -3 - 3 + 0 - 3v - 9. Let a(r) = 15f(r) - k(r). Calculate t(a(o)). 18o*2 Let m(o) = -4o - 3. Let d(b) = -9b - 7. Let t(a) = 3d(a) - 7m(a). Let v(y) = -49y. Give v(t(j)). -49j Let m(b) = 6b*2. Let d(w) = 43w*2 + 42w*2 - 83w*2. Give d(m(z)). 72z*4 Let p(y) = 23y*2. Let f(t) = -2t. Give p(f(g)). 92g2 Let a(h) = -6h*2. Let n(x) = 5x. Determine a(n(v)). -150v2 Let t(k) = 2k. Let x(z) be the second derivative of z7/1260 - z4/4 - 2z. Let m(p) be the third derivative of x(p). What is t(m(w))? 4w*2 Let l(q) = -14q - 17. Let t(j) = 5j + 6. Let g = 6 + -12. Let u(s) = gl(s) - 17t(s). Let o(v) be the third derivative of -v4/12 + v2. Calculate o(u(f)). 2f Let l(c) = -2c2. Let s(t) = 15t + 49. Calculate l(s(y)). -450y2 - 2940y - 4802 Let a(z) = -666z. Let l(v) = v. What is l(a(s))? -666s Let f(o) = -4o. Let a(h) = 2h + 71. Calculate a(f(n)). -8n + 71 Let b = 18 - 9. Let t(w) = b + w - 9. Let d(s) = -5s*2. Give t(d(f)). -5f*2 Let l(x) = 114x*2 - 56x*2 - 56x*2. Let z(i) be the first derivative of 1 - 1/2i*2 + 0i. Give l(z(m)). 2m2 Let k(g) = -g - 1. Let x(y) = 8y - 8. Let r(s) = 8k(s) - x(s). Let q(z) = -z2. Calculate q(r(n)). -256n*2 Let r(m) = -164m. Let u(v) be the first derivative of v*3/3 + 7. Give u(r(f)). 26896f*2 Let n(l) = -2l*2. Let g(r) = -6r + 5. Let z(w) = -9w + 1 + 16 - 9. Let t(k) = 8g(k) - 5z(k). What is t(n(v))? 6v*2 Let g(k) = k. Let y(j) = -234j*2. Determine y(g(o)). -234o*2 Let y(t) = 2t. Let k(d) = -4d + 2. Let p(a) = -21a + 11. Let i(o) = 11k(o) - 2p(o). Give i(y(n)). -4n Let r(a) = -2a. Let t(q) = 100q2 - q - 3. What is r(t(b))? -200b*2 + 2b + 6 Suppose -4g + 13 = 5. Let b = -4 + 6. Let o(t) = -bt - gt + t. Let k(z) = z2. What is o(k(q))? -3q*2 Let v(y) = -2y. Let o(b) = 197b2. What is o(v(s))? 788s*2 Let b(i) = -i. Let z(w) = -3078w*2. Determine b(z(t)). 3078t*2 Suppose -2c = -5j + 15, -4j - 1 + 11 = -2c. Let t(f) = 6f*2. Let z(w) = 7w*2. Let g(u) = cz(u) - 6t(u). Let b(k) = k2. Give b(g(r)). r4 Let q(f) be the third derivative of f7/5040 - f5/15 + 3f*2. Let v(z) be the third derivative of q(z). Let b(c) = -5c*2. Give v(b(u)). -5u*2 Let r(l) = 29l*2 + 7l. Let w(q) = 5q. Determine r(w(n)). 725n*2 + 35n Let r(q) = 21q2 - 18. Suppose 0 = 2c - 5j + 11, -47 = -0c + 4c - 5j. Let f(d) = d*2 - 1. Let k(h) = cf(h) + r(h). Let u(a) = -a*2. Give k(u(y)). 3y*4 Let r(s) = 2s. Suppose -y + 0y + 12 = 0. Let h = y - 10. Let t(n) = 7n*h + 0 - 9n*2 + 0. Give r(t(c)). -4c*2 Let u = 2 - 0. Suppose -2t = 4g - 22, -3g = -2t - 12 - 1. Let q(j) = 5j*u + t - 1. Let l(p) = -p. Determine l(q(y)). -5y*2 Let k(f) = 4f*2. Let j(x) = -x - 2. Let l be j(-4). Let r(p) = -4p2 - p2 + p*2 + 3p*l. Give r(k(c)). -16c*4 Let v(o) = 5o*2 - 5o2 + o2. Let z(p) be the first derivative of 0p + 1/3p*3 + 0p2 - 1. Determine z(v(n)). n4 Let r(o) = o + 6o2 - o - 5o*2. Let p = 2 + 0. Let u(m) = -3m*2 + 3m*2 - 4m*2 + pm*2. What is u(r(x))? -2x4 Let m(u) = u2. Let c(i) be the third derivative of -i5/60 + i3/3 - 2i2. Let w(j) be the first derivative of c(j). Determine w(m(v)). -2v*2 Let o(c) = 3c*2 + 179c - 11. Let a(n) = n*2. Give o(a(t)). 3t*4 + 179t2 - 11 Let y(x) = x3 - x2 + 2. Let r be y(0). Let d(w) = 2 + wr - 5 + 3. Let f(a) = -8a. What is d(f(h))? 64h*2 Let r(i) = 2i. Let g(u) = -6u + 13u - 6u. What is g(r(j))? 2j Let i(t) = 13t2 - 2t*2 - 7t*2. Let h(c) = -5c. What is h(i(j))? -20j2 Let r(f) = 2f. Suppose 0 = -3h + 4h - 3. Let n(u) = 7u + 5u - hu - 2u. Calculate n(r(t)). 14t Let o(r) = 2r. Let h(w) = -7w - 6. Let x(m) be the first derivative of -2 - 1/2m*2 - m. Let s(d) = -h(d) + 6x(d). Calculate o(s(n)). 2n Let a(w) be the first derivative of w2/2 + 1. Let g(k) be the second derivative of 0k*2 + 0k*3 + k + 1/12k4 + 0. Determine a(g(s)). s2 Let x(r) = 2r2 + 0r*2 + 0r2. Let o(i) = i3 - i*2 - i + 1. Let m be o(1). Let t(y) = y + y - y + m. What is x(t(c))? 2c*2 Let s(t) = -2t. Let g(d) = -9d2 + 7. Let y(r) = 5r*2 - 4. Let h(m) = -4g(m) - 7y(m). Determine s(h(x)). -2x2 Let v(d) be the second derivative of -d3/2 - 9d. Let g(c) be the first derivative of 5c*2/2 + 2. Determine v(g(z)). -15z Suppose 0t + 3 = 3t. Suppose 0 = 4w - 4o - 28, -2o + t + 5 = 0. Let m(n) = w + 2n*2 - 10. Let q(a) = 3a*2. Give q(m(h)). 12h*4 Let k(q) = -7q + 11q + 14q. Let f(p) = -2p. Give f(k(r)). -36r Let g(y) = 12y. Let z(n) be the second derivative of -n3/3 + 6n. Determine g(z(s)). -24s Let q(y) be the second derivative of -y6/360 - y4/4 - 2y. Let r(x) be the third derivative of q(x). Let a(g) = 4g + 0g - 2g. Give r(a(n)). -4n Let a(p) = -3p - 429. Let n(u) = 2u. Give n(a(s)). -6s - 858 Let t(k) = -2k*2. Let j(m) = 7m*2 - 7. Let p = 3 - 6. Let l(w) = 4w*2 - 3. Let i(f) = pj(f) + 7l(f). Give t(i(n)). -98n4 Let u(h) = h2. Let c(t) be the third derivative of t*4/24 - 4t2. What is u(c(f))? f2 Let x(g) = -g. Let i(m) = -10m. Let f(p) = -11p. Let d(q) = 5f(q) - 6i(q). Give d(x(z)). -5z Suppose -4y = -y - 33. Let i(h) = -yh + 6h - 2h2 + 5h. Let r(k) = k*2. Determine i(r(x)). -2x*4 Let w(m) = 2m. Let z(k) = 45k. Give z(w(f)). 90f Let i(r) = 2r. Let b(x) = x2 - 4789x. What is i(b(g))? 2g2 - 9578g Let y(h) = -4h. Suppose -2p + 10 = -3s, -s + 0s + 4 = 3p. Let f(c) = cp - 1 + 1 - 2c*2. Give y(f(l)). 4l*2 Let s(b) = -2b. Let r(t) = -t - 205. What is s(r(z))? 2z + 410 Let v(t) = 3t. Let q(u) be the second derivative of 2u3 + 32u. Calculate q(v(k)). 36k Let b(h) = h2 - h. Let t(w) = -14w*2 + 12w. Let l(o) = 12b(o) + t(o). Let k(g) be the second derivative of 2g*3/3 + g. Calculate l(k(r)). -32r2 Let z(y) be the third derivative of -y4/6 + 54y2. Let n(k) = -17k*2. Give z(n(q)). 68q*2 Let h(w) = 2w*2 + 804w. Let o(b) = b*2. Determine h(o(t)). 2t*4 + 804t*2 Let v(n) = -4n*2 - 9n. Let i(s) be the second derivative of -s*3/3 - 2s + 1. What is v(i(y))? -16y2 + 18y Let a(n) = -2. Let f(z) = z + 7. Let k(h) = -7a(h) - 2f(h). Let i(d) = 1. Let r(q) = -2q2 - 3. Let v(b) = -3i(b) - r(b). Give v(k(l)). 8l2 Let f(v) = -2v*2 + 4v2 - v2. Let q(m) = -13m. Determine q(f(t)). -13t*2 Let y(u) = -6u + 6u - 2u. Let j(q) = 33q2 + 2. Determine y(j(x)). -66x*2 - 4 Let b(d) = 9d. Let h(m) = -18m2. Calculate h(b(n)). -1458n2 Let g(f) be the third derivative of -f5/40 - f3/6 - f2. Let m(t) be the first derivative of g(t). Let b(s) = 3s. What is b(m(p))? -9p Let a(f) = f*3 + 4f*2 + 2. Let y be a(-3). Let s(b) = y - 11 - 3b. Let n(k) = -4k. Calculate s(n(q)). 12q Let t(g) = -10g. Let x(i) = -2i*2 + 22i. Determine x(t(w)). -200w2 - 220w Let p(f) = -6f. Let v(l) = l. Let c(b) = 2p(b) + 14v(b). Let m(w) = -13w*2. Determine c(m(q)). -26q*2 Let h(p) = -9p. Let t(v) = 19v. What is h(t(q))? -171q Let a(g) = -14g2. Let c(t) = -21t. What is a(c(d))? -6174d2 Let c(m) = m. Let x(o) be the second derivative of -o3/6 - 9o*2/2 - 21o. Give x(c(k)). -k - 9 Let d(a) = 3a. Let z(q) = -4q*2 - 959 + 959. Determine z(d(i)). -36i2 Let u(c) = c2 + c + 1. Let f(k) = -19k2 - 2k - 2. Let a(o) = -f(o) - 2u(o). Let y(g) = -g. What is y(a(z))? -17z*2 Let u = -59 - -355/6. Let j(l) be the second derivative of 0l*2 + 2l - ul3 + 0. Let c(p) = -2p. What is j(c(n))? 2n Let h(x) = -x. Let l(d) be the third derivative of -3d*5/10 + 31d*2. What is l(h(j))? -18j*2 Let w(k) = 3k. Let l(c) = -3c. Let g(y) = -y. Let a(p) = -17g(p) + 6l(p). Calculate a(w(f)). -3f Let c be (-2)/(3/3-1). Let k(q) = -2q*c - 2q*2 + 2q2. Let y(f) = -f2. What is y(k(u))? -4u4 Let o(l) = 9l. Let a(d) = -11d. Calculate o(a(r)). -99r Let w(k) = 16k2 + 2. Let r(p) = -p2. Give r(w(t)). -256t*4 - 64t*2 - 4 Suppose -4 = -o, -3o = -z + 5z - 20. Let k(g) = 112g*2 - 3g + 3g - 110g*z. Let t(j) = 8j. What is k(t(d))	{ "pile_set_name": "DM Mathematics" }
itive. h(-827/25) Simplify (d(2/3))*16d*(1/10)dd1 assuming d is positive. d(383/30) Simplify ((d(-5)dd)/d(3/7))/(d/(d/d(1/7))dd7/dd) assuming d is positive. d(-81/7) Simplify (s/s(-1/26))/((s/(s(-14)/s))/s) assuming s is positive. s(-363/26) Simplify y(-4/3)/y(-21) assuming y is positive. y(59/3) Simplify g/(g(-2/7)g)g(13/4) assuming g is positive. g(99/28) Simplify (tt(-1))/((tt/(t*15t))/t) assuming t is positive. t*15 Simplify (ww*(-6)ww(-4/3)/w)/(w1)(-16) assuming w is positive. w(29/3) Simplify oo*18oo(-18) assuming o is positive. o2 Simplify bb*27/bbb(-1/32) assuming b is positive. b(895/32) Simplify (i/((ii/(i*(-20)/i))/i))/(i(ii/i5)/ii) assuming i is positive. i*(-19) Simplify ((vv(1/2))(-5))(-28) assuming v is positive. v210 Simplify (y*(1/4)/((y/(yy*(2/7)yy))/y))(-1/2) assuming y is positive. y(-99/56) Simplify ((w(-1/5))(-3/40))(-9) assuming w is positive. w(-27/200) Simplify r(-24)/r(-15) assuming r is positive. r(-9) Simplify (q/(q/(q/(q(q/(qq(-4/7))q)/qq)))q)/(q/q(4/27)) assuming q is positive. q(-269/189) Simplify ((m/(mm(-6/11)m)m)/(mmm(2/17)/m))/(m3/mm)(-3/5) assuming m is positive. m(1148/935) Simplify (m/m*(2/7)mmm)5/(m(-4/9)/(mm(6/11))) assuming m is positive. m(14249/693) Simplify (z4zz/(z/z(-2)))41 assuming z is positive. z123 Simplify g(-1/6)g21/g assuming g is positive. g(119/6) Simplify (jjj/(j(j(28/3)/jj)/jj))/jj/j(1/9) assuming j is positive. j(-67/9) Simplify ((z/(zz0))/z)/(z/z(-5/7)z) assuming z is positive. z*(-26/7) Simplify (ooo(2/19)ooo*(-4))/((oo(oo*(-2/7))/oo)/(ooo(-2/3))) assuming o is positive. o(-509/399) Simplify o(o/(o/((o/((o(o*(-1/65)/oo)/oo)/o))/o)))/oo4 assuming o is positive. o(261/65) Simplify hh(4/19)hhh(-3/2) assuming h is positive. h(65/38) Simplify (zz(-4)zzzz/z(-3/10))39 assuming z is positive. z(507/10) Simplify (vv(v(-12)/v)/v)/v(-1/27) assuming v is positive. v(-323/27) Simplify (c1/cc)(-2/5)/(c(2/7)c2) assuming c is positive. c(-94/35) Simplify (f/(f/((f/(f/(ff/(ff(-2/5)))))/f)))30/(f(2/7)/((f(-1)f)/f)) assuming f is positive. f*(75/7) Simplify ((mmmm*(-2/3))/(m/(m/(mm*6)m)))/(m*2(mmm/((m/m*(2/17))/mm))/m) assuming m is positive. m(-346/51) Simplify (h(-8/5))(2/19) assuming h is positive. h(-16/95) Simplify ((h*(-1)h)/(hh/h(-2/21)))(-11/7) assuming h is positive. h(484/147) Simplify (p/(p/((pp/(p/(p/(p*(-1)pp))))/pp))pp*0)/(p(p/(p/p*(-2/11)p)p)/p)(10/7) assuming p is positive. p(174/77) Simplify ((yy/(yy(6/7)y))/y(2/5))/(y(2/9)y1) assuming y is positive. y(-781/315) Simplify ((g(1/13)/g)/g(2/25))/(g((gg/g2g)/ggg)/gg)(-2/75) assuming g is positive. g(-12/13) Simplify (l/(l/((l(l21/l)/l)/l)))(2/55) assuming l is positive. l*(38/55) Simplify (((xx/x10)/x)/(x(-6)x))/(((x(1/9)x)/xx)/(((x(2/13)/xx)/x)/x)) assuming x is positive. x(-814/117) Simplify (k0)(-1/7) assuming k is positive. 1 Simplify p/p(-27)pp30 assuming p is positive. p59 Simplify (gg/g0)(-11/2)/(g0)(-8) assuming g is positive. g(-11) Simplify ((aaa/(a/(aa*4/aa)))/(aaa5))/(a(1/5)a)41 assuming a is positive. a(-246/5) Simplify ((m(-5))(2/5))42 assuming m is positive. m(-84) Simplify (ll(l/l(-1/22))/l)(-26) assuming l is positive. l(-585/11) Simplify o(-27)o(-18/7) assuming o is positive. o(-207/7) Simplify o7/((o/(o/(o/(o/(o/o(-8))))o))/o)o*(-8)o(3/5) assuming o is positive. o(-37/5) Simplify ww/w(-18/11)w(-24) assuming w is positive. w(-224/11) Simplify q*4q/((q(q(-1)/q)/q)/qq)(qq*8q)/(q*3q) assuming q is positive. q13 Simplify ((f/(f/(f/f(2/5))))/f)(-34) assuming f is positive. f(68/5) Simplify u/((u/(u/(u*(-3)/u)))/u)uu/(u/(u/((u(-2)/u)/uu)))u(u/u*(-5))/uuu(6/5)/u assuming u is positive. u(91/5) Simplify t/t27t/t(-13/5) assuming t is positive. t(-112/5) Simplify (h(8/3))(4/23) assuming h is positive. h(32/69) Simplify (p3pp(1/10))/(p(-1/5)/p)(4/3) assuming p is positive. p(57/10) Simplify f*(-35)f(-29) assuming f is positive. f(-64) Simplify (j*(1/4)jj/(j(2/5)j))/((jj(-1/6))/jj/(j/j7)) assuming j is positive. j(-359/60) Simplify (k*(-2)k)(3/16)/(k2)(-16) assuming k is positive. k(509/16) Simplify (a/a*(-1/6))/aa*(-1)(aa((a/(a(a(2/3)/a)/a))/aaa)/aaaa)/(a/a*8a) assuming a is positive. a(23/2) Simplify (y3y)/(y(y*(-1)y)/y)y(-1)/yyy(yyyy(-8)yy)/yy assuming y is positive. y Simplify ((n(-1))(10/3))(1/4) assuming n is positive. n(-5/6) Simplify ((s*(-5/6)/s)/(sss/s(-2/23)))/(ss/(s/s*6)ss(-5)) assuming s is positive. s(-1093/138) Simplify ((dd/(dd0)d)/d)13/((d/d5)/(d/(d/((d*(-1/3)d)/d)d))) assuming d is positive. d(47/3) Simplify (x0)(-13/6)/(xx/x*(1/5)((x*(-2/7)/xx)/x)/x) assuming x is positive. x(17/35) Simplify (k(-1/5)/k)/(kkk(kk/k*(2/15))/k)(k1)40 assuming k is positive. k(524/15) Simplify ((u(-4/3)/uu)/(uuu(6/7)))(-2/57) assuming u is positive. u(176/1197) Simplify (vv*(2/35)v)(-8) assuming v is positive. v(-576/35) Simplify ((p/(p/((p*(-1/11)p)/p)))/pp/p4)/(p(6/5)p(1/5)) assuming p is positive. p(-302/55) Simplify z/z*(1/15)(z/(z*(-2/17)z))/z assuming z is positive. z(13/255) Simplify (h(-3/5)/h*0)/(h((h/h*(-1/3)h)/h)/hh(h*(2/13)h)/hh) assuming h is positive. h(-797/195) Simplify ((kk/k*0kk)/k)31k/(k*(-9)/kk)k(7/4) assuming k is positive. k(419/4) Simplify (m(3/7)m(3/5))(1/8) assuming m is positive. m*(9/70) Simplify ((d/((dd2/d)/d))/d)(-38)d10((d/d(-6))/d)/d assuming d is positive. d53 Simplify z*4z/(z/z*(2/9))zz/(z(3/7)z)z(-2/9) assuming z is positive. z(32/7) Simplify (k((((k1/k)/k)/k)/k)/k)50/(k*(-2/5)/(kk/k0)) assuming k is positive. k(-738/5) Simplify v/(vv11v)vv(-3/5) assuming v is positive. v(-58/5) Simplify (x(-1))(-5/7)(x(-1/4))(-25) assuming x is positive. x(195/28) Simplify ((bb(-9/2))/b)/b(5/4) assuming b is positive. b*(-23/4) Simplify (v(v/(vvv32))/v)/(v/((v/v(-3))/v)) assuming v is positive. v(-31) Simplify (((v/v(3/5))/vv)44)(-1/16) assuming v is positive. v(-11/10) Simplify (qq/(qq(q(q/(q3/qqqq))/qqq)/q))/qqq/q2 assuming q is positive. q2 Simplify (c/(c/(c(-1)/c)))22 assuming c is positive. c(-44) Simplify (p11)(-8) assuming p is positive. p(-88) Simplify u(-3)/u8(u/(u(-3)/u))/u(10/7) assuming u is positive. u(-52/7) Simplify (t(-1)/t(-1/11))(-6/11) assuming t is positive. t(60/121) Simplify (q/q(-6)qq/(qq(2/7)))/((q/q(-2/5))/(q/(q*3/q)q)) assuming q is positive. q*(221/35) Simplify www(-4)www*(7/5)ww(-1)/w7 assuming w is positive. w(-28/5) Simplify r(2/9)rr(6/13) assuming r is positive. r(197/117) Simplify i(-4)i6 assuming i is positive. i2 Simplify (hh15)/(((hhh/((h/(hhh19/h))/h)h)/h)/hh) assuming h is positive. h(-7) Simplify (tt/t*(-8)t)/t*1(t0)(-16) assuming t is positive. t*10 Simplify ((j(jj(1/4))/j)/(jj(-2/23)/j))/((j0/j)/j5) assuming j is positive. j(675/92) Simplify (f(-1/3))(8/11)f(-1/4)/f(-2/3) assuming f is positive. f(23/132) Simplify (y(4/23)/y)(-31) assuming y is positive. y(589/23) Simplify q/(qq*3/q)((q/(q*(7/3)q))/q)/qq(q*(4/5)qqqq)/(qq*(1/3)/qq) assuming q is positive. q(-28/15) Simplify (p(-2/5))(1/2)/((p(1/3)p)/(p(-6)/p)) assuming p is positive. p(-128/15) Simplify (k(-5/4)k)/k*2(k(2/5))(2/41) assuming k is positive. k(-1829/820) Simplify (c(-5/3)/c)(-46) assuming c is positive. c(368/3) Simplify (v/(v/((vvvv(vvv*(-5))/vv)/vv)))/v(-2/3)(vv(-1))48 assuming v is positive. v(5/3) Simplify (u8uu(-4/9))(-44) assuming u is positive. u(-3388/9) Simplify y((yyy/(y*(-4)/y)y)/y)/yy*(-21) a	{ "pile_set_name": "DM Mathematics" }
.129604. Round g to four dps. 0.0006 Let o(a) = 89997a2 - a. Let i be o(-1). Let c be (2 + i)/(2/2). What is c rounded to the nearest one hundred thousand? 100000 Let i be 0 - -2 - (2 + -5). Suppose iz + 28307 = -4o - 16093, -4z = -o - 11100. What is o rounded to the nearest one thousand? -11000 Suppose -m - 4m + 1500 = 0. Round m to the nearest 100. 300 Let r = -23 - -2. Let o be -2 - -1 - (3 - r). What is o rounded to the nearest ten? -30 Let n = -315 - -364.6. Let i = 49.8002 - n. Let g = i - 0.2. Round g to 4 dps. 0.0002 Let x = -49 + 48.51. What is x rounded to one decimal place? -0.5 Let i = -0.25 - -0.2513. Round i to 3 dps. 0.001 Let a = 1.8 - 0.9. Let y = 0.1 - a. What is y rounded to one decimal place? -0.8 Let z be 425-101000. What is z rounded to the nearest one million? -1000000 Let i = -26.25 - -36. Let q = i + -10. What is q rounded to one decimal place? -0.3 Let w = 20.21 - 21. Let y = w - -0.7900099. What is y rounded to six dps? 0.00001 Let k = 22 + -21.9999987. Round k to six decimal places. 0.000001 Let w = 712.18 - 739. Let o = w - -20.8. Let s = -0.12 - o. What is s rounded to the nearest integer? 6 Let p be 1/(-1) + 2 + -26. Round p to the nearest 10. -30 Let v = 161.99931 + -162. What is v rounded to 4 dps? -0.0007 Suppose -9u + 11u + 73400 = 0. What is u rounded to the nearest one thousand? -37000 Let k = -28 - -28.11. Let y = 0.078 - k. What is y rounded to 2 dps? -0.03 Let p = 0 + 8. Let t = p - -1. Round t to the nearest ten. 10 Let m = 35 + -20. Let f = -15.025 + m. Round f to 2 decimal places. -0.03 Let f = -0.025 + -137.975. Let z = f - -151.1. Let y = z + -13.0887. Round y to 3 decimal places. 0.011 Let x be 6/4 - 25/(-10). Let u be (-2 - (2 - 2)) + x. Suppose m = -5h + 364998, -m - 146002 = -uh - 0m. What is h rounded to the nearest ten thousand? 70000 Let i(c) = -5 + 111c - 5 + 999c. Suppose h + h = -18. Let y be i(h). Round y to the nearest ten thousand. -10000 Suppose -h - 10 = -3h. Suppose 195 = 5v + hl, 3v = -v - 3l + 157. Let d = -76 + v. Round d to the nearest ten. -40 Let g(y) = 3y + 78000. Let u be g(0). What is u rounded to the nearest 10000? 80000 Let f = -279818 + 923329. Let p(d) = -d3 - 146489. Let s be p(0). Let l = s - f. Round l to the nearest one hundred thousand. -800000 Let w(s) = -16s - 8. Let h be w(-7). Round h to the nearest 10. 100 Let c = 2.89952 + -2.9. Round c to four decimal places. -0.0005 Let s = 5 + -3. Suppose -sd = -3d - 81. Let h = d - -48. What is h rounded to the nearest ten? -30 Suppose -6m = -2x - 5m - 7597, -4x - 15209 = 3m. Round x to the nearest one hundred. -3800 Let k = 25.99996 + -26. Round k to 5 decimal places. -0.00004 Let z = 191.788 - -0.212. Let o = -137.1 + z. Let n = o + -50. What is n rounded to the nearest integer? 5 Suppose 0 = -5c - 2s + 3602, -c - 1436 = -3c + 4s. Suppose 5o - c = o. What is o rounded to the nearest 100? 200 Let n(p) be the first derivative of 593p4/4 + 5p*3/3 - 1. Let i be 1(-2)/(-4)-10. Let b be n(i). What is b rounded to the nearest 10000? -70000 Let l = 56 - 55.686. Let f = -5 + 5.36. Let i = f - l. Round i to two decimal places. 0.05 Let b = -278 - -265.7. Let f = 23.7 + b. What is f rounded to the nearest integer? 11 Let b(n) = -16n. Let r be (-260)/36 + (-2)/(-9). Let q be b(r). What is q rounded to the nearest 10? 110 Let h = 0.072 - -46.928. Let b = h - 47.019. What is b rounded to 2 dps? -0.02 Let r = 105 + -105.00000018. What is r rounded to seven decimal places? -0.0000002 Let w = -27.9496 + 28. What is w rounded to two decimal places? 0.05 Let d = -1363.33873612587 - -26831702.03873600587. Let g = -26830338 + d. Let i = 0.7 - g. What is i rounded to 7 dps? 0.0000001 Suppose 0 = -10i - 10495265 - 130504735. Round i to the nearest one million. -14000000 Let u = 2.4 + 0.6. Let c = u - 3.38. Round c to one dp. -0.4 Let y be 12/4 + (-4 - -5). Suppose yu + 69 = -35. What is u rounded to the nearest ten? -30 Let y = 125.7 + -142. What is y rounded to the nearest 10? -20 Let a be -8-22/8. Suppose 2o + 3l - al + 19 = 0, 3l - 49 = 5o. Let k be 0 + 3599999 - 8/o. Round k to the nearest 1000000. 4000000 Let f = 546432339.99999921 - 546432421. Let m = f + 81. What is m rounded to seven decimal places? -0.0000008 Let b be -120/5 + -91996. Round b to the nearest 10000. -90000 Let a = 0.35676 + -0.36. Round a to 4 decimal places. -0.0032 Let v = 643 + -643.000277. What is v rounded to five dps? -0.00028 Let s be (-155)/(1/3226-2). Suppose n + 200010 = 5n - 2y, 5n - s = 3y. What is n rounded to the nearest 100000? 100000 Let p = -81 - -14. Let o = p - -66.9999899. What is o rounded to 6 decimal places? -0.00001 Let k = -39 + 39.034. Round k to 2 dps. 0.03 Let r = 14.476 + 1.154. Let a = r - 15. Round a to one decimal place. 0.6 Suppose 0 = 5g - p - 19, -4g + 3p + 10 = -3. Suppose 3w = -1 - 14, -gi + 4w = 271980. Round i to the nearest ten thousand. -70000 Suppose -j - 19999995 = 4y, 3j - 20000010 = 4y + j. What is y rounded to the nearest one million? -5000000 Let h be 3 - (9/3 + 4800000). What is h rounded to the nearest 1000000? -5000000 Let a = -4.4000064 + 4.4. What is a rounded to six dps? -0.000006 Let j = -228 - -222.88. Let b = j - -0.12. Let p = b + 4.924. Round p to two dps. -0.08 Let f = 5 - 6.1. Let g = 2.9 - f. Let l = g - 3.85. Round l to one decimal place. 0.2 Let w = 17.8296 + -17.8421681. Let s = -2.5291019 + w. Let l = -2.54 - s. What is l rounded to 4 dps? 0.0017 Let v = 2470965 + -4550965. Round v to the nearest one hundred thousand. -2100000 Suppose -2z = 4z. Suppose z = -7r + 3r + 244000. Round r to the nearest ten thousand. 60000 Let g = 104502953.999963 + -104503017. Let y = 63 + g. What is y rounded to five decimal places? -0.00004 Let k = 0.5 + -0.54. Let n = k + -0.3. Let a = n + 0.33999929. Round a to 7 decimal places. -0.0000007 Let z = 485.9683 - 486. Let t = 0.5497 + z. Let i = t - 0.5. What is i rounded to 2 decimal places? 0.02 Let c = 743 + -715.915. Let k = 27 - c. Round k to two dps. -0.09 Let b = 0.01 - 1.01. Let o = 1.75 + b. What is o rounded to 1 decimal place? 0.8 Let y = -0.9577 - -46.9957. Let d = -0.038 + y. Let s = d + -45.9934. What is s rounded to three dps? 0.007 Let r = 895 - 615. What is r rounded to the nearest ten? 280 Let n = 12.6 + -12.6000006. What is n rounded to 7 decimal places? -0.0000006 Let h = 0.08 - 0.41. Let l = h + 0.32999868. What is l rounded to seven dps? -0.0000013 Let u = -4 + 3.96. Let z = u + -0.05. What is z rounded to 1 decimal place? -0.1 Let j be 1 + 0/(-2) + 4. Let m = j - 2. Suppose mn + 501226 = -278774. Round n to the nearest one hundred thousand. -300000 Let w = -0.88 + 1.57. Let t = 5.45 + w. Let i = -5.2 + t. What is i rounded to 1 dp? 0.9 Let x(u) = -80974u - 10 + 30031u - 82389u + 2. Let a be x(6). What is a rounded to the nearest one million? -1000000 Let a = -5.1 - -33.5. What is a rounded to zero decimal places? 28 Suppose 0 = a + 60137 + 99863. Let p be (a/(-6))/(7/714). What is p rounded to the nearest one hundred thousand? 2700000 Let u = 0 - 0.36. Let f = u - 0.29. Let l = f - -0.13. What is l rounded to 1 dp? -0.5 Let s = 0 - -7. Let v = 7.0008 - s. Round v to 3 dps. 0.001 Let x = 0.401 + -0.400999286. What is x rounded to seven decimal places? 0.0000007 Let z = 46 + -72. Let s be 8(1/1 + z). What is s rounded to the nearest 100? -200 Let j = 35.1545 + -43.15515. Let y = j + 8. What is y rounded to four dps? -0.0007 Let b = 122 + -121.9106. Let q = -70 - -70.082. Let o = q - b. What is o rounded to 3 decimal places? -0.007 Let k = -47.4 - -47.687. What is k rounded to two dps? 0.29 Suppose -2l = 2l. Let o be -5299997 - (2 + l - -1). What is o rounded to the nearest 1000000? -5000000 Let c = -23 + 60. What is c rounded to the nearest 10? 40 Let l(k) = 2k3 - k2 - 3k + 2. Let x be l(2). Let w(m) = 2499m + 8. Let c be w(x). What is c rounded to the nearest 10000? 20000 Let r = -1 + 1.3. Let y = r - 0.300096. Round y to 5 decimal places. -0.0001 Let d = -0.117575 - -0.16762. Let f = -0.05 + d. Round f to five dps. 0.00005 Suppose -4y - 52 = -2m, 2m + 44 = 6m + 4y. Suppose -r + 11 = 5z, 5z = z - m. Round r to the nearest 10. 30 Let m(f) = 4277f - 8. Let z b	{ "pile_set_name": "DM Mathematics" }
n(g) = 13j(g) + 6z(g). Factor n(v). -2(v - 1)3 Suppose 0 = 3u - 2h - 27, -5u - h + 45 = h. Factor 2q5 - uq*4 + 2q5 + q3 + 31q3 - 16q*2 - 11q*4. 4q*2(q - 2)*2(q - 1) Let z(c) be the first derivative of -c*4/4 - 2c3/3 - 9. Factor z(g). -g2(g + 2) Suppose 3m - 42 = -42. Factor m + 2/9q2 - 2/3q. 2q(q - 3)/9 Let c(o) be the second derivative of -o6/1440 + o5/240 - o4/96 - o3/3 - 4o. Let j(s) be the second derivative of c(s). Solve j(a) = 0 for a. 1 Solve 3/2 - 9/8c*2 - 3/8c*3 + 0c = 0 for c. -2, 1 Let l(j) be the first derivative of -4j7/525 - j6/300 - j2/2 - 2. Let y(v) be the second derivative of l(v). Factor y(a). -2a*3(4a + 1)/5 Let x(k) = k3 + 3k*2 + 8k - 2. Let b(i) = -4i3 - 8i*2 - 25i + 7. Let w(l) = -2b(l) - 7x(l). Factor w(c). c(c - 6)(c + 1) Let a = -4023/5 + 809. Suppose 12/5 - ab + 6/5b*2 = 0. What is b? 2/3, 3 Suppose 16 = 5m + 1. Factor m - 6 + 3 - o + o*2. o(o - 1) Let l be (-1)/980(-28)/211. Let z(s) be the third derivative of -ls7 + 0 + 1/210s*5 + 0s*3 + 0s + 4s2 + 0s*4 + 0s*6. Factor z(h). -2h*2(h - 1)(h + 1)/7 Suppose -2q - 5b - 34 = -3q, 5q - 116 = -2b. Let j be (3/42)/(6/q). Factor 2/7h2 - jh*3 + 2/7h - 2/7. -2(h - 1)2(h + 1)/7 Let q(v) be the third derivative of v*8/144 - 8v*7/315 - 17v6/360 + v5/30 + 8v2. Find o, given that q(o) = 0. -1, 0, 2/7, 3 Let f(t) be the third derivative of t5/20 - 2t*3 + 10t*2. Let f(g) = 0. What is g? -2, 2 Let -3/2j*4 + 9/2j*2 + 0j*3 + 3j + 0 = 0. Calculate j. -1, 0, 2 Factor 2m2 - 6 + 1 + 2 + 1. 2(m - 1)(m + 1) Let i(g) be the second derivative of -1/36g*4 + 0g*3 - 2g - 1/2g2 - 1/90g*5 + 0. Let c(w) be the first derivative of i(w). Factor c(n). -2n(n + 1)/3 Let i(d) be the second derivative of 5/18d*4 - 1/21d*7 + 1/18d*5 - 4/9d*2 + 0 + 0d*3 - 1/9d*6 - d. Factor i(b). -2(b + 1)*3(3b - 2)2/9 Let c = 393 + -23579/60. Let t(q) be the second derivative of -1/24q*4 + 0 + 1/24q*3 + 0q*2 - 1/168q*7 + cq*6 + 0q*5 + 2q. Factor t(m). -m(m - 1)3(m + 1)/4 Suppose g - 20 = -3g. Let b be 31 - (1 - 0). Factor br - r2 - 3r + 0 + g - 3. -(r - 1)(r + 2) Factor -80y*2 - 8y*4 + 10y*3 + 95y*2 + 3y*4. -5y*2(y - 3)(y + 1) Suppose w - 6w - 15 = 0. Let y be w/(2/(-6)3). Solve -2/3n*4 + 2/3n + 0 + 2ny - 2n*2 = 0 for n. 0, 1 Let i be 1/(0 + (-3)/(-3 - 6)). Suppose -4u = u. Solve -1/4s4 + u + 1/4s*i + 0s - 1/4s5 + 1/4s2 = 0 for s. -1, 0, 1 Let q(c) be the second derivative of c6/25 - 9c5/25 + 9c*4/10 + 4c - 7. Factor q(a). 6a2(a - 3)2/5 Let r(z) = z2 + 3z - 5. Let u be r(-5). Factor -2b*2 - 2b*2 + 14b - 12b3 - 7b*3 + ub*3 + 4. -2(b - 1)(b + 1)(7b + 2) Suppose 3/2t*4 + 0t + 0 - 3t2 - 3/2t*3 = 0. What is t? -1, 0, 2 Factor -11/7x*2 - 1/7x*5 + 3/7x*4 + 1/7x*3 + 12/7x - 4/7. -(x - 2)(x - 1)3(x + 2)/7 Let q(w) be the third derivative of w*5/390 + 7w*4/156 + 2w*3/13 - 22w*2. Determine s, given that q(s) = 0. -6, -1 Let j(f) be the first derivative of -25f*4/6 - 10f3/3 - f2 - 2f/15 + 5. Determine d so that j(d) = 0. -1/5 Let z(y) = 405y*4 + 225y*3 - 125y*2 + 55y. Let t(i) = 29i4 + 16i*3 - 9i*2 + 4i. Let a(q) = -55t(q) + 4z(q). Let a(k) = 0. What is k? -1, 0, 1/5 Suppose -4p = -2h + 22, 4h - 20 = p + p. Factor -q3 + 0qh + 4 - 4. -q3 Let k be 2/(-14)77/(-660). Let q(x) be the third derivative of 1/360x*6 + 0x*3 - kx5 - x2 - 1/72x4 + 0x + 1/210x7 + 0. Factor q(j). j(j - 1)(j + 1)(3j + 1)/3 Let w(g) be the second derivative of g6/1260 - g5/210 + g4/84 + 4g*3/3 - 3g. Let p(k) be the second derivative of w(k). Solve p(z) = 0 for z. 1 Let y(w) be the first derivative of -w*5/40 - 3w + 1. Let l(u) be the first derivative of y(u). Factor l(b). -b*3/2 Let f be (-1 + 9)/(-1) + -2. Let q(m) = -16m*2 + 34m - 14. Let d(j) = -2 - 13j2 - 11j + 18j2 + 7. Let u(h) = fd(h) - 3q(h). Factor u(x). -2(x - 2)2 Let u(l) = -l2 + 2l + 3. Let r(t) = t - 1. Let s(a) = -2a*2 + 9a + 3. Let o(z) = -4r(z) + s(z). Let d(i) = 2o(i) - 5u(i). Find b, given that d(b) = 0. -1, 1 Let d be ((-1)/(-150))/(4/5). Let b(y) be the third derivative of 2y*2 + dy*6 + 0y*5 + 0 + 0y*3 + 0y*4 + 0y. Suppose b(u) = 0. Calculate u. 0 Let v(w) be the third derivative of 109/300w6 + 0 + 0w*3 + 1/15w*4 + 7/120w*8 + 0w - 6w2 - 6/25w*7 - 6/25w*5. Factor v(s). 2s(s - 1)2(7s - 2)2/5 Let k(q) be the first derivative of -q4/16 + q3/6 - q2/8 - 5. Determine c, given that k(c) = 0. 0, 1 Let z = 4 - -6. Factor 4v - v - 16 + 0v4 + 12v*2 - zv*3 + 5v + 2v4. 2(v - 2)*3(v + 1) Let h(s) be the first derivative of -4/11s2 + 0s - 4/55s5 - 1/33s*6 + 3/22s*4 + 3 + 8/33s*3. Determine a so that h(a) = 0. -2, 0, 1 Let b(n) = n + 5. Let g be b(-3). Solve 4m + 5mg + 5m*3 + 3m*2 + 2m - 2m + m4 = 0 for m. -2, -1, 0 Let u(a) be the third derivative of a7/1260 - a5/60 - a4/18 - a3/3 + 6a*2. Let z(m) be the first derivative of u(m). Suppose z(g) = 0. Calculate g. -1, 2 Let m = 130 - 125. Let t(x) be the third derivative of 0x*6 + 0x + 1/90xm - 1/72x*4 + 0 - 3x*2 + 0x*3 + 1/1008x*8 - 1/315x*7. Factor t(j). j(j - 1)*3(j + 1)/3 Let b(w) be the first derivative of -2w5/45 + 5w*4/9 - 16w*3/9 + 22w*2/9 - 14w/9 + 29. Let b(l) = 0. Calculate l. 1, 7 Suppose -9/2l - 3/4l2 - 15/4 = 0. Calculate l. -5, -1 Let q(h) be the third derivative of -h7/3150 - h6/900 + h5/75 + 5h4/24 - 6h*2. Let g(t) be the second derivative of q(t). Let g(l) = 0. What is l? -2, 1 Let p(k) be the first derivative of -2k6/45 - k5/5 - k*4/3 - 2k*3/9 + 4k - 2. Let j(s) be the first derivative of p(s). Factor j(c). -4c(c + 1)*3/3 Let w(n) be the second derivative of -3n*5/20 - 5n*4/4 - 3n*3/2 + 27n*2/2 + 2n. Let w(m) = 0. Calculate m. -3, 1 Suppose 2j - a - 3 - 2 = 0, -3j - 25 = 5a. Let g(t) be the first derivative of 1/2t4 + t2 + 2 - 4/3t3 + jt. Factor g(w). 2w(w - 1)*2 Let l(t) be the first derivative of -3t*3 - 3t - 3/4t4 + 10 - 9/2t*2. Let l(a) = 0. Calculate a. -1 Suppose 5p + 3s - 25 = 0, 0p + 4s = 4p + 12. Let m(k) be the third derivative of 0k - 1/24k*4 + 1/60k5 + kp + 0k3 + 0. Factor m(d). d(d - 1) Let p be 3/((-162)/8)12/(-8). Factor 2/9y*2 + 0 - py. 2y(y - 1)/9 Factor -2/17d2 - 2/17d*3 + 0 + 4/17d. -2d(d - 1)(d + 2)/17 Solve 3/8 - 1/4l - 1/8l2 = 0. -3, 1 Let l(q) be the third derivative of 1/24q*3 + 1/48q*4 + 2q*2 + 0 + 1/240q*5 + 0q. Let l(t) = 0. What is t? -1 Let a(z) be the third derivative of z8/840 - z7/525 - z6/150 + z5/75 + z4/60 - z3/15 - 7z2. Let a(o) = 0. Calculate o. -1, 1 Let g = 0 - -6. Let s be g + 5/(15/(-6)). Factor 0f + 2/3f5 - 16/3f*2 + 0 - sf*4 + 8f*3. 2f*2(f - 2)3/3 Let o(u) = -u3 + 4u2 - 4u + 2. Suppose -4 = i - 3i. Let m be o(i). Factor 5z*4 - 2z*2 + 7z*3 + 0z*2 + 0z*4 + 4zm. z2(z + 1)(5z + 2) Let q(f) = f3 + 7f*2 + 7f + 8. Let u be q(-6). Factor -5pu + 3p2 + p2. -p*2 Find w such that 0 + 0w*4 + 0w + 0w2 + 2/15w*3 - 2/15w5 = 0. -1, 0, 1 Let w(b) be the third derivative of b8/10080 + b7/1260 + b6/360 - 2b5/15 + 4b*2. Let m(u) be the third derivative of w(u). Let m(a) = 0. What is a? -1 Suppose 15 = 8v - 25. Suppose -1 = 2p - v. Factor -2x*p + 2x - 1/2. -(2x - 1)2/2 Suppose 8j*2 - 87j4 - j3 + 89j4 - 7j3 = 0. What is j? 0, 2 Let b(k) be the first derivative of -k5/20 + k*3/12 - 6. Solve b(f) = 0. -1, 0, 1 Let g(m) be the first derivative of -25m*4/6 - 110m*3/9 - 13m*2 - 6m + 2. Factor g(l). -2(l + 1)(5l + 3)2/3 Determine k, given that 3/4k*3 + 0 + 0k - 3/4k2 = 0. 0, 1 Let d(x) = -11x*2 - 9x + 2. Let h(m) = -5m2 - 4m + 1. Let n(c) = 6d(c) - 13h(c). Solve n(r) = 0. -1 Let r(u) be the second derivative of -u*5/4 - 7u4/12 - u3/3 + 30u. Factor r(k). -k(k + 1)(5k + 2) Let b(z) be the second derivative of z*4/96 + 5z*3/48 - 3z*2/8 + 27z. Factor b(v). (v - 1)*(v +	{ "pile_set_name": "DM Mathematics" }
) + -1) + 0). -5 + 225sqrt(2) Simplify (2 + (sqrt(539) - (-1 + sqrt(539))-5) + 1 + sqrt(539) + -3)*26. -2940sqrt(11) + 158616 Simplify (sqrt(170)/(sqrt(810)-1))*2 - ((-5sqrt(1700) - sqrt(1700))-4)2. -79315183/81 Simplify -5(1 + -2 + (sqrt(76) + -3)*2) + 3. -417 + 60sqrt(19) Simplify ((sqrt(13) + sqrt(104)/sqrt(2))61)*2 - (-2sqrt(1053) + -3)5. 90sqrt(13) + 4227 Simplify ((sqrt(7) - (1sqrt(7) + -4)) + sqrt(7))-1 - (sqrt(7) + -1 + -5)5. -6sqrt(7) + 26 Simplify 1 + sqrt(500) - ((sqrt(300)/sqrt(6))/sqrt(10))*2 - 2sqrt(20)/(sqrt(12)/sqrt(27)). -4 + 4sqrt(5) Simplify (sqrt(21)/(sqrt(56)/sqrt(200) - sqrt(7)) + (sqrt(12)/sqrt(2) - sqrt(6))/sqrt(2) + 5 + sqrt(27))-3. -15 - 21sqrt(3)/4 Simplify (sqrt(144)/(sqrt(324) - (sqrt(324)1 + sqrt(324) + sqrt(324) + sqrt(324))))/(6(2sqrt(192) - sqrt(192))). -sqrt(3)/648 Simplify 4(((sqrt(153) + sqrt(153) + sqrt(153)-1 + sqrt(153))4)/(((sqrt(81) - (sqrt(81)1 - sqrt(81)) - sqrt(81)) + sqrt(81) + sqrt(81))/sqrt(9)))*2-3. -3264 Simplify (5 + -2(-2 + sqrt(500) + sqrt(500))-4-1)2. -6720sqrt(5) + 128441 Simplify -3(sqrt(304) - (2 + sqrt(304)3)) + -2 + sqrt(304) + 0 + -4. 28sqrt(19) Simplify 5(-2sqrt(160)-4)/(sqrt(24)/(sqrt(36)/(sqrt(192) - sqrt(12)))). 80sqrt(5)/3 Simplify 2((4sqrt(312)-2 - sqrt(312))/sqrt(6))/(sqrt(32)/(sqrt(8)1 + sqrt(8))-3). 12sqrt(13) Simplify 1 + -1 + (-1 + -3 + (0 + sqrt(612) - sqrt(612)))2. 16 Simplify 3 + -4 + 1sqrt(5) + sqrt(15)/sqrt(3) + -4 + 0. -5 + 2sqrt(5) Simplify (((1(sqrt(209) - (2sqrt(209) + sqrt(209))) - sqrt(209) - sqrt(209)) + (sqrt(209) - 42sqrt(209)))/(-5(sqrt(11) - (sqrt(176) - 2sqrt(176)))))2. 2299/625 Simplify ((51sqrt(42))/(-5sqrt(18)/sqrt(3) - sqrt(6)))*2-55. -4375/36 Simplify (-5 + (sqrt(80)-5 - sqrt(80))-5 + 1)2. -960sqrt(5) + 72016 Simplify 4 + 2 + 4(2 + sqrt(245)). 14 + 28sqrt(5) Simplify (2sqrt(2448) + 5)2 - (sqrt(306)/sqrt(2) - sqrt(34)/sqrt(2)-5)*2. 240sqrt(17) + 8729 Simplify (-3 + (sqrt(85) + -2sqrt(85)-5)/(sqrt(720)/sqrt(4)))3. -9 + 11sqrt(17)/2 Simplify (sqrt(1936)2 - -1sqrt(256))/(sqrt(648) + (-1sqrt(648) - sqrt(648)) + sqrt(96)/sqrt(3)). -26sqrt(2)/7 Simplify (2(sqrt(144)1 - sqrt(144)) + sqrt(144))/(sqrt(21)/(sqrt(14)/sqrt(2)))4. 16sqrt(3) Simplify (sqrt(77) + -5(sqrt(77) + -1sqrt(77)) - (sqrt(77) - (-5(sqrt(77) - sqrt(77)-2) + sqrt(77))))/((sqrt(343) + -2sqrt(343))1). 2sqrt(11) Simplify (-4 + 0 + sqrt(57)/sqrt(3) + (sqrt(19) - sqrt(76)-6 - sqrt(19)))*2 + ((5 + (sqrt(475)-2 - sqrt(475)) - sqrt(475)) + 5 + sqrt(475)2 + sqrt(475))2. -204sqrt(19) + 3802 Simplify 4sqrt(21)/sqrt(7)5 - (2 + (sqrt(192) + sqrt(3))*21). -245 + 20sqrt(3) Simplify (-3sqrt(228)-2)/sqrt(12) + (sqrt(304) + (sqrt(304) + (sqrt(304)-4 - sqrt(304)) - sqrt(304)))*23. 6sqrt(19) + 14592 Simplify -1 + -1 + (-3sqrt(104)/sqrt(2)1)2. 466 Simplify 0 + (-2sqrt(2057)-2 - -5sqrt(2057)1)2. 166617 Simplify 4 + (2 + 3sqrt(3))*2 - sqrt(33)/(sqrt(11) - -6sqrt(22)/sqrt(2)). 83sqrt(3)/7 + 35 Simplify (4(1sqrt(9)1)/(-5sqrt(48)) + -3)2. 6sqrt(3)/5 + 228/25 Simplify (5 + sqrt(1377) + 1 + 4 + (1sqrt(1377) + sqrt(1377) + -4 - sqrt(1377)) + -3)2. 108sqrt(17) + 5517 Simplify (4 + (-2 + sqrt(5) + sqrt(20))32)*2. -288sqrt(5) + 1684 Simplify (sqrt(84)/(sqrt(24)/sqrt(4)) - sqrt(14) - (sqrt(14) - sqrt(224) - sqrt(14))4)/(-6(sqrt(42)/sqrt(3))/sqrt(2)). -8sqrt(2)/3 Simplify (sqrt(153)/(sqrt(54)/sqrt(6)) + (sqrt(17) - (2 + sqrt(17)-1)) - (1sqrt(119)3)/(-1sqrt(175)))2. -72sqrt(17)/5 + 5608/25 Simplify (-3(sqrt(304) + -2) - (6(sqrt(114) - sqrt(114)1))/sqrt(6)) + 1. -12sqrt(19) + 7 Simplify 5 + (((sqrt(72) - (1 + sqrt(72))) + 5)*2 - sqrt(72) - (sqrt(72) + 0 + -4)) + 4. -12sqrt(2) + 29 Simplify ((sqrt(77) + (sqrt(77) - -2sqrt(77)) + sqrt(77))-4 - sqrt(77) - sqrt(77) - 3(-1sqrt(77) - sqrt(77) - sqrt(77)))/((sqrt(630)-1)/sqrt(10)). 13sqrt(11)/3 Simplify (2sqrt(140) - (2sqrt(315) + sqrt(315)))/(5(sqrt(245) + (sqrt(245)2 - sqrt(245)) + sqrt(245))) + 4. -sqrt(7)/21 + 4 Simplify (((sqrt(15) + (sqrt(90) + sqrt(90) + (sqrt(90)2 - sqrt(90)) + sqrt(90))/sqrt(6))4)/(sqrt(20)/(5sqrt(8)/sqrt(2) - sqrt(4))))2. 19200 Simplify (sqrt(272) + 1 - sqrt(17) - (sqrt(51)/sqrt(3) + 4) - sqrt(51)/(sqrt(192)-1))*2. -51sqrt(17)/4 + 5489/64 Simplify 3(2 + sqrt(425) + (-1 + sqrt(425) + sqrt(425) + -2 - sqrt(425))2)3. -225sqrt(17) + 3924 Simplify ((sqrt(77) - -1-5sqrt(77)) + sqrt(77))/(sqrt(176)2). -3sqrt(7)/8 Simplify ((2 + sqrt(176))1)*2 + 3 + 1. 16sqrt(11) + 184 Simplify -2((sqrt(1300) - (-1 + sqrt(1300))) + 3 + sqrt(78)/(sqrt(294) - -2sqrt(294))). -8 - 2sqrt(13)/21 Simplify ((2sqrt(20)/sqrt(2) + sqrt(10))6)/(sqrt(22)/sqrt(44) + -4(2sqrt(2) + sqrt(2))). -36sqrt(5)/23 Simplify (5((1 + sqrt(468))2 - (sqrt(468) + (-5-1sqrt(468) - sqrt(468)))))*2. -1800sqrt(13) + 105400 Simplify -2 + (-2((2 + -1sqrt(704))5 + -2))2. -2560sqrt(11) + 70654 Simplify (((sqrt(27)2)/sqrt(9) - sqrt(24)/(sqrt(24)/sqrt(3)) - (-2(sqrt(243) + -1 + sqrt(243)) + sqrt(243)))-1)2. -112sqrt(3) + 2356 Simplify (sqrt(76)-2-4-1)/(sqrt(96)/sqrt(6)-5). 4sqrt(19)/5 Simplify (3(sqrt(130) + -6sqrt(130)3))/(-1sqrt(90)-1). -17sqrt(13) Simplify (-3(5sqrt(136)-3)/(sqrt(128) + sqrt(128)-5))2. 34425/256 Simplify 5(1sqrt(152)1)/(1-2sqrt(8)). -5sqrt(19)/2 Simplify 6(sqrt(100)3)/sqrt(5) + -4. -4 + 36sqrt(5) Simplify 4 + sqrt(147)-1 + (sqrt(300) - (-2 + (sqrt(300)-4)*2)). -4794 + 3sqrt(3) Simplify (5(sqrt(133) - (sqrt(133) - (sqrt(133)-3 + sqrt(133)) - sqrt(133) - sqrt(133))))/(sqrt(6776)/sqrt(8)). 0 Simplify (-3 + (sqrt(1216)-1 + -3 - (3sqrt(1216)6 + sqrt(1216))))2. 1920sqrt(19) + 486436 Simplify (((1(sqrt(171)-4 + sqrt(171) + sqrt(171)) - sqrt(171))1)/(5sqrt(576)-3))2. 19/1600 Simplify (sqrt(245) + (sqrt(245) - (sqrt(245)-2 + sqrt(245) + 4)))*2 + 1 + ((sqrt(245) - (sqrt(245) + -1))-1 - (sqrt(245) + 0 + sqrt(245)1))2. -140sqrt(5) + 3203 Simplify sqrt(24)/(sqrt(96)/(-2sqrt(12))) - (-1 + 2sqrt(3) - sqrt(15)/(sqrt(80) + sqrt(5))). -19sqrt(3)/5 + 1 Simplify sqrt(117) + -5 - -4-2sqrt(13) - ((-2sqrt(1872) + 0)*2 - (((sqrt(1872)2)*2 - sqrt(1872)) + -2)). -17sqrt(13) - 7 Simplify ((sqrt(153) - (sqrt(153) - 6(sqrt(153)1 - sqrt(153)) - sqrt(153)))2)/(-6sqrt(576)-2). sqrt(17)/48 Simplify (5(sqrt(540)/sqrt(6))/(1(sqrt(2)1 + sqrt(2))))*2. 1125/4 Simplify (3sqrt(1539)2-4 + 5 + 6(sqrt(1539) + 0 + sqrt(1539) - sqrt(1539) - sqrt(1539)))2. -2160sqrt(19) + 886489 Simplify (sqrt(11)-2)2 + -2 + -4 - (-5 + 2 + sqrt(11)-1)*2. -6sqrt(11) + 18 Simplify (1sqrt(3) + sqrt(3) + sqrt(3) + 1 + -5)2 + (2sqrt(243) + 0)*2. -24sqrt(3) + 1015 Simplify (-3 + sqrt(32) + (sqrt(32) - (2 + sqrt(2048))) + ((2sqrt(192) - sqrt(192))4)/sqrt(6))*2. 80sqrt(2) + 153 Simplify ((sqrt(104) + 4sqrt(104)-2 - sqrt(104))-4)/((sqrt(800) - sqrt(800)-2 - sqrt(800))6). 4sqrt(13)/15 Simplify (sqrt(3)-1)2 + 4 + (5 + 1 + sqrt(3) - sqrt(3)) + sqrt(3) + (sqrt(3) - (2 + sqrt(192) + sqrt(192) + sqrt(3)) - sqrt(3))2 + 1. 69sqrt(3) + 885 Simplify (3sqrt(99)/(sqrt(441)-1) + -3)*2. 18sqrt(11)/7 + 540/49 Simplify ((sqrt(125) + -1)-6)2 + (sqrt(125) + -1 + 2 - sqrt(125)) + 1 + (-1 + sqrt(125) + 2)2. -350sqrt(5) + 4664 Simplify (3sqrt(153)2 + (sqrt(153) + 2sqrt(153) + sqrt(153))3)/(1-3sqrt(900)). -3sqrt(17)/5 Simplify (3sqrt(204)-5)/(-1sqrt(12)5). 3sqrt(17) Simplify -3 + (sqrt(4)/sqrt(8) - (sqrt(288) + -1)) + 21sqrt(98) + 4. 2 + 5sqrt(2)/2 Simplify ((sqrt(7) + sqrt(28)/sqrt(4))-1 - (sqrt(7) + 0 + sqrt(7))3)-4 + 0. 32sqrt(7) Simplify (sqrt(48)/sqrt(2))/sqrt(8) + -4 - sqrt(30)/(-1sqrt(10)5). -4 + 6sqrt(3)/5 Simplify (((1sqrt(228) + sqrt(228))-2 - sqrt(228))/sqrt(12))*2 + -1 + sqrt(19) + 5 + 2. sqrt(19) + 481 Simplify (sqrt(189)-1 - sqrt(63)/(sqrt(9)/sqrt(3)))/((sqrt(6300) - (sqrt(6300) - -2sqrt(6300)))/sqrt(9)). sqrt(3)/5 Simplify ((sqrt(144)/sqrt(4)-6)/sqrt(6))/(sqrt(192) + (-4(sqrt(192) - sqrt(192)-3) - sqrt(192))). 3sqrt(2)/64 Simplify 1 + ((sqrt(300)1 + sqrt(300) + -5)45-4)2. -1280000sqrt(3) + 7840001 Simplify (((sqrt(208) + -2)-3)2 + ((sqrt(208) + 2)2 - sqrt(208)))2. -280sqrt(13) + 3824 Simplify -3*(3 +	{ "pile_set_name": "DM Mathematics" }
se -4 - 6 = -5z. Suppose -5i + i = -q - 17, 0 = -i + q + 2. Suppose 5g - 21 + 85 = zp, 0 = -p - ig + 2. Does 11 divide p? True Suppose -27 = -u - 0u - 4b, -3u + 91 = 2b. Does 8 divide u? False Suppose -5d = 3t - 222, 3d - 4t - 131 = -21. Does 13 divide (-3)/(-6)-6 + d? True Suppose 5n + 3g = 130, 0 = -4n + 2g - 7g + 91. Let v = n - 18. Does 10 divide v? False Let y be 2463/4 - (-2)/8. Suppose 2l - 136 = l + 4u, -5l = -4u - y. Suppose -6b + b = -l. Is b a multiple of 12? True Does 2 divide (22/(-33))/(2/(-6))? True Let w = 1 + 6. Let s be (-2)/1 + (0 - w). Is 2 a factor of (-6)/s + (-7)/(-3)? False Let b = -14 + 34. Does 6 divide b? False Let j(n) = 44n2 - 7n + 7. Let p(h) = -22h2 + 3h - 3. Let k(m) = -2j(m) - 5p(m). Let w(i) = i*3 + 3i2 - 1. Let v be w(-1). Does 8 divide k(v)? False Let d(b) be the second derivative of b6/360 + b5/40 + b4/6 + 3b. Let r(t) be the third derivative of d(t). Does 6 divide r(7)? False Let w = 2 - -2. Let s = 6 - w. Suppose sj - 46 = -5q + 62, j = 3q - 67. Does 8 divide q? False Let c = 10 + 7. Let k = c + -1. Suppose 3m + k = 4m. Is 6 a factor of m? False Let q(p) = -p*3 + 4p*2 - p + 5. Does 25 divide q(-4)? False Let k be (-2)/9 + 4868/36. Suppose 5 = q - 5w, 3q - 3w = -2q + k. Does 12 divide q? False Let n = -34 + 16. Let v = n - -39. Is 6 a factor of v? False Suppose -5t - 23 + 8 = 0. Let d(r) = 6r2 + 4r - 1. Is d(t) a multiple of 12? False Let s = -15 + 19. Is 4 a factor of s? True Let u = -45 + 95. Is 21 a factor of u? False Let f = -17 + -3. Let h = f + 41. Is h a multiple of 6? False Suppose -4x = 2v + 312, 89 - 4 = -x - 4v. Is x/(-4) + (-1)/4 a multiple of 19? True Let i(u) = -u + 13. Let o be i(7). Let g be 1/(12/o). Suppose 2k + gk = 25. Is k a multiple of 2? False Let j(w) = 4w2 - 2w - 1. Let f = 41 + -12. Suppose -3c + 2 = -5n, 3c + 7 = -5n + f. Is 7 a factor of j(n)? False Suppose 0x + 2x + 12 = 0. Let q(p) = -6p + 3. Is 13 a factor of q(x)? True Let n = -1 - -3. Suppose -5s - 11 = -nf, 0 = 4s - 0s + 4. Suppose 0 = -2z - 5l + 27, 4z - l = fz + 3. Does 5 divide z? False Let c = 292 - -28. Does 40 divide c? True Let v(f) = f3 + 5f*2 - 3f + 5. Does 20 divide v(-5)? True Let t(f) = 3f2 - 5f + 7. Let d be t(7). Let j(m) = -m + 35. Let v be j(0). Suppose -3u + d = v. Is u a multiple of 24? False Suppose 3k + 2 = 5. Let w = k - -9. Does 5 divide w? True Let t(n) = 62n2 - 4n + 2. Is 4 a factor of t(1)? True Let z be ((-1)/(-1))/11. Let r(o) = 8o2 + o - 1. Let a be r(z). Let n(k) = k2 - 3k - 10. Is 14 a factor of n(a)? False Suppose 4a - 131 = -q, 3a = -4q + 58 + 50. Is a a multiple of 4? True Let x be (-1)/(-3) + (-268)/(-6). Let j = x + 4. Suppose 3k = 3t + 5k - 31, 0 = -5t - 2k + j. Is t a multiple of 8? False Let i = 26 - 0. Does 13 divide i? True Let r be (2 - 951)-1. Does 4 divide (-3)/(-12) + r/12? True Let z = 0 + 177. Suppose -z + 13 = -4i. Does 9 divide i? False Suppose -5l + 438 = 2d, -3l + 3d + 176 = -70. Does 21 divide l? False Let i be 0 - (-15)/((-3)/(-1)). Suppose 5u - iw - 41 = -1, 5u - 32 = -3w. Is u even? False Let c = -22 + 47. Let t(g) = g - 7. Let u be t(4). Let i = u + c. Is i a multiple of 11? True Suppose 128 = 2u - 3o + 2o, 0 = 4u - 5o - 268. Is u a multiple of 31? True Suppose 6c = 12c - 426. Is c a multiple of 27? False Let v = -20 + 42. Let w = v - 8. Is 8 a factor of w? False Let x = -8 + 22. Is x a multiple of 9? False Let u(j) be the third derivative of j4/24 + j3/3 + 3j*2. Let x = 11 - 4. Does 9 divide u(x)? True Suppose -17 + 245 = p. Does 19 divide p? True Is (-2)/18-6312 a multiple of 27? False Suppose 2o + 8 + 10 = 0. Let n(v) = 243v - 3. Let j be n(-1). Is 15 a factor of (-2)/(-3) + j/o? False Suppose -3g + 0g - 2 = 4p, 4g = -4p + 4. Is g a multiple of 2? True Let q be 0 + 463/(-3). Let p = -21 - q. Suppose -p = -2l - 3l. Is l even? False Let d(l) = -l + 4. Let n be d(6). Is 6 a factor of 1/(n - 147/(-72))? True Let n(i) = 42i*2 - 3i + 3. Does 10 divide n(2)? False Let k(i) = -8i - 82. Is 44 a factor of k(-16)? False Suppose -4o + 185 = k, -o + 3k - 1 = -31. Let y(u) = -16u*3 + 2u*2 - u. Let n be y(1). Let t = n + o. Does 10 divide t? True Let h = 179 + -95. Is h a multiple of 18? False Let q(t) = -9t*3 - 2t2 + 1. Is 4 a factor of q(-1)? True Let j(c) = c3 - 10c2 + 13c - 12. Let l be j(9). Suppose l = 3n + 3g, -5n + g + 20 = -50. Is 5 a factor of n? False Suppose -5h = -9h + 72. Is h a multiple of 18? True Let b = -22 + 9. Let n be (-3)/(3(-2)/56). Let u = b + n. Does 10 divide u? False Let h(f) = f*2 + f + 1. Let q be h(-2). Let a be 1/1 + q + -19. Is 13 a factor of (-10)/a(-114)/(-4)? False Suppose 0c - 3c = 0. Is 3 a factor of (5 - c)(-1 - -2)? False Suppose 7l - 724 - 116 = 0. Does 17 divide l? False Suppose 6b - 628 - 314 = 0. Is 36 a factor of b? False Does 27 divide (972/42)/((-1)/7-1)? True Is 4/(-8)8 - -34 a multiple of 20? False Suppose -4u + 2u + 6 = 0. Suppose -2l = -ux + 200, x + 3l = 5x - 266. Is x a multiple of 15? False Suppose 2n = -n. Suppose 4z - 104 = -n. Is z a multiple of 13? True Let k(j) = j2 + 2j. Let v be k(-2). Suppose -2p - 2x + 45 = 3p, v = -2p - 5x + 18. Is 9 a factor of p? True Let c(q) = 3q - 32. Let w(i) = -5i + 64. Let l(j) = 7c(j) + 4w(j). Let y be l(0). Suppose y = 3f - 4. Does 6 divide f? True Let v be (-10)/(-2)(0 - -1). Suppose 4p - vk - 147 = 0, p = -4k + 26 + 16. Is 14 a factor of p? False Suppose -85 = -6m + 155. Is m a multiple of 7? False Is 12 a factor of 60 - (0 - 0)/(-1)? True Let b(c) = -2c + 1. Does 5 divide b(-4)? False Let k = 42 - -29. Is k a multiple of 19? False Let o = 2 + -5. Let i = -3 - o. Suppose i = n - 3y - 31, -137 = -0n - 5n - 3y. Does 14 divide n? True Suppose 4j = -2p + 80, -3p + 5j + 35 = -30. Suppose p = -5w - 5. Let c(k) = -k3 - 8k*2 - 9k + 8. Is c(w) a multiple of 12? False Suppose 0 = -k - 3i - 11, k - 2i = -i + 1. Is 1/((-2)/(-38 + k)) a multiple of 10? True Let t(o) = -3o + 1. Suppose -7 = -3h + 2, -k + 18 = 4h. Suppose -3w - k = -w. Is t(w) a multiple of 6? False Let s(x) = -x*3 - 2x*2 - x + 4. Is 6 a factor of s(-2)? True Let r = 20 - 13. Let l(k) = -15 + 8k + k + 12. Does 24 divide l(r)? False Is 4/(-10) + (810/25 - -1) a multiple of 5? False Suppose -2r + 44 = -4q - 4r, 3q + 2r = -32. Let n = 27 + q. Is 6 a factor of n? False Suppose -31 = -4r + 5j - 0j, -4r + j = -51. Let q = 34 - r. Is q a multiple of 10? True Let g be 4/(-18) - (-20)/9. Suppose -5i - 4v = -306 + 78, v - 93 = -gi. Is i a multiple of 16? True Let r = 1 - -37. Let w = 95 - r. Does 19 divide w? True Let t(q) be the second derivative of q5/20 - q4/4 + q3/6 + q2 + 3q. Is t(4) a multiple of 10? False Let u = -15 + 25. Let b = u + 6. Is 7 a factor of b? False Let j(m) = -15m + 1. Does 23 divide j(-3)? True Is (-251)/(-3) + (3 - (-22)/(-6)) a multiple of 13? False Suppose 0 = 6p - 2p + 76. Let q = p - -10. Let j = q + 19. Is j a multiple of 5? True Let w be (-372)/(-3) + 0 + 0. Let t be 2/3 + w/(-6). Let u = 28 + t. Is u a multiple of 8? True Let x(m) = -16m3 + 50m*2 + 86m + 1. Let l(d) = -3d3 + 10d*2 + 17d. Let f(c) = 11l(c) - 2x(c). Is 15 a factor of f(11)? False Suppose -4m + 1336 = 4u, -2u = 2m + 3m - 1673. Suppose -5d - 115 = -m. Is 10 a factor of d? False Suppose 2i = -2z - 2, z + i - 5i - 14 = 0. Let j = z - -3. Suppose -jd - 78 + 278 = 0. Is 20 a factor of d? True Suppose -r = -t - 4t + 24, 3t + 2r - 17 = 0. Suppose tu - 5i - 155 = 0, 3i + 0i + 57 = 2u. Is 8 a factor of u? False Let g = 3 - 7. Let x = -19 - g. Does 14 divide (0 + -21)/(x/10)? True Let r be 7/3 - (-3)/(-9). Let k = -2 - r. Let g(y) = -2y - 4. Is g(k) a multiple of 2? True Suppose 5n + 0 = -5. Let b be n - -3 - (1 - -21). Is 0 + -1 - (b + 3) a multiple of 6? False Let b(m) = -m*3 + 4m*2 - m. Let a(t) = -t - 3. Let p be a(-6). Is b(p) even? True Let j(k) = k. Is j(7) a multiple of 4? False Let c(i) = 3i*2 - i - 2i*2 + 5 + 0i*2. Does 11 divide c(5)? False Is ((-644)/70)/(1/(-5)) a multiple of 23? True Suppose 6z - 2z = 8, -1028 = -4f + 4*z. Is f a multiple of	{ "pile_set_name": "DM Mathematics" }
078, -50770? -12692t - 2 What is the a'th term of 521, 1166, 1929, 2810, 3809, 4926? 59a*2 + 468a - 6 What is the f'th term of 42219, 42215, 42211, 42207, 42203, 42199? -4f + 42223 What is the n'th term of 14429, 57747, 129941, 231005, 360933? -n3 + 14444n*2 - 7n - 7 What is the z'th term of -7077, -7232, -7383, -7530, -7673? 2z2 - 161z - 6918 What is the x'th term of 95, 187, 291, 371, 391, 315? -6x3 + 42x*2 + 8x + 51 What is the y'th term of 3416, 13734, 30946, 55058, 86076? y*3 + 3441y*2 - 12y - 14 What is the a'th term of 267, 1188, 2727, 4884? 309a2 - 6a - 36 What is the m'th term of 2870, 2863, 2856, 2849, 2842, 2835? -7m + 2877 What is the b'th term of -2370, -4740, -7110, -9480, -11850, -14220? -2370b What is the w'th term of 236, 178, 110, 26, -80, -214, -382? -w3 + w2 - 54w + 290 What is the d'th term of -3029, -24254, -81863, -194048, -379001, -654914, -1039979? -3032d*3 - d + 4 What is the x'th term of 1612, 3282, 5098, 7132, 9456? 12x3 + x2 + 1583x + 16 What is the u'th term of -426, -845, -1542, -2517, -3770, -5301? -139u*2 - 2u - 285 What is the y'th term of 81732, 163468, 245208, 326952, 408700, 490452, 572208? 2y2 + 81730y What is the x'th term of 19574, 19563, 19544, 19517, 19482? -4x2 + x + 19577 What is the f'th term of -4464, -4466, -4468, -4470, -4472? -2f - 4462 What is the x'th term of 4606, 9253, 13900, 18547, 23194? 4647x - 41 What is the k'th term of -1049, -1076, -1113, -1166, -1241, -1344, -1481, -1658? -k3 + k2 - 23k - 1026 What is the l'th term of 74, 162, 284, 446, 654, 914, 1232, 1614? l*3 + 11l*2 + 48l + 14 What is the b'th term of -491, -983, -1477, -1973, -2471, -2971? -b*2 - 489b - 1 What is the o'th term of 22, 127, 300, 541, 850, 1227, 1672? 34o2 + 3o - 15 What is the p'th term of -7433, -14865, -22289, -29699, -37089, -44453, -51785? p*3 - 2p*2 - 7433p + 1 What is the w'th term of 341373, 341371, 341369? -2w + 341375 What is the q'th term of -159929, -159936, -159943, -159950? -7q - 159922 What is the q'th term of 2705, 10775, 24223, 43049, 67253, 96835, 131795? 2689q2 + 3q + 13 What is the n'th term of 32, -70, -336, -850, -1696, -2958, -4720? -14n3 + 2n*2 - 10n + 54 What is the h'th term of 3513209, 3513210, 3513211, 3513212? h + 3513208 What is the v'th term of -749, -1040, -1315, -1568, -1793, -1984, -2135? v*3 + 2v*2 - 304v - 448 What is the f'th term of 32, 98, 202, 362, 596, 922? 3f3 + f2 + 42f - 14 What is the c'th term of -120, -134, -152, -174, -200, -230? -2c2 - 8c - 110 What is the f'th term of 225, 391, 679, 1149, 1861, 2875, 4251, 6049? 10f3 + f2 + 93f + 121 What is the z'th term of -142, -726, -1706, -3088, -4878, -7082? -z*3 - 192z2 - z + 52 What is the t'th term of -32, 84, 198, 310, 420? -t2 + 119t - 150 What is the v'th term of -1473, -578, 317? 895v - 2368 What is the k'th term of -223, -1426, -4671, -10978, -21367, -36858? -170k3 - k2 - 10k - 42 What is the z'th term of 1808, 3605, 5402, 7199, 8996? 1797z + 11 What is the s'th term of -6065, -6024, -5983? 41s - 6106 What is the u'th term of -150, -441, -908, -1545, -2346, -3305? u*3 - 94u*2 - 16u - 41 What is the n'th term of 612, 448, 8, -846, -2252? -23n3 - 3n + 638 What is the o'th term of -25583, -25592, -25601, -25610, -25619? -9o - 25574 What is the o'th term of -1682, -1665, -1666, -1691, -1746, -1837, -1970? -o3 - 3o*2 + 33o - 1711 What is the d'th term of -15080, -15175, -15270? -95d - 14985 What is the m'th term of -60370, -60372, -60374, -60376, -60378, -60380? -2m - 60368 What is the b'th term of -1, -74, -87, -10, 187, 534, 1061? 5b3 - 108b + 102 What is the u'th term of -444, -705, -966, -1227, -1488? -261u - 183 What is the b'th term of -170934, -170936, -170938, -170940, -170942? -2b - 170932 What is the s'th term of 3314, 3301, 3288? -13s + 3327 What is the z'th term of -674, -1353, -2038, -2729, -3426, -4129, -4838? -3z*2 - 670z - 1 What is the g'th term of 84, 36, -76, -282, -612, -1096? -5g3 - 2g*2 - 7g + 98 What is the d'th term of 925, 1875, 2863, 3907, 5025, 6235, 7555, 9003? 3d3 + d2 + 926d - 5 What is the h'th term of 15410, 61636, 138680, 246542? 15409h2 - h + 2 What is the d'th term of 79, -26, -131? -105d + 184 What is the y'th term of 2, 14, 10, -4, -22, -38, -46? y*3 - 14y*2 + 47y - 32 What is the l'th term of 409, 923, 1437, 1951, 2465, 2979? 514l - 105 What is the q'th term of -1073, -4303, -9685, -17219? -1076q*2 - 2q + 5 What is the b'th term of 61759, 123507, 185253, 246997, 308739, 370479, 432217? -b*2 + 61751b + 9 What is the r'th term of -430, -396, -344, -280, -210? -r*3 + 15r*2 - 4r - 440 What is the u'th term of -17158, -68600, -154330, -274342, -428630, -617188? u*3 - 17150u*2 + u - 10 What is the p'th term of -2133, -2362, -2591, -2820, -3049, -3278? -229p - 1904 What is the n'th term of 2435, 1796, 1183, 608, 83, -380, -769? 2n3 + n2 - 656n + 3088 What is the g'th term of -2, -12, -56, -152, -318, -572? -3g3 + g2 + 8g - 8 What is the u'th term of 181, 340, 485, 610, 709, 776, 805? -u3 - u2 + 169u + 14 What is the y'th term of -14378, -14377, -14376, -14375? y - 14379 What is the d'th term of 12400, 12403, 12406, 12409? 3d + 12397 What is the j'th term of -1047, -4207, -9437, -16707, -25987, -37247? 5j3 - 1065j*2 + 13 What is the k'th term of -5397, -5383, -5361, -5331, -5293, -5247? 4k*2 + 2k - 5403 What is the u'th term of 3495, 3597, 3701, 3807, 3915? u*2 + 99u + 3395 What is the d'th term of 59713, 119428, 179143, 238858, 298573, 358288? 59715d - 2 What is the m'th term of 851, 816, 769, 704, 615, 496, 341? -m3 - 28m + 880 What is the u'th term of -10048, -10045, -10042, -10039? 3u - 10051 What is the i'th term of 1970, 1977, 1984, 1991, 1998, 2005? 7i + 1963 What is the q'th term of -21, 99, 237, 345, 375? -8q3 + 57q*2 + 5q - 75 What is the a'th term of 124, 1044, 3568, 8494, 16620, 28744, 45664, 68178? 133a3 + 4a*2 - 23a + 10 What is the x'th term of 2702, 2709, 2724, 2753, 2802? x*3 - 2x*2 + 6x + 2697 What is the t'th term of -95542, -95549, -95556, -95563? -7t - 95535 What is the a'th term of 60616, 121236, 181860, 242488, 303120, 363756? 2a*2 + 60614a What is the k'th term of -5, 73, 147, 217, 283? -2k2 + 84k - 87 What is the g'th term of -1025076, -2050151, -3075226, -4100301, -5125376, -6150451? -1025075g - 1 What is the a'th term of 649, 640, 631, 622? -9a + 658 What is the p'th term of 110, 206, 364, 578, 842, 1150, 1496? -p*3 + 37p*2 - 8p + 82 What is the j'th term of 163578, 163562, 163546, 163530, 163514? -16j + 163594 What is the w'th term of -899, -817, -601, -185, 497, 1511? 11w3 + w2 + 2w - 913 What is the s'th term of 351, 1444, 3271, 5832, 9127? 367s*2 - 8s - 8 What is the i'th term of -5265, -4991, -4731, -4491, -4277? -i3 - i2 + 284i - 5547 What is the a'th term of 3437, 3315, 3181, 3041, 2901? a3 - 12a*2 - 93a + 3541 What is the y'th term of 3461, 6909, 10357, 13805, 17253? 3448y + 13 What is the s'th term of -10362, -10373, -10392, -10419, -10454, -10497, -10548? -4s*2 + s - 10359 What is the n'th term of 538, 1665, 3538, 6157, 9522, 13633? 373n*2 + 8n + 157 What is the o'th term of 288, 282, 272, 258, 240, 218, 192? -2o2 + 290 What is the a'th term of -881658, -1763342, -2645042, -3526764, -4408514, -5290298, -6172122, -7053992? -a3 - 2a*2 - 881671a + 16 What is the r'th term of -30, -64, -90, -108, -118, -120, -114? 4r2 - 46r + 12 What is the k'th term of -4864, -9718, -14572, -19426? -4854k - 10 What is the a'th term of -2127, -2445, -2763, -3081? -318a - 1809 What is the r'th term of 13661, 27334, 41007, 54680, 68353? 13673r - 12 What is the l'th term of 6756, 6644, 6532? -112l + 6868 What is the q'th term of -243260, -243255, -243246, -243233, -243216? 2q2 - q - 243261 What is the v'th term of 562, 595, 650, 727, 826, 947, 1090? 11v2 + 551 What is the g'th term of -69, -241, -533, -951, -1501, -2189, -3021? -g3 - 54g2 - 3g - 11 What is the y'th term of -366, -738, -1116, -1500, -1890? -3y2 - 363y What is the j'th term of 26, 255, 638, 1175? 77j2 - 2j - 4	{ "pile_set_name": "DM Mathematics" }
Expand (s + 0s - 3s)(-184s + 6 + 419s - 200s). -70s2 - 12s Expand (5p2 - 17p*2 + 10p*2 - 4p)(8p - 9p3 - 8p). 18p5 + 36p*4 Expand -6p*3 - 89p*3 + 192p - 188p + 2p - 2p - 2p*3 + (2p*2 - 3p*2 + 2p*2)(-3 + p + 3). -96p3 + 4p Expand (-70 - 8f + 30 + 35)(3f3 + 3f - 3f). -24f*4 - 15f*3 Expand -5s*2 + 42s - 42s + (s + 7s + 11s)(s - 4s + s). -43s*2 Expand 2y*2 - 2y2 - y4 + (-3 + 3 - 2y)(4y - 4y + y3) + y2 - y4 - y2 + y*3 + 1 - 5y*4 - 9y*2 + 11y*2 - 3. -9y4 + y3 + 2y2 - 2 Expand 10188f*3 + 59f*4 - 10188f*3 + 2f*4 + 0f*4 - 5f*4 + (2f - 2f - 2f*3)(2f - 3f - f) - 2f4 - 4f*4 + 4f*4. 58f*4 Expand (2d + d - 2d - d - 3d + 5d + 0 + 0 - d + (-3 + 4 + 0)(4d - d - d))(6d3 + 0d*3 + 0d*3) - 11 - 16d*4 + 11. 2d4 Expand d3 - 2d3 + 0d*3 + (1 - 1 + d)(275d - 190d*2 - 275d) + 3 - 2d3 - 3. -193d*3 Expand (2c - 2c - 2c)(-1 + 0 - 3c + 0c) + (2c - 4c + 0c)(-2c + 3c + 3c). -2c2 + 2c Expand (7a - 4a*2 - 7a)(3 + 5a*3 - 2 - 4a*3). -4a*5 - 4a*2 Expand 2i*5 + 2i*5 - 5i*5 + (-4 + 3 + 3)(i*5 - 3i*5 + 0i*5) + 90i*2 - 162i2 - i5 - 88i2. -6i*5 - 160i*2 Expand (-2 + 1 - 2 + (-1 + 3 - 1)(0 + 4 - 2))(-o - 2o + o - o + 6o - 4o + (0 - 3 + 2)(3o - 2o - 3o) - o + o - 2o + 2o + 3o - 7o - 4o - 2o - o). 10o Expand (-6w*3 + 6w*3 + 30w*4)(-1 - 2 + 1). -60w4 Expand (3 - s - 3 + (-3 + 1 + 0)(1 + 2s - 1) + 2s + 1 - 1)(-4s + 5s + s) + (-4s*2 + 2s*2 + 4s*2)(-1 + 3 - 1) - 35s + 185s*2 + 35s. 181s2 Expand ((4 + d - 4)(0 + 0 + d) - 3 + 3 + 2d2)(70d2 - 18 - 4d - 38d2 - 33d*2). -3d*4 - 12d*3 - 54d*2 Expand (6i2 - i2 - 4i2)(-5 + 17 + 21) + i*2 - 2i*2 + 1 + 0. 32i2 + 1 Expand (5335 + s3 - 5277 - 3s3)(3s + 4s - 4s) + (s2 - s2 + s4)(-3 + 3 + 1). -5s4 + 174s Expand (-11 - p - p - 2p)(6p2 - 4p + 3p - 3p*2). -12p*3 - 29p*2 + 11p Expand (-7486v + 7486v - 251v2)((-3 + 1 + 0)(v3 - 2v*3 + 3v*3) + (-4v2 - v2 + 3v2)(3v - 5v + 0v) + 0v*3 + 0v*3 + 2v*3). -502v5 Expand -p3 - 28p2 - 23p*2 + 53p*2 + (2p - 3p - p)(p2 - p2 - 2p2) - 1 + 1 + 3p*3. 6p*3 + 2p*2 Expand (164s + 18s + 175s + 97s - 33s)(-2s + 4s + 4s). 2526s2 Expand 6b*4 + 15b - 15b + 0b4 - b4 - 2b4 + (-4 + 4 - 1)(-5b + 5b - b*4) - 3b*4 - 7b*4 + 3b*4. -3b*4 Expand (-6c + 2c + 13c + (0 + 4 - 6)(3 - 3 - 2c) + 0c - 4c + 5c)(3c4 - 2c*4 - 6c*4). -70c*5 Expand (-2w + 2w + 3w)(2w*3 + 0w3 - w3 + (-4w + 2w + 4w)(2w2 - w2 + w2) - 3w*3 - 2w*3 + 6w*3 - 88w*3 + 21w*3 + 31w*3). -90w*4 Expand (q + q + 2 - 3)(-3 + 3 + q + (2q - 3 + 3)(-2 + 1 + 2) + 6q - 2q - 3q + 5q + 7q - q)(-11q2 - 5q*3 + 11q*2). -150q*5 + 75q*4 Expand 5y*3 - 9y*3 - 2y4 + y4 + (-2y4 - 5y*4 + 5y*4)(1 - 2 - 1). 3y4 - 4y*3 Expand (26v - 13v - 11v)(3v + 0v - 1 - 5v). -4v2 - 2v Expand (12 + 6n - 12)(-n - n + 4n) - 3n*2 + 4n*2 - 4n*2 + 3n*2 + 0n*2 + 3n*2. 15n*2 Expand (-1 + 1 - 2u*4)(0 + 0 - 2u) + u4 - u4 - u5 - 3u*5 - 10u*5 + 0u5 - u5 - 3u5 + 2u5 + (-3 - u4 + 3)(-4u + 2u - u). -9u*5 Expand ((-3c + 4c - 3c)(3 + 1 - 3) - 2c + 2c - 2c)(c - 3c - 3c)(0 + 8 + 12). 400c2 Expand (25a*2 - 4a*2 - 11a*2)(-3a3 + a3 + 3a*3) - 2a*5 + 6a*5 - 3a*5 + 2a*5 + 3 - 3. 13a*5 Expand (-44g*3 + 105g*3 + 70g*3)(0g2 + 2g2 - g2). 131g5 Expand (-u4 - 3u*4 - 5u*4 - 3u*4 + 2u4 - u4 + (-6u + 3u + 2u)(2u3 + 0 + 0))(-4 + 3 + 4). -39u4 Expand (31k*2 + 89k*2 - 7k*2)((-k + 0 + 0)(-2k + 1 - 1) + 4k2 - 2k*2 + 0k*2). 452k*4 Expand ((3x - 6x + 2x)(x - x + 2x*2) - 2x3 - x3 + 2x3)(-236x - 42 + 42)(1 - x - 1). -708x5 Expand (-13 + 13 - 6h)(-31 + 8h + 31) + (3h + h - 3h)(2h - 2 + 2). -46h2 Expand (-2u - u + 5u)(-4u + 2u - 2u) + 0u + 373 - 372 - 8u2 + 3u. -16u2 + 3u + 1 Expand (-13v - 195v*2 + 13v)(-1 - 2v*3 + 1). 390v*5 Expand (41 - 5 - 107 - 75)(5z - z + 0z). -584z Expand (3o*3 - 5o3 - o3)(-6 + 0 + 0) + o3 + o3 + 0o*3. 20o*3 Expand 1357o*2 - 1357o*2 - 25o*4 + (-2o*2 - 1 + 1)(1 - 2 + 0)(-4 + o2 + 4). -23o*4 Expand (0r + 3r + 0r)(-3 - r2 + 3) - 6r*3 + 0r*3 + 4r*3 - 7r*3 + 3r*3 + 3r*3 - r. -6r*3 - r Expand 48i - 23i - 24i + (10 - 2 + 0)(-4i - 2i + 5i). -7i Expand -2t + 0 + 0 + (0 + 0 + 2)(t + 2t - 5t) - 3t - 4t + 6t - 3t + 3t - t + 9t + 4t - 6t. -t Expand 2y*2 + 0y + 0y + (1 - 1 - 1)(-5y2 + 0y*2 + 6y*2) + 0y*2 - 3y2 + y2 - 1288y - 9 + 701y - y*2 + 629y. -2y2 + 42y - 9 Expand 236n - 91n*3 - 236n - n*3 + 3n3 - n3 + 2 - n3 - 2 + (n2 + 3n2 - 3n*2)(-n - n + n) - 21 + 21 + 2n2 - 5n*3. -97n*3 + 2n*2 Expand (1 + 2i - 1)(4i*4 - 4i*4 - 2i4) - i5 + i*5 - 2i*5 - 4i*5 + 12415i*4 - 12393i*4 - 2i*2 + 19i*5. 9i*5 + 22i*4 - 2i2 Expand j3 + 2j3 - j3 + 30j*3 + 84j - 84j + (2j*2 + 3 - 3)(-j - 2j + 4j). 34j3 Expand (-69 + 27a*2 + 69)(-a*3 - 1 + 1) - 8a*3 + 8a*3 + 11a*5. -16a*5 Expand 0p + 0p - p + (4 - 1 - 2)(8p + 12p - 10p) - 2 + 5p - 3p - 4p. 7p - 2 Expand (-a - 2a + 10a)(177 - 19a3 - 177). -133a*4 Expand (-n - 2n*2 + n)(3 - 3 + 1) - 2n2 - 3n*2 + 4n*2 + (2n - 3n + 0n)(-2n + 1 - 1)(58 - 89 - 131). -327n*2 Expand (6 - 6 + 6b)(-180 - 16b*2 + 177 - 18b*2). -204b*3 - 18b Expand (0p + p - 3p)(-8 + 4 + 0) + 20p + 221 - 221. 28p Expand (-6 - 5 - 80)(-4l + 0l - 2l)(-2 - l + 2). -546l2 Expand (660i + 465i - 342i + 879i - 133i)(-i2 + 0i*2 + 3i*2). 3058i*3 Expand (3b + 0b + 0b)(-2 - 2b + 12b2 + 37b*2 - 14b*2). 105b*3 - 6b*2 - 6b Expand (-1333 + 31z - 1331 + 2661)(-2z4 + 2z*3 - 2z*3). -62z*5 + 6z*4 Expand ((-3 + 3 + 2)(-5t + 5t - t) + 5t - 5t - 3t)(0t - 5t - 2t). 35t*2 Expand (2l*2 - 4 + 4)(l - 2l - l) + (l3 + 2l*3 - 4l*3)(32 + 32 + 33 + (3 + 0 - 1)(1 - 1 + 2)) + (-3l2 + l2 + l*2)(0l + 3l - 5l). -103l*3 Expand ((2 - 3 + 3)(0 + 2 - 3) - 14 + 4 + 8)(-2 + 6 - 1)(-10y - 4y - 16y). 360y Expand (2h + 3 - 3)(-3 + 0 + 5)(-2h*2 - 2h*2 + 3h*2)((-h + 0h - h)(-3 + 1 + 7) + 2 + h - 2). 36h4 Expand (-124q - 17q - 213q)(-4q + 1 - 3q + 6q). 354q2 - 354q Expand (-6s3 + 8s*3 - 11s*2 + 6s*2)(-4 - 43 + 101). 108s3 - 270s*2 Expand (-5v + 6v + 2v)(-3v*2 + 2v*3 + 0 - 3 + 2). 6v*4 - 9v*3 - 3v Expand ((0g + 0g - 2g)(2 + g - 2) - 2g2 - g2 + 4g*2)(1 - 2 - 2)(0g + g - 2g). -3g*3 Expand (9 - 3 + 0)(3l2 + 3l*2 - 4l*2) - 433 + 433 - 21l*2 + (2l - 5l + l)(0l - l + 2l). -11l2 Expand (3v*2 + 4v*2 + 2v*2)(-5v + 18 - 18) + (-v + v - v2)(1 + v - 1) + (2 + 3 - 4)(v3 - 4v*3 + 2v*3) + 0v*3 + 0v*3 - 3v*3. -50v*3 Expand (-2x*3 + 11x*3 - 3x3 + x3 + x - x + (-5x2 + 2x*2 + 4x*2)(2x + 9x - 10x))(-2x2 - x2 + 2x*2). -8x*5 Expand (-18i*3 - 2i*3 - 4i*3)(-1 + 1 - 4i). 96i*4 Expand 21d*2 + 30d*2 - 2d*3 + 13d*4 - 14d4 - d3 - 2d4 + d3 + (-2d*2 + 0 + 0)(-d*2 + 5d*2 - 3d*2). -5d*4 - 2d*3 + 51d*2 Expand (3777 + 93c - 3777)(1 + 4 - 2)(-2c4 + 4c*4 + 0c*4). 558c*5 Expand (-8 + 0 + 1)(-3y2 + 4y*3 + 3y*2 + (1 - 1 + 6y*3)(-3 + 6 - 2)). -70y3 Expand (0z + 2z - 3z)(1 - 1 - 2z)(-7 + 2 + 11)(2 + 0 + 0). 24z2 Expand (0t + 0t - 3t*2)(5t2 + 2t*2 - 5t*2) - 957t*3 + 957t*3 - 52t4 - t4 + 0t4 - 3t*4. -62t*4 Expand (3 + 0 - 4)(680a + 436a + 21a). -1137a Expand -15r4 + 37r*4 + 10r*5 - 24r4 + (-r2 - r2 + r2)(-6r3 + r3 + 2r3). 13r*5 - 2r*4 Expand (-23t + 38t - 20t - 4)(4t*2 - 3t*2 + 2t*2). -15t*3 - 12t2 Expand (i4 + 1 + 9i3 - 9i*3)(2 + 1 - 1) + (-18i2 - 6i*2 - 5i*2)(i - i + i*2). -27i**4 + 2 Expan	{ "pile_set_name": "DM Mathematics" }
377/2 Calculate 243276 divided by 5529. 44 -77343 divided by -4 77343/4 Divide -312984 by 24. -13041 Divide 19 by 186. 19/186 Calculate -41888 divided by 616. -68 Calculate -1118 divided by 942. -559/471 Divide 52592 by -52592. -1 What is 176128 divided by 22016? 8 What is 20883 divided by 1? 20883 9320 divided by 8 1165 1182214 divided by -2398 -493 What is -350410 divided by 4? -175205/2 Divide 1583 by 53. 1583/53 Divide 479 by 39. 479/39 -60256 divided by -224 269 What is 146763 divided by 146763? 1 Calculate 271800 divided by -3020. -90 Calculate 161504 divided by -6. -80752/3 -1 divided by 120130 -1/120130 2765587 divided by -251417 -11 What is 766953 divided by 1143? 671 What is 141930 divided by 28386? 5 Divide 9 by 17622. 1/1958 What is -3 divided by 79820? -3/79820 Divide -440843 by -10. 440843/10 Divide 23 by 1193. 23/1193 Divide 6881 by -6. -6881/6 483 divided by -1 -483 Calculate 3 divided by -44865. -1/14955 Calculate 22 divided by 1. 22 What is 40 divided by -50? -4/5 Calculate -21 divided by 1296. -7/432 Calculate -5 divided by 6322. -5/6322 What is 6369 divided by 61? 6369/61 What is 2 divided by -958608? -1/479304 -30781 divided by 5 -30781/5 Calculate -1 divided by -48041. 1/48041 0 divided by 1499 0 -783510 divided by -5 156702 -4 divided by -402762 2/201381 Divide -1086268 by 76. -14293 Divide 4 by 2210. 2/1105 Calculate 17004 divided by 17004. 1 What is 4736 divided by -91? -4736/91 Calculate 840538 divided by 1. 840538 Divide 2510 by 182. 1255/91 47459 divided by -26 -47459/26 What is 889683 divided by 296561? 3 Calculate -4307715 divided by -3. 1435905 What is 557424 divided by 39816? 14 Divide -57090 by 57090. -1 Calculate -103626 divided by -9. 11514 Calculate -2339 divided by 410. -2339/410 Calculate -6958 divided by -119. 994/17 Divide -75461 by -1279. 59 -3 divided by -15419 3/15419 -64639 divided by -11 64639/11 3 divided by -20322 -1/6774 Calculate -352044 divided by 44. -8001 What is -1 divided by -630654? 1/630654 What is -182342 divided by 62? -2941 Calculate 1554 divided by -42. -37 Calculate -229038 divided by 647. -354 Divide -210304 by -6572. 32 Calculate 35659 divided by 5. 35659/5 Calculate 96782 divided by -31. -3122 Calculate -1826 divided by 179. -1826/179 1479796 divided by -19471 -76 Divide 105460 by -5273. -20 -4096904 divided by 27496 -149 What is 398176 divided by 184? 2164 Calculate -9024 divided by -94. 96 Calculate -6 divided by -2979. 2/993 Divide -72253 by 14. -72253/14 What is 723246 divided by -1? -723246 Calculate 180896 divided by 8. 22612 -11961 divided by -3987 3 What is 309408 divided by 9376? 33 What is 2483914 divided by -2? -1241957 What is -109984 divided by 13748? -8 -378226 divided by -6 189113/3 What is 0 divided by 78473? 0 Calculate 29240 divided by -430. -68 Divide 44579 by 9. 44579/9 Divide -131316 by -12. 10943 -38340740 divided by -4 9585185 Calculate 22407 divided by -7469. -3 What is 446 divided by 125? 446/125 -125 divided by -213 125/213 Divide 516 by 109. 516/109 Divide -676 by 1339. -52/103 What is 160105 divided by 32021? 5 Calculate -230 divided by 32. -115/16 What is -176850 divided by -6? 29475 What is 784436 divided by -196109? -4 What is -18173 divided by -5? 18173/5 49247 divided by 1 49247 Calculate -18444 divided by 4611. -4 What is -94 divided by -934? 47/467 Calculate 71610 divided by 23870. 3 What is -8 divided by -72369? 8/72369 Divide 0 by 5862. 0 What is -11 divided by 6039? -1/549 591 divided by -177 -197/59 Calculate 362880 divided by -27. -13440 Divide 79407 by 26469. 3 Calculate 5969865 divided by 3. 1989955 Divide -143448 by -5977. 24 2 divided by 17667 2/17667 Divide 2721498 by -104673. -26 Calculate -3 divided by -18556. 3/18556 -418236 divided by 766 -546 -77 divided by -16460 77/16460 Divide 397 by -72. -397/72 What is -1 divided by -420442? 1/420442 -61 divided by -7296 61/7296 -212688 divided by -504 422 Calculate 2228 divided by 4. 557 Calculate 2 divided by 13587. 2/13587 Calculate 83578 divided by 22. 3799 Divide -1005720 by 120. -8381 Calculate 8 divided by -22115. -8/22115 -924 divided by 67 -924/67 Divide 77035 by -2485. -31 -295248 divided by -6 49208 Divide 2758770 by -91959. -30 -371015 divided by 5 -74203 62 divided by -94 -31/47 What is 264341 divided by -11? -24031 Divide -1351 by -1927. 1351/1927 What is 44346 divided by 7391? 6 What is 469 divided by 123? 469/123 Divide -16316 by -7. 16316/7 -44 divided by -916 11/229 Calculate 209 divided by 8834. 209/8834 What is 57225 divided by 1635? 35 Calculate -5634 divided by 31. -5634/31 Divide 3105412 by -2428. -1279 Calculate 9030 divided by 7. 1290 What is -58300 divided by -212? 275 Divide 4 by -14782. -2/7391 Calculate -205504 divided by -1352. 152 Calculate -1694686 divided by 1939. -874 What is 3 divided by 74994? 1/24998 What is -287470 divided by 3026? -95 -7186402 divided by 5 -7186402/5 Calculate 75944 divided by -6. -37972/3 259779 divided by 19983 13 What is 1291882 divided by -3? -1291882/3 2 divided by -252126 -1/126063 Calculate 584 divided by 15. 584/15 What is 28401 divided by -4? -28401/4 -347514 divided by -2 173757 Divide -8698 by 1. -8698 Divide 1111321 by -6. -1111321/6 What is -1069 divided by 3? -1069/3 Calculate -627800 divided by -146. 4300 Divide 57795 by 3853. 15 246240 divided by -2 -123120 What is 58556 divided by 3? 58556/3 114250 divided by 22850 5 Calculate -75848 divided by -37924. 2 Divide 558366 by 2. 279183 Divide 1186242 by 4. 593121/2 What is 253069 divided by 1? 253069 Calculate -28 divided by -1031. 28/1031 Calculate -2491290 divided by 498258. -5 -717012 divided by -27 26556 Calculate -543685 divided by -1. 543685 Calculate 36194 divided by -18097. -2 What is 534 divided by 351? 178/117 Divide 517170 by -103434. -5 What is 41 divided by -25530? -41/25530 1211868 divided by 7 173124 Calculate -27609 divided by -3. 9203 Calculate -728 divided by -76. 182/19 What is -403522 divided by -41? 9842 Divide 244 by -122. -2 Calculate -971106 divided by 713. -1362 4 divided by -102378 -2/51189 Calculate 286627 divided by 26057. 11 What is 14439138 divided by -6? -2406523 What is -97177 divided by -97177? 1 16 divided by -9029 -16/9029 -15573 divided by 3 -5191 What is -38057 divided by 2003? -19 Divide -7576 by -947. 8 Calculate -13227 divided by -5. 13227/5 Calculate 56335 divided by 11267. 5 -1033 divided by 22 -1033/22 What is 6 divided by 279? 2/93 -48151 divided by -1 48151 -115779 divided by 1 -115779 151512 divided by -6 -25252 360302 divided by 2 180151 215058 divided by 71686 3 -292647 divided by -1 292647 9 divided by -167544 -1/18616 What is 114 divided by 68? 57/34 What is -201995 divided by 1? -201995 Divide -98072 by -52. 1886 Divide 39116460 by 4. 9779115 1 divided by -103794 -1/103794 240799 divided by 1 240799 Calculate -38535 divided by -15. 2569 Calculate -2656 divided by 2. -1328 Calculate -94116 divided by 132. -713 What is 281481 divided by -1? -281481 9216 divided by -6 -1536 What is -3329144 divided by 7? -475592 What is -242 divided by -227? 242/227 Divide 25641 by -693. -37 Calculate 202745 divided by 43. 4715 Calculate -30290 divided by 5. -6058 -99126 divided by -2 49563 11868 divided by -86 -138 Calculate 510 divided by 86. 255/43 What is -8967 divided by 5? -8967/5 Divide -399425 by 13. -30725 Calculate 20013 divided by -6671. -3 Divide -56209 by -8. 56209/8 What is 42284 divided by 44? 961 Divide -671160 by -39480. 17 Divide -153104 by -8. 19138 What is 5582 divided by 5? 5582/5 -4 divided by 804057 -4/804057 Calculate 150 divided by 56. 75/28 17 divided by 3385 17/3385 3545 divided by 44 3545/44 What is -40 divided by 13423? -40/13423 Calculate 205482 divided by 68494. 3 What is 3 divided by -68213? -3/68213 Divide -96382 by -22. 4381 Calculate -23925 divided by 145. -165 Divide 32 by 18910. 16/9455 What is -550 divided by -71? 550/71 What is 369869 divided by 1? 369869 Divide 47145 by -15715. -3 Calculate 3 divided by -976350. -1/325450 Divide 3 by 62080. 3/62080 What is -13 divided by -3263? 1/251 What is 3336 divided by -52? -834/13 Calculate 5 divided by -20815. -1/4163 359832 divided by -348 -1034 22965 divided by -4593 -5 Divide -3089440 by -617888. 5 Calculate 1 divided by 34792. 1/34792 -241217 divided by 9 -2	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.