Datasets:

totally-not-an-llm
/

PileV2-axolotlformat-smallmix

Dataset card Data Studio Files Files and versions Community

Split (1)

train · 23k rows

text stringlengths 0 13M
Suppose -393 = -3f - p, 3f = -2p - 2p + 384. Calculate the smallest common multiple of 9 and (f/10)/(28/70). 99 Let f be (7 - 4)3 - (1 + 3). Suppose fw = 4w + 2z + 1, 2w + 2z - 14 = 0. Suppose -23 = -3c + 10. What is the lowest common multiple of c and w? 55 Let n(p) = p - 1. Let c(s) = s2 - 8s + 10. Let i be c(7). Suppose q - 51 = -0t - it, -185 = -5q - t. Calculate the lowest common multiple of n(11) and q. 180 Let q(h) = -4h - 3 - 1 + 5h - 7h*2 + 3. Find the common denominator of 151/6 and q(2). 6 Let b be (-4)/16-4 + 17. Suppose c = 4v + b, -5 = -2c + v + 3. Let n(g) = -g*3 + 4g*2 - 3g. Calculate the least common multiple of 7 and n(c). 14 Let j = 5 + -2. Suppose -5i + 42 = -48. Let v = i - 9. What is the least common multiple of v and j? 9 Suppose -3a + 104 = 5c - 0c, 108 = 5c + a. Let k = c - 21. What is the common denominator of (-738)/(-12)k/(-15) and 45/4? 20 Let g(c) = 3 - 3 - 10 - 3c - 4. Let d be g(-8). Suppose 5h - 1 - d = 2t, -4t - 7 = -5h. What is the lowest common multiple of h and 7? 21 Suppose 177664 = -10w + 18w. Let b = -666389/30 + w. What is the common denominator of b and 61/9? 90 Let d = -17101763/37760388 + 1/273626. What is the common denominator of d and -145/24? 552 Let d(v) = -v3 + 23v*2 + 35v - 226. Calculate the smallest common multiple of d(24) and 57. 114 Suppose 192 = 4c - 340. Suppose c + 77 = -3l. Find the common denominator of -31/10 and (-866)/160 - 42/l. 80 Calculate the common denominator of 49/33 and ((-234)/(-1950))/(18/65). 330 Suppose 0 = 3s - 37 - 23. Find the common denominator of 57/8 and (s/(-6))/((-464)/1131). 8 Let c(t) = t. Let d(u) = -u3 - 7u*2 - 9u - 1. Let l(m) = -2c(m) - d(m). Calculate the smallest common multiple of 3 and l(-4). 21 Let r(b) = 3b*3 - 4b*2 + 5b - 1. Let i be r(3). Let z = i + -33. Calculate the lowest common multiple of 2 and z. 26 What is the lowest common multiple of (-2 - -2) + (-8)/10-5 and 20? 20 Let h(q) = -11q + 403. Calculate the least common multiple of h(18) and 82. 410 Suppose 0 = -2r + v + 9, 23 = -r - 6v + v. Calculate the smallest common multiple of r and 15 + 4/2 + 0. 34 Suppose 2o + 3k = -2o + 86, 3k = -5o + 106. Let v = 6 + 4. Let u = 22 - v. Calculate the least common multiple of u and o. 60 Calculate the common denominator of 67/8 and ((-833)/140 + 3)/2. 40 Let t = -19565/528 + 1064/33. What is the common denominator of t and -97/36? 144 What is the common denominator of -149/12 and 14/714385/(-10)? 204 Let f = 2504 + -25129/10. Find the common denominator of 77/192 and f. 960 Let i(k) = 2k2 + 2k + 3. Suppose -d + 0 + 3 = 5n, 0 = n + d - 3. What is the least common multiple of i(n) and 10? 30 Let t(w) = w3 + 3w*2 - 4w + 5. Let x be t(-4). Let o = x - -4. What is the smallest common multiple of 5 and o? 45 Let u = -15932 + 286637/18. Let j(x) = -418x2 + 23x - 14. Let n be j(6). Calculate the common denominator of (n/96)/13 + 6/(-9) and u. 72 Let a = 3/673 - 14815/2019. Suppose 0 = 5o - 2 - 8, -5h - 319 = -2o. Calculate the common denominator of (4 + h/16)-138 and a. 24 Suppose 3c - 3y + 0y = 516021, 688030 = 4c - 2y. Let k be c/(-8) + (-3)/(-1). Let i = 387073/18 + k. Find the common denominator of i and -51/2. 18 Suppose 16 = 12v - 8. What is the lowest common multiple of v and 22? 22 Find the common denominator of 206/24 - -1 - (4 - 3 - -2) and 2/3 - 32/(-66). 132 Calculate the common denominator of 2 - (-1)/(630/(-1758)) and 41/15. 105 Let q = 55/21 - -421/168. What is the common denominator of q and ((-970)/(-660))/((-3)/9)? 88 Calculate the common denominator of 8 + -3 - (-129)/30 and -127/60. 60 Let z = 12 + -3. Suppose -34 = -5j - z. Suppose 5w - 3y - 69 = 0, -5w + 0w - jy + 45 = 0. Calculate the common denominator of w and 101/2. 2 Suppose 4i + m = -24 + 122, 0 = -4m + 8. Calculate the smallest common multiple of i and 20. 120 Suppose 2s - 2d - 136 = 0, -3d + 111 = 5s - 3s. What is the lowest common multiple of s and 27? 189 Let u(q) = q2 + 8q + 22. Let w = 20 + -25. What is the least common multiple of u(w) and 5? 35 Suppose 3p + 46 = 2f, -f + 6p - p + 37 = 0. Let m = 6 - 4. What is the lowest common multiple of m and f? 34 Let u = 2854 + -2396. Calculate the lowest common multiple of u and 4. 916 Let f(k) = -2k*2 + 11k - 21. Let t be f(6). What is the lowest common multiple of (-1764)/t - 4/(-6) and 4? 132 Let i(a) = -a*3 - 4a*2 - 3a - 5. Let q be i(-4). Let j = -1 + q. Calculate the lowest common multiple of j and (0 - 2/(-5))5. 6 Suppose -3f + 2s - 9 = 0, 3f + 2s - 7 + 4 = 0. What is the smallest common multiple of 3 and f/(((-3)/(-8))/(-3))? 24 Let v = -9 - -21. What is the smallest common multiple of 16 and v? 48 Let k = 29380979/260 - 1463028/13. Suppose q = 5, w + 2q = 468 + 8. Let y = k - w. Calculate the common denominator of 75/14 and y. 140 Let u(h) = -3h2 + h - 3. Let n be u(3). Let t be -3 - (n + -4 + 5). Suppose -3 = w - t. What is the lowest common multiple of w and 2? 20 Let u(f) = -f. Let y be u(-4). Let s be 2(y/(-4) + 5). Let g = s + -2. Calculate the lowest common multiple of 2 and g. 6 Suppose s + k - 22 = 4k, -5s = -5k - 60. Let o(z) = z - 2. Let j be o(5). Suppose 0 = jm - 2 - 10. Calculate the least common multiple of s and m. 28 Let i = -251 + 307. Calculate the lowest common multiple of 329 and i. 2632 Let m = 28 - 29. What is the common denominator of ((-3)/4)/(6/(-130)) and m + -3 + -2 + 25/(-40)? 8 What is the common denominator of -5/8 and ((-138)/1932)/((-32)/42)? 32 Find the common denominator of ((-2)/4)/(-1813/(-3692)) and 73/96. 288 Let c = 45 + -44. What is the common denominator of 19/8 and -1(-4)/c + 1144/(-128)? 16 Let t(w) = -4w2 + 211w - 405. Let b = 22 - 16. Let s = b - 4. Calculate the lowest common multiple of t(2) and s. 2 Let s(q) = -67q2 + 3q - 1. Let w be s(-4). Let g = w + 23909/22. Let c = -259687/22 + 11802. Calculate the common denominator of g and c. 22 What is the smallest common multiple of 75 and 435 - 04/(-32)? 2175 Let y = 7985969/13860 + -38537/252. Let v = 4536/11 - y. Calculate the common denominator of v and 9/14. 70 Let p = 12538/45 - 1357/5. Let t = -1282315/3699 + -5/3699. Let s = 365 + t. Find the common denominator of p and s. 9 Let f = 477 + -447. Calculate the smallest common multiple of f and 150. 150 Suppose -3103 = -15p - 403. What is the least common multiple of 24 and p? 360 Let l = -2/142801 + 13851833/9710468. What is the common denominator of -131/24 and l? 408 Let n(q) = -136q2 - q + 3. Let b be n(3). Let v be -4 - 2/(b/2453). Let j = -2641/4896 + v. Find the common denominator of -11/6 and j. 96 Let h(p) = 12p + 104. Calculate the smallest common multiple of 44 and h(-8). 88 Suppose b = 3a - 81, -4b + 70 + 82 = 5a. Calculate the smallest common multiple of 40 and a. 280 Let d = 3457 - 13905/4. Calculate the common denominator of 25/8 and d. 8 Let r = 3253/3120 + 4/65. Calculate the common denominator of r and 53/66. 528 Let o = -23 - -51. Let c = -42 + 11. What is the common denominator of c and o/1060/(-32)? 4 Let b = -27635483/172 - -160672. Find the common denominator of -97/20 and b. 860 Let l = 56225/8 - 7053. Let y = 1789/56 + l. What is the common denominator of 1 + 22(-5)/(-32) and y? 112 Suppose -4f + 4k + 140 = 0, 44 = 5f - k - 111. What is the smallest common multiple of f and 114? 570 Let p(y) = y*2 - 8y - 6. Let j be p(9). Let n(d) = 3d2 - 4 + 23d - 11d - 7d - d*3 - 2d*3. Find the common denominator of 65/9 and n(j). 9 Let h be 1395267/63064-3(-8)/(-36). Let x = h + -2/7883. Let v = -388 - -3099/8. Find the common denominator of v and x. 8 Let o(c) = -c + 32. Let d = -20 + 30. Calculate the smallest common multiple of o(d) and 6. 66 Let t = -40588367/192 + 211397. What is the common denominator of -23/64 and t? 192 Let p(b) = -b2 + 8b + 10. Let r be p(8). Let k be 1187/(-15) - 2/r. Let w = 143/2 + k. Find the common denominator of w and 69/2. 6 Calculate the common denominator of 6 - 1 - (3 + 51/(-108)) and -89/30. 180 What is the common denominator of 57/2 and (-4 - 58/18)4/(-5)? 18 Let p = -96566 - -1164007/12. Let k = p - 867/2. Calculate the common denominator of 5/21 and k. 84 Calculate the smallest common multiple of -4(2 - 1)*(-420)/30 and 14. 56 Let m be (-152)/((4/8 - 0)/1). Let u = -5453/18 - m. Find the common denominator of u and (382/36 - 2) + -1. 18
Let f be (6 - (-23041)/4248)/1. Let d = -26/531 + f. Find the common denominator of d and 97/20. 40 Suppose 4 = 2s - 10. Let y(n) = -n3 + 7n*2 + 2n - 5. Let d be y(s). Let x(p) = p - 7. Calculate the smallest common multiple of x(d) and 18. 18 What is the common denominator of -35/18 and 5 + ((-1577)/(-4980))/((-236)/3755 - 0)? 8496 Suppose 4c - 39 = c - 5q, 0 = 5q - 15. Suppose c = 2d + 2. Suppose 14 = 2l - 4n + 6n, -4l - 2n = -32. What is the least common multiple of l and d? 9 Find the common denominator of 169/126 and ((-81)/1008-148)/(2 + (-14)/4). 126 Let o = -16047372517706120923136093/8235242820 + 95482461240605146/49. Let v = 2/32679535 - o. Let y = -478/9 - v. What is the common denominator of y and 23/8? 40 Let p = -16575 + 596731/36. Let i(u) = u*2 - 8u. Let f be i(6). Calculate the common denominator of p and (2/16)/(f/(-808)). 36 Suppose -u + 3t + 0t + 53 = 0, 4u - 3t - 158 = 0. Calculate the lowest common multiple of u and (-1108)/(-20) - 2/5. 385 Let r(f) = -f*3 + 88f*2 - 975f + 72. What is the smallest common multiple of r(75) and 392? 3528 Let w = -157768/45801 - -1/5089. Let d = 44/279 + 1252/3069. What is the common denominator of w and d? 99 What is the common denominator of (141082/(-8855) + 16)(1 - -1) - 0 and -63/160? 12320 Find the common denominator of -37/536 and ((-1518)/(-117) + -5 + -8)/((-16)/(-498)). 6968 Let u = 45 + -45. Suppose 15z - 116 - 49 = u. What is the least common multiple of 34 and z? 374 Suppose 4m - 6m = -4d - 756, 4m + 567 = -3d. Let k be ((-36)/(-21))/((-6)/d). Calculate the least common multiple of (-10)/45 + 21643/k and 14. 840 Suppose -h + 2d + 83 = -38, 227 = 2h + d. What is the lowest common multiple of h and 17? 1955 Suppose -c + 1238 = 5a + 339, -184 = -a + 4c. Calculate the least common multiple of 12 and a. 180 Let n(w) = -3w + 82. Let d be n(28). Let i be (d/(-3))/(-1) + 148/6. Suppose 4t - i + 0 = 0. Calculate the smallest common multiple of t and 33. 66 Find the common denominator of (-1 - 121/129) + 36/(-7 + 25) and -53/387. 387 Let y = 2664 - 2620. Let r = -44 - -75. Let f = r - 15. Calculate the smallest common multiple of f and y. 176 Let o be ((-18)/(-3))/((-5)/(-5)). Suppose 0 = -23n + 31n. Suppose of + nf = 60. What is the smallest common multiple of 8 and f? 40 Suppose -14k = -37k - 5060. Calculate the smallest common multiple of (-6)/33 - (-4)/(k/(-4795)) and 9. 261 Let o = -609859/97 - -6287. Find the common denominator of (-366 + 365)/((-4)/17) - 1 and o. 388 Let a be (22/4)/11-4472. Let k = 40145/18 + a. Find the common denominator of k and 15/22. 198 Let h(d) = -25d + 208. Let c = 35 - 13. Calculate the lowest common multiple of c and h(8). 88 Suppose -2x = 6, x = 3p + 31013 + 26884. Let g = 231731/12 + p. Let f = 205375 + -28341875/138. Find the common denominator of g and f. 276 Suppose -10n + 8835 = 5b - 7n, 15 = -3n. Calculate the smallest common multiple of b and 780. 46020 Let l(h) = h - 3. Let c be l(-6). Let k = c + 7. What is the least common multiple of 14 and 5/k4/(-1)? 70 Suppose -4g + 2x = -x + 181, -10 = 2x. Let u = g - -93. Calculate the lowest common multiple of u and 6. 132 Let y = -37602/11 - -3416. Let b = 273868 + -3018041/11. Let d = -498 - b. Find the common denominator of y and d. 11 Let u(d) = -d + 8. Suppose 9i = 2i + 28. What is the lowest common multiple of (7 - i/1)3 and u(6)? 18 Let t be ((-315)/140)/(2/170). Let h = -6655/36 - t. Calculate the common denominator of -115/54 and h. 54 Suppose -32 = -5s - 5k + 38, 2s - 56 = 2k. Calculate the smallest common multiple of 333 and s. 2331 What is the common denominator of 67/20 and (-1099)/523/(-7)11/4257? 33540 Suppose -2y + 19 = 25. What is the common denominator of -46/7 and 94/y15/970? 679 What is the lowest common multiple of 5600 and 8/(-28) + (-739140)/(-231) - 1434/(-2629)? 22400 Suppose 5m + 3v - 99 = 0, 62m - 63m + v = -15. Calculate the smallest common multiple of m and 1094. 9846 Let i = 161 - 244. Let f = -18167/8 - -2268. Find the common denominator of f and i/633/(-22). 8 Let y be ((-1)/(28/(-264)))/(4/28). Suppose x = -3k + 20, 2k + y = 19x - 14x. Calculate the least common multiple of x and 296. 2072 Suppose 4u + g = 361, u + 3u = -4g + 364. What is the lowest common multiple of (-900)/u16/(-10) and 390? 3120 Let q(k) = k*2 - 7k - 3. Let n(w) = -4w + 38. Let p be n(8). Let f be 1/(7/67) + p/14. Calculate the common denominator of -25/4 and q(f). 4 Let x = -17172 - -1081805/63. What is the common denominator of x and 21/50? 3150 Let g = 5116 + -5035. Calculate the least common multiple of 2 - (20/50 + (-352)/5) and g. 648 Let b = 478825/32 - 14962. Let f be -3 + 1 - (-2 - (-1)/1750). Let p = 4562/875 - f. Calculate the common denominator of p and b. 224 Let u = -2892 + 23205/8. Let c = 633 - 350. Let k = c + -1171/4. What is the common denominator of u and k? 8 Suppose -74x + 2000 = -516. Calculate the least common multiple of x and 58. 986 Let o = -54 + 30. Let f = o + 28. What is the common denominator of (-1969)/1386 - f/18 and -29/20? 140 Find the common denominator of -1/8 and 1/(-3306)34/((-918)/891). 4408 Let l = -2329451/56 + 41596. Let c = -224/11 + 2331/88. Find the common denominator of c and l. 56 Let q = 271 + -235. What is the common denominator of (-200)/6(-5)/8 and (-2 - 285/(-130))/((-2)/q)? 78 Suppose -5h = -3p - 340, 86p - 3h = 85p - 108. Calculate the common denominator of 20/33 and (-52)/(-117)((-8001)/p)/7. 330 Let v = -3935 - -5828. Calculate the smallest common multiple of 12 and v. 7572 What is the common denominator of ((-10)/(-4) + (-51089)/20445)213/(-62) and 79/8? 35960 Let p be (-1)/(-9)(-2910)/(-10) + 0. Suppose 0 = -5a + 136 + 29. Let q = a - p. What is the common denominator of 25/6 and q? 6 Calculate the common denominator of -41/57 and (-14)/49 - 114/(-105) - 18056/20520. 513 Let x(a) = 95a*3 - 94a*3 + a + 236 - 2a + a*2 - 243. Suppose -d - d + 13 = 3i, -3i - 3d = -12. Calculate the smallest common multiple of 12 and x(i). 276 Calculate the common denominator of (-1157375)/133200 + 8/(-148) - -9 and 67/2556. 10224 Let d = -326107955/1934721 - 2/214969. Let r = -52771/315 - d. Find the common denominator of -71/120 and r. 840 Let c(p) = 118p2 + 45p + 46. What is the lowest common multiple of c(-1) and 120? 14280 Let r = -25 + 31. Calculate the lowest common multiple of (-81)/(-54)(-52)/(-3) and r. 78 Calculate the least common multiple of 1232/(-24)(72/112)/(3/(-4)) and 1532. 16852 Let w = 2131/216 - 7/216. What is the common denominator of w and -145/84? 84 Let m = -1680994/117 - -421410481/31356. Let p = m + 3709/4. Calculate the common denominator of 37/6 and p. 402 Let y = 103 - 91. Suppose -4r - 2r + 396 = 0. What is the least common multiple of r and y? 132 Suppose 139y - 174y + 78 = -27. What is the smallest common multiple of y and 4177? 12531 Let y = 919431/92 - 9994. What is the common denominator of -85/92 and y? 92 Let k be 8/10 - 222/(-10) - -3. What is the common denominator of ((-19789)/572 - 4/k)/3 and 17/48? 48 Let k(v) be the first derivative of v*2 + 20v + 18. Let t be k(-9). Suppose t = -2s + 14. Calculate the lowest common multiple of s and 10. 30 Let l be (60/(-3))/(-34/18). What is the common denominator of ((-513)/l)/(108/45) and ((-62)/(-16) - -2)/(-5)? 40 Let x be (-12)/(-5) + (-30)/(-50). Suppose -1 = -4f + xq + 34, -3q + 9 = 0. What is the smallest common multiple of -1 - -3 - (0 - -1) and f? 11 Suppose 4 = 62s - 60s. Suppose -6m + 3m = -216. Suppose m = 5g - g. What is the smallest common multiple of g and s? 18 Suppose a + 4d = -2a + 1240, 5d - 2060 = -5a. What is the least common multiple of 1032 and a? 17544 Let i(a) = -a*2 - 45a - 170. Calculate the smallest common multiple of 210 and i(-8). 630 Let o = 56573/4 + -14167. Let k be (-2)/(-2) - (7 + -4). What is the common denominator of 125/(-6) + (-3 - k) and o? 12 Suppose -5d - 4v = -264, -d + 41 = 5v - 16. What is the smallest common multiple of 1170 and d? 2340 What is the common denominator of ((0 - -18)/(420/315))/(-4) and 31/2544? 2544 Let t = 71763/10 - 7188. Calculate the common denominator of 42/(-4)6(-2)/(-4) and t. 10 Suppose -575406 = -19r + r. Let l = -3260501/102 + r. Find the common denominator of l and -145/6. 102 What is the common denominator of (-54)/8*12/111 and 4/(-12) - 36/(-189)? 259
Find the third derivative of h*5 + 12h*4 + 278h*3 + 28934h*2. 60h*2 + 288h + 1668 What is the second derivative of -291b4 - 19b*3l + 3b2 - 1169564bl wrt b? -3492b*2 - 114bl + 6 What is the first derivative of -343166k + 564102? -343166 Find the first derivative of 456415m3 + 412532. 1369245m*2 Differentiate -114602k*4 + 97940. -458408k*3 Differentiate -144v*4 + 3v*3 - v - 307485. -576v*3 + 9v*2 - 1 What is the second derivative of 1503r*3 - 81r*2 + 651365r? 9018r - 162 What is the derivative of 30864x + 33374 wrt x? 30864 What is the derivative of 50cx*2 - 7086cxy - 13x2y + x*2 + 54xy wrt c? 50x*2 - 7086xy Find the second derivative of 71i*3p - 7428i2p - ip + 2i + 299 wrt i. 426ip - 14856p What is the second derivative of -51513k*5v + 12k2vw + kvw - 49kv - 2kw - 5vw + 186v + w wrt k? -1030260k3v + 24vw Find the second derivative of 236q5 + 255q*4 + 11705q + 1. 4720q3 + 3060q*2 Find the second derivative of 220ck4 + 23ck - 123k*4 - 57k - 55 wrt k. 2640ck*2 - 1476k*2 What is the derivative of -8316f*3 + 2f + 11464? -24948f2 + 2 What is the derivative of -10q*3 + 1831q + 371561? -30q2 + 1831 What is the third derivative of 25678q*4 + 2q3 - q2 - 76638 wrt q? 616272q + 12 What is the third derivative of 8488h4 + h3 + 77156h2 wrt h? 203712h + 6 Differentiate -1070944fm3 + m3 - 68613m2 wrt f. -1070944m*3 Differentiate -2j*3x - 1234jx - j + 74891x wrt j. -6j*2x - 1234x - 1 What is the first derivative of 182213d + 577260 wrt d? 182213 What is the derivative of 1589fg*2 + 12fg - 15g*2 - 601g - 3 wrt f? 1589g2 + 12g What is the first derivative of -146006b2 - 373279 wrt b? -292012b What is the third derivative of -869039z3 + 919397z*2? -5214234 Differentiate 618621t + 1641705. 618621 What is the third derivative of c*5 - 25508c*4 + 6c*2 - 281c - 45 wrt c? 60c2 - 612192c Find the second derivative of -70996l3 - 93559l wrt l. -425976l Find the third derivative of 42b*5 - 2b*4 - 181b*3s + b*2s + 116679b2 wrt b. 2520b*2 - 48b - 1086s Find the second derivative of 6842g*4iv + 56g*2iv - 191554giv - 2gi wrt g. 82104g2iv + 112iv What is the second derivative of 713ls3 + 2ls + 2l - 161s2 + 6s - 7990 wrt s? 4278ls - 322 Differentiate -2a3 - 9653a*2 + 37788. -6a*2 - 19306a What is the third derivative of -10669g2w*3 + 161g*2w*2 + 2g*2 - 9gw3 - gw - w*3 - 3w*2 + 472 wrt w? -64014g*2 - 54g - 6 Find the second derivative of 3628342o2u - 2o2 - 14ou - 152009o wrt o. 7256684u - 4 What is the second derivative of 386456m*2 + 9m - 849 wrt m? 772912 What is the second derivative of -5f5 + 797f4 + f2 - 6674f wrt f? -100f*3 + 9564f*2 + 2 Find the third derivative of 31807p*3 + 50p*2 + 31p - 5. 190842 What is the second derivative of 38s2v*2 - 1223s*2 - 330sv2 - 32sv - 1 wrt s? 76v*2 - 2446 What is the first derivative of dmq2 + 1832dm - 2dq2 - dq + 78m - 55906q wrt q? 2dmq - 4dq - d - 55906 What is the second derivative of 7s*2u + 6269s2z + 143080su + 2sz wrt s? 14u + 12538z What is the third derivative of -10d3t3 - d3t2z*2 - 31d*3t*2z - 57062d2t*3z*3 - 2d*2t + 467t2z*3 wrt t? -60d*3 - 342372d*2z*3 Find the second derivative of 107627v*2 - 3v - 23454. 215254 What is the third derivative of -3t5 - 2t*4 - 6153t*3 - 18t*2 - 520t + 4? -180t2 - 48t - 36918 What is the third derivative of -60479l5 + 10l*4 + 1617l*2 - 219 wrt l? -3628740l*2 + 240l Differentiate -115669b2f - 15049b2 - 2bf - 12b with respect to f. -115669b2 - 2b Differentiate -230g2t*3 + 120897g*2ty + 2609g*2 - 4t*3y wrt y. 120897g2t - 4t3 What is the derivative of 8gk - 7g + 166318k - 2 wrt g? 8k - 7 Find the second derivative of -20445p2 - 26938p wrt p. -40890 Find the third derivative of 72950u2v*3 - 2u*2v*2 + uv*3 + 56281uv2 wrt v. 437700u*2 + 6u Find the third derivative of 111071v6 + 2v*2 + 1348943v. 13328520v3 Find the second derivative of 285206n*5 - 148038n. 5704120n3 Differentiate 14arz*2 + 27az2 - 4az + 183rz2 - 48 wrt r. 14az2 + 183z2 Find the first derivative of m3 + 1481m2 - 210540. 3m*2 + 2962m Find the first derivative of -2go*4 - 139757g + 322946o4 wrt o. -8go3 + 1291784o*3 What is the second derivative of 1661283c*2 + 710c + 112 wrt c? 3322566 Differentiate 61jv*2 + 283jv - 3j - 6620v2 - 24v wrt j. 61v2 + 283v - 3 What is the second derivative of -46370w5 + 15485w? -927400w3 Find the second derivative of 394543w*2 + w + 125951. 789086 Differentiate 781523v*3 + 957987 wrt v. 2344569v*2 What is the second derivative of 198d*2v*2 - 33501d*2v - dv2 + dv + 60v2 + 1 wrt v? 396d*2 - 2d + 120 What is the second derivative of 9662b2g*2y*3 + 12b*2g*2y - bg2y*3 + 213bg2y*2 + 21g*2y + 2gy*3 wrt b? 19324g*2y*3 + 24g*2y What is the second derivative of -64428k3 - 2k*2t + 2kt - k - 3296t wrt k? -386568k - 4t What is the second derivative of -277605dh2 + 3dh + 1032d + 38h - 2 wrt h? -555210d Find the second derivative of 7bc - 3bf*4 - bf - 2b - 446cf2 - 12f*2 + 44f wrt f. -36bf*2 - 892c - 24 What is the third derivative of -16885c5 - 2c*3z*3 - 20c*2z*3 + 2152z wrt c? -1013100c2 - 12z*3 What is the third derivative of 1839937n*4 + 2n*2 - 12n + 15895? 44158488n Find the third derivative of -51280a*4 - 9a*2 + 446. -1230720a Differentiate -3509229g - 1584238 with respect to g. -3509229 What is the third derivative of -9727y*5 + 20y*4 - 1403352y*2? -583620y*2 + 480y What is the derivative of -8227c3 - 21c*2 - 3c - 4421027? -24681c2 - 42c - 3 What is the second derivative of 387h3 + 528h*2 + 44287h + 6 wrt h? 2322h + 1056 Differentiate -5dw - 2d - 173w - 3662 with respect to w. -5d - 173 What is the third derivative of 20d3j*3s - 376d3s*2 - 6d*2j - 104dj*3s - 14s2 wrt d? 120j*3s - 2256s2 What is the first derivative of 23i*2r*3 - 420i*2r - 52i2 - 46i wrt r? 69i2r*2 - 420i*2 Find the third derivative of 1057g*6 - 13g*2 - 567g - 1 wrt g. 126840g3 Find the first derivative of 20319n - 40666 wrt n. 20319 What is the third derivative of -38344n3 - 15n*2 + 41n + 5 wrt n? -230064 Find the first derivative of 647082h2x*2 - 3x*2 + 248502x wrt h. 1294164hx*2 What is the second derivative of 61l*2m*2o - 3686l2m*2 - 20l*2m + 67l2 - 3mo + 1 wrt m? 122l*2o - 7372l2 Differentiate -1705535a*4 + 150095 wrt a. -6822140a*3 Find the third derivative of -5377s*4 + 7s*3 + 2724472s*2 wrt s. -129048s + 42 Differentiate 31666mz + 3451m wrt z. 31666m Find the third derivative of 24k4 - 444k*3 - 211k*2 + 334k. 576k - 2664 What is the third derivative of 11h*4 - 5685h*3 - 12312h*2 - 13? 264h - 34110 Find the second derivative of 961x4 + 9x*3 - 7x - 4090. 11532x2 + 54x Find the second derivative of 291521x2 - 1100x - 613 wrt x. 583042 Find the second derivative of -5635902s2 + 2753504s wrt s. -11271804 Find the third derivative of -i*4 + 22224i*3 + 6i*2 + 604. -24i + 133344 Find the third derivative of -368286c3 + 61564c*2 + c wrt c. -2209716 Find the third derivative of 56pu3 + 4pu2x + 2u6 - 170u*3x + 9u2x - 17 wrt u. 336p + 240u*3 - 1020x What is the third derivative of 1521669x5 - 1534536x*2? 91300140x*2 What is the third derivative of 103o*6 + 526o*4 - 43o*2 - 21o - 4 wrt o? 12360o3 + 12624o Find the third derivative of 2c3i*3 - 5c*3i*2 + 6011c*3i - c*2i*2 - 13561i*3 wrt c. 12i*3 - 30i*2 + 36066i Find the third derivative of -2dg*5 - 561dg3 + 4dg2 - 2dg - 58d + 3g wrt g. -120dg2 - 3366d Find the second derivative of -11a2r*3 - 2a*2r - a*2 - 14168ar3 - 3ar - 873 wrt r. -66a*2r - 85008ar Find the first derivative of -36583bc - 31166b wrt c. -36583b What is the second derivative of 1324365f3 - 1439580f wrt f? 7946190f Find the second derivative of 154m*5 + 2m - 96006 wrt m. 3080m*3
Let c = -179 - -176. Let p be (11/c)/((-29)/2088). Solve -2d + 2 = 4i + p, -3i - 9 = -d for i. -4 Let c(h) = -h*2 - 3h + 85. Let j be c(-10). Suppose 5t + j - 25 = 0. Solve 2r - 7r = tq - 19, 5q + 40 = 5r for q. -3 Suppose 20o - 3219 = -3179. Solve v - 2 = -2r, 4r - o + 8 = 3v for r. 0 Let o be (3/(-8))/((-90)/1200). Solve 5v + op + 10 = 0, 168v + 5p = 165v - 10 for v. 0 Suppose 5o = -3s + 2627, -s = o - 5o - 870. Let q = s - 870. Solve -5v = qc - 2c - 28, 0 = 2v + 5c - 28 for v. 4 Suppose -178f + 190f - 204 = 0. Suppose -28y = f - 157. Solve -7s - 5 = -3a - 8s, 0 = -a - ys - 3 for a. 2 Suppose 357 = 5m - 12m. Let k be m(20/15)/(-2). Let t = k + -30. Solve 0 = -3w + to - 8, -4o + 0 = -8 for w. 0 Suppose -260j + 265j - 225 = 0. Solve -5n = -5c - j, 5n - 4n = -5c - 21 for n. 4 Let t(w) = 48 + 22w - 49w2 + 48w*2 - 45. Let a be t(22). Solve -4b - 16 = -ai + 2i, 2b + 3i = -22 for b. -5 Let o be (7/2)/(2/4). Let z(q) = -q*3 + 7q*2 + 6. Let f be z(o). Suppose 4v - 10 - f = 0. Solve -5g - 5s = -20, 2g + 0g - vs + 22 = 0 for g. -1 Let m(t) = 11 - 3t + 6t - 53 + t. Let b be m(12). Let c be (-4)/b(-3)/1. Solve 3i + 3 = -3p - 12, 14 = -ci - 3p for i. -1 Let n(z) = z*3 + 64z*2 - 47z + 1174. Let k be n(-65). Solve -5f + 31 = -2c, -kf + 11 = -c + 4c for f. 5 Suppose 0 = 3r - 4h + 19, -2r - 10 = 2h - 4h. Let y be 1r(2 + (-42)/6). Solve yn = 3q + 20, 3q + 2n = -q - 18 for q. -5 Let p(s) = 12s + 191. Let k be p(-11). Suppose -7y + 80 = k. Solve 0 = -yq - 0q + 5w + 18, -3w - 7 = 2q for q. 1 Suppose 0 = 3f + 5b - 86, -4b - 12 = -2f + 16. Suppose 11q = -0q + f. Solve u + qy = -6, 4y - 10 - 6 = 5u for u. -4 Suppose 3s + 0s = -12. Let i be 54/10 + s/10. Let g = 57880 + -57855. Solve -x = x, -g = ia - x for a. -5 Let t = -140 - -141. Let x be (-40)/1200t/1. Solve 5d - 5 = x, -3l + 2d = l + 2 for l. 0 Suppose d - 4d = -18. Suppose -23n + 14n = -4n - 15. Solve -dl = -l + 25, nh = 3l + 9 for h. -2 Let u = -40 - -44. Let r be 12/8 + 10/u. Let j(f) = f*3 + 15f*2 + 13f - 6. Let z be j(-14). Solve rl = d + 15, -3d = -5l + 2 + z for l. 5 Let p be 7 - (-6)/15-10. Suppose 0 = -u - 101 + 103. Solve m - um = -2l - p, 2m - 5l = 8 for m. -1 Let u be 23 + -1 + (3 - -2). Suppose u = 4r - r. Let z = 19 + r. Solve 2j = 5x + 28, 4j = 3x - 0x + z for x. -4 Let w(k) = k*3 - 8k*2 - 29k - 40. Let t be w(11). Solve tb = -3g + 8, -5g + 15 = 3b + 9 for g. 0 Suppose -y + 5r - 133 = 0, -3y = -12r + 7r + 419. Let k = -82 - y. Let d = k + -61. Solve -3t = -dt - 2u - 9, 2u = -6 for t. 1 Let b = 57817 + -57811. Suppose 0 = -c - 1, 5l = -4c - 0c + 1. Suppose l = k - 4. Solve -2h + 3y + b + 1 = 0, -4h - 3y + k = 0 for h. 2 Let c(d) = 77d + 3161. Let b be c(-41). Solve 9i - 13i - 29 = -3n, 0 = i - bn + 17 for i. -5 Let u be ((-10)/700)/(-4 + -3). Solve u = -5v - 3i - 5, -7i = -3i + 20 for v. 2 Let d(q) = -95q + 3. Let r be d(1). Let l = r - -102. Suppose i - l = -4i. Solve -20 = -5a, iw - 2a + 1 = -17 for w. -5 Suppose -16c + 28 = -18c. Let g = c - -17. Solve 2y + gp - 3 = 4p, 27 = 5y + 4p for y. 3 Let z(x) = 10 + 4x + 13 + 14 - 30. Let g be z(-1). Solve 0j - 4l - 8 = 4j, gj = -2l - 5 for j. -1 Suppose 4w + 5i + 24 = 0, 4w = -75i + 79i + 48. Solve 2j + 2h + 2h = 20, -w = -4j + 4h for j. 4 Let s(h) = 8h - 8. Let c = -121 - -131. Let f be s(c). Let v = f - 70. Solve 0 = -z + 3r - 6, 0 = vz - 2r - 0r + 4 for z. 0 Let c(t) = -t*3 + 7t*2 - 17t + 14. Let l be c(2). Solve l = -f - 4o + 5o - 9, 5f + 40 = 4o for f. -4 Suppose 3l = -z + 13, 5 = l + 44z - 43z. Solve 8f + 22 = 7f - 4v, lv + 26 = -3f for f. -2 Suppose -22i - 3l = -21i - 12, -3i + 5l - 6 = 0. Solve 14 = 3j - 2j - 4d, id = 2j - 13 for j. 2 Suppose -278 + 1382 = 16u. Let r = -67 + u. Let l = -28 + 39. Solve -5z - k - 4k = -15, -rk = -3z - l for z. -1 Suppose -5a = -p - 45, -2a - 9 - 1 = p. Let d = 42 + p. Solve 7h - 4h = -4r - d, -2h - 20 = 4r for r. -4 Let f be (-4)/(-51)3621/142. Solve 2o = fm, -2o = m + 27 - 30 for m. 1 Let d = -6338 + 6338. Solve f + 15 = 3p, p = -d + 5 for f. 0 Let v(m) = m + 2604. Let b be v(0). Let g be b/105 + (-1)/(-5). Let h = 43 - 38. Solve 2i - 5z = -g, -hz + 23 + 17 = -5i for i. -5 Let c = -126 + 27. Let j = -639 - -523. Let n = c - j. Solve -3p - n = -f, -2p = f - 0f + 3 for p. -4 Let q = 8 - 3. Let a be (-63)/(-6)(-120)/(-18). Suppose 0 = aj + 46 - 256. Solve qk - 17 = -jd - d, -k + 1 = 2d for d. -2 Suppose 4c - 11 = 5. Suppose -3o + cs + 2 = 0, -5o + 0o = 2s - 12. Suppose 2l = 10, 12 = z + z + ol. Solve 5v + 4b - 2 - z = 0, -4b - 12 = 0 for v. 3 Let o = -1765 - -1769. Let s be (12/7)/((-39)/(-182)). Solve 3f + 17 = -5b, -b - s = -of - 0f for b. -4 Suppose -2n + 0 - 4 = -3w, -w - 5n + 7 = 0. Suppose -6 = -4s + w. Let i(l) = -2825l + 8477. Let x be i(3). Solve -3p + s = a - 1, xa + 2p + 2 = 0 for a. -3 Let d = 401 - 571. Let z = 173 + d. Solve -5a = w - 4w + 24, zw = -4a - 3 for a. -3 Let y = -4213 - -4223. Solve -4x - y = 3o, 5o + 4x + 14 = -0o for o. -2 Suppose -z + 131 - 122 = 0. Let j be 75/(-5) + z - -10. Solve jp = -2u - 20, -u + 4p + 5 = -15 for u. 0 Suppose 4r - 2344 = -2z - 634, 1680 = 4r - 4z. Suppose -q = -6q + r. Suppose -15 = 82c - qc. Solve -3 = -3x, l + cx = -0x for l. -5 Let a = 860 + -1285. Let t = a - -429. Solve 4x = 4n + 32, tn - 8n = 4x + 8 for x. 3 Suppose -3g = -3r + 21, 4g - 20 = 3r - 7r. Suppose -12t - 4l + 14 = -11t, 0 = 3l - r. Solve 0 = -2a - 2f, -t = -2a + 5a + 5f for a. 3 Suppose 265g - 148g + 36 = 135g. Solve -6j - g = -8j, 0 = 4i + j + 15 for i. -4 Let t be 266 + ((-5)/3 - (-17)/(-51)). Let y = t + -259. Solve m = 4r - 11, -y - 2 = 2r - 3m for r. 4 Let k(a) = 2 + 22a3 + 12a*3 + 21a*2 + 20a - 33a3. Let o be k(-20). Solve -of + 5v - 16 = 2f, 4f = 2v - 16 for f. -4 Suppose 27 = 3m - 2o, 70m + 4o + 19 = 69m. Solve 22 = -37c + 33c + 3u, 2u - 24 = mc for c. -4 Suppose -283 = -51q + 23. Solve 5w = -20, 5w + 14 = -qb + 4b for b. 3 Let n(h) = 799h + 12. Let a be n(0). Solve 5j - au + 10u - 31 = 0, -5u = j + 10 for j. 5 Let l(v) = v*3 - 25 - 11v*2 - 25v*2 - 2v*3 + 8v*2 - v. Let r be l(-28). Solve rk = 3p + p + 29, 0 = -2p + 4k - 22 for p. -5 Let c = -120 - -48. Let d = c - -93. Solve -5v - 2 = -l - d, l + 10 = 2v for l. -4 Let k(s) = -55s + 22. Let u be k(10). Let r be (u/(-110))/(-1(-2)/5). Solve -r = 4h, 2m + 0h + 6 = -4h for m. 3 Suppose -2q + 549 = 4t + q, 0 = 2t + 2q - 272. Let w = -139 + t. Solve wd - s + 1 = 0, -d + 3d + 2s = 2 for d. 0 Suppose 0 = -2g - 2g. Suppose g = -7r - 9 + 142. Let h = 22 - r. Solve -hc - 4 = 2z - 0, 3z = c + 5 for c. -2 Let x(t) = -3t + 77. Let i be x(25). Suppose -id + 24 = -5u, d + u = -d. Solve 4f - 5k = -0f + 11, -2k - 6 = -df for f. 4 Let h be -5 - (3 + 16/8-7). Solve -2w = -5f - 4, -3f + 3w = 6w - h for f. 0 Suppose t - 8 = -2s, -50t - 10 = -45t. Solve -3m + 5 = 4w + 11, -sm = -w + 10 for m. -2 Let t(z) = 2z2 + 28z - 72. Let k be t(-22). Let v = k + -275. Solve -l + 0b = 2b - 10, b = v for l. 0 Suppose 17d + 66 - 191 = -74. Solve -2f = -3y - 7, -15y - 17 = -df - 17y for f. 5 Suppose -2k = -b - 61 + 164, -b = -3. Let s = k - -55. Suppose -2o - 2 = 3o - 4m, -5m = -so - 5. Solve -3i = 2c + o, 3 + 0 = 3i - 3c for i. 0 Suppose -j = -6j - 340. Let m = -65 - j. Solve -5c = -4p - 24, 2c - mp = 3c - 1 for c. 4 Let l = 29414 + -29405. Solve 0 = -v + 7 - 8, -l = -4a + 5v for a. 1 Let s(n) = 3n3 - 13n*2 + 4n + 2. Let u be 3/(-18)-4099/6. Suppose 26 = -21j + u. Let t be s(j). Solve -3h = -8h + 5p - 10, -th - 14 = 3p for h. -4 Let j(i) = 21i - 113. Let x be j(6). Suppose 2n + 14 = 2a, 4a + x = -5n - 4. Solve 5 + 0 = s + ab, 4s + 2b = -4 for s. -3 Let l = 60 - 56. Let y(r) = -r*3 + 31r*2 + 33r - 29. Let b be y(32). Solve -3g - l = -2a, 0a - bg = 3a + 9 for a. -1 Let c = -39 - -42. Suppose -cw + 1 + 71 = 0. Let u be (2 - w/4) + 8. Solve 3g = -m + 4, 6g - 35 = g + um for g. 3 Let t = 3210 + -3205. Solve -a - 3c - 4 = 0, -3c - 37 = -ta + c for a. 5 Let y = 450 - 416. Let x = y - 30. Solve 2m = -3m - xp + 29, 0 = -3m + 2*p + 13 for m. 5
Suppose -2j + 18 = 5t, 2j - t - 2 = j. Suppose 2k + 4q = 2019980, -3k = -jq + 6q - 3029990. What is k rounded to the nearest one hundred thousand? 1000000 Let d = -339.99 - 101.31. Let v = d - -419. Round v to the nearest integer. -22 Suppose -164l + 166l = -178000. What is l rounded to the nearest 10000? -90000 Let s = 77584241 - 77584295.999923. Let p = 36 + -91. Let c = p - s. Round c to five dps. -0.00008 Suppose 4i + 4b - 3640 = 0, -1169 + 265 = -i + b. Let s = 13 + i. What is s rounded to the nearest one hundred? 900 Let h = -1.9 + 1.8999907. What is h rounded to 6 dps? -0.000009 Suppose 0 = -2o + 5f - 999995, -3o + 2o - f - 500001 = 0. What is o rounded to the nearest 100000? -500000 Let v = 193.652 - 193. Let t = 0.012 - v. What is t rounded to one decimal place? -0.6 Let f = -4691119.2831424 - 520199.5168406. Let v = f + 5211316. Let t = v - -2.8. Round t to 5 decimal places. 0.00002 Let y = 579.3 + -508.04. Let p = y - 72. What is p rounded to one dp? -0.7 Let k(w) = -2w2 - 16w - 27. Let c be k(-12). Let i = 5 + c. What is i rounded to the nearest 10? -120 Let i = 565.98856 + -566. Round i to 4 decimal places. -0.0114 Let j(w) = -1418w + 10. Let v be (20/(-6))/((-4)/36). Suppose -2c + v = -8c. Let l be j(c). Round l to the nearest one thousand. 7000 Let d = 0.047 + 39.953. Let o = -0.948 + 47.848. Let j = d - o. What is j rounded to zero decimal places? -7 Let u = -64 - -62. Let j(p) = -761p*3 - 3p*2 - p + 2. Let i be j(u). Round i to the nearest one thousand. 6000 Suppose -15 = 4u + 5. Let d = 6 + u. Let h(k) = -691k2 + 1. Let c be h(d). Round c to the nearest one hundred. -700 Let r = 0.317 - 0.463. Round r to 1 dp. -0.1 Let y = -5511.00004717 + 5511. Round y to 5 dps. -0.00005 Let x = 18.1317 + -0.4217. Round x to the nearest integer. 18 Let w = -1311425276.9999927 - -1311425456. Let i = 346 + -167. Let y = w - i. Round y to 6 decimal places. 0.000007 Let o = -9879.400047 + 9859.4. Let p = 35 - 15. Let y = o + p. Round y to 5 dps. -0.00005 Let c be ((-9)/6)/((-3)/(-8)). Let n be 4/(c/(-3)) - 1. Suppose nr = -2r - 2720000. What is r rounded to the nearest 100000? -700000 Let b be (-4)/(8/(-6)) - 11. Let m be (-4)/18 + b/(-36). Let h(z) = z2 + z - 77000. Let c be h(m). Round c to the nearest ten thousand. -80000 Let h = -1050977.2888 + 1050879.28880126. Let q = 0.111 + 97.889. Let a = q + h. What is a rounded to seven decimal places? 0.0000013 Let s = -56.59 + -224.71. What is s rounded to the nearest 10? -280 Let k = -54.6 + 141.3. Let i = k + -121.8. What is i rounded to zero decimal places? -35 Let c = 148 + -248. What is c rounded to the nearest ten thousand? 0 Let f = -12370 + 12369.2923. Round f to two decimal places. -0.71 Let g = -816.396491 - -816.4. What is g rounded to four decimal places? 0.0035 Suppose 81563 = -9z + 23063. Round z to the nearest one thousand. -7000 Let p = -65 - -34. Let f = 60.6 + -26.8. Let a = f + p. Round a to the nearest integer. 3 Let w be (-4754)/(5/30-4). Round w to the nearest 1000. 7000 Suppose -b = -2x - 2844, 4x + 9b = 4b - 5660. Round x to the nearest one hundred. -1400 Let d = -40692746778.79930643347 + 40692746779. Let m = d + -230.20069229653. Let z = -230 - m. Round z to 7 dps. -0.0000013 Let n = 155.2 - 4.2. Let p = -150.933 + n. Round p to two decimal places. 0.07 Let m = 5845 + -5845.16298. Let d = m - -0.163. What is d rounded to five dps? 0.00002 Let n = -201 - -200.999865. Round n to six dps. -0.000135 Let v = -131.3696 + 0.0696. Round v to the nearest 10. -130 Let x = 1076 - 1075.99814. What is x rounded to 4 decimal places? 0.0019 Let i = 510734 + -975734. What is i rounded to the nearest 10000? -470000 Let f = 462039.747 - 462242. Let s = f + 202. What is s rounded to 2 decimal places? -0.25 Let z = -538 - -462. Let a = -518.9729 + 442.966. Let k = a - z. What is k rounded to three dps? -0.007 Let i = -28 - -28. Suppose i = -0k - k - 2060000. Round k to the nearest one hundred thousand. -2100000 Let l = 3574.6 + -3574.599984499. What is l rounded to seven decimal places? 0.0000155 Let c = -265 + 452. Suppose 3a - 108 - 61 = 5i, 4a - c = -i. Let d = a + -23. Round d to the nearest 10. 30 Let b be 1/3 - (-2)/(-6). Suppose 0 = -i + 2m + 5492, 0i - 5m = 2i - 10957. Suppose b = -4k - i - 2954. What is k rounded to the nearest one hundred? -2100 Let j(c) = 1201c + 348. Let r be j(8). What is r rounded to the nearest one hundred? 10000 Suppose -2o + 356 + 278 = -s, -5s = 3o - 925. Let v = o + 55. Round v to the nearest one hundred. 400 Let m = 129.2 + -124.312. Let l = -5 + m. Let y = -0.1120126 - l. Round y to 6 decimal places. -0.000013 Let t = 253.1 + -253.6285. What is t rounded to 2 decimal places? -0.53 Let b = 0.667 + 0.0418. What is b rounded to one decimal place? 0.7 Let z(t) = 5216t3 + 7t*2 - 16t + 16. Let s be z(-8). What is s rounded to the nearest one hundred thousand? -2700000 Let o = 488 - 218. Round o to the nearest one hundred. 300 Let m = -133 - -216.8. Round m to the nearest ten. 80 Let g = 37408060 + -25948060. What is g rounded to the nearest 1000000? 11000000 Let k = 1.864 - 1.9. Let q = 0.03599752 + k. Round q to 7 dps. -0.0000025 Let z = 0.97 - -0.03. Let o = z - 3. Let c = -1.99999997 - o. Round c to 7 decimal places. 0 Let q be (-2 - (-1 + -3)) + 4. Suppose qu + 75 = -5y + u, 5 = -y - 3u. Round y to the nearest 10. -20 Suppose 0 = -3n - 1815 + 36585. Round n to the nearest 1000. 12000 Let z = 896500.9882 - 896352. Let o = 159 - 10. Let i = o - z. What is i rounded to three dps? 0.012 Let q = 125 + -75. Let z = -49.9768 + q. Let m = -0.02 + z. What is m rounded to three dps? 0.003 Let p = -136 + 135.933. Let x = p - -27.067. Let w = x - 28.9. What is w rounded to the nearest integer? -2 Let h(w) = -3w - 2. Let c be h(-2). Suppose -18 = -2i + ci. Let p = i + 4. What is p rounded to the nearest 10? -10 Suppose 0 = -0b + b - 1. Let a be (-3 + 795140 - -2)b. Suppose 5139 = u + a. What is u rounded to the nearest one hundred thousand? -800000 Let c = 1.1 - 7.5. Let g = -6.462 - c. Let q = 3.762 + g. Round q to zero dps. 4 Let f = -4791 - -7056. Round f to the nearest 100. 2300 Suppose -f - 184 - 56 = 0. Let m = 346 + f. Round m to the nearest ten. 110 Let x(h) = -19675003h*2 + 8h - 4. Let y be x(2). Round y to the nearest one million. -79000000 Let g(m) = -m*3 + 6m*2 - 1. Let d be g(6). Let s(x) = -5 - 35x*3 - 21x3 + x2 + 5. Let i be s(d). What is i rounded to the nearest 10? 60 Let z = -15154 + 15153.93863. What is z rounded to 2 dps? -0.06 Let y be (-5 - -5)/(4/4). Suppose -v - 4v - 79505190 = y. Let k = v + -4598962. What is k rounded to the nearest one million? -21000000 Let p be (-2)/8 - (1 + (-2103428)/16). Let u = p - -13537. Round u to the nearest 10000. 150000 Suppose -4s - 12 = 0, 2u + 9 - 3 = -4s. Let z be (-8)/u(-1161)/36. Suppose -v - z = 78. What is v rounded to the nearest 10? -160 Let u(g) = g3 - 2g*2 - 16g + 5. Let c be u(5). Suppose -5l - 5j + 689990 = c, -2j - j = 6. What is l rounded to the nearest 10000? 140000 Let p be 6770/((-2)/(-500)10/(-4)). Round p to the nearest 100000. -700000 Let r = 4926 + -3447.5. What is r rounded to the nearest 100? 1500 Let q = -69 - -68.952. Let r = -0.0848 - q. Round r to 3 dps. -0.037 Let i be 1 + (-1)/20. Let u be 6/(i(0 - -1)). Let f be (-3)/u + 9560002/4. Round f to the nearest 100000. 2400000 Let v = -27.9 - -190.9. Let p = 148.6 - v. Round p to the nearest integer. -14 Suppose 6y + 1719256 - 9630352 = 0. Suppose 0 = 5a - 27481484 - y. Round a to the nearest 100000. 5800000 Suppose -b = 15906028 - 44536028. Round b to the nearest one million. 29000000 Let j = -120.4 + 120.400002751. Round j to 7 dps. 0.0000028 Let n = 9 - 5. Let s = -1 + n. Let l = s - 2.88. Round l to two dps. 0.12 Let c = 9601402.99766 - 9601482. Let y = c + 79. What is y rounded to three dps? -0.002 Let p(a) be the third derivative of 6a2 + 43/60a*6 + 1/12a*5 + 0a*3 + 1/6a*4 + 0 + 0a. Let o be p(4). What is o rounded to the nearest 1000? 6000 Suppose -3h + 72 = -0h. Let f = h + -24. Suppose 0 = -fr - 5r - 2800000. What is r rounded to the nearest 100000? -600000 Let z(y) = -128y2 - 10y + 20. Let u be z(5). Round u to the nearest one hundred. -3200 Suppose 0 = -6p + 4 + 14. Suppose 4a = p*a - 115000. What is a rounded to the nearest 10000? -120000 Let w = 1.155 + -1.17. Let d = 0.015264 + w. What is d rounded to five dps? 0.00026
Let w = -29715 - -64789. Suppose -10j = 28j - w. Does 80 divide j? False Let b(s) = -10s2 + 2s + 5. Let q be 5 + (-2)/21. Let j be b(q). Is 10 a factor of 13/(j/30 - -5)? True Let n(p) = 43p - 29. Let m(a) = -22a + 14. Let i(t) = -9m(t) - 4n(t). Let l be (270/(-12))/(-3) - (-3 + 35/10). Does 18 divide i(l)? False Is -187584/216-6 a multiple of 19? False Let g(l) = -1700l - 1972. Is 4 a factor of g(-4)? True Is 6 a factor of (-16)/208 + (-55352)/(-143)? False Let m(j) = -803j3 + 59j*2 + 220j + 9. Is 113 a factor of m(-4)? False Let o = 114 - 98. Let v(w) = -w*3 + 17w*2 - 24w + 8. Let a be v(o). Let c = a - -185. Is 4 a factor of c? False Let m(w) = -2w2 + 140. Let u be m(12). Is u/(-1) + (-12 - -9) a multiple of 29? True Let i(m) = -m2 - 15m + 10. Let v be i(-11). Let c = -51 + v. Does 15 divide 9 + -2 - c - 44/(-1)? False Is (-1424)/(-64)1607/14 a multiple of 148? False Let n(s) = -16s2 + s + 2. Let h be n(2). Let p = h + 54. Let r(m) = m2 - 6m - 2. Does 10 divide r(p)? True Let a(o) = 2o - 10. Let t be a(6). Suppose -4s + 4551 = 5k, -ts + 0k + 2274 = 2k. Is s a multiple of 54? True Let t(o) = 14o - 43. Suppose 0 = -3d + 2 + 58. Let m = 30 - d. Is t(m) a multiple of 10? False Let p = -34 + 69. Let t = -14 + p. Suppose 0 = 2b - 2k - 23 - t, 0 = -5b + 4k + 112. Is 8 a factor of b? True Let n(o) = -229o - 8370. Is 11 a factor of n(-62)? False Suppose -5v = 4s - 623, 6s - s + 3v = 782. Is 3 a factor of s? False Suppose 4k - 3f = 59635, -3f = -42k + 47k - 74510. Is 55 a factor of k? True Let b be 3/(-2 + 5)-53-2. Suppose -436 + b = 6m. Let h = m - -127. Does 16 divide h? False Suppose -2c + 15b + 385 = 18b, c - 3b - 215 = 0. Is 20 a factor of c? True Let s(h) be the first derivative of -h4/4 + 5h*3/3 + 2h*2 + 11h + 11. Let f be s(6). Does 10 divide 6 + (f - -3) - -2? True Suppose 2n - 4n - 4 = 0, -5y - 2n + 19246 = 0. Does 70 divide y? True Let t(c) = 36141c3 + c2 + 86c - 85. Is t(1) a multiple of 47? True Let t = -24929 + 36937. Is 19 a factor of t? True Suppose -3a = -c - 23664, -5c = -139 + 109. Does 6 divide a? True Let u = -28 + 33. Suppose -4p - 5b + 430 = -62, up - 624 = -4b. Does 10 divide p? False Suppose 3f + 194681 = 43f - 952479. Is f a multiple of 241? True Let h = 65 + -69. Let c be (80/25 + h)-5. Suppose -4l + 5x + 321 = 0, -3l + cx - 2x + 246 = 0. Is 14 a factor of l? True Let b be 1 + 153 - (-88)/(-11). Suppose bs - 145s = 703. Is s a multiple of 50? False Let p(f) = 84f - 813. Is 4 a factor of p(11)? False Let r be 16(2 - (9 - 1)). Let d = 152 + r. Is 8 a factor of d? True Let r be (-20)/50 - (-186)/15 - 5. Suppose 5v - b = rv - 75, 2v - 4b = 80. Is v even? True Suppose -2i + 0g + 220 = -4g, -3g = 3i - 294. Suppose 0l = 3l - 3q + i, -l - 2q - 28 = 0. Is -22 + 21 + (1 - l) a multiple of 12? False Suppose 249 = x + 18. Suppose -b = -x + 71. Is 5 a factor of b? True Let x(z) = -z2 - 7z - 1. Let s be x(-6). Suppose -2l - 4818 = -sh, h + h - 1927 = l. Suppose 13i - 17i = -h. Is i a multiple of 37? False Let y be 1 + (4/(-2))/(-2). Let m be ((-1)/(-11))/(28/924). Suppose 1328 = 4h - 4l, -mh - 30 = -yl - 1023. Does 47 divide h? True Suppose -3j + 23 + 1 = 0. Suppose jd - 16 = -0. Suppose h = -3g + 152, 0 = dh + 5g - 48 - 261. Is h a multiple of 17? False Is 33 a factor of (2 + 53)((-2585)/(-25) + 36/90)? True Suppose -a = -5i - 674, 1253 = 4a - i - 1367. Suppose 5o + a = 4414. Is o a multiple of 47? True Let c = -109 - -64. Let m(q) = -296q*3 + 3q*2 - 2q - 4. Let t be m(-1). Let d = c + t. Is d a multiple of 31? False Let w = -111 - -64. Let c = w + 63. Suppose v + c = 2v. Is v a multiple of 3? False Suppose 33969 = -9m + 11m + 5p, 0 = -2m + 3p + 33977. Is 52 a factor of m? False Suppose 7 = j - 4d, -26j - d - 13 = -30j. Suppose -589 = -ji + 4p, 13i - 12i = 4p + 199. Is 13 a factor of i? True Suppose -2660 = -2u - u - 5q, 4u - q - 3516 = 0. Let n = u - 621. Suppose 3v + 7 - n = 0. Is v a multiple of 17? False Suppose 2y - 5v + 1 = 4, 4y - 2v - 14 = 0. Suppose 3f = 2i - 9, -4f + 58i = 53i + 12. Is 4 a factor of f/y + (-92)/(-16)? False Let b = 186 - 104. Let a = b - 202. Let g = -35 - a. Does 17 divide g? True Let g be (-16)/6 + 8/(-24). Is -4674/(-8) - (-6 - g) a multiple of 20? True Let t = 12 - 3. Let b = 1 + t. Suppose -530 = -15x + bx. Does 17 divide x? False Let r = -26 - -135. Suppose -104n + rn = 65. Is n a multiple of 2? False Suppose -p = -4h - 1276, 0h + 5h = -4p - 1574. Let l = 464 + h. Is 8 a factor of l? False Let j(h) = -h - 6. Let f be j(-6). Suppose fl + 4 = 4l. Is 12 a factor of (3 + (l - 2))-1 - -53? False Let s = -66 + 67. Let n(f) = f + 9. Let y be n(-10). Does 11 divide s + y(-1 + -42)? True Is 8132/154287/8 a multiple of 41? True Let w(a) = 10a3 - 303a*2 + 24a + 54. Does 91 divide w(33)? False Suppose -5z - 3458 = 2967. Let l = -733 - z. Suppose 0 = 4g - 16g + l. Is g a multiple of 5? False Let l be 387/21 - ((-24)/(-7) + -3). Suppose -5a - 5746 = -la. Is 28 a factor of a? False Is ((320/(-12))/5)/((-19)/6156) a multiple of 18? True Let h = 129 - 211. Let p = h + 167. Suppose -4i = -2v - 70, -v - 4v - p = -5i. Does 6 divide i? True Suppose -5s = 4h - 272802, -20h - 4s = -32h + 818520. Is h a multiple of 66? False Suppose -5l + 104 - 109 = 0, 2t - 1521 = 5l. Does 5 divide t? False Let s = -187 - -1614. Is s a multiple of 4? False Suppose b = -3n + 385, -3b - 2n + 1105 = -3n. Let u = b - 210. Let y = 288 - u. Does 32 divide y? True Suppose 0 = -3k + 4u - 3436, 4k - 5u + 4540 = -10u. Let o = k - -1993. Does 35 divide o? False Let m(o) = 0 + 22 + 6 + 9o + 9o*2 - 10o*2. Let b be m(11). Suppose 29 = r + 3u, 3r + u = br - 117. Does 5 divide r? False Let u(f) = 2f + 18. Let o be u(-8). Suppose 3420 = 3w + ow. Suppose -i - w = -7i. Is i a multiple of 19? True Suppose 0 = 11n - 29n + 77598. Is 8 a factor of n? False Let i = -85 - -85. Is 8 a factor of ((-10)/5 + (1 - i))-40? True Suppose 38s + 18s = -8s + 558080. Is 20 a factor of s? True Let a(r) = -5r + 31. Let b = -3 + 10. Suppose h - 5x + 20 = 0, 3h - bh - 3x - 34 = 0. Is a(h) a multiple of 27? True Let d = 6491 - 1404. Does 21 divide d? False Let f(g) = -g2 - 20g + 3. Let u be f(-20). Suppose 5r + 3i - 837 = 0, 4 = -i - ui. Suppose d = -6d + r. Is d a multiple of 24? True Suppose 148 = -9m + 895. Let r = 87 - m. Suppose -4l = w - 120, w - l - 121 = r. Is w a multiple of 34? False Suppose 3c + 5o = 4, 2c + o + 9 + 0 = 0. Is 100 a factor of c/(6919/1156 + -23)? False Let p = -95 + 175. Suppose 16s - 8s - p = 0. Does 10 divide s? True Suppose 1 = 5c - 4. Let s = 477 - 473. Is 5 a factor of 3/(c/(7 - s))? False Suppose 15o = 13o - 8. Let x be -1(1 - o) - 4. Is 27 a factor of (-161)/(-2) + x/(-18)? True Suppose 2r - 5f - 29 = 0, 2r + f = -3f - 16. Let g(s) = 15s3 - 10s*2 - 5s + 5. Does 15 divide g(r)? True Suppose 1292826 + 1027580 = 32h - 21514. Is 15 a factor of h? True Suppose 21a = 24a. Suppose a = 9h - 2h - 1190. Is 34 a factor of h? True Let v = -83 - -129. Is 4 a factor of v/6 + (-16)/24? False Let g = 178 - 176. Suppose -5b + 3v = -157, gb + 2b - 108 = -2v. Is 29 a factor of b? True Let w be (1 + 2)/(9/12). Suppose z = -wh + 690, 435 = 2h + 2z + 87. Does 43 divide h? True Let g(a) = a3 + 14a*2 - 15a - 27. Let o be g(-14). Let b = o - 76. Does 9 divide b? False Let b be (-456)/(-20) - (-2)/10. Let v(q) = q*2 - 20q + 13. Is 41 a factor of v(b)? True Let s be (-4)/(-10) - (-22)/(-5). Let q be s/12-890 - 2/3. Suppose 0 = -r - 3r + q. Does 37 divide r? True Suppose -50l = -531094 - 246932 - 6024. Is 123 a factor of l? False Suppose 5p + 269 = 244. Let z(l) = -4l3 - 5l*2 - 3l + 3. Is z(p) a multiple of 10? False Suppose -7r + 4r + 25 = 5i, 0 = r. Is (-1)/(4 + i123/(-153)) a multiple of 3? True Let r(h) = h*3 + 7h*2 - 3h + 2. Let v be r(-7). Let z = -73 + v. Is 6 a factor of ((-27)/(-45))/((-2)/z)? False Suppose -971 = 173c - 174c + 3y, -3c + 2938 = -4y. Does 56 divide c? False Let f(z) = 210z + 1988. Is 78 a factor of f(31)? False Let h be (-6)/(-18) + (-25)/(-15). Suppose w - 5k = -16 + 81, hk - 406 = -5w. Is w a multiple of 8? True Let v(l) = -38l - 1582. Is v(-50) a multiple of 3? True Let a(q) = -q*3 + 2q*2 + 3q + 2. Let p be a(3). Let h(j) = 223j3 - 5j*2 - 7j + 28. Is h(p) a multiple of 14? True
Suppose 4a - 8 = -i, -2i + 7 = -0a - a. Let j be (-2)/7 + a/(945/312). Let k(m) = -m2 + 16m - 16. Let b be k(15). Is b equal to j? False Let k = 0.109 - -98.891. Let f = k - 33. Let c = f + -65.6. Is 0.3 greater than c? False Let p = 455 + -444. Suppose -4s + g = 1, 0 = 8s - ps + g - 2. Which is bigger: s or -2/77? s Let c = 17 + 25. Let k be 506/(-6) + 14/c. Let u = -287 + 203. Is k at least u? True Let f = -18 + 19. Let s(r) = -r2 - r + 1. Let a be s(f). Which is bigger: -2/253 or a? -2/253 Let x be -12510/(-2520) - (-6)/(-14). Which is smaller: x or 29/35? 29/35 Let y be ((-810)/132 - -6)2. Suppose -3j + 18 = u, 0 = u - 0u - 3j + 12. Suppose 1 = s, 7 = k + 3s + u. Are y and k unequal? True Let h = 167 + -91. Let c = h - 72. Suppose 2z + 2u - 14 = 0, z = cz - 4u - 7. Is z greater than 7? False Let j = 995/24 - 130/3. Let u = j - -17/24. Which is greater: u or 0? 0 Suppose 0g - 2 = g, -4b + 3g = 30. Let j be (30/b + 3)/((-1)/39). Suppose 15 - j = -v. Which is smaller: v or -9/7? v Let w = 13918 + -14560. Is w at most -644? False Let b(n) = 2n3 + n2 + n + 1. Let o be -6 + 2 + 20/5. Let y be b(o). Do -58 and y have the same value? False Let i be (24/26)/(2266/1339). Let v = -726 + 5090/7. Are i and v unequal? True Let p be ((-31)/(-7) - 60/140) + (-1314)/231. Is p >= -3? True Let i = -2 + 2. Let b = 87 - 83. Let n be ((-48)/(-1232))/((-6)/b). Is n smaller than i? True Let w = -6065 + 6064. Which is smaller: w or -115? -115 Let b(i) = 47i*3 - 2i - 1. Let f be b(-1). Let x = -90413 + 90370. Is f greater than or equal to x? False Suppose -14l + 111 + 86 + 27 = 0. Which is bigger: 384/23 or l? 384/23 Let z = -3272 + 3244. Suppose -3p + p = -4. Let y be 5/(-5)15p. Are z and y equal? False Let f(u) = -9u2 + 64u - 760. Let n be f(24). Which is greater: -4406 or n? -4406 Let a be (-25)/(-5) + -31. Suppose -5c + 4p = 6, -2 = -3c - 8p + 9p. Let i be (-8)/18(-105)/28c. Which is smaller: i or a? a Let c be (-1 - (-15)/6)146560/90. Which is smaller: c or 782? c Let z be 2/(-2 + 2 + 2). Suppose p + 4j - 6 = 0, 3p + j - 4j = 18. Suppose 0 = 3s - 3k, ps - 4s + 5k = 0. Which is greater: s or z? z Suppose -3i + r = 94, -85r = -83r - 14. Is 3 less than i? False Let n = -107 + 116. Suppose -nf = -f + 512. Which is smaller: f or 2/7? f Let t be 11/((-11)/(-3)) + 19/(-9). Let n = 218/225 - t. Which is smaller: n or 0? 0 Let j = -67 - -156. Which is smaller: 98 or j? j Suppose -59247 = 16r + 71r. Which is smaller: r or -688? -688 Suppose -11p = -8 - 36. Let z be ((-14)/p)/(26/676). Which is smaller: -92 or z? -92 Suppose -187o + 111 = -224o. Is 2 at least o? True Let r = -52985767/165 + 321127. Which is smaller: 0 or r? 0 Let g = 10 + -186. Let h be ((-16)/g)/(2/8). Let k = 3 + -1. Which is smaller: h or k? h Let m = -537 - -530. Let f be m/4 - (-35853)/20444. Which is greater: -1 or f? f Let v = -7/6 - -2/3. Let q = v - 7/4. Let l = -7856.1 + 7856. Which is smaller: l or q? q Let l = 545 + -404. Is l equal to 154? False Let b = -73.38 + 98.3. Let p = b - 25. Let v = 65 - 67. Which is bigger: v or p? p Let w = 5221454 + -2182569075/418. Let z = -38044/12287 + 6/1117. Let g = z - w. Is g bigger than -1? True Suppose 84h - 1112 = 80h + 4o, o = 5h - 1386. Which is smaller: 1945/7 or h? h Let c(g) = 2g*2 - 6g + 6. Let y be c(1). Suppose -5s + yz = -21 - 1, 4s + 3z = 36. Which is greater: s or 5? s Let u(k) = k*2 - 3k + 3. Let j be u(2). Let o = -11 + 12. Let g be o/(-3) + ((-104)/(-21))/13. Is j equal to g? False Let w(s) = s*3 - 10s*2 + 10s - 5. Let i be w(9). Let v(c) = 4c + 4c*2 - i + c - 3c*2 + 0. Let r be v(-6). Is 2 smaller than r? False Let x be 8/(-2) - (-9 - -7). Let t be (x/(-3))/((-7)/(-126)). Suppose 0 = 14l - tl + 2. Which is greater: -9/7 or l? l Suppose l - 33 = -w, 0 = 15l - 8l + 3w - 219. Which is bigger: -95 or l? l Suppose 119 = -4s - 89. Let y be (-3223 - -23)/25(-2)/(-4). Let t = s - y. Which is smaller: 15 or t? t Let k be (1/3)/((-2)/(-8))(22 - 37). Which is greater: k or 318? 318 Let m = 0.13 - -6.87. Let b = -961.9 - -1130. Let l = 168 - b. Are m and l unequal? True Let u = 22633/12215962 + -3/1958. Which is smaller: u or -1? -1 Suppose -i - 88 = -5y, -12y + 5i = -7y - 100. Let r = 117/7 - y. Let x = 6.4 + -7.4. Which is smaller: r or x? x Let k be (-2300)/(-24) + 1/6. Suppose -24t - k + 504 = 0. Which is bigger: 13 or t? t Let i = -11181 + 14944. Which is smaller: i or -2? -2 Let o = -290897/27472 + 180/17. Is o less than -1? False Suppose 0 = 7i - 13i - 12. Let y be 16/(2 - i) + 1. Let o(s) = 2s - 18. Let u be o(y). Which is smaller: 0 or u? u Let b = 488 + -1961. Do b and -1472 have different values? True Let o(f) = 631f + 3172. Let y be o(-5). Is y greater than 461/25? False Suppose v + 1 = 5i + 30, 5v = 20. Let w be (i/(-90))/(4/6). Let k = 0.12 + -3.12. Are w and k nonequal? True Let a be (29/(-12))/(9/81). Let n = a + 22. Suppose 7 - 6 = r. Which is bigger: r or n? r Suppose -53m - 105822 = 182144 + 44715. Is m at most as big as -6276? True Suppose -2 = 5g - 22. Let j be (-302)/(-588) + (-2)/g. Let a be 1/(-13) - (-27 + 13068/468). Is j at least a? True Let i be 12/8 + (-13)/(-2). Suppose -2m + 3o - 4 = 2, -4o + i = 4m. Let t = -135/14 - -14417/1498. Which is bigger: t or m? m Suppose 6l - 21l = -30. Let j = 7941/7 - 1133. Do l and j have the same value? False Let k be ((-36)/24)/(2/(-4)). Let q be 6/16 + (-261)/(-72) - 1. Suppose -k = -4w - qz - 0, -w + 6 = -z. Which is smaller: 10 or w? w Suppose 54a - 5791 = -38303 + 3136. Is a at least as big as -540? False Let w = 492 - 144. Let c = -349 + w. Is -12/61 < c? False Suppose 5d - 4 - 1 = 0. Let i = 7890130/727 - 10853. Let u = 5078/7997 - i. Which is greater: d or u? d Let k(c) = 24c + 3. Let l be k(1). Let v = -275 + 307. Which is smaller: l or v? l Let k = -0.38 + 0.22. Let q = -0.04 + k. Let t = 0 - q. Which is bigger: t or 4? 4 Let r = 23.9 + -25.984. Let j = 10.016 + -10.1. Let b = r - j. Do b and -0.26 have the same value? False Let s(r) = -r2 - 13r + 6378. Let n be s(-87). Let t = 2727/2 - 1423. Which is bigger: t or n? t Let d = 26 + 14. Let u = 50 + -10. Let t = d - u. Is t bigger than 0.2? False Let z = 45 + -37. Suppose -2w = -z, w = -3k - 3w - 23. Let a be (1/(-3))/(k/(-312)). Is -8 greater than or equal to a? True Suppose -4x = w - 139, -w = 3w + 20. Suppose 2m - x = 122. Suppose j - m = -4h, j = -3h + 18 + 40. Which is greater: h or 20? h Suppose 0 = -7a + a + 306. Suppose -a = t + 3p, 2t + 69 = 4p + p. Let k be (t/2 + -1)/(-2). Is 11 greater than or equal to k? True Suppose 8060 = 33x - 7x. Suppose 6s - x = 284. Is 0.1 equal to s? False Let l = -1329/1729 + 72/91. Which is bigger: 0 or l? l Let c(d) = d - 18. Let s be c(20). Let p be (3 - 2) + 0 + -91 + s. Let j = 98 + p. Which is bigger: j or 14? 14 Let v be 5/2 + 4 + 9/(-2). Suppose -vm = 3m - 5, -3d - 2m + 2 = 0. Let l = 526/551 + -46/29. Do l and d have the same value? False Suppose -432 = -4l + b - 3b, -l + b = -114. Let w be (-30940)/364 - (-2)/(4/(-10)). Let v = w + l. Which is smaller: -2 or v? -2 Let d = 143 - 94. Let h = -0.0036 + -521.9964. Let f = 521 + h. Is d < f? False Let j = 3732 - 3731. Is j at least 21/179? True Let c = -315/2273 - 12129809/25003. Is c bigger than -485? False Let r be 1/5((-14599910)/(-417144) - 35). Which is smaller: r or 1? r Suppose -13g + 408 = -16g. Let n = -64 - g. Let b = n - 72. Is -14/17 greater than b? False Suppose 1013266 + 2027772 = -343b. Is -8867 bigger than b? False Suppose -80c + 53c = -48c + 714. Is -113 greater than or equal to c? False Suppose -246 = -3g + 2j - 0j, 4g - 3j = 328. Let z = -11 + g. Let r(o) = -71o*3 + 2o*2 + 2o + 1. Let n be r(-1). Which is bigger: z or n? n Let a = 18 + -12. Let g(z) = -659z + 13. Let q be g(-2). Let r = -1330 + q. Which is smaller: r or a? r Let p(t) = -t2 + 14t - 16. Let w be p(13). Let o be 6/(-9)(w/(-2))/1. Which is smaller: o or -4/107? o Let p(g) = g3 + 6g*2 + 4g - 3. Let q be p(-5). Suppose -m + qz = -3, -m = 3m - 3z - 7. Let k be ((-8)/(-582))/(8/12). Is k >= m? False Let z = -783 + 783.413. Let y = z + -0.32. Let w = y + -1.093. Which is greater: w or 57? 57 Let v = -528 + 339. Let k = v - -189. Is 83 less than k? False Let p be (-50)/(-15) + (-95)/(-57). Let z = 0 + 1. Suppose 2m + z = 7. Which is bigger: p or m? p Let o = 1/160911 + -1335400394/804555. Which is smaller: -1659 or o? o
Calculate the highest common divisor of 190200 and 216. 24 Calculate the greatest common divisor of 184 and 31487. 23 What is the highest common factor of 556020 and 180? 180 Calculate the greatest common factor of 2860 and 6292. 572 What is the highest common factor of 8415 and 88077? 561 What is the greatest common divisor of 5472 and 1197? 171 What is the greatest common divisor of 206416 and 112? 112 Calculate the highest common factor of 2905 and 167328. 581 Calculate the greatest common factor of 475 and 171. 19 What is the highest common factor of 6392 and 45594? 34 Calculate the highest common divisor of 136 and 118388. 68 What is the highest common factor of 5428363 and 43? 43 Calculate the greatest common divisor of 15 and 4643745. 15 Calculate the greatest common divisor of 3795974 and 364. 182 What is the greatest common divisor of 38100 and 9300? 300 Calculate the greatest common divisor of 36297 and 111. 111 Calculate the highest common factor of 585 and 250920. 45 What is the highest common divisor of 325 and 166595? 65 What is the greatest common divisor of 45 and 14778945? 45 Calculate the highest common factor of 2614024 and 56. 56 Calculate the greatest common factor of 3912 and 20. 4 What is the highest common factor of 249556 and 267? 89 What is the highest common divisor of 3038 and 490? 98 Calculate the greatest common factor of 6544 and 176. 16 Calculate the highest common divisor of 204204 and 156. 156 Calculate the highest common factor of 324 and 98334. 162 Calculate the greatest common factor of 10969 and 119. 7 Calculate the highest common factor of 16905 and 22655. 115 Calculate the highest common divisor of 372208 and 4816. 688 Calculate the greatest common factor of 355016 and 30248. 1592 Calculate the highest common factor of 129914 and 238. 34 What is the greatest common factor of 117 and 213681? 39 Calculate the highest common factor of 9306 and 234. 18 What is the highest common divisor of 101620 and 40? 20 Calculate the highest common divisor of 199826 and 44. 22 Calculate the highest common factor of 22187 and 44. 11 Calculate the greatest common factor of 1338 and 18. 6 What is the highest common factor of 205 and 2375? 5 Calculate the highest common factor of 209205 and 225. 45 Calculate the highest common factor of 255184 and 16. 16 Calculate the highest common divisor of 7491 and 8899. 11 Calculate the greatest common divisor of 664 and 403048. 664 What is the highest common factor of 635 and 53467? 127 What is the highest common factor of 819603 and 684? 171 Calculate the greatest common factor of 25754 and 1027. 79 Calculate the highest common factor of 25 and 26395. 5 What is the highest common divisor of 32643 and 533? 13 Calculate the highest common divisor of 3392 and 9126176. 1696 Calculate the highest common factor of 7219 and 2. 1 What is the greatest common factor of 636 and 21889? 53 Calculate the highest common divisor of 8601 and 3. 3 What is the highest common factor of 2451 and 1321906? 817 Calculate the highest common factor of 5838 and 2363. 139 What is the greatest common factor of 388 and 844? 4 What is the highest common divisor of 120 and 233720? 40 Calculate the greatest common divisor of 350993 and 6587. 941 Calculate the greatest common factor of 678 and 74354. 226 What is the greatest common divisor of 287 and 3338671? 287 What is the highest common factor of 3305 and 70? 5 What is the greatest common factor of 833 and 697? 17 Calculate the highest common divisor of 17 and 11441. 17 Calculate the greatest common factor of 655704 and 28. 28 Calculate the highest common factor of 115128 and 312. 312 Calculate the greatest common factor of 2055 and 2740. 685 What is the highest common divisor of 54763 and 23? 23 What is the greatest common factor of 4 and 223164? 4 Calculate the highest common factor of 2704 and 32. 16 What is the highest common divisor of 83594 and 245? 49 Calculate the highest common factor of 24 and 4353. 3 What is the greatest common divisor of 155 and 2315? 5 Calculate the greatest common factor of 180 and 2490. 30 Calculate the greatest common factor of 1975 and 975. 25 What is the highest common divisor of 9295 and 655? 5 Calculate the highest common factor of 2536 and 392. 8 What is the highest common factor of 2312 and 104771? 17 Calculate the highest common factor of 864 and 1480. 8 Calculate the highest common factor of 16882 and 874. 46 Calculate the highest common divisor of 26979 and 2047. 23 Calculate the greatest common divisor of 424 and 154696. 8 What is the greatest common divisor of 470 and 15228? 94 Calculate the greatest common divisor of 83385 and 1700. 85 Calculate the greatest common divisor of 2652 and 13090. 34 Calculate the highest common divisor of 73524 and 192. 12 Calculate the highest common factor of 557102 and 182. 182 What is the highest common divisor of 112625 and 255? 85 What is the greatest common divisor of 2565 and 13905? 135 Calculate the greatest common factor of 5875 and 3760. 235 Calculate the highest common factor of 55622 and 6028. 274 What is the greatest common factor of 33 and 571461? 33 What is the highest common divisor of 76 and 2033? 19 What is the highest common factor of 50344 and 15022? 406 What is the greatest common divisor of 1 and 1358263? 1 What is the highest common factor of 88 and 141988? 44 Calculate the greatest common divisor of 1053 and 2861703. 351 What is the greatest common factor of 463 and 5828707? 463 What is the highest common factor of 185663 and 463? 463 What is the highest common divisor of 840 and 18200? 280 Calculate the highest common divisor of 408850 and 962. 962 Calculate the highest common factor of 47157 and 33. 33 Calculate the greatest common divisor of 924 and 2828. 28 What is the greatest common factor of 2409 and 297? 33 What is the highest common factor of 2527 and 49457? 361 Calculate the highest common factor of 8 and 9960. 8 What is the greatest common factor of 56028 and 4263? 609 What is the greatest common factor of 28 and 25942? 14 What is the greatest common factor of 30 and 21360? 30 What is the highest common divisor of 9046 and 2? 2 Calculate the greatest common factor of 4170 and 39930. 30 What is the greatest common divisor of 178556 and 12? 4 What is the highest common divisor of 9196 and 1748? 76 Calculate the greatest common factor of 186195 and 345. 15 What is the greatest common factor of 18 and 161994? 6 What is the highest common divisor of 334 and 207748? 334 What is the greatest common divisor of 884364 and 2496? 156 What is the greatest common factor of 3074350 and 50? 50 What is the highest common divisor of 35133 and 294? 147 Calculate the greatest common factor of 81641 and 17549. 763 What is the highest common factor of 73 and 38617? 73 What is the highest common factor of 228 and 5052? 12 What is the greatest common factor of 12645 and 135? 45 What is the greatest common factor of 23153 and 39884? 169 Calculate the greatest common divisor of 251618 and 194. 194 What is the highest common factor of 906 and 525178? 302 Calculate the greatest common factor of 1943624 and 76. 76 Calculate the highest common divisor of 168 and 6489. 21 Calculate the highest common factor of 320 and 772040. 40 Calculate the greatest common divisor of 2480 and 13520. 80 What is the greatest common divisor of 10788 and 54839? 899 What is the highest common factor of 50424 and 858? 66 What is the highest common factor of 34 and 461771? 17 What is the highest common factor of 8305 and 317251? 1661 Calculate the highest common factor of 134658 and 36. 18 Calculate the highest common factor of 27776 and 10304. 448 Calculate the greatest common factor of 87 and 1212577. 29 What is the greatest common factor of 111904 and 1144? 104 Calculate the greatest common divisor of 11 and 1792. 1 What is the greatest common factor of 558 and 44888? 62 What is the highest common divisor of 1750 and 3878? 14 What is the greatest common divisor of 10002 and 3? 3 What is the greatest common divisor of 6688 and 256? 32 What is the greatest common factor of 882 and 2835? 63 What is the greatest common factor of 3592620 and 100? 20 What is the highest common divisor of 498 and 8597970? 498 What is the greatest common factor of 198 and 622413? 99 Calculate the greatest common factor of 97196 and 44. 44 What is the highest common factor of 143740 and 760? 20 Calculate the greatest common factor of 187 and 1078. 11 What is the greatest common divisor of 3065474 and 493? 493 What is the greatest common divisor of 13764 and 868? 124
Let k(w) be the second derivative of -w9/60480 + w8/4480 - w*7/1120 + 67w*4/12 - 115w. Let j(l) be the third derivative of k(l). Factor j(s). -s*2(s - 3)*2/4 Suppose -5 = -v - f, 0 = 4v - 1287f + 1289f - 18. Let c(r) be the second derivative of 1/72rv + 0 + 8r + 1/18r3 + 1/12r2. Factor c(q). (q + 1)2/6 Let y(t) be the second derivative of -2t6/5 - 15t*5/2 - 57t*4/16 + 225t*3/4 - 81t*2 - 13273t. Determine h, given that y(h) = 0. -12, -2, 3/4 Let j be 10(748/1320 - 2/5). Suppose 5f + 11 = 3q, 3q - 4f - 5 = -5f. Let jnq + 320/3 + 80/3n = 0. Calculate n. -8 Let r be ((-10)/(-4) - 1)(-120)/(-36). Let i be -5r/((-100)/12). Factor 0u4 + 4u*4 - iu4. u4 Let v(w) be the third derivative of -w*8/336 + 2w7/105 - w6/60 - w5/15 + w4/8 + w*2 + 2451. Solve v(x) = 0. -1, 0, 1, 3 Let w(q) be the first derivative of -2q*3/11 + 393q*2/11 - 780q/11 - 4659. Let w(y) = 0. What is y? 1, 130 Let y be (4/(-1 + 0))/(16/(-136)). Let 7o4 - 10o*4 - 3o*3 - y + 34 + 12o*2 + 12o = 0. Calculate o. -2, -1, 0, 2 Let z = -7/18426 + 82931/36852. Factor -9/2 - 1/4p2 + zp. -(p - 6)(p - 3)/4 Let j(q) be the first derivative of 82 - 1/10q*4 - 8/5q*3 - 48/5q*2 - 128/5q. Solve j(f) = 0 for f. -4 Let t = 310 - 310. Let r = t - -5. Let 8/13n2 + 0 + 46/13n*4 - 10/13n*r + 16/13n - 60/13n3 = 0. What is n? -2/5, 0, 1, 2 Let z(c) be the third derivative of -86c*2 - 1/120c*4 + 0c - 1/600c5 + 0 + 2/15c3. Determine j, given that z(j) = 0. -4, 2 Let i(y) = -y3 + 2y2 - y - 1. Let d be -15 + 6 + 8 + 2. Let k(s) = -6s*3 + 4s*2 + 16s - 9. Let n(a) = dk(a) - 3i(a). Solve n(h) = 0. -3, 1/3, 2 Let j be 7/(1785/(-3026)) + 12. Let i(o) be the second derivative of 28/45o6 + 3/7o*2 + jo*5 - 83/126o*4 - 2o - 2/21o3 + 0. Factor i(z). 2(2z + 1)2(7z - 3)2/21 Let l(f) be the first derivative of 2535f*6/2 - 3783f*5/5 - 1745f*4/2 - 108f*3 - 4f*2 - 1399. Determine i so that l(i) = 0. -2/5, -2/39, 0, 1 Let d = -472 - -561. Factor 1 - 6i*2 - 13 - 2i*2 + 69i - di. -4(i + 1)(2i + 3) Let q(x) be the third derivative of 3 + 0x3 - 5/72x*4 - 1/1080x*6 - 2/135x*5 + 0x - 28x2. Factor q(b). -b(b + 3)(b + 5)/9 Let m = 177 - 175. Factor 320 + mv*5 + 725v*2 - 65v*4 - 295v - v*5 + 2v*5 + 95v*3 + 2v*5 + 1175v. 5(v - 8)2(v + 1)3 Let q(k) be the second derivative of k6/225 + 17k5/150 - 133k*4/90 + 127k*3/45 + 92k*2/5 - 5311k. Determine w, given that q(w) = 0. -23, -1, 3, 4 Let j = 998 - 2992/3. Let h(t) be the second derivative of 17t + 0 - 1/5t*5 - 1/3t*4 + 2t*2 + jt*3. What is l in h(l) = 0? -1, 1 Let x = -469451/3 - -156489. Find g, given that 4/3g*3 - 1 + xg - 17/3g2 = 0. 1/4, 1, 3 Let o(v) = 5v*2 + 21v + 22. Let a be o(-1). Let b be 138/24 - (-10)/((-12)/a). Solve 12 + bg2 + 6g = 0 for g. -4 Let w(x) be the first derivative of 3x4/20 + 22x*3/15 - 47x*2/10 - 18x/5 - 1116. Determine q, given that w(q) = 0. -9, -1/3, 2 Let u be (-7)/(-28) + (3/42 - (-7205)/1540). Let -1/2qu - 1 - 2q*3 + 2q*4 + 5/2q - q*2 = 0. What is q? -1, 1, 2 Let o = 44 - 128. Let d be ((-24)/o)/((-2)/(-14)). Factor -20x - x*3 + 8 + 5x*2 + 8x + xd. -(x - 2)3 Let k(n) be the first derivative of -2/21n3 - 2/7n*2 + 1/14n*4 - 47 + 0n. Suppose k(f) = 0. Calculate f. -1, 0, 2 Let x(j) be the third derivative of -213j5/80 - j4/16 + 5j*2 - 402j. Solve x(k) = 0. -2/213, 0 Let y = -4/653 - -10063/43751. Let a = 1041/737 + y. Factor -aq2 + 12/11q - 2/11. -2(3q - 1)*2/11 Let y = -32 + 40. Suppose 5n = h + y, 3n - 48 = -5h + 6n. Suppose b2 + 9 - b3 - 13 - 8 - 4b + hb = 0. Calculate b. -3, 2 Let d(m) = m4 - 45m*3 - 64m*2 + 365m + 900. Let x(f) = -f4 + f3 - f. Let o(g) = d(g) + 5x(g). Factor o(w). -4(w - 3)(w + 3)(w + 5)*2 Determine u, given that -388u*2 - 1916u*2 - 16u*3 + 908 - 1534u*2 - 2720u + 194u2 = 0. -227, -1, 1/4 Let u = 99 - 96. Solve uq*3 + 17q*2 + 15q*2 + 11q*2 - 49q2 = 0. 0, 2 Factor o2 - 21 + 41o + 28o - 23o + 226. (o + 5)(o + 41) Let u = 7 + -5. Suppose -13a + 3a = -20. Factor 10 + uia + 2i*3 + 15 - 25. 2i*2(i + 1) Let f(l) be the second derivative of -2l6/15 - 6l*5/5 + 7l*4/3 + 32l*3 + 72l*2 - 647l. Solve f(i) = 0 for i. -6, -2, -1, 3 Let j = -391 - -394. Let d be (j/(-5))/(-3)5/5. Suppose -di*5 - 1/5i + 2/5i3 - 4/5i*2 + 2/5 + 2/5i4 = 0. What is i? -1, 1, 2 Let a(c) be the third derivative of -c7/42 + 109c6/12 - 217c*5/12 - 1652c2 + 3. Determine t, given that a(t) = 0. 0, 1, 217 Let x(r) be the second derivative of -r7/63 - 13r6/45 - 31r*5/15 - 64r*4/9 - 32r*3/3 - 7493r. Solve x(n) = 0 for n. -4, -3, -2, 0 Let l(u) = -7u - 47. Let b be l(-14). Let s = -23 + b. Factor 22 - 13 + sz + 0z2 + 4z*2 + 15. 4(z + 1)(z + 6) Let d(j) be the third derivative of 5/24j*5 + 0 + 1/168j*7 + 3j*2 + 35/96j*4 - 1/1344j*8 + 3/8j*3 + 1/16j*6 + 0j. Let d(g) = 0. Calculate g. -1, 9 Let 1185/4c - 3/4c*4 + 225 + 3/4c*3 + 291/4c*2 = 0. Calculate c. -5, -1, 12 Let o(z) = 105z*4 + 1030z*3 - 1035z*2 - 6615z - 3780. Let i(u) = -5u4 - 49u*3 + 49u*2 + 315u + 180. Let r(y) = 125i(y) + 6o(y). Solve r(f) = 0. -12, -1, 3 Suppose -3l + 11k = -77, 0 = -4l - 18993k + 18998k + 35. Determine a so that 5/2a*3 - 1/4a*4 + l + 0a - 9/4a2 = 0. 0, 1, 9 Suppose -843 = 2r + 2y - 149, 5r + 1725 = 5y. Let p = r + 348. Factor 0 - 3/4z - 3/2zp - 3/4z*3. -3z(z + 1)2/4 Let k(j) be the third derivative of j5/330 + 4j*4 - 9j*2 - 2j - 17. Find h, given that k(h) = 0. -528, 0 Let l(f) be the third derivative of -1/52f4 - 26f*2 + 0 - 2f + 1/780f6 + 2/39f*3 + 0f*5. Suppose l(g) = 0. Calculate g. -2, 1 Let m(j) = 0j + 12j2 - 11j*2 - j + 1. Suppose -256 = -20i + 44. Let r(k) = -95k2 - 90k + 5. Let l(h) = im(h) - r(h). Solve l(z) = 0. -1/2, -2/11 Let g(o) be the second derivative of -o8/6720 - o7/420 - o6/80 - 16o*4/3 + 5o + 6. Let u(l) be the third derivative of g(l). Factor u(n). -n(n + 3)2 Suppose 10w + 9 = 7w + 6w. Let u(s) be the first derivative of -4sw - 16/3s*2 - 10/3s - 2/15s5 - 4/3s*4 - 22. Factor u(m). -2(m + 1)*3(m + 5)/3 Let r(k) be the third derivative of -k7/560 + k6/24 + k*5/20 - 5k*4/2 - 251k*3/6 - 5k*2 - 3. Let t(a) be the first derivative of r(a). Factor t(o). -3(o - 10)(o - 2)(o + 2)/2 Let d(z) be the first derivative of -16z5/5 + 13z*4 + 52z*3/3 - 8z*2 + 4112. Factor d(f). -4f(f - 4)(f + 1)(4f - 1) Let o = -1772 - -1774. Let z(b) be the first derivative of -42bo - 92/3b*3 + 2 + 8b. Find l, given that z(l) = 0. -1, 2/23 Let y(t) be the first derivative of t6/840 + t5/210 + t*4/168 + 18t*2 - 110. Let q(r) be the second derivative of y(r). Solve q(c) = 0. -1, 0 Determine a so that 0 - 126/5a + 87/5a2 + 3/5a*4 + 36/5a*3 = 0. -7, -6, 0, 1 Let 184z - 6461z2 + 4z*5 - 992z*3 - 3z*5 + 15z*5 + 324z*4 + 6929z*2 = 0. What is z? -23, -1/4, 0, 1, 2 Factor -1394842 - 6816w - 2w2 - 3w*2 - 1335763 - 938w + 364w. -5(w + 739)2 Let f = -11 + 12. Let v = -80 - -77. Let z(q) = q - 1. Let c(l) = l2 + 21l + 78. Let m(o) = fc(o) + vz(o). Solve m(k) = 0. -9 Let m be (-60)/(-84)(-903)/(-258). Find a, given that -40a - ma*2 - 75/2 = 0. -15, -1 Let l(r) = -13r*3 + 218r*2 + 216r + 10. Let t(d) = 6d3 - 108d*2 - 108d - 4. Let v(q) = -2l(q) - 5t(q). Factor v(y). -4y(y - 27)(y + 1) Let v(a) be the first derivative of a5/20 + 21a*4/16 - 23a*3/4 + 71a*2/8 - 6a - 1600. Factor v(k). (k - 1)*3(k + 24)/4 Let j(v) be the second derivative of -v*6/30 - 44v*5/5 - 29v*4/2 + 88v*3/3 + 175v*2/2 + 487v - 3. Determine t, given that j(t) = 0. -175, -1, 1 Let v(t) be the first derivative of 2t3/3 - 32t*2 - 370t - 3277. What is o in v(o) = 0? -5, 37 Let b be (-427)/(-183) + 2642/3. Let v = b - 3531/4. Factor 0 + 5/4w - vw*2. -w(w - 5)/4 Factor 0 + 0y + 17/12y*3 + 1/12y*4 + 35/6y2. y2(y + 7)(y + 10)/12 Suppose 75g = 79g + a + 6, 18 = -6g - 3a. Let i(r) be the second derivative of 13r - 27/4r*2 + 2r*3 + 1/8r*4 + g. Factor i(h). 3(h - 1)(h + 9)/2 Find c, given that 0 - 27/4c*2 - 9/2c*3 + 21/2c + 3/4c*4 = 0. -2, 0, 1, 7
Suppose 44 = 6o - 16. Let v = o + 0. Suppose -15 = -vz + 7z. Solve -4u + 20 = -4w - 0u, -zw - 2u - 11 = 0 for w. -3 Let i(u) = u*3 + 82u*2 + 395u + 770. Let m be i(-77). Solve m = -a, 0 = -4x - 4a + 18 - 6 for x. 3 Suppose 167 = 3q + 5m, 5q - 171 = 5m + 134. Let v = -57 + q. Suppose vy + y - 6 = 0. Solve g - 12 = yg - 5k, -5g = k + 8 for g. -2 Let c = 3864 + -3843. Solve 4f + 9 = 4u + c, 0 = 3f + 3u + 15 for f. -1 Let d = -1625 - -1625. Solve 15 = -2q + 2y + 5, -4q - y - 30 = d for q. -7 Let v = 7008 + -7004. Solve 81c - 84c - v = 2l, -4c - l + 3 = 0 for c. 2 Let c(k) = 5k*2 + 71k + 16. Let p be c(-14). Suppose j - 2j + 3z = -27, z - 19 = -pj. Solve -4s = -4b - j, 2 + 1 = -s - 5b for s. 2 Let s = 4366 + -4354. Solve -17z + t - s = -21z, -4t = 0 for z. 3 Let c be -1 + 1 + 3 + (-11 - -42). Let q = 54 - c. Solve 4z - 22 = 2f, 3f + q - 3 = 2z for f. -3 Suppose 0 = -5j - 1 + 11. Let d be ((-5 + 4)j)/(6/(-9)). Suppose a + 2p = -9 + 3, -3 = -da + p. Solve -4i - 4b - 3 - 13 = a, 24 = -5i - b for i. -5 Suppose 36s - 109s = -219. Solve 2h - 5o = 6h + 9, -3o = 3h + s for h. 4 Suppose -3f + z = -12, 0 = -4f - 0f + z + 16. Suppose k + 13 = -fn, 7 = -3k + 33n - 37n. Solve -5t - 16 = -kv, -v - t = 2t + 18 for v. -3 Let k be ((-3)/2)/(536/112 - 5). Suppose 4s + n - 12 = 0, -s + 4n = -4s + 9. Solve 5q = -sm + 13, 3q - k = 5m + 28 for m. -4 Let k(q) = q*3 - 4q*2 - q + 1. Suppose -5v + 19 + 18 = 4z, -v + z = -2. Let p be k(v). Suppose -5m + p = -4. Solve -j = g, 0 = -3g - mj + 2 + 8 for g. -5 Let c be 1/(-2) + (-138)/4. Let q be 6/15 + 14/c. Let p be -1(q - 0)/2. Solve 4a + 8 = 2g, p = 4a + g + g + 8 for a. -2 Let x = -20 + 31. Let l be (9 + -12)/((-3)/22). Let u be (-2)/x + (-2)/l-35. Solve -2c = -2t + 6, -5c - 7 = -ut - c for t. 5 Let j = 474 - 471. Suppose -2l = -2n + 18, 0 = -jl - 20 + 5. Solve 3f + 1 = m + m, 12 = nm + 4f for m. 2 Suppose 3265n - 6 = 3263n. Solve 2s - s + 8 = -3r, ns + r - 8 = 0 for s. 4 Let j = 32 + -20. Let x = 1004 + -1001. Solve 2t - 4t - 14 = 4w, -xw = j for t. 1 Let y be ((-6)/8)/(-3)(-1360)/(-170). Solve 4j = 7j - 4b - 7, -yj - 26 = 5b for j. -3 Let b(p) = -5p. Let y(w) = -4w. Let n(s) = 2b(s) - 3y(s). Let k be n(2). Let o be (-4 + 3)/(k/(-20)). Solve -o = -z + x, 5 = -5z + 4z - x for z. 0 Let c = -6575 - -6583. Let q(o) = o - 7. Let l be q(9). Suppose -2p - lp = 0. Solve -y + 6 + p = 2r, 4r + c = 3y for r. 1 Suppose -156u = 56u - 879 - 181. Solve -k - 15 = -3b, ub - b = 16 for k. -3 Let d be 18/15(-10)/(-4). Let h be (-1 - 14/(-10)) + (-19279)/(-7415). Solve d = -l + 2s - s, hs + 3 = -l for l. -3 Let o be (-12)/(-9)(-15)/(-2) + -5. Suppose -5a + 9a + 16 = 5h, -oa + 5 = 0. Solve 4s = -4p, -4p + 2 = -hs - 38 for s. -5 Let q = 9837 - 9818. Solve 0 = 4p - 20, 3h - 12 = -qp + 16p for h. -1 Let z = 310 + -314. Let v(w) = -8w - 12. Let x be v(z). Solve 11 + 5 = -2f + 2a, 5a - x = 0 for f. -4 Let q = 11443 - 11439. Solve -a = -2o - 2, 0 = 5a - qo - 10 - 6 for a. 4 Let p(o) = o*2 - 25o - 83. Let r be p(28). Let q be (6/15)/((-2)/20). Let d be q/22 - 24/(-11). Solve 31 + r = -4w + 4z, 4w + dz = -14 for w. -5 Let g be (-4)/(-26) - (-30000)/195. Suppose g = -5r + 164. Solve -f = rb - 6, 5f - 5b + 13 = -32 for f. -4 Let d be 96/(-36)(-249)/4. Suppose 0 = -3j + 3, -2j - d = -3z + 3j. Suppose 32 = 61k - zk. Solve 2y + 12 = 4x, -2x + 3x + k = -5y for y. -2 Suppose -d + 5c + 48 = 3d, 0 = 4d + 4c - 48. Solve j = x + 2x + 7, -3x = d for j. -5 Let a(r) = 684r + 3421. Let z be a(-5). Solve -4j - z = -k, -5j + 14 = -7k - 2 for k. -3 Let q = 47 + -42. Suppose 7 + q = 2u. Suppose -um + 2m + 20 = 0. Solve -2h + 1 = -3, mt - 9 = -2h for t. 1 Let y(t) = t*3 + 6t*2 - 3t - 4. Suppose 0x - 9 = 2o + x, -3x = o + 2. Let f be y(o). Let v = f + -31. Solve -vg = 3u, 5u + 6g = 2g + 13 for u. 5 Suppose -k = 14k - 405. Let a(p) = 3p - 79. Let z be a(k). Solve 3n + 3l = zn + 19, -l - 3 = -2n for n. 4 Let l(p) = 7p + 30. Let f be l(-6). Let i be ((-5)/f6)/((-2)/(-4)). Solve 0 = 2c - 3g + 5, 2g = -3g - i for c. -4 Let x(r) = -15r2 - 11r + 4. Let j be x(6). Let s = -593 - j. Solve -4q - 3 = s, 3q - 16 = -5p for p. 5 Let u = -112 + 123. Suppose -z = 9 - u. Solve -4y = 2m + 10, 2y + 25 = zm - 7m for y. 0 Let a = -10 + 22. Let k be (a/1)/2 - 2. Suppose -3c = -12, 5y - kc + 5c - 49 = 0. Solve -2w = -3d - 6, -4w - 2d + y = -w for w. 3 Suppose -5b + 25 + 25 = 0. Let j be -6((-5)/b)/((-9)/(-6)). Let z be j/(-2) + -4 + 5. Solve z = -4u + 3u + 2q, 9 = -3u - 3q for u. -2 Let j = -31251 - -31256. Solve -9h + 6h = -2v - 7, -5h = jv - 20 for v. 1 Let b be 3/(-15)-5(-3 - -8). Suppose bx = 2o - 0o - 25, 0 = -3x - 9. Solve 6r - 2r + 4t = 20, 2r - 3 = ot for r. 4 Let o(v) = -6v - 1. Let f be o(-1). Suppose 3z = 6 - 0, 4k - 4z = -268. Let p = k + 67. Solve c - 4l + f = -pl, 4c = -l + 16 for c. 3 Suppose -15b = -38 - 352. Suppose -bz = -22z. Solve 3t = -5o - zo + 11, o = -t + 1 for t. -3 Let s be ((-6)/3 - 8)/(28 + -30). Suppose 7 = 3z + j + 4j, sz - 61 = 4j. Solve -q = 4k + z, -5k = -0k + 3q + 13 for k. -2 Suppose -48l + 55l = 154. Let i be -1(l/8)/110. Solve -1 = 2c - t, 5t + i - 5 = -c for c. 0 Let g = -9604 - -9609. Solve -gj = -c + 18, c + 47j = 49j + 9 for c. 3 Let a = -9 - -11. Suppose -2v = -a - 4. Let d be 0 + (112)/v + -1. Solve -5b + dx - 9 = -0x, b + 5 = -x for b. -3 Let i(k) = 2k3 - 15k*2 + 11k - 21. Let y be i(7). Solve 3p = -5o + 20 + y, 5p - 26 = -2o for p. 4 Let h be (-2)/(-10) + 1/((-30)/(-24)). Solve 5o - h - 19 = -5s, 4o - 16 = 2s for s. 0 Suppose 0 - 12 = 4l, c = -5l - 36. Let b = c + 26. Solve 2o + z - 15 = 0, -75 + 25 = -bo - 5z for o. 5 Let n(m) be the first derivative of -7/2m*2 - 8m + 5 + 1/3m3. Let c be n(8). Solve 2j + 3t + 0 - 1 = 0, 3j - 3t - 9 = c for j. 2 Suppose -5o = -35o - 26o + 448. Solve z - o = -4d - 5, -5z + d - 27 = 0 for z. -5 Let a = 13353 + -13348. Solve -3q + 21 = 3b, q + 6 = -ab + 37 for q. 1 Let y(b) = 2b*2 - 171b - 4590. Let w be y(107). Solve -7 = 5c + wn - 14n, c + 7 = -5n for c. -2 Let c(z) = 2z2 + 37z - 18. Let v be c(-19). Let p be ((-54)/12 + (4 - v))-2. Solve 2n = 2y + 6, 9 - 26 = -pn + 5y for n. -1 Suppose -3g - 71 = -365. Suppose 0 = -28p + 182 + g. Solve -2 = -5s + 4j - p, 3s = 4j for s. -4 Suppose -3w + 4x - 14 = 0, x + 6 - 17 = -3w. Solve -8a + 12 = -3s - 13a, s + a + w = 0 for s. 1 Suppose -5w = 5a - 40, 6w = 22a - 17a + 15. Solve 4o - 4 = -f + 18, 5o - wf = 15 for o. 5 Suppose -3m = -4t + 1, -257m = 5t - 261m. Solve -16 = to - 5k + 4k, -k - 20 = 5o for o. -4 Let q(g) = 35 + 76 + 1 - 71g + 63g. Let b be q(13). Solve 0y - 3y + 4s = -b, 3s = -15 for y. -4 Let f be 3/(-2)(-60)/9. Let r be ((-12)/f)/((-60)/700). Solve -r = m - 5o, 2m = 5m - o for m. 1 Suppose 8t + 3s = 11t - 9, 4t - 14 = 2s. Solve 0l = 4n - 3l - 23, -20 = tl for n. 2 Let m be (8 - (-289)/(-34))0. Solve m = c - 4j - 13, -7c + 5j + 8 = -3c for c. -3 Let f = 124 - 74. Let k = -36 + f. Suppose 5x - 4g - k = 0, 4x - 2x = 2g + 6. Solve -5l - p = 4p - 10, 0 = xl - 2p + 8 for l. -1 Suppose 0 = t + 4t - 25. Let m be (-4)/5 - 532/(-140). Suppose 15 = 2z + z + mb, -7 = -2z - b. Solve -g + 1 = ts - 5g, zg = -s - 11 for s. -3 Let p(q) = 20q - 59. Let v(c) = 10c - 33. Let z(i) = -4p(i) + 7v(i). Let g be z(0). Solve 2a = -3d + 5, -2a + 2d = -ga for a. -2 Let c be 20174/(-132) + 2/(-12). Let w = c + 157. Solve 4n + wx = 24, -x = -4x + 3 for n. 5 Suppose 22y - 10y - 912 = 0. Suppose -y = -10z - 56. Solve -i - 5f = -19, 2i + zf - 17 = -3 for i. 4 Let z = -388 + 394. Suppose 2c = 5g - 152, 3g - 7c = -3c + 80. Let l = 37 - g. Solve -ls - 4r = -8, -4s = 4r - zr + 4 for s. 0 Let a = -12 + -34. Let p = 49 + a. Let t = p - 0. Solve -5g - 20 = -tv, 8 = -2v - 2g - 0g for v. 0 Let w be (-9)/6 + 22/4. Solve 0 = -wk - 3x + 26, -3k + 5x = 2k - 15 for k. 5 Let i = -26 - -31. Suppose 12k = ik + 7. Solve m + g + k + 0 = 0, -2m + 3g + 8 = 0 for m. 1 Suppose -549l - 219l = 79l - 145 - 1549. Let s(z) = -z3 + z + 15. Let m be s(0). Solve o - lk - 3 = -m, 0 = -4o + k - 13 for o. -2 Suppose -6i - 68 + 23 = -111. Solve -t + i = -3u, 0t - 4 = t + 2*u for t. 2
Collect the terms in 217013m + 217025m - 435181m. -1143m Collect the terms in -34633703x3 + 8 - 5 - 1 + 34633699x*3. -4x*3 + 2 Collect the terms in -18154 - 22219z + 18154. -22219z Collect the terms in -108 - 234b - 212b + 442b + 56 + 53. -4b + 1 Collect the terms in -2252f*2 + 8015f*2 - 2880f*2 - 2881f*2. 2f*2 Collect the terms in -49 - 3 + 122z - 3z2 - 133. -3z*2 + 122z - 185 Collect the terms in -1374 + 59z3 + 2572 + 22z*2 - 1198 - 22z*2. 59z*3 Collect the terms in -3148711s - 3148726s - 27s*2 + 6297437s. -27s2 Collect the terms in -13030o*2 + 6524o*2 + 6517o*2 - 343. 11o*2 - 343 Collect the terms in 161u - 100213u2 - 161u. -100213u2 Collect the terms in -225284q + 225284q - 890q*2 + 2q*3. 2q*3 - 890q*2 Collect the terms in 20784d*2 - 20804d*2 + 5d - 3d. -20d*2 + 2d Collect the terms in 84n3 + 4511926 - 4511926. 84n3 Collect the terms in -s2 + 6s2 + 8s*2 - 264s + 29 + 2s2 + 265s - 5. 15s2 + s + 24 Collect the terms in -388729z*2 - 284590z*2 - 368346z*2 + 222397z*2. -819268z*2 Collect the terms in -1012v*3 - 1002v*3 - 4 + 2004v*3 + 3 - 22. -10v*3 - 23 Collect the terms in -2 - 48212459d*3 - 5 + 24106225d*3 + 7 + 24106227d*3. -7d*3 Collect the terms in 1196500 - 598243 - 334d*2 - 598257. -334d*2 Collect the terms in 51215f - 12863f + 58690f + 105582f. 202624f Collect the terms in -52954y3 + 105697y*3 - 52746y*3. -3y*3 Collect the terms in -6011a*2 - 23a + 23a + 20 + 6011a*2 + 13a*3. 13a*3 + 20 Collect the terms in -560a - 20a - 2 - 746a + 2 - 926a. -2252a Collect the terms in 24k + 3243k*2 - 1071k*2 - 24k. 2172k2 Collect the terms in -3370p - 53 + 53 + 828p. -2542p Collect the terms in 0 + 3 - 3 + 13431r2 - 12557r*2. 874r*2 Collect the terms in -3914441h*3 + 71523771h - 71523771h + 3914444h*3. 3h*3 Collect the terms in 3x + 15412x2 + 15965x*2 - 3x + 26591x2. 57968x*2 Collect the terms in -2226u*3 - 5781u*3 - 2603u*3. -10610u*3 Collect the terms in 124222u + 0u2 - 4u*2 - 246634u + 122412u. -4u*2 Collect the terms in 9677747b*3 - 9677739b*3 + 1892b - 1892b. 8b*3 Collect the terms in 13o - 59o - o3 - 2o*3 + 5o*2 + 335o + o*3. -2o*3 + 5o*2 + 289o Collect the terms in -326x - 378 - 383 + 761 + 972x. 646x Collect the terms in 98y*2 - 30 + 6939y - 3431y - 3508y. 98y2 - 30 Collect the terms in -6470452 - 11x - 2x + 11x*2 + 6470452. 11x*2 - 13x Collect the terms in 208384h3 + 5234h - 5234h - 40155h*3. 168229h*3 Collect the terms in -9183h - 9199h - 2h*3 + 18383h + 2 - 26 - 40 - 6h3. -8h*3 + h - 64 Collect the terms in -3 + 112r + 56r - 158r + 31r2 - 11r + 3. 31r2 - r Collect the terms in -4j*3 + 0j*3 + 38j*3 + 39j*3. 73j*3 Collect the terms in -63m - 61m - 61m - 74m - 63m + 320m + 2. -2m + 2 Collect the terms in 8326528g3 - 1897997g*3 + 7959614g*3 - 9521g*3. 14378624g*3 Collect the terms in -571039n2 + n3 + 1142080n2 - 571041n*2 + 2n*3. 3n*3 Collect the terms in -1349k*2 + 10k - 1307k2 - 10k + 2647k2. -9k*2 Collect the terms in 94j*3 - 38321341770 + 38321341770. 94j*3 Collect the terms in -26268361o*3 - 3309462o*3 + 1416992o*3. -28160831o*3 Collect the terms in 33293f*2 - 1 - 99890f*2 + 33292f*2 + 33286f*2. -19f*2 - 1 Collect the terms in -3726o + 1859o + 1843o + 26o3. 26o*3 - 24o Collect the terms in 3p3 - 852 + 1699 - 2p3 - 883. p3 - 36 Collect the terms in 6421 - 8n3 - n3 + 4n*3 - 952. -5n*3 + 5469 Collect the terms in -3y - 2y - 19540y*2 + 2y. -19540y2 - 3y Collect the terms in 501v - 890 + 890 + 494v - 996v. -v Collect the terms in 8g*3 - 9992941g*2 + 9992941g*2. 8g*3 Collect the terms in 27r + 9 - 2 - 4r - 7 + 2r*2 - 28r. 2r2 - 5r Collect the terms in -7m2 - 11453m*3 - 13m*2 + 111901m*3 + 2m*2. 100448m*3 - 18m*2 Collect the terms in -622207t + 312485t + 309718t. -4t Collect the terms in 464 + 482 + 5i*2 + 945 - 1891. 5i*2 Collect the terms in 40l*2 - 319 - 984 + 1303. 40l*2 Collect the terms in 186r*3 - 95r*3 + 956r*2 - 80r*3 - 956r*2. 11r*3 Collect the terms in 65 + 24 + 5041a*2 - 37. 5041a*2 + 52 Collect the terms in 5j*2 + 6j + 130 + 0j2 - j2. 4j*2 + 6j + 130 Collect the terms in -1015k2 - 2k*3 - 839k*2 + 1854k*2. -2k*3 Collect the terms in 8 + 6 - 56 + 27 + 4874c*2 - 4877c*2 + 15. -3c*2 Collect the terms in 287h + 1419h3 - 184h*3 - 496h*3 - 423h*3 - 287h. 316h3 Collect the terms in -6 - 8 + o3 + 0 - 31o*2 + 5 - 414o2. o3 - 445o2 - 9 Collect the terms in -520 + 128u + 1562 - 518 - 516. 128u + 8 Collect the terms in 171i + 91i + 92i + 101i - 640i + 91i + 95i. i Collect the terms in -4478 - 3i2 + 8i*2 + 9i*2 - 129. 14i*2 - 4607 Collect the terms in -220 - 65b*2 + 435 - 215 + 2b*3 + 583b*2. 2b*3 + 518b*2 Collect the terms in 968830937r - 968830937r - 9r*3 + 26 - 26. -9r*3 Collect the terms in 27q*2 - 29q + 182 - 24q2 - 56. 3q*2 - 29q + 126 Collect the terms in 146645g + 31 - 146631g + 1. 14g + 32 Collect the terms in -140753f*2 + 3 - 3 + 553232f*2. 412479f*2 Collect the terms in 103635r*2 - 103536r*2 + 53 - 53. 99r*2 Collect the terms in 3542o*3 + 2782o*3 + 4614o*3 + 5603o*3. 16541o*3 Collect the terms in -579f*2 + 15132f + 7626f2 - 7562f - 7570f. 7047f*2 Collect the terms in -66 - 8k - 15 + 44 + 31k + 36. 23k - 1 Collect the terms in 2087 - 4168 + 17338j + 2081 + 9j*2 - 17338j. 9j2 Collect the terms in -497c - 484c + 1055c - 59 + 59. 74c Collect the terms in -2262i + 1 - 4 + 0 - 11i2 + 3. -11i*2 - 2262i Collect the terms in 72 - 23 + 1218805u - 49. 1218805u Collect the terms in 95 - 122d - 75d - 97 + 116d - 233d. -314d - 2 Collect the terms in 2y*2 + 3658y - 2y2 - 228y - y*2 + 3y*2. 2y*2 + 3430y Collect the terms in -21 + 13 - m + 0 + 5 - 1386m2 + 4. -1386m*2 - m + 1 Collect the terms in 99j + 3 - 3 - 25006j2. -25006j*2 + 99j Collect the terms in -2 - 1391w3 - 3 - 5965w*3 - 2w*2 + 637w*3. -6719w*3 - 2w*2 - 5 Collect the terms in -6 + 71o*3 + 19 + 5940o + 5948o - 11888o. 71o3 + 13 Collect the terms in -44387 - 2m + 6m + 45992. 4m + 1605 Collect the terms in 25 + 17 + 16 + 16j + 26 + 23 - 105. 16j + 2 Collect the terms in -372 - 8374x - 426 + x2 + 804. x2 - 8374x + 6 Collect the terms in 868s + 835s - 1793s. -90s Collect the terms in -155039f + 4f*2 - 155040f + 465123f - 155044f. 4f2 Collect the terms in 22 - 142h - 551h + 6h. -687h + 22 Collect the terms in -t3 - 784163t*2 - 25t*3 + 784163t*2 + 11t*3. -15t*3 Collect the terms in -4510o*2 - 14 - 6203o*2 - 9428o*2 + 14. -20141o*2 Collect the terms in -89735a*3 - 89372a*3 + 179115a*3. 8a*3 Collect the terms in -140f + 117f - 1 - 101f + 109f. -15f - 1 Collect the terms in -7y2 + 60y + 20y - 98y + 18y + 46y*2. 39y*2 Collect the terms in -2k*3 + 196k*3 + 213k*3. 407k*3 Collect the terms in -272l*3 + 439132l - 152l3 + 109l*3 - 18l*3 - 439132l. -333l3 Collect the terms in 456t*3 - 534t*2 - 12t*3 + 273t*2 + 261t*2. 444t*3 Collect the terms in -203n*3 - 23n*3 - 21n*3 - 3n + 3n - 50n*3 + 299n*3. 2n*3 Collect the terms in -4958884 - 21u*3 + 4958883 + u - 6u. -21u3 - 5u - 1 Collect the terms in 8271h2 + 0h + 0h + 8569h*2 + 8550h*2 - 25385h*2. 5h*2 Collect the terms in 1 + 35515034a + 1 - 3 - 35515033a + 1. a Collect the terms in -2k + 4k - 8k + 1 - 2k + 2444k*2. 2444k*2 - 8k + 1 Collect the terms in -8a2 - 3969a - 1 - 13 + 1986a + 1983a + 13. -8a2 - 1 Collect the terms in -39 - 40 + 20000j + 87. 20000j + 8 Collect the terms in -15046 - 385v - 186v + 15046 - 15v. -586v Collect the terms in 552 - 308735u*2 - 552. -308735u*2 Collect the terms in 118j + 4 - 23j - 17j - 45j - 25j. 8j + 4 Collect the terms in 257 - 5h - 3h + 915 + 253 - 6h - 1428. -14h - 3 Collect the terms in 61t + 81t - 140t - 261t2. -261t*2 + 2t Collect the terms in -22f2 - 663 + 28f*2 - 690 + 222f*2 - 658 + 2011. 228f*2 Collect the terms in -624 - 23056 + 19z*2 + 23680. 19z*2 Collect the terms in -30244y + 15123y - 3970y*3 + 15121y - 138y3. -4108y**3
Let c = -65 + 65. Let j = 104 + -101. Suppose -11 = -4u + 5. Solve -a + ua + j = c for a. -1 Suppose 13k - 8k = -4a + 122, -3a - 79 = -4k. Solve 9l + 23 = -k for l. -5 Suppose 3b - 3 = 4c, 11 = 2c + b - 0. Suppose 0m = -2m + ch + 8, 4 = m + h. Solve -16 = mt - 8t for t. 4 Suppose 7w = -167 + 195. Solve w = 24y - 25y for y. -4 Suppose 2f = -5 + 21. Let a = -13 + f. Let q be (0 - (a + 2))/3. Solve 0 = -2w - 9 + q for w. -4 Suppose 0 = 7m + m - 2m. Suppose 0 = -mb + 3b - 36. Solve 0w = -3w - b for w. -4 Let m = -2 + 5. Suppose 0 = -mx - 1 + 10. Solve 4n + 5 = xn for n. -5 Let w(h) = 36h + 6. Let y(q) = -7q - 1. Let n(u) = 4w(u) + 21y(u). Let g be n(1). Solve 0 = -4l - g + 16 for l. 4 Suppose 0i + 3i + 4t + 16 = 0, 3t = -12. Suppose -4x - 5 = -2x - 5y, 9 = 3y. Let h = x + -5. Solve hr - 2r - 10 = i for r. -5 Let u = -25 - -29. Suppose -s + 27 = -ud, s - d = 10 + 8. Solve 4w + s = 3 for w. -3 Let p = -46 + 101. Let h = p + -50. Solve i = -0 + h for i. 5 Let n be ((-2)/(-4) + -1)-8. Let l = -9156 - -9157. Solve 3d - l = -n for d. -1 Let p(d) be the third derivative of -d6/120 - d5/6 - 3d4/8 + d3/2 - 11d2. Let z be p(-9). Solve -11 - 4 = zn for n. -5 Let m be (108/(-90))/(9/(-30)). Solve 0 = 8o - mo for o. 0 Let k be 0(-5 + ((-45)/2)/(-5)). Solve k = 12f - 14f - 10 for f. -5 Let j = -1 + 16. Suppose -3q + 2q - j = 0. Let a = 20 + q. Solve 0o + o + a = 0 for o. -5 Suppose -5l + 7 = -q - q, -3q = -12. Solve 0 = -lj + 9 - 0 for j. 3 Let v = 39 - 41. Let b be -19/6v. Solve -m + b = -1 for m. 4 Let r be 5 - (-63)/7 - 5. Solve 2q - r = -3 for q. 3 Let m be (-72)/(-63) - 2/14. Solve -4 = d + m for d. -5 Let t(h) = -5h - 40. Let c be t(-8). Solve c = p + 8 - 6 for p. -2 Let w = 0 + 4. Suppose 0 = 4v + wc, 0v + 5c + 16 = -v. Let r be ((-160)/100)/((-4)/5). Solve vm + r = 2m for m. -1 Let q = 58 - 58. Suppose -p + qp = 5b + 7, 0 = -5p - b + 13. Solve 2j + p = -1 for j. -2 Suppose 0 = 20r - 25r + 225. Suppose -8l - l = -r. Solve -j - l = -0j for j. -5 Let l(s) = s2 + 29s + 162. Let d be l(-22). Solve 6o = -2o + d for o. 1 Suppose -5 = 3r - 4r. Suppose 0i + 13 = -y - 3i, -4i + 104 = -3y. Let q = -21 - y. Solve q = -rc - 13 for c. -4 Let x = 0 + 4. Suppose 2b - 8 = xb. Let t be (4 + b)/(-2 - -4). Solve 2u + 3u = t for u. 0 Let n(g) = 8g + 5. Let d(m) = m*2 - 39m - 25. Let c(i) = -2d(i) - 11n(i). Let s be c(-4). Solve 3t - s = 2t for t. 3 Let v be -1(-4 + (-1 - -5)). Suppose -2x + x = v. Let d be (x/(-1))/(4 - 0). Solve -5c - 15 = -dc for c. -3 Let a(q) = 7q + 163. Let v be a(-21). Solve 0 = 12u - 8u - v for u. 4 Let j = 9 + -1. Let i = j - 5. Let c be 3/18 + i/(-18). Solve c = -0t + t + 2 for t. -2 Suppose -7y + 200 = -3y. Let p = -36 + y. Suppose 2z = 3t - p, 2z = t - 2t - 6. Solve 0 - t = b for b. -2 Let f(d) = -5d2 + 44d + 12. Let s be f(9). Solve -sq = 11q + 42 for q. -3 Suppose 3o - 33 = 27. Suppose -4q + 0q = 92. Let d = q - -25. Solve -2w - dw = -o for w. 5 Suppose 2k - 4 + 0 = 0. Let d be 22-1(-1 + 0). Suppose 0 = -2u - 4 + d. Solve -km - u = 1 for m. -5 Let a = 27 - 16. Suppose -2w - 4h - a = -h, -2h - 10 = 0. Suppose 3y - 4b - 20 = 0, 5y - 26 = wb + b. Solve yk = 3k + 1 for k. 1 Let y = 88 - 88. Suppose yj - 8j = -5j. Solve -6 + j = 2g for g. -3 Let w be -15(-15)/50 - (-3)/(-2). Solve -6 = wj + 6 for j. -4 Let t = -116 - -123. Suppose -5a + 29 = -j, j = 2a - 4j - t. Solve -au = -3u + 6 for u. -2 Let w(v) = v*3 + 4v*2 - 2v - 5. Let y be w(-4). Let n(u) = -2 - 5u - yu + 6u. Let j be n(-3). Solve jm + 2 = 6 for m. 1 Let n(j) = -2j + j + j + 14 + 2j. Let y be n(-6). Solve -yd - 5 = 3 for d. -4 Suppose 6o = -8o. Solve ok = -6k + 18 for k. 3 Let v(n) = -3 + 2 - 4 + 4n + 6. Let o be v(1). Suppose 5s = 15, 15s - 20s = 2q - 25. Solve 0b + ob = -q for b. -1 Let x = 543 - 353. Solve 0 = 2u - x + 184 for u. 3 Suppose -4i - 202 = 5j + 151, 3j + 5i + 204 = 0. Let y = -73 - j. Solve -u = -y - 1 for u. 1 Suppose -a - 4a = -30. Let y(o) = 5o + 1. Let t = 21 + -18. Let b be y(t). Solve -a = -2f - b for f. -5 Suppose 6b - 30 = 18. Let u be 63/12 - ((-10)/b)/(-5). Solve -uo - 24 + 4 = 0 for o. -4 Let h be ((-9)/3)/(8/(-8)). Solve -hv = -14 + 11 for v. 1 Let g be 24 - 28 - 16-1. Solve 0x = -3x - g for x. -4 Let a(x) = x*3 - 5x*2 + 2x - 10. Let h = 1 + 4. Let z be a(h). Suppose -1 + z = -m. Solve -c - m = -3 for c. 2 Let l(v) = 29v - 54. Let r be l(2). Solve -5c + 3c = -r for c. 2 Suppose -15d = 429 + 651. Let z = d - -83. Solve 7k = zk + 12 for k. -3 Suppose -3s + 3t + 66 = 0, -2t = 5s - 5t - 110. Let g = s - 16. Solve -g = -6q + 3q for q. 2 Let n be ((-65)/20 - -4)4. Suppose -5l = -5m - 45, 4l - 41 = 2m + nm. Let x be -3((-10)/3)/5. Solve li = xi for i. 0 Let g(q) = 2q2 - 2q + 3. Let p(x) = -3x2 + 5x - 7. Let a(r) = -10g(r) - 6p(r). Let l be a(-6). Solve l = 3m - 8m - 20 for m. -4 Let s be (-4)/18 + (-237)/27. Suppose 0 = f + 3r + 6, -6 = 3f + 2r - 2. Let c be (f/(s/3))/3. Solve 2q - 6q + 8 = c for q. 2 Suppose 5j = a - 15, -3a - j = -0j - 93. Let o be (2 - 5)/((-9)/a). Solve 5x = -o - 10 for x. -4 Suppose -7c - 45 + 10 = 0. Let f be (c/15)/((-3)/45). Solve -fi = -2i - 3 for i. 1 Let v be 272/44 - (-4)/(-22). Suppose -2r + 0r + f + 2 = 0, -5f + 20 = 5r. Suppose t = -3h - r, h + 0 - 2 = t. Solve 4o - v - 2 = h for o. 2 Suppose 5o + 3k + 2k - 65 = 0, -2k = 4o - 46. Let l = -42 + 46. Solve h + o = -lh for h. -2 Let x(h) = -h*3 - 10h*2 - 23h - 1. Let w be x(-3). Solve 5d - 10d - w = 0 for d. -1 Suppose -33 = -2l + p - 34, -2l + 4p = 16. Solve g = -0g + l for g. 2 Let i(k) = 223k + 6k*2 - 1 - 17k*2 + 3k*3 - 228k - k*3. Let d be i(6). Solve 0 = df - f for f. 0 Suppose 22x - 36 = 20x. Suppose -6q + 4q + 3m + x = 0, 5q - 19 = m. Solve qc + 1 = -8 for c. -3 Let k(p) = -2p + 6. Let j be -3(-6)/9 - (-10)/(-2). Let t be k(j). Solve -h + t = -4h for h. -4 Suppose -4h = -4v + 12, -4h + 0v = 2v - 6. Suppose -s + 6s = h. Solve -5u + 1 + 24 = s for u. 5 Suppose -17 = i - 4k, 5i - 3k = k - 21. Let b = 3 + i. Solve bv = -0v + 6 for v. 3 Let v = 1037 - 1019. Solve -vf - 1 - 17 = 0 for f. -1 Suppose -3a - 17 = -v, 3v = -28a + 24a - 14. Solve -3 = vu + u for u. -1 Suppose -4a = -9a + 115. Let x = -2240 - -2243. Solve -x = -4p - a for p. -5 Let b be (-15)/(-60) - 38/(-8). Suppose 4p = 4l, -3l + 2p = -0p + 2. Let a be (8/(-10))/(l/b). Solve -2y = a + 2 for y. -2 Let i(y) = -2y*3 - 3y*2 - 3y - 6. Let p be i(-2). Solve p = -l - 1 for l. -5 Suppose 0 = -10c + 11c - 6. Solve -2i + c = -0 for i. 3 Let a be ((-15)/6)/(-5)-26. Let g be (-7)/(-28) + a/4. Let x = 6 - g. Solve -m = -4m - x for m. -3 Let w = 666 + -624. Solve -wj = -31j - 33 for j. 3 Let l be (-13 + (-6 - 0/(-6)))/(-1). Solve -26h = -7h - l for h. 1 Suppose 16 = -4k + 32. Suppose -22 = -9l - k. Solve lz + 3z = -25 for z. -5 Let m(b) = 13b*2 - 5b + 4. Let r(o) = 27o2 - 11o + 9. Let d(f) = 5m(f) - 2r(f). Let n be d(1). Solve -4s = 22 - n for s. -3 Let t = 1224 + -1219. Solve tc - 5 + 20 = 0 for c. -3 Suppose 280 = 3t + 2t. Let b be (-2)/8 + 126/t. Suppose 3u + 2y + y - 21 = 0, -10 = -2y. Solve bj = -uj for j. 0 Suppose 3y = 6y - 24. Let z be 2/8 - (-918)/y. Let r be 4/(-14) - z/(-35). Solve 0i + i = r for i. 3 Let o(r) = -23r - 167. Let g be o(-8). Solve 3w + 2 - g = 0 for w. 5 Let a(x) = -x*2 + 10x + 2. Let l be a(10). Let k(b) = 0b + 5b + 3 + 0b - b2 - 2b. Let w be k(l). Solve 0 = wq - 7 + 22 for q. -3 Let p be (-8)/(-6)(-1410)/20. Let o = p - -99. Solve -oh + 13 = -7 for h. 4 Suppose -12 = 4d - 7d. Suppose 11v = 9v. Solve 2s + d = -v for s. -2 Let c be 2057/289 + 4/(-34). Solve cr = -34 + 13 for r. -3 Let a = 7 + -3. Suppose -85 = -4w - 5o, 4w - 70 = 5o - 7o. Solve au = -u - w for u. -3 Let x(i) = 29i - 424. Let s be x(16). Solve -s = -17q + 11 for q. 3 Let b = 1082 + -1067. Solve -12 = o - b for o. 3 Suppose 4w + 4n = -8, 5n + 18 + 2 = 0. Suppose 4g + 5x = 2g + 1, -x = g + 1. Let r = g - -7. Solve rk + w - 12 = 0 for k. 2 Let a(t) = -t*3 - 8t*2 + 9t + 2. Let u be 2480/(-70) - 3/(-7). Let o be 330/u + (-3)/(-7). Let s be a(o). Solve f = sf for f. 0 Let u be 2 + (-3 - -2) + 1. Suppose ui - 30 = 2m, -i = 3i - 2m - 70. Suppose 2c + 2c = i. Solve -7 + 17 = cq for q. 2
Calculate the common denominator of -5/35239568 and 73/342327232. 2396290624 Calculate the common denominator of -25/4458 and -103/2448. 1818864 Calculate the least common multiple of 45510 and 71750. 7964250 Calculate the smallest common multiple of 1664490 and 4910. 1664490 Calculate the common denominator of 113/234 and 71/15886. 142974 Calculate the common denominator of -55/1203956 and 47/108. 32506812 Calculate the common denominator of 66/933725 and -19/12569375. 163401875 Find the common denominator of -29/658 and -53/8204. 385588 Calculate the common denominator of 41/306 and -40/21386119. 384950142 What is the least common multiple of 369 and 117024045? 351072135 Calculate the smallest common multiple of 2499 and 412335. 412335 What is the lowest common multiple of 17 and 10187301? 10187301 What is the common denominator of -119/761050 and 107/17670? 43379850 What is the common denominator of -37/509656 and -11/328? 20895896 Calculate the common denominator of -15/13792 and 139/256014. 4096224 Calculate the smallest common multiple of 36 and 103974480. 103974480 What is the least common multiple of 1546295 and 200? 61851800 Calculate the smallest common multiple of 1 and 213704. 213704 What is the common denominator of -34/48951 and 149/955710? 20069910 What is the lowest common multiple of 135493668 and 188? 135493668 What is the common denominator of 58/869823 and -89/82188? 10437876 What is the common denominator of 42/5 and -1/217710265? 217710265 What is the least common multiple of 795450014 and 12? 4772700084 Calculate the common denominator of -19/3048318 and -25/3338634. 70111314 Calculate the common denominator of 41/220 and -41/114305400. 114305400 Find the common denominator of -109/299506 and 7/294814. 112913762 Calculate the lowest common multiple of 755205 and 43725. 200129325 What is the common denominator of -167/239610 and -29/16403016? 574105560 Calculate the smallest common multiple of 375 and 2935250. 8805750 Find the common denominator of 67/316598 and 89/7598352. 7598352 What is the least common multiple of 1020 and 3649305? 14597220 Calculate the common denominator of -13/25691 and 97/585. 15029235 What is the lowest common multiple of 27 and 193344? 1740096 What is the common denominator of -13/39889095 and 83/63822552? 319112760 What is the common denominator of -98/283220235 and 13/13021620? 1132880940 What is the lowest common multiple of 1014 and 3128190? 3128190 Calculate the common denominator of -119/303000 and -71/5863050. 117261000 Calculate the least common multiple of 406 and 315114. 2205798 What is the least common multiple of 1507 and 70521? 9661377 What is the smallest common multiple of 20700 and 1148436? 28710900 Calculate the common denominator of -131/4110 and -79/1727570. 5182710 What is the common denominator of 41/88915430 and 41/751398? 266746290 Calculate the common denominator of -37/4 and 49/90970245. 363880980 Calculate the least common multiple of 2704 and 35332. 23884432 Find the common denominator of 83/57048808 and 115/14. 399341656 Calculate the smallest common multiple of 65760 and 238380. 1907040 What is the smallest common multiple of 398640 and 24160? 797280 What is the common denominator of 27/2438848 and 29/457284? 7316544 Calculate the common denominator of 37/25375590 and -59/563902. 25375590 What is the common denominator of -123/38840 and 23/140000? 135940000 Calculate the least common multiple of 41958 and 2846664. 737285976 Calculate the smallest common multiple of 7753836 and 8404. 85292196 Find the common denominator of -173/1811160 and -71/576. 14489280 Calculate the common denominator of -10/9279337 and 91/148469392. 148469392 Find the common denominator of 15/3543199 and 16/22225521. 244480731 What is the common denominator of -113/5364 and -11/1373184? 1373184 Calculate the common denominator of 97/16320 and 137/48960. 48960 Find the common denominator of 13/3177 and -11/2332161. 823252833 Find the common denominator of 62/3213275 and -17/1675. 215289425 What is the common denominator of -43/452090 and -43/23055? 39331830 What is the common denominator of -36/10393 and 12/4055? 42143615 What is the lowest common multiple of 17620 and 806996? 4034980 What is the common denominator of 83/160 and 169/23964960? 23964960 Find the common denominator of -11/196 and 17/6428198. 89994772 Calculate the common denominator of -139/3168756 and -22/903. 22181292 What is the lowest common multiple of 3729980 and 284490? 33569820 Calculate the lowest common multiple of 91056 and 44370288. 310592016 What is the common denominator of -12/68269825 and -121/42012200? 546158600 What is the common denominator of -71/3080 and -127/141130? 3951640 Find the common denominator of 119/99816 and -28/2433015. 19464120 Calculate the least common multiple of 32009 and 65. 2080585 What is the least common multiple of 324 and 230928? 6235056 Calculate the common denominator of 83/1869012 and 79/47864. 115878744 Calculate the least common multiple of 371548 and 12812. 371548 Calculate the common denominator of -41/22625944 and -24/15683893. 1380182584 What is the common denominator of -43/22364 and -103/870? 9728340 What is the lowest common multiple of 31402 and 515890? 3611230 Find the common denominator of 113/342 and 55/1847028. 5541084 What is the common denominator of -17/49031780 and -61/6451550? 245158900 What is the common denominator of 41/15312 and 9/218152? 37958448 What is the smallest common multiple of 6415 and 4820231? 24101155 What is the common denominator of -127/276 and 11/2409039? 221631588 What is the common denominator of -111/10 and -73/40566710? 40566710 Calculate the least common multiple of 88929 and 1419543. 342109863 What is the lowest common multiple of 100647 and 11708601? 35125803 Calculate the smallest common multiple of 6122889 and 5442568. 48983112 Calculate the least common multiple of 759840 and 61901632. 928524480 What is the least common multiple of 1639714 and 154690? 8198570 What is the common denominator of 103/12007968 and 97/856? 12007968 Calculate the lowest common multiple of 941492 and 5178206. 10356412 What is the common denominator of 157/2352 and -173/92316? 369264 Calculate the least common multiple of 1192 and 367408. 54743792 Calculate the least common multiple of 24342 and 272124. 1104007068 Calculate the common denominator of 151/131890038 and 10/34542629. 1450790418 Calculate the smallest common multiple of 46110175 and 500. 922203500 Calculate the common denominator of -37/134536 and 3/319523. 2556184 What is the lowest common multiple of 4631 and 871470? 9586170 Calculate the common denominator of 93/220 and 181/917100. 10088100 What is the common denominator of 149/176634 and -47/2374746? 21372714 What is the least common multiple of 2444 and 35350? 43197700 What is the smallest common multiple of 53476900 and 5504975? 374338300 Find the common denominator of -179/10830 and -83/858945. 620158290 Calculate the lowest common multiple of 2860 and 3282916. 180560380 Calculate the common denominator of 1/752199 and -6/119. 752199 What is the least common multiple of 28732 and 258588? 258588 Calculate the least common multiple of 1904112 and 997392. 20945232 What is the common denominator of 103/4922508 and 53/7383762? 14767524 What is the least common multiple of 100 and 34701550? 69403100 Find the common denominator of -131/29994 and 131/1589682. 1589682 What is the common denominator of -40/39 and 62/365755? 1097265 Calculate the lowest common multiple of 810851 and 13. 10541063 What is the common denominator of -91/16148 and -89/165884? 1824724 What is the lowest common multiple of 447996 and 895992? 895992 What is the common denominator of 53/68760 and -203/210870? 161104680 Find the common denominator of -127/110473680 and 79/5388960. 220947360 Calculate the common denominator of -113/280 and 89/3484824. 17424120 What is the common denominator of 37/26496 and -39/2271296? 40883328 What is the common denominator of -115/284143296 and 41/3? 284143296 What is the least common multiple of 63365 and 10425210? 198078990 What is the least common multiple of 61 and 189631? 11567491 Calculate the common denominator of 145/48 and 143/465840. 465840 Calculate the common denominator of 83/90 and -59/9558255. 57349530 Calculate the smallest common multiple of 79217990 and 215. 3406373570 Find the common denominator of 9/1713440 and -23/8353020. 66824160 Find the common denominator of -173/9324 and 35/84444. 65612988
Four letters picked without replacement from tmtttnnfnlnftnnmffnt. What is prob of picking 2 f, 1 t, and 1 m? 24/1615 Calculate prob of picking 2 q when two letters picked without replacement from {q: 2, u: 4}. 1/15 Calculate prob of picking 4 n when four letters picked without replacement from wnwwwnwnnwnwnwnnwwn. 21/646 Two letters picked without replacement from msqfqmfqfsqmsssqqss. What is prob of picking 1 q and 1 m? 2/19 Calculate prob of picking 1 e and 2 h when three letters picked without replacement from peefpfcefhfhccpp. 3/560 Three letters picked without replacement from {q: 1, p: 1, c: 2}. What is prob of picking 1 q and 2 c? 1/4 Three letters picked without replacement from xxnvxnvvvxvvn. Give prob of picking 3 n. 1/286 Four letters picked without replacement from {q: 3, p: 2, c: 4}. Give prob of picking 3 c and 1 p. 4/63 Calculate prob of picking 4 p when four letters picked without replacement from {u: 7, p: 4}. 1/330 Two letters picked without replacement from fbbfbmmfmefbfffbe. What is prob of picking 1 m and 1 b? 15/136 What is prob of picking 2 w and 1 j when three letters picked without replacement from {j: 3, a: 2, w: 10}? 27/91 Calculate prob of picking 1 h and 1 c when two letters picked without replacement from {l: 2, m: 2, h: 1, z: 1, c: 1, k: 2}. 1/36 What is prob of picking 1 b and 2 p when three letters picked without replacement from {p: 3, b: 9}? 27/220 Two letters picked without replacement from {x: 4, g: 4, m: 1, n: 3, t: 1, f: 2}. What is prob of picking 1 m and 1 n? 1/35 What is prob of picking 1 o and 2 d when three letters picked without replacement from {o: 1, d: 4, n: 2}? 6/35 Calculate prob of picking 4 n when four letters picked without replacement from nnqnnnnnnnnqn. 6/13 Calculate prob of picking 1 u and 1 e when two letters picked without replacement from ueuuueeuue. 8/15 Two letters picked without replacement from {e: 1, v: 7, f: 8, r: 1}. Give prob of picking 1 r and 1 v. 7/136 Calculate prob of picking 1 a and 1 e when two letters picked without replacement from {e: 1, n: 2, u: 1, a: 1}. 1/10 Calculate prob of picking 1 e and 1 g when two letters picked without replacement from {e: 1, m: 1, g: 1, p: 1, o: 1, x: 2}. 1/21 Calculate prob of picking 1 i and 1 a when two letters picked without replacement from {b: 9, a: 4, i: 1}. 4/91 Three letters picked without replacement from rrrbllbllrbr. Give prob of picking 1 b and 2 r. 3/22 What is prob of picking 1 r, 1 a, 1 f, and 1 k when four letters picked without replacement from {a: 2, u: 3, r: 1, k: 1, f: 3}? 1/35 Four letters picked without replacement from {w: 4}. What is prob of picking 4 w? 1 What is prob of picking 1 z and 1 u when two letters picked without replacement from wwzuuwzuod? 2/15 What is prob of picking 1 h and 1 k when two letters picked without replacement from {k: 2, h: 1}? 2/3 Four letters picked without replacement from {y: 3, i: 1, q: 3}. Give prob of picking 2 y and 2 q. 9/35 Calculate prob of picking 1 b, 1 z, and 1 p when three letters picked without replacement from xlbzpbpl. 1/14 Four letters picked without replacement from {z: 1, e: 2, p: 2, w: 3, o: 8, y: 1}. Give prob of picking 1 o, 1 z, and 2 p. 2/595 Calculate prob of picking 1 i and 1 y when two letters picked without replacement from {y: 2, x: 4, r: 1, i: 2}. 1/9 What is prob of picking 1 l and 1 n when two letters picked without replacement from eeeppeznpaepeplaa? 1/136 What is prob of picking 2 s and 1 n when three letters picked without replacement from ssnssnsn? 15/28 What is prob of picking 1 h and 1 f when two letters picked without replacement from dxxdddhxxhdhxfh? 4/105 Two letters picked without replacement from uaeaeeueueeuaeueoeu. Give prob of picking 1 e and 1 a. 3/19 Two letters picked without replacement from pcvppcnccpppcnpcpp. What is prob of picking 1 c and 1 v? 2/51 Two letters picked without replacement from cczczccccccc. What is prob of picking 2 z? 1/66 What is prob of picking 4 u when four letters picked without replacement from {u: 4, p: 10}? 1/1001 Two letters picked without replacement from {n: 1, v: 1, c: 8, d: 8}. Give prob of picking 1 v and 1 c. 8/153 Calculate prob of picking 2 v when two letters picked without replacement from vcvzccczccccccccvccc. 3/190 Two letters picked without replacement from iiiiipippippi. What is prob of picking 2 p? 5/39 What is prob of picking 2 k when two letters picked without replacement from tttttkttttkt? 1/66 Three letters picked without replacement from uvuvvfvvivf. What is prob of picking 1 i and 2 u? 1/165 Two letters picked without replacement from hhkkkdhskhckhhdhz. Give prob of picking 1 k and 1 h. 35/136 Two letters picked without replacement from {m: 1, n: 2, d: 2}. Give prob of picking 1 n and 1 d. 2/5 Three letters picked without replacement from iteitttiiit. Give prob of picking 1 t and 2 i. 10/33 Two letters picked without replacement from lffnnnnbbnbbncnbnn. Give prob of picking 2 f. 1/153 Calculate prob of picking 1 j and 1 f when two letters picked without replacement from lflljllllf. 2/45 Calculate prob of picking 1 a and 2 g when three letters picked without replacement from aaaaaggaaaaaaaaaaaa. 1/57 Calculate prob of picking 1 a and 1 b when two letters picked without replacement from {j: 4, v: 5, b: 4, a: 2}. 8/105 What is prob of picking 1 h, 1 p, and 1 d when three letters picked without replacement from {p: 7, d: 5, h: 2}? 5/26 Four letters picked without replacement from iiiriddiodiriioidd. What is prob of picking 2 r, 1 i, and 1 o? 1/170 Calculate prob of picking 2 t and 1 u when three letters picked without replacement from tutttstuuttutt. 36/91 What is prob of picking 4 n when four letters picked without replacement from onrorrrnunrrrnoun? 1/476 Calculate prob of picking 2 k when two letters picked without replacement from oookoooeookkooke. 1/20 Calculate prob of picking 1 n and 1 b when two letters picked without replacement from nnnb. 1/2 Two letters picked without replacement from vyviiiivvl. Give prob of picking 1 i and 1 l. 4/45 Three letters picked without replacement from {l: 9, f: 3, c: 3, x: 2}. What is prob of picking 2 f and 1 l? 27/680 Calculate prob of picking 4 p when four letters picked without replacement from pqppqpqpqppppp. 30/143 Calculate prob of picking 1 a and 2 b when three letters picked without replacement from zfbzfbfbbazzbaf. 4/91 Calculate prob of picking 1 y and 1 a when two letters picked without replacement from {y: 14, a: 4}. 56/153 Three letters picked without replacement from {q: 3, f: 4}. Give prob of picking 2 q and 1 f. 12/35 Calculate prob of picking 1 n, 1 w, and 1 x when three letters picked without replacement from wwwnywnynwwywxywwy. 9/272 Calculate prob of picking 1 q, 1 g, and 1 y when three letters picked without replacement from {n: 7, g: 1, q: 7, y: 2}. 7/340 Two letters picked without replacement from uuvkbk. Give prob of picking 1 u and 1 b. 2/15 Two letters picked without replacement from {x: 1, b: 1, t: 1, y: 1, j: 3}. Give prob of picking 1 x and 1 j. 1/7 Two letters picked without replacement from pwpwgwpppwppp. What is prob of picking 1 w and 1 p? 16/39 Three letters picked without replacement from uaotmmb. Give prob of picking 2 m and 1 o. 1/35 Four letters picked without replacement from {e: 9, r: 3}. Give prob of picking 3 e and 1 r. 28/55 Two letters picked without replacement from yzyzzyzziiniiziyy. Give prob of picking 1 z and 1 y. 15/68 What is prob of picking 1 u, 2 w, and 1 g when four letters picked without replacement from whwxpxggu? 1/63 What is prob of picking 2 a when two letters picked without replacement from {a: 4, d: 2, n: 1}? 2/7 Two letters picked without replacement from {i: 2, m: 1, g: 2, h: 1, t: 2}. Give prob of picking 2 t. 1/28 Three letters picked without replacement from uggguguugguuu. Give prob of picking 3 g. 10/143 Calculate prob of picking 1 p, 1 m, and 2 f when four letters picked without replacement from lplfplfmlppmpllll. 1/238 What is prob of picking 1 r, 1 g, and 1 q when three letters picked without replacement from rqgqrrggrgrggrgrrgr? 48/323 Two letters picked without replacement from xxcx. Give prob of picking 1 x and 1 c. 1/2 What is prob of picking 1 n and 1 h when two letters picked without replacement from {t: 3, z: 1, j: 5, n: 1, e: 3, h: 1}? 1/91 What is prob of picking 2 f and 1 i when three letters picked without replacement from {z: 2, i: 1, l: 1, f: 12, a: 3}? 22/323
Solve -5m + 1544 - 1540 = -v, -4v + 3 = -1 for m. 1 Solve 2z - 4n + 6 = 0, -9z - 688n + 691n - 42 = 0 for z. -5 Solve -4w = -4, 1304r - 3w = 1309r - 23 for r. 4 Solve 2k = 2n - k - 10, 3006n + 3k + 2 = 3004n for n. 2 Solve 0 = 5s - 588 + 603, 0 = -2u - 3s + 4s + 9 for u. 3 Solve -9 = 5t + n, -40t = -42t + 4n - 8 for t. -2 Solve -5p = 5i + 25, 17i - 19 = 20i + 5p for i. -3 Solve 2 = -4u + 5c, 834u - 14 = 832u - 5c for u. 2 Solve -10007h - 5 = -10004h - 5q, 0 = 4h + q - 1 for h. 0 Solve -2n + 7 = -a, -30 = -231a + 236a - 5n for a. -5 Solve -13559g - 11 = -13560g + 6d, g + 2d = 3 for g. 5 Solve -3u + 3 = -5k, 2u - 38k + 35k - 1 = 0 for u. -4 Solve 4g - 15 = -32f + 31f, 12 = -f + 5g for f. 3 Solve 5f = b - 7, -88f = 2b - 83f + 16 for b. -3 Solve 2i = 5z + 7, 4z - i = -36 + 28 for z. -3 Solve 236u - 231u + 29 = -h, -9h = -4u - 33 for h. 1 Solve 3p = 5w + 7, p - 5w - 3 = -p for p. 4 Solve -1 = -v + 2t, -84 + 110 = 2v + 2t for v. 9 Solve -4u - 32 = 4s, -s = 7280u - 7284u - 7 for s. -5 Solve -2u - 3u + 5a = -22 + 17, 5u - a - 21 = 0 for u. 5 Solve -2h = -15394d + 15398d - 18, 8h = 3h - 2d - 11 for h. -5 Solve -4b + 15u - 20u - 3 = 0, 3u = 5b + 13 for b. -2 Solve -5v = -5a + 25, -12a - 3v = -17a + 15 for a. 0 Solve -4t + 55 = -5g, 4t - 950g + 952g + 22 = 0 for t. 0 Solve p + 2p + 8t = 40, -p - 2t = -10 for p. 0 Solve 4t - 5b - 12 + 40 = 0, 2b - 40 = -93t + 109t for t. -2 Solve 7 = -5y + 1828a - 1825a, -y - 7 = 5a for y. -2 Solve -4x - o - 110 = -109, 0 = -2x + 3o - 25 for x. -2 Solve 12u - 16 = -4f + 16u, 5f - 2u = -7 for f. -5 Solve 196 = -48p - 4i, 2p - 2i - 344 + 350 = 0 for p. -4 Solve -5o - 27 = 3p, 0 = -56o + 45o - 33 for p. -4 Solve 0 = -3n - 7d + 5d - 8, 3d = 3n + 18 for n. -4 Solve 3872 = 5j + 3d + 3818, 3j + 5d - 74 = 0 for j. 3 Solve 3p = 5v + 50, 0 = 37p - 38p + v + 16 for p. 15 Solve 3y - 43 = 5a, 3y - 6y = -a - 23 for y. 6 Solve 92 = -5o + j, -4o + 33 = 5j + 95 for o. -18 Solve -p = 2c + 30, -c + 1117p - 1107p = -6 for c. -14 Solve 34 = -b + 3v + 16, 0 = 18b - 5v + 226 for b. -12 Solve 0 = -5b + 2d + 10091 - 10103, 2b + 5d = 1 for b. -2 Solve -3 = -2p + 3o, -6352o - 15 = 3p - 6350o for p. -3 Solve 2x + 4y = 34, -5x + 35 = 7y - 32 for x. 5 Solve 2c + 3i = 12, 3555 = 4c + 5i + 3535 for c. 0 Solve 5p - 22 = q, 3p - 194q = -190q + 3 for p. 5 Solve 2n = n + 4, -10o - 94n = -92n + 82 for o. -9 Solve -3f - 15 = -5v, f + 7 - 3 = 2v for f. -10 Solve 275a - 273a - 6 = 0, 1 = -2t + 3a for t. 4 Solve 0p - 5p = -3k - 37, 4843p = 4842p + 5 for k. -4 Solve 4j + 456 - 472 = 4c, -11 = 3c - 4j for c. -5 Solve -2p - 28l + 24l - 30 = 0, 4p = -3l - 55 for p. -13 Solve 0 = a + 5k + 292 - 305, 3a - 6k = -24 for a. -2 Solve n + 5j - 231 + 245 = 0, 0 = -6n + 5j - 84 for n. -14 Solve 170v - 175v + 8 = -g, 33v = g + 148 for v. 5 Solve -2r + 6 = w + 2, -4r + 22 = -5w for r. 3 Solve -39t - 97 + 25 - 61 = 4g, 2g + 3t + 17 = 0 for g. -4 Solve 3z = 2i, -5i - 2232z + 2235z + 9 = 0 for i. 3 Solve 2b = -3g + 17, -1602b + 20 = 4g - 1598b for g. 7 Solve -b = 4v + 24, 11v = 5b + 16v + 75 for b. -12 Solve -14y + 38 = 3g, -5y + 589 = 569 for g. -6 Solve 26 = -3t - 4v, -1116 = -3t - 3v - 1137 for t. -2 Solve -a - 2067 = h - 2069, 4 = -2a for h. 4 Solve t = 3z + 9 - 3, -5z - 10 = 3t for t. 0 Solve -9c + 3y - 99 = 0, 53c - 2y = 50c - 51 for c. -5 Solve 3c + 16o = 96 - 77, -c - 4o + 5 = 0 for c. 1 Solve -f = 6k - 4, f - 2k - 161 = -173 for f. -8 Solve 3b + 5j = -22, 899 - 913 = 2b + 3j for b. -4 Solve 5d = 5h + 30, 1581d - 1585d - 3 = 5h for h. -3 Solve p - 10 = -4y, -36 + 6 = y - 3p for y. 0 Solve -6b - 64k + 73k - 18 = -15b, 2b - k - 7 = 0 for b. 3 Solve 0 = -3i + 484t - 480t + 5, i = 4t + 15 for i. -5 Solve 3i - 538 + 542 = -2u, -3u = 5i + 5 for u. -5 Solve -3n - 4i - 9623 = -9649, -15 = -3i for n. 2 Solve -2r = -w - 4375 + 4377, -5r - w + 2 = 0 for r. 0 Solve 21h - 23h = o - 7, -2h = -o - 13 for o. -3 Solve w = 1258o - 1257o + 5, 3o + 11 = 5w for o. -7 Solve -7227q + 7231q + 3n + 4 = 0, 0 = 5q + 2n + 12 for q. -4 Solve 64i + 4t = 64, -181i + 2t - 4 = -185i for i. 1 Solve -5y = -20z + 55, -2y - 264 = 4z - 254 for z. 1 Solve 9f - 9 = 0, -2d + 4f + 1710 - 1706 = 0 for d. 4 Solve -3s - 73g + 68g = -7s + 25, -g = -7s + 67 for s. 10 Solve 2z - 88m + 4 = -86m, -10m + 5 = -5z for z. -3 Solve -y - 1076t = -1073t - 26, -104 = -4y - 3t for y. 26 Solve 3f - 32 = 4p, 164p = 168p + 16f - 44 for p. -5 Solve -491n - 4b + 15 = -490n, -9 = 5n - b for n. -1 Solve -82l - 4n = -83l + 18, 0 = -5l - 2n - 20 for l. -2 Solve 3m - 2r = -14, 5m = -13m + 23m + 3r + 17 for m. -4 Solve 0 = 3v - x + 33 - 7, -5v - 50 = 5x for v. -9 Solve 4s - 14 = -2q, -3s + 3q - 26 = -14 for s. 1 Solve -102w + 5q + 5 = -104w, -4w = -43q + 63 for w. -5 Solve b - 5 = 306f - 303f, -3f - 30b = -429 for f. 3 Solve 25j - 21j = -20, -8g + 13g = -3j - 25 for g. -2 Solve u - 2q - 6 = 0, -52q + 17 = -3u - 53q for u. -4 Solve 0 = -4w + 2v + 18, 5330v = -2w + 5335v + 5 for w. 5 Solve 7 = 26x - 29x - d, 0 = 27x - 2d + 19 for x. -1 Solve -3f + 31 = 5w, -42 = -117f + 121f - 10w for f. 2 Solve -5r = -i + 20, 160 - 192 = -4i + 4r for i. 5 Solve -2o = 5z + 23, -3z + 2o + 24 - 25 = 0 for z. -3 Solve 5g = 5d + 30, 3g - 1 = -d + 13 for g. 5 Solve -v - 2z - 21 = 0, 4z + 16 + 21 = -3v for v. 5 Solve 5y - l + 3328 - 3314 = 0, 0 = -2y + 5l - 70 for y. 0 Solve -9 = -q + 2y, -6q - 9y + 12y = 9 for q. -5 Solve 3z - 4y = -24, -42 = 5z - 5y - 7 for z. -4 Solve 5j = -5i + 8i + 39, -11j = -2i - j - 66 for i. -3 Solve -4z + 5g + 4 = 0, -11z + 7z + 4 = 4g for z. 1 Solve -5c = -7c - 4w + 4, -2w + 8 = 4c for c. 2 Solve 404f - 401f = -5b - 1, b - 18 = 2f for b. 4 Solve 76q - 30 = -10l + 71q, -4q + 16 = 4l for l. 2 Solve -k = -3102s + 3097s + 79, k - 11 = -s for s. 15 Solve 52 = 5y + 82, 4k - 3y - 18 = 0 for k. 0 Solve 82l - 80l = -4h + 6, 2l - 5h = -3 for l. 1 Solve -i + 12 = -4h, -2h = -569i + 565i - 8 for i. -4 Solve 5c = 46468h - 46464h, -3c - 37 = 5h for h. -5 Solve 3t = 3y + 3, -4y - 345t = -346t + 19 for y. -6 Solve -4k - 3y = 24, 0 = 833k - 831k - 5y - 40 for k. 0 Solve -4a - 17 = 3w, -2a + 3w - 35 + 22 = 0 for a. -5 Solve -25t - 4d - 20 = -23t, 5d + 31 = -4t for t. -4 Solve -1069b = -1072b - 2n + 18, b + 2n - 2 = 0 for b. 8 Solve 55 = 4s + 3 - 16, -3t + 13s - 193 = -10t for t. -4 Solve -k - z - 140 = -153, -17 = -k - 3z for k. 11 Solve 20 = 4y - b, 238b - 234b + 4 = -3y for y. 4 Solve 4q - 40 = 0, -9o + 16o + 5q = 6o + 46 for o. -4 Solve 3z + 12 = -3f, 18f - 17f - 16 = 3z for f. 1 Solve -10 = 3w - 7, -2r - 6w = 10 for r. -2 Solve 5c + 213r = 217r - 9, -2c - 6 = -r for c. -5 Solve 42n - 43n = -p + 6, 4p = -2n + 18 for p. 5 Solve j + 3a - 3543 = -3451, 0 = -5a + 160 for j. -4 Solve 0 = -2g + 2h - 16, 3g + 410h + 26 = 411h for g. -9 Solve 4 = 3f - 25a + 30a, 7f + 4 = -5a for f. -2 Solve 1655f - 3t - 24 = 1657f, 4f - 3t = 24 for f. 0 Solve -13z + 14z = 2p - 1, 2 = -2p + 2z for p. 2 Solve -l + 4p = -5, 10327 - 10319 = 4l - 4p for l. 1 Solve -3q = -5i + 22, 5q = -30i + 31i - 22 for q. -4 Solve -38j + 85 = -31j - 3a, -a + 2 = 0 for j. 13 Solve 900l - 901l + 5n = -27, 4n = 2l - 24 for l. 2 Solve 8 - 33 = 7q + 5t, 2q = t + 5 for q. 0 Solve -566m + 598m = -64, 4b = 2m + 16 for b. 3 Solve 0 = 31x - 29x + 2w - 12, -w = -2x + 9 for x. 5 Solve 4c - 5f - 133 = 0, 2138f = -3c + 2134f - 125 for c. -3 Solve 527t - 532t - 31 = 2d, -2d - 21 = 3t for d. -3 Solve -4j + 134 + 61 = -57a, 5a + 21 = 6 for j. 6 Solve 4l + 15q = 18q + 19, -5l = 2q + 5 for l. 1 Solve 4i - 3s - 18 = 0, -6131i = -6132i - 2s - 1 for i. 3 Solve -5d = -2o - 13, -4o - 161d = -165d + 8 for o. 1 Solve 0 = 3o + 23a - 27a - 3, 0 = 4a - 12 for o. 5 Solve 4o - 14 = -2a, -29o - 7 = -3a - 28o for a. 3 Solve -l - 14 = -2l + 4b, 15 = -3b + 9 for l. 6 Solve -5w = -2a - 20, -19 = 5a + 18w - 15w for a. -5 Solve -3u - 200 + 176 = -4n, 2u + 5n - 7 = 0 for u. -4 Solve 3f = j + 20, 0 = 655j - 657j + 2f - 16 for j. -2 Solve 0 = 4d + a + 24, -331d = -327d + 3a + 32 for d. -5 Solve -5y + 943 = 2f + 968, 5 = -y for f. 0
Solve 5l - 44 = -4a, 37l - 4 = 36l for a. 6 Solve 3o = -3t + 45, -3t - 3187 = -3178 for o. 18 Solve -4k = 3z + 5, 72z - 68z + 15 = 3k for z. -3 Solve 3f - 2t - 15 = 0, 14f - 89 = 36t - 33t for f. 7 Solve -4m + 4z - 36 = 0, -3z = -11m + 12m - 23 for m. -1 Solve 3l = 5k + 28, -5l - 31 = -3k - 51 for l. 1 Solve -4k - 4j = 48, -9k - 118j + 121j - 60 = 0 for k. -8 Solve -239h + 14 = z - 242h, -4z + 2h = -46 for z. 11 Solve -v = -6s + 7, -v - 5s + 18 = 3 for v. 5 Solve -14 = -7y, y = 4z - 11 + 33 for z. -5 Solve -2h - 7t + 0t = -5t - 14, -35t + 105 = 0 for h. 4 Solve -5a + 26 = i, 3a - 53 = 311i - 315i for a. 3 Solve 5r - 2 = 3b, 144b = 147b + r + 14 for b. -4 Solve 4q = 5x - 9, -2x - 254q + 6 = -258q for x. 1 Solve 2s - 72j = -73j - 5, s + 4j - 8 = 0 for s. -4 Solve -3s + 5z + 30 = 0, -559z + 22 = 2s - 563z for s. 5 Solve 0 = -2n - 4s, 130n - s = 125n + 44 for n. 8 Solve 2 = 4u + 2l, 34 = 12u - 14u + 4l for u. -3 Solve -5w - 80 = -4d + 2d - 116, 2d + 3w = 12 for d. -3 Solve 4j - 768m = -769m - 19, 2m - 22 = 2j for j. -6 Solve 2d = 5p + 3, -184d + 187d = -5p + 17 for p. 1 Solve -5b = -2j + 14, -5b = 5j + 454 - 419 for b. -4 Solve 16n - 22 = -3d, 79 = 3d + 73 for n. 1 Solve -3i + 5 = 86r - 91r, -4r + i + 3 = 0 for r. 2 Solve -2p + 4 = 0, 3v + 7 = 2p - 6p for v. -5 Solve 5j = -2l - 7, 4l - 5 = 2j + 5l for j. 3 Solve 0 = -4h - 5g - 3, -h + 50g = 60g - 8 for h. -2 Solve 0 = x + u + 9, 6 = -3x + 2u + 9 for x. -3 Solve -5k + 2572 = -l + 2566, -10k + 3l + 13 = 0 for k. 1 Solve 3j - 3k - 3 = 0, 3j - 1 = -1031k + 1036k for j. 2 Solve 5g = o - 18, 40g + 14 = -o + 37g for o. -2 Solve -476t - 10 = 3i - 481t, -i + 4t = 15 for i. 5 Solve -12 = -4v, -50v + 26 = 4u - 6u - 37v - 21 for u. -4 Solve -147m + 146m - 12 = c, -4c - 55 = 5m for c. -5 Solve 4z - 42 = -22104o + 22099o, -6o - 3z = -45 for o. 6 Solve 5g - 2z + 28 = 0, -5z + 36 = 6z - 7z for g. -2 Solve 14 = -3g - h + 3, -h - 5 = 0 for g. -2 Solve 2w - 4z + 24 = 0, -35z = -4w - 31z - 32 for w. -4 Solve -5t + 12 = 3o, -3o + 23o - 9 = 27 + 44 for t. 0 Solve -542q = -544q - y - 19, q + y = -15 for q. -4 Solve -3x + 23 = -602y + 597y, -60 = -4x - 8y for x. 11 Solve -5g + 22 = -5n - 8, 0g - g = -4 for n. -2 Solve 4p - 9z + 16z = -46, p - z = -6 for p. -8 Solve 2 = -j, 12j = 5i + 17j + 5 for i. 1 Solve 4o - 36 = 0, 137o - 28 = -5l + 135o for l. 2 Solve -3l + 4w - 54 = -48, w - 8 = 4l for l. -2 Solve 2v - i + 233 - 225 = 0, -4v - i = 22 for v. -5 Solve 4v - 64 = -199q + 203q, 0 = -2v - 3q + 7 for v. 11 Solve 3k = -2t - 9, 245k - 250k - 15 = t for t. 0 Solve 6y + 38 = -2o, -41o - 44o + 43 = -6y - 86o for y. -8 Solve 571q = o + 570q + 11, 2o + 25 = 3q for o. -8 Solve -3z + 54 = 14p - 32p, 3p - 24 = -5z for z. 6 Solve 2t - i + 9 = 0, -793t - 4i = -794t - 8 for t. -4 Solve -20 = -263v + 267v, 23 = -4k - 3v for k. -2 Solve -10o + 40 = -5z, 156z - 152z = -5o - 45 for o. -1 Solve 252n - 250n = 5u - 16, -u = 3n + 7 for n. -3 Solve 11y - 4o - 19 = 10y + 7, 3o + 41 = -10y for y. -2 Solve 3m = 109h - 108h + 8, -4m + 2h = -14 for m. 1 Solve 2 = -l - 4a, 16l + 14 = 25l + 4a for l. 2 Solve u - 14 = -5a, -4u - a + 73 = -21 for u. 24 Solve -3r - 3c = 21, 0 = 2535c - 2532c + 6 for r. -5 Solve -3v + 37 = -5c, 7v = 10v - 4c - 35 for v. 9 Solve -4137w + 2v = -4133w + 14, w = 2v - 2 for w. -4 Solve -5i + 58 = 3a + 8, 0 = -4a + i + 36 for a. 10 Solve 0 = -11g - 3x + 15, 10 = -41g + 40g + 2x for g. 0 Solve q + w = 4, -4w + 19 = -q + 23 for q. 4 Solve l - 2g + 3 = 0, 0 = 12l - 17l - 4g - 1 for l. -1 Solve 2q = -i - 0 + 10, 2i = -2q + 8 for q. 6 Solve -2295v + 2289v - 4j = -8, -5v - j = -9 for v. 2 Solve 0 = -4h + 2t + 46, -3h - 8919t + 26 = -8920t for h. 3 Solve n + 5l - 165 + 195 = 92, 0 = -l + 13 for n. -3 Solve 15w = q + 39, 116q - 2w = 119q - 24 for q. 6 Solve 2h = 11676c - 11678c + 4, -4c = -h - 33 for c. 7 Solve u + 7 = 3i, 143u - 39 = 128u - 3i for u. 2 Solve -200a = 4m, 3a + 4m = a - 0a + 5a for a. 0 Solve -868b = -c - 872b - 2, 3c + 6 = 3b for c. -2 Solve 4b - 4k + 36 = 0, -8b - 9k + 5k = 0 for b. -3 Solve -54o = 5f - 53o - 24, -2o = -2f - 0f for f. 4 Solve 3 = -3j - 0, -3j + 117 - 130 = 2b for b. -5 Solve 21u - 51q - 47 = 26u - 40q, 4q = -8 for u. -5 Solve 24b = 9b + 2h - 38, -2h = -b - 10 for b. -2 Solve 0 = 8c - 2q - 42, -4q = 5c - 3q - 15 for c. 4 Solve -5i + 4w - 15 = 0, 3i - 64 + 100 = -33w + 30w for i. -7 Solve -2x = 3i + 46 - 64, 2i - 8 = 0 for x. 3 Solve -w = 13d - 67, -6 = 2d + 3w - 22 for d. 5 Solve x - 2f - 165 = -162, -15 = 4x + f for x. -3 Solve 3q = i + 41, -25 = 3i + q - 22 for i. -5 Solve 0 = -5g + 81l - 36l - 41l + 34, 3g + l = 0 for g. 2 Solve -2a - 5d = -7, -70d + 69d + 7 = -a for a. -4 Solve 4m - 528j + 61 = -533j, 2m + 44 = -4j for m. -4 Solve -3x + 49 = 4t, 4t = -4x + 885 - 841 for t. 16 Solve 3g - 6p + 69 = 0, 3g - 144p + 54 = -141p for g. -13 Solve -2c - 160 + 184 = -2s, 2s = -5c + 25 for s. -5 Solve -385y + 384y - 18 = -5j, 2j - 21 = 5y for j. 3 Solve 5t + 50199g - 50204g = 35, 5t + 3g = 11 for t. 4 Solve -481s + 486s + 5n = -55, -3s = -4n + 19 for s. -9 Solve -9v = 2h - 4h + 84, 2v + 34 = -0 + 14 for h. -3 Solve 0 = -2x - 3a + 88, 241a = -5x + 242a - 1 for x. 5 Solve 3x + 2i - 19 = 0, -x - 112i + 120i = 89 for x. -1 Solve 3i - 3 = -3k, 0 = -707i + 704i - 2k for i. -2 Solve -7b = 3j - 3179 + 3134, b + 5j - 75 = 0 for b. 0 Solve -2v = -3m + 24, 3m + 20v - 3 = 15v for m. 6 Solve 3r = 2d + 14, -4d + 6d - 90 = -23r for r. 4 Solve -4o = 4466 - 4438, 11s - 3o = 10 for s. -1 Solve 5w = -2c - 28, 0 = c - 17w + 16w - 7 for c. 1 Solve -5n + 25 = 5s, 3s - 5n = 171 - 132 for s. 8 Solve -n + 2 = -2m, 0 = 2n + 5m - m + 4 for n. 0 Solve -5 = 10266d - 10268d - 5a, 7d = 4a + 39 for d. 5 Solve 32y + 10 = 4f + 33y, -20f + 2y = -8 for f. 1 Solve -x = -4m - 11, 0 = -1330x + 1326x + 3m - 8 for x. -5 Solve -2s - 4x + 24 = 0, 4x = 461s - 457s + 12 for s. 2 Solve 5r = 10, 2r - 177 = -2m - 173 for m. 0 Solve 22 = 5i + 3a, -2i + 1813a - 1810a = -13 for i. 5 Solve 2a + 66 = 8v + 70, -3a = -4v - 6 for v. 0 Solve 9 = -3r - 3c, 17r - 2c = 18r + 5 for r. -1 Solve -18m + 16m - 2 = 3y, -m = -5y - 25 for y. -4 Solve 12q - 5h + 38 = 8q, 23 - 66 + 25 = -3h for q. -2 Solve 50s - 54s = 4, 7a - 9 = 3a - 3s for a. 3 Solve 0 = -2i - 2a - 2, 0a + 12 = 4a for i. -4 Solve 3417s - p = 3421s - 25, 3p = -4s + 35 for s. 5 Solve -g = 5l + 17, -5g - 4 = -14923l + 14921l for l. -3 Solve f - 3 = 0, -4w + 146f - 148f + 26 = 0 for w. 5 Solve -b - 66 = 5i, -813i + b - 18 = -812i for i. -14 Solve 4q = -2z - 6, 9q - 7q + 6 = -4z for z. -1 Solve -366q - 45u = -367q + 81, -2u = 5q + 49 for q. -9 Solve -30t = -28t - u - 13, 5t + u - 29 = 0 for t. 6 Solve -18u = 4m - 9m - 21u - 8, 0 = 2u + 2 for m. -1 Solve -o - 17z + 21z = 5, 0 = 5o + z + 25 for o. -5 Solve -3s - 2u = 11, -24s + 844u - 839u = 4 for s. -1 Solve 2r + 153i + 12 = 152i, 4r - 2i + 8 = 0 for r. -4 Solve 0 = 3p - 5t - 60, -2p + 27t - 1068 = 116t for p. 0 Solve -3f - g = 1, -3f - 8g + 7 = -9g for f. 1 Solve -71y + 67y - 1 = -v, -2y + 6 = 6v for v. 1 Solve 2u + 3u = j + 9, 4u - 87j + 4 = -89j for u. 1 Solve 13 = -119112a + 119111a, 46 = 4n - 2a for n. 5 Solve -3n = 36b - 41b + 5, 0 = -4b - 5n + 4 for b. 1 Solve -2i - 1117j + 78 = -1120j, 4i - 5j = 132 for i. 3 Solve -2v = 16w - 13w + 43, -v - w - 15 = 0 for v. -2 Solve 173r - 90 = -30k + 178r, 3k = 3r + 24 for k. 2 Solve u - 4 = 0, -2f + 5u - 6u - 4 = 0 for f. -4 Solve 3k = -83i - 329, -429k = -432k + 5i + 23 for k. 1 Solve 10d - 39d + 5i - 5 = 0, 5d + 2i - 2 = 0 for d. 0 Solve -3p - 5w - 201 = -196, -4w + 1 = -4p - 5w for p. 0 Solve -8y + 3y - 38 = -b, 0 = 3y - 11b + 2 for y. -8 Solve -2037 + 2039 = r - x, 4r = x + 8 for r. 2 Solve 0 = 2s - 4m + 20, 13m - 14m = -3s + 5 for s. 4 Solve -5l = 10 + 5, -5v + 84l - 82l - 39 = 0 for v. -9 Solve -5l - 49 + 14 = 5f, -4465 + 4458 = 5l - 2f for l. -3 Solve 0 = 3q + h, 27 = -q + 2h + 20 for q. -1 Solve -f = 9f + 3u + 3, -42f + 4u = -43f - 4 for f. 0 Solve 5h - 4n + 8 = 0, 11n + 458 = -h + 421 for h. -4 Solve 6j + 56 = 2g, j - 2g - 1468 + 1484 = 0 for j. -8
Simplify 3((4-2sqrt(931))2 + -5) - ((1 + sqrt(931) + 4)2 + (sqrt(931) - (sqrt(931) - (sqrt(931) + sqrt(931)1)))*2-2 + -3). -70sqrt(19) + 185232 Simplify ((6-5sqrt(1152)-4)/((-2-2sqrt(6) + sqrt(12)/sqrt(50))2))2. 1920000/49 Simplify (2(sqrt(800) - (sqrt(800) + -1)) + -2(sqrt(800) + 0 + sqrt(800)) + sqrt(800) + 5(1sqrt(800) + sqrt(800)) + 1)2. 840sqrt(2) + 39209 Simplify (4(3(sqrt(70) - sqrt(70)-1) + sqrt(70) + sqrt(70) - 52sqrt(70)))/(5sqrt(250)1-6). 4sqrt(7)/75 Simplify (1(sqrt(304) + 2) + 2 + (sqrt(304) - -1sqrt(304)) - ((sqrt(304) + 1)6 + 0))*2-5. -13700 - 240sqrt(19) Simplify ((2sqrt(3000) + sqrt(3000))/((sqrt(6) - sqrt(96))1) + (3sqrt(5)1 + -3)25)6. -600sqrt(5) + 1620 Simplify (sqrt(243) + 3)*2 + sqrt(3)-4-5 + (sqrt(36) - (2sqrt(360) - sqrt(360))/sqrt(10))/(sqrt(1452)-2). 74sqrt(3) + 252 Simplify -4 + sqrt(55)/(-2sqrt(99)) + -4(sqrt(80) + 3sqrt(80))2-3. -sqrt(5)/6 + 15356 Simplify (4(((sqrt(561)-1)/sqrt(11) - sqrt(51)) + sqrt(153)/sqrt(3)4))/(sqrt(3) - (sqrt(3) + sqrt(3) + sqrt(768) + sqrt(3) + sqrt(3)) - sqrt(15)/sqrt(45)). -12sqrt(17)/29 Simplify -5 + sqrt(9)/(sqrt(15)/sqrt(5)) + 5 + (sqrt(3) - -3sqrt(3)-5) + 2. -13sqrt(3) + 2 Simplify (((sqrt(117) - 1sqrt(117)4) + sqrt(117) + sqrt(117))/(1sqrt(225)) - (5 + (sqrt(1053) - (sqrt(1053) + sqrt(1053)-3 + 3))))2. 544sqrt(13)/5 + 240548/25 Simplify (-1sqrt(153)6 + sqrt(153) + (-1sqrt(153)4 - sqrt(153)))/(sqrt(900) - sqrt(27)/(sqrt(27) - sqrt(3))). -20sqrt(17)/19 Simplify (-23sqrt(204) + -4-2sqrt(204))/(63sqrt(972)-2). -sqrt(17)/162 Simplify (((sqrt(3267) - (0 + sqrt(3267))) + sqrt(3267))1 + -4 + 3(sqrt(432) + -4 + 5))*2. -138sqrt(3) + 14284 Simplify (-6(1 + 1 + (0 + 2sqrt(700) + sqrt(700))-2 + 5))2. -30240sqrt(7) + 908964 Simplify (((sqrt(418)-2 + sqrt(418))-6)/(-6(sqrt(11)-1 - sqrt(11))))/(sqrt(2) + sqrt(2) + sqrt(12)/(-2sqrt(6)) - (sqrt(72)-1 - sqrt(72) - sqrt(72))). sqrt(19)/39 Simplify ((-1((1sqrt(405)-3 - 4(sqrt(405) - (sqrt(405) + 0 + sqrt(405) + sqrt(405)))) + 0) + 2)-6)2. -6480sqrt(5) + 364644 Simplify (-4(sqrt(10) - (sqrt(10) + 3sqrt(10))) + sqrt(10))/(1sqrt(245)) + -3((4 + sqrt(242) + 1 + sqrt(242))*2 + (2sqrt(242)-1)2). -5883 - 4607sqrt(2)/7 Simplify (6(-4 + 3((1 + sqrt(200))-4 - ((sqrt(200) + sqrt(200) + 0 - sqrt(200)) + -3))-4))*2. 345600sqrt(2) + 25922304 Simplify 1 + -6(-2sqrt(304))*2 + sqrt(19) + 5(sqrt(19) + -2) + (sqrt(152)-3)/sqrt(8). -7305 + 3sqrt(19) Simplify ((-4(sqrt(684) + sqrt(684) + -1))2 - (sqrt(684) + (sqrt(684) + 1)-1 + sqrt(684)) - (sqrt(684) + -1)*2-42)3. -1458sqrt(19) + 147819 Simplify ((-3(sqrt(170) - (-4sqrt(170)-5 + sqrt(170)) - sqrt(170))-1)/(1-5sqrt(90)/sqrt(9)1))*2. 67473/25 Simplify (5 + -6((-5(-2sqrt(1700) + sqrt(1700)))*2 - (sqrt(425)-2 + sqrt(187)/(sqrt(11) + sqrt(44)/sqrt(4) - sqrt(11)))))-4. 216sqrt(17) + 1019980 Simplify (-4(1 + sqrt(13)) - sqrt(156)/sqrt(12)4)*2 - (sqrt(130) - -2(sqrt(130) + -1sqrt(130)))/((sqrt(1210) - sqrt(1210)-1) + sqrt(1210)). 2111sqrt(13)/33 + 848 Simplify 2 + sqrt(63)/(-1sqrt(9)) + (-3sqrt(343))2 + (0 + sqrt(343))2-4-1 + -1. -sqrt(7) + 4460 Simplify ((sqrt(8064)4 - sqrt(8064)) + 2sqrt(5600))/(sqrt(96)/(sqrt(3)-1) - -5sqrt(128)/sqrt(4))1. 7sqrt(7) Simplify (6sqrt(130)1)/(sqrt(1000)-2) - (-4 + (sqrt(832) + 2)-5)2. -20996 - 11203sqrt(13)/10 Simplify (sqrt(272) - (sqrt(272) - 5(-2 + sqrt(272) - sqrt(272))) - -5sqrt(272)-1)2 - 5(-3 + 3sqrt(272) - sqrt(272))2. 1415 + 640sqrt(17) Simplify ((((sqrt(72) + (sqrt(72)1 - sqrt(72)))-1)/(sqrt(12) + 2sqrt(192)))/(((1sqrt(144))/sqrt(8))/((2sqrt(81))/sqrt(9))))2. 4/27 Simplify 1(((sqrt(200) - (sqrt(200)-3 + -4))1 + -4)*2 + 1 + -2) + -2. 3197 Simplify (-3 + 5 + ((-3 + sqrt(5) - sqrt(5))-5 + sqrt(5))3 + -4 + sqrt(10)/sqrt(2)6)*2. 774sqrt(5) + 2254 Simplify (-1sqrt(24)/((sqrt(12) - sqrt(300))-3) + -4(3 + sqrt(242) + -4))2. -1058sqrt(2)/3 + 280993/72 Simplify -2 + 4((2sqrt(1280) + -4 - (-4 + (sqrt(1280) - (-1sqrt(1280) - sqrt(1280)))))2 + 0). 5118 Simplify (((sqrt(170) - -31sqrt(170)) + sqrt(170) - sqrt(170))1-1)/((sqrt(250) - (sqrt(250) - 2(sqrt(250) + sqrt(250)-2)))6). sqrt(17)/15 Simplify -6((sqrt(304)3)2 + sqrt(19) + (-3 + sqrt(19))2 + 0 + -2 + -1 + (sqrt(19) + sqrt(95)/sqrt(5) - sqrt(19)) + 3). -16584 + 24sqrt(19) Simplify -4((sqrt(833)-25 + (-1sqrt(833))2 + 2 - 3-1(sqrt(833) + -2)) + -2). -3308 + 196sqrt(17) Simplify 1 + 2 + -1 + ((2sqrt(102)-1)/sqrt(3))/(-5sqrt(32) + (sqrt(6)/sqrt(3) - sqrt(2))5 + sqrt(2)). 2sqrt(17)/19 + 2 Simplify (((sqrt(17) - (sqrt(272) + -5) - (-5 + sqrt(68)/sqrt(4)) - (6(sqrt(833) + -1) + -3)) + 5)2)2. -8832sqrt(17) + 146192 Simplify 3(sqrt(108) - (2sqrt(108)5)2) + (sqrt(9)/sqrt(108)6)*2 + 4. -32393 + 18sqrt(3) Simplify ((sqrt(196)/(-2sqrt(7)))/((sqrt(32)1)/sqrt(8)) + ((-2sqrt(3087) - sqrt(3087)) + sqrt(3087) - sqrt(3087))/(sqrt(324)-1))*2. 63 Simplify ((sqrt(5) + 1)1-1 - 3(sqrt(500) + 1 - sqrt(5)))*2 + -5 + -1 + (1sqrt(405) + -4)*2. 152sqrt(5) + 4351 Simplify 3(sqrt(684) + 4)-5 + (sqrt(190)/sqrt(250) - (-5 + sqrt(1539))*2). -1624 + sqrt(19)/5 Simplify ((4sqrt(275)1)/(-6sqrt(99)))/(3(3sqrt(1620) + sqrt(20))). -sqrt(5)/756 Simplify -2 + ((sqrt(162) + 0 + sqrt(162))*21 - 5(sqrt(162) + (sqrt(162) - sqrt(162)2))2) + ((sqrt(16)/sqrt(2))/sqrt(4) + sqrt(600)/sqrt(12) + 1)2. 12sqrt(2) + 719 Simplify -5((sqrt(1584) - 2sqrt(1584))2 + -5 - ((sqrt(22)/(sqrt(8) - sqrt(2)) - sqrt(11))-1)*2) + 5. -7890 Simplify (3 + -2sqrt(637) + 0 + sqrt(637)1 + sqrt(637) + sqrt(637))2-3 - (2 + (sqrt(637) + -2)5 + 3). -1933 - 161sqrt(13) Simplify -5 + (4 + sqrt(72)-1 + sqrt(72) + -2sqrt(72) + 5)*2 - (-5 + (sqrt(128) + -1)-2)*2-5. 264sqrt(2) + 2969 Simplify ((sqrt(3) - (sqrt(75) - sqrt(75)1 - sqrt(3)))-3 + -2 + (sqrt(3) - sqrt(147)6) + (1 + (sqrt(3) - (2 + sqrt(3))) - sqrt(3)))*2. 288sqrt(3) + 6921 Simplify ((2 + sqrt(2) + -4)*2 - (-3 + 1 + sqrt(2) + sqrt(2))) + ((sqrt(2) + 4 - sqrt(2)) + 2 - -1sqrt(2)3)2 + 4. 30sqrt(2) + 66 Simplify ((-6(-4 + sqrt(612) + 4) + 4)-6 + 3)*2. -9072sqrt(17) + 793593 Simplify 2((-2sqrt(20) + 1)*2 - (sqrt(320) + 0)) - -1(1 + (2 + 1 + sqrt(20) - sqrt(20))). -32sqrt(5) + 166 Simplify -2(sqrt(1200)2)/(sqrt(400) + (2sqrt(400) - sqrt(400))1). -2sqrt(3) Simplify 5 + -2(-5 + sqrt(272) + -2 + -1sqrt(272) + sqrt(272))*2 + 4. -633 + 112sqrt(17) Simplify -3((sqrt(72)2 + sqrt(72))/sqrt(12))/(sqrt(12)1)-3-4 + 0. -54sqrt(2) Simplify (sqrt(8)6 + sqrt(2) - (1 + 4sqrt(2))) + (sqrt(50)4 + sqrt(100)/sqrt(2))2. 9sqrt(2) + 1249 Simplify -5 + (2sqrt(156)-3 + sqrt(156) - sqrt(156)-2-4)/(sqrt(48)-3-52). -5 - 13sqrt(13)/60 Simplify -5((sqrt(405) + 3 + sqrt(405) + 0)-3 - ((sqrt(605)2 + 2)-1)*2). 710sqrt(5) + 12165 Simplify (3 + sqrt(112)-4)2 - (sqrt(112) + -4)-4 - ((1sqrt(112)-2 - (-1(sqrt(112) - (sqrt(112) + -2)) - sqrt(112)))5)*2. -1115 + 320sqrt(7) Simplify (4sqrt(190)/sqrt(5) - (sqrt(38) - sqrt(38)-4)-2)/(sqrt(198)/(sqrt(99) + 3sqrt(99) + sqrt(99) + sqrt(99))). 84sqrt(19) Simplify -5 + (sqrt(32) + sqrt(512) + sqrt(32))2 + -3 + (-3 + -3 + sqrt(2) + -4)6. 6sqrt(2) + 1084 Simplify (-1(sqrt(65) + -4sqrt(65) + sqrt(65)) + sqrt(65)31)/(-4(sqrt(80)-2-1 - sqrt(80))). -5sqrt(13)/16 Simplify 4(((sqrt(30)/sqrt(2)2)/sqrt(5))2 + 3 - ((sqrt(192) - sqrt(192)16)5)*2). -479940 Simplify ((5sqrt(20)3)/(sqrt(1210) - (sqrt(1210) - (sqrt(1210) - 4sqrt(1210)))))*2-54. -1000/121 Simplify (sqrt(50) + (-1sqrt(300) - sqrt(300))/sqrt(6) - (2 + sqrt(50) + sqrt(200))) + 4 + (-3sqrt(50)-2 - sqrt(50) - sqrt(50)) + (sqrt(350)-3)/sqrt(7). -15sqrt(2) + 2 Simplify (3 + ((2(sqrt(192) + sqrt(192)2)4)2 - (0 + sqrt(192) + (-1 + (-2 + sqrt(192))2 - sqrt(192)))))-5. -552000 - 160sqrt(3) Simplify 5 + (4 + 2 + (2sqrt(704)-5 - (-2(sqrt(704) - -1sqrt(704)) - sqrt(704)) - ((sqrt(704) - (1 + -2sqrt(704))) + sqrt(704) + 5)))*2. -288sqrt(11) + 57033 Simplify (((sqrt(152) + sqrt(152) + -1sqrt(152))-1 - sqrt(152))5)/(-6sqrt(24)/sqrt(3) - (2sqrt(1152) + sqrt(8))) + 1 + 1. 10sqrt(19)/31 + 2 Simplify (5 + -35(1sqrt(3800)2)/(-2(sqrt(12) - sqrt(108))/sqrt(6)))2. -750sqrt(19) + 106900 Simplify ((-1sqrt(288)-2 - (-4sqrt(288) + -1))-42-5)*2. 230400sqrt(2) + 16590400
Let j be ((-20)/(-75))/(12/10). Which is the nearest to 0.5? (a) j (b) -1/3 (c) 0.2 a Let z be 1/(-3) + -3 + 26/6. What is the closest to z in -1, -5/3, 0.2? 0.2 Let j = 0.04 + 0.14. Let o = 0.08 - j. What is the closest to o in 1, 2/5, 0.5? 2/5 Let n = -10 + 10. Let w = 3.6 + -0.6. What is the nearest to 2/7 in w, -3/2, n? n Let h(o) = -6o3 + o2 - 1. Let k be h(-1). Let d(j) = j - 4. Let s be d(k). Let l = 113/3 + -38. Which is the closest to 1? (a) l (b) -0.3 (c) s c Let f be 10/6 - (-1 - -3). What is the closest to f in 3, -2/7, 5/2? -2/7 Let k = -4.5 + 5. Which is the closest to -2/7? (a) -4 (b) k (c) 4 b Let g = -13410 - -268137/20. Let w = 17/5 + g. Let o be ((-2)/3)/(5/3). What is the closest to o in -1/3, 0.4, w? -1/3 Let y be (-21)/(-18) - 7/14. Which is the closest to 3? (a) y (b) 3 (c) -0.3 b Let q = -2.83 + -0.17. What is the closest to -1/3 in 4, 1, q? 1 Let p = -28 - -27.74. Let f = p + 10.26. Let r = -11 + f. Which is the nearest to -3? (a) -2 (b) r (c) 2/5 a Let c = -15.9 + 16. What is the closest to 1/2 in c, -4, 0.5? 0.5 Let y = 1.9 + 0.1. Let b = 23 - 24. What is the closest to b in y, -2, -1/3? -1/3 Let g be 185/(-10) + 1/2. Let k be (10/15)/((-4)/g). Suppose -2u + k = -5u. Which is the closest to 2/3? (a) 0.5 (b) -3 (c) u a Suppose j = -0 + 4. Let f be (3/j - 0)4. Which is the nearest to -2? (a) 0 (b) f (c) -0.3 c Let f = -0.09 + -0.01. What is the nearest to 2/7 in -2/9, -5, f? f Let x = 4.15 + -4.1. What is the closest to 0 in x, -0.4, -0.2? x Let j = -35.8 - -30. Let f = j + 1.8. Let g = -20 + 302/15. What is the nearest to -2 in -1/5, f, g? -1/5 Let l = -0.9 - -0.4. Let c = -89/36 - -20/9. What is the closest to c in 2/13, l, 0.3? l Let v = -0.011 + -0.089. Which is the closest to -3/4? (a) 3 (b) v (c) -2 b Let k = 15/31 + -27/248. Let s be 0/((-2)/(-4 + 2)). What is the nearest to s in 0.1, k, -0.3? 0.1 Let c = -11 - -10. Let p = -0.9 - c. What is the closest to p in -0.2, 0.2, 5? 0.2 Let o be (-1 - (-9)/(-4)) + 1 + 3. Suppose -2q - 3 + 1 = 0. What is the nearest to q in 1/7, o, 2/11? 1/7 Let m = 4.3 - -0.7. Which is the closest to 1? (a) m (b) -4 (c) -5 a Let g = 4.07 - 0.07. Let p = 0.2 + -0.2. Let o be 2/(-4) - 11/(-2). Which is the nearest to p? (a) g (b) -0.1 (c) o b Let d = -1 - -0.8. Suppose 0 = -4s - 4z + 4, -z - 2 = -2s + 4z. What is the nearest to -1 in 1/4, d, s? d Let k = 0 - -0.2. Let f be (-2)/22 - (-154)/363. Let p be 4/(-14)(-3)/(-6). What is the nearest to 0 in f, p, k? p Let z = 43/3 + -15. Let i = 3 - 2. Which is the nearest to -1? (a) z (b) 2/3 (c) i a Let a = -4 - -3.7. Suppose -20 = 2x + 5n, -15 + 7 = 5x + 2n. Suppose 0 = -xo - 5o + 15. What is the closest to 1/4 in a, -4, o? a Let q = -0.5 - -0.6. Let h be 1 - (-2 - (2 + -3)). Let i be (h/5)/(2/(-1)). Which is the closest to q? (a) 5/3 (b) i (c) 2/13 c Let y = -2.4 - -3. Let g = -5.6 + y. Let k = -0.3 - -1.3. What is the closest to -1/3 in g, k, -2/17? -2/17 Let p = 0.01 + -5.01. Suppose -3l = 5m - 5 + 2, 0 = -m + 4l + 19. What is the nearest to 0.1 in -2/3, p, m? -2/3 Let x = -0.2 - -2.2. Let o = 17/2 - 31/4. Let p = 3 - 7. Which is the nearest to 0.1? (a) p (b) x (c) o c Let k = -97 - -96.5. Let q = 1 - 3. Which is the nearest to 3/4? (a) -2/9 (b) k (c) q a Let d = -71 + 76. What is the nearest to 0 in d, 0.3, -2/7? -2/7 Let k = 16 + -19. Let w(n) = -n - 2n2 + n2 + 1 + 0n2. Let l be w(0). What is the nearest to l in 4, -0.2, k? -0.2 Let t = 31/4 + -25/4. Suppose 0 = 4h + 2w + w - 140, 0 = w. Let o be (-1)/(-2)(-28)/h. Which is the closest to o? (a) -2/17 (b) t (c) -1 a Let w = 8 - 8.15. Let y = -1.85 + 1.9. Let n = y + w. Which is the nearest to n? (a) -2 (b) 0.5 (c) -1 b Suppose y - 5 = -0. Let t = 0.058 + 0.942. Let g be 3/(-2) + 2/2. Which is the closest to t? (a) y (b) -3/2 (c) g c Let q = -22.1 + 22. What is the nearest to -2 in 3, -4, q? q Let b be 6/(4/(-2))2/6. What is the closest to -0.1 in -2/15, b, 1/10? -2/15 Let b(m) = -m3 + 5m*2 - 6m + 5. Let n be b(4). What is the nearest to 0 in n, -2/3, 0.3? 0.3 Let s be (-14)/15 - 2/5. Suppose 0o + o - 1 = -2y, -y - 2o = 4. Suppose -yg + 5g = 0. What is the nearest to g in s, 0.1, -1/5? 0.1 Let d = -0.197 - 0.003. Let k = -0.67 + 0.07. Let h = d - k. What is the nearest to -2/3 in -2/7, -1, h? -1 Let j = 3 - 8. Let z = -4 - j. Which is the nearest to z? (a) 0 (b) 0.5 (c) -0.5 b Let n = -145/18 + 47/6. What is the nearest to -2 in -4, n, -1/4? -1/4 Let u = 525 - 524. Let q(g) = g2 - 1. Let m be q(0). Let y be m/(1/(1/3)). Which is the nearest to -0.2? (a) u (b) y (c) 3 b Let s be ((-20)/6)/(7/(-21)). Suppose 5q - 5 = 0, j + q - s = 4j. Which is the closest to -1? (a) -0.1 (b) -4 (c) j a Let u = -1.2 - -1.1. Let b = 1 - 2. What is the nearest to u in 1, 0.1, b? 0.1 Let h be (2/(-1))/(12/(-24)-10). Let i = -1839/11 - -167. Let v(f) = f*3 - 4f*2 + 4. Let c be v(3). What is the nearest to h in i, c, 2? i Let g be (-8)/(-28) - (-797)/28. Let y = g + -29. Which is the nearest to 1? (a) -0.1 (b) y (c) -0.4 a Let m = 0 + 0.1. Let q = -9.3 - -6.4. Let v = q - -2.7. What is the closest to m in 0, v, -3/7? 0 Let p be (-2)/(-4)42/49. What is the closest to p in 3, 0, 4? 0 Let o = 0.01 - 2.01. Let y = -3 - o. Let j = -341/36 - -37/4. Which is the closest to y? (a) -2/11 (b) j (c) -5 b Let i be (-1(-15)/(-3))/1. Let z be 7/(308/184) + -4. Which is the nearest to i? (a) -4 (b) -3 (c) z a Let p = -0.6 - -0.4. Let u = -79/4 - -20. What is the nearest to u in p, -5, 4? p Let p = 19.3 - 22. Let m = 1.5 + p. Let c = -0.2 - m. What is the nearest to 0 in 4, c, 0.3? 0.3 Let n = 17 + -17.1. Let q = -0.2 + n. Which is the nearest to -0.1? (a) 0.2 (b) -7 (c) q c Let s = 16.2 - 16. Let d be (-60)/(-14) - (-4)/(-14). What is the closest to s in 5, 0, d? 0 Suppose 5n = z - 15 - 5, -2z + 26 = 4n. Suppose -5m = o - 3, 4o + o = 4m + z. Let d = -1 + 0. Which is the nearest to d? (a) 2 (b) o (c) -3/7 c Let h = -19 - -12. Let s = h + 9. What is the closest to -1/2 in s, 1, 0.2? 0.2 Let p = 25.4 + -21. Let u = p + -0.4. Let g = u - 3.9. Which is the nearest to g? (a) 0.5 (b) 5 (c) -1/2 a Let m = 0.5 + -0.8. Let j = m + -0.2. Let u = -1.4 - -1.3. What is the closest to u in -0.3, j, 3? -0.3 Let x be ((-1130)/35)/(-12 - 0). Let m = x + -20/7. Let v = 0.2 + -0.2. Which is the closest to v? (a) 1/3 (b) m (c) 1 b Let i = 2.8 + -3. Let f = 1.2 + i. Let l = -0.2 + -0.8. Which is the closest to f? (a) -5 (b) l (c) 2/19 c Let h = -38 - -151/4. Which is the closest to h? (a) -5 (b) 0.2 (c) 0.3 b Let o = 101 + -100. Which is the nearest to o? (a) 1/3 (b) 2/25 (c) -2/7 a Let t = -0.07 + 1.07. What is the nearest to 5 in t, -0.1, -5? t Suppose 5v = 3v - 80. Let z be 1/(-10)v/24. What is the closest to -1/3 in -5, z, -4/7? -4/7 Let n = 27 + -26.96. Which is the nearest to n? (a) 0 (b) -1 (c) -3 a Let n = 3 - 4. Let o = 86/3 - 29. Which is the nearest to o? (a) n (b) 0 (c) 5 b Let s = 103/4 - 26. Let n(u) = u*3 - 9u*2. Let i be n(9). Which is the nearest to i? (a) -0.5 (b) -2/11 (c) s b Let t = -4.87 - 0.13. Let l be (5 + -4)(-6)/2. What is the closest to 1 in -0.1, l, t? -0.1 Suppose g = 2g - 5. Suppose -1 = gq + 4. Let i = 232/7 + -33. What is the nearest to 1 in -2/3, i, q? i Let l = 2 - 5. Let f be (-31)/11 - 32/(-2). Which is the nearest to l? (a) f (b) -0.3 (c) 2 b Suppose -6 + 22 = -4v. Let r(g) = -g + 2. Let k be r(0). Suppose 3h + k = h. Which is the nearest to h? (a) 0 (b) 1 (c) v a Suppose 4t + p - 19 = 1, 28 = 2t + 5p. Let r be 5/2(-8)/(-30). Which is the closest to r? (a) -5 (b) t (c) -2/11 c Let s = -4.756 + 0.056. Let x = s - -5. Let o = 1 + -3. Which is the closest to 2? (a) o (b) x (c) -1 b Let h = -2 - -1. Let k = h + 1.1. Which is the closest to 0? (a) 0.5 (b) k (c) 0 c Let p = -0.31 + 2.21. Let l = p + -2.4. Which is the closest to 2? (a) -2 (b) l (c) 1 c Suppose -3x = x - 5l + 4, -2x = 3l + 2. Suppose 0 = -q + 2q - 2. What is the closest to -0.3 in x, 4, q? x Let w be (-135)/72(-4)/10. Which is the closest to 0.2? (a) -1 (b) -4/7 (c) w c Let q = -0.52 + 0.12. Let s = 0.2 + q. Let n = -0.03 - 1.97. What is the nearest to s in n, 3, 3/2? 3/2 Let y = 3.435 + 0.475. Let w = y - -0.09. Which is the closest to -2/3? (a) w (b) -2 (c) -4 b Let k(y) = -10 - 2y*2 - y - 3y - y + 3y*2. Let z be k(7). Let f = 0.2 - 0.3. What is the closest to f in -1, z, 2/5? 2/5
How many micrometers are there in thirteen fifths of a centimeter? 26000 How many millilitres are there in 7/4 of a litre? 1750 What is 3/8 of a tonne in kilograms? 375 How many kilometers are there in 7990.572cm? 0.07990572 What is 29/6 of a week in minutes? 48720 How many millimeters are there in 960.5708 micrometers? 0.9605708 How many meters are there in 3/40 of a kilometer? 75 How many grams are there in 0.4300749kg? 430.0749 What is 3/5 of a minute in milliseconds? 36000 Convert 275752.2ml to litres. 275.7522 Convert 8.637594 grams to milligrams. 8637.594 Convert 8648.7642ms to days. 0.0001001014375 How many millilitres are there in fifty-four fifths of a litre? 10800 What is 13/4 of a gram in milligrams? 3250 What is 184404.57 months in years? 15367.0475 What is 7/6 of a week in hours? 196 What is 393.6884 micrograms in nanograms? 393688.4 How many centuries are there in 0.6645396 months? 0.000553783 What is fifteen quarters of a kilometer in meters? 3750 Convert 22835.634 months to millennia. 1.9029695 What is 29/3 of a year in months? 116 What is seventy-seven halves of a microgram in nanograms? 38500 How many hours are there in one quarter of a week? 42 Convert 3.93499 millennia to centuries. 39.3499 What is 15/16 of a day in minutes? 1350 How many millennia are there in 84.8455 centuries? 8.48455 How many months are there in 0.5546985 years? 6.656382 How many kilograms are there in 3/10 of a tonne? 300 What is 991638.2 centuries in decades? 9916382 What is 506.1017 milliseconds in seconds? 0.5061017 Convert 732474.6 tonnes to nanograms. 732474600000000000000 What is 322.6232ml in litres? 0.3226232 Convert 387155.2 millennia to centuries. 3871552 What is nineteen quarters of a week in hours? 798 What is 9986.145 centuries in months? 11983374 How many millilitres are there in seven halves of a litre? 3500 What is 44945.4 decades in years? 449454 What is 51/5 of a gram in milligrams? 10200 Convert 1.4909697 minutes to days. 0.001035395625 How many decades are there in seven halves of a century? 35 What is 65148.77 milliseconds in seconds? 65.14877 What is 4710.089 hours in seconds? 16956320.4 What is 1/4 of a hour in seconds? 900 What is 34.85175nm in meters? 0.00000003485175 How many micrograms are there in fourty-one halves of a milligram? 20500 What is twenty-one fifths of a centimeter in micrometers? 42000 How many micrometers are there in thirteen eighths of a centimeter? 16250 Convert 749417.8l to millilitres. 749417800 How many milliseconds are there in seventy-five quarters of a second? 18750 How many milligrams are there in eleven quarters of a gram? 2750 How many millilitres are there in 3/8 of a litre? 375 How many decades are there in eleven tenths of a millennium? 110 How many hours are there in 11/2 of a week? 924 Convert 7.562235ml to litres. 0.007562235 How many nanograms are there in 0.8423692 milligrams? 842369.2 What is 11/4 of a kilogram in grams? 2750 How many hours are there in 45/4 of a week? 1890 Convert 5132.16um to millimeters. 5.13216 Convert 31643.82l to millilitres. 31643820 What is fourty-five quarters of a kilometer in meters? 11250 How many millilitres are there in sixty-seven quarters of a litre? 16750 How many minutes are there in 16/15 of a week? 10752 What is three eighths of a kilogram in grams? 375 How many hours are there in 620.5392 microseconds? 0.000000172372 What is twenty-one quarters of a litre in millilitres? 5250 Convert 159.5052 kilometers to micrometers. 159505200000 What is thirty-one halves of a litre in millilitres? 15500 What is 75714.51ng in grams? 0.00007571451 Convert 784803.4m to kilometers. 784.8034 What is one sixteenth of a meter in micrometers? 62500 What is 52.48659 decades in centuries? 5.248659 Convert 211299.4 hours to milliseconds. 760677840000 What is 43/2 of a year in months? 258 How many minutes are there in fourty-five halves of a hour? 1350 What is 693.3675 centuries in decades? 6933.675 How many centimeters are there in one quarter of a meter? 25 How many millilitres are there in nine tenths of a litre? 900 How many millilitres are there in 5/8 of a litre? 625 Convert 91257.48 years to decades. 9125.748 Convert 86194.29mm to nanometers. 86194290000 How many years are there in 427821.3 decades? 4278213 What is 21/5 of a millennium in decades? 420 What is fifty-one quarters of a litre in millilitres? 12750 What is one tenth of a millisecond in microseconds? 100 Convert 197684.3 kilograms to grams. 197684300 Convert 88.42238 days to hours. 2122.13712 What is 11/4 of a litre in millilitres? 2750 What is eleven sevenths of a week in days? 11 How many nanoseconds are there in 84549.4 weeks? 51135477120000000000 What is 8.32776 centuries in years? 832.776 What is 651.0995 milligrams in micrograms? 651099.5 What is 2.845797g in tonnes? 0.000002845797 What is 5/8 of a day in seconds? 54000 Convert 42836.98 weeks to hours. 7196612.64 What is five sixths of a decade in months? 100 Convert 3189.826 weeks to seconds. 1929206764.8 How many years are there in 96.65554 decades? 966.5554 How many millimeters are there in nineteen quarters of a meter? 4750 How many decades are there in 48272.93 centuries? 482729.3 What is six fifths of a century in months? 1440 What is 1/4 of a kilometer in centimeters? 25000 Convert 171040.4 weeks to seconds. 103445233920 How many years are there in 86682.4 centuries? 8668240 What is 1/5 of a century in decades? 2 What is 9.014027 years in centuries? 0.09014027 How many days are there in 14.4856674 seconds? 0.0001676581875 How many centuries are there in 3/5 of a millennium? 6 Convert 0.7328807 millennia to decades. 73.28807 What is twenty-one halves of a microgram in nanograms? 10500 What is 2271.1614 nanoseconds in minutes? 0.00000003785269 Convert 792599.2 millilitres to litres. 792.5992 How many millilitres are there in 1420.447 litres? 1420447 How many millimeters are there in 380.2701 micrometers? 0.3802701 What is three eighths of a hour in seconds? 1350 How many meters are there in 476.955km? 476955 How many litres are there in 560188.3 millilitres? 560.1883 Convert 9.864617ml to litres. 0.009864617 How many micrometers are there in 3/8 of a centimeter? 3750 How many micrometers are there in 18/5 of a millimeter? 3600 How many kilograms are there in 3/8 of a tonne? 375 Convert 5377.687 centimeters to millimeters. 53776.87 What is twenty-one fifths of a millimeter in micrometers? 4200 How many nanograms are there in 24.53207 grams? 24532070000 How many micrograms are there in one twentieth of a milligram? 50 What is 21719.6kg in nanograms? 21719600000000000 What is one fifth of a litre in millilitres? 200 How many centimeters are there in 0.6676441nm? 0.00000006676441 How many millilitres are there in fifty-one fifths of a litre? 10200 What is 5/8 of a micrometer in nanometers? 625 How many kilograms are there in 5/8 of a tonne? 625 Convert 8072.289 seconds to minutes. 134.53815 How many microseconds are there in 7/4 of a millisecond? 1750 How many decades are there in three fifths of a century? 6 What is 4.215429mg in grams? 0.004215429 How many grams are there in 2.356929 tonnes? 2356929 How many centimeters are there in 3/32 of a kilometer? 9375 How many minutes are there in 0.3636217 days? 523.615248 How many months are there in 0.8920303 decades? 107.043636 What is 9656.704nm in kilometers? 0.000000009656704 What is 0.8435527ns in seconds? 0.0000000008435527 How many months are there in three eighths of a century? 450 What is 51/2 of a hour in seconds? 91800 What is 45.93829 nanometers in millimeters? 0.00004593829 Convert 11296.17km to millimeters. 11296170000 How many seconds are there in one fifth of a hour? 720 What is 15/4 of a litre in millilitres? 3750 What is 17/2 of a litre in millilitres? 8500 How many micrometers are there in three fifths of a centimeter? 6000 How many millilitres are there in 390833.4 litres? 390833400 What is 51/5 of a gram in milligrams? 10200 How many litres are there in 0.8145105 millilitres? 0.0008145105 What is 19/4 of a milligram in micrograms? 4750 What is 27/5 of a tonne in kilograms? 5400 What is 840.629cm in millimeters? 8406.29 How many minutes are there in 0.7105812s? 0.01184302 Convert 0.2742742um to nanometers. 274.2742 What is 65572.02 months in millennia? 5.464335 What is 15/4 of a millennium in months? 45000 Convert 34.2242 days to milliseconds. 2956970880 What is 84431.91ng in kilograms? 0.00000008443191 Convert 6402.649 kilometers to micrometers. 6402649000000 How many millilitres are there in three fifths of a litre? 600
What is the o'th term of -442, -415, -306, -73, 326, 933, 1790? 7o3 - o2 - 19o - 429 What is the l'th term of -5786, -10295, -14816, -19355, -23918? -l*3 - 4502l - 1283 What is the l'th term of -7856, -7857, -7860, -7865, -7872, -7881, -7892? -l*2 + 2l - 7857 What is the h'th term of -1425, -5784, -13081, -23316, -36489, -52600? -1469h2 + 48h - 4 What is the k'th term of 35200, 35203, 35206, 35209? 3k + 35197 What is the m'th term of -3002, -2986, -2968, -2954, -2950, -2962? -m3 + 7m*2 + 2m - 3010 What is the z'th term of -1662, -1657, -1628, -1569, -1474, -1337, -1152, -913? z*3 + 6z*2 - 20z - 1649 What is the h'th term of -433, -1755, -3963, -7051, -11013, -15843? h*3 - 449h*2 + 18h - 3 What is the d'th term of -2595709, -5191419, -7787127, -10382833, -12978537? d*2 - 2595713d + 3 What is the q'th term of 1205, 2439, 3699, 4985, 6297, 7635? 13q2 + 1195q - 3 What is the r'th term of -152, -996, -2402, -4370, -6900? -281r2 - r + 130 What is the k'th term of 16144, 32403, 48662, 64921, 81180, 97439? 16259k - 115 What is the k'th term of -30003, -60006, -90009, -120012? -30003k What is the j'th term of -157688, -157672, -157640, -157586, -157504, -157388? j3 + 2j*2 + 3j - 157694 What is the j'th term of 390219, 390220, 390221, 390222, 390223? j + 390218 What is the j'th term of 81, 74, 63, 48, 29? -2j2 - j + 84 What is the b'th term of -699, -2815, -6343, -11283? -706b*2 + 2b + 5 What is the r'th term of 362, 734, 1108, 1484? r*2 + 369r - 8 What is the t'th term of 877, 616, 181, -428, -1211, -2168, -3299? -87t2 + 964 What is the m'th term of 176, 710, 1598, 2840, 4436? 177m*2 + 3m - 4 What is the t'th term of -25, -358, -1249, -2974, -5809, -10030, -15913, -23734? -46t3 - 3t*2 - 2t + 26 What is the y'th term of 406, 737, 1068, 1399? 331y + 75 What is the m'th term of -1210, -1324, -1510, -1768, -2098? -36m*2 - 6m - 1168 What is the o'th term of 14282, 28569, 42858, 57149, 71442, 85737, 100034? o*2 + 14284o - 3 What is the j'th term of -1284, -1483, -1720, -2013, -2380, -2839, -3408? -3j3 - j2 - 175j - 1105 What is the i'th term of -396001, -395999, -395997? 2i - 396003 What is the o'th term of -837, -830, -819, -804? 2o*2 + o - 840 What is the o'th term of 4603, 4580, 4527, 4432, 4283, 4068, 3775? -2o*3 - 3o*2 + 4608 What is the d'th term of 35991, 35989, 35987? -2d + 35993 What is the u'th term of 415, 1544, 3427, 6070, 9479, 13660, 18619, 24362? u*3 + 371u*2 + 9u + 34 What is the d'th term of -542, -1974, -4364, -7712? -479d2 + 5d - 68 What is the k'th term of -727, -727, -773, -895, -1123, -1487? -5k3 + 7k*2 + 14k - 743 What is the a'th term of -160, 161, 482? 321a - 481 What is the x'th term of 12297, 24598, 36899? 12301x - 4 What is the p'th term of -219, -374, -515, -630, -707, -734, -699? 2p3 - 5p*2 - 154p - 62 What is the x'th term of -489, -956, -1389, -1782, -2129, -2424? x*3 + 11x*2 - 507x + 6 What is the y'th term of -2232, -4441, -6650, -8859? -2209y - 23 What is the g'th term of 513823, 513825, 513827, 513829, 513831? 2g + 513821 What is the r'th term of 25223, 50435, 75653, 100877, 126107? 3r2 + 25203r + 17 What is the d'th term of -30946, -61801, -92656? -30855d - 91 What is the q'th term of 6, -6, -12, -12, -6, 6, 24? 3q*2 - 21q + 24 What is the y'th term of 6737, 6691, 6645, 6599, 6553? -46y + 6783 What is the p'th term of 2241, 4477, 6715, 8955, 11197? p2 + 2233p + 7 What is the a'th term of 1088, 2130, 3112, 4034, 4896, 5698, 6440? -30a2 + 1132a - 14 What is the s'th term of 470, 512, 554, 596, 638, 680? 42s + 428 What is the b'th term of -2521, -10127, -22809, -40573, -63425, -91371, -124417, -162569? -b3 - 2532b*2 - 3b + 15 What is the d'th term of -1380, -3188, -5858, -9822, -15512? -72d3 + d2 - 1307d - 2 What is the j'th term of 412, 1590, 3572, 6364, 9972? j*3 + 396j*2 - 17j + 32 What is the g'th term of 31023, 62026, 93027, 124026, 155023, 186018, 217011? -g*2 + 31006g + 18 What is the i'th term of -305, -325, -331, -317, -277, -205, -95, 59? i3 + i2 - 30i - 277 What is the v'th term of -6098, -12191, -18262, -24299, -30290, -36223, -42086, -47867? 2v3 - v2 - 6104v + 5 What is the y'th term of -94455, -94406, -94345, -94266, -94163, -94030, -93861? y3 + 42y - 94498 What is the w'th term of -152, -770, -2456, -5744, -11168, -19262, -30560? -89w3 + 5w - 68 What is the d'th term of -170264, -170270, -170276, -170282? -6d - 170258 What is the s'th term of -787669, -787668, -787667, -787666, -787665, -787664? s - 787670 What is the u'th term of -7, -174, -607, -1438, -2799, -4822, -7639, -11382? -22u3 - u2 - 10u + 26 What is the a'th term of -491, -487, -479, -467, -451? 2a*2 - 2a - 491 What is the o'th term of 25436, 50871, 76306, 101741, 127176? 25435o + 1 What is the h'th term of -56462, -56460, -56458, -56456, -56454? 2h - 56464 What is the j'th term of -2501, -18723, -62759, -148517, -289905, -500831? -2318j3 + j2 + j - 185 What is the s'th term of 141, 166, 191, 216? 25s + 116 What is the a'th term of -118476, -236953, -355430? -118477a + 1 What is the k'th term of -90388, -90379, -90370, -90361, -90352, -90343? 9k - 90397 What is the v'th term of 954, 847, 736, 621, 502, 379, 252? -2v2 - 101v + 1057 What is the o'th term of -156, -329, -518, -723, -944, -1181, -1434? -8o2 - 149o + 1 What is the c'th term of -26430, -52880, -79330, -105780? -26450c + 20 What is the j'th term of -17765, -35544, -53323? -17779j + 14 What is the t'th term of 874, 1746, 2620, 3496, 4374, 5254? t*2 + 869t + 4 What is the k'th term of -867285, -1734562, -2601839, -3469116? -867277k - 8 What is the w'th term of 91478, 182951, 274424, 365897, 457370? 91473w + 5 What is the a'th term of 1217, 4909, 11061, 19667, 30721? -a*3 + 1236a*2 - 9a - 9 What is the z'th term of 980, 1439, 1898, 2357? 459z + 521 What is the p'th term of 6305, 12580, 18867, 25172, 31501, 37860, 44255? p3 + 6268p + 36 What is the h'th term of 82, 319, 692, 1183, 1774, 2447, 3184, 3967? -3h3 + 86h*2 - 1 What is the g'th term of 970, 1968, 2992, 4042, 5118? 13g*2 + 959g - 2 What is the g'th term of 16493, 32987, 49475, 65957, 82433? -3g2 + 16503g - 7 What is the j'th term of 12901, 51613, 116133, 206461, 322597, 464541, 632293? 12904j2 - 3 What is the a'th term of 24767, 99140, 223095, 396632, 619751, 892452? 24791a*2 - 24 What is the i'th term of 73, 408, 1377, 3298, 6489, 11268, 17953? 53i3 - i2 - 33i + 54 What is the g'th term of 134502, 134494, 134496, 134514, 134554, 134622, 134724? g3 - g2 - 12g + 134514 What is the z'th term of 87614, 175250, 262886, 350522, 438158, 525794? 87636z - 22 What is the l'th term of 2782, 3021, 3260? 239l + 2543 What is the k'th term of 4742, 18972, 42698, 75926, 118662, 170912, 232682, 303978? k*3 + 4742k*2 - 3k + 2 What is the k'th term of 45904, 45901, 45896, 45889, 45880, 45869, 45856? -k*2 + 45905 What is the l'th term of 213, 437, 673, 921, 1181? 6l*2 + 206l + 1 What is the n'th term of 4093, 4128, 4167, 4210? 2n2 + 29n + 4062 What is the l'th term of 2825, 5630, 8415, 11174, 13901, 16590, 19235, 21830? -l*3 - 4l*2 + 2824l + 6 What is the v'th term of 2791, 2801, 2811, 2821? 10v + 2781 What is the a'th term of -14789, -29573, -44353, -59129, -73901? 2a*2 - 14790a - 1 What is the g'th term of 60, -367, -1528, -3789, -7516, -13075, -20832? -61g3 - g2 + 3g + 119 What is the o'th term of -4, -208, -688, -1558, -2932, -4924, -7648, -11218? -19o3 - 24o*2 + o + 38 What is the j'th term of 17, 40, 69, 104, 145, 192? 3j*2 + 14j What is the l'th term of -90, -273, -496, -771, -1110, -1525? -2l3 - 8l*2 - 145l + 65 What is the y'th term of -147, -323, -587, -945, -1403? -y*3 - 38y*2 - 55y - 53 What is the o'th term of -3639, -3920, -4397, -5076, -5963? -o*3 - 92o*2 + 2o - 3548 What is the f'th term of -1672, -1627, -1558, -1459, -1324, -1147? f*3 + 6f*2 + 20f - 1699 What is the w'th term of -103175, -103186, -103205, -103232? -4w2 + w - 103172 What is the k'th term of -243, -619, -1131, -1779, -2563? -68k*2 - 172k - 3 What is the u'th term of -59, -201, -371, -521, -603? 8u3 - 62u*2 - 12u + 7 What is the t'th term of -24262, -24280, -24334, -24442, -24622, -24892? -3t3 + 3t - 24262 What is the z'th term of -3132, -6230, -9326, -12420, -15512, -18602, -21690? z*2 - 3101z - 32
Convert 0 (base 5) to base 7. 0 What is f (base 16) in base 10? 15 Convert -3 (base 13) to base 9. -3 Convert a (base 16) to base 9. 11 Convert -20c (base 13) to base 12. -252 Convert -1100100 (base 2) to base 11. -91 Convert 1310 (base 4) to base 13. 8c What is 43 (base 5) in base 4? 113 Convert 127 (base 12) to base 10. 175 -10111 (base 2) to base 13 -1a What is 4 (base 10) in base 12? 4 Convert -51 (base 11) to base 6. -132 What is 7d (base 16) in base 2? 1111101 Convert 24 (base 11) to base 16. 1a Convert b (base 13) to base 8. 13 What is -3 (base 11) in base 3? -10 Convert 110 (base 2) to base 14. 6 Convert -46 (base 14) to base 13. -4a Convert 0 (base 4) to base 12. 0 -210 (base 4) to base 7 -51 What is 80 (base 11) in base 14? 64 What is -1 (base 7) in base 5? -1 -7 (base 16) to base 2 -111 What is -6 (base 15) in base 4? -12 97 (base 15) to base 11 11a Convert -15 (base 10) to base 5. -30 Convert 0 (base 6) to base 8. 0 What is -c (base 14) in base 2? -1100 203 (base 4) to base 8 43 What is 5 (base 12) in base 15? 5 Convert 5 (base 9) to base 7. 5 Convert -a (base 14) to base 4. -22 0 (base 8) to base 10 0 133 (base 4) to base 2 11111 What is -1 (base 3) in base 2? -1 -13 (base 4) to base 2 -111 What is -7a (base 12) in base 8? -136 Convert 154 (base 6) to base 7. 130 -31 (base 15) to base 14 -34 -34 (base 11) to base 7 -52 Convert 1 (base 10) to base 15. 1 What is -67 (base 11) in base 5? -243 11 (base 4) to base 12 5 Convert -22 (base 12) to base 6. -42 Convert -1a (base 13) to base 7. -32 What is 1b0 (base 12) in base 7? 543 Convert -12 (base 15) to base 6. -25 What is -4 (base 6) in base 12? -4 30 (base 13) to base 4 213 10 (base 7) to base 5 12 1a (base 14) to base 16 18 What is 8 (base 15) in base 8? 10 Convert 1 (base 16) to base 8. 1 What is -414 (base 6) in base 14? -b0 Convert -1020 (base 3) to base 11. -30 What is 222 (base 4) in base 5? 132 Convert -10 (base 15) to base 2. -1111 12 (base 10) to base 3 110 What is 5 (base 8) in base 10? 5 74 (base 11) to base 3 10000 28 (base 15) to base 14 2a 65 (base 13) to base 11 76 -143 (base 10) to base 2 -10001111 -15 (base 14) to base 15 -14 Convert -1 (base 13) to base 5. -1 What is -65 (base 8) in base 4? -311 -107 (base 11) to base 4 -2000 Convert -11 (base 11) to base 10. -12 Convert -37 (base 9) to base 6. -54 2 (base 16) to base 15 2 What is -30 (base 11) in base 14? -25 Convert 1 (base 14) to base 13. 1 What is -86 (base 9) in base 14? -58 What is 0 (base 12) in base 7? 0 1 (base 15) to base 8 1 What is 4 (base 15) in base 5? 4 Convert 8 (base 16) to base 11. 8 Convert -6 (base 9) to base 5. -11 Convert -67 (base 8) to base 3. -2001 57 (base 10) to base 8 71 What is -102 (base 3) in base 12? -b 9 (base 15) to base 11 9 Convert -2 (base 14) to base 13. -2 Convert 17c (base 15) to base 2. 101010110 15 (base 6) to base 15 b Convert 1100 (base 3) to base 2. 100100 10 (base 8) to base 12 8 What is -2114 (base 5) in base 6? -1152 2 (base 11) to base 6 2 Convert -2111 (base 4) to base 8. -225 2 (base 6) to base 15 2 Convert -2 (base 9) to base 7. -2 Convert -373 (base 9) to base 16. -135 What is -7 (base 8) in base 7? -10 What is 45 (base 8) in base 11? 34 Convert 1102 (base 3) to base 13. 2c Convert -1 (base 9) to base 13. -1 163 (base 7) to base 9 114 Convert 13 (base 14) to base 6. 25 What is 4 (base 15) in base 4? 10 -1 (base 13) to base 6 -1 -d (base 15) to base 7 -16 -4 (base 10) to base 7 -4 Convert 191 (base 14) to base 13. 1bb 1 (base 7) to base 2 1 Convert -11010101 (base 2) to base 5. -1323 Convert 30 (base 4) to base 9. 13 -10 (base 6) to base 4 -12 What is 4 (base 6) in base 14? 4 Convert -3 (base 14) to base 16. -3 10 (base 3) to base 14 3 -52 (base 15) to base 10 -77 -6 (base 9) to base 3 -20 12 (base 7) to base 13 9 What is 23 (base 6) in base 13? 12 What is -1 (base 6) in base 7? -1 46 (base 10) to base 15 31 What is 4 (base 16) in base 14? 4 What is 38 (base 14) in base 2? 110010 What is 9 (base 10) in base 6? 13 What is -27 (base 10) in base 16? -1b -24 (base 8) to base 14 -16 What is 0 (base 3) in base 11? 0 Convert 7 (base 9) to base 13. 7 Convert 11111010 (base 2) to base 3. 100021 Convert -11 (base 4) to base 15. -5 What is 2 (base 4) in base 5? 2 36 (base 9) to base 15 23 Convert 22 (base 12) to base 11. 24 44 (base 8) to base 6 100 What is -10 (base 7) in base 14? -7 -2033 (base 4) to base 2 -10001111 What is -52 (base 6) in base 4? -200 What is 10 (base 7) in base 16? 7 What is 345 (base 8) in base 4? 3211 -69 (base 12) to base 9 -100 116 (base 7) to base 8 76 What is -5 (base 13) in base 14? -5 What is 12 (base 11) in base 8? 15 2 (base 12) to base 11 2 6 (base 14) to base 13 6 242 (base 6) to base 5 343 -2 (base 3) to base 15 -2 0 (base 8) to base 6 0 Convert 0 (base 10) to base 5. 0 -5 (base 8) to base 11 -5 33 (base 11) to base 4 210 77 (base 11) to base 14 60 What is 5 (base 9) in base 14? 5 Convert -10 (base 14) to base 2. -1110 -45 (base 7) to base 13 -27 8 (base 12) to base 14 8 What is -4 (base 15) in base 5? -4 -23 (base 15) to base 2 -100001 Convert -21 (base 11) to base 4. -113 c6 (base 13) to base 9 200 -72 (base 12) to base 6 -222 -261 (base 7) to base 10 -141 What is -2c (base 16) in base 2? -101100 Convert -4 (base 7) to base 2. -100 Convert -45 (base 13) to base 4. -321 Convert 0 (base 15) to base 9. 0 -69 (base 16) to base 11 -96 Convert -6 (base 15) to base 12. -6 What is 4 (base 7) in base 3? 11 What is 20 (base 3) in base 14? 6 What is -10 (base 10) in base 13? -a Convert 224 (base 5) to base 12. 54 What is -4 (base 13) in base 9? -4 Convert -10 (base 4) to base 5. -4 What is -5 (base 9) in base 4? -11 Convert 4 (base 15) to base 8. 4 What is -5 (base 10) in base 3? -12 0 (base 4) to base 11 0 Convert 1 (base 6) to base 14. 1 What is 0 (base 4) in base 12? 0 -36 (base 14) to base 15 -33 Convert -a1 (base 15) to base 11. -128 Convert 12 (base 4) to base 8. 6 Convert 0 (base 6) to base 11. 0 11011 (base 2) to base 5 102 Convert 17 (base 13) to base 8. 24 What is -6 (base 8) in base 10? -6 What is -67 (base 12) in base 8? -117 Convert -3 (base 10) to base 7. -3 What is 14 (base 8) in base 6? 20 What is 1 (base 13) in base 9? 1 -18 (base 13) to base 14 -17 Convert 64 (base 7) to base 15. 31 What is 200 (base 7) in base 6? 242 -5 (base 14) to base 4 -11 -55 (base 14) to base 4 -1023 4 (base 10) to base 16 4 -12 (base 9) to base 12 -b What is 10010 (base 2) in base 3? 200 What is -4 (base 8) in base 3? -11 What is -2 (base 8) in base 2? -10 What is -101101 (base 2) in base 6? -113 Convert -29 (base 11) to base 15. -21 -40 (base 14) to base 7 -110 Convert 45 (base 6) to base 16. 1d Convert -113 (base 12) to base 15. -a9 3 (base 15) to base 14 3 What is -121 (base 5) in base 9? -40 51 (base 11) to base 4 320 What is -1c (base 14) in base 6? -42 What is -4 (base 15) in base 5? -4 Convert 3 (base 8) to base 6. 3 What is 7 (base 10) in base 15? 7 c9 (base 13) to base 8 245 Convert 201 (base 4) to base 3. 1020 What is 3 (base 13) in base 7? 3 -47 (base 14) to base 16 -3f -1100 (base 2) to base 6 -20 Convert 20022 (base 3) to base 16. aa -1 (base 3) to base 11 -1 What is 21 (base 3) in base 13? 7 Convert -20 (base 9) to base 7. -24 What is 51 (base 7) in base 6? 100 Convert -3 (base 13) to base 3. -10 What is 101 (base 5) in base 12? 22 What is -560 (base 7) in base 5? -2122 Convert 7 (base 10) to base 2. 111 4 (base 6) to base 13 4 3 (base 10) to base 3 10 -164 (base 10) to base 5 -1124 Convert 5 (base 10) to base 5. 10 What is 6 (base 10) in base 15? 6 Convert -2 (base 12) to base 2. -10 260 (base 9) to base 6 1000 What is 36 (base 11) in base 14? 2b What is -442 (base 5) in base 10? -122 -3 (base 12) to base 2 -11 What is 12 (base 3) in base 12? 5 131 (base 9) to base 11 9a 9 (base 15) to base 10 9 Convert ee (base 15) to base 5. 1344 2 (base 5) to base 4 2 101011 (base 2) to base 7 61 1 (base 11) to base 14 1 -1010 (base 6) to base 9 -266 Convert 46 (base 10) to base 3. 1201 What is 55 (base 12) in base 2? 1000001 Convert -11 (base 14) to base 7. -21 Convert -221 (base 5) to base 14. -45 What is a (base 16) in base 9? 11 What is 50 (base 11) in base 6? 131 Convert -10121 (base 3) to base 14. -6d Convert -15 (base 10) to base 16. -f 4 (base 14) to base 3 11 What is -11 (base 3) in base 10? -4 What is -5 (base 6) in base 5? -10 What is -1101001 (base 2) in base 9? -126 203 (base 7) to base 10 101 -2 (base 3) to base 5 -2 9 (base 14) to base 9 10 Convert -a9 (base 13) to base 16. -8b Convert -c (base 13) to base 9. -13 -11 (base 2) to base 7 -3 -3 (base 16) to base 14 -3 What is 1011 (base 2) in base 13? b What is 11 (base 2) in base 15? 3 What is 11000111 (base 2) in base 13? 124 2 (base 9) to base 8 2 What is -59 (base 15) in base 16? -54 What is -15 (base 10) in base 14? -11
Three letters picked without replacement from wwwbbbwwwbbwwwww. What is prob of picking 3 b? 1/56 Calculate prob of picking 1 k and 2 i when three letters picked without replacement from gtiggiggitgikgig. 1/56 Calculate prob of picking 1 r, 1 e, and 1 t when three letters picked without replacement from veqtrfq. 1/35 Four letters picked without replacement from vvxsywwsjwvwss. What is prob of picking 2 s, 1 w, and 1 j? 24/1001 What is prob of picking 1 l and 2 i when three letters picked without replacement from liiliapillipppppil? 25/272 Three letters picked without replacement from {g: 2, d: 2, a: 4, t: 1, j: 1, r: 7}. Give prob of picking 2 d and 1 t. 1/680 Two letters picked without replacement from jqqqlqqjjljq. Give prob of picking 1 l and 1 q. 2/11 Four letters picked without replacement from {p: 10, e: 4}. What is prob of picking 1 p and 3 e? 40/1001 Four letters picked without replacement from {j: 3, d: 2, o: 2, e: 8, w: 2}. Give prob of picking 2 j and 2 d. 3/2380 Calculate prob of picking 1 t and 1 a when two letters picked without replacement from ephahteaceaecp. 3/91 Calculate prob of picking 3 k when three letters picked without replacement from hhhhkhmkhkhhk. 2/143 What is prob of picking 1 e and 2 f when three letters picked without replacement from nfffnefjfnmnujf? 3/91 Calculate prob of picking 1 s and 1 v when two letters picked without replacement from vkkkksbooykybv. 2/91 Two letters picked without replacement from xlxtlxxxxlxxttxtxlx. What is prob of picking 2 x? 55/171 Four letters picked without replacement from {g: 7, p: 2, n: 5, q: 4}. What is prob of picking 2 p, 1 g, and 1 n? 7/612 Calculate prob of picking 2 j when two letters picked without replacement from pjvvpfjvvpjfpvpx. 1/40 Two letters picked without replacement from ddddddd. What is prob of picking 2 d? 1 Calculate prob of picking 1 q and 2 i when three letters picked without replacement from qqqqiiqqqqqqiq. 33/364 Two letters picked without replacement from {l: 18, p: 1}. Give prob of picking 2 l. 17/19 Two letters picked without replacement from ihmhh. What is prob of picking 1 i and 1 h? 3/10 What is prob of picking 2 v when two letters picked without replacement from {v: 4, p: 5, a: 4, l: 2}? 2/35 Four letters picked without replacement from ytqay. Give prob of picking 1 a, 1 t, 1 y, and 1 q. 2/5 Four letters picked without replacement from szsswcrrszrwrxc. What is prob of picking 1 z, 1 s, 1 c, and 1 x? 16/1365 What is prob of picking 4 t when four letters picked without replacement from ettetceeete? 1/330 Four letters picked without replacement from vnbnnvvvb. What is prob of picking 2 b and 2 v? 1/21 Calculate prob of picking 2 d and 2 a when four letters picked without replacement from ddgdgyada. 1/21 Calculate prob of picking 2 r and 2 i when four letters picked without replacement from iriiiir. 2/7 Two letters picked without replacement from {y: 1, t: 1, o: 1, p: 1, g: 1}. Give prob of picking 1 p and 1 g. 1/10 Three letters picked without replacement from {m: 2, j: 4, w: 8, c: 3}. What is prob of picking 1 w, 1 m, and 1 c? 6/85 Calculate prob of picking 2 c and 1 u when three letters picked without replacement from {u: 10, c: 2}. 1/22 Calculate prob of picking 2 y when two letters picked without replacement from {y: 4, t: 2, e: 2}. 3/14 What is prob of picking 1 o, 2 s, and 1 v when four letters picked without replacement from {c: 3, s: 5, o: 3, v: 3, a: 4}? 1/34 Two letters picked without replacement from vehpeevheephpph. Give prob of picking 1 p and 1 v. 8/105 What is prob of picking 1 w, 1 h, and 1 u when three letters picked without replacement from {y: 1, r: 3, u: 3, h: 7, w: 4}? 7/68 Calculate prob of picking 1 f and 1 y when two letters picked without replacement from fpfpppfyy. 1/6 Two letters picked without replacement from xxuuxxxuxxxuxxxuxuu. What is prob of picking 2 x? 22/57 What is prob of picking 2 e when two letters picked without replacement from tetetet? 1/7 Four letters picked without replacement from vjvjv. What is prob of picking 2 j and 2 v? 3/5 Four letters picked without replacement from {k: 10, h: 4}. What is prob of picking 1 k and 3 h? 40/1001 Calculate prob of picking 2 q when two letters picked without replacement from rqqrqqqqqqrqqqqrqqqq. 12/19 What is prob of picking 1 e and 2 u when three letters picked without replacement from hehuheuhuuuhh? 10/143 What is prob of picking 2 f and 1 h when three letters picked without replacement from fffffffffffhfff? 1/5 Calculate prob of picking 1 m and 1 w when two letters picked without replacement from {y: 2, m: 1, w: 1, j: 2, b: 2, e: 1}. 1/36 Calculate prob of picking 2 c and 2 s when four letters picked without replacement from scssscsccsssscss. 55/182 Three letters picked without replacement from {v: 4, z: 2, l: 4}. Give prob of picking 3 l. 1/30 What is prob of picking 2 g and 1 h when three letters picked without replacement from {g: 4, h: 8, z: 2}? 12/91 What is prob of picking 1 h and 1 f when two letters picked without replacement from fehthhehhehhheh? 3/35 Two letters picked without replacement from {l: 1, n: 3, j: 3, p: 1, x: 3}. Give prob of picking 1 n and 1 x. 9/55 Calculate prob of picking 3 g when three letters picked without replacement from {g: 3, b: 7, l: 2}. 1/220 What is prob of picking 3 i when three letters picked without replacement from ixiix? 1/10 Four letters picked without replacement from szaeeazzyzzzzayewa. What is prob of picking 1 z, 1 y, and 2 e? 7/510 What is prob of picking 3 h when three letters picked without replacement from ehppphpehpptptp? 1/455 Two letters picked without replacement from {l: 4, v: 2, a: 1, j: 6}. What is prob of picking 1 a and 1 v? 1/39 Calculate prob of picking 1 f, 1 i, and 1 s when three letters picked without replacement from vqsif. 1/10 What is prob of picking 1 q, 1 t, and 1 e when three letters picked without replacement from ypyqccpyceetcyc? 2/455 Calculate prob of picking 1 g and 1 o when two letters picked without replacement from bbgbgngogvof. 4/33 Calculate prob of picking 2 r, 1 b, and 1 i when four letters picked without replacement from rirrrrbibrr. 14/55 Three letters picked without replacement from cycyyccycry. What is prob of picking 2 y and 1 c? 10/33 Three letters picked without replacement from {c: 5, q: 2, e: 1, j: 1, a: 1}. What is prob of picking 1 c, 1 j, and 1 e? 1/24 Three letters picked without replacement from tqzmx. What is prob of picking 1 t, 1 m, and 1 z? 1/10 What is prob of picking 2 k when two letters picked without replacement from {g: 1, f: 1, q: 1, k: 5, v: 4}? 5/33 What is prob of picking 2 u and 2 q when four letters picked without replacement from uqqum? 1/5 Calculate prob of picking 1 h and 1 y when two letters picked without replacement from byhwvvd. 1/21 Two letters picked without replacement from ejrjpbjwbeebwp. Give prob of picking 2 w. 1/91 Four letters picked without replacement from {u: 5, m: 3, g: 1}. Give prob of picking 4 u. 5/126 Two letters picked without replacement from {v: 2, s: 11}. Give prob of picking 2 v. 1/78 Two letters picked without replacement from oqototqyy. What is prob of picking 1 q and 1 o? 1/6 Calculate prob of picking 1 x and 1 y when two letters picked without replacement from {x: 8, y: 3}. 24/55 Calculate prob of picking 2 h when two letters picked without replacement from mmxkddhdmhddg. 1/78 Three letters picked without replacement from {z: 2, n: 3, q: 1, i: 1}. What is prob of picking 1 q, 1 n, and 1 i? 3/35 Two letters picked without replacement from {y: 2, i: 10}. Give prob of picking 2 y. 1/66 Two letters picked without replacement from {s: 3, g: 2, e: 1, i: 1}. Give prob of picking 1 s and 1 e. 1/7 Two letters picked without replacement from {y: 3, x: 3, i: 1, u: 1, n: 8, f: 3}. Give prob of picking 1 x and 1 n. 8/57 Calculate prob of picking 1 q and 1 v when two letters picked without replacement from zjqvp. 1/10 Three letters picked without replacement from {p: 4, e: 1, r: 4, d: 1, y: 5, h: 4}. Give prob of picking 1 h, 1 y, and 1 e. 20/969 Two letters picked without replacement from ccxoxocxxoooccccdxc. What is prob of picking 1 d and 1 x? 5/171 Three letters picked without replacement from {k: 8, p: 2}. Give prob of picking 1 k and 2 p. 1/15 Two letters picked without replacement from dzprzp. Give prob of picking 1 r and 1 p. 2/15 Two letters picked without replacement from {f: 1, g: 2, w: 1, q: 1, v: 1, p: 1}. What is prob of picking 1 p and 1 g? 2/21
What is next in -34, -48, -16, 86, 282, 596, 1052? 1674 What is next in 25, -7, -39, -71? -103 What is next in 237, 460, 683, 906, 1129, 1352? 1575 What comes next: 105, 412, 923, 1638? 2557 What is the next term in 1607, 1606, 1603, 1598? 1591 What is next in 4, -24, -90, -212, -408, -696, -1094? -1620 What is the next term in 523, 1042, 1563, 2086, 2611? 3138 What is the next term in -1086, -1087, -1088, -1089, -1090? -1091 What is next in -15, -49, -83, -117, -151? -185 What is next in 52, 115, 188, 277, 388, 527, 700? 913 What comes next: -117, -112, -105, -96, -85, -72? -57 What comes next: -3108, -6215, -9322? -12429 What comes next: -1356, -2714, -4074, -5436, -6800, -8166? -9534 What is next in 9, -7, -25, -45, -67, -91? -117 What is the next term in 40, 65, 106, 163? 236 What comes next: -148, -167, -186, -205, -224, -243? -262 What is the next term in 4, 18, 40, 70? 108 What is the next term in 137, 435, 931, 1625? 2517 What comes next: -167, -179, -207, -257, -335, -447, -599, -797? -1047 What is the next term in -4, -9, -26, -61, -120, -209, -334? -501 What comes next: -267, -526, -783, -1038? -1291 What is the next term in -189, -183, -177, -171, -165, -159? -153 What comes next: -626, -625, -622, -617, -610? -601 What is next in 37, 86, 135, 184? 233 What is next in -13, -9, -5, -1, 3? 7 What is next in -256, -253, -250? -247 What is next in -81, -156, -227, -294, -357? -416 What is next in 18, 35, 44, 45, 38? 23 What is next in 36, 67, 88, 99, 100, 91, 72? 43 What comes next: -107, -106, -105? -104 What comes next: -24, -82, -154, -246, -364, -514? -702 What comes next: 184, 203, 258, 367, 548, 819? 1198 What is next in 64, 45, 22, 1, -12? -11 What comes next: 13, 43, 85, 133, 181, 223, 253, 265? 253 What comes next: 0, -10, -20, -30? -40 What comes next: -1, -16, -45, -94, -169? -276 What is the next term in 34, 64, 114, 184, 274, 384? 514 What comes next: 18, 22, 28, 36, 46, 58, 72? 88 What is the next term in -14, -32, -54, -80, -110, -144? -182 What is next in -110, -115, -120? -125 What comes next: 2432, 2434, 2436, 2438, 2440, 2442? 2444 What is the next term in -129, -121, -113? -105 What is next in -4846, -4847, -4848, -4849, -4850, -4851? -4852 What comes next: 0, 27, 72, 135, 216, 315, 432? 567 What is next in 49, 95, 141, 187, 233, 279? 325 What comes next: -716, -714, -712? -710 What is the next term in -25, -24, -23? -22 What is the next term in -23, -60, -137, -272, -483, -788, -1205? -1752 What comes next: -8732, -17463, -26204, -34961, -43740, -52547, -61388, -70269? -79196 What comes next: -73, -72, -71, -70, -69, -68? -67 What comes next: 6, -2, -14, -30, -50, -74, -102? -134 What comes next: 91, 168, 231, 274, 291? 276 What is next in 33926, 33925, 33924, 33923, 33922, 33921? 33920 What is the next term in -57, -74, -117, -198, -329? -522 What is the next term in 2710, 2711, 2712? 2713 What is next in 8, 18, 28? 38 What comes next: 55, 65, 91, 139, 215, 325, 475? 671 What is next in 6018, 6016, 6012, 6006? 5998 What is next in 22, 196, 662, 1564, 3046? 5252 What is the next term in -308, -287, -266, -245, -224? -203 What is the next term in 6433, 6435, 6437, 6439, 6441? 6443 What is the next term in -108, -232, -356, -480? -604 What is next in -5916, -11828, -17740? -23652 What is next in 10155, 10154, 10153? 10152 What comes next: -10, -57, -180, -415, -798, -1365, -2152, -3195? -4530 What is the next term in 194, 190, 182, 170, 154, 134? 110 What is next in -31, 27, 87, 149, 213, 279, 347? 417 What comes next: -167, -185, -203, -221, -239? -257 What is the next term in 11, 21, 33, 47, 63, 81? 101 What is next in -145, -564, -1255, -2212, -3429, -4900? -6619 What is next in 57, 577, 1995, 4761, 9325? 16137 What is the next term in -2, 20, 46, 76? 110 What is next in 72, 148, 224, 300, 376? 452 What is next in 10, 13, 18, 25, 34? 45 What is next in -69, -142, -227, -330, -457? -614 What comes next: -315, -626, -937, -1248, -1559, -1870? -2181 What is the next term in 638, 1273, 1910, 2549, 3190, 3833, 4478? 5125 What is next in -101, -195, -281, -359, -429, -491, -545? -591 What is the next term in 104, 204, 302, 398? 492 What is the next term in -406, -423, -440, -457, -474, -491? -508 What comes next: 20, 12, -20, -82, -180, -320, -508? -750 What is next in -89, -182, -277, -374, -473, -574, -677? -782 What is next in -3204, -3203, -3202, -3201, -3200? -3199 What is the next term in -31, -28, -17, 8, 53, 124, 227, 368? 553 What is the next term in 9210, 9208, 9206? 9204 What is the next term in -179, -199, -203, -185, -139, -59, 61? 227 What is next in -12, 17, 56, 99, 140, 173, 192, 191? 164 What is the next term in 280, 315, 374, 457, 564, 695, 850? 1029 What is next in 0, -1, -2, -3, -4? -5 What comes next: 1292, 1290, 1294, 1310, 1344? 1402 What is the next term in 33, 51, 95, 177, 309, 503, 771, 1125? 1577 What is the next term in -23, -83, -133, -167, -179? -163 What is next in -1899, -1900, -1901, -1902, -1903? -1904 What is the next term in 185, 1489, 5025, 11909, 23257, 40185, 63809, 95245? 135609 What is the next term in 290, 585, 880, 1175, 1470, 1765? 2060 What comes next: -2203, -2202, -2201? -2200 What is the next term in 68, 171, 316, 503, 732, 1003? 1316 What is the next term in -1135, -2267, -3397, -4525, -5651, -6775, -7897? -9017 What is the next term in -52, -90, -124, -154? -180 What is next in 51, 108, 167, 228, 291, 356? 423 What comes next: 16, 48, 100, 172, 264, 376, 508? 660 What is next in 200, 402, 604, 806? 1008 What comes next: 10, 22, 38, 58? 82 What comes next: 4, -6, -14, -20? -24 What comes next: 30, 105, 224, 387, 594, 845? 1140 What is next in -24, -83, -182, -321? -500 What is next in -346, -343, -338, -331, -322, -311? -298 What is next in 248, 261, 298, 371, 492, 673, 926? 1263 What is the next term in 1198, 2370, 3542, 4714? 5886 What is the next term in 47, 36, 13, -28, -93, -188, -319? -492 What is next in -1, -29, -91, -199, -365? -601 What is the next term in -149, -286, -411, -518, -601, -654, -671? -646 What is the next term in -18, -41, -84, -153, -254, -393? -576 What is the next term in -886, -3530, -7936, -14104? -22034 What comes next: -50, -83, -106, -113, -98, -55, 22? 139 What is the next term in 14, 29, 46, 65? 86 What is next in -9006, -9006, -8998, -8976, -8934? -8866 What is next in 15, 37, 73, 123, 187? 265 What comes next: 44, 79, 90, 65, -8? -141 What comes next: 6537, 6538, 6539, 6540? 6541 What is the next term in 20260, 40519, 60778? 81037 What comes next: 1768, 1769, 1772, 1777, 1784, 1793, 1804? 1817 What is next in 13, 35, 85, 175, 317, 523? 805 What is next in -22, -57, -92, -127, -162? -197 What is the next term in 1581, 1579, 1577? 1575 What is next in 18, 40, 62, 84? 106 What is next in 18008, 18007, 18006? 18005 What comes next: -27, -69, -137, -237, -375? -557 What is next in 30, 56, 128, 270, 506, 860? 1356 What is next in -6537, -6535, -6535, -6537, -6541? -6547 What is next in -111, -253, -393, -531? -667 What is the next term in -1371, -5476, -12315, -21888, -34195? -49236 What is the next term in 30, 14, -22, -90, -202, -370, -606? -922 What comes next: 3, 44, 139, 306, 563, 928, 1419? 2054 What comes next: 3448, 3446, 3444, 3442, 3440? 3438 What comes next: -64, -243, -540, -955? -1488 What comes next: 19, 17, -3, -47, -121, -231? -383 What is next in -322, -319, -314, -307, -298, -287, -274? -259 What is the next term in -21, -26, -31, -36, -41? -46 What is the next term in -136, -178, -254, -370, -532, -746, -1018? -1354 What is the next term in -16, 15, 32, 29, 0, -61? -160 What is the next term in -420, -493, -568, -645, -724? -805 What comes next: -484, -488, -494, -502, -512, -524, -538? -554 What is next in -38, -38, -12, 52, 166, 342? 592 What is next in 5, 6, 5, 2, -3, -10, -19? -30 What is the next term in -130, -473, -1036, -1813, -2798, -3985, -5368, -6941? -8698 What is next in -1009, -1007, -1005, -1003, -1001, -999? -997 What is the next term in -18, -42, -68, -90, -102, -98, -72, -18? 70 What comes next: -69, -62, -55? -48 What comes next: 28, 29, 30, 31? 32 What comes next: 166, 332, 498, 664, 830, 996? 1162 What comes next: 52, 89, 126? 163 What comes next: 1, -9, -31, -65, -111, -169, -239? -321 What comes next: 96, 168, 242, 318, 396, 476, 558? 642 What comes next: -363, -355, -343, -327, -307, -283, -255? -223 What is next in 416, 424, 432, 440, 448? 456 What is the next term in 453, 891, 1329, 1767? 2205 What is the next term in -54, -238, -544, -972, -1522, -2194? -2988 What is the next term in -3484, -6967, -10450, -13933, -17416, -20899? -24382
What is 582 minutes before 1:43 PM? 4:01 AM How many minutes are there between 7:21 AM and 2:49 PM? 448 What is 27 minutes after 9:31 PM? 9:58 PM How many minutes are there between 10:37 PM and 8:18 AM? 581 How many minutes are there between 8:42 AM and 9:49 AM? 67 What is 706 minutes after 1:02 AM? 12:48 PM How many minutes are there between 10:06 PM and 11:02 PM? 56 What is 703 minutes after 4:06 AM? 3:49 PM What is 217 minutes before 11:07 AM? 7:30 AM How many minutes are there between 4:40 PM and 4:51 PM? 11 How many minutes are there between 6:50 AM and 11:59 AM? 309 What is 682 minutes before 10:15 AM? 10:53 PM What is 570 minutes before 10:48 AM? 1:18 AM How many minutes are there between 11:11 PM and 9:35 AM? 624 How many minutes are there between 12:14 PM and 11:29 PM? 675 How many minutes are there between 10:10 PM and 3:31 AM? 321 How many minutes are there between 2:12 AM and 11:53 AM? 581 How many minutes are there between 9:41 PM and 5:04 AM? 443 How many minutes are there between 10:15 PM and 4:31 AM? 376 What is 661 minutes before 3:40 PM? 4:39 AM What is 468 minutes after 1:49 PM? 9:37 PM What is 270 minutes before 1:18 AM? 8:48 PM What is 48 minutes before 10:11 AM? 9:23 AM What is 514 minutes before 3:37 AM? 7:03 PM How many minutes are there between 4:13 AM and 10:40 AM? 387 What is 298 minutes after 12:43 PM? 5:41 PM How many minutes are there between 1:46 AM and 3:49 AM? 123 What is 610 minutes before 9:42 PM? 11:32 AM How many minutes are there between 2:19 AM and 1:05 PM? 646 How many minutes are there between 9:49 AM and 8:53 PM? 664 How many minutes are there between 4:23 AM and 8:20 AM? 237 How many minutes are there between 1:12 AM and 11:43 AM? 631 What is 279 minutes before 1:03 PM? 8:24 AM How many minutes are there between 2:55 PM and 1:04 AM? 609 How many minutes are there between 9:27 PM and 4:07 AM? 400 What is 69 minutes after 4:15 PM? 5:24 PM How many minutes are there between 9:04 AM and 5:32 PM? 508 How many minutes are there between 12:39 AM and 3:50 AM? 191 How many minutes are there between 10:24 AM and 7:42 PM? 558 What is 564 minutes after 7:42 AM? 5:06 PM How many minutes are there between 6:31 AM and 4:54 PM? 623 What is 432 minutes after 8:35 PM? 3:47 AM How many minutes are there between 6:09 PM and 2:43 AM? 514 What is 611 minutes before 5:44 PM? 7:33 AM How many minutes are there between 2:42 PM and 8:58 PM? 376 What is 295 minutes after 5:44 AM? 10:39 AM How many minutes are there between 11:21 AM and 6:30 PM? 429 What is 627 minutes after 12:22 PM? 10:49 PM How many minutes are there between 9:10 PM and 8:41 AM? 691 What is 667 minutes before 1:05 AM? 1:58 PM What is 323 minutes after 6:07 AM? 11:30 AM What is 535 minutes after 4:32 AM? 1:27 PM How many minutes are there between 7:21 PM and 9:16 PM? 115 What is 332 minutes before 6:42 AM? 1:10 AM What is 315 minutes after 11:43 PM? 4:58 AM What is 97 minutes after 5:59 PM? 7:36 PM What is 558 minutes after 11:51 PM? 9:09 AM How many minutes are there between 8:14 PM and 9:42 PM? 88 How many minutes are there between 4:17 PM and 4:06 AM? 709 What is 2 minutes after 3:50 AM? 3:52 AM How many minutes are there between 8:40 PM and 6:56 AM? 616 What is 481 minutes before 10:48 PM? 2:47 PM How many minutes are there between 3:56 AM and 4:56 AM? 60 What is 507 minutes before 12:43 PM? 4:16 AM How many minutes are there between 4:04 PM and 10:54 PM? 410 What is 502 minutes after 10:48 AM? 7:10 PM What is 270 minutes after 6:28 PM? 10:58 PM How many minutes are there between 4:41 PM and 4:14 AM? 693 How many minutes are there between 10:36 AM and 1:58 PM? 202 What is 597 minutes before 1:28 AM? 3:31 PM What is 270 minutes before 10:57 PM? 6:27 PM What is 185 minutes after 3:15 PM? 6:20 PM How many minutes are there between 2:47 AM and 3:14 AM? 27 What is 508 minutes before 8:08 PM? 11:40 AM How many minutes are there between 6:02 AM and 1:10 PM? 428 How many minutes are there between 1:16 AM and 3:55 AM? 159 What is 646 minutes after 3:51 PM? 2:37 AM How many minutes are there between 8:08 PM and 8:49 PM? 41 How many minutes are there between 7:40 PM and 6:47 AM? 667 What is 424 minutes before 2:46 PM? 7:42 AM How many minutes are there between 1:26 PM and 3:29 PM? 123 What is 321 minutes after 6:12 AM? 11:33 AM What is 327 minutes after 7:42 AM? 1:09 PM What is 706 minutes before 10:15 PM? 10:29 AM What is 496 minutes after 4:46 PM? 1:02 AM How many minutes are there between 1:08 AM and 3:48 AM? 160 How many minutes are there between 11:07 PM and 10:25 AM? 678 How many minutes are there between 3:35 PM and 12:44 AM? 549 What is 699 minutes after 10:46 PM? 10:25 AM How many minutes are there between 5:04 PM and 1:29 AM? 505 How many minutes are there between 8:53 AM and 10:22 AM? 89 What is 445 minutes before 6:39 AM? 11:14 PM How many minutes are there between 5:56 PM and 9:10 PM? 194 How many minutes are there between 9:48 AM and 7:05 PM? 557 What is 631 minutes before 6:01 AM? 7:30 PM What is 322 minutes after 3:49 PM? 9:11 PM What is 583 minutes after 7:43 PM? 5:26 AM How many minutes are there between 12:10 AM and 5:35 AM? 325 How many minutes are there between 12:39 AM and 4:08 AM? 209 How many minutes are there between 12:43 AM and 6:15 AM? 332 What is 535 minutes before 10:28 AM? 1:33 AM How many minutes are there between 2:25 AM and 10:33 AM? 488 How many minutes are there between 10:40 PM and 9:56 AM? 676 What is 355 minutes before 2:00 PM? 8:05 AM How many minutes are there between 9:07 AM and 1:33 PM? 266 What is 667 minutes after 9:44 PM? 8:51 AM What is 538 minutes after 5:20 AM? 2:18 PM How many minutes are there between 5:27 AM and 11:20 AM? 353 How many minutes are there between 10:45 AM and 1:50 PM? 185 How many minutes are there between 3:41 PM and 1:28 AM? 587 What is 391 minutes before 12:07 AM? 5:36 PM How many minutes are there between 8:30 PM and 12:56 AM? 266 What is 595 minutes after 2:41 AM? 12:36 PM How many minutes are there between 2:05 AM and 12:10 PM? 605 What is 90 minutes before 2:04 AM? 12:34 AM How many minutes are there between 4:54 PM and 6:22 PM? 88 How many minutes are there between 7:12 PM and 3:34 AM? 502 How many minutes are there between 12:59 AM and 3:54 AM? 175 What is 685 minutes before 11:04 AM? 11:39 PM What is 14 minutes before 3:47 PM? 3:33 PM What is 305 minutes before 1:55 AM? 8:50 PM What is 570 minutes before 2:17 PM? 4:47 AM How many minutes are there between 2:40 AM and 6:43 AM? 243 How many minutes are there between 10:18 AM and 2:21 PM? 243 What is 176 minutes before 5:51 AM? 2:55 AM How many minutes are there between 12:18 PM and 10:57 PM? 639 What is 405 minutes after 12:26 PM? 7:11 PM What is 572 minutes after 10:23 AM? 7:55 PM How many minutes are there between 6:43 PM and 2:33 AM? 470 What is 702 minutes before 5:07 PM? 5:25 AM What is 617 minutes before 7:23 AM? 9:06 PM What is 715 minutes before 1:10 AM? 1:15 PM How many minutes are there between 5:01 PM and 11:55 PM? 414 What is 423 minutes before 6:25 PM? 11:22 AM What is 678 minutes before 3:17 AM? 3:59 PM How many minutes are there between 9:36 AM and 3:00 PM? 324 What is 612 minutes before 9:16 AM? 11:04 PM How many minutes are there between 3:51 PM and 2:37 AM? 646 How many minutes are there between 8:15 AM and 4:28 PM? 493 How many minutes are there between 7:11 AM and 3:56 PM? 525 How many minutes are there between 4:56 PM and 5:55 PM? 59 What is 270 minutes before 8:45 AM? 4:15 AM How many minutes are there between 8:49 PM and 10:17 PM? 88 How many minutes are there between 6:07 AM and 7:43 AM? 96 What is 115 minutes after 11:27 PM? 1:22 AM What is 454 minutes after 3:30 AM? 11:04 AM How many minutes are there between 1:05 AM and 3:58 AM? 173 How many minutes are there between 6:15 PM and 6:04 AM? 709 What is 546 minutes before 7:53 PM? 10:47 AM How many minutes are there between 8:14 PM and 7:46 AM? 692 What is 672 minutes after 5:29 PM? 4:41 AM How many minutes are there between 2:56 PM and 12:16 AM? 560 How many minutes are there between 12:47 AM and 12:03 PM? 676 What is 663 minutes before 6:59 PM? 7:56 AM What is 708 minutes before 11:30 PM? 11:42 AM How many minutes are there between 8:57 PM and 1:11 AM? 254 What is 320 minutes after 7:06 PM? 12:26 AM How many minutes are there between 6:09 AM and 3:21 PM? 552 What is 327 minutes after 2:08 PM? 7:35 PM What is 252 minutes after 1:58 AM? 6:10 AM What is 204 minutes after 6:28 PM? 9:52 PM What is 585 minutes after 6:08 PM? 3:53 AM What is 137 minutes after 6:47 AM? 9:04 AM What is 628 minutes after 9:32 PM? 8:00 AM
Let s(u) = 5u2 + 6. Let v(f) = 10f*2 + 12. Suppose 10j = -15673 + 15633. Calculate jv(h) + 7s(h). -5h2 - 6 Let i(u) = 8u + 158 + 7u - 310 + 155. Let m(t) = -8t - 1. What is -6i(a) - 11m(a)? -2a - 7 Let t(o) = -2o + 5. Suppose 34 = 2w + 3i, -4w - 41i = -37i - 64. Let z(j) = -17 + w - 21 + 10j. What is -16t(c) - 3z(c)? 2c - 8 Let o(j) = 6567j + 430. Let g(c) = -c + 48. Give 9g(x) - o(x). -6576x + 2 Let u(h) = -1 - 2 + 1. Suppose -4t + 4k - 14 = -50, -3t = 4k + 8. Suppose 0j - 5 = -5o - tj, 2j = 0. Let m(b) = b. What is ou(g) - m(g)? -g - 2 Let m(o) = -4o - 6. Let i(s) = -5s - 7. Let y = -37 + 42. Suppose 3k - 86 = -2r, -yk + r + 2 = -124. Let p = 32 - k. What is pm(w) - 5i(w)? w - 1 Let u(v) = -1463v - 31. Let l(x) = 1462x + 47. Give -2l(b) - 3u(b). 1465b - 1 Let n(t) = -22t*2 + 3t + 311. Let m(c) = 31c2 - 4c - 465. Calculate 5m(d) + 7n(d). d*2 + d - 148 Let q(x) = 12x + 10. Let g(j) = 4j + 3. Let k(a) = -2a*2 - 7a + 16. Let z be k(2). Let c be (z - -9)(1 + -3). Calculate cq(n) + 20g(n). 8n Let q(c) = -c*3 + 28c*2 + 1. Let x(k) = 130k*3 - 111k*2 - 4. Determine -4q(a) - x(a). -126a3 - a2 Let u(w) be the second derivative of w5/20 - 5w4/12 - w3/3 - 7w2/2 - 244w - 10. Let y(k) = -k*3 + 4k*2 + k + 6. Determine -5u(j) - 6y(j). j3 + j2 + 4j - 1 Let g(s) = 94s3 - 39s*2 + 13s + 480. Let a(x) = 7x3 - 3x*2 + x + 37. Calculate -27a(f) + 2g(f). -f3 + 3f*2 - f - 39 Let n(j) = 17j + 4. Let x(m) = -1 + 4m + m - m - 7m + 4m. What is -n(p) - 6x(p)? -23p + 2 Let g = 123 + -116. Suppose y = -gy + 16. Suppose -yq + 0o - 3o = -12, -q + 2o = -6. Let a(v) = -v*3 + v. Let r(p) = 8p*3 - 3p + 1. Give qa(l) + r(l). 2l*3 + 3l + 1 Let f(c) = 22c3 - 1744c*2 - 15c - 15. Let s(q) = -11q3 + 870q*2 + 8q + 8. What is 8f(i) + 15s(i)? 11i3 - 902i*2 Suppose -3t - 23 = 4g, 9 = -3t + 16g - 13g. Let j(v) = -4v2. Let d(b) = b3 + b2. Give td(l) - j(l). -5l3 - l2 Let p(o) = o2 - o - 5. Let g be p(4). Let f = g - 1. Let t(i) = 2i - 19. Let l(c) = 809 - 428 - 372 + 4c - 5c. What is ft(n) + 13l(n)? -n + 3 Let s(d) = -324023d3 + 369d*2 + 738d + 369. Let t(g) = 1761g3 - 2g*2 - 4g - 2. Give 2s(l) + 369t(l). 1763l3 Let n(u) = -5600u + 4. Let t(c) = 5624c - 5. Give 5n(p) + 4t(p). -5504p Let a(c) = -5c - 1. Let s = 431 - -133. Let z = -568 + s. Let i(n) be the third derivative of -n4/24 - n3/6 + n2. What is zi(o) + a(o)? -o + 3 Let z(n) = 9n2 - 99n + 73. Let g(r) = -10r2 + 101r - 87. What is -5g(t) - 6z(t)? -4t2 + 89t - 3 Let p(u) = 238u2 - 17. Let s(c) = 68c*2 - 5. Suppose 314b + 631 = -4707. Give bs(i) + 5p(i). 34i2 Let w be ((-80)/60)/(-2 - 71/(-3)). Let q(x) = -2x + 12. Let s(l) = -2l + 13. Calculate wq(i) + 3s(i). 2i - 9 Let z(s) = 19s*2 - 11s + 9. Let w(j) = -36j2 + 19j - 17. Give 3w(c) + 5z(c). -13c2 + 2c - 6 Let v(x) be the third derivative of -x*6/5 - 5x4/24 - x3/2 + 8937x2. Let o(j) = -47j*3 - 9j - 5. What is 3o(t) - 5v(t)? -21t3 - 2t Let g(b) = -b + 771. Let q(h) = h + 8. Calculate -g(p) + 2q(p). 3p - 755 Let v(p) = p2 + p - p3 + 5p3 - 5p*3. Let s(h) = -h - 1. Let w(i) = 3i*2 + 6i + 2. Let g(d) = -4s(d) - w(d). What is -g(q) - 2v(q)? 2q3 + q2 - 2 Let y(c) = 36c*2. Let u = 872 + -566. Let w = 286 - u. Let d(b) = 5b*2. What is wd(a) + 3y(a)? 8a*2 Let w(x) be the first derivative of 3x*2/2 + 7x + 67. Let a(l) = -7. Let p(t) = -9. Let r(o) = 5a(o) - 4p(o). Calculate -5r(j) + w(j). 3j + 2 Let k(s) = -2s. Suppose -344618 = -16p + 96886. Let z(h) = ph + 2 - 27591h - 2. Let u(g) = -g + 9. Let i be u(5). Give iz(v) + 5k(v). 2v Let d(l) = 13897l. Let w(t) = -118139t. What is -42d(v) - 5w(v)? 7021v Let c(l) = 2l3 + 214l*2 - 6l + 6. Let t(d) = -d*3 - 216d*2 + 4d - 4. Determine -2c(o) - 3t(o). -o*3 + 220o2 Let s(u) = -u3 - u*2 - u. Let o(x) = 25x*2 + 25x. Let i be 5/20 + -4(-891)/144. Calculate is(c) + o(c). -25c3 Let y(r) = 3r*2 - 2r - 2. Let v = -32 - -50. Suppose -2q + 15 = -11. Let c(s) = -7 - 4 - 9s + qs2 + 1 + 1. Calculate vy(i) - 4c(i). 2i*2 Suppose -5x + 4l + 109 - 10 = 0, -l - 111 = -5x. Let p = 5 + x. Let b = -31 + p. Let g(d) = d*2 - 4d - 1. Let m(y) = -y*2 + 3y. What is bm(w) - 2g(w)? w*2 - w + 2 Let r(a) = 42a*3 - 234a*2 + 129a. Let l(t) = -14t3 + 78t*2 - 47t. What is -11l(b) - 4r(b)? -14b3 + 78b*2 + b Let n(g) = -152g*3 + 10g + 34. Let r(k) = 76k3 - 4k - 17. Determine -2n(b) - 5r(b). -76b3 + 17 Let p(u) = u2 - 4u + 4. Let z(m) = 323m - 314m - 2m2 + 576 - 585. Give 7p(k) + 3z(k). k2 - k + 1 Let n(z) = -z - 1. Let u(x) = -101x + 20. Let t(w) = -48w + 9. Let d(b) = 13t(b) - 6u(b). Give d(c) - 4n(c). -14c + 1 Let p(s) = 1639s*2. Let i(v) = -2248704v*2. Give -2i(x) - 2745p(x). -1647x*2 Let g(q) = -3523q*3 + 25q*2 + 10q. Let x(l) = -2485476l3 + 17640l*2 + 7056l. Determine -3528g(w) + 5x(w). 1764w3 Let g(a) = -751a*3 - 7a*2 + 10a + 31. Let v(m) = 1126m3 + 10m*2 - 14m - 46. What is -7g(u) - 5v(u)? -373u3 - u2 + 13 Let s(o) = -1. Let i be 42/(-8) - (-1)/4. Suppose 3w + 95 = 2d + 10, -w = -4d + 145. Let h(t) = -d + 75 - 37 + t. Determine is(p) - h(p). -p + 2 Let a(v) = -154v*2 + 5v + 1. Let l(z) = -170z2 + 6z + 1. Let p(s) = 10a(s) - 9l(s). Let y(m) = -21m2 - 9m + 2. What is -13p(b) + 6y(b)? 4b2 - 2b - 1 Let w(h) = -h - 2. Let u(l) = -3l2 + 5l - 124. What is -u(t) - 2w(t)? 3t*2 - 3t + 128 Let n(p) = -9p - 9. Let m = -8 - -1. Let d(l) = -8 - 7440776l + 3720386l + 3720381l. Determine md(k) + 6n(k). 9k + 2 Let y(d) = d2 - d + 1. Let k(s) = -5s + 2. Let i = -15 + 16. Suppose -5x + 2x - 177 = 3u, -3x - 165 = -3u. Let l = x + 55. Give ik(q) + ly(q). -2q*2 - 3q Let y(h) = -2h3 + 6h*2 + 7h + 8. Suppose 40454p - 288 = 40502p. Let r(t) = -3t3 + 7t*2 + 8t + 9. Determine pr(c) + 7y(c). 4c3 + c + 2 Let o(z) = -z3 + z2 - 189z - 2. Let q(f) = -f*3 + 2f*2 - 386f - 3. Determine 5o(r) - 3q(r). -2r3 - r2 + 213r - 1 Let o(m) = -m. Let t(s) = -1 + 2346s2 + 4s - 4701s2 + 2348s*2. What is 5o(x) + t(x)? -7x2 - x - 1 Let w(y) be the first derivative of -17y*2/2 - y + 267. Let l(g) = 33g + 2. What is 3l(b) + 5w(b)? 14b + 1 Let r(j) = -5j*2 - 795j - 20. Let s(i) = 6i2 + 798i + 26. Calculate -4r(a) - 3s(a). 2a2 + 786a + 2 Let y(b) = -4b + 3b + 4b2 + 6b*2 - 14b*2 + 3b*2. Let x(m) = 2m*2 + m. Determine -5x(g) - 5y(g). -5g2 Let g(v) = v2 - 5v + 9. Suppose -5196 + 79 = 204n + 527n. Let s(r) = r2 - 7r + 14. What is ng(j) + 5s(j)? -2j2 + 7 Let x(o) = o2 + 9o + 24. Let p be x(-8). Suppose -3m - 13m = p. Let r(a) = 1. Let z(y) = -3y - 3y + 5y + 12 - 3y. What is mz(k) + 12r(k)? 4k Let b(k) = 4k*3 - 4k*2 + 2k - 6. Let j(d) = -5d3 + 2d*2 - d + 3. Determine 2b(a) + 3j(a). -7a*3 - 2a*2 + a - 3 Let n(f) = 8f*2 + 5f + 5. Let w(s) be the second derivative of 2s2 + 2/3s*3 + 7/12s*4 - 30s + 0. Suppose 0t = -t + 5. Give tn(v) - 6w(v). -2v2 + v + 1 Let w(j) = -j3 + 10j2 - 23j - 5. Let p be w(4). Let c(d) = 0d + 0d - d. Let v(i) = 5i - 3. Determine pv(g) - 3c(g). -2g + 3 Let t(y) = 6y3 + y2 + y - 1. Let w(c) = -70c*3 - 15c*2 - 4c + 15. Calculate -30t(q) - 2w(q). -40q3 - 22q Let u(h) = -1 - 1694h2 + 1691h*2 - 9h - h + 3h. Let r(a) = 6a*2 + 13a + 2. Give 3r(s) + 5u(s). 3s2 + 4s + 1 Let b(z) = 8z2 - 4z + 4. Let p(i) = -i2 + i - 1. Let m(a) = a2 - 7a + 34. Let d be m(0). Suppose -22l + d = 56. Calculate lb(r) - 4p(r). -4r2 Let r(f) = -21f + 144. Let q(m) = 7m - 48. Determine -19q(z) - 6r(z). -7z + 48 Let j(v) = -49v2 + 101v + 3. Let c(u) = 59u2 - 96u - 4. Determine 5c(i) + 6j(i). i*2 + 126i - 2 Let z(w) = -6568w - 70. Let l(o) = -3o + 7. Determine 20l(f) + 2z(f). -13196f Let c(l) = -10l - 20. Let z(j) = 50j + 98. What is -16c(m) - 3z(m)? 10m + 26 Let n(j) = 3 + 1 - 4j + 0j + 1. Let b(g) be the third derivative of -11g4/24 + 5g*3/2 + 2g*2 + 36g + 12. Determine 6b(l) - 17n(l). 2l + 5 Let m(q) = -1. Let x(j) be the third derivative of j5/60 + 7j4/6 - j3/3 - 6j2. Let b be x(-28). Let w(o) = -6o + 2. Give bm(c) - w(c). 6c
What is the n'th term of 269090, 538191, 807320, 1076483, 1345686? n*3 + 8n*2 + 269070n + 11 What is the v'th term of 114005, 227577, 340715, 453419, 565689, 677525, 788927? -217v2 + 114223v - 1 What is the m'th term of 6014249, 6014251, 6014253, 6014255? 2m + 6014247 What is the j'th term of -547, -5421, -18669, -44479, -87039, -150537? -698j3 + j2 + 9j + 141 What is the d'th term of -154302, -617184, -1388640, -2468658, -3857226, -5554332? 2d*3 - 154299d*2 + d - 6 What is the h'th term of 12997511, 25995021, 38992531, 51990041? 12997510h + 1 What is the m'th term of 2259150, 4518306, 6777460, 9036612, 11295762, 13554910? -m*2 + 2259159m - 8 What is the r'th term of -529716756, -529716754, -529716752? 2r - 529716758 What is the t'th term of 609, 2385, 5349, 9501, 14841, 21369? 594t*2 - 6t + 21 What is the a'th term of 1039144, 4156600, 9352360, 16626424, 25978792, 37409464, 50918440? 1039152a2 - 8 What is the b'th term of 2523802, 2523800, 2523798? -2b + 2523804 What is the w'th term of -8286, -8658, -9030, -9402, -9774, -10146? -372w - 7914 What is the t'th term of -68899, -68507, -67839, -66883, -65627, -64059, -62167, -59939? 2t*3 + 126t2 - 69027 What is the v'th term of 781082, 1564000, 2346928, 3129872, 3912838, 4695832, 5478860? v3 - v*2 + 782914v - 1832 What is the o'th term of 28, 189, 336, 469? -7o2 + 182o - 147 What is the c'th term of -265125, -264971, -264819, -264669, -264521? -c*2 + 157c - 265281 What is the a'th term of 13393, 13125, 12839, 12535? -9a2 - 241a + 13643 What is the w'th term of -1854210, -1854260, -1854334, -1854426, -1854530? w*3 - 18w*2 - 3w - 1854190 What is the y'th term of 111553, 223201, 334849? 111648y - 95 What is the t'th term of -2054, 218, 2502, 4798, 7106? 6t*2 + 2254t - 4314 What is the k'th term of -5819, -9199, -12581, -15965, -19351, -22739? -k*2 - 3377k - 2441 What is the z'th term of -4482651, -4482652, -4482653? -z - 4482650 What is the w'th term of -1120, -2252, -3382, -4510, -5636, -6760, -7882? w*2 - 1135w + 14 What is the i'th term of -145765, -142896, -140027? 2869i - 148634 What is the p'th term of -19547479, -19547477, -19547475, -19547473? 2p - 19547481 What is the k'th term of 569, 741, 1019, 1397, 1869? -k*3 + 59k*2 + 2k + 509 What is the a'th term of -1947401, -1947403, -1947407, -1947413, -1947421, -1947431? -a*2 + a - 1947401 What is the c'th term of 27375, 27391, 27427, 27495, 27607? 2c*3 - 2c*2 + 8c + 27367 What is the r'th term of -70968, -141983, -212994, -284001, -355004? 2r2 - 71021r + 51 What is the i'th term of 134, -405, -1290, -2509, -4050, -5901? 2i3 - 185i*2 + 2i + 315 What is the h'th term of 88070950, 176141911, 264212872, 352283833, 440354794, 528425755? 88070961h - 11 What is the y'th term of 152571298, 152571296, 152571294, 152571292, 152571290? -2y + 152571300 What is the r'th term of -31857, -57159, -82461, -107763, -133065? -25302r - 6555 What is the x'th term of -5247635, -10495265, -15742895? -5247630x - 5 What is the w'th term of -1751824, -3503619, -5255414, -7007209? -1751795w - 29 What is the t'th term of 9309851, 18619702, 27929553, 37239404, 46549255, 55859106? 9309851t What is the j'th term of -85960, -343882, -773764, -1375606? -85980j2 + 18j + 2 What is the i'th term of 379323, 1517315, 3413967, 6069279, 9483251, 13655883, 18587175? 379330i2 + 2i - 9 What is the w'th term of 23572, 96140, 217708, 388276, 607844, 876412? 24500w2 - 932w + 4 What is the n'th term of 1460, 1338, 1010, 374, -672, -2230, -4402, -7290? -17n3 - n2 + 1478 What is the f'th term of 17616536, 17616537, 17616538, 17616539? f + 17616535 What is the f'th term of -51947108, -103894216, -155841324, -207788432, -259735540, -311682648? -51947108f What is the c'th term of 222452, 222452, 222456, 222458, 222452? -c*3 + 8c*2 - 17c + 222462 What is the s'th term of 5775, 45986, 155161, 367782, 718331? 5747s3 - 18s + 46 What is the d'th term of -13405, -14267, -15131, -15997, -16865, -17735? -d*2 - 859d - 12545 What is the z'th term of 1575, 2895, 3981, 4827, 5427? -z*3 - 111z*2 + 1660z + 27 What is the q'th term of 77392, 154314, 231238, 308164? q*2 + 76919q + 472 What is the j'th term of -46161848, -46161841, -46161834? 7j - 46161855 What is the g'th term of -34001, -67758, -101515? -33757g - 244 What is the o'th term of 968050, 968058, 968070, 968086, 968106, 968130, 968158? 2o2 + 2o + 968046 What is the d'th term of 40602, 172461, 392226, 699897? 43953d2 - 3351 What is the b'th term of 56600, 56837, 57074, 57311, 57548, 57785? 237b + 56363 What is the i'th term of -3633, -3624, -3653, -3732, -3873? -2i3 - 7i*2 + 44i - 3668 What is the z'th term of 2599, 20813, 70241, 166477, 325115, 561749? 2599z3 + 13z*2 - 18z + 5 What is the f'th term of -7215369, -14430744, -21646117, -28861488, -36076857, -43292224? f*2 - 7215378f + 8 What is the g'th term of 503, 5330, 14475, 27938, 45719, 67818, 94235? 2159g2 - 1650g - 6 What is the h'th term of 13453, 26837, 40149, 53389, 66557? -36h2 + 13492h - 3 What is the g'th term of 5246, 7204, 9162? 1958g + 3288 What is the g'th term of -16443, -21465, -26487, -31509? -5022g - 11421 What is the u'th term of -44243, -354085, -1195073, -2832779, -5532775, -9560633, -15181925? -44262u3 - u2 - 5u + 25 What is the y'th term of -230, 476, 1642, 3268, 5354? 230y2 + 16y - 476 What is the q'th term of -107946, -432803, -974568, -1733241, -2708822? -108454q2 + 505q + 3 What is the u'th term of 47015600, 47015602, 47015604, 47015606, 47015608? 2u + 47015598 What is the u'th term of -10571609, -21143209, -31714811, -42286415, -52858021? -u2 - 10571597u - 11 What is the d'th term of 35109077, 70218163, 105327249, 140436335? 35109086d - 9 What is the k'th term of 4050, 16004, 35970, 63954, 99962, 144000? k3 + 4000k*2 - 53k + 102 What is the s'th term of 107, -1739, -6499, -15631, -30593, -52843? -243s3 + s2 - 148s + 497 What is the h'th term of -8367, -66210, -223217, -528972, -1033059, -1785062, -2834565, -4231152? -8264h3 + 2h*2 - h - 104 What is the o'th term of -30091, -120489, -271155, -482089, -753291, -1084761, -1476499? -30134o*2 + 4o + 39 What is the p'th term of 21861892, 21861894, 21861896, 21861898, 21861900, 21861902? 2p + 21861890 What is the f'th term of 10124279, 10124281, 10124283, 10124285? 2f + 10124277 What is the l'th term of -14016840, -14016842, -14016844? -2l - 14016838 What is the q'th term of -8978, -35288, -79136, -140522, -219446, -315908? -8769q*2 - 3q - 206 What is the y'th term of 4589460, 4589499, 4589564, 4589655, 4589772, 4589915? 13y2 + 4589447 What is the f'th term of 1052500, 1052505, 1052522, 1052557, 1052616, 1052705, 1052830? f3 - 2f + 1052501 What is the p'th term of 1097252, 2194511, 3291770, 4389029, 5486288? 1097259p - 7 What is the k'th term of -20585, -82355, -185313, -329459? -20594k*2 + 12k - 3 What is the t'th term of -93677, -749493, -2529563, -5996015, -11710977, -20236577? -93688t3 + t2 - 3t + 13 What is the z'th term of -35957, -143836, -323641, -575378, -899053, -1294672, -1762241? -z*3 - 35957z*2 - z + 2 What is the p'th term of 219, 466, 459, -84, -1445, -3906, -7749? -47p*3 + 155p*2 + 111p What is the z'th term of -17555, -17654, -17753, -17852, -17951? -99z - 17456 What is the g'th term of -451, -5661, -10871, -16081? -5210g + 4759 What is the a'th term of -280369055, -280369052, -280369049? 3a - 280369058 What is the u'th term of 495141, 990603, 1486065, 1981527, 2476989? 495462u - 321 What is the h'th term of 15654, 15717, 15764, 15795, 15810, 15809, 15792? -8h2 + 87h + 15575 What is the m'th term of 837026, 837000, 836974, 836948, 836922? -26m + 837052 What is the s'th term of -43704, -171755, -385174, -683961? -42684s*2 + s - 1021 What is the l'th term of 128452, 128464, 128476? 12l + 128440 What is the b'th term of 77955298, 155910601, 233865904, 311821207, 389776510, 467731813? 77955303b - 5 What is the l'th term of 144322, 288200, 432078, 575956, 719834, 863712? 143878l + 444 What is the b'th term of -214685, -429306, -643927, -858548, -1073169, -1287790? -214621b - 64 What is the w'th term of -763, 4277, 17927, 44483, 88241? 716w*3 + 9w*2 + w - 1489 What is the z'th term of -56170, -112137, -167968, -223663, -279222, -334645, -389932? 68z*2 - 56171z - 67
Let s(q) be the second derivative of q8/6720 - q7/315 - q6/144 + q5/40 + 23q4/6 + 253q. Let p(d) be the third derivative of s(d). Calculate p(8). -37 Let l(z) = z*3 + 11z*2 - 11z + 13. Suppose -2g - 5 = 35. Let w = -32 - g. Give l(w). 1 Let b(k) = 5k + 5k - 9k + 23 + 25k + 2k*2. Calculate b(-13). 23 Suppose -34l + 1143 = 1109. Let v(b) = 5b2 - b + 1 - 6b*2 + 0b. Let w(f) = -6f2 - 4f + 8. Let d(m) = lw(m) - 5v(m). Calculate d(0). 3 Let i(l) = -2l + 61. Suppose -604r = -4o - 605r + 118, -o - 4r + 52 = 0. Determine i(o). 5 Suppose -5t = -5b - 10, 28 = 4b + 6t - t. Let c(p) = 1 + 5p*b + 3p3 + p3 - 6p3 - 2p. Calculate c(3). -14 Suppose -9x - t = -4x - 15, 3t = 8x - 24. Let n(b) = -b*2 + b - 4. Calculate n(x). -10 Suppose v - 4x = 18, x - 10 = 3x. Let n be (-4)/20 - -9v/10. Let d be (0/(-2))/(-3 - -2 - n). Let m(q) = q*3 - q - 18. Calculate m(d). -18 Let m(w) = -36w - 190. Let c(h) = -16h - 93. Let z(d) = -7c(d) + 3m(d). Calculate z(0). 81 Let i = -63 + 63. Suppose 0 = 5a - 5o + 20, ia = -3a + 5o - 22. Let g(x) = -1 - 2x + 1 - a - 7. What is g(8)? -24 Let k(o) = -44o3 + o2 + o - 1. Suppose 24 = 9z + 15z. What is k(z)? -43 Let d(v) be the third derivative of -1/120v6 + 53v*2 + 0 - 1/6v*3 - 1/12v*5 + 0v + 7/24v4. Determine d(-6). -7 Suppose u = 2q + 1, 4q - 4 = -12. Let i be 50/15 + (-4)/3. Let w(z) = -zi + 4z*2 - 3z2 + z2. What is w(u)? 9 Let i(b) = b*2 + 2b - 28. Let y be i(-6). Suppose -6 = g - 3g. Let z(q) = 0q - 6q - 6 + 2q + gq. Calculate z(y). -2 Let w(m) be the second derivative of -m5/4 - m4/12 + 2m*3/3 + 5m*2/2 - 37m - 4. What is w(-2)? 33 Let k(p) = -p*2 + 37p + 2529. Let b be k(72). Let j(f) = f*3 - 8f*2 - 8f + 2. Give j(b). 11 Let g(h) = 5h + 2h*3 + 8 + 2h*2 + 28h*2 - 4h*3 - 18h*2. Calculate g(6). 38 Let h = -6 + 8. Suppose 3o + hn = -2n - 1, 5o + n = 4. Let p(r) be the third derivative of r6/40 + 63r2. What is p(o)? 3 Let r(w) be the second derivative of w3/6 - 3w2/2 + 4w + 17. Suppose -15a = 4a - 24a. Give r(a). -3 Let j(q) be the third derivative of q5/20 + 5q*4/24 - 8q*3/3 - 71q*2 + 5. What is j(2)? 6 Suppose 7q + 849 = 870. Let o(t) = -3t - 29 + 32 - t3 + 6t2 - t2. What is o(q)? 12 Suppose 0 = 11487c - 11504c - 102. Let i(z) = 14z + 7. What is i(c)? -77 Let m(s) be the first derivative of s4/2 + 8s*3/3 + 5s*2/2 - 3s - 6440. Give m(-2). 3 Let j be 270/(-12)((-15)/9 + 1). Let a be 1 + j/(-5) - -6. Let n(r) = 15r - ar + r2 - 9r + 4 - 2r2. Determine n(5). -11 Let t be (5 + (-91)/21)/((-2)/(-9)). Suppose 39 = -ta + 45. Let x(o) = 0o3 - 4o2 - o + 5 - o3 + 4oa + 4o*2. Give x(4). 1 Suppose 3z - 4k = 8, 11 = z + 4k + 35. Let s(b) be the third derivative of -b6/120 - b5/20 + b4/8 - b2. Determine s(z). 4 Let r(c) = c*2 + 18c + 29. Let p be r(-16). Let b(k) = 2k2 - 9k + 37. Let m be b(4). Let x(g) = 76g + 1 - mg - 40g. Determine x(p). -8 Let s(n) = -34n + 10748 + 29n - 10759. Calculate s(-10). 39 Let u(k) = -k3 - 10k*2 - 7k + 6. Let d(x) = x*2 + 2x. Let v(c) = -5d(c) - u(c). Let a be v(-5). Let r(m) = m2 - 10m - 10. Calculate r(a). -19 Let w(h) be the third derivative of -39h2 - 1/3h*3 - 1 + 0h - 1/20h5 + 1/6h*4. Give w(1). -1 Suppose 5u = -0x - 4x - 11, -2x - 12 = -4u. Let v be (-3 + 4)u46. Let q = 40 - v. Let r(s) = -s*2 - 7s + 6. What is r(q)? 12 Suppose -o - 24 = -77. Let s = 46 - o. Let g(b) be the second derivative of b*3/3 + 4b*2 - 21b. What is g(s)? -6 Let y(d) = -2d3 + 3d2 - 3. Let q(m) = -m3 + 3m2 - m - 3. Let u(a) = 3q(a) - 2y(a). Let c = 369930 - 369933. What is u(c)? 6 Let n(q) = q3 + 4q2. Let t be n(-4). Let a(y) = -y2 + 25y - 82. Let g be a(21). Let p(f) = -gf + tf + f - 7 + 1. Determine p(-6). 0 Let b = 9059 + -9064. Let j(w) = -36w - 171. Determine j(b). 9 Let p(z) = 60 + 407 - 2z - 5z - 6z - 6z. What is p(25)? -8 Suppose -4z + 258 + 210 = v, z - 4v = 100. Let w(h) = -3 + 8h - 117h*2 + zh*2 + 3. Give w(7). 7 Let k(v) = 18v*2 - 151v + 259. Let s be k(6). Let r(l) = -l + 0 + 4 + 0l. Give r(s). 3 Let c be 1(-1 - 0)-5. Let g be -6 + 4 + 1(4 + -3). Let d(u) = 11u - 6. Let m(o) = -2o. Let y(l) = gd(l) - 6m(l). What is y(c)? 11 Let i(c) = -4500 + 2244 + 0c2 + 2c*2 + 2246 + 14c. Determine i(-8). 6 Let t(c) = -c*3 + 2c*2 - 4c + 8. Let s = -1 + 4. Determine t(s). -13 Let c = 3051 + -3041. Let k(o) = 5o + 7. Give k(c). 57 Let j(p) be the third derivative of p5/60 + p4/24 - 7p*3/6 + 20p2. Let q(f) = f3 - f*2 - f - 25. Let u be q(0). Let d = -30 - u. Calculate j(d). 13 Let j be (1/3)/(4/2404). Let v(o) = 6o + 1 + 200o*2 - 206o*2 + 10o*3 - 9o*3. Calculate v(j). 6 Let x(y) = 2y*2 + 6y - 7. Let w(p) = 5p + 28. Let c be w(-9). Let v(i) = i2 + 16i - 23. Let t be v(c). What is x(t)? 29 Let y(x) be the first derivative of -7x2/2 - 18x + 3331. Determine y(-9). 45 Suppose 33x + 2380 + 2108 = 0. Let c = x + 150. Let q(p) = -p + 11. Determine q(c). -3 Let t(n) = 4n - 1. Let a(q) = 8q - 2. Let b(k) = -3a(k) + 5t(k). Suppose 173p - 176p = -2m - 4, 4m = 5p - 8. Give b(m). 9 Let b(j) = j*3 - 4j*2 + 2j + 3. Let s be 3842/68 - 1/(-2). Suppose 62z = sz + 15. Give b(z). 0 Let w = -29267 - -29269. Let h(f) be the first derivative of -f*2 + wf - 2/3f3 - 1/4f4 + 6. Give h(-2). 6 Let j(q) = -q + q3 + 9787q2 - 7 - 9788q*2 - 3. Let f(m) = -4m - 3. Let u be f(-5). Let l be u + -14 - (2 - -1). Calculate j(l). -10 Let k(z) = z*3 - 44z + 2z + 9z*2 - 5z + 2 - 11z + 7z. What is k(-13)? -11 Let z(a) = a*2 - 5a - 1. Suppose -8h + 1477 = -123. Let c = -195 + h. What is z(c)? -1 Let r(s) = -s2 + 10s + 46. Let t(g) = 3g2 + 63g - 1331. Let u be t(-34). Give r(u). -29 Let i(k) be the first derivative of -12 + k + 1/4k4 + 1/2k*2 - 1/3k*3. Let a(q) = 4q*3 - 9q*2 + 6q - 4. Let z(b) = -a(b) + 3i(b). Determine z(6). -11 Let n(p) = 2p*2 + 3p + 1. Let w(q) = -9q2 - 30q + 2. Let j(l) = -4n(l) - w(l). Calculate j(-17). -23 Let y be -10 + 10 + (-2 - -5). Suppose 9 = -yj - 2q + q, -j + 2q = -4. Let b(g) = 1 + 2g2 + 2g + g - 1. Determine b(j). 2 Let h(j) = -9j3 - 42j*2 + 40j - 18. Let m(a) = -4a3 - 20a*2 + 19a - 8. Let r(i) = 5h(i) - 11m(i). Give r(9). -2 Let b(f) be the third derivative of -f6/720 + f5/15 - 23f4/4 - 113f*2. Let k(h) be the second derivative of b(h). Determine k(3). 5 Let s(v) = -5v*2 + 3v + 5. Let b(l) = -4l2 + 4l + 5. Let h(m) = 4b(m) - 3s(m). Suppose -7k + 8k - 16 = 4j, -3k = -2j - 28. What is h(k)? -3 Let w = -188 - -781. Let i(g) = 8 - 307g + wg - 293g. Determine i(3). -13 Let f(b) = 12 + 21 + 11b - 43 + 17. Let v(z) = -48z - 30. Let r(q) = 9f(q) + 2v(q). What is r(3)? 12 Let s(r) = 10r + 405401r*2 - 405402r*2 - 3r + 1 + 0r. Calculate s(9). -17 Let m(o) be the second derivative of o5/20 + 4o*4/3 + 17o*3/6 + 29o*2/2 + 105o + 6. What is m(-15)? -1 Let k(x) = 5x3 + 11x*2 - 21x + 24. Let y(a) = -a*3 - 3a*2 + 5a - 6. Let q(i) = 2k(i) + 9y(i). Let m = -33 - -30. Let g = m - -8. What is q(g)? 9 Let f(z) = -1. Let v(b) = -6b - 42. Let u(i) = 5f(i) + v(i). Let n be u(-8). Let g be (6/4)/((-1)/(-3 + n)). Let t(d) = 5d + 4. Calculate t(g). 19 Let o(x) = x + 5. Let s be o(-5). Let c(h) = s - 9 - h - 9. Let m = 693188 + -693196. What is c(m)? -10 Suppose 4q = -2n - 2n + 12, 0 = n - 1. Let l(d) = -12dq + 2d + 7d2 - 18 - 12d2 + 17. Let y(g) = -g - 7. Let t be y(-8). What is l(t)? -16 Let z(o) be the first derivative of -o2/2 - 39o + 143. Calculate z(-30). -9 Let z(w) = w3 - 27w*2 + 25w + 31. Suppose 6a - 24 = 132. Let d be z(a). Suppose -g + 6g + 3v + 19 = 0, dv = 10. Let y(b) = -b - 10. Give y(g). -5 Suppose -56h - 36 = -59h. Suppose -9 - 39 = -hk. Let s(l) = 3l - 2. Give s(k). 10 Let m(p) = p + 1. Let w(n) = -n*3 + 5n*2 - n - 5. Let t be w(-4). Suppose t - 122 = -3j. Give m(j). -6 Let l = 4928 + -295673/60. Let y(o) be the third derivative of -1/6o3 - 19o*2 - 1/12o*4 + lo*5 + 0o + 0. What is y(-1)? 8 Let t(c) be the second derivative of c*4/12 - 7c*3/3 - 39c*2/2 + 1779c + 1. Give t(17). 12 Let x(p) = p*2 - 1. Suppose -137s + 134 + 140 = 0. What is x(s)? 3 Let w(s) = -s*2 - 25s - 117. Let i = 7868 + -7887. Determine w(i). -3
Calculate the remainder when 19527108 is divided by 4881771. 24 Calculate the remainder when 3346302 is divided by 876. 858 Calculate the remainder when 585974 is divided by 214. 42 What is the remainder when 302171 is divided by 59618? 4081 What is the remainder when 22246 is divided by 1278? 520 What is the remainder when 7854068 is divided by 295? 283 Calculate the remainder when 1142127 is divided by 239. 185 Calculate the remainder when 16289 is divided by 414. 143 Calculate the remainder when 1103010 is divided by 2991. 2322 What is the remainder when 195954 is divided by 459? 420 What is the remainder when 236469059 is divided by 19? 18 What is the remainder when 86668 is divided by 170? 138 Calculate the remainder when 254222 is divided by 3737. 106 Calculate the remainder when 11961410 is divided by 1113. 1112 Calculate the remainder when 69777 is divided by 34372. 1033 Calculate the remainder when 15817846 is divided by 493. 434 What is the remainder when 92683 is divided by 671? 85 What is the remainder when 1165147 is divided by 388377? 16 Calculate the remainder when 20629248 is divided by 92. 88 Calculate the remainder when 39480148 is divided by 22483. 0 Calculate the remainder when 3696817 is divided by 142. 131 Calculate the remainder when 164184581 is divided by 1172747. 1 What is the remainder when 913148 is divided by 368? 140 Calculate the remainder when 268072 is divided by 29761. 223 Calculate the remainder when 5077133 is divided by 2307. 1733 Calculate the remainder when 200599 is divided by 22283. 52 Calculate the remainder when 1177284 is divided by 1053. 30 What is the remainder when 34599230 is divided by 79? 74 Calculate the remainder when 2600117827 is divided by 12628. 12627 Calculate the remainder when 51467346 is divided by 10293469. 1 Calculate the remainder when 425394 is divided by 206. 4 Calculate the remainder when 2023398 is divided by 1434. 24 Calculate the remainder when 21867627 is divided by 1002. 981 Calculate the remainder when 620150 is divided by 250. 150 Calculate the remainder when 15285527 is divided by 71763. 8 Calculate the remainder when 10903 is divided by 44. 35 Calculate the remainder when 1751223 is divided by 1059. 696 What is the remainder when 607146 is divided by 202350? 96 What is the remainder when 258843 is divided by 86276? 15 Calculate the remainder when 52022015 is divided by 9. 8 What is the remainder when 16055233 is divided by 144639? 304 What is the remainder when 6243456 is divided by 1856? 1728 What is the remainder when 77417182 is divided by 518? 10 What is the remainder when 8527020 is divided by 147017? 34 Calculate the remainder when 679938 is divided by 396. 6 Calculate the remainder when 4558095 is divided by 647. 627 What is the remainder when 2061624 is divided by 527? 0 Calculate the remainder when 169681132 is divided by 199. 1 What is the remainder when 10108271 is divided by 1698? 77 Calculate the remainder when 86515048 is divided by 1363. 1349 Calculate the remainder when 570074 is divided by 3169. 2823 What is the remainder when 14586984 is divided by 14586983? 1 Calculate the remainder when 2001705 is divided by 333613. 27 Calculate the remainder when 2555254 is divided by 1277625. 4 What is the remainder when 72417 is divided by 6133? 4954 Calculate the remainder when 508936 is divided by 254440. 56 Calculate the remainder when 316340 is divided by 703. 693 Calculate the remainder when 3155502 is divided by 55353. 381 What is the remainder when 11378146 is divided by 124? 30 Calculate the remainder when 882156 is divided by 2471. 9 What is the remainder when 119433 is divided by 474? 459 What is the remainder when 43799804 is divided by 4264? 4260 What is the remainder when 377990 is divided by 609? 410 Calculate the remainder when 1943903 is divided by 1772. 19 What is the remainder when 548765 is divided by 129? 128 What is the remainder when 859266 is divided by 171? 162 What is the remainder when 32831 is divided by 31477? 1354 Calculate the remainder when 50155 is divided by 2968. 2667 Calculate the remainder when 233149 is divided by 3638. 317 What is the remainder when 326044885 is divided by 2484? 13 What is the remainder when 12952 is divided by 2526? 322 What is the remainder when 48023031 is divided by 193? 192 What is the remainder when 103473334 is divided by 25868332? 6 Calculate the remainder when 33650 is divided by 213. 209 What is the remainder when 131381 is divided by 11082? 9479 Calculate the remainder when 7664073 is divided by 418. 43 Calculate the remainder when 119037 is divided by 3217. 8 What is the remainder when 22620 is divided by 22137? 483 Calculate the remainder when 158884333 is divided by 28. 13 What is the remainder when 560504 is divided by 6516? 128 What is the remainder when 63444903 is divided by 88983? 24 What is the remainder when 499671 is divided by 286? 29 Calculate the remainder when 5558412 is divided by 193. 12 What is the remainder when 68871 is divided by 68323? 548 What is the remainder when 48002125 is divided by 24001059? 7 Calculate the remainder when 9159143 is divided by 3188. 19 Calculate the remainder when 21017 is divided by 21005. 12 Calculate the remainder when 265608626 is divided by 7266. 7262 What is the remainder when 56103187 is divided by 11220636? 7 What is the remainder when 13199890 is divided by 40? 10 What is the remainder when 492266 is divided by 123060? 26 What is the remainder when 1332154 is divided by 5597? 68 What is the remainder when 2452305 is divided by 8229? 63 Calculate the remainder when 27176523 is divided by 9058831. 30 What is the remainder when 100033258 is divided by 249? 247 Calculate the remainder when 6941943 is divided by 4631. 74 What is the remainder when 28375 is divided by 1596? 1243 Calculate the remainder when 262186 is divided by 125730. 10726 What is the remainder when 310352 is divided by 15514? 72 Calculate the remainder when 6698029 is divided by 262. 261 Calculate the remainder when 533093 is divided by 44422. 29 What is the remainder when 441096 is divided by 146867? 495 Calculate the remainder when 31657508 is divided by 177. 173 Calculate the remainder when 106283 is divided by 2701. 944 What is the remainder when 1667595 is divided by 6155? 5745 What is the remainder when 7101301 is divided by 1653? 13 Calculate the remainder when 26786435 is divided by 480. 35 Calculate the remainder when 3605798 is divided by 2611. 7 Calculate the remainder when 52082 is divided by 8263. 2504 Calculate the remainder when 142933027 is divided by 1548. 1543 What is the remainder when 78564 is divided by 68? 24 Calculate the remainder when 969267 is divided by 8439. 7221 Calculate the remainder when 165140 is divided by 906. 248 Calculate the remainder when 233958 is divided by 85. 38 Calculate the remainder when 12922 is divided by 387. 151 What is the remainder when 446530 is divided by 20214? 1822 Calculate the remainder when 18795 is divided by 2295. 435 What is the remainder when 52205527 is divided by 26? 23 What is the remainder when 88202333 is divided by 25492? 13 What is the remainder when 29902848 is divided by 2491904? 0 What is the remainder when 7576646 is divided by 678? 674 Calculate the remainder when 5382984 is divided by 897153. 66 Calculate the remainder when 25441 is divided by 3078. 817 What is the remainder when 7276867 is divided by 1569? 1414 Calculate the remainder when 23398 is divided by 903. 823 Calculate the remainder when 42136206 is divided by 3060. 6 Calculate the remainder when 12941303 is divided by 11042. 79 What is the remainder when 2202012 is divided by 20? 12 What is the remainder when 297779 is divided by 4652? 51 Calculate the remainder when 14594 is divided by 908. 66 Calculate the remainder when 480664642 is divided by 3683. 3678 Calculate the remainder when 316394 is divided by 396. 386 What is the remainder when 1268515 is divided by 184? 19 What is the remainder when 14974823 is divided by 13067? 41 Calculate the remainder when 90683 is divided by 8125. 1308 Calculate the remainder when 301184 is divided by 1508. 1092 What is the remainder when 15084957 is divided by 88? 85 What is the remainder when 13281924 is divided by 2628? 12 Calculate the remainder when 139164 is divided by 46378. 30 Calculate the remainder when 81747845 is divided by 11. 3 Calculate the remainder when 1366728 is divided by 3092. 64 Calculate the remainder when 268774 is divided by 9. 7 What is the remainder when 84715504 is divided by 158? 12
Let z be (-123999)/5 - ((-77)/(-35) - 2). What is z rounded to the nearest one thousand? -25000 Let l = -133105.99928 - -133115. Let h = l - 9. Round h to 4 dps. 0.0007 Let u = -61 + 61.00039. Round u to four decimal places. 0.0004 Let b = -10.91 - -11. Let q = b - -0.11. Round q to the nearest integer. 0 Let u = 62 + -62.0184. What is u rounded to 3 decimal places? -0.018 Let d(r) = 13500r2 - r - 2. Let q be d(-2). What is q rounded to the nearest ten thousand? 50000 Let b(j) = j3 + 2j*2 - 3j - 3. Let z be b(-3). Let v(n) = 2 + 1 - 4n + 7n*2 - 6. Let a be v(z). Round a to the nearest ten. 70 Let v(j) = 3j*2 - 1. Let z be v(2). Suppose z = m - 3y, -2y + 0y - 14 = -4m. Suppose 3h - mh = 410. Round h to the nearest 100. 400 Let g = 6 + -43. Let p = g - -35.45. Let k = p + 2. Round k to 1 dp. 0.5 Let g = -8.3 - -8. Let x = g - -0.7. Let f = 0.425 - x. Round f to 2 dps. 0.03 Let w(l) = -l3 + 14l*2 - 14l + 17. Let k be w(13). Suppose -kd - 3158 = 1962. Round d to the nearest one hundred. -1300 Let k = -192 + -66. Let u = -182 - k. Let c = u + -75.969. Round c to 2 decimal places. 0.03 Let w = -0.48 - -1.72. Round w to one dp. 1.2 Let r(o) = -639o*3 - 5o*2 + 2o - 10. Let p be r(5). Round p to the nearest 100000. -100000 Let b = 9 + -2. Suppose 2y = by + 49000000. What is y rounded to the nearest one million? -10000000 Suppose 3 = 5l - 7. Suppose 6106 = lr - 3s, 0 = r + 2s - 560 - 2486. Let t be (40/(-2))/((-1)/r). What is t rounded to the nearest ten thousand? 60000 Let m = -8382.09998 - -8382. Let b = -0.1 + 0. Let l = m - b. What is l rounded to four dps? 0 Let w be (-4)/(-22) + (-20)/(-11). Suppose 5v = -a - 13, v + w = -1. Suppose 0m + as - 17599990 = 2m, 2s + 17600010 = -2m. Round m to the nearest 1000000. -9000000 Let x = 0.02 + -0.12. Let i = 0.10000032 + x. What is i rounded to seven decimal places? 0.0000003 Suppose -4w - 7074 - 7046 = 0. Round w to the nearest 100. -3500 Let t = -58.61 + -1.39. Let a = 36409.5464 - 36349.54639918. Let j = a + t. What is j rounded to 7 dps? 0.0000008 Let i = 45 - 94. Let r = -49.000082 - i. What is r rounded to 5 dps? -0.00008 Let f = 119.000000113 + -119. Round f to seven decimal places. 0.0000001 Suppose 30 = -6j + j. Let f be 3797997/18 - 1/j. What is f rounded to the nearest 10000? 210000 Suppose 4q + q = 58060. Let x = q - 56279. Let b = x - -104667. What is b rounded to the nearest 100000? 100000 Let u = 7 - -4. What is u rounded to 0 decimal places? 11 Let r = -2.05 + 0.05. Let v = -549.965 - -552. Let w = r + v. What is w rounded to 2 dps? 0.04 Let f = -378 - -238. Let z = -139.937 - f. Round z to 2 dps. 0.06 Let p = -1.999988 - -2. Round p to six decimal places. 0.000012 Let i = -2007.6266518649 + -0.0333581351. Let q = i - -2003.66. Let a = q + 4. Round a to six decimal places. -0.00001 Let i = -9.16 - -0.16. Let m = i + 7. Let b = m + 2.0000072. What is b rounded to 6 dps? 0.000007 Let t(v) = 12v*3 + 10v*2 - v + 5. Let q be t(7). Let j be (-5)/15 + (-32378)/(-6). Let k = q + j. Round k to the nearest ten thousand. 10000 Let a = -7 - -7.032. Round a to 2 dps. 0.03 Let y = -0.02 - 3.98. Let u = y + 4.00004. Round u to 4 decimal places. 0 Let q be 0 - (-2 + 1) - -2. Suppose 0 = -qx - 0m - 2m + 6, -4x = 4m - 8. Let y be 6924/(-21) + x/(-7). Round y to the nearest one hundred. -300 Let d = -0.48 - 0.02. Let a = 0.4992 + d. Round a to 4 dps. -0.0008 Let d(j) = -297j2 + 4j + 5. Suppose 5i = -g - 4g + 45, 2i = -4g + 26. Let y be d(i). Round y to the nearest one thousand. -7000 Let b = -0.78 - -0.26. What is b rounded to one dp? -0.5 Let c be (-211199)/4 + 19/(-76). What is c rounded to the nearest one thousand? -53000 Let x = -0.04 - -0.0461. Round x to 3 dps. 0.006 Let s = 0.51 - 0.51000027. Round s to 7 dps. -0.0000003 Let l = -6.13076704 - -0.13082004. Let z = l - -6. What is z rounded to 5 dps? 0.00005 Let a(r) = -r*3 + 6r*2 + 4. Let c be a(6). Let n = -1 + c. Suppose 0 = 5j + 4l - 125, 4j - 60 = nl + 71. What is j rounded to the nearest ten? 30 Let p = -15 - -9. Let l = 6 + p. Let i(y) = y3 + y - 8700000. Let f be i(l). Round f to the nearest 1000000. -9000000 Suppose 0d = -d - 2j - 4808, -d = -3j + 4788. What is d rounded to the nearest 1000? -5000 Let z = -18 + 6. Let g = z - -11.858. Round g to two dps. -0.14 Let t = 0.55352 - 0.587. Let k = 0.0394729 + t. Let f = 0.006 - k. Round f to 6 decimal places. 0.000007 Let p = -0.08292 + 0.082. What is p rounded to 4 dps? -0.0009 Let v = 12150 + -12150.07211. Let h = 1.07213 + v. Let q = h + -1. What is q rounded to 5 dps? 0.00002 Let y = -0.1 - 0.5. Let a = y + 0.76. What is a rounded to 1 dp? 0.2 Let i = -16 - -11.5. Let v = i + 5. Let n = v + -0.499989. What is n rounded to 5 dps? 0.00001 Suppose 0 = 4h + 7 + 5. Let n(i) = 0i*3 - 3i*3 - 2i + i*2 - 10i*3 + 4. Let b be n(h). Round b to the nearest 100. 400 Let h = -20156855.4 + 20189991.970057. Let d = h - 33147.17. Let v = d + 10.6. Round v to 5 decimal places. 0.00006 Let k(g) = 6g2 - g2 + 5g + g - 6 + 0g. Let a be k(-6). What is a rounded to the nearest ten? 140 Let n = -111 + 106.56. Round n to one decimal place. -4.4 Let z = -0.252 + 1.682. What is z rounded to one dp? 1.4 Let z = 0.0939 - 0.082. What is z rounded to three decimal places? 0.012 Suppose 0 = -7h + 85040761 - 414040761. What is h rounded to the nearest 1000000? -47000000 Let m = 0.0787 + 2.8333. Let g = -3 + m. What is g rounded to two dps? -0.09 Let d = -263 + 259.54. Let i = d - -2.9. What is i rounded to one decimal place? -0.6 Let m = -393.48 - -371.571. Let t = m - -22. Round t to two decimal places. 0.09 Let j = -12 + 1. Let o = j - -11.0002. What is o rounded to four decimal places? 0.0002 Let x = 9.9 - 10. Let j = x + 0.84. What is j rounded to 1 dp? 0.7 Let f = -9.00001 + 9. What is f rounded to five decimal places? -0.00001 Let p = 128087 - 128099.9991. Let w = -13 - p. What is w rounded to four dps? -0.0009 Let m = -211.3856 - -210. Let l = -22.6454 + m. Let g = -24 - l. Round g to two dps. 0.03 Let p = -70.1 + 69. Round p to 0 dps. -1 Let w = 0.34999894 - 0.35. Round w to 7 decimal places. -0.0000011 Let c be (0 - 2/(-6))177. Round c to the nearest ten. 60 Let u = 0.27000056 + -0.27. What is u rounded to 7 decimal places? 0.0000006 Let p(y) = y - 13. Let w be p(-11). What is w rounded to the nearest ten? -20 Let x = 107195543.999921 - 107195602. Let n = x + 58. Round n to 5 decimal places. -0.00008 Let s(k) = -k - 1. Let y be s(-4). Let x be 150/((y/(-200))/3). What is x rounded to the nearest one hundred thousand? 0 Let g = -0.102 + 1.274. Let d = -1.2 + g. What is d rounded to 2 decimal places? -0.03 Let d = -85 - -333. Round d to the nearest 10. 250 Let z(j) = j + 1 + 7j - 5j. Let p be z(1). Suppose -ps + 3s + 6200 = 0. What is s rounded to the nearest 1000? 6000 Let q = 0.2 - 3.2. Let j = q - -2.95. Let a = j - -0.041. Round a to 3 dps. -0.009 Let r = -1120.82 + 1179. Let v = r + -39.6. Let j = 18 - v. What is j rounded to 1 decimal place? -0.6 Let p be (375/(-6))/(2/(-1280)). Let m be p/(-2)(-44)/2. Round m to the nearest 100000. 400000 Let m(t) = -3t + 32t2 - 13t*2 + 0 + 2. Let r be m(-5). Suppose j + 288 = -r. Round j to the nearest 100. -800 Let z = 12.6152 - -65.1282. Let r = -12.8224 + z. Let x = 65 - r. What is x rounded to 2 decimal places? 0.08 Let b = -1931.8 - -1939.8052. Let t = b + -8. Round t to 3 dps. 0.005 Let s = 18.0007 + -18. Round s to 3 decimal places. 0.001 Suppose -3g - 22 = -94. Let o = 54 - g. Round o to the nearest one hundred. 0 Let w = -47 + -51. Let d = w - -97.01. Round d to 1 decimal place. -1 Let p = 182.51 + -168.4. Let v = p - 14. Round v to 2 decimal places. 0.11 Suppose 0 = f + 4f - 3220. Let g = f - -266. What is g rounded to the nearest one hundred? 900 Let y = -16.7 - -16.70505. What is y rounded to 3 dps? 0.005 Let c = -8.6999953 - -8.7. Round c to 6 dps. 0.000005 Let v(j) = -14j - 4. Suppose -h + r = -4h - 19, -5h - 25 = 5r. Let q be v(h). Let x = 131 - q. Round x to the nearest 10. 40 Let a be (5/10)/(2/8). Let b(l) = -l + 12000 + 2l2 - la + 2l. Let r be b(0). What is r rounded to the nearest 10000? 10000 Let v(h) = -4h - 5h + 203h**2 + 3 + 6 + h. Let g be v(7). Round g to the nearest 1000. 10000 Let b = 1.8 - -0.2. Let o = -2.0000068 + b. What is o rounded to 6 dps? -0.000007 Let o = -187 + 228.1. Let a = -9646.87 - -9686. Let b = o - a. Round b to one decimal place. 2
Let j(g) = -94g + 873. Determine j(10). -67 Let d(f) = 60f + 71. Give d(-6). -289 Let v(t) = 2t2 + 98t + 832. Determine v(-38). -4 Let u(h) = -h*3 - 32h*2 - 35h + 12. Determine u(-31). 136 Let l(a) = -3a2 + 1226a - 15057. What is l(396)? -9 Let g(s) = 2s3 + 16s*2 - 7s - 66. Give g(-8). -10 Let w(m) = -m*2 - 36m - 315. What is w(-15)? 0 Let k(n) = -287n + 543. Calculate k(2). -31 Let v(a) = -a3 - 29a*2 - 224a + 74. What is v(-12)? 314 Let w(j) = -8j - 350. Determine w(-39). -38 Let v(d) = d2 - 162d - 5107. Calculate v(189). -4 Let m(r) = -44r + 4557. What is m(105)? -63 Let k(d) = 6d*2 + 55d + 105. Calculate k(-2). 19 Let r(i) = -i*3 + 12i*2 - 76i + 909. What is r(12)? -3 Let p(c) = -c*3 - 26c*2 - 105c - 10. Give p(-21). -10 Let l(c) = 329c + 9498. What is l(-29)? -43 Let c(o) = -18o + 16. Give c(-8). 160 Let a(u) = -u*3 + 51u*2 - 189u + 48. Determine a(47). 1 Let y(a) = 104a - 250. Calculate y(3). 62 Let r(q) = 15q*2 - 162q - 205. Give r(12). 11 Let n(b) = -3b2 + 1577b + 11187. Calculate n(-7). 1 Let u(v) = 4v - 87. Determine u(11). -43 Let x(w) = 1355w + 23037. Determine x(-17). 2 Let z(a) = -33a - 376. Calculate z(13). -805 Let w(s) = 517s - 17577. What is w(34)? 1 Let c(t) = -t*3 + 8t2 - t - 50. Determine c(6). 16 Let p(a) = -a3 - 9a2 - 8a + 64. Determine p(-6). 4 Let l(h) = -h3 + h2 + 53h + 9. Give l(6). 147 Let u(i) = -67i + 3278. Calculate u(49). -5 Let d(r) = r*2 - 80r + 1220. What is d(56)? -124 Let u(j) = 274j2 + 3j - 5. Calculate u(2). 1097 Let u(k) = -120k - 3367. Determine u(-28). -7 Let z(s) = -s2 + 330s + 7018. Determine z(-20). 18 Let i(j) = 3j2 - 7j - 1425. Give i(23). 1 Let i(c) = 17c + 121. Calculate i(-7). 2 Let f(h) = -h2 + 33h - 72. Calculate f(28). 68 Let j(g) = 3g3 - g2 + 9g + 35. What is j(-4)? -209 Let r(n) = -48n + 3170. Calculate r(66). 2 Let c(o) = 2o*3 - 5o*2 + 5o - 88. Calculate c(0). -88 Let w(x) = 32x + 796. Give w(-24). 28 Let b(x) = -23x*2 + 84x. What is b(4)? -32 Let b(s) = -720s - 2884. Determine b(-4). -4 Let q(c) = -3c*2 + 54c - 13. What is q(20)? -133 Let t(c) = -7c3 - 36c*2 + 4c + 6. Give t(-6). 198 Let k(x) = -39x + 790. Give k(33). -497 Let z(d) = 49d*2 - 5d + 3. Calculate z(1). 47 Let a(c) = -c*2 - 221c - 12005. Calculate a(-125). -5 Let b(u) = -u*2 - 60u + 594. Give b(-71). -187 Let u(j) = 4j3 - 61j*2 - 12j - 10. Give u(16). 566 Let g(o) = -22o - 366. What is g(-16)? -14 Let v(x) = -x3 - 19x*2 - 14x + 393. Determine v(-17). 53 Let y(v) = -v*3 - 67v*2 + 3v + 149. Determine y(-67). -52 Let p(w) = 15838w + 269252. Determine p(-17). 6 Let q(x) = 3x*3 + 185x*2 - 63x - 42. Determine q(-62). 20 Let g(p) = -3p3 + 49p*2 + 92p - 36. Calculate g(18). 0 Let k(i) = 108575i + 217156. Give k(-2). 6 Let j(s) = -2s*2 + 179s - 1589. Calculate j(10). 1 Let x(s) = -4s2 - 164s + 2335. Calculate x(-52). 47 Let y(s) = -s*3 + 5s*2 + 68s + 19. Calculate y(-6). 7 Let v(w) = 4w2 - 11w - 81. What is v(-5)? 74 Let r(a) = -78a2 + 5a + 1. Give r(-1). -82 Let l(g) = 2g - 18. Determine l(-8). -34 Let l(u) = -2u*2 + 164u + 385. Determine l(84). 49 Let a(j) = 17j - 77. Calculate a(-21). -434 Let z(t) = -54t + 757. Give z(14). 1 Let i(j) = -390j - 2329. Give i(-7). 401 Let q(h) = 98h + 1169. What is q(-12)? -7 Let u(o) = -38o - 880. What is u(-19)? -158 Let f(y) = -47y - 2. Determine f(0). -2 Let m(v) = -11v + 64. Calculate m(-5). 119 Let v(u) = -u2 + 60u - 712. Determine v(43). 19 Let l(i) = 14i + 1224. Calculate l(-89). -22 Let v(y) = 3y*2 - 26y - 55. Calculate v(-2). 9 Let a(v) = -4v3 + 2v*2 + 72v + 147. Give a(-2). 43 Let u(j) = -j*3 - 3j*2 + 810j - 3131. Give u(4). -3 Let v(c) = 553c + 15489. Calculate v(-28). 5 Let j(m) = m3 - 36m - 8. Determine j(6). -8 Let i(k) = 25k - 77. Determine i(-22). -627 Let s(d) = 58d*3 + 3d*2 - 2d - 2. Give s(-1). -55 Let x(s) = 856s - 864. Calculate x(1). -8 Let k(l) = 2l*2 + 4l - 98. Give k(-9). 28 Let b(l) = 3l3 + 5l*2 - 21l + 2. Give b(2). 4 Let f(x) = -15x3 - x2 - 2x + 2. What is f(1)? -16 Let k(q) = q*3 + 24q*2 + 17q + 8. Calculate k(-23). 146 Let s(r) = -r*3 + 28r*2 - 76r + 19. What is s(25)? -6 Let c(d) = -d*3 + 10d*2 + 28d - 184. Determine c(11). 3 Let b(p) = p*3 - 19p*2 - 41p + 108. Determine b(21). 129 Let k(n) = 334n - 2999. Determine k(9). 7 Let f(u) = 178u + 12645. Give f(-71). 7 Let o(i) = i*2 - 7i - 85. Calculate o(14). 13 Let x(p) = -15p + 139. Give x(6). 49 Let s(k) = -k2 - 38k - 37. What is s(-27)? 260 Let l(r) = 824r - 7456. What is l(9)? -40 Let i(m) = m2 - 1519m + 9070. Determine i(6). -8 Let v(j) = -2j3 + 11j*2 + 52j - 428. What is v(8)? -332 Let j(p) = 198p - 4078. Determine j(21). 80 Let b(i) = i2 + 32i - 656. Determine b(-49). 177 Let s(d) = -117d - 225. Calculate s(-2). 9 Let b(r) = -30r - 140. Determine b(-5). 10 Let n(w) = 3w2 + 88w + 591. Calculate n(-19). 2 Let r(s) = -63s + 1376. What is r(22)? -10 Let u(f) = f3 + 63f*2 + 387f + 115. Determine u(-56). 395 Let i(x) = 7390x + 280822. Give i(-38). 2 Let k(g) = g3 - 8g*2 + 10g + 16. Determine k(7). 37 Let w(r) = r*3 + 4r*2 + 49r + 144. What is w(-3)? 6 Let g(c) = -118c2 - 21351c + 1274. What is g(-181)? 7 Let n(o) = -o*2 + 13o - 9. Determine n(6). 33 Let d(n) = -1560n - 6273. Determine d(-4). -33 Let r(y) = 5y*3 + 9y*2 + 18y + 32. Calculate r(-3). -76 Let c(w) = 6203w + 24814. Determine c(-4). 2 Let n(p) = p2 - 50p - 22. Determine n(51). 29 Let j(x) = 16x - 35. Calculate j(2). -3 Let w(b) = 3b*2 + 94b - 94. What is w(-38)? 666 Let v(q) = q*2 - 1371q - 36322. Calculate v(-26). 0 Let f(b) = -4b3 + 408b*2 + 9b - 973. Give f(102). -55 Let z(q) = -30q3 + 22q*2 + 2q - 1. Determine z(1). -7 Let t(h) = -h*3 + 18h*2 - 5h + 26. Calculate t(18). -64 Let c(h) = 381h + 1953. Calculate c(-5). 48 Let x(l) = 2l*2 + 28l - 54. Give x(-18). 90 Let s(z) = 8z3 - 2z*2 - 155z - 154. Give s(-1). -9 Let r(f) = -f*2 + 195f - 778. Determine r(4). -14 Let z(l) = -93l - 189. What is z(-2)? -3 Let y(t) = -t2 - 4t + 699. Calculate y(-28). 27 Let l(k) = 6k + 185. Determine l(-35). -25 Let h(n) = -3n*2 + 154n + 678. Determine h(-4). 14 Let i(k) = 239k + 1420. Give i(-6). -14 Let d(z) = -1422z - 304307. Calculate d(-214). 1 Let n(m) = -2m2 - 67m + 2843. Determine n(-58). 1 Let s(i) = -34i2 + 468i + 119. Calculate s(14). 7 Let q(i) = i*2 - 19i - 21. Give q(7). -105 Let u(g) = -3g2 - 15g + 145. Calculate u(6). -53 Let p(n) = 3n2 - 347n + 1993. Give p(6). 19 Let g(x) = x*3 + 80x*2 - 87x - 459. Calculate g(-81). 27 Let w(p) = -40p - 2514. What is w(-64)? 46 Let k(x) = x2 + 103x + 1655. Calculate k(-20). -5 Let k(x) = -12x2 - 886x + 1986. Determine k(-76). 10 Let s(z) = 3z2 + 48z - 108. What is s(2)? 0 Let c(t) = -2t3 + 52t*2 + 60t - 141. Determine c(27). 21 Let j(m) = 2m2 - 12m - 42. What is j(10)? 38 Let n(w) = -7w2 - 386w + 9763. Calculate n(-74). -5 Let z(f) = f*3 + 12f*2 + 46f + 135. Give z(-8). 23 Let l(b) = -26b - 756. Give l(-64). 908 Let h(v) = -3v*3 - 12v*2 - 8v + 4. Determine h(-3). 1 Let h(q) = -6q2 + 14q + 14. Determine h(-2). -38 Let z(t) = 79t - 175. What is z(2)? -17 Let p(a) = a2 + 57a + 676. Give p(-17). -4 Let m(t) = t*3 + 36t*2 - 9t - 6. Give m(0). -6 Let v(m) = -221m2 - 1550m - 17. Give v(-7). 4 Let o(n) = -30n2 - 1528n + 97. Determine o(-51). -5 Let l(m) = -m*2 - 129m + 810. What is l(-135)? 0 Let z(b) = 544b - 1637. What is z(3)? -5 Let r(v) = v3 + 63v*2 + 234v - 179. Give r(-59). -61 Let g(y) = 61y + 4328. Give g(-73). -125 Let a(d) = -88d - 2. Give a(4). -354 Let f(h) = 9h2 + 182h + 181. Determine f(-1). 8 Let c(f) = -12f2 + 25f + 90. What is c(4)? -2 Let t(k) = 3k - 62. Give t(-15). -107 Let k(h) = -2h*3 - 18h*2 - 14h + 6. Calculate k(-7). -92 Let w(z) = -z*2 - 22z + 4. Determine w(-13). 121 Let k(l) = l*2 - 43l - 2435. Calculate k(-32). -35 Let c(v) = -4v2 + v + 52. Calculate c(4). -8 Let d(p) = -17p - 100. What is d(-3)? -49 Let b(i) = -i*2 + 9i + 71. What is b(-8)? -65 Let h(a) = -2a3 + 20a*2 - 4a + 8. Determine h(10). -32 Let q(h) = -h*3 - 94h*2 - 602h + 5. Calculate q(-7). -44 Let n(o) = -o*2 + 37o + 200. Determine n(42). -10 Let y(a) = -60a + 3648. Calculate y(61). -12 Let d(r) = -r3 - 99r*2 + 413r + 108. Calculate d(-103). 5 Let f(a) = -a*3 + 18a*2 - 65a - 74. What is f(8)? 46 Let a(n) = -24n3 - 457n*2 - 22n - 47. Give a(-19). 10
What is 5703508.51 take away -883? 5704391.51 Add 1 and 92241799978. 92241799979 Calculate -859287 - 7982864. -8842151 What is the distance between 15555709406334 and 4? 15555709406330 What is -0.9 plus -443620018687? -443620018687.9 Sum 341554202 and 0.1031. 341554202.1031 What is -41761123 minus 57071? -41818194 Work out -12644.426852 + 0.29. -12644.136852 Subtract -1768 from -2251752.8. -2249984.8 Calculate 7363.56862788 - 0.212. 7363.35662788 Work out -3318.00339 + -287.4. -3605.40339 Calculate -1.1 - 1844559891787. -1844559891788.1 What is 63 minus -41562642.21226? 41562705.21226 Sum 1138 and 29483767.86. 29484905.86 Sum -0.0205973 and -1.588. -1.6085973 What is 1.43718794457204 take away -4? 5.43718794457204 Work out 2298679 - 83412670. -81113991 Sum 20250 and -71977791. -71957541 Work out -1.3 + -2105624814163. -2105624814164.3 Sum -9909 and 18408645. 18398736 Total of 13588689 and -0.0059577. 13588688.9940423 -974629835 + 34.15 -974629800.85 What is the difference between -2 and -1.064153070060618? 0.935846929939382 Work out 0.219807983838 + -5. -4.780192016162 What is 847631 - 109190? 738441 Put together -2.54232 and 2287770. 2287767.45768 Subtract -71333 from -1130614. -1059281 What is -0.056981329542 plus 10? 9.943018670458 Subtract 1.353982 from -241.33375. -242.687732 Add together -0.61118 and -25.57776. -26.18894 What is the difference between 0.2 and -0.9021755218502? 1.1021755218502 Add together -23585060295 and -5. -23585060300 Work out -12.0967130528902 + -4. -16.0967130528902 What is 4 - 84904005398? -84904005394 What is the distance between -704359469 and -6507? 704352962 Sum -5111992 and -68091810. -73203802 What is the difference between 44367405 and -0.1117? 44367405.1117 -299676756+-231621 -299908377 What is 21443.0078 - -972? 22415.0078 What is 1.9 less than -14759926289179? -14759926289180.9 Put together 6425003 and -56.58. 6424946.42 Calculate 13952 - 878880116. -878866164 Work out 1898675.51014 + 0.05. 1898675.56014 What is 33076302 take away 218289? 32858013 What is 359.993153693 + -0.3? 359.693153693 -318346 + -0.035894814 -318346.035894814 -684 - -2431855911 2431855227 Work out -0.4 + -14224923062728. -14224923062728.4 Calculate 431011458483 + 0. 431011458483 -0.2 - 31201024716 -31201024716.2 Work out 9.22829 + 85487. 85496.22829 Calculate 9.0272015989 + -188. -178.9727984011 -286095 - 32697551 -32983646 What is -6895 - -520201810? 520194915 -100.60563+182160 182059.39437 What is -2.7 + 13.946301814? 11.246301814 Subtract -11483717350 from 171. 11483717521 What is -452667976 + -5016? -452672992 What is -95951025561 plus 1? -95951025560 What is 14601.4364 minus -8.9875? 14610.4239 What is -101.088894 take away 32? -133.088894 Add together -0.07 and 5034328198705. 5034328198704.93 What is -270400229 - -1698? -270398531 Put together 22.09851267 and 1.752. 23.85051267 Work out 15536078 - -180206. 15716284 What is 592728080500645 + 2? 592728080500647 What is 12085.6 take away 10392.48987? 1693.11013 What is 0.000761 less than 757626648? 757626647.999239 What is 2465.1 plus 4370079709? 4370082174.1 37.758124 - 757086 -757048.241876 Sum 0.3 and -1165791542201. -1165791542200.7 What is -52.91811364344 take away 15? -67.91811364344 What is the distance between -0.268012324 and 44187? 44187.268012324 Subtract 1557 from -506054483. -506056040 Calculate -1154010581 - 189. -1154010770 Total of 12 and 10361386853178. 10361386853190 Subtract 771823 from 588.792. -771234.208 Add 650752106 and 625. 650752731 What is -16346.8 - 5257? -21603.8 What is 2572 plus 77318298237? 77318300809 Add -5.1544317924 and -44.6. -49.7544317924 1225.6240702448+-0.2 1225.4240702448 Add together -3398490 and -1773.46. -3400263.46 0.12 - 4627485609.92 -4627485609.8 Put together 18893241053831 and 3. 18893241053834 What is -793.28 minus 3193.94406? -3987.22406 What is -0.545607 take away -0.0932222? -0.4523848 What is the difference between -93213 and 5320815.25? 5414028.25 Calculate -42499548.58 + -52.6. -42499601.18 What is 29955136.8 less than -35969? -29991105.8 Calculate -281.3 + 3170914548. 3170914266.7 Calculate 97564976236199 + 0.5. 97564976236199.5 Put together 175259516 and -2774774. 172484742 What is -10.8 minus 381584371569.7? -381584371580.5 What is the difference between -127 and 59655580092? 59655580219 What is 7846431.6032 less than -4? -7846435.6032 Work out 70211302 + -52718. 70158584 Calculate 101 - -156.674211423. 257.674211423 Total of -626.70939 and 672316. 671689.29061 Add together 1620952.3695497 and -0.05. 1620952.3195497 Calculate -2853.8693 + -211249. -214102.8693 What is -12314 + -0.1026753? -12314.1026753 What is -690 plus 37207466385? 37207465695 3 - 13655260904611 -13655260904608 Calculate 100290527976091 - -3. 100290527976094 What is 0.2 less than -190615341903468? -190615341903468.2 -8922120730+27 -8922120703 What is the difference between 2 and 325502745.26? 325502743.26 Subtract 66.4351 from 6428152. 6428085.5649 What is 1.83 take away -12.6671337? 14.4971337 Work out -69.74752989755 + -0.08. -69.82752989755 Total of 309.925822 and 0.029. 309.954822 Add together -11 and 1443141636864. 1443141636853 Add -4313066912118 and -0.5. -4313066912118.5 What is -0.06 take away -4258471.003267? 4258470.943267 Work out -0.005131 + -1078714346. -1078714346.005131 -5.0275+-29906557 -29906562.0275 Add together 0.027 and 2006290935843. 2006290935843.027 Subtract 11304111772 from 7.32. -11304111764.68 Sum 1688837 and -115.84569. 1688721.15431 Total of 51402.19525298 and 0. 51402.19525298 Sum 87623 and 4681.04. 92304.04 -1359787.7709 + 24 -1359763.7709 Subtract -896 from -101468271. -101467375 What is -15.6648811126 minus 15? -30.6648811126 Work out 7 - 24926130749. -24926130742 Add -0.08 and -3883570.48313. -3883570.56313 25 + -1480.083472 -1455.083472 Subtract -423 from 1252158181692. 1252158182115 Total of 46994664.568 and -0.29. 46994664.278 Subtract 491298966810 from 279. -491298966531 What is the difference between 7731 and -1089015407? 1089023138 What is the distance between -241818766577 and 8? 241818766585 Add -0.5 and -3322928.80351. -3322929.30351 Subtract -34.099182728221 from 2. 36.099182728221 Total of -16645466.043 and 19.2. -16645446.843 What is the difference between 774091.291327 and 5? 774086.291327 Add together -483465099990 and 1. -483465099989 Work out 334424280 + -30530. 334393750 Subtract 30241 from -4081478. -4111719 Subtract 9405078896 from -14575. -9405093471 What is 600.8 + -0.30704388? 600.49295612 Put together -144793929325 and 0.2. -144793929324.8 4035934 + 14307005 18342939 Calculate 1552675 - 2263228. -710553 Put together -1.8118 and -256.356431. -258.168231 Work out -177.70162 + 100546. 100368.29838 Add -438513987 and 67373. -438446614 What is 3495.93 plus 30291353? 30294848.93 Subtract 1471 from 1607173755. 1607172284 -497586787+-1811 -497588598 Add 0.87 and 0.086555554. 0.956555554 -278196088197 - 1 -278196088198 What is 5 + 707072860028? 707072860033 2142574822210 + 30 2142574822240 Subtract -9.502603798873 from -18. -8.497396201127 What is the distance between -15262 and 1627850995? 1627866257 5.0711 + 544192.4 544197.4711 Add together 3571 and -8857995089. -8857991518 What is 450 less than -4597747.687? -4598197.687 What is 50.3351368 + -0.04477? 50.2903668 -7.35027 - 6588669 -6588676.35027 Add -47.845981834 and 0. -47.845981834 What is -307.975961595 take away 0.05? -308.025961595 Work out -468760549 - 1735. -468762284 What is the difference between -5 and -675.60977661317? 670.60977661317 Total of 115373.4949 and 1.398. 115374.8929 Calculate -67 + -271019.8591. -271086.8591 What is -1.293296 minus -0.4690057? -0.8242903 11699278245+5 11699278250 What is the difference between -12463700.46 and 8236? 12471936.46 What is 14.6103 minus -25534.6? 25549.2103 4851384064 - 75 4851383989 Put together -17037.279 and 369.55. -16667.729 Work out 36.262 + -327690236. -327690199.738 Add 34983834 and -81.15. 34983752.85 Add together 247882660 and -141546. 247741114 Subtract -0.02 from -67531747730831. -67531747730830.98 What is 1915.5 plus -1120119? -1118203.5 Calculate -201464278437 - -4. -201464278433 Work out 94592822 + -1423888. 93168934 Total of 0.3 and -0.037236498444. 0.262763501556 What is the difference between 6 and 246932867313971? 246932867313965 What is -0.0982 - 1080.330978? -1080.429178 What is -0.388698580165 + 0.4? 0.011301419835 What is -0.04302317021 take away -505? 504.95697682979 -13.2+2290183245.63 2290183232.43 Total of -26.1987223 and 0.01041. -26.1883123 Put together 28.1 and -8322296769. -8322296740.9 Calculate 0.62860227 - 45.742. -45.11339773 What is -1 - 1650055907116? -1650055907117
What are the prime factors of 840039? 3, 280013 What are the prime factors of 23176905? 3, 5, 1545127 List the prime factors of 9281374. 2, 23, 201769 What are the prime factors of 357516? 2, 3, 9931 List the prime factors of 36727619. 23, 421, 3793 List the prime factors of 561303. 3, 20789 List the prime factors of 2379487. 11, 216317 What are the prime factors of 335407? 19, 127, 139 What are the prime factors of 4524562? 2, 7, 137, 337 List the prime factors of 10589953. 11, 67, 14369 What are the prime factors of 262997? 7, 37571 What are the prime factors of 2976851? 53, 56167 What are the prime factors of 2120520? 2, 3, 5, 41, 431 List the prime factors of 708206. 2, 19, 18637 List the prime factors of 2087127. 3, 7, 409 List the prime factors of 2584708. 2, 7, 92311 List the prime factors of 66537. 3, 7393 List the prime factors of 671094. 2, 3, 23, 1621 What are the prime factors of 30787733? 19, 349, 4643 List the prime factors of 6164316. 2, 3, 57077 What are the prime factors of 658846? 2, 43, 47, 163 List the prime factors of 387067. 23, 16829 What are the prime factors of 324814? 2, 7, 23201 What are the prime factors of 791246? 2, 23, 103, 167 List the prime factors of 28310046. 2, 3, 67, 70423 What are the prime factors of 4896013? 4896013 List the prime factors of 1780920. 2, 3, 5, 17, 97 What are the prime factors of 41899380? 2, 3, 5, 397, 1759 List the prime factors of 214845. 3, 5, 14323 What are the prime factors of 152999? 7, 11, 1987 List the prime factors of 1342040. 2, 5, 7, 4793 List the prime factors of 541260. 2, 3, 5, 31, 97 What are the prime factors of 54356? 2, 107, 127 List the prime factors of 104145. 3, 5, 53, 131 What are the prime factors of 1405125? 3, 5, 1249 What are the prime factors of 105269? 105269 List the prime factors of 1044957. 3, 29, 12011 List the prime factors of 94290. 2, 3, 5, 7, 449 List the prime factors of 9648149. 7, 196901 What are the prime factors of 11148617? 17, 103, 6367 What are the prime factors of 3083466? 2, 3, 653, 787 List the prime factors of 9610247. 1747, 5501 List the prime factors of 4314675. 3, 5, 57529 List the prime factors of 25430. 2, 5, 2543 List the prime factors of 2086586. 2, 1043293 What are the prime factors of 657009? 3, 37, 1973 What are the prime factors of 1285361? 7, 11, 16693 What are the prime factors of 35952? 2, 3, 7, 107 List the prime factors of 13712505. 3, 5, 29, 1087 What are the prime factors of 711476? 2, 83, 2143 What are the prime factors of 4695018? 2, 3, 47, 16649 What are the prime factors of 12304370? 2, 5, 13, 94649 What are the prime factors of 481590? 2, 3, 5, 5351 List the prime factors of 388493. 7, 19, 23, 127 List the prime factors of 2735920. 2, 5, 11, 3109 List the prime factors of 6686983. 6686983 List the prime factors of 302683. 53, 5711 List the prime factors of 3827923. 11, 347993 What are the prime factors of 469969? 469969 List the prime factors of 1042274. 2, 521137 List the prime factors of 2708201. 2708201 List the prime factors of 124130. 2, 5, 12413 List the prime factors of 966934. 2, 483467 What are the prime factors of 776100? 2, 3, 5, 13, 199 What are the prime factors of 5165341? 1489, 3469 List the prime factors of 148215. 3, 5, 41, 241 List the prime factors of 571600. 2, 5, 1429 What are the prime factors of 359768? 2, 44971 What are the prime factors of 3910350? 2, 3, 5, 131, 199 List the prime factors of 319801. 193, 1657 List the prime factors of 5605726. 2, 7, 400409 What are the prime factors of 623120? 2, 5, 7789 List the prime factors of 166272. 2, 3, 433 What are the prime factors of 443159? 443159 List the prime factors of 20065. 5, 4013 What are the prime factors of 56794? 2, 73, 389 List the prime factors of 16313072. 2, 23, 97, 457 What are the prime factors of 3903651? 3, 41, 71, 149 List the prime factors of 1125296. 2, 53, 1327 List the prime factors of 720636. 2, 3, 7, 23, 373 List the prime factors of 12651964. 2, 13, 467, 521 List the prime factors of 10167645. 3, 5, 103, 6581 List the prime factors of 804560. 2, 5, 89, 113 What are the prime factors of 294673? 294673 List the prime factors of 21071053. 21071053 List the prime factors of 15330699. 3, 523, 3257 What are the prime factors of 32362630? 2, 5, 3236263 List the prime factors of 8223214. 2, 47, 87481 What are the prime factors of 5306344? 2, 107, 6199 What are the prime factors of 772046? 2, 11, 19, 1847 List the prime factors of 2156894. 2, 23, 46889 What are the prime factors of 696583? 307, 2269 What are the prime factors of 3861652? 2, 17, 109, 521 List the prime factors of 895935. 3, 5, 59729 List the prime factors of 122385. 3, 5, 41, 199 List the prime factors of 209274. 2, 3, 13, 2683 List the prime factors of 277962. 2, 3, 46327 What are the prime factors of 60488? 2, 7561 What are the prime factors of 12046207? 59, 204173 What are the prime factors of 686002? 2, 71, 4831 List the prime factors of 5414332. 2, 7, 11, 17579 List the prime factors of 91247. 13, 7019 List the prime factors of 391688. 2, 11, 4451 What are the prime factors of 117986? 2, 11, 31, 173 What are the prime factors of 1283767? 1283767 What are the prime factors of 5956237? 7, 850891 What are the prime factors of 10097? 23, 439 What are the prime factors of 178243? 13, 13711 What are the prime factors of 634114? 2, 13, 29 What are the prime factors of 16877922? 2, 3, 971, 2897 List the prime factors of 704988. 2, 3, 19583 List the prime factors of 237745. 5, 17, 2797 List the prime factors of 253909. 253909 What are the prime factors of 241798? 2, 120899 List the prime factors of 2238657. 3, 47, 15877 What are the prime factors of 21757716? 2, 3, 41, 14741 What are the prime factors of 5182407? 3, 367, 523 What are the prime factors of 4868365? 5, 83, 11731 List the prime factors of 988491. 3, 7, 103, 457 What are the prime factors of 86004? 2, 3, 2389 List the prime factors of 398497. 11, 17, 2131 What are the prime factors of 8343? 3, 103 What are the prime factors of 9954337? 29, 343253 What are the prime factors of 3577647? 3, 1192549 What are the prime factors of 378514? 2, 189257 List the prime factors of 2037410. 2, 5, 79, 2579 What are the prime factors of 1486087? 1486087 List the prime factors of 7821000. 2, 3, 5, 11, 79 List the prime factors of 643368. 2, 3, 11, 2437 What are the prime factors of 3088219? 3088219 What are the prime factors of 1604607? 3, 19, 28151 What are the prime factors of 238810? 2, 5, 11, 13, 167 List the prime factors of 150566. 2, 13, 5791 What are the prime factors of 625694? 2, 269, 1163 What are the prime factors of 793101? 3, 17, 15551 What are the prime factors of 3187131? 3, 139, 7643 What are the prime factors of 70367? 11, 6397 List the prime factors of 365687. 7, 17, 439 List the prime factors of 1363588. 2, 340897 List the prime factors of 4051163. 113, 35851 What are the prime factors of 2234375? 5, 11, 13 List the prime factors of 111196. 2, 27799 List the prime factors of 413013. 3, 31, 4441 What are the prime factors of 2643213? 3, 881071 List the prime factors of 2129262. 2, 3, 354877 What are the prime factors of 595996? 2, 37, 4027 What are the prime factors of 8613005? 5, 1722601 List the prime factors of 435426. 2, 3, 31, 2341 What are the prime factors of 2377? 2377 List the prime factors of 8690754. 2, 3, 107, 13537 What are the prime factors of 11623652? 2, 83, 157, 223 What are the prime factors of 935354? 2, 7, 71, 941 What are the prime factors of 60060? 2, 3, 5, 7, 11, 13 What are the prime factors of 5061648? 2, 3, 17, 6203 What are the prime factors of 663503? 41, 16183 List the prime factors of 78593. 78593 List the prime factors of 1648101. 3, 7, 13, 6037 What are the prime factors of 10993708? 2, 11, 249857 What are the prime factors of 162103? 47, 3449 List the prime factors of 232235. 5, 46447 What are the prime factors of 3553? 11, 17, 19 What are the prime factors of 12471177? 3, 79, 101, 521 What are the prime factors of 128261? 7, 73, 251 List the prime factors of 5588293. 967, 5779 What are the prime factors of 370816? 2, 2897 What are the prime factors of 4185425? 5, 23, 29, 251 What are the prime factors of 275281? 17, 16193 List the prime factors of 98052. 2, 3, 8171 What are the prime factors of 601640? 2, 5, 13, 89 List the prime factors of 14799. 3, 4933 What are the prime factors of 813495? 3, 5, 193, 281 What are the prime factors of 400313? 400313 List the prime factors of 6554929. 191, 34319 What are the prime factors of 3096718? 2, 1548359 What are the prime factors of 37342268? 2, 17, 32303 What are the prime factors of 381557? 11, 34687
How many minutes are there between 6:03 AM and 3:55 PM? 592 What is 463 minutes before 9:38 PM? 1:55 PM How many minutes are there between 7:25 PM and 6:30 AM? 665 How many minutes are there between 6:09 PM and 3:29 AM? 560 How many minutes are there between 1:15 PM and 6:47 PM? 332 How many minutes are there between 12:55 AM and 11:26 AM? 631 How many minutes are there between 10:58 PM and 3:37 AM? 279 What is 277 minutes after 6:50 AM? 11:27 AM How many minutes are there between 9:06 AM and 2:33 PM? 327 How many minutes are there between 5:46 PM and 4:32 AM? 646 What is 468 minutes after 6:28 PM? 2:16 AM How many minutes are there between 4:02 PM and 8:17 PM? 255 What is 547 minutes after 1:36 AM? 10:43 AM What is 408 minutes after 1:36 AM? 8:24 AM What is 692 minutes before 5:54 AM? 6:22 PM How many minutes are there between 10:19 PM and 1:10 AM? 171 What is 97 minutes after 10:57 AM? 12:34 PM How many minutes are there between 7:16 AM and 9:40 AM? 144 What is 176 minutes after 5:14 PM? 8:10 PM How many minutes are there between 7:02 PM and 5:25 AM? 623 What is 443 minutes before 10:49 AM? 3:26 AM What is 597 minutes after 5:28 PM? 3:25 AM How many minutes are there between 1:19 AM and 9:31 AM? 492 How many minutes are there between 4:21 AM and 5:03 AM? 42 How many minutes are there between 3:27 AM and 8:48 AM? 321 What is 676 minutes after 7:56 AM? 7:12 PM How many minutes are there between 7:22 AM and 1:15 PM? 353 What is 144 minutes before 7:44 AM? 5:20 AM How many minutes are there between 11:58 PM and 10:26 AM? 628 How many minutes are there between 11:52 AM and 12:01 PM? 9 How many minutes are there between 5:31 PM and 7:41 PM? 130 What is 298 minutes before 8:45 PM? 3:47 PM What is 710 minutes before 2:49 AM? 2:59 PM How many minutes are there between 8:38 AM and 5:28 PM? 530 What is 677 minutes after 12:15 PM? 11:32 PM How many minutes are there between 9:13 PM and 7:08 AM? 595 How many minutes are there between 11:38 AM and 11:58 AM? 20 What is 332 minutes before 11:05 AM? 5:33 AM How many minutes are there between 1:22 PM and 9:32 PM? 490 What is 692 minutes after 12:10 AM? 11:42 AM What is 324 minutes after 6:20 AM? 11:44 AM How many minutes are there between 4:33 PM and 2:43 AM? 610 How many minutes are there between 12:41 AM and 3:20 AM? 159 What is 137 minutes before 5:49 PM? 3:32 PM What is 62 minutes after 1:31 AM? 2:33 AM What is 135 minutes after 10:54 PM? 1:09 AM How many minutes are there between 4:46 PM and 4:04 AM? 678 What is 130 minutes after 8:47 PM? 10:57 PM How many minutes are there between 11:23 AM and 5:23 PM? 360 How many minutes are there between 10:57 PM and 6:30 AM? 453 How many minutes are there between 6:13 PM and 2:50 AM? 517 How many minutes are there between 1:18 AM and 4:19 AM? 181 What is 354 minutes after 1:28 PM? 7:22 PM How many minutes are there between 3:38 AM and 3:40 AM? 2 How many minutes are there between 9:37 PM and 3:00 AM? 323 What is 472 minutes before 8:49 PM? 12:57 PM What is 419 minutes before 9:49 PM? 2:50 PM What is 539 minutes before 7:20 PM? 10:21 AM What is 195 minutes after 9:50 PM? 1:05 AM How many minutes are there between 2:52 PM and 12:24 AM? 572 What is 373 minutes after 9:03 AM? 3:16 PM How many minutes are there between 11:50 PM and 1:21 AM? 91 What is 556 minutes after 8:38 AM? 5:54 PM How many minutes are there between 9:01 PM and 8:38 AM? 697 How many minutes are there between 5:42 AM and 4:07 PM? 625 How many minutes are there between 1:49 AM and 6:51 AM? 302 How many minutes are there between 10:15 PM and 8:00 AM? 585 How many minutes are there between 1:10 PM and 11:41 PM? 631 What is 691 minutes before 1:57 PM? 2:26 AM How many minutes are there between 3:27 AM and 5:11 AM? 104 What is 136 minutes before 6:12 AM? 3:56 AM What is 448 minutes after 5:53 PM? 1:21 AM What is 176 minutes after 7:16 AM? 10:12 AM What is 675 minutes before 10:40 PM? 11:25 AM What is 264 minutes after 2:11 PM? 6:35 PM What is 611 minutes after 11:43 AM? 9:54 PM How many minutes are there between 4:24 AM and 6:30 AM? 126 What is 158 minutes before 11:35 AM? 8:57 AM How many minutes are there between 11:48 AM and 10:55 PM? 667 What is 293 minutes after 1:40 PM? 6:33 PM How many minutes are there between 10:41 PM and 1:47 AM? 186 How many minutes are there between 3:18 AM and 9:25 AM? 367 What is 708 minutes before 7:53 AM? 8:05 PM What is 274 minutes after 8:05 AM? 12:39 PM What is 355 minutes after 12:45 AM? 6:40 AM How many minutes are there between 9:54 AM and 10:27 AM? 33 What is 446 minutes after 5:02 AM? 12:28 PM How many minutes are there between 10:28 AM and 4:54 PM? 386 How many minutes are there between 7:56 AM and 1:11 PM? 315 What is 710 minutes after 12:48 PM? 12:38 AM What is 181 minutes before 12:26 AM? 9:25 PM How many minutes are there between 3:50 AM and 11:23 AM? 453 How many minutes are there between 3:00 AM and 5:24 AM? 144 How many minutes are there between 11:47 PM and 2:34 AM? 167 What is 504 minutes before 6:32 AM? 10:08 PM How many minutes are there between 6:05 AM and 12:49 PM? 404 What is 176 minutes after 1:19 PM? 4:15 PM What is 573 minutes before 6:42 PM? 9:09 AM What is 398 minutes after 10:45 PM? 5:23 AM How many minutes are there between 12:26 PM and 2:59 PM? 153 What is 623 minutes after 8:49 PM? 7:12 AM What is 463 minutes after 11:28 AM? 7:11 PM What is 354 minutes before 6:42 AM? 12:48 AM What is 35 minutes before 10:18 PM? 9:43 PM What is 646 minutes after 10:43 PM? 9:29 AM How many minutes are there between 9:41 PM and 11:11 PM? 90 What is 20 minutes after 7:01 AM? 7:21 AM How many minutes are there between 12:57 AM and 6:56 AM? 359 How many minutes are there between 11:11 AM and 1:56 PM? 165 How many minutes are there between 8:24 PM and 10:14 PM? 110 How many minutes are there between 12:29 AM and 5:20 AM? 291 What is 680 minutes after 4:49 PM? 4:09 AM What is 166 minutes before 9:54 PM? 7:08 PM What is 690 minutes after 12:03 PM? 11:33 PM What is 33 minutes before 5:34 AM? 5:01 AM What is 244 minutes before 9:33 PM? 5:29 PM How many minutes are there between 4:07 PM and 8:05 PM? 238 What is 121 minutes after 7:02 PM? 9:03 PM How many minutes are there between 4:16 AM and 11:01 AM? 405 How many minutes are there between 6:34 PM and 9:35 PM? 181 What is 102 minutes before 12:40 PM? 10:58 AM What is 175 minutes after 11:44 AM? 2:39 PM What is 609 minutes after 4:11 PM? 2:20 AM How many minutes are there between 11:55 PM and 10:47 AM? 652 What is 557 minutes before 12:03 AM? 2:46 PM What is 371 minutes before 11:15 PM? 5:04 PM What is 560 minutes after 1:23 AM? 10:43 AM How many minutes are there between 4:27 PM and 5:17 PM? 50 How many minutes are there between 12:02 AM and 6:15 AM? 373 How many minutes are there between 9:11 PM and 5:34 AM? 503 How many minutes are there between 12:29 AM and 1:09 AM? 40 What is 354 minutes before 2:33 AM? 8:39 PM How many minutes are there between 8:52 PM and 3:37 AM? 405 What is 328 minutes after 5:24 AM? 10:52 AM What is 581 minutes before 10:39 AM? 12:58 AM How many minutes are there between 6:30 PM and 3:50 AM? 560 What is 582 minutes before 6:51 AM? 9:09 PM How many minutes are there between 3:17 AM and 9:16 AM? 359 What is 292 minutes before 10:21 PM? 5:29 PM What is 492 minutes after 8:44 AM? 4:56 PM What is 274 minutes after 9:06 PM? 1:40 AM How many minutes are there between 4:27 PM and 4:10 AM? 703 How many minutes are there between 12:33 AM and 3:06 AM? 153 What is 421 minutes after 10:51 PM? 5:52 AM How many minutes are there between 3:57 AM and 3:16 PM? 679 How many minutes are there between 3:59 AM and 7:54 AM? 235 What is 291 minutes before 1:21 PM? 8:30 AM What is 408 minutes before 4:52 AM? 10:04 PM How many minutes are there between 12:47 PM and 7:51 PM? 424 How many minutes are there between 8:30 AM and 11:41 AM? 191 How many minutes are there between 3:47 PM and 10:56 PM? 429 How many minutes are there between 6:17 PM and 2:44 AM? 507 What is 660 minutes before 10:17 AM? 11:17 PM How many minutes are there between 8:24 PM and 7:42 AM? 678 How many minutes are there between 8:21 AM and 12:21 PM? 240 What is 702 minutes after 3:42 AM? 3:24 PM What is 408 minutes before 7:34 PM? 12:46 PM How many minutes are there between 2:34 AM and 8:59 AM? 385 How many minutes are there between 5:22 PM and 7:56 PM? 154 How many minutes are there between 2:29 PM and 1:47 AM? 678 What is 12 minutes before 11:21 PM? 11:09 PM How many minutes are there between 11:13 AM and 5:38 PM? 385 What is 367 minutes after 10:39 AM? 4:46 PM How many minutes are there between 10:41 AM and 2:36 PM? 235
Suppose -5i - 15 = 0, 0i = 5n - 4i - 332. Does 16 divide n? True Let k = 193 + -63. Does 26 divide k? True Let b(g) = 10g2 + g + 5g - 7 + 7g - g3. Is b(11) a multiple of 15? True Does 10 divide (-30 + 5)(-12)/15? True Let m(y) = y*2 + 9y + 5. Is m(-10) a multiple of 15? True Let y(q) = 8q + 15. Let s(x) = 25x + 44. Let t(v) = -6s(v) + 17y(v). Does 13 divide t(-5)? False Suppose 4z = -5j + 3j + 110, 5j = -5z + 130. Is 4 a factor of z? False Suppose -14 = -54n + 52n. Is n even? False Let y = 3 - -1. Suppose -19 = yz - 67. Suppose -32 = -5b - c - 2, 3c - z = -2b. Does 3 divide b? True Let x = -22 + 11. Suppose -3l + 2l + 2 = 0. Does 7 divide (l/1 - x) + 0? False Let r be (1/(-1))/(1/33). Let z = 63 + r. Is 15 a factor of z - (1 + -2 + 1)? True Let u = -37 + 68. Is u even? False Let x(p) = -2p*3 - 6p*2 - 7p - 8. Is 13 a factor of x(-4)? True Let k be ((-8)/(-1))/(3/36). Suppose -213 = -4p - 5r, 248 = 3p - 4r + k. Is p a multiple of 13? True Suppose -6 = -2h + 4u + 2, -2u - 40 = -4h. Suppose -3n + h = 3. Suppose nf - 6f + 45 = 0. Does 7 divide f? False Let g(s) = 5s + 7 - 4 - 7 - 20s. Let n be (0 + 2)/(1/(-2)). Is g(n) a multiple of 23? False Suppose -n + 16 = -0d - 3d, 8 = -n - 5d. Let l(g) = g*3 - 7g2 + g - 4. Is l(n) even? False Let g(t) = -t3 + 9t2 + 3t - 13. Suppose 0p + x - 12 = p, 5p + 95 = -2x. Let w = p - -26. Is 14 a factor of g(w)? True Let l be 46/3 - 2/6. Let a = 25 - l. Does 5 divide a? True Let r(t) = -t2 + 16t + 3. Let l be 7 + 5 + 0/(-3). Is r(l) a multiple of 17? True Let s(z) = 2z2 + 9z + 9. Let a be s(7). Suppose -a = -6j + j. Is 17 a factor of j? True Let r = -11 + 14. Suppose -c + 106 = 3f, 2f + rc - 40 - 26 = 0. Is f a multiple of 18? True Suppose 2 = 2s - 3h, 36 - 14 = 5s + h. Let w be (43/2)/(s/(-8)). Let n = w + 85. Is n a multiple of 21? True Let a(p) = p + 4. Let z be a(3). Let x = z + -1. Is 6 a factor of x? True Let w = -65 - -95. Suppose -p + 0p = -w. Does 11 divide p? False Suppose -3s = 2s - 190. Suppose t - s = -12. Suppose 3q - 19 = 4p + t, -49 = -5q - 2p. Is 11 a factor of q? True Suppose -5k = -2j + 23, -3 + 4 = 5k + 4j. Let r be (2 - 38)k/2. Suppose 2u = -u + r. Is u a multiple of 6? True Suppose 91 = 5k - 39. Does 13 divide k? True Let x be ((-3)/2)/(3/(-8)). Suppose xs = 5s. Suppose s = -3y + 2m + 120, m + 2m = -y + 51. Does 21 divide y? True Let u(a) = -a*2 + 8a - 7. Let b be u(6). Suppose -k = -3z + 39, 0z = -4z - bk + 52. Suppose 9 = 2s - z. Is 11 a factor of s? True Let g(r) = r3 + 4r*2 + r - 2. Let n be g(-4). Is -272/n3 a multiple of 9? True Let i be (-3250)/(-40) + (-3)/(-4). Let r = i + -44. Is r a multiple of 13? False Is ((-2)/(-3))/(3/369) a multiple of 20? False Let y(r) = 2r*2 + 11r + 21. Is 12 a factor of y(-9)? True Let s(a) = 18a3 - 2a*2 + 2a - 1. Let k be (-2)/4(1 - 3). Is 11 a factor of s(k)? False Suppose -3m = -4m + 17. Does 17 divide m? True Let c(p) be the third derivative of -p4/6 - p3 - 3p*2. Is 17 a factor of c(-8)? False Let x be (-4 - 2) + 31. Let p be (2/x)/(1/(-18)). Suppose 2 = j - p. Is j a multiple of 13? False Let z be 2(-1 + (-2)/4). Is z/(-6) - (-54)/4 a multiple of 14? True Is 15 + 0 - 16/16 a multiple of 10? False Suppose -2g = -6g + 12. Let l(r) = -r + 0r + 27 - rg + 17. Is l(0) a multiple of 18? False Let p(r) = -r2 + 7r - 6. Let a be p(6). Suppose -5z + 135 = -az. Is 8 a factor of z? False Let h(b) = b2 + b + 5. Let x be h(0). Let o be (-1)/((-16)/5 + 3). Suppose z - oa + 11 = -z, 3a - 50 = -xz. Is 7 a factor of z? True Let l(x) = -x*3 - 2x*2 - 2. Let t be l(-2). Is 12 a factor of t/(-7) - (-332)/14? True Is 16 a factor of -2 + 3 + 414? False Suppose -93 = -5g + 77. Is g a multiple of 3? False Suppose 13 - 113 = -5j. Suppose -5o = j, 3y = -3o - o - 10. Does 3 divide (-2 + -2)/y - -6? False Suppose 5u = -4u + 162. Is u even? True Suppose i + i = 6. Suppose 3n = 4l - 21, 0 = -2l - 3l - in + 33. Is l/8 - (-516)/16 a multiple of 17? False Suppose 0 = 7h - 3h - 224. Suppose 0v - h = -4v. Is 7 a factor of v? True Let s = -90 - -124. Is 4 a factor of s? False Suppose 10b - 5b + 201 = 2m, 3b - 9 = 0. Is 27 a factor of m? True Suppose -5f - 2g - g = -385, f + 3g = 89. Is 37 a factor of f? True Let m be ((2 - 2)/(-2))/(-1). Suppose -2v + mv + 5z = -9, -z + 1 = v. Is 14 a factor of (v + -27)/(1-1)? False Let l(f) = 13f + 1. Let q be l(-4). Suppose 0 = 3c + 3o - 228, -5o - 193 - 237 = -5c. Let x = q + c. Is x a multiple of 9? False Let s = 7 - 5. Suppose -94 = -sq + 6. Let o = q - 28. Is 11 a factor of o? True Let k = 7 + 0. Let f = 14 - k. Does 4 divide f? False Let l(p) = -p3 + p2 - 2. Let k be l(0). Is (-42)/(1 - (k - -5)) a multiple of 21? True Let s = -16 - -20. Suppose -4u + 169 = -9r + sr, 4 = -4r. Is u a multiple of 21? False Let r be (2 + -5)/((-2)/(-26)). Let l = -3 - r. Does 9 divide l? True Let b(i) = 19i - 1. Let o(x) = -58x + 2. Let a(s) = 7b(s) + 2o(s). Let q be a(3). Suppose 33 + 7 = 3f + 5k, 4f - q = -4k. Is f a multiple of 10? True Let p = 10 + 2. Is 4 a factor of p? True Let p = -19 + 95. Does 15 divide p? False Suppose 5f - 2f = -12. Let j be (-2 - f - 0) + 7. Is 8 a factor of (-48)/10(-30)/j? True Is 32 a factor of 2 - ((-16)/(-4) + -2) - -64? True Suppose -5b + 15 = 5z, 12 = -2z + b + 3b. Let x = 0 + z. Suppose -i - o - o + 16 = x, -3i - o = -33. Is 10 a factor of i? True Let w(u) = 4u + 1. Let b be w(1). Suppose 4p - 16 = -2k, 0p + p - 15 = bk. Suppose 3 = r + o, -3o + 13 = pr - 4. Does 4 divide r? True Let n(x) = x + 5. Let m(j) = j*2 - j - 2. Let a be m(3). Let h be n(a). Suppose -o - 2o = 4p - h, -5o - 5 = 0. Is 3 a factor of p? True Is 4 a factor of 9/(-4 - (-70)/16)? True Let k be -1 - 1 - (-3 - -10). Let d be k(-2)/3 + -1. Suppose x = -0s - 4s + 139, -4x + 160 = ds. Is s a multiple of 18? True Suppose -2c = -c - 36. Suppose -l = -c - 36. Is 25 a factor of l? False Let f(v) = v*3 - 3v*2 + 2v + 1. Let d be f(2). Let g = d - -3. Is (-18)/(-3)2/g a multiple of 2? False Suppose 3f + 6 = 12. Suppose -fg + g = -52. Does 26 divide g? True Is (-2 - (0 - 1)) + 21 a multiple of 5? True Let y(q) = q3 - 6q*2 + 7q - 6. Let l be y(5). Suppose 23 = c - 5m, 2c + lm + 17 - 49 = 0. Does 9 divide c? True Let x(t) = 2t*2 + 10t + 8. Let m be x(-8). Is 12 a factor of (-12)/8m/(-6)? False Let u = 167 - 119. Is 12 a factor of u? True Let r(z) = -z + 10. Let t be r(9). Is (-5)/(t3/(-33)) a multiple of 11? True Let u(x) = 2x2 - x + 8. Does 22 divide u(-4)? True Let b be (-500)/(-6) + (-1)/3. Let q(p) = -2p - 5. Let t be q(-7). Suppose b - t = 2l. Is 13 a factor of l? False Does 26 divide 3(0 + -2)-23? False Let y(j) = j3 + 9j*2 - 15j - 6. Let l be y(-10). Suppose -3a + 34 = -l. Is 20 a factor of a? False Suppose 2174 = 10f + 534. Is 41 a factor of f? True Let g = -80 - -160. Does 20 divide g? True Let c = 147 - 93. Does 11 divide c? False Suppose -24 = 2m - 120. Is m a multiple of 12? True Let j(y) be the third derivative of y4/2 + 3y*2. Does 6 divide j(1)? True Suppose 0 = 4v - 104 - 88. Does 24 divide v? True Let f = 0 + -1. Let z(q) = 6q2 - 1. Is 2 a factor of z(f)? False Suppose 0 = 5a + 1 - 16. Let l = a + 29. Does 7 divide l? False Let f(z) = -13z - 1. Suppose -5p + 4 = 5l - 2l, 0 = 3p - 4l + 15. Is 6 a factor of f(p)? True Let p(c) = 3c - 3c - 3c2 + 6c*3 - 5c*3 - 2c. Does 8 divide p(4)? True Let n = -28 + 55. Is 6 a factor of n? False Suppose -109 = -i + u - 6u, -4i + 561 = -5u. Is i a multiple of 21? False Suppose -3s = -6s + 210. Suppose s = -3y + 8y - 5m, -3m = 3y - 48. Is 8 a factor of y? False Let t = 133 - 93. Is 8 a factor of t? True Let t be (3 + 0)(-2)/(-3). Is t/(((-2)/45)/(-1)) a multiple of 15? True Suppose -2u - 3r - 1 = 0, -2r - 3r = -4u + 9. Let j be (3 + -2)/u-3. Is 4 a factor of (32/(-12))/(1/j)? True Let k(a) = -2 - 7a - 23a - 4 + 4. Does 10 divide k(-2)? False Is 2 a factor of (185/(-15))/(2/(-6))? False Suppose -2c - 2 = -12. Does 3 divide c? False Suppose 4 = 3p + 34. Let k(i) = -2i*3 + 13i*2 - 6i - 9. Let b(u) = 3u3 - 14u*2 + 6u + 8. Let y(r) = 3b(r) + 4k(r). Is 13 a factor of y(p)? False Let v be -1 - -1 - (1 + 0). Let b(x) = -x3 - x2 - 1. Let y(q) = q3 + q2 + q - 6. Let s(g) = vy(g) - 2b(g). Is s(0) a multiple of 5? False Let u = 21 - 6. Is u a multiple of 13? False
Suppose -3s - 8 - 1 = -n, 0 = -4s - 12. Solve nm + 4 = -4j + 4m, 5j = -4m + 22 for j. 2 Let n be 2/4 + (-45)/(-18). Let m = -3 - -12. Suppose 0 = -2i + 4b - b - 3, -m = -nb. Solve 4d = 5r + 14 + 3, id = -r - 11 for r. -5 Let w be -2 + (-2 - -4) - -4. Let o be (-2)/(-8) - 19/(-4). Suppose -3u = oi - 40, i = u + 4i - 20. Solve -c = -wc + h + 7, h + 11 = uc for c. 2 Suppose -2 + 5 = d. Solve -g - 11 = 3g + dt, -10 = 3g + 4t for g. -2 Let u = 6 + 6. Suppose -4j = -u + 4. Suppose -6 = -5l + 4. Solve -2z + 7z + lp - 8 = 0, jz - 5p = 9 for z. 2 Suppose 6s = 7s - 2. Solve 5t + 0h = -sh - 12, 4h + 4 = 0 for t. -2 Suppose -23 + 31 = 4i. Solve h - 17 = -2z - 2h, -ih = -3z + 6 for z. 4 Suppose 5 = 4y - 7. Suppose 2z - a - 4 = z, z - 3a + 6 = 0. Let h be (-3)/z + (-2)/(-6). Solve -2w = -hw + 8, yc - 7 = w for c. 1 Let p = 24 + -21. Solve -4i - 5k = 9 - 0, -pi + 37 = -5k for i. 4 Suppose 8 = 3h + 2. Let i(u) = 2u3 - u3 - u*2 - 2u + 1 - u*2. Let v be i(3). Solve hn + 5z = 4 + 6, 3n - vz = -8 for n. 0 Suppose -4b = 5m - 35, 0b + m - 18 = -3b. Let h(v) = 3v - 10. Let l be h(b). Solve 3w + 8 = 5z - 15, 0 = lw + 2z - 3 for w. -1 Let h be (1/(-2))/((-5)/20). Suppose 12 = 2n + hn. Solve na - 15 = 5m, a - 2m = 3m + 5 for a. 5 Suppose -16h = -19h + 24. Solve 2k + 4w = 2w + h, 4k = -2w + 12 for k. 2 Suppose 2b - 31 = -17. Solve 0 = m + 3n + b, n = 6n + 20 for m. 5 Let n(m) = -m*2 + 8m + 6. Let l be n(8). Let f be (-22)/(-12) + 1/l. Let a be f(0 - -2)1. Solve w + 0 = 3o - 4, 4o + aw = 0 for o. 1 Let x(b) = -b2 + 14b - 9. Let u be x(13). Solve 4 = -2l - 2j - 0, -5j - 1 = -ul for l. -1 Let q = -24 - -39. Solve b + 3o = 4b + 30, -q = -3o for b. -5 Let d(h) = -4h*3 - 2h*2 + 1. Let c be d(-1). Solve 0 = -5a - 2j - 3, -1 = 4a + cj - 0j for a. -1 Let c(r) = -r*2 + 11r - 25. Let b be c(6). Solve 0 = bs + 15, -5m - 4s + 2 + 11 = 0 for m. 5 Suppose -q + 11 = -2n, 0 = q - 3n - 5 - 6. Solve 4y + q = 5o + 2, 2y = -o + 13 for o. 5 Suppose 5 = -3q + 4q. Solve 1 = 5a - qn - 4, 4 = 4a - n for a. 1 Suppose 0 = 3n + x - 80, 0 = n - 3x - 6 - 4. Suppose 35 = 5l + 10. Suppose -5v - 4z = -9, v + 2z = -3v + 12. Solve vf - n = ly, f - 1 = -y - 0f for y. -2 Suppose 0 = -w + 2 - 2. Solve 2s = -2s + 4v - 8, w = -3s + 5v - 10 for s. 0 Let d = 63 + -28. Suppose d - 4 = c. Suppose -4r + c = 3p, -4p + 13 + 3 = -r. Solve 0 = -2v - 3h - 6, 4 = 2v - rh - 4 for v. 0 Suppose -r + 3k - 1 = 0, k + 9 = 5r - 0k. Solve -h - t = 5, -rh + 3h + 1 = t for h. -3 Let g be 2/4 + (-477)/6. Let x = g - -135. Let o = -19 + x. Solve z - 5u + o = -3z, 0 = -5z - 3u for z. -3 Let a be -6(12/9)/(-2). Solve -n + 1 = -w + 4w, 4n = -aw - 4 for w. 1 Let w(f) = f*3 + 10f*2 + 10f + 11. Let x be w(-9). Solve -xc + 4o - 29 + 7 = 0, 5c - o + 28 = 0 for c. -5 Let p be (1/(-2))/(2/(-28)). Suppose 0 = -5i + 8 + p. Suppose 4j + 5r - 12 - 21 = 0, -ij - 5r = -21. Solve 0n + 21 = 2y + 5n, 3y = -n + j for y. 3 Let d(z) = -z. Let o be d(-2). Solve -oa - 13 = 5t + 7, 0 = -t + 3a + 13 for t. -2 Suppose 19 = -5l - 6. Let u = -3 - l. Suppose um + 15 = 7m. Solve mq = -5f - 1, f - 2q + 3 = -5 for f. -2 Let h = 2 + 0. Let g be 0/(h + -1) - -2. Suppose gs + 2l + 85 = 7s, 4s - 2l = 70. Solve 3i = -0 + s, -4m - 23 = -3i for m. -2 Suppose -6l = -2l. Solve l = 2w - 4i + 6, -4w - 12 = 2i + 10 for w. -5 Let i(a) = 4a*2 + 2a - 1. Let w be i(1). Solve p = wf - p - 4, 3f - 2 = p for f. 0 Let w be (0 + 1)/(4/20). Solve -7 = o - v, -wo + 4v = -4o + 19 for o. -3 Let w be (-64)/(-12) - (-8)/(-6). Solve 5n - wn = 2k, n + 3 = -k for n. -2 Let u = -61 + 83. Solve -4k - 2v = u, 3v + 7 + 11 = -k for k. -3 Suppose -5v - 44 + 64 = 0. Suppose x + 5k = -15, 0x + k = 3x - 3. Solve 5 = -va - 5p, 3p = -2a - xa - 3 for a. 0 Suppose -2x + 9 + 13 = 0. Suppose -x = -3q + 1. Solve 0 = -j - 0j + qa + 11, j - a + 1 = 0 for j. -5 Suppose -4u - 18 = z - 0u, 5z + 135 = -5u. Let c be (-1)/(23/z). Solve -i + 2 = -cr - 9, 4r = -3i - 24 for i. -4 Suppose 0 = -h - 0h. Let c be 28/70 - 36/(-10). Solve h = -4s - cx, 8 = -s + 2x - 4 for s. -4 Suppose -5x + 15 = -10. Suppose -k + 20 = -4q, 2k + 5q + 24 = 3k. Let l be ((-18)/k)/(15/(-20)). Solve -2d - 6 = 0, 0 = -2y + xy - d + l for y. -3 Suppose -2u = 3u. Suppose 4 = 4q - 2m, 2q = -m + 1 - 3. Suppose 0 = -qs - 2s + 8. Solve 4b - 8c + 3c + 9 = u, -sb = -2c - 6 for b. 4 Suppose 0g + 2g = 6. Let f be (52/(-8))/(g/(-6)). Solve 0 = n + 3w - f, n - 9 = -2w - 0 for n. 1 Suppose 4 = 4z, -3x + 2x = -2z. Suppose 22v = 227 - 7. Solve -3r + 3 = -xi - v, 5 = 2r - 5i for r. 5 Suppose 2k - 87 = 5k. Let c = k - -45. Solve -1 = -4d + 15, -d + c = -3v for v. -4 Let p(g) = -g3 - 6g*2 - 2g - 9. Let d be p(-6). Let q = -1 + -1. Let z be q + 1 + d - 0. Solve 4i - zb = 14, 16 = -4b - 4 for i. 1 Let p = -39 + 40. Solve 5j + 15 = -0j, -p = 2n - j for n. -2 Suppose 4n = 4 + 8. Suppose -11 = -t - n. Suppose -f = 0, u - 5u + t = 3f. Solve -5l - 32 = 3v, -uv - 3v - 24 = l for l. -4 Let o(h) = -h - 5. Let c be o(-10). Suppose -s = n - 29, -68 - 84 = -cs + 2n. Solve 4l - 2g - 5 = g, 2l = -4g + s for l. 5 Let m = 37 - 35. Solve -3c - 2n = -4 + 6, 2n - m = -5c for c. 2 Let x(i) = -2i - 10. Let f be x(-6). Let r = -1 - 0. Let l(p) = -3p + 1. Let n be l(r). Solve nw = 3z - 11, -fw = 2z + 3z - 1 for z. 1 Let i be 2/(-7) + 69/21. Suppose -il = -7l + 4. Let t = l + -1. Solve t = 3g - 5o + 5, 4o - 17 = -2g + 7g for g. -5 Suppose -29 = -5j + 16. Let b(w) = -w + 13. Let m be b(j). Solve 4i = -5c + 2c - 4, 4i + m = 0 for c. 0 Suppose -2d + 12 = -2. Let p be ((-5)/3)/(d/(-21)). Solve 4n + 30 = -n - 5a, pa + 6 = 3n for n. -3 Let p be 20/(-5) + 0 - (-10 - -1). Solve 0 = -2s + 3s - pr - 10, 3r = s - 4 for s. -5 Suppose -17 = -r - 4t + 1, -22 = -5r - 3t. Let q = 15 - 8. Solve rc + q + 2 = 5f, 4c + 9 = f for f. 1 Let l(i) = -2i + 39. Let p be l(18). Solve 0 = k + p, 5k + 19 = -3r - r for r. -1 Let s be (-2 + 12/4)-1. Let f be s - -1 - 0/2. Solve -h = -4c - 18, 5h = 5c - fc + 30 for c. -4 Let a be 175/2 + (-4)/8. Suppose 4s - 52 = 3c, -22 = 5s + 2c - a. Solve -3v = q - s, -2v - 2v - 5q = -32 for v. 3 Suppose 0 + 16 = 8q. Let t(a) = 3a2 + a - 2. Let v be t(2). Suppose 3l = -l + v. Solve -qp = -lw + 1 + 5, 0 = 2w for p. -3 Let x(s) = s2 - s + 1. Let m be x(2). Suppose -ma = a. Solve g + 4g + 2f - 3 = a, -16 = -4g - 5f for g. -1 Let x = -12 - -18. Let p(a) = a*2 - 4a - 6. Let d be p(x). Solve -23 = -2y + 5m, 3y - d = -y + 2m for y. -1 Suppose 7 = 5r + c - 11, r = 4c + 12. Suppose -rw + 5a - 46 = 0, 0a - 18 = 2w - 5a. Let d = -2 - w. Solve -4y - l = -2l + 16, 3y + d = 5l for y. -4 Suppose h - 2u - 1 = 7, -3h + 22 = -5u. Solve -hb - 8 = -3o - o, -10 = 5b - 3o for b. -2 Let i(o) = -o + 12. Let h be i(11). Let f = -1 + h. Suppose f = m - 0m. Solve mw - 11 = 2w - 3g, -2w + 5g - 13 = 0 for w. -4 Suppose 4g - 71 = 25. Suppose 0 = 4s - 1 - 71. Suppose v - 4x = -6x + s, 2v - 5x = -9. Solve 3t - 3k + g = 0, 2k - v - 11 = 3t for t. -3 Let y be 02/42. Suppose 3j = -yj + 9. Solve -jn - m - 9 = 0, -6n + 4n + 8 = -4m for n. -2 Suppose 0 = -6h + 139 - 43. Solve 0o - 5y + 7 = 3o, -5o + h = 4y for o. 4 Let z(d) = -d*2 - 9d - 2. Let k be z(-8). Solve -a - 4l - k = 0, -a + 2l = -0l for a. -2 Let y(b) = b2 + b + 1. Let g be y(-2). Suppose 0 = 6m + 10m - 13m. Solve -4x = z + 12, 3z - 9 = gx - mx for x. -3 Let q(p) = -p - 13. Let l be q(0). Let u = -8 - l. Let d = -4 + 7. Solve -2f - u = -4v + 1, dv + 3 = -f for v. 0 Let m = -94 - -94. Solve 2b + 6x = 3x + 7, m = 4b + 2x + 6 for b. -4 Let z(d) = d3 - d2 - 2. Let k be z(2). Let p = -4 + 7. Suppose h - 5s - 5 = 0, -h + 5 = -s + ps. Solve -3i - h - 5 = q, 2i - 4 = kq for q. -4 Suppose -20 - 4 = -4a. Solve -4m - 2p = a, 4p = 3p + 5 for m. -4 Let c = 9 - 5. Let p(h) = h*2 - 4h + 3. Let f be p(3). Suppose f = -4m + 3a + 3, 1 = -4m - a - 0a. Solve 0 = -3l - 4t, ml = -5l - ct - 8 for l. -4 Let l(y) = -y3 - 5y*2 + 5y - 4. Let m be l(-6). Let z = 2 - -1. Let s be (8/(-6))/((-1)/z). Solve mu = sv - 2, -7v + 2v + 5u + 5 = 0 for v. 0 Suppose 5t - 23 = 7. Solve y + 4 = -5*n + 18, -n = y - t for y. 4
Expand (76i - 55 - 58 + 113)(0 - 4 + 5) - 2 + 59i - 6i - 21i. 108i - 2 Expand 1 - l3 - 1 + l3 - l3 + l3 + (8l2 - 3 + 3)(-19 + 19 + 23l) + 5l3 - l3 + 0l3. 188l*3 Expand 2d*2 + 7745d*3 - 8395d*3 - 3d*2 - 2d + (-3 - 2d + 3)(-d*2 + 2d*2 - 2d*2)(-2 + 0 + 1). -652d3 - d2 - 2d Expand (i*4 + 2128 + 614 + 94)(-4i - 2i + 4i). -2i*5 - 5672i Expand y - y*2 - y + (-1 - 2 - 1)(133 + 155 - 254 - 12y2). 47y*2 - 136 Expand (-5i3 - i3 + 4i3)((-2i - 2 + 2)(-10i + 5i - 10i) + (-2i - 2i + i)(i + i + 0i) - i2 - 2i + 2i). -46i*5 Expand (-2y*4 - 176y*2 + 206y*3 - 206y*3)((-2 + 0 + 4)(2 - 1 - 2) + 0 + 6 + 3). -14y*4 - 1232y*2 Expand (18 + 28 + 9)(25 + 26 + n - 45)(8 - 3 - 5n - 3). -275n2 - 1540n + 660 Expand (29 - 187 + 66)(-2 + 4 - 5)(-7u3 + 2u*3 + 3u*3). -552u*3 Expand 0i*2 - 2i*3 - 2i*2 - 2i*4 + 438 - 436 + 3i*4 - 2i*4 - 3i*4 + (0i2 - i2 + 3i2)(-i*2 + 3i2 + i2) + 0i4 - 4i*4 + 3i4. i4 - 2i3 - 2i2 + 2 Expand g5 + 5g5 - 4g*5 + (-56g*4 + 165g*4 + 147g*4)(2g + 8g + 0g). 2562g*5 Expand (701 - 538 - 2q - 335)(2 + 1 - 5). 4q + 344 Expand (-3 + w*2 + 3)(-31w3 + 81w*3 + 519w - 49w3). w5 + 519w*3 Expand (17 - 7 - 15)(5o + 2 - 5 - o) + 2o - 2 + 2. -18o + 15 Expand (2 - 3h*2 - 2)(-22h3 - 27 + 27) + (-2h + 0 + 0)(-3h2 - h4 + 3h2) + 3h5 - h3 + h*3 + 5h*5 - 4h*5 + 2h*5. 74h*5 Expand (0x*2 - 3x2 + x2)(-3 + 1 + 4) + 2499 - 68x*2 - 2499 + (5x + 2x - 2x)(x + 0x + 0x). -67x*2 Expand (2d + 10d + 0d + (0d + 0d + d)(-1 - 4 - 2))(18d3 + 2377 - 2377). 90d*4 Expand ((-5 + 4 - 1)(9 - 3 + 0) + (-4 - 3 - 3)(-5 + 2 + 0))(p - 11 + 11). 18p Expand (-q2 + 0q + 0q)(1 - 4 + 1) + 1 - 3q2 - 1 + 454q*2 + 45q*2 + 141q*2. 639q*2 Expand (-31o*2 - 29o*2 + 77o*2)(19o3 - 34 + 34). 323o*5 Expand (-b + 5b - b)(971 + 618 - 188). 4203b Expand (-2 + 2g + 2)(-11g + 11g - 12g3 + (43 + 8g*2 - 43)(8g - 24 + 24) - 2g + 2g - g3). 102g*4 Expand (1 - 3 + 4)(-b + 4b - b)(-582 + 121 - 1320). -7124b Expand (6 - 3 - 1 + 0 + 0 - 2 + (1 - 2 + 4)(1 - 1 + 4))(-31v + 31v - 19v*2). -228v*2 Expand -8j + 22j - 16j + 1 - 1 + j + (6j - 3j + 5j)(2 + 1 - 5) + 2j - j - 3j + (-2 - 2 - 1)(j - 1 + 1). -24j Expand (6 - 3 + 1)((m - 5m + 2m)(3 - 4 + 3) - 680m - 879m + 804m). -3036m Expand (364f3 + 20f*4 - 364f*3)(22908 + 1700f - 22908). 34000f*5 Expand (0y - y + 2y)(469y - 191y + 13y)(2y2 + 0y2 - y2). 291y4 Expand (2 - 90s*2 - 103s*2 - 82s*2)(-3 - 1 + 3)((0 - 3 + 4)(2 + 3 - 3) - 2 + 1 + 4). 1375s2 - 10 Expand (0c + 2c + c)(7566c - 2116 - 819 - 7564c). 6c2 - 8805c Expand (-5q - 4q + q)(-29q*3 + 2q*3 - 4q*3)(3 + 6 - 2). 1736q4 Expand (-37 + 7 - 19 + (5 - 1 - 1)(0 - 4 - 4))(-4x4 + x4 + 4x4 + (-2x*2 - 1 + 1)(x*2 + 0x2 + x2) + 3x4 - 2x*4 + 0x*4). 146x*4 Expand ((3 + 0 - 4)(4 - 4 - d3) - d2 - 749 + 197d3 + 749)(0d + 0d - 2d)(4 - 3 - 5). 1584d4 - 8d*3 Expand (-b + 5b - b)(211 + 17 + 420) + (-4 + 4 + b)(-1 + 1 + 2) + 7b - 3b - 3b - 2b + 2b + 2b. 1949b Expand (738 - 738 + 631n)(-5n - 6n + 2n). -5679n2 Expand (-3i - 4i - i3 + 6i)(-i + i - 20i)(27i - 105 + 105). 540i5 + 540i*3 Expand (-1 - 3 + 3 + (-6 + 0 + 4)(2 + 0 - 3) - 2 + 3 + 1 - 5 + 8 - 1)(7m - 7m + 3m*2)(-m*2 + 2m*2 - 2m*2). -15m*4 Expand (-4x + 3x + 3x)(-32 - 7 - 25) + (-3 - 3 + 7)(-5x + 3x - x) + 6x + 23 - 23 + (-1 + 4 - 2)(-3x + 3x - x). -126x Expand (3 - 3 - 1)(-3 + 3 - i + (-5 + 5 - 12)(6i + 96i - 60i)). 505i Expand (1 - 3 + 1 + (-1 + 1 + 2)(1 - 5 + 6) + 74 + 23 - 3)(-2i + 0i + 3i). 97i Expand -2j + 2 - 2 + (5 + 5 - 13)(2 + 2j - 2) - j - j + 3j + (4 - 1 - 2)(4j + 2j - 4j) + 64 - 3j - 64. -8j Expand (16w*2 + 23w - 23w)(-2w + 2w - w + (-2 - 1 + 0)(-5w + 5w - 2w))(-w2 - 2w*2 + 4w*2)(2 - 2 + 1)(-2 + 2 - 1) + 2w5 + w4 - w*4. -78w*5 Expand (13x*3 + 14x*3 - 23x*3)(-11x + 3x + 1516 - 1507 + (5 - 4 + 0)(-2x + 1 - 1)). -40x4 + 36x*3 Expand (-6j - 3j2 + 6j)(3j + 2j - 3j)(-358 + 20 + 22)(-3 + 2 + 0). -1896j3 Expand -52z + 52z + 20z*2 + (7 + 6z - 7)(3z - 2z + 3z) - 2z + 2z + 3z2. 47z*2 Expand (3731111b - 3731111b - 4268b*2)(-b + 0b + 3b). -8536b3 Expand (1 - 1 + 3)(145q - 152q - 368q) + 1 - 1 - 3q. -1128q Expand (-86j + 282j + 662j + 142j + 90j)(12j*2 - 12j*2 + 12j*3). 13080j*4 Expand (3666 - 6908 + 3796)(4k2 + k2 - 6k*2). -554k*2 Expand 20213q - 3567q - 5404q + (4 - 2 - 4)(3q - 5q + q). 11244q Expand -3k4 - 3k*4 + 8k*4 + (-17k + 2k - 6k)(12k*3 - 5k*3 + 6k*3). -271k*4 Expand (-3w + 2w - w)(2w - 2w - 2w2) + w3 + 10w*3 - 17w*3 + (7 - 7 - 2w)(w2 - 28w*2 + 5w*2). 42w3 Expand ((d2 - 1 + 1)(-4 - 2 + 3) - 4d + 4d + 2d*2)(-d + 61 - 61). d*3 Expand (2 - 3 - 1)(-4 + 3 + 3)(-743h*5 + 144215h + h*3 - 144215h + 2h4). 2972h*5 - 8h*4 - 4h*3 Expand (0j*2 + 0j*2 + 6j*3)(6624j - 6627j + 50 + 97). -18j4 + 882j*3 Expand 4 + 2d - 4 + 3d + 4d - 4d + (1 - 1 + d)(-487 - 1106 - 89) + (-d + 2 - 2)(2 - 4 + 0) + 2d + 1 - 3 + 0d. -1673d - 2 Expand (-137 + 218 - 150 + 2j)(-3 + 5 - 3)(7 - 1 - 3). -6j + 207 Expand (-149 - 16i + 149)(-i - 30 + 14i + 22). -208i*2 + 128i Expand (-4 + 1 + 4)(b - 2 + 2 + (0 + 1 + 0)(-4b - b + 6b))(-12446 + 4458 + 261). -15454b Expand (-281 + 68 - 56 + (-2 + 3 + 1)(0 - 2 + 0) + 6 - 1 - 2)(z2 - z2 - z*5). 270z*5 Expand (-3386q + 1653q - 2280q)(5 - 2 - 2). -4013q Expand (-2 + 2 + 3y4)(-3 + 4 + 1 + (4 - 1 - 1)(-5 + 2 + 1) - 2 + 4 - 1)(2 + 3 - 6)(1 - 1 - 1)(1062 - 2129 + 1084). -51y4 Expand (13y*4 - 25 + 25 + (-5y*2 + 10y*2 + 7y*2)(y*2 + 10 - 10))(-2y + 3y + y). 50y5 Expand (-2c2 + c2 + 0c2)(4c3 - 5c3 - c3) + c*5 + 9c*5 + 0c*5 - 73c*5 + 1613c - 1613c. -61c*5 Expand (-21k*2 - 24 + 29k*2 - 9k*2)(1060k + 606k - 1262k)(0k + 0k - 2k). 808k*4 + 19392k*2 Expand (0 - 1 + 0)(l - 3l + 4l) + 0l - 2l + l - 4l + l + l + (635l + 551l - 1309l)(1 - 3 + 1). 118l Expand (-1 - 18 - 11)(-4d + d*3 + 4d) + (8d - 8 + 8)(d2 - d - d2 + 2d2). -14d*3 - 8d*2 Expand (4h*2 - 2h2 - h2)(h3 - 3947202h + 3306 + 3947202h). h5 + 3306h*2 Expand (716 - 547 + 658)(2r - 2r - 3r). -2481r Expand 17m4 + 78m*4 + 11m*4 + (0m - 6m + m)(2 - 7m3 - 2). 141m*4 Expand (-1008 - 2j - 629 - 917)(1 + 0 + 2)(4j3 - 5j*3 + 0j*3). 6j*4 + 7662j*3 Expand (-13580c*3 + 12091c*3 - 7c*4 + 2c*2 + 6c*4)(5c - c - 2c). -2c5 - 2978c*4 + 4c*3 Expand (0d3 + d3 - 2d3)(2d2 - 3 + 3) - 4d2 + d5 + 4d2 + (-2d*3 + 3d*3 - 3d*3)(d - 2 + 2)(-60d + 23 + 61d - 93). -3d*5 + 140d*4 Expand (0t + t + 0t)(t - 2t - t)(-32960t + 32960t + 569t2). -1138t*4 Expand 9964m + 620m3 + 377m*3 + 2 - 9963m + (2m3 - 5m*3 + 4m*3)(0 + 1 - 2). 996m3 + m + 2 Expand (-7 + 45j - 44j - 6)(-390j + 390j - 16j2). -16j*3 + 208j*2 Expand (0 - 2 + 0 - 2 + 0 + 0 - 2 + 1 - 1 + 3 - 1 - 3 + (3 + 1 - 2)(-4 + 2 + 3) - 6 + 1 - 6)(3y - 4y + 0y)(1238 - 603 - 541). 1504y Expand (-1 - 1 + 1)((0 + 2 - 3)(0s - 2s + 0s) + 2 + 141 + s - 33) + (-3s - s + 6s)(0 + 2 - 1). -s - 110 Expand (-5 + 5 + a)(-4a + 4a + 2a) + 4436a - 4454a + 46a2 + 219a*2. 267a*2 - 18a Expand (3 + 0 - 1)(-6w + 3w + 2w)(2 - 2 + 10w)(-111w*2 - 113 + 113). 2220w*4 Expand (457 - 1430 + 3314 + 6170 + 510)(2s - 5 + 5). 18042s Expand (147 - 170f - 263 + 125)(-1 - 2f + 1)(0 + 0 + 1). 340f2 - 18f Expand (778 - 2214 + 963)(2x*5 + 4x - 4x) + (-x5 + x5 + 2x*5)(0 - 3 + 5) - x*5 + 0x*3 + 0x*3. -943x*5 Expand (-2k + k + 0k)(-1389k - 316391 + 316391). 1389k*2 Expand (-6 + 3g + 6)(-1 - 2 + 1)(4g - 2g + g). -18g2 Expand 3g*2 + 0g2 - g2 - 74g2 - 110g*2 - 117g*2 + (0g - 3g - 2g)(-2 + g + 2). -304g*2 Expand (0t + t + t)(-26t*2 + 13t*2 + 9 - 8) + (-3t + 2t + 5t)(-8t*2 - 16t + 16t). -58t*3 + 2t Expand (-2b + 1 - 1)((3b2 - 3b*2 - 3b*3)(-b + 4b + b) - 4 + b4 + 4 - 7b*4 + 3b*4 + 38b*4). -46b**5
Solve 221j - 210j = 55 for j. 5 Solve -s - 6s + 7 = 0 for s. 1 Solve -43t - 53t = 672 for t. -7 Solve -28u = -61u - 66 for u. -2 Solve -6598p + 10 = -6597p for p. 10 Solve -23 = -30m + 7 for m. 1 Solve -m = 13m - 14 for m. 1 Solve -58 = -16l + 70 for l. 8 Solve -1 - 8 = 3q for q. -3 Solve 0 = -4k + 69 - 49 for k. 5 Solve -40 = -6h - 14h for h. 2 Solve -7y + 35 = 42 for y. -1 Solve -1 = -b - 6 for b. -5 Solve -41j - 197 = 8 for j. -5 Solve 12b = -13b + 175 for b. 7 Solve -3 = -9o + 8o for o. 3 Solve 58i - 65i + 14 = 0 for i. 2 Solve 4i + 14i = -36 for i. -2 Solve g = 2g + 2 for g. -2 Solve 1 = -k + 2k for k. 1 Solve 0 = 18v - 5 + 23 for v. -1 Solve -5685l = -5690l - 35 for l. -7 Solve -109p + 123p = -28 for p. -2 Solve 5200j = 5197j + 3 for j. 1 Solve -12l - 3017 = -3113 for l. 8 Solve -3p + 8 + 4 = 0 for p. 4 Solve 0 = -3n + 39 - 18 for n. 7 Solve -16y = 6y - 66 for y. 3 Solve -8m = -5m + 12 for m. -4 Solve -2s = 2s for s. 0 Solve 0 = 2902u - 2930u - 56 for u. -2 Solve -5g = -23 - 2 for g. 5 Solve 2o - 110 = 24o for o. -5 Solve 24 - 9 = -3l for l. -5 Solve 0 = -4u + 16 + 4 for u. 5 Solve 9j + 15 = 14j for j. 3 Solve 0 = 40l - 324 + 124 for l. 5 Solve 0 = 12o - 4276 + 4336 for o. -5 Solve -5 = 3x + 7 for x. -4 Solve 3c - 8 = 5c for c. -4 Solve 7 = 16p + 39 for p. -2 Solve 17k + 125 = 42k for k. 5 Solve -5a + 8 = -9a for a. -2 Solve -y = y + 10 for y. -5 Solve 24l - 36 = 42l for l. -2 Solve 2d = 10d + 8 for d. -1 Solve -46 = -9w - 28 for w. 2 Solve -22 = -7i - 71 for i. -7 Solve -2n + 7n = n for n. 0 Solve -19b = -7 - 12 for b. 1 Solve 16 - 1 = 5i for i. 3 Solve -5o - 11 = 14 for o. -5 Solve -113s = -116s for s. 0 Solve -1036v = -1047v + 55 for v. 5 Solve u + 7 = 2 for u. -5 Solve 7j = 5 + 23 for j. 4 Solve 324v + 78 = 285v for v. -2 Solve 15j - 14j = -2 for j. -2 Solve -4p + 2 = -6p for p. -1 Solve 153 = -44c - 243 for c. -9 Solve -21m + 16m = -11m for m. 0 Solve 4w + 1 = -3 for w. -1 Solve 12u - 21 = 51 for u. 6 Solve -22b - 20 = -17b for b. -4 Solve 6l + 14 - 2 = 0 for l. -2 Solve 59 = -2c + 65 for c. 3 Solve 4l - 9l = 0 for l. 0 Solve 17v + 181 = 130 for v. -3 Solve -190i + 108 = -178i for i. 9 Solve 0 = -29b + 75b - 184 for b. 4 Solve 46 + 14 = -30l for l. -2 Solve -52g - 5 = -51g for g. -5 Solve 24h = 32h - 40 for h. 5 Solve 0 = 49n - 14n - 105 for n. 3 Solve 3b = -57 + 48 for b. -3 Solve -u + 3 = -0u for u. 3 Solve 162 = 20y + 182 for y. -1 Solve -2o - 125 = -27o for o. 5 Solve 6 = -m + 8 for m. 2 Solve 0 = 36s - 37s + 3 for s. 3 Solve -2 = -4o + 2 for o. 1 Solve 28 = 49s - 70 for s. 2 Solve -8d = 1208 - 1168 for d. -5 Solve 14w - 6 - 22 = 0 for w. 2 Solve -937 = 7j - 937 for j. 0 Solve 15p + 105 = 30p for p. 7 Solve -16j = -7j - 27 for j. 3 Solve 38 = -4i + 50 for i. 3 Solve 0 = -13v - 5v + 54 for v. 3 Solve 0 = 73v - 42v - 31 for v. 1 Solve -9w - 352 = -442 for w. 10 Solve -15j - 60 = -5j for j. -6 Solve 2653p - 2651p = 4 for p. 2 Solve 44 - 14 = 10c for c. 3 Solve 0 = -0p + 11p for p. 0 Solve -10 = 9x - 28 for x. 2 Solve 0 = 56y - 61y + 25 for y. 5 Solve -3l - 134 + 116 = 0 for l. -6 Solve -8 = 134f - 136f for f. 4 Solve 540 = -7t + 547 for t. 1 Solve 18o - 6 = 12o for o. 1 Solve 39k - 24 = 45k for k. -4 Solve 0 = 2n - 7376 + 7382 for n. -3 Solve -24x - 8 = -20x for x. -2 Solve 4l = -7l - l for l. 0 Solve 5v = -2 + 7 for v. 1 Solve -6t = 2t for t. 0 Solve 2t + 13 = 19 for t. 3 Solve 0 = 6x - 20 + 8 for x. 2 Solve 0 = r - 14 + 12 for r. 2 Solve 13l - 7 = 6 for l. 1 Solve -7t = 7t - 28 for t. 2 Solve -201 + 202 = y for y. 1 Solve -18 = 6l - 36 for l. 3 Solve -2h + 13 - 7 = 0 for h. 3 Solve -37 + 40 = 3q for q. 1 Solve 13b = 44b - 248 for b. 8 Solve -4c = -0 - 8 for c. 2 Solve -43n = -49n for n. 0 Solve 7t = 2t + 5 for t. 1 Solve 13p - 39 = -0 for p. 3 Solve -10 = 16s + 70 for s. -5 Solve -1350i + 7 = -1357i for i. -1 Solve 5 = -o + 4 for o. -1 Solve 4i = 17 - 17 for i. 0 Solve -10f = -4f + 12 for f. -2 Solve 1 = -5c + 6 for c. 1 Solve -4q + 3 = -3q for q. 3 Solve -145x - 66 = 514 for x. -4 Solve 32h = 41h for h. 0 Solve 439t + 594 = 493t for t. 11 Solve -7p = -26 + 61 for p. -5 Solve -4h - 6 = -14 for h. 2 Solve 9d = -7d + 32 for d. 2 Solve 4a = 7a for a. 0 Solve -n - 65 = 12n for n. -5 Solve 4 = 7d + 18 for d. -2 Solve 15q = 20q - 10 for q. 2 Solve -4f = 29 - 13 for f. -4 Solve -846h = -845h for h. 0 Solve -2v = 12 - 20 for v. 4 Solve -56s - 97s = 1377 for s. -9 Solve 0 = 6t + 6 - 0 for t. -1 Solve 0 = 2n - 14 + 10 for n. 2 Solve 3p - 9 = -24 for p. -5 Solve 0 = 5k - 199 + 204 for k. -1 Solve 3d + 30 = -3d for d. -5 Solve 668 = -h + 667 for h. -1 Solve 6q + 39 = -7q for q. -3 Solve 5y = 2y + 15 for y. 5 Solve -14r = -3521 + 3661 for r. -10 Solve -2 = 8m + 6 for m. -1 Solve -25 + 9 = 8p for p. -2 Solve 227z = 222z + 35 for z. 7 Solve -21x + 116 - 263 = 0 for x. -7 Solve 2f - 123 = -129 for f. -3 Solve 0 = 4t + 4147 - 4111 for t. -9 Solve 1881 = -6r + 1893 for r. 2 Solve 5v = -504 + 499 for v. -1 Solve -6x = -2 - 10 for x. 2 Solve -17g - 65 = -4g for g. -5 Solve 33s = -36 + 300 for s. 8 Solve 9d + 28 = -8 for d. -4 Solve 48v - 452 - 28 = 0 for v. 10 Solve 0 = 1392w - 1383w - 18 for w. 2 Solve 11d - 15 = 7 for d. 2 Solve 31z + 37 + 56 = 0 for z. -3 Solve 10 - 1 = k for k. 9 Solve -39 = -21q - 165 for q. -6 Solve 0 = 71f - 311 - 257 for f. 8 Solve -2t - 10 + 2 = 0 for t. -4 Solve -80v + 94v - 28 = 0 for v. 2 Solve -7p + 16p = 63 for p. 7 Solve -2y = -3y + 8y for y. 0 Solve 9 - 8 = x for x. 1 Solve -11 = 2y - 15 for y. 2 Solve 832 - 976 = 18m for m. -8 Solve 0 = 23d - 13d + 20 for d. -2 Solve 25d - 4 = 29d for d. -1 Solve 7 - 6 = -p for p. -1 Solve 5f - 17 = -7 for f. 2 Solve 3c = c - 8 for c. -4 Solve 0 = 495c - 511c - 80 for c. -5 Solve 0 + 4 = -4a for a. -1 Solve 2l + 24 = 16 for l. -4 Solve -2i - 5i = 21 for i. -3 Solve 8l + 0l + 40 = 0 for l. -5 Solve 42 = 44k - 46 for k. 2 Solve -32 = -10n - 82 for n. -5 Solve 354 = 12y + 47y for y. 6 Solve 10g = 69 + 1 for g. 7 Solve 217v + 102 = 234v for v. 6 Solve -69o = -138 - 0 for o. 2 Solve 23n + 2n + 75 = 0 for n. -3 Solve 57k - 71k = 0 for k. 0 Solve 0 = 5t - 14t - 18 for t. -2 Solve -6y - 3y = -27 for y. 3 Solve 185w - 169w = 80 for w. 5 Solve 3l - 26 = 16l for l. -2 Solve 8f - 39 + 87 = 0 for f. -6 Solve 35 = -9f - 10 for f. -5 Solve 46j = -3j + 196 for j. 4 Solve -11y = 4y for y. 0 Solve 14o + 15 = 19o for o. 3 Solve 54 + 26 = -16m for m. -5 Solve -4q = 2 - 18 for q. 4 Solve 0 = -105o + 94o - 11 for o. -1 Solve -39t + 41t - 8 = 0 for t. 4 Solve 12g = 4g for g. 0 Solve -6f + 19f - 26 = 0 for f. 2 Solve 0 = -11v + 413 - 314 for v. 9 Solve 57 + 117 = -87g for g. -2 Solve -6t = -13t - 21 for t. -3 Solve -3z = -2z - 5 for z. 5 Solve 0 = -17d - 17d + 46d for d. 0 Solve 0 = -15n + 6 - 36 for n. -2 Solve -2 = 2b + 2 for b. -2 Solve -12y + 11y - 3 = 0 for y. -3 Solve -3w = -7 + 1 for w. 2 Solve 7x + 13 = -8 for x. -3 Solve -4y - 55 = -63 for y. 2 Solve 107a - 84 = 95a for a. 7 Solve -465y + 462y + 18 = 0 for y. 6 Solve -1 = -3w - 1 for w. 0 Solve -9h = -h + 24 for h. -3 Solve -6 = -4k + k for k. 2 Solve 0 = -35u - 2 + 107 for u. 3 Solve -10j + 8 + 42 = 0 for j. 5 Solve 6t - 231 = -27t for t. 7 Solve -3m + 6m - 9 = 0 for m. 3 Solve -6y = -11y + 5 for y. 1 Solve -37 = 5s - 12 for s. -5 Solve 30 = -9x + 21 for x. -1 Solve 0 = 159h - 157h for h. 0 Solve -7n = -5n + 10 for n. -5 Solve -76 - 9 = 85d for d. -1 Solve 7t = 5t for t. 0 Solve -64y + 70 = -78y for y. -5 Solve 0 = 11g - 12g + 4 for g. 4 Solve -115q - 4 = -119q for q. 1 Solve 2o - 6o - 16 = 0 for o. -4 Solve 15v - 77 = -2 for v. 5 Solve 0 = -24f + 285 - 69 for f. 9 Solve -53b + 69b + 96 = 0 for b. -6 Solve 9 = 6m - 3 for m. 2 Solve 177 = -17i + 109 for i. -4 Solve -140q + 5 = -139q for q. 5 Solve 35c - 45c = 0 for c. 0 Solve -8w - 11757 = -11813 for w. 7 Solve 38o - 33o - 15 = 0 for o. 3 Solve 16o + 16o = 0 for o. 0 Solve 46y = 12y + 170 for y. 5 Solve -4l - 7 - 17 = 0 for l. -6 Solve -23 + 11 = -6p for p. 2 Solve -10s - 8 = -6s for s. -2 Solve 0 = -4x + 21 - 41 for x. -5 Solve 0 = 15w + 8 - 53 for w. 3 Solve 0 = -6h + 14h + 24 for h. -3 Solve 9w = -20 + 38 for w. 2 Solve -7 = 5r + 3 for r. -2 Solve 6 = 33p - 27 for p. 1 Solve u + 22 - 31 = 0 for u. 9 Solve 17y = -17y for y. 0 Solve 124o + 20o + 1296 = 0 for o. -9 Solve -11x + 2 - 35 = 0 for x. -3 Solve -8z + 26 = 2 for z. 3 Solve 585r = 553r - 256 for r. -8 Solve 0 = -30u + 33u + 9 for u. -3 Solve 0 = -5j - 103 + 83 for j. -4 Solve -8u = -11u + 15 for u. 5
Let g = -629/11 - -57. Let h = 0.4 + 0.9. Let m = 2.7 + h. Which is the second smallest value? (a) 3 (b) g (c) m a Let l be (-61)/((-14)/4 + 5). Which is the second biggest value? (a) -1/10 (b) 3 (c) 0.2 (d) l c Let y = 62 + -62.104. Let s = y - 0.096. Let k = 2 - 2. Which is the biggest value? (a) s (b) 7 (c) k b Suppose 4g + 0g + 4m - 8 = 0, -g - 3m + 10 = 0. Let h = 0.969 - 0.069. Which is the second biggest value? (a) h (b) g (c) 0 c Let u(h) = -h2 - 3h + 1. Let s be u(-3). Suppose 2l - 4l + 1 = -f, f = l + s. What is the second biggest value in 2/3, f, 0, 4? f Let g = 5.58 - 5.65. Which is the smallest value? (a) 0.3 (b) g (c) -24 c Let q = -220 + 1982/9. Which is the biggest value? (a) -1/5 (b) 2 (c) 0.4 (d) q b Let v = -48 - -48.1. Let l = 4 - 1. Which is the third biggest value? (a) v (b) -17/5 (c) l b Let g = -0.08 - 0.22. Suppose -7j = -6 - 1. What is the second biggest value in g, j, -2/19? -2/19 Let s = 210.33 + -210.2. What is the fourth biggest value in 3/5, -2/21, s, 1? -2/21 Let z = -498 - -491.8. Which is the third biggest value? (a) z (b) -3 (c) 1 a Let s = -602 + 602.2. What is the second smallest value in 2, s, -0.37? s Let y = 43/19 - 591/152. What is the third smallest value in y, 3, -3/5? 3 Let u = -1403 - -1405. What is the second biggest value in u, 7/11, -3? 7/11 Let p be -25 - (-12)/(96/40). Which is the third biggest value? (a) 4 (b) p (c) 0.03 b Suppose -83 + 110 = -9p. Let o = 0.03 + 3.97. Which is the second biggest value? (a) p (b) o (c) 0 (d) 5/3 d Let w = 9/20 + 3/10. Let k = -0.5 + -0.5. Let q = k + 5. Which is the third smallest value? (a) -1/2 (b) q (c) w b Let n = -26 - -36. Let h = 7 - n. Let s = -5 - -4. Which is the second smallest value? (a) s (b) h (c) -4 b Let k = 19 - 20. Let i = -30 + 27. Which is the fourth biggest value? (a) i (b) 1/41 (c) -4 (d) k c Let r(k) = k3 + 10k*2 - 9. Let s be r(-10). Let f be s/(-1) - (2 + -2). Let h = -8/3 - -19/6. What is the third biggest value in -0.1, f, h? -0.1 Suppose 2k = -4d + 10, -2d + 60 - 52 = 4k. Let o(p) = -p3 + 8p*2 + 10p - 4. Let t be o(9). Which is the second smallest value? (a) 4 (b) k (c) t a Let n = 0.04 + 3.96. Let d = -199 + 199.24. What is the third smallest value in 0, d, n? n Let c(n) be the third derivative of 13n2 + n3 + 0 + 0n - 1/8n4. Let u be c(3). What is the second smallest value in u, 4/9, 1? 4/9 Let m = -3.199 - -0.199. What is the biggest value in 0.4, 2/3, m? 2/3 Let m = 308 - 313. What is the second smallest value in 1/3, -4/7, m? -4/7 Let p be (-3)/2450 - -6. Which is the smallest value? (a) -9/5 (b) 1 (c) p a Let i = -0.2 + -0.3. Let j = -2 - 17.5. Let d = -19 - j. Which is the second biggest value? (a) -0.01 (b) d (c) i a Let o = -0.04 - -3.04. Let k = o - 3.2. Let s = 27040 - 27037. Which is the biggest value? (a) s (b) k (c) -0.1 a Let l = -153 - -156. Let j = 0.05 + -3.05. Let k be -2 - (15/(-9) - 1). Which is the third smallest value? (a) l (b) j (c) k a Let u = -103 - -105. Suppose 3t + 3s = 6 - 30, 0 = 2t - 3s + 26. Let x be 4/t - (-4)/35. Which is the third smallest value? (a) u (b) x (c) -2 a Let k be (1 - (-23)/(-22))2. Let x = 188 + -171.1. Let u = 17 - x. Which is the third biggest value? (a) k (b) 1/7 (c) u a Let j = 118 - 120. Suppose 0 = 3h - 2 + 5. Let g be -9 - -2h/j. Which is the third smallest value? (a) 4 (b) -1 (c) g a Suppose 19g + 60 = 79. What is the third smallest value in 0.73, 0.2, g? g Let j = 679 - 18331/27. Which is the third smallest value? (a) j (b) 4/9 (c) -0.2 b Let k = 56.5 + -30. Let x = -21 + k. Let s = x + -6. Which is the biggest value? (a) 1/4 (b) 3 (c) s b Let c = 2.4 - 4. Let x = c + -1.4. Let n = 2.5 + x. What is the biggest value in 2/3, -0.4, n? 2/3 Let l(k) = -k*3 - 13k*2 + 12k - 28. Let o be l(-14). Let a = -8 - -7. What is the third biggest value in a, 2/11, o? a Let x be (-10(-12)/1200)/(8/(-30)). Which is the third biggest value? (a) -75 (b) x (c) -1/4 a Let m = 0.06 + -5.06. Let a(n) = -n2 - 1. Let f be a(-1). What is the third biggest value in m, 0.4, f? m Let g = 3 - 3.2. Let n = 1.75 - -2.25. Which is the smallest value? (a) n (b) -0.18 (c) g c Suppose -4u = -5x + 15, -7u = 3x - 5u + 13. Let m = -72 + 77. Which is the biggest value? (a) m (b) -1/9 (c) x (d) 2/11 a Suppose -25 = 3k + 5m, 3m + 16 = -2k - m. Let v = k - -18. Suppose 31 = 12t - 17. Which is the biggest value? (a) -1/2 (b) t (c) v c Let j = -0.17 + 0.07. Let u be 1 + -1 - 2/15. Let s = 1 + -0.6. Which is the third biggest value? (a) u (b) s (c) j a Let a = -0.284 - 3.716. Let x = -1 + 0. Let s = 0.6 + x. What is the smallest value in s, 5, a? a Let u be (-3)/(-6) + 2/8. Let z(y) = y3 - y2 + 3y + 2. Let q be z(0). Let i be (-32)/(-40)5/q. Which is the third biggest value? (a) u (b) -0.5 (c) i b Let v be 96/80(4/2 + -3). Which is the fourth biggest value? (a) 2 (b) -2/23 (c) 4 (d) v d Let h = -0.9471 + 0.0471. Which is the second biggest value? (a) h (b) -0.1 (c) -2/13 (d) 2/9 b Let n = -3.79 - -5.79. What is the smallest value in n, -0.3, 0, 8? -0.3 Let h = -19/4 + 55/12. Which is the second biggest value? (a) 1 (b) h (c) -32 b Let g(s) = -s*2 + 2. Let j(n) = -6n*2 - 3n - 5. Let v(m) = 4g(m) + j(m). Let f be v(1). Which is the third biggest value? (a) f (b) -0.4 (c) 1 (d) -2 d Let f(p) = p3 + 30p*2 + 32p + 90. Let m be f(-29). Which is the second biggest value? (a) 10 (b) -1/4 (c) m c Let n(t) = t*2 + 13t + 32. Let m be n(-9). What is the second smallest value in -2/5, m, -12? m Let w = 2/33415 - -567923/2205390. Let y be 36/(-33) + 1 + 0. Let l = w + y. Which is the biggest value? (a) -2 (b) 0.3 (c) l b Let r = 3.9 - -1.6. Let t = r - 2.5. What is the smallest value in t, -2, 4? -2 Let c = -1842 + 7295/4. What is the third biggest value in -4, c, -0.4? c Let y be 4/6(-3)/7. Let x = 0.177 + 18.823. Let t = 19 - x. Which is the third smallest value? (a) y (b) t (c) 3 c Let g = -117 - -112. What is the second biggest value in g, 0.2, -1, -1/6? -1/6 Let i = 25895/773499 - -2/8691. Which is the third smallest value? (a) i (b) 1 (c) 4 c Let j = 501 + -410.4. Let w = j - 91. Which is the second biggest value? (a) w (b) 4 (c) -3 (d) -2 a Let g(z) = -2z*2 + 4z + 4. Let v be g(4). Let h = -2.7 - -2.5. What is the smallest value in 2/3, h, -0.3, v? v Let x = 5704 - 5705. Let l be (2/52)/((-2)/12). What is the fourth biggest value in -5, x, l, 5? -5 Let q = -0.2 + 0. Let b be (-4)/(-6) + 12/(-9). Let y be ((-5)/(165/187) - (-5)/3)/(-22). What is the second biggest value in y, b, q? q Let r = 29 - 27. Suppose -8 = rl - 4l. Let m be (-21)/60 + l/16. Which is the second biggest value? (a) -3 (b) m (c) -2 c Let y = 2314.2 + -2314. What is the fourth biggest value in y, -0.1, 3, -2? -2 Let p = -216.6 - -217. Which is the biggest value? (a) -4/5 (b) p (c) 0.8 (d) -2 c Let j = 48.1 - 48. What is the biggest value in -2, -0.4, j? j Let r(u) = u*2 + 5u + 2. Let i(p) = p. Let f(z) = 6i(z) - r(z). Let y be f(0). Let x be (3/(-42))/(1/y). Which is the biggest value? (a) -3 (b) -5 (c) x c Let d = 4186 + -163264/39. Let o = d + 187/273. What is the biggest value in 2, 0.1, -1, o? 2 Let d = 0.2307 - 0.0307. What is the second biggest value in 26, d, 4, -0.1? 4 Let r be 13501/(-56) + 4/(-14). Let n = r + 241. What is the biggest value in -5, n, -2? n Let w be (41/(-410))/((-1)/(-4)). Let z = 0.24 + 0.06. Which is the third smallest value? (a) w (b) -0.2 (c) z c Let u = -4 - -19/5. Let l be (-75)/(-7) - 20/(-70). Let m = 11 - l. Which is the smallest value? (a) u (b) -1 (c) m b Let y = 0 - -0.1. Let g be 2/162 - 0. Let r = -0.048 - 0.452. Which is the second smallest value? (a) y (b) r (c) g a Let i = 38.987 - -0.013. Let k = -39.5 + i. Let q be (-2)/(-5) - (-48)/(-70). What is the third smallest value in k, 0.5, q? 0.5 Let q = -886.03 + 886. Which is the second biggest value? (a) 2/3 (b) 2/7 (c) q (d) 4 a Suppose -63 + 399 = 2f. Let z = -1846/11 + f. Which is the third biggest value? (a) 0.4 (b) -2/11 (c) 0.02 (d) z c Let f = 0.379 + -0.599. Which is the smallest value? (a) 0.4 (b) 2/7 (c) 2/11 (d) f d Let k = -2.6 + -0.4. Let t = -174.9 - -175. Which is the smallest value? (a) t (b) -4 (c) k b Suppose -3o + 0*o = -42. Let u = 2972/5 - 594. Which is the third biggest value? (a) o (b) u (c) 4 b
What are the prime factors of 24223? 24223 List the prime factors of 473. 11, 43 What are the prime factors of 724? 2, 181 List the prime factors of 3861. 3, 11, 13 What are the prime factors of 4136? 2, 11, 47 What are the prime factors of 2755? 5, 19, 29 List the prime factors of 65434. 2, 32717 What are the prime factors of 15045? 3, 5, 17, 59 List the prime factors of 20801. 11, 31, 61 What are the prime factors of 5444? 2, 1361 List the prime factors of 4010. 2, 5, 401 What are the prime factors of 4618? 2, 2309 What are the prime factors of 1356? 2, 3, 113 List the prime factors of 6549. 3, 37, 59 What are the prime factors of 3941? 7, 563 What are the prime factors of 363? 3, 11 What are the prime factors of 3843? 3, 7, 61 List the prime factors of 49552. 2, 19, 163 List the prime factors of 3391. 3391 What are the prime factors of 1372? 2, 7 What are the prime factors of 206? 2, 103 What are the prime factors of 242? 2, 11 What are the prime factors of 2273? 2273 What are the prime factors of 24195? 3, 5, 1613 What are the prime factors of 1422? 2, 3, 79 List the prime factors of 23846. 2, 11923 List the prime factors of 1873. 1873 What are the prime factors of 551? 19, 29 List the prime factors of 36170. 2, 5, 3617 What are the prime factors of 7608? 2, 3, 317 What are the prime factors of 51997? 11, 29, 163 List the prime factors of 2069. 2069 List the prime factors of 10253. 10253 List the prime factors of 2756. 2, 13, 53 List the prime factors of 755. 5, 151 List the prime factors of 37306. 2, 23, 811 What are the prime factors of 82072? 2, 10259 List the prime factors of 38284. 2, 17, 563 List the prime factors of 36078. 2, 3, 7, 859 What are the prime factors of 2546? 2, 19, 67 List the prime factors of 711. 3, 79 What are the prime factors of 439? 439 List the prime factors of 19190. 2, 5, 19, 101 What are the prime factors of 22130? 2, 5, 2213 What are the prime factors of 34517? 7, 4931 What are the prime factors of 605? 5, 11 What are the prime factors of 20? 2, 5 What are the prime factors of 716? 2, 179 List the prime factors of 202. 2, 101 What are the prime factors of 40360? 2, 5, 1009 List the prime factors of 84797. 19, 4463 What are the prime factors of 133089? 3, 11, 37, 109 List the prime factors of 245. 5, 7 What are the prime factors of 657? 3, 73 List the prime factors of 42. 2, 3, 7 What are the prime factors of 34413? 3, 11471 What are the prime factors of 2836? 2, 709 What are the prime factors of 58513? 7, 13, 643 List the prime factors of 51116. 2, 13, 983 List the prime factors of 280. 2, 5, 7 List the prime factors of 2203. 2203 List the prime factors of 1249. 1249 What are the prime factors of 14654? 2, 17, 431 List the prime factors of 276. 2, 3, 23 What are the prime factors of 1527? 3, 509 What are the prime factors of 4199? 13, 17, 19 List the prime factors of 2257. 37, 61 What are the prime factors of 993? 3, 331 List the prime factors of 16087. 16087 List the prime factors of 5076. 2, 3, 47 What are the prime factors of 4100? 2, 5, 41 What are the prime factors of 258? 2, 3, 43 List the prime factors of 7854. 2, 3, 7, 11, 17 What are the prime factors of 1436? 2, 359 List the prime factors of 1721. 1721 What are the prime factors of 49882? 2, 7, 509 List the prime factors of 9189. 3, 1021 List the prime factors of 55362. 2, 3, 9227 List the prime factors of 4028. 2, 19, 53 List the prime factors of 37502. 2, 17, 1103 What are the prime factors of 216? 2, 3 What are the prime factors of 89383? 7, 113 What are the prime factors of 607? 607 What are the prime factors of 4900? 2, 5, 7 What are the prime factors of 12235? 5, 2447 What are the prime factors of 69? 3, 23 What are the prime factors of 796? 2, 199 What are the prime factors of 17071? 43, 397 What are the prime factors of 711? 3, 79 List the prime factors of 4464. 2, 3, 31 List the prime factors of 513. 3, 19 What are the prime factors of 5606? 2, 2803 List the prime factors of 2850. 2, 3, 5, 19 What are the prime factors of 978? 2, 3, 163 List the prime factors of 16710. 2, 3, 5, 557 What are the prime factors of 8392? 2, 1049 What are the prime factors of 56909? 56909 What are the prime factors of 26714? 2, 19, 37 What are the prime factors of 10069? 10069 List the prime factors of 1069. 1069 What are the prime factors of 46608? 2, 3, 971 List the prime factors of 20497. 103, 199 What are the prime factors of 24157? 7, 17, 29 What are the prime factors of 4165? 5, 7, 17 What are the prime factors of 6116? 2, 11, 139 What are the prime factors of 2107? 7, 43 What are the prime factors of 2522? 2, 13, 97 List the prime factors of 474. 2, 3, 79 List the prime factors of 22973. 22973 What are the prime factors of 90362? 2, 45181 What are the prime factors of 1419? 3, 11, 43 List the prime factors of 708. 2, 3, 59 What are the prime factors of 26922? 2, 3, 7, 641 What are the prime factors of 2681? 7, 383 What are the prime factors of 88088? 2, 7, 11, 13 List the prime factors of 262. 2, 131 What are the prime factors of 31743? 3, 3527 What are the prime factors of 26175? 3, 5, 349 What are the prime factors of 87370? 2, 5, 8737 List the prime factors of 1130. 2, 5, 113 What are the prime factors of 5624? 2, 19, 37 List the prime factors of 828. 2, 3, 23 What are the prime factors of 5990? 2, 5, 599 What are the prime factors of 54853? 19, 2887 What are the prime factors of 31128? 2, 3, 1297 What are the prime factors of 6584? 2, 823 List the prime factors of 67684. 2, 16921 What are the prime factors of 18154? 2, 29, 313 List the prime factors of 51925. 5, 31, 67 What are the prime factors of 68068? 2, 7, 11, 13, 17 What are the prime factors of 6434? 2, 3217 List the prime factors of 2177. 7, 311 What are the prime factors of 1835? 5, 367 What are the prime factors of 16166? 2, 59, 137 What are the prime factors of 1584? 2, 3, 11 What are the prime factors of 43800? 2, 3, 5, 73 List the prime factors of 10865. 5, 41, 53 What are the prime factors of 6480? 2, 3, 5 List the prime factors of 14708. 2, 3677 What are the prime factors of 3465? 3, 5, 7, 11 List the prime factors of 32223. 3, 23, 467 What are the prime factors of 750? 2, 3, 5 List the prime factors of 7645. 5, 11, 139 List the prime factors of 33643. 17, 1979 List the prime factors of 779. 19, 41 List the prime factors of 4708. 2, 11, 107 List the prime factors of 88543. 7, 13, 139 List the prime factors of 3173. 19, 167 List the prime factors of 10952. 2, 37 What are the prime factors of 655? 5, 131 What are the prime factors of 651? 3, 7, 31 What are the prime factors of 1309? 7, 11, 17 List the prime factors of 13418. 2, 6709 What are the prime factors of 5689? 5689 List the prime factors of 6300. 2, 3, 5, 7 What are the prime factors of 112816? 2, 11, 641 What are the prime factors of 13574? 2, 11, 617 List the prime factors of 1048. 2, 131 What are the prime factors of 19441? 19441 What are the prime factors of 16241? 109, 149 List the prime factors of 180. 2, 3, 5 What are the prime factors of 1565? 5, 313 List the prime factors of 42727. 42727 What are the prime factors of 1500? 2, 3, 5 What are the prime factors of 5454? 2, 3, 101 List the prime factors of 12567. 3, 59, 71 What are the prime factors of 8741? 8741 List the prime factors of 1434. 2, 3, 239 List the prime factors of 18941. 13, 31, 47 List the prime factors of 2660. 2, 5, 7, 19 List the prime factors of 4938. 2, 3, 823 What are the prime factors of 69114? 2, 3, 11519 List the prime factors of 13236. 2, 3, 1103 List the prime factors of 4557. 3, 7, 31 List the prime factors of 111981. 3, 163, 229 What are the prime factors of 22559? 17, 1327 List the prime factors of 12221. 11, 101 List the prime factors of 27509. 27509 What are the prime factors of 10623? 3, 3541 What are the prime factors of 718? 2, 359 What are the prime factors of 476? 2, 7, 17 List the prime factors of 5245. 5, 1049 What are the prime factors of 1024? 2 List the prime factors of 82229. 7, 17, 691 List the prime factors of 5413. 5413 What are the prime factors of 16349? 16349 What are the prime factors of 23259? 3, 7753 What are the prime factors of 4197? 3, 1399 What are the prime factors of 2731? 2731 What are the prime factors of 768? 2, 3 What are the prime factors of 7882? 2, 7, 563 List the prime factors of 336. 2, 3, 7 What are the prime factors of 62063? 53, 1171 What are the prime factors of 1470? 2, 3, 5, 7 What are the prime factors of 1447? 1447 List the prime factors of 64125. 3, 5, 19 What are the prime factors of 1621? 1621 List the prime factors of 11222. 2, 31, 181 List the prime factors of 915. 3, 5, 61 What are the prime factors of 573? 3, 191
Let i(z) = -z*3 - 4z*2 - 4z - 1. Let l(t) = -4t. Let o be l(1). Let m(a) be the first derivative of a2/2 + a + 4. Let y be m(o). Determine i(y). 2 Let d(t) = 2t - 17. Let w be d(16). Let j(g) = 18g + wg - 28g. Determine j(-1). -5 Let p be 18/72 - 43(-2)/8. Let c(q) = 4q2 + 10q + 6. Let w(v) = 21v2 + 50v + 30. Let n(t) = pc(t) - 2w(t). Give n(-6). 18 Let y be 2/11 - 9/((-99)/119). Let a(r) = -r + 14. Give a(y). 3 Suppose 0 = 4p + 1 - 53. Let k(a) = -a3 + 12a*2 + 12a + 9. Determine k(p). -4 Suppose -27w + 43 + 65 = 0. Let r(x) = x3 - 6x*2 + x + 5. Give r(w). -23 Let h(y) = -2y - 1. Let u = 15 + -16. Let z be u - -1 - (-3 - 0). Suppose 3r + zs = 7s - 1, -r + 2s = 1. Determine h(r). -3 Let d(v) = -21 + v*2 + 70 + 4v - 2v - 19v. Determine d(13). -3 Let d(t) = t - 16 + 39 - 26. Let l(v) = v - 1. Let s(o) = d(o) - 2l(o). Let z be (0/(-2))/(2 - 1). Calculate s(z). -1 Let l(a) be the first derivative of a2 + 5a + 15. Let n(b) = b + 3. Let i(s) = -2l(s) + 5n(s). Suppose 0 = -9u + 4u - 30. Determine i(u). -1 Let m(b) = -b*2 - 12b - 6. Let f(s) = 12s + 3 - 11s*2 + 10s + 3s3 - 21s. Let i be f(3). What is m(i)? -6 Let k(j) = 3j + 4 + 3j + j*3 + 2j*2 - 8j*2 - 2. Determine k(5). 7 Let h(t) = 2t3 + t2 + t + 2. Suppose 18 + 54 = 4c. Suppose 0 = 3a - p + 1, -3p = -2a + 2p - c. Let z be 3 + (-5)/a + 0. Determine h(z). -12 Let t(v) = -9v*2 - 2v - 2. Suppose -8b = 15 - 7. Determine t(b). -9 Let i(b) = -2b + b*2 - 6b*3 + 0b*3 + 2b*3 + 2b*3 + 0b*3. Let t be (1 - 2)(0 + 2). Determine i(t). 24 Suppose -13 - 11 = 2c + 5y, 3c = 5y - 86. Let r = c - -22. Let d(p) = -3p - 378p*2 + 377p*2 + 6 + 2p. Determine d(r). 6 Let s(b) = b - 1. Let f(h) = 8h - 6. Let r(o) = -f(o) + 5s(o). What is r(-1)? 4 Let o(k) = k3 + k2 - k - 15. Let f = 19 - 19. Determine o(f). -15 Let o be (-5)/(-10) + (-1 - (-22)/4). Let l(z) be the first derivative of -o + 1/2z2 + 11z. Give l(-5). 6 Let b = -87 + 90. Let n(s) = 55s2 - sb - 4 - 30s*2 - 29s*2 - 3s. Determine n(-4). 8 Let s(k) = k + 10. Suppose 8b + 83 = -5l, 4 = -l - 3b - 7. What is s(l)? -13 Let b(x) = -x2 - 4x. Suppose 0 = -2c - 4z + 18, -2c - z + 11 + 10 = 0. Suppose -5m = -2g - 7, g - 3g - m = -c. Suppose gp = -7 - 9. Determine b(p). 0 Let m(g) = -g2 - g + 1. Let a(d) = -20d*3 + 2d + 5. Let j(q) = -a(q) + 2m(q). Determine j(-1). -21 Let v(c) = -c3 - 5c*2 + 16c + 8. Suppose 2k = 35s - 32s - 26, 0 = 4s - 16. Give v(k). -6 Let t(x) = x*3 - 6x*2 - 9x - 2. Suppose 9 = -2l + 4c + 3, 0 = -5l - c + 40. Calculate t(l). -16 Suppose -2k - 2u = 4, -u - 3 = -3k - 5. Let d(s) = s*2 + 2s + 1. Calculate d(k). 0 Let b(c) = c - 6. Suppose 8g + 30 = -2. Give b(g). -10 Let l be ((-6)/1 + 3)/((-27)/(-45)). Let u(r) = r2 + 9r + 23. What is u(l)? 3 Let v(n) = -5n - 7. Let t(m) = -7m - 9. Let g(a) = 3t(a) - 4v(a). Calculate g(5). -4 Let c(g) = 4g - 7. Suppose 3b + 6 = -4z, -3b - 4 + 19 = -3z. Determine c(b). 1 Suppose 0 = 3j - 2r + 42, 6r - 11r = 0. Let v(t) = -t3 - 15t*2 - 16t - 21. Give v(j). 7 Suppose -5u + 11 = -9. Suppose -a = 10 - u. Let b(k) = k3 + 6k*2 + 3k - 3. Let h(v) = -v*3 - 6v*2 - 4v + 4. Let m(f) = -3b(f) - 2h(f). Give m(a). 7 Let w(m) = -10 - m - m + m*2 + 0m*2 - 2m - 7m. Calculate w(9). -28 Let b(n) = -6n - 57. Let t be b(-10). Let o(v) = -v*3 + 4v*2 + 2v - 4. Let a be o(4). Let f(s) = 2s2 - 3s*2 - as + 2s2 - 1. Calculate f(t). -4 Let t(y) = 70 + y2 - 5y - 46 - 34. Give t(7). 4 Suppose 2h - h = -u - 34, 5u - h = -152. Let o = 27 + u. Let d(g) = 2g2 + 6g + 5. Calculate d(o). 13 Let r(c) be the first derivative of -c7/840 - c6/90 + c5/60 + c4/4 + c*3 - 25. Let i(m) be the third derivative of r(m). Calculate i(-4). -2 Suppose -5k + 0k = 3f - 3, 3f + 3 = -3k. Suppose -13 - 5 = -kt. Suppose -9 = 3g - t. Let u(m) = -14m - 1. Determine u(g). 13 Suppose 3k - 3 = 6, 3k = -2x + 15. Let l(a) = 3a3 + 2 + 2a - 3a - 3 - 2ax - a2. Calculate l(-1). -2 Let j(k) = 3k + 1. Let a(l) = -l. Suppose 8 = -5d + 3. Let s(i) = dj(i) + 2a(i). Let r = 11 + -10. Determine s(r). -6 Let g(h) be the second derivative of 5h3/6 - 37h*2/2 - 38h. Determine g(8). 3 Let j(h) = 3h2 - 2h - 1. Let s(g) = g*3 + 2g*2 + 2g + 1. Let p be s(-2). Let n be (4/p)/2-3. Let v be j(n). Let i(o) = o - 7. Determine i(v). 0 Let u(q) = -2q*2 - 26q - 25. Let s(w) = w*2 + 13w + 12. Let o(d) = -5s(d) - 3u(d). Let j(t) be the first derivative of o(t). What is j(-10)? -7 Let y(l) = 10l - 3. Let z(x) = -50x + 16. Let f(s) = -11y(s) - 2z(s). Let t be (6 + -11)4/5. Let q = t + 6. Determine f(q). -19 Let b(x) = x3 + x2. Let m(p) = 6p*3 + 6p*2 + p + 7. Let q = 65 + -60. Let k(c) = qb(c) - m(c). Suppose -3g + g = 0. Calculate k(g). -7 Let b(t) = -11t - 2. Let m = -31 + 33. Let a(d) = 5d + 1. Let g(l) = mb(l) + 5a(l). Calculate g(3). 10 Let d(k) be the second derivative of k4/6 - k3 - k2 + 25k. Let y(p) = p*3 + 9p*2 - 12p. Let u be y(-10). Suppose -7l + 3l = -u. Determine d(l). 18 Let z(n) = 3n2 - 44 - 2n + 95 - n3 - 50. Determine z(3). -5 Let b(y) be the first derivative of y7/840 - y*4/12 - 11y3/3 + 6. Let r(c) be the third derivative of b(c). Let q = -9 - -11. Determine r(q). 6 Let i(y) be the second derivative of y4/12 + 5y3/6 - 2y*2 + y + 57. Let k(f) = f - 2. Let o be k(8). Suppose 0 = -2d - o - 6. Give i(d). 2 Let b(w) = -21 - w*2 + 2w2 - w + 9 + 5. Give b(5). 13 Let n(s) be the third derivative of s4/24 + 31s3/6 - 408s*2. Determine n(-22). 9 Let w(f) = 5f*2 - 3f - 1 + f - 3f2 + 2. Let b be (-6 - 29/(-5))-5. Determine w(b). 1 Let j(v) = v*2 - 14v + 35. Suppose -y - 5y + 66 = 0. Give j(y). 2 Let r(c) = 11c + c*3 - 163 + 0c + 170 - 12c2. Determine r(11). 7 Let l(f) = -2f - 9. Suppose -2w - 2a - 3a = -27, 0 = -w + 3a - 14. Let u be 2-35w/2. Let x be 14/u + (-33)/5. Calculate l(x). 5 Let t(y) be the first derivative of 3y2/2 - 18y + 984. Calculate t(8). 6 Let v be 12/20(-175)/(-21) + 4. Let l(u) = u3 - 9u*2 - 1. What is l(v)? -1 Suppose 5z + 2 = -r + 29, 0 = -2z + 5r + 27. Let d(j) = -j + 12. Let x(f) = f - 12. Let g = 52 + -48. Let v(a) = gx(a) + 5d(a). Determine v(z). 6 Let d(h) be the second derivative of h7/840 - h6/90 + h*5/60 + 5h*4/24 + 7h*3/6 - 4h. Let l(m) be the second derivative of d(m). Calculate l(4). 13 Let k(j) = j*2 - 10j + 11. Let y(r) = -r*2 + 3r + 18. Suppose 106 = -4n + 126. Let l be y(n). What is k(l)? -5 Let f(y) = y + 10. Let m be f(-6). Suppose k - i = -3, -1 = -3k + 5i - m. Let o be 8/k63/(-28). Let q(h) = h*3 - 2h*2 - 3h. Calculate q(o). 0 Let a(v) be the first derivative of -v*4/4 - 26v*3/3 - 49v*2/2 - 26v - 234. Give a(-24). -2 Let b(x) be the first derivative of x*4/4 + 5x3/3 + x2 + 3x - 15. Suppose -2s = 3s. Let q be 0 + -2 + s + -3. Give b(q). -7 Let n(d) = 23d + 12. Let z(x) = 8x + 4. Let s(g) = 4n(g) - 11z(g). Determine s(-3). -8 Let w be (-12)/24 - 14/(-4). Suppose -2g = -8, -wg + g = -2v - 2. Let o(m) = -vm - 2 + m2 - 3m2 + 4 + m2. Calculate o(-4). -2 Suppose -3g - 4x + 0x = 10, -5x - 20 = 0. Let n(t) = 9t2 - 4t + 1. Let q(o) = 7o2 - 3o + 1. Let h(r) = -3n(r) + 4q(r). Calculate h(g). 5 Suppose 0 = -4u + 3h + 5, 15 = -u + 5u - h. Let t(p) = -3p*2 + 1 + up2 + p2. Determine t(1). 4 Let s be (-1 + 2)/((-1)/(-2)). Let c(h) = 5h + sh*2 - 9h*2 + 11h2 + 2 - h3. Give c(5). 2 Let l(m) = 7m3 - 3m*2 - m + 2. Let k be 60/45 - 22/3. Let x(r) = 8r*3 - 3r*2 - r + 3. Let w(t) = kx(t) + 7l(t). Calculate w(3). -7 Let y(p) = 0 - p2 - 41p + 7 + 42p. Let h(w) = 2w*2 - w - 15. Let z be -1 + 2/(-2)-3. Let d(a) = zh(a) + 5y(a). Calculate d(4). 1 Let w = 186 - 185. Let s(k) = k*2 - 2k - 1. Let o be s(-1). Let c(m) = -7m2 - om - 3m + 5m. Give c(w). -7 Suppose -340 + 735 = 79m. Let a(z) be the first derivative of -z5/120 - z4/24 - z3/3 + 1. Let o(r) be the third derivative of a(r). Determine o(m). -6 Suppose -5x + 2k - 57 = -14, -2x - 3k = 21. Let c = 10 + x. Let s(d) = 8d3 - d2 + d - 1. Give s(c). 7 Let o be (-2)/(-3) + 560/42. Let c be (12/(-21))/((-4)/o). Let r(m) = 8m2 + 2m. Let y(f) = 33f2 + 9f. Let q(w) = 21r(w) - 5y(w). Calculate q(c). 6
Let z(v) be the second derivative of -v*3 - 4v*2 - 2v + 63. Let q(u) = 17u + 23. Determine 3q(b) + 8z(b). 3b + 5 Let v(x) = -5x3 + 6x*2 - 6x. Suppose 12h = 48h - 900. Let q(c) = -62c2 + 23c*2 + 20c*3 + 14c*2 + 25c. Calculate hv(g) + 6q(g). -5g3 Let g(x) = 55x*3 + 18x*2 + 4x - 11. Let h(l) = 18l3 + 6l*2 + l - 4. Calculate 4g(n) - 11h(n). 22n*3 + 6n*2 + 5n Let x(c) = -70c3 + 32c*2 + 5c + 6. Let v(j) = -14j3 + 6j*2 + j + 1. Determine 11v(d) - 2x(d). -14d*3 + 2d*2 + d - 1 Let f(a) = -10a*2 - 27a + 498. Let s(u) = -18u2 - 45u + 995. Determine 5f(t) - 3s(t). 4t2 - 495 Let c(y) = -1037y*2 - 28y. Let b(u) = -344u2 - 10u. Determine -8b(n) + 3c(n). -359n2 - 4n Let q(j) = -88j2 - 11j - 97j2 + 11 + 221j*2. Let x(b) = -7b*2 + 2b - 2. Let n = -296 - -298. What is nq(r) + 11x(r)? -5r2 Let v(l) = -20l. Let w(f) = 9f - 12. Let y(a) = -2a + 3. Let s(r) = -w(r) - 4y(r). What is -30s(t) + v(t)? 10t Let r(q) = -4q + 2. Let f(p) = 2p - 3. What is 6f(x) + 4r(x)? -4x - 10 Let u(n) = n - 3. Let p(i) = i - 3. Let b(s) = 4s + 28. Suppose 240 = -10y + 8y. Let t = y - -114. Let m be b(t). Determine mu(k) - 5p(k). -k + 3 Let i(v) = v - 1. Let r(q) be the second derivative of -5q*3/6 + 3q*2 - 46q + 3. Determine 11i(g) + 2r(g). g + 1 Let g(x) = 8x3 - 4x*2 - 92x + 88. Let k(o) = o*2 + 23o + 1. Calculate -g(f) - 4k(f). -8f*3 - 92 Let v(z) = 1527z + 567. Let t(j) = 114. Give 5t(o) - v(o). -1527o + 3 Suppose 3t + 13 = 2c, 0 = -3c + 8c - 2t - 5. Let q(n) = 7 - 23 + 15 + n. Let o(m) = -6m + 8. Calculate co(y) - 5q(y). y - 3 Let t(h) = 15271h2 - 4h - 12. Let d(v) = 173936711v2 - 45561v - 136683. Calculate -4d(m) + 45561t(m). 15187m2 Let s(r) = -2868r*3 + 44r*2 - 11r - 11. Let l(t) = -2869t3 + 48t*2 - 12t - 12. What is 11l(i) - 12s(i)? 2857i3 Let k(a) = a3 + 2a. Let j(z) = 2z. Suppose 11961m - 11540m = 1263. Let u be 3(-1)/34. Calculate mj(x) + uk(x). -4x*3 - 2x Let b(c) be the second derivative of -7c3/6 + c2 + 124c. Let t = 84 - 82. Let h(a) = 14a - 5. Give th(d) + 5b(d). -7d Let u(h) = -21h + 125. Let z(y) = -41y + 251. Give 9u(s) - 4z(s). -25s + 121 Let g(b) = -3b*2 - 62b + 18. Let y(n) = 5n2 + 110n - 35. Let d(q) = -7g(q) - 4y(q). Let h(l) = 3l2 - 17l + 43. Determine -17d(v) + 6h(v). v*2 + 20 Let f(h) = 13h*2 + 2h + 187. Let n(k) = -48k2 - 8k - 750. Give -15f(j) - 4n(j). -3j2 + 2j + 195 Suppose 5 + 30 = 5k. Let s(i) = -5i - 7. Let w(v) = 3v + 4. Let d be (-30 - 20)/(-10) + (-1 - -4) + -4. Give ds(c) + kw(c). c Let p(u) = -1085u*3 + 10u*2 - 10u + 10. Let s(w) = 723w3 - 7w*2 + 7w - 7. Give 7p(b) + 10s(b). -365b3 Let c(y) = 59y*3 - 3y*2. Let o(i) = 177i*3 - 8i*2. Suppose 6875 = 13p + 6979. What is pc(x) + 3o(x)? 59x3 Let o(n) be the second derivative of n3/2 - 2n*2 - 4n. Let t = 339 + -210. Suppose 14h - 3 + t = 0. Let y(f) = -12f + 17. Determine ho(w) - 2y(w). -3w + 2 Suppose 30k - 27k = 15. Let j(s) = 7s - 3 - ks - s + s. Let c(b) = 16b + 2 + 16b - 33b. Calculate 10c(g) + 6j(g). 2g + 2 Let n(k) = 3 - 22392282k*2 + 1 + 22392262k2. Let a(s) = s2 + 1. Determine -4a(y) + n(y). -24y*2 Let a(u) be the second derivative of u + 21 - 2u*2 - 1/2u*3. Let r(b) = -3b - 5. Calculate 4a(x) - 3r(x). -3x - 1 Let r(h) = -13h*3 + 11h*2 + 123h + 4. Let s(x) = -4x3 + 4x*2 + 41x + 1. Determine -4r(w) + 11s(w). 8w3 - 41w - 5 Let t(c) = -19c - 80. Let m(f) = -16f - 79. Give 5m(k) - 4t(k). -4k - 75 Let s(j) = -685j + 1. Let r(a) = -672a + 1. Give -7r(c) + 6s(c). 594c - 1 Let n(w) = 12w3 - 9w + 734. Let d(s) = 2s3 - 2s + 183. Calculate 9d(i) - 2n(i). -6i3 + 179 Let b(a) = a3 + 4a*2 - 3a + 5. Let z(r) = r*2 - r + 1. Let t = 34835 - 34825. What is tz(n) - 2b(n)? -2n*3 + 2n*2 - 4n Let b(p) be the second derivative of p5/20 - p4/12 + p*2/2 + 3298p. Let k(n) = 4n3 + 2n + 2. Calculate -2b(i) + k(i). 2i*3 + 2i*2 + 2i Let i(p) = 4p - 4. Let b(s) = s2 + 2. Let t(w) = 2w*2 + 3w - 44. Let u(k) = 4b(k) - t(k). Let j(x) be the first derivative of u(x). Give 3i(l) - 4j(l). -4l Let g = 89 - 113. Let t = g - -29. Suppose 5s + 30 = tj, 5s = -4j + 6 + 9. Let b(l) = l + 1. Let i(d) = -3d3 + d2 + 6d + 6. Determine si(x) + 6b(x). 3x3 - x2 Let w(d) = -71d*2 - 43d + 5. Let y(f) = 18f2 + 11f - 1. Determine -2w(h) - 9y(h). -20h2 - 13h - 1 Let t(b) = 2b + 1124. Let a(k) = 3k + 2242. Give 4a(m) - 7t(m). -2m + 1100 Let o(x) = -3x - 2. Suppose 5h + 135 = 630. Let l(a) = -a2 - h + 9a + 2a + 108. Give 2l(c) + 9o(c). -2c*2 - 5c Let w(h) = 37h3 + 9h*2 + 9h + 9. Let y(x) = -9x3 - 2x*2 - 2x - 2. Let g be ((-30)/25)/((-30)/(-225)). Determine gy(v) - 2w(v). 7v3 Let a(y) = -y2 + 1. Suppose 57 = -5c + 2c. Let r = 23 + c. Let h(o) = 5o + ro2 - 3o - 2 - 4 + 0. Calculate -6a(f) - h(f). 2f*2 - 2f Let h(k) = 2k2 - 100k - 111k + 209k. Let z(b) = -2b2 + b - 1. Calculate -3h(d) - 4z(d). 2d*2 + 2d + 4 Let a(l) be the first derivative of l + 8 + 4/3l3 + 3l2. Let y(q) = q2 + q + 1. Determine a(u) - 6y(u). -2u*2 - 5 Let t(p) = -p + 1. Let l be t(8). Let x be 7/((-98)/(-4)) + (-124)/l. Let z(s) = -7 - 1 + x - 9 + 6s. Let f(i) = 7i + 1. What is 5f(n) - 6z(n)? -n - 1 Let s(c) = -14c3 + c2 - c - 1. Let v(m) = m3 - m2 + m + 1. Suppose -3b + 3f + 27 = 0, -34 = -3b + 5f + 9. What is bv(r) + s(r)? -13r*3 Let h(k) = -18k*2 - 2447k - 14. Let m(g) = 39g2 + 4890g + 30. Calculate -15h(b) - 7m(b). -3b2 + 2475b Let d(o) = o*3 + 258o*2 + 3o + 4. Let q(f) = -4f2 + f + 1. Give d(y) - 3q(y). y*3 + 270y*2 + 1 Suppose -10c = -6c - 4. Let o be (11 - 1)(-7)/(-2). Let g(w) = w3 + w2 + w - 1. Let f(d) = -28d3 - 35d*2 - 35d + 35. Give cf(b) + og(b). 7b3 Let n(v) = -2630v*2 + 4v. Let q(j) = -882j2 + j. Calculate -4n(z) + 13q(z). -946z*2 - 3z Let u(j) = -326j2 + 116j*2 - 5 + 105j*2 - 1 + 106j*2. Let f(p) = 0 + 5 - 6 + 2. Determine -6f(n) - u(n). -n*2 Let h(z) = -9z - 1. Let c(x) = 49. Let w(u) = -3u + 24. Let j(v) = -c(v) + 2w(v). Give -5h(l) + 7j(l). 3l - 2 Let m(q) = -328q - 319q + 2q*2 + 662q + 5. Suppose 17 = 4c - 3, 0 = -5o + 2c + 10. Let j(k) = k2 + 7k + 2. Give om(p) - 9j(p). -p*2 - 3p + 2 Let m(t) = t*3 - 11t*2 - 12t + 414. Let q(o) = -o*3 + 13o*2 + 14o - 412. Give -7m(a) - 6q(a). -a3 - a2 - 426 Let y(m) = -21m3 - m2 + 547. Let n(i) = 2i*3 - 1. Calculate -22n(a) - 2y(a). -2a*3 + 2a*2 - 1072 Let g(u) = -9u*2 + 55u - 42. Let y(q) = -18q2 + 111q - 105. Calculate 5g(x) - 2y(x). -9x2 + 53x Let c be (-12)/4 + -2 - (2 - 9). Let y(s) = -sc + 29 - 34 - s2 + 5s - s3. Let v(t) = -t + 1. What is 5v(z) + y(z)? -z*3 - 2z*2 Let r(m) = 7m. Let y(w) be the third derivative of w6/120 + w4/24 - w*2 + 417w. What is 3r(h) - 21y(h)? -21h3 Let p(x) = x2 + 38014x - 76032x + 38017x. Let k(n) = -27n3 + n2 - n. What is -k(i) + p(i)? 27i*3 Let o(b) = 124b - 436. Let g(r) = r - 22. Calculate -20g(c) + o(c). 104c + 4 Let h(i) = -56i2 - 14i. Let p(m) = -17m2 + 15m - 18. Let w(t) = 16t2 - 12t + 15. Let c(q) = -5p(q) - 6w(q). What is -14c(u) + 3h(u)? -14u2 Let l(p) = -57p - 571. Let v(d) = 28d + 240. Determine -2l(t) - 5v(t). -26t - 58 Let y(k) = 468k2 + 24k*2 + 5k + 7 - 3 - 499k2. Let n(g) = -g2 + g + 1. Give -5n(m) + y(m). -2m2 - 1 Let n(k) = -2k*3 - 38k*2 - 6k. Let u(w) = -3w3 - 33w*2 - 2w. Determine 7n(o) - 8u(o). 10o3 - 2o*2 - 26o Let k(u) = 1. Let l(t) be the third derivative of -t*4/4 - 2t*3/3 + 31t*2. Let g(p) = -42p - 30. Let h(o) = 5g(o) - 36l(o). Determine -h(j) - 6k(j). -6j Let a(h) = 3. Let m(z) be the first derivative of z*2/2 + z - 16. Suppose 70 = 9t - 2t. Suppose -3j = -5j - t, -3n - 3j = 21. Calculate nm(w) + a(w). -2w + 1 Let n(p) be the first derivative of -19p*2/2 + 2p + 215. Let c(v) = 9v - 1. Give 13c(d) + 6n(d). 3d - 1 Let u(l) = -119l + 2. Let m(f) = 481f - 9. Determine 6m(p) + 25u(p). -89p - 4 Let r(l) = -7243l - 1. Let w(g) = 21694g + 4. What is -7r(t) - 2w(t)? 7313t - 1
Expand ((1 - 1 + 2m)(9m + 2m + 0m) + 55 - 55 - 19m*2)(16m + 27 - 27). 48m*3 Expand (-546 + 488 - 431)(-y*3 - 2y + 2y). 489y*3 Expand (3 - 3 + b)(-4 + 2 + 0)(0b + 10b + 5b) + 20b2 + 15b - 15b. -10b*2 Expand (1 - 1 + j + (1 - 1 - 2j)(0 - 3 + 1))(2648j - 2884 + 2884). 13240j*2 Expand (0r + 4r - 2r)(-1 - 1 + 1) + (-7 + 3 + 1)(2r - 4r + r) + 4r - 8r + 5r. 2r Expand 435a5 - 432a*5 - 1 + 38 + (16a*2 - 57 + 57)(-1 + 1 + 3a3). 51a*5 + 37 Expand 10d - 14d - 15d - 2d + d + 2d + (2 + 4 - 5)(0d - 2d + 0d) - 19d - 19d + 11d. -47d Expand (4 - 1 + 4)(546b - 183b - 191b)(-2b + 2b + b2). 1204b*3 Expand (-6o*3 + 2o*3 + 5o*3)(-4o + 6 - 6) + 3o*4 + 7o*2 + o + 4 + 4o2 - 3. -o4 + 11o2 + o + 1 Expand -f4 - f5 + f4 + (10f*5 - 12f*5 - 10f*5)(-6 + 0 + 4) + 0f5 - 13f5 - f5. 9f5 Expand 0y*4 + 4y*4 - 3y*4 + (-3 - 1 + 5)(4y4 + 0y4 + y4) - 1201y - 105y*4 + 1201y - 2y2. -99y*4 - 2y*2 Expand (-2f*3 + 4f*3 - 4f*3)(5 - 10 - 4) - f2 + f2 - 10f3. 8f*3 Expand (-8544 + 4211 - 6081)(-2j2 + 2j - 2j). 20828j*2 Expand (-38003q*2 - 38156q*2 + 75333q*2)(q - 2 + 2 + (0 + 0 - 2q)(-3 + 4 + 1) - q + 3q - q) - 4q*3 + 2 - 2. 1648q*3 Expand -2j + 0j + 3j + (3 - j - 3)(1 + 2 - 5) - 100j + 11j + 16j + 4j - 4j - 2j + j - 3j + 0j + (0 - 1 + 0)(-j + 5j - 2j) - 4j + 4j - 3j. -79j Expand (-469 - 33 + 167 - 496)(2l + l - 2l + (-2l - 4l + 2l)(2 - 1 + 1)). 5817l Expand (-2 + 3 + 0)(-37517 - 35t + 37517). -35t Expand (-33r*3 - 418 + 418)(-6441 + 6441 + 81r). -2673r*4 Expand -n + 0n + 0n + (-4n - 26n + 0n)(-5 + 0 + 2) + 4n + 6n - 15n. 84n Expand -4603o + 1428o - 507o + (0o + 0o + 2o)(2 + 2 - 6). -3686o Expand (6 + 10 - 4)(-2 - 3 + 3)(-12 + 2438v - 6 - 2446v). 192v + 432 Expand (3x - 10x - 2x)(-5x + 0 - 22x + 1). 243x2 - 9x Expand (2c - 4c + 0c)(-1 + 1 - 2c2) - 2c*3 - 4c*3 + 4c*3 + 2c*3 - 47 + 10c*2 - 58 + 103 + 2c + (2c + 0c - c)(2c*2 + 2c*2 - 3c*2). 5c*3 + 10c*2 + 2c - 2 Expand (0 + 2h + 0)(0 + h*4 + 0) - 9h*5 + 12h*5 + 30h*5 + 6h*5 - 3h*5 - 4h*5 - 2h*5 - 7 + 7. 32h*5 Expand (4 - 2k - 4)(-2k*3 + 0k*3 + 4k*3 + (3k*2 - 11 + 11)(-699k + 42k - 250k)). 5438k*4 Expand (-2z - 21z - 24z)(3z - 5z + z)(z - z + z + 4z - 4z - 2z - 221 + 221 + 78z + z + 2 - 2 + (-1 + 2 - 2)(-z + 6z - 3z)). 3572z*3 Expand (-6206 - 447d + 6206)(3 + 2d*2 + 4 + 1). -894d*3 - 3576d Expand 2z3 - 5z*2 + 1706z - 1706z - 2z*3 + 0z*3 + 0z*3 + (36 - z - 36)(3z2 - z2 - z2). -z3 - 5z*2 Expand -5q*5 + 0q*5 + 4q*5 + (-q + 2q*2 + q)(3q3 + 2q*3 - 3q3) + q3 - q3 + q5 + 2q5 + 45q*4 - 772q + 367q + 385q. 6q5 + 45q*4 - 20q Expand (2 + 1 - 4)(-525c + 241c + 153c) + (2 - 3 - 1)(6c - 2c - 2c) - 2c - 2c + 5c - c - 4 + 4 - c + c + 5c. 132c Expand 22i*5 - 13i + 13i + (-5i*3 + 3i3 + i3)(16i*2 + 10i*2 - 35i*2). 31i*5 Expand (-321 + 1351 + 258 + 1510 + 652)(0r + 4r*2 + 0r). 13800r2 Expand (g + 4 - 2 + 0)((5 - 4 - 3)(-1 + 1 - 2) - 63 + 33 + 76). 50g + 100 Expand -4i - i3 + 4i + (45i3 + 7i*3 + 50i*3)(3 - 7 + 15). 1121i3 Expand (-1 - 5 + 1)(5208l2 - 11 - 11l*3 - 5208l*2). 55l*3 + 55 Expand (4 - 2 - 1)(-93r3 + 96 + 90r*3 - 79 - 6r). -3r3 - 6r + 17 Expand -584z4 - 381z*4 + 1230z*4 + (1 - 6 + 2)(4z - 2z*4 - 4z). 271z4 Expand (1012v + 533743 - 533743)(5 + 2 - 5 - 2v) - 1 + 1 - v*2 + (0 + 0 + 2v*2)(1 - 1 - 1) + 0v2 - 3v*2 + 2v*2 + v - v - 2v*2 - 2v*2 + 3 - 3. -2032v*2 + 2024v Expand (14 - 10y2 - 8 + 13y*2)(1 + 0 + 0) - 20y + 14y*2 + 20y. 17y2 + 6 Expand (198h - 198h + 28h*2)(-4 - 2h + 4) - 3h - h*3 + 3h. -57h3 Expand (-1 - 4 + 6 + (0 + 0 - 2)(4 - 1 - 2) - 6 + 3 + 2 + 0 + 4 - 5)(157 - 305 + 147 - 596i). 1788i + 3 Expand ((-2 + 0 + 1)(4 + 0 - 2) + 0 - 2 + 0 + (13 + 12 - 3)(-8 - 4 + 1))(0 + 0 + j). -246j Expand (6616z + 897 - 1778 + 881 + 1 - 3z - 1 + (-6z + 2z + 2z)(-2 + 1 + 2))(2z + z - 4z). -6611z2 Expand (-3a2 - a5 + 3a2)(-977 + 277 + 417) + 4a5 - 3a*5 + 2a*5 + (-4a*4 + 2a*4 + 5a*4)(4a - a - 5a) + 1 - 1 - 3a5. 277a*5 Expand 12f - f + 0f + (2f + 0f + 0f)(0 + 2 + 0) - 3 - f + 3 + 439 + 798f - 439 + 517f - 33f. 1296f Expand -31 - 14g*3 + 31 + (2g + 1 + 4 - 6)(-9g*2 + 5g*2 - 5g*2). -32g*3 + 9g*2 Expand -17f*2 + 30f*2 + 53f*2 + (0 + 0 + 1)(f + f*2 - f) + 2f*2 - 2f2 + f2 - f*2 + 1 - 1. 67f*2 Expand (6z*4 + 7z*4 - 4z*4)(z + 2z + 4z) - 26z3 + 26z*3 + 25z*5. 88z*5 Expand (-o - 5 - 9 + 0)(67 + 81 - 48 + 1 - 5 + 3 + (4 - 2 - 3)(4 - 3 - 2) + (4 + 1 - 3)(-1 - 1 + 3) - 2 - 1 + 2). -101o - 1414 Expand ((5 - 4 + 1)(5490 + 87s - 5490) + (1 + 2 + 0)(2 + 1 - 1)(2s - 4s + 3s))(2 + 2 - 1)(2s - 5s + s). -1080s2 Expand -12c*3 + 6c*3 + 4c*3 + (36c - 26 + 26)(16c*2 - 14c*2 + 17c*2). 682c3 Expand (q2 - q2 + q3)(0q*2 - 3q*2 + 2q*2) + 25q*5 + 0q*5 - 2q5 - q5 + 4q5 - 2q*5. 23q*5 Expand (2n*3 + 25 + 50 - 15)((0n - 2n + n)(-2 + 0 + 1) + (2 - 2 + 2n)(-2 - 1 + 4)). 6n*4 + 180n Expand (4 + 49j - 6j + 2j)(-2j4 + j4 + 5j*4). 180j*5 + 16j*4 Expand 61b*3 - 57b*3 - 133b*3 + (0 - 4 + 3)(34 + 24 - 94)(0b3 - b3 + 0b3). -165b*3 Expand (1 + 2 + 1 + (4 - 4 + 1)(3 - 1 - 4))(6 - 6 + 2h*3)(12 - 10 - 14 + h) + h*4 + h - h. 5h*4 - 48h*3 Expand (-28 + 13 + 12)(0 + 0 - 2)(-1 + 1 + 2)(29w + 41w - 104w). -408w Expand (-z*2 + 2z3 + z2)(-20471z*2 - 177 + 222 - 21 + 73107z*2 - 24). 105272z*5 Expand -268p + 13p + 6p - 3 + 3 - 2p - 3p - 5p + 5p + (5p - p - 3p)(4 - 3 + 1) - p + 4p - 2p. -251p Expand (7p + 4p - 3p)(2 - 2 + 1) + (4 + 0 + 3)(p + 3p - 3p) + 2 + 5p - 2. 20p Expand ((j2 + j2 + j2)(0j - j + 0j) + (-j*3 + 2j - 2j)(2 - 2 - 2))(4j + 39j + 25j). -68j4 Expand (173q + 93q - 188q)(2q - 3q + 2q) - 5q2 + 5q2 - q2 - q*2 + 0q2 - q2. 75q2 Expand 2 - 1446c - 2282c3 - 60c*2 + 2283c*3 + 59c*2 + 3c - 3c + 2c*3 + (-2c - 3c + 3c)(3c*2 - 2c*2 - 3c*2). 7c3 - c2 - 1446c + 2 Expand (-3 + 4 - 3q - 3)(-30 + 26 + 80)(-q*4 - 2q4 + q4). 456q5 + 304q*4 Expand -1 + 3d + 2 + 6648d2 - 6645d*2 - 91d*2 + 456 + 2d - 456 + (0 + 0 + 2)(5d*2 - 4d*2 - 2d*2). -90d*2 + 5d + 1 Expand (-7439i - 212082 + 212082 - 4819i)(-5i*3 + 3i*3 - 2i*3)(1 + 3 - 3). 49032i4 Expand (1 - 2 + 2)(-3 + l + 3)(0l2 - l2 - l*2)(24 - 7 + 27) + (0l + 3l - l)(0l*2 + 0l*2 - 14l*2). -116l*3 Expand 3z4 - z4 + 2z4 + (21z - 60z - 20z)(-z3 - 4z*2 + 4z*2). 63z*4 Expand (-8t - 45t - 22t)(5 - 2 - 2)(-1 + 4 + 0 + (1 + 2 - 5)(2 + 0 - 1))(0 + 10 + 1). -825t Expand (-6i*3 - 9 + 9)(7 + 12 + 36)(1 - 2 + 0)(-i*2 - 2i*2 + 5i*2 + (-1 + 2 + 0)(4i2 + i2 - 3i*2)). 1320i*5 Expand (-3d*3 + 548d*2 - 548d*2)(-7d2 + 12d*2 - 106d*2). 303d*5 Expand (-230c + 286c - 159c)(-5c + c + 2c)(22 - 6 + 7). 4738c2 Expand (3 + 3 - 1)(-970m - 774m + 1357m + 1680m + 2112m). 17025m Expand (1 - 2 + 0)(-4d + 0d + 6d) - 6d + d + 3d + d - 2d + 0d - 57d - 61d + 37d + 37d - 29d + 15d. -63d Expand -b5 - 5b5 + b5 + (-4b4 + 4b4 - b4)(-b - b + 0b). -3b5 Expand (-3g*4 + 5g4 - g4)((1 + 2 - 1)(4g - 4g + 2g) - 824 + 533g - 201g - 330g - 264). 6g5 - 1088g*4 Expand (0l*3 + 0l*3 + 2l*3)(1 + 2 - 1) + 12009 + 9l2 + 12011 + 9l + l*3 - 24018. 5l*3 + 9l*2 + 9l + 2 Expand ((-4t + 0t - 7t)(2 - 4 - 1) + (0 + 3t + 0)(-1 + 1 + 2))(3t + 2t + 3t). 312t2 Expand 51 - 51 - 2h + (-h + 4h - h)(2 + 2 - 8) + 1 + 4h - 1 + h + 0h - 3h + 1 + 2h - 1 + (2 + 2 - 3)(-2 + 2h + 2) - 2h + h + 2h. -3h Expand 0a*2 - 3a*2 + 0a*2 + (-311 + 311 + 7a + (1 - 2 + 0)(0 + 0 + a))(5a + 2a - 6a). 3a*2 Expand 379v - 68v + 277v + (-1 - 2v + 1)(0 + 2 - 3)(25 + 19 - 9). 658v Expand (t*3 + 13t*2 + 0t*3 + 1 - 3t*2)(0t - t + 0t + (-t + t - 3t)(1 - 3 + 0) + 5 - 5 + 2t). 7t*4 + 70t*3 + 7t Expand (-4k + 0 + 0)(178 + 109 - 61). -904*k
Solve 14 = 30k + 14 for k. 0 Solve 9v = -23v - 192 for v. -6 Solve -42 = -17a + 31a for a. -3 Solve -30 = -2t - 8t for t. 3 Solve 32c + 440 = 184 for c. -8 Solve -172v + 182v + 30 = 0 for v. -3 Solve 32p - 66 = -p for p. 2 Solve -y + 6 = 10 for y. -4 Solve -12g + 6g = 18 for g. -3 Solve 28 + 53 = -27c for c. -3 Solve 0 = 51s - 50s + 5 for s. -5 Solve -6n + 549 = 507 for n. 7 Solve 0 = 21d - 6d - 45 for d. 3 Solve 8u - 13u - 5 = 0 for u. -1 Solve -22 = 6d + 16d for d. -1 Solve 7j = j - 6 for j. -1 Solve 50 = d + 56 for d. -6 Solve 15i + 346 = 421 for i. 5 Solve 3d = 6d + d for d. 0 Solve -14t + 75 = t for t. 5 Solve 7 = -19h + 64 for h. 3 Solve 19t = 8t + 33 for t. 3 Solve 0w = -2w - 6 for w. -3 Solve -39 + 39 = -3s for s. 0 Solve -41v + 90 = 49v for v. 1 Solve 8l - 75l + 335 = 0 for l. 5 Solve -1410d + 63 = -1417d for d. -9 Solve 52t - 44t - 32 = 0 for t. 4 Solve 33k + 54 = 42k for k. 6 Solve -3z = -8z - z for z. 0 Solve 5i + 74 - 94 = 0 for i. 4 Solve -45q = -65q + 80 for q. 4 Solve -6t = -t for t. 0 Solve -64g + 104 = 40 for g. 1 Solve -135h - 33 = -124h for h. -3 Solve 131w = 120w - 33 for w. -3 Solve -29l = 91 - 62 for l. -1 Solve -135 = 3f - 153 for f. 6 Solve 26r = -9r - 105 for r. -3 Solve 0 = -12j + 150 - 102 for j. 4 Solve 34x = -225 - 13 for x. -7 Solve -5x = -x + x for x. 0 Solve 2t = -2t + 16 for t. 4 Solve 0 = 3l + 7 - 1 for l. -2 Solve -8a + 16a - 8 = 0 for a. 1 Solve 36r = 38r - 22 for r. 11 Solve 5q = 5 - 15 for q. -2 Solve -18c - 129 = -165 for c. 2 Solve -41a + 33 = -30a for a. 3 Solve -4m - 5 - 7 = 0 for m. -3 Solve 27t = 34t - 14 for t. 2 Solve -535y = -525y - 60 for y. 6 Solve -41o = -39o + 4 for o. -2 Solve 8 = 6k + 38 for k. -5 Solve 0 = u + 5u - 18 for u. 3 Solve 7r - 6 = -34 for r. -4 Solve 20 = -5r + 9r for r. 5 Solve 335 = -111s - 442 for s. -7 Solve 0 = -3t - 126 + 135 for t. 3 Solve -2b + 8 = -10b for b. -1 Solve 64s - 5 = 69s for s. -1 Solve w = 12 - 14 for w. -2 Solve 0 = -8k - 82 + 146 for k. 8 Solve -408 = -47w - 4w for w. 8 Solve -8 = 7x + 27 for x. -5 Solve j - 11 + 9 = 0 for j. 2 Solve -2h + 5h - 15 = 0 for h. 5 Solve -8l - 40 = -64 for l. 3 Solve 3l = 9 - 3 for l. 2 Solve 21o + 54 = 3o for o. -3 Solve -471 + 411 = 10a for a. -6 Solve c + 5 - 2 = 0 for c. -3 Solve -22u = 3u + 150 for u. -6 Solve 14n = 818 - 804 for n. 1 Solve 8a = -154 + 194 for a. 5 Solve -6l = -2 - 22 for l. 4 Solve -3a + 8 = -10 for a. 6 Solve 6g = 22g - 112 for g. 7 Solve 79c - 89c = 50 for c. -5 Solve 7b + 434 - 385 = 0 for b. -7 Solve -8 = -2p - 0 for p. 4 Solve -3i - 50 = -47 for i. -1 Solve 16s - 4s = 0 for s. 0 Solve -40 = -43f + 39f for f. 10 Solve 0 = -67j + 87j - 80 for j. 4 Solve -13j + 5 - 18 = 0 for j. -1 Solve 19y - 76 = -0 for y. 4 Solve -14t = -17t + 6 for t. 2 Solve 61 = -16d + 109 for d. 3 Solve 15l + 7l + 3l = 0 for l. 0 Solve 0 = 6v - 27 + 3 for v. 4 Solve -11r + 461 - 483 = 0 for r. -2 Solve -50s + 319 - 69 = 0 for s. 5 Solve p + 245 = 239 for p. -6 Solve 0 = -4t + 4 - 8 for t. -1 Solve 301 - 221 = 16c for c. 5 Solve -13u = -12 + 12 for u. 0 Solve 6 - 6 = -25s for s. 0 Solve 0 = -20a - 17 - 43 for a. -3 Solve 63c + 70 = -245 for c. -5 Solve -11x + 13x = -4 for x. -2 Solve 2x + 4 = 4x for x. 2 Solve 0 = 15h - 16h for h. 0 Solve 0 = 5169l - 5176l + 56 for l. 8 Solve 0 = -11n - 6 - 38 for n. -4 Solve -20a + 19a = -4 for a. 4 Solve 7 = 4g - 11g for g. -1 Solve -11r + 15 = -14r for r. -5 Solve 82o - 92o = -20 for o. 2 Solve 49 = -20j - 51 for j. -5 Solve -3a - 3a = 2a for a. 0 Solve 168 = 131g - 155g for g. -7 Solve -135x - 204 = -101x for x. -6 Solve 2j + 27 - 31 = 0 for j. 2 Solve 9f = -7f - 16 for f. -1 Solve 4u + 36 = 56 for u. 5 Solve -14d + 19 = -9 for d. 2 Solve 143w + 8 = 141w for w. -4 Solve -129 + 249 = 20x for x. 6 Solve -7r = -16r + 36 for r. 4 Solve 11f + 18 + 15 = 0 for f. -3 Solve 21f - 15 = 27 for f. 2 Solve -2u = 3 + 5 for u. -4 Solve -2 = -4p + 10 for p. 3 Solve 2 - 64 = -62b for b. 1 Solve 0 = -15d - 62 - 13 for d. -5 Solve 0 = -27t - 46 - 143 for t. -7 Solve 12y - 4y = -8 for y. -1 Solve 21v + 144 = 60 for v. -4 Solve 0 = -14z + 22 + 76 for z. 7 Solve 22m - 59 - 7 = 0 for m. 3 Solve -305c = -278c + 216 for c. -8 Solve -5z + 387 - 382 = 0 for z. 1 Solve -6l + 39 = 69 for l. -5 Solve 0 = -6r + 35 + 13 for r. 8 Solve 6a = -44a + 200 for a. 4 Solve 0 = 35t - 8t + 162 for t. -6 Solve -2d = 4d - 24 for d. 4 Solve 7n - 17 = -3 for n. 2 Solve 0t = -3t for t. 0 Solve 0 = 47b - 29 - 206 for b. 5 Solve 36c - 50 = 61c for c. -2 Solve 12 = -8h + 4h for h. -3 Solve -10i + 35 = -3i for i. 5 Solve -14z = -10z + 4 for z. -1 Solve -5o - 10 = -5 for o. -1 Solve 3v = v + 8 for v. 4 Solve 7m - 38 = 4 for m. 6 Solve -50x + 44x + 6 = 0 for x. 1 Solve -19b = -24b - 5 for b. -1 Solve -2 = -1160c + 1162c for c. -1 Solve 5m - 47m + 126 = 0 for m. 3 Solve -3k + 16 = 1 for k. 5 Solve 26 - 25 = -x for x. -1 Solve -6c = -c for c. 0 Solve 39 = 7b + 32 for b. 1 Solve 32o - 156 - 36 = 0 for o. 6 Solve -14i = 20i for i. 0 Solve 3t + 1 = -5 for t. -2 Solve 290h = 282h - 32 for h. -4 Solve c - 23 = -26 for c. -3 Solve -32b + 30b + 2 = 0 for b. 1 Solve 0 = 25g + 12g + 222 for g. -6 Solve -2m - 22 = -24 for m. 1 Solve -17b + 6 = -19b for b. -3 Solve -j = 18j + 57 for j. -3 Solve -138 = -53s + 339 for s. 9 Solve 0 = 207d - 209d - 8 for d. -4 Solve -162 = -29d + 11d for d. 9 Solve 1 = 6w - 35 for w. 6 Solve -w - 2w = -15 for w. 5 Solve -34f - 109 = -381 for f. 8 Solve 132d + 7 = 125d for d. -1 Solve -25 = 3n - 40 for n. 5 Solve 59 = -12c - 1 for c. -5 Solve 9 = 5j + 4 for j. 1 Solve 52l - 25 = 47l for l. 5 Solve 20 = -27t + 32t for t. 4 Solve 15 = 11l - 7 for l. 2 Solve 3 = 2z + 1 for z. 1 Solve -49 = -10p - 79 for p. -3 Solve 14 = -5l - 6 for l. -4 Solve -4p + 30 - 58 = 0 for p. -7 Solve 8w - 475 + 491 = 0 for w. -2 Solve t - 111 = -111 for t. 0 Solve 310 = 4f + 330 for f. -5 Solve -21p + 17p - 12 = 0 for p. -3 Solve 132d - 28 = 125d for d. 4 Solve 4o = 39 - 23 for o. 4 Solve -49 = -3q - 43 for q. 2 Solve 19x - 147 = 5 for x. 8 Solve -16i = -21i + 5 for i. 1 Solve -6 = 9m - 7m for m. -3 Solve -189r + 192r - 12 = 0 for r. 4 Solve -79i = -74i + 25 for i. -5 Solve -55h - 6 = -54h for h. -6 Solve 52 = -26l + 13l for l. -4 Solve 51j - 60j = 9 for j. -1 Solve -13v - 60 = 7v for v. -3 Solve -68 = 17m - 0 for m. -4 Solve 28a = 3a - 2a for a. 0 Solve -30 = -153x + 159x for x. -5 Solve -42y = -41y - 1 for y. 1 Solve 0 = 1203h - 1197h - 66 for h. 11 Solve 0 = 79n - 37n + 252 for n. -6 Solve 6s + 0 + 18 = 0 for s. -3 Solve 11r = 5r for r. 0 Solve 0 = 6n + 5 - 29 for n. 4 Solve -324a - 6 = -318a for a. -1 Solve 0 = -19y + 28y + 27 for y. -3 Solve -2l = 32l - 170 for l. 5 Solve -14k - 15 = -71 for k. 4 Solve 48p + 77 = 59p for p. 7 Solve 0 = -7j + 5j + 6 for j. 3 Solve -9p - 52 + 7 = 0 for p. -5 Solve -2c = -16c - 56 for c. -4 Solve -9r + 6 = -7r for r. 3 Solve -4j - 12 = -8j for j. 3 Solve -19v + 13v = 6 for v. -1 Solve 4l = 6l - 2 for l. 1 Solve -11c + 48 = -17c for c. -8 Solve 23g = 2114 - 2275 for g. -7 Solve 0 = -4x + 5x + 5 for x. -5 Solve 0 = 117w - 125w - 56 for w. -7 Solve 0 = -17m - 214 + 61 for m. -9 Solve -11 + 6 = -5v for v. 1 Solve 0 = 36l - 30 - 78 for l. 3 Solve 12v = -63 + 15 for v. -4 Solve -4y = 6 - 22 for y. 4 Solve -5m - 1 = 14 for m. -3 Solve 23 = -25m - 77 for m. -4 Solve 18f = 25f - 42 for f. 6 Solve -60x - 36 = -69x for x. 4 Solve -27 = 7a + 2a for a. -3 Solve 10r = 23r + 78 for r. -6 Solve -1705n = -1710n - 10 for n. -2 Solve 28f = 47f - 152 for f. 8 Solve -12n + 5n = 21 for n. -3 Solve 4a - 6 = -10 for a. -1 Solve -280w + 68 = -263w for w. 4 Solve 8r - 28 = 4 for r. 4 Solve -36v = 67v + 103 for v. -1 Solve 0 = -11l - 1 + 1 for l. 0 Solve -181u = -186u + 40 for u. 8 Solve 0 = 215v - 209v - 54 for v. 9 Solve -24f + 26 = 194 for f. -7 Solve 4f - 11 = 1 for f. 3 Solve -3o + 13o - 50 = 0 for o. 5 Solve -9h = -12h - 3 for h. -1 Solve -21z - 7 - 56 = 0 for z. -3 Solve -68 = 72g - 572 for g. 7 Solve -7r + 2 = 16 for r. -2 Solve 0 = 19h - 6h - 65 for h. 5 Solve -107 + 155 = -8a for a. -6 Solve -19i - 21 = 55 for i. -4 Solve -13c - 6c = 95 for c. -5 Solve 0 = -7r + 205 - 177 for r. 4 Solve 0 = 2y + 3y - 10 for y. 2 Solve 0c + 6c = -6 for c. -1 Solve 0k - 3k = -9 for k. 3 Solve 29w + 132 = 7w for w. -6 Solve -17z = 20z - 15z for z. 0 Solve -38w - 104 = 162 for w. -7 Solve -91 = 3i - 79 for i. -4 Solve 141a + 114 = 103a for a. -3 Solve 106t = 101t + 15 for t. 3 Solve -19t = 81 + 109 for t. -10
Sort 853, 0.3, 2/11, 888, -0.4 in decreasing order. 888, 853, 0.3, 2/11, -0.4 Sort -113, -5, 0, -27, 17 in decreasing order. 17, 0, -5, -27, -113 Sort -2, -77, -7, 20679 in ascending order. -77, -7, -2, 20679 Sort 63, 3, 24/7, -23 in descending order. 63, 24/7, 3, -23 Sort 3, -3, -5, 1224, -4, 8, 29 in increasing order. -5, -4, -3, 3, 8, 29, 1224 Put 0.09, -37379, 3, -2 in decreasing order. 3, 0.09, -2, -37379 Put -17, 1, 7, 12, -120, -2 in increasing order. -120, -17, -2, 1, 7, 12 Sort 1/7, 1, 3.8944, 4/9, 4 in decreasing order. 4, 3.8944, 1, 4/9, 1/7 Sort -428, 10, 1, 7, 3, -65, -4. -428, -65, -4, 1, 3, 7, 10 Put -15124, -5, -51, 3, 0 in increasing order. -15124, -51, -5, 0, 3 Put -5, -420, -2, 1, -3, 2, -4 in descending order. 2, 1, -2, -3, -4, -5, -420 Put 204.8, 0, -91, 1/3, 0.002 in ascending order. -91, 0, 0.002, 1/3, 204.8 Put -5, 1380, -1.02, 116 in decreasing order. 1380, 116, -1.02, -5 Put -0.32417, -2, 1483 in descending order. 1483, -0.32417, -2 Sort 8.317, 8.2, 0.4, -6/11, -1 in ascending order. -1, -6/11, 0.4, 8.2, 8.317 Sort 263, 13, -2, 3, 55 in descending order. 263, 55, 13, 3, -2 Put 10, 17, -4, -16405, -2 in ascending order. -16405, -4, -2, 10, 17 Sort 0, -259, -5, 2, -12565 in decreasing order. 2, 0, -5, -259, -12565 Sort -982, -552, -14 in decreasing order. -14, -552, -982 Put -2/5, 5/7, -3402151 in decreasing order. 5/7, -2/5, -3402151 Put -3/64, -0.5, 0.37, -5, 1/7, 3 in increasing order. -5, -0.5, -3/64, 1/7, 0.37, 3 Put 480, -2, 166, 0, 2 in decreasing order. 480, 166, 2, 0, -2 Put 0.48, 175, 1848 in ascending order. 0.48, 175, 1848 Sort -13337, 3, 2, 4 in ascending order. -13337, 2, 3, 4 Sort -17, 3900850, -5. -17, -5, 3900850 Sort 420, 6475, 1/31. 1/31, 420, 6475 Sort -6, -5, 1, -184, 12, -1, -3. -184, -6, -5, -3, -1, 1, 12 Sort 1, -15, -13301, 4. -13301, -15, 1, 4 Put 1, -3, -22, -2, -1196 in descending order. 1, -2, -3, -22, -1196 Put -3, -102, -4, -1, 3, 97, 0 in increasing order. -102, -4, -3, -1, 0, 3, 97 Sort 24, 15/14, 0.08, 1, -5 in decreasing order. 24, 15/14, 1, 0.08, -5 Put 0, -3, 16, -6, 0.191, -4, 0.3 in increasing order. -6, -4, -3, 0, 0.191, 0.3, 16 Put 0, 275, -0.3, -1/4, 441, -5, 3 in descending order. 441, 275, 3, 0, -1/4, -0.3, -5 Sort 5/4, -25/3, 3/178016 in ascending order. -25/3, 3/178016, 5/4 Put -1/29, 137, 4, -0.14, 0.1 in decreasing order. 137, 4, 0.1, -1/29, -0.14 Put 1/2, -246/845, 1, 2/123, -2 in increasing order. -2, -246/845, 2/123, 1/2, 1 Sort -0.5, 2/183, 0, 6.14 in decreasing order. 6.14, 2/183, 0, -0.5 Sort 0.3, -12/11, 1/4, 258, 0.5 in decreasing order. 258, 0.5, 0.3, 1/4, -12/11 Sort 27, 2518, 2. 2, 27, 2518 Put 46, -9, 38, -2, 1, -51, 2 in descending order. 46, 38, 2, 1, -2, -9, -51 Sort -2/7, -1, -97, -3, 431/3 in descending order. 431/3, -2/7, -1, -3, -97 Put 833, 2, 77, -20 in decreasing order. 833, 77, 2, -20 Sort 3403, -250, -41. -250, -41, 3403 Sort -1.9, -8358398, 0.1 in increasing order. -8358398, -1.9, 0.1 Put -14, 7, -4, -1142, 5, -1 in descending order. 7, 5, -1, -4, -14, -1142 Sort -338, -4, -2016, -3, 3, 0 in descending order. 3, 0, -3, -4, -338, -2016 Put -102775, -6, -46, 4 in descending order. 4, -6, -46, -102775 Put 5, -1, -1745, 7, 70, 1 in ascending order. -1745, -1, 1, 5, 7, 70 Sort 8, 2, -7, 4, 3, -24, -139 in descending order. 8, 4, 3, 2, -7, -24, -139 Put -0.3, -1.2, -0.2, -49.6, -4/7 in descending order. -0.2, -0.3, -4/7, -1.2, -49.6 Put -0.195, -0.071, -1/54, 4 in descending order. 4, -1/54, -0.071, -0.195 Sort -3, -2.3887037, 11 in ascending order. -3, -2.3887037, 11 Put -5, 1059925, -3 in descending order. 1059925, -3, -5 Put 5, 1075, 15, 17 in ascending order. 5, 15, 17, 1075 Put 2, 10, -81, -5, 594 in decreasing order. 594, 10, 2, -5, -81 Sort 18, -198, 5, -4, 23 in increasing order. -198, -4, 5, 18, 23 Sort 133, 44, -291 in descending order. 133, 44, -291 Sort -51969, -14, 0, -85 in decreasing order. 0, -14, -85, -51969 Put 4, 7, 2, 1, -4, 38, -86 in ascending order. -86, -4, 1, 2, 4, 7, 38 Put -5, -9, -848, 0.07 in descending order. 0.07, -5, -9, -848 Put -53, -3, 5, 4, 167 in descending order. 167, 5, 4, -3, -53 Sort 37642, 1/14, 2, -59 in ascending order. -59, 1/14, 2, 37642 Sort 541, 7, 4, 1, 5, 0, 64 in ascending order. 0, 1, 4, 5, 7, 64, 541 Sort 14.8, -2, 18917 in decreasing order. 18917, 14.8, -2 Sort 926, 3, -2, 0, 411, -1, 46 in decreasing order. 926, 411, 46, 3, 0, -1, -2 Put 607, 1/3, -0.0521, -0.4 in decreasing order. 607, 1/3, -0.0521, -0.4 Sort -936, 1/2, 0, -9, 4/7. -936, -9, 0, 1/2, 4/7 Sort -2853, 3, -1 in descending order. 3, -1, -2853 Put -5, 46197, 4 in descending order. 46197, 4, -5 Put 5, -1002, 215341 in increasing order. -1002, 5, 215341 Sort -2, -3/8, 0.3, -218/285 in ascending order. -2, -218/285, -3/8, 0.3 Sort 5, 45901788, -5 in decreasing order. 45901788, 5, -5 Put 89, -12951, -3, 0.1 in descending order. 89, 0.1, -3, -12951 Sort -17, -4, -3, 1, -3919, 5. -3919, -17, -4, -3, 1, 5 Put 0.43, -0.4188, 14/11 in descending order. 14/11, 0.43, -0.4188 Sort 5, 1, -9097, 215 in decreasing order. 215, 5, 1, -9097 Put -1/4, 3/7, -1, -4, 13, -0.4 in decreasing order. 13, 3/7, -1/4, -0.4, -1, -4 Sort -3, -3357, 9, 0.1 in decreasing order. 9, 0.1, -3, -3357 Put -5, -1, 1, -134, -12, 5, 156 in descending order. 156, 5, 1, -1, -5, -12, -134 Sort -3, 1, 34, 3, 12, 71, -7. -7, -3, 1, 3, 12, 34, 71 Sort 1, 5, -4, -517, 55, -3, 13 in descending order. 55, 13, 5, 1, -3, -4, -517 Put -2.71, 2/7, -7/6, 2, 4, 0.0757 in ascending order. -2.71, -7/6, 0.0757, 2/7, 2, 4 Sort -8, 2, -10, -4566, 0. -4566, -10, -8, 0, 2 Put 6, -436219, 0, 1/3 in increasing order. -436219, 0, 1/3, 6 Put -1/5, 28, 144, 5, 129 in descending order. 144, 129, 28, 5, -1/5 Sort 6, 724, 23, -6, -3 in ascending order. -6, -3, 6, 23, 724 Put 0.1, -3, 236, -75, 18, 0.5, 2 in descending order. 236, 18, 2, 0.5, 0.1, -3, -75 Put 9, 3587409, 0 in ascending order. 0, 9, 3587409 Sort 5, -146, 2, -174341. -174341, -146, 2, 5 Sort -7, 3, 1, 0, 53, 30 in increasing order. -7, 0, 1, 3, 30, 53 Put -1.83, 2/17, -5, -7567 in decreasing order. 2/17, -1.83, -5, -7567 Sort -0.2, -2/5, 4/83, -603, -12 in increasing order. -603, -12, -2/5, -0.2, 4/83 Sort 9, -1026237, -2 in descending order. 9, -2, -1026237 Put 158, -4, 64, 7, 3, 351, -3 in ascending order. -4, -3, 3, 7, 64, 158, 351 Sort -24, 2/3, 3, -0.1174, -5 in ascending order. -24, -5, -0.1174, 2/3, 3 Sort -4, -3, 102, 140 in decreasing order. 140, 102, -3, -4 Sort -3, 312, -10, -352 in descending order. 312, -3, -10, -352 Put -1, 0, -422, -5, 8, 94 in decreasing order. 94, 8, 0, -1, -5, -422 Sort -4, 9345807, 4 in ascending order. -4, 4, 9345807 Sort 4/7, -624/7, 1.036, -4/9, -5 in increasing order. -624/7, -5, -4/9, 4/7, 1.036 Sort -8, -2/9953, -4222 in increasing order. -4222, -8, -2/9953 Sort 2, 10, 0.3, 0.7, -396, -0.4 in increasing order. -396, -0.4, 0.3, 0.7, 2, 10 Sort -1, -302, -45809, 2. -45809, -302, -1, 2 Put -2.821, 11577, -3, 0.3 in decreasing order. 11577, 0.3, -2.821, -3 Sort 5, 36, 0.16, -1/32, -8, -2/3 in descending order. 36, 5, 0.16, -1/32, -2/3, -8 Put -7, 47, 0.204174 in ascending order. -7, 0.204174, 47 Sort -4, -3, 260/17, -478, -2/3 in descending order. 260/17, -2/3, -3, -4, -478 Sort -3, 5, -25, 0, -177607 in decreasing order. 5, 0, -3, -25, -177607 Sort 0, 985, 12427 in descending order. 12427, 985, 0 Put 3.98598, 0.7, 1, -3 in descending order. 3.98598, 1, 0.7, -3 Sort 5, -10, -1, -3, 25, 11, 168 in ascending order. -10, -3, -1, 5, 11, 25, 168 Sort 16, 5, -2663, 27, 3, 2 in decreasing order. 27, 16, 5, 3, 2, -2663 Sort -3855, 5, -21, -2, -1. -3855, -21, -2, -1, 5 Sort -88/23, -2343, -0.1 in descending order. -0.1, -88/23, -2343 Put 10, -9/4, -10.3, 8/7, 0 in increasing order. -10.3, -9/4, 0, 8/7, 10 Sort -2, -57, 170, 2, -59. -59, -57, -2, 2, 170 Sort -5, 36/11, 3, -1, -7693 in decreasing order. 36/11, 3, -1, -5, -7693 Sort -2, 31, 5543 in ascending order. -2, 31, 5543 Put 9597, -4, 1, -22, 128 in descending order. 9597, 128, 1, -4, -22 Put -4, 4144, -2, -5, 7, 2 in decreasing order. 4144, 7, 2, -2, -4, -5 Put 8, 785, 4, 3, 0, -6 in decreasing order. 785, 8, 4, 3, 0, -6 Sort -3684706, 0.7, -2. -3684706, -2, 0.7 Sort 2677, 391, -3, 1, 5 in descending order. 2677, 391, 5, 1, -3 Put -13, 28914, 14, -1, 6 in increasing order. -13, -1, 6, 14, 28914 Put -0.088, 163, -0.4, 122 in ascending order. -0.4, -0.088, 122, 163 Sort 3, 2, 1/10, -60432 in descending order. 3, 2, 1/10, -60432 Sort 17, 1, -596, 4, 34. -596, 1, 4, 17, 34 Sort -67, -476.06, 5. -476.06, -67, 5
Round 0.01565 to 3 dps. 0.016 Round 0.0000362402 to 7 dps. 0.0000362 Round 1.23354 to 2 decimal places. 1.23 What is 0.35568 rounded to three dps? 0.356 Round 0.0000108487 to 6 decimal places. 0.000011 Round 0.00000484 to seven decimal places. 0.0000048 Round 0.00016833 to five dps. 0.00017 Round -991500 to the nearest 10000. -990000 What is -0.06936 rounded to three decimal places? -0.069 Round 27430 to the nearest one thousand. 27000 What is 538.2 rounded to the nearest ten? 540 Round -0.00002249 to 7 dps. -0.0000225 Round -0.00312118 to four decimal places. -0.0031 Round -168100 to the nearest ten thousand. -170000 Round 0.000039297 to 6 decimal places. 0.000039 What is 35657000 rounded to the nearest one million? 36000000 What is -920.8 rounded to the nearest 100? -900 Round -11308000 to the nearest one hundred thousand. -11300000 Round -12.377 to the nearest integer. -12 Round -1868.7 to the nearest 100. -1900 Round 0.02111 to three decimal places. 0.021 What is -0.00000200752 rounded to seven decimal places? -0.000002 What is -600 rounded to the nearest one hundred? -600 Round -383.8 to the nearest ten. -380 Round -4467.9 to the nearest 100. -4500 What is 0.000006644 rounded to 7 decimal places? 0.0000066 Round 2.404 to the nearest integer. 2 What is -2998800 rounded to the nearest one hundred thousand? -3000000 What is -0.00518 rounded to 3 dps? -0.005 Round 0.008663 to 4 dps. 0.0087 What is 0.00000029164 rounded to 7 dps? 0.0000003 Round 26516 to the nearest one thousand. 27000 Round -0.00000279 to six decimal places. -0.000003 Round -0.00136446 to five decimal places. -0.00136 What is 0.0000075 rounded to 4 decimal places? 0 What is 0.003453 rounded to four dps? 0.0035 What is 630200 rounded to the nearest 10000? 630000 What is -0.0000791 rounded to 5 decimal places? -0.00008 What is 95229 rounded to the nearest one thousand? 95000 What is 3.8496 rounded to the nearest integer? 4 What is 24.89 rounded to 1 dp? 24.9 Round -77.65 to the nearest 10. -80 What is -0.0000012224 rounded to 7 decimal places? -0.0000012 What is -1097250 rounded to the nearest ten thousand? -1100000 Round -0.00004452 to 6 decimal places. -0.000045 Round 0.0002729 to five dps. 0.00027 What is -0.0009232 rounded to 5 decimal places? -0.00092 Round -0.0000015 to 7 dps. -0.0000015 Round -542.807 to the nearest one hundred. -500 Round 0.0362 to 3 dps. 0.036 Round -0.00005837 to six decimal places. -0.000058 Round 0.4239 to one dp. 0.4 Round 0.038921 to 4 dps. 0.0389 Round 2940 to the nearest 100. 2900 What is 582000 rounded to the nearest one hundred thousand? 600000 Round -0.135995 to three dps. -0.136 What is 3327000 rounded to the nearest one million? 3000000 Round 0.000262714 to five dps. 0.00026 Round 33053 to the nearest 10000. 30000 Round -0.11424 to two dps. -0.11 Round -0.1107 to 2 decimal places. -0.11 What is -0.000050027 rounded to 7 decimal places? -0.00005 What is -423.7 rounded to the nearest 10? -420 What is -1311 rounded to the nearest 100? -1300 What is 853.4 rounded to the nearest one hundred? 900 Round 948970 to the nearest 100000. 900000 What is -259913 rounded to the nearest 1000? -260000 What is -1166 rounded to the nearest 100? -1200 What is 0.000176822 rounded to 5 decimal places? 0.00018 Round -44400000 to the nearest one million. -44000000 Round 130.3 to 0 dps. 130 What is 0.00232625 rounded to 5 decimal places? 0.00233 Round 18.4517 to the nearest integer. 18 Round -529470 to the nearest one hundred thousand. -500000 Round 0.187077 to 2 dps. 0.19 What is -114.48 rounded to the nearest one hundred? -100 Round -1480.13 to the nearest one hundred. -1500 Round -0.000010018 to 6 dps. -0.00001 What is 54489300 rounded to the nearest one million? 54000000 Round 505000 to the nearest 100000. 500000 What is 3479.7 rounded to the nearest one thousand? 3000 Round 0.43454 to 3 dps. 0.435 What is 0.000333 rounded to 5 decimal places? 0.00033 Round 4909400 to the nearest ten thousand. 4910000 Round -0.609 to 2 decimal places. -0.61 Round 0.2509 to 2 dps. 0.25 What is -25890 rounded to the nearest 1000? -26000 What is -0.000000807 rounded to 7 decimal places? -0.0000008 Round -0.006654 to 3 decimal places. -0.007 What is 3480 rounded to the nearest 100? 3500 Round 0.00000047662 to 7 dps. 0.0000005 Round 20.625 to one decimal place. 20.6 What is -1.902 rounded to one dp? -1.9 What is -0.000001004 rounded to 7 decimal places? -0.000001 Round 26.516 to the nearest integer. 27 What is -55.8 rounded to 0 decimal places? -56 What is -5184750 rounded to the nearest 10000? -5180000 Round 0.000009179 to 6 decimal places. 0.000009 What is 88.65 rounded to the nearest 10? 90 What is -943.4 rounded to the nearest 100? -900 Round -42500 to the nearest ten thousand. -40000 What is -0.00154 rounded to four dps? -0.0015 What is -1216.3 rounded to the nearest one hundred? -1200 What is -0.00000085871 rounded to seven dps? -0.0000009 What is -35.81 rounded to the nearest ten? -40 Round -46017 to the nearest one thousand. -46000 Round -5.67 to zero dps. -6 Round -94000 to the nearest ten thousand. -90000 What is 0.000002767 rounded to 7 decimal places? 0.0000028 What is -3840000 rounded to the nearest one million? -4000000 Round -321.87 to the nearest one hundred. -300 Round -126000 to the nearest ten thousand. -130000 What is -0.00000224 rounded to 6 decimal places? -0.000002 What is -435 rounded to the nearest 10? -440 Round -0.713 to one decimal place. -0.7 What is 1.3162 rounded to one decimal place? 1.3 Round -0.19543 to 3 decimal places. -0.195 What is -16.7655 rounded to two decimal places? -16.77 Round -70100000 to the nearest one million. -70000000 What is -4.99 rounded to the nearest ten? 0 What is -12739000 rounded to the nearest one hundred thousand? -12700000 What is 30110000 rounded to the nearest 100000? 30100000 Round -50320000 to the nearest 1000000. -50000000 Round 0.00184827 to 4 dps. 0.0018 Round 183500 to the nearest one hundred thousand. 200000 Round 0.00009656 to five decimal places. 0.0001 What is 0.00148 rounded to 4 dps? 0.0015 Round 0.0002899 to five dps. 0.00029 What is 6925 rounded to the nearest 100? 6900 Round -716.1 to the nearest 10. -720 Round -47680 to the nearest 1000. -48000 What is -0.000026451 rounded to 6 dps? -0.000026 What is -5.01 rounded to the nearest integer? -5 Round 20300000 to the nearest one million. 20000000 What is 0.014788 rounded to three decimal places? 0.015 What is -0.00031849 rounded to 5 decimal places? -0.00032 What is 12240 rounded to the nearest one thousand? 12000 Round 12374000 to the nearest 100000. 12400000 Round 0.0000001 to five decimal places. 0 What is -0.0061249 rounded to three dps? -0.006 What is 301160 rounded to the nearest one thousand? 301000 What is 67700 rounded to the nearest ten thousand? 70000 What is -0.0000586 rounded to five decimal places? -0.00006 Round -0.016575 to three dps. -0.017 What is 0.00007007 rounded to five decimal places? 0.00007 What is -2681.2 rounded to the nearest 100? -2700 Round -17.2 to the nearest ten. -20 What is 525600 rounded to the nearest one hundred thousand? 500000 What is -1448 rounded to the nearest 100? -1400 Round 0.0036727 to 3 decimal places. 0.004 What is -2919 rounded to the nearest one hundred? -2900 Round 0.81775 to 1 dp. 0.8 Round 941200 to the nearest one hundred thousand. 900000 What is 82620 rounded to the nearest 1000? 83000 What is 0.00137949 rounded to four dps? 0.0014 Round -12.874 to the nearest ten. -10 What is -0.000011 rounded to 5 decimal places? -0.00001 What is 0.00018025 rounded to five dps? 0.00018 Round -9566 to the nearest 10000. -10000 What is -149500 rounded to the nearest ten thousand? -150000 Round 0.2178 to two dps. 0.22 What is 292300 rounded to the nearest 100000? 300000 What is 2.9 rounded to the nearest 10? 0 What is -2174.2 rounded to the nearest 10? -2170 Round -26.08 to zero dps. -26 What is 356.4 rounded to the nearest 10? 360 What is 0.000000987 rounded to seven decimal places? 0.000001 What is 11088.7 rounded to the nearest 1000? 11000 Round -9.94 to the nearest integer. -10 What is 9730000 rounded to the nearest one million? 10000000 What is -16.13 rounded to 0 decimal places? -16 Round -10.4 to the nearest integer. -10 What is 5574 rounded to the nearest one thousand? 6000 Round 0.0000014858 to seven decimal places. 0.0000015 What is 0.071311 rounded to two decimal places? 0.07 What is 722.63 rounded to the nearest one hundred? 700 What is -0.00003965 rounded to 6 dps? -0.00004 Round 11040 to the nearest one thousand. 11000 Round -0.000032515 to 6 dps. -0.000033
Express (1 - 2 - 2)(3 + 3 - 4)(-1 + 0 + 2)((-1 - 1 + 0)(-51j - 21j + 19j) + j - 2j + 2j) as gj + c and give c. 0 Rearrange (-l - 3l + 5l)(-1 + 6 - 3) + (-33 + 73 + 81)(5l - 3l - 1 - 3) to the form il + m and give m. -484 Rearrange -192766 + 192766 + 3698s to x + hs and give h. 3698 Rearrange (-158 - 147 - 22)(16 - 4 + 10)(-3k*3 + 4k3 + k3) to wk + uk*3 + t + jk*2 and give u. -14388 Express 998b*3 + b - 2006b*3 + 962b*3 - 2b*2 - 5 + 1 + 0 as yb*2 + ob*3 + xb + a and give y. -2 Rearrange -z - 325 + 40z2 - 124 - 211z*2 + 74z*2 + 63z*2 to the form pz + hz2 + i and give i. -449 Rearrange (-l + 3l - 3l)(2436l + 2512l - 4948l + 10408l*2) to the form zl*3 + kl*2 + ol + b and give z. -10408 Rearrange 23t4 - 39 + 12t4 + t3 - 18t4 - 2t to ut + pt*2 + q + nt*4 + ft*3 and give u. -2 Express 2w + 0w - w + (1 + 2 - 4)(4w + w - 7w) + w - 3w + 4w + 0w + w + w + (0 + 0 - 2)(3w - w + w) as zw + u and give z. 1 Rearrange 4 + 3g + 77439g*2 - 38636g*2 - 38654g*2 to bg*2 + c + ug and give c. 4 Rearrange ((1 - 3 - 14)(-3 - 1 + 6) - 6 - 9 + 3)(0 + 4 - 1)(-2x - 4 + 4) to px + t and give p. 264 Express (4 + 1 - 4)(-17 + 17 + 7f2) + 382 + 203f*2 - 382 as m + lf + nf2 and give n. 210 Express 711q + 521q + 2487q + 3943q in the form o + sq and give s. 7662 Express (3 - 3 - b)(2b + b - b) + 9b2 - 136 + 136 - 3 + 3 - 2b*2 + (2b*2 - 3b*2 + 5b*2)(1 + 0 + 4) as wb2 + n + ab and give a. 0 Express -8 + 9 + 2o2 + 1149o + 12o - 219o as ko2 + c + vo and give v. 942 Rearrange -3710i + 3 - 3701i - 40i2 + 7408i to yi2 + q + xi and give x. -3 Express d*2 + 1043d*3 - 2 - 2d*2 + 2505d*3 + 2d*2 - 2d - 869d3 in the form md*2 + nd + hd3 + k and give n. -2 Express w3 - 2w*4 + 1882w - 936w - 56 - 937w in the form aw3 + y + jw*4 + iw + kw2 and give i. 9 Rearrange 17100 + 129x*2 + 17072 - 34168 to dx*2 + s + bx and give d. 129 Express -4q - 6q*2 + 123 + 121 - 3q - 349 + 128 in the form c + kq2 + fq and give c. 23 Express (1783s - 1783s - 35s2)(37s + 8 - 20s - 15s) as g + js*2 + ms + ps3 and give j. -280 Express (-8920p*2 - 66p*2 + 1068p*2)(2p + 3p - 3p) as xp + rp2 + t + kp3 and give k. -15836 Express 85 - 725 - 499 - 495 - t2 - 282 in the form gt + i + qt*2 and give i. -1916 Express 113u*4 + 3u + 2 - 70u4 - 35u*4 + 16u*3 in the form au*3 + b + vu*4 + cu + xu2 and give v. 8 Rearrange -33996w - 1 - 15792w + 26347w + 1 to the form a + uw and give u. -23441 Rearrange (77w + 188w + 58w)(-8 - 1 - 1) to lw + c and give l. -3230 Rearrange 23p2 + 99p - 200p + 94p to vp + fp*2 + c and give f. 23 Rearrange (0t*2 + 3t*2 + 0t*2)(0 + 2 - 1 + 17t)(1 - 8 - 8)(0 - 3 + 0) to y + st + xt2 + vt*3 and give v. 2295 Rearrange (-6 + 3 + 2)(-1 - 433z + 108z - 502z + 45z) to tz + b and give b. 1 Express 112 - 216r*2 + 215r*2 - 387 - 244 - 61 + (-1 + 1 - 2)(-4r2 + 4r2 + r2) as jr + c + zr*2 and give z. -3 Rearrange (2f - 2f - 2f*3 + (1 + 4f - 1)(-3 + 3f*2 + 3))(-1903f - 51001 + 102010 - 51009) to df*2 + of + s + af3 + hf*4 and give o. 0 Express 3203 + y - 5631 - 17441 - 2y in the form c + ty and give t. -1 Rearrange x - 9x*4 - 8x*2 + 3016 + x - 3010 to the form dx*2 + nx*4 + tx + v + qx3 and give n. -9 Rearrange (-22 + 100 + 91)(-111n4 + 200 - 200) to the form s + an*4 + cn + zn3 + fn*2 and give a. -18759 Express -277 - 659w + 57w + 275 in the form v + pw and give p. -602 Rearrange 0r2 - 10r*2 + 2r*2 + 281 - 81 to the form qr + w + or2 and give w. 200 Express -633 - c - 4c + 288 + 270 in the form wc + l and give l. -75 Express (-81b + 35b - 19b)(b + 3b + 6b) + (-b + 2b + b)(2b - 3 + 3) - 3b2 + 2b*2 + 3b2 + 2 - 2 - b2 as ob + ub*2 + a and give u. -645 Rearrange (-6w + 311w - 42w)(0 + 0 - 1)(0w - w + 4w + (-1 + 0 + 3)(0w + 3w - 2w) + 3w + 2w - 3w + 0w + 3w - 2w) to pw2 + q + mw and give m. 0 Rearrange 2 + 7a3 - 2a*2 - 6a*3 + 38a*2 - 2a*3 to the form da*2 + qa*3 + ya + x and give q. -1 Rearrange 19f - 46f - 90f2 - 2 - f4 - f4 + 25f - 3f4 to rf*3 + qf + vf4 + m + df*2 and give q. -2 Rearrange (3739 + 4386 - 2525 + 3234 - 284)(d*4 + 2d*3 - 2d*3) to the form ud + qd2 + nd*3 + y + td*4 and give t. 8550 Rearrange -41 - 2t*2 + 4 - 7t + 20 + 2t3 + 19 to the form pt*3 + w + ct*2 + gt and give p. 2 Rearrange -385 - n + 7466n3 - 3732n*3 - 3732n*3 to the form vn + rn2 + z + un3 and give u. 2 Express s2 - s - 3s2 + 8 + 5820s*3 - 5684s3 - s2 as rs2 + cs*3 + ds + q and give d. -1 Express -98w2 - 37w*2 - 6w*3 + 226580 - 226584 - 44w*2 in the form xw*3 + pw*2 + vw + d and give p. -179 Rearrange 23j3 + 2j*4 + 13j*4 - 2j + 31 - 19j4 + 3j*2 - 31 to nj + kj4 + p + rj*2 + aj*3 and give n. -2 Rearrange 50569c - 2 - 66030c + 0 + 2 to the form u + gc and give g. -15461 Express -2z2 + 2 + 140z - 76z + 155z as dz2 + g + vz and give g. 2 Rearrange 3h2 + 0h*2 + 16h - 33h2 - 3h*2 + 34h*2 - 27 to zh + w + lh2 and give w. -27 Rearrange 51 - 8456x + 18311x - 51 + 18878x to the form t + cx and give c. 28733 Rearrange (6k - 2500 - 3k + 2597)(-112k2 + 112k*2 - 44k*3) to the form lk*3 + jk*2 + tk + qk4 + a and give l. -4268 Express (-21i - 17i + 19i)(16i - 1 - 220i2 - 3i - 14i) in the form oi + w + zi2 + ki*3 and give z. 19 Rearrange -140b*2 + 62b*2 + 4b + b*3 - 4b - 860 + 79b2 to the form rb + sb2 + pb3 + w and give p. 1 Rearrange -j4 - j + 38j2 - 30j*2 - 19j*2 to the form o + nj*4 + pj*3 + gj + vj2 and give o. 0 Express -607g + 1228g - 2 - 3 - 2 as b + vg and give b. -7 Rearrange (-21 + 56 + 141)(2 + 3m*2 - 2) + 0m + 0m - 2m*2 to rm + k + sm2 and give s. 526 Express -837v - 2 - 65v + 132v - 114v - 394v as iv + y and give i. -1278 Express 13u + 10u - 21u + (-2 + 1 + 3)(-3u + 0u + 0u) - 6u + 4u + u + 3 - 3 - 5u in the form o + xu and give x. -10 Express (29l + 132l - 39l)(-l + 2l - 3l) - 1 + 11l2 + 4 - 15l*2 - l as b + xl*2 + gl and give g. -1 Rearrange (-7027 - 4827 - 1479 - 17060 - 4888 + 1331)(3n - 3n + 2n*3) to p + cn*2 + vn + in3 and give i. -67900 Rearrange -14 - 185a + 93a + 15 + 97a - 2a2 - 112a*3 to sa + xa3 + m + ya*2 and give y. -2 Rearrange -x - 2x*4 + 188x*2 - 6x*3 - 374x*2 + 194x*2 - 4 + 4x*3 - 4x to p + kx3 + jx + dx2 + tx*4 and give d. 8 Express 809i - 1920i - 5195 - 972i + 5195 as s + xi and give x. -2083 Express 1105682 - 2211368 - 9099v*2 + 1105688 - 7870v*2 in the form nv + i + sv2 and give s. -16969 Rearrange 1173 - 2450 - 5y + 3y3 + 1200 to the form dy*3 + ky*2 + a + zy and give d. 3 Rearrange 4048s2 + 2 + 8274s*2 - 136s + 1394s2 + 136s to zs + hs*2 + p and give h. 13716 Express (4s + 0s - 3s)(-5s*2 + 0s*2 + 2s*2) + (-2s + 5s2 + 2s)(27 - 27 - 152s) in the form ps + rs*3 + ys*2 + i and give r. -763 Express -1228l - 8574l - 2223l in the form u + yl and give y. -12025 Rearrange -2c*3 - 57c - 58c - 16c*3 - 69c + 58c to oc + pc2 + b + vc*3 and give v. -18 Rearrange -146 - 66 - 7d - 77 - 47 to the form ld + f and give f. -336 Express -170269b + 26244b2 + 340540b - 170271b in the form hb + m + gb2 and give g. 26244 Rearrange b - 14670 + 14672 - 827b*2 - 1719b*2 - 3b to xb2 + u + db and give d. -2 Rearrange (2 - 4 + 4)(-47j + 378 + 989 - 1311) to zj + r and give z. -94 Express 3 + 347019m + 346124m - 3 - 711213m in the form h + zm and give z. -18070 Express 9v*3 + 1 + 40v*2 + 9v*2 - 11v*3 + 151v*2 in the form r + gv*3 + yv*2 + dv and give g. -2 Rearrange (-5 + 8 + 11)(-3 - 2 + 7)(-244q3 + 10820q*2 - 10820q*2) to the form wq + lq3 + r + mq*2 and give l. -6832 Express 104g - 49g - 5g*2 - 56g - 7g2 - 808 + 9g*2 as dg + bg2 + a and give b. -3 Express -2j + 2j + 4j*2 + (-8j + 10 - 12j + 3j - 8)(3j + 12j - 3j) in the form rj2 + aj + x and give r. -200 Express (-425 + 1070 + 65p - p2 - 643)(-1 + p*2 + 5 - 2) as gp*2 + yp*4 + r + cp*3 + lp and give y. -1
What is the ten thousands digit of 98471646? 7 What is the hundred thousands digit of 17791929? 7 What is the ten millions digit of 39432685? 3 What is the units digit of 39220268? 8 What is the tens digit of 7292127628? 2 What is the tens digit of 32703429? 2 What is the hundred thousands digit of 2460744787? 7 What is the millions digit of 58988404? 8 What is the units digit of 137404309? 9 What is the hundred thousands digit of 26465629? 4 What is the tens digit of 246517435? 3 What is the thousands digit of 19069930? 9 What is the hundreds digit of 9641417? 4 What is the ten millions digit of 3432765784? 3 What is the thousands digit of 369931547? 1 What is the millions digit of 441145896? 1 What is the ten thousands digit of 112468702? 6 What is the millions digit of 111260287? 1 What is the millions digit of 51679705? 1 What is the units digit of 484198120? 0 What is the ten millions digit of 2184052423? 8 What is the units digit of 3022660072? 2 What is the millions digit of 105131390? 5 What is the ten thousands digit of 2595061559? 6 What is the ten millions digit of 871305002? 7 What is the millions digit of 189970484? 9 What is the millions digit of 23524494? 3 What is the thousands digit of 466887462? 7 What is the hundred thousands digit of 39352214? 3 What is the millions digit of 24372694? 4 What is the billions digit of 5383482347? 5 What is the hundred thousands digit of 65553336? 5 What is the ten thousands digit of 5812554277? 5 What is the hundred thousands digit of 104555019? 5 What is the hundred millions digit of 103194925? 1 What is the tens digit of 92418226? 2 What is the hundreds digit of 535011198? 1 What is the ten thousands digit of 78255271? 5 What is the hundreds digit of 18304062? 0 What is the hundred thousands digit of 19203707? 2 What is the hundreds digit of 341260265? 2 What is the hundred thousands digit of 69566343? 5 What is the units digit of 47747291? 1 What is the hundred thousands digit of 2615757550? 7 What is the hundred thousands digit of 2400621357? 6 What is the ten thousands digit of 303873964? 7 What is the tens digit of 28075616? 1 What is the units digit of 1054294710? 0 What is the units digit of 393322667? 7 What is the billions digit of 1694903164? 1 What is the tens digit of 2756779874? 7 What is the ten millions digit of 16672228? 1 What is the thousands digit of 1009330675? 0 What is the ten millions digit of 340954978? 4 What is the hundred thousands digit of 15928357? 9 What is the millions digit of 1680764711? 0 What is the hundred millions digit of 2713525040? 7 What is the thousands digit of 1513953077? 3 What is the hundred thousands digit of 12772883? 7 What is the hundred millions digit of 287433650? 2 What is the units digit of 89178155? 5 What is the hundred millions digit of 266021446? 2 What is the thousands digit of 5771352759? 2 What is the ten thousands digit of 854961886? 6 What is the thousands digit of 5129732073? 2 What is the units digit of 448330527? 7 What is the hundreds digit of 417081509? 5 What is the ten thousands digit of 856368003? 6 What is the hundred millions digit of 264881603? 2 What is the hundred thousands digit of 266993657? 9 What is the ten thousands digit of 3555433526? 3 What is the ten millions digit of 131885858? 3 What is the tens digit of 25316424? 2 What is the ten thousands digit of 2891429026? 2 What is the hundred millions digit of 520354291? 5 What is the units digit of 768768573? 3 What is the ten millions digit of 186625262? 8 What is the ten thousands digit of 46330657? 3 What is the millions digit of 50026006? 0 What is the hundred thousands digit of 486269760? 2 What is the ten millions digit of 1281762644? 8 What is the tens digit of 308676249? 4 What is the hundred millions digit of 323404101? 3 What is the units digit of 1391294391? 1 What is the units digit of 45781424? 4 What is the ten thousands digit of 92357091? 5 What is the ten millions digit of 16787800? 1 What is the units digit of 91433385? 5 What is the hundred millions digit of 7089573523? 0 What is the hundreds digit of 141106896? 8 What is the tens digit of 791631911? 1 What is the ten thousands digit of 249300835? 0 What is the thousands digit of 31517948? 7 What is the ten thousands digit of 114655976? 5 What is the hundred thousands digit of 54992897? 9 What is the tens digit of 216225268? 6 What is the hundreds digit of 353412157? 1 What is the thousands digit of 3638510040? 0 What is the thousands digit of 56810796? 0 What is the hundred thousands digit of 993819671? 8 What is the hundreds digit of 158007835? 8 What is the ten millions digit of 21790114? 2 What is the tens digit of 2604586603? 0 What is the tens digit of 82769958? 5 What is the hundred thousands digit of 32567461? 5 What is the thousands digit of 48511791? 1 What is the millions digit of 109177133? 9 What is the hundred thousands digit of 98732490? 7 What is the ten thousands digit of 199200196? 0 What is the tens digit of 182443710? 1 What is the millions digit of 181163557? 1 What is the tens digit of 298213215? 1 What is the hundred millions digit of 634603012? 6 What is the tens digit of 11452865? 6 What is the ten millions digit of 90498560? 9 What is the hundred thousands digit of 87003766? 0 What is the units digit of 321861884? 4 What is the hundreds digit of 100328232? 2 What is the hundreds digit of 31038877? 8 What is the millions digit of 6891341? 6 What is the tens digit of 87088381? 8 What is the hundred millions digit of 116027528? 1 What is the hundred thousands digit of 3231572997? 5 What is the ten millions digit of 24540016? 2 What is the hundred millions digit of 365452838? 3 What is the hundred thousands digit of 253549959? 5 What is the ten thousands digit of 33200583? 0 What is the thousands digit of 268873247? 3 What is the ten thousands digit of 906458823? 5 What is the ten millions digit of 1444142549? 4 What is the hundreds digit of 3232018? 0 What is the millions digit of 61552184? 1 What is the tens digit of 473969495? 9 What is the billions digit of 3554884191? 3 What is the hundreds digit of 49808023? 0 What is the hundred thousands digit of 220388018? 3 What is the hundreds digit of 4006668278? 2 What is the ten millions digit of 4456889067? 5 What is the hundred millions digit of 175809881? 1 What is the ten millions digit of 700185059? 0 What is the thousands digit of 63282419? 2 What is the hundreds digit of 18455844? 8 What is the tens digit of 82429163? 6 What is the hundred thousands digit of 30883907? 8 What is the ten thousands digit of 74137965? 3 What is the ten thousands digit of 13335729? 3 What is the hundred millions digit of 3280467391? 2 What is the hundreds digit of 143148599? 5 What is the hundred thousands digit of 33851386? 8 What is the hundred thousands digit of 883475238? 4 What is the hundred thousands digit of 3208316648? 3 What is the units digit of 150283963? 3 What is the hundred thousands digit of 71134157? 1 What is the hundred millions digit of 819753147? 8 What is the hundred thousands digit of 133221255? 2 What is the hundred thousands digit of 55908309? 9 What is the millions digit of 102623866? 2 What is the hundred thousands digit of 13380059? 3 What is the hundred millions digit of 3695336499? 6 What is the tens digit of 1455629119? 1 What is the thousands digit of 8593179? 3 What is the hundreds digit of 81944222? 2 What is the millions digit of 2322380711? 2 What is the units digit of 108224183? 3 What is the hundred thousands digit of 199341945? 3 What is the hundreds digit of 98479075? 0 What is the units digit of 1210063342? 2 What is the hundred millions digit of 1328258993? 3 What is the hundred thousands digit of 1033714586? 7 What is the units digit of 1263366630? 0 What is the thousands digit of 231105691? 5 What is the tens digit of 3320494895? 9 What is the ten thousands digit of 12944082? 4 What is the units digit of 95728769? 9 What is the ten millions digit of 1612287918? 1 What is the ten thousands digit of 108270208? 7 What is the thousands digit of 1396741? 6 What is the hundred millions digit of 1268006612? 2 What is the hundred thousands digit of 638789818? 7 What is the hundred thousands digit of 4044565014? 5 What is the hundred thousands digit of 721210699? 2 What is the millions digit of 369904504? 9 What is the hundred millions digit of 207592076? 2 What is the hundreds digit of 53581625? 6 What is the ten thousands digit of 7804842914? 4 What is the units digit of 102192305? 5 What is the hundred millions digit of 478534342? 4 What is the millions digit of 218634951? 8
Sort 5, -2024, 295 in ascending order. -2024, 5, 295 Put -5, -8793489, -2 in ascending order. -8793489, -5, -2 Put 3, 2/3, -3, -0.7, -52/5, 4.91 in descending order. 4.91, 3, 2/3, -0.7, -3, -52/5 Sort -819, 21, -2303 in decreasing order. 21, -819, -2303 Sort 0, -2, 39, 93, -1, -5 in decreasing order. 93, 39, 0, -1, -2, -5 Sort 5, -120, 14, 13, 3, -18, -4 in descending order. 14, 13, 5, 3, -4, -18, -120 Put 24/7, 1, 17/6, -39/19, -2 in descending order. 24/7, 17/6, 1, -2, -39/19 Put -191, -4, 63, 488, -3 in increasing order. -191, -4, -3, 63, 488 Put 3, -0.3, 0, 1337, -40, 0.2 in increasing order. -40, -0.3, 0, 0.2, 3, 1337 Sort -2, 0, -28557. -28557, -2, 0 Put 0, 2056, -1, 4, 3 in ascending order. -1, 0, 3, 4, 2056 Put 1, -10, 0.09, -1/6, 4/3, 5.3 in decreasing order. 5.3, 4/3, 1, 0.09, -1/6, -10 Sort 1/5, 8/489, -4, -434 in increasing order. -434, -4, 8/489, 1/5 Put 4, -3, 5904, -19, 1 in ascending order. -19, -3, 1, 4, 5904 Put 2, 5, -1, -5, 246563 in descending order. 246563, 5, 2, -1, -5 Sort 64, 3, 47374 in increasing order. 3, 64, 47374 Put 1/3, 0, 4, 2, 3, -788, -1/6 in ascending order. -788, -1/6, 0, 1/3, 2, 3, 4 Sort -1312, -5, 42417 in descending order. 42417, -5, -1312 Put -141, -2, -1, 148, -3, -4, 0 in ascending order. -141, -4, -3, -2, -1, 0, 148 Sort -7, 77, 0.8846 in descending order. 77, 0.8846, -7 Put -3, 10805, 0, 5 in decreasing order. 10805, 5, 0, -3 Put 2, 2208, 5, 81, 0 in increasing order. 0, 2, 5, 81, 2208 Put 0, -30/11, 6, 5, -1/6, 1, 44 in descending order. 44, 6, 5, 1, 0, -1/6, -30/11 Put 2, 206, -3, -10, -9, -4 in ascending order. -10, -9, -4, -3, 2, 206 Sort 104, -3/16, -1971 in decreasing order. 104, -3/16, -1971 Put 0.1, -21293.7, 3, 2.3 in descending order. 3, 2.3, 0.1, -21293.7 Sort -7445, 0, 16, -114 in ascending order. -7445, -114, 0, 16 Sort -4, -1.955, -0.4, 15, 1.4. -4, -1.955, -0.4, 1.4, 15 Put 67, -1, -22, 40, -4 in ascending order. -22, -4, -1, 40, 67 Put 2604, -179/6, 5/6 in descending order. 2604, 5/6, -179/6 Put 31, -1952, 143/3 in ascending order. -1952, 31, 143/3 Put -9.3, -743, 1, -137, 0, 0.1 in increasing order. -743, -137, -9.3, 0, 0.1, 1 Sort 52.3, -0.06, 3, 1/3, -1/15, -5 in decreasing order. 52.3, 3, 1/3, -0.06, -1/15, -5 Sort 0.06, -1.3, -0.1758, 0.07 in increasing order. -1.3, -0.1758, 0.06, 0.07 Put 5, 3/3650, 0.3, 1 in decreasing order. 5, 1, 0.3, 3/3650 Sort 6, -2, 3, -114105 in descending order. 6, 3, -2, -114105 Put -2, 84312, 254, -3 in descending order. 84312, 254, -2, -3 Put -437, -1757, 1/8, 3/7, -3/8, 2 in increasing order. -1757, -437, -3/8, 1/8, 3/7, 2 Sort 1, 23, 23149 in ascending order. 1, 23, 23149 Sort 4, -185503, 3 in ascending order. -185503, 3, 4 Put -0.085, -2/7, 4, 45.83 in increasing order. -2/7, -0.085, 4, 45.83 Sort 4, -3, 5, -53322, 1 in descending order. 5, 4, 1, -3, -53322 Put 20522, 2, 1, -4 in increasing order. -4, 1, 2, 20522 Sort 19.932, 2, 3 in ascending order. 2, 3, 19.932 Sort 0.1, -1/2, 16, -5344, -3, 2 in ascending order. -5344, -3, -1/2, 0.1, 2, 16 Sort -16, -1812500, 0, 5 in decreasing order. 5, 0, -16, -1812500 Sort 121, -16809, 1 in ascending order. -16809, 1, 121 Sort 6/7, -1/3, 2/13, -2, -52, 973 in increasing order. -52, -2, -1/3, 2/13, 6/7, 973 Sort 0.4, 4, 0.9, -0.0679, 0.5 in decreasing order. 4, 0.9, 0.5, 0.4, -0.0679 Sort 68, -8, 0, 9, -5, -222. -222, -8, -5, 0, 9, 68 Put 14/15, -0.07, -2/14275, -2 in descending order. 14/15, -2/14275, -0.07, -2 Sort -90/173, -4/7, -7, -1/3 in increasing order. -7, -4/7, -90/173, -1/3 Sort 40, -4, 1, -787 in descending order. 40, 1, -4, -787 Sort 73, 5, -50, -80. -80, -50, 5, 73 Put -2, 3, 0, 16, -14, 56 in descending order. 56, 16, 3, 0, -2, -14 Sort 2, 14, 4, -307473 in descending order. 14, 4, 2, -307473 Put 214, -2, 1, 2, -8, -1, 46 in ascending order. -8, -2, -1, 1, 2, 46, 214 Sort -179851153, 0, -4 in decreasing order. 0, -4, -179851153 Sort 14388, -82, 3 in ascending order. -82, 3, 14388 Put 22521, 43, 5, 3 in descending order. 22521, 43, 5, 3 Sort -8, 3, -2184, -100 in descending order. 3, -8, -100, -2184 Sort 0.5, -2, 54, 4, -2313, 16. -2313, -2, 0.5, 4, 16, 54 Put 5, 2, 0, -15, -367, 20 in ascending order. -367, -15, 0, 2, 5, 20 Put 4, 3, -90, 61586 in increasing order. -90, 3, 4, 61586 Put 1, 16, -1, 3, -211, -3 in decreasing order. 16, 3, 1, -1, -3, -211 Put 3/4, -1/2, 1/2, 2/5, -23025 in decreasing order. 3/4, 1/2, 2/5, -1/2, -23025 Sort 2, 5, -5, -45/28, 248, 5/3 in decreasing order. 248, 5, 2, 5/3, -45/28, -5 Put 3/7, -45, -26, -9, 5, 73/7 in descending order. 73/7, 5, 3/7, -9, -26, -45 Sort 0, -19, -6507540. -6507540, -19, 0 Sort 2, -3, 5, -5200, 173 in decreasing order. 173, 5, 2, -3, -5200 Put 105, 2, -41, -24 in ascending order. -41, -24, 2, 105 Put 4, 0.3, -4, -1, 2, 58, 0 in increasing order. -4, -1, 0, 0.3, 2, 4, 58 Put -104, 73, 1, 0, -3/2, 0.5, -4 in decreasing order. 73, 1, 0.5, 0, -3/2, -4, -104 Sort -3, -1, -11, 0, -13681, 98 in descending order. 98, 0, -1, -3, -11, -13681 Put -5, -1769, -8, -3, 11, -2, -4 in descending order. 11, -2, -3, -4, -5, -8, -1769 Sort -7/25, -365644, -0.5 in decreasing order. -7/25, -0.5, -365644 Put -138, 817, -1231 in increasing order. -1231, -138, 817 Put -10, 80, -7, 26, -4 in decreasing order. 80, 26, -4, -7, -10 Sort 2, -26, 1, -1291893 in increasing order. -1291893, -26, 1, 2 Sort 4, -1420, -4, -1, 59. -1420, -4, -1, 4, 59 Sort 46229, 3, -30 in decreasing order. 46229, 3, -30 Sort 1258035, 2, -2/11, 1, -0.02 in descending order. 1258035, 2, 1, -0.02, -2/11 Put -2, 4/4621863, -2/49 in ascending order. -2, -2/49, 4/4621863 Sort 3, -1/4679, -0.06, -0.5, 4. -0.5, -0.06, -1/4679, 3, 4 Put -0.33, -3, -5, -42115, 5 in decreasing order. 5, -0.33, -3, -5, -42115 Sort -49, 703806, 3 in decreasing order. 703806, 3, -49 Put -547, 80, -12, -4 in descending order. 80, -4, -12, -547 Sort 4, -4, 3, 132, 18, -51, 0. -51, -4, 0, 3, 4, 18, 132 Sort -781, -3, -1, 11765 in descending order. 11765, -1, -3, -781 Sort 1, 2, -0.5, -37225, 3. -37225, -0.5, 1, 2, 3 Put -121, 58963, 78 in ascending order. -121, 78, 58963 Put 58, 4, -5, -3, -9, 2, -4 in descending order. 58, 4, 2, -3, -4, -5, -9 Sort 14416, -0.162, -1/2, -3 in ascending order. -3, -1/2, -0.162, 14416 Sort -2, -21, -1669, -4, 3, -6, 0 in descending order. 3, 0, -2, -4, -6, -21, -1669 Put 2, -112, -3, 1443 in descending order. 1443, 2, -3, -112 Sort -1/3, 1/503, -34, 33/5 in increasing order. -34, -1/3, 1/503, 33/5 Sort -3, -4, -2, 2703, 103, -7. -7, -4, -3, -2, 103, 2703 Sort -61, 1, 3, -2/9, -8879 in ascending order. -8879, -61, -2/9, 1, 3 Sort 1/1446155, 3, -5 in increasing order. -5, 1/1446155, 3 Put -11, -2, 6, 0, 0.1, 1/44, -4 in decreasing order. 6, 0.1, 1/44, 0, -2, -4, -11 Put -3, 0.4, 191, -636.6 in descending order. 191, 0.4, -3, -636.6 Sort -0.08, 4/7, 3/80, 3, -13333. -13333, -0.08, 3/80, 4/7, 3 Sort 4, -1, 8632, 11, 6 in ascending order. -1, 4, 6, 11, 8632 Put 2, -0.2, -2/49, 0.5, 4.1, 67/6 in decreasing order. 67/6, 4.1, 2, 0.5, -2/49, -0.2 Sort 1, -7, 6, 11, -1, 53, -4. -7, -4, -1, 1, 6, 11, 53 Put -5, 36, 0, -14, 22, 15, 1 in descending order. 36, 22, 15, 1, 0, -5, -14 Sort -5, 17, 27, -7, 297, 4 in descending order. 297, 27, 17, 4, -5, -7 Put -5, 9, 111, -37 in decreasing order. 111, 9, -5, -37 Sort 3, -12/11, -22342 in decreasing order. 3, -12/11, -22342 Sort -2, -108, 122580, -6. -108, -6, -2, 122580 Put -4/45, -6671, 2, -6 in decreasing order. 2, -4/45, -6, -6671 Sort -258, -1227, -3, 5. -1227, -258, -3, 5 Sort -31, -1.1, -2/11, 6, 3, 0, 11 in increasing order. -31, -1.1, -2/11, 0, 3, 6, 11 Sort -1355695, -5, -0.134 in descending order. -0.134, -5, -1355695 Put -2145, 116, 10 in decreasing order. 116, 10, -2145 Put -3, -4, 11, 5208, 2 in descending order. 5208, 11, 2, -3, -4 Sort -1, 3, -660881, 0, 8.9, -0.4 in decreasing order. 8.9, 3, 0, -0.4, -1, -660881 Put 29123, -67, 3/7, -2/7 in increasing order. -67, -2/7, 3/7, 29123 Sort -1, -1/45, 254, 0.8 in increasing order. -1, -1/45, 0.8, 254 Sort -2/11, 0, 107, 9/16, 20, -1/3 in descending order. 107, 20, 9/16, 0, -2/11, -1/3 Put 0, 1566, -0.136, -7/9, 4/5 in decreasing order. 1566, 4/5, 0, -0.136, -7/9 Sort 245, 123, 1, -1, -5, 4 in ascending order. -5, -1, 1, 4, 123, 245 Put -2/13, 3/2, 2/3, -35/68, 0.4 in decreasing order. 3/2, 2/3, 0.4, -2/13, -35/68 Put 56637, 19, -5, 3 in ascending order. -5, 3, 19, 56637 Put -85, -3, -68, 3, -83 in increasing order. -85, -83, -68, -3, 3 Put 18, 496892, -2 in decreasing order. 496892, 18, -2 Sort 17718, 8/3, 0.03, 3/4, -1/7 in increasing order. -1/7, 0.03, 3/4, 8/3, 17718
Let q(r) = r3 + r - 2. Let g be q(0). Let m(f) = f3 + 2f2. Let u be m(g). Let h(y) = uy*2 + 2y2 + y2 - y2. Let k(z) = -z2. Determine k(h(l)). -4l4 Let v(u) = -6u + 29. Let w(x) = -x*2. What is w(v(n))? -36n*2 + 348n - 841 Let y(p) = -p. Let d(t) = t + 1937. Calculate y(d(b)). -b - 1937 Let f(j) = -4j2 - 2. Let b(h) = -17h + 56h - 20h - 18h. What is b(f(s))? -4s2 - 2 Let v(b) be the second derivative of b3/2 + 32b. Let j(u) = 52u. Determine v(j(t)). 156t Let h(c) be the third derivative of c4/6 - 5c*2. Let v(s) = 3s*2. Calculate h(v(t)). 12t*2 Let x(b) = -b. Let k(w) = -6w*2. Determine x(k(z)). 6z*2 Let a(i) = 6i. Let p(y) = y*2 + 10y. Give a(p(f)). 6f2 + 60f Let s(n) = -5n2. Let g(p) = p2 + 212. Calculate g(s(d)). 25d4 + 212 Let s(k) = -k2. Let m(g) be the third derivative of 0g4 + 0g + 0g3 + 0 - 1/60g*5 + 5g2. Give s(m(y)). -y4 Let s(x) be the third derivative of -x4/6 - x2. Let r(d) = d - 1. Let f(t) = 5t - 4. Let v(b) = -f(b) + 4r(b). What is s(v(a))? 4a Let v(s) = s2 - 7s. Let h(y) = -2y. Let a(b) = 7h(b) - 2v(b). Let q(c) = 4c. Calculate q(a(i)). -8i2 Let g(c) = -32c. Let i(s) = -2s2. Determine i(g(p)). -2048p*2 Let y(j) be the second derivative of -3j + 1/4j4 + 0j*3 + 0 + 0j2. Let u(s) = -s2. Determine u(y(l)). -9l4 Let u(g) = 82g2. Let f(c) be the second derivative of -c4/12 + 14c. What is u(f(l))? 82l*4 Let r(j) = -3 + 3 + 2j*2. Let g(y) = -5y + 6 - 6. What is r(g(d))? 50d2 Let s(k) = 7k. Let t(v) = -266v. Let j(q) = 77s(q) + 2t(q). Let d(n) be the third derivative of -n5/30 - 3n*2. Determine j(d(h)). -14h*2 Let w = 3 - 1. Let d(x) = -4x*2 + 2x - x*2 - wx. Let r(o) = 2o. Give r(d(n)). -10n*2 Let y(h) = -h - 1. Let p(r) = r - 2. Let x = -1 - 0. Let z(b) = xp(b) + 2y(b). Let s(w) = w. What is z(s(l))? -3l Let u(h) = 15h + 2. Let v(q) = -q. Calculate v(u(m)). -15m - 2 Let w(j) = j*2. Let n(b) be the third derivative of -2b*2 + 1/60b*5 + 0 + 0b + 0b3 + 0b4. Determine w(n(p)). p4 Let l(x) = -4x + x + 3x + 3x. Let o(c) be the second derivative of c4/12 + 2c. Calculate o(l(k)). 9k2 Let n(k) = -2k*2. Let m(z) = 768z. What is m(n(q))? -1536q2 Let j(h) = -5h*2. Let w(y) = -2y. Let d(z) = 2z. Let l(o) = -5d(o) - 6w(o). Give j(l(k)). -20k*2 Let q(x) = 4x. Let z(j) = 11j2 + 2. Determine z(q(h)). 176h*2 + 2 Let m(z) be the third derivative of -5z4/24 + z2. Let i(x) = 4x + 2. Let o(q) = -9q - 5. Let d(l) = 5i(l) + 2o(l). Determine d(m(y)). -10y Let p(i) = 3i. Let u be (0 - 6)2/(-6). Let v(j) = -ju + 8 - 8. Calculate p(v(t)). -3t2 Let z(w) be the second derivative of -w4/12 - 3w. Let p(d) = 9d*2. Determine p(z(x)). 9x*4 Let g(t) = -77t*2. Let p(x) = -7x*2. Calculate p(g(r)). -41503r*4 Let i = 0 + 2. Let o(m) = 0m - 3m - im + 6m. Let r(j) = -2j*2. Calculate o(r(k)). -2k*2 Let y(k) = -1. Let z(a) = -3a - 3. Let w(p) = 3y(p) - z(p). Let v(q) = -19 + 2q + 19. What is v(w(b))? 6b Let l(n) be the second derivative of 0 - 1/3n*3 - 3n + 0n2. Let w(h) = 7h. Calculate l(w(k)). -14k Let p(q) = -q + 11. Let t be p(9). Let x(d) = d2 + 2d*t + 3d*2 - 4d*2. Let g(f) = 4f + 0 + 0. What is g(x(k))? 8k2 Let t(f) = 2f*2. Let d(y) be the first derivative of 8/3y*3 - 5 + 0y + 0y2. Give d(t(b)). 32b*4 Let g(a) = -3a. Let z(i) = -9i2 - 11i*2 + 23i*2. Determine z(g(h)). 27h*2 Let v(u) = -2u*2. Let p(g) = -138g*2 - 13g + 13. Let l(z) = -23z2 - 2z + 2. Let o(w) = -39l(w) + 6p(w). Give o(v(b)). 276b4 Let z(q) = -1. Let m(v) = v2 + 5. Let s(o) = m(o) + 5z(o). Let f(d) = -31d. Give f(s(x)). -31x*2 Let g(h) = -179h + 4 + 182h - 4. Let t be 1(-6)/(1-2). Let z(b) = tb - b - b. What is z(g(v))? 3v Let r(p) = -100p. Let y(i) = -6i. Give r(y(n)). 600n Let p(r) = -r. Let u be (-3)/4 - (-19)/4. Let q(z) = uz2 - 5z*2 - 2z*2. What is q(p(k))? -3k2 Let h(s) be the first derivative of -s3/3 + 1. Let y(b) = 2b2 + 3b. Let p(t) = 6t2 + 8t. Let r(l) = 3p(l) - 8y(l). Give r(h(n)). 2n4 Suppose 0 = -5u - 3d + 3, 2u = 3d - 2 - 1. Let o(z) = 0z*2 + uz*2 - 3z*2. Let a(n) = -2n*2. Determine a(o(k)). -18k4 Let v(x) be the third derivative of -x7/840 + x*4/12 + 9x*2. Let l(b) be the second derivative of v(b). Let w(f) = -f. Determine l(w(h)). -3h*2 Let m(x) = 5x. Let r(a) = 4a2 - 6. What is m(r(u))? 20u*2 - 30 Let k(p) = -2p. Suppose 3m + m + 24 = 2a, 2m - 8 = -4a. Let c(g) = -2g + ag - g - 4g. Determine k(c(l)). 6l Let a(k) = 8k + 7. Let x(h) = -2h. Calculate a(x(d)). -16d + 7 Let h(y) = -3y*2. Suppose 16s - 57 = 7. Let f(q) be the third derivative of 0 + 1/8qs + q2 + 0q*3 + 0q. Determine f(h(g)). -9g2 Let l(o) = -2o*2 - 22o + 22o. Let a(y) be the first derivative of 4 - 1 - 1 + y2. Determine l(a(d)). -8d*2 Let n(z) = 13z. Let p(u) = -36u2. Give p(n(l)). -6084l*2 Let b(z) = -10z*2 - 7z. Let a(y) = -7y2 - 5y. Let g(k) = 7a(k) - 5b(k). Let s(h) = -3h + 7h + h*2 - 4h. Determine s(g(m)). m*4 Let f(o) be the first derivative of 0o*2 - 2/3o*3 - 1 + 0o. Let a(u) = -5u2. Determine f(a(g)). -50g*4 Suppose -b + 3 = -d, d - 3d + 8 = 5b. Suppose 0 + b = q. Let n(v) = 5v + 2v - qv. Let a(r) = -2r2. Determine n(a(h)). -10h2 Let i(b) be the third derivative of b5/30 + b*2. Let v(q) be the first derivative of 1/3q*3 + 0q + 1 + 0q2. What is v(i(y))? 4y*4 Let i(s) = -2s2. Let r(p) be the third derivative of p5/20 - 12p2. What is r(i(a))? 12a*4 Let i(s) be the first derivative of 2 + 0s - 1/2s2. Let o(k) = -14k. What is i(o(p))? 14p Let g(q) = 5q - 6. Let o(z) be the second derivative of z*3/3 - 11z - 1. What is g(o(r))? 10r - 6 Let c(z) = -5z - 589. Let a(y) = -y. Determine c(a(v)). 5v - 589 Let h(g) = -4g*2. Suppose 5 = 5l + 3d - 16, -4d + 2 = -2l. Let y(j) = -j + 3j + 0j - lj. Calculate y(h(p)). 4p2 Let d(y) = -y + 7. Let l be d(6). Let g(p) be the first derivative of p3 - l + 0p*3 + 0. Let u(x) = -2x. Calculate u(g(w)). -6w2 Let q(s) = -25 + 10 - s + 15. Let y(d) = 7d. Let o(k) be the second derivative of k*3/6 + 3k. Let g(j) = -18o(j) + 2y(j). Determine g(q(a)). 4a Let w(u) be the first derivative of -u2 + 5. Let q(m) be the third derivative of -m5/12 - m2. Calculate q(w(s)). -20s*2 Let b(o) = -8o. Suppose 24 = -3p + 6p + 3q, -2q + 12 = p. Let g(v) = -11 + 2v2 + p + 7. Give b(g(a)). -16a*2 Let i(l) be the first derivative of 0l2 + l2 + 0l2 + 0 + 2. Let y(g) = 5g. Give y(i(u)). 10u Let a(h) = 6h*2. Let x(c) = 3164c*2. Calculate x(a(d)). 113904d*4 Let g be 9/(-6)16/(-6). Let t = g + -1. Let n(p) = -3 + p + t. Let b(s) = -3s. Determine b(n(h)). -3h Let h(o) be the second derivative of -o*4/12 - o. Suppose -2y - 9 = -5y. Let v(m) = -2m - 3m + ym. Give h(v(i)). -4i2 Let r(p) be the first derivative of -11p*2/2 - 9. Let w(k) = 2k*2. Calculate r(w(h)). -22h*2 Let a(i) = -9i*2 + 2i - 2i. Let x(c) = -8c*2. What is x(a(d))? -648d*4 Let o(n) = 5n + 9. Let v(w) = w + 2. Let q(d) = -2o(d) + 9v(d). Let l(m) = 8m2. Determine q(l(s)). -8s2 Let v(m) = m2. Let u(j) = 31j + 3j - 2j. Determine v(u(d)). 1024d2 Let x(p) be the first derivative of p4/24 + p*2/2 - 1. Let n(m) be the second derivative of x(m). Let s(i) = 2i*2. Give n(s(w)). 2w*2 Let y(c) = -2c. Let x be 0/((12/2)/3). Let g(v) = xv2 - 2v*2 + 2v*2 + 2v*2. Give g(y(u)). 8u2 Let f(u) = -u3 - 5u2 - 7u - 6. Let b be f(-4). Let c(q) = -q + 2q - bq. Let w(t) = -t*2. What is w(c(m))? -25m*2 Let l = -5 + 6. Let b(y) = -y - 1. Let d(j) = 4j + 3. Let p(w) = ld(w) + 3b(w). Let x(o) = 2o2. Give x(p(g)). 2g*2 Let n(r) = -114r*2. Let v(h) = 2h. Determine v(n(c)). -228c2 Let s(n) = 2n*2. Let v(p) be the third derivative of -5p*4/24 - 7p*2. Give v(s(b)). -10b*2 Let k(t) = 11t + 30. Let c(d) = -5d2. What is c(k(p))? -605p*2 - 3300p - 4500 Let w(b) = -102b. Let o(z) = 5z. What is w(o(m))? -510m Let k(c) = 3c*2 - 25c - 3. Let y(x) = x + 1. Let i(g) = -k(g) - 3y(g). Let a(z) = 2z. Give a(i(w)). -6w2 + 44w Let f(x) = -x*2. Let a(j) = 765j - 136. Let z(u) = 17u - 3. Let r(m) = 3a(m) - 136z(m). What is f(r(o))? -289o**2
Three letters picked without replacement from jujyuyujyjjjjjyuy. Give prob of sequence yyy. 1/68 Two letters picked without replacement from xxpjx. Give prob of sequence px. 3/20 Three letters picked without replacement from {z: 1, g: 4, s: 2, a: 2, b: 1}. Give prob of sequence ssa. 1/180 Two letters picked without replacement from {p: 1, s: 1, a: 2, h: 9}. What is prob of sequence as? 1/78 Four letters picked without replacement from {z: 5, c: 2, v: 3, a: 2, s: 8}. Give prob of sequence csvz. 2/969 Four letters picked without replacement from {l: 5, u: 2, f: 1, r: 5, c: 3}. What is prob of sequence lulr? 5/1092 Calculate prob of sequence tp when two letters picked without replacement from {t: 3, h: 3, y: 5, p: 1, e: 1}. 1/52 Calculate prob of sequence bra when three letters picked without replacement from {a: 2, b: 1, g: 2, k: 1, x: 1, r: 1}. 1/168 Calculate prob of sequence ufff when four letters picked without replacement from {x: 2, f: 4, u: 2, b: 12}. 2/4845 Calculate prob of sequence ok when two letters picked without replacement from {k: 1, m: 1, o: 3, p: 3, h: 3, v: 3}. 3/182 What is prob of sequence hh when two letters picked without replacement from zhdhhhhhj? 5/12 Four letters picked without replacement from zyxkrktkzzrrx. What is prob of sequence yzkt? 3/5720 Two letters picked without replacement from {m: 3, e: 1}. Give prob of sequence mm. 1/2 Four letters picked without replacement from {x: 5, j: 4, y: 6}. Give prob of sequence jjyj. 2/455 Two letters picked without replacement from llqqqllqlqqqqlqqqqq. What is prob of sequence ll? 5/57 Calculate prob of sequence zvz when three letters picked without replacement from vzvirvmrzzrgm. 3/286 What is prob of sequence xwwx when four letters picked without replacement from {w: 10, c: 3, a: 1, x: 2}? 3/728 Three letters picked without replacement from vcvccccc. What is prob of sequence cvv? 1/28 What is prob of sequence jxjr when four letters picked without replacement from nxjwewrnwrjrxnx? 1/1820 Two letters picked without replacement from itcictkrtkdcdc. Give prob of sequence td. 3/91 Two letters picked without replacement from {t: 5, e: 1, c: 3, l: 5, s: 4}. Give prob of sequence lt. 25/306 Four letters picked without replacement from fkzkkzkz. Give prob of sequence zzzk. 1/70 Three letters picked without replacement from {h: 2, c: 6}. What is prob of sequence hcc? 5/28 Two letters picked without replacement from {f: 2, a: 1, q: 2}. What is prob of sequence fa? 1/10 What is prob of sequence jhh when three letters picked without replacement from hjh? 1/3 Three letters picked without replacement from {e: 1, f: 1, s: 2, a: 1, m: 1, z: 1}. What is prob of sequence zsa? 1/105 Three letters picked without replacement from kkkkcakckkkkkkaak. Give prob of sequence cka. 3/170 Calculate prob of sequence sox when three letters picked without replacement from {o: 9, s: 4, x: 6}. 12/323 What is prob of sequence bs when two letters picked without replacement from {j: 1, b: 1, s: 1}? 1/6 Two letters picked without replacement from {c: 2, l: 4, u: 1, q: 7}. Give prob of sequence lc. 4/91 What is prob of sequence gu when two letters picked without replacement from ugggggggguu? 12/55 What is prob of sequence ooo when three letters picked without replacement from ooaaoooo? 5/14 What is prob of sequence bi when two letters picked without replacement from {m: 2, j: 1, b: 1, w: 1, r: 1, i: 1}? 1/42 Four letters picked without replacement from eejpppepepeepe. Give prob of sequence eeee. 5/143 Two letters picked without replacement from {y: 4, r: 16}. What is prob of sequence rr? 12/19 Two letters picked without replacement from hvcsvhh. Give prob of sequence vh. 1/7 What is prob of sequence imo when three letters picked without replacement from ooommimoiuimummmmuom? 3/152 What is prob of sequence awy when three letters picked without replacement from ayw? 1/6 Three letters picked without replacement from {z: 2, q: 2, e: 1}. Give prob of sequence zez. 1/30 Calculate prob of sequence mm when two letters picked without replacement from {w: 2, m: 7, g: 2}. 21/55 Two letters picked without replacement from {t: 4, q: 1, d: 3}. What is prob of sequence qd? 3/56 Three letters picked without replacement from ntnf. Give prob of sequence tfn. 1/12 Three letters picked without replacement from vveheeehevehe. Give prob of sequence vee. 21/286 What is prob of sequence pp when two letters picked without replacement from xxxxxxxxxppxxpxxxxp? 2/57 Four letters picked without replacement from {v: 8, c: 3}. What is prob of sequence vvcc? 7/165 Calculate prob of sequence jwpq when four letters picked without replacement from fqfpwjqjfpffpjfufff. 1/5168 Calculate prob of sequence jbz when three letters picked without replacement from {j: 1, k: 1, b: 1, w: 1, z: 1}. 1/60 What is prob of sequence fss when three letters picked without replacement from {s: 15, f: 5}? 35/228 What is prob of sequence bddb when four letters picked without replacement from {d: 5, b: 3}? 1/14 What is prob of sequence pr when two letters picked without replacement from {r: 1, u: 2, p: 1, v: 3, j: 5, x: 3}? 1/210 What is prob of sequence klz when three letters picked without replacement from {z: 6, l: 1, r: 2, i: 2, o: 5, k: 1}? 1/680 Calculate prob of sequence hfif when four letters picked without replacement from {z: 2, e: 1, i: 1, h: 2, f: 2}. 1/420 What is prob of sequence boo when three letters picked without replacement from {b: 2, o: 4, x: 2}? 1/14 Two letters picked without replacement from vqlq. What is prob of sequence vq? 1/6 Two letters picked without replacement from {q: 1, g: 1, w: 1, r: 1, x: 1}. What is prob of sequence gw? 1/20 Calculate prob of sequence hmn when three letters picked without replacement from {h: 1, i: 4, c: 1, n: 8, m: 2}. 1/210 What is prob of sequence zuj when three letters picked without replacement from uzuqjruu? 1/84 Calculate prob of sequence gox when three letters picked without replacement from {x: 2, c: 1, o: 1, g: 2, d: 2, a: 1}. 1/126 Calculate prob of sequence qq when two letters picked without replacement from lbbqqlqlqqqqqlbblqlq. 9/38 What is prob of sequence kk when two letters picked without replacement from zkkzkzkzkkzzkzzzkzzk? 18/95 What is prob of sequence iie when three letters picked without replacement from {g: 2, y: 1, i: 4, v: 1, e: 1}? 1/42 Calculate prob of sequence ep when two letters picked without replacement from {f: 4, r: 1, l: 1, p: 1, e: 1}. 1/56 What is prob of sequence iii when three letters picked without replacement from {i: 5, o: 3}? 5/28 What is prob of sequence uvet when four letters picked without replacement from {a: 7, v: 1, t: 1, e: 3, k: 7, u: 1}? 1/38760 Four letters picked without replacement from {v: 3, s: 3}. What is prob of sequence vssv? 1/10 What is prob of sequence nss when three letters picked without replacement from dryynnrnrdsrgyrnndsd? 1/684 Two letters picked without replacement from lzlalrlllazn. What is prob of sequence az? 1/33 What is prob of sequence xlg when three letters picked without replacement from {x: 1, l: 3, g: 4}? 1/28 What is prob of sequence oiao when four letters picked without replacement from annaonaaannaannaoii? 1/2907 Three letters picked without replacement from {j: 5, t: 5, h: 1, f: 3, l: 5}. What is prob of sequence jtt? 50/2907 Three letters picked without replacement from zlzzzwlwwzwz. What is prob of sequence wzl? 2/55 What is prob of sequence dd when two letters picked without replacement from {d: 5, i: 5, v: 3}? 5/39 Calculate prob of sequence fy when two letters picked without replacement from {f: 3, l: 2, r: 2, s: 2, y: 4}. 1/13 What is prob of sequence jeg when three letters picked without replacement from {j: 1, o: 8, u: 1, g: 4, e: 6}? 1/285 Three letters picked without replacement from {t: 6, g: 1, b: 3, w: 1, u: 3}. What is prob of sequence wuu? 1/364 What is prob of sequence pppu when four letters picked without replacement from pppppppupupp? 4/33 Four letters picked without replacement from ooooooooo. What is prob of sequence oooo? 1 What is prob of sequence hs when two letters picked without replacement from {s: 1, h: 4, x: 6}? 2/55 Four letters picked without replacement from tttttqqq. What is prob of sequence ttqt? 3/28 Two letters picked without replacement from {w: 2, o: 3, c: 1, p: 6, t: 1}. What is prob of sequence ct? 1/156 What is prob of sequence jmm when three letters picked without replacement from yjyyyjjyyyjmyjjmyyy? 2/969
Let u be 6/(-2) + (13 - (-1 + -2)). Suppose 3t + u - 22 = 0. Solve t = -h + 4h for h. 1 Let w be ((260/(-15))/(-4))/((-1)/(-3)). Let l = w + -7. Solve lj - 3j = 15 for j. 5 Let x be (-5)/((-25)/30) + 4. Suppose -5g - x = -7g. Solve 0 = gl - 7 - 3 for l. 2 Let g = 14 - 13. Suppose i + 7d - 2d - 9 = 0, d - g = 0. Solve 2p - i = 6p for p. -1 Let c be (-2)/(-2 - 0) + 127. Suppose 4s - 2f = c, 0 = 5s + f - 62 - 84. Solve -5m + 5 = s for m. -5 Suppose -2d = -2a + 32, -3d - 4a + 2a - 73 = 0. Let n = -13 - d. Let i(g) = -3g2 - 15g + 112. Let m be i(-9). Solve -8 = -mc + n for c. 4 Let n = -5 + 7. Let b = 16 - 15. Let y be 3b(-6 - -7). Solve -nd = -d - y for d. 3 Let v be 600/140 + (-4)/14. Suppose 0 = -0w + 5w - 3n - 18, 0 = 3w + vn - 34. Solve -t = -wt for t. 0 Suppose 63 = 12k - 3k. Solve 35 = kt - 0t for t. 5 Suppose 0 = 137z - 105z. Solve -3l = -zl + 6 for l. -2 Let o = 135 + -291. Let f = o + 170. Solve -3b - f = -17 for b. 1 Let r(d) = d3 - 15d*2 - 41d + 143. Let o be r(17). Solve -20 = -11q + o for q. 4 Suppose 0 = -5x + 3i - 35, 2x + 2i + 2i - 12 = 0. Let b be x/21 + 2. Solve bt = 3t for t. 0 Let g be (0 - -1)(-610)/(-10). Solve 0 = -gz + 67z - 30 for z. 5 Let t(p) = 2p3 - 2p*2 - 16p + 44. Let y be t(5). Solve 6 = -ym + 166m for m. 3 Let l = 7 - 2. Suppose lu - 5w = -25, -4w + 4 + 16 = 0. Solve -y - 1 = -u for y. -1 Suppose -x - 3p = -12, 28p - 33p = -4x + 31. Solve 2u = 19 - x for u. 5 Let o(u) = u*2 + 17u + 86. Let n be o(-8). Solve 6r - n = 4 for r. 3 Let b(l) = 2. Let w(d) = d - 4. Let u(x) = 2b(x) - 2w(x). Let t be u(5). Solve -18 = -5p + t for p. 4 Let a be (0/(0 + -1))/(-2). Suppose 5o = -4 + 9, 2k = 5o + 3. Solve -2p + a - k = 0 for p. -2 Let n be (-3)/(4(-12)/(-160)). Let t(i) = i2 + 9i - 8. Let x be t(n). Solve -10 = xp - 0p for p. -5 Suppose 0 = -5y + 8 + 2. Let d be 11/(33/12) - (193 + -2). Let h = 188 + d. Solve yn + 11 - h = 0 for n. -5 Suppose -4w + 0w = -w. Solve w = -5v + 15 + 5 for v. 4 Suppose -3m - 4a + 8 = 0, -5m + 2m = 5a - 10. Suppose -14h + 6h + 32 = m. Solve -3d + 8 = -h for d. 4 Let r be (-4 + 35/10)/((-3)/54). Solve 0 = -4x + x + r for x. 3 Let u(v) = -v3 - v2 + 3v + 2. Let g(z) = z2 + 5z + 4. Let b be g(-3). Let o be u(b). Solve m + 2m + 6 = o for m. -2 Suppose 0u - 5 = b + u, 5u = 0. Let v(k) = k3 - 12k*2 + 11k + 10. Let q be v(11). Let t be b/q + (-17)/(-2). Solve t = -p + 5p for p. 2 Let a(t) = -2t*2 - 3t + 12. Let k(r) = -2r3 + 2r2 - 3. Let d be k(0). Let c be a(d). Solve -z = -0 - c for z. 3 Let v(q) = q3 - 10q2 - 16q - 23. Let r(m) = m*2 + 1. Let t(z) = -3r(z) - v(z). Let d be t(9). Solve -6 = 2l + d for l. -4 Suppose -7v + v = 9v. Solve v = 5o - o for o. 0 Let d be (12/5)/(-3) - (-16)/20. Suppose db = -b. Solve b = -5t + 4 - 14 for t. -2 Suppose h + 3v + 13 = 0, -h - 18 = 6v - 2v. Solve 2p - 2p = -hp for p. 0 Suppose -3u = 4m - 22, 0 - 1 = -m - 3u. Suppose -o + m - 2 = 0. Solve 3l = 2l + o for l. 5 Let t = 51 + -44. Let y be (1/(-3))/(t/(-84)). Solve -n - 9 + y = 0 for n. -5 Let o(v) = v3 - 3v*2 + v + 2. Let y be o(3). Suppose -yb + 20 + 0 = 0. Suppose 29q + 16 = 32 + 42. Solve -b - q = 2i for i. -3 Let n = -34 + 72. Suppose -35 = y - n. Solve -f - y = -2f for f. 3 Suppose 5t + 2o - 3o = 81, t = o + 17. Suppose -1 = -6y + 29. Suppose -yl - 11 = -21. Solve lj - t = 6j for j. -4 Suppose 0 = 11c - 13c - 2. Let k be 0/(-2 - (-1)/c). Let j be (-4)/6(-6)/2. Solve 3s - js = k for s. 0 Suppose -3a - m = -12, 5a = -4m + 5 + 8. Let h = -2 + 5. Let p be (-7 - -16)3(-6)/(-27). Solve -ax + p = -hx for x. 3 Let k be (4/(7 + -3))/(-1). Let s be (k + 10)2/6. Solve 8v - 5 = sv for v. 1 Let q(y) = -6y - 8. Let p be q(-4). Suppose -p = -x - 3x. Solve 2 = -xf - 10 for f. -3 Let a be 14/(-2) - (2 - (-63)/(-3)). Solve 0 = -at + 6t - 6 for t. -1 Let s = -20 - 10. Let h = 32 + s. Solve 0 = hd - d + 5 for d. -5 Let o be ((-35)/7 + 6)(-1 - 22). Let b = 29 + o. Solve d + 5 = bd for d. 1 Let q be 27 + 5 + 3 + -4. Solve 5k = -11 + q for k. 4 Let b(t) be the first derivative of t*2/2 + t + 4. Let z be b(4). Solve 3a - z = 1 for a. 2 Let q = -15006 + 15009. Let l = -10 + 20. Solve l = -qj - 5 for j. -5 Suppose -5a - u + 2 = -2a, -5u = a - 10. Suppose a = 4k - 5k - 22. Let z = 37 + k. Solve 4f + z = -f for f. -3 Suppose 8k - 60 = 2k. Solve n - k = -4n for n. 2 Suppose 0 = -r - 3w + 5, -4r = -5w - 3. Solve -rv = 2v for v. 0 Let v = -863 + 868. Solve -vk = -6k + 1 for k. 1 Suppose -5y = -j - 8 - 35, -35 = -3y - 4j. Solve -14w = 47 + y for w. -4 Suppose i + 2 + 9 = -m, -5m - 23 = -3i. Let q(r) = -r3 - 7r*2 - 2r - 9. Let n be q(m). Suppose g = 20 - n. Solve -5c - g = 5 for c. -4 Let i be 0 - 4 - (13 - 45). Solve i = m + 25 for m. 3 Let a be (-15)/(-10) + 117/6. Let y be (1 - 0)/((-3)/(-54)). Let c = a - y. Solve -cq + 25 = 2q for q. 5 Let v(y) = y2 - 18y + 12. Let j be v(18). Let g be j/(-15) + (-93)/15. Let i = 10 + g. Solve 3 + 0 = iw for w. 1 Let l(b) be the second derivative of b4/12 - 5b*3/2 - 7b*2/2 + 4b. Let c be l(16). Solve 4o + c = 1 for o. -2 Let a(t) be the third derivative of t5/60 - 7t*4/24 - 2t*3/3 - 29t*2. Let q be a(8). Solve -qi - 8 = 8 for i. -4 Suppose -9j = -6j + 4q + 410, 3q = 5j + 635. Suppose 0 = 5l + 5y + 70, -3l - 4y - 64 + 22 = 0. Let h be j/l - 2/7. Solve -h = 5n + 16 for n. -5 Suppose x + 4p + 0p = -46, -4x = 5p + 162. Let u = -36 - x. Solve -uf = -6f - 4 for f. -1 Let m(g) = -5g - 11. Let x be m(-7). Suppose -z - x = -5z. Let u = 10 - z. Solve s = -0s - u for s. -4 Let d = -524 + 528. Solve 0u + du = 8 for u. 2 Suppose -142 + 542 = 5w. Let i = w + -76. Solve 24 - i = -4g for g. -5 Let y(f) = f3 + 8f*2 - 11f + 25. Let n be y(-9). Solve -46 = 3c - n for c. -1 Let o be (60/16)/(20/(-192)-4). Solve 2l - o = 5l for l. -3 Suppose 489g = 488g + 21. Solve -8 + 50 = gp for p. 2 Let w be ((-1340)/(-15))/(2/60). Let m be w/(-25) - 16/20. Let h be 35/6 - 18/m. Solve -3v = -hv - 9 for v. -3 Let m = -20 + 20. Suppose 2t + 4 - 20 = m. Solve 4h + 8 = -t for h. -4 Let n(f) = -7f - 7f + f + 3f + 9 + f*2. Let r be n(6). Let h = -12 - r. Solve -4p = -hp for p. 0 Let x be 2/(-3)((-77)/14 + -5). Solve -3u + 5 = -x for u. 4 Suppose -45 = -4p + 27. Suppose 4f + k = -k, 5f - 2k - p = 0. Let t(z) = 2z*2 - 3. Let q be t(f). Solve 0 = -3h + qh - 8 for h. 4 Suppose 14l + 1 = 211. Solve 0 = -lm + 21 + 24 for m. 3 Suppose -2y + 312 = 4c, 139 - 947 = -5y - 3c. Solve -174 + y = 2f for f. -5 Let f = 322 + -318. Solve -fq = 16 - 8 for q. -2 Let y(d) = d + 1. Let k be y(3). Let b be (-29)/k(2 + -6). Suppose -4l - 21 = -4q + 23, 4q - b = -l. Solve 3o + 7 = -q for o. -5 Let j be -2(1 + -1 - 1). Let p = -240 - -242. Solve p + 8 = -jr for r. -5 Let y(d) = d*2 + 2d - 1. Let s be y(-3). Suppose 33k - 45 = 24k. Solve -kj = 17 - s for j. -3 Let h be ((-6)/3 + 29)1. Let l be 75/h - 4/(-18). Let n(m) = -m*3 + 3m*2 - m + 3. Let u be n(l). Solve z + uz = -3 for z. -3 Let t(m) = 4 + 9m + 2m*2 + 2m*2 - 3m*2 + 0m*2. Let l be t(-9). Suppose -lx + 36 = -0x. Solve b + x = -2b for b. -3 Let k be (-4)/(-6) + (-12)/18. Let q(j) be the first derivative of j4/4 - j2/2 + 3j + 39. Let w be q(k). Solve w = -2d + d for d. -3 Let f be 0 - (-2)/(-2) - -6. Let b(h) = 6h - 15. Let x be b(7). Let c = -21 + x. Solve -ct = -t + f for t. -1 Suppose 4w - 20 = -w - 5h, 0 = w - h. Suppose 0 = 5v + r - 32, -wv - r + 20 = v. Solve -2 + v = -t for t. -4 Let z(s) = -s*2 + s + 1. Let w(c) = 4c*2 - 3c - 4. Let u(j) = w(j) + 2z(j). Let x be u(2). Let k be 105/20x. Solve -i - i = -k for i. 5 Suppose b + 3b = -4u + 8, 5b - 4u - 46 = 0. Solve a = 3 - b for a. -3 Let j(t) = 25t + 550. Let g be j(-22). Solve 2y + 7 - 3 = g for y. -2 Let f(p) = 21p*2 - 2p. Let w be f(-1). Let y = -16 + w. Solve t = -4 + y for t. 3 Let v(z) = z*2 - 5z + 6. Let n be v(3). Suppose -3k - p = 4p - 34, k - 5p + 2 = n. Solve k = -3l - l for l. -2 Let o = -201 - -206. Solve o + 15 = -5z for z. -4 Let c be 51 + (0 + 108)/(-9). Solve 41i - ci = 0 for i. 0 Suppose 13y = 4 + 373. Suppose 7q - y + 15 = 0. Solve -qa = -5 + 3 for a. 1 Suppose -8 = 7r - 8r. Suppose 0 = -10j + rj + 6. Suppose n - jq = -1, 0n - 25 = -3n - 5q. Solve 0 + n = -d for d. -5
Simplify (((sqrt(76)5)/sqrt(2))/(-6(sqrt(18) - sqrt(2))))*21. 475/144 Simplify 1(sqrt(242) - -1sqrt(242))*25 - ((sqrt(20)/(sqrt(10)2))26 + 0). 4837 Simplify -4 + (32sqrt(85)1)/(-6sqrt(20)/sqrt(4) - -3sqrt(5)-1). -4 - 2sqrt(17)/3 Simplify (-2sqrt(121)/sqrt(176)4 - ((sqrt(396) + 1)-3 + 3(sqrt(396) + -1)))2. -24sqrt(11) + 80 Simplify -2 + (6(sqrt(228) + sqrt(228)2 + sqrt(228) - sqrt(228))/sqrt(12) - (sqrt(133)/(51sqrt(7)))*2). -69/25 + 18sqrt(19) Simplify sqrt(68)-2 + 3 + -5 - (-6(2 + sqrt(68) - sqrt(68)) + -3)*2. -227 - 4sqrt(17) Simplify ((sqrt(100)/sqrt(4))/sqrt(5))*2 + sqrt(20) + 5 + (2sqrt(40))/sqrt(8) + 4sqrt(15)/sqrt(3). 10 + 8sqrt(5) Simplify -1((sqrt(125) - (0 + sqrt(125) + sqrt(125))2) + sqrt(125) + 2 + sqrt(125))1. -15sqrt(5) + 498 Simplify (3(2 + (4 + sqrt(700) + -1 + sqrt(700))4)-3)*2. 181440sqrt(7) + 3644676 Simplify (sqrt(243)-55)/(sqrt(72)/(((sqrt(32) + sqrt(8) - sqrt(8)) + sqrt(8))6)). -1350sqrt(3) Simplify (-5-1sqrt(76) + (sqrt(76) - sqrt(76)1)-1)/(2-2sqrt(64)). -5sqrt(19)/16 Simplify (-3(1 + sqrt(500))*2 - ((-3sqrt(500)1)2 + sqrt(500))) + -3 + (sqrt(500) + -3)2 + -2. -5499 - 130sqrt(5) Simplify -2 + ((sqrt(17) + 5sqrt(153) + sqrt(17))2 - (sqrt(2057) + -2)2) + -4. 44sqrt(17) + 2846 Simplify (-5(sqrt(700) + sqrt(700) + -1 + sqrt(700) + 0 + sqrt(700) + sqrt(700) + 0 + 3 + 1)-6)*2. 270000sqrt(7) + 15758100 Simplify ((sqrt(175) - sqrt(7))-5 - (-4sqrt(63))*2 - (-4 + (-1sqrt(7))*2 + 5)) + -3. -1019 - 20sqrt(7) Simplify sqrt(18)/(-1sqrt(81)/sqrt(9)) - (1 + sqrt(200) + 4sqrt(200) + sqrt(200)). -61sqrt(2) - 1 Simplify (sqrt(104)/sqrt(2) - (sqrt(13) + 5 + 0))2-3. -114 + 30sqrt(13) Simplify (-3(2sqrt(1539)-1 - sqrt(1539) - sqrt(1539)))2 - ((2 + sqrt(1539) + sqrt(1539))2 + -2 + 2). -72sqrt(19) + 215456 Simplify (sqrt(198)/(sqrt(726) - 2sqrt(726)))/(sqrt(275) - (sqrt(275) - ((sqrt(275) - (1sqrt(275) + sqrt(275))-6) + sqrt(275)))). -sqrt(3)/770 Simplify 2((sqrt(13)4)*25 + 4sqrt(117)). 24sqrt(13) + 2080 Simplify -3(((-1sqrt(60))/sqrt(12) + -4)*2 - (sqrt(50)/(sqrt(20)/sqrt(4)))/sqrt(2)). -63 - 21sqrt(5) Simplify (-3(-3(1 + sqrt(80)) + sqrt(80)) + 3(sqrt(80) + 3) + 5)2. 1656sqrt(5) + 7009 Simplify ((sqrt(900) + sqrt(900) + sqrt(900) + 6(2sqrt(900) + sqrt(900)) - sqrt(900))/(6sqrt(720)-2))*2. 125/36 Simplify (-5 + (sqrt(144)6)/(2sqrt(300)))2. -12sqrt(3) + 733/25 Simplify 5-1((sqrt(45) + sqrt(45)-3)-5 - sqrt(45))*2. -18225 Simplify (((sqrt(343) - -2sqrt(343)) + 0 + sqrt(343))2 - sqrt(343) - ((sqrt(7) + (sqrt(189)/sqrt(3) - sqrt(7)))2 + -1)) + 1. -7sqrt(7) + 5427 Simplify (-6(sqrt(91) + sqrt(91)-3) - sqrt(91))/(sqrt(7) + (sqrt(84) + (sqrt(84) - (sqrt(84) + sqrt(84)-2 + sqrt(84) - sqrt(84))) + sqrt(84))/sqrt(12)). 11sqrt(13)/5 Simplify (6sqrt(51)/(sqrt(24)/sqrt(8)) - (-2 + (sqrt(136)-5)/sqrt(8)))-5. -55sqrt(17) - 10 Simplify ((1sqrt(136)-2)/sqrt(4))/(sqrt(72)-2 + -2sqrt(2)1). sqrt(17)/7 Simplify ((sqrt(132) + -1sqrt(132) - sqrt(132))3)/((-2sqrt(108))/sqrt(9)) + (2sqrt(132)-4)/(sqrt(108)/(sqrt(9) - (sqrt(9) - -1sqrt(9)))). 19sqrt(11)/2 Simplify (2sqrt(91)1)/(4sqrt(7)-1 - sqrt(7)) + (sqrt(1872) - (sqrt(1872) - sqrt(1872)1-1)2) + 5. -7483 + 58sqrt(13)/5 Simplify 4(sqrt(7) + (sqrt(21)/sqrt(3) + sqrt(7))-6 + (-1 + sqrt(28))*2) + 2. -60sqrt(7) + 118 Simplify -3 + 1(sqrt(192)2 - sqrt(9)/(sqrt(15)/sqrt(5))). -3 + 15sqrt(3) Simplify (3((sqrt(68) - 4sqrt(68))6 - sqrt(68) - sqrt(68))/(sqrt(20)/(sqrt(500) - sqrt(5) - sqrt(5))))*2. 3916800 Simplify (sqrt(12)/(-2sqrt(726)) + -1)*2 - sqrt(12)/(sqrt(30)/(1sqrt(5)))-1. 243/242 + 12sqrt(2)/11 Simplify 5 + (-2sqrt(242))2 - ((sqrt(12)/sqrt(24))2 - (sqrt(242) - 1sqrt(242))). 1945/2 Simplify 2 + (-2 + -6sqrt(1088)-2)*2-5. -783378 + 1920sqrt(17) Simplify (sqrt(20)-11 - (sqrt(240) + 1sqrt(240) + sqrt(240))/sqrt(12))/(sqrt(70)/((sqrt(392)/sqrt(7))/sqrt(8))). -4sqrt(2) Simplify -1 + (-3 + sqrt(612))2-4 + (3 + (sqrt(85)/sqrt(5))*2 - (-2(sqrt(17) + 2))*2). -2549 + 128sqrt(17) Simplify (((-2sqrt(80))/sqrt(4)5)/(sqrt(10) - (sqrt(10) - (sqrt(80)/sqrt(2))/sqrt(4)) - sqrt(640)-2))2. 200/289 Simplify (sqrt(936)4)/(4sqrt(200) - sqrt(200)). 4sqrt(13)/5 Simplify -1((sqrt(275) + 0 + -5)-2)*2 + -1. -1201 + 200sqrt(11) Simplify -5 + -1 + -1sqrt(75) + 0. -5sqrt(3) - 6 Simplify (sqrt(3300) - (sqrt(3300) - sqrt(3300)3)6)/((sqrt(270)/(sqrt(810) + sqrt(10)))/sqrt(9)). 1300sqrt(11) Simplify ((5 + sqrt(51)/sqrt(3))2 - ((-2 + sqrt(17))2 + -4)) + -2. 23 + 14sqrt(17) Simplify ((-2 + sqrt(2156) + -2)5)2. -2800sqrt(11) + 54300 Simplify 3(sqrt(192)2 + -2 - -4(sqrt(192) + 1)). 6 + 144sqrt(3) Simplify (-41sqrt(19) - sqrt(171)/(sqrt(9)-3)) + 1. -11sqrt(19)/3 + 1 Simplify -4 + (sqrt(48) + -3 - -2sqrt(27))4 + -5. -21 + 40sqrt(3) Simplify ((sqrt(6000) + sqrt(6000)-2)-1)/(sqrt(768)-21). -5sqrt(5)/8 Simplify -1((sqrt(13) - 4sqrt(13))-5 + (sqrt(13) - (3 + sqrt(13) + sqrt(13)))-6)6. -126sqrt(13) - 108 Simplify (sqrt(133)/sqrt(28) + 4sqrt(304) + sqrt(1216)-1 + 0)*2. 5491/4 Simplify -6(sqrt(34)/sqrt(2)-3 + (sqrt(153)/sqrt(3))/sqrt(3))-5. -60sqrt(17) Simplify 5(-4(sqrt(7) + (sqrt(7) - (2 + sqrt(175))2)) - (-2sqrt(28) - (sqrt(567) + 1))). 425sqrt(7) + 3585 Simplify 5 + -45(-1 + sqrt(45) + 0 + sqrt(45) + 1). -120sqrt(5) + 5 Simplify (sqrt(15)-1-2)/sqrt(5) + 5sqrt(18)/sqrt(6) + -3. -3 + 7sqrt(3) Simplify 3 + ((sqrt(132)13 + 5(sqrt(132) - sqrt(132)-2))/(41sqrt(12)-4))2. 1083/64 Simplify sqrt(200) + 2 + 1 - (sqrt(12)/sqrt(6) + 1)4. -1 + 6sqrt(2) Simplify 6(1 + ((sqrt(224)/sqrt(7)3)2 - sqrt(32))). -24sqrt(2) + 1734 Simplify (-1(sqrt(1053) + sqrt(1053)5) + 6(-2 + sqrt(1053)))2. -24 Simplify 5((sqrt(245) - -5(sqrt(245) + 3) - -2(sqrt(245) + sqrt(245)1 + sqrt(245) - sqrt(245))) + 5)*2. 14000sqrt(5) + 124500 Simplify 5(-3sqrt(468) - sqrt(13) - ((-3 + sqrt(1573))*2 + sqrt(1573) - sqrt(1573))) + 2. -7908 + 235sqrt(13) Simplify -1sqrt(17)1 + 4 - (-5 + sqrt(187)/(sqrt(77)/sqrt(7)))*2. -38 + 9sqrt(17) Simplify (2 + sqrt(320))*25 + sqrt(320) - (((sqrt(320) - -2sqrt(320)) + sqrt(320))2 + 0 + sqrt(320)). -3500 + 160sqrt(5) Simplify ((sqrt(567)/sqrt(9) - sqrt(7)) + sqrt(7) + (sqrt(84)/sqrt(108))*2 + (sqrt(567)3-5)2)1. 3sqrt(7) + 1148182/9 Simplify 5sqrt(363)1 - ((sqrt(33)/(sqrt(11) + (sqrt(11) - sqrt(44)/sqrt(4) - sqrt(11) - sqrt(11))))2 - (5 + sqrt(3) + sqrt(12)/sqrt(4))). 2 + 57sqrt(3) Simplify ((2sqrt(77)-4 - sqrt(77)) + sqrt(77) - sqrt(77) - -2sqrt(77)-1)/(sqrt(700) - -6(sqrt(700) - (sqrt(700) + sqrt(700)2))). sqrt(11)/10 Simplify (4(-2sqrt(288) + sqrt(288) + sqrt(288))*2 + sqrt(18)/(sqrt(9)-4)-1)-3. -3sqrt(2)/4 Simplify -3sqrt(18) - (sqrt(28)/sqrt(7))/sqrt(2) - ((sqrt(2) - (-2 + sqrt(2) + -2)) + (5sqrt(14)/sqrt(7))2). -54 - 10sqrt(2) Simplify ((-3 + 2sqrt(612) + sqrt(612) + sqrt(612))2)*2 + (-2sqrt(612)-5)2 + -2. -576sqrt(17) + 100402 Simplify (sqrt(180)/sqrt(9)-4 - sqrt(20))/(sqrt(12)/sqrt(75)). -25sqrt(5) Simplify (5 + sqrt(448) + -2)*2 + (sqrt(448) + (sqrt(448) + 0 - sqrt(448)))5. 88sqrt(7) + 457 Simplify (sqrt(140) + (sqrt(140) - 52sqrt(140)) + sqrt(140) - sqrt(140))/(sqrt(500) - (sqrt(500)22 + sqrt(500) + sqrt(500))). 8sqrt(7)/25 Simplify -4(sqrt(605)-1 + -2) - (-3 + ((-2 + sqrt(80))*2 - (sqrt(125) + 1))). -72 + 65sqrt(5) Simplify (sqrt(175) + (-2 + sqrt(175))*2 + sqrt(175) - sqrt(175))-1 + 4 + sqrt(175)255 + 1. -174 + 265sqrt(7) Simplify -1 + sqrt(8)/sqrt(4) + 4 + 3 + (((4sqrt(36) + sqrt(4) - sqrt(4)) + sqrt(4))/(sqrt(2) + sqrt(20)/(sqrt(10)1) - sqrt(2)))*2. sqrt(2) + 344 Simplify 5 + 0 + -2-1sqrt(180)-2. -24sqrt(5) + 5 Simplify (2sqrt(156)-4 + -51sqrt(156))/(sqrt(48)/(sqrt(4) + 1sqrt(4))-1). 26sqrt(13) Simplify 5 + (-4(sqrt(112)/sqrt(4))2 + -5)-2. 239 Simplify (-1(4 + sqrt(637)-1 + -4 + -4(sqrt(637) - 5(0 + sqrt(637)) - sqrt(637))))*2. 229957 Simplify 6-5(sqrt(72) + (sqrt(72)4 - sqrt(72)))*22. -69120 Simplify -35(((sqrt(343) - (sqrt(343) - 43sqrt(343))*2) + sqrt(343))4 + 4). -840sqrt(7) + 2490120 Simplify sqrt(2) + (sqrt(2) - sqrt(18)/sqrt(36))2 + sqrt(162)-1 + 3(3 + 0 + sqrt(2))2. 10sqrt(2) + 67/2 Simplify 3 + (0 + sqrt(300))*2 - (5 + -1sqrt(300))*2. -22 + 100sqrt(3) Simplify 5(-4 + (sqrt(1331) + -5 + (sqrt(1331) + 1 - sqrt(1331)) - ((1 + sqrt(1331) - sqrt(1331) - sqrt(1331)) + -1 + sqrt(1331)))2). -440sqrt(11) + 6715
What is the u'th term of 12, 25, 24, 3, -44? -u3 - u2 + 23u - 9 What is the z'th term of -46, -81, -102, -103, -78? z3 + z2 - 45z - 3 What is the a'th term of 31, 98, 217, 394, 635, 946, 1333, 1802? a*3 + 20a*2 + 10 What is the i'th term of 907, 908, 909, 910, 911? i + 906 What is the x'th term of 41, 185, 531, 1181, 2237, 3801, 5975? 17x3 - x2 + 28x - 3 What is the d'th term of -20, -12, 8, 46, 108, 200? d3 + d - 22 What is the y'th term of 226, 471, 742, 1051, 1410, 1831, 2326, 2907? 2y3 + y2 + 228y - 5 What is the a'th term of -1507, -1519, -1533, -1549, -1567, -1587? -a2 - 9a - 1497 What is the w'th term of 37442, 37444, 37456, 37484, 37534, 37612? w3 - w2 - 2w + 37444 What is the j'th term of 118, 115, 112, 109? -3j + 121 What is the z'th term of 86, 181, 286, 401? 5z2 + 80z + 1 What is the v'th term of 174, 209, 278, 399, 590, 869, 1254, 1763? 3v3 - v2 + 17v + 155 What is the a'th term of -13, -55, -177, -421, -829, -1443? -7a3 + 2a*2 + a - 9 What is the s'th term of 60, 212, 466, 822, 1280, 1840, 2502? 51s2 - s + 10 What is the r'th term of 18, 29, 38, 45, 50? -r2 + 14r + 5 What is the q'th term of 38, 71, 94, 101, 86, 43, -34, -151? -q3 + q2 + 37q + 1 What is the c'th term of 294, 304, 320, 342, 370? 3c2 + c + 290 What is the x'th term of 13, -28, -97, -194, -319, -472? -14x*2 + x + 26 What is the y'th term of 6, -81, -312, -759, -1494, -2589? -12y*3 - 3y + 21 What is the c'th term of -29, -32, -61, -128, -245, -424? -2c3 - c2 + 14c - 40 What is the x'th term of 44, 81, 136, 203, 276, 349, 416? -x*3 + 15x*2 - x + 31 What is the s'th term of -159, -314, -447, -546, -599, -594, -519? 2s3 - s2 - 166s + 6 What is the r'th term of -14, -69, -172, -347, -618, -1009? -4r*3 - 27r + 17 What is the n'th term of -320, -323, -328, -335, -344, -355? -n2 - 319 What is the y'th term of -697, -708, -733, -778, -849? -y3 - y*2 - y - 694 What is the q'th term of 2, -7, -22, -43, -70? -3q*2 + 5 What is the g'th term of 148, 568, 1264, 2236? 138g*2 + 6g + 4 What is the a'th term of -24, -17, -10, -3, 4? 7a - 31 What is the o'th term of -89, -266, -533, -890, -1337? -45o*2 - 42o - 2 What is the l'th term of -11, -18, -37, -74, -135, -226, -353? -l*3 - 10 What is the a'th term of -2485, -4969, -7453, -9937, -12421, -14905? -2484a - 1 What is the q'th term of -34, 15, 64, 113? 49q - 83 What is the w'th term of -37, -141, -305, -523, -789, -1097, -1441, -1815? w3 - 36w*2 - 3w + 1 What is the k'th term of 8, 12, 26, 56, 108, 188, 302, 456? k3 - k2 + 8 What is the m'th term of 39, 316, 1065, 2520, 4915, 8484, 13461? 39m3 + 2m*2 - 2m What is the j'th term of 75, 72, 69, 66? -3j + 78 What is the g'th term of -29, -33, -37, -41, -45, -49? -4g - 25 What is the k'th term of 133, 177, 243, 343, 489, 693, 967, 1323? 2k3 - k2 + 33k + 99 What is the f'th term of -85, -82, -83, -94, -121, -170, -247, -358? -f*3 + 4f*2 - 2f - 86 What is the h'th term of -29, -68, -139, -248, -401, -604, -863, -1184? -h*3 - 10h*2 - 2h - 16 What is the l'th term of 983, 982, 981, 980? -l + 984 What is the p'th term of 110, 306, 632, 1088, 1674, 2390, 3236? 65p2 + p + 44 What is the g'th term of 49, 209, 467, 817, 1253? -g3 + 55g*2 + 2g - 7 What is the n'th term of 29, 63, 107, 161, 225, 299, 383? 5n2 + 19n + 5 What is the l'th term of -136, -142, -158, -190, -244, -326, -442? -l3 + l2 - 2l - 134 What is the g'th term of 1402, 1888, 2388, 2908, 3454? g3 + g2 + 476g + 924 What is the m'th term of -42, -87, -132? -45m + 3 What is the u'th term of 242, 250, 272, 314, 382, 482? u3 + u2 - 2u + 242 What is the g'th term of -379, -1513, -3401, -6043, -9439, -13589? -377g2 - 3g + 1 What is the t'th term of -1348, -2683, -4016, -5347? t*2 - 1338t - 11 What is the n'th term of -34194, -34193, -34192, -34191? n - 34195 What is the z'th term of -799, -1595, -2387, -3175, -3959, -4739? 2z2 - 802z + 1 What is the n'th term of 2125, 2126, 2127? n + 2124 What is the p'th term of 146, 174, 220, 284, 366, 466, 584? 9p2 + p + 136 What is the h'th term of -14, -24, -40, -62, -90, -124? -3h*2 - h - 10 What is the w'th term of -2339, -4679, -7019? -2340w + 1 What is the d'th term of 75, 80, 85? 5d + 70 What is the t'th term of -61, -40, -19, 2? 21t - 82 What is the u'th term of -1909, -1908, -1907, -1906? u - 1910 What is the x'th term of 1, -6, -25, -62, -123, -214, -341? -x*3 + 2 What is the k'th term of -139, -302, -489, -700? -12k*2 - 127k What is the o'th term of -19, -32, -59, -106, -179? -o3 - o2 - 3o - 14 What is the y'th term of 1194, 1193, 1192, 1191, 1190, 1189? -y + 1195 What is the y'th term of -5776, -5773, -5768, -5761? y2 - 5777 What is the o'th term of -241, -475, -699, -907, -1093, -1251, -1375? o3 - o2 - 238o - 3 What is the j'th term of -1361, -5446, -12253, -21782, -34033, -49006? -1361j2 - 2j + 2 What is the i'th term of 12, 17, 8, -21, -76? -i3 - i2 + 15i - 1 What is the c'th term of 91, 231, 371, 511, 651, 791? 140c - 49 What is the b'th term of 141, 275, 409, 543, 677? 134b + 7 What is the v'th term of 63, 44, -1, -84, -217, -412, -681, -1036? -2v3 - v2 - 2v + 68 What is the p'th term of 573, 1125, 1675, 2223, 2769? -p2 + 555p + 19 What is the h'th term of -574, -590, -616, -658, -722, -814, -940, -1106? -h3 + h2 - 12h - 562 What is the q'th term of 74, 136, 192, 242, 286? -3q*2 + 71q + 6 What is the s'th term of 715, 1427, 2139, 2851, 3563, 4275? 712s + 3 What is the j'th term of -4, -19, -60, -139, -268? -2j3 - j2 + 2j - 3 What is the b'th term of -12, -11, 10, 69, 184? 3b*3 - 8b*2 + 4b - 11 What is the k'th term of -232, -233, -234? -k - 231 What is the s'th term of 42, 56, 76, 102, 134, 172, 216? 3s2 + 5s + 34 What is the w'th term of -95, -288, -481, -674, -867? -193w + 98 What is the g'th term of -32, -30, -26, -20, -12, -2? g2 - g - 32 What is the v'th term of -230, -229, -228, -227, -226? v - 231 What is the z'th term of -29, -35, -41, -47? -6z - 23 What is the u'th term of 18, 29, 34, 33, 26? -3u2 + 20u + 1 What is the b'th term of 48, 78, 108, 138, 168? 30b + 18 What is the d'th term of -83, -78, -65, -38, 9, 82, 187? d3 - 2d*2 + 4d - 86 What is the t'th term of 409, 416, 425, 436, 449, 464, 481? t*2 + 4t + 404 What is the c'th term of 847, 1691, 2535, 3379, 4223? 844c + 3 What is the s'th term of 23, 36, 57, 86? 4s*2 + s + 18 What is the y'th term of 2618, 5232, 7846, 10460, 13074? 2614y + 4 What is the b'th term of 49, 82, 127, 184, 253, 334, 427? 6b2 + 15b + 28 What is the w'th term of 57, 88, 121, 156, 193? w*2 + 28w + 28 What is the i'th term of -19, -25, -49, -103, -199, -349, -565? -2i3 + 3i*2 - i - 19 What is the x'th term of 117, 110, 99, 84, 65, 42, 15? -2x*2 - x + 120 What is the g'th term of 134, 132, 130, 128, 126? -2g + 136 What is the l'th term of -68, -113, -148, -167, -164, -133, -68, 37? l3 - l2 - 49l - 19 What is the i'th term of -73, -307, -697, -1243? -78i2 + 5 What is the t'th term of 390, 386, 380, 372, 362? -t2 - t + 392 What is the s'th term of -389, -812, -1243, -1688, -2153, -2644, -3167, -3728? -s*3 + 2s*2 - 422s + 32 What is the a'th term of 31, 62, 89, 112, 131, 146? -2a2 + 37a - 4 What is the y'th term of -52, -117, -184, -253, -324, -397? -y*2 - 62y + 11 What is the v'th term of 1424, 2834, 4244, 5654, 7064? 1410v + 14 What is the g'th term of -9, 72, 201, 372, 579, 816? -g3 + 30g*2 - 2g - 36 What is the n'th term of -146, -280, -414, -548, -682? -134n - 12 What is the h'th term of -166, -210, -256, -304? -h2 - 41h - 124 What is the r'th term of -14, -23, -24, -17, -2? 4r2 - 21r + 3 What is the m'th term of 19, 16, 13, 10, 7, 4? -3m + 22 What is the g'th term of 378, 750, 1110, 1452, 1770, 2058, 2310? -g3 + 379g What is the o'th term of -182, -320, -544, -848, -1226, -1672, -2180? o*3 - 49o*2 + 2o - 136 What is the i'th term of -1556, -6224, -13998, -24872, -38840? i*3 - 1559i*2 + 2i What is the o'th term of -31, -32, -33, -34, -35? -o - 30 What is the x'th term of 27, 8, -23, -72, -145, -248, -387? -x*3 - 12x + 40 What is the f'th term of 9988, 19979, 29972, 39967, 49964, 59963? f*2 + 9988f - 1 What is the l'th term of 4015, 4013, 4009, 4003, 3995? -l*2 + l + 4015 What is the m'th term of -30, -47, -64? -17m - 13 What is the j'th term of -3046, -3054, -3072, -3106, -3162, -3246? -j3 + j2 - 4*j - 3042
Two letters picked without replacement from zxzzzxjxjxx. Give prob of picking 2 j. 1/55 Two letters picked without replacement from wdlwllxxtwwz. Give prob of picking 1 t and 1 w. 2/33 What is prob of picking 2 c and 2 w when four letters picked without replacement from {w: 9, c: 10}? 135/323 Two letters picked without replacement from xexrxxsxxrnsserrx. What is prob of picking 1 s and 1 n? 3/136 Calculate prob of picking 1 a, 1 l, and 1 f when three letters picked without replacement from ffaaddfdlafaafdddadf. 3/95 Two letters picked without replacement from {f: 4, k: 3}. Give prob of picking 2 f. 2/7 Three letters picked without replacement from lttltllttccc. Give prob of picking 3 t. 1/22 Three letters picked without replacement from dhvivwide. What is prob of picking 1 d and 2 w? 0 What is prob of picking 2 s when two letters picked without replacement from ttssstas? 3/14 What is prob of picking 1 q and 2 p when three letters picked without replacement from pppppqpqpdqqpp? 36/91 Calculate prob of picking 1 c and 1 i when two letters picked without replacement from ickkikickck. 9/55 Two letters picked without replacement from qqzzzzzz. Give prob of picking 2 z. 15/28 Calculate prob of picking 2 j when two letters picked without replacement from {n: 1, u: 1, j: 2, y: 10, l: 2}. 1/120 Three letters picked without replacement from hyyaytyyayatyyhyt. Give prob of picking 2 a and 1 t. 9/680 Two letters picked without replacement from {s: 3, c: 4}. Give prob of picking 2 s. 1/7 Two letters picked without replacement from kmmggmgkg. What is prob of picking 1 m and 1 g? 1/3 Three letters picked without replacement from {b: 3, w: 2}. Give prob of picking 3 b. 1/10 Three letters picked without replacement from awwwwdwaawwdd. What is prob of picking 3 w? 35/286 Four letters picked without replacement from txeggtllgtxle. What is prob of picking 2 t, 1 e, and 1 l? 18/715 Two letters picked without replacement from mgmf. Give prob of picking 1 g and 1 f. 1/6 What is prob of picking 1 p and 2 c when three letters picked without replacement from ccqpccpcppqcqcqc? 1/5 What is prob of picking 2 g and 1 n when three letters picked without replacement from {n: 6, g: 4}? 3/10 What is prob of picking 1 i, 1 w, and 1 b when three letters picked without replacement from nnnwninnwnnwniwnbin? 4/323 Three letters picked without replacement from rrr. Give prob of picking 3 r. 1 Calculate prob of picking 2 o when two letters picked without replacement from {o: 7, j: 2, b: 11}. 21/190 Two letters picked without replacement from juujuuu. Give prob of picking 1 u and 1 j. 10/21 Two letters picked without replacement from {x: 5, t: 1, w: 7}. What is prob of picking 1 t and 1 w? 7/78 Calculate prob of picking 2 w when two letters picked without replacement from {w: 11, t: 1}. 5/6 Four letters picked without replacement from fffpgpgegwm. What is prob of picking 1 g, 1 e, 1 m, and 1 w? 1/110 What is prob of picking 1 t and 1 n when two letters picked without replacement from {n: 2, t: 4}? 8/15 Four letters picked without replacement from ihgiqeg. What is prob of picking 1 i, 1 g, 1 q, and 1 e? 4/35 Four letters picked without replacement from diyisrraidd. Give prob of picking 1 s, 2 i, and 1 r. 1/55 Three letters picked without replacement from essekmhkhmkemsek. Give prob of picking 1 h and 2 k. 3/140 Two letters picked without replacement from cenrcoou. What is prob of picking 1 r and 1 u? 1/28 Calculate prob of picking 2 x when two letters picked without replacement from xvvvvvxv. 1/28 Two letters picked without replacement from rqqqqrprqqqqrqy. What is prob of picking 2 r? 2/35 Calculate prob of picking 1 z and 1 c when two letters picked without replacement from cydcsccyczcdpcs. 1/15 Three letters picked without replacement from {o: 6, j: 3, n: 4, v: 6}. What is prob of picking 3 n? 4/969 Three letters picked without replacement from sbqqqssqqqsybqsss. What is prob of picking 1 s and 2 b? 7/680 Two letters picked without replacement from {w: 1, v: 3, h: 1, b: 2}. Give prob of picking 1 b and 1 w. 2/21 Three letters picked without replacement from {z: 5, v: 2, b: 2, t: 1, m: 10}. What is prob of picking 1 v, 1 t, and 1 z? 1/114 Calculate prob of picking 2 y when two letters picked without replacement from {h: 7, m: 1, f: 1, y: 6, j: 2}. 15/136 Calculate prob of picking 2 r when two letters picked without replacement from rmmrmmrqmmqqrmqr. 1/12 Calculate prob of picking 2 j and 2 p when four letters picked without replacement from {z: 5, p: 3, y: 1, j: 6}. 3/91 Two letters picked without replacement from vvuuuuuuvuuuuuu. Give prob of picking 1 u and 1 v. 12/35 Two letters picked without replacement from osvcs. What is prob of picking 1 v and 1 c? 1/10 Three letters picked without replacement from {b: 2, z: 6}. What is prob of picking 3 z? 5/14 Two letters picked without replacement from {h: 2, p: 3, q: 1, e: 4, k: 8, f: 2}. What is prob of picking 1 f and 1 e? 4/95 Three letters picked without replacement from {j: 7}. What is prob of picking 3 j? 1 Four letters picked without replacement from {z: 3, l: 3, u: 3, v: 4, n: 1, q: 1}. What is prob of picking 2 v, 1 l, and 1 q? 6/455 Two letters picked without replacement from {o: 4, k: 3, t: 1, j: 7, d: 4}. Give prob of picking 1 j and 1 k. 7/57 Four letters picked without replacement from {n: 3, h: 11, q: 1, y: 4}. Give prob of picking 1 h, 2 y, and 1 n. 33/646 Three letters picked without replacement from cccjccccccccccjcccjj. What is prob of picking 1 j and 2 c? 8/19 Calculate prob of picking 2 m and 2 j when four letters picked without replacement from {j: 3, m: 2}. 3/5 Calculate prob of picking 1 p, 1 t, and 1 q when three letters picked without replacement from {t: 1, z: 1, p: 1, q: 1, j: 1}. 1/10 Four letters picked without replacement from xrxxjjxrj. What is prob of picking 2 r and 2 j? 1/42 Three letters picked without replacement from idddiid. What is prob of picking 3 i? 1/35 What is prob of picking 4 h when four letters picked without replacement from {h: 3, g: 3}? 0 Two letters picked without replacement from mwgcmmwgwm. Give prob of picking 1 g and 1 m. 8/45 Two letters picked without replacement from kfqdbbkm. Give prob of picking 1 d and 1 m. 1/28 Calculate prob of picking 1 s and 1 z when two letters picked without replacement from sssrzsszr. 5/18 Four letters picked without replacement from {c: 2, q: 6, m: 1, r: 3, f: 7}. What is prob of picking 1 f and 3 r? 7/3876 Two letters picked without replacement from hhhjhhhh. Give prob of picking 1 h and 1 j. 1/4 Two letters picked without replacement from httht. What is prob of picking 1 t and 1 h? 3/5 Calculate prob of picking 1 m and 1 p when two letters picked without replacement from plppipmmppmmpmppp. 25/68 What is prob of picking 1 l, 1 p, and 1 t when three letters picked without replacement from plppllpzpzltppzppl? 15/272 Calculate prob of picking 2 e, 1 c, and 1 k when four letters picked without replacement from {e: 8, c: 1, k: 6, z: 1}. 6/65 Two letters picked without replacement from yppplppvlrlpylppvpp. Give prob of picking 1 l and 1 r. 4/171 Calculate prob of picking 2 d when two letters picked without replacement from nixdddxxooxdnxoxx. 3/68 Four letters picked without replacement from {d: 1, q: 2, e: 4}. Give prob of picking 4 d. 0 Calculate prob of picking 1 i and 3 v when four letters picked without replacement from {u: 2, f: 4, i: 1, l: 4, v: 3}. 1/1001 What is prob of picking 2 v when two letters picked without replacement from {j: 13, v: 6}? 5/57 Calculate prob of picking 3 z and 1 n when four letters picked without replacement from zznnnzn. 4/35 Two letters picked without replacement from {a: 1, w: 2}. Give prob of picking 1 w and 1 a. 2/3 Calculate prob of picking 2 j and 1 p when three letters picked without replacement from jjppjpjjjjppjpjjppjp. 33/76 What is prob of picking 1 x and 1 w when two letters picked without replacement from {x: 8, f: 2, c: 1, e: 6, w: 1}? 8/153 Two letters picked without replacement from {p: 4, a: 3, j: 1, n: 4, r: 2, h: 1}. What is prob of picking 1 r and 1 n? 8/105 Four letters picked without replacement from qlqhlqqqqqqlhqql. Give prob of picking 2 q and 2 h. 9/364 Two letters picked without replacement from kkmkkehveekm. What is prob of picking 2 k? 5/33 What is prob of picking 1 u and 1 z when two letters picked without replacement from {w: 5, z: 4, u: 3}? 2/11
Let t(k) = -3k2 - 9. Let z(i) = 1013521i. Calculate z(t(c)). -3040563c2 - 9121689 Let g(h) = -6h*2. Let k(w) = 56208436w. Calculate k(g(y)). -337250616y2 Let x(d) = 56d*2. Let a(y) = -114y*2 + 3211. What is a(x(k))? -357504k*4 + 3211 Let m(h) = -6h*2 + 28561 - 28561. Let a(n) = -2n*2. Determine m(a(u)). -24u*4 Let w(k) = -930k. Let f(j) = j - 323 - 324 + 972 - 325. Calculate w(f(g)). -930g Let l(t) = -744 - 754 + t + 2249 - 751. Let r(w) = -6490w. What is l(r(z))? -6490z Let n(y) = 30y - 4. Let p(c) = 7103c. Determine p(n(l)). 213090l - 28412 Let q(o) = -5o2. Let v(i) = 2i*2 + 10977709. Give v(q(s)). 50s4 + 10977709 Let k(a) = a2 - 12a. Let c(d) = 99248d*2. Give k(c(q)). 9850165504q*4 - 1190976q*2 Let p(i) = 3i - i + 3i - 4i. Let v(x) = 11x + 2. Let n(c) = 9c + 20. Let q be n(-2). Let t(m) = 11m + 3. Let o(k) = qt(k) - 3v(k). Determine p(o(h)). -11h Let w(n) = -10n + 3 + 70n - 76n - 3. Let d(x) = 89x*2. What is d(w(t))? 22784t*2 Let m(r) = -327r*2. Let g(p) = -4586p*2 - 1. Give g(m(d)). -490376394d*4 - 1 Let y(l) = -7l. Let j(p) = 3. Let b(a) = -2a + 22. Suppose -26 + 19 = -7o. Let c(i) = oj(i) - b(i). Give y(c(t)). -14t + 133 Let h(y) = 3y2 + 93y. Let q(j) = -141486j. What is h(q(l))? 60054864588l*2 - 13158198l Let f(x) = -4897646x. Let t(u) = 4u. Give f(t(l)). -19590584l Let j(y) = y3 - 29y*2 - 211y - 4. Let c be j(-6). Let h(q) be the second derivative of -10q + 0q*c + 0 + 4/3q3. Let i(w) = -w2. Calculate i(h(v)). -64v2 Let c(g) = -14g + 29. Let p(n) = 1280n - 424n - 424n - 424n. What is c(p(y))? -112y + 29 Let o(d) = 105d*2 + 27d + 27. Let b(g) = -8g2 - 2g - 2. Let f(m) = -27b(m) - 2o(m). Let i(n) = -35n - 2n - 11n + 40n - 27n. What is f(i(l))? 7350l*2 Let n(f) = 162457f. Let d(l) = 25l. Calculate n(d(t)). 4061425t Let n(v) = -201v2 - 3v + 2. Let x(m) = 21m - 2m + m - 5m - 13m. Determine n(x(q)). -804q2 - 6q + 2 Let g(n) = n + 2075. Let c(q) = -2025q. Determine g(c(i)). -2025i + 2075 Let j(b) = 308b + 965b + 287b - 159b - 119b. Let u(w) = w2. Give u(j(c)). 1643524c*2 Let x(v) be the first derivative of 3v*2 - 1. Let d(a) be the second derivative of 1/6a*3 - 1 - 5a + 0a2. Determine d(x(c)). 6c Let k(a) = 2a2. Let j(i) = i2 + 11i - 24. Let m be j(-13). Let r(v) = 10v2. Let g(x) = -270x*2. Let h(w) = mg(w) + 55r(w). What is h(k(n))? 40n*4 Let n(i) = -1015396238i. Let o(q) = q*2. Determine o(n(d)). 1031029520144552644d*2 Let w(b) = 3b + 15686. Let k(u) = -341. Let r(l) = -46k(l) - w(l). Suppose 0z - 5z = 0. Let v(x) = -x - x + zx. Determine v(r(c)). 6c Let q(i) = -1490i*2 + 160. Let l(y) = 298y*2 - 30. Let m(s) = -16l(s) - 3q(s). Let k(z) = z. Calculate k(m(b)). -298b*2 Let i(f) = 3f. Let n(u) = 2u - 8. Let z be n(23). Let o = z - -8. Let s(h) = -oh + h*2 + 21h*2 + 46h. What is i(s(g))? 66g2 Let x(j) = 11j*2 - 124j. Let h(a) = 8a2 - 93a. Let b(s) = 8h(s) - 6x(s). Let c(r) = -r. Let w(n) = 69n. Let f(v) = -2c(v) + w(v). What is f(b(k))? -142k2 Let b(f) = 71f + 9. Let s(x) = -472x - 60. Let t(r) = -20b(r) - 3s(r). Let a(y) = 2y + 145. Give a(t(i)). -8i + 145 Let g(k) = -k. Let n(b) = 0b*2 - 25b*2 - 19b*2. Let q(m) = 88m*2. Let l(h) = 7n(h) + 4q(h). Calculate g(l(i)). -44i*2 Let b(c) = 2c. Let m(l) = -1036612l - 3 + 1034447l + 3. Determine m(b(h)). -4330h Let t(d) = 2d*2 + d. Let l be (10/8)/((-19)/76). Let p(y) = -51y*2 - 3y. Let n(q) = lp(q) - 15t(q). Let v(j) = 3j2. Determine v(n(c)). 151875c*4 Let x(h) = -40h*2 - 25h*2 + 37h*2 + 17h*2. Let g(o) = 3o - 247. Determine g(x(j)). -33j2 - 247 Let g(t) = 2t2. Let i(l) be the third derivative of l8/20160 - l*7/280 + 3l*5 - 61l*2. Let x(k) be the third derivative of i(k). Calculate g(x(n)). 2n*4 - 72n*3 + 648n*2 Let d(p) be the first derivative of -904p*3 - 2193. Let u(i) = 3i. What is u(d(v))? -8136v2 Let z(v) = -v2 + 6v - 10. Let b(c) = -c*2 + 7c - 9. Let x(n) = -6b(n) + 7z(n). Let j(s) = 703s + 708s - 1410s. Calculate j(x(d)). -d2 - 16 Suppose 82720i = 82732i. Let y(l) be the third derivative of 0l*3 + 7/24l*4 + 0l + i - 32l2. Let h(d) = 4d. Give y(h(w)). 28w Let c(a) = -513a + 15a2 - 510a + 1024a. Let s(x) = -54x*2 - 52x*2 - 49x*2 + 161x*2. Determine s(c(q)). 1350q*4 + 180q*3 + 6q*2 Let f(x) = -6x*2 - 2x - 15. Let g(h) = -23143h. Determine g(f(p)). 138858p*2 + 46286p + 347145 Let s(f) be the third derivative of 17 + 4f2 + 0f + 1/6f3 + 43/12f*4. Let i(x) = -2x. Determine i(s(p)). -172p - 2 Let j(t) = 2t*2 + 6t + 31. Let h(n) = 2n2 + 7n + 32. Let i(g) = 6h(g) - 7j(g). Let q(d) = 10d. Calculate q(i(s)). -20s*2 - 250 Let q(a) = 34a*2 + 64. Let w(y) = 3y + 67. Determine w(q(z)). 102z2 + 259 Let r(u) be the second derivative of u3/6 - 3u + 87. Let i(j) = -1890j2. What is r(i(g))? -1890g*2 Let a(m) = -12m. Let x(r) be the second derivative of -120r + 17/6r*3 + 0r*2 + 0. Give x(a(g)). -204g Let b(u) = 1 + 12u + 25u - 2. Let p(x) = -132x2 - 207x*2 + 338x*2. Determine p(b(v)). -1369v*2 + 74v - 1 Let y(h) = 2 + 4h - 2. Let q(w) = 6822 - 1710 - 1709 - 1696 + 12w*2 - 1709. Give y(q(o)). 48o*2 - 8 Let q(m) = m. Let j(v) = 9v*2 + 164. Let g(d) = 26d*2 + 492. Let c(x) = 6g(x) - 17j(x). What is c(q(l))? 3l*2 + 164 Let v(u) = -10u. Let l(p) be the third derivative of -281p5/60 + p4/24 - 6382p*2. Give l(v(y)). -28100y*2 - 10y Let q(h) = 2h. Let c(a) be the third derivative of -11a7/840 - a6/720 - 55a4/24 + 36a*2. Let w(n) be the second derivative of c(n). Give q(w(g)). -66g*2 - 2g Let s(x) = -x*2. Let i(t) = 207354576t. Determine i(s(r)). -207354576r2 Let q(n) = -4n. Suppose -4r + 12 = -12. Suppose -rh + 2 = -10. Let v(w) = -4w2 - hw2 - w2 + 4w2. What is v(q(b))? -48b*2 Let f(r) = -53r - 2. Let c(x) = -42566x. Give f(c(l)). 2255998l - 2 Let m(v) = -12v. Let a(q) = 2q*3 - 11q*2 + 4q + 8. Let d be a(5). Let c(r) be the first derivative of 12 + 2/3rd + 0r + 0r2. Calculate m(c(n)). -24n*2 Let o(v) = 3v*2. Suppose -3x - b = 2x + 11, 0 = 3x + 2b + 1. Let d be 1 + 1 + 2x-2. Let s(a) = 130a - 130a + da*2. Give s(o(n)). 126n*4 Let p(h) = -13h*2 + 3h. Let f(k) be the first derivative of k*3/3 - 10k - 98. Let t(n) be the first derivative of f(n). What is t(p(j))? -26j2 + 6j Let v(s) = 2. Let r be (2/(-3))/((-3)/(-27)). Let p(y) = y*2 - 6. Let w(b) = rv(b) - 2p(b). Let k(n) = 20n*2 - 2. Determine k(w(j)). 80j*4 - 2 Let d(i) = i + 17. Let m(p) = 22p*2 - 144p + 3. Let u(v) = v*2 - 48v + 1. Let o(l) = -m(l) + 3u(l). Determine o(d(j)). -19j*2 - 646j - 5491 Let i be ((-15)/(-20) - 2)/(8/(-160)). Let v(o) = -i + 2 + 10 + 13 - 3o2. Let q(f) = 2f*2 - 201. What is v(q(s))? -12s*4 + 2412s*2 - 121203 Let m(o) = 6299507o*2. Let v(s) = -7s*2. Determine m(v(w)). 308675843w*4 Let y(z) = 66z. Let q(v) be the first derivative of v*5/60 - 64v*3/3 - 129. Let m(i) be the third derivative of q(i). Determine y(m(l)). 132l Let x(p) be the third derivative of p*5/30 - 2p*2. Let h(a) = a. Let g(o) = -3o. Let c(b) = 4g(b) + 9h(b). Calculate c(x(z)). -6z2 Suppose 9d = -19 + 55. Suppose -11o + 84 = -do. Let p(n) = -on2 - n2 - 32n + 12n2. Let c(h) = h2. Calculate p(c(b)). -b4 - 32b*2 Let g(d) = 1 - 3d*2 - 1. Let c be ((-8)/(-18))/((-24)/(-108)). Let q(m) = 549m*2 - 283m*c - 273m*2. What is q(g(r))? -63r*4 Let k(o) = 18o + 10. Let a(c) = 44c + 24. Let t(x) = 5a(x) - 12k(x). Let n(f) be the second derivative of f4/4 - 11f. Give t(n(i)). 12i2 Let t(p) = -12p*2. Let v be (-321)/(-12) + (-1)/(-4). Let i be v/9 + (-2)/2. Let d(f) = -3f*i + 15f*2 - 10f*2. Give d(t(m)). 288m*4 Let s(i) be the second derivative of 0i*3 + 51i - 19/3i4 + 0i*2 + 0. Let v(g) = -2g. Determine s(v(l)). -304l2 Let v(d) be the second derivative of -1/12d*4 + 0d*2 - 21d + 6 + 0d3. Let y(r) = -2 + 4 + 11 + 2r. Calculate y(v(b)). -2b2 + 13 Let j be (-21)/(-14) + (-6)/4. Let r(n) = -217n + 219n + j + 0. Let d(x) = -3x*2. Determine r(d(g)). -6g*2 Let b(y) = -1134131y. Let t(n) = -837n. Let a(u) = 10b(u) - 13549t(u). Let o(k) = 2k*2. Give o(a(w)). 1270418w**2
What is the third smallest value in -1/3, -53, -4, 119? -1/3 Which is the fifth smallest value? (a) 1.3173 (b) 2 (c) 5 (d) 0.1 (e) -3 (f) -1 b Which is the fourth smallest value? (a) -1/6 (b) 1 (c) 2 (d) 0.04 (e) -2 (f) 359 b Which is the third biggest value? (a) 1.1 (b) 4 (c) -39/5 (d) -0.1 d What is the fourth smallest value in 4/3, -2/1779, 2/9, -2/5? 4/3 Which is the second smallest value? (a) -21 (b) -6 (c) 0.3 (d) -0.3 (e) 0 (f) 0.2 b What is the third smallest value in -0.02, 2/11, -0.18, -5, 1/7, -0.35? -0.18 What is the third biggest value in -1087.16, 2/19, 0.1? -1087.16 Which is the biggest value? (a) 2/15 (b) -61 (c) -4 (d) -2/7 (e) -0.3 (f) -0.5 a Which is the fourth smallest value? (a) 2/5 (b) 5 (c) -6/5 (d) 1 (e) 272 b Which is the third smallest value? (a) -326 (b) 32.8 (c) 2 b What is the fifth smallest value in -0.3, -1/10, -1.53, 0.2, 4/7, -3/7? 0.2 Which is the second biggest value? (a) 2 (b) 2/3029 (c) 6 (d) 1/3 a Which is the second smallest value? (a) -4 (b) 2/55 (c) -3/19 (d) -2/9 (e) 5 d What is the fourth smallest value in -16, 0.3007, -0.1, -5? 0.3007 Which is the fourth smallest value? (a) 20 (b) 0.3 (c) -2.3 (d) -1/2 a What is the biggest value in -5, -2186, 1? 1 What is the second biggest value in -155, 2/7, 1, 7, -5? 1 Which is the third smallest value? (a) -9.5 (b) -0.5 (c) -4 b Which is the second smallest value? (a) -3 (b) 5 (c) 1 (d) 15.98 c What is the biggest value in 4, 32.36, 0.4? 32.36 Which is the second smallest value? (a) -5 (b) -881/2 (c) 5 (d) -8/11 (e) -4/3 a What is the smallest value in -4, -0.1, -1686? -1686 What is the second biggest value in -6, 2, 141, 0.03? 2 Which is the third smallest value? (a) 1/411 (b) 15 (c) -2/213 b What is the third biggest value in 3/56, 1/4, -2, 2, -134? 3/56 Which is the second biggest value? (a) -2 (b) 3 (c) 0.8 (d) 27 b What is the third biggest value in -5, 0.309, -2/97? -5 What is the third smallest value in -5, 300.3, -0.3, 0? 0 Which is the third smallest value? (a) 5 (b) 3 (c) -57/7 (d) -8/11 b What is the smallest value in -2/103, 0.4, -1940, -0.1? -1940 Which is the second smallest value? (a) 14 (b) 0.05 (c) -1.4 (d) -3 c Which is the biggest value? (a) -37 (b) 4 (c) -1/3 (d) 6 (e) -11/2 (f) -5 d Which is the second biggest value? (a) -8 (b) 0.11 (c) 0.2 (d) -96 b Which is the fourth biggest value? (a) -4 (b) -0.04 (c) 1 (d) -35 (e) 4 a Which is the fourth smallest value? (a) -6 (b) 0 (c) 92/21 (d) 2/11 c What is the third biggest value in -0.4, -0.09, 4, -0.098, -5? -0.098 What is the biggest value in 1/9, -0.2, -1/42, 1, -1? 1 Which is the smallest value? (a) -18.9 (b) -1/4 (c) 20/3 (d) -3 a What is the fourth biggest value in 0.2, 9/2, -5/34, -4/5? -4/5 Which is the third biggest value? (a) -7.6 (b) 11/9 (c) -0.4 a Which is the fourth smallest value? (a) 2 (b) 1 (c) -3 (d) 7495 (e) -0.3 (f) 0.5 b Which is the third smallest value? (a) -1 (b) -2 (c) 1/188530 c What is the third smallest value in -2, -1/31, -52, -7, 2? -2 What is the fourth biggest value in 3, -0.0385, 2, -0.3, -5? -0.3 Which is the third biggest value? (a) -3 (b) -0.3 (c) -4 (d) -5 (e) 2 (f) -13610 a Which is the second biggest value? (a) 1/3 (b) -3 (c) 122 (d) -1/24 a What is the second smallest value in 1/5, -5, 1/7, 51, 5, 0.3? 1/7 What is the third biggest value in 1776, -4, 5/2, 0? 0 Which is the second smallest value? (a) -2491 (b) 2 (c) -2/7 c Which is the second biggest value? (a) -0.4 (b) 3/25 (c) 42 (d) 1/2 (e) 0 d Which is the biggest value? (a) -2/89 (b) 0.059 (c) -1 (d) 4 d What is the fifth biggest value in -3/2, 62, 9, -0.5, -2/5, 3? -0.5 What is the fourth smallest value in 26, 4, 1.11, -0.2, 0.1? 4 Which is the fifth biggest value? (a) 0.1 (b) 3/4 (c) -7/4 (d) -1/3 (e) -84 e Which is the third smallest value? (a) 2 (b) 4/5 (c) -105/32 (d) -2 b What is the fourth biggest value in -6, 5, 0.4, -5, 2? -5 Which is the smallest value? (a) -0.4 (b) 0.4 (c) -20172 (d) 1/2 (e) -0.3 c Which is the fifth smallest value? (a) -9 (b) -1/9 (c) 4 (d) 0.4 (e) 8 e Which is the fourth biggest value? (a) -0.09 (b) -0.3 (c) 0.1 (d) -2/7 (e) 0.0335 d Which is the third biggest value? (a) 8 (b) 2/3 (c) 129 b Which is the second biggest value? (a) -3/5 (b) -1465/8 (c) -11/3 c Which is the third smallest value? (a) 29 (b) -0.1 (c) 1 (d) -5 (e) -136 b Which is the fifth smallest value? (a) 0.3 (b) -5 (c) -1/2 (d) -0.3 (e) -9/4 a Which is the second smallest value? (a) 0.016 (b) 2/17 (c) 1 (d) -537 a What is the fifth smallest value in 1/5, 0, -66, -2/17, -0.059, -0.1? 0 Which is the third biggest value? (a) 17 (b) -0.5 (c) 17/237 b What is the fourth smallest value in 0, 0.4, 3, -2/11, 12? 3 Which is the biggest value? (a) 1 (b) -0.4 (c) 5 (d) -5 (e) -761 c What is the third smallest value in 0, 1/2, -108.84? 1/2 Which is the fifth biggest value? (a) -1/11 (b) -1 (c) 1 (d) -2 (e) -0.129 d Which is the second biggest value? (a) -2/57 (b) 0.1 (c) 263 (d) -0.5 (e) 4/7 (f) 1 f What is the third smallest value in -115, 6/11, 58? 58 Which is the second smallest value? (a) 10 (b) 0.3 (c) -1152 b What is the smallest value in -0.08, 1970, 92? -0.08 What is the third biggest value in 0.1, 0.28, -298? -298 Which is the smallest value? (a) 1/9 (b) -3 (c) 0 (d) -3/4 (e) -1/3 (f) -3.2 f What is the smallest value in 4/3, 3, -7/4, 0, 420? -7/4 Which is the fifth biggest value? (a) -20 (b) 7 (c) 0.4 (d) -21 (e) 4 (f) 0.1 a Which is the biggest value? (a) -2/4927 (b) 5 (c) -2/9 (d) -4 (e) 0.1 b Which is the smallest value? (a) -4 (b) 2/9 (c) 11 (d) -3/4 (e) -18 (f) 23 e What is the third smallest value in 4, 104, -4/3, 0.15? 4 Which is the biggest value? (a) 14 (b) 4 (c) 0.3 (d) 38/15 a Which is the third smallest value? (a) 55 (b) -1 (c) -126 a What is the fourth biggest value in 3, 1, 0.1, 4/9, -2? 0.1 What is the third biggest value in 0.3, 2686, -2? -2 What is the fifth smallest value in 0.38, -3/4, 0, 3/4, -109? 3/4 Which is the fourth biggest value? (a) 0.05 (b) 1/7 (c) -5 (d) -69 d Which is the biggest value? (a) 0 (b) -540 (c) 13 c What is the third biggest value in 2, 1587, -0.3, -3, 3/34? 3/34 Which is the fourth biggest value? (a) -3 (b) 1.1 (c) -2/9 (d) 7 (e) 8 c Which is the second biggest value? (a) -10 (b) 1732 (c) -2/5 c What is the biggest value in -6/5, 531.2, -1/7? 531.2 What is the second smallest value in 5, 1650, 10, -1? 5 Which is the third smallest value? (a) -5 (b) 1 (c) 211 (d) 2/1057 b What is the fifth biggest value in 7, 1, -3.1, 58, 2? -3.1 Which is the third smallest value? (a) -30 (b) -0.076 (c) 1 (d) 15 (e) 0.4 e Which is the third biggest value? (a) -4/7 (b) -2/167 (c) 33.8 a Which is the third biggest value? (a) -39 (b) -78.3 (c) -5 b What is the fourth biggest value in -1/104, 0.3, 1/3, 2, 12? 0.3 What is the third smallest value in 2, 4/9, 1, 3, -4.43? 1 What is the biggest value in 1/3, 5, -0.0454? 5 What is the second biggest value in -3, -2/7, 2, 145, -1/8? 2 What is the third biggest value in -86, 0.04, 0, -0.09? -0.09 What is the fourth smallest value in 0.81, -0.053, -2, -5, -4? -0.053 Which is the fifth smallest value? (a) -2/3 (b) 0.1 (c) -1 (d) -5 (e) -13 (f) -24 a What is the second smallest value in -4, 0.1292, 2? 0.1292 What is the fourth biggest value in -144, -4/7, -1/3, -500? -500 What is the smallest value in 8, 1, 0.3, 1175? 0.3 What is the biggest value in 2.7, -1, -12/13, 2/13, 0? 2.7 Which is the third smallest value? (a) 0 (b) 10 (c) -5 (d) -8 (e) -0.3 (f) -0.1 e What is the smallest value in -57, 1/2, -13, -5? -57 Which is the biggest value? (a) 3750 (b) 0.02 (c) 1 a What is the second smallest value in -1.73, 2/11, 3, -2/15, -1/2, -12? -1.73 What is the second biggest value in 3, 6, 18, 0.1, -4? 6 Which is the fifth biggest value? (a) 0.04 (b) -2/11 (c) 6 (d) -0.0257 (e) 3/2 b What is the third smallest value in 3, -0.2, -2/79, -71, -5, 0.2? -0.2 What is the smallest value in 1.699, 4/61, 2? 4/61 What is the biggest value in -1/7, 1, 2, 4/91, -6? 2 What is the sixth biggest value in -0.4, 3, 273, 0.02, 2, 0? -0.4 What is the fifth biggest value in 0, 2, 4, -2250, 0.4? -2250 Which is the second smallest value? (a) 82 (b) 0.021 (c) -2/7 (d) -0.3 (e) -0.1 (f) -2/11 c What is the smallest value in -11, 0, -2, -2/5, 0.053? -11
Calculate (-1 - 7)(-8)/(-544). -2/17 Evaluate ((-6)/4)/((-11)/22). 3 -7 - (6/(-3)3 + 2) -3 Evaluate 5 + ((-10)/5 - (-4)/2). 5 4(54/(-720) + 2/(-16)) -4/5 What is the value of (-6)/(-36) - 38/12? -3 What is -1 - (12/8 - 4)? 3/2 Evaluate (((-2)/1)/((-16)/3))/(-3). -1/8 What is 1/(7/30) - 4? 2/7 -65/15 + (-5 - 1) -8 Calculate 14/(-76)158/553. -1/19 384/256 - 22/8 -5/4 Calculate ((-280)/(-32) + -9)/((-1)/20). 5 What is 2/848/54? 2/9 What is the value of (1/3)/(4 + (-342)/95)? 5/6 Calculate (-4)/(-8)4-1 + -1. -3 Calculate ((-4)/2 + -1)128/288. -4/3 Evaluate 52/12 + -2 - 2. 1/3 What is ((-12)/(-315)-3)/((-4)/(-10))? -2/7 Evaluate 6/(-20)164/(-123). 2/5 What is the value of ((-12)/3)/(-2) + 0 + 3? 5 Calculate 2((-12)/(-48) + (-2)/(-8)). 1 What is the value of 9(96/18 + -5)? 3 Calculate ((-1)/18)/(15/45). -1/6 Evaluate 3 - (2 + (-8)/(-20)). 3/5 Calculate ((-57)/(-9) + -3)(-6)/4. -5 (12/(-64)-4)/(15/(-12)) -3/5 (-10 + 17)/(-3 - -4) 7 What is the value of (-24)/(-252) - 88/483? -2/23 What is the value of 93/(-62) + (-1)/2 - -6? 4 What is -280 + 286 - (-2)/((-4)/14)? -1 What is -22 + 4 + -34 + 43? -9 Evaluate (6/75)/(2/(-20)). -4/5 What is the value of (-12)/(-2) + 445/(-89)? 1 Evaluate -1 + 8 + (-6149)/858. -1/6 Evaluate -5 - (-42)/18 - 2/6. -3 Evaluate 2/((-11)/((-33)/2)). 3 Evaluate 12/(-21) + 1287/(-1386). -3/2 Calculate (-1)/(50/(-20))20. 8 Calculate (-5 + 15/2)(2 - 4). -5 17 + -20 + ((-13)/14 - -4) 1/14 What is 12((-5)/24 - 19/152)? -4 What is 4/(82/20)? 5 What is the value of (-166)/34 + 19/646-4? -5 What is the value of (20/300)/(4/(-36))? -3/5 Evaluate -174 - -181 - 22/2. -4 Evaluate (4/(-6)(26 + -29))/(-13). -2/13 What is the value of 134/378 + (-102)/238? -2/27 What is (-3)/(-5) + (-11)/10? -1/2 10/(-1 + 16/4 - 5) -5 What is (9/(-54)0)/(3 - 1)? 0 Evaluate 126/(-540)6/(-14). 1/10 What is 260/700 - (-12)/(-21)? -1/5 -4 - (18/14 + -5) -2/7 What is (-57)/1528/(2 + 2)? -3/4 Calculate (-1)/(((-12)/8 - -2)-1). 2 What is the value of (22)/(0 - (-7 + 8))? -4 What is (-4)/(-50) + 4/(-600)-3? 1/10 Calculate (12/(-126))/((-5)/(-7)). -2/15 Evaluate ((-153)/(-30) + -5)/(6/45). 3/4 Calculate ((-45)/(-40) - 6/(-16))-2. -3 Calculate 17632/(-3496) - (-2)/46. -5 Evaluate (11/(110/12))/((-9)/(-45)). 6 Calculate (10/(-15) + 1)24/(-4). -2 What is the value of (-72)/28 + -1 - (-1 + -3)? 3/7 Evaluate -2 - (5 - 2) - -1. -4 (-6)/(((-7)/(-21))/((-3)/198)) 3/11 Evaluate (-120)/(-21) + -3 + (-18)/(-63). 3 Calculate (0 - (-30)/(-10)) + -1 + 2. -2 Calculate (-1)/(-4) - (-63)/(-924). 2/11 Evaluate (-13)/6 - 2/12. -7/3 Calculate (-21)/((-12)/18). 3 What is the value of ((-57)/(-6) - 8)/((-21)/(-6))? 3/7 What is ((-1188)/(-63))/11 + -21? -2/7 What is the value of (12/10)/((-10)/(300/(-9)))? 4 Calculate (-70)/22 + 6 + -3. -2/11 Calculate 18/6(-4)/(-90). 2/15 Evaluate (-3)/2((-680)/30 + 24). -2 What is -11(105/77)/(-3)? 5 What is the value of 3(13 - 637/39)? -10 What is (2/1)/(375/150)? 4/5 Evaluate (4/(-3))/(-4(-16)/(-48)). 1 (18/12)/((-12)/(-20)) 5/2 What is -3 + (-4 - -3) - -8? 4 Calculate 0 - -5 - (-57)/63-7. -4/3 ((-9)/(-24))/((-40)/(-64)) 3/5 (-6 + 0)1 - (-8 + 5) -3 Calculate (-4 + 33/6)8/42. 2/7 Calculate -2 + 13 + (-27 - -10). -6 Evaluate (-14)/(-56) + 26/(-72). -1/9 Calculate (-14)/8 - 4/16. -2 What is (-2)/(8/(-19)) - 1413/1884? 4 Calculate (((-378)/35)/9)/((-210)/(-100)). -4/7 128/72 - (-6)/27 2 What is -8 - (-2 - 0) - (0 - 5)? -1 Calculate 26/(-195) + -1 + (-112)/60. -3 (2 - 16/6) + (-11)/(-3) 3 What is the value of ((12/3)/16)/1-1? -1/4 What is the value of -1 + 0/(3 + -8) + -3? -4 Calculate (-24 - -27)/(6/10). 5 Calculate (3/2)/(-3 + (-36)/6). -1/6 What is (3/5)/(13/(-520)-16)? 3/2 Calculate (-65)/15 + 4 + -1. -4/3 What is the value of (-3)/712/18? -2/7 6/8 + (108/(-16) - -5) -1 ((-22)/(-484))/(1/4) 2/11 (2 + -2)37/(-74) 0 What is the value of 4/(-6)(-3 + 60/8)? -3 What is the value of -92 - (-169 - -159)? -8 What is (-62)/(-36) + 84/(-56)? 2/9 Evaluate (6/(-7))/(28 + 5346/(-189)). 3 Evaluate -1(-33)/(-6) - (-66)/(-44). -7 What is the value of 8/40((-30)/2)/(-5)? 3/5 Calculate (-4 + 2)/((-4)/8 + 0). 4 What is the value of 17/(-3) + (1200/90)/20? -5 What is (-45)/(-15)8/6? 4 What is 3 + 37/(-4) - -6? -1/4 What is 10 - 0 - 1404/144? 1/4 What is the value of -32 + 13 + (-2 - -11)? -10 7/(-28)0/1 0 (-5)/170106 - (-4)/34 -3 Evaluate (-2280)/225 - 6/(-45). -10 (-6)/(-8) - (9 + (-107)/12) 2/3 What is the value of ((-159)/106)/(6 + 0)? -1/4 -2 + 6/(-21) - (-1 + -1) -2/7 Calculate (-46)/14 - 16/(-56) - 1. -4 Calculate 0 - 0 - (-30)/(-9) - -4. 2/3 -3 - -1 - 224/(-140) -2/5 Calculate (12/(-16))/1 - (-25)/44. -2/11 What is (-1 + 1 - 6) + 116/(-116)? -7 Calculate (240/(-105) - -2) + (-38)/14. -3 1 + (-228)/247 - (-6)/91 1/7 Evaluate 7 + -9 + (3 - 2)/(-1). -3 Evaluate 3 + -4 + (-40)/(-28). 3/7 What is the value of ((-3)/4)/(6 - (-93)/(-8))? 2/15 Evaluate ((-60)/(-385))/6(-105)/(-30). 1/11 What is 45/(-35) - (-95)/63? 2/9 (1/((-8)/(-6)))/((-105)/(-28)) 1/5 Evaluate 30/(-70) - (-4 + 86/28). 1/2 Calculate (-9 + 0)((-423)/(-27) - 16). 3 Calculate ((-50)/4)/5 - (-11)/22. -2 Evaluate 255/(-45) - -23. 1/3 What is the value of 0 + 8 + -13 + (7 - -3)? 5 Calculate (-519)/(-692) + 1/((-8)/(-6)). 3/2 ((-9)/(-3)-1)/((-3)/1) 1 Calculate 2 + 7/(-49)(-48)/(-3). -2/7 Evaluate 9/6(-7)/((-35)/2). 3/5 What is ((-2)/11 - 0) + (-1157)/(-979)? 1 ((-265)/175 - -2) + 1/(-5) 2/7 (-114)/95 - (-133)/(-35) -5 45/27(-18)/(-10) 3 Calculate (-12 + 14)(1 - (-1)/2). 3 Evaluate (-6 - (-4 + -7))/(-3). -5/3 26/18 - (-17 + 18) 4/9 What is the value of 12/64-42 + (-2)/16? -8 Evaluate (-630)/252(-3 + -1). 10 Calculate (-1 - -5)/(4/(-2)). -2 Calculate 6/(-15)(-25)/20. 1/2 8 - 10 - ((-1)/1 - -1) -2 Calculate (-70)/(-306) - (2832/216 - 13). 2/17 What is the value of (-7)/(-28 + -7) - 88/(-10)? 9 Calculate ((-6)/(-18))/(5/(-15)). -1 Calculate (3 + -3)(0 + -1). 0 (4/(-3))/(-510/150) 4 (250/(-8))/(-5) - 7/28 6 What is -1(-247)/(-91) + 1 + 2? 2/7 Calculate 17 - 11(-48)/(-66). -1 What is 2 + (7 - (3 - (-4 - -2)))? 4 Evaluate (150/24 - 5)/(9/(-36)). -5 Evaluate 20/(-14)(-9)/90. 1/7 What is 8/12 + 13/3? 5 Evaluate (6/18)/((-6)/18). -1 Calculate (2 + -1)(2/(-2))/(-1). 1 (-2)/5 - (74/(-10) - -9) -2 What is the value of 2/14(-5 - 46/(-12))? -1/6 What is the value of 21/2((-48)/(-36))/2? 7 What is (357/(-36))/7 - (-9)/12? -2/3 What is (-58)/(-87) + 4/(-6)? 0 (-66)/(-189) - 22/(-99) 4/7 Evaluate 1/((-27)/(-21)) - (1 + 0). -2/9 What is (-1312)/615 + (8/10)/1? -4/3 -2(-6)/(-40) + 1/(-5) -1/2 What is -4 - (23/(-5) - -1)? -2/5 What is (-8)/28 - (-3)/(-14)? -1/2 What is ((-22)/44)/((-3)/36)? 6 What is the value of 2/(-6)-7 + 74/111? 3 Calculate ((-7)/70)/(6/(-216)) - 3. 3/5 What is (-3)/(-6 - -9) + (0 - -6)? 5 Calculate -5 + (-8 - -2)/(-1). 1 Calculate (-33)/(-7) - 84/(-294). 5 What is the value of 192/(-33)1 + (-12)/66? -6 (22/20 + 10/25)-2 -3 Evaluate (-2 + 0/(-1))/(8/12). -3 Calculate (6 - 8 - 1)/(15/(-10)). 2 What is 10 - 4 - (-35)/(-7)? 1 What is the value of (-1 - 12/(-4)) + (-54)/9? -4 What is (-28)/(-14) + (-4)/(-4)? 3 What is (-63)/28 - (-488)/160? 4/5 What is ((-17)/(-34))/((-9)/6)? -1/3 What is the value of (4 - 2 - 2) + 10/(-25)? -2/5 What is (20/(-56) + 1)/(144/(-84))? -3/8 What is ((-43)/(-172))/(1/4)? 1 Calculate (-1 + 1)/5(-2)/2. 0 Evaluate 28/462(-4 + 10). 4/11 (-2 - 41/(-22))(-24)/18 2/11 4/14 + 4/(-14)1 0 Evaluate 128/126 + 68/(-119). 4/9 Evaluate -24 + (-4)/(-24)18. -5 What is the value of 0((-15)/(-12) + 3/(-12))? 0 Calculate 32/(-6) + 0 + (-15)/(-45). -5 Calculate (-2)/(-8) - 231/(-84). 3 What is the value of ((-644)/(-42) - 16) + (-22)/(-6)? 3 What is the value of (-1 - -4)/(-9) - 9/(-189)? -2/7 Calculate ((-9)/15)/(7/35). -3 Calculate (67/11 - -1) + 14/(-154). 7 (3/(-27))/(19 + -18) -1/9 (4 - (-44)/(-12))/((-7)/(-21)) 1 Evaluate 0/1 + 7 + 25/(-5). 2 What is the value of ((-4)/8)/((-65)/52)? 2/5 Evaluate (-27)/252 - (-2)/8. 1/7 ((-10)/(-56))/(-5) + 13/(-52) -2/7 Evaluate (-2)/((-44)/(-70)) - -3. -2/11 53/(-159)(-3)/22-12 -6/11 What is 15/6 + (-3 - -2)? 3/2 Calculate 6/(-3) - 0 - -4 - 2. 0 (15/20)/34 1 Calculate (2/28)/((-26)/(-182)). 1/2 117/(-30) - -6(-2)/120 -4 Calculate (2/(-8))/(7/(-112)). 4 Evaluate (12/(-30))/(39/(-15))13. 2 What is the value of 14/(-3) - (-9)/(-27)-2? -4 Evaluate 158/1817 + (-26)/(-230). 1/5 What is the value of (4/(-20))/(32/30)? -1 What is (-34)/516/20? -1/5 What is the value of 4/34 - 833/(-289)? 3 What is the value of -1 + 136/(-36) - 2/9? -5 What is the value of (84/32)/(0 - 1)? -1 ((-7)/5604)/(5/30) -3/10 ((-12)/(-16))/(15/40) 2 8/(-6)(-259)/(-3108) -1/9 What is (-15)/(225/(-70)) - 4? 2/3 What is (-41/(-2))/(28/(-42))? -3 Calculate 26/14 - ((-240)/14 - -17). 2 What is the value of 20/312/(-8) - -6? -4
Suppose 3v + 6c - 11c = -16, 4c - 16 = 4v. Calculate the remainder when 101 is divided by v + 23 + 18 + -15. 5 Let o = -303204 + 303220. Let q(g) = g3 - g2 + g + 106. What is the remainder when q(0) is divided by o? 10 Let c = -4260 + 4884. Calculate the remainder when c is divided by 125. 124 Let q be (-4)/5(-240)/96. Suppose 12s + qs = 266. Calculate the remainder when 109 is divided by s. 14 Suppose 2v - 133 = -5w, 0 = -w - 3w + 2v + 92. Suppose w = 3t - 50. What is the remainder when (-4)/6 + (-14)/(-12) + (-36022)/(-868) is divided by t? 17 Let q(r) = r2 - 4r + 1. Suppose -h = u - 60, 4u + h = 86 + 154. Suppose -u = -11f + 5f. Calculate the remainder when f is divided by q(5). 4 Let t(y) = 3y2 + 4. Let s(g) = g3 + 2g2 - g - 2. Let h be s(-2). Suppose h = 8m - 66 - 22. Calculate the remainder when t(3) is divided by m. 9 Let j(u) = -126u - 1385. Calculate the remainder when 87/4 - 3/(-12) is divided by j(-11). 0 Suppose p + 0k - 3k - 3 = 0, 2 = 2p - 2k. Suppose pb + 3b - 27 = 0. What is the remainder when 8/(-1) + ((-9768)/(-264) - (6 + -3)) is divided by b? 8 Suppose 2b + 45 - 29 = 0. What is the remainder when 299/3 - 8b/(-96) is divided by 35? 29 Suppose -6t + 8t = s + 3618, 2t + 2s = 3636. What is the remainder when t is divided by 360? 12 Suppose 3j = 4z - 2z - 218, -2z + 222 = -4j. Let a = -180 + z. Let i = -71 - a. Calculate the remainder when 15 is divided by i. 3 Let k = -68 - -70. Suppose -307 = 4c + l, 2c - kl = -2c - 310. Let s = -40 - c. Calculate the remainder when s is divided by 22. 15 Let c(r) = 462r3 + 13r*2 - 22r - 5. Calculate the remainder when c(2) is divided by 10. 9 Suppose -47w - 10 = 37. Calculate the remainder when 44 is divided by -3621/(-28) - w. 16 Let o(b) = -10b3 + 5b*2 + 19b + 30. What is the remainder when 251 is divided by o(-2)? 67 Suppose 0 = -3u - 5a - 1791, 2a = -2u + 5a - 1175. Let t = u - -617. What is the remainder when t is divided by 8? 1 Suppose 3v - 6 = 0, -4v = -3q + q + 52. Suppose -p + 24 = -4m + 2m, 3p = 3m + 69. Suppose 5c - p = 33. What is the remainder when q is divided by c? 8 Suppose x + 3i - 70 = -9, -3x + 172 = -2i. Suppose -5g - 20f = -17f - 4881, -4g + f + 3949 = 0. What is the remainder when g is divided by x? 56 Let d(y) = -43y + 31. Calculate the remainder when d(-8) is divided by 54. 51 Let p(h) = 385h*2 + 15h - 161. What is the remainder when p(5) is divided by 9? 8 Suppose -133 = 13u + 114. Let d = 24 - u. Calculate the remainder when 50 is divided by d. 7 Let l(v) = -v2 + 15v + 57. Let m = 105 - 87. Suppose 5u - 39 = 41. What is the remainder when u is divided by l(m)? 1 Suppose -16h = -17h + 71. Suppose hg = 79g - 272. What is the remainder when g is divided by 19? 15 Suppose -12323 - 3489 = -21m - 46m. Calculate the remainder when m is divided by 70. 26 Let j = 9799 - 9653. What is the remainder when 307 is divided by j? 15 Let g(o) = -o3 + 11o*2 - 8o - 3. Let n = -583 + 586. What is the remainder when 224 is divided by g(n)? 44 Let r(y) = -y*3 + 28y*2 - 58y + 847. What is the remainder when r(26) is divided by 118? 101 Let f(a) be the third derivative of 3/2a3 + 0 - 9a*2 + 1/24a*4 + a. What is the remainder when 20 is divided by f(-4)? 0 Let d(i) be the first derivative of 2i*3/3 + 7i*2/2 - 106i + 139. Let p = -55 - -91. Calculate the remainder when d(11) is divided by p. 33 Let s(d) = -d*2 + 13d - 15. Let a(o) = o*2 + 1. Let c(n) = -2a(n) - s(n). Suppose -3u - 57 + 24 = 0. Calculate the remainder when c(u) is divided by 9. 8 Suppose 3q + 4r = -687 - 6, 4r = q + 215. Suppose 0 = 9b - 0b - 3033. Let d = b + q. Calculate the remainder when d is divided by 37. 36 Let w(q) = 5q2 + 546q - 4416. Calculate the remainder when 632 is divided by w(8). 88 Calculate the remainder when 4/8-4 + (-4 - -9076)/7 is divided by 48. 46 Let a = -579 + 973. What is the remainder when a is divided by 49? 2 Suppose 649 = 7q - 1584. Calculate the remainder when q is divided by 114. 91 Suppose 4o - 3503 = -3q, 26o + 1168 = q + 27o. Calculate the remainder when q is divided by 577. 15 Suppose 2p - 38 = -4t, -p + 3t - 17 = -2p. What is the remainder when 293 is divided by p? 17 Let b be (-74)/3(-9 + 0). Suppose -5h - b = -8h. Suppose -5y + 3u + 87 = 7u, 3y + 4u = 49. What is the remainder when h is divided by y? 17 Suppose -5o + 3430 = -5z, 117 = 5o - z - 3337. What is the remainder when o is divided by 47? 34 Suppose -4u + 12 = 5k, 6 = -0k + 3k + 3u. Calculate the remainder when k is divided by ((-6)/(-15))/(2/5). 0 Calculate the remainder when 958 is divided by -8 + 1-1 + -450 + 482. 15 Suppose -13o = -1784 + 679. Suppose 7z - 6z = 0. Suppose 0l - 5l + 110 = z. Calculate the remainder when o is divided by l. 19 Let g(l) = -203l + 3676. Calculate the remainder when g(-5) is divided by 69. 68 Let z(s) = 67s - 2. Let c(g) = -3g + 74. What is the remainder when z(1) is divided by c(20)? 9 What is the remainder when 1753 is divided by 4/(-20)-4395 - 10? 15 Let s(i) = -13i + 2591. Calculate the remainder when s(190) is divided by (-1 - (-7)/3)12. 9 Calculate the remainder when ((-10)/(-3))/(((-2)/(-226))/(24/16)) is divided by 53. 35 Let i(o) = o*3 - 9o*2 - 11o + 86. Let z be i(12). Let t = -339 + z. Calculate the remainder when 82 is divided by t. 35 Let y(w) = -w*3 + 6w*2 - 5w - 4. Calculate the remainder when (93 - (-1833)/(-39)) + 87 is divided by y(4). 5 Let g(q) = -q3 - q2 - 4q - 3. Calculate the remainder when 605 is divided by g(-4). 56 Let h(z) = z + 10. Suppose -876 = -4n + 4c, -n + 96 = 3c - 127. What is the remainder when n is divided by h(27)? 35 Let l = -180 - -208. What is the remainder when 28 is divided by l? 0 Let t be ((12/(-7))/6)/((-3)/21). Suppose z = 5z - 96. Suppose -ti - 2i + z = 0. What is the remainder when 11 is divided by i? 5 Suppose i = 4b - 19646, 2i - 24556 = -5b + 4i. Calculate the remainder when b is divided by 14. 12 Suppose -2a - 61 = -3s, 5s - 4a - 3 = 96. What is the remainder when 86 is divided by s? 17 Let x = -1176 - -1485. What is the remainder when 2158 is divided by x? 304 Let x = 558 - 334. Suppose -173p + x = -165p. What is the remainder when p is divided by 6? 4 Suppose 6x - 15 = x. Suppose 2p - 3m - 18 - 10 = 0, 0 = -4p - 3m + 74. What is the remainder when p is divided by x? 2 Let h(g) = -16 - 17 + g*2 - 5g - 6g + 13. Let p be h(16). Suppose -4m = -2z - z - p, -5m = 3z - 75. Calculate the remainder when 89 is divided by m. 14 Let d(u) = u3 - 30u*2 + 199u - 2. Let q(p) = -4p - 2. Let c be q(-3). Let l = 5 + c. What is the remainder when d(9) is divided by l? 13 Suppose -272w + 268w - 12 = 0, 571 = 4a - 5w. What is the remainder when a is divided by 52? 35 Let w(c) = c3 - 2c*2 + 5c - 3. Let m = 228 - 381. Let d = m + 212. What is the remainder when d is divided by w(3)? 17 Calculate the remainder when 587 is divided by ((-30)/3)/((1 + (-280)/276)6). 12 Let t be -81(-5 + (-34)/(-6)). Let w = 70 + t. What is the remainder when 157 is divided by w? 13 Let n = 119 + -56. Let x = n + -61. Suppose -xp - 4 + 10 = 0. Calculate the remainder when 4 is divided by p. 1 Suppose 0 = 5q - 3m - 355, 2m = 5q - 2m - 355. Let u be (-2 - -4)q/2. Let f = u - 48. Calculate the remainder when 91 is divided by f. 22 Suppose -2u = 2u + 12, 4u = -4r + 84. What is the remainder when (r/(-9))/((-6)/9) is divided by ((-5)/(-25) - 1)/(1 + 21/(-15))? 0 Let h(s) = -51s*3 - 5s*2 - 12s - 8. What is the remainder when h(-3) is divided by 13? 8 Suppose 16 = 4c - 2r, 4r = -5c - r - 10. Suppose -7 = cq - 3. Let y(x) = -x3 + x2 + 4x + 3. Calculate the remainder when 41 is divided by y(q). 6 Let w(f) = 7f2 + 30f + 109. What is the remainder when w(-10) is divided by 32? 29 Suppose -2j + t + 99 = 0, 5j + t - 231 = 6. Calculate the remainder when j is divided by 13. 9 Let t = 7314 - 6691. Calculate the remainder when t is divided by 29. 14 Suppose -55 = -m + x, 5m + 2x = -962 + 1230. Calculate the remainder when 199 is divided by m. 37 Let t = -454 - -227. Let z = t + 235. Calculate the remainder when 110 is divided by z. 6 Let h(d) = -d*2 - 16d - 23. Let p be h(-14). Suppose -5k + 745 = -5y, 4y + 149 = pk - 4k. Calculate the remainder when k is divided by 25. 24 Suppose 50m - 52m - 5u + 129 = 0, 0 = 2*u + 18. Calculate the remainder when m is divided by 38 + -1 + -2 - 2. 21
Let u(x) = -2x - 2. Let y be u(-1). Suppose y = 6m - 9m. What is the remainder when (1 - m)/(((-24)/6)/(-312)) is divided by 20? 18 Let q = -17 + 28. Calculate the remainder when (-1053)/(-162)(-2 - -12) is divided by q. 10 Suppose 0 = -2f - 2o + 2, 0 = -f - 4o - 2. Suppose -374 = fz - 19z. Calculate the remainder when z is divided by 6. 4 Suppose 2d + 46s = 48s + 432, d + 2s = 216. Calculate the remainder when d is divided by 97. 22 Suppose -5648 + 392 = -3m. Suppose -m = -2i - 10i. What is the remainder when i is divided by 21? 20 What is the remainder when 232 is divided by (6 - 5)1 - -17? 16 Suppose -13a = -17648 + 6182. What is the remainder when a is divided by 15? 12 Suppose -114x = -223x + 3488. Let r = -260 - -379. What is the remainder when r is divided by x? 23 Suppose -5y + 59p - 56p + 2400 = 0, 0 = 2y - 5p - 960. Calculate the remainder when y is divided by 68. 4 Let d = 14132 + -13822. Calculate the remainder when d is divided by 52. 50 Suppose -15 = 5q, -2q + 1 = -4m + 127. What is the remainder when 427 is divided by m? 7 Suppose 10v = 4r + 192, -v - 5r = -1 - 2. What is the remainder when 233 is divided by v? 17 Suppose 2a - 430 = -102. What is the remainder when a is divided by 2/((24/(-930))/(-2))? 9 Suppose 10i - 1320 = 100. What is the remainder when i is divided by 73? 69 Suppose 0 = -30x + 16743 + 1227. What is the remainder when x is divided by 120? 119 Let z = -12548 + 13378. Calculate the remainder when z is divided by 82. 10 Suppose 37j = 35j + 234. Suppose -9g + j = -45. Calculate the remainder when 195 is divided by g. 15 Let q = 51 + -4. Calculate the remainder when q is divided by (-8)/18/(-16). 3 Suppose 4l = -5n + 1206, 22l - 21l = 5n - 1211. What is the remainder when n is divided by 32? 18 Calculate the remainder when ((-2)/(-1))/(2/25) is divided by 384/60 + (-420)/175. 1 Suppose -5w + 5z = 215, 0 = -2z - z - 3. Let c = 49 + w. Suppose 4q - 166 = cy, -4y = -4q + 94 + 70. Calculate the remainder when q is divided by 20. 19 Suppose 32f - 262f = -10580. Calculate the remainder when 94 is divided by f. 2 Let k = -62 - -87. Suppose -k = i + 4i. Calculate the remainder when 23 is divided by 16/72 - 11/9 - i. 3 Suppose -9s - 11s + 665 = -s. What is the remainder when 174 is divided by s? 34 Let x = -12 - 1. Let r be (-3293)/111 + (-3 - 28/(-6)). Let c = x - r. What is the remainder when 27 is divided by c? 12 Let d be (-38988)/(-81) + (-2)/6. Let r = d + -468. Let a(n) = -n3 - 6n*2 + 13n + 3. Calculate the remainder when a(-9) is divided by r. 12 Let t(j) = 4j2 + 8j + 8. Let p be t(-4). Suppose 3u + 20 = 5, 5g - 4u = p. Suppose -2 = gr - 22. What is the remainder when 15 is divided by r? 0 Let s(g) = g*2 + 11g - 19. Suppose -2l + 76 = 66. Let n be s(l). Let j = n + -49. Calculate the remainder when 22 is divided by j. 10 Suppose 2c + 5 - 1 = 0, -3c = -3h + 33. Suppose -3g - u = -104, 0 = 7g - hg + 3u + 62. What is the remainder when g is divided by 9? 7 Let v = 292 - 289. Suppose -206 = -5a + 7h - vh, -5a - 2h = -212. Calculate the remainder when 329 is divided by a. 35 Suppose 2o - 7o = -5n + 405, -3n + 180 = 4o. Calculate the remainder when 9789 is divided by n. 69 Let s(b) = b*2 - 10b + 19. Let r be s(7). Let g(t) = -2t3 + 2t*2 - 4t - 7. What is the remainder when g(r) is divided by (-78)/(-9) - (-4)/(-6)? 1 Let j = -14607 + 14651. What is the remainder when 307 is divided by j? 43 Calculate the remainder when 5/(10/(-112))(-3393)/52 is divided by 159. 156 Let u = 154 - 114. Suppose 8s - u + 0 = 0. What is the remainder when 92 is divided by s? 2 Suppose 3o + 10m - 25079 = 8m, 9o = 2m + 75229. Calculate the remainder when o is divided by 190. 189 Let j(f) = -f3 - 105f*2 - 52f + 143. What is the remainder when j(-105) is divided by 59? 57 Let m = -254 - -259. Suppose -2a + 333 = md, -5d = 3a - 311 - 21. Calculate the remainder when d is divided by 26. 15 Let n be (-3)/((-15)/10) - (-207)/(-3). Let z = 81 + n. Calculate the remainder when 51 is divided by z. 9 Let n(u) = 2u + 5. Let z be n(-2). Let g(x) = 23x*2 - 4x + 3. What is the remainder when g(z) is divided by 5? 2 Suppose -6s - 3s - 855 = 0. Let v = s + 112. Calculate the remainder when 111 is divided by v. 9 Suppose 180o + 1537 = 103o + 130o. Suppose -41 = 2v + 29. Let a = v - -148. What is the remainder when a is divided by o? 26 Let y(o) = -o*2 - 70o - 414. Calculate the remainder when y(-45) is divided by 181. 168 Let v = -308 + 322. What is the remainder when 116 is divided by v? 4 Suppose 1228 = 5v - 4n, -5n = v - 8n - 250. Suppose -14 + v = 10q. Calculate the remainder when (-7)/((-21)/270) + -1 is divided by q. 20 Let w = -151 + 156. Suppose -j + w = -1. What is the remainder when 21 is divided by j? 3 Let p(i) = -3i + 23. Suppose 81 = 14q + 11. What is the remainder when 389 is divided by p(q)? 5 Suppose -5w = -2a + 4, -3a = 10w - 11w - 6. Calculate the remainder when 106 is divided by ((-3)/2 - 0)/(a/(-24)). 16 Let d(c) = 2c2 + 3c - 9. Let y be d(2). Suppose 94 = -yh - w, w = -3h + 5w - 61. Let g = h - -32. Calculate the remainder when 29 is divided by g. 3 Suppose 20h + 58 = 1878. Suppose -h = -59f + 58f. What is the remainder when f is divided by 16? 11 Suppose 0 = 5r - 4s - 131, 4r - 5s = 9 + 103. Suppose 2g = o + 4g - 7, 3o = -4g + r. Calculate the remainder when 702/(-63)(-343)/147 is divided by o. 8 Suppose 5r - 3735 = -5d, 4d + 6r = 7r + 2978. Calculate the remainder when d is divided by 83. 81 Suppose 313r + 10937 = 120153 + 102685. What is the remainder when r is divided by 18? 11 Let b(w) = 15w + 4. Let f be b(-3). Let i = f + 46. Suppose 478 - 158 = iq. What is the remainder when q is divided by 17? 13 Let v be (1 + -2 - 7)/(26 + -28). Suppose 0 = -vt + 6o - 3o + 30, -2o + 40 = 4t. Suppose 48 = 2b - 36. What is the remainder when b is divided by t? 6 Let t(r) = 5r*3 - 16r*2 + 10r - 11. Let p be t(5). What is the remainder when ((-1)/((-2)/9))/(33/p) is divided by 13? 10 Suppose r = 7t + 48, 34t - 39t = 0. Calculate the remainder when (176/(-24))/(2/(-78)) is divided by r. 46 Let r(z) be the first derivative of -3z*2/2 - 12z + 9. Let n be r(-15). Suppose -j = 2j - n. What is the remainder when 76 is divided by j? 10 Let w = 85685 - 85529. Let g = -91 - -131. What is the remainder when w is divided by g? 36 Let s(c) = c2 + 26c + 750. What is the remainder when s(-19) is divided by 123? 2 Suppose -5g + 5 = 0, r = -0r + g - 6. Calculate the remainder when 52/(-6)((-1)/2 + -4) is divided by r(5 + 195/(-25)). 11 Let t(z) = -5z3 - 297z*2 - 120z - 63. Calculate the remainder when 2472 is divided by t(-59). 52 Let a = -45 + 88. Suppose 92 = 2q + 2. Suppose -62 = -qk + ak. What is the remainder when k is divided by 17? 14 Let u(k) = -6k3 - k2 + 7. Let l be u(-3). Suppose -29p = -19p - l. What is the remainder when 110 is divided by p? 14 Suppose -188 = -72h + 2441 + 3203. Calculate the remainder when h is divided by (3/2 + -2)-84. 39 Suppose -63l + 61l + 2k + 292 = 0, 0 = 4l + 4k - 528. Calculate the remainder when l is divided by ((-18)/(-10))/(5/25). 4 Let v(f) = 4f - 25. Let l be v(7). Suppose 0 = -ls + 4s + 43. Let k = s - -53. What is the remainder when 29 is divided by k? 9 Let z be 12614/49 - (-1 + (-3)/(-7)). Suppose -7h = -h + z. Let k = -25 - h. What is the remainder when 32 is divided by k? 14 Let i(q) = 20q*2 + 136q - 14. What is the remainder when i(-14) is divided by 54? 4 Let l(y) = -2y + 8. Let g be l(7). Let a be (-335)/g - (-13)/78. Suppose 59q - 54 = aq. What is the remainder when 107 is divided by q? 17 Let t = 3387 + -3344. What is the remainder when 255 is divided by t? 40 Suppose 3k = 3g + 24, 2k - k - 3g = 8. Let d be (64/12)/k(-45)/(-2). Let y(s) = -2s2 + 38s - 34. Calculate the remainder when y(d) is divided by 23. 17 Suppose h - 4t = -104, -9t + 4t - 500 = 4h. Calculate the remainder when 115 is divided by ((-12)/8)/((-9)/h-1). 15 Suppose 0 = -2o - 2l + 246, o - 27 - 112 = 3l. What is the remainder when o is divided by 51? 25 Suppose 60u + 11u = 20u + 510. Suppose 0 = -5s - 0 + 15. What is the remainder when s - (3 - 1) - -48 is divided by u? 9 Let k(h) = -h*2 + 71h + 207. What is the remainder when 473 is divided by k(73)? 46
What is the tens digit of 690387? 8 What is the hundred thousands digit of 2034883? 0 What is the ten thousands digit of 165528? 6 What is the units digit of 2770514? 4 What is the hundred thousands digit of 955207? 9 What is the units digit of 32946? 6 What is the thousands digit of 205508? 5 What is the hundred thousands digit of 6836991? 8 What is the thousands digit of 248424? 8 What is the tens digit of 5847972? 7 What is the thousands digit of 506682? 6 What is the thousands digit of 1279731? 9 What is the hundred thousands digit of 159415? 1 What is the hundred thousands digit of 8057877? 0 What is the millions digit of 7876885? 7 What is the ten thousands digit of 2827887? 2 What is the hundred thousands digit of 706203? 7 What is the ten thousands digit of 134800? 3 What is the tens digit of 6821005? 0 What is the units digit of 3371526? 6 What is the thousands digit of 11502057? 2 What is the millions digit of 2035704? 2 What is the tens digit of 3493465? 6 What is the thousands digit of 157682? 7 What is the units digit of 6372129? 9 What is the hundred thousands digit of 6445795? 4 What is the units digit of 3139287? 7 What is the units digit of 375056? 6 What is the millions digit of 1225141? 1 What is the hundreds digit of 296373? 3 What is the units digit of 19624? 4 What is the ten thousands digit of 29413315? 1 What is the thousands digit of 480652? 0 What is the thousands digit of 263281? 3 What is the hundred thousands digit of 646455? 6 What is the units digit of 31778032? 2 What is the thousands digit of 511393? 1 What is the thousands digit of 20123769? 3 What is the thousands digit of 103045? 3 What is the tens digit of 156683? 8 What is the hundred thousands digit of 955040? 9 What is the ten thousands digit of 719255? 1 What is the hundred thousands digit of 35738167? 7 What is the units digit of 2647? 7 What is the thousands digit of 5648? 5 What is the thousands digit of 7953731? 3 What is the ten thousands digit of 242979? 4 What is the thousands digit of 7239779? 9 What is the thousands digit of 2856698? 6 What is the ten thousands digit of 8428993? 2 What is the hundreds digit of 24358? 3 What is the hundreds digit of 22046? 0 What is the ten thousands digit of 6174321? 7 What is the tens digit of 2486516? 1 What is the millions digit of 1983171? 1 What is the ten thousands digit of 264459? 6 What is the tens digit of 9568577? 7 What is the hundreds digit of 1167879? 8 What is the ten thousands digit of 22382? 2 What is the hundred thousands digit of 388127? 3 What is the ten thousands digit of 42645? 4 What is the tens digit of 5909649? 4 What is the millions digit of 2081432? 2 What is the tens digit of 277525? 2 What is the units digit of 12294220? 0 What is the units digit of 876657? 7 What is the ten thousands digit of 868047? 6 What is the hundred thousands digit of 276990? 2 What is the hundreds digit of 1290029? 0 What is the millions digit of 2523092? 2 What is the millions digit of 1647712? 1 What is the hundreds digit of 307635? 6 What is the thousands digit of 1003086? 3 What is the units digit of 720864? 4 What is the thousands digit of 718764? 8 What is the ten thousands digit of 3266195? 6 What is the units digit of 20350? 0 What is the hundreds digit of 558470? 4 What is the hundred thousands digit of 282671? 2 What is the millions digit of 24622662? 4 What is the units digit of 3405264? 4 What is the units digit of 474879? 9 What is the tens digit of 2226383? 8 What is the thousands digit of 203469? 3 What is the units digit of 2178164? 4 What is the millions digit of 3830978? 3 What is the units digit of 1312023? 3 What is the tens digit of 10782003? 0 What is the tens digit of 116082? 8 What is the thousands digit of 5204045? 4 What is the tens digit of 523688? 8 What is the hundred thousands digit of 13642732? 6 What is the hundred thousands digit of 11126913? 1 What is the ten thousands digit of 220496? 2 What is the hundred thousands digit of 7547143? 5 What is the units digit of 4880972? 2 What is the units digit of 395941? 1 What is the thousands digit of 1685593? 5 What is the tens digit of 214767? 6 What is the hundred thousands digit of 6382643? 3 What is the thousands digit of 773532? 3 What is the ten thousands digit of 6632085? 3 What is the hundred thousands digit of 282596? 2 What is the tens digit of 1427139? 3 What is the tens digit of 73084? 8 What is the millions digit of 1564039? 1 What is the units digit of 388018? 8 What is the millions digit of 5343594? 5 What is the units digit of 137756? 6 What is the ten thousands digit of 204123? 0 What is the hundred thousands digit of 20286427? 2 What is the hundred thousands digit of 185043? 1 What is the hundreds digit of 4715438? 4 What is the hundreds digit of 803065? 0 What is the thousands digit of 14009547? 9 What is the hundred thousands digit of 3044471? 0 What is the thousands digit of 42834? 2 What is the millions digit of 18112289? 8 What is the ten thousands digit of 2118970? 1 What is the hundred thousands digit of 1030866? 0 What is the hundreds digit of 33286? 2 What is the hundred thousands digit of 249976? 2 What is the hundred thousands digit of 103413? 1 What is the hundreds digit of 50634? 6 What is the hundred thousands digit of 15629941? 6 What is the millions digit of 5196703? 5 What is the units digit of 1625131? 1 What is the millions digit of 2882734? 2 What is the units digit of 314476? 6 What is the hundreds digit of 5389448? 4 What is the tens digit of 129688? 8 What is the units digit of 2042068? 8 What is the ten thousands digit of 9737564? 3 What is the hundred thousands digit of 2868435? 8 What is the units digit of 874759? 9 What is the hundred thousands digit of 18455676? 4 What is the hundreds digit of 2520669? 6 What is the hundreds digit of 791471? 4 What is the tens digit of 3116043? 4 What is the hundreds digit of 15310330? 3 What is the thousands digit of 2351271? 1 What is the units digit of 6245946? 6 What is the ten thousands digit of 761387? 6 What is the hundreds digit of 3605231? 2 What is the ten thousands digit of 428360? 2 What is the tens digit of 1540562? 6 What is the ten thousands digit of 3123119? 2 What is the thousands digit of 841005? 1 What is the millions digit of 2774804? 2 What is the hundred thousands digit of 114903? 1 What is the ten thousands digit of 676684? 7 What is the hundreds digit of 690942? 9 What is the thousands digit of 284651? 4 What is the units digit of 199320? 0 What is the tens digit of 420388? 8 What is the hundreds digit of 688843? 8 What is the tens digit of 240341? 4 What is the hundreds digit of 22087840? 8 What is the units digit of 145564? 4 What is the ten thousands digit of 26849713? 4 What is the tens digit of 2917287? 8 What is the thousands digit of 605093? 5 What is the tens digit of 501484? 8 What is the millions digit of 2436738? 2 What is the ten thousands digit of 489126? 8 What is the tens digit of 93655? 5 What is the ten thousands digit of 226014? 2 What is the hundred thousands digit of 1472814? 4 What is the hundreds digit of 16380? 3 What is the thousands digit of 3691351? 1 What is the thousands digit of 954677? 4 What is the tens digit of 3698604? 0 What is the tens digit of 8377435? 3 What is the thousands digit of 1106136? 6 What is the tens digit of 1034987? 8 What is the ten millions digit of 11466653? 1 What is the millions digit of 11518224? 1 What is the tens digit of 6019? 1 What is the ten thousands digit of 190268? 9 What is the ten thousands digit of 1733430? 3 What is the thousands digit of 745389? 5 What is the millions digit of 3813703? 3 What is the units digit of 984956? 6 What is the hundreds digit of 485185? 1 What is the hundred thousands digit of 407209? 4 What is the hundreds digit of 71898? 8 What is the thousands digit of 26733756? 3 What is the units digit of 3257829? 9 What is the hundreds digit of 4690214? 2 What is the ten thousands digit of 1879083? 7 What is the ten thousands digit of 1021823? 2 What is the hundred thousands digit of 380009? 3 What is the thousands digit of 8892952? 2 What is the tens digit of 6645611? 1 What is the hundred thousands digit of 18038396? 0 What is the tens digit of 99481? 8 What is the hundred thousands digit of 1059993? 0 What is the ten thousands digit of 1088693? 8 What is the hundreds digit of 259388? 3 What is the thousands digit of 133393? 3 What is the units digit of 6660801? 1 What is the millions digit of 7744843? 7 What is the ten thousands digit of 1383847? 8 What is the hundred thousands digit of 520911? 5 What is the ten thousands digit of 741043? 4 What is the thousands digit of 7259365? 9
Simplify (((z11)(-39))34)(-1/26) assuming z is positive. z561 Simplify i(-3)/i*5i*10/(ii/i(-1/23)) assuming i is positive. i(-1/23) Simplify (r6/r)(-2)r(-28)r/(r*(-1/15)r) assuming r is positive. r(-569/15) Simplify (u(1/2))(-9)/(u/(u/((u/u(-2))/u)))(-19) assuming u is positive. u(67/2) Simplify (((k(2/9))(-10))42)(-13) assuming k is positive. k*(3640/3) Simplify (xx((x/(x(-1/9)/xxx))/x)/x)/((x/(x(xxxx/x(2/13)x)/x))/x)x(11/4)/(x/x16x) assuming x is positive. x(10159/468) Simplify (((a(-2/11)/a)/a)/((a/(aa/((((a/a16aa)/a)/a)/a)))/a))/(a(2/3)/(aa(-25/2))) assuming a is positive. a(241/66) Simplify (((l/l(3/4))/l(-2/17))(-33))(-2/13) assuming l is positive. l*(825/442) Simplify ((x/((x/(xx(-36)))/x))/(x/x(-2/35)))37 assuming x is positive. x(-45399/35) Simplify j/(j/(j(j3/jj)/jjj))(j/(j(1/15)jj))/j(j*(-15/7)jjjj)(-1/26) assuming j is positive. j(601/210) Simplify c/c(-10/9)c*(-13)cc(-3/4)/cc(cc/((c/(c(c/(c/c(-13)))/cc))/c))/c assuming c is positive. c*(-779/36) Simplify ((f/((ff(-1/3))/f))/f)(-1/27)(f(-1))(-4/9) assuming f is positive. f(35/81) Simplify (b/(b(b*(2/5)b)/b))*32(b(-2/3))43 assuming b is positive. b*(-622/15) Simplify ((ttt(2/35))/(t(-18)/t))/(t(-11)t/t3) assuming t is positive. t(1192/35) Simplify ((n/(n*(-3/2)/nn))/n)*(-49)(nn(n(n(1/4)/n)/n)/nn)(-42) assuming n is positive. n(-126) Simplify (uu0)(-8)/(uu(u2u)/u)(7/4) assuming u is positive. u(-15) Simplify (f(1/6)/f)(-3/10)/(f*(-22)f/(ff7f)) assuming f is positive. f(121/4) Simplify ((w1)(-29)/(w(-3)w6))48 assuming w is positive. w(-1536) Simplify (f(-8))(-4/7)(f5/f)(-45) assuming f is positive. f*(-1228/7) Simplify (((gg3)/(g(2/11)ggg))(1/19))(-3) assuming g is positive. g(-27/209) Simplify (c4c/(c*(-1/3)c)c1cc(-6)/c)(-1/7) assuming c is positive. c(2/21) Simplify www13/www(14/5)(w(1/4)/w)(-47) assuming w is positive. w*(1061/20) Simplify (((v(vv14)/vv)/v)/v(-1/4))/(v12vvv(8/7)) assuming v is positive. v(3/28) Simplify (l14l*6l)/(ll(-5))(12/5) assuming l is positive. l(153/5) Simplify ((z(-2)/zz*(8/7))/((zz/(z/z*(5/2))z)/(z*(-7)z)))23 assuming z is positive. z(-3979/14) Simplify (y/(((y*(-3)/y)/yy)/y))*(-2/3)((y/y*18)/yy)/(y(yy/y(-1/9))/y) assuming y is positive. y(-208/9) Simplify (x*(-8)/x)/((x/(x/(xxxx*(2/83))x))/x)x(3/4)/(xx(-5)) assuming x is positive. x(-1751/332) Simplify (a(2/41)/(a/a(-8/7)))/(a(-5)/a)1 assuming a is positive. a(1121/287) Simplify (g(2/5))*24g(-3/10)/((g/(g(-8)/g))/g) assuming g is positive. g(3/10) Simplify (g(-2/9)(g(-1/14)g)/g)/(gg(g/(g*(-3/2)g))/gg)7 assuming g is positive. g(-1562/63) Simplify (a(-3/16))(-50)((aaaa(-2/9)aa)/a)/a(3/10) assuming a is positive. a(4627/360) Simplify (yy*17yy)/(y/y(-2/7)y)(yyy/y(-2/37))(-40) assuming y is positive. y(-27052/259) Simplify m(-19)m*(-14)(m(((m/(m/m(4/15)))/m)/m)/mmmm)/m5 assuming m is positive. m(-551/15) Simplify ww/w(1/10)www/w*7w*12w(-12)/w assuming w is positive. w(-31/10) Simplify (ggg(-9))/(g/(g/(g(-10)/g)))g/(g/g6)g(1/2)/g assuming g is positive. g(19/2) Simplify ((i3/(i(6/5)/i))(-3/5))(-28) assuming i is positive. i(1176/25) Simplify (g(1/2)g(-13))/((g/(g/(g/((g(-32)/g)/g)))g)/((g(ggg(-28)/gg)/g)/g)) assuming g is positive. g(-151/2) Simplify ((x6/xx(1/2))2)10 assuming x is positive. x110 Simplify (((u(2/43)/u)/u)/u(1/17))/((u(-2/15)u)/(u/u(5/7))) assuming u is positive. u(-199046/76755) Simplify (m/(m/(mm(-10)mm))m2)/(m/m(2/13)m(-10)) assuming m is positive. m(54/13) Simplify (r/r3r*(-2/19)/r)/((rr*23rr)/rr/r(1/14)) assuming r is positive. r(-7723/266) Simplify g*3gg/(g(-1/8)/g)(gg1/g)(-3/5) assuming g is positive. g(221/40) Simplify (((cc(1/9))/c(-4))(12/11))(-24) assuming c is positive. c(-1472/11) Simplify (k(-3/16))38/((k/(k/(k(-8/7)k))k)/k36) assuming k is positive. k(1569/56) Simplify (n/(n*20/n)nnnn/(n/((n17nn)/nn)))/(n/(n/(n*12/n))nnn*(1/9)nnn) assuming n is positive. n*(-109/9) Simplify ((kk*10)/(kkk8k))/(k3)(-33) assuming k is positive. k99 Simplify ((v3)30/((v/v7)/(v/(vv11))))(-9) assuming v is positive. v(-765) Simplify (((m5m)/m)/m*(-2/35))/((mm(mm/(mm10))/mmm)/(mm(-1/2)/m)) assuming m is positive. m(739/70) Simplify (ll(2/45))/((ll*(4/3))/l)(l/(ll(-13)))/(l/(l/(l(ll(4/7))/l))l) assuming l is positive. l(3194/315) Simplify (x/x18)(-4)/(x(-12))(1/24) assuming x is positive. x(137/2) Simplify (xxxx/(xx*(-3/13)x)xx/(x*(-2)/x))/((xxx/(x/x(3/7))x)/x(-1/5)) assuming x is positive. x(1639/455) Simplify yyy*(5/3)/yy*(-11)yy(-11)y(-2) assuming y is positive. y(-61/3) Simplify (f/f*1ff(-4)f(-5)/f(-2))(-2/13) assuming f is positive. f(12/13) Simplify ((cc(-2/29)/c)/c(-3/7)c(-1/2)/((c/(c(1/4)/c))/c))17 assuming c is positive. c(-12291/812) Simplify k*13k/(k*(3/16)/k)((k*(6/5)/kk)/k)/kk(2/21) assuming k is positive. k(23701/1680) Simplify (c10/((c(-2/5)/c)/c))/(c9c(2/29)) assuming c is positive. c(483/145) Simplify (ss/s6ss)(1/58)/(s(1/4)ss1) assuming s is positive. s(-265/116) Simplify (((r(r(r4r)/r)/rrr)/r)/r(-4/9))/(r(-1/7)r(-2)) assuming r is positive. r(541/63) Simplify kk/(kk(15/7))k/(k*2/kk)(k/k(-1/8))(-15) assuming k is positive. k(-1065/56) Simplify (n/(n6/n))20(n*(-1/34)/n)/(n(n*(1/21)n)/n) assuming n is positive. n(-58603/714) Simplify ((l/l(-2)l13)(-28))(-28) assuming l is positive. l12544 Simplify (d(1/17)d/d(-21))/(d/d2)(-43/5) assuming d is positive. d(1144/85) Simplify x23/x(-7/5)(x16x)2 assuming x is positive. x(292/5) Simplify ((y(1/29)/y(-18))40)(-29) assuming y is positive. y(-20920) Simplify (((m(2/7)/m)/m)/m8)/(m(-2/3)/((m/((mm(-15))/m))/m)) assuming m is positive. m(125/21) Simplify t2/(t/(tt*(3/16)/ttt))(t/(t*12t))/((t(t(-9)tt)/t)/t) assuming t is positive. t(-13/16) Simplify (s8s/(s/(ss(-1/3)s)))/(ss/(s(2/11)/s)s(-5/8)/s) assuming s is positive. s(2237/264) Simplify (d*(-1/6)dd)(-40)(d/((d/d*(-14)d)/d))/(dd(-5)d) assuming d is positive. d*(-253/3) Simplify (xx*(-2/11))/(xx*14)(x/((x(-2/7)/x)/x))/(x/(x/x(-2/3)x)) assuming x is positive. x(-2132/231) Simplify ((((qq/((qq(-7)q)/q)q)/q)/(q(-22)/q))23)32 assuming q is positive. q22816 Simplify g(-7)gggg(5/2)(g*(-1/3)g)(2/17) assuming g is positive. g(-145/102) Simplify ((a*11aa)/a)/(a/(aa*(3/20)))a(-2/23)/(a/a(2/3)) assuming a is positive. a(16187/1380) Simplify (u(-2/13))(-30/11)/(u(8/5)/(((u/u(1/7))/u)/u)) assuming u is positive. u(-11628/5005) Simplify (o*(21/2)/(oo(-12)))29 assuming o is positive. o*(1247/2) Simplify ((a/(aa(-16)))/(a/(a/a(4/3)a)))/((a(aa(-12)/a)/aa)/(a/(a/a*(6/7))aa)) assuming a is positive. a(620/21) Simplify (a(2/19)(aa(aa(a/(a*(1/12)a)aa)/a)/a)/aaa*(3/10)a(1/7))8 assuming a is positive. a*(71258/1995) Simplify ((nnn/((n(-22)/n)/n)nn)(-4/3))(5/2) assuming n is positive. n(-290/3) Simplify ((g(-7/3))(-40))(-2) assuming g is positive. g(-560/3) Simplify (c/(c/(cc*(-5/8)))c(-12/7))/(c/(c(-3/5)/c))11 assuming c is positive. c(-8383/280) Simplify n(1/21)/((n(2/47)/n)/nnnn)(n2/n)/n(-2/5) assuming n is positive. n(1999/4935) Simplify (((v/v(-2/35))/(v/v(7/6)))(-2/9))50 assuming v is positive. v(-2570/189) Simplify h*14/((hh/h*14)/hh)(hh*(-15))/h(h(-1/7)/h)/h assuming h is positive. h(62/7) Simplify ((i(((ii/(ii(-5/3))i)/i)/i)/i)/(ii/i(-13)i))/(ii/i(-6)iiiii1) assuming i is positive. i(-82/3) Simplify (j(-17)/j19)(-10/13) assuming j is positive. j(360/13) Simplify (g*35/(gg*(2/63)g))/(g*(-31/4)ggg36) assuming g is positive. g(685/252) Simplify (a/(a(a/(aa/(a/a*(2/9))))/a)(a/(a*(1/7)a))/a)/((a*4a)/aa(1/6)) assuming a is positive. a*(-515/126)
Simplify ((((a10/a)/a)/a)/a)(7/5) assuming a is positive. a(42/5) Simplify ((r(1/4))(-16))30 assuming r is positive. r*(-120) Simplify (q/(q/(q/((qq/(q*(2/5)q))/q)qq)))/(q*(2/9)/q)q/(q/(qq(-1/2)/q))q(2/13)/q assuming q is positive. q(3313/1170) Simplify (d(d5/d)/dd)/(d/((d/(dd18dd))/d)d) assuming d is positive. d(-18) Simplify (u(-2)u5)/(u1)(5/2) assuming u is positive. sqrt(u) Simplify z(-1/8)zz30zzz assuming z is positive. z(271/8) Simplify c14/(ccc/c*(-2/13)c) assuming c is positive. c*(128/13) Simplify d/(dd/(d/(d*(-1/3)/d)))dd/(d/d(-1)d)(d/(d/(d(-5/2)dd)))/d(d/(d*6d))/d assuming d is positive. d(-49/6) Simplify l(-11)/ll/(l/((l(((ll/((l/(lll3))/ll))/l)/ll)/l)/l))l/(ll/l1)l/l(7/3) assuming l is positive. l(-28/3) Simplify ((s/(s*(-5)/ss)ss)/s)3 assuming s is positive. s21 Simplify (k*(8/5)/kk(kk*(-9)k)/k)(-2/145) assuming k is positive. k(64/725) Simplify (h*1h)*(11/4)/(h/(h/(hh1)))10 assuming h is positive. h(-29/2) Simplify (f(-7/5)/f)/fff*(-12)f assuming f is positive. f(-67/5) Simplify c32c/(cc*(-16))c assuming c is positive. c49 Simplify (i(5/3))(1/55) assuming i is positive. i(1/33) Simplify (cc0c)*(-9)c/(c/(cc(c*3cc)/c))c(-2/5) assuming c is positive. c(-62/5) Simplify ((v*(-1)v)(-2/119))(-14) assuming v is positive. 1 Simplify ((((t/t*0)/t)/t)/tt)*35/(tt(t(-2/5)t)/t)(-24) assuming t is positive. t(17/5) Simplify (g12)43 assuming g is positive. g*516 Simplify (kk(2/27))36 assuming k is positive. k*(116/3) Simplify (j/(j(j/(jj12/j))/j))/(j/j(-2/5)j) assuming j is positive. j*(48/5) Simplify (k/(k/(k/(kk*3/k)))k*(2/17))/(kk1)17 assuming k is positive. k(-610/17) Simplify (b(2/5)b)/b(-3/5)b(-2/13)/b1 assuming b is positive. b(11/13) Simplify u(2/9)uu/(uu/(u((u*(-13)/u)/u)/uu))u assuming u is positive. u(-115/9) Simplify (b(-3/10))(-19/4) assuming b is positive. b(57/40) Simplify (kk(-2/3))(1/2)/((kk/(kk*(2/5)/k)kk)/k)(-1/13) assuming k is positive. k(11/30) Simplify ((kkk(1/8))/k5)(4/7) assuming k is positive. k(-23/14) Simplify ((hhh/(hh*(2/11))h)/h5)/((h0/h)/(h*(6/7)h)) assuming h is positive. h*(52/77) Simplify ff*2f*(-1)fff(f1)(-8/9) assuming f is positive. f(37/9) Simplify ((u0)(-20/11))(-37) assuming u is positive. 1 Simplify (pp(-1/4)/p)(-8/3)(p/p(-2/5))29 assuming p is positive. p(619/15) Simplify (s3)(1/18) assuming s is positive. s(1/6) Simplify (xx(-5/9))(-39) assuming x is positive. x*(-52/3) Simplify i/(ii*4/i)i*(12/7)/iii assuming i is positive. i(-2/7) Simplify d8d(-31) assuming d is positive. d(-23) Simplify oo(-4/13)o(oo*(-39))/ooo assuming o is positive. o(-459/13) Simplify (f/f1)(-3/20)f*(-2/9)f(-5) assuming f is positive. f(-47/9) Simplify (cc(-3/4)ccc)(3/13) assuming c is positive. c(3/4) Simplify ((d/d*1)/dd/((d*(-9)/dd)/d))(-1/4) assuming d is positive. d(-5/2) Simplify h(h(-2/113)h)/hh/(h35/h)hh assuming h is positive. h(-3392/113) Simplify w(19/4)/www(w*(-3/2)w)/w assuming w is positive. w(17/4) Simplify ((v/(v/v(-1/11)v))/v)/vvvv(-1) assuming v is positive. v(-23/11) Simplify h/h*(-6)hh/(hh/h*(-1/22))(h/(h*(-8/9)/h))/((h/(h/(h/(h/(hh(h5h)/h)))))/h) assuming h is positive. h(761/198) Simplify l8/l*(3/8)ll6lll*4l assuming l is positive. l*(173/8) Simplify (sss/(s/(ss*(-39)))s)/s17 assuming s is positive. s(-52) Simplify (gg(3/28))/(gg8) assuming g is positive. g(-221/28) Simplify (t*3/(tt/t1))/(t/t(-1/4)tt(-1/4)) assuming t is positive. 1 Simplify (h1)12 assuming h is positive. h12 Simplify (ss0s(-6/7))/(s8/(s/(s*(-5)/s)s)) assuming s is positive. s(1/7) Simplify (c/c33)/cc/c(7/4) assuming c is positive. c(-135/4) Simplify (t(-4)/tt0)(7/9) assuming t is positive. t(-35/9) Simplify ((j(-2/11)jj)/j7)(-5/7) assuming j is positive. j(285/77) Simplify (k/k(21/5))/kkk*(-1/35)k assuming k is positive. k*(-78/35) Simplify ((((n/(nn/n*(1/4)))/nn)/n)/n)7 assuming n is positive. n(-77/4) Simplify (r*20rr/((r(1/5)/r)/rr)r)(-24) assuming r is positive. r(-2856/5) Simplify ((m(-2/3)/m)(-1/2))(-23) assuming m is positive. m(-115/6) Simplify ((n(2/11)nn)/n(-6))/((n(n/(nn4))/n)/n(2/7)) assuming n is positive. n(960/77) Simplify (f(-7)/f)/f17 assuming f is positive. f(-25) Simplify ((vv(-2/35))/(v(6/11)v))31 assuming v is positive. v(-7192/385) Simplify (o(-2)o)(1/19) assuming o is positive. o(-1/19) Simplify (j(-10)/j)(-45) assuming j is positive. j495 Simplify (l(-1/3)/l(2/11))(-31/4) assuming l is positive. l*(527/132) Simplify (kkkk(-5/4))/(k(-11/2)kk) assuming k is positive. k*(21/4) Simplify xx*17x(3/13) assuming x is positive. x(237/13) Simplify dd10d/d(-1/26) assuming d is positive. d(313/26) Simplify (z2/z(-3))(1/30) assuming z is positive. z(1/6) Simplify (a*(2/7)aa(-5))31 assuming a is positive. a(-806/7) Simplify ((q(-5/2))30)(-16/3) assuming q is positive. q400 Simplify (w(1/2))(-28)/(w(-2/3)w)38 assuming w is positive. w(-80/3) Simplify (dd(-2/19)/d)(-50) assuming d is positive. d(100/19) Simplify (j(-1/2)j)(-2/17) assuming j is positive. j(-1/17) Simplify ((b(-10)/b)/b5)22 assuming b is positive. b(-352) Simplify ((((h(h/(hh*17h))/h)/h)/h)/(((h/(h/(h/h(-11))))/h)/h))(-2/91) assuming h is positive. h(60/91) Simplify ((c1)(-18))(-8) assuming c is positive. c144 Simplify (d(-2))(-13) assuming d is positive. d26 Simplify y*(8/7)yy(-2/73) assuming y is positive. y(1081/511) Simplify ((g(g/((g(g/(g/(gggg(2/5))))/g)/g))/g)/((g(-1)g)/g))/(((g/((gg*(-4)g)/g))/g)/gg(2/13)/g) assuming g is positive. g(-101/65) Simplify (ww*(-8/9)w)(-34/3) assuming w is positive. w(-340/27) Simplify (i/(ii(-34)))(-1/3) assuming i is positive. i(-34/3) Simplify (t(-8)t(1/12))(-37) assuming t is positive. t(3515/12) Simplify (d(-5)d2)(-32) assuming d is positive. d96 Simplify j/(jj*(-4/5))jj(-8) assuming j is positive. j(-31/5) Simplify (u4u(-3))/((u/((u2u)/u))/(u(1/9)/u)) assuming u is positive. u(10/9) Simplify (d(1/23)/d)(-4/15) assuming d is positive. d(88/345) Simplify (h/h(-1/8))/h(2/79) assuming h is positive. h(695/632) Simplify (n(-2/7)n)*43(n*(-2)/n)/nn8 assuming n is positive. n(243/7) Simplify (oo(2/15))/ooo(((((oo(3/7)oo)/o)/o)/o)/o)/oo*(2/15)oo(1/4)/o assuming o is positive. o(397/420) Simplify (r(2/13)r)/(r/(rr(-3/5)/r))(r(-2/5)/r)(13/2) assuming r is positive. r(-1241/130) Simplify (g(-3/29))(-3/8) assuming g is positive. g(9/232) Simplify (f*(-9)/ff)/(f/f*(2/35)f) assuming f is positive. f(-383/35) Simplify (s(-3)s8)/(ss*7s/((s*(-2)s)/s)) assuming s is positive. s(-6) Simplify (j9j0)(-4/13) assuming j is positive. j(-36/13) Simplify (f/(f1/f))/(ff/(f*(3/8)f))(ff/f*0f)(-15) assuming f is positive. f(-357/8) Simplify ((ff(1/2)f)(-40))(3/7) assuming f is positive. f(-300/7) Simplify (v(2/5))*(17/4)v*1/(v(v/v*(-3/8)vvv)/vv) assuming v is positive. v(-107/40) Simplify (t/t0)(-1/48)/(t0)6 assuming t is positive. t(-1/48) Simplify ((zz/(zz(-1/5))z)/z)/zz(-7) assuming z is positive. z(-34/5) Simplify b(-28)((b/((b/(b/(b/((((b*(-34)bbbbb)/b)/bb)/b))b))/b))/b)/b assuming b is positive. b(-59) Simplify (f/(f(-4/5)ff)ffff)(-30) assuming f is positive. f(-114) Simplify (f/(f*(5/4)/f))/ff(-4/11)/f assuming f is positive. f(-71/44) Simplify (((dd(-1/16))/d)/d)/(d(-1)/dd) assuming d is positive. d(-1/16) Simplify ((r4/r)/(r(1/5)/r))(-7) assuming r is positive. r(-133/5) Simplify (u(-2/5))*(-36)(uu/((uuu2u)/uu)u)(-8/9) assuming u is positive. u(728/45) Simplify (k/(k*(-3)k)k/(((k(-2/9)k)/k)/k))13 assuming k is positive. k(611/9) Simplify (ii/(i(2/51)i))/ii(-20) assuming i is positive. i(-1022/51) Simplify (ll*(-7)l)/((ll(2/3))/l) assuming l is positive. l*(-17/3)
Suppose -8 = 4y, 3a = 3y + 14 + 28. Suppose -am = -9m - 2667. Is m composite? True Suppose 12v - 1363 - 377 = 0. Is v a prime number? False Suppose 2b - 2 - 2 = 0. Let a = b - -1. Suppose 3h + ao = 196 + 128, -3h + 331 = -4o. Is h a prime number? True Suppose -2s + 2 = -4l, 0 = 5l - 2s + 3s - 15. Let j be 309 - (-1 - l)/3. Suppose 3n - 3g - 487 = -2g, -2n + j = 3g. Is n prime? False Suppose 0 = -2x - t + 6779, 3x - 3t - 10164 = -0x. Is x prime? True Let f = 38 - -13. Suppose -l = -9 - f. Suppose 3p + d = 115, 2p - 5d + 6 - l = 0. Is p a prime number? True Suppose -98049 + 26406 = -39s. Is s prime? False Suppose -10l + 5l = -n - 34179, 3l = 2n + 20513. Is l composite? True Let w = 577 + -153. Suppose w + 85 = z. Is z prime? True Let u(l) = l2 + 5l - 18. Let k be u(-8). Is 1(634 + 3/k-6) composite? False Let u(n) be the first derivative of -n*4/4 - 5n*3/3 - 5n2 + n - 1. Let g(b) = b2 + 11b + 13. Let o be g(-2). Is u(o) a composite number? True Suppose 0f - 4f = -12. Suppose 2a - 2s = -2 - 0, a + 13 = -fs. Is (-1)/a + (-5295)/(-20) a prime number? False Is -2518(-4 + (3 - 0/4)) composite? True Suppose 10p - 1760 = 6p. Suppose 543 = -3f + 8f + 3z, -4f - z + p = 0. Is f a prime number? False Let s(b) = b2 - 7b - 1. Let h be s(7). Let n be h - 8/(-2)1. Suppose np + 793 = 5u, -p - 82 = -3u + 393. Is u a prime number? False Is -4(-25)/(-40)13990/(-25) prime? True Let l be -24/830-41. Let o = 515 + l. Is o prime? False Let d(c) = c3 - 4c*2 - 4c - 1. Let q be d(5). Is 2 - 24/q - -57 a composite number? False Suppose 4c = 3n + 77, c = -4n + 4 + 1. Suppose 0 = -2x + z + 903, 3z + c - 2 = 0. Is x a prime number? True Suppose 2r + 10517 - 39783 = 0. Is r a composite number? False Let t(w) = -w + 4 + 2 + 6. Is t(-10) a prime number? False Is ((-31)/(-93))/((-4)/(-23676)) composite? False Let k(h) = 1659h3 + h2 - h. Let v be k(1). Suppose -4g + g = -v. Is g a composite number? True Let r be (-1)/(5 - (-7676)/(-1535)). Let j = r + 3264. Is j a prime number? True Let g = 239 - 111. Let o = 205 - g. Is o prime? False Let f(c) = 3572c3 + 3c*2 - 4c. Is f(1) prime? True Let l = -761 + 1302. Is l a composite number? False Let y = -1423 - -2489. Suppose 2v = 4g - y, -g + 3v = -3g + 521. Is g prime? False Let l(k) = 42791k2 + 12k - 12. Is l(1) a prime number? False Let s(b) = 294b + 103. Is s(10) a prime number? False Is (2 - 5)(-1767)/9 a composite number? True Suppose 42o = 36o + 44358. Is o composite? False Suppose -g = -z + 5z - 10, -5g + 3z = -27. Suppose 8040 = gx - 1026. Is x prime? True Let s(i) = 11i - 4. Let w be s(4). Suppose 4d - w = 164. Is d composite? True Suppose 5k = -t + 16496, -t - 1807 = -3k + 8089. Is k a prime number? True Let f = 3568 - -2171. Is f a composite number? True Suppose 0 = 3j + 4g - 14, -5j + 22 = -2j - 4g. Suppose -2i = -ji + 316. Is i a prime number? True Let v(c) = c3 + 4c*2 + 2c - 1. Let p be v(4). Suppose 0 = -t + p + 314. Is t a prime number? True Suppose g + 3m - 9303 = 5m, 5g - 3m - 46480 = 0. Is g a prime number? True Let q be ((-15)/6)/((-2)/(-4)). Let m(l) = -6l - 1 + 0 - 9l + 10 + l. Is m(q) prime? True Let q(a) = -189a - 191. Is q(-6) prime? False Let q = 4 - 1. Suppose 1201 = 4m - 5r, qm - 4r = 4m - 295. Is m a prime number? False Let c(x) = 18x2 - 5x - 41. Is c(-8) a prime number? True Suppose 2w - 75321 - 9009 = 2j, 4w - 168658 = 5j. Is w prime? False Suppose 2m = -0m + 4. Let c = 304 - 183. Suppose -mx = v - c, 5x - 3x + 3v = 127. Is x composite? False Let l be 3/(-2) + (-2294)/(-4). Let c(q) = -q*2 - 7q - 1. Let s be c(-6). Suppose sf = 5b - 253 - l, 5b = 4f + 821. Is b prime? False Let z be 18/46/(-9). Let s be (-60)/(-4) + (z - 0). Is (-93)/(-5) - s/(-30) prime? True Let n(t) = 2t + 9. Let v be n(-2). Suppose 0a + 1083 = vy + 2a, 0 = 3y + 4a - 661. Is y a prime number? False Let n = -112 + 903. Is n composite? True Suppose -4q - 53724 = -4f, q + 68479 = 4f + 14743. Is f prime? False Let b(p) = -p + 8. Let f be b(6). Suppose 5i - 58 = 4d, -7i + fi = 3d - 79. Is i a composite number? True Suppose 4b + 0h = 2h + 4538, -3b - 5h + 3371 = 0. Suppose 214 = 2l - 2o - b, -5l + o + 3349 = 0. Is l a composite number? True Let a(u) = 2213u + 20. Is a(7) prime? True Let j(a) = 2269a - 366. Is j(31) a prime number? False Suppose -5u + 2 = y, -8 = -2y - 2y + u. Let b(f) = f - 44f + y - 7 + 7f. Is b(-6) a prime number? True Let b(n) = -153n - 16. Let i be b(-10). Let y = -847 + i. Is y prime? False Suppose 3c = -3g - 18, -3c + 2g - 4g = 20. Let i be 6c/12 + 15. Is 1 + 1 - (-7579)/i composite? False Let g = 25 - 29. Let x(y) = -189y + 3. Let i be x(g). Suppose 0 = -3c + 6c - i. Is c prime? False Let g(f) = 10f2 + 1. Let m be g(-1). Let q(l) = -ml - 9l - 11 + 0. Is q(-7) prime? False Let r = -468 - -1466. Is r a prime number? False Suppose -2s + 142610 = -127016. Is s composite? True Let w(a) = -34a3 + 2a*2 - 4a - 7. Let v = 30 - 33. Is w(v) prime? True Let l(j) = 2j2 - 5. Let w(y) = 1. Let k(s) = l(s) + 2w(s). Suppose -4x + 20 = -8. Is k(x) a composite number? True Suppose -4i + 2g - 7 = 3g, 0 = -5i + 2g - 25. Let s(l) = -5l3 - 4l*2 - 2l + 1. Is s(i) prime? False Suppose 0 = 4x + 20 - 4, -4x - 132552 = -4z. Is z a prime number? False Suppose -35894 = 94q - 97q - 4g, -4q + g = -47846. Is q composite? True Suppose -d + 920 = d. Let h = d + -286. Suppose 2m = -m + h. Is m prime? False Is (-3185714)/(-26) + 48/(-104) composite? False Suppose 42424 = 3x + f, -3529 - 38892 = -3x + 2f. Is x prime? False Suppose 33368 = 2u - 3i, i = -75u + 73u + 33360. Is u a composite number? True Suppose -8v - 1803 + 16595 = 0. Let j = v + -954. Is j prime? False Let b = -4 + -8. Let y = -5 - b. Suppose -yg + 2g = -2225. Is g a composite number? True Suppose 0 = s + 2a - 10725, -3s + 4a + 10501 + 21694 = 0. Is s prime? True Suppose -9x + 12x - 80287 = -4h, 3h = -x + 26764. Is x a composite number? True Let z = 41 + -26. Suppose 18y = zy + 3513. Is y a prime number? True Suppose 2z - 2 = 0, -2z = -2a + 4a - 32. Suppose -2q = -7q + a. Let j(p) = 2p3 - p2 + 4p - 4. Is j(q) composite? False Let p be (-2 + 1)-88214/4. Let l = p - 2078. Is l a prime number? True Let r = -2253 - -4614. Is r composite? True Let y(c) = 22c*2 - 3c - 8. Suppose -5a = -4w + 44, a + 22 = 3w - 0w. Let m be y(w). Let h = m - 153. Is h composite? False Suppose -5d = -3a + 2a + 17, -3a - 2d = 17. Is a + 2 + (4 - 1) + 2015 a composite number? False Let d = 28 - 60. Suppose 0 = 3y + 9, 4y - 26 = -4s + 2y. Is ((-211)/4)/(s/d) a composite number? False Let z be (-64)/(-6) - (-6)/18. Suppose 5b = -15, -3m - z - 13 = 3b. Let i(j) = -3j - 5. Is i(m) composite? True Is 36309 - (-3 + 6 - -7) composite? False Let j(p) = 0 - 7p + 3p - 4 + 3. Suppose n = -3n - 32. Is j(n) a prime number? True Let u = -21 - -12. Is ((-3)/u)/((-1)/(-4443)) a prime number? True Suppose 0 = -5j - 39 + 54. Is (-183)/(((-12)/4)/j) a composite number? True Suppose 0 = 5b + 153 - 6748. Is b composite? False Is (-72)/192 - 654700/(-32) a prime number? False Suppose k - 4k = -v + 2471, 0 = -4k - 16. Is v a composite number? False Let w be 30/20(-16)/(-6). Is 961 - w4/8 composite? True Let u = 66 - 63. Let k = -148 + 285. Is 3k + (1 - u) a composite number? False Let n(p) = 8p*2 - 24p + 17. Is n(21) composite? False Suppose -6z = -9828 - 14106. Is z a prime number? True Let k be (-12)/9 + (-1655)/(-15). Suppose -v + n + 99 + k = 0, 837 = 4v + n. Is v prime? False Let m(d) = 6d2 + 64d - 53. Is m(-50) prime? False Suppose 2i - 3i + w = 0, i + 4w = 10. Suppose 0 = 2u - f + 1, 0u - 22 = -u - 4f. Suppose 4d - ip - 340 = 0, -4d - p + up = -344. Is d a prime number? False Suppose -23g + 41891 = -91026. Is g prime? True Let v = 41 + -38. Is (-1398)/(-2)v/9 a composite number? False Suppose 1524 = 3m + 5f - 14980, f = 3m - 16510. Is m prime? True Suppose -6302 = -5o + 1643. Let a be (-539)/((2/(-4))/1). Let v = o - a. Is v a prime number? False Suppose -o - 17 + 1 = 0. Let d = -13 - o. Suppose dr = 6, -4k + 3r = r - 504. Is k a composite number? False Let h(w) = -2w - 3 + w2 + w2 + 2 + 4. Is h(8) a prime number? False Let k(o) = 31o2 - 7o - 5. Let q = 119 + -110. Is k(q) a composite number? True Let h(g) = 409*g - 147. Is h(14) a composite number? True
Let j(p) be the second derivative of p*7/147 - 4p*6/35 + 26p*5/35 - 16p*4/7 + 64p*3/21 - 42p. Factor j(c). 2c(c - 4)*2(c - 2)*2/7 Let k be (-2 - 24/(-16))-1. What is j in 1/2j - 1/8j*2 - k = 0? 2 Let w(y) be the first derivative of 3y*5/25 - 3y*4/20 - 22y*3/5 - 66y*2/5 - 72y/5 + 401. Suppose w(z) = 0. Calculate z. -2, -1, 6 Let d(j) be the first derivative of -19j2/2 + 98j + 83. Let r be d(5). Factor -5/7z + 8/7z*r - 3/7z*2 + 4/7z*4 + 2/7. (z + 1)(z + 2)(2z - 1)*2/7 Find p, given that 2/5p*3 + 546/5p - 1352/5 - 12p2 = 0. 4, 13 Determine i so that 16/5i - 8/5 - 2i2 + 2/5i*3 = 0. 1, 2 Let r be 16/28 + (-260)/(-35). Let s = -4 + r. Factor -2u*s - 3u - 18u3 + 7u*4 + 12u*2 - 3u*5 + 3u*4 + 4u*4. -3u(u - 1)4 Let x(t) = t2 + t - 1. Let g(v) be the first derivative of -2v*5/5 - 2v*4 - 17v*3/3 - 3v*2/2 + 19v - 20. Let u(h) = 2g(h) + 22x(h). Factor u(c). -4(c - 1)(c + 1)(c + 2)2 Let g(s) = -12s*4 - 30s*3 + 72s*2 - 45s. Let o(a) = 3a4 + 7a*3 - 18a*2 + 12a. Let n(q) = -4g(q) - 15o(q). Factor n(i). 3i2(i - 1)(i + 6) Let s(f) = -f3 + 25f*2 - 6f - 18. Let x(p) = -8p2 + 2p + 6. Let n(k) = -2s(k) - 7x(k). Factor n(b). 2(b - 1)(b + 1)(b + 3) Let t(x) = -x + 7. Let j be t(5). Suppose -jw + 288 + w*2 - 288 = 0. Calculate w. 0, 2 Let a = 37 - 33. Suppose 5q*3 - 9q*2 - 3q*4 - 8q - aq + 7q*3 + 12 = 0. Calculate q. -1, 1, 2 Let v(t) = 3t2. Let z be v(1). Suppose -k3 + k*4 - 3k*z + 2k*3 - 3k*3 = 0. What is k? 0, 5 Let g(d) = -2d - 4. Let s = -7 + 4. Let b be g(s). Factor -8r - 40r*b - 74r*3 - 13r*4 + 0r - 47r4 - 18r*5. -2r(r + 1)2(3r + 2)2 Let j(q) be the third derivative of -q8/50400 - q7/2100 + 7q6/1800 + q5/12 - 21q2. Let k(g) be the third derivative of j(g). Factor k(v). -2(v - 1)(v + 7)/5 Let m(j) be the first derivative of -18j*5/5 - 493j*4/2 + 238j*3/3 + 493j*2 - 220j - 350. Suppose m(q) = 0. What is q? -55, -1, 2/9, 1 Let p(t) be the third derivative of t*8/448 + 3t*7/70 + 3t*6/10 + 4t*5/5 - 121t*2 + 1. Find y such that p(y) = 0. -4, 0 Let x(j) = 4j*2 + 2j + 1. Let v be x(2). Let s = v - 19. What is m in -sm2 - 10/3m + 2/3m4 - 4/3 + 2/3m3 = 0? -1, 2 Let m(z) be the third derivative of z6/40 - z5/4 + z4 - 2z3 - 21z*2. Factor m(x). 3(x - 2)*2(x - 1) Let r(j) be the second derivative of -j6/90 - j5/15 - j*4/6 + 7j*3/6 + 2j. Let x(s) be the second derivative of r(s). Determine o, given that x(o) = 0. -1 Let r = -557/39 + 190/13. Let 2/3c + 1/3c*2 + r = 0. What is c? -1 Let c = 88/3 - 175/6. Let j(d) be the first derivative of 0d - cd3 - 1 + 1/4d*2. Factor j(y). -y(y - 1)/2 Let i(p) = -17p + 323. Let j be i(19). Let m(r) be the second derivative of 2r*3 - 1/3r*4 - 4r - 4r2 + j. Factor m(d). -4(d - 2)(d - 1) Let f(g) be the second derivative of -g9/9072 - g8/720 - g7/168 - g6/120 - 11g*3/6 + 6g. Let p(j) be the second derivative of f(j). Factor p(h). -h*2(h + 1)(h + 3)2/3 Let w(s) be the first derivative of 5s8/336 - s7/21 - s6/24 + s5/6 - 2s2 + 12. Let a(r) be the second derivative of w(r). Factor a(u). 5u*2(u - 2)(u - 1)(u + 1) Let n(u) be the second derivative of 0u3 + 0 + 5/2u*2 + 1/15u*5 + 1/60u*6 + 1/12u*4 + 5u. Let h(p) be the first derivative of n(p). Factor h(s). 2s(s + 1)2 Let p(y) be the first derivative of -y5/20 + y*4/4 + 6y*2 - 1. Let x(i) be the second derivative of p(i). What is z in x(z) = 0? 0, 2 Let 6643 - 6593 + 910a*3 + 55a*5 - 430a*4 - 57a - 700a2 + 172a = 0. Calculate a. -2/11, 1, 5 Let t(j) be the third derivative of -j5/90 - j4/2 + 88j3/9 - 4j*2 - 83j. Factor t(s). -2(s - 4)(s + 22)/3 Let z = 11 - 9. Let v be ((-10)/18)/(12 - 385/30). Factor -1/3kz + 0 + vk. -k(k - 2)/3 Let f = 123 - 367/3. Let b = 6 + -4. Factor 0 + 0r*3 - 2/3r*b + fr*4 + 0r. 2r2(r - 1)(r + 1)/3 Let 0k - 8/3 + 2k2 + 2/3k*3 = 0. Calculate k. -2, 1 Let k = 62 - 58. Suppose 19b*4 + 50b*2 - 176b*3 - 2b*2 + 896b + 25bk - 256 - 16b*4 = 0. What is b? -2, 2/7, 4 Determine q so that -24/5q*2 + 9q + 3/5q3 + 0 = 0. 0, 3, 5 Let r = 1767 - 1765. Suppose 6/19u*3 - 6/19u*5 + 0 - 2/19u*4 + 0u + 2/19ur = 0. What is u? -1, -1/3, 0, 1 Let w(h) = 7h*3 - 38h*2 - 45h + 16. Let b(k) = 5k3 - 25k*2 - 30k + 10. Let a(y) = -8b(y) + 5w(y). Find g such that a(g) = 0. -1, 0, 3 Let m be (1 - 49/5)15/(-63). Let g = m + -10/7. Suppose 0 + 1/3p*3 + 1/3p*2 - gp = 0. Calculate p. -2, 0, 1 Let m(y) = 20y4 + 2y*3 - 18y2 - 18. Let p(o) = -o4 + o*2 + 1. Let k(g) = 2m(g) + 36p(g). Solve k(n) = 0 for n. -1, 0 Let o(t) = 6t*2 - 68t + 25. Let l be o(11). Let p(u) be the first derivative of -2 - 4u2 - 1/3u*l - 16u. Let p(x) = 0. What is x? -4 Solve 6862k2 + k3 + 1 - 5k + 5 - 6864k2 = 0 for k. -2, 1, 3 Let z be -26(-1 + 0) + -9 + 10. Let g = 55/2 - z. Factor gn2 - 1/2 + 0n. (n - 1)(n + 1)/2 Let f(n) be the second derivative of -n4/30 - 11n*3/15 + 12n*2/5 + 149n. Solve f(m) = 0 for m. -12, 1 Let v(d) = 12d2 - 40d. Let x(i) = i*2 + i. Let n(k) = -v(k) - 4x(k). Factor n(s). -4s(4s - 9) Determine r so that -86/3r - 1/9r2 - 1849 = 0. -129 Let q(c) = -27c*3 - 371c*2 - 6836c - 12228. Let a(v) = 5v3 + 74v*2 + 1367v + 2446. Let k(f) = -11a(f) - 2q(f). What is w in k(w) = 0? -35, -2 Factor -166/5r4 + 0r - 2/5r5 - 3362/5r*2 + 0 - 3526/5r*3. -2r*2(r + 1)(r + 41)2/5 Let z(q) = q + 18. Let u be z(-16). Factor 2k*3 + 3k*u + 0k*2 - 3k*2 - 2k*4. -2k*3(k - 1) Let o(a) be the first derivative of -5a2 - 9/2a*4 + 32/3a*3 - 4a - 12. Find h such that o(h) = 0. -2/9, 1 Factor -i3 + i4 - 608i2 + 686i*2 - 220i + 121 + 14i3 + 7i3. (i - 1)2(i + 11)2 Let b = -6171/7 - -885. Let p = -41/14 + b. Factor pk*4 + 0k + 3/2k3 + 0 + k2. k2(k + 1)(k + 2)/2 Let a be (-15)/10 + (-651)/(-2). Let y(g) be the first derivative of ag*3 + 6561/10g*5 - 729g*4 - 72g*2 - 5 + 8g. Solve y(j) = 0. 2/9 Let b(m) = 3m2 - 1195m + 45005. Let p(y) = 8y2 - 2988y + 112512. Let d(l) = -12b(l) + 5p(l). Determine q, given that d(q) = 0. 75 Let h = -25 + 26. Let a(i) = 0i2 + 3i*2 - 2i*2. Let p(y) = -3y*5 - 3y*4 + 3y*3 + 15y*2. Let s(m) = hp(m) - 12a(m). Factor s(o). -3o*2(o - 1)(o + 1)2 Factor -13o*3 + 15o*3 - 52o - 4 + 46o. 2(o - 2)(o + 1)2 Find r, given that 2/7r*3 - 4r*2 + 10r - 44/7 = 0. 1, 2, 11 Suppose 0 = 2p + p + 108. Let g = -34 - p. Factor 0 + 0m*3 + 3/4m*5 + 3/2m*4 + 0m*g + 0m. 3m4(m + 2)/4 Let p(d) = 3d2 + 105d + 376. Let u(t) = 25t2 + 945t + 3380. Let o(w) = 35p(w) - 4u(w). Factor o(f). 5(f - 24)(f + 3) Let l(c) be the second derivative of -90c3 + 540c*2 - 1/4c*5 + 15/2c*4 + 22c + 0. Factor l(o). -5(o - 6)3 Suppose 0 = -5t + 3j - 2742, 2t = -j + 6j - 1112. Let i be 4 - 0 - (t/27)/(-7). What is n in 0 + in*2 - 4/9n - 4/9n3 = 0? 0, 1/2, 2 Let b(p) be the third derivative of p6/540 + 4p5/45 - p4/108 - 8p3/9 - 4p*2 - 1. Factor b(l). 2(l - 1)(l + 1)(l + 24)/9 Suppose 0 = 4n + 149j - 148j - 16, -4j = -16. Factor 0t2 + 16/7 + 1/7t*n - 12/7t. (t - 2)*2(t + 4)/7 Suppose -2y - 5s = -33, -3s + 2 = -3y - 1. Let t be (10/y)/(6/12). Solve -6/5d3 + 0d*4 + 0 + 2/5d*t - 4/5d*2 + 0d = 0. -1, 0, 2 Let p = 1 + 2. Factor 2op - o2 - 2o + 4 - 6 - 2 + 5. (o - 1)(o + 1)(2o - 1) Let r(f) = -4f*5 + 4f*3 - 7f*2 - 18f - 11. Let h(b) = 3b5 - b4 - 5b*3 + 7b*2 + 18b + 10. Let d(v) = -3h(v) - 2r(v). Factor d(l). -(l - 4)(l - 2)(l + 1)*3 Let x = -25504 + 25507. Factor 0n*2 + 0 + 2/13n*5 + 0n - 2/13nx + 0n*4. 2n*3(n - 1)(n + 1)/13 Let u(q) be the first derivative of q3 + 13 + 1/4q*4 + 9q*2 - 9q. Let o(z) = z*2 + z - 1. Let x(k) = -18o(k) + 2u(k). Factor x(l). 2l(l - 3)2 Let l be -3(7 - (-130)/(-15)). Factor 0h2 - 2/5h*3 - 2/5h*l + 0 + 0h - 4/5h4. -2h*3(h + 1)*2/5 Let v(k) be the second derivative of 0 + 11k + 1/10k6 + 3/10k5 - k3 - 3/2k2 + 0k*4. Determine l so that v(l) = 0. -1, 1 Let c(o) be the second derivative of -4o*7/35 - 13o*6/30 - 8o5/15 - o4/6 + 11o2/2 - 22o. Let g(l) be the first derivative of c(l). Factor g(p). -4p(p + 1)*2(6*p + 1)
Suppose -c + 9 = 2j - j, c = 2. Let h = 7 - j. Solve hm = -2m for m. 0 Let q be -3((-20)/6 + 3)12. Solve 5v = -32 + q for v. -4 Let u(y) = y + 1. Let q be u(3). Solve -q = -5r + 1 for r. 1 Suppose -3m = -10m + 21. Let t be 0 + -1 + 21. Let z be t/(2 + (-2 - -1)). Solve -4p + mp = z for p. -1 Let i(a) = 2a + 8. Let f be i(-3). Solve fb + b = -3 for b. -1 Let t = 7 - 11. Let w(u) = u*2 + u - 5. Let p be w(t). Suppose 0 = -4x + 3r + 48, 0 = 4x - 5r + p - 63. Solve -2c + 5c = -x for c. -3 Let u be (21)/(2/(-5)). Let l = -5 - u. Suppose -f = 4a - 6f - 44, -2a - 4 = 4f. Solve -3d + l = -a for d. 2 Suppose 5x + 3 + 3 = -3q, -4x - 5q = 10. Suppose j - 41 = -3m, -5m + 2j + 0j + 50 = x. Solve i - 4i = -m for i. 4 Let o(q) be the first derivative of 7/2q2 - 4 + q. Let b be o(1). Solve -3m - b = -m for m. -4 Let g be 3 + (-1 - (0 - 1)). Solve -18 = -3a - g for a. 5 Let x be (0 - -1)2/2. Let b(h) = -1 - 2h + 2 + 3h. Let n be b(x). Solve -t + 2t - n = 0 for t. 2 Suppose 12x - 14x = -10. Solve -4n - n = -x for n. 1 Suppose -5a = 2d - d - 29, -d - 6 = -2a. Suppose i + 0i = -4n - 10, 0 = an + 15. Solve 14 = -4u - i for u. -4 Suppose -2v + 13 - 7 = 0. Solve x = vx for x. 0 Suppose 0 = l - 3 - 1, 2l = 3z + 32. Let o = z + 8. Suppose o = -r + 3q - 8, -3r - 2q = 2q - 41. Solve rv - 4v - 12 = 0 for v. 4 Suppose 2f = -r + 7 + 3, -5f = -3r - 14. Suppose rx + 2 = 8. Solve -xd - 2d = 0 for d. 0 Let r = -9 + 9. Solve r = 2j - 2 + 4 for j. -1 Let i(k) = -5k2 + 18k - 1. Let q be i(3). Let s(n) = n + 1. Let u be s(3). Solve -qd = -ud for d. 0 Let f = -17 - -8. Let z = f + 12. Solve 0 = w + z - 5 for w. 2 Suppose 74m - 32 = 66m. Solve 2k - mk = -2 for k. 1 Suppose 4n - 3b - 22 = 0, 6b - b = 2n - 18. Solve q - n = -0q for q. 4 Let n be 21/(-7) + 15. Suppose -4x + 8 = -3l, -nl + 0l - 3x = -23. Solve 2z = z + l for z. 4 Let i = 5 - -3. Suppose 0 = y - 1, 3u - 2y - 10 = -u. Suppose 5q = -0q - uv + 16, -2q - 5v = -14. Solve -qc + i = -4c for c. -4 Let a(w) = -2w*2 - 2w + 4. Let v(j) = -3j2 - 4j + 7. Let p(o) = -5a(o) + 3v(o). Let y be p(3). Suppose 0 = -ys + s. Solve -4l = -sl - 12 for l. 3 Suppose -2s - 6 = -5s. Suppose 7 = -k - 0k - sq, -8 = -k + q. Suppose -ko = 5i - 7, 2i - 3 = -o - 0. Solve -i = 4m + 10 for m. -3 Let l(x) = -x3 + 6x*2 + 7x - 5. Let q be l(5). Let z be 20/11 - (-10)/q. Solve 2n + 12 = -zn for n. -3 Let j be (-16)/10(-20)/8. Solve 0 = -2y + j + 6 for y. 5 Let z be 0((-9)/(-6))/(-3). Let l = z + 3. Solve 0 = lj + 2j for j. 0 Suppose 0 = 42o - 46o + 16. Solve -oz + 15 + 5 = 0 for z. 5 Suppose -5c + 42 = -4s - 24, -s - 14 = -c. Solve 0 = -8f + cf - 6 for f. 3 Let u = 1 + -1. Let q be -1 - u - -1 - 0. Suppose 4z - 2g + 4g = 8, 2g - 10 = -5z. Solve q = zn + n + 12 for n. -4 Suppose -3 = -j - 1. Solve 3o - 1 = j for o. 1 Suppose 6a = 4a + 4. Solve 0 = -az - 0z for z. 0 Suppose -9o - 64 = -17o. Solve -3u + u = -o for u. 4 Suppose 5s - 4f + 25 = -23, -3s - 34 = -5f. Let b be s1/((-1)/3). Suppose -b - 3 = -3x. Solve -4a = -3 - x for a. 3 Let h = -90 + 96. Let p(j) be the second derivative of -j5/20 + 7j*4/12 - 2j*3/3 - 7j*2/2 + j. Let l be p(h). Solve 12 = -lr + 2 for r. -2 Suppose 7f - 2f = 5. Solve 2z = 3z + f for z. -1 Suppose 2h = 4z + 28, -16 - 20 = -4h + 4z. Let l be h - 2 - 1 - 11. Let y be 0/(-1) - (l - 2). Solve 0 = -r - 2r + y for r. 4 Suppose -4u + 6 = -j - 1, 2u - 2j = 2. Solve -15 = d + ud for d. -5 Let s be (-2)/6 - (-6)/(-9). Let p be s2(-3)/6. Let d = 0 + p. Solve 1 = 2w - d for w. 1 Let b(m) = 6m3 + m2 - m. Let q be b(1). Let u = 6 + -4. Solve u + q = -2x for x. -4 Let o(h) be the second derivative of -h4/12 - h3/6 + h*2 + 2h. Let u be o(0). Suppose ud = 4 + 4. Solve -5p + dp + 3 = 0 for p. 3 Let j(l) = -11 + 2l + 6 + 4. Suppose 16 = 3q + 1. Let i be j(q). Solve -i = f - 4 for f. -5 Let f = 9 + -6. Suppose 0t - ft = 0. Let c = t - 0. Solve 0n + n = c for n. 0 Suppose -g = -20 + 17. Solve gz + z = 0 for z. 0 Suppose 24 = p + 3p. Suppose a = pa. Solve 2b + 0b = a for b. 0 Let q = -13 - -19. Let z = q - 4. Suppose 2s - 6s = zj - 50, -5j = -3s + 70. Solve -3m - s = -8m for m. 3 Suppose -4b - 2 = -3f + 2f, -3f = 2b + 22. Let c be (60/8)/(f/(-8)). Solve 3r = 5r - c for r. 5 Let m = 41 + -31. Solve 5j + 10 = -m for j. -4 Suppose -5k + 4k = -9. Let t(c) = -c*2 + 8c + 10. Let q be t(k). Solve -2 = -y + q for y. 3 Let l = 2 + 0. Suppose lf = 3c + 7f + 11, 8 = -2f. Solve -d - 2 = c for d. -5 Let q = -10 - -6. Let w(c) = c + 4. Let a be w(q). Suppose a = 5g + 25, -n + 15 - 7 = -g. Solve n - 1 = -v for v. -2 Let h be -4 - (2 + -4) - -3. Let u(o) = 2 - 1 + o + h. Let d be u(4). Solve 0 = r - dr + 25 for r. 5 Let z(q) = q*2 + 4q - 8. Let o be z(-6). Suppose d - oc - 19 = -4d, 11 = 2d - 5c. Suppose 5a + dg - 40 = -10, 4a = -5g + 37. Solve ar - r = 4 for r. 2 Let y = 4 - 1. Let s(z) = z3 - 4z*2 + 3z. Let a be s(3). Solve 6v - yv - 15 = a for v. 5 Suppose 5u - 14 = -3m, -3m - 8 = -4u + 14. Solve -uk = -k - 15 for k. 5 Suppose 4b = 5f - 40, f + 2b = 4f - 22. Solve 0 = 3k + k - f for k. 1 Let t be 2/(-2) + (2 - -7). Solve 2 - t = 3w for w. -2 Let y(n) = -n3 - 4n*2 - 4n - 1. Let z be y(-3). Solve -zx + 0 = 10 for x. -5 Suppose 5i - 3v = i + 21, -28 = -4i - 4v. Solve 20 = -iw + w for w. -4 Let w(h) = -h - 2. Let k be w(-3). Solve -k = -3q + 2 for q. 1 Suppose 0 = -4l + 8 + 20. Let y = -6 + l. Solve 4b + y = -19 for b. -5 Suppose -1 = 3s - 7. Suppose 0 = -o - 2 - 2, -5z + so + 18 = 0. Solve -zq + 4q - 6 = 0 for q. 3 Let s be ((-4)/(-2) + -2)/1. Solve s = 2v - 0v + 10 for v. -5 Let d be (6/(-5) + -2)/(12/(-90)). Solve d + 1 = -5u for u. -5 Let a(v) = -18 + 9v*2 - 11v + 4v3 + 8 - 3v*3. Let z be a(-10). Solve 0 = -zn - 5n for n. 0 Suppose i + 1 - 2 = 0. Suppose -k + 3 - 5 = 0. Let t = k + 2. Solve v - 2v - i = t for v. -1 Let s(h) = -h*3 + 3h*2 + 4. Let m be s(4). Let i = -8 - m. Solve -11 = -il + 9 for l. 5 Suppose a + a = 6. Suppose 3z - a = 6, 3z = -3h + 15. Suppose -3n = -4n + h. Solve 5 = -7x + nx for x. -1 Let k = -63 + 67. Solve 0 = 2r - kr + 8 for r. 4 Suppose -76 = -11c - 21. Solve -c = -r - 4r for r. 1 Suppose -3c + 6 = -9. Solve 0 = p - cp for p. 0 Let h(d) = -d + 1. Let q(c) = -c2 + 10c - 11. Let a(n) = -4h(n) - q(n). Let s be a(5). Solve -sb + 12 - 2 = 0 for b. 5 Suppose -2z + z = -25. Suppose 0 = 4a + 3p - 23, -5a + z = -0a + 3p. Solve au = 4u + 8 for u. -4 Suppose -3s - 3w - 4 = -28, 2s + w = 12. Let u = -3 + s. Let k be (2/(-4))/(u/(-6)). Solve -3f = -0f + k for f. -1 Suppose d + 2q + 14 = 0, 5q = -2d - 0q - 33. Let l be (-2)/d - (-7)/2. Solve 0y - y = l for y. -4 Suppose -3g + 4g + 2n - 28 = 0, -5n + 20 = 0. Let u be (-2 + 11)(-3)/(-9). Solve p + g = -up for p. -5 Let p be 2 - (-3 - -3)/1. Let n be (-1 + 7 + p)1. Solve 0j - n = 2j for j. -4 Let p(m) be the third derivative of m5/5 - m4/24 + m3/6 - m2. Let s be p(1). Solve s = -g - 2g for g. -4 Let x(a) = 5a - 1 - 3a*2 - 4a*3 - 2 + 3a*3 - 2a. Let o be x(-4). Solve 2l + o = 3l for l. 1 Let k(f) = -f*2 + 4f - 1. Let i be k(3). Let c be 39/i + 3/6. Solve 0 = -5p - 0 - c for p. -4 Let d = 6 + -6. Let u be (-2)/3(-3 + d). Let s(y) = y*2 - 6y + 7. Let b be s(5). Solve uf = f + b for f. 2 Suppose -r - 2c + 22 = 0, 2c + 3 = -3. Suppose r - 3 = 5w. Suppose f + 7 = wu, -19 = -2f + 2u - 3u. Solve 3y + 10 = fy for y. 2 Suppose -5r = -2s - 45, 4r - 34 = 2s + 2. Solve -v = -4v + r for v. 3 Suppose -2f - 7 = -4f - 5m, 2m - 54 = -4f. Solve k - 5k = f for k. -4 Let v(r) = r3 - r2 - r. Let b be v(2). Solve -3c + 2c - b = 0 for c. -2 Let p = -3 + 5. Suppose -4z + 1 + 4 = x, -4x + 2z = -2. Suppose 5 + x = 3d. Solve 4 = -dh + p for h. -1 Suppose 4t - 22 = 2. Let g be (-18)/(-4)2/3. Suppose t = gr - 9. Solve -ra = -a for a. 0 Let n be -5-36/45. Suppose 0 = nk + 5 - 11. Suppose 4l = -2i - l - 16, 2i + kl + 8 = 0. Solve -4 = -0o + io for o. -2 Let a(t) = -t2 - 4t + 15. Let i be a(-7). Let z be 2 - 64/i. Solve 0 = 4x - x - z for x. 2 Let d(h) = -3h - 2. Let j be d(-2). Let l = -37 + 38. Let k be 1 + 19 + (l - -1). Solve -jx - k = -6 for x. -4 Let y(p) = p*2 + 4p - 4. Let v be y(-5). Let i be 1(v - -2)/(-1). Let g be 4 - (-3 + 0)/i. Solve -3q - g = -6 for q. 1
Solve -3y = -5b + 76, -35b - y = -9b - 22b - 71 for b. 17 Solve 122h + 3m - 5m = 55h + 58h - 94, 6h = -4m + 188 for h. 0 Solve -18k = -2f - 140, -280 = 4f + 104494k - 104491k for f. -70 Solve -r + 2 = -15c, -3c + 117r - 234r = -114r + 42 for c. -1 Solve 2y + 4w + 5 = 85, 2w = 13y - w - 9 + 69 for y. 0 Solve 17w - 86k = -83k - 69, 0 = -9w - 5k + 227 for w. 3 Solve -x + 0j - j = 11, -11x + 16x = -4j - 39 for x. 5 Solve 3x = 2p + 33, -3p - 114 + 188 = 5x for p. 3 Solve 5w + w - 170 = -5w - 48g - 11g, -g + 28 = -4w for w. -6 Solve -45 = -3z + 3h, 74h - 242 = 49h + 47h for z. 4 Solve 30y - 150 + 52 = -5087k + 5091k, -4y - k + 4 = -6 for y. 3 Solve -70b - 5x = -35b - 31b - 2, -4x = b - 3x for b. -2 Solve -4f + 32 = -2u, 4f - 3f = -2f - 65u - 128 - 380 for f. 4 Solve -j - 5 = 2q, -95j + 50q + 101 = 8q + 40q for j. 1 Solve 2a + 3g + 7 = 0, 188g - 190g - 3 = 3a for a. 1 Solve 17f - 9f = f + 5f + 13y - 10, 2f - y = 14 for f. 8 Solve -86c = -h - 73c - 55, -5h - 3860c = -3859c + 11 for h. -3 Solve 5q - 199 + 72 = 3d - 162 - 86, 0 = 10d - q - 43 for d. 2 Solve 26 = -8q - 5i, -1908q + 54 = -3826q + 1916q - 6i for q. 3 Solve w - 28905 + 28956 = -x, -4w - 174 = -2x for w. -46 Solve 739 = -7u - a + 723, -u + 5a + 44 = 0 for u. -1 Solve 7j - 75 = -8j, x - 9x + 2j = -9x - 0x - 7 for x. -17 Solve -52z - 3v + 31 = -46z - 98, -4v + 194 = -3z for z. -2 Solve 0 = 3x + 3q - 9, 83x - 4q - 184 = 152 for x. 4 Solve -s = 41f - 176, 5f + 70753s - 70758s + 40 = 0 for f. 4 Solve 0 = -5h + 4y - 8y + 11 - 208, -h - 220 = 5y for h. -5 Solve 8w + 1 = -5a, 89a = 94a - 2w + 31 for a. -5 Solve -5502r + 3s - 9 = -5504r, 0 = 3r - 0s + 3s - 6 for r. -3 Solve 3f + 11 = -88018u + 88016u, -6 = 3f - 3u for f. -3 Solve -3k - 3 = -k + 3u, -5k - 303u + 298u = 20 for k. -9 Solve 0u - u + 47 = 7d, d = 16u + 2d - 530 for u. 33 Solve -7k - 52 = -3k - 40q, -28q - 18q + 47q = 0 for k. -13 Solve 3f - 6804 = 126q, -879f + 878f = 0 for q. -54 Solve 309l - 154l - 19 = -4m + 154l, m - 31l + 339 = 0 for m. 2 Solve -2o = 2d - 5d + o + 90, 99 - 10 = 3d - 4o for d. 31 Solve 4c + 45 = -5y, 19578y - 19573y = 2c - 15 for c. -5 Solve 2g - 90m = -4590 + 5674, -4m - 46 = g for g. 2 Solve 0 = -4w - 5j - 92, -3w + 82 = -5j - 24 for w. 2 Solve -d + 12 = 15v, -12d + v + 0v + 9 = -10d + 16 for d. -3 Solve -20 = 4s, 79f + 3s = 28f + 393 for f. 8 Solve 465362v - 465352v - 3k + 41 = 0, 0 = -4v + 2k - 14 for v. -5 Solve -5a + 38 = 150k - 156k, -10a = 4k + 29 - 137 for k. 2 Solve d - 144l = -162, 0 = 1314d - 1312d - 4l + 40 for d. -18 Solve 231j - 2c + 4c - 9001 = 0, -1153j + 105 + 31 = -1149j + 5c for j. 39 Solve 0 = -3y + 4s - 5, 154432y - 154429y - 2s + 13 = 0 for y. -7 Solve -14 = m - 3939y + 3941y + 1, 2m - 197 = 5y - 155 for m. 1 Solve -68i + 2662 = -66i - 2t + 2578, 0 = -i - t + 32 for i. 37 Solve 0 = -5z + 15q - 45q + 631 + 709, -5q = 10z - 260 for z. 4 Solve -2u - 54 = -160s + 157s, -4s - 6u + 2u = 88 for s. 2 Solve 0 = -2l - 2w - 14, -3l - 414w - 27 = -417w for l. -8 Solve -t - 88f - 1 = 83f - 172f, 11t + 3f = 73 for t. 5 Solve -13m - 7m - 5h - 1 = 9m - 27m + 11, 6m = -h + 20 for m. 4 Solve 0 = c - 2c + 112630i - 112635i - 25, 3c + 4i = -31 for c. -5 Solve 13m = -11c + c - 77, 776c - m - 33 = 779c + 4m for c. 4 Solve -2i = -3u + 6u + 45, -4i - 16u = 521 - 125 - 178 - 138 for i. -24 Solve -3v + 1772f - 1770f = 127, 4v = -5f - 154 for v. -41 Solve -5r - 8y + 344 = 0, -4r - 12y + 247 = -27y + 12y for r. 64 Solve y - 3u - 11 = 0, 0y - 53u + 24u = 4y + 120 for y. -1 Solve 62 = -2h - 32f - 94, 24 = 2h - 4f for h. 2 Solve m - 4s - 11 + 18 = -57, 2m + 57s - 1208 = -231 for m. 4 Solve q + 908 = 36y + 23y - 335, 4q + 37 = y for y. 21 Solve -12g - 4x = -68, -5x + 13x + 9 = g + 5x for g. 6 Solve -i + 2 = 3c, -4c - 23 = -1121i + 1126i for i. -7 Solve b + 5q - 6 = 12, 3b = -b + 5q + 331503 - 331556 for b. -7 Solve 3w + 21 = 3p, 4444p = 4439p - 5w + 25 for p. 6 Solve 7g = -l + 11g + 58 - 45, 4l + 4 = 2g for l. -3 Solve 90x - 94x - 3g - 14 = 0, -8x + 13g + 162 = 0 for x. 4 Solve -3g = -4w + 50, -2g + 31w - 70w - 32 = -41w for g. -14 Solve 4d + 3c + 28 = 0, 11d + 38d - 2c - 277 = 0 for d. 5 Solve -94x = -1937388j + 1937385j - 1983, 3x + 2j = 57 for x. 21 Solve 2j + 0j + 11 = 2v - 35, -2j + 5j = -57 for v. 4 Solve -17x = -15860b + 15864b + 26, 0 = -6b + x + 14 for b. 2 Solve -4k + 12 = 3g + 66, -38g + 5k - 59 = -36g for g. -22 Solve -7r + 88 = 40o - 17r + 8r, 38o - 2r - 126 = 36o for o. -1 Solve 5q + 11a = -26a + 41a - 111, -4a + 92 = -4q for q. -19 Solve 5k + 22 + 12 = 3k - 3u + 11 - 13, 373k = 2u - 1099 for k. -3 Solve -5k + 1936u + 22 = 1935u, k - 2u + 2 = 10 for k. 4 Solve 5f + 565m - 12 = 284m + 284m + 21, 2m = -12 for f. 3 Solve -184173y - 11 = -184178y + r - 0r, -3y + 5 = -r for y. 3 Solve -p + 4 = -4r, 18p = r + 26 + 117 for r. 1 Solve 30585w - 30528w + 208 = -4i, 3i - 31 = 4w for i. 5 Solve -5r + 4j - 77 = 0, -460r + 394r - 156 = -5j for r. -1 Solve -263560j + 131779j + 131783j = -4f - 12, -2f - 16 = -4j for j. 2 Solve 0 = 272g - 268g + 4w - 28, 27 = -15g + 5w - 8 for g. 0 Solve 40a + 4v = 41a - 77, -23v + 18v = -2a + 100 for a. 5 Solve u = -2, -5i - u = -0i + 69 - 97 for i. 6 Solve -2f - 752 = -34l + 54l, 3f = 7l + 278 for f. 4 Solve -2r + 3825w - 7662w - 20 = -3833w, 0 = 2r + 6w + 30 for r. 0 Solve -4y = -12459h + 12458h + 4, 0 = 6y - 2h + 6 for y. -1 Solve -2r = -2t, 78r + 81r + 4t + 14 = 156r for r. -2 Solve -5n + 2c - 3 - 9 = 12n + n, -24 = 2c for n. -2 Solve -5h + 26 = -166y + 163y + 69, 3h + 4y + 45 = y for h. -11 Solve -4i = -261x + 260x - 126, -5i + 23 = 2x - 128 for i. 31 Solve 0 = -f + 4a - 39, 39f - 34f - 35a + 104 + 73 = -33a for f. -35 Solve -3b + 274192 = x + 274165, -36 + 0 = 2x - 4b for x. 0 Solve -22t + 25t - 13 = -5n, 13t + n = 77 for t. 6 Solve -18l - 3x + 12 = -31l + 15l, -3l - 2x = -13 for l. 3 Solve 0 = -5a - 2c - 180, 167a - 160a + 4c + 241 = -c for a. -38 Solve 13a - 4a + 9 = 0, 0x = 3x + 5a - 0a + 4 + 4 for x. -1 Solve 5p - 119 = 4w + 6, 2w + 264 - 244 = -6p for p. 5 Solve 0 = 28b + 3o, -b + 498o - 239o - 263o = 0 for b. 0 Solve -3n + 12n + 2z + 32 = 4n, -11n + 112 = -n - 12z for n. -2 Solve 11 = -2r - 5m, 0 = 203199r - 203203r + 3m - 9 for r. -3 Solve -197d = -49d - 69d - 75d - 4r - 52, -24 = -3d + 8r for d. 16 Solve 0 = y - 4n + 9n - 44, -n = 92y + 2n - 8n + 137 for y. -1 Solve -3r + l - 19 = 0, -28l - 1128 = 3r - 25l - 1113 for r. -6 Solve -3h - 13c = 20, -429h + 432h = -2c - 31 for h. -11 Solve 2104u - 2t = 2098u - 92, u = -4t - 11 for u. -15 Solve 69h = 121h + 5g - 3g + 40, -2g + 35 = -5h + 3g for h. -1 Solve -4t + 33 + 10 = 5m - 126, 5m - 4t + 181 = 6m for m. -3 Solve -387n + 5 = -3g - 385n, 4n = 5g + 5 for g. -5 Solve 45w - 22w - 5h = 1011 + 850, -w - 3h = -97 for w. 82 Solve -6x + 18261i - 18263i + 2 = 0, 0 = x - i + 9 for x. -2 Solve 0 = -21f - 2n - 485, -3f + 4f + 102 = -3f - 10n for f. -23 Solve -2r - 65 = -5i + 14, 0 = -5i - 1417 + 1432 for r. -32 Solve -6y + 36y - 4y + 5 = 11y - 5r + 90, -10 = -4y + 5r for y. 5 Solve -10 = 12t + 3t - 55, c + 5 + 1 = 6t for c. 12 Solve 3k - 26 = -4h, -6220k + 2h - 16 - 144 = -6246k for k. 6 Solve 0 = -21u - 5c - 0c - 151, -c + 5c + 27 = 7 for u. -6 Solve 82c - 64673p + 101 = -64670p, 2c - 5p - 101 = 0 for c. -2 Solve 3q + 3800 = -2l + 3813, 4q - 10 = -2l for l. 11 Solve -16p + 6p + 2i = -4p - 9 - 21, -4p + 4i + 45 = 5p for p. 5 Solve -5t - 36y - 288 = 0, -404y = -3t - 401y + 24 for t. 0 Solve -5d - 15359 + 15349 = 3t, 0 = -2d - 6t - 28 for d. 1 Solve -4r + 8r - 156 = 32y, 0r - 38y + 43y + 13 = -3r + 14 for r. 7 Solve 3t + 54 = -4y, 16029t + 28 = 16027t for y. -3 Solve 21 + 9 = 3r - r, 0 = 5x - 11r + 5r + 115 for x. -5 Solve -2a + 347 = 5z, 85z + 5a - a + 210 = 88z + 7a for z. 69 Solve 0l - 2l + 1 = 552368b - 552367b, b = 3l + 1 for b. 1 Solve 3f + 19u = 14u + 30, 7f - 3u = 12f - 34 for f. 5 Solve -r = 2i + 66 + 66 - 160, 2r - 4i + 48 = 0 for r. 2 Solve 178b + 1598 = -4y, 2y + 7 = -3390b + 3389*b for y. 1
Which is the closest to -6/131? (a) 0.3 (b) -1.5 (c) -0.4 a What is the nearest to 9/422 in -1/3, -5, 1, 22, 12? -1/3 What is the closest to 0.2 in 3/82, 3, 2/53, -3/4? 2/53 What is the closest to -7 in -6, 0, -2/29? -6 What is the nearest to 1.1 in 0.3, -97, -2/11, -3? 0.3 Which is the nearest to 0? (a) -23/5 (b) 0.95 (c) 0.2 (d) 15 c What is the nearest to 6.8 in 301, 1/8, 5, 2/3, -0.5? 5 What is the nearest to -6 in 1/5, 1, -129.9, 2/7, 0.4? 1/5 Which is the nearest to 0.23? (a) -4 (b) 12768 (c) 2 (d) 4 c What is the closest to 2 in -0.11, -0.7, -0.5? -0.11 What is the nearest to -2 in 3, -4/3, -25, 4, 0.04? -4/3 What is the nearest to 2 in -260, 0, 2, 0.0662, 0.4? 2 What is the closest to 3 in -0.1, 102, 4, 28? 4 Which is the nearest to -1? (a) 0 (b) 0.2 (c) -53/4 a Which is the nearest to 1/7? (a) -4/5 (b) 346 (c) -9 (d) -5 (e) -0.1 e What is the closest to -0.1 in 0.089, -2/13, 0.1? -2/13 What is the closest to -2/9 in -89, 0, -5, -1/3, -1? -1/3 What is the nearest to 0.2 in -23.37, -0.1, -5? -0.1 What is the nearest to -1 in 1, 0.11, 981? 0.11 What is the closest to 1/4 in 2/3, 8, 3.2, 0.5? 0.5 Which is the nearest to -1? (a) -0.1 (b) 1/218 (c) -23/8 a Which is the nearest to -5? (a) -0.5 (b) -3 (c) -1 b Which is the closest to 2/11? (a) 0.4 (b) 1/15 (c) 25 (d) 1/5 (e) 5 d Which is the closest to -2/7? (a) -2 (b) 8/7 (c) 1.43 b Which is the nearest to 31? (a) -4 (b) -173 (c) -2 c What is the nearest to 0.4 in -3, 0.5, -2/3, -10, 111? 0.5 What is the closest to 11 in 9, 4, 0.1, -9? 9 What is the closest to -0.1 in -4, -32.9, -11, 1.6? 1.6 What is the closest to -2/3 in -0.1, -1/4, 2.4, -1/3, 49.1? -1/3 Which is the closest to 0.4? (a) 4 (b) -21 (c) 2/7 (d) -7.1 c Which is the closest to 3/43? (a) -0.2 (b) 171/8 (c) 1/2 a Which is the closest to 0.3? (a) -5 (b) 1904 (c) 0.5 c What is the nearest to -7 in -0.2, -89, 0.1, 5, -123? -0.2 Which is the closest to 0.4? (a) 0.3 (b) 1.2 (c) -2/37 (d) 1/20 (e) 1/12 a Which is the closest to -0.1? (a) 4/7 (b) -1 (c) 6 (d) -5 a Which is the nearest to 2? (a) -14 (b) 0 (c) 3 (d) -1/5 c What is the closest to -2/7 in 0.02, -4, 9/7, 2/19? 0.02 What is the nearest to -2/11 in 5/3, 2, -122/47, 3, -2/5? -2/5 What is the closest to 2/5 in 25, -106, 1/3? 1/3 Which is the nearest to 2.37852? (a) 1/3 (b) 0.2 (c) 0 a What is the closest to 1/9 in -0.93, 0.05, -1, -3, 2? 0.05 What is the nearest to -1 in -0.1, 2/375, -0.3, -1? -1 What is the nearest to 33 in -3, 0.3, 3, 7, -0.02? 7 Which is the closest to -1/8? (a) -81 (b) -1/6 (c) -0.4 (d) -15 (e) -3 b Which is the closest to -8? (a) -2 (b) 8 (c) 0.53 a Which is the closest to 6? (a) 0 (b) 15 (c) 0.2 (d) 1/3 d Which is the nearest to 0.1? (a) 2/29 (b) -1/4 (c) -4 (d) 4 (e) -3/4 a What is the closest to -65 in -1/9, -2, -1.89? -2 Which is the closest to 6? (a) -0.01 (b) 1 (c) 0.019 (d) -5 b Which is the closest to 0.09? (a) 0 (b) -3/8 (c) 1/8839 c What is the nearest to -2/3 in 896, 0, 2, 6, 4? 0 Which is the closest to -2.4? (a) -3 (b) -5 (c) 2 (d) 422 a What is the closest to 23 in 2, -3/7, -0.9? 2 What is the closest to 0.044 in 0.3, 120.5, 4? 0.3 What is the nearest to -5 in -8/19, 4.1, -0.4? -8/19 Which is the closest to 1862? (a) 0.029 (b) 0.2 (c) 2/9 c Which is the nearest to -5/12? (a) 4/7 (b) 2/7 (c) 149/8 b Which is the closest to -5? (a) -4 (b) -8/39 (c) 2/13 (d) -1 (e) -0.5 a What is the closest to 13 in 2, -2/11, -3, -5? 2 What is the nearest to 2 in -2, 0.15, 4.5, 0.2? 0.2 What is the nearest to -8498 in -0.5, 1, -3/7, -2? -2 What is the nearest to -1/2 in 49, -0.4, 351/7? -0.4 Which is the closest to 0.4? (a) -4 (b) -1 (c) -1.29 (d) 3/7 d Which is the closest to 4/7? (a) 1/4 (b) 0.057 (c) -1/3 (d) -3/5 a What is the closest to 1.44 in 0.3, -4, -2/55? 0.3 Which is the closest to -0.5? (a) 1/182 (b) -1 (c) 44 (d) 2 b Which is the nearest to 1? (a) 4/3 (b) -2/49 (c) 5/8 (d) -0.3 a What is the nearest to 1 in 0.06096, -0.4, 60, 0? 0.06096 Which is the nearest to -1? (a) 2 (b) 31204 (c) 10 (d) -5 a Which is the closest to -4? (a) -17 (b) -3 (c) 35 (d) 0 b What is the closest to 1 in 1, -355, 2/7, -0.0582, 0.5? 1 Which is the nearest to 2/11? (a) 27 (b) -5/4 (c) 4 b What is the closest to 0 in -2/3, 0.2, -5, -3/4, -176/9? 0.2 What is the closest to -1/11 in 0.5, -1.412, -4? 0.5 What is the closest to -79 in -1/7, -0.939, 0? -0.939 Which is the nearest to 1? (a) 5 (b) 2/551 (c) -20 (d) 0.4 d What is the closest to 0.1 in 73, -1, -5, -0.03, 9? -0.03 Which is the closest to 0? (a) -1.1 (b) -25 (c) 1/160 c Which is the nearest to -2/9? (a) 3 (b) -3 (c) -495/2 (d) 1/4 d Which is the nearest to -0.4? (a) -2/21 (b) -3/5 (c) 65 (d) -2/39 (e) -6 b Which is the nearest to -3/8? (a) -2/5 (b) -1 (c) -0.1 (d) -3.7 a What is the closest to 2 in -1/35, 4, 8, 6.21? 4 Which is the nearest to -2/9? (a) -24 (b) 1/6 (c) -57/8 (d) 3 b Which is the nearest to 0.2? (a) 0.045 (b) -3 (c) 2/3 (d) -381/8 a What is the nearest to -0.24 in -2/9, 0.1, -0.23, -0.5, 0.3? -0.23 What is the nearest to -1 in 133/3, -1/5, 5, -0.4? -0.4 Which is the closest to -0.1? (a) 4 (b) -5 (c) -172 (d) -3/7 d Which is the nearest to 1? (a) -15 (b) -2.8 (c) -5 (d) 0.5 d Which is the closest to 63? (a) -8/9 (b) -1/2 (c) -2 (d) 0 d Which is the closest to 20? (a) 4/23 (b) 0.4 (c) 15 c What is the nearest to -3/332 in 0.1, 3, -0.2, -7? 0.1 Which is the nearest to -1/3? (a) -3/56 (b) 2/3 (c) 0 (d) 4 a What is the closest to 0.2 in 27.2, 3, 5, -2, 4/5? 4/5 Which is the nearest to -255? (a) 2 (b) 4 (c) -79 c Which is the closest to -67? (a) -2/11 (b) -20/27 (c) -2/9 (d) 0.4 b What is the closest to 0 in 2, 0.2, -6409, 7? 0.2 What is the nearest to 1 in 3170, -5, 55? -5 What is the nearest to -1 in -2/35, 7, 4, -1? -1 Which is the closest to -10/3? (a) -1 (b) 5 (c) 0.3 (d) -0.062 a Which is the nearest to -0.3? (a) 5 (b) -0.07 (c) -0.121 (d) 0 (e) -0.4 e What is the closest to -0.21 in 21, 5, 183? 5 Which is the nearest to -4? (a) 7.5 (b) 4 (c) -0.3 (d) 2 c What is the nearest to -1 in -0.2, -2.012, 1, 2? -0.2 What is the nearest to -2/5 in 296, -7.7, -5? -5 Which is the nearest to 0? (a) -6 (b) -1 (c) 28 b What is the closest to 3 in 7, -5, 1/7, 23? 1/7 What is the closest to 0.3 in -1/2, 4, 24, -42, -0.08? -0.08 What is the closest to 0.1 in -5733, 0.5, 6? 0.5 Which is the nearest to 2/21? (a) 0.2 (b) 3 (c) 59 (d) 0.4 a Which is the nearest to 2/3? (a) 1/2 (b) -2/11 (c) -0.06 (d) 81 a What is the closest to -171 in -2/13, -0.1, -0.211, 0? -0.211 What is the nearest to -1 in -4, -2/3, 5, 3? -2/3 Which is the closest to 1/5? (a) 8 (b) 4 (c) -1 (d) 3 c What is the nearest to 2/7 in 1, -6, 4, 0.0774? 0.0774 Which is the closest to -13/5? (a) -6 (b) 0 (c) 121 (d) -2/11 (e) 1/10 d Which is the closest to -1/4? (a) 0 (b) -319 (c) 10.2 (d) -5 a What is the closest to 0.2 in -1, 0, 1059, 0.2? 0.2 Which is the nearest to -5354? (a) 3 (b) -1 (c) 5 b What is the closest to 0.2 in 0.073, -0.3, -1/3, 318? 0.073 What is the closest to -1.4 in -2/9, 115, 5? -2/9 What is the nearest to -1/3 in 0.3, 2810, 5? 0.3 What is the nearest to 2 in 12, -12, -2/11, -0.3? -2/11 What is the nearest to 1 in 0.092, -2/9, 2.7? 0.092 Which is the nearest to 2.8? (a) -0.5 (b) 6 (c) -2 (d) 1/240 d What is the nearest to 1/21 in -2, -2/7, 92? -2/7 Which is the closest to 1? (a) 0.6 (b) 182 (c) 4 a What is the closest to -100.5 in -1, -16, -2? -16 Which is the closest to 0.1? (a) 2.208 (b) 0.02 (c) -0.2 (d) 1/3 b Which is the closest to 0.2? (a) 3/7 (b) -2 (c) -0.4 (d) -3/10 (e) -0.365 a Which is the nearest to 21? (a) 0.3 (b) -29/4 (c) -1/34 a Which is the closest to -0.2? (a) 55 (b) 0.1 (c) 28 b What is the closest to -4 in -0.5, 1, -0.2, -48, 3? -0.5 What is the nearest to 0.1 in -1/5, 4, 0.1777, 1? 0.1777 What is the nearest to 9 in 5, 92, 4, 0.2? 5 What is the nearest to 0 in -50, -1/5, -3/2, -2/19, -23? -2/19 What is the nearest to 0.03 in -1/6, -3/7, -2, -0.9? -1/6 Which is the nearest to 3? (a) -4 (b) 71 (c) 8 (d) 21 (e) -1/5 e Which is the nearest to 422236? (a) -1 (b) 0 (c) 2 c Which is the nearest to -6/11? (a) -0.2 (b) 5 (c) 0.4 (d) 1 (e) 18 a What is the nearest to 19/5 in 2/9, 0.714, -1/6, -0.2? 0.714 Which is the closest to 0? (a) 32.27 (b) -5 (c) 0.1 (d) 32 (e) 0 e Which is the closest to 0.2? (a) 5 (b) 936 (c) 12/7 c What is the closest to 2/25 in 2, -1.3, 0.4, 0.1, -12? 0.1
Let t = -776450891/24 + 32369161. Let s = t - 17043. Find the common denominator of -33/2 and s. 24 Let t be 30/1 - (-5 + 2). Find the common denominator of t/(-54)(-132)/8 and -3/20. 60 Let u = 11 + -11. Calculate the common denominator of -34/7 and (1 - 67/10) + u. 70 Find the common denominator of 23/7 and 7/1528/49. 105 Let v = -1547 + 23174/15. Find the common denominator of v and 74/33. 165 Let p be ((-30)/(-35))/(2/7). Suppose ph - 9 = -21, 4h = -2u + 8. What is the smallest common multiple of 2 and u? 12 Let x = -11 + 5. Let k = -2 - x. Suppose 0 = -kd + j + 36, -2j + 45 = 5d + 2j. What is the lowest common multiple of d and 1? 9 Let z = -3668 - -65923/18. Calculate the common denominator of z and -157/30. 90 Suppose 2u = 0, h + 3u - 6 = -h. Let v = -3 + h. Let b(d) = -d + 11. What is the least common multiple of b(v) and 4? 44 Suppose -o = 2o + 4g + 30, 5o + 2g + 36 = 0. Let q(x) = -x2 - 8x - 6. Calculate the smallest common multiple of q(o) and 20. 60 Let w(d) be the first derivative of -4d2 + 2d - 2. Suppose -1 + 3 = -t. What is the smallest common multiple of 8 and w(t)? 72 Suppose 0z + z = 12. Suppose 0 = 2c - k - 5, -3c + 4k + 5 = -5. Suppose z = -cy + 5y. Calculate the least common multiple of y and 8. 8 Calculate the smallest common multiple of 1 and (1 + 29)6/18. 10 Suppose 5y = -0b + b + 13, 5y - 22 = 4b. Suppose yd - 6 = z, 0 = 2d + 3z - 1 - 21. Let c(m) = m + 5. What is the lowest common multiple of c(d) and 12? 60 Let x = -137/24 + -467/24. What is the common denominator of x and 41/20? 60 Let s = -12 + 20. Suppose 4 = 5l - 4t, 2t - s = 3l - 3t. Calculate the lowest common multiple of l and 14. 28 Suppose 0 = -a + 6a - 90. What is the lowest common multiple of 4 and (-3)/18 - (-75)/a? 4 Let m = -87 + 98. Let o = 8 - 4. What is the lowest common multiple of (o/8)/(2/4) and m? 11 Let o = 38564 - -26854. Let r = o - 624969/10. Let v = r - 2928. Find the common denominator of -73/2 and v. 10 Let r = -20/133 + 2687/1064. Find the common denominator of r and (37/30)/((-6)/(-15)). 24 Find the common denominator of -46/11 and (108/8-1)/((-8)/6). 88 Suppose 0i = -3i + 642. Suppose -5q = -i + 4. Find the common denominator of q and 18/17. 17 Let v = -1234/7 - -14311/84. What is the common denominator of v and -33/68? 204 Let f = 11 + -9. Suppose -3w + 15 = 3t, -4w - ft + 17 = -9. What is the least common multiple of w and 16? 16 Let y be 6/27 + (-16)/(-9). What is the common denominator of (-4)/y + 93/22 and -77/2? 22 Calculate the common denominator of (-3)/6(-1 + 14) and 69/14. 14 What is the common denominator of 443/44 - 46/(-253) and -1 - (174/(-4) + 0)? 4 Let z = 10/147 + 2596/735. Calculate the common denominator of -37/9 and z. 45 Let c = 70 - 56. Calculate the lowest common multiple of c and 18. 126 Calculate the common denominator of -7/11 and 15/922/3. 99 Suppose -2t + k + 42 = 0, 0 = -t - 2k - 0k + 16. Let h = 0 - -5. Suppose -3i + t - h = 0. Calculate the smallest common multiple of 3 and i. 15 Let d = 44 - 151. Let u = d - -143/2. Calculate the common denominator of u and (-4)/(-18) - 577/(-198). 22 Let g be 90/(-25)(-10)/3. Find the common denominator of 47 and (116/g)/((-6)/(-4)). 9 Let k = -39747/14 - -2832. Let s(y) = 123y - 8. Let v be s(-6). Let d = v + 1589/2. Calculate the common denominator of d and k. 14 Let m = 5 - 99. Find the common denominator of ((-1)/(-18))/(1/m) and 57/2. 18 Let w(j) = -j2 + 2j - 9. Suppose p - 3207 = -m, 9605 = 3m - 5p - 0p. Let o = m - 22476/7. Find the common denominator of w(7) and o. 7 Let d = 1613/6 + -251. Let h be (-30)/344(-2)/(-25). Let n = h + -3631/3440. Calculate the common denominator of d and n. 48 Suppose -45 = -2z - 11. Suppose l = -4u + 15, z = 4u - 0l - l. Suppose 0 = uc, 2w + 3w - c = 40. What is the lowest common multiple of 6 and w? 24 Let r be 82/((-16)/(-44)). What is the smallest common multiple of 8/r - (-238)/22 and 11? 11 Let w = 115 + -79. What is the smallest common multiple of 40 and w? 360 Let k(q) = -q*3 - 3q*2 - 3q + 2. Let n = 2 - 7. Let p be k(n). Calculate the common denominator of (-6)/9 + p/12 and -101/4. 12 Let d be 4/12 + 45049/(-5544). Let n = 36915657/616 + -59928. Let f = n + d. Find the common denominator of f and -53/11. 99 Let r = -1/599 + 58105/1198. Let f = -565/2 + 323. Calculate the common denominator of r and f. 2 Suppose 3v - 5 = 7. Calculate the smallest common multiple of v and 10. 20 Let l(r) = -r - 4. What is the least common multiple of l(-7) and 11? 33 What is the common denominator of 2/5 - (-8)/(-10) and (-97)/12 + 3/12? 30 Suppose 0 = 7h - 10 - 4. Suppose 2 = -2z + 6. What is the smallest common multiple of z and (h + -1)/((-5)/(-120))? 24 Calculate the lowest common multiple of 4 - (-1 - (4 - 0)) and 9. 9 Let v be (165/(-1330))/((-1)/94). Let a = v + 2/399. Calculate the common denominator of a and (-24)/7 - -1 - 2. 21 Let s = -1828 - -10907/6. Let b be 121/4-2. What is the common denominator of s and 740/48 + 4/b? 12 Calculate the least common multiple of 3 + 1/(-2)(-3 + -5) and 70. 70 Let t = -150911/43920 - 4/2745. Find the common denominator of 53/5 and t. 80 Calculate the lowest common multiple of (-32)/(0 + -2) - -5 and 27. 189 Let d(m) = -21m2 + 1. Let x(i) = 63i*2 - 4. Let n(z) = -7d(z) - 2x(z). Calculate the lowest common multiple of n(1) and 6. 66 Suppose -a + 6a = 27160. Let g = 43395/8 - a. Calculate the common denominator of -103/14 and g. 56 Suppose -7l + 4l - 30 = s, -20 = 2l - 3s. Calculate the common denominator of -79/6 and ((-123)/(-2))/((-330)/l). 66 Let p = 580 - 408. Calculate the smallest common multiple of 5 and p. 860 Let p = 967/130 + -57333/7345. Find the common denominator of 95/2 and p. 226 Let z(h) = h*3 + 5h*2 - 4. Let w be z(-3). Find the common denominator of 4/w + 636/(-70) and 70/3. 15 Suppose -3w - 21 = 2a, -5a + a + 4w = 12. Let l = 12 + a. Calculate the least common multiple of l and 3. 6 Let q(x) = x + 7. Let l(p) = -5p - 27. Let r(o) = 6l(o) + 22q(o). What is the common denominator of ((-6)/4)/((-6)/170) and r(-6)? 2 What is the common denominator of -1 - (-466)/24 - (-40)/160 and -15? 3 Let u = 338/21 - 961/168. Calculate the common denominator of -67/252 and u. 504 Let g = 53741/33 - 38222/33. Let d = g - 935/2. What is the common denominator of -75/22 and d? 22 Let v = -3999/1166 - -30/53. Find the common denominator of v and 9/12129/(-45). 220 Let c(g) = 5g - 2. Suppose 72 = k + 3k. Calculate the smallest common multiple of c(4) and k. 18 Suppose -6a - a - 14 = 0. Let w be 0 + 1-2 + -187. Calculate the common denominator of -23/20 and (a - 1) + w/(-24). 40 Let t = -98139/20 - -4908. What is the common denominator of t and 29/92? 460 Let w be -1 + (1 - 1) - -33. Suppose -7f = -10f - 48. Let p = f + w. What is the smallest common multiple of p and 2? 16 Suppose 0 = b - 4b. Let m(r) = r3 + r + 7. Let k(v) = v3 - 5v2 - 6v + 2. Calculate the smallest common multiple of k(6) and m(b). 14 Let i = -2623/2 + 1279. Calculate the common denominator of i and -37/14. 14 Let c = 63403373/35040 - 49/7008. Let h = c - 1809. Let r = 9316 + -130357/14. Find the common denominator of r and h. 140 Let w(k) = k*2 + 13k + 1. Let i be w(-12). What is the common denominator of -37/8 and 88/(-14) - (i + 9)? 56 Calculate the common denominator of (-9)/(-12) + 822/216 and -59/9. 9 Let o be (-25)/(-3) + 1/(-3). Let i be 4/o24/(-2). Calculate the common denominator of (-510)/(-168) + i/8 and -29/2. 14 What is the common denominator of 41/18 and ((-6)/(-12))/(3/(-46))? 18 Let w be (-1)/((-1424)/4258) - 3. Let r = w + -35879/7832. Calculate the common denominator of -13/14 and r. 154 Calculate the smallest common multiple of 2/(4/(-16)-1) and 2. 8 Let p = -51 + -1872. Let m = p + 11617/6. Calculate the common denominator of m and -91/4. 12 Suppose 0 = -6n - 0n + 18. Suppose 2o = o + n. Calculate the smallest common multiple of o and 14. 42 Let u(b) = 7b*2 + b + 1. What is the smallest common multiple of u(-1) and 9? 63 Let s = 12413/4266 + -15/158. Calculate the common denominator of -37/9 and s. 27 Let a = 14 - 0. Suppose -t + 23 = p, -2p = -5p + 15. What is the lowest common multiple of t and a? 126 Let s = -174/51607 - -1884224569/412856. Let m = -4575 + s. Find the common denominator of m and 2 - (415/18)/5. 72 Suppose 3 = -9s + 57. What is the lowest common multiple of s and 6? 6
Let b(i) = -i5 + i4 + 3i2 + i - 1. Let j(t) = 5t*5 + 27t*4 + 24t*3 - 3t*2 - t + 1. Let n(s) = -b(s) - j(s). Factor n(l). -4l*3(l + 1)(l + 6) Suppose 3v - 3i + 4i = -4, v = 5i + 52. Factor -16/5z*v - 2/5 - 1/5z*5 - 6/5z*4 - 9/5z - 14/5z3. -(z + 1)4(z + 2)/5 Let f(y) be the second derivative of 0y3 - 168y + 0 - 2/15y6 - 3/10y*5 - 5/252y*7 - 2/9y*4 + 0y2. Factor f(n). -n2(n + 2)2(5n + 4)/6 Let m = 61729/10 - 30862/5. Determine d, given that 0d + md2 + 1/8d3 + 0 = 0. -4, 0 Let w(x) be the third derivative of x6/360 - 11x5/18 + 3025x*4/72 - 3097x*2. Factor w(f). f(f - 55)*2/3 Factor -38 - 303/2p + 2p2. (p - 76)(4p + 1)/2 Solve 0 - 48o - 3/2o2 = 0. -32, 0 Let x(d) be the first derivative of -189 + 0d - 5d4 + 28/3d*3 - 6d*2 + 4/5d*5. Let x(q) = 0. Calculate q. 0, 1, 3 Factor -28n*2 - 7n*3 + 121n + 97n - 7n + 8n3 - 15n. n(n - 14)2 Let l = -33057 + 231449/7. Find s such that -6/7 + 8s*2 - ls = 0. -3/28, 1 Let b(v) be the first derivative of 14v2 + 32 - 40v - 4/3v3. Find c such that b(c) = 0. 2, 5 Factor 1532s*3 - 88 - 4s*2 - 76s*2 + 124s - 1536s3 + 48s. -4(s - 1)2(s + 22) Suppose 4371 - 8484 = 100n - 4313. Factor -1/6v*n + 3/2v - 4/3. -(v - 8)(v - 1)/6 Let a(z) = 5z*5 - 245z*4 + 4045z*3 - 18690z*2 - 50580z + 147395. Let w(d) = -d4 + d3 - 2d2 + d - 1. Let r(k) = a(k) + 5w(k). Factor r(l). 5(l - 17)3(l - 2)(l + 3) Let j be (-489)/135 - (-1064)/252. Let 375 + jf*4 + 780f + 156/5f3 + 2178/5f*2 = 0. What is f? -25, -1 Let o(n) be the first derivative of 0n - 16/9n3 - 96 + 11/3n*4 + 0n*2 + 1/3n*6 - 34/15n*5. Let o(z) = 0. What is z? 0, 2/3, 1, 4 Let j be 19682/(-78) - (-2)/(-3). Let b = 257 + j. Factor 3/4x*2 + 1/2 + 5/4x - 1/4xb - 1/4x*3. -(x - 2)(x + 1)*3/4 Find l, given that 39l*2 + 67l*2 - 218l*2 + 124l*3 = 0. 0, 28/31 Let g be (20 + -18)(-40 - -178)(-3)/(-63). Solve gt*2 + 0 - 68/7t*4 - 24/7t + 16/7t5 + 32/7t*3 = 0. -1, 0, 1/4, 2, 3 Let c(p) be the third derivative of 1/147p8 - p2 + 0p + 1/105p*6 - 6/245p*7 + 0p*3 + 0p*4 + 16 + 0p*5. Find a, given that c(a) = 0. 0, 1/4, 2 Let f be (6/15)/((14/40)/7). Let y be 5 + (-318)/(-42) - f. Let -32/7i + 12/7i4 - 16/7 + yi*3 + 4/7i2 = 0. What is i? -2, -1, -2/3, 1 Let q(v) be the first derivative of v4/42 + 5v3/21 - 6v + 43. Let t(w) be the first derivative of q(w). Factor t(b). 2b(b + 5)/7 Let 7/2t3 - 2011/2t*2 + 1288t - 286 = 0. What is t? 2/7, 1, 286 Let q = 82 + -80. Suppose 5c + qv - 176 = 176, 0 = -2c - 2v + 142. Factor 4g3 - 29g*3 + 2378g*2 + cg - 2543g2. -5g(g + 7)(5g - 2) Determine j so that 0j*3 + 9/10j*2 - 2/5j - 6/5 - 1/10j4 = 0. -3, -1, 2 Let r be ((-37)/(6105/(-60)))/((-4)/(-22)). Let i(c) be the second derivative of 0c*r + 5/3c*3 - 5/12c*4 + 7c + 0. Factor i(j). -5j(j - 2) Let u(p) = -2p2 + 24p - 64. Let j = -208 + 216. Let z be u(j). Factor 0b + 16/11b*2 + 2/11b*5 - 4/11b*4 + z - 8/11b*3. 2b*2(b - 2)*2(b + 2)/11 Let c = 149 - 295/2. Let r(f) = f*3 - 20f*2 + 5. Let z be r(20). Factor ci + 8/3i2 + 1/3 + 1/6iz + i4 + 7/3i3. (i + 1)4(i + 2)/6 Determine z, given that 1530z4 + 64z + 1285z3 + 676z*5 + 806z*4 - 1271z*4 + 6875z*3 + 2999z*4 + 5504z2 = 0. -2, -2/169, 0 Let o(g) be the third derivative of g7/1260 + g*6/90 + 2g*5/45 - 13g*3/6 + 23g*2. Let m(f) be the first derivative of o(f). Factor m(s). 2s(s + 2)(s + 4)/3 Let q(l) be the third derivative of l11/831600 - l10/126000 - l9/37800 + l5/6 + l*4/4 + 83l*2. Let t(d) be the third derivative of q(d). Factor t(b). 2b*3(b - 4)(b + 1)/5 Let l(d) be the second derivative of 0d*2 - 11d + 1/12d4 - 5/2d*3 - 3. Factor l(s). s(s - 15) Solve -7t2 - 18t*2 - 352 - 14t*2 + 40t*2 + 530t - 4t2 = 0 for t. 2/3, 176 Let t be -4 + ((-3 + 5)-2 - -4807). Factor -tb5 - 224b - 96b3 + 22b*4 + 60b*2 + 148b*2 + 4797b*5 + 96. -2(b - 3)(b - 2)4 Let f(o) be the second derivative of 1/12o*4 - 6 - 12/7o*2 + 53/42o*3 + 4o. Determine i, given that f(i) = 0. -8, 3/7 Let d(j) be the second derivative of 3/100j5 - 2 - 4/5j*3 + 0j*2 + 6j - 7/20j4. Factor d(p). 3p(p - 8)(p + 1)/5 Let s(h) = 3h2 + 20h - 2. Let f = 393 - 392. Let z(g) = -g*2 + 1. Let c(m) = fs(m) + 2z(m). Factor c(t). t(t + 20) Let g = -1099/58 - 38223/580. Let k = g - -341/4. Factor k - 1/5i4 - 3/5i*3 + 3/5i - 1/5i2. -(i - 1)(i + 1)*2(i + 2)/5 Let x(o) be the first derivative of -o*3 - 1617o*2 - 871563o - 2010. Factor x(p). -3(p + 539)2 Let a(w) be the third derivative of -1/24w*6 - 160w*4 + 8w*2 + 4w*5 - 2 + 10240/3w*3 + 0w. Factor a(g). -5(g - 16)3 Let w(q) be the first derivative of -q6/12 + 9q*5/10 - 19q4/8 + q3/2 + 5q2 - 6q + 505. Determine z so that w(z) = 0. -1, 1, 2, 6 Let b(q) be the third derivative of -q9/3024 + q7/252 - q*5/24 - 5q4/6 + q3/6 + 25q2 + 1. Let u(z) be the second derivative of b(z). Factor u(d). -5(d - 1)*2(d + 1)*2 Let y(i) = 5i*3 + 42i*2 + 80i. Suppose -30o - 4 = -28o. Let s(j) = 5j3 + 43j*2 + 80j. Let l(g) = os(g) + 3y(g). Factor l(q). 5q(q + 4)*2 Let o(u) = -7242u*2 - 14411u + 69. Let j(m) = 1811m2 + 3603m - 17. Let d(k) = 11j(k) + 3o(k). Factor d(c). -5(c + 2)(361c - 2) Let q be (-36)/(-220)((0 - 8) + 544/48). Let j(h) be the first derivative of qh2 - 18/11h + 15 - 2/33h3. Solve j(l) = 0. 3 Let v(a) = a3 + 4a*2 + 2a - 2. Let c be v(-2). Let g = 118 + c. Find n, given that -17n3 - 32n*3 + 80n + 45n5 + 160n*2 + 9n*3 - gn*4 = 0. -2/3, 0, 2 Factor 2440/7 + 1216/7p - 2/7p2. -2(p - 610)(p + 2)/7 Let m(x) be the first derivative of -x7/4620 + x6/330 - x5/220 - 5x*4/66 + 4x3 - x2/2 + 81. Let j(v) be the third derivative of m(v). Factor j(n). -2(n - 5)(n - 2)(n + 1)/11 Let h = -342249 - -342252. Factor 1/6d + 0 - 1/6dh + 0d*2. -d(d - 1)(d + 1)/6 Suppose -2p + 7p - 2l - 5787 = 0, 4623 = 4p + 5l. Let t = p - 1153. Find v such that 0v + 0 - 4/3v*2 - 8/3v*3 - 4/3v*t = 0. -1, 0 Let k be 3/(-7 - (-76)/10). Let g(d) = -3d*2 + 9d - 2. Let n(f) = 7f2 - 19f + 5. Let o(m) = kg(m) + 2n(m). Let o(y) = 0. What is y? 0, 7 Suppose -3j - 1295 = -371. Let m = j + 308. Solve -16/3v*2 - 4/3v - v*3 + m + 16/3v*4 + 7/3v*5 = 0. -2, -1, -2/7, 0, 1 Let i be 12/(-1) - 3/(480/(-1936)). Let n(b) be the first derivative of 32/5b + 12/5b2 - 3 + 0b*3 - ib*4. Find m such that n(m) = 0. -2, 4 Factor -1756n + 2114n3 - 351 + 387n*3 + 655n*3 - 3n*4 - 1058n*2 + 12n*4. (n - 1)(n + 351)(3n + 1)2 Let q(s) = -s3 - 4s2 - 2s + 3. Let d be q(-3). Suppose -2m - 4m*2 - 2m*2 - 1 + dm*2 + 5m*2 = 0. Calculate m. -1 Let f be -1(3 + -6 - (-3)/(-3)). Determine d so that 373 - 188 - 185 + 40d3 - 2d*f = 0. 0, 20 Let d be ((-10)/6)/(5/15). Let w be (d - 2)-1 - 4. Factor 7994o2 - 8010o*2 + 0o*3 + 16 + 2o*w - 2o. 2(o - 8)(o - 1)(o + 1) Let v be (53032/2841)/((-4)/(-126)). Factor -2/3s*3 - 167/3s*2 - 1148s + v. -(s + 42)*2(2s - 1)/3 Let y(b) = -b2 - 144b + 3285. Let f be y(20). Find k, given that fk + 1/2k*3 + 7/2k*2 + 0 = 0. -5, -2, 0 Suppose 2x + 2 = 0, -4 + 8 = 5o + x. Suppose 6i - 17 - o = 0. Factor 0s2 + 0s + 0 + 1/3s4 - 1/3si. s3(s - 1)/3 Let m(f) = -2f*2 + 26f + 6. Let z be 1(10 - (7 + -2)). Let j(n) = n2 - 10n - 3. Let q(g) = zj(g) + 2m(g). Factor q(a). (a - 1)(a + 3) Let n = 42 + -26. Let z be 18/n(-112)/(-84). What is d in 0 + zd - 1/6d*5 - 4/3d3 - d4 + d2 = 0? -3, -1, 0, 1 Let r(b) be the third derivative of b8/112 + 24b7/35 + 311b*6/20 + 276b*5/5 + 529b*4/8 + 592b*2 + 2. Factor r(i). 3i(i + 1)2(i + 23)2 Let m(y) be the third derivative of -y8/23520 + 3y6/70 - 13y*5/5 - 3y*2 + 13y. Let d(u) be the third derivative of m(u). Factor d(i). -6(i - 6)(i + 6)/7 Suppose -181 = u - j + 425, 4j + 2392 = -4u. Let g = u - -602. Factor 15/4r3 + 3/4r*4 + 0r + g + 9/4r2 - 3/4r*5. -3r*2(r - 3)(r + 1)2/4 Let r(p) = -5p - 34. Let m be r(-24). Let i be 48/22 + -2 - m/(-11). Factor -2d + 6d*2 - 8d - 8d2 - i. -2(d + 1)*(d + 4)
What is the next term in 165, 327, 489, 651, 813, 975? 1137 What is the next term in -282, -564, -846, -1128, -1410, -1692? -1974 What is next in 203, 815, 1831, 3251, 5075, 7303? 9935 What is the next term in -56, -119, -182, -245? -308 What is next in 121, 492, 1115, 1990, 3117, 4496? 6127 What comes next: -821, -825, -829, -833, -837? -841 What is the next term in 50, 120, 190? 260 What is next in -22, -13, 2, 23? 50 What is next in 1, 26, 91, 214, 413, 706? 1111 What comes next: 379, 754, 1127, 1498, 1867? 2234 What is next in 259, 261, 263, 265, 267? 269 What is next in 167, 268, 379, 506, 655, 832, 1043? 1294 What comes next: 102, 213, 326, 441, 558, 677? 798 What is next in 57, 53, 51, 51? 53 What is next in -277, -267, -243, -199, -129? -27 What comes next: 1072, 2136, 3200, 4264, 5328? 6392 What comes next: 53, 109, 165, 221, 277, 333? 389 What comes next: 12849, 25700, 38551? 51402 What is next in 819, 817, 815, 813? 811 What is the next term in 216, 431, 632, 813, 968, 1091? 1176 What is the next term in -835, -810, -783, -754, -723, -690? -655 What is the next term in -62, 2, 108, 256? 446 What comes next: -35, -70, -129, -212, -319? -450 What comes next: -53, -65, -55, -23, 31, 107? 205 What is the next term in -7, -38, -93, -172, -275? -402 What is next in -58, -85, -114, -145, -178? -213 What comes next: 13, 54, 123, 220, 345, 498, 679? 888 What is the next term in -45, -91, -167, -273, -409, -575, -771? -997 What comes next: -613, -599, -585? -571 What is the next term in -4, -1, 2? 5 What comes next: 462, 428, 396, 366, 338, 312? 288 What is the next term in -23, -51, -79? -107 What comes next: -16, -4, -2, -16, -52, -116, -214, -352? -536 What is next in -99, -115, -117, -99, -55, 21, 135, 293? 501 What is the next term in 68, 64, 58, 50, 40? 28 What comes next: -864, -1723, -2566, -3387, -4180, -4939, -5658, -6331? -6952 What is the next term in 1482, 2971, 4460, 5949? 7438 What is next in -481, -962, -1443, -1924, -2405? -2886 What is the next term in -114, -215, -314, -411? -506 What is next in -20, -26, -58, -128, -248, -430? -686 What is next in -36, -66, -86, -96, -96, -86, -66? -36 What is the next term in 412, 836, 1262, 1690, 2120, 2552? 2986 What comes next: 15, 5, -5? -15 What is next in -187, -747, -1689, -3019, -4743, -6867? -9397 What is the next term in 510, 1044, 1578, 2112, 2646, 3180? 3714 What comes next: 1116, 1123, 1140, 1173, 1228, 1311, 1428? 1585 What is next in -45, -88, -127, -162, -193? -220 What is next in 190, 118, -2, -170, -386? -650 What comes next: 153, 113, 55, -15, -91, -167, -237, -295? -335 What is next in 87, 106, 127, 150, 175, 202, 231? 262 What comes next: -1150, -1146, -1140, -1132, -1122? -1110 What is next in 135, 138, 143, 150, 159, 170? 183 What is the next term in -949, -1899, -2847, -3793, -4737, -5679, -6619? -7557 What comes next: 54, 69, 94, 135, 198? 289 What comes next: -517, -1025, -1525, -2011, -2477, -2917, -3325? -3695 What is the next term in -4, -10, -16, -22, -28, -34? -40 What is the next term in -37, -74, -113, -154, -197, -242, -289? -338 What is next in -10, -47, -152, -361, -710, -1235? -1972 What comes next: -72, -51, 6, 117, 300, 573? 954 What comes next: -23, -30, -49, -86, -147, -238, -365, -534? -751 What comes next: 470, 470, 468, 464, 458? 450 What comes next: -1, -2, -1, 2? 7 What is the next term in -2762, -5527, -8292, -11057? -13822 What is the next term in 167, 163, 157, 149, 139, 127, 113? 97 What is next in -66, -49, -12, 51, 146, 279? 456 What is the next term in -28, -40, -38, -16, 32, 112, 230? 392 What is next in -114, -289, -526, -831, -1210, -1669, -2214? -2851 What is the next term in -1755, -3508, -5261? -7014 What is the next term in -106, -105, -104, -103, -102, -101? -100 What is next in -145, -143, -137, -127, -113, -95? -73 What is the next term in -8, 0, 12, 28, 48? 72 What is the next term in -23116, -23111, -23104, -23095, -23084, -23071, -23056? -23039 What comes next: 1094, 1093, 1090, 1085? 1078 What is the next term in 157, 315, 473? 631 What is next in 74, -18, -176, -406, -714, -1106, -1588, -2166? -2846 What comes next: 329, 335, 343, 353, 365? 379 What comes next: 21, 43, 79, 129, 193, 271? 363 What is the next term in -4998, -9996, -14994, -19992, -24990? -29988 What comes next: -17, -57, -123, -215, -333, -477? -647 What is the next term in 789, 793, 799, 807? 817 What is next in 78, 115, 148, 177? 202 What comes next: 4, 1, 2, 7, 16, 29, 46? 67 What comes next: -37, -80, -123, -166, -209? -252 What is next in 441, 445, 461, 495, 553? 641 What comes next: -1, 1, 5, 11, 19, 29, 41? 55 What is next in 82, 80, 76, 70, 62? 52 What comes next: 201, 404, 607, 810, 1013, 1216? 1419 What comes next: -8067, -8056, -8033, -7992, -7927, -7832? -7701 What is the next term in 1025, 2044, 3063, 4082, 5101, 6120? 7139 What comes next: 38, 7, -54, -151, -290, -477, -718? -1019 What is next in 25, 76, 159, 286, 469, 720, 1051? 1474 What is next in 337, 667, 991, 1309, 1621, 1927, 2227? 2521 What is the next term in 8, 2, -22, -70, -148, -262, -418, -622? -880 What is the next term in -166, -167, -168, -169, -170, -171? -172 What is next in 79, 137, 249, 427, 683, 1029, 1477? 2039 What comes next: -1749, -3415, -5093, -6789, -8509? -10259 What comes next: 1, 4, -1, -20, -59, -124? -221 What is next in -11, -124, -319, -602, -979, -1456? -2039 What is the next term in 53, 106, 159, 212, 265? 318 What is next in -25, -89, -195, -343, -533, -765? -1039 What is the next term in 141, 140, 141, 144, 149, 156, 165? 176 What is next in -354, -707, -1060, -1413, -1766, -2119? -2472 What comes next: -132, -272, -422, -588, -776? -992 What comes next: -691, -1388, -2099, -2830, -3587, -4376, -5203, -6074? -6995 What comes next: 375, 381, 399, 435, 495, 585? 711 What comes next: -1159, -2316, -3473, -4630, -5787, -6944? -8101 What comes next: -190, -193, -206, -235, -286, -365, -478, -631? -830 What is the next term in 32, 24, 14, 2, -12, -28, -46? -66 What comes next: -937, -1874, -2811, -3748? -4685 What is next in 13, 6, -7, -26, -51? -82 What is next in -28, -15, 12, 59, 132, 237, 380? 567 What comes next: -56, -74, -96, -122, -152, -186? -224 What is the next term in -70, -58, -58, -76, -118? -190 What comes next: 2468, 2469, 2470, 2471? 2472 What is the next term in 435, 428, 419, 408, 395, 380? 363 What is the next term in -8353, -8341, -8315, -8269, -8197, -8093? -7951 What comes next: -15, -27, -31, -27, -15? 5 What is next in -21, -28, -23, 0, 47, 124, 237, 392? 595 What is the next term in 26, -18, -90, -190, -318, -474, -658? -870 What is the next term in -43, -45, -55, -79, -123, -193, -295, -435? -619 What comes next: -71, -79, -87, -95? -103 What comes next: 478, 1910, 4296, 7636, 11930? 17178 What is the next term in 314, 309, 304, 299, 294? 289 What is the next term in -1124, -2246, -3358, -4454, -5528, -6574, -7586, -8558? -9484 What is the next term in 283, 1007, 2205, 3871, 5999? 8583 What is the next term in -77, -152, -229, -308, -389, -472? -557 What is the next term in -6, 16, 60, 132, 238, 384? 576 What comes next: 862, 863, 864, 865, 866? 867 What comes next: -844, -840, -826, -796, -744, -664, -550? -396 What is next in 36, 44, 52, 60? 68 What comes next: 33, 72, 109, 144? 177 What is the next term in 534, 529, 510, 471, 406, 309, 174, -5? -234 What is the next term in -276, -557, -838? -1119 What is the next term in -1894, -1892, -1890, -1888, -1886, -1884? -1882 What is next in -370, -380, -390, -400, -410, -420? -430 What comes next: -320, -278, -202, -86, 76, 290? 562 What comes next: 201, 191, 179, 165? 149 What comes next: 334, 318, 302, 286, 270? 254 What comes next: 607, 609, 625, 661, 723, 817, 949, 1125? 1351 What is next in 24, 16, 14, 18? 28 What comes next: -183, -185, -175, -147, -95? -13 What is next in 4, -4, -22, -50, -88, -136? -194 What is next in 214, 428, 642, 856, 1070, 1284? 1498 What is the next term in -46, -40, -34, -28, -22, -16? -10 What comes next: 411, 431, 461, 507, 575, 671, 801, 971? 1187 What is next in 26313, 26311, 26309, 26307, 26305? 26303 What is next in 5776, 5775, 5774, 5773, 5772, 5771? 5770 What is the next term in 1115, 1132, 1167, 1226, 1315, 1440? 1607 What is next in -68, -148, -238, -344, -472, -628, -818, -1048? -1324 What is next in -23, -86, -149, -212? -275 What is the next term in 73, 149, 223, 295, 365? 433 What is next in -17, -15, -1, 31, 87, 173, 295, 459? 671 What comes next: -4457, -4451, -4445, -4439? -4433 What is next in -13, 19, 61, 119, 199, 307? 449 What is the next term in 16, 38, 74, 124, 188, 266, 358? 464
Let t(m) = -129m2 + 4m - 1. Let b be (-2)/(-3)(2 + 1). Let q = 1 + b. Let o be t(q). What is o rounded to the nearest 100? -1200 Let y be 2 + (-3)/(6/(-4)). Let d(i) = -2i*2 + 2i + 4. Let n be d(y). What is n rounded to the nearest 100? 0 Let f = 1745.049975 + -1745. Let a = f - 0.05. Let o = 0 - a. What is o rounded to five dps? 0.00003 Let f = 0.114 + -0.1140295. Round f to six dps. -0.00003 Let n = -1.948 + 2. Let q = n + -0.079. Round q to 2 decimal places. -0.03 Let w(f) = -85000f. Let m = 21 + -31. Let i be w(m). What is i rounded to the nearest one hundred thousand? 900000 Let k(o) = -o3 + 2o*2 - 5o - 10. Let d be k(5). What is d rounded to the nearest one hundred? -100 Let x = 0.35 + 0.81. Round x to one decimal place. 1.2 Let o = 25.214 + -25. Let y = 13562783.21400141 - 13562783. Let u = o - y. Round u to seven dps. -0.0000014 Let u = -109 - -109.0071. Round u to 3 decimal places. 0.007 Let x(i) = -641i + 4. Let c be x(-6). Suppose -2o = -7o + c. Round o to the nearest 100. 800 Let h = 2 + -2.1. Let g = h - -0.6. Let o = g + -0.49996. What is o rounded to 4 dps? 0 Suppose -4m + 3435 = -4925. Round m to the nearest one hundred. 2100 Let a = -2229.941419 - -2133.9414233. Let z = 223 + -127. Let b = a + z. Round b to six dps. 0.000004 Let h = 13 + -12.999988. What is h rounded to five decimal places? 0.00001 Let w = 1995543 + -607289. Suppose -3r + x - 2219997 = 0, 2r + 2x = -91752 - w. What is r rounded to the nearest one hundred thousand? -700000 Let h(n) = 347n*2 + n - 4. Let w be h(-4). Suppose -4k - w = 4f, -5k + 0f - 2f - 6942 = 0. What is k rounded to the nearest 100? -1400 Let d = -115.22 + 113. Let c = 1.6 + d. What is c rounded to 1 decimal place? -0.6 Suppose g = -0g + 5. Suppose -2k - p - 3p = 24, -20 = gk + 2p. Let r be (-3)/((-6)/(-1540004)) - k. Round r to the nearest 100000. -800000 Let x = 5.3926 - 5.4. What is x rounded to three decimal places? -0.007 Let c = 47 - 31. Let f = 15.9999999 - c. Round f to 6 dps. 0 Suppose -4r - 4f - 4 = 0, 3 = -r + 2f + 14. Suppose 16 = -rx - 32. Round x to the nearest ten. -20 Let u = -352379.885 + 344984512.885. Let l = -344632117.0000023 + u. Let i = 16 - l. What is i rounded to six dps? 0.000002 Let m = -54484.0019 + 54478. Let o = 6 + m. Round o to 3 decimal places. -0.002 Let c = 48825274477308.999989 - 48825254704664. Let x = c + -19772663. Let v = -18 - x. What is v rounded to 6 dps? 0.000011 Let x(o) = -41o*3 - 3o*2 + 3o + 4. Let i be x(3). Let z = i + -489. Round z to the nearest 100. -1600 Suppose 4n + 18608 = 3u, 0 = -3u + 2n - 5n + 18594. Round u to the nearest one thousand. 6000 Let n(d) = 62500d3 + d2 + 3d - 4. Let x be n(-4). Round x to the nearest one million. -4000000 Suppose k = 4k - 63. Let d be 5466/k - 2/7. Suppose 3p - 4c - 148 = 0, -2c = -5p + 2c + d. What is p rounded to the nearest ten? 60 Let b = 1.9946 + -2. What is b rounded to three decimal places? -0.005 Let p be ((-3)/2 - -1)0. Suppose -3q - a = -154, 4q + 5a - 220 = -pq. Round q to the nearest ten. 50 Suppose -j = -g - 6j - 509975, 0 = 5g + 2j + 2549990. What is g rounded to the nearest one hundred thousand? -500000 Let p = 14 + 69. Round p to the nearest ten. 80 Let l = 334482.9229789 - -0.0770211. Let r = l - 334412.9869. Let w = r - 70. Round w to three dps. 0.013 Suppose 3z + 2b = -5899135, -6z + z + 3b - 9831879 = 0. Let j = 3226377 + z. Round j to the nearest 100000. 1300000 Let r = 4.6136 + -59.6646. Let u = -55 - r. Let j = u - 0.051077. Round j to five decimal places. -0.00008 Let v be (-17207)/(-2)(-9 - -5). Let j = v - -23014. Round j to the nearest one thousand. -11000 Let r(v) = -v*2 - 8v - 4. Let g be r(-7). Suppose 0 = 5y + 4n - 224980, -gy + 69954 + 65021 = 5n. What is y rounded to the nearest 10000? 50000 Let u = -207.7 - -208.5488. Let b = u + -0.988764. Let p = b - -0.14. What is p rounded to five decimal places? 0.00004 Let v = -191 - -13. Let b = v + 177.99887. What is b rounded to four dps? -0.0011 Let o = -0.43200301 - -0.432. What is o rounded to six dps? -0.000003 Suppose 5a + 5 = 0, 2a - 11 = 3i + 5. Let b = -3 - i. Suppose -bn + 6n - 1380 = 0. Round n to the nearest 100. 500 Let q = 0.231 - -9.469. Let j = 13.62 - q. Let u = -0.12 + j. Round u to the nearest integer. 4 Suppose -2m = -6m + 8. Let o(c) = -m + 0 - c + 6c*2 + 3c*2. Let u be o(3). What is u rounded to the nearest ten? 80 Let b = 3.6 + -2. Let f = -1.60015 + b. What is f rounded to four dps? -0.0002 Suppose -4r + 2196 = 716. Round r to the nearest one hundred. 400 Let z = -2.5 - -2.505. Round z to 3 decimal places. 0.005 Let g = 2272 - 5964. Let m = -1192 - g. Let l be m(1678 - -2)/(-2). Round l to the nearest 1000000. -2000000 Let q = 3 - -1. Let w be (-4)/(-16) + 15/q. Suppose -wp + 2524 = m, 0 = -3p + 2m + 753 + 1129. What is p rounded to the nearest 100? 600 Let f = -10 + 9.99999941. What is f rounded to six decimal places? -0.000001 Let z = -1 - -1.00000056. Round z to 7 dps. 0.0000006 Let h = -1.44 + -0.06. Let o = h - -5.2. What is o rounded to 0 decimal places? 4 Let u = 23.9 + 0.4. Let o = -25 + u. Round o to the nearest integer. -1 Let c = 6.366 + -6.45186. Let v = -0.1063 - c. Let u = -0.02 - v. Round u to 4 decimal places. 0.0004 Suppose k - 6z = -z - 11, 5k - 5z = 5. Suppose -5g + kw = -0g - 3912, -3g + 2337 = w. What is g rounded to the nearest 100? 800 Let a be (4 - 304/(-20))-5. Round a to the nearest 10. -100 Suppose 2q = 3q. Suppose -4n - 50246 + 170254 = 3i, q = 5n - 10. Round i to the nearest 10000. 40000 Suppose -g - 15792 = -217. Let a = g - -9375. Round a to the nearest 1000. -6000 Let s = -129.991 - -130. Round s to 3 dps. 0.009 Let v(r) = 99001r*3 + 2r*2 + 2r + 1. Let w be v(-1). What is w rounded to the nearest 10000? -100000 Let g = -0.9 + -0.1. Let l = g - -1. Let k = l + -0.00000075. What is k rounded to seven dps? -0.0000008 Let b = 75.1 + -90. What is b rounded to zero dps? -15 Let d = 0.022 + -29.822. What is d rounded to 0 dps? -30 Let w = -345.0217 + 345. Round w to 3 dps. -0.022 Let g = -1.99 - -1.9. What is g rounded to 2 dps? -0.09 Let f(t) = 784t3 - 10t*2. Let o be f(-10). What is o rounded to the nearest 10000? -790000 Let g(h) = 530000h*3. Let a be g(1). What is a rounded to the nearest 100000? 500000 Let i be (-5 - -3)(-19)/2. Suppose -2s - 17206 = 4u, i = -4s + 7. Round u to the nearest 1000. -4000 Let p = -102.00029 + 102. What is p rounded to four decimal places? -0.0003 Let j = 1491.1 + -1555. Let u = 0.13 - -68.87. Let i = u + j. Round i to zero decimal places. 5 Let x = -0.515 - 49.685. Let o = -45 - x. Let s = 1.7 - o. What is s rounded to the nearest integer? -4 Let u = -2 - -5. Let h be -2 + (u - 2 - -2). Let q be (h - (-2)/6)-630. What is q rounded to the nearest 100? -800 Let p = -2441346459 + 2441346498.47135988. Let v = -39.38136 + p. Let m = 0.09 - v. What is m rounded to 7 decimal places? 0.0000001 Let n = 12363.049996 + -12363. Let j = -0.05 + n. Round j to five decimal places. 0 Let d = -0.0312 - -20.9312. Let k = d + -28. What is k rounded to 0 decimal places? -7 Let d = -32.8 + 37. Round d to 0 decimal places. 4 Let m = -2.08 + 0.08. Let c = m - -4. Let f = 2.00000056 - c. What is f rounded to 7 dps? 0.0000006 Let y = -372869 - -571496. Suppose -2v + 525994 = -5q + 128753, -4q = v - y. Let w = v + -127623. Round w to the nearest 10000. 70000 Let d = 7 - 13. Suppose -2x - 4u - 6 = 0, 0x + 3 = -x + 3u. Let i be -40x/(d/(-20000)). Round i to the nearest one million. 0 Suppose 2d + 213 = 15. Let k = d + -73901. Round k to the nearest ten thousand. -70000 Let s = 35707 + -13907. Round s to the nearest 1000. 22000 Let v = 15.8 + 2.2. Let p = -13.5 + v. What is p rounded to the nearest integer? 5 Let o = 7.6 + -14.38. What is o rounded to 0 decimal places? -7 Let v = -0.5 - 5.5. Let q = 3 + v. Let o = -2.9996 - q. What is o rounded to 4 decimal places? 0.0004 Let t = 389.94 - 385. Round t to the nearest integer. 5 Let n = -7.5 - -6. Let w = n + 1.500058. Round w to 5 decimal places. 0.00006 Let f(k) = 9k - 12. Suppose 13v - 10v - 33 = 0. Let y be f(v). Round y to the nearest 10. 90 Let y = -6.050000557 + 6.05. What is y rounded to seven dps? -0.0000006 Let z = -2 + 1.7. Let i = -0.2999996 - z. What is i rounded to seven decimal places? 0.0000004 Let q = 52.095 - 52. Round q to 2 decimal places. 0.1 Let q = -246.6 - -151. Let g = q + -0.4. Let c = g - -96.0000083. What is c rounded to 6 dps? 0.000008
Let c(x) = -374x2. Let p(g) = -2g*2. Determine c(p(a)). -1496a*4 Let g(w) be the first derivative of -3w*2/2 + 5. Let r(s) = -s. Calculate r(g(x)). 3x Let v(s) = 6s. Let a(b) = -3b + 120. What is v(a(d))? -18d + 720 Let k(a) = 6a. Let t(s) = 36s - 2. What is k(t(p))? 216p - 12 Let w(b) = 4b2 + 3b*2 - 14b*2. Let q(r) = -2r. Determine q(w(n)). 14n2 Let k(p) be the first derivative of 1 + 5 - p2 + 3p*2 - 2. Let m(n) = -2n*2. Give m(k(v)). -32v2 Let w(v) be the third derivative of v5/60 + 7v4/12 - 5v*2. Let j(s) = -2s*2. What is w(j(i))? 4i*4 - 28i*2 Let c(w) = -14w*2 + 9w*2 + 4w*2. Let d(q) = -36q*2. Determine d(c(s)). -36s*4 Let s(v) = -11v*2. Let m(q) = -3q*2 - 351q + 351q. What is s(m(l))? -99l*4 Let j(l) = -5l*2. Let a(v) = -498v. Calculate j(a(d)). -1240020d2 Let y(j) = -3j*2 + 3j*2 + 8j2. Let r(g) be the first derivative of g2 - 1. Determine y(r(t)). 32t2 Let u(h) = -2h. Let k(r) = r*2 + 5. What is u(k(z))? -2z*2 - 10 Let b(a) = -28a*2 - 3a + 3. Let j(h) = -225h2 - 25h + 25. Let o(z) = -25b(z) + 3j(z). Let d(i) = 2i. Give d(o(g)). 50g*2 Let u be 30/1224/5. Let t(q) = uq + 6q - 20q. Let v(p) = -4p. Determine t(v(d)). 8d Let s(x) = -69x*2. Let a(q) = -18q*2. Determine s(a(f)). -22356f4 Let l(w) be the first derivative of w2 - 2. Let i(q) = 84q. Calculate l(i(v)). 168v Let g(d) be the second derivative of d6/360 - d3/2 - 3d. Let b(f) be the second derivative of g(f). Let r(l) = -5l. Calculate r(b(z)). -5z2 Let q(b) = -16b*2. Let j(m) = 179m. What is j(q(h))? -2864h2 Let g(m) = 101m*2 + 6m. Let a(d) = 2d2 + d. Let j(x) = 6a(x) - g(x). Let u(q) = -q*2. Calculate u(j(n)). -7921n*4 Let a(i) = 11i*2. Let f(q) = -q + 180. Give f(a(o)). -11o*2 + 180 Let m(y) = -2y*2. Let f(d) = -3076d. Determine m(f(l)). -18923552l2 Let g(h) = 7h. Let q(a) = -1885a2. What is g(q(n))? -13195n2 Let i(c) be the first derivative of -c4/12 + 3c - 3. Let w(z) be the first derivative of i(z). Let r(l) = 5l. Give r(w(p)). -5p2 Let p(x) = 2x. Let j(u) = 3u + 2u - 5u + u2. Determine p(j(f)). 2f*2 Let z(i) = -8 + 8 - 3i. Let x(l) = -2l2. Determine x(z(f)). -18f2 Let k(o) be the third derivative of -o5/30 - 2o2. Let v(i) = 3i*2 + 2i*2 - 3i*2. Calculate v(k(c)). 8c4 Let j(b) = -b2. Let f(x) be the second derivative of 0x3 + 0x*2 - 5/12x*4 + 0 + 6x. What is f(j(l))? -5l4 Let c(x) = -17x. Let f(a) = -41a. Determine c(f(m)). 697m Let q(l) = l. Suppose 36 = -2z - 3o, -4z - 2o = -2z + 36. Let b = -11 - z. Let j(d) = b - 6d - 7. Give j(q(g)). -6g Let k(m) = -4m - 28. Let r(f) = -2f2. Give r(k(c)). -32c*2 - 448c - 1568 Let n(g) be the second derivative of -3g4/4 + 2g. Let s(b) = -2b. Determine s(n(v)). 18v*2 Let k(s) = -10s*2 + 2s*2 + 10s*2. Let y(x) = -3x + 2. Give k(y(f)). 18f2 - 24f + 8 Let v(x) = -2432x2. Let f(d) = 3d*2. Determine f(v(k)). 17743872k*4 Let r(j) = 2j*2. Let v(d) be the first derivative of d + 2. Let x(l) = -4l - 3. Let h(i) = -3v(i) - x(i). Determine h(r(c)). 8c*2 Let h(p) = -834p + 834p - 2p*2. Suppose -b = -5s - 26, -3b + 2s + 13 = -0b. Let q(u) = -b + u2 + 1. What is q(h(y))? 4y4 Let b(m) = m2. Let g(j) = -13j - 4. Let i(p) = -27p - 7. Let o(q) = -7g(q) + 4i(q). Determine o(b(w)). -17w2 Let m(t) = t2. Let a(i) = 40i - 26. Give m(a(w)). 1600w2 - 2080w + 676 Let i(m) = -m + 1. Let u(g) = 7g2 - 28g + 28. Let k(w) = 28i(w) - u(w). Let r(s) = 155 - s2 + 155 - 310. Calculate k(r(z)). -7z*4 Let k(x) = -4x. Let f(a) = 54a + 4a*2 - 54a. Determine f(k(m)). 64m2 Let j(z) = 4z. Let p(i) = -56i. Calculate p(j(a)). -224a Let c(k) = -k. Let h(t) = 210t2. Give h(c(i)). 210i2 Let u(l) be the first derivative of -l3 + 1. Let q(w) = -15w - 12. Let i(d) = d + 1. Let x(a) = -12i(a) - q(a). Give u(x(k)). -27k2 Let t(q) be the third derivative of q4/12 + q3 + 23q2. Let l(x) = -x2. Give l(t(p)). -4p2 - 24p - 36 Let w(q) = 3q2 + 2q - 2. Let u(o) = 3o2 + 3o - 3. Let h(d) = -2u(d) + 3w(d). Let j(y) = -y*2 - 22y. What is j(h(f))? -9f4 - 66f*2 Let d(g) = 5288g. Let j(z) = -3z2. Determine j(d(s)). -83888832s*2 Let q(r) = -9r + 5. Let p(s) = -4s + 2. Let n(f) = 5p(f) - 2q(f). Let l(w) = -3w + 2w + 2w. Determine n(l(k)). -2k Let n(k) = 299k - 1. Let u(m) = m. Determine n(u(f)). 299f - 1 Let l(w) be the first derivative of -w2 + 3. Let q(u) = u3 + 3u*2 + u. Let i be q(-2). Let h(b) = -3b*2 + 0b2 + bi. Determine h(l(r)). -8r2 Let h(b) = b2 + 1. Let r(s) = -1. Let c(u) = -h(u) - r(u). Let v(o) = 2o*2 + 9o*2 - 12o2. Calculate c(v(x)). -x4 Let r(f) = 2f2. Let k(o) be the first derivative of -3o*3 - 8. What is k(r(b))? -36b*4 Let v(z) = 609z*2 + 77z + 77. Let c(l) = -16l2 - 2l - 2. Let p(h) = 77c(h) + 2v(h). Let m(x) = -3x. Give m(p(y)). 42y*2 Let d(a) = -2a. Let z(s) = -3. Let g(t) be the second derivative of t3/6 - t2/2 - 2t. Let y(p) = 3g(p) - z(p). Calculate d(y(w)). -6w Let x(d) be the third derivative of -d5/15 + 3d*2. Let m(k) = 2k - 5k + k. Calculate x(m(s)). -16s*2 Let t(c) = -4c*2. Let q(k) = 49k*2. Calculate q(t(a)). 784a*4 Let n(c) = 3c*2 + 2c. Let a(f) = 7f2 + 5f. Let s(t) = 4a(t) - 10n(t). Let d(r) = 9r. Give d(s(k)). -18k*2 Let n = 16 - 15. Let k(j) = -n - 2 - j + 3. Let s(t) = 4t. Give k(s(f)). -4f Let j(u) = -15u. Let t(g) be the first derivative of -5g3/3 + 17. Give j(t(p)). 75p*2 Let s(p) = -5p. Let u(z) = 14z. Let n(l) = 17s(l) + 6u(l). Let v(m) be the second derivative of 0 - 2m + 0m3 + 0m*2 - 1/6m*4. What is n(v(f))? 2f*2 Let w(n) = 2n. Let j(m) = 7m2 - 8m. Let x(t) = t*2 - t. Let g(r) = -3j(r) + 24x(r). Determine w(g(i)). 6i*2 Let h(r) = -2r2. Let q(p) be the second derivative of p2 + 0p4 + 1/60p*5 + 0p*3 + 0 - 2p. Let c(i) be the first derivative of q(i). Give c(h(v)). 4v4 Let g(t) = -t. Let o(u) be the third derivative of -u4/6 - 6u*2. Determine g(o(r)). 4r Let f(v) = -47v2. Let w(j) = 3j*2. What is w(f(c))? 6627c*4 Let f(b) = -2b. Suppose -5q = -4w + 41, w + 2q = -0w - 6. Let s(l) be the first derivative of -l - w + l + 0l - l3. Give s(f(d)). -12d*2 Let t(o) = 61o. Let a(k) = 13k - 3. Give a(t(m)). 793m - 3 Let f(b) = 2b. Let u be (-2 - (1 - -1))/(-1). Let c = u - 1. Let l(v) = 2v*2 - cv*2 + 5v*2. Determine f(l(j)). 8j*2 Let j(p) = -p. Suppose 2k - 13 + 1 = 0. Let u be (-14)/(-4) + k/(-12). Let r(a) = -a + ua + a - 5a. Give r(j(b)). 2b Let x(d) = -3d. Let p(t) = 293 - 293 - 2t. Give p(x(z)). 6z Let i(p) = -p*2. Let c(s) = -2s - 37. Calculate i(c(j)). -4j2 - 148j - 1369 Let d(k) = 49k. Let w(o) = -19o*2 + 2o. Give d(w(i)). -931i2 + 98i Let c(n) = -n*2. Let h(g) = g + 12. Let q be h(-9). Suppose u + 3 = 5. Let i(f) = 6f*2 + q - uf*2 - 3. Determine c(i(o)). -16o*4 Let m(l) = 3l*2 + 0l2 - l2. Let v(h) = 5h2 + 2h. Give m(v(r)). 50r4 + 40r*3 + 8r2 Let j(q) = q2 + 2. Let l(t) = -5t2 - 11. Let i(p) = -11j(p) - 2l(p). Let d(m) = -8m*2. Calculate d(i(f)). -8f4 Let a(s) = -s2. Let p(c) = -c. Let o(i) = -2i2 - 2i. Let m(f) = -o(f) + 2p(f). Give m(a(h)). 2h*4 Let a(l) = -4l*2. Suppose 0 = -4m - 4s + 28, 3m = 5m - 2s + 2. Let c(x) = 2x - m + 3 - 3x. Calculate a(c(k)). -4k2 Let a(y) = 6y*2. Let r(v) = -4v - 12. Determine r(a(o)). -24o2 - 12 Let l(z) be the second derivative of z3/3 - 4z. Let p(f) = -5f. Let a(g) = -4g. Let d(w) = -3a(w) + 2p(w). What is l(d(h))? 4h Let k(g) = -18g. Let b(m) be the first derivative of m*2 - 3. Determine k(b(y)). -36y Let g(u) = -u. Let v(y) = 13y2. Give g(v(j)). -13j*2 Let b(p) = -2p. Let j(a) = a - 2. Let w(v) = -3. Let m(z) = 3j(z) - 2w(z). Calculate b(m(d)). -6d Let i(s) = 2s. Let a(h) = 68h2 + h. What is i(a(m))? 136m*2 + 2m Let o(c) = -38c2 + 2657c - 2657c. Let p(a) = -a2. Give o(p(k)). -38k*4 Let i(x) = 2x - 13. Let n(m) = m - 6. Let t(j) = -6i(j) + 13n(j). Let v(k) = 4k. Determine v(t(b)). 4b Let m(b) = 4b. Let f be (-576)/(-99) + (-2)/(-11). Let a be (28/8)/(3/f). Let h(g) = ag - 5g - 4g. Give m(h(u)). -8u Let y(q) = q2. Let z(v) = 946v. Calculate z(y(o)). 946o*2
Let w(o) = -o*2. Let p = 26 + -3. Let r = p - 13. Let j(t) = -10t + rt + t2. Determine w(j(i)). -i4 Let s(o) = -11o. Let d(l) = -5l. Let k(q) = 9d(q) - 4s(q). Let b(a) = -8a*2. Calculate k(b(t)). 8t*2 Let o(z) be the second derivative of -5z3/6 - z. Let a(s) be the third derivative of s5/60 - 61s2 + 1. Determine a(o(n)). 25n*2 Let o(m) = -4m*2 + 7m. Let z(x) = -3x2 + 5x. Let p(v) = 5o(v) - 7z(v). Let u(s) be the first derivative of 0s2 + 0s + 3 + 2/3s3. Give p(u(g)). 4g*4 Let k(w) = 3w. Let l(j) = -j*2 - 9j + 12. Let q be l(-10). Let a(z) = -z*q - 5z*2 + 3z*2. What is a(k(b))? -27b*2 Let m(c) = 12925 - 4c*2 - 12925. Let o(f) = -7f. What is m(o(l))? -196l2 Let l(z) = -5z - 8. Let g(j) be the second derivative of j*3/3 + 54j. What is l(g(d))? -10d - 8 Let h(f) = 37f*2 - 14. Let u(q) = 3q*2. Determine u(h(x)). 4107x*4 - 3108x*2 + 588 Let n(c) = -2c. Let t(v) = -v*2 - 6v + 2. Let q be t(-6). Let o(w) = -21w2 + 13w*2 + 5w*q. What is o(n(r))? -12r*2 Let z(w) = -3w*2 - 311. Let p(x) = -2x*2. Calculate p(z(o)). -18o*4 - 3732o*2 - 193442 Let z(c) = -10c. Let a(x) = x*2 + 3x. Let r(n) = n. Let t(m) = 2a(m) - 6r(m). Calculate z(t(o)). -20o2 Let u(t) be the second derivative of -2t + 2/3t3 + 0 + 0t*2. Let y(j) = -2j*2. Determine u(y(q)). -8q*2 Let f = -18 + 20. Let d(b) = -2b*f + 3b*2 - 3b*2. Let o(v) = -8v*2. What is o(d(c))? -32c*4 Let a(w) = -66 + 6w + 66. Let p(k) = -k. Determine p(a(m)). -6m Let t(a) = 6a*2. Let c(u) = 4u*2 - 5u*2 + 4u*2. Calculate t(c(s)). 54s*4 Let u(g) = 33g. Let v(x) = -19x. Give u(v(p)). -627p Let k(s) = 2s - 33. Let t(l) = 131l*2. Calculate t(k(n)). 524n*2 - 17292n + 142659 Let v(x) = 14x2. Let h(l) = -4l*2. What is h(v(i))? -784i4 Let k(f) be the first derivative of -f3/3 + 1. Let l(m) be the second derivative of 0m2 - 1/6m*3 + 0 - 2m. Give l(k(p)). p*2 Let y(m) = 64m. Let v(b) = -52b2 + 4b. Determine v(y(k)). -212992k2 + 256k Let n(t) = 4t. Let y(b) = -50b*2. What is y(n(m))? -800m2 Let y(k) = -k2. Let a(b) be the second derivative of b*4/6 + 11b*2/2 + 21b. Calculate a(y(l)). 2l4 + 11 Let q(w) = 2w*2. Let s(u) = 10u*2 + u. What is s(q(k))? 40k*4 + 2k*2 Let l(d) = 4d*2 - 6d. Let w(m) = -2m. What is l(w(b))? 16b*2 + 12b Let g(n) = -20n2. Let h(j) = 5j - 3. What is g(h(d))? -500d2 + 600d - 180 Let p(n) = -1440n - 112. Let c(d) = 64d + 5. Let v(q) = 112c(q) + 5p(q). Let b(g) = -2g2. Give v(b(i)). 64i*2 Let v(m) be the first derivative of -13m*2 - 34. Let r(o) = 2o. Determine v(r(d)). -52d Let m(g) = -6g. Let v(a) = 2a - 290. Give v(m(b)). -12b - 290 Let n(l) = -l. Let y(x) = 3x2 - x + 1. Let k be y(1). Suppose -2s + 6 = 0, -ks + 3 + 5 = -d. Let f(h) = -d - h + 1. Give n(f(r)). r Let s(k) = -13k*2 + 3. Let h(g) = 38g*2 - 10. Let r(q) = 3h(q) + 10s(q). Let j(v) = -2v. Give r(j(m)). -64m2 Let a(m) = 1595m*2. Let k(h) = -3h*2. What is a(k(w))? 14355w*4 Let s(y) = -4y. Let p(t) be the second derivative of t*3/3 - 3t. Determine s(p(v)). -8v Let t(j) = -3j. Let p = 6 - 11. Let g be (-2)/((10/3)/p). Let x(y) = 2y2 + gy*2 - 3y*2. Give t(x(r)). -6r*2 Let q(y) = -3y + 31. Let u(w) = 2w2. What is u(q(h))? 18h*2 - 372h + 1922 Let j(g) = -3g + 0g - 2g. Let i(k) = 1328 - k - 1328. What is j(i(c))? 5c Let h be (-2 - 0 - -4)10. Let f(g) = -h + 20 + 3g. Let q(i) = 2i. Calculate f(q(a)). 6a Let u(n) be the third derivative of n*4/12 - 22n*2. Let d(f) = -4f. What is u(d(k))? -8k Let f(u) = -1307u. Let x(j) = j. Calculate x(f(a)). -1307a Let i(z) = -1967z - 1. Let d(b) = b*2. Determine d(i(p)). 3869089p*2 + 3934p + 1 Let j(d) = d*2. Let l(k) = 7k - 4. Suppose 4v + 3z = 17, 4 - 23 = -5v - 3z. Let n(c) = -2c - v + 10c - 3. Let w(s) = 5l(s) - 4n(s). What is j(w(f))? 9f2 Let q(u) = -2u. Let i(p) = -181p. Determine q(i(f)). 362f Let f(h) = -h*2. Let r(c) = 6c. Let n(d) = -4 + 5d + 4. Let k(i) = -4n(i) + 3r(i). Determine k(f(m)). 2m*2 Let v(o) = -104o - 2o2 + 104o. Let c(u) = 40u. What is c(v(t))? -80t*2 Let m(i) = 2i. Let s(p) = 15163p. Determine s(m(y)). 30326y Let c(y) be the third derivative of -y*5/20 - 7y2. Let p(r) be the third derivative of r4/24 - r*2. Determine p(c(b)). -3b*2 Let p(k) = -6k. Let g(h) = 2. Let w be 970/(-90) + 2/(-9). Let j(v) = -v - 11. Let r(a) = wg(a) - 2j(a). Calculate p(r(t)). -12t Let c(o) be the second derivative of -1/6o*4 + o + 0 + 0o*2 + 0o*3. Let s(i) = -2i*2 + 0i + 0i. Calculate c(s(j)). -8j*4 Let u(z) = 2z. Let c be ((-1)/(0 + -1))/(8/16). Let x(w) be the third derivative of -1/8w4 + 0w*3 + 2w*c + 0 + 0w. What is u(x(i))? -6i Let s(d) = 53d*2. Let z(h) = 32h*2. Give z(s(j)). 89888j*4 Let f(a) = -667a. Let i(x) = -x*2. Give f(i(g)). 667g*2 Let n(y) = -2y*2. Let u(k) = 20349k. What is u(n(l))? -40698l2 Let h(g) = g2 - 5. Let c(n) = n2 - 6. Suppose 0 = -5w + 3w - 12. Let j(k) = wh(k) + 5c(k). Let t(p) = p. Calculate j(t(x)). -x2 Let d(t) = -12t. Let l(v) = 22v. What is l(d(m))? -264m Let m(o) = 2o2 + 80o. Let r(t) = -t. What is m(r(i))? 2i2 - 80i Let p(b) = 123b. Let a(q) = -10q*2. Calculate a(p(o)). -151290o*2 Let i(o) = -19o*2 + 13o*2 + 13o*2. Let l(a) = 16a - 11. Let s(w) = -3w + 2. Let b(m) = 2l(m) + 11s(m). Give i(b(p)). 7p*2 Let b(r) = -410r*2. Let l(g) = 2g. Determine l(b(y)). -820y2 Let v(g) = 4g*2. Let z(d) = -5d2 - d - 1. Let o be z(-1). Let k(m) = m2 + 4m - 5. Let f be k(o). Let n(r) = -5r + 6r - 2r + fr. Give v(n(p)). 4p*2 Let j(c) = -4c. Let k(v) = 2v + 0v + 0v. What is k(j(m))? -8m Let v(f) = -4f. Let s(m) = 52m*2. Calculate v(s(c)). -208c*2 Let d(q) = q. Let j(f) be the first derivative of -2f*3/3 + 9. Calculate j(d(s)). -2s*2 Let d(h) = -3h. Let x(j) = -1208j. Determine d(x(l)). 3624l Let u(b) = -3b2 + 0b2 + b2. Let h(i) = -6i. Determine h(u(t)). 12t*2 Let p(c) be the first derivative of -2c*3/3 - 5. Let y(q) = 0q*2 + 6q*2 - 8q*2. What is p(y(l))? -8l*4 Let j(c) = 85c*2. Let g(h) = h. What is g(j(p))? 85p*2 Let b(c) = -4c. Let w(m) = -4 + 182m2 + 4 - 172m*2. Determine w(b(r)). 160r2 Let i(h) = -h2. Let t(l) = l. Let q(k) = -11k2 - 5k. Let m(g) = -q(g) - 5t(g). Calculate m(i(v)). 11v4 Let h(v) be the third derivative of v5/60 + v*2. Let s(y) = -9y. Determine h(s(m)). 81m2 Let v(b) = -b. Let l(i) = -i2 - 278i + 278i. Give l(v(y)). -y2 Let s(n) = -1196n. Let i(k) = -5k. Give i(s(a)). 5980a Let l(b) = -b*2 + 118. Let w(z) = -5z*2. Calculate l(w(h)). -25h*4 + 118 Let i(b) = -119b*2. Let f(c) = -19c. Determine f(i(g)). 2261g2 Let q be (-38)/(-8) - (-4)/16. Let r(o) = 2o - 3. Let p(m) = -3m + 5. Let k(h) = qr(h) + 3p(h). Let g(d) = 2d*2. Give k(g(j)). 2j*2 Let t(p) = -2p2. Let o(a) be the third derivative of -a5/10 + 22a2. Determine o(t(z)). -24z4 Let d(v) be the second derivative of -v4/12 - 2v + 7. Let t(p) = -73p. Determine d(t(o)). -5329o2 Let f(i) = -2i*2. Let v(l) = 66l + 2. Give v(f(g)). -132g2 + 2 Let x(h) = 980 - h2 - 980. Let b(q) = -18q*2. Calculate b(x(y)). -18y*4 Let r(g) = 468g + 2. Let m(f) = 2f2. Calculate m(r(q)). 438048q*2 + 3744q + 8 Let w(x) be the second derivative of 1/3x3 - 2x + 0 + 0x2. Let t(s) = 3 - 3 + s. Determine t(w(h)). 2h Let f(p) = -7p. Let n(g) = -63g*2 + 8g. Determine f(n(j)). 441j2 - 56j Let y(k) = -k - 2. Let w be y(-4). Let x(q) = w - 2 - 2q2. Let j(g) = 3g*2 - 14g + 28g - 14g. What is j(x(z))? 12z4 Let m(w) = -w3 + w + 3. Let f be m(0). Let u(i) = i - 7 + 4 + f. Let y(x) = -x. Calculate y(u(h)). -h Let b(x) = -3x*2. Let j(a) = -20a*2 + 24a. Let q(t) = -4t2 + 5t. Let v(i) = -5j(i) + 24q(i). Determine v(b(f)). 36f4 Let h(g) = 2g + 6. Let i(c) = 1. Let t(k) = h(k) - 6i(k). Let p(d) = -2d*2. Determine t(p(s)). -4s*2 Let g(b) be the first derivative of 2b*3/3 + 55. Let n(r) = -68r*2. Determine g(n(x)). 9248x4 Let p(y) be the second derivative of -y3/3 - 3y. Let w(m) = 2m*2 - 3m + 3. Let q(o) = 7o2 - 11o + 11. Let t(i) = 6q(i) - 22w(i). Determine t(p(j)). -8j2 Let c(a) = 436a. Let x(q) = 2q2. Calculate x(c(j)). 380192j**2
Let f(a) = -13a2 + 33a + 701. Let g(v) = -6v2 + 17v + 315. Let k(u) = 5f(u) - 11g(u). What is k(15)? -65 Let w(o) = 33o3 + 2o + 1. Let r(b) = b*3 + 13b*2 + 11b - 2. Let i be r(-12). Suppose 18x - 8x = -i. What is w(x)? -34 Let t(w) = -2w3 + 20w*2 + 22w - 5. Let a be t(11). Let b be 15/(-25)2a/2. Let i(j) = -j*2 + 3j - 1. What is i(b)? -1 Let t(c) = -5c2 - 4c - 6. Let m(q) = 42q + 42. Let k be m(-1). What is t(k)? -6 Let j be 5 - -3 - 5/1. Let g(r) = 3r2 - r - 9. What is g(j)? 15 Let f(z) = z2 - 5z + 9. Let p = 56 - 54. Suppose 10r = pr + 48. What is f(r)? 15 Let q(v) = -41v*2 + 14v - 26. Let n(x) = 75x2 - 26x + 51. Let m(a) = -6n(a) - 11q(a). What is m(-5)? -5 Let l = 10169 - 10174. Let v(a) = a*2 + a - 2. Determine v(l). 18 Suppose 4f - 2l - 514 = 0, 0 = 3f + 24l - 21l - 363. Let s be (4/6)/((-28)/f). Let m(b) = -3b - 2. Give m(s). 7 Let w(v) = -v - 6v + 11 + 13v. Let o be w(-2). Let t(b) = 6b*3 + b. Calculate t(o). -7 Suppose 4i = 3b - 15, 4i = -3b - 225 + 216. Let q(f) = f3 - 4f*2 - f - 5. Determine q(i). -65 Suppose 2p + 3 = f, -40p + 3f + 31 = -42p. Let x(g) = -73g - 359. Determine x(p). 6 Suppose 3z = -d + 10, -3d + 5 = 2z + 2z. Let l(a) = 921 - 306 - 312 - 309 - 2a. What is l(d)? 4 Let m(p) be the second derivative of -5p*3/6 + 3p*2/2 + 109p. What is m(-2)? 13 Suppose 0 = -0s + 5s - 10. Let n(z) = -sz + 0z - z. Let j be ((-219)/9 - -26)/(15/(-18)). Calculate n(j). 6 Let n(l) = -2l3 - 16l*2 - 24l - 61. Let g(f) = 3f3 + 23f*2 + 38f + 91. Let y(o) = 5g(o) + 8n(o). Calculate y(-13). -7 Let f(b) = -71b + 9b*3 - 5b3 - b2 + 1 + 69b - 2 - 3b3. Calculate f(-4). -73 Let x(t) = -t2 - 2t + 7. Suppose 4 = p + 3p, y + 2p + 42 = 0. Let i be (28 + -80)(-6)/(-8). Let n = y - i. What is x(n)? -8 Let q(r) = -12r + 44. Suppose -168n + 190n - 110 = 0. What is q(n)? -16 Suppose g + 15 - 6 = 3v, -2g - 2 = -2v. Suppose u = 3 - v. Let z(k) = 2k2 + 2k. Let w(t) = 3t2 + 3t. Let h(i) = 3w(i) - 4z(i). What is h(u)? 0 Let l(b) be the third derivative of -b5/60 + b4/4 + 2b3/3 - 3569b2. Determine l(5). 9 Let n(p) be the first derivative of -p2/2 - p + 174. Let k be ((-5)/(-2) + -2)4. Suppose 0 = -3v - k - 22. Calculate n(v). 7 Suppose 2x + 4r + 4 = 0, 3x + 5r = -3 - 3. Let z(m) be the second derivative of -m5/20 - m4/6 + m*3/3 + 3m*2/2 + 27m + 4. What is z(x)? -1 Let b(h) = -h*3 - 6h*2 - 5h + 1. Let x be 105/140 - (-38)/(-8). Calculate b(x). -11 Let o(g) = -g*2 - 6g - 5. Let u = -154 + 229. Suppose -11j + 31 = u. Calculate o(j). 3 Let j = 6066 - 6062. Let u(a) = 2a*3 - 5a*2 + a. What is u(j)? 52 Suppose 2z - 37 + 191 = 88. Let t(i) = -i*3 - 31i*2 + 67i + 21. What is t(z)? -12 Let u(f) be the second derivative of -f*4/12 + 13f*3/6 - 8f*2 - 5f - 132. Determine u(11). 6 Let l(h) = -11h - 123. Let u be l(-12). Suppose us + 18 = 11s. Let y(v) = v - 20. What is y(s)? -11 Let o(w) = w3 + w2 - 1. Let a(s) = -s2 - 24s. Let y be a(-22). Let x = 45 - y. What is o(x)? 1 Let r(m) = -m*2 + 8m - 8. Let w(j) = -j*3 - 9j*2 - 20j - 9. Let x be w(-6). Suppose 2v = -2t + xv + 14, -v = 2. What is r(t)? 4 Suppose 3a - n + 1 = 4a, -5 = 5a - 5n. Suppose -i + ai = 0. Let y(s) = is3 + 0s + 1 + 7 + s - s2 + s3. Calculate y(0). 8 Let b(g) = 2 - 4 - 10 - 10 + 5g + 21. Determine b(-3). -16 Let b(k) = -30k + 2k2 + 73k - 3 - 52k. Calculate b(5). 2 Let s(g) = 4g3 - g2 - 3. Let c be 6(-11 + (-69)/(-6)). Determine s(c). 96 Suppose -3v + v = m + 4, 3v = -3. Suppose l + 89 = 91. Let h(y) = y2 - 3y - y*2 + l - 2y*2 - 3. Determine h(m). -3 Let s(b) = 115 - 17b + 266 - 491. Determine s(-7). 9 Let k(x) be the second derivative of 0 + 5/6x3 - 62x - 3/2x2. Give k(2). 7 Let l(b) = -4b - 60. Let k be l(-21). Let o(i) = i*3 - 6i*2 + ki + 18i - 38i. Give o(5). -5 Let h(r) = 9r + 1. Let c(u) = -44u + 1. Let v(k) = c(k) + 3h(k). What is v(0)? 4 Let z = 2 - 1. Suppose 131 = 5l + c - 123, -2l = -2c - 104. Let a(m) = -52 + 102 + 0m3 - m3 + m2 - l. Give a(z). -1 Let n(r) = -4r + 33. Let u = 2672 - 2663. Calculate n(u). -3 Suppose 0 = 2l + 3c - 2, 18l - 3 = 21l + 3c. Let u(r) = r2 - 106 + 8r + 0r2 + 117. Give u(l). -4 Let p(l) = 2l*3 - 73l*2 + 45l - 329. Let o be p(36). Let q(j) = j*2. Determine q(o). 25 Let n be -2 + 3(-40)/(-12). Let f(c) = 2c - 5c - nc2 + 5 + c3 + c2. What is f(7)? -16 Let a(w) = w2 - 2w - 18. Let u be a(6). Let l be 12/(-20) + -5 + u/(-15). Let k(x) = -x - 4. Give k(l). 2 Suppose -q = -12q. Suppose q = -12h - 23 - 37. Let k(r) = r*3 + 3r*2 - 6r + 4. Give k(h). -16 Let j be -5 + (-252)/(-52) - (-108)/26. Let g(p) = -8937p + p2 + 8937p - j. Determine g(-3). 5 Let d(r) = 5 - 3r2 + 11r*2 + 7r - 7r2. Suppose -12 = -4f - 2f. Suppose -10 = -fv + 7v + 5w, 2w = v + 8. What is d(v)? -7 Let a(o) = -6o2 - o + 1. Let p be a(1). Let d(q) = -q2 + 18q + 46. Let g be d(20). Let u(c) = -g + 6c + c*2 + c - 5c*2 + 5c*2 + 1. Give u(p). -11 Let t be 196/(-28) + 0/(-1). Let c(o) = -2o - 1. Let w(a) = 3a + 1. Let x(d) = -2c(d) - w(d). Give x(t). -6 Let y(l) be the first derivative of l3/3 + l2/2 + 4l + 1786. Calculate y(0). 4 Let c be 6(3/(-9) - -1). Suppose -cp + 0p = 24. Let z(u) be the second derivative of -u*5/20 - 7u4/12 - u3/2 - 9u2/2 + 314u + 1. Calculate z(p). -27 Suppose y + 0y = 2q + 11, -5 = 5y + 5q. Let v be (-1)/y3 + 3. Let j(c) = 7 + 2c + 7c - c2 + c3 - cv + 10c*2. Calculate j(-7). -7 Let j be (-16432)/(-5616) - 7/(567/(-6)). Let o(b) be the first derivative of 7b + 1/2b2 - 1/3bj + 15. What is o(0)? 7 Let u(t) = 13 - 83 + 45 - t2 - 13t. Let q = -1105 + 1095. Give u(q). 5 Let r(w) = w2 - 4w + 24. Let t(s) = -5s2 + 8s - 58. Let c(l) = 5r(l) + 2t(l). Determine c(-3). -29 Let a(n) be the first derivative of -n*4/4 - 5n*3 + 18n*2 + 39n + 796. What is a(-17)? 5 Let k(n) = 17n - 46. Let u(t) = -12t + 31. Let v(f) = 5k(f) + 7u(f). Let q = 231 + -218. Determine v(q). 0 Let z(o) = 102o2 + 32o + 29. Let q(t) = -41t2 - 16t - 13. Let f(n) = 5q(n) + 2z(n). Calculate f(-7). 56 Let y = -2014 + 2012. Let o(r) = 3r2 - 9. Give o(y). 3 Let t(g) = 14g*2 - 11g - 71. Let l(b) = 39b2 - 34b - 206. Let i(h) = -6l(h) + 17t(h). Give i(-2). 11 Let a(z) = z*2 + 11z - 12. Let f be 9(9 - (-93)/(-9)). What is a(f)? 0 Suppose -12 + 0 = -4x. Suppose -4m = xv - 8v + 24, -v = -5m - 30. Let b(z) = -z*3 - 6z*2 - 4z - 9. Give b(m). 15 Let s = -6 + 1. Let j(o) = -8o - 4. Let a(h) = -532912 - 2h + 9h + 532915. Let y(k) = sj(k) - 6a(k). Give y(-5). 12 Let r(d) be the first derivative of d2/2 - 4d + 16. Let o(q) = -q + 5. Let a(l) = -5o(l) - 6r(l). Calculate a(-2). 1 Let y(j) = 2j + 6. Let f = 51 + -25. Suppose 0 = -g - 4s - 21, 3s + 27 = 24g - fg. Calculate y(g). -12 Suppose -2f - 272 + 54 = -2s, 15 = -3s. Let u = 195 + f. Let t(z) = uz + 1 + 0 - 82z. Give t(5). -4 Let a(c) = -7c + 4 + 0c - 3c + 8c. Let z(l) = 2l - 6. Let h(q) = -6a(q) - 5z(q). Give h(5). 16 Let v be (1 - 1)/((-3 - -11)/4). Let y(s) = s3 + s2 - s + 53. Calculate y(v). 53 Let q(v) = -2v*2 + 2v + 3. Let i(f) be the third derivative of -f*5/60 - 29f*4/24 - 55f3/2 + f2 + 32. Let y be i(-21). Give q(y). -9 Let n(p) = -p*2 - 13p - 11. Let j = 2796 - 2809. Calculate n(j). -11 Let g(x) = 3x2 + 5x - 6. Let m be (-20)/(-4) + 2(-3 + 2). Suppose 2f = mq + 14 - 3, -10 = 2q - 4f. Give g(q). 6 Suppose r - 3 = -2. Let g(n) = r + 2n - 14n - 9n. Let y = 278 - 277. Calculate g(y). -20 Let g(q) = 7q3 - q2. Suppose -4s = -24l + 19l + 92, -3l + 66 = 3s. Suppose o = 4h + 79, 2o + 31 = 4h + 113. Let a = h + l. Give g(a). 6 Let k = -52099 - -52104. Let d(p) = 4p + 5 - 2p - 15. Determine d(k). 0 Suppose -q = -3q - 2. Let t(l) = l*2 + 2l - 14. Let o be t(4). Let k(y) = -17 + 6 + o - 3y. Calculate k(q). 2 Suppose 2i - 26 = 5z + 48, -7 = i + 3z. Let h(v) = -5v + 57. Determine h(i). -28 Let l(j) be the second derivative of 3j*4/8 - 3j*3/2 - 37j*2 + 18j - 2. Let x(t) be the first derivative of l(t). Give x(6). 45 Let c(z) be the third derivative of z*5/60 + 9z*4/8 + 2z*3 - 3996z*2. Give c(-25). -38 Suppose 0 = 2f - 0f - 3j - 50, -3f - 2j + 49 = 0. Let r = 20 - f. Suppose -8 = -2m, n = -4m + 12 - r. Let w(g) = g*2 + 6g + 7. What is w(n)? 2
Let w(h) = -15h2 + 11h. Let a = -37 + 41. Suppose aq - 3q - 4 = 0. Let u(j) = -5j2 + 4j. Let x(z) = qw(z) - 11u(z). Let f(m) = 2m. What is f(x(r))? -10r*2 Let a(k) = -18k - 9k + 26k. Suppose 3y - 4c - 2588 = 0, -y + 118 = 3c - 723. Let j(m) = ym - 1749m + 871m. Calculate j(a(h)). 22h Let x(q) = q2. Let p = 884 - 884. Let z(f) be the second derivative of -11f - 17/6f3 + 0 + pf*2. Give x(z(k)). 289k*2 Let o(a) = 54318a - 1. Let i(y) = 109y2. Determine o(i(z)). 5920662z*2 - 1 Let v(y) = 2y. Let l(x) = 1136015 - 900x - 1136015. Give v(l(k)). -1800k Let f(h) be the third derivative of h*8/2240 - 53h*5/30 - 48h*2. Let y(m) be the third derivative of f(m). Let c(z) = -5z. Determine c(y(n)). -45n2 Let a(o) = -480 - 474 - 474 - 472 - 74o + 1901. Let w(d) = 3d2. Calculate w(a(k)). 16428k*2 - 444k + 3 Let l(m) = -30m - 497. Let u(t) = 3t - 8780. Give l(u(a)). -90a + 262903 Let l(j) be the first derivative of 5j - 206 - 1/2j2. Let x(p) = 2p. Determine x(l(f)). -2f + 10 Let i(d) = 2d + 66. Let y(a) = 2484a2 - 5a - 2. Give i(y(q)). 4968q2 - 10q + 62 Let w(a) = 3591870a2. Let y(g) = -21g. Determine w(y(x)). 1584014670x2 Let s(f) = -46f*2 - 35f - 21. Let o(x) = 33x2 + 25x + 15. Let n(q) = -7o(q) - 5s(q). Let d(h) = -768h. What is d(n(a))? 768a*2 Let l(q) = 422q*2 + 2q - 1. Let x(k) = 22k + 36. Let s(y) = -115y - 189. Let j(c) = -4s(c) - 21x(c). Determine j(l(o)). -844o2 - 4o + 2 Let w(n) = 254n. Let o(s) = -6s*2 - 2926. Calculate o(w(x)). -387096x*2 - 2926 Let g(o) = 77 + 75 - 187 - 3o + 80 - 45. Let z(t) = -t*2 - 6t + 3. Let s be z(-6). Let n(c) = 2c - sc - 5c. Determine n(g(q)). 18q Let l(f) = 207f2 + 2. Let a(j) = 23834j*2. Give l(a(r)). 117588328092r*4 + 2 Let q(d) = -424d*2 + 2d + 3. Let x(p) = p*2 - 3. Calculate q(x(c)). -424c*4 + 2546c*2 - 3819 Let m(j) = -1 - 6j + 1. Let a(h) = 11h2 - 35h*2 + 6h*2 + 11h*2 + 10h. Let o(v) = -4v2 + 6v. Let u(z) = 6a(z) - 10o(z). Determine m(u(n)). 12n2 Let r(u) = 31u*2 + 705. Let x(g) = 145g*2. Determine r(x(k)). 651775k*4 + 705 Let x(a) = 12a*2 - 314a + 30. Let z(o) = -61o. What is z(x(u))? -732u*2 + 19154u - 1830 Let n(t) = -46t2. Let f be (-128)/(-12) + 8/(-12). Let z(l) = -fl*2 + 11l*2 + 10l - 7l - 3l. Calculate n(z(k)). -46k4 Let x(n) = 1087n2. Let g(u) be the third derivative of -u4/12 + 1172u2. Calculate x(g(o)). 4348o*2 Let p = -15 + 144. Let d(i) = pi - 3i2 - 64i - 65i. Let c(x) = 22x*2. Give c(d(g)). 198g*4 Suppose -205 + 965 = 5v. Let q(x) = -v - 3x2 + 117 + x2. Let z(o) be the first derivative of o2 - 861. Calculate q(z(t)). -8t*2 - 35 Suppose 4s - 2s - 4 = 0, 0 = 2k + 5s - 32. Let l(i) = -3i*2 + 92i*2 - ki*2 + 41i2. Let v(y) = y2. What is v(l(t))? 14161t4 Let k(d) = 3d - 81. Let h(f) = -2f + 108. Let c(m) = -3h(m) - 4k(m). Let a(x) = -170x*2. What is a(c(p))? -6120p*2 Let k(u) = -3u. Let g(p) = 4p - 6071. Calculate g(k(a)). -12a - 6071 Let n(a) = -83a - 91a + 260a - 87a. Let z(p) = -13p + 74. Let g(m) = 6m - 37. Let j(o) = -9g(o) - 4z(o). Give j(n(u)). 2u + 37 Let w(b) = -3b. Let y(n) = 143n + 11n*2 + 3n + 44n - 12n*2 + 41n. What is w(y(t))? 3t2 - 693t Let m(y) = -2y. Let q(b) be the second derivative of 11b*6/720 + 5b4/2 - b3/3 - 134b. Let l(t) be the third derivative of q(t). Calculate l(m(r)). -22r Let c(g) = -43g2 + 2g - 2. Let o(p) = 21p2 - p + 1. Let l(s) = c(s) + 2o(s). Let i(z) = 43z2 + 2. Give l(i(a)). -1849a*4 - 172a*2 - 4 Let x be 2(-3 + 2 + -3 + 8). Let t(d) = -d + 8. Let f be t(x). Let b(q) = -116q + 121q + 0 + f. Let s(z) = 4z. Calculate b(s(n)). 20n Let m(r) = -66 - r + 66 + 3r. Let q(n) be the third derivative of 0 - 1/24n*4 + 0n*3 + 24n*2 + 0n. Give q(m(i)). -2i Let z(w) = 5w*2. Let r(c) = -674c + 24. Let k(n) = -693550n + 24700. Let i(t) = 6k(t) - 6175r(t). Give z(i(m)). 2112500m*2 Let k(i) = -2i. Let d(y) = 3849y2 - 12050y*2 + 6550y*2. Give k(d(l)). 3302l*2 Let q(p) be the first derivative of -35p4/2 - p2/2 + 29p - 131. Let k(v) be the second derivative of q(v). Let h(i) = i. What is k(h(d))? -420d Let z(j) = 13j - 43. Let o(p) = 36838p - 3. What is o(z(i))? 478894i - 1584037 Let u(l) be the first derivative of -93l*2/2 + 8l + 263. Let p(j) = -29575j + 2548. Let h(i) = 2p(i) - 637u(i). Let o(v) = 2v. Determine h(o(q)). 182q Let h(u) = -2323u. Let q(r) = -3r2 - 8r. Give q(h(n)). -16188987n2 + 18584n Let b(r) = -10r + 61r - 16r - 14r - 20r. Let o(c) = 157c - 1. What is o(b(t))? 157t - 1 Let d(o) = -o + 3. Let f(z) = 280z*2 - 15. Let w(s) = 138s*2 - 7. Let y(g) = -7f(g) + 15w(g). Give d(y(t)). -110t*2 + 3 Let w = -54 + 60. Let f(c) = -wc + c + 6c. Let x(r) = 86r*2 - 7. Let n(i) = 43i*2 - 4. Let z(t) = 11n(t) - 6x(t). Determine z(f(b)). -43b*2 - 2 Let g(c) = -42c*2. Let q(x) = 55331x - 55337x + 2x*2 - 6x2. Let i(v) = 1 - v - 1 - v2. Let y(k) = 6i(k) - q(k). Determine g(y(m)). -168m*4 Let a(d) = -161d*2. Let z(f) be the third derivative of 5f*4/24 + 1115f*2. What is a(z(s))? -4025s*2 Let c(o) = 3o. Let s(y) = -2846y2 + 109y + 11. Calculate s(c(z)). -25614z2 + 327z + 11 Let k(u) = -10u2 + 29. Let w(l) = 14l*2 - 2460. Calculate w(k(o)). 1400o*4 - 8120o*2 + 9314 Suppose z + 2z + 10 = x, -7 = 5x + 4z. Let k(j) = -7j - 19j - 14j + x. Let d(i) = 136i*2 - 73i*2 - 64i*2. Give k(d(u)). 40u2 + 1 Let q(r) be the first derivative of -r2 + 4715. Let a(c) = 2c - 514. Determine a(q(y)). -4y - 514 Let s(j) = -2j2. Suppose -6q + 8 = -5h - 2q, q = 2. Suppose hf - 2 = -f. Let a(k) = fk*2 + 4k - 4k + 0k. Determine s(a(t)). -8t4 Let l(q) = -32 - 2q + 0q - 8. Let g(v) be the first derivative of -2v*3/3 + 5500. Calculate l(g(h)). 4h*2 - 40 Let q be (6 + 45/(-10))(-1 - -3). Suppose 0 = -4m + 2r + 488, -qm + 250 = -m - 4r. Let n(v) = 123v + mv - 246v. Let o(s) = -3s. Determine n(o(k)). 6k Let n(k) = -k. Let h(u) = 4039620u*2. Calculate n(h(f)). -4039620f2 Let n(v) = v2. Let p(b) = -4945b + 344. Let k be 26 + 0 + 41. Suppose 5i = -1750 + k. Let a(s) = 43s - 3. Let t(g) = ia(g) - 3p(g). What is n(t(m))? 1849m2 Suppose k = -3p - 6, -4k + 5k + 10 = -5p. Let l(r) = -21r*2 + kr*2 - 5r2. Let f(n) be the second derivative of n3/3 - 52n. Give l(f(h)). -104h*2 Let i(q) = -10q. Suppose -60r - 33 = -63r. Let y(n) = -2n2 + r - 11. What is i(y(b))? 20b2 Let s(y) be the third derivative of -y4 + 7y3/3 + 135y*2. Let c(u) = -7u + 4. Let m(j) = 21c(j) - 6s(j). Let n(r) = 2r2 - 6. What is n(m(h))? 18h*2 - 6 Let h(v) be the first derivative of 8v*3/3 + 16287. Let i(x) = 12x2 + x2 + x*2. Determine h(i(f)). 1568f*4 Let m(b) = -285b. Let g(v) = 2661668v. What is g(m(c))? -758575380c Let n(g) = 3789g2 + 126. Let f(i) = -11i. What is f(n(s))? -41679s2 - 1386 Let l(b) be the second derivative of 7b*6/360 + 41b*3/6 + 54b. Let k(t) be the second derivative of l(t). Let n(d) = 11d2. Calculate n(k(v)). 539v*4 Let d(r) = 35r. Let b(w) be the second derivative of -w4/12 + w3/6 + 23w + 21. Give d(b(q)). -35q*2 + 35q Let j(p) = 56p - 3. Let i(v) = -150v + 8. Let o(q) = 3i(q) + 8j(q). Let k(c) = -10c2. Calculate o(k(d)). 20d*2 Let k(b) = -50b. Let m(c) = c*2 + 163706c. Determine m(k(r)). 2500r2 - 8185300r Let x(y) = -2y. Let u(n) = -7719n*2 + 1330n - 1. What is u(x(g))? -30876g2 - 2660g - 1 Let x(f) = 3f2. Let g(n) be the third derivative of n7/720 - n6/360 - 17n*5/15 + 2n*2 - 7n. Let i(u) be the third derivative of g(u). Give x(i(r)). 147r2 - 84r + 12 Let o(a) = -7a - 72. Let w(s) = 6s + 60. Let m(y) = -5o(y) - 6w(y). Let h(n) = -3465n2. Give m(h(k)). 3465k*2 Let v(j) = 11223151j*2. Let l(p) = 8p*2. What is v(l(y))? 718281664y4 Let m(x) = 17 - x2 - 10 - 11. Let a(p) = -9. Let s(i) = -4a(i) + 9m(i). Let c(f) = -2f. Determine c(s(b)). 18b*2 Let l(a) be the second derivative of 2a5/15 + a4/24 - 7a3/2 - 37a - 3. Let x(y) be the second derivative of l(y). Let b(s) = 2s2. Determine b(x(q)). 512q*2 + 64q + 2 Let m(u) = -60u - 2. Let d(n) = -149n - 5. Let p(z) = -2d(z) + 5m(z). Let r(k) = -5k2 + 6k + 13. Give p(r(l)). 10l2 - 12l - 26
Let k(y) = -y + 8. Let s(b) = -3 + 1 + 774b - 14 - 772b. Calculate -7k(z) - 3s(z). z - 8 Let a(u) = -5u3 - 20u - 10. Let g(h) = -2h3 - 7h - 3. Give 4a(i) - 11g(i). 2i3 - 3i - 7 Let l(z) = -z*3 + 2z*2 - z. Let a(y) = -4y*3 + 2y*2. Give a(c) - l(c). -3c3 + c Let m(k) = 1. Let w(h) = -h3 - 15h2 + 14h + 12. Let s be w(-16). Let y = 47 - s. Let l(q) = 2q - 2. Determine ym(c) + l(c). 2c + 1 Let k(i) = -5i*3 - 6i*2 - 6i - 6. Let v(x) = -14x3 - 17x*2 - 17x - 17. Let a be (994/(-77) - -14)/((-2)/(-11)). What is av(f) - 17k(f)? f*3 Let h be 46/10 - (-4)/10. Let y = -4 + h. Let p(k) = 5 + 0 - 5 - 4 + 5. Let v(t) = 2t + 1. Give yp(z) - v(z). -2z Let q(r) = -2. Let o(m) = 61m - 9. Calculate -o(a) + 5q(a). -61a - 1 Let j(q) = -q2 + 3q - 2. Let x(p) = 5p2 - 16p + 11. Let b(d) = 33j(d) + 6x(d). Let r(i) = -5i2 + 5i. What is -7b(w) + 4r(w)? w2 - w Let k(x) be the first derivative of x2/2 + 5x - 46. Let z(n) = 1. What is -k(w) + 2z(w)? -w - 3 Let c = -111 + 113. Suppose 5m + 7a = 3a + 32, 5m - ca - 14 = 0. Let p(w) = -5w3 - 5. Let d(v) = v3 + 1. What is md(z) + p(z)? -z3 - 1 Let a(m) = -8m*2 + m - 1. Let w(i) = -4i*2. Calculate -4a(p) + 7w(p). 4p*2 - 4p + 4 Let q(k) = -2k - 6. Let c(v) be the second derivative of -v2/2 + v + 7. Determine -3c(n) + q(n). -2n - 3 Let g(f) = 11f + 1. Let z(l) = -4l3 + 5l*2 - 9l - 13. Let c be z(-1). Let y(n) = -2n + 0n - 3n. What is cy(s) + 2g(s)? -3s + 2 Suppose 14 = 1208m - 1215m. Let u(f) = 16 - f*2 + 13f2 + f2 + 3f2. Let x(h) = 3h*2 + 3. Give mu(b) + 11x(b). b2 + 1 Let c(k) = k3 + 25k2. Let p(o) = -o3 - 26o2. Give 5c(l) + 4p(l). l3 + 21l*2 Let n(b) = 7b + 8. Let j(d) be the third derivative of d*4/4 + 7d*3/6 + 66d*2. Suppose -c + 2m - 1 = 0, 2c - 3c + 5 = -5m. What is cn(k) + 6j(k)? k + 2 Let l(q) = q3 - q2 + 1. Let s(k) be the first derivative of -3k*4/2 + 5k3/3 + k2 - 4k - 67. Give -4l(t) - s(t). 2t3 - t2 - 2t Suppose 5i + 7 = 2r - 0r, -4r - 4i - 56 = 0. Let x(a) = 13a + 11. Let l(d) = 2d + 0 - 8d - 1 - 4. Give rl(n) - 4x(n). 2n + 1 Let r be (5 + -2)1/3. Let l be (-5 + 5 + (-45)/(-36))-20. Let s(y) = 30y*2 + 25y + 25. Let w(f) = f*2 + f + 1. Determine lw(b) + rs(b). 5b*2 Let t(f) = 773 + 2f*3 + 779 - 1539 + 2f*2 + 17f. Let n(g) = -g3 - g2 - 8g - 6. Give 13n(p) + 6t(p). -p3 - p2 - 2p Let i(v) = 2 + 1 - 2. Let a(b) = b*3 + 13b*2 + 15b + 37. Let x be a(-12). Let l(y) = -y. Suppose -4w + 0w = 4. Give wi(c) + xl(c). -c - 1 Let h(k) = 3k3 + 14k*2 + 7k - 53. Let c(n) = -2n3 - 8n*2 - 4n + 27. Give 7c(v) + 4h(v). -2v3 - 23 Let i(t) = -11t*3 - 9t*2 - 6. Let b(o) = 32o*3 + 26o*2 + 17. Suppose 0 = 3g - 6g + 2p - 12, -3g - 5p = 33. Determine gb(c) - 17i(c). -5c3 - 3c*2 Let r(q) = 3q. Let v = 8 + -15. Let h(y) = -2y - 8. Let a be h(-7). Let d(n) = -54n + 105n - 48n. Give ad(k) + vr(k). -3k Let c(f) = -f2 + 1. Let h(k) = -36k*3 + 12k*2 - 6k - 14. What is 12c(n) + h(n)? -36n*3 - 6n - 2 Let w(p) = -p - 1. Let l(v) = -2v2 - 7v + 1. Let f(o) = l(o) - w(o). Let k(z) = -4z2 - 11z + 4. Suppose -6t + 0t = -18. Give tk(j) - 5f(j). -2j2 - 3j + 2 Let b(x) = -182x + 1. Let a(v) = 180v - 1. Calculate -4a(r) - 5b(r). 190r - 1 Let d(h) = -2h*2 + 3h - 6. Suppose -10l + o - 7 = -6l, 0 = -3l - 4o - 10. Let s(j) = -2j2 + 2j - 5. What is ld(i) + 3s(i)? -2i2 - 3 Let l = 28 + -21. Let d be (2/l)/(3/21). Let g(x) = 1. Let q(w) = w2 + 2. Determine dq(r) - 4g(r). 2r*2 Let w(d) = 5d - 2. Suppose 4v - 6r = -5r - 11, 3 = -2v + 3r. Let i(t) = t - 1. Let a(m) = 7m - 6. Let j(o) = 3a(o) - 15i(o). Give vj(x) + 4w(x). 2x + 1 Let p(h) be the second derivative of -7h*3/3 + 4h*2 - 5h + 7. Let t(j) = -5j + 3. Calculate 6p(b) - 17t(b). b - 3 Suppose -m = 3m. Suppose 0 = 4h - 2n - 16, h - 4 + m = 2n. Let t(s) = 2s + 4. Let c(z) = -z - 3. Calculate hc(a) + 3t(a). 2a Let h(c) = -136c - 138c + 275c + 6. Let o be (-77)/(-22) - (-1)/2. Let b(k) = 7 + 5 - 5 + k. What is ob(g) - 5h(g)? -g - 2 Let l(d) = -d + 8. Let w(g) = -562g - 17. What is 2l(v) + w(v)? -564v - 1 Let k(r) = -15r - 246. Let u(t) = 4t + 70. What is -5k(p) - 18u(p)? 3p - 30 Let h(l) = -l. Let n = 790 + -795. Let a(z) = -z - z + z + 0. What is nh(g) + 2a(g)? 3g Let v(u) = -7u*3 - 4u*2 + 4u. Let l(o) = -3o2 + 166 - 335 + 169 + 3o - 8o3. What is -4l(n) + 3v(n)? 11n*3 Let j(i) = -1. Let o(w) = 753w - 5. Determine -5j(n) + o(n). 753n Let s(b) = -b*2 + 2b + 1. Let f(r) = 4r2 + 21r + 21. Let o(j) = f(j) - 4s(j). Let t(p) = -2p*2 - 3p - 4. Determine 2o(y) + 9t(y). -2y2 - y - 2 Let a(s) be the third derivative of s4/12 - 7s*3/6 + 2s*2 + 328. Let j(z) = 2z - 8. Determine -5a(v) + 4j(v). -2v + 3 Let q(x) be the first derivative of 3x*4/4 + 2x*3/3 - 3x2/2 + x + 37. Let o(k) = -k3 - k*2 + k. Let n = 24 + -25. Calculate nq(j) - 2o(j). -j3 + j - 1 Let k(m) = -m2 + 4m - 4. Let j(w) = -2w2 + 5w - 5. Suppose 0 = 4v - 7v - 15. Let q be (-9)/(270/(-42)) + 52/20. Determine qj(z) + vk(z). -3z2 Let m be (-1)/(3/(-24)-2). Let l(b) be the first derivative of -2b3 + 5b*2/2 + 3b + 1. Let o(f) = -f*2 + f. Give mo(i) + l(i). -2i2 + i + 3 Let j(l) = -19l*2 + 3l. Let r = 1058 - 1055. Let c(h) = 816h2 - 128h. Determine rc(t) + 128j(t). 16t2 Let j(n) = -n3 - 2n + 2. Suppose 3c = h + 3 - 16, 0 = 2h + 3c + 19. Let y(d) be the first derivative of d4/2 + 5d*2/2 - 5d + 1. Give hy(g) - 5j(g). g*3 Let n(f) = -16f - 11. Let t(x) = -66x - 45. Give 9n(a) - 2t(a). -12a - 9 Let g(d) = 3d2 - d + 3. Let n(t) = 9t*2 - t + 11. Determine -7g(v) + 2n(v). -3v*2 + 5v + 1 Let m(i) = i - 8. Let c be m(6). Let o(v) = 9v + 3. Suppose -2w - 16 + 6 = -2q, -3w + q + 1 = 0. Let l(x) = 8x + 2. Calculate co(r) + wl(r). 6r Let q = 15 + -18. Let n(l) = 2l2 + 3l - 1. Let x(t) = 4t2 + 5t - 2. Let s(w) = qx(w) + 5n(w). Let g(o) = o*2. What is -8g(d) - 3s(d)? -2d2 - 3 Let k(m) = m2 + m + 1. Let y(f) = 5f2 + 16f + 9. What is -6k(c) + y(c)? -c2 + 10c + 3 Let u(x) = -9x - 3. Let g(m) = -3m - 9. Let b(k) = -k - 4. Let o(f) = 13b(f) - 6g(f). Let y = -1 + -5. Let c = 9 + y. Give cu(q) + 5o(q). -2q + 1 Let a(h) = -2h*2 + 3h + 1. Let m(b) = -99b3 + 24b*2 - 36b - 15. What is 12a(r) + m(r)? -99r*3 - 3 Let i(x) = -5x*3 + 4x*2 - 4. Let w(q) be the second derivative of 21q*5/20 - 5q*4/4 + 15q*2/2 - q - 31. Give 15i(l) + 4w(l). 9l*3 Let k(m) = -112m - 9. Let g(p) = -224p - 16. Give 4g(l) - 7k(l). -112l - 1 Let z(s) = -808s3 + 6s*2 + 26s - 16. Let t(f) = 162f3 - f2 - 5f + 3. Give -16t(o) - 3z(o). -168o3 - 2o*2 + 2o Let v(p) = 5p2 - 4p - 1. Let d = -35 + 31. Let f(a) = 11a2 - 9a - 2. Let t(i) = df(i) + 9v(i). Let y(u) = -u*2 + u. Calculate -t(r) - 2y(r). r*2 - 2r + 1 Let b(w) = 2. Suppose 2s + 2 = 6. Let r be s/2 - (14 - 11). Let h(k) = k + 8. What is rh(o) + 9b(o)? -2o + 2 Let h(q) be the third derivative of 119q6/20 + 17q*5/12 + 85q*3/6 - 2q*2 + 290. Let v(t) = -17t*3 - 2t*2 - 2. Calculate 2h(o) + 85v(o). -17o3 Let n(w) = w2 + 4w. Let a(b) = -8b*2 + 10b. Let v(g) = -13g2 + 18g. Let m(l) = -10a(l) + 6v(l). Determine -6m(i) + 13n(i). i*2 + 4i Let c(x) = -20x2 + 35x. Let t(n) = 7n2 - 17n. Determine 2c(g) + 5t(g). -5g2 - 15g Let o(f) = -4f2 - f + 1. Let s(d) = 11d*2 + 2d - 3. Let c(n) = -4n - 17. Let i be c(-8). Let g = i - 7. Give go(v) + 3s(v). v2 - 2v - 1 Let j(d) = -1278d - 37. Let v(s) = 427s + 13. Determine -6j(x) - 17v(x). 409x + 1 Let o(v) = 945v*2 + 3v - 6. Let g(f) = 946f2 + 4f - 8. What is -3g(k) + 4o(k)? 942k2 Let u(v) = -v - 2. Let r(c) = 5c + 11. Calculate 6r(q) + 34u(q). -4q - 2 Let y(a) = 15a*3 + 68a*2 - 15a - 5. Let x(k) = 8k3 + 34k*2 - 9k - 3. Determine -5x(n) + 3y(n). 5n3 + 34n*2 Let t(r) = 11r + 10. Let q(k) = k*2 - 12k - 12. Determine 4q(u) + 5t(u). 4u2 + 7u + 2 Let m(f) = -3f3 + 7f*2 + 12f. Let w(o) = -2o3 + 6o*2 + 13o. Determine -6m(v) + 7w(v). 4v3 + 19v Let m(n) = n2 - n + 2. Let c(o) = o2 + 6o + 6. Give -c(h) - 4m(h). -5h2 - 2h - 14
Suppose -8v + 12v = -24. Let d(z) be the second derivative of z5/20 + z4/2 - z*3/6 + 7z*2/2 + 44z. Give d(v). 13 Let t(d) = -7d2 + 10d + 2. Let s = 24 - 26. Let v(b) = -38b2 + 51b + 10. Let p(j) = sv(j) + 11t(j). What is p(7)? 9 Let m(w) = -3w + 8w - 8w - 22 - 10w2 + w3. Let z be m(10). Let r = 46 + z. Let y(u) = u*3 + 6u2 - 2. What is y(r)? -2 Let i(f) be the second derivative of f5/20 - 29f4/12 - 29f*3/6 - 57f*2/2 + 5775f. Determine i(30). -27 Let z(o) = -o*2 - o + 3. Let c = 152 + -149. Suppose d = -cy + 16, -3d = 5y - 4d - 16. What is z(y)? -17 Let t(p) = -3p*2 - 26784p - 19p3 - 4 + 5p*2 + 26790p + 18p3. Determine t(2). 8 Let i(s) = 3s + 1 + 2s3 - s3 - s - 4s*2 - s. Suppose 4m = 12, -a + 8 = -0a + 2m. Let l be ((-28)/14)/((-3)/(-2) - a). Determine i(l). 5 Let x(h) = -155h + 767. Let l(t) = 449t + 4495. Let r be l(-10). What is x(r)? -8 Let x(u) be the first derivative of -u*5/120 + 7u*4/24 + 2u*3/3 - 25u + 9. Let z(i) be the third derivative of x(i). Calculate z(6). 1 Let x(t) = t*2 - 2 + 9t - 1 + 9. Let c be x(-11). Suppose -u = 3u - c. Let k(m) = m2 - 6m - 5. What is k(u)? 2 Let d(g) = 7g + 3. Suppose 7 = 6n - 17. Suppose -nj = -4, u = j + 2j - 1. Suppose -4z = 3o - 0 + 2, -4o + 12 = -uz. What is d(z)? -11 Suppose 6m = m - 5u + 180, -31 = -m - 2u. Let y(i) = i + m + 54 - 103. Let k be 3 + -1 + (-2 - 0). Determine y(k). -8 Let w(j) = -109j + 36. Let h(c) = 9c - 3. Let x(v) = -10h(v) - w(v). Calculate x(3). 51 Let h(p) = -4p3 + 10p*2 + 12p + 64. Let f(l) = 5l3 - 8l*2 - 14l - 67. Let b(n) = -5f(n) - 6h(n). Give b(-20). -9 Suppose 4 = 4a - 5a. Let g be a + (6 - 4/(-2)). Let i(f) = 5 - 4 - gf + 0f - 2f. Determine i(-1). 7 Let v be ((-10)/6 - 3)3. Let m be 4/6(v + 11). Let a(i) = i3 + i - 205i*2 + 205i2 + 2. Give a(m). -8 Let y(g) = -g3 + 75g + 50. Let c be y(9). Let m(x) = -x3 - 2x*2 + 2x - 9. What is m(c)? 15 Suppose -57g + 145 = -83. Let r(n) = -n2 + 3n + 2. Calculate r(g). -2 Let w(b) = 14b3 + b2 - 3b + 5. Let r(q) = -65q3 - 6q*2 + 13q - 24. Let k(s) = -3r(s) - 14w(s). Determine k(5). -8 Let v(j) = 4j + 5. Let l be v(4). Let q = l - 18. Let z = 6 - q. Let h(w) = w3 - 2w*2 - 3w + 1. What is h(z)? 1 Let z be -14 + 15 + 33/(-4 - -3). Let f = -44 - z. Let x(w) = -w*3 - 11w*2 + 13w + 15. What is x(f)? 3 Let u = 4 - 7. Let i(f) = 3 + 5390f + 1 + 9 - 3 - 5384f. Give i(u). -8 Let v(z) = z*2 + z - 3. Let u = 442 + -338. Suppose ub - 105b + 3 = 0. Calculate v(b). 9 Let a(h) = -h2 - 8h + 8. Let d(q) = q*2 + 20q + 34. Let z be d(-19). Let g(c) = -c*2 + 10c + 65. Let n be g(z). Give a(n). -12 Let j(p) = -4p2 - p + 3. Let i(v) = v2 - 1. Let w(h) = -3i(h) - j(h). Let q be (2/1)/((-8)/4). Let z(k) = -6k - 1. Let n(c) = qz(c) - 2w(c). Give n(4). -15 Let m = -12016 + 12018. Let i(a) be the third derivative of -a2 + 1/60a*6 + 0 + 1/30a*5 + 0a - 1/12a4 - 1/6a*3. Calculate i(m). 19 Suppose 14w - 146 = 63 - 83. Let u(f) be the second derivative of f*3/3 - 4f*2 - 5f. Calculate u(w). 10 Let h(x) = 2x2 - 63x - 252. Let t be h(35). Let z(g) = g*3 + 7g*2 - 2g - 4. Give z(t). 10 Let y(p) be the first derivative of p5/20 - p4/2 + 5p3/6 - 3p*2 - 21p + 130. Let r(h) be the first derivative of y(h). What is r(5)? -6 Let w(d) = -d*2 - 2d - 1. Let s(x) = -x*3 - 2x*2 + 2x. Let y(b) = s(b) - 2w(b). Give y(-4). 42 Let b(h) = -2h*3 - 12h*2 + 14h. Let r(p) = -3p2 - 11p - 13. Let u be r(-3). Let t be b(u). Let o(k) = -k + 21. What is o(t)? 21 Suppose 0 = y - 5b - 23, -199b = -198b + 3. Let z(l) = -l3 + 9l*2 - 7l - 16. Give z(y). -8 Let c(m) = m*3 - 8m*2 + 8m - 2. Let x be ((-1426)/690 - (-14)/10)(1 + -10). What is c(x)? -26 Let z(q) = 6q - 82. Suppose -279 = -55i - 17i + 225. What is z(i)? -40 Let o(l) = -3l - 2. Let v be 5/(-20) + ((-6505)/(-4))/5. Let m = v + -328. Give o(m). 7 Let p(q) = 11 - 2q*3 - 35q + 50q - 5q*2 - 11q*2 - 53q + 43q. Determine p(-8). -29 Let o(d) = d3 + d + 6. Let k be o(0). Let l(w) be the first derivative of w3/3 - 5w*2 + 19w - 1513. Determine l(k). -5 Let i(h) = -h - 23. Let r = 1590 - 1579. Determine i(r). -34 Let o(b) = -7b2 + 28b - 230. Let z(u) = -u*2 - u + 1. Let f(l) = -o(l) + 6z(l). Give f(25). 11 Let m(d) be the third derivative of -d*5/60 - 11d*4/24 - 5d*3/3 + 1458d*2. What is m(-8)? 14 Let r(w) = 4 - 179w*2 + 5w + 80w2 + 97w*2. Let c(q) = 4q - 5. Let h be c(5). Suppose j + h = 3z, -4z - j + 13 = -0z. Determine r(z). -8 Let x = 788 + -784. Suppose -9v + 2f - 14 = -12v, 0 = 2v + xf - 12. Let l(q) = -q*2 + 8q - 2. What is l(v)? 14 Suppose -14z - 9z - 230 = 0. Let x(d) be the third derivative of 2/3d3 - 5/12d*4 - 1/60d5 + 0 - d2 + 0d. Give x(z). 4 Let i be (165/(-22))/(-1)(-2)/(-3). Let y(n) = 26 - 52 - in + 25. Give y(7). -36 Let q be 0/((-3)/2 - (-14)/28). Let s(j) = 0 + j3 + q - 16j*2 - 16j - 24 + 9. Give s(17). 2 Let g(i) = -44 + 6i + 125 - 46 - 48. Calculate g(9). 41 Suppose -25k = -20k - 325. Let h = k + -60. Let l(i) = -i2 - 1 + 4i - 5 - i + 2i. What is l(h)? -6 Let d be 7 + -11 + 19 + -8 + -2. Let m(o) = -2o*2 + 14o - 2. Calculate m(d). 18 Let i(z) = 11z - 2. Let s be (10/8)/(2/8-1). Let u be (-2 - 2 - s)/((-1)/(-2)). Determine i(u). 20 Suppose 12p + 713 = 677. Let v(a) = -a3 + a + 1. Let g(m) = -4m3 + m2 + 5m + 5. Let k(r) = g(r) - 3v(r). Give k(p). 32 Let o(m) = m*2 - 17m + 2. Let d = 4950 - 4938. What is o(d)? -58 Let g be (-2)/(-1) - (6 - 2). Let i be (20/(-30))/((-64)/30 - g). Let m(c) = -ic3 - 2 - 2c*3 + 4c*3 - 4c*2 + 4c*3 - 6c. Give m(5). -7 Suppose -m + 1 = -2. Let y be (-8 - (-9 + -3))/2. Let l(w) = -2w2 - 7w + 2w2 - wy + 9w - 3 + 0. What is l(m)? -6 Let u(i) be the second derivative of -i5/30 - i4/3 - i*3/3 - 11i*2/2 - 39i. Let q(g) be the first derivative of u(g). Give q(-6). -26 Let j(x) = -14x3 - 209x*2 + 13x - 34. Let g be j(-15). Let m(o) = -18o - 6. What is m(g)? 66 Suppose 4n = 20, 4n - 30 = -z - 0n. Let v = -8 + z. Suppose -3i + v = -i - 2o, 2i - 7 = -3o. Let k(h) = 3h - 5. Calculate k(i). 1 Let v = -81 + 57. Let r = 28 + v. Let k be r/(-8)8 + 8. Let a(f) = f - 3. Calculate a(k). 1 Let h(i) be the first derivative of -i3/3 + i2/2 + 5i + 5. Let x(p) = 5p*2 + p - 12. Let o be x(-4). Let u = o + -60. Determine h(u). -7 Let p(l) = 1437 + 7l - 5l - 1427. Let a be (-4)/(-10) - (-8)/5. Suppose -s - 2s = f - 8, -f = as - 3. Calculate p(f). -4 Let q(i) = -1. Let h(s) = s - 6. Let y(d) = -h(d) + 4q(d). Let u be 70/(-7)((0 - 1) + 0). Suppose 0 = 2c - u, 5a + c - 3c - 25 = 0. Calculate y(a). -5 Let s(f) = f + 8. Let z(r) = 7. Let d(q) = 2s(q) - 3z(q). Let o = 22629 + -22637. What is d(o)? -21 Let o(z) = 3z. Suppose 10n - 79n + 138 = 0. Let d(a) = -7a - 1. Let r(q) = no(q) + d(q). Calculate r(-3). 2 Let c(q) = 1 + 7q*2 + 5q*3 + 23q*3 - 27q3 + q3 + 0q3. What is c(-4)? -15 Let n(l) = l2 + 2l - 27. Suppose -251 = -66p + 145. Give n(p). 21 Let y(v) = v2 + 2v - 1. Let t(r) = -92 - 83 + 5r2 + 172 + 4r. Let k(i) = t(i) - 2y(i). Calculate k(-2). 11 Let s(l) be the first derivative of -l3/3 - l2 + 5. Let w(y) = 15y + 133. Let i be w(-9). Calculate s(i). 0 Suppose -3p - 25 = 2i, -3i - 2p = 2p + 35. Let v(s) = s3 + 4s*2 - 4s + 9. Let q be v(i). Let r(m) = 3 - 2 - 4 + m*2 + 1 - 5m. Give r(q). -6 Suppose -5x + 25 = 5r, -4x + x + 9 = -3r. Suppose xg - 24 = 12. Let p(o) = -5o*2 + 3o*3 + g + 2o - 4o3 - 4 + 6o. What is p(-6)? -7 Let b(u) = -16u + 7. Let k(d) = -13d + 4. Let l(m) = -4b(m) + 5k(m). Determine l(-12). 4 Let z(s) = -20s2 - 6s - 7. Let d(p) = -4p2 - p - 2. Let h(n) = 3d(n) - z(n). Let t be -2 - (0 + -2 - -1). Calculate h(t). 6 Let p(w) be the first derivative of -2w3/3 - 5w*2 + 6w - 701. Determine p(-5). 6 Let s(u) be the second derivative of u*4/12 - 7u*3/3 + 23u*2/2 - 59u. Let c be s(11). Let q(r) = r*3 + 10r*2 - 1. Determine q(c). -1 Let q(u) = 37u - 10. Let w(l) = -12l + 3. Let r(g) = -2q(g) - 7w(g). Let c = 5361 - 5362. Give r(c). -11 Let r(x) = 9x*3 + 2x*2 + 2x - 3. Let j be 6/(-16) + (-1950)/1200 + -1 + 4. What is r(j)? 10 Let h be (-14)/(-35) - (-27)/(-5). Let a(r) be the third derivative of r5/60 + r4/4 - r*3/3 + 1197r**2. Calculate a(h). -7
Find the second derivative of -180r5 - 1334r + 1 wrt r. -3600r3 What is the second derivative of -3c*3p*3 - 14c*3p - 2cp - p*3 + 9p*2 - 5 wrt p? -18c*3p - 6p + 18 Find the second derivative of 9cu2 - 3c - 13t2u*2 + 2t*2u + 72t2 wrt u. 18c - 26t2 What is the first derivative of -14935i*2 + 2i + 12234 wrt i? -29870i + 2 What is the second derivative of u4 - 435u*2 + u - 881? 12u*2 - 870 Differentiate -3j3 - j2v3 + 5j*2v*2 + 1292v*3 + 2 wrt j. -9j*2 - 2jv3 + 10jv2 What is the third derivative of -2c*6z + 12c3z*3 - 729c*2z3 + c2z2 wrt c? -240c*3z + 72z3 Find the second derivative of -303b*2 + 426b. -606 What is the third derivative of 3an + 11ao*3 + a + no*3 - 2no - 5n - 73o3 - o2 wrt o? 66a + 6n - 438 What is the third derivative of 17f*3u*4 - 2f*3u*2 + 34f*2u2 - f2 - 21u6 wrt u? 408f*3u - 2520u3 Differentiate -33j*3r + j*2r2 - r2 - 169r with respect to j. -99j*2r + 2jr*2 Differentiate 45h*4 + 164 wrt h. 180h3 Find the third derivative of m4y3 - 43m*4y + 18m3 - 30m*2y*3 - 2my3 + 6my - 2y*3 wrt m. 24my3 - 1032my + 108 What is the third derivative of 652h*4k - 2h2k + 152k wrt h? 15648hk What is the third derivative of -1792n*3w*3 - 110n*2w*2 + nw*3 wrt n? -10752w*3 What is the second derivative of 8528h4 + h3 + 13986h? 102336h*2 + 6h What is the first derivative of -8s2 - 2s + 55 wrt s? -16s - 2 Find the first derivative of -12a*3m - 3038a3 - 15am - m4 wrt m. -12a*3 - 15a - 4m3 What is the third derivative of -6498x*3 + 7x*2 + 13x + 2? -38988 Find the first derivative of -2m2n - 2m2 + 7387mn4 + 5m + 108 wrt n. -2m2 + 29548mn3 Differentiate 1911k*2 + 2522 wrt k. 3822k Find the second derivative of -11oq*4 + 2oq3 - oq + 11o - 6q - 2 wrt q. -132oq*2 + 12oq What is the second derivative of -2m*4s*3 - 128m*4 - ms*3 - m - 4s*3 wrt m? -24m*2s*3 - 1536m*2 Find the third derivative of 4t*3z*4 + 6t*3z*2 + 6t*2z*6 + 2z*2 wrt z. 96t*3z + 720t2z*3 Differentiate -6vx4 + 5vx3 - 5vx - 1958v - 1 with respect to x. -24vx*3 + 15vx2 - 5v What is the second derivative of -2bmz2 - 4bm + 4bz2 - 9mz3 + 52m - z*3 - z wrt z? -4bm + 8b - 54mz - 6z Find the second derivative of -26l*3tw3 - 2l*3 + 2ltw + 11lw*3 wrt l. -156ltw*3 - 12l Find the second derivative of -am3 - 154am2 + 42a - 3m3 + 7m wrt m. -6am - 308a - 18m What is the second derivative of -632w5 + 2w*2 + 1648w? -12640w3 + 4 Find the first derivative of -2bm2p + 2bm*2 + 126bp + 3m*2p + 3m2 wrt m. -4bmp + 4bm + 6mp + 6m Find the third derivative of -3d*4 - 26d3 + d2 - 31d. -72d - 156 Find the second derivative of -699w2 + 13w - 15 wrt w. -1398 What is the derivative of 13ij*3 + 2ijq + 58iq - 2i - 3q wrt j? 39ij*2 + 2iq Find the second derivative of -4546m*3 + 447m - 1 wrt m. -27276m What is the second derivative of 2f*2s*5 + 4f*2s + 21fs - 63s4 + 13s wrt s? 40f2s*3 - 756s*2 What is the second derivative of -74y*5 + 62y? -1480y3 What is the second derivative of -n3s + 96n3 + 2ns - 31 wrt n? -6ns + 576n Find the third derivative of -8q3u3 - q3u2 - 405q*3u + 138q2u*3 wrt u. -48q*3 + 828q*2 What is the third derivative of 4i*2r*4 + 26i*2r*3 + 4i*2r*2 + 5r*2 + 2r wrt r? 96i2r + 156i2 Find the third derivative of -2c*6 + 1851c*4 - 8309c*2 wrt c. -240c*3 + 44424c Find the third derivative of -a*2j*2x3 - a2j2x - 3a2x*2 - ax3 - j2x3 - 2x*2 - 5x wrt x. -6a2j*2 - 6a - 6j2 What is the second derivative of -309v*2 + 2691v? -618 Find the third derivative of -358h5i - 2h4i - 2h2 + 382i wrt h. -21480h2i - 48hi What is the third derivative of 524a6 - 954a*2 wrt a? 62880a*3 What is the third derivative of -631t*6 - 114t*2 - 3? -75720t*3 Find the third derivative of 769a*2wz3 - 4a*2wz2 + 3a*2z3 - a2 - 2wz*2 - 8wz wrt z. 4614a*2w + 18a2 What is the third derivative of -12h*2p*3y*3 - 13h*2p*2y*2 + 10hp2y*3 + 9p*3y*3 - 4p*2y*2 wrt p? -72h*2y*3 + 54y*3 What is the first derivative of -2l*2 - 9l + 39? -4l - 9 What is the second derivative of -45a3 + a2 + 4a - 15 wrt a? -270a + 2 What is the second derivative of 10z4 + 290z wrt z? 120z2 Find the second derivative of -13811r*5 + 128r + 1 wrt r. -276220r3 What is the second derivative of 2176q*2 - 294q - 2? 4352 What is the second derivative of -16z3 - z2 + 4z + 36? -96z - 2 What is the second derivative of -12d*3z*2 + 227d*3 - 2d*2z wrt z? -24d3 What is the third derivative of -409j*2l*3 - 3j*2l*2 - 49j*2 - 3l*2 wrt l? -2454j*2 Find the second derivative of -9891u*2 + 3u - 425. -19782 Differentiate 146q2 + 132 wrt q. 292q Find the second derivative of -ns2z + 6ns*2 - 2nsz - 2ns - 2nz - n + 3s2z - 7s2 - 23z wrt s. -2nz + 12n + 6z - 14 Find the third derivative of -4m4q - 3m3q + 2m3 - 2m*2q + 42mq wrt m. -96mq - 18q + 12 Find the first derivative of -184c - 159. -184 What is the second derivative of -6f4h + 30f3h - 2f2 + fh - 5f - 51h wrt f? -72f2h + 180fh - 4 Find the second derivative of 2j2m*2y2 - j2m2y + 8j2y - 106jm*2 - 3m*2y*2 wrt j. 4m*2y*2 - 2m*2y + 16y What is the derivative of -d2n - 599dn - n - 73 wrt d? -2dn - 599n Find the third derivative of -13b*3i3 + b3i2o*2 - 7b*2i*3o*2 + 2b*2i2 - b2 + 2i3 wrt b. -78i*3 + 6i*2o*2 Find the second derivative of -2f*2kr2 - 12f*2kr - 2f*2r*3 + 38fkr + 191kr*2 wrt r. -4f*2k - 12f2r + 382k Find the second derivative of 18782f*2v*2 - 1270f*2v - 4fv wrt v. 37564f2 What is the third derivative of -m2q*4 + 242m*2 + 249mq4 + mq*2 wrt q? -24m*2q + 5976mq Find the third derivative of 3262d3 + 4053d2 wrt d. 19572 Find the third derivative of d4 + 808d3 - 5d*2 - 56. 24d + 4848 Find the second derivative of 74ag*3 + 4ag - 117a + 4g3 - g2 + 2g wrt g. 444ag + 24g - 2 What is the second derivative of 446i*2 + 105i? 892 What is the second derivative of 2a4 + a2z*2 - 66a*2 + 59az2 - a wrt a? 24a*2 + 2z2 - 132 What is the third derivative of -c2d2h*2n*2 + 81c*2h*2n*3 + 4c*2hn - 2cd2h*2n - 3d2hn3 + 4d*2 - 3dhn*2 wrt n? 486c*2h*2 - 18d*2h What is the third derivative of -k*5y - 2k4 + 128k*3y*2 - 110k*2 + 2ky2 - 3ky wrt k? -60k*2y - 48k + 768y2 What is the second derivative of j3v5 + 122j*3v*3 - 3j*3v - 53jv wrt v? 20j3v*3 + 732j*3v What is the derivative of 71n3 + n2 + 3n - 3016 wrt n? 213n2 + 2n + 3 What is the third derivative of -204g3 - 269g*2? -1224 What is the third derivative of 364g5 - g4 + 244g2? 21840g*2 - 24g Differentiate -1163jr*2 - 111r*2 + 21r with respect to j. -1163r2 Differentiate -11m - 59. -11 What is the first derivative of g*3 - 125g*2 + 763? 3g*2 - 250g What is the second derivative of 36f3t*2 + 54f*2t - 2f2 - 8ft2 - 2ft + 86t wrt f? 216ft*2 + 108t - 4 What is the third derivative of 3x6 + 268x*4 - 3x*2 + 86x? 360x3 + 6432x Find the second derivative of 245y3 - 2y - 63. 1470y Find the third derivative of 634b*3l*3 + 3b*2l*3 - 55l*3 wrt b. 3804l*3 What is the third derivative of -24111x*3 - 3x*2 - x - 213 wrt x? -144666 What is the first derivative of -323g*2 - 3g - 1892 wrt g? -646g - 3 What is the third derivative of -g6x - 65g4x + 20g3t - 4405g2t + tx wrt g? -120g*3x - 1560gx + 120t Find the third derivative of -6c4 + c3 + 842c2 - 2. -144c + 6 Find the first derivative of 7g2x + 9gx - x + 9 wrt g. 14gx + 9x Find the first derivative of -21f*2 + 37f + 207 wrt f. -42f + 37 What is the second derivative of -473p*3w*4 - 314p3 + p2w4 - pw + 2w wrt w? -5676p*3w*2 + 12p*2w2 What is the third derivative of b5 + 20b4 + 44b*3 - 14538b*2 wrt b? 60b*2 + 480b + 264
Let r(c) = -c - 5. Suppose 0 = 3k - 3z + 21, 0 = -k + 7z - 3z - 7. Let m be r(k). Let f(v) = -v3 + v2 + 2v. Determine f(m). 0 Suppose -42g = -g + 369. Let d(m) = m*2 + 10m + 13. Determine d(g). 4 Let j = -3 + 8. Let l(p) be the second derivative of p*3/6 - 7p*2/2 + 65p - 1. What is l(j)? -2 Let q be (25/(-15))/((-2)/12). Suppose -2w + 9 = -4u - 17, q = -5w - 5u. Suppose 2t + 2 = wt. Let h(l) = 2l - 3. Give h(t). 1 Let x(t) be the first derivative of -2t3/3 - t2 - t + 105. Calculate x(-1). -1 Let h(a) = -3 - a*3 + 3a*2 + 4 + 0a*2 + 0a*2. What is h(3)? 1 Let y(v) = v + 2. Let b be -6 + (1-6 - -3). Let t(a) = -a*2 - 8a + 5. Let q be t(b). Let j = -1 + q. Calculate y(j). -3 Let q(z) = z*2 + z. Let r(i) = 2i*2 - 4i + 10. Let n(a) = -3q(a) + r(a). Suppose -l - 45 = -43, 3l = 4b + 30. Determine n(b). -8 Let u(k) be the third derivative of 1/24k*4 + 25k*2 + 0k + 5/6k3 + 0. What is u(-7)? -2 Let d(y) = 12y + 11 + y*3 + 9y*2 + 0y + 14y - 15y + 5y. Determine d(-7). -3 Let x(t) = t2 - 1. Let y(v) = v3 + 0v*3 - 6v - 7 - v - 6 - 4v2. Let g(o) = 3x(o) - y(o). Let i be g(8). Let a(h) = -2h + 1. Determine a(i). -3 Let w(j) = -j3 + 0j*2 + 0 - 2j - 3j2 - 1. Let r = 23 - 23. Suppose -a = -0x - x - 8, r = -4a + 20. Calculate w(x). 5 Let v(w) = 5 - 19w + 21w - 2. Determine v(-5). -7 Suppose -4c = m + 14, 13m = 17m - 3c - 20. Let p(n) = 6n - 3. Calculate p(m). 9 Let i(d) = -d - 12. Let t(v) = -v - 12. Let n(l) = -6i(l) + 7t(l). Let a(h) = -11h - 138. Let s be a(-12). Give n(s). -6 Let t(u) = -u3 - 36u*2 - 37u - 65. Let b be t(-35). Let l(c) = c*3 - 4c*2 + 3. Give l(b). 28 Let l(n) = -10 - 4n + 9n + 6n + 1 - n*2 - 21n. Give l(-8). 7 Suppose -u + 30 = 3s - 4u, s - 22 = 4u. Let x(o) = -o3 + 4o*2 + 10o + 2. What is x(s)? -10 Suppose -21 = -5d - 3q + 5q, 2q = -2d. Let v(o) = o + 0 + d + 0. What is v(-8)? -5 Let c(i) = -3i*3 - 4i*2 - 4i + 5. Let f(w) = -8w3 - 9w*2 - 9w + 11. Let y(x) = 9c(x) - 4f(x). Determine y(-1). -4 Let g(r) = 2r2 - 11r - 6. Let p be g(6). Let m be -2 + p/(4/(-4)). Let d be 1/(-2)(4 + m). Let n(v) = -v. Determine n(d). 1 Suppose q = -2k + 8, -q = -5k + 9k - 20. Let c(b) = 3b + k - 4b + 2b. Determine c(-5). 1 Suppose -2j = 5 + 3. Let y(x) be the first derivative of -x5/60 - x4/8 + 2x3/3 - 9x*2 + 1. Let o(c) be the second derivative of y(c). Give o(j). 0 Suppose 3j = -9, -5j - 12 = -t + 4. Let w be 2/(-3 - t - -5). Let v(z) = -z2 + 1. Let o(g) = 6g*2 - g - 4. Let f(c) = -o(c) - 3v(c). What is f(w)? -9 Let y(p) = -11p - 8. Let z(t) = -4t - 3. Let r(j) = 3y(j) - 8z(j). Calculate r(4). -4 Let q = 16 + -11. Let x = q + -9. Let u(t) = 4t3 + 6t - 7. Let h(l) = -9l3 + l2 - 16l + 15. Let o(g) = 3h(g) + 7u(g). Calculate o(x). 4 Let c(r) = 46r2 + 5r + 53r2 + 4 - 100r2. What is c(5)? 4 Let q(r) = r2 + 4r - 3. Let g(m) = -6m2 + m - 2. Let u be g(2). Let i be 6/(6/u + 10/(-8)). Give q(i). -3 Let k(y) be the first derivative of -y4/4 + 17y3/3 - 15y*2/2 - 7y + 407. Calculate k(16). 9 Let b(m) = -m*3 + 5m - 4. Let a = -31 - -32. Let h(r) = 45 + 51 + r - 97. Let g(f) = ab(f) - 5h(f). Determine g(2). -7 Let q(t) be the third derivative of 0 - 11/24t4 + 51t*2 + 0t + 0t3. What is q(-1)? 11 Let u(a) be the first derivative of -12a - 1/2a2 + 26. Determine u(-11). -1 Let m = 21 - 61. Let p = 36 + m. Let b(r) = r2 + 4r + 4. Give b(p). 4 Let f(s) = 7s + 13. Let w(v) = 4v + 6. Let x(i) = 9i + 2. Let l be x(-1). Let t(m) = lw(m) + 3f(m). What is t(-3)? 18 Let u(j) = -j3 - 9j*2 + 9j - 6. Let q(s) = -11s - 98. Let a be q(-8). Give u(a). 4 Let s(i) = 4 - 2i*2 + 3i - 2i + i - i3. Let q be (3/2)/(7/56). Let m = 9 - q. Give s(m). 7 Let u(j) = -j2 - 3j - 1. Let z(x) = -x*2 + 4. Suppose -4m = -m + 9. Let h be z(m). Calculate u(h). -11 Let u = 10 - 6. Let r(j) be the second derivative of -j5/20 + j4/2 - 7j3/6 + 2j*2 + 2j + 34. Determine r(u). 8 Let v = -6 + 1. Let f(x) = 16x + 2. Let s(a) = -6a - 1. Let j(k) = -2f(k) - 5s(k). What is j(v)? 11 Let r = -19 - -24. Suppose -f = r - 1. Let q(i) = 2i3 - 8i*2 - 6i - 2. Let n(t) = 3t3 - 9t*2 - 7t - 2. Let l(g) = 3n(g) - 4q(g). Determine l(f). 6 Let t(l) = -4 + 7 + 2 - 9l - 4 + l2. Give t(5). -19 Let j = -95 + 91. Let c(a) = a3 + 4a*2 - 2a + 3. Calculate c(j). 11 Let h(f) = -f*2 + 7f + 18. Let v be h(9). Let g(x) = x3 - x2 + x + 22. Determine g(v). 22 Let b(x) = 2x - 4. Let z be b(6). Suppose -3r - j = z, -4j + 10 + 0 = -2r. Let y(f) be the second derivative of -f*3/2 - 2f*2 - 69f - 2. Determine y(r). 5 Let t(w) = -2w - 3. Let s(h) = 3h - 15. Let y be s(7). Let z be (y/9)/(2/(-9)). What is t(z)? 3 Let a(b) = b*2 - 9b + 10. Suppose 9 - 7 = -2i. Let n be i1 - (-22 + 13). Let v be a(n). Let z(c) = 2c2 - 1. Determine z(v). 7 Suppose -4z - 16 = -2y, -4z = 3y - 17 + 53. Let h(q) be the third derivative of q4/12 + 3q*3/2 + 20q*2 - 2q. What is h(z)? -3 Let n(l) = -l*3 + 12l*2 - 20l - 10. Let o = -121 + 131. What is n(o)? -10 Let h(u) = -u*3 + 7u*2 + 5u - 24. Let o be h(7). Let d(g) = 2g - 9 - 9 + 5g2 - g3 + o. Give d(5). 3 Let r(n) = -36n2 - n - 4. Let k(p) = -31p*2 - 3. Let a(q) = -7k(q) + 6r(q). Determine a(-5). 52 Let b = -34 - -38. Let m(q) = -2q + q + q*2 + bq + 2. Give m(-3). 2 Let f(d) = 4d3 + 3d*2 + d - 1. Suppose -j = 18 - 16. Determine f(j). -23 Let q(b) = 2b - 5. Let h be q(4). Let d(m) = -11 - 6m3 + 5m*h + 10 + 5m*2 - 5m. Determine d(4). -5 Let j(q) = -q*3 - 6q*2 - 5q + 2. Let s(p) = -p - 1. Let x(b) = j(b) - 2s(b). Let f be x(-5). Let t(h) = -h2 - h + 7. What is t(f)? -23 Let a(h) be the third derivative of -h6/60 - h5/60 - h4/6 - h3/2 - h2 + 16. Let q be 0/(3 + -3 + -3). Let z = q + -2. Calculate a(z). 17 Let j(q) = 4q2 - 1. Let g(y) = y2. Let a(i) = g(i) - j(i). Let s be (4 - 0)/(-1) - -6. What is a(s)? -11 Let u(n) = -3n2 + n - 1. Let y(r) = 5r*2 + 1. Let f(c) = -3u(c) - 2y(c). Give f(-3). 1 Let c(j) = 3j. Let u(i) = -2i + 1. Let l(t) = 2c(t) + 2u(t). Let p(z) = -z + 16. Let k be p(12). What is l(k)? 10 Let q = -21 + 23. Let d(k) = k + 3kq + k3 + 6k - 4k + k*3. Determine d(-2). -10 Let h(d) = 19 - 15 + 5d + d + 7. Give h(-2). -1 Suppose -5c + 472 = -123c. Let d(z) = 12z + 6. What is d(c)? -42 Let z(h) be the third derivative of h6/120 - 2h*5/15 + 5h*4/12 - 4h*3/3 + 101h2. Determine z(6). -20 Let y(z) = z3 - 14z2 + 11z + 3. Let m = -454 + 467. Calculate y(m). -23 Let v(d) = -d - 2. Let n = -9 - -14. Suppose 0 = -5r - nt + 35, 3r - 9 = 2t + 7. Let o be (-46)/r + 16/24. Determine v(o). 5 Let w(g) = 6g3 - 3 - 5g*3 - 4g*2 - 3g + 11g2 - 3g. What is w(-8)? -19 Let s(d) = 1. Let w(k) = -k + 2. Let r(x) = -6s(x) + w(x). Determine r(12). -16 Let f(p) = p2 + 8p + 8. Suppose -3j - 2 = 5t + 34, 8 = j - 5t. Let b be f(j). Let y be 11/(-2) + b/(-2). Let v(d) = -2d - 4. Calculate v(y). 8 Let b(m) be the third derivative of -m8/6720 + m7/504 + m6/360 - m5/24 + 5m4/24 + 8m*2. Let u(q) be the second derivative of b(q). Calculate u(5). 5 Let w(x) = -3x3 + x2 - x + 1. Suppose 5g + 8 = -52. Suppose 2f - 36 = 2z, 0 = -5z + 3f - 84 + 4. Let u = g - z. Give w(u). -2 Let h(g) be the first derivative of -g3/3 - g2/2 - g - 120. Calculate h(3). -13 Let n(t) = 28 - 1737t*2 + 1731t*2 - 6t - 20 - t*3. What is n(-6)? 44 Suppose 0 = -2b - b + 18. Suppose 0 = -2k + 5q + 4, 2q - b = -2k - k. Let g(u) = -8u - 4 + 5u + ku. Determine g(-2). -2 Let c be 2 + (3 - (-1)/(-1)). Let y(w) be the second derivative of 1/2w*2 + 2/3w*3 + 0 + 3w - 1/12w4. What is y(c)? 1 Let j(z) = z2 - 7z + 7. Let v be (-4 + 54/12)14. Give j(v). 7 Suppose -k + g = -3k + 2, g = -3k + 5. Let t(z) = -3 - kz + 5 + 0. Suppose 10 = 5i + q - 6q, -5q + 5 = 0. Calculate t(i). -7 Let w(j) = 5j - j - j + 5j - 10j. What is w(-13)? 26 Let m(v) = v*3 + 3v*2 + 2v - 1. Let y(c) = 3c2 - 47c + 28. Let d be y(15). What is m(d)? -1 Let d(a) = -a*3 + 7a*2 + 3a + 7. Let q(l) = 2l + 4. Let s be q(2). Determine d(s). -33 Let y(g) be the second derivative of 0g*2 + 0 - 1/3g*4 - 2g + 11/6g3 + 0g*5 - 1/360g**6. Let p(x) be the second derivative of y(x). Calculate p(0). -8
Two letters picked without replacement from {w: 1, h: 3, z: 3, u: 2, v: 1, k: 1}. What is prob of sequence uh? 3/55 Four letters picked without replacement from {g: 8, q: 4, t: 5, u: 2}. What is prob of sequence uggu? 7/5814 Three letters picked without replacement from pbvpjb. Give prob of sequence jjp. 0 Three letters picked without replacement from qqqqkqkqqkqqkqqqqq. What is prob of sequence qkk? 7/204 Three letters picked without replacement from {m: 7, d: 1, t: 11}. Give prob of sequence mtt. 385/2907 What is prob of sequence uiu when three letters picked without replacement from ixclhiliuxixuc? 1/273 Two letters picked without replacement from gbgbb. What is prob of sequence bb? 3/10 Two letters picked without replacement from {f: 3, e: 2}. Give prob of sequence fe. 3/10 Calculate prob of sequence mjh when three letters picked without replacement from {m: 3, f: 2, h: 1, j: 3, l: 1, a: 5}. 3/910 Three letters picked without replacement from {a: 2, u: 1, q: 4, t: 7, p: 6}. What is prob of sequence qaa? 1/855 Calculate prob of sequence bb when two letters picked without replacement from {b: 4, t: 1, p: 7, c: 1}. 1/13 Calculate prob of sequence av when two letters picked without replacement from {a: 1, y: 2, v: 4}. 2/21 Three letters picked without replacement from rdcycyk. What is prob of sequence rck? 1/105 Four letters picked without replacement from {v: 7, f: 6}. Give prob of sequence vvfv. 21/286 Three letters picked without replacement from {s: 5, v: 3}. What is prob of sequence ssv? 5/28 Four letters picked without replacement from {u: 3, j: 3, y: 1}. Give prob of sequence uyuu. 1/140 Three letters picked without replacement from {q: 3, z: 2, u: 1, w: 1}. Give prob of sequence zzw. 1/105 Calculate prob of sequence jk when two letters picked without replacement from okkjkkjojkokkkjjjjk. 7/38 Four letters picked without replacement from {i: 6, u: 4, n: 4, j: 1}. Give prob of sequence unji. 4/1365 Two letters picked without replacement from odoooooldlooo. Give prob of sequence lo. 3/26 What is prob of sequence wt when two letters picked without replacement from itwzn? 1/20 Three letters picked without replacement from {j: 3, n: 3}. What is prob of sequence jjj? 1/20 What is prob of sequence oe when two letters picked without replacement from oeeoooefofeoo? 7/39 Calculate prob of sequence bjd when three letters picked without replacement from vdjjvbzbddjj. 1/55 Two letters picked without replacement from xxtxxtttooxx. Give prob of sequence oo. 1/66 Two letters picked without replacement from {g: 9, p: 9}. Give prob of sequence gp. 9/34 What is prob of sequence nn when two letters picked without replacement from vvqvfqnhqfqhfnhnyffn? 3/95 What is prob of sequence kb when two letters picked without replacement from {t: 1, k: 2, w: 1, b: 2, m: 1}? 2/21 Four letters picked without replacement from {f: 4, r: 3, o: 2}. What is prob of sequence fofo? 1/126 Two letters picked without replacement from nici. What is prob of sequence in? 1/6 Calculate prob of sequence omm when three letters picked without replacement from {o: 7, j: 6, m: 2, s: 1, a: 3}. 7/2907 Two letters picked without replacement from {u: 1, k: 3, t: 1, x: 1, q: 1}. Give prob of sequence xq. 1/42 Four letters picked without replacement from {d: 3, c: 3, f: 5, r: 1, w: 6, s: 1}. Give prob of sequence dswd. 1/2584 Four letters picked without replacement from {y: 6, m: 1, d: 2, v: 2}. What is prob of sequence dyyd? 1/132 Three letters picked without replacement from llvvpplpplppl. What is prob of sequence lpv? 5/143 What is prob of sequence dca when three letters picked without replacement from {d: 4, c: 7, y: 1, a: 1}? 7/429 Three letters picked without replacement from {m: 2, i: 4, e: 3}. What is prob of sequence eme? 1/42 Calculate prob of sequence ss when two letters picked without replacement from {s: 2, w: 4, t: 2}. 1/28 What is prob of sequence ve when two letters picked without replacement from vvehyyvv? 1/14 What is prob of sequence bg when two letters picked without replacement from guiuciubguzuubuug? 3/136 What is prob of sequence zezl when four letters picked without replacement from {z: 6, e: 2, l: 10}? 5/612 Four letters picked without replacement from {m: 6, p: 2, h: 7, c: 2, s: 1}. What is prob of sequence cpcm? 1/3060 Three letters picked without replacement from kkfffkikikfkfkff. What is prob of sequence ffi? 1/40 Calculate prob of sequence gdd when three letters picked without replacement from gdbkdgxk. 1/84 Calculate prob of sequence te when two letters picked without replacement from {j: 2, e: 1, w: 1, t: 2, l: 1}. 1/21 Two letters picked without replacement from {d: 3, j: 9, i: 2, y: 2}. Give prob of sequence yy. 1/120 Four letters picked without replacement from {j: 4, m: 2, s: 2, w: 7, b: 2}. Give prob of sequence sbbj. 1/3570 What is prob of sequence jj when two letters picked without replacement from kjjkkkkj? 3/28 Calculate prob of sequence hhh when three letters picked without replacement from {h: 5}. 1 What is prob of sequence sg when two letters picked without replacement from {f: 3, y: 2, s: 1, g: 1}? 1/42 Calculate prob of sequence is when two letters picked without replacement from ipjpjgpgsggs. 1/66 Calculate prob of sequence xbx when three letters picked without replacement from {b: 1, x: 2, c: 1}. 1/12 What is prob of sequence ww when two letters picked without replacement from wcwcwwwwwwwccwwwwc? 26/51 What is prob of sequence ttou when four letters picked without replacement from {u: 2, o: 3, j: 1, v: 1, r: 1, t: 4}? 1/165 Calculate prob of sequence vvy when three letters picked without replacement from {f: 6, x: 2, v: 9, y: 1}. 1/68 What is prob of sequence saaw when four letters picked without replacement from {a: 3, w: 3, s: 6, y: 6}? 1/680 Three letters picked without replacement from {h: 1, z: 3, b: 3, d: 1, m: 11}. What is prob of sequence bdm? 11/1938 Calculate prob of sequence eze when three letters picked without replacement from {y: 5, e: 4, z: 5}. 5/182 Three letters picked without replacement from ruuktkuxuuruuuuuuyru. Give prob of sequence kku. 1/285 Four letters picked without replacement from {z: 5, o: 9}. Give prob of sequence ozoz. 60/1001 Four letters picked without replacement from {f: 10}. What is prob of sequence ffff? 1 What is prob of sequence bb when two letters picked without replacement from kkkkbkbkkkb? 3/55 Calculate prob of sequence pp when two letters picked without replacement from {q: 2, p: 4}. 2/5 Three letters picked without replacement from xqxwxoqxo. What is prob of sequence owx? 1/63 Two letters picked without replacement from {o: 2, i: 4}. What is prob of sequence oo? 1/15 What is prob of sequence qcc when three letters picked without replacement from cqqccqccqcccccqc? 55/336 What is prob of sequence ioi when three letters picked without replacement from mmmommmymiiommmm? 1/840 Calculate prob of sequence qoq when three letters picked without replacement from {q: 2, z: 1, o: 1}. 1/12 Calculate prob of sequence lj when two letters picked without replacement from {j: 4, e: 4, n: 4, x: 5, l: 1, i: 2}. 1/95 Three letters picked without replacement from kwkwwkkkkkkkkkwwwk. What is prob of sequence kkk? 55/204 Two letters picked without replacement from {i: 3, r: 5, e: 1, j: 1, h: 1}. Give prob of sequence ji. 3/110 Three letters picked without replacement from {k: 2, a: 5, g: 4}. What is prob of sequence aag? 8/99 What is prob of sequence mmm when three letters picked without replacement from {m: 5}? 1 Three letters picked without replacement from mjwhjjrpppw. What is prob of sequence jwm? 1/165 Three letters picked without replacement from {e: 4, y: 2}. What is prob of sequence eey? 1/5 What is prob of sequence rq when two letters picked without replacement from {e: 10, r: 1, y: 4, q: 2}? 1/136 What is prob of sequence in when two letters picked without replacement from eheerenhiehq? 1/132 Calculate prob of sequence kz when two letters picked without replacement from zxkkauxaakzkaa. 4/91 What is prob of sequence uzuu when four letters picked without replacement from {u: 1, k: 3, z: 1}? 0 Two letters picked without replacement from lslzylsllllllll. Give prob of sequence lz. 11/210 Two letters picked without replacement from {c: 10, w: 2, u: 1, d: 1, x: 5, y: 1}. Give prob of sequence ud. 1/380 Two letters picked without replacement from {p: 1, w: 1, s: 6, x: 4, j: 4}. What is prob of sequence ws? 1/40
Let q(l) = -7l2 + 7l + 2. Let f(n) = -34n2 + 35n + 11. Let u(y) = -2f(y) + 11q(y). Find the second derivative of u(z) wrt z. -18 Suppose -3y = -5g + 6, 4g + 2y + 4 = -g. Find the third derivative of gd4 - 3d2 - d4 + 2d2 wrt d. -24d What is the third derivative of 2o4 + 4o2 + o4 + 2o2 wrt o? 72o Let p(j) = 2j3 + 3j*2 + 5. Let n(g) = -3g*3 - 5g*2 - 8. Let s = -10 + 15. Let m(r) = sn(r) + 8p(r). What is the third derivative of m(z) wrt z? 6 Let a(u) = 15u - 5. Let h(g) = 255g - 85. Let s(w) = 35a(w) - 2h(w). Differentiate s(k) with respect to k. 15 Let k(a) = a3 - 6a*2 + 4a + 7. Let j be k(5). What is the second derivative of 8c + 3cj + c2 - 4c + c2 wrt c? 10 Let y(w) be the third derivative of w8/336 + 5w*4/24 - 10w*2. Find the second derivative of y(p) wrt p. 20p*3 Let s(z) be the second derivative of -2z*6/15 + 13z*2/2 + 9z. Find the first derivative of s(k) wrt k. -16k3 Suppose -2a - 6 = -3a. Differentiate 4p - p + a - 5p - 10 with respect to p. -2 Let z(o) be the first derivative of -8o*5/5 + 5o*3/3 + 7. What is the third derivative of z(b) wrt b? -192b Let q(o) = -23o2 - 4o + 45. Let a(l) = 369l2 + 63l - 720. Let r(n) = 4a(n) + 63q(n). What is the first derivative of r(v) wrt v? 54v What is the third derivative of -65b*3 + 27b*3 - 19b*2 + 25b*2 + 23b*2 wrt b? -228 Let m be (-2)/(-6)(3 + 0). Let x be (4 - m) + (0 - 1). What is the second derivative of 2l + 4l*5 - 3l*x + 3l*2 - 2l*5 wrt l? 40l*3 Find the third derivative of -49p + 15p4 + 49p + 9p2 wrt p. 360p Suppose 3h - 2 = 7. Differentiate ht + 0t + t - 1 with respect to t. 4 Let o(v) = -2v - 5. Let y(b) be the first derivative of -3b2/2 - 9b + 6. Let r(g) = 7o(g) - 4y(g). Differentiate r(q) wrt q. -2 Let p(f) = 9f6 - 2f*2 - 5. Let j(i) = -5i6 + i2 + 2. Let s(v) = -5j(v) - 2p(v). Find the third derivative of s(x) wrt x. 840x3 Let j(v) be the second derivative of -11v*6/30 - 6v*2 + 9v. Differentiate j(f) wrt f. -44f3 Find the second derivative of 3c*2 - 2c*2 - 2c + 3c wrt c. 2 Let a = 23 - 21. Find the second derivative of 3l*a - 5l + 0l + l2 wrt l. 8 Suppose -5f + 24 = f. What is the first derivative of 0m + fm - 4m + 3 + m3 wrt m? 3m2 Let w(q) be the first derivative of q3/3 - 4q - 7. What is the first derivative of w(k) wrt k? 2k Suppose 3n + 4 - 3 = 2k, 6 = 5k - 4n. Find the third derivative of 0g - g2 - kg*2 + 0g + 4g3 wrt g. 24 What is the first derivative of -28r*4 - 3 + 3 + 8r*4 + 2 wrt r? -80r*3 Let f(d) = -d + 1. Let i be f(-3). What is the first derivative of 0 - i + 8 + 2t*2 wrt t? 4t Find the third derivative of 11n2 - 8n*2 - 5n*2 - 3n*5 wrt n. -180n*2 Let a(x) be the first derivative of -2x*4 - 18x - 17. What is the first derivative of a(m) wrt m? -24m2 Differentiate 14 - 17y + 10y + 27y*2 - 13y - 25y2 with respect to y. 4y - 20 Let u(s) = s3 + s2 - s - 7. Let v be u(0). Let b = v + 10. Find the second derivative of -2h + h + h2 + bh wrt h. 2 Let f(g) be the second derivative of -g6/15 - g3/3 - 10g2 - 71g. What is the first derivative of f(s) wrt s? -8s3 - 2 What is the first derivative of -l + 3l + 3 + 4l wrt l? 6 Find the third derivative of 49l*5 + 2l*3 + 0l*3 - 7l*2 + 5l - l*3 - 33l*5 wrt l. 960l*2 + 6 Let p be (-3)/6 - 5/(-5). Let z(n) be the third derivative of 3n*2 + 0n + 0n4 + 0 + 1/30n*5 - pn*3. Differentiate z(k) with respect to k. 4k Let s(r) be the first derivative of 5r4/2 - 38r*3/3 + 63. What is the third derivative of s(f) wrt f? 60 Let q(k) be the second derivative of 2k7/105 - k5/15 + 3k2/2 - k. Let i(s) be the first derivative of q(s). What is the third derivative of i(a) wrt a? 96a Find the second derivative of 18p - 6p + 13p4 - 2p*3 + 2p*3 wrt p. 156p*2 Let x = 17 + 1. Suppose 4f + x = 2f + 4g, 0 = f + 3g - 16. Differentiate -5 - p + f - 3p + 1 with respect to p. -4 Let f(q) = -q3 - q2 - q - 1. Let a(w) = 14w3 + 3w*2 + 3w + 5. Let j(c) = -a(c) - 3f(c). Differentiate j(p) wrt p. -33p2 Let x(n) be the third derivative of n5/6 - 5n3/2 + 18n*2. Differentiate x(f) with respect to f. 20f Let n(o) be the first derivative of 2o6 + 3o*2 - 5. Find the second derivative of n(z) wrt z. 240z*3 Suppose -3s + s + 6 = 0. Suppose -6q = -sw - 3q + 12, 5q - 5 = 0. Find the third derivative of 9y5 + 0yw + y2 - 6y5 wrt y. 180y*2 Let z(x) = -2x + 3. Let c be z(4). Let m = 7 + c. Differentiate -mp + 0 - 3 + 3 - 3 wrt p. -2 Let k(z) = -3z - 2. Suppose 0 = -m - m + 12. Let l(n) = 2 - 3n + 4n + 3n. Let v(i) = mk(i) + 5l(i). Differentiate v(y) wrt y. 2 Suppose -4h - 4 = 0, -4h = 5z - 76 - 30. Suppose i - 17 = -3s, -z = -i - 0i - 4s. Find the third derivative of 3l*6 - il6 + l6 - 2l2 wrt l. 240l*3 Let a(z) = -z + 1. Let x = 4 - 4. Let o(m) = -m + x + 2 - m. Let p(i) = -3a(i) + o(i). What is the derivative of p(k) wrt k? 1 Find the first derivative of 10x2 + 8 - 4x*2 + 10x*2 - 4x*2 wrt x. 24x Let l(t) be the third derivative of 1/112t8 + 0t*6 + 1/30t*5 + 0 + 0t + 0t4 + 0t*3 - 2t*2 + 0t*7. What is the third derivative of l(y) wrt y? 180y2 Let s(k) = k2 - k - 1. Let n(t) = -8t2 + 17t + 6. Let p(g) = n(g) + 6s(g). Find the second derivative of p(a) wrt a. -4 Let s(a) = 3a + 4. Let j(i) = -i - 2. Let z(l) = l + 2. Let o(c) = -4j(c) - 5z(c). Let t(y) = 7o(y) + 4s(y). Find the first derivative of t(g) wrt g. 5 Let l = 9 - 3. Let r(y) be the third derivative of 0y - 2y*2 + 0y*4 - 1/6y*3 + 0y*5 + 0 + 1/120y*l. What is the first derivative of r(o) wrt o? 3o*2 Let m = -14 + 19. Let h(v) be the second derivative of 0 + 3/20v*m + 0v*3 + 0v4 + v2 - 2v. Differentiate h(k) wrt k. 9k*2 Let l(w) = 6w*4 - 16w*2 - 3w + 3. Let i(p) = -7p4 + 15p*2 + 2p - 2. Let b(y) = 3i(y) + 2l(y). Find the third derivative of b(v) wrt v. -216v Let h be 16/3(-54)/24. Let m(x) = 12x3 + 5x - 18. Let p(o) = -30o3 - 12o + 45. Let s(b) = hm(b) - 5p(b). Differentiate s(j) wrt j. 18j2 Suppose -2u + 60 = 3u. Suppose 0 = s - 5s + u. What is the second derivative of 5l3 + 4l - 2l - 3l*s wrt l? 12l Let k(o) be the second derivative of -3o6/10 + 23o*3/6 - 5o. Find the second derivative of k(i) wrt i. -108i2 Let k(s) be the first derivative of -4s*6/3 + 17s*2 - 12. What is the second derivative of k(b) wrt b? -160b*3 Suppose -3m - 8 = -5m - 2b, -2b + 2 = -m. What is the second derivative of -2s*m + 2s*2 + 6s - 8s - s4 wrt s? -12s2 Let q(y) be the first derivative of -y3/3 - y + 2. Find the first derivative of q(k) wrt k. -2k Let c(x) = 11x*6 - 5x*4 - 2x*2 + 5. Let g(b) = -12b*6 + 6b*4 + 2b*2 - 6. Let d(r) = 6c(r) + 5g(r). What is the third derivative of d(h) wrt h? 720h3 Let g(x) = -x3 - 3x2 - 2x - 1. Let q be g(-3). Suppose 28 - 8 = qd. Find the third derivative of 0l2 + l2 + 0l4 - 3l*d wrt l. -72l Let n(k) be the second derivative of 4k + 1/5k*5 - 1/3k*4 + 0 + 0k*2 + 0k3. What is the third derivative of n(m) wrt m? 24 Let q(l) = l3 + 6l2 - 2l - 8. Let f be q(-6). Let h be (f/6)/(1/3). What is the derivative of 2 - 3b + 0 + hb wrt b? -1 Let i(v) be the third derivative of 2v6/5 + 11v4/12 - v3/3 + 13v2. What is the second derivative of i(f) wrt f? 288f Let t(z) = -1. Let u(a) = -a + 2. Let w(m) = 3t(m) - u(m). What is the derivative of w(h) wrt h? 1 Let u(y) = -y. Let g(x) = -4x*2 + 5x + 3. Let c(m) = -2g(m) - 10u(m). What is the derivative of c(l) wrt l? 16l Suppose 5z - 2c = 12, -c = -3z - 2 + 10. What is the third derivative of 0 + 3az + 1 - 2a*2 - 1 wrt a? 72a Suppose 0 = 2k - 2 - 2. What is the first derivative of 4 + 4r*k - 3r*3 - 4r*2 wrt r? -9r*2 Let a(p) = -13p*5 - 7p*2 - 2p - 2. Let n(t) = -t - 1. Let o(i) = -a(i) + 2n(i). Find the third derivative of o(x) wrt x. 780x2 Let b(k) be the first derivative of k5/20 - 3k2/2 - 2k + 2. Let v(w) be the first derivative of b(w). What is the first derivative of v(n) wrt n? 3n2 Let x(j) be the second derivative of j7/7 - 13j*4/12 + 7j. Find the third derivative of x(l) wrt l. 360l2 Let m(s) be the second derivative of 77s4/12 + s3/2 - 5s2/2 + 54s. What is the second derivative of m(h) wrt h? 154
Suppose d - 4d = -15. Suppose 3v = dv - 8. Suppose -vw = -0w - 36. What are the prime factors of w? 3 Let r(y) = 5y2 - 2. Let h(g) be the second derivative of g3/3 + 3g2 - 2g. Let t be h(-4). What are the prime factors of r(t)? 2, 3 Suppose -m = -19 + 6. Suppose m - 101 = -4v - 2f, -v = f - 20. List the prime factors of v. 2, 3 Let w = -28 - -49. Suppose -3z = -3u + w, -4 = 4u + 8. Let y = z + 15. List the prime factors of y. 5 Suppose 15 = 5p, -b = -3b - 2p + 64. List the prime factors of b. 29 Let r = 7 - 5. Let o(x) = -x + 2x3 - r + 4 - x3 - x2. What are the prime factors of o(2)? 2 Suppose -s + 3l = 7, -6s - 2l + 14 = -2s. Let p(a) = 10a2 + 2. What are the prime factors of p(s)? 2, 3, 7 Let n(f) = 3 + 4 - f2 + 7. What are the prime factors of n(0)? 2, 7 Let b = 4 - 3. Let d be 204/10 + 10/(-25). Suppose -b = -x - 0x + 4h, -5h + d = 3x. List the prime factors of x. 5 Suppose -5a + 191 = -2n, -5a = -n - 3n - 187. What are the prime factors of a? 3, 13 What are the prime factors of (30/(-3))/(2/(-7))? 5, 7 Let b(c) = 4c2 - 2. Let s be b(-2). Let f be ((-4)/6)/(2/(-6)). Suppose fi - 2t = 14, 5i - 3t - 21 = s. List the prime factors of i. 7 Suppose p + 15 = -2p. List the prime factors of 1/p + (-162)/(-10). 2 Suppose 2b - 5 = 3f, -b + 2 = -3f + 7. Let z(x) = x + 1. Let k(n) = -6. Let i(v) = -k(v) + z(v). What are the prime factors of i(b)? 17 What are the prime factors of 66/(-5)(-10)/3? 2, 11 Suppose 0 = z - 5a - 46, -5a - 28 + 312 = 4z. List the prime factors of z. 2, 3, 11 Let q be (-2)/(-6) - (-2)/(-6). Let y be -2 + 0 - (-2 - q). List the prime factors of -1(-6 + (y - 1)). 7 Let v(y) = -y*2 + 3y + 1. Let r be v(3). Suppose -2h + 5 + r = 0. What are the prime factors of h? 3 Let c(i) = i3 - 6i*2 + 4i - 2. Let r be c(2). Let l = 2 - r. What are the prime factors of l? 2, 3 Let q be ((-6)/(-4))/(10/20). Suppose -k + qt + 27 = 2k, -5t = 4k - 36. What are the prime factors of k? 3 Let m(a) = -5 - 2a - 4a + 1. Let g be m(-4). What are the prime factors of (-3 + 0)/((-6)/g)? 2, 5 Suppose 3r = -0f + 2f + 49, -4f - 22 = -2r. Let y = r + -11. List the prime factors of y. 2 Suppose -4w + 80 = w. Suppose w = -3g - 0b + 5b, 0 = -4g + 4b - 8. Suppose -14 = -gz + z. List the prime factors of z. 7 Let z = -39 - -20. Let c = 30 + z. What are the prime factors of c? 11 Suppose 0 = 4b + 5l - 103, b + 3b + 3l - 113 = 0. Suppose 0m + 4m = b. What are the prime factors of m? 2 Let a(l) = 0 - 2l - 6 + 0l. Let f be a(-4). Suppose -4k + 60 = -3g, -k + 4g - 15 = -fk. What are the prime factors of k? 3, 5 Let o(y) = -7y2 - 6y - 6. Let n be o(-3). What are the prime factors of n/(-4) - (-5)/20? 13 Let h be (-4)/242-6. Suppose -ht = -9 - 3. What are the prime factors of t? 2, 3 Let d(c) = c2 - 7c + 6. Let l be d(6). Suppose l = 2p - 3p + 18. List the prime factors of p. 2, 3 Let r = 12 - 17. Let a be (r - -3) + 22. Suppose -ad = 3d - 60. List the prime factors of d. 2, 3 Let p(u) = -u3 - u2 + 2u + 6. List the prime factors of p(-2). 2, 3 Suppose 4z + 19 = -5. Suppose 3g - 6 = -0g. Let b = g - z. List the prime factors of b. 2 Suppose -j = -4f - 2j + 29, 5 = j. What are the prime factors of (117/f)/32? 13 Suppose -4u + 5k = -690, -5u - 11k = -9k - 846. List the prime factors of u. 2, 5, 17 Let m(x) = 7x*3 - 2x2 + x + 2. List the prime factors of m(3). 2, 11 Let b(a) be the third derivative of -a4/12 - a*3 - 2a*2. Let q be b(-4). Suppose 4i + q - 26 = 0. What are the prime factors of i? 2, 3 Let n(i) = -i*3 - i + 1. Let h(x) = -4x*3 + 5x*2 + 5x + 2. Let a(m) = h(m) - 3n(m). What are the prime factors of a(6)? 11 Let r(j) = -j2 + 4j + 7. Let o be r(5). Suppose 0 = t + 3, 0 = od + 3d + 4t + 57. Let s = d + 19. What are the prime factors of s? 2, 5 Suppose -2r + 62 + 204 = 0. Suppose r = 4a - q + 4q, a - 46 = -5q. What are the prime factors of a? 31 Suppose -3d = -0d - 18. Let z(a) = a3 - 4a*2 - 7a - 10. List the prime factors of z(d). 2, 5 Let t(q) = q*3 + 8q*2 + 5q + 10. List the prime factors of t(-7). 2, 3 Suppose 0 = 5f - 31 + 6. Suppose -6t + 12 = -2t, 55 = 5c + ft. Let n = -5 + c. What are the prime factors of n? 3 Suppose 3c = -2c + 75. What are the prime factors of c? 3, 5 Let v be 2/5 - 32/(-20). Suppose 2a + v = -0a. Let m(r) = -9r - 1. List the prime factors of m(a). 2 Let f = 11 + -8. Suppose 0t = -ft + 9. Suppose -29 = -tw + 4. What are the prime factors of w? 11 Suppose 11a = 8a + 6. Suppose l = -0l + 9. Let f = l - a. What are the prime factors of f? 7 Let j = -3 + 5. Suppose 5 = jx - 3. What are the prime factors of x? 2 Let n(v) = 90v. Let r be n(1). Suppose r = -0u + 5u. What are the prime factors of u? 2, 3 Let k(i) = -i*3 + 8i*2 - 2i + 1. List the prime factors of k(7). 2, 3 Let w = 2 + -3. Let p(k) be the first derivative of -7k4/4 + k3/3 + k2 + k + 6. List the prime factors of p(w). 7 Let f(k) = 3k - 4. Let g be f(-9). Let i(l) = 10l + 1. Let t be i(-2). Let c = t - g. What are the prime factors of c? 2, 3 Let d(h) = -h - 1. Let o be d(-3). Suppose t + ot + 21 = 0. Let q(b) = -b*2 - 9b - 10. List the prime factors of q(t). 2 What are the prime factors of 18 - (-1 + -5 + 3)? 3, 7 Suppose -w = w + 14. Let z = w + 31. What are the prime factors of z? 2, 3 Suppose -6 = -3a + 6. Let j(w) = w2 + 3w - 5. List the prime factors of j(a). 23 Suppose a + 22 = 3a. Let d = a - 5. What are the prime factors of d? 2, 3 Let q(f) be the third derivative of -f6/120 - f5/30 - f3/6 - 9f*2. Suppose -3v = -3z - 24, -17 = z - 4v + 6. What are the prime factors of q(z)? 2 Let w(b) = -b - 2. Suppose -34 = 3h - k, 3h + 14 + 32 = 4k. List the prime factors of w(h). 2 Suppose 5g - 5u - 75 = 0, -g + 2u + 9 = -1. What are the prime factors of g? 2, 5 Let t(r) = -r*3 - 11r*2 - 12r + 13. List the prime factors of t(-12). 7, 43 Suppose -4y = -3v - 22, 0 = 2y - 4y + 5v + 4. What are the prime factors of (-2)/y + (-1060)/(-35)? 2, 3, 5 Let l = 8 + -18. Let p = l - -7. List the prime factors of (16/6)/((-1)/p). 2 Suppose -5r + 3z + 21 = 91, -20 = 4z. Suppose -4n = 3o + 13, 3o = n - 0n + 22. Let s = n - r. List the prime factors of s. 2, 5 Suppose -5a + 626 = -2c, -2a - 5c = -7a + 620. List the prime factors of a. 2, 3, 7 Let t = -6 - 44. What are the prime factors of ((-14)/5)/(5/t)? 2, 7 Suppose z + 5 = 0, 3i + 0i - 3z - 21 = 0. Let m(f) = 15f2 - 3f + 1. List the prime factors of m(i). 5, 11 List the prime factors of (-6)/(-4)(-4 - -18). 3, 7 Suppose 0 = k + 3l - 26, l + 16 = k - l. Let q = k - 2. What are the prime factors of q? 2, 3 Let j(a) = -a*3 - 5a*2 - 6a. Let g be j(-5). Let z = g - 18. List the prime factors of z. 2, 3 Suppose -3f + 109 = -4y, 2f + 4y = -26 + 92. Suppose -4n + 25 = -f. List the prime factors of n. 3, 5 Suppose 14 = 2z - 4m, z + 2m - 1 = m. Suppose -zv - v + 8 = 0. Suppose vl + h - 7 = l, -5h = 2l - 14. List the prime factors of l. 7 Suppose 7o = 3o. Let i(f) = f + 58. List the prime factors of i(o). 2, 29 Suppose -i - 2i + 2z + 340 = 0, -452 = -4i + 2z. List the prime factors of i. 2, 7 Suppose 2r - 9 = -r. Suppose -4s = 5y - 36, -4s + 7 + 21 = ry. Let t(w) = -w2 + 7w + 4. List the prime factors of t(y). 2 Let k be 148/6 + 2/(-3). Let i be 3/(-3)9/(-2)-2. Let g = i + k. What are the prime factors of g? 3, 5 Suppose 5j = -5u + 9u + 634, 0 = -j - 3u + 142. List the prime factors of j. 2, 5, 13 Let z(s) = -3s - 3. Let b be z(-2). Suppose 2l + r = -4r + 36, -2r = -bl + 35. List the prime factors of l. 13 Let i(n) = 5n*2 + 3n. Let m be i(-2). List the prime factors of (m/4)/((-9)/(-18)). 7 Let r(n) = -n - 7. Let t be r(-7). Suppose ti = -i. Suppose -h + 4o + 6 = -10, -4o = i. List the prime factors of h. 2 What are the prime factors of (-15)/30 + (-297)/(-2)? 2, 37 Suppose -b + 0j + 326 = -5j, 0 = 4b + 2j - 1392. List the prime factors of b. 2, 173 List the prime factors of 3/(3/(-4)) + (155 - 2). 149 Suppose -2o = -3o + 19. Let l = o - 5. List the prime factors of l. 2, 7 Let u be 18/2(-4)/(-12). Suppose -uj - 13 = -d, 4d + 4j = -9 + 29. Let f = d + -3. What are the prime factors of f? 2 Let x(i) = i3 + 9i*2 + 7i - 1. What are the prime factors of x(-6)? 5, 13 Let d be (-4)/(-14) - 5/(-7). What are the prime factors of 1/d - (11 + -12)? 2
Let l be 0/22/4 - 0. Which is bigger: l or 14? 14 Suppose -k + 0 = -2. Let f be (-1)/k + 4/6. Which is bigger: f or 0? f Let s be (-2)/514(3 + -1). Let a = 524/1285 + s. Let k be 147/(-70) + 2/(-5). Which is smaller: a or k? k Let b be ((-580)/(-15))/(-4)3/7. Are b and -3 nonequal? True Let i be (-177)/252 - (0 + (-4)/6). Is i less than 0? True Suppose -8 + 1 = -7x. Is 0 at least x? False Suppose 4d - 3 = 9. Suppose 2z = -du - 7, -3u + 6z = 2z - 5. Let w be (-1)/(-4)(-6)/(-9). Which is bigger: u or w? w Let m be -74(-1)/(-24) + 3. Which is greater: m or -0.1? m Suppose -10z - 20 = -6z. Is z greater than or equal to -5? True Let s(l) = l - 4. Let k be s(7). Is k at most as big as 2? False Let w = 44/45 + -6/5. Suppose j + 5l = -24, 5j - 5l - 24 = 6. Let b be 4j - (0 + 3). Which is bigger: b or w? b Let d = -1 - -0.9. Suppose -29 + 17 = -2a. Which is bigger: d or a? a Let l be 22/(-121) + 52/165. Which is greater: 1 or l? 1 Let k = 5 + -5. Let v = 11 - 9. Suppose -3n = -vn. Is k > n? False Suppose -4h - z = -3, 2z - z = -1. Let d = -134/3 + 941/21. Which is smaller: d or h? d Suppose -5g - 10 = -2c, 0g - g = 2c - 10. Which is smaller: g or -2.1? -2.1 Let q = -13 + 13. Is -2/15 >= q? False Suppose -2v + 4w = 0, 0 = -4v - 4w + w + 55. Let b = -8 + v. Is 1/2 at least as big as b? False Let y = 2/19 + -103/76. Do -1 and y have different values? True Let q = -3215/4 + 737. Suppose 0 = -2a - 3i - 120, 9a + 4i + 248 = 5a. Let y = a - q. Does y = 0? False Suppose -5d - 39 = -2w, 6 - 33 = 5d + 4w. Let f be d/(-2) + 3/6. Suppose -12 = fx - 0. Which is smaller: x or -1? x Let b be (1 + -2)/(-1 - 0). Let s(x) = -27x - 107. Let h be s(-4). Is b less than or equal to h? True Suppose -3k = 3l - 18, l - 3 - 12 = -4k. Let c = k - 3. Which is smaller: c or -1? -1 Let j be (-1)/2(-4)/(-6). Is -3 greater than or equal to j? False Let k = 135/19 + -7. Let w be (-1 + 3)/(1 + 1). Do w and k have different values? True Let b = -24 - -47/2. Let a = 0.3 - 0.6. Let w = 0.1 + a. Which is greater: b or w? w Suppose -2c + 4n = 48 - 10, 3c = -5n - 46. Which is smaller: -18 or c? -18 Suppose 0 = -f + 2x - 5x - 9, 3f = -5x - 19. Suppose -p - 5a - 9 = 0, -17p + 21p + 14 = 2a. Is p less than or equal to f? True Let u = -86/21 - -24/7. Which is greater: u or -0.2? -0.2 Let w be 1(-3 - 0/(-2)). Suppose 5o - 89 = i + 15, -4i = -5o + 116. Suppose -3c - o = 2c. Is w smaller than c? False Let o = -0.8 - 2. Let w = o + 3. Suppose 0 = 3p + 5x - 20, -5p = -2x - 2x + 16. Is w not equal to p? True Let u = 158 + -160. Let f be 0 + 0/(-1) + -3. Is u at most as big as f? False Let f = -3.95 + 0.08. Let s = 0.18 - f. Let r = -0.05 + s. Is r bigger than -2/7? True Let s = -16 + 17.8. Let d = s + 0.2. Let p = -3 + d. Which is greater: p or 2? 2 Let y(o) = 2o. Let l(b) = b. Let x(s) = 5l(s) - 2y(s). Let q be x(0). Suppose -5v = -i - 4, -5v = -qv - 4i - 16. Is 1 < v? False Let r = 6 - -3. Suppose 4g - 2b - 43 = -7, 5b = -g + r. Is g at most as big as 8? False Let x = 0.25 + -0.35. Which is bigger: x or 1/20? 1/20 Let d = 6 + -4. Let q = 0.7 - -2.3. Which is smaller: q or d? d Let f = -9673 - -116165/12. Let s = -27/4 + f. Is -2/3 not equal to s? True Let p be (12/10)/(4/10). Suppose 3o = -2r - p, -13 = -2r - r - o. Is 5 at most as big as r? True Let m(t) = -t + 6. Let l be m(8). Let o be (-6)/(-46)l/3. Is -1 equal to o? False Let p(y) = 2y - 11. Let u be 2/3 - (-14)/(-21). Suppose ut + 8 = t. Let g be p(t). Are g and 5 equal? True Let o be (-2323)/(-3)(-6)/(-23306). Let s = o + 9/271. Let f = -16/301 - s. Is f bigger than 0? False Suppose 0s - 4s + 14 = -2t, -3t = 4s + 1. Suppose 3v - v = 4u - 2, -3v = -5u + s. Which is greater: 3/8 or u? u Suppose -f + l - 15 = 0, -5l = -4f - 35 - 20. Is f at least as big as -22? True Let u = 59 - 25. Suppose 32 = 4j + 4c, 4j - u = -c - 11. Let f = 4 - j. Is f != -2/7? True Suppose -3m + 3r = 0, 0m - r = 2m. Which is smaller: 2 or m? m Let l = -86 - -32. Which is smaller: l or -55? -55 Let h = 4.79 + -0.39. Let b = h + 0.6. Which is smaller: 1 or b? 1 Suppose -2f - f + 14 = p, 5f = 3p + 14. Suppose -4j = -7j + 6. Suppose -ps = js. Is s at most as big as -2? False Let p = 0.7 + -0.76. Let r = -0.46 - p. Which is smaller: 1 or r? r Let z = 93 - 87. Which is bigger: z or 2? z Let b = -4 - -3. Let d be (-3)/(-6)b/3. Which is smaller: -1/4 or d? -1/4 Let u be (-105)/(-564) + (-11)/44. Which is greater: u or 1? 1 Let l(m) = 3m + 22. Let i be l(-7). Is 9/4 at least i? True Suppose m = -3y - 0y - 2, -3y - 3m = 0. Suppose 3j + 3u = -3, -3u + 14 - 2 = -2j. Let x be (1/j)/(y/(-3)). Which is greater: 2/11 or x? 2/11 Let d = -4 - -6. Let k = 6 - 4. Suppose ka = 3j - 2 - 0, 3j + da + 2 = 0. Is j bigger than 0? False Let r = 1/226 - 457/1130. Suppose -5j = -x - 4, 2j - 5x + 1 = -2j. Let z = j - 1. Which is bigger: r or z? z Let b = 7 - 3. Suppose -44 = -3q + bq. Let u be 12/(-9)(-2)/q. Which is greater: -1 or u? u Let m be ((-3)/(-9))/(2/(-18)). Let a be 2/6 + (-11)/m. Suppose 0 = -4j - 0j - 4u - 4, au = -8. Which is bigger: -1/6 or j? j Let l = -216/35 + 33/5. Which is bigger: 0 or l? l Let c be 8/(-24)(-1)/((-1)/2). Which is smaller: c or -4? -4 Let y be ((-4)/(-10))/(16/20). Which is greater: 0 or y? y Let g = 8 + -4. Suppose w + 9 = -2o, -2w + w - go = 19. Suppose 5 + 5 = 4r - 3d, 4d = -8. Is w != r? False Let o = 758/7 - 108. Let h(k) = -k2 + 2k + 1. Let m be h(0). Which is smaller: o or m? o Let o be (-1 - 0) + 2/5. Let q = 0.75 - 0.55. Which is smaller: q or o? o Let v be 4 - ((2 - 0) + 0). Is v at least as big as 4? False Suppose -r = 8r - 9. Which is greater: r or 8? 8 Suppose 2 + 7 = p. Let b be (-1)/(2 + (-21)/p). Let x be b/2(-2)/3. Which is smaller: x or 1/3? x Let l(v) = v*2 + v - 4. Let k be l(-3). Let n be 24/14 + k/7. Let d be (-48)/9n/(-8). Is 2 bigger than d? True Let h(n) = -n*3 + 6n*2 - 2n - 1. Let q be h(3). Suppose -u + 4c = -16, -5u + 5c = -3u - q. Suppose up = -p. Which is smaller: p or -2/9? -2/9 Suppose -f - 30 = -4f - 4d, -4f = 4d - 36. Is 6 less than f? False Suppose 0 = -3d - 3u + 6, 2u + 0 = d + 4. Is d <= -2/95? False Let y = 10 - 38. Which is smaller: -29 or y? -29 Suppose -2v + 1 = p, 5v - 5 = -2p - 3p. Is -0.5 at least p? False Let j be 3/((-7)/(-4) - 1). Suppose -jm - m = -20. Suppose 4z - 5z = -2x - 1, -4x + 4 = 0. Is z smaller than m? True Suppose 9y = -s + 4y - 16, 0 = -y - 1. Let n = s - -18. Suppose -2o + 2m - nm = 11, 2o = -3m - 9. Which is bigger: o or -1? -1 Let m(q) = -q + 4. Let r be m(-6). Let i = -6 + r. Which is smaller: i or 3? 3 Let m = 3 + 10. Is m >= 14? False Suppose -5g = 2m + 17, 4m + g = 2g - 1. Let t = m + -1. Which is smaller: -1 or t? t Let m = 1.3 + 0.7. Let o = m - 1.6. Let j = o + -2.4. Which is greater: j or -2/9? -2/9 Let x = 192.7 - 209.56. Let h = x - -17. Let s = h - 0.04. Which is smaller: 3 or s? s Let c(y) = y*2 - 1. Let u be c(-1). Are u and 1/4 unequal? True Suppose 0k + 100 = -4k. Let v be ((-8)/(-290))/((-10)/k). Which is smaller: 1 or v? v Let x(k) = 4k*2 - 3k*2 - 3k + 2k + 3k. Suppose 2u - 2t - 1 = 5, 5u + 2t = -20. Let g be x(u). Which is greater: 1 or g? 1 Let c = -37 + 22. Are 0 and c equal? False Let q = 8 - 6. Let f = q - 7. Let v be 1/f + (-6)/(-15). Are 1 and v unequal? True Let r = -14 + 15. Do r and -1/3 have different values? True Let d = 2434/3055 + 2/611. Which is greater: d or 2? 2 Let a(n) = 2n2 - 9n. Let w(z) = -3z2 + 17z. Let y be (-2)/((-6)/273). Let t(g) = yw(g) + 5a(g). Let s be t(-6). Which is smaller: -1/3 or s? -1/3 Let d = 12 - 10. Suppose -j - d = -1. Which is bigger: j or 1? 1 Suppose 6l + 28 = -l. Which is smaller: -1 or l? l Let f be 14 + -18 - 30/(-7). Which is bigger: 0.3 or f? 0.3 Suppose -4h - s = -9h + 111, -h + 5s = -3. Which is smaller: 22 or h? 22 Suppose 10 + 25 = 5u. Let f = u - 4. Which is greater: f or -1? f Let q = 32.8 + -30. Let r = -3 + q. Let u = r + 0.4. Which is greater: 0 or u? u Let b be 1/(9/6 - 2). Let y = 3 - 5. Is b > y? False Suppose -3s - 76 = -4b, -3s - 27 + 65 = 2b. Let a = 21 - b. Let w(n) = -n*3 - 6n*2 - 4n + 7. Let x be w(-5). Are x and a non-equal? False Let t = 1 - 1.1. Let j = -302 - -2105/7. Let x = j - -131/91. Is x bigger than t? True Let s = -3.1 - -3.1. Is -0.02 less than s? True Let b be (-3)/(-45)*18/(-4). Does 1 = b? False
Let w be 1 + -8 + -23/3. Let m be (-2)/6 - (-42)/w. Let i be 14/(-49)(1 - 15). Put m, 3, i, 1 in increasing order. m, 1, 3, i Suppose g - 2z + 19 = -4g, 4z + 7 = g. Suppose -j + 16 = 2u + 2u, u - 13 = 2j. Let w = 1510 + -1506. Sort w, g, j in decreasing order. w, j, g Let c be 13 - 7/(-56)-104. Sort -1, -3, 2, c in decreasing order. 2, c, -1, -3 Let l = 1 - 1. Let g = -7 + 21. Let p(y) = y3 + 107y*2 + 1160y + 243. Let s be p(-12). Sort l, g, s in descending order. g, s, l Let c = 75 + -80. Let x = 9.42 + -8.42. Sort c, x, -7 in decreasing order. x, c, -7 Let q = 8 - 10. Let i be (-510)/444/46 - 4 - -5. Sort i, q, 5 in ascending order. q, i, 5 Let v = -4720 - -4725. Sort 3, v, -1161 in ascending order. -1161, 3, v Let o be (-18)/27 + (-3)/((-9)/(-121)). Let d = 125/3 + o. Let c be (-84)/(-16) + -2 - 4. Put d, c, 2 in decreasing order. 2, d, c Let q(s) = -74s*2 - 581s - 61. Let y be q(-8). Sort y, -2, -10 in decreasing order. -2, -10, y Let s = -3860 - -3863. Put 368, s, -2/3, -4, -4/5 in descending order. 368, s, -2/3, -4/5, -4 Let n(r) = -160r + 4642. Let o be n(29). Put -29, -1, -2, -4, o in ascending order. -29, -4, -2, -1, o Let k be (-20 + 144/32)/(-3 - (-39)/12). Put -5, k, 8, 2/5 in descending order. 8, 2/5, -5, k Let s = 7 + -6. Suppose 28 = 4d + 2t, 0d + t = -d + 7. Suppose 2h + 4p - 2 = -8, p - 21 = -5h. Sort s, h, d. s, h, d Let l be (-16)/(-3)(-1773)/(-2364). Let x be (6/(-8))/((-2)/(-8)). Sort 2, -4, l, x in decreasing order. l, 2, x, -4 Let w = -6 - -2. Let y(t) = -32t + 5. Let j be y(-1). Let z = j + -34. Put 10, w, z in descending order. 10, z, w Let w = -3897/2 + 1949. Let o = 0.42 - 19.42. Sort o, w, -4 in descending order. w, -4, o Let i = -3/92 - 5/23. Put 0.2, -4/247, i in descending order. 0.2, -4/247, i Let c = 4457 - 4573. Sort -4, c, 0, 5 in ascending order. c, -4, 0, 5 Let o = -46 - 7. Let c = -23 - o. Let y be c/140(-2)/6-4. Sort -6, 1/7, y in descending order. y, 1/7, -6 Let q = 10 - 10. Let s = -0.975 - -0.91. Let v = s + 0.465. Put 2/3, q, v in ascending order. q, v, 2/3 Let i = -46/5 + 117/10. Let y = 19558.5 + -19559. Put i, y, 3 in descending order. 3, i, y Let h = 0.1977 + 0.1023. Put -5, h, 34.9 in decreasing order. 34.9, h, -5 Suppose 5f + 2185 = 5i, -910 = -2i + 4f - 28. Let x = 436 - i. Sort 30, x, -5. -5, x, 30 Let x = -2.605 - -3.605. Suppose -4f + 3p + 600 = -f, p = -4f + 795. Sort x, f, 3/5 in decreasing order. f, x, 3/5 Let h = -0.217 - -104.217. Let o = 103.1 - h. Suppose 0 = 5f + 2a + 8, 5f + a - 5a = -14. Put f, o, 3/5 in ascending order. f, o, 3/5 Let s be 26 + -40 - -18 - ((-48)/30 - -5). Let m(h) = -h*3 + 4h*2 - 2h. Let z be m(3). Put 3.1, s, z in increasing order. s, z, 3.1 Let g = -2137 + 2136. Put -6, g, -92, 4 in descending order. 4, g, -6, -92 Let k = -14 + 6. Let v(l) = 7l2 - 70l + 4. Let q be v(10). Suppose -2 = -2o + qm, 19o = 22o + m - 10. Put -2, k, -5, o in increasing order. k, -5, -2, o Let w be 16 - (0 - -1)/(15/165). Sort w, 464, 3. 3, w, 464 Let i = 38 + -26. Let o be (-15)/i(0 - -4). Suppose -4h + 10 = 2u + 4, -5u - 3 = 4h. Put o, h, -1 in descending order. h, -1, o Let j be -1 - -10 - ((-468)/104)/(18/(-16)). Suppose a = 0, -4w = -0w + a + 20. Put j, -1, w in decreasing order. j, -1, w Suppose -26w - 96w + 2485 = -199. Suppose -2a + 1 = 7. Sort w, -4, a in decreasing order. w, a, -4 Let l(r) = -r*3 + 4r*2 + 5r - 3. Let n be l(5). Let o(k) = -7520k - 150295. Let q be o(-20). Sort 5, n, q in decreasing order. q, 5, n Let a = -8.5 + 9. Let d = -24814 + 49611/2. Sort d, a, 4/5, -2/9 in decreasing order. 4/5, a, -2/9, d Let c = -319 - -323. Let m = 35 - 38. Put 3, m, c in ascending order. m, 3, c Let f = 46 - 36. Suppose 18 = p - 5z, 3z - 7z = -3p + f. Let g be ((-10)/(-8))/(-5)(-7 - -3). Sort g, p, -4 in ascending order. -4, p, g Suppose 4d + 178 = 5h + 174, 3d + 3 = -h. Put 1209, 0.2, h in descending order. 1209, 0.2, h Let x = -404 + 401. Let g be (6/4)/((-54)/(-48)). Put x, g, -1/11, 0 in descending order. g, 0, -1/11, x Let d(a) = a + 6. Let w(l) = -l + 1. Let k(h) = -d(h) + 3w(h). Let z be k(-1). Suppose -b - 3v - 11 = 0, b - v - z = 4b. Sort -2, -1, b in decreasing order. b, -1, -2 Let v = 169 + -176. Let o(j) = -j*2 - 1. Let s(c) = -3c3 + c2 + 4. Let y(r) = -3o(r) - s(r). Let u be y(-1). Sort v, u, 4 in descending order. 4, u, v Let t be (-8)/3(-26 - (-101)/4). Sort -2/13, -9, 25, t in ascending order. -9, -2/13, t, 25 Let i = 17961.13 + -17961. Put -0.11, i, -16 in decreasing order. i, -0.11, -16 Suppose 0 = 5z + 236 - 150 - 141. Sort -3, z, -5, -12. -12, -5, -3, z Let x be (-21)/315(-135)/18. Put -9/7, x, 1 in descending order. 1, x, -9/7 Let b = 32 - 32.11. Let t = -0.51 - b. Sort -2, -3, t, 2/11 in descending order. 2/11, t, -2, -3 Let k = -24 + 50. Let g = k - 22. Let y be 0 + (-6)/g + 1. Sort y, 1/5, 4 in decreasing order. 4, 1/5, y Let h = 1.81 + -2.78. Let p = h - -0.67. Put -5, 0.4, p, -10 in ascending order. -10, -5, p, 0.4 Let n be (-1 - 6/(-10)) + (-10 - (-2156)/210). Put n, -2/3, -11/18 in increasing order. -2/3, -11/18, n Let c be (-1)/((-2)/14) + 3024/(-540). Sort -3/11, -1/4, c, 0 in decreasing order. c, 0, -1/4, -3/11 Let d = -14 - -15. Let g be (((-280)/50)/14)/((-4)/30). Sort -24, d, g, -4 in decreasing order. g, d, -4, -24 Let y = -1018 - -9160/9. Sort 2/7, -6, y, 2. -6, y, 2/7, 2 Let p = -8062 + 8065. Put 0.4, p, 0, 2/27, 103/2 in descending order. 103/2, p, 0.4, 2/27, 0 Suppose -3b + 5b - 3p = 64, -4b + 3p + 122 = 0. Suppose -2g - 31 = -5s, 27s - g = bs - 7. Put s, -21, -1 in decreasing order. s, -1, -21 Suppose -8 + 4 = 4a. Suppose -198 = 33k - 22k. Let v be ((-110)/(-30) - 7)k/10. Put a, v, -9 in descending order. v, a, -9 Let b = -412/5 - -82. Let c = 570 + -383. Let k be (-12)/c + (-6)/(-33). Put -24, b, k in decreasing order. k, b, -24 Suppose -2d + 30 - 38 = 0. Suppose 3a = -12, 3k - 4 = -2a - 0. Let q = -608 - -608. Put q, 5, k, d in decreasing order. 5, k, q, d Let t = 16709 - 183801/11. Put -335, 3, 2/9, -4, t in descending order. 3, 2/9, t, -4, -335 Let u be 54/(-12) + 4 - 1702/408. Let b = -78/17 - u. Let v = 0.3 - 0.4. Put b, v, 1/2, -1 in decreasing order. 1/2, b, v, -1 Let a = 189 + -186. Suppose 5g - 40 = 3n, 3n - ag + 2g = -20. Sort 4, -3, n, -13 in increasing order. -13, n, -3, 4 Let m = 10.078 - 13.078. Sort m, -1/65, -1, 3/11, 2. m, -1, -1/65, 3/11, 2 Let l be 42/(-5) + ((-7)/(-5) - 1). Let c be (l/(-16))/(2/(-4)). Let t be (c + -1 - 1) + -3 + 3. Put t, 1, 2 in increasing order. t, 1, 2 Let b be (96 + -94)(-63)/6. Sort b, -2, -11 in increasing order. b, -11, -2 Let s = -859/4 - -216. Let j = -0.18 + 1.93. Let b = -1.25 - j. Sort b, 0.12, s in increasing order. b, 0.12, s Let t = -1660 + 1657. Put t, 2, 17, 1 in increasing order. t, 1, 2, 17 Let k = 444 + -438. Suppose -j - 12 = -4o, 2o = -3j + ko - 12. Put -10, -2, 3, j in descending order. 3, j, -2, -10 Let c = -21/8 + 459/184. Let r = c + 170/69. Let x = -1.1 - -0.1. Put x, 2/7, r, 0.2 in ascending order. x, 0.2, 2/7, r Let m = -416/7 - -60. Let v be 2 - 03/12. Suppose -4u + vf + 0f - 10 = 0, -5f = -3u - 11. Sort u, m, 3. u, m, 3 Let d = -17.655 + 15.655. Suppose 2z + 15 = 3i, 5i = 6i - 4z - 5. Put 0, -29, d, i in decreasing order. i, 0, d, -29 Suppose -56 + 70 = -x - 2i, 4 = -5x + i. Sort -21, x, 76, -3. -21, -3, x, 76 Let f = 3 - 3. Suppose 18 + 51 = 68t + t. Put t, f, -2 in increasing order. -2, f, t Let j = -30 + 34. Let a = 7 + -11. Let c = -13.45 + 13.75. Put c, j, a in increasing order. a, c, j Suppose l + t - 10 = 4t, -5l - t + 2 = 0. Let u = 0.1952 + 2.8048. Let f = -2.1 - -2. Sort l, u, f in descending order. u, l, f Let a = 10850 + -10850.3. Put 2/11, a, -177/7 in decreasing order. 2/11, a, -177/7 Let x be (11/(-55))/((-11)/(-55)). Put x, 7, 128, -4 in increasing order. -4, x, 7, 128 Let k be (-3)/9 + (-20)/12. Let l be (1/k)/(3/(-12)). Let s be 23/4 + 297/(-396). Sort l, -3, -2, s in descending order. s, l, -2, -3 Let x = 5 + 3. Let p = x - 3. Let o = 954 - 964. Sort p, -2, o in increasing order. o, -2, p Let p(n) = -35n*2 + 20n - 20. Let g be p(1). Let b = 29.8 - 30. Put -1/2, -3, b, g in decreasing order. b, -1/2, -3, g Suppose 4k = 3k - 5. Let n be 4*((-297)/108 + (9/(-12))/(-1)). Sort n, k, 3, -3 in descending order. 3, -3, k, n Let l = -3988 + 3987. Sort 1, l, 5, 8, -5. -5, l, 1, 5, 8
Simplify (-2 + (-1 + sqrt(15)/((sqrt(27) - sqrt(3)) + sqrt(3)) + 3)-2)2. 8sqrt(5) + 344/9 Simplify ((sqrt(1088) - -3sqrt(1088))3 - ((sqrt(1088) - (sqrt(1088) + -1)5) + sqrt(1088)))2 + 0 + 3. -1200sqrt(17) + 244828 Simplify 6(-21sqrt(2299) - (sqrt(2299)-1 + 3))*2. 396sqrt(19) + 13848 Simplify (((((sqrt(420)1)/sqrt(7) - sqrt(60)) + sqrt(60) - sqrt(60))2)/(2sqrt(144)/sqrt(3)))2. 0 Simplify (4 + (sqrt(243) - (sqrt(243) - (sqrt(243) + (-1 + sqrt(243))-3)) - sqrt(243)))*2 + -4(0 + sqrt(243) + -1)*2. -306sqrt(3) + 1260 Simplify 4((-4sqrt(66)6)/((2sqrt(12))/sqrt(2)))*2. 6336 Simplify ((2(sqrt(132) - 2sqrt(132) - sqrt(132)) + sqrt(132) - sqrt(132))-6)/(sqrt(120)/sqrt(90) + sqrt(588)1). 36sqrt(11)/11 Simplify (sqrt(121) - (sqrt(121)-3 + sqrt(121) + sqrt(121)))/sqrt(11) + -2 - ((sqrt(792)/sqrt(2))2 + -2). -396 + 2sqrt(11) Simplify (1-1sqrt(26))/(sqrt(64)/sqrt(8)) + 0. -sqrt(13)/2 Simplify (3sqrt(84)4)/(-2sqrt(12)4). -3sqrt(7)/2 Simplify (sqrt(352)-26)/(32sqrt(8)) + 1. -4sqrt(11) + 1 Simplify -5 + -4 + (sqrt(425) + -2)-5 + -2. -25sqrt(17) - 1 Simplify (sqrt(143) + sqrt(143)2)/sqrt(11) + -2 + sqrt(13) + (sqrt(52)/sqrt(4))2 - 6(-1 + sqrt(1053) + sqrt(1053))*2. -25267 + 220sqrt(13) Simplify 5(((sqrt(324) - -5(-1sqrt(324) - sqrt(324))) + sqrt(324))/(3(-2sqrt(12) + sqrt(12))))2. 960 Simplify -1 + (5 + (sqrt(3)2 - sqrt(3))-1 + sqrt(27)/(sqrt(36)/sqrt(4))3 + -4)*2. 4sqrt(3) + 12 Simplify (0 + 4sqrt(16)/sqrt(8) - (sqrt(18)1 + sqrt(6)/sqrt(3) + -1))*2. 1 Simplify (2(sqrt(250) + sqrt(250) + sqrt(250)1 + sqrt(360)-1)/(-2sqrt(405)-6 - sqrt(405)))*2. 8/121 Simplify (4 + (-2sqrt(13) - sqrt(13) - sqrt(13))-1 + -4)2 + 2(sqrt(1300)1 - sqrt(1300))2. 208 Simplify (-11sqrt(486))/((-2sqrt(3) + sqrt(3))1 + sqrt(3) - 4sqrt(6)/sqrt(2)). 9sqrt(2)/4 Simplify (-1sqrt(68)-1 + 3-2sqrt(68))/((sqrt(100) - 2sqrt(100)) + sqrt(256)2). -5sqrt(17)/11 Simplify -5 + (1sqrt(133)-5)/(sqrt(7) - (sqrt(7) - (sqrt(343) + -2sqrt(343)))). -5 + 5sqrt(19)/7 Simplify sqrt(343) + (sqrt(343) + 0)-2 + (sqrt(343) - (sqrt(343) + 1 + sqrt(343)-2 + sqrt(343)) - sqrt(343) - sqrt(343)). -14sqrt(7) - 1 Simplify -5((1(sqrt(432) + 3 - sqrt(432))1)2 + -5). -20 Simplify 1 + sqrt(57)/sqrt(3) + (sqrt(19) + (sqrt(19) - (-1 + sqrt(684))2) - sqrt(19)) - sqrt(76)-5-1. -684 + 4sqrt(19) Simplify (sqrt(224)1 + sqrt(56))/(-5sqrt(32)/sqrt(4))34. -36sqrt(7)/5 Simplify (1(6(sqrt(187)1 + sqrt(187)))/(3sqrt(704))-6)2. 153 Simplify (sqrt(8))2 + 2 + 0 - ((-4 + sqrt(18))2 + -3). -21 + 24sqrt(2) Simplify ((sqrt(170) + sqrt(170) + 1sqrt(170) + sqrt(170))/sqrt(10))2 + (sqrt(612) - (sqrt(612) + -1)2) - (-4 + sqrt(1700)2-1). -337 + 38sqrt(17) Simplify -25(sqrt(13)-1)2-3 - (sqrt(637) + -1 + (sqrt(637) - (sqrt(637) + -1)) - 2(1 + sqrt(637) + sqrt(637)))2. -5347 - 84sqrt(13) Simplify -2(sqrt(1800) + sqrt(1800) + 2-1sqrt(1800) + sqrt(1800) + sqrt(1800))/(sqrt(120)/sqrt(3)5). -12sqrt(5)/5 Simplify -2sqrt(176) + 2 - (sqrt(176) + (-1sqrt(176) - sqrt(176))3 - sqrt(176)) - 15(2sqrt(539) + sqrt(11)). -59sqrt(11) + 2 Simplify -5(-1 + (sqrt(2) + 2 + sqrt(6)/sqrt(3))2 + -1(sqrt(72))*2)5. -200sqrt(2) + 1525 Simplify ((sqrt(30) + 5sqrt(120)/sqrt(4))/(-2sqrt(10)1))*2 + 5. 32 Simplify (2-1sqrt(99) + sqrt(99) - sqrt(99)-11)/(sqrt(900) + (sqrt(900) + (sqrt(900) - sqrt(900)2) + sqrt(900))-6 + sqrt(900)). 0 Simplify ((-2 + sqrt(612)-1 - ((2sqrt(136) + sqrt(136))/sqrt(8) + 5sqrt(425))) + -4)*2. 408sqrt(17) + 19688 Simplify 1((2sqrt(612))/sqrt(12)5)/(((-1sqrt(252) + sqrt(252) + sqrt(252) - sqrt(252) - sqrt(252))/sqrt(7))/sqrt(12)). -10sqrt(17) Simplify sqrt(51)/(sqrt(3) - sqrt(588)) + (2 + sqrt(1700) + -5 + sqrt(1700))2. -1561sqrt(17)/13 + 6809 Simplify ((sqrt(204)/(sqrt(24)/sqrt(2) + sqrt(12)) + sqrt(17) + 6(-1 + sqrt(17)))2 - (sqrt(119)/(sqrt(112) - sqrt(7)) - 2sqrt(2057)))-3. -11907/4 + 205sqrt(17) Simplify ((sqrt(704) + -1)3)2 + (sqrt(704) + 0 + -1)2 + 4((sqrt(704) + (sqrt(704) - sqrt(704)-2))-2)*2. -160sqrt(11) + 187274 Simplify -3 + (sqrt(176) + -1 + sqrt(176) + 2 - ((sqrt(66)2)/sqrt(2))/sqrt(3)). -2 + 6sqrt(11) Simplify (-5 + sqrt(17) + sqrt(272) + 1 + 2(sqrt(17) + -1) + sqrt(17))26. -576sqrt(17) + 6744 Simplify 4(sqrt(175) + (sqrt(175)21)*2)-1. -2800 - 20sqrt(7) Simplify ((sqrt(36)-4)/sqrt(48))*2. 12 Simplify -4 + (-1 + sqrt(1573)-3 - (5-3sqrt(104) + sqrt(104))/sqrt(8)). -19sqrt(13) - 5 Simplify 3 + sqrt(76)-4 - (sqrt(57)/sqrt(3) + -2)-3. -5sqrt(19) - 3 Simplify (5 + (sqrt(204) + sqrt(204) + (-1(sqrt(204) + sqrt(204) + (sqrt(204)2 - sqrt(204)) + sqrt(204)) - sqrt(204)) + sqrt(204))/sqrt(12))1. -2sqrt(17) + 5 Simplify -3(sqrt(3) - (sqrt(3) + -1 + 5)2)-3 + (-3sqrt(108)/sqrt(4))/(sqrt(1296)-2). -171 - 503sqrt(3)/8 Simplify (((sqrt(76) + sqrt(76) + -2sqrt(76))2)/sqrt(4) - sqrt(190)/(sqrt(10) - (sqrt(10) + 1sqrt(10))2))2. 19/9 Simplify (-16(sqrt(190)-3 - sqrt(190)))/(sqrt(30)/(sqrt(3) + sqrt(3) + (sqrt(363) - 3sqrt(363) - sqrt(363)))). -744sqrt(19) Simplify 3 + 1 + (-6(-2 + sqrt(72) - sqrt(72)) + sqrt(72))2 + (sqrt(72) - (-2 + sqrt(72) + 3 - sqrt(72))). 150sqrt(2) + 219 Simplify 4(-6(sqrt(9072)1 - sqrt(9072)) + sqrt(9072))/(sqrt(36)/(sqrt(16)1)). 96sqrt(7) Simplify ((sqrt(1053) - (-1 + sqrt(1053) + 2 + sqrt(1053))) + 2)2 + (-2sqrt(52)/sqrt(4) - (sqrt(468) + -3)). -26sqrt(13) + 1057 Simplify -3 + ((-3sqrt(77) - sqrt(77))2 - sqrt(77))/(sqrt(49)/(3sqrt(7))). -27sqrt(11) - 3 Simplify (sqrt(300)/(sqrt(60)/(sqrt(5)3)))/(6sqrt(15)/sqrt(3) - sqrt(50)/sqrt(250)). 15sqrt(5)/29 Simplify ((sqrt(475) + (sqrt(475) - (sqrt(475) + sqrt(475) + -2 + sqrt(475))-5))-1)*2-4-6. -40800sqrt(19) + 3297000 Simplify -1((sqrt(3025) - -2sqrt(3025))-1)/(sqrt(720) - ((sqrt(720)-2 - sqrt(720))6 + sqrt(720) + sqrt(720))). 11sqrt(5)/68 Simplify (sqrt(14)/sqrt(2)1 + -3(sqrt(7) + 3))2. -18 - 4sqrt(7) Simplify (((sqrt(2) - sqrt(6)/sqrt(3))-3 + sqrt(2) + sqrt(18) + -1)2 - sqrt(2048)1) + -2. -40sqrt(2) + 31 Simplify 4((3 + (sqrt(15)/sqrt(3) - sqrt(5) - sqrt(5)) + -5)2 + (sqrt(15)/sqrt(3))2 + -2 + sqrt(30)/(sqrt(6) + (sqrt(6) - sqrt(6)-2))). 17sqrt(5) + 48 Simplify (((sqrt(315) - sqrt(315)3)/sqrt(5))/(sqrt(729) + (-5sqrt(729) + sqrt(729) - sqrt(729))))*2. 7/324 Simplify (1((sqrt(833) + -2)-5 - ((0 + sqrt(833) - sqrt(833)) + -5)))2. -1050sqrt(17) + 21050 Simplify (6(sqrt(190) - (sqrt(190)1 - sqrt(190)))5)/(sqrt(60)/(2sqrt(726) - sqrt(726))) + 5. 5 + 330sqrt(19) Simplify 5(sqrt(24) + (sqrt(96)/(1sqrt(4) + sqrt(4) + sqrt(4)) - sqrt(24)))/(sqrt(24)/(sqrt(3) - sqrt(27))). -10sqrt(3)/3 Simplify (((sqrt(108) + 1)-2 - sqrt(108)) + (sqrt(108) + -1 + sqrt(108))5)*2. -588sqrt(3) + 5341 Simplify -5(2sqrt(1573) + -5) - (-3 + 5 + sqrt(1573) + 1). -121sqrt(13) + 22 Simplify (-1 + 16sqrt(175)4)*2. -240sqrt(7) + 100801 Simplify 6sqrt(240)/(sqrt(405) - (sqrt(405)-1 - sqrt(405))). 8sqrt(3)/9 Simplify 1 + ((-5sqrt(112)/sqrt(4))/(1sqrt(4)-2))*2. 179/4 Simplify ((3 + sqrt(704) + 0 - ((sqrt(704) - ((sqrt(704) - (-2sqrt(704) + sqrt(704)))3 - sqrt(704))) + sqrt(704)) - (-3 + 1 + sqrt(704))5) + 3)*2. -256sqrt(11) + 960 Simplify ((sqrt(120)/sqrt(2))/sqrt(3))*2 + sqrt(360)/sqrt(2) + sqrt(20) + (sqrt(320) - (sqrt(320)-1 + 0 - sqrt(320)) - sqrt(320)). 20 + 24sqrt(5) Simplify ((sqrt(1377)-2-5 + (sqrt(1377) - (-3 + (sqrt(1377) - (-2 + sqrt(1377) - sqrt(1377))))))-3)*2. 1620sqrt(17) + 1239309 Simplify ((-5sqrt(133)1 + 61sqrt(133))/((4sqrt(112) - sqrt(7))2))*22. 19/450 Simplify 3 + (1 + sqrt(28)/sqrt(4) - 4sqrt(252)) + 4. -23sqrt(7) + 8 Simplify ((sqrt(208) + -1(3 + sqrt(208)) - (sqrt(208) + -5 + 1sqrt(208)))34)*2. -4608sqrt(13) + 120384 Simplify (-2 + 0 + sqrt(1280))-1. -16sqrt(5) + 2 Simplify (6((4 + -1sqrt(405) - (sqrt(405) + 1)5) + (-4 + sqrt(405) + -1 - (sqrt(405) + sqrt(405) + (sqrt(405) + 1)-5))))*2. 1296sqrt(5) + 58356 Simplify (1 + 1sqrt(95)/sqrt(5) + (sqrt(19) + sqrt(684) + -1)2)43. -156sqrt(19) + 11196 Simplify (sqrt(80) + 2 - (sqrt(245) + -2 - sqrt(245)))2 + ((2 + sqrt(500) - sqrt(500)) + (sqrt(5) - (0 + sqrt(45))))2. 24sqrt(5) + 120 Simplify 4 + (((sqrt(39) + -5sqrt(39) - sqrt(39) - sqrt(39))5)/(1(sqrt(3) + 3sqrt(3))))2. 2941/4 Simplify 1(-2 + sqrt(192)2 + 1) + -5. -6 + 16sqrt(3) Simplify (-4sqrt(52)/sqrt(4))2 + 0 - (sqrt(468) + (-2sqrt(468))*2 + -4). -1660 - 6sqrt(13)
Let z = -224 - -285. Suppose 153 = 2p - k, p - 59k = -zk + 89. What is the highest common divisor of 158 and p? 79 Suppose 14330 = 27c + 13574. What is the highest common factor of c and 3794? 14 Let a(f) = f*2 + 7f - 6. Let g be 4(1 - 0) + -2. Suppose g = -u - 3, 0 = 4l - 3u + 37. Let q be a(l). Calculate the highest common factor of q and 8. 8 Suppose 57830 = 5l + 5x, -l - 6x + 11582 = -9x. What is the highest common factor of 130 and l? 130 Suppose -1818 - 4149 = -6016x + 6007x. What is the highest common factor of 481 and x? 13 Let f(j) = -j2 - 4j + 1. Let n be f(-3). Suppose -nt + 10 = -10. Let l be (225/(-45))/(0 + -1). Calculate the highest common divisor of t and l. 5 Suppose 3q = -2g + 4, -493g - 3q = -498g + 10. Let w = -4 + 6. Suppose 0 = wb + 8, -ga - 7 + 21 = -2b. Calculate the highest common factor of a and 2. 1 Let i = -10185 + 10200. Calculate the greatest common divisor of i and 1055. 5 Let x = -22421 + 22581. What is the highest common factor of x and 515? 5 Let s be 50/(-4)24/(-10). Let j(z) = z - 17. Let r = 83 - 56. Let m be j(r). What is the highest common factor of m and s? 10 Let x(p) = 11p - 33. Let a = 15 - 11. Let o be x(a). Calculate the greatest common divisor of 176 and o. 11 Let x(o) = 19o*2 - 76o + 410. Let z be x(6). What is the highest common factor of z and 2? 2 Suppose 3m - 2457 = x + 4x, -3x = 9. Let n be (120/(-90))/(1 + 226/(-222)). Calculate the highest common divisor of m and n. 74 Let d(o) = -3o*2 + 250o + 3023. Let x be d(94). Suppose 0p - 1650 = -5p. What is the greatest common factor of x and p? 15 Let k = 8989 - 8339. What is the highest common divisor of 800 and k? 50 Let p(a) = 21a2 - 72a + 71. Let i be p(1). Calculate the highest common divisor of 292 and i. 4 Let b be ((-112)/6)/(-4) - (-46)/138. Suppose bz = 6z + 5, -322 = -h + 2z. Calculate the greatest common factor of h and 24. 24 Let j be (1/10-16 + 1)/((-6)/360). Calculate the greatest common factor of j and 2286. 18 Let l(h) = h*2 - 16h - 6. Let t = -15 + 33. Let b be l(t). Let c = -17 + b. Calculate the highest common factor of c and 52. 13 Let n(b) = 2b3 + 27b*2 + 2b + 3064. Let i be n(0). What is the highest common divisor of 72 and i? 8 Suppose -9s + 25s - 67 = 61. What is the highest common divisor of s and 598? 2 Let u(o) = -4o + 19. Let g be u(7). Let l be (-542)/g + 58/(-261). Suppose l = -10v + 12v. What is the highest common divisor of v and 20? 10 Let x(k) = 244k*2 - 1056k - 5280. Let f be x(-5). What is the greatest common divisor of 80 and f? 20 Suppose 15 = s - 59. Suppose 3t - 92 = -s. Let p be (-2)/(-4)6/(-4)-8. What is the highest common divisor of t and p? 6 Let g(y) = -35y + 59. Let c be g(2). Let f(s) = s + 109. Let i be f(c). Calculate the greatest common factor of 147 and i. 49 Let o(s) = 14s2 - 3s - 11. Let n be o(3). What is the highest common divisor of 1219 and n? 53 Let a be (-246114)/(-45) - ((-57)/15 + 5). Calculate the highest common divisor of 4 and a. 4 Let s be (-15)/40 - 16999/(-8) - (-12)/(-8). What is the highest common divisor of 33 and s? 11 Suppose -3d = 5r - 722, -4r + 577 = 7d - 4d. Let p = r - 115. Calculate the highest common factor of 270 and p. 30 Suppose -8716u = -8837u + 1694000. Calculate the greatest common divisor of u and 750. 250 Suppose -2s = -a - 177, -486 = 4s + 3a - 855. What is the highest common divisor of 355 and s? 5 Suppose -8f + 47 - 287 = 0. Let d be 1884/45 - 4/f. Suppose -3s + 280 = 2s. Calculate the greatest common divisor of s and d. 14 Let x be (-3)/(-2)4/6. Suppose -96 = -5b + 4z, -5b - 7z = -8z - 84. Suppose 5s = -3l + b, 7 = s + 3l - 1. What is the highest common factor of s and x? 1 Let y = -36197 + 36254. What is the greatest common divisor of 13718 and y? 19 Suppose 24 = -g + 2g. Let r(z) = z3 + 6z*2 - 6z + 1. Let f be r(4). Suppose 3v - 115 = f. What is the greatest common divisor of g and v? 12 Suppose 0 = -40h - 5562 + 13516 + 7846. What is the greatest common factor of 360 and h? 5 Let f(c) = -45c + 1251. Let y be f(20). Let k(w) = -w + 13. Let a be k(0). What is the highest common divisor of y and a? 13 Suppose 5n - 55 = -5r, 0 = -5r + 9r - 2n - 14. Calculate the highest common divisor of 6 and r. 6 Let i(s) = -3s3 + s2 - 9s - 11. Let y be i(-1). Suppose -5m + 25 = 0, 18 - 47 = -yw - m. What is the greatest common divisor of 32 and w? 4 Let r be 40/2 - (-1233)/(-137). Suppose -3m - 242 = -4m. What is the greatest common divisor of r and m? 11 Let j be -21/24/1. Let l be (-95)/j + 14/16. What is the highest common divisor of 300 and l? 12 Let y be ((-3)/9 - -3)1089/12. What is the highest common divisor of 990 and y? 22 Suppose 0 = -n + 5, -s - 30n + 1419 = -25n. What is the highest common factor of 410 and s? 82 Let z(c) = c*2 - 6c - 5. Let a be z(-4). Let p be (-13)/((-156)/(-688))42/(-4). Suppose 7n = 50n - p. Calculate the greatest common factor of a and n. 7 Suppose 86g + 4g + 36g = 9450. What is the greatest common divisor of g and 24? 3 Let d(s) = s*2 + 6s + 5. Let l be d(-4). Let g be 360(-1 - l/((-30)/(-26))). Calculate the highest common factor of 36 and g. 36 Suppose 4m - 353 = -2f + 33, 15 = -3f. What is the greatest common factor of m and 7? 1 Let p = 27 - 24. Suppose -pv = -s - 4, 50 = 4s + 4v + 2. Suppose -4h - 120 = -2m, -sm - 2h + 360 = -3m. What is the highest common factor of 14 and m? 14 Let z be 40/678/65. Suppose -5b + zb - 79 = l, 5l = 3b - 83. Let w be 0 - -183 - (1 - 0). Calculate the highest common factor of w and b. 26 Suppose 0 = 4p + 3 - 19. Suppose ps = 55 - 15. Suppose j + 3a - 22 = 0, 0 = j - a - 0a - s. What is the greatest common divisor of 117 and j? 13 Let a(v) = -4v*2 + 346v - 255. Let p be a(74). What is the highest common divisor of p and 260? 65 Let g be 2 + ((-102)/(-68) - 11/(-2)). What is the greatest common divisor of 177 and g? 3 Let t(x) = -x*2 + 84x - 103. Let h be t(8). Calculate the highest common divisor of 909 and h. 101 Suppose -1918 = -2b - 5n, 21b - 958 = 20b - 2n. Calculate the highest common divisor of b and 324. 18 Let w(r) = r3 + r2 + 105. Let z be w(0). Suppose 10410 = -5919n + 6266n. What is the greatest common factor of n and z? 15 Let n(o) be the second derivative of -o4/6 + 11o*3/2 + 34o. Let s be n(15). Suppose 2c = 7c - s. Calculate the greatest common divisor of 63 and c. 9 Suppose -m + 5x + 329 = 0, -26x + 28x + 987 = 3m. Calculate the greatest common divisor of 1363 and m. 47 Let f be -1(-3)/((-6)/(-88)). Let m = 353 + -323. Suppose 20u = mu - 40. What is the highest common factor of f and u? 4 Let b(l) = -2l*2 + 16l - 30l - 24l - 21. Let h be b(-16). Suppose -3a = -a - 50. What is the highest common factor of a and h? 25 Suppose -6a = 126a - 117480. What is the greatest common factor of 190 and a? 10 Let j(l) = 5l*2 - l. Let v be j(-1). Suppose 2c = 3s - 56, -575s + 580s - 3c = 93. What is the highest common factor of v and s? 6 Let x = 58 - 55. Suppose xn - n = 38. Let i = n - 4. Calculate the highest common factor of 120 and i. 15 Let s = -190 + 126. Let w = s + 69. Suppose 4l = -wu + 8l + 100, 60 = 3u + 3l. What is the highest common factor of 12 and u? 4 Let r be 12(-9)/(-6)133/7. Calculate the highest common divisor of r and 304. 19 Suppose 0 = 2m - 63 + 11. Let x(n) = 4n + 42. Let s be x(-12). Let j be 374/(s/(-3)) - 5. Calculate the highest common factor of m and j. 26 Let z = 10864 + -10810. Calculate the highest common factor of 3375 and z. 27 Let x be -1(1 - -1) + -10 + 10 + 4. Calculate the highest common divisor of x and 560. 2 Suppose 10h = 5h + 15. Suppose -3q + 87 = c, 0c + hc = 3q + 321. What is the highest common factor of c and 1326? 102 Let w be (342/99)/(-19) + 0 + (-36942)/(-22). Calculate the greatest common factor of w and 69. 23 Let u(b) = 125 + 4b2 - b2 - 128 + 4b. Let h be u(2). Suppose 5g = -a + 7, h = 2a - 3g + 3. Calculate the highest common factor of a and 28. 7 Suppose 2c + 37h - 2620 = 40h, 5h - 1336 = -c. What is the highest common divisor of c and 56? 28 Let h(q) = -q2 + 12q + 12. Let w be h(12). Let s = 84 + 219. Suppose 3u - s - 21 = 0. What is the greatest common factor of w and u? 12 Suppose 130 = 7843i - 7817i. Suppose -3h = h. Let c = h - -5. Calculate the greatest common factor of i and c. 5
What is 3581648 to the power of 1/3, to the nearest integer? 153 What is 10236004 to the power of 1/4, to the nearest integer? 57 What is the square root of 720764 to the nearest integer? 849 What is the fourth root of 333022 to the nearest integer? 24 What is 2828377 to the power of 1/3, to the nearest integer? 141 What is 1396086 to the power of 1/3, to the nearest integer? 112 What is 247159 to the power of 1/10, to the nearest integer? 3 What is 296513 to the power of 1/3, to the nearest integer? 67 What is 1912991 to the power of 1/8, to the nearest integer? 6 What is 51516 to the power of 1/5, to the nearest integer? 9 What is 1154965 to the power of 1/3, to the nearest integer? 105 What is the third root of 187395 to the nearest integer? 57 What is the fourth root of 1556247 to the nearest integer? 35 What is 16137924 to the power of 1/3, to the nearest integer? 253 What is 7038890 to the power of 1/3, to the nearest integer? 192 What is 228836 to the power of 1/10, to the nearest integer? 3 What is the square root of 17889401 to the nearest integer? 4230 What is the cube root of 878950 to the nearest integer? 96 What is the fourth root of 8952965 to the nearest integer? 55 What is 618651 to the power of 1/3, to the nearest integer? 85 What is the square root of 199742 to the nearest integer? 447 What is 5108093 to the power of 1/2, to the nearest integer? 2260 What is the third root of 2128581 to the nearest integer? 129 What is 2151773 to the power of 1/9, to the nearest integer? 5 What is 2131943 to the power of 1/9, to the nearest integer? 5 What is the square root of 630868 to the nearest integer? 794 What is the seventh root of 9271154 to the nearest integer? 10 What is 2159907 to the power of 1/10, to the nearest integer? 4 What is the third root of 255521 to the nearest integer? 63 What is 266038 to the power of 1/3, to the nearest integer? 64 What is 8531922 to the power of 1/7, to the nearest integer? 10 What is the square root of 627566 to the nearest integer? 792 What is 2080332 to the power of 1/2, to the nearest integer? 1442 What is the third root of 539281 to the nearest integer? 81 What is 1788533 to the power of 1/2, to the nearest integer? 1337 What is the cube root of 6954737 to the nearest integer? 191 What is the square root of 98831 to the nearest integer? 314 What is the eighth root of 30098206 to the nearest integer? 9 What is 181626 to the power of 1/7, to the nearest integer? 6 What is the square root of 349875 to the nearest integer? 592 What is 157760 to the power of 1/8, to the nearest integer? 4 What is 80201 to the power of 1/10, to the nearest integer? 3 What is the square root of 1207873 to the nearest integer? 1099 What is 5506804 to the power of 1/3, to the nearest integer? 177 What is 329491 to the power of 1/9, to the nearest integer? 4 What is the eighth root of 5364695 to the nearest integer? 7 What is 1079285 to the power of 1/7, to the nearest integer? 7 What is 244142 to the power of 1/10, to the nearest integer? 3 What is 12000717 to the power of 1/2, to the nearest integer? 3464 What is the third root of 17970477 to the nearest integer? 262 What is the sixth root of 89008 to the nearest integer? 7 What is 722404 to the power of 1/10, to the nearest integer? 4 What is the fifth root of 500567 to the nearest integer? 14 What is the third root of 14216074 to the nearest integer? 242 What is the cube root of 362218 to the nearest integer? 71 What is the square root of 76452 to the nearest integer? 276 What is 827029 to the power of 1/2, to the nearest integer? 909 What is the fourth root of 63941 to the nearest integer? 16 What is the cube root of 1253838 to the nearest integer? 108 What is the cube root of 252041 to the nearest integer? 63 What is the sixth root of 9070456 to the nearest integer? 14 What is 1477842 to the power of 1/3, to the nearest integer? 114 What is the square root of 2151457 to the nearest integer? 1467 What is 6890722 to the power of 1/2, to the nearest integer? 2625 What is the fifth root of 108112 to the nearest integer? 10 What is the cube root of 9416320 to the nearest integer? 211 What is the cube root of 1070323 to the nearest integer? 102 What is 482064 to the power of 1/5, to the nearest integer? 14 What is 47466 to the power of 1/7, to the nearest integer? 5 What is the sixth root of 12224497 to the nearest integer? 15 What is 235642 to the power of 1/7, to the nearest integer? 6 What is 19299164 to the power of 1/3, to the nearest integer? 268 What is 105787 to the power of 1/8, to the nearest integer? 4 What is the fifth root of 197125 to the nearest integer? 11 What is 951895 to the power of 1/5, to the nearest integer? 16 What is the square root of 271000 to the nearest integer? 521 What is 1848647 to the power of 1/3, to the nearest integer? 123 What is the eighth root of 5350000 to the nearest integer? 7 What is the eighth root of 2820405 to the nearest integer? 6 What is 1161622 to the power of 1/3, to the nearest integer? 105 What is the square root of 12534491 to the nearest integer? 3540 What is 5624948 to the power of 1/2, to the nearest integer? 2372 What is the square root of 47008 to the nearest integer? 217 What is the fourth root of 472638 to the nearest integer? 26 What is 1294252 to the power of 1/3, to the nearest integer? 109 What is the seventh root of 375184 to the nearest integer? 6 What is the square root of 411342 to the nearest integer? 641 What is 351297 to the power of 1/2, to the nearest integer? 593 What is the fourth root of 13012022 to the nearest integer? 60 What is 7360268 to the power of 1/5, to the nearest integer? 24 What is 2274850 to the power of 1/3, to the nearest integer? 132 What is the seventh root of 6550389 to the nearest integer? 9 What is 2663501 to the power of 1/5, to the nearest integer? 19 What is the square root of 394506 to the nearest integer? 628 What is the eighth root of 1761731 to the nearest integer? 6 What is 228601 to the power of 1/2, to the nearest integer? 478 What is the square root of 1274860 to the nearest integer? 1129 What is the fourth root of 22001808 to the nearest integer? 68 What is the seventh root of 599667 to the nearest integer? 7 What is the square root of 22217 to the nearest integer? 149 What is the square root of 3646980 to the nearest integer? 1910 What is 168819 to the power of 1/5, to the nearest integer? 11 What is the square root of 3560878 to the nearest integer? 1887 What is 2505340 to the power of 1/2, to the nearest integer? 1583 What is 2165763 to the power of 1/2, to the nearest integer? 1472 What is 1599689 to the power of 1/2, to the nearest integer? 1265 What is the third root of 3884321 to the nearest integer? 157 What is the square root of 10699315 to the nearest integer? 3271 What is the cube root of 16995606 to the nearest integer? 257 What is 5718013 to the power of 1/2, to the nearest integer? 2391 What is 2027270 to the power of 1/2, to the nearest integer? 1424 What is the third root of 473025 to the nearest integer? 78 What is the fourth root of 587085 to the nearest integer? 28 What is 792624 to the power of 1/4, to the nearest integer? 30 What is 3569325 to the power of 1/10, to the nearest integer? 5 What is the ninth root of 324811 to the nearest integer? 4 What is the cube root of 2866576 to the nearest integer? 142 What is the tenth root of 146100 to the nearest integer? 3 What is 13956322 to the power of 1/2, to the nearest integer? 3736 What is 4679844 to the power of 1/2, to the nearest integer? 2163 What is 261309 to the power of 1/2, to the nearest integer? 511 What is 1646708 to the power of 1/7, to the nearest integer? 8 What is 9665174 to the power of 1/3, to the nearest integer? 213 What is the ninth root of 19568888 to the nearest integer? 6 What is the fourth root of 765466 to the nearest integer? 30 What is 688640 to the power of 1/2, to the nearest integer? 830 What is the tenth root of 319271 to the nearest integer? 4 What is the third root of 4047335 to the nearest integer? 159 What is the eighth root of 4790630 to the nearest integer? 7 What is 655845 to the power of 1/2, to the nearest integer? 810 What is 1892692 to the power of 1/3, to the nearest integer? 124 What is the fifth root of 16711898 to the nearest integer? 28 What is 7189716 to the power of 1/7, to the nearest integer? 10 What is the cube root of 7624393 to the nearest integer? 197 What is the seventh root of 2660476 to the nearest integer? 8
Suppose -190s + 189s - 80 = 0. Let x be (-2)/3 + 1088/12. Let k = s + x. Solve 0 = 4n - 3h - k, 5n + 4h - 25 = 3 for n. 4 Let u be (-19)/(-38)24/(-3). Let i be (-78)/273 - u/14. Solve -5v = -5t - i - 5, 0 = -3v + 2t for v. -2 Let p = -114 + 450. Let m = p + -333. Solve 5 = -4c + mo, -2c - 3o + 9 = -2 for c. 1 Suppose -3g = -5t + 23, 5t + 3g - 27 = 5g. Solve -5h - 10 = o, 3h - 5o + t = -27 for h. -3 Let p be (2/(-3))/((-12)/(-72)) + 32. Let t = 17 - -16. Let j = t - p. Solve 2f - 3f - 12 = -jq, 4q = -5f + 27 for q. 3 Let w(k) = 2k2 - 22k - 116. Let s be w(15). Solve 5t + 11 = -sb + 2, -30 = -5b + 2t for b. 4 Let k be 668/(-9) - (-6)/27. Let i be -117(7 + -8). Let t = k + i. Solve b + 13 = -tn, 4b + n - 23 = 4n for b. 2 Let j = 2317 + -2309. Solve -r + n = 2n + 2, -3r - 5n = j for r. -1 Let r be -1 + 4 - 519/173. Solve -2m - 16 = 2p, 0m - 5m + 5p = r for m. -4 Let q = 4877 - 4852. Solve -3w = 5x - q, -w - 4w + 31 = 3x for w. 5 Suppose 2849 = -7x + 371. Let s = x - -356. Solve 0 = -2g + so - 7o + 19, -3 = -o for g. 2 Let b = -24 + 27. Suppose -o + b + 1 = 0. Let g be (-1)/(o + (-65)/16). Solve -5 = 2s + 3d, 3d + d + g = 2s for s. 2 Let i be (0/(-1))/(55902/5082). Let k be (0 - 1 - -1) + 14. Let d = k + -2. Solve 5j - w - 3 = i, -j - 3w + 3 = d for j. 0 Let p be (12/2)/(13/156). Suppose 0 - 16 = -s - 3f, -2s + 4f + p = 0. Solve 2v - 15 + 3 = -4g, 0 = -5g + 4v + s for g. 4 Let f(g) = 7g3 + 201g*2 - 56g + 62. Let a be f(-29). Solve 0 = -3i + 15, aq + 8i - 5i = 11 for q. -1 Let n(s) = -21s2 + 135s + 89. Let j be n(7). Solve -7h - 8 + j = -k, -4k - 13 = -3h for h. -1 Let g = 16 + -9. Let q be 1/((-1)/(-39) + 0). Suppose qh = 31h + 24. Solve -hm + 4a + 11 = 0, -3m + 2m + 3a = -g for m. 1 Suppose 0 = 11m - 16m + 30. Let d be ((4/m)/(-1))/((-30)/(-4545)). Let u = -85 - d. Solve 0h - 3 = -3a - 2h, -u = 4a - 4h for a. -1 Let h be (-12)/((-240)/70) + 6/12. Solve -5m - 5 = -5q, -q + h + 7 = -3m for m. -5 Let i(o) = -10o + 2. Let j be i(-4). Let b be 21/j - (-135)/(-2). Let v = 82 + b. Solve -3m + 15 = -3w, -2m + v = 3m - 3w for m. 0 Suppose f - 12 = 2i, i + 3 = 2f - 3f. Suppose -31 = -4h - 5z - 3, -fh - 12 = -4z. Solve 0 = 2g - p - h, -5g + g = -4p + 4 for g. 3 Suppose -59i - 32i + 18i = -219. Let v be ((-2)/6)/((-1)/(-3)). Let x = 3 + v. Solve j + j - 2z + 8 = 0, xj + 3 = -iz for j. -3 Let h = -25 - -29. Suppose -ha = 4, -a + 57 = 3d + 2a. Suppose df - 24f = -20. Solve fy = -3q, -5 = 5y - q + 5q for y. 3 Suppose 4v = -5a + 38, a + 71v - 73v = 2. Solve -5t + 22 = 2d, 3t = -ad + d + 17 for t. 4 Suppose 4s + 14 = t, 3s + 127 - 118 = 0. Solve 0 = -2j + t, 3k - 5 = 6j - 5j for k. 2 Suppose 3w - 18 = 5k, 0w = 3w + k - 36. Suppose 5x - w = 2x + d, -3x + 2d = -13. Solve 0 = 3m - 0o - xo + 3, -5m + 2o - 2 = 0 for m. 0 Let s = 3149 - 3147. Solve 11h = 12h - 3o - 10, -sh + 2 = 3o for h. 4 Let c = -5021 - -5024. Solve 2y - q + c = 4y, -y + 4q = 12 for y. 0 Let b be (-8)/3((-8)/(-28) + (-250)/140). Solve -m - 4n + 21 = 0, 24n - 25n = -bm + 16 for m. 5 Let u = 209 - 212. Let a be (u - -1)(-5)/2. Let x be (0/1)/(0 - -1). Solve -4w - 3l = 17, 4w + al - 3l + 18 = x for w. -5 Let k be ((-375)/20)/((-12)/128). Let x = k - 172. Solve -v + 5h = -0v - x, -h = 5 for v. 3 Let g = -71 - -92. Suppose -13 = 2b - g. Suppose 5p + 4z - 19 = 0, 3p + bz - 6z = 29. Solve -4t - 4u + 2 = -2, 2u = -5t - p for t. -3 Let f = 28 + 228. Let h = f - 254. Solve -6q + hq + 2g = 0, 0 = q - g for q. 0 Suppose -2t = -y + 8, 4t - 34 = -2y - 42. Solve y = 2z, -3j + 8 = 3z - 7 for j. 4 Let j = -6747 + 6765. Solve -q - j - 2 = -3i, 0 = -3q + 5i - 40 for q. -5 Let g(k) = 152k - 10. Let u be g(-1). Let d = -159 - u. Let z be -6 + 4 + (1 - -3). Solve -3m + 5m + zn = 10, 3m - dn + 9 = 0 for m. 1 Let i be 53/5 - 0 - (-6)/15. Suppose 8q = 117 + i. Let l be (0 - 2)/(-4) + (-8)/q. Solve -2r + l - 5 = -5d, 0 = 2r + 2d - 16 for r. 5 Let n be 23/46(1 + -57)-1. Solve -4v - 9o + 4o + 36 = 0, 4o = -3v + n for v. 4 Let r(g) = g2 + 5g - 5. Let p be (-7)/(((-1)/1)/(-1)). Let v be r(p). Let x be v/220/15. Solve 4 = -xw + 2w - 2c, w = -3c - 6 for w. 0 Suppose -5y + s + 25 = 0, -3s + 790 = 3y + 757. Solve 3c + 24 = 3k, -4k = 3c + 23 - y for c. -7 Suppose 5o + 569 = 599. Solve oc - 15 = m + 3c, -19 = 5m - c for m. -3 Suppose 0 = 864h - 853h - 132. Solve -7 = -k + z, 0 = hk - 15k - 3z - 9 for k. 2 Let j = 2915 - 2844. Solve 3s + 23 = -4t, -3t + 5s + j - 81 = 0 for t. -5 Let c(f) = 177f - 849. Let q be c(5). Solve -h = -3x - 41 + q, 2h + x + 4 = 0 for h. -1 Suppose -37a - 470 = -38a. Let x = 473 - a. Solve 3h - 4f = 24, 2h - 3f - 29 = -xh for h. 4 Let c(r) = -13r*2 - 63r + 12. Let s be c(-5). Solve -3b + 2 = 17, 4q - sb = 14 for q. 1 Let i(m) = 2m - 4. Let p be i(2). Suppose p = 13d - 14d + 4. Suppose -4n = -w - 1 + 2, dn = -2w + 14. Solve b + n = 2y, 0 - 1 = -y for b. 1 Let v be 3399/30 - 9/30. Suppose 24x = 415 + v. Solve -5m + x + 1 = -3k, -2k + 2m = 10 for k. -1 Let g = 625 + -622. Suppose 7z = 2z - 4s + 13, -gz - s = -12. Solve 3w = -4r - 13, -13 = 5w - zr + 3r for w. -3 Suppose -19b + 124 - 48 = 0. Solve 5o - bn + 26 = 7o, -2o + 5n = 19 for o. 3 Let i = -5981 - -5983. Solve -57h + 56h = 5d + i, -3h + 3d = 6 for h. -2 Let a = 61 + -46. Let d be (-4)/(-2) + -7 + (2 - -3). Solve -a = 3v, d = -2t - t + 3v + 3 for t. -4 Let l(b) = -b*2 + 5b + 14. Let m = -311 - -309. Let q be l(m). Solve -2y = d - qy, -2d = y for d. 0 Let k(j) be the third derivative of 19j4/24 + j3/2 + 37j2. Let c be k(0). Suppose 0 = -3b + 2 + 13. Solve -ca - 15 = 3w, -25 + 4 = ba + w for a. -4 Let z = 27377 + -27370. Solve 48 = -2d - 4c + 56, -3d = c - z for d. 2 Let l(x) = -3x - 25. Let s be l(-9). Let n = -269 + 274. Solve -5o + ny = sy + 16, -2y - 21 = 3o for o. -5 Suppose -382t = -381t - 342. Let a = t - 341. Solve 0 = -2f - p + a, -2f - 5 = 3f - 5p for f. 0 Suppose y + 5m + 85 = 6y, -2m = -4y + 62. Let x = y - 12. Let b be 2/x + 0 + 3. Solve 3d - 16 = 2o, -d + 3o + 13 = -b for d. 2 Suppose -2s - 72 = 4c, -3c = 2s - 21 + 98. Let p = -94 - -45. Let a = s - p. Solve 3l = 4l - 2w - 7, l + 2w = a for l. 5 Let m be ((-100)/6)/(-6 - -2) + 169/(-1014). Solve 0 = 4w - c - 3, 8w = mw + 4c for w. 1 Let s be 1/(1/(-12)2). Let l be (3 + -2)(-42)/s. Suppose -2q - l = -15. Solve -3 - 3 = 2f - 4b, -qf - 12 = -3b for f. -3 Suppose 0 = 2b + 2z + 1 - 7, -b = 8z + 11. Solve -3f = 3v - 6, -bv = 6f - 2f - 8 for f. 2 Let q = -753 + 771. Solve 0 = -21x + qx + 2y - 14, y - 4 = 0 for x. -2 Let v(q) = 5q*3 - 96q*2 - 81q + 24. Let m be v(20). Solve 0g - f = mg - 1, 3f - 15 = 0 for g. -1 Suppose -59f + 16055 = 36f. Suppose -y = -4y + 75. Suppose -3q = y - f. Solve -4m + 26 = -5j, 4j = 5m - q + 20 for j. -2 Suppose -57 = -3m - 4b, -44m - 19 = -43m - 5b. Let y = -3 - -6. Let u = -3 - -7. Solve 5l - yo - 15 = -2, m = -l + uo for l. 5 Suppose 0 = -2j - 8, 4y - 4j + 1912 = 1940. Solve yx = -4f + 8, 3x + 0 + 6 = 3f for f. 2 Suppose -4u + 7u = -3m + 9, 5u + 1 = 3m. Solve 6r = b + mr - 1, -2r + 17 = 3b for b. 5 Let o = 34 - 17. Let i(d) = -2 + d + o + 14 + 4. Let h be i(-17). Solve -r = a + 2r + h, -4a - 36 = 5r for a. -4 Suppose 3u + n - 12 = -1, 4n - 8 = 0. Solve 5c + u = 2o - 5, 0 = 4o - 4c - 16 for o. 4 Suppose -10 = -m - 5v + 8, 0 = 5m - 2v - 171. Let f(t) = -9t + 2. Let n be f(-3). Let w = m - n. Solve -2r = c + 3, -wc - 2 = -4r - 14 for c. 1 Let l = 667 - 662. Solve -la + 4o + 13 = -7, -4a + 2o = -16 for a. 4 Suppose 11 = g + 9. Suppose 30 = 14m + 2. Suppose 2 = -t + mk + 5, t - 3k - 3 = 0. Solve -8 = tw - 5n - 1, -2n + g = -w for w. -4 Let t(k) = -2k*2 - 33k - 106. Let p be t(-11). Solve 3w + 7 = -g, pw - 11w = -g - 8 for w. -1 Let o(i) = 3i*2 + 49i - 1502. Let n be o(-32). Solve 3h - 26c + 25c = n, 3h - 2c + 2 = 0 for h. 2 Let z(m) = -m - 2. Let j(p) = 7p - 13. Let i(r) = j(r) + 2z(r). Let g = -8 - -12. Let y be i(g). Solve 0 = -3s - t + 6, -ys - 2t - 2t + 15 = 0 for s. 1 Suppose 3d - 1195 = -5j, 3d - 6j + 2j = 1150. Suppose -392k = -dk. Solve 0 = 3g - ki - i - 8, 3i = -4g - 11 for g. 1
Let b(z) = z*3 - 19z*2 + 20z - 39. Let x be b(18). Is -1 at most as big as x? False Let y = -63/2 + 145/4. Which is smaller: y or 5? y Let j = 8 + -14. Let d(m) = m*3 + 5m*2 - 6m + 2. Let n be d(j). Suppose -g - ng - 24 = 3f, 0 = g - 1. Is -9 < f? False Let l = -16.1 - -16. Which is smaller: 3.6 or l? l Let f be (-4 + -1)(-6)/5. Suppose -7n + 12n = 5u - 20, 0 = 3u + 3n. Suppose 0 = ul - 5l + f. Which is smaller: l or 3/4? 3/4 Let m = -8 - -6. Let v = 3 + m. Let k be (-66)/90 - (-1)/3. Is k equal to v? False Let h be (-3)/(-4)(-278)/645. Let b = h - -1/43. Which is greater: 0 or b? 0 Let q = 95/632 + -2/79. Suppose 3v = 7v - 8. Let d be (-3)/2v/(-3). Is q >= d? False Let i = -3856/13 - -297. Which is greater: -1 or i? i Suppose -3d = 3c - 24, 2d - c = -5c + 8. Suppose -2j + d = j. Which is smaller: j or 1? 1 Let x(c) = 4c - 4. Let a(w) = -11w + 12. Let u(n) = 3a(n) + 8x(n). Let b be u(6). Suppose -t + 6t = 4r + 18, 4t = 8. Is b bigger than r? False Suppose f = -5d - 22, d = 3f - d - 19. Let z = 0 + 6. Let y = 9 - z. Is f <= y? True Let c = -15 - 3. Is c not equal to -18? False Let f = 4 + 0. Suppose x = -x + 8. Are x and f equal? True Let t = -201/8 - -25. Is t less than 0? True Let r(l) = l*3 - 4l*2 - 5l - 2. Let i(h) = -h*2 - 5h + 1. Let x be i(-4). Let p be r(x). Let o be (1 - p/(-6))3. Do o and 0.1 have different values? True Let i = 63 + -64. Are i and -1/18 nonequal? True Let r = -70 + 71. Which is greater: r or -1/103? r Suppose -4s = 3m - 15, -m - 4m = -4s + 7. Let o be (-13)/1 - (2 - s). Let v be (-3)/o - (-13)/(-4). Which is smaller: -2 or v? v Let w = 62 + -102. Is -2 at most w? False Let d = 1306/7 - 187. Which is bigger: -1 or d? d Suppose 4y + y + 283 = -3k, -3k = -12. Which is smaller: y or -58? y Let u(i) = i*2 - 8i + 6. Let y be u(6). Let x be 0/(-1) - (-1)/y. Suppose 3m + 2 = m. Is m bigger than x? False Let y = 25 - 0. Let g = y - 25. Which is smaller: -0.9 or g? -0.9 Let x = 8 - 14. Which is smaller: -5 or x? x Let k = -0.04 + -0.06. Do -24 and k have the same value? False Let f be (2(1 - 2))/(-2). Let n = f - 0. Let q = -76/423 + -2/47. Is n smaller than q? False Let c be (-2 - -2) + 1 - -2. Let h = 2 - c. Suppose 0 = 5p - 5t + 20, p - 6 = -p - 5t. Which is smaller: p or h? p Suppose -1 - 1 = -2g. Let h = 25 - 15. Let r be h/(-7)(-4)/10. Is r bigger than g? False Suppose 0 = 2t - t + 5. Let l be (-10)/225(t - 0). Which is smaller: l or 2/5? l Suppose -4w + 2 = -2w. Which is bigger: 1/25 or w? w Suppose 6 = -2m - 3p - 5, 0 = 3m - 3p + 24. Which is bigger: m or -1/3? -1/3 Let r = 2/845 + -5092/9295. Which is greater: -1 or r? r Let p = 0.3 + -1.3. Let z be (-12/(-12))/(16/144). Is z > p? True Let j = 9 - 7. Let n(a) = a - 4. Let i be n(j). Which is smaller: i or -1? i Let l = -142/13395 + 1/285. Is 1 >= l? True Let y = 2.04 + -2. Let z = 28 + -28.1. Which is greater: z or y? y Suppose 3n = -v - 4 - 5, -2v - 13 = 5n. Is 4 less than or equal to v? True Let o(k) = -k - 7. Let r be o(-7). Suppose -5s - d + 14 = 0, 2s - 8 = 2d - rd. Let c be (-2 - -4)/(2/s). Which is smaller: 1 or c? 1 Suppose 1 = 3a - 2. Let j = 170/217 + -11/31. Is j smaller than a? True Let m = 82 + -41. Which is greater: m or -2/7? m Let d be 3 + 0 + (-6)/((-6)/(-2)). Let z be 2/52 + 1/(-2). Which is greater: d or z? d Let f(g) be the second derivative of -g5/20 - g4/4 + g*2/2 + 4g. Let s be f(-3). Let c be (-12)/(-18) - (1 - 1). Do c and s have the same value? False Let s(v) = v*3 - 11v*2 + 25v + 1. Let h be s(8). Which is greater: h or 12? 12 Let p(i) = i - 1. Let m be p(8). Let n = -1 - -6. Suppose 10v = nv + 40. Which is bigger: m or v? v Suppose 2y = 4y. Suppose -5k + 4 = -k. Suppose -k = -5a + 4. Which is greater: a or y? a Suppose 13 = -5a - 7. Which is smaller: 2 or a? a Suppose 3v + 3a = v + 12, 2v = -4a + 8. Which is greater: v or 11? v Let p = 14 - 19. Let c(k) = -k + 7. Let y be c(5). Let s be (4/6)/(y/(-12)). Which is greater: s or p? s Let n = 148 - 150. Let z(m) = -m3 + m2 + 3. Let q be z(0). Suppose -l = -c + l, ql = -3c + 9. Which is smaller: n or c? n Let f be ((-56)/21)/((-5)/3). Let s = -2 + f. Which is bigger: 0 or s? 0 Let u = -0.4 + 2.4. Let j = u - 6. Suppose 4m = 10m. Which is smaller: j or m? j Let k = 0.28 - -0.72. Which is bigger: -74 or k? k Let s = 169/4 + -42. Is s at most as big as 1? True Let z = 2.66 + -2.8. Let j = -1.56 + z. Which is bigger: j or -1? -1 Let q = -394 + 1142/3. Which is bigger: q or -13? -13 Let p be 279/6 + (18/4 - 4). Is p not equal to 47? False Let p = 47 - 52. Which is smaller: p or -0.9? p Let c be (-1 + 17/15)/(-1). Let d = -0.22 - 0.08. Which is greater: d or c? c Let n = -0.3 - -0.4. Let c be (26 + -2)/3 + 2. Which is bigger: n or c? c Suppose 2t - 7t - 20 = 0. Is t at least -4? True Suppose -68x + 61x + 119 = 0. Is x smaller than 35/2? True Let l(h) be the second derivative of -h5/20 + 5h*4/12 + 7h*3/6 - 3h2 + h. Let y be l(6). Which is smaller: -0.04 or y? -0.04 Let w = -7 + 17. Do w and 9 have the same value? False Let b = 294.99 - 293. Let u = -0.01 - b. Is 2 equal to u? False Let x be 2/(-3) - (-2)/3. Let w(q) = -q2 + q - 2. Let b be w(x). Let y be -2 + 3 + b/2. Is 1 less than or equal to y? False Let i(n) = -n*3 + 9n*2 - 9n + 10. Let h be i(8). Is 1/2 less than or equal to h? True Let z = -4 + 4.3. Let y = z - 0.1. Let l = -177 - -1237/7. Which is smaller: l or y? l Let a = 763/85 + -9. Which is greater: -1 or a? a Let l = 6 + -1. Let o = -1.81 - 0.19. Do o and l have different values? True Let f = -5.8 + 9.8. Let k = 0.9 + 0.1. Which is greater: k or f? f Let v = -3 - -15. Let d be (6/v)/(2/(-20)). Which is greater: d or 0? 0 Let l = -197/18 + 4/9. Let s = l - -5. Which is smaller: s or -7? -7 Suppose 3z + 0 = 3. Let r be 0/(0 + z + 0). Let a = -13 - -14. Is a > r? True Let u = -10 + 92/9. Which is bigger: -1 or u? u Let z = 135/7 - 19. Is 0 equal to z? False Let j = 1 - -27. Do j and 27 have the same value? False Let o = -24 + 10. Let m = o + 13.4. Is m greater than 0? False Let j be (-2 + 2)/((-3)/(4 - 7)). Which is bigger: j or 1/3? 1/3 Let h = 167/406 + 1/58. Is -0.2 smaller than h? True Suppose -3q - 5y = -23, -4q - y + 3 + 5 = 0. Let a be 3/((-2)/q - -3). Let i be 2/a + 20/(-12). Which is greater: i or -2/17? -2/17 Let l be (-96)/(-110) - (-24)/(-40). Which is bigger: l or 1? 1 Let v = 16 + -14. Let u = 0.02 - 3.02. Let c = u + v. Is 0.1 at least c? True Let q(i) = i*3 + 3i*2 + i + 4. Let r be q(-3). Suppose -5g = -6 - 24. Let z be -1 + g/2 + -1. Is r at least z? True Let s = -0.38 + 0.18. Do s and -1/4 have the same value? False Let c be (10/1)/1. Suppose cw = -2w. Are w and 1/6 nonequal? True Let c be (3/(-6))/(2/20). Suppose 0y = -y + 1. Let x be y/(-1) + (-12)/4. Which is greater: c or x? x Let i = -4/21 + 6/7. Suppose -g - g + 4 = 0. Which is bigger: g or i? g Let h = 226/275 - 16/25. Let f = 0 - 0. Which is bigger: h or f? h Let u = 16.91 + -17. Let o = 1 + -1.09. Let d = o - u. Which is smaller: 1/6 or d? d Let j(i) = i + 12. Let f be j(0). Suppose -5u - f = -2u. Let v(l) = l*2 + 5l + 2. Let k be v(u). Is -2 >= k? True Let c = -8.1 - -8.1. Which is bigger: -3/10 or c? c Let z be -3 - (9620/696)/(-5). Let n = z + 1/6. Is n at most as big as 1? True Let u be ((-1)/(-2))/(1/(-8)). Let c be 4 + ((-56)/4)/2. Are u and c equal? False Let w = 57 + -39. Let a = -0.11 - -0.21. Which is bigger: w or a? w Let x(s) = -s + 3. Let l be x(3). Let b = -44 - -45. Which is bigger: l or b? b Let b = 7 - 5. Let m = -33 - -34. Is b at least m? True Let t be ((-6)/(-12))/((-1)/6). Which is greater: t or -2? -2 Let b(s) = -8s + 1. Let x be (4/3)/((-10)/(-15)). Let f be b(x). Let i be -1(f/21 - -1). Which is smaller: 1 or i? i Let n be 2 + -102/12. Suppose -7 = -3t + 14. Let o be -2(-3)/(t + -1). Which is smaller: o or n? n Let o(f) = -f2 - 7f - 4. Let d be o(-6). Suppose -g + 4b = 17, -5g = -b - db. Suppose -gp + 5 = -1. Is p greater than or equal to 3/5? True Suppose 0r - 4 = -r. Let j(o) = o2 + 2o - 6. Let i be j(-5). Suppose -1 = -rh - i. Which is smaller: h or 0? h Suppose 5o + 7 - 17 = 0. Suppose oc = -4l - 12, 5c - 15 = 6l - l. Which is greater: l or -2? -2 Let w be 10/25 + (-27)/5. Is -11 at most as big as w? True Suppose 9 = -s - 2s, -m + 5s = -26. Is m less than or equal to 11? True Let a be (1/(-5))/((-2)/1). Suppose 0 = -3o - 3o - 12. Let h = -3 - o. Is a <= h? False
Let y = 2 - 0. Let q(j) = j*2 + 16 - 2j - 6 - 10. Let d(l) = -2l2 + 5l - 1. Determine yd(i) + 5q(i). i*2 - 2 Let v(d) = -3d3 - d2 + d. Let a(i) = i*2 - i. Let x(t) = 3a(t) - v(t). Let j(z) = 15z3 + 21z*2 - 21z. Give 4j(o) - 21x(o). -3o3 Let o(i) = 9i + 9. Let f(k) = -k - 1. Let s(c) = -c - 1. Let p(v) = 6f(v) - 4s(v). Let j(b) = 2b - 2. Let x be j(-2). What is xo(w) - 26p(w)? -2w - 2 Let p(c) = 3c + 2. Let y(k) = 6k - 5k - 9 + 24 + 20k. Determine 15p(b) - 2y(b). 3b Let u(j) = 2j - 2 + 2 + 2. Suppose 2b - 5 = 3m, -1 + 19 = -3b - 4m. Let x(w) = -w*2 + 5w + 5. What is bx(v) + 5u(v)? 2v2 Let m(r) be the third derivative of r4/12 + r3 - 5r*2. Let p(g) = -2g - 5. Give -4m(h) - 5p(h). 2h + 1 Suppose -3j + 6 = -6j. Let k(a) = a3 + 1. Let g(b) = -b2 + 5b - 1. Let f be g(4). Let s(o) = 65 + 4of - 5o*3 - 67. Calculate jk(m) - s(m). -m3 Let k(r) = -r2 + r + 1. Let s(c) = -5c2 + 5c + 8. Give 6k(j) - s(j). -j2 + j - 2 Let n(g) = -g2 + g + 1. Let l(p) = -100p*3 - 7p*2 + 6p + 6. What is -l(o) + 6n(o)? 100o3 + o2 Let n(p) = -p3 + p2 + p + 1. Let l(r) = 6r3 - 5r*2 - 6r - 5. Let b = -2 - -1. Suppose -z + 16 = -3i, 0z - 4z + 4 = 0. Calculate bl(j) + in(j). -j3 + j Let l(x) = 5x*2 + 3x - 3. Let m(d) = -5d2 - 2d + 2. Calculate -2l(f) - 3m(f). 5f2 Let d(m) be the second derivative of -m3/6 - m2/2 - 26m. Let r(t) = -t*2 + 3t + 4. Let a = -1 + 0. Give ar(o) - 4d(o). o*2 + o Let a(o) = 6o + 3. Let i = -3 - -5. Suppose -iy + 26 = 3m + 4, 0 = -4m + 16. Let r(b) = 11b + 5. Give ya(n) - 3r(n). -3n Let z(c) = 2c*3 + 35c*2 + 4c. Let g(j) = 4j3 + 71j*2 + 9j. What is -4g(w) + 9z(w)? 2w3 + 31w2 Let j(z) = -z3 + 2z2 + 5z + 2. Let i(v) = -v*2 - 2v - 1. Determine 5i(k) + 2j(k). -2k3 - k2 - 1 Let s(o) = 5o + 4. Let g be (62/155)/(4/(-10)). Let v = 11 - 15. Let i(x) = -x - 1. Determine gs(j) + vi(j). -j Let l(q) = -q*3 + q. Let g(o) = 15o*3 - 18o. Suppose 4n + 17 + 55 = 0. Suppose 2c + 5w + 14 = 2w, 16 = -4w. Give cg(u) + nl(u). 3u3 Let f(k) be the third derivative of k4/4 - 5k3/6 + 3k*2. Let h(t) = t + 11. Let n be h(-5). Let w(p) = -5p + 4. Calculate nf(u) + 7w(u). u - 2 Let w(j) = -j. Let x(a) = -21a2 - 5a - 1. Give 6w(d) - x(d). 21d2 - d + 1 Let b(m) be the second derivative of -m5/5 + m*4/12 - 5m*3/6 + 7m*2/2 + 2m. Let p(a) = -5a3 + a2 - 6a + 8. What is 6b(z) - 5p(z)? z3 + z2 + 2 Let m(y) = y - 6. Suppose -5o + 3 + 7 = 0. Suppose 3i = oi - 5. Let t(f) = 1. Determine it(r) - m(r). -r + 1 Let x(i) = -i - 1. Let t(l) = 2l + 1. Give t(q) + 3x(q). -q - 2 Suppose 157 = -8k - 83. Let z(v) = -v2 + v + 1. Let w(a) = -24a*2 + 30a + 30. Determine kz(x) + w(x). 6x*2 Let b(i) = i + 1. Let p(w) = 3w*2 + 2w + 2. Let j(q) = q*2 - 13q - 15. Let u be j(14). What is up(l) + 2b(l)? -3l2 Let w(n) = 6n*2 - n + 6. Let p(t) = 2t*2 + 2. Give -7p(z) + 2w(z). -2z*2 - 2z - 2 Let n be (6/(-1))/(1 + 0). Let t(m) = -2m + 15. Let c(j) = -j + 8. Give nt(i) + 11c(i). i - 2 Let x(j) = j. Let k(c) = -4c + 16. Give k(z) + 6x(z). 2z + 16 Let o = -27 + 43. Suppose -4u - o = -0u. Let j(t) = -4t2 + 9t - 4. Let n(z) = -2z2 + 4z - 2. Calculate uj(l) + 9n(l). -2l2 - 2 Let h(y) = 3y. Let q(o) be the first derivative of -o*2 - 12. Determine -3h(w) - 4q(w). -w Suppose 2v - 8 = -2v + 3d, 4v - 8 = -2d. Let j(c) = -4 - 5cv + 0c*2 + 7c - 3. Let i(o) = 2o2 - 3o + 3. Calculate -7i(l) - 3j(l). l2 Let h(o) = o2 - 7o + 2. Let p be ((-3)/(-2))/((-9)/(-24)). Let u(a) = -1 + 4 - 3a + p - 6. Calculate -2h(n) + 5u(n). -2n2 - n + 1 Let g(o) = 14o*3 - 8o + 8. Let l be -1(4 - 4 - 3). Let i(c) = 5c*3 - 3c + 3. Give lg(p) - 8i(p). 2p3 Let g(z) = 7z*2 + 5z - 9. Let h(y) = -2y - 20. Let x be h(-10). Let r(i) = -i + xi - 3 + 4i + 4i*2 - 2. What is 3g(o) - 5r(o)? o2 - 2 Let v(w) = -2w - 3. Let i be v(-2). Let s(q) be the third derivative of 0q + 0 - 1/24q*4 + 8q*2 - 1/6q*3. Let t(u) = 5u + 5. Calculate it(f) + 4s(f). f + 1 Let o(u) = u3 + u2 - u. Let t(j) = 5j3 + 5j*2 - 4j + 2. Determine -4o(v) + t(v). v3 + v2 + 2 Let d(l) be the second derivative of -1/12l*4 - 1/3l*3 - 4l - l2 + 0. Let k(w) = -w2 - w - 1. Give 3d(h) - 4k(h). h*2 - 2h - 2 Let g(o) = -o - 3. Let i(j) = 17 + 20 + 18 - 56. Calculate -g(n) + 2i(n). n + 1 Let q(g) = -5g + 8. Let b(v) be the third derivative of -7v4/12 + 23v*3/6 + 13v*2. Calculate -6b(h) + 17q(h). -h - 2 Let f(r) = 4r*3 + 3r*2 - 4r - 3. Let u(o) = -3o3 - 2o*2 + 3o + 2. Suppose -8d = -9d - 2. Give df(x) - 3u(x). x*3 - x Suppose -14u - 8 = -12u. Let l(w) = -w3 - 5w*2 - 5. Let p(i) = -4i*2 - 4. Give ul(r) + 5p(r). 4r*3 Let y(a) = 2a - 4 + 2a + a. Let o(q) = 9q - 8. Let f(m) = -2o(m) + 5y(m). Let g = 8 - 5. Let s(k) = 4k - 2. What is gf(l) - 5s(l)? l - 2 Let c(y) = -y3 + y2 - y - 1. Let f(b) = 5b*3 + 1 + 0 + 3b - 11b2 + 5b*2 + 2b*2. What is -3c(g) - f(g)? -2g3 + g2 + 2 Let l(p) = 1. Suppose 2t + 4 = 12. Let g(m) = 3m + 6. Let n(c) = 10c + 18. Let k(i) = tn(i) - 14g(i). Calculate k(b) + 12l(b). -2b Let t(r) be the third derivative of -5r4/24 + r3/3 - r2. Let u = 10 + -6. Let s be u - (-1 + 0 + 4). Let n(p) = -p + 1. Calculate st(f) - 4n(f). -f - 2 Let f(a) = -14a*2 - 5a - 11. Let b(j) = -5j2 - 2j - 4. Suppose o - 25 = -4o. Suppose 2k + 17 = c, 2k + 70 = oc - 3k. Give cb(h) - 4f(h). h2 - 2h Let p(j) = j3 + j2 + j. Let o = 23 - 21. Suppose 4t = -ox + 3 - 15, -x - 3t = 10. Let c(b) = -4b*3 - 2b*2 - 3b - 2. Determine xp(f) + c(f). -2f*3 - f - 2 Let k(m) = 26m*2 - 7. Let t(y) = -13y*2 + 3. Give 2k(q) + 5t(q). -13q*2 + 1 Let j(l) = -16l*3 - 4l*2 - l + 3. Let v(i) = 31i*3 + 9i*2 + 2i - 7. What is -9j(u) - 4v(u)? 20u3 + u + 1 Let b(h) = -65 + h + 63 + 0h*2 - 4h*2. Let p(n) = -21n*2 + 6n - 11. Give -11b(c) + 2p(c). 2c2 + c Let h(g) = -133g + 77. Let k(f) = 7f - 4. What is -4h(x) - 77k(x)? -7x Let n(k) = k3 + k2. Let s(o) = 7o3 + 6o*2 - o - 1. Let u = -4 + -2. Calculate un(f) + s(f). f*3 - f - 1 Let b(f) = 6f*3 + 9f. Let k(t) = t*3 + t. Give 2b(a) - 14k(a). -2a*3 + 4a Let j(i) = 13i2. Let q(a) = 923a*2. Determine -286j(c) + 4q(c). -26c*2 Let x = 5 - 2. Let f(h) = -43h + 84h - 31h + 10h2. Let a(s) = 2s*2 + 2s. Calculate xf(r) - 14a(r). 2r2 + 2r Let s(b) = 2b2 - 4b - 3. Let u(c) = 5c - 4 + 3c2 - c2 - 10c. Give 6s(g) - 5u(g). 2g*2 + g + 2 Let c(a) = -a. Let q = -64 + 75. Suppose -h - 10 = -4x - 0x, -1 = h - x. Let f(s) = 6s. Give hf(g) + qc(g). g Let k(q) = 2q3 + 6q*2 + 9q - 8. Let u(p) = -3p3 - 7p*2 - 10p + 9. Determine 7k(r) + 6u(r). -4r3 + 3r - 2 Let n(k) = -11k2 + 3k. Let d(p) = -23p2 + 7p. Calculate -6d(q) + 14n(q). -16q2 Let t(k) = -9k*3 - 6k*2 - 10k. Let m(d) = 26d3 + 17d*2 + 30d. Give -6m(h) - 17t(h). -3h3 - 10h Let f(v) = 3v + 2. Let c be 8/28(-1 - 1 - -9). Let k(a) = 9a + 6. Determine ck(u) - 7f(u). -3u - 2 Let o(f) = 2 + 7 - 5f2 - 3 - 11f*2 + 6f. Let i be 5 + (-2 - 0) + -1. Let u(b) = -b + 3bi + b - b - 1. Give -2o(d) - 11u(d). -d2 - d - 1 Let t(n) = n2 + 6n. Let d(b) = b*2 + 7b. Let a(j) = 5d(j) - 6t(j). Let y(s) = s*3 + 4s*2. What is -2a(p) - y(p)? -p*3 - 2p*2 + 2p Let p(r) = 2r2 + 5r + 3. Let z(h) = -h*2 - 4h - 2. Suppose -11 - 13 = 6g. Give gz(c) - 3p(c). -2c*2 + c - 1 Let m(r) = 6r*2 + 2r - 2. Let p(v) = -v*2 - v + 1. What is m(z) + 2p(z)? 4z2 Let q(d) = d3 - 4d2 + 2. Let y(t) = -t3 + 8t2 - 4. What is -5q(a) - 3y(a)? -2a*3 - 4a*2 + 2 Let r(o) = 2o*2 + 4o - 15. Let f(x) = -2x2 - 5x + 15. Calculate -4f(d) - 5r(d). -2d2 + 15 Let l(w) = -10w*3 + w + 4. Let c(s) = -11s*3 + 2s + 5. What is -4c(r) + 5l(r)? -6r3 - 3r Let l(g) = -8g3 - 3g*2. Let r(p) = 17p*3 + 7p*2. Suppose 9t - 36 = 3t. Calculate tr(k) + 13l(k). -2k*3 + 3k*2 Let n(v) = -6v*3. Let m(y) = -85y*3. Give -4m(j) + 55n(j). 10j*3 Suppose 10 = -3q + 1. Let i(t) = -4t + 2. Let d(u) = -7u + 4. Give qd(f) + 5i(f). f - 2 Let x(o) = -4o2 - o + 5o*2 - 2o + 4o. Suppose 2f - 3f + 5 = 0. Let c(g) = 6g*2 + 4g. Give fx(k) - c(k). -k*2 + k
Collect the terms in 24 - 13 - 5 - 98855x + 98701x - 6. -154x Collect the terms in 2887364k + 2120866k + 476220k. 5484450k Collect the terms in 2084a*3 - 14797a + 14797a. 2084a*3 Collect the terms in 17v + 3v + 2v + 0v - 3079 - 21v. v - 3079 Collect the terms in 3 - 5v - 2723v*3 - 4 - v + 0v - 7367v3. -10090v*3 - 6v - 1 Collect the terms in 57d2 + 442944d*3 + 251d*2 - 442942d*3. 2d*3 + 308d*2 Collect the terms in -2634m + 5104m - 9m*3 - 2470m - 2m3. -11m*3 Collect the terms in -222840a - 222845a - 222859a + 668497a. -47a Collect the terms in 703m + 554m + 5 - 1. 1257m + 4 Collect the terms in 55 - 55 + 135470s. 135470s Collect the terms in -299 + 4o - 33o2 - 37o*3 + 20o*3 + 19o*3. 2o*3 - 33o*2 + 4o - 299 Collect the terms in -1028 + 343 + 346 + 339 - 25884d3. -25884d*3 Collect the terms in 6210 - 66p - 12418 + 38p - 64p + 6208. -92p Collect the terms in 1439112 + 20x*2 - 1439112 - 319x*3 - 2x + 0x2. -319x*3 + 20x*2 - 2x Collect the terms in h - 4h + 3692 - 1371 + 13h. 10h + 2321 Collect the terms in 344m*2 + 21m + 34m - 55m - 897m2 + 552m2. -m2 Collect the terms in 2n2 - 142n3 - n2 - n*2 - 37500. -142n*3 - 37500 Collect the terms in -606298d - 9859 - 4d2 + 606298d + 9859. -4d2 Collect the terms in 42960d*3 + 16180d*3 - 14159d*3 + 10600d*3. 55581d*3 Collect the terms in -753o*2 - 200912 + 200914 - 12o + 12o. -753o*2 + 2 Collect the terms in 10457950s + 4001648s + 10584350s - 1313461s. 23730487s Collect the terms in 123 - 61 + 60512u - 59406u - 62. 1106u Collect the terms in j - 203j*2 - 131j*2 + 69 - 67. -334j*2 + j + 2 Collect the terms in -2m*2 - 4387275 - 157m + 18m + 4387275. -2m*2 - 139m Collect the terms in -1085h2 - 1674h*2 - 1943h*2 + 272h*2 + 1112h*2. -3318h*2 Collect the terms in 181 + 26x*2 + 1788555x*3 - 1788553x*3 - 26x*2. 2x*3 + 181 Collect the terms in 30977 + 33431 + 27535 - 22584 - y. -y + 69359 Collect the terms in -1375x*3 - 95x*3 - 271x*3. -1741x*3 Collect the terms in 18x - 21 + 23x2 - 5x - 14x - 5x. 23x2 - 6x - 21 Collect the terms in 14t2 - 14t*2 - 111121060t*3 + 222241856t*3 - 111120795t3. t3 Collect the terms in -319i - 1331i + 329i - 907i. -2228i Collect the terms in 1989m*2 + 19767m*3 - 9697m*3 - 9839m*3 - 1989m*2. 231m*3 Collect the terms in -345m*3 + 356160m - 38m3 - 19m*3. -402m*3 + 356160m Collect the terms in -71042860220b + b3 + 71042860220b. b*3 Collect the terms in -4886d - 4888d - 4894d + 14671d + 60. 3d + 60 Collect the terms in 786497 + g*3 - 2g*3 + 286g*2 - 786497 + 230g2. -g3 + 516g2 Collect the terms in 4914y - 16421y - 8320y - 3269y. -23096y Collect the terms in -516350v2 - 4v + 258139v2 + 258114v*2 + 4v. -97v2 Collect the terms in 95n - 395n + 25n - 41 + 21n + 41. -254n Collect the terms in -1214n2 - 2937n*2 + 48 + 44 - 92. -4151n*2 Collect the terms in 587x*2 + 19x - 19x - 679x*2 - 3345x*2. -3437x*2 Collect the terms in -1452m*3 + 1451m*3 + 1685m - 435m. -m3 + 1250m Collect the terms in 3r2 - r2 - 15r - 2246500r3 + 15r + 2246509r3. 9r*3 + 2r*2 Collect the terms in 2860h*2 + 3 - 830h*2 - 3 - 800h*2 - 943h*2. 287h*2 Collect the terms in 13m*2 - 5m*2 - 30 + 56 - 26 + 16m*2. 24m*2 Collect the terms in 863q + 279q + 1698q + 680q - 247q. 3273q Collect the terms in 139r*2 + 318 - 111 + 50r*2 - 114 - 93. 189r*2 Collect the terms in 8x*3 + 33 + 6x*3 - 63 + 30 - 43x*3 + 33x*3. 4x*3 Collect the terms in 5d*3 - 1910475810 + 1910475810 + 41d*3. 46d*3 Collect the terms in -1351660z - 8z2 - 5z*2 + 12z2. -z2 - 1351660z Collect the terms in -3507o*2 - 3515o*2 - 3519o*2 - 11 + 10547o*2 + 11. 6o*2 Collect the terms in -71 + 8x*3 - 76 + 97x + 226 - 9x3 - 82. -x3 + 97x - 3 Collect the terms in 343q - 141q*2 + 20 - 218q - 125q. -141q*2 + 20 Collect the terms in 161q*3 + 65q*3 - 2q*3 + 0q*3. 224q*3 Collect the terms in -2320s - 2320s - 2s*3 + 9288s - 2322s + 6s*3 - 2326s. 4s3 Collect the terms in 3686a*2 + 8838a*2 - 30123a*2 - 38930a*2. -56529a*2 Collect the terms in 36149970551l - 36149970551l + 264l*2. 264l*2 Collect the terms in -4b*2 - 996b + 2806b + 2810b - 4620b. -4b*2 Collect the terms in -1780f*2 - 1787f*2 + 5356f*2 - 3f - 1782f2 - 3. 7f*2 - 3f - 3 Collect the terms in 303983h3 - 56675h*3 - 23 + 23. 247308h*3 Collect the terms in -19u + 45u - 6u - 887 - 6u - 12u. 2u - 887 Collect the terms in -44948986 + 81h + 44948986 + 0h2 - 2h*2. -2h*2 + 81h Collect the terms in 85y - 11413y*2 - 11429y*2 - 11412y*2 + 34253y2. -y2 + 85y Collect the terms in 156387816 - 156387816 - 4h3 - h3. -5h3 Collect the terms in -108450c*3 + 216956c*3 - 108449c*3. 57c*3 Collect the terms in 21 - 99r + 2405r3 - 1041r*3 - 1362r*3. 2r*3 - 99r + 21 Collect the terms in -104q - 56677 + 56666 + 84q. -20q - 11 Collect the terms in 26259k*2 - 8840k*2 - 8833k*2 - 8595k*2. -9k*2 Collect the terms in 63j*2 + 317j + 71j + 57j*2 + 57j*2 - 231j*2 + 56j*2. 2j*2 + 388j Collect the terms in -90 - 62m2 - 99 - 36m*2 + 22m*2 + 189. -76m*2 Collect the terms in -951t - 991t3 + 476t + 473t + 3 - 9 + 7. -991t*3 - 2t + 1 Collect the terms in -195u + 523u + 523u - 1886u + 516u + 517u. -2u Collect the terms in 2 + 390221p + 1002780p - 231346p. 1161655p + 2 Collect the terms in 12t*3 - 13t*2 + 66t*2 - 53t*2 + 12t*3 - 29t*3 + 17t*3. 12t*3 Collect the terms in 8i + 12i + 4 - 2 - 29901i*2 - 29i + 8i. -29901i*2 - i + 2 Collect the terms in 132h - 166h - 2 + 130h + 138h + 136h + 2 - 369h. h Collect the terms in 28 + 30 + 79r + 22 - 107 + 27. 79r Collect the terms in -984 - 658 + 1641 + 450x. 450x - 1 Collect the terms in -530j - 119 - 76 + 195 + 510j. -20j Collect the terms in 132n2 - 4195780n + 4195780n. 132n*2 Collect the terms in 112 + 3k + 79 + 47 - 3k2 + 120. -3k*2 + 3k + 358 Collect the terms in u*2 - 28u + 6u2 + 12u*2 + 22u*2 - 41u*2 + 2u*2. 2u*2 - 28u Collect the terms in 435524p2 + 207571p*2 - 2p*3 - 86359p*2 + 771574p*2. -2p*3 + 1328310p*2 Collect the terms in 29 + 43 - 102 + 30 + 62672b. 62672b Collect the terms in 3v*3 - 1224685v - 4v3 + 2v*3 - 3v*3. -2v*3 - 1224685v Collect the terms in -3 - 3 - 480u3 - 3719u*3. -4199u*3 - 6 Collect the terms in -371v - 622 - 680 + 1302 + 390v. 19v Collect the terms in 1185 - 5950 + 1163 + 2u + 1286 + 1157 + 1159. 2u Collect the terms in -633b + 1891b + 6 - 632b - 8 - 622b. 4b - 2 Collect the terms in 25359444u*2 - 3u*3 - 25359444u*2 + 102u - u*3. -4u*3 + 102u Collect the terms in 3188 - 931 - 929 + 332w2 - 1328. 332w*2 Collect the terms in 75s*2 + 19s*2 - 7 + 198s*2 + 60s*2 + 7. 352s*2 Collect the terms in -7789v + 3952v + 3819v. -18v Collect the terms in -130s + 780 + 149s + 171s. 190s + 780 Collect the terms in 0y - 78112504y3 + 78112653y*3 + 5y*2 + 0y. 149y3 + 5y*2 Collect the terms in 3b*2 - 898963473b + 898963473b - 71. 3b*2 - 71 Collect the terms in -7772d + 1513d + 6259d - 3d3. -3d*3 Collect the terms in 4u*2 + 3u*2 - 17u + 100u2 + 30u*2 - 2 + 20u*2. 157u*2 - 17u - 2 Collect the terms in -365775c3 - 62347c*3 + 46032c*3. -382090c*3 Collect the terms in -29c*3 - 327c*3 - 66c*3 - 224c*3 - 127c*3 + 12c*3. -761c*3 Collect the terms in -3f*2 + 1086422044f*3 + 3f*2 - 1086422053f*3. -9f*3 Collect the terms in -5973v - 5977v - 5977v - 5969v + 29858v - 5960v. 2v Collect the terms in 102m - 539m - 62m. -499m Collect the terms in -4u2 + 44u*3 - 465 - 68u*3 + 27u*3. 3u*3 - 4u*2 - 465 Collect the terms in -181a*3 + 515a*3 - 175a*3 - 10 - 161a*3 - 271a*2. -2a*3 - 271a*2 - 10 Collect the terms in -20d*2 + 77d*2 - 14d*2 - 19d*2 - 29d*2. -5d*2 Collect the terms in 58m - 20m - 66m + 0m3 + 11m*3. 11m*3 - 28m Collect the terms in 1828f + 1827f + 850f3 + 313f*3 - 3655f. 1163f3 Collect the terms in -22a + 8921a3 - 26068a*3 + 22a - 16803a3. -33950a*3 Collect the terms in 5 + 7 - 74p + 48p - 133p - 12. -159*p
What is prob of picking 2 n when two letters picked without replacement from jlpln? 0 Three letters picked without replacement from {u: 3, c: 1, q: 5, z: 4, f: 2, j: 5}. What is prob of picking 1 c, 1 z, and 1 f? 2/285 What is prob of picking 2 v when two letters picked without replacement from {z: 2, i: 1, v: 4}? 2/7 Calculate prob of picking 1 w and 2 f when three letters picked without replacement from ylyyyflylyldfdlwlwd. 2/969 Four letters picked without replacement from fxwadwr. Give prob of picking 1 a, 1 f, and 2 w. 1/35 Calculate prob of picking 1 b and 1 z when two letters picked without replacement from ssrrzrrsbsrbrr. 2/91 Calculate prob of picking 2 w when two letters picked without replacement from eueowuoeodwwewuoeuue. 3/95 Two letters picked without replacement from kcklckcklckcl. Give prob of picking 2 c. 5/39 Three letters picked without replacement from {d: 1, v: 1, b: 2, f: 3}. Give prob of picking 2 b and 1 f. 3/35 Four letters picked without replacement from lnqldjzz. Give prob of picking 2 l, 1 z, and 1 n. 1/35 What is prob of picking 2 r, 1 l, and 1 s when four letters picked without replacement from rlrvs? 1/5 What is prob of picking 2 k when two letters picked without replacement from akwakkxaxa? 1/15 Two letters picked without replacement from {n: 3, r: 4, z: 5}. What is prob of picking 1 r and 1 z? 10/33 What is prob of picking 1 h and 1 x when two letters picked without replacement from xhu? 1/3 Two letters picked without replacement from gggnizzg. What is prob of picking 1 z and 1 g? 2/7 Three letters picked without replacement from {v: 2, b: 2, m: 4, r: 1, q: 1, k: 2}. Give prob of picking 1 v, 1 q, and 1 m. 2/55 Four letters picked without replacement from {n: 3, w: 6, z: 1, s: 4}. Give prob of picking 1 s, 2 w, and 1 n. 180/1001 Calculate prob of picking 1 k and 3 p when four letters picked without replacement from kppuyupkykupmyxx. 3/455 Two letters picked without replacement from {x: 6, q: 13}. Give prob of picking 1 q and 1 x. 26/57 Calculate prob of picking 1 g and 2 k when three letters picked without replacement from {k: 5, g: 2}. 4/7 Three letters picked without replacement from zjzzpjzzfzpnjzzj. Give prob of picking 1 f and 2 z. 1/20 Calculate prob of picking 2 c when two letters picked without replacement from csccccccccccccc. 13/15 Calculate prob of picking 4 q when four letters picked without replacement from bqqqbqqqqqqqqbqqqq. 91/204 Two letters picked without replacement from {d: 3, i: 13}. Give prob of picking 2 i. 13/20 Three letters picked without replacement from {o: 3, n: 1, t: 1}. What is prob of picking 1 n and 2 o? 3/10 Two letters picked without replacement from wrtrrrrtwrtrwrtffrfr. Give prob of picking 1 r and 1 t. 4/19 Four letters picked without replacement from {f: 2, r: 2, b: 11, j: 1}. What is prob of picking 1 f, 2 r, and 1 j? 1/910 What is prob of picking 2 q and 2 e when four letters picked without replacement from eqeeiqv? 3/35 Calculate prob of picking 2 f when two letters picked without replacement from xfffffffffxxfff. 22/35 What is prob of picking 1 n and 1 k when two letters picked without replacement from hkwknhe? 2/21 Calculate prob of picking 1 o and 1 t when two letters picked without replacement from {e: 1, c: 1, f: 2, j: 1, o: 1, t: 1}. 1/21 Calculate prob of picking 2 z when two letters picked without replacement from {z: 14, c: 2, m: 1}. 91/136 What is prob of picking 2 s and 1 o when three letters picked without replacement from loolosmosls? 4/55 What is prob of picking 1 l and 2 n when three letters picked without replacement from {l: 1, z: 6, s: 1, n: 2, u: 5, g: 1}? 1/560 Four letters picked without replacement from usssmssdmmm. What is prob of picking 4 m? 1/330 Three letters picked without replacement from agigpgippga. What is prob of picking 3 g? 4/165 What is prob of picking 1 h, 1 l, 1 j, and 1 a when four letters picked without replacement from {a: 4, l: 2, d: 3, j: 1, h: 1, u: 1}? 8/495 Two letters picked without replacement from {c: 1, s: 4, n: 2}. Give prob of picking 1 c and 1 s. 4/21 What is prob of picking 3 w when three letters picked without replacement from ywawdwmwmwwmmayw? 1/16 Four letters picked without replacement from {p: 10, t: 1, m: 2, s: 3}. Give prob of picking 3 s and 1 t. 1/1820 Four letters picked without replacement from {g: 3, c: 1}. What is prob of picking 3 g and 1 c? 1 Three letters picked without replacement from {m: 12, x: 3}. What is prob of picking 2 m and 1 x? 198/455 Three letters picked without replacement from uuuxuuuxuxuuxu. What is prob of picking 2 u and 1 x? 45/91 What is prob of picking 1 c, 1 k, and 1 y when three letters picked without replacement from {k: 4, f: 3, c: 2, y: 1, l: 2}? 2/55 What is prob of picking 1 b, 1 z, and 2 k when four letters picked without replacement from {k: 4, b: 9, z: 1}? 54/1001 Two letters picked without replacement from {c: 2, q: 6}. Give prob of picking 2 c. 1/28 Four letters picked without replacement from {j: 7, p: 1, h: 1, q: 8}. What is prob of picking 1 j, 1 h, and 2 q? 7/85 Three letters picked without replacement from rnrc. What is prob of picking 2 r and 1 n? 1/4 Four letters picked without replacement from xssxfazz. What is prob of picking 1 x, 1 s, 1 f, and 1 a? 2/35 Calculate prob of picking 3 m when three letters picked without replacement from {m: 5, o: 15}. 1/114 Calculate prob of picking 3 v and 1 x when four letters picked without replacement from {x: 2, v: 10}. 16/33 What is prob of picking 2 i and 1 h when three letters picked without replacement from eeioieieheeho? 3/143 Four letters picked without replacement from bjwcbbbwbwwcwwwbwj. What is prob of picking 3 b and 1 w? 8/153 What is prob of picking 1 m and 1 t when two letters picked without replacement from ljljjmjtmtlljtmjsmjt? 8/95 Calculate prob of picking 1 l, 1 p, and 1 s when three letters picked without replacement from iiggslliglgigp. 3/364 What is prob of picking 1 y and 1 r when two letters picked without replacement from {v: 4, y: 1, r: 2, g: 2, e: 5}? 2/91 What is prob of picking 1 u, 1 a, and 2 n when four letters picked without replacement from {n: 3, a: 1, m: 6, s: 1, t: 3, u: 1}? 1/455 Two letters picked without replacement from qqqqqqqqq. Give prob of picking 2 q. 1 Calculate prob of picking 1 d and 1 j when two letters picked without replacement from {d: 3, j: 1}. 1/2 What is prob of picking 1 y and 3 d when four letters picked without replacement from yydydyyydyyyyyyyydyd? 10/323 Two letters picked without replacement from {s: 5, f: 3, n: 1, r: 1, v: 3, l: 1}. Give prob of picking 1 r and 1 l. 1/91 What is prob of picking 1 g, 1 r, 1 l, and 1 y when four letters picked without replacement from gllyygggyygyrlyy? 3/52 Three letters picked without replacement from bbbbbbbqqqbbbbbb. Give prob of picking 2 b and 1 q. 117/280 Two letters picked without replacement from {n: 5, e: 7}. What is prob of picking 2 n? 5/33 Four letters picked without replacement from {t: 3, m: 9}. Give prob of picking 3 t and 1 m. 1/55 Three letters picked without replacement from {u: 1, m: 3}. Give prob of picking 1 u and 2 m. 3/4 Calculate prob of picking 1 m, 1 g, and 1 y when three letters picked without replacement from {m: 1, g: 1, y: 3, z: 10}. 3/455 Four letters picked without replacement from whsshwhnhhhhhhnhtphh. Give prob of picking 1 w, 1 p, and 2 h. 44/1615 What is prob of picking 1 k and 1 h when two letters picked without replacement from ypyhypgmpkk? 2/55 Two letters picked without replacement from iipimimimipiikiiiii. What is prob of picking 2 i? 26/57 What is prob of picking 1 j, 1 k, and 2 z when four letters picked without replacement from kjjzjzzjjjjzjjjjzjk? 20/323 Three letters picked without replacement from {g: 2, o: 16}. What is prob of picking 3 o? 35/51 Two letters picked without replacement from sassssa. Give prob of picking 1 s and 1 a. 10/21 Four letters picked without replacement from gdtgctgdgtctdcttc. Give prob of picking 3 d and 1 t. 3/1190 Three letters picked without replacement from {q: 4, r: 1, i: 6, l: 2, z: 3}. What is prob of picking 2 l and 1 i? 3/280 What is prob of picking 4 b when four letters picked without replacement from bdzzzbbbzb? 1/42 Two letters picked without replacement from oyocosoousyoyyy. Give prob of picking 1 y and 1 u. 1/21 Two letters picked without replacement from ppppppjj. Give prob of picking 2 j. 1/28 Three letters picked without replacement from {a: 14, s: 2, d: 1}. What is prob of picking 1 s and 2 a? 91/340
What is the fifth root of 4380 to the nearest integer? 5 What is 1961 to the power of 1/3, to the nearest integer? 13 What is 998 to the power of 1/8, to the nearest integer? 2 What is 81387 to the power of 1/2, to the nearest integer? 285 What is the square root of 5531 to the nearest integer? 74 What is 4243 to the power of 1/7, to the nearest integer? 3 What is the cube root of 2308 to the nearest integer? 13 What is the seventh root of 43216 to the nearest integer? 5 What is the ninth root of 1904 to the nearest integer? 2 What is the cube root of 1149 to the nearest integer? 10 What is 22840 to the power of 1/3, to the nearest integer? 28 What is the third root of 842 to the nearest integer? 9 What is 45357 to the power of 1/2, to the nearest integer? 213 What is 85718 to the power of 1/6, to the nearest integer? 7 What is 10753 to the power of 1/7, to the nearest integer? 4 What is 1077 to the power of 1/9, to the nearest integer? 2 What is 39278 to the power of 1/2, to the nearest integer? 198 What is 27792 to the power of 1/3, to the nearest integer? 30 What is 6188 to the power of 1/2, to the nearest integer? 79 What is the square root of 4554 to the nearest integer? 67 What is 7492 to the power of 1/2, to the nearest integer? 87 What is the square root of 709 to the nearest integer? 27 What is 3626 to the power of 1/2, to the nearest integer? 60 What is the sixth root of 30532 to the nearest integer? 6 What is the cube root of 17166 to the nearest integer? 26 What is 289 to the power of 1/6, to the nearest integer? 3 What is 6386 to the power of 1/2, to the nearest integer? 80 What is the seventh root of 30121 to the nearest integer? 4 What is 42134 to the power of 1/10, to the nearest integer? 3 What is 99642 to the power of 1/2, to the nearest integer? 316 What is the square root of 492 to the nearest integer? 22 What is 413 to the power of 1/2, to the nearest integer? 20 What is the cube root of 75469 to the nearest integer? 42 What is the third root of 7916 to the nearest integer? 20 What is the sixth root of 90 to the nearest integer? 2 What is 44678 to the power of 1/3, to the nearest integer? 35 What is the cube root of 5165 to the nearest integer? 17 What is 35824 to the power of 1/7, to the nearest integer? 4 What is 968 to the power of 1/3, to the nearest integer? 10 What is 22713 to the power of 1/7, to the nearest integer? 4 What is the third root of 2926 to the nearest integer? 14 What is the cube root of 1661 to the nearest integer? 12 What is the sixth root of 4796 to the nearest integer? 4 What is the fifth root of 852 to the nearest integer? 4 What is the ninth root of 22334 to the nearest integer? 3 What is the eighth root of 49818 to the nearest integer? 4 What is 4125 to the power of 1/2, to the nearest integer? 64 What is the third root of 459 to the nearest integer? 8 What is 382 to the power of 1/10, to the nearest integer? 2 What is 2737 to the power of 1/7, to the nearest integer? 3 What is 2145 to the power of 1/5, to the nearest integer? 5 What is 14503 to the power of 1/2, to the nearest integer? 120 What is 40413 to the power of 1/4, to the nearest integer? 14 What is the square root of 2689 to the nearest integer? 52 What is the tenth root of 144774 to the nearest integer? 3 What is 25438 to the power of 1/3, to the nearest integer? 29 What is 1165 to the power of 1/3, to the nearest integer? 11 What is the third root of 19769 to the nearest integer? 27 What is the square root of 461 to the nearest integer? 21 What is 1436 to the power of 1/4, to the nearest integer? 6 What is 247 to the power of 1/3, to the nearest integer? 6 What is the sixth root of 1253 to the nearest integer? 3 What is the third root of 20490 to the nearest integer? 27 What is the square root of 8428 to the nearest integer? 92 What is 56196 to the power of 1/2, to the nearest integer? 237 What is 2017 to the power of 1/5, to the nearest integer? 5 What is the square root of 23 to the nearest integer? 5 What is the square root of 5918 to the nearest integer? 77 What is the fourth root of 128 to the nearest integer? 3 What is the square root of 117353 to the nearest integer? 343 What is the third root of 64289 to the nearest integer? 40 What is 9312 to the power of 1/2, to the nearest integer? 96 What is the cube root of 8366 to the nearest integer? 20 What is 35358 to the power of 1/2, to the nearest integer? 188 What is the ninth root of 3730 to the nearest integer? 2 What is 25810 to the power of 1/9, to the nearest integer? 3 What is the eighth root of 747 to the nearest integer? 2 What is 525 to the power of 1/2, to the nearest integer? 23 What is the cube root of 24100 to the nearest integer? 29 What is 1029 to the power of 1/2, to the nearest integer? 32 What is the square root of 2972 to the nearest integer? 55 What is the square root of 128340 to the nearest integer? 358 What is 2008 to the power of 1/4, to the nearest integer? 7 What is the cube root of 58761 to the nearest integer? 39 What is the cube root of 2688 to the nearest integer? 14 What is the third root of 1284 to the nearest integer? 11 What is 10006 to the power of 1/3, to the nearest integer? 22 What is 1280 to the power of 1/2, to the nearest integer? 36 What is 2755 to the power of 1/3, to the nearest integer? 14 What is 62377 to the power of 1/10, to the nearest integer? 3 What is 12683 to the power of 1/2, to the nearest integer? 113 What is the fifth root of 81004 to the nearest integer? 10 What is the square root of 1056 to the nearest integer? 32 What is 162827 to the power of 1/7, to the nearest integer? 6 What is 3010 to the power of 1/8, to the nearest integer? 3 What is the square root of 5060 to the nearest integer? 71 What is the ninth root of 796 to the nearest integer? 2 What is the third root of 1514 to the nearest integer? 11 What is 1202 to the power of 1/6, to the nearest integer? 3 What is the cube root of 38162 to the nearest integer? 34 What is the eighth root of 1098 to the nearest integer? 2 What is the third root of 16151 to the nearest integer? 25 What is 67669 to the power of 1/2, to the nearest integer? 260 What is 485 to the power of 1/6, to the nearest integer? 3 What is the square root of 30439 to the nearest integer? 174 What is 6138 to the power of 1/7, to the nearest integer? 3 What is the square root of 3104 to the nearest integer? 56 What is 17460 to the power of 1/7, to the nearest integer? 4 What is 797 to the power of 1/2, to the nearest integer? 28 What is the third root of 122220 to the nearest integer? 50 What is the third root of 45929 to the nearest integer? 36 What is the fifth root of 6883 to the nearest integer? 6 What is 14956 to the power of 1/3, to the nearest integer? 25 What is the cube root of 57341 to the nearest integer? 39 What is the tenth root of 3600 to the nearest integer? 2 What is the square root of 3190 to the nearest integer? 56 What is the third root of 2317 to the nearest integer? 13 What is the fifth root of 17237 to the nearest integer? 7 What is the ninth root of 254 to the nearest integer? 2 What is 211 to the power of 1/2, to the nearest integer? 15 What is the square root of 2276 to the nearest integer? 48 What is 22144 to the power of 1/2, to the nearest integer? 149 What is 341 to the power of 1/3, to the nearest integer? 7 What is the square root of 33879 to the nearest integer? 184 What is 15656 to the power of 1/3, to the nearest integer? 25 What is 1406 to the power of 1/3, to the nearest integer? 11 What is 110847 to the power of 1/2, to the nearest integer? 333 What is 7799 to the power of 1/3, to the nearest integer? 20 What is the square root of 40011 to the nearest integer? 200 What is the eighth root of 3280 to the nearest integer? 3 What is 9969 to the power of 1/6, to the nearest integer? 5 What is 8197 to the power of 1/5, to the nearest integer? 6 What is 10999 to the power of 1/2, to the nearest integer? 105 What is the eighth root of 771 to the nearest integer? 2 What is 1553 to the power of 1/2, to the nearest integer? 39 What is the square root of 1075 to the nearest integer? 33 What is the square root of 85 to the nearest integer? 9 What is the square root of 1042 to the nearest integer? 32 What is 416 to the power of 1/7, to the nearest integer? 2 What is the square root of 35252 to the nearest integer? 188 What is the third root of 6912 to the nearest integer? 19 What is the square root of 925 to the nearest integer? 30 What is the square root of 2302 to the nearest integer? 48
Expand -122747d2 + 260454d*2 - 126679d*2 + (-2d + 3 - 3)(0d + d - 2d). 11030d*2 Expand (3n - 1 + 1)(1108n*2 + 851n*2 - 1403n*2) + 2n*3 + 2n*3 - 6n*3. 1666n*3 Expand (-85l + 379l + 272l)(l - 2l - 5l). -3396l*2 Expand 6 - g - 6 + (2 - 1 - 3)(2 - g - 2) + 0g + 12g + 6g + 10g - 37g + 9g. g Expand ((-4 - 4 + 6)(3 - 1 - 4) + 3 + 10 + 96)(3q3 - 5q*3 + 4q*3). 226q*3 Expand (2m*4 + 2m*4 - 5m*4)(-10161m - 2061m - 9810m + 1029m - 12538m + 6615m). 26926m5 Expand (-129f - 26f - 50f - 114f)((1 - 3 + 4)(-1 - 2 + 1) + 1 + 0 + 4)(-10 + 2f + 10). -638f*2 Expand (13w*3 - 26w*3 - 2w*3)(18 + 35 + 10). -945w3 Expand (t2 + 2t2 - t2)(-62t - 395t - 2 + 119t) + (2t + t - 2t)(2t*2 - 4t*2 + 5t*2). -673t*3 - 4t*2 Expand 20d*2 + 3 - 18d*2 - 64d*2 - 8 + 8 - 2d*2 + 2d*2 + 1 - 1 + (-6d + 4d + d)(-2d + 6d - 3d) + 3d2 - d2 - 4d2. -65d*2 + 3 Expand (-5x + 2x + 5x)(-1 + 1 + 2) + x + x + 8x + (4x + x - x)(28 - 9 + 41). 254x Expand (159 + 119 + 131b*2 + 164 - 443)(5 - 2 - 2). 131b2 - 1 Expand (5s + 9s - 6s)(5s - 1 + 1)(-7 + 2 - 2)(4 - 6 + 4). -560s2 Expand (-k + 4k - k)(-3236 - 1009 - 558)(-2 + 2 + 2k). -19212k*2 Expand (-3 + 2 + 0)(2 - d - 2) + 2217d - 735d - 991d - 5d + 7d + 3d. 497d Expand (-1005p + 130p3 + 1005p)(-2p - p + 2p) - 33p*2 - 34p*4 + 33p*2. -164p*4 Expand (8372 - 8670n*2 - 8372)(0n2 - n2 - n2) + 5n*4 - 4n*4 + 0n*4 + (-n + 2n*3 + n)(2n - 3n + 0n) + 2n*4 - 5n*2 + 5n*2. 17341n*4 Expand 8r*2 + 7 - 7 + (5r*2 + 0r*2 - 9r*2)(9 + 73 + 6)(-3 + 1 + 1). 360r*2 Expand (25r*4 - 24r*2 + 24r*2)((3r + r - 6r)(-1 - 2 + 2) - r + 7r - r - r). 150r5 Expand (351 + 445 - 700)(-6o3 - 7o*3 + 4o*3 + (1 + 3o - 1)(-6o*2 + 3o2 + o2) + (0o + 0o + o)(0o*2 - 3o*2 + 4o*2)). -1344o*3 Expand (-b + 4b + 8b)(65 + 93 - 35). 1353b Expand (9086 - 9086 + 5015d)(-2d + 1 - 1). -10030d2 Expand (-2 + 2 + 1)(1 + 3 - 2)(3j - 2j - 2j - 2j + 4j - 3j + 3j + j - 3j + (j - 2j - j)(-2 - 2 + 2) + 3 + 2j - 3 + 152j - 85432 + 85432). 314j Expand (-3164 - 10082v4 + 6329 - 3165)(3v + 0v + 1 - 6v). 30246v*5 - 10082v*4 Expand -74 + 17p*3 + 74 + (233 - 155p - 233)(-p2 + 4p*2 + 0p*2). -448p*3 Expand (-4p + 2p2 + 4p)(-18p - 33p - 18p)(-761 - 137p + 761). 18906p4 Expand (-2i*4 + 6i*4 - 8i*4)(-133i + 342i - 166i + (-4 + 1 + 1)(-i + 0i + 2i)). -164i5 Expand (-3 + 3 - h)(h + 0h - 2h) - 519h2 + 25h - 25h. -518h*2 Expand (-1 - 1 - 1)(b*5 - 5b*5 + 3b*5) - 97 + 98b5 + 97 - b5 + 1 - 1 + (-5b2 + b2 + 2b*2)(0b + 0b - b*3). 102b*5 Expand (2k - 2k - 3k*2)(3k2 - 2k*2 - 7k*2) + 13k*4 - 21k*4 - 14k4 + 0 - k4 + 0 + k*4 - 2k*4 + 2k*4 - 2k*4 - 3k*3 + 3k*3. -6k*4 Expand 3s - 112s2 - 134s*2 + 265s*2 + (-s + 3 - 3)(0s - 2s + s) + 3s2 + 4s*2 - 4s*2 + (2s*2 - 3s*2 + 0s*2)(0 - 2 + 0). 25s2 + 3s Expand (-1 + 1 - 2y2)((5 + 13 - 3)(9y + 3y + 11y) + 3y - 3y + 2y). -694y*3 Expand (4t*4 + 5t*4 - 6t*4)((t + 2 - 2)(-1 - 2 + 4) - 458 - 63t + 458 + 4t + 0 + 0). -174t*5 Expand (-309 + 392 + 840)(-4 - 2z2 + 4)(-1 + 2z + 1). -3692z*3 Expand (2 + 5 - 2)(-h - 1 + 1 + (-3h + 4h + 0h)(-3 + 0 + 0) + (5h - 5h - 3h)(0 - 5 - 3)). 100h Expand (t - t + t2)(3 + 2 - 3) - 40t + 40t - 12t2 - 3131 - 34t*2 + 3131. -44t*2 Expand (2m + 0m - 5m)(-5 - 27 - 61)(7m2 - 55 + 55). 1953m*3 Expand (2 - 2 - 2f)(-3 - 2 + 7) + (-1 + 4 - 4)(108f + 40f + 139f) + 4f - 3f - 3f + 2f + 0 + 0. -291f Expand -4h + 23 - 23 + 2h - 5h + 2h + (-2 + 0 + 1)(2h - 4h + 3h) - 13h + 26h - 29h. -22h Expand (-10355 + 20525 + 120s - 10257)(0s3 + 0s3 - s3). -120s4 + 87s*3 Expand (-1 + 3 + 0)(2d2 - 5d*2 + 4d*2)(30d3 + 32d*3 + 80d*3). 284d*5 Expand (-3 + 4 - 4)(-96 - 296 + 67)(0 + 0 + 2t). 1950t Expand (-2y + 0 + 0)(2y - y - 2y)(2 + 0 + 1) + 146 - 34 - 18y2 + 17y*2. 5y*2 + 112 Expand (1 - 1 + q)(-695q + 10q*2 + 695q)(-6 - 6 + 3). -90q3 Expand (-s3 + 4s - 4s)(81s - 126s + 116s) + 4s4 - 2s*4 - 5s*4. -74s*4 Expand (-2r + 0r + r)(-2032 - 2026 + 4058 + 782r + 60360r). -61142r2 Expand (3o*3 - 3o3 - o3)(2o + 2o - 3o) + 2429o4 + 3006o*4 - 884o*4. 4550o*4 Expand (2n*2 + 4n*2 - 4n*2)(4477n2 + 10085254 - 10085254). 8954n*4 Expand (6c - 7c - 7c)(3 - 2 - 4)(33c2 - 7c*2 + 4c*2). 720c*3 Expand (-8 + 3 + 1)(5c2 - 13c*2 - 3c*2)(11c - 14 + 14). 484c*3 Expand (5s - 3s - 3s)(2s + 2s - 6s)((6 - 11 + 7)(12s3 - 26s*2 + 26s*2) - 12 + 12 + 11s*3). 70s*5 Expand (3 - 3 - 36n + n)(408n*2 - 126n*2 + 384n*2). -23310n*3 Expand 0p*5 - 6p*5 - 3p*5 + (-4p + p + 0p)(0p4 + 2p*4 + 0p*4) - 10p*5 - 2p*2 - 2p - 37p5 + 3p. -62p5 - 2p*2 + p Expand (18a3 + a3 + 4a3)(-a - 22 + 23 + 42a). 943a*4 + 23a*3 Expand (2i - 3 + 3)(19818i*2 + 227 - 44 - 183). 39636i*3 Expand (7k - 3k - 2k)(2 - 2 - 1) + 2k + k + 0k + (-3 + 1 + 5)(36k + 1 - 34k - 53k). -152k + 3 Expand (494o - 703o + 747o)(2o2 - o2 - 3o*2) + (-3o + 4o + 0o)(4o2 - o2 - 4o2) - 2 + 2 + 2o*3. -1075o*3 Expand (14j*3 - 29j + 48j - 20j*3)(3j - 3 + 3 + 7j). -60j4 + 190j*2 Expand -3u*5 + 9u5 - u5 + (2 + 1 + 0)(2u*3 - 2u*3 - 2u*5) - 2u*5 + 11u*5 - 4u*5. 4u*5 Expand -o + o - 2o*3 - 2o - 2o3 + 5o*3 - 2o*3 + (109 - 43 - 39)(7o3 + 3o*3 + 0o*3). 269o*3 - 2o Expand 12f5 - 46f*5 - 26f5 + f5 - 2f5 + 3f5 - f5 - 3f5 + 5f*5 + (2f + f*2 - 2f)(8f*3 + 0f*3 - 4f*3). -53f*5 Expand (7544 - 7544 + 689m)(-3 + 1 + 4)(-25 + 9 + 14)(4 - 5 + 3)(-2 + 5 - 2). -5512m Expand (540t*2 + 28t*3 + 602t*2 - 1190t*2)((-2 + 0 + 0)(t - 3t + 4t) + 0t - 2t + 4t). -56t4 + 96t*3 Expand 0 + 1 + 0k*2 + 2k*2 + (1 - 1 - 1)(-2k2 + 0 + 0) - 24733k*2 + 48115k*2 - 25903k*2. -2517k*2 + 1 Expand (-5 - 5 + 4)(-71 + 1 + 21 - u + 3). 6u + 276 Expand (957u + 9u - 7 + 9 + (-2 + 1 + 3)(-3u + 3u - 2u))(-2u - u + 5u). 1924u2 + 4u Expand n + 0n + n + (-9 + 2 - 2)(-29 + 29 + 33n). -295n Expand (6k - 10k - 2k)((-3 + 0 + 1)(-1 + 4 - 2) - 1 + 2 - 3 - 5 + 5 - 2 + 2 + 1 - 5 - 2 - 5 + 5)(15k - 9k - 17k). -660k*2 Expand (-2 - 5 + 3)(-5p + 8p + 25 - 4p)(4p2 - 3p*2 - 2p*2). -4p*3 + 100p*2 Expand (-10 + 6 - 7)(-40 + 40 - 4u)(0 + 1 + 3)(-1 + 1 + 2) - 2u - 2u + 6u. 354u Expand (-3 - 5 + 2)(3o - 5o + 4o)(2 + 1 - 4)(-1 + 0 - 2). -36o Expand (i - 3i + i)(-1 - 1 + 0) + i - 5i + 3i + (5 + 3 - 3)(i + 6i + 4i) + (-6 - 2 - 5)(0i + 2i - i). 43i Expand (70 - 4 + 215)(-3x4 + 3x*4 + 2x*4). 562x4 Expand (r2 - 4r2 + 2r*2)(79r - 346r - 4r) + 2 - 2r*3 - 2 + 43r - 85r + 31r*3 + 42r. 300r3 Expand (-1 - 4 + 4)(-462c - 41 - 10 + 317c). 145c + 51 Expand (-3 - 2b + 3)(-2b*4 + 3b*3 - 3b3) - b2 + b2 + b5 - 5180b5 - 191b*3 + 5177b*5 - 248b*3. 2b*5 - 439b*3 Expand ((-3 - 2 + 6)(91 + 21i - 91) + 4i - 3i + 0i)(-7 + 7 - i). -22i*2 Expand (10n*2 - 10n*2 + 6n*3)(77n - 47n + 363n). 2358n*4 Expand -384 - 261g*2 + 384 + (4g*2 + 2g*2 - 5g*2)(-1 + 1 + 4). -257g2 Expand (15 - 135s*2 - 15)(10 - 10 - 7s + (-1 - 5 + 4)(2s - 2s + s)) - 2s3 - 3 + 3. 1213s*3 Expand (0p3 + p3 + 2p3)(-3 + 4 + 3)(51p + 160p - 16p). 2340p4 Expand (134w + 13 - 5 - 10)(-3w + 0w + 2w). -134w2 + 2w Expand (-60 + 12q2 + q5 + 60)(39 - 351 - 154 + 11 - 329). -784q5 - 9408q*2 Expand (-8b + 8b - 5b)(0 - 2 + 3)(8b + 7b + 6b). -105b*2 Expand (-l - 8l*2 + 2l*4 - 33884210l*3 + 33884210l*3)(-l + 0 + 0). -2l5 + 8l3 + l2 Expand -41 + 34 + 0s4 - 3s*4 + (-1 + 1 + 2s)(18s*3 - 7s*2 + 7s*2). 33s*4 - 7 Expand (0 - 3 + 2)((30 + 1 + 74)(-m + 0m + 3m) + 3 - 2 - 6 + 2m). -212m + 5 Expand -2p - p*2 + 2p + (5p - 6p - p)(-2p + 6p - 3p)(918 + 623 - 2636). 2189p*2 Expand (-651 + 714 - 924 - 1443 - 389)(-4 + 4 + 2n)(-2 + 0 + 6). -21544n Expand (-3v + 8v + 0v + (2v - v + 3v)(-4 + 2 + 0))(3 - 1 - 5)(1 + 0 - 3). -18v
(354/472)/((-63)/4) -1/21 Calculate (20/42)/(-5)(-5)/307. 1/9 What is (-54)/22525/(-15)-5? -2 Evaluate (1/11)/(161/1771). 1 Calculate (-2)/(-22)(-35)/(-3780)-99. -1/12 What is (3792/(-79))/(-96)12/25? 6/25 What is (24/(-72))/((-8)/(-6))-3? 3/4 What is -2((-2)/(-30)-5)/((-4)/(-6))? 1 Calculate ((-1)/((-3)/(-12)))/7. -4/7 Calculate ((-3)/(12/40))/(-663/27). 5/7 Calculate (-142/(-3))/(-2)1. -7 Evaluate (24/192)/((2/(-4))/((-20)/25)). 1/5 (-161)/1617/4 -7/4 -26(19/(-342))/((6/(-6))/3) -13/3 What is the value of (-18)/(-12)(-3)/18-8? 2 What is the value of 17/((-51)/10)32/(-4)? 5 Evaluate -17(-14)/8330(-5)/3. -1/21 What is the value of (-8304)/(-1211)1/6? 8/7 Evaluate (-1-4(-9)/12)/((-247)/38). 6/13 (((-48)/180)/((-26)/5))/(6/18) 2/13 What is (-795)/(-212)2/24(-296)/(-1110)? 1/12 What is the value of (139/((-4170)/(-108)))/(4/(-30))? -27 What is (52/13)/((-26)/65)? -10 Evaluate ((-2)/(4/(-3)))/(133/266). 3 (-1233)/(-1370)8/18 2/5 Calculate 12/(((-6)/(-7))/((-162)/(-252))). 9 Evaluate ((23408/(-4620))/(6/15))/(4/6). -19 What is 4/(12/9)(-1140)/342? -10 6/8(-5)/(-45)18 3/2 What is the value of ((-1785)/68)/(-35)-8(-2)/2? 6 ((-4)/608)/((-50)/400) 1/19 What is (-258)/43(-9)/(81/15)? 10 ((-11)/((-165)/20))/((16/9)/8) 6 What is 7/((-28)/(-2)(-42)/(-168))? 2 What is 1/121470/147? 5/6 What is 8994/(-1499)16/54? -16/9 Evaluate -615/100(-180)/7212. 27 What is -2-25(-7)/(-70)-3? -15 ((-8)/(-360))/(-1)(288/56)/6 -2/105 What is the value of 36/(-63)(-13)/(936/27)? 3/14 What is (28/17855)/(((-98)/(-21))/7)? 2/17 ((35/(-6))/7)/(((-121)/(-22))/(-11)) 5/3 (4/(-9)(-197)/788)/((-2)/8) -4/9 Evaluate (4/(-12))/((-10)/616/48). 3/5 (462/(-99))/(((-8)/2)/(-12)) -14 What is the value of -3((-510)/357)/((-9)/(-21))? 10 ((-12)/((-17)/(170/(-20))))/((-26)/39) 9 Calculate 4((-321)/(-214))/((-1)/((-2)/(-3))). -4 What is the value of (-84)/(-10)(-5000)/1500? -28 Evaluate (-1652)/590(-5)/(-1). -14 Evaluate ((-3)/((-105)/4))/((-204)/238). -2/15 Calculate (-460)/46(-3)/(-18). -5/3 Evaluate 6(-20)/((-3360)/196). 7 Calculate (-23/18)/(84/1512). -6 (5/1)/1201/2050 2/41 -7(81/42)/(-9)(-1804)/(-123) 22 2880/80040/(-6) -24 What is the value of ((-9)/(-6))/((279/(-2))/(-31))? 1/3 Evaluate 4/158190/(-520). -21/5 What is ((-7)/21)/(20/(-12)(-2)/4)? -2/5 What is ((-126)/294)/(12/(-56))? 2 Calculate (-291)/(-776)48/(-9). -2 What is the value of 252/126(-4)/56? -1/7 960/(-360)(-2)/32 1/6 What is the value of ((-144)/1083/(-8)-1)/(-2)? 1/4 (-140)/(-2)(-645)/2150 -21 What is the value of -41(-605)/(-605)? -4 (-24)/(-27)4785/(-1276) -10/3 What is (-1)/(11(-11)/11)? 1/11 What is the value of 6((-825)/198)/((-10)/6)? 15 Calculate (12/6)/(133/(-266)). -4 Evaluate (-15)/5(-4)/(-10)5. -6 What is the value of (-799)/(-47)(42/(-7))/6? -17 ((-2)/(-1)(-4)/(-8))/(1449/2898) 2 ((1152/54)/(-64))/(1/(-57)) 19 Evaluate 1/1(7224/72)/(-43). -7/3 Calculate (-4)/((188/5)/((-92)/(-230))). -2/47 Evaluate -230/(-40)40/(-24). -5/2 Calculate ((-4563)/(-845))/((-9)/15). -9 What is the value of 6/(-18)-40(-48)/(-40)? 16 Evaluate 30/(690/(-23))(-14)/(-2). -7 Calculate (6/(-6))/((-8)/(-80)). -10 Calculate ((-10)/(-18))/((-5)/45). -5 What is ((-42)/15)/((2/(-15))/((-50)/675))? -14/9 Evaluate (682/(-341))/(((-9)/102)/(6/8)). 17 What is 13651/7803(63/(-2))/(-1)? 28 (-142)/(-2343)(18/12)/(-1) -1/11 Calculate ((-2)/((-24)/63))/((-15)/40). -14 Evaluate 850/(-1190)((-6)/(-5))/(-1). 6/7 ((-135)/(-6))/(-3)(-84)/(-60)-2 21 11760/1400(-45)/21 -18 What is the value of ((-14)/(-5))/((-13)/390-21)? 4 What is the value of (32/90)/((117/130)/3)? 2/9 What is the value of -15(-1)/(-15)7/1? -7 Calculate ((-378)/(-90))/(30/(-100)). -14 Evaluate 2009/57444/14. 11 Evaluate -1(759/92)/1120/(-18). 5/6 What is 5-1(-6)/(-6)20/75? -4/3 Evaluate -1412/2856-85. 5 (8/(-30))/(3/9)48/96 -2/5 Calculate 22/5684/154. 3/14 What is the value of (42/4)/((-130)/13)345/(-207)? 7/4 Calculate 1/((-22)/(-7))(-8124)/14217. -2/11 What is the value of (((-54)/324)/(10/4))/(4/(-10))? 1/6 ((-70)/35)/((-8)/10)(-108)/10 -27 What is (88/18)/((-236)/1062)? -22 Calculate ((-66)/(-22))/(-9(-5)/120). 8 What is (7/(-42))/((-204)/7344)? 6 (288/192)/(87/2)-2 -2/29 What is the value of (36/8)/((-13)/(13/(-3)))? 3/2 Calculate -12(-12)/792(-1)/(-2). 1/11 ((-2)/(-12))/((636/(-1872))/(-53)) 26 Evaluate 33((-12)/(-30))/(18/15). 11 What is the value of 32/(-27)-29/2? 2 Calculate ((-22500)/4125)/(10/(-44)). 24 Calculate (12/27015)/(((-24)/(-117))/4). 13 What is the value of (-100)/(-30)1545/(-206)? -25 What is the value of (37/(999/(-9)))/((-3)/((-459)/12))? -17/4 Evaluate (-5(-198)/(-385))/(69/(-7)). 6/23 Evaluate -2(-120)/(-18)(-417)/1112. 5 Calculate 0/2(-11)/(-44). 0 Evaluate ((-12)/2973)/((-10)/45-3). -2/11 (47/(-987))/((-5)/(-3885)) -37 (25/15)/((-55)/661) -2 Evaluate -2(-65)/(-50)5. -13 Evaluate (((-1292)/95)/(-17))/(182/(-525)). -30/13 Evaluate (-28)/(-3024)-121. -1/9 Evaluate 11/612789/(-34104). -1/16 Evaluate 16(-244)/8547/(-3). 4 What is ((150/660)/((-10)/(-33)))/(9/(-12))? -1 What is the value of (320/(-6))/40(-3)/22? 2/11 Calculate ((-56)/21)/(-1)(165/10)/11. 4 Evaluate (1935/1720)/((-4)/96). -27 (52/38)/(1458/4617) 13/3 Calculate (((-30)/328)/(-5))/(1782/(-4752)). -2/41 ((-69)/161)/((-108)/(-56)) -2/9 Evaluate (27/117)/((-140)/455). -3/4 What is ((-3)/(-6))/((-31)/(-434))? 7 What is the value of (864/(-324)(-18)/(-8))/7? -6/7 What is (258/43-3)/(13-3)? 6/13 (1/8)/(346/(-5536)) -2 14(-34)/595-5 4 Calculate 17/272602(-6)/(-15). 3 ((1764/18)/(-49))/(4/6) -3 (-9189)/40841/(2-3) 3/8 Evaluate (-18(-28)/3528)/(4/(-7)). -1/4 Calculate 7(-1)/2-1460/230. 7 What is the value of (-184)/(-115)(-15)/(-228)? 2/19 What is the value of (-336)/9618/(-945)(-20)/6? -2/9 Evaluate (-5)/30(-18)/(-672)16. -1/14 Evaluate ((9/(-5))/1)/((416/(-65))/(-32)). -9 (-429)/48196/(-1584) 2/37 Calculate (8100/1296)/(10/8). 5 Evaluate (-61)/2448/141. -1/7 Evaluate (21/(-126))/((1/18)/(2/(-57))). 2/19 What is the value of (1149/(-24512))/(1/(-16)2)? 3/8 What is (168/21)/24(-300)/4? -25 Evaluate 35/(945/18)4/(12/45). 10 Calculate (-669)/(-4237)(3/1)/(-9). -1/19 What is the value of 5629/(-866)36/(-507)? 6/13 Evaluate 16/1000-5150/(-40). 3/10 What is ((-236)/(-59))/((-42)/3)? -2/7 What is (-3)/(-2)58/(-783)99? -11 What is (25)/2(-814)/(-2442)? 5/3 What is ((-4)/3)/(4/(-74))1413/(-942)? -37 ((-518)/(-2849))/(3/(-11)) -2/3 What is (2800/20)/(-7)3/21? -20/7 What is ((-40)/(-56))/((-260)/(-28))? 1/13 (18/(-84))/(60/(-120)) 3/7 ((-6)/2)/(40(-64)/3840) 9/2 Calculate ((-160)/(-200))/((-6)/90). -12 Evaluate (437/230)/192. 1/5 Calculate -4(56/8)/(-14)(-4)/88. -1/11 (11/(275/(-30)))/((-5)/((-30)/12)) -3/5 What is (3/188)/(-9(-59)/(-1416))? -2/47 What is the value of (-2)/((-72)/(24/4))(-20)/30? -1/9 What is (-38)/(-4)115/(133285/732)? 6 What is ((-1)/10)/((85/(-204))/((-30)/18))? -2/5 Evaluate 2/8(-4576)/4004. -2/7 Calculate 60/(-14)(-3507)/2004(-8)/5. -12 Calculate 1/((-14)/2016-12). 12 Calculate (-4)/16(-224)/70. 4/5 What is the value of 32/(-48)24/(-2)? 8 What is the value of 28/(-6)1296/(-1512)? 4 What is the value of 2/21(-16)/(-32)-10? -5 Calculate (-6)/((21/10)/(-7))-1. -20 What is (-5)/15120/220? -2/11 What is ((-7)/((-49)/6))/(3(-56)/84)? -3/7 Calculate 56/(2576/230)2/5. 2 Evaluate (1633/(-4899))/(((-17)/(-3))/(1/(-1))). 1/17 What is the value of ((-2)/22)/(((-29848)/(-572))/(-41))? 1/14 What is the value of 11596/456(-34)/7? -17 Evaluate ((-10)/4)/1(-1064)/(-11970). -2/9 Calculate (2535/780)/((-104)/(-64)). 2 Evaluate ((-1)/(-1))/(15/270-3). -6 What is (8/24)/(((-65)/30)/(-1))? 2/13 Calculate (-210)/525(-12)/2. 12/5 ((-28)/56)/((-99)/(-18)) -1/11 What is the value of ((-2)/(50/(-7)))/(375/3750)? 14/5 What is the value of (5/95)/((-22)/44)? -2/19 Calculate -125/8024/3. -6 Calculate ((-756)/882(-14)/(-33))/((-2)/11). 2 Evaluate (982/491)/((2/(-3)-2)/(-2)). -3 What is the value of (20/6(-774)/215)/((-6)/8)? 16 What is the value of ((-3)/27-3)/((-22)/528-124)? 2/31 (-2)/(-1)(-1055)/4228/(-10) 4 What is (-14)/610/12648/720? -7/4 Calculate 2/4-50(-434)/(-1085). -10 Calculate ((5412/(-352))/123)/(23/8). -1/6 Evaluate 120/25120/48. 12 What is the value of ((-348)/(-783))/((-2)/18)? -4 Calculate -2386/86(-1)/2. 3 What is 4/(-68)(-26)/(-4)30/65? -3/17 What is the value of (6480/(-64))/272/(-50)? 3/20 What is -22(-2)/(-5)85/68? -11 What is the value of (-10)/((-10)/(-4)(-14)/70)? 20 1/((-6)/4)6129/6810 -3/5 Calculate (15/60)/((-34)/322). -2/17 What is 1332/(-34632)8/(-6)*-3? -2/13 Calculate ((-39)/(-2))/(1935/1290). 13 Calculate ((12/9)/4)/((266/378)/(-19)). -9
Let j = 212.1 - 232. Let w = 20 + j. What is the second biggest value in -0.2, w, -4, -0.3? -0.2 Let d = -3.08 + -18.92. What is the third smallest value in -5, 2/11, d? 2/11 Let h be (-8)/14 + (-646)/(-714). What is the smallest value in h, 26, 4? h Let t be 6/(-130) + 12/(-78). Let c = -13 + 12.5. What is the second biggest value in t, c, 0.3? t Let r = 0.289 - -1.711. What is the fourth biggest value in 8, -3, r, 0? -3 Let u = -0.58 - -0.6. Let l = -0.08 - u. Let i = 0.6 + l. Which is the second smallest value? (a) i (b) 3 (c) 5 b Let d = -4.3 + -0.7. Let n = 112 - 110. Which is the biggest value? (a) n (b) d (c) 3 c Let q = 2801/4685 - -2/937. Which is the second smallest value? (a) 84 (b) q (c) -1/4 b Let k = -67 + 68.2. Let t = k + -6.2. Which is the third smallest value? (a) -2 (b) 3 (c) t b Let n = -5.6 + 6. Let d = -978 + 978.1. Let s = n + d. Which is the third smallest value? (a) 3 (b) s (c) 5 c Let q = 0.25 + 1.85. Let g = -0.1 + q. Which is the biggest value? (a) g (b) 0.3 (c) -2/3 a Let f = 1 - 3. Let z be (-9)/(-18)(-3 + (-35)/(-15)). Which is the third biggest value? (a) 3/4 (b) f (c) z (d) -0.5 d Let k = -8 + 22. Let g = k - 13.8. Let d = 0.5 - -3.5. What is the smallest value in d, 2/11, g? 2/11 Let u = -0.6 - -16.6. Let f = -19 + u. Let y be -3 - ((-7)/8 + -2). Which is the smallest value? (a) y (b) f (c) 1 b Let j be 1 + (-493)/651 + 6/(-21). Let f = 230/1023 + j. Which is the biggest value? (a) 0 (b) f (c) -3 (d) 1/2 d Let x be 16/4 + -2 - -3. Suppose -xt = 3d - 4, 12 = 5d - d. Let m be (15/(-3))/(t + 0). Which is the smallest value? (a) -3 (b) m (c) 0 a Let q = 5 - 11. Let l = q - -4. Let i(k) = -k*2 + 30k - 200. Let j be i(10). What is the second biggest value in l, 1, j? j Let s = -12010 + 12011. Let n = -4 - -3. Which is the biggest value? (a) s (b) -4 (c) n (d) -2/11 a Let i = -2413.96 + 2414. What is the smallest value in 1/3, 6, i, -1/3? -1/3 Let k = -12.961 + -0.039. What is the second biggest value in k, 0.4, 2/7? 2/7 Let k = 12 + -14. Let m = 7 + k. Let j = -4.01 - -0.01. What is the smallest value in m, -3/8, j? j Let q = -18 + 20. Let v = 0.33 + 0.17. Let c be 10/(-4)16/(-10). What is the third smallest value in q, c, v? c Let n = -16.2 - -16.7. Which is the fourth biggest value? (a) -3 (b) 2/7 (c) n (d) -1/6 a Let t = -5.0589 - -0.0589. Which is the third smallest value? (a) -2/43 (b) 8 (c) 4 (d) t c Let t = -209/157 + 135592/1727. Suppose -2k + 5k = -2p + 231, 0 = -p. Let w = t - k. What is the smallest value in 0.2, w, 2? w Let i = -154 - -159. Let n = -14041985/5389882 + -2/141839. Let o = 5/2 + n. What is the second biggest value in 3, i, o? 3 Let r = 0.092 - 2.092. Suppose 5l = -5w - 1 + 6, -3w - l = -9. What is the biggest value in r, w, -5? w Let m = 55/58 + -13/29. What is the third biggest value in m, 4, 2/63, -3? 2/63 Let i = -27/2 - -55/4. Let t = -0.0792 - -0.4792. What is the biggest value in t, i, -4? t Let g be 0 + 0 + (-1)/3. Let h = 120 - 190. Let k be -2 - (-240)/h(-4)/6. What is the biggest value in g, k, 2/3? 2/3 Let u = 3 + -2.9. Let y be 205/22-12 + 3. Let p = -109 - y. Which is the second smallest value? (a) p (b) 0.03 (c) u b Let q = 477 - 475. Which is the second smallest value? (a) 0.3 (b) -4 (c) 2/7 (d) q c Let f = 0.91 + -0.985. Let w = 4.675 + f. Which is the second biggest value? (a) -3 (b) w (c) -1 c Let f = 5.8 + -9.8. Let d = 9 + -7. Suppose 3w - w = d. Which is the second biggest value? (a) -2/9 (b) w (c) f a Let a be (-2)/66/8. What is the fourth biggest value in a, 7, 1, 6? a Suppose 8 = -4u, 2l - l - 33 = 3u. Let o be 0 + 4/(-3)l/45. Which is the smallest value? (a) 2/11 (b) o (c) -0.4 (d) -1/8 b Let y(n) = -3n*2 - 6n - 8. Let w be y(-4). Let v be (-8)/w - 13/4. Let d = -25 + 24.8. Which is the third biggest value? (a) d (b) v (c) 1 b Let d = -2798 - -2800.031. Let i = -0.031 + d. What is the third biggest value in 0, i, -0.4? -0.4 Let q be (-3)/((-57)/(-2)) + 3965/(-17385). What is the third biggest value in q, 14, 5? q Let u be (-19)/(-4) + (-4)/(-16). Let j be (-20)/1301/6. Which is the smallest value? (a) 3 (b) j (c) u b Let p be 36/(-4) - 158/(-18). What is the third biggest value in 0.4, -7/4, p, 0.2? p Suppose -g - 11 = -5y, -3g = -3y + 11 - 2. Let i = 3 - 3.1. Let w be -1(-4)/(12/(-21)). Which is the biggest value? (a) w (b) g (c) i c Let u = -95 - -41. Let s = u + 53.8. Which is the second biggest value? (a) 1 (b) -0.1 (c) s b Let n = 0.01 + -2.01. Suppose -4h = -5h - z + 5, -5h = -2z - 46. What is the third biggest value in -3, n, h? -3 Let q = -212 + 207. What is the biggest value in 1/2, q, -1/4, -1? 1/2 Let h be 3/(-4)1/(-3). Let l = -23.08 + 23. Let d = l - -0.18. Which is the second smallest value? (a) h (b) -1 (c) d c Suppose 5j - 36 - 14 = 0. Let i be j(-3)/(-36)8/(-30). What is the second biggest value in i, -0.07, 0.2, -1? -0.07 Let f = 0.9 + -1. Suppose s = 3s - 18. Suppose 0 = -2r - 5p + 3p - 14, -r - 2p = s. Which is the third biggest value? (a) r (b) 4 (c) f a Let t(i) = 10i + 165. Let m be t(-16). Which is the smallest value? (a) -18 (b) m (c) -0.3 a Suppose -d - 6 - 13 = 3t, 4t + 32 = 2d. Let x be 3/6 + 7/(-2). Let p = x - 1. What is the third biggest value in t, -0.1, p? t Let n be -2(-28)/(-6)(-3)/(-2). Which is the biggest value? (a) n (b) -2 (c) -0.2 c Let h(g) = -2g - 1. Let s be h(2). Let m = 9 - -11. Let w = m - 27. What is the third smallest value in w, -2, s? -2 Let k(l) = l2 - 17l + 61. Let u be k(12). Which is the third smallest value? (a) -20 (b) -2/9 (c) u c Let l be (-9)/(-35) - 34/85. Which is the third biggest value? (a) -30 (b) 0 (c) l a Let q = 20/11 - 89/55. Let d = 5.18 + -2.18. What is the third smallest value in 2, q, d? d Let c be 27/(-36)(-314)/(-3). Let j = c + 77. Let n(u) = u2 + 19u + 17. Let p be n(-18). What is the second biggest value in j, -4, p? j Let r = 2.1 + -1.1. Suppose -5z = 4j - 20, -16 = -0j + j - 4z. Suppose 4h + 3 + 1 = j. What is the biggest value in -3, h, r? r Let y(g) = -g3 + 9g*2 - 16g - 5. Let k be y(6). What is the smallest value in -2/9, -3, k, 0.1? -3 Let y = -2 - -1.5. Let a = -1898 + 1891. What is the second biggest value in -5/2, a, y? -5/2 Let q = 233/351 - -1/351. Which is the biggest value? (a) q (b) -0.4 (c) -4 a Let d = 3.6 - 4. Let z(w) = -w*2 + 10w - 63. Let p be z(13). Let a = -99 - p. What is the second smallest value in a, d, -2? d Suppose 66 = 6i - 3i. Let s = i - 19. Let f be 2/8 + s/(-6). Which is the second smallest value? (a) -0.4 (b) -2 (c) f a Let j be 6/21 + (-78)/(-21). Suppose 2 = -5b + jb. What is the biggest value in b, 2/3, 0? 2/3 Let u = -0.23 - 13.77. Let o = 0.06 - 28.06. Let z = u - o. What is the third smallest value in z, 2, -0.1? z Let v = 4/105 + 2/21. Let f = -2713 - -2713. What is the biggest value in f, 1, 0.3, v? 1 Let v be ((-4)/28)/((-4)/(-8)). Let t be ((-3)/45)/(8/20). What is the biggest value in -0.2, t, v? t Suppose 6x + 1560 = 18x. Which is the third smallest value? (a) x (b) -1 (c) -4 a Let o = -13.7 + 10.82. Let n = o + -0.12. Let b = 3.5 + n. What is the second smallest value in b, 3, 4? 3 Let n = -7 - -16. Let q = 253 - 257. Which is the second biggest value? (a) q (b) n (c) 0.2 c Let s be (7 - (-7)/((-224)/312)) + 3. Which is the smallest value? (a) -1/14 (b) 5 (c) s (d) -4 d Let y = 35 + -35.26. Let j = y + -0.24. Which is the second smallest value? (a) -3 (b) j (c) 3/2 (d) 4 b Let u = -2 + 8. Let d be (-15)/(-12)u/(-10). Let p = 2731 + -2732. What is the smallest value in p, d, 2? p Let f = 11.7 - -0.3. Let k = -13.07 + 8.07. What is the third biggest value in -1/8, f, k? k Let q = -2.05 + 6.05. Which is the smallest value? (a) -0.13 (b) q (c) -2 (d) 5 c Let p be (214/8025)/(1/(-5)). Which is the fourth biggest value? (a) 3 (b) p (c) 3/5 (d) -11 d Let m = 0.1371 - -2.8629. Suppose 38 = 5w - 1447. Let f = w + -2075/7. Which is the second smallest value? (a) f (b) 0.12 (c) m a Let h = -0.01 - -4.01. Let r = 50 - 52. Let x be r1(-2)/(-4). Which is the biggest value? (a) 2/7 (b) x (c) h c Let y = -1943.9 - -1944. Which is the second smallest value? (a) 0.5 (b) -1/11 (c) y c Suppose 0s - 26 = s - h, 3s - 2*h = -73. Which is the biggest value? (a) 3 (b) s (c) 4 c Let b = 16.8 - 17.8. What is the smallest value in -5, b, 0.9? -5
Let h(y) = y*3 + 4y*2 + 3y + 3. Let i be h(-3). Suppose -ik + 10 = -k. Suppose 2a - 16 = -3g + 7a, -kg + 80 = 5a. List the prime factors of g. 2, 3 Let f = 5 - 4. Let c = f + 4. List the prime factors of c. 5 Let u = 20 - -2. What are the prime factors of u? 2, 11 Let f(h) = h2. Let t(l) be the second derivative of l4/6 + 5l3/6 + 3l*2/2 + 2l. Let p(j) = -3f(j) + t(j). List the prime factors of p(4). 7 Let s be (-11)/(-4) - (-2)/8. Suppose sw = -c + 62 + 40, -4w + 136 = 5c. What are the prime factors of w? 2, 17 Suppose 0t + 20 = 4t. Suppose -77 + 17 = -tz. Suppose 4l = z - 0. List the prime factors of l. 3 Suppose -3r + 15 = 3f + 81, -5r + f - 80 = 0. Let o = 30 + r. What are the prime factors of o? 13 Let x = 12 - 8. Suppose a + 37 = 5t + 2a, -2a + 32 = xt. List the prime factors of t. 7 Suppose -14 = -j - 1. What are the prime factors of j? 13 Let d(z) = z2 - 7z + 1 + 1 + 4z. Let u be d(4). Suppose -u = w - 3w. List the prime factors of w. 3 Let o(x) = -x*3 + 9x*2 - 27. List the prime factors of o(7). 71 Suppose r = 2m - 6, 5r + 0r = -5m + 45. Suppose -mt + 72 = t. List the prime factors of t. 2, 3 Let x(p) = p + 42. What are the prime factors of x(-19)? 23 Let s = 0 + 3. Suppose sd - 104 = -5j, -j + d + d + 13 = 0. What are the prime factors of j? 19 Let k = 997 + -690. What are the prime factors of k? 307 Let k = -18 + 18. Suppose kc = 5c - 190. List the prime factors of c. 2, 19 Let o = 18 - 31. Suppose -5k - 6 - 38 = -l, -4l = -16. Let m = k - o. List the prime factors of m. 5 Suppose 2i = v + 2, 5i + 5v - 17 - 3 = 0. Let k = 4 - i. What are the prime factors of k? 2 Let i = 83 - 60. List the prime factors of i. 23 Suppose 4s + 4 = 5u, s = 4u - 4 - 8. Let j = s - 2. Suppose -jt + 4 = -0t. What are the prime factors of t? 2 Let y be (-3)/3(5 - 8). Suppose 2q - 2a = -0q + 48, 3q = -3a + 90. Suppose 3d - yc = q, c + 0 = -2d + 24. List the prime factors of d. 11 Let v(n) = -3n - 8. Suppose -5i = 3k + 18, 0 = -2k - 3i - 2i - 12. Let r be v(k). Suppose -4t = -5t + r. List the prime factors of t. 2, 5 Let g(x) = -8x - 4. List the prime factors of g(-6). 2, 11 Suppose -20 = -2a + 4l, 6a - a + 2l = -10. Suppose 25 = 5z, a = 4p + 2z - 6 - 0. List the prime factors of p + (-1)/1 + 6. 2 What are the prime factors of 12/(-42) - 424/(-14)? 2, 3, 5 Suppose 3d + 0a = a + 8, 0 = 5d - 2a - 12. What are the prime factors of d? 2 Suppose -12 = -4v, -p + 1 - 2 = -3v. Let y(a) = a2 - 8a + 12. List the prime factors of y(p). 2, 3 Let i = 0 - -2. Let p be ((-5)/(-15))/(i/(-6)). List the prime factors of (-8)/p + -1 + 0. 7 Let b be 90/4(-16)/(-10). Suppose s = -2s - b. List the prime factors of (38/3)/((-8)/s). 19 Suppose -144 = -4t - 3u - u, 0 = 2t + u - 77. List the prime factors of t. 41 What are the prime factors of 13/(-104) + 994/16? 2, 31 Let d = 38 + -20. What are the prime factors of d? 2, 3 Let q(o) be the first derivative of o4/4 - o2/2 + 15o - 1. Suppose -4w = 3t + 6, 5w + 4t = -1 - 7. What are the prime factors of q(w)? 3, 5 Let v = 1 - -13. Let j = 25 - v. List the prime factors of j. 11 Let u(a) = -3a - 5. Let j be u(-7). Let i = -5 + j. List the prime factors of i. 11 Suppose 5y - 5p = -p + 481, y - 2p - 95 = 0. List the prime factors of y. 97 Suppose -2q - 5l = -9, 2l - l + 90 = 5q. List the prime factors of q. 17 Let g be (-2 - (0 + 2)) + 2. Let h be ((-67)/2)/(g/4). What are the prime factors of 2/(-5) - h/(-5)? 13 Suppose 11k - 240 = 3k. List the prime factors of k. 2, 3, 5 Suppose -8 = 2p - 2. List the prime factors of p/(9/6) + 51. 7 Suppose -115 = -v + k + 17, 4v + k = 538. What are the prime factors of v? 2, 67 Suppose -g = -3m - 18, -6m - 12 = g - 3m. Suppose -gd = -15, 40 = -p + 6p - 5d. List the prime factors of p. 13 Suppose 24 = -3q - 24. Let y = -1 - q. Suppose 5o = 4o + y. List the prime factors of o. 3, 5 Let s(u) = u3 + 5u*2 - 8u + 4. Let i(b) = -2b3 - 10b*2 + 17b - 8. Let j(d) = 6i(d) + 13s(d). What are the prime factors of j(-4)? 2, 7 List the prime factors of 0 + 67 + -2 + 3/1. 2, 17 Let y(s) = s*2 - 6s. Let u be y(10). Suppose 0 = k - u - 9. List the prime factors of k. 7 Let m(v) = 6v3 - v2 - 4v - 4. Let o(j) = 7j3 - j2 - 3j - 3. Let n(p) = 4m(p) - 5o(p). Let s be n(-1). What are the prime factors of (-4)/s + 19/3? 2, 3 Suppose -k = 2o - 67, -4o - 210 = -3k - o. What are the prime factors of k? 3, 23 Let p be 13/3 + (-2)/(-3). Suppose 5x + b = 5 + 5, 4x - 22 = 2b. Let t = p + x. List the prime factors of t. 2 Suppose y - 5x + 7 = -3, y + 5x = 10. Suppose 0b + 2b - 50 = y. Let w = b - 14. List the prime factors of w. 11 Suppose 0 = 5m + 3o - 0o - 27, -m = -4o + 13. Suppose 27 = mu - 24. List the prime factors of u. 17 List the prime factors of 2 - (4/12 - 284/6). 7 Let o(z) = 4z*2 - 1. Let w be o(-1). Suppose 3 + 15 = wy. Suppose 0 = -2f + 4t, 0 = 3f - yf + 3t + 6. List the prime factors of f. 2 Let c(u) = u3 - u2 + 4u - 3. Let b = -8 - -10. List the prime factors of c(b). 3 Let a be 2 + (-12 + -2)/(-2). Suppose 2q - 7 - a = 0. Suppose 4z - q - 24 = 0. What are the prime factors of z? 2 Let w(u) = u*2 - 1. Let i(t) = 2t*2 + t - 9. Let z(x) = i(x) - 3w(x). Let m be z(0). List the prime factors of -22(15/m + 2). 11 Suppose 0 = -4m - m. Let p = -2 + m. Let r(d) = -d*3 - 2d*2 - 2d. List the prime factors of r(p). 2 Let q(k) = -k*2 - 9k + 3. Let c be 3/(13/(-9)). List the prime factors of q(c). 3 Let t(l) = -l. Let q = 5 + 0. Suppose 2y = -4m + 8, qm - 21 = y + 2m. What are the prime factors of t(y)? 2, 3 Let v(g) = -4 + 7 - g - 3g + 2g2. List the prime factors of v(4). 19 List the prime factors of ((-519)/9 - -1)(-6)/5. 2, 17 Suppose -d - 2d - q = -3, -5d + 2q - 6 = 0. Let l(a) be the first derivative of -a2/2 + 6a + 1. What are the prime factors of l(d)? 2, 3 Let o(d) = d. Let g be o(3). Suppose -x + g + 0 = 0. Suppose 0 = 2r + x - 7. What are the prime factors of r? 2 Let z(a) = a + 4. List the prime factors of z(2). 2, 3 What are the prime factors of -50((-1)/2)/1? 5 What are the prime factors of 1/((12/100)/3)? 5 Let s(g) = g*2 + 5g - 15. What are the prime factors of s(-8)? 3 Let p(b) = b. Suppose -20 = -6f + 2f. List the prime factors of p(f). 5 Suppose 25o = 161 + 564. List the prime factors of o. 29 Let s = 22 + -14. What are the prime factors of s? 2 Let q = -67 + 165. What are the prime factors of q? 2, 7 Let s(d) = -d2 + 13d - 6. What are the prime factors of s(8)? 2, 17 Suppose -21 - 15 = -4r. Let w(p) = p + 11. Let f be w(-5). Let k = f + r. List the prime factors of k. 3, 5 Let n(t) = -t2 - 10t - 3. Let h be n(-4). Let v be (-8)/(-4) - h/1. Let b = -12 - v. List the prime factors of b. 7 What are the prime factors of -6 + (-4)/(-12)1191? 17, 23 Let n(d) = -2d + 1. Let a be n(2). Let k be 16(-2)/a. List the prime factors of 9/63k. 2, 3 Let i = -4 - -4. Suppose t + 3h + 25 = i, 7t = 3t - 4h - 60. What are the prime factors of 3-2t/12? 5 Suppose -2v - 3v + 15 = 0. Let u(a) = 3a + 0 - 3a*2 + 4a*2 + v. List the prime factors of u(-4). 7 Suppose -2k + 3f = 88, 5k - 3f = -2f - 246. Let j = 83 + k. What are the prime factors of j? 3, 11 What are the prime factors of 29416/120 + (-2)/15? 5, 7 Suppose 3f + 33 = 3r, -2r - 2r = 12. Let y = -35 + 30. List the prime factors of (y/2)/5f. 7 Let b = -76 + 124. Suppose -v - v = -b. What are the prime factors of v? 2, 3 Suppose 0 = -j + 5 - 2. Suppose jy = -2y + 85. Suppose 47 - y = 3x. What are the prime factors of x? 2, 5 Let r(u) = 3u2 + 4u - 4. Let f be r(-4). Let d = f + -20. List the prime factors of d. 2 Let c(v) = v*3 + 9v*2 + 9v + 1. List the prime factors of c(-3). 2, 7 Let u be (-4)/14 - (-32)/14. Let g(p) = 5p + 5p*2 - 6 + 2 + up - p3. List the prime factors of g(6). 2 List the prime factors of 23 + (-5)/((-20)/16). 3 Let y(i) = i3 - 2i2 - 4i + 1. Let x be y(3). Let t = 0 - x. List the prime factors of t. 2 Let j(b) = -6b2 - b + 30. What are the prime factors of j(0)? 2, 3, 5 Let g = -3 + 21. Let q be 48/g - (-1)/3. Suppose -12 = l + ql, -l = 2r - 31. List the prime factors of r. 17 Let h = 7 + -14. Let m(j) = j2 + 5j + 3. What are the prime factors of m(h)? 17 Let v(q) = -5q - 12. List the prime factors of v(-6). 2, 3 Suppose 0 = -29q + 35*q - 234. What are the prime factors of q? 3, 13
What is the x'th term of 6215, 12427, 18641, 24857, 31075, 37295, 43517? x*2 + 6209x + 5 What is the q'th term of 1268, 2642, 4014, 5384, 6752, 8118, 9482? -q*2 + 1377q - 108 What is the i'th term of 650, 1679, 3394, 5795, 8882, 12655? 343i2 + 307 What is the u'th term of -426, -343, -254, -159, -58? 3u*2 + 74u - 503 What is the m'th term of -25085, -50236, -75377, -100502, -125605, -150680, -175721, -200722? m3 - m2 - 25155m + 70 What is the h'th term of -340, -648, -1154, -1852, -2736, -3800? h3 - 105h2 - 236 What is the d'th term of 69704, 69709, 69716, 69725, 69736? d2 + 2d + 69701 What is the x'th term of 7048, 7050, 7052, 7054, 7056? 2x + 7046 What is the q'th term of 9491, 18989, 28475, 37943, 47387? -q*3 + 9505q - 13 What is the c'th term of 149, -335, -819? -484c + 633 What is the b'th term of 74571, 74572, 74573, 74574? b + 74570 What is the u'th term of 3020, 6037, 9054, 12071? 3017u + 3 What is the a'th term of 380097, 760187, 1140261, 1520313, 1900337? -a*3 - 2a*2 + 380103a - 3 What is the t'th term of -1059, -2018, -2977, -3936? -959t - 100 What is the q'th term of 1042, 4181, 9394, 16675, 26018, 37417? -q3 + 1043q*2 + 17q - 17 What is the o'th term of 54, 89, 182, 363, 662, 1109? 5o3 - o2 + 3o + 47 What is the s'th term of 0, 133, 266, 399? 133s - 133 What is the n'th term of 295, 721, 1147, 1573? 426n - 131 What is the a'th term of -5933, -11883, -17833? -5950a + 17 What is the v'th term of -71571, -143144, -214717? -71573v + 2 What is the y'th term of 2110, 4196, 6284, 8374, 10466, 12560, 14656? y*2 + 2083y + 26 What is the f'th term of -6, -25, -82, -183, -334, -541, -810, -1147? -f*3 - 13f*2 + 27f - 19 What is the s'th term of 1071, 1077, 1101, 1155, 1251? 2s3 - 3s*2 + s + 1071 What is the g'th term of 6671, 6917, 7163, 7409, 7655? 246g + 6425 What is the m'th term of -168, -405, -712, -1089, -1536, -2053? -35m2 - 132m - 1 What is the w'th term of 985639, 985640, 985641, 985642, 985643, 985644? w + 985638 What is the a'th term of -43200, -43212, -43224, -43236, -43248? -12a - 43188 What is the c'th term of 18307, 36607, 54907? 18300c + 7 What is the h'th term of -1389, -1373, -1353, -1329, -1301? 2h2 + 10h - 1401 What is the q'th term of 690, 5371, 13180, 24123, 38206, 55435, 75816? q*3 + 1558q*2 - 869 What is the q'th term of -62772, -125542, -188312, -251082, -313852? -62770q - 2 What is the y'th term of -29, -224, -749, -1766, -3437, -5924, -9389, -13994? -27y3 - 3y*2 + 3y - 2 What is the h'th term of -570, -1022, -1474? -452h - 118 What is the v'th term of 11353, 22411, 33469, 44527, 55585? 11058v + 295 What is the m'th term of 316377, 316374, 316371? -3m + 316380 What is the o'th term of 687, 5785, 19595, 46467, 90751, 156797, 248955, 371575? 725o*3 + 6o*2 + 5o - 49 What is the j'th term of 581, 686, 877, 1154, 1517? 43j2 - 24j + 562 What is the q'th term of -1292, -5163, -11610, -20633, -32232? -1288q2 - 7q + 3 What is the f'th term of -53604, -53603, -53602? f - 53605 What is the p'th term of -2691, -2674, -2659, -2652, -2659, -2686, -2739, -2824? -p*3 + 5p*2 + 9p - 2704 What is the z'th term of 1408, 1413, 1418? 5z + 1403 What is the w'th term of -1325, -1418, -1669, -2156, -2957? -13w3 - w2 + w - 1312 What is the i'th term of 14280, 28546, 42812, 57078, 71344? 14266i + 14 What is the a'th term of -32338, -32342, -32356, -32386, -32438, -32518, -32632, -32786? -a3 + a2 - 32338 What is the j'th term of 69, 327, 785, 1449, 2325, 3419, 4737? j3 + 94j*2 - 31j + 5 What is the y'th term of 155, 121, 17, -193, -545, -1075, -1819? -6y3 + y2 + 5y + 155 What is the i'th term of 414, 840, 1274, 1716, 2166, 2624, 3090? 4i2 + 414i - 4 What is the y'th term of -17019, -16922, -16753, -16506, -16175, -15754, -15237, -14618? y*3 + 30y*2 - 17050 What is the h'th term of -275, -1971, -5087, -9623, -15579? -710h*2 + 434h + 1 What is the v'th term of 9746, 19420, 29032, 38588, 48094, 57556? v*3 - 37v*2 + 9778v + 4 What is the c'th term of 156, 632, 1434, 2574, 4064, 5916, 8142, 10754? 2c3 + 151c*2 + 9c - 6 What is the q'th term of 6211, 6216, 6223, 6232, 6243, 6256? q*2 + 2q + 6208 What is the b'th term of -7, -77, -207, -409, -695? -2b3 - 18b*2 - 2b + 15 What is the o'th term of 4100, 4091, 4082, 4073, 4064, 4055? -9o + 4109 What is the o'th term of -396, -1558, -3480, -6162? -380o*2 - 22o + 6 What is the m'th term of -15155, -15154, -15153? m - 15156 What is the u'th term of -221, -383, -547, -713? -u*2 - 159u - 61 What is the s'th term of 45, 77, 91, 81, 41? -s*3 - 3s*2 + 48s + 1 What is the n'th term of 631, -29, -689, -1349, -2009? -660n + 1291 What is the r'th term of -200515, -401033, -601551, -802069, -1002587, -1203105? -200518r + 3 What is the v'th term of 718, 726, 734, 742, 750? 8v + 710 What is the h'th term of 482, 489, 502, 521? 3h*2 - 2h + 481 What is the v'th term of 363, 375, 397, 435, 495, 583, 705, 867? v3 - v2 + 8v + 355 What is the p'th term of -427, -813, -1195, -1573, -1947, -2317? 2p*2 - 392p - 37 What is the p'th term of -243, -2166, -7445, -17754, -34767, -60158? -279p3 - 4p*2 + 42p - 2 What is the o'th term of 86, 369, 850, 1529? 99o2 - 14o + 1 What is the t'th term of -51215, -102428, -153651, -204890, -256151, -307440? -t3 + t2 - 51209t - 6 What is the j'th term of 218110, 436217, 654324, 872431, 1090538? 218107j + 3 What is the s'th term of 70, 175, 306, 463, 646, 855, 1090? 13s2 + 66s - 9 What is the t'th term of 11, 578, 1523, 2846, 4547? 189t2 - 178 What is the q'th term of 357164, 357162, 357160, 357158? -2q + 357166 What is the q'th term of 88411, 176857, 265303, 353749, 442195? 88446q - 35 What is the g'th term of -154, -750, -1790, -3274, -5202, -7574, -10390? -222g*2 + 70g - 2 What is the x'th term of 1134, 1785, 2424, 3045, 3642, 4209? -x*3 + 658x + 477 What is the u'th term of 3809, 7650, 11491, 15332, 19173? 3841u - 32 What is the q'th term of 389, 726, 1309, 2156, 3285? 3q*3 + 105q*2 + q + 280 What is the w'th term of 164, 538, 908, 1274? -2w*2 + 380w - 214 What is the a'th term of 3632, 3625, 3608, 3575, 3520, 3437, 3320? -a3 + a2 - 3a + 3635 What is the s'th term of -42288, -84543, -126798, -169053, -211308, -253563? -42255s - 33 What is the o'th term of 2701, 2700, 2695, 2680, 2649, 2596, 2515? -o*3 + 4o*2 - 6o + 2704 What is the w'th term of -34063, -68134, -102205, -136276? -34071w + 8 What is the x'th term of -1040, -2159, -3278, -4397? -1119x + 79 What is the h'th term of 27786, 27779, 27772, 27765? -7h + 27793 What is the k'th term of 1135, 4482, 10061, 17872, 27915, 40190, 54697? 1116k*2 - k + 20 What is the a'th term of 16, 60, 94, 82, -12? -6a*3 + 31a*2 - 7a - 2 What is the s'th term of -43752, -87482, -131212, -174942, -218672, -262402? -43730s - 22 What is the j'th term of -100864, -100866, -100868, -100870? -2j - 100862 What is the q'th term of -50166, -100329, -150494, -200661, -250830? -q*2 - 50160q - 5 What is the a'th term of 1450, 1445, 1440, 1435, 1430? -5a + 1455 What is the p'th term of -47, -48, -57, -80, -123, -192? -p3 + 2p*2 - 48 What is the x'th term of 737, 1805, 2897, 4025, 5201, 6437, 7745, 9137? 2x*3 + 1054x - 319 What is the n'th term of 3728, 7284, 10840? 3556n + 172 What is the d'th term of -10209, -20423, -30645, -40875, -51113? -4d*2 - 10202d - 3 What is the w'th term of -29196, -116778, -262748, -467106, -729852? -29194w2 - 2 What is the q'th term of -59, -59, -31, 43, 181, 401, 721, 1159? 3q*3 - 4q*2 - 9q - 49 What is the s'th term of -12979, -103853, -350511, -830845, -1622747, -2804109, -4452823, -6646781? -12982s3 + 3 What is the u'th term of -656, -634, -606, -578, -556? -u3 + 9u*2 + 2u - 666 What is the b'th term of 2217, 4413, 6581, 8721, 10833, 12917? -14b2 + 2238b - 7 What is the c'th term of -403, -749, -1039, -1273, -1451, -1573, -1639? 28c2 - 430c - 1 What is the j'th term of 121040, 121044, 121048, 121052, 121056, 121060? 4j + 121036 What is the z'th term of 10820, 10880, 10930, 10964, 10976, 10960, 10910, 10820? -z3 + z2 + 64z + 10756 What is the k'th term of 527, 474, -741, -3700, -8985? -97k3 + k2 + 623k What is the g'th term of 1911571, 3823140, 5734709, 7646278, 9557847, 11469416? 1911569g + 2 What is the u'th term of 626, 1234, 1842, 2450, 3058, 3666? 608u + 18
Suppose 5z + 19 = -c, c - 3z - 7 = 6c. Suppose -5m = 6j - j, c = -4j - 5m. Let q be (-8)/((j/2)/(-1)). Solve -3k - 2 = -2n, k + 0k = 4n + q for n. -5 Let b be ((-2)/(-6))/(56/18 - 3). Solve 2v - 8 = 3j + 5, j - bv + 2 = 0 for j. -5 Suppose -9 = 10r - 29. Let q(f) = -2f*3 + 4f*2. Let j be q(r). Solve j = l + 4k + 2, 0 = -2l + 3k + 12 - 5 for l. 2 Suppose 396x + 52 = 409x. Solve -4r - 8 = -xd, 3d + 2d - 34 = -3r for d. 5 Let i be (2/(-4))/(((-60)/16)/15). Solve 2k + 12 = iu, -4k - u = -2u + 21 for k. -5 Suppose -3s = -2w - 9, -4 + 7 = s - w. Solve -q = sj - 12, j - 2q - 4 = 3q for j. 4 Let k(p) = -p - 19. Let n be k(-23). Solve 0 = 5y + 3o - 29, -3 + n = 4y - 5o for y. 4 Let p(o) = o*3 - 2o*2 - o - 2. Let r be p(3). Let x = 984 - 964. Solve 15 = 3v + 3l, 3l = rv - l + x for v. 0 Let m be -4 - (0 + -1)/(65/520). Solve 2u - 13 = g, 5u + mg - 4 = 9 for u. 5 Suppose -2i + 6 = -2. Solve -5j + iw - 11 = 4, -3w = 3j - 18 for j. 1 Let s(h) = 6h - 3. Let t(r) = -19r + 9. Let l(k) = 11s(k) + 4t(k). Let f be l(-2). Solve w - 1 = -2b, -b + f = -w + 6w for w. 5 Let p(u) = -4u + 18. Let n(v) = 11v - 54. Let k(z) = -3n(z) - 8p(z). Let m be k(10). Let g = m - 6. Solve -3c + 2f = -gf + 16, 21 = -5c + f for c. -4 Suppose 5b + 21 = 4y, y - 5 = -y - 3b. Let d be (y/(-3))/(-1)(-4 - -7). Solve c = -du - 10, 0 = 2c + 3c - u - 13 for c. 2 Let q(i) = -i*3 + 19i*2 + 23i - 48. Let u be q(20). Let j be (4/8)/(2/48). Suppose -r - d = 3r - j, -r = 4d + u. Solve 2z = -5f, -rz - 5f = z for z. 0 Let p = 13 - 11. Suppose pn + 5 = 3b, 3b = -4n + 28 - 11. Solve -bu = q - 4, 0u - 3u - 2 = 4q for u. 2 Let y(w) = w*2 - 6w + 3. Let j be y(6). Solve -17 = -h - jz - 4, z - 11 = 3h for h. -2 Let i = 17 - 11. Suppose 5w + l = -0 + 2, -3l = -i. Suppose -4u - 10 = -5h, h = 2h - 2. Solve u = -2z - 4p + 6, w = z + p - 0 - 1 for z. -1 Let z(s) = 6s + 19. Let u be z(-8). Let d = u + 22. Let v(k) = -2k - 10. Let m be v(d). Solve -5b + 4 = -y - 0y, -m = -2b + y for b. 0 Let s(c) = -2c2 + 79c + 603. Let y be s(46). Solve -w + 2a = -0a - y, -2 = -4w - a for w. 1 Suppose 4q + 6 = 5c, q = -2c - 12 + 4. Let n = q + 7. Suppose nv - 5v = -4. Solve 5f + h - 21 = 0, 0h = f - vh - 13 for f. 5 Let n(s) = s2 + 40s - 79. Let m be n(-42). Solve -28 = -5g + g + mu, -2g + u = -8 for g. 2 Let i be 73/3 - 50/(-75). Suppose -5l - 1 = -41. Solve k = 5d + i, 4d - l = 2k - 28 for d. -5 Let d = 1680 + -1678. Solve -5r = -dr - 6, r = 5t + 12 for t. -2 Suppose 0o + 4 = -o - 4k, 2k = 2o - 2. Let p = 3 - o. Solve v + 4l - p + 10 = 0, 5v = l + 7 for v. 1 Suppose -13q = 7q - 160. Solve -2f = -6f - 4i - q, -3f = i for f. 1 Suppose 2z + 3 = -13. Let k = z + 10. Suppose kv - 3 = -v. Solve 7l - 2l = -5u - 30, 0 = 4u - l - v for u. -1 Let h(l) = -2l2 - 16l - 12. Let d be h(-7). Let p = 0 + d. Solve 4x + x = pa - 7, -x + 1 = 2a for a. 1 Suppose 0 = -y - 3b - 177, 2b = -y + 2y + 167. Let s be (-475)/y - 4/(-18). Let i be 50/3 + (-4)/6. Solve i = u + 4d, 2d + s = -5u + 29 for u. 4 Let p = 3 + 4. Suppose -pa = -3a + 16. Let c be 9/(-36) + (-13)/a. Solve 5 = -5i, -t + 3t - 13 = ci for t. 5 Suppose -13 = -124v + 607. Solve 5s = -2l + 25, -2l = vs - 3l - 25 for s. 5 Suppose 55 = -5o - 5i, -o + 8 = -5i - 11. Let t be (-14)/(-42) - 16/o. Solve 6n = 2y + 7n - 1, tn = 2y + 11 for y. -1 Let j(q) = -q + 13. Let f be j(12). Suppose -11 + f = -5t. Solve -5u - 2a + 8 + 4 = 0, ta = 2 for u. 2 Suppose -2g = 4d - 16, g - 17 = -15d + 10d. Let h = -10 - -14. Let y be 0/(-1 - (1 + -3)). Solve -4o - gw + 4 = -y, -4o + 3w + h = 0 for o. 1 Suppose -55 = 4w - 9w. Suppose 27 - w = 2t. Solve -s = 4u + t, 4s + 0s = 4u + 28 for s. 4 Suppose m + 29 = 3b, 4b + 3m - m = 22. Solve 5v + 11 = -2r - 2r, -4v + b = -r for r. -4 Let b(w) = w*2 + 27w + 115. Let o be b(-22). Solve -22 = 2x - og, -3g + 3 + 8 = x for x. -1 Suppose 7 = 7u - 7. Solve -5h = 4m + 5, -4h - 6 + u = -4m for m. 0 Let i(v) = -v*3 + 13v*2 + 3v - 39. Let m be i(13). Solve -2r + m = 2y + 12, 4y + 6 = 5r for y. -4 Let o = -84 + 147. Let p be 40/7 + 18/o. Solve -n = -4h + n - p, 7 = -5h + 3n for h. -2 Let i(n) = 9n + 8. Let s(o) = -9o - 7. Let q(r) = -6i(r) - 5s(r). Let b be q(-2). Solve -f = 5k + 21, -45 = -7f + 2f + bk for f. 4 Suppose -3r + 11 = 2. Solve -4c - 2 = 3u, 5u + rc + 13 = 6c for u. -2 Suppose 4o + 0f - 3f = -4, 3f + 3 = -3o. Let b be ((-189)/(-54))/(o/(-2)). Solve -2l = -2t - 10 + 2, -b = -l + 4t for l. 3 Let i = 849 + -819. Solve 5p = -5z - i, -5z - 4p - 8 = 19 for z. -3 Suppose 2y + 6 = -3w, -4w - 8 = 5y + 7. Let n = y - -31. Solve -3m = -4d - n, 2d + 1 + 11 = m for m. 4 Suppose -2v + 5 = -5. Suppose 0 = 138y - 128y. Suppose y + v = m. Solve i + 3i + 23 = -ma, -3i + 2a = 0 for i. -2 Suppose 0 = -966d + 959d + 14. Solve -2k - 9 = y, -4k - 3 = -dy - y for k. -3 Let p be 1 + -1 - (-14 + (23 - 13)). Solve 3i - i + 2t = -8, i = 4t - p for i. -4 Let q(g) = 4g - 7. Let o be q(2). Suppose 0 = s - 2h - o, 4s - 4h - 3 = 9. Solve -5i + s + 4 = -3w, 0 = w - 2 for i. 3 Suppose z - 16 = 2z + 4w, -4z = 5w + 20. Let v be (-11 + -3 - z)(-2)/7. Solve -vk = -4q - 8, -k + 0q + 8 = q for k. 5 Let l(x) = -x3 + 3x - 7. Let y be l(-3). Solve -t + 12 = -5b - y, 0 = -3b + 3t - 9 for b. -5 Let f(t) = -t3 - t2. Let v(u) = 4u*3 + 7u*2 + 7u - 9. Let b(i) = 5f(i) + v(i). Let s be b(3). Solve -12 + 2 = 3w - 5x, -2x + 25 = sw for w. 5 Let u = 8 - 4. Suppose -uk = -k + 12. Let h be (-12 + 6)2/k. Solve -2f + 2 = 0, -hi + 20 = -f + 6 for i. 5 Suppose 0 = -19i + 12i + 12i. Solve 3k + i + 2 = -5p, -3k + 7 = -4p for p. -1 Let h = 1871 - 1867. Solve -3g + 4g = 4y - 17, -23 = -hy - g for y. 5 Let w be 0 + (-3)/(-6)4. Suppose 9 = 5c + wq - q, 4c - 20 = -4q. Let d(x) = 8x*2 - x + 1. Let f be d(c). Solve 4s + 4n = f, 0n - 8 = 3s - 4n for s. 0 Suppose 15z - 11z = 12. Suppose -zl = -6 + 3. Solve 3b + 4w + 4 + l = 0, -2b - 4w - 6 = 0 for b. 1 Let a be -5((-36)/48)/(30/32). Solve -ad = 6t - t + 5, 5t - 5d = 40 for t. 3 Let l = -82 + 59. Let j = 0 - l. Solve -b + 5x - j = 0, 4b - 17 = -2x + 1 for b. 2 Let v = 15 - 10. Suppose -vj - 3r + 3 = 0, -3r + 3 = 6j - 2j. Let q be (1 - j)0/16. Solve qx + 2o + 12 = x, x - 3o - 17 = 0 for x. 2 Let c be (-10 + 6 + 4)/(-1). Solve -5u + 4q + 40 = c, -3u - 3q + 5 = 2u for u. 4 Let n be (6/(-16))/((-13)/104). Solve 19 = -2r - r + 4a, na = r + 8 for r. -5 Let w(o) = o*2 - o - 12. Let z be w(8). Suppose -zl - 4 = -45l. Solve 0 = -6u + u - t - 16, lu - 3t = -28 for u. -4 Suppose 5s = -4b, 4s - s - 3b - 27 = 0. Suppose 16 = 2d - s. Let n be 54/d + 10/(-25). Solve -5o + 10 + n = 5p, 4p = 2o + 12 for p. 3 Let i be (-1)/1 + (6 - (-6 + 11)). Suppose n + x - 2x = 4, -n - 3x = i. Solve v = -nd + 8, -4d - 5v + 18 = -0v for d. 2 Let v be 40/(-15)3/(-1) + -1. Solve -2s = -5p + 18, 5p - 4s + vs + 2 = 0 for p. 2 Let s(b) = -21b + 169. Let n be s(8). Solve -2i - 5g = 4 - n, i = -4g for i. -4 Let u be (-120)/505/(-2). Let g = -4 + 6. Solve o - 3 - u = -n, -gn = -o - 3 for o. 5 Suppose 4z = -4u - 12, -2u = z + 1 + 7. Suppose m + 475 = 5g + 421, 3m = 5g - 62. Solve 3f - f + 2l = 10, zf = 3l - g for f. 1 Suppose -5b - 2 + 22 = 0. Suppose 89 = 5m - 11. Let p = m + -16. Solve -4c + 4 = -pk - 8, 0 = k - bc + 12 for k. 0 Let p(o) = o*3 + 23o*2 + 2o + 49. Let h be p(-23). Solve -g + 10 = 3m, -5g - hm + 25 = -7g for g. -5 Suppose -p + 63 = 2x + 40, 0 = 4x - 3p - 71. Solve 0 = -5u - 2z - 1, -xu + 2z = -13u - 7 for u. 1 Suppose 5g + 0g - 30 = 0. Let y be (-7)/(-14) + g/4. Suppose 0 - 6 = -yv. Solve -a - 3t = -6a - 6, 0 = a - vt - 6 for a. -3 Let h = 3 + -3. Suppose h = u + 3x + 1, 5x = -3u + u. Let d(j) = 5j*2 - 66j + 16. Let a be d(13). Solve ut = -0t + 4r, 5r - 37 = -at for t. 4 Let w be (2/6)/(2/6). Suppose 3n - 21 = -4v - 7, 3n + 4 = 5v. Solve -vu - u = 3c + 9, w = -2u - c for u. 2 Suppose w + 3j = -8 + 5, 2j = -4w - 2. Solve w = 4l + 4i, 2i = l - 2i for l. 0 Let p(t) = 7t3 - t2 + t - 1. Let f be p(1). Suppose -37 + 37 = -fq. Solve 2u - h = -11, -2h + q = u - 2 for u. -4 Suppose 5s - 90 = -4s. Solve 2o = 5n + 21, -5o + 4n + s = -0n for o. -2
Suppose 1400 = 15t - 4480. Does 7 divide t? True Suppose -186 = 4r + 70. Let o = r + 148. Suppose -2s - 127 = -5s + 2i, -2i - o = -2s. Is s a multiple of 7? False Suppose -2w + 157 = -w. Suppose -s = -c - 77, -2s + 2c + w = c. Is 40 a factor of s? True Is (-1 - 7470/(-9)) + 8 a multiple of 9? True Let z(l) = l*3 + 3 + 4 + 0 - 4l*2 - 4l*3. Is z(-3) a multiple of 10? False Let a be (-8 - -8) + 0 + 0. Suppose 4m + ai - i - 136 = 0, 0 = -4i. Suppose 0 = -p - 10 + m. Is p a multiple of 24? True Let r(n) = -2n3 - n. Let t be r(-1). Suppose 0g - 147 = -tg. Let p = -3 + g. Is 23 a factor of p? True Let w = -1270 + 2549. Is 34 a factor of w? False Let m = -1 + 36. Let n = m - 35. Suppose 5z - 3z - 56 = n. Is 14 a factor of z? True Let u be (2/5225/(-5))/(-2). Suppose -4h = -5h + u. Is 2 a factor of h? False Suppose 2489 = 2n + s + 199, -2s + 1139 = n. Is n a multiple of 37? True Is 25 a factor of (-2)/((-8)/684) + 2 + 2? True Let s(c) be the second derivative of c*2 + 4c + 0 - 1/6c3. Is s(-10) a multiple of 12? True Let n = -816 + 827. Is n a multiple of 2? False Let h = 782 - 722. Is h a multiple of 12? True Let v = 14 + -13. Let x be 0 - (-3)/1 - v. Suppose -xt + 2 = 0, 0z = -z + t + 24. Is z a multiple of 8? False Let l = 2782 + 686. Is l a multiple of 32? False Does 12 divide 442/(-39)(-10 + 1)? False Let t = 608 + 717. Does 53 divide t? True Suppose -61l + 66l - 240 = 0. Suppose -5c = -c - 1452. Suppose -c + l = -3r. Does 22 divide r? False Suppose 1115 = 7z - 40. Is 5 a factor of z? True Suppose 2r + 4 + 1 = -3x, x = 2r - 7. Suppose -3d + 80 = 5w, 4d - d + rw - 95 = 0. Is d a multiple of 7? True Let j(i) = -13i + 190. Is 20 a factor of j(-18)? False Let f(j) = -863j + 269. Does 34 divide f(-5)? False Suppose -664o = -665o + 259. Is o a multiple of 37? True Is (-1)/(-2) + (-2694)/(-12) a multiple of 6? False Suppose 0 = -5j, d - 10 = -3j + 12. Let z = d - -30. Is z a multiple of 26? True Let v(s) = 6 - 46s + 11s + 17s + 42 + 17s. Let m be 2/9 + (-4)/18. Does 16 divide v(m)? True Suppose 0 = -g - 4g + 20. Suppose -n - 8 = -3n, -3n = -gj. Suppose -7 = -5z + 3, jx + 3z = 96. Does 8 divide x? False Let f(p) = -p3 + 13p*2 + 14p - 14. Let a be f(14). Let t = 78 - a. Is t a multiple of 23? True Let n = 21 - 20. Let l(x) = 42x2 + x - 1. Is l(n) a multiple of 6? True Let h = -65 + 115. Suppose -4v + h = -126. Is 22 a factor of v? True Let l = -22 + 21. Let o(x) = 68x2 + 1. Let f be o(l). Let q = f + -44. Does 15 divide q? False Let m(s) = 32s*2 + 3s + 3. Let d(c) = -2c2 + 4c - 1. Let l be d(2). Does 5 divide m(l)? False Let p(w) = -94w. Let q(z) = z3 - 6z*2 - 6z - 8. Let v be q(7). Does 61 divide p(v)? False Suppose 2o = o - 2a + 215, -5o + 1117 = -4a. Is 4 a factor of o? False Let d(n) = -n*3 - 8n*2 + n - 6. Is 3 a factor of d(-10)? False Let a be 2 + (2 - 3 - -5). Let b be (2 + -14)/((-9)/a). Is 16 a factor of ((-100)/(-2))/(b/4)? False Suppose -95d + 104d - 279 = 0. Does 3 divide d? False Let a = -169 - -296. Suppose -3f + 143 = -a. Is 30 a factor of f? True Let y = -1 + -7. Is (-348)/(-10)(-20)/y a multiple of 29? True Suppose s + 3s = 3v - 16, -19 = -4v + 3s. Suppose 2f - vf + 3o = -52, 3f = 4o + 77. Is 11 a factor of f? False Suppose -126030 + 38523 = -21l. Is 49 a factor of l? False Let n(l) = 29 + 4l + 2l2 - 13l + 13l. Is n(-8) a multiple of 16? False Does 7 divide ((-18)/12)/((-15)/20) - -264? True Let x(l) = l2 + 5l - 11. Let w be x(2). Suppose 71 - 347 = -wk. Does 23 divide k? True Let g(i) = i. Suppose 5c + 3h - 8 = 0, 1 - 2 = -h. Let w(j) = j3 + 8j*2 - 2j. Let n(u) = cw(u) - 6g(u). Does 16 divide n(-8)? True Suppose x - b = 2, 0 = 4x + x + 3b - 50. Suppose 0 = -5j + xj - 242. Suppose -j = -3m - 0q + q, 158 = 4m + 2q. Is m a multiple of 20? True Let y(r) = -r*2 + 24r - 30. Is 42 a factor of y(15)? False Let u(d) = -d*3 + 8d*2 - 7d + 2. Let h be u(7). Is (-1)/h + 6441/38 a multiple of 11? False Suppose 0 = 3o + 2o - 10. Suppose oq + y = 32 - 11, -y - 3 = 0. Does 12 divide q? True Suppose 5d = -4t + 1081, -210 = -d + 5t - 17. Is d a multiple of 19? False Suppose 0 = -6t + 26 + 46. Suppose 6z - 336 = t. Does 9 divide z? False Suppose -7v + 529 + 409 = 0. Let z = 67 + v. Does 44 divide z? False Let l(b) = 7b + 30. Let u be l(13). Let p = -3 + u. Is 28 a factor of p? False Let a(w) = 172w - 34. Does 52 divide a(9)? False Is 12 a factor of 2 + (21618/24)/(3/8)? False Let z(y) = y3 - y2 + 3y - 3. Let m be z(4). Is 6403/m + (-4)/(-6) a multiple of 15? False Suppose p + 3562 = -209j + 211j, 3j - 5369 = -5p. Is j a multiple of 9? False Let k(m) = 2m + 35. Let v be k(-12). Suppose -13n = -vn - 216. Is n a multiple of 37? False Is ((-168)/10)/((-99)/660) a multiple of 7? True Suppose 2a - 510 + 36 = 2v, 3a = -2v + 696. Is a a multiple of 14? False Let y(f) be the third derivative of f6/120 - f4/6 + 2f*3/3 + 7f*2. Let d be y(6). Suppose -4g = -m + 34, 3g + d = 4m - g. Is 7 a factor of m? False Let w(g) = -g*3 + 10g*2 + 5g - 11. Let c be w(10). Suppose i - c = -4y + 181, -5i + 1175 = 5y. Does 20 divide i? True Let o = 197 + 373. Does 41 divide o? False Let z(j) = j3 + 12j*2 - 43j - 42. Does 9 divide z(-14)? False Let l(n) = -14n + 674 - 9n - 689 + n. Is l(-6) a multiple of 9? True Let m = -620 + 1054. Is m a multiple of 14? True Let w(r) = 14r2 - 3r + 11. Let q be (-17)/(-6) + (-2 - 26/(-12)). Is w(q) a multiple of 11? False Let g(a) = -a*2 - 3a + 390. Is g(0) a multiple of 52? False Let c = 56 + -29. Suppose -98b = -102b + 8. Suppose -k - c = -bk. Is k a multiple of 7? False Let k(l) = l2 - 6l - 20. Let c be k(9). Let g = c + 45. Is 13 a factor of g? True Let u = -1634 + 3137. Is 8 a factor of u? False Is 70 a factor of 6/(-11) + ((-105690)/33)/(-5)? False Let z = -6 + -52. Let p = z - -113. Is 11 a factor of p? True Let p(v) = -78v - 102. Does 21 divide p(-11)? True Let m be (6/24)/((-2)/(-16)). Suppose -s - 164 = -2s - 4p, 0 = -2s + mp + 308. Suppose 3b = -4i + 4b + s, 0 = i + 4b - 22. Is 19 a factor of i? True Let c(g) = 251g + 86. Is 53 a factor of c(4)? False Let f(p) = p*2 - p + 5. Let y be f(0). Suppose yt - 144 = -t. Is 17 a factor of t? False Suppose -15 = 2f + a - 294, 5f - 705 = 5a. Does 22 divide f? False Let g be (4/10)/((-17)/85). Let m = 54 - g. Does 14 divide m? True Suppose 4n - 358 = 5q, -4n + 2n = 4q - 166. Let i be n/21 + 3/(-21). Suppose 25 = -iy + 69. Is 7 a factor of y? False Does 11 divide (40/40)/(2/48)? False Suppose 25p - 218 = -d + 24p, -5d - p + 1110 = 0. Does 99 divide d? False Suppose -3z = -s - 199, -5z + 2s + 264 = -z. Is (2 - 1)z1 a multiple of 19? False Let o(f) = -f3 - 17f*2 - 15f + 6. Let v be o(-16). Let g(r) = -r*2 - 14r - 25. Does 7 divide g(v)? False Suppose -i + 2x + 1087 = 0, -3x + 363 = 3i - 2889. Does 45 divide i? False Suppose 0 = 4q - 5y - 4720, -138 + 1329 = q - 4y. Is q a multiple of 11? False Let h(g) = 4g2 - 6g - 58. Does 9 divide h(-5)? True Let d be (754/4)/(-13)(0 + -2). Let y = d - -30. Does 35 divide y? False Does 7 divide (-207)/(-3) + 4/164? True Let v(y) = -y*3 + 11y*2 - 11y - 4. Let c(f) = -f*2 - 13f + 8. Let n be c(-11). Suppose 4r + 2h = n, h + 0h = 4r - 39. Is 15 a factor of v(r)? False Let d(s) = -3 + 5s + 6s2 + 2 - s3 - 4 + 2. Is 3 a factor of d(6)? True Let b(q) be the second derivative of 0 + 6q + 4q*2 - 7/6q*3. Is b(-5) a multiple of 8? False Let x = 33 + -31. Suppose 3g + 278 = 2c - c, 0 = xc + g - 584. Does 29 divide c? True Suppose 0 = -2o - 3q + 13, 5q + 1 = -o + 4. Suppose -u + 2c = -c - o, -4u = -5c - 67. Is u a multiple of 6? False Suppose -4k = 4y - 36, -y + 0k = -4k + 1. Suppose -3 = 2h - y. Let f(t) = 5t3 - t2 + 4t - 3. Is f(h) a multiple of 13? False Let w = 96 + -55. Suppose -15 = -2x + w. Let l = 34 - x. Is 4 a factor of l? False Let n be 1/(-2)0/2. Let o(r) = 23r + r*2 - 23r - 175r3 + 174r*3 + 16. Is 16 a factor of o(n)? True Suppose -2w = 2w. Let k = 46 - 44. Is 30 a factor of -4 - w - (k + -105)? False Let q(c) = c3 + 3c - 4c2 - 41 + 39 + 5c*2 - c. Let y(j) = -j + 3. Let r be y(0). Is 10 a factor of q(r)? True Let x(i) = 3i - 45. Let m be x(13). Let d(l) be the first derivative of -3l2/2 + 14l - 1. Is 32 a factor of d(m)? True Let d(w) = w*2 - 10. Let h = -14 - -16. Suppose 6s = i + 4s + 18, hi + 28 = 2*s. Is d(i) a multiple of 30? True

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.