Spaces:
Runtime error
Runtime error
Last commit not found
from rdkit import Chem | |
from rdkit.Chem import Draw | |
from transformers import pipeline | |
import gradio as gr | |
from rdkit import Chem | |
from rdkit.Chem import Draw | |
from rdkit.Chem.Draw import SimilarityMaps | |
import io | |
from PIL import Image | |
import numpy as np | |
import rdkit | |
from transformers import AutoModelForSequenceClassification, AutoTokenizer | |
from transformers_interpret import SequenceClassificationExplainer | |
model_name = "FartLabs/FART_Augmented" | |
model = AutoModelForSequenceClassification.from_pretrained(model_name) | |
tokenizer = AutoTokenizer.from_pretrained(model_name) | |
cls_explainer = SequenceClassificationExplainer(model, tokenizer) | |
def save_high_quality_png(smiles, title, bw=True, padding=0.05): | |
""" | |
Generates a high-quality PNG of atom-wise gradients or importance scores for a molecule. | |
Parameters: | |
- smiles (str): The SMILES string of the molecule to visualize. | |
- token_importance (list): List of importance scores for each atom. | |
- bw (bool): If True, renders the molecule in black and white. | |
- padding (float): Padding for molecule drawing. | |
- output_file (str): Path to save the high-quality PNG file. | |
Returns: | |
- None | |
""" | |
# Convert SMILES string to RDKit molecule object | |
molecule = Chem.MolFromSmiles(smiles) | |
Chem.rdDepictor.Compute2DCoords(molecule) | |
# Get token importance scores and map to atoms | |
token_importance = cls_explainer(smiles) | |
atom_importance = [c[1] for c in token_importance if c[0].isalpha()] | |
num_atoms = molecule.GetNumAtoms() | |
atom_importance = atom_importance[:num_atoms] | |
# Set a large canvas size for high resolution | |
d = Draw.MolDraw2DCairo(1500, 1500) | |
dopts = d.drawOptions() | |
dopts.padding = padding | |
dopts.maxFontSize = 2000 | |
dopts.bondLineWidth = 5 | |
# Optionally set black and white palette | |
if bw: | |
d.drawOptions().useBWAtomPalette() | |
# Generate and display a similarity map based on atom importance scores | |
SimilarityMaps.GetSimilarityMapFromWeights(molecule, atom_importance, draw2d=d) | |
# Draw molecule with color highlights | |
d.FinishDrawing() | |
# Save to PNG file with high quality | |
with open(f"{title}.png", "wb") as png_file: | |
png_file.write(d.GetDrawingText()) | |
return None | |
model_checkpoint = "FartLabs/FART_Augmented" | |
classifier = pipeline("text-classification", model=model_checkpoint, top_k=None) | |
def process_smiles(smiles, compute_explanation): | |
# Validate and canonicalize SMILES | |
mol = Chem.MolFromSmiles(smiles) | |
if mol is None: | |
return "Invalid SMILES", None, "Invalid SMILES" | |
canonical_smiles = Chem.MolToSmiles(mol) | |
# Predict using the pipeline | |
predictions = classifier(canonical_smiles) | |
# Generate molecule image | |
if compute_explanation: | |
img_path = "molecule" | |
filepath= "molecule.png" | |
save_high_quality_png(smiles, img_path) | |
else: | |
filepath = "molecule.png" | |
img = Draw.MolToImage(mol) | |
img.save(filepath) | |
# Convert predictions to a friendly format | |
prediction_dict = {pred["label"]: pred["score"] for pred in predictions[0]} | |
return prediction_dict, filepath, canonical_smiles | |
iface = gr.Interface( | |
fn=process_smiles, | |
inputs=[ | |
gr.Textbox(label="Input SMILES", value="O1[C@H](CO)[C@@H](O)[C@H](O)[C@@H](O)[C@H]1O[C@@]2(O[C@@H]([C@@H](O)[C@@H]2O)CO)CO"), | |
gr.Checkbox(label="Display Explanation", value=False), | |
], | |
outputs=[ | |
gr.Label(num_top_classes=3, label="Classification Probabilities"), | |
gr.Image(type="filepath", label="Molecule Image"), | |
gr.Textbox(label="Canonical SMILES") | |
], | |
description=""" | |
<section id="molecular-taste-description"> | |
<h2>Discover Molecular Taste with FART</h2> | |
<p> | |
At Kvant AI Labs, we just revolutionized taste chemistry with FART (Flavor Analysis and Recognition Transformer), an AI-powered tool designed to predict molecular taste profiles from SMILES. FART delivers predictions for <strong>sweet</strong>, <strong>bitter</strong>, <strong>sour</strong>, and <strong>umami</strong> with over 91% accuracy. | |
</p> | |
<p> | |
Beyond predictions, FART offers interpretable insights by identifying the molecular features driving the predictions, enabling actionable decisions for flavor innovation. Powered by the ChemBERTa foundation model and trained on the largest molecular taste dataset to date, FART sets a new standard in food science. | |
</p> | |
<p> | |
Learn more about the science behind FART in our <a href="https://chemrxiv.org/engage/chemrxiv/article-details/673a2a3af9980725cf80503c" target="_blank">Pre-print</a>. | |
</p> | |
</section> | |
""", | |
) | |
iface.launch() | |