from rdkit import Chem from rdkit.Chem import Draw from transformers import pipeline import gradio as gr from interpretability import save_high_quality_png model_checkpoint = "FartLabs/FART_Augmented" classifier = pipeline("text-classification", model=model_checkpoint, top_k=None) def process_smiles(smiles): # Validate and canonicalize SMILES mol = Chem.MolFromSmiles(smiles) if mol is None: return "Invalid SMILES", None, "Invalid SMILES" canonical_smiles = Chem.MolToSmiles(mol) # Predict using the pipeline predictions = classifier(canonical_smiles) # Generate molecule image img_path = "molecule" filepath= "molecule.png" save_high_quality_png(smiles, molecule) # Convert predictions to a friendly format prediction_dict = {pred["label"]: pred["score"] for pred in predictions[0]} return prediction_dict, img_path, canonical_smiles iface = gr.Interface( fn=process_smiles, inputs=gr.Textbox(label="Input SMILES", value="O1[C@H](CO)[C@@H](O)[C@H](O)[C@@H](O)[C@H]1O[C@@]2(O[C@@H]([C@@H](O)[C@@H]2O)CO)CO"), outputs=[ gr.Label(num_top_classes=3, label="Classification Probabilities"), gr.Image(type="filepath", label="Molecule Image"), gr.Textbox(label="Canonical SMILES") ], title="FART", description="Enter a SMILES string to get the taste classification probabilities." ) iface.launch()