diff --git "a/src/backend/gradio_molecule3d/templates/component/index.js" "b/src/backend/gradio_molecule3d/templates/component/index.js" --- "a/src/backend/gradio_molecule3d/templates/component/index.js" +++ "b/src/backend/gradio_molecule3d/templates/component/index.js" @@ -1,10 +1,10 @@ var os = Object.defineProperty; -var vn = (n) => { +var kn = (n) => { throw TypeError(n); }; var cs = (n, e, t) => e in n ? os(n, e, { enumerable: !0, configurable: !0, writable: !0, value: t }) : n[e] = t; -var kt = (n, e, t) => cs(n, typeof e != "symbol" ? e + "" : e, t), ci = (n, e, t) => e.has(n) || vn("Cannot " + t); -var wr = (n, e, t) => (ci(n, e, "read from private field"), t ? t.call(n) : e.get(n)), ui = (n, e, t) => e.has(n) ? vn("Cannot add the same private member more than once") : e instanceof WeakSet ? e.add(n) : e.set(n, t), bn = (n, e, t, r) => (ci(n, e, "write to private field"), r ? r.call(n, t) : e.set(n, t), t), Zr = (n, e, t) => (ci(n, e, "access private method"), t); +var Ft = (n, e, t) => cs(n, typeof e != "symbol" ? e + "" : e, t), Ai = (n, e, t) => e.has(n) || kn("Cannot " + t); +var Fr = (n, e, t) => (Ai(n, e, "read from private field"), t ? t.call(n) : e.get(n)), Mi = (n, e, t) => e.has(n) ? kn("Cannot add the same private member more than once") : e instanceof WeakSet ? e.add(n) : e.set(n, t), Ln = (n, e, t, r) => (Ai(n, e, "write to private field"), r ? r.call(n, t) : e.set(n, t), t), ui = (n, e, t) => (Ai(n, e, "access private method"), t); function _mergeNamespaces(n, e) { for (var t = 0; t < e.length; t++) { const r = e[t]; @@ -54,7 +54,7 @@ function create_dynamic_element(n) { n[21], null ); - let d = [ + let h = [ { "data-testid": ( /*test_id*/ n[9] @@ -67,9 +67,9 @@ function create_dynamic_element(n) { class: t = "block " + /*elem_classes*/ n[5].join(" ") + " svelte-1ezsyiy" } - ], o = {}; - for (let u = 0; u < d.length; u += 1) - o = assign$2(o, d[u]); + ], c = {}; + for (let d = 0; d < h.length; d += 1) + c = assign$2(c, h[d]); return { c() { e = element$f( @@ -77,9 +77,9 @@ function create_dynamic_element(n) { n[18] ), l && l.c(), this.h(); }, - l(u) { + l(d) { e = claim_element$f( - u, + d, /*tag*/ (n[18] || "null").toUpperCase(), { @@ -88,14 +88,14 @@ function create_dynamic_element(n) { class: !0 } ); - var p = children$n(e); - l && l.l(p), p.forEach(detach$q), this.h(); + var _ = children$n(e); + l && l.l(_), _.forEach(detach$q), this.h(); }, h() { set_dynamic_element_data( /*tag*/ n[18] - )(e, o), toggle_class$c( + )(e, c), toggle_class$c( e, "hidden", /*visible*/ @@ -175,141 +175,141 @@ function create_dynamic_element(n) { ), set_style$9(e, "min-width", `calc(min(${/*min_width*/ n[16]}px, 100%))`), set_style$9(e, "border-width", "var(--block-border-width)"); }, - m(u, p) { - insert_hydration$q(u, e, p), l && l.m(e, null), r = !0; + m(d, _) { + insert_hydration$q(d, e, _), l && l.m(e, null), r = !0; }, - p(u, p) { - l && l.p && (!r || p & /*$$scope*/ + p(d, _) { + l && l.p && (!r || _ & /*$$scope*/ 2097152) && update_slot_base$7( l, a, - u, + d, /*$$scope*/ - u[21], + d[21], r ? get_slot_changes$7( a, /*$$scope*/ - u[21], - p, + d[21], + _, null ) : get_all_dirty_from_scope$7( /*$$scope*/ - u[21] + d[21] ), null ), set_dynamic_element_data( /*tag*/ - u[18] - )(e, o = get_spread_update$2(d, [ - (!r || p & /*test_id*/ + d[18] + )(e, c = get_spread_update$2(h, [ + (!r || _ & /*test_id*/ 512) && { "data-testid": ( /*test_id*/ - u[9] + d[9] ) }, - (!r || p & /*elem_id*/ + (!r || _ & /*elem_id*/ 16) && { id: ( /*elem_id*/ - u[4] + d[4] ) }, - (!r || p & /*elem_classes*/ + (!r || _ & /*elem_classes*/ 32 && t !== (t = "block " + /*elem_classes*/ - u[5].join(" ") + " svelte-1ezsyiy")) && { class: t } + d[5].join(" ") + " svelte-1ezsyiy")) && { class: t } ])), toggle_class$c( e, "hidden", /*visible*/ - u[12] === !1 + d[12] === !1 ), toggle_class$c( e, "padded", /*padding*/ - u[8] + d[8] ), toggle_class$c( e, "flex", /*flex*/ - u[17] + d[17] ), toggle_class$c( e, "border_focus", /*border_mode*/ - u[7] === "focus" + d[7] === "focus" ), toggle_class$c( e, "border_contrast", /*border_mode*/ - u[7] === "contrast" + d[7] === "contrast" ), toggle_class$c(e, "hide-container", !/*explicit_call*/ - u[10] && !/*container*/ - u[11]), p & /*height*/ + d[10] && !/*container*/ + d[11]), _ & /*height*/ 1 && set_style$9( e, "height", /*get_dimension*/ - u[19]( + d[19]( /*height*/ - u[0] + d[0] ) - ), p & /*min_height*/ + ), _ & /*min_height*/ 2 && set_style$9( e, "min-height", /*get_dimension*/ - u[19]( + d[19]( /*min_height*/ - u[1] + d[1] ) - ), p & /*max_height*/ + ), _ & /*max_height*/ 4 && set_style$9( e, "max-height", /*get_dimension*/ - u[19]( + d[19]( /*max_height*/ - u[2] + d[2] ) - ), p & /*width*/ + ), _ & /*width*/ 8 && set_style$9(e, "width", typeof /*width*/ - u[3] == "number" ? `calc(min(${/*width*/ - u[3]}px, 100%))` : ( + d[3] == "number" ? `calc(min(${/*width*/ + d[3]}px, 100%))` : ( /*get_dimension*/ - u[19]( + d[19]( /*width*/ - u[3] + d[3] ) - )), p & /*variant*/ + )), _ & /*variant*/ 64 && set_style$9( e, "border-style", /*variant*/ - u[6] - ), p & /*allow_overflow, overflow_behavior*/ + d[6] + ), _ & /*allow_overflow, overflow_behavior*/ 24576 && set_style$9( e, "overflow", /*allow_overflow*/ - u[13] ? ( + d[13] ? ( /*overflow_behavior*/ - u[14] + d[14] ) : "hidden" - ), p & /*scale*/ + ), _ & /*scale*/ 32768 && set_style$9( e, "flex-grow", /*scale*/ - u[15] - ), p & /*min_width*/ + d[15] + ), _ & /*min_width*/ 65536 && set_style$9(e, "min-width", `calc(min(${/*min_width*/ - u[16]}px, 100%))`); + d[16]}px, 100%))`); }, - i(u) { - r || (transition_in$f(l, u), r = !0); + i(d) { + r || (transition_in$f(l, d), r = !0); }, - o(u) { - transition_out$e(l, u), r = !1; + o(d) { + transition_out$e(l, d), r = !1; }, - d(u) { - u && detach$q(e), l && l.d(u); + d(d) { + d && detach$q(e), l && l.d(d); } }; } @@ -344,7 +344,7 @@ function create_fragment$q(n) { }; } function instance$i(n, e, t) { - let { $$slots: r = {}, $$scope: a } = e, { height: l = void 0 } = e, { min_height: d = void 0 } = e, { max_height: o = void 0 } = e, { width: u = void 0 } = e, { elem_id: p = "" } = e, { elem_classes: m = [] } = e, { variant: y = "solid" } = e, { border_mode: w = "base" } = e, { padding: b = !0 } = e, { type: A = "normal" } = e, { test_id: f = void 0 } = e, { explicit_call: s = !1 } = e, { container: h = !0 } = e, { visible: _ = !0 } = e, { allow_overflow: g = !0 } = e, { overflow_behavior: x = "auto" } = e, { scale: c = null } = e, { min_width: v = 0 } = e, { flex: M = !1 } = e, E = A === "fieldset" ? "fieldset" : "div"; + let { $$slots: r = {}, $$scope: a } = e, { height: l = void 0 } = e, { min_height: h = void 0 } = e, { max_height: c = void 0 } = e, { width: d = void 0 } = e, { elem_id: _ = "" } = e, { elem_classes: m = [] } = e, { variant: y = "solid" } = e, { border_mode: x = "base" } = e, { padding: b = !0 } = e, { type: A = "normal" } = e, { test_id: f = void 0 } = e, { explicit_call: s = !1 } = e, { container: u = !0 } = e, { visible: p = !0 } = e, { allow_overflow: g = !0 } = e, { overflow_behavior: w = "auto" } = e, { scale: o = null } = e, { min_width: v = 0 } = e, { flex: M = !1 } = e, E = A === "fieldset" ? "fieldset" : "div"; const $ = (k) => { if (k !== void 0) { if (typeof k == "number") @@ -354,24 +354,24 @@ function instance$i(n, e, t) { } }; return n.$$set = (k) => { - "height" in k && t(0, l = k.height), "min_height" in k && t(1, d = k.min_height), "max_height" in k && t(2, o = k.max_height), "width" in k && t(3, u = k.width), "elem_id" in k && t(4, p = k.elem_id), "elem_classes" in k && t(5, m = k.elem_classes), "variant" in k && t(6, y = k.variant), "border_mode" in k && t(7, w = k.border_mode), "padding" in k && t(8, b = k.padding), "type" in k && t(20, A = k.type), "test_id" in k && t(9, f = k.test_id), "explicit_call" in k && t(10, s = k.explicit_call), "container" in k && t(11, h = k.container), "visible" in k && t(12, _ = k.visible), "allow_overflow" in k && t(13, g = k.allow_overflow), "overflow_behavior" in k && t(14, x = k.overflow_behavior), "scale" in k && t(15, c = k.scale), "min_width" in k && t(16, v = k.min_width), "flex" in k && t(17, M = k.flex), "$$scope" in k && t(21, a = k.$$scope); + "height" in k && t(0, l = k.height), "min_height" in k && t(1, h = k.min_height), "max_height" in k && t(2, c = k.max_height), "width" in k && t(3, d = k.width), "elem_id" in k && t(4, _ = k.elem_id), "elem_classes" in k && t(5, m = k.elem_classes), "variant" in k && t(6, y = k.variant), "border_mode" in k && t(7, x = k.border_mode), "padding" in k && t(8, b = k.padding), "type" in k && t(20, A = k.type), "test_id" in k && t(9, f = k.test_id), "explicit_call" in k && t(10, s = k.explicit_call), "container" in k && t(11, u = k.container), "visible" in k && t(12, p = k.visible), "allow_overflow" in k && t(13, g = k.allow_overflow), "overflow_behavior" in k && t(14, w = k.overflow_behavior), "scale" in k && t(15, o = k.scale), "min_width" in k && t(16, v = k.min_width), "flex" in k && t(17, M = k.flex), "$$scope" in k && t(21, a = k.$$scope); }, [ l, + h, + c, d, - o, - u, - p, + _, m, y, - w, + x, b, f, s, - h, - _, + u, + p, g, - x, - c, + w, + o, v, M, E, @@ -752,16 +752,16 @@ function create_fragment$p(n) { stroke: !0, style: !0 }); - var d = children$m(e); - t = claim_svg_element$a(d, "g", { transform: !0 }); - var o = children$m(t); - r = claim_svg_element$a(o, "path", { d: !0, style: !0 }), children$m(r).forEach(detach$p), o.forEach(detach$p), a = claim_svg_element$a(d, "path", { d: !0, style: !0 }), children$m(a).forEach(detach$p), d.forEach(detach$p), this.h(); + var h = children$m(e); + t = claim_svg_element$a(h, "g", { transform: !0 }); + var c = children$m(t); + r = claim_svg_element$a(c, "path", { d: !0, style: !0 }), children$m(r).forEach(detach$p), c.forEach(detach$p), a = claim_svg_element$a(h, "path", { d: !0, style: !0 }), children$m(a).forEach(detach$p), h.forEach(detach$p), this.h(); }, h() { attr$l(r, "d", "M18,6L6.087,17.913"), set_style$8(r, "fill", "none"), set_style$8(r, "fill-rule", "nonzero"), set_style$8(r, "stroke-width", "2px"), attr$l(t, "transform", "matrix(1.14096,-0.140958,-0.140958,1.14096,-0.0559523,0.0559523)"), attr$l(a, "d", "M4.364,4.364L19.636,19.636"), set_style$8(a, "fill", "none"), set_style$8(a, "fill-rule", "nonzero"), set_style$8(a, "stroke-width", "2px"), attr$l(e, "width", "100%"), attr$l(e, "height", "100%"), attr$l(e, "viewBox", "0 0 24 24"), attr$l(e, "version", "1.1"), attr$l(e, "xmlns", "http://www.w3.org/2000/svg"), attr$l(e, "xmlns:xlink", "http://www.w3.org/1999/xlink"), attr$l(e, "xml:space", "preserve"), attr$l(e, "stroke", "currentColor"), set_style$8(e, "fill-rule", "evenodd"), set_style$8(e, "clip-rule", "evenodd"), set_style$8(e, "stroke-linecap", "round"), set_style$8(e, "stroke-linejoin", "round"); }, - m(l, d) { - insert_hydration$p(l, e, d), append_hydration$k(e, t), append_hydration$k(t, r), append_hydration$k(e, a); + m(l, h) { + insert_hydration$p(l, e, h), append_hydration$k(e, t), append_hydration$k(t, r), append_hydration$k(e, a); }, p: noop$g, i: noop$g, @@ -1062,14 +1062,14 @@ function create_fragment$j(n) { "stroke-linejoin": !0, class: !0 }); - var d = children$g(e); - t = claim_svg_element$4(d, "path", { d: !0 }), children$g(t).forEach(detach$j), r = claim_svg_element$4(d, "polyline", { points: !0 }), children$g(r).forEach(detach$j), a = claim_svg_element$4(d, "line", { x1: !0, y1: !0, x2: !0, y2: !0 }), children$g(a).forEach(detach$j), d.forEach(detach$j), this.h(); + var h = children$g(e); + t = claim_svg_element$4(h, "path", { d: !0 }), children$g(t).forEach(detach$j), r = claim_svg_element$4(h, "polyline", { points: !0 }), children$g(r).forEach(detach$j), a = claim_svg_element$4(h, "line", { x1: !0, y1: !0, x2: !0, y2: !0 }), children$g(a).forEach(detach$j), h.forEach(detach$j), this.h(); }, h() { attr$f(t, "d", "M21 15v4a2 2 0 0 1-2 2H5a2 2 0 0 1-2-2v-4"), attr$f(r, "points", "17 8 12 3 7 8"), attr$f(a, "x1", "12"), attr$f(a, "y1", "3"), attr$f(a, "x2", "12"), attr$f(a, "y2", "15"), attr$f(e, "xmlns", "http://www.w3.org/2000/svg"), attr$f(e, "width", "90%"), attr$f(e, "height", "90%"), attr$f(e, "viewBox", "0 0 24 24"), attr$f(e, "fill", "none"), attr$f(e, "stroke", "currentColor"), attr$f(e, "stroke-width", "2"), attr$f(e, "stroke-linecap", "round"), attr$f(e, "stroke-linejoin", "round"), attr$f(e, "class", "feather feather-upload"); }, - m(l, d) { - insert_hydration$j(l, e, d), append_hydration$e(e, t), append_hydration$e(e, r), append_hydration$e(e, a); + m(l, h) { + insert_hydration$j(l, e, h), append_hydration$e(e, t), append_hydration$e(e, r), append_hydration$e(e, a); }, p: noop$a, i: noop$a, @@ -1124,14 +1124,14 @@ class ParseError { // The underlying error message without any context added. constructor(e, t) { this.name = void 0, this.position = void 0, this.length = void 0, this.rawMessage = void 0; - var r = "KaTeX parse error: " + e, a, l, d = t && t.loc; - if (d && d.start <= d.end) { - var o = d.lexer.input; - a = d.start, l = d.end, a === o.length ? r += " at end of input: " : r += " at position " + (a + 1) + ": "; - var u = o.slice(a, l).replace(/[^]/g, "$&̲"), p; - a > 15 ? p = "…" + o.slice(a - 15, a) : p = o.slice(0, a); + var r = "KaTeX parse error: " + e, a, l, h = t && t.loc; + if (h && h.start <= h.end) { + var c = h.lexer.input; + a = h.start, l = h.end, a === c.length ? r += " at end of input: " : r += " at position " + (a + 1) + ": "; + var d = c.slice(a, l).replace(/[^]/g, "$&̲"), _; + a > 15 ? _ = "…" + c.slice(a - 15, a) : _ = c.slice(0, a); var m; - l + 15 < o.length ? m = o.slice(l, l + 15) + "…" : m = o.slice(l), r += p + u + m; + l + 15 < c.length ? m = c.slice(l, l + 15) + "…" : m = c.slice(l), r += _ + d + m; } var y = new Error(r); return y.name = "ParseError", y.__proto__ = ParseError.prototype, y.position = a, a != null && l != null && (y.length = l - a), y.rawMessage = e, y; @@ -3998,8 +3998,8 @@ var ptPerUnit = { for (var l in this.attributes) this.attributes.hasOwnProperty(l) && (t += " " + l + '="' + utils.escape(this.attributes[l]) + '"'); t += ">"; - for (var d = 0; d < this.children.length; d++) - t += this.children[d].toMarkup(); + for (var h = 0; h < this.children.length; h++) + t += this.children[h].toMarkup(); return t += "", t; }; class Span { @@ -4070,10 +4070,10 @@ var iCombinations = { ì: "ı̀" }; class SymbolNode { - constructor(e, t, r, a, l, d, o, u) { - this.text = void 0, this.height = void 0, this.depth = void 0, this.italic = void 0, this.skew = void 0, this.width = void 0, this.maxFontSize = void 0, this.classes = void 0, this.style = void 0, this.text = e, this.height = t || 0, this.depth = r || 0, this.italic = a || 0, this.skew = l || 0, this.width = d || 0, this.classes = o || [], this.style = u || {}, this.maxFontSize = 0; - var p = scriptFromCodepoint(this.text.charCodeAt(0)); - p && this.classes.push(p + "_fallback"), /[îïíì]/.test(this.text) && (this.text = iCombinations[this.text]); + constructor(e, t, r, a, l, h, c, d) { + this.text = void 0, this.height = void 0, this.depth = void 0, this.italic = void 0, this.skew = void 0, this.width = void 0, this.maxFontSize = void 0, this.classes = void 0, this.style = void 0, this.text = e, this.height = t || 0, this.depth = r || 0, this.italic = a || 0, this.skew = l || 0, this.width = h || 0, this.classes = c || [], this.style = d || {}, this.maxFontSize = 0; + var _ = scriptFromCodepoint(this.text.charCodeAt(0)); + _ && this.classes.push(_ + "_fallback"), /[îïíì]/.test(this.text) && (this.text = iCombinations[this.text]); } hasClass(e) { return utils.contains(this.classes, e); @@ -4896,16 +4896,16 @@ var wideLatinLetterData = [ ["mathtt", "texttt", "Typewriter-Regular"] // 0-9 monospace ], wideCharacterFont = function(e, t) { - var r = e.charCodeAt(0), a = e.charCodeAt(1), l = (r - 55296) * 1024 + (a - 56320) + 65536, d = t === "math" ? 0 : 1; + var r = e.charCodeAt(0), a = e.charCodeAt(1), l = (r - 55296) * 1024 + (a - 56320) + 65536, h = t === "math" ? 0 : 1; if (119808 <= l && l < 120484) { - var o = Math.floor((l - 119808) / 26); - return [wideLatinLetterData[o][2], wideLatinLetterData[o][d]]; + var c = Math.floor((l - 119808) / 26); + return [wideLatinLetterData[c][2], wideLatinLetterData[c][h]]; } else if (120782 <= l && l <= 120831) { - var u = Math.floor((l - 120782) / 10); - return [wideNumeralData[u][2], wideNumeralData[u][d]]; + var d = Math.floor((l - 120782) / 10); + return [wideNumeralData[d][2], wideNumeralData[d][h]]; } else { if (l === 120485 || l === 120486) - return [wideLatinLetterData[0][2], wideLatinLetterData[0][d]]; + return [wideLatinLetterData[0][2], wideLatinLetterData[0][h]]; if (120486 < l && l < 120782) return ["", ""]; throw new ParseError("Unsupported character: " + e); @@ -4916,20 +4916,20 @@ var wideLatinLetterData = [ metrics: getCharacterMetrics(e, t, r) }; }, makeSymbol = function(e, t, r, a, l) { - var d = lookupSymbol(e, t, r), o = d.metrics; - e = d.value; - var u; - if (o) { - var p = o.italic; - (r === "text" || a && a.font === "mathit") && (p = 0), u = new SymbolNode(e, o.height, o.depth, p, o.skew, o.width, l); + var h = lookupSymbol(e, t, r), c = h.metrics; + e = h.value; + var d; + if (c) { + var _ = c.italic; + (r === "text" || a && a.font === "mathit") && (_ = 0), d = new SymbolNode(e, c.height, c.depth, _, c.skew, c.width, l); } else - typeof console < "u" && console.warn("No character metrics " + ("for '" + e + "' in style '" + t + "' and mode '" + r + "'")), u = new SymbolNode(e, 0, 0, 0, 0, 0, l); + typeof console < "u" && console.warn("No character metrics " + ("for '" + e + "' in style '" + t + "' and mode '" + r + "'")), d = new SymbolNode(e, 0, 0, 0, 0, 0, l); if (a) { - u.maxFontSize = a.sizeMultiplier, a.style.isTight() && u.classes.push("mtight"); + d.maxFontSize = a.sizeMultiplier, a.style.isTight() && d.classes.push("mtight"); var m = a.getColor(); - m && (u.style.color = m); + m && (d.style.color = m); } - return u; + return d; }, mathsym = function(e, t, r, a) { return a === void 0 && (a = []), r.font === "boldsymbol" && lookupSymbol(e, "Main-Bold", t).metrics ? makeSymbol(e, "Main-Bold", t, r, a.concat(["mathbf"])) : e === "\\" || symbols[t][e].font === "main" ? makeSymbol(e, "Main-Regular", t, r, a) : makeSymbol(e, "AMS-Regular", t, r, a.concat(["amsrm"])); }, boldsymbol = function(e, t, r, a, l) { @@ -4941,36 +4941,36 @@ var wideLatinLetterData = [ fontClass: "mathbf" }; }, makeOrd = function(e, t, r) { - var a = e.mode, l = e.text, d = ["mord"], o = a === "math" || a === "text" && t.font, u = o ? t.font : t.fontFamily, p = "", m = ""; - if (l.charCodeAt(0) === 55349 && ([p, m] = wideCharacterFont(l, a)), p.length > 0) - return makeSymbol(l, p, a, t, d.concat(m)); - if (u) { - var y, w; - if (u === "boldsymbol") { - var b = boldsymbol(l, a, t, d, r); - y = b.fontName, w = [b.fontClass]; - } else o ? (y = fontMap[u].fontName, w = [u]) : (y = retrieveTextFontName(u, t.fontWeight, t.fontShape), w = [u, t.fontWeight, t.fontShape]); + var a = e.mode, l = e.text, h = ["mord"], c = a === "math" || a === "text" && t.font, d = c ? t.font : t.fontFamily, _ = "", m = ""; + if (l.charCodeAt(0) === 55349 && ([_, m] = wideCharacterFont(l, a)), _.length > 0) + return makeSymbol(l, _, a, t, h.concat(m)); + if (d) { + var y, x; + if (d === "boldsymbol") { + var b = boldsymbol(l, a, t, h, r); + y = b.fontName, x = [b.fontClass]; + } else c ? (y = fontMap[d].fontName, x = [d]) : (y = retrieveTextFontName(d, t.fontWeight, t.fontShape), x = [d, t.fontWeight, t.fontShape]); if (lookupSymbol(l, y, a).metrics) - return makeSymbol(l, y, a, t, d.concat(w)); + return makeSymbol(l, y, a, t, h.concat(x)); if (ligatures.hasOwnProperty(l) && y.slice(0, 10) === "Typewriter") { for (var A = [], f = 0; f < l.length; f++) - A.push(makeSymbol(l[f], y, a, t, d.concat(w))); + A.push(makeSymbol(l[f], y, a, t, h.concat(x))); return makeFragment(A); } } if (r === "mathord") - return makeSymbol(l, "Math-Italic", a, t, d.concat(["mathnormal"])); + return makeSymbol(l, "Math-Italic", a, t, h.concat(["mathnormal"])); if (r === "textord") { var s = symbols[a][l] && symbols[a][l].font; if (s === "ams") { - var h = retrieveTextFontName("amsrm", t.fontWeight, t.fontShape); - return makeSymbol(l, h, a, t, d.concat("amsrm", t.fontWeight, t.fontShape)); + var u = retrieveTextFontName("amsrm", t.fontWeight, t.fontShape); + return makeSymbol(l, u, a, t, h.concat("amsrm", t.fontWeight, t.fontShape)); } else if (s === "main" || !s) { - var _ = retrieveTextFontName("textrm", t.fontWeight, t.fontShape); - return makeSymbol(l, _, a, t, d.concat(t.fontWeight, t.fontShape)); + var p = retrieveTextFontName("textrm", t.fontWeight, t.fontShape); + return makeSymbol(l, p, a, t, h.concat(t.fontWeight, t.fontShape)); } else { var g = retrieveTextFontName(s, t.fontWeight, t.fontShape); - return makeSymbol(l, g, a, t, d.concat(g, t.fontWeight, t.fontShape)); + return makeSymbol(l, g, a, t, h.concat(g, t.fontWeight, t.fontShape)); } } else throw new Error("unexpected type: " + r + " in makeOrd"); @@ -4997,8 +4997,8 @@ var wideLatinLetterData = [ return n; }, sizeElementFromChildren = function(e) { for (var t = 0, r = 0, a = 0, l = 0; l < e.children.length; l++) { - var d = e.children[l]; - d.height > t && (t = d.height), d.depth > r && (r = d.depth), d.maxFontSize > a && (a = d.maxFontSize); + var h = e.children[l]; + h.height > t && (t = h.height), h.depth > r && (r = h.depth), h.maxFontSize > a && (a = h.maxFontSize); } e.height = t, e.depth = r, e.maxFontSize = a; }, makeSpan$2 = function(e, t, r, a) { @@ -5017,78 +5017,78 @@ var wideLatinLetterData = [ return e instanceof DocumentFragment ? makeSpan$2([], [e], t) : e; }, getVListChildrenAndDepth = function(e) { if (e.positionType === "individualShift") { - for (var t = e.children, r = [t[0]], a = -t[0].shift - t[0].elem.depth, l = a, d = 1; d < t.length; d++) { - var o = -t[d].shift - l - t[d].elem.depth, u = o - (t[d - 1].elem.height + t[d - 1].elem.depth); - l = l + o, r.push({ + for (var t = e.children, r = [t[0]], a = -t[0].shift - t[0].elem.depth, l = a, h = 1; h < t.length; h++) { + var c = -t[h].shift - l - t[h].elem.depth, d = c - (t[h - 1].elem.height + t[h - 1].elem.depth); + l = l + c, r.push({ type: "kern", - size: u - }), r.push(t[d]); + size: d + }), r.push(t[h]); } return { children: r, depth: a }; } - var p; + var _; if (e.positionType === "top") { for (var m = e.positionData, y = 0; y < e.children.length; y++) { - var w = e.children[y]; - m -= w.type === "kern" ? w.size : w.elem.height + w.elem.depth; + var x = e.children[y]; + m -= x.type === "kern" ? x.size : x.elem.height + x.elem.depth; } - p = m; + _ = m; } else if (e.positionType === "bottom") - p = -e.positionData; + _ = -e.positionData; else { var b = e.children[0]; if (b.type !== "elem") throw new Error('First child must have type "elem".'); if (e.positionType === "shift") - p = -b.elem.depth - e.positionData; + _ = -b.elem.depth - e.positionData; else if (e.positionType === "firstBaseline") - p = -b.elem.depth; + _ = -b.elem.depth; else throw new Error("Invalid positionType " + e.positionType + "."); } return { children: e.children, - depth: p + depth: _ }; }, makeVList = function(e, t) { for (var { children: r, depth: a - } = getVListChildrenAndDepth(e), l = 0, d = 0; d < r.length; d++) { - var o = r[d]; - if (o.type === "elem") { - var u = o.elem; - l = Math.max(l, u.maxFontSize, u.height); + } = getVListChildrenAndDepth(e), l = 0, h = 0; h < r.length; h++) { + var c = r[h]; + if (c.type === "elem") { + var d = c.elem; + l = Math.max(l, d.maxFontSize, d.height); } } l += 2; - var p = makeSpan$2(["pstrut"], []); - p.style.height = makeEm(l); - for (var m = [], y = a, w = a, b = a, A = 0; A < r.length; A++) { + var _ = makeSpan$2(["pstrut"], []); + _.style.height = makeEm(l); + for (var m = [], y = a, x = a, b = a, A = 0; A < r.length; A++) { var f = r[A]; if (f.type === "kern") b += f.size; else { - var s = f.elem, h = f.wrapperClasses || [], _ = f.wrapperStyle || {}, g = makeSpan$2(h, [p, s], void 0, _); + var s = f.elem, u = f.wrapperClasses || [], p = f.wrapperStyle || {}, g = makeSpan$2(u, [_, s], void 0, p); g.style.top = makeEm(-l - b - s.depth), f.marginLeft && (g.style.marginLeft = f.marginLeft), f.marginRight && (g.style.marginRight = f.marginRight), m.push(g), b += s.height + s.depth; } - y = Math.min(y, b), w = Math.max(w, b); + y = Math.min(y, b), x = Math.max(x, b); } - var x = makeSpan$2(["vlist"], m); - x.style.height = makeEm(w); - var c; + var w = makeSpan$2(["vlist"], m); + w.style.height = makeEm(x); + var o; if (y < 0) { var v = makeSpan$2([], []), M = makeSpan$2(["vlist"], [v]); M.style.height = makeEm(-y); var E = makeSpan$2(["vlist-s"], [new SymbolNode("​")]); - c = [makeSpan$2(["vlist-r"], [x, E]), makeSpan$2(["vlist-r"], [M])]; + o = [makeSpan$2(["vlist-r"], [w, E]), makeSpan$2(["vlist-r"], [M])]; } else - c = [makeSpan$2(["vlist-r"], [x])]; - var $ = makeSpan$2(["vlist-t"], c); - return c.length === 2 && $.classes.push("vlist-t2"), $.height = w, $.depth = -y, $; + o = [makeSpan$2(["vlist-r"], [w])]; + var $ = makeSpan$2(["vlist-t"], o); + return o.length === 2 && $.classes.push("vlist-t2"), $.height = x, $.depth = -y, $; }, makeGlue = (n, e) => { var t = makeSpan$2(["mspace"], [], e), r = calculateSize(n, e); return t.style.marginRight = makeEm(r), t; @@ -5172,15 +5172,15 @@ var wideLatinLetterData = [ oiiintSize1: ["oiiintSize1", 1.304, 0.499], oiiintSize2: ["oiiintSize2", 1.98, 0.659] }, staticSvg = function(e, t) { - var [r, a, l] = svgData[e], d = new PathNode(r), o = new SvgNode([d], { + var [r, a, l] = svgData[e], h = new PathNode(r), c = new SvgNode([h], { width: makeEm(a), height: makeEm(l), // Override CSS rule `.katex svg { width: 100% }` style: "width:" + makeEm(a), viewBox: "0 0 " + 1e3 * a + " " + 1e3 * l, preserveAspectRatio: "xMinYMin" - }), u = makeSvgSpan(["overlay"], [o], t); - return u.height = l, u.style.height = makeEm(l), u.style.width = makeEm(a), u; + }), d = makeSvgSpan(["overlay"], [c], t); + return d.height = l, d.style.height = makeEm(l), d.style.width = makeEm(a), d; }, buildCommon = { fontMap, makeSymbol, @@ -5282,8 +5282,8 @@ function defineFunction(n) { props: r, handler: a, htmlBuilder: l, - mathmlBuilder: d - } = n, o = { + mathmlBuilder: h + } = n, c = { type: e, numArgs: r.numArgs, argTypes: r.argTypes, @@ -5294,9 +5294,9 @@ function defineFunction(n) { infix: !!r.infix, primitive: !!r.primitive, handler: a - }, u = 0; u < t.length; ++u) - _functions[t[u]] = o; - e && (l && (_htmlGroupBuilders[e] = l), d && (_mathmlGroupBuilders[e] = d)); + }, d = 0; d < t.length; ++d) + _functions[t[d]] = c; + e && (l && (_htmlGroupBuilders[e] = l), h && (_mathmlGroupBuilders[e] = h)); } function defineFunctionBuilders(n) { var { @@ -5337,50 +5337,50 @@ var normalizeArgument = function(e) { minner: "minner" }, buildExpression$1 = function(e, t, r, a) { a === void 0 && (a = [null, null]); - for (var l = [], d = 0; d < e.length; d++) { - var o = buildGroup$1(e[d], t); - if (o instanceof DocumentFragment) { - var u = o.children; - l.push(...u); + for (var l = [], h = 0; h < e.length; h++) { + var c = buildGroup$1(e[h], t); + if (c instanceof DocumentFragment) { + var d = c.children; + l.push(...d); } else - l.push(o); + l.push(c); } if (buildCommon.tryCombineChars(l), !r) return l; - var p = t; + var _ = t; if (e.length === 1) { var m = e[0]; - m.type === "sizing" ? p = t.havingSize(m.size) : m.type === "styling" && (p = t.havingStyle(styleMap$1[m.style])); + m.type === "sizing" ? _ = t.havingSize(m.size) : m.type === "styling" && (_ = t.havingStyle(styleMap$1[m.style])); } - var y = makeSpan$1([a[0] || "leftmost"], [], t), w = makeSpan$1([a[1] || "rightmost"], [], t), b = r === "root"; + var y = makeSpan$1([a[0] || "leftmost"], [], t), x = makeSpan$1([a[1] || "rightmost"], [], t), b = r === "root"; return traverseNonSpaceNodes(l, (A, f) => { - var s = f.classes[0], h = A.classes[0]; - s === "mbin" && utils.contains(binRightCanceller, h) ? f.classes[0] = "mord" : h === "mbin" && utils.contains(binLeftCanceller, s) && (A.classes[0] = "mord"); + var s = f.classes[0], u = A.classes[0]; + s === "mbin" && utils.contains(binRightCanceller, u) ? f.classes[0] = "mord" : u === "mbin" && utils.contains(binLeftCanceller, s) && (A.classes[0] = "mord"); }, { node: y - }, w, b), traverseNonSpaceNodes(l, (A, f) => { - var s = getTypeOfDomTree(f), h = getTypeOfDomTree(A), _ = s && h ? A.hasClass("mtight") ? tightSpacings[s][h] : spacings[s][h] : null; - if (_) - return buildCommon.makeGlue(_, p); + }, x, b), traverseNonSpaceNodes(l, (A, f) => { + var s = getTypeOfDomTree(f), u = getTypeOfDomTree(A), p = s && u ? A.hasClass("mtight") ? tightSpacings[s][u] : spacings[s][u] : null; + if (p) + return buildCommon.makeGlue(p, _); }, { node: y - }, w, b), l; + }, x, b), l; }, traverseNonSpaceNodes = function n(e, t, r, a, l) { a && e.push(a); - for (var d = 0; d < e.length; d++) { - var o = e[d], u = checkPartialGroup(o); - if (u) { - n(u.children, t, r, null, l); + for (var h = 0; h < e.length; h++) { + var c = e[h], d = checkPartialGroup(c); + if (d) { + n(d.children, t, r, null, l); continue; } - var p = !o.hasClass("mspace"); - if (p) { - var m = t(o, r.node); - m && (r.insertAfter ? r.insertAfter(m) : (e.unshift(m), d++)); + var _ = !c.hasClass("mspace"); + if (_) { + var m = t(c, r.node); + m && (r.insertAfter ? r.insertAfter(m) : (e.unshift(m), h++)); } - p ? r.node = o : l && o.hasClass("newline") && (r.node = makeSpan$1(["leftmost"])), r.insertAfter = /* @__PURE__ */ ((y) => (w) => { - e.splice(y + 1, 0, w), d++; - })(d); + _ ? r.node = c : l && c.hasClass("newline") && (r.node = makeSpan$1(["leftmost"])), r.insertAfter = /* @__PURE__ */ ((y) => (x) => { + e.splice(y + 1, 0, x), h++; + })(h); } a && e.pop(); }, checkPartialGroup = function(e) { @@ -5565,37 +5565,37 @@ var mathMLTree = { if (utils.contains(["\\imath", "\\jmath"], l)) return null; symbols[a][l] && symbols[a][l].replace && (l = symbols[a][l].replace); - var d = buildCommon.fontMap[r].fontName; - return getCharacterMetrics(l, d, a) ? buildCommon.fontMap[r].variant : null; + var h = buildCommon.fontMap[r].fontName; + return getCharacterMetrics(l, h, a) ? buildCommon.fontMap[r].variant : null; }, buildExpression = function(e, t, r) { if (e.length === 1) { var a = buildGroup(e[0], t); return r && a instanceof MathNode && a.type === "mo" && (a.setAttribute("lspace", "0em"), a.setAttribute("rspace", "0em")), [a]; } - for (var l = [], d, o = 0; o < e.length; o++) { - var u = buildGroup(e[o], t); - if (u instanceof MathNode && d instanceof MathNode) { - if (u.type === "mtext" && d.type === "mtext" && u.getAttribute("mathvariant") === d.getAttribute("mathvariant")) { - d.children.push(...u.children); + for (var l = [], h, c = 0; c < e.length; c++) { + var d = buildGroup(e[c], t); + if (d instanceof MathNode && h instanceof MathNode) { + if (d.type === "mtext" && h.type === "mtext" && d.getAttribute("mathvariant") === h.getAttribute("mathvariant")) { + h.children.push(...d.children); continue; - } else if (u.type === "mn" && d.type === "mn") { - d.children.push(...u.children); + } else if (d.type === "mn" && h.type === "mn") { + h.children.push(...d.children); continue; - } else if (u.type === "mi" && u.children.length === 1 && d.type === "mn") { - var p = u.children[0]; - if (p instanceof TextNode && p.text === ".") { - d.children.push(...u.children); + } else if (d.type === "mi" && d.children.length === 1 && h.type === "mn") { + var _ = d.children[0]; + if (_ instanceof TextNode && _.text === ".") { + h.children.push(...d.children); continue; } - } else if (d.type === "mi" && d.children.length === 1) { - var m = d.children[0]; - if (m instanceof TextNode && m.text === "̸" && (u.type === "mo" || u.type === "mi" || u.type === "mn")) { - var y = u.children[0]; + } else if (h.type === "mi" && h.children.length === 1) { + var m = h.children[0]; + if (m instanceof TextNode && m.text === "̸" && (d.type === "mo" || d.type === "mi" || d.type === "mn")) { + var y = d.children[0]; y instanceof TextNode && y.text.length > 0 && (y.text = y.text.slice(0, 1) + "̸" + y.text.slice(1), l.pop()); } } } - l.push(u), d = u; + l.push(d), h = d; } return l; }, buildExpressionRow = function(e, t, r) { @@ -5707,19 +5707,19 @@ var mathMLTree = { return e.type === "ordgroup" ? e.body.length : 1; }, svgSpan = function(e, t) { function r() { - var o = 4e5, u = e.label.slice(1); - if (utils.contains(["widehat", "widecheck", "widetilde", "utilde"], u)) { - var p = e, m = groupLength(p.base), y, w, b; + var c = 4e5, d = e.label.slice(1); + if (utils.contains(["widehat", "widecheck", "widetilde", "utilde"], d)) { + var _ = e, m = groupLength(_.base), y, x, b; if (m > 5) - u === "widehat" || u === "widecheck" ? (y = 420, o = 2364, b = 0.42, w = u + "4") : (y = 312, o = 2340, b = 0.34, w = "tilde4"); + d === "widehat" || d === "widecheck" ? (y = 420, c = 2364, b = 0.42, x = d + "4") : (y = 312, c = 2340, b = 0.34, x = "tilde4"); else { var A = [1, 1, 2, 2, 3, 3][m]; - u === "widehat" || u === "widecheck" ? (o = [0, 1062, 2364, 2364, 2364][A], y = [0, 239, 300, 360, 420][A], b = [0, 0.24, 0.3, 0.3, 0.36, 0.42][A], w = u + A) : (o = [0, 600, 1033, 2339, 2340][A], y = [0, 260, 286, 306, 312][A], b = [0, 0.26, 0.286, 0.3, 0.306, 0.34][A], w = "tilde" + A); + d === "widehat" || d === "widecheck" ? (c = [0, 1062, 2364, 2364, 2364][A], y = [0, 239, 300, 360, 420][A], b = [0, 0.24, 0.3, 0.3, 0.36, 0.42][A], x = d + A) : (c = [0, 600, 1033, 2339, 2340][A], y = [0, 260, 286, 306, 312][A], b = [0, 0.26, 0.286, 0.3, 0.306, 0.34][A], x = "tilde" + A); } - var f = new PathNode(w), s = new SvgNode([f], { + var f = new PathNode(x), s = new SvgNode([f], { width: "100%", height: makeEm(b), - viewBox: "0 0 " + o + " " + y, + viewBox: "0 0 " + c + " " + y, preserveAspectRatio: "none" }); return { @@ -5728,9 +5728,9 @@ var mathMLTree = { height: b }; } else { - var h = [], _ = katexImagesData[u], [g, x, c] = _, v = c / 1e3, M = g.length, E, $; + var u = [], p = katexImagesData[d], [g, w, o] = p, v = o / 1e3, M = g.length, E, $; if (M === 1) { - var k = _[3]; + var k = p[3]; E = ["hide-tail"], $ = [k]; } else if (M === 2) E = ["halfarrow-left", "halfarrow-right"], $ = ["xMinYMin", "xMaxYMin"]; @@ -5743,20 +5743,20 @@ var mathMLTree = { var z = new PathNode(g[L]), O = new SvgNode([z], { width: "400em", height: makeEm(v), - viewBox: "0 0 " + o + " " + c, + viewBox: "0 0 " + c + " " + o, preserveAspectRatio: $[L] + " slice" }), R = buildCommon.makeSvgSpan([E[L]], [O], t); if (M === 1) return { span: R, - minWidth: x, + minWidth: w, height: v }; - R.style.height = makeEm(v), h.push(R); + R.style.height = makeEm(v), u.push(R); } return { - span: buildCommon.makeSpan(["stretchy"], h, t), - minWidth: x, + span: buildCommon.makeSpan(["stretchy"], u, t), + minWidth: w, height: v }; } @@ -5764,38 +5764,38 @@ var mathMLTree = { var { span: a, minWidth: l, - height: d + height: h } = r(); - return a.height = d, a.style.height = makeEm(d), l > 0 && (a.style.minWidth = makeEm(l)), a; + return a.height = h, a.style.height = makeEm(h), l > 0 && (a.style.minWidth = makeEm(l)), a; }, encloseSpan = function(e, t, r, a, l) { - var d, o = e.height + e.depth + r + a; + var h, c = e.height + e.depth + r + a; if (/fbox|color|angl/.test(t)) { - if (d = buildCommon.makeSpan(["stretchy", t], [], l), t === "fbox") { - var u = l.color && l.getColor(); - u && (d.style.borderColor = u); + if (h = buildCommon.makeSpan(["stretchy", t], [], l), t === "fbox") { + var d = l.color && l.getColor(); + d && (h.style.borderColor = d); } } else { - var p = []; - /^[bx]cancel$/.test(t) && p.push(new LineNode({ + var _ = []; + /^[bx]cancel$/.test(t) && _.push(new LineNode({ x1: "0", y1: "0", x2: "100%", y2: "100%", "stroke-width": "0.046em" - })), /^x?cancel$/.test(t) && p.push(new LineNode({ + })), /^x?cancel$/.test(t) && _.push(new LineNode({ x1: "0", y1: "100%", x2: "100%", y2: "0", "stroke-width": "0.046em" })); - var m = new SvgNode(p, { + var m = new SvgNode(_, { width: "100%", - height: makeEm(o) + height: makeEm(c) }); - d = buildCommon.makeSvgSpan([], [m], l); + h = buildCommon.makeSvgSpan([], [m], l); } - return d.height = o, d.style.height = makeEm(o), d; + return h.height = c, h.style.height = makeEm(c), h; }, stretchy = { encloseSpan, mathMLnode, @@ -5818,25 +5818,25 @@ function checkSymbolNodeType(n) { var htmlBuilder$a = (n, e) => { var t, r, a; n && n.type === "supsub" ? (r = assertNodeType(n.base, "accent"), t = r.base, n.base = t, a = assertSpan(buildGroup$1(n, e)), n.base = r) : (r = assertNodeType(n, "accent"), t = r.base); - var l = buildGroup$1(t, e.havingCrampedStyle()), d = r.isShifty && utils.isCharacterBox(t), o = 0; - if (d) { - var u = utils.getBaseElem(t), p = buildGroup$1(u, e.havingCrampedStyle()); - o = assertSymbolDomNode(p).skew; + var l = buildGroup$1(t, e.havingCrampedStyle()), h = r.isShifty && utils.isCharacterBox(t), c = 0; + if (h) { + var d = utils.getBaseElem(t), _ = buildGroup$1(d, e.havingCrampedStyle()); + c = assertSymbolDomNode(_).skew; } - var m = r.label === "\\c", y = m ? l.height + l.depth : Math.min(l.height, e.fontMetrics().xHeight), w; + var m = r.label === "\\c", y = m ? l.height + l.depth : Math.min(l.height, e.fontMetrics().xHeight), x; if (r.isStretchy) - w = stretchy.svgSpan(r, e), w = buildCommon.makeVList({ + x = stretchy.svgSpan(r, e), x = buildCommon.makeVList({ positionType: "firstBaseline", children: [{ type: "elem", elem: l }, { type: "elem", - elem: w, + elem: x, wrapperClasses: ["svg-align"], - wrapperStyle: o > 0 ? { - width: "calc(100% - " + makeEm(2 * o) + ")", - marginLeft: makeEm(2 * o) + wrapperStyle: c > 0 ? { + width: "calc(100% - " + makeEm(2 * c) + ")", + marginLeft: makeEm(2 * c) } : void 0 }] }, e); @@ -5845,11 +5845,11 @@ var htmlBuilder$a = (n, e) => { r.label === "\\vec" ? (b = buildCommon.staticSvg("vec", e), A = buildCommon.svgData.vec[1]) : (b = buildCommon.makeOrd({ mode: r.mode, text: r.label - }, e, "textord"), b = assertSymbolDomNode(b), b.italic = 0, A = b.width, m && (y += b.depth)), w = buildCommon.makeSpan(["accent-body"], [b]); + }, e, "textord"), b = assertSymbolDomNode(b), b.italic = 0, A = b.width, m && (y += b.depth)), x = buildCommon.makeSpan(["accent-body"], [b]); var f = r.label === "\\textcircled"; - f && (w.classes.push("accent-full"), y = l.height); - var s = o; - f || (s -= A / 2), w.style.left = makeEm(s), r.label === "\\textcircled" && (w.style.top = ".2em"), w = buildCommon.makeVList({ + f && (x.classes.push("accent-full"), y = l.height); + var s = c; + f || (s -= A / 2), x.style.left = makeEm(s), r.label === "\\textcircled" && (x.style.top = ".2em"), x = buildCommon.makeVList({ positionType: "firstBaseline", children: [{ type: "elem", @@ -5859,12 +5859,12 @@ var htmlBuilder$a = (n, e) => { size: -y }, { type: "elem", - elem: w + elem: x }] }, e); } - var h = buildCommon.makeSpan(["mord", "accent"], [w], e); - return a ? (a.children[0] = h, a.height = Math.max(h.height, a.height), a.classes[0] = "mord", a) : h; + var u = buildCommon.makeSpan(["mord", "accent"], [x], e); + return a ? (a.children[0] = u, a.height = Math.max(u.height, a.height), a.classes[0] = "mord", a) : u; }, mathmlBuilder$9 = (n, e) => { var t = n.isStretchy ? stretchy.mathMLnode(n.label) : new mathMLTree.MathNode("mo", [makeText(n.label, n.mode)]), r = new mathMLTree.MathNode("mover", [buildGroup(n.base, e), t]); return r.setAttribute("accent", "true"), r; @@ -6012,26 +6012,26 @@ defineFunction({ htmlBuilder(n, e) { var t = e.style, r = e.havingStyle(t.sup()), a = buildCommon.wrapFragment(buildGroup$1(n.body, r, e), e), l = n.label.slice(0, 2) === "\\x" ? "x" : "cd"; a.classes.push(l + "-arrow-pad"); - var d; - n.below && (r = e.havingStyle(t.sub()), d = buildCommon.wrapFragment(buildGroup$1(n.below, r, e), e), d.classes.push(l + "-arrow-pad")); - var o = stretchy.svgSpan(n, e), u = -e.fontMetrics().axisHeight + 0.5 * o.height, p = -e.fontMetrics().axisHeight - 0.5 * o.height - 0.111; - (a.depth > 0.25 || n.label === "\\xleftequilibrium") && (p -= a.depth); + var h; + n.below && (r = e.havingStyle(t.sub()), h = buildCommon.wrapFragment(buildGroup$1(n.below, r, e), e), h.classes.push(l + "-arrow-pad")); + var c = stretchy.svgSpan(n, e), d = -e.fontMetrics().axisHeight + 0.5 * c.height, _ = -e.fontMetrics().axisHeight - 0.5 * c.height - 0.111; + (a.depth > 0.25 || n.label === "\\xleftequilibrium") && (_ -= a.depth); var m; - if (d) { - var y = -e.fontMetrics().axisHeight + d.height + 0.5 * o.height + 0.111; + if (h) { + var y = -e.fontMetrics().axisHeight + h.height + 0.5 * c.height + 0.111; m = buildCommon.makeVList({ positionType: "individualShift", children: [{ type: "elem", elem: a, - shift: p + shift: _ }, { type: "elem", - elem: o, - shift: u + elem: c, + shift: d }, { type: "elem", - elem: d, + elem: h, shift: y }] }, e); @@ -6041,11 +6041,11 @@ defineFunction({ children: [{ type: "elem", elem: a, - shift: p + shift: _ }, { type: "elem", - elem: o, - shift: u + elem: c, + shift: d }] }, e); return m.children[0].children[0].children[1].classes.push("svg-align"), buildCommon.makeSpan(["mrel", "x-arrow"], [m], e); @@ -6062,8 +6062,8 @@ defineFunction({ } else r = new mathMLTree.MathNode("mover", [t, a]); } else if (n.below) { - var d = paddedNode(buildGroup(n.below, e)); - r = new mathMLTree.MathNode("munder", [t, d]); + var h = paddedNode(buildGroup(n.below, e)); + r = new mathMLTree.MathNode("munder", [t, h]); } else r = paddedNode(), r = new mathMLTree.MathNode("mover", [t, r]); return r; @@ -6135,9 +6135,9 @@ defineFunction({ var { parser: t, funcName: r - } = n, a = e[1], l = e[0], d; - r !== "\\stackrel" ? d = binrelClass(a) : d = "mrel"; - var o = { + } = n, a = e[1], l = e[0], h; + r !== "\\stackrel" ? h = binrelClass(a) : h = "mrel"; + var c = { type: "op", mode: a.mode, limits: !0, @@ -6146,19 +6146,19 @@ defineFunction({ symbol: !1, suppressBaseShift: r !== "\\stackrel", body: ordargument(a) - }, u = { + }, d = { type: "supsub", mode: l.mode, - base: o, + base: c, sup: r === "\\underset" ? null : l, sub: r === "\\underset" ? l : null }; return { type: "mclass", mode: t.mode, - mclass: d, - body: [u], - isCharacterBox: utils.isCharacterBox(u) + mclass: h, + body: [d], + isCharacterBox: utils.isCharacterBox(d) }; }, htmlBuilder: htmlBuilder$9, @@ -6218,22 +6218,22 @@ function cdArrow(n, e, t) { text: r, mode: "math", family: "rel" - }, d = t.callFunction("\\Big", [l], []), o = t.callFunction("\\\\cdright", [e[1]], []), u = { + }, h = t.callFunction("\\Big", [l], []), c = t.callFunction("\\\\cdright", [e[1]], []), d = { type: "ordgroup", mode: "math", - body: [a, d, o] + body: [a, h, c] }; - return t.callFunction("\\\\cdparent", [u], []); + return t.callFunction("\\\\cdparent", [d], []); } case "\\\\cdlongequal": return t.callFunction("\\\\cdlongequal", [], []); case "\\Vert": { - var p = { + var _ = { type: "textord", text: "\\Vert", mode: "math" }; - return t.callFunction("\\Big", [p], []); + return t.callFunction("\\Big", [_], []); } default: return { @@ -6257,12 +6257,12 @@ function parseCD(n) { throw new ParseError("Expected \\\\ or \\cr or \\end", n.nextToken); } for (var r = [], a = [r], l = 0; l < e.length; l++) { - for (var d = e[l], o = newCell(), u = 0; u < d.length; u++) - if (!isStartOfArrow(d[u])) - o.body.push(d[u]); + for (var h = e[l], c = newCell(), d = 0; d < h.length; d++) + if (!isStartOfArrow(h[d])) + c.body.push(h[d]); else { - r.push(o), u += 1; - var p = assertSymbolNodeType(d[u]).text, m = new Array(2); + r.push(c), d += 1; + var _ = assertSymbolNodeType(h[d]).text, m = new Array(2); if (m[0] = { type: "ordgroup", mode: "math", @@ -6271,32 +6271,32 @@ function parseCD(n) { type: "ordgroup", mode: "math", body: [] - }, !("=|.".indexOf(p) > -1)) if ("<>AV".indexOf(p) > -1) + }, !("=|.".indexOf(_) > -1)) if ("<>AV".indexOf(_) > -1) for (var y = 0; y < 2; y++) { - for (var w = !0, b = u + 1; b < d.length; b++) { - if (isLabelEnd(d[b], p)) { - w = !1, u = b; + for (var x = !0, b = d + 1; b < h.length; b++) { + if (isLabelEnd(h[b], _)) { + x = !1, d = b; break; } - if (isStartOfArrow(d[b])) - throw new ParseError("Missing a " + p + " character to complete a CD arrow.", d[b]); - m[y].body.push(d[b]); + if (isStartOfArrow(h[b])) + throw new ParseError("Missing a " + _ + " character to complete a CD arrow.", h[b]); + m[y].body.push(h[b]); } - if (w) - throw new ParseError("Missing a " + p + " character to complete a CD arrow.", d[u]); + if (x) + throw new ParseError("Missing a " + _ + " character to complete a CD arrow.", h[d]); } else - throw new ParseError('Expected one of "<>AV=|." after @', d[u]); - var A = cdArrow(p, m, n), f = { + throw new ParseError('Expected one of "<>AV=|." after @', h[d]); + var A = cdArrow(_, m, n), f = { type: "styling", body: [A], mode: "math", style: "display" // CD is always displaystyle. }; - r.push(f), o = newCell(); + r.push(f), c = newCell(); } - l % 2 === 0 ? r.push(o) : r.shift(), r = [], a.push(r); + l % 2 === 0 ? r.push(c) : r.shift(), r = [], a.push(r); } n.gullet.endGroup(), n.gullet.endGroup(); var s = new Array(a[0].length).fill({ @@ -6380,19 +6380,19 @@ defineFunction({ handler(n, e) { for (var { parser: t - } = n, r = assertNodeType(e[0], "ordgroup"), a = r.body, l = "", d = 0; d < a.length; d++) { - var o = assertNodeType(a[d], "textord"); - l += o.text; + } = n, r = assertNodeType(e[0], "ordgroup"), a = r.body, l = "", h = 0; h < a.length; h++) { + var c = assertNodeType(a[h], "textord"); + l += c.text; } - var u = parseInt(l), p; - if (isNaN(u)) + var d = parseInt(l), _; + if (isNaN(d)) throw new ParseError("\\@char has non-numeric argument " + l); - if (u < 0 || u >= 1114111) + if (d < 0 || d >= 1114111) throw new ParseError("\\@char with invalid code point " + l); - return u <= 65535 ? p = String.fromCharCode(u) : (u -= 65536, p = String.fromCharCode((u >> 10) + 55296, (u & 1023) + 56320)), { + return d <= 65535 ? _ = String.fromCharCode(d) : (d -= 65536, _ = String.fromCharCode((d >> 10) + 55296, (d & 1023) + 56320)), { type: "textord", mode: t.mode, - text: p + text: _ }; } }); @@ -6546,29 +6546,29 @@ defineFunction({ } = n, r = e.gullet.popToken(), a = r.text; if (/^(?:[\\{}$&#^_]|EOF)$/.test(a)) throw new ParseError("Expected a control sequence", r); - for (var l = 0, d, o = [[]]; e.gullet.future().text !== "{"; ) + for (var l = 0, h, c = [[]]; e.gullet.future().text !== "{"; ) if (r = e.gullet.popToken(), r.text === "#") { if (e.gullet.future().text === "{") { - d = e.gullet.future(), o[l].push("{"); + h = e.gullet.future(), c[l].push("{"); break; } if (r = e.gullet.popToken(), !/^[1-9]$/.test(r.text)) throw new ParseError('Invalid argument number "' + r.text + '"'); if (parseInt(r.text) !== l + 1) throw new ParseError('Argument number "' + r.text + '" out of order'); - l++, o.push([]); + l++, c.push([]); } else { if (r.text === "EOF") throw new ParseError("Expected a macro definition"); - o[l].push(r.text); + c[l].push(r.text); } var { - tokens: u + tokens: d } = e.gullet.consumeArg(); - return d && u.unshift(d), (t === "\\edef" || t === "\\xdef") && (u = e.gullet.expandTokens(u), u.reverse()), e.gullet.macros.set(a, { - tokens: u, + return h && d.unshift(h), (t === "\\edef" || t === "\\xdef") && (d = e.gullet.expandTokens(d), d.reverse()), e.gullet.macros.set(a, { + tokens: d, numArgs: l, - delimiters: o + delimiters: c }, t === globalMap[t]), { type: "internal", mode: e.mode @@ -6629,19 +6629,19 @@ var getMetrics = function(e, t, r) { throw new Error("Unsupported symbol " + e + " and font size " + t + "."); return l; }, styleWrap = function(e, t, r, a) { - var l = r.havingBaseStyle(t), d = buildCommon.makeSpan(a.concat(l.sizingClasses(r)), [e], r), o = l.sizeMultiplier / r.sizeMultiplier; - return d.height *= o, d.depth *= o, d.maxFontSize = l.sizeMultiplier, d; + var l = r.havingBaseStyle(t), h = buildCommon.makeSpan(a.concat(l.sizingClasses(r)), [e], r), c = l.sizeMultiplier / r.sizeMultiplier; + return h.height *= c, h.depth *= c, h.maxFontSize = l.sizeMultiplier, h; }, centerSpan = function(e, t, r) { var a = t.havingBaseStyle(r), l = (1 - t.sizeMultiplier / a.sizeMultiplier) * t.fontMetrics().axisHeight; e.classes.push("delimcenter"), e.style.top = makeEm(l), e.height -= l, e.depth += l; -}, makeSmallDelim = function(e, t, r, a, l, d) { - var o = buildCommon.makeSymbol(e, "Main-Regular", l, a), u = styleWrap(o, t, a, d); - return r && centerSpan(u, a, t), u; +}, makeSmallDelim = function(e, t, r, a, l, h) { + var c = buildCommon.makeSymbol(e, "Main-Regular", l, a), d = styleWrap(c, t, a, h); + return r && centerSpan(d, a, t), d; }, mathrmSize = function(e, t, r, a) { return buildCommon.makeSymbol(e, "Size" + t + "-Regular", r, a); -}, makeLargeDelim = function(e, t, r, a, l, d) { - var o = mathrmSize(e, t, l, a), u = styleWrap(buildCommon.makeSpan(["delimsizing", "size" + t], [o], a), Style$1.TEXT, a, d); - return r && centerSpan(u, a, Style$1.TEXT), u; +}, makeLargeDelim = function(e, t, r, a, l, h) { + var c = mathrmSize(e, t, l, a), d = styleWrap(buildCommon.makeSpan(["delimsizing", "size" + t], [c], a), Style$1.TEXT, a, h); + return r && centerSpan(d, a, Style$1.TEXT), d; }, makeGlyphSpan = function(e, t, r) { var a; t === "Size1-Regular" ? a = "delim-size1" : a = "delim-size4"; @@ -6651,79 +6651,79 @@ var getMetrics = function(e, t, r) { elem: l }; }, makeInner = function(e, t, r) { - var a = fontMetricsData["Size4-Regular"][e.charCodeAt(0)] ? fontMetricsData["Size4-Regular"][e.charCodeAt(0)][4] : fontMetricsData["Size1-Regular"][e.charCodeAt(0)][4], l = new PathNode("inner", innerPath(e, Math.round(1e3 * t))), d = new SvgNode([l], { + var a = fontMetricsData["Size4-Regular"][e.charCodeAt(0)] ? fontMetricsData["Size4-Regular"][e.charCodeAt(0)][4] : fontMetricsData["Size1-Regular"][e.charCodeAt(0)][4], l = new PathNode("inner", innerPath(e, Math.round(1e3 * t))), h = new SvgNode([l], { width: makeEm(a), height: makeEm(t), // Override CSS rule `.katex svg { width: 100% }` style: "width:" + makeEm(a), viewBox: "0 0 " + 1e3 * a + " " + Math.round(1e3 * t), preserveAspectRatio: "xMinYMin" - }), o = buildCommon.makeSvgSpan([], [d], r); - return o.height = t, o.style.height = makeEm(t), o.style.width = makeEm(a), { + }), c = buildCommon.makeSvgSpan([], [h], r); + return c.height = t, c.style.height = makeEm(t), c.style.width = makeEm(a), { type: "elem", - elem: o + elem: c }; }, lapInEms = 8e-3, lap = { type: "kern", size: -1 * lapInEms -}, verts = ["|", "\\lvert", "\\rvert", "\\vert"], doubleVerts = ["\\|", "\\lVert", "\\rVert", "\\Vert"], makeStackedDelim = function(e, t, r, a, l, d) { - var o, u, p, m, y = "", w = 0; - o = p = m = e, u = null; +}, verts = ["|", "\\lvert", "\\rvert", "\\vert"], doubleVerts = ["\\|", "\\lVert", "\\rVert", "\\Vert"], makeStackedDelim = function(e, t, r, a, l, h) { + var c, d, _, m, y = "", x = 0; + c = _ = m = e, d = null; var b = "Size1-Regular"; - e === "\\uparrow" ? p = m = "⏐" : e === "\\Uparrow" ? p = m = "‖" : e === "\\downarrow" ? o = p = "⏐" : e === "\\Downarrow" ? o = p = "‖" : e === "\\updownarrow" ? (o = "\\uparrow", p = "⏐", m = "\\downarrow") : e === "\\Updownarrow" ? (o = "\\Uparrow", p = "‖", m = "\\Downarrow") : utils.contains(verts, e) ? (p = "∣", y = "vert", w = 333) : utils.contains(doubleVerts, e) ? (p = "∥", y = "doublevert", w = 556) : e === "[" || e === "\\lbrack" ? (o = "⎡", p = "⎢", m = "⎣", b = "Size4-Regular", y = "lbrack", w = 667) : e === "]" || e === "\\rbrack" ? (o = "⎤", p = "⎥", m = "⎦", b = "Size4-Regular", y = "rbrack", w = 667) : e === "\\lfloor" || e === "⌊" ? (p = o = "⎢", m = "⎣", b = "Size4-Regular", y = "lfloor", w = 667) : e === "\\lceil" || e === "⌈" ? (o = "⎡", p = m = "⎢", b = "Size4-Regular", y = "lceil", w = 667) : e === "\\rfloor" || e === "⌋" ? (p = o = "⎥", m = "⎦", b = "Size4-Regular", y = "rfloor", w = 667) : e === "\\rceil" || e === "⌉" ? (o = "⎤", p = m = "⎥", b = "Size4-Regular", y = "rceil", w = 667) : e === "(" || e === "\\lparen" ? (o = "⎛", p = "⎜", m = "⎝", b = "Size4-Regular", y = "lparen", w = 875) : e === ")" || e === "\\rparen" ? (o = "⎞", p = "⎟", m = "⎠", b = "Size4-Regular", y = "rparen", w = 875) : e === "\\{" || e === "\\lbrace" ? (o = "⎧", u = "⎨", m = "⎩", p = "⎪", b = "Size4-Regular") : e === "\\}" || e === "\\rbrace" ? (o = "⎫", u = "⎬", m = "⎭", p = "⎪", b = "Size4-Regular") : e === "\\lgroup" || e === "⟮" ? (o = "⎧", m = "⎩", p = "⎪", b = "Size4-Regular") : e === "\\rgroup" || e === "⟯" ? (o = "⎫", m = "⎭", p = "⎪", b = "Size4-Regular") : e === "\\lmoustache" || e === "⎰" ? (o = "⎧", m = "⎭", p = "⎪", b = "Size4-Regular") : (e === "\\rmoustache" || e === "⎱") && (o = "⎫", m = "⎩", p = "⎪", b = "Size4-Regular"); - var A = getMetrics(o, b, l), f = A.height + A.depth, s = getMetrics(p, b, l), h = s.height + s.depth, _ = getMetrics(m, b, l), g = _.height + _.depth, x = 0, c = 1; - if (u !== null) { - var v = getMetrics(u, b, l); - x = v.height + v.depth, c = 2; + e === "\\uparrow" ? _ = m = "⏐" : e === "\\Uparrow" ? _ = m = "‖" : e === "\\downarrow" ? c = _ = "⏐" : e === "\\Downarrow" ? c = _ = "‖" : e === "\\updownarrow" ? (c = "\\uparrow", _ = "⏐", m = "\\downarrow") : e === "\\Updownarrow" ? (c = "\\Uparrow", _ = "‖", m = "\\Downarrow") : utils.contains(verts, e) ? (_ = "∣", y = "vert", x = 333) : utils.contains(doubleVerts, e) ? (_ = "∥", y = "doublevert", x = 556) : e === "[" || e === "\\lbrack" ? (c = "⎡", _ = "⎢", m = "⎣", b = "Size4-Regular", y = "lbrack", x = 667) : e === "]" || e === "\\rbrack" ? (c = "⎤", _ = "⎥", m = "⎦", b = "Size4-Regular", y = "rbrack", x = 667) : e === "\\lfloor" || e === "⌊" ? (_ = c = "⎢", m = "⎣", b = "Size4-Regular", y = "lfloor", x = 667) : e === "\\lceil" || e === "⌈" ? (c = "⎡", _ = m = "⎢", b = "Size4-Regular", y = "lceil", x = 667) : e === "\\rfloor" || e === "⌋" ? (_ = c = "⎥", m = "⎦", b = "Size4-Regular", y = "rfloor", x = 667) : e === "\\rceil" || e === "⌉" ? (c = "⎤", _ = m = "⎥", b = "Size4-Regular", y = "rceil", x = 667) : e === "(" || e === "\\lparen" ? (c = "⎛", _ = "⎜", m = "⎝", b = "Size4-Regular", y = "lparen", x = 875) : e === ")" || e === "\\rparen" ? (c = "⎞", _ = "⎟", m = "⎠", b = "Size4-Regular", y = "rparen", x = 875) : e === "\\{" || e === "\\lbrace" ? (c = "⎧", d = "⎨", m = "⎩", _ = "⎪", b = "Size4-Regular") : e === "\\}" || e === "\\rbrace" ? (c = "⎫", d = "⎬", m = "⎭", _ = "⎪", b = "Size4-Regular") : e === "\\lgroup" || e === "⟮" ? (c = "⎧", m = "⎩", _ = "⎪", b = "Size4-Regular") : e === "\\rgroup" || e === "⟯" ? (c = "⎫", m = "⎭", _ = "⎪", b = "Size4-Regular") : e === "\\lmoustache" || e === "⎰" ? (c = "⎧", m = "⎭", _ = "⎪", b = "Size4-Regular") : (e === "\\rmoustache" || e === "⎱") && (c = "⎫", m = "⎩", _ = "⎪", b = "Size4-Regular"); + var A = getMetrics(c, b, l), f = A.height + A.depth, s = getMetrics(_, b, l), u = s.height + s.depth, p = getMetrics(m, b, l), g = p.height + p.depth, w = 0, o = 1; + if (d !== null) { + var v = getMetrics(d, b, l); + w = v.height + v.depth, o = 2; } - var M = f + g + x, E = Math.max(0, Math.ceil((t - M) / (c * h))), $ = M + E * c * h, k = a.fontMetrics().axisHeight; + var M = f + g + w, E = Math.max(0, Math.ceil((t - M) / (o * u))), $ = M + E * o * u, k = a.fontMetrics().axisHeight; r && (k *= a.sizeMultiplier); var L = $ / 2 - k, z = []; if (y.length > 0) { - var O = $ - f - g, R = Math.round($ * 1e3), P = tallDelim(y, Math.round(O * 1e3)), U = new PathNode(y, P), B = (w / 1e3).toFixed(3) + "em", N = (R / 1e3).toFixed(3) + "em", G = new SvgNode([U], { + var O = $ - f - g, R = Math.round($ * 1e3), N = tallDelim(y, Math.round(O * 1e3)), W = new PathNode(y, N), B = (x / 1e3).toFixed(3) + "em", P = (R / 1e3).toFixed(3) + "em", G = new SvgNode([W], { width: B, - height: N, - viewBox: "0 0 " + w + " " + R + height: P, + viewBox: "0 0 " + x + " " + R }), H = buildCommon.makeSvgSpan([], [G], a); - H.height = R / 1e3, H.style.width = B, H.style.height = N, z.push({ + H.height = R / 1e3, H.style.width = B, H.style.height = P, z.push({ type: "elem", elem: H }); } else { - if (z.push(makeGlyphSpan(m, b, l)), z.push(lap), u === null) { - var W = $ - f - g + 2 * lapInEms; - z.push(makeInner(p, W, a)); + if (z.push(makeGlyphSpan(m, b, l)), z.push(lap), d === null) { + var U = $ - f - g + 2 * lapInEms; + z.push(makeInner(_, U, a)); } else { - var V = ($ - f - g - x) / 2 + 2 * lapInEms; - z.push(makeInner(p, V, a)), z.push(lap), z.push(makeGlyphSpan(u, b, l)), z.push(lap), z.push(makeInner(p, V, a)); + var j = ($ - f - g - w) / 2 + 2 * lapInEms; + z.push(makeInner(_, j, a)), z.push(lap), z.push(makeGlyphSpan(d, b, l)), z.push(lap), z.push(makeInner(_, j, a)); } - z.push(lap), z.push(makeGlyphSpan(o, b, l)); + z.push(lap), z.push(makeGlyphSpan(c, b, l)); } var re = a.havingBaseStyle(Style$1.TEXT), ie = buildCommon.makeVList({ positionType: "bottom", positionData: L, children: z }, re); - return styleWrap(buildCommon.makeSpan(["delimsizing", "mult"], [ie], re), Style$1.TEXT, a, d); + return styleWrap(buildCommon.makeSpan(["delimsizing", "mult"], [ie], re), Style$1.TEXT, a, h); }, vbPad = 80, emPad = 0.08, sqrtSvg = function(e, t, r, a, l) { - var d = sqrtPath(e, a, r), o = new PathNode(e, d), u = new SvgNode([o], { + var h = sqrtPath(e, a, r), c = new PathNode(e, h), d = new SvgNode([c], { // Note: 1000:1 ratio of viewBox to document em width. width: "400em", height: makeEm(t), viewBox: "0 0 400000 " + r, preserveAspectRatio: "xMinYMin slice" }); - return buildCommon.makeSvgSpan(["hide-tail"], [u], l); + return buildCommon.makeSvgSpan(["hide-tail"], [d], l); }, makeSqrtImage = function(e, t) { - var r = t.havingBaseSizing(), a = traverseSequence("\\surd", e * r.sizeMultiplier, stackLargeDelimiterSequence, r), l = r.sizeMultiplier, d = Math.max(0, t.minRuleThickness - t.fontMetrics().sqrtRuleThickness), o, u = 0, p = 0, m = 0, y; - return a.type === "small" ? (m = 1e3 + 1e3 * d + vbPad, e < 1 ? l = 1 : e < 1.4 && (l = 0.7), u = (1 + d + emPad) / l, p = (1 + d) / l, o = sqrtSvg("sqrtMain", u, m, d, t), o.style.minWidth = "0.853em", y = 0.833 / l) : a.type === "large" ? (m = (1e3 + vbPad) * sizeToMaxHeight[a.size], p = (sizeToMaxHeight[a.size] + d) / l, u = (sizeToMaxHeight[a.size] + d + emPad) / l, o = sqrtSvg("sqrtSize" + a.size, u, m, d, t), o.style.minWidth = "1.02em", y = 1 / l) : (u = e + d + emPad, p = e + d, m = Math.floor(1e3 * e + d) + vbPad, o = sqrtSvg("sqrtTall", u, m, d, t), o.style.minWidth = "0.742em", y = 1.056), o.height = p, o.style.height = makeEm(u), { - span: o, + var r = t.havingBaseSizing(), a = traverseSequence("\\surd", e * r.sizeMultiplier, stackLargeDelimiterSequence, r), l = r.sizeMultiplier, h = Math.max(0, t.minRuleThickness - t.fontMetrics().sqrtRuleThickness), c, d = 0, _ = 0, m = 0, y; + return a.type === "small" ? (m = 1e3 + 1e3 * h + vbPad, e < 1 ? l = 1 : e < 1.4 && (l = 0.7), d = (1 + h + emPad) / l, _ = (1 + h) / l, c = sqrtSvg("sqrtMain", d, m, h, t), c.style.minWidth = "0.853em", y = 0.833 / l) : a.type === "large" ? (m = (1e3 + vbPad) * sizeToMaxHeight[a.size], _ = (sizeToMaxHeight[a.size] + h) / l, d = (sizeToMaxHeight[a.size] + h + emPad) / l, c = sqrtSvg("sqrtSize" + a.size, d, m, h, t), c.style.minWidth = "1.02em", y = 1 / l) : (d = e + h + emPad, _ = e + h, m = Math.floor(1e3 * e + h) + vbPad, c = sqrtSvg("sqrtTall", d, m, h, t), c.style.minWidth = "0.742em", y = 1.056), c.height = _, c.style.height = makeEm(d), { + span: c, advanceWidth: y, // Calculate the actual line width. // This actually should depend on the chosen font -- e.g. \boldmath // should use the thicker surd symbols from e.g. KaTeX_Main-Bold, and // have thicker rules. - ruleWidth: (t.fontMetrics().sqrtRuleThickness + d) * l + ruleWidth: (t.fontMetrics().sqrtRuleThickness + h) * l }; }, stackLargeDelimiters = ["(", "\\lparen", ")", "\\rparen", "[", "\\lbrack", "]", "\\rbrack", "\\{", "\\lbrace", "\\}", "\\rbrace", "\\lfloor", "\\rfloor", "⌊", "⌋", "\\lceil", "\\rceil", "⌈", "⌉", "\\surd"], stackAlwaysDelimiters = ["\\uparrow", "\\downarrow", "\\updownarrow", "\\Uparrow", "\\Downarrow", "\\Updownarrow", "|", "\\|", "\\vert", "\\Vert", "\\lvert", "\\rvert", "\\lVert", "\\rVert", "\\lgroup", "\\rgroup", "⟮", "⟯", "\\lmoustache", "\\rmoustache", "⎰", "⎱"], stackNeverDelimiters = ["<", ">", "\\langle", "\\rangle", "/", "\\backslash", "\\lt", "\\gt"], sizeToMaxHeight = [0, 1.2, 1.8, 2.4, 3], makeSizedDelim = function(e, t, r, a, l) { if (e === "<" || e === "\\lt" || e === "⟨" ? e = "\\langle" : (e === ">" || e === "\\gt" || e === "⟩") && (e = "\\rangle"), utils.contains(stackLargeDelimiters, e) || utils.contains(stackNeverDelimiters, e)) @@ -6795,24 +6795,24 @@ var getMetrics = function(e, t, r) { return "Size4-Regular"; throw new Error("Add support for delim type '" + e.type + "' here."); }, traverseSequence = function(e, t, r, a) { - for (var l = Math.min(2, 3 - a.style.size), d = l; d < r.length && r[d].type !== "stack"; d++) { - var o = getMetrics(e, delimTypeToFont(r[d]), "math"), u = o.height + o.depth; - if (r[d].type === "small") { - var p = a.havingBaseStyle(r[d].style); - u *= p.sizeMultiplier; + for (var l = Math.min(2, 3 - a.style.size), h = l; h < r.length && r[h].type !== "stack"; h++) { + var c = getMetrics(e, delimTypeToFont(r[h]), "math"), d = c.height + c.depth; + if (r[h].type === "small") { + var _ = a.havingBaseStyle(r[h].style); + d *= _.sizeMultiplier; } - if (u > t) - return r[d]; + if (d > t) + return r[h]; } return r[r.length - 1]; -}, makeCustomSizedDelim = function(e, t, r, a, l, d) { +}, makeCustomSizedDelim = function(e, t, r, a, l, h) { e === "<" || e === "\\lt" || e === "⟨" ? e = "\\langle" : (e === ">" || e === "\\gt" || e === "⟩") && (e = "\\rangle"); - var o; - utils.contains(stackNeverDelimiters, e) ? o = stackNeverDelimiterSequence : utils.contains(stackLargeDelimiters, e) ? o = stackLargeDelimiterSequence : o = stackAlwaysDelimiterSequence; - var u = traverseSequence(e, t, o, a); - return u.type === "small" ? makeSmallDelim(e, u.style, r, a, l, d) : u.type === "large" ? makeLargeDelim(e, u.size, r, a, l, d) : makeStackedDelim(e, t, r, a, l, d); -}, makeLeftRightDelim = function(e, t, r, a, l, d) { - var o = a.fontMetrics().axisHeight * a.sizeMultiplier, u = 901, p = 5 / a.fontMetrics().ptPerEm, m = Math.max(t - o, r + o), y = Math.max( + var c; + utils.contains(stackNeverDelimiters, e) ? c = stackNeverDelimiterSequence : utils.contains(stackLargeDelimiters, e) ? c = stackLargeDelimiterSequence : c = stackAlwaysDelimiterSequence; + var d = traverseSequence(e, t, c, a); + return d.type === "small" ? makeSmallDelim(e, d.style, r, a, l, h) : d.type === "large" ? makeLargeDelim(e, d.size, r, a, l, h) : makeStackedDelim(e, t, r, a, l, h); +}, makeLeftRightDelim = function(e, t, r, a, l, h) { + var c = a.fontMetrics().axisHeight * a.sizeMultiplier, d = 901, _ = 5 / a.fontMetrics().ptPerEm, m = Math.max(t - c, r + c), y = Math.max( // In real TeX, calculations are done using integral values which are // 65536 per pt, or 655360 per em. So, the division here truncates in // TeX but doesn't here, producing different results. If we wanted to @@ -6822,10 +6822,10 @@ var getMetrics = function(e, t, r) { // (To see the difference, compare // x^{x^{\left(\rule{0.1em}{0.68em}\right)}} // in TeX and KaTeX) - m / 500 * u, - 2 * m - p + m / 500 * d, + 2 * m - _ ); - return makeCustomSizedDelim(e, y, !0, a, l, d); + return makeCustomSizedDelim(e, y, !0, a, l, h); }, delimiter = { sqrtImage: makeSqrtImage, sizedDelim: makeSizedDelim, @@ -6979,21 +6979,21 @@ defineFunction({ }, htmlBuilder: (n, e) => { assertParsed(n); - for (var t = buildExpression$1(n.body, e, !0, ["mopen", "mclose"]), r = 0, a = 0, l = !1, d = 0; d < t.length; d++) - t[d].isMiddle ? l = !0 : (r = Math.max(t[d].height, r), a = Math.max(t[d].depth, a)); + for (var t = buildExpression$1(n.body, e, !0, ["mopen", "mclose"]), r = 0, a = 0, l = !1, h = 0; h < t.length; h++) + t[h].isMiddle ? l = !0 : (r = Math.max(t[h].height, r), a = Math.max(t[h].depth, a)); r *= e.sizeMultiplier, a *= e.sizeMultiplier; - var o; - if (n.left === "." ? o = makeNullDelimiter(e, ["mopen"]) : o = delimiter.leftRightDelim(n.left, r, a, e, n.mode, ["mopen"]), t.unshift(o), l) - for (var u = 1; u < t.length; u++) { - var p = t[u], m = p.isMiddle; - m && (t[u] = delimiter.leftRightDelim(m.delim, r, a, m.options, n.mode, [])); + var c; + if (n.left === "." ? c = makeNullDelimiter(e, ["mopen"]) : c = delimiter.leftRightDelim(n.left, r, a, e, n.mode, ["mopen"]), t.unshift(c), l) + for (var d = 1; d < t.length; d++) { + var _ = t[d], m = _.isMiddle; + m && (t[d] = delimiter.leftRightDelim(m.delim, r, a, m.options, n.mode, [])); } var y; if (n.right === ".") y = makeNullDelimiter(e, ["mclose"]); else { - var w = n.rightColor ? e.withColor(n.rightColor) : e; - y = delimiter.leftRightDelim(n.right, r, a, w, n.mode, ["mclose"]); + var x = n.rightColor ? e.withColor(n.rightColor) : e; + y = delimiter.leftRightDelim(n.right, r, a, x, n.mode, ["mclose"]); } return t.push(y), buildCommon.makeSpan(["minner"], t, e); }, @@ -7048,47 +7048,47 @@ defineFunction({ } }); var htmlBuilder$7 = (n, e) => { - var t = buildCommon.wrapFragment(buildGroup$1(n.body, e), e), r = n.label.slice(1), a = e.sizeMultiplier, l, d = 0, o = utils.isCharacterBox(n.body); + var t = buildCommon.wrapFragment(buildGroup$1(n.body, e), e), r = n.label.slice(1), a = e.sizeMultiplier, l, h = 0, c = utils.isCharacterBox(n.body); if (r === "sout") - l = buildCommon.makeSpan(["stretchy", "sout"]), l.height = e.fontMetrics().defaultRuleThickness / a, d = -0.5 * e.fontMetrics().xHeight; + l = buildCommon.makeSpan(["stretchy", "sout"]), l.height = e.fontMetrics().defaultRuleThickness / a, h = -0.5 * e.fontMetrics().xHeight; else if (r === "phase") { - var u = calculateSize({ + var d = calculateSize({ number: 0.6, unit: "pt" - }, e), p = calculateSize({ + }, e), _ = calculateSize({ number: 0.35, unit: "ex" }, e), m = e.havingBaseSizing(); a = a / m.sizeMultiplier; - var y = t.height + t.depth + u + p; - t.style.paddingLeft = makeEm(y / 2 + u); - var w = Math.floor(1e3 * y * a), b = phasePath(w), A = new SvgNode([new PathNode("phase", b)], { + var y = t.height + t.depth + d + _; + t.style.paddingLeft = makeEm(y / 2 + d); + var x = Math.floor(1e3 * y * a), b = phasePath(x), A = new SvgNode([new PathNode("phase", b)], { width: "400em", - height: makeEm(w / 1e3), - viewBox: "0 0 400000 " + w, + height: makeEm(x / 1e3), + viewBox: "0 0 400000 " + x, preserveAspectRatio: "xMinYMin slice" }); - l = buildCommon.makeSvgSpan(["hide-tail"], [A], e), l.style.height = makeEm(y), d = t.depth + u + p; + l = buildCommon.makeSvgSpan(["hide-tail"], [A], e), l.style.height = makeEm(y), h = t.depth + d + _; } else { - /cancel/.test(r) ? o || t.classes.push("cancel-pad") : r === "angl" ? t.classes.push("anglpad") : t.classes.push("boxpad"); - var f = 0, s = 0, h = 0; - /box/.test(r) ? (h = Math.max( + /cancel/.test(r) ? c || t.classes.push("cancel-pad") : r === "angl" ? t.classes.push("anglpad") : t.classes.push("boxpad"); + var f = 0, s = 0, u = 0; + /box/.test(r) ? (u = Math.max( e.fontMetrics().fboxrule, // default e.minRuleThickness // User override. - ), f = e.fontMetrics().fboxsep + (r === "colorbox" ? 0 : h), s = f) : r === "angl" ? (h = Math.max(e.fontMetrics().defaultRuleThickness, e.minRuleThickness), f = 4 * h, s = Math.max(0, 0.25 - t.depth)) : (f = o ? 0.2 : 0, s = f), l = stretchy.encloseSpan(t, r, f, s, e), /fbox|boxed|fcolorbox/.test(r) ? (l.style.borderStyle = "solid", l.style.borderWidth = makeEm(h)) : r === "angl" && h !== 0.049 && (l.style.borderTopWidth = makeEm(h), l.style.borderRightWidth = makeEm(h)), d = t.depth + s, n.backgroundColor && (l.style.backgroundColor = n.backgroundColor, n.borderColor && (l.style.borderColor = n.borderColor)); + ), f = e.fontMetrics().fboxsep + (r === "colorbox" ? 0 : u), s = f) : r === "angl" ? (u = Math.max(e.fontMetrics().defaultRuleThickness, e.minRuleThickness), f = 4 * u, s = Math.max(0, 0.25 - t.depth)) : (f = c ? 0.2 : 0, s = f), l = stretchy.encloseSpan(t, r, f, s, e), /fbox|boxed|fcolorbox/.test(r) ? (l.style.borderStyle = "solid", l.style.borderWidth = makeEm(u)) : r === "angl" && u !== 0.049 && (l.style.borderTopWidth = makeEm(u), l.style.borderRightWidth = makeEm(u)), h = t.depth + s, n.backgroundColor && (l.style.backgroundColor = n.backgroundColor, n.borderColor && (l.style.borderColor = n.borderColor)); } - var _; + var p; if (n.backgroundColor) - _ = buildCommon.makeVList({ + p = buildCommon.makeVList({ positionType: "individualShift", children: [ // Put the color background behind inner; { type: "elem", elem: l, - shift: d + shift: h }, { type: "elem", @@ -7099,7 +7099,7 @@ var htmlBuilder$7 = (n, e) => { }, e); else { var g = /cancel|phase/.test(r) ? ["svg-align"] : []; - _ = buildCommon.makeVList({ + p = buildCommon.makeVList({ positionType: "individualShift", children: [ // Write the \cancel stroke on top of inner. @@ -7111,13 +7111,13 @@ var htmlBuilder$7 = (n, e) => { { type: "elem", elem: l, - shift: d, + shift: h, wrapperClasses: g } ] }, e); } - return /cancel/.test(r) && (_.height = t.height, _.depth = t.depth), /cancel/.test(r) && !o ? buildCommon.makeSpan(["mord", "cancel-lap"], [_], e) : buildCommon.makeSpan(["mord"], [_], e); + return /cancel/.test(r) && (p.height = t.height, p.depth = t.depth), /cancel/.test(r) && !c ? buildCommon.makeSpan(["mord", "cancel-lap"], [p], e) : buildCommon.makeSpan(["mord"], [p], e); }, mathmlBuilder$6 = (n, e) => { var t = 0, r = new mathMLTree.MathNode(n.label.indexOf("colorbox") > -1 ? "mpadded" : "menclose", [buildGroup(n.body, e)]); switch (n.label) { @@ -7169,13 +7169,13 @@ defineFunction({ var { parser: r, funcName: a - } = n, l = assertNodeType(e[0], "color-token").color, d = e[1]; + } = n, l = assertNodeType(e[0], "color-token").color, h = e[1]; return { type: "enclose", mode: r.mode, label: a, backgroundColor: l, - body: d + body: h }; }, htmlBuilder: htmlBuilder$7, @@ -7193,14 +7193,14 @@ defineFunction({ var { parser: r, funcName: a - } = n, l = assertNodeType(e[0], "color-token").color, d = assertNodeType(e[1], "color-token").color, o = e[2]; + } = n, l = assertNodeType(e[0], "color-token").color, h = assertNodeType(e[1], "color-token").color, c = e[2]; return { type: "enclose", mode: r.mode, label: a, - backgroundColor: d, + backgroundColor: h, borderColor: l, - body: o + body: c }; }, htmlBuilder: htmlBuilder$7, @@ -7275,16 +7275,16 @@ function defineEnvironment(n) { props: r, handler: a, htmlBuilder: l, - mathmlBuilder: d - } = n, o = { + mathmlBuilder: h + } = n, c = { type: e, numArgs: r.numArgs || 0, allowedInText: !1, numOptionalArgs: 0, handler: a - }, u = 0; u < t.length; ++u) - _environments[t[u]] = o; - l && (_htmlGroupBuilders[e] = l), d && (_mathmlGroupBuilders[e] = d); + }, d = 0; d < t.length; ++d) + _environments[t[d]] = c; + l && (_htmlGroupBuilders[e] = l), h && (_mathmlGroupBuilders[e] = h); } var _macros = {}; function defineMacro(n, e) { @@ -7312,56 +7312,56 @@ function parseArray(n, e, t) { hskipBeforeAndAfter: r, addJot: a, cols: l, - arraystretch: d, - colSeparationType: o, - autoTag: u, - singleRow: p, + arraystretch: h, + colSeparationType: c, + autoTag: d, + singleRow: _, emptySingleRow: m, maxNumCols: y, - leqno: w + leqno: x } = e; - if (n.gullet.beginGroup(), p || n.gullet.macros.set("\\cr", "\\\\\\relax"), !d) { + if (n.gullet.beginGroup(), _ || n.gullet.macros.set("\\cr", "\\\\\\relax"), !h) { var b = n.gullet.expandMacroAsText("\\arraystretch"); if (b == null) - d = 1; - else if (d = parseFloat(b), !d || d < 0) + h = 1; + else if (h = parseFloat(b), !h || h < 0) throw new ParseError("Invalid \\arraystretch: " + b); } n.gullet.beginGroup(); - var A = [], f = [A], s = [], h = [], _ = u != null ? [] : void 0; + var A = [], f = [A], s = [], u = [], p = d != null ? [] : void 0; function g() { - u && n.gullet.macros.set("\\@eqnsw", "1", !0); + d && n.gullet.macros.set("\\@eqnsw", "1", !0); } - function x() { - _ && (n.gullet.macros.get("\\df@tag") ? (_.push(n.subparse([new Token("\\df@tag")])), n.gullet.macros.set("\\df@tag", void 0, !0)) : _.push(!!u && n.gullet.macros.get("\\@eqnsw") === "1")); + function w() { + p && (n.gullet.macros.get("\\df@tag") ? (p.push(n.subparse([new Token("\\df@tag")])), n.gullet.macros.set("\\df@tag", void 0, !0)) : p.push(!!d && n.gullet.macros.get("\\@eqnsw") === "1")); } - for (g(), h.push(getHLines(n)); ; ) { - var c = n.parseExpression(!1, p ? "\\end" : "\\\\"); - n.gullet.endGroup(), n.gullet.beginGroup(), c = { + for (g(), u.push(getHLines(n)); ; ) { + var o = n.parseExpression(!1, _ ? "\\end" : "\\\\"); + n.gullet.endGroup(), n.gullet.beginGroup(), o = { type: "ordgroup", mode: n.mode, - body: c - }, t && (c = { + body: o + }, t && (o = { type: "styling", mode: n.mode, style: t, - body: [c] - }), A.push(c); + body: [o] + }), A.push(o); var v = n.fetch().text; if (v === "&") { if (y && A.length === y) { - if (p || o) + if (_ || c) throw new ParseError("Too many tab characters: &", n.nextToken); n.settings.reportNonstrict("textEnv", "Too few columns specified in the {array} column argument."); } n.consume(); } else if (v === "\\end") { - x(), A.length === 1 && c.type === "styling" && c.body[0].body.length === 0 && (f.length > 1 || !m) && f.pop(), h.length < f.length + 1 && h.push([]); + w(), A.length === 1 && o.type === "styling" && o.body[0].body.length === 0 && (f.length > 1 || !m) && f.pop(), u.length < f.length + 1 && u.push([]); break; } else if (v === "\\\\") { n.consume(); var M = void 0; - n.gullet.future().text !== " " && (M = n.parseSizeGroup(!0)), s.push(M ? M.value : null), x(), h.push(getHLines(n)), A = [], f.push(A), g(); + n.gullet.future().text !== " " && (M = n.parseSizeGroup(!0)), s.push(M ? M.value : null), w(), u.push(getHLines(n)), A = [], f.push(A), g(); } else throw new ParseError("Expected & or \\\\ or \\cr or \\end", n.nextToken); } @@ -7369,163 +7369,163 @@ function parseArray(n, e, t) { type: "array", mode: n.mode, addJot: a, - arraystretch: d, + arraystretch: h, body: f, cols: l, rowGaps: s, hskipBeforeAndAfter: r, - hLinesBeforeRow: h, - colSeparationType: o, - tags: _, - leqno: w + hLinesBeforeRow: u, + colSeparationType: c, + tags: p, + leqno: x }; } function dCellStyle(n) { return n.slice(0, 1) === "d" ? "display" : "text"; } var htmlBuilder$6 = function(e, t) { - var r, a, l = e.body.length, d = e.hLinesBeforeRow, o = 0, u = new Array(l), p = [], m = Math.max( + var r, a, l = e.body.length, h = e.hLinesBeforeRow, c = 0, d = new Array(l), _ = [], m = Math.max( // From LaTeX \showthe\arrayrulewidth. Equals 0.04 em. t.fontMetrics().arrayRuleWidth, t.minRuleThickness // User override. - ), y = 1 / t.fontMetrics().ptPerEm, w = 5 * y; + ), y = 1 / t.fontMetrics().ptPerEm, x = 5 * y; if (e.colSeparationType && e.colSeparationType === "small") { var b = t.havingStyle(Style$1.SCRIPT).sizeMultiplier; - w = 0.2778 * (b / t.sizeMultiplier); + x = 0.2778 * (b / t.sizeMultiplier); } var A = e.colSeparationType === "CD" ? calculateSize({ number: 3, unit: "ex" - }, t) : 12 * y, f = 3 * y, s = e.arraystretch * A, h = 0.7 * s, _ = 0.3 * s, g = 0; - function x(Ue) { - for (var We = 0; We < Ue.length; ++We) - We > 0 && (g += 0.25), p.push({ + }, t) : 12 * y, f = 3 * y, s = e.arraystretch * A, u = 0.7 * s, p = 0.3 * s, g = 0; + function w(Ue) { + for (var He = 0; He < Ue.length; ++He) + He > 0 && (g += 0.25), _.push({ pos: g, - isDashed: Ue[We] + isDashed: Ue[He] }); } - for (x(d[0]), r = 0; r < e.body.length; ++r) { - var c = e.body[r], v = h, M = _; - o < c.length && (o = c.length); - var E = new Array(c.length); - for (a = 0; a < c.length; ++a) { - var $ = buildGroup$1(c[a], t); + for (w(h[0]), r = 0; r < e.body.length; ++r) { + var o = e.body[r], v = u, M = p; + c < o.length && (c = o.length); + var E = new Array(o.length); + for (a = 0; a < o.length; ++a) { + var $ = buildGroup$1(o[a], t); M < $.depth && (M = $.depth), v < $.height && (v = $.height), E[a] = $; } var k = e.rowGaps[r], L = 0; - k && (L = calculateSize(k, t), L > 0 && (L += _, M < L && (M = L), L = 0)), e.addJot && (M += f), E.height = v, E.depth = M, g += v, E.pos = g, g += M + L, u[r] = E, x(d[r + 1]); + k && (L = calculateSize(k, t), L > 0 && (L += p, M < L && (M = L), L = 0)), e.addJot && (M += f), E.height = v, E.depth = M, g += v, E.pos = g, g += M + L, d[r] = E, w(h[r + 1]); } - var z = g / 2 + t.fontMetrics().axisHeight, O = e.cols || [], R = [], P, U, B = []; + var z = g / 2 + t.fontMetrics().axisHeight, O = e.cols || [], R = [], N, W, B = []; if (e.tags && e.tags.some((Ue) => Ue)) for (r = 0; r < l; ++r) { - var N = u[r], G = N.pos - z, H = e.tags[r], W = void 0; - H === !0 ? W = buildCommon.makeSpan(["eqn-num"], [], t) : H === !1 ? W = buildCommon.makeSpan([], [], t) : W = buildCommon.makeSpan([], buildExpression$1(H, t, !0), t), W.depth = N.depth, W.height = N.height, B.push({ + var P = d[r], G = P.pos - z, H = e.tags[r], U = void 0; + H === !0 ? U = buildCommon.makeSpan(["eqn-num"], [], t) : H === !1 ? U = buildCommon.makeSpan([], [], t) : U = buildCommon.makeSpan([], buildExpression$1(H, t, !0), t), U.depth = P.depth, U.height = P.height, B.push({ type: "elem", - elem: W, + elem: U, shift: G }); } for ( - a = 0, U = 0; + a = 0, W = 0; // Continue while either there are more columns or more column // descriptions, so trailing separators don't get lost. - a < o || U < O.length; - ++a, ++U + a < c || W < O.length; + ++a, ++W ) { - for (var V = O[U] || {}, re = !0; V.type === "separator"; ) { - if (re || (P = buildCommon.makeSpan(["arraycolsep"], []), P.style.width = makeEm(t.fontMetrics().doubleRuleSep), R.push(P)), V.separator === "|" || V.separator === ":") { - var ie = V.separator === "|" ? "solid" : "dashed", ee = buildCommon.makeSpan(["vertical-separator"], [], t); - ee.style.height = makeEm(g), ee.style.borderRightWidth = makeEm(m), ee.style.borderRightStyle = ie, ee.style.margin = "0 " + makeEm(-m / 2); - var ce = g - z; - ce && (ee.style.verticalAlign = makeEm(-ce)), R.push(ee); + for (var j = O[W] || {}, re = !0; j.type === "separator"; ) { + if (re || (N = buildCommon.makeSpan(["arraycolsep"], []), N.style.width = makeEm(t.fontMetrics().doubleRuleSep), R.push(N)), j.separator === "|" || j.separator === ":") { + var ie = j.separator === "|" ? "solid" : "dashed", te = buildCommon.makeSpan(["vertical-separator"], [], t); + te.style.height = makeEm(g), te.style.borderRightWidth = makeEm(m), te.style.borderRightStyle = ie, te.style.margin = "0 " + makeEm(-m / 2); + var ue = g - z; + ue && (te.style.verticalAlign = makeEm(-ue)), R.push(te); } else - throw new ParseError("Invalid separator type: " + V.separator); - U++, V = O[U] || {}, re = !1; + throw new ParseError("Invalid separator type: " + j.separator); + W++, j = O[W] || {}, re = !1; } - if (!(a >= o)) { - var he = void 0; - (a > 0 || e.hskipBeforeAndAfter) && (he = utils.deflt(V.pregap, w), he !== 0 && (P = buildCommon.makeSpan(["arraycolsep"], []), P.style.width = makeEm(he), R.push(P))); - var le = []; + if (!(a >= c)) { + var de = void 0; + (a > 0 || e.hskipBeforeAndAfter) && (de = utils.deflt(j.pregap, x), de !== 0 && (N = buildCommon.makeSpan(["arraycolsep"], []), N.style.width = makeEm(de), R.push(N))); + var oe = []; for (r = 0; r < l; ++r) { - var J = u[r], Me = J[a]; - if (Me) { + var J = d[r], Ee = J[a]; + if (Ee) { var se = J.pos - z; - Me.depth = J.depth, Me.height = J.height, le.push({ + Ee.depth = J.depth, Ee.height = J.height, oe.push({ type: "elem", - elem: Me, + elem: Ee, shift: se }); } } - le = buildCommon.makeVList({ + oe = buildCommon.makeVList({ positionType: "individualShift", - children: le - }, t), le = buildCommon.makeSpan(["col-align-" + (V.align || "c")], [le]), R.push(le), (a < o - 1 || e.hskipBeforeAndAfter) && (he = utils.deflt(V.postgap, w), he !== 0 && (P = buildCommon.makeSpan(["arraycolsep"], []), P.style.width = makeEm(he), R.push(P))); + children: oe + }, t), oe = buildCommon.makeSpan(["col-align-" + (j.align || "c")], [oe]), R.push(oe), (a < c - 1 || e.hskipBeforeAndAfter) && (de = utils.deflt(j.postgap, x), de !== 0 && (N = buildCommon.makeSpan(["arraycolsep"], []), N.style.width = makeEm(de), R.push(N))); } } - if (u = buildCommon.makeSpan(["mtable"], R), p.length > 0) { - for (var Ce = buildCommon.makeLineSpan("hline", t, m), ue = buildCommon.makeLineSpan("hdashline", t, m), ne = [{ + if (d = buildCommon.makeSpan(["mtable"], R), _.length > 0) { + for (var Ae = buildCommon.makeLineSpan("hline", t, m), he = buildCommon.makeLineSpan("hdashline", t, m), ne = [{ type: "elem", - elem: u, + elem: d, shift: 0 - }]; p.length > 0; ) { - var _e = p.pop(), Oe = _e.pos - z; + }]; _.length > 0; ) { + var _e = _.pop(), Le = _e.pos - z; _e.isDashed ? ne.push({ type: "elem", - elem: ue, - shift: Oe + elem: he, + shift: Le }) : ne.push({ type: "elem", - elem: Ce, - shift: Oe + elem: Ae, + shift: Le }); } - u = buildCommon.makeVList({ + d = buildCommon.makeVList({ positionType: "individualShift", children: ne }, t); } if (B.length === 0) - return buildCommon.makeSpan(["mord"], [u], t); - var Re = buildCommon.makeVList({ + return buildCommon.makeSpan(["mord"], [d], t); + var Be = buildCommon.makeVList({ positionType: "individualShift", children: B }, t); - return Re = buildCommon.makeSpan(["tag"], [Re], t), buildCommon.makeFragment([u, Re]); + return Be = buildCommon.makeSpan(["tag"], [Be], t), buildCommon.makeFragment([d, Be]); }, alignMap = { c: "center ", l: "left ", r: "right " }, mathmlBuilder$5 = function(e, t) { - for (var r = [], a = new mathMLTree.MathNode("mtd", [], ["mtr-glue"]), l = new mathMLTree.MathNode("mtd", [], ["mml-eqn-num"]), d = 0; d < e.body.length; d++) { - for (var o = e.body[d], u = [], p = 0; p < o.length; p++) - u.push(new mathMLTree.MathNode("mtd", [buildGroup(o[p], t)])); - e.tags && e.tags[d] && (u.unshift(a), u.push(a), e.leqno ? u.unshift(l) : u.push(l)), r.push(new mathMLTree.MathNode("mtr", u)); + for (var r = [], a = new mathMLTree.MathNode("mtd", [], ["mtr-glue"]), l = new mathMLTree.MathNode("mtd", [], ["mml-eqn-num"]), h = 0; h < e.body.length; h++) { + for (var c = e.body[h], d = [], _ = 0; _ < c.length; _++) + d.push(new mathMLTree.MathNode("mtd", [buildGroup(c[_], t)])); + e.tags && e.tags[h] && (d.unshift(a), d.push(a), e.leqno ? d.unshift(l) : d.push(l)), r.push(new mathMLTree.MathNode("mtr", d)); } var m = new mathMLTree.MathNode("mtable", r), y = e.arraystretch === 0.5 ? 0.1 : 0.16 + e.arraystretch - 1 + (e.addJot ? 0.09 : 0); m.setAttribute("rowspacing", makeEm(y)); - var w = "", b = ""; + var x = "", b = ""; if (e.cols && e.cols.length > 0) { - var A = e.cols, f = "", s = !1, h = 0, _ = A.length; - A[0].type === "separator" && (w += "top ", h = 1), A[A.length - 1].type === "separator" && (w += "bottom ", _ -= 1); - for (var g = h; g < _; g++) + var A = e.cols, f = "", s = !1, u = 0, p = A.length; + A[0].type === "separator" && (x += "top ", u = 1), A[A.length - 1].type === "separator" && (x += "bottom ", p -= 1); + for (var g = u; g < p; g++) A[g].type === "align" ? (b += alignMap[A[g].align], s && (f += "none "), s = !0) : A[g].type === "separator" && s && (f += A[g].separator === "|" ? "solid " : "dashed ", s = !1); m.setAttribute("columnalign", b.trim()), /[sd]/.test(f) && m.setAttribute("columnlines", f.trim()); } if (e.colSeparationType === "align") { - for (var x = e.cols || [], c = "", v = 1; v < x.length; v++) - c += v % 2 ? "0em " : "1em "; - m.setAttribute("columnspacing", c.trim()); + for (var w = e.cols || [], o = "", v = 1; v < w.length; v++) + o += v % 2 ? "0em " : "1em "; + m.setAttribute("columnspacing", o.trim()); } else e.colSeparationType === "alignat" || e.colSeparationType === "gather" ? m.setAttribute("columnspacing", "0em") : e.colSeparationType === "small" ? m.setAttribute("columnspacing", "0.2778em") : e.colSeparationType === "CD" ? m.setAttribute("columnspacing", "0.5em") : m.setAttribute("columnspacing", "1em"); var M = "", E = e.hLinesBeforeRow; - w += E[0].length > 0 ? "left " : "", w += E[E.length - 1].length > 0 ? "right " : ""; + x += E[0].length > 0 ? "left " : "", x += E[E.length - 1].length > 0 ? "right " : ""; for (var $ = 1; $ < E.length - 1; $++) M += E[$].length === 0 ? "none " : E[$][0] ? "dashed " : "solid "; - return /[sd]/.test(M) && m.setAttribute("rowlines", M.trim()), w !== "" && (m = new mathMLTree.MathNode("menclose", [m]), m.setAttribute("notation", w.trim())), e.arraystretch && e.arraystretch < 1 && (m = new mathMLTree.MathNode("mstyle", [m]), m.setAttribute("scriptlevel", "1")), m; + return /[sd]/.test(M) && m.setAttribute("rowlines", M.trim()), x !== "" && (m = new mathMLTree.MathNode("menclose", [m]), m.setAttribute("notation", x.trim())), e.arraystretch && e.arraystretch < 1 && (m = new mathMLTree.MathNode("mstyle", [m]), m.setAttribute("scriptlevel", "1")), m; }, alignedHandler = function(e, t) { e.envName.indexOf("ed") === -1 && validateAmsEnvironmentContext(e); - var r = [], a = e.envName.indexOf("at") > -1 ? "alignat" : "align", l = e.envName === "split", d = parseArray(e.parser, { + var r = [], a = e.envName.indexOf("at") > -1 ? "alignat" : "align", l = e.envName === "split", h = parseArray(e.parser, { cols: r, addJot: !0, autoTag: l ? void 0 : getAutoTag(e.envName), @@ -7533,33 +7533,33 @@ var htmlBuilder$6 = function(e, t) { colSeparationType: a, maxNumCols: l ? 2 : void 0, leqno: e.parser.settings.leqno - }, "display"), o, u = 0, p = { + }, "display"), c, d = 0, _ = { type: "ordgroup", mode: e.mode, body: [] }; if (t[0] && t[0].type === "ordgroup") { for (var m = "", y = 0; y < t[0].body.length; y++) { - var w = assertNodeType(t[0].body[y], "textord"); - m += w.text; + var x = assertNodeType(t[0].body[y], "textord"); + m += x.text; } - o = Number(m), u = o * 2; + c = Number(m), d = c * 2; } - var b = !u; - d.body.forEach(function(h) { - for (var _ = 1; _ < h.length; _ += 2) { - var g = assertNodeType(h[_], "styling"), x = assertNodeType(g.body[0], "ordgroup"); - x.body.unshift(p); + var b = !d; + h.body.forEach(function(u) { + for (var p = 1; p < u.length; p += 2) { + var g = assertNodeType(u[p], "styling"), w = assertNodeType(g.body[0], "ordgroup"); + w.body.unshift(_); } if (b) - u < h.length && (u = h.length); + d < u.length && (d = u.length); else { - var c = h.length / 2; - if (o < c) - throw new ParseError("Too many math in a row: " + ("expected " + o + ", but got " + c), h[0]); + var o = u.length / 2; + if (c < o) + throw new ParseError("Too many math in a row: " + ("expected " + c + ", but got " + o), u[0]); } }); - for (var A = 0; A < u; ++A) { + for (var A = 0; A < d; ++A) { var f = "r", s = 0; A % 2 === 1 ? f = "l" : A > 0 && b && (s = 1), r[A] = { type: "align", @@ -7568,7 +7568,7 @@ var htmlBuilder$6 = function(e, t) { postgap: 0 }; } - return d.colSeparationType = b ? "align" : "alignat", d; + return h.colSeparationType = b ? "align" : "alignat", h; }; defineEnvironment({ type: "array", @@ -7577,24 +7577,24 @@ defineEnvironment({ numArgs: 1 }, handler(n, e) { - var t = checkSymbolNodeType(e[0]), r = t ? [e[0]] : assertNodeType(e[0], "ordgroup").body, a = r.map(function(d) { - var o = assertSymbolNodeType(d), u = o.text; - if ("lcr".indexOf(u) !== -1) + var t = checkSymbolNodeType(e[0]), r = t ? [e[0]] : assertNodeType(e[0], "ordgroup").body, a = r.map(function(h) { + var c = assertSymbolNodeType(h), d = c.text; + if ("lcr".indexOf(d) !== -1) return { type: "align", - align: u + align: d }; - if (u === "|") + if (d === "|") return { type: "separator", separator: "|" }; - if (u === ":") + if (d === ":") return { type: "separator", separator: ":" }; - throw new ParseError("Unknown column alignment: " + u, d); + throw new ParseError("Unknown column alignment: " + d, h); }), l = { cols: a, hskipBeforeAndAfter: !0, @@ -7638,8 +7638,8 @@ defineEnvironment({ }]; } } - var l = parseArray(n.parser, r, dCellStyle(n.envName)), d = Math.max(0, ...l.body.map((o) => o.length)); - return l.cols = new Array(d).fill({ + var l = parseArray(n.parser, r, dCellStyle(n.envName)), h = Math.max(0, ...l.body.map((c) => c.length)); + return l.cols = new Array(h).fill({ type: "align", align: t }), e ? { @@ -7677,14 +7677,14 @@ defineEnvironment({ numArgs: 1 }, handler(n, e) { - var t = checkSymbolNodeType(e[0]), r = t ? [e[0]] : assertNodeType(e[0], "ordgroup").body, a = r.map(function(d) { - var o = assertSymbolNodeType(d), u = o.text; - if ("lc".indexOf(u) !== -1) + var t = checkSymbolNodeType(e[0]), r = t ? [e[0]] : assertNodeType(e[0], "ordgroup").body, a = r.map(function(h) { + var c = assertSymbolNodeType(h), d = c.text; + if ("lc".indexOf(d) !== -1) return { type: "align", - align: u + align: d }; - throw new ParseError("Unknown column alignment: " + u, d); + throw new ParseError("Unknown column alignment: " + d, h); }); if (a.length > 1) throw new ParseError("{subarray} can contain only one column"); @@ -7844,23 +7844,23 @@ defineFunction({ } = n, a = e[0]; if (a.type !== "ordgroup") throw new ParseError("Invalid environment name", a); - for (var l = "", d = 0; d < a.body.length; ++d) - l += assertNodeType(a.body[d], "textord").text; + for (var l = "", h = 0; h < a.body.length; ++h) + l += assertNodeType(a.body[h], "textord").text; if (r === "\\begin") { if (!environments.hasOwnProperty(l)) throw new ParseError("No such environment: " + l, a); - var o = environments[l], { - args: u, - optArgs: p - } = t.parseArguments("\\begin{" + l + "}", o), m = { + var c = environments[l], { + args: d, + optArgs: _ + } = t.parseArguments("\\begin{" + l + "}", c), m = { mode: t.mode, envName: l, parser: t - }, y = o.handler(m, u, p); + }, y = c.handler(m, d, _); t.expect("\\end", !1); - var w = t.nextToken, b = assertNodeType(t.parseFunction(), "environment"); + var x = t.nextToken, b = assertNodeType(t.parseFunction(), "environment"); if (b.name !== l) - throw new ParseError("Mismatch: \\begin{" + l + "} matched by \\end{" + b.name + "}", w); + throw new ParseError("Mismatch: \\begin{" + l + "} matched by \\end{" + b.name + "}", x); return y; } return { @@ -7960,15 +7960,15 @@ defineFunction({ breakOnTokenText: a } = n, { mode: l - } = t, d = t.parseExpression(!0, a), o = "math" + r.slice(1); + } = t, h = t.parseExpression(!0, a), c = "math" + r.slice(1); return { type: "font", mode: l, - font: o, + font: c, body: { type: "ordgroup", mode: t.mode, - body: d + body: h } }; }, @@ -7981,26 +7981,26 @@ var adjustStyle = (n, e) => { }, htmlBuilder$4 = (n, e) => { var t = adjustStyle(n.size, e.style), r = t.fracNum(), a = t.fracDen(), l; l = e.havingStyle(r); - var d = buildGroup$1(n.numer, l, e); + var h = buildGroup$1(n.numer, l, e); if (n.continued) { - var o = 8.5 / e.fontMetrics().ptPerEm, u = 3.5 / e.fontMetrics().ptPerEm; - d.height = d.height < o ? o : d.height, d.depth = d.depth < u ? u : d.depth; + var c = 8.5 / e.fontMetrics().ptPerEm, d = 3.5 / e.fontMetrics().ptPerEm; + h.height = h.height < c ? c : h.height, h.depth = h.depth < d ? d : h.depth; } l = e.havingStyle(a); - var p = buildGroup$1(n.denom, l, e), m, y, w; - n.hasBarLine ? (n.barSize ? (y = calculateSize(n.barSize, e), m = buildCommon.makeLineSpan("frac-line", e, y)) : m = buildCommon.makeLineSpan("frac-line", e), y = m.height, w = m.height) : (m = null, y = 0, w = e.fontMetrics().defaultRuleThickness); + var _ = buildGroup$1(n.denom, l, e), m, y, x; + n.hasBarLine ? (n.barSize ? (y = calculateSize(n.barSize, e), m = buildCommon.makeLineSpan("frac-line", e, y)) : m = buildCommon.makeLineSpan("frac-line", e), y = m.height, x = m.height) : (m = null, y = 0, x = e.fontMetrics().defaultRuleThickness); var b, A, f; - t.size === Style$1.DISPLAY.size || n.size === "display" ? (b = e.fontMetrics().num1, y > 0 ? A = 3 * w : A = 7 * w, f = e.fontMetrics().denom1) : (y > 0 ? (b = e.fontMetrics().num2, A = w) : (b = e.fontMetrics().num3, A = 3 * w), f = e.fontMetrics().denom2); + t.size === Style$1.DISPLAY.size || n.size === "display" ? (b = e.fontMetrics().num1, y > 0 ? A = 3 * x : A = 7 * x, f = e.fontMetrics().denom1) : (y > 0 ? (b = e.fontMetrics().num2, A = x) : (b = e.fontMetrics().num3, A = 3 * x), f = e.fontMetrics().denom2); var s; if (m) { - var _ = e.fontMetrics().axisHeight; - b - d.depth - (_ + 0.5 * y) < A && (b += A - (b - d.depth - (_ + 0.5 * y))), _ - 0.5 * y - (p.height - f) < A && (f += A - (_ - 0.5 * y - (p.height - f))); - var g = -(_ - 0.5 * y); + var p = e.fontMetrics().axisHeight; + b - h.depth - (p + 0.5 * y) < A && (b += A - (b - h.depth - (p + 0.5 * y))), p - 0.5 * y - (_.height - f) < A && (f += A - (p - 0.5 * y - (_.height - f))); + var g = -(p - 0.5 * y); s = buildCommon.makeVList({ positionType: "individualShift", children: [{ type: "elem", - elem: p, + elem: _, shift: f }, { type: "elem", @@ -8008,30 +8008,30 @@ var adjustStyle = (n, e) => { shift: g }, { type: "elem", - elem: d, + elem: h, shift: -b }] }, e); } else { - var h = b - d.depth - (p.height - f); - h < A && (b += 0.5 * (A - h), f += 0.5 * (A - h)), s = buildCommon.makeVList({ + var u = b - h.depth - (_.height - f); + u < A && (b += 0.5 * (A - u), f += 0.5 * (A - u)), s = buildCommon.makeVList({ positionType: "individualShift", children: [{ type: "elem", - elem: p, + elem: _, shift: f }, { type: "elem", - elem: d, + elem: h, shift: -b }] }, e); } l = e.havingStyle(t), s.height *= l.sizeMultiplier / e.sizeMultiplier, s.depth *= l.sizeMultiplier / e.sizeMultiplier; - var x; - t.size === Style$1.DISPLAY.size ? x = e.fontMetrics().delim1 : t.size === Style$1.SCRIPTSCRIPT.size ? x = e.havingStyle(Style$1.SCRIPT).fontMetrics().delim2 : x = e.fontMetrics().delim2; - var c, v; - return n.leftDelim == null ? c = makeNullDelimiter(e, ["mopen"]) : c = delimiter.customSizedDelim(n.leftDelim, x, !0, e.havingStyle(t), n.mode, ["mopen"]), n.continued ? v = buildCommon.makeSpan([]) : n.rightDelim == null ? v = makeNullDelimiter(e, ["mclose"]) : v = delimiter.customSizedDelim(n.rightDelim, x, !0, e.havingStyle(t), n.mode, ["mclose"]), buildCommon.makeSpan(["mord"].concat(l.sizingClasses(e)), [c, buildCommon.makeSpan(["mfrac"], [s]), v], e); + var w; + t.size === Style$1.DISPLAY.size ? w = e.fontMetrics().delim1 : t.size === Style$1.SCRIPTSCRIPT.size ? w = e.havingStyle(Style$1.SCRIPT).fontMetrics().delim2 : w = e.fontMetrics().delim2; + var o, v; + return n.leftDelim == null ? o = makeNullDelimiter(e, ["mopen"]) : o = delimiter.customSizedDelim(n.leftDelim, w, !0, e.havingStyle(t), n.mode, ["mopen"]), n.continued ? v = buildCommon.makeSpan([]) : n.rightDelim == null ? v = makeNullDelimiter(e, ["mclose"]) : v = delimiter.customSizedDelim(n.rightDelim, w, !0, e.havingStyle(t), n.mode, ["mclose"]), buildCommon.makeSpan(["mord"].concat(l.sizingClasses(e)), [o, buildCommon.makeSpan(["mfrac"], [s]), v], e); }, mathmlBuilder$3 = (n, e) => { var t = new mathMLTree.MathNode("mfrac", [buildGroup(n.numer, e), buildGroup(n.denom, e)]); if (!n.hasBarLine) @@ -8047,16 +8047,16 @@ var adjustStyle = (n, e) => { t.setAttribute("displaystyle", l), t.setAttribute("scriptlevel", "0"); } if (n.leftDelim != null || n.rightDelim != null) { - var d = []; + var h = []; if (n.leftDelim != null) { - var o = new mathMLTree.MathNode("mo", [new mathMLTree.TextNode(n.leftDelim.replace("\\", ""))]); - o.setAttribute("fence", "true"), d.push(o); + var c = new mathMLTree.MathNode("mo", [new mathMLTree.TextNode(n.leftDelim.replace("\\", ""))]); + c.setAttribute("fence", "true"), h.push(c); } - if (d.push(t), n.rightDelim != null) { - var u = new mathMLTree.MathNode("mo", [new mathMLTree.TextNode(n.rightDelim.replace("\\", ""))]); - u.setAttribute("fence", "true"), d.push(u); + if (h.push(t), n.rightDelim != null) { + var d = new mathMLTree.MathNode("mo", [new mathMLTree.TextNode(n.rightDelim.replace("\\", ""))]); + d.setAttribute("fence", "true"), h.push(d); } - return makeRow(d); + return makeRow(h); } return t; }; @@ -8083,26 +8083,26 @@ defineFunction({ var { parser: t, funcName: r - } = n, a = e[0], l = e[1], d, o = null, u = null, p = "auto"; + } = n, a = e[0], l = e[1], h, c = null, d = null, _ = "auto"; switch (r) { case "\\dfrac": case "\\frac": case "\\tfrac": - d = !0; + h = !0; break; case "\\\\atopfrac": - d = !1; + h = !1; break; case "\\dbinom": case "\\binom": case "\\tbinom": - d = !1, o = "(", u = ")"; + h = !1, c = "(", d = ")"; break; case "\\\\bracefrac": - d = !1, o = "\\{", u = "\\}"; + h = !1, c = "\\{", d = "\\}"; break; case "\\\\brackfrac": - d = !1, o = "[", u = "]"; + h = !1, c = "[", d = "]"; break; default: throw new Error("Unrecognized genfrac command"); @@ -8110,11 +8110,11 @@ defineFunction({ switch (r) { case "\\dfrac": case "\\dbinom": - p = "display"; + _ = "display"; break; case "\\tfrac": case "\\tbinom": - p = "text"; + _ = "text"; break; } return { @@ -8123,10 +8123,10 @@ defineFunction({ continued: !1, numer: a, denom: l, - hasBarLine: d, - leftDelim: o, - rightDelim: u, - size: p, + hasBarLine: h, + leftDelim: c, + rightDelim: d, + size: _, barSize: null }; }, @@ -8213,16 +8213,16 @@ defineFunction({ handler(n, e) { var { parser: t - } = n, r = e[4], a = e[5], l = normalizeArgument(e[0]), d = l.type === "atom" && l.family === "open" ? delimFromValue(l.text) : null, o = normalizeArgument(e[1]), u = o.type === "atom" && o.family === "close" ? delimFromValue(o.text) : null, p = assertNodeType(e[2], "size"), m, y = null; - p.isBlank ? m = !0 : (y = p.value, m = y.number > 0); - var w = "auto", b = e[3]; + } = n, r = e[4], a = e[5], l = normalizeArgument(e[0]), h = l.type === "atom" && l.family === "open" ? delimFromValue(l.text) : null, c = normalizeArgument(e[1]), d = c.type === "atom" && c.family === "close" ? delimFromValue(c.text) : null, _ = assertNodeType(e[2], "size"), m, y = null; + _.isBlank ? m = !0 : (y = _.value, m = y.number > 0); + var x = "auto", b = e[3]; if (b.type === "ordgroup") { if (b.body.length > 0) { var A = assertNodeType(b.body[0], "textord"); - w = stylArray[Number(A.text)]; + x = stylArray[Number(A.text)]; } } else - b = assertNodeType(b, "textord"), w = stylArray[Number(b.text)]; + b = assertNodeType(b, "textord"), x = stylArray[Number(b.text)]; return { type: "genfrac", mode: t.mode, @@ -8231,9 +8231,9 @@ defineFunction({ continued: !1, hasBarLine: m, barSize: y, - leftDelim: d, - rightDelim: u, - size: w + leftDelim: h, + rightDelim: d, + size: x }; }, htmlBuilder: htmlBuilder$4, @@ -8273,14 +8273,14 @@ defineFunction({ var { parser: t, funcName: r - } = n, a = e[0], l = assert(assertNodeType(e[1], "infix").size), d = e[2], o = l.number > 0; + } = n, a = e[0], l = assert(assertNodeType(e[1], "infix").size), h = e[2], c = l.number > 0; return { type: "genfrac", mode: t.mode, numer: a, - denom: d, + denom: h, continued: !1, - hasBarLine: o, + hasBarLine: c, barSize: l, leftDelim: null, rightDelim: null, @@ -8293,8 +8293,8 @@ defineFunction({ var htmlBuilder$3 = (n, e) => { var t = e.style, r, a; n.type === "supsub" ? (r = n.sup ? buildGroup$1(n.sup, e.havingStyle(t.sup()), e) : buildGroup$1(n.sub, e.havingStyle(t.sub()), e), a = assertNodeType(n.base, "horizBrace")) : a = assertNodeType(n, "horizBrace"); - var l = buildGroup$1(a.base, e.havingBaseStyle(Style$1.DISPLAY)), d = stretchy.svgSpan(a, e), o; - if (a.isOver ? (o = buildCommon.makeVList({ + var l = buildGroup$1(a.base, e.havingBaseStyle(Style$1.DISPLAY)), h = stretchy.svgSpan(a, e), c; + if (a.isOver ? (c = buildCommon.makeVList({ positionType: "firstBaseline", children: [{ type: "elem", @@ -8304,14 +8304,14 @@ var htmlBuilder$3 = (n, e) => { size: 0.1 }, { type: "elem", - elem: d + elem: h }] - }, e), o.children[0].children[0].children[1].classes.push("svg-align")) : (o = buildCommon.makeVList({ + }, e), c.children[0].children[0].children[1].classes.push("svg-align")) : (c = buildCommon.makeVList({ positionType: "bottom", - positionData: l.depth + 0.1 + d.height, + positionData: l.depth + 0.1 + h.height, children: [{ type: "elem", - elem: d + elem: h }, { type: "kern", size: 0.1 @@ -8319,13 +8319,13 @@ var htmlBuilder$3 = (n, e) => { type: "elem", elem: l }] - }, e), o.children[0].children[0].children[0].classes.push("svg-align")), r) { - var u = buildCommon.makeSpan(["mord", a.isOver ? "mover" : "munder"], [o], e); - a.isOver ? o = buildCommon.makeVList({ + }, e), c.children[0].children[0].children[0].classes.push("svg-align")), r) { + var d = buildCommon.makeSpan(["mord", a.isOver ? "mover" : "munder"], [c], e); + a.isOver ? c = buildCommon.makeVList({ positionType: "firstBaseline", children: [{ type: "elem", - elem: u + elem: d }, { type: "kern", size: 0.2 @@ -8333,9 +8333,9 @@ var htmlBuilder$3 = (n, e) => { type: "elem", elem: r }] - }, e) : o = buildCommon.makeVList({ + }, e) : c = buildCommon.makeVList({ positionType: "bottom", - positionData: u.depth + 0.2 + r.height + r.depth, + positionData: d.depth + 0.2 + r.height + r.depth, children: [{ type: "elem", elem: r @@ -8344,11 +8344,11 @@ var htmlBuilder$3 = (n, e) => { size: 0.2 }, { type: "elem", - elem: u + elem: d }] }, e); } - return buildCommon.makeSpan(["mord", a.isOver ? "mover" : "munder"], [o], e); + return buildCommon.makeSpan(["mord", a.isOver ? "mover" : "munder"], [c], e); }, mathmlBuilder$2 = (n, e) => { var t = stretchy.mathMLnode(n.label); return new mathMLTree.MathNode(n.isOver ? "mover" : "munder", [buildGroup(n.base, e), t]); @@ -8424,14 +8424,14 @@ defineFunction({ })) return t.formatUnsupportedCmd("\\url"); for (var a = [], l = 0; l < r.length; l++) { - var d = r[l]; - d === "~" && (d = "\\textasciitilde"), a.push({ + var h = r[l]; + h === "~" && (h = "\\textasciitilde"), a.push({ type: "textord", mode: "text", - text: d + text: h }); } - var o = { + var c = { type: "text", mode: t.mode, font: "\\texttt", @@ -8441,7 +8441,7 @@ defineFunction({ type: "href", mode: t.mode, href: r, - body: ordargument(o) + body: ordargument(c) }; } }); @@ -8485,49 +8485,49 @@ defineFunction({ parser: t, funcName: r, token: a - } = n, l = assertNodeType(e[0], "raw").string, d = e[1]; + } = n, l = assertNodeType(e[0], "raw").string, h = e[1]; t.settings.strict && t.settings.reportNonstrict("htmlExtension", "HTML extension is disabled on strict mode"); - var o, u = {}; + var c, d = {}; switch (r) { case "\\htmlClass": - u.class = l, o = { + d.class = l, c = { command: "\\htmlClass", class: l }; break; case "\\htmlId": - u.id = l, o = { + d.id = l, c = { command: "\\htmlId", id: l }; break; case "\\htmlStyle": - u.style = l, o = { + d.style = l, c = { command: "\\htmlStyle", style: l }; break; case "\\htmlData": { - for (var p = l.split(","), m = 0; m < p.length; m++) { - var y = p[m].split("="); + for (var _ = l.split(","), m = 0; m < _.length; m++) { + var y = _[m].split("="); if (y.length !== 2) throw new ParseError("Error parsing key-value for \\htmlData"); - u["data-" + y[0].trim()] = y[1].trim(); + d["data-" + y[0].trim()] = y[1].trim(); } - o = { + c = { command: "\\htmlData", - attributes: u + attributes: d }; break; } default: throw new Error("Unrecognized html command"); } - return t.settings.isTrusted(o) ? { + return t.settings.isTrusted(c) ? { type: "html", mode: t.mode, - attributes: u, - body: ordargument(d) + attributes: d, + body: ordargument(h) } : t.formatUnsupportedCmd(r); }, htmlBuilder: (n, e) => { @@ -8600,27 +8600,27 @@ defineFunction({ }, l = { number: 0.9, unit: "em" - }, d = { + }, h = { number: 0, unit: "em" - }, o = ""; + }, c = ""; if (t[0]) - for (var u = assertNodeType(t[0], "raw").string, p = u.split(","), m = 0; m < p.length; m++) { - var y = p[m].split("="); + for (var d = assertNodeType(t[0], "raw").string, _ = d.split(","), m = 0; m < _.length; m++) { + var y = _[m].split("="); if (y.length === 2) { - var w = y[1].trim(); + var x = y[1].trim(); switch (y[0].trim()) { case "alt": - o = w; + c = x; break; case "width": - a = sizeData(w); + a = sizeData(x); break; case "height": - l = sizeData(w); + l = sizeData(x); break; case "totalheight": - d = sizeData(w); + h = sizeData(x); break; default: throw new ParseError("Invalid key: '" + y[0] + "' in \\includegraphics."); @@ -8628,16 +8628,16 @@ defineFunction({ } } var b = assertNodeType(e[0], "url").url; - return o === "" && (o = b, o = o.replace(/^.*[\\/]/, ""), o = o.substring(0, o.lastIndexOf("."))), r.settings.isTrusted({ + return c === "" && (c = b, c = c.replace(/^.*[\\/]/, ""), c = c.substring(0, c.lastIndexOf("."))), r.settings.isTrusted({ command: "\\includegraphics", url: b }) ? { type: "includegraphics", mode: r.mode, - alt: o, + alt: c, width: a, height: l, - totalheight: d, + totalheight: h, src: b } : r.formatUnsupportedCmd("\\includegraphics"); }, @@ -8650,8 +8650,8 @@ defineFunction({ height: makeEm(t + r) }; a > 0 && (l.width = makeEm(a)), r > 0 && (l.verticalAlign = makeEm(-r)); - var d = new Img(n.src, n.alt, l); - return d.height = t, d.depth = r, d; + var h = new Img(n.src, n.alt, l); + return h.height = t, h.depth = r, h; }, mathmlBuilder: (n, e) => { var t = new mathMLTree.MathNode("mglyph", []); @@ -8679,8 +8679,8 @@ defineFunction({ funcName: r } = n, a = assertNodeType(e[0], "size"); if (t.settings.strict) { - var l = r[1] === "m", d = a.value.unit === "mu"; - l ? (d || t.settings.reportNonstrict("mathVsTextUnits", "LaTeX's " + r + " supports only mu units, " + ("not " + a.value.unit + " units")), t.mode !== "math" && t.settings.reportNonstrict("mathVsTextUnits", "LaTeX's " + r + " works only in math mode")) : d && t.settings.reportNonstrict("mathVsTextUnits", "LaTeX's " + r + " doesn't support mu units"); + var l = r[1] === "m", h = a.value.unit === "mu"; + l ? (h || t.settings.reportNonstrict("mathVsTextUnits", "LaTeX's " + r + " supports only mu units, " + ("not " + a.value.unit + " units")), t.mode !== "math" && t.settings.reportNonstrict("mathVsTextUnits", "LaTeX's " + r + " works only in math mode")) : h && t.settings.reportNonstrict("mathVsTextUnits", "LaTeX's " + r + " doesn't support mu units"); } return { type: "kern", @@ -8744,12 +8744,12 @@ defineFunction({ parser: r } = n, a = r.mode; r.switchMode("math"); - var l = t === "\\(" ? "\\)" : "$", d = r.parseExpression(!1, l); + var l = t === "\\(" ? "\\)" : "$", h = r.parseExpression(!1, l); return r.expect(l), r.switchMode(a), { type: "styling", mode: r.mode, style: "text", - body: d + body: h }; } }); @@ -8809,27 +8809,27 @@ defineFunction({ return buildExpressionRow(t, e); } }); -var assembleSupSub = (n, e, t, r, a, l, d) => { +var assembleSupSub = (n, e, t, r, a, l, h) => { n = buildCommon.makeSpan([], [n]); - var o = t && utils.isCharacterBox(t), u, p; + var c = t && utils.isCharacterBox(t), d, _; if (e) { var m = buildGroup$1(e, r.havingStyle(a.sup()), r); - p = { + _ = { elem: m, kern: Math.max(r.fontMetrics().bigOpSpacing1, r.fontMetrics().bigOpSpacing3 - m.depth) }; } if (t) { var y = buildGroup$1(t, r.havingStyle(a.sub()), r); - u = { + d = { elem: y, kern: Math.max(r.fontMetrics().bigOpSpacing2, r.fontMetrics().bigOpSpacing4 - y.height) }; } - var w; - if (p && u) { - var b = r.fontMetrics().bigOpSpacing5 + u.elem.height + u.elem.depth + u.kern + n.depth + d; - w = buildCommon.makeVList({ + var x; + if (_ && d) { + var b = r.fontMetrics().bigOpSpacing5 + d.elem.height + d.elem.depth + d.kern + n.depth + h; + x = buildCommon.makeVList({ positionType: "bottom", positionData: b, children: [{ @@ -8837,29 +8837,29 @@ var assembleSupSub = (n, e, t, r, a, l, d) => { size: r.fontMetrics().bigOpSpacing5 }, { type: "elem", - elem: u.elem, + elem: d.elem, marginLeft: makeEm(-l) }, { type: "kern", - size: u.kern + size: d.kern }, { type: "elem", elem: n }, { type: "kern", - size: p.kern + size: _.kern }, { type: "elem", - elem: p.elem, + elem: _.elem, marginLeft: makeEm(l) }, { type: "kern", size: r.fontMetrics().bigOpSpacing5 }] }, r); - } else if (u) { - var A = n.height - d; - w = buildCommon.makeVList({ + } else if (d) { + var A = n.height - h; + x = buildCommon.makeVList({ positionType: "top", positionData: A, children: [{ @@ -8867,19 +8867,19 @@ var assembleSupSub = (n, e, t, r, a, l, d) => { size: r.fontMetrics().bigOpSpacing5 }, { type: "elem", - elem: u.elem, + elem: d.elem, marginLeft: makeEm(-l) }, { type: "kern", - size: u.kern + size: d.kern }, { type: "elem", elem: n }] }, r); - } else if (p) { - var f = n.depth + d; - w = buildCommon.makeVList({ + } else if (_) { + var f = n.depth + h; + x = buildCommon.makeVList({ positionType: "bottom", positionData: f, children: [{ @@ -8887,10 +8887,10 @@ var assembleSupSub = (n, e, t, r, a, l, d) => { elem: n }, { type: "kern", - size: p.kern + size: _.kern }, { type: "elem", - elem: p.elem, + elem: _.elem, marginLeft: makeEm(l) }, { type: "kern", @@ -8899,45 +8899,45 @@ var assembleSupSub = (n, e, t, r, a, l, d) => { }, r); } else return n; - var s = [w]; - if (u && l !== 0 && !o) { - var h = buildCommon.makeSpan(["mspace"], [], r); - h.style.marginRight = makeEm(l), s.unshift(h); + var s = [x]; + if (d && l !== 0 && !c) { + var u = buildCommon.makeSpan(["mspace"], [], r); + u.style.marginRight = makeEm(l), s.unshift(u); } return buildCommon.makeSpan(["mop", "op-limits"], s, r); }, noSuccessor = ["\\smallint"], htmlBuilder$2 = (n, e) => { var t, r, a = !1, l; n.type === "supsub" ? (t = n.sup, r = n.sub, l = assertNodeType(n.base, "op"), a = !0) : l = assertNodeType(n, "op"); - var d = e.style, o = !1; - d.size === Style$1.DISPLAY.size && l.symbol && !utils.contains(noSuccessor, l.name) && (o = !0); - var u; + var h = e.style, c = !1; + h.size === Style$1.DISPLAY.size && l.symbol && !utils.contains(noSuccessor, l.name) && (c = !0); + var d; if (l.symbol) { - var p = o ? "Size2-Regular" : "Size1-Regular", m = ""; - if ((l.name === "\\oiint" || l.name === "\\oiiint") && (m = l.name.slice(1), l.name = m === "oiint" ? "\\iint" : "\\iiint"), u = buildCommon.makeSymbol(l.name, p, "math", e, ["mop", "op-symbol", o ? "large-op" : "small-op"]), m.length > 0) { - var y = u.italic, w = buildCommon.staticSvg(m + "Size" + (o ? "2" : "1"), e); - u = buildCommon.makeVList({ + var _ = c ? "Size2-Regular" : "Size1-Regular", m = ""; + if ((l.name === "\\oiint" || l.name === "\\oiiint") && (m = l.name.slice(1), l.name = m === "oiint" ? "\\iint" : "\\iiint"), d = buildCommon.makeSymbol(l.name, _, "math", e, ["mop", "op-symbol", c ? "large-op" : "small-op"]), m.length > 0) { + var y = d.italic, x = buildCommon.staticSvg(m + "Size" + (c ? "2" : "1"), e); + d = buildCommon.makeVList({ positionType: "individualShift", children: [{ type: "elem", - elem: u, + elem: d, shift: 0 }, { type: "elem", - elem: w, - shift: o ? 0.08 : 0 + elem: x, + shift: c ? 0.08 : 0 }] - }, e), l.name = "\\" + m, u.classes.unshift("mop"), u.italic = y; + }, e), l.name = "\\" + m, d.classes.unshift("mop"), d.italic = y; } } else if (l.body) { var b = buildExpression$1(l.body, e, !0); - b.length === 1 && b[0] instanceof SymbolNode ? (u = b[0], u.classes[0] = "mop") : u = buildCommon.makeSpan(["mop"], b, e); + b.length === 1 && b[0] instanceof SymbolNode ? (d = b[0], d.classes[0] = "mop") : d = buildCommon.makeSpan(["mop"], b, e); } else { for (var A = [], f = 1; f < l.name.length; f++) A.push(buildCommon.mathsym(l.name[f], l.mode, e)); - u = buildCommon.makeSpan(["mop"], A, e); + d = buildCommon.makeSpan(["mop"], A, e); } - var s = 0, h = 0; - return (u instanceof SymbolNode || l.name === "\\oiint" || l.name === "\\oiiint") && !l.suppressBaseShift && (s = (u.height - u.depth) / 2 - e.fontMetrics().axisHeight, h = u.italic), a ? assembleSupSub(u, t, r, e, d, h, s) : (s && (u.style.position = "relative", u.style.top = makeEm(s)), u); + var s = 0, u = 0; + return (d instanceof SymbolNode || l.name === "\\oiint" || l.name === "\\oiiint") && !l.suppressBaseShift && (s = (d.height - d.depth) / 2 - e.fontMetrics().axisHeight, u = d.italic), a ? assembleSupSub(d, t, r, e, h, u, s) : (s && (d.style.position = "relative", d.style.top = makeEm(s)), d); }, mathmlBuilder$1 = (n, e) => { var t; if (n.symbol) @@ -9090,23 +9090,23 @@ defineFunction({ var htmlBuilder$1 = (n, e) => { var t, r, a = !1, l; n.type === "supsub" ? (t = n.sup, r = n.sub, l = assertNodeType(n.base, "operatorname"), a = !0) : l = assertNodeType(n, "operatorname"); - var d; + var h; if (l.body.length > 0) { - for (var o = l.body.map((y) => { - var w = y.text; - return typeof w == "string" ? { + for (var c = l.body.map((y) => { + var x = y.text; + return typeof x == "string" ? { type: "textord", mode: y.mode, - text: w + text: x } : y; - }), u = buildExpression$1(o, e.withFont("mathrm"), !0), p = 0; p < u.length; p++) { - var m = u[p]; + }), d = buildExpression$1(c, e.withFont("mathrm"), !0), _ = 0; _ < d.length; _++) { + var m = d[_]; m instanceof SymbolNode && (m.text = m.text.replace(/\u2212/, "-").replace(/\u2217/, "*")); } - d = buildCommon.makeSpan(["mop"], u, e); + h = buildCommon.makeSpan(["mop"], d, e); } else - d = buildCommon.makeSpan(["mop"], [], e); - return a ? assembleSupSub(d, t, r, e, e.style, 0, 0) : d; + h = buildCommon.makeSpan(["mop"], [], e); + return a ? assembleSupSub(h, t, r, e, e.style, 0, 0) : h; }, mathmlBuilder = (n, e) => { for (var t = buildExpression(n.body, e.withFont("mathrm")), r = !0, a = 0; a < t.length; a++) { var l = t[a]; @@ -9119,8 +9119,8 @@ var htmlBuilder$1 = (n, e) => { case "mtext": break; case "mo": { - var d = l.children[0]; - l.children.length === 1 && d instanceof mathMLTree.TextNode ? d.text = d.text.replace(/\u2212/, "-").replace(/\u2217/, "*") : r = !1; + var h = l.children[0]; + l.children.length === 1 && h instanceof mathMLTree.TextNode ? h.text = h.text.replace(/\u2212/, "-").replace(/\u2217/, "*") : r = !1; break; } default: @@ -9130,13 +9130,13 @@ var htmlBuilder$1 = (n, e) => { r = !1; } if (r) { - var o = t.map((m) => m.toText()).join(""); - t = [new mathMLTree.TextNode(o)]; + var c = t.map((m) => m.toText()).join(""); + t = [new mathMLTree.TextNode(c)]; } - var u = new mathMLTree.MathNode("mi", t); - u.setAttribute("mathvariant", "normal"); - var p = new mathMLTree.MathNode("mo", [makeText("⁡", "text")]); - return n.parentIsSupSub ? new mathMLTree.MathNode("mrow", [u, p]) : mathMLTree.newDocumentFragment([u, p]); + var d = new mathMLTree.MathNode("mi", t); + d.setAttribute("mathvariant", "normal"); + var _ = new mathMLTree.MathNode("mo", [makeText("⁡", "text")]); + return n.parentIsSupSub ? new mathMLTree.MathNode("mrow", [d, _]) : mathMLTree.newDocumentFragment([d, _]); }; defineFunction({ type: "operatorname", @@ -9363,13 +9363,13 @@ defineFunction({ handler(n, e, t) { var { parser: r - } = n, a = t[0], l = assertNodeType(e[0], "size"), d = assertNodeType(e[1], "size"); + } = n, a = t[0], l = assertNodeType(e[0], "size"), h = assertNodeType(e[1], "size"); return { type: "rule", mode: r.mode, shift: a && assertNodeType(a, "size").value, width: l.value, - height: d.value + height: h.value }; }, htmlBuilder(n, e) { @@ -9377,16 +9377,16 @@ defineFunction({ return t.style.borderRightWidth = makeEm(r), t.style.borderTopWidth = makeEm(a), t.style.bottom = makeEm(l), t.width = r, t.height = a + l, t.depth = -l, t.maxFontSize = a * 1.125 * e.sizeMultiplier, t; }, mathmlBuilder(n, e) { - var t = calculateSize(n.width, e), r = calculateSize(n.height, e), a = n.shift ? calculateSize(n.shift, e) : 0, l = e.color && e.getColor() || "black", d = new mathMLTree.MathNode("mspace"); - d.setAttribute("mathbackground", l), d.setAttribute("width", makeEm(t)), d.setAttribute("height", makeEm(r)); - var o = new mathMLTree.MathNode("mpadded", [d]); - return a >= 0 ? o.setAttribute("height", makeEm(a)) : (o.setAttribute("height", makeEm(a)), o.setAttribute("depth", makeEm(-a))), o.setAttribute("voffset", makeEm(a)), o; + var t = calculateSize(n.width, e), r = calculateSize(n.height, e), a = n.shift ? calculateSize(n.shift, e) : 0, l = e.color && e.getColor() || "black", h = new mathMLTree.MathNode("mspace"); + h.setAttribute("mathbackground", l), h.setAttribute("width", makeEm(t)), h.setAttribute("height", makeEm(r)); + var c = new mathMLTree.MathNode("mpadded", [h]); + return a >= 0 ? c.setAttribute("height", makeEm(a)) : (c.setAttribute("height", makeEm(a)), c.setAttribute("depth", makeEm(-a))), c.setAttribute("voffset", makeEm(a)), c; } }); function sizingGroup(n, e, t) { for (var r = buildExpression$1(n, e, !1), a = e.sizeMultiplier / t.sizeMultiplier, l = 0; l < r.length; l++) { - var d = r[l].classes.indexOf("sizing"); - d < 0 ? Array.prototype.push.apply(r[l].classes, e.sizingClasses(t)) : r[l].classes[d + 1] === "reset-size" + e.size && (r[l].classes[d + 1] = "reset-size" + t.size), r[l].height *= a, r[l].depth *= a; + var h = r[l].classes.indexOf("sizing"); + h < 0 ? Array.prototype.push.apply(r[l].classes, e.sizingClasses(t)) : r[l].classes[h + 1] === "reset-size" + e.size && (r[l].classes[h + 1] = "reset-size" + t.size), r[l].height *= a, r[l].depth *= a; } return buildCommon.makeFragment(r); } @@ -9432,13 +9432,13 @@ defineFunction({ handler: (n, e, t) => { var { parser: r - } = n, a = !1, l = !1, d = t[0] && assertNodeType(t[0], "ordgroup"); - if (d) - for (var o = "", u = 0; u < d.body.length; ++u) { - var p = d.body[u]; - if (o = p.text, o === "t") + } = n, a = !1, l = !1, h = t[0] && assertNodeType(t[0], "ordgroup"); + if (h) + for (var c = "", d = 0; d < h.body.length; ++d) { + var _ = h.body[d]; + if (c = _.text, c === "t") a = !0; - else if (o === "b") + else if (c === "b") l = !0; else { a = !1, l = !1; @@ -9503,13 +9503,13 @@ defineFunction({ t.height === 0 && (t.height = e.fontMetrics().xHeight), t = buildCommon.wrapFragment(t, e); var r = e.fontMetrics(), a = r.defaultRuleThickness, l = a; e.style.id < Style$1.TEXT.id && (l = e.fontMetrics().xHeight); - var d = a + l / 4, o = t.height + t.depth + d + a, { - span: u, - ruleWidth: p, + var h = a + l / 4, c = t.height + t.depth + h + a, { + span: d, + ruleWidth: _, advanceWidth: m - } = delimiter.sqrtImage(o, e), y = u.height - p; - y > t.height + t.depth + d && (d = (d + y - t.height - t.depth) / 2); - var w = u.height - t.height - d - p; + } = delimiter.sqrtImage(c, e), y = d.height - _; + y > t.height + t.depth + h && (h = (h + y - t.height - t.depth) / 2); + var x = d.height - t.height - h - _; t.style.paddingLeft = makeEm(m); var b = buildCommon.makeVList({ positionType: "firstBaseline", @@ -9519,25 +9519,25 @@ defineFunction({ wrapperClasses: ["svg-align"] }, { type: "kern", - size: -(t.height + w) + size: -(t.height + x) }, { type: "elem", - elem: u + elem: d }, { type: "kern", - size: p + size: _ }] }, e); if (n.index) { - var A = e.havingStyle(Style$1.SCRIPTSCRIPT), f = buildGroup$1(n.index, A, e), s = 0.6 * (b.height - b.depth), h = buildCommon.makeVList({ + var A = e.havingStyle(Style$1.SCRIPTSCRIPT), f = buildGroup$1(n.index, A, e), s = 0.6 * (b.height - b.depth), u = buildCommon.makeVList({ positionType: "shift", positionData: -s, children: [{ type: "elem", elem: f }] - }, e), _ = buildCommon.makeSpan(["root"], [h]); - return buildCommon.makeSpan(["mord", "sqrt"], [_, b], e); + }, e), p = buildCommon.makeSpan(["root"], [u]); + return buildCommon.makeSpan(["mord", "sqrt"], [p, b], e); } else return buildCommon.makeSpan(["mord", "sqrt"], [b], e); }, @@ -9568,13 +9568,13 @@ defineFunction({ breakOnTokenText: t, funcName: r, parser: a - } = n, l = a.parseExpression(!0, t), d = r.slice(1, r.length - 5); + } = n, l = a.parseExpression(!0, t), h = r.slice(1, r.length - 5); return { type: "styling", mode: a.mode, // Figure out what style to use by pulling out the style from // the function name - style: d, + style: h, body: l }; }, @@ -9583,13 +9583,13 @@ defineFunction({ return sizingGroup(n.body, r, e); }, mathmlBuilder(n, e) { - var t = styleMap[n.style], r = e.havingStyle(t), a = buildExpression(n.body, r), l = new mathMLTree.MathNode("mstyle", a), d = { + var t = styleMap[n.style], r = e.havingStyle(t), a = buildExpression(n.body, r), l = new mathMLTree.MathNode("mstyle", a), h = { display: ["0", "true"], text: ["0", "false"], script: ["1", "false"], scriptscript: ["2", "false"] - }, o = d[n.style]; - return l.setAttribute("scriptlevel", o[0]), l.setAttribute("displaystyle", o[1]), l; + }, c = h[n.style]; + return l.setAttribute("scriptlevel", c[0]), l.setAttribute("displaystyle", c[1]), l; } }); var htmlBuilderDelegate = function(e, t) { @@ -9605,8 +9605,8 @@ var htmlBuilderDelegate = function(e, t) { if (r.type === "accent") return utils.isCharacterBox(r.base) ? htmlBuilder$a : null; if (r.type === "horizBrace") { - var d = !e.sub; - return d === r.isOver ? htmlBuilder$3 : null; + var h = !e.sub; + return h === r.isOver ? htmlBuilder$3 : null; } else return null; } @@ -9622,96 +9622,96 @@ defineFunctionBuilders({ base: r, sup: a, sub: l - } = n, d = buildGroup$1(r, e), o, u, p = e.fontMetrics(), m = 0, y = 0, w = r && utils.isCharacterBox(r); + } = n, h = buildGroup$1(r, e), c, d, _ = e.fontMetrics(), m = 0, y = 0, x = r && utils.isCharacterBox(r); if (a) { var b = e.havingStyle(e.style.sup()); - o = buildGroup$1(a, b, e), w || (m = d.height - b.fontMetrics().supDrop * b.sizeMultiplier / e.sizeMultiplier); + c = buildGroup$1(a, b, e), x || (m = h.height - b.fontMetrics().supDrop * b.sizeMultiplier / e.sizeMultiplier); } if (l) { var A = e.havingStyle(e.style.sub()); - u = buildGroup$1(l, A, e), w || (y = d.depth + A.fontMetrics().subDrop * A.sizeMultiplier / e.sizeMultiplier); + d = buildGroup$1(l, A, e), x || (y = h.depth + A.fontMetrics().subDrop * A.sizeMultiplier / e.sizeMultiplier); } var f; - e.style === Style$1.DISPLAY ? f = p.sup1 : e.style.cramped ? f = p.sup3 : f = p.sup2; - var s = e.sizeMultiplier, h = makeEm(0.5 / p.ptPerEm / s), _ = null; - if (u) { + e.style === Style$1.DISPLAY ? f = _.sup1 : e.style.cramped ? f = _.sup3 : f = _.sup2; + var s = e.sizeMultiplier, u = makeEm(0.5 / _.ptPerEm / s), p = null; + if (d) { var g = n.base && n.base.type === "op" && n.base.name && (n.base.name === "\\oiint" || n.base.name === "\\oiiint"); - (d instanceof SymbolNode || g) && (_ = makeEm(-d.italic)); + (h instanceof SymbolNode || g) && (p = makeEm(-h.italic)); } - var x; - if (o && u) { - m = Math.max(m, f, o.depth + 0.25 * p.xHeight), y = Math.max(y, p.sub2); - var c = p.defaultRuleThickness, v = 4 * c; - if (m - o.depth - (u.height - y) < v) { - y = v - (m - o.depth) + u.height; - var M = 0.8 * p.xHeight - (m - o.depth); + var w; + if (c && d) { + m = Math.max(m, f, c.depth + 0.25 * _.xHeight), y = Math.max(y, _.sub2); + var o = _.defaultRuleThickness, v = 4 * o; + if (m - c.depth - (d.height - y) < v) { + y = v - (m - c.depth) + d.height; + var M = 0.8 * _.xHeight - (m - c.depth); M > 0 && (m += M, y -= M); } var E = [{ type: "elem", - elem: u, + elem: d, shift: y, - marginRight: h, - marginLeft: _ + marginRight: u, + marginLeft: p }, { type: "elem", - elem: o, + elem: c, shift: -m, - marginRight: h + marginRight: u }]; - x = buildCommon.makeVList({ + w = buildCommon.makeVList({ positionType: "individualShift", children: E }, e); - } else if (u) { - y = Math.max(y, p.sub1, u.height - 0.8 * p.xHeight); + } else if (d) { + y = Math.max(y, _.sub1, d.height - 0.8 * _.xHeight); var $ = [{ type: "elem", - elem: u, - marginLeft: _, - marginRight: h + elem: d, + marginLeft: p, + marginRight: u }]; - x = buildCommon.makeVList({ + w = buildCommon.makeVList({ positionType: "shift", positionData: y, children: $ }, e); - } else if (o) - m = Math.max(m, f, o.depth + 0.25 * p.xHeight), x = buildCommon.makeVList({ + } else if (c) + m = Math.max(m, f, c.depth + 0.25 * _.xHeight), w = buildCommon.makeVList({ positionType: "shift", positionData: -m, children: [{ type: "elem", - elem: o, - marginRight: h + elem: c, + marginRight: u }] }, e); else throw new Error("supsub must have either sup or sub."); - var k = getTypeOfDomTree(d, "right") || "mord"; - return buildCommon.makeSpan([k], [d, buildCommon.makeSpan(["msupsub"], [x])], e); + var k = getTypeOfDomTree(h, "right") || "mord"; + return buildCommon.makeSpan([k], [h, buildCommon.makeSpan(["msupsub"], [w])], e); }, mathmlBuilder(n, e) { var t = !1, r, a; n.base && n.base.type === "horizBrace" && (a = !!n.sup, a === n.base.isOver && (t = !0, r = n.base.isOver)), n.base && (n.base.type === "op" || n.base.type === "operatorname") && (n.base.parentIsSupSub = !0); var l = [buildGroup(n.base, e)]; n.sub && l.push(buildGroup(n.sub, e)), n.sup && l.push(buildGroup(n.sup, e)); - var d; + var h; if (t) - d = r ? "mover" : "munder"; + h = r ? "mover" : "munder"; else if (n.sub) if (n.sup) { - var p = n.base; - p && p.type === "op" && p.limits && e.style === Style$1.DISPLAY || p && p.type === "operatorname" && p.alwaysHandleSupSub && (e.style === Style$1.DISPLAY || p.limits) ? d = "munderover" : d = "msubsup"; + var _ = n.base; + _ && _.type === "op" && _.limits && e.style === Style$1.DISPLAY || _ && _.type === "operatorname" && _.alwaysHandleSupSub && (e.style === Style$1.DISPLAY || _.limits) ? h = "munderover" : h = "msubsup"; } else { - var u = n.base; - u && u.type === "op" && u.limits && (e.style === Style$1.DISPLAY || u.alwaysHandleSupSub) || u && u.type === "operatorname" && u.alwaysHandleSupSub && (u.limits || e.style === Style$1.DISPLAY) ? d = "munder" : d = "msub"; + var d = n.base; + d && d.type === "op" && d.limits && (e.style === Style$1.DISPLAY || d.alwaysHandleSupSub) || d && d.type === "operatorname" && d.alwaysHandleSupSub && (d.limits || e.style === Style$1.DISPLAY) ? h = "munder" : h = "msub"; } else { - var o = n.base; - o && o.type === "op" && o.limits && (e.style === Style$1.DISPLAY || o.alwaysHandleSupSub) || o && o.type === "operatorname" && o.alwaysHandleSupSub && (o.limits || e.style === Style$1.DISPLAY) ? d = "mover" : d = "msup"; + var c = n.base; + c && c.type === "op" && c.limits && (e.style === Style$1.DISPLAY || c.alwaysHandleSupSub) || c && c.type === "operatorname" && c.alwaysHandleSupSub && (c.limits || e.style === Style$1.DISPLAY) ? h = "mover" : h = "msup"; } - return new mathMLTree.MathNode(d, l); + return new mathMLTree.MathNode(h, l); } }); defineFunctionBuilders({ @@ -9964,8 +9964,8 @@ defineFunction({ }, htmlBuilder(n, e) { for (var t = makeVerb(n), r = [], a = e.havingStyle(e.style.text()), l = 0; l < t.length; l++) { - var d = t[l]; - d === "~" && (d = "\\textasciitilde"), r.push(buildCommon.makeSymbol(d, "Typewriter-Regular", n.mode, a, ["mord", "texttt"])); + var h = t[l]; + h === "~" && (h = "\\textasciitilde"), r.push(buildCommon.makeSymbol(h, "Typewriter-Regular", n.mode, a, ["mord", "texttt"])); } return buildCommon.makeSpan(["mord", "text"].concat(a.sizingClasses(e)), buildCommon.tryCombineChars(r), a); }, @@ -10083,17 +10083,17 @@ var newcommand = (n, e, t) => { throw new ParseError("\\newcommand{" + a + "} attempting to redefine " + (a + "; use \\renewcommand")); if (!l && !t) throw new ParseError("\\renewcommand{" + a + "} when command " + a + " does not yet exist; use \\newcommand"); - var d = 0; + var h = 0; if (r = n.consumeArg().tokens, r.length === 1 && r[0].text === "[") { - for (var o = "", u = n.expandNextToken(); u.text !== "]" && u.text !== "EOF"; ) - o += u.text, u = n.expandNextToken(); - if (!o.match(/^\s*[0-9]+\s*$/)) - throw new ParseError("Invalid number of arguments: " + o); - d = parseInt(o), r = n.consumeArg().tokens; + for (var c = "", d = n.expandNextToken(); d.text !== "]" && d.text !== "EOF"; ) + c += d.text, d = n.expandNextToken(); + if (!c.match(/^\s*[0-9]+\s*$/)) + throw new ParseError("Invalid number of arguments: " + c); + h = parseInt(c), r = n.consumeArg().tokens; } return n.macros.set(a, { tokens: r, - numArgs: d + numArgs: h }), ""; }; defineMacro("\\newcommand", (n) => newcommand(n, !1, !0)); @@ -10465,24 +10465,24 @@ defineMacro("\\braket", "\\mathinner{\\langle{#1}\\rangle}"); defineMacro("\\Bra", "\\left\\langle#1\\right|"); defineMacro("\\Ket", "\\left|#1\\right\\rangle"); var braketHelper = (n) => (e) => { - var t = e.consumeArg().tokens, r = e.consumeArg().tokens, a = e.consumeArg().tokens, l = e.consumeArg().tokens, d = e.macros.get("|"), o = e.macros.get("\\|"); + var t = e.consumeArg().tokens, r = e.consumeArg().tokens, a = e.consumeArg().tokens, l = e.consumeArg().tokens, h = e.macros.get("|"), c = e.macros.get("\\|"); e.macros.beginGroup(); - var u = (y) => (w) => { - n && (w.macros.set("|", d), a.length && w.macros.set("\\|", o)); + var d = (y) => (x) => { + n && (x.macros.set("|", h), a.length && x.macros.set("\\|", c)); var b = y; if (!y && a.length) { - var A = w.future(); - A.text === "|" && (w.popToken(), b = !0); + var A = x.future(); + A.text === "|" && (x.popToken(), b = !0); } return { tokens: b ? a : r, numArgs: 0 }; }; - e.macros.set("|", u(!1)), a.length && e.macros.set("\\|", u(!0)); - var p = e.consumeArg().tokens, m = e.expandTokens([ + e.macros.set("|", d(!1)), a.length && e.macros.set("\\|", d(!0)); + var _ = e.consumeArg().tokens, m = e.expandTokens([ ...l, - ...p, + ..._, ...t // reversed ]); @@ -10597,8 +10597,8 @@ function edit(n, e) { e = e || ""; const r = { replace: (a, l) => { - let d = typeof l == "string" ? l : l.source; - return d = d.replace(caret, "$1"), t = t.replace(a, d), r; + let h = typeof l == "string" ? l : l.source; + return h = h.replace(caret, "$1"), t = t.replace(a, h), r; }, getRegex: () => new RegExp(t, e) }; @@ -10614,11 +10614,11 @@ function cleanUrl(n) { } const noopTest = { exec: () => null }; function splitCells(n, e) { - const t = n.replace(/\|/g, (l, d, o) => { - let u = !1, p = d; - for (; --p >= 0 && o[p] === "\\"; ) - u = !u; - return u ? "|" : " |"; + const t = n.replace(/\|/g, (l, h, c) => { + let d = !1, _ = h; + for (; --_ >= 0 && c[_] === "\\"; ) + d = !d; + return d ? "|" : " |"; }), r = t.split(/ \|/); let a = 0; if (r[0].trim() || r.shift(), r.length > 0 && !r[r.length - 1].trim() && r.pop(), e) @@ -10661,25 +10661,25 @@ function findClosingBracket(n, e) { return -1; } function outputLink(n, e, t, r) { - const a = e.href, l = e.title ? escape$1(e.title) : null, d = n[1].replace(/\\([\[\]])/g, "$1"); + const a = e.href, l = e.title ? escape$1(e.title) : null, h = n[1].replace(/\\([\[\]])/g, "$1"); if (n[0].charAt(0) !== "!") { r.state.inLink = !0; - const o = { + const c = { type: "link", raw: t, href: a, title: l, - text: d, - tokens: r.inlineTokens(d) + text: h, + tokens: r.inlineTokens(h) }; - return r.state.inLink = !1, o; + return r.state.inLink = !1, c; } return { type: "image", raw: t, href: a, title: l, - text: escape$1(d) + text: escape$1(h) }; } function indentCodeCompensation(n, e) { @@ -10692,18 +10692,18 @@ function indentCodeCompensation(n, e) { const l = a.match(/^\s+/); if (l === null) return a; - const [d] = l; - return d.length >= r.length ? a.slice(r.length) : a; + const [h] = l; + return h.length >= r.length ? a.slice(r.length) : a; }).join(` `); } class _Tokenizer { // set by the lexer constructor(e) { - kt(this, "options"); - kt(this, "rules"); + Ft(this, "options"); + Ft(this, "rules"); // set by the lexer - kt(this, "lexer"); + Ft(this, "lexer"); this.options = e || _defaults; } space(e) { @@ -10795,56 +10795,56 @@ class _Tokenizer { items: [] }; r = a ? `\\d{1,9}\\${r.slice(-1)}` : `\\${r}`, this.options.pedantic && (r = a ? r : "[*+-]"); - const d = new RegExp(`^( {0,3}${r})((?:[ ][^\\n]*)?(?:\\n|$))`); - let o = "", u = "", p = !1; + const h = new RegExp(`^( {0,3}${r})((?:[ ][^\\n]*)?(?:\\n|$))`); + let c = "", d = "", _ = !1; for (; e; ) { let m = !1; - if (!(t = d.exec(e)) || this.rules.block.hr.test(e)) + if (!(t = h.exec(e)) || this.rules.block.hr.test(e)) break; - o = t[0], e = e.substring(o.length); + c = t[0], e = e.substring(c.length); let y = t[2].split(` -`, 1)[0].replace(/^\t+/, (h) => " ".repeat(3 * h.length)), w = e.split(` +`, 1)[0].replace(/^\t+/, (u) => " ".repeat(3 * u.length)), x = e.split(` `, 1)[0], b = 0; - this.options.pedantic ? (b = 2, u = y.trimStart()) : (b = t[2].search(/[^ ]/), b = b > 4 ? 1 : b, u = y.slice(b), b += t[1].length); + this.options.pedantic ? (b = 2, d = y.trimStart()) : (b = t[2].search(/[^ ]/), b = b > 4 ? 1 : b, d = y.slice(b), b += t[1].length); let A = !1; - if (!y && /^ *$/.test(w) && (o += w + ` -`, e = e.substring(w.length + 1), m = !0), !m) { - const h = new RegExp(`^ {0,${Math.min(3, b - 1)}}(?:[*+-]|\\d{1,9}[.)])((?:[ ][^\\n]*)?(?:\\n|$))`), _ = new RegExp(`^ {0,${Math.min(3, b - 1)}}((?:- *){3,}|(?:_ *){3,}|(?:\\* *){3,})(?:\\n+|$)`), g = new RegExp(`^ {0,${Math.min(3, b - 1)}}(?:\`\`\`|~~~)`), x = new RegExp(`^ {0,${Math.min(3, b - 1)}}#`); + if (!y && /^ *$/.test(x) && (c += x + ` +`, e = e.substring(x.length + 1), m = !0), !m) { + const u = new RegExp(`^ {0,${Math.min(3, b - 1)}}(?:[*+-]|\\d{1,9}[.)])((?:[ ][^\\n]*)?(?:\\n|$))`), p = new RegExp(`^ {0,${Math.min(3, b - 1)}}((?:- *){3,}|(?:_ *){3,}|(?:\\* *){3,})(?:\\n+|$)`), g = new RegExp(`^ {0,${Math.min(3, b - 1)}}(?:\`\`\`|~~~)`), w = new RegExp(`^ {0,${Math.min(3, b - 1)}}#`); for (; e; ) { - const c = e.split(` + const o = e.split(` `, 1)[0]; - if (w = c, this.options.pedantic && (w = w.replace(/^ {1,4}(?=( {4})*[^ ])/g, " ")), g.test(w) || x.test(w) || h.test(w) || _.test(e)) + if (x = o, this.options.pedantic && (x = x.replace(/^ {1,4}(?=( {4})*[^ ])/g, " ")), g.test(x) || w.test(x) || u.test(x) || p.test(e)) break; - if (w.search(/[^ ]/) >= b || !w.trim()) - u += ` -` + w.slice(b); + if (x.search(/[^ ]/) >= b || !x.trim()) + d += ` +` + x.slice(b); else { - if (A || y.search(/[^ ]/) >= 4 || g.test(y) || x.test(y) || _.test(y)) + if (A || y.search(/[^ ]/) >= 4 || g.test(y) || w.test(y) || p.test(y)) break; - u += ` -` + w; + d += ` +` + x; } - !A && !w.trim() && (A = !0), o += c + ` -`, e = e.substring(c.length + 1), y = w.slice(b); + !A && !x.trim() && (A = !0), c += o + ` +`, e = e.substring(o.length + 1), y = x.slice(b); } } - l.loose || (p ? l.loose = !0 : /\n *\n *$/.test(o) && (p = !0)); + l.loose || (_ ? l.loose = !0 : /\n *\n *$/.test(c) && (_ = !0)); let f = null, s; - this.options.gfm && (f = /^\[[ xX]\] /.exec(u), f && (s = f[0] !== "[ ] ", u = u.replace(/^\[[ xX]\] +/, ""))), l.items.push({ + this.options.gfm && (f = /^\[[ xX]\] /.exec(d), f && (s = f[0] !== "[ ] ", d = d.replace(/^\[[ xX]\] +/, ""))), l.items.push({ type: "list_item", - raw: o, + raw: c, task: !!f, checked: s, loose: !1, - text: u, + text: d, tokens: [] - }), l.raw += o; + }), l.raw += c; } - l.items[l.items.length - 1].raw = o.trimEnd(), l.items[l.items.length - 1].text = u.trimEnd(), l.raw = l.raw.trimEnd(); + l.items[l.items.length - 1].raw = c.trimEnd(), l.items[l.items.length - 1].text = d.trimEnd(), l.raw = l.raw.trimEnd(); for (let m = 0; m < l.items.length; m++) if (this.lexer.state.top = !1, l.items[m].tokens = this.lexer.blockTokens(l.items[m].text, []), !l.loose) { - const y = l.items[m].tokens.filter((b) => b.type === "space"), w = y.length > 0 && y.some((b) => /\n.*\n/.test(b.raw)); - l.loose = w; + const y = l.items[m].tokens.filter((b) => b.type === "space"), x = y.length > 0 && y.some((b) => /\n.*\n/.test(b.raw)); + l.loose = x; } if (l.loose) for (let m = 0; m < l.items.length; m++) @@ -10881,7 +10881,7 @@ class _Tokenizer { if (!t || !/[:|]/.test(t[2])) return; const r = splitCells(t[1]), a = t[2].replace(/^\||\| *$/g, "").split("|"), l = t[3] && t[3].trim() ? t[3].replace(/\n[ \t]*$/, "").split(` -`) : [], d = { +`) : [], h = { type: "table", raw: t[0], header: [], @@ -10889,19 +10889,19 @@ class _Tokenizer { rows: [] }; if (r.length === a.length) { - for (const o of a) - /^ *-+: *$/.test(o) ? d.align.push("right") : /^ *:-+: *$/.test(o) ? d.align.push("center") : /^ *:-+ *$/.test(o) ? d.align.push("left") : d.align.push(null); - for (const o of r) - d.header.push({ - text: o, - tokens: this.lexer.inline(o) + for (const c of a) + /^ *-+: *$/.test(c) ? h.align.push("right") : /^ *:-+: *$/.test(c) ? h.align.push("center") : /^ *:-+ *$/.test(c) ? h.align.push("left") : h.align.push(null); + for (const c of r) + h.header.push({ + text: c, + tokens: this.lexer.inline(c) }); - for (const o of l) - d.rows.push(splitCells(o, d.header.length).map((u) => ({ - text: u, - tokens: this.lexer.inline(u) + for (const c of l) + h.rows.push(splitCells(c, h.header.length).map((d) => ({ + text: d, + tokens: this.lexer.inline(d) }))); - return d; + return h; } } lheading(e) { @@ -10966,20 +10966,20 @@ class _Tokenizer { if (!this.options.pedantic && /^$/.test(r)) return; - const d = rtrim(r.slice(0, -1), "\\"); - if ((r.length - d.length) % 2 === 0) + const h = rtrim(r.slice(0, -1), "\\"); + if ((r.length - h.length) % 2 === 0) return; } else { - const d = findClosingBracket(t[2], "()"); - if (d > -1) { - const u = (t[0].indexOf("!") === 0 ? 5 : 4) + t[1].length + d; - t[2] = t[2].substring(0, d), t[0] = t[0].substring(0, u).trim(), t[3] = ""; + const h = findClosingBracket(t[2], "()"); + if (h > -1) { + const d = (t[0].indexOf("!") === 0 ? 5 : 4) + t[1].length + h; + t[2] = t[2].substring(0, h), t[0] = t[0].substring(0, d).trim(), t[3] = ""; } } let a = t[2], l = ""; if (this.options.pedantic) { - const d = /^([^'"]*[^\s])\s+(['"])(.*)\2/.exec(a); - d && (a = d[1], l = d[3]); + const h = /^([^'"]*[^\s])\s+(['"])(.*)\2/.exec(a); + h && (a = h[1], l = h[3]); } else l = t[3] ? t[3].slice(1, -1) : ""; return a = a.trim(), /^$/.test(r) ? a = a.slice(1) : a = a.slice(1, -1)), outputLink(t, { @@ -10993,11 +10993,11 @@ class _Tokenizer { if ((r = this.rules.inline.reflink.exec(e)) || (r = this.rules.inline.nolink.exec(e))) { const a = (r[2] || r[1]).replace(/\s+/g, " "), l = t[a.toLowerCase()]; if (!l) { - const d = r[0].charAt(0); + const h = r[0].charAt(0); return { type: "text", - raw: d, - text: d + raw: h, + text: h }; } return outputLink(r, l, r[0], this.lexer); @@ -11008,24 +11008,24 @@ class _Tokenizer { if (!a || a[3] && r.match(/[\p{L}\p{N}]/u)) return; if (!(a[1] || a[2] || "") || !r || this.rules.inline.punctuation.exec(r)) { - const d = [...a[0]].length - 1; - let o, u, p = d, m = 0; + const h = [...a[0]].length - 1; + let c, d, _ = h, m = 0; const y = a[0][0] === "*" ? this.rules.inline.emStrongRDelimAst : this.rules.inline.emStrongRDelimUnd; - for (y.lastIndex = 0, t = t.slice(-1 * e.length + d); (a = y.exec(t)) != null; ) { - if (o = a[1] || a[2] || a[3] || a[4] || a[5] || a[6], !o) + for (y.lastIndex = 0, t = t.slice(-1 * e.length + h); (a = y.exec(t)) != null; ) { + if (c = a[1] || a[2] || a[3] || a[4] || a[5] || a[6], !c) continue; - if (u = [...o].length, a[3] || a[4]) { - p += u; + if (d = [...c].length, a[3] || a[4]) { + _ += d; continue; - } else if ((a[5] || a[6]) && d % 3 && !((d + u) % 3)) { - m += u; + } else if ((a[5] || a[6]) && h % 3 && !((h + d) % 3)) { + m += d; continue; } - if (p -= u, p > 0) + if (_ -= d, _ > 0) continue; - u = Math.min(u, u + p + m); - const w = [...a[0]][0].length, b = e.slice(0, d + a.index + w + u); - if (Math.min(d, u) % 2) { + d = Math.min(d, d + _ + m); + const x = [...a[0]][0].length, b = e.slice(0, h + a.index + x + d); + if (Math.min(h, d) % 2) { const f = b.slice(1, -1); return { type: "em", @@ -11101,10 +11101,10 @@ class _Tokenizer { if (t[2] === "@") a = escape$1(t[0]), l = "mailto:" + a; else { - let d; + let h; do - d = t[0], t[0] = ((r = this.rules.inline._backpedal.exec(t[0])) == null ? void 0 : r[0]) ?? ""; - while (d !== t[0]); + h = t[0], t[0] = ((r = this.rules.inline._backpedal.exec(t[0])) == null ? void 0 : r[0]) ?? ""; + while (h !== t[0]); a = escape$1(t[0]), t[1] === "www." ? l = "http://" + t[0] : l = t[0]; } return { @@ -11210,11 +11210,11 @@ const newline = /^(?: *(?:\n|$))+/, blockCode = /^( {4}[^\n]+(?:\n(?: *(?:\n|$)) }; class _Lexer { constructor(e) { - kt(this, "tokens"); - kt(this, "options"); - kt(this, "state"); - kt(this, "tokenizer"); - kt(this, "inlineQueue"); + Ft(this, "tokens"); + Ft(this, "options"); + Ft(this, "state"); + Ft(this, "tokenizer"); + Ft(this, "inlineQueue"); this.tokens = [], this.tokens.links = /* @__PURE__ */ Object.create(null), this.options = e || _defaults, this.options.tokenizer = this.options.tokenizer || new _Tokenizer(), this.tokenizer = this.options.tokenizer, this.tokenizer.options = this.options, this.tokenizer.lexer = this, this.inlineQueue = [], this.state = { inLink: !1, inRawBlock: !1, @@ -11260,10 +11260,10 @@ class _Lexer { return this.inlineQueue = [], this.tokens; } blockTokens(e, t = []) { - this.options.pedantic ? e = e.replace(/\t/g, " ").replace(/^ +$/gm, "") : e = e.replace(/^( *)(\t+)/gm, (o, u, p) => u + " ".repeat(p.length)); - let r, a, l, d; + this.options.pedantic ? e = e.replace(/\t/g, " ").replace(/^ +$/gm, "") : e = e.replace(/^( *)(\t+)/gm, (c, d, _) => d + " ".repeat(_.length)); + let r, a, l, h; for (; e; ) - if (!(this.options.extensions && this.options.extensions.block && this.options.extensions.block.some((o) => (r = o.call({ lexer: this }, e, t)) ? (e = e.substring(r.raw.length), t.push(r), !0) : !1))) { + if (!(this.options.extensions && this.options.extensions.block && this.options.extensions.block.some((c) => (r = c.call({ lexer: this }, e, t)) ? (e = e.substring(r.raw.length), t.push(r), !0) : !1))) { if (r = this.tokenizer.space(e)) { e = e.substring(r.raw.length), r.raw.length === 1 && t.length > 0 ? t[t.length - 1].raw += ` ` : t.push(r); @@ -11317,17 +11317,17 @@ class _Lexer { continue; } if (l = e, this.options.extensions && this.options.extensions.startBlock) { - let o = 1 / 0; - const u = e.slice(1); - let p; + let c = 1 / 0; + const d = e.slice(1); + let _; this.options.extensions.startBlock.forEach((m) => { - p = m.call({ lexer: this }, u), typeof p == "number" && p >= 0 && (o = Math.min(o, p)); - }), o < 1 / 0 && o >= 0 && (l = e.substring(0, o + 1)); + _ = m.call({ lexer: this }, d), typeof _ == "number" && _ >= 0 && (c = Math.min(c, _)); + }), c < 1 / 0 && c >= 0 && (l = e.substring(0, c + 1)); } if (this.state.top && (r = this.tokenizer.paragraph(l))) { - a = t[t.length - 1], d && a.type === "paragraph" ? (a.raw += ` + a = t[t.length - 1], h && a.type === "paragraph" ? (a.raw += ` ` + r.raw, a.text += ` -` + r.text, this.inlineQueue.pop(), this.inlineQueue[this.inlineQueue.length - 1].src = a.text) : t.push(r), d = l.length !== e.length, e = e.substring(r.raw.length); +` + r.text, this.inlineQueue.pop(), this.inlineQueue[this.inlineQueue.length - 1].src = a.text) : t.push(r), h = l.length !== e.length, e = e.substring(r.raw.length); continue; } if (r = this.tokenizer.text(e)) { @@ -11337,12 +11337,12 @@ class _Lexer { continue; } if (e) { - const o = "Infinite loop on byte: " + e.charCodeAt(0); + const c = "Infinite loop on byte: " + e.charCodeAt(0); if (this.options.silent) { - console.error(o); + console.error(c); break; } else - throw new Error(o); + throw new Error(c); } } return this.state.top = !0, t; @@ -11354,19 +11354,19 @@ class _Lexer { * Lexing/Compiling */ inlineTokens(e, t = []) { - let r, a, l, d = e, o, u, p; + let r, a, l, h = e, c, d, _; if (this.tokens.links) { const m = Object.keys(this.tokens.links); if (m.length > 0) - for (; (o = this.tokenizer.rules.inline.reflinkSearch.exec(d)) != null; ) - m.includes(o[0].slice(o[0].lastIndexOf("[") + 1, -1)) && (d = d.slice(0, o.index) + "[" + "a".repeat(o[0].length - 2) + "]" + d.slice(this.tokenizer.rules.inline.reflinkSearch.lastIndex)); + for (; (c = this.tokenizer.rules.inline.reflinkSearch.exec(h)) != null; ) + m.includes(c[0].slice(c[0].lastIndexOf("[") + 1, -1)) && (h = h.slice(0, c.index) + "[" + "a".repeat(c[0].length - 2) + "]" + h.slice(this.tokenizer.rules.inline.reflinkSearch.lastIndex)); } - for (; (o = this.tokenizer.rules.inline.blockSkip.exec(d)) != null; ) - d = d.slice(0, o.index) + "[" + "a".repeat(o[0].length - 2) + "]" + d.slice(this.tokenizer.rules.inline.blockSkip.lastIndex); - for (; (o = this.tokenizer.rules.inline.anyPunctuation.exec(d)) != null; ) - d = d.slice(0, o.index) + "++" + d.slice(this.tokenizer.rules.inline.anyPunctuation.lastIndex); + for (; (c = this.tokenizer.rules.inline.blockSkip.exec(h)) != null; ) + h = h.slice(0, c.index) + "[" + "a".repeat(c[0].length - 2) + "]" + h.slice(this.tokenizer.rules.inline.blockSkip.lastIndex); + for (; (c = this.tokenizer.rules.inline.anyPunctuation.exec(h)) != null; ) + h = h.slice(0, c.index) + "++" + h.slice(this.tokenizer.rules.inline.anyPunctuation.lastIndex); for (; e; ) - if (u || (p = ""), u = !1, !(this.options.extensions && this.options.extensions.inline && this.options.extensions.inline.some((m) => (r = m.call({ lexer: this }, e, t)) ? (e = e.substring(r.raw.length), t.push(r), !0) : !1))) { + if (d || (_ = ""), d = !1, !(this.options.extensions && this.options.extensions.inline && this.options.extensions.inline.some((m) => (r = m.call({ lexer: this }, e, t)) ? (e = e.substring(r.raw.length), t.push(r), !0) : !1))) { if (r = this.tokenizer.escape(e)) { e = e.substring(r.raw.length), t.push(r); continue; @@ -11383,7 +11383,7 @@ class _Lexer { e = e.substring(r.raw.length), a = t[t.length - 1], a && r.type === "text" && a.type === "text" ? (a.raw += r.raw, a.text += r.text) : t.push(r); continue; } - if (r = this.tokenizer.emStrong(e, d, p)) { + if (r = this.tokenizer.emStrong(e, h, _)) { e = e.substring(r.raw.length), t.push(r); continue; } @@ -11410,13 +11410,13 @@ class _Lexer { if (l = e, this.options.extensions && this.options.extensions.startInline) { let m = 1 / 0; const y = e.slice(1); - let w; + let x; this.options.extensions.startInline.forEach((b) => { - w = b.call({ lexer: this }, y), typeof w == "number" && w >= 0 && (m = Math.min(m, w)); + x = b.call({ lexer: this }, y), typeof x == "number" && x >= 0 && (m = Math.min(m, x)); }), m < 1 / 0 && m >= 0 && (l = e.substring(0, m + 1)); } if (r = this.tokenizer.inlineText(l)) { - e = e.substring(r.raw.length), r.raw.slice(-1) !== "_" && (p = r.raw.slice(-1)), u = !0, a = t[t.length - 1], a && a.type === "text" ? (a.raw += r.raw, a.text += r.text) : t.push(r); + e = e.substring(r.raw.length), r.raw.slice(-1) !== "_" && (_ = r.raw.slice(-1)), d = !0, a = t[t.length - 1], a && a.type === "text" ? (a.raw += r.raw, a.text += r.text) : t.push(r); continue; } if (e) { @@ -11433,7 +11433,7 @@ class _Lexer { } class _Renderer { constructor(e) { - kt(this, "options"); + Ft(this, "options"); this.options = e || _defaults; } code(e, t, r) { @@ -11564,9 +11564,9 @@ class _TextRenderer { } class _Parser { constructor(e) { - kt(this, "options"); - kt(this, "renderer"); - kt(this, "textRenderer"); + Ft(this, "options"); + Ft(this, "renderer"); + Ft(this, "textRenderer"); this.options = e || _defaults, this.options.renderer = this.options.renderer || new _Renderer(), this.renderer = this.options.renderer, this.renderer.options = this.options, this.textRenderer = new _TextRenderer(); } /** @@ -11589,9 +11589,9 @@ class _Parser { for (let a = 0; a < e.length; a++) { const l = e[a]; if (this.options.extensions && this.options.extensions.renderers && this.options.extensions.renderers[l.type]) { - const d = l, o = this.options.extensions.renderers[d.type].call({ parser: this }, d); - if (o !== !1 || !["space", "hr", "heading", "code", "table", "blockquote", "list", "html", "paragraph", "text"].includes(d.type)) { - r += o || ""; + const h = l, c = this.options.extensions.renderers[h.type].call({ parser: this }, h); + if (c !== !1 || !["space", "hr", "heading", "code", "table", "blockquote", "list", "html", "paragraph", "text"].includes(h.type)) { + r += c || ""; continue; } } @@ -11603,78 +11603,78 @@ class _Parser { continue; } case "heading": { - const d = l; - r += this.renderer.heading(this.parseInline(d.tokens), d.depth, unescape(this.parseInline(d.tokens, this.textRenderer))); + const h = l; + r += this.renderer.heading(this.parseInline(h.tokens), h.depth, unescape(this.parseInline(h.tokens, this.textRenderer))); continue; } case "code": { - const d = l; - r += this.renderer.code(d.text, d.lang, !!d.escaped); + const h = l; + r += this.renderer.code(h.text, h.lang, !!h.escaped); continue; } case "table": { - const d = l; - let o = "", u = ""; - for (let m = 0; m < d.header.length; m++) - u += this.renderer.tablecell(this.parseInline(d.header[m].tokens), { header: !0, align: d.align[m] }); - o += this.renderer.tablerow(u); - let p = ""; - for (let m = 0; m < d.rows.length; m++) { - const y = d.rows[m]; - u = ""; - for (let w = 0; w < y.length; w++) - u += this.renderer.tablecell(this.parseInline(y[w].tokens), { header: !1, align: d.align[w] }); - p += this.renderer.tablerow(u); + const h = l; + let c = "", d = ""; + for (let m = 0; m < h.header.length; m++) + d += this.renderer.tablecell(this.parseInline(h.header[m].tokens), { header: !0, align: h.align[m] }); + c += this.renderer.tablerow(d); + let _ = ""; + for (let m = 0; m < h.rows.length; m++) { + const y = h.rows[m]; + d = ""; + for (let x = 0; x < y.length; x++) + d += this.renderer.tablecell(this.parseInline(y[x].tokens), { header: !1, align: h.align[x] }); + _ += this.renderer.tablerow(d); } - r += this.renderer.table(o, p); + r += this.renderer.table(c, _); continue; } case "blockquote": { - const d = l, o = this.parse(d.tokens); - r += this.renderer.blockquote(o); + const h = l, c = this.parse(h.tokens); + r += this.renderer.blockquote(c); continue; } case "list": { - const d = l, o = d.ordered, u = d.start, p = d.loose; + const h = l, c = h.ordered, d = h.start, _ = h.loose; let m = ""; - for (let y = 0; y < d.items.length; y++) { - const w = d.items[y], b = w.checked, A = w.task; + for (let y = 0; y < h.items.length; y++) { + const x = h.items[y], b = x.checked, A = x.task; let f = ""; - if (w.task) { + if (x.task) { const s = this.renderer.checkbox(!!b); - p ? w.tokens.length > 0 && w.tokens[0].type === "paragraph" ? (w.tokens[0].text = s + " " + w.tokens[0].text, w.tokens[0].tokens && w.tokens[0].tokens.length > 0 && w.tokens[0].tokens[0].type === "text" && (w.tokens[0].tokens[0].text = s + " " + w.tokens[0].tokens[0].text)) : w.tokens.unshift({ + _ ? x.tokens.length > 0 && x.tokens[0].type === "paragraph" ? (x.tokens[0].text = s + " " + x.tokens[0].text, x.tokens[0].tokens && x.tokens[0].tokens.length > 0 && x.tokens[0].tokens[0].type === "text" && (x.tokens[0].tokens[0].text = s + " " + x.tokens[0].tokens[0].text)) : x.tokens.unshift({ type: "text", text: s + " " }) : f += s + " "; } - f += this.parse(w.tokens, p), m += this.renderer.listitem(f, A, !!b); + f += this.parse(x.tokens, _), m += this.renderer.listitem(f, A, !!b); } - r += this.renderer.list(m, o, u); + r += this.renderer.list(m, c, d); continue; } case "html": { - const d = l; - r += this.renderer.html(d.text, d.block); + const h = l; + r += this.renderer.html(h.text, h.block); continue; } case "paragraph": { - const d = l; - r += this.renderer.paragraph(this.parseInline(d.tokens)); + const h = l; + r += this.renderer.paragraph(this.parseInline(h.tokens)); continue; } case "text": { - let d = l, o = d.tokens ? this.parseInline(d.tokens) : d.text; + let h = l, c = h.tokens ? this.parseInline(h.tokens) : h.text; for (; a + 1 < e.length && e[a + 1].type === "text"; ) - d = e[++a], o += ` -` + (d.tokens ? this.parseInline(d.tokens) : d.text); - r += t ? this.renderer.paragraph(o) : o; + h = e[++a], c += ` +` + (h.tokens ? this.parseInline(h.tokens) : h.text); + r += t ? this.renderer.paragraph(c) : c; continue; } default: { - const d = 'Token with "' + l.type + '" type was not found.'; + const h = 'Token with "' + l.type + '" type was not found.'; if (this.options.silent) - return console.error(d), ""; - throw new Error(d); + return console.error(h), ""; + throw new Error(h); } } } @@ -11689,46 +11689,46 @@ class _Parser { for (let a = 0; a < e.length; a++) { const l = e[a]; if (this.options.extensions && this.options.extensions.renderers && this.options.extensions.renderers[l.type]) { - const d = this.options.extensions.renderers[l.type].call({ parser: this }, l); - if (d !== !1 || !["escape", "html", "link", "image", "strong", "em", "codespan", "br", "del", "text"].includes(l.type)) { - r += d || ""; + const h = this.options.extensions.renderers[l.type].call({ parser: this }, l); + if (h !== !1 || !["escape", "html", "link", "image", "strong", "em", "codespan", "br", "del", "text"].includes(l.type)) { + r += h || ""; continue; } } switch (l.type) { case "escape": { - const d = l; - r += t.text(d.text); + const h = l; + r += t.text(h.text); break; } case "html": { - const d = l; - r += t.html(d.text); + const h = l; + r += t.html(h.text); break; } case "link": { - const d = l; - r += t.link(d.href, d.title, this.parseInline(d.tokens, t)); + const h = l; + r += t.link(h.href, h.title, this.parseInline(h.tokens, t)); break; } case "image": { - const d = l; - r += t.image(d.href, d.title, d.text); + const h = l; + r += t.image(h.href, h.title, h.text); break; } case "strong": { - const d = l; - r += t.strong(this.parseInline(d.tokens, t)); + const h = l; + r += t.strong(this.parseInline(h.tokens, t)); break; } case "em": { - const d = l; - r += t.em(this.parseInline(d.tokens, t)); + const h = l; + r += t.em(this.parseInline(h.tokens, t)); break; } case "codespan": { - const d = l; - r += t.codespan(d.text); + const h = l; + r += t.codespan(h.text); break; } case "br": { @@ -11736,20 +11736,20 @@ class _Parser { break; } case "del": { - const d = l; - r += t.del(this.parseInline(d.tokens, t)); + const h = l; + r += t.del(this.parseInline(h.tokens, t)); break; } case "text": { - const d = l; - r += t.text(d.text); + const h = l; + r += t.text(h.text); break; } default: { - const d = 'Token with "' + l.type + '" type was not found.'; + const h = 'Token with "' + l.type + '" type was not found.'; if (this.options.silent) - return console.error(d), ""; - throw new Error(d); + return console.error(h), ""; + throw new Error(h); } } } @@ -11758,7 +11758,7 @@ class _Parser { } class _Hooks { constructor(e) { - kt(this, "options"); + Ft(this, "options"); this.options = e || _defaults; } /** @@ -11780,25 +11780,25 @@ class _Hooks { return e; } } -kt(_Hooks, "passThroughHooks", /* @__PURE__ */ new Set([ +Ft(_Hooks, "passThroughHooks", /* @__PURE__ */ new Set([ "preprocess", "postprocess", "processAllTokens" ])); -var fr, hi, yn; +var Mr, Di, Fn; class Marked { constructor(...e) { - ui(this, fr); - kt(this, "defaults", _getDefaults()); - kt(this, "options", this.setOptions); - kt(this, "parse", Zr(this, fr, hi).call(this, _Lexer.lex, _Parser.parse)); - kt(this, "parseInline", Zr(this, fr, hi).call(this, _Lexer.lexInline, _Parser.parseInline)); - kt(this, "Parser", _Parser); - kt(this, "Renderer", _Renderer); - kt(this, "TextRenderer", _TextRenderer); - kt(this, "Lexer", _Lexer); - kt(this, "Tokenizer", _Tokenizer); - kt(this, "Hooks", _Hooks); + Mi(this, Mr); + Ft(this, "defaults", _getDefaults()); + Ft(this, "options", this.setOptions); + Ft(this, "parse", ui(this, Mr, Di).call(this, _Lexer.lex, _Parser.parse)); + Ft(this, "parseInline", ui(this, Mr, Di).call(this, _Lexer.lexInline, _Parser.parseInline)); + Ft(this, "Parser", _Parser); + Ft(this, "Renderer", _Renderer); + Ft(this, "TextRenderer", _TextRenderer); + Ft(this, "Lexer", _Lexer); + Ft(this, "Tokenizer", _Tokenizer); + Ft(this, "Hooks", _Hooks); this.use(...e); } /** @@ -11807,28 +11807,28 @@ class Marked { walkTokens(e, t) { var a, l; let r = []; - for (const d of e) - switch (r = r.concat(t.call(this, d)), d.type) { + for (const h of e) + switch (r = r.concat(t.call(this, h)), h.type) { case "table": { - const o = d; - for (const u of o.header) - r = r.concat(this.walkTokens(u.tokens, t)); - for (const u of o.rows) - for (const p of u) - r = r.concat(this.walkTokens(p.tokens, t)); + const c = h; + for (const d of c.header) + r = r.concat(this.walkTokens(d.tokens, t)); + for (const d of c.rows) + for (const _ of d) + r = r.concat(this.walkTokens(_.tokens, t)); break; } case "list": { - const o = d; - r = r.concat(this.walkTokens(o.items, t)); + const c = h; + r = r.concat(this.walkTokens(c.items, t)); break; } default: { - const o = d; - (l = (a = this.defaults.extensions) == null ? void 0 : a.childTokens) != null && l[o.type] ? this.defaults.extensions.childTokens[o.type].forEach((u) => { - const p = o[u].flat(1 / 0); - r = r.concat(this.walkTokens(p, t)); - }) : o.tokens && (r = r.concat(this.walkTokens(o.tokens, t))); + const c = h; + (l = (a = this.defaults.extensions) == null ? void 0 : a.childTokens) != null && l[c.type] ? this.defaults.extensions.childTokens[c.type].forEach((d) => { + const _ = c[d].flat(1 / 0); + r = r.concat(this.walkTokens(_, t)); + }) : c.tokens && (r = r.concat(this.walkTokens(c.tokens, t))); } } return r; @@ -11841,74 +11841,74 @@ class Marked { if (!l.name) throw new Error("extension name required"); if ("renderer" in l) { - const d = t.renderers[l.name]; - d ? t.renderers[l.name] = function(...o) { - let u = l.renderer.apply(this, o); - return u === !1 && (u = d.apply(this, o)), u; + const h = t.renderers[l.name]; + h ? t.renderers[l.name] = function(...c) { + let d = l.renderer.apply(this, c); + return d === !1 && (d = h.apply(this, c)), d; } : t.renderers[l.name] = l.renderer; } if ("tokenizer" in l) { if (!l.level || l.level !== "block" && l.level !== "inline") throw new Error("extension level must be 'block' or 'inline'"); - const d = t[l.level]; - d ? d.unshift(l.tokenizer) : t[l.level] = [l.tokenizer], l.start && (l.level === "block" ? t.startBlock ? t.startBlock.push(l.start) : t.startBlock = [l.start] : l.level === "inline" && (t.startInline ? t.startInline.push(l.start) : t.startInline = [l.start])); + const h = t[l.level]; + h ? h.unshift(l.tokenizer) : t[l.level] = [l.tokenizer], l.start && (l.level === "block" ? t.startBlock ? t.startBlock.push(l.start) : t.startBlock = [l.start] : l.level === "inline" && (t.startInline ? t.startInline.push(l.start) : t.startInline = [l.start])); } "childTokens" in l && l.childTokens && (t.childTokens[l.name] = l.childTokens); }), a.extensions = t), r.renderer) { const l = this.defaults.renderer || new _Renderer(this.defaults); - for (const d in r.renderer) { - if (!(d in l)) - throw new Error(`renderer '${d}' does not exist`); - if (d === "options") + for (const h in r.renderer) { + if (!(h in l)) + throw new Error(`renderer '${h}' does not exist`); + if (h === "options") continue; - const o = d, u = r.renderer[o], p = l[o]; - l[o] = (...m) => { - let y = u.apply(l, m); - return y === !1 && (y = p.apply(l, m)), y || ""; + const c = h, d = r.renderer[c], _ = l[c]; + l[c] = (...m) => { + let y = d.apply(l, m); + return y === !1 && (y = _.apply(l, m)), y || ""; }; } a.renderer = l; } if (r.tokenizer) { const l = this.defaults.tokenizer || new _Tokenizer(this.defaults); - for (const d in r.tokenizer) { - if (!(d in l)) - throw new Error(`tokenizer '${d}' does not exist`); - if (["options", "rules", "lexer"].includes(d)) + for (const h in r.tokenizer) { + if (!(h in l)) + throw new Error(`tokenizer '${h}' does not exist`); + if (["options", "rules", "lexer"].includes(h)) continue; - const o = d, u = r.tokenizer[o], p = l[o]; - l[o] = (...m) => { - let y = u.apply(l, m); - return y === !1 && (y = p.apply(l, m)), y; + const c = h, d = r.tokenizer[c], _ = l[c]; + l[c] = (...m) => { + let y = d.apply(l, m); + return y === !1 && (y = _.apply(l, m)), y; }; } a.tokenizer = l; } if (r.hooks) { const l = this.defaults.hooks || new _Hooks(); - for (const d in r.hooks) { - if (!(d in l)) - throw new Error(`hook '${d}' does not exist`); - if (d === "options") + for (const h in r.hooks) { + if (!(h in l)) + throw new Error(`hook '${h}' does not exist`); + if (h === "options") continue; - const o = d, u = r.hooks[o], p = l[o]; - _Hooks.passThroughHooks.has(d) ? l[o] = (m) => { + const c = h, d = r.hooks[c], _ = l[c]; + _Hooks.passThroughHooks.has(h) ? l[c] = (m) => { if (this.defaults.async) - return Promise.resolve(u.call(l, m)).then((w) => p.call(l, w)); - const y = u.call(l, m); - return p.call(l, y); - } : l[o] = (...m) => { - let y = u.apply(l, m); - return y === !1 && (y = p.apply(l, m)), y; + return Promise.resolve(d.call(l, m)).then((x) => _.call(l, x)); + const y = d.call(l, m); + return _.call(l, y); + } : l[c] = (...m) => { + let y = d.apply(l, m); + return y === !1 && (y = _.apply(l, m)), y; }; } a.hooks = l; } if (r.walkTokens) { - const l = this.defaults.walkTokens, d = r.walkTokens; - a.walkTokens = function(o) { - let u = []; - return u.push(d.call(this, o)), l && (u = u.concat(l.call(this, o))), u; + const l = this.defaults.walkTokens, h = r.walkTokens; + a.walkTokens = function(c) { + let d = []; + return d.push(h.call(this, c)), l && (d = d.concat(l.call(this, c))), d; }; } this.defaults = { ...this.defaults, ...a }; @@ -11924,28 +11924,28 @@ class Marked { return _Parser.parse(e, t ?? this.defaults); } } -fr = new WeakSet(), hi = function(e, t) { +Mr = new WeakSet(), Di = function(e, t) { return (r, a) => { - const l = { ...a }, d = { ...this.defaults, ...l }; - this.defaults.async === !0 && l.async === !1 && (d.silent || console.warn("marked(): The async option was set to true by an extension. The async: false option sent to parse will be ignored."), d.async = !0); - const o = Zr(this, fr, yn).call(this, !!d.silent, !!d.async); + const l = { ...a }, h = { ...this.defaults, ...l }; + this.defaults.async === !0 && l.async === !1 && (h.silent || console.warn("marked(): The async option was set to true by an extension. The async: false option sent to parse will be ignored."), h.async = !0); + const c = ui(this, Mr, Fn).call(this, !!h.silent, !!h.async); if (typeof r > "u" || r === null) - return o(new Error("marked(): input parameter is undefined or null")); + return c(new Error("marked(): input parameter is undefined or null")); if (typeof r != "string") - return o(new Error("marked(): input parameter is of type " + Object.prototype.toString.call(r) + ", string expected")); - if (d.hooks && (d.hooks.options = d), d.async) - return Promise.resolve(d.hooks ? d.hooks.preprocess(r) : r).then((u) => e(u, d)).then((u) => d.hooks ? d.hooks.processAllTokens(u) : u).then((u) => d.walkTokens ? Promise.all(this.walkTokens(u, d.walkTokens)).then(() => u) : u).then((u) => t(u, d)).then((u) => d.hooks ? d.hooks.postprocess(u) : u).catch(o); + return c(new Error("marked(): input parameter is of type " + Object.prototype.toString.call(r) + ", string expected")); + if (h.hooks && (h.hooks.options = h), h.async) + return Promise.resolve(h.hooks ? h.hooks.preprocess(r) : r).then((d) => e(d, h)).then((d) => h.hooks ? h.hooks.processAllTokens(d) : d).then((d) => h.walkTokens ? Promise.all(this.walkTokens(d, h.walkTokens)).then(() => d) : d).then((d) => t(d, h)).then((d) => h.hooks ? h.hooks.postprocess(d) : d).catch(c); try { - d.hooks && (r = d.hooks.preprocess(r)); - let u = e(r, d); - d.hooks && (u = d.hooks.processAllTokens(u)), d.walkTokens && this.walkTokens(u, d.walkTokens); - let p = t(u, d); - return d.hooks && (p = d.hooks.postprocess(p)), p; - } catch (u) { - return o(u); + h.hooks && (r = h.hooks.preprocess(r)); + let d = e(r, h); + h.hooks && (d = h.hooks.processAllTokens(d)), h.walkTokens && this.walkTokens(d, h.walkTokens); + let _ = t(d, h); + return h.hooks && (_ = h.hooks.postprocess(_)), _; + } catch (d) { + return c(d); } }; -}, yn = function(e, t) { +}, Fn = function(e, t) { return (r) => { if (r.message += ` Please report this to https://github.com/markedjs/marked.`, e) { @@ -12048,7 +12048,7 @@ var prism = { exports: {} }; * @public */ var t = function(r) { - var a = /(?:^|\s)lang(?:uage)?-([\w-]+)(?=\s|$)/i, l = 0, d = {}, o = { + var a = /(?:^|\s)lang(?:uage)?-([\w-]+)(?=\s|$)/i, l = 0, h = {}, c = { /** * By default, Prism will attempt to highlight all code elements (by calling {@link Prism.highlightAll}) on the * current page after the page finished loading. This might be a problem if e.g. you wanted to asynchronously load @@ -12103,8 +12103,8 @@ var prism = { exports: {} }; * @memberof Prism */ util: { - encode: function _(g) { - return g instanceof u ? new u(g.type, _(g.content), g.alias) : Array.isArray(g) ? g.map(_) : g.replace(/&/g, "&").replace(/} */ - {}, x[v] = c; + if (v = c.util.objId(g), w[v]) + return w[v]; + o = /** @type {Record} */ + {}, w[v] = o; for (var M in g) - g.hasOwnProperty(M) && (c[M] = _(g[M], x)); + g.hasOwnProperty(M) && (o[M] = p(g[M], w)); return ( /** @type {any} */ - c + o ); case "Array": - return v = o.util.objId(g), x[v] ? x[v] : (c = [], x[v] = c, /** @type {Array} */ + return v = c.util.objId(g), w[v] ? w[v] : (o = [], w[v] = o, /** @type {Array} */ /** @type {any} */ g.forEach(function(E, $) { - c[$] = _(E, x); + o[$] = p(E, w); }), /** @type {any} */ - c); + o); default: return g; } @@ -12178,12 +12178,12 @@ var prism = { exports: {} }; * @param {Element} element * @returns {string} */ - getLanguage: function(_) { - for (; _; ) { - var g = a.exec(_.className); + getLanguage: function(p) { + for (; p; ) { + var g = a.exec(p.className); if (g) return g[1].toLowerCase(); - _ = _.parentElement; + p = p.parentElement; } return "none"; }, @@ -12194,8 +12194,8 @@ var prism = { exports: {} }; * @param {string} language * @returns {void} */ - setLanguage: function(_, g) { - _.className = _.className.replace(RegExp(a, "gi"), ""), _.classList.add("language-" + g); + setLanguage: function(p, g) { + p.className = p.className.replace(RegExp(a, "gi"), ""), p.classList.add("language-" + g); }, /** * Returns the script element that is currently executing. @@ -12214,13 +12214,13 @@ var prism = { exports: {} }; ); try { throw new Error(); - } catch (c) { - var _ = (/at [^(\r\n]*\((.*):[^:]+:[^:]+\)$/i.exec(c.stack) || [])[1]; - if (_) { + } catch (o) { + var p = (/at [^(\r\n]*\((.*):[^:]+:[^:]+\)$/i.exec(o.stack) || [])[1]; + if (p) { var g = document.getElementsByTagName("script"); - for (var x in g) - if (g[x].src == _) - return g[x]; + for (var w in g) + if (g[w].src == p) + return g[w]; } return null; } @@ -12244,16 +12244,16 @@ var prism = { exports: {} }; * @param {boolean} [defaultActivation=false] * @returns {boolean} */ - isActive: function(_, g, x) { - for (var c = "no-" + g; _; ) { - var v = _.classList; + isActive: function(p, g, w) { + for (var o = "no-" + g; p; ) { + var v = p.classList; if (v.contains(g)) return !0; - if (v.contains(c)) + if (v.contains(o)) return !1; - _ = _.parentElement; + p = p.parentElement; } - return !!x; + return !!w; } }, /** @@ -12267,10 +12267,10 @@ var prism = { exports: {} }; /** * The grammar for plain, unformatted text. */ - plain: d, - plaintext: d, - text: d, - txt: d, + plain: h, + plaintext: h, + text: h, + txt: h, /** * Creates a deep copy of the language with the given id and appends the given tokens. * @@ -12299,11 +12299,11 @@ var prism = { exports: {} }; * 'color': /\b(?:red|green|blue)\b/ * }); */ - extend: function(_, g) { - var x = o.util.clone(o.languages[_]); - for (var c in g) - x[c] = g[c]; - return x; + extend: function(p, g) { + var w = c.util.clone(c.languages[p]); + for (var o in g) + w[o] = g[o]; + return w; }, /** * Inserts tokens _before_ another token in a language definition or any other grammar. @@ -12380,31 +12380,31 @@ var prism = { exports: {} }; * @returns {Grammar} The new grammar object. * @public */ - insertBefore: function(_, g, x, c) { - c = c || /** @type {any} */ - o.languages; - var v = c[_], M = {}; + insertBefore: function(p, g, w, o) { + o = o || /** @type {any} */ + c.languages; + var v = o[p], M = {}; for (var E in v) if (v.hasOwnProperty(E)) { if (E == g) - for (var $ in x) - x.hasOwnProperty($) && (M[$] = x[$]); - x.hasOwnProperty(E) || (M[E] = v[E]); + for (var $ in w) + w.hasOwnProperty($) && (M[$] = w[$]); + w.hasOwnProperty(E) || (M[E] = v[E]); } - var k = c[_]; - return c[_] = M, o.languages.DFS(o.languages, function(L, z) { - z === k && L != _ && (this[L] = M); + var k = o[p]; + return o[p] = M, c.languages.DFS(c.languages, function(L, z) { + z === k && L != p && (this[L] = M); }), M; }, // Traverse a language definition with Depth First Search - DFS: function _(g, x, c, v) { + DFS: function p(g, w, o, v) { v = v || {}; - var M = o.util.objId; + var M = c.util.objId; for (var E in g) if (g.hasOwnProperty(E)) { - x.call(g, E, g[E], c || E); - var $ = g[E], k = o.util.type($); - k === "Object" && !v[M($)] ? (v[M($)] = !0, _($, x, null, v)) : k === "Array" && !v[M($)] && (v[M($)] = !0, _($, x, E, v)); + w.call(g, E, g[E], o || E); + var $ = g[E], k = c.util.type($); + k === "Object" && !v[M($)] ? (v[M($)] = !0, p($, w, null, v)) : k === "Array" && !v[M($)] && (v[M($)] = !0, p($, w, E, v)); } } }, @@ -12421,8 +12421,8 @@ var prism = { exports: {} }; * @memberof Prism * @public */ - highlightAll: function(_, g) { - o.highlightAllUnder(document, _, g); + highlightAll: function(p, g) { + c.highlightAllUnder(document, p, g); }, /** * Fetches all the descendants of `container` that have a `.language-xxxx` class and then calls @@ -12439,15 +12439,15 @@ var prism = { exports: {} }; * @memberof Prism * @public */ - highlightAllUnder: function(_, g, x) { - var c = { - callback: x, - container: _, + highlightAllUnder: function(p, g, w) { + var o = { + callback: w, + container: p, selector: 'code[class*="language-"], [class*="language-"] code, code[class*="lang-"], [class*="lang-"] code' }; - o.hooks.run("before-highlightall", c), c.elements = Array.prototype.slice.apply(c.container.querySelectorAll(c.selector)), o.hooks.run("before-all-elements-highlight", c); - for (var v = 0, M; M = c.elements[v++]; ) - o.highlightElement(M, g === !0, c.callback); + c.hooks.run("before-highlightall", o), o.elements = Array.prototype.slice.apply(o.container.querySelectorAll(o.selector)), c.hooks.run("before-all-elements-highlight", o); + for (var v = 0, M; M = o.elements[v++]; ) + c.highlightElement(M, g === !0, o.callback); }, /** * Highlights the code inside a single element. @@ -12477,30 +12477,30 @@ var prism = { exports: {} }; * @memberof Prism * @public */ - highlightElement: function(_, g, x) { - var c = o.util.getLanguage(_), v = o.languages[c]; - o.util.setLanguage(_, c); - var M = _.parentElement; - M && M.nodeName.toLowerCase() === "pre" && o.util.setLanguage(M, c); - var E = _.textContent, $ = { - element: _, - language: c, + highlightElement: function(p, g, w) { + var o = c.util.getLanguage(p), v = c.languages[o]; + c.util.setLanguage(p, o); + var M = p.parentElement; + M && M.nodeName.toLowerCase() === "pre" && c.util.setLanguage(M, o); + var E = p.textContent, $ = { + element: p, + language: o, grammar: v, code: E }; function k(z) { - $.highlightedCode = z, o.hooks.run("before-insert", $), $.element.innerHTML = $.highlightedCode, o.hooks.run("after-highlight", $), o.hooks.run("complete", $), x && x.call($.element); + $.highlightedCode = z, c.hooks.run("before-insert", $), $.element.innerHTML = $.highlightedCode, c.hooks.run("after-highlight", $), c.hooks.run("complete", $), w && w.call($.element); } - if (o.hooks.run("before-sanity-check", $), M = $.element.parentElement, M && M.nodeName.toLowerCase() === "pre" && !M.hasAttribute("tabindex") && M.setAttribute("tabindex", "0"), !$.code) { - o.hooks.run("complete", $), x && x.call($.element); + if (c.hooks.run("before-sanity-check", $), M = $.element.parentElement, M && M.nodeName.toLowerCase() === "pre" && !M.hasAttribute("tabindex") && M.setAttribute("tabindex", "0"), !$.code) { + c.hooks.run("complete", $), w && w.call($.element); return; } - if (o.hooks.run("before-highlight", $), !$.grammar) { - k(o.util.encode($.code)); + if (c.hooks.run("before-highlight", $), !$.grammar) { + k(c.util.encode($.code)); return; } if (g && r.Worker) { - var L = new Worker(o.filename); + var L = new Worker(c.filename); L.onmessage = function(z) { k(z.data); }, L.postMessage(JSON.stringify({ @@ -12509,7 +12509,7 @@ var prism = { exports: {} }; immediateClose: !0 })); } else - k(o.highlight($.code, $.grammar, $.language)); + k(c.highlight($.code, $.grammar, $.language)); }, /** * Low-level function, only use if you know what you’re doing. It accepts a string of text as input @@ -12531,15 +12531,15 @@ var prism = { exports: {} }; * @example * Prism.highlight('var foo = true;', Prism.languages.javascript, 'javascript'); */ - highlight: function(_, g, x) { - var c = { - code: _, + highlight: function(p, g, w) { + var o = { + code: p, grammar: g, - language: x + language: w }; - if (o.hooks.run("before-tokenize", c), !c.grammar) - throw new Error('The language "' + c.language + '" has no grammar.'); - return c.tokens = o.tokenize(c.code, c.grammar), o.hooks.run("after-tokenize", c), u.stringify(o.util.encode(c.tokens), c.language); + if (c.hooks.run("before-tokenize", o), !o.grammar) + throw new Error('The language "' + o.language + '" has no grammar.'); + return o.tokens = c.tokenize(o.code, o.grammar), c.hooks.run("after-tokenize", o), d.stringify(c.util.encode(o.tokens), o.language); }, /** * This is the heart of Prism, and the most low-level function you can use. It accepts a string of text as input @@ -12565,15 +12565,15 @@ var prism = { exports: {} }; * } * }); */ - tokenize: function(_, g) { - var x = g.rest; - if (x) { - for (var c in x) - g[c] = x[c]; + tokenize: function(p, g) { + var w = g.rest; + if (w) { + for (var o in w) + g[o] = w[o]; delete g.rest; } var v = new y(); - return w(v, v.head, _), m(_, v, g, v.head, 0), A(v); + return x(v, v.head, p), m(p, v, g, v.head, 0), A(v); }, /** * @namespace @@ -12594,9 +12594,9 @@ var prism = { exports: {} }; * @param {HookCallback} callback The callback function which is given environment variables. * @public */ - add: function(_, g) { - var x = o.hooks.all; - x[_] = x[_] || [], x[_].push(g); + add: function(p, g) { + var w = c.hooks.all; + w[p] = w[p] || [], w[p].push(g); }, /** * Runs a hook invoking all registered callbacks with the given environment variables. @@ -12607,94 +12607,94 @@ var prism = { exports: {} }; * @param {Object} env The environment variables of the hook passed to all callbacks registered. * @public */ - run: function(_, g) { - var x = o.hooks.all[_]; - if (!(!x || !x.length)) - for (var c = 0, v; v = x[c++]; ) + run: function(p, g) { + var w = c.hooks.all[p]; + if (!(!w || !w.length)) + for (var o = 0, v; v = w[o++]; ) v(g); } }, - Token: u + Token: d }; - r.Prism = o; - function u(_, g, x, c) { - this.type = _, this.content = g, this.alias = x, this.length = (c || "").length | 0; + r.Prism = c; + function d(p, g, w, o) { + this.type = p, this.content = g, this.alias = w, this.length = (o || "").length | 0; } - u.stringify = function _(g, x) { + d.stringify = function p(g, w) { if (typeof g == "string") return g; if (Array.isArray(g)) { - var c = ""; + var o = ""; return g.forEach(function(k) { - c += _(k, x); - }), c; + o += p(k, w); + }), o; } var v = { type: g.type, - content: _(g.content, x), + content: p(g.content, w), tag: "span", classes: ["token", g.type], attributes: {}, - language: x + language: w }, M = g.alias; - M && (Array.isArray(M) ? Array.prototype.push.apply(v.classes, M) : v.classes.push(M)), o.hooks.run("wrap", v); + M && (Array.isArray(M) ? Array.prototype.push.apply(v.classes, M) : v.classes.push(M)), c.hooks.run("wrap", v); var E = ""; for (var $ in v.attributes) E += " " + $ + '="' + (v.attributes[$] || "").replace(/"/g, """) + '"'; return "<" + v.tag + ' class="' + v.classes.join(" ") + '"' + E + ">" + v.content + ""; }; - function p(_, g, x, c) { - _.lastIndex = g; - var v = _.exec(x); - if (v && c && v[1]) { + function _(p, g, w, o) { + p.lastIndex = g; + var v = p.exec(w); + if (v && o && v[1]) { var M = v[1].length; v.index += M, v[0] = v[0].slice(M); } return v; } - function m(_, g, x, c, v, M) { - for (var E in x) - if (!(!x.hasOwnProperty(E) || !x[E])) { - var $ = x[E]; + function m(p, g, w, o, v, M) { + for (var E in w) + if (!(!w.hasOwnProperty(E) || !w[E])) { + var $ = w[E]; $ = Array.isArray($) ? $ : [$]; for (var k = 0; k < $.length; ++k) { if (M && M.cause == E + "," + k) return; - var L = $[k], z = L.inside, O = !!L.lookbehind, R = !!L.greedy, P = L.alias; + var L = $[k], z = L.inside, O = !!L.lookbehind, R = !!L.greedy, N = L.alias; if (R && !L.pattern.global) { - var U = L.pattern.toString().match(/[imsuy]*$/)[0]; - L.pattern = RegExp(L.pattern.source, U + "g"); + var W = L.pattern.toString().match(/[imsuy]*$/)[0]; + L.pattern = RegExp(L.pattern.source, W + "g"); } - for (var B = L.pattern || L, N = c.next, G = v; N !== g.tail && !(M && G >= M.reach); G += N.value.length, N = N.next) { - var H = N.value; - if (g.length > _.length) + for (var B = L.pattern || L, P = o.next, G = v; P !== g.tail && !(M && G >= M.reach); G += P.value.length, P = P.next) { + var H = P.value; + if (g.length > p.length) return; - if (!(H instanceof u)) { - var W = 1, V; + if (!(H instanceof d)) { + var U = 1, j; if (R) { - if (V = p(B, G, _, O), !V || V.index >= _.length) + if (j = _(B, G, p, O), !j || j.index >= p.length) break; - var ce = V.index, re = V.index + V[0].length, ie = G; - for (ie += N.value.length; ce >= ie; ) - N = N.next, ie += N.value.length; - if (ie -= N.value.length, G = ie, N.value instanceof u) + var ue = j.index, re = j.index + j[0].length, ie = G; + for (ie += P.value.length; ue >= ie; ) + P = P.next, ie += P.value.length; + if (ie -= P.value.length, G = ie, P.value instanceof d) continue; - for (var ee = N; ee !== g.tail && (ie < re || typeof ee.value == "string"); ee = ee.next) - W++, ie += ee.value.length; - W--, H = _.slice(G, ie), V.index -= G; - } else if (V = p(B, 0, H, O), !V) + for (var te = P; te !== g.tail && (ie < re || typeof te.value == "string"); te = te.next) + U++, ie += te.value.length; + U--, H = p.slice(G, ie), j.index -= G; + } else if (j = _(B, 0, H, O), !j) continue; - var ce = V.index, he = V[0], le = H.slice(0, ce), J = H.slice(ce + he.length), Me = G + H.length; - M && Me > M.reach && (M.reach = Me); - var se = N.prev; - le && (se = w(g, se, le), G += le.length), b(g, se, W); - var Ce = new u(E, z ? o.tokenize(he, z) : he, P, he); - if (N = w(g, se, Ce), J && w(g, N, J), W > 1) { - var ue = { + var ue = j.index, de = j[0], oe = H.slice(0, ue), J = H.slice(ue + de.length), Ee = G + H.length; + M && Ee > M.reach && (M.reach = Ee); + var se = P.prev; + oe && (se = x(g, se, oe), G += oe.length), b(g, se, U); + var Ae = new d(E, z ? c.tokenize(de, z) : de, N, de); + if (P = x(g, se, Ae), J && x(g, P, J), U > 1) { + var he = { cause: E + "," + k, - reach: Me + reach: Ee }; - m(_, g, x, N.prev, G, ue), M && ue.reach > M.reach && (M.reach = ue.reach); + m(p, g, w, P.prev, G, he), M && he.reach > M.reach && (M.reach = he.reach); } } } @@ -12702,38 +12702,38 @@ var prism = { exports: {} }; } } function y() { - var _ = { value: null, prev: null, next: null }, g = { value: null, prev: _, next: null }; - _.next = g, this.head = _, this.tail = g, this.length = 0; + var p = { value: null, prev: null, next: null }, g = { value: null, prev: p, next: null }; + p.next = g, this.head = p, this.tail = g, this.length = 0; } - function w(_, g, x) { - var c = g.next, v = { value: x, prev: g, next: c }; - return g.next = v, c.prev = v, _.length++, v; + function x(p, g, w) { + var o = g.next, v = { value: w, prev: g, next: o }; + return g.next = v, o.prev = v, p.length++, v; } - function b(_, g, x) { - for (var c = g.next, v = 0; v < x && c !== _.tail; v++) - c = c.next; - g.next = c, c.prev = g, _.length -= v; + function b(p, g, w) { + for (var o = g.next, v = 0; v < w && o !== p.tail; v++) + o = o.next; + g.next = o, o.prev = g, p.length -= v; } - function A(_) { - for (var g = [], x = _.head.next; x !== _.tail; ) - g.push(x.value), x = x.next; + function A(p) { + for (var g = [], w = p.head.next; w !== p.tail; ) + g.push(w.value), w = w.next; return g; } if (!r.document) - return r.addEventListener && (o.disableWorkerMessageHandler || r.addEventListener("message", function(_) { - var g = JSON.parse(_.data), x = g.language, c = g.code, v = g.immediateClose; - r.postMessage(o.highlight(c, o.languages[x], x)), v && r.close(); - }, !1)), o; - var f = o.util.currentScript(); - f && (o.filename = f.src, f.hasAttribute("data-manual") && (o.manual = !0)); + return r.addEventListener && (c.disableWorkerMessageHandler || r.addEventListener("message", function(p) { + var g = JSON.parse(p.data), w = g.language, o = g.code, v = g.immediateClose; + r.postMessage(c.highlight(o, c.languages[w], w)), v && r.close(); + }, !1)), c; + var f = c.util.currentScript(); + f && (c.filename = f.src, f.hasAttribute("data-manual") && (c.manual = !0)); function s() { - o.manual || o.highlightAll(); + c.manual || c.highlightAll(); } - if (!o.manual) { - var h = document.readyState; - h === "loading" || h === "interactive" && f && f.defer ? document.addEventListener("DOMContentLoaded", s) : window.requestAnimationFrame ? window.requestAnimationFrame(s) : window.setTimeout(s, 16); + if (!c.manual) { + var u = document.readyState; + u === "loading" || u === "interactive" && f && f.defer ? document.addEventListener("DOMContentLoaded", s) : window.requestAnimationFrame ? window.requestAnimationFrame(s) : window.setTimeout(s, 16); } - return o; + return c; }(e); n.exports && (n.exports = t), typeof commonjsGlobal < "u" && (commonjsGlobal.Prism = t), t.languages.markup = { comment: { @@ -12827,31 +12827,31 @@ var prism = { exports: {} }; * addInlined('style', 'css'); */ value: function(a, l) { - var d = {}; - d["language-" + l] = { + var h = {}; + h["language-" + l] = { pattern: /(^$)/i, lookbehind: !0, inside: t.languages[l] - }, d.cdata = /^$/i; - var o = { + }, h.cdata = /^$/i; + var c = { "included-cdata": { pattern: //i, - inside: d + inside: h } }; - o["language-" + l] = { + c["language-" + l] = { pattern: /[\s\S]+/, inside: t.languages[l] }; - var u = {}; - u[a] = { + var d = {}; + d[a] = { pattern: RegExp(/(<__[^>]*>)(?:))*\]\]>|(?!)/.source.replace(/__/g, function() { return a; }), "i"), lookbehind: !0, greedy: !0, - inside: o - }, t.languages.insertBefore("markup", "cdata", u); + inside: c + }, t.languages.insertBefore("markup", "cdata", d); } }), Object.defineProperty(t.languages.markup.tag, "addAttribute", { /** @@ -13115,7 +13115,7 @@ var prism = { exports: {} }; Element.prototype.matches || (Element.prototype.matches = Element.prototype.msMatchesSelector || Element.prototype.webkitMatchesSelector); var r = "Loading…", a = function(f, s) { return "✖ Error " + f + " while fetching file: " + s; - }, l = "✖ Error: File does not exist or is empty", d = { + }, l = "✖ Error: File does not exist or is empty", h = { js: "javascript", py: "python", rb: "ruby", @@ -13125,18 +13125,18 @@ var prism = { exports: {} }; bat: "batch", h: "c", tex: "latex" - }, o = "data-src-status", u = "loading", p = "loaded", m = "failed", y = "pre[data-src]:not([" + o + '="' + p + '"]):not([' + o + '="' + u + '"])'; - function w(f, s, h) { - var _ = new XMLHttpRequest(); - _.open("GET", f, !0), _.onreadystatechange = function() { - _.readyState == 4 && (_.status < 400 && _.responseText ? s(_.responseText) : _.status >= 400 ? h(a(_.status, _.statusText)) : h(l)); - }, _.send(null); + }, c = "data-src-status", d = "loading", _ = "loaded", m = "failed", y = "pre[data-src]:not([" + c + '="' + _ + '"]):not([' + c + '="' + d + '"])'; + function x(f, s, u) { + var p = new XMLHttpRequest(); + p.open("GET", f, !0), p.onreadystatechange = function() { + p.readyState == 4 && (p.status < 400 && p.responseText ? s(p.responseText) : p.status >= 400 ? u(a(p.status, p.statusText)) : u(l)); + }, p.send(null); } function b(f) { var s = /^\s*(\d+)\s*(?:(,)\s*(?:(\d+)\s*)?)?$/.exec(f || ""); if (s) { - var h = Number(s[1]), _ = s[2], g = s[3]; - return _ ? g ? [h, Number(g)] : [h, void 0] : [h, h]; + var u = Number(s[1]), p = s[2], g = s[3]; + return p ? g ? [u, Number(g)] : [u, void 0] : [u, u]; } } t.hooks.add("before-highlightall", function(f) { @@ -13147,30 +13147,30 @@ var prism = { exports: {} }; f.element ); if (s.matches(y)) { - f.code = "", s.setAttribute(o, u); - var h = s.appendChild(document.createElement("CODE")); - h.textContent = r; - var _ = s.getAttribute("data-src"), g = f.language; + f.code = "", s.setAttribute(c, d); + var u = s.appendChild(document.createElement("CODE")); + u.textContent = r; + var p = s.getAttribute("data-src"), g = f.language; if (g === "none") { - var x = (/\.(\w+)$/.exec(_) || [, "none"])[1]; - g = d[x] || x; + var w = (/\.(\w+)$/.exec(p) || [, "none"])[1]; + g = h[w] || w; } - t.util.setLanguage(h, g), t.util.setLanguage(s, g); - var c = t.plugins.autoloader; - c && c.loadLanguages(g), w( - _, + t.util.setLanguage(u, g), t.util.setLanguage(s, g); + var o = t.plugins.autoloader; + o && o.loadLanguages(g), x( + p, function(v) { - s.setAttribute(o, p); + s.setAttribute(c, _); var M = b(s.getAttribute("data-range")); if (M) { var E = v.split(/\r\n?|\n/g), $ = M[0], k = M[1] == null ? E.length : M[1]; $ < 0 && ($ += E.length), $ = Math.max(0, Math.min($ - 1, E.length)), k < 0 && (k += E.length), k = Math.max(0, Math.min(k, E.length)), v = E.slice($, k).join(` `), s.hasAttribute("data-start") || s.setAttribute("data-start", String($ + 1)); } - h.textContent = v, t.highlightElement(h); + u.textContent = v, t.highlightElement(u); }, function(v) { - s.setAttribute(o, m), h.textContent = v; + s.setAttribute(c, m), u.textContent = v; } ); } @@ -13183,7 +13183,7 @@ var prism = { exports: {} }; * @param {ParentNode} [container=document] */ highlight: function(s) { - for (var h = (s || document).querySelectorAll(y), _ = 0, g; g = h[_++]; ) + for (var u = (s || document).querySelectorAll(y), p = 0, g; g = u[p++]; ) t.highlightElement(g); } }; @@ -13530,8 +13530,8 @@ Prism.languages.py = Prism.languages.python; "operator", "punctuation", "number" - ], l = r.variable[1].inside, d = 0; d < a.length; d++) - l[a[d]] = n.languages.bash[a[d]]; + ], l = r.variable[1].inside, h = 0; h < a.length; h++) + l[a[h]] = n.languages.bash[a[h]]; n.languages.sh = n.languages.bash, n.languages.shell = n.languages.bash; })(Prism); new BananaSlug(); @@ -14245,36 +14245,36 @@ const subscriber_queue = []; function writable(n, e = noop$9) { let t; const r = /* @__PURE__ */ new Set(); - function a(o) { - if (safe_not_equal$j(n, o) && (n = o, t)) { - const u = !subscriber_queue.length; - for (const p of r) - p[1](), subscriber_queue.push(p, n); - if (u) { - for (let p = 0; p < subscriber_queue.length; p += 2) - subscriber_queue[p][0](subscriber_queue[p + 1]); + function a(c) { + if (safe_not_equal$j(n, c) && (n = c, t)) { + const d = !subscriber_queue.length; + for (const _ of r) + _[1](), subscriber_queue.push(_, n); + if (d) { + for (let _ = 0; _ < subscriber_queue.length; _ += 2) + subscriber_queue[_][0](subscriber_queue[_ + 1]); subscriber_queue.length = 0; } } } - function l(o) { - a(o(n)); + function l(c) { + a(c(n)); } - function d(o, u = noop$9) { - const p = [o, u]; - return r.add(p), r.size === 1 && (t = e(a, l) || noop$9), o(n), () => { - r.delete(p), r.size === 0 && t && (t(), t = null); + function h(c, d = noop$9) { + const _ = [c, d]; + return r.add(_), r.size === 1 && (t = e(a, l) || noop$9), c(n), () => { + r.delete(_), r.size === 0 && t && (t(), t = null); }; } - return { set: a, update: l, subscribe: d }; + return { set: a, update: l, subscribe: h }; } function is_date(n) { return Object.prototype.toString.call(n) === "[object Date]"; } function tick_spring(n, e, t, r) { if (typeof t == "number" || is_date(t)) { - const a = r - t, l = (t - e) / (n.dt || 1 / 60), d = n.opts.stiffness * a, o = n.opts.damping * l, u = (d - o) * n.inv_mass, p = (l + u) * n.dt; - return Math.abs(p) < n.opts.precision && Math.abs(a) < n.opts.precision ? r : (n.settled = !1, is_date(t) ? new Date(t.getTime() + p) : t + p); + const a = r - t, l = (t - e) / (n.dt || 1 / 60), h = n.opts.stiffness * a, c = n.opts.damping * l, d = (h - c) * n.inv_mass, _ = (l + d) * n.dt; + return Math.abs(_) < n.opts.precision && Math.abs(a) < n.opts.precision ? r : (n.settled = !1, is_date(t) ? new Date(t.getTime() + _) : t + _); } else { if (Array.isArray(t)) return t.map( @@ -14291,30 +14291,30 @@ function tick_spring(n, e, t, r) { } function spring(n, e = {}) { const t = writable(n), { stiffness: r = 0.15, damping: a = 0.8, precision: l = 0.01 } = e; - let d, o, u, p = n, m = n, y = 1, w = 0, b = !1; - function A(s, h = {}) { + let h, c, d, _ = n, m = n, y = 1, x = 0, b = !1; + function A(s, u = {}) { m = s; - const _ = u = {}; - return n == null || h.hard || f.stiffness >= 1 && f.damping >= 1 ? (b = !0, d = now(), p = s, t.set(n = m), Promise.resolve()) : (h.soft && (w = 1 / ((h.soft === !0 ? 0.5 : +h.soft) * 60), y = 0), o || (d = now(), b = !1, o = loop((g) => { + const p = d = {}; + return n == null || u.hard || f.stiffness >= 1 && f.damping >= 1 ? (b = !0, h = now(), _ = s, t.set(n = m), Promise.resolve()) : (u.soft && (x = 1 / ((u.soft === !0 ? 0.5 : +u.soft) * 60), y = 0), c || (h = now(), b = !1, c = loop((g) => { if (b) - return b = !1, o = null, !1; - y = Math.min(y + w, 1); - const x = { + return b = !1, c = null, !1; + y = Math.min(y + x, 1); + const w = { inv_mass: y, opts: f, settled: !0, - dt: (g - d) * 60 / 1e3 - }, c = tick_spring(x, p, n, m); - return d = g, p = n, t.set(n = c), x.settled && (o = null), !x.settled; + dt: (g - h) * 60 / 1e3 + }, o = tick_spring(w, _, n, m); + return h = g, _ = n, t.set(n = o), w.settled && (c = null), !w.settled; })), new Promise((g) => { - o.promise.then(() => { - _ === u && g(); + c.promise.then(() => { + p === d && g(); }); })); } const f = { set: A, - update: (s, h) => A(s(m, n), h), + update: (s, u) => A(s(m, n), u), subscribe: t.subscribe, stiffness: r, damping: a, @@ -14453,11 +14453,11 @@ const NODE_TYPE = { const l = "dompurify" + (r ? "#" + r : ""); try { return e.createPolicy(l, { - createHTML(d) { - return d; + createHTML(h) { + return h; }, - createScriptURL(d) { - return d; + createScriptURL(h) { + return h; } }); } catch { @@ -14466,7 +14466,7 @@ const NODE_TYPE = { }; function createDOMPurify() { let n = arguments.length > 0 && arguments[0] !== void 0 ? arguments[0] : getGlobal(); - const e = (Qe) => createDOMPurify(Qe); + const e = (qe) => createDOMPurify(qe); if (e.version = "3.1.7", e.removed = [], !n || !n.document || n.document.nodeType !== NODE_TYPE.document) return e.isSupported = !1, e; let { @@ -14474,20 +14474,20 @@ function createDOMPurify() { } = n; const r = t, a = r.currentScript, { DocumentFragment: l, - HTMLTemplateElement: d, - Node: o, - Element: u, - NodeFilter: p, + HTMLTemplateElement: h, + Node: c, + Element: d, + NodeFilter: _, NamedNodeMap: m = n.NamedNodeMap || n.MozNamedAttrMap, HTMLFormElement: y, - DOMParser: w, + DOMParser: x, trustedTypes: b - } = n, A = u.prototype, f = lookupGetter(A, "cloneNode"), s = lookupGetter(A, "remove"), h = lookupGetter(A, "nextSibling"), _ = lookupGetter(A, "childNodes"), g = lookupGetter(A, "parentNode"); - if (typeof d == "function") { - const Qe = t.createElement("template"); - Qe.content && Qe.content.ownerDocument && (t = Qe.content.ownerDocument); + } = n, A = d.prototype, f = lookupGetter(A, "cloneNode"), s = lookupGetter(A, "remove"), u = lookupGetter(A, "nextSibling"), p = lookupGetter(A, "childNodes"), g = lookupGetter(A, "parentNode"); + if (typeof h == "function") { + const qe = t.createElement("template"); + qe.content && qe.content.ownerDocument && (t = qe.content.ownerDocument); } - let x, c = ""; + let w, o = ""; const { implementation: v, createNodeIterator: M, @@ -14502,19 +14502,19 @@ function createDOMPurify() { MUSTACHE_EXPR: z, ERB_EXPR: O, TMPLIT_EXPR: R, - DATA_ATTR: P, - ARIA_ATTR: U, + DATA_ATTR: N, + ARIA_ATTR: W, IS_SCRIPT_OR_DATA: B, - ATTR_WHITESPACE: N, + ATTR_WHITESPACE: P, CUSTOM_ELEMENT: G } = EXPRESSIONS; let { IS_ALLOWED_URI: H - } = EXPRESSIONS, W = null; - const V = addToSet({}, [...html$1, ...svg$1, ...svgFilters, ...mathMl$1, ...text$9]); + } = EXPRESSIONS, U = null; + const j = addToSet({}, [...html$1, ...svg$1, ...svgFilters, ...mathMl$1, ...text$9]); let re = null; const ie = addToSet({}, [...html, ...svg, ...mathMl, ...xml]); - let ee = Object.seal(create(null, { + let te = Object.seal(create(null, { tagNameCheck: { writable: !0, configurable: !1, @@ -14533,178 +14533,178 @@ function createDOMPurify() { enumerable: !0, value: !1 } - })), ce = null, he = null, le = !0, J = !0, Me = !1, se = !0, Ce = !1, ue = !0, ne = !1, _e = !1, Oe = !1, Re = !1, Ue = !1, We = !1, Ee = !0, Ae = !1; - const ge = "user-content-"; - let Le = !0, Te = !1, Ke = {}, je = null; - const Y = addToSet({}, ["annotation-xml", "audio", "colgroup", "desc", "foreignobject", "head", "iframe", "math", "mi", "mn", "mo", "ms", "mtext", "noembed", "noframes", "noscript", "plaintext", "script", "style", "svg", "template", "thead", "title", "video", "xmp"]); - let q = null; - const te = addToSet({}, ["audio", "video", "img", "source", "image", "track"]); - let we = null; - const me = addToSet({}, ["alt", "class", "for", "id", "label", "name", "pattern", "placeholder", "role", "summary", "title", "value", "style", "xmlns"]), Pe = "http://www.w3.org/1998/Math/MathML", Fe = "http://www.w3.org/2000/svg", K = "http://www.w3.org/1999/xhtml"; - let fe = K, Se = !1, Ne = null; - const pe = addToSet({}, [Pe, Fe, K], stringToString); - let ke = null; - const X = ["application/xhtml+xml", "text/html"], Be = "text/html"; - let Ge = null, I = null; - const ye = t.createElement("form"), ve = function(xe) { - return xe instanceof RegExp || xe instanceof Function; - }, Z = function() { - let xe = arguments.length > 0 && arguments[0] !== void 0 ? arguments[0] : {}; - if (!(I && I === xe)) { - if ((!xe || typeof xe != "object") && (xe = {}), xe = clone(xe), ke = // eslint-disable-next-line unicorn/prefer-includes - X.indexOf(xe.PARSER_MEDIA_TYPE) === -1 ? Be : xe.PARSER_MEDIA_TYPE, Ge = ke === "application/xhtml+xml" ? stringToString : stringToLowerCase, W = objectHasOwnProperty(xe, "ALLOWED_TAGS") ? addToSet({}, xe.ALLOWED_TAGS, Ge) : V, re = objectHasOwnProperty(xe, "ALLOWED_ATTR") ? addToSet({}, xe.ALLOWED_ATTR, Ge) : ie, Ne = objectHasOwnProperty(xe, "ALLOWED_NAMESPACES") ? addToSet({}, xe.ALLOWED_NAMESPACES, stringToString) : pe, we = objectHasOwnProperty(xe, "ADD_URI_SAFE_ATTR") ? addToSet( - clone(me), + })), ue = null, de = null, oe = !0, J = !0, Ee = !1, se = !0, Ae = !1, he = !0, ne = !1, _e = !1, Le = !1, Be = !1, Ue = !1, He = !1, We = !0, Ge = !1; + const Ne = "user-content-"; + let Pe = !0, Te = !1, Me = {}, De = null; + const V = addToSet({}, ["annotation-xml", "audio", "colgroup", "desc", "foreignobject", "head", "iframe", "math", "mi", "mn", "mo", "ms", "mtext", "noembed", "noframes", "noscript", "plaintext", "script", "style", "svg", "template", "thead", "title", "video", "xmp"]); + let Z = null; + const ee = addToSet({}, ["audio", "video", "img", "source", "image", "track"]); + let ye = null; + const ce = addToSet({}, ["alt", "class", "for", "id", "label", "name", "pattern", "placeholder", "role", "summary", "title", "value", "style", "xmlns"]), Ie = "http://www.w3.org/1998/Math/MathML", ke = "http://www.w3.org/2000/svg", Y = "http://www.w3.org/1999/xhtml"; + let me = Y, we = !1, Re = null; + const pe = addToSet({}, [Ie, ke, Y], stringToString); + let $e = null; + const X = ["application/xhtml+xml", "text/html"], ze = "text/html"; + let Ve = null, I = null; + const xe = t.createElement("form"), be = function(ge) { + return ge instanceof RegExp || ge instanceof Function; + }, q = function() { + let ge = arguments.length > 0 && arguments[0] !== void 0 ? arguments[0] : {}; + if (!(I && I === ge)) { + if ((!ge || typeof ge != "object") && (ge = {}), ge = clone(ge), $e = // eslint-disable-next-line unicorn/prefer-includes + X.indexOf(ge.PARSER_MEDIA_TYPE) === -1 ? ze : ge.PARSER_MEDIA_TYPE, Ve = $e === "application/xhtml+xml" ? stringToString : stringToLowerCase, U = objectHasOwnProperty(ge, "ALLOWED_TAGS") ? addToSet({}, ge.ALLOWED_TAGS, Ve) : j, re = objectHasOwnProperty(ge, "ALLOWED_ATTR") ? addToSet({}, ge.ALLOWED_ATTR, Ve) : ie, Re = objectHasOwnProperty(ge, "ALLOWED_NAMESPACES") ? addToSet({}, ge.ALLOWED_NAMESPACES, stringToString) : pe, ye = objectHasOwnProperty(ge, "ADD_URI_SAFE_ATTR") ? addToSet( + clone(ce), // eslint-disable-line indent - xe.ADD_URI_SAFE_ATTR, + ge.ADD_URI_SAFE_ATTR, // eslint-disable-line indent - Ge + Ve // eslint-disable-line indent - ) : me, q = objectHasOwnProperty(xe, "ADD_DATA_URI_TAGS") ? addToSet( - clone(te), + ) : ce, Z = objectHasOwnProperty(ge, "ADD_DATA_URI_TAGS") ? addToSet( + clone(ee), // eslint-disable-line indent - xe.ADD_DATA_URI_TAGS, + ge.ADD_DATA_URI_TAGS, // eslint-disable-line indent - Ge + Ve // eslint-disable-line indent - ) : te, je = objectHasOwnProperty(xe, "FORBID_CONTENTS") ? addToSet({}, xe.FORBID_CONTENTS, Ge) : Y, ce = objectHasOwnProperty(xe, "FORBID_TAGS") ? addToSet({}, xe.FORBID_TAGS, Ge) : {}, he = objectHasOwnProperty(xe, "FORBID_ATTR") ? addToSet({}, xe.FORBID_ATTR, Ge) : {}, Ke = objectHasOwnProperty(xe, "USE_PROFILES") ? xe.USE_PROFILES : !1, le = xe.ALLOW_ARIA_ATTR !== !1, J = xe.ALLOW_DATA_ATTR !== !1, Me = xe.ALLOW_UNKNOWN_PROTOCOLS || !1, se = xe.ALLOW_SELF_CLOSE_IN_ATTR !== !1, Ce = xe.SAFE_FOR_TEMPLATES || !1, ue = xe.SAFE_FOR_XML !== !1, ne = xe.WHOLE_DOCUMENT || !1, Re = xe.RETURN_DOM || !1, Ue = xe.RETURN_DOM_FRAGMENT || !1, We = xe.RETURN_TRUSTED_TYPE || !1, Oe = xe.FORCE_BODY || !1, Ee = xe.SANITIZE_DOM !== !1, Ae = xe.SANITIZE_NAMED_PROPS || !1, Le = xe.KEEP_CONTENT !== !1, Te = xe.IN_PLACE || !1, H = xe.ALLOWED_URI_REGEXP || IS_ALLOWED_URI, fe = xe.NAMESPACE || K, ee = xe.CUSTOM_ELEMENT_HANDLING || {}, xe.CUSTOM_ELEMENT_HANDLING && ve(xe.CUSTOM_ELEMENT_HANDLING.tagNameCheck) && (ee.tagNameCheck = xe.CUSTOM_ELEMENT_HANDLING.tagNameCheck), xe.CUSTOM_ELEMENT_HANDLING && ve(xe.CUSTOM_ELEMENT_HANDLING.attributeNameCheck) && (ee.attributeNameCheck = xe.CUSTOM_ELEMENT_HANDLING.attributeNameCheck), xe.CUSTOM_ELEMENT_HANDLING && typeof xe.CUSTOM_ELEMENT_HANDLING.allowCustomizedBuiltInElements == "boolean" && (ee.allowCustomizedBuiltInElements = xe.CUSTOM_ELEMENT_HANDLING.allowCustomizedBuiltInElements), Ce && (J = !1), Ue && (Re = !0), Ke && (W = addToSet({}, text$9), re = [], Ke.html === !0 && (addToSet(W, html$1), addToSet(re, html)), Ke.svg === !0 && (addToSet(W, svg$1), addToSet(re, svg), addToSet(re, xml)), Ke.svgFilters === !0 && (addToSet(W, svgFilters), addToSet(re, svg), addToSet(re, xml)), Ke.mathMl === !0 && (addToSet(W, mathMl$1), addToSet(re, mathMl), addToSet(re, xml))), xe.ADD_TAGS && (W === V && (W = clone(W)), addToSet(W, xe.ADD_TAGS, Ge)), xe.ADD_ATTR && (re === ie && (re = clone(re)), addToSet(re, xe.ADD_ATTR, Ge)), xe.ADD_URI_SAFE_ATTR && addToSet(we, xe.ADD_URI_SAFE_ATTR, Ge), xe.FORBID_CONTENTS && (je === Y && (je = clone(je)), addToSet(je, xe.FORBID_CONTENTS, Ge)), Le && (W["#text"] = !0), ne && addToSet(W, ["html", "head", "body"]), W.table && (addToSet(W, ["tbody"]), delete ce.tbody), xe.TRUSTED_TYPES_POLICY) { - if (typeof xe.TRUSTED_TYPES_POLICY.createHTML != "function") + ) : ee, De = objectHasOwnProperty(ge, "FORBID_CONTENTS") ? addToSet({}, ge.FORBID_CONTENTS, Ve) : V, ue = objectHasOwnProperty(ge, "FORBID_TAGS") ? addToSet({}, ge.FORBID_TAGS, Ve) : {}, de = objectHasOwnProperty(ge, "FORBID_ATTR") ? addToSet({}, ge.FORBID_ATTR, Ve) : {}, Me = objectHasOwnProperty(ge, "USE_PROFILES") ? ge.USE_PROFILES : !1, oe = ge.ALLOW_ARIA_ATTR !== !1, J = ge.ALLOW_DATA_ATTR !== !1, Ee = ge.ALLOW_UNKNOWN_PROTOCOLS || !1, se = ge.ALLOW_SELF_CLOSE_IN_ATTR !== !1, Ae = ge.SAFE_FOR_TEMPLATES || !1, he = ge.SAFE_FOR_XML !== !1, ne = ge.WHOLE_DOCUMENT || !1, Be = ge.RETURN_DOM || !1, Ue = ge.RETURN_DOM_FRAGMENT || !1, He = ge.RETURN_TRUSTED_TYPE || !1, Le = ge.FORCE_BODY || !1, We = ge.SANITIZE_DOM !== !1, Ge = ge.SANITIZE_NAMED_PROPS || !1, Pe = ge.KEEP_CONTENT !== !1, Te = ge.IN_PLACE || !1, H = ge.ALLOWED_URI_REGEXP || IS_ALLOWED_URI, me = ge.NAMESPACE || Y, te = ge.CUSTOM_ELEMENT_HANDLING || {}, ge.CUSTOM_ELEMENT_HANDLING && be(ge.CUSTOM_ELEMENT_HANDLING.tagNameCheck) && (te.tagNameCheck = ge.CUSTOM_ELEMENT_HANDLING.tagNameCheck), ge.CUSTOM_ELEMENT_HANDLING && be(ge.CUSTOM_ELEMENT_HANDLING.attributeNameCheck) && (te.attributeNameCheck = ge.CUSTOM_ELEMENT_HANDLING.attributeNameCheck), ge.CUSTOM_ELEMENT_HANDLING && typeof ge.CUSTOM_ELEMENT_HANDLING.allowCustomizedBuiltInElements == "boolean" && (te.allowCustomizedBuiltInElements = ge.CUSTOM_ELEMENT_HANDLING.allowCustomizedBuiltInElements), Ae && (J = !1), Ue && (Be = !0), Me && (U = addToSet({}, text$9), re = [], Me.html === !0 && (addToSet(U, html$1), addToSet(re, html)), Me.svg === !0 && (addToSet(U, svg$1), addToSet(re, svg), addToSet(re, xml)), Me.svgFilters === !0 && (addToSet(U, svgFilters), addToSet(re, svg), addToSet(re, xml)), Me.mathMl === !0 && (addToSet(U, mathMl$1), addToSet(re, mathMl), addToSet(re, xml))), ge.ADD_TAGS && (U === j && (U = clone(U)), addToSet(U, ge.ADD_TAGS, Ve)), ge.ADD_ATTR && (re === ie && (re = clone(re)), addToSet(re, ge.ADD_ATTR, Ve)), ge.ADD_URI_SAFE_ATTR && addToSet(ye, ge.ADD_URI_SAFE_ATTR, Ve), ge.FORBID_CONTENTS && (De === V && (De = clone(De)), addToSet(De, ge.FORBID_CONTENTS, Ve)), Pe && (U["#text"] = !0), ne && addToSet(U, ["html", "head", "body"]), U.table && (addToSet(U, ["tbody"]), delete ue.tbody), ge.TRUSTED_TYPES_POLICY) { + if (typeof ge.TRUSTED_TYPES_POLICY.createHTML != "function") throw typeErrorCreate('TRUSTED_TYPES_POLICY configuration option must provide a "createHTML" hook.'); - if (typeof xe.TRUSTED_TYPES_POLICY.createScriptURL != "function") + if (typeof ge.TRUSTED_TYPES_POLICY.createScriptURL != "function") throw typeErrorCreate('TRUSTED_TYPES_POLICY configuration option must provide a "createScriptURL" hook.'); - x = xe.TRUSTED_TYPES_POLICY, c = x.createHTML(""); + w = ge.TRUSTED_TYPES_POLICY, o = w.createHTML(""); } else - x === void 0 && (x = _createTrustedTypesPolicy(b, a)), x !== null && typeof c == "string" && (c = x.createHTML("")); - freeze && freeze(xe), I = xe; + w === void 0 && (w = _createTrustedTypesPolicy(b, a)), w !== null && typeof o == "string" && (o = w.createHTML("")); + freeze && freeze(ge), I = ge; } - }, de = addToSet({}, ["mi", "mo", "mn", "ms", "mtext"]), $e = addToSet({}, ["annotation-xml"]), Ye = addToSet({}, ["title", "style", "font", "a", "script"]), qe = addToSet({}, [...svg$1, ...svgFilters, ...svgDisallowed]), Xe = addToSet({}, [...mathMl$1, ...mathMlDisallowed]), at = function(xe) { - let He = g(xe); - (!He || !He.tagName) && (He = { - namespaceURI: fe, + }, fe = addToSet({}, ["mi", "mo", "mn", "ms", "mtext"]), Ce = addToSet({}, ["annotation-xml"]), Ze = addToSet({}, ["title", "style", "font", "a", "script"]), Xe = addToSet({}, [...svg$1, ...svgFilters, ...svgDisallowed]), Ye = addToSet({}, [...mathMl$1, ...mathMlDisallowed]), lt = function(ge) { + let Ke = g(ge); + (!Ke || !Ke.tagName) && (Ke = { + namespaceURI: me, tagName: "template" }); - const Ze = stringToLowerCase(xe.tagName), yt = stringToLowerCase(He.tagName); - return Ne[xe.namespaceURI] ? xe.namespaceURI === Fe ? He.namespaceURI === K ? Ze === "svg" : He.namespaceURI === Pe ? Ze === "svg" && (yt === "annotation-xml" || de[yt]) : !!qe[Ze] : xe.namespaceURI === Pe ? He.namespaceURI === K ? Ze === "math" : He.namespaceURI === Fe ? Ze === "math" && $e[yt] : !!Xe[Ze] : xe.namespaceURI === K ? He.namespaceURI === Fe && !$e[yt] || He.namespaceURI === Pe && !de[yt] ? !1 : !Xe[Ze] && (Ye[Ze] || !qe[Ze]) : !!(ke === "application/xhtml+xml" && Ne[xe.namespaceURI]) : !1; - }, dt = function(xe) { + const Qe = stringToLowerCase(ge.tagName), _t = stringToLowerCase(Ke.tagName); + return Re[ge.namespaceURI] ? ge.namespaceURI === ke ? Ke.namespaceURI === Y ? Qe === "svg" : Ke.namespaceURI === Ie ? Qe === "svg" && (_t === "annotation-xml" || fe[_t]) : !!Xe[Qe] : ge.namespaceURI === Ie ? Ke.namespaceURI === Y ? Qe === "math" : Ke.namespaceURI === ke ? Qe === "math" && Ce[_t] : !!Ye[Qe] : ge.namespaceURI === Y ? Ke.namespaceURI === ke && !Ce[_t] || Ke.namespaceURI === Ie && !fe[_t] ? !1 : !Ye[Qe] && (Ze[Qe] || !Xe[Qe]) : !!($e === "application/xhtml+xml" && Re[ge.namespaceURI]) : !1; + }, dt = function(ge) { arrayPush(e.removed, { - element: xe + element: ge }); try { - g(xe).removeChild(xe); + g(ge).removeChild(ge); } catch { - s(xe); + s(ge); } - }, lt = function(xe, He) { + }, it = function(ge, Ke) { try { arrayPush(e.removed, { - attribute: He.getAttributeNode(xe), - from: He + attribute: Ke.getAttributeNode(ge), + from: Ke }); } catch { arrayPush(e.removed, { attribute: null, - from: He + from: Ke }); } - if (He.removeAttribute(xe), xe === "is" && !re[xe]) - if (Re || Ue) + if (Ke.removeAttribute(ge), ge === "is" && !re[ge]) + if (Be || Ue) try { - dt(He); + dt(Ke); } catch { } else try { - He.setAttribute(xe, ""); + Ke.setAttribute(ge, ""); } catch { } - }, ot = function(xe) { - let He = null, Ze = null; - if (Oe) - xe = "" + xe; + }, ot = function(ge) { + let Ke = null, Qe = null; + if (Le) + ge = "" + ge; else { - const Ft = stringMatch(xe, /^[\r\n\t ]+/); - Ze = Ft && Ft[0]; + const St = stringMatch(ge, /^[\r\n\t ]+/); + Qe = St && St[0]; } - ke === "application/xhtml+xml" && fe === K && (xe = '' + xe + ""); - const yt = x ? x.createHTML(xe) : xe; - if (fe === K) + $e === "application/xhtml+xml" && me === Y && (ge = '' + ge + ""); + const _t = w ? w.createHTML(ge) : ge; + if (me === Y) try { - He = new w().parseFromString(yt, ke); + Ke = new x().parseFromString(_t, $e); } catch { } - if (!He || !He.documentElement) { - He = v.createDocument(fe, "template", null); + if (!Ke || !Ke.documentElement) { + Ke = v.createDocument(me, "template", null); try { - He.documentElement.innerHTML = Se ? c : yt; + Ke.documentElement.innerHTML = we ? o : _t; } catch { } } - const zt = He.body || He.documentElement; - return xe && Ze && zt.insertBefore(t.createTextNode(Ze), zt.childNodes[0] || null), fe === K ? $.call(He, ne ? "html" : "body")[0] : ne ? He.documentElement : zt; - }, st = function(xe) { + const Mt = Ke.body || Ke.documentElement; + return ge && Qe && Mt.insertBefore(t.createTextNode(Qe), Mt.childNodes[0] || null), me === Y ? $.call(Ke, ne ? "html" : "body")[0] : ne ? Ke.documentElement : Mt; + }, nt = function(ge) { return M.call( - xe.ownerDocument || xe, - xe, + ge.ownerDocument || ge, + ge, // eslint-disable-next-line no-bitwise - p.SHOW_ELEMENT | p.SHOW_COMMENT | p.SHOW_TEXT | p.SHOW_PROCESSING_INSTRUCTION | p.SHOW_CDATA_SECTION, + _.SHOW_ELEMENT | _.SHOW_COMMENT | _.SHOW_TEXT | _.SHOW_PROCESSING_INSTRUCTION | _.SHOW_CDATA_SECTION, null ); - }, bt = function(xe) { - return xe instanceof y && (typeof xe.nodeName != "string" || typeof xe.textContent != "string" || typeof xe.removeChild != "function" || !(xe.attributes instanceof m) || typeof xe.removeAttribute != "function" || typeof xe.setAttribute != "function" || typeof xe.namespaceURI != "string" || typeof xe.insertBefore != "function" || typeof xe.hasChildNodes != "function"); - }, _t = function(xe) { - return typeof o == "function" && xe instanceof o; - }, Lt = function(xe, He, Ze) { - L[xe] && arrayForEach(L[xe], (yt) => { - yt.call(e, He, Ze, I); + }, Ct = function(ge) { + return ge instanceof y && (typeof ge.nodeName != "string" || typeof ge.textContent != "string" || typeof ge.removeChild != "function" || !(ge.attributes instanceof m) || typeof ge.removeAttribute != "function" || typeof ge.setAttribute != "function" || typeof ge.namespaceURI != "string" || typeof ge.insertBefore != "function" || typeof ge.hasChildNodes != "function"); + }, ut = function(ge) { + return typeof c == "function" && ge instanceof c; + }, zt = function(ge, Ke, Qe) { + L[ge] && arrayForEach(L[ge], (_t) => { + _t.call(e, Ke, Qe, I); }); - }, Gt = function(xe) { - let He = null; - if (Lt("beforeSanitizeElements", xe, null), bt(xe)) - return dt(xe), !0; - const Ze = Ge(xe.nodeName); - if (Lt("uponSanitizeElement", xe, { - tagName: Ze, - allowedTags: W - }), xe.hasChildNodes() && !_t(xe.firstElementChild) && regExpTest(/<[/\w]/g, xe.innerHTML) && regExpTest(/<[/\w]/g, xe.textContent) || xe.nodeType === NODE_TYPE.progressingInstruction || ue && xe.nodeType === NODE_TYPE.comment && regExpTest(/<[/\w]/g, xe.data)) - return dt(xe), !0; - if (!W[Ze] || ce[Ze]) { - if (!ce[Ze] && Et(Ze) && (ee.tagNameCheck instanceof RegExp && regExpTest(ee.tagNameCheck, Ze) || ee.tagNameCheck instanceof Function && ee.tagNameCheck(Ze))) + }, Ut = function(ge) { + let Ke = null; + if (zt("beforeSanitizeElements", ge, null), Ct(ge)) + return dt(ge), !0; + const Qe = Ve(ge.nodeName); + if (zt("uponSanitizeElement", ge, { + tagName: Qe, + allowedTags: U + }), ge.hasChildNodes() && !ut(ge.firstElementChild) && regExpTest(/<[/\w]/g, ge.innerHTML) && regExpTest(/<[/\w]/g, ge.textContent) || ge.nodeType === NODE_TYPE.progressingInstruction || he && ge.nodeType === NODE_TYPE.comment && regExpTest(/<[/\w]/g, ge.data)) + return dt(ge), !0; + if (!U[Qe] || ue[Qe]) { + if (!ue[Qe] && mt(Qe) && (te.tagNameCheck instanceof RegExp && regExpTest(te.tagNameCheck, Qe) || te.tagNameCheck instanceof Function && te.tagNameCheck(Qe))) return !1; - if (Le && !je[Ze]) { - const yt = g(xe) || xe.parentNode, zt = _(xe) || xe.childNodes; - if (zt && yt) { - const Ft = zt.length; - for (let Bt = Ft - 1; Bt >= 0; --Bt) { - const Nt = f(zt[Bt], !0); - Nt.__removalCount = (xe.__removalCount || 0) + 1, yt.insertBefore(Nt, h(xe)); + if (Pe && !De[Qe]) { + const _t = g(ge) || ge.parentNode, Mt = p(ge) || ge.childNodes; + if (Mt && _t) { + const St = Mt.length; + for (let It = St - 1; It >= 0; --It) { + const Pt = f(Mt[It], !0); + Pt.__removalCount = (ge.__removalCount || 0) + 1, _t.insertBefore(Pt, u(ge)); } } } - return dt(xe), !0; - } - return xe instanceof u && !at(xe) || (Ze === "noscript" || Ze === "noembed" || Ze === "noframes") && regExpTest(/<\/no(script|embed|frames)/i, xe.innerHTML) ? (dt(xe), !0) : (Ce && xe.nodeType === NODE_TYPE.text && (He = xe.textContent, arrayForEach([z, O, R], (yt) => { - He = stringReplace(He, yt, " "); - }), xe.textContent !== He && (arrayPush(e.removed, { - element: xe.cloneNode() - }), xe.textContent = He)), Lt("afterSanitizeElements", xe, null), !1); - }, ft = function(xe, He, Ze) { - if (Ee && (He === "id" || He === "name") && (Ze in t || Ze in ye)) + return dt(ge), !0; + } + return ge instanceof d && !lt(ge) || (Qe === "noscript" || Qe === "noembed" || Qe === "noframes") && regExpTest(/<\/no(script|embed|frames)/i, ge.innerHTML) ? (dt(ge), !0) : (Ae && ge.nodeType === NODE_TYPE.text && (Ke = ge.textContent, arrayForEach([z, O, R], (_t) => { + Ke = stringReplace(Ke, _t, " "); + }), ge.textContent !== Ke && (arrayPush(e.removed, { + element: ge.cloneNode() + }), ge.textContent = Ke)), zt("afterSanitizeElements", ge, null), !1); + }, wt = function(ge, Ke, Qe) { + if (We && (Ke === "id" || Ke === "name") && (Qe in t || Qe in xe)) return !1; - if (!(J && !he[He] && regExpTest(P, He))) { - if (!(le && regExpTest(U, He))) { - if (!re[He] || he[He]) { + if (!(J && !de[Ke] && regExpTest(N, Ke))) { + if (!(oe && regExpTest(W, Ke))) { + if (!re[Ke] || de[Ke]) { if ( // First condition does a very basic check if a) it's basically a valid custom element tagname AND // b) if the tagName passes whatever the user has configured for CUSTOM_ELEMENT_HANDLING.tagNameCheck // and c) if the attribute name passes whatever the user has configured for CUSTOM_ELEMENT_HANDLING.attributeNameCheck - !(Et(xe) && (ee.tagNameCheck instanceof RegExp && regExpTest(ee.tagNameCheck, xe) || ee.tagNameCheck instanceof Function && ee.tagNameCheck(xe)) && (ee.attributeNameCheck instanceof RegExp && regExpTest(ee.attributeNameCheck, He) || ee.attributeNameCheck instanceof Function && ee.attributeNameCheck(He)) || // Alternative, second condition checks if it's an `is`-attribute, AND + !(mt(ge) && (te.tagNameCheck instanceof RegExp && regExpTest(te.tagNameCheck, ge) || te.tagNameCheck instanceof Function && te.tagNameCheck(ge)) && (te.attributeNameCheck instanceof RegExp && regExpTest(te.attributeNameCheck, Ke) || te.attributeNameCheck instanceof Function && te.attributeNameCheck(Ke)) || // Alternative, second condition checks if it's an `is`-attribute, AND // the value passes whatever the user has configured for CUSTOM_ELEMENT_HANDLING.tagNameCheck - He === "is" && ee.allowCustomizedBuiltInElements && (ee.tagNameCheck instanceof RegExp && regExpTest(ee.tagNameCheck, Ze) || ee.tagNameCheck instanceof Function && ee.tagNameCheck(Ze))) + Ke === "is" && te.allowCustomizedBuiltInElements && (te.tagNameCheck instanceof RegExp && regExpTest(te.tagNameCheck, Qe) || te.tagNameCheck instanceof Function && te.tagNameCheck(Qe))) ) return !1; - } else if (!we[He]) { - if (!regExpTest(H, stringReplace(Ze, N, ""))) { - if (!((He === "src" || He === "xlink:href" || He === "href") && xe !== "script" && stringIndexOf(Ze, "data:") === 0 && q[xe])) { - if (!(Me && !regExpTest(B, stringReplace(Ze, N, "")))) { - if (Ze) + } else if (!ye[Ke]) { + if (!regExpTest(H, stringReplace(Qe, P, ""))) { + if (!((Ke === "src" || Ke === "xlink:href" || Ke === "href") && ge !== "script" && stringIndexOf(Qe, "data:") === 0 && Z[ge])) { + if (!(Ee && !regExpTest(B, stringReplace(Qe, P, "")))) { + if (Qe) return !1; } } @@ -14713,129 +14713,129 @@ function createDOMPurify() { } } return !0; - }, Et = function(xe) { - return xe !== "annotation-xml" && stringMatch(xe, G); - }, gt = function(xe) { - Lt("beforeSanitizeAttributes", xe, null); + }, mt = function(ge) { + return ge !== "annotation-xml" && stringMatch(ge, G); + }, vt = function(ge) { + zt("beforeSanitizeAttributes", ge, null); const { - attributes: He - } = xe; - if (!He) + attributes: Ke + } = ge; + if (!Ke) return; - const Ze = { + const Qe = { attrName: "", attrValue: "", keepAttr: !0, allowedAttributes: re }; - let yt = He.length; - for (; yt--; ) { - const zt = He[yt], { - name: Ft, - namespaceURI: Bt, - value: Nt - } = zt, Zt = Ge(Ft); - let Pt = Ft === "value" ? Nt : stringTrim(Nt); - if (Ze.attrName = Zt, Ze.attrValue = Pt, Ze.keepAttr = !0, Ze.forceKeepAttr = void 0, Lt("uponSanitizeAttribute", xe, Ze), Pt = Ze.attrValue, Ze.forceKeepAttr || (lt(Ft, xe), !Ze.keepAttr)) + let _t = Ke.length; + for (; _t--; ) { + const Mt = Ke[_t], { + name: St, + namespaceURI: It, + value: Pt + } = Mt, Zt = Ve(St); + let Tt = St === "value" ? Pt : stringTrim(Pt); + if (Qe.attrName = Zt, Qe.attrValue = Tt, Qe.keepAttr = !0, Qe.forceKeepAttr = void 0, zt("uponSanitizeAttribute", ge, Qe), Tt = Qe.attrValue, Qe.forceKeepAttr || (it(St, ge), !Qe.keepAttr)) continue; - if (!se && regExpTest(/\/>/i, Pt)) { - lt(Ft, xe); + if (!se && regExpTest(/\/>/i, Tt)) { + it(St, ge); continue; } - Ce && arrayForEach([z, O, R], (pr) => { - Pt = stringReplace(Pt, pr, " "); + Ae && arrayForEach([z, O, R], (nr) => { + Tt = stringReplace(Tt, nr, " "); }); - const mr = Ge(xe.nodeName); - if (ft(mr, Zt, Pt)) { - if (Ae && (Zt === "id" || Zt === "name") && (lt(Ft, xe), Pt = ge + Pt), ue && regExpTest(/((--!?|])>)|<\/(style|title)/i, Pt)) { - lt(Ft, xe); + const mr = Ve(ge.nodeName); + if (wt(mr, Zt, Tt)) { + if (Ge && (Zt === "id" || Zt === "name") && (it(St, ge), Tt = Ne + Tt), he && regExpTest(/((--!?|])>)|<\/(style|title)/i, Tt)) { + it(St, ge); continue; } - if (x && typeof b == "object" && typeof b.getAttributeType == "function" && !Bt) + if (w && typeof b == "object" && typeof b.getAttributeType == "function" && !It) switch (b.getAttributeType(mr, Zt)) { case "TrustedHTML": { - Pt = x.createHTML(Pt); + Tt = w.createHTML(Tt); break; } case "TrustedScriptURL": { - Pt = x.createScriptURL(Pt); + Tt = w.createScriptURL(Tt); break; } } try { - Bt ? xe.setAttributeNS(Bt, Ft, Pt) : xe.setAttribute(Ft, Pt), bt(xe) ? dt(xe) : arrayPop(e.removed); + It ? ge.setAttributeNS(It, St, Tt) : ge.setAttribute(St, Tt), Ct(ge) ? dt(ge) : arrayPop(e.removed); } catch { } } } - Lt("afterSanitizeAttributes", xe, null); - }, Rt = function Qe(xe) { - let He = null; - const Ze = st(xe); - for (Lt("beforeSanitizeShadowDOM", xe, null); He = Ze.nextNode(); ) - Lt("uponSanitizeShadowNode", He, null), !Gt(He) && (He.content instanceof l && Qe(He.content), gt(He)); - Lt("afterSanitizeShadowDOM", xe, null); + zt("afterSanitizeAttributes", ge, null); + }, Rt = function qe(ge) { + let Ke = null; + const Qe = nt(ge); + for (zt("beforeSanitizeShadowDOM", ge, null); Ke = Qe.nextNode(); ) + zt("uponSanitizeShadowNode", Ke, null), !Ut(Ke) && (Ke.content instanceof l && qe(Ke.content), vt(Ke)); + zt("afterSanitizeShadowDOM", ge, null); }; - return e.sanitize = function(Qe) { - let xe = arguments.length > 1 && arguments[1] !== void 0 ? arguments[1] : {}, He = null, Ze = null, yt = null, zt = null; - if (Se = !Qe, Se && (Qe = ""), typeof Qe != "string" && !_t(Qe)) - if (typeof Qe.toString == "function") { - if (Qe = Qe.toString(), typeof Qe != "string") + return e.sanitize = function(qe) { + let ge = arguments.length > 1 && arguments[1] !== void 0 ? arguments[1] : {}, Ke = null, Qe = null, _t = null, Mt = null; + if (we = !qe, we && (qe = ""), typeof qe != "string" && !ut(qe)) + if (typeof qe.toString == "function") { + if (qe = qe.toString(), typeof qe != "string") throw typeErrorCreate("dirty is not a string, aborting"); } else throw typeErrorCreate("toString is not a function"); if (!e.isSupported) - return Qe; - if (_e || Z(xe), e.removed = [], typeof Qe == "string" && (Te = !1), Te) { - if (Qe.nodeName) { - const Nt = Ge(Qe.nodeName); - if (!W[Nt] || ce[Nt]) + return qe; + if (_e || q(ge), e.removed = [], typeof qe == "string" && (Te = !1), Te) { + if (qe.nodeName) { + const Pt = Ve(qe.nodeName); + if (!U[Pt] || ue[Pt]) throw typeErrorCreate("root node is forbidden and cannot be sanitized in-place"); } - } else if (Qe instanceof o) - He = ot(""), Ze = He.ownerDocument.importNode(Qe, !0), Ze.nodeType === NODE_TYPE.element && Ze.nodeName === "BODY" || Ze.nodeName === "HTML" ? He = Ze : He.appendChild(Ze); + } else if (qe instanceof c) + Ke = ot(""), Qe = Ke.ownerDocument.importNode(qe, !0), Qe.nodeType === NODE_TYPE.element && Qe.nodeName === "BODY" || Qe.nodeName === "HTML" ? Ke = Qe : Ke.appendChild(Qe); else { - if (!Re && !Ce && !ne && // eslint-disable-next-line unicorn/prefer-includes - Qe.indexOf("<") === -1) - return x && We ? x.createHTML(Qe) : Qe; - if (He = ot(Qe), !He) - return Re ? null : We ? c : ""; - } - He && Oe && dt(He.firstChild); - const Ft = st(Te ? Qe : He); - for (; yt = Ft.nextNode(); ) - Gt(yt) || (yt.content instanceof l && Rt(yt.content), gt(yt)); + if (!Be && !Ae && !ne && // eslint-disable-next-line unicorn/prefer-includes + qe.indexOf("<") === -1) + return w && He ? w.createHTML(qe) : qe; + if (Ke = ot(qe), !Ke) + return Be ? null : He ? o : ""; + } + Ke && Le && dt(Ke.firstChild); + const St = nt(Te ? qe : Ke); + for (; _t = St.nextNode(); ) + Ut(_t) || (_t.content instanceof l && Rt(_t.content), vt(_t)); if (Te) - return Qe; - if (Re) { + return qe; + if (Be) { if (Ue) - for (zt = E.call(He.ownerDocument); He.firstChild; ) - zt.appendChild(He.firstChild); + for (Mt = E.call(Ke.ownerDocument); Ke.firstChild; ) + Mt.appendChild(Ke.firstChild); else - zt = He; - return (re.shadowroot || re.shadowrootmode) && (zt = k.call(r, zt, !0)), zt; - } - let Bt = ne ? He.outerHTML : He.innerHTML; - return ne && W["!doctype"] && He.ownerDocument && He.ownerDocument.doctype && He.ownerDocument.doctype.name && regExpTest(DOCTYPE_NAME, He.ownerDocument.doctype.name) && (Bt = " -` + Bt), Ce && arrayForEach([z, O, R], (Nt) => { - Bt = stringReplace(Bt, Nt, " "); - }), x && We ? x.createHTML(Bt) : Bt; + Mt = Ke; + return (re.shadowroot || re.shadowrootmode) && (Mt = k.call(r, Mt, !0)), Mt; + } + let It = ne ? Ke.outerHTML : Ke.innerHTML; + return ne && U["!doctype"] && Ke.ownerDocument && Ke.ownerDocument.doctype && Ke.ownerDocument.doctype.name && regExpTest(DOCTYPE_NAME, Ke.ownerDocument.doctype.name) && (It = " +` + It), Ae && arrayForEach([z, O, R], (Pt) => { + It = stringReplace(It, Pt, " "); + }), w && He ? w.createHTML(It) : It; }, e.setConfig = function() { - let Qe = arguments.length > 0 && arguments[0] !== void 0 ? arguments[0] : {}; - Z(Qe), _e = !0; + let qe = arguments.length > 0 && arguments[0] !== void 0 ? arguments[0] : {}; + q(qe), _e = !0; }, e.clearConfig = function() { I = null, _e = !1; - }, e.isValidAttribute = function(Qe, xe, He) { - I || Z({}); - const Ze = Ge(Qe), yt = Ge(xe); - return ft(Ze, yt, He); - }, e.addHook = function(Qe, xe) { - typeof xe == "function" && (L[Qe] = L[Qe] || [], arrayPush(L[Qe], xe)); - }, e.removeHook = function(Qe) { - if (L[Qe]) - return arrayPop(L[Qe]); - }, e.removeHooks = function(Qe) { - L[Qe] && (L[Qe] = []); + }, e.isValidAttribute = function(qe, ge, Ke) { + I || q({}); + const Qe = Ve(qe), _t = Ve(ge); + return wt(Qe, _t, Ke); + }, e.addHook = function(qe, ge) { + typeof ge == "function" && (L[qe] = L[qe] || [], arrayPush(L[qe], ge)); + }, e.removeHook = function(qe) { + if (L[qe]) + return arrayPop(L[qe]); + }, e.removeHooks = function(qe) { + L[qe] && (L[qe] = []); }, e.removeAllHooks = function() { L = {}; }, e; @@ -14866,7 +14866,7 @@ const { transition_out: transition_out$d } = window.__gradio__svelte__internal; function create_fragment$i(n) { - let e, t, r, a, l, d; + let e, t, r, a, l, h; return r = new /*Icon*/ n[1]({}), { c() { @@ -14875,20 +14875,20 @@ function create_fragment$i(n) { n[0] ), this.h(); }, - l(o) { - e = claim_element$e(o, "LABEL", { + l(c) { + e = claim_element$e(c, "LABEL", { for: !0, "data-testid": !0, class: !0 }); - var u = children$f(e); - t = claim_element$e(u, "SPAN", { class: !0 }); - var p = children$f(t); - claim_component$a(r.$$.fragment, p), p.forEach(detach$i), a = claim_space$c(u), l = claim_text$8( - u, + var d = children$f(e); + t = claim_element$e(d, "SPAN", { class: !0 }); + var _ = children$f(t); + claim_component$a(r.$$.fragment, _), _.forEach(detach$i), a = claim_space$c(d), l = claim_text$8( + d, /*label*/ n[0] - ), u.forEach(detach$i), this.h(); + ), d.forEach(detach$i), this.h(); }, h() { attr$e(t, "class", "svelte-168uj4v"), attr$e(e, "for", ""), attr$e(e, "data-testid", "block-label"), attr$e(e, "class", "svelte-168uj4v"), toggle_class$b(e, "hide", !/*show_label*/ @@ -14905,49 +14905,49 @@ function create_fragment$i(n) { n[3] ); }, - m(o, u) { - insert_hydration$i(o, e, u), append_hydration$d(e, t), mount_component$a(r, t, null), append_hydration$d(e, a), append_hydration$d(e, l), d = !0; + m(c, d) { + insert_hydration$i(c, e, d), append_hydration$d(e, t), mount_component$a(r, t, null), append_hydration$d(e, a), append_hydration$d(e, l), h = !0; }, - p(o, [u]) { - (!d || u & /*label*/ + p(c, [d]) { + (!h || d & /*label*/ 1) && set_data$7( l, /*label*/ - o[0] - ), (!d || u & /*show_label*/ + c[0] + ), (!h || d & /*show_label*/ 4) && toggle_class$b(e, "hide", !/*show_label*/ - o[2]), (!d || u & /*show_label*/ + c[2]), (!h || d & /*show_label*/ 4) && toggle_class$b(e, "sr-only", !/*show_label*/ - o[2]), (!d || u & /*float*/ + c[2]), (!h || d & /*float*/ 16) && toggle_class$b( e, "float", /*float*/ - o[4] - ), (!d || u & /*disable*/ + c[4] + ), (!h || d & /*disable*/ 8) && toggle_class$b( e, "hide-label", /*disable*/ - o[3] + c[3] ); }, - i(o) { - d || (transition_in$e(r.$$.fragment, o), d = !0); + i(c) { + h || (transition_in$e(r.$$.fragment, c), h = !0); }, - o(o) { - transition_out$d(r.$$.fragment, o), d = !1; + o(c) { + transition_out$d(r.$$.fragment, c), h = !1; }, - d(o) { - o && detach$i(e), destroy_component$a(r); + d(c) { + c && detach$i(e), destroy_component$a(r); } }; } function instance$h(n, e, t) { - let { label: r = null } = e, { Icon: a } = e, { show_label: l = !0 } = e, { disable: d = !1 } = e, { float: o = !0 } = e; - return n.$$set = (u) => { - "label" in u && t(0, r = u.label), "Icon" in u && t(1, a = u.Icon), "show_label" in u && t(2, l = u.show_label), "disable" in u && t(3, d = u.disable), "float" in u && t(4, o = u.float); - }, [r, a, l, d, o]; + let { label: r = null } = e, { Icon: a } = e, { show_label: l = !0 } = e, { disable: h = !1 } = e, { float: c = !0 } = e; + return n.$$set = (d) => { + "label" in d && t(0, r = d.label), "Icon" in d && t(1, a = d.Icon), "show_label" in d && t(2, l = d.show_label), "disable" in d && t(3, h = d.disable), "float" in d && t(4, c = d.float); + }, [r, a, l, h, c]; } class BlockLabel extends SvelteComponent$i { constructor(e) { @@ -15028,20 +15028,20 @@ function create_if_block$c(n) { }; } function create_fragment$h(n) { - let e, t, r, a, l, d, o, u = ( + let e, t, r, a, l, h, c, d = ( /*show_label*/ n[2] && create_if_block$c(n) ); - var p = ( + var _ = ( /*Icon*/ n[0] ); - function m(y, w) { + function m(y, x) { return {}; } - return p && (a = construct_svelte_component(p, m())), { + return _ && (a = construct_svelte_component(_, m())), { c() { - e = element$d("button"), u && u.c(), t = space$b(), r = element$d("div"), a && create_component$9(a.$$.fragment), this.h(); + e = element$d("button"), d && d.c(), t = space$b(), r = element$d("div"), a && create_component$9(a.$$.fragment), this.h(); }, l(y) { e = claim_element$d(y, "BUTTON", { @@ -15050,10 +15050,10 @@ function create_fragment$h(n) { title: !0, class: !0 }); - var w = children$e(e); - u && u.l(w), t = claim_space$b(w), r = claim_element$d(w, "DIV", { class: !0 }); + var x = children$e(e); + d && d.l(x), t = claim_space$b(x), r = claim_element$d(x, "DIV", { class: !0 }); var b = children$e(r); - a && claim_component$9(a.$$.fragment, b), b.forEach(detach$h), w.forEach(detach$h), this.h(); + a && claim_component$9(a.$$.fragment, b), b.forEach(detach$h), x.forEach(detach$h), this.h(); }, h() { attr$d(r, "class", "svelte-vk34kx"), toggle_class$a( @@ -15118,18 +15118,18 @@ function create_fragment$h(n) { n[10] )); }, - m(y, w) { - insert_hydration$h(y, e, w), u && u.m(e, null), append_hydration$c(e, t), append_hydration$c(e, r), a && mount_component$9(a, r, null), l = !0, d || (o = listen$5( + m(y, x) { + insert_hydration$h(y, e, x), d && d.m(e, null), append_hydration$c(e, t), append_hydration$c(e, r), a && mount_component$9(a, r, null), l = !0, h || (c = listen$5( e, "click", /*click_handler*/ n[13] - ), d = !0); + ), h = !0); }, - p(y, [w]) { + p(y, [x]) { if (/*show_label*/ - y[2] ? u ? u.p(y, w) : (u = create_if_block$c(y), u.c(), u.m(e, t)) : u && (u.d(1), u = null), w & /*Icon*/ - 1 && p !== (p = /*Icon*/ + y[2] ? d ? d.p(y, x) : (d = create_if_block$c(y), d.c(), d.m(e, t)) : d && (d.d(1), d = null), x & /*Icon*/ + 1 && _ !== (_ = /*Icon*/ y[0])) { if (a) { group_outros$a(); @@ -15138,77 +15138,77 @@ function create_fragment$h(n) { destroy_component$9(b, 1); }), check_outros$a(); } - p ? (a = construct_svelte_component(p, m()), create_component$9(a.$$.fragment), transition_in$d(a.$$.fragment, 1), mount_component$9(a, r, null)) : a = null; + _ ? (a = construct_svelte_component(_, m()), create_component$9(a.$$.fragment), transition_in$d(a.$$.fragment, 1), mount_component$9(a, r, null)) : a = null; } - (!l || w & /*size*/ + (!l || x & /*size*/ 16) && toggle_class$a( r, "small", /*size*/ y[4] === "small" - ), (!l || w & /*size*/ + ), (!l || x & /*size*/ 16) && toggle_class$a( r, "large", /*size*/ y[4] === "large" - ), (!l || w & /*size*/ + ), (!l || x & /*size*/ 16) && toggle_class$a( r, "medium", /*size*/ y[4] === "medium" - ), (!l || w & /*disabled*/ + ), (!l || x & /*disabled*/ 128) && (e.disabled = /*disabled*/ - y[7]), (!l || w & /*label*/ + y[7]), (!l || x & /*label*/ 2) && attr$d( e, "aria-label", /*label*/ y[1] - ), (!l || w & /*hasPopup*/ + ), (!l || x & /*hasPopup*/ 256) && attr$d( e, "aria-haspopup", /*hasPopup*/ y[8] - ), (!l || w & /*label*/ + ), (!l || x & /*label*/ 2) && attr$d( e, "title", /*label*/ y[1] - ), (!l || w & /*pending*/ + ), (!l || x & /*pending*/ 8) && toggle_class$a( e, "pending", /*pending*/ y[3] - ), (!l || w & /*padded*/ + ), (!l || x & /*padded*/ 32) && toggle_class$a( e, "padded", /*padded*/ y[5] - ), (!l || w & /*highlight*/ + ), (!l || x & /*highlight*/ 64) && toggle_class$a( e, "highlight", /*highlight*/ y[6] - ), (!l || w & /*transparent*/ + ), (!l || x & /*transparent*/ 512) && toggle_class$a( e, "transparent", /*transparent*/ y[9] - ), w & /*disabled, _color*/ + ), x & /*disabled, _color*/ 2176 && set_style$7(e, "color", !/*disabled*/ y[7] && /*_color*/ y[11] ? ( /*_color*/ y[11] - ) : "var(--block-label-text-color)"), w & /*disabled, background*/ + ) : "var(--block-label-text-color)"), x & /*disabled, background*/ 1152 && set_style$7(e, "--bg-color", /*disabled*/ y[7] ? "auto" : ( /*background*/ @@ -15222,30 +15222,30 @@ function create_fragment$h(n) { a && transition_out$c(a.$$.fragment, y), l = !1; }, d(y) { - y && detach$h(e), u && u.d(), a && destroy_component$9(a), d = !1, o(); + y && detach$h(e), d && d.d(), a && destroy_component$9(a), h = !1, c(); } }; } function instance$g(n, e, t) { - let r, { Icon: a } = e, { label: l = "" } = e, { show_label: d = !1 } = e, { pending: o = !1 } = e, { size: u = "small" } = e, { padded: p = !0 } = e, { highlight: m = !1 } = e, { disabled: y = !1 } = e, { hasPopup: w = !1 } = e, { color: b = "var(--block-label-text-color)" } = e, { transparent: A = !1 } = e, { background: f = "var(--block-background-fill)" } = e; - function s(h) { - bubble$3.call(this, n, h); + let r, { Icon: a } = e, { label: l = "" } = e, { show_label: h = !1 } = e, { pending: c = !1 } = e, { size: d = "small" } = e, { padded: _ = !0 } = e, { highlight: m = !1 } = e, { disabled: y = !1 } = e, { hasPopup: x = !1 } = e, { color: b = "var(--block-label-text-color)" } = e, { transparent: A = !1 } = e, { background: f = "var(--block-background-fill)" } = e; + function s(u) { + bubble$3.call(this, n, u); } - return n.$$set = (h) => { - "Icon" in h && t(0, a = h.Icon), "label" in h && t(1, l = h.label), "show_label" in h && t(2, d = h.show_label), "pending" in h && t(3, o = h.pending), "size" in h && t(4, u = h.size), "padded" in h && t(5, p = h.padded), "highlight" in h && t(6, m = h.highlight), "disabled" in h && t(7, y = h.disabled), "hasPopup" in h && t(8, w = h.hasPopup), "color" in h && t(12, b = h.color), "transparent" in h && t(9, A = h.transparent), "background" in h && t(10, f = h.background); + return n.$$set = (u) => { + "Icon" in u && t(0, a = u.Icon), "label" in u && t(1, l = u.label), "show_label" in u && t(2, h = u.show_label), "pending" in u && t(3, c = u.pending), "size" in u && t(4, d = u.size), "padded" in u && t(5, _ = u.padded), "highlight" in u && t(6, m = u.highlight), "disabled" in u && t(7, y = u.disabled), "hasPopup" in u && t(8, x = u.hasPopup), "color" in u && t(12, b = u.color), "transparent" in u && t(9, A = u.transparent), "background" in u && t(10, f = u.background); }, n.$$.update = () => { n.$$.dirty & /*highlight, color*/ 4160 && t(11, r = m ? "var(--color-accent)" : b); }, [ a, l, + h, + c, d, - o, - u, - p, + _, m, y, - w, + x, A, f, r, @@ -15307,12 +15307,12 @@ function create_fragment$g(n) { c() { e = element$c("div"), t = element$c("div"), l && l.c(), this.h(); }, - l(d) { - e = claim_element$c(d, "DIV", { class: !0, "aria-label": !0 }); - var o = children$d(e); - t = claim_element$c(o, "DIV", { class: !0 }); - var u = children$d(t); - l && l.l(u), u.forEach(detach$g), o.forEach(detach$g), this.h(); + l(h) { + e = claim_element$c(h, "DIV", { class: !0, "aria-label": !0 }); + var c = children$d(e); + t = claim_element$c(c, "DIV", { class: !0 }); + var d = children$d(t); + l && l.l(d), d.forEach(detach$g), c.forEach(detach$g), this.h(); }, h() { attr$c(t, "class", "icon svelte-3w3rth"), attr$c(e, "class", "empty svelte-3w3rth"), attr$c(e, "aria-label", "Empty value"), toggle_class$9( @@ -15337,84 +15337,84 @@ function create_fragment$g(n) { n[3] ); }, - m(d, o) { - insert_hydration$g(d, e, o), append_hydration$b(e, t), l && l.m(t, null), n[6](e), r = !0; + m(h, c) { + insert_hydration$g(h, e, c), append_hydration$b(e, t), l && l.m(t, null), n[6](e), r = !0; }, - p(d, [o]) { - l && l.p && (!r || o & /*$$scope*/ + p(h, [c]) { + l && l.p && (!r || c & /*$$scope*/ 16) && update_slot_base$6( l, a, - d, + h, /*$$scope*/ - d[4], + h[4], r ? get_slot_changes$6( a, /*$$scope*/ - d[4], - o, + h[4], + c, null ) : get_all_dirty_from_scope$6( /*$$scope*/ - d[4] + h[4] ), null - ), (!r || o & /*size*/ + ), (!r || c & /*size*/ 1) && toggle_class$9( e, "small", /*size*/ - d[0] === "small" - ), (!r || o & /*size*/ + h[0] === "small" + ), (!r || c & /*size*/ 1) && toggle_class$9( e, "large", /*size*/ - d[0] === "large" - ), (!r || o & /*unpadded_box*/ + h[0] === "large" + ), (!r || c & /*unpadded_box*/ 2) && toggle_class$9( e, "unpadded_box", /*unpadded_box*/ - d[1] - ), (!r || o & /*parent_height*/ + h[1] + ), (!r || c & /*parent_height*/ 8) && toggle_class$9( e, "small_parent", /*parent_height*/ - d[3] + h[3] ); }, - i(d) { - r || (transition_in$c(l, d), r = !0); + i(h) { + r || (transition_in$c(l, h), r = !0); }, - o(d) { - transition_out$b(l, d), r = !1; + o(h) { + transition_out$b(l, h), r = !1; }, - d(d) { - d && detach$g(e), l && l.d(d), n[6](null); + d(h) { + h && detach$g(e), l && l.d(h), n[6](null); } }; } function instance$f(n, e, t) { - let r, { $$slots: a = {}, $$scope: l } = e, { size: d = "small" } = e, { unpadded_box: o = !1 } = e, u; - function p(y) { - var w; + let r, { $$slots: a = {}, $$scope: l } = e, { size: h = "small" } = e, { unpadded_box: c = !1 } = e, d; + function _(y) { + var x; if (!y) return !1; - const { height: b } = y.getBoundingClientRect(), { height: A } = ((w = y.parentElement) === null || w === void 0 ? void 0 : w.getBoundingClientRect()) || { height: b }; + const { height: b } = y.getBoundingClientRect(), { height: A } = ((x = y.parentElement) === null || x === void 0 ? void 0 : x.getBoundingClientRect()) || { height: b }; return b > A + 2; } function m(y) { binding_callbacks$4[y ? "unshift" : "push"](() => { - u = y, t(2, u); + d = y, t(2, d); }); } return n.$$set = (y) => { - "size" in y && t(0, d = y.size), "unpadded_box" in y && t(1, o = y.unpadded_box), "$$scope" in y && t(4, l = y.$$scope); + "size" in y && t(0, h = y.size), "unpadded_box" in y && t(1, c = y.unpadded_box), "$$scope" in y && t(4, l = y.$$scope); }, n.$$.update = () => { n.$$.dirty & /*el*/ - 4 && t(3, r = p(u)); - }, [d, o, u, r, l, a, m]; + 4 && t(3, r = _(d)); + }, [h, c, d, r, l, a, m]; } class Empty extends SvelteComponent$g { constructor(e) { @@ -15429,8 +15429,8 @@ function inject(n) { const [r, , a] = t, l = a.trim(); if (e === r) return [l, !1]; - const d = t.index !== void 0 ? t.index + r.length : 0, u = e.substring(d).trim() || !1; - return [l, u]; + const h = t.index !== void 0 ? t.index + r.length : 0, d = e.substring(h).trim() || !1; + return [l, d]; } const { SvelteComponent: SvelteComponent$f, @@ -15524,27 +15524,27 @@ function create_else_block$9(n) { c() { t = text$6(e), r = space$a(), l && l.c(), a = empty$6(); }, - l(d) { - t = claim_text$6(d, e), r = claim_space$a(d), l && l.l(d), a = empty$6(); + l(h) { + t = claim_text$6(h, e), r = claim_space$a(h), l && l.l(h), a = empty$6(); }, - m(d, o) { - insert_hydration$f(d, t, o), insert_hydration$f(d, r, o), l && l.m(d, o), insert_hydration$f(d, a, o); + m(h, c) { + insert_hydration$f(h, t, c), insert_hydration$f(h, r, c), l && l.m(h, c), insert_hydration$f(h, a, c); }, - p(d, o) { - o & /*i18n, type*/ + p(h, c) { + c & /*i18n, type*/ 3 && e !== (e = /*i18n*/ - d[1]( + h[1]( /*defs*/ - d[7][ + h[7][ /*type*/ - d[0] + h[0] ] || /*defs*/ - d[7].file + h[7].file ) + "") && set_data$5(t, e), /*mode*/ - d[3] !== "short" ? l ? l.p(d, o) : (l = create_if_block_3$2(d), l.c(), l.m(a.parentNode, a)) : l && (l.d(1), l = null); + h[3] !== "short" ? l ? l.p(h, c) : (l = create_if_block_3$2(h), l.c(), l.m(a.parentNode, a)) : l && (l.d(1), l = null); }, - d(d) { - d && (detach$f(t), detach$f(r), detach$f(a)), l && l.d(d); + d(h) { + h && (detach$f(t), detach$f(r), detach$f(a)), l && l.d(h); } }; } @@ -15563,13 +15563,13 @@ function create_if_block$b(n) { l(l) { r && r.l(l), e = claim_space$a(l), a && a.l(l), t = empty$6(); }, - m(l, d) { - r && r.m(l, d), insert_hydration$f(l, e, d), a && a.m(l, d), insert_hydration$f(l, t, d); + m(l, h) { + r && r.m(l, h), insert_hydration$f(l, e, h), a && a.m(l, h), insert_hydration$f(l, t, h); }, - p(l, d) { + p(l, h) { /*heading*/ - l[6] ? r ? r.p(l, d) : (r = create_if_block_2$4(l), r.c(), r.m(e.parentNode, e)) : r && (r.d(1), r = null), /*paragraph*/ - l[5] ? a ? a.p(l, d) : (a = create_if_block_1$9(l), a.c(), a.m(t.parentNode, t)) : a && (a.d(1), a = null); + l[6] ? r ? r.p(l, h) : (r = create_if_block_2$4(l), r.c(), r.m(e.parentNode, e)) : r && (r.d(1), r = null), /*paragraph*/ + l[5] ? a ? a.p(l, h) : (a = create_if_block_1$9(l), a.c(), a.m(t.parentNode, t)) : a && (a.d(1), a = null); }, d(l) { l && (detach$f(e), detach$f(t)), r && r.d(l), a && a.d(l); @@ -15580,36 +15580,36 @@ function create_if_block_3$2(n) { let e, t, r = ( /*i18n*/ n[1]("common.or") + "" - ), a, l, d, o = ( + ), a, l, h, c = ( /*message*/ (n[2] || /*i18n*/ n[1]("upload_text.click_to_upload")) + "" - ), u; + ), d; return { c() { - e = element$b("span"), t = text$6("- "), a = text$6(r), l = text$6(" -"), d = space$a(), u = text$6(o), this.h(); + e = element$b("span"), t = text$6("- "), a = text$6(r), l = text$6(" -"), h = space$a(), d = text$6(c), this.h(); }, - l(p) { - e = claim_element$b(p, "SPAN", { class: !0 }); + l(_) { + e = claim_element$b(_, "SPAN", { class: !0 }); var m = children$c(e); - t = claim_text$6(m, "- "), a = claim_text$6(m, r), l = claim_text$6(m, " -"), m.forEach(detach$f), d = claim_space$a(p), u = claim_text$6(p, o), this.h(); + t = claim_text$6(m, "- "), a = claim_text$6(m, r), l = claim_text$6(m, " -"), m.forEach(detach$f), h = claim_space$a(_), d = claim_text$6(_, c), this.h(); }, h() { attr$b(e, "class", "or svelte-1xg7h5n"); }, - m(p, m) { - insert_hydration$f(p, e, m), append_hydration$a(e, t), append_hydration$a(e, a), append_hydration$a(e, l), insert_hydration$f(p, d, m), insert_hydration$f(p, u, m); + m(_, m) { + insert_hydration$f(_, e, m), append_hydration$a(e, t), append_hydration$a(e, a), append_hydration$a(e, l), insert_hydration$f(_, h, m), insert_hydration$f(_, d, m); }, - p(p, m) { + p(_, m) { m & /*i18n*/ 2 && r !== (r = /*i18n*/ - p[1]("common.or") + "") && set_data$5(a, r), m & /*message, i18n*/ - 6 && o !== (o = /*message*/ - (p[2] || /*i18n*/ - p[1]("upload_text.click_to_upload")) + "") && set_data$5(u, o); + _[1]("common.or") + "") && set_data$5(a, r), m & /*message, i18n*/ + 6 && c !== (c = /*message*/ + (_[2] || /*i18n*/ + _[1]("upload_text.click_to_upload")) + "") && set_data$5(d, c); }, - d(p) { - p && (detach$f(e), detach$f(d), detach$f(u)); + d(_) { + _ && (detach$f(e), detach$f(h), detach$f(d)); } }; } @@ -15688,15 +15688,15 @@ function create_if_block_1$9(n) { }; } function create_fragment$f(n) { - let e, t, r, a, l, d; - const o = [create_if_block_4$2, create_else_block_1$1], u = []; - function p(b, A) { + let e, t, r, a, l, h; + const c = [create_if_block_4$2, create_else_block_1$1], d = []; + function _(b, A) { return ( /*type*/ b[0] === "clipboard" ? 0 : 1 ); } - r = p(n), a = u[r] = o[r](n); + r = _(n), a = d[r] = c[r](n); function m(b, A) { return ( /*heading*/ @@ -15704,17 +15704,17 @@ function create_fragment$f(n) { b[5] ? create_if_block$b : create_else_block$9 ); } - let y = m(n), w = y(n); + let y = m(n), x = y(n); return { c() { - e = element$b("div"), t = element$b("span"), a.c(), l = space$a(), w.c(), this.h(); + e = element$b("div"), t = element$b("span"), a.c(), l = space$a(), x.c(), this.h(); }, l(b) { e = claim_element$b(b, "DIV", { class: !0 }); var A = children$c(e); t = claim_element$b(A, "SPAN", { class: !0 }); var f = children$c(t); - a.l(f), f.forEach(detach$f), l = claim_space$a(A), w.l(A), A.forEach(detach$f), this.h(); + a.l(f), f.forEach(detach$f), l = claim_space$a(A), x.l(A), A.forEach(detach$f), this.h(); }, h() { attr$b(t, "class", "icon-wrap svelte-1xg7h5n"), toggle_class$8( @@ -15725,33 +15725,33 @@ function create_fragment$f(n) { ), attr$b(e, "class", "wrap svelte-1xg7h5n"); }, m(b, A) { - insert_hydration$f(b, e, A), append_hydration$a(e, t), u[r].m(t, null), append_hydration$a(e, l), w.m(e, null), d = !0; + insert_hydration$f(b, e, A), append_hydration$a(e, t), d[r].m(t, null), append_hydration$a(e, l), x.m(e, null), h = !0; }, p(b, [A]) { let f = r; - r = p(b), r !== f && (group_outros$9(), transition_out$a(u[f], 1, 1, () => { - u[f] = null; - }), check_outros$9(), a = u[r], a || (a = u[r] = o[r](b), a.c()), transition_in$b(a, 1), a.m(t, null)), (!d || A & /*hovered*/ + r = _(b), r !== f && (group_outros$9(), transition_out$a(d[f], 1, 1, () => { + d[f] = null; + }), check_outros$9(), a = d[r], a || (a = d[r] = c[r](b), a.c()), transition_in$b(a, 1), a.m(t, null)), (!h || A & /*hovered*/ 16) && toggle_class$8( t, "hovered", /*hovered*/ b[4] - ), y === (y = m(b)) && w ? w.p(b, A) : (w.d(1), w = y(b), w && (w.c(), w.m(e, null))); + ), y === (y = m(b)) && x ? x.p(b, A) : (x.d(1), x = y(b), x && (x.c(), x.m(e, null))); }, i(b) { - d || (transition_in$b(a), d = !0); + h || (transition_in$b(a), h = !0); }, o(b) { - transition_out$a(a), d = !1; + transition_out$a(a), h = !1; }, d(b) { - b && detach$f(e), u[r].d(), w.d(); + b && detach$f(e), d[r].d(), x.d(); } }; } function instance$e(n, e, t) { - let r, a, { type: l = "file" } = e, { i18n: d } = e, { message: o = void 0 } = e, { mode: u = "full" } = e, { hovered: p = !1 } = e, { placeholder: m = void 0 } = e; + let r, a, { type: l = "file" } = e, { i18n: h } = e, { message: c = void 0 } = e, { mode: d = "full" } = e, { hovered: _ = !1 } = e, { placeholder: m = void 0 } = e; const y = { image: "upload_text.drop_image", video: "upload_text.drop_video", @@ -15761,12 +15761,12 @@ function instance$e(n, e, t) { gallery: "upload_text.drop_gallery", clipboard: "upload_text.paste_clipboard" }; - return n.$$set = (w) => { - "type" in w && t(0, l = w.type), "i18n" in w && t(1, d = w.i18n), "message" in w && t(2, o = w.message), "mode" in w && t(3, u = w.mode), "hovered" in w && t(4, p = w.hovered), "placeholder" in w && t(8, m = w.placeholder); + return n.$$set = (x) => { + "type" in x && t(0, l = x.type), "i18n" in x && t(1, h = x.i18n), "message" in x && t(2, c = x.message), "mode" in x && t(3, d = x.mode), "hovered" in x && t(4, _ = x.hovered), "placeholder" in x && t(8, m = x.placeholder); }, n.$$.update = () => { n.$$.dirty & /*placeholder*/ 256 && t(6, [r, a] = m ? inject(m) : [!1, !1], r, (t(5, a), t(8, m))); - }, [l, d, o, u, p, a, r, y, m]; + }, [l, h, c, d, _, a, r, y, m]; } class UploadText extends SvelteComponent$f { constructor(e) { @@ -15814,56 +15814,56 @@ function create_fragment$e(n) { c() { e = element$a("div"), l && l.c(), this.h(); }, - l(d) { - e = claim_element$a(d, "DIV", { class: !0 }); - var o = children$b(e); - l && l.l(o), o.forEach(detach$e), this.h(); + l(h) { + e = claim_element$a(h, "DIV", { class: !0 }); + var c = children$b(e); + l && l.l(c), c.forEach(detach$e), this.h(); }, h() { attr$a(e, "class", t = null_to_empty$1(`icon-button-wrapper ${/*top_panel*/ n[0] ? "top-panel" : ""}`) + " svelte-171ybii"); }, - m(d, o) { - insert_hydration$e(d, e, o), l && l.m(e, null), r = !0; + m(h, c) { + insert_hydration$e(h, e, c), l && l.m(e, null), r = !0; }, - p(d, [o]) { - l && l.p && (!r || o & /*$$scope*/ + p(h, [c]) { + l && l.p && (!r || c & /*$$scope*/ 2) && update_slot_base$5( l, a, - d, + h, /*$$scope*/ - d[1], + h[1], r ? get_slot_changes$5( a, /*$$scope*/ - d[1], - o, + h[1], + c, null ) : get_all_dirty_from_scope$5( /*$$scope*/ - d[1] + h[1] ), null - ), (!r || o & /*top_panel*/ + ), (!r || c & /*top_panel*/ 1 && t !== (t = null_to_empty$1(`icon-button-wrapper ${/*top_panel*/ - d[0] ? "top-panel" : ""}`) + " svelte-171ybii")) && attr$a(e, "class", t); + h[0] ? "top-panel" : ""}`) + " svelte-171ybii")) && attr$a(e, "class", t); }, - i(d) { - r || (transition_in$a(l, d), r = !0); + i(h) { + r || (transition_in$a(l, h), r = !0); }, - o(d) { - transition_out$9(l, d), r = !1; + o(h) { + transition_out$9(l, h), r = !1; }, - d(d) { - d && detach$e(e), l && l.d(d); + d(h) { + h && detach$e(e), l && l.d(h); } }; } function instance$d(n, e, t) { let { $$slots: r = {}, $$scope: a } = e, { top_panel: l = !0 } = e; - return n.$$set = (d) => { - "top_panel" in d && t(0, l = d.top_panel), "$$scope" in d && t(1, a = d.$$scope); + return n.$$set = (h) => { + "top_panel" in h && t(0, l = h.top_panel), "$$scope" in h && t(1, a = h.$$scope); }, [l, a, r]; } class IconButtonWrapper extends SvelteComponent$e { @@ -15929,17 +15929,17 @@ const { } = window.__gradio__svelte__internal, { createEventDispatcher: createEventDispatcher$7 } = window.__gradio__svelte__internal; function create_else_block_1(n) { let e, t, r, a, l; - const d = ( + const h = ( /*#slots*/ n[8].default - ), o = create_slot$4( - d, + ), c = create_slot$4( + h, n, /*$$scope*/ n[7], null ); - let u = [ + let d = [ { class: "download-link" }, { href: ( /*href*/ @@ -15955,12 +15955,12 @@ function create_else_block_1(n) { ) }, /*$$restProps*/ n[6] - ], p = {}; - for (let m = 0; m < u.length; m += 1) - p = assign$1(p, u[m]); + ], _ = {}; + for (let m = 0; m < d.length; m += 1) + _ = assign$1(_, d[m]); return { c() { - e = element$9("a"), o && o.c(), this.h(); + e = element$9("a"), c && c.c(), this.h(); }, l(m) { e = claim_element$9(m, "A", { @@ -15971,13 +15971,13 @@ function create_else_block_1(n) { download: !0 }); var y = children$a(e); - o && o.l(y), y.forEach(detach$d), this.h(); + c && c.l(y), y.forEach(detach$d), this.h(); }, h() { - set_attributes(e, p), set_style$6(e, "position", "relative"), toggle_class$7(e, "svelte-151nsdd", !0); + set_attributes(e, _), set_style$6(e, "position", "relative"), toggle_class$7(e, "svelte-151nsdd", !0); }, m(m, y) { - insert_hydration$d(m, e, y), o && o.m(e, null), r = !0, a || (l = listen$4( + insert_hydration$d(m, e, y), c && c.m(e, null), r = !0, a || (l = listen$4( e, "click", /*dispatch*/ @@ -15985,15 +15985,15 @@ function create_else_block_1(n) { ), a = !0); }, p(m, y) { - o && o.p && (!r || y & /*$$scope*/ + c && c.p && (!r || y & /*$$scope*/ 128) && update_slot_base$4( - o, - d, + c, + h, m, /*$$scope*/ m[7], r ? get_slot_changes$4( - d, + h, /*$$scope*/ m[7], y, @@ -16003,7 +16003,7 @@ function create_else_block_1(n) { m[7] ), null - ), set_attributes(e, p = get_spread_update$1(u, [ + ), set_attributes(e, _ = get_spread_update$1(d, [ { class: "download-link" }, (!r || y & /*href*/ 1) && { href: ( @@ -16023,49 +16023,49 @@ function create_else_block_1(n) { ])), set_style$6(e, "position", "relative"), toggle_class$7(e, "svelte-151nsdd", !0); }, i(m) { - r || (transition_in$9(o, m), r = !0); + r || (transition_in$9(c, m), r = !0); }, o(m) { - transition_out$8(o, m), r = !1; + transition_out$8(c, m), r = !1; }, d(m) { - m && detach$d(e), o && o.d(m), a = !1, l(); + m && detach$d(e), c && c.d(m), a = !1, l(); } }; } function create_if_block$a(n) { let e, t, r, a; - const l = [create_if_block_1$8, create_else_block$8], d = []; - function o(u, p) { + const l = [create_if_block_1$8, create_else_block$8], h = []; + function c(d, _) { return ( /*is_downloading*/ - u[2] ? 0 : 1 + d[2] ? 0 : 1 ); } - return e = o(n), t = d[e] = l[e](n), { + return e = c(n), t = h[e] = l[e](n), { c() { t.c(), r = empty$5(); }, - l(u) { - t.l(u), r = empty$5(); + l(d) { + t.l(d), r = empty$5(); }, - m(u, p) { - d[e].m(u, p), insert_hydration$d(u, r, p), a = !0; + m(d, _) { + h[e].m(d, _), insert_hydration$d(d, r, _), a = !0; }, - p(u, p) { + p(d, _) { let m = e; - e = o(u), e === m ? d[e].p(u, p) : (group_outros$8(), transition_out$8(d[m], 1, 1, () => { - d[m] = null; - }), check_outros$8(), t = d[e], t ? t.p(u, p) : (t = d[e] = l[e](u), t.c()), transition_in$9(t, 1), t.m(r.parentNode, r)); + e = c(d), e === m ? h[e].p(d, _) : (group_outros$8(), transition_out$8(h[m], 1, 1, () => { + h[m] = null; + }), check_outros$8(), t = h[e], t ? t.p(d, _) : (t = h[e] = l[e](d), t.c()), transition_in$9(t, 1), t.m(r.parentNode, r)); }, - i(u) { + i(d) { a || (transition_in$9(t), a = !0); }, - o(u) { + o(d) { transition_out$8(t), a = !1; }, - d(u) { - u && detach$d(r), d[e].d(u); + d(d) { + d && detach$d(r), h[e].d(d); } }; } @@ -16074,79 +16074,79 @@ function create_else_block$8(n) { const l = ( /*#slots*/ n[8].default - ), d = create_slot$4( + ), h = create_slot$4( l, n, /*$$scope*/ n[7], null ); - let o = [ + let c = [ /*$$restProps*/ n[6], { href: ( /*href*/ n[0] ) } - ], u = {}; - for (let p = 0; p < o.length; p += 1) - u = assign$1(u, o[p]); + ], d = {}; + for (let _ = 0; _ < c.length; _ += 1) + d = assign$1(d, c[_]); return { c() { - e = element$9("a"), d && d.c(), this.h(); + e = element$9("a"), h && h.c(), this.h(); }, - l(p) { - e = claim_element$9(p, "A", { href: !0 }); + l(_) { + e = claim_element$9(_, "A", { href: !0 }); var m = children$a(e); - d && d.l(m), m.forEach(detach$d), this.h(); + h && h.l(m), m.forEach(detach$d), this.h(); }, h() { - set_attributes(e, u), toggle_class$7(e, "svelte-151nsdd", !0); + set_attributes(e, d), toggle_class$7(e, "svelte-151nsdd", !0); }, - m(p, m) { - insert_hydration$d(p, e, m), d && d.m(e, null), t = !0, r || (a = listen$4(e, "click", prevent_default$1( + m(_, m) { + insert_hydration$d(_, e, m), h && h.m(e, null), t = !0, r || (a = listen$4(e, "click", prevent_default$1( /*wasm_click_handler*/ n[5] )), r = !0); }, - p(p, m) { - d && d.p && (!t || m & /*$$scope*/ + p(_, m) { + h && h.p && (!t || m & /*$$scope*/ 128) && update_slot_base$4( - d, + h, l, - p, + _, /*$$scope*/ - p[7], + _[7], t ? get_slot_changes$4( l, /*$$scope*/ - p[7], + _[7], m, null ) : get_all_dirty_from_scope$4( /*$$scope*/ - p[7] + _[7] ), null - ), set_attributes(e, u = get_spread_update$1(o, [ + ), set_attributes(e, d = get_spread_update$1(c, [ m & /*$$restProps*/ 64 && /*$$restProps*/ - p[6], + _[6], (!t || m & /*href*/ 1) && { href: ( /*href*/ - p[0] + _[0] ) } ])), toggle_class$7(e, "svelte-151nsdd", !0); }, - i(p) { - t || (transition_in$9(d, p), t = !0); + i(_) { + t || (transition_in$9(h, _), t = !0); }, - o(p) { - transition_out$8(d, p), t = !1; + o(_) { + transition_out$8(h, _), t = !1; }, - d(p) { - p && detach$d(e), d && d.d(p), r = !1, a(); + d(_) { + _ && detach$d(e), h && h.d(_), r = !1, a(); } }; } @@ -16206,86 +16206,86 @@ function create_if_block_1$8(n) { } function create_fragment$d(n) { let e, t, r, a, l; - const d = [create_if_block$a, create_else_block_1], o = []; - function u(p, m) { + const h = [create_if_block$a, create_else_block_1], c = []; + function d(_, m) { return m & /*href*/ 1 && (e = null), e == null && (e = !!/*worker_proxy*/ - (p[4] && should_proxy_wasm_src( + (_[4] && should_proxy_wasm_src( /*href*/ - p[0] + _[0] ))), e ? 0 : 1; } - return t = u(n, -1), r = o[t] = d[t](n), { + return t = d(n, -1), r = c[t] = h[t](n), { c() { r.c(), a = empty$5(); }, - l(p) { - r.l(p), a = empty$5(); + l(_) { + r.l(_), a = empty$5(); }, - m(p, m) { - o[t].m(p, m), insert_hydration$d(p, a, m), l = !0; + m(_, m) { + c[t].m(_, m), insert_hydration$d(_, a, m), l = !0; }, - p(p, [m]) { + p(_, [m]) { let y = t; - t = u(p, m), t === y ? o[t].p(p, m) : (group_outros$8(), transition_out$8(o[y], 1, 1, () => { - o[y] = null; - }), check_outros$8(), r = o[t], r ? r.p(p, m) : (r = o[t] = d[t](p), r.c()), transition_in$9(r, 1), r.m(a.parentNode, a)); + t = d(_, m), t === y ? c[t].p(_, m) : (group_outros$8(), transition_out$8(c[y], 1, 1, () => { + c[y] = null; + }), check_outros$8(), r = c[t], r ? r.p(_, m) : (r = c[t] = h[t](_), r.c()), transition_in$9(r, 1), r.m(a.parentNode, a)); }, - i(p) { + i(_) { l || (transition_in$9(r), l = !0); }, - o(p) { + o(_) { transition_out$8(r), l = !1; }, - d(p) { - p && detach$d(a), o[t].d(p); + d(_) { + _ && detach$d(a), c[t].d(_); } }; } function instance$c(n, e, t) { const r = ["href", "download"]; - let a = compute_rest_props(e, r), { $$slots: l = {}, $$scope: d } = e; - var o = this && this.__awaiter || function(A, f, s, h) { - function _(g) { - return g instanceof s ? g : new s(function(x) { - x(g); + let a = compute_rest_props(e, r), { $$slots: l = {}, $$scope: h } = e; + var c = this && this.__awaiter || function(A, f, s, u) { + function p(g) { + return g instanceof s ? g : new s(function(w) { + w(g); }); } - return new (s || (s = Promise))(function(g, x) { - function c(E) { + return new (s || (s = Promise))(function(g, w) { + function o(E) { try { - M(h.next(E)); + M(u.next(E)); } catch ($) { - x($); + w($); } } function v(E) { try { - M(h.throw(E)); + M(u.throw(E)); } catch ($) { - x($); + w($); } } function M(E) { - E.done ? g(E.value) : _(E.value).then(c, v); + E.done ? g(E.value) : p(E.value).then(o, v); } - M((h = h.apply(A, f || [])).next()); + M((u = u.apply(A, f || [])).next()); }); }; - let { href: u = void 0 } = e, { download: p } = e; + let { href: d = void 0 } = e, { download: _ } = e; const m = createEventDispatcher$7(); let y = !1; - const w = getWorkerProxyContext(); + const x = getWorkerProxyContext(); function b() { - return o(this, void 0, void 0, function* () { + return c(this, void 0, void 0, function* () { if (y) return; - if (m("click"), u == null) + if (m("click"), d == null) throw new Error("href is not defined."); - if (w == null) + if (x == null) throw new Error("Wasm worker proxy is not available."); - const f = new URL(u, window.location.href).pathname; - t(2, y = !0), w.httpRequest({ + const f = new URL(d, window.location.href).pathname; + t(2, y = !0), x.httpRequest({ method: "GET", path: f, headers: {}, @@ -16293,29 +16293,29 @@ function instance$c(n, e, t) { }).then((s) => { if (s.status !== 200) throw new Error(`Failed to get file ${f} from the Wasm worker.`); - const h = new Blob( + const u = new Blob( [s.body], { type: getHeaderValue(s.headers, "content-type") } - ), _ = URL.createObjectURL(h), g = document.createElement("a"); - g.href = _, g.download = p, g.click(), URL.revokeObjectURL(_); + ), p = URL.createObjectURL(u), g = document.createElement("a"); + g.href = p, g.download = _, g.click(), URL.revokeObjectURL(p); }).finally(() => { t(2, y = !1); }); }); } return n.$$set = (A) => { - e = assign$1(assign$1({}, e), exclude_internal_props(A)), t(6, a = compute_rest_props(e, r)), "href" in A && t(0, u = A.href), "download" in A && t(1, p = A.download), "$$scope" in A && t(7, d = A.$$scope); + e = assign$1(assign$1({}, e), exclude_internal_props(A)), t(6, a = compute_rest_props(e, r)), "href" in A && t(0, d = A.href), "download" in A && t(1, _ = A.download), "$$scope" in A && t(7, h = A.$$scope); }, [ - u, - p, + d, + _, y, m, - w, + x, b, a, - d, + h, l ]; } @@ -16474,7 +16474,7 @@ function create_default_slot$4(n) { } function create_if_block$9(n) { let e, t, r = "×", a, l; - function d() { + function h() { return ( /*click_handler*/ n[7]( @@ -16483,13 +16483,13 @@ function create_if_block$9(n) { ) ); } - function o(...u) { + function c(...d) { return ( /*keydown_handler*/ n[8]( /*i*/ n[13], - ...u + ...d ) ); } @@ -16497,29 +16497,29 @@ function create_if_block$9(n) { c() { e = element$8("td"), t = element$8("button"), t.textContent = r, this.h(); }, - l(u) { - e = claim_element$8(u, "TD", { class: !0 }); - var p = children$9(e); - t = claim_element$8(p, "BUTTON", { + l(d) { + e = claim_element$8(d, "TD", { class: !0 }); + var _ = children$9(e); + t = claim_element$8(_, "BUTTON", { class: !0, "aria-label": !0, "data-svelte-h": !0 - }), get_svelte_dataset$3(t) !== "svelte-nhtord" && (t.textContent = r), p.forEach(detach$c), this.h(); + }), get_svelte_dataset$3(t) !== "svelte-nhtord" && (t.textContent = r), _.forEach(detach$c), this.h(); }, h() { attr$9(t, "class", "label-clear-button svelte-1g4vug2"), attr$9(t, "aria-label", "Remove this file"), attr$9(e, "class", "svelte-1g4vug2"); }, - m(u, p) { - insert_hydration$c(u, e, p), append_hydration$9(e, t), a || (l = [ - listen$3(t, "click", d), - listen$3(t, "keydown", o) + m(d, _) { + insert_hydration$c(d, e, _), append_hydration$9(e, t), a || (l = [ + listen$3(t, "click", h), + listen$3(t, "keydown", c) ], a = !0); }, - p(u, p) { - n = u; + p(d, _) { + n = d; }, - d(u) { - u && detach$c(e), a = !1, run_all$3(l); + d(d) { + d && detach$c(e), a = !1, run_all$3(l); } }; } @@ -16527,18 +16527,18 @@ function create_each_block$3(n, e) { let t, r, a, l = ( /*file*/ e[11].filename_stem + "" - ), d, o, u, p = ( + ), h, c, d, _ = ( /*file*/ e[11].filename_ext + "" - ), m, y, w, b, A, f, s, h, _, g, x; - const c = [create_if_block_1$7, create_else_block$7], v = []; + ), m, y, x, b, A, f, s, u, p, g, w; + const o = [create_if_block_1$7, create_else_block$7], v = []; function M(k, L) { return ( /*file*/ k[11].url ? 0 : 1 ); } - A = M(e), f = v[A] = c[A](e); + A = M(e), f = v[A] = o[A](e); let E = ( /*normalized_files*/ e[3].length > 1 && create_if_block$9(e) @@ -16557,7 +16557,7 @@ function create_each_block$3(n, e) { key: n, first: null, c() { - t = element$8("tr"), r = element$8("td"), a = element$8("span"), d = text$5(l), o = space$9(), u = element$8("span"), m = text$5(p), w = space$9(), b = element$8("td"), f.c(), s = space$9(), E && E.c(), h = space$9(), this.h(); + t = element$8("tr"), r = element$8("td"), a = element$8("span"), h = text$5(l), c = space$9(), d = element$8("span"), m = text$5(_), x = space$9(), b = element$8("td"), f.c(), s = space$9(), E && E.c(), u = space$9(), this.h(); }, l(k) { t = claim_element$8(k, "TR", { class: !0 }); @@ -16566,14 +16566,14 @@ function create_each_block$3(n, e) { var z = children$9(r); a = claim_element$8(z, "SPAN", { class: !0 }); var O = children$9(a); - d = claim_text$5(O, l), O.forEach(detach$c), o = claim_space$9(z), u = claim_element$8(z, "SPAN", { class: !0 }); - var R = children$9(u); - m = claim_text$5(R, p), R.forEach(detach$c), z.forEach(detach$c), w = claim_space$9(L), b = claim_element$8(L, "TD", { class: !0 }); - var P = children$9(b); - f.l(P), P.forEach(detach$c), s = claim_space$9(L), E && E.l(L), h = claim_space$9(L), L.forEach(detach$c), this.h(); + h = claim_text$5(O, l), O.forEach(detach$c), c = claim_space$9(z), d = claim_element$8(z, "SPAN", { class: !0 }); + var R = children$9(d); + m = claim_text$5(R, _), R.forEach(detach$c), z.forEach(detach$c), x = claim_space$9(L), b = claim_element$8(L, "TD", { class: !0 }); + var N = children$9(b); + f.l(N), N.forEach(detach$c), s = claim_space$9(L), E && E.l(L), u = claim_space$9(L), L.forEach(detach$c), this.h(); }, h() { - attr$9(a, "class", "stem svelte-1g4vug2"), attr$9(u, "class", "ext svelte-1g4vug2"), attr$9(r, "class", "filename svelte-1g4vug2"), attr$9(r, "aria-label", y = /*file*/ + attr$9(a, "class", "stem svelte-1g4vug2"), attr$9(d, "class", "ext svelte-1g4vug2"), attr$9(r, "class", "filename svelte-1g4vug2"), attr$9(r, "aria-label", y = /*file*/ e[11].orig_name), attr$9(b, "class", "download svelte-1g4vug2"), attr$9(t, "class", "file svelte-1g4vug2"), toggle_class$6( t, "selectable", @@ -16582,21 +16582,21 @@ function create_each_block$3(n, e) { ), this.first = t; }, m(k, L) { - insert_hydration$c(k, t, L), append_hydration$9(t, r), append_hydration$9(r, a), append_hydration$9(a, d), append_hydration$9(r, o), append_hydration$9(r, u), append_hydration$9(u, m), append_hydration$9(t, w), append_hydration$9(t, b), v[A].m(b, null), append_hydration$9(t, s), E && E.m(t, null), append_hydration$9(t, h), _ = !0, g || (x = listen$3(t, "click", $), g = !0); + insert_hydration$c(k, t, L), append_hydration$9(t, r), append_hydration$9(r, a), append_hydration$9(a, h), append_hydration$9(r, c), append_hydration$9(r, d), append_hydration$9(d, m), append_hydration$9(t, x), append_hydration$9(t, b), v[A].m(b, null), append_hydration$9(t, s), E && E.m(t, null), append_hydration$9(t, u), p = !0, g || (w = listen$3(t, "click", $), g = !0); }, p(k, L) { - e = k, (!_ || L & /*normalized_files*/ + e = k, (!p || L & /*normalized_files*/ 8) && l !== (l = /*file*/ - e[11].filename_stem + "") && set_data$4(d, l), (!_ || L & /*normalized_files*/ - 8) && p !== (p = /*file*/ - e[11].filename_ext + "") && set_data$4(m, p), (!_ || L & /*normalized_files*/ + e[11].filename_stem + "") && set_data$4(h, l), (!p || L & /*normalized_files*/ + 8) && _ !== (_ = /*file*/ + e[11].filename_ext + "") && set_data$4(m, _), (!p || L & /*normalized_files*/ 8 && y !== (y = /*file*/ e[11].orig_name)) && attr$9(r, "aria-label", y); let z = A; A = M(e), A === z ? v[A].p(e, L) : (group_outros$7(), transition_out$7(v[z], 1, 1, () => { v[z] = null; - }), check_outros$7(), f = v[A], f ? f.p(e, L) : (f = v[A] = c[A](e), f.c()), transition_in$8(f, 1), f.m(b, null)), /*normalized_files*/ - e[3].length > 1 ? E ? E.p(e, L) : (E = create_if_block$9(e), E.c(), E.m(t, h)) : E && (E.d(1), E = null), (!_ || L & /*selectable*/ + }), check_outros$7(), f = v[A], f ? f.p(e, L) : (f = v[A] = o[A](e), f.c()), transition_in$8(f, 1), f.m(b, null)), /*normalized_files*/ + e[3].length > 1 ? E ? E.p(e, L) : (E = create_if_block$9(e), E.c(), E.m(t, u)) : E && (E.d(1), E = null), (!p || L & /*selectable*/ 1) && toggle_class$6( t, "selectable", @@ -16605,46 +16605,46 @@ function create_each_block$3(n, e) { ); }, i(k) { - _ || (transition_in$8(f), _ = !0); + p || (transition_in$8(f), p = !0); }, o(k) { - transition_out$7(f), _ = !1; + transition_out$7(f), p = !1; }, d(k) { - k && detach$c(t), v[A].d(), E && E.d(), g = !1, x(); + k && detach$c(t), v[A].d(), E && E.d(), g = !1, w(); } }; } function create_fragment$c(n) { - let e, t, r, a = [], l = /* @__PURE__ */ new Map(), d, o = ensure_array_like$3( + let e, t, r, a = [], l = /* @__PURE__ */ new Map(), h, c = ensure_array_like$3( /*normalized_files*/ n[3] ); - const u = (p) => ( + const d = (_) => ( /*file*/ - p[11] + _[11] ); - for (let p = 0; p < o.length; p += 1) { - let m = get_each_context$3(n, o, p), y = u(m); - l.set(y, a[p] = create_each_block$3(y, m)); + for (let _ = 0; _ < c.length; _ += 1) { + let m = get_each_context$3(n, c, _), y = d(m); + l.set(y, a[_] = create_each_block$3(y, m)); } return { c() { e = element$8("div"), t = element$8("table"), r = element$8("tbody"); - for (let p = 0; p < a.length; p += 1) - a[p].c(); + for (let _ = 0; _ < a.length; _ += 1) + a[_].c(); this.h(); }, - l(p) { - e = claim_element$8(p, "DIV", { class: !0, style: !0 }); + l(_) { + e = claim_element$8(_, "DIV", { class: !0, style: !0 }); var m = children$9(e); t = claim_element$8(m, "TABLE", { class: !0 }); var y = children$9(t); r = claim_element$8(y, "TBODY", { class: !0 }); - var w = children$9(r); + var x = children$9(r); for (let b = 0; b < a.length; b += 1) - a[b].l(w); - w.forEach(detach$c), y.forEach(detach$c), m.forEach(detach$c), this.h(); + a[b].l(x); + x.forEach(detach$c), y.forEach(detach$c), m.forEach(detach$c), this.h(); }, h() { attr$9(r, "class", "svelte-1g4vug2"), attr$9(t, "class", "file-preview svelte-1g4vug2"), attr$9(e, "class", "file-preview-holder svelte-1g4vug2"), set_style$5(e, "max-height", typeof /*height*/ @@ -16653,38 +16653,38 @@ function create_fragment$c(n) { n[1] + "px" )); }, - m(p, m) { - insert_hydration$c(p, e, m), append_hydration$9(e, t), append_hydration$9(t, r); + m(_, m) { + insert_hydration$c(_, e, m), append_hydration$9(e, t), append_hydration$9(t, r); for (let y = 0; y < a.length; y += 1) a[y] && a[y].m(r, null); - d = !0; + h = !0; }, - p(p, [m]) { + p(_, [m]) { m & /*selectable, handle_row_click, normalized_files, remove_file, window, i18n*/ - 61 && (o = ensure_array_like$3( + 61 && (c = ensure_array_like$3( /*normalized_files*/ - p[3] - ), group_outros$7(), a = update_keyed_each(a, m, u, 1, p, o, l, r, outro_and_destroy_block, create_each_block$3, null, get_each_context$3), check_outros$7()), (!d || m & /*height*/ + _[3] + ), group_outros$7(), a = update_keyed_each(a, m, d, 1, _, c, l, r, outro_and_destroy_block, create_each_block$3, null, get_each_context$3), check_outros$7()), (!h || m & /*height*/ 2) && set_style$5(e, "max-height", typeof /*height*/ - p[1] === void 0 ? "auto" : ( + _[1] === void 0 ? "auto" : ( /*height*/ - p[1] + "px" + _[1] + "px" )); }, - i(p) { - if (!d) { - for (let m = 0; m < o.length; m += 1) + i(_) { + if (!h) { + for (let m = 0; m < c.length; m += 1) transition_in$8(a[m]); - d = !0; + h = !0; } }, - o(p) { + o(_) { for (let m = 0; m < a.length; m += 1) transition_out$7(a[m]); - d = !1; + h = !1; }, - d(p) { - p && detach$c(e); + d(_) { + _ && detach$c(e); for (let m = 0; m < a.length; m += 1) a[m].d(); } @@ -16697,8 +16697,8 @@ function split_filename(n) { function instance$b(n, e, t) { let r; const a = createEventDispatcher$6(); - let { value: l } = e, { selectable: d = !1 } = e, { height: o = void 0 } = e, { i18n: u } = e; - function p(A, f) { + let { value: l } = e, { selectable: h = !1 } = e, { height: c = void 0 } = e, { i18n: d } = e; + function _(A, f) { const s = A.currentTarget; (A.target === s || // Only select if the click is on the row itself s && s.firstElementChild && A.composedPath().includes(s.firstElementChild)) && a("select", { @@ -16712,30 +16712,30 @@ function instance$b(n, e, t) { } const y = (A) => { m(A); - }, w = (A, f) => { + }, x = (A, f) => { f.key === "Enter" && m(A); }, b = (A, f) => { - p(f, A); + _(f, A); }; return n.$$set = (A) => { - "value" in A && t(6, l = A.value), "selectable" in A && t(0, d = A.selectable), "height" in A && t(1, o = A.height), "i18n" in A && t(2, u = A.i18n); + "value" in A && t(6, l = A.value), "selectable" in A && t(0, h = A.selectable), "height" in A && t(1, c = A.height), "i18n" in A && t(2, d = A.i18n); }, n.$$.update = () => { n.$$.dirty & /*value*/ 64 && t(3, r = (Array.isArray(l) ? l : [l]).map((A) => { var f; - const [s, h] = split_filename((f = A.orig_name) !== null && f !== void 0 ? f : ""); - return Object.assign(Object.assign({}, A), { filename_stem: s, filename_ext: h }); + const [s, u] = split_filename((f = A.orig_name) !== null && f !== void 0 ? f : ""); + return Object.assign(Object.assign({}, A), { filename_stem: s, filename_ext: u }); })); }, [ + h, + c, d, - o, - u, r, - p, + _, m, l, y, - w, + x, b ]; } @@ -16773,7 +16773,7 @@ var _3Dmol$1 = { exports: {} }; /* harmony export */ IOBuffer: () => ( /* binding */ - o + c ) /* harmony export */ }); @@ -16782,9 +16782,9 @@ var _3Dmol$1 = { exports: {} }; "./node_modules/iobuffer/lib-esm/text.browser.js" ); const a = 1024 * 8, l = (() => { - const u = new Uint8Array(4), p = new Uint32Array(u.buffer); - return !((p[0] = 1) & u[0]); - })(), d = { + const d = new Uint8Array(4), _ = new Uint32Array(d.buffer); + return !((_[0] = 1) & d[0]); + })(), h = { int8: globalThis.Int8Array, uint8: globalThis.Uint8Array, int16: globalThis.Int16Array, @@ -16796,7 +16796,7 @@ var _3Dmol$1 = { exports: {} }; float32: globalThis.Float32Array, float64: globalThis.Float64Array }; - class o { + class c { /** * @param data - The data to construct the IOBuffer with. * If data is a number, it will be the new buffer's length
@@ -16805,12 +16805,12 @@ var _3Dmol$1 = { exports: {} }; * or a Node.js Buffer, a view will be created over the underlying ArrayBuffer. * @param options */ - constructor(p = a, m = {}) { + constructor(_ = a, m = {}) { let y = !1; - typeof p == "number" ? p = new ArrayBuffer(p) : (y = !0, this.lastWrittenByte = p.byteLength); - const w = m.offset ? m.offset >>> 0 : 0, b = p.byteLength - w; - let A = w; - (ArrayBuffer.isView(p) || p instanceof o) && (p.byteLength !== p.buffer.byteLength && (A = p.byteOffset + w), p = p.buffer), y ? this.lastWrittenByte = b : this.lastWrittenByte = 0, this.buffer = p, this.length = b, this.byteLength = b, this.byteOffset = A, this.offset = 0, this.littleEndian = !0, this._data = new DataView(this.buffer, A, b), this._mark = 0, this._marks = []; + typeof _ == "number" ? _ = new ArrayBuffer(_) : (y = !0, this.lastWrittenByte = _.byteLength); + const x = m.offset ? m.offset >>> 0 : 0, b = _.byteLength - x; + let A = x; + (ArrayBuffer.isView(_) || _ instanceof c) && (_.byteLength !== _.buffer.byteLength && (A = _.byteOffset + x), _ = _.buffer), y ? this.lastWrittenByte = b : this.lastWrittenByte = 0, this.buffer = _, this.length = b, this.byteLength = b, this.byteOffset = A, this.offset = 0, this.littleEndian = !0, this._data = new DataView(this.buffer, A, b), this._mark = 0, this._marks = []; } /** * Checks if the memory allocated to the buffer is sufficient to store more @@ -16818,8 +16818,8 @@ var _3Dmol$1 = { exports: {} }; * @param byteLength - The needed memory in bytes. * @returns `true` if there is sufficient space and `false` otherwise. */ - available(p = 1) { - return this.offset + p <= this.length; + available(_ = 1) { + return this.offset + _ <= this.length; } /** * Check if little-endian mode is used for reading and writing multi-byte @@ -16852,22 +16852,22 @@ var _3Dmol$1 = { exports: {} }; * Move the pointer n bytes forward. * @param n - Number of bytes to skip. */ - skip(p = 1) { - return this.offset += p, this; + skip(_ = 1) { + return this.offset += _, this; } /** * Move the pointer n bytes backward. * @param n - Number of bytes to move back. */ - back(p = 1) { - return this.offset -= p, this; + back(_ = 1) { + return this.offset -= _, this; } /** * Move the pointer to the given offset. * @param offset */ - seek(p) { - return this.offset = p, this; + seek(_) { + return this.offset = _, this; } /** * Store the current pointer offset. @@ -16896,10 +16896,10 @@ var _3Dmol$1 = { exports: {} }; * @see {@link IOBuffer#pushMark} */ popMark() { - const p = this._marks.pop(); - if (p === void 0) + const _ = this._marks.pop(); + if (_ === void 0) throw new Error("Mark stack empty"); - return this.seek(p), this; + return this.seek(_), this; } /** * Move the pointer offset back to 0. @@ -16914,10 +16914,10 @@ var _3Dmol$1 = { exports: {} }; * buffer (a copy) with a length that is twice (byteLength + current offset). * @param byteLength */ - ensureAvailable(p = 1) { - if (!this.available(p)) { - const y = (this.offset + p) * 2, w = new Uint8Array(y); - w.set(new Uint8Array(this.buffer)), this.buffer = w.buffer, this.length = this.byteLength = y, this._data = new DataView(this.buffer); + ensureAvailable(_ = 1) { + if (!this.available(_)) { + const y = (this.offset + _) * 2, x = new Uint8Array(y); + x.set(new Uint8Array(this.buffer)), this.buffer = x.buffer, this.length = this.byteLength = y, this._data = new DataView(this.buffer); } return this; } @@ -16949,8 +16949,8 @@ var _3Dmol$1 = { exports: {} }; /** * Read `n` bytes and move pointer forward by `n` bytes. */ - readBytes(p = 1) { - return this.readArray(p, "uint8"); + readBytes(_ = 1) { + return this.readArray(_, "uint8"); } /** * Creates an array of corresponding to the type `type` and size `size`. @@ -16958,72 +16958,72 @@ var _3Dmol$1 = { exports: {} }; * @param size - size of the resulting array * @param type - number type of elements to read */ - readArray(p, m) { - const y = d[m].BYTES_PER_ELEMENT * p, w = this.byteOffset + this.offset, b = this.buffer.slice(w, w + y); + readArray(_, m) { + const y = h[m].BYTES_PER_ELEMENT * _, x = this.byteOffset + this.offset, b = this.buffer.slice(x, x + y); if (this.littleEndian === l && m !== "uint8" && m !== "int8") { - const f = new Uint8Array(this.buffer.slice(w, w + y)); + const f = new Uint8Array(this.buffer.slice(x, x + y)); f.reverse(); - const s = new d[m](f.buffer); + const s = new h[m](f.buffer); return this.offset += y, s.reverse(), s; } - const A = new d[m](b); + const A = new h[m](b); return this.offset += y, A; } /** * Read a 16-bit signed integer and move pointer forward by 2 bytes. */ readInt16() { - const p = this._data.getInt16(this.offset, this.littleEndian); - return this.offset += 2, p; + const _ = this._data.getInt16(this.offset, this.littleEndian); + return this.offset += 2, _; } /** * Read a 16-bit unsigned integer and move pointer forward by 2 bytes. */ readUint16() { - const p = this._data.getUint16(this.offset, this.littleEndian); - return this.offset += 2, p; + const _ = this._data.getUint16(this.offset, this.littleEndian); + return this.offset += 2, _; } /** * Read a 32-bit signed integer and move pointer forward by 4 bytes. */ readInt32() { - const p = this._data.getInt32(this.offset, this.littleEndian); - return this.offset += 4, p; + const _ = this._data.getInt32(this.offset, this.littleEndian); + return this.offset += 4, _; } /** * Read a 32-bit unsigned integer and move pointer forward by 4 bytes. */ readUint32() { - const p = this._data.getUint32(this.offset, this.littleEndian); - return this.offset += 4, p; + const _ = this._data.getUint32(this.offset, this.littleEndian); + return this.offset += 4, _; } /** * Read a 32-bit floating number and move pointer forward by 4 bytes. */ readFloat32() { - const p = this._data.getFloat32(this.offset, this.littleEndian); - return this.offset += 4, p; + const _ = this._data.getFloat32(this.offset, this.littleEndian); + return this.offset += 4, _; } /** * Read a 64-bit floating number and move pointer forward by 8 bytes. */ readFloat64() { - const p = this._data.getFloat64(this.offset, this.littleEndian); - return this.offset += 8, p; + const _ = this._data.getFloat64(this.offset, this.littleEndian); + return this.offset += 8, _; } /** * Read a 64-bit signed integer number and move pointer forward by 8 bytes. */ readBigInt64() { - const p = this._data.getBigInt64(this.offset, this.littleEndian); - return this.offset += 8, p; + const _ = this._data.getBigInt64(this.offset, this.littleEndian); + return this.offset += 8, _; } /** * Read a 64-bit unsigned integer number and move pointer forward by 8 bytes. */ readBigUint64() { - const p = this._data.getBigUint64(this.offset, this.littleEndian); - return this.offset += 8, p; + const _ = this._data.getBigUint64(this.offset, this.littleEndian); + return this.offset += 8, _; } /** * Read a 1-byte ASCII character and move pointer forward by 1 byte. @@ -17034,9 +17034,9 @@ var _3Dmol$1 = { exports: {} }; /** * Read `n` 1-byte ASCII characters and move pointer forward by `n` bytes. */ - readChars(p = 1) { + readChars(_ = 1) { let m = ""; - for (let y = 0; y < p; y++) + for (let y = 0; y < _; y++) m += this.readChar(); return m; } @@ -17044,131 +17044,131 @@ var _3Dmol$1 = { exports: {} }; * Read the next `n` bytes, return a UTF-8 decoded string and move pointer * forward by `n` bytes. */ - readUtf8(p = 1) { - return (0, r.decode)(this.readBytes(p)); + readUtf8(_ = 1) { + return (0, r.decode)(this.readBytes(_)); } /** * Read the next `n` bytes, return a string decoded with `encoding` and move pointer * forward by `n` bytes. * If no encoding is passed, the function is equivalent to @see {@link IOBuffer#readUtf8} */ - decodeText(p = 1, m = "utf-8") { - return (0, r.decode)(this.readBytes(p), m); + decodeText(_ = 1, m = "utf-8") { + return (0, r.decode)(this.readBytes(_), m); } /** * Write 0xff if the passed value is truthy, 0x00 otherwise and move pointer * forward by 1 byte. */ - writeBoolean(p) { - return this.writeUint8(p ? 255 : 0), this; + writeBoolean(_) { + return this.writeUint8(_ ? 255 : 0), this; } /** * Write `value` as an 8-bit signed integer and move pointer forward by 1 byte. */ - writeInt8(p) { - return this.ensureAvailable(1), this._data.setInt8(this.offset++, p), this._updateLastWrittenByte(), this; + writeInt8(_) { + return this.ensureAvailable(1), this._data.setInt8(this.offset++, _), this._updateLastWrittenByte(), this; } /** * Write `value` as an 8-bit unsigned integer and move pointer forward by 1 * byte. */ - writeUint8(p) { - return this.ensureAvailable(1), this._data.setUint8(this.offset++, p), this._updateLastWrittenByte(), this; + writeUint8(_) { + return this.ensureAvailable(1), this._data.setUint8(this.offset++, _), this._updateLastWrittenByte(), this; } /** * An alias for {@link IOBuffer#writeUint8}. */ - writeByte(p) { - return this.writeUint8(p); + writeByte(_) { + return this.writeUint8(_); } /** * Write all elements of `bytes` as uint8 values and move pointer forward by * `bytes.length` bytes. */ - writeBytes(p) { - this.ensureAvailable(p.length); - for (let m = 0; m < p.length; m++) - this._data.setUint8(this.offset++, p[m]); + writeBytes(_) { + this.ensureAvailable(_.length); + for (let m = 0; m < _.length; m++) + this._data.setUint8(this.offset++, _[m]); return this._updateLastWrittenByte(), this; } /** * Write `value` as a 16-bit signed integer and move pointer forward by 2 * bytes. */ - writeInt16(p) { - return this.ensureAvailable(2), this._data.setInt16(this.offset, p, this.littleEndian), this.offset += 2, this._updateLastWrittenByte(), this; + writeInt16(_) { + return this.ensureAvailable(2), this._data.setInt16(this.offset, _, this.littleEndian), this.offset += 2, this._updateLastWrittenByte(), this; } /** * Write `value` as a 16-bit unsigned integer and move pointer forward by 2 * bytes. */ - writeUint16(p) { - return this.ensureAvailable(2), this._data.setUint16(this.offset, p, this.littleEndian), this.offset += 2, this._updateLastWrittenByte(), this; + writeUint16(_) { + return this.ensureAvailable(2), this._data.setUint16(this.offset, _, this.littleEndian), this.offset += 2, this._updateLastWrittenByte(), this; } /** * Write `value` as a 32-bit signed integer and move pointer forward by 4 * bytes. */ - writeInt32(p) { - return this.ensureAvailable(4), this._data.setInt32(this.offset, p, this.littleEndian), this.offset += 4, this._updateLastWrittenByte(), this; + writeInt32(_) { + return this.ensureAvailable(4), this._data.setInt32(this.offset, _, this.littleEndian), this.offset += 4, this._updateLastWrittenByte(), this; } /** * Write `value` as a 32-bit unsigned integer and move pointer forward by 4 * bytes. */ - writeUint32(p) { - return this.ensureAvailable(4), this._data.setUint32(this.offset, p, this.littleEndian), this.offset += 4, this._updateLastWrittenByte(), this; + writeUint32(_) { + return this.ensureAvailable(4), this._data.setUint32(this.offset, _, this.littleEndian), this.offset += 4, this._updateLastWrittenByte(), this; } /** * Write `value` as a 32-bit floating number and move pointer forward by 4 * bytes. */ - writeFloat32(p) { - return this.ensureAvailable(4), this._data.setFloat32(this.offset, p, this.littleEndian), this.offset += 4, this._updateLastWrittenByte(), this; + writeFloat32(_) { + return this.ensureAvailable(4), this._data.setFloat32(this.offset, _, this.littleEndian), this.offset += 4, this._updateLastWrittenByte(), this; } /** * Write `value` as a 64-bit floating number and move pointer forward by 8 * bytes. */ - writeFloat64(p) { - return this.ensureAvailable(8), this._data.setFloat64(this.offset, p, this.littleEndian), this.offset += 8, this._updateLastWrittenByte(), this; + writeFloat64(_) { + return this.ensureAvailable(8), this._data.setFloat64(this.offset, _, this.littleEndian), this.offset += 8, this._updateLastWrittenByte(), this; } /** * Write `value` as a 64-bit signed bigint and move pointer forward by 8 * bytes. */ - writeBigInt64(p) { - return this.ensureAvailable(8), this._data.setBigInt64(this.offset, p, this.littleEndian), this.offset += 8, this._updateLastWrittenByte(), this; + writeBigInt64(_) { + return this.ensureAvailable(8), this._data.setBigInt64(this.offset, _, this.littleEndian), this.offset += 8, this._updateLastWrittenByte(), this; } /** * Write `value` as a 64-bit unsigned bigint and move pointer forward by 8 * bytes. */ - writeBigUint64(p) { - return this.ensureAvailable(8), this._data.setBigUint64(this.offset, p, this.littleEndian), this.offset += 8, this._updateLastWrittenByte(), this; + writeBigUint64(_) { + return this.ensureAvailable(8), this._data.setBigUint64(this.offset, _, this.littleEndian), this.offset += 8, this._updateLastWrittenByte(), this; } /** * Write the charCode of `str`'s first character as an 8-bit unsigned integer * and move pointer forward by 1 byte. */ - writeChar(p) { - return this.writeUint8(p.charCodeAt(0)); + writeChar(_) { + return this.writeUint8(_.charCodeAt(0)); } /** * Write the charCodes of all `str`'s characters as 8-bit unsigned integers * and move pointer forward by `str.length` bytes. */ - writeChars(p) { - for (let m = 0; m < p.length; m++) - this.writeUint8(p.charCodeAt(m)); + writeChars(_) { + for (let m = 0; m < _.length; m++) + this.writeUint8(_.charCodeAt(m)); return this; } /** * UTF-8 encode and write `str` to the current pointer offset and move pointer * forward according to the encoded length. */ - writeUtf8(p) { - return this.writeBytes((0, r.encode)(p)); + writeUtf8(_) { + return this.writeBytes((0, r.encode)(_)); } /** * Export a Uint8Array view of the internal buffer. @@ -17208,39 +17208,39 @@ var _3Dmol$1 = { exports: {} }; if (a.stream) throw new Error("Failed to encode: the 'stream' option is unsupported."); let l = 0; - const d = r.length; - let o = 0, u = Math.max(32, d + (d >> 1) + 7), p = new Uint8Array(u >> 3 << 3); - for (; l < d; ) { + const h = r.length; + let c = 0, d = Math.max(32, h + (h >> 1) + 7), _ = new Uint8Array(d >> 3 << 3); + for (; l < h; ) { let m = r.charCodeAt(l++); if (m >= 55296 && m <= 56319) { - if (l < d) { + if (l < h) { const y = r.charCodeAt(l); (y & 64512) === 56320 && (++l, m = ((m & 1023) << 10) + (y & 1023) + 65536); } if (m >= 55296 && m <= 56319) continue; } - if (o + 4 > p.length) { - u += 8, u *= 1 + l / r.length * 2, u = u >> 3 << 3; - const y = new Uint8Array(u); - y.set(p), p = y; + if (c + 4 > _.length) { + d += 8, d *= 1 + l / r.length * 2, d = d >> 3 << 3; + const y = new Uint8Array(d); + y.set(_), _ = y; } if (m & 4294967168) if (!(m & 4294965248)) - p[o++] = m >> 6 & 31 | 192; + _[c++] = m >> 6 & 31 | 192; else if (!(m & 4294901760)) - p[o++] = m >> 12 & 15 | 224, p[o++] = m >> 6 & 63 | 128; + _[c++] = m >> 12 & 15 | 224, _[c++] = m >> 6 & 63 | 128; else if (!(m & 4292870144)) - p[o++] = m >> 18 & 7 | 240, p[o++] = m >> 12 & 63 | 128, p[o++] = m >> 6 & 63 | 128; + _[c++] = m >> 18 & 7 | 240, _[c++] = m >> 12 & 63 | 128, _[c++] = m >> 6 & 63 | 128; else continue; else { - p[o++] = m; + _[c++] = m; continue; } - p[o++] = m & 63 | 128; + _[c++] = m & 63 | 128; } - return p.slice(0, o); + return _.slice(0, c); }; function t(r = "utf-8", a = { fatal: !1 }) { if (r !== "utf-8") @@ -17256,27 +17256,27 @@ var _3Dmol$1 = { exports: {} }; if (a.stream) throw new Error("Failed to decode: the 'stream' option is unsupported."); const l = new Uint8Array(r); - let d = 0; - const o = l.length, u = []; - for (; d < o; ) { - const p = l[d++]; - if (p === 0) + let h = 0; + const c = l.length, d = []; + for (; h < c; ) { + const _ = l[h++]; + if (_ === 0) break; - if (!(p & 128)) - u.push(p); - else if ((p & 224) === 192) { - const m = l[d++] & 63; - u.push((p & 31) << 6 | m); - } else if ((p & 240) === 224) { - const m = l[d++] & 63, y = l[d++] & 63; - u.push((p & 31) << 12 | m << 6 | y); - } else if ((p & 248) === 240) { - const m = l[d++] & 63, y = l[d++] & 63, w = l[d++] & 63; - let b = (p & 7) << 18 | m << 12 | y << 6 | w; - b > 65535 && (b -= 65536, u.push(b >>> 10 & 1023 | 55296), b = 56320 | b & 1023), u.push(b); + if (!(_ & 128)) + d.push(_); + else if ((_ & 224) === 192) { + const m = l[h++] & 63; + d.push((_ & 31) << 6 | m); + } else if ((_ & 240) === 224) { + const m = l[h++] & 63, y = l[h++] & 63; + d.push((_ & 31) << 12 | m << 6 | y); + } else if ((_ & 248) === 240) { + const m = l[h++] & 63, y = l[h++] & 63, x = l[h++] & 63; + let b = (_ & 7) << 18 | m << 12 | y << 6 | x; + b > 65535 && (b -= 65536, d.push(b >>> 10 & 1023 | 55296), b = 56320 | b & 1023), d.push(b); } } - return String.fromCharCode.apply(null, u); + return String.fromCharCode.apply(null, d); }, n.TextEncoder = e, n.TextDecoder = t; })(typeof window < "u" ? window : typeof self < "u" ? self : this); } @@ -17304,12 +17304,12 @@ var _3Dmol$1 = { exports: {} }; /*! ./text-encoding-polyfill */ "./node_modules/iobuffer/lib-esm/text-encoding-polyfill.js" ); - function r(d, o = "utf8") { - return new TextDecoder(o).decode(d); + function r(h, c = "utf8") { + return new TextDecoder(c).decode(h); } const a = new TextEncoder(); - function l(d) { - return a.encode(d); + function l(h) { + return a.encode(h); } } ), @@ -17337,22 +17337,22 @@ var _3Dmol$1 = { exports: {} }; /*! ./types */ "./node_modules/netcdfjs/lib-esm/types.js" ); - function a(d, o) { - const u = (0, r.str2num)(o.type), p = o.size / (0, r.num2bytes)(u), m = new Array(p); - for (let y = 0; y < p; y++) - m[y] = (0, r.readType)(d, u, 1); + function a(h, c) { + const d = (0, r.str2num)(c.type), _ = c.size / (0, r.num2bytes)(d), m = new Array(_); + for (let y = 0; y < _; y++) + m[y] = (0, r.readType)(h, d, 1); return m; } - function l(d, o, u) { - const p = (0, r.str2num)(o.type), m = o.size ? o.size / (0, r.num2bytes)(p) : 1, y = u.length, w = new Array(y), b = u.recordStep; + function l(h, c, d) { + const _ = (0, r.str2num)(c.type), m = c.size ? c.size / (0, r.num2bytes)(_) : 1, y = d.length, x = new Array(y), b = d.recordStep; if (b) for (let A = 0; A < y; A++) { - const f = d.offset; - w[A] = (0, r.readType)(d, p, m), d.seek(f + b); + const f = h.offset; + x[A] = (0, r.readType)(h, _, m), h.seek(f + b); } else throw new Error("recordDimension.recordStep is undefined"); - return w; + return x; } } ), @@ -17378,52 +17378,52 @@ var _3Dmol$1 = { exports: {} }; /*! ./utils */ "./node_modules/netcdfjs/lib-esm/utils.js" ); - const l = 0, d = 10, o = 11, u = 12, p = 0; + const l = 0, h = 10, c = 11, d = 12, _ = 0; function m(A, f) { - const s = { version: f }, h = { + const s = { version: f }, u = { length: A.readUint32() - }, _ = y(A); - Array.isArray(_) || (h.id = _.recordId, h.name = _.recordName, s.dimensions = _.dimensions), s.globalAttributes = w(A); - const g = b(A, h == null ? void 0 : h.id, f); - return Array.isArray(g) || (s.variables = g.variables, h.recordStep = g.recordStep), s.recordDimension = h, s; + }, p = y(A); + Array.isArray(p) || (u.id = p.recordId, u.name = p.recordName, s.dimensions = p.dimensions), s.globalAttributes = x(A); + const g = b(A, u == null ? void 0 : u.id, f); + return Array.isArray(g) || (s.variables = g.variables, u.recordStep = g.recordStep), s.recordDimension = u, s; } function y(A) { const f = {}; - let s, h; - const _ = A.readUint32(); + let s, u; + const p = A.readUint32(); let g; - if (_ === l) + if (p === l) return (0, a.notNetcdf)(A.readUint32() !== l, "wrong empty tag for list of dimensions"), []; { - (0, a.notNetcdf)(_ !== d, "wrong tag for list of dimensions"); - const x = A.readUint32(); - g = new Array(x); - for (let c = 0; c < x; c++) { + (0, a.notNetcdf)(p !== h, "wrong tag for list of dimensions"); + const w = A.readUint32(); + g = new Array(w); + for (let o = 0; o < w; o++) { const v = (0, a.readName)(A), M = A.readUint32(); - M === p && (s = c, h = v), g[c] = { + M === _ && (s = o, u = v), g[o] = { name: v, size: M }; } } - return s !== void 0 && (f.recordId = s), h !== void 0 && (f.recordName = h), f.dimensions = g, f; + return s !== void 0 && (f.recordId = s), u !== void 0 && (f.recordName = u), f.dimensions = g, f; } - function w(A) { + function x(A) { const f = A.readUint32(); let s; if (f === l) return (0, a.notNetcdf)(A.readUint32() !== l, "wrong empty tag for list of attributes"), []; { - (0, a.notNetcdf)(f !== u, "wrong tag for list of attributes"); - const h = A.readUint32(); - s = new Array(h); - for (let _ = 0; _ < h; _++) { - const g = (0, a.readName)(A), x = A.readUint32(); - (0, a.notNetcdf)(x < 1 || x > 6, `non valid type ${x}`); - const c = A.readUint32(), v = (0, r.readType)(A, x, c); - (0, a.padding)(A), s[_] = { + (0, a.notNetcdf)(f !== d, "wrong tag for list of attributes"); + const u = A.readUint32(); + s = new Array(u); + for (let p = 0; p < u; p++) { + const g = (0, a.readName)(A), w = A.readUint32(); + (0, a.notNetcdf)(w < 1 || w > 6, `non valid type ${w}`); + const o = A.readUint32(), v = (0, r.readType)(A, w, o); + (0, a.padding)(A), s[p] = { name: g, - type: (0, r.num2str)(x), + type: (0, r.num2str)(w), value: v }; } @@ -17431,25 +17431,25 @@ var _3Dmol$1 = { exports: {} }; return s; } function b(A, f, s) { - const h = A.readUint32(); - let _ = 0, g; - if (h === l) + const u = A.readUint32(); + let p = 0, g; + if (u === l) return (0, a.notNetcdf)(A.readUint32() !== l, "wrong empty tag for list of variables"), []; { - (0, a.notNetcdf)(h !== o, "wrong tag for list of variables"); - const x = A.readUint32(); - g = new Array(x); - for (let c = 0; c < x; c++) { + (0, a.notNetcdf)(u !== c, "wrong tag for list of variables"); + const w = A.readUint32(); + g = new Array(w); + for (let o = 0; o < w; o++) { const v = (0, a.readName)(A), M = A.readUint32(), E = new Array(M); for (let R = 0; R < M; R++) E[R] = A.readUint32(); - const $ = w(A), k = A.readUint32(); + const $ = x(A), k = A.readUint32(); (0, a.notNetcdf)(k < 1 && k > 6, `non valid type ${k}`); const L = A.readUint32(); let z = A.readUint32(); s === 2 && ((0, a.notNetcdf)(z > 0, "offsets larger than 4GB not supported"), z = A.readUint32()); let O = !1; - typeof f < "u" && E[0] === f && (_ += L, O = !0), g[c] = { + typeof f < "u" && E[0] === f && (p += L, O = !0), g[o] = { name: v, dimensions: E, attributes: $, @@ -17462,7 +17462,7 @@ var _3Dmol$1 = { exports: {} }; } return { variables: g, - recordStep: _ + recordStep: p }; } } @@ -17499,7 +17499,7 @@ var _3Dmol$1 = { exports: {} }; /* harmony export */ NetCDFReader: () => ( /* binding */ - u + d ) /* harmony export */ }); @@ -17512,20 +17512,20 @@ var _3Dmol$1 = { exports: {} }; ), l = t( /*! ./header */ "./node_modules/netcdfjs/lib-esm/header.js" - ), d = t( + ), h = t( /*! ./toString */ "./node_modules/netcdfjs/lib-esm/toString.js" - ), o = t( + ), c = t( /*! ./utils */ "./node_modules/netcdfjs/lib-esm/utils.js" ); - class u { + class d { constructor(m) { - this.toString = d.toString; + this.toString = h.toString; const y = new r.IOBuffer(m); - y.setBigEndian(), (0, o.notNetcdf)(y.readChars(3) !== "CDF", "should start with CDF"); - const w = y.readByte(); - (0, o.notNetcdf)(w > 2, "unknown version"), this.header = (0, l.header)(y, w), this.buffer = y; + y.setBigEndian(), (0, c.notNetcdf)(y.readChars(3) !== "CDF", "should start with CDF"); + const x = y.readByte(); + (0, c.notNetcdf)(x > 2, "unknown version"), this.header = (0, l.header)(y, x), this.buffer = y; } /** * @return - Version for the NetCDF format @@ -17566,7 +17566,7 @@ var _3Dmol$1 = { exports: {} }; * @return - Value of the attributeName or null */ getAttribute(m) { - const y = this.globalAttributes.find((w) => w.name === m); + const y = this.globalAttributes.find((x) => x.name === m); return y ? y.value : null; } /** @@ -17588,7 +17588,7 @@ var _3Dmol$1 = { exports: {} }; */ getDataVariable(m) { let y; - if (typeof m == "string" ? y = this.header.variables.find((w) => w.name === m) : y = m, y === void 0) + if (typeof m == "string" ? y = this.header.variables.find((x) => x.name === m) : y = m, y === void 0) throw new Error("Not a valid NetCDF v3.x file: variable not found"); return this.buffer.seek(y.offset), y.record ? (0, a.record)(this.buffer, y, this.header.recordDimension) : (0, a.nonRecord)(this.buffer, y); } @@ -17598,7 +17598,7 @@ var _3Dmol$1 = { exports: {} }; * @return boolean */ dataVariableExists(m) { - return this.header.variables.find((w) => w.name === m) !== void 0; + return this.header.variables.find((x) => x.name === m) !== void 0; } /** * Check if an attribute exists @@ -17606,7 +17606,7 @@ var _3Dmol$1 = { exports: {} }; * @return boolean */ attributeExists(m) { - return this.globalAttributes.find((w) => w.name === m) !== void 0; + return this.globalAttributes.find((x) => x.name === m) !== void 0; } } } @@ -17629,17 +17629,17 @@ var _3Dmol$1 = { exports: {} }; function r() { const a = []; a.push("DIMENSIONS"); - for (const d of this.dimensions) - a.push(` ${d.name.padEnd(30)} = size: ${d.size}`); + for (const h of this.dimensions) + a.push(` ${h.name.padEnd(30)} = size: ${h.size}`); a.push(""), a.push("GLOBAL ATTRIBUTES"); - for (const d of this.globalAttributes) - a.push(` ${d.name.padEnd(30)} = ${d.value}`); + for (const h of this.globalAttributes) + a.push(` ${h.name.padEnd(30)} = ${h.value}`); const l = JSON.parse(JSON.stringify(this.variables)); a.push(""), a.push("VARIABLES:"); - for (const d of l) { - d.value = this.getDataVariable(d); - let o = JSON.stringify(d.value); - o.length > 50 && (o = o.substring(0, 50)), isNaN(d.value.length) || (o += ` (length: ${d.value.length})`), a.push(` ${d.name.padEnd(30)} = ${o}`); + for (const h of l) { + h.value = this.getDataVariable(h); + let c = JSON.stringify(h.value); + c.length > 50 && (c = c.substring(0, 50)), isNaN(h.value.length) || (c += ` (length: ${h.value.length})`), a.push(` ${h.name.padEnd(30)} = ${c}`); } return a.join(` `); @@ -17667,12 +17667,12 @@ var _3Dmol$1 = { exports: {} }; /* harmony export */ readType: () => ( /* binding */ - u + d ), /* harmony export */ str2num: () => ( /* binding */ - d + h ) /* harmony export */ }); @@ -17720,7 +17720,7 @@ var _3Dmol$1 = { exports: {} }; return -1; } } - function d(m) { + function h(m) { switch (String(m)) { case "byte": return r.BYTE; @@ -17738,34 +17738,34 @@ var _3Dmol$1 = { exports: {} }; return -1; } } - function o(m, y) { + function c(m, y) { if (m !== 1) { - const w = new Array(m); + const x = new Array(m); for (let b = 0; b < m; b++) - w[b] = y(); - return w; + x[b] = y(); + return x; } else return y(); } - function u(m, y, w) { + function d(m, y, x) { switch (y) { case r.BYTE: - return Array.from(m.readBytes(w)); + return Array.from(m.readBytes(x)); case r.CHAR: - return p(m.readChars(w)); + return _(m.readChars(x)); case r.SHORT: - return o(w, m.readInt16.bind(m)); + return c(x, m.readInt16.bind(m)); case r.INT: - return o(w, m.readInt32.bind(m)); + return c(x, m.readInt32.bind(m)); case r.FLOAT: - return o(w, m.readFloat32.bind(m)); + return c(x, m.readFloat32.bind(m)); case r.DOUBLE: - return o(w, m.readFloat64.bind(m)); + return c(x, m.readFloat64.bind(m)); default: throw new Error(`non valid type ${y}`); } } - function p(m) { + function _(m) { return m.charCodeAt(m.length - 1) === 0 ? m.substring(0, m.length - 1) : m; } } @@ -17795,16 +17795,16 @@ var _3Dmol$1 = { exports: {} }; ) /* harmony export */ }); - function r(d, o) { - if (d) - throw new TypeError(`Not a valid NetCDF v3.x file: ${o}`); + function r(h, c) { + if (h) + throw new TypeError(`Not a valid NetCDF v3.x file: ${c}`); } - function a(d) { - d.offset % 4 !== 0 && d.skip(4 - d.offset % 4); + function a(h) { + h.offset % 4 !== 0 && h.skip(4 - h.offset % 4); } - function l(d) { - const o = d.readUint32(), u = d.readChars(o); - return a(d), u; + function l(h) { + const c = h.readUint32(), d = h.readChars(c); + return a(h), d; } } ), @@ -19482,160 +19482,160 @@ void main() { /*! ./WebGL/math */ "./src/WebGL/math/index.ts" ), a; - (function(d) { - d[d.NONE = 0] = "NONE", d[d.FLAT = 1] = "FLAT", d[d.ROUND = 2] = "ROUND"; + (function(h) { + h[h.NONE = 0] = "NONE", h[h.FLAT = 1] = "FLAT", h[h.ROUND = 2] = "ROUND"; })(a || (a = {})); var l; - (function(d) { - function o(f, s, h) { - var _ = Math.hypot(f, s), g, x, c, v, M; - _ < 1e-4 ? (x = 0, c = 1) : (x = -f / _, c = s / _), s = -x * f + c * s, g = Math.hypot(s, h), g < 1e-4 ? (v = 0, M = 1) : (v = h / g, M = s / g); + (function(h) { + function c(f, s, u) { + var p = Math.hypot(f, s), g, w, o, v, M; + p < 1e-4 ? (w = 0, o = 1) : (w = -f / p, o = s / p), s = -w * f + o * s, g = Math.hypot(s, u), g < 1e-4 ? (v = 0, M = 1) : (v = u / g, M = s / g); var E = new Float32Array(9); - return E[0] = c, E[1] = x, E[2] = 0, E[3] = -x * M, E[4] = c * M, E[5] = v, E[6] = x * v, E[7] = -c * v, E[8] = M, E; + return E[0] = o, E[1] = w, E[2] = 0, E[3] = -w * M, E[4] = o * M, E[5] = v, E[6] = w * v, E[7] = -o * v, E[8] = M, E; } - class u { + class d { constructor() { this.cache = {}; - let s = [], h = 4, _ = Math.pow(2, h), g = 2, x = Math.pow(2, g), c = _ / x, v; - for (s[0] = new r.Vector3(-1, 0, 0), s[c] = new r.Vector3(0, 0, 1), s[c * 2] = new r.Vector3(1, 0, 0), s[c * 3] = new r.Vector3(0, 0, -1), g = 3; g <= h; g++) { - for (x = Math.pow(2, g - 1), c = _ / x, v = 0; v < x - 1; v++) - s[c / 2 + v * c] = s[v * c].clone().add(s[(v + 1) * c]).normalize(); - v = x - 1, s[c / 2 + v * c] = s[v * c].clone().add(s[0]).normalize(); + let s = [], u = 4, p = Math.pow(2, u), g = 2, w = Math.pow(2, g), o = p / w, v; + for (s[0] = new r.Vector3(-1, 0, 0), s[o] = new r.Vector3(0, 0, 1), s[o * 2] = new r.Vector3(1, 0, 0), s[o * 3] = new r.Vector3(0, 0, -1), g = 3; g <= u; g++) { + for (w = Math.pow(2, g - 1), o = p / w, v = 0; v < w - 1; v++) + s[o / 2 + v * o] = s[v * o].clone().add(s[(v + 1) * o]).normalize(); + v = w - 1, s[o / 2 + v * o] = s[v * o].clone().add(s[0]).normalize(); } this.basisVectors = s; } - getVerticesForRadius(s, h, _) { - if (typeof this.cache < "u" && this.cache[s] !== void 0 && this.cache[s][h + _] !== void 0) - return this.cache[s][h + _]; - for (var g = this.basisVectors.length, x = [], c = [], v, M = 0; M < g; M++) - x.push(this.basisVectors[M].clone().multiplyScalar(s)), x.push(this.basisVectors[M].clone().multiplyScalar(s)), v = this.basisVectors[M].clone().normalize(), c.push(v), c.push(v); - var E = [], $ = 10, k = g, L = 0, z = Math.PI * 2, O = 0, R = Math.PI, P, U, B = !1, N = !1; - for (U = 0; U <= $; U++) { - B = U === 0 || U === $, N = U === $ / 2; + getVerticesForRadius(s, u, p) { + if (typeof this.cache < "u" && this.cache[s] !== void 0 && this.cache[s][u + p] !== void 0) + return this.cache[s][u + p]; + for (var g = this.basisVectors.length, w = [], o = [], v, M = 0; M < g; M++) + w.push(this.basisVectors[M].clone().multiplyScalar(s)), w.push(this.basisVectors[M].clone().multiplyScalar(s)), v = this.basisVectors[M].clone().normalize(), o.push(v), o.push(v); + var E = [], $ = 10, k = g, L = 0, z = Math.PI * 2, O = 0, R = Math.PI, N, W, B = !1, P = !1; + for (W = 0; W <= $; W++) { + B = W === 0 || W === $, P = W === $ / 2; var G = [], H = []; - for (P = 0; P <= k; P++) { - if (N) { - var W = P < k ? 2 * P : 0; - H.push(W + 1), G.push(W); + for (N = 0; N <= k; N++) { + if (P) { + var U = N < k ? 2 * N : 0; + H.push(U + 1), G.push(U); continue; } - var V = P / k, re = U / $; - if (!B || P === 0) - if (P < k) { + var j = N / k, re = W / $; + if (!B || N === 0) + if (N < k) { var ie = new r.Vector3(); - ie.x = -s * Math.cos(L + V * z) * Math.sin(O + re * R), h == 1 ? ie.y = 0 : ie.y = s * Math.cos(O + re * R), ie.z = s * Math.sin(L + V * z) * Math.sin(O + re * R), Math.abs(ie.x) < 1e-5 && (ie.x = 0), Math.abs(ie.y) < 1e-5 && (ie.y = 0), Math.abs(ie.z) < 1e-5 && (ie.z = 0), h == a.FLAT ? (v = new r.Vector3(0, Math.cos(O + re * R), 0), v.normalize()) : (v = new r.Vector3(ie.x, ie.y, ie.z), v.normalize()), x.push(ie), c.push(v), G.push(x.length - 1); + ie.x = -s * Math.cos(L + j * z) * Math.sin(O + re * R), u == 1 ? ie.y = 0 : ie.y = s * Math.cos(O + re * R), ie.z = s * Math.sin(L + j * z) * Math.sin(O + re * R), Math.abs(ie.x) < 1e-5 && (ie.x = 0), Math.abs(ie.y) < 1e-5 && (ie.y = 0), Math.abs(ie.z) < 1e-5 && (ie.z = 0), u == a.FLAT ? (v = new r.Vector3(0, Math.cos(O + re * R), 0), v.normalize()) : (v = new r.Vector3(ie.x, ie.y, ie.z), v.normalize()), w.push(ie), o.push(v), G.push(w.length - 1); } else - G.push(x.length - k); - else B && G.push(x.length - 1); + G.push(w.length - k); + else B && G.push(w.length - 1); } - N && E.push(H), E.push(G); + P && E.push(H), E.push(G); } - var ee = { - vertices: x, - normals: c, + var te = { + vertices: w, + normals: o, verticesRows: E, w: k, h: $ }; - return s in this.cache || (this.cache[s] = {}), this.cache[s][h + _] = ee, ee; + return s in this.cache || (this.cache[s] = {}), this.cache[s][u + p] = te, te; } } - var p = new u(); - function m(f, s, h, _, g, x = 0, c = 0) { - if (!s || !h) + var _ = new d(); + function m(f, s, u, p, g, w = 0, o = 0) { + if (!s || !u) return; - let v = function($e) { - if (typeof $e == "string") { - let Ye = $e; - return Ye.toLowerCase() == "flat" ? a.FLAT : Ye.toLowerCase() == "round" ? a.ROUND : a.NONE; + let v = function(Ce) { + if (typeof Ce == "string") { + let Ze = Ce; + return Ze.toLowerCase() == "flat" ? a.FLAT : Ze.toLowerCase() == "round" ? a.ROUND : a.NONE; } else - return $e; + return Ce; }; - x = v(x), c = v(c); - var M = c || x; + w = v(w), o = v(o); + var M = o || w; g = g || { r: 0, g: 0, b: 0 }; - var E = o(h.x - s.x, h.y - s.y, h.z - s.z), $ = p.getVerticesForRadius(_, c, "to"), k = $.w, L = $.h, z = M ? L * k + 2 : 2 * k, O = f.updateGeoGroup(z), R = $.vertices, P = $.normals, U = $.verticesRows, B = U[L / 2], N = U[L / 2 + 1], G = O.vertices, H, W, V, re, ie, ee, ce = O.vertexArray, he = O.normalArray, le = O.colorArray, J = O.faceArray; - for (V = 0; V < k; ++V) { - var Me = 2 * V; - re = E[0] * R[Me].x + E[3] * R[Me].y + E[6] * R[Me].z, ie = E[1] * R[Me].x + E[4] * R[Me].y + E[7] * R[Me].z, ee = E[5] * R[Me].y + E[8] * R[Me].z, H = 3 * (G + Me), W = O.faceidx, ce[H] = re + s.x, ce[H + 1] = ie + s.y, ce[H + 2] = ee + s.z, ce[H + 3] = re + h.x, ce[H + 4] = ie + h.y, ce[H + 5] = ee + h.z, he[H] = re, he[H + 3] = re, he[H + 1] = ie, he[H + 4] = ie, he[H + 2] = ee, he[H + 5] = ee, le[H] = g.r, le[H + 3] = g.r, le[H + 1] = g.g, le[H + 4] = g.g, le[H + 2] = g.b, le[H + 5] = g.b, J[W] = N[V] + G, J[W + 1] = N[V + 1] + G, J[W + 2] = B[V] + G, J[W + 3] = B[V] + G, J[W + 4] = N[V + 1] + G, J[W + 5] = B[V + 1] + G, O.faceidx += 6; + var E = c(u.x - s.x, u.y - s.y, u.z - s.z), $ = _.getVerticesForRadius(p, o, "to"), k = $.w, L = $.h, z = M ? L * k + 2 : 2 * k, O = f.updateGeoGroup(z), R = $.vertices, N = $.normals, W = $.verticesRows, B = W[L / 2], P = W[L / 2 + 1], G = O.vertices, H, U, j, re, ie, te, ue = O.vertexArray, de = O.normalArray, oe = O.colorArray, J = O.faceArray; + for (j = 0; j < k; ++j) { + var Ee = 2 * j; + re = E[0] * R[Ee].x + E[3] * R[Ee].y + E[6] * R[Ee].z, ie = E[1] * R[Ee].x + E[4] * R[Ee].y + E[7] * R[Ee].z, te = E[5] * R[Ee].y + E[8] * R[Ee].z, H = 3 * (G + Ee), U = O.faceidx, ue[H] = re + s.x, ue[H + 1] = ie + s.y, ue[H + 2] = te + s.z, ue[H + 3] = re + u.x, ue[H + 4] = ie + u.y, ue[H + 5] = te + u.z, de[H] = re, de[H + 3] = re, de[H + 1] = ie, de[H + 4] = ie, de[H + 2] = te, de[H + 5] = te, oe[H] = g.r, oe[H + 3] = g.r, oe[H + 1] = g.g, oe[H + 4] = g.g, oe[H + 2] = g.b, oe[H + 5] = g.b, J[U] = P[j] + G, J[U + 1] = P[j + 1] + G, J[U + 2] = B[j] + G, J[U + 3] = B[j] + G, J[U + 4] = P[j + 1] + G, J[U + 5] = B[j + 1] + G, O.faceidx += 6; } if (M) { - var se = c ? 0 : L / 2, Ce = x ? L + 1 : L / 2 + 1, ue, ne, _e, Oe, Re, Ue, We, Ee, Ae, ge, Le, Te, Ke, je, Y, q, te, we, me, Pe, Fe, K, fe, Se, Ne, pe, ke, X, Be, Ge, I, ye; - for (ie = se; ie < Ce; ie++) + var se = o ? 0 : L / 2, Ae = w ? L + 1 : L / 2 + 1, he, ne, _e, Le, Be, Ue, He, We, Ge, Ne, Pe, Te, Me, De, V, Z, ee, ye, ce, Ie, ke, Y, me, we, Re, pe, $e, X, ze, Ve, I, xe; + for (ie = se; ie < Ae; ie++) if (ie !== L / 2) { - var ve = ie <= L / 2 ? h : s, Z = p.getVerticesForRadius(_, c, "to"), de = p.getVerticesForRadius(_, x, "from"); - for (ve === h ? (R = Z.vertices, P = Z.normals, U = Z.verticesRows) : ve == s && (R = de.vertices, P = de.normals, U = de.verticesRows), re = 0; re < k; re++) - W = O.faceidx, ue = U[ie][re + 1], Be = (ue + G) * 3, ne = U[ie][re], Ge = (ne + G) * 3, _e = U[ie + 1][re], I = (_e + G) * 3, Oe = U[ie + 1][re + 1], ye = (Oe + G) * 3, Re = E[0] * R[ue].x + E[3] * R[ue].y + E[6] * R[ue].z, Ue = E[0] * R[ne].x + E[3] * R[ne].y + E[6] * R[ne].z, We = E[0] * R[_e].x + E[3] * R[_e].y + E[6] * R[_e].z, Ee = E[0] * R[Oe].x + E[3] * R[Oe].y + E[6] * R[Oe].z, Ae = E[1] * R[ue].x + E[4] * R[ue].y + E[7] * R[ue].z, ge = E[1] * R[ne].x + E[4] * R[ne].y + E[7] * R[ne].z, Le = E[1] * R[_e].x + E[4] * R[_e].y + E[7] * R[_e].z, Te = E[1] * R[Oe].x + E[4] * R[Oe].y + E[7] * R[Oe].z, Ke = E[5] * R[ue].y + E[8] * R[ue].z, je = E[5] * R[ne].y + E[8] * R[ne].z, Y = E[5] * R[_e].y + E[8] * R[_e].z, q = E[5] * R[Oe].y + E[8] * R[Oe].z, ce[Be] = Re + ve.x, ce[Ge] = Ue + ve.x, ce[I] = We + ve.x, ce[ye] = Ee + ve.x, ce[Be + 1] = Ae + ve.y, ce[Ge + 1] = ge + ve.y, ce[I + 1] = Le + ve.y, ce[ye + 1] = Te + ve.y, ce[Be + 2] = Ke + ve.z, ce[Ge + 2] = je + ve.z, ce[I + 2] = Y + ve.z, ce[ye + 2] = q + ve.z, le[Be] = g.r, le[Ge] = g.r, le[I] = g.r, le[ye] = g.r, le[Be + 1] = g.g, le[Ge + 1] = g.g, le[I + 1] = g.g, le[ye + 1] = g.g, le[Be + 2] = g.b, le[Ge + 2] = g.b, le[I + 2] = g.b, le[ye + 2] = g.b, te = E[0] * P[ue].x + E[3] * P[ue].y + E[6] * P[ue].z, we = E[0] * P[ne].x + E[3] * P[ne].y + E[6] * P[ne].z, me = E[0] * P[_e].x + E[3] * P[_e].y + E[6] * P[_e].z, Pe = E[0] * P[Oe].x + E[3] * P[Oe].y + E[6] * P[Oe].z, Fe = E[1] * P[ue].x + E[4] * P[ue].y + E[7] * P[ue].z, K = E[1] * P[ne].x + E[4] * P[ne].y + E[7] * P[ne].z, fe = E[1] * P[_e].x + E[4] * P[_e].y + E[7] * P[_e].z, Se = E[1] * P[Oe].x + E[4] * P[Oe].y + E[7] * P[Oe].z, Ne = E[5] * P[ue].y + E[8] * P[ue].z, pe = E[5] * P[ne].y + E[8] * P[ne].z, ke = E[5] * P[_e].y + E[8] * P[_e].z, X = E[5] * P[Oe].y + E[8] * P[Oe].z, ie === 0 ? (he[Be] = te, he[I] = me, he[ye] = Pe, he[Be + 1] = Fe, he[I + 1] = fe, he[ye + 1] = Se, he[Be + 2] = Ne, he[I + 2] = ke, he[ye + 2] = X, J[W] = ue + G, J[W + 1] = _e + G, J[W + 2] = Oe + G, O.faceidx += 3) : ie === Ce - 1 ? (he[Be] = te, he[Ge] = we, he[I] = me, he[Be + 1] = Fe, he[Ge + 1] = K, he[I + 1] = fe, he[Be + 2] = Ne, he[Ge + 2] = pe, he[I + 2] = ke, J[W] = ue + G, J[W + 1] = ne + G, J[W + 2] = _e + G, O.faceidx += 3) : (he[Be] = te, he[Ge] = we, he[ye] = Pe, he[Be + 1] = Fe, he[Ge + 1] = K, he[ye + 1] = Se, he[Be + 2] = Ne, he[Ge + 2] = pe, he[ye + 2] = X, he[Ge] = we, he[I] = me, he[ye] = Pe, he[Ge + 1] = K, he[I + 1] = fe, he[ye + 1] = Se, he[Ge + 2] = pe, he[I + 2] = ke, he[ye + 2] = X, J[W] = ue + G, J[W + 1] = ne + G, J[W + 2] = Oe + G, J[W + 3] = ne + G, J[W + 4] = _e + G, J[W + 5] = Oe + G, O.faceidx += 6); + var be = ie <= L / 2 ? u : s, q = _.getVerticesForRadius(p, o, "to"), fe = _.getVerticesForRadius(p, w, "from"); + for (be === u ? (R = q.vertices, N = q.normals, W = q.verticesRows) : be == s && (R = fe.vertices, N = fe.normals, W = fe.verticesRows), re = 0; re < k; re++) + U = O.faceidx, he = W[ie][re + 1], ze = (he + G) * 3, ne = W[ie][re], Ve = (ne + G) * 3, _e = W[ie + 1][re], I = (_e + G) * 3, Le = W[ie + 1][re + 1], xe = (Le + G) * 3, Be = E[0] * R[he].x + E[3] * R[he].y + E[6] * R[he].z, Ue = E[0] * R[ne].x + E[3] * R[ne].y + E[6] * R[ne].z, He = E[0] * R[_e].x + E[3] * R[_e].y + E[6] * R[_e].z, We = E[0] * R[Le].x + E[3] * R[Le].y + E[6] * R[Le].z, Ge = E[1] * R[he].x + E[4] * R[he].y + E[7] * R[he].z, Ne = E[1] * R[ne].x + E[4] * R[ne].y + E[7] * R[ne].z, Pe = E[1] * R[_e].x + E[4] * R[_e].y + E[7] * R[_e].z, Te = E[1] * R[Le].x + E[4] * R[Le].y + E[7] * R[Le].z, Me = E[5] * R[he].y + E[8] * R[he].z, De = E[5] * R[ne].y + E[8] * R[ne].z, V = E[5] * R[_e].y + E[8] * R[_e].z, Z = E[5] * R[Le].y + E[8] * R[Le].z, ue[ze] = Be + be.x, ue[Ve] = Ue + be.x, ue[I] = He + be.x, ue[xe] = We + be.x, ue[ze + 1] = Ge + be.y, ue[Ve + 1] = Ne + be.y, ue[I + 1] = Pe + be.y, ue[xe + 1] = Te + be.y, ue[ze + 2] = Me + be.z, ue[Ve + 2] = De + be.z, ue[I + 2] = V + be.z, ue[xe + 2] = Z + be.z, oe[ze] = g.r, oe[Ve] = g.r, oe[I] = g.r, oe[xe] = g.r, oe[ze + 1] = g.g, oe[Ve + 1] = g.g, oe[I + 1] = g.g, oe[xe + 1] = g.g, oe[ze + 2] = g.b, oe[Ve + 2] = g.b, oe[I + 2] = g.b, oe[xe + 2] = g.b, ee = E[0] * N[he].x + E[3] * N[he].y + E[6] * N[he].z, ye = E[0] * N[ne].x + E[3] * N[ne].y + E[6] * N[ne].z, ce = E[0] * N[_e].x + E[3] * N[_e].y + E[6] * N[_e].z, Ie = E[0] * N[Le].x + E[3] * N[Le].y + E[6] * N[Le].z, ke = E[1] * N[he].x + E[4] * N[he].y + E[7] * N[he].z, Y = E[1] * N[ne].x + E[4] * N[ne].y + E[7] * N[ne].z, me = E[1] * N[_e].x + E[4] * N[_e].y + E[7] * N[_e].z, we = E[1] * N[Le].x + E[4] * N[Le].y + E[7] * N[Le].z, Re = E[5] * N[he].y + E[8] * N[he].z, pe = E[5] * N[ne].y + E[8] * N[ne].z, $e = E[5] * N[_e].y + E[8] * N[_e].z, X = E[5] * N[Le].y + E[8] * N[Le].z, ie === 0 ? (de[ze] = ee, de[I] = ce, de[xe] = Ie, de[ze + 1] = ke, de[I + 1] = me, de[xe + 1] = we, de[ze + 2] = Re, de[I + 2] = $e, de[xe + 2] = X, J[U] = he + G, J[U + 1] = _e + G, J[U + 2] = Le + G, O.faceidx += 3) : ie === Ae - 1 ? (de[ze] = ee, de[Ve] = ye, de[I] = ce, de[ze + 1] = ke, de[Ve + 1] = Y, de[I + 1] = me, de[ze + 2] = Re, de[Ve + 2] = pe, de[I + 2] = $e, J[U] = he + G, J[U + 1] = ne + G, J[U + 2] = _e + G, O.faceidx += 3) : (de[ze] = ee, de[Ve] = ye, de[xe] = Ie, de[ze + 1] = ke, de[Ve + 1] = Y, de[xe + 1] = we, de[ze + 2] = Re, de[Ve + 2] = pe, de[xe + 2] = X, de[Ve] = ye, de[I] = ce, de[xe] = Ie, de[Ve + 1] = Y, de[I + 1] = me, de[xe + 1] = we, de[Ve + 2] = pe, de[I + 2] = $e, de[xe + 2] = X, J[U] = he + G, J[U + 1] = ne + G, J[U + 2] = Le + G, J[U + 3] = ne + G, J[U + 4] = _e + G, J[U + 5] = Le + G, O.faceidx += 6); } } O.vertices += z; } - d.drawCylinder = m; - function y(f, s, h, _, g) { - if (!s || !h) + h.drawCylinder = m; + function y(f, s, u, p, g) { + if (!s || !u) return; g = g || { r: 0, g: 0, b: 0 }; - let x = new r.Vector3(h.x - s.x, h.y - s.y, h.z - s.z); - var c = o(x.x, x.y, x.z); - x = x.normalize(); - var v = p.basisVectors.length, M = p.basisVectors, E = v + 2, $ = f.updateGeoGroup(E), k = $.vertices, L, z, O, R, P, U, B = $.vertexArray, N = $.normalArray, G = $.colorArray, H = $.faceArray; - for (L = k * 3, B[L] = s.x, B[L + 1] = s.y, B[L + 2] = s.z, N[L] = -x.x, N[L + 1] = -x.y, N[L + 2] = -x.z, G[L] = g.r, G[L + 1] = g.g, G[L + 2] = g.b, B[L + 3] = h.x, B[L + 4] = h.y, B[L + 5] = h.z, N[L + 3] = x.x, N[L + 4] = x.y, N[L + 5] = x.z, G[L + 3] = g.r, G[L + 4] = g.g, G[L + 5] = g.b, L += 6, O = 0; O < v; ++O) { - var W = M[O].clone(); - W.multiplyScalar(_), R = c[0] * W.x + c[3] * W.y + c[6] * W.z, P = c[1] * W.x + c[4] * W.y + c[7] * W.z, U = c[5] * W.y + c[8] * W.z, B[L] = R + s.x, B[L + 1] = P + s.y, B[L + 2] = U + s.z, N[L] = R, N[L + 1] = P, N[L + 2] = U, G[L] = g.r, G[L + 1] = g.g, G[L + 2] = g.b, L += 3; + let w = new r.Vector3(u.x - s.x, u.y - s.y, u.z - s.z); + var o = c(w.x, w.y, w.z); + w = w.normalize(); + var v = _.basisVectors.length, M = _.basisVectors, E = v + 2, $ = f.updateGeoGroup(E), k = $.vertices, L, z, O, R, N, W, B = $.vertexArray, P = $.normalArray, G = $.colorArray, H = $.faceArray; + for (L = k * 3, B[L] = s.x, B[L + 1] = s.y, B[L + 2] = s.z, P[L] = -w.x, P[L + 1] = -w.y, P[L + 2] = -w.z, G[L] = g.r, G[L + 1] = g.g, G[L + 2] = g.b, B[L + 3] = u.x, B[L + 4] = u.y, B[L + 5] = u.z, P[L + 3] = w.x, P[L + 4] = w.y, P[L + 5] = w.z, G[L + 3] = g.r, G[L + 4] = g.g, G[L + 5] = g.b, L += 6, O = 0; O < v; ++O) { + var U = M[O].clone(); + U.multiplyScalar(p), R = o[0] * U.x + o[3] * U.y + o[6] * U.z, N = o[1] * U.x + o[4] * U.y + o[7] * U.z, W = o[5] * U.y + o[8] * U.z, B[L] = R + s.x, B[L + 1] = N + s.y, B[L + 2] = W + s.z, P[L] = R, P[L + 1] = N, P[L + 2] = W, G[L] = g.r, G[L + 1] = g.g, G[L + 2] = g.b, L += 3; } for ($.vertices += v + 2, z = $.faceidx, O = 0; O < v; O++) { - var V = k + 2 + O, re = k + 2 + (O + 1) % v; - H[z] = V, H[z + 1] = re, H[z + 2] = k, z += 3, H[z] = V, H[z + 1] = re, H[z + 2] = k + 1, z += 3; + var j = k + 2 + O, re = k + 2 + (O + 1) % v; + H[z] = j, H[z + 1] = re, H[z + 2] = k, z += 3, H[z] = j, H[z + 1] = re, H[z + 2] = k + 1, z += 3; } $.faceidx += 6 * v; } - d.drawCone = y; - class w { + h.drawCone = y; + class x { constructor() { this.cache = /* @__PURE__ */ new Map(); } - getVerticesForRadius(s, h) { - h = h || 2, this.cache.has(h) || this.cache.set(h, /* @__PURE__ */ new Map()); - let _ = this.cache.get(h); - if (_.has(s)) - return _.get(s); + getVerticesForRadius(s, u) { + u = u || 2, this.cache.has(u) || this.cache.set(u, /* @__PURE__ */ new Map()); + let p = this.cache.get(u); + if (p.has(s)) + return p.get(s); var g = { vertices: [], verticesRows: [], normals: [] - }, x = 16 * h, c = 10 * h; - s < 1 && (x = 10 * h, c = 8 * h); + }, w = 16 * u, o = 10 * u; + s < 1 && (w = 10 * u, o = 8 * u); var v = 0, M = Math.PI * 2, E = 0, $ = Math.PI, k, L; - for (L = 0; L <= c; L++) { + for (L = 0; L <= o; L++) { let O = []; - for (k = 0; k <= x; k++) { - let R = k / x, P = L / c, U = -s * Math.cos(v + R * M) * Math.sin(E + P * $), B = s * Math.cos(E + P * $), N = s * Math.sin(v + R * M) * Math.sin(E + P * $); - var z = new r.Vector3(U, B, N); - z.normalize(), g.vertices.push({ x: U, y: B, z: N }), g.normals.push(z), O.push(g.vertices.length - 1); + for (k = 0; k <= w; k++) { + let R = k / w, N = L / o, W = -s * Math.cos(v + R * M) * Math.sin(E + N * $), B = s * Math.cos(E + N * $), P = s * Math.sin(v + R * M) * Math.sin(E + N * $); + var z = new r.Vector3(W, B, P); + z.normalize(), g.vertices.push({ x: W, y: B, z: P }), g.normals.push(z), O.push(g.vertices.length - 1); } g.verticesRows.push(O); } - return _.set(s, g), g; - } - } - var b = new w(); - function A(f, s, h, _, g) { - var x = b.getVerticesForRadius(h, g), c = x.vertices, v = x.normals, M = f.updateGeoGroup(c.length), E = M.vertices, $ = M.vertexArray, k = M.colorArray, L = M.faceArray, z = M.lineArray, O = M.normalArray; - for (let U = 0, B = c.length; U < B; ++U) { - let N = 3 * (E + U), G = c[U]; - $[N] = G.x + s.x, $[N + 1] = G.y + s.y, $[N + 2] = G.z + s.z, k[N] = _.r, k[N + 1] = _.g, k[N + 2] = _.b; - } - M.vertices += c.length; - let R = x.verticesRows, P = R.length - 1; - for (let U = 0; U < P; U++) { - let B = R[U].length - 1; - for (let N = 0; N < B; N++) { - let G = M.faceidx, H = M.lineidx, W = R[U][N + 1] + E, V = W * 3, re = R[U][N] + E, ie = re * 3, ee = R[U + 1][N] + E, ce = ee * 3, he = R[U + 1][N + 1] + E, le = he * 3, J = v[W - E], Me = v[re - E], se = v[ee - E], Ce = v[he - E]; - Math.abs(c[W - E].y) === h ? (O[V] = J.x, O[ce] = se.x, O[le] = Ce.x, O[V + 1] = J.y, O[ce + 1] = se.y, O[le + 1] = Ce.y, O[V + 2] = J.z, O[ce + 2] = se.z, O[le + 2] = Ce.z, L[G] = W, L[G + 1] = ee, L[G + 2] = he, z[H] = W, z[H + 1] = ee, z[H + 2] = W, z[H + 3] = he, z[H + 4] = ee, z[H + 5] = he, M.faceidx += 3, M.lineidx += 6) : Math.abs(c[ee - E].y) === h ? (O[V] = J.x, O[ie] = Me.x, O[ce] = se.x, O[V + 1] = J.y, O[ie + 1] = Me.y, O[ce + 1] = se.y, O[V + 2] = J.z, O[ie + 2] = Me.z, O[ce + 2] = se.z, L[G] = W, L[G + 1] = re, L[G + 2] = ee, z[H] = W, z[H + 1] = re, z[H + 2] = W, z[H + 3] = ee, z[H + 4] = re, z[H + 5] = ee, M.faceidx += 3, M.lineidx += 6) : (O[V] = J.x, O[ie] = Me.x, O[le] = Ce.x, O[V + 1] = J.y, O[ie + 1] = Me.y, O[le + 1] = Ce.y, O[V + 2] = J.z, O[ie + 2] = Me.z, O[le + 2] = Ce.z, O[ie] = Me.x, O[ce] = se.x, O[le] = Ce.x, O[ie + 1] = Me.y, O[ce + 1] = se.y, O[le + 1] = Ce.y, O[ie + 2] = Me.z, O[ce + 2] = se.z, O[le + 2] = Ce.z, L[G] = W, L[G + 1] = re, L[G + 2] = he, L[G + 3] = re, L[G + 4] = ee, L[G + 5] = he, z[H] = W, z[H + 1] = re, z[H + 2] = W, z[H + 3] = he, z[H + 4] = re, z[H + 5] = ee, z[H + 6] = ee, z[H + 7] = he, M.faceidx += 6, M.lineidx += 8); + return p.set(s, g), g; + } + } + var b = new x(); + function A(f, s, u, p, g) { + var w = b.getVerticesForRadius(u, g), o = w.vertices, v = w.normals, M = f.updateGeoGroup(o.length), E = M.vertices, $ = M.vertexArray, k = M.colorArray, L = M.faceArray, z = M.lineArray, O = M.normalArray; + for (let W = 0, B = o.length; W < B; ++W) { + let P = 3 * (E + W), G = o[W]; + $[P] = G.x + s.x, $[P + 1] = G.y + s.y, $[P + 2] = G.z + s.z, k[P] = p.r, k[P + 1] = p.g, k[P + 2] = p.b; + } + M.vertices += o.length; + let R = w.verticesRows, N = R.length - 1; + for (let W = 0; W < N; W++) { + let B = R[W].length - 1; + for (let P = 0; P < B; P++) { + let G = M.faceidx, H = M.lineidx, U = R[W][P + 1] + E, j = U * 3, re = R[W][P] + E, ie = re * 3, te = R[W + 1][P] + E, ue = te * 3, de = R[W + 1][P + 1] + E, oe = de * 3, J = v[U - E], Ee = v[re - E], se = v[te - E], Ae = v[de - E]; + Math.abs(o[U - E].y) === u ? (O[j] = J.x, O[ue] = se.x, O[oe] = Ae.x, O[j + 1] = J.y, O[ue + 1] = se.y, O[oe + 1] = Ae.y, O[j + 2] = J.z, O[ue + 2] = se.z, O[oe + 2] = Ae.z, L[G] = U, L[G + 1] = te, L[G + 2] = de, z[H] = U, z[H + 1] = te, z[H + 2] = U, z[H + 3] = de, z[H + 4] = te, z[H + 5] = de, M.faceidx += 3, M.lineidx += 6) : Math.abs(o[te - E].y) === u ? (O[j] = J.x, O[ie] = Ee.x, O[ue] = se.x, O[j + 1] = J.y, O[ie + 1] = Ee.y, O[ue + 1] = se.y, O[j + 2] = J.z, O[ie + 2] = Ee.z, O[ue + 2] = se.z, L[G] = U, L[G + 1] = re, L[G + 2] = te, z[H] = U, z[H + 1] = re, z[H + 2] = U, z[H + 3] = te, z[H + 4] = re, z[H + 5] = te, M.faceidx += 3, M.lineidx += 6) : (O[j] = J.x, O[ie] = Ee.x, O[oe] = Ae.x, O[j + 1] = J.y, O[ie + 1] = Ee.y, O[oe + 1] = Ae.y, O[j + 2] = J.z, O[ie + 2] = Ee.z, O[oe + 2] = Ae.z, O[ie] = Ee.x, O[ue] = se.x, O[oe] = Ae.x, O[ie + 1] = Ee.y, O[ue + 1] = se.y, O[oe + 1] = Ae.y, O[ie + 2] = Ee.z, O[ue + 2] = se.z, O[oe + 2] = Ae.z, L[G] = U, L[G + 1] = re, L[G + 2] = de, L[G + 3] = re, L[G + 4] = te, L[G + 5] = de, z[H] = U, z[H + 1] = re, z[H + 2] = U, z[H + 3] = de, z[H + 4] = re, z[H + 5] = te, z[H + 6] = te, z[H + 7] = de, M.faceidx += 6, M.lineidx += 8); } } } - d.drawSphere = A; + h.drawSphere = A; })(l || (l = {})); } ), @@ -19663,16 +19663,16 @@ void main() { ), l = t( /*! ./WebGL/math */ "./src/WebGL/math/index.ts" - ), d = t( + ), h = t( /*! ./colors */ "./src/colors.ts" - ), o = t( + ), c = t( /*! ./GLDraw */ "./src/GLDraw.ts" - ), u = t( + ), d = t( /*! ./glcartoon */ "./src/glcartoon.ts" - ), p = t( + ), _ = t( /*! ./utilities */ "./src/utilities.ts" ), m = t( @@ -19681,7 +19681,7 @@ void main() { ), y = t( /*! ./parsers */ "./src/parsers/index.ts" - ), w = t( + ), x = t( /*! netcdfjs */ "./node_modules/netcdfjs/lib-esm/index.js" ), b = t( @@ -19691,11 +19691,11 @@ void main() { class A { // class functions // return true if a and b represent the same style - static sameObj(s, h) { - return s && h ? JSON.stringify(s) == JSON.stringify(h) : s == h; + static sameObj(s, u) { + return s && u ? JSON.stringify(s) == JSON.stringify(u) : s == u; } - constructor(s, h) { - this.atoms = [], this.frames = [], this.box = null, this.atomdfs = null, this.id = 0, this.hidden = !1, this.molObj = null, this.renderedMolObj = null, this.lastColors = null, this.modelData = {}, this.modelDatas = null, this.idMatrix = new l.Matrix4(), this.dontDuplicateAtoms = !0, this.defaultColor = d.elementColors.defaultColor, this.defaultStickRadius = 0.25, this.options = h || {}, this.ElementColors = this.options.defaultcolors ? this.options.defaultcolors : d.elementColors.defaultColors, this.defaultSphereRadius = this.options.defaultSphereRadius ? this.options.defaultSphereRadius : 1.5, this.defaultCartoonQuality = this.options.cartoonQuality ? this.options.cartoonQuality : 10, this.id = s; + constructor(s, u) { + this.atoms = [], this.frames = [], this.box = null, this.atomdfs = null, this.id = 0, this.hidden = !1, this.molObj = null, this.renderedMolObj = null, this.lastColors = null, this.modelData = {}, this.modelDatas = null, this.idMatrix = new l.Matrix4(), this.dontDuplicateAtoms = !0, this.defaultColor = h.elementColors.defaultColor, this.defaultStickRadius = 0.25, this.options = u || {}, this.ElementColors = this.options.defaultcolors ? this.options.defaultcolors : h.elementColors.defaultColors, this.defaultSphereRadius = this.options.defaultSphereRadius ? this.options.defaultSphereRadius : 1.5, this.defaultCartoonQuality = this.options.cartoonQuality ? this.options.cartoonQuality : 10, this.id = s; } // return proper radius for atom given style /** @@ -19705,17 +19705,17 @@ void main() { * @return {number} * */ - getRadiusFromStyle(s, h) { - var _ = this.defaultSphereRadius; - if (typeof h.radius < "u") - _ = h.radius; + getRadiusFromStyle(s, u) { + var p = this.defaultSphereRadius; + if (typeof u.radius < "u") + p = u.radius; else if (A.vdwRadii[s.elem]) - _ = A.vdwRadii[s.elem]; + p = A.vdwRadii[s.elem]; else if (s.elem.length > 1) { let g = s.elem; - g = g[0].toUpperCase() + g[1].toLowerCase(), A.vdwRadii[g] && (_ = A.vdwRadii[g]); + g = g[0].toUpperCase() + g[1].toLowerCase(), A.vdwRadii[g] && (p = A.vdwRadii[g]); } - return typeof h.scale < "u" && (_ *= h.scale), _; + return typeof u.scale < "u" && (p *= u.scale), p; } // cross drawing /** @@ -19723,24 +19723,24 @@ void main() { * @param {AtomSpec} atom * @param {Record} geos */ - drawAtomCross(s, h) { + drawAtomCross(s, u) { if (s.style.cross) { - var _ = s.style.cross; - if (!_.hidden) { - var g = _.linewidth || A.defaultlineWidth; - h[g] || (h[g] = new r.Geometry()); - var x = h[g].updateGeoGroup(6), c = this.getRadiusFromStyle(s, _), v = [ - [c, 0, 0], - [-c, 0, 0], - [0, c, 0], - [0, -c, 0], - [0, 0, c], - [0, 0, -c] + var p = s.style.cross; + if (!p.hidden) { + var g = p.linewidth || A.defaultlineWidth; + u[g] || (u[g] = new r.Geometry()); + var w = u[g].updateGeoGroup(6), o = this.getRadiusFromStyle(s, p), v = [ + [o, 0, 0], + [-o, 0, 0], + [0, o, 0], + [0, -o, 0], + [0, 0, o], + [0, 0, -o] ], M = s.clickable || s.hoverable; M && s.intersectionShape === void 0 && (s.intersectionShape = { sphere: [], cylinder: [], line: [] }); - for (var E = (0, p.getColorFromStyle)(s, _), $ = x.vertexArray, k = x.colorArray, L = 0; L < 6; L++) { - var z = x.vertices * 3; - if (x.vertices++, $[z] = s.x + v[L][0], $[z + 1] = s.y + v[L][1], $[z + 2] = s.z + v[L][2], k[z] = E.r, k[z + 1] = E.g, k[z + 2] = E.b, M) { + for (var E = (0, _.getColorFromStyle)(s, p), $ = w.vertexArray, k = w.colorArray, L = 0; L < 6; L++) { + var z = w.vertices * 3; + if (w.vertices++, $[z] = s.x + v[L][0], $[z + 1] = s.y + v[L][1], $[z + 2] = s.z + v[L][2], k[z] = E.r, k[z + 1] = E.g, k[z + 2] = E.b, M) { var O = new l.Vector3(v[L][0], v[L][1], v[L][2]); O.multiplyScalar(0.1), O.set(O.x + s.x, O.y + s.y, O.z + s.z), s.intersectionShape.line.push(O); } @@ -19748,33 +19748,33 @@ void main() { } } } - getGoodCross(s, h, _, g) { - for (var x = null, c = -1, v = 0, M = s.bonds.length; v < M; v++) - if (s.bonds[v] != h.index) { + getGoodCross(s, u, p, g) { + for (var w = null, o = -1, v = 0, M = s.bonds.length; v < M; v++) + if (s.bonds[v] != u.index) { let $ = s.bonds[v], k = this.atoms[$], z = new l.Vector3(k.x, k.y, k.z).clone(); - z.sub(_); + z.sub(p); let O = z.clone(); O.cross(g); var E = O.lengthSq(); - if (E > c && (c = E, x = O, c > 0.1)) - return x; + if (E > o && (o = E, w = O, o > 0.1)) + return w; } - return x; + return w; } //from atom, return a normalized vector v that is orthogonal and along which //it is appropraite to draw multiple bonds - getSideBondV(s, h, _) { - var g, x, c, v, M, E = new l.Vector3(s.x, s.y, s.z), $ = new l.Vector3(h.x, h.y, h.z), k = $.clone(), L = null; + getSideBondV(s, u, p) { + var g, w, o, v, M, E = new l.Vector3(s.x, s.y, s.z), $ = new l.Vector3(u.x, u.y, u.z), k = $.clone(), L = null; if (k.sub(E), s.bonds.length === 1) - h.bonds.length === 1 ? (L = k.clone(), Math.abs(L.x) > 1e-4 ? L.y += 1 : L.x += 1) : (g = (_ + 1) % h.bonds.length, x = h.bonds[g], c = this.atoms[x], c.index == s.index && (g = (g + 1) % h.bonds.length, x = h.bonds[g], c = this.atoms[x]), v = new l.Vector3(c.x, c.y, c.z), M = v.clone(), M.sub(E), L = M.clone(), L.cross(k)); - else if (L = this.getGoodCross(s, h, E, k), L.lengthSq() < 0.01) { - var z = this.getGoodCross(h, s, E, k); + u.bonds.length === 1 ? (L = k.clone(), Math.abs(L.x) > 1e-4 ? L.y += 1 : L.x += 1) : (g = (p + 1) % u.bonds.length, w = u.bonds[g], o = this.atoms[w], o.index == s.index && (g = (g + 1) % u.bonds.length, w = u.bonds[g], o = this.atoms[w]), v = new l.Vector3(o.x, o.y, o.z), M = v.clone(), M.sub(E), L = M.clone(), L.cross(k)); + else if (L = this.getGoodCross(s, u, E, k), L.lengthSq() < 0.01) { + var z = this.getGoodCross(u, s, E, k); z != null && (L = z); } return L.lengthSq() < 0.01 && (L = k.clone(), Math.abs(L.x) > 1e-4 ? L.y += 1 : L.x += 1), L.cross(k), L.normalize(), L; } - addLine(s, h, _, g, x, c) { - s[_] = g.x, s[_ + 1] = g.y, s[_ + 2] = g.z, h[_] = c.r, h[_ + 1] = c.g, h[_ + 2] = c.b, s[_ + 3] = x.x, s[_ + 4] = x.y, s[_ + 5] = x.z, h[_ + 3] = c.r, h[_ + 4] = c.g, h[_ + 5] = c.b; + addLine(s, u, p, g, w, o) { + s[p] = g.x, s[p + 1] = g.y, s[p + 2] = g.z, u[p] = o.r, u[p + 1] = o.g, u[p + 2] = o.b, s[p + 3] = w.x, s[p + 4] = w.y, s[p + 5] = w.z, u[p + 3] = o.r, u[p + 4] = o.g, u[p + 5] = o.b; } // bonds - both atoms must match bond style // standardize on only drawing for lowest to highest @@ -19785,30 +19785,30 @@ void main() { * @param {AtomSpec[]} atoms * @param {Record} geos */ - drawBondLines(s, h, _) { + drawBondLines(s, u, p) { if (s.style.line) { var g = s.style.line; if (!g.hidden) { - var x, c, v, M, E = g.linewidth || A.defaultlineWidth; - _[E] || (_[E] = new r.Geometry()); - for (var $ = _[E].updateGeoGroup(6 * s.bonds.length), k = $.vertexArray, L = $.colorArray, z = 0; z < s.bonds.length; z++) { - var O = s.bonds[z], R = h[O]; + var w, o, v, M, E = g.linewidth || A.defaultlineWidth; + p[E] || (p[E] = new r.Geometry()); + for (var $ = p[E].updateGeoGroup(6 * s.bonds.length), k = $.vertexArray, L = $.colorArray, z = 0; z < s.bonds.length; z++) { + var O = s.bonds[z], R = u[O]; if (R.style.line && !(s.index >= R.index)) { - var P = new l.Vector3(s.x, s.y, s.z), U = new l.Vector3(R.x, R.y, R.z), B = P.clone().add(U).multiplyScalar(0.5), N = !1, G = s.clickable || s.hoverable, H = R.clickable || R.hoverable; - (G || H) && (G && (s.intersectionShape === void 0 && (s.intersectionShape = { sphere: [], cylinder: [], line: [], triangle: [] }), s.intersectionShape.line.push(P), s.intersectionShape.line.push(B)), H && (R.intersectionShape === void 0 && (R.intersectionShape = { sphere: [], cylinder: [], line: [], triangle: [] }), R.intersectionShape.line.push(B), R.intersectionShape.line.push(U))); - var W = (0, p.getColorFromStyle)(s, s.style.line), V = (0, p.getColorFromStyle)(R, R.style.line); + var N = new l.Vector3(s.x, s.y, s.z), W = new l.Vector3(R.x, R.y, R.z), B = N.clone().add(W).multiplyScalar(0.5), P = !1, G = s.clickable || s.hoverable, H = R.clickable || R.hoverable; + (G || H) && (G && (s.intersectionShape === void 0 && (s.intersectionShape = { sphere: [], cylinder: [], line: [], triangle: [] }), s.intersectionShape.line.push(N), s.intersectionShape.line.push(B)), H && (R.intersectionShape === void 0 && (R.intersectionShape = { sphere: [], cylinder: [], line: [], triangle: [] }), R.intersectionShape.line.push(B), R.intersectionShape.line.push(W))); + var U = (0, _.getColorFromStyle)(s, s.style.line), j = (0, _.getColorFromStyle)(R, R.style.line); if (s.bondStyles && s.bondStyles[z]) { var re = s.bondStyles[z]; if (!re.iswire) continue; - re.singleBond && (N = !0), typeof re.color1 < "u" && (W = d.CC.color(re.color1)), typeof re.color2 < "u" && (V = d.CC.color(re.color2)); + re.singleBond && (P = !0), typeof re.color1 < "u" && (U = h.CC.color(re.color1)), typeof re.color2 < "u" && (j = h.CC.color(re.color2)); } - var ie = $.vertices * 3, ee, ce; - if (s.bondOrder[z] > 1 && s.bondOrder[z] < 4 && !N) { - var he = this.getSideBondV(s, R, z), le = U.clone(); - le.sub(P), s.bondOrder[z] == 2 ? (he.multiplyScalar(0.1), x = P.clone(), x.add(he), c = P.clone(), c.sub(he), v = x.clone(), v.add(le), M = c.clone(), M.add(le), W == V ? ($.vertices += 4, this.addLine(k, L, ie, x, v, W), this.addLine(k, L, ie + 6, c, M, W)) : ($.vertices += 8, le.multiplyScalar(0.5), ee = x.clone(), ee.add(le), ce = c.clone(), ce.add(le), this.addLine(k, L, ie, x, ee, W), this.addLine(k, L, ie + 6, ee, v, V), this.addLine(k, L, ie + 12, c, ce, W), this.addLine(k, L, ie + 18, ce, M, V))) : s.bondOrder[z] == 3 && (he.multiplyScalar(0.1), x = P.clone(), x.add(he), c = P.clone(), c.sub(he), v = x.clone(), v.add(le), M = c.clone(), M.add(le), W == V ? ($.vertices += 6, this.addLine(k, L, ie, P, U, W), this.addLine(k, L, ie + 6, x, v, W), this.addLine(k, L, ie + 12, c, M, W)) : ($.vertices += 12, le.multiplyScalar(0.5), ee = x.clone(), ee.add(le), ce = c.clone(), ce.add(le), this.addLine(k, L, ie, P, B, W), this.addLine(k, L, ie + 6, B, U, V), this.addLine(k, L, ie + 12, x, ee, W), this.addLine(k, L, ie + 18, ee, v, V), this.addLine(k, L, ie + 24, c, ce, W), this.addLine(k, L, ie + 30, ce, M, V))); + var ie = $.vertices * 3, te, ue; + if (s.bondOrder[z] > 1 && s.bondOrder[z] < 4 && !P) { + var de = this.getSideBondV(s, R, z), oe = W.clone(); + oe.sub(N), s.bondOrder[z] == 2 ? (de.multiplyScalar(0.1), w = N.clone(), w.add(de), o = N.clone(), o.sub(de), v = w.clone(), v.add(oe), M = o.clone(), M.add(oe), U == j ? ($.vertices += 4, this.addLine(k, L, ie, w, v, U), this.addLine(k, L, ie + 6, o, M, U)) : ($.vertices += 8, oe.multiplyScalar(0.5), te = w.clone(), te.add(oe), ue = o.clone(), ue.add(oe), this.addLine(k, L, ie, w, te, U), this.addLine(k, L, ie + 6, te, v, j), this.addLine(k, L, ie + 12, o, ue, U), this.addLine(k, L, ie + 18, ue, M, j))) : s.bondOrder[z] == 3 && (de.multiplyScalar(0.1), w = N.clone(), w.add(de), o = N.clone(), o.sub(de), v = w.clone(), v.add(oe), M = o.clone(), M.add(oe), U == j ? ($.vertices += 6, this.addLine(k, L, ie, N, W, U), this.addLine(k, L, ie + 6, w, v, U), this.addLine(k, L, ie + 12, o, M, U)) : ($.vertices += 12, oe.multiplyScalar(0.5), te = w.clone(), te.add(oe), ue = o.clone(), ue.add(oe), this.addLine(k, L, ie, N, B, U), this.addLine(k, L, ie + 6, B, W, j), this.addLine(k, L, ie + 12, w, te, U), this.addLine(k, L, ie + 18, te, v, j), this.addLine(k, L, ie + 24, o, ue, U), this.addLine(k, L, ie + 30, ue, M, j))); } else - W == V ? ($.vertices += 2, this.addLine(k, L, ie, P, U, W)) : ($.vertices += 4, this.addLine(k, L, ie, P, B, W), this.addLine(k, L, ie + 6, B, U, V)); + U == j ? ($.vertices += 2, this.addLine(k, L, ie, N, W, U)) : ($.vertices += 4, this.addLine(k, L, ie, N, B, U), this.addLine(k, L, ie + 6, B, W, j)); } } } @@ -19821,144 +19821,144 @@ void main() { * @param {AtomSpec} atom * @param {Geometry} geo */ - drawAtomSphere(s, h) { + drawAtomSphere(s, u) { if (s.style.sphere) { - var _ = s.style.sphere; - if (!_.hidden) { - var g = (0, p.getColorFromStyle)(s, _), x = this.getRadiusFromStyle(s, _); + var p = s.style.sphere; + if (!p.hidden) { + var g = (0, _.getColorFromStyle)(s, p), w = this.getRadiusFromStyle(s, p); if ((s.clickable === !0 || s.hoverable) && s.intersectionShape !== void 0) { - var c = new l.Vector3(s.x, s.y, s.z); - s.intersectionShape.sphere.push(new a.Sphere(c, x)); + var o = new l.Vector3(s.x, s.y, s.z); + s.intersectionShape.sphere.push(new a.Sphere(o, w)); } - o.GLDraw.drawSphere(h, s, x, g); + c.GLDraw.drawSphere(u, s, w, g); } } } /** Register atom shaped click handlers */ drawAtomClickSphere(s) { if (s.style.clicksphere) { - var h = s.style.clicksphere; - if (!h.hidden) { - var _ = this.getRadiusFromStyle(s, h); + var u = s.style.clicksphere; + if (!u.hidden) { + var p = this.getRadiusFromStyle(s, u); if ((s.clickable === !0 || s.hoverable) && s.intersectionShape !== void 0) { var g = new l.Vector3(s.x, s.y, s.z); - s.intersectionShape.sphere.push(new a.Sphere(g, _)); + s.intersectionShape.sphere.push(new a.Sphere(g, p)); } } } } - drawAtomInstanced(s, h) { + drawAtomInstanced(s, u) { if (s.style.sphere) { - var _ = s.style.sphere; - if (!_.hidden) { - var g = this.getRadiusFromStyle(s, _), x = (0, p.getColorFromStyle)(s, _), c = h.updateGeoGroup(1), v = c.vertices, M = v * 3, E = c.vertexArray, $ = c.colorArray, k = c.radiusArray; - if (E[M] = s.x, E[M + 1] = s.y, E[M + 2] = s.z, $[M] = x.r, $[M + 1] = x.g, $[M + 2] = x.b, k[v] = g, (s.clickable === !0 || s.hoverable) && s.intersectionShape !== void 0) { + var p = s.style.sphere; + if (!p.hidden) { + var g = this.getRadiusFromStyle(s, p), w = (0, _.getColorFromStyle)(s, p), o = u.updateGeoGroup(1), v = o.vertices, M = v * 3, E = o.vertexArray, $ = o.colorArray, k = o.radiusArray; + if (E[M] = s.x, E[M + 1] = s.y, E[M + 2] = s.z, $[M] = w.r, $[M + 1] = w.g, $[M + 2] = w.b, k[v] = g, (s.clickable === !0 || s.hoverable) && s.intersectionShape !== void 0) { var L = new l.Vector3(s.x, s.y, s.z); s.intersectionShape.sphere.push(new a.Sphere(L, g)); } - c.vertices += 1; + o.vertices += 1; } } } - drawSphereImposter(s, h, _, g) { - var x = s.updateGeoGroup(4), c, v = x.vertices, M = v * 3, E = x.vertexArray, $ = x.colorArray; - for (c = 0; c < 4; c++) - E[M + 3 * c] = h.x, E[M + 3 * c + 1] = h.y, E[M + 3 * c + 2] = h.z; - var k = x.normalArray; - for (c = 0; c < 4; c++) - $[M + 3 * c] = g.r, $[M + 3 * c + 1] = g.g, $[M + 3 * c + 2] = g.b; - k[M + 0] = -_, k[M + 1] = _, k[M + 2] = 0, k[M + 3] = -_, k[M + 4] = -_, k[M + 5] = 0, k[M + 6] = _, k[M + 7] = -_, k[M + 8] = 0, k[M + 9] = _, k[M + 10] = _, k[M + 11] = 0, x.vertices += 4; - var L = x.faceArray, z = x.faceidx; - L[z + 0] = v, L[z + 1] = v + 1, L[z + 2] = v + 2, L[z + 3] = v + 2, L[z + 4] = v + 3, L[z + 5] = v, x.faceidx += 6; + drawSphereImposter(s, u, p, g) { + var w = s.updateGeoGroup(4), o, v = w.vertices, M = v * 3, E = w.vertexArray, $ = w.colorArray; + for (o = 0; o < 4; o++) + E[M + 3 * o] = u.x, E[M + 3 * o + 1] = u.y, E[M + 3 * o + 2] = u.z; + var k = w.normalArray; + for (o = 0; o < 4; o++) + $[M + 3 * o] = g.r, $[M + 3 * o + 1] = g.g, $[M + 3 * o + 2] = g.b; + k[M + 0] = -p, k[M + 1] = p, k[M + 2] = 0, k[M + 3] = -p, k[M + 4] = -p, k[M + 5] = 0, k[M + 6] = p, k[M + 7] = -p, k[M + 8] = 0, k[M + 9] = p, k[M + 10] = p, k[M + 11] = 0, w.vertices += 4; + var L = w.faceArray, z = w.faceidx; + L[z + 0] = v, L[z + 1] = v + 1, L[z + 2] = v + 2, L[z + 3] = v + 2, L[z + 4] = v + 3, L[z + 5] = v, w.faceidx += 6; } //dkoes - code for sphere imposters - drawAtomImposter(s, h) { + drawAtomImposter(s, u) { if (s.style.sphere) { - var _ = s.style.sphere; - if (!_.hidden) { - var g = this.getRadiusFromStyle(s, _), x = (0, p.getColorFromStyle)(s, _); + var p = s.style.sphere; + if (!p.hidden) { + var g = this.getRadiusFromStyle(s, p), w = (0, _.getColorFromStyle)(s, p); if ((s.clickable === !0 || s.hoverable) && s.intersectionShape !== void 0) { - var c = new l.Vector3(s.x, s.y, s.z); - s.intersectionShape.sphere.push(new a.Sphere(c, g)); + var o = new l.Vector3(s.x, s.y, s.z); + s.intersectionShape.sphere.push(new a.Sphere(o, g)); } - this.drawSphereImposter(h, s, g, x); + this.drawSphereImposter(u, s, g, w); } } } - calculateDashes(s, h, _, g, x) { - var c = Math.sqrt(Math.pow(s.x - h.x, 2) + Math.pow(s.y - h.y, 2) + Math.pow(s.z - h.z, 2)); - _ = Math.max(_, 0), x = Math.max(x, 0) + 2 * _, g = Math.max(g, 1e-3), g + x > c && (g = c, x = 0); - var v = Math.floor((c - g) / (g + x)) + 1, M = v * g; - x = (c - M) / v; - for (var E, $ = new l.Vector3(s.x, s.y, s.z), k = new l.Vector3((h.x - s.x) / (c / x), (h.y - s.y) / (c / x), (h.z - s.z) / (c / x)), L = new l.Vector3((h.x - s.x) / (c / g), (h.y - s.y) / (c / g), (h.z - s.z) / (c / g)), z = [], O = 0; O < v; O++) + calculateDashes(s, u, p, g, w) { + var o = Math.sqrt(Math.pow(s.x - u.x, 2) + Math.pow(s.y - u.y, 2) + Math.pow(s.z - u.z, 2)); + p = Math.max(p, 0), w = Math.max(w, 0) + 2 * p, g = Math.max(g, 1e-3), g + w > o && (g = o, w = 0); + var v = Math.floor((o - g) / (g + w)) + 1, M = v * g; + w = (o - M) / v; + for (var E, $ = new l.Vector3(s.x, s.y, s.z), k = new l.Vector3((u.x - s.x) / (o / w), (u.y - s.y) / (o / w), (u.z - s.z) / (o / w)), L = new l.Vector3((u.x - s.x) / (o / g), (u.y - s.y) / (o / g), (u.z - s.z) / (o / g)), z = [], O = 0; O < v; O++) E = new l.Vector3($.x + L.x, $.y + L.y, $.z + L.z), z.push({ from: $, to: E }), $ = new l.Vector3(E.x + k.x, E.y + k.y, E.z + k.z); return z; } - static drawStickImposter(s, h, _, g, x, c = 0, v = 0) { - for (var M = s.updateGeoGroup(4), E = M.vertices, $ = E * 3, k = M.vertexArray, L = M.colorArray, z = M.radiusArray, O = M.normalArray, R = x.r, P = x.g, U = x.b, B = function(V) { - var re = -V; + static drawStickImposter(s, u, p, g, w, o = 0, v = 0) { + for (var M = s.updateGeoGroup(4), E = M.vertices, $ = E * 3, k = M.vertexArray, L = M.colorArray, z = M.radiusArray, O = M.normalArray, R = w.r, N = w.g, W = w.b, B = function(j) { + var re = -j; return re == 0 && (re = -1e-4), re; - }, N = $, G = 0; G < 4; G++) - k[N] = h.x, O[N] = _.x, L[N] = R, N++, k[N] = h.y, O[N] = _.y, L[N] = P, N++, k[N] = h.z, O[N] = _.z, G < 2 ? L[N] = U : L[N] = B(U), N++; + }, P = $, G = 0; G < 4; G++) + k[P] = u.x, O[P] = p.x, L[P] = R, P++, k[P] = u.y, O[P] = p.y, L[P] = N, P++, k[P] = u.z, O[P] = p.z, G < 2 ? L[P] = W : L[P] = B(W), P++; M.vertices += 4, z[E] = -g, z[E + 1] = g, z[E + 2] = -g, z[E + 3] = g; - var H = M.faceArray, W = M.faceidx; - H[W + 0] = E, H[W + 1] = E + 1, H[W + 2] = E + 2, H[W + 3] = E + 2, H[W + 4] = E + 3, H[W + 5] = E, M.faceidx += 6; + var H = M.faceArray, U = M.faceidx; + H[U + 0] = E, H[U + 1] = E + 1, H[U + 2] = E + 2, H[U + 3] = E + 2, H[U + 4] = E + 3, H[U + 5] = E, M.faceidx += 6; } // draws cylinders and small spheres (at bond radius) - drawBondSticks(s, h, _) { - var g, x; + drawBondSticks(s, u, p) { + var g, w; if (s.style.stick) { - var c = s.style.stick; - if (!c.hidden) { - var v = c.radius || this.defaultStickRadius, M = c.doubleBondScaling || 0.4, E = c.tripleBondScaling || 0.25, $ = ((g = c.dashedBondConfig) === null || g === void 0 ? void 0 : g.dashLength) || 0.1, k = ((x = c.dashedBondConfig) === null || x === void 0 ? void 0 : x.gapLength) || 0.25, L = v, z = c.singleBonds || !1, O = c.dashedBonds || !1, R = 0, P = 0, U, B, N, G, H, W, V, re, ie, ee, ce, he = (0, p.getColorFromStyle)(s, c), le, J, Me; + var o = s.style.stick; + if (!o.hidden) { + var v = o.radius || this.defaultStickRadius, M = o.doubleBondScaling || 0.4, E = o.tripleBondScaling || 0.25, $ = ((g = o.dashedBondConfig) === null || g === void 0 ? void 0 : g.dashLength) || 0.1, k = ((w = o.dashedBondConfig) === null || w === void 0 ? void 0 : w.gapLength) || 0.25, L = v, z = o.singleBonds || !1, O = o.dashedBonds || !1, R = 0, N = 0, W, B, P, G, H, U, j, re, ie, te, ue, de = (0, _.getColorFromStyle)(s, o), oe, J, Ee; !s.capDrawn && s.bonds.length < 4 && (R = 2); - var se = (fe) => { - var Se = _.imposter ? A.drawStickImposter : o.GLDraw.drawCylinder; - return !O && fe >= 1 ? Se : (Ne, pe, ke, X, Be, Ge = 0, I = 0, ye = 0.1, ve = 0.25) => { - var Z = this.calculateDashes(pe, ke, X, ye, ve); - Z.forEach((de) => { - Se(Ne, de.from, de.to, X, Be, Ge, I); + var se = (me) => { + var we = p.imposter ? A.drawStickImposter : c.GLDraw.drawCylinder; + return !O && me >= 1 ? we : (Re, pe, $e, X, ze, Ve = 0, I = 0, xe = 0.1, be = 0.25) => { + var q = this.calculateDashes(pe, $e, X, xe, be); + q.forEach((fe) => { + we(Re, fe.from, fe.to, X, ze, Ve, I); }); }; }; - for (N = 0; N < s.bonds.length; N++) { - var Ce = se(s.bondOrder[N]), ue = s.bonds[N], ne = h[ue]; - if (le = J = Me = null, s.index < ne.index) { + for (P = 0; P < s.bonds.length; P++) { + var Ae = se(s.bondOrder[P]), he = s.bonds[P], ne = u[he]; + if (oe = J = Ee = null, s.index < ne.index) { var _e = ne.style; if (!_e.stick || _e.stick.hidden) continue; - var Oe = (0, p.getColorFromStyle)(ne, _e.stick); - if (L = v, G = z, s.bondStyles && s.bondStyles[N]) { - if (H = s.bondStyles[N], H.iswire) + var Le = (0, _.getColorFromStyle)(ne, _e.stick); + if (L = v, G = z, s.bondStyles && s.bondStyles[P]) { + if (H = s.bondStyles[P], H.iswire) continue; - H.radius && (L = H.radius), H.singleBond && (G = !0), typeof H.color1 < "u" && (he = d.CC.color(H.color1)), typeof H.color2 < "u" && (Oe = d.CC.color(H.color2)); + H.radius && (L = H.radius), H.singleBond && (G = !0), typeof H.color1 < "u" && (de = h.CC.color(H.color1)), typeof H.color2 < "u" && (Le = h.CC.color(H.color2)); } - var Re = new l.Vector3(s.x, s.y, s.z), Ue = new l.Vector3(ne.x, ne.y, ne.z); - if (s.bondOrder[N] <= 1 || G || s.bondOrder[N] > 3) { - if (s.bondOrder[N] < 1 && (L *= s.bondOrder[N]), !ne.capDrawn && ne.bonds.length < 4 && (P = 2), he != Oe ? (le = new l.Vector3().addVectors(Re, Ue).multiplyScalar(0.5), Ce(_, Re, le, L, he, R, 0, $, k), Ce(_, le, Ue, L, Oe, 0, P, $, k)) : Ce(_, Re, Ue, L, he, R, P, $, k), U = s.clickable || s.hoverable, B = ne.clickable || ne.hoverable, U || B) { - if (le || (le = new l.Vector3().addVectors(Re, Ue).multiplyScalar(0.5)), U) { - var We = new a.Cylinder(Re, le, L), Ee = new a.Sphere(Re, L); - s.intersectionShape.cylinder.push(We), s.intersectionShape.sphere.push(Ee); + var Be = new l.Vector3(s.x, s.y, s.z), Ue = new l.Vector3(ne.x, ne.y, ne.z); + if (s.bondOrder[P] <= 1 || G || s.bondOrder[P] > 3) { + if (s.bondOrder[P] < 1 && (L *= s.bondOrder[P]), !ne.capDrawn && ne.bonds.length < 4 && (N = 2), de != Le ? (oe = new l.Vector3().addVectors(Be, Ue).multiplyScalar(0.5), Ae(p, Be, oe, L, de, R, 0, $, k), Ae(p, oe, Ue, L, Le, 0, N, $, k)) : Ae(p, Be, Ue, L, de, R, N, $, k), W = s.clickable || s.hoverable, B = ne.clickable || ne.hoverable, W || B) { + if (oe || (oe = new l.Vector3().addVectors(Be, Ue).multiplyScalar(0.5)), W) { + var He = new a.Cylinder(Be, oe, L), We = new a.Sphere(Be, L); + s.intersectionShape.cylinder.push(He), s.intersectionShape.sphere.push(We); } if (B) { - var Ae = new a.Cylinder(Ue, le, L), ge = new a.Sphere(Ue, L); - ne.intersectionShape.cylinder.push(Ae), ne.intersectionShape.sphere.push(ge); + var Ge = new a.Cylinder(Ue, oe, L), Ne = new a.Sphere(Ue, L); + ne.intersectionShape.cylinder.push(Ge), ne.intersectionShape.sphere.push(Ne); } } - } else if (s.bondOrder[N] > 1) { - var Le = 0, Te = 0; - L != v && (Le = 2, Te = 2); - var Ke = Ue.clone(), je = null; - Ke.sub(Re); - var Y, q, te, we, me; - je = this.getSideBondV(s, ne, N), s.bondOrder[N] == 2 ? (Y = L * M, je.multiplyScalar(Y * 1.5), q = Re.clone(), q.add(je), te = Re.clone(), te.sub(je), we = q.clone(), we.add(Ke), me = te.clone(), me.add(Ke), he != Oe ? (le = new l.Vector3().addVectors(q, we).multiplyScalar(0.5), J = new l.Vector3().addVectors(te, me).multiplyScalar(0.5), Ce(_, q, le, Y, he, Le, 0), Ce(_, le, we, Y, Oe, 0, Te), Ce(_, te, J, Y, he, Le, 0), Ce(_, J, me, Y, Oe, 0, Te)) : (Ce(_, q, we, Y, he, Le, Te), Ce(_, te, me, Y, he, Le, Te)), U = s.clickable || s.hoverable, B = ne.clickable || ne.hoverable, (U || B) && (le || (le = new l.Vector3().addVectors(q, we).multiplyScalar(0.5)), J || (J = new l.Vector3().addVectors(te, me).multiplyScalar(0.5)), U && (W = new a.Cylinder(q, le, Y), V = new a.Cylinder(te, J, Y), s.intersectionShape.cylinder.push(W), s.intersectionShape.cylinder.push(V)), B && (ie = new a.Cylinder(we, le, Y), ee = new a.Cylinder(me, J, Y), ne.intersectionShape.cylinder.push(ie), ne.intersectionShape.cylinder.push(ee)))) : s.bondOrder[N] == 3 && (Y = L * E, je.cross(Ke), je.normalize(), je.multiplyScalar(Y * 3), q = Re.clone(), q.add(je), te = Re.clone(), te.sub(je), we = q.clone(), we.add(Ke), me = te.clone(), me.add(Ke), he != Oe ? (le = new l.Vector3().addVectors(q, we).multiplyScalar(0.5), J = new l.Vector3().addVectors(te, me).multiplyScalar(0.5), Me = new l.Vector3().addVectors(Re, Ue).multiplyScalar(0.5), Ce(_, q, le, Y, he, Le, 0), Ce(_, le, we, Y, Oe, 0, Te), Ce(_, Re, Me, Y, he, R, 0), Ce(_, Me, Ue, Y, Oe, 0, P), Ce(_, te, J, Y, he, Le, 0), Ce(_, J, me, Y, Oe, 0, Te)) : (Ce(_, q, we, Y, he, Le, Te), Ce(_, Re, Ue, Y, he, R, P), Ce(_, te, me, Y, he, Le, Te)), U = s.clickable || s.hoverable, B = ne.clickable || ne.hoverable, (U || B) && (le || (le = new l.Vector3().addVectors(q, we).multiplyScalar(0.5)), J || (J = new l.Vector3().addVectors(te, me).multiplyScalar(0.5)), Me || (Me = new l.Vector3().addVectors(Re, Ue).multiplyScalar(0.5)), U && (W = new a.Cylinder(q.clone(), le.clone(), Y), V = new a.Cylinder(te.clone(), J.clone(), Y), re = new a.Cylinder(Re.clone(), Me.clone(), Y), s.intersectionShape.cylinder.push(W), s.intersectionShape.cylinder.push(V), s.intersectionShape.cylinder.push(re)), B && (ie = new a.Cylinder(we.clone(), le.clone(), Y), ee = new a.Cylinder(me.clone(), J.clone(), Y), ce = new a.Cylinder(Ue.clone(), Me.clone(), Y), ne.intersectionShape.cylinder.push(ie), ne.intersectionShape.cylinder.push(ee), ne.intersectionShape.cylinder.push(ce)))); + } else if (s.bondOrder[P] > 1) { + var Pe = 0, Te = 0; + L != v && (Pe = 2, Te = 2); + var Me = Ue.clone(), De = null; + Me.sub(Be); + var V, Z, ee, ye, ce; + De = this.getSideBondV(s, ne, P), s.bondOrder[P] == 2 ? (V = L * M, De.multiplyScalar(V * 1.5), Z = Be.clone(), Z.add(De), ee = Be.clone(), ee.sub(De), ye = Z.clone(), ye.add(Me), ce = ee.clone(), ce.add(Me), de != Le ? (oe = new l.Vector3().addVectors(Z, ye).multiplyScalar(0.5), J = new l.Vector3().addVectors(ee, ce).multiplyScalar(0.5), Ae(p, Z, oe, V, de, Pe, 0), Ae(p, oe, ye, V, Le, 0, Te), Ae(p, ee, J, V, de, Pe, 0), Ae(p, J, ce, V, Le, 0, Te)) : (Ae(p, Z, ye, V, de, Pe, Te), Ae(p, ee, ce, V, de, Pe, Te)), W = s.clickable || s.hoverable, B = ne.clickable || ne.hoverable, (W || B) && (oe || (oe = new l.Vector3().addVectors(Z, ye).multiplyScalar(0.5)), J || (J = new l.Vector3().addVectors(ee, ce).multiplyScalar(0.5)), W && (U = new a.Cylinder(Z, oe, V), j = new a.Cylinder(ee, J, V), s.intersectionShape.cylinder.push(U), s.intersectionShape.cylinder.push(j)), B && (ie = new a.Cylinder(ye, oe, V), te = new a.Cylinder(ce, J, V), ne.intersectionShape.cylinder.push(ie), ne.intersectionShape.cylinder.push(te)))) : s.bondOrder[P] == 3 && (V = L * E, De.cross(Me), De.normalize(), De.multiplyScalar(V * 3), Z = Be.clone(), Z.add(De), ee = Be.clone(), ee.sub(De), ye = Z.clone(), ye.add(Me), ce = ee.clone(), ce.add(Me), de != Le ? (oe = new l.Vector3().addVectors(Z, ye).multiplyScalar(0.5), J = new l.Vector3().addVectors(ee, ce).multiplyScalar(0.5), Ee = new l.Vector3().addVectors(Be, Ue).multiplyScalar(0.5), Ae(p, Z, oe, V, de, Pe, 0), Ae(p, oe, ye, V, Le, 0, Te), Ae(p, Be, Ee, V, de, R, 0), Ae(p, Ee, Ue, V, Le, 0, N), Ae(p, ee, J, V, de, Pe, 0), Ae(p, J, ce, V, Le, 0, Te)) : (Ae(p, Z, ye, V, de, Pe, Te), Ae(p, Be, Ue, V, de, R, N), Ae(p, ee, ce, V, de, Pe, Te)), W = s.clickable || s.hoverable, B = ne.clickable || ne.hoverable, (W || B) && (oe || (oe = new l.Vector3().addVectors(Z, ye).multiplyScalar(0.5)), J || (J = new l.Vector3().addVectors(ee, ce).multiplyScalar(0.5)), Ee || (Ee = new l.Vector3().addVectors(Be, Ue).multiplyScalar(0.5)), W && (U = new a.Cylinder(Z.clone(), oe.clone(), V), j = new a.Cylinder(ee.clone(), J.clone(), V), re = new a.Cylinder(Be.clone(), Ee.clone(), V), s.intersectionShape.cylinder.push(U), s.intersectionShape.cylinder.push(j), s.intersectionShape.cylinder.push(re)), B && (ie = new a.Cylinder(ye.clone(), oe.clone(), V), te = new a.Cylinder(ce.clone(), J.clone(), V), ue = new a.Cylinder(Ue.clone(), Ee.clone(), V), ne.intersectionShape.cylinder.push(ie), ne.intersectionShape.cylinder.push(te), ne.intersectionShape.cylinder.push(ue)))); } } } - var Pe = !1, Fe = 0, K = !1; - for (N = 0; N < s.bonds.length; N++) - G = z, s.bondStyles && s.bondStyles[N] && (H = s.bondStyles[N], H.singleBond && (G = !0), H.radius && H.radius != v && (K = !0)), (G || s.bondOrder[N] == 1) && Fe++; - K ? Fe > 0 && (Pe = !0) : Fe == 0 && (s.bonds.length > 0 || c.showNonBonded) && (Pe = !0), Pe && (L = v, _.imposter ? this.drawSphereImposter(_.sphereGeometry, s, L, he) : o.GLDraw.drawSphere(_, s, L, he)); + var Ie = !1, ke = 0, Y = !1; + for (P = 0; P < s.bonds.length; P++) + G = z, s.bondStyles && s.bondStyles[P] && (H = s.bondStyles[P], H.singleBond && (G = !0), H.radius && H.radius != v && (Y = !0)), (G || s.bondOrder[P] == 1) && ke++; + Y ? ke > 0 && (Ie = !0) : ke == 0 && (s.bonds.length > 0 || o.showNonBonded) && (Ie = !0), Ie && (L = v, p.imposter ? this.drawSphereImposter(p.sphereGeometry, s, L, de) : c.GLDraw.drawSphere(p, s, L, de)); } } } @@ -19968,83 +19968,83 @@ void main() { // at some point we should optimize this to avoid unnecessary // recalculation /** param {AtomSpec[]} atoms */ - createMolObj(s, h) { - h = h || {}; - var _ = new r.Object3D(), g = [], x = {}, c = {}, v = this.drawAtomSphere, M = null, E = null; - h.supportsImposters ? (v = this.drawAtomImposter, M = new r.Geometry(!0), M.imposter = !0, E = new r.Geometry(!0, !0), E.imposter = !0, E.sphereGeometry = new r.Geometry(!0), E.sphereGeometry.imposter = !0, E.drawnCaps = {}) : h.supportsAIA ? (v = this.drawAtomInstanced, M = new r.Geometry(!1, !0, !0), M.instanced = !0, E = new r.Geometry(!0)) : (M = new r.Geometry(!0), E = new r.Geometry(!0)); + createMolObj(s, u) { + u = u || {}; + var p = new r.Object3D(), g = [], w = {}, o = {}, v = this.drawAtomSphere, M = null, E = null; + u.supportsImposters ? (v = this.drawAtomImposter, M = new r.Geometry(!0), M.imposter = !0, E = new r.Geometry(!0, !0), E.imposter = !0, E.sphereGeometry = new r.Geometry(!0), E.sphereGeometry.imposter = !0, E.drawnCaps = {}) : u.supportsAIA ? (v = this.drawAtomInstanced, M = new r.Geometry(!1, !0, !0), M.instanced = !0, E = new r.Geometry(!0)) : (M = new r.Geometry(!0), E = new r.Geometry(!0)); var $, k, L, z, O = {}, R = [Number.POSITIVE_INFINITY, Number.NEGATIVE_INFINITY]; for ($ = 0, L = s.length; $ < L; $++) { - var P = s[$]; - if (P && P.style) { - (P.clickable || P.hoverable) && P.intersectionShape === void 0 && (P.intersectionShape = { sphere: [], cylinder: [], line: [], triangle: [] }), z = { line: void 0, cross: void 0, stick: void 0, sphere: void 0 }; + var N = s[$]; + if (N && N.style) { + (N.clickable || N.hoverable) && N.intersectionShape === void 0 && (N.intersectionShape = { sphere: [], cylinder: [], line: [], triangle: [] }), z = { line: void 0, cross: void 0, stick: void 0, sphere: void 0 }; for (k in z) - P.style[k] ? P.style[k].opacity ? z[k] = parseFloat(P.style[k].opacity) : z[k] = 1 : z[k] = void 0, O[k] ? z[k] != null && O[k] != z[k] && (console.log("Warning: " + k + " opacity is ambiguous"), O[k] = 1) : O[k] = z[k]; - v.call(this, P, M), this.drawAtomClickSphere(P), this.drawAtomCross(P, c), this.drawBondLines(P, s, x), this.drawBondSticks(P, s, E), typeof P.style.cartoon < "u" && !P.style.cartoon.hidden && (P.style.cartoon.color === "spectrum" && typeof P.resi == "number" && !P.hetflag && (P.resi < R[0] && (R[0] = P.resi), P.resi > R[1] && (R[1] = P.resi)), g.push(P)); + N.style[k] ? N.style[k].opacity ? z[k] = parseFloat(N.style[k].opacity) : z[k] = 1 : z[k] = void 0, O[k] ? z[k] != null && O[k] != z[k] && (console.log("Warning: " + k + " opacity is ambiguous"), O[k] = 1) : O[k] = z[k]; + v.call(this, N, M), this.drawAtomClickSphere(N), this.drawAtomCross(N, o), this.drawBondLines(N, s, w), this.drawBondSticks(N, s, E), typeof N.style.cartoon < "u" && !N.style.cartoon.hidden && (N.style.cartoon.color === "spectrum" && typeof N.resi == "number" && !N.hetflag && (N.resi < R[0] && (R[0] = N.resi), N.resi > R[1] && (R[1] = N.resi)), g.push(N)); } } - if (g.length > 0 && (0, u.drawCartoon)(_, g, R, this.defaultCartoonQuality), M && M.vertices > 0) { + if (g.length > 0 && (0, d.drawCartoon)(p, g, R, this.defaultCartoonQuality), M && M.vertices > 0) { M.initTypedArrays(); - var U = null, B = null; - M.imposter ? U = new r.SphereImposterMaterial({ + var W = null, B = null; + M.imposter ? W = new r.SphereImposterMaterial({ ambient: 0, vertexColors: !0, reflectivity: 0 - }) : M.instanced ? (B = new r.Geometry(!0), o.GLDraw.drawSphere(B, { x: 0, y: 0, z: 0 }, 1, new d.Color(0.5, 0.5, 0.5)), B.initTypedArrays(), U = new r.InstancedMaterial({ + }) : M.instanced ? (B = new r.Geometry(!0), c.GLDraw.drawSphere(B, { x: 0, y: 0, z: 0 }, 1, new h.Color(0.5, 0.5, 0.5)), B.initTypedArrays(), W = new r.InstancedMaterial({ sphereMaterial: new r.MeshLambertMaterial({ ambient: 0, vertexColors: !0, reflectivity: 0 }), sphere: B - })) : U = new r.MeshLambertMaterial({ + })) : W = new r.MeshLambertMaterial({ ambient: 0, vertexColors: !0, reflectivity: 0 - }), O.sphere < 1 && O.sphere >= 0 && (U.transparent = !0, U.opacity = O.sphere), B = new r.Mesh(M, U), _.add(B); + }), O.sphere < 1 && O.sphere >= 0 && (W.transparent = !0, W.opacity = O.sphere), B = new r.Mesh(M, W), p.add(B); } if (E.vertices > 0) { - var N = null, G = null, H = E.sphereGeometry; + var P = null, G = null, H = E.sphereGeometry; (!H || typeof H.vertices > "u" || H.vertices == 0) && (H = null), E.initTypedArrays(), H && H.initTypedArrays(); - var W = { ambient: 0, vertexColors: !0, reflectivity: 0 }; - E.imposter ? (N = new r.StickImposterMaterial(W), G = new r.SphereImposterMaterial(W)) : (N = new r.MeshLambertMaterial(W), G = new r.MeshLambertMaterial(W), N.wireframe && (E.setUpWireframe(), H && H.setUpWireframe())), O.stick < 1 && O.stick >= 0 && (N.transparent = !0, N.opacity = O.stick, G.transparent = !0, G.opacity = O.stick); - var V = new r.Mesh(E, N); - if (_.add(V), H) { + var U = { ambient: 0, vertexColors: !0, reflectivity: 0 }; + E.imposter ? (P = new r.StickImposterMaterial(U), G = new r.SphereImposterMaterial(U)) : (P = new r.MeshLambertMaterial(U), G = new r.MeshLambertMaterial(U), P.wireframe && (E.setUpWireframe(), H && H.setUpWireframe())), O.stick < 1 && O.stick >= 0 && (P.transparent = !0, P.opacity = O.stick, G.transparent = !0, G.opacity = O.stick); + var j = new r.Mesh(E, P); + if (p.add(j), H) { var re = new r.Mesh(H, G); - _.add(re); + p.add(re); } } var ie; - for ($ in x) - if (x.hasOwnProperty($)) { + for ($ in w) + if (w.hasOwnProperty($)) { ie = $; - var ee = new r.LineBasicMaterial({ + var te = new r.LineBasicMaterial({ linewidth: ie, vertexColors: !0 }); - O.line < 1 && O.line >= 0 && (ee.transparent = !0, ee.opacity = O.line), x[$].initTypedArrays(); - var ce = new r.Line(x[$], ee, r.LineStyle.LinePieces); - _.add(ce); + O.line < 1 && O.line >= 0 && (te.transparent = !0, te.opacity = O.line), w[$].initTypedArrays(); + var ue = new r.Line(w[$], te, r.LineStyle.LinePieces); + p.add(ue); } - for ($ in c) - if (c.hasOwnProperty($)) { + for ($ in o) + if (o.hasOwnProperty($)) { ie = $; - var he = new r.LineBasicMaterial({ + var de = new r.LineBasicMaterial({ linewidth: ie, vertexColors: !0 }); - O.cross < 1 && O.cross >= 0 && (he.transparent = !0, he.opacity = O.cross), c[$].initTypedArrays(); - var le = new r.Line(c[$], he, r.LineStyle.LinePieces); - _.add(le); + O.cross < 1 && O.cross >= 0 && (de.transparent = !0, de.opacity = O.cross), o[$].initTypedArrays(); + var oe = new r.Line(o[$], de, r.LineStyle.LinePieces); + p.add(oe); } if (this.dontDuplicateAtoms && this.modelData.symmetries && this.modelData.symmetries.length > 0) { - var J = new r.Object3D(), Me; - for (Me = 0; Me < this.modelData.symmetries.length; Me++) { + var J = new r.Object3D(), Ee; + for (Ee = 0; Ee < this.modelData.symmetries.length; Ee++) { var se = new r.Object3D(); - se = _.clone(), se.matrix.copy(this.modelData.symmetries[Me]), se.matrixAutoUpdate = !1, J.add(se); + se = p.clone(), se.matrix.copy(this.modelData.symmetries[Ee]), se.matrixAutoUpdate = !1, J.add(se); } return J; } - return _; + return p; } /** * Return object representing internal state of @@ -20090,16 +20090,16 @@ void main() { * @param {number} gamma - unit cell angle in degrees (default 90) */ - setCrystData(s, h, _, g, x, c) { - s = s || 1, h = h || 1, _ = _ || 1, g = g || 90, x = x || 90, c = c || 90; - const v = (0, l.conversionMatrix3)(s, h, _, g, x, c); + setCrystData(s, u, p, g, w, o) { + s = s || 1, u = u || 1, p = p || 1, g = g || 90, w = w || 90, o = o || 90; + const v = (0, l.conversionMatrix3)(s, u, p, g, w, o); this.modelData.cryst = { a: s, - b: h, - c: _, + b: u, + c: p, alpha: g, - beta: x, - gamma: c, + beta: w, + gamma: o, matrix: v }; } @@ -20151,18 +20151,18 @@ void main() { getNumFrames() { return this.frames.numFrames != null ? this.frames.numFrames : this.frames.length; } - adjustCoord(s, h, _, g) { - var x = h - s; - return x < -_ ? h + g : x > _ ? h - g : h; + adjustCoord(s, u, p, g) { + var w = u - s; + return w < -p ? u + g : w > p ? u - g : u; } //go over current atoms in depth first order and ensure that connected //attoms aren't split across the box adjustCoordinatesToBox() { if (this.box && this.atomdfs) - for (var s = this.box[0], h = this.box[1], _ = this.box[2], g = s * 0.9, x = h * 0.9, c = _ * 0.9, v = 0; v < this.atomdfs.length; v++) + for (var s = this.box[0], u = this.box[1], p = this.box[2], g = s * 0.9, w = u * 0.9, o = p * 0.9, v = 0; v < this.atomdfs.length; v++) for (var M = this.atomdfs[v], E = 1; E < M.length; E++) { var $ = this.atoms[M[E][0]], k = this.atoms[M[E][1]]; - $.x = this.adjustCoord(k.x, $.x, g, s), $.y = this.adjustCoord(k.y, $.y, x, h), $.z = this.adjustCoord(k.z, $.z, c, _); + $.x = this.adjustCoord(k.x, $.x, g, s), $.y = this.adjustCoord(k.y, $.y, w, u), $.z = this.adjustCoord(k.z, $.z, o, p); } } /** @@ -20172,20 +20172,20 @@ void main() { * @param {number} framenum - model's atoms are set to this index in frames list * @return {Promise} */ - setFrame(s, h) { - var _ = this.getNumFrames(); + setFrame(s, u) { + var p = this.getNumFrames(); let g = this; - return new Promise(function(x, c) { - if (_ == 0 && x(), (s < 0 || s >= _) && (s = _ - 1), g.frames.url != null) { + return new Promise(function(w, o) { + if (p == 0 && w(), (s < 0 || s >= p) && (s = p - 1), g.frames.url != null) { var v = g.frames.url; - (0, p.getbin)(v + "/traj/frame/" + s + "/" + g.frames.path, void 0, "POST", void 0).then(function(M) { + (0, _.getbin)(v + "/traj/frame/" + s + "/" + g.frames.path, void 0, "POST", void 0).then(function(M) { for (var E = new Float32Array(M, 44), $ = 0, k = 0; k < g.atoms.length; k++) g.atoms[k].x = E[$++], g.atoms[k].y = E[$++], g.atoms[k].z = E[$++]; - g.box && g.atomdfs && g.adjustCoordinatesToBox(), x(); - }).catch(c); + g.box && g.atomdfs && g.adjustCoordinatesToBox(), w(); + }).catch(o); } else - g.atoms = g.frames[s], x(); - g.molObj = null, g.modelDatas && s < g.modelDatas.length && (g.modelData = g.modelDatas[s], g.unitCellObjects && h && (h.removeUnitCell(g), h.addUnitCell(g))); + g.atoms = g.frames[s], w(); + g.molObj = null, g.modelDatas && s < g.modelDatas.length && (g.modelData = g.modelDatas[s], g.unitCellObjects && u && (u.removeUnitCell(g), u.addUnitCell(g))); }); } /** @@ -20216,26 +20216,26 @@ void main() { viewer.render(); }); */ - vibrate(s = 10, h = 1, _ = !1, g, x) { - var c = 0, v = s; - _ && (c = -s, v = s), this.frames !== void 0 && this.frames.origIndex !== void 0 ? this.setFrame(this.frames.origIndex) : this.setFrame(0), c < v && (this.frames = []), _ && (this.frames.origIndex = s); - for (var M = c; M < v; M++) { + vibrate(s = 10, u = 1, p = !1, g, w) { + var o = 0, v = s; + p && (o = -s, v = s), this.frames !== void 0 && this.frames.origIndex !== void 0 ? this.setFrame(this.frames.origIndex) : this.setFrame(0), o < v && (this.frames = []), p && (this.frames.origIndex = s); + for (var M = o; M < v; M++) { var E = [], $ = this.frames.length; - if (M == 0 && !x) { + if (M == 0 && !w) { this.frames.push(this.atoms); continue; } for (var k = 0; k < this.atoms.length; k++) { - var L = (0, p.getAtomProperty)(this.atoms[k], "dx"), z = (0, p.getAtomProperty)(this.atoms[k], "dy"), O = (0, p.getAtomProperty)(this.atoms[k], "dz"), R = new l.Vector3(L, z, O), P = new l.Vector3(this.atoms[k].x, this.atoms[k].y, this.atoms[k].z), U = M * h / s; - R.multiplyScalar(U), P.add(R); + var L = (0, _.getAtomProperty)(this.atoms[k], "dx"), z = (0, _.getAtomProperty)(this.atoms[k], "dy"), O = (0, _.getAtomProperty)(this.atoms[k], "dz"), R = new l.Vector3(L, z, O), N = new l.Vector3(this.atoms[k].x, this.atoms[k].y, this.atoms[k].z), W = M * u / s; + R.multiplyScalar(W), N.add(R); var B = {}; - for (var N in this.atoms[k]) - B[N] = this.atoms[k][N]; - if (B.x = P.x, B.y = P.y, B.z = P.z, E.push(B), g && x) { - var G = (0, p.extend)({}, x), H = new l.Vector3(L, z, O); - if (H.multiplyScalar(h), H.add(P), G.start = P, G.end = H, G.frame = $, !G.color) { - var W = B.style.sphere; - W || (W = B.style.stick), W || (W = B.style.line), G.color = (0, p.getColorFromStyle)(B, W); + for (var P in this.atoms[k]) + B[P] = this.atoms[k][P]; + if (B.x = N.x, B.y = N.y, B.z = N.z, E.push(B), g && w) { + var G = (0, _.extend)({}, w), H = new l.Vector3(L, z, O); + if (H.multiplyScalar(u), H.add(N), G.start = N, G.end = H, G.frame = $, !G.color) { + var U = B.style.sphere; + U || (U = B.style.stick), U || (U = B.style.line), G.color = (0, _.getColorFromStyle)(B, U); } g.addArrow(G); } @@ -20245,9 +20245,9 @@ void main() { } // set default style and colors for atoms setAtomDefaults(s) { - for (let h = 0; h < s.length; h++) { - let _ = s[h]; - _ && (_.style = _.style || (0, p.deepCopy)(A.defaultAtomStyle), _.color = _.color || this.ElementColors[_.elem] || this.defaultColor, _.model = this.id, (_.clickable || _.hoverable) && (_.intersectionShape = { sphere: [], cylinder: [], line: [], triangle: [] })); + for (let u = 0; u < s.length; u++) { + let p = s[u]; + p && (p.style = p.style || (0, _.deepCopy)(A.defaultAtomStyle), p.color = p.color || this.ElementColors[p.elem] || this.defaultColor, p.model = this.id, (p.clickable || p.hoverable) && (p.intersectionShape = { sphere: [], cylinder: [], line: [], triangle: [] })); } } /** add atoms to this model from molecular data string @@ -20256,23 +20256,23 @@ void main() { * @param {string} format - input file string format (e.g 'pdb', 'sdf', 'sdf.gz', etc.) * @param {ParserOptionsSpec} options - format dependent options. Attributes depend on the input format */ - addMolData(s, h, _ = {}) { - var g = A.parseMolData(s, h, _); - this.dontDuplicateAtoms = !_.duplicateAssemblyAtoms; - var x = g.modelData; - if (x && (Array.isArray(x) ? (this.modelData = x[0], _.frames && (this.modelDatas = x)) : this.modelData = x), g.box ? this.box = g.box : this.box = null, this.frames.length == 0) { + addMolData(s, u, p = {}) { + var g = A.parseMolData(s, u, p); + this.dontDuplicateAtoms = !p.duplicateAssemblyAtoms; + var w = g.modelData; + if (w && (Array.isArray(w) ? (this.modelData = w[0], p.frames && (this.modelDatas = w)) : this.modelData = w), g.box ? this.box = g.box : this.box = null, this.frames.length == 0) { for (let v = 0; v < g.length; v++) g[v].length != 0 && this.frames.push(g[v]); this.frames[0] && (this.atoms = this.frames[0]); - } else if (_.frames) + } else if (p.frames) for (let v = 0; v < g.length; v++) this.frames.push(g[v]); else - for (var c = 0; c < g.length; c++) - this.addAtoms(g[c]); + for (var o = 0; o < g.length; o++) + this.addAtoms(g[o]); for (let v = 0; v < this.frames.length; v++) this.setAtomDefaults(this.frames[v]); - _.vibrate && _.vibrate.frames && _.vibrate.amplitude && this.vibrate(_.vibrate.frames, _.vibrate.amplitude), _.style && this.setStyle({}, _.style); + p.vibrate && p.vibrate.frames && p.vibrate.amplitude && this.vibrate(p.vibrate.frames, p.vibrate.amplitude), p.style && this.setStyle({}, p.style); } setDontDuplicateAtoms(s) { this.dontDuplicateAtoms = s; @@ -20281,14 +20281,14 @@ void main() { this.modelData = s; } //return true if atom value matches property val - propertyMatches(s, h) { - if (s == h) + propertyMatches(s, u) { + if (s == u) return !0; - if (typeof h == "string" && typeof s == "number") { - var _ = h.match(/(-?\d+)\s*-\s*(-?\d+)/); - if (_) { - var g = parseInt(_[1]), x = parseInt(_[2]); - if (_ && s >= g && s <= x) + if (typeof u == "string" && typeof s == "number") { + var p = u.match(/(-?\d+)\s*-\s*(-?\d+)/); + if (p) { + var g = parseInt(p[1]), w = parseInt(p[2]); + if (p && s >= g && s <= w) return !0; } } @@ -20302,24 +20302,24 @@ void main() { // used in selections: number, string, boolean, functions; as well // as arrays and nested objects with values of the aformentioned // types. - static deepCopyAndCache(s, h) { + static deepCopyAndCache(s, u) { if (typeof s != "object" || s == null || s.__cache_created) return s; - const _ = {}; + const p = {}; for (const g in s) { - const x = s[g]; - if (Array.isArray(x)) { - _[g] = []; - for (let c = 0; c < x.length; c++) - _[g].push(A.deepCopyAndCache(x[c], h)); - } else typeof x == "object" && g != "properties" && g != "model" ? _[g] = A.deepCopyAndCache(x, h) : _[g] = x; + const w = s[g]; + if (Array.isArray(w)) { + p[g] = []; + for (let o = 0; o < w.length; o++) + p[g].push(A.deepCopyAndCache(w[o], u)); + } else typeof w == "object" && g != "properties" && g != "model" ? p[g] = A.deepCopyAndCache(w, u) : p[g] = w; if (g == "and" || g == "or") { - const c = []; - for (const v of _[g]) { + const o = []; + for (const v of p[g]) { const M = /* @__PURE__ */ new Set(); - for (const E of h.selectedAtoms(v)) + for (const E of u.selectedAtoms(v)) M.add(E.index); - c.push(M); + o.push(M); } if (g == "and") { const v = function(E, $) { @@ -20328,20 +20328,20 @@ void main() { E.has(L) && k.add(L); return k; }; - let M = new Set(c[0]); - for (const E of c.splice(1)) + let M = new Set(o[0]); + for (const E of o.splice(1)) M = v(M, E); - _[g].__cached_results = M; + p[g].__cached_results = M; } else if (g == "or") { const v = /* @__PURE__ */ new Set(); - for (const M of c) + for (const M of o) for (const E of M) v.add(E); - _[g].__cached_results = v; + p[g].__cached_results = v; } } } - return _.__cache_created = !0, _; + return p.__cache_created = !0, p; } /** given a selection specification, return true if atom is selected. * Does not support context-aware selectors like expand/within/byres. @@ -20350,50 +20350,50 @@ void main() { * @param {AtomSelectionSpec} sel * @return {boolean} */ - atomIsSelected(s, h) { - if (typeof h > "u") + atomIsSelected(s, u) { + if (typeof u > "u") return !0; - var _ = !!h.invert, g = !0; - for (var x in h) - if (x == "and" || x == "or" || x == "not") { - if (x == "not") { - if (this.atomIsSelected(s, h[x])) { + var p = !!u.invert, g = !0; + for (var w in u) + if (w == "and" || w == "or" || w == "not") { + if (w == "not") { + if (this.atomIsSelected(s, u[w])) { g = !1; break; } - } else if (h[x].__cached_results === void 0 && (h = A.deepCopyAndCache(h, this)), g = h[x].__cached_results.has(s.index), !g) + } else if (u[w].__cached_results === void 0 && (u = A.deepCopyAndCache(u, this)), g = u[w].__cached_results.has(s.index), !g) break; - } else if (x === "predicate") { - if (!h.predicate(s)) { + } else if (w === "predicate") { + if (!u.predicate(s)) { g = !1; break; } - } else if (x == "properties" && s[x]) { - for (var c in h.properties) - if (!c.startsWith("__cache")) { - if (typeof s.properties[c] > "u") { + } else if (w == "properties" && s[w]) { + for (var o in u.properties) + if (!o.startsWith("__cache")) { + if (typeof s.properties[o] > "u") { g = !1; break; } - if (s.properties[c] != h.properties[c]) { + if (s.properties[o] != u.properties[o]) { g = !1; break; } } - } else if (h.hasOwnProperty(x) && !A.ignoredKeys.has(x) && !x.startsWith("__cache")) { - if (typeof s[x] > "u") { + } else if (u.hasOwnProperty(w) && !A.ignoredKeys.has(w) && !w.startsWith("__cache")) { + if (typeof s[w] > "u") { g = !1; break; } var v = !1; - if (x === "bonds") { - var M = h[x]; + if (w === "bonds") { + var M = u[w]; if (M != s.bonds.length) { g = !1; break; } - } else if (Array.isArray(h[x])) { - var E = h[x], $ = s[x]; + } else if (Array.isArray(u[w])) { + var E = u[w], $ = s[w]; for (let k = 0; k < E.length; k++) if (this.propertyMatches($, E[k])) { v = !0; @@ -20404,18 +20404,18 @@ void main() { break; } } else { - let k = h[x]; - if (!this.propertyMatches(s[x], k)) { + let k = u[w]; + if (!this.propertyMatches(s[w], k)) { g = !1; break; } } } - return _ ? !g : g; + return p ? !g : g; } - static squaredDistance(s, h) { - var _ = h.x - s.x, g = h.y - s.y, x = h.z - s.z; - return _ * _ + g * g + x * x; + static squaredDistance(s, u) { + var p = u.x - s.x, g = u.y - s.y, w = u.z - s.z; + return p * p + g * g + w * w; } /** returns a list of atoms in the expanded bounding box, but not in the current one * @@ -20426,17 +20426,17 @@ void main() { * [ xctr, yctr, zctr ] ] * **/ - expandAtomList(s, h) { - if (h <= 0) + expandAtomList(s, u) { + if (u <= 0) return s; - for (var _ = (0, p.getExtent)(s, void 0), g = [[], [], []], x = 0; x < 3; x++) - g[0][x] = _[0][x] - h, g[1][x] = _[1][x] + h, g[2][x] = _[2][x]; - var c = []; + for (var p = (0, _.getExtent)(s, void 0), g = [[], [], []], w = 0; w < 3; w++) + g[0][w] = p[0][w] - u, g[1][w] = p[1][w] + u, g[2][w] = p[2][w]; + var o = []; for (let $ = 0; $ < this.atoms.length; $++) { var v = this.atoms[$].x, M = this.atoms[$].y, E = this.atoms[$].z; - v >= g[0][0] && v <= g[1][0] && M >= g[0][1] && M <= g[1][1] && E >= g[0][2] && E <= g[1][2] && (v >= _[0][0] && v <= _[1][0] && M >= _[0][1] && M <= _[1][1] && E >= _[0][2] && E <= _[1][2] || c.push(this.atoms[$])); + v >= g[0][0] && v <= g[1][0] && M >= g[0][1] && M <= g[1][1] && E >= g[0][2] && E <= g[1][2] && (v >= p[0][0] && v <= p[1][0] && M >= p[0][1] && M <= p[1][1] && E >= p[0][2] && E <= p[1][2] || o.push(this.atoms[$])); } - return c; + return o; } static getFloat(s) { return typeof s == "number" ? s : parseFloat(s); @@ -20455,58 +20455,58 @@ void main() { viewer.render(); }); */ - selectedAtoms(s, h) { - var _ = []; - s = A.deepCopyAndCache(s || {}, this), h || (h = this.atoms); - for (var g = h.length, x = 0; x < g; x++) { - var c = h[x]; - c && this.atomIsSelected(c, s) && _.push(c); + selectedAtoms(s, u) { + var p = []; + s = A.deepCopyAndCache(s || {}, this), u || (u = this.atoms); + for (var g = u.length, w = 0; w < g; w++) { + var o = u[w]; + o && this.atomIsSelected(o, s) && p.push(o); } if (s.hasOwnProperty("expand")) { const B = A.getFloat(s.expand); - let N = this.expandAtomList(_, B), G = _.length; + let P = this.expandAtomList(p, B), G = p.length; const H = B * B; - for (let W = 0; W < N.length; W++) - for (let V = 0; V < G; V++) { - var v = A.squaredDistance(N[W], _[V]); - v < H && v > 0 && _.push(N[W]); + for (let U = 0; U < P.length; U++) + for (let j = 0; j < G; j++) { + var v = A.squaredDistance(P[U], p[j]); + v < H && v > 0 && p.push(P[U]); } } if (s.hasOwnProperty("within") && s.within.hasOwnProperty("sel") && s.within.hasOwnProperty("distance")) { var M = this.selectedAtoms(s.within.sel, this.atoms), E = {}; - const B = A.getFloat(s.within.distance), N = B * B; + const B = A.getFloat(s.within.distance), P = B * B; for (let G = 0; G < M.length; G++) - for (let H = 0; H < _.length; H++) { - let W = A.squaredDistance(M[G], _[H]); - W < N && W > 0 && (E[H] = 1); + for (let H = 0; H < p.length; H++) { + let U = A.squaredDistance(M[G], p[H]); + U < P && U > 0 && (E[H] = 1); } var $ = []; if (s.within.invert) - for (let G = 0; G < _.length; G++) - E[G] || $.push(_[G]); + for (let G = 0; G < p.length; G++) + E[G] || $.push(p[G]); else for (let G in E) - $.push(_[G]); - _ = $; + $.push(p[G]); + p = $; } if (s.hasOwnProperty("byres")) { var k = {}, L = [], z = []; - for (let B = 0; B < _.length; B++) { - let N = _[B]; - var O = N.chain, R = N.resi; - if (k[O] === void 0 && (k[O] = {}), N.hasOwnProperty("resi") && k[O][R] === void 0) { - for (k[O][R] = !0, z.push(N); z.length > 0; ) - if (N = z.pop(), O = N.chain, R = N.resi, L[N.index] === void 0) { - L[N.index] = !0; - for (var P = 0; P < N.bonds.length; P++) { - var U = this.atoms[N.bonds[P]]; - L[U.index] === void 0 && U.hasOwnProperty("resi") && U.chain == O && U.resi == R && (z.push(U), _.push(U)); + for (let B = 0; B < p.length; B++) { + let P = p[B]; + var O = P.chain, R = P.resi; + if (k[O] === void 0 && (k[O] = {}), P.hasOwnProperty("resi") && k[O][R] === void 0) { + for (k[O][R] = !0, z.push(P); z.length > 0; ) + if (P = z.pop(), O = P.chain, R = P.resi, L[P.index] === void 0) { + L[P.index] = !0; + for (var N = 0; N < P.bonds.length; N++) { + var W = this.atoms[P.bonds[N]]; + L[W.index] === void 0 && W.hasOwnProperty("resi") && W.chain == O && W.resi == R && (z.push(W), p.push(W)); } } } } } - return _; + return p; } /** Add list of new atoms to model. Adjusts bonds appropriately. * @@ -20523,15 +20523,15 @@ void main() { */ addAtoms(s) { this.molObj = null; - var h = this.atoms.length, _ = [], g; + var u = this.atoms.length, p = [], g; for (g = 0; g < s.length; g++) - typeof s[g].index > "u" && (s[g].index = g), typeof s[g].serial > "u" && (s[g].serial = g), _[s[g].index] = h + g; + typeof s[g].index > "u" && (s[g].index = g), typeof s[g].serial > "u" && (s[g].serial = g), p[s[g].index] = u + g; for (g = 0; g < s.length; g++) { - var x = s[g], c = _[x.index], v = (0, p.extend)({}, x); - v.index = c, v.bonds = [], v.bondOrder = [], v.model = this.id, v.style = v.style || (0, p.deepCopy)(A.defaultAtomStyle), typeof v.color > "u" && (v.color = this.ElementColors[v.elem] || this.defaultColor); - for (var M = x.bonds ? x.bonds.length : 0, E = 0; E < M; E++) { - var $ = _[x.bonds[E]]; - typeof $ < "u" && (v.bonds.push($), v.bondOrder.push(x.bondOrder ? x.bondOrder[E] : 1)); + var w = s[g], o = p[w.index], v = (0, _.extend)({}, w); + v.index = o, v.bonds = [], v.bondOrder = [], v.model = this.id, v.style = v.style || (0, _.deepCopy)(A.defaultAtomStyle), typeof v.color > "u" && (v.color = this.ElementColors[v.elem] || this.defaultColor); + for (var M = w.bonds ? w.bonds.length : 0, E = 0; E < M; E++) { + var $ = p[w.bonds[E]]; + typeof $ < "u" && (v.bonds.push($), v.bondOrder.push(w.bondOrder ? w.bondOrder[E] : 1)); } this.atoms.push(v); } @@ -20549,13 +20549,13 @@ void main() { */ removeAtoms(s) { this.molObj = null; - var h = [], _; - for (_ = 0; _ < s.length; _++) - h[s[_].index] = !0; + var u = [], p; + for (p = 0; p < s.length; p++) + u[s[p].index] = !0; var g = []; - for (_ = 0; _ < this.atoms.length; _++) { - var x = this.atoms[_]; - h[x.index] || g.push(x); + for (p = 0; p < this.atoms.length; p++) { + var w = this.atoms[p]; + u[w.index] || g.push(w); } this.atoms = [], this.addAtoms(g); } @@ -20579,25 +20579,25 @@ void main() { viewer.render(); }); */ - setStyle(s, h, _) { - typeof h > "u" && typeof _ > "u" && (h = s, s = {}), s = s, typeof h == "string" && (h = (0, p.specStringToObject)(h)); - var g = !1, x = this, c = function(M) { - var E = x.selectedAtoms(s, M); + setStyle(s, u, p) { + typeof u > "u" && typeof p > "u" && (u = s, s = {}), s = s, typeof u == "string" && (u = (0, _.specStringToObject)(u)); + var g = !1, w = this, o = function(M) { + var E = w.selectedAtoms(s, M); for (let $ = 0; $ < M.length; $++) M[$] && (M[$].capDrawn = !1); for (let $ = 0; $ < E.length; $++) { - g = !0, (E[$].clickable || E[$].hoverable) && (E[$].intersectionShape = { sphere: [], cylinder: [], line: [], triangle: [] }), _ || (E[$].style = {}); - for (let k in h) - h.hasOwnProperty(k) && (E[$].style[k] = E[$].style[k] || {}, Object.assign(E[$].style[k], h[k])); + g = !0, (E[$].clickable || E[$].hoverable) && (E[$].intersectionShape = { sphere: [], cylinder: [], line: [], triangle: [] }), p || (E[$].style = {}); + for (let k in u) + u.hasOwnProperty(k) && (E[$].style[k] = E[$].style[k] || {}, Object.assign(E[$].style[k], u[k])); } }; if (s.frame !== void 0 && s.frame < this.frames.length) { let M = s.frame; - M < 0 && (M = this.frames.length + M), c(this.frames[M]); + M < 0 && (M = this.frames.length + M), o(this.frames[M]); } else { - c(this.atoms); + o(this.atoms); for (var v = 0; v < this.frames.length; v++) - this.frames[v] !== this.atoms && c(this.frames[v]); + this.frames[v] !== this.atoms && o(this.frames[v]); } g && (this.molObj = null); } @@ -20608,15 +20608,15 @@ void main() { * @param {function} callback - function called when an atom in the selection is clicked */ - setClickable(s, h, _) { - if (h = !!h, _ = (0, p.makeFunction)(_), _ === null) { + setClickable(s, u, p) { + if (u = !!u, p = (0, _.makeFunction)(p), p === null) { console.log("Callback is not a function"); return; } - var g = this.selectedAtoms(s, this.atoms), x = g.length; - for (let c = 0; c < x; c++) - g[c].intersectionShape = { sphere: [], cylinder: [], line: [], triangle: [] }, g[c].clickable = h, _ && (g[c].callback = _); - x > 0 && (this.molObj = null); + var g = this.selectedAtoms(s, this.atoms), w = g.length; + for (let o = 0; o < w; o++) + g[o].intersectionShape = { sphere: [], cylinder: [], line: [], triangle: [] }, g[o].clickable = u, p && (g[o].callback = p); + w > 0 && (this.molObj = null); } /** Set hoverable and callback of selected atoms * @@ -20625,8 +20625,8 @@ void main() { * @param {function} hover_callback - function called when an atom in the selection is hovered over * @param {function} unhover_callback - function called when the mouse moves out of the hover area */ - setHoverable(s, h, _, g) { - if (h = !!h, _ = (0, p.makeFunction)(_), g = (0, p.makeFunction)(g), _ === null) { + setHoverable(s, u, p, g) { + if (u = !!u, p = (0, _.makeFunction)(p), g = (0, _.makeFunction)(g), p === null) { console.log("Hover_callback is not a function"); return; } @@ -20634,36 +20634,36 @@ void main() { console.log("Unhover_callback is not a function"); return; } - var x = this.selectedAtoms(s, this.atoms), c = x.length; - for (let v = 0; v < c; v++) - x[v].intersectionShape = { sphere: [], cylinder: [], line: [], triangle: [] }, x[v].hoverable = h, _ && (x[v].hover_callback = _), g && (x[v].unhover_callback = g); - c > 0 && (this.molObj = null); + var w = this.selectedAtoms(s, this.atoms), o = w.length; + for (let v = 0; v < o; v++) + w[v].intersectionShape = { sphere: [], cylinder: [], line: [], triangle: [] }, w[v].hoverable = u, p && (w[v].hover_callback = p), g && (w[v].unhover_callback = g); + o > 0 && (this.molObj = null); } /** enable context menu of selected atoms * * @param {AtomSelectionSpec} sel - atom selection to apply hoverable settings to * @param {boolean} contextMenuEnabled - whether contextMenu-handling is enabled for the selection */ - enableContextMenu(s, h) { - h = !!h; - var _, g = this.selectedAtoms(s, this.atoms), x = g.length; - for (_ = 0; _ < x; _++) - g[_].intersectionShape = { sphere: [], cylinder: [], line: [], triangle: [] }, g[_].contextMenuEnabled = h; - x > 0 && (this.molObj = null); + enableContextMenu(s, u) { + u = !!u; + var p, g = this.selectedAtoms(s, this.atoms), w = g.length; + for (p = 0; p < w; p++) + g[p].intersectionShape = { sphere: [], cylinder: [], line: [], triangle: [] }, g[p].contextMenuEnabled = u; + w > 0 && (this.molObj = null); } /** given a mapping from element to color, set atom colors * * @param {AtomSelectionSpec} sel * @param {object} colors */ - setColorByElement(s, h) { - if (!(this.molObj !== null && A.sameObj(h, this.lastColors))) { - this.lastColors = h; - var _ = this.selectedAtoms(s, _); - _.length > 0 && (this.molObj = null); - for (var g = 0; g < _.length; g++) { - var x = _[g]; - typeof h[x.elem] < "u" && (x.color = h[x.elem]); + setColorByElement(s, u) { + if (!(this.molObj !== null && A.sameObj(u, this.lastColors))) { + this.lastColors = u; + var p = this.selectedAtoms(s, p); + p.length > 0 && (this.molObj = null); + for (var g = 0; g < p.length; g++) { + var w = p[g]; + typeof u[w.elem] < "u" && (w.color = u[w.elem]); } } } @@ -20672,12 +20672,12 @@ void main() { * @param {string} prop * @param {Gradient|string} scheme */ - setColorByProperty(s, h, _, g) { - var x, c, v = this.selectedAtoms(s, v); - for (this.lastColors = null, v.length > 0 && (this.molObj = null), typeof _ == "string" && typeof m.Gradient.builtinGradients[_] < "u" && (_ = new m.Gradient.builtinGradients[_]()), _ = _, g || (g = _.range()), g || (g = (0, p.getPropertyRange)(v, h)), x = 0; x < v.length; x++) { - c = v[x]; - var M = (0, p.getAtomProperty)(c, h); - M != null && (c.color = _.valueToHex(parseFloat(c.properties[h]), g)); + setColorByProperty(s, u, p, g) { + var w, o, v = this.selectedAtoms(s, v); + for (this.lastColors = null, v.length > 0 && (this.molObj = null), typeof p == "string" && typeof m.Gradient.builtinGradients[p] < "u" && (p = new m.Gradient.builtinGradients[p]()), p = p, g || (g = p.range()), g || (g = (0, _.getPropertyRange)(v, u)), w = 0; w < v.length; w++) { + o = v[w]; + var M = (0, _.getAtomProperty)(o, u); + M != null && (o.color = p.valueToHex(parseFloat(o.properties[u]), g)); } } /** @@ -20697,13 +20697,13 @@ void main() { }); */ - setColorByFunction(s, h) { - var _ = this.selectedAtoms(s, _); - if (typeof h == "function") { - this.lastColors = null, _.length > 0 && (this.molObj = null); - for (let g = 0; g < _.length; g++) { - let x = _[g]; - x.color = h(x); + setColorByFunction(s, u) { + var p = this.selectedAtoms(s, p); + if (typeof u == "function") { + this.lastColors = null, p.length > 0 && (this.molObj = null); + for (let g = 0; g < p.length; g++) { + let w = p[g]; + w.color = u(w); } } } @@ -20713,36 +20713,36 @@ void main() { * @return {Object} */ toCDObject(s = !1) { - var h = { a: [], b: [] }; - s && (h.s = []); + var u = { a: [], b: [] }; + s && (u.s = []); for (let g = 0; g < this.atoms.length; g++) { - let x = {}, c = this.atoms[g]; - if (x.x = c.x, x.y = c.y, x.z = c.z, c.elem != "C" && (x.l = c.elem), s) { - for (var _ = 0; _ < h.s.length && JSON.stringify(c.style) !== JSON.stringify(h.s[_]); ) - _++; - _ === h.s.length && h.s.push(c.style), _ !== 0 && (x.s = _); + let w = {}, o = this.atoms[g]; + if (w.x = o.x, w.y = o.y, w.z = o.z, o.elem != "C" && (w.l = o.elem), s) { + for (var p = 0; p < u.s.length && JSON.stringify(o.style) !== JSON.stringify(u.s[p]); ) + p++; + p === u.s.length && u.s.push(o.style), p !== 0 && (w.s = p); } - h.a.push(x); - for (let v = 0; v < c.bonds.length; v++) { - let M = g, E = c.bonds[v]; + u.a.push(w); + for (let v = 0; v < o.bonds.length; v++) { + let M = g, E = o.bonds[v]; if (M >= E) continue; let $ = { b: M, e: E - }, k = c.bondOrder[v]; - k != 1 && ($.o = k), h.b.push($); + }, k = o.bondOrder[v]; + k != 1 && ($.o = k), u.b.push($); } } - return h; + return u; } /** manage the globj for this model in the possed modelGroup - if it has to be regenerated, remove and add * * @param {Object3D} group * @param Object options */ - globj(s, h) { - (this.molObj === null || h.regen) && (this.molObj = this.createMolObj(this.atoms, h), this.renderedMolObj && (s.remove(this.renderedMolObj), this.renderedMolObj = null), this.renderedMolObj = this.molObj.clone(), this.hidden && (this.renderedMolObj.setVisible(!1), this.molObj.setVisible(!1)), s.add(this.renderedMolObj)); + globj(s, u) { + (this.molObj === null || u.regen) && (this.molObj = this.createMolObj(this.atoms, u), this.renderedMolObj && (s.remove(this.renderedMolObj), this.renderedMolObj = null), this.renderedMolObj = this.molObj.clone(), this.hidden && (this.renderedMolObj.setVisible(!1), this.molObj.setVisible(!1)), s.add(this.renderedMolObj)); } /** return a VRML string representation of the model. Does not include VRML header information * @return VRML @@ -20796,10 +20796,10 @@ void main() { * @param {GLViewer} viewer * @param {LabelSpec} options */ - addPropertyLabels(s, h, _, g) { - for (var x = this.selectedAtoms(h, x), c = (0, p.deepCopy)(g), v = 0; v < x.length; v++) { - var M = x[v], E = null; - typeof M[s] < "u" ? E = String(M[s]) : typeof M.properties[s] < "u" && (E = String(M.properties[s])), E != null && (c.position = M, _.addLabel(E, c)); + addPropertyLabels(s, u, p, g) { + for (var w = this.selectedAtoms(u, w), o = (0, _.deepCopy)(g), v = 0; v < w.length; v++) { + var M = w[v], E = null; + typeof M[s] < "u" ? E = String(M[s]) : typeof M.properties[s] < "u" && (E = String(M.properties[s])), E != null && (o.position = M, p.addLabel(E, o)); } } /** Create labels for residues of selected atoms. @@ -20811,26 +20811,26 @@ void main() { * @param {LabelSpec} options * @param {boolean} byframe - if true, create labels for every individual frame, not just current; frames must be loaded already */ - addResLabels(s, h, _, g = !1) { - var x = [], c = function(M, E) { + addResLabels(s, u, p, g = !1) { + var w = [], o = function(M, E) { for (var $ = M.selectedAtoms(s, $), k = {}, L = 0; L < $.length; L++) { - var z = $[L], O = z.chain, R = z.resn, P = z.resi, U = R + "" + P; - k[O] || (k[O] = {}), k[O][U] || (k[O][U] = []), k[O][U].push(z); + var z = $[L], O = z.chain, R = z.resn, N = z.resi, W = R + "" + N; + k[O] || (k[O] = {}), k[O][W] || (k[O][W] = []), k[O][W].push(z); } - var B = (0, p.deepCopy)(_); + var B = (0, _.deepCopy)(p); for (let G in k) if (k.hasOwnProperty(G)) { - var N = k[G]; - for (let H in N) - if (N.hasOwnProperty(H)) { - let W = N[H], V = new l.Vector3(0, 0, 0); - for (let ie = 0; ie < W.length; ie++) { - let ee = W[ie]; - V.x += ee.x, V.y += ee.y, V.z += ee.z; + var P = k[G]; + for (let H in P) + if (P.hasOwnProperty(H)) { + let U = P[H], j = new l.Vector3(0, 0, 0); + for (let ie = 0; ie < U.length; ie++) { + let te = U[ie]; + j.x += te.x, j.y += te.y, j.z += te.z; } - V.divideScalar(W.length), B.position = V, B.frame = E; - let re = h.addLabel(H, B, void 0, !0); - x.push(re); + j.divideScalar(U.length), B.position = j, B.frame = E; + let re = u.addLabel(H, B, void 0, !0); + w.push(re); } } }; @@ -20838,30 +20838,30 @@ void main() { var v = this.getNumFrames(); let M = this.atoms; for (let E = 0; E < v; E++) - this.frames[E] && (this.atoms = this.frames[E], c(this, E)); + this.frames[E] && (this.atoms = this.frames[E], o(this, E)); this.atoms = M; } else - c(this); - return x; + o(this); + return w; } //recurse over the current atoms to establish a depth first order setupDFS() { this.atomdfs = []; - var s = this, h = new Int8Array(this.atoms.length); - h.fill(0); - for (var _ = function(v, M, E) { + var s = this, u = new Int8Array(this.atoms.length); + u.fill(0); + for (var p = function(v, M, E) { E.push([v, M]); var $ = s.atoms[v]; - h[v] = 1; + u[v] = 1; for (var k = 0; k < $.bonds.length; k++) { var L = $.bonds[k]; - s.atoms[L] && !h[L] && _(L, v, E); + s.atoms[L] && !u[L] && p(L, v, E); } }, g = 0; g < this.atoms.length; g++) { - var x = this.atoms[g]; - if (x && !h[g]) { - var c = []; - _(g, -1, c), this.atomdfs.push(c); + var w = this.atoms[g]; + if (w && !u[g]) { + var o = []; + p(g, -1, o), this.atomdfs.push(o); } } } @@ -20871,12 +20871,12 @@ void main() { * @param {string} path - contains the path of the file (/filename) * @return {Promise} */ - setCoordinatesFromURL(s, h) { + setCoordinatesFromURL(s, u) { this.frames = []; - var _ = this; - return this.box && this.setupDFS(), s.startsWith("http") || (s = "http://" + s), (0, p.get)(s + "/traj/numframes/" + h, function(g) { + var p = this; + return this.box && this.setupDFS(), s.startsWith("http") || (s = "http://" + s), (0, _.get)(s + "/traj/numframes/" + u, function(g) { if (!isNaN(parseInt(g))) - return _.frames.push(_.atoms), _.frames.numFrames = g, _.frames.url = s, _.frames.path = h, _.setFrame(0); + return p.frames.push(p.atoms), p.frames.numFrames = g, p.frames.url = s, p.frames.path = u, p.setFrame(0); }); } /** @@ -20893,26 +20893,26 @@ void main() { viewer.zoom(0.5); viewer.render(); */ - setCoordinates(s, h) { - if (h = h || "", !s) + setCoordinates(s, u) { + if (u = u || "", !s) return []; - if (/\.gz$/.test(h)) { - h = h.replace(/\.gz$/, ""); + if (/\.gz$/.test(u)) { + u = u.replace(/\.gz$/, ""); try { - s = (0, p.inflateString)(s); + s = (0, _.inflateString)(s); } catch (k) { console.log(k); } } - var _ = { mdcrd: "", inpcrd: "", pdb: "", netcdf: "", array: "" }; - if (_.hasOwnProperty(h)) { + var p = { mdcrd: "", inpcrd: "", pdb: "", netcdf: "", array: "" }; + if (p.hasOwnProperty(u)) { this.frames = []; - for (var g = this.atoms.length, x = A.parseCrd(s, h), c = 0; c < x.length; ) { + for (var g = this.atoms.length, w = A.parseCrd(s, u), o = 0; o < w.length; ) { for (var v = [], M = 0; M < g; M++) { var E = {}; for (var $ in this.atoms[M]) E[$] = this.atoms[M][$]; - v[M] = E, v[M].x = x[c++], v[M].y = x[c++], v[M].z = x[c++]; + v[M] = E, v[M].x = w[o++], v[M].y = w[o++], v[M].z = w[o++]; } this.frames.push(v); } @@ -20933,50 +20933,50 @@ void main() { */ addAtomSpecs(s) { } - static parseCrd(s, h) { - var _ = [], g = 0; - if (h == "pdb") - for (var x = s.indexOf(` -ATOM`); x != -1; ) { - for (; s.slice(x, x + 5) == ` -ATOM` || s.slice(x, x + 7) == ` + static parseCrd(s, u) { + var p = [], g = 0; + if (u == "pdb") + for (var w = s.indexOf(` +ATOM`); w != -1; ) { + for (; s.slice(w, w + 5) == ` +ATOM` || s.slice(w, w + 7) == ` HETATM`; ) - _[g++] = parseFloat(s.slice(x + 31, x + 39)), _[g++] = parseFloat(s.slice(x + 39, x + 47)), _[g++] = parseFloat(s.slice(x + 47, x + 55)), x = s.indexOf(` -`, x + 54), s.slice(x, x + 4) == ` -TER` && (x = s.indexOf(` -`, x + 5)); - x = s.indexOf(` -ATOM`, x); + p[g++] = parseFloat(s.slice(w + 31, w + 39)), p[g++] = parseFloat(s.slice(w + 39, w + 47)), p[g++] = parseFloat(s.slice(w + 47, w + 55)), w = s.indexOf(` +`, w + 54), s.slice(w, w + 4) == ` +TER` && (w = s.indexOf(` +`, w + 5)); + w = s.indexOf(` +ATOM`, w); } - else if (h == "netcdf") { - var c = new w.NetCDFReader(s); - _ = [].concat.apply([], c.getDataVariable("coordinates")); + else if (u == "netcdf") { + var o = new x.NetCDFReader(s); + p = [].concat.apply([], o.getDataVariable("coordinates")); } else { - if (h == "array" || Array.isArray(s)) + if (u == "array" || Array.isArray(s)) return s.flat(2); { let v = s.indexOf(` `); - h == "inpcrd" && (v = s.indexOf(` -`, v + 1)), s = s.slice(v + 1), _ = s.match(/\S+/g).map(parseFloat); + u == "inpcrd" && (v = s.indexOf(` +`, v + 1)), s = s.slice(v + 1), p = s.match(/\S+/g).map(parseFloat); } } - return _; + return p; } - static parseMolData(s, h = "", _) { + static parseMolData(s, u = "", p) { if (!s) return []; - if (/\.gz$/.test(h)) { - h = h.replace(/\.gz$/, ""); + if (/\.gz$/.test(u)) { + u = u.replace(/\.gz$/, ""); try { - h.match(/bcif/i) ? s = (0, p.inflateString)(s, !1) : s = (0, p.inflateString)(s); - } catch (c) { - console.log(c); + u.match(/bcif/i) ? s = (0, _.inflateString)(s, !1) : s = (0, _.inflateString)(s); + } catch (o) { + console.log(o); } } - typeof y.Parsers[h] > "u" && (h = h.split(".").pop(), typeof y.Parsers[h] > "u" && (console.log("Unknown format: " + h), s instanceof Uint8Array ? h = "bcif" : s.match(/^@MOLECULE/gm) ? h = "mol2" : s.match(/^data_/gm) && s.match(/^loop_/gm) ? h = "cif" : s.match(/^HETATM/gm) || s.match(/^ATOM/gm) ? h = "pdb" : s.match(/ITEM: TIMESTEP/gm) ? h = "lammpstrj" : s.match(/^.*\n.*\n.\s*(\d+)\s+(\d+)/gm) ? h = "sdf" : s.match(/^%VERSION\s+VERSION_STAMP/gm) ? h = "prmtop" : h = "xyz", console.log("Best guess: " + h))); - var g = y.Parsers[h], x = g(s, _); - return x; + typeof y.Parsers[u] > "u" && (u = u.split(".").pop(), typeof y.Parsers[u] > "u" && (console.log("Unknown format: " + u), s instanceof Uint8Array ? u = "bcif" : s.match(/^@MOLECULE/gm) ? u = "mol2" : s.match(/^data_/gm) && s.match(/^loop_/gm) ? u = "cif" : s.match(/^HETATM/gm) || s.match(/^ATOM/gm) ? u = "pdb" : s.match(/ITEM: TIMESTEP/gm) ? u = "lammpstrj" : s.match(/^.*\n.*\n.\s*(\d+)\s+(\d+)/gm) ? u = "sdf" : s.match(/^%VERSION\s+VERSION_STAMP/gm) ? u = "prmtop" : u = "xyz", console.log("Best guess: " + u))); + var g = y.Parsers[u], w = g(s, p); + return w; } } A.defaultAtomStyle = { @@ -21050,7 +21050,7 @@ ATOM`, x); /* harmony export */ GLShape: () => ( /* binding */ - w + x ), /* harmony export */ splitMesh: () => ( @@ -21068,16 +21068,16 @@ ATOM`, x); ), l = t( /*! ./WebGL/math */ "./src/WebGL/math/index.ts" - ), d = t( + ), h = t( /*! ./colors */ "./src/colors.ts" - ), o = t( + ), c = t( /*! ./ProteinSurface4 */ "./src/ProteinSurface4.ts" - ), u = t( + ), d = t( /*! ./VolumeData */ "./src/VolumeData.ts" - ), p = t( + ), _ = t( /*! ./GLDraw */ "./src/GLDraw.ts" ), m = t( @@ -21087,7 +21087,7 @@ ATOM`, x); /*! ./utilities */ "./src/utilities.ts" ); - class w { + class x { static finalizeGeo(f) { var s = f.updateGeoGroup(0); s.vertices > 0 && s.truncateArrayBuffers(!0, !0); @@ -21099,17 +21099,17 @@ ATOM`, x); * @param {Color | colorlike} color */ static updateColor(f, s) { - s = s || d.CC.color(s), f.colorsNeedUpdate = !0; - var h, _, g; - s.constructor !== Array && (h = s.r, _ = s.g, g = s.b); - for (let x in f.geometryGroups) { - let c = f.geometryGroups[x], v = c.colorArray; - for (let M = 0, E = c.vertices; M < E; ++M) { + s = s || h.CC.color(s), f.colorsNeedUpdate = !0; + var u, p, g; + s.constructor !== Array && (u = s.r, p = s.g, g = s.b); + for (let w in f.geometryGroups) { + let o = f.geometryGroups[w], v = o.colorArray; + for (let M = 0, E = o.vertices; M < E; ++M) { if (s.constructor === Array) { let $ = s[M]; - h = $.r, _ = $.g, g = $.b; + u = $.r, p = $.g, g = $.b; } - v[M * 3] = h, v[M * 3 + 1] = _, v[M * 3 + 2] = g; + v[M * 3] = u, v[M * 3 + 1] = p, v[M * 3 + 2] = g; } } } @@ -21121,44 +21121,44 @@ ATOM`, x); * @param {ArrowSpec} * spec */ - static drawArrow(f, s, h) { - var _ = h.start, g = h.end, x = h.radius, c = h.radiusRatio, v = h.mid, M = h.midpos; - if (!(_ && g)) + static drawArrow(f, s, u) { + var p = u.start, g = u.end, w = u.radius, o = u.radiusRatio, v = u.mid, M = u.midpos; + if (!(p && g)) return; - var E = s.updateGeoGroup(51), $ = new l.Vector3(g.x, g.y, g.z).sub(_); + var E = s.updateGeoGroup(51), $ = new l.Vector3(g.x, g.y, g.z).sub(p); if (M) { let pe = $.length(); M > 0 ? v = M / pe : v = (pe + M) / pe; } $.multiplyScalar(v); - var k = new l.Vector3(_.x, _.y, _.z).add($), L = $.clone().negate(); - let z = new l.Vector3(_.x, _.y, _.z); - f.intersectionShape.cylinder.push(new a.Cylinder(z, k.clone(), x)), f.intersectionShape.sphere.push(new a.Sphere(z, x)); + var k = new l.Vector3(p.x, p.y, p.z).add($), L = $.clone().negate(); + let z = new l.Vector3(p.x, p.y, p.z); + f.intersectionShape.cylinder.push(new a.Cylinder(z, k.clone(), w)), f.intersectionShape.sphere.push(new a.Sphere(z, w)); var O = []; O[0] = $.clone(), Math.abs(O[0].x) > 1e-4 ? O[0].y += 1 : O[0].x += 1, O[0].cross($), O[0].normalize(), O[4] = O[0].clone(), O[4].crossVectors(O[0], $), O[4].normalize(), O[8] = O[0].clone().negate(), O[12] = O[4].clone().negate(), O[2] = O[0].clone().add(O[4]).normalize(), O[6] = O[4].clone().add(O[8]).normalize(), O[10] = O[8].clone().add(O[12]).normalize(), O[14] = O[12].clone().add(O[0]).normalize(), O[1] = O[0].clone().add(O[2]).normalize(), O[3] = O[2].clone().add(O[4]).normalize(), O[5] = O[4].clone().add(O[6]).normalize(), O[7] = O[6].clone().add(O[8]).normalize(), O[9] = O[8].clone().add(O[10]).normalize(), O[11] = O[10].clone().add(O[12]).normalize(), O[13] = O[12].clone().add(O[14]).normalize(), O[15] = O[14].clone().add(O[0]).normalize(); - var R = E.vertices, P = E.vertexArray, U = E.faceArray, B = E.normalArray, N = E.lineArray, G, H, W; - for (H = 0, W = O.length; H < W; ++H) { + var R = E.vertices, N = E.vertexArray, W = E.faceArray, B = E.normalArray, P = E.lineArray, G, H, U; + for (H = 0, U = O.length; H < U; ++H) { G = 3 * (R + 3 * H); - var V = O[H].clone().multiplyScalar(x).add(_), re = O[H].clone().multiplyScalar(x).add(k), ie = O[H].clone().multiplyScalar(x * c).add(k); - if (P[G] = V.x, P[G + 1] = V.y, P[G + 2] = V.z, P[G + 3] = re.x, P[G + 4] = re.y, P[G + 5] = re.z, P[G + 6] = ie.x, P[G + 7] = ie.y, P[G + 8] = ie.z, H > 0) { - var ee = P[G - 3], ce = P[G - 2], he = P[G - 1], le = new l.Vector3(ee, ce, he), J = new l.Vector3(g.x, g.y, g.z), Me = k.clone(), se = new l.Vector3(ie.x, ie.y, ie.z); - f.intersectionShape.triangle.push(new a.Triangle(se, J, le)), f.intersectionShape.triangle.push(new a.Triangle(le.clone(), Me, se.clone())); + var j = O[H].clone().multiplyScalar(w).add(p), re = O[H].clone().multiplyScalar(w).add(k), ie = O[H].clone().multiplyScalar(w * o).add(k); + if (N[G] = j.x, N[G + 1] = j.y, N[G + 2] = j.z, N[G + 3] = re.x, N[G + 4] = re.y, N[G + 5] = re.z, N[G + 6] = ie.x, N[G + 7] = ie.y, N[G + 8] = ie.z, H > 0) { + var te = N[G - 3], ue = N[G - 2], de = N[G - 1], oe = new l.Vector3(te, ue, de), J = new l.Vector3(g.x, g.y, g.z), Ee = k.clone(), se = new l.Vector3(ie.x, ie.y, ie.z); + f.intersectionShape.triangle.push(new a.Triangle(se, J, oe)), f.intersectionShape.triangle.push(new a.Triangle(oe.clone(), Ee, se.clone())); } } - E.vertices += 48, G = E.vertices * 3, P[G] = _.x, P[G + 1] = _.y, P[G + 2] = _.z, P[G + 3] = k.x, P[G + 4] = k.y, P[G + 5] = k.z, P[G + 6] = g.x, P[G + 7] = g.y, P[G + 8] = g.z, E.vertices += 3; - var Ce, ue, ne, _e, Oe, Re, Ue, We, Ee, Ae, ge, Le, Te, Ke, je, Y, q, te, we, me = E.vertices - 3, Pe = E.vertices - 2, Fe = E.vertices - 1, K = me * 3, fe = Pe * 3, Se = Fe * 3; - for (H = 0, W = O.length - 1; H < W; ++H) { - var Ne = R + 3 * H; - G = Ne * 3, ue = E.faceidx, ne = E.lineidx, _e = Ne, Ae = _e * 3, Oe = Ne + 1, ge = Oe * 3, Re = Ne + 2, Le = Re * 3, Ue = Ne + 4, Te = Ue * 3, We = Ne + 5, Ke = We * 3, Ee = Ne + 3, je = Ee * 3, Y = q = O[H], te = we = O[H + 1], B[Ae] = Y.x, B[ge] = q.x, B[je] = we.x, B[Ae + 1] = Y.y, B[ge + 1] = q.y, B[je + 1] = we.y, B[Ae + 2] = Y.z, B[ge + 2] = q.z, B[je + 2] = we.z, B[ge] = q.x, B[Te] = te.x, B[je] = we.x, B[ge + 1] = q.y, B[Te + 1] = te.y, B[je + 1] = we.y, B[ge + 2] = q.z, B[Te + 2] = te.z, B[je + 2] = we.z, B[Le] = q.x, B[Ke] = te.x, B[Le + 1] = q.y, B[Ke + 1] = te.y, B[Le + 2] = q.z, B[Ke + 2] = te.z, U[ue] = _e, U[ue + 1] = Oe, U[ue + 2] = Ee, U[ue + 3] = Oe, U[ue + 4] = Ue, U[ue + 5] = Ee, U[ue + 6] = _e, U[ue + 7] = Ee, U[ue + 8] = me, U[ue + 9] = Re, U[ue + 10] = Pe, U[ue + 11] = We, U[ue + 12] = Re, U[ue + 13] = Fe, U[ue + 14] = We, N[ne] = _e, N[ne + 1] = Oe, N[ne + 2] = _e, N[ne + 3] = Ee, N[ne + 4] = Ue, N[ne + 5] = Ee, N[ne + 6] = _e, N[ne + 7] = Ee, N[ne + 8] = Re, N[ne + 9] = Oe, N[ne + 10] = Re, N[ne + 11] = We, N[ne + 12] = Ue, N[ne + 13] = We, N[ne + 14] = Re, N[ne + 15] = Fe, N[ne + 16] = Re, N[ne + 17] = We, N[ne + 18] = Fe, N[ne + 19] = We, E.faceidx += 15, E.lineidx += 20; + E.vertices += 48, G = E.vertices * 3, N[G] = p.x, N[G + 1] = p.y, N[G + 2] = p.z, N[G + 3] = k.x, N[G + 4] = k.y, N[G + 5] = k.z, N[G + 6] = g.x, N[G + 7] = g.y, N[G + 8] = g.z, E.vertices += 3; + var Ae, he, ne, _e, Le, Be, Ue, He, We, Ge, Ne, Pe, Te, Me, De, V, Z, ee, ye, ce = E.vertices - 3, Ie = E.vertices - 2, ke = E.vertices - 1, Y = ce * 3, me = Ie * 3, we = ke * 3; + for (H = 0, U = O.length - 1; H < U; ++H) { + var Re = R + 3 * H; + G = Re * 3, he = E.faceidx, ne = E.lineidx, _e = Re, Ge = _e * 3, Le = Re + 1, Ne = Le * 3, Be = Re + 2, Pe = Be * 3, Ue = Re + 4, Te = Ue * 3, He = Re + 5, Me = He * 3, We = Re + 3, De = We * 3, V = Z = O[H], ee = ye = O[H + 1], B[Ge] = V.x, B[Ne] = Z.x, B[De] = ye.x, B[Ge + 1] = V.y, B[Ne + 1] = Z.y, B[De + 1] = ye.y, B[Ge + 2] = V.z, B[Ne + 2] = Z.z, B[De + 2] = ye.z, B[Ne] = Z.x, B[Te] = ee.x, B[De] = ye.x, B[Ne + 1] = Z.y, B[Te + 1] = ee.y, B[De + 1] = ye.y, B[Ne + 2] = Z.z, B[Te + 2] = ee.z, B[De + 2] = ye.z, B[Pe] = Z.x, B[Me] = ee.x, B[Pe + 1] = Z.y, B[Me + 1] = ee.y, B[Pe + 2] = Z.z, B[Me + 2] = ee.z, W[he] = _e, W[he + 1] = Le, W[he + 2] = We, W[he + 3] = Le, W[he + 4] = Ue, W[he + 5] = We, W[he + 6] = _e, W[he + 7] = We, W[he + 8] = ce, W[he + 9] = Be, W[he + 10] = Ie, W[he + 11] = He, W[he + 12] = Be, W[he + 13] = ke, W[he + 14] = He, P[ne] = _e, P[ne + 1] = Le, P[ne + 2] = _e, P[ne + 3] = We, P[ne + 4] = Ue, P[ne + 5] = We, P[ne + 6] = _e, P[ne + 7] = We, P[ne + 8] = Be, P[ne + 9] = Le, P[ne + 10] = Be, P[ne + 11] = He, P[ne + 12] = Ue, P[ne + 13] = He, P[ne + 14] = Be, P[ne + 15] = ke, P[ne + 16] = Be, P[ne + 17] = He, P[ne + 18] = ke, P[ne + 19] = He, E.faceidx += 15, E.lineidx += 20; } - Ce = [ + Ae = [ R + 45, R + 46, R + 1, R, R + 47, R + 2 - ], ue = E.faceidx, ne = E.lineidx, _e = Ce[0], Ae = _e * 3, Oe = Ce[1], ge = Oe * 3, Re = Ce[4], Le = Re * 3, Ue = Ce[2], Te = Ue * 3, We = Ce[5], Ke = We * 3, Ee = Ce[3], je = Ee * 3, Y = q = O[15], te = we = O[0], B[Ae] = Y.x, B[ge] = q.x, B[je] = we.x, B[Ae + 1] = Y.y, B[ge + 1] = q.y, B[je + 1] = we.y, B[Ae + 2] = Y.z, B[ge + 2] = q.z, B[je + 2] = we.z, B[ge] = q.x, B[Te] = te.x, B[je] = we.x, B[ge + 1] = q.y, B[Te + 1] = te.y, B[je + 1] = we.y, B[ge + 2] = q.z, B[Te + 2] = te.z, B[je + 2] = we.z, B[Le] = q.x, B[Ke] = te.x, B[Le + 1] = q.y, B[Ke + 1] = te.y, B[Le + 2] = q.z, B[Ke + 2] = te.z, $.normalize(), L.normalize(), B[K] = L.x, B[fe] = B[Se] = $.x, B[K + 1] = L.y, B[fe + 1] = B[Se + 1] = $.y, B[K + 2] = L.z, B[fe + 2] = B[Se + 2] = $.z, U[ue] = _e, U[ue + 1] = Oe, U[ue + 2] = Ee, U[ue + 3] = Oe, U[ue + 4] = Ue, U[ue + 5] = Ee, U[ue + 6] = _e, U[ue + 7] = Ee, U[ue + 8] = me, U[ue + 9] = Re, U[ue + 10] = Pe, U[ue + 11] = We, U[ue + 12] = Re, U[ue + 13] = Fe, U[ue + 14] = We, N[ne] = _e, N[ne + 1] = Oe, N[ne + 2] = _e, N[ne + 3] = Ee, N[ne + 4] = Ue, N[ne + 5] = Ee, N[ne + 6] = _e, N[ne + 7] = Ee, N[ne + 8] = Re, N[ne + 9] = Oe, N[ne + 10] = Re, N[ne + 11] = We, N[ne + 12] = Ue, N[ne + 13] = We, N[ne + 14] = Re, N[ne + 15] = Fe, N[ne + 16] = Re, N[ne + 17] = We, N[ne + 18] = Fe, N[ne + 19] = We, E.faceidx += 15, E.lineidx += 20; + ], he = E.faceidx, ne = E.lineidx, _e = Ae[0], Ge = _e * 3, Le = Ae[1], Ne = Le * 3, Be = Ae[4], Pe = Be * 3, Ue = Ae[2], Te = Ue * 3, He = Ae[5], Me = He * 3, We = Ae[3], De = We * 3, V = Z = O[15], ee = ye = O[0], B[Ge] = V.x, B[Ne] = Z.x, B[De] = ye.x, B[Ge + 1] = V.y, B[Ne + 1] = Z.y, B[De + 1] = ye.y, B[Ge + 2] = V.z, B[Ne + 2] = Z.z, B[De + 2] = ye.z, B[Ne] = Z.x, B[Te] = ee.x, B[De] = ye.x, B[Ne + 1] = Z.y, B[Te + 1] = ee.y, B[De + 1] = ye.y, B[Ne + 2] = Z.z, B[Te + 2] = ee.z, B[De + 2] = ye.z, B[Pe] = Z.x, B[Me] = ee.x, B[Pe + 1] = Z.y, B[Me + 1] = ee.y, B[Pe + 2] = Z.z, B[Me + 2] = ee.z, $.normalize(), L.normalize(), B[Y] = L.x, B[me] = B[we] = $.x, B[Y + 1] = L.y, B[me + 1] = B[we + 1] = $.y, B[Y + 2] = L.z, B[me + 2] = B[we + 2] = $.z, W[he] = _e, W[he + 1] = Le, W[he + 2] = We, W[he + 3] = Le, W[he + 4] = Ue, W[he + 5] = We, W[he + 6] = _e, W[he + 7] = We, W[he + 8] = ce, W[he + 9] = Be, W[he + 10] = Ie, W[he + 11] = He, W[he + 12] = Be, W[he + 13] = ke, W[he + 14] = He, P[ne] = _e, P[ne + 1] = Le, P[ne + 2] = _e, P[ne + 3] = We, P[ne + 4] = Ue, P[ne + 5] = We, P[ne + 6] = _e, P[ne + 7] = We, P[ne + 8] = Be, P[ne + 9] = Le, P[ne + 10] = Be, P[ne + 11] = He, P[ne + 12] = Ue, P[ne + 13] = He, P[ne + 14] = Be, P[ne + 15] = ke, P[ne + 16] = Be, P[ne + 17] = He, P[ne + 18] = ke, P[ne + 19] = He, E.faceidx += 15, E.lineidx += 20; } // Update a bounding sphere's position and radius // from list of centroids and new points @@ -21171,43 +21171,43 @@ ATOM`, x); * points, flat array of all points in shape * @param {int} numPoints, number of valid poitns in points */ - static updateBoundingFromPoints(f, s, h, _) { + static updateBoundingFromPoints(f, s, u, p) { f.center.set(0, 0, 0); - let g = 1 / 0, x = 1 / 0, c = 1 / 0, v = -1 / 0, M = -1 / 0, E = -1 / 0; - f.box && (g = f.box.min.x, v = f.box.max.x, x = f.box.min.y, M = f.box.max.y, c = f.box.min.z, E = f.box.max.z); - for (let z = 0, O = _; z < O; z++) { - var $ = h[z * 3], k = h[z * 3 + 1], L = h[z * 3 + 2]; - $ < g && (g = $), k < x && (x = k), L < c && (c = L), $ > v && (v = $), k > M && (M = k), L > E && (E = L); + let g = 1 / 0, w = 1 / 0, o = 1 / 0, v = -1 / 0, M = -1 / 0, E = -1 / 0; + f.box && (g = f.box.min.x, v = f.box.max.x, w = f.box.min.y, M = f.box.max.y, o = f.box.min.z, E = f.box.max.z); + for (let z = 0, O = p; z < O; z++) { + var $ = u[z * 3], k = u[z * 3 + 1], L = u[z * 3 + 2]; + $ < g && (g = $), k < w && (w = k), L < o && (o = L), $ > v && (v = $), k > M && (M = k), L > E && (E = L); } - f.center.set((v + g) / 2, (M + x) / 2, (E + c) / 2), f.radius = f.center.distanceTo({ x: v, y: M, z: E }), f.box = { min: { x: g, y: x, z: c }, max: { x: v, y: M, z: E } }; + f.center.set((v + g) / 2, (M + w) / 2, (E + o) / 2), f.radius = f.center.distanceTo({ x: v, y: M, z: E }), f.box = { min: { x: g, y: w, z: o }, max: { x: v, y: M, z: E } }; } //helper function for adding an appropriately sized mesh - static addCustomGeo(f, s, h, _, g) { - var x = s.addGeoGroup(), c = h.vertexArr, v = h.normalArr, M = h.faceArr; - x.vertices = c.length, x.faceidx = M.length; - var E, $, k, L, z, O, R, P, U, B = x.vertexArray, N = x.colorArray; - for (_.constructor !== Array && (P = _.r, U = _.g, L = _.b), O = 0, R = x.vertices; O < R; ++O) - E = O * 3, $ = c[O], B[E] = $.x, B[E + 1] = $.y, B[E + 2] = $.z, _.constructor === Array && (z = _[O], P = z.r, U = z.g, L = z.b), N[E] = P, N[E + 1] = U, N[E + 2] = L; + static addCustomGeo(f, s, u, p, g) { + var w = s.addGeoGroup(), o = u.vertexArr, v = u.normalArr, M = u.faceArr; + w.vertices = o.length, w.faceidx = M.length; + var E, $, k, L, z, O, R, N, W, B = w.vertexArray, P = w.colorArray; + for (p.constructor !== Array && (N = p.r, W = p.g, L = p.b), O = 0, R = w.vertices; O < R; ++O) + E = O * 3, $ = o[O], B[E] = $.x, B[E + 1] = $.y, B[E + 2] = $.z, p.constructor === Array && (z = p[O], N = z.r, W = z.g, L = z.b), P[E] = N, P[E + 1] = W, P[E + 2] = L; if (g) - for (O = 0, R = x.faceidx / 3; O < R; ++O) { + for (O = 0, R = w.faceidx / 3; O < R; ++O) { E = O * 3, k = M[E], L = M[E + 1], z = M[E + 2]; - var G = new l.Vector3(), H = new l.Vector3(), W = new l.Vector3(); - f.intersectionShape.triangle.push(new a.Triangle(G.copy(c[k]), H.copy(c[L]), W.copy(c[z]))); + var G = new l.Vector3(), H = new l.Vector3(), U = new l.Vector3(); + f.intersectionShape.triangle.push(new a.Triangle(G.copy(o[k]), H.copy(o[L]), U.copy(o[z]))); } if (g) { - var V = new l.Vector3(0, 0, 0), re = 0; - for (let ce = 0; ce < s.geometryGroups.length; ce++) - V.add(s.geometryGroups[ce].getCentroid()), re++; - V.divideScalar(re), w.updateBoundingFromPoints(f.boundingSphere, { centroid: V }, B, x.vertices); + var j = new l.Vector3(0, 0, 0), re = 0; + for (let ue = 0; ue < s.geometryGroups.length; ue++) + j.add(s.geometryGroups[ue].getCentroid()), re++; + j.divideScalar(re), x.updateBoundingFromPoints(f.boundingSphere, { centroid: j }, B, w.vertices); } - if (x.faceArray = new Uint16Array(M), x.truncateArrayBuffers(!0, !0), v.length < x.vertices) - x.setNormals(); + if (w.faceArray = new Uint16Array(M), w.truncateArrayBuffers(!0, !0), v.length < w.vertices) + w.setNormals(); else { - var ie = x.normalArray = new Float32Array(x.vertices * 3), ee; - for (O = 0, R = x.vertices; O < R; ++O) - E = O * 3, ee = v[O], ie[E] = ee.x, ie[E + 1] = ee.y, ie[E + 2] = ee.z; + var ie = w.normalArray = new Float32Array(w.vertices * 3), te; + for (O = 0, R = w.vertices; O < R; ++O) + E = O * 3, te = v[O], ie[E] = te.x, ie[E + 1] = te.y, ie[E + 2] = te.z; } - x.setLineIndices(), x.lineidx = x.lineArray.length; + w.setLineIndices(), w.lineidx = w.lineArray.length; } /* * @@ -21218,7 +21218,7 @@ ATOM`, x); * @returns {undefined} */ static updateFromStyle(f, s) { - typeof s.color < "u" ? (f.color = s.color || new d.Color(), s.color instanceof d.Color || (f.color = d.CC.color(s.color))) : f.color = d.CC.color(0), f.wireframe = !!s.wireframe, f.opacity = s.alpha ? (0, l.clamp)(s.alpha, 0, 1) : 1, typeof s.opacity < "u" && (f.opacity = (0, l.clamp)(s.opacity, 0, 1)), f.side = s.side !== void 0 ? s.side : r.DoubleSide, f.linewidth = typeof s.linewidth > "u" ? 1 : s.linewidth, f.clickable = !!s.clickable, f.callback = (0, y.makeFunction)(s.callback), f.hoverable = !!s.hoverable, f.hover_callback = (0, y.makeFunction)(s.hover_callback), f.unhover_callback = (0, y.makeFunction)(s.unhover_callback), f.contextMenuEnabled = !!s.contextMenuEnabled, f.hidden = s.hidden, f.frame = s.frame; + typeof s.color < "u" ? (f.color = s.color || new h.Color(), s.color instanceof h.Color || (f.color = h.CC.color(s.color))) : f.color = h.CC.color(0), f.wireframe = !!s.wireframe, f.opacity = s.alpha ? (0, l.clamp)(s.alpha, 0, 1) : 1, typeof s.opacity < "u" && (f.opacity = (0, l.clamp)(s.opacity, 0, 1)), f.side = s.side !== void 0 ? s.side : r.DoubleSide, f.linewidth = typeof s.linewidth > "u" ? 1 : s.linewidth, f.clickable = !!s.clickable, f.callback = (0, y.makeFunction)(s.callback), f.hoverable = !!s.hoverable, f.hover_callback = (0, y.makeFunction)(s.hover_callback), f.unhover_callback = (0, y.makeFunction)(s.unhover_callback), f.contextMenuEnabled = !!s.contextMenuEnabled, f.hidden = s.hidden, f.frame = s.frame; } /** * Custom renderable shape @@ -21233,7 +21233,7 @@ ATOM`, x); cylinder: [], line: [], triangle: [] - }, w.updateFromStyle(this, this.stylespec), this.components = [], this.shapeObj = null, this.renderedShapeObj = null, this.geo = new r.Geometry(!0), this.linegeo = new r.Geometry(!0); + }, x.updateFromStyle(this, this.stylespec), this.components = [], this.shapeObj = null, this.renderedShapeObj = null, this.geo = new r.Geometry(!0), this.linegeo = new r.Geometry(!0); } /** Update shape with new style specification * @param {ShapeSpec} newspec @@ -21245,12 +21245,12 @@ ATOM`, x); updateStyle(f) { for (var s in f) this.stylespec[s] = f[s]; - if (w.updateFromStyle(this, this.stylespec), f.voldata && f.volscheme) { + if (x.updateFromStyle(this, this.stylespec), f.voldata && f.volscheme) { (0, y.adjustVolumeStyle)(f); - const h = f.volscheme, _ = f.voldata, g = d.CC, x = h.range() || [-1, 1]; - this.geo.setColors(function(c, v, M) { - let E = _.getVal(c, v, M); - return g.color(h.valueToHex(E, x)); + const u = f.volscheme, p = f.voldata, g = h.CC, w = u.range() || [-1, 1]; + this.geo.setColors(function(o, v, M) { + let E = p.getVal(o, v, M); + return g.color(u.valueToHex(E, w)); }), delete this.color; } } @@ -21259,7 +21259,7 @@ ATOM`, x); * @param {CustomShapeSpec} customSpec */ addCustom(f) { - f.vertexArr = f.vertexArr || [], f.faceArr = f.faceArr || [], f.normalArr = f.normalArr || [], w.drawCustom(this, this.geo, f); + f.vertexArr = f.vertexArr || [], f.faceArr = f.faceArr || [], f.normalArr = f.normalArr || [], x.drawCustom(this, this.geo, f); } /** * Creates a sphere shape @@ -21270,11 +21270,11 @@ ATOM`, x); viewer.render(); */ addSphere(f) { - f.center || (f.center = new l.Vector3(0, 0, 0)), f.radius = f.radius ? (0, l.clamp)(f.radius, 0, 1 / 0) : 1.5, f.color = d.CC.color(f.color), this.intersectionShape.sphere.push(new a.Sphere(f.center, f.radius)), p.GLDraw.drawSphere(this.geo, f.center, f.radius, f.color, f.quality), this.components.push({ + f.center || (f.center = new l.Vector3(0, 0, 0)), f.radius = f.radius ? (0, l.clamp)(f.radius, 0, 1 / 0) : 1.5, f.color = h.CC.color(f.color), this.intersectionShape.sphere.push(new a.Sphere(f.center, f.radius)), _.GLDraw.drawSphere(this.geo, f.center, f.radius, f.color, f.quality), this.components.push({ centroid: new l.Vector3(f.center.x, f.center.y, f.center.z) }); var s = this.geo.updateGeoGroup(0); - w.updateBoundingFromPoints(this.boundingSphere, this.components, s.vertexArray, s.vertices); + x.updateBoundingFromPoints(this.boundingSphere, this.components, s.vertexArray, s.vertices); } /** * Creates a box @@ -21291,39 +21291,39 @@ ATOM`, x); viewer.render(); */ addBox(f) { - var s = f.dimensions || { w: 1, h: 1, d: 1 }, h; - typeof s.w == "number" ? h = { x: s.w, y: 0, z: 0 } : h = s.w; - var _; - typeof s.h == "number" ? _ = { x: 0, y: s.h, z: 0 } : _ = s.h; + var s = f.dimensions || { w: 1, h: 1, d: 1 }, u; + typeof s.w == "number" ? u = { x: s.w, y: 0, z: 0 } : u = s.w; + var p; + typeof s.h == "number" ? p = { x: 0, y: s.h, z: 0 } : p = s.h; var g; typeof s.d == "number" ? g = { x: 0, y: 0, z: s.d } : g = s.d; - var x = f.corner; - x == null && (f.center !== void 0 ? x = { - x: f.center.x - 0.5 * (h.x + _.x + g.x), - y: f.center.y - 0.5 * (h.y + _.y + g.y), - z: f.center.z - 0.5 * (h.z + _.z + g.z) - } : x = { x: 0, y: 0, z: 0 }); - var c = [ - { x: x.x, y: x.y, z: x.z }, - { x: x.x + h.x, y: x.y + h.y, z: x.z + h.z }, - { x: x.x + _.x, y: x.y + _.y, z: x.z + _.z }, - { x: x.x + h.x + _.x, y: x.y + h.y + _.y, z: x.z + h.z + _.z }, - { x: x.x + g.x, y: x.y + g.y, z: x.z + g.z }, - { x: x.x + h.x + g.x, y: x.y + h.y + g.y, z: x.z + h.z + g.z }, - { x: x.x + _.x + g.x, y: x.y + _.y + g.y, z: x.z + _.z + g.z }, - { x: x.x + h.x + _.x + g.x, y: x.y + h.y + _.y + g.y, z: x.z + h.z + _.z + g.z } + var w = f.corner; + w == null && (f.center !== void 0 ? w = { + x: f.center.x - 0.5 * (u.x + p.x + g.x), + y: f.center.y - 0.5 * (u.y + p.y + g.y), + z: f.center.z - 0.5 * (u.z + p.z + g.z) + } : w = { x: 0, y: 0, z: 0 }); + var o = [ + { x: w.x, y: w.y, z: w.z }, + { x: w.x + u.x, y: w.y + u.y, z: w.z + u.z }, + { x: w.x + p.x, y: w.y + p.y, z: w.z + p.z }, + { x: w.x + u.x + p.x, y: w.y + u.y + p.y, z: w.z + u.z + p.z }, + { x: w.x + g.x, y: w.y + g.y, z: w.z + g.z }, + { x: w.x + u.x + g.x, y: w.y + u.y + g.y, z: w.z + u.z + g.z }, + { x: w.x + p.x + g.x, y: w.y + p.y + g.y, z: w.z + p.z + g.z }, + { x: w.x + u.x + p.x + g.x, y: w.y + u.y + p.y + g.y, z: w.z + u.z + p.z + g.z } ], v = [], M = []; - v.splice(v.length, 0, c[0], c[1], c[2], c[3]), M.splice(M.length, 0, 0, 2, 1, 1, 2, 3); + v.splice(v.length, 0, o[0], o[1], o[2], o[3]), M.splice(M.length, 0, 0, 2, 1, 1, 2, 3); var E = 4; - v.splice(v.length, 0, c[2], c[3], c[6], c[7]), M.splice(M.length, 0, E + 0, E + 2, E + 1, E + 1, E + 2, E + 3), E += 4, v.splice(v.length, 0, c[4], c[5], c[0], c[1]), M.splice(M.length, 0, E + 0, E + 2, E + 1, E + 1, E + 2, E + 3), E += 4, v.splice(v.length, 0, c[6], c[7], c[4], c[5]), M.splice(M.length, 0, E + 0, E + 2, E + 1, E + 1, E + 2, E + 3), E += 4, v.splice(v.length, 0, c[3], c[1], c[7], c[5]), M.splice(M.length, 0, E + 0, E + 2, E + 1, E + 1, E + 2, E + 3), E += 4, v.splice(v.length, 0, c[2], c[6], c[0], c[4]), M.splice(M.length, 0, E + 0, E + 2, E + 1, E + 1, E + 2, E + 3), E += 4; + v.splice(v.length, 0, o[2], o[3], o[6], o[7]), M.splice(M.length, 0, E + 0, E + 2, E + 1, E + 1, E + 2, E + 3), E += 4, v.splice(v.length, 0, o[4], o[5], o[0], o[1]), M.splice(M.length, 0, E + 0, E + 2, E + 1, E + 1, E + 2, E + 3), E += 4, v.splice(v.length, 0, o[6], o[7], o[4], o[5]), M.splice(M.length, 0, E + 0, E + 2, E + 1, E + 1, E + 2, E + 3), E += 4, v.splice(v.length, 0, o[3], o[1], o[7], o[5]), M.splice(M.length, 0, E + 0, E + 2, E + 1, E + 1, E + 2, E + 3), E += 4, v.splice(v.length, 0, o[2], o[6], o[0], o[4]), M.splice(M.length, 0, E + 0, E + 2, E + 1, E + 1, E + 2, E + 3), E += 4; var $ = (0, y.extend)({}, f); - $.vertexArr = v, $.faceArr = M, $.normalArr = [], w.drawCustom(this, this.geo, $); + $.vertexArr = v, $.faceArr = M, $.normalArr = [], x.drawCustom(this, this.geo, $); var k = new l.Vector3(); this.components.push({ - centroid: k.addVectors(c[0], c[7]).multiplyScalar(0.5) + centroid: k.addVectors(o[0], o[7]).multiplyScalar(0.5) }); var L = this.geo.updateGeoGroup(0); - w.updateBoundingFromPoints(this.boundingSphere, this.components, L.vertexArray, L.vertices); + x.updateBoundingFromPoints(this.boundingSphere, this.components, L.vertexArray, L.vertices); } /** * Creates a cylinder shape @@ -21356,16 +21356,16 @@ ATOM`, x); viewer.render(); */ addCylinder(f) { - var s, h; - f.start ? s = new l.Vector3(f.start.x || 0, f.start.y || 0, f.start.z || 0) : s = new l.Vector3(0, 0, 0), f.end ? (h = new l.Vector3(f.end.x, f.end.y || 0, f.end.z || 0), typeof h.x > "u" && (h.x = 3)) : h = new l.Vector3(0, 0, 0); - var _ = f.radius || 0.1, g = d.CC.color(f.color); - this.intersectionShape.cylinder.push(new a.Cylinder(s, h, _)), p.GLDraw.drawCylinder(this.geo, s, h, _, g, f.fromCap, f.toCap); - var x = new l.Vector3(); + var s, u; + f.start ? s = new l.Vector3(f.start.x || 0, f.start.y || 0, f.start.z || 0) : s = new l.Vector3(0, 0, 0), f.end ? (u = new l.Vector3(f.end.x, f.end.y || 0, f.end.z || 0), typeof u.x > "u" && (u.x = 3)) : u = new l.Vector3(0, 0, 0); + var p = f.radius || 0.1, g = h.CC.color(f.color); + this.intersectionShape.cylinder.push(new a.Cylinder(s, u, p)), _.GLDraw.drawCylinder(this.geo, s, u, p, g, f.fromCap, f.toCap); + var w = new l.Vector3(); this.components.push({ - centroid: x.addVectors(s, h).multiplyScalar(0.5) + centroid: w.addVectors(s, u).multiplyScalar(0.5) }); - var c = this.geo.updateGeoGroup(0); - w.updateBoundingFromPoints(this.boundingSphere, this.components, c.vertexArray, c.vertices); + var o = this.geo.updateGeoGroup(0); + x.updateBoundingFromPoints(this.boundingSphere, this.components, o.vertexArray, o.vertices); } /** * Creates a dashed cylinder shape @@ -21375,16 +21375,16 @@ ATOM`, x); f.dashLength = f.dashLength || 0.25, f.gapLength = f.gapLength || 0.25; var s; f.start ? s = new l.Vector3(f.start.x || 0, f.start.y || 0, f.start.z || 0) : s = new l.Vector3(0, 0, 0); - var h; - f.end ? (h = new l.Vector3(f.end.x, f.end.y || 0, f.end.z || 0), typeof h.x > "u" && (h.x = 3)) : h = new l.Vector3(3, 0, 0); - for (var _ = f.radius || 0.1, g = d.CC.color(f.color), x = Math.sqrt(Math.pow(s.x - h.x, 2) + Math.pow(s.y - h.y, 2) + Math.pow(s.z - h.z, 2)), c = x / (f.gapLength + f.dashLength), v = new l.Vector3(f.start.x || 0, f.start.y || 0, f.start.z || 0), M = new l.Vector3(f.end.x, f.end.y || 0, f.end.z || 0), E = new l.Vector3((h.x - s.x) / (x / f.gapLength), (h.y - s.y) / (x / f.gapLength), (h.z - s.z) / (x / f.gapLength)), $ = new l.Vector3((h.x - s.x) / (x / f.dashLength), (h.y - s.y) / (x / f.dashLength), (h.z - s.z) / (x / f.dashLength)), k = 0; k < c; k++) - M = new l.Vector3(v.x + $.x, v.y + $.y, v.z + $.z), this.intersectionShape.cylinder.push(new a.Cylinder(v, M, _)), p.GLDraw.drawCylinder(this.geo, v, M, _, g, f.fromCap, f.toCap), v = new l.Vector3(M.x + E.x, M.y + E.y, M.z + E.z); + var u; + f.end ? (u = new l.Vector3(f.end.x, f.end.y || 0, f.end.z || 0), typeof u.x > "u" && (u.x = 3)) : u = new l.Vector3(3, 0, 0); + for (var p = f.radius || 0.1, g = h.CC.color(f.color), w = Math.sqrt(Math.pow(s.x - u.x, 2) + Math.pow(s.y - u.y, 2) + Math.pow(s.z - u.z, 2)), o = w / (f.gapLength + f.dashLength), v = new l.Vector3(f.start.x || 0, f.start.y || 0, f.start.z || 0), M = new l.Vector3(f.end.x, f.end.y || 0, f.end.z || 0), E = new l.Vector3((u.x - s.x) / (w / f.gapLength), (u.y - s.y) / (w / f.gapLength), (u.z - s.z) / (w / f.gapLength)), $ = new l.Vector3((u.x - s.x) / (w / f.dashLength), (u.y - s.y) / (w / f.dashLength), (u.z - s.z) / (w / f.dashLength)), k = 0; k < o; k++) + M = new l.Vector3(v.x + $.x, v.y + $.y, v.z + $.z), this.intersectionShape.cylinder.push(new a.Cylinder(v, M, p)), _.GLDraw.drawCylinder(this.geo, v, M, p, g, f.fromCap, f.toCap), v = new l.Vector3(M.x + E.x, M.y + E.y, M.z + E.z); var L = new l.Vector3(); this.components.push({ - centroid: L.addVectors(s, h).multiplyScalar(0.5) + centroid: L.addVectors(s, u).multiplyScalar(0.5) }); var z = this.geo.updateGeoGroup(0); - w.updateBoundingFromPoints(this.boundingSphere, this.components, z.vertexArray, z.vertices); + x.updateBoundingFromPoints(this.boundingSphere, this.components, z.vertexArray, z.vertices); } /** * Creates a curved shape @@ -21397,14 +21397,14 @@ ATOM`, x); console.log("Too few points in addCurve"); return; } - var h = f.radius || 0.1, _ = d.CC.color(f.color), g = 0, x = s.length - 1, c = s[0].distanceTo(s[1]), v = Math.ceil(2 * h / c); + var u = f.radius || 0.1, p = h.CC.color(f.color), g = 0, w = s.length - 1, o = s[0].distanceTo(s[1]), v = Math.ceil(2 * u / o); if (f.toArrow) { - x -= v; + w -= v; let k = { - start: s[x], + start: s[w], end: s[s.length - 1], - radius: h, - color: _, + radius: u, + color: p, mid: 1e-4 }; this.addArrow(k); @@ -21414,13 +21414,13 @@ ATOM`, x); let k = { start: s[g], end: s[0], - radius: h, - color: _, + radius: u, + color: p, mid: 1e-4 }; this.addArrow(k); } - for (var M = Math.ceil(s.length / 2), E = { radius: h, color: _, fromCap: 2, toCap: 2 }, $ = g; $ < x; $++) + for (var M = Math.ceil(s.length / 2), E = { radius: u, color: p, fromCap: 2, toCap: 2 }, $ = g; $ < w; $++) E.start = s[$], E.end = s[$ + 1], E.fromCap = 2, E.toCap = 2, $ < M ? (E.fromCap = 2, E.toCap = 0) : $ > M ? (E.fromCap = 0, E.toCap = 2) : (E.fromCap = 2, E.toCap = 2), this.addCylinder(E); } /** @@ -21434,16 +21434,16 @@ ATOM`, x); */ addLine(f) { - var s, h; - f.start ? s = new l.Vector3(f.start.x || 0, f.start.y || 0, f.start.z || 0) : s = new l.Vector3(0, 0, 0), f.end ? (h = new l.Vector3(f.end.x, f.end.y || 0, f.end.z || 0), typeof h.x > "u" && (h.x = 3)) : h = new l.Vector3(3, 0, 0); - var _ = this.geo.updateGeoGroup(2), g = _.vertices, x = g * 3, c = _.vertexArray; - c[x] = s.x, c[x + 1] = s.y, c[x + 2] = s.z, c[x + 3] = h.x, c[x + 4] = h.y, c[x + 5] = h.z, _.vertices += 2; - var v = _.lineArray, M = _.lineidx; - v[M] = g, v[M + 1] = g + 1, _.lineidx += 2; + var s, u; + f.start ? s = new l.Vector3(f.start.x || 0, f.start.y || 0, f.start.z || 0) : s = new l.Vector3(0, 0, 0), f.end ? (u = new l.Vector3(f.end.x, f.end.y || 0, f.end.z || 0), typeof u.x > "u" && (u.x = 3)) : u = new l.Vector3(3, 0, 0); + var p = this.geo.updateGeoGroup(2), g = p.vertices, w = g * 3, o = p.vertexArray; + o[w] = s.x, o[w + 1] = s.y, o[w + 2] = s.z, o[w + 3] = u.x, o[w + 4] = u.y, o[w + 5] = u.z, p.vertices += 2; + var v = p.lineArray, M = p.lineidx; + v[M] = g, v[M + 1] = g + 1, p.lineidx += 2; var E = new l.Vector3(); this.components.push({ - centroid: E.addVectors(s, h).multiplyScalar(0.5) - }), _ = this.geo.updateGeoGroup(0), w.updateBoundingFromPoints(this.boundingSphere, this.components, _.vertexArray, _.vertices); + centroid: E.addVectors(s, u).multiplyScalar(0.5) + }), p = this.geo.updateGeoGroup(0), x.updateBoundingFromPoints(this.boundingSphere, this.components, p.vertexArray, p.vertices); } /** * Creates an arrow shape @@ -21471,20 +21471,20 @@ ATOM`, x); var s = f.dir.clone().multiplyScalar(f.length).add(f.start); f.end = s; } else f.end ? (f.end = new l.Vector3(f.end.x, f.end.y || 0, f.end.z || 0), typeof f.end.x > "u" && (f.end.x = 3)) : f.end = new l.Vector3(3, 0, 0); - f.radius = f.radius || 0.1, f.radiusRatio = f.radiusRatio || 1.618034, f.mid = 0 < f.mid && f.mid < 1 ? f.mid : 0.618034, w.drawArrow(this, this.geo, f); - var h = new l.Vector3(); + f.radius = f.radius || 0.1, f.radiusRatio = f.radiusRatio || 1.618034, f.mid = 0 < f.mid && f.mid < 1 ? f.mid : 0.618034, x.drawArrow(this, this.geo, f); + var u = new l.Vector3(); this.components.push({ - centroid: h.addVectors(f.start, f.end).multiplyScalar(0.5) + centroid: u.addVectors(f.start, f.end).multiplyScalar(0.5) }); - var _ = this.geo.updateGeoGroup(0); - w.updateBoundingFromPoints(this.boundingSphere, this.components, _.vertexArray, _.vertices); + var p = this.geo.updateGeoGroup(0); + x.updateBoundingFromPoints(this.boundingSphere, this.components, p.vertexArray, p.vertices); } static distance_from(f, s) { return Math.sqrt(Math.pow(f.x - s.x, 2) + Math.pow(f.y - s.y, 2) + Math.pow(f.z - s.z, 2)); } - static inSelectedRegion(f, s, h) { - for (var _ = 0; _ < s.length; _++) - if (w.distance_from(s[_], f) <= h) + static inSelectedRegion(f, s, u) { + for (var p = 0; p < s.length; p++) + if (x.distance_from(s[p], f) <= u) return !0; return !1; } @@ -21515,52 +21515,52 @@ ATOM`, x); viewer.render(); }); */ - addIsosurface(f, s, h, _) { - var g = s.isoval !== void 0 && typeof s.isoval == "number" ? s.isoval : 0, x = !!s.voxel, c = s.smoothness === void 0 ? 1 : s.smoothness, v = f.size.x, M = f.size.y, E = f.size.z, $ = new Int16Array(v * M * E), k = f.data, L, z; + addIsosurface(f, s, u, p) { + var g = s.isoval !== void 0 && typeof s.isoval == "number" ? s.isoval : 0, w = !!s.voxel, o = s.smoothness === void 0 ? 1 : s.smoothness, v = f.size.x, M = f.size.y, E = f.size.z, $ = new Int16Array(v * M * E), k = f.data, L, z; for (L = 0, z = $.length; L < z; ++L) $[L] = -1; var O = new Uint8Array(v * M * E); for (L = 0, z = k.length; L < z; ++L) { var R = g >= 0 ? k[L] - g : g - k[L]; - R > 0 && (O[L] |= w.ISDONE); + R > 0 && (O[L] |= x.ISDONE); } - var P = [], U = []; - o.MarchingCube.march(O, P, U, { + var N = [], W = []; + c.MarchingCube.march(O, N, W, { fulltable: !0, - voxel: x, + voxel: w, unitCube: f.unit, origin: f.origin, matrix: f.matrix, nX: v, nY: M, nZ: E - }), !x && c > 0 && o.MarchingCube.laplacianSmooth(c, P, U); - var B = [], N = [], G = []; - if (s.selectedRegion && s.coords === void 0 && (s.coords = s.selectedRegion), s.coords === void 0 && s.selection !== void 0 && (_ ? s.coords = _.selectedAtoms(s.selection) : console.log("addIsosurface needs viewer is selection provided.")), s.coords !== void 0) { - var H = s.coords[0].x, W = s.coords[0].y, V = s.coords[0].z, re = s.coords[0].x, ie = s.coords[0].y, ee = s.coords[0].z; + }), !w && o > 0 && c.MarchingCube.laplacianSmooth(o, N, W); + var B = [], P = [], G = []; + if (s.selectedRegion && s.coords === void 0 && (s.coords = s.selectedRegion), s.coords === void 0 && s.selection !== void 0 && (p ? s.coords = p.selectedAtoms(s.selection) : console.log("addIsosurface needs viewer is selection provided.")), s.coords !== void 0) { + var H = s.coords[0].x, U = s.coords[0].y, j = s.coords[0].z, re = s.coords[0].x, ie = s.coords[0].y, te = s.coords[0].z; for (let ne = 0; ne < s.coords.length; ne++) - s.coords[ne].x > H ? H = s.coords[ne].x : s.coords[ne].x < re && (re = s.coords[ne].x), s.coords[ne].y > W ? W = s.coords[ne].y : s.coords[ne].y < ie && (ie = s.coords[ne].y), s.coords[ne].z > V ? V = s.coords[ne].z : s.coords[ne].z < ee && (ee = s.coords[ne].z); - var ce = 2; - s.radius !== void 0 && (ce = s.radius), s.selectedOffset !== void 0 && (ce = s.selectedOffset), s.seldist !== void 0 && (ce = s.seldist), re -= ce, H += ce, ie -= ce, W += ce, ee -= ce, V += ce; - for (let ne = 0; ne < P.length; ne++) - P[ne].x > re && P[ne].x < H && P[ne].y > ie && P[ne].y < W && P[ne].z > ee && P[ne].z < V && w.inSelectedRegion(P[ne], s.coords, ce) ? (B.push(N.length), N.push(P[ne])) : B.push(-1); - for (let ne = 0; ne + 2 < U.length; ne += 3) - B[U[ne]] !== -1 && B[U[ne + 1]] !== -1 && B[U[ne + 2]] !== -1 && (G.push(U[ne] - (U[ne] - B[U[ne]])), G.push(U[ne + 1] - (U[ne + 1] - B[U[ne + 1]])), G.push(U[ne + 2] - (U[ne + 2] - B[U[ne + 2]]))); - P = N, U = G; - } - w.drawCustom(this, this.geo, { - vertexArr: P, - faceArr: U, + s.coords[ne].x > H ? H = s.coords[ne].x : s.coords[ne].x < re && (re = s.coords[ne].x), s.coords[ne].y > U ? U = s.coords[ne].y : s.coords[ne].y < ie && (ie = s.coords[ne].y), s.coords[ne].z > j ? j = s.coords[ne].z : s.coords[ne].z < te && (te = s.coords[ne].z); + var ue = 2; + s.radius !== void 0 && (ue = s.radius), s.selectedOffset !== void 0 && (ue = s.selectedOffset), s.seldist !== void 0 && (ue = s.seldist), re -= ue, H += ue, ie -= ue, U += ue, te -= ue, j += ue; + for (let ne = 0; ne < N.length; ne++) + N[ne].x > re && N[ne].x < H && N[ne].y > ie && N[ne].y < U && N[ne].z > te && N[ne].z < j && x.inSelectedRegion(N[ne], s.coords, ue) ? (B.push(P.length), P.push(N[ne])) : B.push(-1); + for (let ne = 0; ne + 2 < W.length; ne += 3) + B[W[ne]] !== -1 && B[W[ne + 1]] !== -1 && B[W[ne + 2]] !== -1 && (G.push(W[ne] - (W[ne] - B[W[ne]])), G.push(W[ne + 1] - (W[ne + 1] - B[W[ne + 1]])), G.push(W[ne + 2] - (W[ne + 2] - B[W[ne + 2]]))); + N = P, W = G; + } + x.drawCustom(this, this.geo, { + vertexArr: N, + faceArr: W, normalArr: [], clickable: s.clickable, hoverable: s.hoverable }), this.updateStyle(s); - var he = new l.Vector3(f.origin.x, f.origin.y, f.origin.z), le = new l.Vector3(f.size.x * f.unit.x, f.size.y * f.unit.y, f.size.z * f.unit.z), J = new l.Vector3(0, 0, 0), Me = he.clone(), se = he.clone().add(le); - for (let ne = 0; ne < P.length; ne++) - J.add(P[ne]), Me.max(P[ne]), se.min(P[ne]); - J.divideScalar(P.length); - var Ce = J.distanceTo(se), ue = J.distanceTo(Me); - this.boundingSphere.center = J, this.boundingSphere.radius = Math.max(Ce, ue), typeof h == "function" && h(); + var de = new l.Vector3(f.origin.x, f.origin.y, f.origin.z), oe = new l.Vector3(f.size.x * f.unit.x, f.size.y * f.unit.y, f.size.z * f.unit.z), J = new l.Vector3(0, 0, 0), Ee = de.clone(), se = de.clone().add(oe); + for (let ne = 0; ne < N.length; ne++) + J.add(N[ne]), Ee.max(N[ne]), se.min(N[ne]); + J.divideScalar(N.length); + var Ae = J.distanceTo(se), he = J.distanceTo(Ee); + this.boundingSphere.center = J, this.boundingSphere.radius = Math.max(Ae, he), typeof u == "function" && u(); } /** * @deprecated Use addIsosurface instead @@ -21569,12 +21569,12 @@ ATOM`, x); * @param {string} fmt - Input data format (e.g. 'cube' for cube file format) * @param {IsoSurfaceSpec} isoSpec - Volumetric data shape specification */ - addVolumetricData(f, s, h) { - f = new u.VolumeData(f, s), this.addIsosurface(f, h); + addVolumetricData(f, s, u) { + f = new d.VolumeData(f, s), this.addIsosurface(f, u); } //for internal use, truncate buffers to save memory finalize() { - return w.finalizeGeo(this.geo), this.geo.initTypedArrays(), this.geo; + return x.finalizeGeo(this.geo), this.geo.initTypedArrays(), this.geo; } /* * Initialize webgl objects for rendering @@ -21583,7 +21583,7 @@ ATOM`, x); */ globj(f) { if (this.renderedShapeObj && (f.remove(this.renderedShapeObj), this.renderedShapeObj = null), !this.hidden) { - w.finalizeGeo(this.geo), this.geo.initTypedArrays(), this.wireframe && this.geo.setUpWireframe(), typeof this.color < "u" && w.updateColor(this.geo, this.color), this.shapeObj = new r.Object3D(); + x.finalizeGeo(this.geo), this.geo.initTypedArrays(), this.wireframe && this.geo.setUpWireframe(), typeof this.color < "u" && x.updateColor(this.geo, this.color), this.shapeObj = new r.Object3D(); var s = null; this.side == r.DoubleSide ? s = new r.MeshDoubleLambertMaterial({ wireframe: this.wireframe, @@ -21600,12 +21600,12 @@ ATOM`, x); wireframeLinewidth: this.linewidth, vertexColors: r.Coloring.VertexColors }); - var h = new r.Mesh(this.geo, s); - if (this.shapeObj.add(h), this.linegeo && this.linegeo.vertices > 0) { - var _ = new r.LineBasicMaterial({ + var u = new r.Mesh(this.geo, s); + if (this.shapeObj.add(u), this.linegeo && this.linegeo.vertices > 0) { + var p = new r.LineBasicMaterial({ linewidth: this.linewidth, color: this.color - }), g = new r.Line(this.linegeo, _, r.LineStyle.LinePieces); + }), g = new r.Line(this.linegeo, p, r.LineStyle.LinePieces); this.shapeObj.add(g); } this.renderedShapeObj = this.shapeObj.clone(), f.add(this.renderedShapeObj); @@ -21627,13 +21627,13 @@ ATOM`, x); return this.boundingSphere.center.z; } } - w.ISDONE = 2, w.drawCustom = function(A, f, s) { - var h = s, _ = h.vertexArr, g = h.faceArr; - (_.length === 0 || g.length === 0) && console.warn("Error adding custom shape component: No vertices and/or face indices supplied!"); - var x = s.color; - typeof x > "u" && (x = A.color), x = d.CC.color(x); - for (var c = b(h), v = 0, M = c.length; v < M; v++) - w.addCustomGeo(A, f, c[v], c[v].colorArr ? c[v].colorArr : x, s.clickable); + x.ISDONE = 2, x.drawCustom = function(A, f, s) { + var u = s, p = u.vertexArr, g = u.faceArr; + (p.length === 0 || g.length === 0) && console.warn("Error adding custom shape component: No vertices and/or face indices supplied!"); + var w = s.color; + typeof w > "u" && (w = A.color), w = h.CC.color(w); + for (var o = b(u), v = 0, M = o.length; v < M; v++) + x.addCustomGeo(A, f, o[v], o[v].colorArr ? o[v].colorArr : w, s.clickable); }; function b(A) { var f = 64e3; @@ -21641,12 +21641,12 @@ ATOM`, x); return [A]; var s = [{ vertexArr: [], normalArr: [], faceArr: [] }]; A.colorArr && (s.colorArr = []); - var h = [], _ = [], g = 0, x = A.faceArr; - for (let v = 0, M = x.length; v < M; v += 3) { + var u = [], p = [], g = 0, w = A.faceArr; + for (let v = 0, M = w.length; v < M; v += 3) { let E = s[g]; for (let $ = 0; $ < 3; $++) { - var c = x[v + $]; - h[c] !== g && (h[c] = g, _[c] = E.vertexArr.length, E.vertexArr.push(A.vertexArr[c]), A.normalArr && A.normalArr[c] && E.normalArr.push(A.normalArr[c]), A.colorArr && A.colorArr[c] && E.colorArr.push(A.colorArr[c])), E.faceArr.push(_[c]); + var o = w[v + $]; + u[o] !== g && (u[o] = g, p[o] = E.vertexArr.length, E.vertexArr.push(A.vertexArr[o]), A.normalArr && A.normalArr[o] && E.normalArr.push(A.normalArr[o]), A.colorArr && A.colorArr[o] && E.colorArr.push(A.colorArr[o])), E.faceArr.push(p[o]); } E.vertexArr.length >= f && (s.push({ vertexArr: [], normalArr: [], faceArr: [] }), A.colorArr && (s.colorArr = []), g++); } @@ -21680,12 +21680,12 @@ ATOM`, x); /* harmony export */ createViewer: () => ( /* binding */ - h + u ), /* harmony export */ createViewerGrid: () => ( /* binding */ - _ + p ) /* harmony export */ }); @@ -21698,16 +21698,16 @@ ATOM`, x); ), l = t( /*! ./colors */ "./src/colors.ts" - ), d = t( + ), h = t( /*! ./utilities */ "./src/utilities.ts" - ), o = t( + ), c = t( /*! ./Gradient */ "./src/Gradient.ts" - ), u = t( + ), d = t( /*! ./GLModel */ "./src/GLModel.ts" - ), p = t( + ), _ = t( /*! ./Label */ "./src/Label.ts" ), m = t( @@ -21716,7 +21716,7 @@ ATOM`, x); ), y = t( /*! ./VolumeData */ "./src/VolumeData.ts" - ), w = t( + ), x = t( /*! ./ProteinSurface4 */ "./src/ProteinSurface4.ts" ), b = t( @@ -21729,18 +21729,18 @@ ATOM`, x); const f = 16; class s { getWidth() { - let c = this.container, v = c.offsetWidth; - if (v == 0 && c.style.display === "none") { - let M = c.style.position, E = c.style.visibility; - c.style.display = "block", c.style.visibility = "hidden", c.style.position = "absolute", v = c.offsetWidth, c.style.display = "none", c.style.visibility = E, c.style.position = M; + let o = this.container, v = o.offsetWidth; + if (v == 0 && o.style.display === "none") { + let M = o.style.position, E = o.style.visibility; + o.style.display = "block", o.style.visibility = "hidden", o.style.position = "absolute", v = o.offsetWidth, o.style.display = "none", o.style.visibility = E, o.style.position = M; } return v; } getHeight() { - let c = this.container, v = c.offsetHeight; - if (v == 0 && c.style.display === "none") { - let M = c.style.position, E = c.style.visibility; - c.style.display = "block", c.style.visibility = "hidden", c.style.position = "absolute", v = c.offsetHeight, c.style.display = "none", c.style.visibility = E, c.style.position = M; + let o = this.container, v = o.offsetHeight; + if (v == 0 && o.style.display === "none") { + let M = o.style.position, E = o.style.visibility; + o.style.display = "block", o.style.visibility = "hidden", o.style.position = "absolute", v = o.offsetHeight, o.style.display = "none", o.style.visibility = E, o.style.position = M; } return v; } @@ -21764,10 +21764,10 @@ ATOM`, x); } initializeScene() { this.scene = new r.Scene(), this.scene.fog = new r.Fog(this.bgColor, 100, 200), this.modelGroup = new r.Object3D(), this.rotationGroup = new r.Object3D(), this.rotationGroup.useQuaternion = !0, this.rotationGroup.quaternion = new a.Quaternion(0, 0, 0, 1), this.rotationGroup.add(this.modelGroup), this.scene.add(this.rotationGroup); - var c = new r.Light(16777215); - c.position = new a.Vector3(0.2, 0.2, 1).normalize(), c.intensity = 1, this.scene.add(c); + var o = new r.Light(16777215); + o.position = new a.Vector3(0.2, 0.2, 1).normalize(), o.intensity = 1, this.scene.add(o); } - _handleLostContext(c) { + _handleLostContext(o) { const v = function(M) { const E = M.getBoundingClientRect(); return !(E.right < 0 || E.bottom < 0 || E.top > (window.innerHeight || document.documentElement.clientHeight) || E.left > (window.innerWidth || document.documentElement.clientWidth)); @@ -21779,8 +21779,8 @@ ATOM`, x); break; } } - initContainer(c) { - this.container = c, this.WIDTH = this.getWidth(), this.HEIGHT = this.getHeight(), this.ASPECT = this.renderer.getAspect(this.WIDTH, this.HEIGHT), this.renderer.setSize(this.WIDTH, this.HEIGHT), this.container.append(this.renderer.domElement), this.glDOM = this.renderer.domElement, this.glDOM._3dmol_viewer = this, this.glDOM.addEventListener("webglcontextlost", this._handleLostContext.bind(this)), this.nomouse || (this.glDOM.addEventListener("mousedown", this._handleMouseDown.bind(this), { passive: !1 }), this.glDOM.addEventListener("touchstart", this._handleMouseDown.bind(this), { passive: !1 }), this.glDOM.addEventListener("wheel", this._handleMouseScroll.bind(this), { passive: !1 }), this.glDOM.addEventListener("mousemove", this._handleMouseMove.bind(this), { passive: !1 }), this.glDOM.addEventListener("touchmove", this._handleMouseMove.bind(this), { passive: !1 }), this.glDOM.addEventListener("contextmenu", this._handleContextMenu.bind(this), { passive: !1 })); + initContainer(o) { + this.container = o, this.WIDTH = this.getWidth(), this.HEIGHT = this.getHeight(), this.ASPECT = this.renderer.getAspect(this.WIDTH, this.HEIGHT), this.renderer.setSize(this.WIDTH, this.HEIGHT), this.container.append(this.renderer.domElement), this.glDOM = this.renderer.domElement, this.glDOM._3dmol_viewer = this, this.glDOM.addEventListener("webglcontextlost", this._handleLostContext.bind(this)), this.nomouse || (this.glDOM.addEventListener("mousedown", this._handleMouseDown.bind(this), { passive: !1 }), this.glDOM.addEventListener("touchstart", this._handleMouseDown.bind(this), { passive: !1 }), this.glDOM.addEventListener("wheel", this._handleMouseScroll.bind(this), { passive: !1 }), this.glDOM.addEventListener("mousemove", this._handleMouseMove.bind(this), { passive: !1 }), this.glDOM.addEventListener("touchmove", this._handleMouseMove.bind(this), { passive: !1 }), this.glDOM.addEventListener("contextmenu", this._handleContextMenu.bind(this), { passive: !1 })); } decAnim() { this.animated--, this.animated < 0 && (this.animated = 0); @@ -21789,22 +21789,22 @@ ATOM`, x); this.animated++; } nextSurfID() { - var c = 0; + var o = 0; for (let M in this.surfaces) if (this.surfaces.hasOwnProperty(M)) { var v = parseInt(M); - isNaN(v) || v > c && (c = v); + isNaN(v) || v > o && (o = v); } - return c + 1; + return o + 1; } setSlabAndFog() { - let c = this.camera.position.z - this.rotationGroup.position.z; - c < 1 && (c = 1), this.camera.near = c + this.slabNear, this.camera.near < 1 && (this.camera.near = 1), this.camera.far = c + this.slabFar, this.camera.near + 1 > this.camera.far && (this.camera.far = this.camera.near + 1), this.camera.fov = this.fov, this.camera.right = c * Math.tan(Math.PI / 180 * this.fov), this.camera.left = -this.camera.right, this.camera.top = this.camera.right / this.ASPECT, this.camera.bottom = -this.camera.top, this.camera.updateProjectionMatrix(), this.scene.fog.near = this.camera.near + this.fogStart * (this.camera.far - this.camera.near), this.scene.fog.far = this.camera.far, this.config.disableFog && (this.scene.fog.near = this.scene.fog.far); + let o = this.camera.position.z - this.rotationGroup.position.z; + o < 1 && (o = 1), this.camera.near = o + this.slabNear, this.camera.near < 1 && (this.camera.near = 1), this.camera.far = o + this.slabFar, this.camera.near + 1 > this.camera.far && (this.camera.far = this.camera.near + 1), this.camera.fov = this.fov, this.camera.right = o * Math.tan(Math.PI / 180 * this.fov), this.camera.left = -this.camera.right, this.camera.top = this.camera.right / this.ASPECT, this.camera.bottom = -this.camera.top, this.camera.updateProjectionMatrix(), this.scene.fog.near = this.camera.near + this.fogStart * (this.camera.far - this.camera.near), this.scene.fog.far = this.camera.far, this.config.disableFog && (this.scene.fog.near = this.scene.fog.far); } // display scene //if nolink is set/true, don't propagate changes to linked viewers - show(c) { - if (this.renderer.setViewport(), !!this.scene && (this.setSlabAndFog(), this.renderer.render(this.scene, this.camera), this.viewChangeCallback && this.viewChangeCallback(this._viewer.getView()), !c && this.linkedViewers.length > 0)) + show(o) { + if (this.renderer.setViewport(), !!this.scene && (this.setSlabAndFog(), this.renderer.render(this.scene, this.camera), this.viewChangeCallback && this.viewChangeCallback(this._viewer.getView()), !o && this.linkedViewers.length > 0)) for (var v = this._viewer.getView(), M = 0; M < this.linkedViewers.length; M++) { var E = this.linkedViewers[M]; E.setView(v, !0); @@ -21814,8 +21814,8 @@ ATOM`, x); //also updates hoverables updateClickables() { this.clickables.splice(0, this.clickables.length), this.hoverables.splice(0, this.hoverables.length), this.contextMenuEnabledObjects.splice(0, this.contextMenuEnabledObjects.length); - for (let c = 0, v = this.models.length; c < v; c++) { - let M = this.models[c]; + for (let o = 0, v = this.models.length; o < v; o++) { + let M = this.models[o]; if (M) { let E = M.selectedAtoms({ clickable: !0 @@ -21830,36 +21830,36 @@ ATOM`, x); this.contextMenuEnabledObjects.push(k[L]); } } - for (let c = 0, v = this.shapes.length; c < v; c++) { - let M = this.shapes[c]; + for (let o = 0, v = this.shapes.length; o < v; o++) { + let M = this.shapes[o]; M && M.clickable && this.clickables.push(M), M && M.hoverable && this.hoverables.push(M), M && M.contextMenuEnabled && this.contextMenuEnabledObjects.push(M); } } // Checks for selection intersects on mousedown - handleClickSelection(c, v, M) { - let E = this.targetedObjects(c, v, this.clickables); + handleClickSelection(o, v, M) { + let E = this.targetedObjects(o, v, this.clickables); if (E.length) { var $ = E[0].clickable; - $.callback !== void 0 && (typeof $.callback != "function" && ($.callback = (0, d.makeFunction)($.callback)), typeof $.callback == "function" && (this.mouseButton === 3 && this.contextMenuEnabledObjects.includes($) && this.userContextMenuHandler || $.callback($, this._viewer, M, this.container, E))); + $.callback !== void 0 && (typeof $.callback != "function" && ($.callback = (0, h.makeFunction)($.callback)), typeof $.callback == "function" && (this.mouseButton === 3 && this.contextMenuEnabledObjects.includes($) && this.userContextMenuHandler || $.callback($, this._viewer, M, this.container, E))); } } //return offset of container canvasOffset() { - let c = this.glDOM, v = c.getBoundingClientRect(), M = c.ownerDocument, E = M.documentElement, $ = M.defaultView; + let o = this.glDOM, v = o.getBoundingClientRect(), M = o.ownerDocument, E = M.documentElement, $ = M.defaultView; return { top: v.top + $.pageYOffset - E.clientTop, left: v.left + $.pageXOffset - E.clientLeft }; } //set current_hover to sel (which can be null), calling appropraite callbacks - setHover(c, v, M) { - this.current_hover != c && (this.current_hover && (typeof this.current_hover.unhover_callback != "function" && (this.current_hover.unhover_callback = (0, d.makeFunction)(this.current_hover.unhover_callback)), this.current_hover.unhover_callback(this.current_hover, this._viewer, v, this.container, M)), this.current_hover = c, c && c.hover_callback !== void 0 && (typeof c.hover_callback != "function" && (c.hover_callback = (0, d.makeFunction)(c.hover_callback)), typeof c.hover_callback == "function" && c.hover_callback(c, this._viewer, v, this.container, M))); + setHover(o, v, M) { + this.current_hover != o && (this.current_hover && (typeof this.current_hover.unhover_callback != "function" && (this.current_hover.unhover_callback = (0, h.makeFunction)(this.current_hover.unhover_callback)), this.current_hover.unhover_callback(this.current_hover, this._viewer, v, this.container, M)), this.current_hover = o, o && o.hover_callback !== void 0 && (typeof o.hover_callback != "function" && (o.hover_callback = (0, h.makeFunction)(o.hover_callback)), typeof o.hover_callback == "function" && o.hover_callback(o, this._viewer, v, this.container, M))); } //checks for selection intersects on hover - handleHoverSelection(c, v, M) { + handleHoverSelection(o, v, M) { if (this.hoverables.length == 0) return; - let E = this.targetedObjects(c, v, this.hoverables); + let E = this.targetedObjects(o, v, this.hoverables); if (E.length) { var $ = E[0].clickable; this.setHover($, M, E), this.current_hover = $; @@ -21867,8 +21867,8 @@ ATOM`, x); this.setHover(null); } //sees if the mouse is still on the object that invoked a hover event and if not then the unhover callback is called - handleHoverContinue(c, v) { - let M = this.targetedObjects(c, v, this.hoverables); + handleHoverContinue(o, v) { + let M = this.targetedObjects(o, v, this.hoverables); (M.length == 0 || M[0] === void 0) && this.setHover(null), M[0] !== void 0 && M[0].clickable !== this.current_hover && this.setHover(null); } /** @@ -21877,31 +21877,31 @@ ATOM`, x); * @param {Event} event * @param {{ allowTolerance, tolerance: number }} options */ - closeEnoughForClick(c, { allowTolerance: v = c.targetTouches, tolerance: M = 5 } = {}) { - const E = this.getX(c), $ = this.getY(c); + closeEnoughForClick(o, { allowTolerance: v = o.targetTouches, tolerance: M = 5 } = {}) { + const E = this.getX(o), $ = this.getY(o); if (v) { const k = Math.abs(E - this.mouseStartX), L = Math.abs($ - this.mouseStartY); return k <= M && L <= M; } else return E === this.mouseStartX && $ === this.mouseStartY; } - calcTouchDistance(c) { - var v = c.targetTouches[0].pageX - c.targetTouches[1].pageX, M = c.targetTouches[0].pageY - c.targetTouches[1].pageY; + calcTouchDistance(o) { + var v = o.targetTouches[0].pageX - o.targetTouches[1].pageX, M = o.targetTouches[0].pageY - o.targetTouches[1].pageY; return Math.hypot(v, M); } //check targetTouches as well - getX(c) { - var v = c.pageX; - return v == null && (v = c.pageX), c.targetTouches && c.targetTouches[0] ? v = c.targetTouches[0].pageX : c.changedTouches && c.changedTouches[0] && (v = c.changedTouches[0].pageX), v; + getX(o) { + var v = o.pageX; + return v == null && (v = o.pageX), o.targetTouches && o.targetTouches[0] ? v = o.targetTouches[0].pageX : o.changedTouches && o.changedTouches[0] && (v = o.changedTouches[0].pageX), v; } - getY(c) { - var v = c.pageY; - return v == null && (v = c.pageY), c.targetTouches && c.targetTouches[0] ? v = c.targetTouches[0].pageY : c.changedTouches && c.changedTouches[0] && (v = c.changedTouches[0].pageY), v; + getY(o) { + var v = o.pageY; + return v == null && (v = o.pageY), o.targetTouches && o.targetTouches[0] ? v = o.targetTouches[0].pageY : o.changedTouches && o.changedTouches[0] && (v = o.changedTouches[0].pageY), v; } //for grid viewers, return true if point is in this viewer - isInViewer(c, v) { + isInViewer(o, v) { if (this.viewers != null) { - var M = this.WIDTH / this.cols, E = this.HEIGHT / this.rows, $ = this.canvasOffset(), k = c - $.left, L = v - $.top, z = this.rows - Math.floor(L / E) - 1, O = Math.floor(k / M); + var M = this.WIDTH / this.cols, E = this.HEIGHT / this.rows, $ = this.canvasOffset(), k = o - $.left, L = v - $.top, z = this.rows - Math.floor(L / E) - 1, O = Math.floor(k / M); if (z != this.row || O != this.col) return !1; } @@ -21909,40 +21909,40 @@ ATOM`, x); } //if the user has specify zoom limits, readjust to fit within them //also, make sure we don't go past CAMERA_Z - adjustZoomToLimits(c) { + adjustZoomToLimits(o) { if (this.config.lowerZoomLimit && this.config.lowerZoomLimit > 0) { let v = this.CAMERA_Z - this.config.lowerZoomLimit; - c > v && (c = v); + o > v && (o = v); } if (this.config.upperZoomLimit && this.config.upperZoomLimit > 0) { let v = this.CAMERA_Z - this.config.upperZoomLimit; - c < v && (c = v); + o < v && (o = v); } - return c > this.CAMERA_Z - 1 && (c = this.CAMERA_Z - 1), c; + return o > this.CAMERA_Z - 1 && (o = this.CAMERA_Z - 1), o; } //interpolate between two normalized quaternions (t between 0 and 1) //https://en.wikipedia.org/wiki/Slerp - static slerp(c, v, M) { + static slerp(o, v, M) { if (M == 1) return v.clone(); if (M == 0) - return c.clone(); - let E = c.x * v.x + c.y * v.y + c.z * v.z + c.w * v.w; + return o.clone(); + let E = o.x * v.x + o.y * v.y + o.z * v.z + o.w * v.w; if (E > 0.9995) { - let P = new a.Quaternion(c.x + M * (v.x - c.x), c.y + M * (v.y - c.y), c.z + M * (v.z - c.z), c.w + M * (v.w - c.w)); - return P.normalize(), P; + let N = new a.Quaternion(o.x + M * (v.x - o.x), o.y + M * (v.y - o.y), o.z + M * (v.z - o.z), o.w + M * (v.w - o.w)); + return N.normalize(), N; } E < 0 && (v = v.clone().multiplyScalar(-1), E = -E), E > 1 ? E = 1 : E < -1 && (E = -1); var $ = Math.acos(E), k = $ * M, L = v.clone(); - L.sub(c.clone().multiplyScalar(E)), L.normalize(); - var z = Math.cos(k), O = Math.sin(k), R = new a.Quaternion(c.x * z + L.x * O, c.y * z + L.y * O, c.z * z + L.z * O, c.w * z + L.w * O); + L.sub(o.clone().multiplyScalar(E)), L.normalize(); + var z = Math.cos(k), O = Math.sin(k), R = new a.Quaternion(o.x * z + L.x * O, o.y * z + L.y * O, o.z * z + L.z * O, o.w * z + L.w * O); return R.normalize(), R; } /* @param {Object} element HTML element within which to create viewer * @param {ViewerSpec} config Object containing optional configuration for the viewer */ - constructor(c, v = {}) { - if (this.nomouse = !1, this.glDOM = null, this.models = [], this.surfaces = {}, this.shapes = [], this.labels = [], this.clickables = [], this.hoverables = [], this.contextMenuEnabledObjects = [], this.current_hover = null, this.hoverDuration = 500, this.longTouchDuration = 1e3, this.viewer_frame = 0, this.viewChangeCallback = null, this.stateChangeCallback = null, this.NEAR = 1, this.FAR = 800, this.CAMERA_Z = 150, this.fov = 20, this.linkedViewers = [], this.renderer = null, this.control_all = !1, this.scene = null, this.rotationGroup = null, this.modelGroup = null, this.fogStart = 0.4, this.slabNear = -50, this.slabFar = 50, this.cq = new a.Quaternion(0, 0, 0, 1), this.dq = new a.Quaternion(0, 0, 0, 1), this.animated = 0, this.animationTimers = /* @__PURE__ */ new Set(), this.isDragging = !1, this.mouseStartX = 0, this.mouseStartY = 0, this.touchDistanceStart = 0, this.touchHold = !1, this.currentModelPos = 0, this.cz = 0, this.cslabNear = 0, this.cslabFar = 0, this.userContextMenuHandler = null, this.config = v, this.callback = this.config.callback, this.defaultcolors = this.config.defaultcolors, this.defaultcolors || (this.defaultcolors = l.elementColors.defaultColors), this.nomouse = !!this.config.nomouse, this.bgColor = 0, this.config.backgroundColor = this.config.backgroundColor || "#ffffff", typeof this.config.backgroundColor < "u" && (this.bgColor = l.CC.color(this.config.backgroundColor).getHex()), this.config.backgroundAlpha = this.config.backgroundAlpha == null ? 1 : this.config.backgroundAlpha, this.camerax = 0, typeof this.config.camerax < "u" && (this.camerax = typeof this.config.camerax == "string" ? parseFloat(this.config.camerax) : this.config.camerax), this._viewer = this, this.container = c, this.config.hoverDuration != null && (this.hoverDuration = this.config.hoverDuration), this.config.antialias === void 0 && (this.config.antialias = !0), this.config.cartoonQuality === void 0 && (this.config.cartoonQuality = 10), this.WIDTH = this.getWidth(), this.HEIGHT = this.getHeight(), this.setupRenderer(), this.row = this.config.row == null ? 0 : this.config.row, this.col = this.config.col == null ? 0 : this.config.col, this.cols = this.config.cols, this.rows = this.config.rows, this.viewers = this.config.viewers, this.control_all = this.config.control_all, this.ASPECT = this.renderer.getAspect(this.WIDTH, this.HEIGHT), this.camera = new r.Camera(this.fov, this.ASPECT, this.NEAR, this.FAR, this.config.orthographic), this.camera.position = new a.Vector3(this.camerax, 0, this.CAMERA_Z), this.lookingAt = new a.Vector3(), this.camera.lookAt(this.lookingAt), this.raycaster = new r.Raycaster(new a.Vector3(0, 0, 0), new a.Vector3(0, 0, 0)), this.projector = new r.Projector(), this.initializeScene(), this.renderer.setClearColorHex(this.bgColor, this.config.backgroundAlpha), this.scene.fog.color = l.CC.color(this.bgColor), document.body.addEventListener("mouseup", this._handleMouseUp.bind(this)), document.body.addEventListener("touchend", this._handleMouseUp.bind(this)), this.initContainer(this.container), this.config.style && this.setViewStyle(this.config), window.addEventListener("resize", this.resize.bind(this)), typeof window.ResizeObserver < "u" && (this.divwatcher = new window.ResizeObserver(this.resize.bind(this)), this.divwatcher.observe(this.container)), typeof window.IntersectionObserver < "u") { + constructor(o, v = {}) { + if (this.nomouse = !1, this.glDOM = null, this.models = [], this.surfaces = {}, this.shapes = [], this.labels = [], this.clickables = [], this.hoverables = [], this.contextMenuEnabledObjects = [], this.current_hover = null, this.hoverDuration = 500, this.longTouchDuration = 1e3, this.viewer_frame = 0, this.viewChangeCallback = null, this.stateChangeCallback = null, this.NEAR = 1, this.FAR = 800, this.CAMERA_Z = 150, this.fov = 20, this.linkedViewers = [], this.renderer = null, this.control_all = !1, this.scene = null, this.rotationGroup = null, this.modelGroup = null, this.fogStart = 0.4, this.slabNear = -50, this.slabFar = 50, this.cq = new a.Quaternion(0, 0, 0, 1), this.dq = new a.Quaternion(0, 0, 0, 1), this.animated = 0, this.animationTimers = /* @__PURE__ */ new Set(), this.isDragging = !1, this.mouseStartX = 0, this.mouseStartY = 0, this.touchDistanceStart = 0, this.touchHold = !1, this.currentModelPos = 0, this.cz = 0, this.cslabNear = 0, this.cslabFar = 0, this.userContextMenuHandler = null, this.config = v, this.callback = this.config.callback, this.defaultcolors = this.config.defaultcolors, this.defaultcolors || (this.defaultcolors = l.elementColors.defaultColors), this.nomouse = !!this.config.nomouse, this.bgColor = 0, this.config.backgroundColor = this.config.backgroundColor || "#ffffff", typeof this.config.backgroundColor < "u" && (this.bgColor = l.CC.color(this.config.backgroundColor).getHex()), this.config.backgroundAlpha = this.config.backgroundAlpha == null ? 1 : this.config.backgroundAlpha, this.camerax = 0, typeof this.config.camerax < "u" && (this.camerax = typeof this.config.camerax == "string" ? parseFloat(this.config.camerax) : this.config.camerax), this._viewer = this, this.container = o, this.config.hoverDuration != null && (this.hoverDuration = this.config.hoverDuration), this.config.antialias === void 0 && (this.config.antialias = !0), this.config.cartoonQuality === void 0 && (this.config.cartoonQuality = 10), this.WIDTH = this.getWidth(), this.HEIGHT = this.getHeight(), this.setupRenderer(), this.row = this.config.row == null ? 0 : this.config.row, this.col = this.config.col == null ? 0 : this.config.col, this.cols = this.config.cols, this.rows = this.config.rows, this.viewers = this.config.viewers, this.control_all = this.config.control_all, this.ASPECT = this.renderer.getAspect(this.WIDTH, this.HEIGHT), this.camera = new r.Camera(this.fov, this.ASPECT, this.NEAR, this.FAR, this.config.orthographic), this.camera.position = new a.Vector3(this.camerax, 0, this.CAMERA_Z), this.lookingAt = new a.Vector3(), this.camera.lookAt(this.lookingAt), this.raycaster = new r.Raycaster(new a.Vector3(0, 0, 0), new a.Vector3(0, 0, 0)), this.projector = new r.Projector(), this.initializeScene(), this.renderer.setClearColorHex(this.bgColor, this.config.backgroundAlpha), this.scene.fog.color = l.CC.color(this.bgColor), document.body.addEventListener("mouseup", this._handleMouseUp.bind(this)), document.body.addEventListener("touchend", this._handleMouseUp.bind(this)), this.initContainer(this.container), this.config.style && this.setViewStyle(this.config), window.addEventListener("resize", this.resize.bind(this)), typeof window.ResizeObserver < "u" && (this.divwatcher = new window.ResizeObserver(this.resize.bind(this)), this.divwatcher.observe(this.container)), typeof window.IntersectionObserver < "u") { let M = (E, $) => { E.forEach((k) => { k.isIntersecting && this.resize(); @@ -21963,9 +21963,9 @@ ATOM`, x); * @param y - y position in screen coordinates * @param {Object[]} - list of objects or selection object specifying what object to check for targeting */ - targetedObjects(c, v, M) { + targetedObjects(o, v, M) { var E = { - x: c, + x: o, y: v, z: -1 }; @@ -21975,15 +21975,15 @@ ATOM`, x); * @param {object | list} - an object or list of objects with x,y,z attributes (e.g. an atom) * @return {object | list} - and object or list of {x: screenX, y: screenY} */ - modelToScreen(c) { + modelToScreen(o) { let v = !1; - Array.isArray(c) || (c = [c], v = !0); + Array.isArray(o) || (o = [o], v = !0); let M = this.renderer.getXRatio(), E = this.renderer.getYRatio(), $ = this.col, k = this.row, L = $ * (this.WIDTH / M), z = (E - k - 1) * (this.HEIGHT / E), O = [], R = this.canvasOffset(); - return c.forEach((P) => { - let U = new a.Vector3(P.x, P.y, P.z); - U.applyMatrix4(this.modelGroup.matrixWorld), this.projector.projectVector(U, this.camera); - let B = this.WIDTH / M * (U.x + 1) / 2 + R.left + L, N = -(this.HEIGHT / E) * (U.y - 1) / 2 + R.top + z; - O.push({ x: B, y: N }); + return o.forEach((N) => { + let W = new a.Vector3(N.x, N.y, N.z); + W.applyMatrix4(this.modelGroup.matrixWorld), this.projector.projectVector(W, this.camera); + let B = this.WIDTH / M * (W.x + 1) / 2 + R.left + L, P = -(this.HEIGHT / E) * (W.y - 1) / 2 + R.top + z; + O.push({ x: B, y: P }); }), v && (O = O[0]), O; } /** @@ -21992,8 +21992,8 @@ ATOM`, x); * @param{y} y displacement in screen corodinates * @param{modelz} z coordinate in model coordinates to compute offset for, default is model axis */ - screenOffsetToModel(c, v, M) { - var E = c / this.WIDTH, $ = v / this.HEIGHT, k = M === void 0 ? this.rotationGroup.position.z : M, L = this.rotationGroup.quaternion, z = new a.Vector3(0, 0, k); + screenOffsetToModel(o, v, M) { + var E = o / this.WIDTH, $ = v / this.HEIGHT, k = M === void 0 ? this.rotationGroup.position.z : M, L = this.rotationGroup.quaternion, z = new a.Vector3(0, 0, k); return this.projector.projectVector(z, this.camera), z.x += E * 2, z.y -= $ * 2, this.projector.unprojectVector(z, this.camera), z.z = 0, z.applyQuaternion(L), z; } /** @@ -22002,27 +22002,27 @@ ATOM`, x); * @param{screen} xy screen coordinate * @param{model} xyz model coordinate */ - screenToModelDistance(c, v) { + screenToModelDistance(o, v) { let M = this.canvasOffset(), E = new a.Vector3(v.x, v.y, v.z); E.applyMatrix4(this.modelGroup.matrixWorld); let $ = E.clone(); this.projector.projectVector(E, this.camera); - let k = new a.Vector3((c.x - M.left) * 2 / this.WIDTH - 1, (c.y - M.top) * 2 / -this.HEIGHT + 1, E.z); + let k = new a.Vector3((o.x - M.left) * 2 / this.WIDTH - 1, (o.y - M.top) * 2 / -this.HEIGHT + 1, E.z); return this.projector.unprojectVector(k, this.camera), k.distanceTo($); } /** * Set a callback to call when the view has potentially changed. * */ - setViewChangeCallback(c) { - (typeof c == "function" || c == null) && (this.viewChangeCallback = c); + setViewChangeCallback(o) { + (typeof o == "function" || o == null) && (this.viewChangeCallback = o); } /** * Set a callback to call when the view has potentially changed. * */ - setStateChangeCallback(c) { - (typeof c == "function" || c == null) && (this.stateChangeCallback = c); + setStateChangeCallback(o) { + (typeof o == "function" || o == null) && (this.stateChangeCallback = o); } /** * Return configuration of viewer @@ -22034,8 +22034,8 @@ ATOM`, x); * Set the configuration object. Note that some settings may only * have an effect at viewer creation time. */ - setConfig(c) { - this.config = c, c.ambientOcclusion && this.renderer.enableAmbientOcclusion(c.ambientOcclusion); + setConfig(o) { + this.config = o, o.ambientOcclusion && this.renderer.enableAmbientOcclusion(o.ambientOcclusion); } /** * Return object representing internal state of @@ -22043,21 +22043,21 @@ ATOM`, x); * */ getInternalState() { - var c = { models: [], surfaces: [], shapes: [], labels: [] }; + var o = { models: [], surfaces: [], shapes: [], labels: [] }; for (let v = 0; v < this.models.length; v++) - this.models[v] && (c.models[v] = this.models[v].getInternalState()); - return c; + this.models[v] && (o.models[v] = this.models[v].getInternalState()); + return o; } /** * Overwrite internal state of the viewer with passed object * which should come from getInternalState. * */ - setInternalState(c) { + setInternalState(o) { this.clear(); - var v = c.models; + var v = o.models; for (let M = 0; M < v.length; M++) - v[M] && (this.models[M] = new u.GLModel(M), this.models[M].setInternalState(v[M])); + v[M] && (this.models[M] = new d.GLModel(M), this.models[M].setInternalState(v[M])); this.render(); } /** @@ -22075,8 +22075,8 @@ ATOM`, x); viewer.render(); }); */ - setZoomLimits(c, v) { - typeof c < "u" && (this.config.lowerZoomLimit = c), v && (this.config.upperZoomLimit = v), this.rotationGroup.position.z = this.adjustZoomToLimits(this.rotationGroup.position.z), this.show(); + setZoomLimits(o, v) { + typeof o < "u" && (this.config.lowerZoomLimit = o), v && (this.config.upperZoomLimit = v), this.rotationGroup.position.z = this.adjustZoomToLimits(this.rotationGroup.position.z), this.show(); } /** * Set camera parameters (distance to the origin and field of view) @@ -22094,44 +22094,44 @@ ATOM`, x); viewer.render(); }); */ - setCameraParameters(c) { - c.fov !== void 0 && (this.fov = c.fov, this.camera.fov = this.fov), c.z !== void 0 && (this.CAMERA_Z = c.z, this.camera.z = this.CAMERA_Z), c.orthographic !== void 0 && (this.camera.ortho = c.orthographic); + setCameraParameters(o) { + o.fov !== void 0 && (this.fov = o.fov, this.camera.fov = this.fov), o.z !== void 0 && (this.CAMERA_Z = o.z, this.camera.z = this.CAMERA_Z), o.orthographic !== void 0 && (this.camera.ortho = o.orthographic); } - _handleMouseDown(c) { - if (c.preventDefault(), !this.scene) + _handleMouseDown(o) { + if (o.preventDefault(), !this.scene) return; - var v = this.getX(c), M = this.getY(c); + var v = this.getX(o), M = this.getY(o); if (v === void 0) return; - this.isDragging = !0, this.mouseButton = c.which, this.mouseStartX = v, this.mouseStartY = M, this.touchHold = !0, this.touchDistanceStart = 0, c.targetTouches && c.targetTouches.length == 2 && (this.touchDistanceStart = this.calcTouchDistance(c)), this.cq = this.rotationGroup.quaternion.clone(), this.cz = this.rotationGroup.position.z, this.currentModelPos = this.modelGroup.position.clone(), this.cslabNear = this.slabNear, this.cslabFar = this.slabFar; + this.isDragging = !0, this.mouseButton = o.which, this.mouseStartX = v, this.mouseStartY = M, this.touchHold = !0, this.touchDistanceStart = 0, o.targetTouches && o.targetTouches.length == 2 && (this.touchDistanceStart = this.calcTouchDistance(o)), this.cq = this.rotationGroup.quaternion.clone(), this.cz = this.rotationGroup.position.z, this.currentModelPos = this.modelGroup.position.clone(), this.cslabNear = this.slabNear, this.cslabFar = this.slabFar; let E = this; - c.targetTouches && c.targetTouches.length === 1 && (this.longTouchTimeout = setTimeout(function() { + o.targetTouches && o.targetTouches.length === 1 && (this.longTouchTimeout = setTimeout(function() { if (E.touchHold == !0) { E.glDOM = E.renderer.domElement; - const $ = c.targetTouches[0], k = new PointerEvent("contextmenu", Object.assign(Object.assign({}, c), { pageX: $.pageX, pageY: $.pageY, screenX: $.screenX, screenY: $.screenY, clientX: $.clientX, clientY: $.clientY })); + const $ = o.targetTouches[0], k = new PointerEvent("contextmenu", Object.assign(Object.assign({}, o), { pageX: $.pageX, pageY: $.pageY, screenX: $.screenX, screenY: $.screenY, clientX: $.clientX, clientY: $.clientY })); E.glDOM.dispatchEvent(k); } }, this.longTouchDuration)); } - _handleMouseUp(c) { + _handleMouseUp(o) { if (this.touchHold = !1, this.isDragging && this.scene) { - var v = this.getX(c), M = this.getY(c); - if (this.closeEnoughForClick(c) && this.isInViewer(v, M)) { + var v = this.getX(o), M = this.getY(o); + if (this.closeEnoughForClick(o) && this.isInViewer(v, M)) { let E = this.mouseXY(v, M); - this.handleClickSelection(E.x, E.y, c); + this.handleClickSelection(E.x, E.y, o); } } this.isDragging = !1; } - _handleMouseScroll(c) { - if (c.preventDefault(), !!this.scene) { - var v = this.getX(c), M = this.getY(c); + _handleMouseScroll(o) { + if (o.preventDefault(), !!this.scene) { + var v = this.getX(o), M = this.getY(o); if (v !== void 0 && !(!this.control_all && !this.isInViewer(v, M))) { var E = (this.CAMERA_Z - this.rotationGroup.position.z) * 0.85, $ = 1; - if (c.ctrlKey && ($ = -1), c.detail) - this.rotationGroup.position.z += $ * E * c.detail / 10; - else if (c.wheelDelta) { - let k = c.wheelDelta * 600 / (c.wheelDelta + 600); + if (o.ctrlKey && ($ = -1), o.detail) + this.rotationGroup.position.z += $ * E * o.detail / 10; + else if (o.wheelDelta) { + let k = o.wheelDelta * 600 / (o.wheelDelta + 600); this.rotationGroup.position.z -= $ * E * k / 400; } this.rotationGroup.position.z = this.adjustZoomToLimits(this.rotationGroup.position.z), this.show(); @@ -22149,25 +22149,25 @@ ATOM`, x); viewer contents (base64 encoded) for nframes of viewer changes. * @return {Promise} */ - apngURI(c) { + apngURI(o) { let v = this; - return c = c || 1, new Promise(function(M) { + return o = o || 1, new Promise(function(M) { let E = 0, $ = v.viewChangeCallback, k = [], L = [], z = Date.now(); v.viewChangeCallback = function() { L.push(Date.now() - z), z = Date.now(), k.push(new Promise((O) => { v.getCanvas().toBlob(function(R) { R.arrayBuffer().then(O); }, "image/png"); - })), E += 1, E == c && (v.viewChangeCallback = $, Promise.all(k).then((O) => { + })), E += 1, E == o && (v.viewChangeCallback = $, Promise.all(k).then((O) => { let R = []; for (let H = 0; H < O.length; H++) { - let W = (0, A.decode)(O[H]); - R.push((0, A.toRGBA8)(W)[0]); + let U = (0, A.decode)(O[H]); + R.push((0, A.toRGBA8)(U)[0]); } - let P = v.getCanvas().width, U = v.getCanvas().height, B = (0, A.encode)(R, P, U, 0, L), N = new Blob([B], { type: "image/png" }), G = new FileReader(); + let N = v.getCanvas().width, W = v.getCanvas().height, B = (0, A.encode)(R, N, W, 0, L), P = new Blob([B], { type: "image/png" }), G = new FileReader(); G.onload = function(H) { M(H.target.result); - }, G.readAsDataURL(N); + }, G.readAsDataURL(P); })); }; }); @@ -22192,54 +22192,54 @@ ATOM`, x); * the duration of the hover delay (in milliseconds) before the hover action is called * */ - setHoverDuration(c) { - this.hoverDuration = c; + setHoverDuration(o) { + this.hoverDuration = o; } - mouseXY(c, v) { - let M = this.canvasOffset(), E = this.renderer.getXRatio(), $ = this.renderer.getYRatio(), k = this.col, L = this.row, z = k * (this.WIDTH / E), O = ($ - L - 1) * (this.HEIGHT / $), R = (c - M.left - z) / (this.WIDTH / E) * 2 - 1, P = -((v - M.top - O) / (this.HEIGHT / $)) * 2 + 1; - return { x: R, y: P }; + mouseXY(o, v) { + let M = this.canvasOffset(), E = this.renderer.getXRatio(), $ = this.renderer.getYRatio(), k = this.col, L = this.row, z = k * (this.WIDTH / E), O = ($ - L - 1) * (this.HEIGHT / $), R = (o - M.left - z) / (this.WIDTH / E) * 2 - 1, N = -((v - M.top - O) / (this.HEIGHT / $)) * 2 + 1; + return { x: R, y: N }; } - _handleMouseMove(c) { - clearTimeout(this.hoverTimeout), c.preventDefault(); - let v = this.getX(c), M = this.getY(c); + _handleMouseMove(o) { + clearTimeout(this.hoverTimeout), o.preventDefault(); + let v = this.getX(o), M = this.getY(o); if (v === void 0) return; let E = this.renderer.getXRatio(), $ = this.renderer.getYRatio(), k = this.mouseXY(v, M), L = this; this.current_hover !== null && this.handleHoverContinue(k.x, k.y); var z = 0; if (!(!this.control_all && !this.isInViewer(v, M)) && this.scene && (this.hoverables.length > 0 && (this.hoverTimeout = setTimeout(function() { - L.handleHoverSelection(k.x, k.y, c); + L.handleHoverSelection(k.x, k.y, o); }, this.hoverDuration)), !!this.isDragging)) { - c.targetTouches && (c.targetTouches.length > 1 || c.targetTouches.length === 1 && !this.closeEnoughForClick(c)) && clearTimeout(this.longTouchTimeout); + o.targetTouches && (o.targetTouches.length > 1 || o.targetTouches.length === 1 && !this.closeEnoughForClick(o)) && clearTimeout(this.longTouchTimeout); var O = (v - this.mouseStartX) / this.WIDTH, R = (M - this.mouseStartY) / this.HEIGHT; - if (this.touchDistanceStart != 0 && c.targetTouches && c.targetTouches.length == 2) { - var P = this.calcTouchDistance(c); - z = 2, R = (P - this.touchDistanceStart) * 2 / (this.WIDTH + this.HEIGHT); - } else c.targetTouches && c.targetTouches.length == 3 && (z = 1); + if (this.touchDistanceStart != 0 && o.targetTouches && o.targetTouches.length == 2) { + var N = this.calcTouchDistance(o); + z = 2, R = (N - this.touchDistanceStart) * 2 / (this.WIDTH + this.HEIGHT); + } else o.targetTouches && o.targetTouches.length == 3 && (z = 1); O *= E, R *= $; - var U = Math.hypot(O, R), B; - if (z == 3 || this.mouseButton == 3 && c.ctrlKey) + var W = Math.hypot(O, R), B; + if (z == 3 || this.mouseButton == 3 && o.ctrlKey) this.slabNear = this.cslabNear + O * 100, this.slabFar = this.cslabFar - R * 100; - else if (z == 2 || this.mouseButton == 3 || c.shiftKey) + else if (z == 2 || this.mouseButton == 3 || o.shiftKey) B = (this.CAMERA_Z - this.rotationGroup.position.z) * 0.85, B < 80 && (B = 80), this.rotationGroup.position.z = this.cz + R * B, this.rotationGroup.position.z = this.adjustZoomToLimits(this.rotationGroup.position.z); - else if (z == 1 || this.mouseButton == 2 || c.ctrlKey) { - var N = this.screenOffsetToModel(E * (v - this.mouseStartX), $ * (M - this.mouseStartY)); - this.modelGroup.position.addVectors(this.currentModelPos, N); - } else if ((z === 0 || this.mouseButton == 1) && U !== 0) { - var G = Math.sin(U * Math.PI) / U; - this.dq.x = Math.cos(U * Math.PI), this.dq.y = 0, this.dq.z = G * O, this.dq.w = -G * R, this.rotationGroup.quaternion.set(1, 0, 0, 0), this.rotationGroup.quaternion.multiply(this.dq), this.rotationGroup.quaternion.multiply(this.cq); + else if (z == 1 || this.mouseButton == 2 || o.ctrlKey) { + var P = this.screenOffsetToModel(E * (v - this.mouseStartX), $ * (M - this.mouseStartY)); + this.modelGroup.position.addVectors(this.currentModelPos, P); + } else if ((z === 0 || this.mouseButton == 1) && W !== 0) { + var G = Math.sin(W * Math.PI) / W; + this.dq.x = Math.cos(W * Math.PI), this.dq.y = 0, this.dq.z = G * O, this.dq.w = -G * R, this.rotationGroup.quaternion.set(1, 0, 0, 0), this.rotationGroup.quaternion.multiply(this.dq), this.rotationGroup.quaternion.multiply(this.cq); } this.show(); } } - _handleContextMenu(c) { - if (c.preventDefault(), this.closeEnoughForClick(c)) { + _handleContextMenu(o) { + if (o.preventDefault(), this.closeEnoughForClick(o)) { var E = this.mouseStartX, $ = this.mouseStartY, M = this.canvasOffset(); let k = this.mouseXY(E, $), L = k.x, z = k.y, O = this.targetedObjects(L, z, this.contextMenuEnabledObjects); var v = null; O.length && (v = O[0].clickable); var M = this.canvasOffset(), E = this.mouseStartX - M.left, $ = this.mouseStartY - M.top; - this.userContextMenuHandler && (this.userContextMenuHandler(v, E, $, O, c), this.isDragging = !1); + this.userContextMenuHandler && (this.userContextMenuHandler(v, E, $, O, o), this.isDragging = !1); } } /** @@ -22250,8 +22250,8 @@ ATOM`, x); * Either HTML element or string identifier. Defaults to the element used to initialize the viewer. */ - setContainer(c) { - let v = (0, d.getElement)(c) || this.container; + setContainer(o) { + let v = (0, h.getElement)(o) || this.container; return this.initContainer(v), this; } /** @@ -22269,9 +22269,9 @@ ATOM`, x); * */ - setBackgroundColor(c, v) { + setBackgroundColor(o, v) { (typeof v > "u" || v < 0 || v > 1) && (v = 1); - var M = l.CC.color(c); + var M = l.CC.color(o); return this.scene.fog.color = M, this.bgColor = M.getHex(), this.renderer.setClearColorHex(M.getHex(), v), this.show(), this; } /** @@ -22294,8 +22294,8 @@ ATOM`, x); }); * */ - setProjection(c) { - this.camera.ortho = c === "orthographic", this.setSlabAndFog(); + setProjection(o) { + this.camera.ortho = o === "orthographic", this.setSlabAndFog(); } /** * Set global view styles. @@ -22312,10 +22312,10 @@ ATOM`, x); }); * */ - setViewStyle(c) { - if (c = c || {}, c.style = c.style || "", c.style.includes("outline") ? this.renderer.enableOutline(c) : this.renderer.disableOutline(), c.style.includes("ambientOcclusion")) { + setViewStyle(o) { + if (o = o || {}, o.style = o.style || "", o.style.includes("outline") ? this.renderer.enableOutline(o) : this.renderer.disableOutline(), o.style.includes("ambientOcclusion")) { var v = {}; - c.strength && (v.strength = c.strength), c.radius && (v.radius = c.radius), this.renderer.enableAmbientOcclusion(v); + o.strength && (v.strength = o.strength), o.radius && (v.radius = o.radius), this.renderer.enableAmbientOcclusion(v); } else this.renderer.disableAmbientOcclusion(); return this; @@ -22328,16 +22328,16 @@ ATOM`, x); * * @param {number} w Width in pixels */ - setWidth(c) { - return this.WIDTH = c || this.WIDTH, this.updateSize(), this; + setWidth(o) { + return this.WIDTH = o || this.WIDTH, this.updateSize(), this; } /** * Set viewer height independently of the HTML container. This is probably not what you want. * * @param {number} h Height in pixels */ - setHeight(c) { - return this.HEIGHT = c || this.HEIGHT, this.updateSize(), this; + setHeight(o) { + return this.HEIGHT = o || this.HEIGHT, this.updateSize(), this; } /** * Resize viewer according to containing HTML element's dimensions @@ -22345,12 +22345,12 @@ ATOM`, x); */ resize() { this.WIDTH = this.getWidth(), this.HEIGHT = this.getHeight(); - let c = !1; + let o = !1; if (this.renderer.isLost() && this.WIDTH > 0 && this.HEIGHT > 0) { let v = !1, M = this.container.querySelector("canvas"); - M && M != this.renderer.getCanvas() ? this.config.canvas = M : (M.remove(), this.config && this.config.canvas != null && (delete this.config.canvas, v = !0)), this.setupRenderer(), this.initContainer(this.container), this.renderer.setClearColorHex(this.bgColor, this.config.backgroundAlpha), c = !0, v && (this.config.canvas = this.renderer.getCanvas()); + M && M != this.renderer.getCanvas() ? this.config.canvas = M : (M.remove(), this.config && this.config.canvas != null && (delete this.config.canvas, v = !0)), this.setupRenderer(), this.initContainer(this.container), this.renderer.setClearColorHex(this.bgColor, this.config.backgroundAlpha), o = !0, v && (this.config.canvas = this.renderer.getCanvas()); } - if (this.WIDTH == 0 || this.HEIGHT == 0 ? this.animated && this._viewer.pauseAnimate() : this.animated && this._viewer.resumeAnimate(), this.updateSize(), c) { + if (this.WIDTH == 0 || this.HEIGHT == 0 ? this.animated && this._viewer.pauseAnimate() : this.animated && this._viewer.resumeAnimate(), this.updateSize(), o) { let v = this.renderer.supportedExtensions(); if (v.regen = !0, this.viewers) for (let M = 0, E = this.viewers.length; M < E; M++) @@ -22380,8 +22380,8 @@ ATOM`, x); }) }); */ - getModel(c) { - return c === void 0 ? this.models.length == 0 ? null : this.models[this.models.length - 1] : c instanceof u.GLModel ? c : c in this.models ? this.models[c] : this.models.length == 0 ? null : this.models[this.models.length - 1]; + getModel(o) { + return o === void 0 ? this.models.length == 0 ? null : this.models[this.models.length - 1] : o instanceof d.GLModel ? o : o in this.models ? this.models[o] : this.models.length == 0 ? null : this.models[this.models.length - 1]; } /** * Continuously rotate a scene around the specified axis. @@ -22396,16 +22396,16 @@ ATOM`, x); * value reverses the direction of the spin. * */ - spin(c, v = 1) { - if (clearInterval(this.spinInterval), typeof c > "u" && (c = "y"), typeof c == "boolean") - if (c) - c = "y"; + spin(o, v = 1) { + if (clearInterval(this.spinInterval), typeof o > "u" && (o = "y"), typeof o == "boolean") + if (o) + o = "y"; else return; - Array.isArray(c) && (c = { x: c[0], y: c[1], z: c[2] }); + Array.isArray(o) && (o = { x: o[0], y: o[1], z: o[2] }); var M = this; this.spinInterval = setInterval(function() { - !M.getCanvas().isConnected && M.renderer.isLost() && clearInterval(M.spinInterval), M.rotate(1 * v, c); + !M.getCanvas().isConnected && M.renderer.isLost() && clearInterval(M.spinInterval), M.rotate(1 * v, o); }, 25); } //animate motion between current position and passed position @@ -22416,8 +22416,8 @@ ATOM`, x); //and rotationgroup quaternion //return array includes final position, but not current //the returned array includes an animate method - animateMotion(c, v, M, E, $, k) { - var L = 20, z = Math.ceil(c / L); + animateMotion(o, v, M, E, $, k) { + var L = 20, z = Math.ceil(o / L); z < 1 && (z = 1), this.incAnim(); var O = { mpos: this.modelGroup.position.clone(), @@ -22426,26 +22426,26 @@ ATOM`, x); cam: this.lookingAt.clone() }; if (v) { - let U = new Array(z); + let W = new Array(z); for (let H = 0; H < z; H++) { - let W = (H + 1) / z, V = { mpos: O.mpos, rz: O.rz, rot: O.rot }; - V.mpos = M.clone().sub(O.mpos).multiplyScalar(W).add(O.mpos), V.rz = O.rz + W * (E - O.rz), V.rot = s.slerp(O.rot, $, W), V.cam = k.clone().sub(O.cam).multiplyScalar(W).add(O.cam), U[H] = V; + let U = (H + 1) / z, j = { mpos: O.mpos, rz: O.rz, rot: O.rot }; + j.mpos = M.clone().sub(O.mpos).multiplyScalar(U).add(O.mpos), j.rz = O.rz + U * (E - O.rz), j.rot = s.slerp(O.rot, $, U), j.cam = k.clone().sub(O.cam).multiplyScalar(U).add(O.cam), W[H] = j; } - let B = 0, N = this, G = function() { - var H = U[B]; - B += 1, N.modelGroup.position = H.mpos, N.rotationGroup.position.z = H.rz, N.rotationGroup.quaternion = H.rot, N.camera.lookAt(H.cam), B < U.length ? setTimeout(G, L) : N.decAnim(), N.show(); + let B = 0, P = this, G = function() { + var H = W[B]; + B += 1, P.modelGroup.position = H.mpos, P.rotationGroup.position.z = H.rz, P.rotationGroup.quaternion = H.rot, P.camera.lookAt(H.cam), B < W.length ? setTimeout(G, L) : P.decAnim(), P.show(); }; setTimeout(G, L); } else { var R = {}; - let U = 1 / z; - if (M && (R.mpos = M.clone().sub(O.mpos).multiplyScalar(U)), typeof E < "u" && E != null && (R.rz = U * (E - O.rz)), $) { - var P = s.slerp(O.rot, $, U); - R.rot = O.rot.clone().inverse().multiply(P); + let W = 1 / z; + if (M && (R.mpos = M.clone().sub(O.mpos).multiplyScalar(W)), typeof E < "u" && E != null && (R.rz = W * (E - O.rz)), $) { + var N = s.slerp(O.rot, $, W); + R.rot = O.rot.clone().inverse().multiply(N); } - k && (R.cam = k.clone().sub(O.cam).multiplyScalar(U)); - let B = 0, N = this, G = function() { - B += 1, R.mpos && N.modelGroup.position.add(R.mpos), R.rz && (N.rotationGroup.position.z += R.rz), R.rot && N.rotationGroup.quaternion.multiply(R.rot), R.cam && (N.lookingAt.add(R.cam), N.camera.lookAt(N.lookingAt)), B < z ? setTimeout(G, L) : N.decAnim(), N.show(); + k && (R.cam = k.clone().sub(O.cam).multiplyScalar(W)); + let B = 0, P = this, G = function() { + B += 1, R.mpos && P.modelGroup.position.add(R.mpos), R.rz && (P.rotationGroup.position.z += R.rz), R.rot && P.rotationGroup.quaternion.multiply(R.rot), R.cam && (P.lookingAt.add(R.cam), P.camera.lookAt(P.lookingAt)), B < z ? setTimeout(G, L) : P.decAnim(), P.show(); }; setTimeout(G, L); } @@ -22473,15 +22473,15 @@ ATOM`, x); * */ - rotate(c, v = "y", M = 0, E = !1) { + rotate(o, v = "y", M = 0, E = !1) { if (v == "x" ? v = { x: 1, y: 0, z: 0 } : v == "y" ? v = { x: 0, y: 1, z: 0 } : v == "z" && (v = { x: 0, y: 0, z: 1 }), v == "vx" ? v = { vx: 1, vy: 0, vz: 0 } : v == "vy" ? v = { vx: 0, vy: 1, vz: 0 } : v == "vz" && (v = { vx: 0, vy: 0, vz: 1 }), typeof v.vx < "u") { var $ = new a.Vector3(v.vx, v.vy, v.vz); $.applyQuaternion(this.rotationGroup.quaternion), v = { x: $.x, y: $.y, z: $.z }; } var k = function(R) { - var P = Math.sin(R / 2), U = Math.cos(R / 2), B = 0, N = 0, G = 0; - return B = v.x * P, N = v.y * P, G = v.z * P, new a.Quaternion(B, N, G, U).normalize(); - }, L = Math.PI * c / 180, z = k(L); + var N = Math.sin(R / 2), W = Math.cos(R / 2), B = 0, P = 0, G = 0; + return B = v.x * N, P = v.y * N, G = v.z * N, new a.Quaternion(B, P, G, W).normalize(); + }, L = Math.PI * o / 180, z = k(L); if (M) { var O = new a.Quaternion().copy(this.rotationGroup.quaternion).multiply(z); this.animateMotion(M, E, this.modelGroup.position, this.rotationGroup.position.z, O, this.lookingAt); @@ -22490,8 +22490,8 @@ ATOM`, x); return this; } surfacesFinished() { - for (var c in this.surfaces) - if (!this.surfaces[c][0].done) + for (var o in this.surfaces) + if (!this.surfaces[o][0].done) return !1; return !0; } @@ -22502,11 +22502,11 @@ ATOM`, x); getView() { if (!this.modelGroup) return [0, 0, 0, 0, 0, 0, 0, 1]; - var c = this.modelGroup.position, v = this.rotationGroup.quaternion; + var o = this.modelGroup.position, v = this.rotationGroup.quaternion; return [ - c.x, - c.y, - c.z, + o.x, + o.y, + o.z, this.rotationGroup.position.z, v.x, v.y, @@ -22517,8 +22517,8 @@ ATOM`, x); /** Sets the view to the specified translation, zoom, and rotation. * * @param {Array.} arg Array formatted identically to the return value of getView */ - setView(c, v) { - return c === void 0 || !(c instanceof Array || c.length !== 8) ? this : !this.modelGroup || !this.rotationGroup ? this : (this.modelGroup.position.x = c[0], this.modelGroup.position.y = c[1], this.modelGroup.position.z = c[2], this.rotationGroup.position.z = c[3], this.rotationGroup.quaternion.x = c[4], this.rotationGroup.quaternion.y = c[5], this.rotationGroup.quaternion.z = c[6], this.rotationGroup.quaternion.w = c[7], typeof c[8] < "u" && (this.rotationGroup.position.x = c[8], this.rotationGroup.position.y = c[9]), this.show(v), this); + setView(o, v) { + return o === void 0 || !(o instanceof Array || o.length !== 8) ? this : !this.modelGroup || !this.rotationGroup ? this : (this.modelGroup.position.x = o[0], this.modelGroup.position.y = o[1], this.modelGroup.position.z = o[2], this.rotationGroup.position.z = o[3], this.rotationGroup.quaternion.x = o[4], this.rotationGroup.quaternion.y = o[5], this.rotationGroup.quaternion.z = o[6], this.rotationGroup.quaternion.w = o[7], typeof o[8] < "u" && (this.rotationGroup.position.x = o[8], this.rotationGroup.position.y = o[9]), this.show(v), this); } // apply styles, models, etc in viewer /** @@ -22526,7 +22526,7 @@ ATOM`, x); * adding/removing models, applying styles, etc. * */ - render(c, v) { + render(o, v) { this.renderer.setViewport(), this.updateClickables(); var M = this.getView(); this.stateChangeCallback && this.stateChangeCallback(this.getInternalState()); @@ -22549,8 +22549,8 @@ ATOM`, x); if (k[$].mat instanceof r.LineBasicMaterial ? z = new r.Line(L, k[$].mat) : z = new r.Mesh(L, k[$].mat), k[$].mat.transparent && k[$].mat.opacity == 0 ? z.visible = !1 : z.visible = !0, k[$].symmetries.length > 1 || k[$].symmetries.length == 1 && !k[$].symmetries[$].isIdentity()) { var O, R = new r.Object3D(); for (O = 0; O < k[$].symmetries.length; O++) { - var P = z.clone(); - P.matrix = k[$].symmetries[O], P.matrixAutoUpdate = !1, R.add(P); + var N = z.clone(); + N.matrix = k[$].symmetries[O], N.matrixAutoUpdate = !1, R.add(N); } k[$].lastGL = R, this.modelGroup.add(R); } else @@ -22558,18 +22558,18 @@ ATOM`, x); } } } - return this.setView(M), typeof c == "function" && c(this), this; + return this.setView(M), typeof o == "function" && o(this), this; } /* @param {AtomSelectionSpec|any} sel * @return list of models specified by sel */ - getModelList(c) { + getModelList(o) { let v = []; - if (typeof c > "u" || typeof c.model > "u") + if (typeof o > "u" || typeof o.model > "u") for (let E = 0; E < this.models.length; E++) this.models[E] && v.push(this.models[E]); else { - let E = c.model; + let E = o.model; Array.isArray(E) || (E = [E]); for (let $ = 0; $ < E.length; $++) if (typeof E[$] == "number") { @@ -22586,12 +22586,12 @@ ATOM`, x); * sel * @return {AtomSpec[]} */ - getAtomsFromSel(c) { + getAtomsFromSel(o) { var v = []; - typeof c > "u" && (c = {}); - var M = this.getModelList(c); + typeof o > "u" && (o = {}); + var M = this.getModelList(o); for (let E = 0; E < M.length; E++) - v = v.concat(M[E].selectedAtoms(c)); + v = v.concat(M[E].selectedAtoms(o)); return v; } /** @@ -22602,10 +22602,10 @@ ATOM`, x); * sel * @return {boolean} */ - atomIsSelected(c, v) { + atomIsSelected(o, v) { typeof v > "u" && (v = {}); for (var M = this.getModelList(v), E = 0; E < M.length; E++) - if (M[E].atomIsSelected(c, v)) + if (M[E].atomIsSelected(o, v)) return !0; return !1; } @@ -22614,8 +22614,8 @@ ATOM`, x); * @param {AtomSelectionSpec} sel * @return {AtomSpec[]} */ - selectedAtoms(c) { - return this.getAtomsFromSel(c); + selectedAtoms(o) { + return this.getAtomsFromSel(o); } /** * Returns valid values for the specified attribute in the given selection @@ -22624,12 +22624,12 @@ ATOM`, x); * @return {Array.} * */ - getUniqueValues(c, v) { + getUniqueValues(o, v) { typeof v > "u" && (v = {}); var M = this.getAtomsFromSel(v), E = {}; for (var $ in M) - if (M[$].hasOwnProperty(c)) { - var k = M[$][c]; + if (M[$].hasOwnProperty(o)) { + var k = M[$][o]; E[k] = !0; } return Object.keys(E); @@ -22640,8 +22640,8 @@ ATOM`, x); * @param {AtomSelectionSpec} sel - Selection specification specifying model and atom properties to select. Default: all atoms in viewer * @return {string} PDB string of selected atoms */ - pdbData(c) { - for (var v = this.getAtomsFromSel(c), M = "", E = 0, $ = v.length; E < $; ++E) + pdbData(o) { + for (var v = this.getAtomsFromSel(o), M = "", E = 0, $ = v.length; E < $; ++E) M += v[E].pdbline + ` `; return M; @@ -22667,8 +22667,8 @@ ATOM`, x); }); */ - zoom(c = 2, v = 0, M = !1) { - var E = (this.CAMERA_Z - this.rotationGroup.position.z) / c, $ = this.CAMERA_Z - E; + zoom(o = 2, v = 0, M = !1) { + var E = (this.CAMERA_Z - this.rotationGroup.position.z) / o, $ = this.CAMERA_Z - E; return v > 0 ? this.animateMotion(v, M, this.modelGroup.position, this.adjustZoomToLimits($), this.rotationGroup.quaternion, this.lookingAt) : (this.rotationGroup.position.z = this.adjustZoomToLimits($), this.show()), this; } /** @@ -22691,8 +22691,8 @@ ATOM`, x); viewer.render(callback); }); */ - translate(c, v, M = 0, E = !1) { - var $ = c / this.WIDTH, k = v / this.HEIGHT, L = new a.Vector3(0, 0, -this.CAMERA_Z); + translate(o, v, M = 0, E = !1) { + var $ = o / this.WIDTH, k = v / this.HEIGHT, L = new a.Vector3(0, 0, -this.CAMERA_Z); this.projector.projectVector(L, this.camera), L.x -= $, L.y -= k, this.projector.unprojectVector(L, this.camera), L.z = 0; var z = this.lookingAt.clone().add(L); return M > 0 ? this.animateMotion(M, E, this.modelGroup.position, this.rotationGroup.position.z, this.rotationGroup.quaternion, z) : (this.lookingAt = z, this.camera.lookAt(this.lookingAt), this.show()), this; @@ -22718,8 +22718,8 @@ ATOM`, x); viewer.render(callback); }); */ - translateScene(c, v, M = 0, E = !1) { - var $ = this.screenOffsetToModel(c, v), k = this.modelGroup.position.clone().add($); + translateScene(o, v, M = 0, E = !1) { + var $ = this.screenOffsetToModel(o, v), k = this.modelGroup.position.clone().add($); return M > 0 ? this.animateMotion(M, E, this.modelGroup.position, this.rotationGroup.position.z, this.rotationGroup.quaternion, this.lookingAt) : (this.modelGroup.position = k, this.show()), this; } /** @@ -22729,9 +22729,9 @@ ATOM`, x); * Selection specification specifying model and atom * properties to select. Default: all atoms in viewer */ - fitSlab(c) { - c = c || {}; - var v = this.getAtomsFromSel(c), M = (0, d.getExtent)(v), E = M[1][0] - M[0][0], $ = M[1][1] - M[0][1], k = M[1][2] - M[0][2], L = Math.hypot(E, $, k); + fitSlab(o) { + o = o || {}; + var v = this.getAtomsFromSel(o), M = (0, h.getExtent)(v), E = M[1][0] - M[0][0], $ = M[1][1] - M[0][1], k = M[1][2] - M[0][2], L = Math.hypot(E, $, k); return L < 5 && (L = 5), this.slabNear = -L / 1.9, this.slabFar = L / 2, this; } /** @@ -22758,22 +22758,22 @@ ATOM`, x); viewer.render(callback); }); */ - center(c = {}, v = 0, M = !1) { - var E, $, k = this.getAtomsFromSel(c), L = (0, d.getExtent)(k); - (0, d.isEmptyObject)(c) ? (this.shapes.forEach((W) => { - if (W && W.boundingSphere && W.boundingSphere.center) { - var V = W.boundingSphere.center, re = W.boundingSphere.radius; - re > 0 ? (k.push(new a.Vector3(V.x + re, V.y, V.z)), k.push(new a.Vector3(V.x - re, V.y, V.z)), k.push(new a.Vector3(V.x, V.y + re, V.z)), k.push(new a.Vector3(V.x, V.y - re, V.z)), k.push(new a.Vector3(V.x, V.y, V.z + re)), k.push(new a.Vector3(V.x, V.y, V.z - re))) : k.push(V); + center(o = {}, v = 0, M = !1) { + var E, $, k = this.getAtomsFromSel(o), L = (0, h.getExtent)(k); + (0, h.isEmptyObject)(o) ? (this.shapes.forEach((U) => { + if (U && U.boundingSphere && U.boundingSphere.center) { + var j = U.boundingSphere.center, re = U.boundingSphere.radius; + re > 0 ? (k.push(new a.Vector3(j.x + re, j.y, j.z)), k.push(new a.Vector3(j.x - re, j.y, j.z)), k.push(new a.Vector3(j.x, j.y + re, j.z)), k.push(new a.Vector3(j.x, j.y - re, j.z)), k.push(new a.Vector3(j.x, j.y, j.z + re)), k.push(new a.Vector3(j.x, j.y, j.z - re))) : k.push(j); } - }), L = (0, d.getExtent)(k), E = k, $ = L) : (E = this.getAtomsFromSel({}), $ = (0, d.getExtent)(E)); - var z = new a.Vector3(L[2][0], L[2][1], L[2][2]), O = $[1][0] - $[0][0], R = $[1][1] - $[0][1], P = $[1][2] - $[0][2], U = Math.hypot(O, R, P); - U < 5 && (U = 5), this.slabNear = -U / 1.9, this.slabFar = U / 2, O = L[1][0] - L[0][0], R = L[1][1] - L[0][1], P = L[1][2] - L[0][2], U = Math.hypot(O, R, P), U < 5 && (U = 5); - for (var B = 25, N = 0; N < k.length; N++) - if (k[N]) { - var G = z.distanceToSquared(k[N]); + }), L = (0, h.getExtent)(k), E = k, $ = L) : (E = this.getAtomsFromSel({}), $ = (0, h.getExtent)(E)); + var z = new a.Vector3(L[2][0], L[2][1], L[2][2]), O = $[1][0] - $[0][0], R = $[1][1] - $[0][1], N = $[1][2] - $[0][2], W = Math.hypot(O, R, N); + W < 5 && (W = 5), this.slabNear = -W / 1.9, this.slabFar = W / 2, O = L[1][0] - L[0][0], R = L[1][1] - L[0][1], N = L[1][2] - L[0][2], W = Math.hypot(O, R, N), W < 5 && (W = 5); + for (var B = 25, P = 0; P < k.length; P++) + if (k[P]) { + var G = z.distanceToSquared(k[P]); G > B && (B = G); } - U = Math.sqrt(B) * 2; + W = Math.sqrt(B) * 2; var H = z.clone().multiplyScalar(-1); return v > 0 ? this.animateMotion(v, M, H, this.rotationGroup.position.z, this.rotationGroup.quaternion, this.lookingAt) : (this.modelGroup.position = H, this.show()), this; } @@ -22806,39 +22806,39 @@ ATOM`, x); }); }); */ - zoomTo(c = {}, v = 0, M = !1) { - let E = this.getAtomsFromSel(c), $ = (0, d.getExtent)(E), k = $; - if ((0, d.isEmptyObject)(c)) { - let V = E && E.length; + zoomTo(o = {}, v = 0, M = !1) { + let E = this.getAtomsFromSel(o), $ = (0, h.getExtent)(E), k = $; + if ((0, h.isEmptyObject)(o)) { + let j = E && E.length; if (this.shapes.forEach((re) => { if (re && re.boundingSphere) { if (re.boundingSphere.box) { - let ce = re.boundingSphere.box; - E.push(new a.Vector3(ce.min.x, ce.min.y, ce.min.z)), E.push(new a.Vector3(ce.max.x, ce.max.y, ce.max.z)); + let ue = re.boundingSphere.box; + E.push(new a.Vector3(ue.min.x, ue.min.y, ue.min.z)), E.push(new a.Vector3(ue.max.x, ue.max.y, ue.max.z)); } else if (re.boundingSphere.center) { - var ie = re.boundingSphere.center, ee = re.boundingSphere.radius; - ee > 0 ? (E.push(new a.Vector3(ie.x + ee, ie.y, ie.z)), E.push(new a.Vector3(ie.x - ee, ie.y, ie.z)), E.push(new a.Vector3(ie.x, ie.y + ee, ie.z)), E.push(new a.Vector3(ie.x, ie.y - ee, ie.z)), E.push(new a.Vector3(ie.x, ie.y, ie.z + ee)), E.push(new a.Vector3(ie.x, ie.y, ie.z - ee))) : E.push(ie); + var ie = re.boundingSphere.center, te = re.boundingSphere.radius; + te > 0 ? (E.push(new a.Vector3(ie.x + te, ie.y, ie.z)), E.push(new a.Vector3(ie.x - te, ie.y, ie.z)), E.push(new a.Vector3(ie.x, ie.y + te, ie.z)), E.push(new a.Vector3(ie.x, ie.y - te, ie.z)), E.push(new a.Vector3(ie.x, ie.y, ie.z + te)), E.push(new a.Vector3(ie.x, ie.y, ie.z - te))) : E.push(ie); } } - }), k = (0, d.getExtent)(E), !V) + }), k = (0, h.getExtent)(E), !j) for (let re = 0; re < 3; re++) $[2][re] = (k[0][re] + k[1][re]) / 2; } else { - let V = this.getAtomsFromSel({}); - k = (0, d.getExtent)(V); - } - var L = new a.Vector3($[2][0], $[2][1], $[2][2]), z = k[1][0] - k[0][0], O = k[1][1] - k[0][1], R = k[1][2] - k[0][2], P = Math.hypot(z, O, R); - P < 5 && (P = 5), this.slabNear = -P / 1.9, this.slabFar = P / 2, Object.keys(c).length === 0 && (this.slabNear = Math.min(-P * 2, -50), this.slabFar = Math.max(P * 2, 50)); - var U = this.config.minimumZoomToDistance || 5; - z = $[1][0] - $[0][0], O = $[1][1] - $[0][1], R = $[1][2] - $[0][2], P = Math.hypot(z, O, R), P < U && (P = U); - for (var B = U * U, N = 0; N < E.length; N++) - if (E[N]) { - var G = L.distanceToSquared(E[N]); + let j = this.getAtomsFromSel({}); + k = (0, h.getExtent)(j); + } + var L = new a.Vector3($[2][0], $[2][1], $[2][2]), z = k[1][0] - k[0][0], O = k[1][1] - k[0][1], R = k[1][2] - k[0][2], N = Math.hypot(z, O, R); + N < 5 && (N = 5), this.slabNear = -N / 1.9, this.slabFar = N / 2, Object.keys(o).length === 0 && (this.slabNear = Math.min(-N * 2, -50), this.slabFar = Math.max(N * 2, 50)); + var W = this.config.minimumZoomToDistance || 5; + z = $[1][0] - $[0][0], O = $[1][1] - $[0][1], R = $[1][2] - $[0][2], N = Math.hypot(z, O, R), N < W && (N = W); + for (var B = W * W, P = 0; P < E.length; P++) + if (E[P]) { + var G = L.distanceToSquared(E[P]); G > B && (B = G); } - P = Math.sqrt(B) * 2; - var H = L.clone().multiplyScalar(-1), W = -(P * 0.5 / Math.tan(Math.PI / 180 * this.camera.fov / 2) - this.CAMERA_Z); - return W = this.adjustZoomToLimits(W), v > 0 ? this.animateMotion(v, M, H, W, this.rotationGroup.quaternion, this.lookingAt) : (this.modelGroup.position = H, this.rotationGroup.position.z = W, this.show()), this; + N = Math.sqrt(B) * 2; + var H = L.clone().multiplyScalar(-1), U = -(N * 0.5 / Math.tan(Math.PI / 180 * this.camera.fov / 2) - this.CAMERA_Z); + return U = this.adjustZoomToLimits(U), v > 0 ? this.animateMotion(v, M, H, U, this.rotationGroup.quaternion, this.lookingAt) : (this.modelGroup.position = H, this.rotationGroup.position.z = U, this.show()), this; } /** * Set slab of view (contents outside of slab are clipped). @@ -22847,8 +22847,8 @@ ATOM`, x); * @param {number} near near clipping plane distance * @param {number} far far clipping plane distance */ - setSlab(c, v) { - this.slabNear = c, this.slabFar = v; + setSlab(o, v) { + this.slabNear = o, this.slabFar = v; } /** * Get slab of view (contents outside of slab are clipped). @@ -22898,12 +22898,12 @@ ATOM`, x); }); */ - addLabel(c, v = {}, M, E = !1) { + addLabel(o, v = {}, M, E = !1) { if (M) { - var $ = (0, d.getExtent)(this.getAtomsFromSel(M)); + var $ = (0, h.getExtent)(this.getAtomsFromSel(M)); v.position = { x: $[2][0], y: $[2][1], z: $[2][2] }; } - var k = new p.Label(c, v); + var k = new _.Label(o, v); return k.setContext(), this.modelGroup.add(k.sprite), this.labels.push(k), E || this.show(), k; } /** Add residue labels. This will generate one label per a @@ -22923,9 +22923,9 @@ ATOM`, x); viewer.render(); }); */ - addResLabels(c, v, M = !1) { + addResLabels(o, v, M = !1) { let E = this.labels.length; - return this.applyToModels("addResLabels", c, this, v, M), this.show(), this.labels.slice(E); + return this.applyToModels("addResLabels", o, this, v, M), this.show(), this.labels.slice(E); } /** Add property labels. This will generate one label per a selected * atom at the atom's coordinates with the property value as the label text. @@ -22942,8 +22942,8 @@ ATOM`, x); viewer.render(); }); */ - addPropertyLabels(c, v, M) { - return this.applyToModels("addPropertyLabels", c, v, this, M), this.show(), this; + addPropertyLabels(o, v, M) { + return this.applyToModels("addPropertyLabels", o, v, this, M), this.show(), this; } /** * Remove label from viewer @@ -22963,10 +22963,10 @@ ATOM`, x); }); */ - removeLabel(c) { + removeLabel(o) { for (var v = 0; v < this.labels.length; v++) - if (this.labels[v] == c) { - this.labels.splice(v, 1), c.dispose(), this.modelGroup.remove(c.sprite); + if (this.labels[v] == o) { + this.labels.splice(v, 1), o.dispose(), this.modelGroup.remove(o.sprite); break; } return this.show(), this; @@ -22986,8 +22986,8 @@ ATOM`, x); }); */ removeAllLabels() { - for (var c = 0; c < this.labels.length; c++) - this.labels[c] && this.labels[c].sprite && this.modelGroup.remove(this.labels[c].sprite); + for (var o = 0; o < this.labels.length; o++) + this.labels[o] && this.labels[o].sprite && this.modelGroup.remove(this.labels[o].sprite); return this.labels.splice(0, this.labels.length), this.show(), this; } // Modify label style @@ -22999,8 +22999,8 @@ ATOM`, x); * stylespec - Label style specification * @return {Label} */ - setLabelStyle(c, v) { - return this.modelGroup.remove(c.sprite), c.dispose(), c.stylespec = v, c.setContext(), this.modelGroup.add(c.sprite), this.show(), c; + setLabelStyle(o, v) { + return this.modelGroup.remove(o.sprite), o.dispose(), o.stylespec = v, o.setContext(), this.modelGroup.add(o.sprite), this.show(), o; } // Change label text /** @@ -23011,8 +23011,8 @@ ATOM`, x); * text - Label text * @return {Label} */ - setLabelText(c, v) { - return this.modelGroup.remove(c.sprite), c.dispose(), c.text = v, c.setContext(), this.modelGroup.add(c.sprite), this.show(), c; + setLabelText(o, v) { + return this.modelGroup.remove(o.sprite), o.dispose(), o.text = v, o.setContext(), this.modelGroup.add(o.sprite), this.show(), o; } /** * Add shape object to viewer @@ -23021,9 +23021,9 @@ ATOM`, x); * @param {ShapeSpec} shapeSpec - style specification for label * @return {GLShape} */ - addShape(c) { - c = c || {}; - var v = new m.GLShape(c); + addShape(o) { + o = o || {}; + var v = new m.GLShape(o); return v.shapePosition = this.shapes.length, this.shapes.push(v), v; } /** @@ -23031,10 +23031,10 @@ ATOM`, x); * * @param {GLShape} shape - Reference to shape object to remove */ - removeShape(c) { - if (!c) + removeShape(o) { + if (!o) return this; - for (c.removegl(this.modelGroup), delete this.shapes[c.shapePosition]; this.shapes.length > 0 && typeof this.shapes[this.shapes.length - 1] > "u"; ) + for (o.removegl(this.modelGroup), delete this.shapes[o.shapePosition]; this.shapes.length > 0 && typeof this.shapes[this.shapes.length - 1] > "u"; ) this.shapes.pop(); return this; } @@ -23042,20 +23042,20 @@ ATOM`, x); * Remove all shape objects from viewer */ removeAllShapes() { - for (var c = 0; c < this.shapes.length; c++) { - var v = this.shapes[c]; + for (var o = 0; o < this.shapes.length; o++) { + var v = this.shapes[o]; v && v.removegl(this.modelGroup); } return this.shapes.splice(0, this.shapes.length), this; } //gets the center of the selection - getSelectionCenter(c) { - if (c.hasOwnProperty("x") && c.hasOwnProperty("y") && c.hasOwnProperty("z")) - return c; - var v = this.getAtomsFromSel(c); + getSelectionCenter(o) { + if (o.hasOwnProperty("x") && o.hasOwnProperty("y") && o.hasOwnProperty("z")) + return o; + var v = this.getAtomsFromSel(o); if (v.length == 0) return { x: 0, y: 0, z: 0 }; - var M = (0, d.getExtent)(v); + var M = (0, h.getExtent)(v); return { x: M[0][0] + (M[1][0] - M[0][0]) / 2, y: M[0][1] + (M[1][1] - M[0][1]) / 2, z: M[0][2] + (M[1][2] - M[0][2]) / 2 }; } /** @@ -23070,10 +23070,10 @@ ATOM`, x); viewer.render(); */ - addSphere(c) { - c = c || {}, c.center = this.getSelectionCenter(c.center); - var v = new m.GLShape(c); - return v.shapePosition = this.shapes.length, v.addSphere(c), this.shapes.push(v), v.finalize(), v; + addSphere(o) { + o = o || {}, o.center = this.getSelectionCenter(o.center); + var v = new m.GLShape(o); + return v.shapePosition = this.shapes.length, v.addSphere(o), this.shapes.push(v), v.finalize(), v; } /** * Create and add box shape. This method provides a shorthand @@ -23092,10 +23092,10 @@ ATOM`, x); viewer.rotate(45, {x:1,y:1,z:1}); viewer.render(); */ - addBox(c = {}) { - c.corner != null && (c.corner = this.getSelectionCenter(c.corner)), c.center != null && (c.center = this.getSelectionCenter(c.center)); - var v = new m.GLShape(c); - return v.shapePosition = this.shapes.length, v.addBox(c), this.shapes.push(v), v.finalize(), v; + addBox(o = {}) { + o.corner != null && (o.corner = this.getSelectionCenter(o.corner)), o.center != null && (o.center = this.getSelectionCenter(o.center)); + var v = new m.GLShape(o); + return v.shapePosition = this.shapes.length, v.addBox(o), this.shapes.push(v), v.finalize(), v; } /** * Create and add arrow shape @@ -23121,10 +23121,10 @@ ATOM`, x); viewer.render(); }); */ - addArrow(c = {}) { - c.start = this.getSelectionCenter(c.start), c.end = this.getSelectionCenter(c.end); - var v = new m.GLShape(c); - return v.shapePosition = this.shapes.length, v.addArrow(c), this.shapes.push(v), v.finalize(), v; + addArrow(o = {}) { + o.start = this.getSelectionCenter(o.start), o.end = this.getSelectionCenter(o.end); + var v = new m.GLShape(o); + return v.shapePosition = this.shapes.length, v.addArrow(o), this.shapes.push(v), v.finalize(), v; } /** * Create and add cylinder shape @@ -23160,10 +23160,10 @@ ATOM`, x); toCap:false}); viewer.render(); */ - addCylinder(c = {}) { - c.start = this.getSelectionCenter(c.start), c.end = this.getSelectionCenter(c.end); - var v = new m.GLShape(c); - return v.shapePosition = this.shapes.length, c.dashed ? v.addDashedCylinder(c) : v.addCylinder(c), this.shapes.push(v), v.finalize(), v; + addCylinder(o = {}) { + o.start = this.getSelectionCenter(o.start), o.end = this.getSelectionCenter(o.end); + var v = new m.GLShape(o); + return v.shapePosition = this.shapes.length, o.dashed ? v.addDashedCylinder(o) : v.addCylinder(o), this.shapes.push(v), v.finalize(), v; } /** * Create and add Curve shape @@ -23188,9 +23188,9 @@ ATOM`, x); viewer.zoomTo(); viewer.render(); */ - addCurve(c = {}) { - var v = new m.GLShape(c); - return v.shapePosition = this.shapes.length, v.addCurve(c), this.shapes.push(v), v.finalize(), v; + addCurve(o = {}) { + var v = new m.GLShape(o); + return v.shapePosition = this.shapes.length, v.addCurve(o), this.shapes.push(v), v.finalize(), v; } /** * Create and add line shape @@ -23210,10 +23210,10 @@ ATOM`, x); }); */ - addLine(c = {}) { - c.start = this.getSelectionCenter(c.start), c.end = this.getSelectionCenter(c.end), c.wireframe = !0; - var v = new m.GLShape(c); - return v.shapePosition = this.shapes.length, c.dashed ? v = this.addLineDashed(c, v) : v.addLine(c), this.shapes.push(v), v.finalize(), v; + addLine(o = {}) { + o.start = this.getSelectionCenter(o.start), o.end = this.getSelectionCenter(o.end), o.wireframe = !0; + var v = new m.GLShape(o); + return v.shapePosition = this.shapes.length, o.dashed ? v = this.addLineDashed(o, v) : v.addLine(o), this.shapes.push(v), v.finalize(), v; } /** * Create and add unit cell visualization. @@ -23229,19 +23229,19 @@ ATOM`, x); viewer.render(); }); */ - addUnitCell(c, v) { - c = this.getModel(c), v = v || { alabel: "a", blabel: "b", clabel: "c" }, v.box = v.box || {}, v.astyle = v.astyle || { color: "red", radius: 0.1, midpos: -1 }, v.bstyle = v.bstyle || { color: "green", radius: 0.1, midpos: -1 }, v.cstyle = v.cstyle || { color: "blue", radius: 0.1, midpos: -1 }, v.alabelstyle = v.alabelstyle || { fontColor: "red", showBackground: !1, alignment: "center", inFront: !1 }, v.blabelstyle = v.blabelstyle || { fontColor: "green", showBackground: !1, alignment: "center", inFront: !1 }, v.clabelstyle = v.clabelstyle || { fontColor: "blue", showBackground: !1, alignment: "center", inFront: !1 }, c.unitCellObjects && this.removeUnitCell(c), c.unitCellObjects = { shapes: [], labels: [] }; - var M = c.getCrystData(), E = null; + addUnitCell(o, v) { + o = this.getModel(o), v = v || { alabel: "a", blabel: "b", clabel: "c" }, v.box = v.box || {}, v.astyle = v.astyle || { color: "red", radius: 0.1, midpos: -1 }, v.bstyle = v.bstyle || { color: "green", radius: 0.1, midpos: -1 }, v.cstyle = v.cstyle || { color: "blue", radius: 0.1, midpos: -1 }, v.alabelstyle = v.alabelstyle || { fontColor: "red", showBackground: !1, alignment: "center", inFront: !1 }, v.blabelstyle = v.blabelstyle || { fontColor: "green", showBackground: !1, alignment: "center", inFront: !1 }, v.clabelstyle = v.clabelstyle || { fontColor: "blue", showBackground: !1, alignment: "center", inFront: !1 }, o.unitCellObjects && this.removeUnitCell(o), o.unitCellObjects = { shapes: [], labels: [] }; + var M = o.getCrystData(), E = null; if (M) { if (M.matrix) E = M.matrix; else { var $ = M.a, k = M.b, L = M.c, z = M.alpha, O = M.beta, R = M.gamma; z = z * Math.PI / 180, O = O * Math.PI / 180, R = R * Math.PI / 180; - var P, U, B; - P = Math.cos(O), U = (Math.cos(z) - Math.cos(O) * Math.cos(R)) / Math.sin(R), B = Math.sqrt(Math.max(0, 1 - P * P - U * U)), E = new a.Matrix3($, k * Math.cos(R), L * P, 0, k * Math.sin(R), L * U, 0, 0, L * B); + var N, W, B; + N = Math.cos(O), W = (Math.cos(z) - Math.cos(O) * Math.cos(R)) / Math.sin(R), B = Math.sqrt(Math.max(0, 1 - N * N - W * W)), E = new a.Matrix3($, k * Math.cos(R), L * N, 0, k * Math.sin(R), L * W, 0, 0, L * B); } - var N = [ + var P = [ new a.Vector3(0, 0, 0), new a.Vector3(1, 0, 0), new a.Vector3(0, 1, 0), @@ -23252,45 +23252,45 @@ ATOM`, x); new a.Vector3(1, 1, 1) ]; if (M.matrix4) - for (let H = 0; H < N.length; H++) - M.size && N[H].multiplyVectors(N[H], M.size), N[H] = N[H].applyMatrix4(M.matrix4); + for (let H = 0; H < P.length; H++) + M.size && P[H].multiplyVectors(P[H], M.size), P[H] = P[H].applyMatrix4(M.matrix4); else - for (let H = 0; H < N.length; H++) - N[H] = N[H].applyMatrix3(E); + for (let H = 0; H < P.length; H++) + P[H] = P[H].applyMatrix3(E); if (v.box && !v.box.hidden) { v.box.wireframe = !0; var G = new m.GLShape(v.box); - G.shapePosition = this.shapes.length, G.addLine({ start: N[0], end: N[1] }), G.addLine({ start: N[0], end: N[2] }), G.addLine({ start: N[1], end: N[4] }), G.addLine({ start: N[2], end: N[4] }), G.addLine({ start: N[0], end: N[3] }), G.addLine({ start: N[3], end: N[5] }), G.addLine({ start: N[2], end: N[5] }), G.addLine({ start: N[1], end: N[6] }), G.addLine({ start: N[4], end: N[7] }), G.addLine({ start: N[6], end: N[7] }), G.addLine({ start: N[3], end: N[6] }), G.addLine({ start: N[5], end: N[7] }), this.shapes.push(G), c.unitCellObjects.shapes.push(G), G.finalize(); + G.shapePosition = this.shapes.length, G.addLine({ start: P[0], end: P[1] }), G.addLine({ start: P[0], end: P[2] }), G.addLine({ start: P[1], end: P[4] }), G.addLine({ start: P[2], end: P[4] }), G.addLine({ start: P[0], end: P[3] }), G.addLine({ start: P[3], end: P[5] }), G.addLine({ start: P[2], end: P[5] }), G.addLine({ start: P[1], end: P[6] }), G.addLine({ start: P[4], end: P[7] }), G.addLine({ start: P[6], end: P[7] }), G.addLine({ start: P[3], end: P[6] }), G.addLine({ start: P[5], end: P[7] }), this.shapes.push(G), o.unitCellObjects.shapes.push(G), G.finalize(); } if (!v.astyle.hidden) { - v.astyle.start = N[0], v.astyle.end = N[1]; + v.astyle.start = P[0], v.astyle.end = P[1]; let H = this.addArrow(v.astyle); - c.unitCellObjects.shapes.push(H); + o.unitCellObjects.shapes.push(H); } if (!v.bstyle.hidden) { - v.bstyle.start = N[0], v.bstyle.end = N[2]; + v.bstyle.start = P[0], v.bstyle.end = P[2]; let H = this.addArrow(v.bstyle); - c.unitCellObjects.shapes.push(H); + o.unitCellObjects.shapes.push(H); } if (!v.cstyle.hidden) { - v.cstyle.start = N[0], v.cstyle.end = N[3]; + v.cstyle.start = P[0], v.cstyle.end = P[3]; let H = this.addArrow(v.cstyle); - c.unitCellObjects.shapes.push(H); + o.unitCellObjects.shapes.push(H); } if (v.alabel) { - v.alabelstyle.position = N[1]; + v.alabelstyle.position = P[1]; let H = this.addLabel(v.alabel, v.alabelstyle); - c.unitCellObjects.labels.push(H); + o.unitCellObjects.labels.push(H); } if (v.blabel) { - v.blabelstyle.position = N[2]; + v.blabelstyle.position = P[2]; let H = this.addLabel(v.blabel, v.blabelstyle); - c.unitCellObjects.labels.push(H); + o.unitCellObjects.labels.push(H); } if (v.clabel) { - v.clabelstyle.position = N[3]; + v.clabelstyle.position = P[3]; let H = this.addLabel(v.clabel, v.clabelstyle); - c.unitCellObjects.labels.push(H); + o.unitCellObjects.labels.push(H); } } } @@ -23308,16 +23308,16 @@ ATOM`, x); viewer.render(); }); */ - removeUnitCell(c) { - if (c = this.getModel(c), c.unitCellObjects) { + removeUnitCell(o) { + if (o = this.getModel(o), o.unitCellObjects) { let v = this; - c.unitCellObjects.shapes.forEach(function(M) { + o.unitCellObjects.shapes.forEach(function(M) { v.removeShape(M); - }), c.unitCellObjects.labels.forEach(function(M) { + }), o.unitCellObjects.labels.forEach(function(M) { v.removeLabel(M); }); } - delete c.unitCellObjects; + delete o.unitCellObjects; } /** * Replicate atoms in model to form a super cell of the specified dimensions. @@ -23339,41 +23339,41 @@ ATOM`, x); viewer.render(); }); */ - replicateUnitCell(c = 3, v = c, M = v, E, $, k) { + replicateUnitCell(o = 3, v = o, M = v, E, $, k) { E = this.getModel(E); let L = E.getCrystData(); if (L) { const z = E.selectedAtoms({}), O = L.matrix; - let R = function(U) { - return U % 2 == 0 ? -U / 2 : Math.ceil(U / 2); + let R = function(W) { + return W % 2 == 0 ? -W / 2 : Math.ceil(W / 2); }; - c <= 1 && v <= 1 && M <= 1 && (k = !0, c = v = M = 3); - let P = function(U, B, N) { + o <= 1 && v <= 1 && M <= 1 && (k = !0, o = v = M = 3); + let N = function(W, B, P) { return !1; }; if (k) { - const U = new a.Matrix3().getInverse3(O); - P = function(B, N, G) { - let H = new a.Vector3(B, N, G).applyMatrix3(U); + const W = new a.Matrix3().getInverse3(O); + N = function(B, P, G) { + let H = new a.Vector3(B, P, G).applyMatrix3(W); return !(H.x > -1e-4 && H.x < 1.0001 && H.y > -1e-4 && H.y < 1.0001 && H.z > -1e-4 && H.z < 1.0001); }; } - for (let U = 0; U < c; U++) + for (let W = 0; W < o; W++) for (let B = 0; B < v; B++) - for (let N = 0; N < M; N++) { - if (U == 0 && B == 0 && N == 0) + for (let P = 0; P < M; P++) { + if (W == 0 && B == 0 && P == 0) continue; - let G = new a.Vector3(R(U), R(B), R(N)); + let G = new a.Vector3(R(W), R(B), R(P)); G.applyMatrix3(O); let H = []; - for (let W = 0; W < z.length; W++) { - let V = z[W].x + G.x, re = z[W].y + G.y, ie = z[W].z + G.z; - if (P(V, re, ie)) + for (let U = 0; U < z.length; U++) { + let j = z[U].x + G.x, re = z[U].y + G.y, ie = z[U].z + G.z; + if (N(j, re, ie)) continue; - let ee = {}; - for (let ce in z[W]) - ee[ce] = z[W][ce]; - ee.x = V, ee.y = re, ee.z = ie, H.push(ee); + let te = {}; + for (let ue in z[U]) + te[ue] = z[U][ue]; + te.x = j, te.y = re, te.z = ie, H.push(te); } E.addAtoms(H); } @@ -23381,19 +23381,19 @@ ATOM`, x); } } /** Add dashed line to shape */ - addLineDashed(c, v) { - c.dashLength = c.dashLength || 0.5, c.gapLength = c.gapLength || 0.5; + addLineDashed(o, v) { + o.dashLength = o.dashLength || 0.5, o.gapLength = o.gapLength || 0.5; var M; - c.start ? M = new a.Vector3(c.start.x || 0, c.start.y || 0, c.start.z || 0) : M = new a.Vector3(0, 0, 0); + o.start ? M = new a.Vector3(o.start.x || 0, o.start.y || 0, o.start.z || 0) : M = new a.Vector3(0, 0, 0); var E; - c.end ? E = new a.Vector3(c.end.x, c.end.y || 0, c.end.z || 0) : E = new a.Vector3(0, 0, 0); - var $ = new a.Vector3(), k = new a.Vector3(), L = new a.Vector3(), z, O, R, P = M.clone(), U = 0; - for ($.subVectors(E, M), z = $.length(), $.normalize(), k = $.clone(), L = $.clone(), k.multiplyScalar(c.dashLength), L.multiplyScalar(c.gapLength), O = k.length(), R = L.length(); U < z; ) { - if (U + O > z) { - c.start = M, c.end = E, v.addLine(c); + o.end ? E = new a.Vector3(o.end.x, o.end.y || 0, o.end.z || 0) : E = new a.Vector3(0, 0, 0); + var $ = new a.Vector3(), k = new a.Vector3(), L = new a.Vector3(), z, O, R, N = M.clone(), W = 0; + for ($.subVectors(E, M), z = $.length(), $.normalize(), k = $.clone(), L = $.clone(), k.multiplyScalar(o.dashLength), L.multiplyScalar(o.gapLength), O = k.length(), R = L.length(); W < z; ) { + if (W + O > z) { + o.start = M, o.end = E, v.addLine(o); break; } - P.addVectors(M, k), c.start = M, c.end = P, v.addLine(c), M = P.clone(), U += O, P.addVectors(M, L), M = P.clone(), U += R; + N.addVectors(M, k), o.start = M, o.end = N, v.addLine(o), M = N.clone(), W += O, N.addVectors(M, L), M = N.clone(), W += R; } return v.finalize(), v; } @@ -23429,10 +23429,10 @@ ATOM`, x); triangle(viewer); viewer.render(); */ - addCustom(c) { - c = c || {}; - var v = new m.GLShape(c); - return v.shapePosition = this.shapes.length, v.addCustom(c), this.shapes.push(v), v.finalize(), v; + addCustom(o) { + o = o || {}; + var v = new m.GLShape(o); + return v.shapePosition = this.shapes.length, v.addCustom(o), this.shapes.push(v), v.finalize(), v; } /** * Construct isosurface from volumetric data in gaussian cube format @@ -23454,8 +23454,8 @@ ATOM`, x); */ - addVolumetricData(c, v, M = {}) { - var E = new y.VolumeData(c, v); + addVolumetricData(o, v, M = {}) { + var E = new y.VolumeData(o, v); return M.hasOwnProperty("transferfn") ? this.addVolumetricRender(E, M) : this.addIsosurface(E, M); } /** @@ -23476,9 +23476,9 @@ ATOM`, x); viewer.render(); }); */ - addIsosurface(c, v = {}, M) { + addIsosurface(o, v = {}, M) { var E = new m.GLShape(v); - return E.shapePosition = this.shapes.length, E.addIsosurface(c, v, M, this), this.shapes.push(E), E; + return E.shapePosition = this.shapes.length, E.addIsosurface(o, v, M, this), this.shapes.push(E), E; } /** * Create volumetric renderer for volumetricData @@ -23488,9 +23488,9 @@ ATOM`, x); * @return {GLShape} * */ - addVolumetricRender(c, v) { + addVolumetricRender(o, v) { v = v || {}; - var M = new b.GLVolumetricRender(c, v, this); + var M = new b.GLVolumetricRender(o, v, this); return M.shapePosition = this.shapes.length, this.shapes.push(M), M; } /** @@ -23506,8 +23506,8 @@ ATOM`, x); * * @param {boolean} fog whether to enable or disable the fog */ - enableFog(c) { - c ? this.scene.fog = new r.Fog(this.bgColor, 100, 200) : (this.config.disableFog = !0, this.show()); + enableFog(o) { + o ? this.scene.fog = new r.Fog(this.bgColor, 100, 200) : (this.config.disableFog = !0, this.show()); } /** * Sets the atomlists of all models in the viewer to specified frame. @@ -23517,12 +23517,12 @@ ATOM`, x); * @param {number} framenum - fame index to use, starts at zero * @return {Promise} */ - setFrame(c) { - this.viewer_frame = c; + setFrame(o) { + this.viewer_frame = o; let v = this; return new Promise(function(M) { var E = v.models.map(function($) { - return $.setFrame(c, v); + return $.setFrame(o, v); }); Promise.all(E).then(function() { M(); @@ -23542,14 +23542,14 @@ ATOM`, x); * @return {number} */ getNumFrames() { - var c = 0; + var o = 0; for (let v = 0; v < this.models.length; v++) - this.models[v].getNumFrames() > c && (c = this.models[v].getNumFrames()); + this.models[v].getNumFrames() > o && (o = this.models[v].getNumFrames()); for (let v = 0; v < this.shapes.length; v++) - this.shapes[v].frame && this.shapes[v].frame >= c && (c = this.shapes[v].frame + 1); + this.shapes[v].frame && this.shapes[v].frame >= o && (o = this.shapes[v].frame + 1); for (let v = 0; v < this.labels.length; v++) - this.labels[v].frame && this.labels[v].frame >= c && (c = this.labels[v].frame + 1); - return c; + this.labels[v].frame && this.labels[v].frame >= o && (o = this.labels[v].frame + 1); + return o; } /** * Animate all models in viewer from their respective frames @@ -23557,56 +23557,56 @@ ATOM`, x); * of looping, 'backward', 'forward' or 'backAndForth'), step interval between frames ('step'), startFrame, and reps (numer of repetitions, 0 indicates infinite loop) * */ - animate(c) { + animate(o) { this.incAnim(); var v = 100, M = "forward", E = 1 / 0; - c = c || {}, c.interval && (v = c.interval), c.loop && (M = c.loop), c.reps && (E = c.reps); + o = o || {}, o.interval && (v = o.interval), o.loop && (M = o.loop), o.reps && (E = o.reps); var $ = this.getNumFrames(), k = this, L = 0; - c.startFrame && (L = c.startFrame % $); + o.startFrame && (L = o.startFrame % $); var z = 1; - c.step && (z = c.step, E /= z); - var O = 0, R = $ * E, P = /* @__PURE__ */ new Date(), U, B, N = function(G) { - P = /* @__PURE__ */ new Date(), G == "forward" ? k.setFrame(L).then(function() { - L = (L + z) % $, U(); + o.step && (z = o.step, E /= z); + var O = 0, R = $ * E, N = /* @__PURE__ */ new Date(), W, B, P = function(G) { + N = /* @__PURE__ */ new Date(), G == "forward" ? k.setFrame(L).then(function() { + L = (L + z) % $, W(); }) : G == "backward" ? k.setFrame($ - 1 - L).then(function() { - L = (L + z) % $, U(); + L = (L + z) % $, W(); }) : k.setFrame(L).then(function() { - L += z, z *= L % ($ - 1) == 0 ? -1 : 1, U(); + L += z, z *= L % ($ - 1) == 0 ? -1 : 1, W(); }); }; - return U = function() { + return W = function() { if (k.render(), !k.getCanvas().isConnected) k.stopAnimate(); else if (++O >= R || !k.isAnimated()) B.cancel(), k.animationTimers.delete(B), k.decAnim(); else { - var G = v - ((/* @__PURE__ */ new Date()).getTime() - P.getTime()); - G = G > 0 ? G : 0, k.animationTimers.delete(B), B = new d.PausableTimer(N, G, M), k.animationTimers.add(B); + var G = v - ((/* @__PURE__ */ new Date()).getTime() - N.getTime()); + G = G > 0 ? G : 0, k.animationTimers.delete(B), B = new h.PausableTimer(P, G, M), k.animationTimers.add(B); } - }, B = new d.PausableTimer(N, 0, M), this.animationTimers.add(B), this; + }, B = new h.PausableTimer(P, 0, M), this.animationTimers.add(B), this; } /** * Stop animation of all models in viewer */ stopAnimate() { - return this.animated = 0, this.animationTimers.forEach(function(c) { - c.cancel(); + return this.animated = 0, this.animationTimers.forEach(function(o) { + o.cancel(); }), this.animationTimers = /* @__PURE__ */ new Set(), this; } /** * Pause animation of all models in viewer */ pauseAnimate() { - return this.animationTimers.forEach(function(c) { - c.pause(); + return this.animationTimers.forEach(function(o) { + o.pause(); }), this; } /** * Resume animation of all models in viewer */ resumeAnimate() { - return this.animationTimers.forEach(function(c) { - c.resume(); + return this.animationTimers.forEach(function(o) { + o.resume(); }), this; } /** @@ -23617,8 +23617,8 @@ ATOM`, x); return this.animated > 0; } //setup options dict - getModelOpt(c) { - return c && !c.defaultcolors ? (c.defaultcolors = this.defaultcolors, c.cartoonQuality = c.cartoonQuality || this.config.cartoonQuality) : typeof c > "u" && (c = { defaultcolors: this.defaultcolors, cartoonQuality: this.config.cartoonQuality }), c; + getModelOpt(o) { + return o && !o.defaultcolors ? (o.defaultcolors = this.defaultcolors, o.cartoonQuality = o.cartoonQuality || this.config.cartoonQuality) : typeof o > "u" && (o = { defaultcolors: this.defaultcolors, cartoonQuality: this.config.cartoonQuality }), o; } /** * Create and add model to viewer, given molecular data and its format @@ -23642,10 +23642,10 @@ ATOM`, x); * * @return {GLModel} */ - addModel(c, v = "", M) { + addModel(o, v = "", M) { M = this.getModelOpt(M); - var E = new u.GLModel(this.models.length, M); - return E.addMolData(c, v, M), this.models.push(E), E; + var E = new d.GLModel(this.models.length, M); + return E.addMolData(o, v, M), this.models.push(E), E; } /** * Given multimodel file and its format, add atom data to the viewer as separate models @@ -23655,10 +23655,10 @@ ATOM`, x); * @param {string} format - Input format (see {@link FileFormats}) * @return {Array} */ - addModels(c, v, M) { + addModels(o, v, M) { M = this.getModelOpt(M), M.multimodel = !0, M.frames = !0; - for (var E = u.GLModel.parseMolData(c, v, M), $ = 0; $ < E.length; $++) { - var k = new u.GLModel(this.models.length, M); + for (var E = d.GLModel.parseMolData(o, v, M), $ = 0; $ < E.length; $++) { + var k = new d.GLModel(this.models.length, M); k.setAtomDefaults(E[$]), k.addFrame(E[$]), k.setFrame(0), E.modelData && k.setModelData(E.modelData[$]), k.setDontDuplicateAtoms(!M.duplicateAssemblyAtoms), this.models.push(k); } return this.models; @@ -23681,10 +23681,10 @@ ATOM`, x); viewer.render(); }); */ - addModelsAsFrames(c, v, M) { + addModelsAsFrames(o, v, M) { M = this.getModelOpt(M), M.multimodel = !0, M.frames = !0; - var E = new u.GLModel(this.models.length, M); - return E.addMolData(c, v, M), this.models.push(E), E; + var E = new d.GLModel(this.models.length, M); + return E.addMolData(o, v, M), this.models.push(E), E; } /** * Create and add model to viewer. Given multimodel file and its format, @@ -23702,19 +23702,19 @@ ATOM`, x); viewer.render(); }); */ - addAsOneMolecule(c, v, M) { + addAsOneMolecule(o, v, M) { M = this.getModelOpt(M), M.multimodel = !0, M.onemol = !0; - var E = new u.GLModel(this.models.length, M); - return E.addMolData(c, v, M), this.models.push(E), E; + var E = new d.GLModel(this.models.length, M); + return E.addMolData(o, v, M), this.models.push(E), E; } /** * Delete specified model from viewer * * @param {GLModel|number} model */ - removeModel(c) { - if (c = this.getModel(c), !!c) { - for (c.removegl(this.modelGroup), delete this.models[c.getID()]; this.models.length > 0 && typeof this.models[this.models.length - 1] > "u"; ) + removeModel(o) { + if (o = this.getModel(o), !!o) { + for (o.removegl(this.modelGroup), delete this.models[o.getID()]; this.models.length > 0 && typeof this.models[this.models.length - 1] > "u"; ) this.models.pop(); return this; } @@ -23723,8 +23723,8 @@ ATOM`, x); * Delete all existing models */ removeAllModels() { - for (var c = 0; c < this.models.length; c++) { - var v = this.models[c]; + for (var o = 0; o < this.models.length; o++) { + var v = this.models[o]; v && v.removegl(this.modelGroup); } return this.models.splice(0, this.models.length), this; @@ -23735,22 +23735,22 @@ ATOM`, x); * @param {number} modelID - Optional parameter for which model to export. If left out, export all of them. * @return {string} */ - exportJSON(c, v) { + exportJSON(o, v) { var M = {}; return v === void 0 ? M.m = this.models.map(function(E) { - return E.toCDObject(c); + return E.toCDObject(o); }) : M.m = [this.models[v].toCDObject()], JSON.stringify(M); } /** return a VRML string representation of the scene. Include VRML header information * @return VRML */ exportVRML() { - var c = this.modelGroup; + var o = this.modelGroup; this.applyToModels("removegl", this.modelGroup), this.modelGroup = new r.Object3D(), this.render(null, { supportsImposters: !1, supportsAIA: !1, regen: !0 }); var v = `#VRML V2.0 utf8 ` + this.modelGroup.vrml() + ` `; - return this.applyToModels("removegl", this.modelGroup), this.modelGroup = c, v; + return this.applyToModels("removegl", this.modelGroup), this.modelGroup = o, v; } /** * Create a new model from atoms specified by sel. @@ -23760,23 +23760,23 @@ ATOM`, x); * @param {boolean=} extract - If true, remove selected atoms from existing models * @return {GLModel} */ - createModelFrom(c, v = !1) { - for (var M = new u.GLModel(this.models.length, this.defaultcolors), E = 0; E < this.models.length; E++) + createModelFrom(o, v = !1) { + for (var M = new d.GLModel(this.models.length, this.defaultcolors), E = 0; E < this.models.length; E++) if (this.models[E]) { - var $ = this.models[E].selectedAtoms(c); + var $ = this.models[E].selectedAtoms(o); M.addAtoms($), v && this.models[E].removeAtoms($); } return this.models.push(M), M; } - applyToModels(c, v, M, E, $, k, L) { + applyToModels(o, v, M, E, $, k, L) { for (var z = this.getModelList(v), O = 0; O < z.length; O++) - z[O][c](v, M, E, $, k, L); + z[O][o](v, M, E, $, k, L); } - setStyle(c, v) { - return typeof v > "u" && (v = c, c = {}), this.applyToModels("setStyle", c, v, !1), this; + setStyle(o, v) { + return typeof v > "u" && (v = o, o = {}), this.applyToModels("setStyle", o, v, !1), this; } - addStyle(c, v) { - return typeof v > "u" && (v = c, c = {}), this.applyToModels("setStyle", c, v, !0), this; + addStyle(o, v) { + return typeof v > "u" && (v = o, o = {}), this.applyToModels("setStyle", o, v, !0), this; } /** * Set click-handling properties to all selected atoms. *Important*: render must be called for this to take effect. @@ -23797,8 +23797,8 @@ ATOM`, x); viewer.render(); }); */ - setClickable(c, v, M) { - return this.applyToModels("setClickable", c, v, M), this; + setClickable(o, v, M) { + return this.applyToModels("setClickable", o, v, M), this; } /** Set hoverable and callback of selected atoms * @@ -23826,8 +23826,8 @@ ATOM`, x); }); */ - setHoverable(c, v, M, E) { - return this.applyToModels("setHoverable", c, v, M, E), this; + setHoverable(o, v, M, E) { + return this.applyToModels("setHoverable", o, v, M, E), this; } /** enable context menu and callback of selected atoms * @@ -23835,8 +23835,8 @@ ATOM`, x); * @param {boolean} contextMenuEnabled - whether contextMenu-handling is enabled for the selection */ - enableContextMenu(c, v) { - return this.applyToModels("enableContextMenu", c, v), this; + enableContextMenu(o, v) { + return this.applyToModels("enableContextMenu", o, v), this; } /** * If atoms have dx, dy, dz properties (in some xyz files), vibrate populates each model's frame property based on parameters. @@ -23847,8 +23847,8 @@ ATOM`, x); * @param {boolean} bothWays - if true, extend both in positive and negative directions by numFrames * @param {ArrowSpec} arrowSpec - specification for drawing animated arrows. If color isn't specified, atom color (sphere, stick, line preference) is used. */ - vibrate(c, v, M, E) { - return this.applyToModels("vibrate", c, v, M, this, E), this; + vibrate(o, v, M, E) { + return this.applyToModels("vibrate", o, v, M, this, E), this; } /** * @param {AtomSelectionSpec} sel @@ -23856,15 +23856,15 @@ ATOM`, x); * @param {Gradient|string} scheme * @param {object} range */ - setColorByProperty(c, v, M, E) { - return this.applyToModels("setColorByProperty", c, v, M, E), this; + setColorByProperty(o, v, M, E) { + return this.applyToModels("setColorByProperty", o, v, M, E), this; } /** * @param {AtomSelectionSpec} sel * @param {object} colors */ - setColorByElement(c, v) { - return this.applyToModels("setColorByElement", c, v), this; + setColorByElement(o, v) { + return this.applyToModels("setColorByElement", o, v), this; } /** * @@ -23873,17 +23873,17 @@ ATOM`, x); * extent * @return {Array} */ - static getAtomsWithin(c, v) { + static getAtomsWithin(o, v) { var M = []; - for (let $ = 0; $ < c.length; $++) { - var E = c[$]; + for (let $ = 0; $ < o.length; $++) { + var E = o[$]; typeof E > "u" || E.x < v[0][0] || E.x > v[1][0] || E.y < v[0][1] || E.y > v[1][1] || E.z < v[0][2] || E.z > v[1][2] || M.push(E); } return M; } // return volume of extent - static volume(c) { - var v = c[1][0] - c[0][0], M = c[1][1] - c[0][1], E = c[1][2] - c[0][2]; + static volume(o) { + var v = o[1][0] - o[0][0], M = o[1][1] - o[0][1], E = o[1][2] - o[0][2]; return v * M * E; } // volume @@ -23901,35 +23901,35 @@ ATOM`, x); * @param {AtomSpec[]} atomstoshow * @return {Array} */ - carveUpExtent(c, v, M) { + carveUpExtent(o, v, M) { let E = [], $ = {}; - for (let P = 0, U = v.length; P < U; P++) - $[v[P].index] = P; - let k = function(P) { - let U = []; - for (let B = 0, N = P.length; B < N; B++) - P[B].index in $ && U.push($[P[B].index]); - return U; - }, L = function(P) { - let U = []; - return U[0] = [P[0][0], P[0][1], P[0][2]], U[1] = [P[1][0], P[1][1], P[1][2]], U; - }, z = function(P) { - if (s.volume(P) < s.maxVolume) - return [P]; - var U = P[1][0] - P[0][0], B = P[1][1] - P[0][1], N = P[1][2] - P[0][2], G; - U > B && U > N ? G = 0 : B > U && B > N ? G = 1 : G = 2; - var H = L(P), W = L(P), V = (P[1][G] - P[0][G]) / 2 + P[0][G]; - H[1][G] = V, W[0][G] = V; - var re = z(H), ie = z(W); + for (let N = 0, W = v.length; N < W; N++) + $[v[N].index] = N; + let k = function(N) { + let W = []; + for (let B = 0, P = N.length; B < P; B++) + N[B].index in $ && W.push($[N[B].index]); + return W; + }, L = function(N) { + let W = []; + return W[0] = [N[0][0], N[0][1], N[0][2]], W[1] = [N[1][0], N[1][1], N[1][2]], W; + }, z = function(N) { + if (s.volume(N) < s.maxVolume) + return [N]; + var W = N[1][0] - N[0][0], B = N[1][1] - N[0][1], P = N[1][2] - N[0][2], G; + W > B && W > P ? G = 0 : B > W && B > P ? G = 1 : G = 2; + var H = L(N), U = L(N), j = (N[1][G] - N[0][G]) / 2 + N[0][G]; + H[1][G] = j, U[0][G] = j; + var re = z(H), ie = z(U); return re.concat(ie); - }, O = z(c), R = 6; - for (let P = 0, U = O.length; P < U; P++) { - let B = L(O[P]); + }, O = z(o), R = 6; + for (let N = 0, W = O.length; N < W; N++) { + let B = L(O[N]); B[0][0] -= R, B[0][1] -= R, B[0][2] -= R, B[1][0] += R, B[1][1] += R, B[1][2] += R; - let N = s.getAtomsWithin(v, B), G = s.getAtomsWithin(M, O[P]); + let P = s.getAtomsWithin(v, B), G = s.getAtomsWithin(M, O[N]); E.push({ - extent: O[P], - atoms: k(N), + extent: O[N], + atoms: k(P), toshow: k(G) }); } @@ -23946,40 +23946,40 @@ ATOM`, x); * mat * @return {Mesh} */ - static generateSurfaceMesh(c, v, M) { + static generateSurfaceMesh(o, v, M) { var E = new r.Geometry(!0), $ = E.updateGeoGroup(0), k = []; - for (let ue = 0, ne = c.length; ue < ne; ue++) { - var L = c[ue]; - L && (typeof L.surfaceColor < "u" ? k[ue] = L.surfaceColor : L.color && (k[ue] = l.CC.color(L.color))); + for (let he = 0, ne = o.length; he < ne; he++) { + var L = o[he]; + L && (typeof L.surfaceColor < "u" ? k[he] = L.surfaceColor : L.color && (k[he] = l.CC.color(L.color))); } var z = $.vertexArray, O = v.vertices; - for (let ue = 0, ne = O.length; ue < ne; ue++) { + for (let he = 0, ne = O.length; he < ne; he++) { let _e = $.vertices * 3; - z[_e] = O[ue].x, z[_e + 1] = O[ue].y, z[_e + 2] = O[ue].z, $.vertices++; + z[_e] = O[he].x, z[_e + 1] = O[he].y, z[_e + 2] = O[he].z, $.vertices++; } var R = $.colorArray; - let P = $.atomArray; + let N = $.atomArray; if (M.voldata && M.volscheme) { - var U = M.volscheme, B = M.voldata, N = U.range() || [-1, 1]; - for (let ue = 0, ne = O.length; ue < ne; ue++) { - let _e = O[ue].atomid, Oe = B.getVal(O[ue].x, O[ue].y, O[ue].z), Re = l.CC.color(U.valueToHex(Oe, N)), Ue = ue * 3; - R[Ue] = Re.r, R[Ue + 1] = Re.g, R[Ue + 2] = Re.b, P[ue] = c[_e]; + var W = M.volscheme, B = M.voldata, P = W.range() || [-1, 1]; + for (let he = 0, ne = O.length; he < ne; he++) { + let _e = O[he].atomid, Le = B.getVal(O[he].x, O[he].y, O[he].z), Be = l.CC.color(W.valueToHex(Le, P)), Ue = he * 3; + R[Ue] = Be.r, R[Ue + 1] = Be.g, R[Ue + 2] = Be.b, N[he] = o[_e]; } } else if (k.length > 0) - for (let ue = 0, ne = O.length; ue < ne; ue++) { - let _e = O[ue].atomid, Oe = ue * 3; - R[Oe] = k[_e].r, R[Oe + 1] = k[_e].g, R[Oe + 2] = k[_e].b, P[ue] = c[_e]; + for (let he = 0, ne = O.length; he < ne; he++) { + let _e = O[he].atomid, Le = he * 3; + R[Le] = k[_e].r, R[Le + 1] = k[_e].g, R[Le + 2] = k[_e].b, N[he] = o[_e]; } var G = v.faces; $.faceidx = G.length, E.initTypedArrays(); - var H = $.vertexArray, W = $.normalArray, V, re, ie, ee; - for (let ue = 0, ne = G.length; ue < ne; ue += 3) { - var ce = G[ue], he = G[ue + 1], le = G[ue + 2], J = ce * 3, Me = he * 3, se = le * 3; - V = new a.Vector3(H[J], H[J + 1], H[J + 2]), re = new a.Vector3(H[Me], H[Me + 1], H[Me + 2]), ie = new a.Vector3(H[se], H[se + 1], H[se + 2]), ie.subVectors(ie, re), V.subVectors(V, re), ie.cross(V), ee = ie, ee.normalize(), W[J] += ee.x, W[Me] += ee.x, W[se] += ee.x, W[J + 1] += ee.y, W[Me + 1] += ee.y, W[se + 1] += ee.y, W[J + 2] += ee.z, W[Me + 2] += ee.z, W[se + 2] += ee.z; + var H = $.vertexArray, U = $.normalArray, j, re, ie, te; + for (let he = 0, ne = G.length; he < ne; he += 3) { + var ue = G[he], de = G[he + 1], oe = G[he + 2], J = ue * 3, Ee = de * 3, se = oe * 3; + j = new a.Vector3(H[J], H[J + 1], H[J + 2]), re = new a.Vector3(H[Ee], H[Ee + 1], H[Ee + 2]), ie = new a.Vector3(H[se], H[se + 1], H[se + 2]), ie.subVectors(ie, re), j.subVectors(j, re), ie.cross(j), te = ie, te.normalize(), U[J] += te.x, U[Ee] += te.x, U[se] += te.x, U[J + 1] += te.y, U[Ee + 1] += te.y, U[se + 1] += te.y, U[J + 2] += te.z, U[Ee + 2] += te.z, U[se + 2] += te.z; } $.faceArray = new Uint16Array(G); - var Ce = new r.Mesh(E, M); - return Ce; + var Ae = new r.Mesh(E, M); + return Ae; } // do same thing as worker in main thread /** @@ -23997,9 +23997,9 @@ ATOM`, x); * vol * @return {Object} */ - static generateMeshSyncHelper(c, v, M, E, $, k) { - var L = new w.ProteinSurface(); - return L.initparm(v, c !== 1, k), L.fillvoxels($, M), L.buildboundary(), (c == w.SurfaceType.SES || c == w.SurfaceType.MS) && (L.fastdistancemap(), L.boundingatom(!1), L.fillvoxelswaals($, M)), L.marchingcube(c), L.getFacesAndVertices(E); + static generateMeshSyncHelper(o, v, M, E, $, k) { + var L = new x.ProteinSurface(); + return L.initparm(v, o !== 1, k), L.fillvoxels($, M), L.buildboundary(), (o == x.SurfaceType.SES || o == x.SurfaceType.MS) && (L.fastdistancemap(), L.boundingatom(!1), L.fillvoxelswaals($, M)), L.marchingcube(o), L.getFacesAndVertices(E); } /* * @@ -24007,12 +24007,12 @@ ATOM`, x); * style * @return {MeshLambertMaterial} */ - static getMatWithStyle(c) { + static getMatWithStyle(o) { let v = null; - c.onesided ? v = new r.MeshLambertMaterial() : v = new r.MeshDoubleLambertMaterial(), v.vertexColors = r.Coloring.VertexColors; - for (var M in c) - M === "color" || M === "map" || c.hasOwnProperty(M) && (v[M] = c[M]); - return c.opacity !== void 0 && (c.opacity === 1 ? v.transparent = !1 : v.transparent = !0), v; + o.onesided ? v = new r.MeshLambertMaterial() : v = new r.MeshDoubleLambertMaterial(), v.vertexColors = r.Coloring.VertexColors; + for (var M in o) + M === "color" || M === "map" || o.hasOwnProperty(M) && (v[M] = o[M]); + return o.opacity !== void 0 && (o.opacity === 1 ? v.transparent = !1 : v.transparent = !0), v; } /** * Adds an explicit mesh as a surface object. @@ -24022,10 +24022,10 @@ ATOM`, x); * style * @returns {number} surfid */ - addMesh(c) { + addMesh(o) { var v = { - geo: c.geometry, - mat: c.material, + geo: o.geometry, + mat: o.material, done: !0, finished: !1 //the rendered finishes surfaces when they are done @@ -24035,11 +24035,11 @@ ATOM`, x); //return a shallow copy of list l, e.g., for atoms so we can //ignore superficial changes (ie surfacecolor, position) that happen //while we're surface building - static shallowCopy(c) { + static shallowCopy(o) { var v = []; - let M = c.length; + let M = o.length; for (let E = 0; E < M; E++) - v[E] = (0, d.extend)({}, c[E]); + v[E] = (0, h.extend)({}, o[E]); return v; } /** @@ -24052,47 +24052,47 @@ ATOM`, x); * @param {function} surfacecallback - function to be called after setting the surface * @return {Promise} promise - Returns a promise that ultimately resovles to the surfid. Returns surfid immediately if surfacecallback is specified. Returned promise has a [surfid, GLViewer, style, atomsel, allsel, focus] fields for immediate access. */ - addSurface(c, v = {}, M = {}, E, $, k) { - let L = this.nextSurfID(), z = null, O = this, R = w.SurfaceType.VDW; - typeof c == "string" ? s.surfaceTypeMap[c.toUpperCase()] !== void 0 ? R = s.surfaceTypeMap[c] : console.log("Surface type : " + c + " is not recognized") : typeof c == "number" && (R = c); - var P = null, U = null, B = s.shallowCopy(this.getAtomsFromSel(M)); - E ? P = s.shallowCopy(this.getAtomsFromSel(E)) : P = B, (0, d.adjustVolumeStyle)(v); - var N = !1, G; + addSurface(o, v = {}, M = {}, E, $, k) { + let L = this.nextSurfID(), z = null, O = this, R = x.SurfaceType.VDW; + typeof o == "string" ? s.surfaceTypeMap[o.toUpperCase()] !== void 0 ? R = s.surfaceTypeMap[o] : console.log("Surface type : " + o + " is not recognized") : typeof o == "number" && (R = o); + var N = null, W = null, B = s.shallowCopy(this.getAtomsFromSel(M)); + E ? N = s.shallowCopy(this.getAtomsFromSel(E)) : N = B, (0, h.adjustVolumeStyle)(v); + var P = !1, G; for (G = 0; G < this.models.length; G++) if (this.models[G]) { var H = this.models[G].getSymmetries(); if (H.length > 1 || H.length == 1 && !H[0].isIdentity()) { - N = !0; + P = !0; break; } } - var W = function(le, J, Me) { - $ ? U = s.shallowCopy(O.getAtomsFromSel($)) : U = Me; - var se, Ce = (0, d.getExtent)(Me, !0); + var U = function(oe, J, Ee) { + $ ? W = s.shallowCopy(O.getAtomsFromSel($)) : W = Ee; + var se, Ae = (0, h.getExtent)(Ee, !0); if (v.map && v.map.prop) { - var ue = v.map.prop; - let Te = (0, o.getGradient)(v.map.scheme || v.map.gradient || new o.Gradient.RWB()), Ke = Te.range(); - Ke || (Ke = (0, d.getPropertyRange)(Me, ue)), v.colorscheme = { prop: ue, gradient: Te }; + var he = v.map.prop; + let Te = (0, c.getGradient)(v.map.scheme || v.map.gradient || new c.Gradient.RWB()), Me = Te.range(); + Me || (Me = (0, h.getPropertyRange)(Ee, he)), v.colorscheme = { prop: he, gradient: Te }; } - for (let Te = 0, Ke = J.length; Te < Ke; Te++) - se = J[Te], se.surfaceColor = (0, d.getColorFromStyle)(se, v); - var ne = s.volume(Ce), _e = O.carveUpExtent(Ce, J, Me); - if (U && U.length && U.length > 0) { - var Oe = (0, d.getExtent)(U, !0), Re = function(Te, Ke) { - var je = function(te, we) { - var me = te.extent, Pe = me[1][0] - me[0][0], Fe = me[1][1] - me[0][1], K = me[1][2] - me[0][2], fe = Pe - we[2][0]; - fe *= fe; - var Se = Fe - we[2][1]; - Se *= Se; - var Ne = K - we[2][2]; - return Ne *= Ne, fe + Se + Ne; - }, Y = je(Te, Oe), q = je(Ke, Oe); - return Y - q; + for (let Te = 0, Me = J.length; Te < Me; Te++) + se = J[Te], se.surfaceColor = (0, h.getColorFromStyle)(se, v); + var ne = s.volume(Ae), _e = O.carveUpExtent(Ae, J, Ee); + if (W && W.length && W.length > 0) { + var Le = (0, h.getExtent)(W, !0), Be = function(Te, Me) { + var De = function(ee, ye) { + var ce = ee.extent, Ie = ce[1][0] - ce[0][0], ke = ce[1][1] - ce[0][1], Y = ce[1][2] - ce[0][2], me = Ie - ye[2][0]; + me *= me; + var we = ke - ye[2][1]; + we *= we; + var Re = Y - ye[2][2]; + return Re *= Re, me + we + Re; + }, V = De(Te, Le), Z = De(Me, Le); + return V - Z; }; - _e.sort(Re); + _e.sort(Be); } var Ue = []; - for (let Te = 0, Ke = J.length; Te < Ke; Te++) + for (let Te = 0, Me = J.length; Te < Me; Te++) se = J[Te], Ue[Te] = { x: se.x, y: se.y, @@ -24100,102 +24100,102 @@ ATOM`, x); serial: Te, elem: se.elem }; - var We = !!w.syncSurface; - if (We) { - var Ee = function(Ke) { - return new Promise(function(je) { - for (var Y = s.generateMeshSyncHelper(R, _e[Ke].extent, _e[Ke].atoms, _e[Ke].toshow, Ue, ne), q = (0, m.splitMesh)({ vertexArr: Y.vertices, faceArr: Y.faces }), te = 0, we = q.length; te < we; te++) { - Y = { - vertices: q[te].vertexArr, - faces: q[te].faceArr + var He = !!x.syncSurface; + if (He) { + var We = function(Me) { + return new Promise(function(De) { + for (var V = s.generateMeshSyncHelper(R, _e[Me].extent, _e[Me].atoms, _e[Me].toshow, Ue, ne), Z = (0, m.splitMesh)({ vertexArr: V.vertices, faceArr: V.faces }), ee = 0, ye = Z.length; ee < ye; ee++) { + V = { + vertices: Z[ee].vertexArr, + faces: Z[ee].faceArr }; - var me = s.generateSurfaceMesh(J, Y, z); - (0, d.mergeGeos)(le.geo, me); + var ce = s.generateSurfaceMesh(J, V, z); + (0, h.mergeGeos)(oe.geo, ce); } - O.render(), je(); + O.render(), De(); }); - }, Ae = []; + }, Ge = []; for (let Te = 0; Te < _e.length; Te++) - Ae.push(Ee(Te)); - return Promise.all(Ae).then(function() { - return le.done = !0, Promise.resolve(L); + Ge.push(We(Te)); + return Promise.all(Ge).then(function() { + return oe.done = !0, Promise.resolve(L); }); } else { - var ge = []; + var Ne = []; R < 0 && (R = 0); - for (let Te = 0, Ke = s.numWorkers; Te < Ke; Te++) { - var Le = new Worker($3Dmol.SurfaceWorker); - ge.push(Le), Le.postMessage({ + for (let Te = 0, Me = s.numWorkers; Te < Me; Te++) { + var Pe = new Worker($3Dmol.SurfaceWorker); + Ne.push(Pe), Pe.postMessage({ type: -1, atoms: Ue, volume: ne }); } - return new Promise(function(Te, Ke) { - var je = 0, Y = function() { - !ge || !ge.length || ge.forEach(function(me) { - me && me.terminate && me.terminate(); + return new Promise(function(Te, Me) { + var De = 0, V = function() { + !Ne || !Ne.length || Ne.forEach(function(ce) { + ce && ce.terminate && ce.terminate(); }); - }, q = function(me) { - for (var Pe = (0, m.splitMesh)({ - vertexArr: me.data.vertices, - faceArr: me.data.faces - }), Fe = 0, K = Pe.length; Fe < K; Fe++) { - var fe = { - vertices: Pe[Fe].vertexArr, - faces: Pe[Fe].faceArr - }, Se = s.generateSurfaceMesh(J, fe, z); - (0, d.mergeGeos)(le.geo, Se); + }, Z = function(ce) { + for (var Ie = (0, m.splitMesh)({ + vertexArr: ce.data.vertices, + faceArr: ce.data.faces + }), ke = 0, Y = Ie.length; ke < Y; ke++) { + var me = { + vertices: Ie[ke].vertexArr, + faces: Ie[ke].faceArr + }, we = s.generateSurfaceMesh(J, me, z); + (0, h.mergeGeos)(oe.geo, we); } - O.render(), je++, je == _e.length && (le.done = !0, Y(), Te(L)); - }, te = function(me) { - Y(), console.log(me.message + " (" + me.filename + ":" + me.lineno + ")"), Ke(me); + O.render(), De++, De == _e.length && (oe.done = !0, V(), Te(L)); + }, ee = function(ce) { + V(), console.log(ce.message + " (" + ce.filename + ":" + ce.lineno + ")"), Me(ce); }; - for (let me = 0; me < _e.length; me++) { - var we = ge[me % ge.length]; - we.onmessage = q, we.onerror = te, we.postMessage({ + for (let ce = 0; ce < _e.length; ce++) { + var ye = Ne[ce % Ne.length]; + ye.onmessage = Z, ye.onerror = ee, ye.postMessage({ type: R, - expandedExtent: _e[me].extent, - extendedAtoms: _e[me].atoms, - atomsToShow: _e[me].toshow + expandedExtent: _e[ce].extent, + extendedAtoms: _e[ce].atoms, + atomsToShow: _e[ce].toshow }); } }); } }; v = v || {}, z = s.getMatWithStyle(v); - var V = []; - V.style = v, V.atomsel = M, V.allsel = E, V.focus = $; + var j = []; + j.style = v, j.atomsel = M, j.allsel = E, j.focus = $; var re = null; - if (N) { - var ie = {}, ee = {}; + if (P) { + var ie = {}, te = {}; for (G = 0; G < this.models.length; G++) - ie[G] = [], ee[G] = []; - for (G = 0; G < P.length; G++) - ie[P[G].model].push(P[G]); + ie[G] = [], te[G] = []; + for (G = 0; G < N.length; G++) + ie[N[G].model].push(N[G]); for (G = 0; G < B.length; G++) - ee[B[G].model].push(B[G]); - var ce = []; + te[B[G].model].push(B[G]); + var ue = []; for (G = 0; G < this.models.length; G++) - ee[G].length > 0 && (V.push({ + te[G].length > 0 && (j.push({ geo: new r.Geometry(!0), mat: z, done: !1, finished: !1, symmetries: this.models[G].getSymmetries() // also webgl initialized - }), ce.push(W(V[V.length - 1], ie[G], ee[G]))); - re = Promise.all(ce); + }), ue.push(U(j[j.length - 1], ie[G], te[G]))); + re = Promise.all(ue); } else - V.push({ + j.push({ geo: new r.Geometry(!0), mat: z, done: !1, finished: !1, symmetries: [new a.Matrix4()] - }), re = W(V[V.length - 1], P, B); - return this.surfaces[L] = V, re.surfid = L, k && typeof k == "function" ? (re.then(function(he) { - k(he); + }), re = U(j[j.length - 1], N, B); + return this.surfaces[L] = j, re.surfid = L, k && typeof k == "function" ? (re.then(function(de) { + k(de); }), L) : re; } /** @@ -24213,9 +24213,9 @@ ATOM`, x); }); }); */ - setSurfaceMaterialStyle(c, v) { - if ((0, d.adjustVolumeStyle)(v), this.surfaces[c]) { - var M = this.surfaces[c]; + setSurfaceMaterialStyle(o, v) { + if ((0, h.adjustVolumeStyle)(v), this.surfaces[o]) { + var M = this.surfaces[o]; for (let $ = 0; $ < M.length; $++) { var E = M[$].mat = s.getMatWithStyle(v); if (M[$].mat.side = r.FrontSide, v.color) { @@ -24224,15 +24224,15 @@ ATOM`, x); M[$].geo.setColor(k); } else if (E.voldata && E.volscheme) { const k = E.volscheme, L = E.voldata, z = l.CC, O = k.range() || [-1, 1]; - M[$].geo.setColors(function(R, P, U) { - let B = L.getVal(R, P, U); + M[$].geo.setColors(function(R, N, W) { + let B = L.getVal(R, N, W); return z.color(k.valueToHex(B, O)); }); } else { M[$].geo.colorsNeedUpdate = !0; for (let k of M[$].geo.geometryGroups) for (let L = 0; L < k.vertices; L++) { - let z = (0, d.getColorFromStyle)(k.atomArray[L], v), O = 3 * L; + let z = (0, h.getColorFromStyle)(k.atomArray[L], v), O = 3 * L; k.colorArray[O] = z.r, k.colorArray[O + 1] = z.g, k.colorArray[O + 2] = z.b; } } @@ -24245,32 +24245,32 @@ ATOM`, x); * Return surface object * @param {number} surf - surface id */ - getSurface(c) { - return this.surfaces[c]; + getSurface(o) { + return this.surfaces[o]; } /** * Remove surface with given ID * @param {number} surf - surface id */ - removeSurface(c) { - for (var v = this.surfaces[c], M = 0; M < v.length; M++) + removeSurface(o) { + for (var v = this.surfaces[o], M = 0; M < v.length; M++) v[M] && v[M].lastGL && (v[M].geo !== void 0 && v[M].geo.dispose(), v[M].mat !== void 0 && v[M].mat.dispose(), this.modelGroup.remove(v[M].lastGL)); - return delete this.surfaces[c], this.show(), this; + return delete this.surfaces[o], this.show(), this; } /** Remove all surfaces. **/ removeAllSurfaces() { - for (var c in this.surfaces) - if (this.surfaces.hasOwnProperty(c)) { - for (var v = this.surfaces[c], M = 0; M < v.length; M++) + for (var o in this.surfaces) + if (this.surfaces.hasOwnProperty(o)) { + for (var v = this.surfaces[o], M = 0; M < v.length; M++) v[M] && v[M].lastGL && (v[M].geo !== void 0 && v[M].geo.dispose(), v[M].mat !== void 0 && v[M].mat.dispose(), this.modelGroup.remove(v[M].lastGL)); - delete this.surfaces[c]; + delete this.surfaces[o]; } return this.show(), this; } /** return Jmol moveto command to position this scene */ jmolMoveTo() { - var c = this.modelGroup.position, v = "center { " + -c.x + " " + -c.y + " " + -c.z + " }; ", M = this.rotationGroup.quaternion; + var o = this.modelGroup.position, v = "center { " + -o.x + " " + -o.y + " " + -o.z + " }; ", M = this.rotationGroup.quaternion; return v += "moveto .5 quaternion { " + M.x + " " + M.y + " " + M.z + " " + M.w + " };", v; } /** Clear scene of all objects @@ -24298,19 +24298,19 @@ ATOM`, x); viewer.render(); }); */ - mapAtomProperties(c, v) { + mapAtomProperties(o, v) { v = v || {}; var M = this.getAtomsFromSel(v); - if (typeof c == "function") + if (typeof o == "function") for (let k = 0, L = M.length; k < L; k++) { let z = M[k]; - c(z); + o(z); } else for (let k = 0, L = M.length; k < L; k++) { var E = M[k]; - for (let z = 0, O = c.length; z < O; z++) { - let R = c[z]; + for (let z = 0, O = o.length; z < O; z++) { + let R = o[z]; if (R.props) for (var $ in R.props) R.props.hasOwnProperty($) && this.atomIsSelected(E, R) && (E.properties || (E.properties = {}), E.properties[$] = R.props[$]); @@ -24324,8 +24324,8 @@ ATOM`, x); * be set to this viewer's view. * @param {GLViewer} otherview */ - linkViewer(c) { - return this.linkedViewers.push(c), this; + linkViewer(o) { + return this.linkedViewers.push(o), this; } /** * Return the z distance between the model and the camera @@ -24338,52 +24338,52 @@ ATOM`, x); * Set the distance between the model and the camera * Essentially zooming. Useful while stereo rendering. */ - setPerceivedDistance(c) { - this.rotationGroup.position.z = this.CAMERA_Z - c; + setPerceivedDistance(o) { + this.rotationGroup.position.z = this.CAMERA_Z - o; } /** * Used for setting an approx value of eyeSeparation. Created for calling by StereoViewer object * @return {number} camera x position */ - setAutoEyeSeparation(c, v) { + setAutoEyeSeparation(o, v) { var M = this.getPerceivedDistance(); - return v || (v = 5), c || this.camera.position.x > 0 ? this.camera.position.x = M * Math.tan(Math.PI / 180 * v) : this.camera.position.x = -M * Math.tan(Math.PI / 180 * v), this.camera.lookAt(new a.Vector3(0, 0, this.rotationGroup.position.z)), this.camera.position.x; + return v || (v = 5), o || this.camera.position.x > 0 ? this.camera.position.x = M * Math.tan(Math.PI / 180 * v) : this.camera.position.x = -M * Math.tan(Math.PI / 180 * v), this.camera.lookAt(new a.Vector3(0, 0, this.rotationGroup.position.z)), this.camera.position.x; } /** * Set the default cartoon quality for newly created models. Default is 5. * Current models are not affected. * @number quality, higher results in higher resolution renders */ - setDefaultCartoonQuality(c) { - this.config.cartoonQuality = c; + setDefaultCartoonQuality(o) { + this.config.cartoonQuality = o; } } s.numWorkers = 4, s.maxVolume = 64e3, s.surfaceTypeMap = { - VDW: w.SurfaceType.VDW, - MS: w.SurfaceType.MS, - SAS: w.SurfaceType.SAS, - SES: w.SurfaceType.SES + VDW: x.SurfaceType.VDW, + MS: x.SurfaceType.MS, + SAS: x.SurfaceType.SAS, + SES: x.SurfaceType.SES }; - function h(x, c) { - if (x = (0, d.getElement)(x), !!x) { - c = c || {}; + function u(w, o) { + if (w = (0, h.getElement)(w), !!w) { + o = o || {}; try { - var v = new s(x, c); + var v = new s(w, o); return v; } catch (M) { throw "error creating viewer: " + M; } } } - function _(x, c = {}, v = {}) { - if (x = (0, d.getElement)(x), !!x) { + function p(w, o = {}, v = {}) { + if (w = (0, h.getElement)(w), !!w) { var M = [], E = document.createElement("canvas"); - v.rows = c.rows, v.cols = c.cols, v.control_all = c.control_all != null ? c.control_all : !1, x.appendChild(E); + v.rows = o.rows, v.cols = o.cols, v.control_all = o.control_all != null ? o.control_all : !1, w.appendChild(E); try { - for (var $ = 0; $ < c.rows; $++) { - for (var k = [], L = 0; L < c.cols; L++) { - v.row = $, v.col = L, v.canvas = E, v.viewers = M, v.control_all = c.control_all; - var z = h(x, (0, d.extend)({}, v)); + for (var $ = 0; $ < o.rows; $++) { + for (var k = [], L = 0; L < o.cols; L++) { + v.row = $, v.col = L, v.canvas = E, v.viewers = M, v.control_all = o.control_all; + var z = u(w, (0, h.extend)({}, v)); k.push(z); } M.unshift(k); @@ -24394,13 +24394,13 @@ ATOM`, x); return M; } } - function g(x) { - var c = this; - if (x = (0, d.getElement)(x), !!x) { - var v = _(x, { rows: 1, cols: 2, control_all: !0 }); + function g(w) { + var o = this; + if (w = (0, h.getElement)(w), !!w) { + var v = p(w, { rows: 1, cols: 2, control_all: !0 }); this.glviewer1 = v[0][0], this.glviewer2 = v[0][1], this.glviewer1.setAutoEyeSeparation(!1), this.glviewer2.setAutoEyeSeparation(!0), this.glviewer1.linkViewer(this.glviewer2), this.glviewer2.linkViewer(this.glviewer1); for (var M = Object.getOwnPropertyNames(this.glviewer1.__proto__).filter(function($) { - return typeof c.glviewer1[$] == "function"; + return typeof o.glviewer1[$] == "function"; }), E = 0; E < M.length; E++) this[M[E]] = /* @__PURE__ */ function($) { return function() { @@ -24440,7 +24440,7 @@ ATOM`, x); /* harmony export */ Gradient: () => ( /* binding */ - w + x ), /* harmony export */ GradientType: () => ( @@ -24450,17 +24450,17 @@ ATOM`, x); /* harmony export */ ROYGB: () => ( /* binding */ - u + d ), /* harmony export */ RWB: () => ( /* binding */ - o + c ), /* harmony export */ Sinebow: () => ( /* binding */ - p + _ ), /* harmony export */ builtinGradients: () => ( @@ -24470,7 +24470,7 @@ ATOM`, x); /* harmony export */ getGradient: () => ( /* binding */ - d + h ), /* harmony export */ normalizeValue: () => ( @@ -24488,7 +24488,7 @@ ATOM`, x); function l(b, A, f) { return A >= b ? (f < b && (f = b), f > A && (f = A), { lo: b, hi: A, val: f }) : (f > b && (f = b), f < A && (f = A), f = b - f + A, { lo: A, hi: b, val: f }); } - function d(b) { + function h(b) { if (b instanceof a) return b; if (b.gradient !== void 0 && y[b.gradient]) { @@ -24502,7 +24502,7 @@ ATOM`, x); } return b; } - class o extends a { + class c extends a { constructor(A, f, s) { super(), this.gradient = "RWB", this.mult = 1, this.mid = s, this.min = A, this.max = f, typeof f > "u" && Array.isArray(A) && A.length >= 2 ? (this.max = A[1], this.min = A[0]) : A && f && !Array.isArray(A) && (this.min = A, this.max = f); } @@ -24512,53 +24512,53 @@ ATOM`, x); } //map value to hex color, range is provided valueToHex(A, f) { - var s, h; - if (A = this.mult * A, f ? (s = f[0], h = f[1]) : (s = this.min, h = this.max), A === void 0) + var s, u; + if (A = this.mult * A, f ? (s = f[0], u = f[1]) : (s = this.min, u = this.max), A === void 0) return 16777215; - var _ = l(s, h, A); - s = _.lo, h = _.hi, A = _.val; - var g = (h + s) / 2; - f && typeof f[2] < "u" ? g = f[2] : typeof this.mid < "u" ? g = this.mid : g = (s + h) / 2; - var x, c; - return A < g ? (x = Math.floor(255 * Math.sqrt((A - s) / (g - s))), c = 16711680 + 256 * x + x, c) : A > g ? (x = Math.floor(255 * Math.sqrt(1 - (A - g) / (h - g))), c = 65536 * x + 256 * x + 255, c) : 16777215; + var p = l(s, u, A); + s = p.lo, u = p.hi, A = p.val; + var g = (u + s) / 2; + f && typeof f[2] < "u" ? g = f[2] : typeof this.mid < "u" ? g = this.mid : g = (s + u) / 2; + var w, o; + return A < g ? (w = Math.floor(255 * Math.sqrt((A - s) / (g - s))), o = 16711680 + 256 * w + w, o) : A > g ? (w = Math.floor(255 * Math.sqrt(1 - (A - g) / (u - g))), o = 65536 * w + 256 * w + 255, o) : 16777215; } } - class u extends a { + class d extends a { constructor(A, f) { super(), this.gradient = "ROYGB", this.mult = 1, this.min = A, this.max = f, typeof f > "u" && Array.isArray(A) && A.length >= 2 ? (this.max = A[1], this.min = A[0]) : A && f && !Array.isArray(A) && (this.min = A, this.max = f); } //map value to hex color, range is provided valueToHex(A, f) { - var s, h; - if (A = this.mult * A, f ? (s = f[0], h = f[1]) : (s = this.min, h = this.max), typeof A > "u") + var s, u; + if (A = this.mult * A, f ? (s = f[0], u = f[1]) : (s = this.min, u = this.max), typeof A > "u") return 16777215; - var _ = l(s, h, A); - s = _.lo, h = _.hi, A = _.val; - var g = (s + h) / 2, x = (s + g) / 2, c = (g + h) / 2, v, M; - return A < x ? (v = Math.floor(255 * Math.sqrt((A - s) / (x - s))), M = 16711680 + 256 * v + 0, M) : A < g ? (v = Math.floor(255 * Math.sqrt(1 - (A - x) / (g - x))), M = 65536 * v + 65280 + 0, M) : A < c ? (v = Math.floor(255 * Math.sqrt((A - g) / (c - g))), M = 65280 + 1 * v, M) : (v = Math.floor(255 * Math.sqrt(1 - (A - c) / (h - c))), M = 0 + 256 * v + 255, M); + var p = l(s, u, A); + s = p.lo, u = p.hi, A = p.val; + var g = (s + u) / 2, w = (s + g) / 2, o = (g + u) / 2, v, M; + return A < w ? (v = Math.floor(255 * Math.sqrt((A - s) / (w - s))), M = 16711680 + 256 * v + 0, M) : A < g ? (v = Math.floor(255 * Math.sqrt(1 - (A - w) / (g - w))), M = 65536 * v + 65280 + 0, M) : A < o ? (v = Math.floor(255 * Math.sqrt((A - g) / (o - g))), M = 65280 + 1 * v, M) : (v = Math.floor(255 * Math.sqrt(1 - (A - o) / (u - o))), M = 0 + 256 * v + 255, M); } //return range used for color mapping, null if none set range() { return typeof this.min < "u" && typeof this.max < "u" ? [this.min, this.max] : null; } } - class p extends a { + class _ extends a { constructor(A, f) { super(), this.gradient = "Sinebow", this.mult = 1, this.min = A, this.max = f, typeof f > "u" && Array.isArray(A) && A.length >= 2 && (this.max = A[1], this.min = A[0]), f < A && (this.mult = -1, this.min *= -1, this.max *= -1); } //map value to hex color, range is provided valueToHex(A, f) { - var s, h; - if (A = this.mult * A, f ? (s = f[0], h = f[1]) : (s = this.min, h = this.max), typeof A > "u") + var s, u; + if (A = this.mult * A, f ? (s = f[0], u = f[1]) : (s = this.min, u = this.max), typeof A > "u") return 16777215; - var _ = w.normalizeValue(s, h, A); - s = _.lo, h = _.hi, A = _.val; - var g = (A - s) / (h - s), x = 5 * g / 6 + 0.5, c = Math.sin(Math.PI * x); - c *= c * 255; - var v = Math.sin(Math.PI * (x + 1 / 3)); + var p = x.normalizeValue(s, u, A); + s = p.lo, u = p.hi, A = p.val; + var g = (A - s) / (u - s), w = 5 * g / 6 + 0.5, o = Math.sin(Math.PI * w); + o *= o * 255; + var v = Math.sin(Math.PI * (w + 1 / 3)); v *= v * 255; - var M = Math.sin(Math.PI * (x + 2 / 3)); - return M *= M * 255, 65536 * Math.floor(c) + 256 * Math.floor(M) + 1 * Math.floor(v); + var M = Math.sin(Math.PI * (w + 2 / 3)); + return M *= M * 255, 65536 * Math.floor(o) + 256 * Math.floor(M) + 1 * Math.floor(v); } //return range used for color mapping, null if none set range() { @@ -24568,10 +24568,10 @@ ATOM`, x); class m extends a { constructor(A, f, s) { super(), this.gradient = "linear", this.colors = new Array(); - var h; - if (Array.isArray(A) && A.length >= 2 ? (this.max = A[1], this.min = A[0], h = f) : (this.min = A, this.max = f, h = s), h) - for (let _ of h) - this.colors.push(r.CC.color(_)); + var u; + if (Array.isArray(A) && A.length >= 2 ? (this.max = A[1], this.min = A[0], u = f) : (this.min = A, this.max = f, u = s), u) + for (let p of u) + this.colors.push(r.CC.color(p)); else this.colors.push(r.CC.color(0)); } @@ -24581,24 +24581,24 @@ ATOM`, x); } //map value to hex color, range is provided valueToHex(A, f) { - var s, h; - if (f ? (s = f[0], h = f[1]) : (s = this.min, h = this.max), A === void 0) + var s, u; + if (f ? (s = f[0], u = f[1]) : (s = this.min, u = this.max), A === void 0) return 16777215; - var _ = l(s, h, A); - s = _.lo, h = _.hi, A = _.val; - let g = this.colors.length, x = (h - s) / g, c = Math.min(Math.floor((A - s) / x), g - 1), v = Math.min(c + 1, g - 1), M = (A - s - c * x) / x, E = this.colors[c], $ = this.colors[v]; + var p = l(s, u, A); + s = p.lo, u = p.hi, A = p.val; + let g = this.colors.length, w = (u - s) / g, o = Math.min(Math.floor((A - s) / w), g - 1), v = Math.min(o + 1, g - 1), M = (A - s - o * w) / w, E = this.colors[o], $ = this.colors[v]; return new r.Color(E.r + M * ($.r - E.r), E.g + M * ($.g - E.g), E.b + M * ($.b - E.b)).getHex(); } } const y = { - rwb: o, - RWB: o, - roygb: u, - ROYGB: u, - sinebow: p, + rwb: c, + RWB: c, + roygb: d, + ROYGB: d, + sinebow: _, linear: m }; - class w extends a { + class x extends a { valueToHex(A, f) { return 0; } @@ -24606,7 +24606,7 @@ ATOM`, x); return null; } } - w.RWB = o, w.ROYGB = u, w.Sinebow = p, w.CustomLinear = m, w.builtinGradients = y, w.normalizeValue = l, w.getGradient = d; + x.RWB = c, x.ROYGB = d, x.Sinebow = _, x.CustomLinear = m, x.builtinGradients = y, x.normalizeValue = l, x.getGradient = h; } ), /***/ @@ -24620,12 +24620,12 @@ ATOM`, x); /* harmony export */ Label: () => ( /* binding */ - p + _ ), /* harmony export */ LabelCount: () => ( /* binding */ - d + h ) /* harmony export */ }); @@ -24639,17 +24639,17 @@ ATOM`, x); /*! ./colors */ "./src/colors.ts" ); - let d = 0; - function o(m, y, w, b, A, f, s) { - m.beginPath(), m.moveTo(y + f, w), m.lineTo(y + b - f, w), m.quadraticCurveTo(y + b, w, y + b, w + f), m.lineTo(y + b, w + A - f), m.quadraticCurveTo(y + b, w + A, y + b - f, w + A), m.lineTo(y + f, w + A), m.quadraticCurveTo(y, w + A, y, w + A - f), m.lineTo(y, w + f), m.quadraticCurveTo(y, w, y + f, w), m.closePath(), m.fill(), s && m.stroke(); + let h = 0; + function c(m, y, x, b, A, f, s) { + m.beginPath(), m.moveTo(y + f, x), m.lineTo(y + b - f, x), m.quadraticCurveTo(y + b, x, y + b, x + f), m.lineTo(y + b, x + A - f), m.quadraticCurveTo(y + b, x + A, y + b - f, x + A), m.lineTo(y + f, x + A), m.quadraticCurveTo(y, x + A, y, x + A - f), m.lineTo(y, x + f), m.quadraticCurveTo(y, x, y + f, x), m.closePath(), m.fill(), s && m.stroke(); } - function u(m, y, w) { - var b = w; + function d(m, y, x) { + var b = x; return typeof m < "u" && (m instanceof l.Color ? b = m.scaled() : (b = l.CC.color(m), typeof b.scaled < "u" && (b = b.scaled()))), typeof y < "u" && (b.a = parseFloat(y)), b; } - class p { - constructor(y, w) { - this.id = d++, this.stylespec = w || {}, this.canvas = document.createElement("canvas"), this.canvas.width = 134, this.canvas.height = 35, this.context = this.canvas.getContext("2d"), this.sprite = new r.Sprite(), this.text = y, this.frame = this.stylespec.frame; + class _ { + constructor(y, x) { + this.id = h++, this.stylespec = x || {}, this.canvas = document.createElement("canvas"), this.canvas.width = 134, this.canvas.height = 35, this.context = this.canvas.getContext("2d"), this.sprite = new r.Sprite(), this.text = y, this.frame = this.stylespec.frame; } getStyle() { return this.stylespec; @@ -24663,19 +24663,19 @@ ATOM`, x); this.sprite.visible = !0; } setContext() { - var y = this.stylespec, w = typeof y.useScreen > "u" ? !1 : y.useScreen, b = y.showBackground; + var y = this.stylespec, x = typeof y.useScreen > "u" ? !1 : y.useScreen, b = y.showBackground; (b === "0" || b === "false") && (b = !1), typeof b > "u" && (b = !0); - var A = y.font ? y.font : "sans-serif", f = parseInt(y.fontSize) ? parseInt(y.fontSize) : 18, s = u(y.fontColor, y.fontOpacity, { + var A = y.font ? y.font : "sans-serif", f = parseInt(y.fontSize) ? parseInt(y.fontSize) : 18, s = d(y.fontColor, y.fontOpacity, { r: 255, g: 255, b: 255, a: 1 - }), h = y.padding ? y.padding : 4, _ = y.borderThickness ? y.borderThickness : 0, g = u(y.backgroundColor, y.backgroundOpacity, { + }), u = y.padding ? y.padding : 4, p = y.borderThickness ? y.borderThickness : 0, g = d(y.backgroundColor, y.backgroundOpacity, { r: 0, g: 0, b: 0, a: 1 - }), x = u(y.borderColor, y.borderOpacity, g), c = y.position ? y.position : { + }), w = d(y.borderColor, y.borderOpacity, g), o = y.position ? y.position : { x: -10, y: 1, z: 1 @@ -24686,31 +24686,31 @@ ATOM`, x); var E = ""; y.bold && (E = "bold "), this.context.font = E + f + "px " + A; var $ = this.context.measureText(this.text), k = $.width; - b || (_ = 0); - var L = k + 2.5 * _ + 2 * h, z = f * 1.25 + 2 * _ + 2 * h; + b || (p = 0); + var L = k + 2.5 * p + 2 * u, z = f * 1.25 + 2 * p + 2 * u; if (y.backgroundImage) { - var O = y.backgroundImage, R = y.backgroundWidth ? y.backgroundWidth : O.width, P = y.backgroundHeight ? y.backgroundHeight : O.height; - R > L && (L = R), P > z && (z = P); + var O = y.backgroundImage, R = y.backgroundWidth ? y.backgroundWidth : O.width, N = y.backgroundHeight ? y.backgroundHeight : O.height; + R > L && (L = R), N > z && (z = N); } - if (this.canvas.width = L, this.canvas.height = z, this.context.clearRect(0, 0, this.canvas.width, this.canvas.height), E = "", y.bold && (E = "bold "), this.context.font = E + f + "px " + A, this.context.fillStyle = "rgba(" + g.r + "," + g.g + "," + g.b + "," + g.a + ")", this.context.strokeStyle = "rgba(" + x.r + "," + x.g + "," + x.b + "," + x.a + ")", y.backgroundGradient) { - let B = this.context.createLinearGradient(0, z / 2, L, z / 2), N = a.Gradient.getGradient(y.backgroundGradient), G = N.range(), H = -1, W = 1; - G && (H = G[0], W = G[1]); - let V = W - H; + if (this.canvas.width = L, this.canvas.height = z, this.context.clearRect(0, 0, this.canvas.width, this.canvas.height), E = "", y.bold && (E = "bold "), this.context.font = E + f + "px " + A, this.context.fillStyle = "rgba(" + g.r + "," + g.g + "," + g.b + "," + g.a + ")", this.context.strokeStyle = "rgba(" + w.r + "," + w.g + "," + w.b + "," + w.a + ")", y.backgroundGradient) { + let B = this.context.createLinearGradient(0, z / 2, L, z / 2), P = a.Gradient.getGradient(y.backgroundGradient), G = P.range(), H = -1, U = 1; + G && (H = G[0], U = G[1]); + let j = U - H; for (let re = 0; re < 1.01; re += 0.1) { - let ie = u(N.valueToHex(H + V * re)), ee = "rgba(" + ie.r + "," + ie.g + "," + ie.b + "," + ie.a + ")"; - B.addColorStop(re, ee); + let ie = d(P.valueToHex(H + j * re)), te = "rgba(" + ie.r + "," + ie.g + "," + ie.b + "," + ie.a + ")"; + B.addColorStop(re, te); } this.context.fillStyle = B; } - this.context.lineWidth = _, b && o(this.context, _, _, L - 2 * _, z - 2 * _, 6, _ > 0), y.backgroundImage && this.context.drawImage(O, 0, 0, L, z), this.context.fillStyle = "rgba(" + s.r + "," + s.g + "," + s.b + "," + s.a + ")", this.context.fillText(this.text, _ + h, f + _ + h, k); - var U = new r.Texture(this.canvas); - U.needsUpdate = !0, this.sprite.material = new r.SpriteMaterial({ - map: U, - useScreenCoordinates: w, + this.context.lineWidth = p, b && c(this.context, p, p, L - 2 * p, z - 2 * p, 6, p > 0), y.backgroundImage && this.context.drawImage(O, 0, 0, L, z), this.context.fillStyle = "rgba(" + s.r + "," + s.g + "," + s.b + "," + s.a + ")", this.context.fillText(this.text, p + u, f + p + u, k); + var W = new r.Texture(this.canvas); + W.needsUpdate = !0, this.sprite.material = new r.SpriteMaterial({ + map: W, + useScreenCoordinates: x, alignment: M, depthTest: !v, screenOffset: y.screenOffset || null - }), this.sprite.scale.set(1, 1, 1), this.sprite.position.set(c.x, c.y, c.z); + }), this.sprite.scale.set(1, 1, 1), this.sprite.position.set(o.x, o.y, o.z); } // clean up material and texture dispose() { @@ -24730,17 +24730,17 @@ ATOM`, x); /* harmony export */ MarchingCube: () => ( /* binding */ - u + d ), /* harmony export */ MarchingCubeInitializer: () => ( /* binding */ - o + c ), /* harmony export */ PointGrid: () => ( /* binding */ - p + _ ), /* harmony export */ ProteinSurface: () => ( @@ -24755,7 +24755,7 @@ ATOM`, x); /* harmony export */ setSyncSurface: () => ( /* binding */ - d + h ), /* harmony export */ syncSurface: () => ( @@ -24772,11 +24772,11 @@ ATOM`, x); y[y.VDW = 1] = "VDW", y[y.MS = 2] = "MS", y[y.SAS = 3] = "SAS", y[y.SES = 4] = "SES"; })(a || (a = {})); var l = !1; - function d(y) { + function h(y) { l = y; } (window.navigator.userAgent.indexOf("MSIE ") >= 0 || window.navigator.userAgent.indexOf("Trident/") >= 0) && (l = !0); - class o { + class c { constructor() { this.ISDONE = 2, this.edgeTable = new Uint32Array([ 0, @@ -25808,122 +25808,122 @@ ATOM`, x); [] ]; } - march(w, b, A, f) { - let s = !!f.fulltable, h = f.hasOwnProperty("origin") && f.origin.hasOwnProperty("x") ? f.origin : { x: 0, y: 0, z: 0 }, _ = !!f.voxel, g = f.matrix, x = f.nX || 0, c = f.nY || 0, v = f.nZ || 0, M = f.scale || 1, E = null; + march(x, b, A, f) { + let s = !!f.fulltable, u = f.hasOwnProperty("origin") && f.origin.hasOwnProperty("x") ? f.origin : { x: 0, y: 0, z: 0 }, p = !!f.voxel, g = f.matrix, w = f.nX || 0, o = f.nY || 0, v = f.nZ || 0, M = f.scale || 1, E = null; f.unitCube ? E = f.unitCube : E = { x: M, y: M, z: M }; - let $ = new Int32Array(x * c * v), k, L; + let $ = new Int32Array(w * o * v), k, L; for (k = 0, L = $.length; k < L; ++k) $[k] = -1; - let z = function(U, B, N, G, H, W) { - let V = { x: 0, y: 0, z: 0 }, re = !!(G & 1 << H), ie = !!(G & 1 << W), ee = H; - if (!re && ie && (ee = W), ee & 1 && N++, ee & 2 && B++, ee & 4 && U++, g) { - let he = new r.Vector3(U, B, N); - he = he.applyMatrix4(g), V = { x: he.x, y: he.y, z: he.z }; + let z = function(W, B, P, G, H, U) { + let j = { x: 0, y: 0, z: 0 }, re = !!(G & 1 << H), ie = !!(G & 1 << U), te = H; + if (!re && ie && (te = U), te & 1 && P++, te & 2 && B++, te & 4 && W++, g) { + let de = new r.Vector3(W, B, P); + de = de.applyMatrix4(g), j = { x: de.x, y: de.y, z: de.z }; } else - V.x = h.x + E.x * U, V.y = h.y + E.y * B, V.z = h.z + E.z * N; - let ce = (c * U + B) * v + N; - return _ ? (b.push(V), b.length - 1) : ($[ce] < 0 && ($[ce] = b.length, b.push(V)), $[ce]); - }, O = new Int32Array(12), R = s ? this.edgeTable2 : this.edgeTable, P = s ? this.triTable2 : this.triTable; - for (k = 0; k < x - 1; ++k) - for (let U = 0; U < c - 1; ++U) + j.x = u.x + E.x * W, j.y = u.y + E.y * B, j.z = u.z + E.z * P; + let ue = (o * W + B) * v + P; + return p ? (b.push(j), b.length - 1) : ($[ue] < 0 && ($[ue] = b.length, b.push(j)), $[ue]); + }, O = new Int32Array(12), R = s ? this.edgeTable2 : this.edgeTable, N = s ? this.triTable2 : this.triTable; + for (k = 0; k < w - 1; ++k) + for (let W = 0; W < o - 1; ++W) for (let B = 0; B < v - 1; ++B) { - let N = 0; - for (let W = 0; W < 8; ++W) { - let V = (c * (k + ((W & 4) >> 2)) + U + ((W & 2) >> 1)) * v + B + (W & 1), re = !!(w[V] & this.ISDONE); - N |= re << W; + let P = 0; + for (let U = 0; U < 8; ++U) { + let j = (o * (k + ((U & 4) >> 2)) + W + ((U & 2) >> 1)) * v + B + (U & 1), re = !!(x[j] & this.ISDONE); + P |= re << U; } - if (N === 0 || N === 255) + if (P === 0 || P === 255) continue; - let G = R[N]; + let G = R[P]; if (G === 0) continue; - let H = P[N]; - G & 1 && (O[0] = z(k, U, B, N, 0, 1)), G & 2 && (O[1] = z(k, U, B, N, 1, 3)), G & 4 && (O[2] = z(k, U, B, N, 3, 2)), G & 8 && (O[3] = z(k, U, B, N, 2, 0)), G & 16 && (O[4] = z(k, U, B, N, 4, 5)), G & 32 && (O[5] = z(k, U, B, N, 5, 7)), G & 64 && (O[6] = z(k, U, B, N, 7, 6)), G & 128 && (O[7] = z(k, U, B, N, 6, 4)), G & 256 && (O[8] = z(k, U, B, N, 0, 4)), G & 512 && (O[9] = z(k, U, B, N, 1, 5)), G & 1024 && (O[10] = z(k, U, B, N, 3, 7)), G & 2048 && (O[11] = z(k, U, B, N, 2, 6)); - for (let W = 0; W < H.length; W += 3) { - let V = O[H[W]], re = O[H[W + 1]], ie = O[H[W + 2]]; - _ && W >= 3 && (b.push(b[V]), V = b.length - 1, b.push(b[re]), re = b.length - 1, b.push(b[ie]), ie = b.length - 1), A.push(V), A.push(re), A.push(ie); + let H = N[P]; + G & 1 && (O[0] = z(k, W, B, P, 0, 1)), G & 2 && (O[1] = z(k, W, B, P, 1, 3)), G & 4 && (O[2] = z(k, W, B, P, 3, 2)), G & 8 && (O[3] = z(k, W, B, P, 2, 0)), G & 16 && (O[4] = z(k, W, B, P, 4, 5)), G & 32 && (O[5] = z(k, W, B, P, 5, 7)), G & 64 && (O[6] = z(k, W, B, P, 7, 6)), G & 128 && (O[7] = z(k, W, B, P, 6, 4)), G & 256 && (O[8] = z(k, W, B, P, 0, 4)), G & 512 && (O[9] = z(k, W, B, P, 1, 5)), G & 1024 && (O[10] = z(k, W, B, P, 3, 7)), G & 2048 && (O[11] = z(k, W, B, P, 2, 6)); + for (let U = 0; U < H.length; U += 3) { + let j = O[H[U]], re = O[H[U + 1]], ie = O[H[U + 2]]; + p && U >= 3 && (b.push(b[j]), j = b.length - 1, b.push(b[re]), re = b.length - 1, b.push(b[ie]), ie = b.length - 1), A.push(j), A.push(re), A.push(ie); } } } - laplacianSmooth(w, b, A) { - let f = new Array(b.length), s, h, _, g, x; - for (s = 0, h = b.length; s < h; s++) + laplacianSmooth(x, b, A) { + let f = new Array(b.length), s, u, p, g, w; + for (s = 0, u = b.length; s < u; s++) f[s] = { x: 0, y: 0, z: 0 }; - let c = new Array(20), v; + let o = new Array(20), v; for (s = 0; s < 20; s++) - c[s] = new Array(b.length); - for (s = 0, h = b.length; s < h; s++) - c[0][s] = 0; - for (s = 0, h = A.length / 3; s < h; s++) { + o[s] = new Array(b.length); + for (s = 0, u = b.length; s < u; s++) + o[0][s] = 0; + for (s = 0, u = A.length / 3; s < u; s++) { let $ = s * 3, k = s * 3 + 1, L = s * 3 + 2; - for (v = !0, _ = 0, g = c[0][A[$]]; _ < g; _++) - if (A[k] == c[_ + 1][A[$]]) { + for (v = !0, p = 0, g = o[0][A[$]]; p < g; p++) + if (A[k] == o[p + 1][A[$]]) { v = !1; break; } - for (v && (c[0][A[$]]++, c[c[0][A[$]]][A[$]] = A[k]), v = !0, _ = 0, g = c[0][A[$]]; _ < g; _++) - if (A[L] == c[_ + 1][A[$]]) { + for (v && (o[0][A[$]]++, o[o[0][A[$]]][A[$]] = A[k]), v = !0, p = 0, g = o[0][A[$]]; p < g; p++) + if (A[L] == o[p + 1][A[$]]) { v = !1; break; } - for (v && (c[0][A[$]]++, c[c[0][A[$]]][A[$]] = A[L]), v = !0, _ = 0, g = c[0][A[k]]; _ < g; _++) - if (A[$] == c[_ + 1][A[k]]) { + for (v && (o[0][A[$]]++, o[o[0][A[$]]][A[$]] = A[L]), v = !0, p = 0, g = o[0][A[k]]; p < g; p++) + if (A[$] == o[p + 1][A[k]]) { v = !1; break; } - for (v && (c[0][A[k]]++, c[c[0][A[k]]][A[k]] = A[$]), v = !0, _ = 0, g = c[0][A[k]]; _ < g; _++) - if (A[L] == c[_ + 1][A[k]]) { + for (v && (o[0][A[k]]++, o[o[0][A[k]]][A[k]] = A[$]), v = !0, p = 0, g = o[0][A[k]]; p < g; p++) + if (A[L] == o[p + 1][A[k]]) { v = !1; break; } - for (v && (c[0][A[k]]++, c[c[0][A[k]]][A[k]] = A[L]), v = !0, _ = 0; _ < c[0][A[L]]; _++) - if (A[$] == c[_ + 1][A[L]]) { + for (v && (o[0][A[k]]++, o[o[0][A[k]]][A[k]] = A[L]), v = !0, p = 0; p < o[0][A[L]]; p++) + if (A[$] == o[p + 1][A[L]]) { v = !1; break; } - for (v && (c[0][A[L]]++, c[c[0][A[L]]][A[L]] = A[$]), v = !0, _ = 0, g = c[0][A[L]]; _ < g; _++) - if (A[k] == c[_ + 1][A[L]]) { + for (v && (o[0][A[L]]++, o[o[0][A[L]]][A[L]] = A[$]), v = !0, p = 0, g = o[0][A[L]]; p < g; p++) + if (A[k] == o[p + 1][A[L]]) { v = !1; break; } - v && (c[0][A[L]]++, c[c[0][A[L]]][A[L]] = A[k]); + v && (o[0][A[L]]++, o[o[0][A[L]]][A[L]] = A[k]); } let M = 1, E = 0.5; - for (x = 0; x < w; x++) { - for (s = 0, h = b.length; s < h; s++) - if (c[0][s] < 3) + for (w = 0; w < x; w++) { + for (s = 0, u = b.length; s < u; s++) + if (o[0][s] < 3) f[s].x = b[s].x, f[s].y = b[s].y, f[s].z = b[s].z; - else if (c[0][s] == 3 || c[0][s] == 4) { - for (f[s].x = 0, f[s].y = 0, f[s].z = 0, _ = 0, g = c[0][s]; _ < g; _++) - f[s].x += b[c[_ + 1][s]].x, f[s].y += b[c[_ + 1][s]].y, f[s].z += b[c[_ + 1][s]].z; - f[s].x += E * b[s].x, f[s].y += E * b[s].y, f[s].z += E * b[s].z, f[s].x /= E + c[0][s], f[s].y /= E + c[0][s], f[s].z /= E + c[0][s]; + else if (o[0][s] == 3 || o[0][s] == 4) { + for (f[s].x = 0, f[s].y = 0, f[s].z = 0, p = 0, g = o[0][s]; p < g; p++) + f[s].x += b[o[p + 1][s]].x, f[s].y += b[o[p + 1][s]].y, f[s].z += b[o[p + 1][s]].z; + f[s].x += E * b[s].x, f[s].y += E * b[s].y, f[s].z += E * b[s].z, f[s].x /= E + o[0][s], f[s].y /= E + o[0][s], f[s].z /= E + o[0][s]; } else { - for (f[s].x = 0, f[s].y = 0, f[s].z = 0, _ = 0, g = c[0][s]; _ < g; _++) - f[s].x += b[c[_ + 1][s]].x, f[s].y += b[c[_ + 1][s]].y, f[s].z += b[c[_ + 1][s]].z; - f[s].x += M * b[s].x, f[s].y += M * b[s].y, f[s].z += M * b[s].z, f[s].x /= M + c[0][s], f[s].y /= M + c[0][s], f[s].z /= M + c[0][s]; + for (f[s].x = 0, f[s].y = 0, f[s].z = 0, p = 0, g = o[0][s]; p < g; p++) + f[s].x += b[o[p + 1][s]].x, f[s].y += b[o[p + 1][s]].y, f[s].z += b[o[p + 1][s]].z; + f[s].x += M * b[s].x, f[s].y += M * b[s].y, f[s].z += M * b[s].z, f[s].x /= M + o[0][s], f[s].y /= M + o[0][s], f[s].z /= M + o[0][s]; } - for (s = 0, h = b.length; s < h; s++) + for (s = 0, u = b.length; s < u; s++) b[s].x = f[s].x, b[s].y = f[s].y, b[s].z = f[s].z; } } } - let u = new o(); - class p { - constructor(w, b, A) { - this.data = new Int32Array(w * b * A * 3), this.width = b, this.height = A; + let d = new c(); + class _ { + constructor(x, b, A) { + this.data = new Int32Array(x * b * A * 3), this.width = b, this.height = A; } // set position x,y,z to pt, which has ix,iy,and iz - set(w, b, A, f) { - let s = ((w * this.width + b) * this.height + A) * 3; + set(x, b, A, f) { + let s = ((x * this.width + b) * this.height + A) * 3; this.data[s] = f.ix, this.data[s + 1] = f.iy, this.data[s + 2] = f.iz; } // return point at x,y,z - get(w, b, A) { - let f = ((w * this.width + b) * this.height + A) * 3; + get(x, b, A) { + let f = ((x * this.width + b) * this.height + A) * 3; return { ix: this.data[f], iy: this.data[f + 1], @@ -25978,124 +25978,124 @@ ATOM`, x); new Int32Array([-1, -1, 1]), new Int32Array([-1, 1, -1]), new Int32Array([-1, -1, -1]) - ], m.MarchingCube || (m.MarchingCube = new o()); + ], m.MarchingCube || (m.MarchingCube = new c()); } - getVDWIndex(w) { - return !w.elem || typeof this.vdwRadii[w.elem] > "u" ? "X" : w.elem; + getVDWIndex(x) { + return !x.elem || typeof this.vdwRadii[x.elem] > "u" ? "X" : x.elem; } - getFacesAndVertices(w) { + getFacesAndVertices(x) { let b = {}; - for (let s = 0, h = w.length; s < h; s++) - b[w[s]] = !0; + for (let s = 0, u = x.length; s < u; s++) + b[x[s]] = !0; let A = this.verts; - for (let s = 0, h = A.length; s < h; s++) + for (let s = 0, u = A.length; s < u; s++) A[s].x = A[s].x / this.scaleFactor - this.ptranx, A[s].y = A[s].y / this.scaleFactor - this.ptrany, A[s].z = A[s].z / this.scaleFactor - this.ptranz; let f = []; - for (let s = 0, h = this.faces.length; s < h; s += 3) { - let _ = this.faces[s], g = this.faces[s + 1], x = this.faces[s + 2], c = A[_].atomid, v = A[g].atomid, M = A[x].atomid, E = c; - v < E && (E = v), M < E && (E = M), b[E] && _ !== g && g !== x && _ !== x && (f.push(_), f.push(g), f.push(x)); + for (let s = 0, u = this.faces.length; s < u; s += 3) { + let p = this.faces[s], g = this.faces[s + 1], w = this.faces[s + 2], o = A[p].atomid, v = A[g].atomid, M = A[w].atomid, E = o; + v < E && (E = v), M < E && (E = M), b[E] && p !== g && g !== w && p !== w && (f.push(p), f.push(g), f.push(w)); } return this.vpBits = null, this.vpDistance = null, this.vpAtomID = null, { vertices: A, faces: f }; } - initparm(w, b, A) { + initparm(x, b, A) { A > 1e6 && (this.scaleFactor = this.defaultScaleFactor / 2); let f = 1 / this.scaleFactor * 5.5; - this.pminx = w[0][0], this.pmaxx = w[1][0], this.pminy = w[0][1], this.pmaxy = w[1][1], this.pminz = w[0][2], this.pmaxz = w[1][2], b ? (this.pminx -= this.probeRadius + f, this.pminy -= this.probeRadius + f, this.pminz -= this.probeRadius + f, this.pmaxx += this.probeRadius + f, this.pmaxy += this.probeRadius + f, this.pmaxz += this.probeRadius + f) : (this.pminx -= f, this.pminy -= f, this.pminz -= f, this.pmaxx += f, this.pmaxy += f, this.pmaxz += f), this.pminx = Math.floor(this.pminx * this.scaleFactor) / this.scaleFactor, this.pminy = Math.floor(this.pminy * this.scaleFactor) / this.scaleFactor, this.pminz = Math.floor(this.pminz * this.scaleFactor) / this.scaleFactor, this.pmaxx = Math.ceil(this.pmaxx * this.scaleFactor) / this.scaleFactor, this.pmaxy = Math.ceil(this.pmaxy * this.scaleFactor) / this.scaleFactor, this.pmaxz = Math.ceil(this.pmaxz * this.scaleFactor) / this.scaleFactor, this.ptranx = -this.pminx, this.ptrany = -this.pminy, this.ptranz = -this.pminz, this.pLength = Math.ceil(this.scaleFactor * (this.pmaxx - this.pminx)) + 1, this.pWidth = Math.ceil(this.scaleFactor * (this.pmaxy - this.pminy)) + 1, this.pHeight = Math.ceil(this.scaleFactor * (this.pmaxz - this.pminz)) + 1, this.boundingatom(b), this.cutRadius = this.probeRadius * this.scaleFactor, this.vpBits = new Uint8Array(this.pLength * this.pWidth * this.pHeight), this.vpDistance = new Float64Array(this.pLength * this.pWidth * this.pHeight), this.vpAtomID = new Int32Array(this.pLength * this.pWidth * this.pHeight); + this.pminx = x[0][0], this.pmaxx = x[1][0], this.pminy = x[0][1], this.pmaxy = x[1][1], this.pminz = x[0][2], this.pmaxz = x[1][2], b ? (this.pminx -= this.probeRadius + f, this.pminy -= this.probeRadius + f, this.pminz -= this.probeRadius + f, this.pmaxx += this.probeRadius + f, this.pmaxy += this.probeRadius + f, this.pmaxz += this.probeRadius + f) : (this.pminx -= f, this.pminy -= f, this.pminz -= f, this.pmaxx += f, this.pmaxy += f, this.pmaxz += f), this.pminx = Math.floor(this.pminx * this.scaleFactor) / this.scaleFactor, this.pminy = Math.floor(this.pminy * this.scaleFactor) / this.scaleFactor, this.pminz = Math.floor(this.pminz * this.scaleFactor) / this.scaleFactor, this.pmaxx = Math.ceil(this.pmaxx * this.scaleFactor) / this.scaleFactor, this.pmaxy = Math.ceil(this.pmaxy * this.scaleFactor) / this.scaleFactor, this.pmaxz = Math.ceil(this.pmaxz * this.scaleFactor) / this.scaleFactor, this.ptranx = -this.pminx, this.ptrany = -this.pminy, this.ptranz = -this.pminz, this.pLength = Math.ceil(this.scaleFactor * (this.pmaxx - this.pminx)) + 1, this.pWidth = Math.ceil(this.scaleFactor * (this.pmaxy - this.pminy)) + 1, this.pHeight = Math.ceil(this.scaleFactor * (this.pmaxz - this.pminz)) + 1, this.boundingatom(b), this.cutRadius = this.probeRadius * this.scaleFactor, this.vpBits = new Uint8Array(this.pLength * this.pWidth * this.pHeight), this.vpDistance = new Float64Array(this.pLength * this.pWidth * this.pHeight), this.vpAtomID = new Int32Array(this.pLength * this.pWidth * this.pHeight); } - boundingatom(w) { + boundingatom(x) { let b = {}; for (const A in this.vdwRadii) { let f = this.vdwRadii[A]; - w ? b[A] = (f + this.probeRadius) * this.scaleFactor + 0.5 : b[A] = f * this.scaleFactor + 0.5; + x ? b[A] = (f + this.probeRadius) * this.scaleFactor + 0.5 : b[A] = f * this.scaleFactor + 0.5; let s = b[A] * b[A]; this.widxz[A] = Math.floor(b[A]) + 1, this.depty[A] = new Int32Array(this.widxz[A] * this.widxz[A]); - let h = 0; - for (let _ = 0; _ < this.widxz[A]; _++) + let u = 0; + for (let p = 0; p < this.widxz[A]; p++) for (let g = 0; g < this.widxz[A]; g++) { - let x = _ * _ + g * g; - if (x > s) - this.depty[A][h] = -1; + let w = p * p + g * g; + if (w > s) + this.depty[A][u] = -1; else { - let c = Math.sqrt(s - x); - this.depty[A][h] = Math.floor(c); + let o = Math.sqrt(s - w); + this.depty[A][u] = Math.floor(o); } - h++; + u++; } } } - fillvoxels(w, b) { + fillvoxels(x, b) { for (let A = 0, f = this.vpBits.length; A < f; A++) this.vpBits[A] = 0, this.vpDistance[A] = -1, this.vpAtomID[A] = -1; for (let A in b) { - let f = w[b[A]]; - f !== void 0 && this.fillAtom(f, w); + let f = x[b[A]]; + f !== void 0 && this.fillAtom(f, x); } for (let A = 0, f = this.vpBits.length; A < f; A++) this.vpBits[A] & this.INOUT && (this.vpBits[A] |= this.ISDONE); } - fillAtom(w, b) { - let A = Math.floor(0.5 + this.scaleFactor * (w.x + this.ptranx)), f = Math.floor(0.5 + this.scaleFactor * (w.y + this.ptrany)), s = Math.floor(0.5 + this.scaleFactor * (w.z + this.ptranz)), h = this.getVDWIndex(w), _ = 0, g = this.pWidth * this.pHeight; - for (let x = 0, c = this.widxz[h]; x < c; x++) - for (let v = 0; v < c; v++) { - if (this.depty[h][_] != -1) { + fillAtom(x, b) { + let A = Math.floor(0.5 + this.scaleFactor * (x.x + this.ptranx)), f = Math.floor(0.5 + this.scaleFactor * (x.y + this.ptrany)), s = Math.floor(0.5 + this.scaleFactor * (x.z + this.ptranz)), u = this.getVDWIndex(x), p = 0, g = this.pWidth * this.pHeight; + for (let w = 0, o = this.widxz[u]; w < o; w++) + for (let v = 0; v < o; v++) { + if (this.depty[u][p] != -1) { for (let M = -1; M < 2; M++) for (let E = -1; E < 2; E++) for (let $ = -1; $ < 2; $++) if (M !== 0 && E !== 0 && $ !== 0) { - let k = M * x, L = $ * v; - for (let z = 0; z <= this.depty[h][_]; z++) { - let O = z * E, R = A + k, P = f + O, U = s + L; - if (R < 0 || P < 0 || U < 0 || R >= this.pLength || P >= this.pWidth || U >= this.pHeight) + let k = M * w, L = $ * v; + for (let z = 0; z <= this.depty[u][p]; z++) { + let O = z * E, R = A + k, N = f + O, W = s + L; + if (R < 0 || N < 0 || W < 0 || R >= this.pLength || N >= this.pWidth || W >= this.pHeight) continue; - let B = R * g + P * this.pHeight + U; + let B = R * g + N * this.pHeight + W; if (!(this.vpBits[B] & this.INOUT)) - this.vpBits[B] |= this.INOUT, this.vpAtomID[B] = w.serial; + this.vpBits[B] |= this.INOUT, this.vpAtomID[B] = x.serial; else { - let N = b[this.vpAtomID[B]]; - if (N.serial != w.serial) { - let G = A + k - Math.floor(0.5 + this.scaleFactor * (N.x + this.ptranx)), H = f + O - Math.floor(0.5 + this.scaleFactor * (N.y + this.ptrany)), W = s + L - Math.floor(0.5 + this.scaleFactor * (N.z + this.ptranz)); - k * k + O * O + L * L < G * G + H * H + W * W && (this.vpAtomID[B] = w.serial); + let P = b[this.vpAtomID[B]]; + if (P.serial != x.serial) { + let G = A + k - Math.floor(0.5 + this.scaleFactor * (P.x + this.ptranx)), H = f + O - Math.floor(0.5 + this.scaleFactor * (P.y + this.ptrany)), U = s + L - Math.floor(0.5 + this.scaleFactor * (P.z + this.ptranz)); + k * k + O * O + L * L < G * G + H * H + U * U && (this.vpAtomID[B] = x.serial); } } } } } - _++; + p++; } } - fillvoxelswaals(w, b) { + fillvoxelswaals(x, b) { for (let A = 0, f = this.vpBits.length; A < f; A++) this.vpBits[A] &= ~this.ISDONE; for (let A in b) { - let f = w[b[A]]; - f !== void 0 && this.fillAtomWaals(f, w); + let f = x[b[A]]; + f !== void 0 && this.fillAtomWaals(f, x); } } - fillAtomWaals(w, b) { - let A = 0, f = Math.floor(0.5 + this.scaleFactor * (w.x + this.ptranx)), s = Math.floor(0.5 + this.scaleFactor * (w.y + this.ptrany)), h = Math.floor(0.5 + this.scaleFactor * (w.z + this.ptranz)), _ = this.getVDWIndex(w), g = this.pWidth * this.pHeight; - for (let x = 0, c = this.widxz[_]; x < c; x++) - for (let v = 0; v < c; v++) { - if (this.depty[_][A] != -1) { + fillAtomWaals(x, b) { + let A = 0, f = Math.floor(0.5 + this.scaleFactor * (x.x + this.ptranx)), s = Math.floor(0.5 + this.scaleFactor * (x.y + this.ptrany)), u = Math.floor(0.5 + this.scaleFactor * (x.z + this.ptranz)), p = this.getVDWIndex(x), g = this.pWidth * this.pHeight; + for (let w = 0, o = this.widxz[p]; w < o; w++) + for (let v = 0; v < o; v++) { + if (this.depty[p][A] != -1) { for (let M = -1; M < 2; M++) for (let E = -1; E < 2; E++) for (let $ = -1; $ < 2; $++) if (M !== 0 && E !== 0 && $ !== 0) { - let k = M * x, L = $ * v; - for (let z = 0; z <= this.depty[_][A]; z++) { - let O = z * E, R = f + k, P = s + O, U = h + L; - if (R < 0 || P < 0 || U < 0 || R >= this.pLength || P >= this.pWidth || U >= this.pHeight) + let k = M * w, L = $ * v; + for (let z = 0; z <= this.depty[p][A]; z++) { + let O = z * E, R = f + k, N = s + O, W = u + L; + if (R < 0 || N < 0 || W < 0 || R >= this.pLength || N >= this.pWidth || W >= this.pHeight) continue; - let B = R * g + P * this.pHeight + U; + let B = R * g + N * this.pHeight + W; if (!(this.vpBits[B] & this.ISDONE)) - this.vpBits[B] |= this.ISDONE, this.vpAtomID[B] = w.serial; + this.vpBits[B] |= this.ISDONE, this.vpAtomID[B] = x.serial; else { - let N = b[this.vpAtomID[B]]; - if (N.serial != w.serial) { - let G = f + k - Math.floor(0.5 + this.scaleFactor * (N.x + this.ptranx)), H = s + O - Math.floor(0.5 + this.scaleFactor * (N.y + this.ptrany)), W = h + L - Math.floor(0.5 + this.scaleFactor * (N.z + this.ptranz)); - k * k + O * O + L * L < G * G + H * H + W * W && (this.vpAtomID[B] = w.serial); + let P = b[this.vpAtomID[B]]; + if (P.serial != x.serial) { + let G = f + k - Math.floor(0.5 + this.scaleFactor * (P.x + this.ptranx)), H = s + O - Math.floor(0.5 + this.scaleFactor * (P.y + this.ptrany)), U = u + L - Math.floor(0.5 + this.scaleFactor * (P.z + this.ptranz)); + k * k + O * O + L * L < G * G + H * H + U * U && (this.vpAtomID[B] = x.serial); } } } @@ -26105,98 +26105,98 @@ ATOM`, x); } } buildboundary() { - let w = this.pWidth * this.pHeight; + let x = this.pWidth * this.pHeight; for (let b = 0; b < this.pLength; b++) for (let A = 0; A < this.pHeight; A++) for (let f = 0; f < this.pWidth; f++) { - let s = b * w + f * this.pHeight + A; + let s = b * x + f * this.pHeight + A; if (this.vpBits[s] & this.INOUT) { - let h = 0; - for (; h < 26; ) { - let _ = b + this.nb[h][0], g = A + this.nb[h][2], x = f + this.nb[h][1]; - if (_ > -1 && _ < this.pLength && x > -1 && x < this.pWidth && g > -1 && g < this.pHeight && !(this.vpBits[_ * w + x * this.pHeight + g] & this.INOUT)) { + let u = 0; + for (; u < 26; ) { + let p = b + this.nb[u][0], g = A + this.nb[u][2], w = f + this.nb[u][1]; + if (p > -1 && p < this.pLength && w > -1 && w < this.pWidth && g > -1 && g < this.pHeight && !(this.vpBits[p * x + w * this.pHeight + g] & this.INOUT)) { this.vpBits[s] |= this.ISBOUND; break; } else - h++; + u++; } } } } fastdistancemap() { - let w = new p(this.pLength, this.pWidth, this.pHeight), b = this.pWidth * this.pHeight, A = this.cutRadius * this.cutRadius, f = [], s = [], h; - for (let x = 0; x < this.pLength; x++) - for (let c = 0; c < this.pWidth; c++) + let x = new _(this.pLength, this.pWidth, this.pHeight), b = this.pWidth * this.pHeight, A = this.cutRadius * this.cutRadius, f = [], s = [], u; + for (let w = 0; w < this.pLength; w++) + for (let o = 0; o < this.pWidth; o++) for (let v = 0; v < this.pHeight; v++) - if (h = x * b + c * this.pHeight + v, this.vpBits[h] &= ~this.ISDONE, this.vpBits[h] & this.INOUT && this.vpBits[h] & this.ISBOUND) { + if (u = w * b + o * this.pHeight + v, this.vpBits[u] &= ~this.ISDONE, this.vpBits[u] & this.INOUT && this.vpBits[u] & this.ISBOUND) { let M = { - ix: x, - iy: c, + ix: w, + iy: o, iz: v }; - w.set(x, c, v, M), f.push(M), this.vpDistance[h] = 0, this.vpBits[h] |= this.ISDONE, this.vpBits[h] &= ~this.ISBOUND; + x.set(w, o, v, M), f.push(M), this.vpDistance[u] = 0, this.vpBits[u] |= this.ISDONE, this.vpBits[u] &= ~this.ISBOUND; } do { - s = this.fastoneshell(f, w), f = []; - for (let x = 0, c = s.length; x < c; x++) - h = b * s[x].ix + this.pHeight * s[x].iy + s[x].iz, this.vpBits[h] &= ~this.ISBOUND, this.vpDistance[h] <= 1.0404 * A && f.push({ - ix: s[x].ix, - iy: s[x].iy, - iz: s[x].iz + s = this.fastoneshell(f, x), f = []; + for (let w = 0, o = s.length; w < o; w++) + u = b * s[w].ix + this.pHeight * s[w].iy + s[w].iz, this.vpBits[u] &= ~this.ISBOUND, this.vpDistance[u] <= 1.0404 * A && f.push({ + ix: s[w].ix, + iy: s[w].iy, + iz: s[w].iz }); } while (f.length !== 0); - f = [], s = [], w = null; - let _ = this.scaleFactor - 0.5; - _ < 0 && (_ = 0); - let g = A - 0.5 / (0.1 + _); - for (let x = 0; x < this.pLength; x++) - for (let c = 0; c < this.pWidth; c++) + f = [], s = [], x = null; + let p = this.scaleFactor - 0.5; + p < 0 && (p = 0); + let g = A - 0.5 / (0.1 + p); + for (let w = 0; w < this.pLength; w++) + for (let o = 0; o < this.pWidth; o++) for (let v = 0; v < this.pHeight; v++) - h = x * b + c * this.pHeight + v, this.vpBits[h] &= ~this.ISBOUND, this.vpBits[h] & this.INOUT && (!(this.vpBits[h] & this.ISDONE) || this.vpBits[h] & this.ISDONE && this.vpDistance[h] >= g) && (this.vpBits[h] |= this.ISBOUND); + u = w * b + o * this.pHeight + v, this.vpBits[u] &= ~this.ISBOUND, this.vpBits[u] & this.INOUT && (!(this.vpBits[u] & this.ISDONE) || this.vpBits[u] & this.ISDONE && this.vpDistance[u] >= g) && (this.vpBits[u] |= this.ISBOUND); } - fastoneshell(w, b) { - let A, f, s, h, _, g, x, c, v, M = []; - if (w.length === 0) + fastoneshell(x, b) { + let A, f, s, u, p, g, w, o, v, M = []; + if (x.length === 0) return M; let E = { ix: -1, iy: -1, iz: -1 }, $ = this.pWidth * this.pHeight; - for (let k = 0, L = w.length; k < L; k++) { - A = w[k].ix, f = w[k].iy, s = w[k].iz, c = b.get(A, f, s); + for (let k = 0, L = x.length; k < L; k++) { + A = x[k].ix, f = x[k].iy, s = x[k].iz, o = b.get(A, f, s); for (let z = 0; z < 6; z++) - E.ix = A + this.nb[z][0], E.iy = f + this.nb[z][1], E.iz = s + this.nb[z][2], E.ix < this.pLength && E.ix > -1 && E.iy < this.pWidth && E.iy > -1 && E.iz < this.pHeight && E.iz > -1 && (v = E.ix * $ + this.pHeight * E.iy + E.iz, this.vpBits[v] & this.INOUT && !(this.vpBits[v] & this.ISDONE) ? (b.set(E.ix, E.iy, s + this.nb[z][2], c), h = E.ix - c.ix, _ = E.iy - c.iy, g = E.iz - c.iz, x = h * h + _ * _ + g * g, this.vpDistance[v] = x, this.vpBits[v] |= this.ISDONE, this.vpBits[v] |= this.ISBOUND, M.push({ + E.ix = A + this.nb[z][0], E.iy = f + this.nb[z][1], E.iz = s + this.nb[z][2], E.ix < this.pLength && E.ix > -1 && E.iy < this.pWidth && E.iy > -1 && E.iz < this.pHeight && E.iz > -1 && (v = E.ix * $ + this.pHeight * E.iy + E.iz, this.vpBits[v] & this.INOUT && !(this.vpBits[v] & this.ISDONE) ? (b.set(E.ix, E.iy, s + this.nb[z][2], o), u = E.ix - o.ix, p = E.iy - o.iy, g = E.iz - o.iz, w = u * u + p * p + g * g, this.vpDistance[v] = w, this.vpBits[v] |= this.ISDONE, this.vpBits[v] |= this.ISBOUND, M.push({ ix: E.ix, iy: E.iy, iz: E.iz - })) : this.vpBits[v] & this.INOUT && this.vpBits[v] & this.ISDONE && (h = E.ix - c.ix, _ = E.iy - c.iy, g = E.iz - c.iz, x = h * h + _ * _ + g * g, x < this.vpDistance[v] && (b.set(E.ix, E.iy, E.iz, c), this.vpDistance[v] = x, this.vpBits[v] & this.ISBOUND || (this.vpBits[v] |= this.ISBOUND, M.push({ + })) : this.vpBits[v] & this.INOUT && this.vpBits[v] & this.ISDONE && (u = E.ix - o.ix, p = E.iy - o.iy, g = E.iz - o.iz, w = u * u + p * p + g * g, w < this.vpDistance[v] && (b.set(E.ix, E.iy, E.iz, o), this.vpDistance[v] = w, this.vpBits[v] & this.ISBOUND || (this.vpBits[v] |= this.ISBOUND, M.push({ ix: E.ix, iy: E.iy, iz: E.iz }))))); } - for (let k = 0, L = w.length; k < L; k++) { - A = w[k].ix, f = w[k].iy, s = w[k].iz, c = b.get(A, f, s); + for (let k = 0, L = x.length; k < L; k++) { + A = x[k].ix, f = x[k].iy, s = x[k].iz, o = b.get(A, f, s); for (let z = 6; z < 18; z++) - E.ix = A + this.nb[z][0], E.iy = f + this.nb[z][1], E.iz = s + this.nb[z][2], E.ix < this.pLength && E.ix > -1 && E.iy < this.pWidth && E.iy > -1 && E.iz < this.pHeight && E.iz > -1 && (v = E.ix * $ + this.pHeight * E.iy + E.iz, this.vpBits[v] & this.INOUT && !(this.vpBits[v] & this.ISDONE) ? (b.set(E.ix, E.iy, s + this.nb[z][2], c), h = E.ix - c.ix, _ = E.iy - c.iy, g = E.iz - c.iz, x = h * h + _ * _ + g * g, this.vpDistance[v] = x, this.vpBits[v] |= this.ISDONE, this.vpBits[v] |= this.ISBOUND, M.push({ + E.ix = A + this.nb[z][0], E.iy = f + this.nb[z][1], E.iz = s + this.nb[z][2], E.ix < this.pLength && E.ix > -1 && E.iy < this.pWidth && E.iy > -1 && E.iz < this.pHeight && E.iz > -1 && (v = E.ix * $ + this.pHeight * E.iy + E.iz, this.vpBits[v] & this.INOUT && !(this.vpBits[v] & this.ISDONE) ? (b.set(E.ix, E.iy, s + this.nb[z][2], o), u = E.ix - o.ix, p = E.iy - o.iy, g = E.iz - o.iz, w = u * u + p * p + g * g, this.vpDistance[v] = w, this.vpBits[v] |= this.ISDONE, this.vpBits[v] |= this.ISBOUND, M.push({ ix: E.ix, iy: E.iy, iz: E.iz - })) : this.vpBits[v] & this.INOUT && this.vpBits[v] & this.ISDONE && (h = E.ix - c.ix, _ = E.iy - c.iy, g = E.iz - c.iz, x = h * h + _ * _ + g * g, x < this.vpDistance[v] && (b.set(E.ix, E.iy, E.iz, c), this.vpDistance[v] = x, this.vpBits[v] & this.ISBOUND || (this.vpBits[v] |= this.ISBOUND, M.push({ + })) : this.vpBits[v] & this.INOUT && this.vpBits[v] & this.ISDONE && (u = E.ix - o.ix, p = E.iy - o.iy, g = E.iz - o.iz, w = u * u + p * p + g * g, w < this.vpDistance[v] && (b.set(E.ix, E.iy, E.iz, o), this.vpDistance[v] = w, this.vpBits[v] & this.ISBOUND || (this.vpBits[v] |= this.ISBOUND, M.push({ ix: E.ix, iy: E.iy, iz: E.iz }))))); } - for (let k = 0, L = w.length; k < L; k++) { - A = w[k].ix, f = w[k].iy, s = w[k].iz, c = b.get(A, f, s); + for (let k = 0, L = x.length; k < L; k++) { + A = x[k].ix, f = x[k].iy, s = x[k].iz, o = b.get(A, f, s); for (let z = 18; z < 26; z++) - E.ix = A + this.nb[z][0], E.iy = f + this.nb[z][1], E.iz = s + this.nb[z][2], E.ix < this.pLength && E.ix > -1 && E.iy < this.pWidth && E.iy > -1 && E.iz < this.pHeight && E.iz > -1 && (v = E.ix * $ + this.pHeight * E.iy + E.iz, this.vpBits[v] & this.INOUT && !(this.vpBits[v] & this.ISDONE) ? (b.set(E.ix, E.iy, s + this.nb[z][2], c), h = E.ix - c.ix, _ = E.iy - c.iy, g = E.iz - c.iz, x = h * h + _ * _ + g * g, this.vpDistance[v] = x, this.vpBits[v] |= this.ISDONE, this.vpBits[v] |= this.ISBOUND, M.push({ + E.ix = A + this.nb[z][0], E.iy = f + this.nb[z][1], E.iz = s + this.nb[z][2], E.ix < this.pLength && E.ix > -1 && E.iy < this.pWidth && E.iy > -1 && E.iz < this.pHeight && E.iz > -1 && (v = E.ix * $ + this.pHeight * E.iy + E.iz, this.vpBits[v] & this.INOUT && !(this.vpBits[v] & this.ISDONE) ? (b.set(E.ix, E.iy, s + this.nb[z][2], o), u = E.ix - o.ix, p = E.iy - o.iy, g = E.iz - o.iz, w = u * u + p * p + g * g, this.vpDistance[v] = w, this.vpBits[v] |= this.ISDONE, this.vpBits[v] |= this.ISBOUND, M.push({ ix: E.ix, iy: E.iy, iz: E.iz - })) : this.vpBits[v] & this.INOUT && this.vpBits[v] & this.ISDONE && (h = E.ix - c.ix, _ = E.iy - c.iy, g = E.iz - c.iz, x = h * h + _ * _ + g * g, x < this.vpDistance[v] && (b.set(E.ix, E.iy, E.iz, c), this.vpDistance[v] = x, this.vpBits[v] & this.ISBOUND || (this.vpBits[v] |= this.ISBOUND, M.push({ + })) : this.vpBits[v] & this.INOUT && this.vpBits[v] & this.ISDONE && (u = E.ix - o.ix, p = E.iy - o.iy, g = E.iz - o.iz, w = u * u + p * p + g * g, w < this.vpDistance[v] && (b.set(E.ix, E.iy, E.iz, o), this.vpDistance[v] = w, this.vpBits[v] & this.ISBOUND || (this.vpBits[v] |= this.ISBOUND, M.push({ ix: E.ix, iy: E.iy, iz: E.iz @@ -26204,12 +26204,12 @@ ATOM`, x); } return M; } - marchingcubeinit(w) { + marchingcubeinit(x) { for (let b = 0, A = this.vpBits.length; b < A; b++) - w == 1 ? this.vpBits[b] &= ~this.ISBOUND : w == 4 ? (this.vpBits[b] &= ~this.ISDONE, this.vpBits[b] & this.ISBOUND && (this.vpBits[b] |= this.ISDONE), this.vpBits[b] &= ~this.ISBOUND) : w == 2 ? this.vpBits[b] & this.ISBOUND && this.vpBits[b] & this.ISDONE ? this.vpBits[b] &= ~this.ISBOUND : this.vpBits[b] & this.ISBOUND && !(this.vpBits[b] & this.ISDONE) && (this.vpBits[b] |= this.ISDONE) : w == 3 && (this.vpBits[b] &= ~this.ISBOUND); + x == 1 ? this.vpBits[b] &= ~this.ISBOUND : x == 4 ? (this.vpBits[b] &= ~this.ISDONE, this.vpBits[b] & this.ISBOUND && (this.vpBits[b] |= this.ISDONE), this.vpBits[b] &= ~this.ISBOUND) : x == 2 ? this.vpBits[b] & this.ISBOUND && this.vpBits[b] & this.ISDONE ? this.vpBits[b] &= ~this.ISBOUND : this.vpBits[b] & this.ISBOUND && !(this.vpBits[b] & this.ISDONE) && (this.vpBits[b] |= this.ISDONE) : x == 3 && (this.vpBits[b] &= ~this.ISBOUND); } - marchingcube(w) { - this.marchingcubeinit(w), this.verts = [], this.faces = [], m.MarchingCube.march(this.vpBits, this.verts, this.faces, { + marchingcube(x) { + this.marchingcubeinit(x), this.verts = [], this.faces = [], m.MarchingCube.march(this.vpBits, this.verts, this.faces, { smooth: 1, nX: this.pLength, nY: this.pWidth, @@ -26221,7 +26221,7 @@ ATOM`, x); m.MarchingCube.laplacianSmooth(1, this.verts, this.faces); } } - m.MarchingCube = new o(); + m.MarchingCube = new c(); } ), /***/ @@ -26235,7 +26235,7 @@ ATOM`, x); /* harmony export */ VolumeData: () => ( /* binding */ - u + d ) /* harmony export */ }); @@ -26248,15 +26248,15 @@ ATOM`, x); ), l = t( /*! ./parsers/VASP */ "./src/parsers/VASP.ts" - ), d = t( + ), h = t( /*! ./parsers/CUBE */ "./src/parsers/CUBE.ts" - ), o = t( + ), c = t( /*! pako */ "./node_modules/pako/dist/pako.esm.mjs" ); - class u { - constructor(m, y, w) { + class d { + constructor(m, y, x) { if (this.unit = { x: 1, y: 1, @@ -26269,57 +26269,57 @@ ATOM`, x); x: 0, y: 0, z: 0 - }, this.data = new Float32Array([]), this.matrix = null, this.inversematrix = null, this.isbinary = /* @__PURE__ */ new Set(["ccp4", "CCP4"]), this.getCoordinates = function(h) { - var _ = h / (this.size.y * this.size.z), g = h % (this.size.y * this.size.z), x = h % this.size.z; - return _ *= this.unit.x, g *= this.unit.y, x *= this.unit.z, _ += this.origin.x, g += this.origin.y, x += this.origin.z, { x: _, y: g, z: x }; - }, this.vasp = function(h) { - var _ = h.replace(/^\s+/, "").split(/[\n\r]/), g = (0, l.VASP)(h)[0], x = g.length; - if (x == 0) { + }, this.data = new Float32Array([]), this.matrix = null, this.inversematrix = null, this.isbinary = /* @__PURE__ */ new Set(["ccp4", "CCP4"]), this.getCoordinates = function(u) { + var p = u / (this.size.y * this.size.z), g = u % (this.size.y * this.size.z), w = u % this.size.z; + return p *= this.unit.x, g *= this.unit.y, w *= this.unit.z, p += this.origin.x, g += this.origin.y, w += this.origin.z, { x: p, y: g, z: w }; + }, this.vasp = function(u) { + var p = u.replace(/^\s+/, "").split(/[\n\r]/), g = (0, l.VASP)(u)[0], w = g.length; + if (w == 0) { console.warn("No good formating of CHG or CHGCAR file, not atomic information provided in the file."), this.data = []; return; } - var c = 1.889725992, v = 0.036749309, M = parseFloat(_[1]), E; - E = _[2].replace(/^\s+/, "").split(/\s+/); - var $ = new a.Vector3(parseFloat(E[0]), parseFloat(E[1]), parseFloat(E[2])).multiplyScalar(M * c); - E = _[3].replace(/^\s+/, "").split(/\s+/); - var k = new a.Vector3(parseFloat(E[0]), parseFloat(E[1]), parseFloat(E[2])).multiplyScalar(M * c); - E = _[4].replace(/^\s+/, "").split(/\s+/); - var L = new a.Vector3(parseFloat(E[0]), parseFloat(E[1]), parseFloat(E[2])).multiplyScalar(M * c), z = $.x * (k.y * L.z - L.y * k.z) - k.x * ($.y * L.z - L.y * $.z) + L.x * ($.y * k.z - k.y * $.z); - z = Math.abs(z) / Math.pow(c, 3); + var o = 1.889725992, v = 0.036749309, M = parseFloat(p[1]), E; + E = p[2].replace(/^\s+/, "").split(/\s+/); + var $ = new a.Vector3(parseFloat(E[0]), parseFloat(E[1]), parseFloat(E[2])).multiplyScalar(M * o); + E = p[3].replace(/^\s+/, "").split(/\s+/); + var k = new a.Vector3(parseFloat(E[0]), parseFloat(E[1]), parseFloat(E[2])).multiplyScalar(M * o); + E = p[4].replace(/^\s+/, "").split(/\s+/); + var L = new a.Vector3(parseFloat(E[0]), parseFloat(E[1]), parseFloat(E[2])).multiplyScalar(M * o), z = $.x * (k.y * L.z - L.y * k.z) - k.x * ($.y * L.z - L.y * $.z) + L.x * ($.y * k.z - k.y * $.z); + z = Math.abs(z) / Math.pow(o, 3); var O = 1 / z; - _.splice(0, 8 + x + 1); - var R = _[0].replace(/^\s+/, "").replace(/\s+/g, " ").split(" "), P = Math.abs(parseFloat(R[0])), U = Math.abs(parseFloat(R[1])), B = Math.abs(parseFloat(R[2])), N = this.origin = new a.Vector3(0, 0, 0); - this.size = { x: P, y: U, z: B }, this.unit = new a.Vector3($.x, k.y, L.z), $ = $.multiplyScalar(1 / (c * P)), k = k.multiplyScalar(1 / (c * U)), L = L.multiplyScalar(1 / (c * B)), ($.y != 0 || $.z != 0 || k.x != 0 || k.z != 0 || L.x != 0 || L.y != 0) && (this.matrix = new a.Matrix4($.x, k.x, L.x, 0, $.y, k.y, L.y, 0, $.z, k.z, L.z, 0, 0, 0, 0, 1), this.matrix = this.matrix.multiplyMatrices(this.matrix, new a.Matrix4().makeTranslation(N.x, N.y, N.z)), this.origin = new a.Vector3(0, 0, 0), this.unit = new a.Vector3(1, 1, 1)), _.splice(0, 1); - var G = _.join(" "); + p.splice(0, 8 + w + 1); + var R = p[0].replace(/^\s+/, "").replace(/\s+/g, " ").split(" "), N = Math.abs(parseFloat(R[0])), W = Math.abs(parseFloat(R[1])), B = Math.abs(parseFloat(R[2])), P = this.origin = new a.Vector3(0, 0, 0); + this.size = { x: N, y: W, z: B }, this.unit = new a.Vector3($.x, k.y, L.z), $ = $.multiplyScalar(1 / (o * N)), k = k.multiplyScalar(1 / (o * W)), L = L.multiplyScalar(1 / (o * B)), ($.y != 0 || $.z != 0 || k.x != 0 || k.z != 0 || L.x != 0 || L.y != 0) && (this.matrix = new a.Matrix4($.x, k.x, L.x, 0, $.y, k.y, L.y, 0, $.z, k.z, L.z, 0, 0, 0, 0, 1), this.matrix = this.matrix.multiplyMatrices(this.matrix, new a.Matrix4().makeTranslation(P.x, P.y, P.z)), this.origin = new a.Vector3(0, 0, 0), this.unit = new a.Vector3(1, 1, 1)), p.splice(0, 1); + var G = p.join(" "); G = G.replace(/^\s+/, ""); var H = G.split(/[\s\r]+/); - H.splice(P * U * B + 1); - for (var W = Float32Array.from(H, parseFloat), V = 0; V < W.length; V++) - W[V] = W[V] * O * v; - this.data = W; - }, this.dx = function(h) { - var _ = h.split(/[\n\r]+/), g, x = /gridpositions\s+counts\s+(\d+)\s+(\d+)\s+(\d+)/, c = /^origin\s+(\S+)\s+(\S+)\s+(\S+)/, v = /^delta\s+(\S+)\s+(\S+)\s+(\S+)/, M = /data follows/, E = 0; - for (E = 0; E < _.length; E++) { - var $ = _[E]; - if (g = x.exec($)) { + H.splice(N * W * B + 1); + for (var U = Float32Array.from(H, parseFloat), j = 0; j < U.length; j++) + U[j] = U[j] * O * v; + this.data = U; + }, this.dx = function(u) { + var p = u.split(/[\n\r]+/), g, w = /gridpositions\s+counts\s+(\d+)\s+(\d+)\s+(\d+)/, o = /^origin\s+(\S+)\s+(\S+)\s+(\S+)/, v = /^delta\s+(\S+)\s+(\S+)\s+(\S+)/, M = /data follows/, E = 0; + for (E = 0; E < p.length; E++) { + var $ = p[E]; + if (g = w.exec($)) { var k = parseInt(g[1]), L = parseInt(g[2]), z = parseInt(g[3]); this.size = { x: k, y: L, z }; } else if (g = v.exec($)) { var O = parseFloat(g[1]); - if ((parseFloat(g[2]) != 0 || parseFloat(g[3]) != 0) && console.warn("Non-orthogonal delta matrix not currently supported in dx format"), E += 1, $ = _[E], g = v.exec($), g == null) { + if ((parseFloat(g[2]) != 0 || parseFloat(g[3]) != 0) && console.warn("Non-orthogonal delta matrix not currently supported in dx format"), E += 1, $ = p[E], g = v.exec($), g == null) { console.error("Parse error in dx delta matrix"); return; } var R = parseFloat(g[2]); - if ((parseFloat(g[1]) != 0 || parseFloat(g[3]) != 0) && console.warn("Non-orthogonal delta matrix not currently supported in dx format"), E += 1, $ = _[E], g = v.exec($), g == null) { + if ((parseFloat(g[1]) != 0 || parseFloat(g[3]) != 0) && console.warn("Non-orthogonal delta matrix not currently supported in dx format"), E += 1, $ = p[E], g = v.exec($), g == null) { console.error("Parse error in dx delta matrix"); return; } - var P = parseFloat(g[3]); - (parseFloat(g[1]) != 0 || parseFloat(g[2]) != 0) && console.warn("Non-orthogonal delta matrix not currently supported in dx format"), this.unit = new a.Vector3(O, R, P); - } else if (g = c.exec($)) { - var U = parseFloat(g[1]), B = parseFloat(g[2]), N = parseFloat(g[3]); - this.origin = new a.Vector3(U, B, N); + var N = parseFloat(g[3]); + (parseFloat(g[1]) != 0 || parseFloat(g[2]) != 0) && console.warn("Non-orthogonal delta matrix not currently supported in dx format"), this.unit = new a.Vector3(O, R, N); + } else if (g = o.exec($)) { + var W = parseFloat(g[1]), B = parseFloat(g[2]), P = parseFloat(g[3]); + this.origin = new a.Vector3(W, B, P); } else if (g = M.exec($)) break; } @@ -26327,33 +26327,33 @@ ATOM`, x); console.error("Error parsing dx format"); return; } - var G = _.splice(E).join(" "), H = G.split(/[\s\r]+/); + var G = p.splice(E).join(" "), H = G.split(/[\s\r]+/); this.data = Float32Array.from(H, parseFloat); }, y = y.toLowerCase(), /\.gz$/.test(y)) { y = y.replace(/\.gz$/, ""); try { - this[y] && this.isbinary.has(y) ? (typeof m == "string" && (m = (0, r.base64ToArray)(m)), m = (0, o.inflate)(m)) : m = new TextDecoder("utf-8").decode((0, o.inflate)(m)); - } catch (h) { - console.error(h); + this[y] && this.isbinary.has(y) ? (typeof m == "string" && (m = (0, r.base64ToArray)(m)), m = (0, c.inflate)(m)) : m = new TextDecoder("utf-8").decode((0, c.inflate)(m)); + } catch (u) { + console.error(u); } } - if (this[y] && (this.isbinary.has(y) && typeof m == "string" && (m = (0, r.base64ToArray)(m)), this[y](m)), w) { - if (w.negate) - for (let h = 0, _ = this.data.length; h < _; h++) - this.data[h] = -this.data[h]; - if (w.normalize) { + if (this[y] && (this.isbinary.has(y) && typeof m == "string" && (m = (0, r.base64ToArray)(m)), this[y](m)), x) { + if (x.negate) + for (let u = 0, p = this.data.length; u < p; u++) + this.data[u] = -this.data[u]; + if (x.normalize) { var b = 0; - for (let h = 0, _ = this.data.length; h < _; h++) - b += this.data[h]; + for (let u = 0, p = this.data.length; u < p; u++) + b += this.data[u]; var A = b / this.data.length; b = 0; - for (let h = 0, _ = this.data.length; h < _; h++) { - var f = this.data[h] - A; + for (let u = 0, p = this.data.length; u < p; u++) { + var f = this.data[u] - A; b += f * f; } var s = b / this.data.length; - for (let h = 0, _ = this.data.length; h < _; h++) - this.data[h] = (this.data[h] - A) / s; + for (let u = 0, p = this.data.length; u < p; u++) + this.data[u] = (this.data[u] - A) / s; } } } @@ -26362,63 +26362,63 @@ ATOM`, x); * @param {number} x,y,z - the coordinates * @returns - index into flat array closest to provided coordinate; -1 if invalid */ - getIndex(m, y, w) { + getIndex(m, y, x) { if (this.matrix) { this.inversematrix == null && (this.inversematrix = new a.Matrix4().getInverse(this.matrix)); - var b = new a.Vector3(m, y, w); - b = b.applyMatrix4(this.inversematrix), m = b.x, y = b.y, w = b.z; + var b = new a.Vector3(m, y, x); + b = b.applyMatrix4(this.inversematrix), m = b.x, y = b.y, x = b.z; } else - m -= this.origin.x, y -= this.origin.y, w -= this.origin.z, m /= this.unit.x, y /= this.unit.y, w /= this.unit.z; - return m = Math.round(m), y = Math.round(y), w = Math.round(w), m < 0 || m >= this.size.x || y < 0 || y >= this.size.y || w < 0 || w >= this.size.z ? -1 : m * this.size.y * this.size.z + y * this.size.z + w; + m -= this.origin.x, y -= this.origin.y, x -= this.origin.z, m /= this.unit.x, y /= this.unit.y, x /= this.unit.z; + return m = Math.round(m), y = Math.round(y), x = Math.round(x), m < 0 || m >= this.size.x || y < 0 || y >= this.size.y || x < 0 || x >= this.size.z ? -1 : m * this.size.y * this.size.z + y * this.size.z + x; } /** * @function $3Dmol.VolumeData.getVal * @param {number} x,y,z - the coordinates * @returns - value closest to provided coordinate; zero if coordinate invalid */ - getVal(m, y, w) { - let b = this.getIndex(m, y, w); + getVal(m, y, x) { + let b = this.getIndex(m, y, x); return b < 0 ? 0 : this.data[b]; } // parse cube data cube(m) { var y = m.split(/\r?\n/); if (!(y.length < 6)) { - var w = (0, d.CUBE)(m, {}).modelData[0].cryst, b = y[2].replace(/^\s+/, "").replace(/\s+/g, " ").split(" "), A = parseFloat(b[0]), f = Math.abs(A); - this.origin = w.origin, this.size = w.size, this.unit = w.unit, this.matrix = w.matrix4; + var x = (0, h.CUBE)(m, {}).modelData[0].cryst, b = y[2].replace(/^\s+/, "").replace(/\s+/g, " ").split(" "), A = parseFloat(b[0]), f = Math.abs(A); + this.origin = x.origin, this.size = x.size, this.unit = x.unit, this.matrix = x.matrix4; var s = 6; A < 0 && s++; - var h = y.splice(f + s).join(" "); - h = h.replace(/^\s+/, ""); - var _ = h.split(/[\s\r]+/); - this.data = Float32Array.from(_, parseFloat); + var u = y.splice(f + s).join(" "); + u = u.replace(/^\s+/, ""); + var p = u.split(/[\s\r]+/); + this.data = Float32Array.from(p, parseFloat); } } //parse cp4 files ccp4(m) { var y = {}; m = new Int8Array(m); - var w = new Int32Array(m.buffer, 0, 56), b = new Float32Array(m.buffer, 0, 56), A = new DataView(m.buffer); + var x = new Int32Array(m.buffer, 0, 56), b = new Float32Array(m.buffer, 0, 56), A = new DataView(m.buffer); if (y.MAP = String.fromCharCode(A.getUint8(208), A.getUint8(209), A.getUint8(210), A.getUint8(211)), y.MACHST = [A.getUint8(212), A.getUint8(213)], y.MACHST[0] === 17 && y.MACHST[1] === 17) for (var f = m.byteLength, s = 0; s < f; s += 4) A.setFloat32(s, A.getFloat32(s), !0); - y.NX = w[0], y.NY = w[1], y.NZ = w[2], y.MODE = w[3], y.NXSTART = w[4], y.NYSTART = w[5], y.NZSTART = w[6], y.MX = w[7], y.MY = w[8], y.MZ = w[9], y.xlen = b[10], y.ylen = b[11], y.zlen = b[12], y.alpha = b[13], y.beta = b[14], y.gamma = b[15], y.MAPC = w[16], y.MAPR = w[17], y.MAPS = w[18], y.DMIN = b[19], y.DMAX = b[20], y.DMEAN = b[21], y.ISPG = w[22], y.NSYMBT = w[23], y.LSKFLG = w[24], y.originX = b[49], y.originY = b[50], y.originZ = b[51], y.ARMS = b[54]; - var h = y, _ = [ - h.xlen, + y.NX = x[0], y.NY = x[1], y.NZ = x[2], y.MODE = x[3], y.NXSTART = x[4], y.NYSTART = x[5], y.NZSTART = x[6], y.MX = x[7], y.MY = x[8], y.MZ = x[9], y.xlen = b[10], y.ylen = b[11], y.zlen = b[12], y.alpha = b[13], y.beta = b[14], y.gamma = b[15], y.MAPC = x[16], y.MAPR = x[17], y.MAPS = x[18], y.DMIN = b[19], y.DMAX = b[20], y.DMEAN = b[21], y.ISPG = x[22], y.NSYMBT = x[23], y.LSKFLG = x[24], y.originX = b[49], y.originY = b[50], y.originZ = b[51], y.ARMS = b[54]; + var u = y, p = [ + u.xlen, 0, 0 ], g = [ - h.ylen * Math.cos(Math.PI / 180 * h.gamma), - h.ylen * Math.sin(Math.PI / 180 * h.gamma), + u.ylen * Math.cos(Math.PI / 180 * u.gamma), + u.ylen * Math.sin(Math.PI / 180 * u.gamma), 0 - ], x = [ - h.zlen * Math.cos(Math.PI / 180 * h.beta), - h.zlen * (Math.cos(Math.PI / 180 * h.alpha) - Math.cos(Math.PI / 180 * h.gamma) * Math.cos(Math.PI / 180 * h.beta)) / Math.sin(Math.PI / 180 * h.gamma), + ], w = [ + u.zlen * Math.cos(Math.PI / 180 * u.beta), + u.zlen * (Math.cos(Math.PI / 180 * u.alpha) - Math.cos(Math.PI / 180 * u.gamma) * Math.cos(Math.PI / 180 * u.beta)) / Math.sin(Math.PI / 180 * u.gamma), 0 ]; - x[2] = Math.sqrt(h.zlen * h.zlen * Math.sin(Math.PI / 180 * h.beta) * Math.sin(Math.PI / 180 * h.beta) - x[1] * x[1]); - var c = [0, _, g, x], v = [0, h.MX, h.MY, h.MZ], M = [0, h.MAPC, h.MAPR, h.MAPS]; - this.matrix = new a.Matrix4(), this.matrix.set(c[M[1]][0] / v[M[1]], c[M[2]][0] / v[M[2]], c[M[3]][0] / v[M[3]], 0, c[M[1]][1] / v[M[1]], c[M[2]][1] / v[M[2]], c[M[3]][1] / v[M[3]], 0, c[M[1]][2] / v[M[1]], c[M[2]][2] / v[M[2]], c[M[3]][2] / v[M[3]], 0, 0, 0, 0, 1), this.matrix = this.matrix.multiplyMatrices(this.matrix, new a.Matrix4().makeTranslation(h.NXSTART + h.originX, h.NYSTART + h.originY, h.NZSTART + h.originZ)), this.origin = new a.Vector3(0, 0, 0), this.unit = new a.Vector3(1, 1, 1), this.size = { x: y.NX, y: y.NY, z: y.NZ }, this.dimensionorder = [y.MAPC, y.MAPR, y.MAPS]; + w[2] = Math.sqrt(u.zlen * u.zlen * Math.sin(Math.PI / 180 * u.beta) * Math.sin(Math.PI / 180 * u.beta) - w[1] * w[1]); + var o = [0, p, g, w], v = [0, u.MX, u.MY, u.MZ], M = [0, u.MAPC, u.MAPR, u.MAPS]; + this.matrix = new a.Matrix4(), this.matrix.set(o[M[1]][0] / v[M[1]], o[M[2]][0] / v[M[2]], o[M[3]][0] / v[M[3]], 0, o[M[1]][1] / v[M[1]], o[M[2]][1] / v[M[2]], o[M[3]][1] / v[M[3]], 0, o[M[1]][2] / v[M[1]], o[M[2]][2] / v[M[2]], o[M[3]][2] / v[M[3]], 0, 0, 0, 0, 1), this.matrix = this.matrix.multiplyMatrices(this.matrix, new a.Matrix4().makeTranslation(u.NXSTART + u.originX, u.NYSTART + u.originY, u.NZSTART + u.originZ)), this.origin = new a.Vector3(0, 0, 0), this.unit = new a.Vector3(1, 1, 1), this.size = { x: y.NX, y: y.NY, z: y.NZ }, this.dimensionorder = [y.MAPC, y.MAPR, y.MAPS]; var E = new Float32Array(m.buffer, 1024 + y.NSYMBT), $ = y.NX, k = y.NY, L = y.NZ; this.data = new Float32Array($ * k * L); for (let z = 0; z < $; z++) @@ -26440,7 +26440,7 @@ ATOM`, x); /* harmony export */ GLVolumetricRender: () => ( /* binding */ - u + d ) /* harmony export */ }); @@ -26453,27 +26453,27 @@ ATOM`, x); ), l = t( /*! ./WebGL */ "./src/WebGL/index.ts" - ), d = t( + ), h = t( /*! ./colors */ "./src/colors.ts" - ), o = t( + ), c = t( /*! ./GLShape */ "./src/GLShape.ts" ); - class u { + class d { static interpolateArray(m, y) { - function w(x, c, v) { - return x + (c - x) * v; + function x(w, o, v) { + return w + (o - w) * v; } var b = [], A = (m.length - 1) / (y - 1); b[0] = m[0]; for (var f = 1; f < y - 1; f++) { - var s = f * A, h = Math.floor(s), _ = Math.ceil(s), g = s - h; - b[f] = w(m[h], m[_], g); + var s = f * A, u = Math.floor(s), p = Math.ceil(s), g = s - u; + b[f] = x(m[u], m[p], g); } return b[y - 1] = m[m.length - 1], b; } - constructor(m, y, w) { + constructor(m, y, x) { this.hidden = !1, this.boundingSphere = new r.Sphere(), this.renderedShapeObj = null, this.shapeObj = null, this.subsamples = 5, this.data = null, this.transferfunctionbuffer = [], this.min = 0, this.max = 0, y = y || {}; var b = Object.assign([], y.transferfn); this.subsamples = y.subsamples || 5; @@ -26483,20 +26483,20 @@ ATOM`, x); }), b.sort(function(k, L) { return k.value - L.value; }), this.min = b[0].value, b.length == 0 && b.push(b[0]), this.max = b[b.length - 1].value; - var f, s, h, _, g, x, c, v, M, E; + var f, s, u, p, g, w, o, v, M, E; for (let k = 0; k < b.length - 1; k++) - if (h = d.CC.color(b[k].color), _ = d.CC.color(b[k + 1].color), M = b[k].opacity, E = b[k + 1].opacity, f = Math.floor((b[k].value - this.min) * A / (this.max - this.min)), s = Math.floor((b[k + 1].value - this.min) * A / (this.max - this.min)), f != s) { - g = u.interpolateArray([h.r * 255, _.r * 255], s - f), x = u.interpolateArray([h.g * 255, _.g * 255], s - f), c = u.interpolateArray([h.b * 255, _.b * 255], s - f), v = u.interpolateArray([M * 255, E * 255], s - f); + if (u = h.CC.color(b[k].color), p = h.CC.color(b[k + 1].color), M = b[k].opacity, E = b[k + 1].opacity, f = Math.floor((b[k].value - this.min) * A / (this.max - this.min)), s = Math.floor((b[k + 1].value - this.min) * A / (this.max - this.min)), f != s) { + g = d.interpolateArray([u.r * 255, p.r * 255], s - f), w = d.interpolateArray([u.g * 255, p.g * 255], s - f), o = d.interpolateArray([u.b * 255, p.b * 255], s - f), v = d.interpolateArray([M * 255, E * 255], s - f); for (let L = 0; L < g.length; L++) - this.transferfunctionbuffer.push(g[L]), this.transferfunctionbuffer.push(x[L]), this.transferfunctionbuffer.push(c[L]), this.transferfunctionbuffer.push(v[L]); + this.transferfunctionbuffer.push(g[L]), this.transferfunctionbuffer.push(w[L]), this.transferfunctionbuffer.push(o[L]), this.transferfunctionbuffer.push(v[L]); } if (this.transferfunctionbuffer = new Uint8ClampedArray(this.transferfunctionbuffer), m.matrix) { let k = new a.Vector3(0, 0, 0), L = new a.Vector3(m.size.x, m.size.y, m.size.z), z = new a.Vector3(1, 1, 1); k.applyMatrix4(m.matrix), L.applyMatrix4(m.matrix), z.applyMatrix4(m.matrix).sub(k), this.extent = [[k.x, k.y, k.z], [L.x, L.y, L.z]]; - for (let U = 1; U < 7; U++) - L.x = U & 1 ? m.size.x : 0, L.y = U & 2 ? m.size.y : 0, L.z = U & 4 ? m.size.z : 0, L.applyMatrix4(m.matrix), this.extent[0][0] = Math.min(this.extent[0][0], L.x), this.extent[0][1] = Math.min(this.extent[0][1], L.y), this.extent[0][2] = Math.min(this.extent[0][2], L.z), this.extent[1][0] = Math.max(this.extent[1][0], L.x), this.extent[1][1] = Math.max(this.extent[1][1], L.y), this.extent[1][2] = Math.max(this.extent[1][2], L.z); - let O = L.x - k.x, R = L.y - k.y, P = L.z - k.z; - this.maxdepth = Math.sqrt(O * O + R * R + P * P), this.minunit = Math.min(Math.min(z.x, z.y), z.z), this.texmatrix = new a.Matrix4().identity().scale({ x: m.size.x, y: m.size.y, z: m.size.z }), this.texmatrix = this.texmatrix.multiplyMatrices(m.matrix, this.texmatrix), this.texmatrix = this.texmatrix.getInverse(this.texmatrix); + for (let W = 1; W < 7; W++) + L.x = W & 1 ? m.size.x : 0, L.y = W & 2 ? m.size.y : 0, L.z = W & 4 ? m.size.z : 0, L.applyMatrix4(m.matrix), this.extent[0][0] = Math.min(this.extent[0][0], L.x), this.extent[0][1] = Math.min(this.extent[0][1], L.y), this.extent[0][2] = Math.min(this.extent[0][2], L.z), this.extent[1][0] = Math.max(this.extent[1][0], L.x), this.extent[1][1] = Math.max(this.extent[1][1], L.y), this.extent[1][2] = Math.max(this.extent[1][2], L.z); + let O = L.x - k.x, R = L.y - k.y, N = L.z - k.z; + this.maxdepth = Math.sqrt(O * O + R * R + N * N), this.minunit = Math.min(Math.min(z.x, z.y), z.z), this.texmatrix = new a.Matrix4().identity().scale({ x: m.size.x, y: m.size.y, z: m.size.z }), this.texmatrix = this.texmatrix.multiplyMatrices(m.matrix, this.texmatrix), this.texmatrix = this.texmatrix.getInverse(this.texmatrix); } else { this.texmatrix = new a.Matrix4().identity(); let k = m.unit.x * m.size.x, L = m.unit.y * m.size.y, z = m.unit.z * m.size.z; @@ -26505,7 +26505,7 @@ ATOM`, x); [m.origin.x + k, m.origin.y + L, m.origin.z + z] ], this.maxdepth = Math.sqrt(k * k + L * L + z * z); } - var $ = new o.GLShape({}); + var $ = new c.GLShape({}); if ($.addBox({ corner: { x: this.extent[0][0], y: this.extent[0][1], z: this.extent[0][2] }, dimensions: { @@ -26513,16 +26513,16 @@ ATOM`, x); h: this.extent[1][1] - this.extent[0][1], d: this.extent[1][2] - this.extent[0][2] } - }), this.geo = $.finalize(), this.boundingSphere.center = new a.Vector3((this.extent[0][0] + this.extent[1][0]) / 2, (this.extent[0][1] + this.extent[1][1]) / 2, (this.extent[0][2] + this.extent[1][2]) / 2), this.boundingSphere.radius = this.maxdepth / 2, y.coords === void 0 && y.selection !== void 0 && (w ? y.coords = w.selectedAtoms(y.selection) : console.log("Need to provide viewer to volumetric renderer if selection specified.")), y.coords !== void 0 && y.seldist !== void 0) { + }), this.geo = $.finalize(), this.boundingSphere.center = new a.Vector3((this.extent[0][0] + this.extent[1][0]) / 2, (this.extent[0][1] + this.extent[1][1]) / 2, (this.extent[0][2] + this.extent[1][2]) / 2), this.boundingSphere.radius = this.maxdepth / 2, y.coords === void 0 && y.selection !== void 0 && (x ? y.coords = x.selectedAtoms(y.selection) : console.log("Need to provide viewer to volumetric renderer if selection specified.")), y.coords !== void 0 && y.seldist !== void 0) { let k = new Uint8Array(m.data.length), L = y.seldist, z = L * L; for (let O = 0, R = y.coords.length; O < R; O++) { - let P = y.coords[O], U = P.x - L, B = P.y - L, N = P.z - L, G = P.x + L, H = P.y + L, W = P.z + L; - if (m.getIndex(U, B, N) >= 0 || m.getIndex(G, H, W) >= 0) - for (let V = U; V < G; V += this.minunit) + let N = y.coords[O], W = N.x - L, B = N.y - L, P = N.z - L, G = N.x + L, H = N.y + L, U = N.z + L; + if (m.getIndex(W, B, P) >= 0 || m.getIndex(G, H, U) >= 0) + for (let j = W; j < G; j += this.minunit) for (let re = B; re < H; re += this.minunit) - for (let ie = N; ie < W; ie += this.minunit) { - let ee = m.getIndex(V, re, ie); - ee >= 0 && !k[ee] && (V - P.x) * (V - P.x) + (re - P.y) * (re - P.y) + (ie - P.z) * (ie - P.z) < z && (k[ee] = 1); + for (let ie = P; ie < U; ie += this.minunit) { + let te = m.getIndex(j, re, ie); + te >= 0 && !k[te] && (j - N.x) * (j - N.x) + (re - N.y) * (re - N.y) + (ie - N.z) * (ie - N.z) < z && (k[te] = 1); } } for (let O = 0, R = m.data.length; O < R; O++) @@ -26538,12 +26538,12 @@ ATOM`, x); globj(m) { if (this.renderedShapeObj && (m.remove(this.renderedShapeObj), this.renderedShapeObj = null), !this.hidden) { this.shapeObj = new l.Object3D(); - var y = null, w = new l.Texture(this.data, !0), b = new l.Texture(this.transferfunctionbuffer, !1); - w.needsUpdate = !0, b.needsUpdate = !0, b.flipY = !1, y = new l.VolumetricMaterial({ + var y = null, x = new l.Texture(this.data, !0), b = new l.Texture(this.transferfunctionbuffer, !1); + x.needsUpdate = !0, b.needsUpdate = !0, b.flipY = !1, y = new l.VolumetricMaterial({ transferfn: b, transfermin: this.min, transfermax: this.max, - map: w, + map: x, extent: this.extent, maxdepth: this.maxdepth, texmatrix: this.texmatrix, @@ -26595,13 +26595,13 @@ ATOM`, x); "./src/WebGL/math/index.ts" ); class l extends r.Object3D { - constructor(o = 50, u = 1, p = 0.1, m = 2e3, y = !1) { - super(), this.projectionMatrix = new a.Matrix4(), this.projectionMatrixInverse = new a.Matrix4(), this.matrixWorldInverse = new a.Matrix4(), this.fov = o, this.aspect = u, this.near = p, this.far = m; - var w = this.position.z; - this.right = w * Math.tan(Math.PI / 180 * o), this.left = -this.right, this.top = this.right / this.aspect, this.bottom = -this.top, this.ortho = !!y, this.updateProjectionMatrix(); + constructor(c = 50, d = 1, _ = 0.1, m = 2e3, y = !1) { + super(), this.projectionMatrix = new a.Matrix4(), this.projectionMatrixInverse = new a.Matrix4(), this.matrixWorldInverse = new a.Matrix4(), this.fov = c, this.aspect = d, this.near = _, this.far = m; + var x = this.position.z; + this.right = x * Math.tan(Math.PI / 180 * c), this.left = -this.right, this.top = this.right / this.aspect, this.bottom = -this.top, this.ortho = !!y, this.updateProjectionMatrix(); } - lookAt(o) { - this.matrix.lookAt(this.position, o, this.up), this.rotationAutoUpdate && (this.useQuaternion === !1 && this.rotation instanceof a.Vector3 ? this.rotation.setEulerFromRotationMatrix(this.matrix, this.eulerOrder) : console.error("Unimplemented math operation.")); + lookAt(c) { + this.matrix.lookAt(this.position, c, this.up), this.rotationAutoUpdate && (this.useQuaternion === !1 && this.rotation instanceof a.Vector3 ? this.rotation.setEulerFromRotationMatrix(this.matrix, this.eulerOrder) : console.error("Unimplemented math operation.")); } updateProjectionMatrix() { this.ortho ? this.projectionMatrix.makeOrthographic(this.left, this.right, this.top, this.bottom, this.near, this.far) : this.projectionMatrix.makePerspective(this.fov, this.aspect, this.near, this.far), this.projectionMatrixInverse.getInverse(this.projectionMatrix); @@ -26629,8 +26629,8 @@ ATOM`, x); "./src/colors.ts" ); class a { - constructor(d, o = 1, u = 1e3) { - this.name = "", this.color = new r.Color(d), this.near = o, this.far = u; + constructor(h, c = 1, d = 1e3) { + this.name = "", this.color = new r.Color(h), this.near = c, this.far = d; } clone() { return new a(this.color.getHex(), this.near, this.far); @@ -26662,16 +26662,16 @@ ATOM`, x); ), l = t( /*! ./constants/TextureConstants */ "./src/WebGL/constants/TextureConstants.ts" - ), d = t( + ), h = t( /*! ./core */ "./src/WebGL/core/index.ts" - ), o = t( + ), c = t( /*! ../colors */ "./src/colors.ts" - ), u = t( + ), d = t( /*! ./materials */ "./src/WebGL/materials/index.ts" - ), p = t( + ), _ = t( /*! ./math */ "./src/WebGL/math/index.ts" ), m = t( @@ -26680,12 +26680,12 @@ ATOM`, x); ), y = t( /*! ./shaders */ "./src/WebGL/shaders/index.ts" - ), w = t( + ), x = t( /*! ./SpritePlugin */ "./src/WebGL/SpritePlugin.ts" ), b = null, A = null; class f { - constructor(h) { + constructor(u) { this.context = null, this.devicePixelRatio = 1, this.sortObjects = !0, this.autoUpdateObjects = !0, this.autoUpdateScene = !0, this.info = { memory: { programs: 0, @@ -26698,7 +26698,7 @@ ATOM`, x); faces: 0, points: 0 } - }, this._offscreen = null, this._bitmap = null, this._programs = [], this._programs_counter = 0, this._webglversion = 1, this._currentProgram = null, this._currentMaterialId = -1, this._currentGeometryGroupHash = null, this._currentCamera = null, this._geometryGroupCounter = 0, this._oldDoubleSided = -1, this._oldFlipSided = -1, this._oldDepthTest = -1, this._oldDepthWrite = -1, this._oldPolygonOffset = null, this._oldLineWidth = null, this._viewportWidth = 0, this._viewportHeight = 0, this._currentWidth = 0, this._currentHeight = 0, this._enabledAttributes = {}, this._vector3 = new p.Vector3(), this._worldInverse = new p.Matrix4(), this._projInverse = new p.Matrix4(), this._textureMatrix = new p.Matrix4(), this._fullProjModelMatrix = new p.Matrix4(), this._fullProjModelMatrixInv = new p.Matrix4(), this._direction = new p.Vector3(), this._lightsNeedUpdate = !0, this._lights = { + }, this._offscreen = null, this._bitmap = null, this._programs = [], this._programs_counter = 0, this._webglversion = 1, this._currentProgram = null, this._currentMaterialId = -1, this._currentGeometryGroupHash = null, this._currentCamera = null, this._geometryGroupCounter = 0, this._oldDoubleSided = -1, this._oldFlipSided = -1, this._oldDepthTest = -1, this._oldDepthWrite = -1, this._oldPolygonOffset = null, this._oldLineWidth = null, this._viewportWidth = 0, this._viewportHeight = 0, this._currentWidth = 0, this._currentHeight = 0, this._enabledAttributes = {}, this._vector3 = new _.Vector3(), this._worldInverse = new _.Matrix4(), this._projInverse = new _.Matrix4(), this._textureMatrix = new _.Matrix4(), this._fullProjModelMatrix = new _.Matrix4(), this._fullProjModelMatrixInv = new _.Matrix4(), this._direction = new _.Vector3(), this._lightsNeedUpdate = !0, this._lights = { ambient: [0, 0, 0], directional: { length: 0, @@ -26726,7 +26726,7 @@ ATOM`, x); groundColors: [], positions: [] } - }, this.sprites = new w.SpritePlugin(), this._screenshader = null, this._AOshader = null, this._blurshader = null, this._vertexattribpos = null, this._aovertexattribpos = null, this._blurvertexattribpos = null, this._screenQuadVBO = null, this._fb = null, this._targetTexture = null, this._depthTexture = null, this._shadingTexture = null, this._scratchTexture = null, this._AOstrength = 1, this._AOradius = 5, this.SHADE_TEXTURE = 3, h = h || {}, this.row = h.row, this.col = h.col, this.rows = h.rows, this.cols = h.cols, this._canvas = h.canvas !== void 0 ? h.canvas : document.createElement("canvas"), this._precision = h.precision !== void 0 ? h.precision : "highp", this._alpha = h.alpha !== void 0 ? h.alpha : !0, this._premultipliedAlpha = h.premultipliedAlpha !== void 0 ? h.premultipliedAlpha : !0, this._antialias = h.antialias !== void 0 ? h.antialias : !1, this._preserveDrawingBuffer = h.preserveDrawingBuffer !== void 0 ? h.preserveDrawingBuffer : !1, this._clearColor = h.clearColor !== void 0 ? new o.Color(h.clearColor) : new o.Color(0), this._clearAlpha = h.clearAlpha !== void 0 ? h.clearAlpha : 0, this._outlineMaterial = new u.MeshOutlineMaterial(h.outline), this._outlineSphereImposterMaterial = new u.SphereImposterOutlineMaterial(h.outline), this._outlineStickImposterMaterial = new u.StickImposterOutlineMaterial(h.outline), this._outlineEnabled = !!h.outline, this._AOEnabled = !!h.ambientOcclusion, h.ambientOcclusion && typeof h.ambientOcclusion.strength < "u" && (this._AOstrength = parseFloat(h.ambientOcclusion.strength)), this._AOstrength == 0 && (this._AOEnabled = !1), h.ambientOcclusion && typeof h.ambientOcclusion.radius < "u" && (this._AOradius = parseFloat(h.ambientOcclusion.radius)), this.domElement = this._canvas, this._canvas.id = h.id, !(h.containerWidth == 0 || h.containerHeight == 0) && (this.initGL(), this.setDefaultGLState(), this.context = this._gl, this.isWebGL1() ? this._extInstanced = this._gl.getExtension("ANGLE_instanced_arrays") : this._extInstanced = { + }, this.sprites = new x.SpritePlugin(), this._screenshader = null, this._AOshader = null, this._blurshader = null, this._vertexattribpos = null, this._aovertexattribpos = null, this._blurvertexattribpos = null, this._screenQuadVBO = null, this._fb = null, this._targetTexture = null, this._depthTexture = null, this._shadingTexture = null, this._scratchTexture = null, this._AOstrength = 1, this._AOradius = 5, this.SHADE_TEXTURE = 3, u = u || {}, this.row = u.row, this.col = u.col, this.rows = u.rows, this.cols = u.cols, this._canvas = u.canvas !== void 0 ? u.canvas : document.createElement("canvas"), this._precision = u.precision !== void 0 ? u.precision : "highp", this._alpha = u.alpha !== void 0 ? u.alpha : !0, this._premultipliedAlpha = u.premultipliedAlpha !== void 0 ? u.premultipliedAlpha : !0, this._antialias = u.antialias !== void 0 ? u.antialias : !1, this._preserveDrawingBuffer = u.preserveDrawingBuffer !== void 0 ? u.preserveDrawingBuffer : !1, this._clearColor = u.clearColor !== void 0 ? new c.Color(u.clearColor) : new c.Color(0), this._clearAlpha = u.clearAlpha !== void 0 ? u.clearAlpha : 0, this._outlineMaterial = new d.MeshOutlineMaterial(u.outline), this._outlineSphereImposterMaterial = new d.SphereImposterOutlineMaterial(u.outline), this._outlineStickImposterMaterial = new d.StickImposterOutlineMaterial(u.outline), this._outlineEnabled = !!u.outline, this._AOEnabled = !!u.ambientOcclusion, u.ambientOcclusion && typeof u.ambientOcclusion.strength < "u" && (this._AOstrength = parseFloat(u.ambientOcclusion.strength)), this._AOstrength == 0 && (this._AOEnabled = !1), u.ambientOcclusion && typeof u.ambientOcclusion.radius < "u" && (this._AOradius = parseFloat(u.ambientOcclusion.radius)), this.domElement = this._canvas, this._canvas.id = u.id, !(u.containerWidth == 0 || u.containerHeight == 0) && (this.initGL(), this.setDefaultGLState(), this.context = this._gl, this.isWebGL1() ? this._extInstanced = this._gl.getExtension("ANGLE_instanced_arrays") : this._extInstanced = { vertexAttribDivisorANGLE: this._gl.vertexAttribDivisor.bind(this._gl), drawElementsInstancedANGLE: this._gl.drawElementsInstanced.bind(this._gl) }, this._extFragDepth = this._gl.getExtension("EXT_frag_depth"), this._extFloatLinear = this._gl.getExtension("OES_texture_float_linear"), this._extColorBufferFloat = this._gl.getExtension("EXT_color_buffer_float"), this.sprites.init(this)); @@ -26751,85 +26751,85 @@ ATOM`, x); getPrecision() { return this._precision; } - setClearColorHex(h, _) { - this._clearColor.setHex(h), this._clearAlpha = _, this.isLost() || this._gl.clearColor(this._clearColor.r, this._clearColor.g, this._clearColor.b, this._clearAlpha); + setClearColorHex(u, p) { + this._clearColor.setHex(u), this._clearAlpha = p, this.isLost() || this._gl.clearColor(this._clearColor.r, this._clearColor.g, this._clearColor.b, this._clearAlpha); } - enableOutline(h) { - this._outlineMaterial = new u.MeshOutlineMaterial(h), this._outlineSphereImposterMaterial = new u.SphereImposterOutlineMaterial(h), this._outlineStickImposterMaterial = new u.StickImposterOutlineMaterial(h), this._outlineEnabled = !0; + enableOutline(u) { + this._outlineMaterial = new d.MeshOutlineMaterial(u), this._outlineSphereImposterMaterial = new d.SphereImposterOutlineMaterial(u), this._outlineStickImposterMaterial = new d.StickImposterOutlineMaterial(u), this._outlineEnabled = !0; } disableOutline() { this._outlineEnabled = !1; } - enableAmbientOcclusion(h) { - h && (h.strength && (this._AOstrength = h.strength), h.scale && (this._AOradius = h.scale)), this._AOEnabled = this._AOstrength > 0; + enableAmbientOcclusion(u) { + u && (u.strength && (this._AOstrength = u.strength), u.scale && (this._AOradius = u.scale)), this._AOEnabled = this._AOstrength > 0; } disableAmbientOcclusion() { this._AOEnabled = !1; } setViewport() { if (this._offscreen && (this._offscreen.width = this._canvas.width, this._offscreen.height = this._canvas.height), this.rows != null && this.cols != null && this.row != null && this.col != null) { - var h = this._canvas.width / this.cols, _ = this._canvas.height / this.rows; - this._viewportWidth = h, this._viewportHeight = _, this.isLost() || (this._gl.enable(this._gl.SCISSOR_TEST), this._gl.scissor(h * this.col, _ * this.row, h, _), this._gl.viewport(h * this.col, _ * this.row, h, _)); + var u = this._canvas.width / this.cols, p = this._canvas.height / this.rows; + this._viewportWidth = u, this._viewportHeight = p, this.isLost() || (this._gl.enable(this._gl.SCISSOR_TEST), this._gl.scissor(u * this.col, p * this.row, u, p), this._gl.viewport(u * this.col, p * this.row, u, p)); } } - setSize(h, _) { + setSize(u, p) { if (this.devicePixelRatio = window.devicePixelRatio !== void 0 ? window.devicePixelRatio : 1, this._antialias && this.devicePixelRatio < 2 && (this.devicePixelRatio *= 2), this.rows != null && this.cols != null && this.row != null && this.col != null) { - var g = h / this.cols, x = _ / this.rows; - this._canvas.width = h * this.devicePixelRatio, this._canvas.height = _ * this.devicePixelRatio, this._viewportWidth = g * this.devicePixelRatio, this._viewportHeight = x * this.devicePixelRatio, this._canvas.style.width = h + "px", this._canvas.style.height = _ + "px", this.setViewport(); + var g = u / this.cols, w = p / this.rows; + this._canvas.width = u * this.devicePixelRatio, this._canvas.height = p * this.devicePixelRatio, this._viewportWidth = g * this.devicePixelRatio, this._viewportHeight = w * this.devicePixelRatio, this._canvas.style.width = u + "px", this._canvas.style.height = p + "px", this.setViewport(); } else - this._viewportWidth = this._canvas.width = h * this.devicePixelRatio, this._viewportHeight = this._canvas.height = _ * this.devicePixelRatio, this._canvas.style.width = h + "px", this._canvas.style.height = _ + "px", this.isLost() || this._gl.viewport(0, 0, this._gl.drawingBufferWidth, this._gl.drawingBufferHeight); + this._viewportWidth = this._canvas.width = u * this.devicePixelRatio, this._viewportHeight = this._canvas.height = p * this.devicePixelRatio, this._canvas.style.width = u + "px", this._canvas.style.height = p + "px", this.isLost() || this._gl.viewport(0, 0, this._gl.drawingBufferWidth, this._gl.drawingBufferHeight); this.initFrameBuffer(); } - clear(h, _, g) { - var x = 0; - (h === void 0 || h) && (x |= this._gl.COLOR_BUFFER_BIT), (_ === void 0 || _) && (x |= this._gl.DEPTH_BUFFER_BIT), (g === void 0 || g) && (x |= this._gl.STENCIL_BUFFER_BIT), this._gl.clear(x); + clear(u, p, g) { + var w = 0; + (u === void 0 || u) && (w |= this._gl.COLOR_BUFFER_BIT), (p === void 0 || p) && (w |= this._gl.DEPTH_BUFFER_BIT), (g === void 0 || g) && (w |= this._gl.STENCIL_BUFFER_BIT), this._gl.clear(w); } - setMaterialFaces(h, _) { - var g = h.side === a.DoubleSide, x = h.side === a.BackSide; - h.imposter || (x = _ ? !x : x), this._oldDoubleSided !== g && (g ? this._gl.disable(this._gl.CULL_FACE) : this._gl.enable(this._gl.CULL_FACE), this._oldDoubleSided = g), this._oldFlipSided !== x && (x ? this._gl.frontFace(this._gl.CW) : this._gl.frontFace(this._gl.CCW), this._oldFlipSided = x), this._gl.cullFace(this._gl.BACK); + setMaterialFaces(u, p) { + var g = u.side === a.DoubleSide, w = u.side === a.BackSide; + u.imposter || (w = p ? !w : w), this._oldDoubleSided !== g && (g ? this._gl.disable(this._gl.CULL_FACE) : this._gl.enable(this._gl.CULL_FACE), this._oldDoubleSided = g), this._oldFlipSided !== w && (w ? this._gl.frontFace(this._gl.CW) : this._gl.frontFace(this._gl.CCW), this._oldFlipSided = w), this._gl.cullFace(this._gl.BACK); } - setDepthTest(h) { - this._oldDepthTest !== h && (h ? this._gl.enable(this._gl.DEPTH_TEST) : this._gl.disable(this._gl.DEPTH_TEST), this._oldDepthTest = h); + setDepthTest(u) { + this._oldDepthTest !== u && (u ? this._gl.enable(this._gl.DEPTH_TEST) : this._gl.disable(this._gl.DEPTH_TEST), this._oldDepthTest = u); } - setDepthWrite(h) { - this._oldDepthWrite !== h && (this._gl.depthMask(h), this._oldDepthWrite = h); + setDepthWrite(u) { + this._oldDepthWrite !== u && (this._gl.depthMask(u), this._oldDepthWrite = u); } - setBlending(h) { - h ? (this._gl.enable(this._gl.BLEND), this._gl.blendEquationSeparate(this._gl.FUNC_ADD, this._gl.FUNC_ADD), this._gl.blendFuncSeparate(this._gl.SRC_ALPHA, this._gl.ONE_MINUS_SRC_ALPHA, this._gl.ONE, this._gl.ONE_MINUS_SRC_ALPHA)) : this._gl.disable(this._gl.BLEND); + setBlending(u) { + u ? (this._gl.enable(this._gl.BLEND), this._gl.blendEquationSeparate(this._gl.FUNC_ADD, this._gl.FUNC_ADD), this._gl.blendFuncSeparate(this._gl.SRC_ALPHA, this._gl.ONE_MINUS_SRC_ALPHA, this._gl.ONE, this._gl.ONE_MINUS_SRC_ALPHA)) : this._gl.disable(this._gl.BLEND); } // TODO: need to set up shader attributes and uniforms as attributes on // material object after attaching prgm // We need to attach appropriate uniform variables to material after shaders // have been chosen - initMaterial(h, _, g, x) { - h.addEventListener("dispose", this.onMaterialDispose.bind(this)); - var c, v; - if (v = h.shaderID, v) { + initMaterial(u, p, g, w) { + u.addEventListener("dispose", this.onMaterialDispose.bind(this)); + var o, v; + if (v = u.shaderID, v) { var M = y.ShaderLib[v]; - h.vertexShader = M.vertexShader, h.fragmentShader = M.fragmentShader, h.uniforms = y.ShaderUtils.clone(M.uniforms), h.shaded && h.makeShaded(this.SHADE_TEXTURE); + u.vertexShader = M.vertexShader, u.fragmentShader = M.fragmentShader, u.uniforms = y.ShaderUtils.clone(M.uniforms), u.shaded && u.makeShaded(this.SHADE_TEXTURE); } - c = { - wireframe: h.wireframe, - fragdepth: h.imposter, - volumetric: h.volumetric, - shaded: h.shaded - }, h.program = this.buildProgram(h.fragmentShader, h.vertexShader, h.uniforms, c); + o = { + wireframe: u.wireframe, + fragdepth: u.imposter, + volumetric: u.volumetric, + shaded: u.shaded + }, u.program = this.buildProgram(u.fragmentShader, u.vertexShader, u.uniforms, o); } - renderBuffer(h, _, g, x, c, v) { - if (x.visible) { + renderBuffer(u, p, g, w, o, v) { + if (w.visible) { var M, E; - if (M = this.setProgram(h, _, g, x, v, this), !!M) { + if (M = this.setProgram(u, p, g, w, v, this), !!M) { E = M.attributes; - var $ = !1, k = x.wireframe ? 1 : 0, L = c.id * 16777215 + M.id * 2 + k; - L !== this._currentGeometryGroupHash && (this._currentGeometryGroupHash = L, $ = !0), $ && (this.disableAttributes(), E.position >= 0 && (this._gl.bindBuffer(this._gl.ARRAY_BUFFER, c.__webglVertexBuffer), this.enableAttribute(E.position), this._gl.vertexAttribPointer(E.position, 3, this._gl.FLOAT, !1, 0, 0)), E.color >= 0 && (this._gl.bindBuffer(this._gl.ARRAY_BUFFER, c.__webglColorBuffer), this.enableAttribute(E.color), this._gl.vertexAttribPointer(E.color, 3, this._gl.FLOAT, !1, 0, 0)), E.normal >= 0 && (this._gl.bindBuffer(this._gl.ARRAY_BUFFER, c.__webglNormalBuffer), this.enableAttribute(E.normal), this._gl.vertexAttribPointer(E.normal, 3, this._gl.FLOAT, !1, 0, 0)), E.offset >= 0 && (this._gl.bindBuffer(this._gl.ARRAY_BUFFER, c.__webglOffsetBuffer), this.enableAttribute(E.offset), this._gl.vertexAttribPointer(E.offset, 3, this._gl.FLOAT, !1, 0, 0)), E.radius >= 0 && (this._gl.bindBuffer(this._gl.ARRAY_BUFFER, c.__webglRadiusBuffer), this.enableAttribute(E.radius), this._gl.vertexAttribPointer(E.radius, 1, this._gl.FLOAT, !1, 0, 0))); + var $ = !1, k = w.wireframe ? 1 : 0, L = o.id * 16777215 + M.id * 2 + k; + L !== this._currentGeometryGroupHash && (this._currentGeometryGroupHash = L, $ = !0), $ && (this.disableAttributes(), E.position >= 0 && (this._gl.bindBuffer(this._gl.ARRAY_BUFFER, o.__webglVertexBuffer), this.enableAttribute(E.position), this._gl.vertexAttribPointer(E.position, 3, this._gl.FLOAT, !1, 0, 0)), E.color >= 0 && (this._gl.bindBuffer(this._gl.ARRAY_BUFFER, o.__webglColorBuffer), this.enableAttribute(E.color), this._gl.vertexAttribPointer(E.color, 3, this._gl.FLOAT, !1, 0, 0)), E.normal >= 0 && (this._gl.bindBuffer(this._gl.ARRAY_BUFFER, o.__webglNormalBuffer), this.enableAttribute(E.normal), this._gl.vertexAttribPointer(E.normal, 3, this._gl.FLOAT, !1, 0, 0)), E.offset >= 0 && (this._gl.bindBuffer(this._gl.ARRAY_BUFFER, o.__webglOffsetBuffer), this.enableAttribute(E.offset), this._gl.vertexAttribPointer(E.offset, 3, this._gl.FLOAT, !1, 0, 0)), E.radius >= 0 && (this._gl.bindBuffer(this._gl.ARRAY_BUFFER, o.__webglRadiusBuffer), this.enableAttribute(E.radius), this._gl.vertexAttribPointer(E.radius, 1, this._gl.FLOAT, !1, 0, 0))); var z, O; if (v instanceof m.Mesh) { - if (x.shaderID === "instanced") { - var R = x.sphere.geometryGroups[0]; - $ && (this._gl.bindBuffer(this._gl.ARRAY_BUFFER, c.__webglVertexBuffer), this._gl.bufferData(this._gl.ARRAY_BUFFER, R.vertexArray, this._gl.STATIC_DRAW), this._gl.bindBuffer(this._gl.ARRAY_BUFFER, c.__webglNormalBuffer), this._gl.bufferData(this._gl.ARRAY_BUFFER, R.normalArray, this._gl.STATIC_DRAW), this._gl.bindBuffer(this._gl.ELEMENT_ARRAY_BUFFER, c.__webglFaceBuffer), this._gl.bufferData(this._gl.ELEMENT_ARRAY_BUFFER, R.faceArray, this._gl.STATIC_DRAW)), z = R.faceidx, this._extInstanced.vertexAttribDivisorANGLE(E.offset, 1), this._extInstanced.vertexAttribDivisorANGLE(E.radius, 1), this._extInstanced.vertexAttribDivisorANGLE(E.color, 1), this._extInstanced.drawElementsInstancedANGLE(this._gl.TRIANGLES, z, this._gl.UNSIGNED_SHORT, 0, c.radiusArray.length), this._extInstanced.vertexAttribDivisorANGLE(E.offset, 0), this._extInstanced.vertexAttribDivisorANGLE(E.radius, 0), this._extInstanced.vertexAttribDivisorANGLE(E.color, 0); - } else x.wireframe ? (O = c.lineidx, this.setLineWidth(x.wireframeLinewidth), $ && this._gl.bindBuffer(this._gl.ELEMENT_ARRAY_BUFFER, c.__webglLineBuffer), this._gl.drawElements(this._gl.LINES, O, this._gl.UNSIGNED_SHORT, 0)) : (z = c.faceidx, $ && this._gl.bindBuffer(this._gl.ELEMENT_ARRAY_BUFFER, c.__webglFaceBuffer), this._gl.drawElements(this._gl.TRIANGLES, z, this._gl.UNSIGNED_SHORT, 0)); + if (w.shaderID === "instanced") { + var R = w.sphere.geometryGroups[0]; + $ && (this._gl.bindBuffer(this._gl.ARRAY_BUFFER, o.__webglVertexBuffer), this._gl.bufferData(this._gl.ARRAY_BUFFER, R.vertexArray, this._gl.STATIC_DRAW), this._gl.bindBuffer(this._gl.ARRAY_BUFFER, o.__webglNormalBuffer), this._gl.bufferData(this._gl.ARRAY_BUFFER, R.normalArray, this._gl.STATIC_DRAW), this._gl.bindBuffer(this._gl.ELEMENT_ARRAY_BUFFER, o.__webglFaceBuffer), this._gl.bufferData(this._gl.ELEMENT_ARRAY_BUFFER, R.faceArray, this._gl.STATIC_DRAW)), z = R.faceidx, this._extInstanced.vertexAttribDivisorANGLE(E.offset, 1), this._extInstanced.vertexAttribDivisorANGLE(E.radius, 1), this._extInstanced.vertexAttribDivisorANGLE(E.color, 1), this._extInstanced.drawElementsInstancedANGLE(this._gl.TRIANGLES, z, this._gl.UNSIGNED_SHORT, 0, o.radiusArray.length), this._extInstanced.vertexAttribDivisorANGLE(E.offset, 0), this._extInstanced.vertexAttribDivisorANGLE(E.radius, 0), this._extInstanced.vertexAttribDivisorANGLE(E.color, 0); + } else w.wireframe ? (O = o.lineidx, this.setLineWidth(w.wireframeLinewidth), $ && this._gl.bindBuffer(this._gl.ELEMENT_ARRAY_BUFFER, o.__webglLineBuffer), this._gl.drawElements(this._gl.LINES, O, this._gl.UNSIGNED_SHORT, 0)) : (z = o.faceidx, $ && this._gl.bindBuffer(this._gl.ELEMENT_ARRAY_BUFFER, o.__webglFaceBuffer), this._gl.drawElements(this._gl.TRIANGLES, z, this._gl.UNSIGNED_SHORT, 0)); this.info.render.calls++, this.info.render.vertices += z, this.info.render.faces += z / 3; - } else v instanceof m.Line && (O = c.vertices, this.setLineWidth(x.linewidth), this._gl.drawArrays(this._gl.LINES, 0, O), this.info.render.calls++); + } else v instanceof m.Line && (O = o.vertices, this.setLineWidth(w.linewidth), this._gl.drawArrays(this._gl.LINES, 0, O), this.info.render.calls++); } } } @@ -26839,10 +26839,10 @@ ATOM`, x); } /* Setup the shading buffer to reflect desired shading (ambient occlusion) values. Only the matching object with materialType are considered. */ - setShading(h, _, g) { - let x = h.__lights, c = h.fog, v = []; - for (let $ = 0, k = h.__webglObjects.length; $ < k; $++) { - let L = h.__webglObjects[$]; + setShading(u, p, g) { + let w = u.__lights, o = u.fog, v = []; + for (let $ = 0, k = u.__webglObjects.length; $ < k; $++) { + let L = u.__webglObjects[$]; L.render && L[g] && v.push(L); } if (v.length == 0) @@ -26854,25 +26854,25 @@ ATOM`, x); null, //don't write colors (can we do this?) 0 - ), this.renderObjects(h.__webglObjects, !0, g + "Depth", _, x, c, !1), this._gl.framebufferTexture2D(this._gl.FRAMEBUFFER, this._gl.DEPTH_ATTACHMENT, this._gl.TEXTURE_2D, this._scratchTexture, 0), this.clear(!1, !0, !1), this._gl.useProgram(this._AOshader), this._currentProgram = this._AOshader, this.setDepthTest(-1), this.setDepthWrite(-1); + ), this.renderObjects(u.__webglObjects, !0, g + "Depth", p, w, o, !1), this._gl.framebufferTexture2D(this._gl.FRAMEBUFFER, this._gl.DEPTH_ATTACHMENT, this._gl.TEXTURE_2D, this._scratchTexture, 0), this.clear(!1, !0, !1), this._gl.useProgram(this._AOshader), this._currentProgram = this._AOshader, this.setDepthTest(-1), this.setDepthWrite(-1); let M = this._AOshader.uniforms; - this._gl.uniform1f(M.total_strength, this._AOstrength), this._gl.uniform1f(M.radius, this._AOradius), this._fullProjModelMatrix = new p.Matrix4(), this._fullProjModelMatrixInv = new p.Matrix4(); + this._gl.uniform1f(M.total_strength, this._AOstrength), this._gl.uniform1f(M.radius, this._AOradius), this._fullProjModelMatrix = new _.Matrix4(), this._fullProjModelMatrixInv = new _.Matrix4(); let E = v[0].object; - this._fullProjModelMatrix.multiplyMatrices(_.projectionMatrix, E._modelViewMatrix), this._fullProjModelMatrixInv.getInverse(this._fullProjModelMatrix), this._gl.uniformMatrix4fv(M.projectionMatrix, !1, this._fullProjModelMatrix.elements), this._gl.uniformMatrix4fv(M.projinv, !1, this._fullProjModelMatrixInv.elements), this._gl.bindBuffer(this._gl.ARRAY_BUFFER, this._screenQuadVBO), this._gl.enableVertexAttribArray(this._aovertexattribpos), this._gl.vertexAttribPointer(this._aovertexattribpos, 2, this._gl.FLOAT, !1, 0, 0), this._gl.activeTexture(this._gl.TEXTURE0), this._gl.bindTexture(this._gl.TEXTURE_2D, this._shadingTexture), this._gl.drawArrays(this._gl.TRIANGLES, 0, 6), this._gl.framebufferTexture2D(this._gl.FRAMEBUFFER, this._gl.DEPTH_ATTACHMENT, this._gl.TEXTURE_2D, this._shadingTexture, 0), this.clear(!1, !0, !1), this._gl.useProgram(this._blurshader), this._currentProgram = this._blurshader, this.setDepthTest(-1), this.setDepthWrite(-1), this._gl.bindBuffer(this._gl.ARRAY_BUFFER, this._screenQuadVBO), this._gl.enableVertexAttribArray(this._blurvertexattribpos), this._gl.vertexAttribPointer(this._blurvertexattribpos, 2, this._gl.FLOAT, !1, 0, 0), this._gl.activeTexture(this._gl.TEXTURE0), this._gl.bindTexture(this._gl.TEXTURE_2D, this._scratchTexture), this._gl.drawArrays(this._gl.TRIANGLES, 0, 6), this._gl.framebufferTexture2D(this._gl.FRAMEBUFFER, this._gl.COLOR_ATTACHMENT0, this._gl.TEXTURE_2D, this._targetTexture, 0), this._gl.framebufferTexture2D(this._gl.FRAMEBUFFER, this._gl.DEPTH_ATTACHMENT, this._gl.TEXTURE_2D, this._depthTexture, 0); + this._fullProjModelMatrix.multiplyMatrices(p.projectionMatrix, E._modelViewMatrix), this._fullProjModelMatrixInv.getInverse(this._fullProjModelMatrix), this._gl.uniformMatrix4fv(M.projectionMatrix, !1, this._fullProjModelMatrix.elements), this._gl.uniformMatrix4fv(M.projinv, !1, this._fullProjModelMatrixInv.elements), this._gl.bindBuffer(this._gl.ARRAY_BUFFER, this._screenQuadVBO), this._gl.enableVertexAttribArray(this._aovertexattribpos), this._gl.vertexAttribPointer(this._aovertexattribpos, 2, this._gl.FLOAT, !1, 0, 0), this._gl.activeTexture(this._gl.TEXTURE0), this._gl.bindTexture(this._gl.TEXTURE_2D, this._shadingTexture), this._gl.drawArrays(this._gl.TRIANGLES, 0, 6), this._gl.framebufferTexture2D(this._gl.FRAMEBUFFER, this._gl.DEPTH_ATTACHMENT, this._gl.TEXTURE_2D, this._shadingTexture, 0), this.clear(!1, !0, !1), this._gl.useProgram(this._blurshader), this._currentProgram = this._blurshader, this.setDepthTest(-1), this.setDepthWrite(-1), this._gl.bindBuffer(this._gl.ARRAY_BUFFER, this._screenQuadVBO), this._gl.enableVertexAttribArray(this._blurvertexattribpos), this._gl.vertexAttribPointer(this._blurvertexattribpos, 2, this._gl.FLOAT, !1, 0, 0), this._gl.activeTexture(this._gl.TEXTURE0), this._gl.bindTexture(this._gl.TEXTURE_2D, this._scratchTexture), this._gl.drawArrays(this._gl.TRIANGLES, 0, 6), this._gl.framebufferTexture2D(this._gl.FRAMEBUFFER, this._gl.COLOR_ATTACHMENT0, this._gl.TEXTURE_2D, this._targetTexture, 0), this._gl.framebufferTexture2D(this._gl.FRAMEBUFFER, this._gl.DEPTH_ATTACHMENT, this._gl.TEXTURE_2D, this._depthTexture, 0); } - render(h, _) { - if (!(_ instanceof r.Camera)) { + render(u, p) { + if (!(p instanceof r.Camera)) { console.error("Renderer.render: camera is not an instance of Camera."); return; } - var g, x, c, v, M, E = h.__lights, $ = h.fog; - if (this._currentMaterialId = -1, this._lightsNeedUpdate = !0, this.autoUpdateScene && h.updateMatrixWorld(), _.parent === void 0 && _.updateMatrixWorld(), _.matrixWorldInverse.getInverse(_.matrixWorld), this.isLost()) + var g, w, o, v, M, E = u.__lights, $ = u.fog; + if (this._currentMaterialId = -1, this._lightsNeedUpdate = !0, this.autoUpdateScene && u.updateMatrixWorld(), p.parent === void 0 && p.updateMatrixWorld(), p.matrixWorldInverse.getInverse(p.matrixWorld), this.isLost()) return; - this.autoUpdateObjects && this.initWebGLObjects(h), this.info.render.calls = 0, this.info.render.vertices = 0, this.info.render.faces = 0, this.info.render.points = 0, this._currentWidth = this._viewportWidth, this._currentHeight = this._viewportHeight, this.setViewport(), this.setFrameBuffer(), this._gl.clearColor(this._clearColor.r, this._clearColor.g, this._clearColor.b, this._clearAlpha), this.clear(!0, !0, !0), M = h.__webglObjects; + this.autoUpdateObjects && this.initWebGLObjects(u), this.info.render.calls = 0, this.info.render.vertices = 0, this.info.render.faces = 0, this.info.render.points = 0, this._currentWidth = this._viewportWidth, this._currentHeight = this._viewportHeight, this.setViewport(), this.setFrameBuffer(), this._gl.clearColor(this._clearColor.r, this._clearColor.g, this._clearColor.b, this._clearAlpha), this.clear(!0, !0, !0), M = u.__webglObjects; let k = !1, L = this._AOEnabled; - for (g = 0, x = M.length; g < x; g++) - c = M[g], v = c.object, c.render = !1, v.visible && (this.setupMatrices(v, _), this.unrollBufferMaterial(c), c.render = !0, c.volumetric && (k = !0), c.hasAO && (L = !0)); - if (this.setBlending(!1), L && this.setShading(h, _, "opaque"), this.renderObjects(h.__webglObjects, !0, "opaque", _, E, $, !1), L && this.clearShading(), this.renderSprites(h, _, !1), this.renderObjects(h.__webglObjects, !0, "transparentDepth", _, E, $, !0), this.renderObjects(h.__webglObjects, !1, "transparent", _, E, $, !0), k && this._fb && (this._gl.framebufferTexture2D(this._gl.FRAMEBUFFER, this._gl.DEPTH_ATTACHMENT, this._gl.TEXTURE_2D, null, 0), this.renderObjects(h.__webglObjects, !1, "volumetric", _, E, $, !0)), this.renderFrameBuffertoScreen(), this.setDepthTest(!0), this.setDepthWrite(!0), this.renderSprites(h, _, !0), this._bitmap) { + for (g = 0, w = M.length; g < w; g++) + o = M[g], v = o.object, o.render = !1, v.visible && (this.setupMatrices(v, p), this.unrollBufferMaterial(o), o.render = !0, o.volumetric && (k = !0), o.hasAO && (L = !0)); + if (this.setBlending(!1), L && this.setShading(u, p, "opaque"), this.renderObjects(u.__webglObjects, !0, "opaque", p, E, $, !1), L && this.clearShading(), this.renderSprites(u, p, !1), this.renderObjects(u.__webglObjects, !0, "transparentDepth", p, E, $, !0), this.renderObjects(u.__webglObjects, !1, "transparent", p, E, $, !0), k && this._fb && (this._gl.framebufferTexture2D(this._gl.FRAMEBUFFER, this._gl.DEPTH_ATTACHMENT, this._gl.TEXTURE_2D, null, 0), this.renderObjects(u.__webglObjects, !1, "volumetric", p, E, $, !0)), this.renderFrameBuffertoScreen(), this.setDepthTest(!0), this.setDepthWrite(!0), this.renderSprites(u, p, !0), this._bitmap) { const z = this._offscreen.transferToImageBitmap(); this._bitmap.transferFromImageBitmap(z); } @@ -26881,18 +26881,18 @@ ATOM`, x); setFrameBuffer() { if (this.isWebGL1() || !this._fb) return; - let h = this._viewportWidth, _ = this._viewportHeight; - this._gl.enable(this._gl.SCISSOR_TEST), this._gl.scissor(0, 0, h, _), this._gl.viewport(0, 0, h, _), this._gl.bindTexture(this._gl.TEXTURE_2D, this._targetTexture), this._gl.texImage2D(this._gl.TEXTURE_2D, 0, this._gl.RGBA, h, _, 0, this._gl.RGBA, this._gl.UNSIGNED_BYTE, null), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_MIN_FILTER, this._gl.LINEAR), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_MAG_FILTER, this._gl.LINEAR), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_S, this._gl.CLAMP_TO_EDGE), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_T, this._gl.CLAMP_TO_EDGE), this._gl.bindTexture(this._gl.TEXTURE_2D, this._depthTexture), this._gl.texImage2D(this._gl.TEXTURE_2D, 0, this._gl.DEPTH_COMPONENT32F, h, _, 0, this._gl.DEPTH_COMPONENT, this._gl.FLOAT, null), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_MIN_FILTER, this._gl.NEAREST), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_MAG_FILTER, this._gl.NEAREST), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_S, this._gl.CLAMP_TO_EDGE), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_T, this._gl.CLAMP_TO_EDGE), this._shadingTexture && (this._gl.deleteTexture(this._shadingTexture), this._shadingTexture = this._gl.createTexture(), this._gl.bindTexture(this._gl.TEXTURE_2D, this._shadingTexture), this._gl.texImage2D(this._gl.TEXTURE_2D, 0, this._gl.DEPTH_COMPONENT32F, h, _, 0, this._gl.DEPTH_COMPONENT, this._gl.FLOAT, null), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_MIN_FILTER, this._gl.NEAREST), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_MAG_FILTER, this._gl.NEAREST), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_S, this._gl.CLAMP_TO_EDGE), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_T, this._gl.CLAMP_TO_EDGE), this._gl.deleteTexture(this._scratchTexture), this._scratchTexture = this._gl.createTexture(), this._gl.bindTexture(this._gl.TEXTURE_2D, this._scratchTexture), this._gl.texImage2D(this._gl.TEXTURE_2D, 0, this._gl.DEPTH_COMPONENT32F, h, _, 0, this._gl.DEPTH_COMPONENT, this._gl.FLOAT, null), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_MIN_FILTER, this._gl.NEAREST), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_MAG_FILTER, this._gl.NEAREST), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_S, this._gl.CLAMP_TO_EDGE), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_T, this._gl.CLAMP_TO_EDGE)), this._gl.bindFramebuffer(this._gl.FRAMEBUFFER, this._fb), this._gl.framebufferTexture2D(this._gl.FRAMEBUFFER, this._gl.COLOR_ATTACHMENT0, this._gl.TEXTURE_2D, this._targetTexture, 0), this._gl.framebufferTexture2D(this._gl.FRAMEBUFFER, this._gl.DEPTH_ATTACHMENT, this._gl.TEXTURE_2D, this._shadingTexture, 0), this._gl.clearDepth(1), this._gl.clear(this._gl.DEPTH_BUFFER_BIT), this._gl.framebufferTexture2D(this._gl.FRAMEBUFFER, this._gl.DEPTH_ATTACHMENT, this._gl.TEXTURE_2D, this._depthTexture, 0); + let u = this._viewportWidth, p = this._viewportHeight; + this._gl.enable(this._gl.SCISSOR_TEST), this._gl.scissor(0, 0, u, p), this._gl.viewport(0, 0, u, p), this._gl.bindTexture(this._gl.TEXTURE_2D, this._targetTexture), this._gl.texImage2D(this._gl.TEXTURE_2D, 0, this._gl.RGBA, u, p, 0, this._gl.RGBA, this._gl.UNSIGNED_BYTE, null), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_MIN_FILTER, this._gl.LINEAR), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_MAG_FILTER, this._gl.LINEAR), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_S, this._gl.CLAMP_TO_EDGE), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_T, this._gl.CLAMP_TO_EDGE), this._gl.bindTexture(this._gl.TEXTURE_2D, this._depthTexture), this._gl.texImage2D(this._gl.TEXTURE_2D, 0, this._gl.DEPTH_COMPONENT32F, u, p, 0, this._gl.DEPTH_COMPONENT, this._gl.FLOAT, null), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_MIN_FILTER, this._gl.NEAREST), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_MAG_FILTER, this._gl.NEAREST), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_S, this._gl.CLAMP_TO_EDGE), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_T, this._gl.CLAMP_TO_EDGE), this._shadingTexture && (this._gl.deleteTexture(this._shadingTexture), this._shadingTexture = this._gl.createTexture(), this._gl.bindTexture(this._gl.TEXTURE_2D, this._shadingTexture), this._gl.texImage2D(this._gl.TEXTURE_2D, 0, this._gl.DEPTH_COMPONENT32F, u, p, 0, this._gl.DEPTH_COMPONENT, this._gl.FLOAT, null), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_MIN_FILTER, this._gl.NEAREST), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_MAG_FILTER, this._gl.NEAREST), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_S, this._gl.CLAMP_TO_EDGE), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_T, this._gl.CLAMP_TO_EDGE), this._gl.deleteTexture(this._scratchTexture), this._scratchTexture = this._gl.createTexture(), this._gl.bindTexture(this._gl.TEXTURE_2D, this._scratchTexture), this._gl.texImage2D(this._gl.TEXTURE_2D, 0, this._gl.DEPTH_COMPONENT32F, u, p, 0, this._gl.DEPTH_COMPONENT, this._gl.FLOAT, null), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_MIN_FILTER, this._gl.NEAREST), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_MAG_FILTER, this._gl.NEAREST), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_S, this._gl.CLAMP_TO_EDGE), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_T, this._gl.CLAMP_TO_EDGE)), this._gl.bindFramebuffer(this._gl.FRAMEBUFFER, this._fb), this._gl.framebufferTexture2D(this._gl.FRAMEBUFFER, this._gl.COLOR_ATTACHMENT0, this._gl.TEXTURE_2D, this._targetTexture, 0), this._gl.framebufferTexture2D(this._gl.FRAMEBUFFER, this._gl.DEPTH_ATTACHMENT, this._gl.TEXTURE_2D, this._shadingTexture, 0), this._gl.clearDepth(1), this._gl.clear(this._gl.DEPTH_BUFFER_BIT), this._gl.framebufferTexture2D(this._gl.FRAMEBUFFER, this._gl.DEPTH_ATTACHMENT, this._gl.TEXTURE_2D, this._depthTexture, 0); } //allocate buffers for framebuffer, needs to be called with every resize initFrameBuffer() { if (this.isWebGL1()) return; - let h = this._viewportWidth, _ = this._viewportHeight; - this._gl.enable(this._gl.SCISSOR_TEST), this._gl.scissor(0, 0, h, _), this._gl.viewport(0, 0, h, _), this._targetTexture = this._gl.createTexture(), this._depthTexture = this._gl.createTexture(), this._shadingTexture = this._gl.createTexture(), this._scratchTexture = this._gl.createTexture(), this._fb = this._gl.createFramebuffer(); + let u = this._viewportWidth, p = this._viewportHeight; + this._gl.enable(this._gl.SCISSOR_TEST), this._gl.scissor(0, 0, u, p), this._gl.viewport(0, 0, u, p), this._targetTexture = this._gl.createTexture(), this._depthTexture = this._gl.createTexture(), this._shadingTexture = this._gl.createTexture(), this._scratchTexture = this._gl.createTexture(), this._fb = this._gl.createFramebuffer(); var g = this._antialias ? y.ShaderLib.screenaa : y.ShaderLib.screen; this._screenshader = this.buildProgram(g.fragmentShader, g.vertexShader, g.uniforms, {}), this._vertexattribpos = this._gl.getAttribLocation(this._screenshader, "vertexPosition"); - var x = [ + var w = [ // First triangle: 1, 1, @@ -26908,25 +26908,25 @@ ATOM`, x); 1, 1 ]; - this._screenQuadVBO = this._gl.createBuffer(), this._gl.bindBuffer(this._gl.ARRAY_BUFFER, this._screenQuadVBO), this._gl.bufferData(this._gl.ARRAY_BUFFER, new Float32Array(x), this._gl.STATIC_DRAW); - let c = y.ShaderLib.ssao; - this._AOshader = this.buildProgram(c.fragmentShader, c.vertexShader, c.uniforms, {}), this._aovertexattribpos = this._gl.getAttribLocation(this._AOshader, "vertexPosition"); + this._screenQuadVBO = this._gl.createBuffer(), this._gl.bindBuffer(this._gl.ARRAY_BUFFER, this._screenQuadVBO), this._gl.bufferData(this._gl.ARRAY_BUFFER, new Float32Array(w), this._gl.STATIC_DRAW); + let o = y.ShaderLib.ssao; + this._AOshader = this.buildProgram(o.fragmentShader, o.vertexShader, o.uniforms, {}), this._aovertexattribpos = this._gl.getAttribLocation(this._AOshader, "vertexPosition"); let v = y.ShaderLib.blur; this._blurshader = this.buildProgram(v.fragmentShader, v.vertexShader, v.uniforms, {}), this._blurvertexattribpos = this._gl.getAttribLocation(this._blurshader, "vertexPosition"); } renderFrameBuffertoScreen() { this.isWebGL1() || this._fb === null || (this.setViewport(), this._gl.bindFramebuffer(this._gl.FRAMEBUFFER, null), this._gl.clear(this._gl.COLOR_BUFFER_BIT | this._gl.DEPTH_BUFFER_BIT), this._gl.frontFace(this._gl.CCW), this._gl.cullFace(this._gl.BACK), this._gl.useProgram(this._screenshader), this._currentProgram = this._screenshader, this.setDepthTest(-1), this.setDepthWrite(-1), this._gl.bindBuffer(this._gl.ARRAY_BUFFER, this._screenQuadVBO), this._gl.enableVertexAttribArray(this._vertexattribpos), this._gl.vertexAttribPointer(this._vertexattribpos, 2, this._gl.FLOAT, !1, 0, 0), this._gl.activeTexture(this._gl.TEXTURE0), this._gl.bindTexture(this._gl.TEXTURE_2D, this._targetTexture), this._gl.drawArrays(this._gl.TRIANGLES, 0, 6)); } - initWebGLObjects(h) { - if (h.__webglObjects || (h.__webglObjects = [], h.__webglObjectsImmediate = [], h.__webglSprites = [], h.__webglFlares = []), h.__objectsAdded.length) { - for (; h.__objectsAdded.length; ) - this.addObject(h.__objectsAdded[0], h), h.__objectsAdded.splice(0, 1); + initWebGLObjects(u) { + if (u.__webglObjects || (u.__webglObjects = [], u.__webglObjectsImmediate = [], u.__webglSprites = [], u.__webglFlares = []), u.__objectsAdded.length) { + for (; u.__objectsAdded.length; ) + this.addObject(u.__objectsAdded[0], u), u.__objectsAdded.splice(0, 1); this._currentGeometryGroupHash = -1; } - for (; h.__objectsRemoved.length; ) - this.removeObject(h.__objectsRemoved[0], h), h.__objectsRemoved.splice(0, 1); - for (var _ = 0, g = h.__webglObjects.length; _ < g; _++) - this.updateObject(h.__webglObjects[_].object); + for (; u.__objectsRemoved.length; ) + this.removeObject(u.__objectsRemoved[0], u), u.__objectsRemoved.splice(0, 1); + for (var p = 0, g = u.__webglObjects.length; p < g; p++) + this.updateObject(u.__webglObjects[p].object); } getYRatio() { return this.rows !== void 0 && this.row !== void 0 ? this.rows : 1; @@ -26934,129 +26934,129 @@ ATOM`, x); getXRatio() { return this.cols !== void 0 && this.col !== void 0 ? this.cols : 1; } - getAspect(h, _) { - (h == null || _ == null) && (h = this._canvas.width, _ = this._canvas.height); - var g = h / _; + getAspect(u, p) { + (u == null || p == null) && (u = this._canvas.width, p = this._canvas.height); + var g = u / p; if (this.rows != null && this.cols != null && this.row != null && this.col != null) { - var x = h / this.cols, c = _ / this.rows; - g = x / c; + var w = u / this.cols, o = p / this.rows; + g = w / o; } return g; } - setTexture(h, _, g) { - if (h.needsUpdate) { - h.__webglInit || (h.__webglInit = !0, h.addEventListener("dispose", this.onTextureDispose.bind(this)), h.__webglTexture = this._gl.createTexture(), this.info.memory.textures++), this._gl.activeTexture(this._gl.TEXTURE0 + _); - var x = g ? this._gl.TEXTURE_3D : this._gl.TEXTURE_2D; - this._gl.bindTexture(x, h.__webglTexture), this._gl.pixelStorei(this._gl.UNPACK_FLIP_Y_WEBGL, h.flipY), this._gl.pixelStorei(this._gl.UNPACK_PREMULTIPLY_ALPHA_WEBGL, h.premultiplyAlpha), this._gl.pixelStorei(this._gl.UNPACK_ALIGNMENT, h.unpackAlignment), this._gl.pixelStorei(this._gl.PACK_ALIGNMENT, h.unpackAlignment); - var c = this.paramToGL(h.format), v = this.paramToGL(h.type); + setTexture(u, p, g) { + if (u.needsUpdate) { + u.__webglInit || (u.__webglInit = !0, u.addEventListener("dispose", this.onTextureDispose.bind(this)), u.__webglTexture = this._gl.createTexture(), this.info.memory.textures++), this._gl.activeTexture(this._gl.TEXTURE0 + p); + var w = g ? this._gl.TEXTURE_3D : this._gl.TEXTURE_2D; + this._gl.bindTexture(w, u.__webglTexture), this._gl.pixelStorei(this._gl.UNPACK_FLIP_Y_WEBGL, u.flipY), this._gl.pixelStorei(this._gl.UNPACK_PREMULTIPLY_ALPHA_WEBGL, u.premultiplyAlpha), this._gl.pixelStorei(this._gl.UNPACK_ALIGNMENT, u.unpackAlignment), this._gl.pixelStorei(this._gl.PACK_ALIGNMENT, u.unpackAlignment); + var o = this.paramToGL(u.format), v = this.paramToGL(u.type); if (g) - this.setTextureParameters(this._gl.TEXTURE_3D, h), this._gl.texImage3D(this._gl.TEXTURE_3D, 0, this._gl.R32F, h.image.size.z, h.image.size.y, h.image.size.x, 0, this._gl.RED, this._gl.FLOAT, h.image.data); + this.setTextureParameters(this._gl.TEXTURE_3D, u), this._gl.texImage3D(this._gl.TEXTURE_3D, 0, this._gl.R32F, u.image.size.z, u.image.size.y, u.image.size.x, 0, this._gl.RED, this._gl.FLOAT, u.image.data); else { - var M = h.image, E = M.width, $ = M.height; - typeof E > "u" && (E = M.length, c == this._gl.RGBA && (E /= 4), $ = 1), this.setTextureParameters(this._gl.TEXTURE_2D, h), this.isWebGL1() ? this._gl.texImage2D(this._gl.TEXTURE_2D, 0, c, c, v, h.image) : this._gl.texImage2D(this._gl.TEXTURE_2D, 0, c, E, $, 0, c, v, h.image); + var M = u.image, E = M.width, $ = M.height; + typeof E > "u" && (E = M.length, o == this._gl.RGBA && (E /= 4), $ = 1), this.setTextureParameters(this._gl.TEXTURE_2D, u), this.isWebGL1() ? this._gl.texImage2D(this._gl.TEXTURE_2D, 0, o, o, v, u.image) : this._gl.texImage2D(this._gl.TEXTURE_2D, 0, o, E, $, 0, o, v, u.image); } - h.needsUpdate = !1, h.onUpdate && h.onUpdate(); + u.needsUpdate = !1, u.onUpdate && u.onUpdate(); } else - this._gl.activeTexture(this._gl.TEXTURE0 + _), g ? this._gl.bindTexture(this._gl.TEXTURE_3D, h.__webglTexture) : this._gl.bindTexture(this._gl.TEXTURE_2D, h.__webglTexture); + this._gl.activeTexture(this._gl.TEXTURE0 + p), g ? this._gl.bindTexture(this._gl.TEXTURE_3D, u.__webglTexture) : this._gl.bindTexture(this._gl.TEXTURE_2D, u.__webglTexture); } supportsVolumetric() { return !this.isWebGL1(); } - enableAttribute(h) { - this._enabledAttributes[h] || (this._gl.enableVertexAttribArray(h), this._enabledAttributes[h] = !0); + enableAttribute(u) { + this._enabledAttributes[u] || (this._gl.enableVertexAttribArray(u), this._enabledAttributes[u] = !0); } disableAttributes() { - for (let h in this._enabledAttributes) - this._enabledAttributes[h] && (this._gl.disableVertexAttribArray(h), this._enabledAttributes[h] = !1); + for (let u in this._enabledAttributes) + this._enabledAttributes[u] && (this._gl.disableVertexAttribArray(u), this._enabledAttributes[u] = !1); } - setPolygonOffset(h, _, g) { - this._oldPolygonOffset !== h && (h ? this._gl.enable(this._gl.POLYGON_OFFSET_FILL) : this._gl.disable(this._gl.POLYGON_OFFSET_FILL)); + setPolygonOffset(u, p, g) { + this._oldPolygonOffset !== u && (u ? this._gl.enable(this._gl.POLYGON_OFFSET_FILL) : this._gl.disable(this._gl.POLYGON_OFFSET_FILL)); } - setLineWidth(h) { - h !== this._oldLineWidth && (this._gl.lineWidth(h), this._oldLineWidth = h); + setLineWidth(u) { + u !== this._oldLineWidth && (this._gl.lineWidth(u), this._oldLineWidth = u); } - deallocateGeometry(h) { - if (h.__webglInit = void 0, h.__webglVertexBuffer !== void 0 && this._gl.deleteBuffer(h.__webglVertexBuffer), h.__webglColorBuffer !== void 0 && this._gl.deleteBuffer(h.__webglColorBuffer), h.geometryGroups !== void 0) - for (var _ = 0, g = h.groups; _ < g; _++) { - var x = h.geometryGroups[_]; - x.__webglVertexBuffer !== void 0 && this._gl.deleteBuffer(x.__webglVertexBuffer), x.__webglColorBuffer !== void 0 && this._gl.deleteBuffer(x.__webglColorBuffer), x.__webglNormalBuffer !== void 0 && this._gl.deleteBuffer(x.__webglNormalBuffer), x.__webglFaceBuffer !== void 0 && this._gl.deleteBuffer(x.__webglFaceBuffer), x.__webglLineBuffer !== void 0 && this._gl.deleteBuffer(x.__webglLineBuffer); + deallocateGeometry(u) { + if (u.__webglInit = void 0, u.__webglVertexBuffer !== void 0 && this._gl.deleteBuffer(u.__webglVertexBuffer), u.__webglColorBuffer !== void 0 && this._gl.deleteBuffer(u.__webglColorBuffer), u.geometryGroups !== void 0) + for (var p = 0, g = u.groups; p < g; p++) { + var w = u.geometryGroups[p]; + w.__webglVertexBuffer !== void 0 && this._gl.deleteBuffer(w.__webglVertexBuffer), w.__webglColorBuffer !== void 0 && this._gl.deleteBuffer(w.__webglColorBuffer), w.__webglNormalBuffer !== void 0 && this._gl.deleteBuffer(w.__webglNormalBuffer), w.__webglFaceBuffer !== void 0 && this._gl.deleteBuffer(w.__webglFaceBuffer), w.__webglLineBuffer !== void 0 && this._gl.deleteBuffer(w.__webglLineBuffer); } } - deallocateMaterial(h) { - var _ = h.program; - if (_ !== void 0) { - h.program = void 0; - var g, x, c, v = !1; - for (g = 0, x = this._programs.length; g < x; g++) - if (c = this._programs[g], c.program === _) { - c.usedTimes--, c.usedTimes === 0 && (v = !0); + deallocateMaterial(u) { + var p = u.program; + if (p !== void 0) { + u.program = void 0; + var g, w, o, v = !1; + for (g = 0, w = this._programs.length; g < w; g++) + if (o = this._programs[g], o.program === p) { + o.usedTimes--, o.usedTimes === 0 && (v = !0); break; } if (v === !0) { var M = []; - for (g = 0, x = this._programs.length; g < x; g++) - c = this._programs[g], c.program !== _ && M.push(c); - this._programs = M, this._gl.deleteProgram(_), this.info.memory.programs--; + for (g = 0, w = this._programs.length; g < w; g++) + o = this._programs[g], o.program !== p && M.push(o); + this._programs = M, this._gl.deleteProgram(p), this.info.memory.programs--; } } } - deallocateTexture(h) { - if (h.image && h.image.__webglTextureCube) - this._gl.deleteTexture(h.image.__webglTextureCube); + deallocateTexture(u) { + if (u.image && u.image.__webglTextureCube) + this._gl.deleteTexture(u.image.__webglTextureCube); else { - if (!h.__webglInit) + if (!u.__webglInit) return; - h.__webglInit = !1, this._gl.deleteTexture(h.__webglTexture); + u.__webglInit = !1, this._gl.deleteTexture(u.__webglTexture); } } - onGeometryDispose(h) { - var _ = h.target; - _.removeEventListener("dispose", this.onGeometryDispose), this.deallocateGeometry(_), this.info.memory.geometries--; + onGeometryDispose(u) { + var p = u.target; + p.removeEventListener("dispose", this.onGeometryDispose), this.deallocateGeometry(p), this.info.memory.geometries--; } - onTextureDispose(h) { - var _ = h.target; - _.removeEventListener("dispose", this.onTextureDispose), this.deallocateTexture(_), this.info.memory.textures--; + onTextureDispose(u) { + var p = u.target; + p.removeEventListener("dispose", this.onTextureDispose), this.deallocateTexture(p), this.info.memory.textures--; } - onMaterialDispose(h) { - var _ = h.target; - _.removeEventListener("dispose", this.onMaterialDispose), this.deallocateMaterial(_); + onMaterialDispose(u) { + var p = u.target; + p.removeEventListener("dispose", this.onMaterialDispose), this.deallocateMaterial(p); } // Compile and return shader - getShader(h, _) { + getShader(u, p) { var g; - return !this.isWebGL1() && !_.startsWith("#version") && (_ = _.replace(/gl_FragDepthEXT/g, "gl_FragDepth"), h == "fragment" ? _ = _.replace(/varying/g, "in") : _ = _.replace(/varying/g, "out"), _ = _.replace(/attribute/g, "in"), _ = _.replace(/texture2D/g, "texture"), _ = _.replace(/\/\/DEFINEFRAGCOLOR/g, "out vec4 glFragColor;"), _ = _.replace(/gl_FragColor/g, "glFragColor"), _ = `#version 300 es -` + _), h === "fragment" ? g = this._gl.createShader(this._gl.FRAGMENT_SHADER) : h === "vertex" && (g = this._gl.createShader(this._gl.VERTEX_SHADER)), g == null ? null : (this._gl.shaderSource(g, _), this._gl.compileShader(g), this._gl.getShaderParameter(g, this._gl.COMPILE_STATUS) ? g : (console.error(this._gl.getShaderInfoLog(g)), console.error("could not initialize shader"), null)); + return !this.isWebGL1() && !p.startsWith("#version") && (p = p.replace(/gl_FragDepthEXT/g, "gl_FragDepth"), u == "fragment" ? p = p.replace(/varying/g, "in") : p = p.replace(/varying/g, "out"), p = p.replace(/attribute/g, "in"), p = p.replace(/texture2D/g, "texture"), p = p.replace(/\/\/DEFINEFRAGCOLOR/g, "out vec4 glFragColor;"), p = p.replace(/gl_FragColor/g, "glFragColor"), p = `#version 300 es +` + p), u === "fragment" ? g = this._gl.createShader(this._gl.FRAGMENT_SHADER) : u === "vertex" && (g = this._gl.createShader(this._gl.VERTEX_SHADER)), g == null ? null : (this._gl.shaderSource(g, p), this._gl.compileShader(g), this._gl.getShaderParameter(g, this._gl.COMPILE_STATUS) ? g : (console.error(this._gl.getShaderInfoLog(g)), console.error("could not initialize shader"), null)); } // Compile appropriate shaders (if necessary) from source code and attach to // gl program. - buildProgram(h, _, g, x) { - var c, v, M, E, $ = []; - $.push(h), $.push(_); - for (c in x) - $.push(c), $.push(x[c]); - for (E = $.join(), c = 0, v = this._programs.length; c < v; c++) { - var k = this._programs[c]; + buildProgram(u, p, g, w) { + var o, v, M, E, $ = []; + $.push(u), $.push(p); + for (o in w) + $.push(o), $.push(w[o]); + for (E = $.join(), o = 0, v = this._programs.length; o < v; o++) { + var k = this._programs[o]; if (k.code === E) return k.usedTimes++, k.program; } - if (this.isWebGL1() && x.volumetric) + if (this.isWebGL1() && w.volumetric) throw new Error("Volumetric rendering requires webgl2 which is not supported by your hardware."); if (M = this._gl.createProgram(), M == null) return null; var L = this._precision, z = "precision " + L + " float;", O = [ - x.volumetric ? "#version 300 es" : "", + w.volumetric ? "#version 300 es" : "", z ].join(` `), R = [ - x.volumetric ? "#version 300 es" : "", - x.fragdepth && this.isWebGL1() ? "#extension GL_EXT_frag_depth: enable" : "", - x.shaded ? "#define SHADED 1" : "", - x.wireframe ? "#define WIREFRAME 1" : "", + w.volumetric ? "#version 300 es" : "", + w.fragdepth && this.isWebGL1() ? "#extension GL_EXT_frag_depth: enable" : "", + w.shaded ? "#define SHADED 1" : "", + w.wireframe ? "#define WIREFRAME 1" : "", z ].join(` -`), P = this.getShader("fragment", R + h), U = this.getShader("vertex", O + _); - U != null && this._gl.attachShader(M, U), P != null && this._gl.attachShader(M, P), this._gl.linkProgram(M), this._gl.getProgramParameter(M, this._gl.LINK_STATUS) || console.error("Could not initialize shader"), M.uniforms = {}, M.attributes = {}; - var B, N, G; +`), N = this.getShader("fragment", R + u), W = this.getShader("vertex", O + p); + W != null && this._gl.attachShader(M, W), N != null && this._gl.attachShader(M, N), this._gl.linkProgram(M), this._gl.getProgramParameter(M, this._gl.LINK_STATUS) || console.error("Could not initialize shader"), M.uniforms = {}, M.attributes = {}; + var B, P, G; B = [ "viewMatrix", "modelViewMatrix", @@ -27065,8 +27065,8 @@ ATOM`, x); "vWidth", "vHeight" ]; - for (N in g) - B.push(N); + for (P in g) + B.push(P); for (G = 0; G < B.length; G++) { var H = B[G]; M.uniforms[H] = this._gl.getUniformLocation(M, H); @@ -27079,8 +27079,8 @@ ATOM`, x); "offset", "radius" ], G = 0; G < B.length; G++) { - var W = B[G]; - M.attributes[W] = this._gl.getAttribLocation(M, W); + var U = B[G]; + M.attributes[U] = this._gl.getAttribLocation(M, U); } return M.id = this._programs_counter++, this._programs.push({ program: M, @@ -27088,132 +27088,132 @@ ATOM`, x); usedTimes: 1 }), this.info.memory.programs = this._programs.length, M; } - setProgram(h, _, g, x, c, v) { - if (x.needsUpdate && (x.program && this.deallocateMaterial(x), this.initMaterial(x, _, g, c), x.needsUpdate = !1), x.program == null) + setProgram(u, p, g, w, o, v) { + if (w.needsUpdate && (w.program && this.deallocateMaterial(w), this.initMaterial(w, p, g, o), w.needsUpdate = !1), w.program == null) return null; - var M = !1, E = x.program, $ = E.uniforms, k = x.uniforms; - if (E != this._currentProgram && (this._gl.useProgram(E), this._currentProgram = E, M = !0), x.id != this._currentMaterialId && (this._currentMaterialId = x.id, M = !0), h != this._currentCamera && (this._currentCamera = h, M = !0), $.projectionMatrix && this._gl.uniformMatrix4fv($.projectionMatrix, !1, h.projectionMatrix.elements), $.modelViewMatrix && this._gl.uniformMatrix4fv($.modelViewMatrix, !1, c._modelViewMatrix.elements), $.normalMatrix && this._gl.uniformMatrix3fv($.normalMatrix, !1, c._normalMatrix.elements), $.projinv && (this._projInverse.getInverse(h.projectionMatrix), this._gl.uniformMatrix4fv($.projinv, !1, this._projInverse.elements)), $.viewMatrix && this._gl.uniformMatrix4fv($.viewMatrix, !1, h.matrixWorldInverse.elements), $.vWidth && this._gl.uniform1f($.vWidth, this._viewportWidth), $.vHeight && this._gl.uniform1f($.vHeight, this._viewportHeight), M) { - if (k.fogColor.value = g.color, k.fogNear.value = g.near, k.fogFar.value = g.far, x.shaderID.startsWith("lambert") || x.shaderID === "instanced" || x.shaderID.endsWith("imposter")) - this._lightsNeedUpdate && (this.setupLights(E, _), this._lightsNeedUpdate = !1), k.directionalLightColor.value = this._lights.directional.colors, k.directionalLightDirection.value = this._lights.directional.positions; - else if (x.shaderID.endsWith("outline")) - k.outlineColor.value = x.outlineColor, k.outlineWidth.value = x.outlineWidth, k.outlinePushback.value = x.outlinePushback, k.outlineMaxPixels.value = x.outlineMaxPixels * this.devicePixelRatio; - else if (x.shaderID === "volumetric") { - c._modelViewMatrix.getScale(this._direction), this._worldInverse.getInverse(c._modelViewMatrix), this._projInverse.getInverse(h.projectionMatrix), this._textureMatrix.multiplyMatrices(c.material.texmatrix, this._worldInverse), this._gl.uniformMatrix4fv($.textmat, !1, this._textureMatrix.elements), this._gl.uniformMatrix4fv($.projinv, !1, this._projInverse.elements); + var M = !1, E = w.program, $ = E.uniforms, k = w.uniforms; + if (E != this._currentProgram && (this._gl.useProgram(E), this._currentProgram = E, M = !0), w.id != this._currentMaterialId && (this._currentMaterialId = w.id, M = !0), u != this._currentCamera && (this._currentCamera = u, M = !0), $.projectionMatrix && this._gl.uniformMatrix4fv($.projectionMatrix, !1, u.projectionMatrix.elements), $.modelViewMatrix && this._gl.uniformMatrix4fv($.modelViewMatrix, !1, o._modelViewMatrix.elements), $.normalMatrix && this._gl.uniformMatrix3fv($.normalMatrix, !1, o._normalMatrix.elements), $.projinv && (this._projInverse.getInverse(u.projectionMatrix), this._gl.uniformMatrix4fv($.projinv, !1, this._projInverse.elements)), $.viewMatrix && this._gl.uniformMatrix4fv($.viewMatrix, !1, u.matrixWorldInverse.elements), $.vWidth && this._gl.uniform1f($.vWidth, this._viewportWidth), $.vHeight && this._gl.uniform1f($.vHeight, this._viewportHeight), M) { + if (k.fogColor.value = g.color, k.fogNear.value = g.near, k.fogFar.value = g.far, w.shaderID.startsWith("lambert") || w.shaderID === "instanced" || w.shaderID.endsWith("imposter")) + this._lightsNeedUpdate && (this.setupLights(E, p), this._lightsNeedUpdate = !1), k.directionalLightColor.value = this._lights.directional.colors, k.directionalLightDirection.value = this._lights.directional.positions; + else if (w.shaderID.endsWith("outline")) + k.outlineColor.value = w.outlineColor, k.outlineWidth.value = w.outlineWidth, k.outlinePushback.value = w.outlinePushback, k.outlineMaxPixels.value = w.outlineMaxPixels * this.devicePixelRatio; + else if (w.shaderID === "volumetric") { + o._modelViewMatrix.getScale(this._direction), this._worldInverse.getInverse(o._modelViewMatrix), this._projInverse.getInverse(u.projectionMatrix), this._textureMatrix.multiplyMatrices(o.material.texmatrix, this._worldInverse), this._gl.uniformMatrix4fv($.textmat, !1, this._textureMatrix.elements), this._gl.uniformMatrix4fv($.projinv, !1, this._projInverse.elements); let L = Math.min(Math.min(this._direction.x, this._direction.y), this._direction.z); - k.step.value = c.material.unit * L, k.maxdepth.value = c.material.maxdepth * L, k.transfermax.value = c.material.transfermax, k.transfermin.value = c.material.transfermin, k.subsamples.value = c.material.subsamples, v.setTexture(c.material.transferfn, 4, !1), v.setTexture(c.material.map, 3, !0), this._gl.activeTexture(this._gl.TEXTURE5), this._gl.bindTexture(this._gl.TEXTURE_2D, this._depthTexture); + k.step.value = o.material.unit * L, k.maxdepth.value = o.material.maxdepth * L, k.transfermax.value = o.material.transfermax, k.transfermin.value = o.material.transfermin, k.subsamples.value = o.material.subsamples, v.setTexture(o.material.transferfn, 4, !1), v.setTexture(o.material.map, 3, !0), this._gl.activeTexture(this._gl.TEXTURE5), this._gl.bindTexture(this._gl.TEXTURE_2D, this._depthTexture); } - k.opacity.value = x.opacity, this.loadMaterialUniforms($, k); + k.opacity.value = w.opacity, this.loadMaterialUniforms($, k); } return k.shading && (k.shading.value == 3 ? (this._gl.activeTexture(this._gl.TEXTURE0 + this.SHADE_TEXTURE), this._gl.bindTexture(this._gl.TEXTURE_2D, this._shadingTexture)) : console.error("Invalid shading textures.")), E; } - loadMaterialUniforms(h, _) { - var g, x, c, v; - for (g in _) - h[g] && (x = _[g].type, c = _[g].value, v = h[g], x === "f" ? this._gl.uniform1f(v, c) : x === "i" ? this._gl.uniform1i(v, c) : x === "fv" ? this._gl.uniform3fv(v, c) : x === "c" ? this._gl.uniform3f(v, c.r, c.g, c.b) : x === "f4" && this._gl.uniform4f(v, c[0], c[1], c[2], c[3])); + loadMaterialUniforms(u, p) { + var g, w, o, v; + for (g in p) + u[g] && (w = p[g].type, o = p[g].value, v = u[g], w === "f" ? this._gl.uniform1f(v, o) : w === "i" ? this._gl.uniform1i(v, o) : w === "fv" ? this._gl.uniform3fv(v, o) : w === "c" ? this._gl.uniform3f(v, o.r, o.g, o.b) : w === "f4" && this._gl.uniform4f(v, o[0], o[1], o[2], o[3])); } // Objects adding - addObject(h, _) { - var g, x, c, v; - if (!h.__webglInit && (h.__webglInit = !0, h._modelViewMatrix = new p.Matrix4(), h._normalMatrix = new p.Matrix3(), h.geometry !== void 0 && h.geometry.__webglInit === void 0 && (h.geometry.__webglInit = !0, h.geometry.addEventListener("dispose", this.onGeometryDispose.bind(this))), h instanceof m.Mesh || h instanceof m.Line)) - for (c = h.geometry, g = 0, x = c.geometryGroups.length; g < x; g++) - v = c.geometryGroups[g], v.id = this._geometryGroupCounter++, v.__webglVertexBuffer || (h instanceof m.Mesh ? (this.createMeshBuffers(v), c.elementsNeedUpdate = !0, c.normalsNeedUpdate = !0) : h instanceof m.Line && this.createLineBuffers(v), c.verticesNeedUpdate = !0, c.colorsNeedUpdate = !0); - if (!h.__webglActive) { - if (h instanceof m.Mesh || h instanceof m.Line) - for (c = h.geometry, g = 0, x = c.geometryGroups.length; g < x; g++) - v = c.geometryGroups[g], this.addBuffer(_.__webglObjects, v, h); - else h instanceof m.Sprite && _.__webglSprites.push(h); - h.__webglActive = !0; - } - } - updateObject(h) { - var _ = h.geometry, g; - if (h instanceof m.Mesh || h instanceof m.Line) { - for (var x = 0, c = _.geometryGroups.length; x < c; x++) - g = _.geometryGroups[x], (_.verticesNeedUpdate || _.elementsNeedUpdate || _.colorsNeedUpdate || _.normalsNeedUpdate) && this.setBuffers(g, this._gl.STATIC_DRAW); - _.verticesNeedUpdate = !1, _.elementsNeedUpdate = !1, _.normalsNeedUpdate = !1, _.colorsNeedUpdate = !1, _.buffersNeedUpdate = !1; - } - } - removeObject(h, _) { - h instanceof m.Mesh || h instanceof m.Line ? this.removeInstances(_.__webglObjects, h) : h instanceof m.Sprite && this.removeInstancesDirect(_.__webglSprites, h), h.__webglActive = !1; - } - removeInstances(h, _) { - for (var g = h.length - 1; g >= 0; --g) - h[g].object === _ && h.splice(g, 1); - } - removeInstancesDirect(h, _) { - for (var g = h.length - 1; g >= 0; --g) - h[g] === _ && h.splice(g, 1); - } - unrollBufferMaterial(h) { - var _ = h.object, g = _.material; + addObject(u, p) { + var g, w, o, v; + if (!u.__webglInit && (u.__webglInit = !0, u._modelViewMatrix = new _.Matrix4(), u._normalMatrix = new _.Matrix3(), u.geometry !== void 0 && u.geometry.__webglInit === void 0 && (u.geometry.__webglInit = !0, u.geometry.addEventListener("dispose", this.onGeometryDispose.bind(this))), u instanceof m.Mesh || u instanceof m.Line)) + for (o = u.geometry, g = 0, w = o.geometryGroups.length; g < w; g++) + v = o.geometryGroups[g], v.id = this._geometryGroupCounter++, v.__webglVertexBuffer || (u instanceof m.Mesh ? (this.createMeshBuffers(v), o.elementsNeedUpdate = !0, o.normalsNeedUpdate = !0) : u instanceof m.Line && this.createLineBuffers(v), o.verticesNeedUpdate = !0, o.colorsNeedUpdate = !0); + if (!u.__webglActive) { + if (u instanceof m.Mesh || u instanceof m.Line) + for (o = u.geometry, g = 0, w = o.geometryGroups.length; g < w; g++) + v = o.geometryGroups[g], this.addBuffer(p.__webglObjects, v, u); + else u instanceof m.Sprite && p.__webglSprites.push(u); + u.__webglActive = !0; + } + } + updateObject(u) { + var p = u.geometry, g; + if (u instanceof m.Mesh || u instanceof m.Line) { + for (var w = 0, o = p.geometryGroups.length; w < o; w++) + g = p.geometryGroups[w], (p.verticesNeedUpdate || p.elementsNeedUpdate || p.colorsNeedUpdate || p.normalsNeedUpdate) && this.setBuffers(g, this._gl.STATIC_DRAW); + p.verticesNeedUpdate = !1, p.elementsNeedUpdate = !1, p.normalsNeedUpdate = !1, p.colorsNeedUpdate = !1, p.buffersNeedUpdate = !1; + } + } + removeObject(u, p) { + u instanceof m.Mesh || u instanceof m.Line ? this.removeInstances(p.__webglObjects, u) : u instanceof m.Sprite && this.removeInstancesDirect(p.__webglSprites, u), u.__webglActive = !1; + } + removeInstances(u, p) { + for (var g = u.length - 1; g >= 0; --g) + u[g].object === p && u.splice(g, 1); + } + removeInstancesDirect(u, p) { + for (var g = u.length - 1; g >= 0; --g) + u[g] === p && u.splice(g, 1); + } + unrollBufferMaterial(u) { + var p = u.object, g = p.material; if (g.volumetric) - h.opaque = null, h.transparent = null, h.volumetric = g; + u.opaque = null, u.transparent = null, u.volumetric = g; else if (g.transparent) { - if (h.opaque = null, h.volumetric = null, h.transparent = g, !g.wireframe) { - let x = g.clone(); - x.opacity = 0, h.transparentDepth = x; + if (u.opaque = null, u.volumetric = null, u.transparent = g, !g.wireframe) { + let w = g.clone(); + w.opacity = 0, u.transparentDepth = w; } } else { - if (h.opaque = g, h.transparent = null, h.volumetric = null, !g.wireframe) { - let x = g.clone(); - x.opacity = 0, h.opaqueDepth = x; + if (u.opaque = g, u.transparent = null, u.volumetric = null, !g.wireframe) { + let w = g.clone(); + w.opacity = 0, u.opaqueDepth = w; } - g.hasAO && (h.hasAO = !0), (this._AOEnabled || h.hasAO) && (h.opaqueShaded = g.clone(), h.opaqueShaded.shaded = !0); + g.hasAO && (u.hasAO = !0), (this._AOEnabled || u.hasAO) && (u.opaqueShaded = g.clone(), u.opaqueShaded.shaded = !0); } } - setBuffers(h, _) { - var g = h.vertexArray, x = h.colorArray; - if (h.__webglOffsetBuffer !== void 0 ? (this._gl.bindBuffer(this._gl.ARRAY_BUFFER, h.__webglOffsetBuffer), this._gl.bufferData(this._gl.ARRAY_BUFFER, g, _)) : (this._gl.bindBuffer(this._gl.ARRAY_BUFFER, h.__webglVertexBuffer), this._gl.bufferData(this._gl.ARRAY_BUFFER, g, _)), this._gl.bindBuffer(this._gl.ARRAY_BUFFER, h.__webglColorBuffer), this._gl.bufferData(this._gl.ARRAY_BUFFER, x, _), h.normalArray && h.__webglNormalBuffer !== void 0) { - var c = h.normalArray; - this._gl.bindBuffer(this._gl.ARRAY_BUFFER, h.__webglNormalBuffer), this._gl.bufferData(this._gl.ARRAY_BUFFER, c, _); + setBuffers(u, p) { + var g = u.vertexArray, w = u.colorArray; + if (u.__webglOffsetBuffer !== void 0 ? (this._gl.bindBuffer(this._gl.ARRAY_BUFFER, u.__webglOffsetBuffer), this._gl.bufferData(this._gl.ARRAY_BUFFER, g, p)) : (this._gl.bindBuffer(this._gl.ARRAY_BUFFER, u.__webglVertexBuffer), this._gl.bufferData(this._gl.ARRAY_BUFFER, g, p)), this._gl.bindBuffer(this._gl.ARRAY_BUFFER, u.__webglColorBuffer), this._gl.bufferData(this._gl.ARRAY_BUFFER, w, p), u.normalArray && u.__webglNormalBuffer !== void 0) { + var o = u.normalArray; + this._gl.bindBuffer(this._gl.ARRAY_BUFFER, u.__webglNormalBuffer), this._gl.bufferData(this._gl.ARRAY_BUFFER, o, p); } - if (h.radiusArray && h.__webglRadiusBuffer !== void 0 && (this._gl.bindBuffer(this._gl.ARRAY_BUFFER, h.__webglRadiusBuffer), this._gl.bufferData(this._gl.ARRAY_BUFFER, h.radiusArray, _)), h.faceArray && h.__webglFaceBuffer !== void 0) { - var v = h.faceArray; - this._gl.bindBuffer(this._gl.ELEMENT_ARRAY_BUFFER, h.__webglFaceBuffer), this._gl.bufferData(this._gl.ELEMENT_ARRAY_BUFFER, v, _); + if (u.radiusArray && u.__webglRadiusBuffer !== void 0 && (this._gl.bindBuffer(this._gl.ARRAY_BUFFER, u.__webglRadiusBuffer), this._gl.bufferData(this._gl.ARRAY_BUFFER, u.radiusArray, p)), u.faceArray && u.__webglFaceBuffer !== void 0) { + var v = u.faceArray; + this._gl.bindBuffer(this._gl.ELEMENT_ARRAY_BUFFER, u.__webglFaceBuffer), this._gl.bufferData(this._gl.ELEMENT_ARRAY_BUFFER, v, p); } - if (h.lineArray && h.__webglLineBuffer !== void 0) { - var M = h.lineArray; - this._gl.bindBuffer(this._gl.ELEMENT_ARRAY_BUFFER, h.__webglLineBuffer), this._gl.bufferData(this._gl.ELEMENT_ARRAY_BUFFER, M, _); + if (u.lineArray && u.__webglLineBuffer !== void 0) { + var M = u.lineArray; + this._gl.bindBuffer(this._gl.ELEMENT_ARRAY_BUFFER, u.__webglLineBuffer), this._gl.bufferData(this._gl.ELEMENT_ARRAY_BUFFER, M, p); } } // Creates appropriate gl buffers for geometry chunk // TODO: do we need line buffer for mesh objects? // Also, can we integrate this with createLineBuffers? - createMeshBuffers(h) { - h.radiusArray && (h.__webglRadiusBuffer = this._gl.createBuffer()), h.useOffset && (h.__webglOffsetBuffer = this._gl.createBuffer()), h.__webglVertexBuffer = this._gl.createBuffer(), h.__webglNormalBuffer = this._gl.createBuffer(), h.__webglColorBuffer = this._gl.createBuffer(), h.__webglFaceBuffer = this._gl.createBuffer(), h.__webglLineBuffer = this._gl.createBuffer(), this.info.memory.geometries++; + createMeshBuffers(u) { + u.radiusArray && (u.__webglRadiusBuffer = this._gl.createBuffer()), u.useOffset && (u.__webglOffsetBuffer = this._gl.createBuffer()), u.__webglVertexBuffer = this._gl.createBuffer(), u.__webglNormalBuffer = this._gl.createBuffer(), u.__webglColorBuffer = this._gl.createBuffer(), u.__webglFaceBuffer = this._gl.createBuffer(), u.__webglLineBuffer = this._gl.createBuffer(), this.info.memory.geometries++; } - createLineBuffers(h) { - h.__webglVertexBuffer = this._gl.createBuffer(), h.__webglColorBuffer = this._gl.createBuffer(), this.info.memory.geometries++; + createLineBuffers(u) { + u.__webglVertexBuffer = this._gl.createBuffer(), u.__webglColorBuffer = this._gl.createBuffer(), this.info.memory.geometries++; } - addBuffer(h, _, g) { - h.push({ - buffer: _, + addBuffer(u, p, g) { + u.push({ + buffer: p, object: g, opaque: null, transparent: null }); } - setupMatrices(h, _) { - h._modelViewMatrix.multiplyMatrices(_.matrixWorldInverse, h.matrixWorld), h._normalMatrix.getInverse(h._modelViewMatrix), h._normalMatrix.transpose(); + setupMatrices(u, p) { + u._modelViewMatrix.multiplyMatrices(p.matrixWorldInverse, u.matrixWorld), u._normalMatrix.getInverse(u._modelViewMatrix), u._normalMatrix.transpose(); } // Fallback filters for non-power-of-2 textures - filterFallback(h) { + filterFallback(u) { return this._gl.LINEAR; } - setTextureParameters(h, _) { - h == this._gl.TEXTURE_2D ? (this._gl.texParameteri(h, this._gl.TEXTURE_WRAP_S, this._gl.CLAMP_TO_EDGE), this._gl.texParameteri(h, this._gl.TEXTURE_WRAP_T, this._gl.CLAMP_TO_EDGE), this._gl.texParameteri(h, this._gl.TEXTURE_MAG_FILTER, this.filterFallback(_.magFilter)), this._gl.texParameteri(h, this._gl.TEXTURE_MIN_FILTER, this.filterFallback(_.minFilter))) : (this._gl.texParameteri(h, this._gl.TEXTURE_WRAP_S, this._gl.CLAMP_TO_EDGE), this._gl.texParameteri(h, this._gl.TEXTURE_WRAP_T, this._gl.CLAMP_TO_EDGE), this._gl.texParameteri(h, this._gl.TEXTURE_WRAP_R, this._gl.CLAMP_TO_EDGE), this._extColorBufferFloat && this._extFloatLinear ? (this._gl.texParameteri(h, this._gl.TEXTURE_MAG_FILTER, this._gl.LINEAR), this._gl.texParameteri(h, this._gl.TEXTURE_MIN_FILTER, this._gl.LINEAR)) : (this._gl.texParameteri(h, this._gl.TEXTURE_MAG_FILTER, this._gl.NEAREST), this._gl.texParameteri(h, this._gl.TEXTURE_MIN_FILTER, this._gl.NEAREST))); + setTextureParameters(u, p) { + u == this._gl.TEXTURE_2D ? (this._gl.texParameteri(u, this._gl.TEXTURE_WRAP_S, this._gl.CLAMP_TO_EDGE), this._gl.texParameteri(u, this._gl.TEXTURE_WRAP_T, this._gl.CLAMP_TO_EDGE), this._gl.texParameteri(u, this._gl.TEXTURE_MAG_FILTER, this.filterFallback(p.magFilter)), this._gl.texParameteri(u, this._gl.TEXTURE_MIN_FILTER, this.filterFallback(p.minFilter))) : (this._gl.texParameteri(u, this._gl.TEXTURE_WRAP_S, this._gl.CLAMP_TO_EDGE), this._gl.texParameteri(u, this._gl.TEXTURE_WRAP_T, this._gl.CLAMP_TO_EDGE), this._gl.texParameteri(u, this._gl.TEXTURE_WRAP_R, this._gl.CLAMP_TO_EDGE), this._extColorBufferFloat && this._extFloatLinear ? (this._gl.texParameteri(u, this._gl.TEXTURE_MAG_FILTER, this._gl.LINEAR), this._gl.texParameteri(u, this._gl.TEXTURE_MIN_FILTER, this._gl.LINEAR)) : (this._gl.texParameteri(u, this._gl.TEXTURE_MAG_FILTER, this._gl.NEAREST), this._gl.texParameteri(u, this._gl.TEXTURE_MIN_FILTER, this._gl.NEAREST))); } // Map constants to WebGL constants - paramToGL(h) { - return h === l.UnsignedByteType ? this._gl.UNSIGNED_BYTE : h === l.RGBAFormat ? this._gl.RGBA : h === l.NearestFilter ? this._gl.NEAREST : 0; - } - setupLights(h, _) { - var g, x, c, v = 0, M = 0, E = 0, $, k, L = this._lights, z = L.directional.colors, O = L.directional.positions, R = 0, P = 0; - for (g = 0, x = _.length; g < x; g++) - if (c = _[g], $ = c.color, k = c.intensity, c instanceof d.Light) { - if (this._direction.getPositionFromMatrix(c.matrixWorld), this._vector3.getPositionFromMatrix(c.target.matrixWorld), this._direction.sub(this._vector3), this._direction.normalize(), this._direction.x === 0 && this._direction.y === 0 && this._direction.z === 0) + paramToGL(u) { + return u === l.UnsignedByteType ? this._gl.UNSIGNED_BYTE : u === l.RGBAFormat ? this._gl.RGBA : u === l.NearestFilter ? this._gl.NEAREST : 0; + } + setupLights(u, p) { + var g, w, o, v = 0, M = 0, E = 0, $, k, L = this._lights, z = L.directional.colors, O = L.directional.positions, R = 0, N = 0; + for (g = 0, w = p.length; g < w; g++) + if (o = p[g], $ = o.color, k = o.intensity, o instanceof h.Light) { + if (this._direction.getPositionFromMatrix(o.matrixWorld), this._vector3.getPositionFromMatrix(o.target.matrixWorld), this._direction.sub(this._vector3), this._direction.normalize(), this._direction.x === 0 && this._direction.y === 0 && this._direction.z === 0) continue; - O[P] = this._direction.x, O[P + 1] = this._direction.y, O[P + 2] = this._direction.z, z[P] = $.r * k, z[P + 1] = $.g * k, z[P + 2] = $.b * k, P += 3, R++; + O[N] = this._direction.x, O[N + 1] = this._direction.y, O[N + 2] = this._direction.z, z[N] = $.r * k, z[N + 1] = $.g * k, z[N + 2] = $.b * k, N += 3, R++; } L.ambient[0] = v, L.ambient[1] = M, L.ambient[2] = E, L.directional.length = R; } @@ -27245,10 +27245,10 @@ ATOM`, x); preserveDrawingBuffer: this._preserveDrawingBuffer }))) throw "Error creating WebGL context."; - var h = this._gl.getParameter(this._gl.VERSION); - this._webglversion = parseInt(h[6]); - } catch (_) { - console.error(_); + var u = this._gl.getParameter(this._gl.VERSION); + this._webglversion = parseInt(u[6]); + } catch (p) { + console.error(p); } } isWebGL1() { @@ -27258,23 +27258,23 @@ ATOM`, x); this._gl.clearDepth(1), this._gl.clearStencil(0), this._gl.enable(this._gl.DEPTH_TEST), this._gl.depthFunc(this._gl.LEQUAL), this._gl.frontFace(this._gl.CCW), this._gl.cullFace(this._gl.BACK), this._gl.enable(this._gl.CULL_FACE), this._gl.enable(this._gl.BLEND), this._gl.blendEquation(this._gl.FUNC_ADD), this._gl.blendFunc(this._gl.SRC_ALPHA, this._gl.ONE_MINUS_SRC_ALPHA), this._gl.clearColor(this._clearColor.r, this._clearColor.g, this._clearColor.b, this._clearAlpha); } // rendering - renderObjects(h, _, g, x, c, v, M) { + renderObjects(u, p, g, w, o, v, M) { var E, $, k, L, z, O, R; - _ ? (z = h.length - 1, O = -1, R = -1) : (z = 0, O = h.length, R = 1); - for (var P = z; P !== O; P += R) - if (E = h[P], E.render) { + p ? (z = u.length - 1, O = -1, R = -1) : (z = 0, O = u.length, R = 1); + for (var N = z; N !== O; N += R) + if (E = u[N], E.render) { if ($ = E.object, k = E.buffer, L = E[g], (E.hasAO || this._AOEnabled) && E[g + "Shaded"] && (L = E[g + "Shaded"]), !L) continue; M && this.setBlending(!0), this.setDepthTest(L.depthTest), this.setDepthWrite(L.depthWrite), this.setPolygonOffset(L.polygonOffset, L.polygonOffsetFactor, L.polygonOffsetUnits); - var U = $._modelViewMatrix.isReflected(); - if (this.setMaterialFaces(L, U), this.renderBuffer(x, c, v, L, k, $), (this._outlineEnabled || L.outline) && !L.wireframe && L.shaderID !== "basic" && L.opacity !== 0) { + var W = $._modelViewMatrix.isReflected(); + if (this.setMaterialFaces(L, W), this.renderBuffer(w, o, v, L, k, $), (this._outlineEnabled || L.outline) && !L.wireframe && L.shaderID !== "basic" && L.opacity !== 0) { let B = this._outlineMaterial; - L.shaderID == "sphereimposter" ? B = this._outlineSphereImposterMaterial : L.shaderID == "stickimposter" && (B = this._outlineStickImposterMaterial), this.renderBuffer(x, c, v, B, k, $); + L.shaderID == "sphereimposter" ? B = this._outlineSphereImposterMaterial : L.shaderID == "stickimposter" && (B = this._outlineStickImposterMaterial), this.renderBuffer(w, o, v, B, k, $); } } } - renderSprites(h, _, g) { - this._currentGeometryGroupHash = -1, this._currentProgram = null, this._currentCamera = null, this._oldDepthWrite = -1, this._oldDepthTest = -1, this._oldDoubleSided = -1, this._currentMaterialId = -1, this._oldFlipSided = -1, this._lightsNeedUpdate = !0, this.sprites.render(h, _, this._currentWidth, this._currentHeight, g), this._currentGeometryGroupHash = -1, this._currentProgram = null, this._currentCamera = null, this._oldDepthWrite = -1, this._oldDepthTest = -1, this._oldDoubleSided = -1, this._currentMaterialId = -1, this._oldFlipSided = -1; + renderSprites(u, p, g) { + this._currentGeometryGroupHash = -1, this._currentProgram = null, this._currentCamera = null, this._oldDepthWrite = -1, this._oldDepthTest = -1, this._oldDoubleSided = -1, this._currentMaterialId = -1, this._oldFlipSided = -1, this._lightsNeedUpdate = !0, this.sprites.render(u, p, this._currentWidth, this._currentHeight, g), this._currentGeometryGroupHash = -1, this._currentProgram = null, this._currentCamera = null, this._oldDepthWrite = -1, this._oldDepthTest = -1, this._oldDoubleSided = -1, this._currentMaterialId = -1, this._oldFlipSided = -1; } } } @@ -27310,23 +27310,23 @@ ATOM`, x); uniforms: null }; } - init(o) { - this.gl = o.context, this.renderer = o, this.precision = o.getPrecision(), this.sprite.vertices = new Float32Array(16), this.sprite.faces = new Uint16Array(6); - var u = 0; - this.sprite.vertices[u++] = -1, this.sprite.vertices[u++] = -1, this.sprite.vertices[u++] = 0, this.sprite.vertices[u++] = 0, this.sprite.vertices[u++] = 1, this.sprite.vertices[u++] = -1, this.sprite.vertices[u++] = 1, this.sprite.vertices[u++] = 0, this.sprite.vertices[u++] = 1, this.sprite.vertices[u++] = 1, this.sprite.vertices[u++] = 1, this.sprite.vertices[u++] = 1, this.sprite.vertices[u++] = -1, this.sprite.vertices[u++] = 1, this.sprite.vertices[u++] = 0, this.sprite.vertices[u++] = 1, u = 0, this.sprite.faces[u++] = 0, this.sprite.faces[u++] = 1, this.sprite.faces[u++] = 2, this.sprite.faces[u++] = 0, this.sprite.faces[u++] = 2, this.sprite.faces[u++] = 3, this.sprite.vertexBuffer = this.gl.createBuffer(), this.sprite.elementBuffer = this.gl.createBuffer(), this.gl.bindBuffer(this.gl.ARRAY_BUFFER, this.sprite.vertexBuffer), this.gl.bufferData(this.gl.ARRAY_BUFFER, this.sprite.vertices, this.gl.STATIC_DRAW), this.gl.bindBuffer(this.gl.ELEMENT_ARRAY_BUFFER, this.sprite.elementBuffer), this.gl.bufferData(this.gl.ELEMENT_ARRAY_BUFFER, this.sprite.faces, this.gl.STATIC_DRAW), this.sprite.program = this.createProgram( + init(c) { + this.gl = c.context, this.renderer = c, this.precision = c.getPrecision(), this.sprite.vertices = new Float32Array(16), this.sprite.faces = new Uint16Array(6); + var d = 0; + this.sprite.vertices[d++] = -1, this.sprite.vertices[d++] = -1, this.sprite.vertices[d++] = 0, this.sprite.vertices[d++] = 0, this.sprite.vertices[d++] = 1, this.sprite.vertices[d++] = -1, this.sprite.vertices[d++] = 1, this.sprite.vertices[d++] = 0, this.sprite.vertices[d++] = 1, this.sprite.vertices[d++] = 1, this.sprite.vertices[d++] = 1, this.sprite.vertices[d++] = 1, this.sprite.vertices[d++] = -1, this.sprite.vertices[d++] = 1, this.sprite.vertices[d++] = 0, this.sprite.vertices[d++] = 1, d = 0, this.sprite.faces[d++] = 0, this.sprite.faces[d++] = 1, this.sprite.faces[d++] = 2, this.sprite.faces[d++] = 0, this.sprite.faces[d++] = 2, this.sprite.faces[d++] = 3, this.sprite.vertexBuffer = this.gl.createBuffer(), this.sprite.elementBuffer = this.gl.createBuffer(), this.gl.bindBuffer(this.gl.ARRAY_BUFFER, this.sprite.vertexBuffer), this.gl.bufferData(this.gl.ARRAY_BUFFER, this.sprite.vertices, this.gl.STATIC_DRAW), this.gl.bindBuffer(this.gl.ELEMENT_ARRAY_BUFFER, this.sprite.elementBuffer), this.gl.bufferData(this.gl.ELEMENT_ARRAY_BUFFER, this.sprite.faces, this.gl.STATIC_DRAW), this.sprite.program = this.createProgram( r.ShaderLib.sprite, this.precision || 1 /** added default to single precision */ ), this.sprite.attributes = {}; - const p = {}; - this.sprite.attributes.position = this.gl.getAttribLocation(this.sprite.program, "position"), this.sprite.attributes.uv = this.gl.getAttribLocation(this.sprite.program, "uv"), p.uvOffset = this.gl.getUniformLocation(this.sprite.program, "uvOffset"), p.uvScale = this.gl.getUniformLocation(this.sprite.program, "uvScale"), p.rotation = this.gl.getUniformLocation(this.sprite.program, "rotation"), p.scale = this.gl.getUniformLocation(this.sprite.program, "scale"), p.alignment = this.gl.getUniformLocation(this.sprite.program, "alignment"), p.color = this.gl.getUniformLocation(this.sprite.program, "color"), p.map = this.gl.getUniformLocation(this.sprite.program, "map"), p.opacity = this.gl.getUniformLocation(this.sprite.program, "opacity"), p.useScreenCoordinates = this.gl.getUniformLocation(this.sprite.program, "useScreenCoordinates"), p.screenPosition = this.gl.getUniformLocation(this.sprite.program, "screenPosition"), p.modelViewMatrix = this.gl.getUniformLocation(this.sprite.program, "modelViewMatrix"), p.projectionMatrix = this.gl.getUniformLocation(this.sprite.program, "projectionMatrix"), p.fogType = this.gl.getUniformLocation(this.sprite.program, "fogType"), p.fogDensity = this.gl.getUniformLocation(this.sprite.program, "fogDensity"), p.fogNear = this.gl.getUniformLocation(this.sprite.program, "fogNear"), p.fogFar = this.gl.getUniformLocation(this.sprite.program, "fogFar"), p.fogColor = this.gl.getUniformLocation(this.sprite.program, "fogColor"), p.alphaTest = this.gl.getUniformLocation(this.sprite.program, "alphaTest"), this.sprite.uniforms = p; + const _ = {}; + this.sprite.attributes.position = this.gl.getAttribLocation(this.sprite.program, "position"), this.sprite.attributes.uv = this.gl.getAttribLocation(this.sprite.program, "uv"), _.uvOffset = this.gl.getUniformLocation(this.sprite.program, "uvOffset"), _.uvScale = this.gl.getUniformLocation(this.sprite.program, "uvScale"), _.rotation = this.gl.getUniformLocation(this.sprite.program, "rotation"), _.scale = this.gl.getUniformLocation(this.sprite.program, "scale"), _.alignment = this.gl.getUniformLocation(this.sprite.program, "alignment"), _.color = this.gl.getUniformLocation(this.sprite.program, "color"), _.map = this.gl.getUniformLocation(this.sprite.program, "map"), _.opacity = this.gl.getUniformLocation(this.sprite.program, "opacity"), _.useScreenCoordinates = this.gl.getUniformLocation(this.sprite.program, "useScreenCoordinates"), _.screenPosition = this.gl.getUniformLocation(this.sprite.program, "screenPosition"), _.modelViewMatrix = this.gl.getUniformLocation(this.sprite.program, "modelViewMatrix"), _.projectionMatrix = this.gl.getUniformLocation(this.sprite.program, "projectionMatrix"), _.fogType = this.gl.getUniformLocation(this.sprite.program, "fogType"), _.fogDensity = this.gl.getUniformLocation(this.sprite.program, "fogDensity"), _.fogNear = this.gl.getUniformLocation(this.sprite.program, "fogNear"), _.fogFar = this.gl.getUniformLocation(this.sprite.program, "fogFar"), _.fogColor = this.gl.getUniformLocation(this.sprite.program, "fogColor"), _.alphaTest = this.gl.getUniformLocation(this.sprite.program, "alphaTest"), this.sprite.uniforms = _; } - render(o, u, p, m, y) { - var w, b, A, f, s, h, _, g, x, c; + render(c, d, _, m, y) { + var x, b, A, f, s, u, p, g, w, o; if (!this.gl) throw new Error("WebGLRenderer not initialized"); let v = []; - (w = o == null ? void 0 : o.__webglSprites) === null || w === void 0 || w.forEach((re) => { + (x = c == null ? void 0 : c.__webglSprites) === null || x === void 0 || x.forEach((re) => { (y && re.material.depthTest == !1 || !y && re.material.depthTest) && v.push(re); }); let M = v.length; @@ -27335,46 +27335,46 @@ ATOM`, x); const E = this.sprite.attributes, $ = this.sprite.uniforms; if (!$) throw new Error("Uniforms not defined"); - var k = p * 0.5, L = m * 0.5; - this.gl.useProgram(this.sprite.program), this.gl.enableVertexAttribArray(E.position), this.gl.enableVertexAttribArray(E.uv), this.gl.disable(this.gl.CULL_FACE), this.gl.enable(this.gl.BLEND), this.gl.bindBuffer(this.gl.ARRAY_BUFFER, this.sprite.vertexBuffer), this.gl.vertexAttribPointer(E.position, 2, this.gl.FLOAT, !1, 16, 0), this.gl.vertexAttribPointer(E.uv, 2, this.gl.FLOAT, !1, 16, 8), this.gl.bindBuffer(this.gl.ELEMENT_ARRAY_BUFFER, this.sprite.elementBuffer), this.gl.uniformMatrix4fv($.projectionMatrix, !1, u.projectionMatrix.elements), this.gl.activeTexture(this.gl.TEXTURE0), this.gl.uniform1i($.map, 0); - var z = 0, O = 0, R = o.fog; + var k = _ * 0.5, L = m * 0.5; + this.gl.useProgram(this.sprite.program), this.gl.enableVertexAttribArray(E.position), this.gl.enableVertexAttribArray(E.uv), this.gl.disable(this.gl.CULL_FACE), this.gl.enable(this.gl.BLEND), this.gl.bindBuffer(this.gl.ARRAY_BUFFER, this.sprite.vertexBuffer), this.gl.vertexAttribPointer(E.position, 2, this.gl.FLOAT, !1, 16, 0), this.gl.vertexAttribPointer(E.uv, 2, this.gl.FLOAT, !1, 16, 8), this.gl.bindBuffer(this.gl.ELEMENT_ARRAY_BUFFER, this.sprite.elementBuffer), this.gl.uniformMatrix4fv($.projectionMatrix, !1, d.projectionMatrix.elements), this.gl.activeTexture(this.gl.TEXTURE0), this.gl.uniform1i($.map, 0); + var z = 0, O = 0, R = c.fog; R ? (this.gl.uniform3f($.fogColor, R.color.r, R.color.g, R.color.b), this.gl.uniform1f($.fogNear, R.near), this.gl.uniform1f($.fogFar, R.far), this.gl.uniform1i($.fogType, 1), z = 1, O = 1) : (this.gl.uniform1i($.fogType, 0), z = 0, O = 0); - var P; - let U, B, N, G, H = []; - for (P = 0; P < M; P++) - U = v[P], B = U.material, B && (B.depthTest == !1 && !y || !U.visible || B.opacity === 0 || (B.useScreenCoordinates ? U.z = -U.position.z : (U._modelViewMatrix.multiplyMatrices(u.matrixWorldInverse, U.matrixWorld), U.z = -U._modelViewMatrix.elements[14]))); - for (v.sort(l), P = 0; P < M; P++) - if (U = v[P], B = U.material, !!B && !(!U.visible || B.opacity === 0) && B.map && B.map.image && B.map.image.width) { + var N; + let W, B, P, G, H = []; + for (N = 0; N < M; N++) + W = v[N], B = W.material, B && (B.depthTest == !1 && !y || !W.visible || B.opacity === 0 || (B.useScreenCoordinates ? W.z = -W.position.z : (W._modelViewMatrix.multiplyMatrices(d.matrixWorldInverse, W.matrixWorld), W.z = -W._modelViewMatrix.elements[14]))); + for (v.sort(l), N = 0; N < M; N++) + if (W = v[N], B = W.material, !!B && !(!W.visible || B.opacity === 0) && B.map && B.map.image && B.map.image.width) { this.gl.uniform1f(($ == null ? void 0 : $.alphaTest) || null, B.alphaTest); - var W = B.map.image.width, V = B.map.image.height; - H[0] = W * this.renderer.devicePixelRatio / p, H[1] = V * this.renderer.devicePixelRatio / m, B.useScreenCoordinates === !0 ? (this.gl.uniform1i($.useScreenCoordinates, 1), this.gl.uniform3f($.screenPosition, (U.position.x * this.renderer.devicePixelRatio - k) / k, (L - U.position.y * this.renderer.devicePixelRatio) / L, Math.max(0, Math.min(1, U.position.z)))) : (this.gl.uniform1i($.useScreenCoordinates, 0), this.gl.uniformMatrix4fv($.modelViewMatrix, !1, U._modelViewMatrix.elements)), o.fog && B.fog ? G = O : G = 0, z !== G && (this.gl.uniform1i($.fogType, G), z = G), N = 1 / (B.scaleByViewport ? m : 1), H[0] *= N * U.scale.x, H[1] *= N * U.scale.y; + var U = B.map.image.width, j = B.map.image.height; + H[0] = U * this.renderer.devicePixelRatio / _, H[1] = j * this.renderer.devicePixelRatio / m, B.useScreenCoordinates === !0 ? (this.gl.uniform1i($.useScreenCoordinates, 1), this.gl.uniform3f($.screenPosition, (W.position.x * this.renderer.devicePixelRatio - k) / k, (L - W.position.y * this.renderer.devicePixelRatio) / L, Math.max(0, Math.min(1, W.position.z)))) : (this.gl.uniform1i($.useScreenCoordinates, 0), this.gl.uniformMatrix4fv($.modelViewMatrix, !1, W._modelViewMatrix.elements)), c.fog && B.fog ? G = O : G = 0, z !== G && (this.gl.uniform1i($.fogType, G), z = G), P = 1 / (B.scaleByViewport ? m : 1), H[0] *= P * W.scale.x, H[1] *= P * W.scale.y; let re = (b = B == null ? void 0 : B.alignment) === null || b === void 0 ? void 0 : b.x, ie = (A = B == null ? void 0 : B.alignment) === null || A === void 0 ? void 0 : A.y; - B.screenOffset && (re = (re || 0) + 2 * B.screenOffset.x / W, ie = (ie || 0) + 2 * B.screenOffset.y / V), this.gl.uniform2f($.uvScale, ((f = B == null ? void 0 : B.uvScale) === null || f === void 0 ? void 0 : f.x) || 1, ((s = B == null ? void 0 : B.uvScale) === null || s === void 0 ? void 0 : s.y) || 1), this.gl.uniform2f($.uvOffset, ((h = B == null ? void 0 : B.uvOffset) === null || h === void 0 ? void 0 : h.x) || 0, ((_ = B == null ? void 0 : B.uvOffset) === null || _ === void 0 ? void 0 : _.y) || 0), this.gl.uniform2f($.alignment, re || 0, ie || 0), this.gl.uniform1f($.opacity, B.opacity), this.gl.uniform3f($.color, ((g = B == null ? void 0 : B.color) === null || g === void 0 ? void 0 : g.r) || 0, ((x = B == null ? void 0 : B.color) === null || x === void 0 ? void 0 : x.g) || 0, ((c = B == null ? void 0 : B.color) === null || c === void 0 ? void 0 : c.b) || 0), this.gl.uniform1f($.rotation, U.rotation), this.gl.uniform2fv($.scale, H), this.renderer.setDepthTest(B.depthTest), this.renderer.setDepthWrite(B.depthWrite), this.renderer.setTexture(B.map, 0), this.gl.drawElements(this.gl.TRIANGLES, 6, this.gl.UNSIGNED_SHORT, 0); + B.screenOffset && (re = (re || 0) + 2 * B.screenOffset.x / U, ie = (ie || 0) + 2 * B.screenOffset.y / j), this.gl.uniform2f($.uvScale, ((f = B == null ? void 0 : B.uvScale) === null || f === void 0 ? void 0 : f.x) || 1, ((s = B == null ? void 0 : B.uvScale) === null || s === void 0 ? void 0 : s.y) || 1), this.gl.uniform2f($.uvOffset, ((u = B == null ? void 0 : B.uvOffset) === null || u === void 0 ? void 0 : u.x) || 0, ((p = B == null ? void 0 : B.uvOffset) === null || p === void 0 ? void 0 : p.y) || 0), this.gl.uniform2f($.alignment, re || 0, ie || 0), this.gl.uniform1f($.opacity, B.opacity), this.gl.uniform3f($.color, ((g = B == null ? void 0 : B.color) === null || g === void 0 ? void 0 : g.r) || 0, ((w = B == null ? void 0 : B.color) === null || w === void 0 ? void 0 : w.g) || 0, ((o = B == null ? void 0 : B.color) === null || o === void 0 ? void 0 : o.b) || 0), this.gl.uniform1f($.rotation, W.rotation), this.gl.uniform2fv($.scale, H), this.renderer.setDepthTest(B.depthTest), this.renderer.setDepthWrite(B.depthWrite), this.renderer.setTexture(B.map, 0), this.gl.drawElements(this.gl.TRIANGLES, 6, this.gl.UNSIGNED_SHORT, 0); } this.gl.enable(this.gl.CULL_FACE); } - createProgram(o, u) { + createProgram(c, d) { if (!this.gl) throw new Error("WebGL Rendering context not found"); - var p = this.gl.createProgram(); - if (!p) + var _ = this.gl.createProgram(); + if (!_) throw new Error("Error creating webgl program"); var m = this.gl.createShader(this.gl.FRAGMENT_SHADER), y = this.gl.createShader(this.gl.VERTEX_SHADER); if (!m) throw new Error("Unable to create fragment shader SpritePlugin.createProgram"); if (!y) throw new Error("Unable to create vertex shader SpritePlugin.createProgram"); - var w = "precision " + u + ` float; + var x = "precision " + d + ` float; `; - if (this.gl.shaderSource(m, w + o.fragmentShader), this.gl.shaderSource(y, w + o.vertexShader), this.gl.compileShader(m), this.gl.compileShader(y), !this.gl.getShaderParameter(m, this.gl.COMPILE_STATUS) || !this.gl.getShaderParameter(y, this.gl.COMPILE_STATUS)) + if (this.gl.shaderSource(m, x + c.fragmentShader), this.gl.shaderSource(y, x + c.vertexShader), this.gl.compileShader(m), this.gl.compileShader(y), !this.gl.getShaderParameter(m, this.gl.COMPILE_STATUS) || !this.gl.getShaderParameter(y, this.gl.COMPILE_STATUS)) throw new Error(`Error compiling shader: ${this.gl.getShaderInfoLog(m)} ${this.gl.getShaderInfoLog(y)}`); - return this.gl.attachShader(p, m), this.gl.attachShader(p, y), this.gl.linkProgram(p), this.gl.getProgramParameter(p, this.gl.LINK_STATUS) || console.error("Could not initialize shader"), p; + return this.gl.attachShader(_, m), this.gl.attachShader(_, y), this.gl.linkProgram(_), this.gl.getProgramParameter(_, this.gl.LINK_STATUS) || console.error("Could not initialize shader"), _; } } - function l(d, o) { - return d.z !== o.z ? o.z - d.z : o.id - d.id; + function l(h, c) { + return h.z !== c.z ? c.z - h.z : c.id - h.id; } } ), @@ -27496,7 +27496,7 @@ ATOM`, x); /* harmony export */ FloatType: () => ( /* binding */ - u + d ), /* harmony export */ LinearFilter: () => ( @@ -27506,7 +27506,7 @@ ATOM`, x); /* harmony export */ LinearMipMapLinearFilter: () => ( /* binding */ - d + h ), /* harmony export */ NearestFilter: () => ( @@ -27526,16 +27526,16 @@ ATOM`, x); /* harmony export */ RGBAFormat: () => ( /* binding */ - p + _ ), /* harmony export */ UnsignedByteType: () => ( /* binding */ - o + c ) /* harmony export */ }); - const r = 1001, a = 1006, l = 1007, d = 1008, o = 1009, u = 1010, p = 1021, m = 1022, y = 1023; + const r = 1001, a = 1006, l = 1007, h = 1008, c = 1009, d = 1010, _ = 1021, m = 1022, y = 1023; } ), /***/ @@ -27575,7 +27575,7 @@ ATOM`, x); /* harmony export */ ClampToEdgeWrapping: () => ( /* reexport safe */ - o.ClampToEdgeWrapping + c.ClampToEdgeWrapping ), /* harmony export */ Coloring: () => ( @@ -27590,7 +27590,7 @@ ATOM`, x); /* harmony export */ FloatType: () => ( /* reexport safe */ - o.FloatType + c.FloatType ), /* harmony export */ FrontSide: () => ( @@ -27600,32 +27600,32 @@ ATOM`, x); /* harmony export */ LinearFilter: () => ( /* reexport safe */ - o.LinearFilter + c.LinearFilter ), /* harmony export */ LinearMipMapLinearFilter: () => ( /* reexport safe */ - o.LinearMipMapLinearFilter + c.LinearMipMapLinearFilter ), /* harmony export */ NearestFilter: () => ( /* reexport safe */ - o.NearestFilter + c.NearestFilter ), /* harmony export */ R32Format: () => ( /* reexport safe */ - o.R32Format + c.R32Format ), /* harmony export */ RFormat: () => ( /* reexport safe */ - o.RFormat + c.RFormat ), /* harmony export */ RGBAFormat: () => ( /* reexport safe */ - o.RGBAFormat + c.RGBAFormat ), /* harmony export */ Shading: () => ( @@ -27635,17 +27635,17 @@ ATOM`, x); /* harmony export */ SpriteAlignment: () => ( /* reexport safe */ - d.SpriteAlignment + h.SpriteAlignment ), /* harmony export */ TextureOperations: () => ( /* reexport safe */ - u.TextureOperations + d.TextureOperations ), /* harmony export */ UnsignedByteType: () => ( /* reexport safe */ - o.UnsignedByteType + c.UnsignedByteType ) /* harmony export */ }); @@ -27658,13 +27658,13 @@ ATOM`, x); ), l = t( /*! ./Shading */ "./src/WebGL/constants/Shading.ts" - ), d = t( + ), h = t( /*! ./SpriteAlignment */ "./src/WebGL/constants/SpriteAlignment.ts" - ), o = t( + ), c = t( /*! ./TextureConstants */ "./src/WebGL/constants/TextureConstants.ts" - ), u = t( + ), d = t( /*! ./TextureOperations */ "./src/WebGL/constants/TextureOperations.ts" ); @@ -27690,23 +27690,23 @@ ATOM`, x); this.listeners = {}; } dispatchEvent(l) { - var d = this.listeners[l.type]; - if (d !== void 0) { + var h = this.listeners[l.type]; + if (h !== void 0) { l.target = this; - for (var o = 0, u = d.length; o < u; o++) - d[o].call(this, l); + for (var c = 0, d = h.length; c < d; c++) + h[c].call(this, l); } } - removeEventListener(l, d) { - if (!d) + removeEventListener(l, h) { + if (!h) this.listeners[l] = []; else { - var o = this.listeners[l].indexOf(d); - o !== -1 && this.listeners[l].splice(o, 1); + var c = this.listeners[l].indexOf(h); + c !== -1 && this.listeners[l].splice(c, 1); } } - addEventListener(l, d) { - this.listeners[l] === void 0 && (this.listeners[l] = []), this.listeners[l].indexOf(d) === -1 && this.listeners[l].push(d); + addEventListener(l, h) { + this.listeners[l] === void 0 && (this.listeners[l] = []), this.listeners[l].indexOf(h) === -1 && this.listeners[l].push(h); } } } @@ -27722,12 +27722,12 @@ ATOM`, x); /* harmony export */ Geometry: () => ( /* binding */ - p + _ ), /* harmony export */ GeometryGroup: () => ( /* binding */ - u + d ), /* harmony export */ GeometryIDCount: () => ( @@ -27745,26 +27745,26 @@ ATOM`, x); ), l = t( /*! ../math */ "./src/WebGL/math/index.ts" - ), d = t( + ), h = t( /*! ../../colors */ "./src/colors.ts" ); - const o = 65535; - class u { - constructor(w = 0) { - this.vertexArray = null, this.colorArray = null, this.normalArray = null, this.radiusArray = null, this.faceArray = null, this.lineArray = null, this.atomArray = Array(), this.vertices = 0, this.faceidx = 0, this.lineidx = 0, this.__inittedArrays = !1, this.id = w; + const c = 65535; + class d { + constructor(x = 0) { + this.vertexArray = null, this.colorArray = null, this.normalArray = null, this.radiusArray = null, this.faceArray = null, this.lineArray = null, this.atomArray = Array(), this.vertices = 0, this.faceidx = 0, this.lineidx = 0, this.__inittedArrays = !1, this.id = x; } - setColor(w) { + setColor(x) { var b = this.vertexArray, A = this.colorArray; if (!b) throw new Error("vertex array not initialized"); if (!A) throw new Error("color array not initialized"); - let f = d.CC.color(w); + let f = h.CC.color(x); for (var s = 0; s < b.length; s += 3) A[s] = f.r, A[s + 1] = f.g, A[s + 2] = f.b; } - setColors(w) { + setColors(x) { var b = this.vertexArray, A = this.colorArray; if (!b) throw new Error("vertex array not initialized"); @@ -27775,8 +27775,8 @@ ATOM`, x); return; } for (var f = 0; f < b.length; f += 3) { - var s = w(b[f], b[f + 1], b[f + 2]); - s instanceof d.Color || (s = d.CC.color(s)), A[f] = s.r, A[f + 1] = s.g, A[f + 2] = s.b; + var s = x(b[f], b[f + 1], b[f + 2]); + s instanceof h.Color || (s = h.CC.color(s)), A[f] = s.r, A[f + 1] = s.g, A[f + 2] = s.b; } } getNumVertices() { @@ -27788,22 +27788,22 @@ ATOM`, x); getCentroid() { if (!this.vertexArray) throw new Error("vertex array not initialized"); - for (var w = new l.Vector3(), b, A, f, s, h = 0; h < this.vertices; ++h) - b = h * 3, A = this.vertexArray[b], f = this.vertexArray[b + 1], s = this.vertexArray[b + 2], w.x += A, w.y += f, w.z += s; - return w.divideScalar(this.vertices), w; + for (var x = new l.Vector3(), b, A, f, s, u = 0; u < this.vertices; ++u) + b = u * 3, A = this.vertexArray[b], f = this.vertexArray[b + 1], s = this.vertexArray[b + 2], x.x += A, x.y += f, x.z += s; + return x.divideScalar(this.vertices), x; } //setup normals - vertex and face array must exist setNormals() { - var w = this.faceArray, b = this.vertexArray, A = this.normalArray; + var x = this.faceArray, b = this.vertexArray, A = this.normalArray; if (!(!this.vertices || !this.faceidx)) { - if (!w) + if (!x) throw new Error("face array not initialized"); if (!b) throw new Error("vertex array not initialized"); if (!A) throw new Error("normal array not initialized"); - for (var f, s, h, _, g, x, c, v = 0; v < w.length / 3; ++v) - f = w[v * 3] * 3, s = w[v * 3 + 1] * 3, h = w[v * 3 + 2] * 3, _ = new l.Vector3(b[f], b[f + 1], b[f + 2]), g = new l.Vector3(b[s], b[s + 1], b[s + 2]), x = new l.Vector3(b[h], b[h + 1], b[h + 2]), _.subVectors(_, g), x.subVectors(x, g), x.cross(_), c = x, c.normalize(), A[f] += c.x, A[s] += c.x, A[h] += c.x, A[f + 1] += c.y, A[s + 1] += c.y, A[h + 1] += c.y, A[f + 2] += c.z, A[s + 2] += c.z, A[h + 2] += c.z; + for (var f, s, u, p, g, w, o, v = 0; v < x.length / 3; ++v) + f = x[v * 3] * 3, s = x[v * 3 + 1] * 3, u = x[v * 3 + 2] * 3, p = new l.Vector3(b[f], b[f + 1], b[f + 2]), g = new l.Vector3(b[s], b[s + 1], b[s + 2]), w = new l.Vector3(b[u], b[u + 1], b[u + 2]), p.subVectors(p, g), w.subVectors(w, g), w.cross(p), o = w, o.normalize(), A[f] += o.x, A[s] += o.x, A[u] += o.x, A[f + 1] += o.y, A[s + 1] += o.y, A[u + 1] += o.y, A[f + 2] += o.z, A[s + 2] += o.z, A[u + 2] += o.z; } } /* sets line index array from face arr @@ -27813,177 +27813,177 @@ ATOM`, x); as rectangles rather than two triangles) */ setLineIndices() { if (this.faceidx && !(this.lineArray && this.lineArray.length == this.faceidx * 2 && this.lineidx == this.faceidx * 2)) { - var w = this.faceArray, b = this.lineArray = new Uint16Array(this.faceidx * 2); - if (this.lineidx = this.faceidx * 2, !w) + var x = this.faceArray, b = this.lineArray = new Uint16Array(this.faceidx * 2); + if (this.lineidx = this.faceidx * 2, !x) throw new Error("face array not initialized"); for (var A = 0; A < this.faceidx / 3; ++A) { - var f = A * 3, s = f * 2, h = w[f], _ = w[f + 1], g = w[f + 2]; - b[s] = h, b[s + 1] = _, b[s + 2] = h, b[s + 3] = g, b[s + 4] = _, b[s + 5] = g; + var f = A * 3, s = f * 2, u = x[f], p = x[f + 1], g = x[f + 2]; + b[s] = u, b[s + 1] = p, b[s + 2] = u, b[s + 3] = g, b[s + 4] = p, b[s + 5] = g; } } } - vrml(w, b) { - var A, f, s, h, _, g, x, c, v, M, E, $, k, L, z, O, R, P, U = ""; - if (U += w + `Shape { -` + w + ` appearance Appearance { -` + w + ` material Material { -` + w + " diffuseColor " + ((A = b == null ? void 0 : b.color) === null || A === void 0 ? void 0 : A.r) + " " + ((f = b == null ? void 0 : b.color) === null || f === void 0 ? void 0 : f.g) + " " + ((s = b == null ? void 0 : b.color) === null || s === void 0 ? void 0 : s.b) + ` + vrml(x, b) { + var A, f, s, u, p, g, w, o, v, M, E, $, k, L, z, O, R, N, W = ""; + if (W += x + `Shape { +` + x + ` appearance Appearance { +` + x + ` material Material { +` + x + " diffuseColor " + ((A = b == null ? void 0 : b.color) === null || A === void 0 ? void 0 : A.r) + " " + ((f = b == null ? void 0 : b.color) === null || f === void 0 ? void 0 : f.g) + " " + ((s = b == null ? void 0 : b.color) === null || s === void 0 ? void 0 : s.b) + ` `, b.wireframe && this.colorArray) { - let N = this.colorArray; - U += w + " emissiveColor " + N[0] + " " + N[1] + " " + N[2] + ` + let P = this.colorArray; + W += x + " emissiveColor " + P[0] + " " + P[1] + " " + P[2] + ` `; } - b != null && b.transparent && (U += w + " transparency " + (1 - b.opacity) + ` -`), U += w + ` } -`, U += w + ` } + b != null && b.transparent && (W += x + " transparency " + (1 - b.opacity) + ` +`), W += x + ` } +`, W += x + ` } `; - var B = w; - if (w += " ", b instanceof r.LineBasicMaterial || b.wireframe) { - U += w + `geometry IndexedLineSet { -` + w + ` colorPerVertex TRUE -` + w + ` coord Coordinate { -` + w + ` point [ + var B = x; + if (x += " ", b instanceof r.LineBasicMaterial || b.wireframe) { + W += x + `geometry IndexedLineSet { +` + x + ` colorPerVertex TRUE +` + x + ` coord Coordinate { +` + x + ` point [ `; - let N, G, H; - for (let W = 0; W < this.vertices; ++W) { - let V = W * 3; - N = (h = this.vertexArray) === null || h === void 0 ? void 0 : h[V], G = (_ = this.vertexArray) === null || _ === void 0 ? void 0 : _[V + 1], H = (g = this.vertexArray) === null || g === void 0 ? void 0 : g[V + 2], U += w + " " + N + " " + G + " " + H + `, + let P, G, H; + for (let U = 0; U < this.vertices; ++U) { + let j = U * 3; + P = (u = this.vertexArray) === null || u === void 0 ? void 0 : u[j], G = (p = this.vertexArray) === null || p === void 0 ? void 0 : p[j + 1], H = (g = this.vertexArray) === null || g === void 0 ? void 0 : g[j + 2], W += x + " " + P + " " + G + " " + H + `, `; } - if (U += w + ` ] -`, U += w + ` } + if (W += x + ` ] +`, W += x + ` } `, this.colorArray && !b.wireframe) { - U += w + ` color Color { -` + w + ` color [ + W += x + ` color Color { +` + x + ` color [ `; - for (let W = 0; W < this.vertices; ++W) { - let V = W * 3; - N = this.colorArray[V], G = this.colorArray[V + 1], H = this.colorArray[V + 2], U += w + " " + N + " " + G + " " + H + `, + for (let U = 0; U < this.vertices; ++U) { + let j = U * 3; + P = this.colorArray[j], G = this.colorArray[j + 1], H = this.colorArray[j + 2], W += x + " " + P + " " + G + " " + H + `, `; } - U += w + ` ] -`, U += w + ` } + W += x + ` ] +`, W += x + ` } `; } - if (U += w + ` coordIndex [ + if (W += x + ` coordIndex [ `, b.wireframe && this.faceArray) - for (let W = 0; W < this.faceidx; W += 3) - N = (x = this.faceArray) === null || x === void 0 ? void 0 : x[W], G = (c = this.faceArray) === null || c === void 0 ? void 0 : c[W + 1], H = (v = this.faceArray) === null || v === void 0 ? void 0 : v[W + 2], U += w + " " + N + ", " + G + ", " + H + `, -1, + for (let U = 0; U < this.faceidx; U += 3) + P = (w = this.faceArray) === null || w === void 0 ? void 0 : w[U], G = (o = this.faceArray) === null || o === void 0 ? void 0 : o[U + 1], H = (v = this.faceArray) === null || v === void 0 ? void 0 : v[U + 2], W += x + " " + P + ", " + G + ", " + H + `, -1, `; else - for (let W = 0; W < this.vertices - 1; W += 2) - U += w + " " + W + ", " + (W + 1) + `, -1, + for (let U = 0; U < this.vertices - 1; U += 2) + W += x + " " + U + ", " + (U + 1) + `, -1, `; - U += w + ` ] -`, U += w + `} + W += x + ` ] +`, W += x + `} `; } else { - U += w + `geometry IndexedFaceSet { -` + w + ` colorPerVertex TRUE -` + w + ` normalPerVertex TRUE -` + w + ` solid FALSE -`, U += w + ` coord Coordinate { -` + w + ` point [ + W += x + `geometry IndexedFaceSet { +` + x + ` colorPerVertex TRUE +` + x + ` normalPerVertex TRUE +` + x + ` solid FALSE +`, W += x + ` coord Coordinate { +` + x + ` point [ `; - let N, G, H; - for (let W = 0; W < this.vertices; ++W) { - let V = W * 3; - N = (M = this.vertexArray) === null || M === void 0 ? void 0 : M[V], G = (E = this.vertexArray) === null || E === void 0 ? void 0 : E[V + 1], H = ($ = this.vertexArray) === null || $ === void 0 ? void 0 : $[V + 2], U += w + " " + N + " " + G + " " + H + `, + let P, G, H; + for (let U = 0; U < this.vertices; ++U) { + let j = U * 3; + P = (M = this.vertexArray) === null || M === void 0 ? void 0 : M[j], G = (E = this.vertexArray) === null || E === void 0 ? void 0 : E[j + 1], H = ($ = this.vertexArray) === null || $ === void 0 ? void 0 : $[j + 2], W += x + " " + P + " " + G + " " + H + `, `; } - U += w + ` ] -`, U += w + ` } -`, U += w + ` normal Normal { -` + w + ` vector [ + W += x + ` ] +`, W += x + ` } +`, W += x + ` normal Normal { +` + x + ` vector [ `; - for (let W = 0; W < this.vertices; ++W) { - let V = W * 3; - N = (k = this.normalArray) === null || k === void 0 ? void 0 : k[V], G = (L = this.normalArray) === null || L === void 0 ? void 0 : L[V + 1], H = (z = this.normalArray) === null || z === void 0 ? void 0 : z[V + 2], U += w + " " + N + " " + G + " " + H + `, + for (let U = 0; U < this.vertices; ++U) { + let j = U * 3; + P = (k = this.normalArray) === null || k === void 0 ? void 0 : k[j], G = (L = this.normalArray) === null || L === void 0 ? void 0 : L[j + 1], H = (z = this.normalArray) === null || z === void 0 ? void 0 : z[j + 2], W += x + " " + P + " " + G + " " + H + `, `; } - if (U += w + ` ] -`, U += w + ` } + if (W += x + ` ] +`, W += x + ` } `, this.colorArray) { - U += w + ` color Color { -` + w + ` color [ + W += x + ` color Color { +` + x + ` color [ `; - for (let W = 0; W < this.vertices; ++W) { - let V = W * 3; - N = this.colorArray[V], G = this.colorArray[V + 1], H = this.colorArray[V + 2], U += w + " " + N + " " + G + " " + H + `, + for (let U = 0; U < this.vertices; ++U) { + let j = U * 3; + P = this.colorArray[j], G = this.colorArray[j + 1], H = this.colorArray[j + 2], W += x + " " + P + " " + G + " " + H + `, `; } - U += w + ` ] -`, U += w + ` } + W += x + ` ] +`, W += x + ` } `; } - U += w + ` coordIndex [ + W += x + ` coordIndex [ `; - for (let W = 0; W < this.faceidx; W += 3) - N = (O = this.faceArray) === null || O === void 0 ? void 0 : O[W], G = (R = this.faceArray) === null || R === void 0 ? void 0 : R[W + 1], H = (P = this.faceArray) === null || P === void 0 ? void 0 : P[W + 2], U += w + " " + N + ", " + G + ", " + H + `, -1, + for (let U = 0; U < this.faceidx; U += 3) + P = (O = this.faceArray) === null || O === void 0 ? void 0 : O[U], G = (R = this.faceArray) === null || R === void 0 ? void 0 : R[U + 1], H = (N = this.faceArray) === null || N === void 0 ? void 0 : N[U + 2], W += x + " " + P + ", " + G + ", " + H + `, -1, `; - U += w + ` ] -`, U += w + `} + W += x + ` ] +`, W += x + `} `; } - return U += B + "}", U; + return W += B + "}", W; } - truncateArrayBuffers(w = !0, b = !1) { - var A = this.vertexArray, f = this.colorArray, s = this.normalArray, h = this.faceArray, _ = this.lineArray, g = this.radiusArray; - this.vertexArray = (A == null ? void 0 : A.subarray(0, this.vertices * 3)) || null, this.colorArray = (f == null ? void 0 : f.subarray(0, this.vertices * 3)) || null, w ? (this.normalArray = (s == null ? void 0 : s.subarray(0, this.vertices * 3)) || null, this.faceArray = (h == null ? void 0 : h.subarray(0, this.faceidx)) || null, this.lineidx > 0 ? this.lineArray = (_ == null ? void 0 : _.subarray(0, this.lineidx)) || null : this.lineArray = new Uint16Array(0)) : (this.normalArray = new Float32Array(0), this.faceArray = new Uint16Array(0), this.lineArray = new Uint16Array(0)), g && (this.radiusArray = g.subarray(0, this.vertices)), b && (this.normalArray && (this.normalArray = new Float32Array(this.normalArray)), this.faceArray && (this.faceArray = new Uint16Array(this.faceArray)), this.lineArray && (this.lineArray = new Uint16Array(this.lineArray)), this.vertexArray && (this.vertexArray = new Float32Array(this.vertexArray)), this.colorArray && (this.colorArray = new Float32Array(this.colorArray)), this.radiusArray && (this.radiusArray = new Float32Array(this.radiusArray))), this.__inittedArrays = !0; + truncateArrayBuffers(x = !0, b = !1) { + var A = this.vertexArray, f = this.colorArray, s = this.normalArray, u = this.faceArray, p = this.lineArray, g = this.radiusArray; + this.vertexArray = (A == null ? void 0 : A.subarray(0, this.vertices * 3)) || null, this.colorArray = (f == null ? void 0 : f.subarray(0, this.vertices * 3)) || null, x ? (this.normalArray = (s == null ? void 0 : s.subarray(0, this.vertices * 3)) || null, this.faceArray = (u == null ? void 0 : u.subarray(0, this.faceidx)) || null, this.lineidx > 0 ? this.lineArray = (p == null ? void 0 : p.subarray(0, this.lineidx)) || null : this.lineArray = new Uint16Array(0)) : (this.normalArray = new Float32Array(0), this.faceArray = new Uint16Array(0), this.lineArray = new Uint16Array(0)), g && (this.radiusArray = g.subarray(0, this.vertices)), b && (this.normalArray && (this.normalArray = new Float32Array(this.normalArray)), this.faceArray && (this.faceArray = new Uint16Array(this.faceArray)), this.lineArray && (this.lineArray = new Uint16Array(this.lineArray)), this.vertexArray && (this.vertexArray = new Float32Array(this.vertexArray)), this.colorArray && (this.colorArray = new Float32Array(this.colorArray)), this.radiusArray && (this.radiusArray = new Float32Array(this.radiusArray))), this.__inittedArrays = !0; } } - class p extends a.EventDispatcher { - constructor(w = !1, b = !1, A = !1) { - super(), this.name = "", this.hasTangents = !1, this.dynamic = !0, this.verticesNeedUpdate = !1, this.elementsNeedUpdate = !1, this.normalsNeedUpdate = !1, this.colorsNeedUpdate = !1, this.buffersNeedUpdate = !1, this.imposter = !1, this.instanced = !1, this.geometryGroups = [], this.groups = 0, this.id = m++, this.mesh = w, this.radii = b, this.offset = A; + class _ extends a.EventDispatcher { + constructor(x = !1, b = !1, A = !1) { + super(), this.name = "", this.hasTangents = !1, this.dynamic = !0, this.verticesNeedUpdate = !1, this.elementsNeedUpdate = !1, this.normalsNeedUpdate = !1, this.colorsNeedUpdate = !1, this.buffersNeedUpdate = !1, this.imposter = !1, this.instanced = !1, this.geometryGroups = [], this.groups = 0, this.id = m++, this.mesh = x, this.radii = b, this.offset = A; } //Get geometry group to accomodate addVertices new vertices - create // new group if necessary - updateGeoGroup(w = 0) { + updateGeoGroup(x = 0) { var b, A = this.groups > 0 ? this.geometryGroups[this.groups - 1] : null; - return (!A || A.vertices + w > (((b = A == null ? void 0 : A.vertexArray) === null || b === void 0 ? void 0 : b.length) || 0) / 3) && (A = this.addGeoGroup()), A; + return (!A || A.vertices + x > (((b = A == null ? void 0 : A.vertexArray) === null || b === void 0 ? void 0 : b.length) || 0) / 3) && (A = this.addGeoGroup()), A; } //return comma separated list of IndexedFace (or Line) sets from geometry groups - vrml(w, b) { + vrml(x, b) { for (var A = "", f = this.geometryGroups.length, s = 0; s < f; s++) { - var h = this.geometryGroups[s]; - A += h.vrml(w, b) + `, + var u = this.geometryGroups[s]; + A += u.vrml(x, b) + `, `; } return A; } addGeoGroup() { - var w = new u(this.geometryGroups.length); - return this.geometryGroups.push(w), this.groups = this.geometryGroups.length, w.vertexArray = new Float32Array(o * 3), w.colorArray = new Float32Array(o * 3), this.mesh && (w.normalArray = new Float32Array(o * 3), w.faceArray = new Uint16Array(o * 6), w.lineArray = new Uint16Array(o * 6)), this.radii && (w.radiusArray = new Float32Array(o)), w.useOffset = this.offset, w; + var x = new d(this.geometryGroups.length); + return this.geometryGroups.push(x), this.groups = this.geometryGroups.length, x.vertexArray = new Float32Array(c * 3), x.colorArray = new Float32Array(c * 3), this.mesh && (x.normalArray = new Float32Array(c * 3), x.faceArray = new Uint16Array(c * 6), x.lineArray = new Uint16Array(c * 6)), this.radii && (x.radiusArray = new Float32Array(c)), x.useOffset = this.offset, x; } - setUpNormals(...w) { + setUpNormals(...x) { for (var b = 0; b < this.groups; b++) { var A = this.geometryGroups[b]; - A.setNormals(...w); + A.setNormals(...x); } } - setColors(...w) { + setColors(...x) { for (var b = this.geometryGroups.length, A = 0; A < b; A++) { var f = this.geometryGroups[A]; - f.setColors(...w); + f.setColors(...x); } } - setColor(...w) { + setColor(...x) { for (var b = this.geometryGroups.length, A = 0; A < b; A++) { var f = this.geometryGroups[A]; - f.setColor(...w); + f.setColor(...x); } } - setUpWireframe(...w) { + setUpWireframe(...x) { for (var b = 0; b < this.groups; b++) { var A = this.geometryGroups[b]; - A.setLineIndices(...w); + A.setLineIndices(...x); } } //After vertices, colors, etc are collected in regular or typed arrays, // create typed arrays from regular arrays if they don't already exist, initTypedArrays() { - for (var w = 0; w < this.groups; w++) { - var b = this.geometryGroups[w]; + for (var x = 0; x < this.groups; x++) { + var b = this.geometryGroups[x]; b.__inittedArrays !== !0 && b.truncateArrayBuffers(this.mesh, !1); } } @@ -27991,9 +27991,9 @@ ATOM`, x); this.dispatchEvent({ type: "dispose" }); } get vertices() { - for (var w = 0, b = 0; b < this.groups; b++) - w += this.geometryGroups[b].vertices; - return w; + for (var x = 0, b = 0; b < this.groups; b++) + x += this.geometryGroups[b].vertices; + return x; } } let m = 0; @@ -28010,12 +28010,12 @@ ATOM`, x); /* harmony export */ Light: () => ( /* binding */ - u + d ), /* harmony export */ Object3D: () => ( /* binding */ - d + h ), /* harmony export */ Object3DIDCount: () => ( @@ -28025,7 +28025,7 @@ ATOM`, x); /* harmony export */ Scene: () => ( /* binding */ - o + c ) /* harmony export */ }); @@ -28037,7 +28037,7 @@ ATOM`, x); "./src/colors.ts" ); let l = 0; - class d { + class h { constructor() { this.id = l++, this.name = "", this.children = [], this.position = new r.Vector3(), this.rotation = new r.Vector3(), this.matrix = new r.Matrix4(), this.matrixWorld = new r.Matrix4(), this.quaternion = new r.Quaternion(), this.eulerOrder = "XYZ", this.up = new r.Vector3(0, 1, 0), this.scale = new r.Vector3(1, 1, 1), this.matrixAutoUpdate = !0, this.matrixWorldNeedsUpdate = !0, this.rotationAutoUpdate = !0, this.useQuaternion = !1, this.visible = !0; } @@ -28053,28 +28053,28 @@ ATOM`, x); m.parent = this, this.children.push(m); for (var y = this; y.parent !== void 0; ) y = y.parent; - y !== void 0 && y instanceof o && y.__addObject(m); + y !== void 0 && y instanceof c && y.__addObject(m); } remove(m) { var y = this.children.indexOf(m); if (y !== -1) { m.parent = void 0, this.children.splice(y, 1); - for (var w = this; w.parent !== void 0; ) - w = w.parent; - w !== void 0 && w instanceof o && w.__removeObject(m); + for (var x = this; x.parent !== void 0; ) + x = x.parent; + x !== void 0 && x instanceof c && x.__removeObject(m); } } //convert to vrml vrml(m) { m || (m = " "); - var y = 2 * Math.atan2(this.quaternion.lengthxyz(), this.quaternion.w), w = 0, b = 0, A = 0; + var y = 2 * Math.atan2(this.quaternion.lengthxyz(), this.quaternion.w), x = 0, b = 0, A = 0; if (y != 0) { - let h = Math.sin(y / 2); - w = this.quaternion.x / h, b = this.quaternion.y / h, A = this.quaternion.z / h; + let u = Math.sin(y / 2); + x = this.quaternion.x / u, b = this.quaternion.y / u, A = this.quaternion.z / u; } var f = m + `Transform { ` + m + " center " + this.position.x + " " + this.position.y + " " + this.position.z + ` -` + m + " rotation " + w + " " + b + " " + A + " " + y + ` +` + m + " rotation " + x + " " + b + " " + A + " " + y + ` ` + m + ` children [ `; this.geometry && (f += this.geometry.vrml(m, this.material)); @@ -28093,52 +28093,52 @@ ATOM`, x); this.children[y].updateMatrixWorld(!0); } clone(m) { - m === void 0 && (m = new d()), m.name = this.name, m.up.copy(this.up), m.position.copy(this.position), m.rotation instanceof r.Vector3 && this.rotation instanceof r.Vector3 ? m.rotation.copy(this.rotation) : m.rotation = this.rotation, m.eulerOrder = this.eulerOrder, m.scale.copy(this.scale), m.rotationAutoUpdate = this.rotationAutoUpdate, m.matrix.copy(this.matrix), m.matrixWorld.copy(this.matrixWorld), m.quaternion.copy(this.quaternion), m.matrixAutoUpdate = this.matrixAutoUpdate, m.matrixWorldNeedsUpdate = this.matrixWorldNeedsUpdate, m.useQuaternion = this.useQuaternion, m.visible = this.visible; + m === void 0 && (m = new h()), m.name = this.name, m.up.copy(this.up), m.position.copy(this.position), m.rotation instanceof r.Vector3 && this.rotation instanceof r.Vector3 ? m.rotation.copy(this.rotation) : m.rotation = this.rotation, m.eulerOrder = this.eulerOrder, m.scale.copy(this.scale), m.rotationAutoUpdate = this.rotationAutoUpdate, m.matrix.copy(this.matrix), m.matrixWorld.copy(this.matrixWorld), m.quaternion.copy(this.quaternion), m.matrixAutoUpdate = this.matrixAutoUpdate, m.matrixWorldNeedsUpdate = this.matrixWorldNeedsUpdate, m.useQuaternion = this.useQuaternion, m.visible = this.visible; for (var y = 0; y < this.children.length; y++) { - var w = this.children[y]; - m.add(w.clone()); + var x = this.children[y]; + m.add(x.clone()); } return m; } setVisible(m) { this.visible = m; for (var y = 0; y < this.children.length; y++) { - var w = this.children[y]; - w.setVisible(m); + var x = this.children[y]; + x.setVisible(m); } } } - class o extends d { + class c extends h { constructor() { super(...arguments), this.fog = null, this.overrideMaterial = null, this.matrixAutoUpdate = !1, this.__objects = [], this.__lights = [], this.__objectsAdded = [], this.__objectsRemoved = []; } __addObject(m) { - if (m instanceof u) + if (m instanceof d) this.__lights.indexOf(m) === -1 && this.__lights.push(m), m.target && m.target.parent === void 0 && this.add(m.target); else if (this.__objects.indexOf(m) === -1) { this.__objects.push(m), this.__objectsAdded.push(m); var y = this.__objectsRemoved.indexOf(m); y !== -1 && this.__objectsRemoved.splice(y, 1); } - for (var w = 0; w < m.children.length; w++) - this.__addObject(m.children[w]); + for (var x = 0; x < m.children.length; x++) + this.__addObject(m.children[x]); } __removeObject(m) { var y; - if (m instanceof u) + if (m instanceof d) y = this.__lights.indexOf(m), y !== -1 && this.__lights.splice(y, 1); else if (y = this.__objects.indexOf(m), y !== -1) { this.__objects.splice(y, 1), this.__objectsRemoved.push(m); - var w = this.__objectsAdded.indexOf(m); - w !== -1 && this.__objectsAdded.splice(y, 1); + var x = this.__objectsAdded.indexOf(m); + x !== -1 && this.__objectsAdded.splice(y, 1); } for (var b = 0; b < m.children.length; b++) this.__removeObject(m.children[b]); } } - class u extends d { + class d extends h { constructor(m, y = 1) { - super(), this.position = new r.Vector3(0, 1, 0), this.target = new d(), this.castShadow = !1, this.onlyShadow = !1, this.color = new a.Color(m), this.intensity = y; + super(), this.position = new r.Vector3(0, 1, 0), this.target = new h(), this.castShadow = !1, this.onlyShadow = !1, this.color = new a.Color(m), this.intensity = y; } } } @@ -28164,17 +28164,17 @@ ATOM`, x); ); const a = new r.Matrix4(); class l { - static unprojectVector(o, u) { - return u.projectionMatrixInverse.getInverse(u.projectionMatrix), a.multiplyMatrices(u.matrixWorld, u.projectionMatrixInverse), o.applyProjection(a); + static unprojectVector(c, d) { + return d.projectionMatrixInverse.getInverse(d.projectionMatrix), a.multiplyMatrices(d.matrixWorld, d.projectionMatrixInverse), c.applyProjection(a); } - static projectVector(o, u) { - return u.matrixWorldInverse.getInverse(u.matrixWorld), a.multiplyMatrices(u.projectionMatrix, u.matrixWorldInverse), o.applyProjection(a); + static projectVector(c, d) { + return d.matrixWorldInverse.getInverse(d.matrixWorld), a.multiplyMatrices(d.projectionMatrix, d.matrixWorldInverse), c.applyProjection(a); } - projectVector(o, u) { - return l.projectVector(o, u); + projectVector(c, d) { + return l.projectVector(c, d); } - unprojectVector(o, u) { - return l.unprojectVector(o, u); + unprojectVector(c, d) { + return l.unprojectVector(c, d); } } } @@ -28190,12 +28190,12 @@ ATOM`, x); /* harmony export */ Raycaster: () => ( /* binding */ - o + c ), /* harmony export */ intersectObject: () => ( /* binding */ - h + u ) /* harmony export */ }); @@ -28206,72 +28206,72 @@ ATOM`, x); /*! ../shapes */ "./src/WebGL/shapes/index.ts" ); - const l = (_, g) => _.distance - g.distance, d = new r.Matrix4(); - class o { - constructor(g, x, c, v) { - this.precision = 1e-4, this.linePrecision = 0.2, this.ray = new r.Ray(g, x), this.ray.direction.lengthSq() > 0 && this.ray.direction.normalize(), this.near = v || 0, this.far = c || 1 / 0; + const l = (p, g) => p.distance - g.distance, h = new r.Matrix4(); + class c { + constructor(g, w, o, v) { + this.precision = 1e-4, this.linePrecision = 0.2, this.ray = new r.Ray(g, w), this.ray.direction.lengthSq() > 0 && this.ray.direction.normalize(), this.near = v || 0, this.far = o || 1 / 0; } - set(g, x) { - this.ray.set(g, x); + set(g, w) { + this.ray.set(g, w); } - setFromCamera(g, x) { - x.ortho ? (this.ray.origin.set(g.x, g.y, (x.near + x.far) / (x.near - x.far)).unproject(x), this.ray.direction.set(0, 0, -1).transformDirection(x.matrixWorld)) : (this.ray.origin.setFromMatrixPosition(x.matrixWorld), this.ray.direction.set(g.x, g.y, g.z), x.projectionMatrixInverse.getInverse(x.projectionMatrix), d.multiplyMatrices(x.matrixWorld, x.projectionMatrixInverse), this.ray.direction.applyProjection(d), this.ray.direction.sub(this.ray.origin).normalize()); + setFromCamera(g, w) { + w.ortho ? (this.ray.origin.set(g.x, g.y, (w.near + w.far) / (w.near - w.far)).unproject(w), this.ray.direction.set(0, 0, -1).transformDirection(w.matrixWorld)) : (this.ray.origin.setFromMatrixPosition(w.matrixWorld), this.ray.direction.set(g.x, g.y, g.z), w.projectionMatrixInverse.getInverse(w.projectionMatrix), h.multiplyMatrices(w.matrixWorld, w.projectionMatrixInverse), this.ray.direction.applyProjection(h), this.ray.direction.sub(this.ray.origin).normalize()); } - intersectObjects(g, x) { - for (var c = [], v = 0, M = x.length; v < M; v++) - h(g, x[v], this, c); - return c.sort(l), c; + intersectObjects(g, w) { + for (var o = [], v = 0, M = w.length; v < M; v++) + u(g, w[v], this, o); + return o.sort(l), o; } } - const u = (_) => Math.min(Math.max(_, -1), 1); - var p = new a.Sphere(), m = new a.Cylinder(), y = new a.Triangle(), w = new r.Vector3(), b = new r.Vector3(), A = new r.Vector3(), f = new r.Vector3(), s = new r.Vector3(); - function h(_, g, x, c) { - if (s.getPositionFromMatrix(_.matrixWorld), g.intersectionShape === void 0) - return c; - var v = g.intersectionShape, M = x.linePrecision; - M *= _.matrixWorld.getMaxScaleOnAxis(); + const d = (p) => Math.min(Math.max(p, -1), 1); + var _ = new a.Sphere(), m = new a.Cylinder(), y = new a.Triangle(), x = new r.Vector3(), b = new r.Vector3(), A = new r.Vector3(), f = new r.Vector3(), s = new r.Vector3(); + function u(p, g, w, o) { + if (s.getPositionFromMatrix(p.matrixWorld), g.intersectionShape === void 0) + return o; + var v = g.intersectionShape, M = w.linePrecision; + M *= p.matrixWorld.getMaxScaleOnAxis(); var E = M * M; - if (g.boundingSphere !== void 0 && g.boundingSphere instanceof a.Sphere && (p.copy(g.boundingSphere), p.applyMatrix4(_.matrixWorld), !x.ray.isIntersectionSphere(p))) - return c; - var $, k, L, z, O, R, P, U, B, N, G, H, W, V; + if (g.boundingSphere !== void 0 && g.boundingSphere instanceof a.Sphere && (_.copy(g.boundingSphere), _.applyMatrix4(p.matrixWorld), !w.ray.isIntersectionSphere(_))) + return o; + var $, k, L, z, O, R, N, W, B, P, G, H, U, j; for ($ = 0, k = v.triangle.length; $ < k; $++) if (v.triangle[$] instanceof a.Triangle) { - if (y.copy(v.triangle[$]), y.applyMatrix4(_.matrixWorld), L = y.getNormal(), z = x.ray.direction.dot(L), z >= 0 || (w.subVectors(y.a, x.ray.origin), P = L.dot(w) / z, P < 0)) + if (y.copy(v.triangle[$]), y.applyMatrix4(p.matrixWorld), L = y.getNormal(), z = w.ray.direction.dot(L), z >= 0 || (x.subVectors(y.a, w.ray.origin), N = L.dot(x) / z, N < 0)) continue; - b.copy(x.ray.direction).multiplyScalar(P).add(x.ray.origin), b.sub(y.a), A.copy(y.b).sub(y.a), f.copy(y.c).sub(y.a); - var re = A.dot(f), ie = A.lengthSq(), ee = f.lengthSq(); - if (H = (ie * b.dot(f) - re * b.dot(A)) / (ie * ee - re * re), H < 0 || H > 1 || (G = (b.dot(A) - H * re) / ie, G < 0 || G > 1 || G + H > 1)) + b.copy(w.ray.direction).multiplyScalar(N).add(w.ray.origin), b.sub(y.a), A.copy(y.b).sub(y.a), f.copy(y.c).sub(y.a); + var re = A.dot(f), ie = A.lengthSq(), te = f.lengthSq(); + if (H = (ie * b.dot(f) - re * b.dot(A)) / (ie * te - re * re), H < 0 || H > 1 || (G = (b.dot(A) - H * re) / ie, G < 0 || G > 1 || G + H > 1)) continue; - c.push({ clickable: g, distance: P }); + o.push({ clickable: g, distance: N }); } for ($ = 0, k = v.cylinder.length; $ < k; $++) if (v.cylinder[$] instanceof a.Cylinder) { - if (m.copy(v.cylinder[$]), m.applyMatrix4(_.matrixWorld), w.subVectors(m.c1, x.ray.origin), O = w.dot(m.direction), R = w.dot(x.ray.direction), z = u(x.ray.direction.dot(m.direction)), B = 1 - z * z, B === 0) + if (m.copy(v.cylinder[$]), m.applyMatrix4(p.matrixWorld), x.subVectors(m.c1, w.ray.origin), O = x.dot(m.direction), R = x.dot(w.ray.direction), z = d(w.ray.direction.dot(m.direction)), B = 1 - z * z, B === 0) continue; - W = (z * R - O) / B, V = (R - z * O) / B, b.copy(m.direction).multiplyScalar(W).add(m.c1), A.copy(x.ray.direction).multiplyScalar(V).add(x.ray.origin), U = f.subVectors(b, A).lengthSq(); - var ce = m.radius * m.radius; - if (U <= ce) { - if (N = (z * O - R) * (z * O - R) - B * (w.lengthSq() - O * O - ce), N <= 0 ? H = P = Math.sqrt(U) : H = P = (R - z * O - Math.sqrt(N)) / B, G = z * H - O, G < 0 || G * G > m.lengthSq() || H < 0) + U = (z * R - O) / B, j = (R - z * O) / B, b.copy(m.direction).multiplyScalar(U).add(m.c1), A.copy(w.ray.direction).multiplyScalar(j).add(w.ray.origin), W = f.subVectors(b, A).lengthSq(); + var ue = m.radius * m.radius; + if (W <= ue) { + if (P = (z * O - R) * (z * O - R) - B * (x.lengthSq() - O * O - ue), P <= 0 ? H = N = Math.sqrt(W) : H = N = (R - z * O - Math.sqrt(P)) / B, G = z * H - O, G < 0 || G * G > m.lengthSq() || H < 0) continue; - c.push({ clickable: g, distance: P }); + o.push({ clickable: g, distance: N }); } } for ($ = 0, k = v.line.length; $ < k; $ += 2) { - b.copy(v.line[$]), b.applyMatrix4(_.matrixWorld), A.copy(v.line[$ + 1]), A.applyMatrix4(_.matrixWorld), f.subVectors(A, b); - var he = f.lengthSq(); - f.normalize(), w.subVectors(b, x.ray.origin); - var le = w.dot(f); - R = w.dot(x.ray.direction), z = u(x.ray.direction.dot(f)), B = 1 - z * z, B !== 0 && (W = (z * R - le) / B, V = (R - z * le) / B, b.add(f.multiplyScalar(W)), A.copy(x.ray.direction).multiplyScalar(V).add(x.ray.origin), U = f.subVectors(A, b).lengthSq(), U < E && W * W < he && c.push({ clickable: g, distance: V })); + b.copy(v.line[$]), b.applyMatrix4(p.matrixWorld), A.copy(v.line[$ + 1]), A.applyMatrix4(p.matrixWorld), f.subVectors(A, b); + var de = f.lengthSq(); + f.normalize(), x.subVectors(b, w.ray.origin); + var oe = x.dot(f); + R = x.dot(w.ray.direction), z = d(w.ray.direction.dot(f)), B = 1 - z * z, B !== 0 && (U = (z * R - oe) / B, j = (R - z * oe) / B, b.add(f.multiplyScalar(U)), A.copy(w.ray.direction).multiplyScalar(j).add(w.ray.origin), W = f.subVectors(A, b).lengthSq(), W < E && U * U < de && o.push({ clickable: g, distance: j })); } for ($ = 0, k = v.sphere.length; $ < k; $++) - if (v.sphere[$] instanceof a.Sphere && (p.copy(v.sphere[$]), p.applyMatrix4(_.matrixWorld), x.ray.isIntersectionSphere(p))) { - b.subVectors(p.center, x.ray.origin); - var J = b.dot(x.ray.direction); - if (N = J * J - (b.lengthSq() - p.radius * p.radius), J < 0) - return c; - N <= 0 ? P = J : P = J - Math.sqrt(N), c.push({ clickable: g, distance: P }); + if (v.sphere[$] instanceof a.Sphere && (_.copy(v.sphere[$]), _.applyMatrix4(p.matrixWorld), w.ray.isIntersectionSphere(_))) { + b.subVectors(_.center, w.ray.origin); + var J = b.dot(w.ray.direction); + if (P = J * J - (b.lengthSq() - _.radius * _.radius), J < 0) + return o; + P <= 0 ? N = J : N = J - Math.sqrt(P), o.push({ clickable: g, distance: N }); } - return c; + return o; } } ), @@ -28286,12 +28286,12 @@ ATOM`, x); /* harmony export */ Texture: () => ( /* binding */ - o + c ), /* harmony export */ TextureIdCount: () => ( /* binding */ - u + d ) /* harmony export */ }); @@ -28304,22 +28304,22 @@ ATOM`, x); ), l = t( /*! ./EventDispatcher */ "./src/WebGL/core/EventDispatcher.ts" - ), d = t( + ), h = t( /*! ./UVMapping */ "./src/WebGL/core/UVMapping.ts" ); - class o extends l.EventDispatcher { + class c extends l.EventDispatcher { constructor(m, y) { - super(), this.id = u++, this.name = "", this.image = m, this.mapping = new d.UVMapping(), this.wrapS = r.ClampToEdgeWrapping, this.wrapT = r.ClampToEdgeWrapping, this.anisotropy = 1, y ? (this.format = r.RFormat, this.type = r.FloatType, this.premultiplyAlpha = !1, this.flipY = !1, this.unpackAlignment = 1, this.magFilter = r.NearestFilter, this.minFilter = r.NearestFilter) : (this.format = r.RGBAFormat, this.type = r.UnsignedByteType, this.offset = new a.Vector2(0, 0), this.repeat = new a.Vector2(1, 1), this.premultiplyAlpha = !1, this.flipY = !0, this.unpackAlignment = 4, this.magFilter = r.LinearFilter, this.minFilter = r.LinearMipMapLinearFilter), this.needsUpdate = !1, this.onUpdate = null; + super(), this.id = d++, this.name = "", this.image = m, this.mapping = new h.UVMapping(), this.wrapS = r.ClampToEdgeWrapping, this.wrapT = r.ClampToEdgeWrapping, this.anisotropy = 1, y ? (this.format = r.RFormat, this.type = r.FloatType, this.premultiplyAlpha = !1, this.flipY = !1, this.unpackAlignment = 1, this.magFilter = r.NearestFilter, this.minFilter = r.NearestFilter) : (this.format = r.RGBAFormat, this.type = r.UnsignedByteType, this.offset = new a.Vector2(0, 0), this.repeat = new a.Vector2(1, 1), this.premultiplyAlpha = !1, this.flipY = !0, this.unpackAlignment = 4, this.magFilter = r.LinearFilter, this.minFilter = r.LinearMipMapLinearFilter), this.needsUpdate = !1, this.onUpdate = null; } - clone(m = new o()) { + clone(m = new c()) { return m.image = this.image, m.mapping = this.mapping, m.wrapS = this.wrapS, m.wrapT = this.wrapT, m.magFilter = this.magFilter, m.minFilter = this.minFilter, m.anisotropy = this.anisotropy, m.format = this.format, m.type = this.type, m.offset.copy(this.offset), m.repeat.copy(this.repeat), m.premultiplyAlpha = this.premultiplyAlpha, m.flipY = this.flipY, m.unpackAlignment = this.unpackAlignment, m; } dispose() { this.dispatchEvent({ type: "dispose" }); } } - let u = 0; + let d = 0; } ), /***/ @@ -28387,12 +28387,12 @@ ATOM`, x); /* harmony export */ Projector: () => ( /* reexport safe */ - d.Projector + h.Projector ), /* harmony export */ Raycaster: () => ( /* reexport safe */ - o.Raycaster + c.Raycaster ), /* harmony export */ Scene: () => ( @@ -28402,22 +28402,22 @@ ATOM`, x); /* harmony export */ Texture: () => ( /* reexport safe */ - u.Texture + d.Texture ), /* harmony export */ TextureIdCount: () => ( /* reexport safe */ - u.TextureIdCount + d.TextureIdCount ), /* harmony export */ UVMapping: () => ( /* reexport safe */ - p.UVMapping + _.UVMapping ), /* harmony export */ intersectObject: () => ( /* reexport safe */ - o.intersectObject + c.intersectObject ) /* harmony export */ }); @@ -28430,16 +28430,16 @@ ATOM`, x); ), l = t( /*! ./Object3D */ "./src/WebGL/core/Object3D.ts" - ), d = t( + ), h = t( /*! ./Projector */ "./src/WebGL/core/Projector.ts" - ), o = t( + ), c = t( /*! ./Raycaster */ "./src/WebGL/core/Raycaster.ts" - ), u = t( + ), d = t( /*! ./Texture */ "./src/WebGL/core/Texture.ts" - ), p = t( + ), _ = t( /*! ./UVMapping */ "./src/WebGL/core/UVMapping.ts" ); @@ -28476,7 +28476,7 @@ ATOM`, x); /* harmony export */ Cylinder: () => ( /* reexport safe */ - p.Cylinder + _.Cylinder ), /* harmony export */ DoubleSide: () => ( @@ -28536,7 +28536,7 @@ ATOM`, x); /* harmony export */ Line: () => ( /* reexport safe */ - o.Line + c.Line ), /* harmony export */ LineBasicMaterial: () => ( @@ -28546,7 +28546,7 @@ ATOM`, x); /* harmony export */ LineStyle: () => ( /* reexport safe */ - o.LineStyle + c.LineStyle ), /* harmony export */ LinearFilter: () => ( @@ -28571,17 +28571,17 @@ ATOM`, x); /* harmony export */ Matrix3: () => ( /* reexport safe */ - d.Matrix3 + h.Matrix3 ), /* harmony export */ Matrix4: () => ( /* reexport safe */ - d.Matrix4 + h.Matrix4 ), /* harmony export */ Mesh: () => ( /* reexport safe */ - o.Mesh + c.Mesh ), /* harmony export */ MeshDoubleLambertMaterial: () => ( @@ -28621,7 +28621,7 @@ ATOM`, x); /* harmony export */ Quaternion: () => ( /* reexport safe */ - d.Quaternion + h.Quaternion ), /* harmony export */ R32Format: () => ( @@ -28641,7 +28641,7 @@ ATOM`, x); /* harmony export */ Ray: () => ( /* reexport safe */ - d.Ray + h.Ray ), /* harmony export */ Raycaster: () => ( @@ -28651,7 +28651,7 @@ ATOM`, x); /* harmony export */ Renderer: () => ( /* reexport safe */ - w.Renderer + x.Renderer ), /* harmony export */ Scene: () => ( @@ -28661,12 +28661,12 @@ ATOM`, x); /* harmony export */ ShaderLib: () => ( /* reexport safe */ - u.ShaderLib + d.ShaderLib ), /* harmony export */ ShaderUtils: () => ( /* reexport safe */ - u.ShaderUtils + d.ShaderUtils ), /* harmony export */ Shading: () => ( @@ -28676,7 +28676,7 @@ ATOM`, x); /* harmony export */ Sphere: () => ( /* reexport safe */ - p.Sphere + _.Sphere ), /* harmony export */ SphereImposterMaterial: () => ( @@ -28691,7 +28691,7 @@ ATOM`, x); /* harmony export */ Sprite: () => ( /* reexport safe */ - o.Sprite + c.Sprite ), /* harmony export */ SpriteAlignment: () => ( @@ -28736,7 +28736,7 @@ ATOM`, x); /* harmony export */ Triangle: () => ( /* reexport safe */ - p.Triangle + _.Triangle ), /* harmony export */ UVMapping: () => ( @@ -28751,12 +28751,12 @@ ATOM`, x); /* harmony export */ Vector2: () => ( /* reexport safe */ - d.Vector2 + h.Vector2 ), /* harmony export */ Vector3: () => ( /* reexport safe */ - d.Vector3 + h.Vector3 ), /* harmony export */ VolumetricMaterial: () => ( @@ -28766,32 +28766,32 @@ ATOM`, x); /* harmony export */ basic: () => ( /* reexport safe */ - u.basic + d.basic ), /* harmony export */ clamp: () => ( /* reexport safe */ - d.clamp + h.clamp ), /* harmony export */ clone: () => ( /* reexport safe */ - u.clone + d.clone ), /* harmony export */ conversionMatrix3: () => ( /* reexport safe */ - d.conversionMatrix3 + h.conversionMatrix3 ), /* harmony export */ degToRad: () => ( /* reexport safe */ - d.degToRad + h.degToRad ), /* harmony export */ instanced: () => ( /* reexport safe */ - u.instanced + d.instanced ), /* harmony export */ intersectObject: () => ( @@ -28801,57 +28801,57 @@ ATOM`, x); /* harmony export */ lambert: () => ( /* reexport safe */ - u.lambert + d.lambert ), /* harmony export */ lambertdouble: () => ( /* reexport safe */ - u.lambertdouble + d.lambertdouble ), /* harmony export */ outline: () => ( /* reexport safe */ - u.outline + d.outline ), /* harmony export */ screen: () => ( /* reexport safe */ - u.screen + d.screen ), /* harmony export */ screenaa: () => ( /* reexport safe */ - u.screenaa + d.screenaa ), /* harmony export */ sphereimposter: () => ( /* reexport safe */ - u.sphereimposter + d.sphereimposter ), /* harmony export */ sphereimposteroutline: () => ( /* reexport safe */ - u.sphereimposteroutline + d.sphereimposteroutline ), /* harmony export */ sprite: () => ( /* reexport safe */ - u.sprite + d.sprite ), /* harmony export */ stickimposter: () => ( /* reexport safe */ - u.stickimposter + d.stickimposter ), /* harmony export */ stickimposteroutline: () => ( /* reexport safe */ - u.stickimposteroutline + d.stickimposteroutline ), /* harmony export */ volumetric: () => ( /* reexport safe */ - u.volumetric + d.volumetric ) /* harmony export */ }); @@ -28864,16 +28864,16 @@ ATOM`, x); ), l = t( /*! ./materials */ "./src/WebGL/materials/index.ts" - ), d = t( + ), h = t( /*! ./math */ "./src/WebGL/math/index.ts" - ), o = t( + ), c = t( /*! ./objects */ "./src/WebGL/objects/index.ts" - ), u = t( + ), d = t( /*! ./shaders */ "./src/WebGL/shaders/index.ts" - ), p = t( + ), _ = t( /*! ./shapes */ "./src/WebGL/shapes/index.ts" ), m = t( @@ -28882,7 +28882,7 @@ ATOM`, x); ), y = t( /*! ./Fog */ "./src/WebGL/Fog.ts" - ), w = t( + ), x = t( /*! ./Renderer */ "./src/WebGL/Renderer.ts" ), b = t( @@ -28902,7 +28902,7 @@ ATOM`, x); /* harmony export */ ImposterMaterial: () => ( /* binding */ - u + d ) /* harmony export */ }); @@ -28915,18 +28915,18 @@ ATOM`, x); ), l = t( /*! ../../colors */ "./src/colors.ts" - ), d = t( + ), h = t( /*! ../math */ "./src/WebGL/math/index.ts" - ), o = t( + ), c = t( /*! ./Material */ "./src/WebGL/materials/Material.ts" ); - class u extends o.Material { + class d extends c.Material { constructor(m) { - super(), this.color = new l.Color(16777215), this.ambient = new l.Color(1048575), this.emissive = new l.Color(0), this.imposter = !0, this.wrapAround = !1, this.wrapRGB = new d.Vector3(1, 1, 1), this.map = void 0, this.lightMap = null, this.specularMap = null, this.envMap = null, this.reflectivity = 1, this.refractionRatio = 0.98, this.fog = !0, this.wireframe = !1, this.wireframeLinewidth = 1, this.wireframeLinecap = "round", this.wireframeLinejoin = "round", this.shading = a.Shading.SmoothShading, this.shaderID = null, this.vertexColors = r.Coloring.NoColors, this.skinning = !1, this.setValues(m); + super(), this.color = new l.Color(16777215), this.ambient = new l.Color(1048575), this.emissive = new l.Color(0), this.imposter = !0, this.wrapAround = !1, this.wrapRGB = new h.Vector3(1, 1, 1), this.map = void 0, this.lightMap = null, this.specularMap = null, this.envMap = null, this.reflectivity = 1, this.refractionRatio = 0.98, this.fog = !0, this.wireframe = !1, this.wireframeLinewidth = 1, this.wireframeLinecap = "round", this.wireframeLinejoin = "round", this.shading = a.Shading.SmoothShading, this.shaderID = null, this.vertexColors = r.Coloring.NoColors, this.skinning = !1, this.setValues(m); } - clone(m = new u()) { + clone(m = new d()) { return super.clone.call(this, m), m.color.copy(this.color), m.ambient.copy(this.ambient), m.emissive.copy(this.emissive), m.wrapAround = this.wrapAround, m.wrapRGB.copy(this.wrapRGB), m.map = this.map, m.lightMap = this.lightMap, m.specularMap = this.specularMap, m.envMap = this.envMap, m.combine = this.combine, m.reflectivity = this.reflectivity, m.refractionRatio = this.refractionRatio, m.fog = this.fog, m.shading = this.shading, m.shaderID = this.shaderID, m.vertexColors = this.vertexColors, m.skinning = this.skinning, m.morphTargets = this.morphTargets, m.morphNormals = this.morphNormals, m; } } @@ -28943,7 +28943,7 @@ ATOM`, x); /* harmony export */ InstancedMaterial: () => ( /* binding */ - u + d ) /* harmony export */ }); @@ -28956,18 +28956,18 @@ ATOM`, x); ), l = t( /*! ../../colors */ "./src/colors.ts" - ), d = t( + ), h = t( /*! ../math */ "./src/WebGL/math/index.ts" - ), o = t( + ), c = t( /*! ./Material */ "./src/WebGL/materials/Material.ts" ); - class u extends o.Material { + class d extends c.Material { constructor(m) { - super(), this.color = new l.Color(16777215), this.ambient = new l.Color(1048575), this.emissive = new l.Color(0), this.wrapAround = !1, this.wrapRGB = new d.Vector3(1, 1, 1), this.map = void 0, this.lightMap = null, this.specularMap = null, this.envMap = null, this.reflectivity = 1, this.refractionRatio = 0.98, this.fog = !0, this.wireframe = !1, this.wireframeLinewidth = 1, this.wireframeLinecap = "round", this.wireframeLinejoin = "round", this.shading = a.Shading.SmoothShading, this.shaderID = "instanced", this.vertexColors = r.Coloring.NoColors, this.skinning = !1, this.sphere = null, this.setValues(m); + super(), this.color = new l.Color(16777215), this.ambient = new l.Color(1048575), this.emissive = new l.Color(0), this.wrapAround = !1, this.wrapRGB = new h.Vector3(1, 1, 1), this.map = void 0, this.lightMap = null, this.specularMap = null, this.envMap = null, this.reflectivity = 1, this.refractionRatio = 0.98, this.fog = !0, this.wireframe = !1, this.wireframeLinewidth = 1, this.wireframeLinecap = "round", this.wireframeLinejoin = "round", this.shading = a.Shading.SmoothShading, this.shaderID = "instanced", this.vertexColors = r.Coloring.NoColors, this.skinning = !1, this.sphere = null, this.setValues(m); } - clone(m = new u()) { + clone(m = new d()) { return super.clone.call(this, m), m.color.copy(this.color), m.ambient.copy(this.ambient), m.emissive.copy(this.emissive), m.wrapAround = this.wrapAround, m.wrapRGB.copy(this.wrapRGB), m.map = this.map, m.lightMap = this.lightMap, m.specularMap = this.specularMap, m.envMap = this.envMap, m.combine = this.combine, m.reflectivity = this.reflectivity, m.refractionRatio = this.refractionRatio, m.fog = this.fog, m.shading = this.shading, m.shaderID = this.shaderID, m.vertexColors = this.vertexColors, m.skinning = this.skinning, m.morphTargets = this.morphTargets, m.morphNormals = this.morphNormals, m.sphere = this.sphere, m; } } @@ -28996,11 +28996,11 @@ ATOM`, x); "./src/WebGL/materials/Material.ts" ); class l extends a.Material { - constructor(o) { - super(), this.color = new r.Color(16777215), this.linewidth = 1, this.linecap = "round", this.linejoin = "round", this.vertexColors = !1, this.fog = !0, this.shaderID = "basic", this.setValues(o); + constructor(c) { + super(), this.color = new r.Color(16777215), this.linewidth = 1, this.linecap = "round", this.linejoin = "round", this.vertexColors = !1, this.fog = !0, this.shaderID = "basic", this.setValues(c); } - clone(o = new l()) { - return super.clone.call(this, o), o.color.copy(this.color), o; + clone(c = new l()) { + return super.clone.call(this, c), c.color.copy(this.color), c; } } } @@ -29016,12 +29016,12 @@ ATOM`, x); /* harmony export */ Material: () => ( /* binding */ - o + c ), /* harmony export */ MaterialIdCount: () => ( /* binding */ - u + d ) /* harmony export */ }); @@ -29034,30 +29034,30 @@ ATOM`, x); ), l = t( /*! ../math */ "./src/WebGL/math/index.ts" - ), d = t( + ), h = t( /*! ../../colors */ "./src/colors.ts" ); - class o extends a.EventDispatcher { + class c extends a.EventDispatcher { constructor() { - super(...arguments), this.id = u++, this.name = "", this.side = r.FrontSide, this.opacity = 1, this.transparent = !1, this.depthTest = !0, this.depthWrite = !0, this.polygonOffset = !1, this.polygonOffsetFactor = 0, this.polygonOffsetUnits = 0, this.alphaTest = 0, this.visible = !0, this.needsUpdate = !0, this.outline = !1, this.wireframe = !1, this.shaded = !1; + super(...arguments), this.id = d++, this.name = "", this.side = r.FrontSide, this.opacity = 1, this.transparent = !1, this.depthTest = !0, this.depthWrite = !0, this.polygonOffset = !1, this.polygonOffsetFactor = 0, this.polygonOffsetUnits = 0, this.alphaTest = 0, this.visible = !0, this.needsUpdate = !0, this.outline = !1, this.wireframe = !1, this.shaded = !1; } setValues(m = {}) { if (m !== void 0) for (var y in m) { - var w = m[y]; - if (w === void 0) { + var x = m[y]; + if (x === void 0) { console.warn("$3Dmol.Material: '" + y + "' parameter is undefined."); continue; } if (y in this) { var b = this[y]; - b instanceof d.Color && w instanceof d.Color ? b.copy(w) : b instanceof d.Color ? b.set(w) : b instanceof l.Vector3 && w instanceof l.Vector3 ? b.copy(w) : this[y] = w; + b instanceof h.Color && x instanceof h.Color ? b.copy(x) : b instanceof h.Color ? b.set(x) : b instanceof l.Vector3 && x instanceof l.Vector3 ? b.copy(x) : this[y] = x; } } } //TODO: might want to look into blending equations - clone(m = new o()) { + clone(m = new c()) { return m.name = this.name, m.side = this.side, m.opacity = this.opacity, m.transparent = this.transparent, m.depthTest = this.depthTest, m.depthWrite = this.depthWrite, m.polygonOffset = this.polygonOffset, m.polygonOffsetFactor = this.polygonOffsetFactor, m.polygonOffsetUnits = this.polygonOffsetUnits, m.alphaTest = this.alphaTest, m.overdraw = this.overdraw, m.visible = this.visible, m; } makeShaded(m) { @@ -29067,7 +29067,7 @@ ATOM`, x); this.dispatchEvent({ type: "dispose" }); } } - let u = 0; + let d = 0; } ), /***/ @@ -29093,11 +29093,11 @@ ATOM`, x); "./src/WebGL/materials/MeshLambertMaterial.ts" ); class l extends a.MeshLambertMaterial { - constructor(o) { - super(o), this.shaderID = "lambertdouble", this.side = r.DoubleSide, this.outline = !1; + constructor(c) { + super(c), this.shaderID = "lambertdouble", this.side = r.DoubleSide, this.outline = !1; } - clone(o = new l()) { - return super.clone.call(this, o), o; + clone(c = new l()) { + return super.clone.call(this, c), c; } } } @@ -29113,7 +29113,7 @@ ATOM`, x); /* harmony export */ MeshLambertMaterial: () => ( /* binding */ - u + d ) /* harmony export */ }); @@ -29126,18 +29126,18 @@ ATOM`, x); ), l = t( /*! ./Material */ "./src/WebGL/materials/Material.ts" - ), d = t( + ), h = t( /*! ../../colors */ "./src/colors.ts" - ), o = t( + ), c = t( /*! ../math */ "./src/WebGL/math/index.ts" ); - class u extends l.Material { + class d extends l.Material { constructor(m) { - super(), this.color = new d.Color(16777215), this.ambient = new d.Color(1048575), this.emissive = new d.Color(0), this.wrapAround = !1, this.wrapRGB = new o.Vector3(1, 1, 1), this.map = void 0, this.lightMap = null, this.specularMap = null, this.envMap = null, this.reflectivity = 1, this.refractionRatio = 0.98, this.fog = !0, this.wireframe = !1, this.wireframeLinewidth = 1, this.wireframeLinecap = "round", this.wireframeLinejoin = "round", this.shading = a.Shading.SmoothShading, this.shaderID = "lambert", this.vertexColors = r.Coloring.NoColors, this.skinning = !1, this.setValues(m); + super(), this.color = new h.Color(16777215), this.ambient = new h.Color(1048575), this.emissive = new h.Color(0), this.wrapAround = !1, this.wrapRGB = new c.Vector3(1, 1, 1), this.map = void 0, this.lightMap = null, this.specularMap = null, this.envMap = null, this.reflectivity = 1, this.refractionRatio = 0.98, this.fog = !0, this.wireframe = !1, this.wireframeLinewidth = 1, this.wireframeLinecap = "round", this.wireframeLinejoin = "round", this.shading = a.Shading.SmoothShading, this.shaderID = "lambert", this.vertexColors = r.Coloring.NoColors, this.skinning = !1, this.setValues(m); } - clone(m = new u()) { + clone(m = new d()) { return super.clone.call(this, m), m.color.copy(this.color), m.ambient.copy(this.ambient), m.emissive.copy(this.emissive), m.wrapAround = this.wrapAround, m.wrapRGB.copy(this.wrapRGB), m.map = this.map, m.lightMap = this.lightMap, m.specularMap = this.specularMap, m.envMap = this.envMap, m.combine = this.combine, m.reflectivity = this.reflectivity, m.refractionRatio = this.refractionRatio, m.fog = this.fog, m.shading = this.shading, m.shaderID = this.shaderID, m.vertexColors = this.vertexColors, m.skinning = this.skinning, m.morphTargets = this.morphTargets, m.morphNormals = this.morphNormals, m; } } @@ -29166,11 +29166,11 @@ ATOM`, x); "./src/WebGL/materials/Material.ts" ); class l extends a.Material { - constructor(o) { - super(), o = o || {}, this.fog = !0, this.shaderID = "outline", this.wireframe = !1, this.outlineColor = r.CC.color(o.color || new r.Color(0, 0, 0)), this.outlineWidth = o.width || 0.1, this.outlinePushback = o.pushback || 1, this.outlineMaxPixels = o.maxpixels || 0; + constructor(c) { + super(), c = c || {}, this.fog = !0, this.shaderID = "outline", this.wireframe = !1, this.outlineColor = r.CC.color(c.color || new r.Color(0, 0, 0)), this.outlineWidth = c.width || 0.1, this.outlinePushback = c.pushback || 1, this.outlineMaxPixels = c.maxpixels || 0; } - clone(o = new l()) { - return super.clone.call(this, o), o.fog = this.fog, o.shaderID = this.shaderID, o.wireframe = this.wireframe, o.outlineColor = this.outlineColor, o.outlineWidth = this.outlineWidth, o.outlinePushback = this.outlinePushback, o.outlineMaxPixels = this.outlineMaxPixels, o; + clone(c = new l()) { + return super.clone.call(this, c), c.fog = this.fog, c.shaderID = this.shaderID, c.wireframe = this.wireframe, c.outlineColor = this.outlineColor, c.outlineWidth = this.outlineWidth, c.outlinePushback = this.outlinePushback, c.outlineMaxPixels = this.outlineMaxPixels, c; } } } @@ -29195,11 +29195,11 @@ ATOM`, x); "./src/WebGL/materials/ImposterMaterial.ts" ); class a extends r.ImposterMaterial { - constructor(d) { - super(d), this.shaderID = "sphereimposter", this.setValues(d); + constructor(h) { + super(h), this.shaderID = "sphereimposter", this.setValues(h); } - clone(d = new a()) { - return super.clone.call(this, d), d; + clone(h = new a()) { + return super.clone.call(this, h), h; } } } @@ -29227,11 +29227,11 @@ ATOM`, x); "./src/WebGL/materials/ImposterMaterial.ts" ); class l extends a.ImposterMaterial { - constructor(o) { - super(o), o = o || {}, this.shaderID = "sphereimposteroutline", this.outlineColor = r.CC.color(o.color || new r.Color(0, 0, 0)), this.outlineWidth = o.width || 0.1, this.outlinePushback = o.pushback || 1, this.outlineMaxPixels = o.maxpixels || 0, this.setValues(o); + constructor(c) { + super(c), c = c || {}, this.shaderID = "sphereimposteroutline", this.outlineColor = r.CC.color(c.color || new r.Color(0, 0, 0)), this.outlineWidth = c.width || 0.1, this.outlinePushback = c.pushback || 1, this.outlineMaxPixels = c.maxpixels || 0, this.setValues(c); } - clone(o = new l()) { - return super.clone.call(this, o), o.outlineColor = this.outlineColor, o.outlineWidth = this.outlineWidth, o.outlinePushback = this.outlinePushback, o.outlineMaxPixels = this.outlineMaxPixels, o; + clone(c = new l()) { + return super.clone.call(this, c), c.outlineColor = this.outlineColor, c.outlineWidth = this.outlineWidth, c.outlinePushback = this.outlinePushback, c.outlineMaxPixels = this.outlineMaxPixels, c; } } } @@ -29247,7 +29247,7 @@ ATOM`, x); /* harmony export */ SpriteMaterial: () => ( /* binding */ - u + d ) /* harmony export */ }); @@ -29260,18 +29260,18 @@ ATOM`, x); ), l = t( /*! ../../colors */ "./src/colors.ts" - ), d = t( + ), h = t( /*! ../math */ "./src/WebGL/math/index.ts" - ), o = t( + ), c = t( /*! ./Material */ "./src/WebGL/materials/Material.ts" ); - class u extends o.Material { + class d extends c.Material { constructor(m) { - super(), this.color = new l.Color(16777215), this.map = new a.Texture(), this.useScreenCoordinates = !0, this.fog = !1, this.uvOffset = new d.Vector2(0, 0), this.uvScale = new d.Vector2(1, 1), this.depthTest = !this.useScreenCoordinates, this.sizeAttenuation = !this.useScreenCoordinates, this.screenOffset = this.screenOffset, this.scaleByViewPort = !this.sizeAttenuation, this.alignment = r.SpriteAlignment.center.clone(), this.setValues(m), m = m || {}, m.depthTest === void 0 && (this.depthTest = !this.useScreenCoordinates), m.sizeAttenuation === void 0 && (this.sizeAttenuation = !this.useScreenCoordinates), m.scaleByViewPort === void 0 && (this.scaleByViewPort = !this.sizeAttenuation); + super(), this.color = new l.Color(16777215), this.map = new a.Texture(), this.useScreenCoordinates = !0, this.fog = !1, this.uvOffset = new h.Vector2(0, 0), this.uvScale = new h.Vector2(1, 1), this.depthTest = !this.useScreenCoordinates, this.sizeAttenuation = !this.useScreenCoordinates, this.screenOffset = this.screenOffset, this.scaleByViewPort = !this.sizeAttenuation, this.alignment = r.SpriteAlignment.center.clone(), this.setValues(m), m = m || {}, m.depthTest === void 0 && (this.depthTest = !this.useScreenCoordinates), m.sizeAttenuation === void 0 && (this.sizeAttenuation = !this.useScreenCoordinates), m.scaleByViewPort === void 0 && (this.scaleByViewPort = !this.sizeAttenuation); } - clone(m = new u()) { + clone(m = new d()) { return super.clone.call(this, m), m.color.copy(this.color), m.map = this.map, m.useScreenCoordinates = this.useScreenCoordinates, m.screenOffset = this.screenOffset, m.sizeAttenuation = this.sizeAttenuation, m.scaleByViewport = this.scaleByViewPort, m.alignment.copy(this.alignment), m.uvOffset.copy(this.uvOffset), m; } } @@ -29297,11 +29297,11 @@ ATOM`, x); "./src/WebGL/materials/ImposterMaterial.ts" ); class a extends r.ImposterMaterial { - constructor(d) { - super(d), this.shaderID = "stickimposter", this.setValues(d); + constructor(h) { + super(h), this.shaderID = "stickimposter", this.setValues(h); } - clone(d = new a()) { - return super.clone.call(this, d), d; + clone(h = new a()) { + return super.clone.call(this, h), h; } } } @@ -29329,11 +29329,11 @@ ATOM`, x); "./src/WebGL/materials/ImposterMaterial.ts" ); class l extends a.ImposterMaterial { - constructor(o = {}) { - super(o), this.shaderID = "stickimposteroutline", this.outlineColor = new r.Color(0, 0, 0), this.outlineWidth = 0.1, this.outlinePushback = 1, this.outlineMaxPixels = 0, o.color && (this.outlineColor = r.CC.color(o.color)), o.width && (this.outlineWidth = o.width), o.pushback && (this.outlinePushback = o.pushback), o.maxpixels && (this.outlineMaxPixels = o.maxpixels), this.setValues(o); + constructor(c = {}) { + super(c), this.shaderID = "stickimposteroutline", this.outlineColor = new r.Color(0, 0, 0), this.outlineWidth = 0.1, this.outlinePushback = 1, this.outlineMaxPixels = 0, c.color && (this.outlineColor = r.CC.color(c.color)), c.width && (this.outlineWidth = c.width), c.pushback && (this.outlinePushback = c.pushback), c.maxpixels && (this.outlineMaxPixels = c.maxpixels), this.setValues(c); } - clone(o = new l()) { - return super.clone.call(this, o), o.outlineColor = this.outlineColor, o.outlineWidth = this.outlineWidth, o.outlinePushback = this.outlinePushback, o.outlineMaxPixels = this.outlineMaxPixels, o; + clone(c = new l()) { + return super.clone.call(this, c), c.outlineColor = this.outlineColor, c.outlineWidth = this.outlineWidth, c.outlinePushback = this.outlinePushback, c.outlineMaxPixels = this.outlineMaxPixels, c; } } } @@ -29349,7 +29349,7 @@ ATOM`, x); /* harmony export */ VolumetricMaterial: () => ( /* binding */ - d + h ) /* harmony export */ }); @@ -29363,12 +29363,12 @@ ATOM`, x); /*! ./Material */ "./src/WebGL/materials/Material.ts" ); - class d extends l.Material { - constructor(u) { - super(), this.transparent = !1, this.volumetric = !0, this.color = new a.Color(16777215), this.transferfn = null, this.map = void 0, this.extent = [], this.maxdepth = 100, this.unit = 0, this.texmatrix = null, this.transfermin = -1, this.transfermax = 1, this.subsamples = 5, this.shaderID = "volumetric", this.side = r.FrontSide, this.setValues(u); + class h extends l.Material { + constructor(d) { + super(), this.transparent = !1, this.volumetric = !0, this.color = new a.Color(16777215), this.transferfn = null, this.map = void 0, this.extent = [], this.maxdepth = 100, this.unit = 0, this.texmatrix = null, this.transfermin = -1, this.transfermax = 1, this.subsamples = 5, this.shaderID = "volumetric", this.side = r.FrontSide, this.setValues(d); } - clone(u = new d()) { - return super.clone.call(this, u), u.transparent = this.transparent, u.volumetric = this.volumetric, u.color = this.color, u.transferfn = this.transferfn, u.map = this.map, u.extent = this.extent, u.maxdepth = this.maxdepth, u.unit = this.unit, u.texmatrix = this.texmatrix, u.transfermin = this.transfermin, u.transfermax = this.transfermax, u.subsamples = this.subsamples, u.shaderID = this.shaderID, u.side = this.side, u; + clone(d = new h()) { + return super.clone.call(this, d), d.transparent = this.transparent, d.volumetric = this.volumetric, d.color = this.color, d.transferfn = this.transferfn, d.map = this.map, d.extent = this.extent, d.maxdepth = this.maxdepth, d.unit = this.unit, d.texmatrix = this.texmatrix, d.transfermin = this.transfermin, d.transfermax = this.transfermax, d.subsamples = this.subsamples, d.shaderID = this.shaderID, d.side = this.side, d; } } } @@ -29399,27 +29399,27 @@ ATOM`, x); /* harmony export */ Material: () => ( /* reexport safe */ - d.Material + h.Material ), /* harmony export */ MaterialIdCount: () => ( /* reexport safe */ - d.MaterialIdCount + h.MaterialIdCount ), /* harmony export */ MeshDoubleLambertMaterial: () => ( /* reexport safe */ - o.MeshDoubleLambertMaterial + c.MeshDoubleLambertMaterial ), /* harmony export */ MeshLambertMaterial: () => ( /* reexport safe */ - u.MeshLambertMaterial + d.MeshLambertMaterial ), /* harmony export */ MeshOutlineMaterial: () => ( /* reexport safe */ - p.MeshOutlineMaterial + _.MeshOutlineMaterial ), /* harmony export */ SphereImposterMaterial: () => ( @@ -29434,7 +29434,7 @@ ATOM`, x); /* harmony export */ SpriteMaterial: () => ( /* reexport safe */ - w.SpriteMaterial + x.SpriteMaterial ), /* harmony export */ StickImposterMaterial: () => ( @@ -29462,16 +29462,16 @@ ATOM`, x); ), l = t( /*! ./LineBasicMaterial */ "./src/WebGL/materials/LineBasicMaterial.ts" - ), d = t( + ), h = t( /*! ./Material */ "./src/WebGL/materials/Material.ts" - ), o = t( + ), c = t( /*! ./MeshDoubleLambertMaterial */ "./src/WebGL/materials/MeshDoubleLambertMaterial.ts" - ), u = t( + ), d = t( /*! ./MeshLambertMaterial */ "./src/WebGL/materials/MeshLambertMaterial.ts" - ), p = t( + ), _ = t( /*! ./MeshOutlineMaterial */ "./src/WebGL/materials/MeshOutlineMaterial.ts" ), m = t( @@ -29480,7 +29480,7 @@ ATOM`, x); ), y = t( /*! ./SphereImposterOutlineMaterial */ "./src/WebGL/materials/SphereImposterOutlineMaterial.ts" - ), w = t( + ), x = t( /*! ./SpriteMaterial */ "./src/WebGL/materials/SpriteMaterial.ts" ), b = t( @@ -29511,11 +29511,11 @@ ATOM`, x); /* harmony export */ }); class r { - constructor(l, d, o, u) { - this.x = l || 0, this.y = d || 0, this.z = o || 0, this.w = u !== void 0 ? u : 1; + constructor(l, h, c, d) { + this.x = l || 0, this.y = h || 0, this.z = c || 0, this.w = d !== void 0 ? d : 1; } - set(l, d, o, u) { - return this.x = l, this.y = d, this.z = o, this.w = u, this; + set(l, h, c, d) { + return this.x = l, this.y = h, this.z = c, this.w = d, this; } copy(l) { return this.x = l.x, this.y = l.y, this.z = l.z, this.w = l.w, this; @@ -29542,9 +29542,9 @@ ATOM`, x); multiplyScalar(l) { return this.x *= l, this.y *= l, this.z *= l, this.w *= l, this; } - multiplyQuaternions(l, d) { - const o = l.x, u = l.y, p = l.z, m = l.w, y = d.x, w = d.y, b = d.z, A = d.w; - return this.x = o * A + m * y + u * b - p * w, this.y = u * A + m * w + p * y - o * b, this.z = p * A + m * b + o * w - u * y, this.w = m * A - o * y - u * w - p * b, this; + multiplyQuaternions(l, h) { + const c = l.x, d = l.y, _ = l.z, m = l.w, y = h.x, x = h.y, b = h.z, A = h.w; + return this.x = c * A + m * y + d * b - _ * x, this.y = d * A + m * x + _ * y - c * b, this.z = _ * A + m * b + c * x - d * y, this.w = m * A - c * y - d * x - _ * b, this; } sub(l) { return this.x -= l.x, this.y -= l.y, this.z -= l.z, this.w -= l.w, this; @@ -29553,8 +29553,8 @@ ATOM`, x); return new r(this.x, this.y, this.z, this.w); } setFromEuler(l) { - const d = Math.cos(l.x / 2), o = Math.cos(l.y / 2), u = Math.cos(l.z / 2), p = Math.sin(l.x / 2), m = Math.sin(l.y / 2), y = Math.sin(l.z / 2); - return this.x = p * o * u + d * m * y, this.y = d * m * u - p * o * y, this.z = d * o * y + p * m * u, this.w = d * o * u - p * m * y, this; + const h = Math.cos(l.x / 2), c = Math.cos(l.y / 2), d = Math.cos(l.z / 2), _ = Math.sin(l.x / 2), m = Math.sin(l.y / 2), y = Math.sin(l.z / 2); + return this.x = _ * c * d + h * m * y, this.y = h * m * d - _ * c * y, this.z = h * c * y + _ * m * d, this.w = h * c * d - _ * m * y, this; } } } @@ -29575,14 +29575,14 @@ ATOM`, x); /* harmony export */ }); class r { - constructor(l, d) { - this.x = l || 0, this.y = d || 0; + constructor(l, h) { + this.x = l || 0, this.y = h || 0; } - set(l, d) { - return this.x = l, this.y = d, this; + set(l, h) { + return this.x = l, this.y = h, this; } - subVectors(l, d) { - return this.x = l.x - d.x, this.y = l.y - d.y, this; + subVectors(l, h) { + return this.x = l.x - h.x, this.y = l.y - h.y, this; } copy(l) { return this.x = l.x, this.y = l.y, this; @@ -29604,12 +29604,12 @@ ATOM`, x); /* harmony export */ Matrix3: () => ( /* reexport safe */ - u.Matrix3 + d.Matrix3 ), /* harmony export */ Matrix4: () => ( /* reexport safe */ - u.Matrix4 + d.Matrix4 ), /* harmony export */ Quaternion: () => ( @@ -29619,7 +29619,7 @@ ATOM`, x); /* harmony export */ Ray: () => ( /* reexport safe */ - u.Ray + d.Ray ), /* harmony export */ Vector2: () => ( @@ -29629,7 +29629,7 @@ ATOM`, x); /* harmony export */ Vector3: () => ( /* reexport safe */ - u.Vector3 + d.Vector3 ), /* harmony export */ clamp: () => ( @@ -29639,12 +29639,12 @@ ATOM`, x); /* harmony export */ conversionMatrix3: () => ( /* reexport safe */ - d.conversionMatrix3 + h.conversionMatrix3 ), /* harmony export */ degToRad: () => ( /* reexport safe */ - o.degToRad + c.degToRad ) /* harmony export */ }); @@ -29657,13 +29657,13 @@ ATOM`, x); ), l = t( /*! ./utils/clamp */ "./src/WebGL/math/utils/clamp.ts" - ), d = t( + ), h = t( /*! ./utils/conversionMatrix3 */ "./src/WebGL/math/utils/conversionMatrix3.ts" - ), o = t( + ), c = t( /*! ./utils/degToRad */ "./src/WebGL/math/utils/degToRad.ts" - ), u = t( + ), d = t( /*! ./math */ "./src/WebGL/math/math.ts" ); @@ -29680,7 +29680,7 @@ ATOM`, x); /* harmony export */ Matrix3: () => ( /* binding */ - w + x ), /* harmony export */ Matrix4: () => ( @@ -29705,18 +29705,18 @@ ATOM`, x); ), a = t( /*! ./utils/clamp */ "./src/WebGL/math/utils/clamp.ts" - ), l, d, o, u, p; + ), l, h, c, d, _; class m { - constructor(f = 1, s = 0, h = 0, _ = 0, g = 0, x = 1, c = 0, v = 0, M = 0, E = 0, $ = 1, k = 0, L = 0, z = 0, O = 0, R = 1) { - typeof f < "u" && typeof f != "number" ? this.elements = new Float32Array(f) : (this.elements = new Float32Array(16), this.elements[0] = f, this.elements[4] = s, this.elements[8] = h, this.elements[12] = _, this.elements[1] = g, this.elements[5] = x, this.elements[9] = c, this.elements[13] = v, this.elements[2] = M, this.elements[6] = E, this.elements[10] = $, this.elements[14] = k, this.elements[3] = L, this.elements[7] = z, this.elements[11] = O, this.elements[15] = R); + constructor(f = 1, s = 0, u = 0, p = 0, g = 0, w = 1, o = 0, v = 0, M = 0, E = 0, $ = 1, k = 0, L = 0, z = 0, O = 0, R = 1) { + typeof f < "u" && typeof f != "number" ? this.elements = new Float32Array(f) : (this.elements = new Float32Array(16), this.elements[0] = f, this.elements[4] = s, this.elements[8] = u, this.elements[12] = p, this.elements[1] = g, this.elements[5] = w, this.elements[9] = o, this.elements[13] = v, this.elements[2] = M, this.elements[6] = E, this.elements[10] = $, this.elements[14] = k, this.elements[3] = L, this.elements[7] = z, this.elements[11] = O, this.elements[15] = R); } // eslint-disable-next-line no-unused-vars, class-methods-use-this - makeScale(f, s, h) { + makeScale(f, s, u) { throw new Error("Method not implemented."); } - set(f, s, h, _, g, x, c, v, M, E, $, k, L, z, O, R) { - const P = this.elements; - return P[0] = f, P[4] = s, P[8] = h, P[12] = _, P[1] = g, P[5] = x, P[9] = c, P[13] = v, P[2] = M, P[6] = E, P[10] = $, P[14] = k, P[3] = L, P[7] = z, P[11] = O, P[15] = R, this; + set(f, s, u, p, g, w, o, v, M, E, $, k, L, z, O, R) { + const N = this.elements; + return N[0] = f, N[4] = s, N[8] = u, N[12] = p, N[1] = g, N[5] = w, N[9] = o, N[13] = v, N[2] = M, N[6] = E, N[10] = $, N[14] = k, N[3] = L, N[7] = z, N[11] = O, N[15] = R, this; } identity() { return this.set(1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1), this; @@ -29727,39 +29727,39 @@ ATOM`, x); } matrix3FromTopLeft() { const f = this.elements; - return new w(f[0], f[4], f[8], f[1], f[5], f[9], f[2], f[6], f[10]); + return new x(f[0], f[4], f[8], f[1], f[5], f[9], f[2], f[6], f[10]); } setRotationFromEuler(f, s) { - const h = this.elements, { x: _, y: g, z: x } = f, c = Math.cos(_), v = Math.sin(_), M = Math.cos(g), E = Math.sin(g), $ = Math.cos(x), k = Math.sin(x); + const u = this.elements, { x: p, y: g, z: w } = f, o = Math.cos(p), v = Math.sin(p), M = Math.cos(g), E = Math.sin(g), $ = Math.cos(w), k = Math.sin(w); if (s === void 0 || s === "XYZ") { - const L = c * $, z = c * k, O = v * $, R = v * k; - h[0] = M * $, h[4] = -M * k, h[8] = E, h[1] = z + O * E, h[5] = L - R * E, h[9] = -v * M, h[2] = R - L * E, h[6] = O + z * E, h[10] = c * M; + const L = o * $, z = o * k, O = v * $, R = v * k; + u[0] = M * $, u[4] = -M * k, u[8] = E, u[1] = z + O * E, u[5] = L - R * E, u[9] = -v * M, u[2] = R - L * E, u[6] = O + z * E, u[10] = o * M; } else console.error(`Error with matrix4 setRotationFromEuler. Order: ${s}`); return this; } setRotationFromQuaternion(f) { - const s = this.elements, { x: h, y: _, z: g, w: x } = f, c = h + h, v = _ + _, M = g + g, E = h * c, $ = h * v, k = h * M, L = _ * v, z = _ * M, O = g * M, R = x * c, P = x * v, U = x * M; - return s[0] = 1 - (L + O), s[4] = $ - U, s[8] = k + P, s[1] = $ + U, s[5] = 1 - (E + O), s[9] = z - R, s[2] = k - P, s[6] = z + R, s[10] = 1 - (E + L), this; + const s = this.elements, { x: u, y: p, z: g, w } = f, o = u + u, v = p + p, M = g + g, E = u * o, $ = u * v, k = u * M, L = p * v, z = p * M, O = g * M, R = w * o, N = w * v, W = w * M; + return s[0] = 1 - (L + O), s[4] = $ - W, s[8] = k + N, s[1] = $ + W, s[5] = 1 - (E + O), s[9] = z - R, s[2] = k - N, s[6] = z + R, s[10] = 1 - (E + L), this; } multiplyMatrices(f, s) { - const h = f.elements, _ = s.elements, g = this.elements, x = h[0], c = h[4], v = h[8], M = h[12], E = h[1], $ = h[5], k = h[9], L = h[13], z = h[2], O = h[6], R = h[10], P = h[14], U = h[3], B = h[7], N = h[11], G = h[15], H = _[0], W = _[4], V = _[8], re = _[12], ie = _[1], ee = _[5], ce = _[9], he = _[13], le = _[2], J = _[6], Me = _[10], se = _[14], Ce = _[3], ue = _[7], ne = _[11], _e = _[15]; - return g[0] = x * H + c * ie + v * le + M * Ce, g[4] = x * W + c * ee + v * J + M * ue, g[8] = x * V + c * ce + v * Me + M * ne, g[12] = x * re + c * he + v * se + M * _e, g[1] = E * H + $ * ie + k * le + L * Ce, g[5] = E * W + $ * ee + k * J + L * ue, g[9] = E * V + $ * ce + k * Me + L * ne, g[13] = E * re + $ * he + k * se + L * _e, g[2] = z * H + O * ie + R * le + P * Ce, g[6] = z * W + O * ee + R * J + P * ue, g[10] = z * V + O * ce + R * Me + P * ne, g[14] = z * re + O * he + R * se + P * _e, g[3] = U * H + B * ie + N * le + G * Ce, g[7] = U * W + B * ee + N * J + G * ue, g[11] = U * V + B * ce + N * Me + G * ne, g[15] = U * re + B * he + N * se + G * _e, this; + const u = f.elements, p = s.elements, g = this.elements, w = u[0], o = u[4], v = u[8], M = u[12], E = u[1], $ = u[5], k = u[9], L = u[13], z = u[2], O = u[6], R = u[10], N = u[14], W = u[3], B = u[7], P = u[11], G = u[15], H = p[0], U = p[4], j = p[8], re = p[12], ie = p[1], te = p[5], ue = p[9], de = p[13], oe = p[2], J = p[6], Ee = p[10], se = p[14], Ae = p[3], he = p[7], ne = p[11], _e = p[15]; + return g[0] = w * H + o * ie + v * oe + M * Ae, g[4] = w * U + o * te + v * J + M * he, g[8] = w * j + o * ue + v * Ee + M * ne, g[12] = w * re + o * de + v * se + M * _e, g[1] = E * H + $ * ie + k * oe + L * Ae, g[5] = E * U + $ * te + k * J + L * he, g[9] = E * j + $ * ue + k * Ee + L * ne, g[13] = E * re + $ * de + k * se + L * _e, g[2] = z * H + O * ie + R * oe + N * Ae, g[6] = z * U + O * te + R * J + N * he, g[10] = z * j + O * ue + R * Ee + N * ne, g[14] = z * re + O * de + R * se + N * _e, g[3] = W * H + B * ie + P * oe + G * Ae, g[7] = W * U + B * te + P * J + G * he, g[11] = W * j + B * ue + P * Ee + G * ne, g[15] = W * re + B * de + P * se + G * _e, this; } multiplyScalar(f) { const s = this.elements; return s[0] *= f, s[4] *= f, s[8] *= f, s[12] *= f, s[1] *= f, s[5] *= f, s[9] *= f, s[13] *= f, s[2] *= f, s[6] *= f, s[10] *= f, s[14] *= f, s[3] *= f, s[7] *= f, s[11] *= f, s[15] *= f, this; } - makeTranslation(f, s, h) { - return this.set(1, 0, 0, f, 0, 1, 0, s, 0, 0, 1, h, 0, 0, 0, 1), this; + makeTranslation(f, s, u) { + return this.set(1, 0, 0, f, 0, 1, 0, s, 0, 0, 1, u, 0, 0, 0, 1), this; } // snap values close to integers to their integer value // useful and identifying identity matrices snap(f) { - const s = Math.pow(10, 4), h = this.elements; - for (let _ = 0; _ < 16; _++) { - const g = Math.round(h[_]); - g === Math.round(h[_] * s) / s && (h[_] = g); + const s = Math.pow(10, 4), u = this.elements; + for (let p = 0; p < 16; p++) { + const g = Math.round(u[p]); + g === Math.round(u[p] * s) / s && (u[p] = g); } return this; } @@ -29777,9 +29777,9 @@ ATOM`, x); return s[12] += f.x, s[13] += f.y, s[14] += f.z, this; } getInverse(f, s) { - const h = this.elements, _ = f.elements, g = _[0], x = _[4], c = _[8], v = _[12], M = _[1], E = _[5], $ = _[9], k = _[13], L = _[2], z = _[6], O = _[10], R = _[14], P = _[3], U = _[7], B = _[11], N = _[15]; - h[0] = $ * R * U - k * O * U + k * z * B - E * R * B - $ * z * N + E * O * N, h[4] = v * O * U - c * R * U - v * z * B + x * R * B + c * z * N - x * O * N, h[8] = c * k * U - v * $ * U + v * E * B - x * k * B - c * E * N + x * $ * N, h[12] = v * $ * z - c * k * z - v * E * O + x * k * O + c * E * R - x * $ * R, h[1] = k * O * P - $ * R * P - k * L * B + M * R * B + $ * L * N - M * O * N, h[5] = c * R * P - v * O * P + v * L * B - g * R * B - c * L * N + g * O * N, h[9] = v * $ * P - c * k * P - v * M * B + g * k * B + c * M * N - g * $ * N, h[13] = c * k * L - v * $ * L + v * M * O - g * k * O - c * M * R + g * $ * R, h[2] = E * R * P - k * z * P + k * L * U - M * R * U - E * L * N + M * z * N, h[6] = v * z * P - x * R * P - v * L * U + g * R * U + x * L * N - g * z * N, h[10] = x * k * P - v * E * P + v * M * U - g * k * U - x * M * N + g * E * N, h[14] = v * E * L - x * k * L - v * M * z + g * k * z + x * M * R - g * E * R, h[3] = $ * z * P - E * O * P - $ * L * U + M * O * U + E * L * B - M * z * B, h[7] = x * O * P - c * z * P + c * L * U - g * O * U - x * L * B + g * z * B, h[11] = c * E * P - x * $ * P - c * M * U + g * $ * U + x * M * B - g * E * B, h[15] = x * $ * L - c * E * L + c * M * z - g * $ * z - x * M * O + g * E * O; - const G = g * h[0] + M * h[4] + L * h[8] + P * h[12]; + const u = this.elements, p = f.elements, g = p[0], w = p[4], o = p[8], v = p[12], M = p[1], E = p[5], $ = p[9], k = p[13], L = p[2], z = p[6], O = p[10], R = p[14], N = p[3], W = p[7], B = p[11], P = p[15]; + u[0] = $ * R * W - k * O * W + k * z * B - E * R * B - $ * z * P + E * O * P, u[4] = v * O * W - o * R * W - v * z * B + w * R * B + o * z * P - w * O * P, u[8] = o * k * W - v * $ * W + v * E * B - w * k * B - o * E * P + w * $ * P, u[12] = v * $ * z - o * k * z - v * E * O + w * k * O + o * E * R - w * $ * R, u[1] = k * O * N - $ * R * N - k * L * B + M * R * B + $ * L * P - M * O * P, u[5] = o * R * N - v * O * N + v * L * B - g * R * B - o * L * P + g * O * P, u[9] = v * $ * N - o * k * N - v * M * B + g * k * B + o * M * P - g * $ * P, u[13] = o * k * L - v * $ * L + v * M * O - g * k * O - o * M * R + g * $ * R, u[2] = E * R * N - k * z * N + k * L * W - M * R * W - E * L * P + M * z * P, u[6] = v * z * N - w * R * N - v * L * W + g * R * W + w * L * P - g * z * P, u[10] = w * k * N - v * E * N + v * M * W - g * k * W - w * M * P + g * E * P, u[14] = v * E * L - w * k * L - v * M * z + g * k * z + w * M * R - g * E * R, u[3] = $ * z * N - E * O * N - $ * L * W + M * O * W + E * L * B - M * z * B, u[7] = w * O * N - o * z * N + o * L * W - g * O * W - w * L * B + g * z * B, u[11] = o * E * N - w * $ * N - o * M * W + g * $ * W + w * M * B - g * E * B, u[15] = w * $ * L - o * E * L + o * M * z - g * $ * z - w * M * O + g * E * O; + const G = g * u[0] + M * u[4] + L * u[8] + N * u[12]; if (G === 0) { const H = "Matrix4.getInverse(): can't invert matrix, determinant is 0"; if (s) @@ -29789,37 +29789,37 @@ ATOM`, x); return this.multiplyScalar(1 / G), this; } isReflected() { - const f = this.elements, s = f[0], h = f[4], _ = f[8], g = f[1], x = f[5], c = f[9], v = f[2], M = f[6], E = f[10]; - return s * x * E + // +aei - g * M * _ + // +bfg - v * h * c - // +cdh - v * x * _ - // -ceg - g * h * E - // -bdi - s * M * c < 0; + const f = this.elements, s = f[0], u = f[4], p = f[8], g = f[1], w = f[5], o = f[9], v = f[2], M = f[6], E = f[10]; + return s * w * E + // +aei + g * M * p + // +bfg + v * u * o - // +cdh + v * w * p - // -ceg + g * u * E - // -bdi + s * M * o < 0; } scale(f) { - const s = this.elements, { x: h } = f, { y: _ } = f, { z: g } = f; - return s[0] *= h, s[4] *= _, s[8] *= g, s[1] *= h, s[5] *= _, s[9] *= g, s[2] *= h, s[6] *= _, s[10] *= g, s[3] *= h, s[7] *= _, s[11] *= g, this; + const s = this.elements, { x: u } = f, { y: p } = f, { z: g } = f; + return s[0] *= u, s[4] *= p, s[8] *= g, s[1] *= u, s[5] *= p, s[9] *= g, s[2] *= u, s[6] *= p, s[10] *= g, s[3] *= u, s[7] *= p, s[11] *= g, this; } getMaxScaleOnAxis() { - const f = this.elements, s = f[0] * f[0] + f[1] * f[1] + f[2] * f[2], h = f[4] * f[4] + f[5] * f[5] + f[6] * f[6], _ = f[8] * f[8] + f[9] * f[9] + f[10] * f[10]; - return Math.sqrt(Math.max(s, Math.max(h, _))); + const f = this.elements, s = f[0] * f[0] + f[1] * f[1] + f[2] * f[2], u = f[4] * f[4] + f[5] * f[5] + f[6] * f[6], p = f[8] * f[8] + f[9] * f[9] + f[10] * f[10]; + return Math.sqrt(Math.max(s, Math.max(u, p))); } - makeFrustum(f, s, h, _, g, x) { - const c = this.elements, v = 2 * g / (s - f), M = 2 * g / (_ - h), E = (s + f) / (s - f), $ = (_ + h) / (_ - h), k = -(x + g) / (x - g), L = -2 * x * g / (x - g); - return c[0] = v, c[4] = 0, c[8] = E, c[12] = 0, c[1] = 0, c[5] = M, c[9] = $, c[13] = 0, c[2] = 0, c[6] = 0, c[10] = k, c[14] = L, c[3] = 0, c[7] = 0, c[11] = -1, c[15] = 0, this; + makeFrustum(f, s, u, p, g, w) { + const o = this.elements, v = 2 * g / (s - f), M = 2 * g / (p - u), E = (s + f) / (s - f), $ = (p + u) / (p - u), k = -(w + g) / (w - g), L = -2 * w * g / (w - g); + return o[0] = v, o[4] = 0, o[8] = E, o[12] = 0, o[1] = 0, o[5] = M, o[9] = $, o[13] = 0, o[2] = 0, o[6] = 0, o[10] = k, o[14] = L, o[3] = 0, o[7] = 0, o[11] = -1, o[15] = 0, this; } - makePerspective(f, s, h, _) { - const g = h * Math.tan((0, r.degToRad)(f * 0.5)), x = -g, c = x * s, v = g * s; - return this.makeFrustum(c, v, x, g, h, _); + makePerspective(f, s, u, p) { + const g = u * Math.tan((0, r.degToRad)(f * 0.5)), w = -g, o = w * s, v = g * s; + return this.makeFrustum(o, v, w, g, u, p); } - makeOrthographic(f, s, h, _, g, x) { - const c = this.elements, v = 1 / (s - f), M = 1 / (h - _), E = 1 / (x - g), $ = (s + f) * v, k = (h + _) * M, L = (x + g) * E; - return c[0] = 2 * v, c[4] = 0, c[8] = 0, c[12] = -$, c[1] = 0, c[5] = 2 * M, c[9] = 0, c[13] = -k, c[2] = 0, c[6] = 0, c[10] = -2 * E, c[14] = -L, c[3] = 0, c[7] = 0, c[11] = 0, c[15] = 1, this; + makeOrthographic(f, s, u, p, g, w) { + const o = this.elements, v = 1 / (s - f), M = 1 / (u - p), E = 1 / (w - g), $ = (s + f) * v, k = (u + p) * M, L = (w + g) * E; + return o[0] = 2 * v, o[4] = 0, o[8] = 0, o[12] = -$, o[1] = 0, o[5] = 2 * M, o[9] = 0, o[13] = -k, o[2] = 0, o[6] = 0, o[10] = -2 * E, o[14] = -L, o[3] = 0, o[7] = 0, o[11] = 0, o[15] = 1, this; } isEqual(f) { - const s = f.elements, h = this.elements; - return h[0] === s[0] && h[4] === s[4] && h[8] === s[8] && h[12] === s[12] && h[1] === s[1] && h[5] === s[5] && h[9] === s[9] && h[13] === s[13] && h[2] === s[2] && h[6] === s[6] && h[10] === s[10] && h[14] === s[14] && h[3] === s[3] && h[7] === s[7] && h[11] === s[11] && h[15] === s[15]; + const s = f.elements, u = this.elements; + return u[0] === s[0] && u[4] === s[4] && u[8] === s[8] && u[12] === s[12] && u[1] === s[1] && u[5] === s[5] && u[9] === s[9] && u[13] === s[13] && u[2] === s[2] && u[6] === s[6] && u[10] === s[10] && u[14] === s[14] && u[3] === s[3] && u[7] === s[7] && u[11] === s[11] && u[15] === s[15]; } clone() { const f = this.elements; @@ -29835,24 +29835,24 @@ ATOM`, x); } getScale(f) { const s = this.elements; - return f = f || new y(), o.set(s[0], s[1], s[2]), u.set(s[4], s[5], s[6]), p.set(s[8], s[9], s[10]), f.x = o.length(), f.y = u.length(), f.z = p.length(), f; + return f = f || new y(), c.set(s[0], s[1], s[2]), d.set(s[4], s[5], s[6]), _.set(s[8], s[9], s[10]), f.x = c.length(), f.y = d.length(), f.z = _.length(), f; } - lookAt(f, s, h) { - const _ = this.elements; - return p.subVectors(f, s).normalize(), p.length() === 0 && (p.z = 1), o.crossVectors(h, p).normalize(), o.length() === 0 && (p.x += 1e-4, o.crossVectors(h, p).normalize()), u.crossVectors(p, o), _[0] = o.x, _[4] = u.x, _[8] = p.x, _[1] = o.y, _[5] = u.y, _[9] = p.y, _[2] = o.z, _[6] = u.z, _[10] = p.z, this; + lookAt(f, s, u) { + const p = this.elements; + return _.subVectors(f, s).normalize(), _.length() === 0 && (_.z = 1), c.crossVectors(u, _).normalize(), c.length() === 0 && (_.x += 1e-4, c.crossVectors(u, _).normalize()), d.crossVectors(_, c), p[0] = c.x, p[4] = d.x, p[8] = _.x, p[1] = c.y, p[5] = d.y, p[9] = _.y, p[2] = c.z, p[6] = d.z, p[10] = _.z, this; } - compose(f, s, h) { - const _ = this.elements; - return l.identity(), l.setRotationFromQuaternion(s), d.makeScale(h.x, h.y, h.z), this.multiplyMatrices(l, d), _[12] = f.x, _[13] = f.y, _[14] = f.z, this; + compose(f, s, u) { + const p = this.elements; + return l.identity(), l.setRotationFromQuaternion(s), h.makeScale(u.x, u.y, u.z), this.multiplyMatrices(l, h), p[12] = f.x, p[13] = f.y, p[14] = f.z, this; } } - l = new m(), d = new m(); + l = new m(), h = new m(); class y { - constructor(f, s, h) { - this.x = f || 0, this.y = s || 0, this.z = h || 0, this.atomid = void 0; + constructor(f, s, u) { + this.x = f || 0, this.y = s || 0, this.z = u || 0, this.atomid = void 0; } - set(f, s, h) { - return this.x = f, this.y = s, this.z = h, this; + set(f, s, u) { + return this.x = f, this.y = s, this.z = u, this; } copy(f) { return this.x = f.x, this.y = f.y, this.z = f.z, this; @@ -29890,26 +29890,26 @@ ATOM`, x); return Math.sqrt(this.distanceToSquared(f)); } distanceToSquared(f) { - const s = this.x - f.x, h = this.y - f.y, _ = this.z - f.z; - return s * s + h * h + _ * _; + const s = this.x - f.x, u = this.y - f.y, p = this.z - f.z; + return s * s + u * u + p * p; } applyMatrix3(f) { - const { x: s } = this, { y: h } = this, { z: _ } = this, g = f.elements; - return this.x = g[0] * s + g[3] * h + g[6] * _, this.y = g[1] * s + g[4] * h + g[7] * _, this.z = g[2] * s + g[5] * h + g[8] * _, this; + const { x: s } = this, { y: u } = this, { z: p } = this, g = f.elements; + return this.x = g[0] * s + g[3] * u + g[6] * p, this.y = g[1] * s + g[4] * u + g[7] * p, this.z = g[2] * s + g[5] * u + g[8] * p, this; } applyMatrix4(f) { - const { x: s } = this, { y: h } = this, { z: _ } = this, g = f.elements; - return this.x = g[0] * s + g[4] * h + g[8] * _ + g[12], this.y = g[1] * s + g[5] * h + g[9] * _ + g[13], this.z = g[2] * s + g[6] * h + g[10] * _ + g[14], this; + const { x: s } = this, { y: u } = this, { z: p } = this, g = f.elements; + return this.x = g[0] * s + g[4] * u + g[8] * p + g[12], this.y = g[1] * s + g[5] * u + g[9] * p + g[13], this.z = g[2] * s + g[6] * u + g[10] * p + g[14], this; } applyProjection(f) { - const { x: s } = this, { y: h } = this, { z: _ } = this, g = f.elements, x = g[3] * s + g[7] * h + g[11] * _ + g[15]; - return this.x = (g[0] * s + g[4] * h + g[8] * _ + g[12]) / x, this.y = (g[1] * s + g[5] * h + g[9] * _ + g[13]) / x, this.z = (g[2] * s + g[6] * h + g[10] * _ + g[14]) / x, this; + const { x: s } = this, { y: u } = this, { z: p } = this, g = f.elements, w = g[3] * s + g[7] * u + g[11] * p + g[15]; + return this.x = (g[0] * s + g[4] * u + g[8] * p + g[12]) / w, this.y = (g[1] * s + g[5] * u + g[9] * p + g[13]) / w, this.z = (g[2] * s + g[6] * u + g[10] * p + g[14]) / w, this; } applyQuaternion(f) { - const { x: s } = this, { y: h } = this, { z: _ } = this, g = f.x, x = f.y, c = f.z, v = f.w, M = {}; - M.x = 2 * (h * c - _ * x), M.y = 2 * (_ * g - s * c), M.z = 2 * (s * x - h * g); + const { x: s } = this, { y: u } = this, { z: p } = this, g = f.x, w = f.y, o = f.z, v = f.w, M = {}; + M.x = 2 * (u * o - p * w), M.y = 2 * (p * g - s * o), M.z = 2 * (s * w - u * g); const E = {}; - return E.x = M.y * c - M.z * x, E.y = M.z * g - M.x * c, E.z = M.x * x - M.y * g, this.x = s + v * M.x + E.x, this.y = h + v * M.y + E.y, this.z = _ + v * M.z + E.z, this; + return E.x = M.y * o - M.z * w, E.y = M.z * g - M.x * o, E.z = M.x * w - M.y * g, this.x = s + v * M.x + E.x, this.y = u + v * M.y + E.y, this.z = p + v * M.z + E.z, this; } negate() { return this.multiplyScalar(-1); @@ -29927,8 +29927,8 @@ ATOM`, x); return this.divideScalar(this.length()); } cross(f) { - const { x: s } = this, { y: h } = this, { z: _ } = this; - return this.x = h * f.z - _ * f.y, this.y = _ * f.x - s * f.z, this.z = s * f.y - h * f.x, this; + const { x: s } = this, { y: u } = this, { z: p } = this; + return this.x = u * f.z - p * f.y, this.y = p * f.x - s * f.z, this.z = s * f.y - u * f.x, this; } crossVectors(f, s) { return this.x = f.y * s.z - f.z * s.y, this.y = f.z * s.x - f.x * s.z, this.z = f.x * s.y - f.y * s.x, this; @@ -29940,12 +29940,12 @@ ATOM`, x); return this.x = f.elements[12], this.y = f.elements[13], this.z = f.elements[14], this; } setEulerFromRotationMatrix(f, s) { - const h = f.elements, _ = h[0], g = h[4], x = h[8], c = h[5], v = h[9], M = h[6], E = h[10]; - return s === void 0 || s === "XYZ" ? (this.y = Math.asin((0, a.clamp)(x, -1, 1)), Math.abs(x) < 0.99999 ? (this.x = Math.atan2(-v, E), this.z = Math.atan2(-g, _)) : (this.x = Math.atan2(M, c), this.z = 0)) : console.error(`Error with vector's setEulerFromRotationMatrix: Unknown order: ${s}`), this; + const u = f.elements, p = u[0], g = u[4], w = u[8], o = u[5], v = u[9], M = u[6], E = u[10]; + return s === void 0 || s === "XYZ" ? (this.y = Math.asin((0, a.clamp)(w, -1, 1)), Math.abs(w) < 0.99999 ? (this.x = Math.atan2(-v, E), this.z = Math.atan2(-g, p)) : (this.x = Math.atan2(M, o), this.z = 0)) : console.error(`Error with vector's setEulerFromRotationMatrix: Unknown order: ${s}`), this; } rotateAboutVector(f, s) { f.normalize(); - const h = Math.cos(s), _ = Math.sin(s), g = this.clone().multiplyScalar(h), x = f.clone().cross(this).multiplyScalar(_), c = f.clone().multiplyScalar(f.clone().dot(this)).multiplyScalar(1 - h), v = g.add(x).add(c); + const u = Math.cos(s), p = Math.sin(s), g = this.clone().multiplyScalar(u), w = f.clone().cross(this).multiplyScalar(p), o = f.clone().multiplyScalar(f.clone().dot(this)).multiplyScalar(1 - u), v = g.add(w).add(o); return this.x = v.x, this.y = v.y, this.z = v.z, this; } setFromMatrixPosition(f) { @@ -29954,8 +29954,8 @@ ATOM`, x); } // unproject is defined after Matrix4 transformDirection(f) { - const { x: s } = this, { y: h } = this, { z: _ } = this, g = f.elements; - return this.x = g[0] * s + g[4] * h + g[8] * _, this.y = g[1] * s + g[5] * h + g[9] * _, this.z = g[2] * s + g[6] * h + g[10] * _, this.normalize(); + const { x: s } = this, { y: u } = this, { z: p } = this, g = f.elements; + return this.x = g[0] * s + g[4] * u + g[8] * p, this.y = g[1] * s + g[5] * u + g[9] * p, this.z = g[2] * s + g[6] * u + g[10] * p, this.normalize(); } clone() { return new y(this.x, this.y, this.z); @@ -29965,14 +29965,14 @@ ATOM`, x); return s.multiplyMatrices(f.matrixWorld, s.getInverse(f.projectionMatrix)), this.applyMatrix4(s); } } - o = new y(), u = new y(), p = new y(); - class w { - constructor(f = 1, s = 0, h = 0, _ = 0, g = 1, x = 0, c = 0, v = 0, M = 1) { - this.elements = new Float32Array(9), this.set(f, s, h, _, g, x, c, v, M); + c = new y(), d = new y(), _ = new y(); + class x { + constructor(f = 1, s = 0, u = 0, p = 0, g = 1, w = 0, o = 0, v = 0, M = 1) { + this.elements = new Float32Array(9), this.set(f, s, u, p, g, w, o, v, M); } - set(f, s, h, _, g, x, c, v, M) { + set(f, s, u, p, g, w, o, v, M) { const E = this.elements; - return E[0] = f, E[3] = s, E[6] = h, E[1] = _, E[4] = g, E[7] = x, E[2] = c, E[5] = v, E[8] = M, this; + return E[0] = f, E[3] = s, E[6] = u, E[1] = p, E[4] = g, E[7] = w, E[2] = o, E[5] = v, E[8] = M, this; } identity() { return this.set(1, 0, 0, 0, 1, 0, 0, 0, 1), this; @@ -29986,20 +29986,20 @@ ATOM`, x); return s[0] *= f, s[3] *= f, s[6] *= f, s[1] *= f, s[4] *= f, s[7] *= f, s[2] *= f, s[5] *= f, s[8] *= f, this; } getInverse3(f) { - const s = f.elements, h = this.elements; - h[0] = s[4] * s[8] - s[5] * s[7], h[3] = s[6] * s[5] - s[3] * s[8], h[6] = s[3] * s[7] - s[6] * s[4], h[1] = s[7] * s[2] - s[1] * s[8], h[4] = s[0] * s[8] - s[6] * s[2], h[7] = s[1] * s[6] - s[0] * s[7], h[2] = s[1] * s[5] - s[2] * s[4], h[5] = s[2] * s[3] - s[0] * s[5], h[8] = s[0] * s[4] - s[1] * s[3]; - const _ = s[0] * h[0] + s[3] * h[1] + s[6] * h[2]; - return this.multiplyScalar(1 / _), this; + const s = f.elements, u = this.elements; + u[0] = s[4] * s[8] - s[5] * s[7], u[3] = s[6] * s[5] - s[3] * s[8], u[6] = s[3] * s[7] - s[6] * s[4], u[1] = s[7] * s[2] - s[1] * s[8], u[4] = s[0] * s[8] - s[6] * s[2], u[7] = s[1] * s[6] - s[0] * s[7], u[2] = s[1] * s[5] - s[2] * s[4], u[5] = s[2] * s[3] - s[0] * s[5], u[8] = s[0] * s[4] - s[1] * s[3]; + const p = s[0] * u[0] + s[3] * u[1] + s[6] * u[2]; + return this.multiplyScalar(1 / p), this; } getInverse(f, s) { - const h = f.elements, _ = this.elements; - _[0] = h[10] * h[5] - h[6] * h[9], _[1] = -h[10] * h[1] + h[2] * h[9], _[2] = h[6] * h[1] - h[2] * h[5], _[3] = -h[10] * h[4] + h[6] * h[8], _[4] = h[10] * h[0] - h[2] * h[8], _[5] = -h[6] * h[0] + h[2] * h[4], _[6] = h[9] * h[4] - h[5] * h[8], _[7] = -h[9] * h[0] + h[1] * h[8], _[8] = h[5] * h[0] - h[1] * h[4]; - const g = h[0] * _[0] + h[1] * _[3] + h[2] * _[6]; + const u = f.elements, p = this.elements; + p[0] = u[10] * u[5] - u[6] * u[9], p[1] = -u[10] * u[1] + u[2] * u[9], p[2] = u[6] * u[1] - u[2] * u[5], p[3] = -u[10] * u[4] + u[6] * u[8], p[4] = u[10] * u[0] - u[2] * u[8], p[5] = -u[6] * u[0] + u[2] * u[4], p[6] = u[9] * u[4] - u[5] * u[8], p[7] = -u[9] * u[0] + u[1] * u[8], p[8] = u[5] * u[0] - u[1] * u[4]; + const g = u[0] * p[0] + u[1] * p[3] + u[2] * p[6]; if (g === 0) { - const x = "Matrix3.getInverse(): can't invert matrix, determinant is 0"; + const w = "Matrix3.getInverse(): can't invert matrix, determinant is 0"; if (s) - throw new Error(x); - return console.warn(x), this.identity(), this; + throw new Error(w); + return console.warn(w), this.identity(), this; } return this.multiplyScalar(1 / g), this; } @@ -30020,7 +30020,7 @@ ATOM`, x); } clone() { const f = this.elements; - return new w(f[0], f[3], f[6], f[1], f[4], f[7], f[2], f[5], f[8]); + return new x(f[0], f[3], f[6], f[1], f[4], f[7], f[2], f[5], f[8]); } getMatrix4() { const f = this.elements; @@ -30041,18 +30041,18 @@ ATOM`, x); return (s || new y()).copy(this.direction).multiplyScalar(f).add(this.origin); } recast(f) { - const s = o; + const s = c; return this.origin.copy(this.at(f, s)), this; } closestPointToPoint(f, s) { - const h = s || new y(); - h.subVectors(f, this.origin); - const _ = h.dot(this.direction); - return h.copy(this.direction).multiplyScalar(_).add(this.origin); + const u = s || new y(); + u.subVectors(f, this.origin); + const p = u.dot(this.direction); + return u.copy(this.direction).multiplyScalar(p).add(this.origin); } distanceToPoint(f) { - const s = o, h = s.subVectors(f, this.origin).dot(this.direction); - return s.copy(this.direction).multiplyScalar(h).add(this.origin), s.distanceTo(f); + const s = c, u = s.subVectors(f, this.origin).dot(this.direction); + return s.copy(this.direction).multiplyScalar(u).add(this.origin), s.distanceTo(f); } // eslint-disable-next-line class-methods-use-this isIntersectionCylinder() { @@ -30068,9 +30068,9 @@ ATOM`, x); return s === 0 ? f.distanceToPoint(this.origin) === 0 ? 0 : void 0 : -(this.origin.dot(f.normal) + f.constant) / s; } intersectPlane(f, s) { - const h = this.distanceToPlane(f); - if (h !== void 0) - return this.at(h, s); + const u = this.distanceToPlane(f); + if (u !== void 0) + return this.at(u, s); } applyMatrix4(f) { return this.direction.add(this.origin).applyMatrix4(f), this.origin.applyMatrix4(f), this.direction.sub(this.origin), this; @@ -30096,8 +30096,8 @@ ATOM`, x); ) /* harmony export */ }); - function r(a, l, d) { - return Math.min(Math.max(a, l), d); + function r(a, l, h) { + return Math.min(Math.max(a, l), h); } } ), @@ -30120,10 +30120,10 @@ ATOM`, x); /*! ../math */ "./src/WebGL/math/math.ts" ); - function a(l, d, o, u, p, m) { - u = u * Math.PI / 180, p = p * Math.PI / 180, m = m * Math.PI / 180; - const y = (h) => h * h, w = Math.cos(u), b = Math.cos(p), A = Math.cos(m), f = Math.sin(m); - return new r.Matrix3(l, d * A, o * b, 0, d * f, o * (w - b * A) / f, 0, 0, o * Math.sqrt(1 - y(w) - y(b) - y(A) + 2 * w * b * A) / f); + function a(l, h, c, d, _, m) { + d = d * Math.PI / 180, _ = _ * Math.PI / 180, m = m * Math.PI / 180; + const y = (u) => u * u, x = Math.cos(d), b = Math.cos(_), A = Math.cos(m), f = Math.sin(m); + return new r.Matrix3(l, h * A, c * b, 0, h * f, c * (x - b * A) / f, 0, 0, c * Math.sqrt(1 - y(x) - y(b) - y(A) + 2 * x * b * A) / f); } } ), @@ -30159,7 +30159,7 @@ ATOM`, x); /* harmony export */ Line: () => ( /* binding */ - d + h ), /* harmony export */ LineStyle: () => ( @@ -30175,17 +30175,17 @@ ATOM`, x); /*! ../core */ "./src/WebGL/core/index.ts" ), l; - (function(o) { - o[o.LineStrip = 0] = "LineStrip", o[o.LinePieces = 1] = "LinePieces"; + (function(c) { + c[c.LineStrip = 0] = "LineStrip", c[c.LinePieces = 1] = "LinePieces"; })(l || (l = {})); - class d extends a.Object3D { - constructor(u, p = new r.LineBasicMaterial({ + class h extends a.Object3D { + constructor(d, _ = new r.LineBasicMaterial({ color: Math.random() * 16777215 }), m = l.LineStrip) { - super(), this.geometry = u, this.material = p, this.type = m; + super(), this.geometry = d, this.material = _, this.type = m; } - clone(u = new d(this.geometry, this.material, this.type)) { - return super.clone.call(this, u), u; + clone(d = new h(this.geometry, this.material, this.type)) { + return super.clone.call(this, d), d; } } } @@ -30210,11 +30210,11 @@ ATOM`, x); "./src/WebGL/core/index.ts" ); class a extends r.Object3D { - constructor(d, o) { - super(), this.geometry = d, this.material = o; + constructor(h, c) { + super(), this.geometry = h, this.material = c; } - clone(d) { - return d === void 0 && (d = new a(this.geometry, this.material)), super.clone.call(this, d), d; + clone(h) { + return h === void 0 && (h = new a(this.geometry, this.material)), super.clone.call(this, h), h; } } } @@ -30242,14 +30242,14 @@ ATOM`, x); "./src/WebGL/core/index.ts" ); class l extends a.Object3D { - constructor(o = new r.SpriteMaterial()) { - super(), this.material = o, this.rotation3d = this.rotation, this.rotation = 0; + constructor(c = new r.SpriteMaterial()) { + super(), this.material = c, this.rotation3d = this.rotation, this.rotation = 0; } updateMatrix() { this.matrix.setPosition(this.position), this.rotation3d.set(0, 0, this.rotation), this.matrix.setRotationFromEuler(this.rotation3d), (this.scale.x !== 1 || this.scale.y !== 1) && this.matrix.scale(this.scale), this.matrixWorldNeedsUpdate = !0; } - clone(o = new l(this.material)) { - return a.Object3D.prototype.clone.call(this, o), o; + clone(c = new l(this.material)) { + return a.Object3D.prototype.clone.call(this, c), c; } } } @@ -30420,7 +30420,7 @@ ATOM`, x); /* harmony export */ basic: () => ( /* binding */ - d + h ) /* harmony export */ }); @@ -30434,7 +30434,7 @@ ATOM`, x); /*! ./basic.vert */ "./src/WebGL/shaders/lib/basic/basic.vert" ); - const d = { + const h = { vertexShader: l.default.replace("#define GLSLIFY 1", ""), fragmentShader: a.default.replace("#define GLSLIFY 1", ""), uniforms: r.uniforms @@ -30479,7 +30479,7 @@ ATOM`, x); /* harmony export */ blur: () => ( /* binding */ - d + h ) /* harmony export */ }); @@ -30493,7 +30493,7 @@ ATOM`, x); /*! ./blur.vert */ "./src/WebGL/shaders/lib/blur/blur.vert" ); - const d = { + const h = { fragmentShader: a.default, vertexShader: l.default, uniforms: r.uniforms @@ -30529,7 +30529,7 @@ ATOM`, x); /* harmony export */ ShaderLib: () => ( /* binding */ - _ + p ), /* harmony export */ basic: () => ( @@ -30549,22 +30549,22 @@ ATOM`, x); /* harmony export */ lambertdouble: () => ( /* reexport safe */ - d.lambertdouble + h.lambertdouble ), /* harmony export */ outline: () => ( /* reexport safe */ - o.outline + c.outline ), /* harmony export */ screen: () => ( /* reexport safe */ - u.screen + d.screen ), /* harmony export */ screenaa: () => ( /* reexport safe */ - p.screenaa + _.screenaa ), /* harmony export */ sphereimposter: () => ( @@ -30579,7 +30579,7 @@ ATOM`, x); /* harmony export */ sprite: () => ( /* reexport safe */ - w.sprite + x.sprite ), /* harmony export */ stickimposter: () => ( @@ -30607,16 +30607,16 @@ ATOM`, x); ), l = t( /*! ./lambert */ "./src/WebGL/shaders/lib/lambert/index.ts" - ), d = t( + ), h = t( /*! ./lambertdouble */ "./src/WebGL/shaders/lib/lambertdouble/index.ts" - ), o = t( + ), c = t( /*! ./outline */ "./src/WebGL/shaders/lib/outline/index.ts" - ), u = t( + ), d = t( /*! ./screen */ "./src/WebGL/shaders/lib/screen/index.ts" - ), p = t( + ), _ = t( /*! ./screenaa */ "./src/WebGL/shaders/lib/screenaa/index.ts" ), m = t( @@ -30625,7 +30625,7 @@ ATOM`, x); ), y = t( /*! ./sphereimposteroutline */ "./src/WebGL/shaders/lib/sphereimposteroutline/index.ts" - ), w = t( + ), x = t( /*! ./sprite */ "./src/WebGL/shaders/lib/sprite/index.ts" ), b = t( @@ -30640,23 +30640,23 @@ ATOM`, x); ), s = t( /*! ./ssao */ "./src/WebGL/shaders/lib/ssao/index.ts" - ), h = t( + ), u = t( /*! ./blur */ "./src/WebGL/shaders/lib/blur/index.ts" ); - const _ = { + const p = { basic: r.basic, - blur: h.blur, + blur: u.blur, instanced: a.instanced, lambert: l.lambert, - lambertdouble: d.lambertdouble, - outline: o.outline, - screen: u.screen, - screenaa: p.screenaa, + lambertdouble: h.lambertdouble, + outline: c.outline, + screen: d.screen, + screenaa: _.screenaa, ssao: s.ssao, sphereimposter: m.sphereimposter, sphereimposteroutline: y.sphereimposteroutline, - sprite: w.sprite, + sprite: x.sprite, stickimposter: b.stickimposter, stickimposteroutline: A.stickimposteroutline, volumetric: f.volumetric @@ -30674,7 +30674,7 @@ ATOM`, x); /* harmony export */ instanced: () => ( /* binding */ - d + h ) /* harmony export */ }); @@ -30688,7 +30688,7 @@ ATOM`, x); /*! ./instanced.vert */ "./src/WebGL/shaders/lib/instanced/instanced.vert" ); - const d = { + const h = { fragmentShader: a.default.replace("#define GLSLIFY 1", ""), vertexShader: l.default.replace("#define GLSLIFY 1", ""), uniforms: r.uniforms @@ -30735,7 +30735,7 @@ ATOM`, x); /* harmony export */ lambert: () => ( /* binding */ - d + h ) /* harmony export */ }); @@ -30749,7 +30749,7 @@ ATOM`, x); /*! ./lambert.vert */ "./src/WebGL/shaders/lib/lambert/lambert.vert" ); - const d = { + const h = { fragmentShader: a.default.replace("#define GLSLIFY 1", ""), vertexShader: l.default.replace("#define GLSLIFY 1", ""), uniforms: r.uniforms @@ -30796,7 +30796,7 @@ ATOM`, x); /* harmony export */ lambertdouble: () => ( /* binding */ - d + h ) /* harmony export */ }); @@ -30810,7 +30810,7 @@ ATOM`, x); /*! ./lambertdouble.vert */ "./src/WebGL/shaders/lib/lambertdouble/lambertdouble.vert" ); - const d = { + const h = { fragmentShader: a.default.replace("#define GLSLIFY 1", ""), vertexShader: l.default.replace("#define GLSLIFY 1", ""), uniforms: r.uniforms @@ -30857,7 +30857,7 @@ ATOM`, x); /* harmony export */ outline: () => ( /* binding */ - d + h ) /* harmony export */ }); @@ -30871,7 +30871,7 @@ ATOM`, x); /*! ./outline.vert */ "./src/WebGL/shaders/lib/outline/outline.vert" ); - const d = { + const h = { fragmentShader: a.default.replace("#define GLSLIFY 1", ""), vertexShader: l.default.replace("#define GLSLIFY 1", ""), uniforms: r.uniforms @@ -30920,7 +30920,7 @@ ATOM`, x); /* harmony export */ screen: () => ( /* binding */ - d + h ) /* harmony export */ }); @@ -30934,7 +30934,7 @@ ATOM`, x); /*! ./screen.vert */ "./src/WebGL/shaders/lib/screen/screen.vert" ); - const d = { + const h = { fragmentShader: a.default.replace("#define GLSLIFY 1", ""), vertexShader: l.default.replace("#define GLSLIFY 1", ""), uniforms: r.uniforms @@ -30970,7 +30970,7 @@ ATOM`, x); /* harmony export */ screenaa: () => ( /* binding */ - d + h ) /* harmony export */ }); @@ -30984,7 +30984,7 @@ ATOM`, x); /*! ./screenaa.vert */ "./src/WebGL/shaders/lib/screenaa/screenaa.vert" ); - const d = { + const h = { fragmentShader: a.default.replace("#define GLSLIFY 1", ""), vertexShader: l.default.replace("#define GLSLIFY 1", ""), uniforms: r.uniforms @@ -31020,7 +31020,7 @@ ATOM`, x); /* harmony export */ sphereimposter: () => ( /* binding */ - d + h ) /* harmony export */ }); @@ -31034,7 +31034,7 @@ ATOM`, x); /*! ./sphereimposter.vert */ "./src/WebGL/shaders/lib/sphereimposter/sphereimposter.vert" ); - const d = { + const h = { vertexShader: l.default.replace("#define GLSLIFY 1", ""), fragmentShader: a.default.replace("#define GLSLIFY 1", ""), uniforms: r.uniforms @@ -31081,7 +31081,7 @@ ATOM`, x); /* harmony export */ sphereimposteroutline: () => ( /* binding */ - d + h ) /* harmony export */ }); @@ -31095,7 +31095,7 @@ ATOM`, x); /*! ./sphereimposteroutline.vert */ "./src/WebGL/shaders/lib/sphereimposteroutline/sphereimposteroutline.vert" ); - const d = { + const h = { fragmentShader: a.default.replace("#define GLSLIFY 1", ""), vertexShader: l.default.replace("#define GLSLIFY 1", ""), uniforms: r.uniforms @@ -31144,7 +31144,7 @@ ATOM`, x); /* harmony export */ sprite: () => ( /* binding */ - d + h ) /* harmony export */ }); @@ -31158,7 +31158,7 @@ ATOM`, x); /*! ./sprite.vert */ "./src/WebGL/shaders/lib/sprite/sprite.vert" ); - const d = { + const h = { fragmentShader: a.default.replace("#define GLSLIFY 1", ""), vertexShader: l.default.replace("#define GLSLIFY 1", ""), uniforms: r.uniforms @@ -31194,7 +31194,7 @@ ATOM`, x); /* harmony export */ ssao: () => ( /* binding */ - d + h ) /* harmony export */ }); @@ -31208,7 +31208,7 @@ ATOM`, x); /*! ./ssao.vert */ "./src/WebGL/shaders/lib/ssao/ssao.vert" ); - const d = { + const h = { fragmentShader: a.default, vertexShader: l.default, uniforms: r.uniforms @@ -31248,7 +31248,7 @@ ATOM`, x); /* harmony export */ stickimposter: () => ( /* binding */ - u + d ) /* harmony export */ }); @@ -31261,14 +31261,14 @@ ATOM`, x); ), l = t( /*! ./stickimposter.partial.frag */ "./src/WebGL/shaders/lib/stickimposter/stickimposter.partial.frag" - ), d = t( + ), h = t( /*! ./stickimposter.vert */ "./src/WebGL/shaders/lib/stickimposter/stickimposter.vert" ); - const u = { + const d = { fragmentShader: [a.default, l.default].join(` `), - vertexShader: d.default, + vertexShader: h.default, uniforms: r.uniforms }; } @@ -31313,7 +31313,7 @@ ATOM`, x); /* harmony export */ stickimposteroutline: () => ( /* binding */ - o + c ) /* harmony export */ }); @@ -31327,7 +31327,7 @@ ATOM`, x); /*! ./stickimposteroutline.vert */ "./src/WebGL/shaders/lib/stickimposteroutline/stickimposteroutline.vert" ); - const o = { + const c = { fragmentShader: a.default + "gl_FragColor = vec4(color,1.0);}", vertexShader: l.default, uniforms: r.uniforms @@ -31377,7 +31377,7 @@ ATOM`, x); /* harmony export */ volumetric: () => ( /* binding */ - d + h ) /* harmony export */ }); @@ -31391,7 +31391,7 @@ ATOM`, x); /*! ./volumetric.vert */ "./src/WebGL/shaders/lib/volumetric/volumetric.vert" ); - const d = { + const h = { fragmentShader: a.default.replace("#define GLSLIFY 1", ""), vertexShader: l.default.replace("#define GLSLIFY 1", ""), uniforms: r.uniforms @@ -31455,13 +31455,13 @@ ATOM`, x); "./src/colors.ts" ); function a(l) { - let d = {}; - for (const u in l) { - d[u] = {}, d[u].type = l[u].type; - var o = l[u].value; - o instanceof r.Color ? d[u].value = o.clone() : typeof o == "number" ? d[u].value = o : o instanceof Array ? d[u].value = [] : console.error("Error copying shader uniforms from ShaderLib: unknown type for uniform"); + let h = {}; + for (const d in l) { + h[d] = {}, h[d].type = l[d].type; + var c = l[d].value; + c instanceof r.Color ? h[d].value = c.clone() : typeof c == "number" ? h[d].value = c : c instanceof Array ? h[d].value = [] : console.error("Error copying shader uniforms from ShaderLib: unknown type for uniform"); } - return d; + return h; } } ), @@ -31515,17 +31515,17 @@ ATOM`, x); ); let a = new r.Vector3(); class l { - constructor(o = new r.Vector3(), u = new r.Vector3(), p = 0) { - this.c1 = o, this.c2 = u, this.radius = p, this.direction = new r.Vector3().subVectors(this.c2, this.c1).normalize(); + constructor(c = new r.Vector3(), d = new r.Vector3(), _ = 0) { + this.c1 = c, this.c2 = d, this.radius = _, this.direction = new r.Vector3().subVectors(this.c2, this.c1).normalize(); } - copy(o) { - return this.c1.copy(o.c1), this.c2.copy(o.c2), this.direction.copy(o.direction), this.radius = o.radius, this; + copy(c) { + return this.c1.copy(c.c1), this.c2.copy(c.c2), this.direction.copy(c.direction), this.radius = c.radius, this; } lengthSq() { return a.subVectors(this.c2, this.c1).lengthSq(); } - applyMatrix4(o) { - return this.direction.add(this.c1).applyMatrix4(o), this.c1.applyMatrix4(o), this.c2.applyMatrix4(o), this.direction.sub(this.c1).normalize(), this.radius = this.radius * o.getMaxScaleOnAxis(), this; + applyMatrix4(c) { + return this.direction.add(this.c1).applyMatrix4(c), this.c1.applyMatrix4(c), this.c2.applyMatrix4(c), this.direction.sub(this.c1).normalize(), this.radius = this.radius * c.getMaxScaleOnAxis(), this; } } } @@ -31550,23 +31550,23 @@ ATOM`, x); "./src/WebGL/math/index.ts" ); class a { - constructor(d = { x: 0, y: 0, z: 0 }, o = 0) { - this.center = new r.Vector3(d.x, d.y, d.z), this.radius = o; + constructor(h = { x: 0, y: 0, z: 0 }, c = 0) { + this.center = new r.Vector3(h.x, h.y, h.z), this.radius = c; } - set(d, o) { - return this.center.copy(d), this.radius = o, this; + set(h, c) { + return this.center.copy(h), this.radius = c, this; } - copy(d) { - return this.center.copy(d.center), this.radius = d.radius, this; + copy(h) { + return this.center.copy(h.center), this.radius = h.radius, this; } - applyMatrix4(d) { - return this.center.applyMatrix4(d), this.radius = this.radius * d.getMaxScaleOnAxis(), this; + applyMatrix4(h) { + return this.center.applyMatrix4(h), this.radius = this.radius * h.getMaxScaleOnAxis(), this; } - translate(d) { - return this.center.add(d), this; + translate(h) { + return this.center.add(h), this; } - equals(d) { - return d.center.equals(this.center) && d.radius === this.radius; + equals(h) { + return h.center.equals(this.center) && h.radius === this.radius; } clone() { return new a().copy(this); @@ -31595,18 +31595,18 @@ ATOM`, x); ); const a = new r.Vector3(); class l { - constructor(o = new r.Vector3(), u = new r.Vector3(), p = new r.Vector3()) { - this.a = o, this.b = u, this.c = p; + constructor(c = new r.Vector3(), d = new r.Vector3(), _ = new r.Vector3()) { + this.a = c, this.b = d, this.c = _; } - copy(o) { - return this.a.copy(o.a), this.b.copy(o.b), this.c.copy(o.c), this; + copy(c) { + return this.a.copy(c.a), this.b.copy(c.b), this.c.copy(c.c), this; } - applyMatrix4(o) { - return this.a.applyMatrix4(o), this.b.applyMatrix4(o), this.c.applyMatrix4(o), this; + applyMatrix4(c) { + return this.a.applyMatrix4(c), this.b.applyMatrix4(c), this.c.applyMatrix4(c), this; } getNormal() { - var o = this.a.clone(); - return o.sub(this.b), a.subVectors(this.c, this.b), o.cross(a), o.normalize(), o; + var c = this.a.clone(); + return c.sub(this.b), a.subVectors(this.c, this.b), c.cross(a), c.normalize(), c; } } } @@ -31659,7 +31659,7 @@ ATOM`, x); /* harmony export */ autoinit: () => ( /* binding */ - o + c ), /* harmony export */ autoload: () => ( @@ -31669,12 +31669,12 @@ ATOM`, x); /* harmony export */ processing_autoinit: () => ( /* binding */ - u + d ), /* harmony export */ viewers: () => ( /* binding */ - p + _ ) /* harmony export */ }); @@ -31687,92 +31687,92 @@ ATOM`, x); ), l = t( /*! ./utilities */ "./src/utilities.ts" - ), d = t( + ), h = t( /*! ./colors */ "./src/colors.ts" - ), o = !1, u = !1, p = {}; - function m(y, w) { + ), c = !1, d = !1, _ = {}; + function m(y, x) { var b, A, f; - if (document.querySelector(".viewer_3Dmoljs") != null && (o = !0), o) { - u = !0, y = y ?? null; + if (document.querySelector(".viewer_3Dmoljs") != null && (c = !0), c) { + d = !0, y = y ?? null; var s = 0; - document.querySelectorAll(".viewer_3Dmoljs").forEach((h) => { - var _ = [], g = [], x = ""; - h.style.position == "static" && (h.style.position = "relative"); - var c = null; - if (f = null, h.dataset.pdb) - _.push("https://files.rcsb.org/view/" + h.dataset.pdb + ".pdb"), g.push("pdb"); - else if (h.dataset.cid) - g.push("sdf"), _.push("https://pubchem.ncbi.nlm.nih.gov/rest/pug/compound/cid/" + h.dataset.cid + "/SDF?record_type=3d"); - else if (h.dataset.href || h.dataset.url) { - if (h.dataset.href ? x = h.dataset.href : x = h.dataset.url, _.push(x), f = x.substring(x.lastIndexOf(".") + 1), f == "gz") { - let ue = x.substring(0, x.lastIndexOf(".")).lastIndexOf("."); - f = x.substring(ue + 1); + document.querySelectorAll(".viewer_3Dmoljs").forEach((u) => { + var p = [], g = [], w = ""; + u.style.position == "static" && (u.style.position = "relative"); + var o = null; + if (f = null, u.dataset.pdb) + p.push("https://files.rcsb.org/view/" + u.dataset.pdb + ".pdb"), g.push("pdb"); + else if (u.dataset.cid) + g.push("sdf"), p.push("https://pubchem.ncbi.nlm.nih.gov/rest/pug/compound/cid/" + u.dataset.cid + "/SDF?record_type=3d"); + else if (u.dataset.href || u.dataset.url) { + if (u.dataset.href ? w = u.dataset.href : w = u.dataset.url, p.push(w), f = w.substring(w.lastIndexOf(".") + 1), f == "gz") { + let he = w.substring(0, w.lastIndexOf(".")).lastIndexOf("."); + f = w.substring(he + 1); } g.push(f); - var v = x.substring(x.lastIndexOf("/") + 1, x.lastIndexOf(".")); - v == "/" && (v = x.substring(x.lastIndexOf("/") + 1)), h.dataset[g[g.length - 1]] = v; + var v = w.substring(w.lastIndexOf("/") + 1, w.lastIndexOf(".")); + v == "/" && (v = w.substring(w.lastIndexOf("/") + 1)), u.dataset[g[g.length - 1]] = v; } - let M = h.dataset; + let M = u.dataset; for (b in M) - b.substring(0, 3) === "pdb" && b !== "pdb" ? (_.push("https://files.rcsb.org/view/" + M[b] + ".pdb"), g.push("pdb")) : b.substring(0, 4) === "href" && b !== "href" ? (x = M[b], _.push(x), g.push(x.substring(x.lastIndexOf(".") + 1))) : b.substring(0, 3) === "cid" && b !== "cid" && (_.push("https://pubchem.ncbi.nlm.nih.gov/rest/pug/compound/cid/" + M[b] + "/SDF?record_type=3d"), g.push("sdf")); + b.substring(0, 3) === "pdb" && b !== "pdb" ? (p.push("https://files.rcsb.org/view/" + M[b] + ".pdb"), g.push("pdb")) : b.substring(0, 4) === "href" && b !== "href" ? (w = M[b], p.push(w), g.push(w.substring(w.lastIndexOf(".") + 1))) : b.substring(0, 3) === "cid" && b !== "cid" && (p.push("https://pubchem.ncbi.nlm.nih.gov/rest/pug/compound/cid/" + M[b] + "/SDF?record_type=3d"), g.push("sdf")); var E = {}; - h.dataset.options && (E = (0, l.specStringToObject)(h.dataset.options)); - var $ = d.CC.color(h.dataset.backgroundcolor), k = h.dataset.backgroundalpha; + u.dataset.options && (E = (0, l.specStringToObject)(u.dataset.options)); + var $ = h.CC.color(u.dataset.backgroundcolor), k = u.dataset.backgroundalpha; k = k == null ? 1 : parseFloat(k); var L = { line: {} }; - h.dataset.style && (L = (0, l.specStringToObject)(h.dataset.style)); + u.dataset.style && (L = (0, l.specStringToObject)(u.dataset.style)); var z = {}; - h.dataset.select && (z = (0, l.specStringToObject)(h.dataset.select)); - var O = [], R = [], P = [], U = {}, B = null, N = h.dataset, G = /style(.+)/, H = /surface(.*)/, W = /labelres(.*)/, V = []; - for (A in N) - Object.prototype.hasOwnProperty.call(N, A) && V.push(A); - for (V.sort(), b = 0; b < V.length; b++) { - A = V[b]; - var re = G.exec(A), ie, ee, ce; - re && (ie = "select" + re[1], ee = (0, l.specStringToObject)(N[ie]), ce = (0, l.specStringToObject)(N[A]), O.push([ee, ce])), re = H.exec(A), re && (ie = "select" + re[1], ee = (0, l.specStringToObject)(N[ie]), ce = (0, l.specStringToObject)(N[A]), R.push([ee, ce])), re = W.exec(A), re && (ie = "select" + re[1], ee = (0, l.specStringToObject)(N[ie]), ce = (0, l.specStringToObject)(N[A]), P.push([ee, ce])), A == "zoomto" && (U = (0, l.specStringToObject)(N[A])), A == "spin" && (B = (0, l.specStringToObject)(N[A])); + u.dataset.select && (z = (0, l.specStringToObject)(u.dataset.select)); + var O = [], R = [], N = [], W = {}, B = null, P = u.dataset, G = /style(.+)/, H = /surface(.*)/, U = /labelres(.*)/, j = []; + for (A in P) + Object.prototype.hasOwnProperty.call(P, A) && j.push(A); + for (j.sort(), b = 0; b < j.length; b++) { + A = j[b]; + var re = G.exec(A), ie, te, ue; + re && (ie = "select" + re[1], te = (0, l.specStringToObject)(P[ie]), ue = (0, l.specStringToObject)(P[A]), O.push([te, ue])), re = H.exec(A), re && (ie = "select" + re[1], te = (0, l.specStringToObject)(P[ie]), ue = (0, l.specStringToObject)(P[A]), R.push([te, ue])), re = U.exec(A), re && (ie = "select" + re[1], te = (0, l.specStringToObject)(P[ie]), ue = (0, l.specStringToObject)(P[A]), N.push([te, ue])), A == "zoomto" && (W = (0, l.specStringToObject)(P[A])), A == "spin" && (B = (0, l.specStringToObject)(P[A])); } - var he = function(ue) { - for (ue.setStyle(z, L), c && c.createSelectionAndStyle(z, L), b = 0; b < O.length; b++) { + var de = function(he) { + for (he.setStyle(z, L), o && o.createSelectionAndStyle(z, L), b = 0; b < O.length; b++) { let ne = O[b][0] || {}, _e = O[b][1] || { line: {} }; - ue.setStyle(ne, _e), c && c.createSelectionAndStyle(z, L); + he.setStyle(ne, _e), o && o.createSelectionAndStyle(z, L); } for (b = 0; b < R.length; b++) { let ne = R[b][0] || {}, _e = R[b][1] || {}; - c ? ue.addSurface(a.SurfaceType.VDW, _e, ne, ne).then((Re) => { - c.loadSurface("VDW", ne, _e, Re); - }) : ue.addSurface(a.SurfaceType.VDW, _e, ne, ne); + o ? he.addSurface(a.SurfaceType.VDW, _e, ne, ne).then((Be) => { + o.loadSurface("VDW", ne, _e, Be); + }) : he.addSurface(a.SurfaceType.VDW, _e, ne, ne); } - for (b = 0; b < P.length; b++) { - let ne = P[b][0] || {}, _e = P[b][1] || {}; - ue.addResLabels(ne, _e); + for (b = 0; b < N.length; b++) { + let ne = N[b][0] || {}, _e = N[b][1] || {}; + he.addResLabels(ne, _e); } - ue.render(), ue.zoomTo(U), B && ue.spin(B.axis, B.speed); + he.render(), he.zoomTo(W), B && he.spin(B.axis, B.speed); }; - let le = y; + let oe = y; try { - var J = (0, l.specStringToObject)(h.dataset.config) || {}; - J.backgroundColor === void 0 && (J.backgroundColor = $), J.backgroundAlpha === void 0 && (J.backgroundAlpha = k), le == null ? le = p[h.id || s++] = (0, r.createViewer)(h, J) : (le.setBackgroundColor($, k), le.setConfig(J), c && c.initiateUI()), h.dataset.ui && $3Dmol.StateManager && (c = new $3Dmol.StateManager(le)); - } catch (ue) { - console.log(ue), h.textContent = "WebGL appears to be disabled."; + var J = (0, l.specStringToObject)(u.dataset.config) || {}; + J.backgroundColor === void 0 && (J.backgroundColor = $), J.backgroundAlpha === void 0 && (J.backgroundAlpha = k), oe == null ? oe = _[u.id || s++] = (0, r.createViewer)(u, J) : (oe.setBackgroundColor($, k), oe.setConfig(J), o && o.initiateUI()), u.dataset.ui && $3Dmol.StateManager && (o = new $3Dmol.StateManager(oe)); + } catch (he) { + console.log(he), u.textContent = "WebGL appears to be disabled."; } - if (_.length != 0) { - let ue = 0, ne = /* @__PURE__ */ ((_e, Oe) => function(Re) { - x = _[ue]; - var Ue = _e.dataset.type || _e.dataset.datatype || g[ue]; - if (Oe.addModel(Re, Ue, E), c) { - var We = _e.dataset[g[ue]]; - c.setModelTitle(We); + if (p.length != 0) { + let he = 0, ne = /* @__PURE__ */ ((_e, Le) => function(Be) { + w = p[he]; + var Ue = _e.dataset.type || _e.dataset.datatype || g[he]; + if (Le.addModel(Be, Ue, E), o) { + var He = _e.dataset[g[he]]; + o.setModelTitle(He); } - ue += 1, ue < _.length ? (0, l.get)(_[ue]).then(ne) : (he(Oe), _e.dataset.callback && (0, l.makeFunction)(_e.dataset.callback)(Oe), u = !1, w && w(Oe)); - })(h, le); - f && f.endsWith("gz") ? (0, l.getbin)(_[0]).then(ne) : (0, l.get)(_[0]).then(ne); + he += 1, he < p.length ? (0, l.get)(p[he]).then(ne) : (de(Le), _e.dataset.callback && (0, l.makeFunction)(_e.dataset.callback)(Le), d = !1, x && x(Le)); + })(u, oe); + f && f.endsWith("gz") ? (0, l.getbin)(p[0]).then(ne) : (0, l.get)(p[0]).then(ne); } else { - if (h.dataset.element) { - var Me = "#" + h.dataset.element, se = document.querySelector(Me), Ce = se ? se.textContent : ""; - f = h.dataset.type || h.dataset.datatype, le.addModel(Ce, f, E); + if (u.dataset.element) { + var Ee = "#" + u.dataset.element, se = document.querySelector(Ee), Ae = se ? se.textContent : ""; + f = u.dataset.type || u.dataset.datatype, oe.addModel(Ae, f, E); } - he(le), h.dataset.callback && (0, l.makeFunction)(h.dataset.callback)(le), u = !1, w && w(le); + de(oe), u.dataset.callback && (0, l.makeFunction)(u.dataset.callback)(oe), d = !1, x && x(oe); } }); } @@ -31813,7 +31813,7 @@ ATOM`, x); /* harmony export */ elementColors: () => ( /* binding */ - u + d ), /* harmony export */ htmlColors: () => ( @@ -31823,12 +31823,12 @@ ATOM`, x); /* harmony export */ residues: () => ( /* binding */ - p + _ ), /* harmony export */ ssColors: () => ( /* binding */ - d + h ) /* harmony export */ }); @@ -31884,13 +31884,13 @@ ATOM`, x); let s = a.rgbRegEx.exec(f); if (s) { s[1] != "" && console.log("WARNING: Opacity value in rgba ignored. Specify separately as opacity attribute."); - let h = 0; - for (let _ = 2; _ < 5; _++) { - h *= 256; - let g = s[_].endsWith("%") ? 255 * parseFloat(s[_]) / 100 : parseFloat(s[_]); - h += Math.round(g); + let u = 0; + for (let p = 2; p < 5; p++) { + u *= 256; + let g = s[p].endsWith("%") ? 255 * parseFloat(s[p]) / 100 : parseFloat(s[p]); + u += Math.round(g); } - return h; + return u; } return ((A = window == null ? void 0 : window.$3Dmol) === null || A === void 0 ? void 0 : A.htmlColors[b.toLowerCase()]) || 0; } @@ -32047,11 +32047,11 @@ ATOM`, x); whitesmoke: 16119285, yellow: 16776960, yellowgreen: 10145074 - }, d = { + }, h = { //names are in helix-sheet-coil order pyMol: { h: 16711680, s: 16776960, c: 65280 }, Jmol: { h: 16711808, s: 16762880, c: 16777215 } - }, o = { + }, c = { H: 16777215, He: 16761035, HE: 16761035, @@ -32099,7 +32099,7 @@ ATOM`, x); BA: 16753920, Au: 14329120, AU: 14329120 - }, u = { + }, d = { defaultColor: 16716947, /** Jmol-like element colors*/ Jmol: { @@ -32309,17 +32309,17 @@ ATOM`, x); MT: 15400998 }, /** rasmol-like element colors */ - rasmol: o, - defaultColors: Object.assign({}, o), - greenCarbon: Object.assign(Object.assign({}, o), { C: 65280 }), - cyanCarbon: Object.assign(Object.assign({}, o), { C: 65535 }), - magentaCarbon: Object.assign(Object.assign({}, o), { C: 16711935 }), - yellowCarbon: Object.assign(Object.assign({}, o), { C: 16776960 }), - whiteCarbon: Object.assign(Object.assign({}, o), { C: 16777215 }), - orangeCarbon: Object.assign(Object.assign({}, o), { C: 16753920 }), - purpleCarbon: Object.assign(Object.assign({}, o), { C: 8388736 }), - blueCarbon: Object.assign(Object.assign({}, o), { C: 255 }) - }, p = { + rasmol: c, + defaultColors: Object.assign({}, c), + greenCarbon: Object.assign(Object.assign({}, c), { C: 65280 }), + cyanCarbon: Object.assign(Object.assign({}, c), { C: 65535 }), + magentaCarbon: Object.assign(Object.assign({}, c), { C: 16711935 }), + yellowCarbon: Object.assign(Object.assign({}, c), { C: 16776960 }), + whiteCarbon: Object.assign(Object.assign({}, c), { C: 16777215 }), + orangeCarbon: Object.assign(Object.assign({}, c), { C: 16753920 }), + purpleCarbon: Object.assign(Object.assign({}, c), { C: 8388736 }), + blueCarbon: Object.assign(Object.assign({}, c), { C: 255 }) + }, _ = { /** @property standard amino acid color scheme*/ amino: { ALA: 13158600, @@ -32440,24 +32440,24 @@ ATOM`, x); } }, y = { /** secondary structure pymol */ - ssPyMol: { prop: "ss", map: d.pyMol }, - ssJmol: { prop: "ss", map: d.Jmol }, - Jmol: { prop: "elem", map: u.Jmol }, - amino: { prop: "resn", map: p.amino }, - shapely: { prop: "resn", map: p.shapely }, - nucleic: { prop: "resn", map: p.nucleic }, + ssPyMol: { prop: "ss", map: h.pyMol }, + ssJmol: { prop: "ss", map: h.Jmol }, + Jmol: { prop: "elem", map: d.Jmol }, + amino: { prop: "resn", map: _.amino }, + shapely: { prop: "resn", map: _.shapely }, + nucleic: { prop: "resn", map: _.nucleic }, chain: { prop: "chain", map: m.atom }, - rasmol: { prop: "elem", map: u.rasmol }, - default: { prop: "elem", map: u.defaultColors }, - greenCarbon: { prop: "elem", map: u.greenCarbon }, + rasmol: { prop: "elem", map: d.rasmol }, + default: { prop: "elem", map: d.defaultColors }, + greenCarbon: { prop: "elem", map: d.greenCarbon }, chainHetatm: { prop: "chain", map: m.hetatm }, - cyanCarbon: { prop: "elem", map: u.cyanCarbon }, - magentaCarbon: { prop: "elem", map: u.magentaCarbon }, - purpleCarbon: { prop: "elem", map: u.purpleCarbon }, - whiteCarbon: { prop: "elem", map: u.whiteCarbon }, - orangeCarbon: { prop: "elem", map: u.orangeCarbon }, - yellowCarbon: { prop: "elem", map: u.yellowCarbon }, - blueCarbon: { prop: "elem", map: u.blueCarbon } + cyanCarbon: { prop: "elem", map: d.cyanCarbon }, + magentaCarbon: { prop: "elem", map: d.magentaCarbon }, + purpleCarbon: { prop: "elem", map: d.purpleCarbon }, + whiteCarbon: { prop: "elem", map: d.whiteCarbon }, + orangeCarbon: { prop: "elem", map: d.orangeCarbon }, + yellowCarbon: { prop: "elem", map: d.yellowCarbon }, + blueCarbon: { prop: "elem", map: d.blueCarbon } }; } ), @@ -32490,213 +32490,213 @@ ATOM`, x); ), l = t( /*! ./WebGL */ "./src/WebGL/index.ts" - ), d = t( + ), h = t( /*! ./Gradient */ "./src/Gradient.ts" - ), o = t( + ), c = t( /*! ./colors */ "./src/colors.ts" - ), u = t( + ), d = t( /*! ./GLDraw */ "./src/GLDraw.ts" - ), p = t( + ), _ = t( /*! ./utilities */ "./src/utilities.ts" ); function m(O, R) { - var P = [], U = O; - U = [], U.push(O[0]); - var B, N, G, H, W, V, re, ie, ee; - for (B = 1, N = O.length - 1; B < N; B++) - if (W = O[B], V = O[B + 1], W.smoothen) { - var ce = new r.Vector3((W.x + V.x) / 2, (W.y + V.y) / 2, (W.z + V.z) / 2); - ce.atom = W.atom, U.push(ce); + var N = [], W = O; + W = [], W.push(O[0]); + var B, P, G, H, U, j, re, ie, te; + for (B = 1, P = O.length - 1; B < P; B++) + if (U = O[B], j = O[B + 1], U.smoothen) { + var ue = new r.Vector3((U.x + j.x) / 2, (U.y + j.y) / 2, (U.z + j.z) / 2); + ue.atom = U.atom, W.push(ue); } else - U.push(W); - for (U.push(O[O.length - 1]), B = -1, G = U.length; B <= G - 3; B++) - if (H = U[B === -1 ? 0 : B], W = U[B + 1], V = U[B + 2], re = U[B === G - 3 ? G - 1 : B + 3], ie = new r.Vector3().subVectors(V, H).multiplyScalar(0.5), ee = new r.Vector3().subVectors(re, W).multiplyScalar(0.5), !V.skip) - for (var he = 0; he < R; he++) { - var le = 1 / R * he, J = W.x + le * ie.x + le * le * (-3 * W.x + 3 * V.x - 2 * ie.x - ee.x) + le * le * le * (2 * W.x - 2 * V.x + ie.x + ee.x), Me = W.y + le * ie.y + le * le * (-3 * W.y + 3 * V.y - 2 * ie.y - ee.y) + le * le * le * (2 * W.y - 2 * V.y + ie.y + ee.y), se = W.z + le * ie.z + le * le * (-3 * W.z + 3 * V.z - 2 * ie.z - ee.z) + le * le * le * (2 * W.z - 2 * V.z + ie.z + ee.z), Ce = new r.Vector3(J, Me, se); - he < R / 2 ? Ce.atom = W.atom : Ce.atom = V.atom, P.push(Ce); + W.push(U); + for (W.push(O[O.length - 1]), B = -1, G = W.length; B <= G - 3; B++) + if (H = W[B === -1 ? 0 : B], U = W[B + 1], j = W[B + 2], re = W[B === G - 3 ? G - 1 : B + 3], ie = new r.Vector3().subVectors(j, H).multiplyScalar(0.5), te = new r.Vector3().subVectors(re, U).multiplyScalar(0.5), !j.skip) + for (var de = 0; de < R; de++) { + var oe = 1 / R * de, J = U.x + oe * ie.x + oe * oe * (-3 * U.x + 3 * j.x - 2 * ie.x - te.x) + oe * oe * oe * (2 * U.x - 2 * j.x + ie.x + te.x), Ee = U.y + oe * ie.y + oe * oe * (-3 * U.y + 3 * j.y - 2 * ie.y - te.y) + oe * oe * oe * (2 * U.y - 2 * j.y + ie.y + te.y), se = U.z + oe * ie.z + oe * oe * (-3 * U.z + 3 * j.z - 2 * ie.z - te.z) + oe * oe * oe * (2 * U.z - 2 * j.z + ie.z + te.z), Ae = new r.Vector3(J, Ee, se); + de < R / 2 ? Ae.atom = U.atom : Ae.atom = j.atom, N.push(Ae); } - return P.push(U[U.length - 1]), P; - } - const y = 0.5, w = 1.3, b = 0.8, A = 0.4, f = 0.4; - function s(O, R, P, U) { - for (var B, N, G, H, W = 0, V = R.length; W < V; W++) { - H = Math.round(W * (U.length - 1) / V), G = o.CC.color(U[H]); - var re = O.updateGeoGroup(2), ie = re.vertexArray, ee = re.colorArray, ce = re.faceArray; - B = re.vertices, N = B * 3, ie[N] = R[W].x, ie[N + 1] = R[W].y, ie[N + 2] = R[W].z, ie[N + 3] = P[W].x, ie[N + 4] = P[W].y, ie[N + 5] = P[W].z; - for (var he = 0; he < 6; ++he) - ee[N + 3 * he] = G.r, ee[N + 1 + 3 * he] = G.g, ee[N + 2 + 3 * he] = G.b; - if (W > 0) { - var le = [B, B + 1, B - 1, B - 2], J = re.faceidx; - ce[J] = le[0], ce[J + 1] = le[1], ce[J + 2] = le[3], ce[J + 3] = le[1], ce[J + 4] = le[2], ce[J + 5] = le[3], re.faceidx += 6; + return N.push(W[W.length - 1]), N; + } + const y = 0.5, x = 1.3, b = 0.8, A = 0.4, f = 0.4; + function s(O, R, N, W) { + for (var B, P, G, H, U = 0, j = R.length; U < j; U++) { + H = Math.round(U * (W.length - 1) / j), G = c.CC.color(W[H]); + var re = O.updateGeoGroup(2), ie = re.vertexArray, te = re.colorArray, ue = re.faceArray; + B = re.vertices, P = B * 3, ie[P] = R[U].x, ie[P + 1] = R[U].y, ie[P + 2] = R[U].z, ie[P + 3] = N[U].x, ie[P + 4] = N[U].y, ie[P + 5] = N[U].z; + for (var de = 0; de < 6; ++de) + te[P + 3 * de] = G.r, te[P + 1 + 3 * de] = G.g, te[P + 2 + 3 * de] = G.b; + if (U > 0) { + var oe = [B, B + 1, B - 1, B - 2], J = re.faceidx; + ue[J] = oe[0], ue[J + 1] = oe[1], ue[J + 2] = oe[3], ue[J + 3] = oe[1], ue[J + 4] = oe[2], ue[J + 5] = oe[3], re.faceidx += 6; } re.vertices += 2; } } - function h(O, R, P, U, B, N, G) { - var H, W, V, re; - if (V = R.length, V < 2 || R[0].length < 2) + function u(O, R, N, W, B, P, G) { + var H, U, j, re; + if (j = R.length, j < 2 || R[0].length < 2) return; - for (H = 0; H < V; H++) - R[H] = m(R[H], U); + for (H = 0; H < j; H++) + R[H] = m(R[H], W); if (re = R[0].length, !B) - return s(O, R[0], R[V - 1], P); - var ie, ee, ce, he, le, J, Me = [], se = [], Ce = []; - for (W = 0; W < V; W++) - Me.push(0.25 + 1.5 * Math.sqrt((V - 1) * W - Math.pow(W, 2)) / (V - 1)), se.push(0.5), Ce.push(2 * (Math.pow(W / V, 2) - W / V) + 0.6); - var ue = []; - for (W = 0; W < V * 2 - 1; W++) - ue[W] = [W, W + 1, W + 1 - 2 * V, W - 2 * V]; - ue[V * 2 - 1] = [ - W, - W + 1 - 2 * V, - W + 1 - 4 * V, - W - 2 * V + return s(O, R[0], R[j - 1], N); + var ie, te, ue, de, oe, J, Ee = [], se = [], Ae = []; + for (U = 0; U < j; U++) + Ee.push(0.25 + 1.5 * Math.sqrt((j - 1) * U - Math.pow(U, 2)) / (j - 1)), se.push(0.5), Ae.push(2 * (Math.pow(U / j, 2) - U / j) + 0.6); + var he = []; + for (U = 0; U < j * 2 - 1; U++) + he[U] = [U, U + 1, U + 1 - 2 * j, U - 2 * j]; + he[j * 2 - 1] = [ + U, + U + 1 - 2 * j, + U + 1 - 4 * j, + U - 2 * j ]; - var ne, _e, Oe, Re, Ue, We, Ee, Ae, ge, Le; + var ne, _e, Le, Be, Ue, He, We, Ge, Ne, Pe; let Te = O.updateGeoGroup(); for (H = 0; H < re; H++) { - let q = O.groups, te = !1; - Te = O.updateGeoGroup(2 * V), q != O.groups && H > 0 && (H = H - 1, te = !0), We = Math.round(H * (P.length - 1) / re), Ue = o.CC.color(P[We]), le = ce, J = he, ce = [], he = [], ie = [], R[0][H].atom !== void 0 && (Re = R[0][H].atom, G === "oval" ? ee = Me : G === "rectangle" ? ee = se : G === "parabola" && (ee = Ce)), ee || (ee = se); - var Ke, je; - for (W = 0; W < V; W++) - H < re - 1 ? Ke = R[W][H + 1].clone().sub(R[W][H]) : Ke = R[W][H - 1].clone().sub(R[W][H]).negate(), W < V - 1 ? je = R[W + 1][H].clone().sub(R[W][H]) : je = R[W - 1][H].clone().sub(R[W][H]).negate(), ie[W] = je.cross(Ke).normalize().multiplyScalar(B * ee[W]); - for (W = 0; W < V; W++) - ce[W] = R[W][H].clone().add(ie[W].clone().negate()); - for (W = 0; W < V; W++) - he[W] = R[W][H].clone().add(ie[W]); - for (Ee = Te.vertexArray, Ae = Te.colorArray, ge = Te.faceArray, ne = Te.vertices, _e = ne * 3, W = 0; W < V; W++) - Ee[_e + 3 * W + 0] = ce[W].x, Ee[_e + 3 * W + 1] = ce[W].y, Ee[_e + 3 * W + 2] = ce[W].z; - for (W = 0; W < V; W++) - Ee[_e + 3 * W + 0 + 3 * V] = he[V - 1 - W].x, Ee[_e + 3 * W + 1 + 3 * V] = he[V - 1 - W].y, Ee[_e + 3 * W + 2 + 3 * V] = he[V - 1 - W].z; - for (W = 0; W < 2 * V; ++W) - Ae[_e + 3 * W + 0] = Ue.r, Ae[_e + 3 * W + 1] = Ue.g, Ae[_e + 3 * W + 2] = Ue.b; - if (H > 0 && !te) { - for (W = 0; W < V * 2; W++) - Le = [ - ne + ue[W][0], - ne + ue[W][1], - ne + ue[W][2], - ne + ue[W][3] - ], Oe = Te.faceidx, ge[Oe] = Le[0], ge[Oe + 1] = Le[1], ge[Oe + 2] = Le[3], ge[Oe + 3] = Le[1], ge[Oe + 4] = Le[2], ge[Oe + 5] = Le[3], Te.faceidx += 6; - if (Re.clickable || Re.hoverable) { - var Y = []; - Y.push(new a.Triangle(le[0], ce[0], ce[V - 1])), Y.push(new a.Triangle(le[0], ce[V - 1], le[V - 1])), Y.push(new a.Triangle(le[V - 1], ce[V - 1], he[V - 1])), Y.push(new a.Triangle(le[V - 1], he[V - 1], J[V - 1])), Y.push(new a.Triangle(he[0], J[0], J[V - 1])), Y.push(new a.Triangle(he[V - 1], he[0], J[V - 1])), Y.push(new a.Triangle(ce[0], le[0], J[0])), Y.push(new a.Triangle(he[0], ce[0], J[0])); - for (W in Y) - Re.intersectionShape.triangle.push(Y[W]); + let Z = O.groups, ee = !1; + Te = O.updateGeoGroup(2 * j), Z != O.groups && H > 0 && (H = H - 1, ee = !0), He = Math.round(H * (N.length - 1) / re), Ue = c.CC.color(N[He]), oe = ue, J = de, ue = [], de = [], ie = [], R[0][H].atom !== void 0 && (Be = R[0][H].atom, G === "oval" ? te = Ee : G === "rectangle" ? te = se : G === "parabola" && (te = Ae)), te || (te = se); + var Me, De; + for (U = 0; U < j; U++) + H < re - 1 ? Me = R[U][H + 1].clone().sub(R[U][H]) : Me = R[U][H - 1].clone().sub(R[U][H]).negate(), U < j - 1 ? De = R[U + 1][H].clone().sub(R[U][H]) : De = R[U - 1][H].clone().sub(R[U][H]).negate(), ie[U] = De.cross(Me).normalize().multiplyScalar(B * te[U]); + for (U = 0; U < j; U++) + ue[U] = R[U][H].clone().add(ie[U].clone().negate()); + for (U = 0; U < j; U++) + de[U] = R[U][H].clone().add(ie[U]); + for (We = Te.vertexArray, Ge = Te.colorArray, Ne = Te.faceArray, ne = Te.vertices, _e = ne * 3, U = 0; U < j; U++) + We[_e + 3 * U + 0] = ue[U].x, We[_e + 3 * U + 1] = ue[U].y, We[_e + 3 * U + 2] = ue[U].z; + for (U = 0; U < j; U++) + We[_e + 3 * U + 0 + 3 * j] = de[j - 1 - U].x, We[_e + 3 * U + 1 + 3 * j] = de[j - 1 - U].y, We[_e + 3 * U + 2 + 3 * j] = de[j - 1 - U].z; + for (U = 0; U < 2 * j; ++U) + Ge[_e + 3 * U + 0] = Ue.r, Ge[_e + 3 * U + 1] = Ue.g, Ge[_e + 3 * U + 2] = Ue.b; + if (H > 0 && !ee) { + for (U = 0; U < j * 2; U++) + Pe = [ + ne + he[U][0], + ne + he[U][1], + ne + he[U][2], + ne + he[U][3] + ], Le = Te.faceidx, Ne[Le] = Pe[0], Ne[Le + 1] = Pe[1], Ne[Le + 2] = Pe[3], Ne[Le + 3] = Pe[1], Ne[Le + 4] = Pe[2], Ne[Le + 5] = Pe[3], Te.faceidx += 6; + if (Be.clickable || Be.hoverable) { + var V = []; + V.push(new a.Triangle(oe[0], ue[0], ue[j - 1])), V.push(new a.Triangle(oe[0], ue[j - 1], oe[j - 1])), V.push(new a.Triangle(oe[j - 1], ue[j - 1], de[j - 1])), V.push(new a.Triangle(oe[j - 1], de[j - 1], J[j - 1])), V.push(new a.Triangle(de[0], J[0], J[j - 1])), V.push(new a.Triangle(de[j - 1], de[0], J[j - 1])), V.push(new a.Triangle(ue[0], oe[0], J[0])), V.push(new a.Triangle(de[0], ue[0], J[0])); + for (U in V) + Be.intersectionShape.triangle.push(V[U]); } } - Te.vertices += 2 * V; + Te.vertices += 2 * j; } - for (Ee = Te.vertexArray, Ae = Te.colorArray, ge = Te.faceArray, ne = Te.vertices, _e = ne * 3, Oe = Te.faceidx, H = 0; H < V - 1; H++) - Le = [H, H + 1, 2 * V - 2 - H, 2 * V - 1 - H], Oe = Te.faceidx, ge[Oe] = Le[0], ge[Oe + 1] = Le[1], ge[Oe + 2] = Le[3], ge[Oe + 3] = Le[1], ge[Oe + 4] = Le[2], ge[Oe + 5] = Le[3], Te.faceidx += 6; - for (H = 0; H < V - 1; H++) - Le = [ + for (We = Te.vertexArray, Ge = Te.colorArray, Ne = Te.faceArray, ne = Te.vertices, _e = ne * 3, Le = Te.faceidx, H = 0; H < j - 1; H++) + Pe = [H, H + 1, 2 * j - 2 - H, 2 * j - 1 - H], Le = Te.faceidx, Ne[Le] = Pe[0], Ne[Le + 1] = Pe[1], Ne[Le + 2] = Pe[3], Ne[Le + 3] = Pe[1], Ne[Le + 4] = Pe[2], Ne[Le + 5] = Pe[3], Te.faceidx += 6; + for (H = 0; H < j - 1; H++) + Pe = [ ne - 1 - H, ne - 2 - H, - ne - 2 * V + H + 1, - ne - 2 * V + H - ], Oe = Te.faceidx, ge[Oe] = Le[0], ge[Oe + 1] = Le[1], ge[Oe + 2] = Le[3], ge[Oe + 3] = Le[1], ge[Oe + 4] = Le[2], ge[Oe + 5] = Le[3], Te.faceidx += 6; + ne - 2 * j + H + 1, + ne - 2 * j + H + ], Le = Te.faceidx, Ne[Le] = Pe[0], Ne[Le + 1] = Pe[1], Ne[Le + 2] = Pe[3], Ne[Le + 3] = Pe[1], Ne[Le + 4] = Pe[2], Ne[Le + 5] = Pe[3], Te.faceidx += 6; } - function _(O, R, P, U, B, N) { + function p(O, R, N, W, B, P) { if (!(R.length < 2)) { var G, H; - if (G = R[0], H = R[R.length - 1], G = m(G, U), H = m(H, U), !B) - return s(O, G, H, P); - var W = [], V, re, ie, ee, ce, he = [ + if (G = R[0], H = R[R.length - 1], G = m(G, W), H = m(H, W), !B) + return s(O, G, H, N); + var U = [], j, re, ie, te, ue, de = [ [0, 2, -6, -8], [-4, -2, 6, 4], [7, -1, -5, 3], [-3, 5, 1, -7] - ], le, J, Me, se, Ce, ue, ne, _e, Oe, Re, Ue, We, Ee, Ae, ge, Le, Te; - for (_e = 0, Oe = G.length; _e < Oe; _e++) { - if (Ce = Math.round(_e * (P.length - 1) / Oe), se = o.CC.color(P[Ce]), W.push(re = G[_e]), W.push(re), W.push(ie = H[_e]), W.push(ie), _e < Oe - 1) { - var Ke = G[_e + 1].clone().sub(G[_e]), je = H[_e].clone().sub(G[_e]); - V = je.cross(Ke).normalize().multiplyScalar(B); + ], oe, J, Ee, se, Ae, he, ne, _e, Le, Be, Ue, He, We, Ge, Ne, Pe, Te; + for (_e = 0, Le = G.length; _e < Le; _e++) { + if (Ae = Math.round(_e * (N.length - 1) / Le), se = c.CC.color(N[Ae]), U.push(re = G[_e]), U.push(re), U.push(ie = H[_e]), U.push(ie), _e < Le - 1) { + var Me = G[_e + 1].clone().sub(G[_e]), De = H[_e].clone().sub(G[_e]); + j = De.cross(Me).normalize().multiplyScalar(B); } - for (W.push(ee = G[_e].clone().add(V)), W.push(ee), W.push(ce = H[_e].clone().add(V)), W.push(ce), re.atom !== void 0 && (ue = re.atom), Ae = O.updateGeoGroup(8), ge = Ae.vertexArray, Le = Ae.colorArray, Te = Ae.faceArray, le = Ae.vertices, J = le * 3, ge[J] = re.x, ge[J + 1] = re.y, ge[J + 2] = re.z, ge[J + 3] = re.x, ge[J + 4] = re.y, ge[J + 5] = re.z, ge[J + 6] = ie.x, ge[J + 7] = ie.y, ge[J + 8] = ie.z, ge[J + 9] = ie.x, ge[J + 10] = ie.y, ge[J + 11] = ie.z, ge[J + 12] = ee.x, ge[J + 13] = ee.y, ge[J + 14] = ee.z, ge[J + 15] = ee.x, ge[J + 16] = ee.y, ge[J + 17] = ee.z, ge[J + 18] = ce.x, ge[J + 19] = ce.y, ge[J + 20] = ce.z, ge[J + 21] = ce.x, ge[J + 22] = ce.y, ge[J + 23] = ce.z, Re = 0; Re < 8; ++Re) - Le[J + 3 * Re] = se.r, Le[J + 1 + 3 * Re] = se.g, Le[J + 2 + 3 * Re] = se.b; + for (U.push(te = G[_e].clone().add(j)), U.push(te), U.push(ue = H[_e].clone().add(j)), U.push(ue), re.atom !== void 0 && (he = re.atom), Ge = O.updateGeoGroup(8), Ne = Ge.vertexArray, Pe = Ge.colorArray, Te = Ge.faceArray, oe = Ge.vertices, J = oe * 3, Ne[J] = re.x, Ne[J + 1] = re.y, Ne[J + 2] = re.z, Ne[J + 3] = re.x, Ne[J + 4] = re.y, Ne[J + 5] = re.z, Ne[J + 6] = ie.x, Ne[J + 7] = ie.y, Ne[J + 8] = ie.z, Ne[J + 9] = ie.x, Ne[J + 10] = ie.y, Ne[J + 11] = ie.z, Ne[J + 12] = te.x, Ne[J + 13] = te.y, Ne[J + 14] = te.z, Ne[J + 15] = te.x, Ne[J + 16] = te.y, Ne[J + 17] = te.z, Ne[J + 18] = ue.x, Ne[J + 19] = ue.y, Ne[J + 20] = ue.z, Ne[J + 21] = ue.x, Ne[J + 22] = ue.y, Ne[J + 23] = ue.z, Be = 0; Be < 8; ++Be) + Pe[J + 3 * Be] = se.r, Pe[J + 1 + 3 * Be] = se.g, Pe[J + 2 + 3 * Be] = se.b; if (_e > 0) { - var Y = ne !== void 0 && ue !== void 0 && ne.serial !== ue.serial; - for (Re = 0; Re < 4; Re++) { - var q = [ - le + he[Re][0], - le + he[Re][1], - le + he[Re][2], - le + he[Re][3] + var V = ne !== void 0 && he !== void 0 && ne.serial !== he.serial; + for (Be = 0; Be < 4; Be++) { + var Z = [ + oe + de[Be][0], + oe + de[Be][1], + oe + de[Be][2], + oe + de[Be][3] ]; - if (Me = Ae.faceidx, Te[Me] = q[0], Te[Me + 1] = q[1], Te[Me + 2] = q[3], Te[Me + 3] = q[1], Te[Me + 4] = q[2], Te[Me + 5] = q[3], Ae.faceidx += 6, ue.clickable || ne.clickable || ue.hoverable || ne.hoverable) { - var te = W[q[3]].clone(), we = W[q[0]].clone(), me = W[q[2]].clone(), Pe = W[q[1]].clone(); - if (te.atom = W[q[3]].atom || null, me.atom = W[q[2]].atom || null, we.atom = W[q[0]].atom || null, Pe.atom = W[q[1]].atom || null, Y) { - var Fe = te.clone().add(we).multiplyScalar(0.5), K = me.clone().add(Pe).multiplyScalar(0.5), fe = te.clone().add(Pe).multiplyScalar(0.5); - Re % 2 === 0 ? ((ne.clickable || ne.hoverable) && (Ue = new a.Triangle(Fe, fe, te), We = new a.Triangle(K, me, fe), Ee = new a.Triangle(fe, me, te), ne.intersectionShape.triangle.push(Ue), ne.intersectionShape.triangle.push(We), ne.intersectionShape.triangle.push(Ee)), (ue.clickable || ue.hoverable) && (Ue = new a.Triangle(we, Pe, fe), We = new a.Triangle(Pe, K, fe), Ee = new a.Triangle(we, fe, Fe), ue.intersectionShape.triangle.push(Ue), ue.intersectionShape.triangle.push(We), ue.intersectionShape.triangle.push(Ee))) : ((ue.clickable || ue.hoverable) && (Ue = new a.Triangle(Fe, fe, te), We = new a.Triangle(K, me, fe), Ee = new a.Triangle(fe, me, te), ue.intersectionShape.triangle.push(Ue), ue.intersectionShape.triangle.push(We), ue.intersectionShape.triangle.push(Ee)), (ne.clickable || ne.hoverable) && (Ue = new a.Triangle(we, Pe, fe), We = new a.Triangle(Pe, K, fe), Ee = new a.Triangle(we, fe, Fe), ne.intersectionShape.triangle.push(Ue), ne.intersectionShape.triangle.push(We), ne.intersectionShape.triangle.push(Ee))); - } else (ue.clickable || ue.hoverable) && (Ue = new a.Triangle(we, Pe, te), We = new a.Triangle(Pe, me, te), ue.intersectionShape.triangle.push(Ue), ue.intersectionShape.triangle.push(We)); + if (Ee = Ge.faceidx, Te[Ee] = Z[0], Te[Ee + 1] = Z[1], Te[Ee + 2] = Z[3], Te[Ee + 3] = Z[1], Te[Ee + 4] = Z[2], Te[Ee + 5] = Z[3], Ge.faceidx += 6, he.clickable || ne.clickable || he.hoverable || ne.hoverable) { + var ee = U[Z[3]].clone(), ye = U[Z[0]].clone(), ce = U[Z[2]].clone(), Ie = U[Z[1]].clone(); + if (ee.atom = U[Z[3]].atom || null, ce.atom = U[Z[2]].atom || null, ye.atom = U[Z[0]].atom || null, Ie.atom = U[Z[1]].atom || null, V) { + var ke = ee.clone().add(ye).multiplyScalar(0.5), Y = ce.clone().add(Ie).multiplyScalar(0.5), me = ee.clone().add(Ie).multiplyScalar(0.5); + Be % 2 === 0 ? ((ne.clickable || ne.hoverable) && (Ue = new a.Triangle(ke, me, ee), He = new a.Triangle(Y, ce, me), We = new a.Triangle(me, ce, ee), ne.intersectionShape.triangle.push(Ue), ne.intersectionShape.triangle.push(He), ne.intersectionShape.triangle.push(We)), (he.clickable || he.hoverable) && (Ue = new a.Triangle(ye, Ie, me), He = new a.Triangle(Ie, Y, me), We = new a.Triangle(ye, me, ke), he.intersectionShape.triangle.push(Ue), he.intersectionShape.triangle.push(He), he.intersectionShape.triangle.push(We))) : ((he.clickable || he.hoverable) && (Ue = new a.Triangle(ke, me, ee), He = new a.Triangle(Y, ce, me), We = new a.Triangle(me, ce, ee), he.intersectionShape.triangle.push(Ue), he.intersectionShape.triangle.push(He), he.intersectionShape.triangle.push(We)), (ne.clickable || ne.hoverable) && (Ue = new a.Triangle(ye, Ie, me), He = new a.Triangle(Ie, Y, me), We = new a.Triangle(ye, me, ke), ne.intersectionShape.triangle.push(Ue), ne.intersectionShape.triangle.push(He), ne.intersectionShape.triangle.push(We))); + } else (he.clickable || he.hoverable) && (Ue = new a.Triangle(ye, Ie, ee), He = new a.Triangle(Ie, ce, ee), he.intersectionShape.triangle.push(Ue), he.intersectionShape.triangle.push(He)); } } } - Ae.vertices += 8, ne = ue; + Ge.vertices += 8, ne = he; } - var Se = W.length - 8; - for (Ae = O.updateGeoGroup(8), ge = Ae.vertexArray, Le = Ae.colorArray, Te = Ae.faceArray, le = Ae.vertices, J = le * 3, Me = Ae.faceidx, _e = 0; _e < 4; _e++) { - W.push(W[_e * 2]), W.push(W[Se + _e * 2]); - var Ne = W[_e * 2], pe = W[Se + _e * 2]; - ge[J + 6 * _e] = Ne.x, ge[J + 1 + 6 * _e] = Ne.y, ge[J + 2 + 6 * _e] = Ne.z, ge[J + 3 + 6 * _e] = pe.x, ge[J + 4 + 6 * _e] = pe.y, ge[J + 5 + 6 * _e] = pe.z, Le[J + 6 * _e] = se.r, Le[J + 1 + 6 * _e] = se.g, Le[J + 2 + 6 * _e] = se.b, Le[J + 3 + 6 * _e] = se.r, Le[J + 4 + 6 * _e] = se.g, Le[J + 5 + 6 * _e] = se.b; + var we = U.length - 8; + for (Ge = O.updateGeoGroup(8), Ne = Ge.vertexArray, Pe = Ge.colorArray, Te = Ge.faceArray, oe = Ge.vertices, J = oe * 3, Ee = Ge.faceidx, _e = 0; _e < 4; _e++) { + U.push(U[_e * 2]), U.push(U[we + _e * 2]); + var Re = U[_e * 2], pe = U[we + _e * 2]; + Ne[J + 6 * _e] = Re.x, Ne[J + 1 + 6 * _e] = Re.y, Ne[J + 2 + 6 * _e] = Re.z, Ne[J + 3 + 6 * _e] = pe.x, Ne[J + 4 + 6 * _e] = pe.y, Ne[J + 5 + 6 * _e] = pe.z, Pe[J + 6 * _e] = se.r, Pe[J + 1 + 6 * _e] = se.g, Pe[J + 2 + 6 * _e] = se.b, Pe[J + 3 + 6 * _e] = se.r, Pe[J + 4 + 6 * _e] = se.g, Pe[J + 5 + 6 * _e] = se.b; } - Se += 8, Ue = [le, le + 2, le + 6, le + 4], We = [le + 1, le + 5, le + 7, le + 3], Te[Me] = Ue[0], Te[Me + 1] = Ue[1], Te[Me + 2] = Ue[3], Te[Me + 3] = Ue[1], Te[Me + 4] = Ue[2], Te[Me + 5] = Ue[3], Te[Me + 6] = We[0], Te[Me + 7] = We[1], Te[Me + 8] = We[3], Te[Me + 9] = We[1], Te[Me + 10] = We[2], Te[Me + 11] = We[3], Ae.faceidx += 12, Ae.vertices += 8; + we += 8, Ue = [oe, oe + 2, oe + 6, oe + 4], He = [oe + 1, oe + 5, oe + 7, oe + 3], Te[Ee] = Ue[0], Te[Ee + 1] = Ue[1], Te[Ee + 2] = Ue[3], Te[Ee + 3] = Ue[1], Te[Ee + 4] = Ue[2], Te[Ee + 5] = Ue[3], Te[Ee + 6] = He[0], Te[Ee + 7] = He[1], Te[Ee + 8] = He[3], Te[Ee + 9] = He[1], Te[Ee + 10] = He[2], Te[Ee + 11] = He[3], Ge.faceidx += 12, Ge.vertices += 8; } } - function g(O, R, P, U, B, N, G) { - (!G || G === "default") && (G = "rectangle"), G === "edged" ? _(O, R, P, U, B) : (G === "rectangle" || G === "oval" || G === "parabola") && h(O, R, P, U, B, N, G); + function g(O, R, N, W, B, P, G) { + (!G || G === "default") && (G = "rectangle"), G === "edged" ? p(O, R, N, W, B) : (G === "rectangle" || G === "oval" || G === "parabola") && u(O, R, N, W, B, P, G); } - function x(O) { + function w(O) { return O && O.elem === "C" && O.atom === "CA"; } - function c(O, R) { + function o(O, R) { if (O && R && O.chain === R.chain) { if (!O.hetflag && !R.hetflag && O.reschain === R.reschain && (O.resi === R.resi || O.resi === R.resi - 1)) return !0; if (O.resi < R.resi) { - var P = O.x - R.x, U = O.y - R.y, B = O.z - R.z, N = P * P + U * U + B * B; - if (O.atom == "CA" && R.atom == "CA" && N < 16) + var N = O.x - R.x, W = O.y - R.y, B = O.z - R.z, P = N * N + W * W + B * B; + if (O.atom == "CA" && R.atom == "CA" && P < 16) return !0; - if ((O.atom == "P" || R.atom == "P") && N < 64) + if ((O.atom == "P" || R.atom == "P") && P < 64) return !0; } } return !1; } - function v(O, R, P, U, B) { + function v(O, R, N, W, B) { if (!(R == null || R.vertices == 0)) { B && (R.initTypedArrays(), R.setUpNormals()); - var N = new l.MeshDoubleLambertMaterial(); - N.vertexColors = l.Coloring.FaceColors, typeof P == "number" && P >= 0 && P < 1 && (N.transparent = !0, N.opacity = P), N.outline = U; - var G = new l.Mesh(R, N); + var P = new l.MeshDoubleLambertMaterial(); + P.vertexColors = l.Coloring.FaceColors, typeof N == "number" && N >= 0 && N < 1 && (P.transparent = !0, P.opacity = N), P.outline = W; + var G = new l.Mesh(R, P); O.add(G); } } - function M(O, R, P, U, B, N, G, H, W) { - var V, re, ie, ee, ce, he; - if (!(!U || !B || !G)) { - var le = B.sub(U); - le.normalize(); - var J = H[W]; - for (re = W + 1; re < H.length && (J = H[re], J.atom != G.atom); re++) + function M(O, R, N, W, B, P, G, H, U) { + var j, re, ie, te, ue, de; + if (!(!W || !B || !G)) { + var oe = B.sub(W); + oe.normalize(); + var J = H[U]; + for (re = U + 1; re < H.length && (J = H[re], J.atom != G.atom); re++) ; - if (J = J ? new r.Vector3(J.x, J.y, J.z) : new r.Vector3(0, 0, 0), J.sub(U), G.ss === "arrow start") { - var Me = J.clone().multiplyScalar(0.3).cross(B); - U.add(Me); - var se = J.clone().cross(le).normalize(); - le.rotateAboutVector(se, 0.43); + if (J = J ? new r.Vector3(J.x, J.y, J.z) : new r.Vector3(0, 0, 0), J.sub(W), G.ss === "arrow start") { + var Ee = J.clone().multiplyScalar(0.3).cross(B); + W.add(Ee); + var se = J.clone().cross(oe).normalize(); + oe.rotateAboutVector(se, 0.43); } - for (G.style.cartoon.ribbon ? V = G.style.cartoon.thickness || A : G.style.cartoon.width ? V = G.style.cartoon.width : G.ss === "c" ? G.atom === "P" ? V = b : V = y : G.ss === "arrow start" ? (V = w, ce = !0) : G.ss === "arrow end" || G.ss === "h" && G.style.cartoon.tubes || G.ss === "tube start" ? V = y : V = w, N != null && le.dot(N) < 0 && le.negate(), le.multiplyScalar(V), re = 0; re < R; re++) - ie = -1 + re * 2 / (R - 1), ee = new r.Vector3(U.x + ie * le.x, U.y + ie * le.y, U.z + ie * le.z), ee.atom = G, G.ss === "s" && (ee.smoothen = !0), O[re].push(ee); - if (ce) - for (le.multiplyScalar(2), re = 0; re < R; re++) - ie = -1 + re * 2 / (R - 1), ee = new r.Vector3(U.x + ie * le.x, U.y + ie * le.y, U.z + ie * le.z), ee.atom = G, ee.smoothen = !1, ee.skip = !0, O[re].push(ee); - return he = G.style.cartoon.style || "default", O.style ? O.style != he && (console.log("Warning: a cartoon chain's strand-style is ambiguous"), O.style = "default") : O.style = he, (G.ss === "arrow start" || G.ss === "arrow end") && (G.ss = "s"), ce; + for (G.style.cartoon.ribbon ? j = G.style.cartoon.thickness || A : G.style.cartoon.width ? j = G.style.cartoon.width : G.ss === "c" ? G.atom === "P" ? j = b : j = y : G.ss === "arrow start" ? (j = x, ue = !0) : G.ss === "arrow end" || G.ss === "h" && G.style.cartoon.tubes || G.ss === "tube start" ? j = y : j = x, P != null && oe.dot(P) < 0 && oe.negate(), oe.multiplyScalar(j), re = 0; re < R; re++) + ie = -1 + re * 2 / (R - 1), te = new r.Vector3(W.x + ie * oe.x, W.y + ie * oe.y, W.z + ie * oe.z), te.atom = G, G.ss === "s" && (te.smoothen = !0), O[re].push(te); + if (ue) + for (oe.multiplyScalar(2), re = 0; re < R; re++) + ie = -1 + re * 2 / (R - 1), te = new r.Vector3(W.x + ie * oe.x, W.y + ie * oe.y, W.z + ie * oe.z), te.atom = G, te.smoothen = !1, te.skip = !0, O[re].push(te); + return de = G.style.cartoon.style || "default", O.style ? O.style != de && (console.log("Warning: a cartoon chain's strand-style is ambiguous"), O.style = "default") : O.style = de, (G.ss === "arrow start" || G.ss === "arrow end") && (G.ss = "s"), ue; } } const E = { @@ -32717,97 +32717,97 @@ ATOM`, x); N1: !0, N3: !0 }, $ = { DA: !0, DG: !0, A: !0, G: !0 }, k = { DT: !0, DC: !0, U: !0, C: !0, T: !0 }, L = { DA: !0, DG: !0, A: !0, G: !0, DT: !0, DC: !0, U: !0, C: !0, T: !0 }; - function z(O, R, P, U = 10) { - let B = U, N = U; - var G, H, W, V, re, ie, ee, ce, he, le, J, Me, se, Ce, ue, ne, _e, Oe, Re = new l.Geometry(!0), Ue = new l.Geometry(!0), We = [], Ee = [], Ae = 1, ge = !1, Le = {}; - for (var Te in d.Gradient.builtinGradients) - d.Gradient.builtinGradients.hasOwnProperty(Te) && (Le[Te] = new d.Gradient.builtinGradients[Te](P[1], P[0])); - var Ke = function(X, Be) { - return P && Be.color === "spectrum" ? Be.colorscheme in Le ? Le[Be.colorscheme].valueToHex(X.resi) : Le.sinebow.valueToHex(X.resi) : (0, p.getColorFromStyle)(X, Be).getHex(); + function z(O, R, N, W = 10) { + let B = W, P = W; + var G, H, U, j, re, ie, te, ue, de, oe, J, Ee, se, Ae, he, ne, _e, Le, Be = new l.Geometry(!0), Ue = new l.Geometry(!0), He = [], We = [], Ge = 1, Ne = !1, Pe = {}; + for (var Te in h.Gradient.builtinGradients) + h.Gradient.builtinGradients.hasOwnProperty(Te) && (Pe[Te] = new h.Gradient.builtinGradients[Te](N[1], N[0])); + var Me = function(X, ze) { + return N && ze.color === "spectrum" ? ze.colorscheme in Pe ? Pe[ze.colorscheme].valueToHex(X.resi) : Pe.sinebow.valueToHex(X.resi) : (0, _.getColorFromStyle)(X, ze).getHex(); }; - for (ce = 0; ce < B; ce++) - Ee[ce] = []; - var je = !1, Y = !1, q = []; - for (ce in R) { - if (V = R[ce], V.elem === "C" && V.atom === "CA") { - var te = c(W, V); - te && V.ss === "s" ? je = !0 : je && (W && H && W.style.cartoon.arrows && H.style.cartoon.arrows && (W.ss = "arrow end", H.ss = "arrow start"), je = !1), te && (W.ss === "h" || W.ss == "tube start") && W.style.cartoon.tubes ? !Y && W.ss != "tube start" && V.style.cartoon.tubes && (V.ss = "tube start", Y = !0) : Y && (W.ss === "tube start" ? W.ss = "tube end" : H && H.style.cartoon.tubes && (H.ss = "tube end"), Y = !1), H = W, W = V; - } - V && V.atom in E && q.push(V); - } - Y && W.style.cartoon.tubes && (W.ss = "tube end", Y = !1); - var we = function(X) { - Ee[0].length > 0 && g(Ue, Ee, We, N, ee, Ae, Ee.style); - var Be = [], Ge = null; + for (ue = 0; ue < B; ue++) + We[ue] = []; + var De = !1, V = !1, Z = []; + for (ue in R) { + if (j = R[ue], j.elem === "C" && j.atom === "CA") { + var ee = o(U, j); + ee && j.ss === "s" ? De = !0 : De && (U && H && U.style.cartoon.arrows && H.style.cartoon.arrows && (U.ss = "arrow end", H.ss = "arrow start"), De = !1), ee && (U.ss === "h" || U.ss == "tube start") && U.style.cartoon.tubes ? !V && U.ss != "tube start" && j.style.cartoon.tubes && (j.ss = "tube start", V = !0) : V && (U.ss === "tube start" ? U.ss = "tube end" : H && H.style.cartoon.tubes && (H.ss = "tube end"), V = !1), H = U, U = j; + } + j && j.atom in E && Z.push(j); + } + V && U.style.cartoon.tubes && (U.ss = "tube end", V = !1); + var ye = function(X) { + We[0].length > 0 && g(Ue, We, He, P, te, Ge, We.style); + var ze = [], Ve = null; if (X) { - for (ce = 0; ce < B; ce++) - Be[ce] = Ee[ce][Ee[ce].length - 1]; - Ge = We[We.length - 1]; - } - for (Ee = [], ce = 0; ce < B; ce++) - Ee[ce] = []; - if (We = [], X) { - for (ce = 0; ce < B; ce++) - Ee[ce].push(Be[ce]); - We.push(Ge); - } - v(O, Ue, Ae, ge, !0), v(O, Re, Ae, ge, !1), Ue = new l.Geometry(!0), Re = new l.Geometry(!0); + for (ue = 0; ue < B; ue++) + ze[ue] = We[ue][We[ue].length - 1]; + Ve = He[He.length - 1]; + } + for (We = [], ue = 0; ue < B; ue++) + We[ue] = []; + if (He = [], X) { + for (ue = 0; ue < B; ue++) + We[ue].push(ze[ue]); + He.push(Ve); + } + v(O, Ue, Ge, Ne, !0), v(O, Be, Ge, Ne, !1), Ue = new l.Geometry(!0), Be = new l.Geometry(!0); }; - W = void 0; - for (var me = 0; me < q.length; me++) { - V = q[me]; - var Pe = V.resn.trim(), Fe = Pe in L; - if (Ae = 1, G = V.style.cartoon, W && W.style.cartoon && (Ae = W.style.cartoon.opacity), W && W.style.cartoon && W.style.cartoon.outline && (ge = W.style.cartoon.outline), W && W.style.cartoon && (!V.style.cartoon || W.style.cartoon.opacity != V.style.cartoon.opacity) && we(W.chain == V.chain), G.style === "trace") { - if (!V.hetflag) { - if (V.elem === "C" && V.atom === "CA" || Fe && V.atom === "P" || V.atom === "BB") { - if (ie = Ke(V, G), (0, p.isNumeric)(G.thickness) ? ee = G.thickness : ee = A, c(W, V)) + U = void 0; + for (var ce = 0; ce < Z.length; ce++) { + j = Z[ce]; + var Ie = j.resn.trim(), ke = Ie in L; + if (Ge = 1, G = j.style.cartoon, U && U.style.cartoon && (Ge = U.style.cartoon.opacity), U && U.style.cartoon && U.style.cartoon.outline && (Ne = U.style.cartoon.outline), U && U.style.cartoon && (!j.style.cartoon || U.style.cartoon.opacity != j.style.cartoon.opacity) && ye(U.chain == j.chain), G.style === "trace") { + if (!j.hetflag) { + if (j.elem === "C" && j.atom === "CA" || ke && j.atom === "P" || j.atom === "BB") { + if (ie = Me(j, G), (0, _.isNumeric)(G.thickness) ? te = G.thickness : te = A, o(U, j)) if (ie == re) { - var K = o.CC.color(ie); - u.GLDraw.drawCylinder(Re, W, V, ee, K, 2, 2); + var Y = c.CC.color(ie); + d.GLDraw.drawCylinder(Be, U, j, te, Y, 2, 2); } else { - var fe = new r.Vector3().addVectors(W, V).multiplyScalar(0.5), Se = o.CC.color(re), Ne = o.CC.color(ie); - u.GLDraw.drawCylinder(Re, W, fe, ee, Se, 2, 0), u.GLDraw.drawCylinder(Re, fe, V, ee, Ne, 0, 2); + var me = new r.Vector3().addVectors(U, j).multiplyScalar(0.5), we = c.CC.color(re), Re = c.CC.color(ie); + d.GLDraw.drawCylinder(Be, U, me, te, we, 2, 0), d.GLDraw.drawCylinder(Be, me, j, te, Re, 0, 2); } - if ((V.clickable === !0 || V.hoverable) && V.intersectionShape !== void 0) { - var pe = new r.Vector3(V.x, V.y, V.z); - V.intersectionShape.sphere.push(new a.Sphere(pe, ee)); + if ((j.clickable === !0 || j.hoverable) && j.intersectionShape !== void 0) { + var pe = new r.Vector3(j.x, j.y, j.z); + j.intersectionShape.sphere.push(new a.Sphere(pe, te)); } - W = V, re = ie; + U = j, re = ie; } } } else { - if (x(V) || Fe && (V.atom === "P" || V.atom.indexOf("O5") == 0)) { - if (Oe) - if (V.ss === "tube end") - Oe = !1, _e = new r.Vector3(V.x, V.y, V.z), u.GLDraw.drawCylinder(Re, ne, _e, 2, o.CC.color(re), 1, 1), V.ss = "h"; - else if (W.chain != V.chain || W.ss === "tube end") - Oe = !1, W.ss = "h", _e = new r.Vector3(W.x, W.y, W.z), u.GLDraw.drawCylinder(Re, ne, _e, 2, o.CC.color(re), 1, 1); + if (w(j) || ke && (j.atom === "P" || j.atom.indexOf("O5") == 0)) { + if (Le) + if (j.ss === "tube end") + Le = !1, _e = new r.Vector3(j.x, j.y, j.z), d.GLDraw.drawCylinder(Be, ne, _e, 2, c.CC.color(re), 1, 1), j.ss = "h"; + else if (U.chain != j.chain || U.ss === "tube end") + Le = !1, U.ss = "h", _e = new r.Vector3(U.x, U.y, U.z), d.GLDraw.drawCylinder(Be, ne, _e, 2, c.CC.color(re), 1, 1); else continue; - if (W && (!c(W, V) || W.ss === "tube start")) { - for (W.ss === "tube start" && (Oe = !0, ne = new r.Vector3(W.x, W.y, W.z), W.ss = "h"), ue && (Me ? Ce = new r.Vector3().addVectors(W, Me).multiplyScalar(0.5) : Ce = new r.Vector3(W.x, W.y, W.z), u.GLDraw.drawCylinder(Re, Ce, ue, f, o.CC.color(ue.color), 0, 2), M(Ee, B, !0, Me, se, J, W, q, me), We.push(ie), Ce = null, ue = null), Ee[0].length > 0 && g(Ue, Ee, We, N, ee, Ae, Ee.style), Ee = [], ce = 0; ce < B; ce++) - Ee[ce] = []; - We = []; + if (U && (!o(U, j) || U.ss === "tube start")) { + for (U.ss === "tube start" && (Le = !0, ne = new r.Vector3(U.x, U.y, U.z), U.ss = "h"), he && (Ee ? Ae = new r.Vector3().addVectors(U, Ee).multiplyScalar(0.5) : Ae = new r.Vector3(U.x, U.y, U.z), d.GLDraw.drawCylinder(Be, Ae, he, f, c.CC.color(he.color), 0, 2), M(We, B, !0, Ee, se, J, U, Z, ce), He.push(ie), Ae = null, he = null), We[0].length > 0 && g(Ue, We, He, P, te, Ge, We.style), We = [], ue = 0; ue < B; ue++) + We[ue] = []; + He = []; } - if (W === void 0 || W.rescode != V.rescode || W.resi != V.resi) { - if (ue && W != null) { - Ce = new r.Vector3().addVectors(W, V).multiplyScalar(0.5); - var ke = Ce.clone().sub(ue).multiplyScalar(0.02); - Ce.add(ke), u.GLDraw.drawCylinder(Re, Ce, ue, f, o.CC.color(ue.color), 0, 2), Ce = null, ue = null; + if (U === void 0 || U.rescode != j.rescode || U.resi != j.resi) { + if (he && U != null) { + Ae = new r.Vector3().addVectors(U, j).multiplyScalar(0.5); + var $e = Ae.clone().sub(he).multiplyScalar(0.02); + Ae.add($e), d.GLDraw.drawCylinder(Be, Ae, he, f, c.CC.color(he.color), 0, 2), Ae = null, he = null; } - ie = Ke(V, G), We.push(ie), (0, p.isNumeric)(G.thickness) ? ee = G.thickness : ee = A, W = V, he = new r.Vector3(W.x, W.y, W.z), he.resi = W.resi, re = ie; + ie = Me(j, G), He.push(ie), (0, _.isNumeric)(G.thickness) ? te = G.thickness : te = A, U = j, de = new r.Vector3(U.x, U.y, U.z), de.resi = U.resi, re = ie; } - (V.clickable === !0 || V.hoverable === !0) && (V.intersectionShape === void 0 || V.intersectionShape.triangle === void 0) && (V.intersectionShape = { + (j.clickable === !0 || j.hoverable === !0) && (j.intersectionShape === void 0 || j.intersectionShape.triangle === void 0) && (j.intersectionShape = { sphere: null, cylinder: [], line: [], triangle: [] }); - } else W != null && (x(W) && V.atom === "O" || Fe && W.atom === "P" && (V.atom === "OP2" || V.atom === "O2P") || Fe && W.atom.indexOf("O5") == 0 && V.atom.indexOf("C5") == 0) ? (le = new r.Vector3(V.x, V.y, V.z), le.resi = V.resi, (V.atom === "OP2" || V.atom === "O2P") && (se = new r.Vector3(V.x, V.y, V.z))) : Fe && V.atom.indexOf("O3") == 0 ? Me = new r.Vector3(V.x, V.y, V.z) : (V.atom === "N1" && Pe in $ || V.atom === "N3" && Pe in k) && (ue = new r.Vector3(V.x, V.y, V.z), ue.color = (0, p.getColorFromStyle)(V, G).getHex()); - le && he && le.resi === he.resi && (M(Ee, B, !0, he, le, J, W, q, me), J = le, he = null, le = null, We.push(ie)); + } else U != null && (w(U) && j.atom === "O" || ke && U.atom === "P" && (j.atom === "OP2" || j.atom === "O2P") || ke && U.atom.indexOf("O5") == 0 && j.atom.indexOf("C5") == 0) ? (oe = new r.Vector3(j.x, j.y, j.z), oe.resi = j.resi, (j.atom === "OP2" || j.atom === "O2P") && (se = new r.Vector3(j.x, j.y, j.z))) : ke && j.atom.indexOf("O3") == 0 ? Ee = new r.Vector3(j.x, j.y, j.z) : (j.atom === "N1" && Ie in $ || j.atom === "N3" && Ie in k) && (he = new r.Vector3(j.x, j.y, j.z), he.color = (0, _.getColorFromStyle)(j, G).getHex()); + oe && de && oe.resi === de.resi && (M(We, B, !0, de, oe, J, U, Z, ce), J = oe, de = null, oe = null, He.push(ie)); } } - ue && (Me ? Ce = new r.Vector3().addVectors(W, Me).multiplyScalar(0.5) : Ce = new r.Vector3(W.x, W.y, W.z), u.GLDraw.drawCylinder(Re, Ce, ue, f, o.CC.color(ue.color), 0, 2), M(Ee, B, !0, Me, se, J, W, q, me), We.push(ie)), we(!1); + he && (Ee ? Ae = new r.Vector3().addVectors(U, Ee).multiplyScalar(0.5) : Ae = new r.Vector3(U.x, U.y, U.z), d.GLDraw.drawCylinder(Be, Ae, he, f, c.CC.color(he.color), 0, 2), M(We, B, !0, Ee, se, J, U, Z, ce), He.push(ie)), ye(!1); } } ), @@ -32832,7 +32832,7 @@ ATOM`, x); /* harmony export */ CONTEXTS_PER_VIEWPORT: () => ( /* reexport safe */ - _.CONTEXTS_PER_VIEWPORT + p.CONTEXTS_PER_VIEWPORT ), /* harmony export */ Color: () => ( @@ -32847,7 +32847,7 @@ ATOM`, x); /* harmony export */ Cylinder: () => ( /* reexport safe */ - p.Cylinder + _.Cylinder ), /* harmony export */ GLDraw: () => ( @@ -32857,7 +32857,7 @@ ATOM`, x); /* harmony export */ GLModel: () => ( /* reexport safe */ - h.GLModel + u.GLModel ), /* harmony export */ GLShape: () => ( @@ -32867,7 +32867,7 @@ ATOM`, x); /* harmony export */ GLViewer: () => ( /* reexport safe */ - _.GLViewer + p.GLViewer ), /* harmony export */ GLVolumetricRender: () => ( @@ -32907,17 +32907,17 @@ ATOM`, x); /* harmony export */ Matrix3: () => ( /* reexport safe */ - u.Matrix3 + d.Matrix3 ), /* harmony export */ Matrix4: () => ( /* reexport safe */ - u.Matrix4 + d.Matrix4 ), /* harmony export */ Parsers: () => ( /* reexport safe */ - o.Parsers + c.Parsers ), /* harmony export */ PausableTimer: () => ( @@ -32937,7 +32937,7 @@ ATOM`, x); /* harmony export */ Quaternion: () => ( /* reexport safe */ - u.Quaternion + d.Quaternion ), /* harmony export */ ROYGB: () => ( @@ -32952,7 +32952,7 @@ ATOM`, x); /* harmony export */ Ray: () => ( /* reexport safe */ - u.Ray + d.Ray ), /* harmony export */ Sinebow: () => ( @@ -32962,7 +32962,7 @@ ATOM`, x); /* harmony export */ Sphere: () => ( /* reexport safe */ - p.Sphere + _.Sphere ), /* harmony export */ SurfaceType: () => ( @@ -32972,22 +32972,22 @@ ATOM`, x); /* harmony export */ Triangle: () => ( /* reexport safe */ - p.Triangle + _.Triangle ), /* harmony export */ Vector2: () => ( /* reexport safe */ - u.Vector2 + d.Vector2 ), /* harmony export */ Vector3: () => ( /* reexport safe */ - u.Vector3 + d.Vector3 ), /* harmony export */ VolumeData: () => ( /* reexport safe */ - w.VolumeData + x.VolumeData ), /* harmony export */ adjustVolumeStyle: () => ( @@ -32997,7 +32997,7 @@ ATOM`, x); /* harmony export */ applyPartialCharges: () => ( /* reexport safe */ - d.applyPartialCharges + h.applyPartialCharges ), /* harmony export */ autoinit: () => ( @@ -33017,7 +33017,7 @@ ATOM`, x); /* harmony export */ bondLength: () => ( /* reexport safe */ - o.bondLength + c.bondLength ), /* harmony export */ builtinColorSchemes: () => ( @@ -33037,27 +33037,27 @@ ATOM`, x); /* harmony export */ clamp: () => ( /* reexport safe */ - u.clamp + d.clamp ), /* harmony export */ conversionMatrix3: () => ( /* reexport safe */ - u.conversionMatrix3 + d.conversionMatrix3 ), /* harmony export */ createStereoViewer: () => ( /* reexport safe */ - _.createStereoViewer + p.createStereoViewer ), /* harmony export */ createViewer: () => ( /* reexport safe */ - _.createViewer + p.createViewer ), /* harmony export */ createViewerGrid: () => ( /* reexport safe */ - _.createViewerGrid + p.createViewerGrid ), /* harmony export */ deepCopy: () => ( @@ -33067,7 +33067,7 @@ ATOM`, x); /* harmony export */ degToRad: () => ( /* reexport safe */ - u.degToRad + d.degToRad ), /* harmony export */ download: () => ( @@ -33167,7 +33167,7 @@ ATOM`, x); /* harmony export */ partialCharges: () => ( /* reexport safe */ - d.partialCharges + h.partialCharges ), /* harmony export */ processing_autoinit: () => ( @@ -33182,7 +33182,7 @@ ATOM`, x); /* harmony export */ setBondLength: () => ( /* reexport safe */ - o.setBondLength + c.setBondLength ), /* harmony export */ setSyncSurface: () => ( @@ -33230,16 +33230,16 @@ ATOM`, x); ), l = t( /*! ./Label */ "./src/Label.ts" - ), d = t( + ), h = t( /*! ./partialCharges */ "./src/partialCharges.ts" - ), o = t( + ), c = t( /*! ./parsers */ "./src/parsers/index.ts" - ), u = t( + ), d = t( /*! ./WebGL/math */ "./src/WebGL/math/index.ts" - ), p = t( + ), _ = t( /*! ./WebGL/shapes */ "./src/WebGL/shapes/index.ts" ), m = t( @@ -33248,7 +33248,7 @@ ATOM`, x); ), y = t( /*! ./ProteinSurface4 */ "./src/ProteinSurface4.ts" - ), w = t( + ), x = t( /*! ./VolumeData */ "./src/VolumeData.ts" ), b = t( @@ -33263,10 +33263,10 @@ ATOM`, x); ), s = t( /*! ./glcartoon */ "./src/glcartoon.ts" - ), h = t( + ), u = t( /*! ./GLModel */ "./src/GLModel.ts" - ), _ = t( + ), p = t( /*! ./GLViewer */ "./src/GLViewer.ts" ), g = t( @@ -33303,16 +33303,16 @@ ATOM`, x); ), l = t( /*! ./utils/processSymmetries */ "./src/parsers/utils/processSymmetries.ts" - ), d = t( + ), h = t( /*! ./cifutils/category */ "./src/parsers/cifutils/category.ts" - ), o = t( + ), c = t( /*! ./utils/assignPDBBonds */ "./src/parsers/utils/assignPDBBonds.ts" - ), u = t( + ), d = t( /*! ../WebGL */ "./src/WebGL/index.ts" - ), p = t( + ), _ = t( /*! ./utils/isEmpty */ "./src/parsers/utils/isEmpty.ts" ), m = t( @@ -33322,26 +33322,26 @@ ATOM`, x); class y { constructor(s) { if (this.C = {}, s) { - let h = s.getField("comp_id"), _ = s.getField("atom_id_1"), g = s.getField("atom_id_2"), x = s.getField("value_order"); - for (let c = 0; c < h.length; c++) { - let v = h[c], M = _[c], E = g[c], $ = x[c], k = 1; + let u = s.getField("comp_id"), p = s.getField("atom_id_1"), g = s.getField("atom_id_2"), w = s.getField("value_order"); + for (let o = 0; o < u.length; o++) { + let v = u[o], M = p[o], E = g[o], $ = w[o], k = 1; $ == "doub" ? k = 2 : $ == "trip" && (k = 3), this.C[v] == null && (this.C[v] = {}), this.C[v][M] == null && (this.C[v][M] = {}), this.C[v][E] == null && (this.C[v][E] = {}), this.C[v][M][E] = k, this.C[v][E][M] = k; } } } //returns bond order, zero if not connected - order(s, h, _) { - return this.C[s] !== void 0 && this.C[s][h] !== void 0 && this.C[s][h][_] !== void 0 ? this.C[s][h][_] : 0; + order(s, u, p) { + return this.C[s] !== void 0 && this.C[s][u] !== void 0 && this.C[s][u][p] !== void 0 ? this.C[s][u][p] : 0; } } - class w { + class x { constructor(s) { if (this.C = [], s) { - let h = s.getField("conn_type_id"), _ = s.getField("ptnr1_label_asym_id"), g = s.getField("ptnr1_label_seq_id"), x = s.getField("ptnr1_label_comp_id"), c = s.getField("ptnr1_label_atom_id"), v = s.getField("ptnr2_label_asym_id"), M = s.getField("ptnr2_label_seq_id"), E = s.getField("ptnr2_label_comp_id"), $ = s.getField("ptnr2_label_atom_id"), k = s.getField("pdbx_value_order"); - for (let L = 0; L < h.length; L++) - if (h[L] == "disulf" || h[L] == "covale") { + let u = s.getField("conn_type_id"), p = s.getField("ptnr1_label_asym_id"), g = s.getField("ptnr1_label_seq_id"), w = s.getField("ptnr1_label_comp_id"), o = s.getField("ptnr1_label_atom_id"), v = s.getField("ptnr2_label_asym_id"), M = s.getField("ptnr2_label_seq_id"), E = s.getField("ptnr2_label_comp_id"), $ = s.getField("ptnr2_label_atom_id"), k = s.getField("pdbx_value_order"); + for (let L = 0; L < u.length; L++) + if (u[L] == "disulf" || u[L] == "covale") { let z = k ? k[L] == "" ? 1 : parseInt(k[L]) : 1; - this.C.push([[_[L], g[L], x[L], c[L]], [v[L], M[L], E[L], $[L]], z]); + this.C.push([[p[L], g[L], w[L], o[L]], [v[L], M[L], E[L], $[L]], z]); } } } @@ -33353,30 +33353,30 @@ ATOM`, x); add(s) { this.R[s.lchain] == null && (this.R[s.lchain] = {}), this.R[s.lchain][s.lresi] == null && (this.R[s.lchain][s.lresi] = {}), this.R[s.lchain][s.lresi][s.lresn] == null && (this.R[s.lchain][s.lresi][s.lresn] = []), this.R[s.lchain][s.lresi][s.lresn].push(s), this.R[s.lchain][s.lresi][s.lresn][s.atom] = s; } - geta([s, h, _, g]) { - if (this.R[s] !== void 0 && this.R[s][h] !== void 0 && this.R[s][h][_] !== void 0) - return this.R[s][h][_][g]; - } - setBonds(s, h) { - for (let _ in this.R) - for (let g in this.R[_]) - for (let x in this.R[_][g]) { - let c = this.R[_][g][x]; - for (let v = 0; v < c.length; v++) - for (let M = v + 1; M < c.length; M++) { - let E = c[v], $ = c[M], k = s.order(x, E.atom, $.atom); + geta([s, u, p, g]) { + if (this.R[s] !== void 0 && this.R[s][u] !== void 0 && this.R[s][u][p] !== void 0) + return this.R[s][u][p][g]; + } + setBonds(s, u) { + for (let p in this.R) + for (let g in this.R[p]) + for (let w in this.R[p][g]) { + let o = this.R[p][g][w]; + for (let v = 0; v < o.length; v++) + for (let M = v + 1; M < o.length; M++) { + let E = o[v], $ = o[M], k = s.order(w, E.atom, $.atom); k > 0 && (E.bonds.push($.index), $.bonds.push(E.index), E.bondOrder.push(k), $.bondOrder.push(k)); } } - for (let _ of h.C) { - let g = _[0], x = _[1], c = _[2], v = this.geta(g), M = this.geta(x); - v != null && M != null && (v.bonds.push(M.index), M.bonds.push(v.index), v.bondOrder.push(c), M.bondOrder.push(c)); + for (let p of u.C) { + let g = p[0], w = p[1], o = p[2], v = this.geta(g), M = this.geta(w); + v != null && M != null && (v.bonds.push(M.index), M.bonds.push(v.index), v.bondOrder.push(o), M.bondOrder.push(o)); } } } function A(f, s) { - var h = !s.keepH, _ = s.altLoc ? s.altLoc : "A", g = !s.noComputeSecondaryStructure; - const x = !s.doAssembly, c = s.assignBonds === void 0 ? !0 : s.assignBonds; + var u = !s.keepH, p = s.altLoc ? s.altLoc : "A", g = !s.noComputeSecondaryStructure; + const w = !s.doAssembly, o = s.assignBonds === void 0 ? !0 : s.assignBonds; if (typeof f == "string") try { f = (0, r.base64ToArray)(f); @@ -33396,68 +33396,68 @@ ATOM`, x); const z = []; E.push({ symmetries: [] }), M.push([]); const O = v.dataBlocks[k], R = /* @__PURE__ */ Object.create(null); - for (const Le of O.categories) - R[Le.name.substr(1)] = (0, d.Category)(Le); - let P = {}, U = R.struct_conf; - if (U) { - let Le = U.getField("conf_type_id"), Te = U.getField("beg_label_asym_id"), Ke = U.getField("beg_label_seq_id"), je = U.getField("end_label_seq_id"); - for (let Y = 0; Y < Le.length; Y++) - if (Le[Y].startsWith("H")) { - let q = Te[Y], te = Ke[Y], we = je[Y]; - q in P || (P[q] = {}), P[q][te] = "h1"; - for (let me = te + 1; me < we; me++) - P[q][me] = "h"; - P[q][we] = "h2"; + for (const Pe of O.categories) + R[Pe.name.substr(1)] = (0, h.Category)(Pe); + let N = {}, W = R.struct_conf; + if (W) { + let Pe = W.getField("conf_type_id"), Te = W.getField("beg_label_asym_id"), Me = W.getField("beg_label_seq_id"), De = W.getField("end_label_seq_id"); + for (let V = 0; V < Pe.length; V++) + if (Pe[V].startsWith("H")) { + let Z = Te[V], ee = Me[V], ye = De[V]; + Z in N || (N[Z] = {}), N[Z][ee] = "h1"; + for (let ce = ee + 1; ce < ye; ce++) + N[Z][ce] = "h"; + N[Z][ye] = "h2"; } } let B = R.struct_sheet_range; if (B) { - let Le = B.getField("id"), Te = B.getField("beg_label_asym_id"), Ke = B.getField("beg_label_seq_id"), je = B.getField("end_label_seq_id"); - for (let Y = 0; Y < Le.length; Y++) { - let q = Te[Y], te = Ke[Y], we = je[Y]; - q in P || (P[q] = {}), P[q][te] = "s1"; - for (let me = te + 1; me < we; me++) - P[q][me] = "s"; - P[q][we] = "s2"; + let Pe = B.getField("id"), Te = B.getField("beg_label_asym_id"), Me = B.getField("beg_label_seq_id"), De = B.getField("end_label_seq_id"); + for (let V = 0; V < Pe.length; V++) { + let Z = Te[V], ee = Me[V], ye = De[V]; + Z in N || (N[Z] = {}), N[Z][ee] = "s1"; + for (let ce = ee + 1; ce < ye; ce++) + N[Z][ce] = "s"; + N[Z][ye] = "s2"; } } - let N = R.pdbx_struct_oper_list, G = N.getField("id"); - if (G && !x) { - let Le = N.getField("matrix[1][1]"), Te = N.getField("matrix[1][2]"), Ke = N.getField("matrix[1][3]"), je = N.getField("matrix[2][1]"), Y = N.getField("matrix[2][2]"), q = N.getField("matrix[2][3]"), te = N.getField("matrix[3][1]"), we = N.getField("matrix[3][2]"), me = N.getField("matrix[3][3]"), Pe = N.getField("vector[1]"), Fe = N.getField("vector[2]"), K = N.getField("vector[3]"); - for (let fe = 0; fe < G.length; fe++) { - const Se = new u.Matrix4(Le[fe], Te[fe], Ke[fe], Pe[fe], je[fe], Y[fe], q[fe], Fe[fe], te[fe], we[fe], me[fe], K[fe]); - E[E.length - 1].symmetries.push(Se); + let P = R.pdbx_struct_oper_list, G = P.getField("id"); + if (G && !w) { + let Pe = P.getField("matrix[1][1]"), Te = P.getField("matrix[1][2]"), Me = P.getField("matrix[1][3]"), De = P.getField("matrix[2][1]"), V = P.getField("matrix[2][2]"), Z = P.getField("matrix[2][3]"), ee = P.getField("matrix[3][1]"), ye = P.getField("matrix[3][2]"), ce = P.getField("matrix[3][3]"), Ie = P.getField("vector[1]"), ke = P.getField("vector[2]"), Y = P.getField("vector[3]"); + for (let me = 0; me < G.length; me++) { + const we = new d.Matrix4(Pe[me], Te[me], Me[me], Ie[me], De[me], V[me], Z[me], ke[me], ee[me], ye[me], ce[me], Y[me]); + E[E.length - 1].symmetries.push(we); } } - let H = new y(R.chem_comp_bond), W = new b(), V = new w(R.struct_conn), re = R.atom_site, ie = re.rowCount, ee = re.getField("group_PDB"), ce = re.getField("Cartn_x"), he = re.getField("Cartn_y"), le = re.getField("Cartn_z"), J = re.getField("auth_asym_id"), Me = re.getField("label_asym_id"), se = re.getField("auth_seq_id"), Ce = re.getField("label_seq_id"), ue = re.getField("auth_comp_id"), ne = re.getField("label_comp_id"), _e = re.getField("auth_atom_id"), Oe = re.getField("label_atom_id"), Re = re.getField("type_symbol"), Ue = re.getField("B_iso_or_equiv"), We = re.getField("id"), Ee = re.getField("label_alt_id"), Ae = re.getField("pdbx_PDB_model_num"), ge = Ae ? Ae[0] : 0; - for (let Le = 0; Le < ie; Le++) { - if (ee !== void 0 && ee[Le] === "TER") + let H = new y(R.chem_comp_bond), U = new b(), j = new x(R.struct_conn), re = R.atom_site, ie = re.rowCount, te = re.getField("group_PDB"), ue = re.getField("Cartn_x"), de = re.getField("Cartn_y"), oe = re.getField("Cartn_z"), J = re.getField("auth_asym_id"), Ee = re.getField("label_asym_id"), se = re.getField("auth_seq_id"), Ae = re.getField("label_seq_id"), he = re.getField("auth_comp_id"), ne = re.getField("label_comp_id"), _e = re.getField("auth_atom_id"), Le = re.getField("label_atom_id"), Be = re.getField("type_symbol"), Ue = re.getField("B_iso_or_equiv"), He = re.getField("id"), We = re.getField("label_alt_id"), Ge = re.getField("pdbx_PDB_model_num"), Ne = Ge ? Ge[0] : 0; + for (let Pe = 0; Pe < ie; Pe++) { + if (te !== void 0 && te[Pe] === "TER") continue; - if (Ae && Ae[Le] != ge) - if (ge = Ae[Le], s.multimodel) - s.onemol || (M.push([]), E.push(E[E.length - 1]), ge = Ae[Le], W.setBonds(H, V), W = new b()); + if (Ge && Ge[Pe] != Ne) + if (Ne = Ge[Pe], s.multimodel) + s.onemol || (M.push([]), E.push(E[E.length - 1]), Ne = Ge[Pe], U.setBonds(H, j), U = new b()); else break; const Te = {}; - Te.x = ce[Le], Te.y = he[Le], Te.z = le[Le], Te.chain = J ? J[Le] : Me ? Me[Le] : void 0, Te.lchain = Me ? Me[Le] : void 0, Te.resi = se ? se[Le] : Ce ? Ce[Le] : void 0, Te.lresi = Ce ? Ce[Le] : void 0, Te.resn = ue ? ue[Le].trim() : ne ? ne[Le].trim() : void 0, Te.lresn = ne ? ne[Le].trim() : void 0, Te.atom = _e ? _e[Le].replace(/"/gm, "") : Oe ? Oe[Le].replace(/"/gm, "") : void 0, Te.icode = Ee ? Ee[Le] : void 0, Te.altLoc = Te.icode, Te.hetflag = !ee || ee[Le] === "HETA" || ee[Le] === "HETATM"; - let Ke = "X"; - Re && (Ke = Re[Le].replace(/\(?\+?\d+.*/, "")), Te.elem = Ke[0].toUpperCase() + Ke.substring(1, 2).toLowerCase(), Ue && (Te.b = Ue[Le]), !(h && Te.elem == "H") && (Te.altLoc != "" && Te.altLoc != _ && _ != "*" || (Te.bonds = [], Te.ss = "c", Te.serial = We[Le], Te.model = ge, Te.bondOrder = [], Te.properties = {}, Te.index = M[M.length - 1].length, z[Te.serial] = [M.length, Te.index], M[M.length - 1].push(Te), W.add(Te))); - } - if (W.setBonds(H, V), !(0, p.isEmpty)(P)) - for (let Le = L; Le < M.length; Le++) { - let Te = M[Le]; - for (let Ke = 0; Ke < Te.length; Ke++) { - const je = Te[Ke]; - if (je !== void 0 && je.lchain in P && je.lresi in P[je.lchain]) { - const Y = P[je.lchain][je.lresi]; - je.ss = Y[0], Y.length > 1 && (Y[1] == "1" ? je.ssbegin = !0 : Y[1] == "2" && (je.ssend = !0)); + Te.x = ue[Pe], Te.y = de[Pe], Te.z = oe[Pe], Te.chain = J ? J[Pe] : Ee ? Ee[Pe] : void 0, Te.lchain = Ee ? Ee[Pe] : void 0, Te.resi = se ? se[Pe] : Ae ? Ae[Pe] : void 0, Te.lresi = Ae ? Ae[Pe] : void 0, Te.resn = he ? he[Pe].trim() : ne ? ne[Pe].trim() : void 0, Te.lresn = ne ? ne[Pe].trim() : void 0, Te.atom = _e ? _e[Pe].replace(/"/gm, "") : Le ? Le[Pe].replace(/"/gm, "") : void 0, Te.icode = We ? We[Pe] : void 0, Te.altLoc = Te.icode, Te.hetflag = !te || te[Pe] === "HETA" || te[Pe] === "HETATM"; + let Me = "X"; + Be && (Me = Be[Pe].replace(/\(?\+?\d+.*/, "")), Te.elem = Me[0].toUpperCase() + Me.substring(1, 2).toLowerCase(), Ue && (Te.b = Ue[Pe]), !(u && Te.elem == "H") && (Te.altLoc != "" && Te.altLoc != p && p != "*" || (Te.bonds = [], Te.ss = "c", Te.serial = He[Pe], Te.model = Ne, Te.bondOrder = [], Te.properties = {}, Te.index = M[M.length - 1].length, z[Te.serial] = [M.length, Te.index], M[M.length - 1].push(Te), U.add(Te))); + } + if (U.setBonds(H, j), !(0, _.isEmpty)(N)) + for (let Pe = L; Pe < M.length; Pe++) { + let Te = M[Pe]; + for (let Me = 0; Me < Te.length; Me++) { + const De = Te[Me]; + if (De !== void 0 && De.lchain in N && De.lresi in N[De.lchain]) { + const V = N[De.lchain][De.lresi]; + De.ss = V[0], V.length > 1 && (V[1] == "1" ? De.ssbegin = !0 : V[1] == "2" && (De.ssend = !0)); } } } s.multimodel && k < $ - 1 && (s.onemol || (M.push([]), E.push({ symmetries: [] }))); } for (let k = 0; k < M.length; k++) - c && !(s.duplicateAssemblyAtoms && !s.dontConnectDuplicatedAtoms) && (0, o.assignPDBBonds)(M[k], s), g && (0, a.computeSecondaryStructure)(M[k], s.hbondCutoff), (0, l.processSymmetries)(E[k].symmetries, M[k], s, E[k].cryst), s.duplicateAssemblyAtoms && !s.dontConnectDuplicatedAtoms && c && (0, o.assignPDBBonds)(M[k], s); + o && !(s.duplicateAssemblyAtoms && !s.dontConnectDuplicatedAtoms) && (0, c.assignPDBBonds)(M[k], s), g && (0, a.computeSecondaryStructure)(M[k], s.hbondCutoff), (0, l.processSymmetries)(E[k].symmetries, M[k], s, E[k].cryst), s.duplicateAssemblyAtoms && !s.dontConnectDuplicatedAtoms && o && (0, c.assignPDBBonds)(M[k], s); return M; } } @@ -33478,19 +33478,19 @@ ATOM`, x); /* harmony export */ }); function r(a, l) { - var d = [[]]; + var h = [[]]; typeof a == "string" && (a = JSON.parse(a)); - for (var o = a.m, u = o[0].a, p = o[0].b, m = o[0].s, y = l !== void 0 && l.parseStyle !== void 0 ? l.parseStyle : m !== void 0, w = d[d.length - 1].length, b = 0; b < u.length; b++) { - var A = u[b], f = {}; + for (var c = a.m, d = c[0].a, _ = c[0].b, m = c[0].s, y = l !== void 0 && l.parseStyle !== void 0 ? l.parseStyle : m !== void 0, x = h[h.length - 1].length, b = 0; b < d.length; b++) { + var A = d[b], f = {}; f.id = A.i, f.x = A.x, f.y = A.y, f.z = A.z || 0, f.bonds = [], f.bondOrder = []; var s = A.l || "C"; - f.elem = s[0].toUpperCase() + s.substring(1).toLowerCase(), f.serial = d[d.length - 1].length, y && (f.style = m[A.s || 0]), d[d.length - 1].push(f); + f.elem = s[0].toUpperCase() + s.substring(1).toLowerCase(), f.serial = h[h.length - 1].length, y && (f.style = m[A.s || 0]), h[h.length - 1].push(f); } - for (let h = 0; h < p.length; h++) { - let _ = p[h], g = _.b + w, x = _.e + w, c = _.o || 1, v = d[d.length - 1][g], M = d[d.length - 1][x]; - v.bonds.push(x), v.bondOrder.push(c), M.bonds.push(g), M.bondOrder.push(c); + for (let u = 0; u < _.length; u++) { + let p = _[u], g = p.b + x, w = p.e + x, o = p.o || 1, v = h[h.length - 1][g], M = h[h.length - 1][w]; + v.bonds.push(w), v.bondOrder.push(o), M.bonds.push(g), M.bondOrder.push(o); } - return d; + return h; } } ), @@ -33505,7 +33505,7 @@ ATOM`, x); /* harmony export */ CIF: () => ( /* binding */ - u + d ) /* harmony export */ }); @@ -33518,97 +33518,97 @@ ATOM`, x); ), l = t( /*! ../WebGL */ "./src/WebGL/index.ts" - ), d = t( + ), h = t( /*! ./utils/assignPDBBonds */ "./src/parsers/utils/assignPDBBonds.ts" ); - const o = function(p, m, y, w) { - return new l.Vector3(m, y, w).applyMatrix3(p); + const c = function(_, m, y, x) { + return new l.Vector3(m, y, x).applyMatrix3(_); }; - function u(p, m = {}) { - const y = [], w = !m.doAssembly, b = y.modelData = [], A = m.assignBonds === void 0 ? !0 : m.assignBonds; - function f(c, v) { + function d(_, m = {}) { + const y = [], x = !m.doAssembly, b = y.modelData = [], A = m.assignBonds === void 0 ? !0 : m.assignBonds; + function f(o, v) { const M = []; let E = 0, $ = 0; - for (; $ < c.length; ) { - for (; c.substring($, $ + v.length) !== v && $ < c.length; ) - if (c[$] === "'") { - for ($++; $ < c.length && c[$] !== "'"; ) + for (; $ < o.length; ) { + for (; o.substring($, $ + v.length) !== v && $ < o.length; ) + if (o[$] === "'") { + for ($++; $ < o.length && o[$] !== "'"; ) $++; - for (; c.substring($, $ + v.length) !== v && $ < c.length; ) + for (; o.substring($, $ + v.length) !== v && $ < o.length; ) $++; - } else if (c[$] === '"') { - for ($++; $ < c.length && c[$] !== '"'; ) + } else if (o[$] === '"') { + for ($++; $ < o.length && o[$] !== '"'; ) $++; $++; } else $++; - M.push(c.substring(E, $)), E = $ = $ + v.length; + M.push(o.substring(E, $)), E = $ = $ + v.length; } return M; } - const s = p.split(/\r?\n|\r/), h = []; - let _ = !1; - for (let c = 0; c < s.length; c++) { - var g = s[c].split("#")[0]; - if (_ ? g[0] === ";" && (_ = !1) : g[0] === ";" && (_ = !0), _ || g !== "") { - if (!_ && (g = g.trim(), g[0] === "_")) { + const s = _.split(/\r?\n|\r/), u = []; + let p = !1; + for (let o = 0; o < s.length; o++) { + var g = s[o].split("#")[0]; + if (p ? g[0] === ";" && (p = !1) : g[0] === ";" && (p = !0), p || g !== "") { + if (!p && (g = g.trim(), g[0] === "_")) { const v = g.split(/\s/)[0].indexOf("."); if (v > -1) { let M = g.split(""); M[v] = "_", g = M.join(""), g = g.substring(0, v) + "_" + g.substring(v + 1); } } - h.push(g); + u.push(g); } } - let x = 0; - for (; x < h.length; ) { - for (; !h[x].startsWith("data_") || h[x] === "data_global"; ) - x++; - x++; - const c = {}; - for (; x < h.length && !h[x].startsWith("data_"); ) - if (h[x][0] === void 0) - x++; - else if (h[x][0] === "_") { - const $ = h[x].split(/\s/)[0].toLowerCase(), k = c[$] = c[$] || [], L = h[x].substring(h[x].indexOf($) + $.length); + let w = 0; + for (; w < u.length; ) { + for (; !u[w].startsWith("data_") || u[w] === "data_global"; ) + w++; + w++; + const o = {}; + for (; w < u.length && !u[w].startsWith("data_"); ) + if (u[w][0] === void 0) + w++; + else if (u[w][0] === "_") { + const $ = u[w].split(/\s/)[0].toLowerCase(), k = o[$] = o[$] || [], L = u[w].substring(u[w].indexOf($) + $.length); if (L === "") - if (x++, h[x][0] === ";") { - let z = h[x].substring(1); - for (x++; h[x] !== ";"; ) + if (w++, u[w][0] === ";") { + let z = u[w].substring(1); + for (w++; u[w] !== ";"; ) z = z + ` -` + h[x], x++; +` + u[w], w++; k.push(z); } else - k.push(h[x]); + k.push(u[w]); else k.push(L.trim()); - x++; - } else if (h[x].substring(0, 5) === "loop_") { - x++; + w++; + } else if (u[w].substring(0, 5) === "loop_") { + w++; const $ = []; - for (; h[x] === "" || h[x][0] === "_"; ) { - if (h[x] !== "") { - let L = h[x].split(/\s/)[0].toLowerCase(), z = c[L] = c[L] || []; + for (; u[w] === "" || u[w][0] === "_"; ) { + if (u[w] !== "") { + let L = u[w].split(/\s/)[0].toLowerCase(), z = o[L] = o[L] || []; $.push(z); } - x++; + w++; } let k = 0; - for (; x < h.length && h[x][0] !== "_" && !h[x].startsWith("loop_") && !h[x].startsWith("data_"); ) { - let L = f(h[x], " "); + for (; w < u.length && u[w][0] !== "_" && !u[w].startsWith("loop_") && !u[w].startsWith("data_"); ) { + let L = f(u[w], " "); for (let z = 0; z < L.length; z++) L[z] !== "" && ($[k].push(L[z]), k = (k + 1) % $.length); - x++; + w++; } } else - x++; + w++; b.push({ symmetries: [] }), y.push([]); - const v = c._atom_site_id !== void 0 ? c._atom_site_id.length : c._atom_site_label.length; + const v = o._atom_site_id !== void 0 ? o._atom_site_id.length : o._atom_site_label.length; let M; - if (c._cell_length_a !== void 0) { - const $ = parseFloat(c._cell_length_a), k = parseFloat(c._cell_length_b), L = parseFloat(c._cell_length_c), z = parseFloat(c._cell_angle_alpha) || 90, O = parseFloat(c._cell_angle_beta) || 90, R = parseFloat(c._cell_angle_gamma) || 90; + if (o._cell_length_a !== void 0) { + const $ = parseFloat(o._cell_length_a), k = parseFloat(o._cell_length_b), L = parseFloat(o._cell_length_c), z = parseFloat(o._cell_angle_alpha) || 90, O = parseFloat(o._cell_angle_beta) || 90, R = parseFloat(o._cell_angle_gamma) || 90; M = (0, l.conversionMatrix3)($, k, L, z, O, R), b[b.length - 1].cryst = { a: $, b: k, @@ -33619,23 +33619,23 @@ ATOM`, x); }; } for (let $ = 0; $ < v; $++) { - if (c._atom_site_group_pdb !== void 0 && c._atom_site_group_pdb[$] === "TER") + if (o._atom_site_group_pdb !== void 0 && o._atom_site_group_pdb[$] === "TER") continue; const k = {}; - if (c._atom_site_cartn_x !== void 0) - k.x = parseFloat(c._atom_site_cartn_x[$]), k.y = parseFloat(c._atom_site_cartn_y[$]), k.z = parseFloat(c._atom_site_cartn_z[$]); + if (o._atom_site_cartn_x !== void 0) + k.x = parseFloat(o._atom_site_cartn_x[$]), k.y = parseFloat(o._atom_site_cartn_y[$]), k.z = parseFloat(o._atom_site_cartn_z[$]); else { - const z = o(M, parseFloat(c._atom_site_fract_x[$]), parseFloat(c._atom_site_fract_y[$]), parseFloat(c._atom_site_fract_z[$])); + const z = c(M, parseFloat(o._atom_site_fract_x[$]), parseFloat(o._atom_site_fract_y[$]), parseFloat(o._atom_site_fract_z[$])); k.x = z.x, k.y = z.y, k.z = z.z; } - k.chain = c._atom_site_auth_asym_id ? c._atom_site_auth_asym_id[$] : c._atom_site_label_asym_id ? c._atom_site_label_asym_id[$] : void 0, k.resi = c._atom_site_auth_seq_id ? parseInt(c._atom_site_auth_seq_id[$]) : c._atom_site_label_seq_id ? c._atom_site_label_seq_id[$] : void 0, k.resn = c._atom_site_auth_comp_id ? c._atom_site_auth_comp_id[$].trim() : c._atom_site_label_comp_id ? c._atom_site_label_comp_id[$].trim() : void 0, k.atom = c._atom_site_auth_atom_id ? c._atom_site_auth_atom_id[$].replace(/"/gm, "") : c._atom_site_label_atom_id ? c._atom_site_label_atom_id[$].replace(/"/gm, "") : void 0, k.hetflag = !c._atom_site_group_pdb || c._atom_site_group_pdb[$] === "HETA" || c._atom_site_group_pdb[$] === "HETATM", c._atom_site_b_iso_or_equiv && (k.b = parseFloat(c._atom_site_b_iso_or_equiv[$])); + k.chain = o._atom_site_auth_asym_id ? o._atom_site_auth_asym_id[$] : o._atom_site_label_asym_id ? o._atom_site_label_asym_id[$] : void 0, k.resi = o._atom_site_auth_seq_id ? parseInt(o._atom_site_auth_seq_id[$]) : o._atom_site_label_seq_id ? o._atom_site_label_seq_id[$] : void 0, k.resn = o._atom_site_auth_comp_id ? o._atom_site_auth_comp_id[$].trim() : o._atom_site_label_comp_id ? o._atom_site_label_comp_id[$].trim() : void 0, k.atom = o._atom_site_auth_atom_id ? o._atom_site_auth_atom_id[$].replace(/"/gm, "") : o._atom_site_label_atom_id ? o._atom_site_label_atom_id[$].replace(/"/gm, "") : void 0, k.hetflag = !o._atom_site_group_pdb || o._atom_site_group_pdb[$] === "HETA" || o._atom_site_group_pdb[$] === "HETATM", o._atom_site_b_iso_or_equiv && (k.b = parseFloat(o._atom_site_b_iso_or_equiv[$])); let L = "X"; - c._atom_site_type_symbol ? L = c._atom_site_type_symbol[$].replace(/\(?\+?\d+.*/, "") : c._atom_site_label && (L = c._atom_site_label[$].split("_")[0].replace(/\(?\d+.*/, "")), k.elem = L[0].toUpperCase() + L.substring(1, 2).toLowerCase(), k.bonds = [], k.ss = "c", k.serial = $, k.bondOrder = [], k.properties = {}, y[y.length - 1].push(k); + o._atom_site_type_symbol ? L = o._atom_site_type_symbol[$].replace(/\(?\+?\d+.*/, "") : o._atom_site_label && (L = o._atom_site_label[$].split("_")[0].replace(/\(?\d+.*/, "")), k.elem = L[0].toUpperCase() + L.substring(1, 2).toLowerCase(), k.bonds = [], k.ss = "c", k.serial = $, k.bondOrder = [], k.properties = {}, y[y.length - 1].push(k); } - if (c._pdbx_struct_oper_list_id !== void 0 && !w) - for (let $ = 0; $ < c._pdbx_struct_oper_list_id.length; $++) { - const k = parseFloat(c["_pdbx_struct_oper_list_matrix[1][1]"][$]), L = parseFloat(c["_pdbx_struct_oper_list_matrix[1][2]"][$]), z = parseFloat(c["_pdbx_struct_oper_list_matrix[1][3]"][$]), O = parseFloat(c["_pdbx_struct_oper_list_vector[1]"][$]), R = parseFloat(c["_pdbx_struct_oper_list_matrix[2][1]"][$]), P = parseFloat(c["_pdbx_struct_oper_list_matrix[2][2]"][$]), U = parseFloat(c["_pdbx_struct_oper_list_matrix[2][3]"][$]), B = parseFloat(c["_pdbx_struct_oper_list_vector[2]"][$]), N = parseFloat(c["_pdbx_struct_oper_list_matrix[3][1]"][$]), G = parseFloat(c["_pdbx_struct_oper_list_matrix[3][2]"][$]), H = parseFloat(c["_pdbx_struct_oper_list_matrix[3][3]"][$]), W = parseFloat(c["_pdbx_struct_oper_list_vector[3]"][$]), V = new l.Matrix4(k, L, z, O, R, P, U, B, N, G, H, W); - b[b.length - 1].symmetries.push(V); + if (o._pdbx_struct_oper_list_id !== void 0 && !x) + for (let $ = 0; $ < o._pdbx_struct_oper_list_id.length; $++) { + const k = parseFloat(o["_pdbx_struct_oper_list_matrix[1][1]"][$]), L = parseFloat(o["_pdbx_struct_oper_list_matrix[1][2]"][$]), z = parseFloat(o["_pdbx_struct_oper_list_matrix[1][3]"][$]), O = parseFloat(o["_pdbx_struct_oper_list_vector[1]"][$]), R = parseFloat(o["_pdbx_struct_oper_list_matrix[2][1]"][$]), N = parseFloat(o["_pdbx_struct_oper_list_matrix[2][2]"][$]), W = parseFloat(o["_pdbx_struct_oper_list_matrix[2][3]"][$]), B = parseFloat(o["_pdbx_struct_oper_list_vector[2]"][$]), P = parseFloat(o["_pdbx_struct_oper_list_matrix[3][1]"][$]), G = parseFloat(o["_pdbx_struct_oper_list_matrix[3][2]"][$]), H = parseFloat(o["_pdbx_struct_oper_list_matrix[3][3]"][$]), U = parseFloat(o["_pdbx_struct_oper_list_vector[3]"][$]), j = new l.Matrix4(k, L, z, O, R, N, W, B, P, G, H, U); + b[b.length - 1].symmetries.push(j); } const E = function($) { const k = $.match("-"); @@ -33644,28 +33644,28 @@ ATOM`, x); let z, O; return L[1] === void 0 ? O = 1 : O = parseInt(L[1]), L[0] === "" ? z = 1 : z = parseInt(L[0]), z / O * (k ? -1 : 1); }; - if (c._symmetry_equiv_pos_as_xyz !== void 0 && !w) - for (let $ = 0; $ < c._symmetry_equiv_pos_as_xyz.length; $++) { - const L = c._symmetry_equiv_pos_as_xyz[$].replace(/["' ]/g, "").split(",").map(function(P) { - return P.replace(/-/g, "+-"); + if (o._symmetry_equiv_pos_as_xyz !== void 0 && !x) + for (let $ = 0; $ < o._symmetry_equiv_pos_as_xyz.length; $++) { + const L = o._symmetry_equiv_pos_as_xyz[$].replace(/["' ]/g, "").split(",").map(function(N) { + return N.replace(/-/g, "+-"); }); let z = new l.Matrix4(0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1); - for (let P = 0; P < 3; P++) { - const U = L[P].split("+"); - for (let B = 0; B < U.length; B++) { - const N = U[B]; - if (N === "") + for (let N = 0; N < 3; N++) { + const W = L[N].split("+"); + for (let B = 0; B < W.length; B++) { + const P = W[B]; + if (P === "") continue; - const G = E(N); - N.match("x") ? z.elements[P + 0] = G : N.match("y") ? z.elements[P + 4] = G : N.match("z") ? z.elements[P + 8] = G : z.elements[P + 12] = G; + const G = E(P); + P.match("x") ? z.elements[N + 0] = G : P.match("y") ? z.elements[N + 4] = G : P.match("z") ? z.elements[N + 8] = G : z.elements[N + 12] = G; } } const O = M.getMatrix4(), R = new l.Matrix4().getInverse(O, !0); z = new l.Matrix4().multiplyMatrices(z, R), z = new l.Matrix4().multiplyMatrices(O, z), b[b.length - 1].symmetries.push(z); } } - for (let c = 0; c < y.length; c++) - A && !(m.duplicateAssemblyAtoms && !m.dontConnectDuplicatedAtoms) && (0, d.assignPDBBonds)(y[c], m), (0, r.computeSecondaryStructure)(y[c], m.hbondCutoff), (0, a.processSymmetries)(b[c].symmetries, y[c], m, b[c].cryst), m.duplicateAssemblyAtoms && !m.dontConnectDuplicatedAtoms && A && (0, d.assignPDBBonds)(y[c], m); + for (let o = 0; o < y.length; o++) + A && !(m.duplicateAssemblyAtoms && !m.dontConnectDuplicatedAtoms) && (0, h.assignPDBBonds)(y[o], m), (0, r.computeSecondaryStructure)(y[o], m.hbondCutoff), (0, a.processSymmetries)(b[o].symmetries, y[o], m, b[o].cryst), m.duplicateAssemblyAtoms && !m.dontConnectDuplicatedAtoms && A && (0, h.assignPDBBonds)(y[o], m); return y; } } @@ -33681,7 +33681,7 @@ ATOM`, x); /* harmony export */ CUBE: () => ( /* binding */ - d + h ) /* harmony export */ }); @@ -33695,15 +33695,15 @@ ATOM`, x); /*! ./utils/anumToSymbol */ "./src/parsers/utils/anumToSymbol.ts" ); - function d(o, u) { - u = u || {}; - const p = [[]]; - let m = o.split(/\r?\n/); - const y = u.assignBonds === void 0 ? !0 : u.assignBonds; + function h(c, d) { + d = d || {}; + const _ = [[]]; + let m = c.split(/\r?\n/); + const y = d.assignBonds === void 0 ? !0 : d.assignBonds; if (m.length < 6) - return p; - let w = m[2].replace(/^\s+/, "").replace(/\s+/g, " ").split(" "); - const b = Math.abs(parseFloat(w[0])); + return _; + let x = m[2].replace(/^\s+/, "").replace(/\s+/g, " ").split(" "); + const b = Math.abs(parseFloat(x[0])); let A = { origin: void 0, size: void 0, @@ -33711,31 +33711,31 @@ ATOM`, x); matrix4: void 0, matrix: void 0 }; - const f = A.origin = new r.Vector3(parseFloat(w[1]), parseFloat(w[2]), parseFloat(w[3])); - w = m[3].replace(/^\s+/, "").replace(/\s+/g, " ").split(" "), w = m[3].replace(/^\s+/, "").replace(/\s+/g, " ").split(" "); - const s = w[0] > 0 ? 0.529177 : 1; + const f = A.origin = new r.Vector3(parseFloat(x[1]), parseFloat(x[2]), parseFloat(x[3])); + x = m[3].replace(/^\s+/, "").replace(/\s+/g, " ").split(" "), x = m[3].replace(/^\s+/, "").replace(/\s+/g, " ").split(" "); + const s = x[0] > 0 ? 0.529177 : 1; f.multiplyScalar(s); - const h = Math.abs(w[0]), _ = new r.Vector3(parseFloat(w[1]), parseFloat(w[2]), parseFloat(w[3])).multiplyScalar(s); - w = m[4].replace(/^\s+/, "").replace(/\s+/g, " ").split(" "); - const g = Math.abs(w[0]), x = new r.Vector3(parseFloat(w[1]), parseFloat(w[2]), parseFloat(w[3])).multiplyScalar(s); - w = m[5].replace(/^\s+/, "").replace(/\s+/g, " ").split(" "); - const c = Math.abs(w[0]), v = new r.Vector3(parseFloat(w[1]), parseFloat(w[2]), parseFloat(w[3])).multiplyScalar(s); - if (A.size = { x: h, y: g, z: c }, A.unit = new r.Vector3(_.x, x.y, v.z), _.y != 0 || _.z != 0 || x.x != 0 || x.z != 0 || v.x != 0 || v.y != 0) { - A.matrix4 = new r.Matrix4(_.x, x.x, v.x, 0, _.y, x.y, v.y, 0, _.z, x.z, v.z, 0, 0, 0, 0, 1); + const u = Math.abs(x[0]), p = new r.Vector3(parseFloat(x[1]), parseFloat(x[2]), parseFloat(x[3])).multiplyScalar(s); + x = m[4].replace(/^\s+/, "").replace(/\s+/g, " ").split(" "); + const g = Math.abs(x[0]), w = new r.Vector3(parseFloat(x[1]), parseFloat(x[2]), parseFloat(x[3])).multiplyScalar(s); + x = m[5].replace(/^\s+/, "").replace(/\s+/g, " ").split(" "); + const o = Math.abs(x[0]), v = new r.Vector3(parseFloat(x[1]), parseFloat(x[2]), parseFloat(x[3])).multiplyScalar(s); + if (A.size = { x: u, y: g, z: o }, A.unit = new r.Vector3(p.x, w.y, v.z), p.y != 0 || p.z != 0 || w.x != 0 || w.z != 0 || v.x != 0 || v.y != 0) { + A.matrix4 = new r.Matrix4(p.x, w.x, v.x, 0, p.y, w.y, v.y, 0, p.z, w.z, v.z, 0, 0, 0, 0, 1); let O = new r.Matrix4().makeTranslation(f.x, f.y, f.z); A.matrix4 = A.matrix4.multiplyMatrices(O, A.matrix4), A.matrix = A.matrix4.matrix3FromTopLeft(), A.origin = new r.Vector3(0, 0, 0), A.unit = new r.Vector3(1, 1, 1); } - p.modelData = [{ cryst: A }], m = m.splice(6, b); - for (var M = p[p.length - 1].length, E = M + m.length, $ = M; $ < E; ++$) { + _.modelData = [{ cryst: A }], m = m.splice(6, b); + for (var M = _[_.length - 1].length, E = M + m.length, $ = M; $ < E; ++$) { var k = {}; k.serial = $; var L = m[$ - M], z = L.replace(/^\s+/, "").replace(/\s+/g, " ").split(" "); - k.elem = l.anumToSymbol[z[0]], k.x = parseFloat(z[2]) * s, k.y = parseFloat(z[3]) * s, k.z = parseFloat(z[4]) * s, k.hetflag = !0, k.bonds = [], k.bondOrder = [], k.properties = {}, p[p.length - 1].push(k); + k.elem = l.anumToSymbol[z[0]], k.x = parseFloat(z[2]) * s, k.y = parseFloat(z[3]) * s, k.z = parseFloat(z[4]) * s, k.hetflag = !0, k.bonds = [], k.bondOrder = [], k.properties = {}, _[_.length - 1].push(k); } if (y) - for (let O = 0; O < p.length; O++) - (0, a.assignBonds)(p[O], u); - return p; + for (let O = 0; O < _.length; O++) + (0, a.assignBonds)(_[O], d); + return _; } } ), @@ -33761,33 +33761,33 @@ ATOM`, x); /*! ./utils/atomNameToElem */ "./src/parsers/utils/atomNameToElem.ts" ); - function l(d, o) { - const u = [], p = d.split(/\r?\n|\r/); - for (; p.length > 0; ) { - const m = parseInt(p[1]); - if (p.length < 3 || isNaN(m) || m <= 0 || p.length < m + 3) + function l(h, c) { + const d = [], _ = h.split(/\r?\n|\r/); + for (; _.length > 0; ) { + const m = parseInt(_[1]); + if (_.length < 3 || isNaN(m) || m <= 0 || _.length < m + 3) break; - const w = []; - u.push(w); + const x = []; + d.push(x); let b = 2; - const A = w.length, f = A + m; + const A = x.length, f = A + m; for (let s = A; s < f; s++) { - const h = p[b++], _ = {}; - _.serial = s, _.atom = h.slice(10, 15).trim(), _.elem = (0, a.atomNameToElem)(_.atom, !0), _.x = 10 * parseFloat(h.slice(20, 28)), _.y = 10 * parseFloat(h.slice(28, 36)), _.z = 10 * parseFloat(h.slice(36, 44)), _.resi = parseInt(h.slice(0, 5)), _.resn = h.slice(5, 10).trim(), _.bonds = [], _.bondOrder = [], _.properties = {}, h.length > 44 && (_.dx = 10 * parseFloat(h.slice(44, 52)), _.dy = 10 * parseFloat(h.slice(52, 60)), _.dz = 10 * parseFloat(h.slice(60, 68))), w[s] = _; - } - if (p.length <= b + 3) { - const h = p[b++].trim().split(/\s+/); - if (h.length === 3) { - for (let _ = 0; _ < 3; _++) - h[_] = (parseFloat(h[_]) * 10).toString(); - u.box = h; + const u = _[b++], p = {}; + p.serial = s, p.atom = u.slice(10, 15).trim(), p.elem = (0, a.atomNameToElem)(p.atom, !0), p.x = 10 * parseFloat(u.slice(20, 28)), p.y = 10 * parseFloat(u.slice(28, 36)), p.z = 10 * parseFloat(u.slice(36, 44)), p.resi = parseInt(u.slice(0, 5)), p.resn = u.slice(5, 10).trim(), p.bonds = [], p.bondOrder = [], p.properties = {}, u.length > 44 && (p.dx = 10 * parseFloat(u.slice(44, 52)), p.dy = 10 * parseFloat(u.slice(52, 60)), p.dz = 10 * parseFloat(u.slice(60, 68))), x[s] = p; + } + if (_.length <= b + 3) { + const u = _[b++].trim().split(/\s+/); + if (u.length === 3) { + for (let p = 0; p < 3; p++) + u[p] = (parseFloat(u[p]) * 10).toString(); + d.box = u; } } - p.splice(0, ++b); + _.splice(0, ++b); } - for (let m = 0; m < u.length; m++) - (0, r.assignPDBBonds)(u[m], o); - return u; + for (let m = 0; m < d.length; m++) + (0, r.assignPDBBonds)(d[m], c); + return d; } } ), @@ -33829,31 +33829,31 @@ ATOM`, x); zs: "z", zsu: "z" }; - function l(d, o) { - const u = [], p = d.split(/\r?\n|\r/); - let m = 0, y = 0, w = 0; - for (; w < p.length - 9; ) { - for (var b = w; b < p.length; b++) - if (p[b].match(/ITEM: NUMBER OF ATOMS/) && (y = parseInt(p[b + 1])), p[b].match(/ITEM: ATOMS/)) { + function l(h, c) { + const d = [], _ = h.split(/\r?\n|\r/); + let m = 0, y = 0, x = 0; + for (; x < _.length - 9; ) { + for (var b = x; b < _.length; b++) + if (_[b].match(/ITEM: NUMBER OF ATOMS/) && (y = parseInt(_[b + 1])), _[b].match(/ITEM: ATOMS/)) { m = b + 1; break; } - const A = p[m - 1].replace("ITEM: ATOMS ", "").split(" "); - u.push([]); + const A = _[m - 1].replace("ITEM: ATOMS ", "").split(" "); + d.push([]); for (let f = m; f < m + y; f++) { - const s = {}, h = {}, _ = p[f].split(" "); - for (let g = 0; g < _.length; g++) { - const x = a[A[g]]; - x !== void 0 && (x === "serial" ? s[x] = parseInt(_[g]) : x === "x" || x === "y" || x === "z" ? s[x] = parseFloat(_[g]) : x === "charge" || x === "radius" ? h[x] = parseFloat(_[g]) : s[x] = _[g]), s.properties = h, s.bonds = [], s.bondOrder = []; + const s = {}, u = {}, p = _[f].split(" "); + for (let g = 0; g < p.length; g++) { + const w = a[A[g]]; + w !== void 0 && (w === "serial" ? s[w] = parseInt(p[g]) : w === "x" || w === "y" || w === "z" ? s[w] = parseFloat(p[g]) : w === "charge" || w === "radius" ? u[w] = parseFloat(p[g]) : s[w] = p[g]), s.properties = u, s.bonds = [], s.bondOrder = []; } - u[u.length - 1][f - m] = s; + d[d.length - 1][f - m] = s; } - w = m + y - 1; + x = m + y - 1; } - if (o.assignBonds) - for (let A = 0; A < u.length; A++) - (0, r.assignBonds)(u[A], o); - return u; + if (c.assignBonds) + for (let A = 0; A < d.length; A++) + (0, r.assignBonds)(d[A], c); + return d; } } ), @@ -33881,16 +33881,16 @@ ATOM`, x); ), l = t( /*! ./utils/computeSecondaryStructure */ "./src/parsers/utils/computeSecondaryStructure.ts" - ), d = t( + ), h = t( /*! ./utils/processSymmetries */ "./src/parsers/utils/processSymmetries.ts" - ), o = t( + ), c = t( /*! ./src/vendor/mmtf.js */ "./src/vendor/mmtf.js" - ), u = function(w) { - return String.fromCharCode.apply(null, w).replace(/\0/g, ""); - }, p = function(w) { - return w == 0 || w == 2 || w == 4 ? "h" : w == 3 ? "s" : "c"; + ), d = function(x) { + return String.fromCharCode.apply(null, x).replace(/\0/g, ""); + }, _ = function(x) { + return x == 0 || x == 2 || x == 4 ? "h" : x == 3 ? "s" : "c"; }; let m = /* @__PURE__ */ new Set([ "D-SACCHARIDE", @@ -33904,124 +33904,124 @@ ATOM`, x); "PEPTIDE-LIKE", "SACCHARIDE" ]); - function y(w, b) { - var A = !b.keepH, f = b.altLoc ? b.altLoc : "A", s = !!b.noSecondaryStructure, h = !b.noComputeSecondaryStructure, _ = !b.doAssembly, g = b.assemblyIndex ? b.assemblyIndex : 0; - typeof w == "string" ? w = (0, r.base64ToArray)(w) : w = new Uint8Array(w); - var x = o.decode(w), c = [[]], v = c.modelData = [], M = 0, E = 0, $ = 0, k = x.secStructList, L = x.bFactorList, z = x.altLocList, O = x.occupancyList, R = x.bondAtomList, P = x.bondOrderList, U = x.numModels; - if (U == 0) - return c; - b.multimodel || (U = 1); - var B, N, G, H, W, V, re = []; - if (!_ && x.bioAssemblyList && x.bioAssemblyList.length > 0) { - var ie = x.bioAssemblyList[g].transformList; - for (B = 0, V = ie.length; B < V; B++) { - var ee = new a.Matrix4(ie[B].matrix); - ee.transpose(), re.push(ee); - } - } - var ce = null; - if (x.unitCell) { - var he = x.unitCell; - ce = { a: he[0], b: he[1], c: he[2], alpha: he[3], beta: he[4], gamma: he[5] }; - } - let le = []; - x.entityList.forEach((ve) => { - ve.chainIndexList.forEach((Z) => { - le[Z] = ve.type == "polymer"; + function y(x, b) { + var A = !b.keepH, f = b.altLoc ? b.altLoc : "A", s = !!b.noSecondaryStructure, u = !b.noComputeSecondaryStructure, p = !b.doAssembly, g = b.assemblyIndex ? b.assemblyIndex : 0; + typeof x == "string" ? x = (0, r.base64ToArray)(x) : x = new Uint8Array(x); + var w = c.decode(x), o = [[]], v = o.modelData = [], M = 0, E = 0, $ = 0, k = w.secStructList, L = w.bFactorList, z = w.altLocList, O = w.occupancyList, R = w.bondAtomList, N = w.bondOrderList, W = w.numModels; + if (W == 0) + return o; + b.multimodel || (W = 1); + var B, P, G, H, U, j, re = []; + if (!p && w.bioAssemblyList && w.bioAssemblyList.length > 0) { + var ie = w.bioAssemblyList[g].transformList; + for (B = 0, j = ie.length; B < j; B++) { + var te = new a.Matrix4(ie[B].matrix); + te.transpose(), re.push(te); + } + } + var ue = null; + if (w.unitCell) { + var de = w.unitCell; + ue = { a: de[0], b: de[1], c: de[2], alpha: de[3], beta: de[4], gamma: de[5] }; + } + let oe = []; + w.entityList.forEach((be) => { + be.chainIndexList.forEach((q) => { + oe[q] = be.type == "polymer"; }); }); var J = 0; - for (W = 0; W < U; W++) { - var Me = x.chainsPerModel[W], se = c[c.length - 1], Ce = []; - for (v.push({ symmetries: re, cryst: ce }), B = 0; B < Me; ++B) { - var ue = x.groupsPerChain[M], ne = u(x.chainIdList.subarray(M * 4, M * 4 + 4)); - x.chainNameList && (ne = u(x.chainNameList.subarray(M * 4, M * 4 + 4))); - var _e = E, Oe = ""; - for (N = 0; N < ue; ++N) { - var Re = x.groupList[x.groupTypeList[E]], Ue = Re.atomNameList.length, We = 0, Ee = !1, Ae = !1; + for (U = 0; U < W; U++) { + var Ee = w.chainsPerModel[U], se = o[o.length - 1], Ae = []; + for (v.push({ symmetries: re, cryst: ue }), B = 0; B < Ee; ++B) { + var he = w.groupsPerChain[M], ne = d(w.chainIdList.subarray(M * 4, M * 4 + 4)); + w.chainNameList && (ne = d(w.chainNameList.subarray(M * 4, M * 4 + 4))); + var _e = E, Le = ""; + for (P = 0; P < he; ++P) { + var Be = w.groupList[w.groupTypeList[E]], Ue = Be.atomNameList.length, He = 0, We = !1, Ge = !1; if (k) { - We = k[E]; - var ge = p(We); - (E == 0 || ge != Oe) && (Ee = !0), Oe = ge; - var Le = E + 1; - (Le >= k.length || p(k[Le] != ge)) && (Ae = !0); + He = k[E]; + var Ne = _(He); + (E == 0 || Ne != Le) && (We = !0), Le = Ne; + var Pe = E + 1; + (Pe >= k.length || _(k[Pe] != Ne)) && (Ge = !0); } - var Te = x.groupIdList[E], Ke = Re.groupName; - let ve = Re.chemCompType; - var je = $; - let Z = m.has(ve) || !le[M]; + var Te = w.groupIdList[E], Me = Be.groupName; + let be = Be.chemCompType; + var De = $; + let q = m.has(be) || !oe[M]; for (G = 0; G < Ue; ++G) { - var Y = Re.elementList[G]; - if (A && Y == "H") { + var V = Be.elementList[G]; + if (A && V == "H") { $ += 1; continue; } - var q = ""; - L && (q = L[$]); - var te = ""; - z && z[$] && (te = String.fromCharCode(z[$])); - var we = ""; - if (O && (we = O[$]), te != "" && te != f && f != "*") { + var Z = ""; + L && (Z = L[$]); + var ee = ""; + z && z[$] && (ee = String.fromCharCode(z[$])); + var ye = ""; + if (O && (ye = O[$]), ee != "" && ee != f && f != "*") { $ += 1; continue; } - var me = x.atomIdList[$], Pe = Re.atomNameList[G], Fe = 0; - Re.atomChargeList && (Fe = Re.atomChargeList[G]); - var K = x.xCoordList[$], fe = x.yCoordList[$], Se = x.zCoordList[$]; - Ce[$] = se.length, se.push({ - resn: Ke, - x: K, - y: fe, - z: Se, - elem: Y, - hetflag: Z, + var ce = w.atomIdList[$], Ie = Be.atomNameList[G], ke = 0; + Be.atomChargeList && (ke = Be.atomChargeList[G]); + var Y = w.xCoordList[$], me = w.yCoordList[$], we = w.zCoordList[$]; + Ae[$] = se.length, se.push({ + resn: Me, + x: Y, + y: me, + z: we, + elem: V, + hetflag: q, chain: ne, resi: Te, - icode: te, - rescode: Te + (te != " " ? "^" + te : ""), + icode: ee, + rescode: Te + (ee != " " ? "^" + ee : ""), // resi // and // icode - serial: me, - altLoc: te, + serial: ce, + altLoc: ee, index: $, - atom: Pe, + atom: Ie, bonds: [], - ss: p(We), - ssbegin: Ee, - ssend: Ae, + ss: _(He), + ssbegin: We, + ssend: Ge, bondOrder: [], - properties: { charge: Fe, occupancy: we }, - b: q + properties: { charge: ke, occupancy: ye }, + b: Z }), $ += 1; } - var Ne = Re.bondAtomList; - for (G = 0, H = Re.bondOrderList.length; G < H; ++G) { - var pe = je + Ne[G * 2], ke = je + Ne[G * 2 + 1], X = Re.bondOrderList[G], Be = Ce[pe], Ge = Ce[ke], I = se[Be], ye = se[Ge]; - I && ye && (I.bonds.push(Ge), I.bondOrder.push(X), ye.bonds.push(Be), ye.bondOrder.push(X)); + var Re = Be.bondAtomList; + for (G = 0, H = Be.bondOrderList.length; G < H; ++G) { + var pe = De + Re[G * 2], $e = De + Re[G * 2 + 1], X = Be.bondOrderList[G], ze = Ae[pe], Ve = Ae[$e], I = se[ze], xe = se[Ve]; + I && xe && (I.bonds.push(Ve), I.bondOrder.push(X), xe.bonds.push(ze), xe.bondOrder.push(X)); } E += 1; } - for (E = _e, N = 0; N < ue; ++N) + for (E = _e, P = 0; P < he; ++P) E += 1; M += 1; } if (R) - for (let ve = J, Z = R.length; ve < Z; ve += 2) { - let de = R[ve], $e = R[ve + 1], Ye = P ? P[ve / 2] : 1; - if (de >= $) { - J = ve; + for (let be = J, q = R.length; be < q; be += 2) { + let fe = R[be], Ce = R[be + 1], Ze = N ? N[be / 2] : 1; + if (fe >= $) { + J = be; break; } - let qe = Ce[de], Xe = Ce[$e], at = se[qe], dt = se[Xe]; - at && dt && (at.bonds.push(Xe), at.bondOrder.push(Ye), dt.bonds.push(qe), dt.bondOrder.push(Ye)); + let Xe = Ae[fe], Ye = Ae[Ce], lt = se[Xe], dt = se[Ye]; + lt && dt && (lt.bonds.push(Ye), lt.bondOrder.push(Ze), dt.bonds.push(Xe), dt.bondOrder.push(Ze)); } - b.multimodel && (b.onemol || c.push([])); + b.multimodel && (b.onemol || o.push([])); } - if (!_) - for (let ve = 0; ve < c.length; ve++) - (0, d.processSymmetries)(v[ve].symmetries, c[ve], b, v[ve].cryst); - return h && !s && (0, l.computeSecondaryStructure)(c, b.hbondCutoff), c; + if (!p) + for (let be = 0; be < o.length; be++) + (0, h.processSymmetries)(v[be].symmetries, o[be], b, v[be].cryst); + return u && !s && (0, l.computeSecondaryStructure)(o, b.hbondCutoff), o; } } ), @@ -34090,33 +34090,33 @@ ATOM`, x); "S.o2": "S", So2: "S" }; - function a(l, d) { - var o = [[]], u = !1; - typeof d.keepH < "u" && (u = !d.keepH); - var p = l.search(/@MOLECULE/), m = l.search(/@ATOM/); - if (p == -1 || m == -1) - return o; - for (var y = l.substring(p).split(/\r?\n|\r/); y.length > 0; ) { - var w = [], b = y[2].replace(/^\s+/, "").replace(/\s+/g, " ").split(" "), A = parseInt(b[0]), f = 0; + function a(l, h) { + var c = [[]], d = !1; + typeof h.keepH < "u" && (d = !h.keepH); + var _ = l.search(/@MOLECULE/), m = l.search(/@ATOM/); + if (_ == -1 || m == -1) + return c; + for (var y = l.substring(_).split(/\r?\n|\r/); y.length > 0; ) { + var x = [], b = y[2].replace(/^\s+/, "").replace(/\s+/g, " ").split(" "), A = parseInt(b[0]), f = 0; b.length > 1 && (f = parseInt(b[1])); - var s = 4, h; - for (h = 3; h < y.length; h++) - if (y[h] == "@ATOM") { - s = h + 1; + var s = 4, u; + for (u = 3; u < y.length; u++) + if (y[u] == "@ATOM") { + s = u + 1; break; } - var _ = o[o.length - 1].length, g = _ + A, x; - for (h = _; h < g; h++) { - x = y[s++], b = x.replace(/^\s+/, "").replace(/\s+/g, " ").split(" "); - var c = {}, v = b[5]; - if (r[v] !== void 0 ? v = r[v] : (v = v.split(".")[0], v = v[0].toUpperCase() + v.substring(1).toLowerCase()), c.atom = b[1], c.elem = v, !(c.elem == "H" && u)) { - var M = o[o.length - 1].length, E = parseInt(b[0]); - c.serial = E, c.x = parseFloat(b[2]), c.y = parseFloat(b[3]), c.z = parseFloat(b[4]), c.atom = b[5]; + var p = c[c.length - 1].length, g = p + A, w; + for (u = p; u < g; u++) { + w = y[s++], b = w.replace(/^\s+/, "").replace(/\s+/g, " ").split(" "); + var o = {}, v = b[5]; + if (r[v] !== void 0 ? v = r[v] : (v = v.split(".")[0], v = v[0].toUpperCase() + v.substring(1).toLowerCase()), o.atom = b[1], o.elem = v, !(o.elem == "H" && d)) { + var M = c[c.length - 1].length, E = parseInt(b[0]); + o.serial = E, o.x = parseFloat(b[2]), o.y = parseFloat(b[3]), o.z = parseFloat(b[4]), o.atom = b[5]; var $ = parseFloat(b[8]); - c.index = M, c.bonds = [], c.bondOrder = [], c.properties = { + o.index = M, o.bonds = [], o.bondOrder = [], o.properties = { charge: $, partialCharge: $ - }, w[E] = M, o[o.length - 1].push(c); + }, x[E] = M, c[c.length - 1].push(o); } } for (var k = !1; s < y.length; ) @@ -34125,19 +34125,19 @@ ATOM`, x); break; } if (k && f) - for (h = 0; h < f; h++) { - x = y[s++], b = x.replace(/^\s+/, "").replace(/\s+/g, " ").split(" "); - var L = parseInt(b[1]), z = o[o.length - 1][w[L]], O = parseInt(b[2]), R = o[o.length - 1][w[O]], P = parseInt(b[3]); - isNaN(P) && (P = 1), z !== void 0 && R !== void 0 && (z.bonds.push(w[O]), z.bondOrder.push(P), R.bonds.push(w[L]), R.bondOrder.push(P)); + for (u = 0; u < f; u++) { + w = y[s++], b = w.replace(/^\s+/, "").replace(/\s+/g, " ").split(" "); + var L = parseInt(b[1]), z = c[c.length - 1][x[L]], O = parseInt(b[2]), R = c[c.length - 1][x[O]], N = parseInt(b[3]); + isNaN(N) && (N = 1), z !== void 0 && R !== void 0 && (z.bonds.push(x[O]), z.bondOrder.push(N), R.bonds.push(x[L]), R.bondOrder.push(N)); } - if (d.multimodel) { - d.onemol || o.push([]), y.splice(0, s), l = y.join(` + if (h.multimodel) { + h.onemol || c.push([]), y.splice(0, s), l = y.join(` `); continue; } else break; } - return o; + return c; } } ), @@ -34160,28 +34160,28 @@ ATOM`, x); /*! ./utils/getSinglePDB */ "./src/parsers/utils/getSinglePDB.ts" ); - function a(l, d) { - d = d || {}; - var o = [], u = {}; - o.modelData = []; - for (var p = l.split(/\r?\n|\r/); p.length > 0; ) { - var m = (0, r.getSinglePDB)(p, d, u), y = m[0], w = m[1]; - if (p = m[2], y.length != 0) { - if (d.multimodel && d.onemol && o.length > 0) - for (var b = o[0].length, A = 0; A < y.length; A++) { + function a(l, h) { + h = h || {}; + var c = [], d = {}; + c.modelData = []; + for (var _ = l.split(/\r?\n|\r/); _.length > 0; ) { + var m = (0, r.getSinglePDB)(_, h, d), y = m[0], x = m[1]; + if (_ = m[2], y.length != 0) { + if (h.multimodel && h.onemol && c.length > 0) + for (var b = c[0].length, A = 0; A < y.length; A++) { var f = y[A]; f.index = A; for (var s = 0; s < f.bonds.length; s++) f.bonds[s] += b; - o[0].push(f); + c[0].push(f); } else - o.modelData.push(w), o.push(y); - if (!d.multimodel) + c.modelData.push(x), c.push(y); + if (!h.multimodel) break; } } - return o; + return c; } } ), @@ -34207,32 +34207,32 @@ ATOM`, x); /*! ./utils/computeSecondaryStructure */ "./src/parsers/utils/computeSecondaryStructure.ts" ); - function l(d, o) { - var u = [[]], p = !o.noSecondaryStructure; - u.modelData = [{ symmetries: [] }]; - var m = [], y = d.split(/\r?\n|\r/), w; + function l(h, c) { + var d = [[]], _ = !c.noSecondaryStructure; + d.modelData = [{ symmetries: [] }]; + var m = [], y = h.split(/\r?\n|\r/), x; for (let k = 0; k < y.length; k++) { - w = y[k].replace(/^\s*/, ""); - var b = w.substring(0, 6); + x = y[k].replace(/^\s*/, ""); + var b = x.substring(0, 6); if (b.indexOf("END") == 0) - if (o.multimodel) { - o.onemol || u.push([]); + if (c.multimodel) { + c.onemol || d.push([]); continue; } else break; else if (b == "ATOM " || b == "HETATM") { var A; - let L = parseInt(w.substring(6, 11)), z = w.substring(12, 16).replace(/ /g, ""), O = w.substring(17, 20).trim(), R = w.substring(21, 22), P = parseInt(w.substring(22, 26)); - var f = w.substring(30).trim().split(/\s+/), s = parseFloat(f[0]), h = parseFloat(f[1]), _ = parseFloat(f[2]), g = parseFloat(f[3]), x = parseFloat(f[4]), c = z[0]; - z.length > 1 && z[1].toUpperCase() != z[1] && (c = z.substring(0, 2)), w[0] == "H" ? A = !0 : A = !1, m[L] = u[u.length - 1].length, u[u.length - 1].push({ + let L = parseInt(x.substring(6, 11)), z = x.substring(12, 16).replace(/ /g, ""), O = x.substring(17, 20).trim(), R = x.substring(21, 22), N = parseInt(x.substring(22, 26)); + var f = x.substring(30).trim().split(/\s+/), s = parseFloat(f[0]), u = parseFloat(f[1]), p = parseFloat(f[2]), g = parseFloat(f[3]), w = parseFloat(f[4]), o = z[0]; + z.length > 1 && z[1].toUpperCase() != z[1] && (o = z.substring(0, 2)), x[0] == "H" ? A = !0 : A = !1, m[L] = d[d.length - 1].length, d[d.length - 1].push({ resn: O, x: s, - y: h, - z: _, - elem: c, + y: u, + z: p, + elem: o, hetflag: A, chain: R, - resi: P, + resi: N, serial: L, atom: z, bonds: [], @@ -34241,21 +34241,21 @@ ATOM`, x); properties: { charge: g, partialCharge: g, - radius: x + radius: w }, - pdbline: w + pdbline: x }); } else if (b == "CONECT") { - var v = parseInt(w.substring(6, 11)), M = u[u.length - 1][m[v]]; + var v = parseInt(x.substring(6, 11)), M = d[d.length - 1][m[v]]; for (let L = 0; L < 4; L++) { - var E = parseInt(w.substring([11, 16, 21, 26][L], [11, 16, 21, 26][L] + 5)), $ = u[u.length - 1][m[E]]; + var E = parseInt(x.substring([11, 16, 21, 26][L], [11, 16, 21, 26][L] + 5)), $ = d[d.length - 1][m[E]]; M !== void 0 && $ !== void 0 && (M.bonds.push(m[E]), M.bondOrder.push(1)); } } } - for (let k = 0; k < u.length; k++) - (0, r.assignPDBBonds)(u[k], o), p && (0, a.computeSecondaryStructure)(u[k], o.hbondCutoff); - return u; + for (let k = 0; k < d.length; k++) + (0, r.assignPDBBonds)(d[k], c), _ && (0, a.computeSecondaryStructure)(d[k], c.hbondCutoff); + return d; } } ), @@ -34275,76 +34275,76 @@ ATOM`, x); /* harmony export */ }); function r(a) { - var l = [], d, o = 0, u = a.split(/\r?\n|\r/); - if (u.length > 0 && u[0].includes("VERSION")) { - var p = u.filter(function(s) { + var l = [], h, c = 0, d = a.split(/\r?\n|\r/); + if (d.length > 0 && d[0].includes("VERSION")) { + var _ = d.filter(function(s) { return s.includes("POINTERS") || s.includes("ATOM_NAME") || s.includes("CHARGE") || s.includes("RADII") || s.includes("BONDS_INC_HYDROGEN") || s.includes("BONDS_WITHOUT_HYDROGEN"); }), m = A("POINTERS"); if (m == -1) return []; - var y = f(m), w = parseInt(u[m + 1].slice(0, y[1])); - if (isNaN(w) || w <= 0) + var y = f(m), x = parseInt(d[m + 1].slice(0, y[1])); + if (isNaN(x) || x <= 0) return []; if (m = A("ATOM_NAME"), m == -1) return []; y = f(m); var b = y[0]; - for (let s = 0; s < w / y[0]; s++) { - s == parseInt(w / y[0]) && (b = w % y[0]); - for (let h = 0; h < b; h++) { - let _ = {}, g = { charge: "", radii: "" }; - _.serial = o, _.x = 0, _.y = 0, _.z = 0, _.atom = u[m + 1].slice(y[1] * h, y[1] * (h + 1)).trim(), _.elem = u[m + 1].slice(y[1] * h, y[1] * h + 1).trim(), _.properties = g, _.bonds = [], _.bondOrder = [], l.push(_), o++; + for (let s = 0; s < x / y[0]; s++) { + s == parseInt(x / y[0]) && (b = x % y[0]); + for (let u = 0; u < b; u++) { + let p = {}, g = { charge: "", radii: "" }; + p.serial = c, p.x = 0, p.y = 0, p.z = 0, p.atom = d[m + 1].slice(y[1] * u, y[1] * (u + 1)).trim(), p.elem = d[m + 1].slice(y[1] * u, y[1] * u + 1).trim(), p.properties = g, p.bonds = [], p.bondOrder = [], l.push(p), c++; } m++; } if (m = A("CHARGE"), m != -1) { - y = f(m), o = 0, b = y[0]; - for (let s = 0; s < w / y[0]; s++) { - s == parseInt(w / y[0]) && (b = w % y[0]); - for (let h = 0; h < b; h++) - l[o].properties.charge = parseFloat(u[m + 1].slice(y[1] * h, y[1] * (h + 1))), o++; + y = f(m), c = 0, b = y[0]; + for (let s = 0; s < x / y[0]; s++) { + s == parseInt(x / y[0]) && (b = x % y[0]); + for (let u = 0; u < b; u++) + l[c].properties.charge = parseFloat(d[m + 1].slice(y[1] * u, y[1] * (u + 1))), c++; m++; } } if (m = A("RADII"), m != -1) { - y = f(m), o = 0, b = y[0]; - for (let s = 0; s < w / y[0]; s++) { - s == parseInt(w / y[0]) && (b = w % y[0]); - for (let h = 0; h < b; h++) - l[o].properties.radii = parseFloat(u[m + 1].slice(y[1] * h, y[1] * (h + 1))), o++; + y = f(m), c = 0, b = y[0]; + for (let s = 0; s < x / y[0]; s++) { + s == parseInt(x / y[0]) && (b = x % y[0]); + for (let u = 0; u < b; u++) + l[c].properties.radii = parseFloat(d[m + 1].slice(y[1] * u, y[1] * (u + 1))), c++; m++; } } if (m = A("BONDS_WITHOUT_HYDROGEN"), m != -1) - for (y = f(m), o = 0, b = y[0], m = m + 1; !u[m].match(/^%FLAG/); ) { - u[m + 1].match(/^%FLAG/) && (b = w % y[0]); + for (y = f(m), c = 0, b = y[0], m = m + 1; !d[m].match(/^%FLAG/); ) { + d[m + 1].match(/^%FLAG/) && (b = x % y[0]); for (let s = 0; s < b; s++) - o % 3 == 0 ? d = parseInt(u[m].slice(y[1] * s, y[1] * (s + 1)) / 3) : o % 3 == 1 && l[d].bonds.push(parseInt(u[m].slice(y[1] * s, y[1] * (s + 1)) / 3)), o++; + c % 3 == 0 ? h = parseInt(d[m].slice(y[1] * s, y[1] * (s + 1)) / 3) : c % 3 == 1 && l[h].bonds.push(parseInt(d[m].slice(y[1] * s, y[1] * (s + 1)) / 3)), c++; m++; } if (m = A("BONDS_INC_HYDROGEN"), m != -1) - for (y = f(m), o = 0, b = y[0], m = m + 1; !u[m].match(/^%FLAG/); ) { - u[m + 1].match(/^%FLAG/) && (b = w % y[0]); + for (y = f(m), c = 0, b = y[0], m = m + 1; !d[m].match(/^%FLAG/); ) { + d[m + 1].match(/^%FLAG/) && (b = x % y[0]); for (let s = 0; s < b; s++) - o % 3 == 0 ? d = parseInt(u[m].slice(y[1] * s, y[1] * (s + 1)) / 3) : o % 3 == 1 && l[d].bonds.push(parseInt(u[m].slice(y[1] * s, y[1] * (s + 1)) / 3)), o++; + c % 3 == 0 ? h = parseInt(d[m].slice(y[1] * s, y[1] * (s + 1)) / 3) : c % 3 == 1 && l[h].bonds.push(parseInt(d[m].slice(y[1] * s, y[1] * (s + 1)) / 3)), c++; m++; } } else return []; function A(s) { - var h = u.indexOf(p.filter(function(_) { - return _.includes(s); + var u = d.indexOf(_.filter(function(p) { + return p.includes(s); })[0]); - if (Number.isInteger(h) && h > 0) { - for (; !u[h].includes("FORMAT"); ) - h++; - return h; + if (Number.isInteger(u) && u > 0) { + for (; !d[u].includes("FORMAT"); ) + u++; + return u; } else return -1; } function f(s) { - var h = u[s].match(/\((\d*)\S*/), _ = u[s].match(/[a-zA-Z](\d*)\)\s*/); - return _ == null && (_ = u[s].match(/[a-zA-Z](\d*)\.\d*\)\s*/)), [h[1], _[1]]; + var u = d[s].match(/\((\d*)\S*/), p = d[s].match(/[a-zA-Z](\d*)\)\s*/); + return p == null && (p = d[s].match(/[a-zA-Z](\d*)\.\d*\)\s*/)), [u[1], p[1]]; } return [l]; } @@ -34365,83 +34365,83 @@ ATOM`, x); ) /* harmony export */ }); - var r = function(d, o) { - var u = [[]], p = !1; - for (typeof o.keepH < "u" && (p = !o.keepH); d.length > 0 && !(d.length < 4); ) { - var m = parseInt(d[3].substring(0, 3)); + var r = function(h, c) { + var d = [[]], _ = !1; + for (typeof c.keepH < "u" && (_ = !c.keepH); h.length > 0 && !(h.length < 4); ) { + var m = parseInt(h[3].substring(0, 3)); if (isNaN(m) || m <= 0) break; - var y = parseInt(d[3].substring(3, 6)), w = 4; - if (d.length < 4 + m + y) + var y = parseInt(h[3].substring(3, 6)), x = 4; + if (h.length < 4 + m + y) break; - var b = [], A = u[u.length - 1].length, f = A + m, s, h; - for (s = A; s < f; s++, w++) { - h = d[w]; - var _ = {}, g = h.substring(31, 34).replace(/ /g, ""); - _.atom = _.elem = g[0].toUpperCase() + g.substring(1).toLowerCase(), (_.elem !== "H" || !p) && (_.serial = s, b[s] = u[u.length - 1].length, _.x = parseFloat(h.substring(0, 10)), _.y = parseFloat(h.substring(10, 20)), _.z = parseFloat(h.substring(20, 30)), _.hetflag = !0, _.bonds = [], _.bondOrder = [], _.properties = {}, _.index = u[u.length - 1].length, u[u.length - 1].push(_)); - } - for (s = 0; s < y; s++, w++) { - h = d[w]; - var x = b[parseInt(h.substring(0, 3)) - 1 + A], c = b[parseInt(h.substring(3, 6)) - 1 + A], v = parseFloat(h.substring(6)); - typeof x < "u" && typeof c < "u" && (u[u.length - 1][x].bonds.push(c), u[u.length - 1][x].bondOrder.push(v), u[u.length - 1][c].bonds.push(x), u[u.length - 1][c].bondOrder.push(v)); - } - if (o.multimodel) { - for (o.onemol || u.push([]); d[w] !== "$$$$" && w < d.length; ) - w++; - d.splice(0, ++w); + var b = [], A = d[d.length - 1].length, f = A + m, s, u; + for (s = A; s < f; s++, x++) { + u = h[x]; + var p = {}, g = u.substring(31, 34).replace(/ /g, ""); + p.atom = p.elem = g[0].toUpperCase() + g.substring(1).toLowerCase(), (p.elem !== "H" || !_) && (p.serial = s, b[s] = d[d.length - 1].length, p.x = parseFloat(u.substring(0, 10)), p.y = parseFloat(u.substring(10, 20)), p.z = parseFloat(u.substring(20, 30)), p.hetflag = !0, p.bonds = [], p.bondOrder = [], p.properties = {}, p.index = d[d.length - 1].length, d[d.length - 1].push(p)); + } + for (s = 0; s < y; s++, x++) { + u = h[x]; + var w = b[parseInt(u.substring(0, 3)) - 1 + A], o = b[parseInt(u.substring(3, 6)) - 1 + A], v = parseFloat(u.substring(6)); + typeof w < "u" && typeof o < "u" && (d[d.length - 1][w].bonds.push(o), d[d.length - 1][w].bondOrder.push(v), d[d.length - 1][o].bonds.push(w), d[d.length - 1][o].bondOrder.push(v)); + } + if (c.multimodel) { + for (c.onemol || d.push([]); h[x] !== "$$$$" && x < h.length; ) + x++; + h.splice(0, ++x); } else break; } - return u; - }, a = function(d, o) { - var u = [[]], p = !1; - for (typeof o.keepH < "u" && (p = !o.keepH); d.length > 0 && !(d.length < 8 || !d[4].startsWith("M V30 BEGIN CTAB") || !d[5].startsWith("M V30 COUNTS") || d[5].length < 14); ) { - var m = d[5].substring(13).match(/\S+/g); + return d; + }, a = function(h, c) { + var d = [[]], _ = !1; + for (typeof c.keepH < "u" && (_ = !c.keepH); h.length > 0 && !(h.length < 8 || !h[4].startsWith("M V30 BEGIN CTAB") || !h[5].startsWith("M V30 COUNTS") || h[5].length < 14); ) { + var m = h[5].substring(13).match(/\S+/g); if (m.length < 2) break; var y = parseInt(m[0]); if (isNaN(y) || y <= 0) break; - var w = parseInt(m[1]), b = 7; - if (d.length < 8 + y + w) + var x = parseInt(m[1]), b = 7; + if (h.length < 8 + y + x) break; - var A = [], f = u[u.length - 1].length, s = f + y, h, _; - for (h = f; h < s; h++, b++) { - _ = d[b]; - var g = _.substring(6).match(/\S+/g); + var A = [], f = d[d.length - 1].length, s = f + y, u, p; + for (u = f; u < s; u++, b++) { + p = h[b]; + var g = p.substring(6).match(/\S+/g); if (g.length > 4) { - var x = {}, c = g[1].replace(/ /g, ""); - x.atom = x.elem = c[0].toUpperCase() + c.substring(1).toLowerCase(), (x.elem !== "H" || !p) && (x.serial = h, A[h] = u[u.length - 1].length, x.x = parseFloat(g[2]), x.y = parseFloat(g[3]), x.z = parseFloat(g[4]), x.hetflag = !0, x.bonds = [], x.bondOrder = [], x.properties = {}, x.index = u[u.length - 1].length, u[u.length - 1].push(x)); + var w = {}, o = g[1].replace(/ /g, ""); + w.atom = w.elem = o[0].toUpperCase() + o.substring(1).toLowerCase(), (w.elem !== "H" || !_) && (w.serial = u, A[u] = d[d.length - 1].length, w.x = parseFloat(g[2]), w.y = parseFloat(g[3]), w.z = parseFloat(g[4]), w.hetflag = !0, w.bonds = [], w.bondOrder = [], w.properties = {}, w.index = d[d.length - 1].length, d[d.length - 1].push(w)); } } - if (d[b] === "M V30 END ATOM") + if (h[b] === "M V30 END ATOM") b++; else break; - if (w !== 0 && d[b] === "M V30 BEGIN BOND") + if (x !== 0 && h[b] === "M V30 BEGIN BOND") b++; else break; - for (h = 0; h < w; h++, b++) { - _ = d[b]; - var v = _.substring(6).match(/\S+/g); + for (u = 0; u < x; u++, b++) { + p = h[b]; + var v = p.substring(6).match(/\S+/g); if (v.length > 3) { var M = A[parseInt(v[2]) - 1 + f], E = A[parseInt(v[3]) - 1 + f], $ = parseFloat(v[1]); - typeof M < "u" && typeof E < "u" && (u[u.length - 1][M].bonds.push(E), u[u.length - 1][M].bondOrder.push($), u[u.length - 1][E].bonds.push(M), u[u.length - 1][E].bondOrder.push($)); + typeof M < "u" && typeof E < "u" && (d[d.length - 1][M].bonds.push(E), d[d.length - 1][M].bondOrder.push($), d[d.length - 1][E].bonds.push(M), d[d.length - 1][E].bondOrder.push($)); } } - if (o.multimodel) { - for (o.onemol || u.push([]); d[b] !== "$$$$" && b < d.length; ) + if (c.multimodel) { + for (c.onemol || d.push([]); h[b] !== "$$$$" && b < h.length; ) b++; - d.splice(0, ++b); + h.splice(0, ++b); } else break; } - return u; + return d; }; - function l(d, o) { - var u = "V2000", p = d.split(/\r?\n|\r/); - return p.length > 3 && p[3].length > 38 && (u = p[3].substring(34, 39)), u === "V2000" ? r(p, o) : u === "V3000" ? a(p, o) : [[""]]; + function l(h, c) { + var d = "V2000", _ = h.split(/\r?\n|\r/); + return _.length > 3 && _[3].length > 38 && (d = _[3].substring(34, 39)), d === "V2000" ? r(_, c) : d === "V3000" ? a(_, c) : [[""]]; } } ), @@ -34467,42 +34467,42 @@ ATOM`, x); /*! ./utils/assignBonds */ "./src/parsers/utils/assignBonds.ts" ); - function l(d, o = {}) { - var u = [[]], p = {}; - const m = o.assignBonds === void 0 ? !0 : o.assignBonds; - var y = d.replace(/^\s+/, "").split(/\r?\n/); + function l(h, c = {}) { + var d = [[]], _ = {}; + const m = c.assignBonds === void 0 ? !0 : c.assignBonds; + var y = h.replace(/^\s+/, "").split(/\r?\n/); if (y.length < 3) - return u; + return d; if (y[1].match(/\d+/)) - p.length = parseFloat(y[1]); + _.length = parseFloat(y[1]); else - return console.log("Warning: second line of the vasp structure file must be a number"), u; - if (p.length < 0) - return console.log("Warning: Vasp implementation for negative lattice lengths is not yet available"), u; - p.xVec = new Float32Array(y[2].replace(/^\s+/, "").split(/\s+/)), p.yVec = new Float32Array(y[3].replace(/^\s+/, "").split(/\s+/)), p.zVec = new Float32Array(y[4].replace(/^\s+/, "").split(/\s+/)); - var w = new r.Matrix3(p.xVec[0], p.xVec[1], p.xVec[2], p.yVec[0], p.yVec[1], p.yVec[2], p.zVec[0], p.zVec[1], p.zVec[2]); - w.multiplyScalar(p.length), u.modelData = [{ symmetries: [], cryst: { matrix: w } }]; + return console.log("Warning: second line of the vasp structure file must be a number"), d; + if (_.length < 0) + return console.log("Warning: Vasp implementation for negative lattice lengths is not yet available"), d; + _.xVec = new Float32Array(y[2].replace(/^\s+/, "").split(/\s+/)), _.yVec = new Float32Array(y[3].replace(/^\s+/, "").split(/\s+/)), _.zVec = new Float32Array(y[4].replace(/^\s+/, "").split(/\s+/)); + var x = new r.Matrix3(_.xVec[0], _.xVec[1], _.xVec[2], _.yVec[0], _.yVec[1], _.yVec[2], _.zVec[0], _.zVec[1], _.zVec[2]); + x.multiplyScalar(_.length), d.modelData = [{ symmetries: [], cryst: { matrix: x } }]; var b = y[5].trim().split(/\s+/), A = new Int16Array(y[6].trim().split(/\s+/)), f = y[7].trim(), s = !1; if (f.match(/S/) && (s = !0, f = y[8].trim()), f.toLowerCase()[0] == "c") f = "cartesian"; else if (f.toLowerCase()[0] == "d") f = "direct"; else - return console.log("Warning: Unknown vasp mode in POSCAR file: mode must be either C(artesian) or D(irect)"), u; + return console.log("Warning: Unknown vasp mode in POSCAR file: mode must be either C(artesian) or D(irect)"), d; if (b.length != A.length) - return console.log("Warning: declaration of atomary species wrong:"), console.log(b), console.log(A), u; + return console.log("Warning: declaration of atomary species wrong:"), console.log(b), console.log(A), d; s ? y.splice(0, 9) : y.splice(0, 8); - for (var h = 0, _ = 0, g = b.length; _ < g; _++) { - for (var x = b[_], c = 0, v = A[_]; c < v; c++) { - var M = new Float32Array(y[h + c].trim().split(/\s+/)), E = {}; - E.elem = x, f == "cartesian" ? (E.x = p.length * M[0], E.y = p.length * M[1], E.z = p.length * M[2]) : (E.x = p.length * (M[0] * p.xVec[0] + M[1] * p.yVec[0] + M[2] * p.zVec[0]), E.y = p.length * (M[0] * p.xVec[1] + M[1] * p.yVec[1] + M[2] * p.zVec[1]), E.z = p.length * (M[0] * p.xVec[2] + M[1] * p.yVec[2] + M[2] * p.zVec[2])), E.bonds = [], E.bondOrder = [], u[0].push(E); + for (var u = 0, p = 0, g = b.length; p < g; p++) { + for (var w = b[p], o = 0, v = A[p]; o < v; o++) { + var M = new Float32Array(y[u + o].trim().split(/\s+/)), E = {}; + E.elem = w, f == "cartesian" ? (E.x = _.length * M[0], E.y = _.length * M[1], E.z = _.length * M[2]) : (E.x = _.length * (M[0] * _.xVec[0] + M[1] * _.yVec[0] + M[2] * _.zVec[0]), E.y = _.length * (M[0] * _.xVec[1] + M[1] * _.yVec[1] + M[2] * _.zVec[1]), E.z = _.length * (M[0] * _.xVec[2] + M[1] * _.yVec[2] + M[2] * _.zVec[2])), E.bonds = [], E.bondOrder = [], d[0].push(E); } - h += A[_]; + u += A[p]; } if (m) - for (let $ = 0; $ < u.length; $++) - (0, a.assignBonds)(u[$], o); - return u; + for (let $ = 0; $ < d.length; $++) + (0, a.assignBonds)(d[$], c); + return d; } } ), @@ -34528,45 +34528,45 @@ ATOM`, x); /*! ./utils/assignBonds */ "./src/parsers/utils/assignBonds.ts" ); - function l(d, o) { - o = o || {}; - for (var u = [[]], p = o.assignBonds === void 0 ? !0 : o.assignBonds, m = d.split(/\r?\n|\r/); m.length > 0 && !(m.length < 3); ) { + function l(h, c) { + c = c || {}; + for (var d = [[]], _ = c.assignBonds === void 0 ? !0 : c.assignBonds, m = h.split(/\r?\n|\r/); m.length > 0 && !(m.length < 3); ) { var y = parseInt(m[0]); if (isNaN(y) || y <= 0 || m.length < y + 2) break; - var w = /Lattice\s*=\s*["\{\}]([^"\{\}]+)["\{\}]\s*/gi, b = w.exec(m[1]); + var x = /Lattice\s*=\s*["\{\}]([^"\{\}]+)["\{\}]\s*/gi, b = x.exec(m[1]); if (b != null && b.length > 1) { var A = new Float32Array(b[1].split(/\s+/)), f = new r.Matrix3(A[0], A[3], A[6], A[1], A[4], A[7], A[2], A[5], A[8]); - u.modelData = [{ cryst: { matrix: f } }]; + d.modelData = [{ cryst: { matrix: f } }]; } - for (var s = 2, h = u[u.length - 1].length, _ = h + y, g = h; g < _; g++) { - var x = m[s++], c = x.replace(/^\s+/, "").replace(/\s+/g, " ").split(" "), v = {}; + for (var s = 2, u = d[d.length - 1].length, p = u + y, g = u; g < p; g++) { + var w = m[s++], o = w.replace(/^\s+/, "").replace(/\s+/g, " ").split(" "), v = {}; v.serial = g; - var M = c[0]; - v.atom = v.elem = M[0].toUpperCase() + M.substring(1, 2).toLowerCase(), v.x = parseFloat(c[1]), v.y = parseFloat(c[2]), v.z = parseFloat(c[3]), v.hetflag = !0, v.bonds = [], v.bondOrder = [], v.properties = {}, u[u.length - 1][g] = v, c.length >= 7 && (v.dx = parseFloat(c[4]), v.dy = parseFloat(c[5]), v.dz = parseFloat(c[6])); + var M = o[0]; + v.atom = v.elem = M[0].toUpperCase() + M.substring(1, 2).toLowerCase(), v.x = parseFloat(o[1]), v.y = parseFloat(o[2]), v.z = parseFloat(o[3]), v.hetflag = !0, v.bonds = [], v.bondOrder = [], v.properties = {}, d[d.length - 1][g] = v, o.length >= 7 && (v.dx = parseFloat(o[4]), v.dy = parseFloat(o[5]), v.dz = parseFloat(o[6])); } - if (o.multimodel) - u.push([]), m.splice(0, s); + if (c.multimodel) + d.push([]), m.splice(0, s); else break; } - if (p) - for (let $ = 0; $ < u.length; $++) - (0, a.assignBonds)(u[$], o); - if (o.onemol) { - var E = u; - u = [], u.push(E[0]); + if (_) + for (let $ = 0; $ < d.length; $++) + (0, a.assignBonds)(d[$], c); + if (c.onemol) { + var E = d; + d = [], d.push(E[0]); for (let $ = 1; $ < E.length; $++) { - let k = u[0].length; + let k = d[0].length; for (let L = 0; L < E[$].length; L++) { let z = E[$][L]; for (let O = 0; O < z.bonds.length; O++) z.bonds[O] = z.bonds[O] + k; - z.index = u[0].length, z.serial = u[0].length, u[0].push(z); + z.index = d[0].length, z.serial = d[0].length, d[0].push(z); } } } - return u; + return d; } } ), @@ -34590,17 +34590,17 @@ ATOM`, x); "./src/parsers/cifutils/decoder.ts" ); function a(l) { - const d = /* @__PURE__ */ Object.create(null), o = /* @__PURE__ */ Object.create(null); - for (const u of l.columns) - d[u.name] = u; + const h = /* @__PURE__ */ Object.create(null), c = /* @__PURE__ */ Object.create(null); + for (const d of l.columns) + h[d.name] = d; return { rowCount: l.rowCount, name: l.name.substring(1), - fieldNames: l.columns.map((u) => u.name), - getField(u) { - const p = d[u]; - if (p) - return o[u] || (o[u] = (0, r.decode)(p.data)), o[u]; + fieldNames: l.columns.map((d) => d.name), + getField(d) { + const _ = h[d]; + if (_) + return c[d] || (c[d] = (0, r.decode)(_.data)), c[d]; } }; } @@ -34617,7 +34617,7 @@ ATOM`, x); /* harmony export */ decode: () => ( /* binding */ - d + h ) /* harmony export */ }); @@ -34628,18 +34628,18 @@ ATOM`, x); const a = new Uint16Array(new Uint8Array([18, 52]).buffer)[0] === 13330; function l(k, L) { const z = new ArrayBuffer(k.length), O = new Uint8Array(z); - for (let R = 0, P = k.length; R < P; R += L) - for (let U = 0; U < L; U++) - O[R + L - U - 1] = k[R + U]; + for (let R = 0, N = k.length; R < N; R += L) + for (let W = 0; W < L; W++) + O[R + L - W - 1] = k[R + W]; return z; } - function d(k) { + function h(k) { let L = k.data; for (let z = k.encoding.length - 1; z >= 0; z--) - L = o(L, k.encoding[z]); + L = c(L, k.encoding[z]); return L; } - function o(k, L) { + function c(k, L) { switch (L.kind) { case "ByteArray": switch (L.type) { @@ -34648,7 +34648,7 @@ ATOM`, x); case r.Encoding.IntDataType.Int8: return m(k); case r.Encoding.IntDataType.Int16: - return w(k); + return x(k); case r.Encoding.IntDataType.Uint16: return b(k); case r.Encoding.IntDataType.Int32: @@ -34658,25 +34658,25 @@ ATOM`, x); case r.Encoding.FloatDataType.Float32: return s(k); case r.Encoding.FloatDataType.Float64: - return h(k); + return u(k); default: throw new Error("unreachable"); } case "FixedPoint": - return _(k, L); + return p(k, L); case "IntervalQuantization": return g(k, L); case "RunLength": - return x(k, L); + return w(k, L); case "Delta": - return c(k, L); + return o(k, L); case "IntegerPacking": return E(k, L); case "StringArray": return $(k, L); } } - function u(k, L) { + function d(k, L) { switch (k) { case r.Encoding.IntDataType.Int8: return new Int8Array(L); @@ -34694,7 +34694,7 @@ ATOM`, x); return new Int32Array(L); } } - function p(k, L) { + function _(k, L) { switch (k) { case r.Encoding.FloatDataType.Float32: return new Float32Array(L); @@ -34710,7 +34710,7 @@ ATOM`, x); function y(k, L, z) { return (k.byteOffset != 0 || k.byteLength != k.buffer.byteLength) && (k = new Uint8Array(k)), a ? new z(k.buffer) : new z(l(k, L)); } - function w(k) { + function x(k) { return y(k, 2, Int16Array); } function b(k) { @@ -34725,33 +34725,33 @@ ATOM`, x); function s(k) { return y(k, 4, Float32Array); } - function h(k) { + function u(k) { return y(k, 8, Float64Array); } - function _(k, L) { - const z = k.length, O = p(L.srcType, z), R = 1 / L.factor; - for (let P = 0; P < z; P++) - O[P] = R * k[P]; + function p(k, L) { + const z = k.length, O = _(L.srcType, z), R = 1 / L.factor; + for (let N = 0; N < z; N++) + O[N] = R * k[N]; return O; } function g(k, L) { - const z = k.length, O = p(L.srcType, z), R = (L.max - L.min) / (L.numSteps - 1), P = L.min; - for (let U = 0; U < z; U++) - O[U] = P + R * k[U]; + const z = k.length, O = _(L.srcType, z), R = (L.max - L.min) / (L.numSteps - 1), N = L.min; + for (let W = 0; W < z; W++) + O[W] = N + R * k[W]; return O; } - function x(k, L) { - const z = u(L.srcType, L.srcSize); + function w(k, L) { + const z = d(L.srcType, L.srcSize); let O = 0; - for (let R = 0, P = k.length; R < P; R += 2) { - const U = k[R], B = k[R + 1]; - for (let N = 0; N < B; ++N) - z[O++] = U; + for (let R = 0, N = k.length; R < N; R += 2) { + const W = k[R], B = k[R + 1]; + for (let P = 0; P < B; ++P) + z[O++] = W; } return z; } - function c(k, L) { - const z = k.length, O = u(L.srcType, z); + function o(k, L) { + const z = k.length, O = d(L.srcType, z); if (!z) return k; O[0] = k[0] + (L.origin | 0); @@ -34760,24 +34760,24 @@ ATOM`, x); return O; } function v(k, L) { - const z = L.byteCount === 1 ? 127 : 32767, O = -z - 1, R = k.length, P = new Int32Array(L.srcSize); - let U = 0, B = 0; - for (; U < R; ) { - let N = 0, G = k[U]; + const z = L.byteCount === 1 ? 127 : 32767, O = -z - 1, R = k.length, N = new Int32Array(L.srcSize); + let W = 0, B = 0; + for (; W < R; ) { + let P = 0, G = k[W]; for (; G === z || G === O; ) - N += G, U++, G = k[U]; - N += G, P[B] = N, U++, B++; + P += G, W++, G = k[W]; + P += G, N[B] = P, W++, B++; } - return P; + return N; } function M(k, L) { const z = L.byteCount === 1 ? 255 : 65535, O = k.length, R = new Int32Array(L.srcSize); - let P = 0, U = 0; - for (; P < O; ) { - let B = 0, N = k[P]; - for (; N === z; ) - B += N, P++, N = k[P]; - B += N, R[U] = B, P++, U++; + let N = 0, W = 0; + for (; N < O; ) { + let B = 0, P = k[N]; + for (; P === z; ) + B += P, N++, P = k[N]; + B += P, R[W] = B, N++, W++; } return R; } @@ -34785,14 +34785,14 @@ ATOM`, x); return k.length === L.srcSize ? k : L.isUnsigned ? M(k, L) : v(k, L); } function $(k, L) { - const z = d({ encoding: L.offsetEncoding, data: L.offsets }), O = d({ encoding: L.dataEncoding, data: k }), R = L.stringData, P = new Array(z.length); - P[0] = ""; - for (let N = 1, G = z.length; N < G; N++) - P[N] = R.substring(z[N - 1], z[N]); - let U = 0; + const z = h({ encoding: L.offsetEncoding, data: L.offsets }), O = h({ encoding: L.dataEncoding, data: k }), R = L.stringData, N = new Array(z.length); + N[0] = ""; + for (let P = 1, G = z.length; P < G; P++) + N[P] = R.substring(z[P - 1], z[P]); + let W = 0; const B = new Array(O.length); - for (let N = 0, G = O.length; N < G; N++) - B[U++] = P[O[N] + 1]; + for (let P = 0, G = O.length; P < G; P++) + B[W++] = N[O[P] + 1]; return B; } } @@ -34820,25 +34820,25 @@ ATOM`, x); const r = "0.3.0"; var a; (function(l) { - (function(u) { - u[u.Int8 = 1] = "Int8", u[u.Int16 = 2] = "Int16", u[u.Int32 = 3] = "Int32", u[u.Uint8 = 4] = "Uint8", u[u.Uint16 = 5] = "Uint16", u[u.Uint32 = 6] = "Uint32"; - })(l.IntDataType || (l.IntDataType = {})), function(u) { - u[u.Float32 = 32] = "Float32", u[u.Float64 = 33] = "Float64"; + (function(d) { + d[d.Int8 = 1] = "Int8", d[d.Int16 = 2] = "Int16", d[d.Int32 = 3] = "Int32", d[d.Uint8 = 4] = "Uint8", d[d.Uint16 = 5] = "Uint16", d[d.Uint32 = 6] = "Uint32"; + })(l.IntDataType || (l.IntDataType = {})), function(d) { + d[d.Float32 = 32] = "Float32", d[d.Float64 = 33] = "Float64"; }(l.FloatDataType || (l.FloatDataType = {})); - function d(u) { - let p; - return u instanceof Int8Array ? p = l.IntDataType.Int8 : u instanceof Int16Array ? p = l.IntDataType.Int16 : u instanceof Int32Array ? p = l.IntDataType.Int32 : u instanceof Uint8Array ? p = l.IntDataType.Uint8 : u instanceof Uint16Array ? p = l.IntDataType.Uint16 : u instanceof Uint32Array ? p = l.IntDataType.Uint32 : u instanceof Float32Array ? p = l.FloatDataType.Float32 : u instanceof Float64Array ? p = l.FloatDataType.Float64 : p = l.IntDataType.Int32, p; + function h(d) { + let _; + return d instanceof Int8Array ? _ = l.IntDataType.Int8 : d instanceof Int16Array ? _ = l.IntDataType.Int16 : d instanceof Int32Array ? _ = l.IntDataType.Int32 : d instanceof Uint8Array ? _ = l.IntDataType.Uint8 : d instanceof Uint16Array ? _ = l.IntDataType.Uint16 : d instanceof Uint32Array ? _ = l.IntDataType.Uint32 : d instanceof Float32Array ? _ = l.FloatDataType.Float32 : d instanceof Float64Array ? _ = l.FloatDataType.Float64 : _ = l.IntDataType.Int32, _; } - l.getDataType = d; - function o(u) { - if (u instanceof Int8Array || u instanceof Int16Array || u instanceof Int32Array) + l.getDataType = h; + function c(d) { + if (d instanceof Int8Array || d instanceof Int16Array || d instanceof Int32Array) return !0; - for (let p = 0, m = u.length; p < m; p++) - if (p < 0) + for (let _ = 0, m = d.length; _ < m; _++) + if (_ < 0) return !1; return !0; } - l.isSignedIntegerDataType = o; + l.isSignedIntegerDataType = c; })(a || (a = {})); } ), @@ -34853,17 +34853,17 @@ ATOM`, x); /* harmony export */ Parsers: () => ( /* binding */ - _ + p ), /* harmony export */ bondLength: () => ( /* reexport safe */ - h.bondLength + u.bondLength ), /* harmony export */ setBondLength: () => ( /* reexport safe */ - h.setBondLength + u.setBondLength ) /* harmony export */ }); @@ -34876,16 +34876,16 @@ ATOM`, x); ), l = t( /*! ./XYZ */ "./src/parsers/XYZ.ts" - ), d = t( + ), h = t( /*! ./SDF */ "./src/parsers/SDF.ts" - ), o = t( + ), c = t( /*! ./CDJSON */ "./src/parsers/CDJSON.ts" - ), u = t( + ), d = t( /*! ./CIF */ "./src/parsers/CIF.ts" - ), p = t( + ), _ = t( /*! ./MOL2 */ "./src/parsers/MOL2.ts" ), m = t( @@ -34894,7 +34894,7 @@ ATOM`, x); ), y = t( /*! ./PQR */ "./src/parsers/PQR.ts" - ), w = t( + ), x = t( /*! ./MMTF */ "./src/parsers/MMTF.ts" ), b = t( @@ -34909,35 +34909,35 @@ ATOM`, x); ), s = t( /*! ./BCIF */ "./src/parsers/BCIF.ts" - ), h = t( + ), u = t( /*! ./utils/bondLength */ "./src/parsers/utils/bondLength.ts" ); - const _ = { + const p = { vasp: r.VASP, VASP: r.VASP, cube: a.CUBE, CUBE: a.CUBE, xyz: l.XYZ, XYZ: l.XYZ, - sdf: d.SDF, - SDF: d.SDF, - json: o.CDJSON, - cdjson: o.CDJSON, - CDJSON: o.CDJSON, - mcif: u.CIF, - cif: u.CIF, - CIF: u.CIF, - mol2: p.MOL2, - MOL2: p.MOL2, + sdf: h.SDF, + SDF: h.SDF, + json: c.CDJSON, + cdjson: c.CDJSON, + CDJSON: c.CDJSON, + mcif: d.CIF, + cif: d.CIF, + CIF: d.CIF, + mol2: _.MOL2, + MOL2: _.MOL2, pdb: m.PDB, PDB: m.PDB, pdbqt: m.PDB, PDBQT: m.PDB, pqr: y.PQR, PQR: y.PQR, - mmtf: w.MMTFparser, - MMTF: w.MMTFparser, + mmtf: x.MMTFparser, + MMTF: x.MMTFparser, prmtop: b.PRMTOP, PRMTOP: b.PRMTOP, gro: A.GRO, @@ -35105,22 +35105,22 @@ ATOM`, x); "./src/parsers/utils/bondLength.ts" ); const a = /* @__PURE__ */ new Set(["Na", "K", "Ca", "Mg", "Mn", "Sr"]); - function l(d, o, u) { - if (u && u.unboundCations && (a.has(d.elem) || a.has(o.elem))) + function l(h, c, d) { + if (d && d.unboundCations && (a.has(h.elem) || a.has(c.elem))) return !1; - let p = (0, r.bondLength)(d.elem) + (0, r.bondLength)(o.elem); - p += 0.25, p *= p; - let m = d.x - o.x; - if (m *= m, m > p) + let _ = (0, r.bondLength)(h.elem) + (0, r.bondLength)(c.elem); + _ += 0.25, _ *= _; + let m = h.x - c.x; + if (m *= m, m > _) return !1; - let y = d.y - o.y; - if (y *= y, y > p) + let y = h.y - c.y; + if (y *= y, y > _) return !1; - let w = d.z - o.z; - if (w *= w, w > p) + let x = h.z - c.z; + if (x *= x, x > _) return !1; - const b = m + y + w; - return !(isNaN(b) || b < 0.5 || b > p || d.altLoc !== o.altLoc && d.altLoc.trim() !== "" && o.altLoc.trim() !== ""); + const b = m + y + x; + return !(isNaN(b) || b < 0.5 || b > _ || h.altLoc !== c.altLoc && h.altLoc.trim() !== "" && c.altLoc.trim() !== ""); } } ), @@ -35140,31 +35140,31 @@ ATOM`, x); /* harmony export */ }); function r(a, l) { - const d = l || 3.2, o = d * d, u = []; - for (let p = 0, m = a.length; p < m; p++) { - a[p].index = p; - const y = a[p]; - !y.hetflag && (y.atom === "N" || y.atom === "O") && (u.push(y), y.hbondOther = null, y.hbondDistanceSq = Number.POSITIVE_INFINITY); - } - u.sort(function(p, m) { - return p.z - m.z; + const h = l || 3.2, c = h * h, d = []; + for (let _ = 0, m = a.length; _ < m; _++) { + a[_].index = _; + const y = a[_]; + !y.hetflag && (y.atom === "N" || y.atom === "O") && (d.push(y), y.hbondOther = null, y.hbondDistanceSq = Number.POSITIVE_INFINITY); + } + d.sort(function(_, m) { + return _.z - m.z; }); - for (let p = 0, m = u.length; p < m; p++) { - const y = u[p]; - for (let w = p + 1; w < m; w++) { - const b = u[w], A = b.z - y.z; - if (A > d) + for (let _ = 0, m = d.length; _ < m; _++) { + const y = d[_]; + for (let x = _ + 1; x < m; x++) { + const b = d[x], A = b.z - y.z; + if (A > h) break; if (b.atom == y.atom) continue; const f = Math.abs(b.y - y.y); - if (f > d) + if (f > h) continue; const s = Math.abs(b.x - y.x); - if (s > d) + if (s > h) continue; - const h = s * s + f * f + A * A; - h > o || b.chain == y.chain && Math.abs(b.resi - y.resi) < 4 || (h < y.hbondDistanceSq && (y.hbondOther = b, y.hbondDistanceSq = h), h < b.hbondDistanceSq && (b.hbondOther = y, b.hbondDistanceSq = h)); + const u = s * s + f * f + A * A; + u > c || b.chain == y.chain && Math.abs(b.resi - y.resi) < 4 || (u < y.hbondDistanceSq && (y.hbondOther = b, y.hbondDistanceSq = u), u < b.hbondDistanceSq && (b.hbondOther = y, b.hbondDistanceSq = u)); } } } @@ -35181,7 +35181,7 @@ ATOM`, x); /* harmony export */ assignBonds: () => ( /* binding */ - d + h ) /* harmony export */ }); @@ -35204,51 +35204,51 @@ ATOM`, x); { x: 1, y: 1, z: 0 }, { x: 1, y: 1, z: 1 } ], l = 4.95; - function d(o, u) { - for (let y = 0, w = o.length; y < w; y++) - o[y].index || (o[y].index = y); - const p = { + function h(c, d) { + for (let y = 0, x = c.length; y < x; y++) + c[y].index || (c[y].index = y); + const _ = { x: { y: { z: [] } } }; - for (let y = 0; y < o.length; y++) { - const w = o[y], b = Math.floor(w.x / l), A = Math.floor(w.y / l), f = Math.floor(w.z / l); - p[b] || (p[b] = {}), p[b][A] || (p[b][A] = {}), p[b][A][f] || (p[b][A][f] = []), p[b][A][f].push(w); + for (let y = 0; y < c.length; y++) { + const x = c[y], b = Math.floor(x.x / l), A = Math.floor(x.y / l), f = Math.floor(x.z / l); + _[b] || (_[b] = {}), _[b][A] || (_[b][A] = {}), _[b][A][f] || (_[b][A][f] = []), _[b][A][f].push(x); } - function m(y, w) { + function m(y, x) { for (let b = 0; b < y.length; b++) { const A = y[b]; - for (let f = 0; f < w.length; f++) { - const s = w[f]; - if ((0, r.areConnected)(A, s, u)) { - const h = A.bonds.indexOf(s.index), _ = s.bonds.indexOf(A.index); - h === -1 && _ === -1 ? (A.bonds.push(s.index), A.bondOrder.push(1), s.bonds.push(A.index), s.bondOrder.push(1)) : h === -1 ? (A.bonds.push(s.index), A.bondOrder.push(s.bondOrder[_])) : _ === -1 && (s.bonds.push(A.index), s.bondOrder.push(A.bondOrder[h])); + for (let f = 0; f < x.length; f++) { + const s = x[f]; + if ((0, r.areConnected)(A, s, d)) { + const u = A.bonds.indexOf(s.index), p = s.bonds.indexOf(A.index); + u === -1 && p === -1 ? (A.bonds.push(s.index), A.bondOrder.push(1), s.bonds.push(A.index), s.bondOrder.push(1)) : u === -1 ? (A.bonds.push(s.index), A.bondOrder.push(s.bondOrder[p])) : p === -1 && (s.bonds.push(A.index), s.bondOrder.push(A.bondOrder[u])); } } } } - for (let y in p) { - const w = parseInt(y); - for (let b in p[w]) { + for (let y in _) { + const x = parseInt(y); + for (let b in _[x]) { const A = parseInt(b); - for (let f in p[w][A]) { - const s = parseInt(f), h = p[w][A][s]; - for (let _ = 0; _ < h.length; _++) { - const g = h[_]; - for (let x = _ + 1; x < h.length; x++) { - const c = h[x]; - (0, r.areConnected)(g, c, u) && g.bonds.indexOf(c.index) == -1 && (g.bonds.push(c.index), g.bondOrder.push(1), c.bonds.push(g.index), c.bondOrder.push(1)); + for (let f in _[x][A]) { + const s = parseInt(f), u = _[x][A][s]; + for (let p = 0; p < u.length; p++) { + const g = u[p]; + for (let w = p + 1; w < u.length; w++) { + const o = u[w]; + (0, r.areConnected)(g, o, d) && g.bonds.indexOf(o.index) == -1 && (g.bonds.push(o.index), g.bondOrder.push(1), o.bonds.push(g.index), o.bondOrder.push(1)); } } - for (let _ = 0; _ < a.length; _++) { - const g = a[_]; - if (!p[w + g.x] || !p[w + g.x][A + g.y] || !p[w + g.x][A + g.y][s + g.z]) + for (let p = 0; p < a.length; p++) { + const g = a[p]; + if (!_[x + g.x] || !_[x + g.x][A + g.y] || !_[x + g.x][A + g.y][s + g.z]) continue; - const x = p[w + g.x][A + g.y][s + g.z]; - m(h, x); + const w = _[x + g.x][A + g.y][s + g.z]; + m(u, w); } } } @@ -35267,7 +35267,7 @@ ATOM`, x); /* harmony export */ assignPDBBonds: () => ( /* binding */ - d + h ) /* harmony export */ }); @@ -35281,24 +35281,24 @@ ATOM`, x); /*! ./standardResidues */ "./src/parsers/utils/standardResidues.ts" ); - function d(o, u) { - const p = [], m = []; - for (let A = 0, f = o.length; A < f; A++) { - const s = o[A]; - s.index = A, s.hetflag || !l.standardResidues.has(s.resn) ? m.push(s) : p.push(s); + function h(c, d) { + const _ = [], m = []; + for (let A = 0, f = c.length; A < f; A++) { + const s = c[A]; + s.index = A, s.hetflag || !l.standardResidues.has(s.resn) ? m.push(s) : _.push(s); } - (0, a.assignBonds)(m, u), p.sort(function(A, f) { + (0, a.assignBonds)(m, d), _.sort(function(A, f) { return A.chain !== f.chain ? A.chain < f.chain ? -1 : 1 : A.resi - f.resi; }); - let y = -1, w = -1, b; - for (let A = 0, f = p.length; A < f; A++) { - const s = p[A]; - s.resi !== y && (y = s.resi, b || w++, b = !1), s.reschain = w; - for (let h = A + 1; h < p.length; h++) { - const _ = p[h]; - if (_.chain !== s.chain || _.resi - s.resi > 1) + let y = -1, x = -1, b; + for (let A = 0, f = _.length; A < f; A++) { + const s = _[A]; + s.resi !== y && (y = s.resi, b || x++, b = !1), s.reschain = x; + for (let u = A + 1; u < _.length; u++) { + const p = _[u]; + if (p.chain !== s.chain || p.resi - s.resi > 1) break; - (0, r.areConnected)(s, _, u) && (s.bonds.indexOf(_.index) === -1 && (s.bonds.push(_.index), s.bondOrder.push(1), _.bonds.push(s.index), _.bondOrder.push(1)), s.resi !== _.resi && (b = !0)); + (0, r.areConnected)(s, p, d) && (s.bonds.indexOf(p.index) === -1 && (s.bonds.push(p.index), s.bondOrder.push(1), p.bonds.push(s.index), p.bondOrder.push(1)), s.resi !== p.resi && (b = !0)); } } } @@ -35323,9 +35323,9 @@ ATOM`, x); /*! ./bondLength */ "./src/parsers/utils/bondLength.ts" ); - function a(l, d) { - let o = l.replace(/ /g, ""); - return o.length > 0 && o[0] === "H" && o !== "Hg" && o !== "He" && o !== "Hf" && o !== "Hs" && o !== "Ho" && (o = "H"), o.length > 1 && (o = o[0].toUpperCase() + o.substring(1).toLowerCase(), r.bondTable[o] === void 0 ? o = o[0] : d && (o === "Ca" || o === "Cd") && (o = "C")), o; + function a(l, h) { + let c = l.replace(/ /g, ""); + return c.length > 0 && c[0] === "H" && c !== "Hg" && c !== "He" && c !== "Hf" && c !== "Hs" && c !== "Ho" && (c = "H"), c.length > 1 && (c = c[0].toUpperCase() + c.substring(1).toLowerCase(), r.bondTable[c] === void 0 ? c = c[0] : h && (c === "Ca" || c === "Cd") && (c = "C")), c; } } ), @@ -35429,11 +35429,11 @@ ATOM`, x); Rn: 1.45 // None of the bottom row or any of the Lanthanides have bond lengths }; - function a(d) { - return r[d] || 1.6; + function a(h) { + return r[h] || 1.6; } - function l(d, o) { - o < 0 && (o = 0), r[d] = o; + function l(h, c) { + c < 0 && (c = 0), r[h] = c; } } ), @@ -35456,39 +35456,39 @@ ATOM`, x); /*! ./assignBackboneHBonds */ "./src/parsers/utils/assignBackboneHBonds.ts" ); - function a(l, d) { - (0, r.assignBackboneHBonds)(l, d); - const o = {}; - let u, p, m, y, w, b; - for (u = 0, p = l.length; u < p; u++) - if (w = l[u], o[w.chain] === void 0 && (o[w.chain] = []), isFinite(w.hbondDistanceSq)) { - const A = w.hbondOther; - o[A.chain] === void 0 && (o[A.chain] = []), Math.abs(A.resi - w.resi) === 4 && (o[w.chain][w.resi] = "h"); - } - for (m in o) - for (y = 1; y < o[m].length - 1; y++) { - const A = o[m][y - 1], f = o[m][y + 1]; - b = o[m][y], A == "h" && A == f && b != A && (o[m][y] = A); - } - for (u = 0, p = l.length; u < p; u++) - w = l[u], isFinite(w.hbondDistanceSq) && o[w.chain][w.resi] != "h" && w.ss !== "h" && (o[w.chain][w.resi] = "maybesheet"); + function a(l, h) { + (0, r.assignBackboneHBonds)(l, h); + const c = {}; + let d, _, m, y, x, b; + for (d = 0, _ = l.length; d < _; d++) + if (x = l[d], c[x.chain] === void 0 && (c[x.chain] = []), isFinite(x.hbondDistanceSq)) { + const A = x.hbondOther; + c[A.chain] === void 0 && (c[A.chain] = []), Math.abs(A.resi - x.resi) === 4 && (c[x.chain][x.resi] = "h"); + } + for (m in c) + for (y = 1; y < c[m].length - 1; y++) { + const A = c[m][y - 1], f = c[m][y + 1]; + b = c[m][y], A == "h" && A == f && b != A && (c[m][y] = A); + } + for (d = 0, _ = l.length; d < _; d++) + x = l[d], isFinite(x.hbondDistanceSq) && c[x.chain][x.resi] != "h" && x.ss !== "h" && (c[x.chain][x.resi] = "maybesheet"); for (let A = 0, f = l.length; A < f; A++) - if (w = l[A], isFinite(w.hbondDistanceSq) && o[w.chain][w.resi] == "maybesheet") { - let s = w.hbondOther, h = o[s.chain][s.resi]; - (h == "maybesheet" || h == "s") && (o[w.chain][w.resi] = "s", o[s.chain][s.resi] = "s"); + if (x = l[A], isFinite(x.hbondDistanceSq) && c[x.chain][x.resi] == "maybesheet") { + let s = x.hbondOther, u = c[s.chain][s.resi]; + (u == "maybesheet" || u == "s") && (c[x.chain][x.resi] = "s", c[s.chain][s.resi] = "s"); } - for (let A in o) { - for (let f = 1; f < o[A].length - 1; f++) { - const s = o[A][f - 1], h = o[A][f + 1]; - b = o[A][f], s == "s" && s == h && b != s && (o[A][f] = s); + for (let A in c) { + for (let f = 1; f < c[A].length - 1; f++) { + const s = c[A][f - 1], u = c[A][f + 1]; + b = c[A][f], s == "s" && s == u && b != s && (c[A][f] = s); } - for (let f = 0; f < o[A].length; f++) { - const s = o[A][f]; - (s == "h" || s == "s") && o[A][f - 1] != s && o[A][f + 1] != s && delete o[A][f]; + for (let f = 0; f < c[A].length; f++) { + const s = c[A][f]; + (s == "h" || s == "s") && c[A][f - 1] != s && c[A][f + 1] != s && delete c[A][f]; } } - for (u = 0, p = l.length; u < p; u++) - w = l[u], b = o[w.chain][w.resi], delete w.hbondOther, delete w.hbondDistanceSq, !(b === void 0 || b === "maybesheet") && (w.ss = b, o[w.chain][w.resi - 1] != b && (w.ssbegin = !0), o[w.chain][w.resi + 1] != b && (w.ssend = !0)); + for (d = 0, _ = l.length; d < _; d++) + x = l[d], b = c[x.chain][x.resi], delete x.hbondOther, delete x.hbondDistanceSq, !(b === void 0 || b === "maybesheet") && (x.ss = b, c[x.chain][x.resi - 1] != b && (x.ssbegin = !0), c[x.chain][x.resi + 1] != b && (x.ssend = !0)); } } ), @@ -35516,116 +35516,116 @@ ATOM`, x); ), l = t( /*! ./bondLength */ "./src/parsers/utils/bondLength.ts" - ), d = t( + ), h = t( /*! ./computeSecondaryStructure */ "./src/parsers/utils/computeSecondaryStructure.ts" - ), o = t( + ), c = t( /*! ./isEmpty */ "./src/parsers/utils/isEmpty.ts" - ), u = t( + ), d = t( /*! ./processSymmetries */ "./src/parsers/utils/processSymmetries.ts" - ), p = t( + ), _ = t( /*! ./assignPDBBonds */ "./src/parsers/utils/assignPDBBonds.ts" ), m = t( /*! ./validateBonds */ "./src/parsers/utils/validateBonds.ts" ); - function y(w, b, A) { - const f = [], s = b.assignBonds === void 0 ? !0 : b.assignBonds, h = !b.keepH, _ = !!b.noSecondaryStructure, g = !b.noComputeSecondaryStructure, x = !b.doAssembly, c = b.altLoc ? b.altLoc : "A", v = { symmetries: [], cryst: void 0 }; + function y(x, b, A) { + const f = [], s = b.assignBonds === void 0 ? !0 : b.assignBonds, u = !b.keepH, p = !!b.noSecondaryStructure, g = !b.noComputeSecondaryStructure, w = !b.doAssembly, o = b.altLoc ? b.altLoc : "A", v = { symmetries: [], cryst: void 0 }; let M, E = []; const $ = []; let k; const L = {}; - for (let z = 0; z < w.length; z++) { - k = w[z].replace(/^\s*/, ""); + for (let z = 0; z < x.length; z++) { + k = x[z].replace(/^\s*/, ""); const O = k.substring(0, 6); - let R, P, U; + let R, N, W; if (O.indexOf("END") === 0) { - if (E = w.slice(z + 1), O === "END") + if (E = x.slice(z + 1), O === "END") for (const B in A) A.hasOwnProperty(B) && delete A[B]; break; } else if (O === "ATOM " || O === "HETATM") { - let B, N, G, H, W, V, re, ie, ee, ce, he, le; - if (he = k.substring(16, 17), he !== " " && he !== c && c !== "*" || (ce = parseInt(k.substring(6, 11)), M = k.substring(12, 16).replace(/ /g, ""), B = k.substring(17, 20).replace(/ /g, ""), N = k.substring(21, 22), G = parseInt(k.substring(22, 26)), H = k.substring(26, 27), W = parseFloat(k.substring(30, 38)), V = parseFloat(k.substring(38, 46)), re = parseFloat(k.substring(46, 54)), le = parseFloat(k.substring(60, 68)), ee = k.substring(76, 78).replace(/ /g, ""), ee === "" || l.bondTable[ee] === void 0 ? ee = (0, a.atomNameToElem)(k.substring(12, 14), k[0] == "A") : ee = ee[0].toUpperCase() + ee.substring(1).toLowerCase(), ee === "H" && h)) + let B, P, G, H, U, j, re, ie, te, ue, de, oe; + if (de = k.substring(16, 17), de !== " " && de !== o && o !== "*" || (ue = parseInt(k.substring(6, 11)), M = k.substring(12, 16).replace(/ /g, ""), B = k.substring(17, 20).replace(/ /g, ""), P = k.substring(21, 22), G = parseInt(k.substring(22, 26)), H = k.substring(26, 27), U = parseFloat(k.substring(30, 38)), j = parseFloat(k.substring(38, 46)), re = parseFloat(k.substring(46, 54)), oe = parseFloat(k.substring(60, 68)), te = k.substring(76, 78).replace(/ /g, ""), te === "" || l.bondTable[te] === void 0 ? te = (0, a.atomNameToElem)(k.substring(12, 14), k[0] == "A") : te = te[0].toUpperCase() + te.substring(1).toLowerCase(), te === "H" && u)) continue; - O[0] == "H" ? ie = !0 : ie = !1, $[ce] = f.length, f.push({ + O[0] == "H" ? ie = !0 : ie = !1, $[ue] = f.length, f.push({ resn: B, - x: W, - y: V, + x: U, + y: j, z: re, - elem: ee, + elem: te, hetflag: ie, - altLoc: he, - chain: N, + altLoc: de, + chain: P, resi: G, icode: H, rescode: G + (H !== " " ? "^" + H : ""), // resi // and // icode - serial: ce, + serial: ue, atom: M, bonds: [], ss: "c", bondOrder: [], properties: {}, - b: le, + b: oe, pdbline: k }); } else if (O === "SHEET ") { - R = k.substring(21, 22), P = parseInt(k.substring(22, 26)), U = parseInt(k.substring(33, 37)), R in A || (A[R] = {}), A[R][P] = "s1"; - for (let B = P + 1; B < U; B++) + R = k.substring(21, 22), N = parseInt(k.substring(22, 26)), W = parseInt(k.substring(33, 37)), R in A || (A[R] = {}), A[R][N] = "s1"; + for (let B = N + 1; B < W; B++) A[R][B] = "s"; - A[R][U] = "s2"; + A[R][W] = "s2"; } else if (O === "CONECT") { - const B = parseInt(k.substring(6, 11)), N = $[B], G = f[N], H = [11, 16, 21, 26]; - for (let W = 0; W < 4; W++) { - const V = parseInt(k.substring(H[W], H[W] + 5)), re = $[V]; - let ie = N + ":" + re; - const ee = f[re]; - if (G !== void 0 && ee !== void 0) + const B = parseInt(k.substring(6, 11)), P = $[B], G = f[P], H = [11, 16, 21, 26]; + for (let U = 0; U < 4; U++) { + const j = parseInt(k.substring(H[U], H[U] + 5)), re = $[j]; + let ie = P + ":" + re; + const te = f[re]; + if (G !== void 0 && te !== void 0) if (!L[ie]) L[ie] = 1, (G.bonds.length == 0 || G.bonds[G.bonds.length - 1] !== re) && (G.bonds.push(re), G.bondOrder.push(1)); else { L[ie] += 1; - for (let ce = 0; ce < G.bonds.length; ce++) - if (G.bonds[ce] == re) { - const he = L[ie]; - he >= 4 ? G.bondOrder[ce] = 1 : G.bondOrder[ce] = he; + for (let ue = 0; ue < G.bonds.length; ue++) + if (G.bonds[ue] == re) { + const de = L[ie]; + de >= 4 ? G.bondOrder[ue] = 1 : G.bondOrder[ue] = de; } } } } else if (O === "HELIX ") { - R = k.substring(19, 20), P = parseInt(k.substring(21, 25)), U = parseInt(k.substring(33, 37)), R in A || (A[R] = {}), A[R][P] = "h1"; - for (let B = P + 1; B < U; B++) + R = k.substring(19, 20), N = parseInt(k.substring(21, 25)), W = parseInt(k.substring(33, 37)), R in A || (A[R] = {}), A[R][N] = "h1"; + for (let B = N + 1; B < W; B++) A[R][B] = "h"; - A[R][U] = "h2"; - } else if (!x && O === "REMARK" && k.substring(13, 18) === "BIOMT") { - let B, N = new r.Matrix4(); + A[R][W] = "h2"; + } else if (!w && O === "REMARK" && k.substring(13, 18) === "BIOMT") { + let B, P = new r.Matrix4(); for (B = 1; B <= 3; B++) - if (k = w[z].replace(/^\s*/, ""), parseInt(k.substring(18, 19)) == B) - N.elements[B - 1] = parseFloat(k.substring(23, 33)), N.elements[B - 1 + 4] = parseFloat(k.substring(33, 43)), N.elements[B - 1 + 8] = parseFloat(k.substring(43, 53)), N.elements[B - 1 + 12] = parseFloat(k.substring(53)), z++; + if (k = x[z].replace(/^\s*/, ""), parseInt(k.substring(18, 19)) == B) + P.elements[B - 1] = parseFloat(k.substring(23, 33)), P.elements[B - 1 + 4] = parseFloat(k.substring(33, 43)), P.elements[B - 1 + 8] = parseFloat(k.substring(43, 53)), P.elements[B - 1 + 12] = parseFloat(k.substring(53)), z++; else for (; k.substring(13, 18) === "BIOMT"; ) - z++, k = w[z].replace(/^\s*/, ""); - N.elements[3] = 0, N.elements[7] = 0, N.elements[11] = 0, N.elements[15] = 1, v.symmetries.push(N), z--; + z++, k = x[z].replace(/^\s*/, ""); + P.elements[3] = 0, P.elements[7] = 0, P.elements[11] = 0, P.elements[15] = 1, v.symmetries.push(P), z--; } else if (O === "CRYST1") { - let B, N, G, H, W, V; - B = parseFloat(k.substring(7, 15)), N = parseFloat(k.substring(16, 24)), G = parseFloat(k.substring(25, 33)), H = parseFloat(k.substring(34, 40)), W = parseFloat(k.substring(41, 47)), V = parseFloat(k.substring(48, 54)), v.cryst = { + let B, P, G, H, U, j; + B = parseFloat(k.substring(7, 15)), P = parseFloat(k.substring(16, 24)), G = parseFloat(k.substring(25, 33)), H = parseFloat(k.substring(34, 40)), U = parseFloat(k.substring(41, 47)), j = parseFloat(k.substring(48, 54)), v.cryst = { a: B, - b: N, + b: P, c: G, alpha: H, - beta: W, - gamma: V + beta: U, + gamma: j }; } else if (O === "ANISOU") { - const B = parseInt(k.substring(6, 11)), N = $[B], G = f[N]; + const B = parseInt(k.substring(6, 11)), P = $[B], G = f[P]; if (G) { - const H = k.substring(30).trim().split(/\s+/), W = { + const H = k.substring(30).trim().split(/\s+/), U = { u11: parseInt(H[0]), u22: parseInt(H[1]), u33: parseInt(H[2]), @@ -35633,11 +35633,11 @@ ATOM`, x); u13: parseInt(H[4]), u23: parseInt(H[5]) }; - G.uMat = W; + G.uMat = U; } } } - if ((0, m.validateBonds)(f, $), s && (0, p.assignPDBBonds)(f, b), x || (0, u.processSymmetries)(v.symmetries, f, b, v.cryst), g && !_ && (0, d.computeSecondaryStructure)(f, b.hbondCutoff), !(0, o.isEmpty)(A)) + if ((0, m.validateBonds)(f, $), s && (0, _.assignPDBBonds)(f, b), w || (0, d.processSymmetries)(v.symmetries, f, b, v.cryst), g && !p && (0, h.computeSecondaryStructure)(f, b.hbondCutoff), !(0, c.isEmpty)(A)) for (let z = 0; z < f.length; z++) { const O = f[z]; if (O !== void 0 && O.chain in A && O.resi in A[O.chain]) { @@ -35690,79 +35690,79 @@ ATOM`, x); /*! ../../WebGL */ "./src/WebGL/index.ts" ); - function a(l, d, o, u) { - const p = !o.duplicateAssemblyAtoms, m = d.length; - let y = m, w = -1, b = null, A = null; - (o.normalizeAssembly || o.wrapAtoms) && u && (b = (0, r.conversionMatrix3)(u.a, u.b, u.c, u.alpha, u.beta, u.gamma), A = new r.Matrix3(), A.getInverse3(b)); - let f = function(_) { - let g = _.clone().applyMatrix3(A); - const x = [g.x, g.y, g.z], c = [0, 0, 0]; + function a(l, h, c, d) { + const _ = !c.duplicateAssemblyAtoms, m = h.length; + let y = m, x = -1, b = null, A = null; + (c.normalizeAssembly || c.wrapAtoms) && d && (b = (0, r.conversionMatrix3)(d.a, d.b, d.c, d.alpha, d.beta, d.gamma), A = new r.Matrix3(), A.getInverse3(b)); + let f = function(p) { + let g = p.clone().applyMatrix3(A); + const w = [g.x, g.y, g.z], o = [0, 0, 0]; for (let M = 0; M < 3; M++) { - for (; x[M] < -1e-3; ) - x[M] += 1, c[M] += 1; - for (; x[M] > 1.001; ) - x[M] -= 1, c[M] -= 1; + for (; w[M] < -1e-3; ) + w[M] += 1, o[M] += 1; + for (; w[M] > 1.001; ) + w[M] -= 1, o[M] -= 1; } - const v = new r.Vector3(c[0], c[1], c[2]); + const v = new r.Vector3(o[0], o[1], o[2]); return v.applyMatrix3(b), v; }; - if (o.normalizeAssembly && u) - for (let _ = 0; _ < l.length; _++) { + if (c.normalizeAssembly && d) + for (let p = 0; p < l.length; p++) { const g = new r.Vector3(0, 0, 0); - for (let c = 0; c < m; c++) { - const v = new r.Vector3(d[c].x, d[c].y, d[c].z); - v.applyMatrix4(l[_]), g.add(v); + for (let o = 0; o < m; o++) { + const v = new r.Vector3(h[o].x, h[o].y, h[o].z); + v.applyMatrix4(l[p]), g.add(v); } g.divideScalar(m); - const x = f(g); - l[_].isNearlyIdentity() && x.lengthSq() > 1e-3 && (w = _), l[_].translate(x); + const w = f(g); + l[p].isNearlyIdentity() && w.lengthSq() > 1e-3 && (x = p), l[p].translate(w); } - if (p) { + if (_) { if (l.length > 1) - for (let _ = 0; _ < d.length; _++) { + for (let p = 0; p < h.length; p++) { var s = []; for (let g = 0; g < l.length; g++) if (!l[g].isNearlyIdentity()) { - var h = new r.Vector3(); - h.set(d[_].x, d[_].y, d[_].z), h.applyMatrix4(l[g]), s.push(h); + var u = new r.Vector3(); + u.set(h[p].x, h[p].y, h[p].z), u.applyMatrix4(l[g]), s.push(u); } - d[_].symmetries = s; + h[p].symmetries = s; } } else { - for (let _ = 0; _ < m; _++) - d[_].sym = -1; - for (let _ = 0; _ < l.length; _++) - if (!l[_].isNearlyIdentity() && w != _) { + for (let p = 0; p < m; p++) + h[p].sym = -1; + for (let p = 0; p < l.length; p++) + if (!l[p].isNearlyIdentity() && x != p) { let g = new r.Vector3(); - for (let x = 0; x < m; x++) { - const c = []; - for (let M = 0; M < d[x].bonds.length; M++) - c.push(d[x].bonds[M] + y); - if (g.set(d[x].x, d[x].y, d[x].z), g.applyMatrix4(l[_]), o.wrapAtoms && u) { + for (let w = 0; w < m; w++) { + const o = []; + for (let M = 0; M < h[w].bonds.length; M++) + o.push(h[w].bonds[M] + y); + if (g.set(h[w].x, h[w].y, h[w].z), g.applyMatrix4(l[p]), c.wrapAtoms && d) { let M = f(g); g.add(M); } const v = {}; - for (const M in d[x]) - v[M] = d[x][M]; - v.x = g.x, v.y = g.y, v.z = g.z, v.bonds = c, v.sym = _, v.index = d.length, d.push(v); + for (const M in h[w]) + v[M] = h[w][M]; + v.x = g.x, v.y = g.y, v.z = g.z, v.bonds = o, v.sym = p, v.index = h.length, h.push(v); } - y = d.length; + y = h.length; } else for (let g = 0; g < m; g++) - d[g].sym = _; - if (o.wrapAtoms && u) { - let _ = new r.Vector3(); + h[g].sym = p; + if (c.wrapAtoms && d) { + let p = new r.Vector3(); for (let g = 0; g < m; g++) { - _.set(d[g].x, d[g].y, d[g].z); - let x = f(_); - _.add(x), d[g].x = _.x, d[g].y = _.y, d[g].z = _.z; + p.set(h[g].x, h[g].y, h[g].z); + let w = f(p); + p.add(w), h[g].x = p.x, h[g].y = p.y, h[g].z = p.z; } } - if (w >= 0) { - const _ = new r.Vector3(); + if (x >= 0) { + const p = new r.Vector3(); for (let g = 0; g < m; g++) - _.set(d[g].x, d[g].y, d[g].z), _.applyMatrix4(l[w]), d[g].x = _.x, d[g].y = _.y, d[g].z = _.z; + p.set(h[g].x, h[g].y, h[g].z), p.applyMatrix4(l[x]), h[g].x = p.x, h[g].y = p.y, h[g].z = p.z; } l.length = 0; } @@ -35869,11 +35869,11 @@ ATOM`, x); /* harmony export */ }); function r(a, l) { - for (let d = 0, o = a.length; d < o; d++) { - const u = a[d]; - for (let p = 0; p < u.bonds.length; p++) { - const m = u.bonds[p], y = a[m], w = l[u.serial]; - y && w && y.bonds.indexOf(w) < 0 && (y.bonds.push(w), y.bondOrder.push(u.bondOrder[p])); + for (let h = 0, c = a.length; h < c; h++) { + const d = a[h]; + for (let _ = 0; _ < d.bonds.length; _++) { + const m = d.bonds[_], y = a[m], x = l[d.serial]; + y && x && y.bonds.indexOf(x) < 0 && (y.bonds.push(x), y.bondOrder.push(d.bondOrder[_])); } } } @@ -36068,10 +36068,10 @@ ATOM`, x); "VAL:C": 0.6, "VAL:O": -0.55 }; - function a(l, d) { - if ((!d || typeof l.partialCharge > "u") && l.resn && l.atom) { - var o = l.resn + ":" + l.atom; - l.properties.partialCharge = r[o]; + function a(l, h) { + if ((!h || typeof l.partialCharge > "u") && l.resn && l.atom) { + var c = l.resn + ":" + l.atom; + l.properties.partialCharge = r[c]; } } } @@ -36238,25 +36238,25 @@ ATOM`, x); n && (n.volformat && !(n.voldata instanceof _VolumeData__WEBPACK_IMPORTED_MODULE_1__.VolumeData) && (n.voldata = new _VolumeData__WEBPACK_IMPORTED_MODULE_1__.VolumeData(n.voldata, n.volformat)), n.volscheme && (n.volscheme = _Gradient__WEBPACK_IMPORTED_MODULE_0__.Gradient.getGradient(n.volscheme))); } function getExtent(n, e) { - var t, r, a, l, d, o, u, p, m, y, w = !e; - if (t = r = a = 9999, l = d = o = -9999, u = p = m = y = 0, n.length === 0) + var t, r, a, l, h, c, d, _, m, y, x = !e; + if (t = r = a = 9999, l = h = c = -9999, d = _ = m = y = 0, n.length === 0) return [[0, 0, 0], [0, 0, 0], [0, 0, 0]]; for (var b = 0; b < n.length; b++) { var A = n[b]; - if (!(typeof A > "u" || !isFinite(A.x) || !isFinite(A.y) || !isFinite(A.z)) && (y++, u += A.x, p += A.y, m += A.z, t = t < A.x ? t : A.x, r = r < A.y ? r : A.y, a = a < A.z ? a : A.z, l = l > A.x ? l : A.x, d = d > A.y ? d : A.y, o = o > A.z ? o : A.z, A.symmetries && w)) + if (!(typeof A > "u" || !isFinite(A.x) || !isFinite(A.y) || !isFinite(A.z)) && (y++, d += A.x, _ += A.y, m += A.z, t = t < A.x ? t : A.x, r = r < A.y ? r : A.y, a = a < A.z ? a : A.z, l = l > A.x ? l : A.x, h = h > A.y ? h : A.y, c = c > A.z ? c : A.z, A.symmetries && x)) for (var f = 0; f < A.symmetries.length; f++) - y++, u += A.symmetries[f].x, p += A.symmetries[f].y, m += A.symmetries[f].z, t = t < A.symmetries[f].x ? t : A.symmetries[f].x, r = r < A.symmetries[f].y ? r : A.symmetries[f].y, a = a < A.symmetries[f].z ? a : A.symmetries[f].z, l = l > A.symmetries[f].x ? l : A.symmetries[f].x, d = d > A.symmetries[f].y ? d : A.symmetries[f].y, o = o > A.symmetries[f].z ? o : A.symmetries[f].z; + y++, d += A.symmetries[f].x, _ += A.symmetries[f].y, m += A.symmetries[f].z, t = t < A.symmetries[f].x ? t : A.symmetries[f].x, r = r < A.symmetries[f].y ? r : A.symmetries[f].y, a = a < A.symmetries[f].z ? a : A.symmetries[f].z, l = l > A.symmetries[f].x ? l : A.symmetries[f].x, h = h > A.symmetries[f].y ? h : A.symmetries[f].y, c = c > A.symmetries[f].z ? c : A.symmetries[f].z; } return [ [t, r, a], - [l, d, o], - [u / y, p / y, m / y] + [l, h, c], + [d / y, _ / y, m / y] ]; } function getPropertyRange(n, e) { for (var t = Number.POSITIVE_INFINITY, r = Number.NEGATIVE_INFINITY, a = 0, l = n.length; a < l; a++) { - var d = n[a], o = getAtomProperty(d, e); - o != null && (o < t && (t = o), o > r && (r = o)); + var h = n[a], c = getAtomProperty(h, e); + c != null && (c < t && (t = c), c > r && (r = c)); } return !isFinite(t) && !isFinite(r) ? t = r = 0 : isFinite(t) ? isFinite(r) || (r = t) : t = r, [t, r]; } @@ -36297,21 +36297,21 @@ ATOM`, x); } catch { } n = n.replace(/%7E/g, "~"); - var e = function(w) { - return isNumeric(w) ? Math.floor(parseFloat(w)) == parseInt(w) || w.indexOf(".") >= 0 ? parseFloat(w) : parseInt(w) : w === "true" ? !0 : w === "false" ? !1 : w; + var e = function(x) { + return isNumeric(x) ? Math.floor(parseFloat(x)) == parseInt(x) || x.indexOf(".") >= 0 ? parseFloat(x) : parseInt(x) : x === "true" ? !0 : x === "false" ? !1 : x; }, t = {}; if (n === "all") return t; for (var r = n.split(";"), a = 0; a < r.length; a++) { - var l = r[a].split(":"), d = l[0], o = {}, u = l[1]; - if (u) - if (u = u.replace(/~/g, "="), u.indexOf("=") !== -1) - for (var p = u.split(","), m = 0; m < p.length; m++) { - var y = p[m].split("=", 2); - o[y[0]] = e(y[1]); + var l = r[a].split(":"), h = l[0], c = {}, d = l[1]; + if (d) + if (d = d.replace(/~/g, "="), d.indexOf("=") !== -1) + for (var _ = d.split(","), m = 0; m < _.length; m++) { + var y = _[m].split("=", 2); + c[y[0]] = e(y[1]); } - else u.indexOf(",") !== -1 ? o = u.split(",") : o = e(u); - t[d] = o; + else d.indexOf(",") !== -1 ? c = d.split(",") : c = e(d); + t[h] = c; } return t; } @@ -36329,13 +36329,13 @@ ATOM`, x); return t == "POST" ? a = fetch(n, { method: "POST", body: r }).then((l) => checkStatus(l)).then((l) => l.arrayBuffer()) : a = fetch(n).then((l) => checkStatus(l)).then((l) => l.arrayBuffer()), e ? a.then(e) : a; } function download(n, e, t, r) { - var a = "", l = "", d = "", o = null, u = e.addModel(); + var a = "", l = "", h = "", c = null, d = e.addModel(); if (n.indexOf(":") < 0 && (n.length == 4 ? n = "pdb:" + n : isNaN(n) ? n = "url:" + n : n = "cid:" + n), n.substring(0, 5) == "mmtf:" && (console.warn("WARNING: MMTF now deprecated. Reverting to bcif."), n = "bcif:" + n.slice(5)), n.substring(0, 5) === "bcif:") - n = n.substring(5).toUpperCase(), d = "https://models.rcsb.org/" + n + ".bcif.gz", t && typeof t.noComputeSecondaryStructure > "u" && (t.noComputeSecondaryStructure = !0), o = new Promise(function(m) { - getbin(d).then(function(y) { - u.addMolData(y, "bcif.gz", t), e.zoomTo(), e.render(), m(u); + n = n.substring(5).toUpperCase(), h = "https://models.rcsb.org/" + n + ".bcif.gz", t && typeof t.noComputeSecondaryStructure > "u" && (t.noComputeSecondaryStructure = !0), c = new Promise(function(m) { + getbin(h).then(function(y) { + d.addMolData(y, "bcif.gz", t), e.zoomTo(), e.render(), m(d); }, function() { - console.error("fetch of " + d + " failed."); + console.error("fetch of " + h + " failed."); }); }); else { @@ -36344,62 +36344,62 @@ ATOM`, x); alert("Wrong PDB ID"); return; } - a == "bcif" ? d = "https://models.rcsb.org/" + n.toUpperCase() + ".bcif.gz" : (l = t && t.pdbUri ? t.pdbUri : "https://files.rcsb.org/view/", d = l + n + "." + a); + a == "bcif" ? h = "https://models.rcsb.org/" + n.toUpperCase() + ".bcif.gz" : (l = t && t.pdbUri ? t.pdbUri : "https://files.rcsb.org/view/", h = l + n + "." + a); } else if (n.substring(0, 4) == "cid:") { if (a = "sdf", n = n.substring(4), !n.match(/^[0-9]+$/)) { alert("Wrong Compound ID"); return; } - d = "https://pubchem.ncbi.nlm.nih.gov/rest/pug/compound/cid/" + n + "/SDF?record_type=3d"; - } else n.substring(0, 4) == "url:" && (d = n.substring(4), a = d); - var p = function(m) { - u.addMolData(m, a, t), e.zoomTo(), e.render(); + h = "https://pubchem.ncbi.nlm.nih.gov/rest/pug/compound/cid/" + n + "/SDF?record_type=3d"; + } else n.substring(0, 4) == "url:" && (h = n.substring(4), a = h); + var _ = function(m) { + d.addMolData(m, a, t), e.zoomTo(), e.render(); }; - o = new Promise(function(m) { - a == "bcif" ? getbin(d).then(function(y) { - p(y), m(u); + c = new Promise(function(m) { + a == "bcif" ? getbin(h).then(function(y) { + _(y), m(d); }).catch(function() { - l = t && t.pdbUri ? t.pdbUri : "https://files.rcsb.org/view/", d = l + n + ".pdb", a = "pdb", console.warn("falling back to pdb format"), get(d).then(function(y) { - p(y), m(u); + l = t && t.pdbUri ? t.pdbUri : "https://files.rcsb.org/view/", h = l + n + ".pdb", a = "pdb", console.warn("falling back to pdb format"), get(h).then(function(y) { + _(y), m(d); }).catch(function(y) { - p(""), m(u), console.error("fetch of " + d + " failed: " + y.statusText); + _(""), m(d), console.error("fetch of " + h + " failed: " + y.statusText); }); - }) : get(d).then(function(y) { - p(y), m(u); + }) : get(h).then(function(y) { + _(y), m(d); }).catch(function(y) { - p(""), m(u), console.error("fetch of " + d + " failed: " + y.statusText); + _(""), m(d), console.error("fetch of " + h + " failed: " + y.statusText); }); }); } - return r ? (o.then(function(m) { + return r ? (c.then(function(m) { r(m); - }), u) : o; + }), d) : c; } function getColorFromStyle(n, e) { let t = e.colorscheme; if (typeof _colors__WEBPACK_IMPORTED_MODULE_2__.builtinColorSchemes[t] < "u") t = _colors__WEBPACK_IMPORTED_MODULE_2__.builtinColorSchemes[t]; else if (typeof t == "string" && t.endsWith("Carbon")) { - let d = t.substring(0, t.lastIndexOf("Carbon")).toLowerCase(); - if (typeof _colors__WEBPACK_IMPORTED_MODULE_2__.htmlColors[d] < "u") { - let o = Object.assign({}, _colors__WEBPACK_IMPORTED_MODULE_2__.elementColors.defaultColors); - o.C = _colors__WEBPACK_IMPORTED_MODULE_2__.htmlColors[d], _colors__WEBPACK_IMPORTED_MODULE_2__.builtinColorSchemes[t] = { prop: "elem", map: o }, t = _colors__WEBPACK_IMPORTED_MODULE_2__.builtinColorSchemes[t]; + let h = t.substring(0, t.lastIndexOf("Carbon")).toLowerCase(); + if (typeof _colors__WEBPACK_IMPORTED_MODULE_2__.htmlColors[h] < "u") { + let c = Object.assign({}, _colors__WEBPACK_IMPORTED_MODULE_2__.elementColors.defaultColors); + c.C = _colors__WEBPACK_IMPORTED_MODULE_2__.htmlColors[h], _colors__WEBPACK_IMPORTED_MODULE_2__.builtinColorSchemes[t] = { prop: "elem", map: c }, t = _colors__WEBPACK_IMPORTED_MODULE_2__.builtinColorSchemes[t]; } } let r = n.color; if (typeof e.color < "u" && e.color != "spectrum" && (r = e.color), typeof t < "u") { - let d, o; + let h, c; if (typeof _colors__WEBPACK_IMPORTED_MODULE_2__.elementColors[t] < "u") t = _colors__WEBPACK_IMPORTED_MODULE_2__.elementColors[t], typeof t[n[t.prop]] < "u" && (r = t.map[n[t.prop]]); else if (typeof t[n[t.prop]] < "u") r = t.map[n[t.prop]]; else if (typeof t.prop < "u" && typeof t.gradient < "u") { - d = t.prop; + h = t.prop; var a = t.gradient; a instanceof _Gradient__WEBPACK_IMPORTED_MODULE_0__.GradientType || (a = (0, _Gradient__WEBPACK_IMPORTED_MODULE_0__.getGradient)(t)); - let u = a.range() || [-1, 1]; - o = getAtomProperty(n, d), o != null && (r = a.valueToHex(o, u)); - } else typeof t.prop < "u" && typeof t.map < "u" ? (d = t.prop, o = getAtomProperty(n, d), typeof t.map[o] < "u" && (r = t.map[o])) : typeof e.colorscheme[n.elem] < "u" ? r = e.colorscheme[n.elem] : console.warn("Could not interpret colorscheme " + t); + let d = a.range() || [-1, 1]; + c = getAtomProperty(n, h), c != null && (r = a.valueToHex(c, d)); + } else typeof t.prop < "u" && typeof t.map < "u" ? (h = t.prop, c = getAtomProperty(n, h), typeof t.map[c] < "u" && (r = t.map[c])) : typeof e.colorscheme[n.elem] < "u" ? r = e.colorscheme[n.elem] : console.warn("Could not interpret colorscheme " + t); } else typeof e.colorfunc < "u" && (r = e.colorfunc(n)); return _colors__WEBPACK_IMPORTED_MODULE_2__.CC.color(r); } @@ -36427,552 +36427,552 @@ ATOM`, x); n.exports = r, a = t( /*! pako */ "./node_modules/upng-js/node_modules/pako/index.js" - ), function(l, d) { - l.toRGBA8 = function(o) { - var u = o.width, p = o.height; - if (o.tabs.acTL == null) return [l.toRGBA8.decodeImage(o.data, u, p, o).buffer]; + ), function(l, h) { + l.toRGBA8 = function(c) { + var d = c.width, _ = c.height; + if (c.tabs.acTL == null) return [l.toRGBA8.decodeImage(c.data, d, _, c).buffer]; var m = []; - o.frames[0].data == null && (o.frames[0].data = o.data); - for (var y, w = new Uint8Array(u * p * 4), b = 0; b < o.frames.length; b++) { - var A = o.frames[b], f = A.rect.x, s = A.rect.y, h = A.rect.width, _ = A.rect.height, g = l.toRGBA8.decodeImage(A.data, h, _, o); - if (b == 0 ? y = g : A.blend == 0 ? l._copyTile(g, h, _, y, u, p, f, s, 0) : A.blend == 1 && l._copyTile(g, h, _, y, u, p, f, s, 1), m.push(y.buffer), y = y.slice(0), A.dispose != 0) { - if (A.dispose == 1) l._copyTile(w, h, _, y, u, p, f, s, 0); + c.frames[0].data == null && (c.frames[0].data = c.data); + for (var y, x = new Uint8Array(d * _ * 4), b = 0; b < c.frames.length; b++) { + var A = c.frames[b], f = A.rect.x, s = A.rect.y, u = A.rect.width, p = A.rect.height, g = l.toRGBA8.decodeImage(A.data, u, p, c); + if (b == 0 ? y = g : A.blend == 0 ? l._copyTile(g, u, p, y, d, _, f, s, 0) : A.blend == 1 && l._copyTile(g, u, p, y, d, _, f, s, 1), m.push(y.buffer), y = y.slice(0), A.dispose != 0) { + if (A.dispose == 1) l._copyTile(x, u, p, y, d, _, f, s, 0); else if (A.dispose == 2) { - for (var x = b - 1; o.frames[x].dispose == 2; ) x--; - y = new Uint8Array(m[x]).slice(0); + for (var w = b - 1; c.frames[w].dispose == 2; ) w--; + y = new Uint8Array(m[w]).slice(0); } } } return m; - }, l.toRGBA8.decodeImage = function(o, u, p, m) { - var y = u * p, w = l.decode._getBPP(m), b = Math.ceil(u * w / 8), A = new Uint8Array(y * 4), f = new Uint32Array(A.buffer), s = m.ctype, h = m.depth, _ = l._bin.readUshort; + }, l.toRGBA8.decodeImage = function(c, d, _, m) { + var y = d * _, x = l.decode._getBPP(m), b = Math.ceil(d * x / 8), A = new Uint8Array(y * 4), f = new Uint32Array(A.buffer), s = m.ctype, u = m.depth, p = l._bin.readUshort; if (s == 6) { var g = y << 2; - if (h == 8) for (var x = 0; x < g; x++) - A[x] = o[x]; - if (h == 16) for (var x = 0; x < g; x++) - A[x] = o[x << 1]; + if (u == 8) for (var w = 0; w < g; w++) + A[w] = c[w]; + if (u == 16) for (var w = 0; w < g; w++) + A[w] = c[w << 1]; } else if (s == 2) { - var c = m.tabs.tRNS, v = -1, M = -1, E = -1; - if (c && (v = c[0], M = c[1], E = c[2]), h == 8) for (var x = 0; x < y; x++) { - var $ = x << 2, k = x * 3; - A[$] = o[k], A[$ + 1] = o[k + 1], A[$ + 2] = o[k + 2], A[$ + 3] = 255, v != -1 && o[k] == v && o[k + 1] == M && o[k + 2] == E && (A[$ + 3] = 0); + var o = m.tabs.tRNS, v = -1, M = -1, E = -1; + if (o && (v = o[0], M = o[1], E = o[2]), u == 8) for (var w = 0; w < y; w++) { + var $ = w << 2, k = w * 3; + A[$] = c[k], A[$ + 1] = c[k + 1], A[$ + 2] = c[k + 2], A[$ + 3] = 255, v != -1 && c[k] == v && c[k + 1] == M && c[k + 2] == E && (A[$ + 3] = 0); } - if (h == 16) for (var x = 0; x < y; x++) { - var $ = x << 2, k = x * 6; - A[$] = o[k], A[$ + 1] = o[k + 2], A[$ + 2] = o[k + 4], A[$ + 3] = 255, v != -1 && _(o, k) == v && _(o, k + 2) == M && _(o, k + 4) == E && (A[$ + 3] = 0); + if (u == 16) for (var w = 0; w < y; w++) { + var $ = w << 2, k = w * 6; + A[$] = c[k], A[$ + 1] = c[k + 2], A[$ + 2] = c[k + 4], A[$ + 3] = 255, v != -1 && p(c, k) == v && p(c, k + 2) == M && p(c, k + 4) == E && (A[$ + 3] = 0); } } else if (s == 3) { var L = m.tabs.PLTE, z = m.tabs.tRNS, O = z ? z.length : 0; - if (h == 1) for (var R = 0; R < p; R++) - for (var P = R * b, U = R * u, x = 0; x < u; x++) { - var $ = U + x << 2, B = o[P + (x >> 3)] >> 7 - ((x & 7) << 0) & 1, N = 3 * B; - A[$] = L[N], A[$ + 1] = L[N + 1], A[$ + 2] = L[N + 2], A[$ + 3] = B < O ? z[B] : 255; + if (u == 1) for (var R = 0; R < _; R++) + for (var N = R * b, W = R * d, w = 0; w < d; w++) { + var $ = W + w << 2, B = c[N + (w >> 3)] >> 7 - ((w & 7) << 0) & 1, P = 3 * B; + A[$] = L[P], A[$ + 1] = L[P + 1], A[$ + 2] = L[P + 2], A[$ + 3] = B < O ? z[B] : 255; } - if (h == 2) for (var R = 0; R < p; R++) - for (var P = R * b, U = R * u, x = 0; x < u; x++) { - var $ = U + x << 2, B = o[P + (x >> 2)] >> 6 - ((x & 3) << 1) & 3, N = 3 * B; - A[$] = L[N], A[$ + 1] = L[N + 1], A[$ + 2] = L[N + 2], A[$ + 3] = B < O ? z[B] : 255; + if (u == 2) for (var R = 0; R < _; R++) + for (var N = R * b, W = R * d, w = 0; w < d; w++) { + var $ = W + w << 2, B = c[N + (w >> 2)] >> 6 - ((w & 3) << 1) & 3, P = 3 * B; + A[$] = L[P], A[$ + 1] = L[P + 1], A[$ + 2] = L[P + 2], A[$ + 3] = B < O ? z[B] : 255; } - if (h == 4) for (var R = 0; R < p; R++) - for (var P = R * b, U = R * u, x = 0; x < u; x++) { - var $ = U + x << 2, B = o[P + (x >> 1)] >> 4 - ((x & 1) << 2) & 15, N = 3 * B; - A[$] = L[N], A[$ + 1] = L[N + 1], A[$ + 2] = L[N + 2], A[$ + 3] = B < O ? z[B] : 255; + if (u == 4) for (var R = 0; R < _; R++) + for (var N = R * b, W = R * d, w = 0; w < d; w++) { + var $ = W + w << 2, B = c[N + (w >> 1)] >> 4 - ((w & 1) << 2) & 15, P = 3 * B; + A[$] = L[P], A[$ + 1] = L[P + 1], A[$ + 2] = L[P + 2], A[$ + 3] = B < O ? z[B] : 255; } - if (h == 8) for (var x = 0; x < y; x++) { - var $ = x << 2, B = o[x], N = 3 * B; - A[$] = L[N], A[$ + 1] = L[N + 1], A[$ + 2] = L[N + 2], A[$ + 3] = B < O ? z[B] : 255; + if (u == 8) for (var w = 0; w < y; w++) { + var $ = w << 2, B = c[w], P = 3 * B; + A[$] = L[P], A[$ + 1] = L[P + 1], A[$ + 2] = L[P + 2], A[$ + 3] = B < O ? z[B] : 255; } } else if (s == 4) { - if (h == 8) for (var x = 0; x < y; x++) { - var $ = x << 2, G = x << 1, H = o[G]; - A[$] = H, A[$ + 1] = H, A[$ + 2] = H, A[$ + 3] = o[G + 1]; + if (u == 8) for (var w = 0; w < y; w++) { + var $ = w << 2, G = w << 1, H = c[G]; + A[$] = H, A[$ + 1] = H, A[$ + 2] = H, A[$ + 3] = c[G + 1]; } - if (h == 16) for (var x = 0; x < y; x++) { - var $ = x << 2, G = x << 2, H = o[G]; - A[$] = H, A[$ + 1] = H, A[$ + 2] = H, A[$ + 3] = o[G + 2]; + if (u == 16) for (var w = 0; w < y; w++) { + var $ = w << 2, G = w << 2, H = c[G]; + A[$] = H, A[$ + 1] = H, A[$ + 2] = H, A[$ + 3] = c[G + 2]; } } else if (s == 0) { var v = m.tabs.tRNS ? m.tabs.tRNS : -1; - if (h == 1) for (var x = 0; x < y; x++) { - var H = 255 * (o[x >> 3] >> 7 - (x & 7) & 1), W = H == v * 255 ? 0 : 255; - f[x] = W << 24 | H << 16 | H << 8 | H; + if (u == 1) for (var w = 0; w < y; w++) { + var H = 255 * (c[w >> 3] >> 7 - (w & 7) & 1), U = H == v * 255 ? 0 : 255; + f[w] = U << 24 | H << 16 | H << 8 | H; } - if (h == 2) for (var x = 0; x < y; x++) { - var H = 85 * (o[x >> 2] >> 6 - ((x & 3) << 1) & 3), W = H == v * 85 ? 0 : 255; - f[x] = W << 24 | H << 16 | H << 8 | H; + if (u == 2) for (var w = 0; w < y; w++) { + var H = 85 * (c[w >> 2] >> 6 - ((w & 3) << 1) & 3), U = H == v * 85 ? 0 : 255; + f[w] = U << 24 | H << 16 | H << 8 | H; } - if (h == 4) for (var x = 0; x < y; x++) { - var H = 17 * (o[x >> 1] >> 4 - ((x & 1) << 2) & 15), W = H == v * 17 ? 0 : 255; - f[x] = W << 24 | H << 16 | H << 8 | H; + if (u == 4) for (var w = 0; w < y; w++) { + var H = 17 * (c[w >> 1] >> 4 - ((w & 1) << 2) & 15), U = H == v * 17 ? 0 : 255; + f[w] = U << 24 | H << 16 | H << 8 | H; } - if (h == 8) for (var x = 0; x < y; x++) { - var H = o[x], W = H == v ? 0 : 255; - f[x] = W << 24 | H << 16 | H << 8 | H; + if (u == 8) for (var w = 0; w < y; w++) { + var H = c[w], U = H == v ? 0 : 255; + f[w] = U << 24 | H << 16 | H << 8 | H; } - if (h == 16) for (var x = 0; x < y; x++) { - var H = o[x << 1], W = _(o, x << 1) == v ? 0 : 255; - f[x] = W << 24 | H << 16 | H << 8 | H; + if (u == 16) for (var w = 0; w < y; w++) { + var H = c[w << 1], U = p(c, w << 1) == v ? 0 : 255; + f[w] = U << 24 | H << 16 | H << 8 | H; } } return A; - }, l.decode = function(o) { - for (var u = new Uint8Array(o), p = 8, m = l._bin, y = m.readUshort, w = m.readUint, b = { tabs: {}, frames: [] }, A = new Uint8Array(u.length), f = 0, s, h = 0, _ = [137, 80, 78, 71, 13, 10, 26, 10], g = 0; g < 8; g++) if (u[g] != _[g]) throw "The input is not a PNG file!"; - for (; p < u.length; ) { - var x = m.readUint(u, p); - p += 4; - var c = m.readASCII(u, p, 4); - if (p += 4, c == "IHDR") - l.decode._IHDR(u, p, b); - else if (c == "IDAT") { - for (var g = 0; g < x; g++) A[f + g] = u[p + g]; - f += x; - } else if (c == "acTL") - b.tabs[c] = { num_frames: w(u, p), num_plays: w(u, p + 4) }, s = new Uint8Array(u.length); - else if (c == "fcTL") { - if (h != 0) { + }, l.decode = function(c) { + for (var d = new Uint8Array(c), _ = 8, m = l._bin, y = m.readUshort, x = m.readUint, b = { tabs: {}, frames: [] }, A = new Uint8Array(d.length), f = 0, s, u = 0, p = [137, 80, 78, 71, 13, 10, 26, 10], g = 0; g < 8; g++) if (d[g] != p[g]) throw "The input is not a PNG file!"; + for (; _ < d.length; ) { + var w = m.readUint(d, _); + _ += 4; + var o = m.readASCII(d, _, 4); + if (_ += 4, o == "IHDR") + l.decode._IHDR(d, _, b); + else if (o == "IDAT") { + for (var g = 0; g < w; g++) A[f + g] = d[_ + g]; + f += w; + } else if (o == "acTL") + b.tabs[o] = { num_frames: x(d, _), num_plays: x(d, _ + 4) }, s = new Uint8Array(d.length); + else if (o == "fcTL") { + if (u != 0) { var v = b.frames[b.frames.length - 1]; - v.data = l.decode._decompress(b, s.slice(0, h), v.rect.width, v.rect.height), h = 0; + v.data = l.decode._decompress(b, s.slice(0, u), v.rect.width, v.rect.height), u = 0; } - var M = { x: w(u, p + 12), y: w(u, p + 16), width: w(u, p + 4), height: w(u, p + 8) }, E = y(u, p + 22); - E = y(u, p + 20) / (E == 0 ? 100 : E); - var $ = { rect: M, delay: Math.round(E * 1e3), dispose: u[p + 24], blend: u[p + 25] }; + var M = { x: x(d, _ + 12), y: x(d, _ + 16), width: x(d, _ + 4), height: x(d, _ + 8) }, E = y(d, _ + 22); + E = y(d, _ + 20) / (E == 0 ? 100 : E); + var $ = { rect: M, delay: Math.round(E * 1e3), dispose: d[_ + 24], blend: d[_ + 25] }; b.frames.push($); - } else if (c == "fdAT") { - for (var g = 0; g < x - 4; g++) s[h + g] = u[p + g + 4]; - h += x - 4; - } else if (c == "pHYs") - b.tabs[c] = [m.readUint(u, p), m.readUint(u, p + 4), u[p + 8]]; - else if (c == "cHRM") { - b.tabs[c] = []; - for (var g = 0; g < 8; g++) b.tabs[c].push(m.readUint(u, p + g * 4)); - } else if (c == "tEXt") { - b.tabs[c] == null && (b.tabs[c] = {}); - var k = m.nextZero(u, p), L = m.readASCII(u, p, k - p), z = m.readASCII(u, k + 1, p + x - k - 1); - b.tabs[c][L] = z; - } else if (c == "iTXt") { - b.tabs[c] == null && (b.tabs[c] = {}); - var k = 0, O = p; - k = m.nextZero(u, O); - var L = m.readASCII(u, O, k - O); - O = k + 1, u[O], u[O + 1], O += 2, k = m.nextZero(u, O), m.readASCII(u, O, k - O), O = k + 1, k = m.nextZero(u, O), m.readUTF8(u, O, k - O), O = k + 1; - var z = m.readUTF8(u, O, x - (O - p)); - b.tabs[c][L] = z; - } else if (c == "PLTE") - b.tabs[c] = m.readBytes(u, p, x); - else if (c == "hIST") { + } else if (o == "fdAT") { + for (var g = 0; g < w - 4; g++) s[u + g] = d[_ + g + 4]; + u += w - 4; + } else if (o == "pHYs") + b.tabs[o] = [m.readUint(d, _), m.readUint(d, _ + 4), d[_ + 8]]; + else if (o == "cHRM") { + b.tabs[o] = []; + for (var g = 0; g < 8; g++) b.tabs[o].push(m.readUint(d, _ + g * 4)); + } else if (o == "tEXt") { + b.tabs[o] == null && (b.tabs[o] = {}); + var k = m.nextZero(d, _), L = m.readASCII(d, _, k - _), z = m.readASCII(d, k + 1, _ + w - k - 1); + b.tabs[o][L] = z; + } else if (o == "iTXt") { + b.tabs[o] == null && (b.tabs[o] = {}); + var k = 0, O = _; + k = m.nextZero(d, O); + var L = m.readASCII(d, O, k - O); + O = k + 1, d[O], d[O + 1], O += 2, k = m.nextZero(d, O), m.readASCII(d, O, k - O), O = k + 1, k = m.nextZero(d, O), m.readUTF8(d, O, k - O), O = k + 1; + var z = m.readUTF8(d, O, w - (O - _)); + b.tabs[o][L] = z; + } else if (o == "PLTE") + b.tabs[o] = m.readBytes(d, _, w); + else if (o == "hIST") { var R = b.tabs.PLTE.length / 3; - b.tabs[c] = []; - for (var g = 0; g < R; g++) b.tabs[c].push(y(u, p + g * 2)); - } else if (c == "tRNS") - b.ctype == 3 ? b.tabs[c] = m.readBytes(u, p, x) : b.ctype == 0 ? b.tabs[c] = y(u, p) : b.ctype == 2 && (b.tabs[c] = [y(u, p), y(u, p + 2), y(u, p + 4)]); - else if (c == "gAMA") b.tabs[c] = m.readUint(u, p) / 1e5; - else if (c == "sRGB") b.tabs[c] = u[p]; - else if (c == "bKGD") - b.ctype == 0 || b.ctype == 4 ? b.tabs[c] = [y(u, p)] : b.ctype == 2 || b.ctype == 6 ? b.tabs[c] = [y(u, p), y(u, p + 2), y(u, p + 4)] : b.ctype == 3 && (b.tabs[c] = u[p]); - else if (c == "IEND") { - if (h != 0) { + b.tabs[o] = []; + for (var g = 0; g < R; g++) b.tabs[o].push(y(d, _ + g * 2)); + } else if (o == "tRNS") + b.ctype == 3 ? b.tabs[o] = m.readBytes(d, _, w) : b.ctype == 0 ? b.tabs[o] = y(d, _) : b.ctype == 2 && (b.tabs[o] = [y(d, _), y(d, _ + 2), y(d, _ + 4)]); + else if (o == "gAMA") b.tabs[o] = m.readUint(d, _) / 1e5; + else if (o == "sRGB") b.tabs[o] = d[_]; + else if (o == "bKGD") + b.ctype == 0 || b.ctype == 4 ? b.tabs[o] = [y(d, _)] : b.ctype == 2 || b.ctype == 6 ? b.tabs[o] = [y(d, _), y(d, _ + 2), y(d, _ + 4)] : b.ctype == 3 && (b.tabs[o] = d[_]); + else if (o == "IEND") { + if (u != 0) { var v = b.frames[b.frames.length - 1]; - v.data = l.decode._decompress(b, s.slice(0, h), v.rect.width, v.rect.height), h = 0; + v.data = l.decode._decompress(b, s.slice(0, u), v.rect.width, v.rect.height), u = 0; } b.data = l.decode._decompress(b, A, b.width, b.height); break; } - p += x, m.readUint(u, p), p += 4; + _ += w, m.readUint(d, _), _ += 4; } return delete b.compress, delete b.interlace, delete b.filter, b; - }, l.decode._decompress = function(o, u, p, m) { - return o.compress == 0 && (u = l.decode._inflate(u)), o.interlace == 0 ? u = l.decode._filterZero(u, o, 0, p, m) : o.interlace == 1 && (u = l.decode._readInterlace(u, o)), u; - }, l.decode._inflate = function(o) { - return d.inflate(o); - }, l.decode._readInterlace = function(o, u) { - for (var p = u.width, m = u.height, y = l.decode._getBPP(u), w = y >> 3, b = Math.ceil(p * y / 8), A = new Uint8Array(m * b), f = 0, s = [0, 0, 4, 0, 2, 0, 1], h = [0, 4, 0, 2, 0, 1, 0], _ = [8, 8, 8, 4, 4, 2, 2], g = [8, 8, 4, 4, 2, 2, 1], x = 0; x < 7; ) { - for (var c = _[x], v = g[x], M = 0, E = 0, $ = s[x]; $ < m; ) - $ += c, E++; - for (var k = h[x]; k < p; ) + }, l.decode._decompress = function(c, d, _, m) { + return c.compress == 0 && (d = l.decode._inflate(d)), c.interlace == 0 ? d = l.decode._filterZero(d, c, 0, _, m) : c.interlace == 1 && (d = l.decode._readInterlace(d, c)), d; + }, l.decode._inflate = function(c) { + return h.inflate(c); + }, l.decode._readInterlace = function(c, d) { + for (var _ = d.width, m = d.height, y = l.decode._getBPP(d), x = y >> 3, b = Math.ceil(_ * y / 8), A = new Uint8Array(m * b), f = 0, s = [0, 0, 4, 0, 2, 0, 1], u = [0, 4, 0, 2, 0, 1, 0], p = [8, 8, 8, 4, 4, 2, 2], g = [8, 8, 4, 4, 2, 2, 1], w = 0; w < 7; ) { + for (var o = p[w], v = g[w], M = 0, E = 0, $ = s[w]; $ < m; ) + $ += o, E++; + for (var k = u[w]; k < _; ) k += v, M++; var L = Math.ceil(M * y / 8); - l.decode._filterZero(o, u, f, M, E); - for (var z = 0, O = s[x]; O < m; ) { - for (var R = h[x], P = f + z * L << 3; R < p; ) { + l.decode._filterZero(c, d, f, M, E); + for (var z = 0, O = s[w]; O < m; ) { + for (var R = u[w], N = f + z * L << 3; R < _; ) { if (y == 1) { - var U = o[P >> 3]; - U = U >> 7 - (P & 7) & 1, A[O * b + (R >> 3)] |= U << 7 - ((R & 3) << 0); + var W = c[N >> 3]; + W = W >> 7 - (N & 7) & 1, A[O * b + (R >> 3)] |= W << 7 - ((R & 3) << 0); } if (y == 2) { - var U = o[P >> 3]; - U = U >> 6 - (P & 7) & 3, A[O * b + (R >> 2)] |= U << 6 - ((R & 3) << 1); + var W = c[N >> 3]; + W = W >> 6 - (N & 7) & 3, A[O * b + (R >> 2)] |= W << 6 - ((R & 3) << 1); } if (y == 4) { - var U = o[P >> 3]; - U = U >> 4 - (P & 7) & 15, A[O * b + (R >> 1)] |= U << 4 - ((R & 1) << 2); + var W = c[N >> 3]; + W = W >> 4 - (N & 7) & 15, A[O * b + (R >> 1)] |= W << 4 - ((R & 1) << 2); } if (y >= 8) - for (var B = O * b + R * w, N = 0; N < w; N++) A[B + N] = o[(P >> 3) + N]; - P += y, R += v; + for (var B = O * b + R * x, P = 0; P < x; P++) A[B + P] = c[(N >> 3) + P]; + N += y, R += v; } - z++, O += c; + z++, O += o; } - M * E != 0 && (f += E * (1 + L)), x = x + 1; + M * E != 0 && (f += E * (1 + L)), w = w + 1; } return A; - }, l.decode._getBPP = function(o) { - var u = [1, null, 3, 1, 2, null, 4][o.ctype]; - return u * o.depth; - }, l.decode._filterZero = function(o, u, p, m, y) { - var w = l.decode._getBPP(u), b = Math.ceil(m * w / 8), A = l.decode._paeth; - w = Math.ceil(w / 8); + }, l.decode._getBPP = function(c) { + var d = [1, null, 3, 1, 2, null, 4][c.ctype]; + return d * c.depth; + }, l.decode._filterZero = function(c, d, _, m, y) { + var x = l.decode._getBPP(d), b = Math.ceil(m * x / 8), A = l.decode._paeth; + x = Math.ceil(x / 8); for (var f = 0; f < y; f++) { - var s = p + f * b, h = s + f + 1, _ = o[h - 1]; - if (_ == 0) for (var g = 0; g < b; g++) o[s + g] = o[h + g]; - else if (_ == 1) { - for (var g = 0; g < w; g++) o[s + g] = o[h + g]; - for (var g = w; g < b; g++) o[s + g] = o[h + g] + o[s + g - w] & 255; + var s = _ + f * b, u = s + f + 1, p = c[u - 1]; + if (p == 0) for (var g = 0; g < b; g++) c[s + g] = c[u + g]; + else if (p == 1) { + for (var g = 0; g < x; g++) c[s + g] = c[u + g]; + for (var g = x; g < b; g++) c[s + g] = c[u + g] + c[s + g - x] & 255; } else if (f == 0) { - for (var g = 0; g < w; g++) o[s + g] = o[h + g]; - if (_ == 2) for (var g = w; g < b; g++) o[s + g] = o[h + g] & 255; - if (_ == 3) for (var g = w; g < b; g++) o[s + g] = o[h + g] + (o[s + g - w] >> 1) & 255; - if (_ == 4) for (var g = w; g < b; g++) o[s + g] = o[h + g] + A(o[s + g - w], 0, 0) & 255; + for (var g = 0; g < x; g++) c[s + g] = c[u + g]; + if (p == 2) for (var g = x; g < b; g++) c[s + g] = c[u + g] & 255; + if (p == 3) for (var g = x; g < b; g++) c[s + g] = c[u + g] + (c[s + g - x] >> 1) & 255; + if (p == 4) for (var g = x; g < b; g++) c[s + g] = c[u + g] + A(c[s + g - x], 0, 0) & 255; } else { - if (_ == 2) - for (var g = 0; g < b; g++) o[s + g] = o[h + g] + o[s + g - b] & 255; - if (_ == 3) { - for (var g = 0; g < w; g++) o[s + g] = o[h + g] + (o[s + g - b] >> 1) & 255; - for (var g = w; g < b; g++) o[s + g] = o[h + g] + (o[s + g - b] + o[s + g - w] >> 1) & 255; + if (p == 2) + for (var g = 0; g < b; g++) c[s + g] = c[u + g] + c[s + g - b] & 255; + if (p == 3) { + for (var g = 0; g < x; g++) c[s + g] = c[u + g] + (c[s + g - b] >> 1) & 255; + for (var g = x; g < b; g++) c[s + g] = c[u + g] + (c[s + g - b] + c[s + g - x] >> 1) & 255; } - if (_ == 4) { - for (var g = 0; g < w; g++) o[s + g] = o[h + g] + A(0, o[s + g - b], 0) & 255; - for (var g = w; g < b; g++) o[s + g] = o[h + g] + A(o[s + g - w], o[s + g - b], o[s + g - w - b]) & 255; + if (p == 4) { + for (var g = 0; g < x; g++) c[s + g] = c[u + g] + A(0, c[s + g - b], 0) & 255; + for (var g = x; g < b; g++) c[s + g] = c[u + g] + A(c[s + g - x], c[s + g - b], c[s + g - x - b]) & 255; } } } - return o; - }, l.decode._paeth = function(o, u, p) { - var m = o + u - p, y = Math.abs(m - o), w = Math.abs(m - u), b = Math.abs(m - p); - return y <= w && y <= b ? o : w <= b ? u : p; - }, l.decode._IHDR = function(o, u, p) { + return c; + }, l.decode._paeth = function(c, d, _) { + var m = c + d - _, y = Math.abs(m - c), x = Math.abs(m - d), b = Math.abs(m - _); + return y <= x && y <= b ? c : x <= b ? d : _; + }, l.decode._IHDR = function(c, d, _) { var m = l._bin; - p.width = m.readUint(o, u), u += 4, p.height = m.readUint(o, u), u += 4, p.depth = o[u], u++, p.ctype = o[u], u++, p.compress = o[u], u++, p.filter = o[u], u++, p.interlace = o[u], u++; + _.width = m.readUint(c, d), d += 4, _.height = m.readUint(c, d), d += 4, _.depth = c[d], d++, _.ctype = c[d], d++, _.compress = c[d], d++, _.filter = c[d], d++, _.interlace = c[d], d++; }, l._bin = { - nextZero: function(o, u) { - for (; o[u] != 0; ) u++; - return u; + nextZero: function(c, d) { + for (; c[d] != 0; ) d++; + return d; }, - readUshort: function(o, u) { - return o[u] << 8 | o[u + 1]; + readUshort: function(c, d) { + return c[d] << 8 | c[d + 1]; }, - writeUshort: function(o, u, p) { - o[u] = p >> 8 & 255, o[u + 1] = p & 255; + writeUshort: function(c, d, _) { + c[d] = _ >> 8 & 255, c[d + 1] = _ & 255; }, - readUint: function(o, u) { - return o[u] * 16777216 + (o[u + 1] << 16 | o[u + 2] << 8 | o[u + 3]); + readUint: function(c, d) { + return c[d] * 16777216 + (c[d + 1] << 16 | c[d + 2] << 8 | c[d + 3]); }, - writeUint: function(o, u, p) { - o[u] = p >> 24 & 255, o[u + 1] = p >> 16 & 255, o[u + 2] = p >> 8 & 255, o[u + 3] = p & 255; + writeUint: function(c, d, _) { + c[d] = _ >> 24 & 255, c[d + 1] = _ >> 16 & 255, c[d + 2] = _ >> 8 & 255, c[d + 3] = _ & 255; }, - readASCII: function(o, u, p) { - for (var m = "", y = 0; y < p; y++) m += String.fromCharCode(o[u + y]); + readASCII: function(c, d, _) { + for (var m = "", y = 0; y < _; y++) m += String.fromCharCode(c[d + y]); return m; }, - writeASCII: function(o, u, p) { - for (var m = 0; m < p.length; m++) o[u + m] = p.charCodeAt(m); + writeASCII: function(c, d, _) { + for (var m = 0; m < _.length; m++) c[d + m] = _.charCodeAt(m); }, - readBytes: function(o, u, p) { - for (var m = [], y = 0; y < p; y++) m.push(o[u + y]); + readBytes: function(c, d, _) { + for (var m = [], y = 0; y < _; y++) m.push(c[d + y]); return m; }, - pad: function(o) { - return o.length < 2 ? "0" + o : o; + pad: function(c) { + return c.length < 2 ? "0" + c : c; }, - readUTF8: function(o, u, p) { - for (var m = "", y, w = 0; w < p; w++) m += "%" + l._bin.pad(o[u + w].toString(16)); + readUTF8: function(c, d, _) { + for (var m = "", y, x = 0; x < _; x++) m += "%" + l._bin.pad(c[d + x].toString(16)); try { y = decodeURIComponent(m); } catch { - return l._bin.readASCII(o, u, p); + return l._bin.readASCII(c, d, _); } return y; } - }, l._copyTile = function(o, u, p, m, y, w, b, A, f) { - for (var s = Math.min(u, y), h = Math.min(p, w), _ = 0, g = 0, x = 0; x < h; x++) - for (var c = 0; c < s; c++) - if (b >= 0 && A >= 0 ? (_ = x * u + c << 2, g = (A + x) * y + b + c << 2) : (_ = (-A + x) * u - b + c << 2, g = x * y + c << 2), f == 0) - m[g] = o[_], m[g + 1] = o[_ + 1], m[g + 2] = o[_ + 2], m[g + 3] = o[_ + 3]; + }, l._copyTile = function(c, d, _, m, y, x, b, A, f) { + for (var s = Math.min(d, y), u = Math.min(_, x), p = 0, g = 0, w = 0; w < u; w++) + for (var o = 0; o < s; o++) + if (b >= 0 && A >= 0 ? (p = w * d + o << 2, g = (A + w) * y + b + o << 2) : (p = (-A + w) * d - b + o << 2, g = w * y + o << 2), f == 0) + m[g] = c[p], m[g + 1] = c[p + 1], m[g + 2] = c[p + 2], m[g + 3] = c[p + 3]; else if (f == 1) { - var v = o[_ + 3] * 0.00392156862745098, M = o[_] * v, E = o[_ + 1] * v, $ = o[_ + 2] * v, k = m[g + 3] * (1 / 255), L = m[g] * k, z = m[g + 1] * k, O = m[g + 2] * k, R = 1 - v, P = v + k * R, U = P == 0 ? 0 : 1 / P; - m[g + 3] = 255 * P, m[g + 0] = (M + L * R) * U, m[g + 1] = (E + z * R) * U, m[g + 2] = ($ + O * R) * U; + var v = c[p + 3] * 0.00392156862745098, M = c[p] * v, E = c[p + 1] * v, $ = c[p + 2] * v, k = m[g + 3] * (1 / 255), L = m[g] * k, z = m[g + 1] * k, O = m[g + 2] * k, R = 1 - v, N = v + k * R, W = N == 0 ? 0 : 1 / N; + m[g + 3] = 255 * N, m[g + 0] = (M + L * R) * W, m[g + 1] = (E + z * R) * W, m[g + 2] = ($ + O * R) * W; } else if (f == 2) { - var v = o[_ + 3], M = o[_], E = o[_ + 1], $ = o[_ + 2], k = m[g + 3], L = m[g], z = m[g + 1], O = m[g + 2]; + var v = c[p + 3], M = c[p], E = c[p + 1], $ = c[p + 2], k = m[g + 3], L = m[g], z = m[g + 1], O = m[g + 2]; v == k && M == L && E == z && $ == O ? (m[g] = 0, m[g + 1] = 0, m[g + 2] = 0, m[g + 3] = 0) : (m[g] = M, m[g + 1] = E, m[g + 2] = $, m[g + 3] = v); } else if (f == 3) { - var v = o[_ + 3], M = o[_], E = o[_ + 1], $ = o[_ + 2], k = m[g + 3], L = m[g], z = m[g + 1], O = m[g + 2]; + var v = c[p + 3], M = c[p], E = c[p + 1], $ = c[p + 2], k = m[g + 3], L = m[g], z = m[g + 1], O = m[g + 2]; if (v == k && M == L && E == z && $ == O) continue; if (v < 220 && k > 20) return !1; } return !0; - }, l.encode = function(o, u, p, m, y, w) { - m == null && (m = 0), w == null && (w = !1); - for (var b = new Uint8Array(o[0].byteLength * o.length + 100), A = [137, 80, 78, 71, 13, 10, 26, 10], f = 0; f < 8; f++) b[f] = A[f]; - var s = 8, h = l._bin, _ = l.crc.crc, g = h.writeUint, x = h.writeUshort, c = h.writeASCII, v = l.encode.compressPNG(o, u, p, m, w); - g(b, s, 13), s += 4, c(b, s, "IHDR"), s += 4, g(b, s, u), s += 4, g(b, s, p), s += 4, b[s] = v.depth, s++, b[s] = v.ctype, s++, b[s] = 0, s++, b[s] = 0, s++, b[s] = 0, s++, g(b, s, _(b, s - 17, 17)), s += 4, g(b, s, 1), s += 4, c(b, s, "sRGB"), s += 4, b[s] = 1, s++, g(b, s, _(b, s - 5, 5)), s += 4; - var M = o.length > 1; - if (M && (g(b, s, 8), s += 4, c(b, s, "acTL"), s += 4, g(b, s, o.length), s += 4, g(b, s, 0), s += 4, g(b, s, _(b, s - 12, 12)), s += 4), v.ctype == 3) { + }, l.encode = function(c, d, _, m, y, x) { + m == null && (m = 0), x == null && (x = !1); + for (var b = new Uint8Array(c[0].byteLength * c.length + 100), A = [137, 80, 78, 71, 13, 10, 26, 10], f = 0; f < 8; f++) b[f] = A[f]; + var s = 8, u = l._bin, p = l.crc.crc, g = u.writeUint, w = u.writeUshort, o = u.writeASCII, v = l.encode.compressPNG(c, d, _, m, x); + g(b, s, 13), s += 4, o(b, s, "IHDR"), s += 4, g(b, s, d), s += 4, g(b, s, _), s += 4, b[s] = v.depth, s++, b[s] = v.ctype, s++, b[s] = 0, s++, b[s] = 0, s++, b[s] = 0, s++, g(b, s, p(b, s - 17, 17)), s += 4, g(b, s, 1), s += 4, o(b, s, "sRGB"), s += 4, b[s] = 1, s++, g(b, s, p(b, s - 5, 5)), s += 4; + var M = c.length > 1; + if (M && (g(b, s, 8), s += 4, o(b, s, "acTL"), s += 4, g(b, s, c.length), s += 4, g(b, s, 0), s += 4, g(b, s, p(b, s - 12, 12)), s += 4), v.ctype == 3) { var E = v.plte.length; - g(b, s, E * 3), s += 4, c(b, s, "PLTE"), s += 4; + g(b, s, E * 3), s += 4, o(b, s, "PLTE"), s += 4; for (var f = 0; f < E; f++) { var $ = f * 3, k = v.plte[f], L = k & 255, z = k >> 8 & 255, O = k >> 16 & 255; b[s + $ + 0] = L, b[s + $ + 1] = z, b[s + $ + 2] = O; } - if (s += E * 3, g(b, s, _(b, s - E * 3 - 4, E * 3 + 4)), s += 4, v.gotAlpha) { - g(b, s, E), s += 4, c(b, s, "tRNS"), s += 4; + if (s += E * 3, g(b, s, p(b, s - E * 3 - 4, E * 3 + 4)), s += 4, v.gotAlpha) { + g(b, s, E), s += 4, o(b, s, "tRNS"), s += 4; for (var f = 0; f < E; f++) b[s + f] = v.plte[f] >> 24 & 255; - s += E, g(b, s, _(b, s - E - 4, E + 4)), s += 4; + s += E, g(b, s, p(b, s - E - 4, E + 4)), s += 4; } } - for (var R = 0, P = 0; P < v.frames.length; P++) { - var U = v.frames[P]; - M && (g(b, s, 26), s += 4, c(b, s, "fcTL"), s += 4, g(b, s, R++), s += 4, g(b, s, U.rect.width), s += 4, g(b, s, U.rect.height), s += 4, g(b, s, U.rect.x), s += 4, g(b, s, U.rect.y), s += 4, x(b, s, y[P]), s += 2, x(b, s, 1e3), s += 2, b[s] = U.dispose, s++, b[s] = U.blend, s++, g(b, s, _(b, s - 30, 30)), s += 4); - var B = U.cimg, E = B.length; - g(b, s, E + (P == 0 ? 0 : 4)), s += 4; - var N = s; - c(b, s, P == 0 ? "IDAT" : "fdAT"), s += 4, P != 0 && (g(b, s, R++), s += 4); + for (var R = 0, N = 0; N < v.frames.length; N++) { + var W = v.frames[N]; + M && (g(b, s, 26), s += 4, o(b, s, "fcTL"), s += 4, g(b, s, R++), s += 4, g(b, s, W.rect.width), s += 4, g(b, s, W.rect.height), s += 4, g(b, s, W.rect.x), s += 4, g(b, s, W.rect.y), s += 4, w(b, s, y[N]), s += 2, w(b, s, 1e3), s += 2, b[s] = W.dispose, s++, b[s] = W.blend, s++, g(b, s, p(b, s - 30, 30)), s += 4); + var B = W.cimg, E = B.length; + g(b, s, E + (N == 0 ? 0 : 4)), s += 4; + var P = s; + o(b, s, N == 0 ? "IDAT" : "fdAT"), s += 4, N != 0 && (g(b, s, R++), s += 4); for (var f = 0; f < E; f++) b[s + f] = B[f]; - s += E, g(b, s, _(b, N, s - N)), s += 4; + s += E, g(b, s, p(b, P, s - P)), s += 4; } - return g(b, s, 0), s += 4, c(b, s, "IEND"), s += 4, g(b, s, _(b, s - 4, 4)), s += 4, b.buffer.slice(0, s); - }, l.encode.compressPNG = function(o, u, p, m, y) { - for (var w = l.encode.compress(o, u, p, m, !1, y), b = 0; b < o.length; b++) { - var A = w.frames[b]; + return g(b, s, 0), s += 4, o(b, s, "IEND"), s += 4, g(b, s, p(b, s - 4, 4)), s += 4, b.buffer.slice(0, s); + }, l.encode.compressPNG = function(c, d, _, m, y) { + for (var x = l.encode.compress(c, d, _, m, !1, y), b = 0; b < c.length; b++) { + var A = x.frames[b]; A.rect.width; - var f = A.rect.height, s = A.bpl, h = A.bpp, _ = new Uint8Array(f * s + f); - A.cimg = l.encode._filterZero(A.img, f, h, s, _); + var f = A.rect.height, s = A.bpl, u = A.bpp, p = new Uint8Array(f * s + f); + A.cimg = l.encode._filterZero(A.img, f, u, s, p); } - return w; - }, l.encode.compress = function(o, u, p, m, y, w) { - w == null && (w = !1); - for (var b = 6, A = 8, f = 4, s = 255, h = 0; h < o.length; h++) - for (var _ = new Uint8Array(o[h]), g = _.length, x = 0; x < g; x += 4) s &= _[x + 3]; - var c = s != 255, v = {}, M = []; - if (o.length != 0 && (v[0] = 0, M.push(0), m != 0 && m--), m != 0) { - var E = l.quantize(o, m, y); - o = E.bufs; - for (var x = 0; x < E.plte.length; x++) { - var $ = E.plte[x].est.rgba; + return x; + }, l.encode.compress = function(c, d, _, m, y, x) { + x == null && (x = !1); + for (var b = 6, A = 8, f = 4, s = 255, u = 0; u < c.length; u++) + for (var p = new Uint8Array(c[u]), g = p.length, w = 0; w < g; w += 4) s &= p[w + 3]; + var o = s != 255, v = {}, M = []; + if (c.length != 0 && (v[0] = 0, M.push(0), m != 0 && m--), m != 0) { + var E = l.quantize(c, m, y); + c = E.bufs; + for (var w = 0; w < E.plte.length; w++) { + var $ = E.plte[w].est.rgba; v[$] == null && (v[$] = M.length, M.push($)); } } else - for (var h = 0; h < o.length; h++) - for (var k = new Uint32Array(o[h]), g = k.length, x = 0; x < g; x++) { - var $ = k[x]; - if ((x < u || $ != k[x - 1] && $ != k[x - u]) && v[$] == null && (v[$] = M.length, M.push($), M.length >= 300)) + for (var u = 0; u < c.length; u++) + for (var k = new Uint32Array(c[u]), g = k.length, w = 0; w < g; w++) { + var $ = k[w]; + if ((w < d || $ != k[w - 1] && $ != k[w - d]) && v[$] == null && (v[$] = M.length, M.push($), M.length >= 300)) break; } - var L = c ? y : !1, z = M.length; - z <= 256 && w == !1 && (z <= 2 ? A = 1 : z <= 4 ? A = 2 : z <= 16 ? A = 4 : A = 8, y && (A = 8), c = !0); - for (var O = [], h = 0; h < o.length; h++) { - var R = new Uint8Array(o[h]), P = new Uint32Array(R.buffer), U = 0, B = 0, N = u, G = p, H = 0; - if (h != 0 && !L) { - for (var W = y || h == 1 || O[O.length - 2].dispose == 2 ? 1 : 2, V = 0, re = 1e9, ie = 0; ie < W; ie++) { - for (var ue = new Uint8Array(o[h - 1 - ie]), ee = new Uint32Array(o[h - 1 - ie]), ce = u, he = p, le = -1, J = -1, Me = 0; Me < p; Me++) for (var se = 0; se < u; se++) { - var x = Me * u + se; - P[x] != ee[x] && (se < ce && (ce = se), se > le && (le = se), Me < he && (he = Me), Me > J && (J = Me)); + var L = o ? y : !1, z = M.length; + z <= 256 && x == !1 && (z <= 2 ? A = 1 : z <= 4 ? A = 2 : z <= 16 ? A = 4 : A = 8, y && (A = 8), o = !0); + for (var O = [], u = 0; u < c.length; u++) { + var R = new Uint8Array(c[u]), N = new Uint32Array(R.buffer), W = 0, B = 0, P = d, G = _, H = 0; + if (u != 0 && !L) { + for (var U = y || u == 1 || O[O.length - 2].dispose == 2 ? 1 : 2, j = 0, re = 1e9, ie = 0; ie < U; ie++) { + for (var he = new Uint8Array(c[u - 1 - ie]), te = new Uint32Array(c[u - 1 - ie]), ue = d, de = _, oe = -1, J = -1, Ee = 0; Ee < _; Ee++) for (var se = 0; se < d; se++) { + var w = Ee * d + se; + N[w] != te[w] && (se < ue && (ue = se), se > oe && (oe = se), Ee < de && (de = Ee), Ee > J && (J = Ee)); } - var Ce = le == -1 ? 1 : (le - ce + 1) * (J - he + 1); - Ce < re && (re = Ce, V = ie, le == -1 ? (U = B = 0, N = G = 1) : (U = ce, B = he, N = le - ce + 1, G = J - he + 1)); + var Ae = oe == -1 ? 1 : (oe - ue + 1) * (J - de + 1); + Ae < re && (re = Ae, j = ie, oe == -1 ? (W = B = 0, P = G = 1) : (W = ue, B = de, P = oe - ue + 1, G = J - de + 1)); } - var ue = new Uint8Array(o[h - 1 - V]); - V == 1 && (O[O.length - 1].dispose = 2); - var ne = new Uint8Array(N * G * 4); - new Uint32Array(ne.buffer), l._copyTile(ue, u, p, ne, N, G, -U, -B, 0), l._copyTile(R, u, p, ne, N, G, -U, -B, 3) ? (l._copyTile(R, u, p, ne, N, G, -U, -B, 2), H = 1) : (l._copyTile(R, u, p, ne, N, G, -U, -B, 0), H = 0), R = ne, P = new Uint32Array(R.buffer); + var he = new Uint8Array(c[u - 1 - j]); + j == 1 && (O[O.length - 1].dispose = 2); + var ne = new Uint8Array(P * G * 4); + new Uint32Array(ne.buffer), l._copyTile(he, d, _, ne, P, G, -W, -B, 0), l._copyTile(R, d, _, ne, P, G, -W, -B, 3) ? (l._copyTile(R, d, _, ne, P, G, -W, -B, 2), H = 1) : (l._copyTile(R, d, _, ne, P, G, -W, -B, 0), H = 0), R = ne, N = new Uint32Array(R.buffer); } - var _e = 4 * N; - if (z <= 256 && w == !1) { - _e = Math.ceil(A * N / 8); - for (var ne = new Uint8Array(_e * G), Me = 0; Me < G; Me++) { - var x = Me * _e, Oe = Me * N; - if (A == 8) for (var se = 0; se < N; se++) ne[x + se] = v[P[Oe + se]]; - else if (A == 4) for (var se = 0; se < N; se++) ne[x + (se >> 1)] |= v[P[Oe + se]] << 4 - (se & 1) * 4; - else if (A == 2) for (var se = 0; se < N; se++) ne[x + (se >> 2)] |= v[P[Oe + se]] << 6 - (se & 3) * 2; - else if (A == 1) for (var se = 0; se < N; se++) ne[x + (se >> 3)] |= v[P[Oe + se]] << 7 - (se & 7) * 1; + var _e = 4 * P; + if (z <= 256 && x == !1) { + _e = Math.ceil(A * P / 8); + for (var ne = new Uint8Array(_e * G), Ee = 0; Ee < G; Ee++) { + var w = Ee * _e, Le = Ee * P; + if (A == 8) for (var se = 0; se < P; se++) ne[w + se] = v[N[Le + se]]; + else if (A == 4) for (var se = 0; se < P; se++) ne[w + (se >> 1)] |= v[N[Le + se]] << 4 - (se & 1) * 4; + else if (A == 2) for (var se = 0; se < P; se++) ne[w + (se >> 2)] |= v[N[Le + se]] << 6 - (se & 3) * 2; + else if (A == 1) for (var se = 0; se < P; se++) ne[w + (se >> 3)] |= v[N[Le + se]] << 7 - (se & 7) * 1; } R = ne, b = 3, f = 1; - } else if (c == !1 && o.length == 1) { - for (var ne = new Uint8Array(N * G * 3), Re = N * G, x = 0; x < Re; x++) { - var Ue = x * 3, We = x * 4; - ne[Ue] = R[We], ne[Ue + 1] = R[We + 1], ne[Ue + 2] = R[We + 2]; + } else if (o == !1 && c.length == 1) { + for (var ne = new Uint8Array(P * G * 3), Be = P * G, w = 0; w < Be; w++) { + var Ue = w * 3, He = w * 4; + ne[Ue] = R[He], ne[Ue + 1] = R[He + 1], ne[Ue + 2] = R[He + 2]; } - R = ne, b = 2, f = 3, _e = 3 * N; + R = ne, b = 2, f = 3, _e = 3 * P; } - O.push({ rect: { x: U, y: B, width: N, height: G }, img: R, bpl: _e, bpp: f, blend: H, dispose: L ? 1 : 0 }); + O.push({ rect: { x: W, y: B, width: P, height: G }, img: R, bpl: _e, bpp: f, blend: H, dispose: L ? 1 : 0 }); } - return { ctype: b, depth: A, plte: M, gotAlpha: c, frames: O }; - }, l.encode._filterZero = function(o, u, p, m, y) { - for (var w = [], b = 0; b < 5; b++) - if (!(u * m > 5e5 && (b == 2 || b == 3 || b == 4))) { - for (var A = 0; A < u; A++) l.encode._filterLine(y, o, A, m, p, b); - if (w.push(d.deflate(y)), p == 1) break; + return { ctype: b, depth: A, plte: M, gotAlpha: o, frames: O }; + }, l.encode._filterZero = function(c, d, _, m, y) { + for (var x = [], b = 0; b < 5; b++) + if (!(d * m > 5e5 && (b == 2 || b == 3 || b == 4))) { + for (var A = 0; A < d; A++) l.encode._filterLine(y, c, A, m, _, b); + if (x.push(h.deflate(y)), _ == 1) break; } - for (var f, s = 1e9, h = 0; h < w.length; h++) w[h].length < s && (f = h, s = w[h].length); - return w[f]; - }, l.encode._filterLine = function(o, u, p, m, y, w) { - var b = p * m, A = b + p, f = l.decode._paeth; - if (o[A] = w, A++, w == 0) for (var s = 0; s < m; s++) o[A + s] = u[b + s]; - else if (w == 1) { - for (var s = 0; s < y; s++) o[A + s] = u[b + s]; - for (var s = y; s < m; s++) o[A + s] = u[b + s] - u[b + s - y] + 256 & 255; - } else if (p == 0) { - for (var s = 0; s < y; s++) o[A + s] = u[b + s]; - if (w == 2) for (var s = y; s < m; s++) o[A + s] = u[b + s]; - if (w == 3) for (var s = y; s < m; s++) o[A + s] = u[b + s] - (u[b + s - y] >> 1) + 256 & 255; - if (w == 4) for (var s = y; s < m; s++) o[A + s] = u[b + s] - f(u[b + s - y], 0, 0) + 256 & 255; + for (var f, s = 1e9, u = 0; u < x.length; u++) x[u].length < s && (f = u, s = x[u].length); + return x[f]; + }, l.encode._filterLine = function(c, d, _, m, y, x) { + var b = _ * m, A = b + _, f = l.decode._paeth; + if (c[A] = x, A++, x == 0) for (var s = 0; s < m; s++) c[A + s] = d[b + s]; + else if (x == 1) { + for (var s = 0; s < y; s++) c[A + s] = d[b + s]; + for (var s = y; s < m; s++) c[A + s] = d[b + s] - d[b + s - y] + 256 & 255; + } else if (_ == 0) { + for (var s = 0; s < y; s++) c[A + s] = d[b + s]; + if (x == 2) for (var s = y; s < m; s++) c[A + s] = d[b + s]; + if (x == 3) for (var s = y; s < m; s++) c[A + s] = d[b + s] - (d[b + s - y] >> 1) + 256 & 255; + if (x == 4) for (var s = y; s < m; s++) c[A + s] = d[b + s] - f(d[b + s - y], 0, 0) + 256 & 255; } else { - if (w == 2) - for (var s = 0; s < m; s++) o[A + s] = u[b + s] + 256 - u[b + s - m] & 255; - if (w == 3) { - for (var s = 0; s < y; s++) o[A + s] = u[b + s] + 256 - (u[b + s - m] >> 1) & 255; - for (var s = y; s < m; s++) o[A + s] = u[b + s] + 256 - (u[b + s - m] + u[b + s - y] >> 1) & 255; + if (x == 2) + for (var s = 0; s < m; s++) c[A + s] = d[b + s] + 256 - d[b + s - m] & 255; + if (x == 3) { + for (var s = 0; s < y; s++) c[A + s] = d[b + s] + 256 - (d[b + s - m] >> 1) & 255; + for (var s = y; s < m; s++) c[A + s] = d[b + s] + 256 - (d[b + s - m] + d[b + s - y] >> 1) & 255; } - if (w == 4) { - for (var s = 0; s < y; s++) o[A + s] = u[b + s] + 256 - f(0, u[b + s - m], 0) & 255; - for (var s = y; s < m; s++) o[A + s] = u[b + s] + 256 - f(u[b + s - y], u[b + s - m], u[b + s - y - m]) & 255; + if (x == 4) { + for (var s = 0; s < y; s++) c[A + s] = d[b + s] + 256 - f(0, d[b + s - m], 0) & 255; + for (var s = y; s < m; s++) c[A + s] = d[b + s] + 256 - f(d[b + s - y], d[b + s - m], d[b + s - y - m]) & 255; } } }, l.crc = { table: function() { - for (var o = new Uint32Array(256), u = 0; u < 256; u++) { - for (var p = u, m = 0; m < 8; m++) - p & 1 ? p = 3988292384 ^ p >>> 1 : p = p >>> 1; - o[u] = p; + for (var c = new Uint32Array(256), d = 0; d < 256; d++) { + for (var _ = d, m = 0; m < 8; m++) + _ & 1 ? _ = 3988292384 ^ _ >>> 1 : _ = _ >>> 1; + c[d] = _; } - return o; + return c; }(), - update: function(o, u, p, m) { - for (var y = 0; y < m; y++) o = l.crc.table[(o ^ u[p + y]) & 255] ^ o >>> 8; - return o; + update: function(c, d, _, m) { + for (var y = 0; y < m; y++) c = l.crc.table[(c ^ d[_ + y]) & 255] ^ c >>> 8; + return c; }, - crc: function(o, u, p) { - return l.crc.update(4294967295, o, u, p) ^ 4294967295; + crc: function(c, d, _) { + return l.crc.update(4294967295, c, d, _) ^ 4294967295; } - }, l.quantize = function(o, u, p) { - for (var m = [], y = 0, w = 0; w < o.length; w++) - m.push(l.encode.alphaMul(new Uint8Array(o[w]), p)), y += o[w].byteLength; - for (var b = new Uint8Array(y), A = new Uint32Array(b.buffer), f = 0, w = 0; w < m.length; w++) { - for (var s = m[w], h = s.length, _ = 0; _ < h; _++) b[f + _] = s[_]; - f += h; + }, l.quantize = function(c, d, _) { + for (var m = [], y = 0, x = 0; x < c.length; x++) + m.push(l.encode.alphaMul(new Uint8Array(c[x]), _)), y += c[x].byteLength; + for (var b = new Uint8Array(y), A = new Uint32Array(b.buffer), f = 0, x = 0; x < m.length; x++) { + for (var s = m[x], u = s.length, p = 0; p < u; p++) b[f + p] = s[p]; + f += u; } var g = { i0: 0, i1: b.length, bst: null, est: null, tdst: 0, left: null, right: null }; g.bst = l.quantize.stats(b, g.i0, g.i1), g.est = l.quantize.estats(g.bst); - for (var x = [g]; x.length < u; ) { - for (var c = 0, v = 0, w = 0; w < x.length; w++) x[w].est.L > c && (c = x[w].est.L, v = w); - if (c < 1e-3) break; - var M = x[v], E = l.quantize.splitPixels(b, A, M.i0, M.i1, M.est.e, M.est.eMq255), $ = { i0: M.i0, i1: E, bst: null, est: null, tdst: 0, left: null, right: null }; + for (var w = [g]; w.length < d; ) { + for (var o = 0, v = 0, x = 0; x < w.length; x++) w[x].est.L > o && (o = w[x].est.L, v = x); + if (o < 1e-3) break; + var M = w[v], E = l.quantize.splitPixels(b, A, M.i0, M.i1, M.est.e, M.est.eMq255), $ = { i0: M.i0, i1: E, bst: null, est: null, tdst: 0, left: null, right: null }; $.bst = l.quantize.stats(b, $.i0, $.i1), $.est = l.quantize.estats($.bst); var k = { i0: E, i1: M.i1, bst: null, est: null, tdst: 0, left: null, right: null }; k.bst = { R: [], m: [], N: M.bst.N - $.bst.N }; - for (var w = 0; w < 16; w++) k.bst.R[w] = M.bst.R[w] - $.bst.R[w]; - for (var w = 0; w < 4; w++) k.bst.m[w] = M.bst.m[w] - $.bst.m[w]; - k.est = l.quantize.estats(k.bst), M.left = $, M.right = k, x[v] = $, x.push(k); + for (var x = 0; x < 16; x++) k.bst.R[x] = M.bst.R[x] - $.bst.R[x]; + for (var x = 0; x < 4; x++) k.bst.m[x] = M.bst.m[x] - $.bst.m[x]; + k.est = l.quantize.estats(k.bst), M.left = $, M.right = k, w[v] = $, w.push(k); } - x.sort(function(W, V) { - return V.bst.N - W.bst.N; + w.sort(function(U, j) { + return j.bst.N - U.bst.N; }); for (var L = 0; L < m.length; L++) { - for (var z = l.quantize.planeDst, O = new Uint8Array(m[L].buffer), R = new Uint32Array(m[L].buffer), P = O.length, w = 0; w < P; w += 4) { - for (var U = O[w] * 0.00392156862745098, B = O[w + 1] * (1 / 255), N = O[w + 2] * (1 / 255), G = O[w + 3] * (1 / 255), H = g; H.left; ) H = z(H.est, U, B, N, G) <= 0 ? H.left : H.right; - R[w >> 2] = H.est.rgba; + for (var z = l.quantize.planeDst, O = new Uint8Array(m[L].buffer), R = new Uint32Array(m[L].buffer), N = O.length, x = 0; x < N; x += 4) { + for (var W = O[x] * 0.00392156862745098, B = O[x + 1] * (1 / 255), P = O[x + 2] * (1 / 255), G = O[x + 3] * (1 / 255), H = g; H.left; ) H = z(H.est, W, B, P, G) <= 0 ? H.left : H.right; + R[x >> 2] = H.est.rgba; } m[L] = R.buffer; } - return { bufs: m, plte: x }; - }, l.quantize.getNearest = function(o, u, p, m, y) { - if (o.left == null) - return o.tdst = l.quantize.dist(o.est.q, u, p, m, y), o; - var w = l.quantize.planeDst(o.est, u, p, m, y), b = o.left, A = o.right; - w > 0 && (b = o.right, A = o.left); - var f = l.quantize.getNearest(b, u, p, m, y); - if (f.tdst <= w * w) return f; - var s = l.quantize.getNearest(A, u, p, m, y); + return { bufs: m, plte: w }; + }, l.quantize.getNearest = function(c, d, _, m, y) { + if (c.left == null) + return c.tdst = l.quantize.dist(c.est.q, d, _, m, y), c; + var x = l.quantize.planeDst(c.est, d, _, m, y), b = c.left, A = c.right; + x > 0 && (b = c.right, A = c.left); + var f = l.quantize.getNearest(b, d, _, m, y); + if (f.tdst <= x * x) return f; + var s = l.quantize.getNearest(A, d, _, m, y); return s.tdst < f.tdst ? s : f; - }, l.quantize.planeDst = function(o, u, p, m, y) { - var w = o.e; - return w[0] * u + w[1] * p + w[2] * m + w[3] * y - o.eMq; - }, l.quantize.dist = function(o, u, p, m, y) { - var w = u - o[0], b = p - o[1], A = m - o[2], f = y - o[3]; - return w * w + b * b + A * A + f * f; - }, l.quantize.splitPixels = function(o, u, p, m, y, w) { + }, l.quantize.planeDst = function(c, d, _, m, y) { + var x = c.e; + return x[0] * d + x[1] * _ + x[2] * m + x[3] * y - c.eMq; + }, l.quantize.dist = function(c, d, _, m, y) { + var x = d - c[0], b = _ - c[1], A = m - c[2], f = y - c[3]; + return x * x + b * b + A * A + f * f; + }, l.quantize.splitPixels = function(c, d, _, m, y, x) { var b = l.quantize.vecDot; - for (m -= 4; p < m; ) { - for (; b(o, p, y) <= w; ) p += 4; - for (; b(o, m, y) > w; ) m -= 4; - if (p >= m) break; - var A = u[p >> 2]; - u[p >> 2] = u[m >> 2], u[m >> 2] = A, p += 4, m -= 4; + for (m -= 4; _ < m; ) { + for (; b(c, _, y) <= x; ) _ += 4; + for (; b(c, m, y) > x; ) m -= 4; + if (_ >= m) break; + var A = d[_ >> 2]; + d[_ >> 2] = d[m >> 2], d[m >> 2] = A, _ += 4, m -= 4; } - for (; b(o, p, y) > w; ) p -= 4; - return p + 4; - }, l.quantize.vecDot = function(o, u, p) { - return o[u] * p[0] + o[u + 1] * p[1] + o[u + 2] * p[2] + o[u + 3] * p[3]; - }, l.quantize.stats = function(o, u, p) { - for (var m = [0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0], y = [0, 0, 0, 0], w = p - u >> 2, b = u; b < p; b += 4) { - var A = o[b] * 0.00392156862745098, f = o[b + 1] * (1 / 255), s = o[b + 2] * (1 / 255), h = o[b + 3] * (1 / 255); - y[0] += A, y[1] += f, y[2] += s, y[3] += h, m[0] += A * A, m[1] += A * f, m[2] += A * s, m[3] += A * h, m[5] += f * f, m[6] += f * s, m[7] += f * h, m[10] += s * s, m[11] += s * h, m[15] += h * h; + for (; b(c, _, y) > x; ) _ -= 4; + return _ + 4; + }, l.quantize.vecDot = function(c, d, _) { + return c[d] * _[0] + c[d + 1] * _[1] + c[d + 2] * _[2] + c[d + 3] * _[3]; + }, l.quantize.stats = function(c, d, _) { + for (var m = [0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0], y = [0, 0, 0, 0], x = _ - d >> 2, b = d; b < _; b += 4) { + var A = c[b] * 0.00392156862745098, f = c[b + 1] * (1 / 255), s = c[b + 2] * (1 / 255), u = c[b + 3] * (1 / 255); + y[0] += A, y[1] += f, y[2] += s, y[3] += u, m[0] += A * A, m[1] += A * f, m[2] += A * s, m[3] += A * u, m[5] += f * f, m[6] += f * s, m[7] += f * u, m[10] += s * s, m[11] += s * u, m[15] += u * u; } - return m[4] = m[1], m[8] = m[2], m[12] = m[3], m[9] = m[6], m[13] = m[7], m[14] = m[11], { R: m, m: y, N: w }; - }, l.quantize.estats = function(o) { - var u = o.R, p = o.m, m = o.N, y = p[0], w = p[1], b = p[2], A = p[3], f = m == 0 ? 0 : 1 / m, s = [ - u[0] - y * y * f, - u[1] - y * w * f, - u[2] - y * b * f, - u[3] - y * A * f, - u[4] - w * y * f, - u[5] - w * w * f, - u[6] - w * b * f, - u[7] - w * A * f, - u[8] - b * y * f, - u[9] - b * w * f, - u[10] - b * b * f, - u[11] - b * A * f, - u[12] - A * y * f, - u[13] - A * w * f, - u[14] - A * b * f, - u[15] - A * A * f - ], h = s, _ = l.M4, g = [0.5, 0.5, 0.5, 0.5], x = 0, c = 0; + return m[4] = m[1], m[8] = m[2], m[12] = m[3], m[9] = m[6], m[13] = m[7], m[14] = m[11], { R: m, m: y, N: x }; + }, l.quantize.estats = function(c) { + var d = c.R, _ = c.m, m = c.N, y = _[0], x = _[1], b = _[2], A = _[3], f = m == 0 ? 0 : 1 / m, s = [ + d[0] - y * y * f, + d[1] - y * x * f, + d[2] - y * b * f, + d[3] - y * A * f, + d[4] - x * y * f, + d[5] - x * x * f, + d[6] - x * b * f, + d[7] - x * A * f, + d[8] - b * y * f, + d[9] - b * x * f, + d[10] - b * b * f, + d[11] - b * A * f, + d[12] - A * y * f, + d[13] - A * x * f, + d[14] - A * b * f, + d[15] - A * A * f + ], u = s, p = l.M4, g = [0.5, 0.5, 0.5, 0.5], w = 0, o = 0; if (m != 0) - for (var v = 0; v < 10 && (g = _.multVec(h, g), c = Math.sqrt(_.dot(g, g)), g = _.sml(1 / c, g), !(Math.abs(c - x) < 1e-9)); v++) - x = c; - var M = [y * f, w * f, b * f, A * f], E = _.dot(_.sml(255, M), g), $ = M[3] < 1e-3 ? 0 : 1 / M[3]; + for (var v = 0; v < 10 && (g = p.multVec(u, g), o = Math.sqrt(p.dot(g, g)), g = p.sml(1 / o, g), !(Math.abs(o - w) < 1e-9)); v++) + w = o; + var M = [y * f, x * f, b * f, A * f], E = p.dot(p.sml(255, M), g), $ = M[3] < 1e-3 ? 0 : 1 / M[3]; return { Cov: s, q: M, e: g, - L: x, + L: w, eMq255: E, - eMq: _.dot(g, M), + eMq: p.dot(g, M), rgba: (Math.round(255 * M[3]) << 24 | Math.round(255 * M[2] * $) << 16 | Math.round(255 * M[1] * $) << 8 | Math.round(255 * M[0] * $) << 0) >>> 0 }; }, l.M4 = { - multVec: function(o, u) { + multVec: function(c, d) { return [ - o[0] * u[0] + o[1] * u[1] + o[2] * u[2] + o[3] * u[3], - o[4] * u[0] + o[5] * u[1] + o[6] * u[2] + o[7] * u[3], - o[8] * u[0] + o[9] * u[1] + o[10] * u[2] + o[11] * u[3], - o[12] * u[0] + o[13] * u[1] + o[14] * u[2] + o[15] * u[3] + c[0] * d[0] + c[1] * d[1] + c[2] * d[2] + c[3] * d[3], + c[4] * d[0] + c[5] * d[1] + c[6] * d[2] + c[7] * d[3], + c[8] * d[0] + c[9] * d[1] + c[10] * d[2] + c[11] * d[3], + c[12] * d[0] + c[13] * d[1] + c[14] * d[2] + c[15] * d[3] ]; }, - dot: function(o, u) { - return o[0] * u[0] + o[1] * u[1] + o[2] * u[2] + o[3] * u[3]; + dot: function(c, d) { + return c[0] * d[0] + c[1] * d[1] + c[2] * d[2] + c[3] * d[3]; }, - sml: function(o, u) { - return [o * u[0], o * u[1], o * u[2], o * u[3]]; + sml: function(c, d) { + return [c * d[0], c * d[1], c * d[2], c * d[3]]; } - }, l.encode.alphaMul = function(o, u) { - for (var p = new Uint8Array(o.length), m = o.length >> 2, y = 0; y < m; y++) { - var w = y << 2, b = o[w + 3]; - u && (b = b < 128 ? 0 : 255); + }, l.encode.alphaMul = function(c, d) { + for (var _ = new Uint8Array(c.length), m = c.length >> 2, y = 0; y < m; y++) { + var x = y << 2, b = c[x + 3]; + d && (b = b < 128 ? 0 : 255); var A = b * (1 / 255); - p[w + 0] = o[w + 0] * A, p[w + 1] = o[w + 1] * A, p[w + 2] = o[w + 2] * A, p[w + 3] = b; + _[x + 0] = c[x + 0] * A, _[x + 1] = c[x + 1] * A, _[x + 2] = c[x + 2] * A, _[x + 3] = b; } - return p; + return _; }; }(r, a); })(); @@ -36994,11 +36994,11 @@ ATOM`, x); ), l = t( /*! ./lib/inflate */ "./node_modules/upng-js/node_modules/pako/lib/inflate.js" - ), d = t( + ), h = t( /*! ./lib/zlib/constants */ "./node_modules/upng-js/node_modules/pako/lib/zlib/constants.js" - ), o = {}; - r(o, a, l, d), n.exports = o; + ), c = {}; + r(c, a, l, h), n.exports = c; } ), /***/ @@ -37017,15 +37017,15 @@ ATOM`, x); ), l = t( /*! ./utils/strings */ "./node_modules/upng-js/node_modules/pako/lib/utils/strings.js" - ), d = t( + ), h = t( /*! ./zlib/messages */ "./node_modules/upng-js/node_modules/pako/lib/zlib/messages.js" - ), o = t( + ), c = t( /*! ./zlib/zstream */ "./node_modules/upng-js/node_modules/pako/lib/zlib/zstream.js" - ), u = Object.prototype.toString, p = 0, m = 4, y = 0, w = 1, b = 2, A = -1, f = 0, s = 8; - function h(c) { - if (!(this instanceof h)) return new h(c); + ), d = Object.prototype.toString, _ = 0, m = 4, y = 0, x = 1, b = 2, A = -1, f = 0, s = 8; + function u(o) { + if (!(this instanceof u)) return new u(o); this.options = a.assign({ level: A, method: s, @@ -37034,9 +37034,9 @@ ATOM`, x); memLevel: 8, strategy: f, to: "" - }, c || {}); + }, o || {}); var v = this.options; - v.raw && v.windowBits > 0 ? v.windowBits = -v.windowBits : v.gzip && v.windowBits > 0 && v.windowBits < 16 && (v.windowBits += 16), this.err = 0, this.msg = "", this.ended = !1, this.chunks = [], this.strm = new o(), this.strm.avail_out = 0; + v.raw && v.windowBits > 0 ? v.windowBits = -v.windowBits : v.gzip && v.windowBits > 0 && v.windowBits < 16 && (v.windowBits += 16), this.err = 0, this.msg = "", this.ended = !1, this.chunks = [], this.strm = new c(), this.strm.avail_out = 0; var M = r.deflateInit2( this.strm, v.level, @@ -37046,43 +37046,43 @@ ATOM`, x); v.strategy ); if (M !== y) - throw new Error(d[M]); + throw new Error(h[M]); if (v.header && r.deflateSetHeader(this.strm, v.header), v.dictionary) { var E; - if (typeof v.dictionary == "string" ? E = l.string2buf(v.dictionary) : u.call(v.dictionary) === "[object ArrayBuffer]" ? E = new Uint8Array(v.dictionary) : E = v.dictionary, M = r.deflateSetDictionary(this.strm, E), M !== y) - throw new Error(d[M]); + if (typeof v.dictionary == "string" ? E = l.string2buf(v.dictionary) : d.call(v.dictionary) === "[object ArrayBuffer]" ? E = new Uint8Array(v.dictionary) : E = v.dictionary, M = r.deflateSetDictionary(this.strm, E), M !== y) + throw new Error(h[M]); this._dict_set = !0; } } - h.prototype.push = function(c, v) { + u.prototype.push = function(o, v) { var M = this.strm, E = this.options.chunkSize, $, k; if (this.ended) return !1; - k = v === ~~v ? v : v === !0 ? m : p, typeof c == "string" ? M.input = l.string2buf(c) : u.call(c) === "[object ArrayBuffer]" ? M.input = new Uint8Array(c) : M.input = c, M.next_in = 0, M.avail_in = M.input.length; + k = v === ~~v ? v : v === !0 ? m : _, typeof o == "string" ? M.input = l.string2buf(o) : d.call(o) === "[object ArrayBuffer]" ? M.input = new Uint8Array(o) : M.input = o, M.next_in = 0, M.avail_in = M.input.length; do { - if (M.avail_out === 0 && (M.output = new a.Buf8(E), M.next_out = 0, M.avail_out = E), $ = r.deflate(M, k), $ !== w && $ !== y) + if (M.avail_out === 0 && (M.output = new a.Buf8(E), M.next_out = 0, M.avail_out = E), $ = r.deflate(M, k), $ !== x && $ !== y) return this.onEnd($), this.ended = !0, !1; (M.avail_out === 0 || M.avail_in === 0 && (k === m || k === b)) && (this.options.to === "string" ? this.onData(l.buf2binstring(a.shrinkBuf(M.output, M.next_out))) : this.onData(a.shrinkBuf(M.output, M.next_out))); - } while ((M.avail_in > 0 || M.avail_out === 0) && $ !== w); + } while ((M.avail_in > 0 || M.avail_out === 0) && $ !== x); return k === m ? ($ = r.deflateEnd(this.strm), this.onEnd($), this.ended = !0, $ === y) : (k === b && (this.onEnd(y), M.avail_out = 0), !0); - }, h.prototype.onData = function(c) { - this.chunks.push(c); - }, h.prototype.onEnd = function(c) { - c === y && (this.options.to === "string" ? this.result = this.chunks.join("") : this.result = a.flattenChunks(this.chunks)), this.chunks = [], this.err = c, this.msg = this.strm.msg; + }, u.prototype.onData = function(o) { + this.chunks.push(o); + }, u.prototype.onEnd = function(o) { + o === y && (this.options.to === "string" ? this.result = this.chunks.join("") : this.result = a.flattenChunks(this.chunks)), this.chunks = [], this.err = o, this.msg = this.strm.msg; }; - function _(c, v) { - var M = new h(v); - if (M.push(c, !0), M.err) - throw M.msg || d[M.err]; + function p(o, v) { + var M = new u(v); + if (M.push(o, !0), M.err) + throw M.msg || h[M.err]; return M.result; } - function g(c, v) { - return v = v || {}, v.raw = !0, _(c, v); + function g(o, v) { + return v = v || {}, v.raw = !0, p(o, v); } - function x(c, v) { - return v = v || {}, v.gzip = !0, _(c, v); + function w(o, v) { + return v = v || {}, v.gzip = !0, p(o, v); } - e.Deflate = h, e.deflate = _, e.deflateRaw = g, e.gzip = x; + e.Deflate = u, e.deflate = p, e.deflateRaw = g, e.gzip = w; } ), /***/ @@ -37101,16 +37101,16 @@ ATOM`, x); ), l = t( /*! ./utils/strings */ "./node_modules/upng-js/node_modules/pako/lib/utils/strings.js" - ), d = t( + ), h = t( /*! ./zlib/constants */ "./node_modules/upng-js/node_modules/pako/lib/zlib/constants.js" - ), o = t( + ), c = t( /*! ./zlib/messages */ "./node_modules/upng-js/node_modules/pako/lib/zlib/messages.js" - ), u = t( + ), d = t( /*! ./zlib/zstream */ "./node_modules/upng-js/node_modules/pako/lib/zlib/zstream.js" - ), p = t( + ), _ = t( /*! ./zlib/gzheader */ "./node_modules/upng-js/node_modules/pako/lib/zlib/gzheader.js" ), m = Object.prototype.toString; @@ -37122,42 +37122,42 @@ ATOM`, x); to: "" }, A || {}); var f = this.options; - f.raw && f.windowBits >= 0 && f.windowBits < 16 && (f.windowBits = -f.windowBits, f.windowBits === 0 && (f.windowBits = -15)), f.windowBits >= 0 && f.windowBits < 16 && !(A && A.windowBits) && (f.windowBits += 32), f.windowBits > 15 && f.windowBits < 48 && (f.windowBits & 15 || (f.windowBits |= 15)), this.err = 0, this.msg = "", this.ended = !1, this.chunks = [], this.strm = new u(), this.strm.avail_out = 0; + f.raw && f.windowBits >= 0 && f.windowBits < 16 && (f.windowBits = -f.windowBits, f.windowBits === 0 && (f.windowBits = -15)), f.windowBits >= 0 && f.windowBits < 16 && !(A && A.windowBits) && (f.windowBits += 32), f.windowBits > 15 && f.windowBits < 48 && (f.windowBits & 15 || (f.windowBits |= 15)), this.err = 0, this.msg = "", this.ended = !1, this.chunks = [], this.strm = new d(), this.strm.avail_out = 0; var s = r.inflateInit2( this.strm, f.windowBits ); - if (s !== d.Z_OK) - throw new Error(o[s]); - if (this.header = new p(), r.inflateGetHeader(this.strm, this.header), f.dictionary && (typeof f.dictionary == "string" ? f.dictionary = l.string2buf(f.dictionary) : m.call(f.dictionary) === "[object ArrayBuffer]" && (f.dictionary = new Uint8Array(f.dictionary)), f.raw && (s = r.inflateSetDictionary(this.strm, f.dictionary), s !== d.Z_OK))) - throw new Error(o[s]); + if (s !== h.Z_OK) + throw new Error(c[s]); + if (this.header = new _(), r.inflateGetHeader(this.strm, this.header), f.dictionary && (typeof f.dictionary == "string" ? f.dictionary = l.string2buf(f.dictionary) : m.call(f.dictionary) === "[object ArrayBuffer]" && (f.dictionary = new Uint8Array(f.dictionary)), f.raw && (s = r.inflateSetDictionary(this.strm, f.dictionary), s !== h.Z_OK))) + throw new Error(c[s]); } y.prototype.push = function(A, f) { - var s = this.strm, h = this.options.chunkSize, _ = this.options.dictionary, g, x, c, v, M, E = !1; + var s = this.strm, u = this.options.chunkSize, p = this.options.dictionary, g, w, o, v, M, E = !1; if (this.ended) return !1; - x = f === ~~f ? f : f === !0 ? d.Z_FINISH : d.Z_NO_FLUSH, typeof A == "string" ? s.input = l.binstring2buf(A) : m.call(A) === "[object ArrayBuffer]" ? s.input = new Uint8Array(A) : s.input = A, s.next_in = 0, s.avail_in = s.input.length; + w = f === ~~f ? f : f === !0 ? h.Z_FINISH : h.Z_NO_FLUSH, typeof A == "string" ? s.input = l.binstring2buf(A) : m.call(A) === "[object ArrayBuffer]" ? s.input = new Uint8Array(A) : s.input = A, s.next_in = 0, s.avail_in = s.input.length; do { - if (s.avail_out === 0 && (s.output = new a.Buf8(h), s.next_out = 0, s.avail_out = h), g = r.inflate(s, d.Z_NO_FLUSH), g === d.Z_NEED_DICT && _ && (g = r.inflateSetDictionary(this.strm, _)), g === d.Z_BUF_ERROR && E === !0 && (g = d.Z_OK, E = !1), g !== d.Z_STREAM_END && g !== d.Z_OK) + if (s.avail_out === 0 && (s.output = new a.Buf8(u), s.next_out = 0, s.avail_out = u), g = r.inflate(s, h.Z_NO_FLUSH), g === h.Z_NEED_DICT && p && (g = r.inflateSetDictionary(this.strm, p)), g === h.Z_BUF_ERROR && E === !0 && (g = h.Z_OK, E = !1), g !== h.Z_STREAM_END && g !== h.Z_OK) return this.onEnd(g), this.ended = !0, !1; - s.next_out && (s.avail_out === 0 || g === d.Z_STREAM_END || s.avail_in === 0 && (x === d.Z_FINISH || x === d.Z_SYNC_FLUSH)) && (this.options.to === "string" ? (c = l.utf8border(s.output, s.next_out), v = s.next_out - c, M = l.buf2string(s.output, c), s.next_out = v, s.avail_out = h - v, v && a.arraySet(s.output, s.output, c, v, 0), this.onData(M)) : this.onData(a.shrinkBuf(s.output, s.next_out))), s.avail_in === 0 && s.avail_out === 0 && (E = !0); - } while ((s.avail_in > 0 || s.avail_out === 0) && g !== d.Z_STREAM_END); - return g === d.Z_STREAM_END && (x = d.Z_FINISH), x === d.Z_FINISH ? (g = r.inflateEnd(this.strm), this.onEnd(g), this.ended = !0, g === d.Z_OK) : (x === d.Z_SYNC_FLUSH && (this.onEnd(d.Z_OK), s.avail_out = 0), !0); + s.next_out && (s.avail_out === 0 || g === h.Z_STREAM_END || s.avail_in === 0 && (w === h.Z_FINISH || w === h.Z_SYNC_FLUSH)) && (this.options.to === "string" ? (o = l.utf8border(s.output, s.next_out), v = s.next_out - o, M = l.buf2string(s.output, o), s.next_out = v, s.avail_out = u - v, v && a.arraySet(s.output, s.output, o, v, 0), this.onData(M)) : this.onData(a.shrinkBuf(s.output, s.next_out))), s.avail_in === 0 && s.avail_out === 0 && (E = !0); + } while ((s.avail_in > 0 || s.avail_out === 0) && g !== h.Z_STREAM_END); + return g === h.Z_STREAM_END && (w = h.Z_FINISH), w === h.Z_FINISH ? (g = r.inflateEnd(this.strm), this.onEnd(g), this.ended = !0, g === h.Z_OK) : (w === h.Z_SYNC_FLUSH && (this.onEnd(h.Z_OK), s.avail_out = 0), !0); }, y.prototype.onData = function(A) { this.chunks.push(A); }, y.prototype.onEnd = function(A) { - A === d.Z_OK && (this.options.to === "string" ? this.result = this.chunks.join("") : this.result = a.flattenChunks(this.chunks)), this.chunks = [], this.err = A, this.msg = this.strm.msg; + A === h.Z_OK && (this.options.to === "string" ? this.result = this.chunks.join("") : this.result = a.flattenChunks(this.chunks)), this.chunks = [], this.err = A, this.msg = this.strm.msg; }; - function w(A, f) { + function x(A, f) { var s = new y(f); if (s.push(A, !0), s.err) - throw s.msg || o[s.err]; + throw s.msg || c[s.err]; return s.result; } function b(A, f) { - return f = f || {}, f.raw = !0, w(A, f); + return f = f || {}, f.raw = !0, x(A, f); } - e.Inflate = y, e.inflate = w, e.inflateRaw = b, e.ungzip = w; + e.Inflate = y, e.inflate = x, e.inflateRaw = b, e.ungzip = x; } ), /***/ @@ -37168,53 +37168,53 @@ ATOM`, x); /***/ (n, e) => { var t = typeof Uint8Array < "u" && typeof Uint16Array < "u" && typeof Int32Array < "u"; - function r(d, o) { - return Object.prototype.hasOwnProperty.call(d, o); - } - e.assign = function(d) { - for (var o = Array.prototype.slice.call(arguments, 1); o.length; ) { - var u = o.shift(); - if (u) { - if (typeof u != "object") - throw new TypeError(u + "must be non-object"); - for (var p in u) - r(u, p) && (d[p] = u[p]); - } - } - return d; - }, e.shrinkBuf = function(d, o) { - return d.length === o ? d : d.subarray ? d.subarray(0, o) : (d.length = o, d); + function r(h, c) { + return Object.prototype.hasOwnProperty.call(h, c); + } + e.assign = function(h) { + for (var c = Array.prototype.slice.call(arguments, 1); c.length; ) { + var d = c.shift(); + if (d) { + if (typeof d != "object") + throw new TypeError(d + "must be non-object"); + for (var _ in d) + r(d, _) && (h[_] = d[_]); + } + } + return h; + }, e.shrinkBuf = function(h, c) { + return h.length === c ? h : h.subarray ? h.subarray(0, c) : (h.length = c, h); }; var a = { - arraySet: function(d, o, u, p, m) { - if (o.subarray && d.subarray) { - d.set(o.subarray(u, u + p), m); + arraySet: function(h, c, d, _, m) { + if (c.subarray && h.subarray) { + h.set(c.subarray(d, d + _), m); return; } - for (var y = 0; y < p; y++) - d[m + y] = o[u + y]; + for (var y = 0; y < _; y++) + h[m + y] = c[d + y]; }, // Join array of chunks to single array. - flattenChunks: function(d) { - var o, u, p, m, y, w; - for (p = 0, o = 0, u = d.length; o < u; o++) - p += d[o].length; - for (w = new Uint8Array(p), m = 0, o = 0, u = d.length; o < u; o++) - y = d[o], w.set(y, m), m += y.length; - return w; + flattenChunks: function(h) { + var c, d, _, m, y, x; + for (_ = 0, c = 0, d = h.length; c < d; c++) + _ += h[c].length; + for (x = new Uint8Array(_), m = 0, c = 0, d = h.length; c < d; c++) + y = h[c], x.set(y, m), m += y.length; + return x; } }, l = { - arraySet: function(d, o, u, p, m) { - for (var y = 0; y < p; y++) - d[m + y] = o[u + y]; + arraySet: function(h, c, d, _, m) { + for (var y = 0; y < _; y++) + h[m + y] = c[d + y]; }, // Join array of chunks to single array. - flattenChunks: function(d) { - return [].concat.apply([], d); + flattenChunks: function(h) { + return [].concat.apply([], h); } }; - e.setTyped = function(d) { - d ? (e.Buf8 = Uint8Array, e.Buf16 = Uint16Array, e.Buf32 = Int32Array, e.assign(e, a)) : (e.Buf8 = Array, e.Buf16 = Array, e.Buf32 = Array, e.assign(e, l)); + e.setTyped = function(h) { + h ? (e.Buf8 = Uint8Array, e.Buf16 = Uint16Array, e.Buf32 = Int32Array, e.assign(e, a)) : (e.Buf8 = Array, e.Buf16 = Array, e.Buf32 = Array, e.assign(e, l)); }, e.setTyped(t); } ), @@ -37239,54 +37239,54 @@ ATOM`, x); } catch { l = !1; } - for (var d = new r.Buf8(256), o = 0; o < 256; o++) - d[o] = o >= 252 ? 6 : o >= 248 ? 5 : o >= 240 ? 4 : o >= 224 ? 3 : o >= 192 ? 2 : 1; - d[254] = d[254] = 1, e.string2buf = function(p) { - var m, y, w, b, A, f = p.length, s = 0; + for (var h = new r.Buf8(256), c = 0; c < 256; c++) + h[c] = c >= 252 ? 6 : c >= 248 ? 5 : c >= 240 ? 4 : c >= 224 ? 3 : c >= 192 ? 2 : 1; + h[254] = h[254] = 1, e.string2buf = function(_) { + var m, y, x, b, A, f = _.length, s = 0; for (b = 0; b < f; b++) - y = p.charCodeAt(b), (y & 64512) === 55296 && b + 1 < f && (w = p.charCodeAt(b + 1), (w & 64512) === 56320 && (y = 65536 + (y - 55296 << 10) + (w - 56320), b++)), s += y < 128 ? 1 : y < 2048 ? 2 : y < 65536 ? 3 : 4; + y = _.charCodeAt(b), (y & 64512) === 55296 && b + 1 < f && (x = _.charCodeAt(b + 1), (x & 64512) === 56320 && (y = 65536 + (y - 55296 << 10) + (x - 56320), b++)), s += y < 128 ? 1 : y < 2048 ? 2 : y < 65536 ? 3 : 4; for (m = new r.Buf8(s), A = 0, b = 0; A < s; b++) - y = p.charCodeAt(b), (y & 64512) === 55296 && b + 1 < f && (w = p.charCodeAt(b + 1), (w & 64512) === 56320 && (y = 65536 + (y - 55296 << 10) + (w - 56320), b++)), y < 128 ? m[A++] = y : y < 2048 ? (m[A++] = 192 | y >>> 6, m[A++] = 128 | y & 63) : y < 65536 ? (m[A++] = 224 | y >>> 12, m[A++] = 128 | y >>> 6 & 63, m[A++] = 128 | y & 63) : (m[A++] = 240 | y >>> 18, m[A++] = 128 | y >>> 12 & 63, m[A++] = 128 | y >>> 6 & 63, m[A++] = 128 | y & 63); + y = _.charCodeAt(b), (y & 64512) === 55296 && b + 1 < f && (x = _.charCodeAt(b + 1), (x & 64512) === 56320 && (y = 65536 + (y - 55296 << 10) + (x - 56320), b++)), y < 128 ? m[A++] = y : y < 2048 ? (m[A++] = 192 | y >>> 6, m[A++] = 128 | y & 63) : y < 65536 ? (m[A++] = 224 | y >>> 12, m[A++] = 128 | y >>> 6 & 63, m[A++] = 128 | y & 63) : (m[A++] = 240 | y >>> 18, m[A++] = 128 | y >>> 12 & 63, m[A++] = 128 | y >>> 6 & 63, m[A++] = 128 | y & 63); return m; }; - function u(p, m) { - if (m < 65534 && (p.subarray && l || !p.subarray && a)) - return String.fromCharCode.apply(null, r.shrinkBuf(p, m)); - for (var y = "", w = 0; w < m; w++) - y += String.fromCharCode(p[w]); + function d(_, m) { + if (m < 65534 && (_.subarray && l || !_.subarray && a)) + return String.fromCharCode.apply(null, r.shrinkBuf(_, m)); + for (var y = "", x = 0; x < m; x++) + y += String.fromCharCode(_[x]); return y; } - e.buf2binstring = function(p) { - return u(p, p.length); - }, e.binstring2buf = function(p) { - for (var m = new r.Buf8(p.length), y = 0, w = m.length; y < w; y++) - m[y] = p.charCodeAt(y); + e.buf2binstring = function(_) { + return d(_, _.length); + }, e.binstring2buf = function(_) { + for (var m = new r.Buf8(_.length), y = 0, x = m.length; y < x; y++) + m[y] = _.charCodeAt(y); return m; - }, e.buf2string = function(p, m) { - var y, w, b, A, f = m || p.length, s = new Array(f * 2); - for (w = 0, y = 0; y < f; ) { - if (b = p[y++], b < 128) { - s[w++] = b; + }, e.buf2string = function(_, m) { + var y, x, b, A, f = m || _.length, s = new Array(f * 2); + for (x = 0, y = 0; y < f; ) { + if (b = _[y++], b < 128) { + s[x++] = b; continue; } - if (A = d[b], A > 4) { - s[w++] = 65533, y += A - 1; + if (A = h[b], A > 4) { + s[x++] = 65533, y += A - 1; continue; } for (b &= A === 2 ? 31 : A === 3 ? 15 : 7; A > 1 && y < f; ) - b = b << 6 | p[y++] & 63, A--; + b = b << 6 | _[y++] & 63, A--; if (A > 1) { - s[w++] = 65533; + s[x++] = 65533; continue; } - b < 65536 ? s[w++] = b : (b -= 65536, s[w++] = 55296 | b >> 10 & 1023, s[w++] = 56320 | b & 1023); + b < 65536 ? s[x++] = b : (b -= 65536, s[x++] = 55296 | b >> 10 & 1023, s[x++] = 56320 | b & 1023); } - return u(s, w); - }, e.utf8border = function(p, m) { + return d(s, x); + }, e.utf8border = function(_, m) { var y; - for (m = m || p.length, m > p.length && (m = p.length), y = m - 1; y >= 0 && (p[y] & 192) === 128; ) + for (m = m || _.length, m > _.length && (m = _.length), y = m - 1; y >= 0 && (_[y] & 192) === 128; ) y--; - return y < 0 || y === 0 ? m : y + d[p[y]] > m ? y : m; + return y < 0 || y === 0 ? m : y + h[_[y]] > m ? y : m; }; } ), @@ -37298,14 +37298,14 @@ ATOM`, x); /***/ (n) => { function e(t, r, a, l) { - for (var d = t & 65535 | 0, o = t >>> 16 & 65535 | 0, u = 0; a !== 0; ) { - u = a > 2e3 ? 2e3 : a, a -= u; + for (var h = t & 65535 | 0, c = t >>> 16 & 65535 | 0, d = 0; a !== 0; ) { + d = a > 2e3 ? 2e3 : a, a -= d; do - d = d + r[l++] | 0, o = o + d | 0; - while (--u); - d %= 65521, o %= 65521; + h = h + r[l++] | 0, c = c + h | 0; + while (--d); + h %= 65521, c %= 65521; } - return d | o << 16 | 0; + return h | c << 16 | 0; } n.exports = e; } @@ -37367,20 +37367,20 @@ ATOM`, x); /***/ (n) => { function e() { - for (var a, l = [], d = 0; d < 256; d++) { - a = d; - for (var o = 0; o < 8; o++) + for (var a, l = [], h = 0; h < 256; h++) { + a = h; + for (var c = 0; c < 8; c++) a = a & 1 ? 3988292384 ^ a >>> 1 : a >>> 1; - l[d] = a; + l[h] = a; } return l; } var t = e(); - function r(a, l, d, o) { - var u = t, p = o + d; + function r(a, l, h, c) { + var d = t, _ = c + h; a ^= -1; - for (var m = o; m < p; m++) - a = a >>> 8 ^ u[(a ^ l[m]) & 255]; + for (var m = c; m < _; m++) + a = a >>> 8 ^ d[(a ^ l[m]) & 255]; return a ^ -1; } n.exports = r; @@ -37402,314 +37402,314 @@ ATOM`, x); ), l = t( /*! ./adler32 */ "./node_modules/upng-js/node_modules/pako/lib/zlib/adler32.js" - ), d = t( + ), h = t( /*! ./crc32 */ "./node_modules/upng-js/node_modules/pako/lib/zlib/crc32.js" - ), o = t( + ), c = t( /*! ./messages */ "./node_modules/upng-js/node_modules/pako/lib/zlib/messages.js" - ), u = 0, p = 1, m = 3, y = 4, w = 5, b = 0, A = 1, f = -2, s = -3, h = -5, _ = -1, g = 1, x = 2, c = 3, v = 4, M = 0, E = 2, $ = 8, k = 9, L = 15, z = 8, O = 29, R = 256, P = R + 1 + O, U = 30, B = 19, N = 2 * P + 1, G = 15, H = 3, W = 258, V = W + H + 1, re = 32, ie = 42, ee = 69, ce = 73, he = 91, le = 103, J = 113, Me = 666, se = 1, Ce = 2, ue = 3, ne = 4, _e = 3; - function Oe(I, ye) { - return I.msg = o[ye], ye; + ), d = 0, _ = 1, m = 3, y = 4, x = 5, b = 0, A = 1, f = -2, s = -3, u = -5, p = -1, g = 1, w = 2, o = 3, v = 4, M = 0, E = 2, $ = 8, k = 9, L = 15, z = 8, O = 29, R = 256, N = R + 1 + O, W = 30, B = 19, P = 2 * N + 1, G = 15, H = 3, U = 258, j = U + H + 1, re = 32, ie = 42, te = 69, ue = 73, de = 91, oe = 103, J = 113, Ee = 666, se = 1, Ae = 2, he = 3, ne = 4, _e = 3; + function Le(I, xe) { + return I.msg = c[xe], xe; } - function Re(I) { + function Be(I) { return (I << 1) - (I > 4 ? 9 : 0); } function Ue(I) { - for (var ye = I.length; --ye >= 0; ) - I[ye] = 0; + for (var xe = I.length; --xe >= 0; ) + I[xe] = 0; } - function We(I) { - var ye = I.state, ve = ye.pending; - ve > I.avail_out && (ve = I.avail_out), ve !== 0 && (r.arraySet(I.output, ye.pending_buf, ye.pending_out, ve, I.next_out), I.next_out += ve, ye.pending_out += ve, I.total_out += ve, I.avail_out -= ve, ye.pending -= ve, ye.pending === 0 && (ye.pending_out = 0)); + function He(I) { + var xe = I.state, be = xe.pending; + be > I.avail_out && (be = I.avail_out), be !== 0 && (r.arraySet(I.output, xe.pending_buf, xe.pending_out, be, I.next_out), I.next_out += be, xe.pending_out += be, I.total_out += be, I.avail_out -= be, xe.pending -= be, xe.pending === 0 && (xe.pending_out = 0)); } - function Ee(I, ye) { - a._tr_flush_block(I, I.block_start >= 0 ? I.block_start : -1, I.strstart - I.block_start, ye), I.block_start = I.strstart, We(I.strm); + function We(I, xe) { + a._tr_flush_block(I, I.block_start >= 0 ? I.block_start : -1, I.strstart - I.block_start, xe), I.block_start = I.strstart, He(I.strm); } - function Ae(I, ye) { - I.pending_buf[I.pending++] = ye; + function Ge(I, xe) { + I.pending_buf[I.pending++] = xe; } - function ge(I, ye) { - I.pending_buf[I.pending++] = ye >>> 8 & 255, I.pending_buf[I.pending++] = ye & 255; + function Ne(I, xe) { + I.pending_buf[I.pending++] = xe >>> 8 & 255, I.pending_buf[I.pending++] = xe & 255; } - function Le(I, ye, ve, Z) { - var de = I.avail_in; - return de > Z && (de = Z), de === 0 ? 0 : (I.avail_in -= de, r.arraySet(ye, I.input, I.next_in, de, ve), I.state.wrap === 1 ? I.adler = l(I.adler, ye, de, ve) : I.state.wrap === 2 && (I.adler = d(I.adler, ye, de, ve)), I.next_in += de, I.total_in += de, de); + function Pe(I, xe, be, q) { + var fe = I.avail_in; + return fe > q && (fe = q), fe === 0 ? 0 : (I.avail_in -= fe, r.arraySet(xe, I.input, I.next_in, fe, be), I.state.wrap === 1 ? I.adler = l(I.adler, xe, fe, be) : I.state.wrap === 2 && (I.adler = h(I.adler, xe, fe, be)), I.next_in += fe, I.total_in += fe, fe); } - function Te(I, ye) { - var ve = I.max_chain_length, Z = I.strstart, de, $e, Ye = I.prev_length, qe = I.nice_match, Xe = I.strstart > I.w_size - V ? I.strstart - (I.w_size - V) : 0, at = I.window, dt = I.w_mask, lt = I.prev, ot = I.strstart + W, st = at[Z + Ye - 1], bt = at[Z + Ye]; - I.prev_length >= I.good_match && (ve >>= 2), qe > I.lookahead && (qe = I.lookahead); + function Te(I, xe) { + var be = I.max_chain_length, q = I.strstart, fe, Ce, Ze = I.prev_length, Xe = I.nice_match, Ye = I.strstart > I.w_size - j ? I.strstart - (I.w_size - j) : 0, lt = I.window, dt = I.w_mask, it = I.prev, ot = I.strstart + U, nt = lt[q + Ze - 1], Ct = lt[q + Ze]; + I.prev_length >= I.good_match && (be >>= 2), Xe > I.lookahead && (Xe = I.lookahead); do - if (de = ye, !(at[de + Ye] !== bt || at[de + Ye - 1] !== st || at[de] !== at[Z] || at[++de] !== at[Z + 1])) { - Z += 2, de++; + if (fe = xe, !(lt[fe + Ze] !== Ct || lt[fe + Ze - 1] !== nt || lt[fe] !== lt[q] || lt[++fe] !== lt[q + 1])) { + q += 2, fe++; do ; - while (at[++Z] === at[++de] && at[++Z] === at[++de] && at[++Z] === at[++de] && at[++Z] === at[++de] && at[++Z] === at[++de] && at[++Z] === at[++de] && at[++Z] === at[++de] && at[++Z] === at[++de] && Z < ot); - if ($e = W - (ot - Z), Z = ot - W, $e > Ye) { - if (I.match_start = ye, Ye = $e, $e >= qe) + while (lt[++q] === lt[++fe] && lt[++q] === lt[++fe] && lt[++q] === lt[++fe] && lt[++q] === lt[++fe] && lt[++q] === lt[++fe] && lt[++q] === lt[++fe] && lt[++q] === lt[++fe] && lt[++q] === lt[++fe] && q < ot); + if (Ce = U - (ot - q), q = ot - U, Ce > Ze) { + if (I.match_start = xe, Ze = Ce, Ce >= Xe) break; - st = at[Z + Ye - 1], bt = at[Z + Ye]; + nt = lt[q + Ze - 1], Ct = lt[q + Ze]; } } - while ((ye = lt[ye & dt]) > Xe && --ve !== 0); - return Ye <= I.lookahead ? Ye : I.lookahead; + while ((xe = it[xe & dt]) > Ye && --be !== 0); + return Ze <= I.lookahead ? Ze : I.lookahead; } - function Ke(I) { - var ye = I.w_size, ve, Z, de, $e, Ye; + function Me(I) { + var xe = I.w_size, be, q, fe, Ce, Ze; do { - if ($e = I.window_size - I.lookahead - I.strstart, I.strstart >= ye + (ye - V)) { - r.arraySet(I.window, I.window, ye, ye, 0), I.match_start -= ye, I.strstart -= ye, I.block_start -= ye, Z = I.hash_size, ve = Z; + if (Ce = I.window_size - I.lookahead - I.strstart, I.strstart >= xe + (xe - j)) { + r.arraySet(I.window, I.window, xe, xe, 0), I.match_start -= xe, I.strstart -= xe, I.block_start -= xe, q = I.hash_size, be = q; do - de = I.head[--ve], I.head[ve] = de >= ye ? de - ye : 0; - while (--Z); - Z = ye, ve = Z; + fe = I.head[--be], I.head[be] = fe >= xe ? fe - xe : 0; + while (--q); + q = xe, be = q; do - de = I.prev[--ve], I.prev[ve] = de >= ye ? de - ye : 0; - while (--Z); - $e += ye; + fe = I.prev[--be], I.prev[be] = fe >= xe ? fe - xe : 0; + while (--q); + Ce += xe; } if (I.strm.avail_in === 0) break; - if (Z = Le(I.strm, I.window, I.strstart + I.lookahead, $e), I.lookahead += Z, I.lookahead + I.insert >= H) - for (Ye = I.strstart - I.insert, I.ins_h = I.window[Ye], I.ins_h = (I.ins_h << I.hash_shift ^ I.window[Ye + 1]) & I.hash_mask; I.insert && (I.ins_h = (I.ins_h << I.hash_shift ^ I.window[Ye + H - 1]) & I.hash_mask, I.prev[Ye & I.w_mask] = I.head[I.ins_h], I.head[I.ins_h] = Ye, Ye++, I.insert--, !(I.lookahead + I.insert < H)); ) + if (q = Pe(I.strm, I.window, I.strstart + I.lookahead, Ce), I.lookahead += q, I.lookahead + I.insert >= H) + for (Ze = I.strstart - I.insert, I.ins_h = I.window[Ze], I.ins_h = (I.ins_h << I.hash_shift ^ I.window[Ze + 1]) & I.hash_mask; I.insert && (I.ins_h = (I.ins_h << I.hash_shift ^ I.window[Ze + H - 1]) & I.hash_mask, I.prev[Ze & I.w_mask] = I.head[I.ins_h], I.head[I.ins_h] = Ze, Ze++, I.insert--, !(I.lookahead + I.insert < H)); ) ; - } while (I.lookahead < V && I.strm.avail_in !== 0); + } while (I.lookahead < j && I.strm.avail_in !== 0); } - function je(I, ye) { - var ve = 65535; - for (ve > I.pending_buf_size - 5 && (ve = I.pending_buf_size - 5); ; ) { + function De(I, xe) { + var be = 65535; + for (be > I.pending_buf_size - 5 && (be = I.pending_buf_size - 5); ; ) { if (I.lookahead <= 1) { - if (Ke(I), I.lookahead === 0 && ye === u) + if (Me(I), I.lookahead === 0 && xe === d) return se; if (I.lookahead === 0) break; } I.strstart += I.lookahead, I.lookahead = 0; - var Z = I.block_start + ve; - if ((I.strstart === 0 || I.strstart >= Z) && (I.lookahead = I.strstart - Z, I.strstart = Z, Ee(I, !1), I.strm.avail_out === 0) || I.strstart - I.block_start >= I.w_size - V && (Ee(I, !1), I.strm.avail_out === 0)) + var q = I.block_start + be; + if ((I.strstart === 0 || I.strstart >= q) && (I.lookahead = I.strstart - q, I.strstart = q, We(I, !1), I.strm.avail_out === 0) || I.strstart - I.block_start >= I.w_size - j && (We(I, !1), I.strm.avail_out === 0)) return se; } - return I.insert = 0, ye === y ? (Ee(I, !0), I.strm.avail_out === 0 ? ue : ne) : (I.strstart > I.block_start && (Ee(I, !1), I.strm.avail_out === 0), se); + return I.insert = 0, xe === y ? (We(I, !0), I.strm.avail_out === 0 ? he : ne) : (I.strstart > I.block_start && (We(I, !1), I.strm.avail_out === 0), se); } - function Y(I, ye) { - for (var ve, Z; ; ) { - if (I.lookahead < V) { - if (Ke(I), I.lookahead < V && ye === u) + function V(I, xe) { + for (var be, q; ; ) { + if (I.lookahead < j) { + if (Me(I), I.lookahead < j && xe === d) return se; if (I.lookahead === 0) break; } - if (ve = 0, I.lookahead >= H && (I.ins_h = (I.ins_h << I.hash_shift ^ I.window[I.strstart + H - 1]) & I.hash_mask, ve = I.prev[I.strstart & I.w_mask] = I.head[I.ins_h], I.head[I.ins_h] = I.strstart), ve !== 0 && I.strstart - ve <= I.w_size - V && (I.match_length = Te(I, ve)), I.match_length >= H) - if (Z = a._tr_tally(I, I.strstart - I.match_start, I.match_length - H), I.lookahead -= I.match_length, I.match_length <= I.max_lazy_match && I.lookahead >= H) { + if (be = 0, I.lookahead >= H && (I.ins_h = (I.ins_h << I.hash_shift ^ I.window[I.strstart + H - 1]) & I.hash_mask, be = I.prev[I.strstart & I.w_mask] = I.head[I.ins_h], I.head[I.ins_h] = I.strstart), be !== 0 && I.strstart - be <= I.w_size - j && (I.match_length = Te(I, be)), I.match_length >= H) + if (q = a._tr_tally(I, I.strstart - I.match_start, I.match_length - H), I.lookahead -= I.match_length, I.match_length <= I.max_lazy_match && I.lookahead >= H) { I.match_length--; do - I.strstart++, I.ins_h = (I.ins_h << I.hash_shift ^ I.window[I.strstart + H - 1]) & I.hash_mask, ve = I.prev[I.strstart & I.w_mask] = I.head[I.ins_h], I.head[I.ins_h] = I.strstart; + I.strstart++, I.ins_h = (I.ins_h << I.hash_shift ^ I.window[I.strstart + H - 1]) & I.hash_mask, be = I.prev[I.strstart & I.w_mask] = I.head[I.ins_h], I.head[I.ins_h] = I.strstart; while (--I.match_length !== 0); I.strstart++; } else I.strstart += I.match_length, I.match_length = 0, I.ins_h = I.window[I.strstart], I.ins_h = (I.ins_h << I.hash_shift ^ I.window[I.strstart + 1]) & I.hash_mask; else - Z = a._tr_tally(I, 0, I.window[I.strstart]), I.lookahead--, I.strstart++; - if (Z && (Ee(I, !1), I.strm.avail_out === 0)) + q = a._tr_tally(I, 0, I.window[I.strstart]), I.lookahead--, I.strstart++; + if (q && (We(I, !1), I.strm.avail_out === 0)) return se; } - return I.insert = I.strstart < H - 1 ? I.strstart : H - 1, ye === y ? (Ee(I, !0), I.strm.avail_out === 0 ? ue : ne) : I.last_lit && (Ee(I, !1), I.strm.avail_out === 0) ? se : Ce; + return I.insert = I.strstart < H - 1 ? I.strstart : H - 1, xe === y ? (We(I, !0), I.strm.avail_out === 0 ? he : ne) : I.last_lit && (We(I, !1), I.strm.avail_out === 0) ? se : Ae; } - function q(I, ye) { - for (var ve, Z, de; ; ) { - if (I.lookahead < V) { - if (Ke(I), I.lookahead < V && ye === u) + function Z(I, xe) { + for (var be, q, fe; ; ) { + if (I.lookahead < j) { + if (Me(I), I.lookahead < j && xe === d) return se; if (I.lookahead === 0) break; } - if (ve = 0, I.lookahead >= H && (I.ins_h = (I.ins_h << I.hash_shift ^ I.window[I.strstart + H - 1]) & I.hash_mask, ve = I.prev[I.strstart & I.w_mask] = I.head[I.ins_h], I.head[I.ins_h] = I.strstart), I.prev_length = I.match_length, I.prev_match = I.match_start, I.match_length = H - 1, ve !== 0 && I.prev_length < I.max_lazy_match && I.strstart - ve <= I.w_size - V && (I.match_length = Te(I, ve), I.match_length <= 5 && (I.strategy === g || I.match_length === H && I.strstart - I.match_start > 4096) && (I.match_length = H - 1)), I.prev_length >= H && I.match_length <= I.prev_length) { - de = I.strstart + I.lookahead - H, Z = a._tr_tally(I, I.strstart - 1 - I.prev_match, I.prev_length - H), I.lookahead -= I.prev_length - 1, I.prev_length -= 2; + if (be = 0, I.lookahead >= H && (I.ins_h = (I.ins_h << I.hash_shift ^ I.window[I.strstart + H - 1]) & I.hash_mask, be = I.prev[I.strstart & I.w_mask] = I.head[I.ins_h], I.head[I.ins_h] = I.strstart), I.prev_length = I.match_length, I.prev_match = I.match_start, I.match_length = H - 1, be !== 0 && I.prev_length < I.max_lazy_match && I.strstart - be <= I.w_size - j && (I.match_length = Te(I, be), I.match_length <= 5 && (I.strategy === g || I.match_length === H && I.strstart - I.match_start > 4096) && (I.match_length = H - 1)), I.prev_length >= H && I.match_length <= I.prev_length) { + fe = I.strstart + I.lookahead - H, q = a._tr_tally(I, I.strstart - 1 - I.prev_match, I.prev_length - H), I.lookahead -= I.prev_length - 1, I.prev_length -= 2; do - ++I.strstart <= de && (I.ins_h = (I.ins_h << I.hash_shift ^ I.window[I.strstart + H - 1]) & I.hash_mask, ve = I.prev[I.strstart & I.w_mask] = I.head[I.ins_h], I.head[I.ins_h] = I.strstart); + ++I.strstart <= fe && (I.ins_h = (I.ins_h << I.hash_shift ^ I.window[I.strstart + H - 1]) & I.hash_mask, be = I.prev[I.strstart & I.w_mask] = I.head[I.ins_h], I.head[I.ins_h] = I.strstart); while (--I.prev_length !== 0); - if (I.match_available = 0, I.match_length = H - 1, I.strstart++, Z && (Ee(I, !1), I.strm.avail_out === 0)) + if (I.match_available = 0, I.match_length = H - 1, I.strstart++, q && (We(I, !1), I.strm.avail_out === 0)) return se; } else if (I.match_available) { - if (Z = a._tr_tally(I, 0, I.window[I.strstart - 1]), Z && Ee(I, !1), I.strstart++, I.lookahead--, I.strm.avail_out === 0) + if (q = a._tr_tally(I, 0, I.window[I.strstart - 1]), q && We(I, !1), I.strstart++, I.lookahead--, I.strm.avail_out === 0) return se; } else I.match_available = 1, I.strstart++, I.lookahead--; } - return I.match_available && (Z = a._tr_tally(I, 0, I.window[I.strstart - 1]), I.match_available = 0), I.insert = I.strstart < H - 1 ? I.strstart : H - 1, ye === y ? (Ee(I, !0), I.strm.avail_out === 0 ? ue : ne) : I.last_lit && (Ee(I, !1), I.strm.avail_out === 0) ? se : Ce; + return I.match_available && (q = a._tr_tally(I, 0, I.window[I.strstart - 1]), I.match_available = 0), I.insert = I.strstart < H - 1 ? I.strstart : H - 1, xe === y ? (We(I, !0), I.strm.avail_out === 0 ? he : ne) : I.last_lit && (We(I, !1), I.strm.avail_out === 0) ? se : Ae; } - function te(I, ye) { - for (var ve, Z, de, $e, Ye = I.window; ; ) { - if (I.lookahead <= W) { - if (Ke(I), I.lookahead <= W && ye === u) + function ee(I, xe) { + for (var be, q, fe, Ce, Ze = I.window; ; ) { + if (I.lookahead <= U) { + if (Me(I), I.lookahead <= U && xe === d) return se; if (I.lookahead === 0) break; } - if (I.match_length = 0, I.lookahead >= H && I.strstart > 0 && (de = I.strstart - 1, Z = Ye[de], Z === Ye[++de] && Z === Ye[++de] && Z === Ye[++de])) { - $e = I.strstart + W; + if (I.match_length = 0, I.lookahead >= H && I.strstart > 0 && (fe = I.strstart - 1, q = Ze[fe], q === Ze[++fe] && q === Ze[++fe] && q === Ze[++fe])) { + Ce = I.strstart + U; do ; - while (Z === Ye[++de] && Z === Ye[++de] && Z === Ye[++de] && Z === Ye[++de] && Z === Ye[++de] && Z === Ye[++de] && Z === Ye[++de] && Z === Ye[++de] && de < $e); - I.match_length = W - ($e - de), I.match_length > I.lookahead && (I.match_length = I.lookahead); + while (q === Ze[++fe] && q === Ze[++fe] && q === Ze[++fe] && q === Ze[++fe] && q === Ze[++fe] && q === Ze[++fe] && q === Ze[++fe] && q === Ze[++fe] && fe < Ce); + I.match_length = U - (Ce - fe), I.match_length > I.lookahead && (I.match_length = I.lookahead); } - if (I.match_length >= H ? (ve = a._tr_tally(I, 1, I.match_length - H), I.lookahead -= I.match_length, I.strstart += I.match_length, I.match_length = 0) : (ve = a._tr_tally(I, 0, I.window[I.strstart]), I.lookahead--, I.strstart++), ve && (Ee(I, !1), I.strm.avail_out === 0)) + if (I.match_length >= H ? (be = a._tr_tally(I, 1, I.match_length - H), I.lookahead -= I.match_length, I.strstart += I.match_length, I.match_length = 0) : (be = a._tr_tally(I, 0, I.window[I.strstart]), I.lookahead--, I.strstart++), be && (We(I, !1), I.strm.avail_out === 0)) return se; } - return I.insert = 0, ye === y ? (Ee(I, !0), I.strm.avail_out === 0 ? ue : ne) : I.last_lit && (Ee(I, !1), I.strm.avail_out === 0) ? se : Ce; + return I.insert = 0, xe === y ? (We(I, !0), I.strm.avail_out === 0 ? he : ne) : I.last_lit && (We(I, !1), I.strm.avail_out === 0) ? se : Ae; } - function we(I, ye) { - for (var ve; ; ) { - if (I.lookahead === 0 && (Ke(I), I.lookahead === 0)) { - if (ye === u) + function ye(I, xe) { + for (var be; ; ) { + if (I.lookahead === 0 && (Me(I), I.lookahead === 0)) { + if (xe === d) return se; break; } - if (I.match_length = 0, ve = a._tr_tally(I, 0, I.window[I.strstart]), I.lookahead--, I.strstart++, ve && (Ee(I, !1), I.strm.avail_out === 0)) + if (I.match_length = 0, be = a._tr_tally(I, 0, I.window[I.strstart]), I.lookahead--, I.strstart++, be && (We(I, !1), I.strm.avail_out === 0)) return se; } - return I.insert = 0, ye === y ? (Ee(I, !0), I.strm.avail_out === 0 ? ue : ne) : I.last_lit && (Ee(I, !1), I.strm.avail_out === 0) ? se : Ce; + return I.insert = 0, xe === y ? (We(I, !0), I.strm.avail_out === 0 ? he : ne) : I.last_lit && (We(I, !1), I.strm.avail_out === 0) ? se : Ae; } - function me(I, ye, ve, Z, de) { - this.good_length = I, this.max_lazy = ye, this.nice_length = ve, this.max_chain = Z, this.func = de; + function ce(I, xe, be, q, fe) { + this.good_length = I, this.max_lazy = xe, this.nice_length = be, this.max_chain = q, this.func = fe; } - var Pe; - Pe = [ + var Ie; + Ie = [ /* good lazy nice chain */ - new me(0, 0, 0, 0, je), + new ce(0, 0, 0, 0, De), /* 0 store only */ - new me(4, 4, 8, 4, Y), + new ce(4, 4, 8, 4, V), /* 1 max speed, no lazy matches */ - new me(4, 5, 16, 8, Y), + new ce(4, 5, 16, 8, V), /* 2 */ - new me(4, 6, 32, 32, Y), + new ce(4, 6, 32, 32, V), /* 3 */ - new me(4, 4, 16, 16, q), + new ce(4, 4, 16, 16, Z), /* 4 lazy matches */ - new me(8, 16, 32, 32, q), + new ce(8, 16, 32, 32, Z), /* 5 */ - new me(8, 16, 128, 128, q), + new ce(8, 16, 128, 128, Z), /* 6 */ - new me(8, 32, 128, 256, q), + new ce(8, 32, 128, 256, Z), /* 7 */ - new me(32, 128, 258, 1024, q), + new ce(32, 128, 258, 1024, Z), /* 8 */ - new me(32, 258, 258, 4096, q) + new ce(32, 258, 258, 4096, Z) /* 9 max compression */ ]; - function Fe(I) { - I.window_size = 2 * I.w_size, Ue(I.head), I.max_lazy_match = Pe[I.level].max_lazy, I.good_match = Pe[I.level].good_length, I.nice_match = Pe[I.level].nice_length, I.max_chain_length = Pe[I.level].max_chain, I.strstart = 0, I.block_start = 0, I.lookahead = 0, I.insert = 0, I.match_length = I.prev_length = H - 1, I.match_available = 0, I.ins_h = 0; + function ke(I) { + I.window_size = 2 * I.w_size, Ue(I.head), I.max_lazy_match = Ie[I.level].max_lazy, I.good_match = Ie[I.level].good_length, I.nice_match = Ie[I.level].nice_length, I.max_chain_length = Ie[I.level].max_chain, I.strstart = 0, I.block_start = 0, I.lookahead = 0, I.insert = 0, I.match_length = I.prev_length = H - 1, I.match_available = 0, I.ins_h = 0; } - function K() { - this.strm = null, this.status = 0, this.pending_buf = null, this.pending_buf_size = 0, this.pending_out = 0, this.pending = 0, this.wrap = 0, this.gzhead = null, this.gzindex = 0, this.method = $, this.last_flush = -1, this.w_size = 0, this.w_bits = 0, this.w_mask = 0, this.window = null, this.window_size = 0, this.prev = null, this.head = null, this.ins_h = 0, this.hash_size = 0, this.hash_bits = 0, this.hash_mask = 0, this.hash_shift = 0, this.block_start = 0, this.match_length = 0, this.prev_match = 0, this.match_available = 0, this.strstart = 0, this.match_start = 0, this.lookahead = 0, this.prev_length = 0, this.max_chain_length = 0, this.max_lazy_match = 0, this.level = 0, this.strategy = 0, this.good_match = 0, this.nice_match = 0, this.dyn_ltree = new r.Buf16(N * 2), this.dyn_dtree = new r.Buf16((2 * U + 1) * 2), this.bl_tree = new r.Buf16((2 * B + 1) * 2), Ue(this.dyn_ltree), Ue(this.dyn_dtree), Ue(this.bl_tree), this.l_desc = null, this.d_desc = null, this.bl_desc = null, this.bl_count = new r.Buf16(G + 1), this.heap = new r.Buf16(2 * P + 1), Ue(this.heap), this.heap_len = 0, this.heap_max = 0, this.depth = new r.Buf16(2 * P + 1), Ue(this.depth), this.l_buf = 0, this.lit_bufsize = 0, this.last_lit = 0, this.d_buf = 0, this.opt_len = 0, this.static_len = 0, this.matches = 0, this.insert = 0, this.bi_buf = 0, this.bi_valid = 0; + function Y() { + this.strm = null, this.status = 0, this.pending_buf = null, this.pending_buf_size = 0, this.pending_out = 0, this.pending = 0, this.wrap = 0, this.gzhead = null, this.gzindex = 0, this.method = $, this.last_flush = -1, this.w_size = 0, this.w_bits = 0, this.w_mask = 0, this.window = null, this.window_size = 0, this.prev = null, this.head = null, this.ins_h = 0, this.hash_size = 0, this.hash_bits = 0, this.hash_mask = 0, this.hash_shift = 0, this.block_start = 0, this.match_length = 0, this.prev_match = 0, this.match_available = 0, this.strstart = 0, this.match_start = 0, this.lookahead = 0, this.prev_length = 0, this.max_chain_length = 0, this.max_lazy_match = 0, this.level = 0, this.strategy = 0, this.good_match = 0, this.nice_match = 0, this.dyn_ltree = new r.Buf16(P * 2), this.dyn_dtree = new r.Buf16((2 * W + 1) * 2), this.bl_tree = new r.Buf16((2 * B + 1) * 2), Ue(this.dyn_ltree), Ue(this.dyn_dtree), Ue(this.bl_tree), this.l_desc = null, this.d_desc = null, this.bl_desc = null, this.bl_count = new r.Buf16(G + 1), this.heap = new r.Buf16(2 * N + 1), Ue(this.heap), this.heap_len = 0, this.heap_max = 0, this.depth = new r.Buf16(2 * N + 1), Ue(this.depth), this.l_buf = 0, this.lit_bufsize = 0, this.last_lit = 0, this.d_buf = 0, this.opt_len = 0, this.static_len = 0, this.matches = 0, this.insert = 0, this.bi_buf = 0, this.bi_valid = 0; } - function fe(I) { - var ye; - return !I || !I.state ? Oe(I, f) : (I.total_in = I.total_out = 0, I.data_type = E, ye = I.state, ye.pending = 0, ye.pending_out = 0, ye.wrap < 0 && (ye.wrap = -ye.wrap), ye.status = ye.wrap ? ie : J, I.adler = ye.wrap === 2 ? 0 : 1, ye.last_flush = u, a._tr_init(ye), b); + function me(I) { + var xe; + return !I || !I.state ? Le(I, f) : (I.total_in = I.total_out = 0, I.data_type = E, xe = I.state, xe.pending = 0, xe.pending_out = 0, xe.wrap < 0 && (xe.wrap = -xe.wrap), xe.status = xe.wrap ? ie : J, I.adler = xe.wrap === 2 ? 0 : 1, xe.last_flush = d, a._tr_init(xe), b); } - function Se(I) { - var ye = fe(I); - return ye === b && Fe(I.state), ye; + function we(I) { + var xe = me(I); + return xe === b && ke(I.state), xe; } - function Ne(I, ye) { - return !I || !I.state || I.state.wrap !== 2 ? f : (I.state.gzhead = ye, b); + function Re(I, xe) { + return !I || !I.state || I.state.wrap !== 2 ? f : (I.state.gzhead = xe, b); } - function pe(I, ye, ve, Z, de, $e) { + function pe(I, xe, be, q, fe, Ce) { if (!I) return f; - var Ye = 1; - if (ye === _ && (ye = 6), Z < 0 ? (Ye = 0, Z = -Z) : Z > 15 && (Ye = 2, Z -= 16), de < 1 || de > k || ve !== $ || Z < 8 || Z > 15 || ye < 0 || ye > 9 || $e < 0 || $e > v) - return Oe(I, f); - Z === 8 && (Z = 9); - var qe = new K(); - return I.state = qe, qe.strm = I, qe.wrap = Ye, qe.gzhead = null, qe.w_bits = Z, qe.w_size = 1 << qe.w_bits, qe.w_mask = qe.w_size - 1, qe.hash_bits = de + 7, qe.hash_size = 1 << qe.hash_bits, qe.hash_mask = qe.hash_size - 1, qe.hash_shift = ~~((qe.hash_bits + H - 1) / H), qe.window = new r.Buf8(qe.w_size * 2), qe.head = new r.Buf16(qe.hash_size), qe.prev = new r.Buf16(qe.w_size), qe.lit_bufsize = 1 << de + 6, qe.pending_buf_size = qe.lit_bufsize * 4, qe.pending_buf = new r.Buf8(qe.pending_buf_size), qe.d_buf = 1 * qe.lit_bufsize, qe.l_buf = 3 * qe.lit_bufsize, qe.level = ye, qe.strategy = $e, qe.method = ve, Se(I); - } - function ke(I, ye) { - return pe(I, ye, $, L, z, M); - } - function X(I, ye) { - var ve, Z, de, $e; - if (!I || !I.state || ye > w || ye < 0) - return I ? Oe(I, f) : f; - if (Z = I.state, !I.output || !I.input && I.avail_in !== 0 || Z.status === Me && ye !== y) - return Oe(I, I.avail_out === 0 ? h : f); - if (Z.strm = I, ve = Z.last_flush, Z.last_flush = ye, Z.status === ie) - if (Z.wrap === 2) - I.adler = 0, Ae(Z, 31), Ae(Z, 139), Ae(Z, 8), Z.gzhead ? (Ae( - Z, - (Z.gzhead.text ? 1 : 0) + (Z.gzhead.hcrc ? 2 : 0) + (Z.gzhead.extra ? 4 : 0) + (Z.gzhead.name ? 8 : 0) + (Z.gzhead.comment ? 16 : 0) - ), Ae(Z, Z.gzhead.time & 255), Ae(Z, Z.gzhead.time >> 8 & 255), Ae(Z, Z.gzhead.time >> 16 & 255), Ae(Z, Z.gzhead.time >> 24 & 255), Ae(Z, Z.level === 9 ? 2 : Z.strategy >= x || Z.level < 2 ? 4 : 0), Ae(Z, Z.gzhead.os & 255), Z.gzhead.extra && Z.gzhead.extra.length && (Ae(Z, Z.gzhead.extra.length & 255), Ae(Z, Z.gzhead.extra.length >> 8 & 255)), Z.gzhead.hcrc && (I.adler = d(I.adler, Z.pending_buf, Z.pending, 0)), Z.gzindex = 0, Z.status = ee) : (Ae(Z, 0), Ae(Z, 0), Ae(Z, 0), Ae(Z, 0), Ae(Z, 0), Ae(Z, Z.level === 9 ? 2 : Z.strategy >= x || Z.level < 2 ? 4 : 0), Ae(Z, _e), Z.status = J); + var Ze = 1; + if (xe === p && (xe = 6), q < 0 ? (Ze = 0, q = -q) : q > 15 && (Ze = 2, q -= 16), fe < 1 || fe > k || be !== $ || q < 8 || q > 15 || xe < 0 || xe > 9 || Ce < 0 || Ce > v) + return Le(I, f); + q === 8 && (q = 9); + var Xe = new Y(); + return I.state = Xe, Xe.strm = I, Xe.wrap = Ze, Xe.gzhead = null, Xe.w_bits = q, Xe.w_size = 1 << Xe.w_bits, Xe.w_mask = Xe.w_size - 1, Xe.hash_bits = fe + 7, Xe.hash_size = 1 << Xe.hash_bits, Xe.hash_mask = Xe.hash_size - 1, Xe.hash_shift = ~~((Xe.hash_bits + H - 1) / H), Xe.window = new r.Buf8(Xe.w_size * 2), Xe.head = new r.Buf16(Xe.hash_size), Xe.prev = new r.Buf16(Xe.w_size), Xe.lit_bufsize = 1 << fe + 6, Xe.pending_buf_size = Xe.lit_bufsize * 4, Xe.pending_buf = new r.Buf8(Xe.pending_buf_size), Xe.d_buf = 1 * Xe.lit_bufsize, Xe.l_buf = 3 * Xe.lit_bufsize, Xe.level = xe, Xe.strategy = Ce, Xe.method = be, we(I); + } + function $e(I, xe) { + return pe(I, xe, $, L, z, M); + } + function X(I, xe) { + var be, q, fe, Ce; + if (!I || !I.state || xe > x || xe < 0) + return I ? Le(I, f) : f; + if (q = I.state, !I.output || !I.input && I.avail_in !== 0 || q.status === Ee && xe !== y) + return Le(I, I.avail_out === 0 ? u : f); + if (q.strm = I, be = q.last_flush, q.last_flush = xe, q.status === ie) + if (q.wrap === 2) + I.adler = 0, Ge(q, 31), Ge(q, 139), Ge(q, 8), q.gzhead ? (Ge( + q, + (q.gzhead.text ? 1 : 0) + (q.gzhead.hcrc ? 2 : 0) + (q.gzhead.extra ? 4 : 0) + (q.gzhead.name ? 8 : 0) + (q.gzhead.comment ? 16 : 0) + ), Ge(q, q.gzhead.time & 255), Ge(q, q.gzhead.time >> 8 & 255), Ge(q, q.gzhead.time >> 16 & 255), Ge(q, q.gzhead.time >> 24 & 255), Ge(q, q.level === 9 ? 2 : q.strategy >= w || q.level < 2 ? 4 : 0), Ge(q, q.gzhead.os & 255), q.gzhead.extra && q.gzhead.extra.length && (Ge(q, q.gzhead.extra.length & 255), Ge(q, q.gzhead.extra.length >> 8 & 255)), q.gzhead.hcrc && (I.adler = h(I.adler, q.pending_buf, q.pending, 0)), q.gzindex = 0, q.status = te) : (Ge(q, 0), Ge(q, 0), Ge(q, 0), Ge(q, 0), Ge(q, 0), Ge(q, q.level === 9 ? 2 : q.strategy >= w || q.level < 2 ? 4 : 0), Ge(q, _e), q.status = J); else { - var Ye = $ + (Z.w_bits - 8 << 4) << 8, qe = -1; - Z.strategy >= x || Z.level < 2 ? qe = 0 : Z.level < 6 ? qe = 1 : Z.level === 6 ? qe = 2 : qe = 3, Ye |= qe << 6, Z.strstart !== 0 && (Ye |= re), Ye += 31 - Ye % 31, Z.status = J, ge(Z, Ye), Z.strstart !== 0 && (ge(Z, I.adler >>> 16), ge(Z, I.adler & 65535)), I.adler = 1; - } - if (Z.status === ee) - if (Z.gzhead.extra) { - for (de = Z.pending; Z.gzindex < (Z.gzhead.extra.length & 65535) && !(Z.pending === Z.pending_buf_size && (Z.gzhead.hcrc && Z.pending > de && (I.adler = d(I.adler, Z.pending_buf, Z.pending - de, de)), We(I), de = Z.pending, Z.pending === Z.pending_buf_size)); ) - Ae(Z, Z.gzhead.extra[Z.gzindex] & 255), Z.gzindex++; - Z.gzhead.hcrc && Z.pending > de && (I.adler = d(I.adler, Z.pending_buf, Z.pending - de, de)), Z.gzindex === Z.gzhead.extra.length && (Z.gzindex = 0, Z.status = ce); + var Ze = $ + (q.w_bits - 8 << 4) << 8, Xe = -1; + q.strategy >= w || q.level < 2 ? Xe = 0 : q.level < 6 ? Xe = 1 : q.level === 6 ? Xe = 2 : Xe = 3, Ze |= Xe << 6, q.strstart !== 0 && (Ze |= re), Ze += 31 - Ze % 31, q.status = J, Ne(q, Ze), q.strstart !== 0 && (Ne(q, I.adler >>> 16), Ne(q, I.adler & 65535)), I.adler = 1; + } + if (q.status === te) + if (q.gzhead.extra) { + for (fe = q.pending; q.gzindex < (q.gzhead.extra.length & 65535) && !(q.pending === q.pending_buf_size && (q.gzhead.hcrc && q.pending > fe && (I.adler = h(I.adler, q.pending_buf, q.pending - fe, fe)), He(I), fe = q.pending, q.pending === q.pending_buf_size)); ) + Ge(q, q.gzhead.extra[q.gzindex] & 255), q.gzindex++; + q.gzhead.hcrc && q.pending > fe && (I.adler = h(I.adler, q.pending_buf, q.pending - fe, fe)), q.gzindex === q.gzhead.extra.length && (q.gzindex = 0, q.status = ue); } else - Z.status = ce; - if (Z.status === ce) - if (Z.gzhead.name) { - de = Z.pending; + q.status = ue; + if (q.status === ue) + if (q.gzhead.name) { + fe = q.pending; do { - if (Z.pending === Z.pending_buf_size && (Z.gzhead.hcrc && Z.pending > de && (I.adler = d(I.adler, Z.pending_buf, Z.pending - de, de)), We(I), de = Z.pending, Z.pending === Z.pending_buf_size)) { - $e = 1; + if (q.pending === q.pending_buf_size && (q.gzhead.hcrc && q.pending > fe && (I.adler = h(I.adler, q.pending_buf, q.pending - fe, fe)), He(I), fe = q.pending, q.pending === q.pending_buf_size)) { + Ce = 1; break; } - Z.gzindex < Z.gzhead.name.length ? $e = Z.gzhead.name.charCodeAt(Z.gzindex++) & 255 : $e = 0, Ae(Z, $e); - } while ($e !== 0); - Z.gzhead.hcrc && Z.pending > de && (I.adler = d(I.adler, Z.pending_buf, Z.pending - de, de)), $e === 0 && (Z.gzindex = 0, Z.status = he); + q.gzindex < q.gzhead.name.length ? Ce = q.gzhead.name.charCodeAt(q.gzindex++) & 255 : Ce = 0, Ge(q, Ce); + } while (Ce !== 0); + q.gzhead.hcrc && q.pending > fe && (I.adler = h(I.adler, q.pending_buf, q.pending - fe, fe)), Ce === 0 && (q.gzindex = 0, q.status = de); } else - Z.status = he; - if (Z.status === he) - if (Z.gzhead.comment) { - de = Z.pending; + q.status = de; + if (q.status === de) + if (q.gzhead.comment) { + fe = q.pending; do { - if (Z.pending === Z.pending_buf_size && (Z.gzhead.hcrc && Z.pending > de && (I.adler = d(I.adler, Z.pending_buf, Z.pending - de, de)), We(I), de = Z.pending, Z.pending === Z.pending_buf_size)) { - $e = 1; + if (q.pending === q.pending_buf_size && (q.gzhead.hcrc && q.pending > fe && (I.adler = h(I.adler, q.pending_buf, q.pending - fe, fe)), He(I), fe = q.pending, q.pending === q.pending_buf_size)) { + Ce = 1; break; } - Z.gzindex < Z.gzhead.comment.length ? $e = Z.gzhead.comment.charCodeAt(Z.gzindex++) & 255 : $e = 0, Ae(Z, $e); - } while ($e !== 0); - Z.gzhead.hcrc && Z.pending > de && (I.adler = d(I.adler, Z.pending_buf, Z.pending - de, de)), $e === 0 && (Z.status = le); + q.gzindex < q.gzhead.comment.length ? Ce = q.gzhead.comment.charCodeAt(q.gzindex++) & 255 : Ce = 0, Ge(q, Ce); + } while (Ce !== 0); + q.gzhead.hcrc && q.pending > fe && (I.adler = h(I.adler, q.pending_buf, q.pending - fe, fe)), Ce === 0 && (q.status = oe); } else - Z.status = le; - if (Z.status === le && (Z.gzhead.hcrc ? (Z.pending + 2 > Z.pending_buf_size && We(I), Z.pending + 2 <= Z.pending_buf_size && (Ae(Z, I.adler & 255), Ae(Z, I.adler >> 8 & 255), I.adler = 0, Z.status = J)) : Z.status = J), Z.pending !== 0) { - if (We(I), I.avail_out === 0) - return Z.last_flush = -1, b; - } else if (I.avail_in === 0 && Re(ye) <= Re(ve) && ye !== y) - return Oe(I, h); - if (Z.status === Me && I.avail_in !== 0) - return Oe(I, h); - if (I.avail_in !== 0 || Z.lookahead !== 0 || ye !== u && Z.status !== Me) { - var Xe = Z.strategy === x ? we(Z, ye) : Z.strategy === c ? te(Z, ye) : Pe[Z.level].func(Z, ye); - if ((Xe === ue || Xe === ne) && (Z.status = Me), Xe === se || Xe === ue) - return I.avail_out === 0 && (Z.last_flush = -1), b; - if (Xe === Ce && (ye === p ? a._tr_align(Z) : ye !== w && (a._tr_stored_block(Z, 0, 0, !1), ye === m && (Ue(Z.head), Z.lookahead === 0 && (Z.strstart = 0, Z.block_start = 0, Z.insert = 0))), We(I), I.avail_out === 0)) - return Z.last_flush = -1, b; - } - return ye !== y ? b : Z.wrap <= 0 ? A : (Z.wrap === 2 ? (Ae(Z, I.adler & 255), Ae(Z, I.adler >> 8 & 255), Ae(Z, I.adler >> 16 & 255), Ae(Z, I.adler >> 24 & 255), Ae(Z, I.total_in & 255), Ae(Z, I.total_in >> 8 & 255), Ae(Z, I.total_in >> 16 & 255), Ae(Z, I.total_in >> 24 & 255)) : (ge(Z, I.adler >>> 16), ge(Z, I.adler & 65535)), We(I), Z.wrap > 0 && (Z.wrap = -Z.wrap), Z.pending !== 0 ? b : A); - } - function Be(I) { - var ye; - return !I || !I.state ? f : (ye = I.state.status, ye !== ie && ye !== ee && ye !== ce && ye !== he && ye !== le && ye !== J && ye !== Me ? Oe(I, f) : (I.state = null, ye === J ? Oe(I, s) : b)); - } - function Ge(I, ye) { - var ve = ye.length, Z, de, $e, Ye, qe, Xe, at, dt; - if (!I || !I.state || (Z = I.state, Ye = Z.wrap, Ye === 2 || Ye === 1 && Z.status !== ie || Z.lookahead)) + q.status = oe; + if (q.status === oe && (q.gzhead.hcrc ? (q.pending + 2 > q.pending_buf_size && He(I), q.pending + 2 <= q.pending_buf_size && (Ge(q, I.adler & 255), Ge(q, I.adler >> 8 & 255), I.adler = 0, q.status = J)) : q.status = J), q.pending !== 0) { + if (He(I), I.avail_out === 0) + return q.last_flush = -1, b; + } else if (I.avail_in === 0 && Be(xe) <= Be(be) && xe !== y) + return Le(I, u); + if (q.status === Ee && I.avail_in !== 0) + return Le(I, u); + if (I.avail_in !== 0 || q.lookahead !== 0 || xe !== d && q.status !== Ee) { + var Ye = q.strategy === w ? ye(q, xe) : q.strategy === o ? ee(q, xe) : Ie[q.level].func(q, xe); + if ((Ye === he || Ye === ne) && (q.status = Ee), Ye === se || Ye === he) + return I.avail_out === 0 && (q.last_flush = -1), b; + if (Ye === Ae && (xe === _ ? a._tr_align(q) : xe !== x && (a._tr_stored_block(q, 0, 0, !1), xe === m && (Ue(q.head), q.lookahead === 0 && (q.strstart = 0, q.block_start = 0, q.insert = 0))), He(I), I.avail_out === 0)) + return q.last_flush = -1, b; + } + return xe !== y ? b : q.wrap <= 0 ? A : (q.wrap === 2 ? (Ge(q, I.adler & 255), Ge(q, I.adler >> 8 & 255), Ge(q, I.adler >> 16 & 255), Ge(q, I.adler >> 24 & 255), Ge(q, I.total_in & 255), Ge(q, I.total_in >> 8 & 255), Ge(q, I.total_in >> 16 & 255), Ge(q, I.total_in >> 24 & 255)) : (Ne(q, I.adler >>> 16), Ne(q, I.adler & 65535)), He(I), q.wrap > 0 && (q.wrap = -q.wrap), q.pending !== 0 ? b : A); + } + function ze(I) { + var xe; + return !I || !I.state ? f : (xe = I.state.status, xe !== ie && xe !== te && xe !== ue && xe !== de && xe !== oe && xe !== J && xe !== Ee ? Le(I, f) : (I.state = null, xe === J ? Le(I, s) : b)); + } + function Ve(I, xe) { + var be = xe.length, q, fe, Ce, Ze, Xe, Ye, lt, dt; + if (!I || !I.state || (q = I.state, Ze = q.wrap, Ze === 2 || Ze === 1 && q.status !== ie || q.lookahead)) return f; - for (Ye === 1 && (I.adler = l(I.adler, ye, ve, 0)), Z.wrap = 0, ve >= Z.w_size && (Ye === 0 && (Ue(Z.head), Z.strstart = 0, Z.block_start = 0, Z.insert = 0), dt = new r.Buf8(Z.w_size), r.arraySet(dt, ye, ve - Z.w_size, Z.w_size, 0), ye = dt, ve = Z.w_size), qe = I.avail_in, Xe = I.next_in, at = I.input, I.avail_in = ve, I.next_in = 0, I.input = ye, Ke(Z); Z.lookahead >= H; ) { - de = Z.strstart, $e = Z.lookahead - (H - 1); + for (Ze === 1 && (I.adler = l(I.adler, xe, be, 0)), q.wrap = 0, be >= q.w_size && (Ze === 0 && (Ue(q.head), q.strstart = 0, q.block_start = 0, q.insert = 0), dt = new r.Buf8(q.w_size), r.arraySet(dt, xe, be - q.w_size, q.w_size, 0), xe = dt, be = q.w_size), Xe = I.avail_in, Ye = I.next_in, lt = I.input, I.avail_in = be, I.next_in = 0, I.input = xe, Me(q); q.lookahead >= H; ) { + fe = q.strstart, Ce = q.lookahead - (H - 1); do - Z.ins_h = (Z.ins_h << Z.hash_shift ^ Z.window[de + H - 1]) & Z.hash_mask, Z.prev[de & Z.w_mask] = Z.head[Z.ins_h], Z.head[Z.ins_h] = de, de++; - while (--$e); - Z.strstart = de, Z.lookahead = H - 1, Ke(Z); + q.ins_h = (q.ins_h << q.hash_shift ^ q.window[fe + H - 1]) & q.hash_mask, q.prev[fe & q.w_mask] = q.head[q.ins_h], q.head[q.ins_h] = fe, fe++; + while (--Ce); + q.strstart = fe, q.lookahead = H - 1, Me(q); } - return Z.strstart += Z.lookahead, Z.block_start = Z.strstart, Z.insert = Z.lookahead, Z.lookahead = 0, Z.match_length = Z.prev_length = H - 1, Z.match_available = 0, I.next_in = Xe, I.input = at, I.avail_in = qe, Z.wrap = Ye, b; + return q.strstart += q.lookahead, q.block_start = q.strstart, q.insert = q.lookahead, q.lookahead = 0, q.match_length = q.prev_length = H - 1, q.match_available = 0, I.next_in = Ye, I.input = lt, I.avail_in = Xe, q.wrap = Ze, b; } - e.deflateInit = ke, e.deflateInit2 = pe, e.deflateReset = Se, e.deflateResetKeep = fe, e.deflateSetHeader = Ne, e.deflate = X, e.deflateEnd = Be, e.deflateSetDictionary = Ge, e.deflateInfo = "pako deflate (from Nodeca project)"; + e.deflateInit = $e, e.deflateInit2 = pe, e.deflateReset = we, e.deflateResetKeep = me, e.deflateSetHeader = Re, e.deflate = X, e.deflateEnd = ze, e.deflateSetDictionary = Ve, e.deflateInfo = "pako deflate (from Nodeca project)"; } ), /***/ @@ -37734,93 +37734,93 @@ ATOM`, x); (n) => { var e = 30, t = 12; n.exports = function(a, l) { - var d, o, u, p, m, y, w, b, A, f, s, h, _, g, x, c, v, M, E, $, k, L, z, O, R; - d = a.state, o = a.next_in, O = a.input, u = o + (a.avail_in - 5), p = a.next_out, R = a.output, m = p - (l - a.avail_out), y = p + (a.avail_out - 257), w = d.dmax, b = d.wsize, A = d.whave, f = d.wnext, s = d.window, h = d.hold, _ = d.bits, g = d.lencode, x = d.distcode, c = (1 << d.lenbits) - 1, v = (1 << d.distbits) - 1; + var h, c, d, _, m, y, x, b, A, f, s, u, p, g, w, o, v, M, E, $, k, L, z, O, R; + h = a.state, c = a.next_in, O = a.input, d = c + (a.avail_in - 5), _ = a.next_out, R = a.output, m = _ - (l - a.avail_out), y = _ + (a.avail_out - 257), x = h.dmax, b = h.wsize, A = h.whave, f = h.wnext, s = h.window, u = h.hold, p = h.bits, g = h.lencode, w = h.distcode, o = (1 << h.lenbits) - 1, v = (1 << h.distbits) - 1; e: do { - _ < 15 && (h += O[o++] << _, _ += 8, h += O[o++] << _, _ += 8), M = g[h & c]; + p < 15 && (u += O[c++] << p, p += 8, u += O[c++] << p, p += 8), M = g[u & o]; t: for (; ; ) { - if (E = M >>> 24, h >>>= E, _ -= E, E = M >>> 16 & 255, E === 0) - R[p++] = M & 65535; + if (E = M >>> 24, u >>>= E, p -= E, E = M >>> 16 & 255, E === 0) + R[_++] = M & 65535; else if (E & 16) { - $ = M & 65535, E &= 15, E && (_ < E && (h += O[o++] << _, _ += 8), $ += h & (1 << E) - 1, h >>>= E, _ -= E), _ < 15 && (h += O[o++] << _, _ += 8, h += O[o++] << _, _ += 8), M = x[h & v]; + $ = M & 65535, E &= 15, E && (p < E && (u += O[c++] << p, p += 8), $ += u & (1 << E) - 1, u >>>= E, p -= E), p < 15 && (u += O[c++] << p, p += 8, u += O[c++] << p, p += 8), M = w[u & v]; r: for (; ; ) { - if (E = M >>> 24, h >>>= E, _ -= E, E = M >>> 16 & 255, E & 16) { - if (k = M & 65535, E &= 15, _ < E && (h += O[o++] << _, _ += 8, _ < E && (h += O[o++] << _, _ += 8)), k += h & (1 << E) - 1, k > w) { - a.msg = "invalid distance too far back", d.mode = e; + if (E = M >>> 24, u >>>= E, p -= E, E = M >>> 16 & 255, E & 16) { + if (k = M & 65535, E &= 15, p < E && (u += O[c++] << p, p += 8, p < E && (u += O[c++] << p, p += 8)), k += u & (1 << E) - 1, k > x) { + a.msg = "invalid distance too far back", h.mode = e; break e; } - if (h >>>= E, _ -= E, E = p - m, k > E) { - if (E = k - E, E > A && d.sane) { - a.msg = "invalid distance too far back", d.mode = e; + if (u >>>= E, p -= E, E = _ - m, k > E) { + if (E = k - E, E > A && h.sane) { + a.msg = "invalid distance too far back", h.mode = e; break e; } if (L = 0, z = s, f === 0) { if (L += b - E, E < $) { $ -= E; do - R[p++] = s[L++]; + R[_++] = s[L++]; while (--E); - L = p - k, z = R; + L = _ - k, z = R; } } else if (f < E) { if (L += b + f - E, E -= f, E < $) { $ -= E; do - R[p++] = s[L++]; + R[_++] = s[L++]; while (--E); if (L = 0, f < $) { E = f, $ -= E; do - R[p++] = s[L++]; + R[_++] = s[L++]; while (--E); - L = p - k, z = R; + L = _ - k, z = R; } } } else if (L += f - E, E < $) { $ -= E; do - R[p++] = s[L++]; + R[_++] = s[L++]; while (--E); - L = p - k, z = R; + L = _ - k, z = R; } for (; $ > 2; ) - R[p++] = z[L++], R[p++] = z[L++], R[p++] = z[L++], $ -= 3; - $ && (R[p++] = z[L++], $ > 1 && (R[p++] = z[L++])); + R[_++] = z[L++], R[_++] = z[L++], R[_++] = z[L++], $ -= 3; + $ && (R[_++] = z[L++], $ > 1 && (R[_++] = z[L++])); } else { - L = p - k; + L = _ - k; do - R[p++] = R[L++], R[p++] = R[L++], R[p++] = R[L++], $ -= 3; + R[_++] = R[L++], R[_++] = R[L++], R[_++] = R[L++], $ -= 3; while ($ > 2); - $ && (R[p++] = R[L++], $ > 1 && (R[p++] = R[L++])); + $ && (R[_++] = R[L++], $ > 1 && (R[_++] = R[L++])); } } else if (E & 64) { - a.msg = "invalid distance code", d.mode = e; + a.msg = "invalid distance code", h.mode = e; break e; } else { - M = x[(M & 65535) + (h & (1 << E) - 1)]; + M = w[(M & 65535) + (u & (1 << E) - 1)]; continue r; } break; } } else if (E & 64) if (E & 32) { - d.mode = t; + h.mode = t; break e; } else { - a.msg = "invalid literal/length code", d.mode = e; + a.msg = "invalid literal/length code", h.mode = e; break e; } else { - M = g[(M & 65535) + (h & (1 << E) - 1)]; + M = g[(M & 65535) + (u & (1 << E) - 1)]; continue t; } break; } - } while (o < u && p < y); - $ = _ >> 3, o -= $, _ -= $ << 3, h &= (1 << _) - 1, a.next_in = o, a.next_out = p, a.avail_in = o < u ? 5 + (u - o) : 5 - (o - u), a.avail_out = p < y ? 257 + (y - p) : 257 - (p - y), d.hold = h, d.bits = _; + } while (c < d && _ < y); + $ = p >> 3, c -= $, p -= $ << 3, u &= (1 << p) - 1, a.next_in = c, a.next_out = _, a.avail_in = c < d ? 5 + (d - c) : 5 - (c - d), a.avail_out = _ < y ? 257 + (y - _) : 257 - (_ - y), h.hold = u, h.bits = p; }; } ), @@ -37840,109 +37840,109 @@ ATOM`, x); ), l = t( /*! ./crc32 */ "./node_modules/upng-js/node_modules/pako/lib/zlib/crc32.js" - ), d = t( + ), h = t( /*! ./inffast */ "./node_modules/upng-js/node_modules/pako/lib/zlib/inffast.js" - ), o = t( + ), c = t( /*! ./inftrees */ "./node_modules/upng-js/node_modules/pako/lib/zlib/inftrees.js" - ), u = 0, p = 1, m = 2, y = 4, w = 5, b = 6, A = 0, f = 1, s = 2, h = -2, _ = -3, g = -4, x = -5, c = 8, v = 1, M = 2, E = 3, $ = 4, k = 5, L = 6, z = 7, O = 8, R = 9, P = 10, U = 11, B = 12, N = 13, G = 14, H = 15, W = 16, V = 17, re = 18, ie = 19, ee = 20, ce = 21, he = 22, le = 23, J = 24, Me = 25, se = 26, Ce = 27, ue = 28, ne = 29, _e = 30, Oe = 31, Re = 32, Ue = 852, We = 592, Ee = 15, Ae = Ee; - function ge(pe) { + ), d = 0, _ = 1, m = 2, y = 4, x = 5, b = 6, A = 0, f = 1, s = 2, u = -2, p = -3, g = -4, w = -5, o = 8, v = 1, M = 2, E = 3, $ = 4, k = 5, L = 6, z = 7, O = 8, R = 9, N = 10, W = 11, B = 12, P = 13, G = 14, H = 15, U = 16, j = 17, re = 18, ie = 19, te = 20, ue = 21, de = 22, oe = 23, J = 24, Ee = 25, se = 26, Ae = 27, he = 28, ne = 29, _e = 30, Le = 31, Be = 32, Ue = 852, He = 592, We = 15, Ge = We; + function Ne(pe) { return (pe >>> 24 & 255) + (pe >>> 8 & 65280) + ((pe & 65280) << 8) + ((pe & 255) << 24); } - function Le() { + function Pe() { this.mode = 0, this.last = !1, this.wrap = 0, this.havedict = !1, this.flags = 0, this.dmax = 0, this.check = 0, this.total = 0, this.head = null, this.wbits = 0, this.wsize = 0, this.whave = 0, this.wnext = 0, this.window = null, this.hold = 0, this.bits = 0, this.length = 0, this.offset = 0, this.extra = 0, this.lencode = null, this.distcode = null, this.lenbits = 0, this.distbits = 0, this.ncode = 0, this.nlen = 0, this.ndist = 0, this.have = 0, this.next = null, this.lens = new r.Buf16(320), this.work = new r.Buf16(288), this.lendyn = null, this.distdyn = null, this.sane = 0, this.back = 0, this.was = 0; } function Te(pe) { - var ke; - return !pe || !pe.state ? h : (ke = pe.state, pe.total_in = pe.total_out = ke.total = 0, pe.msg = "", ke.wrap && (pe.adler = ke.wrap & 1), ke.mode = v, ke.last = 0, ke.havedict = 0, ke.dmax = 32768, ke.head = null, ke.hold = 0, ke.bits = 0, ke.lencode = ke.lendyn = new r.Buf32(Ue), ke.distcode = ke.distdyn = new r.Buf32(We), ke.sane = 1, ke.back = -1, A); - } - function Ke(pe) { - var ke; - return !pe || !pe.state ? h : (ke = pe.state, ke.wsize = 0, ke.whave = 0, ke.wnext = 0, Te(pe)); - } - function je(pe, ke) { - var X, Be; - return !pe || !pe.state || (Be = pe.state, ke < 0 ? (X = 0, ke = -ke) : (X = (ke >> 4) + 1, ke < 48 && (ke &= 15)), ke && (ke < 8 || ke > 15)) ? h : (Be.window !== null && Be.wbits !== ke && (Be.window = null), Be.wrap = X, Be.wbits = ke, Ke(pe)); - } - function Y(pe, ke) { - var X, Be; - return pe ? (Be = new Le(), pe.state = Be, Be.window = null, X = je(pe, ke), X !== A && (pe.state = null), X) : h; - } - function q(pe) { - return Y(pe, Ae); - } - var te = !0, we, me; - function Pe(pe) { - if (te) { - var ke; - for (we = new r.Buf32(512), me = new r.Buf32(32), ke = 0; ke < 144; ) - pe.lens[ke++] = 8; - for (; ke < 256; ) - pe.lens[ke++] = 9; - for (; ke < 280; ) - pe.lens[ke++] = 7; - for (; ke < 288; ) - pe.lens[ke++] = 8; - for (o(p, pe.lens, 0, 288, we, 0, pe.work, { bits: 9 }), ke = 0; ke < 32; ) - pe.lens[ke++] = 5; - o(m, pe.lens, 0, 32, me, 0, pe.work, { bits: 5 }), te = !1; - } - pe.lencode = we, pe.lenbits = 9, pe.distcode = me, pe.distbits = 5; - } - function Fe(pe, ke, X, Be) { - var Ge, I = pe.state; - return I.window === null && (I.wsize = 1 << I.wbits, I.wnext = 0, I.whave = 0, I.window = new r.Buf8(I.wsize)), Be >= I.wsize ? (r.arraySet(I.window, ke, X - I.wsize, I.wsize, 0), I.wnext = 0, I.whave = I.wsize) : (Ge = I.wsize - I.wnext, Ge > Be && (Ge = Be), r.arraySet(I.window, ke, X - Be, Ge, I.wnext), Be -= Ge, Be ? (r.arraySet(I.window, ke, X - Be, Be, 0), I.wnext = Be, I.whave = I.wsize) : (I.wnext += Ge, I.wnext === I.wsize && (I.wnext = 0), I.whave < I.wsize && (I.whave += Ge))), 0; - } - function K(pe, ke) { - var X, Be, Ge, I, ye, ve, Z, de, $e, Ye, qe, Xe, at, dt, lt = 0, ot, st, bt, _t, Lt, Gt, ft, Et, gt = new r.Buf8(4), Rt, Qe, xe = ( + var $e; + return !pe || !pe.state ? u : ($e = pe.state, pe.total_in = pe.total_out = $e.total = 0, pe.msg = "", $e.wrap && (pe.adler = $e.wrap & 1), $e.mode = v, $e.last = 0, $e.havedict = 0, $e.dmax = 32768, $e.head = null, $e.hold = 0, $e.bits = 0, $e.lencode = $e.lendyn = new r.Buf32(Ue), $e.distcode = $e.distdyn = new r.Buf32(He), $e.sane = 1, $e.back = -1, A); + } + function Me(pe) { + var $e; + return !pe || !pe.state ? u : ($e = pe.state, $e.wsize = 0, $e.whave = 0, $e.wnext = 0, Te(pe)); + } + function De(pe, $e) { + var X, ze; + return !pe || !pe.state || (ze = pe.state, $e < 0 ? (X = 0, $e = -$e) : (X = ($e >> 4) + 1, $e < 48 && ($e &= 15)), $e && ($e < 8 || $e > 15)) ? u : (ze.window !== null && ze.wbits !== $e && (ze.window = null), ze.wrap = X, ze.wbits = $e, Me(pe)); + } + function V(pe, $e) { + var X, ze; + return pe ? (ze = new Pe(), pe.state = ze, ze.window = null, X = De(pe, $e), X !== A && (pe.state = null), X) : u; + } + function Z(pe) { + return V(pe, Ge); + } + var ee = !0, ye, ce; + function Ie(pe) { + if (ee) { + var $e; + for (ye = new r.Buf32(512), ce = new r.Buf32(32), $e = 0; $e < 144; ) + pe.lens[$e++] = 8; + for (; $e < 256; ) + pe.lens[$e++] = 9; + for (; $e < 280; ) + pe.lens[$e++] = 7; + for (; $e < 288; ) + pe.lens[$e++] = 8; + for (c(_, pe.lens, 0, 288, ye, 0, pe.work, { bits: 9 }), $e = 0; $e < 32; ) + pe.lens[$e++] = 5; + c(m, pe.lens, 0, 32, ce, 0, pe.work, { bits: 5 }), ee = !1; + } + pe.lencode = ye, pe.lenbits = 9, pe.distcode = ce, pe.distbits = 5; + } + function ke(pe, $e, X, ze) { + var Ve, I = pe.state; + return I.window === null && (I.wsize = 1 << I.wbits, I.wnext = 0, I.whave = 0, I.window = new r.Buf8(I.wsize)), ze >= I.wsize ? (r.arraySet(I.window, $e, X - I.wsize, I.wsize, 0), I.wnext = 0, I.whave = I.wsize) : (Ve = I.wsize - I.wnext, Ve > ze && (Ve = ze), r.arraySet(I.window, $e, X - ze, Ve, I.wnext), ze -= Ve, ze ? (r.arraySet(I.window, $e, X - ze, ze, 0), I.wnext = ze, I.whave = I.wsize) : (I.wnext += Ve, I.wnext === I.wsize && (I.wnext = 0), I.whave < I.wsize && (I.whave += Ve))), 0; + } + function Y(pe, $e) { + var X, ze, Ve, I, xe, be, q, fe, Ce, Ze, Xe, Ye, lt, dt, it = 0, ot, nt, Ct, ut, zt, Ut, wt, mt, vt = new r.Buf8(4), Rt, qe, ge = ( /* permutation of code lengths */ [16, 17, 18, 0, 8, 7, 9, 6, 10, 5, 11, 4, 12, 3, 13, 2, 14, 1, 15] ); if (!pe || !pe.state || !pe.output || !pe.input && pe.avail_in !== 0) - return h; - X = pe.state, X.mode === B && (X.mode = N), ye = pe.next_out, Ge = pe.output, Z = pe.avail_out, I = pe.next_in, Be = pe.input, ve = pe.avail_in, de = X.hold, $e = X.bits, Ye = ve, qe = Z, Et = A; + return u; + X = pe.state, X.mode === B && (X.mode = P), xe = pe.next_out, Ve = pe.output, q = pe.avail_out, I = pe.next_in, ze = pe.input, be = pe.avail_in, fe = X.hold, Ce = X.bits, Ze = be, Xe = q, mt = A; e: for (; ; ) switch (X.mode) { case v: if (X.wrap === 0) { - X.mode = N; + X.mode = P; break; } - for (; $e < 16; ) { - if (ve === 0) + for (; Ce < 16; ) { + if (be === 0) break e; - ve--, de += Be[I++] << $e, $e += 8; + be--, fe += ze[I++] << Ce, Ce += 8; } - if (X.wrap & 2 && de === 35615) { - X.check = 0, gt[0] = de & 255, gt[1] = de >>> 8 & 255, X.check = l(X.check, gt, 2, 0), de = 0, $e = 0, X.mode = M; + if (X.wrap & 2 && fe === 35615) { + X.check = 0, vt[0] = fe & 255, vt[1] = fe >>> 8 & 255, X.check = l(X.check, vt, 2, 0), fe = 0, Ce = 0, X.mode = M; break; } if (X.flags = 0, X.head && (X.head.done = !1), !(X.wrap & 1) || /* check if zlib header allowed */ - (((de & 255) << 8) + (de >> 8)) % 31) { + (((fe & 255) << 8) + (fe >> 8)) % 31) { pe.msg = "incorrect header check", X.mode = _e; break; } - if ((de & 15) !== c) { + if ((fe & 15) !== o) { pe.msg = "unknown compression method", X.mode = _e; break; } - if (de >>>= 4, $e -= 4, ft = (de & 15) + 8, X.wbits === 0) - X.wbits = ft; - else if (ft > X.wbits) { + if (fe >>>= 4, Ce -= 4, wt = (fe & 15) + 8, X.wbits === 0) + X.wbits = wt; + else if (wt > X.wbits) { pe.msg = "invalid window size", X.mode = _e; break; } - X.dmax = 1 << ft, pe.adler = X.check = 1, X.mode = de & 512 ? P : B, de = 0, $e = 0; + X.dmax = 1 << wt, pe.adler = X.check = 1, X.mode = fe & 512 ? N : B, fe = 0, Ce = 0; break; case M: - for (; $e < 16; ) { - if (ve === 0) + for (; Ce < 16; ) { + if (be === 0) break e; - ve--, de += Be[I++] << $e, $e += 8; + be--, fe += ze[I++] << Ce, Ce += 8; } - if (X.flags = de, (X.flags & 255) !== c) { + if (X.flags = fe, (X.flags & 255) !== o) { pe.msg = "unknown compression method", X.mode = _e; break; } @@ -37950,217 +37950,217 @@ ATOM`, x); pe.msg = "unknown header flags set", X.mode = _e; break; } - X.head && (X.head.text = de >> 8 & 1), X.flags & 512 && (gt[0] = de & 255, gt[1] = de >>> 8 & 255, X.check = l(X.check, gt, 2, 0)), de = 0, $e = 0, X.mode = E; + X.head && (X.head.text = fe >> 8 & 1), X.flags & 512 && (vt[0] = fe & 255, vt[1] = fe >>> 8 & 255, X.check = l(X.check, vt, 2, 0)), fe = 0, Ce = 0, X.mode = E; case E: - for (; $e < 32; ) { - if (ve === 0) + for (; Ce < 32; ) { + if (be === 0) break e; - ve--, de += Be[I++] << $e, $e += 8; + be--, fe += ze[I++] << Ce, Ce += 8; } - X.head && (X.head.time = de), X.flags & 512 && (gt[0] = de & 255, gt[1] = de >>> 8 & 255, gt[2] = de >>> 16 & 255, gt[3] = de >>> 24 & 255, X.check = l(X.check, gt, 4, 0)), de = 0, $e = 0, X.mode = $; + X.head && (X.head.time = fe), X.flags & 512 && (vt[0] = fe & 255, vt[1] = fe >>> 8 & 255, vt[2] = fe >>> 16 & 255, vt[3] = fe >>> 24 & 255, X.check = l(X.check, vt, 4, 0)), fe = 0, Ce = 0, X.mode = $; case $: - for (; $e < 16; ) { - if (ve === 0) + for (; Ce < 16; ) { + if (be === 0) break e; - ve--, de += Be[I++] << $e, $e += 8; + be--, fe += ze[I++] << Ce, Ce += 8; } - X.head && (X.head.xflags = de & 255, X.head.os = de >> 8), X.flags & 512 && (gt[0] = de & 255, gt[1] = de >>> 8 & 255, X.check = l(X.check, gt, 2, 0)), de = 0, $e = 0, X.mode = k; + X.head && (X.head.xflags = fe & 255, X.head.os = fe >> 8), X.flags & 512 && (vt[0] = fe & 255, vt[1] = fe >>> 8 & 255, X.check = l(X.check, vt, 2, 0)), fe = 0, Ce = 0, X.mode = k; case k: if (X.flags & 1024) { - for (; $e < 16; ) { - if (ve === 0) + for (; Ce < 16; ) { + if (be === 0) break e; - ve--, de += Be[I++] << $e, $e += 8; + be--, fe += ze[I++] << Ce, Ce += 8; } - X.length = de, X.head && (X.head.extra_len = de), X.flags & 512 && (gt[0] = de & 255, gt[1] = de >>> 8 & 255, X.check = l(X.check, gt, 2, 0)), de = 0, $e = 0; + X.length = fe, X.head && (X.head.extra_len = fe), X.flags & 512 && (vt[0] = fe & 255, vt[1] = fe >>> 8 & 255, X.check = l(X.check, vt, 2, 0)), fe = 0, Ce = 0; } else X.head && (X.head.extra = null); X.mode = L; case L: - if (X.flags & 1024 && (Xe = X.length, Xe > ve && (Xe = ve), Xe && (X.head && (ft = X.head.extra_len - X.length, X.head.extra || (X.head.extra = new Array(X.head.extra_len)), r.arraySet( + if (X.flags & 1024 && (Ye = X.length, Ye > be && (Ye = be), Ye && (X.head && (wt = X.head.extra_len - X.length, X.head.extra || (X.head.extra = new Array(X.head.extra_len)), r.arraySet( X.head.extra, - Be, + ze, I, // extra field is limited to 65536 bytes // - no need for additional size check - Xe, + Ye, /*len + copy > state.head.extra_max - len ? state.head.extra_max : copy,*/ - ft - )), X.flags & 512 && (X.check = l(X.check, Be, Xe, I)), ve -= Xe, I += Xe, X.length -= Xe), X.length)) + wt + )), X.flags & 512 && (X.check = l(X.check, ze, Ye, I)), be -= Ye, I += Ye, X.length -= Ye), X.length)) break e; X.length = 0, X.mode = z; case z: if (X.flags & 2048) { - if (ve === 0) + if (be === 0) break e; - Xe = 0; + Ye = 0; do - ft = Be[I + Xe++], X.head && ft && X.length < 65536 && (X.head.name += String.fromCharCode(ft)); - while (ft && Xe < ve); - if (X.flags & 512 && (X.check = l(X.check, Be, Xe, I)), ve -= Xe, I += Xe, ft) + wt = ze[I + Ye++], X.head && wt && X.length < 65536 && (X.head.name += String.fromCharCode(wt)); + while (wt && Ye < be); + if (X.flags & 512 && (X.check = l(X.check, ze, Ye, I)), be -= Ye, I += Ye, wt) break e; } else X.head && (X.head.name = null); X.length = 0, X.mode = O; case O: if (X.flags & 4096) { - if (ve === 0) + if (be === 0) break e; - Xe = 0; + Ye = 0; do - ft = Be[I + Xe++], X.head && ft && X.length < 65536 && (X.head.comment += String.fromCharCode(ft)); - while (ft && Xe < ve); - if (X.flags & 512 && (X.check = l(X.check, Be, Xe, I)), ve -= Xe, I += Xe, ft) + wt = ze[I + Ye++], X.head && wt && X.length < 65536 && (X.head.comment += String.fromCharCode(wt)); + while (wt && Ye < be); + if (X.flags & 512 && (X.check = l(X.check, ze, Ye, I)), be -= Ye, I += Ye, wt) break e; } else X.head && (X.head.comment = null); X.mode = R; case R: if (X.flags & 512) { - for (; $e < 16; ) { - if (ve === 0) + for (; Ce < 16; ) { + if (be === 0) break e; - ve--, de += Be[I++] << $e, $e += 8; + be--, fe += ze[I++] << Ce, Ce += 8; } - if (de !== (X.check & 65535)) { + if (fe !== (X.check & 65535)) { pe.msg = "header crc mismatch", X.mode = _e; break; } - de = 0, $e = 0; + fe = 0, Ce = 0; } X.head && (X.head.hcrc = X.flags >> 9 & 1, X.head.done = !0), pe.adler = X.check = 0, X.mode = B; break; - case P: - for (; $e < 32; ) { - if (ve === 0) + case N: + for (; Ce < 32; ) { + if (be === 0) break e; - ve--, de += Be[I++] << $e, $e += 8; + be--, fe += ze[I++] << Ce, Ce += 8; } - pe.adler = X.check = ge(de), de = 0, $e = 0, X.mode = U; - case U: + pe.adler = X.check = Ne(fe), fe = 0, Ce = 0, X.mode = W; + case W: if (X.havedict === 0) - return pe.next_out = ye, pe.avail_out = Z, pe.next_in = I, pe.avail_in = ve, X.hold = de, X.bits = $e, s; + return pe.next_out = xe, pe.avail_out = q, pe.next_in = I, pe.avail_in = be, X.hold = fe, X.bits = Ce, s; pe.adler = X.check = 1, X.mode = B; case B: - if (ke === w || ke === b) + if ($e === x || $e === b) break e; - case N: + case P: if (X.last) { - de >>>= $e & 7, $e -= $e & 7, X.mode = Ce; + fe >>>= Ce & 7, Ce -= Ce & 7, X.mode = Ae; break; } - for (; $e < 3; ) { - if (ve === 0) + for (; Ce < 3; ) { + if (be === 0) break e; - ve--, de += Be[I++] << $e, $e += 8; + be--, fe += ze[I++] << Ce, Ce += 8; } - switch (X.last = de & 1, de >>>= 1, $e -= 1, de & 3) { + switch (X.last = fe & 1, fe >>>= 1, Ce -= 1, fe & 3) { case 0: X.mode = G; break; case 1: - if (Pe(X), X.mode = ee, ke === b) { - de >>>= 2, $e -= 2; + if (Ie(X), X.mode = te, $e === b) { + fe >>>= 2, Ce -= 2; break e; } break; case 2: - X.mode = V; + X.mode = j; break; case 3: pe.msg = "invalid block type", X.mode = _e; } - de >>>= 2, $e -= 2; + fe >>>= 2, Ce -= 2; break; case G: - for (de >>>= $e & 7, $e -= $e & 7; $e < 32; ) { - if (ve === 0) + for (fe >>>= Ce & 7, Ce -= Ce & 7; Ce < 32; ) { + if (be === 0) break e; - ve--, de += Be[I++] << $e, $e += 8; + be--, fe += ze[I++] << Ce, Ce += 8; } - if ((de & 65535) !== (de >>> 16 ^ 65535)) { + if ((fe & 65535) !== (fe >>> 16 ^ 65535)) { pe.msg = "invalid stored block lengths", X.mode = _e; break; } - if (X.length = de & 65535, de = 0, $e = 0, X.mode = H, ke === b) + if (X.length = fe & 65535, fe = 0, Ce = 0, X.mode = H, $e === b) break e; case H: - X.mode = W; - case W: - if (Xe = X.length, Xe) { - if (Xe > ve && (Xe = ve), Xe > Z && (Xe = Z), Xe === 0) + X.mode = U; + case U: + if (Ye = X.length, Ye) { + if (Ye > be && (Ye = be), Ye > q && (Ye = q), Ye === 0) break e; - r.arraySet(Ge, Be, I, Xe, ye), ve -= Xe, I += Xe, Z -= Xe, ye += Xe, X.length -= Xe; + r.arraySet(Ve, ze, I, Ye, xe), be -= Ye, I += Ye, q -= Ye, xe += Ye, X.length -= Ye; break; } X.mode = B; break; - case V: - for (; $e < 14; ) { - if (ve === 0) + case j: + for (; Ce < 14; ) { + if (be === 0) break e; - ve--, de += Be[I++] << $e, $e += 8; + be--, fe += ze[I++] << Ce, Ce += 8; } - if (X.nlen = (de & 31) + 257, de >>>= 5, $e -= 5, X.ndist = (de & 31) + 1, de >>>= 5, $e -= 5, X.ncode = (de & 15) + 4, de >>>= 4, $e -= 4, X.nlen > 286 || X.ndist > 30) { + if (X.nlen = (fe & 31) + 257, fe >>>= 5, Ce -= 5, X.ndist = (fe & 31) + 1, fe >>>= 5, Ce -= 5, X.ncode = (fe & 15) + 4, fe >>>= 4, Ce -= 4, X.nlen > 286 || X.ndist > 30) { pe.msg = "too many length or distance symbols", X.mode = _e; break; } X.have = 0, X.mode = re; case re: for (; X.have < X.ncode; ) { - for (; $e < 3; ) { - if (ve === 0) + for (; Ce < 3; ) { + if (be === 0) break e; - ve--, de += Be[I++] << $e, $e += 8; + be--, fe += ze[I++] << Ce, Ce += 8; } - X.lens[xe[X.have++]] = de & 7, de >>>= 3, $e -= 3; + X.lens[ge[X.have++]] = fe & 7, fe >>>= 3, Ce -= 3; } for (; X.have < 19; ) - X.lens[xe[X.have++]] = 0; - if (X.lencode = X.lendyn, X.lenbits = 7, Rt = { bits: X.lenbits }, Et = o(u, X.lens, 0, 19, X.lencode, 0, X.work, Rt), X.lenbits = Rt.bits, Et) { + X.lens[ge[X.have++]] = 0; + if (X.lencode = X.lendyn, X.lenbits = 7, Rt = { bits: X.lenbits }, mt = c(d, X.lens, 0, 19, X.lencode, 0, X.work, Rt), X.lenbits = Rt.bits, mt) { pe.msg = "invalid code lengths set", X.mode = _e; break; } X.have = 0, X.mode = ie; case ie: for (; X.have < X.nlen + X.ndist; ) { - for (; lt = X.lencode[de & (1 << X.lenbits) - 1], ot = lt >>> 24, st = lt >>> 16 & 255, bt = lt & 65535, !(ot <= $e); ) { - if (ve === 0) + for (; it = X.lencode[fe & (1 << X.lenbits) - 1], ot = it >>> 24, nt = it >>> 16 & 255, Ct = it & 65535, !(ot <= Ce); ) { + if (be === 0) break e; - ve--, de += Be[I++] << $e, $e += 8; + be--, fe += ze[I++] << Ce, Ce += 8; } - if (bt < 16) - de >>>= ot, $e -= ot, X.lens[X.have++] = bt; + if (Ct < 16) + fe >>>= ot, Ce -= ot, X.lens[X.have++] = Ct; else { - if (bt === 16) { - for (Qe = ot + 2; $e < Qe; ) { - if (ve === 0) + if (Ct === 16) { + for (qe = ot + 2; Ce < qe; ) { + if (be === 0) break e; - ve--, de += Be[I++] << $e, $e += 8; + be--, fe += ze[I++] << Ce, Ce += 8; } - if (de >>>= ot, $e -= ot, X.have === 0) { + if (fe >>>= ot, Ce -= ot, X.have === 0) { pe.msg = "invalid bit length repeat", X.mode = _e; break; } - ft = X.lens[X.have - 1], Xe = 3 + (de & 3), de >>>= 2, $e -= 2; - } else if (bt === 17) { - for (Qe = ot + 3; $e < Qe; ) { - if (ve === 0) + wt = X.lens[X.have - 1], Ye = 3 + (fe & 3), fe >>>= 2, Ce -= 2; + } else if (Ct === 17) { + for (qe = ot + 3; Ce < qe; ) { + if (be === 0) break e; - ve--, de += Be[I++] << $e, $e += 8; + be--, fe += ze[I++] << Ce, Ce += 8; } - de >>>= ot, $e -= ot, ft = 0, Xe = 3 + (de & 7), de >>>= 3, $e -= 3; + fe >>>= ot, Ce -= ot, wt = 0, Ye = 3 + (fe & 7), fe >>>= 3, Ce -= 3; } else { - for (Qe = ot + 7; $e < Qe; ) { - if (ve === 0) + for (qe = ot + 7; Ce < qe; ) { + if (be === 0) break e; - ve--, de += Be[I++] << $e, $e += 8; + be--, fe += ze[I++] << Ce, Ce += 8; } - de >>>= ot, $e -= ot, ft = 0, Xe = 11 + (de & 127), de >>>= 7, $e -= 7; + fe >>>= ot, Ce -= ot, wt = 0, Ye = 11 + (fe & 127), fe >>>= 7, Ce -= 7; } - if (X.have + Xe > X.nlen + X.ndist) { + if (X.have + Ye > X.nlen + X.ndist) { pe.msg = "invalid bit length repeat", X.mode = _e; break; } - for (; Xe--; ) - X.lens[X.have++] = ft; + for (; Ye--; ) + X.lens[X.have++] = wt; } } if (X.mode === _e) @@ -38169,173 +38169,173 @@ ATOM`, x); pe.msg = "invalid code -- missing end-of-block", X.mode = _e; break; } - if (X.lenbits = 9, Rt = { bits: X.lenbits }, Et = o(p, X.lens, 0, X.nlen, X.lencode, 0, X.work, Rt), X.lenbits = Rt.bits, Et) { + if (X.lenbits = 9, Rt = { bits: X.lenbits }, mt = c(_, X.lens, 0, X.nlen, X.lencode, 0, X.work, Rt), X.lenbits = Rt.bits, mt) { pe.msg = "invalid literal/lengths set", X.mode = _e; break; } - if (X.distbits = 6, X.distcode = X.distdyn, Rt = { bits: X.distbits }, Et = o(m, X.lens, X.nlen, X.ndist, X.distcode, 0, X.work, Rt), X.distbits = Rt.bits, Et) { + if (X.distbits = 6, X.distcode = X.distdyn, Rt = { bits: X.distbits }, mt = c(m, X.lens, X.nlen, X.ndist, X.distcode, 0, X.work, Rt), X.distbits = Rt.bits, mt) { pe.msg = "invalid distances set", X.mode = _e; break; } - if (X.mode = ee, ke === b) + if (X.mode = te, $e === b) break e; - case ee: - X.mode = ce; - case ce: - if (ve >= 6 && Z >= 258) { - pe.next_out = ye, pe.avail_out = Z, pe.next_in = I, pe.avail_in = ve, X.hold = de, X.bits = $e, d(pe, qe), ye = pe.next_out, Ge = pe.output, Z = pe.avail_out, I = pe.next_in, Be = pe.input, ve = pe.avail_in, de = X.hold, $e = X.bits, X.mode === B && (X.back = -1); + case te: + X.mode = ue; + case ue: + if (be >= 6 && q >= 258) { + pe.next_out = xe, pe.avail_out = q, pe.next_in = I, pe.avail_in = be, X.hold = fe, X.bits = Ce, h(pe, Xe), xe = pe.next_out, Ve = pe.output, q = pe.avail_out, I = pe.next_in, ze = pe.input, be = pe.avail_in, fe = X.hold, Ce = X.bits, X.mode === B && (X.back = -1); break; } - for (X.back = 0; lt = X.lencode[de & (1 << X.lenbits) - 1], ot = lt >>> 24, st = lt >>> 16 & 255, bt = lt & 65535, !(ot <= $e); ) { - if (ve === 0) + for (X.back = 0; it = X.lencode[fe & (1 << X.lenbits) - 1], ot = it >>> 24, nt = it >>> 16 & 255, Ct = it & 65535, !(ot <= Ce); ) { + if (be === 0) break e; - ve--, de += Be[I++] << $e, $e += 8; + be--, fe += ze[I++] << Ce, Ce += 8; } - if (st && !(st & 240)) { - for (_t = ot, Lt = st, Gt = bt; lt = X.lencode[Gt + ((de & (1 << _t + Lt) - 1) >> _t)], ot = lt >>> 24, st = lt >>> 16 & 255, bt = lt & 65535, !(_t + ot <= $e); ) { - if (ve === 0) + if (nt && !(nt & 240)) { + for (ut = ot, zt = nt, Ut = Ct; it = X.lencode[Ut + ((fe & (1 << ut + zt) - 1) >> ut)], ot = it >>> 24, nt = it >>> 16 & 255, Ct = it & 65535, !(ut + ot <= Ce); ) { + if (be === 0) break e; - ve--, de += Be[I++] << $e, $e += 8; + be--, fe += ze[I++] << Ce, Ce += 8; } - de >>>= _t, $e -= _t, X.back += _t; + fe >>>= ut, Ce -= ut, X.back += ut; } - if (de >>>= ot, $e -= ot, X.back += ot, X.length = bt, st === 0) { + if (fe >>>= ot, Ce -= ot, X.back += ot, X.length = Ct, nt === 0) { X.mode = se; break; } - if (st & 32) { + if (nt & 32) { X.back = -1, X.mode = B; break; } - if (st & 64) { + if (nt & 64) { pe.msg = "invalid literal/length code", X.mode = _e; break; } - X.extra = st & 15, X.mode = he; - case he: + X.extra = nt & 15, X.mode = de; + case de: if (X.extra) { - for (Qe = X.extra; $e < Qe; ) { - if (ve === 0) + for (qe = X.extra; Ce < qe; ) { + if (be === 0) break e; - ve--, de += Be[I++] << $e, $e += 8; + be--, fe += ze[I++] << Ce, Ce += 8; } - X.length += de & (1 << X.extra) - 1, de >>>= X.extra, $e -= X.extra, X.back += X.extra; + X.length += fe & (1 << X.extra) - 1, fe >>>= X.extra, Ce -= X.extra, X.back += X.extra; } - X.was = X.length, X.mode = le; - case le: - for (; lt = X.distcode[de & (1 << X.distbits) - 1], ot = lt >>> 24, st = lt >>> 16 & 255, bt = lt & 65535, !(ot <= $e); ) { - if (ve === 0) + X.was = X.length, X.mode = oe; + case oe: + for (; it = X.distcode[fe & (1 << X.distbits) - 1], ot = it >>> 24, nt = it >>> 16 & 255, Ct = it & 65535, !(ot <= Ce); ) { + if (be === 0) break e; - ve--, de += Be[I++] << $e, $e += 8; + be--, fe += ze[I++] << Ce, Ce += 8; } - if (!(st & 240)) { - for (_t = ot, Lt = st, Gt = bt; lt = X.distcode[Gt + ((de & (1 << _t + Lt) - 1) >> _t)], ot = lt >>> 24, st = lt >>> 16 & 255, bt = lt & 65535, !(_t + ot <= $e); ) { - if (ve === 0) + if (!(nt & 240)) { + for (ut = ot, zt = nt, Ut = Ct; it = X.distcode[Ut + ((fe & (1 << ut + zt) - 1) >> ut)], ot = it >>> 24, nt = it >>> 16 & 255, Ct = it & 65535, !(ut + ot <= Ce); ) { + if (be === 0) break e; - ve--, de += Be[I++] << $e, $e += 8; + be--, fe += ze[I++] << Ce, Ce += 8; } - de >>>= _t, $e -= _t, X.back += _t; + fe >>>= ut, Ce -= ut, X.back += ut; } - if (de >>>= ot, $e -= ot, X.back += ot, st & 64) { + if (fe >>>= ot, Ce -= ot, X.back += ot, nt & 64) { pe.msg = "invalid distance code", X.mode = _e; break; } - X.offset = bt, X.extra = st & 15, X.mode = J; + X.offset = Ct, X.extra = nt & 15, X.mode = J; case J: if (X.extra) { - for (Qe = X.extra; $e < Qe; ) { - if (ve === 0) + for (qe = X.extra; Ce < qe; ) { + if (be === 0) break e; - ve--, de += Be[I++] << $e, $e += 8; + be--, fe += ze[I++] << Ce, Ce += 8; } - X.offset += de & (1 << X.extra) - 1, de >>>= X.extra, $e -= X.extra, X.back += X.extra; + X.offset += fe & (1 << X.extra) - 1, fe >>>= X.extra, Ce -= X.extra, X.back += X.extra; } if (X.offset > X.dmax) { pe.msg = "invalid distance too far back", X.mode = _e; break; } - X.mode = Me; - case Me: - if (Z === 0) + X.mode = Ee; + case Ee: + if (q === 0) break e; - if (Xe = qe - Z, X.offset > Xe) { - if (Xe = X.offset - Xe, Xe > X.whave && X.sane) { + if (Ye = Xe - q, X.offset > Ye) { + if (Ye = X.offset - Ye, Ye > X.whave && X.sane) { pe.msg = "invalid distance too far back", X.mode = _e; break; } - Xe > X.wnext ? (Xe -= X.wnext, at = X.wsize - Xe) : at = X.wnext - Xe, Xe > X.length && (Xe = X.length), dt = X.window; + Ye > X.wnext ? (Ye -= X.wnext, lt = X.wsize - Ye) : lt = X.wnext - Ye, Ye > X.length && (Ye = X.length), dt = X.window; } else - dt = Ge, at = ye - X.offset, Xe = X.length; - Xe > Z && (Xe = Z), Z -= Xe, X.length -= Xe; + dt = Ve, lt = xe - X.offset, Ye = X.length; + Ye > q && (Ye = q), q -= Ye, X.length -= Ye; do - Ge[ye++] = dt[at++]; - while (--Xe); - X.length === 0 && (X.mode = ce); + Ve[xe++] = dt[lt++]; + while (--Ye); + X.length === 0 && (X.mode = ue); break; case se: - if (Z === 0) + if (q === 0) break e; - Ge[ye++] = X.length, Z--, X.mode = ce; + Ve[xe++] = X.length, q--, X.mode = ue; break; - case Ce: + case Ae: if (X.wrap) { - for (; $e < 32; ) { - if (ve === 0) + for (; Ce < 32; ) { + if (be === 0) break e; - ve--, de |= Be[I++] << $e, $e += 8; + be--, fe |= ze[I++] << Ce, Ce += 8; } - if (qe -= Z, pe.total_out += qe, X.total += qe, qe && (pe.adler = X.check = /*UPDATE(state.check, put - _out, _out);*/ - X.flags ? l(X.check, Ge, qe, ye - qe) : a(X.check, Ge, qe, ye - qe)), qe = Z, (X.flags ? de : ge(de)) !== X.check) { + if (Xe -= q, pe.total_out += Xe, X.total += Xe, Xe && (pe.adler = X.check = /*UPDATE(state.check, put - _out, _out);*/ + X.flags ? l(X.check, Ve, Xe, xe - Xe) : a(X.check, Ve, Xe, xe - Xe)), Xe = q, (X.flags ? fe : Ne(fe)) !== X.check) { pe.msg = "incorrect data check", X.mode = _e; break; } - de = 0, $e = 0; + fe = 0, Ce = 0; } - X.mode = ue; - case ue: + X.mode = he; + case he: if (X.wrap && X.flags) { - for (; $e < 32; ) { - if (ve === 0) + for (; Ce < 32; ) { + if (be === 0) break e; - ve--, de += Be[I++] << $e, $e += 8; + be--, fe += ze[I++] << Ce, Ce += 8; } - if (de !== (X.total & 4294967295)) { + if (fe !== (X.total & 4294967295)) { pe.msg = "incorrect length check", X.mode = _e; break; } - de = 0, $e = 0; + fe = 0, Ce = 0; } X.mode = ne; case ne: - Et = f; + mt = f; break e; case _e: - Et = _; + mt = p; break e; - case Oe: + case Le: return g; - case Re: + case Be: default: - return h; + return u; } - return pe.next_out = ye, pe.avail_out = Z, pe.next_in = I, pe.avail_in = ve, X.hold = de, X.bits = $e, (X.wsize || qe !== pe.avail_out && X.mode < _e && (X.mode < Ce || ke !== y)) && Fe(pe, pe.output, pe.next_out, qe - pe.avail_out), Ye -= pe.avail_in, qe -= pe.avail_out, pe.total_in += Ye, pe.total_out += qe, X.total += qe, X.wrap && qe && (pe.adler = X.check = /*UPDATE(state.check, strm.next_out - _out, _out);*/ - X.flags ? l(X.check, Ge, qe, pe.next_out - qe) : a(X.check, Ge, qe, pe.next_out - qe)), pe.data_type = X.bits + (X.last ? 64 : 0) + (X.mode === B ? 128 : 0) + (X.mode === ee || X.mode === H ? 256 : 0), (Ye === 0 && qe === 0 || ke === y) && Et === A && (Et = x), Et; + return pe.next_out = xe, pe.avail_out = q, pe.next_in = I, pe.avail_in = be, X.hold = fe, X.bits = Ce, (X.wsize || Xe !== pe.avail_out && X.mode < _e && (X.mode < Ae || $e !== y)) && ke(pe, pe.output, pe.next_out, Xe - pe.avail_out), Ze -= pe.avail_in, Xe -= pe.avail_out, pe.total_in += Ze, pe.total_out += Xe, X.total += Xe, X.wrap && Xe && (pe.adler = X.check = /*UPDATE(state.check, strm.next_out - _out, _out);*/ + X.flags ? l(X.check, Ve, Xe, pe.next_out - Xe) : a(X.check, Ve, Xe, pe.next_out - Xe)), pe.data_type = X.bits + (X.last ? 64 : 0) + (X.mode === B ? 128 : 0) + (X.mode === te || X.mode === H ? 256 : 0), (Ze === 0 && Xe === 0 || $e === y) && mt === A && (mt = w), mt; } - function fe(pe) { + function me(pe) { if (!pe || !pe.state) - return h; - var ke = pe.state; - return ke.window && (ke.window = null), pe.state = null, A; + return u; + var $e = pe.state; + return $e.window && ($e.window = null), pe.state = null, A; } - function Se(pe, ke) { + function we(pe, $e) { var X; - return !pe || !pe.state || (X = pe.state, !(X.wrap & 2)) ? h : (X.head = ke, ke.done = !1, A); + return !pe || !pe.state || (X = pe.state, !(X.wrap & 2)) ? u : (X.head = $e, $e.done = !1, A); } - function Ne(pe, ke) { - var X = ke.length, Be, Ge, I; - return !pe || !pe.state || (Be = pe.state, Be.wrap !== 0 && Be.mode !== U) ? h : Be.mode === U && (Ge = 1, Ge = a(Ge, ke, X, 0), Ge !== Be.check) ? _ : (I = Fe(pe, ke, X, X), I ? (Be.mode = Oe, g) : (Be.havedict = 1, A)); + function Re(pe, $e) { + var X = $e.length, ze, Ve, I; + return !pe || !pe.state || (ze = pe.state, ze.wrap !== 0 && ze.mode !== W) ? u : ze.mode === W && (Ve = 1, Ve = a(Ve, $e, X, 0), Ve !== ze.check) ? p : (I = ke(pe, $e, X, X), I ? (ze.mode = Le, g) : (ze.havedict = 1, A)); } - e.inflateReset = Ke, e.inflateReset2 = je, e.inflateResetKeep = Te, e.inflateInit = q, e.inflateInit2 = Y, e.inflate = K, e.inflateEnd = fe, e.inflateGetHeader = Se, e.inflateSetDictionary = Ne, e.inflateInfo = "pako inflate (from Nodeca project)"; + e.inflateReset = Me, e.inflateReset2 = De, e.inflateResetKeep = Te, e.inflateInit = Z, e.inflateInit2 = V, e.inflate = Y, e.inflateEnd = me, e.inflateGetHeader = we, e.inflateSetDictionary = Re, e.inflateInfo = "pako inflate (from Nodeca project)"; } ), /***/ @@ -38348,7 +38348,7 @@ ATOM`, x); var r = t( /*! ../utils/common */ "./node_modules/upng-js/node_modules/pako/lib/utils/common.js" - ), a = 15, l = 852, d = 592, o = 0, u = 1, p = 2, m = [ + ), a = 15, l = 852, h = 592, c = 0, d = 1, _ = 2, m = [ /* Length codes 257..285 base */ 3, 4, @@ -38414,7 +38414,7 @@ ATOM`, x); 16, 72, 78 - ], w = [ + ], x = [ /* Distance codes 0..29 base */ 1, 2, @@ -38483,50 +38483,50 @@ ATOM`, x); 64, 64 ]; - n.exports = function(f, s, h, _, g, x, c, v) { - var M = v.bits, E = 0, $ = 0, k = 0, L = 0, z = 0, O = 0, R = 0, P = 0, U = 0, B = 0, N, G, H, W, V, re = null, ie = 0, ee, ce = new r.Buf16(a + 1), he = new r.Buf16(a + 1), le = null, J = 0, Me, se, Ce; + n.exports = function(f, s, u, p, g, w, o, v) { + var M = v.bits, E = 0, $ = 0, k = 0, L = 0, z = 0, O = 0, R = 0, N = 0, W = 0, B = 0, P, G, H, U, j, re = null, ie = 0, te, ue = new r.Buf16(a + 1), de = new r.Buf16(a + 1), oe = null, J = 0, Ee, se, Ae; for (E = 0; E <= a; E++) - ce[E] = 0; - for ($ = 0; $ < _; $++) - ce[s[h + $]]++; - for (z = M, L = a; L >= 1 && ce[L] === 0; L--) + ue[E] = 0; + for ($ = 0; $ < p; $++) + ue[s[u + $]]++; + for (z = M, L = a; L >= 1 && ue[L] === 0; L--) ; if (z > L && (z = L), L === 0) - return g[x++] = 20971520, g[x++] = 20971520, v.bits = 1, 0; - for (k = 1; k < L && ce[k] === 0; k++) + return g[w++] = 20971520, g[w++] = 20971520, v.bits = 1, 0; + for (k = 1; k < L && ue[k] === 0; k++) ; - for (z < k && (z = k), P = 1, E = 1; E <= a; E++) - if (P <<= 1, P -= ce[E], P < 0) + for (z < k && (z = k), N = 1, E = 1; E <= a; E++) + if (N <<= 1, N -= ue[E], N < 0) return -1; - if (P > 0 && (f === o || L !== 1)) + if (N > 0 && (f === c || L !== 1)) return -1; - for (he[1] = 0, E = 1; E < a; E++) - he[E + 1] = he[E] + ce[E]; - for ($ = 0; $ < _; $++) - s[h + $] !== 0 && (c[he[s[h + $]]++] = $); - if (f === o ? (re = le = c, ee = 19) : f === u ? (re = m, ie -= 257, le = y, J -= 257, ee = 256) : (re = w, le = b, ee = -1), B = 0, $ = 0, E = k, V = x, O = z, R = 0, H = -1, U = 1 << z, W = U - 1, f === u && U > l || f === p && U > d) + for (de[1] = 0, E = 1; E < a; E++) + de[E + 1] = de[E] + ue[E]; + for ($ = 0; $ < p; $++) + s[u + $] !== 0 && (o[de[s[u + $]]++] = $); + if (f === c ? (re = oe = o, te = 19) : f === d ? (re = m, ie -= 257, oe = y, J -= 257, te = 256) : (re = x, oe = b, te = -1), B = 0, $ = 0, E = k, j = w, O = z, R = 0, H = -1, W = 1 << z, U = W - 1, f === d && W > l || f === _ && W > h) return 1; for (; ; ) { - Me = E - R, c[$] < ee ? (se = 0, Ce = c[$]) : c[$] > ee ? (se = le[J + c[$]], Ce = re[ie + c[$]]) : (se = 96, Ce = 0), N = 1 << E - R, G = 1 << O, k = G; + Ee = E - R, o[$] < te ? (se = 0, Ae = o[$]) : o[$] > te ? (se = oe[J + o[$]], Ae = re[ie + o[$]]) : (se = 96, Ae = 0), P = 1 << E - R, G = 1 << O, k = G; do - G -= N, g[V + (B >> R) + G] = Me << 24 | se << 16 | Ce | 0; + G -= P, g[j + (B >> R) + G] = Ee << 24 | se << 16 | Ae | 0; while (G !== 0); - for (N = 1 << E - 1; B & N; ) - N >>= 1; - if (N !== 0 ? (B &= N - 1, B += N) : B = 0, $++, --ce[E] === 0) { + for (P = 1 << E - 1; B & P; ) + P >>= 1; + if (P !== 0 ? (B &= P - 1, B += P) : B = 0, $++, --ue[E] === 0) { if (E === L) break; - E = s[h + c[$]]; + E = s[u + o[$]]; } - if (E > z && (B & W) !== H) { - for (R === 0 && (R = z), V += k, O = E - R, P = 1 << O; O + R < L && (P -= ce[O + R], !(P <= 0)); ) - O++, P <<= 1; - if (U += 1 << O, f === u && U > l || f === p && U > d) + if (E > z && (B & U) !== H) { + for (R === 0 && (R = z), j += k, O = E - R, N = 1 << O; O + R < L && (N -= ue[O + R], !(N <= 0)); ) + O++, N <<= 1; + if (W += 1 << O, f === d && W > l || f === _ && W > h) return 1; - H = B & W, g[H] = z << 24 | O << 16 | V - x | 0; + H = B & U, g[H] = z << 24 | O << 16 | j - w | 0; } } - return B !== 0 && (g[V + B] = E - R << 24 | 4194304 | 0), v.bits = z, 0; + return B !== 0 && (g[j + B] = E - R << 24 | 4194304 | 0), v.bits = z, 0; }; } ), @@ -38569,12 +38569,12 @@ ATOM`, x); var r = t( /*! ../utils/common */ "./node_modules/upng-js/node_modules/pako/lib/utils/common.js" - ), a = 4, l = 0, d = 1, o = 2; - function u(K) { - for (var fe = K.length; --fe >= 0; ) - K[fe] = 0; + ), a = 4, l = 0, h = 1, c = 2; + function d(Y) { + for (var me = Y.length; --me >= 0; ) + Y[me] = 0; } - var p = 0, m = 1, y = 2, w = 3, b = 258, A = 29, f = 256, s = f + 1 + A, h = 30, _ = 19, g = 2 * s + 1, x = 15, c = 16, v = 7, M = 256, E = 16, $ = 17, k = 18, L = ( + var _ = 0, m = 1, y = 2, x = 3, b = 258, A = 29, f = 256, s = f + 1 + A, u = 30, p = 19, g = 2 * s + 1, w = 15, o = 16, v = 7, M = 256, E = 16, $ = 17, k = 18, L = ( /* extra bits for each length code */ [0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 2, 2, 2, 2, 3, 3, 3, 3, 4, 4, 4, 4, 5, 5, 5, 5, 0] ), z = ( @@ -38583,234 +38583,234 @@ ATOM`, x); ), O = ( /* extra bits for each bit length code */ [0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 2, 3, 7] - ), R = [16, 17, 18, 0, 8, 7, 9, 6, 10, 5, 11, 4, 12, 3, 13, 2, 14, 1, 15], P = 512, U = new Array((s + 2) * 2); - u(U); - var B = new Array(h * 2); - u(B); - var N = new Array(P); - u(N); - var G = new Array(b - w + 1); - u(G); + ), R = [16, 17, 18, 0, 8, 7, 9, 6, 10, 5, 11, 4, 12, 3, 13, 2, 14, 1, 15], N = 512, W = new Array((s + 2) * 2); + d(W); + var B = new Array(u * 2); + d(B); + var P = new Array(N); + d(P); + var G = new Array(b - x + 1); + d(G); var H = new Array(A); - u(H); - var W = new Array(h); - u(W); - function V(K, fe, Se, Ne, pe) { - this.static_tree = K, this.extra_bits = fe, this.extra_base = Se, this.elems = Ne, this.max_length = pe, this.has_stree = K && K.length; + d(H); + var U = new Array(u); + d(U); + function j(Y, me, we, Re, pe) { + this.static_tree = Y, this.extra_bits = me, this.extra_base = we, this.elems = Re, this.max_length = pe, this.has_stree = Y && Y.length; } - var re, ie, ee; - function ce(K, fe) { - this.dyn_tree = K, this.max_code = 0, this.stat_desc = fe; + var re, ie, te; + function ue(Y, me) { + this.dyn_tree = Y, this.max_code = 0, this.stat_desc = me; } - function he(K) { - return K < 256 ? N[K] : N[256 + (K >>> 7)]; + function de(Y) { + return Y < 256 ? P[Y] : P[256 + (Y >>> 7)]; } - function le(K, fe) { - K.pending_buf[K.pending++] = fe & 255, K.pending_buf[K.pending++] = fe >>> 8 & 255; + function oe(Y, me) { + Y.pending_buf[Y.pending++] = me & 255, Y.pending_buf[Y.pending++] = me >>> 8 & 255; } - function J(K, fe, Se) { - K.bi_valid > c - Se ? (K.bi_buf |= fe << K.bi_valid & 65535, le(K, K.bi_buf), K.bi_buf = fe >> c - K.bi_valid, K.bi_valid += Se - c) : (K.bi_buf |= fe << K.bi_valid & 65535, K.bi_valid += Se); + function J(Y, me, we) { + Y.bi_valid > o - we ? (Y.bi_buf |= me << Y.bi_valid & 65535, oe(Y, Y.bi_buf), Y.bi_buf = me >> o - Y.bi_valid, Y.bi_valid += we - o) : (Y.bi_buf |= me << Y.bi_valid & 65535, Y.bi_valid += we); } - function Me(K, fe, Se) { + function Ee(Y, me, we) { J( - K, - Se[fe * 2], - Se[fe * 2 + 1] + Y, + we[me * 2], + we[me * 2 + 1] /*.Len*/ ); } - function se(K, fe) { - var Se = 0; + function se(Y, me) { + var we = 0; do - Se |= K & 1, K >>>= 1, Se <<= 1; - while (--fe > 0); - return Se >>> 1; - } - function Ce(K) { - K.bi_valid === 16 ? (le(K, K.bi_buf), K.bi_buf = 0, K.bi_valid = 0) : K.bi_valid >= 8 && (K.pending_buf[K.pending++] = K.bi_buf & 255, K.bi_buf >>= 8, K.bi_valid -= 8); - } - function ue(K, fe) { - var Se = fe.dyn_tree, Ne = fe.max_code, pe = fe.stat_desc.static_tree, ke = fe.stat_desc.has_stree, X = fe.stat_desc.extra_bits, Be = fe.stat_desc.extra_base, Ge = fe.stat_desc.max_length, I, ye, ve, Z, de, $e, Ye = 0; - for (Z = 0; Z <= x; Z++) - K.bl_count[Z] = 0; - for (Se[K.heap[K.heap_max] * 2 + 1] = 0, I = K.heap_max + 1; I < g; I++) - ye = K.heap[I], Z = Se[Se[ye * 2 + 1] * 2 + 1] + 1, Z > Ge && (Z = Ge, Ye++), Se[ye * 2 + 1] = Z, !(ye > Ne) && (K.bl_count[Z]++, de = 0, ye >= Be && (de = X[ye - Be]), $e = Se[ye * 2], K.opt_len += $e * (Z + de), ke && (K.static_len += $e * (pe[ye * 2 + 1] + de))); - if (Ye !== 0) { + we |= Y & 1, Y >>>= 1, we <<= 1; + while (--me > 0); + return we >>> 1; + } + function Ae(Y) { + Y.bi_valid === 16 ? (oe(Y, Y.bi_buf), Y.bi_buf = 0, Y.bi_valid = 0) : Y.bi_valid >= 8 && (Y.pending_buf[Y.pending++] = Y.bi_buf & 255, Y.bi_buf >>= 8, Y.bi_valid -= 8); + } + function he(Y, me) { + var we = me.dyn_tree, Re = me.max_code, pe = me.stat_desc.static_tree, $e = me.stat_desc.has_stree, X = me.stat_desc.extra_bits, ze = me.stat_desc.extra_base, Ve = me.stat_desc.max_length, I, xe, be, q, fe, Ce, Ze = 0; + for (q = 0; q <= w; q++) + Y.bl_count[q] = 0; + for (we[Y.heap[Y.heap_max] * 2 + 1] = 0, I = Y.heap_max + 1; I < g; I++) + xe = Y.heap[I], q = we[we[xe * 2 + 1] * 2 + 1] + 1, q > Ve && (q = Ve, Ze++), we[xe * 2 + 1] = q, !(xe > Re) && (Y.bl_count[q]++, fe = 0, xe >= ze && (fe = X[xe - ze]), Ce = we[xe * 2], Y.opt_len += Ce * (q + fe), $e && (Y.static_len += Ce * (pe[xe * 2 + 1] + fe))); + if (Ze !== 0) { do { - for (Z = Ge - 1; K.bl_count[Z] === 0; ) - Z--; - K.bl_count[Z]--, K.bl_count[Z + 1] += 2, K.bl_count[Ge]--, Ye -= 2; - } while (Ye > 0); - for (Z = Ge; Z !== 0; Z--) - for (ye = K.bl_count[Z]; ye !== 0; ) - ve = K.heap[--I], !(ve > Ne) && (Se[ve * 2 + 1] !== Z && (K.opt_len += (Z - Se[ve * 2 + 1]) * Se[ve * 2], Se[ve * 2 + 1] = Z), ye--); + for (q = Ve - 1; Y.bl_count[q] === 0; ) + q--; + Y.bl_count[q]--, Y.bl_count[q + 1] += 2, Y.bl_count[Ve]--, Ze -= 2; + } while (Ze > 0); + for (q = Ve; q !== 0; q--) + for (xe = Y.bl_count[q]; xe !== 0; ) + be = Y.heap[--I], !(be > Re) && (we[be * 2 + 1] !== q && (Y.opt_len += (q - we[be * 2 + 1]) * we[be * 2], we[be * 2 + 1] = q), xe--); } } - function ne(K, fe, Se) { - var Ne = new Array(x + 1), pe = 0, ke, X; - for (ke = 1; ke <= x; ke++) - Ne[ke] = pe = pe + Se[ke - 1] << 1; - for (X = 0; X <= fe; X++) { - var Be = K[X * 2 + 1]; - Be !== 0 && (K[X * 2] = se(Ne[Be]++, Be)); + function ne(Y, me, we) { + var Re = new Array(w + 1), pe = 0, $e, X; + for ($e = 1; $e <= w; $e++) + Re[$e] = pe = pe + we[$e - 1] << 1; + for (X = 0; X <= me; X++) { + var ze = Y[X * 2 + 1]; + ze !== 0 && (Y[X * 2] = se(Re[ze]++, ze)); } } function _e() { - var K, fe, Se, Ne, pe, ke = new Array(x + 1); - for (Se = 0, Ne = 0; Ne < A - 1; Ne++) - for (H[Ne] = Se, K = 0; K < 1 << L[Ne]; K++) - G[Se++] = Ne; - for (G[Se - 1] = Ne, pe = 0, Ne = 0; Ne < 16; Ne++) - for (W[Ne] = pe, K = 0; K < 1 << z[Ne]; K++) - N[pe++] = Ne; - for (pe >>= 7; Ne < h; Ne++) - for (W[Ne] = pe << 7, K = 0; K < 1 << z[Ne] - 7; K++) - N[256 + pe++] = Ne; - for (fe = 0; fe <= x; fe++) - ke[fe] = 0; - for (K = 0; K <= 143; ) - U[K * 2 + 1] = 8, K++, ke[8]++; - for (; K <= 255; ) - U[K * 2 + 1] = 9, K++, ke[9]++; - for (; K <= 279; ) - U[K * 2 + 1] = 7, K++, ke[7]++; - for (; K <= 287; ) - U[K * 2 + 1] = 8, K++, ke[8]++; - for (ne(U, s + 1, ke), K = 0; K < h; K++) - B[K * 2 + 1] = 5, B[K * 2] = se(K, 5); - re = new V(U, L, f + 1, s, x), ie = new V(B, z, 0, h, x), ee = new V(new Array(0), O, 0, _, v); - } - function Oe(K) { - var fe; - for (fe = 0; fe < s; fe++) - K.dyn_ltree[fe * 2] = 0; - for (fe = 0; fe < h; fe++) - K.dyn_dtree[fe * 2] = 0; - for (fe = 0; fe < _; fe++) - K.bl_tree[fe * 2] = 0; - K.dyn_ltree[M * 2] = 1, K.opt_len = K.static_len = 0, K.last_lit = K.matches = 0; - } - function Re(K) { - K.bi_valid > 8 ? le(K, K.bi_buf) : K.bi_valid > 0 && (K.pending_buf[K.pending++] = K.bi_buf), K.bi_buf = 0, K.bi_valid = 0; - } - function Ue(K, fe, Se, Ne) { - Re(K), le(K, Se), le(K, ~Se), r.arraySet(K.pending_buf, K.window, fe, Se, K.pending), K.pending += Se; - } - function We(K, fe, Se, Ne) { - var pe = fe * 2, ke = Se * 2; - return K[pe] < K[ke] || K[pe] === K[ke] && Ne[fe] <= Ne[Se]; - } - function Ee(K, fe, Se) { - for (var Ne = K.heap[Se], pe = Se << 1; pe <= K.heap_len && (pe < K.heap_len && We(fe, K.heap[pe + 1], K.heap[pe], K.depth) && pe++, !We(fe, Ne, K.heap[pe], K.depth)); ) - K.heap[Se] = K.heap[pe], Se = pe, pe <<= 1; - K.heap[Se] = Ne; - } - function Ae(K, fe, Se) { - var Ne, pe, ke = 0, X, Be; - if (K.last_lit !== 0) + var Y, me, we, Re, pe, $e = new Array(w + 1); + for (we = 0, Re = 0; Re < A - 1; Re++) + for (H[Re] = we, Y = 0; Y < 1 << L[Re]; Y++) + G[we++] = Re; + for (G[we - 1] = Re, pe = 0, Re = 0; Re < 16; Re++) + for (U[Re] = pe, Y = 0; Y < 1 << z[Re]; Y++) + P[pe++] = Re; + for (pe >>= 7; Re < u; Re++) + for (U[Re] = pe << 7, Y = 0; Y < 1 << z[Re] - 7; Y++) + P[256 + pe++] = Re; + for (me = 0; me <= w; me++) + $e[me] = 0; + for (Y = 0; Y <= 143; ) + W[Y * 2 + 1] = 8, Y++, $e[8]++; + for (; Y <= 255; ) + W[Y * 2 + 1] = 9, Y++, $e[9]++; + for (; Y <= 279; ) + W[Y * 2 + 1] = 7, Y++, $e[7]++; + for (; Y <= 287; ) + W[Y * 2 + 1] = 8, Y++, $e[8]++; + for (ne(W, s + 1, $e), Y = 0; Y < u; Y++) + B[Y * 2 + 1] = 5, B[Y * 2] = se(Y, 5); + re = new j(W, L, f + 1, s, w), ie = new j(B, z, 0, u, w), te = new j(new Array(0), O, 0, p, v); + } + function Le(Y) { + var me; + for (me = 0; me < s; me++) + Y.dyn_ltree[me * 2] = 0; + for (me = 0; me < u; me++) + Y.dyn_dtree[me * 2] = 0; + for (me = 0; me < p; me++) + Y.bl_tree[me * 2] = 0; + Y.dyn_ltree[M * 2] = 1, Y.opt_len = Y.static_len = 0, Y.last_lit = Y.matches = 0; + } + function Be(Y) { + Y.bi_valid > 8 ? oe(Y, Y.bi_buf) : Y.bi_valid > 0 && (Y.pending_buf[Y.pending++] = Y.bi_buf), Y.bi_buf = 0, Y.bi_valid = 0; + } + function Ue(Y, me, we, Re) { + Be(Y), oe(Y, we), oe(Y, ~we), r.arraySet(Y.pending_buf, Y.window, me, we, Y.pending), Y.pending += we; + } + function He(Y, me, we, Re) { + var pe = me * 2, $e = we * 2; + return Y[pe] < Y[$e] || Y[pe] === Y[$e] && Re[me] <= Re[we]; + } + function We(Y, me, we) { + for (var Re = Y.heap[we], pe = we << 1; pe <= Y.heap_len && (pe < Y.heap_len && He(me, Y.heap[pe + 1], Y.heap[pe], Y.depth) && pe++, !He(me, Re, Y.heap[pe], Y.depth)); ) + Y.heap[we] = Y.heap[pe], we = pe, pe <<= 1; + Y.heap[we] = Re; + } + function Ge(Y, me, we) { + var Re, pe, $e = 0, X, ze; + if (Y.last_lit !== 0) do - Ne = K.pending_buf[K.d_buf + ke * 2] << 8 | K.pending_buf[K.d_buf + ke * 2 + 1], pe = K.pending_buf[K.l_buf + ke], ke++, Ne === 0 ? Me(K, pe, fe) : (X = G[pe], Me(K, X + f + 1, fe), Be = L[X], Be !== 0 && (pe -= H[X], J(K, pe, Be)), Ne--, X = he(Ne), Me(K, X, Se), Be = z[X], Be !== 0 && (Ne -= W[X], J(K, Ne, Be))); - while (ke < K.last_lit); - Me(K, M, fe); - } - function ge(K, fe) { - var Se = fe.dyn_tree, Ne = fe.stat_desc.static_tree, pe = fe.stat_desc.has_stree, ke = fe.stat_desc.elems, X, Be, Ge = -1, I; - for (K.heap_len = 0, K.heap_max = g, X = 0; X < ke; X++) - Se[X * 2] !== 0 ? (K.heap[++K.heap_len] = Ge = X, K.depth[X] = 0) : Se[X * 2 + 1] = 0; - for (; K.heap_len < 2; ) - I = K.heap[++K.heap_len] = Ge < 2 ? ++Ge : 0, Se[I * 2] = 1, K.depth[I] = 0, K.opt_len--, pe && (K.static_len -= Ne[I * 2 + 1]); - for (fe.max_code = Ge, X = K.heap_len >> 1; X >= 1; X--) - Ee(K, Se, X); - I = ke; + Re = Y.pending_buf[Y.d_buf + $e * 2] << 8 | Y.pending_buf[Y.d_buf + $e * 2 + 1], pe = Y.pending_buf[Y.l_buf + $e], $e++, Re === 0 ? Ee(Y, pe, me) : (X = G[pe], Ee(Y, X + f + 1, me), ze = L[X], ze !== 0 && (pe -= H[X], J(Y, pe, ze)), Re--, X = de(Re), Ee(Y, X, we), ze = z[X], ze !== 0 && (Re -= U[X], J(Y, Re, ze))); + while ($e < Y.last_lit); + Ee(Y, M, me); + } + function Ne(Y, me) { + var we = me.dyn_tree, Re = me.stat_desc.static_tree, pe = me.stat_desc.has_stree, $e = me.stat_desc.elems, X, ze, Ve = -1, I; + for (Y.heap_len = 0, Y.heap_max = g, X = 0; X < $e; X++) + we[X * 2] !== 0 ? (Y.heap[++Y.heap_len] = Ve = X, Y.depth[X] = 0) : we[X * 2 + 1] = 0; + for (; Y.heap_len < 2; ) + I = Y.heap[++Y.heap_len] = Ve < 2 ? ++Ve : 0, we[I * 2] = 1, Y.depth[I] = 0, Y.opt_len--, pe && (Y.static_len -= Re[I * 2 + 1]); + for (me.max_code = Ve, X = Y.heap_len >> 1; X >= 1; X--) + We(Y, we, X); + I = $e; do - X = K.heap[ + X = Y.heap[ 1 /*SMALLEST*/ - ], K.heap[ + ], Y.heap[ 1 /*SMALLEST*/ - ] = K.heap[K.heap_len--], Ee( - K, - Se, + ] = Y.heap[Y.heap_len--], We( + Y, + we, 1 /*SMALLEST*/ - ), Be = K.heap[ + ), ze = Y.heap[ 1 /*SMALLEST*/ - ], K.heap[--K.heap_max] = X, K.heap[--K.heap_max] = Be, Se[I * 2] = Se[X * 2] + Se[Be * 2], K.depth[I] = (K.depth[X] >= K.depth[Be] ? K.depth[X] : K.depth[Be]) + 1, Se[X * 2 + 1] = Se[Be * 2 + 1] = I, K.heap[ + ], Y.heap[--Y.heap_max] = X, Y.heap[--Y.heap_max] = ze, we[I * 2] = we[X * 2] + we[ze * 2], Y.depth[I] = (Y.depth[X] >= Y.depth[ze] ? Y.depth[X] : Y.depth[ze]) + 1, we[X * 2 + 1] = we[ze * 2 + 1] = I, Y.heap[ 1 /*SMALLEST*/ - ] = I++, Ee( - K, - Se, + ] = I++, We( + Y, + we, 1 /*SMALLEST*/ ); - while (K.heap_len >= 2); - K.heap[--K.heap_max] = K.heap[ + while (Y.heap_len >= 2); + Y.heap[--Y.heap_max] = Y.heap[ 1 /*SMALLEST*/ - ], ue(K, fe), ne(Se, Ge, K.bl_count); - } - function Le(K, fe, Se) { - var Ne, pe = -1, ke, X = fe[0 * 2 + 1], Be = 0, Ge = 7, I = 4; - for (X === 0 && (Ge = 138, I = 3), fe[(Se + 1) * 2 + 1] = 65535, Ne = 0; Ne <= Se; Ne++) - ke = X, X = fe[(Ne + 1) * 2 + 1], !(++Be < Ge && ke === X) && (Be < I ? K.bl_tree[ke * 2] += Be : ke !== 0 ? (ke !== pe && K.bl_tree[ke * 2]++, K.bl_tree[E * 2]++) : Be <= 10 ? K.bl_tree[$ * 2]++ : K.bl_tree[k * 2]++, Be = 0, pe = ke, X === 0 ? (Ge = 138, I = 3) : ke === X ? (Ge = 6, I = 3) : (Ge = 7, I = 4)); - } - function Te(K, fe, Se) { - var Ne, pe = -1, ke, X = fe[0 * 2 + 1], Be = 0, Ge = 7, I = 4; - for (X === 0 && (Ge = 138, I = 3), Ne = 0; Ne <= Se; Ne++) - if (ke = X, X = fe[(Ne + 1) * 2 + 1], !(++Be < Ge && ke === X)) { - if (Be < I) + ], he(Y, me), ne(we, Ve, Y.bl_count); + } + function Pe(Y, me, we) { + var Re, pe = -1, $e, X = me[0 * 2 + 1], ze = 0, Ve = 7, I = 4; + for (X === 0 && (Ve = 138, I = 3), me[(we + 1) * 2 + 1] = 65535, Re = 0; Re <= we; Re++) + $e = X, X = me[(Re + 1) * 2 + 1], !(++ze < Ve && $e === X) && (ze < I ? Y.bl_tree[$e * 2] += ze : $e !== 0 ? ($e !== pe && Y.bl_tree[$e * 2]++, Y.bl_tree[E * 2]++) : ze <= 10 ? Y.bl_tree[$ * 2]++ : Y.bl_tree[k * 2]++, ze = 0, pe = $e, X === 0 ? (Ve = 138, I = 3) : $e === X ? (Ve = 6, I = 3) : (Ve = 7, I = 4)); + } + function Te(Y, me, we) { + var Re, pe = -1, $e, X = me[0 * 2 + 1], ze = 0, Ve = 7, I = 4; + for (X === 0 && (Ve = 138, I = 3), Re = 0; Re <= we; Re++) + if ($e = X, X = me[(Re + 1) * 2 + 1], !(++ze < Ve && $e === X)) { + if (ze < I) do - Me(K, ke, K.bl_tree); - while (--Be !== 0); - else ke !== 0 ? (ke !== pe && (Me(K, ke, K.bl_tree), Be--), Me(K, E, K.bl_tree), J(K, Be - 3, 2)) : Be <= 10 ? (Me(K, $, K.bl_tree), J(K, Be - 3, 3)) : (Me(K, k, K.bl_tree), J(K, Be - 11, 7)); - Be = 0, pe = ke, X === 0 ? (Ge = 138, I = 3) : ke === X ? (Ge = 6, I = 3) : (Ge = 7, I = 4); + Ee(Y, $e, Y.bl_tree); + while (--ze !== 0); + else $e !== 0 ? ($e !== pe && (Ee(Y, $e, Y.bl_tree), ze--), Ee(Y, E, Y.bl_tree), J(Y, ze - 3, 2)) : ze <= 10 ? (Ee(Y, $, Y.bl_tree), J(Y, ze - 3, 3)) : (Ee(Y, k, Y.bl_tree), J(Y, ze - 11, 7)); + ze = 0, pe = $e, X === 0 ? (Ve = 138, I = 3) : $e === X ? (Ve = 6, I = 3) : (Ve = 7, I = 4); } } - function Ke(K) { - var fe; - for (Le(K, K.dyn_ltree, K.l_desc.max_code), Le(K, K.dyn_dtree, K.d_desc.max_code), ge(K, K.bl_desc), fe = _ - 1; fe >= 3 && K.bl_tree[R[fe] * 2 + 1] === 0; fe--) + function Me(Y) { + var me; + for (Pe(Y, Y.dyn_ltree, Y.l_desc.max_code), Pe(Y, Y.dyn_dtree, Y.d_desc.max_code), Ne(Y, Y.bl_desc), me = p - 1; me >= 3 && Y.bl_tree[R[me] * 2 + 1] === 0; me--) ; - return K.opt_len += 3 * (fe + 1) + 5 + 5 + 4, fe; + return Y.opt_len += 3 * (me + 1) + 5 + 5 + 4, me; } - function je(K, fe, Se, Ne) { + function De(Y, me, we, Re) { var pe; - for (J(K, fe - 257, 5), J(K, Se - 1, 5), J(K, Ne - 4, 4), pe = 0; pe < Ne; pe++) - J(K, K.bl_tree[R[pe] * 2 + 1], 3); - Te(K, K.dyn_ltree, fe - 1), Te(K, K.dyn_dtree, Se - 1); - } - function Y(K) { - var fe = 4093624447, Se; - for (Se = 0; Se <= 31; Se++, fe >>>= 1) - if (fe & 1 && K.dyn_ltree[Se * 2] !== 0) + for (J(Y, me - 257, 5), J(Y, we - 1, 5), J(Y, Re - 4, 4), pe = 0; pe < Re; pe++) + J(Y, Y.bl_tree[R[pe] * 2 + 1], 3); + Te(Y, Y.dyn_ltree, me - 1), Te(Y, Y.dyn_dtree, we - 1); + } + function V(Y) { + var me = 4093624447, we; + for (we = 0; we <= 31; we++, me >>>= 1) + if (me & 1 && Y.dyn_ltree[we * 2] !== 0) return l; - if (K.dyn_ltree[18] !== 0 || K.dyn_ltree[20] !== 0 || K.dyn_ltree[26] !== 0) - return d; - for (Se = 32; Se < f; Se++) - if (K.dyn_ltree[Se * 2] !== 0) - return d; + if (Y.dyn_ltree[18] !== 0 || Y.dyn_ltree[20] !== 0 || Y.dyn_ltree[26] !== 0) + return h; + for (we = 32; we < f; we++) + if (Y.dyn_ltree[we * 2] !== 0) + return h; return l; } - var q = !1; - function te(K) { - q || (_e(), q = !0), K.l_desc = new ce(K.dyn_ltree, re), K.d_desc = new ce(K.dyn_dtree, ie), K.bl_desc = new ce(K.bl_tree, ee), K.bi_buf = 0, K.bi_valid = 0, Oe(K); + var Z = !1; + function ee(Y) { + Z || (_e(), Z = !0), Y.l_desc = new ue(Y.dyn_ltree, re), Y.d_desc = new ue(Y.dyn_dtree, ie), Y.bl_desc = new ue(Y.bl_tree, te), Y.bi_buf = 0, Y.bi_valid = 0, Le(Y); } - function we(K, fe, Se, Ne) { - J(K, (p << 1) + (Ne ? 1 : 0), 3), Ue(K, fe, Se); + function ye(Y, me, we, Re) { + J(Y, (_ << 1) + (Re ? 1 : 0), 3), Ue(Y, me, we); } - function me(K) { - J(K, m << 1, 3), Me(K, M, U), Ce(K); + function ce(Y) { + J(Y, m << 1, 3), Ee(Y, M, W), Ae(Y); } - function Pe(K, fe, Se, Ne) { - var pe, ke, X = 0; - K.level > 0 ? (K.strm.data_type === o && (K.strm.data_type = Y(K)), ge(K, K.l_desc), ge(K, K.d_desc), X = Ke(K), pe = K.opt_len + 3 + 7 >>> 3, ke = K.static_len + 3 + 7 >>> 3, ke <= pe && (pe = ke)) : pe = ke = Se + 5, Se + 4 <= pe && fe !== -1 ? we(K, fe, Se, Ne) : K.strategy === a || ke === pe ? (J(K, (m << 1) + (Ne ? 1 : 0), 3), Ae(K, U, B)) : (J(K, (y << 1) + (Ne ? 1 : 0), 3), je(K, K.l_desc.max_code + 1, K.d_desc.max_code + 1, X + 1), Ae(K, K.dyn_ltree, K.dyn_dtree)), Oe(K), Ne && Re(K); + function Ie(Y, me, we, Re) { + var pe, $e, X = 0; + Y.level > 0 ? (Y.strm.data_type === c && (Y.strm.data_type = V(Y)), Ne(Y, Y.l_desc), Ne(Y, Y.d_desc), X = Me(Y), pe = Y.opt_len + 3 + 7 >>> 3, $e = Y.static_len + 3 + 7 >>> 3, $e <= pe && (pe = $e)) : pe = $e = we + 5, we + 4 <= pe && me !== -1 ? ye(Y, me, we, Re) : Y.strategy === a || $e === pe ? (J(Y, (m << 1) + (Re ? 1 : 0), 3), Ge(Y, W, B)) : (J(Y, (y << 1) + (Re ? 1 : 0), 3), De(Y, Y.l_desc.max_code + 1, Y.d_desc.max_code + 1, X + 1), Ge(Y, Y.dyn_ltree, Y.dyn_dtree)), Le(Y), Re && Be(Y); } - function Fe(K, fe, Se) { - return K.pending_buf[K.d_buf + K.last_lit * 2] = fe >>> 8 & 255, K.pending_buf[K.d_buf + K.last_lit * 2 + 1] = fe & 255, K.pending_buf[K.l_buf + K.last_lit] = Se & 255, K.last_lit++, fe === 0 ? K.dyn_ltree[Se * 2]++ : (K.matches++, fe--, K.dyn_ltree[(G[Se] + f + 1) * 2]++, K.dyn_dtree[he(fe) * 2]++), K.last_lit === K.lit_bufsize - 1; + function ke(Y, me, we) { + return Y.pending_buf[Y.d_buf + Y.last_lit * 2] = me >>> 8 & 255, Y.pending_buf[Y.d_buf + Y.last_lit * 2 + 1] = me & 255, Y.pending_buf[Y.l_buf + Y.last_lit] = we & 255, Y.last_lit++, me === 0 ? Y.dyn_ltree[we * 2]++ : (Y.matches++, me--, Y.dyn_ltree[(G[we] + f + 1) * 2]++, Y.dyn_dtree[de(me) * 2]++), Y.last_lit === Y.lit_bufsize - 1; } - e._tr_init = te, e._tr_stored_block = we, e._tr_flush_block = Pe, e._tr_tally = Fe, e._tr_align = me; + e._tr_init = ee, e._tr_stored_block = ye, e._tr_flush_block = Ie, e._tr_tally = ke, e._tr_align = ce; } ), /***/ @@ -38877,529 +38877,529 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `; (function(t, r) { r(e); })(this, function(t) { - function r(Y, q, te) { - for (var we = (Y.byteLength, 0), me = te.length; me > we; we++) { - var Pe = te.charCodeAt(we); - if (128 > Pe) Y.setUint8(q++, Pe >>> 0 & 127 | 0); - else if (2048 > Pe) Y.setUint8(q++, Pe >>> 6 & 31 | 192), Y.setUint8(q++, Pe >>> 0 & 63 | 128); - else if (65536 > Pe) Y.setUint8(q++, Pe >>> 12 & 15 | 224), Y.setUint8(q++, Pe >>> 6 & 63 | 128), Y.setUint8(q++, Pe >>> 0 & 63 | 128); + function r(V, Z, ee) { + for (var ye = (V.byteLength, 0), ce = ee.length; ce > ye; ye++) { + var Ie = ee.charCodeAt(ye); + if (128 > Ie) V.setUint8(Z++, Ie >>> 0 & 127 | 0); + else if (2048 > Ie) V.setUint8(Z++, Ie >>> 6 & 31 | 192), V.setUint8(Z++, Ie >>> 0 & 63 | 128); + else if (65536 > Ie) V.setUint8(Z++, Ie >>> 12 & 15 | 224), V.setUint8(Z++, Ie >>> 6 & 63 | 128), V.setUint8(Z++, Ie >>> 0 & 63 | 128); else { - if (!(1114112 > Pe)) throw new Error("bad codepoint " + Pe); - Y.setUint8(q++, Pe >>> 18 & 7 | 240), Y.setUint8(q++, Pe >>> 12 & 63 | 128), Y.setUint8(q++, Pe >>> 6 & 63 | 128), Y.setUint8(q++, Pe >>> 0 & 63 | 128); + if (!(1114112 > Ie)) throw new Error("bad codepoint " + Ie); + V.setUint8(Z++, Ie >>> 18 & 7 | 240), V.setUint8(Z++, Ie >>> 12 & 63 | 128), V.setUint8(Z++, Ie >>> 6 & 63 | 128), V.setUint8(Z++, Ie >>> 0 & 63 | 128); } } } - function a(Y) { - for (var q = 0, te = 0, we = Y.length; we > te; te++) { - var me = Y.charCodeAt(te); - if (128 > me) q += 1; - else if (2048 > me) q += 2; - else if (65536 > me) q += 3; + function a(V) { + for (var Z = 0, ee = 0, ye = V.length; ye > ee; ee++) { + var ce = V.charCodeAt(ee); + if (128 > ce) Z += 1; + else if (2048 > ce) Z += 2; + else if (65536 > ce) Z += 3; else { - if (!(1114112 > me)) throw new Error("bad codepoint " + me); - q += 4; + if (!(1114112 > ce)) throw new Error("bad codepoint " + ce); + Z += 4; } } - return q; - } - function l(Y, q, te) { - var we = typeof Y; - if (we === "string") { - var me = a(Y); - if (32 > me) return q.setUint8(te, 160 | me), r(q, te + 1, Y), 1 + me; - if (256 > me) return q.setUint8(te, 217), q.setUint8(te + 1, me), r(q, te + 2, Y), 2 + me; - if (65536 > me) return q.setUint8(te, 218), q.setUint16(te + 1, me), r(q, te + 3, Y), 3 + me; - if (4294967296 > me) return q.setUint8(te, 219), q.setUint32(te + 1, me), r(q, te + 5, Y), 5 + me; - } - if (Y instanceof Uint8Array) { - var me = Y.byteLength, Pe = new Uint8Array(q.buffer); - if (256 > me) return q.setUint8(te, 196), q.setUint8(te + 1, me), Pe.set(Y, te + 2), 2 + me; - if (65536 > me) return q.setUint8(te, 197), q.setUint16(te + 1, me), Pe.set(Y, te + 3), 3 + me; - if (4294967296 > me) return q.setUint8(te, 198), q.setUint32(te + 1, me), Pe.set(Y, te + 5), 5 + me; - } - if (we === "number") { - if (!isFinite(Y)) throw new Error("Number not finite: " + Y); - if (Math.floor(Y) !== Y) return q.setUint8(te, 203), q.setFloat64(te + 1, Y), 9; - if (Y >= 0) { - if (128 > Y) return q.setUint8(te, Y), 1; - if (256 > Y) return q.setUint8(te, 204), q.setUint8(te + 1, Y), 2; - if (65536 > Y) return q.setUint8(te, 205), q.setUint16(te + 1, Y), 3; - if (4294967296 > Y) return q.setUint8(te, 206), q.setUint32(te + 1, Y), 5; - throw new Error("Number too big 0x" + Y.toString(16)); + return Z; + } + function l(V, Z, ee) { + var ye = typeof V; + if (ye === "string") { + var ce = a(V); + if (32 > ce) return Z.setUint8(ee, 160 | ce), r(Z, ee + 1, V), 1 + ce; + if (256 > ce) return Z.setUint8(ee, 217), Z.setUint8(ee + 1, ce), r(Z, ee + 2, V), 2 + ce; + if (65536 > ce) return Z.setUint8(ee, 218), Z.setUint16(ee + 1, ce), r(Z, ee + 3, V), 3 + ce; + if (4294967296 > ce) return Z.setUint8(ee, 219), Z.setUint32(ee + 1, ce), r(Z, ee + 5, V), 5 + ce; + } + if (V instanceof Uint8Array) { + var ce = V.byteLength, Ie = new Uint8Array(Z.buffer); + if (256 > ce) return Z.setUint8(ee, 196), Z.setUint8(ee + 1, ce), Ie.set(V, ee + 2), 2 + ce; + if (65536 > ce) return Z.setUint8(ee, 197), Z.setUint16(ee + 1, ce), Ie.set(V, ee + 3), 3 + ce; + if (4294967296 > ce) return Z.setUint8(ee, 198), Z.setUint32(ee + 1, ce), Ie.set(V, ee + 5), 5 + ce; + } + if (ye === "number") { + if (!isFinite(V)) throw new Error("Number not finite: " + V); + if (Math.floor(V) !== V) return Z.setUint8(ee, 203), Z.setFloat64(ee + 1, V), 9; + if (V >= 0) { + if (128 > V) return Z.setUint8(ee, V), 1; + if (256 > V) return Z.setUint8(ee, 204), Z.setUint8(ee + 1, V), 2; + if (65536 > V) return Z.setUint8(ee, 205), Z.setUint16(ee + 1, V), 3; + if (4294967296 > V) return Z.setUint8(ee, 206), Z.setUint32(ee + 1, V), 5; + throw new Error("Number too big 0x" + V.toString(16)); } - if (Y >= -32) return q.setInt8(te, Y), 1; - if (Y >= -128) return q.setUint8(te, 208), q.setInt8(te + 1, Y), 2; - if (Y >= -32768) return q.setUint8(te, 209), q.setInt16(te + 1, Y), 3; - if (Y >= -2147483648) return q.setUint8(te, 210), q.setInt32(te + 1, Y), 5; - throw new Error("Number too small -0x" + (-Y).toString(16).substr(1)); - } - if (Y === null) return q.setUint8(te, 192), 1; - if (we === "boolean") return q.setUint8(te, Y ? 195 : 194), 1; - if (we === "object") { - var me, fe = 0, Fe = Array.isArray(Y); - if (Fe) me = Y.length; + if (V >= -32) return Z.setInt8(ee, V), 1; + if (V >= -128) return Z.setUint8(ee, 208), Z.setInt8(ee + 1, V), 2; + if (V >= -32768) return Z.setUint8(ee, 209), Z.setInt16(ee + 1, V), 3; + if (V >= -2147483648) return Z.setUint8(ee, 210), Z.setInt32(ee + 1, V), 5; + throw new Error("Number too small -0x" + (-V).toString(16).substr(1)); + } + if (V === null) return Z.setUint8(ee, 192), 1; + if (ye === "boolean") return Z.setUint8(ee, V ? 195 : 194), 1; + if (ye === "object") { + var ce, me = 0, ke = Array.isArray(V); + if (ke) ce = V.length; else { - var K = Object.keys(Y); - me = K.length; + var Y = Object.keys(V); + ce = Y.length; } - var fe; - if (16 > me ? (q.setUint8(te, me | (Fe ? 144 : 128)), fe = 1) : 65536 > me ? (q.setUint8(te, Fe ? 220 : 222), q.setUint16(te + 1, me), fe = 3) : 4294967296 > me && (q.setUint8(te, Fe ? 221 : 223), q.setUint32(te + 1, me), fe = 5), Fe) for (var Se = 0; me > Se; Se++) fe += l(Y[Se], q, te + fe); - else for (var Se = 0; me > Se; Se++) { - var Ne = K[Se]; - fe += l(Ne, q, te + fe), fe += l(Y[Ne], q, te + fe); + var me; + if (16 > ce ? (Z.setUint8(ee, ce | (ke ? 144 : 128)), me = 1) : 65536 > ce ? (Z.setUint8(ee, ke ? 220 : 222), Z.setUint16(ee + 1, ce), me = 3) : 4294967296 > ce && (Z.setUint8(ee, ke ? 221 : 223), Z.setUint32(ee + 1, ce), me = 5), ke) for (var we = 0; ce > we; we++) me += l(V[we], Z, ee + me); + else for (var we = 0; ce > we; we++) { + var Re = Y[we]; + me += l(Re, Z, ee + me), me += l(V[Re], Z, ee + me); } - return fe; - } - throw new Error("Unknown type " + we); - } - function d(Y) { - var q = typeof Y; - if (q === "string") { - var te = a(Y); - if (32 > te) return 1 + te; - if (256 > te) return 2 + te; - if (65536 > te) return 3 + te; - if (4294967296 > te) return 5 + te; - } - if (Y instanceof Uint8Array) { - var te = Y.byteLength; - if (256 > te) return 2 + te; - if (65536 > te) return 3 + te; - if (4294967296 > te) return 5 + te; - } - if (q === "number") { - if (Math.floor(Y) !== Y) return 9; - if (Y >= 0) { - if (128 > Y) return 1; - if (256 > Y) return 2; - if (65536 > Y) return 3; - if (4294967296 > Y) return 5; - throw new Error("Number too big 0x" + Y.toString(16)); + return me; + } + throw new Error("Unknown type " + ye); + } + function h(V) { + var Z = typeof V; + if (Z === "string") { + var ee = a(V); + if (32 > ee) return 1 + ee; + if (256 > ee) return 2 + ee; + if (65536 > ee) return 3 + ee; + if (4294967296 > ee) return 5 + ee; + } + if (V instanceof Uint8Array) { + var ee = V.byteLength; + if (256 > ee) return 2 + ee; + if (65536 > ee) return 3 + ee; + if (4294967296 > ee) return 5 + ee; + } + if (Z === "number") { + if (Math.floor(V) !== V) return 9; + if (V >= 0) { + if (128 > V) return 1; + if (256 > V) return 2; + if (65536 > V) return 3; + if (4294967296 > V) return 5; + throw new Error("Number too big 0x" + V.toString(16)); } - if (Y >= -32) return 1; - if (Y >= -128) return 2; - if (Y >= -32768) return 3; - if (Y >= -2147483648) return 5; - throw new Error("Number too small -0x" + Y.toString(16).substr(1)); - } - if (q === "boolean" || Y === null) return 1; - if (q === "object") { - var te, we = 0; - if (Array.isArray(Y)) { - te = Y.length; - for (var me = 0; te > me; me++) we += d(Y[me]); + if (V >= -32) return 1; + if (V >= -128) return 2; + if (V >= -32768) return 3; + if (V >= -2147483648) return 5; + throw new Error("Number too small -0x" + V.toString(16).substr(1)); + } + if (Z === "boolean" || V === null) return 1; + if (Z === "object") { + var ee, ye = 0; + if (Array.isArray(V)) { + ee = V.length; + for (var ce = 0; ee > ce; ce++) ye += h(V[ce]); } else { - var Pe = Object.keys(Y); - te = Pe.length; - for (var me = 0; te > me; me++) { - var Fe = Pe[me]; - we += d(Fe) + d(Y[Fe]); + var Ie = Object.keys(V); + ee = Ie.length; + for (var ce = 0; ee > ce; ce++) { + var ke = Ie[ce]; + ye += h(ke) + h(V[ke]); } } - if (16 > te) return 1 + we; - if (65536 > te) return 3 + we; - if (4294967296 > te) return 5 + we; - throw new Error("Array or object too long 0x" + te.toString(16)); - } - throw new Error("Unknown type " + q); - } - function o(Y) { - var q = new ArrayBuffer(d(Y)), te = new DataView(q); - return l(Y, te, 0), new Uint8Array(q); - } - function u(Y, q, te) { - return q ? new Y(q.buffer, q.byteOffset, q.byteLength / (te || 1)) : void 0; - } - function p(Y) { - return u(DataView, Y); - } - function m(Y) { - return u(Uint8Array, Y); - } - function y(Y) { - return u(Int8Array, Y); - } - function w(Y) { - return u(Int32Array, Y, 4); - } - function b(Y) { - return u(Float32Array, Y, 4); - } - function A(Y, q) { - var te = Y.length / 2; - q || (q = new Int16Array(te)); - for (var we = 0, me = 0; te > we; ++we, me += 2) q[we] = Y[me] << 8 ^ Y[me + 1] << 0; - return q; - } - function f(Y, q) { - var te = Y.length; - q || (q = new Uint8Array(2 * te)); - for (var we = p(q), me = 0; te > me; ++me) we.setInt16(2 * me, Y[me]); - return m(q); - } - function s(Y, q) { - var te = Y.length / 4; - q || (q = new Int32Array(te)); - for (var we = 0, me = 0; te > we; ++we, me += 4) q[we] = Y[me] << 24 ^ Y[me + 1] << 16 ^ Y[me + 2] << 8 ^ Y[me + 3] << 0; - return q; - } - function h(Y, q) { - var te = Y.length; - q || (q = new Uint8Array(4 * te)); - for (var we = p(q), me = 0; te > me; ++me) we.setInt32(4 * me, Y[me]); - return m(q); - } - function _(Y, q) { - var te = Y.length; - q || (q = new Float32Array(te / 4)); - for (var we = p(q), me = p(Y), Pe = 0, Fe = 0, K = te / 4; K > Pe; ++Pe, Fe += 4) we.setFloat32(Fe, me.getFloat32(Fe), !0); - return q; - } - function g(Y, q, te) { - var we = Y.length, me = 1 / q; - te || (te = new Float32Array(we)); - for (var Pe = 0; we > Pe; ++Pe) te[Pe] = Y[Pe] * me; - return te; - } - function x(Y, q, te) { - var we = Y.length; - te || (te = new Int32Array(we)); - for (var me = 0; we > me; ++me) te[me] = Math.round(Y[me] * q); - return te; - } - function c(Y, q) { - var te, we; - if (!q) { - var me = 0; - for (te = 0, we = Y.length; we > te; te += 2) me += Y[te + 1]; - q = new Y.constructor(me); - } - var Pe = 0; - for (te = 0, we = Y.length; we > te; te += 2) for (var Fe = Y[te], K = Y[te + 1], fe = 0; K > fe; ++fe) q[Pe] = Fe, ++Pe; - return q; - } - function v(Y) { - if (Y.length === 0) return new Int32Array(); - var q, te, we = 2; - for (q = 1, te = Y.length; te > q; ++q) Y[q - 1] !== Y[q] && (we += 2); - var me = new Int32Array(we), Pe = 0, Fe = 1; - for (q = 1, te = Y.length; te > q; ++q) Y[q - 1] !== Y[q] ? (me[Pe] = Y[q - 1], me[Pe + 1] = Fe, Fe = 1, Pe += 2) : ++Fe; - return me[Pe] = Y[Y.length - 1], me[Pe + 1] = Fe, me; - } - function M(Y, q) { - var te = Y.length; - q || (q = new Y.constructor(te)), te && (q[0] = Y[0]); - for (var we = 1; te > we; ++we) q[we] = Y[we] + q[we - 1]; - return q; - } - function E(Y, q) { - var te = Y.length; - q || (q = new Y.constructor(te)), q[0] = Y[0]; - for (var we = 1; te > we; ++we) q[we] = Y[we] - Y[we - 1]; - return q; - } - function $(Y, q) { - var te, we, me = Y instanceof Int8Array ? 127 : 32767, Pe = -me - 1, Fe = Y.length; - if (!q) { - var K = 0; - for (te = 0; Fe > te; ++te) Y[te] < me && Y[te] > Pe && ++K; - q = new Int32Array(K); - } - for (te = 0, we = 0; Fe > te; ) { - for (var fe = 0; Y[te] === me || Y[te] === Pe; ) fe += Y[te], ++te; - fe += Y[te], ++te, q[we] = fe, ++we; - } - return q; - } - function k(Y, q) { - var te, we = 32767, me = -we - 1, Pe = Y.length, Fe = 0; - for (te = 0; Pe > te; ++te) { - var K = Y[te]; - K === 0 ? ++Fe : K > 0 ? (Fe += Math.ceil(K / we), K % we === 0 && (Fe += 1)) : (Fe += Math.ceil(K / me), K % me === 0 && (Fe += 1)); - } - var fe = new Int16Array(Fe), Se = 0; - for (te = 0; Pe > te; ++te) { - var K = Y[te]; - if (K >= 0) for (; K >= we; ) fe[Se] = we, ++Se, K -= we; - else for (; me >= K; ) fe[Se] = me, ++Se, K -= me; - fe[Se] = K, ++Se; - } - return fe; - } - function L(Y, q) { - return M(c(Y), q); - } - function z(Y) { - return v(E(Y)); - } - function O(Y, q, te) { - return g(c(Y, w(te)), q, te); - } - function R(Y, q) { - return v(x(Y, q)); - } - function P(Y, q, te) { - return g(M(Y, w(te)), q, te); - } - function U(Y, q, te) { - return E(x(Y, q), te); - } - function B(Y, q, te) { - return g($(Y, w(te)), q, te); - } - function N(Y, q, te) { - var we = $(Y, w(te)); - return P(we, q, b(we)); - } - function G(Y, q, te) { - return k(U(Y, q)); - } - function H(Pe) { - var q = p(Pe), te = q.getInt32(0), we = q.getInt32(4), me = Pe.subarray(8, 12), Pe = Pe.subarray(12); - return [te, Pe, we, me]; - } - function W(Y, q, te, we) { - var me = new ArrayBuffer(12 + we.byteLength), Pe = new Uint8Array(me), Fe = new DataView(me); - return Fe.setInt32(0, Y), Fe.setInt32(4, q), te && Pe.set(te, 8), Pe.set(we, 12), Pe; - } - function V(Y) { - var q = Y.length, te = m(Y); - return W(2, q, void 0, te); - } - function re(Y) { - var q = Y.length, te = h(Y); - return W(4, q, void 0, te); - } - function ie(Y, q) { - var te = Y.length / q, we = h([q]), me = m(Y); - return W(5, te, we, me); - } - function ee(Y) { - var q = Y.length, te = h(v(Y)); - return W(6, q, void 0, te); - } - function ce(Y) { - var q = Y.length, te = h(z(Y)); - return W(8, q, void 0, te); - } - function he(Y, q) { - var te = Y.length, we = h([q]), me = h(R(Y, q)); - return W(9, te, we, me); - } - function le(Y, q) { - var te = Y.length, we = h([q]), me = f(G(Y, q)); - return W(10, te, we, me); - } - function J(Y) { - var q = {}; - return Ee.forEach(function(te) { - Y[te] !== void 0 && (q[te] = Y[te]); - }), Y.bondAtomList && (q.bondAtomList = re(Y.bondAtomList)), Y.bondOrderList && (q.bondOrderList = V(Y.bondOrderList)), q.xCoordList = le(Y.xCoordList, 1e3), q.yCoordList = le(Y.yCoordList, 1e3), q.zCoordList = le(Y.zCoordList, 1e3), Y.bFactorList && (q.bFactorList = le(Y.bFactorList, 100)), Y.atomIdList && (q.atomIdList = ce(Y.atomIdList)), Y.altLocList && (q.altLocList = ee(Y.altLocList)), Y.occupancyList && (q.occupancyList = he(Y.occupancyList, 100)), q.groupIdList = ce(Y.groupIdList), q.groupTypeList = re(Y.groupTypeList), Y.secStructList && (q.secStructList = V(Y.secStructList)), Y.insCodeList && (q.insCodeList = ee(Y.insCodeList)), Y.sequenceIndexList && (q.sequenceIndexList = ce(Y.sequenceIndexList)), q.chainIdList = ie(Y.chainIdList, 4), Y.chainNameList && (q.chainNameList = ie(Y.chainNameList, 4)), q; + if (16 > ee) return 1 + ye; + if (65536 > ee) return 3 + ye; + if (4294967296 > ee) return 5 + ye; + throw new Error("Array or object too long 0x" + ee.toString(16)); + } + throw new Error("Unknown type " + Z); + } + function c(V) { + var Z = new ArrayBuffer(h(V)), ee = new DataView(Z); + return l(V, ee, 0), new Uint8Array(Z); + } + function d(V, Z, ee) { + return Z ? new V(Z.buffer, Z.byteOffset, Z.byteLength / (ee || 1)) : void 0; + } + function _(V) { + return d(DataView, V); + } + function m(V) { + return d(Uint8Array, V); + } + function y(V) { + return d(Int8Array, V); + } + function x(V) { + return d(Int32Array, V, 4); + } + function b(V) { + return d(Float32Array, V, 4); + } + function A(V, Z) { + var ee = V.length / 2; + Z || (Z = new Int16Array(ee)); + for (var ye = 0, ce = 0; ee > ye; ++ye, ce += 2) Z[ye] = V[ce] << 8 ^ V[ce + 1] << 0; + return Z; + } + function f(V, Z) { + var ee = V.length; + Z || (Z = new Uint8Array(2 * ee)); + for (var ye = _(Z), ce = 0; ee > ce; ++ce) ye.setInt16(2 * ce, V[ce]); + return m(Z); + } + function s(V, Z) { + var ee = V.length / 4; + Z || (Z = new Int32Array(ee)); + for (var ye = 0, ce = 0; ee > ye; ++ye, ce += 4) Z[ye] = V[ce] << 24 ^ V[ce + 1] << 16 ^ V[ce + 2] << 8 ^ V[ce + 3] << 0; + return Z; + } + function u(V, Z) { + var ee = V.length; + Z || (Z = new Uint8Array(4 * ee)); + for (var ye = _(Z), ce = 0; ee > ce; ++ce) ye.setInt32(4 * ce, V[ce]); + return m(Z); + } + function p(V, Z) { + var ee = V.length; + Z || (Z = new Float32Array(ee / 4)); + for (var ye = _(Z), ce = _(V), Ie = 0, ke = 0, Y = ee / 4; Y > Ie; ++Ie, ke += 4) ye.setFloat32(ke, ce.getFloat32(ke), !0); + return Z; + } + function g(V, Z, ee) { + var ye = V.length, ce = 1 / Z; + ee || (ee = new Float32Array(ye)); + for (var Ie = 0; ye > Ie; ++Ie) ee[Ie] = V[Ie] * ce; + return ee; + } + function w(V, Z, ee) { + var ye = V.length; + ee || (ee = new Int32Array(ye)); + for (var ce = 0; ye > ce; ++ce) ee[ce] = Math.round(V[ce] * Z); + return ee; + } + function o(V, Z) { + var ee, ye; + if (!Z) { + var ce = 0; + for (ee = 0, ye = V.length; ye > ee; ee += 2) ce += V[ee + 1]; + Z = new V.constructor(ce); + } + var Ie = 0; + for (ee = 0, ye = V.length; ye > ee; ee += 2) for (var ke = V[ee], Y = V[ee + 1], me = 0; Y > me; ++me) Z[Ie] = ke, ++Ie; + return Z; + } + function v(V) { + if (V.length === 0) return new Int32Array(); + var Z, ee, ye = 2; + for (Z = 1, ee = V.length; ee > Z; ++Z) V[Z - 1] !== V[Z] && (ye += 2); + var ce = new Int32Array(ye), Ie = 0, ke = 1; + for (Z = 1, ee = V.length; ee > Z; ++Z) V[Z - 1] !== V[Z] ? (ce[Ie] = V[Z - 1], ce[Ie + 1] = ke, ke = 1, Ie += 2) : ++ke; + return ce[Ie] = V[V.length - 1], ce[Ie + 1] = ke, ce; + } + function M(V, Z) { + var ee = V.length; + Z || (Z = new V.constructor(ee)), ee && (Z[0] = V[0]); + for (var ye = 1; ee > ye; ++ye) Z[ye] = V[ye] + Z[ye - 1]; + return Z; + } + function E(V, Z) { + var ee = V.length; + Z || (Z = new V.constructor(ee)), Z[0] = V[0]; + for (var ye = 1; ee > ye; ++ye) Z[ye] = V[ye] - V[ye - 1]; + return Z; + } + function $(V, Z) { + var ee, ye, ce = V instanceof Int8Array ? 127 : 32767, Ie = -ce - 1, ke = V.length; + if (!Z) { + var Y = 0; + for (ee = 0; ke > ee; ++ee) V[ee] < ce && V[ee] > Ie && ++Y; + Z = new Int32Array(Y); + } + for (ee = 0, ye = 0; ke > ee; ) { + for (var me = 0; V[ee] === ce || V[ee] === Ie; ) me += V[ee], ++ee; + me += V[ee], ++ee, Z[ye] = me, ++ye; + } + return Z; + } + function k(V, Z) { + var ee, ye = 32767, ce = -ye - 1, Ie = V.length, ke = 0; + for (ee = 0; Ie > ee; ++ee) { + var Y = V[ee]; + Y === 0 ? ++ke : Y > 0 ? (ke += Math.ceil(Y / ye), Y % ye === 0 && (ke += 1)) : (ke += Math.ceil(Y / ce), Y % ce === 0 && (ke += 1)); + } + var me = new Int16Array(ke), we = 0; + for (ee = 0; Ie > ee; ++ee) { + var Y = V[ee]; + if (Y >= 0) for (; Y >= ye; ) me[we] = ye, ++we, Y -= ye; + else for (; ce >= Y; ) me[we] = ce, ++we, Y -= ce; + me[we] = Y, ++we; + } + return me; + } + function L(V, Z) { + return M(o(V), Z); + } + function z(V) { + return v(E(V)); + } + function O(V, Z, ee) { + return g(o(V, x(ee)), Z, ee); + } + function R(V, Z) { + return v(w(V, Z)); + } + function N(V, Z, ee) { + return g(M(V, x(ee)), Z, ee); + } + function W(V, Z, ee) { + return E(w(V, Z), ee); + } + function B(V, Z, ee) { + return g($(V, x(ee)), Z, ee); + } + function P(V, Z, ee) { + var ye = $(V, x(ee)); + return N(ye, Z, b(ye)); + } + function G(V, Z, ee) { + return k(W(V, Z)); + } + function H(Ie) { + var Z = _(Ie), ee = Z.getInt32(0), ye = Z.getInt32(4), ce = Ie.subarray(8, 12), Ie = Ie.subarray(12); + return [ee, Ie, ye, ce]; + } + function U(V, Z, ee, ye) { + var ce = new ArrayBuffer(12 + ye.byteLength), Ie = new Uint8Array(ce), ke = new DataView(ce); + return ke.setInt32(0, V), ke.setInt32(4, Z), ee && Ie.set(ee, 8), Ie.set(ye, 12), Ie; + } + function j(V) { + var Z = V.length, ee = m(V); + return U(2, Z, void 0, ee); + } + function re(V) { + var Z = V.length, ee = u(V); + return U(4, Z, void 0, ee); + } + function ie(V, Z) { + var ee = V.length / Z, ye = u([Z]), ce = m(V); + return U(5, ee, ye, ce); + } + function te(V) { + var Z = V.length, ee = u(v(V)); + return U(6, Z, void 0, ee); + } + function ue(V) { + var Z = V.length, ee = u(z(V)); + return U(8, Z, void 0, ee); + } + function de(V, Z) { + var ee = V.length, ye = u([Z]), ce = u(R(V, Z)); + return U(9, ee, ye, ce); + } + function oe(V, Z) { + var ee = V.length, ye = u([Z]), ce = f(G(V, Z)); + return U(10, ee, ye, ce); + } + function J(V) { + var Z = {}; + return We.forEach(function(ee) { + V[ee] !== void 0 && (Z[ee] = V[ee]); + }), V.bondAtomList && (Z.bondAtomList = re(V.bondAtomList)), V.bondOrderList && (Z.bondOrderList = j(V.bondOrderList)), Z.xCoordList = oe(V.xCoordList, 1e3), Z.yCoordList = oe(V.yCoordList, 1e3), Z.zCoordList = oe(V.zCoordList, 1e3), V.bFactorList && (Z.bFactorList = oe(V.bFactorList, 100)), V.atomIdList && (Z.atomIdList = ue(V.atomIdList)), V.altLocList && (Z.altLocList = te(V.altLocList)), V.occupancyList && (Z.occupancyList = de(V.occupancyList, 100)), Z.groupIdList = ue(V.groupIdList), Z.groupTypeList = re(V.groupTypeList), V.secStructList && (Z.secStructList = j(V.secStructList)), V.insCodeList && (Z.insCodeList = te(V.insCodeList)), V.sequenceIndexList && (Z.sequenceIndexList = ue(V.sequenceIndexList)), Z.chainIdList = ie(V.chainIdList, 4), V.chainNameList && (Z.chainNameList = ie(V.chainNameList, 4)), Z; } - function Me(Y) { - function q(fe) { - for (var Se = {}, Ne = 0; fe > Ne; Ne++) { - var pe = Pe(); - Se[pe] = Pe(); + function Ee(V) { + function Z(me) { + for (var we = {}, Re = 0; me > Re; Re++) { + var pe = Ie(); + we[pe] = Ie(); } - return Se; - } - function te(fe) { - var Se = Y.subarray(Fe, Fe + fe); - return Fe += fe, Se; - } - function we(fe) { - var Se = Y.subarray(Fe, Fe + fe); - Fe += fe; - var Ne = 65535; - if (fe > Ne) { - for (var pe = [], ke = 0; ke < Se.length; ke += Ne) pe.push(String.fromCharCode.apply(null, Se.subarray(ke, ke + Ne))); + return we; + } + function ee(me) { + var we = V.subarray(ke, ke + me); + return ke += me, we; + } + function ye(me) { + var we = V.subarray(ke, ke + me); + ke += me; + var Re = 65535; + if (me > Re) { + for (var pe = [], $e = 0; $e < we.length; $e += Re) pe.push(String.fromCharCode.apply(null, we.subarray($e, $e + Re))); return pe.join(""); } - return String.fromCharCode.apply(null, Se); - } - function me(fe) { - for (var Se = new Array(fe), Ne = 0; fe > Ne; Ne++) Se[Ne] = Pe(); - return Se; - } - function Pe() { - var fe, Se, Ne = Y[Fe]; - if (!(128 & Ne)) return Fe++, Ne; - if ((240 & Ne) === 128) return Se = 15 & Ne, Fe++, q(Se); - if ((240 & Ne) === 144) return Se = 15 & Ne, Fe++, me(Se); - if ((224 & Ne) === 160) return Se = 31 & Ne, Fe++, we(Se); - if ((224 & Ne) === 224) return fe = K.getInt8(Fe), Fe++, fe; - switch (Ne) { + return String.fromCharCode.apply(null, we); + } + function ce(me) { + for (var we = new Array(me), Re = 0; me > Re; Re++) we[Re] = Ie(); + return we; + } + function Ie() { + var me, we, Re = V[ke]; + if (!(128 & Re)) return ke++, Re; + if ((240 & Re) === 128) return we = 15 & Re, ke++, Z(we); + if ((240 & Re) === 144) return we = 15 & Re, ke++, ce(we); + if ((224 & Re) === 160) return we = 31 & Re, ke++, ye(we); + if ((224 & Re) === 224) return me = Y.getInt8(ke), ke++, me; + switch (Re) { case 192: - return Fe++, null; + return ke++, null; case 194: - return Fe++, !1; + return ke++, !1; case 195: - return Fe++, !0; + return ke++, !0; case 196: - return Se = K.getUint8(Fe + 1), Fe += 2, te(Se); + return we = Y.getUint8(ke + 1), ke += 2, ee(we); case 197: - return Se = K.getUint16(Fe + 1), Fe += 3, te(Se); + return we = Y.getUint16(ke + 1), ke += 3, ee(we); case 198: - return Se = K.getUint32(Fe + 1), Fe += 5, te(Se); + return we = Y.getUint32(ke + 1), ke += 5, ee(we); case 202: - return fe = K.getFloat32(Fe + 1), Fe += 5, fe; + return me = Y.getFloat32(ke + 1), ke += 5, me; case 203: - return fe = K.getFloat64(Fe + 1), Fe += 9, fe; + return me = Y.getFloat64(ke + 1), ke += 9, me; case 204: - return fe = Y[Fe + 1], Fe += 2, fe; + return me = V[ke + 1], ke += 2, me; case 205: - return fe = K.getUint16(Fe + 1), Fe += 3, fe; + return me = Y.getUint16(ke + 1), ke += 3, me; case 206: - return fe = K.getUint32(Fe + 1), Fe += 5, fe; + return me = Y.getUint32(ke + 1), ke += 5, me; case 208: - return fe = K.getInt8(Fe + 1), Fe += 2, fe; + return me = Y.getInt8(ke + 1), ke += 2, me; case 209: - return fe = K.getInt16(Fe + 1), Fe += 3, fe; + return me = Y.getInt16(ke + 1), ke += 3, me; case 210: - return fe = K.getInt32(Fe + 1), Fe += 5, fe; + return me = Y.getInt32(ke + 1), ke += 5, me; case 217: - return Se = K.getUint8(Fe + 1), Fe += 2, we(Se); + return we = Y.getUint8(ke + 1), ke += 2, ye(we); case 218: - return Se = K.getUint16(Fe + 1), Fe += 3, we(Se); + return we = Y.getUint16(ke + 1), ke += 3, ye(we); case 219: - return Se = K.getUint32(Fe + 1), Fe += 5, we(Se); + return we = Y.getUint32(ke + 1), ke += 5, ye(we); case 220: - return Se = K.getUint16(Fe + 1), Fe += 3, me(Se); + return we = Y.getUint16(ke + 1), ke += 3, ce(we); case 221: - return Se = K.getUint32(Fe + 1), Fe += 5, me(Se); + return we = Y.getUint32(ke + 1), ke += 5, ce(we); case 222: - return Se = K.getUint16(Fe + 1), Fe += 3, q(Se); + return we = Y.getUint16(ke + 1), ke += 3, Z(we); case 223: - return Se = K.getUint32(Fe + 1), Fe += 5, q(Se); + return we = Y.getUint32(ke + 1), ke += 5, Z(we); } - throw new Error("Unknown type 0x" + Ne.toString(16)); + throw new Error("Unknown type 0x" + Re.toString(16)); } - var Fe = 0, K = new DataView(Y.buffer); - return Pe(); + var ke = 0, Y = new DataView(V.buffer); + return Ie(); } - function se(Y, q, te, we) { - switch (Y) { + function se(V, Z, ee, ye) { + switch (V) { case 1: - return _(q); + return p(Z); case 2: - return y(q); + return y(Z); case 3: - return A(q); + return A(Z); case 4: - return s(q); + return s(Z); case 5: - return m(q); + return m(Z); case 6: - return c(s(q), new Uint8Array(te)); + return o(s(Z), new Uint8Array(ee)); case 7: - return c(s(q)); + return o(s(Z)); case 8: - return L(s(q)); + return L(s(Z)); case 9: - return O(s(q), s(we)[0]); + return O(s(Z), s(ye)[0]); case 10: - return N(A(q), s(we)[0]); + return P(A(Z), s(ye)[0]); case 11: - return g(A(q), s(we)[0]); + return g(A(Z), s(ye)[0]); case 12: - return B(A(q), s(we)[0]); + return B(A(Z), s(ye)[0]); case 13: - return B(y(q), s(we)[0]); + return B(y(Z), s(ye)[0]); case 14: - return $(A(q)); + return $(A(Z)); case 15: - return $(y(q)); - } - } - function Ce(Y, q) { - q = q || {}; - var te = q.ignoreFields, we = {}; - return ge.forEach(function(me) { - var Pe = te ? te.indexOf(me) !== -1 : !1, Fe = Y[me]; - Pe || Fe === void 0 || (Fe instanceof Uint8Array ? we[me] = se.apply(null, H(Fe)) : we[me] = Fe); - }), we; - } - function ue(Y) { - return String.fromCharCode.apply(null, Y).replace(/\0/g, ""); - } - function ne(Y, q, te) { - te = te || {}; - var we, me, Pe, Fe, K, fe, Se = te.firstModelOnly, Ne = q.onModel, pe = q.onChain, ke = q.onGroup, X = q.onAtom, Be = q.onBond, Ge = 0, I = 0, ye = 0, ve = 0, Z = 0, de = -1, $e = Y.chainNameList, Ye = Y.secStructList, qe = Y.insCodeList, Xe = Y.sequenceIndexList, at = Y.atomIdList, dt = Y.bFactorList, lt = Y.altLocList, ot = Y.occupancyList, st = Y.bondAtomList, bt = Y.bondOrderList; - for (we = 0, me = Y.chainsPerModel.length; me > we && !(Se && Ge > 0); ++we) { - var _t = Y.chainsPerModel[Ge]; - for (Ne && Ne({ chainCount: _t, modelIndex: Ge }), Pe = 0; _t > Pe; ++Pe) { - var Lt = Y.groupsPerChain[I]; + return $(y(Z)); + } + } + function Ae(V, Z) { + Z = Z || {}; + var ee = Z.ignoreFields, ye = {}; + return Ne.forEach(function(ce) { + var Ie = ee ? ee.indexOf(ce) !== -1 : !1, ke = V[ce]; + Ie || ke === void 0 || (ke instanceof Uint8Array ? ye[ce] = se.apply(null, H(ke)) : ye[ce] = ke); + }), ye; + } + function he(V) { + return String.fromCharCode.apply(null, V).replace(/\0/g, ""); + } + function ne(V, Z, ee) { + ee = ee || {}; + var ye, ce, Ie, ke, Y, me, we = ee.firstModelOnly, Re = Z.onModel, pe = Z.onChain, $e = Z.onGroup, X = Z.onAtom, ze = Z.onBond, Ve = 0, I = 0, xe = 0, be = 0, q = 0, fe = -1, Ce = V.chainNameList, Ze = V.secStructList, Xe = V.insCodeList, Ye = V.sequenceIndexList, lt = V.atomIdList, dt = V.bFactorList, it = V.altLocList, ot = V.occupancyList, nt = V.bondAtomList, Ct = V.bondOrderList; + for (ye = 0, ce = V.chainsPerModel.length; ce > ye && !(we && Ve > 0); ++ye) { + var ut = V.chainsPerModel[Ve]; + for (Re && Re({ chainCount: ut, modelIndex: Ve }), Ie = 0; ut > Ie; ++Ie) { + var zt = V.groupsPerChain[I]; if (pe) { - var Gt = ue(Y.chainIdList.subarray(4 * I, 4 * I + 4)), ft = null; - $e && (ft = ue($e.subarray(4 * I, 4 * I + 4))), pe({ groupCount: Lt, chainIndex: I, modelIndex: Ge, chainId: Gt, chainName: ft }); + var Ut = he(V.chainIdList.subarray(4 * I, 4 * I + 4)), wt = null; + Ce && (wt = he(Ce.subarray(4 * I, 4 * I + 4))), pe({ groupCount: zt, chainIndex: I, modelIndex: Ve, chainId: Ut, chainName: wt }); } - for (Fe = 0; Lt > Fe; ++Fe) { - var Et = Y.groupList[Y.groupTypeList[ye]], gt = Et.atomNameList.length; - if (ke) { + for (ke = 0; zt > ke; ++ke) { + var mt = V.groupList[V.groupTypeList[xe]], vt = mt.atomNameList.length; + if ($e) { var Rt = null; - Ye && (Rt = Ye[ye]); - var Qe = null; - Y.insCodeList && (Qe = String.fromCharCode(qe[ye])); - var xe = null; - Xe && (xe = Xe[ye]), ke({ atomCount: gt, groupIndex: ye, chainIndex: I, modelIndex: Ge, groupId: Y.groupIdList[ye], groupType: Y.groupTypeList[ye], groupName: Et.groupName, singleLetterCode: Et.singleLetterCode, chemCompType: Et.chemCompType, secStruct: Rt, insCode: Qe, sequenceIndex: xe }); + Ze && (Rt = Ze[xe]); + var qe = null; + V.insCodeList && (qe = String.fromCharCode(Xe[xe])); + var ge = null; + Ye && (ge = Ye[xe]), $e({ atomCount: vt, groupIndex: xe, chainIndex: I, modelIndex: Ve, groupId: V.groupIdList[xe], groupType: V.groupTypeList[xe], groupName: mt.groupName, singleLetterCode: mt.singleLetterCode, chemCompType: mt.chemCompType, secStruct: Rt, insCode: qe, sequenceIndex: ge }); } - for (K = 0; gt > K; ++K) { + for (Y = 0; vt > Y; ++Y) { if (X) { - var He = null; - at && (He = at[ve]); - var Ze = null; - dt && (Ze = dt[ve]); - var yt = null; - lt && (yt = String.fromCharCode(lt[ve])); - var zt = null; - ot && (zt = ot[ve]), X({ atomIndex: ve, groupIndex: ye, chainIndex: I, modelIndex: Ge, atomId: He, element: Et.elementList[K], atomName: Et.atomNameList[K], formalCharge: Et.formalChargeList[K], xCoord: Y.xCoordList[ve], yCoord: Y.yCoordList[ve], zCoord: Y.zCoordList[ve], bFactor: Ze, altLoc: yt, occupancy: zt }); + var Ke = null; + lt && (Ke = lt[be]); + var Qe = null; + dt && (Qe = dt[be]); + var _t = null; + it && (_t = String.fromCharCode(it[be])); + var Mt = null; + ot && (Mt = ot[be]), X({ atomIndex: be, groupIndex: xe, chainIndex: I, modelIndex: Ve, atomId: Ke, element: mt.elementList[Y], atomName: mt.atomNameList[Y], formalCharge: mt.formalChargeList[Y], xCoord: V.xCoordList[be], yCoord: V.yCoordList[be], zCoord: V.zCoordList[be], bFactor: Qe, altLoc: _t, occupancy: Mt }); } - ve += 1; + be += 1; } - if (Be) { - var Ft = Et.bondAtomList; - for (K = 0, fe = Et.bondOrderList.length; fe > K; ++K) Be({ atomIndex1: ve - gt + Ft[2 * K], atomIndex2: ve - gt + Ft[2 * K + 1], bondOrder: Et.bondOrderList[K] }); + if (ze) { + var St = mt.bondAtomList; + for (Y = 0, me = mt.bondOrderList.length; me > Y; ++Y) ze({ atomIndex1: be - vt + St[2 * Y], atomIndex2: be - vt + St[2 * Y + 1], bondOrder: mt.bondOrderList[Y] }); } - ye += 1; + xe += 1; } I += 1; } - if (Z = de + 1, de = ve - 1, Be && st) for (K = 0, fe = st.length; fe > K; K += 2) { - var Bt = st[K], Nt = st[K + 1]; - (Bt >= Z && de >= Bt || Nt >= Z && de >= Nt) && Be({ atomIndex1: Bt, atomIndex2: Nt, bondOrder: bt ? bt[K / 2] : null }); + if (q = fe + 1, fe = be - 1, ze && nt) for (Y = 0, me = nt.length; me > Y; Y += 2) { + var It = nt[Y], Pt = nt[Y + 1]; + (It >= q && fe >= It || Pt >= q && fe >= Pt) && ze({ atomIndex1: It, atomIndex2: Pt, bondOrder: Ct ? Ct[Y / 2] : null }); } - Ge += 1; + Ve += 1; } } - function _e(Y) { - return o(J(Y)); + function _e(V) { + return c(J(V)); } - function Oe(Y, q) { - Y instanceof ArrayBuffer && (Y = new Uint8Array(Y)); - var te; - return te = Y instanceof Uint8Array ? Me(Y) : Y, Ce(te, q); + function Le(V, Z) { + V instanceof ArrayBuffer && (V = new Uint8Array(V)); + var ee; + return ee = V instanceof Uint8Array ? Ee(V) : V, Ae(ee, Z); } - function Re(Y, q, te, we) { - function me() { + function Be(V, Z, ee, ye) { + function ce() { try { - var Fe = Oe(Pe.response); - te(Fe); - } catch (K) { - we(K); + var ke = Le(Ie.response); + ee(ke); + } catch (Y) { + ye(Y); } } - var Pe = new XMLHttpRequest(); - Pe.addEventListener("load", me, !0), Pe.addEventListener("error", we, !0), Pe.responseType = "arraybuffer", Pe.open("GET", q + Y.toUpperCase()), Pe.send(); + var Ie = new XMLHttpRequest(); + Ie.addEventListener("load", ce, !0), Ie.addEventListener("error", ye, !0), Ie.responseType = "arraybuffer", Ie.open("GET", Z + V.toUpperCase()), Ie.send(); } - function Ue(Y, q, te) { - Re(Y, Ke, q, te); + function Ue(V, Z, ee) { + Be(V, Me, Z, ee); } - function We(Y, q, te) { - Re(Y, je, q, te); + function He(V, Z, ee) { + Be(V, De, Z, ee); } - var Ee = ["mmtfVersion", "mmtfProducer", "unitCell", "spaceGroup", "structureId", "title", "depositionDate", "releaseDate", "experimentalMethods", "resolution", "rFree", "rWork", "bioAssemblyList", "ncsOperatorList", "entityList", "groupList", "numBonds", "numAtoms", "numGroups", "numChains", "numModels", "groupsPerChain", "chainsPerModel"], Ae = ["xCoordList", "yCoordList", "zCoordList", "groupIdList", "groupTypeList", "chainIdList", "bFactorList", "atomIdList", "altLocList", "occupancyList", "secStructList", "insCodeList", "sequenceIndexList", "chainNameList", "bondAtomList", "bondOrderList"], ge = Ee.concat(Ae), Le = "v1.0.1", Te = "//mmtf.rcsb.org/v1.0/", Ke = Te + "full/", je = Te + "reduced/"; - t.encode = _e, t.decode = Oe, t.traverse = ne, t.fetch = Ue, t.fetchReduced = We, t.version = Le, t.fetchUrl = Ke, t.fetchReducedUrl = je, t.encodeMsgpack = o, t.encodeMmtf = J, t.decodeMsgpack = Me, t.decodeMmtf = Ce; + var We = ["mmtfVersion", "mmtfProducer", "unitCell", "spaceGroup", "structureId", "title", "depositionDate", "releaseDate", "experimentalMethods", "resolution", "rFree", "rWork", "bioAssemblyList", "ncsOperatorList", "entityList", "groupList", "numBonds", "numAtoms", "numGroups", "numChains", "numModels", "groupsPerChain", "chainsPerModel"], Ge = ["xCoordList", "yCoordList", "zCoordList", "groupIdList", "groupTypeList", "chainIdList", "bFactorList", "atomIdList", "altLocList", "occupancyList", "secStructList", "insCodeList", "sequenceIndexList", "chainNameList", "bondAtomList", "bondOrderList"], Ne = We.concat(Ge), Pe = "v1.0.1", Te = "//mmtf.rcsb.org/v1.0/", Me = Te + "full/", De = Te + "reduced/"; + t.encode = _e, t.decode = Le, t.traverse = ne, t.fetch = Ue, t.fetchReduced = He, t.version = Pe, t.fetchUrl = Me, t.fetchReducedUrl = De, t.encodeMsgpack = c, t.encodeMmtf = J, t.decodeMsgpack = Ee, t.decodeMmtf = Ae; }); } ), @@ -39414,17 +39414,17 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `; /* harmony export */ Deflate: () => ( /* binding */ - on + xn ), /* harmony export */ Inflate: () => ( /* binding */ - dn + An ), /* harmony export */ constants: () => ( /* binding */ - _n + $n ), /* harmony export */ default: () => ( @@ -39434,43 +39434,43 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `; /* harmony export */ deflate: () => ( /* binding */ - cn + wn ), /* harmony export */ deflateRaw: () => ( /* binding */ - un + En ), /* harmony export */ gzip: () => ( /* binding */ - hn + Sn ), /* harmony export */ inflate: () => ( /* binding */ - fn + Mn ), /* harmony export */ inflateRaw: () => ( /* binding */ - mn + Dn ), /* harmony export */ ungzip: () => ( /* binding */ - pn + Cn ) /* harmony export */ }); /*! pako 2.1.0 https://github.com/nodeca/pako @license (MIT AND Zlib) */ - const r = 4, a = 0, l = 1, d = 2; - function o(C) { - let j = C.length; - for (; --j >= 0; ) - C[j] = 0; + const r = 4, a = 0, l = 1, h = 2; + function c(C) { + let K = C.length; + for (; --K >= 0; ) + C[K] = 0; } - const u = 0, p = 1, m = 2, y = 3, w = 258, b = 29, A = 256, f = A + 1 + b, s = 30, h = 19, _ = 2 * f + 1, g = 15, x = 16, c = 7, v = 256, M = 16, E = 17, $ = 18, k = ( + const d = 0, _ = 1, m = 2, y = 3, x = 258, b = 29, A = 256, f = A + 1 + b, s = 30, u = 19, p = 2 * f + 1, g = 15, w = 16, o = 7, v = 256, M = 16, E = 17, $ = 18, k = ( /* extra bits for each length code */ new Uint8Array([0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 2, 2, 2, 2, 3, 3, 3, 3, 4, 4, 4, 4, 5, 5, 5, 5, 0]) ), L = ( @@ -39479,134 +39479,134 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `; ), z = ( /* extra bits for each bit length code */ new Uint8Array([0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 2, 3, 7]) - ), O = new Uint8Array([16, 17, 18, 0, 8, 7, 9, 6, 10, 5, 11, 4, 12, 3, 13, 2, 14, 1, 15]), R = 512, P = new Array((f + 2) * 2); - o(P); - const U = new Array(s * 2); - o(U); + ), O = new Uint8Array([16, 17, 18, 0, 8, 7, 9, 6, 10, 5, 11, 4, 12, 3, 13, 2, 14, 1, 15]), R = 512, N = new Array((f + 2) * 2); + c(N); + const W = new Array(s * 2); + c(W); const B = new Array(R); - o(B); - const N = new Array(w - y + 1); - o(N); + c(B); + const P = new Array(x - y + 1); + c(P); const G = new Array(b); - o(G); + c(G); const H = new Array(s); - o(H); - function W(C, j, F, Q, oe) { - this.static_tree = C, this.extra_bits = j, this.extra_base = F, this.elems = Q, this.max_length = oe, this.has_stree = C && C.length; - } - let V, re, ie; - function ee(C, j) { - this.dyn_tree = C, this.max_code = 0, this.stat_desc = j; - } - const ce = (C) => C < 256 ? B[C] : B[256 + (C >>> 7)], he = (C, j) => { - C.pending_buf[C.pending++] = j & 255, C.pending_buf[C.pending++] = j >>> 8 & 255; - }, le = (C, j, F) => { - C.bi_valid > x - F ? (C.bi_buf |= j << C.bi_valid & 65535, he(C, C.bi_buf), C.bi_buf = j >> x - C.bi_valid, C.bi_valid += F - x) : (C.bi_buf |= j << C.bi_valid & 65535, C.bi_valid += F); - }, J = (C, j, F) => { - le( + c(H); + function U(C, K, F, Q, le) { + this.static_tree = C, this.extra_bits = K, this.extra_base = F, this.elems = Q, this.max_length = le, this.has_stree = C && C.length; + } + let j, re, ie; + function te(C, K) { + this.dyn_tree = C, this.max_code = 0, this.stat_desc = K; + } + const ue = (C) => C < 256 ? B[C] : B[256 + (C >>> 7)], de = (C, K) => { + C.pending_buf[C.pending++] = K & 255, C.pending_buf[C.pending++] = K >>> 8 & 255; + }, oe = (C, K, F) => { + C.bi_valid > w - F ? (C.bi_buf |= K << C.bi_valid & 65535, de(C, C.bi_buf), C.bi_buf = K >> w - C.bi_valid, C.bi_valid += F - w) : (C.bi_buf |= K << C.bi_valid & 65535, C.bi_valid += F); + }, J = (C, K, F) => { + oe( C, - F[j * 2], - F[j * 2 + 1] + F[K * 2], + F[K * 2 + 1] /*.Len*/ ); - }, Me = (C, j) => { + }, Ee = (C, K) => { let F = 0; do F |= C & 1, C >>>= 1, F <<= 1; - while (--j > 0); + while (--K > 0); return F >>> 1; }, se = (C) => { - C.bi_valid === 16 ? (he(C, C.bi_buf), C.bi_buf = 0, C.bi_valid = 0) : C.bi_valid >= 8 && (C.pending_buf[C.pending++] = C.bi_buf & 255, C.bi_buf >>= 8, C.bi_valid -= 8); - }, Ce = (C, j) => { - const F = j.dyn_tree, Q = j.max_code, oe = j.stat_desc.static_tree, ae = j.stat_desc.has_stree, ze = j.stat_desc.extra_bits, De = j.stat_desc.extra_base, tt = j.stat_desc.max_length; - let be, Ie, St, et, Ve, it, It = 0; + C.bi_valid === 16 ? (de(C, C.bi_buf), C.bi_buf = 0, C.bi_valid = 0) : C.bi_valid >= 8 && (C.pending_buf[C.pending++] = C.bi_buf & 255, C.bi_buf >>= 8, C.bi_valid -= 8); + }, Ae = (C, K) => { + const F = K.dyn_tree, Q = K.max_code, le = K.stat_desc.static_tree, ae = K.stat_desc.has_stree, Fe = K.stat_desc.extra_bits, Se = K.stat_desc.extra_base, tt = K.stat_desc.max_length; + let ve, Oe, Et, et, je, at, Bt = 0; for (et = 0; et <= g; et++) C.bl_count[et] = 0; - for (F[C.heap[C.heap_max] * 2 + 1] = 0, be = C.heap_max + 1; be < _; be++) - Ie = C.heap[be], et = F[F[Ie * 2 + 1] * 2 + 1] + 1, et > tt && (et = tt, It++), F[Ie * 2 + 1] = et, !(Ie > Q) && (C.bl_count[et]++, Ve = 0, Ie >= De && (Ve = ze[Ie - De]), it = F[Ie * 2], C.opt_len += it * (et + Ve), ae && (C.static_len += it * (oe[Ie * 2 + 1] + Ve))); - if (It !== 0) { + for (F[C.heap[C.heap_max] * 2 + 1] = 0, ve = C.heap_max + 1; ve < p; ve++) + Oe = C.heap[ve], et = F[F[Oe * 2 + 1] * 2 + 1] + 1, et > tt && (et = tt, Bt++), F[Oe * 2 + 1] = et, !(Oe > Q) && (C.bl_count[et]++, je = 0, Oe >= Se && (je = Fe[Oe - Se]), at = F[Oe * 2], C.opt_len += at * (et + je), ae && (C.static_len += at * (le[Oe * 2 + 1] + je))); + if (Bt !== 0) { do { for (et = tt - 1; C.bl_count[et] === 0; ) et--; - C.bl_count[et]--, C.bl_count[et + 1] += 2, C.bl_count[tt]--, It -= 2; - } while (It > 0); + C.bl_count[et]--, C.bl_count[et + 1] += 2, C.bl_count[tt]--, Bt -= 2; + } while (Bt > 0); for (et = tt; et !== 0; et--) - for (Ie = C.bl_count[et]; Ie !== 0; ) - St = C.heap[--be], !(St > Q) && (F[St * 2 + 1] !== et && (C.opt_len += (et - F[St * 2 + 1]) * F[St * 2], F[St * 2 + 1] = et), Ie--); + for (Oe = C.bl_count[et]; Oe !== 0; ) + Et = C.heap[--ve], !(Et > Q) && (F[Et * 2 + 1] !== et && (C.opt_len += (et - F[Et * 2 + 1]) * F[Et * 2], F[Et * 2 + 1] = et), Oe--); } - }, ue = (C, j, F) => { + }, he = (C, K, F) => { const Q = new Array(g + 1); - let oe = 0, ae, ze; + let le = 0, ae, Fe; for (ae = 1; ae <= g; ae++) - oe = oe + F[ae - 1] << 1, Q[ae] = oe; - for (ze = 0; ze <= j; ze++) { - let De = C[ze * 2 + 1]; - De !== 0 && (C[ze * 2] = Me(Q[De]++, De)); + le = le + F[ae - 1] << 1, Q[ae] = le; + for (Fe = 0; Fe <= K; Fe++) { + let Se = C[Fe * 2 + 1]; + Se !== 0 && (C[Fe * 2] = Ee(Q[Se]++, Se)); } }, ne = () => { - let C, j, F, Q, oe; + let C, K, F, Q, le; const ae = new Array(g + 1); for (F = 0, Q = 0; Q < b - 1; Q++) for (G[Q] = F, C = 0; C < 1 << k[Q]; C++) - N[F++] = Q; - for (N[F - 1] = Q, oe = 0, Q = 0; Q < 16; Q++) - for (H[Q] = oe, C = 0; C < 1 << L[Q]; C++) - B[oe++] = Q; - for (oe >>= 7; Q < s; Q++) - for (H[Q] = oe << 7, C = 0; C < 1 << L[Q] - 7; C++) - B[256 + oe++] = Q; - for (j = 0; j <= g; j++) - ae[j] = 0; + P[F++] = Q; + for (P[F - 1] = Q, le = 0, Q = 0; Q < 16; Q++) + for (H[Q] = le, C = 0; C < 1 << L[Q]; C++) + B[le++] = Q; + for (le >>= 7; Q < s; Q++) + for (H[Q] = le << 7, C = 0; C < 1 << L[Q] - 7; C++) + B[256 + le++] = Q; + for (K = 0; K <= g; K++) + ae[K] = 0; for (C = 0; C <= 143; ) - P[C * 2 + 1] = 8, C++, ae[8]++; + N[C * 2 + 1] = 8, C++, ae[8]++; for (; C <= 255; ) - P[C * 2 + 1] = 9, C++, ae[9]++; + N[C * 2 + 1] = 9, C++, ae[9]++; for (; C <= 279; ) - P[C * 2 + 1] = 7, C++, ae[7]++; + N[C * 2 + 1] = 7, C++, ae[7]++; for (; C <= 287; ) - P[C * 2 + 1] = 8, C++, ae[8]++; - for (ue(P, f + 1, ae), C = 0; C < s; C++) - U[C * 2 + 1] = 5, U[C * 2] = Me(C, 5); - V = new W(P, k, A + 1, f, g), re = new W(U, L, 0, s, g), ie = new W(new Array(0), z, 0, h, c); + N[C * 2 + 1] = 8, C++, ae[8]++; + for (he(N, f + 1, ae), C = 0; C < s; C++) + W[C * 2 + 1] = 5, W[C * 2] = Ee(C, 5); + j = new U(N, k, A + 1, f, g), re = new U(W, L, 0, s, g), ie = new U(new Array(0), z, 0, u, o); }, _e = (C) => { - let j; - for (j = 0; j < f; j++) - C.dyn_ltree[j * 2] = 0; - for (j = 0; j < s; j++) - C.dyn_dtree[j * 2] = 0; - for (j = 0; j < h; j++) - C.bl_tree[j * 2] = 0; + let K; + for (K = 0; K < f; K++) + C.dyn_ltree[K * 2] = 0; + for (K = 0; K < s; K++) + C.dyn_dtree[K * 2] = 0; + for (K = 0; K < u; K++) + C.bl_tree[K * 2] = 0; C.dyn_ltree[v * 2] = 1, C.opt_len = C.static_len = 0, C.sym_next = C.matches = 0; - }, Oe = (C) => { - C.bi_valid > 8 ? he(C, C.bi_buf) : C.bi_valid > 0 && (C.pending_buf[C.pending++] = C.bi_buf), C.bi_buf = 0, C.bi_valid = 0; - }, Re = (C, j, F, Q) => { - const oe = j * 2, ae = F * 2; - return C[oe] < C[ae] || C[oe] === C[ae] && Q[j] <= Q[F]; - }, Ue = (C, j, F) => { + }, Le = (C) => { + C.bi_valid > 8 ? de(C, C.bi_buf) : C.bi_valid > 0 && (C.pending_buf[C.pending++] = C.bi_buf), C.bi_buf = 0, C.bi_valid = 0; + }, Be = (C, K, F, Q) => { + const le = K * 2, ae = F * 2; + return C[le] < C[ae] || C[le] === C[ae] && Q[K] <= Q[F]; + }, Ue = (C, K, F) => { const Q = C.heap[F]; - let oe = F << 1; - for (; oe <= C.heap_len && (oe < C.heap_len && Re(j, C.heap[oe + 1], C.heap[oe], C.depth) && oe++, !Re(j, Q, C.heap[oe], C.depth)); ) - C.heap[F] = C.heap[oe], F = oe, oe <<= 1; + let le = F << 1; + for (; le <= C.heap_len && (le < C.heap_len && Be(K, C.heap[le + 1], C.heap[le], C.depth) && le++, !Be(K, Q, C.heap[le], C.depth)); ) + C.heap[F] = C.heap[le], F = le, le <<= 1; C.heap[F] = Q; - }, We = (C, j, F) => { - let Q, oe, ae = 0, ze, De; + }, He = (C, K, F) => { + let Q, le, ae = 0, Fe, Se; if (C.sym_next !== 0) do - Q = C.pending_buf[C.sym_buf + ae++] & 255, Q += (C.pending_buf[C.sym_buf + ae++] & 255) << 8, oe = C.pending_buf[C.sym_buf + ae++], Q === 0 ? J(C, oe, j) : (ze = N[oe], J(C, ze + A + 1, j), De = k[ze], De !== 0 && (oe -= G[ze], le(C, oe, De)), Q--, ze = ce(Q), J(C, ze, F), De = L[ze], De !== 0 && (Q -= H[ze], le(C, Q, De))); + Q = C.pending_buf[C.sym_buf + ae++] & 255, Q += (C.pending_buf[C.sym_buf + ae++] & 255) << 8, le = C.pending_buf[C.sym_buf + ae++], Q === 0 ? J(C, le, K) : (Fe = P[le], J(C, Fe + A + 1, K), Se = k[Fe], Se !== 0 && (le -= G[Fe], oe(C, le, Se)), Q--, Fe = ue(Q), J(C, Fe, F), Se = L[Fe], Se !== 0 && (Q -= H[Fe], oe(C, Q, Se))); while (ae < C.sym_next); - J(C, v, j); - }, Ee = (C, j) => { - const F = j.dyn_tree, Q = j.stat_desc.static_tree, oe = j.stat_desc.has_stree, ae = j.stat_desc.elems; - let ze, De, tt = -1, be; - for (C.heap_len = 0, C.heap_max = _, ze = 0; ze < ae; ze++) - F[ze * 2] !== 0 ? (C.heap[++C.heap_len] = tt = ze, C.depth[ze] = 0) : F[ze * 2 + 1] = 0; + J(C, v, K); + }, We = (C, K) => { + const F = K.dyn_tree, Q = K.stat_desc.static_tree, le = K.stat_desc.has_stree, ae = K.stat_desc.elems; + let Fe, Se, tt = -1, ve; + for (C.heap_len = 0, C.heap_max = p, Fe = 0; Fe < ae; Fe++) + F[Fe * 2] !== 0 ? (C.heap[++C.heap_len] = tt = Fe, C.depth[Fe] = 0) : F[Fe * 2 + 1] = 0; for (; C.heap_len < 2; ) - be = C.heap[++C.heap_len] = tt < 2 ? ++tt : 0, F[be * 2] = 1, C.depth[be] = 0, C.opt_len--, oe && (C.static_len -= Q[be * 2 + 1]); - for (j.max_code = tt, ze = C.heap_len >> 1; ze >= 1; ze--) - Ue(C, F, ze); - be = ae; + ve = C.heap[++C.heap_len] = tt < 2 ? ++tt : 0, F[ve * 2] = 1, C.depth[ve] = 0, C.opt_len--, le && (C.static_len -= Q[ve * 2 + 1]); + for (K.max_code = tt, Fe = C.heap_len >> 1; Fe >= 1; Fe--) + Ue(C, F, Fe); + ve = ae; do - ze = C.heap[ + Fe = C.heap[ 1 /*SMALLEST*/ ], C.heap[ @@ -39617,13 +39617,13 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `; F, 1 /*SMALLEST*/ - ), De = C.heap[ + ), Se = C.heap[ 1 /*SMALLEST*/ - ], C.heap[--C.heap_max] = ze, C.heap[--C.heap_max] = De, F[be * 2] = F[ze * 2] + F[De * 2], C.depth[be] = (C.depth[ze] >= C.depth[De] ? C.depth[ze] : C.depth[De]) + 1, F[ze * 2 + 1] = F[De * 2 + 1] = be, C.heap[ + ], C.heap[--C.heap_max] = Fe, C.heap[--C.heap_max] = Se, F[ve * 2] = F[Fe * 2] + F[Se * 2], C.depth[ve] = (C.depth[Fe] >= C.depth[Se] ? C.depth[Fe] : C.depth[Se]) + 1, F[Fe * 2 + 1] = F[Se * 2 + 1] = ve, C.heap[ 1 /*SMALLEST*/ - ] = be++, Ue( + ] = ve++, Ue( C, F, 1 @@ -39633,36 +39633,36 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `; C.heap[--C.heap_max] = C.heap[ 1 /*SMALLEST*/ - ], Ce(C, j), ue(F, tt, C.bl_count); - }, Ae = (C, j, F) => { - let Q, oe = -1, ae, ze = j[0 * 2 + 1], De = 0, tt = 7, be = 4; - for (ze === 0 && (tt = 138, be = 3), j[(F + 1) * 2 + 1] = 65535, Q = 0; Q <= F; Q++) - ae = ze, ze = j[(Q + 1) * 2 + 1], !(++De < tt && ae === ze) && (De < be ? C.bl_tree[ae * 2] += De : ae !== 0 ? (ae !== oe && C.bl_tree[ae * 2]++, C.bl_tree[M * 2]++) : De <= 10 ? C.bl_tree[E * 2]++ : C.bl_tree[$ * 2]++, De = 0, oe = ae, ze === 0 ? (tt = 138, be = 3) : ae === ze ? (tt = 6, be = 3) : (tt = 7, be = 4)); - }, ge = (C, j, F) => { - let Q, oe = -1, ae, ze = j[0 * 2 + 1], De = 0, tt = 7, be = 4; - for (ze === 0 && (tt = 138, be = 3), Q = 0; Q <= F; Q++) - if (ae = ze, ze = j[(Q + 1) * 2 + 1], !(++De < tt && ae === ze)) { - if (De < be) + ], Ae(C, K), he(F, tt, C.bl_count); + }, Ge = (C, K, F) => { + let Q, le = -1, ae, Fe = K[0 * 2 + 1], Se = 0, tt = 7, ve = 4; + for (Fe === 0 && (tt = 138, ve = 3), K[(F + 1) * 2 + 1] = 65535, Q = 0; Q <= F; Q++) + ae = Fe, Fe = K[(Q + 1) * 2 + 1], !(++Se < tt && ae === Fe) && (Se < ve ? C.bl_tree[ae * 2] += Se : ae !== 0 ? (ae !== le && C.bl_tree[ae * 2]++, C.bl_tree[M * 2]++) : Se <= 10 ? C.bl_tree[E * 2]++ : C.bl_tree[$ * 2]++, Se = 0, le = ae, Fe === 0 ? (tt = 138, ve = 3) : ae === Fe ? (tt = 6, ve = 3) : (tt = 7, ve = 4)); + }, Ne = (C, K, F) => { + let Q, le = -1, ae, Fe = K[0 * 2 + 1], Se = 0, tt = 7, ve = 4; + for (Fe === 0 && (tt = 138, ve = 3), Q = 0; Q <= F; Q++) + if (ae = Fe, Fe = K[(Q + 1) * 2 + 1], !(++Se < tt && ae === Fe)) { + if (Se < ve) do J(C, ae, C.bl_tree); - while (--De !== 0); - else ae !== 0 ? (ae !== oe && (J(C, ae, C.bl_tree), De--), J(C, M, C.bl_tree), le(C, De - 3, 2)) : De <= 10 ? (J(C, E, C.bl_tree), le(C, De - 3, 3)) : (J(C, $, C.bl_tree), le(C, De - 11, 7)); - De = 0, oe = ae, ze === 0 ? (tt = 138, be = 3) : ae === ze ? (tt = 6, be = 3) : (tt = 7, be = 4); + while (--Se !== 0); + else ae !== 0 ? (ae !== le && (J(C, ae, C.bl_tree), Se--), J(C, M, C.bl_tree), oe(C, Se - 3, 2)) : Se <= 10 ? (J(C, E, C.bl_tree), oe(C, Se - 3, 3)) : (J(C, $, C.bl_tree), oe(C, Se - 11, 7)); + Se = 0, le = ae, Fe === 0 ? (tt = 138, ve = 3) : ae === Fe ? (tt = 6, ve = 3) : (tt = 7, ve = 4); } - }, Le = (C) => { - let j; - for (Ae(C, C.dyn_ltree, C.l_desc.max_code), Ae(C, C.dyn_dtree, C.d_desc.max_code), Ee(C, C.bl_desc), j = h - 1; j >= 3 && C.bl_tree[O[j] * 2 + 1] === 0; j--) + }, Pe = (C) => { + let K; + for (Ge(C, C.dyn_ltree, C.l_desc.max_code), Ge(C, C.dyn_dtree, C.d_desc.max_code), We(C, C.bl_desc), K = u - 1; K >= 3 && C.bl_tree[O[K] * 2 + 1] === 0; K--) ; - return C.opt_len += 3 * (j + 1) + 5 + 5 + 4, j; - }, Te = (C, j, F, Q) => { - let oe; - for (le(C, j - 257, 5), le(C, F - 1, 5), le(C, Q - 4, 4), oe = 0; oe < Q; oe++) - le(C, C.bl_tree[O[oe] * 2 + 1], 3); - ge(C, C.dyn_ltree, j - 1), ge(C, C.dyn_dtree, F - 1); - }, Ke = (C) => { - let j = 4093624447, F; - for (F = 0; F <= 31; F++, j >>>= 1) - if (j & 1 && C.dyn_ltree[F * 2] !== 0) + return C.opt_len += 3 * (K + 1) + 5 + 5 + 4, K; + }, Te = (C, K, F, Q) => { + let le; + for (oe(C, K - 257, 5), oe(C, F - 1, 5), oe(C, Q - 4, 4), le = 0; le < Q; le++) + oe(C, C.bl_tree[O[le] * 2 + 1], 3); + Ne(C, C.dyn_ltree, K - 1), Ne(C, C.dyn_dtree, F - 1); + }, Me = (C) => { + let K = 4093624447, F; + for (F = 0; F <= 31; F++, K >>>= 1) + if (K & 1 && C.dyn_ltree[F * 2] !== 0) return a; if (C.dyn_ltree[9 * 2] !== 0 || C.dyn_ltree[10 * 2] !== 0 || C.dyn_ltree[13 * 2] !== 0) return l; @@ -39671,51 +39671,51 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `; return l; return a; }; - let je = !1; - const Y = (C) => { - je || (ne(), je = !0), C.l_desc = new ee(C.dyn_ltree, V), C.d_desc = new ee(C.dyn_dtree, re), C.bl_desc = new ee(C.bl_tree, ie), C.bi_buf = 0, C.bi_valid = 0, _e(C); - }, q = (C, j, F, Q) => { - le(C, (u << 1) + (Q ? 1 : 0), 3), Oe(C), he(C, F), he(C, ~F), F && C.pending_buf.set(C.window.subarray(j, j + F), C.pending), C.pending += F; - }, te = (C) => { - le(C, p << 1, 3), J(C, v, P), se(C); - }, we = (C, j, F, Q) => { - let oe, ae, ze = 0; - C.level > 0 ? (C.strm.data_type === d && (C.strm.data_type = Ke(C)), Ee(C, C.l_desc), Ee(C, C.d_desc), ze = Le(C), oe = C.opt_len + 3 + 7 >>> 3, ae = C.static_len + 3 + 7 >>> 3, ae <= oe && (oe = ae)) : oe = ae = F + 5, F + 4 <= oe && j !== -1 ? q(C, j, F, Q) : C.strategy === r || ae === oe ? (le(C, (p << 1) + (Q ? 1 : 0), 3), We(C, P, U)) : (le(C, (m << 1) + (Q ? 1 : 0), 3), Te(C, C.l_desc.max_code + 1, C.d_desc.max_code + 1, ze + 1), We(C, C.dyn_ltree, C.dyn_dtree)), _e(C), Q && Oe(C); - }, me = (C, j, F) => (C.pending_buf[C.sym_buf + C.sym_next++] = j, C.pending_buf[C.sym_buf + C.sym_next++] = j >> 8, C.pending_buf[C.sym_buf + C.sym_next++] = F, j === 0 ? C.dyn_ltree[F * 2]++ : (C.matches++, j--, C.dyn_ltree[(N[F] + A + 1) * 2]++, C.dyn_dtree[ce(j) * 2]++), C.sym_next === C.sym_end); - var Pe = Y, Fe = q, K = we, fe = me, Se = te, Ne = { - _tr_init: Pe, - _tr_stored_block: Fe, - _tr_flush_block: K, - _tr_tally: fe, - _tr_align: Se - }, ke = (C, j, F, Q) => { - let oe = C & 65535 | 0, ae = C >>> 16 & 65535 | 0, ze = 0; + let De = !1; + const V = (C) => { + De || (ne(), De = !0), C.l_desc = new te(C.dyn_ltree, j), C.d_desc = new te(C.dyn_dtree, re), C.bl_desc = new te(C.bl_tree, ie), C.bi_buf = 0, C.bi_valid = 0, _e(C); + }, Z = (C, K, F, Q) => { + oe(C, (d << 1) + (Q ? 1 : 0), 3), Le(C), de(C, F), de(C, ~F), F && C.pending_buf.set(C.window.subarray(K, K + F), C.pending), C.pending += F; + }, ee = (C) => { + oe(C, _ << 1, 3), J(C, v, N), se(C); + }, ye = (C, K, F, Q) => { + let le, ae, Fe = 0; + C.level > 0 ? (C.strm.data_type === h && (C.strm.data_type = Me(C)), We(C, C.l_desc), We(C, C.d_desc), Fe = Pe(C), le = C.opt_len + 3 + 7 >>> 3, ae = C.static_len + 3 + 7 >>> 3, ae <= le && (le = ae)) : le = ae = F + 5, F + 4 <= le && K !== -1 ? Z(C, K, F, Q) : C.strategy === r || ae === le ? (oe(C, (_ << 1) + (Q ? 1 : 0), 3), He(C, N, W)) : (oe(C, (m << 1) + (Q ? 1 : 0), 3), Te(C, C.l_desc.max_code + 1, C.d_desc.max_code + 1, Fe + 1), He(C, C.dyn_ltree, C.dyn_dtree)), _e(C), Q && Le(C); + }, ce = (C, K, F) => (C.pending_buf[C.sym_buf + C.sym_next++] = K, C.pending_buf[C.sym_buf + C.sym_next++] = K >> 8, C.pending_buf[C.sym_buf + C.sym_next++] = F, K === 0 ? C.dyn_ltree[F * 2]++ : (C.matches++, K--, C.dyn_ltree[(P[F] + A + 1) * 2]++, C.dyn_dtree[ue(K) * 2]++), C.sym_next === C.sym_end); + var Ie = V, ke = Z, Y = ye, me = ce, we = ee, Re = { + _tr_init: Ie, + _tr_stored_block: ke, + _tr_flush_block: Y, + _tr_tally: me, + _tr_align: we + }, $e = (C, K, F, Q) => { + let le = C & 65535 | 0, ae = C >>> 16 & 65535 | 0, Fe = 0; for (; F !== 0; ) { - ze = F > 2e3 ? 2e3 : F, F -= ze; + Fe = F > 2e3 ? 2e3 : F, F -= Fe; do - oe = oe + j[Q++] | 0, ae = ae + oe | 0; - while (--ze); - oe %= 65521, ae %= 65521; + le = le + K[Q++] | 0, ae = ae + le | 0; + while (--Fe); + le %= 65521, ae %= 65521; } - return oe | ae << 16 | 0; + return le | ae << 16 | 0; }; const X = () => { - let C, j = []; + let C, K = []; for (var F = 0; F < 256; F++) { C = F; for (var Q = 0; Q < 8; Q++) C = C & 1 ? 3988292384 ^ C >>> 1 : C >>> 1; - j[F] = C; + K[F] = C; } - return j; - }, Be = new Uint32Array(X()); - var I = (C, j, F, Q) => { - const oe = Be, ae = Q + F; + return K; + }, ze = new Uint32Array(X()); + var I = (C, K, F, Q) => { + const le = ze, ae = Q + F; C ^= -1; - for (let ze = Q; ze < ae; ze++) - C = C >>> 8 ^ oe[(C ^ j[ze]) & 255]; + for (let Fe = Q; Fe < ae; Fe++) + C = C >>> 8 ^ le[(C ^ K[Fe]) & 255]; return C ^ -1; - }, ye = { + }, xe = { 2: "need dictionary", /* Z_NEED_DICT 2 */ 1: "stream end", @@ -39734,7 +39734,7 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `; /* Z_BUF_ERROR (-5) */ "-6": "incompatible version" /* Z_VERSION_ERROR (-6) */ - }, ve = { + }, be = { /* Allowed flush values; see deflate() and inflate() below for details */ Z_NO_FLUSH: 0, Z_PARTIAL_FLUSH: 1, @@ -39774,364 +39774,364 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `; Z_DEFLATED: 8 //Z_NULL: null // Use -1 or null inline, depending on var type }; - const { _tr_init: Z, _tr_stored_block: de, _tr_flush_block: $e, _tr_tally: Ye, _tr_align: qe } = Ne, { - Z_NO_FLUSH: Xe, - Z_PARTIAL_FLUSH: at, + const { _tr_init: q, _tr_stored_block: fe, _tr_flush_block: Ce, _tr_tally: Ze, _tr_align: Xe } = Re, { + Z_NO_FLUSH: Ye, + Z_PARTIAL_FLUSH: lt, Z_FULL_FLUSH: dt, - Z_FINISH: lt, + Z_FINISH: it, Z_BLOCK: ot, - Z_OK: st, - Z_STREAM_END: bt, - Z_STREAM_ERROR: _t, - Z_DATA_ERROR: Lt, - Z_BUF_ERROR: Gt, - Z_DEFAULT_COMPRESSION: ft, - Z_FILTERED: Et, - Z_HUFFMAN_ONLY: gt, + Z_OK: nt, + Z_STREAM_END: Ct, + Z_STREAM_ERROR: ut, + Z_DATA_ERROR: zt, + Z_BUF_ERROR: Ut, + Z_DEFAULT_COMPRESSION: wt, + Z_FILTERED: mt, + Z_HUFFMAN_ONLY: vt, Z_RLE: Rt, - Z_FIXED: Qe, - Z_DEFAULT_STRATEGY: xe, - Z_UNKNOWN: He, - Z_DEFLATED: Ze - } = ve, yt = 9, zt = 15, Ft = 8, Zt = 256 + 1 + 29, Pt = 30, mr = 19, pr = 2 * Zt + 1, qr = 15, mt = 3, Jt = 258, Xt = Jt + mt + 1, Qr = 32, sr = 42, Er = 57, Sr = 69, Ar = 73, Mr = 91, Dr = 103, tr = 113, $t = 666, rt = 1, Dt = 2, Vt = 3, qt = 4, _r = 3, Ht = (C, j) => (C.msg = ye[j], j), Qt = (C) => C * 2 - (C > 4 ? 9 : 0), jt = (C) => { - let j = C.length; - for (; --j >= 0; ) - C[j] = 0; - }, gr = (C) => { - let j, F, Q, oe = C.w_size; - j = C.hash_size, Q = j; + Z_FIXED: qe, + Z_DEFAULT_STRATEGY: ge, + Z_UNKNOWN: Ke, + Z_DEFLATED: Qe + } = be, _t = 9, Mt = 15, St = 8, Zt = 256 + 1 + 29, Tt = 30, mr = 19, nr = 2 * Zt + 1, Or = 15, ft = 3, Qt = 258, Gt = Qt + ft + 1, Nt = 32, ar = 42, zr = 57, Ir = 69, Br = 73, Dr = 91, Rr = 103, sr = 113, vr = 666, Ht = 1, pr = 2, lr = 3, _r = 4, hi = 3, or = (C, K) => (C.msg = xe[K], K), Yr = (C) => C * 2 - (C > 4 ? 9 : 0), tr = (C) => { + let K = C.length; + for (; --K >= 0; ) + C[K] = 0; + }, fi = (C) => { + let K, F, Q, le = C.w_size; + K = C.hash_size, Q = K; do - F = C.head[--Q], C.head[Q] = F >= oe ? F - oe : 0; - while (--j); - j = oe, Q = j; + F = C.head[--Q], C.head[Q] = F >= le ? F - le : 0; + while (--K); + K = le, Q = K; do - F = C.prev[--Q], C.prev[Q] = F >= oe ? F - oe : 0; - while (--j); + F = C.prev[--Q], C.prev[Q] = F >= le ? F - le : 0; + while (--K); }; - let Kt = (C, j, F) => (j << C.hash_shift ^ F) & C.hash_mask; - const Ut = (C) => { - const j = C.state; - let F = j.pending; - F > C.avail_out && (F = C.avail_out), F !== 0 && (C.output.set(j.pending_buf.subarray(j.pending_out, j.pending_out + F), C.next_out), C.next_out += F, j.pending_out += F, C.total_out += F, C.avail_out -= F, j.pending -= F, j.pending === 0 && (j.pending_out = 0)); - }, Ct = (C, j) => { - $e(C, C.block_start >= 0 ? C.block_start : -1, C.strstart - C.block_start, j), C.block_start = C.strstart, Ut(C.strm); - }, ut = (C, j) => { - C.pending_buf[C.pending++] = j; - }, lr = (C, j) => { - C.pending_buf[C.pending++] = j >>> 8 & 255, C.pending_buf[C.pending++] = j & 255; - }, vr = (C, j, F, Q) => { - let oe = C.avail_in; - return oe > Q && (oe = Q), oe === 0 ? 0 : (C.avail_in -= oe, j.set(C.input.subarray(C.next_in, C.next_in + oe), F), C.state.wrap === 1 ? C.adler = ke(C.adler, j, oe, F) : C.state.wrap === 2 && (C.adler = I(C.adler, j, oe, F)), C.next_in += oe, C.total_in += oe, oe); - }, $r = (C, j) => { - let F = C.max_chain_length, Q = C.strstart, oe, ae, ze = C.prev_length, De = C.nice_match; - const tt = C.strstart > C.w_size - Xt ? C.strstart - (C.w_size - Xt) : 0, be = C.window, Ie = C.w_mask, St = C.prev, et = C.strstart + Jt; - let Ve = be[Q + ze - 1], it = be[Q + ze]; - C.prev_length >= C.good_match && (F >>= 2), De > C.lookahead && (De = C.lookahead); + let rr = (C, K, F) => (K << C.hash_shift ^ F) & C.hash_mask; + const Kt = (C) => { + const K = C.state; + let F = K.pending; + F > C.avail_out && (F = C.avail_out), F !== 0 && (C.output.set(K.pending_buf.subarray(K.pending_out, K.pending_out + F), C.next_out), C.next_out += F, K.pending_out += F, C.total_out += F, C.avail_out -= F, K.pending -= F, K.pending === 0 && (K.pending_out = 0)); + }, Yt = (C, K) => { + Ce(C, C.block_start >= 0 ? C.block_start : -1, C.strstart - C.block_start, K), C.block_start = C.strstart, Kt(C.strm); + }, xt = (C, K) => { + C.pending_buf[C.pending++] = K; + }, yr = (C, K) => { + C.pending_buf[C.pending++] = K >>> 8 & 255, C.pending_buf[C.pending++] = K & 255; + }, Pr = (C, K, F, Q) => { + let le = C.avail_in; + return le > Q && (le = Q), le === 0 ? 0 : (C.avail_in -= le, K.set(C.input.subarray(C.next_in, C.next_in + le), F), C.state.wrap === 1 ? C.adler = $e(C.adler, K, le, F) : C.state.wrap === 2 && (C.adler = I(C.adler, K, le, F)), C.next_in += le, C.total_in += le, le); + }, kt = (C, K) => { + let F = C.max_chain_length, Q = C.strstart, le, ae, Fe = C.prev_length, Se = C.nice_match; + const tt = C.strstart > C.w_size - Gt ? C.strstart - (C.w_size - Gt) : 0, ve = C.window, Oe = C.w_mask, Et = C.prev, et = C.strstart + Qt; + let je = ve[Q + Fe - 1], at = ve[Q + Fe]; + C.prev_length >= C.good_match && (F >>= 2), Se > C.lookahead && (Se = C.lookahead); do - if (oe = j, !(be[oe + ze] !== it || be[oe + ze - 1] !== Ve || be[oe] !== be[Q] || be[++oe] !== be[Q + 1])) { - Q += 2, oe++; + if (le = K, !(ve[le + Fe] !== at || ve[le + Fe - 1] !== je || ve[le] !== ve[Q] || ve[++le] !== ve[Q + 1])) { + Q += 2, le++; do ; - while (be[++Q] === be[++oe] && be[++Q] === be[++oe] && be[++Q] === be[++oe] && be[++Q] === be[++oe] && be[++Q] === be[++oe] && be[++Q] === be[++oe] && be[++Q] === be[++oe] && be[++Q] === be[++oe] && Q < et); - if (ae = Jt - (et - Q), Q = et - Jt, ae > ze) { - if (C.match_start = j, ze = ae, ae >= De) + while (ve[++Q] === ve[++le] && ve[++Q] === ve[++le] && ve[++Q] === ve[++le] && ve[++Q] === ve[++le] && ve[++Q] === ve[++le] && ve[++Q] === ve[++le] && ve[++Q] === ve[++le] && ve[++Q] === ve[++le] && Q < et); + if (ae = Qt - (et - Q), Q = et - Qt, ae > Fe) { + if (C.match_start = K, Fe = ae, ae >= Se) break; - Ve = be[Q + ze - 1], it = be[Q + ze]; + je = ve[Q + Fe - 1], at = ve[Q + Fe]; } } - while ((j = St[j & Ie]) > tt && --F !== 0); - return ze <= C.lookahead ? ze : C.lookahead; - }, rr = (C) => { - const j = C.w_size; - let F, Q, oe; + while ((K = Et[K & Oe]) > tt && --F !== 0); + return Fe <= C.lookahead ? Fe : C.lookahead; + }, rt = (C) => { + const K = C.w_size; + let F, Q, le; do { - if (Q = C.window_size - C.lookahead - C.strstart, C.strstart >= j + (j - Xt) && (C.window.set(C.window.subarray(j, j + j - Q), 0), C.match_start -= j, C.strstart -= j, C.block_start -= j, C.insert > C.strstart && (C.insert = C.strstart), gr(C), Q += j), C.strm.avail_in === 0) + if (Q = C.window_size - C.lookahead - C.strstart, C.strstart >= K + (K - Gt) && (C.window.set(C.window.subarray(K, K + K - Q), 0), C.match_start -= K, C.strstart -= K, C.block_start -= K, C.insert > C.strstart && (C.insert = C.strstart), fi(C), Q += K), C.strm.avail_in === 0) break; - if (F = vr(C.strm, C.window, C.strstart + C.lookahead, Q), C.lookahead += F, C.lookahead + C.insert >= mt) - for (oe = C.strstart - C.insert, C.ins_h = C.window[oe], C.ins_h = Kt(C, C.ins_h, C.window[oe + 1]); C.insert && (C.ins_h = Kt(C, C.ins_h, C.window[oe + mt - 1]), C.prev[oe & C.w_mask] = C.head[C.ins_h], C.head[C.ins_h] = oe, oe++, C.insert--, !(C.lookahead + C.insert < mt)); ) + if (F = Pr(C.strm, C.window, C.strstart + C.lookahead, Q), C.lookahead += F, C.lookahead + C.insert >= ft) + for (le = C.strstart - C.insert, C.ins_h = C.window[le], C.ins_h = rr(C, C.ins_h, C.window[le + 1]); C.insert && (C.ins_h = rr(C, C.ins_h, C.window[le + ft - 1]), C.prev[le & C.w_mask] = C.head[C.ins_h], C.head[C.ins_h] = le, le++, C.insert--, !(C.lookahead + C.insert < ft)); ) ; - } while (C.lookahead < Xt && C.strm.avail_in !== 0); - }, Tr = (C, j) => { - let F = C.pending_buf_size - 5 > C.w_size ? C.w_size : C.pending_buf_size - 5, Q, oe, ae, ze = 0, De = C.strm.avail_in; + } while (C.lookahead < Gt && C.strm.avail_in !== 0); + }, Lt = (C, K) => { + let F = C.pending_buf_size - 5 > C.w_size ? C.w_size : C.pending_buf_size - 5, Q, le, ae, Fe = 0, Se = C.strm.avail_in; do { - if (Q = 65535, ae = C.bi_valid + 42 >> 3, C.strm.avail_out < ae || (ae = C.strm.avail_out - ae, oe = C.strstart - C.block_start, Q > oe + C.strm.avail_in && (Q = oe + C.strm.avail_in), Q > ae && (Q = ae), Q < F && (Q === 0 && j !== lt || j === Xe || Q !== oe + C.strm.avail_in))) + if (Q = 65535, ae = C.bi_valid + 42 >> 3, C.strm.avail_out < ae || (ae = C.strm.avail_out - ae, le = C.strstart - C.block_start, Q > le + C.strm.avail_in && (Q = le + C.strm.avail_in), Q > ae && (Q = ae), Q < F && (Q === 0 && K !== it || K === Ye || Q !== le + C.strm.avail_in))) break; - ze = j === lt && Q === oe + C.strm.avail_in ? 1 : 0, de(C, 0, 0, ze), C.pending_buf[C.pending - 4] = Q, C.pending_buf[C.pending - 3] = Q >> 8, C.pending_buf[C.pending - 2] = ~Q, C.pending_buf[C.pending - 1] = ~Q >> 8, Ut(C.strm), oe && (oe > Q && (oe = Q), C.strm.output.set(C.window.subarray(C.block_start, C.block_start + oe), C.strm.next_out), C.strm.next_out += oe, C.strm.avail_out -= oe, C.strm.total_out += oe, C.block_start += oe, Q -= oe), Q && (vr(C.strm, C.strm.output, C.strm.next_out, Q), C.strm.next_out += Q, C.strm.avail_out -= Q, C.strm.total_out += Q); - } while (ze === 0); - return De -= C.strm.avail_in, De && (De >= C.w_size ? (C.matches = 2, C.window.set(C.strm.input.subarray(C.strm.next_in - C.w_size, C.strm.next_in), 0), C.strstart = C.w_size, C.insert = C.strstart) : (C.window_size - C.strstart <= De && (C.strstart -= C.w_size, C.window.set(C.window.subarray(C.w_size, C.w_size + C.strstart), 0), C.matches < 2 && C.matches++, C.insert > C.strstart && (C.insert = C.strstart)), C.window.set(C.strm.input.subarray(C.strm.next_in - De, C.strm.next_in), C.strstart), C.strstart += De, C.insert += De > C.w_size - C.insert ? C.w_size - C.insert : De), C.block_start = C.strstart), C.high_water < C.strstart && (C.high_water = C.strstart), ze ? qt : j !== Xe && j !== lt && C.strm.avail_in === 0 && C.strstart === C.block_start ? Dt : (ae = C.window_size - C.strstart, C.strm.avail_in > ae && C.block_start >= C.w_size && (C.block_start -= C.w_size, C.strstart -= C.w_size, C.window.set(C.window.subarray(C.w_size, C.w_size + C.strstart), 0), C.matches < 2 && C.matches++, ae += C.w_size, C.insert > C.strstart && (C.insert = C.strstart)), ae > C.strm.avail_in && (ae = C.strm.avail_in), ae && (vr(C.strm, C.window, C.strstart, ae), C.strstart += ae, C.insert += ae > C.w_size - C.insert ? C.w_size - C.insert : ae), C.high_water < C.strstart && (C.high_water = C.strstart), ae = C.bi_valid + 42 >> 3, ae = C.pending_buf_size - ae > 65535 ? 65535 : C.pending_buf_size - ae, F = ae > C.w_size ? C.w_size : ae, oe = C.strstart - C.block_start, (oe >= F || (oe || j === lt) && j !== Xe && C.strm.avail_in === 0 && oe <= ae) && (Q = oe > ae ? ae : oe, ze = j === lt && C.strm.avail_in === 0 && Q === oe ? 1 : 0, de(C, C.block_start, Q, ze), C.block_start += Q, Ut(C.strm)), ze ? Vt : rt); - }, or = (C, j) => { + Fe = K === it && Q === le + C.strm.avail_in ? 1 : 0, fe(C, 0, 0, Fe), C.pending_buf[C.pending - 4] = Q, C.pending_buf[C.pending - 3] = Q >> 8, C.pending_buf[C.pending - 2] = ~Q, C.pending_buf[C.pending - 1] = ~Q >> 8, Kt(C.strm), le && (le > Q && (le = Q), C.strm.output.set(C.window.subarray(C.block_start, C.block_start + le), C.strm.next_out), C.strm.next_out += le, C.strm.avail_out -= le, C.strm.total_out += le, C.block_start += le, Q -= le), Q && (Pr(C.strm, C.strm.output, C.strm.next_out, Q), C.strm.next_out += Q, C.strm.avail_out -= Q, C.strm.total_out += Q); + } while (Fe === 0); + return Se -= C.strm.avail_in, Se && (Se >= C.w_size ? (C.matches = 2, C.window.set(C.strm.input.subarray(C.strm.next_in - C.w_size, C.strm.next_in), 0), C.strstart = C.w_size, C.insert = C.strstart) : (C.window_size - C.strstart <= Se && (C.strstart -= C.w_size, C.window.set(C.window.subarray(C.w_size, C.w_size + C.strstart), 0), C.matches < 2 && C.matches++, C.insert > C.strstart && (C.insert = C.strstart)), C.window.set(C.strm.input.subarray(C.strm.next_in - Se, C.strm.next_in), C.strstart), C.strstart += Se, C.insert += Se > C.w_size - C.insert ? C.w_size - C.insert : Se), C.block_start = C.strstart), C.high_water < C.strstart && (C.high_water = C.strstart), Fe ? _r : K !== Ye && K !== it && C.strm.avail_in === 0 && C.strstart === C.block_start ? pr : (ae = C.window_size - C.strstart, C.strm.avail_in > ae && C.block_start >= C.w_size && (C.block_start -= C.w_size, C.strstart -= C.w_size, C.window.set(C.window.subarray(C.w_size, C.w_size + C.strstart), 0), C.matches < 2 && C.matches++, ae += C.w_size, C.insert > C.strstart && (C.insert = C.strstart)), ae > C.strm.avail_in && (ae = C.strm.avail_in), ae && (Pr(C.strm, C.window, C.strstart, ae), C.strstart += ae, C.insert += ae > C.w_size - C.insert ? C.w_size - C.insert : ae), C.high_water < C.strstart && (C.high_water = C.strstart), ae = C.bi_valid + 42 >> 3, ae = C.pending_buf_size - ae > 65535 ? 65535 : C.pending_buf_size - ae, F = ae > C.w_size ? C.w_size : ae, le = C.strstart - C.block_start, (le >= F || (le || K === it) && K !== Ye && C.strm.avail_in === 0 && le <= ae) && (Q = le > ae ? ae : le, Fe = K === it && C.strm.avail_in === 0 && Q === le ? 1 : 0, fe(C, C.block_start, Q, Fe), C.block_start += Q, Kt(C.strm)), Fe ? lr : Ht); + }, cr = (C, K) => { let F, Q; for (; ; ) { - if (C.lookahead < Xt) { - if (rr(C), C.lookahead < Xt && j === Xe) - return rt; + if (C.lookahead < Gt) { + if (rt(C), C.lookahead < Gt && K === Ye) + return Ht; if (C.lookahead === 0) break; } - if (F = 0, C.lookahead >= mt && (C.ins_h = Kt(C, C.ins_h, C.window[C.strstart + mt - 1]), F = C.prev[C.strstart & C.w_mask] = C.head[C.ins_h], C.head[C.ins_h] = C.strstart), F !== 0 && C.strstart - F <= C.w_size - Xt && (C.match_length = $r(C, F)), C.match_length >= mt) - if (Q = Ye(C, C.strstart - C.match_start, C.match_length - mt), C.lookahead -= C.match_length, C.match_length <= C.max_lazy_match && C.lookahead >= mt) { + if (F = 0, C.lookahead >= ft && (C.ins_h = rr(C, C.ins_h, C.window[C.strstart + ft - 1]), F = C.prev[C.strstart & C.w_mask] = C.head[C.ins_h], C.head[C.ins_h] = C.strstart), F !== 0 && C.strstart - F <= C.w_size - Gt && (C.match_length = kt(C, F)), C.match_length >= ft) + if (Q = Ze(C, C.strstart - C.match_start, C.match_length - ft), C.lookahead -= C.match_length, C.match_length <= C.max_lazy_match && C.lookahead >= ft) { C.match_length--; do - C.strstart++, C.ins_h = Kt(C, C.ins_h, C.window[C.strstart + mt - 1]), F = C.prev[C.strstart & C.w_mask] = C.head[C.ins_h], C.head[C.ins_h] = C.strstart; + C.strstart++, C.ins_h = rr(C, C.ins_h, C.window[C.strstart + ft - 1]), F = C.prev[C.strstart & C.w_mask] = C.head[C.ins_h], C.head[C.ins_h] = C.strstart; while (--C.match_length !== 0); C.strstart++; } else - C.strstart += C.match_length, C.match_length = 0, C.ins_h = C.window[C.strstart], C.ins_h = Kt(C, C.ins_h, C.window[C.strstart + 1]); + C.strstart += C.match_length, C.match_length = 0, C.ins_h = C.window[C.strstart], C.ins_h = rr(C, C.ins_h, C.window[C.strstart + 1]); else - Q = Ye(C, 0, C.window[C.strstart]), C.lookahead--, C.strstart++; - if (Q && (Ct(C, !1), C.strm.avail_out === 0)) - return rt; + Q = Ze(C, 0, C.window[C.strstart]), C.lookahead--, C.strstart++; + if (Q && (Yt(C, !1), C.strm.avail_out === 0)) + return Ht; } - return C.insert = C.strstart < mt - 1 ? C.strstart : mt - 1, j === lt ? (Ct(C, !0), C.strm.avail_out === 0 ? Vt : qt) : C.sym_next && (Ct(C, !1), C.strm.avail_out === 0) ? rt : Dt; - }, yr = (C, j) => { - let F, Q, oe; + return C.insert = C.strstart < ft - 1 ? C.strstart : ft - 1, K === it ? (Yt(C, !0), C.strm.avail_out === 0 ? lr : _r) : C.sym_next && (Yt(C, !1), C.strm.avail_out === 0) ? Ht : pr; + }, Jt = (C, K) => { + let F, Q, le; for (; ; ) { - if (C.lookahead < Xt) { - if (rr(C), C.lookahead < Xt && j === Xe) - return rt; + if (C.lookahead < Gt) { + if (rt(C), C.lookahead < Gt && K === Ye) + return Ht; if (C.lookahead === 0) break; } - if (F = 0, C.lookahead >= mt && (C.ins_h = Kt(C, C.ins_h, C.window[C.strstart + mt - 1]), F = C.prev[C.strstart & C.w_mask] = C.head[C.ins_h], C.head[C.ins_h] = C.strstart), C.prev_length = C.match_length, C.prev_match = C.match_start, C.match_length = mt - 1, F !== 0 && C.prev_length < C.max_lazy_match && C.strstart - F <= C.w_size - Xt && (C.match_length = $r(C, F), C.match_length <= 5 && (C.strategy === Et || C.match_length === mt && C.strstart - C.match_start > 4096) && (C.match_length = mt - 1)), C.prev_length >= mt && C.match_length <= C.prev_length) { - oe = C.strstart + C.lookahead - mt, Q = Ye(C, C.strstart - 1 - C.prev_match, C.prev_length - mt), C.lookahead -= C.prev_length - 1, C.prev_length -= 2; + if (F = 0, C.lookahead >= ft && (C.ins_h = rr(C, C.ins_h, C.window[C.strstart + ft - 1]), F = C.prev[C.strstart & C.w_mask] = C.head[C.ins_h], C.head[C.ins_h] = C.strstart), C.prev_length = C.match_length, C.prev_match = C.match_start, C.match_length = ft - 1, F !== 0 && C.prev_length < C.max_lazy_match && C.strstart - F <= C.w_size - Gt && (C.match_length = kt(C, F), C.match_length <= 5 && (C.strategy === mt || C.match_length === ft && C.strstart - C.match_start > 4096) && (C.match_length = ft - 1)), C.prev_length >= ft && C.match_length <= C.prev_length) { + le = C.strstart + C.lookahead - ft, Q = Ze(C, C.strstart - 1 - C.prev_match, C.prev_length - ft), C.lookahead -= C.prev_length - 1, C.prev_length -= 2; do - ++C.strstart <= oe && (C.ins_h = Kt(C, C.ins_h, C.window[C.strstart + mt - 1]), F = C.prev[C.strstart & C.w_mask] = C.head[C.ins_h], C.head[C.ins_h] = C.strstart); + ++C.strstart <= le && (C.ins_h = rr(C, C.ins_h, C.window[C.strstart + ft - 1]), F = C.prev[C.strstart & C.w_mask] = C.head[C.ins_h], C.head[C.ins_h] = C.strstart); while (--C.prev_length !== 0); - if (C.match_available = 0, C.match_length = mt - 1, C.strstart++, Q && (Ct(C, !1), C.strm.avail_out === 0)) - return rt; + if (C.match_available = 0, C.match_length = ft - 1, C.strstart++, Q && (Yt(C, !1), C.strm.avail_out === 0)) + return Ht; } else if (C.match_available) { - if (Q = Ye(C, 0, C.window[C.strstart - 1]), Q && Ct(C, !1), C.strstart++, C.lookahead--, C.strm.avail_out === 0) - return rt; + if (Q = Ze(C, 0, C.window[C.strstart - 1]), Q && Yt(C, !1), C.strstart++, C.lookahead--, C.strm.avail_out === 0) + return Ht; } else C.match_available = 1, C.strstart++, C.lookahead--; } - return C.match_available && (Q = Ye(C, 0, C.window[C.strstart - 1]), C.match_available = 0), C.insert = C.strstart < mt - 1 ? C.strstart : mt - 1, j === lt ? (Ct(C, !0), C.strm.avail_out === 0 ? Vt : qt) : C.sym_next && (Ct(C, !1), C.strm.avail_out === 0) ? rt : Dt; - }, xn = (C, j) => { - let F, Q, oe, ae; - const ze = C.window; + return C.match_available && (Q = Ze(C, 0, C.window[C.strstart - 1]), C.match_available = 0), C.insert = C.strstart < ft - 1 ? C.strstart : ft - 1, K === it ? (Yt(C, !0), C.strm.avail_out === 0 ? lr : _r) : C.sym_next && (Yt(C, !1), C.strm.avail_out === 0) ? Ht : pr; + }, Cr = (C, K) => { + let F, Q, le, ae; + const Fe = C.window; for (; ; ) { - if (C.lookahead <= Jt) { - if (rr(C), C.lookahead <= Jt && j === Xe) - return rt; + if (C.lookahead <= Qt) { + if (rt(C), C.lookahead <= Qt && K === Ye) + return Ht; if (C.lookahead === 0) break; } - if (C.match_length = 0, C.lookahead >= mt && C.strstart > 0 && (oe = C.strstart - 1, Q = ze[oe], Q === ze[++oe] && Q === ze[++oe] && Q === ze[++oe])) { - ae = C.strstart + Jt; + if (C.match_length = 0, C.lookahead >= ft && C.strstart > 0 && (le = C.strstart - 1, Q = Fe[le], Q === Fe[++le] && Q === Fe[++le] && Q === Fe[++le])) { + ae = C.strstart + Qt; do ; - while (Q === ze[++oe] && Q === ze[++oe] && Q === ze[++oe] && Q === ze[++oe] && Q === ze[++oe] && Q === ze[++oe] && Q === ze[++oe] && Q === ze[++oe] && oe < ae); - C.match_length = Jt - (ae - oe), C.match_length > C.lookahead && (C.match_length = C.lookahead); + while (Q === Fe[++le] && Q === Fe[++le] && Q === Fe[++le] && Q === Fe[++le] && Q === Fe[++le] && Q === Fe[++le] && Q === Fe[++le] && Q === Fe[++le] && le < ae); + C.match_length = Qt - (ae - le), C.match_length > C.lookahead && (C.match_length = C.lookahead); } - if (C.match_length >= mt ? (F = Ye(C, 1, C.match_length - mt), C.lookahead -= C.match_length, C.strstart += C.match_length, C.match_length = 0) : (F = Ye(C, 0, C.window[C.strstart]), C.lookahead--, C.strstart++), F && (Ct(C, !1), C.strm.avail_out === 0)) - return rt; + if (C.match_length >= ft ? (F = Ze(C, 1, C.match_length - ft), C.lookahead -= C.match_length, C.strstart += C.match_length, C.match_length = 0) : (F = Ze(C, 0, C.window[C.strstart]), C.lookahead--, C.strstart++), F && (Yt(C, !1), C.strm.avail_out === 0)) + return Ht; } - return C.insert = 0, j === lt ? (Ct(C, !0), C.strm.avail_out === 0 ? Vt : qt) : C.sym_next && (Ct(C, !1), C.strm.avail_out === 0) ? rt : Dt; - }, wn = (C, j) => { + return C.insert = 0, K === it ? (Yt(C, !0), C.strm.avail_out === 0 ? lr : _r) : C.sym_next && (Yt(C, !1), C.strm.avail_out === 0) ? Ht : pr; + }, gr = (C, K) => { let F; for (; ; ) { - if (C.lookahead === 0 && (rr(C), C.lookahead === 0)) { - if (j === Xe) - return rt; + if (C.lookahead === 0 && (rt(C), C.lookahead === 0)) { + if (K === Ye) + return Ht; break; } - if (C.match_length = 0, F = Ye(C, 0, C.window[C.strstart]), C.lookahead--, C.strstart++, F && (Ct(C, !1), C.strm.avail_out === 0)) - return rt; + if (C.match_length = 0, F = Ze(C, 0, C.window[C.strstart]), C.lookahead--, C.strstart++, F && (Yt(C, !1), C.strm.avail_out === 0)) + return Ht; } - return C.insert = 0, j === lt ? (Ct(C, !0), C.strm.avail_out === 0 ? Vt : qt) : C.sym_next && (Ct(C, !1), C.strm.avail_out === 0) ? rt : Dt; + return C.insert = 0, K === it ? (Yt(C, !0), C.strm.avail_out === 0 ? lr : _r) : C.sym_next && (Yt(C, !1), C.strm.avail_out === 0) ? Ht : pr; }; - function er(C, j, F, Q, oe) { - this.good_length = C, this.max_lazy = j, this.nice_length = F, this.max_chain = Q, this.func = oe; + function Vt(C, K, F, Q, le) { + this.good_length = C, this.max_lazy = K, this.nice_length = F, this.max_chain = Q, this.func = le; } - const kr = [ + const Xt = [ /* good lazy nice chain */ - new er(0, 0, 0, 0, Tr), + new Vt(0, 0, 0, 0, Lt), /* 0 store only */ - new er(4, 4, 8, 4, or), + new Vt(4, 4, 8, 4, cr), /* 1 max speed, no lazy matches */ - new er(4, 5, 16, 8, or), + new Vt(4, 5, 16, 8, cr), /* 2 */ - new er(4, 6, 32, 32, or), + new Vt(4, 6, 32, 32, cr), /* 3 */ - new er(4, 4, 16, 16, yr), + new Vt(4, 4, 16, 16, Jt), /* 4 lazy matches */ - new er(8, 16, 32, 32, yr), + new Vt(8, 16, 32, 32, Jt), /* 5 */ - new er(8, 16, 128, 128, yr), + new Vt(8, 16, 128, 128, Jt), /* 6 */ - new er(8, 32, 128, 256, yr), + new Vt(8, 32, 128, 256, Jt), /* 7 */ - new er(32, 128, 258, 1024, yr), + new Vt(32, 128, 258, 1024, Jt), /* 8 */ - new er(32, 258, 258, 4096, yr) + new Vt(32, 258, 258, 4096, Jt) /* 9 max compression */ - ], En = (C) => { - C.window_size = 2 * C.w_size, jt(C.head), C.max_lazy_match = kr[C.level].max_lazy, C.good_match = kr[C.level].good_length, C.nice_match = kr[C.level].nice_length, C.max_chain_length = kr[C.level].max_chain, C.strstart = 0, C.block_start = 0, C.lookahead = 0, C.insert = 0, C.match_length = C.prev_length = mt - 1, C.match_available = 0, C.ins_h = 0; + ], $r = (C) => { + C.window_size = 2 * C.w_size, tr(C.head), C.max_lazy_match = Xt[C.level].max_lazy, C.good_match = Xt[C.level].good_length, C.nice_match = Xt[C.level].nice_length, C.max_chain_length = Xt[C.level].max_chain, C.strstart = 0, C.block_start = 0, C.lookahead = 0, C.insert = 0, C.match_length = C.prev_length = ft - 1, C.match_available = 0, C.ins_h = 0; }; - function Sn() { - this.strm = null, this.status = 0, this.pending_buf = null, this.pending_buf_size = 0, this.pending_out = 0, this.pending = 0, this.wrap = 0, this.gzhead = null, this.gzindex = 0, this.method = Ze, this.last_flush = -1, this.w_size = 0, this.w_bits = 0, this.w_mask = 0, this.window = null, this.window_size = 0, this.prev = null, this.head = null, this.ins_h = 0, this.hash_size = 0, this.hash_bits = 0, this.hash_mask = 0, this.hash_shift = 0, this.block_start = 0, this.match_length = 0, this.prev_match = 0, this.match_available = 0, this.strstart = 0, this.match_start = 0, this.lookahead = 0, this.prev_length = 0, this.max_chain_length = 0, this.max_lazy_match = 0, this.level = 0, this.strategy = 0, this.good_match = 0, this.nice_match = 0, this.dyn_ltree = new Uint16Array(pr * 2), this.dyn_dtree = new Uint16Array((2 * Pt + 1) * 2), this.bl_tree = new Uint16Array((2 * mr + 1) * 2), jt(this.dyn_ltree), jt(this.dyn_dtree), jt(this.bl_tree), this.l_desc = null, this.d_desc = null, this.bl_desc = null, this.bl_count = new Uint16Array(qr + 1), this.heap = new Uint16Array(2 * Zt + 1), jt(this.heap), this.heap_len = 0, this.heap_max = 0, this.depth = new Uint16Array(2 * Zt + 1), jt(this.depth), this.sym_buf = 0, this.lit_bufsize = 0, this.sym_next = 0, this.sym_end = 0, this.opt_len = 0, this.static_len = 0, this.matches = 0, this.insert = 0, this.bi_buf = 0, this.bi_valid = 0; + function Tr() { + this.strm = null, this.status = 0, this.pending_buf = null, this.pending_buf_size = 0, this.pending_out = 0, this.pending = 0, this.wrap = 0, this.gzhead = null, this.gzindex = 0, this.method = Qe, this.last_flush = -1, this.w_size = 0, this.w_bits = 0, this.w_mask = 0, this.window = null, this.window_size = 0, this.prev = null, this.head = null, this.ins_h = 0, this.hash_size = 0, this.hash_bits = 0, this.hash_mask = 0, this.hash_shift = 0, this.block_start = 0, this.match_length = 0, this.prev_match = 0, this.match_available = 0, this.strstart = 0, this.match_start = 0, this.lookahead = 0, this.prev_length = 0, this.max_chain_length = 0, this.max_lazy_match = 0, this.level = 0, this.strategy = 0, this.good_match = 0, this.nice_match = 0, this.dyn_ltree = new Uint16Array(nr * 2), this.dyn_dtree = new Uint16Array((2 * Tt + 1) * 2), this.bl_tree = new Uint16Array((2 * mr + 1) * 2), tr(this.dyn_ltree), tr(this.dyn_dtree), tr(this.bl_tree), this.l_desc = null, this.d_desc = null, this.bl_desc = null, this.bl_count = new Uint16Array(Or + 1), this.heap = new Uint16Array(2 * Zt + 1), tr(this.heap), this.heap_len = 0, this.heap_max = 0, this.depth = new Uint16Array(2 * Zt + 1), tr(this.depth), this.sym_buf = 0, this.lit_bufsize = 0, this.sym_next = 0, this.sym_end = 0, this.opt_len = 0, this.static_len = 0, this.matches = 0, this.insert = 0, this.bi_buf = 0, this.bi_valid = 0; } - const Lr = (C) => { + const ir = (C) => { if (!C) return 1; - const j = C.state; - return !j || j.strm !== C || j.status !== sr && //#ifdef GZIP - j.status !== Er && //#endif - j.status !== Sr && j.status !== Ar && j.status !== Mr && j.status !== Dr && j.status !== tr && j.status !== $t ? 1 : 0; - }, di = (C) => { - if (Lr(C)) - return Ht(C, _t); - C.total_in = C.total_out = 0, C.data_type = He; - const j = C.state; - return j.pending = 0, j.pending_out = 0, j.wrap < 0 && (j.wrap = -j.wrap), j.status = //#ifdef GZIP - j.wrap === 2 ? Er : ( + const K = C.state; + return !K || K.strm !== C || K.status !== ar && //#ifdef GZIP + K.status !== zr && //#endif + K.status !== Ir && K.status !== Br && K.status !== Dr && K.status !== Rr && K.status !== sr && K.status !== vr ? 1 : 0; + }, xr = (C) => { + if (ir(C)) + return or(C, ut); + C.total_in = C.total_out = 0, C.data_type = Ke; + const K = C.state; + return K.pending = 0, K.pending_out = 0, K.wrap < 0 && (K.wrap = -K.wrap), K.status = //#ifdef GZIP + K.wrap === 2 ? zr : ( //#endif - j.wrap ? sr : tr - ), C.adler = j.wrap === 2 ? 0 : 1, j.last_flush = -2, Z(j), st; - }, fi = (C) => { - const j = di(C); - return j === st && En(C.state), j; - }, An = (C, j) => Lr(C) || C.state.wrap !== 2 ? _t : (C.state.gzhead = j, st), mi = (C, j, F, Q, oe, ae) => { + K.wrap ? ar : sr + ), C.adler = K.wrap === 2 ? 0 : 1, K.last_flush = -2, q(K), nt; + }, wr = (C) => { + const K = xr(C); + return K === nt && $r(C.state), K; + }, jt = (C, K) => ir(C) || C.state.wrap !== 2 ? ut : (C.state.gzhead = K, nt), er = (C, K, F, Q, le, ae) => { if (!C) - return _t; - let ze = 1; - if (j === ft && (j = 6), Q < 0 ? (ze = 0, Q = -Q) : Q > 15 && (ze = 2, Q -= 16), oe < 1 || oe > yt || F !== Ze || Q < 8 || Q > 15 || j < 0 || j > 9 || ae < 0 || ae > Qe || Q === 8 && ze !== 1) - return Ht(C, _t); + return ut; + let Fe = 1; + if (K === wt && (K = 6), Q < 0 ? (Fe = 0, Q = -Q) : Q > 15 && (Fe = 2, Q -= 16), le < 1 || le > _t || F !== Qe || Q < 8 || Q > 15 || K < 0 || K > 9 || ae < 0 || ae > qe || Q === 8 && Fe !== 1) + return or(C, ut); Q === 8 && (Q = 9); - const De = new Sn(); - return C.state = De, De.strm = C, De.status = sr, De.wrap = ze, De.gzhead = null, De.w_bits = Q, De.w_size = 1 << De.w_bits, De.w_mask = De.w_size - 1, De.hash_bits = oe + 7, De.hash_size = 1 << De.hash_bits, De.hash_mask = De.hash_size - 1, De.hash_shift = ~~((De.hash_bits + mt - 1) / mt), De.window = new Uint8Array(De.w_size * 2), De.head = new Uint16Array(De.hash_size), De.prev = new Uint16Array(De.w_size), De.lit_bufsize = 1 << oe + 6, De.pending_buf_size = De.lit_bufsize * 4, De.pending_buf = new Uint8Array(De.pending_buf_size), De.sym_buf = De.lit_bufsize, De.sym_end = (De.lit_bufsize - 1) * 3, De.level = j, De.strategy = ae, De.method = F, fi(C); - }, Mn = (C, j) => mi(C, j, Ze, zt, Ft, xe), Dn = (C, j) => { - if (Lr(C) || j > ot || j < 0) - return C ? Ht(C, _t) : _t; + const Se = new Tr(); + return C.state = Se, Se.strm = C, Se.status = ar, Se.wrap = Fe, Se.gzhead = null, Se.w_bits = Q, Se.w_size = 1 << Se.w_bits, Se.w_mask = Se.w_size - 1, Se.hash_bits = le + 7, Se.hash_size = 1 << Se.hash_bits, Se.hash_mask = Se.hash_size - 1, Se.hash_shift = ~~((Se.hash_bits + ft - 1) / ft), Se.window = new Uint8Array(Se.w_size * 2), Se.head = new Uint16Array(Se.hash_size), Se.prev = new Uint16Array(Se.w_size), Se.lit_bufsize = 1 << le + 6, Se.pending_buf_size = Se.lit_bufsize * 4, Se.pending_buf = new Uint8Array(Se.pending_buf_size), Se.sym_buf = Se.lit_bufsize, Se.sym_end = (Se.lit_bufsize - 1) * 3, Se.level = K, Se.strategy = ae, Se.method = F, wr(C); + }, Xr = (C, K) => er(C, K, Qe, Mt, St, ge), Zr = (C, K) => { + if (ir(C) || K > ot || K < 0) + return C ? or(C, ut) : ut; const F = C.state; - if (!C.output || C.avail_in !== 0 && !C.input || F.status === $t && j !== lt) - return Ht(C, C.avail_out === 0 ? Gt : _t); + if (!C.output || C.avail_in !== 0 && !C.input || F.status === vr && K !== it) + return or(C, C.avail_out === 0 ? Ut : ut); const Q = F.last_flush; - if (F.last_flush = j, F.pending !== 0) { - if (Ut(C), C.avail_out === 0) - return F.last_flush = -1, st; - } else if (C.avail_in === 0 && Qt(j) <= Qt(Q) && j !== lt) - return Ht(C, Gt); - if (F.status === $t && C.avail_in !== 0) - return Ht(C, Gt); - if (F.status === sr && F.wrap === 0 && (F.status = tr), F.status === sr) { - let oe = Ze + (F.w_bits - 8 << 4) << 8, ae = -1; - if (F.strategy >= gt || F.level < 2 ? ae = 0 : F.level < 6 ? ae = 1 : F.level === 6 ? ae = 2 : ae = 3, oe |= ae << 6, F.strstart !== 0 && (oe |= Qr), oe += 31 - oe % 31, lr(F, oe), F.strstart !== 0 && (lr(F, C.adler >>> 16), lr(F, C.adler & 65535)), C.adler = 1, F.status = tr, Ut(C), F.pending !== 0) - return F.last_flush = -1, st; - } - if (F.status === Er) { - if (C.adler = 0, ut(F, 31), ut(F, 139), ut(F, 8), F.gzhead) - ut( + if (F.last_flush = K, F.pending !== 0) { + if (Kt(C), C.avail_out === 0) + return F.last_flush = -1, nt; + } else if (C.avail_in === 0 && Yr(K) <= Yr(Q) && K !== it) + return or(C, Ut); + if (F.status === vr && C.avail_in !== 0) + return or(C, Ut); + if (F.status === ar && F.wrap === 0 && (F.status = sr), F.status === ar) { + let le = Qe + (F.w_bits - 8 << 4) << 8, ae = -1; + if (F.strategy >= vt || F.level < 2 ? ae = 0 : F.level < 6 ? ae = 1 : F.level === 6 ? ae = 2 : ae = 3, le |= ae << 6, F.strstart !== 0 && (le |= Nt), le += 31 - le % 31, yr(F, le), F.strstart !== 0 && (yr(F, C.adler >>> 16), yr(F, C.adler & 65535)), C.adler = 1, F.status = sr, Kt(C), F.pending !== 0) + return F.last_flush = -1, nt; + } + if (F.status === zr) { + if (C.adler = 0, xt(F, 31), xt(F, 139), xt(F, 8), F.gzhead) + xt( F, (F.gzhead.text ? 1 : 0) + (F.gzhead.hcrc ? 2 : 0) + (F.gzhead.extra ? 4 : 0) + (F.gzhead.name ? 8 : 0) + (F.gzhead.comment ? 16 : 0) - ), ut(F, F.gzhead.time & 255), ut(F, F.gzhead.time >> 8 & 255), ut(F, F.gzhead.time >> 16 & 255), ut(F, F.gzhead.time >> 24 & 255), ut(F, F.level === 9 ? 2 : F.strategy >= gt || F.level < 2 ? 4 : 0), ut(F, F.gzhead.os & 255), F.gzhead.extra && F.gzhead.extra.length && (ut(F, F.gzhead.extra.length & 255), ut(F, F.gzhead.extra.length >> 8 & 255)), F.gzhead.hcrc && (C.adler = I(C.adler, F.pending_buf, F.pending, 0)), F.gzindex = 0, F.status = Sr; - else if (ut(F, 0), ut(F, 0), ut(F, 0), ut(F, 0), ut(F, 0), ut(F, F.level === 9 ? 2 : F.strategy >= gt || F.level < 2 ? 4 : 0), ut(F, _r), F.status = tr, Ut(C), F.pending !== 0) - return F.last_flush = -1, st; + ), xt(F, F.gzhead.time & 255), xt(F, F.gzhead.time >> 8 & 255), xt(F, F.gzhead.time >> 16 & 255), xt(F, F.gzhead.time >> 24 & 255), xt(F, F.level === 9 ? 2 : F.strategy >= vt || F.level < 2 ? 4 : 0), xt(F, F.gzhead.os & 255), F.gzhead.extra && F.gzhead.extra.length && (xt(F, F.gzhead.extra.length & 255), xt(F, F.gzhead.extra.length >> 8 & 255)), F.gzhead.hcrc && (C.adler = I(C.adler, F.pending_buf, F.pending, 0)), F.gzindex = 0, F.status = Ir; + else if (xt(F, 0), xt(F, 0), xt(F, 0), xt(F, 0), xt(F, 0), xt(F, F.level === 9 ? 2 : F.strategy >= vt || F.level < 2 ? 4 : 0), xt(F, hi), F.status = sr, Kt(C), F.pending !== 0) + return F.last_flush = -1, nt; } - if (F.status === Sr) { + if (F.status === Ir) { if (F.gzhead.extra) { - let oe = F.pending, ae = (F.gzhead.extra.length & 65535) - F.gzindex; + let le = F.pending, ae = (F.gzhead.extra.length & 65535) - F.gzindex; for (; F.pending + ae > F.pending_buf_size; ) { - let De = F.pending_buf_size - F.pending; - if (F.pending_buf.set(F.gzhead.extra.subarray(F.gzindex, F.gzindex + De), F.pending), F.pending = F.pending_buf_size, F.gzhead.hcrc && F.pending > oe && (C.adler = I(C.adler, F.pending_buf, F.pending - oe, oe)), F.gzindex += De, Ut(C), F.pending !== 0) - return F.last_flush = -1, st; - oe = 0, ae -= De; + let Se = F.pending_buf_size - F.pending; + if (F.pending_buf.set(F.gzhead.extra.subarray(F.gzindex, F.gzindex + Se), F.pending), F.pending = F.pending_buf_size, F.gzhead.hcrc && F.pending > le && (C.adler = I(C.adler, F.pending_buf, F.pending - le, le)), F.gzindex += Se, Kt(C), F.pending !== 0) + return F.last_flush = -1, nt; + le = 0, ae -= Se; } - let ze = new Uint8Array(F.gzhead.extra); - F.pending_buf.set(ze.subarray(F.gzindex, F.gzindex + ae), F.pending), F.pending += ae, F.gzhead.hcrc && F.pending > oe && (C.adler = I(C.adler, F.pending_buf, F.pending - oe, oe)), F.gzindex = 0; + let Fe = new Uint8Array(F.gzhead.extra); + F.pending_buf.set(Fe.subarray(F.gzindex, F.gzindex + ae), F.pending), F.pending += ae, F.gzhead.hcrc && F.pending > le && (C.adler = I(C.adler, F.pending_buf, F.pending - le, le)), F.gzindex = 0; } - F.status = Ar; + F.status = Br; } - if (F.status === Ar) { + if (F.status === Br) { if (F.gzhead.name) { - let oe = F.pending, ae; + let le = F.pending, ae; do { if (F.pending === F.pending_buf_size) { - if (F.gzhead.hcrc && F.pending > oe && (C.adler = I(C.adler, F.pending_buf, F.pending - oe, oe)), Ut(C), F.pending !== 0) - return F.last_flush = -1, st; - oe = 0; + if (F.gzhead.hcrc && F.pending > le && (C.adler = I(C.adler, F.pending_buf, F.pending - le, le)), Kt(C), F.pending !== 0) + return F.last_flush = -1, nt; + le = 0; } - F.gzindex < F.gzhead.name.length ? ae = F.gzhead.name.charCodeAt(F.gzindex++) & 255 : ae = 0, ut(F, ae); + F.gzindex < F.gzhead.name.length ? ae = F.gzhead.name.charCodeAt(F.gzindex++) & 255 : ae = 0, xt(F, ae); } while (ae !== 0); - F.gzhead.hcrc && F.pending > oe && (C.adler = I(C.adler, F.pending_buf, F.pending - oe, oe)), F.gzindex = 0; + F.gzhead.hcrc && F.pending > le && (C.adler = I(C.adler, F.pending_buf, F.pending - le, le)), F.gzindex = 0; } - F.status = Mr; + F.status = Dr; } - if (F.status === Mr) { + if (F.status === Dr) { if (F.gzhead.comment) { - let oe = F.pending, ae; + let le = F.pending, ae; do { if (F.pending === F.pending_buf_size) { - if (F.gzhead.hcrc && F.pending > oe && (C.adler = I(C.adler, F.pending_buf, F.pending - oe, oe)), Ut(C), F.pending !== 0) - return F.last_flush = -1, st; - oe = 0; + if (F.gzhead.hcrc && F.pending > le && (C.adler = I(C.adler, F.pending_buf, F.pending - le, le)), Kt(C), F.pending !== 0) + return F.last_flush = -1, nt; + le = 0; } - F.gzindex < F.gzhead.comment.length ? ae = F.gzhead.comment.charCodeAt(F.gzindex++) & 255 : ae = 0, ut(F, ae); + F.gzindex < F.gzhead.comment.length ? ae = F.gzhead.comment.charCodeAt(F.gzindex++) & 255 : ae = 0, xt(F, ae); } while (ae !== 0); - F.gzhead.hcrc && F.pending > oe && (C.adler = I(C.adler, F.pending_buf, F.pending - oe, oe)); + F.gzhead.hcrc && F.pending > le && (C.adler = I(C.adler, F.pending_buf, F.pending - le, le)); } - F.status = Dr; + F.status = Rr; } - if (F.status === Dr) { + if (F.status === Rr) { if (F.gzhead.hcrc) { - if (F.pending + 2 > F.pending_buf_size && (Ut(C), F.pending !== 0)) - return F.last_flush = -1, st; - ut(F, C.adler & 255), ut(F, C.adler >> 8 & 255), C.adler = 0; - } - if (F.status = tr, Ut(C), F.pending !== 0) - return F.last_flush = -1, st; - } - if (C.avail_in !== 0 || F.lookahead !== 0 || j !== Xe && F.status !== $t) { - let oe = F.level === 0 ? Tr(F, j) : F.strategy === gt ? wn(F, j) : F.strategy === Rt ? xn(F, j) : kr[F.level].func(F, j); - if ((oe === Vt || oe === qt) && (F.status = $t), oe === rt || oe === Vt) - return C.avail_out === 0 && (F.last_flush = -1), st; - if (oe === Dt && (j === at ? qe(F) : j !== ot && (de(F, 0, 0, !1), j === dt && (jt(F.head), F.lookahead === 0 && (F.strstart = 0, F.block_start = 0, F.insert = 0))), Ut(C), C.avail_out === 0)) - return F.last_flush = -1, st; - } - return j !== lt ? st : F.wrap <= 0 ? bt : (F.wrap === 2 ? (ut(F, C.adler & 255), ut(F, C.adler >> 8 & 255), ut(F, C.adler >> 16 & 255), ut(F, C.adler >> 24 & 255), ut(F, C.total_in & 255), ut(F, C.total_in >> 8 & 255), ut(F, C.total_in >> 16 & 255), ut(F, C.total_in >> 24 & 255)) : (lr(F, C.adler >>> 16), lr(F, C.adler & 65535)), Ut(C), F.wrap > 0 && (F.wrap = -F.wrap), F.pending !== 0 ? st : bt); - }, Cn = (C) => { - if (Lr(C)) - return _t; - const j = C.state.status; - return C.state = null, j === tr ? Ht(C, Lt) : st; - }, $n = (C, j) => { - let F = j.length; - if (Lr(C)) - return _t; - const Q = C.state, oe = Q.wrap; - if (oe === 2 || oe === 1 && Q.status !== sr || Q.lookahead) - return _t; - if (oe === 1 && (C.adler = ke(C.adler, j, F, 0)), Q.wrap = 0, F >= Q.w_size) { - oe === 0 && (jt(Q.head), Q.strstart = 0, Q.block_start = 0, Q.insert = 0); + if (F.pending + 2 > F.pending_buf_size && (Kt(C), F.pending !== 0)) + return F.last_flush = -1, nt; + xt(F, C.adler & 255), xt(F, C.adler >> 8 & 255), C.adler = 0; + } + if (F.status = sr, Kt(C), F.pending !== 0) + return F.last_flush = -1, nt; + } + if (C.avail_in !== 0 || F.lookahead !== 0 || K !== Ye && F.status !== vr) { + let le = F.level === 0 ? Lt(F, K) : F.strategy === vt ? gr(F, K) : F.strategy === Rt ? Cr(F, K) : Xt[F.level].func(F, K); + if ((le === lr || le === _r) && (F.status = vr), le === Ht || le === lr) + return C.avail_out === 0 && (F.last_flush = -1), nt; + if (le === pr && (K === lt ? Xe(F) : K !== ot && (fe(F, 0, 0, !1), K === dt && (tr(F.head), F.lookahead === 0 && (F.strstart = 0, F.block_start = 0, F.insert = 0))), Kt(C), C.avail_out === 0)) + return F.last_flush = -1, nt; + } + return K !== it ? nt : F.wrap <= 0 ? Ct : (F.wrap === 2 ? (xt(F, C.adler & 255), xt(F, C.adler >> 8 & 255), xt(F, C.adler >> 16 & 255), xt(F, C.adler >> 24 & 255), xt(F, C.total_in & 255), xt(F, C.total_in >> 8 & 255), xt(F, C.total_in >> 16 & 255), xt(F, C.total_in >> 24 & 255)) : (yr(F, C.adler >>> 16), yr(F, C.adler & 65535)), Kt(C), F.wrap > 0 && (F.wrap = -F.wrap), F.pending !== 0 ? nt : Ct); + }, qr = (C) => { + if (ir(C)) + return ut; + const K = C.state.status; + return C.state = null, K === sr ? or(C, zt) : nt; + }, Qr = (C, K) => { + let F = K.length; + if (ir(C)) + return ut; + const Q = C.state, le = Q.wrap; + if (le === 2 || le === 1 && Q.status !== ar || Q.lookahead) + return ut; + if (le === 1 && (C.adler = $e(C.adler, K, F, 0)), Q.wrap = 0, F >= Q.w_size) { + le === 0 && (tr(Q.head), Q.strstart = 0, Q.block_start = 0, Q.insert = 0); let tt = new Uint8Array(Q.w_size); - tt.set(j.subarray(F - Q.w_size, F), 0), j = tt, F = Q.w_size; + tt.set(K.subarray(F - Q.w_size, F), 0), K = tt, F = Q.w_size; } - const ae = C.avail_in, ze = C.next_in, De = C.input; - for (C.avail_in = F, C.next_in = 0, C.input = j, rr(Q); Q.lookahead >= mt; ) { - let tt = Q.strstart, be = Q.lookahead - (mt - 1); + const ae = C.avail_in, Fe = C.next_in, Se = C.input; + for (C.avail_in = F, C.next_in = 0, C.input = K, rt(Q); Q.lookahead >= ft; ) { + let tt = Q.strstart, ve = Q.lookahead - (ft - 1); do - Q.ins_h = Kt(Q, Q.ins_h, Q.window[tt + mt - 1]), Q.prev[tt & Q.w_mask] = Q.head[Q.ins_h], Q.head[Q.ins_h] = tt, tt++; - while (--be); - Q.strstart = tt, Q.lookahead = mt - 1, rr(Q); + Q.ins_h = rr(Q, Q.ins_h, Q.window[tt + ft - 1]), Q.prev[tt & Q.w_mask] = Q.head[Q.ins_h], Q.head[Q.ins_h] = tt, tt++; + while (--ve); + Q.strstart = tt, Q.lookahead = ft - 1, rt(Q); } - return Q.strstart += Q.lookahead, Q.block_start = Q.strstart, Q.insert = Q.lookahead, Q.lookahead = 0, Q.match_length = Q.prev_length = mt - 1, Q.match_available = 0, C.next_in = ze, C.input = De, C.avail_in = ae, Q.wrap = oe, st; + return Q.strstart += Q.lookahead, Q.block_start = Q.strstart, Q.insert = Q.lookahead, Q.lookahead = 0, Q.match_length = Q.prev_length = ft - 1, Q.match_available = 0, C.next_in = Fe, C.input = Se, C.avail_in = ae, Q.wrap = le, nt; }; - var Tn = Mn, kn = mi, Ln = fi, Fn = di, On = An, zn = Dn, In = Cn, Bn = $n, Rn = "pako deflate (from Nodeca project)", Fr = { - deflateInit: Tn, - deflateInit2: kn, - deflateReset: Ln, - deflateResetKeep: Fn, + var kr = Xr, Jr = er, ei = wr, Nr = xr, On = jt, zn = Zr, In = qr, Bn = Qr, Rn = "pako deflate (from Nodeca project)", Ur = { + deflateInit: kr, + deflateInit2: Jr, + deflateReset: ei, + deflateResetKeep: Nr, deflateSetHeader: On, deflate: zn, deflateEnd: In, deflateSetDictionary: Bn, deflateInfo: Rn }; - const Pn = (C, j) => Object.prototype.hasOwnProperty.call(C, j); + const Pn = (C, K) => Object.prototype.hasOwnProperty.call(C, K); var Nn = function(C) { - const j = Array.prototype.slice.call(arguments, 1); - for (; j.length; ) { - const F = j.shift(); + const K = Array.prototype.slice.call(arguments, 1); + for (; K.length; ) { + const F = K.shift(); if (F) { if (typeof F != "object") throw new TypeError(F + "must be non-object"); @@ -40141,80 +40141,80 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `; } return C; }, Un = (C) => { - let j = 0; - for (let Q = 0, oe = C.length; Q < oe; Q++) - j += C[Q].length; - const F = new Uint8Array(j); - for (let Q = 0, oe = 0, ae = C.length; Q < ae; Q++) { - let ze = C[Q]; - F.set(ze, oe), oe += ze.length; + let K = 0; + for (let Q = 0, le = C.length; Q < le; Q++) + K += C[Q].length; + const F = new Uint8Array(K); + for (let Q = 0, le = 0, ae = C.length; Q < ae; Q++) { + let Fe = C[Q]; + F.set(Fe, le), le += Fe.length; } return F; - }, Nr = { + }, ti = { assign: Nn, flattenChunks: Un }; - let pi = !0; + let $i = !0; try { String.fromCharCode.apply(null, new Uint8Array(1)); } catch { - pi = !1; + $i = !1; } - const Or = new Uint8Array(256); + const Wr = new Uint8Array(256); for (let C = 0; C < 256; C++) - Or[C] = C >= 252 ? 6 : C >= 248 ? 5 : C >= 240 ? 4 : C >= 224 ? 3 : C >= 192 ? 2 : 1; - Or[254] = Or[254] = 1; + Wr[C] = C >= 252 ? 6 : C >= 248 ? 5 : C >= 240 ? 4 : C >= 224 ? 3 : C >= 192 ? 2 : 1; + Wr[254] = Wr[254] = 1; var Wn = (C) => { if (typeof TextEncoder == "function" && TextEncoder.prototype.encode) return new TextEncoder().encode(C); - let j, F, Q, oe, ae, ze = C.length, De = 0; - for (oe = 0; oe < ze; oe++) - F = C.charCodeAt(oe), (F & 64512) === 55296 && oe + 1 < ze && (Q = C.charCodeAt(oe + 1), (Q & 64512) === 56320 && (F = 65536 + (F - 55296 << 10) + (Q - 56320), oe++)), De += F < 128 ? 1 : F < 2048 ? 2 : F < 65536 ? 3 : 4; - for (j = new Uint8Array(De), ae = 0, oe = 0; ae < De; oe++) - F = C.charCodeAt(oe), (F & 64512) === 55296 && oe + 1 < ze && (Q = C.charCodeAt(oe + 1), (Q & 64512) === 56320 && (F = 65536 + (F - 55296 << 10) + (Q - 56320), oe++)), F < 128 ? j[ae++] = F : F < 2048 ? (j[ae++] = 192 | F >>> 6, j[ae++] = 128 | F & 63) : F < 65536 ? (j[ae++] = 224 | F >>> 12, j[ae++] = 128 | F >>> 6 & 63, j[ae++] = 128 | F & 63) : (j[ae++] = 240 | F >>> 18, j[ae++] = 128 | F >>> 12 & 63, j[ae++] = 128 | F >>> 6 & 63, j[ae++] = 128 | F & 63); - return j; + let K, F, Q, le, ae, Fe = C.length, Se = 0; + for (le = 0; le < Fe; le++) + F = C.charCodeAt(le), (F & 64512) === 55296 && le + 1 < Fe && (Q = C.charCodeAt(le + 1), (Q & 64512) === 56320 && (F = 65536 + (F - 55296 << 10) + (Q - 56320), le++)), Se += F < 128 ? 1 : F < 2048 ? 2 : F < 65536 ? 3 : 4; + for (K = new Uint8Array(Se), ae = 0, le = 0; ae < Se; le++) + F = C.charCodeAt(le), (F & 64512) === 55296 && le + 1 < Fe && (Q = C.charCodeAt(le + 1), (Q & 64512) === 56320 && (F = 65536 + (F - 55296 << 10) + (Q - 56320), le++)), F < 128 ? K[ae++] = F : F < 2048 ? (K[ae++] = 192 | F >>> 6, K[ae++] = 128 | F & 63) : F < 65536 ? (K[ae++] = 224 | F >>> 12, K[ae++] = 128 | F >>> 6 & 63, K[ae++] = 128 | F & 63) : (K[ae++] = 240 | F >>> 18, K[ae++] = 128 | F >>> 12 & 63, K[ae++] = 128 | F >>> 6 & 63, K[ae++] = 128 | F & 63); + return K; }; - const Gn = (C, j) => { - if (j < 65534 && C.subarray && pi) - return String.fromCharCode.apply(null, C.length === j ? C : C.subarray(0, j)); + const Gn = (C, K) => { + if (K < 65534 && C.subarray && $i) + return String.fromCharCode.apply(null, C.length === K ? C : C.subarray(0, K)); let F = ""; - for (let Q = 0; Q < j; Q++) + for (let Q = 0; Q < K; Q++) F += String.fromCharCode(C[Q]); return F; }; - var Hn = (C, j) => { - const F = j || C.length; + var Hn = (C, K) => { + const F = K || C.length; if (typeof TextDecoder == "function" && TextDecoder.prototype.decode) - return new TextDecoder().decode(C.subarray(0, j)); - let Q, oe; + return new TextDecoder().decode(C.subarray(0, K)); + let Q, le; const ae = new Array(F * 2); - for (oe = 0, Q = 0; Q < F; ) { - let ze = C[Q++]; - if (ze < 128) { - ae[oe++] = ze; + for (le = 0, Q = 0; Q < F; ) { + let Fe = C[Q++]; + if (Fe < 128) { + ae[le++] = Fe; continue; } - let De = Or[ze]; - if (De > 4) { - ae[oe++] = 65533, Q += De - 1; + let Se = Wr[Fe]; + if (Se > 4) { + ae[le++] = 65533, Q += Se - 1; continue; } - for (ze &= De === 2 ? 31 : De === 3 ? 15 : 7; De > 1 && Q < F; ) - ze = ze << 6 | C[Q++] & 63, De--; - if (De > 1) { - ae[oe++] = 65533; + for (Fe &= Se === 2 ? 31 : Se === 3 ? 15 : 7; Se > 1 && Q < F; ) + Fe = Fe << 6 | C[Q++] & 63, Se--; + if (Se > 1) { + ae[le++] = 65533; continue; } - ze < 65536 ? ae[oe++] = ze : (ze -= 65536, ae[oe++] = 55296 | ze >> 10 & 1023, ae[oe++] = 56320 | ze & 1023); + Fe < 65536 ? ae[le++] = Fe : (Fe -= 65536, ae[le++] = 55296 | Fe >> 10 & 1023, ae[le++] = 56320 | Fe & 1023); } - return Gn(ae, oe); - }, Vn = (C, j) => { - j = j || C.length, j > C.length && (j = C.length); - let F = j - 1; + return Gn(ae, le); + }, Vn = (C, K) => { + K = K || C.length, K > C.length && (K = C.length); + let F = K - 1; for (; F >= 0 && (C[F] & 192) === 128; ) F--; - return F < 0 || F === 0 ? j : F + Or[C[F]] > j ? F : j; - }, zr = { + return F < 0 || F === 0 ? K : F + Wr[C[F]] > K ? F : K; + }, Gr = { string2buf: Wn, buf2string: Hn, utf8border: Vn @@ -40222,20 +40222,20 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `; function jn() { this.input = null, this.next_in = 0, this.avail_in = 0, this.total_in = 0, this.output = null, this.next_out = 0, this.avail_out = 0, this.total_out = 0, this.msg = "", this.state = null, this.data_type = 2, this.adler = 0; } - var gi = jn; - const vi = Object.prototype.toString, { + var Ti = jn; + const ki = Object.prototype.toString, { Z_NO_FLUSH: Kn, - Z_SYNC_FLUSH: Xn, - Z_FULL_FLUSH: Yn, + Z_SYNC_FLUSH: Yn, + Z_FULL_FLUSH: Xn, Z_FINISH: Zn, - Z_OK: Ur, + Z_OK: ri, Z_STREAM_END: qn, Z_DEFAULT_COMPRESSION: Qn, Z_DEFAULT_STRATEGY: Jn, Z_DEFLATED: ea - } = ve; - function Ir(C) { - this.options = Nr.assign({ + } = be; + function Hr(C) { + this.options = ti.assign({ level: Qn, method: ea, chunkSize: 16384, @@ -40243,37 +40243,37 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `; memLevel: 8, strategy: Jn }, C || {}); - let j = this.options; - j.raw && j.windowBits > 0 ? j.windowBits = -j.windowBits : j.gzip && j.windowBits > 0 && j.windowBits < 16 && (j.windowBits += 16), this.err = 0, this.msg = "", this.ended = !1, this.chunks = [], this.strm = new gi(), this.strm.avail_out = 0; - let F = Fr.deflateInit2( + let K = this.options; + K.raw && K.windowBits > 0 ? K.windowBits = -K.windowBits : K.gzip && K.windowBits > 0 && K.windowBits < 16 && (K.windowBits += 16), this.err = 0, this.msg = "", this.ended = !1, this.chunks = [], this.strm = new Ti(), this.strm.avail_out = 0; + let F = Ur.deflateInit2( this.strm, - j.level, - j.method, - j.windowBits, - j.memLevel, - j.strategy + K.level, + K.method, + K.windowBits, + K.memLevel, + K.strategy ); - if (F !== Ur) - throw new Error(ye[F]); - if (j.header && Fr.deflateSetHeader(this.strm, j.header), j.dictionary) { + if (F !== ri) + throw new Error(xe[F]); + if (K.header && Ur.deflateSetHeader(this.strm, K.header), K.dictionary) { let Q; - if (typeof j.dictionary == "string" ? Q = zr.string2buf(j.dictionary) : vi.call(j.dictionary) === "[object ArrayBuffer]" ? Q = new Uint8Array(j.dictionary) : Q = j.dictionary, F = Fr.deflateSetDictionary(this.strm, Q), F !== Ur) - throw new Error(ye[F]); + if (typeof K.dictionary == "string" ? Q = Gr.string2buf(K.dictionary) : ki.call(K.dictionary) === "[object ArrayBuffer]" ? Q = new Uint8Array(K.dictionary) : Q = K.dictionary, F = Ur.deflateSetDictionary(this.strm, Q), F !== ri) + throw new Error(xe[F]); this._dict_set = !0; } } - Ir.prototype.push = function(C, j) { + Hr.prototype.push = function(C, K) { const F = this.strm, Q = this.options.chunkSize; - let oe, ae; + let le, ae; if (this.ended) return !1; - for (j === ~~j ? ae = j : ae = j === !0 ? Zn : Kn, typeof C == "string" ? F.input = zr.string2buf(C) : vi.call(C) === "[object ArrayBuffer]" ? F.input = new Uint8Array(C) : F.input = C, F.next_in = 0, F.avail_in = F.input.length; ; ) { - if (F.avail_out === 0 && (F.output = new Uint8Array(Q), F.next_out = 0, F.avail_out = Q), (ae === Xn || ae === Yn) && F.avail_out <= 6) { + for (K === ~~K ? ae = K : ae = K === !0 ? Zn : Kn, typeof C == "string" ? F.input = Gr.string2buf(C) : ki.call(C) === "[object ArrayBuffer]" ? F.input = new Uint8Array(C) : F.input = C, F.next_in = 0, F.avail_in = F.input.length; ; ) { + if (F.avail_out === 0 && (F.output = new Uint8Array(Q), F.next_out = 0, F.avail_out = Q), (ae === Yn || ae === Xn) && F.avail_out <= 6) { this.onData(F.output.subarray(0, F.next_out)), F.avail_out = 0; continue; } - if (oe = Fr.deflate(F, ae), oe === qn) - return F.next_out > 0 && this.onData(F.output.subarray(0, F.next_out)), oe = Fr.deflateEnd(this.strm), this.onEnd(oe), this.ended = !0, oe === Ur; + if (le = Ur.deflate(F, ae), le === qn) + return F.next_out > 0 && this.onData(F.output.subarray(0, F.next_out)), le = Ur.deflateEnd(this.strm), this.onEnd(le), this.ended = !0, le === ri; if (F.avail_out === 0) { this.onData(F.output); continue; @@ -40285,122 +40285,122 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `; if (F.avail_in === 0) break; } return !0; - }, Ir.prototype.onData = function(C) { + }, Hr.prototype.onData = function(C) { this.chunks.push(C); - }, Ir.prototype.onEnd = function(C) { - C === Ur && (this.result = Nr.flattenChunks(this.chunks)), this.chunks = [], this.err = C, this.msg = this.strm.msg; + }, Hr.prototype.onEnd = function(C) { + C === ri && (this.result = ti.flattenChunks(this.chunks)), this.chunks = [], this.err = C, this.msg = this.strm.msg; }; - function Jr(C, j) { - const F = new Ir(j); + function mi(C, K) { + const F = new Hr(K); if (F.push(C, !0), F.err) - throw F.msg || ye[F.err]; + throw F.msg || xe[F.err]; return F.result; } - function ta(C, j) { - return j = j || {}, j.raw = !0, Jr(C, j); + function ta(C, K) { + return K = K || {}, K.raw = !0, mi(C, K); } - function ra(C, j) { - return j = j || {}, j.gzip = !0, Jr(C, j); + function ra(C, K) { + return K = K || {}, K.gzip = !0, mi(C, K); } - var ia = Ir, na = Jr, aa = ta, sa = ra, la = ve, oa = { + var ia = Hr, na = mi, aa = ta, sa = ra, la = be, oa = { Deflate: ia, deflate: na, deflateRaw: aa, gzip: sa, constants: la }; - const Wr = 16209, ca = 16191; - var ua = function(j, F) { - let Q, oe, ae, ze, De, tt, be, Ie, St, et, Ve, it, It, xt, ht, Mt, pt, Je, At, Wt, nt, Tt, wt, ct; - const vt = j.state; - Q = j.next_in, wt = j.input, oe = Q + (j.avail_in - 5), ae = j.next_out, ct = j.output, ze = ae - (F - j.avail_out), De = ae + (j.avail_out - 257), tt = vt.dmax, be = vt.wsize, Ie = vt.whave, St = vt.wnext, et = vt.window, Ve = vt.hold, it = vt.bits, It = vt.lencode, xt = vt.distcode, ht = (1 << vt.lenbits) - 1, Mt = (1 << vt.distbits) - 1; + const ii = 16209, ca = 16191; + var da = function(K, F) { + let Q, le, ae, Fe, Se, tt, ve, Oe, Et, et, je, at, Bt, bt, ht, Dt, pt, Je, At, Wt, st, $t, yt, ct; + const gt = K.state; + Q = K.next_in, yt = K.input, le = Q + (K.avail_in - 5), ae = K.next_out, ct = K.output, Fe = ae - (F - K.avail_out), Se = ae + (K.avail_out - 257), tt = gt.dmax, ve = gt.wsize, Oe = gt.whave, Et = gt.wnext, et = gt.window, je = gt.hold, at = gt.bits, Bt = gt.lencode, bt = gt.distcode, ht = (1 << gt.lenbits) - 1, Dt = (1 << gt.distbits) - 1; e: do { - it < 15 && (Ve += wt[Q++] << it, it += 8, Ve += wt[Q++] << it, it += 8), pt = It[Ve & ht]; + at < 15 && (je += yt[Q++] << at, at += 8, je += yt[Q++] << at, at += 8), pt = Bt[je & ht]; t: for (; ; ) { - if (Je = pt >>> 24, Ve >>>= Je, it -= Je, Je = pt >>> 16 & 255, Je === 0) + if (Je = pt >>> 24, je >>>= Je, at -= Je, Je = pt >>> 16 & 255, Je === 0) ct[ae++] = pt & 65535; else if (Je & 16) { - At = pt & 65535, Je &= 15, Je && (it < Je && (Ve += wt[Q++] << it, it += 8), At += Ve & (1 << Je) - 1, Ve >>>= Je, it -= Je), it < 15 && (Ve += wt[Q++] << it, it += 8, Ve += wt[Q++] << it, it += 8), pt = xt[Ve & Mt]; + At = pt & 65535, Je &= 15, Je && (at < Je && (je += yt[Q++] << at, at += 8), At += je & (1 << Je) - 1, je >>>= Je, at -= Je), at < 15 && (je += yt[Q++] << at, at += 8, je += yt[Q++] << at, at += 8), pt = bt[je & Dt]; r: for (; ; ) { - if (Je = pt >>> 24, Ve >>>= Je, it -= Je, Je = pt >>> 16 & 255, Je & 16) { - if (Wt = pt & 65535, Je &= 15, it < Je && (Ve += wt[Q++] << it, it += 8, it < Je && (Ve += wt[Q++] << it, it += 8)), Wt += Ve & (1 << Je) - 1, Wt > tt) { - j.msg = "invalid distance too far back", vt.mode = Wr; + if (Je = pt >>> 24, je >>>= Je, at -= Je, Je = pt >>> 16 & 255, Je & 16) { + if (Wt = pt & 65535, Je &= 15, at < Je && (je += yt[Q++] << at, at += 8, at < Je && (je += yt[Q++] << at, at += 8)), Wt += je & (1 << Je) - 1, Wt > tt) { + K.msg = "invalid distance too far back", gt.mode = ii; break e; } - if (Ve >>>= Je, it -= Je, Je = ae - ze, Wt > Je) { - if (Je = Wt - Je, Je > Ie && vt.sane) { - j.msg = "invalid distance too far back", vt.mode = Wr; + if (je >>>= Je, at -= Je, Je = ae - Fe, Wt > Je) { + if (Je = Wt - Je, Je > Oe && gt.sane) { + K.msg = "invalid distance too far back", gt.mode = ii; break e; } - if (nt = 0, Tt = et, St === 0) { - if (nt += be - Je, Je < At) { + if (st = 0, $t = et, Et === 0) { + if (st += ve - Je, Je < At) { At -= Je; do - ct[ae++] = et[nt++]; + ct[ae++] = et[st++]; while (--Je); - nt = ae - Wt, Tt = ct; + st = ae - Wt, $t = ct; } - } else if (St < Je) { - if (nt += be + St - Je, Je -= St, Je < At) { + } else if (Et < Je) { + if (st += ve + Et - Je, Je -= Et, Je < At) { At -= Je; do - ct[ae++] = et[nt++]; + ct[ae++] = et[st++]; while (--Je); - if (nt = 0, St < At) { - Je = St, At -= Je; + if (st = 0, Et < At) { + Je = Et, At -= Je; do - ct[ae++] = et[nt++]; + ct[ae++] = et[st++]; while (--Je); - nt = ae - Wt, Tt = ct; + st = ae - Wt, $t = ct; } } - } else if (nt += St - Je, Je < At) { + } else if (st += Et - Je, Je < At) { At -= Je; do - ct[ae++] = et[nt++]; + ct[ae++] = et[st++]; while (--Je); - nt = ae - Wt, Tt = ct; + st = ae - Wt, $t = ct; } for (; At > 2; ) - ct[ae++] = Tt[nt++], ct[ae++] = Tt[nt++], ct[ae++] = Tt[nt++], At -= 3; - At && (ct[ae++] = Tt[nt++], At > 1 && (ct[ae++] = Tt[nt++])); + ct[ae++] = $t[st++], ct[ae++] = $t[st++], ct[ae++] = $t[st++], At -= 3; + At && (ct[ae++] = $t[st++], At > 1 && (ct[ae++] = $t[st++])); } else { - nt = ae - Wt; + st = ae - Wt; do - ct[ae++] = ct[nt++], ct[ae++] = ct[nt++], ct[ae++] = ct[nt++], At -= 3; + ct[ae++] = ct[st++], ct[ae++] = ct[st++], ct[ae++] = ct[st++], At -= 3; while (At > 2); - At && (ct[ae++] = ct[nt++], At > 1 && (ct[ae++] = ct[nt++])); + At && (ct[ae++] = ct[st++], At > 1 && (ct[ae++] = ct[st++])); } } else if (Je & 64) { - j.msg = "invalid distance code", vt.mode = Wr; + K.msg = "invalid distance code", gt.mode = ii; break e; } else { - pt = xt[(pt & 65535) + (Ve & (1 << Je) - 1)]; + pt = bt[(pt & 65535) + (je & (1 << Je) - 1)]; continue r; } break; } } else if (Je & 64) if (Je & 32) { - vt.mode = ca; + gt.mode = ca; break e; } else { - j.msg = "invalid literal/length code", vt.mode = Wr; + K.msg = "invalid literal/length code", gt.mode = ii; break e; } else { - pt = It[(pt & 65535) + (Ve & (1 << Je) - 1)]; + pt = Bt[(pt & 65535) + (je & (1 << Je) - 1)]; continue t; } break; } - } while (Q < oe && ae < De); - At = it >> 3, Q -= At, it -= At << 3, Ve &= (1 << it) - 1, j.next_in = Q, j.next_out = ae, j.avail_in = Q < oe ? 5 + (oe - Q) : 5 - (Q - oe), j.avail_out = ae < De ? 257 + (De - ae) : 257 - (ae - De), vt.hold = Ve, vt.bits = it; + } while (Q < le && ae < Se); + At = at >> 3, Q -= At, at -= At << 3, je &= (1 << at) - 1, K.next_in = Q, K.next_out = ae, K.avail_in = Q < le ? 5 + (le - Q) : 5 - (Q - le), K.avail_out = ae < Se ? 257 + (Se - ae) : 257 - (ae - Se), gt.hold = je, gt.bits = at; }; - const xr = 15, bi = 852, yi = 592, xi = 0, ei = 1, wi = 2, ha = new Uint16Array([ + const Lr = 15, Li = 852, Fi = 592, Oi = 0, pi = 1, zi = 2, ua = new Uint16Array([ /* Length codes 257..285 base */ 3, 4, @@ -40433,7 +40433,7 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `; 258, 0, 0 - ]), da = new Uint8Array([ + ]), ha = new Uint8Array([ /* Length codes 257..285 extra */ 16, 16, @@ -40535,171 +40535,171 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `; 64, 64 ]); - var Br = (C, j, F, Q, oe, ae, ze, De) => { - const tt = De.bits; - let be = 0, Ie = 0, St = 0, et = 0, Ve = 0, it = 0, It = 0, xt = 0, ht = 0, Mt = 0, pt, Je, At, Wt, nt, Tt = null, wt; - const ct = new Uint16Array(xr + 1), vt = new Uint16Array(xr + 1); - let dr = null, gn, Xr, Yr; - for (be = 0; be <= xr; be++) - ct[be] = 0; - for (Ie = 0; Ie < Q; Ie++) - ct[j[F + Ie]]++; - for (Ve = tt, et = xr; et >= 1 && ct[et] === 0; et--) + var Vr = (C, K, F, Q, le, ae, Fe, Se) => { + const tt = Se.bits; + let ve = 0, Oe = 0, Et = 0, et = 0, je = 0, at = 0, Bt = 0, bt = 0, ht = 0, Dt = 0, pt, Je, At, Wt, st, $t = null, yt; + const ct = new Uint16Array(Lr + 1), gt = new Uint16Array(Lr + 1); + let Ar = null, Tn, ci, di; + for (ve = 0; ve <= Lr; ve++) + ct[ve] = 0; + for (Oe = 0; Oe < Q; Oe++) + ct[K[F + Oe]]++; + for (je = tt, et = Lr; et >= 1 && ct[et] === 0; et--) ; - if (Ve > et && (Ve = et), et === 0) - return oe[ae++] = 1 << 24 | 64 << 16 | 0, oe[ae++] = 1 << 24 | 64 << 16 | 0, De.bits = 1, 0; - for (St = 1; St < et && ct[St] === 0; St++) + if (je > et && (je = et), et === 0) + return le[ae++] = 1 << 24 | 64 << 16 | 0, le[ae++] = 1 << 24 | 64 << 16 | 0, Se.bits = 1, 0; + for (Et = 1; Et < et && ct[Et] === 0; Et++) ; - for (Ve < St && (Ve = St), xt = 1, be = 1; be <= xr; be++) - if (xt <<= 1, xt -= ct[be], xt < 0) + for (je < Et && (je = Et), bt = 1, ve = 1; ve <= Lr; ve++) + if (bt <<= 1, bt -= ct[ve], bt < 0) return -1; - if (xt > 0 && (C === xi || et !== 1)) + if (bt > 0 && (C === Oi || et !== 1)) return -1; - for (vt[1] = 0, be = 1; be < xr; be++) - vt[be + 1] = vt[be] + ct[be]; - for (Ie = 0; Ie < Q; Ie++) - j[F + Ie] !== 0 && (ze[vt[j[F + Ie]]++] = Ie); - if (C === xi ? (Tt = dr = ze, wt = 20) : C === ei ? (Tt = ha, dr = da, wt = 257) : (Tt = fa, dr = ma, wt = 0), Mt = 0, Ie = 0, be = St, nt = ae, it = Ve, It = 0, At = -1, ht = 1 << Ve, Wt = ht - 1, C === ei && ht > bi || C === wi && ht > yi) + for (gt[1] = 0, ve = 1; ve < Lr; ve++) + gt[ve + 1] = gt[ve] + ct[ve]; + for (Oe = 0; Oe < Q; Oe++) + K[F + Oe] !== 0 && (Fe[gt[K[F + Oe]]++] = Oe); + if (C === Oi ? ($t = Ar = Fe, yt = 20) : C === pi ? ($t = ua, Ar = ha, yt = 257) : ($t = fa, Ar = ma, yt = 0), Dt = 0, Oe = 0, ve = Et, st = ae, at = je, Bt = 0, At = -1, ht = 1 << je, Wt = ht - 1, C === pi && ht > Li || C === zi && ht > Fi) return 1; for (; ; ) { - gn = be - It, ze[Ie] + 1 < wt ? (Xr = 0, Yr = ze[Ie]) : ze[Ie] >= wt ? (Xr = dr[ze[Ie] - wt], Yr = Tt[ze[Ie] - wt]) : (Xr = 96, Yr = 0), pt = 1 << be - It, Je = 1 << it, St = Je; + Tn = ve - Bt, Fe[Oe] + 1 < yt ? (ci = 0, di = Fe[Oe]) : Fe[Oe] >= yt ? (ci = Ar[Fe[Oe] - yt], di = $t[Fe[Oe] - yt]) : (ci = 96, di = 0), pt = 1 << ve - Bt, Je = 1 << at, Et = Je; do - Je -= pt, oe[nt + (Mt >> It) + Je] = gn << 24 | Xr << 16 | Yr | 0; + Je -= pt, le[st + (Dt >> Bt) + Je] = Tn << 24 | ci << 16 | di | 0; while (Je !== 0); - for (pt = 1 << be - 1; Mt & pt; ) + for (pt = 1 << ve - 1; Dt & pt; ) pt >>= 1; - if (pt !== 0 ? (Mt &= pt - 1, Mt += pt) : Mt = 0, Ie++, --ct[be] === 0) { - if (be === et) + if (pt !== 0 ? (Dt &= pt - 1, Dt += pt) : Dt = 0, Oe++, --ct[ve] === 0) { + if (ve === et) break; - be = j[F + ze[Ie]]; + ve = K[F + Fe[Oe]]; } - if (be > Ve && (Mt & Wt) !== At) { - for (It === 0 && (It = Ve), nt += St, it = be - It, xt = 1 << it; it + It < et && (xt -= ct[it + It], !(xt <= 0)); ) - it++, xt <<= 1; - if (ht += 1 << it, C === ei && ht > bi || C === wi && ht > yi) + if (ve > je && (Dt & Wt) !== At) { + for (Bt === 0 && (Bt = je), st += Et, at = ve - Bt, bt = 1 << at; at + Bt < et && (bt -= ct[at + Bt], !(bt <= 0)); ) + at++, bt <<= 1; + if (ht += 1 << at, C === pi && ht > Li || C === zi && ht > Fi) return 1; - At = Mt & Wt, oe[At] = Ve << 24 | it << 16 | nt - ae | 0; + At = Dt & Wt, le[At] = je << 24 | at << 16 | st - ae | 0; } } - return Mt !== 0 && (oe[nt + Mt] = be - It << 24 | 64 << 16 | 0), De.bits = Ve, 0; + return Dt !== 0 && (le[st + Dt] = ve - Bt << 24 | 64 << 16 | 0), Se.bits = je, 0; }; - const pa = 0, Ei = 1, Si = 2, { - Z_FINISH: Ai, + const pa = 0, Ii = 1, Bi = 2, { + Z_FINISH: Ri, Z_BLOCK: _a, - Z_TREES: Gr, - Z_OK: cr, + Z_TREES: ni, + Z_OK: Er, Z_STREAM_END: ga, Z_NEED_DICT: va, - Z_STREAM_ERROR: Yt, - Z_DATA_ERROR: Mi, - Z_MEM_ERROR: Di, + Z_STREAM_ERROR: qt, + Z_DATA_ERROR: Pi, + Z_MEM_ERROR: Ni, Z_BUF_ERROR: ba, - Z_DEFLATED: Ci - } = ve, Hr = 16180, $i = 16181, Ti = 16182, ki = 16183, Li = 16184, Fi = 16185, Oi = 16186, zi = 16187, Ii = 16188, Bi = 16189, Vr = 16190, ir = 16191, ti = 16192, Ri = 16193, ri = 16194, Pi = 16195, Ni = 16196, Ui = 16197, Wi = 16198, jr = 16199, Kr = 16200, Gi = 16201, Hi = 16202, Vi = 16203, ji = 16204, Ki = 16205, ii = 16206, Xi = 16207, Yi = 16208, Ot = 16209, Zi = 16210, qi = 16211, ya = 852, xa = 592, wa = 15, Qi = (C) => (C >>> 24 & 255) + (C >>> 8 & 65280) + ((C & 65280) << 8) + ((C & 255) << 24); + Z_DEFLATED: Ui + } = be, ai = 16180, Wi = 16181, Gi = 16182, Hi = 16183, Vi = 16184, ji = 16185, Ki = 16186, Yi = 16187, Xi = 16188, Zi = 16189, si = 16190, dr = 16191, gi = 16192, qi = 16193, vi = 16194, Qi = 16195, Ji = 16196, en = 16197, tn = 16198, li = 16199, oi = 16200, rn = 16201, nn = 16202, an = 16203, sn = 16204, ln = 16205, bi = 16206, on = 16207, cn = 16208, Ot = 16209, dn = 16210, un = 16211, ya = 852, xa = 592, wa = 15, hn = (C) => (C >>> 24 & 255) + (C >>> 8 & 65280) + ((C & 65280) << 8) + ((C & 255) << 24); function Ea() { this.strm = null, this.mode = 0, this.last = !1, this.wrap = 0, this.havedict = !1, this.flags = 0, this.dmax = 0, this.check = 0, this.total = 0, this.head = null, this.wbits = 0, this.wsize = 0, this.whave = 0, this.wnext = 0, this.window = null, this.hold = 0, this.bits = 0, this.length = 0, this.offset = 0, this.extra = 0, this.lencode = null, this.distcode = null, this.lenbits = 0, this.distbits = 0, this.ncode = 0, this.nlen = 0, this.ndist = 0, this.have = 0, this.next = null, this.lens = new Uint16Array(320), this.work = new Uint16Array(288), this.lendyn = null, this.distdyn = null, this.sane = 0, this.back = 0, this.was = 0; } - const ur = (C) => { + const Sr = (C) => { if (!C) return 1; - const j = C.state; - return !j || j.strm !== C || j.mode < Hr || j.mode > qi ? 1 : 0; - }, Ji = (C) => { - if (ur(C)) - return Yt; - const j = C.state; - return C.total_in = C.total_out = j.total = 0, C.msg = "", j.wrap && (C.adler = j.wrap & 1), j.mode = Hr, j.last = 0, j.havedict = 0, j.flags = -1, j.dmax = 32768, j.head = null, j.hold = 0, j.bits = 0, j.lencode = j.lendyn = new Int32Array(ya), j.distcode = j.distdyn = new Int32Array(xa), j.sane = 1, j.back = -1, cr; - }, en = (C) => { - if (ur(C)) - return Yt; - const j = C.state; - return j.wsize = 0, j.whave = 0, j.wnext = 0, Ji(C); - }, tn = (C, j) => { + const K = C.state; + return !K || K.strm !== C || K.mode < ai || K.mode > un ? 1 : 0; + }, fn = (C) => { + if (Sr(C)) + return qt; + const K = C.state; + return C.total_in = C.total_out = K.total = 0, C.msg = "", K.wrap && (C.adler = K.wrap & 1), K.mode = ai, K.last = 0, K.havedict = 0, K.flags = -1, K.dmax = 32768, K.head = null, K.hold = 0, K.bits = 0, K.lencode = K.lendyn = new Int32Array(ya), K.distcode = K.distdyn = new Int32Array(xa), K.sane = 1, K.back = -1, Er; + }, mn = (C) => { + if (Sr(C)) + return qt; + const K = C.state; + return K.wsize = 0, K.whave = 0, K.wnext = 0, fn(C); + }, pn = (C, K) => { let F; - if (ur(C)) - return Yt; + if (Sr(C)) + return qt; const Q = C.state; - return j < 0 ? (F = 0, j = -j) : (F = (j >> 4) + 5, j < 48 && (j &= 15)), j && (j < 8 || j > 15) ? Yt : (Q.window !== null && Q.wbits !== j && (Q.window = null), Q.wrap = F, Q.wbits = j, en(C)); - }, rn = (C, j) => { + return K < 0 ? (F = 0, K = -K) : (F = (K >> 4) + 5, K < 48 && (K &= 15)), K && (K < 8 || K > 15) ? qt : (Q.window !== null && Q.wbits !== K && (Q.window = null), Q.wrap = F, Q.wbits = K, mn(C)); + }, _n = (C, K) => { if (!C) - return Yt; + return qt; const F = new Ea(); - C.state = F, F.strm = C, F.window = null, F.mode = Hr; - const Q = tn(C, j); - return Q !== cr && (C.state = null), Q; - }, Sa = (C) => rn(C, wa); - let nn = !0, ni, ai; + C.state = F, F.strm = C, F.window = null, F.mode = ai; + const Q = pn(C, K); + return Q !== Er && (C.state = null), Q; + }, Sa = (C) => _n(C, wa); + let gn = !0, yi, xi; const Aa = (C) => { - if (nn) { - ni = new Int32Array(512), ai = new Int32Array(32); - let j = 0; - for (; j < 144; ) - C.lens[j++] = 8; - for (; j < 256; ) - C.lens[j++] = 9; - for (; j < 280; ) - C.lens[j++] = 7; - for (; j < 288; ) - C.lens[j++] = 8; - for (Br(Ei, C.lens, 0, 288, ni, 0, C.work, { bits: 9 }), j = 0; j < 32; ) - C.lens[j++] = 5; - Br(Si, C.lens, 0, 32, ai, 0, C.work, { bits: 5 }), nn = !1; - } - C.lencode = ni, C.lenbits = 9, C.distcode = ai, C.distbits = 5; - }, an = (C, j, F, Q) => { - let oe; + if (gn) { + yi = new Int32Array(512), xi = new Int32Array(32); + let K = 0; + for (; K < 144; ) + C.lens[K++] = 8; + for (; K < 256; ) + C.lens[K++] = 9; + for (; K < 280; ) + C.lens[K++] = 7; + for (; K < 288; ) + C.lens[K++] = 8; + for (Vr(Ii, C.lens, 0, 288, yi, 0, C.work, { bits: 9 }), K = 0; K < 32; ) + C.lens[K++] = 5; + Vr(Bi, C.lens, 0, 32, xi, 0, C.work, { bits: 5 }), gn = !1; + } + C.lencode = yi, C.lenbits = 9, C.distcode = xi, C.distbits = 5; + }, vn = (C, K, F, Q) => { + let le; const ae = C.state; - return ae.window === null && (ae.wsize = 1 << ae.wbits, ae.wnext = 0, ae.whave = 0, ae.window = new Uint8Array(ae.wsize)), Q >= ae.wsize ? (ae.window.set(j.subarray(F - ae.wsize, F), 0), ae.wnext = 0, ae.whave = ae.wsize) : (oe = ae.wsize - ae.wnext, oe > Q && (oe = Q), ae.window.set(j.subarray(F - Q, F - Q + oe), ae.wnext), Q -= oe, Q ? (ae.window.set(j.subarray(F - Q, F), 0), ae.wnext = Q, ae.whave = ae.wsize) : (ae.wnext += oe, ae.wnext === ae.wsize && (ae.wnext = 0), ae.whave < ae.wsize && (ae.whave += oe))), 0; - }, Ma = (C, j) => { - let F, Q, oe, ae, ze, De, tt, be, Ie, St, et, Ve, it, It, xt = 0, ht, Mt, pt, Je, At, Wt, nt, Tt; - const wt = new Uint8Array(4); - let ct, vt; - const dr = ( + return ae.window === null && (ae.wsize = 1 << ae.wbits, ae.wnext = 0, ae.whave = 0, ae.window = new Uint8Array(ae.wsize)), Q >= ae.wsize ? (ae.window.set(K.subarray(F - ae.wsize, F), 0), ae.wnext = 0, ae.whave = ae.wsize) : (le = ae.wsize - ae.wnext, le > Q && (le = Q), ae.window.set(K.subarray(F - Q, F - Q + le), ae.wnext), Q -= le, Q ? (ae.window.set(K.subarray(F - Q, F), 0), ae.wnext = Q, ae.whave = ae.wsize) : (ae.wnext += le, ae.wnext === ae.wsize && (ae.wnext = 0), ae.whave < ae.wsize && (ae.whave += le))), 0; + }, Ma = (C, K) => { + let F, Q, le, ae, Fe, Se, tt, ve, Oe, Et, et, je, at, Bt, bt = 0, ht, Dt, pt, Je, At, Wt, st, $t; + const yt = new Uint8Array(4); + let ct, gt; + const Ar = ( /* permutation of code lengths */ new Uint8Array([16, 17, 18, 0, 8, 7, 9, 6, 10, 5, 11, 4, 12, 3, 13, 2, 14, 1, 15]) ); - if (ur(C) || !C.output || !C.input && C.avail_in !== 0) - return Yt; - F = C.state, F.mode === ir && (F.mode = ti), ze = C.next_out, oe = C.output, tt = C.avail_out, ae = C.next_in, Q = C.input, De = C.avail_in, be = F.hold, Ie = F.bits, St = De, et = tt, Tt = cr; + if (Sr(C) || !C.output || !C.input && C.avail_in !== 0) + return qt; + F = C.state, F.mode === dr && (F.mode = gi), Fe = C.next_out, le = C.output, tt = C.avail_out, ae = C.next_in, Q = C.input, Se = C.avail_in, ve = F.hold, Oe = F.bits, Et = Se, et = tt, $t = Er; e: for (; ; ) switch (F.mode) { - case Hr: + case ai: if (F.wrap === 0) { - F.mode = ti; + F.mode = gi; break; } - for (; Ie < 16; ) { - if (De === 0) + for (; Oe < 16; ) { + if (Se === 0) break e; - De--, be += Q[ae++] << Ie, Ie += 8; + Se--, ve += Q[ae++] << Oe, Oe += 8; } - if (F.wrap & 2 && be === 35615) { - F.wbits === 0 && (F.wbits = 15), F.check = 0, wt[0] = be & 255, wt[1] = be >>> 8 & 255, F.check = I(F.check, wt, 2, 0), be = 0, Ie = 0, F.mode = $i; + if (F.wrap & 2 && ve === 35615) { + F.wbits === 0 && (F.wbits = 15), F.check = 0, yt[0] = ve & 255, yt[1] = ve >>> 8 & 255, F.check = I(F.check, yt, 2, 0), ve = 0, Oe = 0, F.mode = Wi; break; } if (F.head && (F.head.done = !1), !(F.wrap & 1) || /* check if zlib header allowed */ - (((be & 255) << 8) + (be >> 8)) % 31) { + (((ve & 255) << 8) + (ve >> 8)) % 31) { C.msg = "incorrect header check", F.mode = Ot; break; } - if ((be & 15) !== Ci) { + if ((ve & 15) !== Ui) { C.msg = "unknown compression method", F.mode = Ot; break; } - if (be >>>= 4, Ie -= 4, nt = (be & 15) + 8, F.wbits === 0 && (F.wbits = nt), nt > 15 || nt > F.wbits) { + if (ve >>>= 4, Oe -= 4, st = (ve & 15) + 8, F.wbits === 0 && (F.wbits = st), st > 15 || st > F.wbits) { C.msg = "invalid window size", F.mode = Ot; break; } - F.dmax = 1 << F.wbits, F.flags = 0, C.adler = F.check = 1, F.mode = be & 512 ? Bi : ir, be = 0, Ie = 0; + F.dmax = 1 << F.wbits, F.flags = 0, C.adler = F.check = 1, F.mode = ve & 512 ? Zi : dr, ve = 0, Oe = 0; break; - case $i: - for (; Ie < 16; ) { - if (De === 0) + case Wi: + for (; Oe < 16; ) { + if (Se === 0) break e; - De--, be += Q[ae++] << Ie, Ie += 8; + Se--, ve += Q[ae++] << Oe, Oe += 8; } - if (F.flags = be, (F.flags & 255) !== Ci) { + if (F.flags = ve, (F.flags & 255) !== Ui) { C.msg = "unknown compression method", F.mode = Ot; break; } @@ -40707,217 +40707,217 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `; C.msg = "unknown header flags set", F.mode = Ot; break; } - F.head && (F.head.text = be >> 8 & 1), F.flags & 512 && F.wrap & 4 && (wt[0] = be & 255, wt[1] = be >>> 8 & 255, F.check = I(F.check, wt, 2, 0)), be = 0, Ie = 0, F.mode = Ti; - case Ti: - for (; Ie < 32; ) { - if (De === 0) + F.head && (F.head.text = ve >> 8 & 1), F.flags & 512 && F.wrap & 4 && (yt[0] = ve & 255, yt[1] = ve >>> 8 & 255, F.check = I(F.check, yt, 2, 0)), ve = 0, Oe = 0, F.mode = Gi; + case Gi: + for (; Oe < 32; ) { + if (Se === 0) break e; - De--, be += Q[ae++] << Ie, Ie += 8; + Se--, ve += Q[ae++] << Oe, Oe += 8; } - F.head && (F.head.time = be), F.flags & 512 && F.wrap & 4 && (wt[0] = be & 255, wt[1] = be >>> 8 & 255, wt[2] = be >>> 16 & 255, wt[3] = be >>> 24 & 255, F.check = I(F.check, wt, 4, 0)), be = 0, Ie = 0, F.mode = ki; - case ki: - for (; Ie < 16; ) { - if (De === 0) + F.head && (F.head.time = ve), F.flags & 512 && F.wrap & 4 && (yt[0] = ve & 255, yt[1] = ve >>> 8 & 255, yt[2] = ve >>> 16 & 255, yt[3] = ve >>> 24 & 255, F.check = I(F.check, yt, 4, 0)), ve = 0, Oe = 0, F.mode = Hi; + case Hi: + for (; Oe < 16; ) { + if (Se === 0) break e; - De--, be += Q[ae++] << Ie, Ie += 8; + Se--, ve += Q[ae++] << Oe, Oe += 8; } - F.head && (F.head.xflags = be & 255, F.head.os = be >> 8), F.flags & 512 && F.wrap & 4 && (wt[0] = be & 255, wt[1] = be >>> 8 & 255, F.check = I(F.check, wt, 2, 0)), be = 0, Ie = 0, F.mode = Li; - case Li: + F.head && (F.head.xflags = ve & 255, F.head.os = ve >> 8), F.flags & 512 && F.wrap & 4 && (yt[0] = ve & 255, yt[1] = ve >>> 8 & 255, F.check = I(F.check, yt, 2, 0)), ve = 0, Oe = 0, F.mode = Vi; + case Vi: if (F.flags & 1024) { - for (; Ie < 16; ) { - if (De === 0) + for (; Oe < 16; ) { + if (Se === 0) break e; - De--, be += Q[ae++] << Ie, Ie += 8; + Se--, ve += Q[ae++] << Oe, Oe += 8; } - F.length = be, F.head && (F.head.extra_len = be), F.flags & 512 && F.wrap & 4 && (wt[0] = be & 255, wt[1] = be >>> 8 & 255, F.check = I(F.check, wt, 2, 0)), be = 0, Ie = 0; + F.length = ve, F.head && (F.head.extra_len = ve), F.flags & 512 && F.wrap & 4 && (yt[0] = ve & 255, yt[1] = ve >>> 8 & 255, F.check = I(F.check, yt, 2, 0)), ve = 0, Oe = 0; } else F.head && (F.head.extra = null); - F.mode = Fi; - case Fi: - if (F.flags & 1024 && (Ve = F.length, Ve > De && (Ve = De), Ve && (F.head && (nt = F.head.extra_len - F.length, F.head.extra || (F.head.extra = new Uint8Array(F.head.extra_len)), F.head.extra.set( + F.mode = ji; + case ji: + if (F.flags & 1024 && (je = F.length, je > Se && (je = Se), je && (F.head && (st = F.head.extra_len - F.length, F.head.extra || (F.head.extra = new Uint8Array(F.head.extra_len)), F.head.extra.set( Q.subarray( ae, // extra field is limited to 65536 bytes // - no need for additional size check - ae + Ve + ae + je ), /*len + copy > state.head.extra_max - len ? state.head.extra_max : copy,*/ - nt - )), F.flags & 512 && F.wrap & 4 && (F.check = I(F.check, Q, Ve, ae)), De -= Ve, ae += Ve, F.length -= Ve), F.length)) + st + )), F.flags & 512 && F.wrap & 4 && (F.check = I(F.check, Q, je, ae)), Se -= je, ae += je, F.length -= je), F.length)) break e; - F.length = 0, F.mode = Oi; - case Oi: + F.length = 0, F.mode = Ki; + case Ki: if (F.flags & 2048) { - if (De === 0) + if (Se === 0) break e; - Ve = 0; + je = 0; do - nt = Q[ae + Ve++], F.head && nt && F.length < 65536 && (F.head.name += String.fromCharCode(nt)); - while (nt && Ve < De); - if (F.flags & 512 && F.wrap & 4 && (F.check = I(F.check, Q, Ve, ae)), De -= Ve, ae += Ve, nt) + st = Q[ae + je++], F.head && st && F.length < 65536 && (F.head.name += String.fromCharCode(st)); + while (st && je < Se); + if (F.flags & 512 && F.wrap & 4 && (F.check = I(F.check, Q, je, ae)), Se -= je, ae += je, st) break e; } else F.head && (F.head.name = null); - F.length = 0, F.mode = zi; - case zi: + F.length = 0, F.mode = Yi; + case Yi: if (F.flags & 4096) { - if (De === 0) + if (Se === 0) break e; - Ve = 0; + je = 0; do - nt = Q[ae + Ve++], F.head && nt && F.length < 65536 && (F.head.comment += String.fromCharCode(nt)); - while (nt && Ve < De); - if (F.flags & 512 && F.wrap & 4 && (F.check = I(F.check, Q, Ve, ae)), De -= Ve, ae += Ve, nt) + st = Q[ae + je++], F.head && st && F.length < 65536 && (F.head.comment += String.fromCharCode(st)); + while (st && je < Se); + if (F.flags & 512 && F.wrap & 4 && (F.check = I(F.check, Q, je, ae)), Se -= je, ae += je, st) break e; } else F.head && (F.head.comment = null); - F.mode = Ii; - case Ii: + F.mode = Xi; + case Xi: if (F.flags & 512) { - for (; Ie < 16; ) { - if (De === 0) + for (; Oe < 16; ) { + if (Se === 0) break e; - De--, be += Q[ae++] << Ie, Ie += 8; + Se--, ve += Q[ae++] << Oe, Oe += 8; } - if (F.wrap & 4 && be !== (F.check & 65535)) { + if (F.wrap & 4 && ve !== (F.check & 65535)) { C.msg = "header crc mismatch", F.mode = Ot; break; } - be = 0, Ie = 0; + ve = 0, Oe = 0; } - F.head && (F.head.hcrc = F.flags >> 9 & 1, F.head.done = !0), C.adler = F.check = 0, F.mode = ir; + F.head && (F.head.hcrc = F.flags >> 9 & 1, F.head.done = !0), C.adler = F.check = 0, F.mode = dr; break; - case Bi: - for (; Ie < 32; ) { - if (De === 0) + case Zi: + for (; Oe < 32; ) { + if (Se === 0) break e; - De--, be += Q[ae++] << Ie, Ie += 8; + Se--, ve += Q[ae++] << Oe, Oe += 8; } - C.adler = F.check = Qi(be), be = 0, Ie = 0, F.mode = Vr; - case Vr: + C.adler = F.check = hn(ve), ve = 0, Oe = 0, F.mode = si; + case si: if (F.havedict === 0) - return C.next_out = ze, C.avail_out = tt, C.next_in = ae, C.avail_in = De, F.hold = be, F.bits = Ie, va; - C.adler = F.check = 1, F.mode = ir; - case ir: - if (j === _a || j === Gr) + return C.next_out = Fe, C.avail_out = tt, C.next_in = ae, C.avail_in = Se, F.hold = ve, F.bits = Oe, va; + C.adler = F.check = 1, F.mode = dr; + case dr: + if (K === _a || K === ni) break e; - case ti: + case gi: if (F.last) { - be >>>= Ie & 7, Ie -= Ie & 7, F.mode = ii; + ve >>>= Oe & 7, Oe -= Oe & 7, F.mode = bi; break; } - for (; Ie < 3; ) { - if (De === 0) + for (; Oe < 3; ) { + if (Se === 0) break e; - De--, be += Q[ae++] << Ie, Ie += 8; + Se--, ve += Q[ae++] << Oe, Oe += 8; } - switch (F.last = be & 1, be >>>= 1, Ie -= 1, be & 3) { + switch (F.last = ve & 1, ve >>>= 1, Oe -= 1, ve & 3) { case 0: - F.mode = Ri; + F.mode = qi; break; case 1: - if (Aa(F), F.mode = jr, j === Gr) { - be >>>= 2, Ie -= 2; + if (Aa(F), F.mode = li, K === ni) { + ve >>>= 2, Oe -= 2; break e; } break; case 2: - F.mode = Ni; + F.mode = Ji; break; case 3: C.msg = "invalid block type", F.mode = Ot; } - be >>>= 2, Ie -= 2; + ve >>>= 2, Oe -= 2; break; - case Ri: - for (be >>>= Ie & 7, Ie -= Ie & 7; Ie < 32; ) { - if (De === 0) + case qi: + for (ve >>>= Oe & 7, Oe -= Oe & 7; Oe < 32; ) { + if (Se === 0) break e; - De--, be += Q[ae++] << Ie, Ie += 8; + Se--, ve += Q[ae++] << Oe, Oe += 8; } - if ((be & 65535) !== (be >>> 16 ^ 65535)) { + if ((ve & 65535) !== (ve >>> 16 ^ 65535)) { C.msg = "invalid stored block lengths", F.mode = Ot; break; } - if (F.length = be & 65535, be = 0, Ie = 0, F.mode = ri, j === Gr) + if (F.length = ve & 65535, ve = 0, Oe = 0, F.mode = vi, K === ni) break e; - case ri: - F.mode = Pi; - case Pi: - if (Ve = F.length, Ve) { - if (Ve > De && (Ve = De), Ve > tt && (Ve = tt), Ve === 0) + case vi: + F.mode = Qi; + case Qi: + if (je = F.length, je) { + if (je > Se && (je = Se), je > tt && (je = tt), je === 0) break e; - oe.set(Q.subarray(ae, ae + Ve), ze), De -= Ve, ae += Ve, tt -= Ve, ze += Ve, F.length -= Ve; + le.set(Q.subarray(ae, ae + je), Fe), Se -= je, ae += je, tt -= je, Fe += je, F.length -= je; break; } - F.mode = ir; + F.mode = dr; break; - case Ni: - for (; Ie < 14; ) { - if (De === 0) + case Ji: + for (; Oe < 14; ) { + if (Se === 0) break e; - De--, be += Q[ae++] << Ie, Ie += 8; + Se--, ve += Q[ae++] << Oe, Oe += 8; } - if (F.nlen = (be & 31) + 257, be >>>= 5, Ie -= 5, F.ndist = (be & 31) + 1, be >>>= 5, Ie -= 5, F.ncode = (be & 15) + 4, be >>>= 4, Ie -= 4, F.nlen > 286 || F.ndist > 30) { + if (F.nlen = (ve & 31) + 257, ve >>>= 5, Oe -= 5, F.ndist = (ve & 31) + 1, ve >>>= 5, Oe -= 5, F.ncode = (ve & 15) + 4, ve >>>= 4, Oe -= 4, F.nlen > 286 || F.ndist > 30) { C.msg = "too many length or distance symbols", F.mode = Ot; break; } - F.have = 0, F.mode = Ui; - case Ui: + F.have = 0, F.mode = en; + case en: for (; F.have < F.ncode; ) { - for (; Ie < 3; ) { - if (De === 0) + for (; Oe < 3; ) { + if (Se === 0) break e; - De--, be += Q[ae++] << Ie, Ie += 8; + Se--, ve += Q[ae++] << Oe, Oe += 8; } - F.lens[dr[F.have++]] = be & 7, be >>>= 3, Ie -= 3; + F.lens[Ar[F.have++]] = ve & 7, ve >>>= 3, Oe -= 3; } for (; F.have < 19; ) - F.lens[dr[F.have++]] = 0; - if (F.lencode = F.lendyn, F.lenbits = 7, ct = { bits: F.lenbits }, Tt = Br(pa, F.lens, 0, 19, F.lencode, 0, F.work, ct), F.lenbits = ct.bits, Tt) { + F.lens[Ar[F.have++]] = 0; + if (F.lencode = F.lendyn, F.lenbits = 7, ct = { bits: F.lenbits }, $t = Vr(pa, F.lens, 0, 19, F.lencode, 0, F.work, ct), F.lenbits = ct.bits, $t) { C.msg = "invalid code lengths set", F.mode = Ot; break; } - F.have = 0, F.mode = Wi; - case Wi: + F.have = 0, F.mode = tn; + case tn: for (; F.have < F.nlen + F.ndist; ) { - for (; xt = F.lencode[be & (1 << F.lenbits) - 1], ht = xt >>> 24, Mt = xt >>> 16 & 255, pt = xt & 65535, !(ht <= Ie); ) { - if (De === 0) + for (; bt = F.lencode[ve & (1 << F.lenbits) - 1], ht = bt >>> 24, Dt = bt >>> 16 & 255, pt = bt & 65535, !(ht <= Oe); ) { + if (Se === 0) break e; - De--, be += Q[ae++] << Ie, Ie += 8; + Se--, ve += Q[ae++] << Oe, Oe += 8; } if (pt < 16) - be >>>= ht, Ie -= ht, F.lens[F.have++] = pt; + ve >>>= ht, Oe -= ht, F.lens[F.have++] = pt; else { if (pt === 16) { - for (vt = ht + 2; Ie < vt; ) { - if (De === 0) + for (gt = ht + 2; Oe < gt; ) { + if (Se === 0) break e; - De--, be += Q[ae++] << Ie, Ie += 8; + Se--, ve += Q[ae++] << Oe, Oe += 8; } - if (be >>>= ht, Ie -= ht, F.have === 0) { + if (ve >>>= ht, Oe -= ht, F.have === 0) { C.msg = "invalid bit length repeat", F.mode = Ot; break; } - nt = F.lens[F.have - 1], Ve = 3 + (be & 3), be >>>= 2, Ie -= 2; + st = F.lens[F.have - 1], je = 3 + (ve & 3), ve >>>= 2, Oe -= 2; } else if (pt === 17) { - for (vt = ht + 3; Ie < vt; ) { - if (De === 0) + for (gt = ht + 3; Oe < gt; ) { + if (Se === 0) break e; - De--, be += Q[ae++] << Ie, Ie += 8; + Se--, ve += Q[ae++] << Oe, Oe += 8; } - be >>>= ht, Ie -= ht, nt = 0, Ve = 3 + (be & 7), be >>>= 3, Ie -= 3; + ve >>>= ht, Oe -= ht, st = 0, je = 3 + (ve & 7), ve >>>= 3, Oe -= 3; } else { - for (vt = ht + 7; Ie < vt; ) { - if (De === 0) + for (gt = ht + 7; Oe < gt; ) { + if (Se === 0) break e; - De--, be += Q[ae++] << Ie, Ie += 8; + Se--, ve += Q[ae++] << Oe, Oe += 8; } - be >>>= ht, Ie -= ht, nt = 0, Ve = 11 + (be & 127), be >>>= 7, Ie -= 7; + ve >>>= ht, Oe -= ht, st = 0, je = 11 + (ve & 127), ve >>>= 7, Oe -= 7; } - if (F.have + Ve > F.nlen + F.ndist) { + if (F.have + je > F.nlen + F.ndist) { C.msg = "invalid bit length repeat", F.mode = Ot; break; } - for (; Ve--; ) - F.lens[F.have++] = nt; + for (; je--; ) + F.lens[F.have++] = st; } } if (F.mode === Ot) @@ -40926,173 +40926,173 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `; C.msg = "invalid code -- missing end-of-block", F.mode = Ot; break; } - if (F.lenbits = 9, ct = { bits: F.lenbits }, Tt = Br(Ei, F.lens, 0, F.nlen, F.lencode, 0, F.work, ct), F.lenbits = ct.bits, Tt) { + if (F.lenbits = 9, ct = { bits: F.lenbits }, $t = Vr(Ii, F.lens, 0, F.nlen, F.lencode, 0, F.work, ct), F.lenbits = ct.bits, $t) { C.msg = "invalid literal/lengths set", F.mode = Ot; break; } - if (F.distbits = 6, F.distcode = F.distdyn, ct = { bits: F.distbits }, Tt = Br(Si, F.lens, F.nlen, F.ndist, F.distcode, 0, F.work, ct), F.distbits = ct.bits, Tt) { + if (F.distbits = 6, F.distcode = F.distdyn, ct = { bits: F.distbits }, $t = Vr(Bi, F.lens, F.nlen, F.ndist, F.distcode, 0, F.work, ct), F.distbits = ct.bits, $t) { C.msg = "invalid distances set", F.mode = Ot; break; } - if (F.mode = jr, j === Gr) + if (F.mode = li, K === ni) break e; - case jr: - F.mode = Kr; - case Kr: - if (De >= 6 && tt >= 258) { - C.next_out = ze, C.avail_out = tt, C.next_in = ae, C.avail_in = De, F.hold = be, F.bits = Ie, ua(C, et), ze = C.next_out, oe = C.output, tt = C.avail_out, ae = C.next_in, Q = C.input, De = C.avail_in, be = F.hold, Ie = F.bits, F.mode === ir && (F.back = -1); + case li: + F.mode = oi; + case oi: + if (Se >= 6 && tt >= 258) { + C.next_out = Fe, C.avail_out = tt, C.next_in = ae, C.avail_in = Se, F.hold = ve, F.bits = Oe, da(C, et), Fe = C.next_out, le = C.output, tt = C.avail_out, ae = C.next_in, Q = C.input, Se = C.avail_in, ve = F.hold, Oe = F.bits, F.mode === dr && (F.back = -1); break; } - for (F.back = 0; xt = F.lencode[be & (1 << F.lenbits) - 1], ht = xt >>> 24, Mt = xt >>> 16 & 255, pt = xt & 65535, !(ht <= Ie); ) { - if (De === 0) + for (F.back = 0; bt = F.lencode[ve & (1 << F.lenbits) - 1], ht = bt >>> 24, Dt = bt >>> 16 & 255, pt = bt & 65535, !(ht <= Oe); ) { + if (Se === 0) break e; - De--, be += Q[ae++] << Ie, Ie += 8; + Se--, ve += Q[ae++] << Oe, Oe += 8; } - if (Mt && !(Mt & 240)) { - for (Je = ht, At = Mt, Wt = pt; xt = F.lencode[Wt + ((be & (1 << Je + At) - 1) >> Je)], ht = xt >>> 24, Mt = xt >>> 16 & 255, pt = xt & 65535, !(Je + ht <= Ie); ) { - if (De === 0) + if (Dt && !(Dt & 240)) { + for (Je = ht, At = Dt, Wt = pt; bt = F.lencode[Wt + ((ve & (1 << Je + At) - 1) >> Je)], ht = bt >>> 24, Dt = bt >>> 16 & 255, pt = bt & 65535, !(Je + ht <= Oe); ) { + if (Se === 0) break e; - De--, be += Q[ae++] << Ie, Ie += 8; + Se--, ve += Q[ae++] << Oe, Oe += 8; } - be >>>= Je, Ie -= Je, F.back += Je; + ve >>>= Je, Oe -= Je, F.back += Je; } - if (be >>>= ht, Ie -= ht, F.back += ht, F.length = pt, Mt === 0) { - F.mode = Ki; + if (ve >>>= ht, Oe -= ht, F.back += ht, F.length = pt, Dt === 0) { + F.mode = ln; break; } - if (Mt & 32) { - F.back = -1, F.mode = ir; + if (Dt & 32) { + F.back = -1, F.mode = dr; break; } - if (Mt & 64) { + if (Dt & 64) { C.msg = "invalid literal/length code", F.mode = Ot; break; } - F.extra = Mt & 15, F.mode = Gi; - case Gi: + F.extra = Dt & 15, F.mode = rn; + case rn: if (F.extra) { - for (vt = F.extra; Ie < vt; ) { - if (De === 0) + for (gt = F.extra; Oe < gt; ) { + if (Se === 0) break e; - De--, be += Q[ae++] << Ie, Ie += 8; + Se--, ve += Q[ae++] << Oe, Oe += 8; } - F.length += be & (1 << F.extra) - 1, be >>>= F.extra, Ie -= F.extra, F.back += F.extra; + F.length += ve & (1 << F.extra) - 1, ve >>>= F.extra, Oe -= F.extra, F.back += F.extra; } - F.was = F.length, F.mode = Hi; - case Hi: - for (; xt = F.distcode[be & (1 << F.distbits) - 1], ht = xt >>> 24, Mt = xt >>> 16 & 255, pt = xt & 65535, !(ht <= Ie); ) { - if (De === 0) + F.was = F.length, F.mode = nn; + case nn: + for (; bt = F.distcode[ve & (1 << F.distbits) - 1], ht = bt >>> 24, Dt = bt >>> 16 & 255, pt = bt & 65535, !(ht <= Oe); ) { + if (Se === 0) break e; - De--, be += Q[ae++] << Ie, Ie += 8; + Se--, ve += Q[ae++] << Oe, Oe += 8; } - if (!(Mt & 240)) { - for (Je = ht, At = Mt, Wt = pt; xt = F.distcode[Wt + ((be & (1 << Je + At) - 1) >> Je)], ht = xt >>> 24, Mt = xt >>> 16 & 255, pt = xt & 65535, !(Je + ht <= Ie); ) { - if (De === 0) + if (!(Dt & 240)) { + for (Je = ht, At = Dt, Wt = pt; bt = F.distcode[Wt + ((ve & (1 << Je + At) - 1) >> Je)], ht = bt >>> 24, Dt = bt >>> 16 & 255, pt = bt & 65535, !(Je + ht <= Oe); ) { + if (Se === 0) break e; - De--, be += Q[ae++] << Ie, Ie += 8; + Se--, ve += Q[ae++] << Oe, Oe += 8; } - be >>>= Je, Ie -= Je, F.back += Je; + ve >>>= Je, Oe -= Je, F.back += Je; } - if (be >>>= ht, Ie -= ht, F.back += ht, Mt & 64) { + if (ve >>>= ht, Oe -= ht, F.back += ht, Dt & 64) { C.msg = "invalid distance code", F.mode = Ot; break; } - F.offset = pt, F.extra = Mt & 15, F.mode = Vi; - case Vi: + F.offset = pt, F.extra = Dt & 15, F.mode = an; + case an: if (F.extra) { - for (vt = F.extra; Ie < vt; ) { - if (De === 0) + for (gt = F.extra; Oe < gt; ) { + if (Se === 0) break e; - De--, be += Q[ae++] << Ie, Ie += 8; + Se--, ve += Q[ae++] << Oe, Oe += 8; } - F.offset += be & (1 << F.extra) - 1, be >>>= F.extra, Ie -= F.extra, F.back += F.extra; + F.offset += ve & (1 << F.extra) - 1, ve >>>= F.extra, Oe -= F.extra, F.back += F.extra; } if (F.offset > F.dmax) { C.msg = "invalid distance too far back", F.mode = Ot; break; } - F.mode = ji; - case ji: + F.mode = sn; + case sn: if (tt === 0) break e; - if (Ve = et - tt, F.offset > Ve) { - if (Ve = F.offset - Ve, Ve > F.whave && F.sane) { + if (je = et - tt, F.offset > je) { + if (je = F.offset - je, je > F.whave && F.sane) { C.msg = "invalid distance too far back", F.mode = Ot; break; } - Ve > F.wnext ? (Ve -= F.wnext, it = F.wsize - Ve) : it = F.wnext - Ve, Ve > F.length && (Ve = F.length), It = F.window; + je > F.wnext ? (je -= F.wnext, at = F.wsize - je) : at = F.wnext - je, je > F.length && (je = F.length), Bt = F.window; } else - It = oe, it = ze - F.offset, Ve = F.length; - Ve > tt && (Ve = tt), tt -= Ve, F.length -= Ve; + Bt = le, at = Fe - F.offset, je = F.length; + je > tt && (je = tt), tt -= je, F.length -= je; do - oe[ze++] = It[it++]; - while (--Ve); - F.length === 0 && (F.mode = Kr); + le[Fe++] = Bt[at++]; + while (--je); + F.length === 0 && (F.mode = oi); break; - case Ki: + case ln: if (tt === 0) break e; - oe[ze++] = F.length, tt--, F.mode = Kr; + le[Fe++] = F.length, tt--, F.mode = oi; break; - case ii: + case bi: if (F.wrap) { - for (; Ie < 32; ) { - if (De === 0) + for (; Oe < 32; ) { + if (Se === 0) break e; - De--, be |= Q[ae++] << Ie, Ie += 8; + Se--, ve |= Q[ae++] << Oe, Oe += 8; } if (et -= tt, C.total_out += et, F.total += et, F.wrap & 4 && et && (C.adler = F.check = /*UPDATE_CHECK(state.check, put - _out, _out);*/ - F.flags ? I(F.check, oe, et, ze - et) : ke(F.check, oe, et, ze - et)), et = tt, F.wrap & 4 && (F.flags ? be : Qi(be)) !== F.check) { + F.flags ? I(F.check, le, et, Fe - et) : $e(F.check, le, et, Fe - et)), et = tt, F.wrap & 4 && (F.flags ? ve : hn(ve)) !== F.check) { C.msg = "incorrect data check", F.mode = Ot; break; } - be = 0, Ie = 0; + ve = 0, Oe = 0; } - F.mode = Xi; - case Xi: + F.mode = on; + case on: if (F.wrap && F.flags) { - for (; Ie < 32; ) { - if (De === 0) + for (; Oe < 32; ) { + if (Se === 0) break e; - De--, be += Q[ae++] << Ie, Ie += 8; + Se--, ve += Q[ae++] << Oe, Oe += 8; } - if (F.wrap & 4 && be !== (F.total & 4294967295)) { + if (F.wrap & 4 && ve !== (F.total & 4294967295)) { C.msg = "incorrect length check", F.mode = Ot; break; } - be = 0, Ie = 0; + ve = 0, Oe = 0; } - F.mode = Yi; - case Yi: - Tt = ga; + F.mode = cn; + case cn: + $t = ga; break e; case Ot: - Tt = Mi; + $t = Pi; break e; - case Zi: - return Di; - case qi: + case dn: + return Ni; + case un: default: - return Yt; + return qt; } - return C.next_out = ze, C.avail_out = tt, C.next_in = ae, C.avail_in = De, F.hold = be, F.bits = Ie, (F.wsize || et !== C.avail_out && F.mode < Ot && (F.mode < ii || j !== Ai)) && an(C, C.output, C.next_out, et - C.avail_out), St -= C.avail_in, et -= C.avail_out, C.total_in += St, C.total_out += et, F.total += et, F.wrap & 4 && et && (C.adler = F.check = /*UPDATE_CHECK(state.check, strm.next_out - _out, _out);*/ - F.flags ? I(F.check, oe, et, C.next_out - et) : ke(F.check, oe, et, C.next_out - et)), C.data_type = F.bits + (F.last ? 64 : 0) + (F.mode === ir ? 128 : 0) + (F.mode === jr || F.mode === ri ? 256 : 0), (St === 0 && et === 0 || j === Ai) && Tt === cr && (Tt = ba), Tt; + return C.next_out = Fe, C.avail_out = tt, C.next_in = ae, C.avail_in = Se, F.hold = ve, F.bits = Oe, (F.wsize || et !== C.avail_out && F.mode < Ot && (F.mode < bi || K !== Ri)) && vn(C, C.output, C.next_out, et - C.avail_out), Et -= C.avail_in, et -= C.avail_out, C.total_in += Et, C.total_out += et, F.total += et, F.wrap & 4 && et && (C.adler = F.check = /*UPDATE_CHECK(state.check, strm.next_out - _out, _out);*/ + F.flags ? I(F.check, le, et, C.next_out - et) : $e(F.check, le, et, C.next_out - et)), C.data_type = F.bits + (F.last ? 64 : 0) + (F.mode === dr ? 128 : 0) + (F.mode === li || F.mode === vi ? 256 : 0), (Et === 0 && et === 0 || K === Ri) && $t === Er && ($t = ba), $t; }, Da = (C) => { - if (ur(C)) - return Yt; - let j = C.state; - return j.window && (j.window = null), C.state = null, cr; - }, Ca = (C, j) => { - if (ur(C)) - return Yt; + if (Sr(C)) + return qt; + let K = C.state; + return K.window && (K.window = null), C.state = null, Er; + }, Ca = (C, K) => { + if (Sr(C)) + return qt; const F = C.state; - return F.wrap & 2 ? (F.head = j, j.done = !1, cr) : Yt; - }, $a = (C, j) => { - const F = j.length; - let Q, oe, ae; - return ur(C) || (Q = C.state, Q.wrap !== 0 && Q.mode !== Vr) ? Yt : Q.mode === Vr && (oe = 1, oe = ke(oe, j, F, 0), oe !== Q.check) ? Mi : (ae = an(C, j, F, F), ae ? (Q.mode = Zi, Di) : (Q.havedict = 1, cr)); + return F.wrap & 2 ? (F.head = K, K.done = !1, Er) : qt; + }, $a = (C, K) => { + const F = K.length; + let Q, le, ae; + return Sr(C) || (Q = C.state, Q.wrap !== 0 && Q.mode !== si) ? qt : Q.mode === si && (le = 1, le = $e(le, K, F, 0), le !== Q.check) ? Pi : (ae = vn(C, K, F, F), ae ? (Q.mode = dn, Ni) : (Q.havedict = 1, Er)); }; - var Ta = en, ka = tn, La = Ji, Fa = Sa, Oa = rn, za = Ma, Ia = Da, Ba = Ca, Ra = $a, Pa = "pako inflate (from Nodeca project)", nr = { + var Ta = mn, ka = pn, La = fn, Fa = Sa, Oa = _n, za = Ma, Ia = Da, Ba = Ca, Ra = $a, Pa = "pako inflate (from Nodeca project)", ur = { inflateReset: Ta, inflateReset2: ka, inflateResetKeep: La, @@ -41108,91 +41108,91 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `; this.text = 0, this.time = 0, this.xflags = 0, this.os = 0, this.extra = null, this.extra_len = 0, this.name = "", this.comment = "", this.hcrc = 0, this.done = !1; } var Ua = Na; - const sn = Object.prototype.toString, { + const bn = Object.prototype.toString, { Z_NO_FLUSH: Wa, Z_FINISH: Ga, - Z_OK: Rr, - Z_STREAM_END: si, - Z_NEED_DICT: li, + Z_OK: jr, + Z_STREAM_END: wi, + Z_NEED_DICT: Ei, Z_STREAM_ERROR: Ha, - Z_DATA_ERROR: ln, + Z_DATA_ERROR: yn, Z_MEM_ERROR: Va - } = ve; - function Pr(C) { - this.options = Nr.assign({ + } = be; + function Kr(C) { + this.options = ti.assign({ chunkSize: 65536, windowBits: 15, to: "" }, C || {}); - const j = this.options; - j.raw && j.windowBits >= 0 && j.windowBits < 16 && (j.windowBits = -j.windowBits, j.windowBits === 0 && (j.windowBits = -15)), j.windowBits >= 0 && j.windowBits < 16 && !(C && C.windowBits) && (j.windowBits += 32), j.windowBits > 15 && j.windowBits < 48 && (j.windowBits & 15 || (j.windowBits |= 15)), this.err = 0, this.msg = "", this.ended = !1, this.chunks = [], this.strm = new gi(), this.strm.avail_out = 0; - let F = nr.inflateInit2( + const K = this.options; + K.raw && K.windowBits >= 0 && K.windowBits < 16 && (K.windowBits = -K.windowBits, K.windowBits === 0 && (K.windowBits = -15)), K.windowBits >= 0 && K.windowBits < 16 && !(C && C.windowBits) && (K.windowBits += 32), K.windowBits > 15 && K.windowBits < 48 && (K.windowBits & 15 || (K.windowBits |= 15)), this.err = 0, this.msg = "", this.ended = !1, this.chunks = [], this.strm = new Ti(), this.strm.avail_out = 0; + let F = ur.inflateInit2( this.strm, - j.windowBits + K.windowBits ); - if (F !== Rr) - throw new Error(ye[F]); - if (this.header = new Ua(), nr.inflateGetHeader(this.strm, this.header), j.dictionary && (typeof j.dictionary == "string" ? j.dictionary = zr.string2buf(j.dictionary) : sn.call(j.dictionary) === "[object ArrayBuffer]" && (j.dictionary = new Uint8Array(j.dictionary)), j.raw && (F = nr.inflateSetDictionary(this.strm, j.dictionary), F !== Rr))) - throw new Error(ye[F]); - } - Pr.prototype.push = function(C, j) { - const F = this.strm, Q = this.options.chunkSize, oe = this.options.dictionary; - let ae, ze, De; + if (F !== jr) + throw new Error(xe[F]); + if (this.header = new Ua(), ur.inflateGetHeader(this.strm, this.header), K.dictionary && (typeof K.dictionary == "string" ? K.dictionary = Gr.string2buf(K.dictionary) : bn.call(K.dictionary) === "[object ArrayBuffer]" && (K.dictionary = new Uint8Array(K.dictionary)), K.raw && (F = ur.inflateSetDictionary(this.strm, K.dictionary), F !== jr))) + throw new Error(xe[F]); + } + Kr.prototype.push = function(C, K) { + const F = this.strm, Q = this.options.chunkSize, le = this.options.dictionary; + let ae, Fe, Se; if (this.ended) return !1; - for (j === ~~j ? ze = j : ze = j === !0 ? Ga : Wa, sn.call(C) === "[object ArrayBuffer]" ? F.input = new Uint8Array(C) : F.input = C, F.next_in = 0, F.avail_in = F.input.length; ; ) { - for (F.avail_out === 0 && (F.output = new Uint8Array(Q), F.next_out = 0, F.avail_out = Q), ae = nr.inflate(F, ze), ae === li && oe && (ae = nr.inflateSetDictionary(F, oe), ae === Rr ? ae = nr.inflate(F, ze) : ae === ln && (ae = li)); F.avail_in > 0 && ae === si && F.state.wrap > 0 && C[F.next_in] !== 0; ) - nr.inflateReset(F), ae = nr.inflate(F, ze); + for (K === ~~K ? Fe = K : Fe = K === !0 ? Ga : Wa, bn.call(C) === "[object ArrayBuffer]" ? F.input = new Uint8Array(C) : F.input = C, F.next_in = 0, F.avail_in = F.input.length; ; ) { + for (F.avail_out === 0 && (F.output = new Uint8Array(Q), F.next_out = 0, F.avail_out = Q), ae = ur.inflate(F, Fe), ae === Ei && le && (ae = ur.inflateSetDictionary(F, le), ae === jr ? ae = ur.inflate(F, Fe) : ae === yn && (ae = Ei)); F.avail_in > 0 && ae === wi && F.state.wrap > 0 && C[F.next_in] !== 0; ) + ur.inflateReset(F), ae = ur.inflate(F, Fe); switch (ae) { case Ha: - case ln: - case li: + case yn: + case Ei: case Va: return this.onEnd(ae), this.ended = !0, !1; } - if (De = F.avail_out, F.next_out && (F.avail_out === 0 || ae === si)) + if (Se = F.avail_out, F.next_out && (F.avail_out === 0 || ae === wi)) if (this.options.to === "string") { - let tt = zr.utf8border(F.output, F.next_out), be = F.next_out - tt, Ie = zr.buf2string(F.output, tt); - F.next_out = be, F.avail_out = Q - be, be && F.output.set(F.output.subarray(tt, tt + be), 0), this.onData(Ie); + let tt = Gr.utf8border(F.output, F.next_out), ve = F.next_out - tt, Oe = Gr.buf2string(F.output, tt); + F.next_out = ve, F.avail_out = Q - ve, ve && F.output.set(F.output.subarray(tt, tt + ve), 0), this.onData(Oe); } else this.onData(F.output.length === F.next_out ? F.output : F.output.subarray(0, F.next_out)); - if (!(ae === Rr && De === 0)) { - if (ae === si) - return ae = nr.inflateEnd(this.strm), this.onEnd(ae), this.ended = !0, !0; + if (!(ae === jr && Se === 0)) { + if (ae === wi) + return ae = ur.inflateEnd(this.strm), this.onEnd(ae), this.ended = !0, !0; if (F.avail_in === 0) break; } } return !0; - }, Pr.prototype.onData = function(C) { + }, Kr.prototype.onData = function(C) { this.chunks.push(C); - }, Pr.prototype.onEnd = function(C) { - C === Rr && (this.options.to === "string" ? this.result = this.chunks.join("") : this.result = Nr.flattenChunks(this.chunks)), this.chunks = [], this.err = C, this.msg = this.strm.msg; + }, Kr.prototype.onEnd = function(C) { + C === jr && (this.options.to === "string" ? this.result = this.chunks.join("") : this.result = ti.flattenChunks(this.chunks)), this.chunks = [], this.err = C, this.msg = this.strm.msg; }; - function oi(C, j) { - const F = new Pr(j); - if (F.push(C), F.err) throw F.msg || ye[F.err]; + function Si(C, K) { + const F = new Kr(K); + if (F.push(C), F.err) throw F.msg || xe[F.err]; return F.result; } - function ja(C, j) { - return j = j || {}, j.raw = !0, oi(C, j); + function ja(C, K) { + return K = K || {}, K.raw = !0, Si(C, K); } - var Ka = Pr, Xa = oi, Ya = ja, Za = oi, qa = ve, Qa = { + var Ka = Kr, Ya = Si, Xa = ja, Za = Si, qa = be, Qa = { Inflate: Ka, - inflate: Xa, - inflateRaw: Ya, + inflate: Ya, + inflateRaw: Xa, ungzip: Za, constants: qa }; const { Deflate: Ja, deflate: es, deflateRaw: ts, gzip: rs } = oa, { Inflate: is, inflate: ns, inflateRaw: as, ungzip: ss } = Qa; - var on = Ja, cn = es, un = ts, hn = rs, dn = is, fn = ns, mn = as, pn = ss, _n = ve, ls = { - Deflate: on, - deflate: cn, - deflateRaw: un, - gzip: hn, - Inflate: dn, - inflate: fn, - inflateRaw: mn, - ungzip: pn, - constants: _n + var xn = Ja, wn = es, En = ts, Sn = rs, An = is, Mn = ns, Dn = as, Cn = ss, $n = be, ls = { + Deflate: xn, + deflate: wn, + deflateRaw: En, + gzip: Sn, + Inflate: An, + inflate: Mn, + inflateRaw: Dn, + ungzip: Cn, + constants: $n }; } ) @@ -41271,133 +41271,153 @@ const _3Dmol = /* @__PURE__ */ getDefaultExportFromCjs(_3DmolExports), mol = /* text: text$4, toggle_class: toggle_class$5, transition_in: transition_in$7 -} = window.__gradio__svelte__internal, { onMount: onMount$2 } = window.__gradio__svelte__internal; +} = window.__gradio__svelte__internal, { onMount: onMount$2, beforeUpdate } = window.__gradio__svelte__internal; function get_each_context$2(n, e, t) { const r = n.slice(); - return r[53] = e[t], r[54] = e, r[55] = t, r; + return r[58] = e[t], r[59] = e, r[60] = t, r; } function get_each_context_1$1(n, e, t) { const r = n.slice(); - return r[56] = e[t], r[58] = t, r; + return r[61] = e[t], r[63] = t, r; } function get_each_context_2(n, e, t) { const r = n.slice(); - return r[59] = e[t], r[60] = e, r[61] = t, r; + return r[64] = e[t], r[65] = e, r[66] = t, r; } function get_each_context_3(n, e, t) { const r = n.slice(); - return r[62] = e[t], r; + return r[67] = e[t], r; } -function create_if_block_8$1(n) { - let e, t, r, a, l = " ", d, o, u, p, m, y, w, b = " ", A, f, s, h, _, g, x, c = " ", v, M, E, $, k, L, z, O = " ", R, P, U, B; +function create_if_block_9$1(n) { + let e, t, r, a, l = " ", h, c, d, _, m, y, x, b = " ", A, f, s, u, p, g, w, o = " ", v, M, E, $, k, L, z, O = " ", R, N, W, B; return { c() { - e = element$7("div"), t = element$7("div"), r = element$7("div"), a = element$7("span"), a.textContent = l, d = element$7("span"), o = text$4("Very high ("), u = text$4( + e = element$7("div"), t = element$7("div"), r = element$7("div"), a = element$7("span"), a.textContent = l, h = element$7("span"), c = text$4("Very high ("), d = text$4( /*confidenceLabel*/ n[2] - ), p = text$4(" > 90)"), m = space$8(), y = element$7("div"), w = element$7("span"), w.textContent = b, A = element$7("span"), f = text$4("Confident (90 > "), s = text$4( + ), _ = text$4(" > 90)"), m = space$8(), y = element$7("div"), x = element$7("span"), x.textContent = b, A = element$7("span"), f = text$4("Confident (90 > "), s = text$4( /*confidenceLabel*/ n[2] - ), h = text$4(" > 70)"), _ = space$8(), g = element$7("div"), x = element$7("span"), x.textContent = c, v = element$7("span"), M = text$4("Low (70 > "), E = text$4( + ), u = text$4(" > 70)"), p = space$8(), g = element$7("div"), w = element$7("span"), w.textContent = o, v = element$7("span"), M = text$4("Low (70 > "), E = text$4( /*confidenceLabel*/ n[2] - ), $ = text$4(" > 50)"), k = space$8(), L = element$7("div"), z = element$7("span"), z.textContent = O, R = element$7("span"), P = text$4("Very low ("), U = text$4( + ), $ = text$4(" > 50)"), k = space$8(), L = element$7("div"), z = element$7("span"), z.textContent = O, R = element$7("span"), N = text$4("Very low ("), W = text$4( /*confidenceLabel*/ n[2] ), B = text$4(" < 50)"), this.h(); }, - l(N) { - e = claim_element$7(N, "DIV", { class: !0 }); + l(P) { + e = claim_element$7(P, "DIV", { class: !0 }); var G = children$8(e); t = claim_element$7(G, "DIV", { class: !0 }); var H = children$8(t); r = claim_element$7(H, "DIV", { class: !0 }); - var W = children$8(r); - a = claim_element$7(W, "SPAN", { + var U = children$8(r); + a = claim_element$7(U, "SPAN", { class: !0, style: !0, "data-svelte-h": !0 - }), get_svelte_dataset$2(a) !== "svelte-z3k9fb" && (a.textContent = l), d = claim_element$7(W, "SPAN", { class: !0 }); - var V = children$8(d); - o = claim_text$4(V, "Very high ("), u = claim_text$4( - V, + }), get_svelte_dataset$2(a) !== "svelte-z3k9fb" && (a.textContent = l), h = claim_element$7(U, "SPAN", { class: !0 }); + var j = children$8(h); + c = claim_text$4(j, "Very high ("), d = claim_text$4( + j, /*confidenceLabel*/ n[2] - ), p = claim_text$4(V, " > 90)"), V.forEach(detach$b), W.forEach(detach$b), m = claim_space$8(H), y = claim_element$7(H, "DIV", { class: !0 }); + ), _ = claim_text$4(j, " > 90)"), j.forEach(detach$b), U.forEach(detach$b), m = claim_space$8(H), y = claim_element$7(H, "DIV", { class: !0 }); var re = children$8(y); - w = claim_element$7(re, "SPAN", { + x = claim_element$7(re, "SPAN", { class: !0, style: !0, "data-svelte-h": !0 - }), get_svelte_dataset$2(w) !== "svelte-sel3h7" && (w.textContent = b), A = claim_element$7(re, "SPAN", { class: !0 }); + }), get_svelte_dataset$2(x) !== "svelte-sel3h7" && (x.textContent = b), A = claim_element$7(re, "SPAN", { class: !0 }); var ie = children$8(A); f = claim_text$4(ie, "Confident (90 > "), s = claim_text$4( ie, /*confidenceLabel*/ n[2] - ), h = claim_text$4(ie, " > 70)"), ie.forEach(detach$b), re.forEach(detach$b), _ = claim_space$8(H), g = claim_element$7(H, "DIV", { class: !0 }); - var ee = children$8(g); - x = claim_element$7(ee, "SPAN", { + ), u = claim_text$4(ie, " > 70)"), ie.forEach(detach$b), re.forEach(detach$b), p = claim_space$8(H), g = claim_element$7(H, "DIV", { class: !0 }); + var te = children$8(g); + w = claim_element$7(te, "SPAN", { class: !0, style: !0, "data-svelte-h": !0 - }), get_svelte_dataset$2(x) !== "svelte-13r2awx" && (x.textContent = c), v = claim_element$7(ee, "SPAN", { class: !0 }); - var ce = children$8(v); - M = claim_text$4(ce, "Low (70 > "), E = claim_text$4( - ce, + }), get_svelte_dataset$2(w) !== "svelte-13r2awx" && (w.textContent = o), v = claim_element$7(te, "SPAN", { class: !0 }); + var ue = children$8(v); + M = claim_text$4(ue, "Low (70 > "), E = claim_text$4( + ue, /*confidenceLabel*/ n[2] - ), $ = claim_text$4(ce, " > 50)"), ce.forEach(detach$b), ee.forEach(detach$b), k = claim_space$8(H), L = claim_element$7(H, "DIV", { class: !0 }); - var he = children$8(L); - z = claim_element$7(he, "SPAN", { + ), $ = claim_text$4(ue, " > 50)"), ue.forEach(detach$b), te.forEach(detach$b), k = claim_space$8(H), L = claim_element$7(H, "DIV", { class: !0 }); + var de = children$8(L); + z = claim_element$7(de, "SPAN", { class: !0, style: !0, "data-svelte-h": !0 - }), get_svelte_dataset$2(z) !== "svelte-gwtl5e" && (z.textContent = O), R = claim_element$7(he, "SPAN", { class: !0 }); - var le = children$8(R); - P = claim_text$4(le, "Very low ("), U = claim_text$4( - le, + }), get_svelte_dataset$2(z) !== "svelte-gwtl5e" && (z.textContent = O), R = claim_element$7(de, "SPAN", { class: !0 }); + var oe = children$8(R); + N = claim_text$4(oe, "Very low ("), W = claim_text$4( + oe, /*confidenceLabel*/ n[2] - ), B = claim_text$4(le, " < 50)"), le.forEach(detach$b), he.forEach(detach$b), H.forEach(detach$b), G.forEach(detach$b), this.h(); + ), B = claim_text$4(oe, " < 50)"), oe.forEach(detach$b), de.forEach(detach$b), H.forEach(detach$b), G.forEach(detach$b), this.h(); }, h() { - attr$8(a, "class", "w-4 h-4 svelte-1skivl7"), set_style$4(a, "background-color", "rgb(0, 83, 214)"), attr$8(d, "class", "legendlabel svelte-1skivl7"), attr$8(r, "class", "flex space-x-1 py-1 items-center svelte-1skivl7"), attr$8(w, "class", "w-4 h-4 svelte-1skivl7"), set_style$4(w, "background-color", "rgb(101, 203, 243)"), attr$8(A, "class", "legendlabel svelte-1skivl7"), attr$8(y, "class", "flex space-x-1 py-1 items-center svelte-1skivl7"), attr$8(x, "class", "w-4 h-4 svelte-1skivl7"), set_style$4(x, "background-color", "rgb(255, 219, 19)"), attr$8(v, "class", "legendlabel svelte-1skivl7"), attr$8(g, "class", "flex space-x-1 py-1 items-center svelte-1skivl7"), attr$8(z, "class", "w-4 h-4 svelte-1skivl7"), set_style$4(z, "background-color", "rgb(255, 125, 69)"), attr$8(R, "class", "legendlabel svelte-1skivl7"), attr$8(L, "class", "flex space-x-1 py-1 items-center svelte-1skivl7"), attr$8(t, "class", "flex text-sm items-center space-x-2 justify-center svelte-1skivl7"), attr$8(e, "class", "absolute bottom-0 left-0 z-50 p-2 -mb-2 w-full bg-white svelte-1skivl7"); + attr$8(a, "class", "w-4 h-4 svelte-1skivl7"), set_style$4(a, "background-color", "rgb(0, 83, 214)"), attr$8(h, "class", "legendlabel svelte-1skivl7"), attr$8(r, "class", "flex space-x-1 py-1 items-center svelte-1skivl7"), attr$8(x, "class", "w-4 h-4 svelte-1skivl7"), set_style$4(x, "background-color", "rgb(101, 203, 243)"), attr$8(A, "class", "legendlabel svelte-1skivl7"), attr$8(y, "class", "flex space-x-1 py-1 items-center svelte-1skivl7"), attr$8(w, "class", "w-4 h-4 svelte-1skivl7"), set_style$4(w, "background-color", "rgb(255, 219, 19)"), attr$8(v, "class", "legendlabel svelte-1skivl7"), attr$8(g, "class", "flex space-x-1 py-1 items-center svelte-1skivl7"), attr$8(z, "class", "w-4 h-4 svelte-1skivl7"), set_style$4(z, "background-color", "rgb(255, 125, 69)"), attr$8(R, "class", "legendlabel svelte-1skivl7"), attr$8(L, "class", "flex space-x-1 py-1 items-center svelte-1skivl7"), attr$8(t, "class", "flex text-sm items-center space-x-2 justify-center svelte-1skivl7"), attr$8(e, "class", "absolute bottom-0 left-0 z-50 p-2 -mb-2 w-full bg-white svelte-1skivl7"); }, - m(N, G) { - insert_hydration$b(N, e, G), append_hydration$8(e, t), append_hydration$8(t, r), append_hydration$8(r, a), append_hydration$8(r, d), append_hydration$8(d, o), append_hydration$8(d, u), append_hydration$8(d, p), append_hydration$8(t, m), append_hydration$8(t, y), append_hydration$8(y, w), append_hydration$8(y, A), append_hydration$8(A, f), append_hydration$8(A, s), append_hydration$8(A, h), append_hydration$8(t, _), append_hydration$8(t, g), append_hydration$8(g, x), append_hydration$8(g, v), append_hydration$8(v, M), append_hydration$8(v, E), append_hydration$8(v, $), append_hydration$8(t, k), append_hydration$8(t, L), append_hydration$8(L, z), append_hydration$8(L, R), append_hydration$8(R, P), append_hydration$8(R, U), append_hydration$8(R, B); + m(P, G) { + insert_hydration$b(P, e, G), append_hydration$8(e, t), append_hydration$8(t, r), append_hydration$8(r, a), append_hydration$8(r, h), append_hydration$8(h, c), append_hydration$8(h, d), append_hydration$8(h, _), append_hydration$8(t, m), append_hydration$8(t, y), append_hydration$8(y, x), append_hydration$8(y, A), append_hydration$8(A, f), append_hydration$8(A, s), append_hydration$8(A, u), append_hydration$8(t, p), append_hydration$8(t, g), append_hydration$8(g, w), append_hydration$8(g, v), append_hydration$8(v, M), append_hydration$8(v, E), append_hydration$8(v, $), append_hydration$8(t, k), append_hydration$8(t, L), append_hydration$8(L, z), append_hydration$8(L, R), append_hydration$8(R, N), append_hydration$8(R, W), append_hydration$8(R, B); }, - p(N, G) { + p(P, G) { G[0] & /*confidenceLabel*/ 4 && set_data$3( - u, + d, /*confidenceLabel*/ - N[2] + P[2] ), G[0] & /*confidenceLabel*/ 4 && set_data$3( s, /*confidenceLabel*/ - N[2] + P[2] ), G[0] & /*confidenceLabel*/ 4 && set_data$3( E, /*confidenceLabel*/ - N[2] + P[2] ), G[0] & /*confidenceLabel*/ 4 && set_data$3( - U, + W, /*confidenceLabel*/ - N[2] + P[2] ); }, - d(N) { - N && detach$b(e); + d(P) { + P && detach$b(e); + } + }; +} +function create_if_block_8$1(n) { + let e, t = '
Kyte & Doolittle hydrophobicity scale:
 Hydrophobic
 Neutral
 Hydrophilic
'; + return { + c() { + e = element$7("div"), e.innerHTML = t, this.h(); + }, + l(r) { + e = claim_element$7(r, "DIV", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$2(e) !== "svelte-n84ddp" && (e.innerHTML = t), this.h(); + }, + h() { + attr$8(e, "class", "absolute bottom-0 left-0 z-50 p-2 mb-2 w-full bg-white svelte-1skivl7"); + }, + m(r, a) { + insert_hydration$b(r, e, a); + }, + d(r) { + r && detach$b(e); } }; } function create_if_block_6$1(n) { let e; - function t(l, d) { + function t(l, h) { return ( /*isAnimated*/ l[10] ? create_else_block$6 : create_if_block_7$1 @@ -41410,17 +41430,17 @@ function create_if_block_6$1(n) { }, l(l) { e = claim_element$7(l, "DIV", { class: !0 }); - var d = children$8(e); - a.l(d), d.forEach(detach$b), this.h(); + var h = children$8(e); + a.l(h), h.forEach(detach$b), this.h(); }, h() { attr$8(e, "class", "absolute z-50 bottom-0 right-0 mr-2 flex divide-x border border-gray-200 mb-2 rounded items-center justify-center svelte-1skivl7"); }, - m(l, d) { - insert_hydration$b(l, e, d), a.m(e, null); + m(l, h) { + insert_hydration$b(l, e, h), a.m(e, null); }, - p(l, d) { - r === (r = t(l)) && a ? a.p(l, d) : (a.d(1), a = r(l), a && (a.c(), a.m(e, null))); + p(l, h) { + r === (r = t(l)) && a ? a.p(l, h) : (a.d(1), a = r(l), a && (a.c(), a.m(e, null))); }, d(l) { l && detach$b(e), a.d(); @@ -41443,12 +41463,12 @@ function create_else_block$6(n) { h() { attr$8(e, "class", "p-2 svelte-1skivl7"), attr$8(e, "title", "Pause"); }, - m(l, d) { - insert_hydration$b(l, e, d), r || (a = listen$2( + m(l, h) { + insert_hydration$b(l, e, h), r || (a = listen$2( e, "click", /*toggleAnimation*/ - n[19] + n[20] ), r = !0); }, p: noop$7, @@ -41473,12 +41493,12 @@ function create_if_block_7$1(n) { h() { attr$8(e, "class", "p-2 svelte-1skivl7"), attr$8(e, "title", "Play"); }, - m(l, d) { - insert_hydration$b(l, e, d), r || (a = listen$2( + m(l, h) { + insert_hydration$b(l, e, h), r || (a = listen$2( e, "click", /*toggleAnimation*/ - n[19] + n[20] ), r = !0); }, p: noop$7, @@ -41488,18 +41508,18 @@ function create_if_block_7$1(n) { }; } function create_if_block_2$3(n) { - let e, t, r, a = "Settings", l, d, o = ' Close menu', u, p, m, y, w, b = "Label atoms on hover", A, f, s, h, _, g, x, c = ensure_array_like$2(Object.keys( + let e, t, r, a = "Settings", l, h, c = ' Close menu', d, _, m, y, x, b = "Label atoms on hover", A, f, s, u, p, g, w, o = ensure_array_like$2(Object.keys( /*config*/ n[0] )), v = []; - for (let M = 0; M < c.length; M += 1) - v[M] = create_each_block_2(get_each_context_2(n, c, M)); + for (let M = 0; M < o.length; M += 1) + v[M] = create_each_block_2(get_each_context_2(n, o, M)); return { c() { - e = element$7("div"), t = element$7("div"), r = element$7("h5"), r.textContent = a, l = space$8(), d = element$7("button"), d.innerHTML = o, u = space$8(); + e = element$7("div"), t = element$7("div"), r = element$7("h5"), r.textContent = a, l = space$8(), h = element$7("button"), h.innerHTML = c, d = space$8(); for (let M = 0; M < v.length; M += 1) v[M].c(); - p = space$8(), m = element$7("div"), y = element$7("div"), w = element$7("label"), w.textContent = b, A = space$8(), f = element$7("label"), s = element$7("input"), h = space$8(), _ = element$7("div"), this.h(); + _ = space$8(), m = element$7("div"), y = element$7("div"), x = element$7("label"), x.textContent = b, A = space$8(), f = element$7("label"), s = element$7("input"), u = space$8(), p = element$7("div"), this.h(); }, l(M) { e = claim_element$7(M, "DIV", { @@ -41515,64 +41535,64 @@ function create_if_block_2$3(n) { id: !0, class: !0, "data-svelte-h": !0 - }), get_svelte_dataset$2(r) !== "svelte-17gte" && (r.textContent = a), l = claim_space$8($), d = claim_element$7($, "BUTTON", { + }), get_svelte_dataset$2(r) !== "svelte-17gte" && (r.textContent = a), l = claim_space$8($), h = claim_element$7($, "BUTTON", { type: !0, "data-drawer-hide": !0, "aria-controls": !0, class: !0, "data-svelte-h": !0 - }), get_svelte_dataset$2(d) !== "svelte-1qzp5va" && (d.innerHTML = o), $.forEach(detach$b), u = claim_space$8(E); + }), get_svelte_dataset$2(h) !== "svelte-1qzp5va" && (h.innerHTML = c), $.forEach(detach$b), d = claim_space$8(E); for (let O = 0; O < v.length; O += 1) v[O].l(E); - p = claim_space$8(E), m = claim_element$7(E, "DIV", { class: !0 }); + _ = claim_space$8(E), m = claim_element$7(E, "DIV", { class: !0 }); var k = children$8(m); y = claim_element$7(k, "DIV", { class: !0 }); var L = children$8(y); - w = claim_element$7(L, "LABEL", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$2(w) !== "svelte-1l09ghj" && (w.textContent = b), A = claim_space$8(L), f = claim_element$7(L, "LABEL", { class: !0 }); + x = claim_element$7(L, "LABEL", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$2(x) !== "svelte-1l09ghj" && (x.textContent = b), A = claim_space$8(L), f = claim_element$7(L, "LABEL", { class: !0 }); var z = children$8(f); - s = claim_element$7(z, "INPUT", { type: !0, class: !0 }), h = claim_space$8(z), _ = claim_element$7(z, "DIV", { class: !0 }), children$8(_).forEach(detach$b), z.forEach(detach$b), L.forEach(detach$b), k.forEach(detach$b), E.forEach(detach$b), this.h(); + s = claim_element$7(z, "INPUT", { type: !0, class: !0 }), u = claim_space$8(z), p = claim_element$7(z, "DIV", { class: !0 }), children$8(p).forEach(detach$b), z.forEach(detach$b), L.forEach(detach$b), k.forEach(detach$b), E.forEach(detach$b), this.h(); }, h() { - attr$8(r, "id", "settings-drawer-label"), attr$8(r, "class", "inline-flex items-center mb-4 text-base font-semibold text-gray-500 dark:text-gray-400 svelte-1skivl7"), attr$8(d, "type", "button"), attr$8(d, "data-drawer-hide", "drawer-example"), attr$8(d, "aria-controls", "drawer-example"), attr$8(d, "class", "text-gray-400 bg-transparent hover:bg-gray-200 hover:text-gray-900 rounded-lg text-sm p-1.5 absolute top-2.5 right-2.5 inline-flex items-center dark:hover:bg-gray-600 dark:hover:text-white svelte-1skivl7"), attr$8(t, "class", "p-4 svelte-1skivl7"), attr$8(w, "class", "text-sm font-medium text-gray-600 dark:text-gray-400 w-1/2 svelte-1skivl7"), attr$8(s, "type", "checkbox"), attr$8(s, "class", "sr-only peer svelte-1skivl7"), attr$8(_, "class", "w-11 h-6 bg-gray-200 rounded-full peer dark:bg-gray-700 peer-focus:ring-4 peer-focus:ring-orange-300 dark:peer-focus:ring-orange-800 peer-checked:after:translate-x-full peer-checked:after:border-white after:content-[''] after:absolute after:top-0.5 after:left-[2px] after:bg-white after:border-gray-300 after:border after:rounded-full after:h-5 after:w-5 after:transition-all dark:border-gray-600 peer-checked:bg-orange-400 svelte-1skivl7"), attr$8(f, "class", "relative inline-flex items-center mr-5 cursor-pointer text-center justify-center svelte-1skivl7"), attr$8(y, "class", "flex items-center border-t border-b border-gray-200 bg-white px-4 py-2 space-x-2 svelte-1skivl7"), attr$8(m, "class", "bg-white svelte-1skivl7"), attr$8(e, "id", "settings-drawer"), attr$8(e, "class", "absolute top-0 right-0 z-50 h-full overflow-y-auto transition-transform bg-gray-100 w-80 dark:bg-gray-800 svelte-1skivl7"), attr$8(e, "tabindex", "-1"), attr$8(e, "aria-labelledby", "settings-drawer-label"); + attr$8(r, "id", "settings-drawer-label"), attr$8(r, "class", "inline-flex items-center mb-4 text-base font-semibold text-gray-500 dark:text-gray-400 svelte-1skivl7"), attr$8(h, "type", "button"), attr$8(h, "data-drawer-hide", "drawer-example"), attr$8(h, "aria-controls", "drawer-example"), attr$8(h, "class", "text-gray-400 bg-transparent hover:bg-gray-200 hover:text-gray-900 rounded-lg text-sm p-1.5 absolute top-2.5 right-2.5 inline-flex items-center dark:hover:bg-gray-600 dark:hover:text-white svelte-1skivl7"), attr$8(t, "class", "p-4 svelte-1skivl7"), attr$8(x, "class", "text-sm font-medium text-gray-600 dark:text-gray-400 w-1/2 svelte-1skivl7"), attr$8(s, "type", "checkbox"), attr$8(s, "class", "sr-only peer svelte-1skivl7"), attr$8(p, "class", "w-11 h-6 bg-gray-200 rounded-full peer dark:bg-gray-700 peer-focus:ring-4 peer-focus:ring-orange-300 dark:peer-focus:ring-orange-800 peer-checked:after:translate-x-full peer-checked:after:border-white after:content-[''] after:absolute after:top-0.5 after:left-[2px] after:bg-white after:border-gray-300 after:border after:rounded-full after:h-5 after:w-5 after:transition-all dark:border-gray-600 peer-checked:bg-orange-400 svelte-1skivl7"), attr$8(f, "class", "relative inline-flex items-center mr-5 cursor-pointer text-center justify-center svelte-1skivl7"), attr$8(y, "class", "flex items-center border-t border-b border-gray-200 bg-white px-4 py-2 space-x-2 svelte-1skivl7"), attr$8(m, "class", "bg-white svelte-1skivl7"), attr$8(e, "id", "settings-drawer"), attr$8(e, "class", "absolute top-0 right-0 z-50 h-full overflow-y-auto transition-transform bg-gray-100 w-80 dark:bg-gray-800 svelte-1skivl7"), attr$8(e, "tabindex", "-1"), attr$8(e, "aria-labelledby", "settings-drawer-label"); }, m(M, E) { - insert_hydration$b(M, e, E), append_hydration$8(e, t), append_hydration$8(t, r), append_hydration$8(t, l), append_hydration$8(t, d), append_hydration$8(e, u); + insert_hydration$b(M, e, E), append_hydration$8(e, t), append_hydration$8(t, r), append_hydration$8(t, l), append_hydration$8(t, h), append_hydration$8(e, d); for (let $ = 0; $ < v.length; $ += 1) v[$] && v[$].m(e, null); - append_hydration$8(e, p), append_hydration$8(e, m), append_hydration$8(m, y), append_hydration$8(y, w), append_hydration$8(y, A), append_hydration$8(y, f), append_hydration$8(f, s), set_input_value$1( + append_hydration$8(e, _), append_hydration$8(e, m), append_hydration$8(m, y), append_hydration$8(y, x), append_hydration$8(y, A), append_hydration$8(y, f), append_hydration$8(f, s), set_input_value$1( s, /*labelHover*/ n[5] - ), append_hydration$8(f, h), append_hydration$8(f, _), g || (x = [ + ), append_hydration$8(f, u), append_hydration$8(f, p), g || (w = [ listen$2( - d, + h, "click", /*toggleOffCanvas*/ - n[14] + n[15] ), listen$2( s, "change", /*input_change_handler_1*/ - n[25] + n[26] ) ], g = !0); }, p(M, E) { if (E[0] & /*config, settings*/ - 4097) { - c = ensure_array_like$2(Object.keys( + 8193) { + o = ensure_array_like$2(Object.keys( /*config*/ M[0] )); let $; - for ($ = 0; $ < c.length; $ += 1) { - const k = get_each_context_2(M, c, $); - v[$] ? v[$].p(k, E) : (v[$] = create_each_block_2(k), v[$].c(), v[$].m(e, p)); + for ($ = 0; $ < o.length; $ += 1) { + const k = get_each_context_2(M, o, $); + v[$] ? v[$].p(k, E) : (v[$] = create_each_block_2(k), v[$].c(), v[$].m(e, _)); } for (; $ < v.length; $ += 1) v[$].d(1); - v.length = c.length; + v.length = o.length; } E[0] & /*labelHover*/ 32 && set_input_value$1( @@ -41582,71 +41602,71 @@ function create_if_block_2$3(n) { ); }, d(M) { - M && detach$b(e), destroy_each$2(v, M), g = !1, run_all$2(x); + M && detach$b(e), destroy_each$2(v, M), g = !1, run_all$2(w); } }; } function create_if_block_5$1(n) { - let e, t, r, a, l, d; - function o() { - n[22].call( + let e, t, r, a, l, h; + function c() { + n[23].call( t, /*setting*/ - n[59] + n[64] ); } return { c() { e = element$7("label"), t = element$7("input"), r = space$8(), a = element$7("div"), this.h(); }, - l(u) { - e = claim_element$7(u, "LABEL", { class: !0 }); - var p = children$8(e); - t = claim_element$7(p, "INPUT", { type: !0, class: !0 }), r = claim_space$8(p), a = claim_element$7(p, "DIV", { class: !0 }), children$8(a).forEach(detach$b), p.forEach(detach$b), this.h(); + l(d) { + e = claim_element$7(d, "LABEL", { class: !0 }); + var _ = children$8(e); + t = claim_element$7(_, "INPUT", { type: !0, class: !0 }), r = claim_space$8(_), a = claim_element$7(_, "DIV", { class: !0 }), children$8(a).forEach(detach$b), _.forEach(detach$b), this.h(); }, h() { attr$8(t, "type", "checkbox"), t.__value = "", set_input_value$1(t, t.__value), attr$8(t, "class", "sr-only peer svelte-1skivl7"), attr$8(a, "class", "w-11 h-6 bg-gray-200 rounded-full peer dark:bg-gray-700 peer-focus:ring-4 peer-focus:ring-orange-300 dark:peer-focus:ring-orange-800 peer-checked:after:translate-x-full peer-checked:after:border-white after:content-[''] after:absolute after:top-0.5 after:left-[2px] after:bg-white after:border-gray-300 after:border after:rounded-full after:h-5 after:w-5 after:transition-all dark:border-gray-600 peer-checked:bg-orange-400 svelte-1skivl7"), attr$8(e, "class", "relative inline-flex items-center mr-5 cursor-pointer text-center justify-center svelte-1skivl7"); }, - m(u, p) { - insert_hydration$b(u, e, p), append_hydration$8(e, t), t.checked = /*config*/ + m(d, _) { + insert_hydration$b(d, e, _), append_hydration$8(e, t), t.checked = /*config*/ n[0][ /*setting*/ - n[59] - ], append_hydration$8(e, r), append_hydration$8(e, a), l || (d = listen$2(t, "change", o), l = !0); + n[64] + ], append_hydration$8(e, r), append_hydration$8(e, a), l || (h = listen$2(t, "change", c), l = !0); }, - p(u, p) { - n = u, p[0] & /*config, settings*/ - 4097 && (t.checked = /*config*/ + p(d, _) { + n = d, _[0] & /*config, settings*/ + 8193 && (t.checked = /*config*/ n[0][ /*setting*/ - n[59] + n[64] ]); }, - d(u) { - u && detach$b(e), l = !1, d(); + d(d) { + d && detach$b(e), l = !1, h(); } }; } function create_if_block_4$1(n) { - let e, t, r, a, l, d, o, u, p = ( + let e, t, r, a, l, h, c, d, _ = ( /*config*/ n[0][ /*setting*/ - n[59] + n[64] ] + "" - ), m, y, w; + ), m, y, x; function b() { return ( /*change_handler*/ - n[23]( + n[24]( /*setting*/ - n[59] + n[64] ) ); } return { c() { - e = element$7("div"), t = element$7("input"), o = space$8(), u = element$7("span"), m = text$4(p), this.h(); + e = element$7("div"), t = element$7("input"), c = space$8(), d = element$7("span"), m = text$4(_), this.h(); }, l(A) { e = claim_element$7(A, "DIV", { class: !0 }); @@ -41658,93 +41678,93 @@ function create_if_block_4$1(n) { max: !0, step: !0, class: !0 - }), o = claim_space$8(f), u = claim_element$7(f, "SPAN", { class: !0 }); - var s = children$8(u); - m = claim_text$4(s, p), s.forEach(detach$b), f.forEach(detach$b), this.h(); + }), c = claim_space$8(f), d = claim_element$7(f, "SPAN", { class: !0 }); + var s = children$8(d); + m = claim_text$4(s, _), s.forEach(detach$b), f.forEach(detach$b), this.h(); }, h() { attr$8(t, "id", "medium-range"), attr$8(t, "type", "range"), t.value = r = /*config*/ n[0][ /*setting*/ - n[59] + n[64] ], attr$8(t, "min", a = /*settings*/ - n[12][ + n[13][ /*setting*/ - n[59] + n[64] ].min), attr$8(t, "max", l = /*settings*/ - n[12][ + n[13][ /*setting*/ - n[59] - ].max), attr$8(t, "step", d = /*settings*/ - n[12][ + n[64] + ].max), attr$8(t, "step", h = /*settings*/ + n[13][ /*setting*/ - n[59] - ].step), attr$8(t, "class", "w-2/3 h-2 bg-gray-200 rounded-lg appearance-none cursor-pointer dark:bg-gray-700 svelte-1skivl7"), attr$8(u, "class", "w-1/3 text-center text-sm font-medium text-gray-600 dark:text-gray-400 svelte-1skivl7"), attr$8(e, "class", "flex items-center svelte-1skivl7"); + n[64] + ].step), attr$8(t, "class", "w-2/3 h-2 bg-gray-200 rounded-lg appearance-none cursor-pointer dark:bg-gray-700 svelte-1skivl7"), attr$8(d, "class", "w-1/3 text-center text-sm font-medium text-gray-600 dark:text-gray-400 svelte-1skivl7"), attr$8(e, "class", "flex items-center svelte-1skivl7"); }, m(A, f) { - insert_hydration$b(A, e, f), append_hydration$8(e, t), append_hydration$8(e, o), append_hydration$8(e, u), append_hydration$8(u, m), y || (w = listen$2(t, "change", b), y = !0); + insert_hydration$b(A, e, f), append_hydration$8(e, t), append_hydration$8(e, c), append_hydration$8(e, d), append_hydration$8(d, m), y || (x = listen$2(t, "change", b), y = !0); }, p(A, f) { n = A, f[0] & /*config, settings*/ - 4097 && r !== (r = /*config*/ + 8193 && r !== (r = /*config*/ n[0][ /*setting*/ - n[59] + n[64] ]) && (t.value = r), f[0] & /*config, settings*/ - 4097 && a !== (a = /*settings*/ - n[12][ + 8193 && a !== (a = /*settings*/ + n[13][ /*setting*/ - n[59] + n[64] ].min) && attr$8(t, "min", a), f[0] & /*config, settings*/ - 4097 && l !== (l = /*settings*/ - n[12][ + 8193 && l !== (l = /*settings*/ + n[13][ /*setting*/ - n[59] + n[64] ].max) && attr$8(t, "max", l), f[0] & /*config, settings*/ - 4097 && d !== (d = /*settings*/ - n[12][ + 8193 && h !== (h = /*settings*/ + n[13][ /*setting*/ - n[59] - ].step) && attr$8(t, "step", d), f[0] & /*config*/ - 1 && p !== (p = /*config*/ + n[64] + ].step) && attr$8(t, "step", h), f[0] & /*config*/ + 1 && _ !== (_ = /*config*/ n[0][ /*setting*/ - n[59] - ] + "") && set_data$3(m, p); + n[64] + ] + "") && set_data$3(m, _); }, d(A) { - A && detach$b(e), y = !1, w(); + A && detach$b(e), y = !1, x(); } }; } function create_if_block_3$1(n) { - let e, t, r, a, l, d, o, u, p = ensure_array_like$2( + let e, t, r, a, l, h, c, d, _ = ensure_array_like$2( /*settings*/ - n[12][ + n[13][ /*setting*/ - n[59] + n[64] ].options ), m = []; - for (let w = 0; w < p.length; w += 1) - m[w] = create_each_block_3(get_each_context_3(n, p, w)); + for (let x = 0; x < _.length; x += 1) + m[x] = create_each_block_3(get_each_context_3(n, _, x)); function y() { - n[24].call( + n[25].call( l, /*setting*/ - n[59] + n[64] ); } return { c() { e = element$7("label"), t = text$4("Select style"), a = space$8(), l = element$7("select"); - for (let w = 0; w < m.length; w += 1) - m[w].c(); + for (let x = 0; x < m.length; x += 1) + m[x].c(); this.h(); }, - l(w) { - e = claim_element$7(w, "LABEL", { for: !0, class: !0 }); + l(x) { + e = claim_element$7(x, "LABEL", { for: !0, class: !0 }); var b = children$8(e); - t = claim_text$4(b, "Select style"), b.forEach(detach$b), a = claim_space$8(w), l = claim_element$7(w, "SELECT", { id: !0, class: !0 }); + t = claim_text$4(b, "Select style"), b.forEach(detach$b), a = claim_space$8(x), l = claim_element$7(x, "SELECT", { id: !0, class: !0 }); var A = children$8(l); for (let f = 0; f < m.length; f += 1) m[f].l(A); @@ -41752,15 +41772,15 @@ function create_if_block_3$1(n) { }, h() { attr$8(e, "for", r = /*setting*/ - n[59]), attr$8(e, "class", "sr-only svelte-1skivl7"), attr$8(l, "id", d = /*setting*/ - n[59]), attr$8(l, "class", "bg-gray-50 border border-gray-300 text-gray-900 text-sm rounded-lg focus:ring-blue-500 focus:border-blue-500 block w-full p-2.5 dark:bg-gray-700 dark:border-gray-600 dark:placeholder-gray-400 dark:text-white dark:focus:ring-blue-500 dark:focus:border-blue-500 svelte-1skivl7"), /*config*/ + n[64]), attr$8(e, "class", "sr-only svelte-1skivl7"), attr$8(l, "id", h = /*setting*/ + n[64]), attr$8(l, "class", "bg-gray-50 border border-gray-300 text-gray-900 text-sm rounded-lg focus:ring-blue-500 focus:border-blue-500 block w-full p-2.5 dark:bg-gray-700 dark:border-gray-600 dark:placeholder-gray-400 dark:text-white dark:focus:ring-blue-500 dark:focus:border-blue-500 svelte-1skivl7"), /*config*/ n[0][ /*setting*/ - n[59] + n[64] ] === void 0 && add_render_callback(y); }, - m(w, b) { - insert_hydration$b(w, e, b), append_hydration$8(e, t), insert_hydration$b(w, a, b), insert_hydration$b(w, l, b); + m(x, b) { + insert_hydration$b(x, e, b), append_hydration$8(e, t), insert_hydration$b(x, a, b), insert_hydration$b(x, l, b); for (let A = 0; A < m.length; A += 1) m[A] && m[A].m(l, null); select_option( @@ -41768,119 +41788,119 @@ function create_if_block_3$1(n) { /*config*/ n[0][ /*setting*/ - n[59] + n[64] ], !0 - ), o || (u = listen$2(l, "change", y), o = !0); - }, - p(w, b) { - if (n = w, b[0] & /*config, settings*/ - 4097 && r !== (r = /*setting*/ - n[59]) && attr$8(e, "for", r), b[0] & /*settings, config*/ - 4097) { - p = ensure_array_like$2( + ), c || (d = listen$2(l, "change", y), c = !0); + }, + p(x, b) { + if (n = x, b[0] & /*config, settings*/ + 8193 && r !== (r = /*setting*/ + n[64]) && attr$8(e, "for", r), b[0] & /*settings, config*/ + 8193) { + _ = ensure_array_like$2( /*settings*/ - n[12][ + n[13][ /*setting*/ - n[59] + n[64] ].options ); let A; - for (A = 0; A < p.length; A += 1) { - const f = get_each_context_3(n, p, A); + for (A = 0; A < _.length; A += 1) { + const f = get_each_context_3(n, _, A); m[A] ? m[A].p(f, b) : (m[A] = create_each_block_3(f), m[A].c(), m[A].m(l, null)); } for (; A < m.length; A += 1) m[A].d(1); - m.length = p.length; + m.length = _.length; } b[0] & /*config, settings*/ - 4097 && d !== (d = /*setting*/ - n[59]) && attr$8(l, "id", d), b[0] & /*config, settings*/ - 4097 && select_option( + 8193 && h !== (h = /*setting*/ + n[64]) && attr$8(l, "id", h), b[0] & /*config, settings*/ + 8193 && select_option( l, /*config*/ n[0][ /*setting*/ - n[59] + n[64] ] ); }, - d(w) { - w && (detach$b(e), detach$b(a), detach$b(l)), destroy_each$2(m, w), o = !1, u(); + d(x) { + x && (detach$b(e), detach$b(a), detach$b(l)), destroy_each$2(m, x), c = !1, d(); } }; } function create_each_block_3(n) { let e, t = ( /*option*/ - n[62] + "" + n[67] + "" ), r, a, l; return { c() { e = element$7("option"), r = text$4(t), this.h(); }, - l(d) { - e = claim_element$7(d, "OPTION", { class: !0 }); - var o = children$8(e); - r = claim_text$4(o, t), o.forEach(detach$b), this.h(); + l(h) { + e = claim_element$7(h, "OPTION", { class: !0 }); + var c = children$8(e); + r = claim_text$4(c, t), c.forEach(detach$b), this.h(); }, h() { e.__value = a = /*option*/ - n[62], set_input_value$1(e, e.__value), e.selected = l = /*option*/ - n[62] == /*config*/ + n[67], set_input_value$1(e, e.__value), e.selected = l = /*option*/ + n[67] == /*config*/ n[0][ /*setting*/ - n[59] + n[64] ], attr$8(e, "class", "svelte-1skivl7"); }, - m(d, o) { - insert_hydration$b(d, e, o), append_hydration$8(e, r); + m(h, c) { + insert_hydration$b(h, e, c), append_hydration$8(e, r); }, - p(d, o) { - o[0] & /*config*/ + p(h, c) { + c[0] & /*config*/ 1 && t !== (t = /*option*/ - d[62] + "") && set_data$3(r, t), o[0] & /*config, settings*/ - 4097 && a !== (a = /*option*/ - d[62]) && (e.__value = a, set_input_value$1(e, e.__value)), o[0] & /*config, settings*/ - 4097 && l !== (l = /*option*/ - d[62] == /*config*/ - d[0][ + h[67] + "") && set_data$3(r, t), c[0] & /*config, settings*/ + 8193 && a !== (a = /*option*/ + h[67]) && (e.__value = a, set_input_value$1(e, e.__value)), c[0] & /*config, settings*/ + 8193 && l !== (l = /*option*/ + h[67] == /*config*/ + h[0][ /*setting*/ - d[59] + h[64] ]) && (e.selected = l); }, - d(d) { - d && detach$b(e); + d(h) { + h && detach$b(e); } }; } function create_each_block_2(n) { let e, t, r, a = ( /*setting*/ - n[59] + "" - ), l, d, o, u, p, m = ( + n[64] + "" + ), l, h, c, d, _, m = ( /*settings*/ - n[12][ + n[13][ /*setting*/ - n[59] + n[64] ].type == "toggle" && create_if_block_5$1(n) ), y = ( /*settings*/ - n[12][ + n[13][ /*setting*/ - n[59] + n[64] ].type == "range" && create_if_block_4$1(n) - ), w = ( + ), x = ( /*settings*/ - n[12][ + n[13][ /*setting*/ - n[59] + n[64] ].type == "select" && create_if_block_3$1(n) ); return { c() { - e = element$7("div"), t = element$7("div"), r = element$7("label"), l = text$4(a), o = space$8(), m && m.c(), u = space$8(), y && y.c(), p = space$8(), w && w.c(), this.h(); + e = element$7("div"), t = element$7("div"), r = element$7("label"), l = text$4(a), c = space$8(), m && m.c(), d = space$8(), y && y.c(), _ = space$8(), x && x.c(), this.h(); }, l(b) { e = claim_element$7(b, "DIV", { class: !0 }); @@ -41889,41 +41909,41 @@ function create_each_block_2(n) { var f = children$8(t); r = claim_element$7(f, "LABEL", { for: !0, class: !0 }); var s = children$8(r); - l = claim_text$4(s, a), s.forEach(detach$b), o = claim_space$8(f), m && m.l(f), u = claim_space$8(f), y && y.l(f), p = claim_space$8(f), w && w.l(f), f.forEach(detach$b), A.forEach(detach$b), this.h(); + l = claim_text$4(s, a), s.forEach(detach$b), c = claim_space$8(f), m && m.l(f), d = claim_space$8(f), y && y.l(f), _ = claim_space$8(f), x && x.l(f), f.forEach(detach$b), A.forEach(detach$b), this.h(); }, h() { - attr$8(r, "for", d = /*setting*/ - n[59]), attr$8(r, "class", "text-sm font-medium text-gray-600 dark:text-gray-400 w-1/2 svelte-1skivl7"), attr$8(t, "class", "flex items-center border-t border-b border-gray-200 bg-white px-4 py-2 space-x-2 svelte-1skivl7"), attr$8(e, "class", "flex flex-col mb-4 divide-y svelte-1skivl7"); + attr$8(r, "for", h = /*setting*/ + n[64]), attr$8(r, "class", "text-sm font-medium text-gray-600 dark:text-gray-400 w-1/2 svelte-1skivl7"), attr$8(t, "class", "flex items-center border-t border-b border-gray-200 bg-white px-4 py-2 space-x-2 svelte-1skivl7"), attr$8(e, "class", "flex flex-col mb-4 divide-y svelte-1skivl7"); }, m(b, A) { - insert_hydration$b(b, e, A), append_hydration$8(e, t), append_hydration$8(t, r), append_hydration$8(r, l), append_hydration$8(t, o), m && m.m(t, null), append_hydration$8(t, u), y && y.m(t, null), append_hydration$8(t, p), w && w.m(t, null); + insert_hydration$b(b, e, A), append_hydration$8(e, t), append_hydration$8(t, r), append_hydration$8(r, l), append_hydration$8(t, c), m && m.m(t, null), append_hydration$8(t, d), y && y.m(t, null), append_hydration$8(t, _), x && x.m(t, null); }, p(b, A) { A[0] & /*config*/ 1 && a !== (a = /*setting*/ - b[59] + "") && set_data$3(l, a), A[0] & /*config, settings*/ - 4097 && d !== (d = /*setting*/ - b[59]) && attr$8(r, "for", d), /*settings*/ - b[12][ + b[64] + "") && set_data$3(l, a), A[0] & /*config, settings*/ + 8193 && h !== (h = /*setting*/ + b[64]) && attr$8(r, "for", h), /*settings*/ + b[13][ /*setting*/ - b[59] - ].type == "toggle" ? m ? m.p(b, A) : (m = create_if_block_5$1(b), m.c(), m.m(t, u)) : m && (m.d(1), m = null), /*settings*/ - b[12][ + b[64] + ].type == "toggle" ? m ? m.p(b, A) : (m = create_if_block_5$1(b), m.c(), m.m(t, d)) : m && (m.d(1), m = null), /*settings*/ + b[13][ /*setting*/ - b[59] - ].type == "range" ? y ? y.p(b, A) : (y = create_if_block_4$1(b), y.c(), y.m(t, p)) : y && (y.d(1), y = null), /*settings*/ - b[12][ + b[64] + ].type == "range" ? y ? y.p(b, A) : (y = create_if_block_4$1(b), y.c(), y.m(t, _)) : y && (y.d(1), y = null), /*settings*/ + b[13][ /*setting*/ - b[59] - ].type == "select" ? w ? w.p(b, A) : (w = create_if_block_3$1(b), w.c(), w.m(t, null)) : w && (w.d(1), w = null); + b[64] + ].type == "select" ? x ? x.p(b, A) : (x = create_if_block_3$1(b), x.c(), x.m(t, null)) : x && (x.d(1), x = null); }, d(b) { - b && detach$b(e), m && m.d(), y && y.d(), w && w.d(); + b && detach$b(e), m && m.d(), y && y.d(), x && x.d(); } }; } function create_if_block$8(n) { - let e, t, r, a = "Representations", l, d, o = ' Close menu', u, p, m, y = '
Add representation
', w, b, A = ensure_array_like$2( + let e, t, r, a = "Representations", l, h, c = ' Close menu', d, _, m, y = '
Add representation
', x, b, A = ensure_array_like$2( /*representations*/ n[1] ), f = []; @@ -41931,10 +41951,10 @@ function create_if_block$8(n) { f[s] = create_each_block$2(get_each_context$2(n, A, s)); return { c() { - e = element$7("div"), t = element$7("div"), r = element$7("h5"), r.textContent = a, l = space$8(), d = element$7("button"), d.innerHTML = o, u = space$8(); + e = element$7("div"), t = element$7("div"), r = element$7("h5"), r.textContent = a, l = space$8(), h = element$7("button"), h.innerHTML = c, d = space$8(); for (let s = 0; s < f.length; s += 1) f[s].c(); - p = space$8(), m = element$7("button"), m.innerHTML = y, this.h(); + _ = space$8(), m = element$7("button"), m.innerHTML = y, this.h(); }, l(s) { e = claim_element$7(s, "DIV", { @@ -41943,691 +41963,763 @@ function create_if_block$8(n) { tabindex: !0, "aria-labelledby": !0 }); - var h = children$8(e); - t = claim_element$7(h, "DIV", { class: !0 }); - var _ = children$8(t); - r = claim_element$7(_, "H5", { + var u = children$8(e); + t = claim_element$7(u, "DIV", { class: !0 }); + var p = children$8(t); + r = claim_element$7(p, "H5", { id: !0, class: !0, "data-svelte-h": !0 - }), get_svelte_dataset$2(r) !== "svelte-1o7jz4z" && (r.textContent = a), l = claim_space$8(_), d = claim_element$7(_, "BUTTON", { + }), get_svelte_dataset$2(r) !== "svelte-1o7jz4z" && (r.textContent = a), l = claim_space$8(p), h = claim_element$7(p, "BUTTON", { type: !0, "data-drawer-hide": !0, "aria-controls": !0, class: !0, "data-svelte-h": !0 - }), get_svelte_dataset$2(d) !== "svelte-1nfxhie" && (d.innerHTML = o), _.forEach(detach$b), u = claim_space$8(h); + }), get_svelte_dataset$2(h) !== "svelte-1nfxhie" && (h.innerHTML = c), p.forEach(detach$b), d = claim_space$8(u); for (let g = 0; g < f.length; g += 1) - f[g].l(h); - p = claim_space$8(h), m = claim_element$7(h, "BUTTON", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$2(m) !== "svelte-dc168v" && (m.innerHTML = y), h.forEach(detach$b), this.h(); + f[g].l(u); + _ = claim_space$8(u), m = claim_element$7(u, "BUTTON", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$2(m) !== "svelte-dc168v" && (m.innerHTML = y), u.forEach(detach$b), this.h(); }, h() { - attr$8(r, "id", "drawer-label"), attr$8(r, "class", "inline-flex items-center mb-4 text-base font-semibold text-gray-500 dark:text-gray-400 svelte-1skivl7"), attr$8(d, "type", "button"), attr$8(d, "data-drawer-hide", "drawer-example"), attr$8(d, "aria-controls", "drawer-example"), attr$8(d, "class", "text-gray-400 bg-transparent hover:bg-gray-200 hover:text-gray-900 rounded-lg text-sm p-1.5 absolute top-2.5 right-2.5 inline-flex items-center dark:hover:bg-gray-600 dark:hover:text-white svelte-1skivl7"), attr$8(t, "class", "p-4 svelte-1skivl7"), attr$8(m, "class", "w-full flex text-orange-600 justify-center my-2 text-sm space-x-2 items-center hover:text-gray-600 cursor-pointer svelte-1skivl7"), attr$8(e, "id", "drawer-example"), attr$8(e, "class", "absolute top-0 right-0 z-50 h-full overflow-y-auto transition-transform bg-gray-100 w-80 dark:bg-gray-800 border-l border-gray-200 svelte-1skivl7"), attr$8(e, "tabindex", "-1"), attr$8(e, "aria-labelledby", "drawer-label"); + attr$8(r, "id", "drawer-label"), attr$8(r, "class", "inline-flex items-center mb-4 text-base font-semibold text-gray-500 dark:text-gray-400 svelte-1skivl7"), attr$8(h, "type", "button"), attr$8(h, "data-drawer-hide", "drawer-example"), attr$8(h, "aria-controls", "drawer-example"), attr$8(h, "class", "text-gray-400 bg-transparent hover:bg-gray-200 hover:text-gray-900 rounded-lg text-sm p-1.5 absolute top-2.5 right-2.5 inline-flex items-center dark:hover:bg-gray-600 dark:hover:text-white svelte-1skivl7"), attr$8(t, "class", "p-4 svelte-1skivl7"), attr$8(m, "class", "w-full flex text-orange-600 justify-center my-2 text-sm space-x-2 items-center hover:text-gray-600 cursor-pointer svelte-1skivl7"), attr$8(e, "id", "drawer-example"), attr$8(e, "class", "absolute top-0 right-0 z-50 h-full overflow-y-auto transition-transform bg-gray-100 w-80 dark:bg-gray-800 border-l border-gray-200 svelte-1skivl7"), attr$8(e, "tabindex", "-1"), attr$8(e, "aria-labelledby", "drawer-label"); }, - m(s, h) { - insert_hydration$b(s, e, h), append_hydration$8(e, t), append_hydration$8(t, r), append_hydration$8(t, l), append_hydration$8(t, d), append_hydration$8(e, u); - for (let _ = 0; _ < f.length; _ += 1) - f[_] && f[_].m(e, null); - append_hydration$8(e, p), append_hydration$8(e, m), w || (b = [ + m(s, u) { + insert_hydration$b(s, e, u), append_hydration$8(e, t), append_hydration$8(t, r), append_hydration$8(t, l), append_hydration$8(t, h), append_hydration$8(e, d); + for (let p = 0; p < f.length; p += 1) + f[p] && f[p].m(e, null); + append_hydration$8(e, _), append_hydration$8(e, m), x || (b = [ listen$2( - d, + h, "click", /*toggleOffCanvasReps*/ - n[15] + n[16] ), listen$2( m, "click", /*insertRep*/ - n[17] + n[18] ) - ], w = !0); + ], x = !0); }, - p(s, h) { - if (h[0] & /*representations, moldata, resetZoom, deleteRep*/ - 327690) { + p(s, u) { + if (u[0] & /*representations, moldata, resetZoom, deleteRep*/ + 655370) { A = ensure_array_like$2( /*representations*/ s[1] ); - let _; - for (_ = 0; _ < A.length; _ += 1) { - const g = get_each_context$2(s, A, _); - f[_] ? f[_].p(g, h) : (f[_] = create_each_block$2(g), f[_].c(), f[_].m(e, p)); + let p; + for (p = 0; p < A.length; p += 1) { + const g = get_each_context$2(s, A, p); + f[p] ? f[p].p(g, u) : (f[p] = create_each_block$2(g), f[p].c(), f[p].m(e, _)); } - for (; _ < f.length; _ += 1) - f[_].d(1); + for (; p < f.length; p += 1) + f[p].d(1); f.length = A.length; } }, d(s) { - s && detach$b(e), destroy_each$2(f, s), w = !1, run_all$2(b); + s && detach$b(e), destroy_each$2(f, s), x = !1, run_all$2(b); } }; } function create_if_block_1$6(n) { - let e, t, r, a, l, d, o, u, p, m, y, w, b, A = "Select style", f, s, h, _ = "Stick", g, x = "Cartoon", c, v = "Surface", M, E, $ = "Sphere", k, L, z, O = "Expand selection", R, P, U, B, N, G, H, W = "Å", V, re, ie, ee, ce = "Full residue", he, le, J, Me, se, Ce, ue, ne, _e = "Only sidechain", Oe, Re, Ue, We, Ee, Ae, ge, Le, Te, Ke, je, Y, q, te, we, me, Pe, Fe, K, fe, Se, Ne, pe, ke, X, Be, Ge, I, ye, ve, Z, de, $e, Ye, qe, Xe, at, dt, lt, ot, st, bt, _t, Lt, Gt, ft, Et, gt, Rt, Qe, xe, He = ensure_array_like$2( + let e, t, r, a, l, h, c, d, _, m, y, x, b, A = "Select style", f, s, u, p = "Stick", g, w = "Cartoon", o, v = "Surface", M, E, $ = "Sphere", k, L, z, O = "Opacity", R, N, W, B, P, G, H, U, j = "Expand selection", re, ie, te, ue, de, oe, J, Ee = "Å", se, Ae, he, ne, _e = "Full residue", Le, Be, Ue, He, We, Ge, Ne, Pe, Te = "Only sidechain", Me, De, V, Z, ee, ye, ce, Ie, ke, Y, me, we, Re, pe, $e, X, ze, Ve, I, xe, be, q, fe, Ce, Ze, Xe, Ye, lt, dt, it, ot, nt, Ct, ut, zt, Ut, wt, mt, vt, Rt, qe, ge, Ke, Qe, _t, Mt, St, It, Pt, Zt, Tt, mr, nr, Or, ft, Qt, Gt = ensure_array_like$2( /*moldata*/ n[3] - ), Ze = []; - for (let $t = 0; $t < He.length; $t += 1) - Ze[$t] = create_each_block_1$1(get_each_context_1$1(n, He, $t)); - function yt() { - n[29].call( + ), Nt = []; + for (let kt = 0; kt < Gt.length; kt += 1) + Nt[kt] = create_each_block_1$1(get_each_context_1$1(n, Gt, kt)); + function ar() { + n[30].call( r, /*each_value*/ - n[54], + n[59], /*index*/ - n[55] + n[60] ); } - function zt() { - n[30].call( + function zr() { + n[31].call( l, /*each_value*/ - n[54], + n[59], /*index*/ - n[55] + n[60] ); } - function Ft() { - n[31].call( - u, + function Ir() { + n[32].call( + d, /*each_value*/ - n[54], + n[59], /*index*/ - n[55] + n[60] ); } - function Bt() { - n[32].call( + function Br() { + n[33].call( m, /*each_value*/ - n[54], + n[59], /*index*/ - n[55] + n[60] ); } - function Nt() { - n[33].call( + function Dr() { + n[34].call( s, /*each_value*/ - n[54], + n[59], /*index*/ - n[55] + n[60] ); } - function Zt(...$t) { + function Rr(...kt) { return ( /*change_handler_1*/ - n[34]( + n[35]( /*rep*/ - n[53], + n[58], /*each_value*/ - n[54], + n[59], /*index*/ - n[55], - ...$t + n[60], + ...kt ) ); } - function Pt() { - n[35].call( - N, + function sr() { + n[36].call( + P, /*each_value*/ - n[54], + n[59], /*index*/ - n[55] + n[60] ); } - function mr() { - n[36].call( - J, + function vr(...kt) { + return ( + /*change_handler_2*/ + n[37]( + /*rep*/ + n[58], + /*each_value*/ + n[59], + /*index*/ + n[60], + ...kt + ) + ); + } + function Ht() { + n[38].call( + de, /*each_value*/ - n[54], + n[59], /*index*/ - n[55] + n[60] ); } function pr() { - n[37].call( + n[39].call( Ue, /*each_value*/ - n[54], + n[59], /*index*/ - n[55] + n[60] ); } - function qr() { + function lr() { + n[40].call( + V, + /*each_value*/ + n[59], + /*index*/ + n[60] + ); + } + function _r() { return ( /*click_handler_3*/ - n[38]( + n[41]( /*rep*/ - n[53], + n[58], /*each_value*/ - n[54], + n[59], /*index*/ - n[55] + n[60] ) ); } - function mt() { + function hi() { return ( /*click_handler_4*/ - n[39]( + n[42]( /*rep*/ - n[53], + n[58], /*each_value*/ - n[54], + n[59], /*index*/ - n[55] + n[60] ) ); } - function Jt() { + function or() { return ( /*click_handler_5*/ - n[40]( + n[43]( /*rep*/ - n[53], + n[58], /*each_value*/ - n[54], + n[59], /*index*/ - n[55] + n[60] ) ); } - function Xt() { + function Yr() { return ( /*click_handler_6*/ - n[41]( + n[44]( /*rep*/ - n[53], + n[58], /*each_value*/ - n[54], + n[59], /*index*/ - n[55] + n[60] ) ); } - function Qr() { + function tr() { return ( /*click_handler_7*/ - n[42]( + n[45]( /*rep*/ - n[53], + n[58], /*each_value*/ - n[54], + n[59], /*index*/ - n[55] + n[60] ) ); } - function sr() { + function fi() { return ( /*click_handler_8*/ - n[43]( + n[46]( /*rep*/ - n[53], + n[58], /*each_value*/ - n[54], + n[59], /*index*/ - n[55] + n[60] ) ); } - function Er() { + function Ci() { return ( /*click_handler_9*/ - n[44]( + n[47]( /*rep*/ - n[53], + n[58], /*each_value*/ - n[54], + n[59], /*index*/ - n[55] + n[60] ) ); } - function Sr() { + function rr() { return ( /*click_handler_10*/ - n[45]( + n[48]( /*rep*/ - n[53], + n[58], /*each_value*/ - n[54], + n[59], /*index*/ - n[55] + n[60] ) ); } - function Ar() { + function Kt() { return ( /*click_handler_11*/ - n[46]( + n[49]( /*rep*/ - n[53], + n[58], /*each_value*/ - n[54], + n[59], /*index*/ - n[55] + n[60] ) ); } - function Mr() { + function Yt() { return ( /*click_handler_12*/ - n[47]( + n[50]( /*rep*/ - n[53], + n[58], /*each_value*/ - n[54], + n[59], /*index*/ - n[55] + n[60] ) ); } - function Dr() { + function xt() { return ( /*click_handler_13*/ - n[48]( + n[51]( /*rep*/ - n[53], + n[58], /*each_value*/ - n[54], + n[59], /*index*/ - n[55] + n[60] ) ); } - function tr() { + function yr() { return ( /*click_handler_14*/ - n[49]( + n[52]( + /*rep*/ + n[58], + /*each_value*/ + n[59], + /*index*/ + n[60] + ) + ); + } + function Pr() { + return ( + /*click_handler_15*/ + n[53]( /*rep*/ - n[53], + n[58], /*each_value*/ - n[54], + n[59], /*index*/ - n[55] + n[60] ) ); } return { c() { e = element$7("div"), t = element$7("div"), r = element$7("select"); - for (let $t = 0; $t < Ze.length; $t += 1) - Ze[$t].c(); - a = space$8(), l = element$7("input"), d = space$8(), o = element$7("div"), u = element$7("input"), p = space$8(), m = element$7("input"), y = space$8(), w = element$7("div"), b = element$7("label"), b.textContent = A, f = space$8(), s = element$7("select"), h = element$7("option"), h.textContent = _, g = element$7("option"), g.textContent = x, c = element$7("option"), c.textContent = v, M = text$4(`$ - `), E = element$7("option"), E.textContent = $, k = space$8(), L = element$7("div"), z = element$7("div"), z.textContent = O, R = space$8(), P = element$7("input"), B = space$8(), N = element$7("input"), G = space$8(), H = element$7("div"), H.textContent = W, V = space$8(), re = element$7("div"), ie = element$7("div"), ee = element$7("span"), ee.textContent = ce, he = space$8(), le = element$7("label"), J = element$7("input"), Me = space$8(), se = element$7("div"), Ce = space$8(), ue = element$7("div"), ne = element$7("span"), ne.textContent = _e, Oe = space$8(), Re = element$7("label"), Ue = element$7("input"), We = space$8(), Ee = element$7("div"), Ae = space$8(), ge = element$7("div"), Le = element$7("button"), Ke = space$8(), je = element$7("button"), q = space$8(), te = element$7("button"), me = space$8(), Pe = element$7("button"), K = space$8(), fe = element$7("button"), Ne = space$8(), pe = element$7("button"), X = space$8(), Be = element$7("button"), I = space$8(), ye = element$7("div"), ve = element$7("button"), Z = text$4("AlphaFold"), $e = space$8(), Ye = element$7("button"), qe = text$4("PyMol"), at = space$8(), dt = element$7("button"), lt = text$4("Jmol"), st = space$8(), bt = element$7("button"), _t = text$4("Chain"), Gt = space$8(), ft = element$7("button"), Et = text$4("Spectrum"), this.h(); + for (let kt = 0; kt < Nt.length; kt += 1) + Nt[kt].c(); + a = space$8(), l = element$7("input"), h = space$8(), c = element$7("div"), d = element$7("input"), _ = space$8(), m = element$7("input"), y = space$8(), x = element$7("div"), b = element$7("label"), b.textContent = A, f = space$8(), s = element$7("select"), u = element$7("option"), u.textContent = p, g = element$7("option"), g.textContent = w, o = element$7("option"), o.textContent = v, M = text$4(`$ + `), E = element$7("option"), E.textContent = $, k = space$8(), L = element$7("div"), z = element$7("div"), z.textContent = O, R = space$8(), N = element$7("input"), B = space$8(), P = element$7("input"), G = space$8(), H = element$7("div"), U = element$7("div"), U.textContent = j, re = space$8(), ie = element$7("input"), ue = space$8(), de = element$7("input"), oe = space$8(), J = element$7("div"), J.textContent = Ee, se = space$8(), Ae = element$7("div"), he = element$7("div"), ne = element$7("span"), ne.textContent = _e, Le = space$8(), Be = element$7("label"), Ue = element$7("input"), He = space$8(), We = element$7("div"), Ge = space$8(), Ne = element$7("div"), Pe = element$7("span"), Pe.textContent = Te, Me = space$8(), De = element$7("label"), V = element$7("input"), Z = space$8(), ee = element$7("div"), ye = space$8(), ce = element$7("div"), Ie = element$7("button"), Y = space$8(), me = element$7("button"), Re = space$8(), pe = element$7("button"), X = space$8(), ze = element$7("button"), I = space$8(), xe = element$7("button"), q = space$8(), fe = element$7("button"), Ze = space$8(), Xe = element$7("button"), lt = space$8(), dt = element$7("div"), it = element$7("button"), ot = text$4("AlphaFold"), Ct = space$8(), ut = element$7("button"), zt = text$4("Hydrophobicity"), wt = space$8(), mt = element$7("button"), vt = text$4("PyMol"), qe = space$8(), ge = element$7("button"), Ke = text$4("Jmol"), _t = space$8(), Mt = element$7("div"), St = element$7("button"), It = text$4("Chain"), Zt = space$8(), Tt = element$7("button"), mr = text$4("Spectrum"), this.h(); }, - l($t) { - e = claim_element$7($t, "DIV", { class: !0 }); + l(kt) { + e = claim_element$7(kt, "DIV", { class: !0 }); var rt = children$8(e); t = claim_element$7(rt, "DIV", { class: !0 }); - var Dt = children$8(t); - r = claim_element$7(Dt, "SELECT", { id: !0, class: !0 }); - var Vt = children$8(r); - for (let or = 0; or < Ze.length; or += 1) - Ze[or].l(Vt); - Vt.forEach(detach$b), a = claim_space$8(Dt), l = claim_element$7(Dt, "INPUT", { + var Lt = children$8(t); + r = claim_element$7(Lt, "SELECT", { id: !0, class: !0 }); + var cr = children$8(r); + for (let Nr = 0; Nr < Nt.length; Nr += 1) + Nt[Nr].l(cr); + cr.forEach(detach$b), a = claim_space$8(Lt), l = claim_element$7(Lt, "INPUT", { type: !0, id: !0, class: !0, placeholder: !0 - }), Dt.forEach(detach$b), d = claim_space$8(rt), o = claim_element$7(rt, "DIV", { class: !0 }); - var qt = children$8(o); - u = claim_element$7(qt, "INPUT", { + }), Lt.forEach(detach$b), h = claim_space$8(rt), c = claim_element$7(rt, "DIV", { class: !0 }); + var Jt = children$8(c); + d = claim_element$7(Jt, "INPUT", { type: !0, id: !0, class: !0, placeholder: !0 - }), p = claim_space$8(qt), m = claim_element$7(qt, "INPUT", { + }), _ = claim_space$8(Jt), m = claim_element$7(Jt, "INPUT", { type: !0, id: !0, class: !0, placeholder: !0 - }), qt.forEach(detach$b), y = claim_space$8(rt), w = claim_element$7(rt, "DIV", { class: !0 }); - var _r = children$8(w); - b = claim_element$7(_r, "LABEL", { + }), Jt.forEach(detach$b), y = claim_space$8(rt), x = claim_element$7(rt, "DIV", { class: !0 }); + var Cr = children$8(x); + b = claim_element$7(Cr, "LABEL", { for: !0, class: !0, "data-svelte-h": !0 - }), get_svelte_dataset$2(b) !== "svelte-wallp4" && (b.textContent = A), f = claim_space$8(_r), s = claim_element$7(_r, "SELECT", { id: !0, class: !0 }); - var Ht = children$8(s); - h = claim_element$7(Ht, "OPTION", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$2(h) !== "svelte-sfou62" && (h.textContent = _), g = claim_element$7(Ht, "OPTION", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$2(g) !== "svelte-e05dfq" && (g.textContent = x), c = claim_element$7(Ht, "OPTION", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$2(c) !== "svelte-1nnagnw" && (c.textContent = v), M = claim_text$4(Ht, `$ - `), E = claim_element$7(Ht, "OPTION", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$2(E) !== "svelte-eymsc2" && (E.textContent = $), Ht.forEach(detach$b), _r.forEach(detach$b), k = claim_space$8(rt), L = claim_element$7(rt, "DIV", { class: !0 }); - var Qt = children$8(L); - z = claim_element$7(Qt, "DIV", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$2(z) !== "svelte-1i4r04x" && (z.textContent = O), R = claim_space$8(Qt), P = claim_element$7(Qt, "INPUT", { + }), get_svelte_dataset$2(b) !== "svelte-wallp4" && (b.textContent = A), f = claim_space$8(Cr), s = claim_element$7(Cr, "SELECT", { id: !0, class: !0 }); + var gr = children$8(s); + u = claim_element$7(gr, "OPTION", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$2(u) !== "svelte-sfou62" && (u.textContent = p), g = claim_element$7(gr, "OPTION", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$2(g) !== "svelte-e05dfq" && (g.textContent = w), o = claim_element$7(gr, "OPTION", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$2(o) !== "svelte-1nnagnw" && (o.textContent = v), M = claim_text$4(gr, `$ + `), E = claim_element$7(gr, "OPTION", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$2(E) !== "svelte-eymsc2" && (E.textContent = $), gr.forEach(detach$b), Cr.forEach(detach$b), k = claim_space$8(rt), L = claim_element$7(rt, "DIV", { class: !0 }); + var Vt = children$8(L); + z = claim_element$7(Vt, "DIV", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$2(z) !== "svelte-17zx4ra" && (z.textContent = O), R = claim_space$8(Vt), N = claim_element$7(Vt, "INPUT", { id: !0, type: !0, min: !0, max: !0, step: !0, class: !0 - }), B = claim_space$8(Qt), N = claim_element$7(Qt, "INPUT", { type: !0, class: !0 }), G = claim_space$8(Qt), H = claim_element$7(Qt, "DIV", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$2(H) !== "svelte-n73cw5" && (H.textContent = W), Qt.forEach(detach$b), V = claim_space$8(rt), re = claim_element$7(rt, "DIV", { class: !0 }); - var jt = children$8(re); - ie = claim_element$7(jt, "DIV", { class: !0 }); - var gr = children$8(ie); - ee = claim_element$7(gr, "SPAN", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$2(ee) !== "svelte-1vt6cv2" && (ee.textContent = ce), he = claim_space$8(gr), le = claim_element$7(gr, "LABEL", { class: !0 }); - var Cr = children$8(le); - J = claim_element$7(Cr, "INPUT", { type: !0, class: !0 }), Me = claim_space$8(Cr), se = claim_element$7(Cr, "DIV", { class: !0 }), children$8(se).forEach(detach$b), Cr.forEach(detach$b), gr.forEach(detach$b), Ce = claim_space$8(jt), ue = claim_element$7(jt, "DIV", { class: !0 }); - var Kt = children$8(ue); - ne = claim_element$7(Kt, "SPAN", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$2(ne) !== "svelte-17x7gtg" && (ne.textContent = _e), Oe = claim_space$8(Kt), Re = claim_element$7(Kt, "LABEL", { class: !0 }); - var Ut = children$8(Re); - Ue = claim_element$7(Ut, "INPUT", { type: !0, class: !0 }), We = claim_space$8(Ut), Ee = claim_element$7(Ut, "DIV", { class: !0 }), children$8(Ee).forEach(detach$b), Ut.forEach(detach$b), Kt.forEach(detach$b), jt.forEach(detach$b), Ae = claim_space$8(rt), ge = claim_element$7(rt, "DIV", { class: !0 }); - var Ct = children$8(ge); - Le = claim_element$7(Ct, "BUTTON", { class: !0 }), children$8(Le).forEach(detach$b), Ke = claim_space$8(Ct), je = claim_element$7(Ct, "BUTTON", { class: !0 }), children$8(je).forEach(detach$b), q = claim_space$8(Ct), te = claim_element$7(Ct, "BUTTON", { class: !0 }), children$8(te).forEach(detach$b), me = claim_space$8(Ct), Pe = claim_element$7(Ct, "BUTTON", { class: !0 }), children$8(Pe).forEach(detach$b), K = claim_space$8(Ct), fe = claim_element$7(Ct, "BUTTON", { class: !0 }), children$8(fe).forEach(detach$b), Ne = claim_space$8(Ct), pe = claim_element$7(Ct, "BUTTON", { class: !0 }), children$8(pe).forEach(detach$b), X = claim_space$8(Ct), Be = claim_element$7(Ct, "BUTTON", { class: !0 }), children$8(Be).forEach(detach$b), Ct.forEach(detach$b), I = claim_space$8(rt), ye = claim_element$7(rt, "DIV", { class: !0 }); - var ut = children$8(ye); - ve = claim_element$7(ut, "BUTTON", { class: !0 }); - var lr = children$8(ve); - Z = claim_text$4(lr, "AlphaFold"), lr.forEach(detach$b), $e = claim_space$8(ut), Ye = claim_element$7(ut, "BUTTON", { class: !0 }); - var vr = children$8(Ye); - qe = claim_text$4(vr, "PyMol"), vr.forEach(detach$b), at = claim_space$8(ut), dt = claim_element$7(ut, "BUTTON", { class: !0 }); - var $r = children$8(dt); - lt = claim_text$4($r, "Jmol"), $r.forEach(detach$b), st = claim_space$8(ut), bt = claim_element$7(ut, "BUTTON", { class: !0 }); - var rr = children$8(bt); - _t = claim_text$4(rr, "Chain"), rr.forEach(detach$b), Gt = claim_space$8(ut), ft = claim_element$7(ut, "BUTTON", { class: !0 }); - var Tr = children$8(ft); - Et = claim_text$4(Tr, "Spectrum"), Tr.forEach(detach$b), ut.forEach(detach$b), rt.forEach(detach$b), this.h(); + }), B = claim_space$8(Vt), P = claim_element$7(Vt, "INPUT", { type: !0, class: !0 }), Vt.forEach(detach$b), G = claim_space$8(rt), H = claim_element$7(rt, "DIV", { class: !0 }); + var Xt = children$8(H); + U = claim_element$7(Xt, "DIV", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$2(U) !== "svelte-1i4r04x" && (U.textContent = j), re = claim_space$8(Xt), ie = claim_element$7(Xt, "INPUT", { + id: !0, + type: !0, + min: !0, + max: !0, + step: !0, + class: !0 + }), ue = claim_space$8(Xt), de = claim_element$7(Xt, "INPUT", { type: !0, class: !0 }), oe = claim_space$8(Xt), J = claim_element$7(Xt, "DIV", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$2(J) !== "svelte-n73cw5" && (J.textContent = Ee), Xt.forEach(detach$b), se = claim_space$8(rt), Ae = claim_element$7(rt, "DIV", { class: !0 }); + var $r = children$8(Ae); + he = claim_element$7($r, "DIV", { class: !0 }); + var Tr = children$8(he); + ne = claim_element$7(Tr, "SPAN", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$2(ne) !== "svelte-1vt6cv2" && (ne.textContent = _e), Le = claim_space$8(Tr), Be = claim_element$7(Tr, "LABEL", { class: !0 }); + var ir = children$8(Be); + Ue = claim_element$7(ir, "INPUT", { type: !0, class: !0 }), He = claim_space$8(ir), We = claim_element$7(ir, "DIV", { class: !0 }), children$8(We).forEach(detach$b), ir.forEach(detach$b), Tr.forEach(detach$b), Ge = claim_space$8($r), Ne = claim_element$7($r, "DIV", { class: !0 }); + var xr = children$8(Ne); + Pe = claim_element$7(xr, "SPAN", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$2(Pe) !== "svelte-17x7gtg" && (Pe.textContent = Te), Me = claim_space$8(xr), De = claim_element$7(xr, "LABEL", { class: !0 }); + var wr = children$8(De); + V = claim_element$7(wr, "INPUT", { type: !0, class: !0 }), Z = claim_space$8(wr), ee = claim_element$7(wr, "DIV", { class: !0 }), children$8(ee).forEach(detach$b), wr.forEach(detach$b), xr.forEach(detach$b), $r.forEach(detach$b), ye = claim_space$8(rt), ce = claim_element$7(rt, "DIV", { class: !0 }); + var jt = children$8(ce); + Ie = claim_element$7(jt, "BUTTON", { class: !0 }), children$8(Ie).forEach(detach$b), Y = claim_space$8(jt), me = claim_element$7(jt, "BUTTON", { class: !0 }), children$8(me).forEach(detach$b), Re = claim_space$8(jt), pe = claim_element$7(jt, "BUTTON", { class: !0 }), children$8(pe).forEach(detach$b), X = claim_space$8(jt), ze = claim_element$7(jt, "BUTTON", { class: !0 }), children$8(ze).forEach(detach$b), I = claim_space$8(jt), xe = claim_element$7(jt, "BUTTON", { class: !0 }), children$8(xe).forEach(detach$b), q = claim_space$8(jt), fe = claim_element$7(jt, "BUTTON", { class: !0 }), children$8(fe).forEach(detach$b), Ze = claim_space$8(jt), Xe = claim_element$7(jt, "BUTTON", { class: !0 }), children$8(Xe).forEach(detach$b), jt.forEach(detach$b), lt = claim_space$8(rt), dt = claim_element$7(rt, "DIV", { class: !0 }); + var er = children$8(dt); + it = claim_element$7(er, "BUTTON", { class: !0 }); + var Xr = children$8(it); + ot = claim_text$4(Xr, "AlphaFold"), Xr.forEach(detach$b), Ct = claim_space$8(er), ut = claim_element$7(er, "BUTTON", { class: !0 }); + var Zr = children$8(ut); + zt = claim_text$4(Zr, "Hydrophobicity"), Zr.forEach(detach$b), wt = claim_space$8(er), mt = claim_element$7(er, "BUTTON", { class: !0 }); + var qr = children$8(mt); + vt = claim_text$4(qr, "PyMol"), qr.forEach(detach$b), qe = claim_space$8(er), ge = claim_element$7(er, "BUTTON", { class: !0 }); + var Qr = children$8(ge); + Ke = claim_text$4(Qr, "Jmol"), Qr.forEach(detach$b), er.forEach(detach$b), _t = claim_space$8(rt), Mt = claim_element$7(rt, "DIV", { class: !0 }); + var kr = children$8(Mt); + St = claim_element$7(kr, "BUTTON", { class: !0 }); + var Jr = children$8(St); + It = claim_text$4(Jr, "Chain"), Jr.forEach(detach$b), Zt = claim_space$8(kr), Tt = claim_element$7(kr, "BUTTON", { class: !0 }); + var ei = children$8(Tt); + mr = claim_text$4(ei, "Spectrum"), ei.forEach(detach$b), kr.forEach(detach$b), rt.forEach(detach$b), this.h(); }, h() { attr$8(r, "id", "style"), attr$8(r, "class", "bg-gray-50 border border-gray-300 text-gray-900 text-sm rounded-lg focus:ring-blue-500 focus:border-blue-500 block w-full p-2.5 dark:bg-gray-700 dark:border-gray-600 dark:placeholder-gray-400 dark:text-white dark:focus:ring-blue-500 dark:focus:border-blue-500 svelte-1skivl7"), /*rep*/ - n[53].model === void 0 && add_render_callback(yt), attr$8(l, "type", "text"), attr$8(l, "id", "chain"), attr$8(l, "class", "w-1/2 bg-gray-50 border border-gray-300 text-gray-900 text-sm rounded-lg focus:ring-blue-500 focus:border-blue-500 block p-2.5 dark:bg-gray-700 dark:border-gray-600 dark:placeholder-gray-400 dark:text-white dark:focus:ring-blue-500 dark:focus:border-blue-500 svelte-1skivl7"), attr$8(l, "placeholder", "Chain"), attr$8(t, "class", "p-1 flex space-x-1 svelte-1skivl7"), attr$8(u, "type", "text"), attr$8(u, "id", "chain"), attr$8(u, "class", "w-1/2 bg-gray-50 border border-gray-300 text-gray-900 text-sm rounded-lg focus:ring-blue-500 focus:border-blue-500 block p-2.5 dark:bg-gray-700 dark:border-gray-600 dark:placeholder-gray-400 dark:text-white dark:focus:ring-blue-500 dark:focus:border-blue-500 svelte-1skivl7"), attr$8(u, "placeholder", "Resname"), attr$8(m, "type", "text"), attr$8(m, "id", "residue_range"), attr$8(m, "class", "w-full bg-gray-50 border border-gray-300 text-gray-900 text-sm rounded-lg focus:ring-blue-500 focus:border-blue-500 block p-2.5 dark:bg-gray-700 dark:border-gray-600 dark:placeholder-gray-400 dark:text-white dark:focus:ring-blue-500 dark:focus:border-blue-500 svelte-1skivl7"), attr$8(m, "placeholder", "Residue range"), attr$8(o, "class", "p-1 flex space-x-1 svelte-1skivl7"), attr$8(b, "for", "countries"), attr$8(b, "class", "block mb-2 text-sm w-1/3 font-medium text-gray-600 dark:text-white svelte-1skivl7"), h.__value = "stick", set_input_value$1(h, h.__value), attr$8(h, "class", "svelte-1skivl7"), g.__value = "cartoon", set_input_value$1(g, g.__value), attr$8(g, "class", "svelte-1skivl7"), c.__value = "surface", set_input_value$1(c, c.__value), attr$8(c, "class", "svelte-1skivl7"), E.__value = "sphere", set_input_value$1(E, E.__value), attr$8(E, "class", "svelte-1skivl7"), attr$8(s, "id", "style"), attr$8(s, "class", "bg-gray-50 border border-gray-300 text-gray-900 text-sm rounded-lg focus:ring-blue-500 focus:border-blue-500 block w-full p-2.5 dark:bg-gray-700 dark:border-gray-600 dark:placeholder-gray-400 dark:text-white dark:focus:ring-blue-500 dark:focus:border-blue-500 svelte-1skivl7"), /*rep*/ - n[53].style === void 0 && add_render_callback(Nt), attr$8(w, "class", "p-1 flex space-x-1 items-center svelte-1skivl7"), attr$8(z, "class", " svelte-1skivl7"), attr$8(P, "id", "around"), attr$8(P, "type", "range"), P.value = U = /*rep*/ - n[53].around, attr$8(P, "min", "0"), attr$8(P, "max", "10"), attr$8(P, "step", "0.5"), attr$8(P, "class", "h-2 w-1/3 bg-gray-200 rounded-lg appearance-none cursor-pointer dark:bg-gray-700 svelte-1skivl7"), attr$8(N, "type", "text"), attr$8(N, "class", "w-8 svelte-1skivl7"), attr$8(H, "class", "svelte-1skivl7"), attr$8(L, "class", "flex p-1 items-center text-gray-700 space-x-1 text-sm svelte-1skivl7"), attr$8(ee, "class", "svelte-1skivl7"), attr$8(J, "type", "checkbox"), J.__value = "", set_input_value$1(J, J.__value), attr$8(J, "class", "sr-only peer svelte-1skivl7"), attr$8(se, "class", "w-11 h-6 bg-gray-200 rounded-full peer dark:bg-gray-700 peer-focus:ring-4 peer-focus:ring-orange-300 dark:peer-focus:ring-orange-800 peer-checked:after:translate-x-full peer-checked:after:border-white after:content-[''] after:absolute after:top-0.5 after:left-[2px] after:bg-white after:border-gray-300 after:border after:rounded-full after:h-5 after:w-5 after:transition-all dark:border-gray-600 peer-checked:bg-orange-400 svelte-1skivl7"), attr$8(le, "class", "relative inline-flex items-center mr-5 cursor-pointer text-center svelte-1skivl7"), attr$8(ie, "class", "flex space-x-1 w-1/2 svelte-1skivl7"), attr$8(ne, "class", "svelte-1skivl7"), attr$8(Ue, "type", "checkbox"), Ue.__value = "", set_input_value$1(Ue, Ue.__value), attr$8(Ue, "class", "sr-only peer svelte-1skivl7"), attr$8(Ee, "class", "w-11 h-6 bg-gray-200 rounded-full peer dark:bg-gray-700 peer-focus:ring-4 peer-focus:ring-orange-300 dark:peer-focus:ring-orange-800 peer-checked:after:translate-x-full peer-checked:after:border-white after:content-[''] after:absolute after:top-0.5 after:left-[2px] after:bg-white after:border-gray-300 after:border after:rounded-full after:h-5 after:w-5 after:transition-all dark:border-gray-600 peer-checked:bg-orange-400 svelte-1skivl7"), attr$8(Re, "class", "relative inline-flex items-center mr-5 cursor-pointer text-center svelte-1skivl7"), attr$8(ue, "class", "flex space-x-1 w-1/2 svelte-1skivl7"), attr$8(re, "class", "flex p-1 items-center text-gray-700 space-x-1 text-sm svelte-1skivl7"), attr$8(Le, "class", Te = null_to_empty( + n[58].model === void 0 && add_render_callback(ar), attr$8(l, "type", "text"), attr$8(l, "id", "chain"), attr$8(l, "class", "w-1/2 bg-gray-50 border border-gray-300 text-gray-900 text-sm rounded-lg focus:ring-blue-500 focus:border-blue-500 block p-2.5 dark:bg-gray-700 dark:border-gray-600 dark:placeholder-gray-400 dark:text-white dark:focus:ring-blue-500 dark:focus:border-blue-500 svelte-1skivl7"), attr$8(l, "placeholder", "Chain"), attr$8(t, "class", "p-1 flex space-x-1 svelte-1skivl7"), attr$8(d, "type", "text"), attr$8(d, "id", "chain"), attr$8(d, "class", "w-1/2 bg-gray-50 border border-gray-300 text-gray-900 text-sm rounded-lg focus:ring-blue-500 focus:border-blue-500 block p-2.5 dark:bg-gray-700 dark:border-gray-600 dark:placeholder-gray-400 dark:text-white dark:focus:ring-blue-500 dark:focus:border-blue-500 svelte-1skivl7"), attr$8(d, "placeholder", "Resname"), attr$8(m, "type", "text"), attr$8(m, "id", "residue_range"), attr$8(m, "class", "w-full bg-gray-50 border border-gray-300 text-gray-900 text-sm rounded-lg focus:ring-blue-500 focus:border-blue-500 block p-2.5 dark:bg-gray-700 dark:border-gray-600 dark:placeholder-gray-400 dark:text-white dark:focus:ring-blue-500 dark:focus:border-blue-500 svelte-1skivl7"), attr$8(m, "placeholder", "Residue range"), attr$8(c, "class", "p-1 flex space-x-1 svelte-1skivl7"), attr$8(b, "for", "countries"), attr$8(b, "class", "block mb-2 text-sm w-1/3 font-medium text-gray-600 dark:text-white svelte-1skivl7"), u.__value = "stick", set_input_value$1(u, u.__value), attr$8(u, "class", "svelte-1skivl7"), g.__value = "cartoon", set_input_value$1(g, g.__value), attr$8(g, "class", "svelte-1skivl7"), o.__value = "surface", set_input_value$1(o, o.__value), attr$8(o, "class", "svelte-1skivl7"), E.__value = "sphere", set_input_value$1(E, E.__value), attr$8(E, "class", "svelte-1skivl7"), attr$8(s, "id", "style"), attr$8(s, "class", "bg-gray-50 border border-gray-300 text-gray-900 text-sm rounded-lg focus:ring-blue-500 focus:border-blue-500 block w-full p-2.5 dark:bg-gray-700 dark:border-gray-600 dark:placeholder-gray-400 dark:text-white dark:focus:ring-blue-500 dark:focus:border-blue-500 svelte-1skivl7"), /*rep*/ + n[58].style === void 0 && add_render_callback(Dr), attr$8(x, "class", "p-1 flex space-x-1 items-center svelte-1skivl7"), attr$8(z, "class", " svelte-1skivl7"), attr$8(N, "id", "around"), attr$8(N, "type", "range"), N.value = W = /*rep*/ + n[58].opacity, attr$8(N, "min", "0"), attr$8(N, "max", "1"), attr$8(N, "step", "0.1"), attr$8(N, "class", "h-2 w-full bg-gray-200 rounded-lg appearance-none cursor-pointer dark:bg-gray-700 svelte-1skivl7"), attr$8(P, "type", "text"), attr$8(P, "class", "w-8 svelte-1skivl7"), attr$8(L, "class", "flex p-1 items-center text-gray-700 space-x-1 text-sm svelte-1skivl7"), attr$8(U, "class", " svelte-1skivl7"), attr$8(ie, "id", "around"), attr$8(ie, "type", "range"), ie.value = te = /*rep*/ + n[58].around, attr$8(ie, "min", "0"), attr$8(ie, "max", "10"), attr$8(ie, "step", "0.5"), attr$8(ie, "class", "h-2 w-1/3 bg-gray-200 rounded-lg appearance-none cursor-pointer dark:bg-gray-700 svelte-1skivl7"), attr$8(de, "type", "text"), attr$8(de, "class", "w-8 svelte-1skivl7"), attr$8(J, "class", "svelte-1skivl7"), attr$8(H, "class", "flex p-1 items-center text-gray-700 space-x-1 text-sm svelte-1skivl7"), attr$8(ne, "class", "svelte-1skivl7"), attr$8(Ue, "type", "checkbox"), Ue.__value = "", set_input_value$1(Ue, Ue.__value), attr$8(Ue, "class", "sr-only peer svelte-1skivl7"), attr$8(We, "class", "w-11 h-6 bg-gray-200 rounded-full peer dark:bg-gray-700 peer-focus:ring-4 peer-focus:ring-orange-300 dark:peer-focus:ring-orange-800 peer-checked:after:translate-x-full peer-checked:after:border-white after:content-[''] after:absolute after:top-0.5 after:left-[2px] after:bg-white after:border-gray-300 after:border after:rounded-full after:h-5 after:w-5 after:transition-all dark:border-gray-600 peer-checked:bg-orange-400 svelte-1skivl7"), attr$8(Be, "class", "relative inline-flex items-center mr-5 cursor-pointer text-center svelte-1skivl7"), attr$8(he, "class", "flex space-x-1 w-1/2 svelte-1skivl7"), attr$8(Pe, "class", "svelte-1skivl7"), attr$8(V, "type", "checkbox"), V.__value = "", set_input_value$1(V, V.__value), attr$8(V, "class", "sr-only peer svelte-1skivl7"), attr$8(ee, "class", "w-11 h-6 bg-gray-200 rounded-full peer dark:bg-gray-700 peer-focus:ring-4 peer-focus:ring-orange-300 dark:peer-focus:ring-orange-800 peer-checked:after:translate-x-full peer-checked:after:border-white after:content-[''] after:absolute after:top-0.5 after:left-[2px] after:bg-white after:border-gray-300 after:border after:rounded-full after:h-5 after:w-5 after:transition-all dark:border-gray-600 peer-checked:bg-orange-400 svelte-1skivl7"), attr$8(De, "class", "relative inline-flex items-center mr-5 cursor-pointer text-center svelte-1skivl7"), attr$8(Ne, "class", "flex space-x-1 w-1/2 svelte-1skivl7"), attr$8(Ae, "class", "flex p-1 items-center text-gray-700 space-x-1 text-sm svelte-1skivl7"), attr$8(Ie, "class", ke = null_to_empty( /*rep*/ - n[53].color === "orangeCarbon" ? "bg-orange-600 rounded-full w-8 h-8 border-4 border-gray-300 cursor-pointer" : "bg-orange-600 rounded-full w-8 h-8 border-4 border-white cursor-pointer" - ) + " svelte-1skivl7"), attr$8(je, "class", Y = null_to_empty( + n[58].color === "orangeCarbon" ? "bg-orange-600 rounded-full w-8 h-8 border-4 border-gray-300 cursor-pointer" : "bg-orange-600 rounded-full w-8 h-8 border-4 border-white cursor-pointer" + ) + " svelte-1skivl7"), attr$8(me, "class", we = null_to_empty( /*rep*/ - n[53].color === "redCarbon" ? "bg-red-600 rounded-full w-8 h-8 border-4 border-gray-300 cursor-pointer" : "bg-red-600 rounded-full w-8 h-8 border-4 border-white cursor-pointer" - ) + " svelte-1skivl7"), attr$8(te, "class", we = null_to_empty( + n[58].color === "redCarbon" ? "bg-red-600 rounded-full w-8 h-8 border-4 border-gray-300 cursor-pointer" : "bg-red-600 rounded-full w-8 h-8 border-4 border-white cursor-pointer" + ) + " svelte-1skivl7"), attr$8(pe, "class", $e = null_to_empty( /*rep*/ - n[53].color === "blackCarbon" ? "bg-black rounded-full w-8 h-8 border-4 border-gray-300 cursor-pointer" : "bg-black rounded-full w-8 h-8 border-4 border-white cursor-pointer" - ) + " svelte-1skivl7"), attr$8(Pe, "class", Fe = null_to_empty( + n[58].color === "blackCarbon" ? "bg-black rounded-full w-8 h-8 border-4 border-gray-300 cursor-pointer" : "bg-black rounded-full w-8 h-8 border-4 border-white cursor-pointer" + ) + " svelte-1skivl7"), attr$8(ze, "class", Ve = null_to_empty( /*rep*/ - n[53].color === "blueCarbon" ? "bg-blue-600 rounded-full w-8 h-8 border-4 border-gray-300 cursor-pointer" : "bg-blue-600 rounded-full w-8 h-8 border-4 border-white cursor-pointer" - ) + " svelte-1skivl7"), attr$8(fe, "class", Se = null_to_empty( + n[58].color === "blueCarbon" ? "bg-blue-600 rounded-full w-8 h-8 border-4 border-gray-300 cursor-pointer" : "bg-blue-600 rounded-full w-8 h-8 border-4 border-white cursor-pointer" + ) + " svelte-1skivl7"), attr$8(xe, "class", be = null_to_empty( /*rep*/ - n[53].color === "grayCarbon" ? "bg-gray-600 rounded-full w-8 h-8 border-4 border-gray-300 cursor-pointer" : "bg-gray-600 rounded-full w-8 h-8 border-4 border-white cursor-pointer" - ) + " svelte-1skivl7"), attr$8(pe, "class", ke = null_to_empty( + n[58].color === "grayCarbon" ? "bg-gray-600 rounded-full w-8 h-8 border-4 border-gray-300 cursor-pointer" : "bg-gray-600 rounded-full w-8 h-8 border-4 border-white cursor-pointer" + ) + " svelte-1skivl7"), attr$8(fe, "class", Ce = null_to_empty( /*rep*/ - n[53].color === "greenCarbon" ? "bg-green-600 rounded-full w-8 h-8 border-4 border-gray-300 cursor-pointer" : "bg-green-600 rounded-full w-8 h-8 border-4 border-white cursor-pointer" - ) + " svelte-1skivl7"), attr$8(Be, "class", Ge = null_to_empty( + n[58].color === "greenCarbon" ? "bg-green-600 rounded-full w-8 h-8 border-4 border-gray-300 cursor-pointer" : "bg-green-600 rounded-full w-8 h-8 border-4 border-white cursor-pointer" + ) + " svelte-1skivl7"), attr$8(Xe, "class", Ye = null_to_empty( /*rep*/ - n[53].color === "cyanCarbon" ? "bg-cyan-600 rounded-full w-8 h-8 border-4 border-gray-300 cursor-pointer" : "bg-cyan-600 rounded-full w-8 h-8 border-4 border-white cursor-pointer" - ) + " svelte-1skivl7"), attr$8(ge, "class", "flex space-x-2 mt-2 svelte-1skivl7"), attr$8(ve, "class", de = null_to_empty( + n[58].color === "cyanCarbon" ? "bg-cyan-600 rounded-full w-8 h-8 border-4 border-gray-300 cursor-pointer" : "bg-cyan-600 rounded-full w-8 h-8 border-4 border-white cursor-pointer" + ) + " svelte-1skivl7"), attr$8(ce, "class", "flex space-x-2 mt-2 svelte-1skivl7"), attr$8(it, "class", nt = null_to_empty( /*rep*/ - n[53].color === "alphafold" ? "rounded-lg p-1 border border-gray-400 cursor-pointer bg-gray-200" : "rounded-lg p-1 border border-gray-200 cursor-pointer bg-white" - ) + " svelte-1skivl7"), attr$8(Ye, "class", Xe = null_to_empty( + n[58].color === "alphafold" ? "rounded-lg p-1 border border-gray-400 cursor-pointer bg-gray-200" : "rounded-lg p-1 border border-gray-200 cursor-pointer bg-white" + ) + " svelte-1skivl7"), attr$8(ut, "class", Ut = null_to_empty( /*rep*/ - n[53].color === "default" ? "rounded-lg p-1 border border-gray-400 cursor-pointer bg-gray-200" : "rounded-lg p-1 border border-gray-200 cursor-pointer bg-white" - ) + " svelte-1skivl7"), attr$8(dt, "class", ot = null_to_empty( + n[58].color === "hydrophobicity" ? "rounded-lg p-1 border border-gray-400 cursor-pointer bg-gray-200" : "rounded-lg p-1 border border-gray-200 cursor-pointer bg-white" + ) + " svelte-1skivl7"), attr$8(mt, "class", Rt = null_to_empty( /*rep*/ - n[53].color === "Jmol" ? "rounded-lg p-1 border border-gray-400 cursor-pointer bg-gray-200" : "rounded-lg p-1 border border-gray-200 cursor-pointer bg-white" - ) + " svelte-1skivl7"), attr$8(bt, "class", Lt = null_to_empty( + n[58].color === "default" ? "rounded-lg p-1 border border-gray-400 cursor-pointer bg-gray-200" : "rounded-lg p-1 border border-gray-200 cursor-pointer bg-white" + ) + " svelte-1skivl7"), attr$8(ge, "class", Qe = null_to_empty( /*rep*/ - n[53].color === "chain" ? "rounded-lg p-1 border border-gray-400 cursor-pointer bg-gray-200" : "rounded-lg p-1 border border-gray-200 cursor-pointer bg-white" - ) + " svelte-1skivl7"), attr$8(ft, "class", gt = null_to_empty( + n[58].color === "Jmol" ? "rounded-lg p-1 border border-gray-400 cursor-pointer bg-gray-200" : "rounded-lg p-1 border border-gray-200 cursor-pointer bg-white" + ) + " svelte-1skivl7"), attr$8(dt, "class", "flex space-x-2 py-2 text-sm svelte-1skivl7"), attr$8(St, "class", Pt = null_to_empty( /*rep*/ - n[53].color === "spectrum" ? "rounded-lg p-1 border border-gray-400 cursor-pointer bg-gray-200" : "rounded-lg p-1 border border-gray-200 cursor-pointer bg-white" - ) + " svelte-1skivl7"), attr$8(ye, "class", "flex space-x-2 py-2 text-sm svelte-1skivl7"), attr$8(e, "class", "svelte-1skivl7"); + n[58].color === "chain" ? "rounded-lg p-1 border border-gray-400 cursor-pointer bg-gray-200" : "rounded-lg p-1 border border-gray-200 cursor-pointer bg-white" + ) + " svelte-1skivl7"), attr$8(Tt, "class", nr = null_to_empty( + /*rep*/ + n[58].color === "spectrum" ? "rounded-lg p-1 border border-gray-400 cursor-pointer bg-gray-200" : "rounded-lg p-1 border border-gray-200 cursor-pointer bg-white" + ) + " svelte-1skivl7"), attr$8(Mt, "class", "flex space-x-2 py-2 text-sm svelte-1skivl7"), attr$8(e, "class", "svelte-1skivl7"); }, - m($t, rt) { - insert_hydration$b($t, e, rt), append_hydration$8(e, t), append_hydration$8(t, r); - for (let Dt = 0; Dt < Ze.length; Dt += 1) - Ze[Dt] && Ze[Dt].m(r, null); + m(kt, rt) { + insert_hydration$b(kt, e, rt), append_hydration$8(e, t), append_hydration$8(t, r); + for (let Lt = 0; Lt < Nt.length; Lt += 1) + Nt[Lt] && Nt[Lt].m(r, null); select_option( r, /*rep*/ - n[53].model, + n[58].model, !0 ), append_hydration$8(t, a), append_hydration$8(t, l), set_input_value$1( l, /*rep*/ - n[53].chain - ), append_hydration$8(e, d), append_hydration$8(e, o), append_hydration$8(o, u), set_input_value$1( - u, + n[58].chain + ), append_hydration$8(e, h), append_hydration$8(e, c), append_hydration$8(c, d), set_input_value$1( + d, /*rep*/ - n[53].resname - ), append_hydration$8(o, p), append_hydration$8(o, m), set_input_value$1( + n[58].resname + ), append_hydration$8(c, _), append_hydration$8(c, m), set_input_value$1( m, /*rep*/ - n[53].residue_range - ), append_hydration$8(e, y), append_hydration$8(e, w), append_hydration$8(w, b), append_hydration$8(w, f), append_hydration$8(w, s), append_hydration$8(s, h), append_hydration$8(s, g), append_hydration$8(s, c), append_hydration$8(s, M), append_hydration$8(s, E), select_option( + n[58].residue_range + ), append_hydration$8(e, y), append_hydration$8(e, x), append_hydration$8(x, b), append_hydration$8(x, f), append_hydration$8(x, s), append_hydration$8(s, u), append_hydration$8(s, g), append_hydration$8(s, o), append_hydration$8(s, M), append_hydration$8(s, E), select_option( s, /*rep*/ - n[53].style, + n[58].style, !0 - ), append_hydration$8(e, k), append_hydration$8(e, L), append_hydration$8(L, z), append_hydration$8(L, R), append_hydration$8(L, P), append_hydration$8(L, B), append_hydration$8(L, N), set_input_value$1( - N, + ), append_hydration$8(e, k), append_hydration$8(e, L), append_hydration$8(L, z), append_hydration$8(L, R), append_hydration$8(L, N), append_hydration$8(L, B), append_hydration$8(L, P), set_input_value$1( + P, + /*rep*/ + n[58].opacity + ), append_hydration$8(e, G), append_hydration$8(e, H), append_hydration$8(H, U), append_hydration$8(H, re), append_hydration$8(H, ie), append_hydration$8(H, ue), append_hydration$8(H, de), set_input_value$1( + de, /*rep*/ - n[53].around - ), append_hydration$8(L, G), append_hydration$8(L, H), append_hydration$8(e, V), append_hydration$8(e, re), append_hydration$8(re, ie), append_hydration$8(ie, ee), append_hydration$8(ie, he), append_hydration$8(ie, le), append_hydration$8(le, J), J.checked = /*rep*/ - n[53].byres, append_hydration$8(le, Me), append_hydration$8(le, se), append_hydration$8(re, Ce), append_hydration$8(re, ue), append_hydration$8(ue, ne), append_hydration$8(ue, Oe), append_hydration$8(ue, Re), append_hydration$8(Re, Ue), Ue.checked = /*rep*/ - n[53].sidechain, append_hydration$8(Re, We), append_hydration$8(Re, Ee), append_hydration$8(e, Ae), append_hydration$8(e, ge), append_hydration$8(ge, Le), append_hydration$8(ge, Ke), append_hydration$8(ge, je), append_hydration$8(ge, q), append_hydration$8(ge, te), append_hydration$8(ge, me), append_hydration$8(ge, Pe), append_hydration$8(ge, K), append_hydration$8(ge, fe), append_hydration$8(ge, Ne), append_hydration$8(ge, pe), append_hydration$8(ge, X), append_hydration$8(ge, Be), append_hydration$8(e, I), append_hydration$8(e, ye), append_hydration$8(ye, ve), append_hydration$8(ve, Z), append_hydration$8(ye, $e), append_hydration$8(ye, Ye), append_hydration$8(Ye, qe), append_hydration$8(ye, at), append_hydration$8(ye, dt), append_hydration$8(dt, lt), append_hydration$8(ye, st), append_hydration$8(ye, bt), append_hydration$8(bt, _t), append_hydration$8(ye, Gt), append_hydration$8(ye, ft), append_hydration$8(ft, Et), Qe || (xe = [ - listen$2(r, "change", yt), - listen$2(l, "input", zt), - listen$2(u, "input", Ft), - listen$2(m, "input", Bt), - listen$2(s, "change", Nt), - listen$2(P, "change", Zt), - listen$2(N, "input", Pt), - listen$2(J, "change", mr), + n[58].around + ), append_hydration$8(H, oe), append_hydration$8(H, J), append_hydration$8(e, se), append_hydration$8(e, Ae), append_hydration$8(Ae, he), append_hydration$8(he, ne), append_hydration$8(he, Le), append_hydration$8(he, Be), append_hydration$8(Be, Ue), Ue.checked = /*rep*/ + n[58].byres, append_hydration$8(Be, He), append_hydration$8(Be, We), append_hydration$8(Ae, Ge), append_hydration$8(Ae, Ne), append_hydration$8(Ne, Pe), append_hydration$8(Ne, Me), append_hydration$8(Ne, De), append_hydration$8(De, V), V.checked = /*rep*/ + n[58].sidechain, append_hydration$8(De, Z), append_hydration$8(De, ee), append_hydration$8(e, ye), append_hydration$8(e, ce), append_hydration$8(ce, Ie), append_hydration$8(ce, Y), append_hydration$8(ce, me), append_hydration$8(ce, Re), append_hydration$8(ce, pe), append_hydration$8(ce, X), append_hydration$8(ce, ze), append_hydration$8(ce, I), append_hydration$8(ce, xe), append_hydration$8(ce, q), append_hydration$8(ce, fe), append_hydration$8(ce, Ze), append_hydration$8(ce, Xe), append_hydration$8(e, lt), append_hydration$8(e, dt), append_hydration$8(dt, it), append_hydration$8(it, ot), append_hydration$8(dt, Ct), append_hydration$8(dt, ut), append_hydration$8(ut, zt), append_hydration$8(dt, wt), append_hydration$8(dt, mt), append_hydration$8(mt, vt), append_hydration$8(dt, qe), append_hydration$8(dt, ge), append_hydration$8(ge, Ke), append_hydration$8(e, _t), append_hydration$8(e, Mt), append_hydration$8(Mt, St), append_hydration$8(St, It), append_hydration$8(Mt, Zt), append_hydration$8(Mt, Tt), append_hydration$8(Tt, mr), ft || (Qt = [ + listen$2(r, "change", ar), + listen$2(l, "input", zr), + listen$2(d, "input", Ir), + listen$2(m, "input", Br), + listen$2(s, "change", Dr), + listen$2(N, "change", Rr), + listen$2(P, "input", sr), + listen$2(ie, "change", vr), + listen$2(de, "input", Ht), listen$2(Ue, "change", pr), - listen$2(Le, "click", qr), - listen$2(je, "click", mt), - listen$2(te, "click", Jt), - listen$2(Pe, "click", Xt), - listen$2(fe, "click", Qr), - listen$2(pe, "click", sr), - listen$2(Be, "click", Er), - listen$2(ve, "click", Sr), - listen$2(Ye, "click", Ar), - listen$2(dt, "click", Mr), - listen$2(bt, "click", Dr), - listen$2(ft, "click", tr) - ], Qe = !0); - }, - p($t, rt) { - if (n = $t, rt[0] & /*moldata*/ + listen$2(V, "change", lr), + listen$2(Ie, "click", _r), + listen$2(me, "click", hi), + listen$2(pe, "click", or), + listen$2(ze, "click", Yr), + listen$2(xe, "click", tr), + listen$2(fe, "click", fi), + listen$2(Xe, "click", Ci), + listen$2(it, "click", rr), + listen$2(ut, "click", Kt), + listen$2(mt, "click", Yt), + listen$2(ge, "click", xt), + listen$2(St, "click", yr), + listen$2(Tt, "click", Pr) + ], ft = !0); + }, + p(kt, rt) { + if (n = kt, rt[0] & /*moldata*/ 8) { - He = ensure_array_like$2( + Gt = ensure_array_like$2( /*moldata*/ n[3] ); - let Dt; - for (Dt = 0; Dt < He.length; Dt += 1) { - const Vt = get_each_context_1$1(n, He, Dt); - Ze[Dt] ? Ze[Dt].p(Vt, rt) : (Ze[Dt] = create_each_block_1$1(Vt), Ze[Dt].c(), Ze[Dt].m(r, null)); + let Lt; + for (Lt = 0; Lt < Gt.length; Lt += 1) { + const cr = get_each_context_1$1(n, Gt, Lt); + Nt[Lt] ? Nt[Lt].p(cr, rt) : (Nt[Lt] = create_each_block_1$1(cr), Nt[Lt].c(), Nt[Lt].m(r, null)); } - for (; Dt < Ze.length; Dt += 1) - Ze[Dt].d(1); - Ze.length = He.length; + for (; Lt < Nt.length; Lt += 1) + Nt[Lt].d(1); + Nt.length = Gt.length; } rt[0] & /*representations*/ 2 && select_option( r, /*rep*/ - n[53].model + n[58].model ), rt[0] & /*representations*/ 2 && l.value !== /*rep*/ - n[53].chain && set_input_value$1( + n[58].chain && set_input_value$1( l, /*rep*/ - n[53].chain + n[58].chain ), rt[0] & /*representations*/ - 2 && u.value !== /*rep*/ - n[53].resname && set_input_value$1( - u, + 2 && d.value !== /*rep*/ + n[58].resname && set_input_value$1( + d, /*rep*/ - n[53].resname + n[58].resname ), rt[0] & /*representations*/ 2 && m.value !== /*rep*/ - n[53].residue_range && set_input_value$1( + n[58].residue_range && set_input_value$1( m, /*rep*/ - n[53].residue_range + n[58].residue_range ), rt[0] & /*representations*/ 2 && select_option( s, /*rep*/ - n[53].style + n[58].style ), rt[0] & /*representations*/ - 2 && U !== (U = /*rep*/ - n[53].around) && (P.value = U), rt[0] & /*representations*/ - 2 && N.value !== /*rep*/ - n[53].around && set_input_value$1( - N, + 2 && W !== (W = /*rep*/ + n[58].opacity) && (N.value = W), rt[0] & /*representations*/ + 2 && P.value !== /*rep*/ + n[58].opacity && set_input_value$1( + P, /*rep*/ - n[53].around + n[58].opacity ), rt[0] & /*representations*/ - 2 && (J.checked = /*rep*/ - n[53].byres), rt[0] & /*representations*/ - 2 && (Ue.checked = /*rep*/ - n[53].sidechain), rt[0] & /*representations*/ - 2 && Te !== (Te = null_to_empty( + 2 && te !== (te = /*rep*/ + n[58].around) && (ie.value = te), rt[0] & /*representations*/ + 2 && de.value !== /*rep*/ + n[58].around && set_input_value$1( + de, /*rep*/ - n[53].color === "orangeCarbon" ? "bg-orange-600 rounded-full w-8 h-8 border-4 border-gray-300 cursor-pointer" : "bg-orange-600 rounded-full w-8 h-8 border-4 border-white cursor-pointer" - ) + " svelte-1skivl7") && attr$8(Le, "class", Te), rt[0] & /*representations*/ - 2 && Y !== (Y = null_to_empty( + n[58].around + ), rt[0] & /*representations*/ + 2 && (Ue.checked = /*rep*/ + n[58].byres), rt[0] & /*representations*/ + 2 && (V.checked = /*rep*/ + n[58].sidechain), rt[0] & /*representations*/ + 2 && ke !== (ke = null_to_empty( /*rep*/ - n[53].color === "redCarbon" ? "bg-red-600 rounded-full w-8 h-8 border-4 border-gray-300 cursor-pointer" : "bg-red-600 rounded-full w-8 h-8 border-4 border-white cursor-pointer" - ) + " svelte-1skivl7") && attr$8(je, "class", Y), rt[0] & /*representations*/ + n[58].color === "orangeCarbon" ? "bg-orange-600 rounded-full w-8 h-8 border-4 border-gray-300 cursor-pointer" : "bg-orange-600 rounded-full w-8 h-8 border-4 border-white cursor-pointer" + ) + " svelte-1skivl7") && attr$8(Ie, "class", ke), rt[0] & /*representations*/ 2 && we !== (we = null_to_empty( /*rep*/ - n[53].color === "blackCarbon" ? "bg-black rounded-full w-8 h-8 border-4 border-gray-300 cursor-pointer" : "bg-black rounded-full w-8 h-8 border-4 border-white cursor-pointer" - ) + " svelte-1skivl7") && attr$8(te, "class", we), rt[0] & /*representations*/ - 2 && Fe !== (Fe = null_to_empty( + n[58].color === "redCarbon" ? "bg-red-600 rounded-full w-8 h-8 border-4 border-gray-300 cursor-pointer" : "bg-red-600 rounded-full w-8 h-8 border-4 border-white cursor-pointer" + ) + " svelte-1skivl7") && attr$8(me, "class", we), rt[0] & /*representations*/ + 2 && $e !== ($e = null_to_empty( /*rep*/ - n[53].color === "blueCarbon" ? "bg-blue-600 rounded-full w-8 h-8 border-4 border-gray-300 cursor-pointer" : "bg-blue-600 rounded-full w-8 h-8 border-4 border-white cursor-pointer" - ) + " svelte-1skivl7") && attr$8(Pe, "class", Fe), rt[0] & /*representations*/ - 2 && Se !== (Se = null_to_empty( + n[58].color === "blackCarbon" ? "bg-black rounded-full w-8 h-8 border-4 border-gray-300 cursor-pointer" : "bg-black rounded-full w-8 h-8 border-4 border-white cursor-pointer" + ) + " svelte-1skivl7") && attr$8(pe, "class", $e), rt[0] & /*representations*/ + 2 && Ve !== (Ve = null_to_empty( /*rep*/ - n[53].color === "grayCarbon" ? "bg-gray-600 rounded-full w-8 h-8 border-4 border-gray-300 cursor-pointer" : "bg-gray-600 rounded-full w-8 h-8 border-4 border-white cursor-pointer" - ) + " svelte-1skivl7") && attr$8(fe, "class", Se), rt[0] & /*representations*/ - 2 && ke !== (ke = null_to_empty( + n[58].color === "blueCarbon" ? "bg-blue-600 rounded-full w-8 h-8 border-4 border-gray-300 cursor-pointer" : "bg-blue-600 rounded-full w-8 h-8 border-4 border-white cursor-pointer" + ) + " svelte-1skivl7") && attr$8(ze, "class", Ve), rt[0] & /*representations*/ + 2 && be !== (be = null_to_empty( + /*rep*/ + n[58].color === "grayCarbon" ? "bg-gray-600 rounded-full w-8 h-8 border-4 border-gray-300 cursor-pointer" : "bg-gray-600 rounded-full w-8 h-8 border-4 border-white cursor-pointer" + ) + " svelte-1skivl7") && attr$8(xe, "class", be), rt[0] & /*representations*/ + 2 && Ce !== (Ce = null_to_empty( + /*rep*/ + n[58].color === "greenCarbon" ? "bg-green-600 rounded-full w-8 h-8 border-4 border-gray-300 cursor-pointer" : "bg-green-600 rounded-full w-8 h-8 border-4 border-white cursor-pointer" + ) + " svelte-1skivl7") && attr$8(fe, "class", Ce), rt[0] & /*representations*/ + 2 && Ye !== (Ye = null_to_empty( /*rep*/ - n[53].color === "greenCarbon" ? "bg-green-600 rounded-full w-8 h-8 border-4 border-gray-300 cursor-pointer" : "bg-green-600 rounded-full w-8 h-8 border-4 border-white cursor-pointer" - ) + " svelte-1skivl7") && attr$8(pe, "class", ke), rt[0] & /*representations*/ - 2 && Ge !== (Ge = null_to_empty( + n[58].color === "cyanCarbon" ? "bg-cyan-600 rounded-full w-8 h-8 border-4 border-gray-300 cursor-pointer" : "bg-cyan-600 rounded-full w-8 h-8 border-4 border-white cursor-pointer" + ) + " svelte-1skivl7") && attr$8(Xe, "class", Ye), rt[0] & /*representations*/ + 2 && nt !== (nt = null_to_empty( /*rep*/ - n[53].color === "cyanCarbon" ? "bg-cyan-600 rounded-full w-8 h-8 border-4 border-gray-300 cursor-pointer" : "bg-cyan-600 rounded-full w-8 h-8 border-4 border-white cursor-pointer" - ) + " svelte-1skivl7") && attr$8(Be, "class", Ge), rt[0] & /*representations*/ - 2 && de !== (de = null_to_empty( + n[58].color === "alphafold" ? "rounded-lg p-1 border border-gray-400 cursor-pointer bg-gray-200" : "rounded-lg p-1 border border-gray-200 cursor-pointer bg-white" + ) + " svelte-1skivl7") && attr$8(it, "class", nt), rt[0] & /*representations*/ + 2 && Ut !== (Ut = null_to_empty( /*rep*/ - n[53].color === "alphafold" ? "rounded-lg p-1 border border-gray-400 cursor-pointer bg-gray-200" : "rounded-lg p-1 border border-gray-200 cursor-pointer bg-white" - ) + " svelte-1skivl7") && attr$8(ve, "class", de), rt[0] & /*representations*/ - 2 && Xe !== (Xe = null_to_empty( + n[58].color === "hydrophobicity" ? "rounded-lg p-1 border border-gray-400 cursor-pointer bg-gray-200" : "rounded-lg p-1 border border-gray-200 cursor-pointer bg-white" + ) + " svelte-1skivl7") && attr$8(ut, "class", Ut), rt[0] & /*representations*/ + 2 && Rt !== (Rt = null_to_empty( /*rep*/ - n[53].color === "default" ? "rounded-lg p-1 border border-gray-400 cursor-pointer bg-gray-200" : "rounded-lg p-1 border border-gray-200 cursor-pointer bg-white" - ) + " svelte-1skivl7") && attr$8(Ye, "class", Xe), rt[0] & /*representations*/ - 2 && ot !== (ot = null_to_empty( + n[58].color === "default" ? "rounded-lg p-1 border border-gray-400 cursor-pointer bg-gray-200" : "rounded-lg p-1 border border-gray-200 cursor-pointer bg-white" + ) + " svelte-1skivl7") && attr$8(mt, "class", Rt), rt[0] & /*representations*/ + 2 && Qe !== (Qe = null_to_empty( /*rep*/ - n[53].color === "Jmol" ? "rounded-lg p-1 border border-gray-400 cursor-pointer bg-gray-200" : "rounded-lg p-1 border border-gray-200 cursor-pointer bg-white" - ) + " svelte-1skivl7") && attr$8(dt, "class", ot), rt[0] & /*representations*/ - 2 && Lt !== (Lt = null_to_empty( + n[58].color === "Jmol" ? "rounded-lg p-1 border border-gray-400 cursor-pointer bg-gray-200" : "rounded-lg p-1 border border-gray-200 cursor-pointer bg-white" + ) + " svelte-1skivl7") && attr$8(ge, "class", Qe), rt[0] & /*representations*/ + 2 && Pt !== (Pt = null_to_empty( /*rep*/ - n[53].color === "chain" ? "rounded-lg p-1 border border-gray-400 cursor-pointer bg-gray-200" : "rounded-lg p-1 border border-gray-200 cursor-pointer bg-white" - ) + " svelte-1skivl7") && attr$8(bt, "class", Lt), rt[0] & /*representations*/ - 2 && gt !== (gt = null_to_empty( + n[58].color === "chain" ? "rounded-lg p-1 border border-gray-400 cursor-pointer bg-gray-200" : "rounded-lg p-1 border border-gray-200 cursor-pointer bg-white" + ) + " svelte-1skivl7") && attr$8(St, "class", Pt), rt[0] & /*representations*/ + 2 && nr !== (nr = null_to_empty( /*rep*/ - n[53].color === "spectrum" ? "rounded-lg p-1 border border-gray-400 cursor-pointer bg-gray-200" : "rounded-lg p-1 border border-gray-200 cursor-pointer bg-white" - ) + " svelte-1skivl7") && attr$8(ft, "class", gt); + n[58].color === "spectrum" ? "rounded-lg p-1 border border-gray-400 cursor-pointer bg-gray-200" : "rounded-lg p-1 border border-gray-200 cursor-pointer bg-white" + ) + " svelte-1skivl7") && attr$8(Tt, "class", nr); }, - i($t) { - $t && (Rt || add_render_callback(() => { - Rt = create_in_transition(e, fade, {}), Rt.start(); + i(kt) { + kt && (Or || add_render_callback(() => { + Or = create_in_transition(e, fade, {}), Or.start(); })); }, o: noop$7, - d($t) { - $t && detach$b(e), destroy_each$2(Ze, $t), Qe = !1, run_all$2(xe); + d(kt) { + kt && detach$b(e), destroy_each$2(Nt, kt), ft = !1, run_all$2(Qt); } }; } function create_each_block_1$1(n) { let e, t = ( /*mol*/ - n[56].name + "" + n[61].name + "" ), r, a, l; return { c() { e = element$7("option"), r = text$4(t), a = text$4(" #"), l = text$4( /*i*/ - n[58] + n[63] ), this.h(); }, - l(d) { - e = claim_element$7(d, "OPTION", { class: !0 }); - var o = children$8(e); - r = claim_text$4(o, t), a = claim_text$4(o, " #"), l = claim_text$4( - o, + l(h) { + e = claim_element$7(h, "OPTION", { class: !0 }); + var c = children$8(e); + r = claim_text$4(c, t), a = claim_text$4(c, " #"), l = claim_text$4( + c, /*i*/ - n[58] - ), o.forEach(detach$b), this.h(); + n[63] + ), c.forEach(detach$b), this.h(); }, h() { e.__value = /*i*/ - n[58], set_input_value$1(e, e.__value), attr$8(e, "class", "svelte-1skivl7"); + n[63], set_input_value$1(e, e.__value), attr$8(e, "class", "svelte-1skivl7"); }, - m(d, o) { - insert_hydration$b(d, e, o), append_hydration$8(e, r), append_hydration$8(e, a), append_hydration$8(e, l); + m(h, c) { + insert_hydration$b(h, e, c), append_hydration$8(e, r), append_hydration$8(e, a), append_hydration$8(e, l); }, - p(d, o) { - o[0] & /*moldata*/ + p(h, c) { + c[0] & /*moldata*/ 8 && t !== (t = /*mol*/ - d[56].name + "") && set_data$3(r, t); + h[61].name + "") && set_data$3(r, t); }, - d(d) { - d && detach$b(e); + d(h) { + h && detach$b(e); } }; } function create_each_block$2(n) { - let e, t, r, a, l, d, o, u, p, m, y, w, b, A = '', f, s, h = '', _, g, x; - function c() { + let e, t, r, a, l, h, c, d, _, m, y, x, b, A = '', f, s, u = '', p, g, w; + function o() { return ( /*click_handler*/ - n[26]( + n[27]( /*rep*/ - n[53], + n[58], /*each_value*/ - n[54], + n[59], /*index*/ - n[55] + n[60] ) ); } function v() { return ( /*click_handler_1*/ - n[27]( + n[28]( /*index*/ - n[55] + n[60] ) ); } function M() { return ( /*click_handler_2*/ - n[28]( + n[29]( /*rep*/ - n[53] + n[58] ) ); } let E = ( /*rep*/ - n[53].visible && create_if_block_1$6(n) + n[58].visible && create_if_block_1$6(n) ); return { c() { - e = element$7("div"), t = element$7("div"), r = element$7("div"), a = element$7("button"), l = svg_element$3("svg"), d = svg_element$3("path"), u = space$8(), p = element$7("span"), m = text$4("Representation #"), y = text$4( + e = element$7("div"), t = element$7("div"), r = element$7("div"), a = element$7("button"), l = svg_element$3("svg"), h = svg_element$3("path"), d = space$8(), _ = element$7("span"), m = text$4("Representation #"), y = text$4( /*index*/ - n[55] - ), w = space$8(), b = element$7("button"), b.innerHTML = A, f = space$8(), s = element$7("button"), s.innerHTML = h, _ = space$8(), E && E.c(), this.h(); + n[60] + ), x = space$8(), b = element$7("button"), b.innerHTML = A, f = space$8(), s = element$7("button"), s.innerHTML = u, p = space$8(), E && E.c(), this.h(); }, l($) { e = claim_element$7($, "DIV", { class: !0 }); @@ -42647,150 +42739,154 @@ function create_each_block$2(n) { class: !0 }); var R = children$8(l); - d = claim_svg_element$3(R, "path", { + h = claim_svg_element$3(R, "path", { "stroke-linecap": !0, "stroke-linejoin": !0, d: !0, class: !0 - }), children$8(d).forEach(detach$b), R.forEach(detach$b), u = claim_space$8(O), p = claim_element$7(O, "SPAN", { class: !0 }); - var P = children$8(p); - m = claim_text$4(P, "Representation #"), y = claim_text$4( - P, + }), children$8(h).forEach(detach$b), R.forEach(detach$b), d = claim_space$8(O), _ = claim_element$7(O, "SPAN", { class: !0 }); + var N = children$8(_); + m = claim_text$4(N, "Representation #"), y = claim_text$4( + N, /*index*/ - n[55] - ), P.forEach(detach$b), O.forEach(detach$b), w = claim_space$8(z), b = claim_element$7(z, "BUTTON", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$2(b) !== "svelte-1b0ur8n" && (b.innerHTML = A), f = claim_space$8(z), s = claim_element$7(z, "BUTTON", { + n[60] + ), N.forEach(detach$b), O.forEach(detach$b), x = claim_space$8(z), b = claim_element$7(z, "BUTTON", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$2(b) !== "svelte-1b0ur8n" && (b.innerHTML = A), f = claim_space$8(z), s = claim_element$7(z, "BUTTON", { title: !0, class: !0, "data-svelte-h": !0 - }), get_svelte_dataset$2(s) !== "svelte-jpslxx" && (s.innerHTML = h), z.forEach(detach$b), _ = claim_space$8(L), E && E.l(L), L.forEach(detach$b), k.forEach(detach$b), this.h(); + }), get_svelte_dataset$2(s) !== "svelte-jpslxx" && (s.innerHTML = u), z.forEach(detach$b), p = claim_space$8(L), E && E.l(L), L.forEach(detach$b), k.forEach(detach$b), this.h(); }, h() { - attr$8(d, "stroke-linecap", "round"), attr$8(d, "stroke-linejoin", "round"), attr$8(d, "d", "M8.25 4.5l7.5 7.5-7.5 7.5"), attr$8(d, "class", "svelte-1skivl7"), attr$8(l, "xmlns", "http://www.w3.org/2000/svg"), attr$8(l, "fill", "none"), attr$8(l, "viewBox", "0 0 24 24"), attr$8(l, "stroke-width", "1.5"), attr$8(l, "stroke", "currentColor"), attr$8(l, "class", o = null_to_empty( + attr$8(h, "stroke-linecap", "round"), attr$8(h, "stroke-linejoin", "round"), attr$8(h, "d", "M8.25 4.5l7.5 7.5-7.5 7.5"), attr$8(h, "class", "svelte-1skivl7"), attr$8(l, "xmlns", "http://www.w3.org/2000/svg"), attr$8(l, "fill", "none"), attr$8(l, "viewBox", "0 0 24 24"), attr$8(l, "stroke-width", "1.5"), attr$8(l, "stroke", "currentColor"), attr$8(l, "class", c = null_to_empty( /*rep*/ - n[53].visible ? "transform rotate-90 w-5 h-5 " : "w-5 h-5 " - ) + " svelte-1skivl7"), attr$8(p, "class", "svelte-1skivl7"), attr$8(a, "class", "flex items-center space-x-2 svelte-1skivl7"), attr$8(b, "class", "svelte-1skivl7"), attr$8(s, "title", "zoom to selection"), attr$8(s, "class", "svelte-1skivl7"), attr$8(r, "class", "flex space-x-2 items-center cursor-pointer p-1 svelte-1skivl7"), attr$8(t, "class", " svelte-1skivl7"), attr$8(e, "class", "bg-white border-b border-t border-gray-200 py-4 px-2 svelte-1skivl7"); + n[58].visible ? "transform rotate-90 w-5 h-5 " : "w-5 h-5 " + ) + " svelte-1skivl7"), attr$8(_, "class", "svelte-1skivl7"), attr$8(a, "class", "flex items-center space-x-2 svelte-1skivl7"), attr$8(b, "class", "svelte-1skivl7"), attr$8(s, "title", "zoom to selection"), attr$8(s, "class", "svelte-1skivl7"), attr$8(r, "class", "flex space-x-2 items-center cursor-pointer p-1 svelte-1skivl7"), attr$8(t, "class", " svelte-1skivl7"), attr$8(e, "class", "bg-white border-b border-t border-gray-200 py-4 px-2 svelte-1skivl7"); }, m($, k) { - insert_hydration$b($, e, k), append_hydration$8(e, t), append_hydration$8(t, r), append_hydration$8(r, a), append_hydration$8(a, l), append_hydration$8(l, d), append_hydration$8(a, u), append_hydration$8(a, p), append_hydration$8(p, m), append_hydration$8(p, y), append_hydration$8(r, w), append_hydration$8(r, b), append_hydration$8(r, f), append_hydration$8(r, s), append_hydration$8(t, _), E && E.m(t, null), g || (x = [ - listen$2(a, "click", c), + insert_hydration$b($, e, k), append_hydration$8(e, t), append_hydration$8(t, r), append_hydration$8(r, a), append_hydration$8(a, l), append_hydration$8(l, h), append_hydration$8(a, d), append_hydration$8(a, _), append_hydration$8(_, m), append_hydration$8(_, y), append_hydration$8(r, x), append_hydration$8(r, b), append_hydration$8(r, f), append_hydration$8(r, s), append_hydration$8(t, p), E && E.m(t, null), g || (w = [ + listen$2(a, "click", o), listen$2(b, "click", v), listen$2(s, "click", M) ], g = !0); }, p($, k) { n = $, k[0] & /*representations*/ - 2 && o !== (o = null_to_empty( + 2 && c !== (c = null_to_empty( /*rep*/ - n[53].visible ? "transform rotate-90 w-5 h-5 " : "w-5 h-5 " - ) + " svelte-1skivl7") && attr$8(l, "class", o), /*rep*/ - n[53].visible ? E ? (E.p(n, k), k[0] & /*representations*/ + n[58].visible ? "transform rotate-90 w-5 h-5 " : "w-5 h-5 " + ) + " svelte-1skivl7") && attr$8(l, "class", c), /*rep*/ + n[58].visible ? E ? (E.p(n, k), k[0] & /*representations*/ 2 && transition_in$7(E, 1)) : (E = create_if_block_1$6(n), E.c(), transition_in$7(E, 1), E.m(t, null)) : E && (E.d(1), E = null); }, d($) { - $ && detach$b(e), E && E.d(), g = !1, run_all$2(x); + $ && detach$b(e), E && E.d(), g = !1, run_all$2(w); } }; } function create_fragment$b(n) { - let e, t, r, a, l, d = '', o, u, p = '', m, y, w = '', b, A, f, s, h, _ = '', g, x, c = "Cite 3dmol.js as Rego & Koes, doi:10/gb5g5n", v, M, E, $, k, L, z = ( + let e, t, r, a, l, h = '', c, d, _ = '', m, y, x = '', b, A, f, s, u, p, g = '', w, o, v = "Cite 3dmol.js as Rego & Koes, doi:10/gb5g5n", M, E, $, k, L, z, O = ( /*anyColorAlphaFold*/ - n[11] && create_if_block_8$1(n) - ), O = ( + n[11] && create_if_block_9$1(n) + ), R = ( + /*anyColorHydrophobic*/ + n[12] && create_if_block_8$1() + ), N = ( /*hasFrames*/ n[9] && create_if_block_6$1(n) - ), R = ( + ), W = ( /*showOffCanvas*/ n[7] && create_if_block_2$3(n) - ), P = ( + ), B = ( /*showOffCanvasReps*/ n[8] && create_if_block$8(n) ); return { c() { - e = element$7("div"), t = element$7("div"), r = element$7("div"), a = element$7("div"), l = element$7("button"), l.innerHTML = d, o = space$8(), u = element$7("button"), u.innerHTML = p, m = space$8(), y = element$7("button"), y.innerHTML = w, b = space$8(), z && z.c(), A = space$8(), O && O.c(), f = space$8(), s = element$7("div"), h = element$7("button"), h.innerHTML = _, g = space$8(), x = element$7("span"), x.textContent = c, v = space$8(), M = element$7("div"), E = space$8(), R && R.c(), $ = space$8(), P && P.c(), this.h(); - }, - l(U) { - e = claim_element$7(U, "DIV", { class: !0 }); - var B = children$8(e); - t = claim_element$7(B, "DIV", { class: !0 }); - var N = children$8(t); - r = claim_element$7(N, "DIV", { class: !0 }); - var G = children$8(r); - a = claim_element$7(G, "DIV", { class: !0 }); - var H = children$8(a); - l = claim_element$7(H, "BUTTON", { + e = element$7("div"), t = element$7("div"), r = element$7("div"), a = element$7("div"), l = element$7("button"), l.innerHTML = h, c = space$8(), d = element$7("button"), d.innerHTML = _, m = space$8(), y = element$7("button"), y.innerHTML = x, b = space$8(), O && O.c(), A = space$8(), R && R.c(), f = space$8(), N && N.c(), s = space$8(), u = element$7("div"), p = element$7("button"), p.innerHTML = g, w = space$8(), o = element$7("span"), o.textContent = v, M = space$8(), E = element$7("div"), $ = space$8(), W && W.c(), k = space$8(), B && B.c(), this.h(); + }, + l(P) { + e = claim_element$7(P, "DIV", { class: !0 }); + var G = children$8(e); + t = claim_element$7(G, "DIV", { class: !0 }); + var H = children$8(t); + r = claim_element$7(H, "DIV", { class: !0 }); + var U = children$8(r); + a = claim_element$7(U, "DIV", { class: !0 }); + var j = children$8(a); + l = claim_element$7(j, "BUTTON", { class: !0, title: !0, "data-svelte-h": !0 - }), get_svelte_dataset$2(l) !== "svelte-1awoxzz" && (l.innerHTML = d), o = claim_space$8(H), u = claim_element$7(H, "BUTTON", { + }), get_svelte_dataset$2(l) !== "svelte-1awoxzz" && (l.innerHTML = h), c = claim_space$8(j), d = claim_element$7(j, "BUTTON", { class: !0, title: !0, "data-svelte-h": !0 - }), get_svelte_dataset$2(u) !== "svelte-18a3afg" && (u.innerHTML = p), m = claim_space$8(H), y = claim_element$7(H, "BUTTON", { + }), get_svelte_dataset$2(d) !== "svelte-18a3afg" && (d.innerHTML = _), m = claim_space$8(j), y = claim_element$7(j, "BUTTON", { class: !0, title: !0, "data-svelte-h": !0 - }), get_svelte_dataset$2(y) !== "svelte-osiom6" && (y.innerHTML = w), H.forEach(detach$b), b = claim_space$8(G), z && z.l(G), A = claim_space$8(G), O && O.l(G), f = claim_space$8(G), s = claim_element$7(G, "DIV", { class: !0 }); - var W = children$8(s); - h = claim_element$7(W, "BUTTON", { + }), get_svelte_dataset$2(y) !== "svelte-osiom6" && (y.innerHTML = x), j.forEach(detach$b), b = claim_space$8(U), O && O.l(U), A = claim_space$8(U), R && R.l(U), f = claim_space$8(U), N && N.l(U), s = claim_space$8(U), u = claim_element$7(U, "DIV", { class: !0 }); + var re = children$8(u); + p = claim_element$7(re, "BUTTON", { class: !0, title: !0, "data-svelte-h": !0 - }), get_svelte_dataset$2(h) !== "svelte-1yqhmsc" && (h.innerHTML = _), g = claim_space$8(W), x = claim_element$7(W, "SPAN", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$2(x) !== "svelte-yennc4" && (x.textContent = c), W.forEach(detach$b), v = claim_space$8(G), M = claim_element$7(G, "DIV", { class: !0 }), children$8(M).forEach(detach$b), E = claim_space$8(G), R && R.l(G), $ = claim_space$8(G), P && P.l(G), G.forEach(detach$b), N.forEach(detach$b), B.forEach(detach$b), this.h(); + }), get_svelte_dataset$2(p) !== "svelte-1yqhmsc" && (p.innerHTML = g), w = claim_space$8(re), o = claim_element$7(re, "SPAN", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$2(o) !== "svelte-yennc4" && (o.textContent = v), re.forEach(detach$b), M = claim_space$8(U), E = claim_element$7(U, "DIV", { class: !0 }), children$8(E).forEach(detach$b), $ = claim_space$8(U), W && W.l(U), k = claim_space$8(U), B && B.l(U), U.forEach(detach$b), H.forEach(detach$b), G.forEach(detach$b), this.h(); }, h() { - attr$8(l, "class", "p-2 svelte-1skivl7"), attr$8(l, "title", "Reset View"), attr$8(u, "class", "p-2 svelte-1skivl7"), attr$8(u, "title", "Settings"), attr$8(y, "class", "p-2 svelte-1skivl7"), attr$8(y, "title", "Representations"), attr$8(a, "class", "absolute z-50 top-0 right-0 mr-2 flex flex-col divide-y border border-gray-200 mt-2 rounded items-center justify-center bg-white dark:bg-gray-800 svelte-1skivl7"), attr$8(h, "class", "p-1 svelte-1skivl7"), attr$8(h, "title", "How to cite 3Dmol.js"), attr$8(x, "class", "absolute -top-1 left-6 w-max rounded bg-gray-900 px-2 py-1 text-sm font-medium text-gray-50 opacity-0 shadow transition-opacity svelte-1skivl7"), toggle_class$5( - x, + attr$8(l, "class", "p-2 svelte-1skivl7"), attr$8(l, "title", "Reset View"), attr$8(d, "class", "p-2 svelte-1skivl7"), attr$8(d, "title", "Settings"), attr$8(y, "class", "p-2 svelte-1skivl7"), attr$8(y, "title", "Representations"), attr$8(a, "class", "absolute z-50 top-0 right-0 mr-2 flex flex-col divide-y border border-gray-200 mt-2 rounded items-center justify-center bg-white dark:bg-gray-800 svelte-1skivl7"), attr$8(p, "class", "p-1 svelte-1skivl7"), attr$8(p, "title", "How to cite 3Dmol.js"), attr$8(o, "class", "absolute -top-1 left-6 w-max rounded bg-gray-900 px-2 py-1 text-sm font-medium text-gray-50 opacity-0 shadow transition-opacity svelte-1skivl7"), toggle_class$5( + o, "opacity-100", /*showCiteTooltip*/ n[6] - ), attr$8(s, "class", "absolute z-50 bottom-0 left-0 ml-2 flex divide-x mb-2 rounded items-center justify-center svelte-1skivl7"), attr$8(M, "class", "viewer w-full h-full z-10 svelte-1skivl7"), attr$8(r, "class", "gr-block gr-box relative w-full overflow-hidden svelte-1skivl7"), attr$8(t, "class", "overflow-hidden flex gap-px w-full h-full flex-wrap svelte-1skivl7"), attr$8(e, "class", "bg-white w-full minh svelte-1skivl7"); + ), attr$8(u, "class", "absolute z-50 bottom-0 left-0 ml-2 flex divide-x mb-2 rounded items-center justify-center svelte-1skivl7"), attr$8(E, "class", "viewer w-full h-full z-10 svelte-1skivl7"), attr$8(r, "class", "gr-block gr-box relative w-full overflow-hidden svelte-1skivl7"), attr$8(t, "class", "overflow-hidden flex gap-px w-full h-full flex-wrap svelte-1skivl7"), attr$8(e, "class", "bg-white w-full minh svelte-1skivl7"); }, - m(U, B) { - insert_hydration$b(U, e, B), append_hydration$8(e, t), append_hydration$8(t, r), append_hydration$8(r, a), append_hydration$8(a, l), append_hydration$8(a, o), append_hydration$8(a, u), append_hydration$8(a, m), append_hydration$8(a, y), append_hydration$8(r, b), z && z.m(r, null), append_hydration$8(r, A), O && O.m(r, null), append_hydration$8(r, f), append_hydration$8(r, s), append_hydration$8(s, h), append_hydration$8(s, g), append_hydration$8(s, x), append_hydration$8(r, v), append_hydration$8(r, M), n[21](M), append_hydration$8(r, E), R && R.m(r, null), append_hydration$8(r, $), P && P.m(r, null), k || (L = [ + m(P, G) { + insert_hydration$b(P, e, G), append_hydration$8(e, t), append_hydration$8(t, r), append_hydration$8(r, a), append_hydration$8(a, l), append_hydration$8(a, c), append_hydration$8(a, d), append_hydration$8(a, m), append_hydration$8(a, y), append_hydration$8(r, b), O && O.m(r, null), append_hydration$8(r, A), R && R.m(r, null), append_hydration$8(r, f), N && N.m(r, null), append_hydration$8(r, s), append_hydration$8(r, u), append_hydration$8(u, p), append_hydration$8(u, w), append_hydration$8(u, o), append_hydration$8(r, M), append_hydration$8(r, E), n[22](E), append_hydration$8(r, $), W && W.m(r, null), append_hydration$8(r, k), B && B.m(r, null), L || (z = [ listen$2( l, "click", /*resetZoom*/ - n[18] + n[19] ), listen$2( - u, + d, "click", /*toggleOffCanvas*/ - n[14] + n[15] ), listen$2( y, "click", /*toggleOffCanvasReps*/ - n[15] + n[16] ), listen$2( - h, + p, "click", /*toggleCiteTooltip*/ - n[13] + n[14] ) - ], k = !0); + ], L = !0); }, - p(U, B) { + p(P, G) { /*anyColorAlphaFold*/ - U[11] ? z ? z.p(U, B) : (z = create_if_block_8$1(U), z.c(), z.m(r, A)) : z && (z.d(1), z = null), /*hasFrames*/ - U[9] ? O ? O.p(U, B) : (O = create_if_block_6$1(U), O.c(), O.m(r, f)) : O && (O.d(1), O = null), B[0] & /*showCiteTooltip*/ + P[11] ? O ? O.p(P, G) : (O = create_if_block_9$1(P), O.c(), O.m(r, A)) : O && (O.d(1), O = null), /*anyColorHydrophobic*/ + P[12] ? R || (R = create_if_block_8$1(), R.c(), R.m(r, f)) : R && (R.d(1), R = null), /*hasFrames*/ + P[9] ? N ? N.p(P, G) : (N = create_if_block_6$1(P), N.c(), N.m(r, s)) : N && (N.d(1), N = null), G[0] & /*showCiteTooltip*/ 64 && toggle_class$5( - x, + o, "opacity-100", /*showCiteTooltip*/ - U[6] + P[6] ), /*showOffCanvas*/ - U[7] ? R ? R.p(U, B) : (R = create_if_block_2$3(U), R.c(), R.m(r, $)) : R && (R.d(1), R = null), /*showOffCanvasReps*/ - U[8] ? P ? P.p(U, B) : (P = create_if_block$8(U), P.c(), P.m(r, null)) : P && (P.d(1), P = null); + P[7] ? W ? W.p(P, G) : (W = create_if_block_2$3(P), W.c(), W.m(r, k)) : W && (W.d(1), W = null), /*showOffCanvasReps*/ + P[8] ? B ? B.p(P, G) : (B = create_if_block$8(P), B.c(), B.m(r, null)) : B && (B.d(1), B = null); }, i: noop$7, o: noop$7, - d(U) { - U && detach$b(e), z && z.d(), O && O.d(), n[21](null), R && R.d(), P && P.d(), k = !1, run_all$2(L); + d(P) { + P && detach$b(e), O && O.d(), R && R.d(), N && N.d(), n[22](null), W && W.d(), B && B.d(), L = !1, run_all$2(z); } }; } @@ -42803,33 +42899,33 @@ function fade(n, { delay: e = 0, duration: t = 50 }) { }; } function instance$a(n, e, t) { - let r = mol, a, { confidenceLabel: l = null } = e, { moldata: d = null } = e, o = { + let r = mol, a, { confidenceLabel: l = null } = e, { moldata: h = null } = e, c = { backgroundColor: { type: "select", options: ["white", "black", "gray", "lightgray", "beige", "orange"] }, orthographic: { type: "toggle" }, disableFog: { type: "toggle" } - }, { config: u = { + }, { config: d = { backgroundColor: "white", orthographic: !1, disableFog: !1 - } } = e, p = !0, m = !1; + } } = e, _ = !0, m = !1; function y() { t(6, m = !m); } - let { representations: w = [] } = e, b = !1, A = !1; + let { representations: x = [] } = e, b = !1, A = !1; function f() { t(7, b = !b); } function s() { t(8, A = !A); } - function h(Ee) { - w.splice(Ee, 1), t(1, w); + function u(Me) { + x.splice(Me, 1), t(1, x); } - function _() { - w.push({ + function p() { + x.push({ model: 0, chain: "", resname: "", @@ -42838,180 +42934,227 @@ function instance$a(n, e, t) { residue_range: "", around: 0, byres: !1, - visible: !0 - }), t(1, w); - } - let g = function(Ee) { - return Ee.b < 50 ? "OrangeRed" : Ee.b < 70 ? "Gold" : Ee.b < 90 ? "MediumTurquoise" : "Blue"; - }, x; - function c(Ee) { - if (Ee.type != null) - x.zoomTo(); + visible: !0, + opacity: 1 + }), t(1, x); + } + let g = function(Me) { + return Me.b < 50 ? "OrangeRed" : Me.b < 70 ? "Gold" : Me.b < 90 ? "MediumTurquoise" : "Blue"; + }, w = function(Me) { + let De = { + ILE: 4.5, + VAL: 4.2, + LEU: 3.8, + PHE: 2.8, + CYS: 2.5, + MET: 1.9, + ALA: 1.8, + GLY: -0.4, + THR: -0.7, + SER: -0.8, + TRP: -0.9, + TYR: -1.3, + PRO: -1.6, + HIS: -3.2, + GLU: -3.5, + GLN: -3.5, + ASP: -3.5, + ASN: -3.5, + LYS: -3.9, + ARG: -4.5 + }; + if (Me.resn in De) { + const V = De[Me.resn], Z = -4.5, ye = (V - Z) / (4.5 - Z), ce = (Ie, ke, Y) => { + const me = parseInt(Ie.slice(1), 16), we = parseInt(ke.slice(1), 16), Re = Math.round(((we >> 16) - (me >> 16)) * Y + (me >> 16)), pe = Math.round(((we >> 8 & 255) - (me >> 8 & 255)) * Y + (me >> 8 & 255)), $e = Math.round(((we & 255) - (me & 255)) * Y + (me & 255)); + return `#${((1 << 24) + (Re << 16) + (pe << 8) + $e).toString(16).slice(1)}`; + }; + return ye <= 0.5 ? ce("#008B8B", "#FFFFFF", ye * 2) : ce("#FFFFFF", "#B8860B", (ye - 0.5) * 2); + } else + return "#FFFFFF"; + }, o; + function v(Me) { + if (Me.type != null) + o.zoomTo(); else { - let Ae = { model: Ee.model }; - Ee.chain !== "" && (Ae.chain = Ee.chain), Ee.residue_range !== "" && (Ae.resi = Ee.residue_range), Ee.resname !== "" && (Ae.resn = Ee.resname), x.zoomTo(Ae); - } - } - function v(Ee) { - x !== void 0 && (x.setStyle(), x.removeAllSurfaces(), Ee.forEach((Ae) => { - let ge; - Ae.color === "alphafold" ? ge = { colorfunc: g } : Ae.color == "spectrum" ? ge = { color: "spectrum" } : ge = { colorscheme: Ae.color }; - let Le = { model: Ae.model }; - if (Ae.chain !== "" && (Le.chain = Ae.chain), Ae.residue_range !== "" && (Le.resi = Ae.residue_range), Ae.resname !== "" && (Le.resn = Ae.resname), Le.byres = Ae.byres, Ae.around !== 0 && (Le.expand = Ae.around), Ae.sidechain && (Le = { - and: [Le, { atom: ["N", "C", "O"], invert: !0 }] - }), Ae.style === "surface") - ge.opacity = 0.8, x.addSurface(r.SurfaceType.VDW, ge, Le); + let De = { model: Me.model }; + Me.chain !== "" && (De.chain = Me.chain), Me.residue_range !== "" && (De.resi = Me.residue_range), Me.resname !== "" && (De.resn = Me.resname), o.zoomTo(De); + } + } + function M(Me) { + o !== void 0 && (o.setStyle(), o.removeAllSurfaces(), Me.forEach((De) => { + let V; + De.color === "alphafold" ? V = { colorfunc: g } : De.color === "hydrophobicity" ? V = { colorfunc: w } : De.color == "spectrum" ? V = { color: "spectrum" } : V = { colorscheme: De.color }, V.opacity = De.opacity; + let Z = { model: De.model }; + if (De.chain !== "" && (Z.chain = De.chain), De.residue_range !== "" && (Z.resi = De.residue_range), De.resname !== "" && (Z.resn = De.resname), Z.byres = De.byres, De.around !== 0 && (Z.expand = De.around), De.sidechain && (Z = { + and: [Z, { atom: ["N", "C", "O"], invert: !0 }] + }), De.style === "surface") + o.addSurface(r.SurfaceType.VDW, V, Z); else try { - x.getModel(Le.model) != null && x.addStyle(Le, { [Ae.style]: ge }); - } catch (Te) { - console.log(Te); + o.getModel(Z.model) != null && o.addStyle(Z, { [De.style]: V }); + } catch (ee) { + console.log(ee); } - }), x.render()); + }), o.render()); } onMount$2(() => { console.log("MolecularViewer Mounted"); - let Ee = Object.assign(Object.assign({}, u), { cartoonQuality: 7 }); - t(20, x = r.createViewer(a, Ee)); - let Ae = []; - w.forEach((ge) => { - Ae.some((Le) => Le.model === ge.model && Le.chain === ge.chain && Le.resname === ge.resname && Le.style === ge.style && Le.color === ge.color && Le.residue_range === ge.residue_range && Le.around === ge.around && Le.byres === ge.byres && Le.sidechain === ge.sidechain) || Ae.push(ge); - }), t(1, w = Ae), console.log(d), d.length > 0 && d.forEach((ge) => { - ge.asFrames ? x.addModelsAsFrames(ge.data, ge.format) : x.addModel(ge.data, ge.format); - }), v(w), x.zoomTo(), x.render(), x.zoom(0.9, 100), w.forEach((ge) => { - ge.color === "alphafold" && t(11, $ = !0); - }), p && x.setHoverable( + let Me = Object.assign(Object.assign({}, d), { cartoonQuality: 7 }); + t(21, o = r.createViewer(a, Me)); + let De = []; + x.forEach((V) => { + De.some((Z) => Z.model === V.model && Z.chain === V.chain && Z.resname === V.resname && Z.style === V.style && Z.color === V.color && Z.residue_range === V.residue_range && Z.around === V.around && Z.byres === V.byres && Z.sidechain === V.sidechain) || De.push(V); + }), t(1, x = De), h.length > 0 && h.forEach((V) => { + V.asFrames ? o.addModelsAsFrames(V.data, V.format) : o.addModel(V.data, V.format); + }), M(x), o.zoomTo(), o.render(), o.zoom(0.9, 100), x.forEach((V) => { + V.color === "alphafold" && t(11, k = !0), V.color === "hydrophobicity" && t(12, L = !0); + }), _ && o.setHoverable( {}, !0, - function(ge, Le, Te, Ke) { - if (!ge.label) { - let je; - $ ? je = ge.resn + ":" + ge.resi + ":" + ge.atom + " (" + l + " " + ge.b + ")" : je = ge.resn + ":" + ge.resi + ":" + ge.atom, ge.label = Le.addLabel(je, { - position: ge, + function(V, Z, ee, ye) { + if (!V.label) { + let ce; + k ? ce = V.resn + ":" + V.resi + ":" + V.atom + " (" + l + " " + V.b + ")" : ce = V.resn + ":" + V.resi + ":" + V.atom, V.label = Z.addLabel(ce, { + position: V, backgroundColor: "#ffffff", borderColor: "#dddddd", fontColor: "black" }); } }, - function(ge, Le) { - ge.label && (Le.removeLabel(ge.label), delete ge.label); + function(V, Z) { + V.label && (Z.removeLabel(V.label), delete V.label); } ); + }), beforeUpdate(() => { + console.log("beforeUpdate"), console.log(x); }); - let M = !1, E = !1, $ = !1; - function k() { - console.log(x.isAnimated()), E ? x.pauseAnimate() : x.animate({ loop: "forward", reps: 0 }), x.render(), console.log(x.isAnimated()), t(10, E = !E); + let E = !1, $ = !1, k = !1, L = !1; + function z() { + console.log(o.isAnimated()), $ ? o.pauseAnimate() : o.animate({ loop: "forward", reps: 0 }), o.render(), console.log(o.isAnimated()), t(10, $ = !$); } - function L(Ee) { - binding_callbacks$3[Ee ? "unshift" : "push"](() => { - a = Ee, t(4, a); + function O(Me) { + binding_callbacks$3[Me ? "unshift" : "push"](() => { + a = Me, t(4, a); }); } - function z(Ee) { - u[Ee] = this.checked, t(0, u), t(12, o); + function R(Me) { + d[Me] = this.checked, t(0, d), t(13, c); } - const O = (Ee) => { - t(0, u[Ee] = event.target.value, u); + const N = (Me) => { + t(0, d[Me] = event.target.value, d); }; - function R(Ee) { - u[Ee] = select_value(this), t(0, u), t(12, o); + function W(Me) { + d[Me] = select_value(this), t(0, d), t(13, c); } - function P() { - p = this.value, t(5, p); + function B() { + _ = this.value, t(5, _); } - const U = (Ee, Ae, ge) => t(1, Ae[ge].visible = !Ee.visible, w), B = (Ee) => h(Ee), N = (Ee) => c(Ee); - function G(Ee, Ae) { - Ee[Ae].model = select_value(this), t(1, w); + const P = (Me, De, V) => t(1, De[V].visible = !Me.visible, x), G = (Me) => u(Me), H = (Me) => v(Me); + function U(Me, De) { + Me[De].model = select_value(this), t(1, x); } - function H(Ee, Ae) { - Ee[Ae].chain = this.value, t(1, w); + function j(Me, De) { + Me[De].chain = this.value, t(1, x); } - function W(Ee, Ae) { - Ee[Ae].resname = this.value, t(1, w); + function re(Me, De) { + Me[De].resname = this.value, t(1, x); } - function V(Ee, Ae) { - Ee[Ae].residue_range = this.value, t(1, w); + function ie(Me, De) { + Me[De].residue_range = this.value, t(1, x); } - function re(Ee, Ae) { - Ee[Ae].style = select_value(this), t(1, w); + function te(Me, De) { + Me[De].style = select_value(this), t(1, x); } - const ie = (Ee, Ae, ge, Le) => { - t(1, Ae[ge].around = Le.target.value, w); + const ue = (Me, De, V, Z) => { + t(1, De[V].opacity = Z.target.value, x); }; - function ee(Ee, Ae) { - Ee[Ae].around = this.value, t(1, w); + function de(Me, De) { + Me[De].opacity = this.value, t(1, x); } - function ce(Ee, Ae) { - Ee[Ae].byres = this.checked, t(1, w); + const oe = (Me, De, V, Z) => { + t(1, De[V].around = Z.target.value, x); + }; + function J(Me, De) { + Me[De].around = this.value, t(1, x); } - function he(Ee, Ae) { - Ee[Ae].sidechain = this.checked, t(1, w); + function Ee(Me, De) { + Me[De].byres = this.checked, t(1, x); } - const le = (Ee, Ae, ge) => t(1, Ae[ge].color = "orangeCarbon", w), J = (Ee, Ae, ge) => t(1, Ae[ge].color = "redCarbon", w), Me = (Ee, Ae, ge) => t(1, Ae[ge].color = "blackCarbon", w), se = (Ee, Ae, ge) => t(1, Ae[ge].color = "blueCarbon", w), Ce = (Ee, Ae, ge) => t(1, Ae[ge].color = "grayCarbon", w), ue = (Ee, Ae, ge) => t(1, Ae[ge].color = "greenCarbon", w), ne = (Ee, Ae, ge) => t(1, Ae[ge].color = "cyanCarbon", w), _e = (Ee, Ae, ge) => t(1, Ae[ge].color = "alphafold", w), Oe = (Ee, Ae, ge) => t(1, Ae[ge].color = "default", w), Re = (Ee, Ae, ge) => t(1, Ae[ge].color = "Jmol", w), Ue = (Ee, Ae, ge) => t(1, Ae[ge].color = "chain", w), We = (Ee, Ae, ge) => t(1, Ae[ge].color = "spectrum", w); - return n.$$set = (Ee) => { - "confidenceLabel" in Ee && t(2, l = Ee.confidenceLabel), "moldata" in Ee && t(3, d = Ee.moldata), "config" in Ee && t(0, u = Ee.config), "representations" in Ee && t(1, w = Ee.representations); + function se(Me, De) { + Me[De].sidechain = this.checked, t(1, x); + } + const Ae = (Me, De, V) => t(1, De[V].color = "orangeCarbon", x), he = (Me, De, V) => t(1, De[V].color = "redCarbon", x), ne = (Me, De, V) => t(1, De[V].color = "blackCarbon", x), _e = (Me, De, V) => t(1, De[V].color = "blueCarbon", x), Le = (Me, De, V) => t(1, De[V].color = "grayCarbon", x), Be = (Me, De, V) => t(1, De[V].color = "greenCarbon", x), Ue = (Me, De, V) => t(1, De[V].color = "cyanCarbon", x), He = (Me, De, V) => t(1, De[V].color = "alphafold", x), We = (Me, De, V) => t(1, De[V].color = "hydrophobicity", x), Ge = (Me, De, V) => t(1, De[V].color = "default", x), Ne = (Me, De, V) => t(1, De[V].color = "Jmol", x), Pe = (Me, De, V) => t(1, De[V].color = "chain", x), Te = (Me, De, V) => t(1, De[V].color = "spectrum", x); + return n.$$set = (Me) => { + "confidenceLabel" in Me && t(2, l = Me.confidenceLabel), "moldata" in Me && t(3, h = Me.moldata), "config" in Me && t(0, d = Me.config), "representations" in Me && t(1, x = Me.representations); }, n.$$.update = () => { n.$$.dirty[0] & /*view, config*/ - 1048577 && x != null && (x.setBackgroundColor(u.backgroundColor), x.enableFog(!u.disableFog), x.setCameraParameters({ orthographic: u.orthographic })), n.$$.dirty[0] & /*representations*/ - 2 && v(w), n.$$.dirty[0] & /*moldata*/ - 8 && d.forEach((Ee) => { - Ee.asFrames && t(9, M = !0); + 2097153 && o != null && (o.setBackgroundColor(d.backgroundColor), o.enableFog(!d.disableFog), o.setCameraParameters({ orthographic: d.orthographic })), n.$$.dirty[0] & /*representations*/ + 2 && M(x), n.$$.dirty[0] & /*moldata*/ + 8 && h.forEach((Me) => { + Me.asFrames && t(9, E = !0); }), n.$$.dirty[0] & /*representations*/ - 2 && (t(11, $ = !1), w.forEach((Ee) => { - Ee.color === "alphafold" && t(11, $ = !0); + 2 && (t(11, k = !1), x.forEach((Me) => { + Me.color === "alphafold" && t(11, k = !0); + })), n.$$.dirty[0] & /*representations*/ + 2 && (t(12, L = !1), x.forEach((Me) => { + Me.color === "hydrophobicity" && t(12, L = !0); })); }, [ - u, - w, - l, d, + x, + l, + h, a, - p, + _, m, b, A, - M, E, $, - o, + k, + L, + c, y, f, s, - h, - _, - c, - k, - x, - L, + u, + p, + v, z, + o, O, R, - P, - U, - B, N, + W, + B, + P, G, H, - W, - V, + U, + j, re, ie, - ee, - ce, - he, - le, + te, + ue, + de, + oe, J, - Me, + Ee, se, - Ce, - ue, + Ae, + he, ne, _e, - Oe, - Re, + Le, + Be, Ue, - We + He, + We, + Ge, + Ne, + Pe, + Te ]; } class MolecularViewer extends SvelteComponent$b { @@ -43122,37 +43265,37 @@ function create_if_block$7(n) { c() { create_component$6(e.$$.fragment), t = space$7(), l && l.c(), r = empty$4(); }, - l(d) { - claim_component$6(e.$$.fragment, d), t = claim_space$7(d), l && l.l(d), r = empty$4(); - }, - m(d, o) { - mount_component$6(e, d, o), insert_hydration$a(d, t, o), l && l.m(d, o), insert_hydration$a(d, r, o), a = !0; - }, - p(d, o) { - const u = {}; - o & /*i18n*/ - 32 && (u.i18n = /*i18n*/ - d[5]), o & /*selectable*/ - 8 && (u.selectable = /*selectable*/ - d[3]), o & /*value*/ - 1 && (u.value = /*value*/ - d[0]), o & /*height*/ - 16 && (u.height = /*height*/ - d[4]), e.$set(u), /*moldata*/ - d[9] != null && /*molviewer*/ - d[10] ? l ? (l.p(d, o), o & /*moldata, molviewer*/ - 1536 && transition_in$6(l, 1)) : (l = create_if_block_1$5(d), l.c(), transition_in$6(l, 1), l.m(r.parentNode, r)) : l && (group_outros$6(), transition_out$6(l, 1, 1, () => { + l(h) { + claim_component$6(e.$$.fragment, h), t = claim_space$7(h), l && l.l(h), r = empty$4(); + }, + m(h, c) { + mount_component$6(e, h, c), insert_hydration$a(h, t, c), l && l.m(h, c), insert_hydration$a(h, r, c), a = !0; + }, + p(h, c) { + const d = {}; + c & /*i18n*/ + 32 && (d.i18n = /*i18n*/ + h[5]), c & /*selectable*/ + 8 && (d.selectable = /*selectable*/ + h[3]), c & /*value*/ + 1 && (d.value = /*value*/ + h[0]), c & /*height*/ + 16 && (d.height = /*height*/ + h[4]), e.$set(d), /*moldata*/ + h[9] != null && /*molviewer*/ + h[10] ? l ? (l.p(h, c), c & /*moldata, molviewer*/ + 1536 && transition_in$6(l, 1)) : (l = create_if_block_1$5(h), l.c(), transition_in$6(l, 1), l.m(r.parentNode, r)) : l && (group_outros$6(), transition_out$6(l, 1, 1, () => { l = null; }), check_outros$6()); }, - i(d) { - a || (transition_in$6(e.$$.fragment, d), transition_in$6(l), a = !0); + i(h) { + a || (transition_in$6(e.$$.fragment, h), transition_in$6(l), a = !0); }, - o(d) { - transition_out$6(e.$$.fragment, d), transition_out$6(l), a = !1; + o(h) { + transition_out$6(e.$$.fragment, h), transition_out$6(l), a = !1; }, - d(d) { - d && (detach$a(t), detach$a(r)), destroy_component$6(e, d), l && l.d(d); + d(h) { + h && (detach$a(t), detach$a(r)), destroy_component$6(e, h), l && l.d(h); } }; } @@ -43234,7 +43377,7 @@ function create_if_block_1$5(n) { }; } function create_fragment$a(n) { - let e, t, r, a, l, d, o; + let e, t, r, a, l, h, c; e = new BlockLabel({ props: { show_label: ( @@ -43252,9 +43395,9 @@ function create_fragment$a(n) { ) } }); - const u = [create_if_block$7, create_else_block$5], p = []; - function m(y, w) { - return w & /*value*/ + const d = [create_if_block$7, create_else_block$5], _ = []; + function m(y, x) { + return x & /*value*/ 1 && (r = null), r == null && (r = !!/*value*/ (y[0] && (!Array.isArray( /*value*/ @@ -43262,59 +43405,59 @@ function create_fragment$a(n) { ) || /*value*/ y[0].length > 0))), r ? 0 : 1; } - return a = m(n, -1), l = p[a] = u[a](n), { + return a = m(n, -1), l = _[a] = d[a](n), { c() { - create_component$6(e.$$.fragment), t = space$7(), l.c(), d = empty$4(); + create_component$6(e.$$.fragment), t = space$7(), l.c(), h = empty$4(); }, l(y) { - claim_component$6(e.$$.fragment, y), t = claim_space$7(y), l.l(y), d = empty$4(); + claim_component$6(e.$$.fragment, y), t = claim_space$7(y), l.l(y), h = empty$4(); }, - m(y, w) { - mount_component$6(e, y, w), insert_hydration$a(y, t, w), p[a].m(y, w), insert_hydration$a(y, d, w), o = !0; + m(y, x) { + mount_component$6(e, y, x), insert_hydration$a(y, t, x), _[a].m(y, x), insert_hydration$a(y, h, x), c = !0; }, - p(y, [w]) { + p(y, [x]) { const b = {}; - w & /*show_label*/ + x & /*show_label*/ 4 && (b.show_label = /*show_label*/ - y[2]), w & /*value*/ + y[2]), x & /*value*/ 1 && (b.float = /*value*/ - y[0] === null), w & /*label*/ + y[0] === null), x & /*label*/ 2 && (b.label = /*label*/ y[1] || "File"), e.$set(b); let A = a; - a = m(y, w), a === A ? p[a].p(y, w) : (group_outros$6(), transition_out$6(p[A], 1, 1, () => { - p[A] = null; - }), check_outros$6(), l = p[a], l ? l.p(y, w) : (l = p[a] = u[a](y), l.c()), transition_in$6(l, 1), l.m(d.parentNode, d)); + a = m(y, x), a === A ? _[a].p(y, x) : (group_outros$6(), transition_out$6(_[A], 1, 1, () => { + _[A] = null; + }), check_outros$6(), l = _[a], l ? l.p(y, x) : (l = _[a] = d[a](y), l.c()), transition_in$6(l, 1), l.m(h.parentNode, h)); }, i(y) { - o || (transition_in$6(e.$$.fragment, y), transition_in$6(l), o = !0); + c || (transition_in$6(e.$$.fragment, y), transition_in$6(l), c = !0); }, o(y) { - transition_out$6(e.$$.fragment, y), transition_out$6(l), o = !1; + transition_out$6(e.$$.fragment, y), transition_out$6(l), c = !1; }, d(y) { - y && (detach$a(t), detach$a(d)), destroy_component$6(e, y), p[a].d(y); + y && (detach$a(t), detach$a(h)), destroy_component$6(e, y), _[a].d(y); } }; } function instance$9(n, e, t) { - let { value: r = null } = e, { label: a } = e, { show_label: l = !0 } = e, { selectable: d = !1 } = e, { height: o = void 0 } = e, { i18n: u } = e, { config: p = {} } = e, { confidenceLabel: m = "" } = e, { representations: y = [] } = e, { moldata: w = null } = e, { molviewer: b = !1 } = e; + let { value: r = null } = e, { label: a } = e, { show_label: l = !0 } = e, { selectable: h = !1 } = e, { height: c = void 0 } = e, { i18n: d } = e, { config: _ = {} } = e, { confidenceLabel: m = "" } = e, { representations: y = [] } = e, { moldata: x = null } = e, { molviewer: b = !1 } = e; function A(f) { bubble$2.call(this, n, f); } return n.$$set = (f) => { - "value" in f && t(0, r = f.value), "label" in f && t(1, a = f.label), "show_label" in f && t(2, l = f.show_label), "selectable" in f && t(3, d = f.selectable), "height" in f && t(4, o = f.height), "i18n" in f && t(5, u = f.i18n), "config" in f && t(6, p = f.config), "confidenceLabel" in f && t(7, m = f.confidenceLabel), "representations" in f && t(8, y = f.representations), "moldata" in f && t(9, w = f.moldata), "molviewer" in f && t(10, b = f.molviewer); + "value" in f && t(0, r = f.value), "label" in f && t(1, a = f.label), "show_label" in f && t(2, l = f.show_label), "selectable" in f && t(3, h = f.selectable), "height" in f && t(4, c = f.height), "i18n" in f && t(5, d = f.i18n), "config" in f && t(6, _ = f.config), "confidenceLabel" in f && t(7, m = f.confidenceLabel), "representations" in f && t(8, y = f.representations), "moldata" in f && t(9, x = f.moldata), "molviewer" in f && t(10, b = f.molviewer); }, [ r, a, l, + h, + c, d, - o, - u, - p, + _, m, y, - w, + x, b, A ]; @@ -43356,46 +43499,46 @@ class FileData { orig_name: r, size: a, blob: l, - is_stream: d, - mime_type: o, - alt_text: u, - b64: p + is_stream: h, + mime_type: c, + alt_text: d, + b64: _ }) { - this.meta = { _type: "gradio.FileData" }, this.path = e, this.url = t, this.orig_name = r, this.size = a, this.blob = t ? void 0 : l, this.is_stream = d, this.mime_type = o, this.alt_text = u, this.b64 = p; + this.meta = { _type: "gradio.FileData" }, this.path = e, this.url = t, this.orig_name = r, this.size = a, this.blob = t ? void 0 : l, this.is_stream = h, this.mime_type = c, this.alt_text = d, this.b64 = _; } } typeof process < "u" && process.versions && process.versions.node; -var ar; +var fr; class TextLineStream extends TransformStream { /** Constructs a new instance. */ constructor(t = { allowCR: !1 }) { super({ transform: (r, a) => { - for (r = wr(this, ar) + r; ; ) { + for (r = Fr(this, fr) + r; ; ) { const l = r.indexOf(` -`), d = t.allowCR ? r.indexOf("\r") : -1; - if (d !== -1 && d !== r.length - 1 && (l === -1 || l - 1 > d)) { - a.enqueue(r.slice(0, d)), r = r.slice(d + 1); +`), h = t.allowCR ? r.indexOf("\r") : -1; + if (h !== -1 && h !== r.length - 1 && (l === -1 || l - 1 > h)) { + a.enqueue(r.slice(0, h)), r = r.slice(h + 1); continue; } if (l === -1) break; - const o = r[l - 1] === "\r" ? l - 1 : l; - a.enqueue(r.slice(0, o)), r = r.slice(l + 1); + const c = r[l - 1] === "\r" ? l - 1 : l; + a.enqueue(r.slice(0, c)), r = r.slice(l + 1); } - bn(this, ar, r); + Ln(this, fr, r); }, flush: (r) => { - if (wr(this, ar) === "") + if (Fr(this, fr) === "") return; - const a = t.allowCR && wr(this, ar).endsWith("\r") ? wr(this, ar).slice(0, -1) : wr(this, ar); + const a = t.allowCR && Fr(this, fr).endsWith("\r") ? Fr(this, fr).slice(0, -1) : Fr(this, fr); r.enqueue(a); } }); - ui(this, ar, ""); + Mi(this, fr, ""); } } -ar = new WeakMap(); +fr = new WeakMap(); const { SvelteComponent: SvelteComponent$9, append_hydration: append_hydration$7, @@ -43420,16 +43563,16 @@ function create_if_block$6(n) { let e, t, r, a, l = getProgress( /*file_to_display*/ n[2] - ) + "", d, o, u, p, m = ( + ) + "", h, c, d, _, m = ( /*file_to_display*/ n[2].orig_name + "" ), y; return { c() { - e = element$6("div"), t = element$6("span"), r = element$6("div"), a = element$6("progress"), d = text$3(l), u = space$6(), p = element$6("span"), y = text$3(m), this.h(); + e = element$6("div"), t = element$6("span"), r = element$6("div"), a = element$6("progress"), h = text$3(l), d = space$6(), _ = element$6("span"), y = text$3(m), this.h(); }, - l(w) { - e = claim_element$6(w, "DIV", { class: !0 }); + l(x) { + e = claim_element$6(x, "DIV", { class: !0 }); var b = children$7(e); t = claim_element$6(b, "SPAN", {}); var A = children$7(t); @@ -43437,34 +43580,34 @@ function create_if_block$6(n) { var f = children$7(r); a = claim_element$6(f, "PROGRESS", { style: !0, max: !0, class: !0 }); var s = children$7(a); - d = claim_text$3(s, l), s.forEach(detach$9), f.forEach(detach$9), A.forEach(detach$9), u = claim_space$6(b), p = claim_element$6(b, "SPAN", { class: !0 }); - var h = children$7(p); - y = claim_text$3(h, m), h.forEach(detach$9), b.forEach(detach$9), this.h(); + h = claim_text$3(s, l), s.forEach(detach$9), f.forEach(detach$9), A.forEach(detach$9), d = claim_space$6(b), _ = claim_element$6(b, "SPAN", { class: !0 }); + var u = children$7(_); + y = claim_text$3(u, m), u.forEach(detach$9), b.forEach(detach$9), this.h(); }, h() { - set_style$3(a, "visibility", "hidden"), set_style$3(a, "height", "0"), set_style$3(a, "width", "0"), a.value = o = getProgress( + set_style$3(a, "visibility", "hidden"), set_style$3(a, "height", "0"), set_style$3(a, "width", "0"), a.value = c = getProgress( /*file_to_display*/ n[2] - ), attr$7(a, "max", "100"), attr$7(a, "class", "svelte-cr2edf"), attr$7(r, "class", "progress-bar svelte-cr2edf"), attr$7(p, "class", "file-name svelte-cr2edf"), attr$7(e, "class", "file svelte-cr2edf"); + ), attr$7(a, "max", "100"), attr$7(a, "class", "svelte-cr2edf"), attr$7(r, "class", "progress-bar svelte-cr2edf"), attr$7(_, "class", "file-name svelte-cr2edf"), attr$7(e, "class", "file svelte-cr2edf"); }, - m(w, b) { - insert_hydration$9(w, e, b), append_hydration$7(e, t), append_hydration$7(t, r), append_hydration$7(r, a), append_hydration$7(a, d), append_hydration$7(e, u), append_hydration$7(e, p), append_hydration$7(p, y); + m(x, b) { + insert_hydration$9(x, e, b), append_hydration$7(e, t), append_hydration$7(t, r), append_hydration$7(r, a), append_hydration$7(a, h), append_hydration$7(e, d), append_hydration$7(e, _), append_hydration$7(_, y); }, - p(w, b) { + p(x, b) { b & /*file_to_display*/ 4 && l !== (l = getProgress( /*file_to_display*/ - w[2] - ) + "") && set_data$2(d, l), b & /*file_to_display*/ - 4 && o !== (o = getProgress( + x[2] + ) + "") && set_data$2(h, l), b & /*file_to_display*/ + 4 && c !== (c = getProgress( /*file_to_display*/ - w[2] - )) && (a.value = o), b & /*file_to_display*/ + x[2] + )) && (a.value = c), b & /*file_to_display*/ 4 && m !== (m = /*file_to_display*/ - w[2].orig_name + "") && set_data$2(y, m); + x[2].orig_name + "") && set_data$2(y, m); }, - d(w) { - w && detach$9(e); + d(x) { + x && detach$9(e); } }; } @@ -43472,23 +43615,23 @@ function create_fragment$9(n) { let e, t, r, a = ( /*files_with_progress*/ n[0].length + "" - ), l, d, o = ( + ), l, h, c = ( /*files_with_progress*/ n[0].length > 1 ? "files" : "file" - ), u, p, m, y = ( + ), d, _, m, y = ( /*file_to_display*/ n[2] && create_if_block$6(n) ); return { c() { - e = element$6("div"), t = element$6("span"), r = text$3("Uploading "), l = text$3(a), d = space$6(), u = text$3(o), p = text$3("..."), m = space$6(), y && y.c(), this.h(); + e = element$6("div"), t = element$6("span"), r = text$3("Uploading "), l = text$3(a), h = space$6(), d = text$3(c), _ = text$3("..."), m = space$6(), y && y.c(), this.h(); }, - l(w) { - e = claim_element$6(w, "DIV", { class: !0 }); + l(x) { + e = claim_element$6(x, "DIV", { class: !0 }); var b = children$7(e); t = claim_element$6(b, "SPAN", { class: !0 }); var A = children$7(t); - r = claim_text$3(A, "Uploading "), l = claim_text$3(A, a), d = claim_space$6(A), u = claim_text$3(A, o), p = claim_text$3(A, "..."), A.forEach(detach$9), m = claim_space$6(b), y && y.l(b), b.forEach(detach$9), this.h(); + r = claim_text$3(A, "Uploading "), l = claim_text$3(A, a), h = claim_space$6(A), d = claim_text$3(A, c), _ = claim_text$3(A, "..."), A.forEach(detach$9), m = claim_space$6(b), y && y.l(b), b.forEach(detach$9), this.h(); }, h() { attr$7(t, "class", "uploading svelte-cr2edf"), attr$7(e, "class", "wrap svelte-cr2edf"), toggle_class$4( @@ -43498,27 +43641,27 @@ function create_fragment$9(n) { n[1] ); }, - m(w, b) { - insert_hydration$9(w, e, b), append_hydration$7(e, t), append_hydration$7(t, r), append_hydration$7(t, l), append_hydration$7(t, d), append_hydration$7(t, u), append_hydration$7(t, p), append_hydration$7(e, m), y && y.m(e, null); + m(x, b) { + insert_hydration$9(x, e, b), append_hydration$7(e, t), append_hydration$7(t, r), append_hydration$7(t, l), append_hydration$7(t, h), append_hydration$7(t, d), append_hydration$7(t, _), append_hydration$7(e, m), y && y.m(e, null); }, - p(w, [b]) { + p(x, [b]) { b & /*files_with_progress*/ 1 && a !== (a = /*files_with_progress*/ - w[0].length + "") && set_data$2(l, a), b & /*files_with_progress*/ - 1 && o !== (o = /*files_with_progress*/ - w[0].length > 1 ? "files" : "file") && set_data$2(u, o), /*file_to_display*/ - w[2] ? y ? y.p(w, b) : (y = create_if_block$6(w), y.c(), y.m(e, null)) : y && (y.d(1), y = null), b & /*progress*/ + x[0].length + "") && set_data$2(l, a), b & /*files_with_progress*/ + 1 && c !== (c = /*files_with_progress*/ + x[0].length > 1 ? "files" : "file") && set_data$2(d, c), /*file_to_display*/ + x[2] ? y ? y.p(x, b) : (y = create_if_block$6(x), y.c(), y.m(e, null)) : y && (y.d(1), y = null), b & /*progress*/ 2 && toggle_class$4( e, "progress", /*progress*/ - w[1] + x[1] ); }, i: noop$6, o: noop$6, - d(w) { - w && detach$9(e), y && y.d(); + d(x) { + x && detach$9(e), y && y.d(); } }; } @@ -43532,63 +43675,63 @@ function calculateTotalProgress(n) { }), document.documentElement.style.setProperty("--upload-progress-width", (e / n.length).toFixed(2) + "%"), e / n.length; } function instance$8(n, e, t) { - var r = this && this.__awaiter || function(f, s, h, _) { - function g(x) { - return x instanceof h ? x : new h(function(c) { - c(x); + var r = this && this.__awaiter || function(f, s, u, p) { + function g(w) { + return w instanceof u ? w : new u(function(o) { + o(w); }); } - return new (h || (h = Promise))(function(x, c) { + return new (u || (u = Promise))(function(w, o) { function v($) { try { - E(_.next($)); + E(p.next($)); } catch (k) { - c(k); + o(k); } } function M($) { try { - E(_.throw($)); + E(p.throw($)); } catch (k) { - c(k); + o(k); } } function E($) { - $.done ? x($.value) : g($.value).then(v, M); + $.done ? w($.value) : g($.value).then(v, M); } - E((_ = _.apply(f, s || [])).next()); + E((p = p.apply(f, s || [])).next()); }); }; - let { upload_id: a } = e, { root: l } = e, { files: d } = e, { stream_handler: o } = e, u, p = !1, m, y, w = d.map((f) => Object.assign(Object.assign({}, f), { progress: 0 })); + let { upload_id: a } = e, { root: l } = e, { files: h } = e, { stream_handler: c } = e, d, _ = !1, m, y, x = h.map((f) => Object.assign(Object.assign({}, f), { progress: 0 })); const b = createEventDispatcher$5(); function A(f, s) { - t(0, w = w.map((h) => (h.orig_name === f && (h.progress += s), h))); + t(0, x = x.map((u) => (u.orig_name === f && (u.progress += s), u))); } return onMount$1(() => r(void 0, void 0, void 0, function* () { - if (u = yield o(new URL(`${l}/gradio_api/upload_progress?upload_id=${a}`)), u == null) + if (d = yield c(new URL(`${l}/gradio_api/upload_progress?upload_id=${a}`)), d == null) throw new Error("Event source is not defined"); - u.onmessage = function(f) { + d.onmessage = function(f) { return r(this, void 0, void 0, function* () { const s = JSON.parse(f.data); - p || t(1, p = !0), s.msg === "done" ? (u == null || u.close(), b("done")) : (t(7, m = s), A(s.orig_name, s.chunk_size)); + _ || t(1, _ = !0), s.msg === "done" ? (d == null || d.close(), b("done")) : (t(7, m = s), A(s.orig_name, s.chunk_size)); }); }; })), onDestroy$1(() => { - (u != null || u != null) && u.close(); + (d != null || d != null) && d.close(); }), n.$$set = (f) => { - "upload_id" in f && t(3, a = f.upload_id), "root" in f && t(4, l = f.root), "files" in f && t(5, d = f.files), "stream_handler" in f && t(6, o = f.stream_handler); + "upload_id" in f && t(3, a = f.upload_id), "root" in f && t(4, l = f.root), "files" in f && t(5, h = f.files), "stream_handler" in f && t(6, c = f.stream_handler); }, n.$$.update = () => { n.$$.dirty & /*files_with_progress*/ - 1 && calculateTotalProgress(w), n.$$.dirty & /*current_file_upload, files_with_progress*/ - 129 && t(2, y = m || w[0]); + 1 && calculateTotalProgress(x), n.$$.dirty & /*current_file_upload, files_with_progress*/ + 129 && t(2, y = m || x[0]); }, [ - w, - p, + x, + _, y, a, l, - d, - o, + h, + c, m ]; } @@ -43638,12 +43781,12 @@ const { update_slot_base: update_slot_base$3 } = window.__gradio__svelte__internal, { createEventDispatcher: createEventDispatcher$4, tick: tick$3 } = window.__gradio__svelte__internal; function create_else_block$4(n) { - let e, t, r, a, l, d, o, u, p, m, y; - const w = ( + let e, t, r, a, l, h, c, d, _, m, y; + const x = ( /*#slots*/ n[27].default ), b = create_slot$3( - w, + x, n, /*$$scope*/ n[26], @@ -43669,9 +43812,9 @@ function create_else_block$4(n) { h() { attr$6(r, "aria-label", "file upload"), attr$6(r, "data-testid", "file-upload"), attr$6(r, "type", "file"), attr$6(r, "accept", a = /*accept_file_types*/ n[16] || void 0), r.multiple = l = /*file_count*/ - n[6] === "multiple" || void 0, attr$6(r, "webkitdirectory", d = /*file_count*/ - n[6] === "directory" || void 0), attr$6(r, "mozdirectory", o = /*file_count*/ - n[6] === "directory" || void 0), attr$6(r, "class", "svelte-1mceliw"), attr$6(e, "tabindex", u = /*hidden*/ + n[6] === "multiple" || void 0, attr$6(r, "webkitdirectory", h = /*file_count*/ + n[6] === "directory" || void 0), attr$6(r, "mozdirectory", c = /*file_count*/ + n[6] === "directory" || void 0), attr$6(r, "class", "svelte-1mceliw"), attr$6(e, "tabindex", d = /*hidden*/ n[9] ? -1 : 0), attr$6(e, "class", "svelte-1mceliw"), toggle_class$3( e, "hidden", @@ -43700,7 +43843,7 @@ function create_else_block$4(n) { ), set_style$2(e, "height", "100%"); }, m(A, f) { - insert_hydration$8(A, e, f), b && b.m(e, null), append_hydration$6(e, t), append_hydration$6(e, r), n[35](r), p = !0, m || (y = [ + insert_hydration$8(A, e, f), b && b.m(e, null), append_hydration$6(e, t), append_hydration$6(e, r), n[35](r), _ = !0, m || (y = [ listen$1( r, "change", @@ -43762,15 +43905,15 @@ function create_else_block$4(n) { ], m = !0); }, p(A, f) { - b && b.p && (!p || f[0] & /*$$scope*/ + b && b.p && (!_ || f[0] & /*$$scope*/ 67108864) && update_slot_base$3( b, - w, + x, A, /*$$scope*/ A[26], - p ? get_slot_changes$3( - w, + _ ? get_slot_changes$3( + x, /*$$scope*/ A[26], f, @@ -43780,41 +43923,41 @@ function create_else_block$4(n) { A[26] ), null - ), (!p || f[0] & /*accept_file_types*/ + ), (!_ || f[0] & /*accept_file_types*/ 65536 && a !== (a = /*accept_file_types*/ - A[16] || void 0)) && attr$6(r, "accept", a), (!p || f[0] & /*file_count*/ + A[16] || void 0)) && attr$6(r, "accept", a), (!_ || f[0] & /*file_count*/ 64 && l !== (l = /*file_count*/ - A[6] === "multiple" || void 0)) && (r.multiple = l), (!p || f[0] & /*file_count*/ - 64 && d !== (d = /*file_count*/ - A[6] === "directory" || void 0)) && attr$6(r, "webkitdirectory", d), (!p || f[0] & /*file_count*/ - 64 && o !== (o = /*file_count*/ - A[6] === "directory" || void 0)) && attr$6(r, "mozdirectory", o), (!p || f[0] & /*hidden*/ - 512 && u !== (u = /*hidden*/ - A[9] ? -1 : 0)) && attr$6(e, "tabindex", u), (!p || f[0] & /*hidden*/ + A[6] === "multiple" || void 0)) && (r.multiple = l), (!_ || f[0] & /*file_count*/ + 64 && h !== (h = /*file_count*/ + A[6] === "directory" || void 0)) && attr$6(r, "webkitdirectory", h), (!_ || f[0] & /*file_count*/ + 64 && c !== (c = /*file_count*/ + A[6] === "directory" || void 0)) && attr$6(r, "mozdirectory", c), (!_ || f[0] & /*hidden*/ + 512 && d !== (d = /*hidden*/ + A[9] ? -1 : 0)) && attr$6(e, "tabindex", d), (!_ || f[0] & /*hidden*/ 512) && toggle_class$3( e, "hidden", /*hidden*/ A[9] - ), (!p || f[0] & /*center*/ + ), (!_ || f[0] & /*center*/ 16) && toggle_class$3( e, "center", /*center*/ A[4] - ), (!p || f[0] & /*boundedheight*/ + ), (!_ || f[0] & /*boundedheight*/ 8) && toggle_class$3( e, "boundedheight", /*boundedheight*/ A[3] - ), (!p || f[0] & /*flex*/ + ), (!_ || f[0] & /*flex*/ 32) && toggle_class$3( e, "flex", /*flex*/ A[5] - ), (!p || f[0] & /*disable_click*/ + ), (!_ || f[0] & /*disable_click*/ 128) && toggle_class$3( e, "disable_click", @@ -43823,10 +43966,10 @@ function create_else_block$4(n) { ); }, i(A) { - p || (transition_in$5(b, A), p = !0); + _ || (transition_in$5(b, A), _ = !0); }, o(A) { - transition_out$5(b, A), p = !1; + transition_out$5(b, A), _ = !1; }, d(A) { A && detach$8(e), b && b.d(A), n[35](null), m = !1, run_all$1(y); @@ -43866,11 +44009,11 @@ function create_if_block_1$4(n) { } function create_if_block$5(n) { let e, t, r, a, l; - const d = ( + const h = ( /*#slots*/ n[27].default - ), o = create_slot$3( - d, + ), c = create_slot$3( + h, n, /*$$scope*/ n[26], @@ -43878,12 +44021,12 @@ function create_if_block$5(n) { ); return { c() { - e = element$5("button"), o && o.c(), this.h(); + e = element$5("button"), c && c.c(), this.h(); }, - l(u) { - e = claim_element$5(u, "BUTTON", { tabindex: !0, class: !0 }); - var p = children$6(e); - o && o.l(p), p.forEach(detach$8), this.h(); + l(d) { + e = claim_element$5(d, "BUTTON", { tabindex: !0, class: !0 }); + var _ = children$6(e); + c && c.l(_), _.forEach(detach$8), this.h(); }, h() { attr$6(e, "tabindex", t = /*hidden*/ @@ -43909,69 +44052,69 @@ function create_if_block$5(n) { n[5] ), set_style$2(e, "height", "100%"); }, - m(u, p) { - insert_hydration$8(u, e, p), o && o.m(e, null), r = !0, a || (l = listen$1( + m(d, _) { + insert_hydration$8(d, e, _), c && c.m(e, null), r = !0, a || (l = listen$1( e, "click", /*paste_clipboard*/ n[12] ), a = !0); }, - p(u, p) { - o && o.p && (!r || p[0] & /*$$scope*/ + p(d, _) { + c && c.p && (!r || _[0] & /*$$scope*/ 67108864) && update_slot_base$3( - o, + c, + h, d, - u, /*$$scope*/ - u[26], + d[26], r ? get_slot_changes$3( - d, + h, /*$$scope*/ - u[26], - p, + d[26], + _, null ) : get_all_dirty_from_scope$3( /*$$scope*/ - u[26] + d[26] ), null - ), (!r || p[0] & /*hidden*/ + ), (!r || _[0] & /*hidden*/ 512 && t !== (t = /*hidden*/ - u[9] ? -1 : 0)) && attr$6(e, "tabindex", t), (!r || p[0] & /*hidden*/ + d[9] ? -1 : 0)) && attr$6(e, "tabindex", t), (!r || _[0] & /*hidden*/ 512) && toggle_class$3( e, "hidden", /*hidden*/ - u[9] - ), (!r || p[0] & /*center*/ + d[9] + ), (!r || _[0] & /*center*/ 16) && toggle_class$3( e, "center", /*center*/ - u[4] - ), (!r || p[0] & /*boundedheight*/ + d[4] + ), (!r || _[0] & /*boundedheight*/ 8) && toggle_class$3( e, "boundedheight", /*boundedheight*/ - u[3] - ), (!r || p[0] & /*flex*/ + d[3] + ), (!r || _[0] & /*flex*/ 32) && toggle_class$3( e, "flex", /*flex*/ - u[5] + d[5] ); }, - i(u) { - r || (transition_in$5(o, u), r = !0); + i(d) { + r || (transition_in$5(c, d), r = !0); }, - o(u) { - transition_out$5(o, u), r = !1; + o(d) { + transition_out$5(c, d), r = !1; }, - d(u) { - u && detach$8(e), o && o.d(u), a = !1, l(); + d(d) { + d && detach$8(e), c && c.d(d), a = !1, l(); } }; } @@ -44031,41 +44174,41 @@ function create_if_block_2$2(n) { } function create_fragment$8(n) { let e, t, r, a; - const l = [create_if_block$5, create_if_block_1$4, create_else_block$4], d = []; - function o(u, p) { + const l = [create_if_block$5, create_if_block_1$4, create_else_block$4], h = []; + function c(d, _) { return ( /*filetype*/ - u[0] === "clipboard" ? 0 : ( + d[0] === "clipboard" ? 0 : ( /*uploading*/ - u[1] && /*show_progress*/ - u[10] ? 1 : 2 + d[1] && /*show_progress*/ + d[10] ? 1 : 2 ) ); } - return e = o(n), t = d[e] = l[e](n), { + return e = c(n), t = h[e] = l[e](n), { c() { t.c(), r = empty$3(); }, - l(u) { - t.l(u), r = empty$3(); + l(d) { + t.l(d), r = empty$3(); }, - m(u, p) { - d[e].m(u, p), insert_hydration$8(u, r, p), a = !0; + m(d, _) { + h[e].m(d, _), insert_hydration$8(d, r, _), a = !0; }, - p(u, p) { + p(d, _) { let m = e; - e = o(u), e === m ? d[e].p(u, p) : (group_outros$5(), transition_out$5(d[m], 1, 1, () => { - d[m] = null; - }), check_outros$5(), t = d[e], t ? t.p(u, p) : (t = d[e] = l[e](u), t.c()), transition_in$5(t, 1), t.m(r.parentNode, r)); + e = c(d), e === m ? h[e].p(d, _) : (group_outros$5(), transition_out$5(h[m], 1, 1, () => { + h[m] = null; + }), check_outros$5(), t = h[e], t ? t.p(d, _) : (t = h[e] = l[e](d), t.c()), transition_in$5(t, 1), t.m(r.parentNode, r)); }, - i(u) { + i(d) { a || (transition_in$5(t), a = !0); }, - o(u) { + o(d) { transition_out$5(t), a = !1; }, - d(u) { - u && detach$8(r), d[e].d(u); + d(d) { + d && detach$8(r), h[e].d(d); } }; } @@ -44080,40 +44223,40 @@ function is_valid_mimetype(n, e, t) { else return !1; return r.includes(e) || r.some((a) => { - const [l] = a.split("/").map((d) => d.trim()); + const [l] = a.split("/").map((h) => h.trim()); return a.endsWith("/*") && t.startsWith(l + "/"); }); } function instance$7(n, e, t) { let r, { $$slots: a = {}, $$scope: l } = e; - var d = this && this.__awaiter || function(se, Ce, ue, ne) { - function _e(Oe) { - return Oe instanceof ue ? Oe : new ue(function(Re) { - Re(Oe); + var h = this && this.__awaiter || function(se, Ae, he, ne) { + function _e(Le) { + return Le instanceof he ? Le : new he(function(Be) { + Be(Le); }); } - return new (ue || (ue = Promise))(function(Oe, Re) { - function Ue(Ae) { + return new (he || (he = Promise))(function(Le, Be) { + function Ue(Ge) { try { - Ee(ne.next(Ae)); - } catch (ge) { - Re(ge); + We(ne.next(Ge)); + } catch (Ne) { + Be(Ne); } } - function We(Ae) { + function He(Ge) { try { - Ee(ne.throw(Ae)); - } catch (ge) { - Re(ge); + We(ne.throw(Ge)); + } catch (Ne) { + Be(Ne); } } - function Ee(Ae) { - Ae.done ? Oe(Ae.value) : _e(Ae.value).then(Ue, We); + function We(Ge) { + Ge.done ? Le(Ge.value) : _e(Ge.value).then(Ue, He); } - Ee((ne = ne.apply(se, Ce || [])).next()); + We((ne = ne.apply(se, Ae || [])).next()); }); }; - let { filetype: o = null } = e, { dragging: u = !1 } = e, { boundedheight: p = !0 } = e, { center: m = !0 } = e, { flex: y = !0 } = e, { file_count: w = "single" } = e, { disable_click: b = !1 } = e, { root: A } = e, { hidden: f = !1 } = e, { format: s = "file" } = e, { uploading: h = !1 } = e, { hidden_upload: _ = null } = e, { show_progress: g = !0 } = e, { max_file_size: x = null } = e, { upload: c } = e, { stream_handler: v } = e, M, E, $, k = null; + let { filetype: c = null } = e, { dragging: d = !1 } = e, { boundedheight: _ = !0 } = e, { center: m = !0 } = e, { flex: y = !0 } = e, { file_count: x = "single" } = e, { disable_click: b = !1 } = e, { root: A } = e, { hidden: f = !1 } = e, { format: s = "file" } = e, { uploading: u = !1 } = e, { hidden_upload: p = null } = e, { show_progress: g = !0 } = e, { max_file_size: w = null } = e, { upload: o } = e, { stream_handler: v } = e, M, E, $, k = null; const L = () => { if (typeof navigator < "u") { const se = navigator.userAgent.toLowerCase(); @@ -44121,16 +44264,16 @@ function instance$7(n, e, t) { } return !1; }, z = createEventDispatcher$4(), O = ["image", "video", "audio", "text", "file"], R = (se) => r && se.startsWith(".") ? (k = !0, se) : r && se.includes("file/*") ? "*" : se.startsWith(".") || se.endsWith("/*") ? se : O.includes(se) ? se + "/*" : "." + se; - function P() { - t(20, u = !u); - } - function U() { - navigator.clipboard.read().then((se) => d(this, void 0, void 0, function* () { - for (let Ce = 0; Ce < se.length; Ce++) { - const ue = se[Ce].types.find((ne) => ne.startsWith("image/")); - if (ue) { - se[Ce].getType(ue).then((ne) => d(this, void 0, void 0, function* () { - const _e = new File([ne], `clipboard.${ue.replace("image/", "")}`); + function N() { + t(20, d = !d); + } + function W() { + navigator.clipboard.read().then((se) => h(this, void 0, void 0, function* () { + for (let Ae = 0; Ae < se.length; Ae++) { + const he = se[Ae].types.find((ne) => ne.startsWith("image/")); + if (he) { + se[Ae].getType(he).then((ne) => h(this, void 0, void 0, function* () { + const _e = new File([ne], `clipboard.${he.replace("image/", "")}`); yield G([_e]); })); break; @@ -44139,30 +44282,30 @@ function instance$7(n, e, t) { })); } function B() { - b || _ && (t(2, _.value = "", _), _.click()); + b || p && (t(2, p.value = "", p), p.click()); } - function N(se) { - return d(this, void 0, void 0, function* () { - yield tick$3(), t(14, M = Math.random().toString(36).substring(2, 15)), t(1, h = !0); + function P(se) { + return h(this, void 0, void 0, function* () { + yield tick$3(), t(14, M = Math.random().toString(36).substring(2, 15)), t(1, u = !0); try { - const Ce = yield c(se, A, M, x ?? 1 / 0); - return z("load", w === "single" ? Ce == null ? void 0 : Ce[0] : Ce), t(1, h = !1), Ce || []; - } catch (Ce) { - return z("error", Ce.message), t(1, h = !1), []; + const Ae = yield o(se, A, M, w ?? 1 / 0); + return z("load", x === "single" ? Ae == null ? void 0 : Ae[0] : Ae), t(1, u = !1), Ae || []; + } catch (Ae) { + return z("error", Ae.message), t(1, u = !1), []; } }); } function G(se) { - return d(this, void 0, void 0, function* () { + return h(this, void 0, void 0, function* () { if (!se.length) return; - let Ce = se.map((ue) => new File([ue], ue instanceof File ? ue.name : "file", { type: ue.type })); - return r && k && (Ce = Ce.filter((ue) => H(ue) ? !0 : (z("error", `Invalid file type: ${ue.name}. Only ${o} allowed.`), !1)), Ce.length === 0) ? [] : (t(15, E = yield prepare_files(Ce)), yield N(E)); + let Ae = se.map((he) => new File([he], he instanceof File ? he.name : "file", { type: he.type })); + return r && k && (Ae = Ae.filter((he) => H(he) ? !0 : (z("error", `Invalid file type: ${he.name}. Only ${c} allowed.`), !1)), Ae.length === 0) ? [] : (t(15, E = yield prepare_files(Ae)), yield P(E)); }); } function H(se) { - return o ? (Array.isArray(o) ? o : [o]).some((ue) => { - const ne = R(ue); + return c ? (Array.isArray(c) ? c : [c]).some((he) => { + const ne = R(he); if (ne.startsWith(".")) return se.name.toLowerCase().endsWith(ne.toLowerCase()); if (ne === "*") @@ -44174,37 +44317,37 @@ function instance$7(n, e, t) { return se.type === ne; }) : !0; } - function W(se) { - return d(this, void 0, void 0, function* () { - const Ce = se.target; - if (Ce.files) + function U(se) { + return h(this, void 0, void 0, function* () { + const Ae = se.target; + if (Ae.files) if (s != "blob") - yield G(Array.from(Ce.files)); + yield G(Array.from(Ae.files)); else { - if (w === "single") { - z("load", Ce.files[0]); + if (x === "single") { + z("load", Ae.files[0]); return; } - z("load", Ce.files); + z("load", Ae.files); } }); } - function V(se) { - return d(this, void 0, void 0, function* () { - var Ce; - if (t(20, u = !1), !(!((Ce = se.dataTransfer) === null || Ce === void 0) && Ce.files)) return; - const ue = Array.from(se.dataTransfer.files).filter((ne) => { + function j(se) { + return h(this, void 0, void 0, function* () { + var Ae; + if (t(20, d = !1), !(!((Ae = se.dataTransfer) === null || Ae === void 0) && Ae.files)) return; + const he = Array.from(se.dataTransfer.files).filter((ne) => { const _e = "." + ne.name.split(".").pop(); - return _e && is_valid_mimetype($, _e, ne.type) || (_e && Array.isArray(o) ? o.includes(_e) : _e === o) ? !0 : (z("error", `Invalid file type only ${o} allowed.`), !1); + return _e && is_valid_mimetype($, _e, ne.type) || (_e && Array.isArray(c) ? c.includes(_e) : _e === c) ? !0 : (z("error", `Invalid file type only ${c} allowed.`), !1); }); if (s != "blob") - yield G(ue); + yield G(he); else { - if (w === "single") { - z("load", ue[0]); + if (x === "single") { + z("load", he[0]); return; } - z("load", ue); + z("load", he); } }); } @@ -44214,68 +44357,68 @@ function instance$7(n, e, t) { function ie(se) { bubble$1.call(this, n, se); } - function ee(se) { + function te(se) { bubble$1.call(this, n, se); } - function ce(se) { + function ue(se) { bubble$1.call(this, n, se); } - function he(se) { + function de(se) { bubble$1.call(this, n, se); } - function le(se) { + function oe(se) { bubble$1.call(this, n, se); } function J(se) { bubble$1.call(this, n, se); } - function Me(se) { + function Ee(se) { binding_callbacks$2[se ? "unshift" : "push"](() => { - _ = se, t(2, _); + p = se, t(2, p); }); } return n.$$set = (se) => { - "filetype" in se && t(0, o = se.filetype), "dragging" in se && t(20, u = se.dragging), "boundedheight" in se && t(3, p = se.boundedheight), "center" in se && t(4, m = se.center), "flex" in se && t(5, y = se.flex), "file_count" in se && t(6, w = se.file_count), "disable_click" in se && t(7, b = se.disable_click), "root" in se && t(8, A = se.root), "hidden" in se && t(9, f = se.hidden), "format" in se && t(21, s = se.format), "uploading" in se && t(1, h = se.uploading), "hidden_upload" in se && t(2, _ = se.hidden_upload), "show_progress" in se && t(10, g = se.show_progress), "max_file_size" in se && t(22, x = se.max_file_size), "upload" in se && t(23, c = se.upload), "stream_handler" in se && t(11, v = se.stream_handler), "$$scope" in se && t(26, l = se.$$scope); + "filetype" in se && t(0, c = se.filetype), "dragging" in se && t(20, d = se.dragging), "boundedheight" in se && t(3, _ = se.boundedheight), "center" in se && t(4, m = se.center), "flex" in se && t(5, y = se.flex), "file_count" in se && t(6, x = se.file_count), "disable_click" in se && t(7, b = se.disable_click), "root" in se && t(8, A = se.root), "hidden" in se && t(9, f = se.hidden), "format" in se && t(21, s = se.format), "uploading" in se && t(1, u = se.uploading), "hidden_upload" in se && t(2, p = se.hidden_upload), "show_progress" in se && t(10, g = se.show_progress), "max_file_size" in se && t(22, w = se.max_file_size), "upload" in se && t(23, o = se.upload), "stream_handler" in se && t(11, v = se.stream_handler), "$$scope" in se && t(26, l = se.$$scope); }, n.$$.update = () => { n.$$.dirty[0] & /*filetype, ios*/ - 33554433 && (o == null ? t(16, $ = null) : typeof o == "string" ? t(16, $ = R(o)) : r && o.includes("file/*") ? t(16, $ = "*") : (t(0, o = o.map(R)), t(16, $ = o.join(", ")))); + 33554433 && (c == null ? t(16, $ = null) : typeof c == "string" ? t(16, $ = R(c)) : r && c.includes("file/*") ? t(16, $ = "*") : (t(0, c = c.map(R)), t(16, $ = c.join(", ")))); }, t(25, r = L()), [ - o, - h, - _, + c, + u, p, + _, m, y, - w, + x, b, A, f, g, v, - U, + W, B, M, E, $, - P, - W, - V, - u, + N, + U, + j, + d, s, - x, - c, + w, + o, G, r, l, a, re, ie, - ee, - ce, - he, - le, + te, + ue, + de, + oe, J, - Me + Ee ]; } class Upload extends SvelteComponent$8 { @@ -44502,13 +44645,13 @@ function create_default_slot_1$1(n) { }; } function create_default_slot$2(n) { - let e, t, r, a, l, d, o = ( + let e, t, r, a, l, h, c = ( /*editable*/ n[0] && create_if_block_2$1(n) - ), u = ( + ), d = ( /*undoable*/ n[1] && create_if_block_1$3(n) - ), p = ( + ), _ = ( /*download*/ n[2] && create_if_block$4(n) ); @@ -44536,59 +44679,59 @@ function create_default_slot$2(n) { n[8] ), { c() { - o && o.c(), e = space$4(), u && u.c(), t = space$4(), p && p.c(), r = space$4(), y && y.c(), a = space$4(), create_component$4(l.$$.fragment); + c && c.c(), e = space$4(), d && d.c(), t = space$4(), _ && _.c(), r = space$4(), y && y.c(), a = space$4(), create_component$4(l.$$.fragment); }, - l(w) { - o && o.l(w), e = claim_space$4(w), u && u.l(w), t = claim_space$4(w), p && p.l(w), r = claim_space$4(w), y && y.l(w), a = claim_space$4(w), claim_component$4(l.$$.fragment, w); + l(x) { + c && c.l(x), e = claim_space$4(x), d && d.l(x), t = claim_space$4(x), _ && _.l(x), r = claim_space$4(x), y && y.l(x), a = claim_space$4(x), claim_component$4(l.$$.fragment, x); }, - m(w, b) { - o && o.m(w, b), insert_hydration$7(w, e, b), u && u.m(w, b), insert_hydration$7(w, t, b), p && p.m(w, b), insert_hydration$7(w, r, b), y && y.m(w, b), insert_hydration$7(w, a, b), mount_component$4(l, w, b), d = !0; + m(x, b) { + c && c.m(x, b), insert_hydration$7(x, e, b), d && d.m(x, b), insert_hydration$7(x, t, b), _ && _.m(x, b), insert_hydration$7(x, r, b), y && y.m(x, b), insert_hydration$7(x, a, b), mount_component$4(l, x, b), h = !0; }, - p(w, b) { + p(x, b) { /*editable*/ - w[0] ? o ? (o.p(w, b), b & /*editable*/ - 1 && transition_in$4(o, 1)) : (o = create_if_block_2$1(w), o.c(), transition_in$4(o, 1), o.m(e.parentNode, e)) : o && (group_outros$4(), transition_out$4(o, 1, 1, () => { - o = null; + x[0] ? c ? (c.p(x, b), b & /*editable*/ + 1 && transition_in$4(c, 1)) : (c = create_if_block_2$1(x), c.c(), transition_in$4(c, 1), c.m(e.parentNode, e)) : c && (group_outros$4(), transition_out$4(c, 1, 1, () => { + c = null; }), check_outros$4()), /*undoable*/ - w[1] ? u ? (u.p(w, b), b & /*undoable*/ - 2 && transition_in$4(u, 1)) : (u = create_if_block_1$3(w), u.c(), transition_in$4(u, 1), u.m(t.parentNode, t)) : u && (group_outros$4(), transition_out$4(u, 1, 1, () => { - u = null; + x[1] ? d ? (d.p(x, b), b & /*undoable*/ + 2 && transition_in$4(d, 1)) : (d = create_if_block_1$3(x), d.c(), transition_in$4(d, 1), d.m(t.parentNode, t)) : d && (group_outros$4(), transition_out$4(d, 1, 1, () => { + d = null; }), check_outros$4()), /*download*/ - w[2] ? p ? (p.p(w, b), b & /*download*/ - 4 && transition_in$4(p, 1)) : (p = create_if_block$4(w), p.c(), transition_in$4(p, 1), p.m(r.parentNode, r)) : p && (group_outros$4(), transition_out$4(p, 1, 1, () => { - p = null; - }), check_outros$4()), y && y.p && (!d || b & /*$$scope*/ + x[2] ? _ ? (_.p(x, b), b & /*download*/ + 4 && transition_in$4(_, 1)) : (_ = create_if_block$4(x), _.c(), transition_in$4(_, 1), _.m(r.parentNode, r)) : _ && (group_outros$4(), transition_out$4(_, 1, 1, () => { + _ = null; + }), check_outros$4()), y && y.p && (!h || b & /*$$scope*/ 512) && update_slot_base$2( y, m, - w, + x, /*$$scope*/ - w[9], - d ? get_slot_changes$2( + x[9], + h ? get_slot_changes$2( m, /*$$scope*/ - w[9], + x[9], b, null ) : get_all_dirty_from_scope$2( /*$$scope*/ - w[9] + x[9] ), null ); const A = {}; b & /*i18n*/ 8 && (A.label = /*i18n*/ - w[3]("common.clear")), l.$set(A); + x[3]("common.clear")), l.$set(A); }, - i(w) { - d || (transition_in$4(o), transition_in$4(u), transition_in$4(p), transition_in$4(y, w), transition_in$4(l.$$.fragment, w), d = !0); + i(x) { + h || (transition_in$4(c), transition_in$4(d), transition_in$4(_), transition_in$4(y, x), transition_in$4(l.$$.fragment, x), h = !0); }, - o(w) { - transition_out$4(o), transition_out$4(u), transition_out$4(p), transition_out$4(y, w), transition_out$4(l.$$.fragment, w), d = !1; + o(x) { + transition_out$4(c), transition_out$4(d), transition_out$4(_), transition_out$4(y, x), transition_out$4(l.$$.fragment, x), h = !1; }, - d(w) { - w && (detach$7(e), detach$7(t), detach$7(r), detach$7(a)), o && o.d(w), u && u.d(w), p && p.d(w), y && y.d(w), destroy_component$4(l, w); + d(x) { + x && (detach$7(e), detach$7(t), detach$7(r), detach$7(a)), c && c.d(x), d && d.d(x), _ && _.d(x), y && y.d(x), destroy_component$4(l, x); } }; } @@ -44626,22 +44769,22 @@ function create_fragment$7(n) { }; } function instance$6(n, e, t) { - let { $$slots: r = {}, $$scope: a } = e, { editable: l = !1 } = e, { undoable: d = !1 } = e, { download: o = null } = e, { i18n: u } = e; - const p = createEventDispatcher$3(), m = () => p("edit"), y = () => p("undo"), w = (b) => { - p("clear"), b.stopPropagation(); + let { $$slots: r = {}, $$scope: a } = e, { editable: l = !1 } = e, { undoable: h = !1 } = e, { download: c = null } = e, { i18n: d } = e; + const _ = createEventDispatcher$3(), m = () => _("edit"), y = () => _("undo"), x = (b) => { + _("clear"), b.stopPropagation(); }; return n.$$set = (b) => { - "editable" in b && t(0, l = b.editable), "undoable" in b && t(1, d = b.undoable), "download" in b && t(2, o = b.download), "i18n" in b && t(3, u = b.i18n), "$$scope" in b && t(9, a = b.$$scope); + "editable" in b && t(0, l = b.editable), "undoable" in b && t(1, h = b.undoable), "download" in b && t(2, c = b.download), "i18n" in b && t(3, d = b.i18n), "$$scope" in b && t(9, a = b.$$scope); }, [ l, + h, + c, d, - o, - u, - p, + _, r, m, y, - w, + x, a ]; } @@ -44669,10 +44812,10 @@ const { svg_element: svg_element$2 } = window.__gradio__svelte__internal; function create_fragment$6(n) { - let e, t, r, a, l, d, o, u, p, m, y, w; + let e, t, r, a, l, h, c, d, _, m, y, x; return { c() { - e = svg_element$2("svg"), t = svg_element$2("defs"), r = svg_element$2("linearGradient"), a = svg_element$2("stop"), l = svg_element$2("stop"), d = svg_element$2("stop"), o = svg_element$2("g"), u = svg_element$2("g"), p = svg_element$2("path"), m = svg_element$2("animateTransform"), y = svg_element$2("circle"), w = svg_element$2("animateTransform"), this.h(); + e = svg_element$2("svg"), t = svg_element$2("defs"), r = svg_element$2("linearGradient"), a = svg_element$2("stop"), l = svg_element$2("stop"), h = svg_element$2("stop"), c = svg_element$2("g"), d = svg_element$2("g"), _ = svg_element$2("path"), m = svg_element$2("animateTransform"), y = svg_element$2("circle"), x = svg_element$2("animateTransform"), this.h(); }, l(b) { e = claim_svg_element$2(b, "svg", { @@ -44700,17 +44843,17 @@ function create_fragment$6(n) { "stop-color": !0, "stop-opacity": !0, offset: !0 - }), children$5(l).forEach(detach$6), d = claim_svg_element$2(s, "stop", { "stop-color": !0, offset: !0 }), children$5(d).forEach(detach$6), s.forEach(detach$6), f.forEach(detach$6), o = claim_svg_element$2(A, "g", { fill: !0, "fill-rule": !0 }); - var h = children$5(o); - u = claim_svg_element$2(h, "g", { transform: !0 }); - var _ = children$5(u); - p = claim_svg_element$2(_, "path", { + }), children$5(l).forEach(detach$6), h = claim_svg_element$2(s, "stop", { "stop-color": !0, offset: !0 }), children$5(h).forEach(detach$6), s.forEach(detach$6), f.forEach(detach$6), c = claim_svg_element$2(A, "g", { fill: !0, "fill-rule": !0 }); + var u = children$5(c); + d = claim_svg_element$2(u, "g", { transform: !0 }); + var p = children$5(d); + _ = claim_svg_element$2(p, "path", { d: !0, id: !0, stroke: !0, "stroke-width": !0 }); - var g = children$5(p); + var g = children$5(_); m = claim_svg_element$2(g, "animateTransform", { attributeName: !0, type: !0, @@ -44718,22 +44861,22 @@ function create_fragment$6(n) { to: !0, dur: !0, repeatCount: !0 - }), children$5(m).forEach(detach$6), g.forEach(detach$6), y = claim_svg_element$2(_, "circle", { fill: !0, cx: !0, cy: !0, r: !0 }); - var x = children$5(y); - w = claim_svg_element$2(x, "animateTransform", { + }), children$5(m).forEach(detach$6), g.forEach(detach$6), y = claim_svg_element$2(p, "circle", { fill: !0, cx: !0, cy: !0, r: !0 }); + var w = children$5(y); + x = claim_svg_element$2(w, "animateTransform", { attributeName: !0, type: !0, from: !0, to: !0, dur: !0, repeatCount: !0 - }), children$5(w).forEach(detach$6), x.forEach(detach$6), _.forEach(detach$6), h.forEach(detach$6), A.forEach(detach$6), this.h(); + }), children$5(x).forEach(detach$6), w.forEach(detach$6), p.forEach(detach$6), u.forEach(detach$6), A.forEach(detach$6), this.h(); }, h() { - attr$5(a, "stop-color", "#FF7C00"), attr$5(a, "stop-opacity", "0"), attr$5(a, "offset", "0%"), attr$5(l, "stop-color", "#FF7C00"), attr$5(l, "stop-opacity", ".631"), attr$5(l, "offset", "63.146%"), attr$5(d, "stop-color", "#FF7C00"), attr$5(d, "offset", "100%"), attr$5(r, "x1", "8.042%"), attr$5(r, "y1", "0%"), attr$5(r, "x2", "65.682%"), attr$5(r, "y2", "23.865%"), attr$5(r, "id", "a"), attr$5(m, "attributeName", "transform"), attr$5(m, "type", "rotate"), attr$5(m, "from", "0 18 18"), attr$5(m, "to", "360 18 18"), attr$5(m, "dur", "0.9s"), attr$5(m, "repeatCount", "indefinite"), attr$5(p, "d", "M36 18c0-9.94-8.06-18-18-18"), attr$5(p, "id", "Oval-2"), attr$5(p, "stroke", "url(#a)"), attr$5(p, "stroke-width", "2"), attr$5(w, "attributeName", "transform"), attr$5(w, "type", "rotate"), attr$5(w, "from", "0 18 18"), attr$5(w, "to", "360 18 18"), attr$5(w, "dur", "0.9s"), attr$5(w, "repeatCount", "indefinite"), attr$5(y, "fill", "#FFf"), attr$5(y, "cx", "36"), attr$5(y, "cy", "18"), attr$5(y, "r", "1"), attr$5(u, "transform", "translate(1 1)"), attr$5(o, "fill", "none"), attr$5(o, "fill-rule", "evenodd"), attr$5(e, "width", "20"), attr$5(e, "height", "20 "), attr$5(e, "viewBox", "0 0 38 38"), attr$5(e, "xmlns", "http://www.w3.org/2000/svg"); + attr$5(a, "stop-color", "#FF7C00"), attr$5(a, "stop-opacity", "0"), attr$5(a, "offset", "0%"), attr$5(l, "stop-color", "#FF7C00"), attr$5(l, "stop-opacity", ".631"), attr$5(l, "offset", "63.146%"), attr$5(h, "stop-color", "#FF7C00"), attr$5(h, "offset", "100%"), attr$5(r, "x1", "8.042%"), attr$5(r, "y1", "0%"), attr$5(r, "x2", "65.682%"), attr$5(r, "y2", "23.865%"), attr$5(r, "id", "a"), attr$5(m, "attributeName", "transform"), attr$5(m, "type", "rotate"), attr$5(m, "from", "0 18 18"), attr$5(m, "to", "360 18 18"), attr$5(m, "dur", "0.9s"), attr$5(m, "repeatCount", "indefinite"), attr$5(_, "d", "M36 18c0-9.94-8.06-18-18-18"), attr$5(_, "id", "Oval-2"), attr$5(_, "stroke", "url(#a)"), attr$5(_, "stroke-width", "2"), attr$5(x, "attributeName", "transform"), attr$5(x, "type", "rotate"), attr$5(x, "from", "0 18 18"), attr$5(x, "to", "360 18 18"), attr$5(x, "dur", "0.9s"), attr$5(x, "repeatCount", "indefinite"), attr$5(y, "fill", "#FFf"), attr$5(y, "cx", "36"), attr$5(y, "cy", "18"), attr$5(y, "r", "1"), attr$5(d, "transform", "translate(1 1)"), attr$5(c, "fill", "none"), attr$5(c, "fill-rule", "evenodd"), attr$5(e, "width", "20"), attr$5(e, "height", "20 "), attr$5(e, "viewBox", "0 0 38 38"), attr$5(e, "xmlns", "http://www.w3.org/2000/svg"); }, m(b, A) { - insert_hydration$6(b, e, A), append_hydration$5(e, t), append_hydration$5(t, r), append_hydration$5(r, a), append_hydration$5(r, l), append_hydration$5(r, d), append_hydration$5(e, o), append_hydration$5(o, u), append_hydration$5(u, p), append_hydration$5(p, m), append_hydration$5(u, y), append_hydration$5(y, w); + insert_hydration$6(b, e, A), append_hydration$5(e, t), append_hydration$5(t, r), append_hydration$5(r, a), append_hydration$5(r, l), append_hydration$5(r, h), append_hydration$5(e, c), append_hydration$5(c, d), append_hydration$5(d, _), append_hydration$5(_, m), append_hydration$5(d, y), append_hydration$5(y, x); }, p: noop$5, i: noop$5, @@ -44818,7 +44961,7 @@ function create_if_block$3(n) { }; } function create_fragment$5(n) { - let e, t, r, a, l, d, o = "PDB Assym. Unit", u, p = "PDB BioAssembly", m, y = "AlphaFold DB", w, b = "ESMFold DB", A, f, s, h, _, g, x = "- or -", c, v, M; + let e, t, r, a, l, h, c = "PDB Assym. Unit", d, _ = "PDB BioAssembly", m, y = "AlphaFold DB", x, b = "ESMFold DB", A, f, s, u, p, g, w = "- or -", o, v, M; const E = [create_if_block$3, create_else_block$3], $ = []; function k(L, z) { return ( @@ -44826,9 +44969,9 @@ function create_fragment$5(n) { L[1] ? 0 : 1 ); } - return s = k(n), h = $[s] = E[s](n), { + return s = k(n), u = $[s] = E[s](n), { c() { - e = element$4("div"), t = element$4("div"), r = element$4("input"), a = space$3(), l = element$4("select"), d = element$4("option"), d.textContent = o, u = element$4("option"), u.textContent = p, m = element$4("option"), m.textContent = y, w = element$4("option"), w.textContent = b, A = space$3(), f = element$4("button"), h.c(), _ = space$3(), g = element$4("span"), g.textContent = x, this.h(); + e = element$4("div"), t = element$4("div"), r = element$4("input"), a = space$3(), l = element$4("select"), h = element$4("option"), h.textContent = c, d = element$4("option"), d.textContent = _, m = element$4("option"), m.textContent = y, x = element$4("option"), x.textContent = b, A = space$3(), f = element$4("button"), u.c(), p = space$3(), g = element$4("span"), g.textContent = w, this.h(); }, l(L) { e = claim_element$4(L, "DIV", { class: !0 }); @@ -44841,9 +44984,9 @@ function create_fragment$5(n) { class: !0 }), a = claim_space$3(O), l = claim_element$4(O, "SELECT", { name: !0, id: !0, class: !0 }); var R = children$4(l); - d = claim_element$4(R, "OPTION", { "data-svelte-h": !0 }), get_svelte_dataset$1(d) !== "svelte-qgpnsj" && (d.textContent = o), u = claim_element$4(R, "OPTION", { "data-svelte-h": !0 }), get_svelte_dataset$1(u) !== "svelte-q1k5ac" && (u.textContent = p), m = claim_element$4(R, "OPTION", { "data-svelte-h": !0 }), get_svelte_dataset$1(m) !== "svelte-s0for2" && (m.textContent = y), w = claim_element$4(R, "OPTION", { "data-svelte-h": !0 }), get_svelte_dataset$1(w) !== "svelte-1l46pah" && (w.textContent = b), R.forEach(detach$5), O.forEach(detach$5), A = claim_space$3(z), f = claim_element$4(z, "BUTTON", { class: !0 }); - var P = children$4(f); - h.l(P), P.forEach(detach$5), z.forEach(detach$5), _ = claim_space$3(L), g = claim_element$4(L, "SPAN", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$1(g) !== "svelte-vmas2q" && (g.textContent = x), this.h(); + h = claim_element$4(R, "OPTION", { "data-svelte-h": !0 }), get_svelte_dataset$1(h) !== "svelte-qgpnsj" && (h.textContent = c), d = claim_element$4(R, "OPTION", { "data-svelte-h": !0 }), get_svelte_dataset$1(d) !== "svelte-q1k5ac" && (d.textContent = _), m = claim_element$4(R, "OPTION", { "data-svelte-h": !0 }), get_svelte_dataset$1(m) !== "svelte-s0for2" && (m.textContent = y), x = claim_element$4(R, "OPTION", { "data-svelte-h": !0 }), get_svelte_dataset$1(x) !== "svelte-1l46pah" && (x.textContent = b), R.forEach(detach$5), O.forEach(detach$5), A = claim_space$3(z), f = claim_element$4(z, "BUTTON", { class: !0 }); + var N = children$4(f); + u.l(N), N.forEach(detach$5), z.forEach(detach$5), p = claim_space$3(L), g = claim_element$4(L, "SPAN", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$1(g) !== "svelte-vmas2q" && (g.textContent = w), this.h(); }, h() { attr$4(r, "type", "text"), attr$4( @@ -44851,14 +44994,14 @@ function create_fragment$5(n) { "placeholder", /*placeholder*/ n[2] - ), attr$4(r, "class", "wfull inp svelte-1nnwgsd"), d.__value = "pdb_assym", set_input_value(d, d.__value), u.__value = "pdb_bioass", set_input_value(u, u.__value), m.__value = "af", set_input_value(m, m.__value), w.__value = "esm", set_input_value(w, w.__value), attr$4(l, "name", ""), attr$4(l, "id", ""), attr$4(l, "class", "select svelte-1nnwgsd"), attr$4(t, "class", "flex input wfull svelte-1nnwgsd"), attr$4(f, "class", "btn text-center svelte-1nnwgsd"), attr$4(e, "class", "flex mt-2 svelte-1nnwgsd"), attr$4(g, "class", "or py svelte-1nnwgsd"); + ), attr$4(r, "class", "wfull inp svelte-1nnwgsd"), h.__value = "pdb_assym", set_input_value(h, h.__value), d.__value = "pdb_bioass", set_input_value(d, d.__value), m.__value = "af", set_input_value(m, m.__value), x.__value = "esm", set_input_value(x, x.__value), attr$4(l, "name", ""), attr$4(l, "id", ""), attr$4(l, "class", "select svelte-1nnwgsd"), attr$4(t, "class", "flex input wfull svelte-1nnwgsd"), attr$4(f, "class", "btn text-center svelte-1nnwgsd"), attr$4(e, "class", "flex mt-2 svelte-1nnwgsd"), attr$4(g, "class", "or py svelte-1nnwgsd"); }, m(L, z) { insert_hydration$5(L, e, z), append_hydration$4(e, t), append_hydration$4(t, r), set_input_value( r, /*textInput*/ n[3] - ), append_hydration$4(t, a), append_hydration$4(t, l), append_hydration$4(l, d), append_hydration$4(l, u), append_hydration$4(l, m), append_hydration$4(l, w), append_hydration$4(e, A), append_hydration$4(e, f), $[s].m(f, null), insert_hydration$5(L, _, z), insert_hydration$5(L, g, z), c = !0, v || (M = [ + ), append_hydration$4(t, a), append_hydration$4(t, l), append_hydration$4(l, h), append_hydration$4(l, d), append_hydration$4(l, m), append_hydration$4(l, x), append_hydration$4(e, A), append_hydration$4(e, f), $[s].m(f, null), insert_hydration$5(L, p, z), insert_hydration$5(L, g, z), o = !0, v || (M = [ listen( r, "input", @@ -44886,7 +45029,7 @@ function create_fragment$5(n) { ], v = !0); }, p(L, [z]) { - (!c || z & /*placeholder*/ + (!o || z & /*placeholder*/ 4) && attr$4( r, "placeholder", @@ -44902,27 +45045,27 @@ function create_fragment$5(n) { let O = s; s = k(L), s !== O && (group_outros$3(), transition_out$3($[O], 1, 1, () => { $[O] = null; - }), check_outros$3(), h = $[s], h || (h = $[s] = E[s](L), h.c()), transition_in$3(h, 1), h.m(f, null)); + }), check_outros$3(), u = $[s], u || (u = $[s] = E[s](L), u.c()), transition_in$3(u, 1), u.m(f, null)); }, i(L) { - c || (transition_in$3(h), c = !0); + o || (transition_in$3(u), o = !0); }, o(L) { - transition_out$3(h), c = !1; + transition_out$3(u), o = !1; }, d(L) { - L && (detach$5(e), detach$5(_), detach$5(g)), $[s].d(), v = !1, run_all(M); + L && (detach$5(e), detach$5(p), detach$5(g)), $[s].d(), v = !1, run_all(M); } }; } function instance$5(n, e, t) { - var r = this && this.__awaiter || function(g, x, c, v) { + var r = this && this.__awaiter || function(g, w, o, v) { function M(E) { - return E instanceof c ? E : new c(function($) { + return E instanceof o ? E : new o(function($) { $(E); }); } - return new (c || (c = Promise))(function(E, $) { + return new (o || (o = Promise))(function(E, $) { function k(O) { try { z(v.next(O)); @@ -44940,23 +45083,23 @@ function instance$5(n, e, t) { function z(O) { O.done ? E(O.value) : M(O.value).then(k, L); } - z((v = v.apply(g, x || [])).next()); + z((v = v.apply(g, w || [])).next()); }); }; let a; const l = createEventDispatcher$2(); - let { upload: d } = e, { root: o } = e; - function u(g) { + let { upload: h } = e, { root: c } = e; + function d(g) { return r(this, void 0, void 0, function* () { yield tick$2(); - const x = Math.random().toString(36).substring(2, 15); - a = yield d([g], o, x), l("load", a[0]); + const w = Math.random().toString(36).substring(2, 15); + a = yield h([g], c, w), l("load", a[0]); }); } - let p = !1; - function m(g, x) { + let _ = !1; + function m(g, w) { return r(this, void 0, void 0, function* () { - let c = { + let o = { pdb_assym: { url: "https://files.rcsb.org/view/", ext: ".pdb" @@ -44973,17 +45116,17 @@ function instance$5(n, e, t) { url: "https://api.esmatlas.com/fetchPredictedStructure/", ext: ".pdb" } - }, v = c[x].url, M = c[x].ext; - t(1, p = !0); + }, v = o[w].url, M = o[w].ext; + t(1, _ = !0); let E = null; try { E = yield fetch(v + g + M).then((k) => { - if (t(1, p = !1), k.status == 200) + if (t(1, _ = !1), k.status == 200) return k.blob(); l("notfound"); }).then((k) => new File([k], g + ".pdb", { type: "text/plain" })); } catch { - t(1, p = !1), l("notfound"); + t(1, _ = !1), l("notfound"); } let $ = new FileData({ path: g + ".pdb", @@ -44993,10 +45136,10 @@ function instance$5(n, e, t) { mime_type: E.type, is_stream: !1 }); - yield u($); + yield d($); }); } - let y = "pdb_assym", w = "", b = ""; + let y = "pdb_assym", x = "", b = ""; function A(g) { t(0, y = g.target.value); } @@ -45009,27 +45152,27 @@ function instance$5(n, e, t) { function s(g) { g.key === "Enter" && m(b, y); } - function h() { + function u() { b = this.value, t(3, b); } - const _ = () => m(b, y); + const p = () => m(b, y); return n.$$set = (g) => { - "upload" in g && t(7, d = g.upload), "root" in g && t(8, o = g.root); + "upload" in g && t(7, h = g.upload), "root" in g && t(8, c = g.root); }, n.$$.update = () => { n.$$.dirty & /*selectedValue*/ - 1 && t(2, w = f[y]); + 1 && t(2, x = f[y]); }, [ y, - p, - w, + _, + x, b, m, A, s, - d, - o, h, - _ + c, + u, + p ]; } class FileRetrieval extends SvelteComponent$5 { @@ -45085,10 +45228,10 @@ function create_else_block$2(n) { /*notfound_handler*/ n[25] ); - function d(u) { - n[26](u); + function h(d) { + n[26](d); } - let o = { + let c = { filetype: ( /*file_types*/ n[4] @@ -45118,8 +45261,8 @@ function create_else_block$2(n) { }; return ( /*dragging*/ - n[17] !== void 0 && (o.dragging = /*dragging*/ - n[17]), r = new Upload({ props: o }), binding_callbacks$1.push(() => bind(r, "dragging", d)), r.$on( + n[17] !== void 0 && (c.dragging = /*dragging*/ + n[17]), r = new Upload({ props: c }), binding_callbacks$1.push(() => bind(r, "dragging", h)), r.$on( "load", /*handle_upload*/ n[18] @@ -45131,51 +45274,51 @@ function create_else_block$2(n) { c() { create_component$2(e.$$.fragment), t = space$2(), create_component$2(r.$$.fragment); }, - l(u) { - claim_component$2(e.$$.fragment, u), t = claim_space$2(u), claim_component$2(r.$$.fragment, u); + l(d) { + claim_component$2(e.$$.fragment, d), t = claim_space$2(d), claim_component$2(r.$$.fragment, d); }, - m(u, p) { - mount_component$2(e, u, p), insert_hydration$4(u, t, p), mount_component$2(r, u, p), l = !0; + m(d, _) { + mount_component$2(e, d, _), insert_hydration$4(d, t, _), mount_component$2(r, d, _), l = !0; }, - p(u, p) { + p(d, _) { const m = {}; - p & /*root*/ + _ & /*root*/ 64 && (m.root = /*root*/ - u[6]), p & /*upload*/ + d[6]), _ & /*upload*/ 1024 && (m.upload = /*upload*/ - u[10]), e.$set(m); + d[10]), e.$set(m); const y = {}; - p & /*file_types*/ + _ & /*file_types*/ 16 && (y.filetype = /*file_types*/ - u[4]), p & /*file_count*/ + d[4]), _ & /*file_count*/ 8 && (y.file_count = /*file_count*/ - u[3]), p & /*max_file_size*/ + d[3]), _ & /*max_file_size*/ 512 && (y.max_file_size = /*max_file_size*/ - u[9]), p & /*root*/ + d[9]), _ & /*root*/ 64 && (y.root = /*root*/ - u[6]), p & /*stream_handler*/ + d[6]), _ & /*stream_handler*/ 2048 && (y.stream_handler = /*stream_handler*/ - u[11]), p & /*upload*/ + d[11]), _ & /*upload*/ 1024 && (y.upload = /*upload*/ - u[10]), p & /*$$scope*/ - 268435456 && (y.$$scope = { dirty: p, ctx: u }), !a && p & /*dragging*/ + d[10]), _ & /*$$scope*/ + 268435456 && (y.$$scope = { dirty: _, ctx: d }), !a && _ & /*dragging*/ 131072 && (a = !0, y.dragging = /*dragging*/ - u[17], add_flush_callback(() => a = !1)), r.$set(y); + d[17], add_flush_callback(() => a = !1)), r.$set(y); }, - i(u) { - l || (transition_in$2(e.$$.fragment, u), transition_in$2(r.$$.fragment, u), l = !0); + i(d) { + l || (transition_in$2(e.$$.fragment, d), transition_in$2(r.$$.fragment, d), l = !0); }, - o(u) { - transition_out$2(e.$$.fragment, u), transition_out$2(r.$$.fragment, u), l = !1; + o(d) { + transition_out$2(e.$$.fragment, d), transition_out$2(r.$$.fragment, d), l = !1; }, - d(u) { - u && detach$4(t), destroy_component$2(e, u), destroy_component$2(r, u); + d(d) { + d && detach$4(t), destroy_component$2(e, d), destroy_component$2(r, d); } } ); } function create_if_block$2(n) { - let e, t, r, a, l, d; + let e, t, r, a, l, h; e = new ModifyUpload({ props: { i18n: ( /*i18n*/ @@ -45217,50 +45360,50 @@ function create_if_block$2(n) { /*delete_handler*/ n[24] ); - let o = ( + let c = ( /*moldata*/ n[15] != null && /*molviewer*/ n[16] && create_if_block_1$2(n) ); return { c() { - create_component$2(e.$$.fragment), t = space$2(), create_component$2(r.$$.fragment), a = space$2(), o && o.c(), l = empty$2(); + create_component$2(e.$$.fragment), t = space$2(), create_component$2(r.$$.fragment), a = space$2(), c && c.c(), l = empty$2(); }, - l(u) { - claim_component$2(e.$$.fragment, u), t = claim_space$2(u), claim_component$2(r.$$.fragment, u), a = claim_space$2(u), o && o.l(u), l = empty$2(); + l(d) { + claim_component$2(e.$$.fragment, d), t = claim_space$2(d), claim_component$2(r.$$.fragment, d), a = claim_space$2(d), c && c.l(d), l = empty$2(); }, - m(u, p) { - mount_component$2(e, u, p), insert_hydration$4(u, t, p), mount_component$2(r, u, p), insert_hydration$4(u, a, p), o && o.m(u, p), insert_hydration$4(u, l, p), d = !0; + m(d, _) { + mount_component$2(e, d, _), insert_hydration$4(d, t, _), mount_component$2(r, d, _), insert_hydration$4(d, a, _), c && c.m(d, _), insert_hydration$4(d, l, _), h = !0; }, - p(u, p) { + p(d, _) { const m = {}; - p & /*i18n*/ + _ & /*i18n*/ 256 && (m.i18n = /*i18n*/ - u[8]), e.$set(m); + d[8]), e.$set(m); const y = {}; - p & /*i18n*/ + _ & /*i18n*/ 256 && (y.i18n = /*i18n*/ - u[8]), p & /*selectable*/ + d[8]), _ & /*selectable*/ 32 && (y.selectable = /*selectable*/ - u[5]), p & /*value*/ + d[5]), _ & /*value*/ 1 && (y.value = /*value*/ - u[0]), p & /*height*/ + d[0]), _ & /*height*/ 128 && (y.height = /*height*/ - u[7]), r.$set(y), /*moldata*/ - u[15] != null && /*molviewer*/ - u[16] ? o ? (o.p(u, p), p & /*moldata, molviewer*/ - 98304 && transition_in$2(o, 1)) : (o = create_if_block_1$2(u), o.c(), transition_in$2(o, 1), o.m(l.parentNode, l)) : o && (group_outros$2(), transition_out$2(o, 1, 1, () => { - o = null; + d[7]), r.$set(y), /*moldata*/ + d[15] != null && /*molviewer*/ + d[16] ? c ? (c.p(d, _), _ & /*moldata, molviewer*/ + 98304 && transition_in$2(c, 1)) : (c = create_if_block_1$2(d), c.c(), transition_in$2(c, 1), c.m(l.parentNode, l)) : c && (group_outros$2(), transition_out$2(c, 1, 1, () => { + c = null; }), check_outros$2()); }, - i(u) { - d || (transition_in$2(e.$$.fragment, u), transition_in$2(r.$$.fragment, u), transition_in$2(o), d = !0); + i(d) { + h || (transition_in$2(e.$$.fragment, d), transition_in$2(r.$$.fragment, d), transition_in$2(c), h = !0); }, - o(u) { - transition_out$2(e.$$.fragment, u), transition_out$2(r.$$.fragment, u), transition_out$2(o), d = !1; + o(d) { + transition_out$2(e.$$.fragment, d), transition_out$2(r.$$.fragment, d), transition_out$2(c), h = !1; }, - d(u) { - u && (detach$4(t), detach$4(a), detach$4(l)), destroy_component$2(e, u), destroy_component$2(r, u), o && o.d(u); + d(d) { + d && (detach$4(t), detach$4(a), detach$4(l)), destroy_component$2(e, d), destroy_component$2(r, d), c && c.d(d); } }; } @@ -45373,7 +45516,7 @@ function create_if_block_1$2(n) { }; } function create_fragment$4(n) { - let e, t, r, a, l, d, o; + let e, t, r, a, l, h, c; e = new BlockLabel({ props: { show_label: ( @@ -45389,9 +45532,9 @@ function create_fragment$4(n) { ) } }); - const u = [create_if_block$2, create_else_block$2], p = []; - function m(y, w) { - return w & /*value*/ + const d = [create_if_block$2, create_else_block$2], _ = []; + function m(y, x) { + return x & /*value*/ 1 && (r = null), r == null && (r = !!/*value*/ (y[0] && (!Array.isArray( /*value*/ @@ -45399,78 +45542,78 @@ function create_fragment$4(n) { ) || /*value*/ y[0].length > 0))), r ? 0 : 1; } - return a = m(n, -1), l = p[a] = u[a](n), { + return a = m(n, -1), l = _[a] = d[a](n), { c() { - create_component$2(e.$$.fragment), t = space$2(), l.c(), d = empty$2(); + create_component$2(e.$$.fragment), t = space$2(), l.c(), h = empty$2(); }, l(y) { - claim_component$2(e.$$.fragment, y), t = claim_space$2(y), l.l(y), d = empty$2(); + claim_component$2(e.$$.fragment, y), t = claim_space$2(y), l.l(y), h = empty$2(); }, - m(y, w) { - mount_component$2(e, y, w), insert_hydration$4(y, t, w), p[a].m(y, w), insert_hydration$4(y, d, w), o = !0; + m(y, x) { + mount_component$2(e, y, x), insert_hydration$4(y, t, x), _[a].m(y, x), insert_hydration$4(y, h, x), c = !0; }, - p(y, [w]) { + p(y, [x]) { const b = {}; - w & /*show_label*/ + x & /*show_label*/ 4 && (b.show_label = /*show_label*/ - y[2]), w & /*value*/ + y[2]), x & /*value*/ 1 && (b.float = !/*value*/ - y[0]), w & /*label*/ + y[0]), x & /*label*/ 2 && (b.label = /*label*/ y[1] || "File"), e.$set(b); let A = a; - a = m(y, w), a === A ? p[a].p(y, w) : (group_outros$2(), transition_out$2(p[A], 1, 1, () => { - p[A] = null; - }), check_outros$2(), l = p[a], l ? l.p(y, w) : (l = p[a] = u[a](y), l.c()), transition_in$2(l, 1), l.m(d.parentNode, d)); + a = m(y, x), a === A ? _[a].p(y, x) : (group_outros$2(), transition_out$2(_[A], 1, 1, () => { + _[A] = null; + }), check_outros$2(), l = _[a], l ? l.p(y, x) : (l = _[a] = d[a](y), l.c()), transition_in$2(l, 1), l.m(h.parentNode, h)); }, i(y) { - o || (transition_in$2(e.$$.fragment, y), transition_in$2(l), o = !0); + c || (transition_in$2(e.$$.fragment, y), transition_in$2(l), c = !0); }, o(y) { - transition_out$2(e.$$.fragment, y), transition_out$2(l), o = !1; + transition_out$2(e.$$.fragment, y), transition_out$2(l), c = !1; }, d(y) { - y && (detach$4(t), detach$4(d)), destroy_component$2(e, y), p[a].d(y); + y && (detach$4(t), detach$4(h)), destroy_component$2(e, y), _[a].d(y); } }; } function instance$4(n, e, t) { let { $$slots: r = {}, $$scope: a } = e; - var l = this && this.__awaiter || function(B, N, G, H) { - function W(V) { - return V instanceof G ? V : new G(function(re) { - re(V); + var l = this && this.__awaiter || function(B, P, G, H) { + function U(j) { + return j instanceof G ? j : new G(function(re) { + re(j); }); } - return new (G || (G = Promise))(function(V, re) { - function ie(he) { + return new (G || (G = Promise))(function(j, re) { + function ie(de) { try { - ce(H.next(he)); - } catch (le) { - re(le); + ue(H.next(de)); + } catch (oe) { + re(oe); } } - function ee(he) { + function te(de) { try { - ce(H.throw(he)); - } catch (le) { - re(le); + ue(H.throw(de)); + } catch (oe) { + re(oe); } } - function ce(he) { - he.done ? V(he.value) : W(he.value).then(ie, ee); + function ue(de) { + de.done ? j(de.value) : U(de.value).then(ie, te); } - ce((H = H.apply(B, N || [])).next()); + ue((H = H.apply(B, P || [])).next()); }); }; - let { value: d } = e, { label: o } = e, { show_label: u = !0 } = e, { file_count: p = "single" } = e, { file_types: m = null } = e, { selectable: y = !1 } = e, { root: w } = e, { height: b = void 0 } = e, { i18n: A } = e, { max_file_size: f = null } = e, { upload: s } = e, { stream_handler: h } = e, { config: _ = {} } = e, { confidenceLabel: g = "" } = e, { representations: x = [] } = e, { moldata: c = null } = e, { molviewer: v = !1 } = e; + let { value: h } = e, { label: c } = e, { show_label: d = !0 } = e, { file_count: _ = "single" } = e, { file_types: m = null } = e, { selectable: y = !1 } = e, { root: x } = e, { height: b = void 0 } = e, { i18n: A } = e, { max_file_size: f = null } = e, { upload: s } = e, { stream_handler: u } = e, { config: p = {} } = e, { confidenceLabel: g = "" } = e, { representations: w = [] } = e, { moldata: o = null } = e, { molviewer: v = !1 } = e; function M(B) { - return l(this, arguments, void 0, function* ({ detail: N }) { - t(0, d = N), console.log("upload", N), yield tick$1(), $("change", d), $("upload", N); + return l(this, arguments, void 0, function* ({ detail: P }) { + t(0, h = P), console.log("upload", P), yield tick$1(), $("change", h), $("upload", P); }); } function E() { - t(0, d = null), oldata = null, $("change", null), $("clear"); + t(0, h = null), oldata = null, $("change", null), $("clear"); } const $ = createEventDispatcher$1(); let k = !1; @@ -45484,34 +45627,34 @@ function instance$4(n, e, t) { bubble.call(this, n, B); } const R = () => $("notfound"); - function P(B) { + function N(B) { k = B, t(17, k); } - function U(B) { + function W(B) { bubble.call(this, n, B); } return n.$$set = (B) => { - "value" in B && t(0, d = B.value), "label" in B && t(1, o = B.label), "show_label" in B && t(2, u = B.show_label), "file_count" in B && t(3, p = B.file_count), "file_types" in B && t(4, m = B.file_types), "selectable" in B && t(5, y = B.selectable), "root" in B && t(6, w = B.root), "height" in B && t(7, b = B.height), "i18n" in B && t(8, A = B.i18n), "max_file_size" in B && t(9, f = B.max_file_size), "upload" in B && t(10, s = B.upload), "stream_handler" in B && t(11, h = B.stream_handler), "config" in B && t(12, _ = B.config), "confidenceLabel" in B && t(13, g = B.confidenceLabel), "representations" in B && t(14, x = B.representations), "moldata" in B && t(15, c = B.moldata), "molviewer" in B && t(16, v = B.molviewer), "$$scope" in B && t(28, a = B.$$scope); + "value" in B && t(0, h = B.value), "label" in B && t(1, c = B.label), "show_label" in B && t(2, d = B.show_label), "file_count" in B && t(3, _ = B.file_count), "file_types" in B && t(4, m = B.file_types), "selectable" in B && t(5, y = B.selectable), "root" in B && t(6, x = B.root), "height" in B && t(7, b = B.height), "i18n" in B && t(8, A = B.i18n), "max_file_size" in B && t(9, f = B.max_file_size), "upload" in B && t(10, s = B.upload), "stream_handler" in B && t(11, u = B.stream_handler), "config" in B && t(12, p = B.config), "confidenceLabel" in B && t(13, g = B.confidenceLabel), "representations" in B && t(14, w = B.representations), "moldata" in B && t(15, o = B.moldata), "molviewer" in B && t(16, v = B.molviewer), "$$scope" in B && t(28, a = B.$$scope); }, n.$$.update = () => { n.$$.dirty & /*dragging*/ 131072 && $("drag", k); }, [ + h, + c, d, - o, - u, - p, + _, m, y, - w, + x, b, A, f, s, - h, - _, + u, + p, g, - x, - c, + w, + o, v, k, M, @@ -45522,8 +45665,8 @@ function instance$4(n, e, t) { z, O, R, - P, - U, + N, + W, a ]; } @@ -45576,10 +45719,10 @@ const { toggle_class: toggle_class$2 } = window.__gradio__svelte__internal, { onMount } = window.__gradio__svelte__internal; function create_fragment$3(n) { - let e, t, r, a, l, d, o, u, p, m, y, w; + let e, t, r, a, l, h, c, d, _, m, y, x; return { c() { - e = element$3("div"), t = svg_element$1("svg"), r = svg_element$1("g"), a = svg_element$1("path"), l = svg_element$1("path"), d = svg_element$1("path"), o = svg_element$1("path"), u = svg_element$1("g"), p = svg_element$1("path"), m = svg_element$1("path"), y = svg_element$1("path"), w = svg_element$1("path"), this.h(); + e = element$3("div"), t = svg_element$1("svg"), r = svg_element$1("g"), a = svg_element$1("path"), l = svg_element$1("path"), h = svg_element$1("path"), c = svg_element$1("path"), d = svg_element$1("g"), _ = svg_element$1("path"), m = svg_element$1("path"), y = svg_element$1("path"), x = svg_element$1("path"), this.h(); }, l(b) { e = claim_element$3(b, "DIV", { class: !0 }); @@ -45598,29 +45741,29 @@ function create_fragment$3(n) { fill: !0, "fill-opacity": !0, class: !0 - }), children$3(a).forEach(detach$3), l = claim_svg_element$1(s, "path", { d: !0, fill: !0, class: !0 }), children$3(l).forEach(detach$3), d = claim_svg_element$1(s, "path", { + }), children$3(a).forEach(detach$3), l = claim_svg_element$1(s, "path", { d: !0, fill: !0, class: !0 }), children$3(l).forEach(detach$3), h = claim_svg_element$1(s, "path", { d: !0, fill: !0, "fill-opacity": !0, class: !0 - }), children$3(d).forEach(detach$3), o = claim_svg_element$1(s, "path", { d: !0, fill: !0, class: !0 }), children$3(o).forEach(detach$3), s.forEach(detach$3), u = claim_svg_element$1(f, "g", { style: !0 }); - var h = children$3(u); - p = claim_svg_element$1(h, "path", { + }), children$3(h).forEach(detach$3), c = claim_svg_element$1(s, "path", { d: !0, fill: !0, class: !0 }), children$3(c).forEach(detach$3), s.forEach(detach$3), d = claim_svg_element$1(f, "g", { style: !0 }); + var u = children$3(d); + _ = claim_svg_element$1(u, "path", { d: !0, fill: !0, "fill-opacity": !0, class: !0 - }), children$3(p).forEach(detach$3), m = claim_svg_element$1(h, "path", { d: !0, fill: !0, class: !0 }), children$3(m).forEach(detach$3), y = claim_svg_element$1(h, "path", { + }), children$3(_).forEach(detach$3), m = claim_svg_element$1(u, "path", { d: !0, fill: !0, class: !0 }), children$3(m).forEach(detach$3), y = claim_svg_element$1(u, "path", { d: !0, fill: !0, "fill-opacity": !0, class: !0 - }), children$3(y).forEach(detach$3), w = claim_svg_element$1(h, "path", { d: !0, fill: !0, class: !0 }), children$3(w).forEach(detach$3), h.forEach(detach$3), f.forEach(detach$3), A.forEach(detach$3), this.h(); + }), children$3(y).forEach(detach$3), x = claim_svg_element$1(u, "path", { d: !0, fill: !0, class: !0 }), children$3(x).forEach(detach$3), u.forEach(detach$3), f.forEach(detach$3), A.forEach(detach$3), this.h(); }, h() { - attr$3(a, "d", "M255.926 0.754768L509.702 139.936V221.027L255.926 81.8465V0.754768Z"), attr$3(a, "fill", "#FF7C00"), attr$3(a, "fill-opacity", "0.4"), attr$3(a, "class", "svelte-43sxxs"), attr$3(l, "d", "M509.69 139.936L254.981 279.641V361.255L509.69 221.55V139.936Z"), attr$3(l, "fill", "#FF7C00"), attr$3(l, "class", "svelte-43sxxs"), attr$3(d, "d", "M0.250138 139.937L254.981 279.641V361.255L0.250138 221.55V139.937Z"), attr$3(d, "fill", "#FF7C00"), attr$3(d, "fill-opacity", "0.4"), attr$3(d, "class", "svelte-43sxxs"), attr$3(o, "d", "M255.923 0.232622L0.236328 139.936V221.55L255.923 81.8469V0.232622Z"), attr$3(o, "fill", "#FF7C00"), attr$3(o, "class", "svelte-43sxxs"), set_style$1(r, "transform", "translate(" + /*$top*/ + attr$3(a, "d", "M255.926 0.754768L509.702 139.936V221.027L255.926 81.8465V0.754768Z"), attr$3(a, "fill", "#FF7C00"), attr$3(a, "fill-opacity", "0.4"), attr$3(a, "class", "svelte-43sxxs"), attr$3(l, "d", "M509.69 139.936L254.981 279.641V361.255L509.69 221.55V139.936Z"), attr$3(l, "fill", "#FF7C00"), attr$3(l, "class", "svelte-43sxxs"), attr$3(h, "d", "M0.250138 139.937L254.981 279.641V361.255L0.250138 221.55V139.937Z"), attr$3(h, "fill", "#FF7C00"), attr$3(h, "fill-opacity", "0.4"), attr$3(h, "class", "svelte-43sxxs"), attr$3(c, "d", "M255.923 0.232622L0.236328 139.936V221.55L255.923 81.8469V0.232622Z"), attr$3(c, "fill", "#FF7C00"), attr$3(c, "class", "svelte-43sxxs"), set_style$1(r, "transform", "translate(" + /*$top*/ n[1][0] + "px, " + /*$top*/ - n[1][1] + "px)"), attr$3(p, "d", "M255.926 141.5L509.702 280.681V361.773L255.926 222.592V141.5Z"), attr$3(p, "fill", "#FF7C00"), attr$3(p, "fill-opacity", "0.4"), attr$3(p, "class", "svelte-43sxxs"), attr$3(m, "d", "M509.69 280.679L254.981 420.384V501.998L509.69 362.293V280.679Z"), attr$3(m, "fill", "#FF7C00"), attr$3(m, "class", "svelte-43sxxs"), attr$3(y, "d", "M0.250138 280.681L254.981 420.386V502L0.250138 362.295V280.681Z"), attr$3(y, "fill", "#FF7C00"), attr$3(y, "fill-opacity", "0.4"), attr$3(y, "class", "svelte-43sxxs"), attr$3(w, "d", "M255.923 140.977L0.236328 280.68V362.294L255.923 222.591V140.977Z"), attr$3(w, "fill", "#FF7C00"), attr$3(w, "class", "svelte-43sxxs"), set_style$1(u, "transform", "translate(" + /*$bottom*/ + n[1][1] + "px)"), attr$3(_, "d", "M255.926 141.5L509.702 280.681V361.773L255.926 222.592V141.5Z"), attr$3(_, "fill", "#FF7C00"), attr$3(_, "fill-opacity", "0.4"), attr$3(_, "class", "svelte-43sxxs"), attr$3(m, "d", "M509.69 280.679L254.981 420.384V501.998L509.69 362.293V280.679Z"), attr$3(m, "fill", "#FF7C00"), attr$3(m, "class", "svelte-43sxxs"), attr$3(y, "d", "M0.250138 280.681L254.981 420.386V502L0.250138 362.295V280.681Z"), attr$3(y, "fill", "#FF7C00"), attr$3(y, "fill-opacity", "0.4"), attr$3(y, "class", "svelte-43sxxs"), attr$3(x, "d", "M255.923 140.977L0.236328 280.68V362.294L255.923 222.591V140.977Z"), attr$3(x, "fill", "#FF7C00"), attr$3(x, "class", "svelte-43sxxs"), set_style$1(d, "transform", "translate(" + /*$bottom*/ n[2][0] + "px, " + /*$bottom*/ n[2][1] + "px)"), attr$3(t, "viewBox", "-1200 -1200 3000 3000"), attr$3(t, "fill", "none"), attr$3(t, "xmlns", "http://www.w3.org/2000/svg"), attr$3(t, "class", "svelte-43sxxs"), attr$3(e, "class", "svelte-43sxxs"), toggle_class$2( e, @@ -45630,14 +45773,14 @@ function create_fragment$3(n) { ); }, m(b, A) { - insert_hydration$3(b, e, A), append_hydration$3(e, t), append_hydration$3(t, r), append_hydration$3(r, a), append_hydration$3(r, l), append_hydration$3(r, d), append_hydration$3(r, o), append_hydration$3(t, u), append_hydration$3(u, p), append_hydration$3(u, m), append_hydration$3(u, y), append_hydration$3(u, w); + insert_hydration$3(b, e, A), append_hydration$3(e, t), append_hydration$3(t, r), append_hydration$3(r, a), append_hydration$3(r, l), append_hydration$3(r, h), append_hydration$3(r, c), append_hydration$3(t, d), append_hydration$3(d, _), append_hydration$3(d, m), append_hydration$3(d, y), append_hydration$3(d, x); }, p(b, [A]) { A & /*$top*/ 2 && set_style$1(r, "transform", "translate(" + /*$top*/ b[1][0] + "px, " + /*$top*/ b[1][1] + "px)"), A & /*$bottom*/ - 4 && set_style$1(u, "transform", "translate(" + /*$bottom*/ + 4 && set_style$1(d, "transform", "translate(" + /*$bottom*/ b[2][0] + "px, " + /*$bottom*/ b[2][1] + "px)"), A & /*margin*/ 1 && toggle_class$2( @@ -45657,20 +45800,20 @@ function create_fragment$3(n) { function instance$3(n, e, t) { let r, a; var l = this && this.__awaiter || function(b, A, f, s) { - function h(_) { - return _ instanceof f ? _ : new f(function(g) { - g(_); + function u(p) { + return p instanceof f ? p : new f(function(g) { + g(p); }); } - return new (f || (f = Promise))(function(_, g) { - function x(M) { + return new (f || (f = Promise))(function(p, g) { + function w(M) { try { v(s.next(M)); } catch (E) { g(E); } } - function c(M) { + function o(M) { try { v(s.throw(M)); } catch (E) { @@ -45678,35 +45821,35 @@ function instance$3(n, e, t) { } } function v(M) { - M.done ? _(M.value) : h(M.value).then(x, c); + M.done ? p(M.value) : u(M.value).then(w, o); } v((s = s.apply(b, A || [])).next()); }); }; - let { margin: d = !0 } = e; - const o = spring([0, 0]); - component_subscribe(n, o, (b) => t(1, r = b)); - const u = spring([0, 0]); - component_subscribe(n, u, (b) => t(2, a = b)); - let p; + let { margin: h = !0 } = e; + const c = spring([0, 0]); + component_subscribe(n, c, (b) => t(1, r = b)); + const d = spring([0, 0]); + component_subscribe(n, d, (b) => t(2, a = b)); + let _; function m() { return l(this, void 0, void 0, function* () { - yield Promise.all([o.set([125, 140]), u.set([-125, -140])]), yield Promise.all([o.set([-125, 140]), u.set([125, -140])]), yield Promise.all([o.set([-125, 0]), u.set([125, -0])]), yield Promise.all([o.set([125, 0]), u.set([-125, 0])]); + yield Promise.all([c.set([125, 140]), d.set([-125, -140])]), yield Promise.all([c.set([-125, 140]), d.set([125, -140])]), yield Promise.all([c.set([-125, 0]), d.set([125, -0])]), yield Promise.all([c.set([125, 0]), d.set([-125, 0])]); }); } function y() { return l(this, void 0, void 0, function* () { - yield m(), p || y(); + yield m(), _ || y(); }); } - function w() { + function x() { return l(this, void 0, void 0, function* () { - yield Promise.all([o.set([125, 0]), u.set([-125, 0])]), y(); + yield Promise.all([c.set([125, 0]), d.set([-125, 0])]), y(); }); } - return onMount(() => (w(), () => p = !0)), n.$$set = (b) => { - "margin" in b && t(0, d = b.margin); - }, [d, r, a, o, u]; + return onMount(() => (x(), () => _ = !0)), n.$$set = (b) => { + "margin" in b && t(0, h = b.margin); + }, [h, r, a, c, d]; } class Loader extends SvelteComponent$3 { constructor(e) { @@ -45761,7 +45904,7 @@ function create_if_block_17(n) { let e, t, r, a, l = ( /*i18n*/ n[1]("common.error") + "" - ), d, o, u; + ), h, c, d; t = new IconButton({ props: { Icon: Clear, @@ -45776,11 +45919,11 @@ function create_if_block_17(n) { /*click_handler*/ n[32] ); - const p = ( + const _ = ( /*#slots*/ n[30].error ), m = create_slot( - p, + _, n, /*$$scope*/ n[29], @@ -45788,39 +45931,39 @@ function create_if_block_17(n) { ); return { c() { - e = element$2("div"), create_component$1(t.$$.fragment), r = space$1(), a = element$2("span"), d = text$2(l), o = space$1(), m && m.c(), this.h(); + e = element$2("div"), create_component$1(t.$$.fragment), r = space$1(), a = element$2("span"), h = text$2(l), c = space$1(), m && m.c(), this.h(); }, l(y) { e = claim_element$2(y, "DIV", { class: !0 }); - var w = children$2(e); - claim_component$1(t.$$.fragment, w), w.forEach(detach$2), r = claim_space$1(y), a = claim_element$2(y, "SPAN", { class: !0 }); + var x = children$2(e); + claim_component$1(t.$$.fragment, x), x.forEach(detach$2), r = claim_space$1(y), a = claim_element$2(y, "SPAN", { class: !0 }); var b = children$2(a); - d = claim_text$2(b, l), b.forEach(detach$2), o = claim_space$1(y), m && m.l(y), this.h(); + h = claim_text$2(b, l), b.forEach(detach$2), c = claim_space$1(y), m && m.l(y), this.h(); }, h() { attr$2(e, "class", "clear-status svelte-17v219f"), attr$2(a, "class", "error svelte-17v219f"); }, - m(y, w) { - insert_hydration$2(y, e, w), mount_component$1(t, e, null), insert_hydration$2(y, r, w), insert_hydration$2(y, a, w), append_hydration$2(a, d), insert_hydration$2(y, o, w), m && m.m(y, w), u = !0; + m(y, x) { + insert_hydration$2(y, e, x), mount_component$1(t, e, null), insert_hydration$2(y, r, x), insert_hydration$2(y, a, x), append_hydration$2(a, h), insert_hydration$2(y, c, x), m && m.m(y, x), d = !0; }, - p(y, w) { + p(y, x) { const b = {}; - w[0] & /*i18n*/ + x[0] & /*i18n*/ 2 && (b.label = /*i18n*/ - y[1]("common.clear")), t.$set(b), (!u || w[0] & /*i18n*/ + y[1]("common.clear")), t.$set(b), (!d || x[0] & /*i18n*/ 2) && l !== (l = /*i18n*/ - y[1]("common.error") + "") && set_data$1(d, l), m && m.p && (!u || w[0] & /*$$scope*/ + y[1]("common.error") + "") && set_data$1(h, l), m && m.p && (!d || x[0] & /*$$scope*/ 536870912) && update_slot_base( m, - p, + _, y, /*$$scope*/ y[29], - u ? get_slot_changes( - p, + d ? get_slot_changes( + _, /*$$scope*/ y[29], - w, + x, get_error_slot_changes ) : get_all_dirty_from_scope( /*$$scope*/ @@ -45830,24 +45973,24 @@ function create_if_block_17(n) { ); }, i(y) { - u || (transition_in$1(t.$$.fragment, y), transition_in$1(m, y), u = !0); + d || (transition_in$1(t.$$.fragment, y), transition_in$1(m, y), d = !0); }, o(y) { - transition_out$1(t.$$.fragment, y), transition_out$1(m, y), u = !1; + transition_out$1(t.$$.fragment, y), transition_out$1(m, y), d = !1; }, d(y) { - y && (detach$2(e), detach$2(r), detach$2(a), detach$2(o)), destroy_component$1(t), m && m.d(y); + y && (detach$2(e), detach$2(r), detach$2(a), detach$2(c)), destroy_component$1(t), m && m.d(y); } }; } function create_if_block$1(n) { - let e, t, r, a, l, d, o, u, p, m = ( + let e, t, r, a, l, h, c, d, _, m = ( /*variant*/ n[8] === "default" && /*show_eta_bar*/ n[18] && /*show_progress*/ n[6] === "full" && create_if_block_16(n) ); - function y(g, x) { + function y(g, w) { if ( /*progress*/ g[7] @@ -45863,12 +46006,12 @@ function create_if_block$1(n) { g[2] === 0 ) return create_if_block_15; } - let w = y(n), b = w && w(n), A = ( + let x = y(n), b = x && x(n), A = ( /*timer*/ n[5] && create_if_block_10(n) ); const f = [create_if_block_2, create_if_block_9], s = []; - function h(g, x) { + function u(g, w) { return ( /*last_progress_level*/ g[15] != null ? 0 : ( @@ -45877,17 +46020,17 @@ function create_if_block$1(n) { ) ); } - ~(l = h(n)) && (d = s[l] = f[l](n)); - let _ = !/*timer*/ + ~(l = u(n)) && (h = s[l] = f[l](n)); + let p = !/*timer*/ n[5] && create_if_block_1$1(n); return { c() { - m && m.c(), e = space$1(), t = element$2("div"), b && b.c(), r = space$1(), A && A.c(), a = space$1(), d && d.c(), o = space$1(), _ && _.c(), u = empty$1(), this.h(); + m && m.c(), e = space$1(), t = element$2("div"), b && b.c(), r = space$1(), A && A.c(), a = space$1(), h && h.c(), c = space$1(), p && p.c(), d = empty$1(), this.h(); }, l(g) { m && m.l(g), e = claim_space$1(g), t = claim_element$2(g, "DIV", { class: !0 }); - var x = children$2(t); - b && b.l(x), r = claim_space$1(x), A && A.l(x), x.forEach(detach$2), a = claim_space$1(g), d && d.l(g), o = claim_space$1(g), _ && _.l(g), u = empty$1(), this.h(); + var w = children$2(t); + b && b.l(w), r = claim_space$1(w), A && A.l(w), w.forEach(detach$2), a = claim_space$1(g), h && h.l(g), c = claim_space$1(g), p && p.l(g), d = empty$1(), this.h(); }, h() { attr$2(t, "class", "progress-text svelte-17v219f"), toggle_class$1( @@ -45902,44 +46045,44 @@ function create_if_block$1(n) { n[8] === "default" ); }, - m(g, x) { - m && m.m(g, x), insert_hydration$2(g, e, x), insert_hydration$2(g, t, x), b && b.m(t, null), append_hydration$2(t, r), A && A.m(t, null), insert_hydration$2(g, a, x), ~l && s[l].m(g, x), insert_hydration$2(g, o, x), _ && _.m(g, x), insert_hydration$2(g, u, x), p = !0; + m(g, w) { + m && m.m(g, w), insert_hydration$2(g, e, w), insert_hydration$2(g, t, w), b && b.m(t, null), append_hydration$2(t, r), A && A.m(t, null), insert_hydration$2(g, a, w), ~l && s[l].m(g, w), insert_hydration$2(g, c, w), p && p.m(g, w), insert_hydration$2(g, d, w), _ = !0; }, - p(g, x) { + p(g, w) { /*variant*/ g[8] === "default" && /*show_eta_bar*/ g[18] && /*show_progress*/ - g[6] === "full" ? m ? m.p(g, x) : (m = create_if_block_16(g), m.c(), m.m(e.parentNode, e)) : m && (m.d(1), m = null), w === (w = y(g)) && b ? b.p(g, x) : (b && b.d(1), b = w && w(g), b && (b.c(), b.m(t, r))), /*timer*/ - g[5] ? A ? A.p(g, x) : (A = create_if_block_10(g), A.c(), A.m(t, null)) : A && (A.d(1), A = null), (!p || x[0] & /*variant*/ + g[6] === "full" ? m ? m.p(g, w) : (m = create_if_block_16(g), m.c(), m.m(e.parentNode, e)) : m && (m.d(1), m = null), x === (x = y(g)) && b ? b.p(g, w) : (b && b.d(1), b = x && x(g), b && (b.c(), b.m(t, r))), /*timer*/ + g[5] ? A ? A.p(g, w) : (A = create_if_block_10(g), A.c(), A.m(t, null)) : A && (A.d(1), A = null), (!_ || w[0] & /*variant*/ 256) && toggle_class$1( t, "meta-text-center", /*variant*/ g[8] === "center" - ), (!p || x[0] & /*variant*/ + ), (!_ || w[0] & /*variant*/ 256) && toggle_class$1( t, "meta-text", /*variant*/ g[8] === "default" ); - let c = l; - l = h(g), l === c ? ~l && s[l].p(g, x) : (d && (group_outros$1(), transition_out$1(s[c], 1, 1, () => { - s[c] = null; - }), check_outros$1()), ~l ? (d = s[l], d ? d.p(g, x) : (d = s[l] = f[l](g), d.c()), transition_in$1(d, 1), d.m(o.parentNode, o)) : d = null), /*timer*/ - g[5] ? _ && (group_outros$1(), transition_out$1(_, 1, 1, () => { - _ = null; - }), check_outros$1()) : _ ? (_.p(g, x), x[0] & /*timer*/ - 32 && transition_in$1(_, 1)) : (_ = create_if_block_1$1(g), _.c(), transition_in$1(_, 1), _.m(u.parentNode, u)); + let o = l; + l = u(g), l === o ? ~l && s[l].p(g, w) : (h && (group_outros$1(), transition_out$1(s[o], 1, 1, () => { + s[o] = null; + }), check_outros$1()), ~l ? (h = s[l], h ? h.p(g, w) : (h = s[l] = f[l](g), h.c()), transition_in$1(h, 1), h.m(c.parentNode, c)) : h = null), /*timer*/ + g[5] ? p && (group_outros$1(), transition_out$1(p, 1, 1, () => { + p = null; + }), check_outros$1()) : p ? (p.p(g, w), w[0] & /*timer*/ + 32 && transition_in$1(p, 1)) : (p = create_if_block_1$1(g), p.c(), transition_in$1(p, 1), p.m(d.parentNode, d)); }, i(g) { - p || (transition_in$1(d), transition_in$1(_), p = !0); + _ || (transition_in$1(h), transition_in$1(p), _ = !0); }, o(g) { - transition_out$1(d), transition_out$1(_), p = !1; + transition_out$1(h), transition_out$1(p), _ = !1; }, d(g) { - g && (detach$2(e), detach$2(t), detach$2(a), detach$2(o), detach$2(u)), m && m.d(g), b && b.d(), A && A.d(), ~l && s[l].d(g), _ && _.d(g); + g && (detach$2(e), detach$2(t), detach$2(a), detach$2(c), detach$2(d)), m && m.d(g), b && b.d(), A && A.d(), ~l && s[l].d(g), p && p.d(g); } }; } @@ -45991,36 +46134,36 @@ function create_if_block_14(n) { let e, t = ( /*queue_position*/ n[2] + 1 + "" - ), r, a, l, d; + ), r, a, l, h; return { c() { e = text$2("queue: "), r = text$2(t), a = text$2("/"), l = text$2( /*queue_size*/ n[3] - ), d = text$2(" |"); + ), h = text$2(" |"); }, - l(o) { - e = claim_text$2(o, "queue: "), r = claim_text$2(o, t), a = claim_text$2(o, "/"), l = claim_text$2( - o, + l(c) { + e = claim_text$2(c, "queue: "), r = claim_text$2(c, t), a = claim_text$2(c, "/"), l = claim_text$2( + c, /*queue_size*/ n[3] - ), d = claim_text$2(o, " |"); + ), h = claim_text$2(c, " |"); }, - m(o, u) { - insert_hydration$2(o, e, u), insert_hydration$2(o, r, u), insert_hydration$2(o, a, u), insert_hydration$2(o, l, u), insert_hydration$2(o, d, u); + m(c, d) { + insert_hydration$2(c, e, d), insert_hydration$2(c, r, d), insert_hydration$2(c, a, d), insert_hydration$2(c, l, d), insert_hydration$2(c, h, d); }, - p(o, u) { - u[0] & /*queue_position*/ + p(c, d) { + d[0] & /*queue_position*/ 4 && t !== (t = /*queue_position*/ - o[2] + 1 + "") && set_data$1(r, t), u[0] & /*queue_size*/ + c[2] + 1 + "") && set_data$1(r, t), d[0] & /*queue_size*/ 8 && set_data$1( l, /*queue_size*/ - o[3] + c[3] ); }, - d(o) { - o && (detach$2(e), detach$2(r), detach$2(a), detach$2(l), detach$2(d)); + d(c) { + c && (detach$2(e), detach$2(r), detach$2(a), detach$2(l), detach$2(h)); } }; } @@ -46043,8 +46186,8 @@ function create_if_block_11(n) { e = empty$1(); }, m(a, l) { - for (let d = 0; d < r.length; d += 1) - r[d] && r[d].m(a, l); + for (let h = 0; h < r.length; h += 1) + r[h] && r[h].m(a, l); insert_hydration$2(a, e, l); }, p(a, l) { @@ -46054,13 +46197,13 @@ function create_if_block_11(n) { /*progress*/ a[7] ); - let d; - for (d = 0; d < t.length; d += 1) { - const o = get_each_context_1(a, t, d); - r[d] ? r[d].p(o, l) : (r[d] = create_each_block_1(o), r[d].c(), r[d].m(e.parentNode, e)); + let h; + for (h = 0; h < t.length; h += 1) { + const c = get_each_context_1(a, t, h); + r[h] ? r[h].p(c, l) : (r[h] = create_each_block_1(c), r[h].c(), r[h].m(e.parentNode, e)); } - for (; d < r.length; d += 1) - r[d].d(1); + for (; h < r.length; h += 1) + r[h].d(1); r.length = t.length; } }, @@ -46073,31 +46216,31 @@ function create_if_block_12(n) { let e, t = ( /*p*/ n[41].unit + "" - ), r, a, l = " ", d; - function o(m, y) { + ), r, a, l = " ", h; + function c(m, y) { return ( /*p*/ m[41].length != null ? create_if_block_13 : create_else_block$1 ); } - let u = o(n), p = u(n); + let d = c(n), _ = d(n); return { c() { - p.c(), e = space$1(), r = text$2(t), a = text$2(" | "), d = text$2(l); + _.c(), e = space$1(), r = text$2(t), a = text$2(" | "), h = text$2(l); }, l(m) { - p.l(m), e = claim_space$1(m), r = claim_text$2(m, t), a = claim_text$2(m, " | "), d = claim_text$2(m, l); + _.l(m), e = claim_space$1(m), r = claim_text$2(m, t), a = claim_text$2(m, " | "), h = claim_text$2(m, l); }, m(m, y) { - p.m(m, y), insert_hydration$2(m, e, y), insert_hydration$2(m, r, y), insert_hydration$2(m, a, y), insert_hydration$2(m, d, y); + _.m(m, y), insert_hydration$2(m, e, y), insert_hydration$2(m, r, y), insert_hydration$2(m, a, y), insert_hydration$2(m, h, y); }, p(m, y) { - u === (u = o(m)) && p ? p.p(m, y) : (p.d(1), p = u(m), p && (p.c(), p.m(e.parentNode, e))), y[0] & /*progress*/ + d === (d = c(m)) && _ ? _.p(m, y) : (_.d(1), _ = d(m), _ && (_.c(), _.m(e.parentNode, e))), y[0] & /*progress*/ 128 && t !== (t = /*p*/ m[41].unit + "") && set_data$1(r, t); }, d(m) { - m && (detach$2(e), detach$2(r), detach$2(a), detach$2(d)), p.d(m); + m && (detach$2(e), detach$2(r), detach$2(a), detach$2(h)), _.d(m); } }; } @@ -46140,25 +46283,25 @@ function create_if_block_13(n) { c() { t = text$2(e), r = text$2("/"), l = text$2(a); }, - l(d) { - t = claim_text$2(d, e), r = claim_text$2(d, "/"), l = claim_text$2(d, a); + l(h) { + t = claim_text$2(h, e), r = claim_text$2(h, "/"), l = claim_text$2(h, a); }, - m(d, o) { - insert_hydration$2(d, t, o), insert_hydration$2(d, r, o), insert_hydration$2(d, l, o); + m(h, c) { + insert_hydration$2(h, t, c), insert_hydration$2(h, r, c), insert_hydration$2(h, l, c); }, - p(d, o) { - o[0] & /*progress*/ + p(h, c) { + c[0] & /*progress*/ 128 && e !== (e = pretty_si( /*p*/ - d[41].index || 0 - ) + "") && set_data$1(t, e), o[0] & /*progress*/ + h[41].index || 0 + ) + "") && set_data$1(t, e), c[0] & /*progress*/ 128 && a !== (a = pretty_si( /*p*/ - d[41].length + h[41].length ) + "") && set_data$1(l, a); }, - d(d) { - d && (detach$2(t), detach$2(r), detach$2(l)); + d(h) { + h && (detach$2(t), detach$2(r), detach$2(l)); } }; } @@ -46206,16 +46349,16 @@ function create_if_block_10(n) { n[20] ), r = claim_text$2(l, t), a = claim_text$2(l, "s"); }, - m(l, d) { - insert_hydration$2(l, e, d), insert_hydration$2(l, r, d), insert_hydration$2(l, a, d); + m(l, h) { + insert_hydration$2(l, e, h), insert_hydration$2(l, r, h), insert_hydration$2(l, a, h); }, - p(l, d) { - d[0] & /*formatted_timer*/ + p(l, h) { + h[0] & /*formatted_timer*/ 1048576 && set_data$1( e, /*formatted_timer*/ l[20] - ), d[0] & /*eta, formatted_eta*/ + ), h[0] & /*eta, formatted_eta*/ 524289 && t !== (t = /*eta*/ l[0] ? `/${/*formatted_eta*/ l[19]}` : "") && set_data$1(r, t); @@ -46260,40 +46403,40 @@ function create_if_block_9(n) { }; } function create_if_block_2(n) { - let e, t, r, a, l, d = `${/*last_progress_level*/ - n[15] * 100}%`, o = ( + let e, t, r, a, l, h = `${/*last_progress_level*/ + n[15] * 100}%`, c = ( /*progress*/ n[7] != null && create_if_block_3(n) ); return { c() { - e = element$2("div"), t = element$2("div"), o && o.c(), r = space$1(), a = element$2("div"), l = element$2("div"), this.h(); + e = element$2("div"), t = element$2("div"), c && c.c(), r = space$1(), a = element$2("div"), l = element$2("div"), this.h(); }, - l(u) { - e = claim_element$2(u, "DIV", { class: !0 }); - var p = children$2(e); - t = claim_element$2(p, "DIV", { class: !0 }); + l(d) { + e = claim_element$2(d, "DIV", { class: !0 }); + var _ = children$2(e); + t = claim_element$2(_, "DIV", { class: !0 }); var m = children$2(t); - o && o.l(m), m.forEach(detach$2), r = claim_space$1(p), a = claim_element$2(p, "DIV", { class: !0 }); + c && c.l(m), m.forEach(detach$2), r = claim_space$1(_), a = claim_element$2(_, "DIV", { class: !0 }); var y = children$2(a); - l = claim_element$2(y, "DIV", { class: !0 }), children$2(l).forEach(detach$2), y.forEach(detach$2), p.forEach(detach$2), this.h(); + l = claim_element$2(y, "DIV", { class: !0 }), children$2(l).forEach(detach$2), y.forEach(detach$2), _.forEach(detach$2), this.h(); }, h() { - attr$2(t, "class", "progress-level-inner svelte-17v219f"), attr$2(l, "class", "progress-bar svelte-17v219f"), set_style(l, "width", d), attr$2(a, "class", "progress-bar-wrap svelte-17v219f"), attr$2(e, "class", "progress-level svelte-17v219f"); + attr$2(t, "class", "progress-level-inner svelte-17v219f"), attr$2(l, "class", "progress-bar svelte-17v219f"), set_style(l, "width", h), attr$2(a, "class", "progress-bar-wrap svelte-17v219f"), attr$2(e, "class", "progress-level svelte-17v219f"); }, - m(u, p) { - insert_hydration$2(u, e, p), append_hydration$2(e, t), o && o.m(t, null), append_hydration$2(e, r), append_hydration$2(e, a), append_hydration$2(a, l), n[31](l); + m(d, _) { + insert_hydration$2(d, e, _), append_hydration$2(e, t), c && c.m(t, null), append_hydration$2(e, r), append_hydration$2(e, a), append_hydration$2(a, l), n[31](l); }, - p(u, p) { + p(d, _) { /*progress*/ - u[7] != null ? o ? o.p(u, p) : (o = create_if_block_3(u), o.c(), o.m(t, null)) : o && (o.d(1), o = null), p[0] & /*last_progress_level*/ - 32768 && d !== (d = `${/*last_progress_level*/ - u[15] * 100}%`) && set_style(l, "width", d); + d[7] != null ? c ? c.p(d, _) : (c = create_if_block_3(d), c.c(), c.m(t, null)) : c && (c.d(1), c = null), _[0] & /*last_progress_level*/ + 32768 && h !== (h = `${/*last_progress_level*/ + d[15] * 100}%`) && set_style(l, "width", h); }, i: noop$2, o: noop$2, - d(u) { - u && detach$2(e), o && o.d(), n[31](null); + d(d) { + d && detach$2(e), c && c.d(), n[31](null); } }; } @@ -46316,8 +46459,8 @@ function create_if_block_3(n) { e = empty$1(); }, m(a, l) { - for (let d = 0; d < r.length; d += 1) - r[d] && r[d].m(a, l); + for (let h = 0; h < r.length; h += 1) + r[h] && r[h].m(a, l); insert_hydration$2(a, e, l); }, p(a, l) { @@ -46327,13 +46470,13 @@ function create_if_block_3(n) { /*progress*/ a[7] ); - let d; - for (d = 0; d < t.length; d += 1) { - const o = get_each_context$1(a, t, d); - r[d] ? r[d].p(o, l) : (r[d] = create_each_block$1(o), r[d].c(), r[d].m(e.parentNode, e)); + let h; + for (h = 0; h < t.length; h += 1) { + const c = get_each_context$1(a, t, h); + r[h] ? r[h].p(c, l) : (r[h] = create_each_block$1(c), r[h].c(), r[h].m(e.parentNode, e)); } - for (; d < r.length; d += 1) - r[d].d(1); + for (; h < r.length; h += 1) + r[h].d(1); r.length = t.length; } }, @@ -46346,10 +46489,10 @@ function create_if_block_4(n) { let e, t, r, a, l = ( /*i*/ n[43] !== 0 && create_if_block_8() - ), d = ( + ), h = ( /*p*/ n[41].desc != null && create_if_block_7(n) - ), o = ( + ), c = ( /*p*/ n[41].desc != null && /*progress_level*/ n[14] && /*progress_level*/ @@ -46357,33 +46500,33 @@ function create_if_block_4(n) { /*i*/ n[43] ] != null && create_if_block_6() - ), u = ( + ), d = ( /*progress_level*/ n[14] != null && create_if_block_5(n) ); return { c() { - l && l.c(), e = space$1(), d && d.c(), t = space$1(), o && o.c(), r = space$1(), u && u.c(), a = empty$1(); + l && l.c(), e = space$1(), h && h.c(), t = space$1(), c && c.c(), r = space$1(), d && d.c(), a = empty$1(); }, - l(p) { - l && l.l(p), e = claim_space$1(p), d && d.l(p), t = claim_space$1(p), o && o.l(p), r = claim_space$1(p), u && u.l(p), a = empty$1(); + l(_) { + l && l.l(_), e = claim_space$1(_), h && h.l(_), t = claim_space$1(_), c && c.l(_), r = claim_space$1(_), d && d.l(_), a = empty$1(); }, - m(p, m) { - l && l.m(p, m), insert_hydration$2(p, e, m), d && d.m(p, m), insert_hydration$2(p, t, m), o && o.m(p, m), insert_hydration$2(p, r, m), u && u.m(p, m), insert_hydration$2(p, a, m); + m(_, m) { + l && l.m(_, m), insert_hydration$2(_, e, m), h && h.m(_, m), insert_hydration$2(_, t, m), c && c.m(_, m), insert_hydration$2(_, r, m), d && d.m(_, m), insert_hydration$2(_, a, m); }, - p(p, m) { + p(_, m) { /*p*/ - p[41].desc != null ? d ? d.p(p, m) : (d = create_if_block_7(p), d.c(), d.m(t.parentNode, t)) : d && (d.d(1), d = null), /*p*/ - p[41].desc != null && /*progress_level*/ - p[14] && /*progress_level*/ - p[14][ + _[41].desc != null ? h ? h.p(_, m) : (h = create_if_block_7(_), h.c(), h.m(t.parentNode, t)) : h && (h.d(1), h = null), /*p*/ + _[41].desc != null && /*progress_level*/ + _[14] && /*progress_level*/ + _[14][ /*i*/ - p[43] - ] != null ? o || (o = create_if_block_6(), o.c(), o.m(r.parentNode, r)) : o && (o.d(1), o = null), /*progress_level*/ - p[14] != null ? u ? u.p(p, m) : (u = create_if_block_5(p), u.c(), u.m(a.parentNode, a)) : u && (u.d(1), u = null); + _[43] + ] != null ? c || (c = create_if_block_6(), c.c(), c.m(r.parentNode, r)) : c && (c.d(1), c = null), /*progress_level*/ + _[14] != null ? d ? d.p(_, m) : (d = create_if_block_5(_), d.c(), d.m(a.parentNode, a)) : d && (d.d(1), d = null); }, - d(p) { - p && (detach$2(e), detach$2(t), detach$2(r), detach$2(a)), l && l.d(p), d && d.d(p), o && o.d(p), u && u.d(p); + d(_) { + _ && (detach$2(e), detach$2(t), detach$2(r), detach$2(a)), l && l.d(_), h && h.d(_), c && c.d(_), d && d.d(_); } }; } @@ -46514,7 +46657,7 @@ function create_if_block_1$1(n) { const l = ( /*#slots*/ n[30]["additional-loading-text"] - ), d = create_slot( + ), h = create_slot( l, n, /*$$scope*/ @@ -46526,78 +46669,78 @@ function create_if_block_1$1(n) { e = element$2("p"), t = text$2( /*loading_text*/ n[9] - ), r = space$1(), d && d.c(), this.h(); + ), r = space$1(), h && h.c(), this.h(); }, - l(o) { - e = claim_element$2(o, "P", { class: !0 }); - var u = children$2(e); + l(c) { + e = claim_element$2(c, "P", { class: !0 }); + var d = children$2(e); t = claim_text$2( - u, + d, /*loading_text*/ n[9] - ), u.forEach(detach$2), r = claim_space$1(o), d && d.l(o), this.h(); + ), d.forEach(detach$2), r = claim_space$1(c), h && h.l(c), this.h(); }, h() { attr$2(e, "class", "loading svelte-17v219f"); }, - m(o, u) { - insert_hydration$2(o, e, u), append_hydration$2(e, t), insert_hydration$2(o, r, u), d && d.m(o, u), a = !0; + m(c, d) { + insert_hydration$2(c, e, d), append_hydration$2(e, t), insert_hydration$2(c, r, d), h && h.m(c, d), a = !0; }, - p(o, u) { - (!a || u[0] & /*loading_text*/ + p(c, d) { + (!a || d[0] & /*loading_text*/ 512) && set_data$1( t, /*loading_text*/ - o[9] - ), d && d.p && (!a || u[0] & /*$$scope*/ + c[9] + ), h && h.p && (!a || d[0] & /*$$scope*/ 536870912) && update_slot_base( - d, + h, l, - o, + c, /*$$scope*/ - o[29], + c[29], a ? get_slot_changes( l, /*$$scope*/ - o[29], - u, + c[29], + d, get_additional_loading_text_slot_changes ) : get_all_dirty_from_scope( /*$$scope*/ - o[29] + c[29] ), get_additional_loading_text_slot_context ); }, - i(o) { - a || (transition_in$1(d, o), a = !0); + i(c) { + a || (transition_in$1(h, c), a = !0); }, - o(o) { - transition_out$1(d, o), a = !1; + o(c) { + transition_out$1(h, c), a = !1; }, - d(o) { - o && (detach$2(e), detach$2(r)), d && d.d(o); + d(c) { + c && (detach$2(e), detach$2(r)), h && h.d(c); } }; } function create_fragment$2(n) { let e, t, r, a, l; - const d = [create_if_block$1, create_if_block_17], o = []; - function u(p, m) { + const h = [create_if_block$1, create_if_block_17], c = []; + function d(_, m) { return ( /*status*/ - p[4] === "pending" ? 0 : ( + _[4] === "pending" ? 0 : ( /*status*/ - p[4] === "error" ? 1 : -1 + _[4] === "error" ? 1 : -1 ) ); } - return ~(t = u(n)) && (r = o[t] = d[t](n)), { + return ~(t = d(n)) && (r = c[t] = h[t](n)), { c() { e = element$2("div"), r && r.c(), this.h(); }, - l(p) { - e = claim_element$2(p, "DIV", { class: !0 }); + l(_) { + e = claim_element$2(_, "DIV", { class: !0 }); var m = children$2(e); r && r.l(m), m.forEach(detach$2), this.h(); }, @@ -46640,94 +46783,94 @@ function create_fragment$2(n) { n[10] ? "0" : "var(--size-8) 0" ); }, - m(p, m) { - insert_hydration$2(p, e, m), ~t && o[t].m(e, null), n[33](e), l = !0; + m(_, m) { + insert_hydration$2(_, e, m), ~t && c[t].m(e, null), n[33](e), l = !0; }, - p(p, m) { + p(_, m) { let y = t; - t = u(p), t === y ? ~t && o[t].p(p, m) : (r && (group_outros$1(), transition_out$1(o[y], 1, 1, () => { - o[y] = null; - }), check_outros$1()), ~t ? (r = o[t], r ? r.p(p, m) : (r = o[t] = d[t](p), r.c()), transition_in$1(r, 1), r.m(e, null)) : r = null), (!l || m[0] & /*variant, show_progress*/ + t = d(_), t === y ? ~t && c[t].p(_, m) : (r && (group_outros$1(), transition_out$1(c[y], 1, 1, () => { + c[y] = null; + }), check_outros$1()), ~t ? (r = c[t], r ? r.p(_, m) : (r = c[t] = h[t](_), r.c()), transition_in$1(r, 1), r.m(e, null)) : r = null), (!l || m[0] & /*variant, show_progress*/ 320 && a !== (a = "wrap " + /*variant*/ - p[8] + " " + /*show_progress*/ - p[6] + " svelte-17v219f")) && attr$2(e, "class", a), (!l || m[0] & /*variant, show_progress, status, show_progress*/ + _[8] + " " + /*show_progress*/ + _[6] + " svelte-17v219f")) && attr$2(e, "class", a), (!l || m[0] & /*variant, show_progress, status, show_progress*/ 336) && toggle_class$1(e, "hide", !/*status*/ - p[4] || /*status*/ - p[4] === "complete" || /*show_progress*/ - p[6] === "hidden" || /*status*/ - p[4] == "streaming"), (!l || m[0] & /*variant, show_progress, variant, status, translucent, show_progress*/ + _[4] || /*status*/ + _[4] === "complete" || /*show_progress*/ + _[6] === "hidden" || /*status*/ + _[4] == "streaming"), (!l || m[0] & /*variant, show_progress, variant, status, translucent, show_progress*/ 2384) && toggle_class$1( e, "translucent", /*variant*/ - p[8] === "center" && /*status*/ - (p[4] === "pending" || /*status*/ - p[4] === "error") || /*translucent*/ - p[11] || /*show_progress*/ - p[6] === "minimal" + _[8] === "center" && /*status*/ + (_[4] === "pending" || /*status*/ + _[4] === "error") || /*translucent*/ + _[11] || /*show_progress*/ + _[6] === "minimal" ), (!l || m[0] & /*variant, show_progress, status, show_progress*/ 336) && toggle_class$1( e, "generating", /*status*/ - p[4] === "generating" && /*show_progress*/ - p[6] === "full" + _[4] === "generating" && /*show_progress*/ + _[6] === "full" ), (!l || m[0] & /*variant, show_progress, border*/ 4416) && toggle_class$1( e, "border", /*border*/ - p[12] + _[12] ), m[0] & /*absolute*/ 1024 && set_style( e, "position", /*absolute*/ - p[10] ? "absolute" : "static" + _[10] ? "absolute" : "static" ), m[0] & /*absolute*/ 1024 && set_style( e, "padding", /*absolute*/ - p[10] ? "0" : "var(--size-8) 0" + _[10] ? "0" : "var(--size-8) 0" ); }, - i(p) { + i(_) { l || (transition_in$1(r), l = !0); }, - o(p) { + o(_) { transition_out$1(r), l = !1; }, - d(p) { - p && detach$2(e), ~t && o[t].d(), n[33](null); + d(_) { + _ && detach$2(e), ~t && c[t].d(), n[33](null); } }; } var __awaiter = function(n, e, t, r) { function a(l) { - return l instanceof t ? l : new t(function(d) { - d(l); + return l instanceof t ? l : new t(function(h) { + h(l); }); } - return new (t || (t = Promise))(function(l, d) { - function o(m) { + return new (t || (t = Promise))(function(l, h) { + function c(m) { try { - p(r.next(m)); + _(r.next(m)); } catch (y) { - d(y); + h(y); } } - function u(m) { + function d(m) { try { - p(r.throw(m)); + _(r.throw(m)); } catch (y) { - d(y); + h(y); } } - function p(m) { - m.done ? l(m.value) : a(m.value).then(o, u); + function _(m) { + m.done ? l(m.value) : a(m.value).then(c, d); } - p((r = r.apply(n, e || [])).next()); + _((r = r.apply(n, e || [])).next()); }); }; let items = [], called = !1; @@ -46741,8 +46884,8 @@ function scroll_into_view(n) { yield tick(), raf(() => { let r = [0, 0]; for (let a = 0; a < items.length; a++) { - const d = items[a].getBoundingClientRect(); - (a === 0 || d.top + window.scrollY <= r[0]) && (r[0] = d.top + window.scrollY, r[1] = a); + const h = items[a].getBoundingClientRect(); + (a === 0 || h.top + window.scrollY <= r[0]) && (r[0] = h.top + window.scrollY, r[1] = a); } window.scrollTo({ top: r[0] - 20, behavior: "smooth" }), called = !1, items = []; }); @@ -46752,10 +46895,10 @@ function scroll_into_view(n) { function instance$2(n, e, t) { let r, { $$slots: a = {}, $$scope: l } = e; this && this.__awaiter; - const d = createEventDispatcher(); - let { i18n: o } = e, { eta: u = null } = e, { queue_position: p } = e, { queue_size: m } = e, { status: y } = e, { scroll_to_output: w = !1 } = e, { timer: b = !0 } = e, { show_progress: A = "full" } = e, { message: f = null } = e, { progress: s = null } = e, { variant: h = "default" } = e, { loading_text: _ = "Loading..." } = e, { absolute: g = !0 } = e, { translucent: x = !1 } = e, { border: c = !1 } = e, { autoscroll: v } = e, M, E = !1, $ = 0, k = 0, L = null, z = null, O = 0, R = null, P, U = null, B = !0; - const N = () => { - t(0, u = t(27, L = t(19, W = null))), t(25, $ = performance.now()), t(26, k = 0), E = !0, G(); + const h = createEventDispatcher(); + let { i18n: c } = e, { eta: d = null } = e, { queue_position: _ } = e, { queue_size: m } = e, { status: y } = e, { scroll_to_output: x = !1 } = e, { timer: b = !0 } = e, { show_progress: A = "full" } = e, { message: f = null } = e, { progress: s = null } = e, { variant: u = "default" } = e, { loading_text: p = "Loading..." } = e, { absolute: g = !0 } = e, { translucent: w = !1 } = e, { border: o = !1 } = e, { autoscroll: v } = e, M, E = !1, $ = 0, k = 0, L = null, z = null, O = 0, R = null, N, W = null, B = !0; + const P = () => { + t(0, d = t(27, L = t(19, U = null))), t(25, $ = performance.now()), t(26, k = 0), E = !0, G(); }; function G() { raf(() => { @@ -46763,66 +46906,66 @@ function instance$2(n, e, t) { }); } function H() { - t(26, k = 0), t(0, u = t(27, L = t(19, W = null))), E && (E = !1); + t(26, k = 0), t(0, d = t(27, L = t(19, U = null))), E && (E = !1); } onDestroy(() => { E && H(); }); - let W = null; - function V(ee) { - binding_callbacks[ee ? "unshift" : "push"](() => { - U = ee, t(16, U), t(7, s), t(14, R), t(15, P); + let U = null; + function j(te) { + binding_callbacks[te ? "unshift" : "push"](() => { + W = te, t(16, W), t(7, s), t(14, R), t(15, N); }); } const re = () => { - d("clear_status"); + h("clear_status"); }; - function ie(ee) { - binding_callbacks[ee ? "unshift" : "push"](() => { - M = ee, t(13, M); + function ie(te) { + binding_callbacks[te ? "unshift" : "push"](() => { + M = te, t(13, M); }); } - return n.$$set = (ee) => { - "i18n" in ee && t(1, o = ee.i18n), "eta" in ee && t(0, u = ee.eta), "queue_position" in ee && t(2, p = ee.queue_position), "queue_size" in ee && t(3, m = ee.queue_size), "status" in ee && t(4, y = ee.status), "scroll_to_output" in ee && t(22, w = ee.scroll_to_output), "timer" in ee && t(5, b = ee.timer), "show_progress" in ee && t(6, A = ee.show_progress), "message" in ee && t(23, f = ee.message), "progress" in ee && t(7, s = ee.progress), "variant" in ee && t(8, h = ee.variant), "loading_text" in ee && t(9, _ = ee.loading_text), "absolute" in ee && t(10, g = ee.absolute), "translucent" in ee && t(11, x = ee.translucent), "border" in ee && t(12, c = ee.border), "autoscroll" in ee && t(24, v = ee.autoscroll), "$$scope" in ee && t(29, l = ee.$$scope); + return n.$$set = (te) => { + "i18n" in te && t(1, c = te.i18n), "eta" in te && t(0, d = te.eta), "queue_position" in te && t(2, _ = te.queue_position), "queue_size" in te && t(3, m = te.queue_size), "status" in te && t(4, y = te.status), "scroll_to_output" in te && t(22, x = te.scroll_to_output), "timer" in te && t(5, b = te.timer), "show_progress" in te && t(6, A = te.show_progress), "message" in te && t(23, f = te.message), "progress" in te && t(7, s = te.progress), "variant" in te && t(8, u = te.variant), "loading_text" in te && t(9, p = te.loading_text), "absolute" in te && t(10, g = te.absolute), "translucent" in te && t(11, w = te.translucent), "border" in te && t(12, o = te.border), "autoscroll" in te && t(24, v = te.autoscroll), "$$scope" in te && t(29, l = te.$$scope); }, n.$$.update = () => { n.$$.dirty[0] & /*eta, old_eta, timer_start, eta_from_start*/ - 436207617 && (u === null && t(0, u = L), u != null && L !== u && (t(28, z = (performance.now() - $) / 1e3 + u), t(19, W = z.toFixed(1)), t(27, L = u))), n.$$.dirty[0] & /*eta_from_start, timer_diff*/ + 436207617 && (d === null && t(0, d = L), d != null && L !== d && (t(28, z = (performance.now() - $) / 1e3 + d), t(19, U = z.toFixed(1)), t(27, L = d))), n.$$.dirty[0] & /*eta_from_start, timer_diff*/ 335544320 && t(17, O = z === null || z <= 0 || !k ? null : Math.min(k / z, 1)), n.$$.dirty[0] & /*progress*/ 128 && s != null && t(18, B = !1), n.$$.dirty[0] & /*progress, progress_level, progress_bar, last_progress_level*/ - 114816 && (s != null ? t(14, R = s.map((ee) => { - if (ee.index != null && ee.length != null) - return ee.index / ee.length; - if (ee.progress != null) - return ee.progress; - })) : t(14, R = null), R ? (t(15, P = R[R.length - 1]), U && (P === 0 ? t(16, U.style.transition = "0", U) : t(16, U.style.transition = "150ms", U))) : t(15, P = void 0)), n.$$.dirty[0] & /*status*/ - 16 && (y === "pending" ? N() : H()), n.$$.dirty[0] & /*el, scroll_to_output, status, autoscroll*/ - 20979728 && M && w && (y === "pending" || y === "complete") && scroll_into_view(M, v), n.$$.dirty[0] & /*status, message*/ + 114816 && (s != null ? t(14, R = s.map((te) => { + if (te.index != null && te.length != null) + return te.index / te.length; + if (te.progress != null) + return te.progress; + })) : t(14, R = null), R ? (t(15, N = R[R.length - 1]), W && (N === 0 ? t(16, W.style.transition = "0", W) : t(16, W.style.transition = "150ms", W))) : t(15, N = void 0)), n.$$.dirty[0] & /*status*/ + 16 && (y === "pending" ? P() : H()), n.$$.dirty[0] & /*el, scroll_to_output, status, autoscroll*/ + 20979728 && M && x && (y === "pending" || y === "complete") && scroll_into_view(M, v), n.$$.dirty[0] & /*status, message*/ 8388624, n.$$.dirty[0] & /*timer_diff*/ 67108864 && t(20, r = k.toFixed(1)); }, [ - u, - o, - p, + d, + c, + _, m, y, b, A, s, - h, - _, + u, + p, g, - x, - c, + w, + o, M, R, - P, - U, + N, + W, O, B, - W, + U, r, - d, - w, + h, + x, f, v, $, @@ -46831,7 +46974,7 @@ function instance$2(n, e, t) { z, l, a, - V, + j, re, ie ]; @@ -46969,8 +47112,8 @@ function create_fragment$1(n) { } function instance$1(n, e, t) { let { value: r } = e, { type: a } = e, { selected: l = !1 } = e; - return n.$$set = (d) => { - "value" in d && t(0, r = d.value), "type" in d && t(1, a = d.type), "selected" in d && t(2, l = d.selected); + return n.$$set = (h) => { + "value" in h && t(0, r = h.value), "type" in h && t(1, a = h.type), "selected" in h && t(2, l = h.selected); }, [r, a, l]; } class Example extends SvelteComponent$1 { @@ -47323,7 +47466,7 @@ function create_default_slot_1(n) { }; } function create_if_block(n) { - let e, t, r, a, l, d = "Error in the representations", o, u, p, m = "Couldn't display Molecule. Fix the following problems:", y, w, b = ensure_array_like( + let e, t, r, a, l, h = "Error in the representations", c, d, _, m = "Couldn't display Molecule. Fix the following problems:", y, x, b = ensure_array_like( /*errors*/ n[22] ), A = []; @@ -47331,7 +47474,7 @@ function create_if_block(n) { A[f] = create_each_block(get_each_context(n, b, f)); return { c() { - e = element("div"), t = svg_element("svg"), r = svg_element("path"), a = space(), l = element("span"), l.textContent = d, o = space(), u = element("div"), p = element("span"), p.textContent = m, y = space(), w = element("ul"); + e = element("div"), t = svg_element("svg"), r = svg_element("path"), a = space(), l = element("span"), l.textContent = h, c = space(), d = element("div"), _ = element("span"), _.textContent = m, y = space(), x = element("ul"); for (let f = 0; f < A.length; f += 1) A[f].c(); this.h(); @@ -47347,26 +47490,26 @@ function create_if_block(n) { "stroke-width": !0, stroke: !0 }); - var h = children(t); - r = claim_svg_element(h, "path", { + var u = children(t); + r = claim_svg_element(u, "path", { "stroke-linecap": !0, "stroke-linejoin": !0, d: !0 - }), children(r).forEach(detach), h.forEach(detach), a = claim_space(s), l = claim_element(s, "SPAN", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset(l) !== "svelte-jj7i23" && (l.textContent = d), o = claim_space(s), u = claim_element(s, "DIV", {}); - var _ = children(u); - p = claim_element(_, "SPAN", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset(p) !== "svelte-6hdql9" && (p.textContent = m), y = claim_space(_), w = claim_element(_, "UL", { class: !0 }); - var g = children(w); - for (let x = 0; x < A.length; x += 1) - A[x].l(g); - g.forEach(detach), _.forEach(detach), s.forEach(detach), this.h(); + }), children(r).forEach(detach), u.forEach(detach), a = claim_space(s), l = claim_element(s, "SPAN", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset(l) !== "svelte-jj7i23" && (l.textContent = h), c = claim_space(s), d = claim_element(s, "DIV", {}); + var p = children(d); + _ = claim_element(p, "SPAN", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset(_) !== "svelte-6hdql9" && (_.textContent = m), y = claim_space(p), x = claim_element(p, "UL", { class: !0 }); + var g = children(x); + for (let w = 0; w < A.length; w += 1) + A[w].l(g); + g.forEach(detach), p.forEach(detach), s.forEach(detach), this.h(); }, h() { - attr(r, "stroke-linecap", "round"), attr(r, "stroke-linejoin", "round"), attr(r, "d", "M12 9v3.75m-9.303 3.376c-.866 1.5.217 3.374 1.948 3.374h14.71c1.73 0 2.813-1.874 1.948-3.374L13.949 3.378c-.866-1.5-3.032-1.5-3.898 0L2.697 16.126zM12 15.75h.007v.008H12v-.008z"), attr(t, "class", "flex-shrink-0 inline w-4 h-4 mr-3 mt-[2px]"), attr(t, "xmlns", "http://www.w3.org/2000/svg"), attr(t, "fill", "none"), attr(t, "viewBox", "0 0 24 24"), attr(t, "stroke-width", "1.5"), attr(t, "stroke", "currentColor"), attr(l, "class", "sr-only"), attr(p, "class", "font-medium"), attr(w, "class", "mt-1.5 ml-4 list-disc list-inside"), attr(e, "class", "flex m-2 p-4 mb-4 text-sm text-red-800 rounded-lg bg-red-50 dark:bg-gray-800 dark:text-red-400"), attr(e, "role", "alert"); + attr(r, "stroke-linecap", "round"), attr(r, "stroke-linejoin", "round"), attr(r, "d", "M12 9v3.75m-9.303 3.376c-.866 1.5.217 3.374 1.948 3.374h14.71c1.73 0 2.813-1.874 1.948-3.374L13.949 3.378c-.866-1.5-3.032-1.5-3.898 0L2.697 16.126zM12 15.75h.007v.008H12v-.008z"), attr(t, "class", "flex-shrink-0 inline w-4 h-4 mr-3 mt-[2px]"), attr(t, "xmlns", "http://www.w3.org/2000/svg"), attr(t, "fill", "none"), attr(t, "viewBox", "0 0 24 24"), attr(t, "stroke-width", "1.5"), attr(t, "stroke", "currentColor"), attr(l, "class", "sr-only"), attr(_, "class", "font-medium"), attr(x, "class", "mt-1.5 ml-4 list-disc list-inside"), attr(e, "class", "flex m-2 p-4 mb-4 text-sm text-red-800 rounded-lg bg-red-50 dark:bg-gray-800 dark:text-red-400"), attr(e, "role", "alert"); }, m(f, s) { - insert_hydration(f, e, s), append_hydration(e, t), append_hydration(t, r), append_hydration(e, a), append_hydration(e, l), append_hydration(e, o), append_hydration(e, u), append_hydration(u, p), append_hydration(u, y), append_hydration(u, w); - for (let h = 0; h < A.length; h += 1) - A[h] && A[h].m(w, null); + insert_hydration(f, e, s), append_hydration(e, t), append_hydration(t, r), append_hydration(e, a), append_hydration(e, l), append_hydration(e, c), append_hydration(e, d), append_hydration(d, _), append_hydration(d, y), append_hydration(d, x); + for (let u = 0; u < A.length; u += 1) + A[u] && A[u].m(x, null); }, p(f, s) { if (s[0] & /*errors*/ @@ -47375,13 +47518,13 @@ function create_if_block(n) { /*errors*/ f[22] ); - let h; - for (h = 0; h < b.length; h += 1) { - const _ = get_each_context(f, b, h); - A[h] ? A[h].p(_, s) : (A[h] = create_each_block(_), A[h].c(), A[h].m(w, null)); + let u; + for (u = 0; u < b.length; u += 1) { + const p = get_each_context(f, b, u); + A[u] ? A[u].p(p, s) : (A[u] = create_each_block(p), A[u].c(), A[u].m(x, null)); } - for (; h < A.length; h += 1) - A[h].d(1); + for (; u < A.length; u += 1) + A[u].d(1); A.length = b.length; } }, @@ -47415,8 +47558,8 @@ function create_each_block(n) { } function create_default_slot(n) { var A; - let e, t, r, a, l, d, o; - const u = [ + let e, t, r, a, l, h, c; + const d = [ { autoscroll: ( /*gradio*/ @@ -47436,22 +47579,22 @@ function create_default_slot(n) { ) } ]; - let p = {}; - for (let f = 0; f < u.length; f += 1) - p = assign(p, u[f]); - e = new Static({ props: p }), e.$on( + let _ = {}; + for (let f = 0; f < d.length; f += 1) + _ = assign(_, d[f]); + e = new Static({ props: _ }), e.$on( "clear_status", /*clear_status_handler*/ n[27] ); const m = [create_if_block_1, create_else_block], y = []; - function w(f, s) { + function x(f, s) { return ( /*interactive*/ f[5] ? 1 : 0 ); } - r = w(n), a = y[r] = m[r](n); + r = x(n), a = y[r] = m[r](n); let b = ( /*errors*/ n[22].length > 0 && /*value*/ @@ -47459,18 +47602,18 @@ function create_default_slot(n) { ); return { c() { - create_component(e.$$.fragment), t = space(), a.c(), l = space(), b && b.c(), d = empty(); + create_component(e.$$.fragment), t = space(), a.c(), l = space(), b && b.c(), h = empty(); }, l(f) { - claim_component(e.$$.fragment, f), t = claim_space(f), a.l(f), l = claim_space(f), b && b.l(f), d = empty(); + claim_component(e.$$.fragment, f), t = claim_space(f), a.l(f), l = claim_space(f), b && b.l(f), h = empty(); }, m(f, s) { - mount_component(e, f, s), insert_hydration(f, t, s), y[r].m(f, s), insert_hydration(f, l, s), b && b.m(f, s), insert_hydration(f, d, s), o = !0; + mount_component(e, f, s), insert_hydration(f, t, s), y[r].m(f, s), insert_hydration(f, l, s), b && b.m(f, s), insert_hydration(f, h, s), c = !0; }, p(f, s) { var g; - const h = s[0] & /*gradio, loading_status*/ - 131074 ? get_spread_update(u, [ + const u = s[0] & /*gradio, loading_status*/ + 131074 ? get_spread_update(d, [ s[0] & /*gradio*/ 131072 && { autoscroll: ( @@ -47496,22 +47639,22 @@ function create_default_slot(n) { ) } ]) : {}; - e.$set(h); - let _ = r; - r = w(f), r === _ ? y[r].p(f, s) : (group_outros(), transition_out(y[_], 1, 1, () => { - y[_] = null; + e.$set(u); + let p = r; + r = x(f), r === p ? y[r].p(f, s) : (group_outros(), transition_out(y[p], 1, 1, () => { + y[p] = null; }), check_outros(), a = y[r], a ? a.p(f, s) : (a = y[r] = m[r](f), a.c()), transition_in(a, 1), a.m(l.parentNode, l)), /*errors*/ f[22].length > 0 && /*value*/ - f[0] !== null ? b ? b.p(f, s) : (b = create_if_block(f), b.c(), b.m(d.parentNode, d)) : b && (b.d(1), b = null); + f[0] !== null ? b ? b.p(f, s) : (b = create_if_block(f), b.c(), b.m(h.parentNode, h)) : b && (b.d(1), b = null); }, i(f) { - o || (transition_in(e.$$.fragment, f), transition_in(a), o = !0); + c || (transition_in(e.$$.fragment, f), transition_in(a), c = !0); }, o(f) { - transition_out(e.$$.fragment, f), transition_out(a), o = !1; + transition_out(e.$$.fragment, f), transition_out(a), c = !1; }, d(f) { - f && (detach(t), detach(l), detach(d)), destroy_component(e, f), y[r].d(f), b && b.d(f); + f && (detach(t), detach(l), detach(h)), destroy_component(e, f), y[r].d(f), b && b.d(f); } }; } @@ -47600,34 +47743,34 @@ function create_fragment(n) { }; } function instance(n, e, t) { - var r = this && this.__awaiter || function(J, Me, se, Ce) { - function ue(ne) { + var r = this && this.__awaiter || function(J, Ee, se, Ae) { + function he(ne) { return ne instanceof se ? ne : new se(function(_e) { _e(ne); }); } return new (se || (se = Promise))(function(ne, _e) { - function Oe(We) { + function Le(He) { try { - Ue(Ce.next(We)); - } catch (Ee) { - _e(Ee); + Ue(Ae.next(He)); + } catch (We) { + _e(We); } } - function Re(We) { + function Be(He) { try { - Ue(Ce.throw(We)); - } catch (Ee) { - _e(Ee); + Ue(Ae.throw(He)); + } catch (We) { + _e(We); } } - function Ue(We) { - We.done ? ne(We.value) : ue(We.value).then(Oe, Re); + function Ue(He) { + He.done ? ne(He.value) : he(He.value).then(Le, Be); } - Ue((Ce = Ce.apply(J, Me || [])).next()); + Ue((Ae = Ae.apply(J, Ee || [])).next()); }); }; - let { elem_id: a = "" } = e, { elem_classes: l = [] } = e, { visible: d = !0 } = e, { value: o } = e, { interactive: u } = e, { root: p } = e, { label: m } = e, { show_label: y } = e, { height: w = void 0 } = e, { reps: b = [] } = e, { config: A = {} } = e, { confidenceLabel: f = "" } = e, { showviewer: s = !0 } = e, { _selectable: h = !1 } = e, { loading_status: _ } = e, { container: g = !0 } = e, { scale: x = null } = e, { min_width: c = void 0 } = e, { gradio: v } = e, { file_count: M } = e, { file_types: E = ["file"] } = e, $ = o, k = !1, L = { + let { elem_id: a = "" } = e, { elem_classes: l = [] } = e, { visible: h = !0 } = e, { value: c } = e, { interactive: d } = e, { root: _ } = e, { label: m } = e, { show_label: y } = e, { height: x = void 0 } = e, { reps: b = [] } = e, { config: A = {} } = e, { confidenceLabel: f = "" } = e, { showviewer: s = !0 } = e, { _selectable: u = !1 } = e, { loading_status: p } = e, { container: g = !0 } = e, { scale: w = null } = e, { min_width: o = void 0 } = e, { gradio: v } = e, { file_count: M } = e, { file_types: E = ["file"] } = e, $ = c, k = !1, L = { model: { type: Number, default: 0 }, chain: { type: String, default: "" }, resname: { type: String, default: "" }, @@ -47655,6 +47798,7 @@ function instance(n, e, t) { "spectrum" ] }, + opacity: { type: Number, default: 1 }, residue_range: { type: String, default: "" }, around: { type: Number, default: 0 }, byres: { type: Boolean, default: !1 }, @@ -47665,38 +47809,38 @@ function instance(n, e, t) { return yield (yield fetch(J)).text(); }); } - let P = []; - function U(J) { + let N = []; + function W(J) { return r(this, void 0, void 0, function* () { if (J == null) return []; if (Array.isArray(J)) { - let Me = []; + let Ee = []; for (const se of J) { - let Ce = se.orig_name.split(".").pop(); - if (!O.includes(Ce)) { - P.push(`Invalid file extension for ${se.orig_name}. Expected one of ${O.join(", ")}, got ${Ce}`), t(20, z = null); + let Ae = se.orig_name.split(".").pop(); + if (!O.includes(Ae)) { + N.push(`Invalid file extension for ${se.orig_name}. Expected one of ${O.join(", ")}, got ${Ae}`), t(20, z = null); continue; } - Me.push({ + Ee.push({ data: yield R(se.url), name: se.orig_name, - format: Ce, + format: Ae, asFrames: !1 }); } - t(20, z = Me); + t(20, z = Ee); } else if (typeof J == "object" && J !== null) { - let Me = J.orig_name.split(".").pop(); - if (!O.includes(Me)) - P.push(`Invalid file extension for ${J.orig_name}. Expected one of ${O.join(", ")}, got ${Me}`), t(20, z = null); + let Ee = J.orig_name.split(".").pop(); + if (!O.includes(Ee)) + N.push(`Invalid file extension for ${J.orig_name}. Expected one of ${O.join(", ")}, got ${Ee}`), t(20, z = null); else { - let se = yield R(J.url), Ce = J.orig_name.split(".").pop(); - Ce === "pdb1" && (Ce = "pdb"), t(20, z = [ + let se = yield R(J.url), Ae = J.orig_name.split(".").pop(); + Ae === "pdb1" && (Ae = "pdb"), t(20, z = [ { data: se, name: J.orig_name, - format: Ce, + format: Ae, asFrames: !1 } ]); @@ -47705,65 +47849,66 @@ function instance(n, e, t) { t(20, z = null); }); } - let B = 0, N = []; - const G = () => v.dispatch("clear_status", _), H = ({ detail: J }) => v.dispatch("select", J), W = ({ detail: J }) => { - t(0, o = J); - }, V = ({ detail: J }) => t(21, k = J), re = () => v.dispatch("clear"), ie = ({ detail: J }) => v.dispatch("select", J), ee = () => v.dispatch("error", "identifier not found in database, check spelling"), ce = () => v.dispatch("upload"), he = ({ detail: J }) => { - t(1, _ = _ || {}), t(1, _.status = "error", _), v.dispatch("error", J); - }, le = ({ detail: J }) => { + let B = 0, P = []; + const G = () => v.dispatch("clear_status", p), H = ({ detail: J }) => v.dispatch("select", J), U = ({ detail: J }) => { + t(0, c = J); + }, j = ({ detail: J }) => t(21, k = J), re = () => v.dispatch("clear"), ie = ({ detail: J }) => v.dispatch("select", J), te = () => v.dispatch("error", "identifier not found in database, check spelling"), ue = () => v.dispatch("upload"), de = ({ detail: J }) => { + t(1, p = p || {}), t(1, p.status = "error", p), v.dispatch("error", J); + }, oe = ({ detail: J }) => { v.dispatch("delete", J); }; return n.$$set = (J) => { - "elem_id" in J && t(2, a = J.elem_id), "elem_classes" in J && t(3, l = J.elem_classes), "visible" in J && t(4, d = J.visible), "value" in J && t(0, o = J.value), "interactive" in J && t(5, u = J.interactive), "root" in J && t(6, p = J.root), "label" in J && t(7, m = J.label), "show_label" in J && t(8, y = J.show_label), "height" in J && t(9, w = J.height), "reps" in J && t(24, b = J.reps), "config" in J && t(10, A = J.config), "confidenceLabel" in J && t(11, f = J.confidenceLabel), "showviewer" in J && t(12, s = J.showviewer), "_selectable" in J && t(13, h = J._selectable), "loading_status" in J && t(1, _ = J.loading_status), "container" in J && t(14, g = J.container), "scale" in J && t(15, x = J.scale), "min_width" in J && t(16, c = J.min_width), "gradio" in J && t(17, v = J.gradio), "file_count" in J && t(18, M = J.file_count), "file_types" in J && t(19, E = J.file_types); + "elem_id" in J && t(2, a = J.elem_id), "elem_classes" in J && t(3, l = J.elem_classes), "visible" in J && t(4, h = J.visible), "value" in J && t(0, c = J.value), "interactive" in J && t(5, d = J.interactive), "root" in J && t(6, _ = J.root), "label" in J && t(7, m = J.label), "show_label" in J && t(8, y = J.show_label), "height" in J && t(9, x = J.height), "reps" in J && t(24, b = J.reps), "config" in J && t(10, A = J.config), "confidenceLabel" in J && t(11, f = J.confidenceLabel), "showviewer" in J && t(12, s = J.showviewer), "_selectable" in J && t(13, u = J._selectable), "loading_status" in J && t(1, p = J.loading_status), "container" in J && t(14, g = J.container), "scale" in J && t(15, w = J.scale), "min_width" in J && t(16, o = J.min_width), "gradio" in J && t(17, v = J.gradio), "file_count" in J && t(18, M = J.file_count), "file_types" in J && t(19, E = J.file_types); }, n.$$.update = () => { n.$$.dirty[0] & /*old_value, value, gradio*/ - 33685505 && JSON.stringify($) !== JSON.stringify(o) && (v.dispatch("change"), t(25, $ = o), t(20, z = null), U(o)), n.$$.dirty[0] & /*moldata*/ + 33685505 && JSON.stringify($) !== JSON.stringify(c) && (v.dispatch("change"), t(25, $ = c), t(20, z = null), W(c)), n.$$.dirty[0] & /*reps, gradio, value*/ + 16908289 && JSON.stringify(b) !== JSON.stringify(b) && (v.dispatch("change"), t(25, $ = c), t(20, z = null), W(c)), n.$$.dirty[0] & /*moldata*/ 1048576 && t(26, B = z ? z.length : 0), n.$$.dirty[0] & /*reps, lenMoldata*/ 83886080 && (b.forEach((J) => { - for (const [Me, se] of Object.entries(L)) - J[Me] === void 0 && (J[Me] = se.default), J[Me].constructor != se.type && P.push(`Invalid type for ${Me} in reps. Expected ${se.type}, got ${typeof J[Me]}`); + for (const [Ee, se] of Object.entries(L)) + J[Ee] === void 0 && (J[Ee] = se.default), J[Ee].constructor != se.type && N.push(`Invalid type for ${Ee} in reps. Expected ${se.type}, got ${typeof J[Ee]}`); }), b.forEach((J) => { - J.model <= B && N.push(J); + J.model <= B && P.push(J); })), n.$$.dirty[0] & /*value*/ - 1 && U(o); + 1 && W(c); }, [ - o, - _, + c, + p, a, l, + h, d, - u, - p, + _, m, y, - w, + x, A, f, s, - h, + u, g, - x, - c, + w, + o, v, M, E, z, k, - P, N, + P, b, $, B, G, H, - W, - V, + U, + j, re, ie, - ee, - ce, - he, - le + te, + ue, + de, + oe ]; } class Index extends SvelteComponent {