Spaces:
Runtime error
Runtime error
from rdkit import Chem | |
from rdkit.Chem import Draw | |
from transformers import pipeline | |
import gradio as gr | |
model_checkpoint = "FartLabs/FART_Chemberta_PubChem10M" | |
classifier = pipeline("text-classification", model=model_checkpoint, top_k=None) | |
def process_smiles(smiles): | |
# Validate and canonicalize SMILES | |
mol = Chem.MolFromSmiles(smiles) | |
if mol is None: | |
return "Invalid SMILES", None, "Invalid SMILES" | |
canonical_smiles = Chem.MolToSmiles(mol) | |
# Predict using the pipeline | |
predictions = classifier(canonical_smiles) | |
# Generate molecule image | |
img_path = "molecule.png" | |
img = Draw.MolToImage(mol) | |
img.save(img_path) | |
# Convert predictions to a friendly format | |
prediction_dict = {pred["label"]: pred["score"] for pred in predictions[0]} | |
return prediction_dict, img_path, canonical_smiles | |
iface = gr.Interface( | |
fn=process_smiles, | |
inputs=gr.Textbox(label="Input SMILES", value="O1[C@H](CO)[C@@H](O)[C@H](O)[C@@H](O)[C@H]1O[C@@]2(O[C@@H]([C@@H](O)[C@@H]2O)CO)CO"), | |
outputs=[ | |
gr.Label(num_top_classes=3, label="Classification Probabilities"), | |
gr.Image(type="filepath", label="Molecule Image"), | |
gr.Textbox(label="Canonical SMILES") | |
], | |
title="FART", | |
description="Enter a SMILES string to get the taste classification probabilities." | |
) | |
iface.launch() | |