JoaoJunior/python_java_dataset_APR · Datasets at Hugging Face

rem stringlengths 1 226k	add stringlengths 0 227k	context stringlengths 6 326k	meta stringlengths 143 403	input_ids sequencelengths 256 256	attention_mask sequencelengths 256 256	labels sequencelengths 128 128
def errcheck(result, func, arguments): if result < 0: errno = ctypes.get_errno() raise OSError(errno, os.strerror(errno)) return result libc = ctypes.CDLL(ctypes.util.find_library("c"), use_errno=True) libc.inotify_init.argtypes = [] libc.inotify_init.errcheck = errcheck libc.inotify_init1.argtypes = [ctypes.c_int] libc.inotify_init1.errcheck = errcheck libc.inotify_add_watch.argtypes = [ctypes.c_int, ctypes.c_char_p, ctypes.c_uint32] libc.inotify_add_watch.errcheck = errcheck libc.inotify_rm_watch.argtypes = [ctypes.c_int, ctypes.c_int] libc.inotify_rm_watch.errcheck = errcheck		def errcheck(result, func, arguments): if result < 0: errno = ctypes.get_errno() raise OSError(errno, os.strerror(errno)) return result	cd4adef5bbe7c15f648d858e0fd291f85642892b /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/13731/cd4adef5bbe7c15f648d858e0fd291f85642892b/__init__.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 393, 1893, 12, 2088, 16, 1326, 16, 1775, 4672, 309, 563, 411, 374, 30, 8402, 273, 6983, 18, 588, 67, 19088, 1435, 1002, 10002, 12, 19088, 16, 1140, 18, 701, 1636, 12, 19088, 3719, 225, 327, 563, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 393, 1893, 12, 2088, 16, 1326, 16, 1775, 4672, 309, 563, 411, 374, 30, 8402, 273, 6983, 18, 588, 67, 19088, 1435, 1002, 10002, 12, 19088, 16, 1140, 18, 701, 1636, 12, 19088, 3719, 225, 327, 563, 225, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
tf.close()	tf.close()	def createPackedInputSandbox(sandbox_files,inws,name): """Put all sandbox_files into tarball called name and write it into to the input workspace. This function is called by Ganga client at the submission time. Arguments: 'sandbox_files': a list of File or FileBuffer objects. 'inws': a InputFileWorkspace object Return: a list containing a path to the tarball """	3975c813beb1813bd20f0bfbca2b9570fe12bca8 /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/1488/3975c813beb1813bd20f0bfbca2b9570fe12bca8/Sandbox.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 752, 4420, 329, 1210, 17881, 12, 27004, 67, 2354, 16, 267, 4749, 16, 529, 4672, 3536, 6426, 777, 15202, 67, 2354, 1368, 29441, 2566, 508, 471, 1045, 518, 1368, 358, 326, 810, 6003, 18, 1220, 445, 353, 2566, 635, 611, 539, 69, 1004, 622, 326, 8515, 813, 18, 13599, 30, 296, 27004, 67, 2354, 4278, 279, 666, 434, 1387, 578, 1387, 1892, 2184, 18, 296, 267, 4749, 4278, 279, 2741, 812, 8241, 733, 2000, 30, 279, 666, 4191, 279, 589, 358, 326, 29441, 3536, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 752, 4420, 329, 1210, 17881, 12, 27004, 67, 2354, 16, 267, 4749, 16, 529, 4672, 3536, 6426, 777, 15202, 67, 2354, 1368, 29441, 2566, 508, 471, 1045, 518, 1368, 358, 326, 810, 6003, 18, 1220, 445, 353, 2566, 635, 611, 539, 69, 1004, 622, 326, 8515, 813, 18, 13599, 30, 296, 27004, 67, 2354, 4278, 279, 666, 434, 1387, 578, 1387, 1892, 2184, 18, 296, 267, 4749, 4278, 279, 2741, 812, 8241, 733, 2000, 30, 279, 666, 4191, 279, 589, 358, 326, 29441, 3536, 225, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
if not f in self.cexecuted:	if not self.cexecuted.has_key(f):	def canonicalize_filenames(self): for filename, lineno in self.c.keys(): if filename == '<string>': # Can't do anything useful with exec'd strings, so skip them. continue f = self.canonical_filename(filename) if not f in self.cexecuted: self.cexecuted[f] = {} self.cexecuted[f][lineno] = 1 self.c = {}	6554c74cd9574cf89b8acd0a0333651afacbfa8e /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/11312/6554c74cd9574cf89b8acd0a0333651afacbfa8e/coverage.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 25839, 67, 19875, 12, 2890, 4672, 364, 1544, 16, 7586, 316, 365, 18, 71, 18, 2452, 13332, 309, 1544, 422, 2368, 1080, 1870, 30, 468, 4480, 1404, 741, 6967, 5301, 598, 1196, 14271, 2064, 16, 1427, 2488, 2182, 18, 1324, 284, 273, 365, 18, 18288, 67, 3459, 12, 3459, 13, 309, 486, 365, 18, 26155, 557, 4817, 18, 5332, 67, 856, 12, 74, 4672, 365, 18, 26155, 557, 4817, 63, 74, 65, 273, 2618, 365, 18, 26155, 557, 4817, 63, 74, 6362, 17782, 65, 273, 404, 365, 18, 71, 273, 2618, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 25839, 67, 19875, 12, 2890, 4672, 364, 1544, 16, 7586, 316, 365, 18, 71, 18, 2452, 13332, 309, 1544, 422, 2368, 1080, 1870, 30, 468, 4480, 1404, 741, 6967, 5301, 598, 1196, 14271, 2064, 16, 1427, 2488, 2182, 18, 1324, 284, 273, 365, 18, 18288, 67, 3459, 12, 3459, 13, 309, 486, 365, 18, 26155, 557, 4817, 18, 5332, 67, 856, 12, 74, 4672, 365, 18, 26155, 557, 4817, 63, 74, 65, 273, 2618, 365, 18, 26155, 557, 4817, 63, 74, 6362, 17782, 65, 273, 404, 365, 18, 71, 273, 2618, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
Return the quartic twist of this curve by D.	Return the quartic twist of this curve by D, which must be nonzero.	def quartic_twist(self, D): """ Return the quartic twist of this curve by D.	317b135e24525174c25bb62d554be485f9c82093 /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/9417/317b135e24525174c25bb62d554be485f9c82093/ell_generic.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 719, 485, 335, 67, 11246, 376, 12, 2890, 16, 463, 4672, 3536, 2000, 326, 719, 485, 335, 2339, 376, 434, 333, 8882, 635, 463, 18, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 719, 485, 335, 67, 11246, 376, 12, 2890, 16, 463, 4672, 3536, 2000, 326, 719, 485, 335, 2339, 376, 434, 333, 8882, 635, 463, 18, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
if isinstance(property_uri, (list, tuple, QuerySet)): result_prop_uri = property_uri	if isinstance(property_uri, (list, tuple, QuerySet)): result_prop_uri = property_uri	def get_property_uris(self, prop, rdfMeta=None): if not rdfMeta: rdfMeta = self.rdfMeta() rdfprops = rdfMeta[prop] # -- get the value of this property dbval = getattr(self, rdfprops["property"]) if "property" in rdfprops else getattr(self, prop) # --- if this is a relation type of property if hasattr(dbval, 'all') and callable(dbval.all): rval = self.objects_as_rdf_list(dbval.all()) # --- if this is a literal ? else: rval = self.property_to_string(prop) # -- property property_uri = rdfMeta[prop]["uri"] # -- repack	d6c797f4a2089543ac6cb76bfb9c014053f177e3 /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/11435/d6c797f4a2089543ac6cb76bfb9c014053f177e3/rdf.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 336, 67, 4468, 67, 23510, 12, 2890, 16, 2270, 16, 9160, 2781, 33, 7036, 4672, 309, 486, 9160, 2781, 30, 9160, 2781, 273, 365, 18, 19299, 2781, 1435, 9160, 9693, 273, 9160, 2781, 63, 5986, 65, 468, 1493, 336, 326, 460, 434, 333, 1272, 1319, 1125, 273, 3869, 12, 2890, 16, 9160, 9693, 9614, 4468, 6, 5717, 309, 315, 4468, 6, 316, 9160, 9693, 469, 3869, 12, 2890, 16, 2270, 13, 468, 9948, 309, 333, 353, 279, 2533, 618, 434, 1272, 309, 3859, 12, 1966, 1125, 16, 296, 454, 6134, 471, 4140, 12, 1966, 1125, 18, 454, 4672, 14267, 273, 365, 18, 6911, 67, 345, 67, 19299, 67, 1098, 12, 1966, 1125, 18, 454, 10756, 468, 9948, 309, 333, 353, 279, 7158, 692, 469, 30, 14267, 273, 365, 18, 4468, 67, 869, 67, 1080, 12, 5986, 13, 468, 1493, 1272, 1272, 67, 1650, 273, 9160, 2781, 63, 5986, 6362, 6, 1650, 11929, 468, 1493, 2071, 484, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 336, 67, 4468, 67, 23510, 12, 2890, 16, 2270, 16, 9160, 2781, 33, 7036, 4672, 309, 486, 9160, 2781, 30, 9160, 2781, 273, 365, 18, 19299, 2781, 1435, 9160, 9693, 273, 9160, 2781, 63, 5986, 65, 468, 1493, 336, 326, 460, 434, 333, 1272, 1319, 1125, 273, 3869, 12, 2890, 16, 9160, 9693, 9614, 4468, 6, 5717, 309, 315, 4468, 6, 316, 9160, 9693, 469, 3869, 12, 2890, 16, 2270, 13, 468, 9948, 309, 333, 353, 279, 2533, 618, 434, 1272, 309, 3859, 12, 1966, 1125, 16, 296, 454, 6134, 471, 4140, 12, 1966, 1125, 18, 454, 4672, 14267, 273, 365, 18, 6911, 67, 345, 67, 19299, 67, 1098, 12, 1966, 1125, 18, 454, 10756, 468, 9948, 309, 2 ]
op.add_option('-d', '--debug', dest='debug', action='store_true',	op.add_option('-g', '--debug', dest='debug', action='store_true',	def run_tests(tests, test_dir, lib_dir): pb = None if not OPTIONS.hide_progress and not OPTIONS.show_cmd: try: from progressbar import ProgressBar pb = ProgressBar('', len(tests), 13) except ImportError: pass failures = [] complete = False doing = 'before starting' try: for i, test in enumerate(tests): doing = 'on %s'%test.path ok, out, err = run_test(test, lib_dir) doing = 'after %s'%test.path if not ok: failures.append(test.path) if OPTIONS.tinderbox: if ok: print('TEST-PASS \| trace-test.py \| %s'%test.path) else: lines = [ _ for _ in out.split('\n') + err.split('\n') if _ != '' ] if len(lines) >= 1: msg = lines[-1] else: msg = '' print('TEST-UNEXPECTED-FAIL \| trace-test.py \| %s: %s'% (test.path, msg)) n = i + 1 if pb: pb.label = '[%3d\|%3d\|%3d]'%(n - len(failures), len(failures), n) pb.update(n) complete = True except KeyboardInterrupt: pass if pb: pb.finish() if failures: if OPTIONS.write_failures: try: out = open(OPTIONS.write_failures, 'w') for test in failures: out.write(os.path.relpath(test, test_dir) + '\n') out.close() except IOError: sys.stderr.write("Exception thrown trying to write failure file '%s'\n"% OPTIONS.write_failures) traceback.print_exc() sys.stderr.write('---\n') print('FAILURES:') for test in failures: if OPTIONS.show_failed: print(' ' + subprocess.list2cmdline(get_test_cmd(test, lib_dir))) else: print(' ' + test) else: print('PASSED ALL' + ('' if complete else ' (partial run -- interrupted by user %s)'%doing))	7bf18187bf331c61553e8ba72d890bd5fd4cc385 /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/11102/7bf18187bf331c61553e8ba72d890bd5fd4cc385/trace-test.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1086, 67, 16341, 12, 16341, 16, 1842, 67, 1214, 16, 2561, 67, 1214, 4672, 6386, 273, 599, 309, 486, 16726, 18, 11248, 67, 8298, 471, 486, 16726, 18, 4500, 67, 4172, 30, 775, 30, 628, 31730, 1930, 27793, 6386, 273, 27793, 2668, 2187, 562, 12, 16341, 3631, 5958, 13, 1335, 11308, 30, 1342, 225, 11720, 273, 5378, 3912, 273, 1083, 9957, 273, 296, 5771, 5023, 11, 775, 30, 364, 277, 16, 1842, 316, 4241, 12, 16341, 4672, 9957, 273, 296, 265, 738, 87, 11, 9, 3813, 18, 803, 1529, 16, 596, 16, 393, 273, 1086, 67, 3813, 12, 3813, 16, 2561, 67, 1214, 13, 9957, 273, 296, 5205, 738, 87, 11, 9, 3813, 18, 803, 225, 309, 486, 1529, 30, 11720, 18, 6923, 12, 3813, 18, 803, 13, 225, 309, 16726, 18, 88, 14055, 2147, 30, 309, 1529, 30, 1172, 2668, 16961, 17, 10884, 571, 2606, 17, 3813, 18, 2074, 571, 738, 87, 11, 9, 3813, 18, 803, 13, 469, 30, 2362, 273, 306, 389, 364, 389, 316, 596, 18, 4939, 2668, 64, 82, 6134, 397, 393, 18, 4939, 2668, 64, 82, 6134, 309, 389, 480, 875, 308, 309, 562, 12, 3548, 13, 1545, 404, 30, 1234, 273, 2362, 18919, 21, 65, 469, 30, 1234, 273, 875, 1172, 2668, 16961, 17, 2124, 27409, 17, 12319, 571, 2606, 17, 3813, 18, 2074, 571, 738, 87, 30, 738, 87, 11, 9, 261, 3813, 18, 803, 16, 1234, 3719, 225, 290, 273, 277, 397, 404, 309, 6386, 30, 6386, 2 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1086, 67, 16341, 12, 16341, 16, 1842, 67, 1214, 16, 2561, 67, 1214, 4672, 6386, 273, 599, 309, 486, 16726, 18, 11248, 67, 8298, 471, 486, 16726, 18, 4500, 67, 4172, 30, 775, 30, 628, 31730, 1930, 27793, 6386, 273, 27793, 2668, 2187, 562, 12, 16341, 3631, 5958, 13, 1335, 11308, 30, 1342, 225, 11720, 273, 5378, 3912, 273, 1083, 9957, 273, 296, 5771, 5023, 11, 775, 30, 364, 277, 16, 1842, 316, 4241, 12, 16341, 4672, 9957, 273, 296, 265, 738, 87, 11, 9, 3813, 18, 803, 1529, 16, 596, 16, 393, 273, 1086, 67, 3813, 12, 3813, 16, 2561, 67, 1214, 13, 9957, 273, 296, 5205, 738, 87, 11, 9, 3813, 18, 803, 225, 309, 486, 2 ]
if pkg["name"] != name:	if rpm["name"] != name:	def checkDeps(rpms): # Add all packages in. resolver = RpmResolver() for pkg in rpms: resolver.addPkg(pkg) # Check for obsoletes. for name in resolver.obsoletes_list.deps.keys(): for (flag, version, rpm) in resolver.obsoletes_list.deps[name]: for pkg in searchDep(name, flag, version, resolver.mydeps.get(name, [])): if pkg["name"] != name: print "Warning:", pkg.getFilename(), "is obsoleted by", \ depString(name, flag, version), "from", rpm.getFilename() # Check all requires. for name in resolver.requires_list.deps.keys(): if name.startswith("rpmlib("): continue for (flag, version, rpm) in resolver.requires_list.deps[name]: if not resolver.searchDependency(name, flag, version): print "Warning:", rpm.getFilename(), \ "did not find a package for:", \ depString(name, flag, version) # Check all conflicts. for name in resolver.conflicts_list.deps.keys(): for (flag, version, rpm) in resolver.conflicts_list.deps[name]: for pkg in resolver.searchDependency(name, flag, version): print "Warning:", rpm.getFilename(), "contains a conflict", \ depString(name, flag, version), "with", pkg.getFilename() # Check for fileconflicts. for dirname in resolver.filenames_list.path.keys(): for basename in resolver.filenames_list.path[dirname].keys(): s = resolver.filenames_list.path[dirname][basename] if len(s) < 2: continue filename = dirname + basename for j in xrange(len(s) - 1): (rpm1, i1) = s[j] for k in xrange(j + 1, len(s)): (rpm2, i2) = s[k] if not S_ISREG(rpm1["filemodes"][i1]) or \ not S_ISREG(rpm2["filemodes"][i2]): continue if rpm1["filemd5s"][i1] != rpm2["filemd5s"][i2]: print "fileconflict for", filename, "in", \ rpm1.getFilename(), rpm2.getFilename()	1fec9a43376b6b9bfe41360a3ad6f07af8f8af71 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/1143/1fec9a43376b6b9bfe41360a3ad6f07af8f8af71/oldpyrpm.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 866, 14430, 12, 13832, 959, 4672, 468, 1436, 777, 5907, 316, 18, 5039, 273, 534, 7755, 4301, 1435, 364, 3475, 316, 8715, 959, 30, 5039, 18, 1289, 11264, 12, 10657, 13, 468, 2073, 364, 7160, 355, 278, 281, 18, 364, 508, 316, 5039, 18, 10992, 355, 278, 281, 67, 1098, 18, 14877, 18, 2452, 13332, 364, 261, 6420, 16, 1177, 16, 25228, 13, 316, 5039, 18, 10992, 355, 278, 281, 67, 1098, 18, 14877, 63, 529, 14542, 364, 3475, 316, 1623, 16316, 12, 529, 16, 2982, 16, 1177, 16, 5039, 18, 4811, 14877, 18, 588, 12, 529, 16, 5378, 3719, 30, 309, 25228, 9614, 529, 11929, 480, 508, 30, 1172, 315, 6210, 2773, 16, 3475, 18, 588, 5359, 9334, 315, 291, 7160, 355, 278, 329, 635, 3113, 521, 5993, 780, 12, 529, 16, 2982, 16, 1177, 3631, 315, 2080, 3113, 25228, 18, 588, 5359, 1435, 468, 2073, 777, 4991, 18, 364, 508, 316, 5039, 18, 18942, 67, 1098, 18, 14877, 18, 2452, 13332, 309, 508, 18, 17514, 1918, 2932, 13832, 781, 495, 2932, 4672, 1324, 364, 261, 6420, 16, 1177, 16, 25228, 13, 316, 5039, 18, 18942, 67, 1098, 18, 14877, 63, 529, 14542, 309, 486, 5039, 18, 3072, 7787, 12, 529, 16, 2982, 16, 1177, 4672, 1172, 315, 6210, 2773, 16, 25228, 18, 588, 5359, 9334, 521, 315, 14044, 486, 1104, 279, 2181, 364, 2773, 16, 521, 5993, 780, 12, 529, 16, 2982, 16, 1177, 13, 468, 2073, 777, 14450, 18, 364, 508, 316, 5039, 2 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 866, 14430, 12, 13832, 959, 4672, 468, 1436, 777, 5907, 316, 18, 5039, 273, 534, 7755, 4301, 1435, 364, 3475, 316, 8715, 959, 30, 5039, 18, 1289, 11264, 12, 10657, 13, 468, 2073, 364, 7160, 355, 278, 281, 18, 364, 508, 316, 5039, 18, 10992, 355, 278, 281, 67, 1098, 18, 14877, 18, 2452, 13332, 364, 261, 6420, 16, 1177, 16, 25228, 13, 316, 5039, 18, 10992, 355, 278, 281, 67, 1098, 18, 14877, 63, 529, 14542, 364, 3475, 316, 1623, 16316, 12, 529, 16, 2982, 16, 1177, 16, 5039, 18, 4811, 14877, 18, 588, 12, 529, 16, 5378, 3719, 30, 309, 25228, 9614, 529, 11929, 480, 508, 30, 1172, 315, 6210, 2773, 16, 3475, 18, 588, 5359, 2 ]
if hasattr( left, "radius" ):	if hasattr(left, "radius"):	def __call__( self, left, right ): """pygame.sprite.collide_circle_radio(ratio)(left, right): return bool collision detection between two sprites, using scaled circles.	d9760f3e4782abb02dd98080337626eefdad67ee /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/1298/d9760f3e4782abb02dd98080337626eefdad67ee/sprite.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 1991, 972, 12, 365, 16, 2002, 16, 2145, 262, 30, 3536, 2074, 13957, 18, 1752, 796, 18, 1293, 8130, 67, 18970, 67, 17006, 12, 9847, 21433, 4482, 16, 2145, 4672, 327, 1426, 17740, 11649, 3086, 2795, 1694, 24047, 16, 1450, 12304, 5886, 9558, 18, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 1991, 972, 12, 365, 16, 2002, 16, 2145, 262, 30, 3536, 2074, 13957, 18, 1752, 796, 18, 1293, 8130, 67, 18970, 67, 17006, 12, 9847, 21433, 4482, 16, 2145, 4672, 327, 1426, 17740, 11649, 3086, 2795, 1694, 24047, 16, 1450, 12304, 5886, 9558, 18, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
if v:	print v if v is not None:	def get_all_keys(self, headers=None, **params): """ A lower-level method for listing contents of a bucket. This closely models the actual S3 API and requires you to manually handle the paging of results. For a higher-level method that handles the details of paging for you, you can use the list method. @type maxkeys: int @param maxkeys: The maximum number of keys to retrieve @type prefix: string @param prefix: The prefix of the keys you want to retrieve @type marker: string @param marker: The "marker" of where you are in the result set @type delimiter: string @param delimiter: "If this optional, Unicode string parameter is included with your request, then keys that contain the same string between the prefix and the first occurrence of the delimiter will be rolled up into a single result element in the CommonPrefixes collection. These rolled-up keys are not returned elsewhere in the response."	ab75072a7d8b8462fc6ae179a49f86427823f303 /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/1098/ab75072a7d8b8462fc6ae179a49f86427823f303/bucket.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 336, 67, 454, 67, 2452, 12, 2890, 16, 1607, 33, 7036, 16, 2826, 2010, 4672, 3536, 432, 2612, 17, 2815, 707, 364, 11591, 2939, 434, 279, 2783, 18, 225, 1220, 1219, 1786, 93, 3679, 326, 3214, 348, 23, 1491, 471, 4991, 1846, 358, 10036, 1640, 326, 17859, 434, 1686, 18, 225, 2457, 279, 10478, 17, 2815, 707, 716, 7372, 326, 3189, 434, 17859, 364, 1846, 16, 1846, 848, 999, 326, 666, 707, 18, 225, 632, 723, 943, 2452, 30, 509, 632, 891, 943, 2452, 30, 1021, 4207, 1300, 434, 1311, 358, 4614, 225, 632, 723, 1633, 30, 533, 632, 891, 1633, 30, 1021, 1633, 434, 326, 1311, 1846, 2545, 358, 4614, 225, 632, 723, 5373, 30, 533, 632, 891, 5373, 30, 1021, 315, 11145, 6, 434, 1625, 1846, 854, 316, 326, 563, 444, 225, 632, 723, 5654, 30, 533, 632, 891, 5654, 30, 315, 2047, 333, 3129, 16, 9633, 533, 1569, 353, 5849, 598, 3433, 590, 16, 1508, 1311, 716, 912, 326, 1967, 533, 3086, 326, 1633, 471, 326, 1122, 13083, 434, 326, 5654, 903, 506, 28693, 731, 1368, 279, 2202, 563, 930, 316, 326, 5658, 11700, 1849, 18, 8646, 28693, 17, 416, 1311, 854, 486, 2106, 25795, 316, 326, 766, 1199, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 336, 67, 454, 67, 2452, 12, 2890, 16, 1607, 33, 7036, 16, 2826, 2010, 4672, 3536, 432, 2612, 17, 2815, 707, 364, 11591, 2939, 434, 279, 2783, 18, 225, 1220, 1219, 1786, 93, 3679, 326, 3214, 348, 23, 1491, 471, 4991, 1846, 358, 10036, 1640, 326, 17859, 434, 1686, 18, 225, 2457, 279, 10478, 17, 2815, 707, 716, 7372, 326, 3189, 434, 17859, 364, 1846, 16, 1846, 848, 999, 326, 666, 707, 18, 225, 632, 723, 943, 2452, 30, 509, 632, 891, 943, 2452, 30, 1021, 4207, 1300, 434, 1311, 358, 4614, 225, 632, 723, 1633, 30, 533, 632, 891, 1633, 30, 1021, 1633, 434, 326, 1311, 1846, 2545, 358, 4614, 225, 632, 723, 5373, 30, 533, 632, 2 ]
transport = Transport()	if type == "https": transport = SafeTransport() else: transport = Transport()	def __init__(self, uri, transport=None): # establish a "logical" server connection	80ead46c3b0b9513bc116e8fe08faa2f91145a91 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/4325/80ead46c3b0b9513bc116e8fe08faa2f91145a91/xmlrpclib.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 2890, 16, 2003, 16, 4736, 33, 7036, 4672, 468, 18312, 279, 315, 20300, 6, 1438, 1459, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 2890, 16, 2003, 16, 4736, 33, 7036, 4672, 468, 18312, 279, 315, 20300, 6, 1438, 1459, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
log.msg("Downloading %s\n" % (PackageName) )	log.msg("Downloading %s.%s\n" % (PackageName, LINE_OVERWRITE_FULL) )	def run(request, response, func=find_first_match): '''Get items from the request Queue, process them with func(), put the results along with the Thread's name into the response Queue. Stop running when item is None.''' while 1: tuple_item_key = request.get() if tuple_item_key is None: break (key, item) = tuple_item_key (url, file, download_size, checksum) = stripper(item) thread_name = threading.currentThread().getName() if key == 'Update': temp_file = file.split("_") PackageName = temp_file[0] PackageName += " - " + temp_file[len(temp_file) - 1] del temp_file #INFO: We pass None as a filename here because we don't want to do a tree search of # update files. Update files are changed daily and there is no point in doing a search of # them in the cache_dir response.put(func(cache_dir, None) ) #INFO: exit_status here would be False because for updates there's no need to do a # find_first_match # This is more with the above statement where None is passed as the filename exit_status = response.get() if exit_status == False: log.msg("Downloading %s\n" % (PackageName) ) if FetcherInstance.download_from_web(url, file, download_path) == True: log.success("\r%s done.%s\n" % (PackageName, LINE_OVERWRITE_FULL) ) if ArgumentOptions.zip_it: if FetcherInstance.compress_the_file(ArgumentOptions.zip_update_file, file) != True: log.err("Couldn't archive %s to file %s.%s\n" % (file, ArgumentOptions.zip_update_file, LINE_OVERWRITE_MID) ) sys.exit(1) else: log.verbose("%s added to archive %s.%s\n" % (file, ArgumentOptions.zip_update_file, LINE_OVERWRITE_FULL) ) os.unlink(os.path.join(download_path, file) ) else: errlist.append(file) elif key == 'Upgrade': PackageName = file.split("_")[0] response.put(func(cache_dir, file) ) #INFO: find_first_match() returns False or a file name with absolute path full_file_path = response.get() #INFO: If we find the file in the local cache_dir, we'll execute this block. if full_file_path != False: # We'll first check for its md5 checksum if ArgumentOptions.disable_md5check is False: if FetcherInstance.md5_check(full_file_path, checksum) is True: log.verbose("md5checksum correct for package %s.%s\n" % (PackageName, LINE_OVERWRITE_FULL) ) if ArgumentOptions.deb_bugs: bug_fetched = 0 log.verbose("Fetching bug reports for package %s.%s\n" % (PackageName, LINE_OVERWRITE_FULL) ) if FetchBugReportsDebian.FetchBugsDebian(PackageName): log.verbose("Fetched bug reports for package %s.%s\n" % (PackageName, LINE_OVERWRITE_FULL) ) bug_fetched = 1 else: log.verbose("Couldn't fetch bug reports for package %s.%s\n" % (PackageName, LINE_OVERWRITE_MID) ) if ArgumentOptions.zip_it: if FetcherInstance.compress_the_file(ArgumentOptions.zip_upgrade_file, full_file_path) is True: log.success("%s copied from local cache directory %s.%s\n" % (PackageName, cache_dir, LINE_OVERWRITE_MID) ) else: log.err("Couldn't add %s to archive %s.%s\n" % (file, ArgumentOptions.zip_upgrade_file, LINE_OVERWRITE_MID) ) sys.exit(1) #INFO: If no zip option enabled, simply copy the downloaded package file # along with the downloaded bug reports. else: try: shutil.copy(full_file_path, download_path) log.success("%s copied from local cache directory %s.%s\n" % (PackageName, cache_dir, LINE_OVERWRITE_MID) ) except shutil.Error: log.verbose("%s already available in %s. Skipping copy!!!%s\n\n" % (file, download_path, LINE_OVERWRITE_MID) ) if bug_fetched == 1: for x in os.listdir(os.curdir): if (x.startswith(PackageName) and x.endswith(pypt_bug_file_format) ): shutil.move(x, download_path) log.verbose("Moved %s file to %s folder.%s\n" % (x, download_path, LINE_OVERWRITE_FULL) ) #INFO: Damn!! The md5chesum didn't match :-( # The file is corrupted and we need to download a new copy from the internet else: log.verbose("%s MD5 checksum mismatch. Skipping file.%s\n" % (file, LINE_OVERWRITE_FULL) ) log.msg("Downloading %s - %d KB%s\n" % (PackageName, download_size/1024, LINE_OVERWRITE_FULL) ) if FetcherInstance.download_from_web(url, file, download_path) == True: log.success("\r%s done.%s\n" % (PackageName, LINE_OVERWRITE_FULL) ) #Add to cache_dir if possible if ArgumentOptions.cache_dir: try: shutil.copy(file, cache_dir) log.verbose("%s copied to local cache directory %s.%s\n" % (file, ArgumentOptions.cache_dir, LINE_OVERWRITE_MID) ) except shutil.Error: log.verbose("Couldn't copy %s to %s.%s\n\n" % (file, ArgumentOptions.cache_dir, LINE_OVERWRITE_FULL) ) #Fetch bug reports if ArgumentOptions.deb_bugs: if FetchBugReportsDebian.FetchBugsDebian(PackageName): log.verbose("Fetched bug reports for package %s.%s\n" % (PackageName, LINE_OVERWRITE_MID) ) else: log.verbose("Couldn't fetch bug reports for package %s.%s\n" % (PackageName, LINE_OVERWRITE_MID) ) if ArgumentOptions.zip_it: if FetcherInstance.compress_the_file(ArgumentOptions.zip_upgrade_file, file) != True: log.err("Couldn't archive %s to file %s.%s\n" % (file, ArgumentOptions.zip_upgrade_file, LINE_OVERWRITE_SMALL) ) sys.exit(1) else: log.verbose("%s added to archive %s.%s\n" % (file, ArgumentOptions.zip_upgrade_file, LINE_OVERWRITE_SMALL) ) os.unlink(os.path.join(download_path, file) ) #INFO: You're and idiot. # You should NOT disable md5checksum for any files else: if ArgumentOptions.deb_bugs: bug_fetched = 0 if FetchBugReportsDebian.FetchBugsDebian(PackageName): log.verbose("Fetched bug reports for package %s.%s\n" % (PackageName, LINE_OVERWRITE_MID) ) bug_fetched = 1 else: log.verbose("Couldn't fetch bug reports for package %s.%s\n" % (PackageName, LINE_OVERWRITE_MID) ) #FIXME: Don't know why this was really required. If this has no changes, delete it. #file = full_file_path.split("/") #file = file[len(file) - 1] #file = download_path + "/" + file if ArgumentOptions.zip_it: if FetcherInstance.compress_the_file(ArgumentOptions.zip_upgrade_file, file) != True: log.err("Couldn't archive %s to file %s.%s\n" % (file, ArgumentOptions.zip_upgrade_file, LINE_OVERWRITE_SMALL) ) sys.exit(1) else: log.verbose("%s added to archive %s.%s\n" % (file, ArgumentOptions.zip_upgrade_file, LINE_OVERWRITE_SMALL) ) os.unlink(os.path.join(download_path, file) ) else: # Since zip file option is not enabled let's copy the file to the target folder try: shutil.copy(full_file_path, download_path) log.success("%s copied from local cache directory %s.%s\n" % (file, cache_dir, LINE_OVERWRITE_SMALL) ) except shutil.Error: log.verbose("%s already available in dest_dir. Skipping copy!!!%s\n\n" % (file, LINE_OVERWRITE_SMALL) ) # And also the bug reports if bug_fetched == 1: for x in os.listdir(os.curdir): if (x.startswith(PackageName) and x.endswith(pypt_bug_file_format) ): shutil.move(x, download_path) log.verbose("Moved %s file to %s folder.%s\n" % (x, download_path, LINE_OVERWRITE_MID) ) else: #INFO: This block gets executed if the file is not found in local cache_dir or cache_dir is None # We go ahead and try to download it from the internet log.verbose("%s not available in local cache %s.%s\n" % (file, ArgumentOptions.cache_dir, LINE_OVERWRITE_MID) ) log.msg("Downloading %s - %d KB%s\n" % (PackageName, download_size/1024, LINE_OVERWRITE_FULL) ) if FetcherInstance.download_from_web(url, file, download_path) == True: #INFO: This block gets executed if md5checksum is allowed if ArgumentOptions.disable_md5check is False: if FetcherInstance.md5_check(file, checksum) is True: if ArgumentOptions.cache_dir: try: shutil.copy(file, ArgumentOptions.cache_dir) log.verbose("%s copied to local cache directory %s.%s\n" % (file, ArgumentOptions.cache_dir, LINE_OVERWRITE_MID) ) except shutil.Error: log.verbose("%s already available in %s. Skipping copy!!!%s\n\n" % (file, ArgumentOptions.cache_dir, LINE_OVERWRITE_MID) ) if ArgumentOptions.deb_bugs: if FetchBugReportsDebian.FetchBugsDebian(PackageName): log.verbose("Fetched bug reports for package %s.%s\n" % (PackageName, LINE_OVERWRITE_MID) ) else: log.verbose("Couldn't fetch bug reports for package %s.%s\n" % (PackageName, LINE_OVERWRITE_MID) ) if ArgumentOptions.zip_it: if FetcherInstance.compress_the_file(ArgumentOptions.zip_upgrade_file, file) != True: log.err("Couldn't archive %s to file %s.%s\n" % (file, ArgumentOptions.zip_upgrade_file, LINE_OVERWRITE_SMALL) ) sys.exit(1) else: log.verbose("%s added to archive %s.%s\n" % (file, ArgumentOptions.zip_upgrade_file, LINE_OVERWRITE_SMALL) ) os.unlink(os.path.join(download_path, file) ) else: if ArgumentOptions.deb_bugs: if FetchBugReportsDebian.FetchBugsDebian(PackageName): log.verbose("Fetched bug reports for package %s.%s\n" % (PackageName, LINE_OVERWRITE_MID) ) else: log.verbose("Couldn't fetch bug reports for package %s.%s\n" % (PackageName, LINE_OVERWRITE_MID) ) if ArgumentOptions.zip_it: if FetcherInstance.compress_the_file(ArgumentOptions.zip_upgrade_file, file) != True: log.err("Couldn't archive %s to file %s.%s\n" % (file, ArgumentOptions.zip_upgrade_file, LINE_OVERWRITE_SMALL) ) sys.exit(1) else: log.verbose("%s added to archive %s.%s\n" % (file, ArgumentOptions.zip_upgrade_file, LINE_OVERWRITE_SMALL) ) os.unlink(os.path.join(download_path, file) ) log.success("\r%s done.%s\n" % (PackageName, LINE_OVERWRITE_FULL) ) else: #log.err("Couldn't find %s\n" % (PackageName) ) errlist.append(PackageName) else: raise FetchDataKeyError	f9cf927078f9b55d9b348831720ac6187f897284 /local1/tlutelli/issta_data/temp/all_python//python/2007_temp/2007/12499/f9cf927078f9b55d9b348831720ac6187f897284/pypt_core.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1086, 12, 2293, 16, 766, 16, 1326, 33, 4720, 67, 3645, 67, 1916, 4672, 9163, 967, 1516, 628, 326, 590, 7530, 16, 1207, 2182, 598, 1326, 9334, 1378, 326, 1686, 7563, 598, 326, 4884, 1807, 508, 1368, 326, 766, 7530, 18, 225, 5131, 3549, 1347, 761, 353, 599, 1093, 6309, 225, 1323, 404, 30, 3193, 67, 1726, 67, 856, 273, 590, 18, 588, 1435, 309, 3193, 67, 1726, 67, 856, 353, 599, 30, 898, 261, 856, 16, 761, 13, 273, 3193, 67, 1726, 67, 856, 261, 718, 16, 585, 16, 4224, 67, 1467, 16, 6697, 13, 273, 2569, 457, 12, 1726, 13, 2650, 67, 529, 273, 17254, 18, 2972, 3830, 7675, 17994, 1435, 225, 309, 498, 422, 296, 1891, 4278, 1906, 67, 768, 273, 585, 18, 4939, 2932, 67, 7923, 7508, 461, 273, 1906, 67, 768, 63, 20, 65, 7508, 461, 1011, 315, 300, 315, 397, 1906, 67, 768, 63, 1897, 12, 5814, 67, 768, 13, 300, 404, 65, 1464, 1906, 67, 768, 225, 468, 5923, 30, 1660, 1342, 599, 487, 279, 1544, 2674, 2724, 732, 2727, 1404, 2545, 358, 741, 279, 2151, 1623, 434, 468, 1089, 1390, 18, 2315, 1390, 854, 3550, 18872, 471, 1915, 353, 1158, 1634, 316, 9957, 279, 1623, 434, 468, 2182, 316, 326, 1247, 67, 1214, 766, 18, 458, 12, 644, 12, 2493, 67, 1214, 16, 599, 13, 262, 225, 468, 5923, 30, 2427, 67, 2327, 2674, 4102, 506, 1083, 2724, 364, 4533, 1915, 1807, 1158, 1608, 358, 741, 279, 468, 2 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1086, 12, 2293, 16, 766, 16, 1326, 33, 4720, 67, 3645, 67, 1916, 4672, 9163, 967, 1516, 628, 326, 590, 7530, 16, 1207, 2182, 598, 1326, 9334, 1378, 326, 1686, 7563, 598, 326, 4884, 1807, 508, 1368, 326, 766, 7530, 18, 225, 5131, 3549, 1347, 761, 353, 599, 1093, 6309, 225, 1323, 404, 30, 3193, 67, 1726, 67, 856, 273, 590, 18, 588, 1435, 309, 3193, 67, 1726, 67, 856, 353, 599, 30, 898, 261, 856, 16, 761, 13, 273, 3193, 67, 1726, 67, 856, 261, 718, 16, 585, 16, 4224, 67, 1467, 16, 6697, 13, 273, 2569, 457, 12, 1726, 13, 2650, 67, 529, 273, 17254, 18, 2972, 3830, 7675, 17994, 1435, 225, 309, 498, 422, 296, 2 ]
'now': datetime.datetime.now().isoformat(' '),	'now': datetime.datetime.now().isoformat(' ')[0:-7] + '+0000',	def write_infos(self, modules): import release self.buffer.write("# Translation of %(project)s.\n" \ "# This file contains the translation of the following modules:\n" \ "%(modules)s" \ "#\n" \ "msgid \"\"\n" \ "msgstr \"\"\n" \ '''"Project-Id-Version: %(project)s %(version)s\\n"\n''' \ '''"Report-Msgid-Bugs-To: %(bugmail)s\\n"\n''' \ '''"POT-Creation-Date: %(now)s\\n"\n''' \ '''"PO-Revision-Date: %(now)s\\n"\n''' \ '''"Last-Translator: <>\\n"\n''' \ '''"Language-Team: \\n"\n''' \ '''"MIME-Version: 1.0\\n"\n''' \ '''"Content-Type: text/plain; charset=UTF-8\\n"\n''' \ '''"Content-Transfer-Encoding: \\n"\n''' \ '''"Plural-Forms: \\n"\n''' \ "\n"	c3cea6e6c2e847862ef84de55d56dd5fa5610e3b /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/12853/c3cea6e6c2e847862ef84de55d56dd5fa5610e3b/translate.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1045, 67, 18227, 12, 2890, 16, 4381, 4672, 1930, 3992, 365, 18, 4106, 18, 2626, 2932, 7, 17427, 434, 8975, 4406, 13, 87, 8403, 82, 6, 521, 6619, 1220, 585, 1914, 326, 4794, 434, 326, 3751, 4381, 5581, 82, 6, 521, 22061, 6400, 13, 87, 6, 521, 6619, 64, 82, 6, 521, 315, 3576, 350, 1239, 31670, 82, 6, 521, 315, 27439, 313, 1239, 31670, 82, 6, 521, 875, 4970, 4109, 17, 548, 17, 1444, 30, 8975, 4406, 13, 87, 8975, 1589, 13, 87, 1695, 82, 12691, 82, 26418, 521, 875, 4970, 4820, 17, 3332, 350, 17, 31559, 17, 774, 30, 8975, 925, 4408, 13, 87, 1695, 82, 12691, 82, 26418, 521, 875, 4970, 52, 1974, 17, 9906, 17, 1626, 30, 8975, 3338, 13, 87, 1695, 82, 12691, 82, 26418, 3639, 521, 875, 4970, 2419, 17, 7939, 17, 1626, 30, 8975, 3338, 13, 87, 1695, 82, 12691, 82, 26418, 540, 521, 875, 4970, 3024, 17, 12233, 30, 2813, 1695, 82, 12691, 82, 26418, 521, 875, 4970, 3779, 17, 8689, 30, 1736, 82, 12691, 82, 26418, 282, 521, 875, 4970, 18178, 17, 1444, 30, 404, 18, 20, 1695, 82, 12691, 82, 26418, 521, 875, 4970, 1350, 17, 559, 30, 977, 19, 7446, 31, 4856, 33, 5159, 17, 28, 1695, 82, 12691, 82, 26418, 282, 521, 875, 4970, 1350, 17, 5912, 17, 4705, 30, 1736, 82, 12691, 82, 26418, 4202, 521, 875, 4970, 12968, 17, 18529, 30, 1736, 82, 12691, 82, 26418, 565, 521, 1548, 82, 6, 2, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1045, 67, 18227, 12, 2890, 16, 4381, 4672, 1930, 3992, 365, 18, 4106, 18, 2626, 2932, 7, 17427, 434, 8975, 4406, 13, 87, 8403, 82, 6, 521, 6619, 1220, 585, 1914, 326, 4794, 434, 326, 3751, 4381, 5581, 82, 6, 521, 22061, 6400, 13, 87, 6, 521, 6619, 64, 82, 6, 521, 315, 3576, 350, 1239, 31670, 82, 6, 521, 315, 27439, 313, 1239, 31670, 82, 6, 521, 875, 4970, 4109, 17, 548, 17, 1444, 30, 8975, 4406, 13, 87, 8975, 1589, 13, 87, 1695, 82, 12691, 82, 26418, 521, 875, 4970, 4820, 17, 3332, 350, 17, 31559, 17, 774, 30, 8975, 925, 4408, 13, 87, 1695, 82, 12691, 82, 26418, 521, 875, 4970, 52, 1974, 17, 9906, 2 ]
@param address: any address in the breakpoint range	@param ea: any address in the breakpoint range	def SetBptCnd(ea, cnd): """ Set breakpoint condition @param address: any address in the breakpoint range @param cnd: breakpoint condition @return: success """ bpt = idaapi.bpt_t() if not idaapi.get_bpt(ea, bpt): return False bpt.condition = cnd return idaapi.update_bpt(bpt)	e44bdcd4de27699ae0ecbd6c9dc2f42ebbbc110e /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/3410/e44bdcd4de27699ae0ecbd6c9dc2f42ebbbc110e/idc.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1000, 38, 337, 39, 4880, 12, 24852, 16, 276, 4880, 4672, 3536, 1000, 18820, 2269, 225, 632, 891, 24164, 30, 1281, 1758, 316, 326, 18820, 1048, 632, 891, 276, 4880, 30, 18820, 2269, 225, 632, 2463, 30, 2216, 3536, 324, 337, 273, 612, 69, 2425, 18, 70, 337, 67, 88, 1435, 225, 309, 486, 612, 69, 2425, 18, 588, 67, 70, 337, 12, 24852, 16, 324, 337, 4672, 327, 1083, 225, 324, 337, 18, 4175, 273, 276, 4880, 225, 327, 612, 69, 2425, 18, 2725, 67, 70, 337, 12, 70, 337, 13, 282, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1000, 38, 337, 39, 4880, 12, 24852, 16, 276, 4880, 4672, 3536, 1000, 18820, 2269, 225, 632, 891, 24164, 30, 1281, 1758, 316, 326, 18820, 1048, 632, 891, 276, 4880, 30, 18820, 2269, 225, 632, 2463, 30, 2216, 3536, 324, 337, 273, 612, 69, 2425, 18, 70, 337, 67, 88, 1435, 225, 309, 486, 612, 69, 2425, 18, 588, 67, 70, 337, 12, 24852, 16, 324, 337, 4672, 327, 1083, 225, 324, 337, 18, 4175, 273, 276, 4880, 225, 327, 612, 69, 2425, 18, 2725, 67, 70, 337, 12, 70, 337, 13, 282, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
:returns: :class:`celery.result.AsyncResult`.	:returns :class:`celery.result.AsyncResult`:	def delay_task(task_name, args, kwargs): """Delay a task for execution by the ``celery`` daemon. :param task_name: the name of a task registered in the task registry. :param \args: positional arguments to pass on to the task. :param \\kwargs: keyword arguments to pass on to the task. :raises celery.exceptions.NotRegistered: exception if no such task has been registered in the task registry. :returns: :class:`celery.result.AsyncResult`. Example >>> r = delay_task("update_record", name="George Costanza", age=32) >>> r.ready() True >>> r.result "Record was updated" """ return apply_async(tasks[task_name], args, kwargs)	d789a8f203274d33dba847c85f5b19a934ff74df /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/2024/d789a8f203274d33dba847c85f5b19a934ff74df/__init__.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 4624, 67, 4146, 12, 4146, 67, 529, 16, 380, 1968, 16, 2826, 4333, 4672, 3536, 6763, 279, 1562, 364, 4588, 635, 326, 12176, 2183, 627, 10335, 8131, 18, 225, 294, 891, 1562, 67, 529, 30, 326, 508, 434, 279, 1562, 4104, 316, 326, 1562, 4023, 18, 294, 891, 521, 14, 1968, 30, 16780, 1775, 358, 1342, 603, 358, 326, 1562, 18, 294, 891, 521, 12174, 14, 4333, 30, 4932, 1775, 358, 1342, 603, 358, 326, 1562, 18, 225, 294, 354, 6141, 25357, 627, 18, 11855, 18, 1248, 10868, 30, 1520, 309, 1158, 4123, 1562, 711, 2118, 4104, 316, 326, 1562, 4023, 18, 225, 294, 6154, 294, 1106, 28288, 2183, 627, 18, 2088, 18, 2771, 1253, 68, 30, 225, 5090, 225, 4080, 436, 273, 4624, 67, 4146, 2932, 2725, 67, 3366, 3113, 508, 1546, 18809, 280, 908, 7695, 541, 11939, 3113, 9388, 33, 1578, 13, 4080, 436, 18, 1672, 1435, 1053, 4080, 436, 18, 2088, 315, 2115, 1703, 3526, 6, 225, 3536, 327, 2230, 67, 3810, 12, 9416, 63, 4146, 67, 529, 6487, 833, 16, 1205, 13, 282, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 4624, 67, 4146, 12, 4146, 67, 529, 16, 380, 1968, 16, 2826, 4333, 4672, 3536, 6763, 279, 1562, 364, 4588, 635, 326, 12176, 2183, 627, 10335, 8131, 18, 225, 294, 891, 1562, 67, 529, 30, 326, 508, 434, 279, 1562, 4104, 316, 326, 1562, 4023, 18, 294, 891, 521, 14, 1968, 30, 16780, 1775, 358, 1342, 603, 358, 326, 1562, 18, 294, 891, 521, 12174, 14, 4333, 30, 4932, 1775, 358, 1342, 603, 358, 326, 1562, 18, 225, 294, 354, 6141, 25357, 627, 18, 11855, 18, 1248, 10868, 30, 1520, 309, 1158, 4123, 1562, 711, 2118, 4104, 316, 326, 1562, 4023, 18, 225, 294, 6154, 294, 1106, 28288, 2183, 627, 18, 2088, 18, 2771, 1253, 68, 30, 225, 2 ]
return _('Factors of %d') % ( self.level_multiple[self.curlevel-1] ) def setLevel(self, n): self.curlevel = n	return _('Factors of %d') % ( self.level_multiple[self.cur_sublevel-1] ) def setLevel(self, level, sublevel): self.curlevel = level self.cur_sublevel = sublevel	def getTitle(self): return _('Factors of %d') % ( self.level_multiple[self.curlevel-1] )	af34e64d38be11ba68a4418286816d4e15a20114 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/11306/af34e64d38be11ba68a4418286816d4e15a20114/gnumch.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 10786, 12, 2890, 4672, 327, 389, 2668, 23535, 434, 738, 72, 6134, 738, 261, 365, 18, 2815, 67, 9622, 63, 2890, 18, 1397, 2815, 17, 21, 65, 262, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 10786, 12, 2890, 4672, 327, 389, 2668, 23535, 434, 738, 72, 6134, 738, 261, 365, 18, 2815, 67, 9622, 63, 2890, 18, 1397, 2815, 17, 21, 65, 262, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
'onclick="toggle(\'%s\'); return false;">-</a>\\2' %	'onclick="return toggle(\'%s\');">-</a>\\2' %	def mark_def(self, s, name): replacement = ('<a name="%s"></a><div id="%s-def">\\1' '<a class="py-toggle" href="#" id="%s-toggle" ' 'onclick="toggle(\'%s\'); return false;">-</a>\\2' % (name, name, name, name)) return re.sub('(.) (<span class="py-line">.)\Z', replacement, s)	cd4d6e5fbca5f698866ebe3598f5c2ca592983e0 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/11420/cd4d6e5fbca5f698866ebe3598f5c2ca592983e0/html_colorize.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 2267, 67, 536, 12, 2890, 16, 272, 16, 508, 4672, 6060, 273, 7707, 32, 69, 508, 11613, 87, 13762, 69, 4438, 2892, 612, 11613, 87, 17, 536, 6441, 1695, 21, 11, 2368, 69, 667, 1546, 2074, 17, 14401, 6, 3897, 1546, 17133, 612, 11613, 87, 17, 14401, 6, 296, 296, 265, 7475, 1546, 2463, 10486, 21923, 9, 87, 3730, 1769, 6441, 17, 1757, 69, 34, 1695, 22, 11, 738, 261, 529, 16, 508, 16, 508, 16, 508, 3719, 327, 283, 18, 1717, 2668, 14361, 261, 32, 3969, 667, 1546, 2074, 17, 1369, 6441, 4509, 5153, 62, 2187, 6060, 16, 272, 13, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 2267, 67, 536, 12, 2890, 16, 272, 16, 508, 4672, 6060, 273, 7707, 32, 69, 508, 11613, 87, 13762, 69, 4438, 2892, 612, 11613, 87, 17, 536, 6441, 1695, 21, 11, 2368, 69, 667, 1546, 2074, 17, 14401, 6, 3897, 1546, 17133, 612, 11613, 87, 17, 14401, 6, 296, 296, 265, 7475, 1546, 2463, 10486, 21923, 9, 87, 3730, 1769, 6441, 17, 1757, 69, 34, 1695, 22, 11, 738, 261, 529, 16, 508, 16, 508, 16, 508, 3719, 327, 283, 18, 1717, 2668, 14361, 261, 32, 3969, 667, 1546, 2074, 17, 1369, 6441, 4509, 5153, 62, 2187, 6060, 16, 272, 13, 225, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
sender, conn = sender		def _pongHandler(sender, id=node.id, host=node.host, port=node.port, table=self.table): sender, conn = sender if id != 20 * ' ' and id != sender['id'].data: # whoah, got response from different peer than we were expecting pass else: sender['host'] = host sender['port'] = port n = Node().initWithDict(sender) table.insertNode(n) return	30d0bd614dd718bb2c3fd331b3c1fd56786a02aa /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/665/30d0bd614dd718bb2c3fd331b3c1fd56786a02aa/khashmir.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 500, 75, 1503, 12, 15330, 16, 612, 33, 2159, 18, 350, 16, 1479, 33, 2159, 18, 2564, 16, 1756, 33, 2159, 18, 655, 16, 1014, 33, 2890, 18, 2121, 4672, 309, 612, 480, 4200, 380, 296, 296, 471, 612, 480, 5793, 3292, 350, 29489, 892, 30, 468, 10354, 9795, 16, 2363, 766, 628, 3775, 4261, 2353, 732, 4591, 17012, 1342, 469, 30, 5793, 3292, 2564, 3546, 273, 1479, 5793, 3292, 655, 3546, 273, 1756, 290, 273, 2029, 7675, 2738, 1190, 5014, 12, 15330, 13, 1014, 18, 6387, 907, 12, 82, 13, 327, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 500, 75, 1503, 12, 15330, 16, 612, 33, 2159, 18, 350, 16, 1479, 33, 2159, 18, 2564, 16, 1756, 33, 2159, 18, 655, 16, 1014, 33, 2890, 18, 2121, 4672, 309, 612, 480, 4200, 380, 296, 296, 471, 612, 480, 5793, 3292, 350, 29489, 892, 30, 468, 10354, 9795, 16, 2363, 766, 628, 3775, 4261, 2353, 732, 4591, 17012, 1342, 469, 30, 5793, 3292, 2564, 3546, 273, 1479, 5793, 3292, 655, 3546, 273, 1756, 290, 273, 2029, 7675, 2738, 1190, 5014, 12, 15330, 13, 1014, 18, 6387, 907, 12, 82, 13, 327, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
ttfont = self.setupFont(font, fontsize * scale_bias)	ttfont = self.setupFont(font, fontsize)	def truetypeText(self, xy, string, **kwargs): scale_bias = 4 fill = kwargs.get('fill') font = kwargs.get('font') fontsize = kwargs.get('fontsize', 11)	b648335863326a7794f99ca7f1c81399a501eb5e /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/81/b648335863326a7794f99ca7f1c81399a501eb5e/DiagramDraw.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 433, 89, 5872, 1528, 12, 2890, 16, 7668, 16, 533, 16, 2826, 4333, 4672, 3159, 67, 13931, 273, 1059, 3636, 273, 1205, 18, 588, 2668, 5935, 6134, 3512, 273, 1205, 18, 588, 2668, 5776, 6134, 14869, 273, 1205, 18, 588, 2668, 23055, 2187, 4648, 13, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 433, 89, 5872, 1528, 12, 2890, 16, 7668, 16, 533, 16, 2826, 4333, 4672, 3159, 67, 13931, 273, 1059, 3636, 273, 1205, 18, 588, 2668, 5935, 6134, 3512, 273, 1205, 18, 588, 2668, 5776, 6134, 14869, 273, 1205, 18, 588, 2668, 23055, 2187, 4648, 13, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
msg = 'No Candidate Sites in Mask'	msg = 'No Candidate Sites in Mask'	def checkJob(self,job): """This method controls the checking of the job. """ self.log.verbose('Job %s will be processed' % (job)) #First check whether the job has an input data requirement result = self.jobDB.getInputData(job) if not result['OK']: self.log.warn('Failed to get input data from JobDB for %s' % (job)) self.log.error(result['Message'])	6a41e53ca0e8385ad60a7fc3b43a5923a12510f3 /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/12864/6a41e53ca0e8385ad60a7fc3b43a5923a12510f3/JobSchedulingAgent.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 866, 2278, 12, 2890, 16, 4688, 4672, 3536, 2503, 707, 11022, 326, 6728, 434, 326, 1719, 18, 3536, 365, 18, 1330, 18, 11369, 2668, 2278, 738, 87, 903, 506, 5204, 11, 738, 261, 4688, 3719, 468, 3759, 866, 2856, 326, 1719, 711, 392, 810, 501, 12405, 563, 273, 365, 18, 4688, 2290, 18, 588, 1210, 751, 12, 4688, 13, 309, 486, 563, 3292, 3141, 3546, 30, 365, 18, 1330, 18, 8935, 2668, 2925, 358, 336, 810, 501, 628, 3956, 2290, 364, 738, 87, 11, 738, 261, 4688, 3719, 365, 18, 1330, 18, 1636, 12, 2088, 3292, 1079, 19486, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 866, 2278, 12, 2890, 16, 4688, 4672, 3536, 2503, 707, 11022, 326, 6728, 434, 326, 1719, 18, 3536, 365, 18, 1330, 18, 11369, 2668, 2278, 738, 87, 903, 506, 5204, 11, 738, 261, 4688, 3719, 468, 3759, 866, 2856, 326, 1719, 711, 392, 810, 501, 12405, 563, 273, 365, 18, 4688, 2290, 18, 588, 1210, 751, 12, 4688, 13, 309, 486, 563, 3292, 3141, 3546, 30, 365, 18, 1330, 18, 8935, 2668, 2925, 358, 336, 810, 501, 628, 3956, 2290, 364, 738, 87, 11, 738, 261, 4688, 3719, 365, 18, 1330, 18, 1636, 12, 2088, 3292, 1079, 19486, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
self.roomsmodel.append([room, users, users])	self.roomsmodel.append([room, users, 0])	def SetRoomList(self, msg): if self.autojoin: self.autojoin = 0 if self.joinedrooms.keys(): list = self.joinedrooms.keys() else: list = self.frame.np.config.sections["server"]["autojoin"]	bd22d9a79d709d993463602575ff87e47daaa60e /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/8738/bd22d9a79d709d993463602575ff87e47daaa60e/chatrooms.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1000, 13646, 682, 12, 2890, 16, 1234, 4672, 225, 309, 365, 18, 6079, 5701, 30, 365, 18, 6079, 5701, 273, 374, 309, 365, 18, 5701, 329, 13924, 87, 18, 2452, 13332, 666, 273, 365, 18, 5701, 329, 13924, 87, 18, 2452, 1435, 469, 30, 666, 273, 365, 18, 3789, 18, 6782, 18, 1425, 18, 11657, 9614, 3567, 6, 6362, 6, 6079, 5701, 11929, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1000, 13646, 682, 12, 2890, 16, 1234, 4672, 225, 309, 365, 18, 6079, 5701, 30, 365, 18, 6079, 5701, 273, 374, 309, 365, 18, 5701, 329, 13924, 87, 18, 2452, 13332, 666, 273, 365, 18, 5701, 329, 13924, 87, 18, 2452, 1435, 469, 30, 666, 273, 365, 18, 3789, 18, 6782, 18, 1425, 18, 11657, 9614, 3567, 6, 6362, 6, 6079, 5701, 11929, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
Individual.__getattr__ = ind_getInfo2	Individual.__getattr__ = Individual.info	def ind_getInfo3(self, field): if field == 'this': return self.__dict__['this'] else: return self.info(field)	11ebaaa64ca7a29581921643e7054787bddf7835 /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/401/11ebaaa64ca7a29581921643e7054787bddf7835/__init__.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1547, 67, 588, 966, 23, 12, 2890, 16, 652, 4672, 309, 652, 422, 296, 2211, 4278, 327, 365, 16186, 1576, 972, 3292, 2211, 3546, 469, 30, 327, 365, 18, 1376, 12, 1518, 13, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1547, 67, 588, 966, 23, 12, 2890, 16, 652, 4672, 309, 652, 422, 296, 2211, 4278, 327, 365, 16186, 1576, 972, 3292, 2211, 3546, 469, 30, 327, 365, 18, 1376, 12, 1518, 13, 225, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
value = theDuration.strftime (self.durationFormat)	if theDuration is not None: value = self.formattedDuration (theDuration, '') else: value = 'hh:mm'	def loadAttributeIntoWidget(self, item, widget): """" Update the widget display based on the value in the attribute. """ try: theDuration = item.duration except AttributeError: value = '?' else: value = theDuration.strftime (self.durationFormat) widget.SetValue (value)	3f9d10450d98d9f910b82730307316ba3d4cf615 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/9228/3f9d10450d98d9f910b82730307316ba3d4cf615/Detail.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1262, 1499, 5952, 4609, 12, 2890, 16, 761, 16, 3604, 4672, 3536, 6, 2315, 326, 3604, 2562, 2511, 603, 326, 460, 316, 326, 1566, 18, 3536, 775, 30, 326, 5326, 273, 761, 18, 8760, 1335, 6394, 30, 460, 273, 6787, 469, 30, 309, 326, 5326, 353, 486, 599, 30, 460, 273, 365, 18, 14897, 5326, 261, 5787, 5326, 16, 28707, 469, 30, 460, 273, 296, 21622, 30, 7020, 11, 3604, 18, 694, 620, 261, 1132, 13, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1262, 1499, 5952, 4609, 12, 2890, 16, 761, 16, 3604, 4672, 3536, 6, 2315, 326, 3604, 2562, 2511, 603, 326, 460, 316, 326, 1566, 18, 3536, 775, 30, 326, 5326, 273, 761, 18, 8760, 1335, 6394, 30, 460, 273, 6787, 469, 30, 309, 326, 5326, 353, 486, 599, 30, 460, 273, 365, 18, 14897, 5326, 261, 5787, 5326, 16, 28707, 469, 30, 460, 273, 296, 21622, 30, 7020, 11, 3604, 18, 694, 620, 261, 1132, 13, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
if t._checked == True: return if not t: raise BoardCoordOutOfRangeExcepton, "Tile coordinate (%d,%d) out of bounds"%(x,y)	if not t: return if t._checked: return	def reveal(self,player,x,y, list=[]): if list==[]: first=True else: first=False t = self.get_tile(x,y) if t._checked == True: return if not t: raise BoardCoordOutOfRangeExcepton, "Tile coordinate (%d,%d) out of bounds"%(x,y) t._checked = True if t.uncovered == 0: t.uncovered = player list.append(t) if t.adjacency==0: for a in self.get_adjacent_tiles(x, y): self.reveal(player,*a.pos,list=list) if first: for l in self.tiles: for t in l: t._checked = False	76b80045ff8fc568b5b27e58828689805a12f2d7 /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/14104/76b80045ff8fc568b5b27e58828689805a12f2d7/game.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 283, 24293, 12, 2890, 16, 14872, 16, 92, 16, 93, 16, 666, 33, 8526, 4672, 309, 666, 631, 8526, 30, 1122, 33, 5510, 469, 30, 1122, 33, 8381, 268, 273, 365, 18, 588, 67, 15368, 12, 92, 16, 93, 13, 309, 486, 268, 30, 327, 309, 268, 6315, 4532, 30, 327, 268, 6315, 4532, 273, 1053, 309, 268, 18, 551, 1643, 329, 422, 374, 30, 268, 18, 551, 1643, 329, 273, 7291, 666, 18, 6923, 12, 88, 13, 309, 268, 18, 13829, 1077, 2075, 631, 20, 30, 364, 279, 316, 365, 18, 588, 67, 13829, 25897, 67, 28366, 12, 92, 16, 677, 4672, 365, 18, 266, 24293, 12, 14872, 16, 14, 69, 18, 917, 16, 1098, 33, 1098, 13, 309, 1122, 30, 364, 328, 316, 365, 18, 28366, 30, 364, 268, 316, 328, 30, 268, 6315, 4532, 273, 1083, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 283, 24293, 12, 2890, 16, 14872, 16, 92, 16, 93, 16, 666, 33, 8526, 4672, 309, 666, 631, 8526, 30, 1122, 33, 5510, 469, 30, 1122, 33, 8381, 268, 273, 365, 18, 588, 67, 15368, 12, 92, 16, 93, 13, 309, 486, 268, 30, 327, 309, 268, 6315, 4532, 30, 327, 268, 6315, 4532, 273, 1053, 309, 268, 18, 551, 1643, 329, 422, 374, 30, 268, 18, 551, 1643, 329, 273, 7291, 666, 18, 6923, 12, 88, 13, 309, 268, 18, 13829, 1077, 2075, 631, 20, 30, 364, 279, 316, 365, 18, 588, 67, 13829, 25897, 67, 28366, 12, 92, 16, 677, 4672, 365, 18, 266, 24293, 12, 14872, 16, 14, 69, 18, 917, 16, 1098, 33, 1098, 2 ]
iter = model.get_iter_root() while iter:	__iter = model.get_iter_root() while __iter:	def get_selected_operations(self): """Return a list of the IDs of the selected operations in the tree view""" r = [] model = self.tree_store.get_model() iter = model.get_iter_root() while iter: #print "debug: get_selected_operations: iter id = '%s', value='%s'" % (model[iter][2], model[iter][1]) if True == model[iter][1]: r.append(model[iter][2]) iter = model.iter_next(iter) return r	9d492cae068d04dccea7b824cceed2984729452a /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/7853/9d492cae068d04dccea7b824cceed2984729452a/GUI.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 336, 67, 8109, 67, 17542, 12, 2890, 4672, 3536, 990, 279, 666, 434, 326, 7115, 434, 326, 3170, 5295, 316, 326, 2151, 1476, 8395, 436, 273, 5378, 938, 273, 365, 18, 3413, 67, 2233, 18, 588, 67, 2284, 1435, 1001, 2165, 273, 938, 18, 588, 67, 2165, 67, 3085, 1435, 1323, 1001, 2165, 30, 468, 1188, 315, 4148, 30, 336, 67, 8109, 67, 17542, 30, 1400, 612, 273, 1995, 87, 2187, 460, 28713, 87, 4970, 738, 261, 2284, 63, 2165, 6362, 22, 6487, 938, 63, 2165, 6362, 21, 5717, 309, 1053, 422, 938, 63, 2165, 6362, 21, 14542, 436, 18, 6923, 12, 2284, 63, 2165, 6362, 22, 5717, 1400, 273, 938, 18, 2165, 67, 4285, 12, 2165, 13, 327, 436, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 336, 67, 8109, 67, 17542, 12, 2890, 4672, 3536, 990, 279, 666, 434, 326, 7115, 434, 326, 3170, 5295, 316, 326, 2151, 1476, 8395, 436, 273, 5378, 938, 273, 365, 18, 3413, 67, 2233, 18, 588, 67, 2284, 1435, 1001, 2165, 273, 938, 18, 588, 67, 2165, 67, 3085, 1435, 1323, 1001, 2165, 30, 468, 1188, 315, 4148, 30, 336, 67, 8109, 67, 17542, 30, 1400, 612, 273, 1995, 87, 2187, 460, 28713, 87, 4970, 738, 261, 2284, 63, 2165, 6362, 22, 6487, 938, 63, 2165, 6362, 21, 5717, 309, 1053, 422, 938, 63, 2165, 6362, 21, 14542, 436, 18, 6923, 12, 2284, 63, 2165, 6362, 22, 5717, 1400, 273, 938, 18, 2165, 67, 4285, 12, 2165, 13, 2 ]
96889010407L 96889010407	96889010407	def cardinality(self): r""" Returns the number of words of length n from alphabet.	dcebd36667c37501e3ed85d2815782c98473a1c8 /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/9417/dcebd36667c37501e3ed85d2815782c98473a1c8/words.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 14379, 12, 2890, 4672, 436, 8395, 2860, 326, 1300, 434, 4511, 434, 769, 290, 628, 10877, 18, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 14379, 12, 2890, 4672, 436, 8395, 2860, 326, 1300, 434, 4511, 434, 769, 290, 628, 10877, 18, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
def archive_db(): print "STATUS: archiving old database" archive_db = "psql template1 postgres -qc " \ " 'ALTER DATABASE %s RENAME TO %s;';" \ " createdb -U postgres %s > /dev/null; " % \ (database, archived_database, database)	def archive_db(database, archived_database): print "Status: archiving old database" archive_db = " dropdb -U postgres %s; > /dev/null 2>&1" \ " psql template1 postgres -qc " \ " 'ALTER DATABASE %s RENAME TO %s;';" \ " createdb -U postgres %s > /dev/null; " % \ (archived_database, database, archived_database, database)	def archive_db(): print "STATUS: archiving old database" archive_db = "psql template1 postgres -qc " \ " 'ALTER DATABASE %s RENAME TO %s;';" \ " createdb -U postgres %s > /dev/null; " % \ (database, archived_database, database) exit_status = os.system(archive_db) if exit_status: print "ERROR: unable to archive database. Upgrade failed" sys.exit(1) print "STATUS: %s has been archived. now named %s" % (database, archived_database)	af98851618b632afb0a950644c796b7c633ace40 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/7598/af98851618b632afb0a950644c796b7c633ace40/upgrade-db.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 5052, 67, 1966, 12, 6231, 16, 23276, 67, 6231, 4672, 225, 1172, 315, 1482, 30, 6637, 9288, 1592, 2063, 6, 5052, 67, 1966, 273, 315, 3640, 1966, 300, 57, 1603, 14107, 738, 87, 31, 405, 342, 5206, 19, 2011, 576, 22393, 21, 6, 521, 315, 4250, 1217, 1542, 21, 1603, 14107, 300, 30675, 315, 521, 315, 296, 18843, 17998, 738, 87, 534, 21150, 8493, 738, 87, 4359, 4868, 521, 315, 2522, 70, 300, 57, 1603, 14107, 738, 87, 405, 342, 5206, 19, 2011, 31, 315, 738, 521, 261, 991, 2950, 67, 6231, 16, 2063, 16, 23276, 67, 6231, 16, 2063, 13, 2427, 67, 2327, 273, 1140, 18, 4299, 12, 10686, 67, 1966, 13, 309, 2427, 67, 2327, 30, 1172, 315, 3589, 30, 13496, 358, 5052, 2063, 18, 17699, 2535, 6, 2589, 18, 8593, 12, 21, 13, 1172, 315, 8608, 30, 738, 87, 711, 2118, 23276, 18, 2037, 4141, 738, 87, 6, 738, 261, 6231, 16, 23276, 67, 6231, 13, 282, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 5052, 67, 1966, 12, 6231, 16, 23276, 67, 6231, 4672, 225, 1172, 315, 1482, 30, 6637, 9288, 1592, 2063, 6, 5052, 67, 1966, 273, 315, 3640, 1966, 300, 57, 1603, 14107, 738, 87, 31, 405, 342, 5206, 19, 2011, 576, 22393, 21, 6, 521, 315, 4250, 1217, 1542, 21, 1603, 14107, 300, 30675, 315, 521, 315, 296, 18843, 17998, 738, 87, 534, 21150, 8493, 738, 87, 4359, 4868, 521, 315, 2522, 70, 300, 57, 1603, 14107, 738, 87, 405, 342, 5206, 19, 2011, 31, 315, 738, 521, 261, 991, 2950, 67, 6231, 16, 2063, 16, 23276, 67, 6231, 16, 2063, 13, 2427, 67, 2327, 273, 1140, 18, 4299, 12, 10686, 67, 1966, 13, 309, 2427, 67, 2327, 30, 2 ]
return cmp(map(int, a.split('.')), map(int, b.split('.')))	aa = a.split('.') bb = b.split('.') for index in range(min(len(aa), len(bb))): result = cmp(int(aa[index]), int(bb[index])) if result != 0: return result return 0	def CompareVersions(a, b): if (a.find('.') < 0) or (b.find('.') < 0): return -1 return cmp(map(int, a.split('.')), map(int, b.split('.')))	1331841a3d5d1a886c5e30836daef2c3d23ecce2 /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/14747/1331841a3d5d1a886c5e30836daef2c3d23ecce2/util.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 11051, 5940, 12, 69, 16, 324, 4672, 309, 261, 69, 18, 4720, 2668, 1093, 13, 411, 374, 13, 578, 261, 70, 18, 4720, 2668, 1093, 13, 411, 374, 4672, 327, 300, 21, 540, 12391, 273, 279, 18, 4939, 2668, 1093, 13, 7129, 273, 324, 18, 4939, 2668, 1093, 13, 364, 770, 316, 1048, 12, 1154, 12, 1897, 12, 7598, 3631, 562, 12, 9897, 3719, 4672, 563, 273, 9411, 12, 474, 12, 7598, 63, 1615, 65, 3631, 509, 12, 9897, 63, 1615, 22643, 309, 563, 480, 374, 30, 327, 563, 327, 374, 282, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 11051, 5940, 12, 69, 16, 324, 4672, 309, 261, 69, 18, 4720, 2668, 1093, 13, 411, 374, 13, 578, 261, 70, 18, 4720, 2668, 1093, 13, 411, 374, 4672, 327, 300, 21, 540, 12391, 273, 279, 18, 4939, 2668, 1093, 13, 7129, 273, 324, 18, 4939, 2668, 1093, 13, 364, 770, 316, 1048, 12, 1154, 12, 1897, 12, 7598, 3631, 562, 12, 9897, 3719, 4672, 563, 273, 9411, 12, 474, 12, 7598, 63, 1615, 65, 3631, 509, 12, 9897, 63, 1615, 22643, 309, 563, 480, 374, 30, 327, 563, 327, 374, 282, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
conn.settimeout(5)	conn.settimeout(10)	def _recv(self): data = '' conn = socket.socket(socket.AF_INET, socket.SOCK_STREAM) conn.connect(self.__addr) conn.settimeout(5) conn.send('++read' + self.__term) while data.find(self.__term) < 0: data += conn.recv(1024) conn.close() return data[:data.find(self.__term)]	c9fb5cb45e19096da2005d67889aea2b141a7f0e /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/14654/c9fb5cb45e19096da2005d67889aea2b141a7f0e/synth_agent.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 18334, 12, 2890, 4672, 501, 273, 875, 1487, 273, 2987, 18, 7814, 12, 7814, 18, 6799, 67, 18819, 16, 2987, 18, 3584, 3507, 67, 13693, 13, 1487, 18, 3612, 12, 2890, 16186, 4793, 13, 1487, 18, 542, 4538, 12, 2163, 13, 1487, 18, 4661, 2668, 9904, 896, 11, 397, 365, 16186, 6408, 13, 1323, 501, 18, 4720, 12, 2890, 16186, 6408, 13, 411, 374, 30, 501, 1011, 1487, 18, 18334, 12, 2163, 3247, 13, 1487, 18, 4412, 1435, 327, 501, 10531, 892, 18, 4720, 12, 2890, 16186, 6408, 25887, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 18334, 12, 2890, 4672, 501, 273, 875, 1487, 273, 2987, 18, 7814, 12, 7814, 18, 6799, 67, 18819, 16, 2987, 18, 3584, 3507, 67, 13693, 13, 1487, 18, 3612, 12, 2890, 16186, 4793, 13, 1487, 18, 542, 4538, 12, 2163, 13, 1487, 18, 4661, 2668, 9904, 896, 11, 397, 365, 16186, 6408, 13, 1323, 501, 18, 4720, 12, 2890, 16186, 6408, 13, 411, 374, 30, 501, 1011, 1487, 18, 18334, 12, 2163, 3247, 13, 1487, 18, 4412, 1435, 327, 501, 10531, 892, 18, 4720, 12, 2890, 16186, 6408, 25887, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
lex = shlex.shlex(StringIO(s))	lex = shlex.shlex(io.StringIO(s))	def oldSplit(self, s): ret = [] lex = shlex.shlex(StringIO(s)) tok = lex.get_token() while tok: ret.append(tok) tok = lex.get_token() return ret	826980d93aa913cc6fc217b1207fb7d5fd98aad3 /local1/tlutelli/issta_data/temp/all_python//python/2007_temp/2007/8125/826980d93aa913cc6fc217b1207fb7d5fd98aad3/test_shlex.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1592, 5521, 12, 2890, 16, 272, 4672, 325, 273, 5378, 5275, 273, 27180, 18, 674, 4149, 12, 1594, 18, 780, 4294, 12, 87, 3719, 946, 273, 5275, 18, 588, 67, 2316, 1435, 1323, 946, 30, 325, 18, 6923, 12, 17692, 13, 946, 273, 5275, 18, 588, 67, 2316, 1435, 327, 325, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1592, 5521, 12, 2890, 16, 272, 4672, 325, 273, 5378, 5275, 273, 27180, 18, 674, 4149, 12, 1594, 18, 780, 4294, 12, 87, 3719, 946, 273, 5275, 18, 588, 67, 2316, 1435, 1323, 946, 30, 325, 18, 6923, 12, 17692, 13, 946, 273, 5275, 18, 588, 67, 2316, 1435, 327, 325, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
self.__p = int(parent.residue_characteristic())	self.__p = integer.Integer(parent.residue_characteristic())	def __init__(self, parent, x, big_oh=infinity, ordp=None, construct=False): r""" INPUT: parent -- a p-adic field. x -- anything that can be coerced to a p-adic number. big_oh -- is such that, e.g. 3^(-1) + 1 + 2 * 3 + (3^2) has big_oh equal to 2. """ field_element.FieldElement.__init__(self, parent) if construct: self.__parent = parent (self.__p, self.__unit, self.__ordp, self.__prec) = x return	2524dc6cf63145fc327980456b747492a7ca7be7 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/9417/2524dc6cf63145fc327980456b747492a7ca7be7/padic.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 2890, 16, 982, 16, 619, 16, 5446, 67, 16699, 33, 267, 7850, 16, 4642, 84, 33, 7036, 16, 4872, 33, 8381, 4672, 436, 8395, 12943, 30, 982, 1493, 279, 293, 17, 20333, 652, 18, 619, 1493, 6967, 716, 848, 506, 12270, 72, 358, 279, 293, 17, 20333, 1300, 18, 5446, 67, 16699, 1493, 353, 4123, 716, 16, 425, 18, 75, 18, 890, 66, 19236, 21, 13, 397, 404, 397, 576, 380, 890, 397, 261, 23, 66, 22, 13, 711, 5446, 67, 16699, 3959, 358, 576, 18, 3536, 652, 67, 2956, 18, 974, 1046, 16186, 2738, 972, 12, 2890, 16, 982, 13, 309, 4872, 30, 365, 16186, 2938, 273, 982, 261, 2890, 16186, 84, 16, 365, 16186, 4873, 16, 365, 16186, 517, 84, 16, 365, 16186, 4036, 13, 273, 619, 327, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 2890, 16, 982, 16, 619, 16, 5446, 67, 16699, 33, 267, 7850, 16, 4642, 84, 33, 7036, 16, 4872, 33, 8381, 4672, 436, 8395, 12943, 30, 982, 1493, 279, 293, 17, 20333, 652, 18, 619, 1493, 6967, 716, 848, 506, 12270, 72, 358, 279, 293, 17, 20333, 1300, 18, 5446, 67, 16699, 1493, 353, 4123, 716, 16, 425, 18, 75, 18, 890, 66, 19236, 21, 13, 397, 404, 397, 576, 380, 890, 397, 261, 23, 66, 22, 13, 711, 5446, 67, 16699, 3959, 358, 576, 18, 3536, 652, 67, 2956, 18, 974, 1046, 16186, 2738, 972, 12, 2890, 16, 982, 13, 309, 4872, 30, 365, 16186, 2938, 273, 982, 261, 2890, 16186, 84, 16, 2 ]
def retry_command(cmd, retries, timeout, sleeptime):	def retry_command(cmd, retries, timeout, sleeptime, stdout_regexp=None, stderr_regexp=None, fail_if_match=False):	def retry_command(cmd, retries, timeout, sleeptime): # Which iteration we're on i = 0 # Current return code rc = False while True: i += 1 rc = run_with_timeout(cmd, timeout) if rc: break if retries > 0 and i >= retries: log.info("Number of retries exceeded maximum (%i), giving up.", retries) break if sleeptime: log.info("Sleeping for %i.", sleeptime) time.sleep(sleeptime) return rc	c43e77b901baa29ea327693e697bb61fd7622486 /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/6206/c43e77b901baa29ea327693e697bb61fd7622486/retry.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 3300, 67, 3076, 12, 4172, 16, 9453, 16, 2021, 16, 272, 11182, 10650, 16, 3909, 67, 17745, 33, 7036, 16, 4514, 67, 17745, 33, 7036, 16, 2321, 67, 430, 67, 1916, 33, 8381, 4672, 468, 21918, 6532, 732, 4565, 603, 277, 273, 374, 225, 468, 6562, 327, 981, 4519, 273, 1083, 225, 1323, 1053, 30, 277, 1011, 404, 225, 4519, 273, 1086, 67, 1918, 67, 4538, 12, 4172, 16, 2021, 13, 225, 309, 4519, 30, 898, 225, 309, 9453, 405, 374, 471, 277, 1545, 9453, 30, 613, 18, 1376, 2932, 1854, 434, 9453, 12428, 4207, 6142, 77, 3631, 21057, 731, 1199, 16, 9453, 13, 898, 225, 309, 272, 11182, 10650, 30, 613, 18, 1376, 2932, 20768, 310, 364, 738, 77, 1199, 16, 272, 11182, 10650, 13, 813, 18, 19607, 12, 87, 11182, 10650, 13, 225, 327, 4519, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 3300, 67, 3076, 12, 4172, 16, 9453, 16, 2021, 16, 272, 11182, 10650, 16, 3909, 67, 17745, 33, 7036, 16, 4514, 67, 17745, 33, 7036, 16, 2321, 67, 430, 67, 1916, 33, 8381, 4672, 468, 21918, 6532, 732, 4565, 603, 277, 273, 374, 225, 468, 6562, 327, 981, 4519, 273, 1083, 225, 1323, 1053, 30, 277, 1011, 404, 225, 4519, 273, 1086, 67, 1918, 67, 4538, 12, 4172, 16, 2021, 13, 225, 309, 4519, 30, 898, 225, 309, 9453, 405, 374, 471, 277, 1545, 9453, 30, 613, 18, 1376, 2932, 1854, 434, 9453, 12428, 4207, 6142, 77, 3631, 21057, 731, 1199, 16, 9453, 13, 898, 225, 309, 272, 11182, 10650, 30, 613, 18, 1376, 2932, 20768, 310, 364, 2 ]
return t + data[9] - time.timezone	return t - data[9] - time.timezone	def mktime_tz(data): """Turn a 10-tuple as returned by parsedate_tz() into a UTC timestamp. Minor glitch: this first interprets the first 8 elements as a local time and then compensates for the timezone difference; this may yield a slight error around daylight savings time switch dates. Not enough to worry about for common use. """ t = time.mktime(data[:8] + (0,)) return t + data[9] - time.timezone	9aa8e8179b2162a324553202bc68d6aa11f490ac /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/3187/9aa8e8179b2162a324553202bc68d6aa11f490ac/rfc822.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 21977, 67, 12994, 12, 892, 4672, 3536, 15858, 279, 1728, 17, 8052, 487, 2106, 635, 1109, 712, 67, 12994, 1435, 1368, 279, 9951, 2858, 18, 225, 29007, 5118, 1437, 30, 333, 1122, 10634, 87, 326, 1122, 1725, 2186, 487, 279, 1191, 813, 471, 1508, 1161, 773, 815, 364, 326, 6371, 7114, 31, 333, 2026, 2824, 279, 20049, 555, 6740, 2548, 5099, 4087, 899, 813, 1620, 7811, 18, 225, 2288, 7304, 358, 26784, 2973, 364, 2975, 999, 18, 225, 3536, 268, 273, 813, 18, 24816, 957, 12, 892, 10531, 28, 65, 397, 261, 20, 16, 3719, 327, 268, 300, 501, 63, 29, 65, 300, 813, 18, 12690, 282, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 21977, 67, 12994, 12, 892, 4672, 3536, 15858, 279, 1728, 17, 8052, 487, 2106, 635, 1109, 712, 67, 12994, 1435, 1368, 279, 9951, 2858, 18, 225, 29007, 5118, 1437, 30, 333, 1122, 10634, 87, 326, 1122, 1725, 2186, 487, 279, 1191, 813, 471, 1508, 1161, 773, 815, 364, 326, 6371, 7114, 31, 333, 2026, 2824, 279, 20049, 555, 6740, 2548, 5099, 4087, 899, 813, 1620, 7811, 18, 225, 2288, 7304, 358, 26784, 2973, 364, 2975, 999, 18, 225, 3536, 268, 273, 813, 18, 24816, 957, 12, 892, 10531, 28, 65, 397, 261, 20, 16, 3719, 327, 268, 300, 501, 63, 29, 65, 300, 813, 18, 12690, 282, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
self.colorkey(1)	if self["key_green"].getBoolean(): self.colorkey(1)	def keyGreen(self): self.colorkey(1)	71dcc2c21cb3488861444e6f4e82a25b77df70ed /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/6652/71dcc2c21cb3488861444e6f4e82a25b77df70ed/AudioSelection.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 498, 21453, 12, 2890, 4672, 365, 18, 1293, 778, 402, 12, 21, 13, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 498, 21453, 12, 2890, 4672, 365, 18, 1293, 778, 402, 12, 21, 13, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
sage: latex(r(2))	sage: latex(r(2))	def _latex_(self): r""" Return LaTeX representation of this R object.	42a77e19371576e2f0fa4a64916832f43f940a8c /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/9890/42a77e19371576e2f0fa4a64916832f43f940a8c/r.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 26264, 67, 12, 2890, 4672, 436, 8395, 2000, 21072, 21575, 60, 4335, 434, 333, 534, 733, 18, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 26264, 67, 12, 2890, 4672, 436, 8395, 2000, 21072, 21575, 60, 4335, 434, 333, 534, 733, 18, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
if krawly == m.j or m.i == 0:	if krawlj == m.j or m.i == 0:	def movebaddy(enemy): "Tactical movement for the bad guys." next = coord(); look = coord() irun = False # This should probably be just (game.quadrant in game.state.kcmdr) + (game.state.kscmdr==game.quadrant) if game.skill >= SKILL_EXPERT: nbaddys = (((game.quadrant in game.state.kcmdr)2 + (game.state.kscmdr==game.quadrant)2+game.klhere1.23+game.irhere1.5)/2.0) else: nbaddys = (game.quadrant in game.state.kcmdr) + (game.state.kscmdr==game.quadrant) dist1 = enemy.kdist mdist = int(dist1 + 0.5); # Nearest integer distance # If SC, check with spy to see if should hi-tail it if enemy.type==IHS and \ (enemy.kpower <= 500.0 or (game.condition=="docked" and not damaged(DPHOTON))): irun = True motion = -QUADSIZE else: # decide whether to advance, retreat, or hold position forces = enemy.kpower+100.0len(game.enemies)+400(nbaddys-1) if not game.shldup: forces += 1000; # Good for enemy if shield is down! if not damaged(DPHASER) or not damaged(DPHOTON): if damaged(DPHASER): # phasers damaged forces += 300.0 else: forces -= 0.2(game.energy - 2500.0) if damaged(DPHOTON): # photon torpedoes damaged forces += 300.0 else: forces -= 50.0game.torps else: # phasers and photon tubes both out! forces += 1000.0 motion = 0 if forces <= 1000.0 and game.condition != "docked": # Typical situation motion = ((forces + randreal(200))/150.0) - 5.0 else: if forces > 1000.0: # Very strong -- move in for kill motion = (1.0 - randreal())*2 dist1 + 1.0 if game.condition=="docked" and (game.options & OPTION_BASE): # protected by base -- back off ! motion -= game.skill(2.0-randreal()2) if idebug: proutn("=== MOTION = %d, FORCES = %1.2f, " % (motion, forces)) # don't move if no motion if motion==0: return # Limit motion according to skill if abs(motion) > game.skill: if motion < 0: motion = -game.skill else: motion = game.skill # calculate preferred number of steps if motion < 0: nsteps = -motion else: nsteps = motion if motion > 0 and nsteps > mdist: nsteps = mdist; # don't overshoot if nsteps > QUADSIZE: nsteps = QUADSIZE; # This shouldn't be necessary if nsteps < 1: nsteps = 1; # This shouldn't be necessary if idebug: proutn("NSTEPS = %d:" % nsteps) # Compute preferred values of delta X and Y m = game.sector - enemy.kloc if 2.0 abs(m.i) < abs(m.j): m.i = 0 if 2.0 * abs(m.j) < abs(game.sector.i-enemy.kloc.i): m.j = 0 if m.i != 0: if m.imotion < 0: m.i = -1 else: m.i = 1 if m.j != 0: if m.jmotion < 0: m.j = -1 else: m.j = 1 next = enemy.kloc # main move loop for ll in range(nsteps): if idebug: proutn(" %d" % (ll+1)) # Check if preferred position available look = next + m if m.i < 0: krawlx = 1 else: krawlx = -1 if m.j < 0: krawly = 1 else: krawly = -1 success = False attempts = 0; # Settle mysterious hang problem while attempts < 20 and not success: attempts += 1 if look.i < 0 or look.i >= QUADSIZE: if motion < 0 and tryexit(enemy, look, irun): return if krawlx == m.i or m.j == 0: break look.i = next.i + krawlx krawlx = -krawlx elif look.j < 0 or look.j >= QUADSIZE: if motion < 0 and tryexit(enemy, look, irun): return if krawly == m.j or m.i == 0: break look.j = next.j + krawly krawly = -krawly elif (game.options & OPTION_RAMMING) and game.quad[look.i][look.j] != IHDOT: # See if enemy should ram ship if game.quad[look.i][look.j] == game.ship and \ (enemy.type == IHC or enemy.type == IHS): collision(rammed=True, enemy=enemy) return if krawlx != m.i and m.j != 0: look.i = next.i + krawlx krawlx = -krawlx elif krawly != m.j and m.i != 0: look.j = next.j + krawly krawly = -krawly else: break; # we have failed else: success = True if success: next = look if idebug: proutn(`next`) else: break; # done early if idebug: skip(1) if enemy.move(next): if not damaged(DSRSENS) or game.condition == "docked": proutn(_("*** %s from Sector %s") % (cramen(enemy.type), enemy.kloc)) if enemy.kdist < dist1: proutn(_(" advances to ")) else: proutn(_(" retreats to ")) prout("Sector %s." % next)	9166a6df132fa18c32881b2019e1fcc41716a3ab /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/3176/9166a6df132fa18c32881b2019e1fcc41716a3ab/sst.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 3635, 70, 31934, 12, 275, 351, 93, 4672, 315, 56, 621, 1706, 26017, 364, 326, 5570, 3058, 1900, 1199, 1024, 273, 2745, 5621, 2324, 273, 2745, 1435, 277, 2681, 273, 1083, 468, 1220, 1410, 8656, 506, 2537, 261, 13957, 18, 21733, 6890, 316, 7920, 18, 2019, 18, 79, 4172, 86, 13, 397, 261, 13957, 18, 2019, 18, 79, 1017, 1264, 86, 631, 13957, 18, 21733, 6890, 13, 309, 7920, 18, 7771, 737, 1545, 12038, 15125, 67, 2294, 3194, 56, 30, 4264, 1289, 1900, 273, 261, 12443, 13957, 18, 21733, 6890, 316, 7920, 18, 2019, 18, 79, 4172, 86, 17653, 22, 397, 261, 13957, 18, 2019, 18, 79, 1017, 1264, 86, 631, 13957, 18, 21733, 6890, 17653, 22, 15, 13957, 18, 16391, 14852, 14, 21, 18, 4366, 15, 13957, 18, 481, 14852, 14, 21, 18, 25, 13176, 22, 18, 20, 13, 469, 30, 4264, 1289, 1900, 273, 261, 13957, 18, 21733, 6890, 316, 7920, 18, 2019, 18, 79, 4172, 86, 13, 397, 261, 13957, 18, 2019, 18, 79, 1017, 1264, 86, 631, 13957, 18, 21733, 6890, 13, 2411, 21, 273, 570, 351, 93, 18, 79, 4413, 3481, 376, 273, 509, 12, 4413, 21, 397, 374, 18, 25, 1769, 468, 7455, 8945, 3571, 3888, 468, 971, 8795, 16, 866, 598, 21459, 358, 2621, 309, 1410, 10118, 17, 13101, 518, 309, 570, 351, 93, 18, 723, 631, 45, 13173, 471, 521, 261, 275, 351, 93, 18, 79, 12238, 1648, 6604, 18, 20, 578, 261, 13957, 18, 4175, 31713, 72, 2 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 3635, 70, 31934, 12, 275, 351, 93, 4672, 315, 56, 621, 1706, 26017, 364, 326, 5570, 3058, 1900, 1199, 1024, 273, 2745, 5621, 2324, 273, 2745, 1435, 277, 2681, 273, 1083, 468, 1220, 1410, 8656, 506, 2537, 261, 13957, 18, 21733, 6890, 316, 7920, 18, 2019, 18, 79, 4172, 86, 13, 397, 261, 13957, 18, 2019, 18, 79, 1017, 1264, 86, 631, 13957, 18, 21733, 6890, 13, 309, 7920, 18, 7771, 737, 1545, 12038, 15125, 67, 2294, 3194, 56, 30, 4264, 1289, 1900, 273, 261, 12443, 13957, 18, 21733, 6890, 316, 7920, 18, 2019, 18, 79, 4172, 86, 17653, 22, 397, 261, 13957, 18, 2019, 18, 79, 1017, 1264, 86, 631, 13957, 18, 21733, 6890, 17653, 22, 15, 2 ]
plugin_api.AddToolbarItem(self.tb_button)	plugin_api.add_toolbar_item(self.button)	def activate(self, plugin_api): self.menu_item = gtk.MenuItem("Start task in Hamster") self.menu_item.connect('activate', self.browser_cb, plugin_api) self.tb_button=gtk.ToolButton() self.tb_button.set_label("Start") self.tb_button.set_icon_name('hamster-applet') self.tb_button.set_tooltip_text("Start a new activity in Hamster Time Tracker based on the selected task") self.tb_button.connect('clicked', self.browser_cb, plugin_api) # add a menu item to the menu bar plugin_api.AddMenuItem(self.menu_item) # saves the separator's index to later remove it self.separator = plugin_api.AddToolbarItem(gtk.SeparatorToolItem()) # add a item (button) to the ToolBar plugin_api.AddToolbarItem(self.tb_button)	7172602e6dde54005cdbf7139d595e8248bd20d0 /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/7036/7172602e6dde54005cdbf7139d595e8248bd20d0/hamster.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 10235, 12, 2890, 16, 1909, 67, 2425, 4672, 365, 18, 5414, 67, 1726, 273, 22718, 18, 12958, 2932, 1685, 1562, 316, 670, 301, 8190, 7923, 365, 18, 5414, 67, 1726, 18, 3612, 2668, 10014, 2187, 365, 18, 11213, 67, 7358, 16, 1909, 67, 2425, 13, 225, 365, 18, 18587, 67, 5391, 33, 4521, 79, 18, 6364, 3616, 1435, 365, 18, 18587, 67, 5391, 18, 542, 67, 1925, 2932, 1685, 7923, 365, 18, 18587, 67, 5391, 18, 542, 67, 3950, 67, 529, 2668, 31698, 8190, 17, 438, 1469, 6134, 365, 18, 18587, 67, 5391, 18, 542, 67, 19798, 67, 955, 2932, 1685, 279, 394, 5728, 316, 670, 301, 8190, 2647, 11065, 264, 2511, 603, 326, 3170, 1562, 7923, 365, 18, 18587, 67, 5391, 18, 3612, 2668, 7475, 329, 2187, 365, 18, 11213, 67, 7358, 16, 1909, 67, 2425, 13, 225, 468, 527, 279, 3824, 761, 358, 326, 3824, 4653, 1909, 67, 2425, 18, 986, 12958, 12, 2890, 18, 5414, 67, 1726, 13, 225, 468, 14649, 326, 4182, 1807, 770, 358, 5137, 1206, 518, 365, 18, 11287, 273, 1909, 67, 2425, 18, 986, 17907, 1180, 12, 4521, 79, 18, 6581, 6364, 1180, 10756, 468, 527, 279, 761, 261, 5391, 13, 358, 326, 13288, 5190, 1909, 67, 2425, 18, 986, 17907, 1180, 12, 2890, 18, 18587, 67, 5391, 13, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 10235, 12, 2890, 16, 1909, 67, 2425, 4672, 365, 18, 5414, 67, 1726, 273, 22718, 18, 12958, 2932, 1685, 1562, 316, 670, 301, 8190, 7923, 365, 18, 5414, 67, 1726, 18, 3612, 2668, 10014, 2187, 365, 18, 11213, 67, 7358, 16, 1909, 67, 2425, 13, 225, 365, 18, 18587, 67, 5391, 33, 4521, 79, 18, 6364, 3616, 1435, 365, 18, 18587, 67, 5391, 18, 542, 67, 1925, 2932, 1685, 7923, 365, 18, 18587, 67, 5391, 18, 542, 67, 3950, 67, 529, 2668, 31698, 8190, 17, 438, 1469, 6134, 365, 18, 18587, 67, 5391, 18, 542, 67, 19798, 67, 955, 2932, 1685, 279, 394, 5728, 316, 670, 301, 8190, 2647, 11065, 264, 2511, 603, 326, 3170, 1562, 7923, 365, 2 ]
if country.adminarea_set.filter(active=True).filter(Q(name=data.capitalize())\|Q(abbrev=data.upper())).count() != 1:	if country.adminarea_set.filter(active=True).filter(Q(name=data)\|Q(abbrev=data)\|Q(name=data.capitalize())\|Q(abbrev=data.upper())).count() != 1:	def clean_state(self): data = self.cleaned_data.get('state') if self._local_only: country = self._default_country else: country = self.fields['country'].clean(self.data['country']) if country.adminarea_set.filter(active=True).count() > 0: if not data or data == selection and not self._billing_data_optional: raise forms.ValidationError( self._local_only and _('This field is required.') \ or _('State is required for your country.')) if country.adminarea_set.filter(active=True).filter(Q(name=data.capitalize())\|Q(abbrev=data.upper())).count() != 1: raise forms.ValidationError(_('Invalid state or province.')) return data	ee4e1486c68d9e1c6870b61b5e55c294fb67e2aa /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/13656/ee4e1486c68d9e1c6870b61b5e55c294fb67e2aa/forms.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 2721, 67, 2019, 12, 2890, 4672, 501, 273, 365, 18, 6200, 329, 67, 892, 18, 588, 2668, 2019, 6134, 309, 365, 6315, 3729, 67, 3700, 30, 5251, 273, 365, 6315, 1886, 67, 9082, 469, 30, 5251, 273, 365, 18, 2821, 3292, 9082, 29489, 6200, 12, 2890, 18, 892, 3292, 9082, 19486, 309, 5251, 18, 3666, 5036, 67, 542, 18, 2188, 12, 3535, 33, 5510, 2934, 1883, 1435, 405, 374, 30, 309, 486, 501, 578, 501, 422, 4421, 471, 486, 365, 6315, 16360, 67, 892, 67, 10444, 30, 1002, 10138, 18, 12101, 12, 365, 6315, 3729, 67, 3700, 471, 389, 2668, 2503, 652, 353, 1931, 1093, 13, 521, 578, 389, 2668, 1119, 353, 1931, 364, 3433, 5251, 1093, 3719, 309, 5251, 18, 3666, 5036, 67, 542, 18, 2188, 12, 3535, 33, 5510, 2934, 2188, 12, 53, 12, 529, 33, 892, 14047, 53, 12, 378, 27216, 33, 892, 14047, 53, 12, 529, 33, 892, 18, 5909, 7053, 554, 10756, 96, 53, 12, 378, 27216, 33, 892, 18, 5797, 10756, 2934, 1883, 1435, 480, 404, 30, 1002, 10138, 18, 12101, 24899, 2668, 1941, 919, 578, 17197, 2410, 1093, 3719, 327, 501, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 2721, 67, 2019, 12, 2890, 4672, 501, 273, 365, 18, 6200, 329, 67, 892, 18, 588, 2668, 2019, 6134, 309, 365, 6315, 3729, 67, 3700, 30, 5251, 273, 365, 6315, 1886, 67, 9082, 469, 30, 5251, 273, 365, 18, 2821, 3292, 9082, 29489, 6200, 12, 2890, 18, 892, 3292, 9082, 19486, 309, 5251, 18, 3666, 5036, 67, 542, 18, 2188, 12, 3535, 33, 5510, 2934, 1883, 1435, 405, 374, 30, 309, 486, 501, 578, 501, 422, 4421, 471, 486, 365, 6315, 16360, 67, 892, 67, 10444, 30, 1002, 10138, 18, 12101, 12, 365, 6315, 3729, 67, 3700, 471, 389, 2668, 2503, 652, 353, 1931, 1093, 13, 521, 578, 389, 2668, 1119, 353, 1931, 364, 3433, 5251, 1093, 3719, 2 ]
{'summary': 'Yo é'}]}	{ 'title': 'Yo é', 'summary': 'Yo é' }]}	def test_blog_entries(self, mock_feedparser_parse): mock_feedparser_parse.return_value = { 'entries': [ {'summary': 'Yo é'}]} entries = mysite.customs.feed._blog_entries() self.assertEqual(entries[0]['unicode_text'], u'Yo \xe9')	f50ea125e2e5610b3ed4d02dbf938f738eeffad7 /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/11976/f50ea125e2e5610b3ed4d02dbf938f738eeffad7/tests.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1842, 67, 11439, 67, 8219, 12, 2890, 16, 5416, 67, 7848, 4288, 67, 2670, 4672, 5416, 67, 7848, 4288, 67, 2670, 18, 2463, 67, 1132, 273, 288, 296, 8219, 4278, 306, 288, 296, 2649, 4278, 296, 61, 83, 473, 73, 1077, 624, 31, 2187, 296, 7687, 4278, 296, 61, 83, 473, 73, 1077, 624, 4359, 289, 18322, 3222, 273, 312, 1900, 1137, 18, 3662, 87, 18, 7848, 6315, 11439, 67, 8219, 1435, 365, 18, 11231, 5812, 12, 8219, 63, 20, 23962, 9124, 67, 955, 17337, 582, 11, 61, 83, 521, 6554, 29, 6134, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1842, 67, 11439, 67, 8219, 12, 2890, 16, 5416, 67, 7848, 4288, 67, 2670, 4672, 5416, 67, 7848, 4288, 67, 2670, 18, 2463, 67, 1132, 273, 288, 296, 8219, 4278, 306, 288, 296, 2649, 4278, 296, 61, 83, 473, 73, 1077, 624, 31, 2187, 296, 7687, 4278, 296, 61, 83, 473, 73, 1077, 624, 4359, 289, 18322, 3222, 273, 312, 1900, 1137, 18, 3662, 87, 18, 7848, 6315, 11439, 67, 8219, 1435, 365, 18, 11231, 5812, 12, 8219, 63, 20, 23962, 9124, 67, 955, 17337, 582, 11, 61, 83, 521, 6554, 29, 6134, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
for x in ipath: cmd = cmd + ' -I"' + dotdots + x + '"'	for x in ipath: cmd = cmd + ' -I' + dotdots + x	def Interrogate(ipath=0, opts=0, outd=0, outc=0, src=0, module=0, library=0, files=0): if ((ipath==0)\|(opts==0)\|(outd==0)\|(outc==0)\|(src==0)\|(module==0)\|(library==0)\|(files==0)): sys.exit("syntax error in Interrogate directive") ALLIN.append(outd) ipath = [PREFIX+"/tmp"] + ipath + [PREFIX+"/include"] outd = PREFIX+"/pandac/input/"+outd outc = PREFIX+"/tmp/"+outc paths = xpaths(src+"/",files,"") dep = CxxCalcDependenciesAll(paths, ipath) dotdots = "" for i in range(0,src.count("/")+1): dotdots = dotdots + "../" building = 0 for x in opts: if (x[:9]=="BUILDING_"): building = x[9:] if (older(outc, dep) or older(outd, dep)): if (COMPILER=="MSVC7"): cmd = '"' + dotdots + PREFIX+'/bin/interrogate.exe"' cmd = cmd + ' -DCPPPARSER -D__STDC__=1 -D__cplusplus -longlong __int64 -D_X86_ -DWIN32_VC -D_WIN32' cmd = cmd + ' -D"_declspec(param)=" -D_near -D_far -D__near -D__far -D__stdcall' if (OPTIMIZE==1): cmd = cmd + ' ' if (OPTIMIZE==2): cmd = cmd + ' ' if (OPTIMIZE==3): cmd = cmd + ' -DFORCE_INLINING' if (OPTIMIZE==4): cmd = cmd + ' -DFORCE_INLINING' cmd = cmd + ' -S"' + dotdots + PREFIX+'/include/parser-inc"' cmd = cmd + ' -I"' + dotdots + PREFIX+'/python/include"' if (COMPILER=="LINUXA"): cmd = '"' + dotdots + PREFIX + '/bin/interrogate"' cmd = cmd + ' -DCPPPARSER -D__STDC__=1 -D__cplusplus -D__i386__ -D__const=const' if (OPTIMIZE==1): cmd = cmd + ' ' if (OPTIMIZE==2): cmd = cmd + ' ' if (OPTIMIZE==3): cmd = cmd + ' ' if (OPTIMIZE==4): cmd = cmd + ' ' cmd = cmd + ' -S"' + dotdots + PREFIX+'/include/parser-inc" -S"/usr/include"' cmd = cmd + ' -I"' + dotdots + PREFIX+'/python/include"' cmd = cmd + ' -oc "' + dotdots + outc + '" -od "' + dotdots + outd + '"' cmd = cmd + ' -fnames -string -refcount -assert -python' for x in ipath: cmd = cmd + ' -I"' + dotdots + x + '"' if (building): cmd = cmd + " -DBUILDING_"+building if (opts.count("WITHINPANDA")): cmd = cmd + " -DWITHIN_PANDA" for pkg in PACKAGES: if (PkgSelected(opts,pkg)): cmd = cmd + ' -I"' + dotdots + THIRDPARTY + pkg.lower() + "/include" + '"' cmd = cmd + ' -module "' + module + '" -library "' + library + '"' if ((COMPILER=="MSVC7") and opts.count("DXSDK")): cmd = cmd + ' -I"' + DIRECTXSDK + '/include"' if ((COMPILER=="MSVC7") and opts.count("MAYA5")): cmd = cmd + ' -I"' + Maya5SDK + 'include"' if ((COMPILER=="MSVC7") and opts.count("MAYA6")): cmd = cmd + ' -I"' + Maya6SDK + 'include"' for x in files: cmd = cmd + ' ' + x oslocalcmd(src, cmd) updatefiledate(outd) updatefiledate(outc)	e743cb25c4127c99b6bf2de385cf618b18e32531 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/7242/e743cb25c4127c99b6bf2de385cf618b18e32531/makepanda.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 5294, 15283, 12, 625, 421, 33, 20, 16, 1500, 33, 20, 16, 596, 72, 33, 20, 16, 596, 71, 33, 20, 16, 1705, 33, 20, 16, 1605, 33, 20, 16, 5313, 33, 20, 16, 1390, 33, 20, 4672, 309, 14015, 625, 421, 631, 20, 14047, 12, 4952, 631, 20, 14047, 12, 659, 72, 631, 20, 14047, 12, 659, 71, 631, 20, 14047, 12, 4816, 631, 20, 14047, 12, 2978, 631, 20, 14047, 12, 12083, 631, 20, 14047, 12, 2354, 631, 20, 3719, 30, 2589, 18, 8593, 2932, 14308, 555, 316, 5294, 15283, 8655, 7923, 8061, 706, 18, 6923, 12, 659, 72, 13, 277, 803, 273, 306, 6307, 9078, 19, 5645, 11929, 397, 277, 803, 397, 306, 6307, 9078, 19, 6702, 11929, 596, 72, 273, 17154, 9078, 19, 84, 464, 1077, 19, 2630, 4898, 15, 659, 72, 596, 71, 273, 17154, 9078, 19, 5645, 4898, 15, 659, 71, 2953, 273, 619, 4481, 12, 4816, 9078, 19, 3113, 2354, 16, 3660, 13, 5993, 273, 385, 5279, 25779, 8053, 1595, 12, 4481, 16, 277, 803, 13, 3928, 72, 6968, 273, 1408, 364, 277, 316, 1048, 12, 20, 16, 4816, 18, 1883, 2932, 4898, 27921, 21, 4672, 3928, 72, 6968, 273, 3928, 72, 6968, 397, 315, 838, 4898, 10504, 273, 374, 364, 619, 316, 1500, 30, 309, 261, 92, 10531, 29, 65, 31713, 20215, 1360, 9548, 4672, 10504, 273, 619, 63, 29, 26894, 309, 261, 1498, 12, 659, 71, 16, 5993, 13, 578, 12156, 12, 659, 72, 16, 5993, 3719, 2 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 5294, 15283, 12, 625, 421, 33, 20, 16, 1500, 33, 20, 16, 596, 72, 33, 20, 16, 596, 71, 33, 20, 16, 1705, 33, 20, 16, 1605, 33, 20, 16, 5313, 33, 20, 16, 1390, 33, 20, 4672, 309, 14015, 625, 421, 631, 20, 14047, 12, 4952, 631, 20, 14047, 12, 659, 72, 631, 20, 14047, 12, 659, 71, 631, 20, 14047, 12, 4816, 631, 20, 14047, 12, 2978, 631, 20, 14047, 12, 12083, 631, 20, 14047, 12, 2354, 631, 20, 3719, 30, 2589, 18, 8593, 2932, 14308, 555, 316, 5294, 15283, 8655, 7923, 8061, 706, 18, 6923, 12, 659, 72, 13, 277, 803, 273, 306, 6307, 9078, 19, 5645, 11929, 397, 277, 803, 397, 306, 6307, 9078, 2 ]
self._write(self.write_term_index, directory, 'term-index.html', indices)	self._write(self.write_link_index, directory, 'term-index.html', indices, 'Term Definition Index', 'term-index.html', 'term')	def write(self, directory=None): """ Write the documentation to the given directory.	5c410b5b6e25df3bdbc6da266f7773518165cb02 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/3512/5c410b5b6e25df3bdbc6da266f7773518165cb02/html.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1045, 12, 2890, 16, 1867, 33, 7036, 4672, 3536, 2598, 326, 7323, 358, 326, 864, 1867, 18, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1045, 12, 2890, 16, 1867, 33, 7036, 4672, 3536, 2598, 326, 7323, 358, 326, 864, 1867, 18, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
self.model["card"] = zdc.ObjectView(card)	self.model["card"] = [zdc.ObjectView(card)]	def act_confirm(self): import zebra, zdc #@TODO: make a .fromDict or .consult for zdc.RecordObjects # for now, we'll assume this is okay, since the classes have # already validated everything in here: bill = zikebase.Contact(); bill._data = self.billData ship = zikebase.Contact(); ship._data = self.shipData card = zikeshop.Card(); card._data = self.cardData	8f9da0ecdf1f4ffe43c7c8552ad5e88ade81637e /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/8821/8f9da0ecdf1f4ffe43c7c8552ad5e88ade81637e/checkout.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1328, 67, 10927, 12, 2890, 4672, 1930, 26637, 15397, 16, 998, 7201, 468, 36, 6241, 30, 1221, 279, 263, 2080, 5014, 578, 263, 8559, 406, 364, 998, 7201, 18, 2115, 4710, 468, 364, 2037, 16, 732, 5614, 6750, 333, 353, 21194, 16, 3241, 326, 3318, 1240, 468, 1818, 10266, 7756, 316, 2674, 30, 20714, 273, 998, 2547, 1969, 18, 6567, 5621, 20714, 6315, 892, 273, 365, 18, 17240, 751, 24316, 273, 998, 2547, 1969, 18, 6567, 5621, 24316, 6315, 892, 273, 365, 18, 3261, 751, 5270, 273, 998, 1766, 4607, 556, 18, 6415, 5621, 5270, 6315, 892, 273, 365, 18, 3327, 751, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1328, 67, 10927, 12, 2890, 4672, 1930, 26637, 15397, 16, 998, 7201, 468, 36, 6241, 30, 1221, 279, 263, 2080, 5014, 578, 263, 8559, 406, 364, 998, 7201, 18, 2115, 4710, 468, 364, 2037, 16, 732, 5614, 6750, 333, 353, 21194, 16, 3241, 326, 3318, 1240, 468, 1818, 10266, 7756, 316, 2674, 30, 20714, 273, 998, 2547, 1969, 18, 6567, 5621, 20714, 6315, 892, 273, 365, 18, 17240, 751, 24316, 273, 998, 2547, 1969, 18, 6567, 5621, 24316, 6315, 892, 273, 365, 18, 3261, 751, 5270, 273, 998, 1766, 4607, 556, 18, 6415, 5621, 5270, 6315, 892, 273, 365, 18, 3327, 751, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
class DocstringTestCase(unittest.TestCase):	class DocstringTestCase(SecureTestCase):	def getModuleObjects(folder, rootName, typ): "Get a list of all function objects defined somewhere in a package." folders = [folder] + subFoldersOfFolder(folder) objects = [] for f in folders: sys.path.insert(0, f) os.chdir(f) pattern = os.path.join('*.py') prefix = f[string.find(f, rootName):] prefix = string.replace(prefix, os.sep, '.') modNames = glob.glob(pattern) modNames = filter(lambda m:string.find(m, '__init__.py') == -1, modNames) # Make module names fully qualified. for i in range(len(modNames)): modNames[i] = prefix + '.' + modNames[i][:string.find(modNames[i], '.')] for mName in modNames: module = __import__(mName) # Get the 'real' (leaf) module # (__import__ loads only the top-level one). if string.find(mName, '.') != -1: for part in string.split(mName, '.')[1:]: module = getattr(module, part) # Find the objects in the module's content. modContentNames = dir(module) # Handle modules. if typ == types.ModuleType: if string.find(module.__name__, 'reportlab') > -1: objects.append((mName, module)) continue for n in modContentNames: obj = eval(mName + '.' + n) # Handle functions and classes. if typ in (types.FunctionType, types.ClassType): if type(obj) == typ: objects.append((mName, obj)) # Handle methods. elif typ == types.MethodType: if type(obj) == types.ClassType: for m in dir(obj): a = getattr(obj, m) if type(a) == typ: cName = obj.__name__ objects.append(("%s.%s" % (mName, cName), a)) del sys.path[0] return objects	b5a2e28469e8eb9f8edf3d66ca5ecf2c5f7f3905 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/3878/b5a2e28469e8eb9f8edf3d66ca5ecf2c5f7f3905/test_docstrings.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 11251, 4710, 12, 5609, 16, 1365, 461, 16, 3815, 4672, 315, 967, 279, 666, 434, 777, 445, 2184, 2553, 380, 87, 362, 359, 14852, 14, 316, 279, 2181, 1199, 225, 9907, 273, 306, 5609, 65, 397, 720, 14885, 951, 3899, 12, 5609, 13, 225, 2184, 273, 5378, 364, 284, 316, 9907, 30, 2589, 18, 803, 18, 6387, 12, 20, 16, 284, 13, 1140, 18, 343, 1214, 12, 74, 13, 1936, 273, 1140, 18, 803, 18, 5701, 2668, 11146, 2074, 6134, 1633, 273, 284, 63, 1080, 18, 4720, 12, 74, 16, 1365, 461, 4672, 65, 1633, 273, 533, 18, 2079, 12, 3239, 16, 1140, 18, 10814, 16, 2611, 13, 681, 1557, 273, 4715, 18, 10581, 12, 4951, 13, 681, 1557, 273, 1034, 12, 14661, 312, 30, 1080, 18, 4720, 12, 81, 16, 4940, 2738, 25648, 2074, 6134, 422, 300, 21, 16, 681, 1557, 13, 468, 4344, 1605, 1257, 7418, 9348, 18, 364, 277, 316, 1048, 12, 1897, 12, 1711, 1557, 3719, 30, 681, 1557, 63, 77, 65, 273, 1633, 397, 2611, 397, 681, 1557, 63, 77, 6362, 30, 1080, 18, 4720, 12, 1711, 1557, 63, 77, 6487, 2611, 25887, 364, 312, 461, 316, 681, 1557, 30, 1605, 273, 1001, 5666, 972, 12, 81, 461, 13, 468, 968, 326, 296, 7688, 11, 261, 12070, 13, 1605, 468, 261, 972, 5666, 972, 6277, 1338, 326, 1760, 17, 2815, 1245, 2934, 309, 533, 18, 4720, 12, 81, 461, 16, 2611, 13, 480, 300, 21, 30, 364, 1087, 316, 533, 18, 2 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 11251, 4710, 12, 5609, 16, 1365, 461, 16, 3815, 4672, 315, 967, 279, 666, 434, 777, 445, 2184, 2553, 380, 87, 362, 359, 14852, 14, 316, 279, 2181, 1199, 225, 9907, 273, 306, 5609, 65, 397, 720, 14885, 951, 3899, 12, 5609, 13, 225, 2184, 273, 5378, 364, 284, 316, 9907, 30, 2589, 18, 803, 18, 6387, 12, 20, 16, 284, 13, 1140, 18, 343, 1214, 12, 74, 13, 1936, 273, 1140, 18, 803, 18, 5701, 2668, 11146, 2074, 6134, 1633, 273, 284, 63, 1080, 18, 4720, 12, 74, 16, 1365, 461, 4672, 65, 1633, 273, 533, 18, 2079, 12, 3239, 16, 1140, 18, 10814, 16, 2611, 13, 681, 1557, 273, 4715, 18, 10581, 12, 4951, 13, 681, 2 ]
FakeProxyHandler.digest_auth_handler.set_qop("auth")	self.digest_auth_handler.set_qop("auth")	def test_proxy_with_bad_password_raises_httperror(self): self._digest_auth_handler.add_password(self.REALM, self.URL, self.USER, self.PASSWD+"bad") FakeProxyHandler.digest_auth_handler.set_qop("auth") self.assertRaises(urllib2.HTTPError, self.opener.open, self.URL)	f03c42f0ab4b4fc0705e2717a89af1254820fed3 /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/8546/f03c42f0ab4b4fc0705e2717a89af1254820fed3/test_urllib2_localnet.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1842, 67, 5656, 67, 1918, 67, 8759, 67, 3664, 67, 354, 6141, 67, 2505, 1636, 12, 2890, 4672, 365, 6315, 10171, 67, 1944, 67, 4176, 18, 1289, 67, 3664, 12, 2890, 18, 31052, 49, 16, 365, 18, 1785, 16, 365, 18, 4714, 16, 365, 18, 10884, 16006, 9078, 8759, 7923, 365, 18, 10171, 67, 1944, 67, 4176, 18, 542, 67, 85, 556, 2932, 1944, 7923, 365, 18, 11231, 12649, 6141, 12, 718, 2941, 22, 18, 3693, 668, 16, 365, 18, 25098, 18, 3190, 16, 365, 18, 1785, 13, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1842, 67, 5656, 67, 1918, 67, 8759, 67, 3664, 67, 354, 6141, 67, 2505, 1636, 12, 2890, 4672, 365, 6315, 10171, 67, 1944, 67, 4176, 18, 1289, 67, 3664, 12, 2890, 18, 31052, 49, 16, 365, 18, 1785, 16, 365, 18, 4714, 16, 365, 18, 10884, 16006, 9078, 8759, 7923, 365, 18, 10171, 67, 1944, 67, 4176, 18, 542, 67, 85, 556, 2932, 1944, 7923, 365, 18, 11231, 12649, 6141, 12, 718, 2941, 22, 18, 3693, 668, 16, 365, 18, 25098, 18, 3190, 16, 365, 18, 1785, 13, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
def test_chainHandling(self): """PDBModel chain handling and writing test"""	def test_chainBreaks(self): """PDBModel chain break handling and writing test"""	def test_chainHandling(self): """PDBModel chain handling and writing test""" self.m4 = B.PDBModel( T.testRoot()+'/com/1BGS_original.pdb') self.assertEqual( self.m4.lenChains(), 9 ) self.assertEqual( self.m4.lenChains( breaks=1 ), 138 ) self.m4.writePdb( self.fout_pdb, ter=2 )	d1c3d5f9c43c1af7d5e068db8407753d7aed3a40 /local1/tlutelli/issta_data/temp/all_python//python/2007_temp/2007/482/d1c3d5f9c43c1af7d5e068db8407753d7aed3a40/PDBModel.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1842, 67, 5639, 26806, 12, 2890, 4672, 3536, 52, 2290, 1488, 2687, 898, 5057, 471, 7410, 1842, 8395, 365, 18, 81, 24, 273, 605, 18, 52, 2290, 1488, 12, 399, 18, 3813, 2375, 1435, 6797, 19, 832, 19, 21, 38, 16113, 67, 8830, 18, 17414, 6134, 365, 18, 11231, 5812, 12, 365, 18, 81, 24, 18, 1897, 15945, 9334, 2468, 262, 365, 18, 11231, 5812, 12, 365, 18, 81, 24, 18, 1897, 15945, 12, 16217, 33, 21, 262, 16, 5958, 28, 262, 365, 18, 81, 24, 18, 2626, 52, 1966, 12, 365, 18, 617, 322, 67, 17414, 16, 19272, 33, 22, 262, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1842, 67, 5639, 26806, 12, 2890, 4672, 3536, 52, 2290, 1488, 2687, 898, 5057, 471, 7410, 1842, 8395, 365, 18, 81, 24, 273, 605, 18, 52, 2290, 1488, 12, 399, 18, 3813, 2375, 1435, 6797, 19, 832, 19, 21, 38, 16113, 67, 8830, 18, 17414, 6134, 365, 18, 11231, 5812, 12, 365, 18, 81, 24, 18, 1897, 15945, 9334, 2468, 262, 365, 18, 11231, 5812, 12, 365, 18, 81, 24, 18, 1897, 15945, 12, 16217, 33, 21, 262, 16, 5958, 28, 262, 365, 18, 81, 24, 18, 2626, 52, 1966, 12, 365, 18, 617, 322, 67, 17414, 16, 19272, 33, 22, 262, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
if self._sampleNum < 60*60:	if self._memSampleNum < 60*60:	def _nextMemSample(self): curUsage = self._getValue() self._usage.append(curUsage) maxUsage = self._maxUsage[-1] if curUsage>maxUsage: maxUsage = curUsage lastMaxChangeTime = time.time() self._textNode1.text = ("Last increase in maximum: " +time.strftime("%H:%M:%S", time.localtime(lastMaxChangeTime))) self._maxUsage.append(maxUsage) self._sampleNum += 1 if self._sampleNum % 60 == 0: lastMinuteAverage = sum(self._usage[-60:])/60 self._minutesUsage.append(lastMinuteAverage) self._minutesMaxUsage.append(maxUsage)	5db631b9081e9af0ba5615613d6fbe26fed5b363 /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/7300/5db631b9081e9af0ba5615613d6fbe26fed5b363/AVGAppStarter.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 4285, 3545, 8504, 12, 2890, 4672, 662, 5357, 273, 365, 6315, 24805, 1435, 365, 6315, 9167, 18, 6923, 12, 1397, 5357, 13, 943, 5357, 273, 365, 6315, 1896, 5357, 18919, 21, 65, 309, 662, 5357, 34, 1896, 5357, 30, 943, 5357, 273, 662, 5357, 1142, 2747, 3043, 950, 273, 813, 18, 957, 1435, 365, 6315, 955, 907, 21, 18, 955, 273, 7566, 3024, 10929, 316, 4207, 30, 315, 397, 957, 18, 701, 9982, 27188, 44, 5319, 49, 5319, 55, 3113, 813, 18, 3729, 957, 12, 2722, 2747, 3043, 950, 20349, 365, 6315, 1896, 5357, 18, 6923, 12, 1896, 5357, 13, 365, 6315, 6358, 2578, 1011, 404, 309, 365, 6315, 6358, 2578, 738, 4752, 422, 374, 30, 1142, 18329, 17115, 273, 2142, 12, 2890, 6315, 9167, 18919, 4848, 30, 5717, 19, 4848, 365, 6315, 17916, 5357, 18, 6923, 12, 2722, 18329, 17115, 13, 365, 6315, 17916, 2747, 5357, 18, 6923, 12, 1896, 5357, 13, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 4285, 3545, 8504, 12, 2890, 4672, 662, 5357, 273, 365, 6315, 24805, 1435, 365, 6315, 9167, 18, 6923, 12, 1397, 5357, 13, 943, 5357, 273, 365, 6315, 1896, 5357, 18919, 21, 65, 309, 662, 5357, 34, 1896, 5357, 30, 943, 5357, 273, 662, 5357, 1142, 2747, 3043, 950, 273, 813, 18, 957, 1435, 365, 6315, 955, 907, 21, 18, 955, 273, 7566, 3024, 10929, 316, 4207, 30, 315, 397, 957, 18, 701, 9982, 27188, 44, 5319, 49, 5319, 55, 3113, 813, 18, 3729, 957, 12, 2722, 2747, 3043, 950, 20349, 365, 6315, 1896, 5357, 18, 6923, 12, 1896, 5357, 13, 365, 6315, 6358, 2578, 1011, 404, 309, 365, 6315, 6358, 2578, 738, 4752, 422, 374, 30, 1142, 2 ]
if po.arch != installed_pkg.arch and (isMultiLibArch(po.arch) or isMultiLibArch(installed_pkg.arch)):	if (po.arch != installed_pkg.arch and (rpmUtils.arch.isMultiLibArch(po.arch) or rpmUtils.arch.isMultiLibArch(installed_pkg.arch))):	def installLocal(self, pkg, po=None, updateonly=False): """ handles installs/updates of rpms provided on the filesystem in a local dir (ie: not from a repo)	ec1fb3b9c8487a021e86a34d3a3b0d580a5ac49e /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/5445/ec1fb3b9c8487a021e86a34d3a3b0d580a5ac49e/__init__.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 3799, 2042, 12, 2890, 16, 3475, 16, 8275, 33, 7036, 16, 1089, 3700, 33, 8381, 4672, 3536, 7372, 31011, 19, 14703, 434, 8715, 959, 2112, 603, 326, 6496, 316, 279, 1191, 1577, 261, 1385, 30, 486, 628, 279, 3538, 13, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 3799, 2042, 12, 2890, 16, 3475, 16, 8275, 33, 7036, 16, 1089, 3700, 33, 8381, 4672, 3536, 7372, 31011, 19, 14703, 434, 8715, 959, 2112, 603, 326, 6496, 316, 279, 1191, 1577, 261, 1385, 30, 486, 628, 279, 3538, 13, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
debug(" domain %s is in user block-list", cookie.domain)	_debug(" domain %s is in user block-list", cookie.domain)	def set_ok_domain(self, cookie, request): if self.is_blocked(cookie.domain): debug(" domain %s is in user block-list", cookie.domain) return False if self.is_not_allowed(cookie.domain): debug(" domain %s is not in user allow-list", cookie.domain) return False if cookie.domain_specified: req_host, erhn = eff_request_host(request) domain = cookie.domain if self.strict_domain and (domain.count(".") >= 2): # XXX This should probably be compared with the Konqueror # (kcookiejar.cpp) and Mozilla implementations, but it's a # losing battle. i = domain.rfind(".") j = domain.rfind(".", 0, i) if j == 0: # domain like .foo.bar tld = domain[i+1:] sld = domain[j+1:i] if sld.lower() in ("co", "ac", "com", "edu", "org", "net", "gov", "mil", "int", "aero", "biz", "cat", "coop", "info", "jobs", "mobi", "museum", "name", "pro", "travel", "eu") and len(tld) == 2: # domain like .co.uk debug(" country-code second level domain %s", domain) return False if domain.startswith("."): undotted_domain = domain[1:] else: undotted_domain = domain embedded_dots = (undotted_domain.find(".") >= 0) if not embedded_dots and domain != ".local": debug(" non-local domain %s contains no embedded dot", domain) return False if cookie.version == 0: if (not erhn.endswith(domain) and (not erhn.startswith(".") and not ("."+erhn).endswith(domain))): debug(" effective request-host %s (even with added " "initial dot) does not end end with %s", erhn, domain) return False if (cookie.version > 0 or (self.strict_ns_domain & self.DomainRFC2965Match)): if not domain_match(erhn, domain): debug(" effective request-host %s does not domain-match " "%s", erhn, domain) return False if (cookie.version > 0 or (self.strict_ns_domain & self.DomainStrictNoDots)): host_prefix = req_host[:-len(domain)] if (host_prefix.find(".") >= 0 and not IPV4_RE.search(req_host)): debug(" host prefix %s for domain %s contains a dot", host_prefix, domain) return False return True	feb0a3bdbccc7b45bc8b960aa4c3434838b52d05 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/8546/feb0a3bdbccc7b45bc8b960aa4c3434838b52d05/cookielib.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 444, 67, 601, 67, 4308, 12, 2890, 16, 3878, 16, 590, 4672, 309, 365, 18, 291, 67, 23156, 12, 8417, 18, 4308, 4672, 389, 4148, 2932, 282, 2461, 738, 87, 353, 316, 729, 1203, 17, 1098, 3113, 3878, 18, 4308, 13, 327, 1083, 309, 365, 18, 291, 67, 902, 67, 8151, 12, 8417, 18, 4308, 4672, 1198, 2932, 282, 2461, 738, 87, 353, 486, 316, 729, 1699, 17, 1098, 3113, 3878, 18, 4308, 13, 327, 1083, 309, 3878, 18, 4308, 67, 13827, 30, 1111, 67, 2564, 16, 6445, 76, 82, 273, 16419, 67, 2293, 67, 2564, 12, 2293, 13, 2461, 273, 3878, 18, 4308, 309, 365, 18, 13948, 67, 4308, 471, 261, 4308, 18, 1883, 2932, 1199, 13, 1545, 576, 4672, 468, 11329, 1220, 1410, 8656, 506, 15843, 598, 326, 1475, 265, 25734, 280, 468, 261, 79, 8417, 11930, 18, 4057, 84, 13, 471, 19058, 10745, 16164, 16, 1496, 518, 1807, 279, 468, 437, 2470, 324, 4558, 298, 18, 277, 273, 2461, 18, 86, 4720, 2932, 1199, 13, 525, 273, 2461, 18, 86, 4720, 2932, 1199, 16, 374, 16, 277, 13, 309, 525, 422, 374, 30, 225, 468, 2461, 3007, 263, 11351, 18, 3215, 23373, 273, 2461, 63, 77, 15, 21, 26894, 272, 1236, 273, 2461, 63, 78, 15, 21, 30, 77, 65, 309, 272, 1236, 18, 8167, 1435, 316, 7566, 2894, 3113, 315, 1077, 3113, 315, 832, 3113, 315, 28049, 3113, 315, 3341, 3113, 315, 2758, 3113, 315, 75, 1527, 3113, 315, 81, 330, 3113, 2 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 444, 67, 601, 67, 4308, 12, 2890, 16, 3878, 16, 590, 4672, 309, 365, 18, 291, 67, 23156, 12, 8417, 18, 4308, 4672, 389, 4148, 2932, 282, 2461, 738, 87, 353, 316, 729, 1203, 17, 1098, 3113, 3878, 18, 4308, 13, 327, 1083, 309, 365, 18, 291, 67, 902, 67, 8151, 12, 8417, 18, 4308, 4672, 1198, 2932, 282, 2461, 738, 87, 353, 486, 316, 729, 1699, 17, 1098, 3113, 3878, 18, 4308, 13, 327, 1083, 309, 3878, 18, 4308, 67, 13827, 30, 1111, 67, 2564, 16, 6445, 76, 82, 273, 16419, 67, 2293, 67, 2564, 12, 2293, 13, 2461, 273, 3878, 18, 4308, 309, 365, 18, 13948, 67, 4308, 471, 261, 4308, 18, 1883, 2932, 1199, 13, 2 ]
print "str: %s" % self.description	if self.verbose: print "str: %s" % self.description	def unserializeExtra(self,data): print "found %d extra bytes." % len(data)	5ec5c46b0b6b12f6dd38c8d54dc0815bac382b0e /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/8136/5ec5c46b0b6b12f6dd38c8d54dc0815bac382b0e/pyemf.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 10954, 7800, 12, 2890, 16, 892, 4672, 1172, 315, 7015, 738, 72, 2870, 1731, 1199, 738, 562, 12, 892, 13, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 10954, 7800, 12, 2890, 16, 892, 4672, 1172, 315, 7015, 738, 72, 2870, 1731, 1199, 738, 562, 12, 892, 13, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
musicianship.play_instrument( char, instrument, result )	skills.musicianship.play_instrument( char, instrument, result )	def response( char, args, target ): if not char.socket.hastag( 'peacemaking_instrument' ): return 0 # you can only target chars if not target.char: return 1 instrument = wolfpack.finditem( char.socket.gettag( 'peacemaking_instrument' ) ) if not instrument: return 0 if skills.skilltable[ PEACEMAKING ][ skills.UNHIDE ] and char.hidden: char.removefromview() char.hidden = False char.update() char.socket.deltag( 'peacemaking_instrument' ) char.socket.settag( 'skill_delay', int( wolfpack.time.currenttime() + PEACE_DELAY ) ) # if target him/her self : standard (regional) mode # anyone including npcs can re-target and start fight peace_range = skills.musicianship.bard_range( char ) if char == target.char: result = char.checkskill( MUSICIANSHIP, 0, 1000 ) musicianship.play_instrument( char, instrument, result ) # fail to play well if not result: char.socket.clilocmessage( 500612, "", 0x3b2, 3 ) return 1 result = char.checkskill( PEACEMAKING, 0, 1000 ) # fail on peacemaking if not result: char.socket.clilocmessage( 500613, "", 0x3b2, 3 ) return 1 char.socket.clilocmessage( 500615, "", 0x3b2, 3 ) creatures = wolfpack.chars( char.pos.x, char.pos.y, char.pos.map, peace_range ) for creature in creatures: if char.canreach( creature, peace_range ): # stop combat # player chars if creature.socket: creature.socket.clilocmessage( 500616, "", 0x3b2, 3 ) # target on an npc - effect will go some duration else: if char.canreach( target.char, peace_range ): char.socket.clilocmessage( 500618, "", 0x3b2, 3 ) return 1 if not target.char.npc: return 1 # bard difficulty - later, we should get these from the xml defs. loskill = 0 hiskill = 1000 result = char.checkskill( MUSICIANSHIP, loskill, hiskill ) musicianship.play_instrument( char, instrument, result ) if not result: char.socket.clilocmessage( 500612, "", 0x3b2, 3 ) return 1 result = char.checkskill( PEACEMAKING, loskill, hiskill ) if not result: char.socket.clilocmessage( 500613, "", 0x3b2, 3 ) return 1 # FIXME : duration ( 5 sec ~ 65 sec ) duration = 5000 + char.skill[ PEACEMAKING ] * 60 # stop combat # if npc, do not start combat for the duration while not attacked creature.settag( 'peacemaking', 1 ) creature.addtimer( duration, release, [] ) return 1	ad2fb5c1af41304c615892963957d7cff3e3439e /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/2534/ad2fb5c1af41304c615892963957d7cff3e3439e/peacemaking.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 766, 12, 1149, 16, 833, 16, 1018, 262, 30, 309, 486, 1149, 18, 7814, 18, 76, 689, 346, 12, 296, 347, 623, 19718, 67, 22818, 11, 262, 30, 327, 374, 468, 1846, 848, 1338, 1018, 5230, 309, 486, 1018, 18, 3001, 30, 327, 404, 10353, 273, 341, 355, 74, 2920, 18, 4720, 1726, 12, 1149, 18, 7814, 18, 588, 2692, 12, 296, 347, 623, 19718, 67, 22818, 11, 262, 262, 309, 486, 10353, 30, 327, 374, 225, 309, 15667, 87, 18, 7771, 737, 2121, 63, 16628, 6312, 5535, 47, 1360, 308, 63, 15667, 87, 18, 2124, 44, 10385, 308, 471, 1149, 18, 6345, 30, 1149, 18, 4479, 2080, 1945, 1435, 1149, 18, 6345, 273, 1083, 1149, 18, 2725, 1435, 225, 1149, 18, 7814, 18, 3771, 2692, 12, 296, 347, 623, 19718, 67, 22818, 11, 262, 1149, 18, 7814, 18, 542, 2692, 12, 296, 7771, 737, 67, 10790, 2187, 509, 12, 341, 355, 74, 2920, 18, 957, 18, 2972, 957, 1435, 397, 16628, 6312, 67, 26101, 262, 262, 225, 468, 309, 1018, 366, 381, 19, 1614, 365, 294, 4529, 261, 6858, 287, 13, 1965, 468, 1281, 476, 6508, 1130, 2143, 848, 283, 17, 3299, 471, 787, 284, 750, 2804, 623, 67, 3676, 273, 15667, 87, 18, 81, 407, 14463, 634, 5310, 18, 70, 1060, 67, 3676, 12, 1149, 262, 309, 1149, 422, 1018, 18, 3001, 30, 563, 273, 1149, 18, 1893, 7771, 737, 12, 490, 57, 2320, 7266, 1258, 20101, 16, 374, 16, 4336, 262, 15667, 87, 2 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 766, 12, 1149, 16, 833, 16, 1018, 262, 30, 309, 486, 1149, 18, 7814, 18, 76, 689, 346, 12, 296, 347, 623, 19718, 67, 22818, 11, 262, 30, 327, 374, 468, 1846, 848, 1338, 1018, 5230, 309, 486, 1018, 18, 3001, 30, 327, 404, 10353, 273, 341, 355, 74, 2920, 18, 4720, 1726, 12, 1149, 18, 7814, 18, 588, 2692, 12, 296, 347, 623, 19718, 67, 22818, 11, 262, 262, 309, 486, 10353, 30, 327, 374, 225, 309, 15667, 87, 18, 7771, 737, 2121, 63, 16628, 6312, 5535, 47, 1360, 308, 63, 15667, 87, 18, 2124, 44, 10385, 308, 471, 1149, 18, 6345, 30, 1149, 18, 4479, 2080, 1945, 1435, 1149, 18, 6345, 273, 1083, 1149, 18, 2725, 2 ]
pbuffer(True,define_buffer)	pbufferStr(define_buffer + "\n")	def parseSource(sfile, vars_dict): i = 0; #line counter in_v_comment = False; #Flag for lines inside a verilog comment block in_p_block = False; #Flag for lines inside a preprocessor block #Run through the file character by character using a DFA state = DEFAULT # State variable err_code = NOERR # Code variable for syntax errors pre_seg_begin_line = 0 # Line number of a preprocessor section start v_com_begin_line = 0 # Line number of a Verilog block comment start pre_expr_begin_line = 0 # Line number of a preprocessor expression start line_count = 0 # Current line number char_count = 0 # Current character number (in line) pre_seg_buffer = "" # Character buffer for preprocessor segments pre_expr_buffer = "" # Character buffer for preprocessor expressions define_buffer = "" # Character buffer for DEFINE statements sfile.seek(0) char = sfile.read(1) while char and state != ERROR: # DEFAULT if state == DEFAULT: if char == "/": state = DEF_FOUND_FSLASH pbuffer(False,char) elif char == "%": state = PRE_COM elif char == "`": state = DEFINE pbuffer(False,char) elif char == "<": state = DEF_FOUND_LCARET else: pbuffer(False,char) # DEF_FOUND_FSLASH elif state == DEF_FOUND_FSLASH: if char == "": state = V_COM v_com_begin_line = line_count pbuffer(False,char) elif char == "/": state = V_COM_LINE pbuffer(False,char) else: state = DEFAULT pbuffer(False,char) # V_COM_LINE elif state == V_COM_LINE: if char == "\n": state = DEFAULT pbuffer(False,char) # V_COM elif state == V_COM: if char == "": state = V_COM_FOUND_AST pbuffer(False,char) # V_COM_FOUND_AST elif state == V_COM_FOUND_AST: if char == "/": state = DEFAULT elif not char == "*": state = V_COM pbuffer(False,char) # DEFINE elif state == DEFINE: if char == "\n": state = DEFAULT parseDefine(define_buffer,vars_dict) pbuffer(True,define_buffer) define_buffer = "" else: define_buffer = define_buffer + char # DEF_FOUND_LCARET elif state == DEF_FOUND_LCARET: if char == "?": state = PRE_SEG pre_seg_begin_line = line_count else: state = DEFAULT pbuffer(False, "<" + char) # have to put a < because prev state didn't write one # PRE_COM elif state == PRE_COM: if char == "\n": state = DEFAULT # PRE_SEG elif state == PRE_SEG: if char == "{": state = PRE_EXPR pre_expr_begin_line = line_count elif char == "<": state = PRE_FOUND_LCARET elif char == "?": state = PRE_FOUND_QUEST else: pre_seg_buffer = pre_seg_buffer + char # PRE_EXPR elif state == PRE_EXPR: if char == "}": state = PRE_SEG if pre_expr_buffer != "": parsePreExpr(pre_expr_buffer,pre_seg_buffer,vars_dict) pre_expr_buffer = "" elif char == "\n": state = ERROR err_code = NEWLINE_IN_PRE_EXPR else: pre_expr_buffer = pre_expr_buffer + char # PRE_FOUND_QUEST elif state == PRE_FOUND_QUEST: if char == ">": state = DEFAULT parsePreSeg(pre_seg_buffer, vars_dict) pre_seg_buffer = "" else: state = PRE_SEG pre_seg_buffer = pre_seg_buffer + "?" + char # PRE_FOUND_LCARET elif state == PRE_FOUND_LCARET: if char == "?": state = ERROR err_code = DUP_PRE_BEGIN else: state = PRE_SEG pre_seg_buffer = pre_seg_buffer + "<" + char # Update line count and char count if state != ERROR: char_count = char_count + 1 if char == "\n": line_count = line_count + 1 char_count = 0 # Read the next character char = sfile.read(1) #end while #Check to make sure EOF did not occur in an invalid state if state == V_COM: err_code = UNCLOSED_V_COM elif state == PRE_EXPR: err_code = UNCLOSED_PRE_EXPR elif state == PRE_FOUND_LCARET: err_code = UNCLOSED_PRE_EXPR elif state == PRE_FOUND_QUEST: err_code = UNCLOSED_PRE_SEG #If an error occured, report it if err_code != NOERR: if err_code == UNCLOSED_V_COM: print "Error: Unclosed Verilog block comment (beginning at line " + `v_com_begin_line` + ")\n" sys.exit(1) elif err_code == NEWLINE_IN_PRE_EXPR: print "Error: Newline occurred in preprocessor expression: at line " + `line_count` +"\n" sys.exit(1) elif err_code == UNCLOSED_PRE_EXPR: print "Error: Unclosed preprocessor expression (beginning at line " + `pre_expr_begin_line` + ")\n" sys.exit(1) elif err_code == DUP_PRE_BEGIN: print "Error: Nested preprocessor tags: at line " + `line_count` + "\n" sys.exit(1) elif err_code == UNCLOSED_PRE_SEG: print "Error: Unclosed preprocessor tags (beginning at line " + `pre_seg_begin_line` + ")\n" sys.exit(1)	bc7caa6020ce9c0d3efd9e0dbbc8e121c4373dda /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/3352/bc7caa6020ce9c0d3efd9e0dbbc8e121c4373dda/preprocessor.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1109, 1830, 12, 87, 768, 16, 4153, 67, 1576, 4672, 225, 277, 273, 374, 31, 5375, 468, 1369, 3895, 316, 67, 90, 67, 3469, 273, 1083, 31, 282, 468, 4678, 364, 2362, 4832, 279, 1924, 21947, 2879, 1203, 316, 67, 84, 67, 2629, 273, 1083, 31, 377, 468, 4678, 364, 2362, 4832, 279, 31445, 1203, 225, 468, 1997, 3059, 326, 585, 3351, 635, 3351, 1450, 279, 463, 2046, 919, 273, 3331, 2398, 468, 3287, 2190, 393, 67, 710, 273, 3741, 9712, 5411, 468, 3356, 2190, 364, 6279, 1334, 675, 67, 5680, 67, 10086, 67, 1369, 273, 374, 1377, 468, 5377, 1300, 434, 279, 31445, 2442, 787, 331, 67, 832, 67, 10086, 67, 1369, 273, 374, 3639, 468, 5377, 1300, 434, 279, 6160, 21947, 1203, 2879, 787, 675, 67, 8638, 67, 10086, 67, 1369, 273, 374, 377, 468, 5377, 1300, 434, 279, 31445, 2652, 787, 980, 67, 1883, 273, 374, 2868, 468, 6562, 980, 1300, 1149, 67, 1883, 273, 374, 2868, 468, 6562, 3351, 1300, 261, 267, 980, 13, 225, 675, 67, 5680, 67, 4106, 273, 1408, 540, 468, 6577, 1613, 364, 31445, 5155, 675, 67, 8638, 67, 4106, 273, 1408, 3639, 468, 6577, 1613, 364, 31445, 8041, 4426, 67, 4106, 273, 1408, 1850, 468, 6577, 1613, 364, 25957, 3740, 6317, 225, 272, 768, 18, 16508, 12, 20, 13, 1149, 273, 272, 768, 18, 896, 12, 21, 13, 225, 1323, 1149, 471, 919, 480, 5475, 30, 225, 468, 3331, 309, 919, 422, 3331, 30, 309, 1149, 422, 2 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1109, 1830, 12, 87, 768, 16, 4153, 67, 1576, 4672, 225, 277, 273, 374, 31, 5375, 468, 1369, 3895, 316, 67, 90, 67, 3469, 273, 1083, 31, 282, 468, 4678, 364, 2362, 4832, 279, 1924, 21947, 2879, 1203, 316, 67, 84, 67, 2629, 273, 1083, 31, 377, 468, 4678, 364, 2362, 4832, 279, 31445, 1203, 225, 468, 1997, 3059, 326, 585, 3351, 635, 3351, 1450, 279, 463, 2046, 919, 273, 3331, 2398, 468, 3287, 2190, 393, 67, 710, 273, 3741, 9712, 5411, 468, 3356, 2190, 364, 6279, 1334, 675, 67, 5680, 67, 10086, 67, 1369, 273, 374, 1377, 468, 5377, 1300, 434, 279, 31445, 2442, 787, 331, 67, 832, 67, 10086, 67, 1369, 273, 374, 3639, 468, 5377, 2 ]
if op1.sign == -1: result.sign = -1	if op1.sign == 1: result.sign = 1	def __add__(self, other, context=None): """Returns self + other.	ce77754a7a9856b4ea3aec633c8021212c8039a7 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/8125/ce77754a7a9856b4ea3aec633c8021212c8039a7/decimal.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 1289, 972, 12, 2890, 16, 1308, 16, 819, 33, 7036, 4672, 3536, 1356, 365, 397, 1308, 18, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 1289, 972, 12, 2890, 16, 1308, 16, 819, 33, 7036, 4672, 3536, 1356, 365, 397, 1308, 18, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
description= "Create a "+name, category = "PGL Object Generator", nodemodule = "objectgenerator", nodeclass = name+'Node', **kargs)	description= "Create a "+name, category = "PGL Object Generator", nodemodule = "objectgenerator", nodeclass = name+'Node', **kargs)	def generate_factory(name, kargs): return Factory( name= name, description= "Create a "+name, category = "PGL Object Generator", nodemodule = "objectgenerator", nodeclass = name+'Node', kargs)	2a6da979b8a59c13d5a15249a32414ef9a1f6adb /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/799/2a6da979b8a59c13d5a15249a32414ef9a1f6adb/__wralea__.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 2103, 67, 6848, 12, 529, 16, 2826, 79, 1968, 4672, 327, 7822, 12, 508, 33, 508, 16, 2477, 33, 315, 1684, 279, 13773, 529, 16, 3150, 273, 315, 52, 11261, 1033, 10159, 3113, 756, 2978, 273, 315, 1612, 8812, 3113, 756, 1106, 273, 508, 6797, 907, 2187, 2826, 79, 1968, 13, 282, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 2103, 67, 6848, 12, 529, 16, 2826, 79, 1968, 4672, 327, 7822, 12, 508, 33, 508, 16, 2477, 33, 315, 1684, 279, 13773, 529, 16, 3150, 273, 315, 52, 11261, 1033, 10159, 3113, 756, 2978, 273, 315, 1612, 8812, 3113, 756, 1106, 273, 508, 6797, 907, 2187, 2826, 79, 1968, 13, 282, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
except AttributeError: fp_size = None		def do_grep(self, fp): """ Do a full grep.	73b5557e048342a519cecab38c11b31b4cc2dac6 /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/10903/73b5557e048342a519cecab38c11b31b4cc2dac6/grin.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 741, 67, 11556, 84, 12, 2890, 16, 4253, 4672, 3536, 2256, 279, 1983, 23366, 18, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 741, 67, 11556, 84, 12, 2890, 16, 4253, 4672, 3536, 2256, 279, 1983, 23366, 18, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
info = document.toxml(encoding='utf-16') obj.info = info	obj.info = document	def create_elem(): elem = document.createElement(self.tag_name) parent = document.getElementsByTagName(self.parent)[0] parent.appendChild(elem) return elem	5cbe331c0791d5ce5030fc48987fd5072a9a9db7 /local1/tlutelli/issta_data/temp/all_python//python/2007_temp/2007/9125/5cbe331c0791d5ce5030fc48987fd5072a9a9db7/meta.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 752, 67, 10037, 13332, 3659, 273, 1668, 18, 2640, 1046, 12, 2890, 18, 2692, 67, 529, 13, 982, 273, 1668, 18, 588, 3471, 10401, 12, 2890, 18, 2938, 25146, 20, 65, 982, 18, 6923, 1763, 12, 10037, 13, 327, 3659, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 752, 67, 10037, 13332, 3659, 273, 1668, 18, 2640, 1046, 12, 2890, 18, 2692, 67, 529, 13, 982, 273, 1668, 18, 588, 3471, 10401, 12, 2890, 18, 2938, 25146, 20, 65, 982, 18, 6923, 1763, 12, 10037, 13, 327, 3659, 225, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
self.indiType = self.data and self.methods.get(self.data.domain[self.selectedAttr].name, (0, ""))[0] or 0	if self.data: attr = self.data.domain[self.selectedAttr] self.indiType, value = self.methods.get(attr.name, False) or (-1, "") if self.indiType >= 0: if attr.varType == orange.VarTypes.Discrete: self.indiValueCtrl.setCurrentItem(value) else: self.indiValueCtrl.setText(value)	def setIndiType(self): self.indiType = self.data and self.methods.get(self.data.domain[self.selectedAttr].name, (0, ""))[0] or 0	5a20988f1aa69f170b9d5db9340463971696fdfe /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/6366/5a20988f1aa69f170b9d5db9340463971696fdfe/OWImpute.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 444, 382, 3211, 559, 12, 2890, 4672, 309, 365, 18, 892, 30, 1604, 273, 365, 18, 892, 18, 4308, 63, 2890, 18, 8109, 3843, 65, 365, 18, 728, 77, 559, 16, 460, 273, 365, 18, 5163, 18, 588, 12, 1747, 18, 529, 16, 1083, 13, 578, 24927, 21, 16, 1408, 13, 309, 365, 18, 728, 77, 559, 1545, 374, 30, 309, 1604, 18, 1401, 559, 422, 578, 726, 18, 1537, 2016, 18, 1669, 6883, 30, 365, 18, 728, 77, 620, 12418, 18, 542, 3935, 1180, 12, 1132, 13, 469, 30, 365, 18, 728, 77, 620, 12418, 18, 542, 1528, 12, 1132, 13, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 444, 382, 3211, 559, 12, 2890, 4672, 309, 365, 18, 892, 30, 1604, 273, 365, 18, 892, 18, 4308, 63, 2890, 18, 8109, 3843, 65, 365, 18, 728, 77, 559, 16, 460, 273, 365, 18, 5163, 18, 588, 12, 1747, 18, 529, 16, 1083, 13, 578, 24927, 21, 16, 1408, 13, 309, 365, 18, 728, 77, 559, 1545, 374, 30, 309, 1604, 18, 1401, 559, 422, 578, 726, 18, 1537, 2016, 18, 1669, 6883, 30, 365, 18, 728, 77, 620, 12418, 18, 542, 3935, 1180, 12, 1132, 13, 469, 30, 365, 18, 728, 77, 620, 12418, 18, 542, 1528, 12, 1132, 13, 225, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
else	else:	def __init__(data = None) if data == None: quickfix.StringField.__init__(self, 568) else quickfix.StringField.__init__(self, 568, data)	484890147d4b23aac4b9d0e85e84fceab7e137c3 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/8819/484890147d4b23aac4b9d0e85e84fceab7e137c3/quickfix_fields.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 892, 273, 599, 13, 309, 501, 422, 599, 30, 9549, 904, 18, 780, 974, 16186, 2738, 972, 12, 2890, 16, 1381, 9470, 13, 469, 30, 9549, 904, 18, 780, 974, 16186, 2738, 972, 12, 2890, 16, 1381, 9470, 16, 501, 13, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 892, 273, 599, 13, 309, 501, 422, 599, 30, 9549, 904, 18, 780, 974, 16186, 2738, 972, 12, 2890, 16, 1381, 9470, 13, 469, 30, 9549, 904, 18, 780, 974, 16186, 2738, 972, 12, 2890, 16, 1381, 9470, 16, 501, 13, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
info = None		def createFields(self): # This stupid shit gets the LSB, not the MSB... self.info("Note info: 0x%02X" % self.stream.readBits(self.absolute_address, 8, LITTLE_ENDIAN)) yield RealBit(self, "is_extended") info = None if self["is_extended"].value: info = NoteInfo(self, "info") yield info if info["has_note"].value: yield Enum(UInt8(self, "note"), NOTE_NAME) else: yield Enum(Bits(self, "note", 7), NOTE_NAME)	c99931bfecc0c1d1ea8ca2bff60774c9102dc066 /local1/tlutelli/issta_data/temp/all_python//python/2007_temp/2007/9327/c99931bfecc0c1d1ea8ca2bff60774c9102dc066/xm.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 752, 2314, 12, 2890, 4672, 468, 1220, 384, 416, 350, 699, 305, 5571, 326, 511, 14541, 16, 486, 326, 9238, 38, 2777, 365, 18, 1376, 2932, 8067, 1123, 30, 374, 92, 9, 3103, 60, 6, 738, 365, 18, 3256, 18, 896, 6495, 12, 2890, 18, 12547, 67, 2867, 16, 1725, 16, 511, 30972, 900, 67, 30597, 3719, 2824, 15987, 5775, 12, 2890, 16, 315, 291, 67, 14948, 7923, 309, 365, 9614, 291, 67, 14948, 6, 8009, 1132, 30, 1123, 273, 3609, 966, 12, 2890, 16, 315, 1376, 7923, 2824, 1123, 309, 1123, 9614, 5332, 67, 7652, 6, 8009, 1132, 30, 2824, 6057, 12, 14342, 28, 12, 2890, 16, 315, 7652, 6, 3631, 5219, 67, 1985, 13, 469, 30, 2824, 6057, 12, 6495, 12, 2890, 16, 315, 7652, 3113, 2371, 3631, 5219, 67, 1985, 13, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 752, 2314, 12, 2890, 4672, 468, 1220, 384, 416, 350, 699, 305, 5571, 326, 511, 14541, 16, 486, 326, 9238, 38, 2777, 365, 18, 1376, 2932, 8067, 1123, 30, 374, 92, 9, 3103, 60, 6, 738, 365, 18, 3256, 18, 896, 6495, 12, 2890, 18, 12547, 67, 2867, 16, 1725, 16, 511, 30972, 900, 67, 30597, 3719, 2824, 15987, 5775, 12, 2890, 16, 315, 291, 67, 14948, 7923, 309, 365, 9614, 291, 67, 14948, 6, 8009, 1132, 30, 1123, 273, 3609, 966, 12, 2890, 16, 315, 1376, 7923, 2824, 1123, 309, 1123, 9614, 5332, 67, 7652, 6, 8009, 1132, 30, 2824, 6057, 12, 14342, 28, 12, 2890, 16, 315, 7652, 6, 3631, 5219, 67, 1985, 13, 469, 30, 2 ]
str='No MIB info for %s (distant parent %s)' % (oid, mibNode)	str='No MIB info for %s (closest parent %s)' % (oid, mibNode.name)	def oidToInstanceName(mibView, oid): oid, label, suffix = mibView.getNodeNameByOid(tuple(oid)) modName, symName, __suffix = mibView.getNodeLocation(oid) mibNode, = mibView.mibBuilder.importSymbols( modName, symName ) if hasattr(mibNode, 'getColumnInitializer'): # table column __modName, __symName, __s = mibView.getNodeLocation(oid[:-1]) rowNode, = mibView.mibBuilder.importSymbols(__modName, __symName) return (symName, modName), rowNode.getIndicesFromInstId(suffix) elif not suffix or suffix == (0,): # scalar/identifier return (symName, modName), suffix else: raise NoSuchInstanceError( str='No MIB info for %s (distant parent %s)' % (oid, mibNode) )	d1a4bbb6950ea6d7df3f385cc62df9731e497a70 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/587/d1a4bbb6950ea6d7df3f385cc62df9731e497a70/mibvar.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 7764, 774, 22520, 12, 81, 495, 1767, 16, 7764, 4672, 7764, 16, 1433, 16, 3758, 273, 312, 495, 1767, 18, 588, 18948, 858, 19105, 12, 8052, 12, 839, 3719, 681, 461, 16, 5382, 461, 16, 1001, 8477, 273, 312, 495, 1767, 18, 588, 907, 2735, 12, 839, 13, 312, 495, 907, 16, 273, 312, 495, 1767, 18, 81, 495, 1263, 18, 5666, 14821, 12, 681, 461, 16, 5382, 461, 262, 309, 3859, 12, 81, 495, 907, 16, 296, 588, 1494, 14729, 11, 4672, 468, 1014, 1057, 1001, 1711, 461, 16, 1001, 8117, 461, 16, 1001, 87, 273, 312, 495, 1767, 18, 588, 907, 2735, 12, 839, 10531, 17, 21, 5717, 1027, 907, 16, 273, 312, 495, 1767, 18, 81, 495, 1263, 18, 5666, 14821, 12, 972, 1711, 461, 16, 1001, 8117, 461, 13, 327, 261, 8117, 461, 16, 681, 461, 3631, 1027, 907, 18, 588, 8776, 1265, 10773, 548, 12, 8477, 13, 1327, 486, 3758, 578, 3758, 422, 261, 20, 16, 4672, 468, 4981, 19, 5644, 327, 261, 8117, 461, 16, 681, 461, 3631, 3758, 469, 30, 1002, 5823, 1442, 668, 12, 609, 2218, 2279, 490, 13450, 1123, 364, 738, 87, 261, 7550, 7781, 982, 738, 87, 2506, 738, 261, 839, 16, 312, 495, 907, 18, 529, 13, 262, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 7764, 774, 22520, 12, 81, 495, 1767, 16, 7764, 4672, 7764, 16, 1433, 16, 3758, 273, 312, 495, 1767, 18, 588, 18948, 858, 19105, 12, 8052, 12, 839, 3719, 681, 461, 16, 5382, 461, 16, 1001, 8477, 273, 312, 495, 1767, 18, 588, 907, 2735, 12, 839, 13, 312, 495, 907, 16, 273, 312, 495, 1767, 18, 81, 495, 1263, 18, 5666, 14821, 12, 681, 461, 16, 5382, 461, 262, 309, 3859, 12, 81, 495, 907, 16, 296, 588, 1494, 14729, 11, 4672, 468, 1014, 1057, 1001, 1711, 461, 16, 1001, 8117, 461, 16, 1001, 87, 273, 312, 495, 1767, 18, 588, 907, 2735, 12, 839, 10531, 17, 21, 5717, 1027, 907, 16, 273, 312, 495, 1767, 18, 2 ]
self.add_row(path[0])	self.add_row(os.path.join(defs.HOME_THEME_DIR, path[0]))	def extract_file(self, fname): tar = tarfile.open(fname, "r:gz") filelist = tar.getmembers() theme_found = False thumb_found = False for f in filelist: path = os.path.split(f.name) if path[1] == self.AWN_CONFIG: theme_found = True if path[1] == self.AWN_THUMB: thumb_found = True if theme_found and thumb_found: if hasattr(tar, 'extractall'): tar.extractall(defs.HOME_THEME_DIR) #new in python 2.5 else: [tar.extract(f, defs.HOME_THEME_DIR) for f in tar.getnames()] tar.close() self.add_row(path[0]) message = "Theme Successfully Added" message2 = "" success = gtk.MessageDialog(parent=None, flags=0, type=gtk.MESSAGE_WARNING, buttons=gtk.BUTTONS_OK, message_format=message) icon_path = os.path.join(defs.HOME_THEME_DIR, path[0], self.AWN_CUSTOM_ICONS) if os.path.exists(icon_path): message2 = "Custom icons included can be found at:\n " + os.path.join(defs.HOME_THEME_DIR, path[0], self.AWN_CUSTOM_ICONS) success.format_secondary_text(message2) success.run() success.destroy() return True else: return False	fbbad571f1ee3b50f3b4afce97428d348e7cce32 /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/8416/fbbad571f1ee3b50f3b4afce97428d348e7cce32/awnTheme.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 2608, 67, 768, 12, 2890, 16, 5299, 4672, 8232, 273, 25857, 18, 3190, 12, 12749, 16, 315, 86, 30, 9764, 7923, 26204, 273, 8232, 18, 588, 7640, 1435, 5006, 67, 7015, 273, 1083, 11156, 67, 7015, 273, 1083, 364, 284, 316, 26204, 30, 589, 273, 1140, 18, 803, 18, 4939, 12, 74, 18, 529, 13, 309, 589, 63, 21, 65, 422, 365, 18, 37, 5665, 67, 7203, 30, 5006, 67, 7015, 273, 1053, 309, 589, 63, 21, 65, 422, 365, 18, 37, 5665, 67, 2455, 2799, 38, 30, 11156, 67, 7015, 273, 1053, 309, 5006, 67, 7015, 471, 11156, 67, 7015, 30, 309, 3859, 12, 11718, 16, 296, 8004, 454, 11, 4672, 8232, 18, 8004, 454, 12, 12537, 18, 14209, 67, 24644, 958, 67, 4537, 13, 468, 2704, 316, 5790, 576, 18, 25, 469, 30, 306, 11718, 18, 8004, 12, 74, 16, 17588, 18, 14209, 67, 24644, 958, 67, 4537, 13, 364, 284, 316, 8232, 18, 588, 1973, 1435, 65, 8232, 18, 4412, 1435, 365, 18, 1289, 67, 492, 12, 538, 18, 803, 18, 5701, 12, 12537, 18, 14209, 67, 24644, 958, 67, 4537, 16, 589, 63, 20, 22643, 883, 273, 315, 8335, 11958, 4095, 25808, 6, 883, 22, 273, 1408, 2216, 273, 22718, 18, 1079, 6353, 12, 2938, 33, 7036, 16, 2943, 33, 20, 16, 618, 33, 4521, 79, 18, 8723, 67, 9511, 16, 9502, 33, 4521, 79, 18, 20068, 55, 67, 3141, 16, 883, 67, 2139, 33, 2150, 13, 4126, 67, 803, 273, 1140, 2 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 2608, 67, 768, 12, 2890, 16, 5299, 4672, 8232, 273, 25857, 18, 3190, 12, 12749, 16, 315, 86, 30, 9764, 7923, 26204, 273, 8232, 18, 588, 7640, 1435, 5006, 67, 7015, 273, 1083, 11156, 67, 7015, 273, 1083, 364, 284, 316, 26204, 30, 589, 273, 1140, 18, 803, 18, 4939, 12, 74, 18, 529, 13, 309, 589, 63, 21, 65, 422, 365, 18, 37, 5665, 67, 7203, 30, 5006, 67, 7015, 273, 1053, 309, 589, 63, 21, 65, 422, 365, 18, 37, 5665, 67, 2455, 2799, 38, 30, 11156, 67, 7015, 273, 1053, 309, 5006, 67, 7015, 471, 11156, 67, 7015, 30, 309, 3859, 12, 11718, 16, 296, 8004, 454, 11, 4672, 8232, 18, 8004, 454, 12, 12537, 2 ]
nic = InstanceCatalog.InstanceCatalog()	nic = InstanceCatalog()	def makeCatalogFromQuery(self, result): if os.environ.has_key("CATALOG_DESCRIPTION_PATH"): catalogDescriptionPath = os.environ["CATALOG_DESCRIPTION_PATH"] else: raise Exception("Environment variable CATALOG_DESCRIPTION_PATH not set to location of the catalog description files") nic = InstanceCatalog.InstanceCatalog() nic.catalogDescription = CatalogDescription.CatalogDescription( catalogDescriptionPath+"requiredMetadata.dat", catalogDescriptionPath+"requiredSchemaFields.dat", catalogDescriptionPath+"requiredDerivedFields.dat", catalogDescriptionPath+"outputFormat.dat") nic.metadata.catalogDescription = nic.catalogDescription nic.catalogType = self.filetypes data = {} for k in self.cdm.objectTypes['POINT'].keys(): data[k] = [] for s in result: for k in self.cdm.objectTypes['POINT'].keys():	11976c942f9ebf4a51cb090a8c8fcb77b4828536 /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/91/11976c942f9ebf4a51cb090a8c8fcb77b4828536/queryDB.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1221, 9769, 1265, 1138, 12, 2890, 16, 563, 4672, 309, 1140, 18, 28684, 18, 5332, 67, 856, 2932, 14130, 18683, 67, 15911, 67, 4211, 6, 4672, 6222, 3291, 743, 273, 1140, 18, 28684, 9614, 14130, 18683, 67, 15911, 67, 4211, 11929, 469, 30, 1002, 1185, 2932, 5494, 2190, 30210, 18683, 67, 15911, 67, 4211, 486, 444, 358, 2117, 434, 326, 6222, 2477, 1390, 7923, 11562, 273, 5180, 9769, 1435, 11562, 18, 7199, 3291, 273, 14953, 3291, 18, 9769, 3291, 12, 6222, 3291, 743, 9078, 4718, 2277, 18, 3404, 3113, 6222, 3291, 743, 9078, 4718, 3078, 2314, 18, 3404, 3113, 6222, 3291, 743, 9078, 4718, 21007, 2314, 18, 3404, 3113, 6222, 3291, 743, 9078, 2844, 1630, 18, 3404, 7923, 11562, 18, 4165, 18, 7199, 3291, 273, 225, 11562, 18, 7199, 3291, 11562, 18, 7199, 559, 273, 365, 18, 7540, 15180, 501, 273, 2618, 364, 417, 316, 365, 18, 4315, 81, 18, 1612, 2016, 3292, 8941, 29489, 2452, 13332, 501, 63, 79, 65, 273, 5378, 364, 272, 316, 563, 30, 364, 417, 316, 365, 18, 4315, 81, 18, 1612, 2016, 3292, 8941, 29489, 2452, 13332, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1221, 9769, 1265, 1138, 12, 2890, 16, 563, 4672, 309, 1140, 18, 28684, 18, 5332, 67, 856, 2932, 14130, 18683, 67, 15911, 67, 4211, 6, 4672, 6222, 3291, 743, 273, 1140, 18, 28684, 9614, 14130, 18683, 67, 15911, 67, 4211, 11929, 469, 30, 1002, 1185, 2932, 5494, 2190, 30210, 18683, 67, 15911, 67, 4211, 486, 444, 358, 2117, 434, 326, 6222, 2477, 1390, 7923, 11562, 273, 5180, 9769, 1435, 11562, 18, 7199, 3291, 273, 14953, 3291, 18, 9769, 3291, 12, 6222, 3291, 743, 9078, 4718, 2277, 18, 3404, 3113, 6222, 3291, 743, 9078, 4718, 3078, 2314, 18, 3404, 3113, 6222, 3291, 743, 9078, 4718, 21007, 2314, 18, 3404, 3113, 6222, 3291, 743, 9078, 2844, 1630, 18, 3404, 7923, 2 ]
assert allclose(struve(v, z), value, atol=err), (v, z)	assert_tol_equal(struve(v, z), value, rtol=0, atol=err), (v, z)	def test_vs_series(self): """Check Struve function versus its power series""" for v in [-20, -10, -7.99, -3.4, -1, 0, 1, 3.4, 12.49, 16]: for z in [1, 10, 19, 21, 30]: value, err = self._series(v, z) assert allclose(struve(v, z), value, atol=err), (v, z)	9bfb2390def95a96da5a56f3a02a6b962e87c293 /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/12971/9bfb2390def95a96da5a56f3a02a6b962e87c293/test_basic.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1842, 67, 6904, 67, 10222, 12, 2890, 4672, 3536, 1564, 3978, 89, 537, 445, 14690, 407, 2097, 7212, 4166, 8395, 364, 331, 316, 23059, 3462, 16, 300, 2163, 16, 300, 27, 18, 2733, 16, 300, 23, 18, 24, 16, 300, 21, 16, 374, 16, 404, 16, 890, 18, 24, 16, 2593, 18, 7616, 16, 2872, 14542, 364, 998, 316, 306, 21, 16, 1728, 16, 5342, 16, 9035, 16, 5196, 14542, 460, 16, 393, 273, 365, 6315, 10222, 12, 90, 16, 998, 13, 1815, 777, 4412, 12, 701, 89, 537, 12, 90, 16, 998, 3631, 460, 16, 26322, 33, 370, 3631, 261, 90, 16, 998, 13, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1842, 67, 6904, 67, 10222, 12, 2890, 4672, 3536, 1564, 3978, 89, 537, 445, 14690, 407, 2097, 7212, 4166, 8395, 364, 331, 316, 23059, 3462, 16, 300, 2163, 16, 300, 27, 18, 2733, 16, 300, 23, 18, 24, 16, 300, 21, 16, 374, 16, 404, 16, 890, 18, 24, 16, 2593, 18, 7616, 16, 2872, 14542, 364, 998, 316, 306, 21, 16, 1728, 16, 5342, 16, 9035, 16, 5196, 14542, 460, 16, 393, 273, 365, 6315, 10222, 12, 90, 16, 998, 13, 1815, 777, 4412, 12, 701, 89, 537, 12, 90, 16, 998, 3631, 460, 16, 26322, 33, 370, 3631, 261, 90, 16, 998, 13, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
self.app = app	self.rootapp = rootapp self.apps = apps	def __init__(self, app): trace("ISAPISimpleHandler.__init__") self.app = app	742beb9f59a980a41b87dc069bb870643ade7d03 /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/4963/742beb9f59a980a41b87dc069bb870643ade7d03/isapi_wsgi.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 2890, 16, 595, 4672, 2606, 2932, 5127, 2557, 5784, 1503, 16186, 2738, 972, 7923, 365, 18, 2910, 273, 595, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 2890, 16, 595, 4672, 2606, 2932, 5127, 2557, 5784, 1503, 16186, 2738, 972, 7923, 365, 18, 2910, 273, 595, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
src_piece = self.locs[src]	src_piece = self[src]	def move(self, sym, src, dst, options): """a (parsed) move is: (piece, src, dst, options), where dict options may contain the following keys: promote (None, R, Q, B, N), capture (True, False), hybrid, i.e. 'going to hybrid' (True, False), check (None, check, mate). all keys except 'promote' may be ignored""" src_piece = self.locs[src] if src_piece == E: raise IllegalMove, ("source position %s is empty" % str(src)) (src_sym, src_col) = src_piece if src_col != self.turn: raise IllegalMove, "attempt to move enemy's piece" movingPiece = pieceObjects[sym] NotImplemented	3776bd3cb848913021c849d965c97d087e6dc8c1 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/5164/3776bd3cb848913021c849d965c97d087e6dc8c1/board.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 3635, 12, 2890, 16, 5382, 16, 1705, 16, 3046, 16, 702, 4672, 3536, 69, 261, 10817, 13, 3635, 353, 30, 261, 30100, 16, 1705, 16, 3046, 16, 702, 3631, 1625, 2065, 702, 2026, 912, 326, 3751, 1311, 30, 28374, 261, 7036, 16, 534, 16, 2238, 16, 605, 16, 423, 3631, 7477, 261, 5510, 16, 1083, 3631, 30190, 16, 277, 18, 73, 18, 296, 8162, 358, 30190, 11, 261, 5510, 16, 1083, 3631, 866, 261, 7036, 16, 866, 16, 312, 340, 2934, 777, 1311, 1335, 296, 17401, 1168, 11, 2026, 506, 5455, 8395, 225, 1705, 67, 30100, 273, 365, 63, 4816, 65, 309, 1705, 67, 30100, 422, 512, 30, 1002, 2141, 7607, 16, 7566, 3168, 1754, 738, 87, 353, 1008, 6, 738, 609, 12, 4816, 3719, 261, 4816, 67, 8117, 16, 1705, 67, 1293, 13, 273, 1705, 67, 30100, 309, 1705, 67, 1293, 480, 365, 18, 20922, 30, 1002, 2141, 7607, 16, 315, 11764, 358, 3635, 570, 351, 93, 1807, 11151, 6, 225, 12499, 22607, 273, 11151, 4710, 63, 8117, 65, 10051, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 3635, 12, 2890, 16, 5382, 16, 1705, 16, 3046, 16, 702, 4672, 3536, 69, 261, 10817, 13, 3635, 353, 30, 261, 30100, 16, 1705, 16, 3046, 16, 702, 3631, 1625, 2065, 702, 2026, 912, 326, 3751, 1311, 30, 28374, 261, 7036, 16, 534, 16, 2238, 16, 605, 16, 423, 3631, 7477, 261, 5510, 16, 1083, 3631, 30190, 16, 277, 18, 73, 18, 296, 8162, 358, 30190, 11, 261, 5510, 16, 1083, 3631, 866, 261, 7036, 16, 866, 16, 312, 340, 2934, 777, 1311, 1335, 296, 17401, 1168, 11, 2026, 506, 5455, 8395, 225, 1705, 67, 30100, 273, 365, 63, 4816, 65, 309, 1705, 67, 30100, 422, 512, 30, 1002, 2141, 7607, 16, 7566, 3168, 1754, 738, 87, 353, 2 ]
def haselement(self,mycat,mypkg,ename): "boolean -- is the specified cat/pkg listed in this package's elements file?" mycmp=mycat+"/"+mypkg for x in self.getelements(ename): if x == mycmp: return 1 return 0 def hasprovide(self,mycat,mypkg): return self.haselement(mycat,mypkg,"PROVIDE") def getprovides(self): "get a list of virtual packages provided by this package." return self.getelements("PROVIDE") def setprovides(self,mylist=None,oldprovides=None): "set virtual packages provided by this package, and also update virtual links" if not mylist: mylist=self.getelements("PROVIDE") if not oldprovides: oldprovides=self.getelements("PROVIDE") for x in mylist: if x not in oldprovides: mypsplit=string.split(x,"/") mylink=dblink(mypsplit[0],mypsplit[1]) myvirts=plink.getvirtuals() if self.cat+"/"+self.pkg in myvirts: myvirts.remove(self.cat+"/"+self.pkg) mylink.setvirtuals(myvirts) for x in oldprovides: if x not in mylist: mypsplit=string.split(x,"/") mylink=dblink(mypsplit[0],mypsplit[1]) myvirts=plink.getvirtuals() if not self.cat+"/"+self.pkg in myvirts: myvirts.append(self.cat+"/"+self.pkg) mylink.setvirtuals(myvirts) return self.setelements(mylist,"PROVIDE") def isprovide(self): return os.path.exists(self.dbdir+"/PROVIDE") def hasvirtual(self,mycat,mypkg): return self.haselement(mycat,mypkg,"VIRTUAL") def getvirtuals(self): "get a list of packages providing this virtual package." return self.getelements("VIRTUAL") def setvirtuals(self,mylist): "set a list of packages providing this virtual package." return self.setelements(mylist,"VIRTUAL") def isvirtual(self): "is this a virtual package? boolean." return os.path.exists(self.dbdir+"/VIRTUAL")	def isregular(self): "Is this a regular package (does it have a CATEGORY file? A dblink can be virtual and regular)" return os.path.exists(self.dbdir+"/CATEGORY")	def haselement(self,mycat,mypkg,ename): "boolean -- is the specified cat/pkg listed in this package's elements file?" mycmp=mycat+"/"+mypkg for x in self.getelements(ename): if x == mycmp: return 1 return 0	e2aa1d10ca9e8b9fc4c5050206871cfb8f47522d /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/2807/e2aa1d10ca9e8b9fc4c5050206871cfb8f47522d/portage.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 711, 2956, 12, 2890, 16, 4811, 2574, 16, 81, 879, 14931, 16, 1069, 4672, 315, 6494, 1493, 353, 326, 1269, 6573, 19, 10657, 12889, 316, 333, 2181, 1807, 2186, 585, 7225, 3399, 9625, 33, 4811, 2574, 9078, 4898, 15, 81, 879, 14931, 364, 619, 316, 365, 18, 588, 6274, 12, 1069, 4672, 309, 619, 422, 3399, 9625, 30, 327, 404, 327, 374, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 711, 2956, 12, 2890, 16, 4811, 2574, 16, 81, 879, 14931, 16, 1069, 4672, 315, 6494, 1493, 353, 326, 1269, 6573, 19, 10657, 12889, 316, 333, 2181, 1807, 2186, 585, 7225, 3399, 9625, 33, 4811, 2574, 9078, 4898, 15, 81, 879, 14931, 364, 619, 316, 365, 18, 588, 6274, 12, 1069, 4672, 309, 619, 422, 3399, 9625, 30, 327, 404, 327, 374, 225, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
self.out.write("void %s::SendContents(Bridge* b)\n" % classname)	self.out.write("void %s::SendContents(Bridge* b) const\n" % classname)	def sendcontents_im(self, obj, statics): classname = classize(obj.attr['id'].value) self.out.write("void %s::SendContents(Bridge* b)\n" % classname) self.out.write("{\n") for attr in statics: self.out.write(' Send%s(b);\n' % classize(attr.name)) parent = obj.attr['parents'].value[0] self.out.write(" %s::SendContents(b);\n" % classize(parent)) self.out.write("}\n\n")	9735567828cceff0576f75d0dc23ff6b13b4f601 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/12931/9735567828cceff0576f75d0dc23ff6b13b4f601/gen_cc.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1366, 3980, 67, 381, 12, 2890, 16, 1081, 16, 760, 87, 4672, 7479, 273, 667, 554, 12, 2603, 18, 1747, 3292, 350, 29489, 1132, 13, 365, 18, 659, 18, 2626, 2932, 6459, 738, 87, 2866, 3826, 6323, 12, 13691, 14, 324, 13, 1866, 64, 82, 6, 738, 7479, 13, 365, 18, 659, 18, 2626, 2932, 23241, 82, 7923, 364, 1604, 316, 760, 87, 30, 365, 18, 659, 18, 2626, 2668, 565, 2479, 9, 87, 12, 70, 20472, 82, 11, 738, 667, 554, 12, 1747, 18, 529, 3719, 982, 273, 1081, 18, 1747, 3292, 12606, 29489, 1132, 63, 20, 65, 365, 18, 659, 18, 2626, 2932, 565, 738, 87, 2866, 3826, 6323, 12, 70, 20472, 82, 6, 738, 667, 554, 12, 2938, 3719, 365, 18, 659, 18, 2626, 2932, 6280, 82, 64, 82, 7923, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1366, 3980, 67, 381, 12, 2890, 16, 1081, 16, 760, 87, 4672, 7479, 273, 667, 554, 12, 2603, 18, 1747, 3292, 350, 29489, 1132, 13, 365, 18, 659, 18, 2626, 2932, 6459, 738, 87, 2866, 3826, 6323, 12, 13691, 14, 324, 13, 1866, 64, 82, 6, 738, 7479, 13, 365, 18, 659, 18, 2626, 2932, 23241, 82, 7923, 364, 1604, 316, 760, 87, 30, 365, 18, 659, 18, 2626, 2668, 565, 2479, 9, 87, 12, 70, 20472, 82, 11, 738, 667, 554, 12, 1747, 18, 529, 3719, 982, 273, 1081, 18, 1747, 3292, 12606, 29489, 1132, 63, 20, 65, 365, 18, 659, 18, 2626, 2932, 565, 738, 87, 2866, 3826, 6323, 12, 70, 20472, 82, 6, 738, 667, 2 ]
resp, subs = s.xhdr('subject', first + '-' + last)	resp, subs = s.xhdr('subject', '{0}-{1}'.format(first, last))	def quit(self): """Process a QUIT command and close the socket. Returns: - resp: server response if successful"""	eb96c4e975fd746fcc8b85f47c3592472b8d6b15 /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/3187/eb96c4e975fd746fcc8b85f47c3592472b8d6b15/nntplib.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 9706, 12, 2890, 4672, 3536, 2227, 279, 10110, 1285, 1296, 471, 1746, 326, 2987, 18, 225, 2860, 30, 300, 1718, 30, 1438, 766, 309, 6873, 8395, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 9706, 12, 2890, 4672, 3536, 2227, 279, 10110, 1285, 1296, 471, 1746, 326, 2987, 18, 225, 2860, 30, 300, 1718, 30, 1438, 766, 309, 6873, 8395, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
self._write_namespace(namespace, shlib)	self._write_namespace(namespace, shlibs)	def _write_repository(self, namespace, shlib, includes=set()): attrs = [ ('version', '1.0'), ('xmlns', 'http://www.gtk.org/introspection/core/1.0'), ('xmlns:c', 'http://www.gtk.org/introspection/c/1.0'), ('xmlns:glib', 'http://www.gtk.org/introspection/glib/1.0'), ] with self.tagcontext('repository', attrs): for include in includes: self._write_include(include) self._write_namespace(namespace, shlib)	9045f204f1f911867c2dae885904f13f83b9ddab /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/2770/9045f204f1f911867c2dae885904f13f83b9ddab/girwriter.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 2626, 67, 9071, 12, 2890, 16, 1981, 16, 699, 2941, 16, 6104, 33, 542, 1435, 4672, 3422, 273, 306, 7707, 1589, 2187, 296, 21, 18, 20, 19899, 7707, 16741, 2187, 296, 2505, 2207, 5591, 18, 4521, 79, 18, 3341, 19, 474, 26362, 19, 3644, 19, 21, 18, 20, 19899, 7707, 16741, 30, 71, 2187, 296, 2505, 2207, 5591, 18, 4521, 79, 18, 3341, 19, 474, 26362, 19, 71, 19, 21, 18, 20, 19899, 7707, 16741, 30, 75, 2941, 2187, 296, 2505, 2207, 5591, 18, 4521, 79, 18, 3341, 19, 474, 26362, 19, 75, 2941, 19, 21, 18, 20, 19899, 308, 598, 365, 18, 2692, 2472, 2668, 9071, 2187, 3422, 4672, 364, 2341, 316, 6104, 30, 365, 6315, 2626, 67, 6702, 12, 6702, 13, 365, 6315, 2626, 67, 4937, 12, 4937, 16, 699, 2941, 13, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 2626, 67, 9071, 12, 2890, 16, 1981, 16, 699, 2941, 16, 6104, 33, 542, 1435, 4672, 3422, 273, 306, 7707, 1589, 2187, 296, 21, 18, 20, 19899, 7707, 16741, 2187, 296, 2505, 2207, 5591, 18, 4521, 79, 18, 3341, 19, 474, 26362, 19, 3644, 19, 21, 18, 20, 19899, 7707, 16741, 30, 71, 2187, 296, 2505, 2207, 5591, 18, 4521, 79, 18, 3341, 19, 474, 26362, 19, 71, 19, 21, 18, 20, 19899, 7707, 16741, 30, 75, 2941, 2187, 296, 2505, 2207, 5591, 18, 4521, 79, 18, 3341, 19, 474, 26362, 19, 75, 2941, 19, 21, 18, 20, 19899, 308, 598, 365, 18, 2692, 2472, 2668, 9071, 2187, 3422, 4672, 364, 2341, 316, 6104, 30, 365, 6315, 2 ]
def __add__(self, s): """ Returns the sum of two streams. EXAMPLES:: sage: from sage.combinat.species.stream import Stream sage: s = Stream(ZZ) sage: ss = s + s sage: [ss[i] for i in range(10)] [0, 2, -2, 4, -4, 6, -6, 8, -8, 10] """ if not isinstance(s, Stream_class): raise TypeError, "s must be a Stream" return Stream((a+b for (a,b) in itertools.izip(self,s))) def __mul__(self, s): """ Returns the product of two streams. EXAMPLES: We can use a stream to represent the polynomial 1+x and use it to compute the coefficients of (1+x)2. :: sage: from sage.combinat.species.stream import Stream sage: s = Stream([1,1,0]) sage: ss = ss sage: [ss[i] for i in range(5)] [1, 2, 1, 0, 0] """ if not isinstance(s, Stream_class): raise TypeError, "s must be a Stream" return Stream((self._times_naive(s, n) for n in _integers_from(0))) def _times_naive(self, s, n): """ Returns the nth entry in the product of self and s via the naive multiplication algorithm. Note that this requires that all entries for self and s in range(n+1) be computed. EXAMPLES:: sage: from sage.combinat.species.stream import Stream sage: s = Stream([1,1,0]) sage: s._times_naive(s, 0) 1 sage: s._times_naive(s, 1) 2 sage: s._times_naive(s, 2) 1 """ t = 0 for k in range(n+1): sk = self[k] if sk == 0: continue t += sk s[n-k] return t		def __add__(self, s): """ Returns the sum of two streams.	ebfc2d1b32c8b0153b7c6921bae684dee1185427 /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/9417/ebfc2d1b32c8b0153b7c6921bae684dee1185427/stream.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 1289, 972, 12, 2890, 16, 272, 4672, 3536, 2860, 326, 2142, 434, 2795, 8205, 18, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 1289, 972, 12, 2890, 16, 272, 4672, 3536, 2860, 326, 2142, 434, 2795, 8205, 18, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
autocomplete="off" onkeypress="upArrow(this, event)"><br>	autocomplete="off"><br>	def make_repost_button(environ): url = request.construct_url(environ) if environ['REQUEST_METHOD'] == 'GET': return ('<button onclick="window.location.href=%r">' 'Re-GET Page</button><br>' % url) else: # @@: I'd like to reconstruct this, but I can't because # the POST body is probably lost at this point, and # I can't get it back :( return None # @@: Use or lose the following code block """ fields = [] for name, value in request.parse_formvars( environ, include_get_vars=False).items(): if hasattr(value, 'filename'): # @@: Arg, we'll just submit the body, and leave out # the filename :( value = value.value fields.append( '<input type="hidden" name="%s" value="%s">' % (html_quote(name), html_quote(value))) return '''	b236391d16e3eae856284a48117e19a19e9b54f1 /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/12946/b236391d16e3eae856284a48117e19a19e9b54f1/evalexception.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1221, 67, 266, 2767, 67, 5391, 12, 28684, 4672, 880, 273, 590, 18, 10062, 67, 718, 12, 28684, 13, 309, 5473, 3292, 5519, 67, 5327, 3546, 422, 296, 3264, 4278, 327, 7707, 32, 5391, 22324, 1546, 5668, 18, 3562, 18, 7547, 5095, 86, 7918, 296, 426, 17, 3264, 3460, 1757, 5391, 4438, 2848, 1870, 738, 880, 13, 469, 30, 468, 22175, 30, 467, 14271, 3007, 358, 23243, 333, 16, 1496, 467, 848, 1404, 2724, 468, 326, 5485, 1417, 353, 8656, 13557, 622, 333, 1634, 16, 471, 468, 467, 848, 1404, 336, 518, 1473, 294, 12, 327, 599, 468, 22175, 30, 2672, 578, 29612, 326, 3751, 981, 1203, 3536, 1466, 273, 5378, 364, 508, 16, 460, 316, 590, 18, 2670, 67, 687, 4699, 12, 5473, 16, 2341, 67, 588, 67, 4699, 33, 8381, 2934, 3319, 13332, 309, 3859, 12, 1132, 16, 296, 3459, 11, 4672, 468, 22175, 30, 14448, 16, 732, 5614, 2537, 4879, 326, 1417, 16, 471, 8851, 596, 468, 326, 1544, 294, 12, 460, 273, 460, 18, 1132, 1466, 18, 6923, 12, 2368, 2630, 618, 1546, 6345, 6, 508, 11613, 87, 6, 460, 11613, 87, 7918, 738, 261, 2620, 67, 6889, 12, 529, 3631, 1729, 67, 6889, 12, 1132, 20349, 327, 9163, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1221, 67, 266, 2767, 67, 5391, 12, 28684, 4672, 880, 273, 590, 18, 10062, 67, 718, 12, 28684, 13, 309, 5473, 3292, 5519, 67, 5327, 3546, 422, 296, 3264, 4278, 327, 7707, 32, 5391, 22324, 1546, 5668, 18, 3562, 18, 7547, 5095, 86, 7918, 296, 426, 17, 3264, 3460, 1757, 5391, 4438, 2848, 1870, 738, 880, 13, 469, 30, 468, 22175, 30, 467, 14271, 3007, 358, 23243, 333, 16, 1496, 467, 848, 1404, 2724, 468, 326, 5485, 1417, 353, 8656, 13557, 622, 333, 1634, 16, 471, 468, 467, 848, 1404, 336, 518, 1473, 294, 12, 327, 599, 468, 22175, 30, 2672, 578, 29612, 326, 3751, 981, 1203, 3536, 1466, 273, 5378, 364, 508, 16, 460, 316, 590, 18, 2 ]
self.session.gotoLocation()	self.view.send.gotoLocation()	def on_location_editing_done(self, location): self.session.gotoLocation()	4fadf73203be069e1abb0745e50de808e949d82c /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/9377/4fadf73203be069e1abb0745e50de808e949d82c/gnomoire.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 603, 67, 3562, 67, 4619, 310, 67, 8734, 12, 2890, 16, 2117, 4672, 365, 18, 3184, 18, 75, 6302, 2735, 1435, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 603, 67, 3562, 67, 4619, 310, 67, 8734, 12, 2890, 16, 2117, 4672, 365, 18, 3184, 18, 75, 6302, 2735, 1435, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
self.fps = nsteps / (end_time - start_time + .001 )	duration = min(1.5, time.time() - start_time + .001) self.fps = nsteps / duration	def animateView(self, q2, s2, p2, z2, animate=True): "Animate current view to quat (viewpoint) q2, scale s2, pov p2, and zoom factor z2" # Check User Preference "General \| Standard Views: Animate" if not animate or not env.prefs[animateStandardViews_prefs_key]: self.quat = Q(q2) self.pov = V(p2[0], p2[1], p2[2]) self.zoomFactor = z2 self.scale = s2 self.gl_update() return # Disable standard view actions on toolbars/menus. self.win.enableViews(False) wxyz1 = V(self.quat.w, self.quat.x, self.quat.y, self.quat.z) s1 = self.scale pov1 = V(self.pov[0], self.pov[1], self.pov[2]) z1 = self.zoomFactor wxyz2 = V(q2.w, q2.x, q2.y, q2.z) pov2 = V(p2[0], p2[1], p2[2]) # The rotation path may turn either the "short way" (less than 180) or the "long way" (more than 180). # Long paths can be prevented by negating one end (if the dot product is negative). if dot(wxyz1, wxyz2) < 0: wxyz2 = V(-q2.w, -q2.x, -q2.y, -q2.z) off = wxyz2 -wxyz1	5fb22f777c91adb971bce1f786163070dfd13fc4 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/11221/5fb22f777c91adb971bce1f786163070dfd13fc4/GLPane.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 14671, 1767, 12, 2890, 16, 1043, 22, 16, 272, 22, 16, 293, 22, 16, 998, 22, 16, 14671, 33, 5510, 4672, 315, 979, 4988, 783, 1476, 358, 25847, 261, 1945, 1153, 13, 1043, 22, 16, 3159, 272, 22, 16, 293, 1527, 293, 22, 16, 471, 7182, 5578, 998, 22, 6, 225, 468, 2073, 2177, 29125, 315, 12580, 571, 8263, 31117, 30, 1922, 4988, 6, 309, 486, 14671, 578, 486, 1550, 18, 1484, 2556, 63, 304, 4988, 8336, 9959, 67, 1484, 2556, 67, 856, 14542, 365, 18, 372, 270, 273, 2238, 12, 85, 22, 13, 365, 18, 84, 1527, 273, 776, 12, 84, 22, 63, 20, 6487, 293, 22, 63, 21, 6487, 293, 22, 63, 22, 5717, 365, 18, 14932, 6837, 273, 998, 22, 365, 18, 5864, 273, 272, 22, 365, 18, 7043, 67, 2725, 1435, 327, 225, 468, 10639, 4529, 1476, 4209, 603, 12748, 87, 19, 26065, 18, 365, 18, 8082, 18, 7589, 9959, 12, 8381, 13, 225, 341, 17177, 21, 273, 776, 12, 2890, 18, 372, 270, 18, 91, 16, 365, 18, 372, 270, 18, 92, 16, 365, 18, 372, 270, 18, 93, 16, 365, 18, 372, 270, 18, 94, 13, 272, 21, 273, 365, 18, 5864, 293, 1527, 21, 273, 776, 12, 2890, 18, 84, 1527, 63, 20, 6487, 365, 18, 84, 1527, 63, 21, 6487, 365, 18, 84, 1527, 63, 22, 5717, 998, 21, 273, 365, 18, 14932, 6837, 225, 341, 17177, 22, 273, 776, 12, 85, 22, 18, 91, 16, 1043, 22, 2 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 14671, 1767, 12, 2890, 16, 1043, 22, 16, 272, 22, 16, 293, 22, 16, 998, 22, 16, 14671, 33, 5510, 4672, 315, 979, 4988, 783, 1476, 358, 25847, 261, 1945, 1153, 13, 1043, 22, 16, 3159, 272, 22, 16, 293, 1527, 293, 22, 16, 471, 7182, 5578, 998, 22, 6, 225, 468, 2073, 2177, 29125, 315, 12580, 571, 8263, 31117, 30, 1922, 4988, 6, 309, 486, 14671, 578, 486, 1550, 18, 1484, 2556, 63, 304, 4988, 8336, 9959, 67, 1484, 2556, 67, 856, 14542, 365, 18, 372, 270, 273, 2238, 12, 85, 22, 13, 365, 18, 84, 1527, 273, 776, 12, 84, 22, 63, 20, 6487, 293, 22, 63, 21, 6487, 293, 22, 63, 22, 5717, 365, 18, 2 ]
for key in request.session['shares'].iterkeys(): try: session_key = "S:%s if share_connectors.has_key(session_key): share_connectors.get(session_key).seppuku() del share_connectors[session_key] except: logger.error(traceback.format_exc())	try: for key in request.session['shares'].iterkeys(): try: session_key = "S:%s if share_connectors.has_key(session_key): share_connectors.get(session_key).seppuku() del share_connectors[session_key] except: logger.error(traceback.format_exc()) except KeyError: pass	def logout(request, **kwargs): conn = None try: conn = kwargs["conn"] except: logger.error(traceback.format_exc()) return handlerInternalError("Connection is not available. Please contact your administrator.") for key in request.session['shares'].iterkeys(): try: session_key = "S:%s#%s#%s" % (request.session.session_key,request.session['server'], key) if share_connectors.has_key(session_key): share_connectors.get(session_key).seppuku() del share_connectors[session_key] except: logger.error(traceback.format_exc()) try: del request.session['shares'] except KeyError: logger.error(traceback.format_exc()) try: session_key = "S:%s#%s" % (request.session.session_key,request.session['server']) if connectors.has_key(session_key): conn.seppuku() del connectors[session_key] except: logger.error(traceback.format_exc()) try: del request.session['server'] except KeyError: logger.error(traceback.format_exc()) try: del request.session['host'] except KeyError: logger.error(traceback.format_exc()) try: del request.session['port'] except KeyError: logger.error(traceback.format_exc()) try: del request.session['username'] except KeyError: logger.error(traceback.format_exc()) try: del request.session['password'] except KeyError: logger.error(traceback.format_exc()) try: del request.session['sessionUuid'] except KeyError: logger.error(traceback.format_exc()) try: del request.session['groupId'] except KeyError: logger.error(traceback.format_exc()) try: del request.session['experimenter'] except KeyError: logger.error(traceback.format_exc()) pass try: del request.session['imageInBasket'] except KeyError: logger.error(traceback.format_exc()) try: del request.session['nav'] except KeyError: logger.error(traceback.format_exc()) request.session.set_expiry(1) return HttpResponseRedirect("/%s/" % (settings.WEBCLIENT_ROOT_BASE))	ad77f06d874b17f64116bf1142bc099dabd5d3da /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/12409/ad77f06d874b17f64116bf1142bc099dabd5d3da/views.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 12735, 12, 2293, 16, 2826, 4333, 4672, 1487, 273, 599, 775, 30, 1487, 273, 1205, 9614, 4646, 11929, 1335, 30, 1194, 18, 1636, 12, 21696, 18, 2139, 67, 10075, 10756, 327, 1838, 20980, 2932, 1952, 353, 486, 2319, 18, 7801, 5388, 3433, 22330, 1199, 13, 225, 364, 498, 316, 590, 18, 3184, 3292, 30720, 29489, 2165, 2452, 13332, 775, 30, 1339, 67, 856, 273, 315, 55, 5319, 87, 7, 9, 87, 7, 9, 87, 6, 738, 261, 2293, 18, 3184, 18, 3184, 67, 856, 16, 2293, 18, 3184, 3292, 3567, 17337, 498, 13, 309, 7433, 67, 4646, 18886, 18, 5332, 67, 856, 12, 3184, 67, 856, 4672, 7433, 67, 4646, 18886, 18, 588, 12, 3184, 67, 856, 2934, 10814, 11938, 31562, 1435, 1464, 7433, 67, 4646, 18886, 63, 3184, 67, 856, 65, 1335, 30, 1194, 18, 1636, 12, 21696, 18, 2139, 67, 10075, 10756, 225, 775, 30, 1464, 590, 18, 3184, 3292, 30720, 3546, 1335, 4999, 30, 1194, 18, 1636, 12, 21696, 18, 2139, 67, 10075, 10756, 225, 775, 30, 1339, 67, 856, 273, 315, 55, 5319, 87, 7, 9, 87, 6, 738, 261, 2293, 18, 3184, 18, 3184, 67, 856, 16, 2293, 18, 3184, 3292, 3567, 19486, 309, 28473, 18, 5332, 67, 856, 12, 3184, 67, 856, 4672, 1487, 18, 10814, 11938, 31562, 1435, 1464, 28473, 63, 3184, 67, 856, 65, 1335, 30, 1194, 18, 1636, 12, 21696, 18, 2139, 67, 10075, 10756, 225, 775, 30, 1464, 590, 18, 3184, 3292, 3567, 3546, 1335, 4999, 2 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 12735, 12, 2293, 16, 2826, 4333, 4672, 1487, 273, 599, 775, 30, 1487, 273, 1205, 9614, 4646, 11929, 1335, 30, 1194, 18, 1636, 12, 21696, 18, 2139, 67, 10075, 10756, 327, 1838, 20980, 2932, 1952, 353, 486, 2319, 18, 7801, 5388, 3433, 22330, 1199, 13, 225, 364, 498, 316, 590, 18, 3184, 3292, 30720, 29489, 2165, 2452, 13332, 775, 30, 1339, 67, 856, 273, 315, 55, 5319, 87, 7, 9, 87, 7, 9, 87, 6, 738, 261, 2293, 18, 3184, 18, 3184, 67, 856, 16, 2293, 18, 3184, 3292, 3567, 17337, 498, 13, 309, 7433, 67, 4646, 18886, 18, 5332, 67, 856, 12, 3184, 67, 856, 4672, 7433, 67, 4646, 18886, 18, 588, 12, 3184, 67, 856, 2934, 2 ]
if not self.abort: self.parent.gauge1.SetValue(0.0) self.parent.thisvideo.append(self.parent.videos[self.parent.converting]) self.filename=REGEX_FILE_CLEANUP_FILENAME.sub('',self.parent.meta[self.parent.videos[self.parent.converting]]['name']) self.profile=int(self.parent.meta[self.parent.videos[self.parent.converting]]['profile']) self.outdir=self.parent.prefs.getp(self.profile,'Outdir') if self.outdir[-1:]==os.sep: self.outdir=self.outdir[0:-1] if not os.path.lexists(self.outdir): os.makedirs(self.outdir) elif not os.path.isdir(self.outdir): os.remove(self.outdir) os.makedirs(self.outdir) self.outdir=self.outdir+os.sep if os.path.lexists(self.uri): self.stream=self.uri	self.parent.gauge1.SetValue(0.0) self.parent.thisvideo.append(self.parent.videos[self.parent.converting]) self.filename=REGEX_FILE_CLEANUP_FILENAME.sub('',self.parent.meta[self.parent.videos[self.parent.converting]]['name']) self.profile=int(self.parent.meta[self.parent.videos[self.parent.converting]]['profile']) self.outdir=self.parent.prefs.getp(self.profile,'Outdir') if self.outdir[-1:]==os.sep: self.outdir=self.outdir[0:-1] if not os.path.lexists(self.outdir): os.makedirs(self.outdir) elif not os.path.isdir(self.outdir): os.remove(self.outdir) os.makedirs(self.outdir) self.outdir=self.outdir+os.sep if os.path.lexists(self.uri): self.stream=self.uri else: self.stream='-' if self.profile==-1: try: failed=False if self.stream=='-': src=DamnURLPicker(self.uris) total=int(src.info()['Content-Length']) try: tmpuri=src.info()['Content-Disposition'][src.info()['Content-Disposition'].find('filename=')+9:] except: tmpuri='video.avi' else: total=int(os.lstat(self.stream).st_size) src=open(self.stream,'rb') tmpuri=self.stream if REGEX_URI_EXTENSION_EXTRACT.search(tmpuri): ext='.'+REGEX_URI_EXTENSION_EXTRACT.sub('\\1',tmpuri) else: ext='.avi' self.filename=self.getfinalfilename(self.outdir,self.filename,ext) dst=open(self.outdir+self.filename+ext,'wb') keepgoing=True copied=0.0 self.parent.SetStatusText('Copying '+self.parent.meta[self.parent.videos[self.parent.converting]]['name']+' to '+self.filename+ext+'...') while keepgoing and not self.abort: i=src.read(256) if len(i): dst.write(i) copied+=256.0 else: copied=total keepgoing=False self.parent.gauge1.SetValue(min((100.0,copied/total*100.0))) except: failed=True self.grabberrun=False if self.abort or failed: self.parent.meta[self.parent.videos[self.parent.converting]]['status']='Failure.' self.parent.list.SetStringItem(self.parent.converting,ID_COL_VIDSTAT,'Failure.')	def run(self): self.abort=False if True:#for self.uri in self.uris: self.uri=self.uris[0] if not self.abort: self.parent.gauge1.SetValue(0.0) self.parent.thisvideo.append(self.parent.videos[self.parent.converting]) self.filename=REGEX_FILE_CLEANUP_FILENAME.sub('',self.parent.meta[self.parent.videos[self.parent.converting]]['name']) self.profile=int(self.parent.meta[self.parent.videos[self.parent.converting]]['profile']) self.outdir=self.parent.prefs.getp(self.profile,'Outdir') if self.outdir[-1:]==os.sep: self.outdir=self.outdir[0:-1] if not os.path.lexists(self.outdir): os.makedirs(self.outdir) elif not os.path.isdir(self.outdir): os.remove(self.outdir) os.makedirs(self.outdir) self.outdir=self.outdir+os.sep if os.path.lexists(self.uri): self.stream=self.uri # It's a file stream, ffmpeg will take care of it else: self.stream='-' # It's another stream, spawn a downloader thread to take care of it and feed the content to ffmpeg via stdin if self.profile==-1: # Do not encode, just copy try: failed=False if self.stream=='-': # Spawn a downloader src=urllib.urlopen(self.uri) total=int(src.info()['Content-Length']) try: tmpuri=src.info()['Content-Disposition'][src.info()['Content-Disposition'].find('filename=')+9:] except: tmpuri='video.avi' # And pray for the best! else: # Just copy the file, lol total=int(os.lstat(self.stream).st_size) src=open(self.stream,'rb') tmpuri=self.stream if REGEX_URI_EXTENSION_EXTRACT.search(tmpuri): ext='.'+REGEX_URI_EXTENSION_EXTRACT.sub('\\1',tmpuri) else: ext='.avi' # And pray for the best again! self.filename=self.getfinalfilename(self.outdir,self.filename,ext) dst=open(self.outdir+self.filename+ext,'wb') keepgoing=True copied=0.0 self.parent.SetStatusText('Copying '+self.parent.meta[self.parent.videos[self.parent.converting]]['name']+' to '+self.filename+ext+'...') while keepgoing and not self.abort: i=src.read(256) if len(i): dst.write(i) copied+=256.0 else: copied=total keepgoing=False self.parent.gauge1.SetValue(min((100.0,copied/total*100.0))) except: failed=True self.grabberrun=False if self.abort or failed: self.parent.meta[self.parent.videos[self.parent.converting]]['status']='Failure.' self.parent.list.SetStringItem(self.parent.converting,ID_COL_VIDSTAT,'Failure.') else: self.parent.meta[self.parent.videos[self.parent.converting]]['status']='Success!' self.parent.list.SetStringItem(self.parent.converting,ID_COL_VIDSTAT,'Success!') self.parent.go(aborted=self.abort) return os_exe_ext='' if os.name=='nt': os_exe_ext='.exe' self.passes=1 cmd=[DV_BIN_PATH+'ffmpeg'+os_exe_ext,'-i','?DAMNVID_VIDEO_STREAM?','-y','-title',self.parent.meta[self.parent.videos[self.parent.converting]]['name'],'-comment','Converted by DamnVid '+DV_VERSION+'.','-deinterlace','-passlogfile',DV_TMP_PATH+'pass'] for i in DV_PREFERENCES.keys(): if i[0:25]=='damnvid-profile:encoding_': i=i[16:] pref=self.parent.prefs.getp(self.profile,i) if pref: if type(DV_PREFERENCES['damnvid-profile:'+i]['kind']) is types.StringType: if DV_PREFERENCES['damnvid-profile:'+i]['kind'][0]=='%': pref=str(round(float(pref),0)) # Round if i=='encoding_pass': pref='?DAMNVID_VIDEO_PASS?' cmd.extend(['-'+i[9:],pref]) vidformat=self.parent.prefs.getp(self.profile,'Encoding_f') self.vcodec=self.parent.prefs.getp(self.profile,'Encoding_vcodec') self.totalpasses=self.parent.prefs.getp(self.profile,'Encoding_pass') if not self.totalpasses: self.totalpasses=1 else: self.totalpasses=int(self.totalpasses) if vidformat and DV_FILE_EXT.has_key(vidformat): ext='.'+DV_FILE_EXT[vidformat] else: if self.vcodec and DV_FILE_EXT_BY_CODEC.has_key(self.vcodec): ext='.'+DV_FILE_EXT_BY_CODEC[self.vcodec] else: ext='.avi' self.filename=self.getfinalfilename(self.outdir,self.filename,ext) self.filenamenoext=self.filename self.tmpfilename=self.gettmpfilename(DV_TMP_PATH,self.filenamenoext,ext) cmd.append('?DAMNVID_OUTPUT_FILE?') self.filename=self.filenamenoext+ext self.duration=None self.parent.SetStatusText('Converting '+self.parent.meta[self.parent.videos[self.parent.converting]]['name']+' to '+self.filename+'...') while int(self.passes)<=int(self.totalpasses) and not self.abort: if self.passes!=1: self.stream=DV_TMP_PATH+self.tmpfilename self.tmpfilename=self.gettmpfilename(DV_TMP_PATH,self.filenamenoext,ext) tmpf=open('stderr.txt','a') tmpf.write('\n\n--------\n\n') self.process=DamnSpawner(self.cmd2str(cmd),stderr=subprocess.PIPE,stdin=subprocess.PIPE,cwd=os.path.dirname(DV_TMP_PATH)) if self.stream=='-': self.feeder=DamnDownloader(self.uri,self.process.stdin) self.feeder.start() curline='' while self.process.poll()==None and not self.abort: c=self.process.stderr.read(1) tmpf.write(c) curline+=c if c=="\r" or c=="\n": self.parseLine(curline) curline='' self.passes+=1 tmpf.close() self.parent.gauge1.SetValue(100.0) result=self.process.poll() # The process is complete, but .poll() still returns the process's return code time.sleep(.25) # Wait a bit self.grabberrun=False # That'll make the DamnConverterGrabber wake up just in case if result and os.path.lexists(DV_TMP_PATH+self.tmpfilename): os.remove(DV_TMP_PATH+self.tmpfilename) # Delete the output file if ffmpeg has exitted with a bad return code for i in os.listdir(os.path.dirname(DV_TMP_PATH)): if i[0:8]=='damnvid-': i=i[8:] if i==self.tmpfilename and not result: try: os.rename(DV_TMP_PATH+i,self.outdir+self.filename) except: # Maybe the file still isn't unlocked, it happens... Wait moar and retry try: time.sleep(2) os.rename(DV_TMP_PATH+i,self.outdir+self.filename) except: # Now this is really bad, alert the user dlg=wx.MessageDialog(None,'DamnVid successfully converted the file but something prevents it from moving it to the output directory.\nAll hope is not lost, you can still move the file by yourself. It is here:\n'+DV_TMP_PATH+i,'Cannot move file!',wx.OK\|wx.ICON_EXCLAMATION) dlg.SetIcon(DV_ICON) dlg.ShowModal() dlg.Destroy() else: try: os.remove(DV_TMP_PATH+i) except: pass if not result: self.parent.meta[self.parent.videos[self.parent.converting]]['status']='Success!' self.parent.list.SetStringItem(self.parent.converting,ID_COL_VIDSTAT,'Success!') self.parent.go(aborted=self.abort) return self.parent.meta[self.parent.videos[self.parent.converting]]['status']='Failure.' self.parent.list.SetStringItem(self.parent.converting,ID_COL_VIDSTAT,'Failure.') self.parent.go(aborted=self.abort)	7ad6098b40f1a39c4d76402fede5772f656b7b13 /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/11142/7ad6098b40f1a39c4d76402fede5772f656b7b13/DamnVid.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1086, 12, 2890, 4672, 365, 18, 18623, 33, 8381, 309, 1053, 27363, 1884, 365, 18, 1650, 316, 365, 18, 23510, 30, 365, 18, 1650, 33, 2890, 18, 23510, 63, 20, 65, 365, 18, 2938, 18, 75, 8305, 21, 18, 694, 620, 12, 20, 18, 20, 13, 365, 18, 2938, 18, 2211, 9115, 18, 6923, 12, 2890, 18, 2938, 18, 6768, 538, 63, 2890, 18, 2938, 18, 6283, 310, 5717, 365, 18, 3459, 33, 12472, 67, 3776, 67, 39, 10439, 3079, 67, 16080, 18, 1717, 2668, 2187, 2890, 18, 2938, 18, 3901, 63, 2890, 18, 2938, 18, 6768, 538, 63, 2890, 18, 2938, 18, 6283, 310, 13563, 3292, 529, 19486, 365, 18, 5040, 33, 474, 12, 2890, 18, 2938, 18, 3901, 63, 2890, 18, 2938, 18, 6768, 538, 63, 2890, 18, 2938, 18, 6283, 310, 13563, 3292, 5040, 19486, 365, 18, 659, 1214, 33, 2890, 18, 2938, 18, 1484, 2556, 18, 588, 84, 12, 2890, 18, 5040, 11189, 1182, 1214, 6134, 309, 365, 18, 659, 1214, 18919, 21, 26894, 631, 538, 18, 10814, 30, 365, 18, 659, 1214, 33, 2890, 18, 659, 1214, 63, 20, 30, 17, 21, 65, 309, 486, 1140, 18, 803, 18, 4149, 1486, 12, 2890, 18, 659, 1214, 4672, 1140, 18, 81, 9477, 10539, 12, 2890, 18, 659, 1214, 13, 1327, 486, 1140, 18, 803, 18, 291, 1214, 12, 2890, 18, 659, 1214, 4672, 1140, 18, 4479, 12, 2890, 18, 659, 1214, 13, 1140, 18, 81, 9477, 10539, 12, 2890, 18, 659, 1214, 2 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1086, 12, 2890, 4672, 365, 18, 18623, 33, 8381, 309, 1053, 27363, 1884, 365, 18, 1650, 316, 365, 18, 23510, 30, 365, 18, 1650, 33, 2890, 18, 23510, 63, 20, 65, 365, 18, 2938, 18, 75, 8305, 21, 18, 694, 620, 12, 20, 18, 20, 13, 365, 18, 2938, 18, 2211, 9115, 18, 6923, 12, 2890, 18, 2938, 18, 6768, 538, 63, 2890, 18, 2938, 18, 6283, 310, 5717, 365, 18, 3459, 33, 12472, 67, 3776, 67, 39, 10439, 3079, 67, 16080, 18, 1717, 2668, 2187, 2890, 18, 2938, 18, 3901, 63, 2890, 18, 2938, 18, 6768, 538, 63, 2890, 18, 2938, 18, 6283, 310, 13563, 3292, 529, 19486, 365, 18, 5040, 33, 474, 12, 2890, 18, 2938, 2 ]
self.parser.openElements.pop()	if self.parser.openElements[-1] == name: self.parser.openElements.pop() else: self.parser.parseError()	def endTagTitleStyleScript(self, name): self.parser.openElements.pop()	9968d62be9415e0f0c75be992d56b7adab3b89d3 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/4487/9968d62be9415e0f0c75be992d56b7adab3b89d3/parser.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 29765, 4247, 2885, 3651, 12, 2890, 16, 508, 4672, 309, 365, 18, 4288, 18, 3190, 3471, 18919, 21, 65, 422, 508, 30, 365, 18, 4288, 18, 3190, 3471, 18, 5120, 1435, 469, 30, 365, 18, 4288, 18, 2670, 668, 1435, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 29765, 4247, 2885, 3651, 12, 2890, 16, 508, 4672, 309, 365, 18, 4288, 18, 3190, 3471, 18919, 21, 65, 422, 508, 30, 365, 18, 4288, 18, 3190, 3471, 18, 5120, 1435, 469, 30, 365, 18, 4288, 18, 2670, 668, 1435, 225, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
def eval(self, args, *kwds):	def eval(self, code, globals=None, locals=None, synchronize=True, args, *kwds):	def eval(self, args, *kwds): """ Evaluates a command inside the R interpreter and returns the output as a string. EXAMPLES: sage: r.eval('1+1') '[1] 2'	27b9dddb1083d54aec9102ed84a9441f2f76eb42 /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/9890/27b9dddb1083d54aec9102ed84a9441f2f76eb42/r.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 5302, 12, 2890, 16, 981, 16, 10941, 33, 7036, 16, 8985, 33, 7036, 16, 16978, 33, 5510, 16, 380, 1968, 16, 2826, 25577, 4672, 3536, 10271, 815, 279, 1296, 4832, 326, 534, 16048, 471, 1135, 326, 876, 487, 279, 533, 18, 225, 5675, 8900, 11386, 30, 272, 410, 30, 436, 18, 8622, 2668, 21, 15, 21, 6134, 5271, 21, 65, 576, 11, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 5302, 12, 2890, 16, 981, 16, 10941, 33, 7036, 16, 8985, 33, 7036, 16, 16978, 33, 5510, 16, 380, 1968, 16, 2826, 25577, 4672, 3536, 10271, 815, 279, 1296, 4832, 326, 534, 16048, 471, 1135, 326, 876, 487, 279, 533, 18, 225, 5675, 8900, 11386, 30, 272, 410, 30, 436, 18, 8622, 2668, 21, 15, 21, 6134, 5271, 21, 65, 576, 11, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
HandlerAPI.DeliverToList(self, msg, newdata=msgdata)	HandlerAPI.DeliverToList(self, msg, msgdata)	def __handlepost(self, record, value, comment): # For backwards compatibility with pre 2.0beta3 if len(record) == 5: ptime, sender, subject, reason, filename = record msgdata = {} else: # New format of record ptime, sender, subject, reason, filename, msgdata = record path = os.path.join(mm_cfg.DATA_DIR, filename) rejection = None if value == 0: # Approved try: fp = open(path) except IOError: # we lost the message text file. clean up our housekeeping # and raise an exception. raise Errors.LostHeldMessage(path) msg = Message.Message(fp) msgdata['approved'] = 1 # ignore return value HandlerAPI.DeliverToList(self, msg, newdata=msgdata) elif value == 1: # Rejected rejection = 'Refused' if not self.dont_respond_to_post_requests: self.__refuse('Posting of your message titled "%s"' % subject, sender, comment or '[No reason given]') else: assert value == 2 # Discarded rejection = 'Discarded' # Log the rejection def strquote(s): return string.replace(s, '%', '%%')	18950fcd77ad9afe6dbee3c2be29fd019aabcd9a /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/2120/18950fcd77ad9afe6dbee3c2be29fd019aabcd9a/ListAdmin.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 4110, 2767, 12, 2890, 16, 1409, 16, 460, 16, 2879, 4672, 468, 2457, 12727, 8926, 598, 675, 576, 18, 20, 5758, 23, 309, 562, 12, 3366, 13, 422, 1381, 30, 293, 957, 16, 5793, 16, 3221, 16, 3971, 16, 1544, 273, 1409, 1234, 892, 273, 2618, 469, 30, 468, 1166, 740, 434, 1409, 293, 957, 16, 5793, 16, 3221, 16, 3971, 16, 1544, 16, 1234, 892, 273, 1409, 589, 273, 1140, 18, 803, 18, 5701, 12, 7020, 67, 7066, 18, 4883, 67, 4537, 16, 1544, 13, 283, 3710, 273, 599, 309, 460, 422, 374, 30, 468, 1716, 685, 2155, 775, 30, 4253, 273, 1696, 12, 803, 13, 1335, 8340, 30, 468, 732, 13557, 326, 883, 977, 585, 18, 225, 2721, 731, 3134, 23867, 10102, 310, 468, 471, 1002, 392, 1520, 18, 1002, 9372, 18, 19024, 44, 488, 1079, 12, 803, 13, 1234, 273, 2350, 18, 1079, 12, 7944, 13, 1234, 892, 3292, 25990, 3546, 273, 404, 468, 2305, 327, 460, 4663, 2557, 18, 20813, 25772, 12, 2890, 16, 1234, 16, 1234, 892, 13, 1327, 460, 422, 404, 30, 468, 868, 6059, 283, 3710, 273, 296, 1957, 3668, 11, 309, 486, 365, 18, 72, 1580, 67, 17863, 67, 869, 67, 2767, 67, 11420, 30, 365, 16186, 1734, 1202, 2668, 3349, 310, 434, 3433, 883, 268, 305, 1259, 2213, 87, 5187, 738, 3221, 16, 5793, 16, 2879, 578, 5271, 2279, 3971, 864, 3864, 13, 469, 30, 1815, 460, 422, 576, 468, 3035, 16500, 283, 3710, 273, 296, 2 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 4110, 2767, 12, 2890, 16, 1409, 16, 460, 16, 2879, 4672, 468, 2457, 12727, 8926, 598, 675, 576, 18, 20, 5758, 23, 309, 562, 12, 3366, 13, 422, 1381, 30, 293, 957, 16, 5793, 16, 3221, 16, 3971, 16, 1544, 273, 1409, 1234, 892, 273, 2618, 469, 30, 468, 1166, 740, 434, 1409, 293, 957, 16, 5793, 16, 3221, 16, 3971, 16, 1544, 16, 1234, 892, 273, 1409, 589, 273, 1140, 18, 803, 18, 5701, 12, 7020, 67, 7066, 18, 4883, 67, 4537, 16, 1544, 13, 283, 3710, 273, 599, 309, 460, 422, 374, 30, 468, 1716, 685, 2155, 775, 30, 4253, 273, 1696, 12, 803, 13, 1335, 8340, 30, 468, 732, 13557, 326, 883, 977, 585, 2 ]
tc = 1.0/max(abs(vals.real)) T = arange(0,8tc,8tc / float(N))	tc = 1.0/max(abs(real(vals))) T = arange(0,10tc,10tc / float(N))	def impulse(system, X0=None, T=None, N=None): if isinstance(system, lti): sys = system else: sys = lti(system) if X0 is None: B = sys.B else: B = sys.B + X0 if N is None: N = 100 if T is None: vals = linalg.eigvals(sys.A) tc = 1.0/max(abs(vals.real)) T = arange(0,8tc,8tc / float(N)) h = zeros(T.shape, sys.A.typecode()) for k in range(len(h)): eA = Mat(linalg.expm(sys.AT[k])) B,C = map(Mat, (B,sys.C)) h[k] = squeeze(CeAB) return T, h	268e9b5bffbd8a297de272073e03dd07dffaa5bc /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/12971/268e9b5bffbd8a297de272073e03dd07dffaa5bc/ltisys.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1646, 24667, 12, 4299, 16, 1139, 20, 33, 7036, 16, 399, 33, 7036, 16, 423, 33, 7036, 4672, 309, 1549, 12, 4299, 16, 20197, 4672, 2589, 273, 2619, 469, 30, 2589, 273, 20197, 30857, 4299, 13, 309, 1139, 20, 353, 599, 30, 605, 273, 2589, 18, 38, 469, 30, 605, 273, 2589, 18, 38, 397, 1139, 20, 309, 423, 353, 599, 30, 423, 273, 2130, 309, 399, 353, 599, 30, 5773, 273, 11818, 18, 22663, 4524, 12, 9499, 18, 37, 13, 1715, 273, 404, 18, 20, 19, 1896, 12, 5113, 12, 7688, 12, 4524, 20349, 399, 273, 9660, 12, 20, 16, 2163, 14, 5111, 16, 2163, 14, 5111, 342, 1431, 12, 50, 3719, 366, 273, 4922, 12, 56, 18, 4867, 16, 2589, 18, 37, 18, 723, 710, 10756, 364, 417, 316, 1048, 12, 1897, 12, 76, 3719, 30, 425, 37, 273, 14493, 12, 80, 11521, 18, 2749, 81, 12, 9499, 18, 37, 14, 56, 63, 79, 22643, 605, 16, 39, 273, 852, 12, 15947, 16, 261, 38, 16, 9499, 18, 39, 3719, 366, 63, 79, 65, 273, 17173, 12, 39, 14, 73, 37, 14, 38, 13, 327, 399, 16, 366, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1646, 24667, 12, 4299, 16, 1139, 20, 33, 7036, 16, 399, 33, 7036, 16, 423, 33, 7036, 4672, 309, 1549, 12, 4299, 16, 20197, 4672, 2589, 273, 2619, 469, 30, 2589, 273, 20197, 30857, 4299, 13, 309, 1139, 20, 353, 599, 30, 605, 273, 2589, 18, 38, 469, 30, 605, 273, 2589, 18, 38, 397, 1139, 20, 309, 423, 353, 599, 30, 423, 273, 2130, 309, 399, 353, 599, 30, 5773, 273, 11818, 18, 22663, 4524, 12, 9499, 18, 37, 13, 1715, 273, 404, 18, 20, 19, 1896, 12, 5113, 12, 7688, 12, 4524, 20349, 399, 273, 9660, 12, 20, 16, 2163, 14, 5111, 16, 2163, 14, 5111, 342, 1431, 12, 50, 3719, 366, 273, 4922, 12, 56, 2 ]
if type_datum is UnicodeType:	type_datum = type(datum) if type_datum == UnicodeType:	def SearchableText(self): """All fields marked as 'searchable' are concatenated together here for indexing purpose""" data = [] charset = self.getCharset() for field in self.Schema().fields(): if not field.searchable: continue method = field.getAccessor(self) try: datum = method(mimetype="text/plain") except TypeError: # retry in case typeerror was raised because accessor doesn't # handle the mimetype argument try: datum = method() except: continue	f0ae295d4e54409254bff207c9403071e6554fe7 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/12165/f0ae295d4e54409254bff207c9403071e6554fe7/BaseObject.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 5167, 429, 1528, 12, 2890, 4672, 3536, 1595, 1466, 9350, 487, 296, 3072, 429, 11, 854, 22080, 9475, 2674, 364, 14403, 13115, 8395, 501, 273, 5378, 4856, 273, 365, 18, 588, 9652, 1435, 364, 652, 316, 365, 18, 3078, 7675, 2821, 13332, 309, 486, 652, 18, 3072, 429, 30, 1324, 707, 273, 652, 18, 588, 8235, 12, 2890, 13, 775, 30, 12059, 273, 225, 707, 12, 22571, 1546, 955, 19, 7446, 7923, 1335, 3580, 30, 468, 3300, 316, 648, 618, 1636, 1703, 11531, 2724, 9789, 3302, 1404, 468, 1640, 326, 12595, 1237, 775, 30, 12059, 273, 225, 707, 1435, 1335, 30, 1324, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 5167, 429, 1528, 12, 2890, 4672, 3536, 1595, 1466, 9350, 487, 296, 3072, 429, 11, 854, 22080, 9475, 2674, 364, 14403, 13115, 8395, 501, 273, 5378, 4856, 273, 365, 18, 588, 9652, 1435, 364, 652, 316, 365, 18, 3078, 7675, 2821, 13332, 309, 486, 652, 18, 3072, 429, 30, 1324, 707, 273, 652, 18, 588, 8235, 12, 2890, 13, 775, 30, 12059, 273, 225, 707, 12, 22571, 1546, 955, 19, 7446, 7923, 1335, 3580, 30, 468, 3300, 316, 648, 618, 1636, 1703, 11531, 2724, 9789, 3302, 1404, 468, 1640, 326, 12595, 1237, 775, 30, 12059, 273, 225, 707, 1435, 1335, 30, 1324, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
except EOFError: typ, dat = None, [None]	except: typ, dat = 'NO', ['%s: %s' % sys.exc_info()[:2]]	def logout(self): """Shutdown connection to server.	30d7469fec69eeeae9057b22a126d4a00278147c /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/12029/30d7469fec69eeeae9057b22a126d4a00278147c/imaplib.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 12735, 12, 2890, 4672, 3536, 10961, 1459, 358, 1438, 18, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 12735, 12, 2890, 4672, 3536, 10961, 1459, 358, 1438, 18, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
class TopVirusesDetected(reports.Graph):	class TopWebVirusesDetected(reports.Graph):	def get_plot(self, end_date, report_days, host=None, user=None, email=None): ed = DateFromMx(end_date) one_week = DateFromMx(end_date - mx.DateTime.DateTimeDelta(report_days))	105b5e27bf63d007da247194879b178db12c5076 /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/87/105b5e27bf63d007da247194879b178db12c5076/untangle_base_virus.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 336, 67, 4032, 12, 2890, 16, 679, 67, 712, 16, 2605, 67, 9810, 16, 1479, 33, 7036, 16, 729, 33, 7036, 16, 2699, 33, 7036, 4672, 1675, 273, 2167, 1265, 49, 92, 12, 409, 67, 712, 13, 1245, 67, 10741, 273, 2167, 1265, 49, 92, 12, 409, 67, 712, 300, 7938, 18, 5096, 18, 5096, 9242, 12, 6006, 67, 9810, 3719, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 336, 67, 4032, 12, 2890, 16, 679, 67, 712, 16, 2605, 67, 9810, 16, 1479, 33, 7036, 16, 729, 33, 7036, 16, 2699, 33, 7036, 4672, 1675, 273, 2167, 1265, 49, 92, 12, 409, 67, 712, 13, 1245, 67, 10741, 273, 2167, 1265, 49, 92, 12, 409, 67, 712, 300, 7938, 18, 5096, 18, 5096, 9242, 12, 6006, 67, 9810, 3719, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
"Could not find example root directory. Do you have the " \	"Could not find example root directory. Do you have the" \	def test_get_test_path(): assert os.path.isdir(get_example_path('')), \ "Could not find example root directory. Do you have the " \ + " whole repository structure checked out?"	51cce200bcae1cb17e93d25a05a967a88116f114 /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/7711/51cce200bcae1cb17e93d25a05a967a88116f114/jmitest.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1842, 67, 588, 67, 3813, 67, 803, 13332, 1815, 1140, 18, 803, 18, 291, 1214, 12, 588, 67, 8236, 67, 803, 2668, 6134, 3631, 521, 315, 4445, 486, 1104, 3454, 1365, 1867, 18, 2256, 1846, 1240, 326, 6, 521, 397, 315, 7339, 3352, 3695, 5950, 596, 7225, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1842, 67, 588, 67, 3813, 67, 803, 13332, 1815, 1140, 18, 803, 18, 291, 1214, 12, 588, 67, 8236, 67, 803, 2668, 6134, 3631, 521, 315, 4445, 486, 1104, 3454, 1365, 1867, 18, 2256, 1846, 1240, 326, 6, 521, 397, 315, 7339, 3352, 3695, 5950, 596, 7225, 225, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
guess = self.add(bank, 077777 & ~bugger)	guess = self._add(bank, 077777 & ~bugger)	def __init__(self, context): self.context = context # Assembler context. self.objectCode = {}	17f6f0cbe742001a56ee33de28087b87c16288b2 /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/8152/17f6f0cbe742001a56ee33de28087b87c16288b2/binary.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 2890, 16, 819, 4672, 365, 18, 2472, 273, 819, 2868, 468, 2970, 5747, 749, 819, 18, 365, 18, 1612, 1085, 273, 2618, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 2890, 16, 819, 4672, 365, 18, 2472, 273, 819, 2868, 468, 2970, 5747, 749, 819, 18, 365, 18, 1612, 1085, 273, 2618, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
(cSuccess, cResult), (sSuccess, sResult) = util.deferredResult(d) self.failIf(cSuccess) self.failIf(sSuccess) errors = log.flushErrors(SSL.Error)	def afterLost(((cSuccess, cResult), (sSuccess, sResult))): self.failIf(cSuccess) self.failIf(sSuccess) return d.addCallback(afterLost)	def testRefusedAnonymousClientConnection(self): onServerLost = defer.Deferred() onClientLost = defer.Deferred() self.loopback(sslverify.OpenSSLCertificateOptions(privateKey=self.sKey, certificate=self.sCert, verify=True, caCerts=[self.sCert], requireCertificate=True), sslverify.OpenSSLCertificateOptions(requireCertificate=False), onServerLost=onServerLost, onClientLost=onClientLost)	6305a011c61d2e3075143d6d1aac62b453e35f67 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/8962/6305a011c61d2e3075143d6d1aac62b453e35f67/test_sslverify.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1842, 1957, 3668, 18792, 1227, 1952, 12, 2890, 4672, 603, 2081, 19024, 273, 2220, 18, 16886, 1435, 603, 1227, 19024, 273, 2220, 18, 16886, 1435, 365, 18, 6498, 823, 12, 8157, 8705, 18, 3678, 6745, 4719, 1320, 12, 1152, 653, 33, 2890, 18, 87, 653, 16, 4944, 33, 2890, 18, 87, 5461, 16, 3929, 33, 5510, 16, 3474, 16273, 22850, 2890, 18, 87, 5461, 6487, 2583, 4719, 33, 5510, 3631, 5832, 8705, 18, 3678, 6745, 4719, 1320, 12, 6528, 4719, 33, 8381, 3631, 603, 2081, 19024, 33, 265, 2081, 19024, 16, 603, 1227, 19024, 33, 265, 1227, 19024, 13, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1842, 1957, 3668, 18792, 1227, 1952, 12, 2890, 4672, 603, 2081, 19024, 273, 2220, 18, 16886, 1435, 603, 1227, 19024, 273, 2220, 18, 16886, 1435, 365, 18, 6498, 823, 12, 8157, 8705, 18, 3678, 6745, 4719, 1320, 12, 1152, 653, 33, 2890, 18, 87, 653, 16, 4944, 33, 2890, 18, 87, 5461, 16, 3929, 33, 5510, 16, 3474, 16273, 22850, 2890, 18, 87, 5461, 6487, 2583, 4719, 33, 5510, 3631, 5832, 8705, 18, 3678, 6745, 4719, 1320, 12, 6528, 4719, 33, 8381, 3631, 603, 2081, 19024, 33, 265, 2081, 19024, 16, 603, 1227, 19024, 33, 265, 1227, 19024, 13, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
return html2unicode(s, language = incode)	return unicodeName(s, language = incode)	def interwikiFormat(links, incode): """Create a suitable string to start a wikipedia page consisting of interwikilinks given as a dictionary of code:pagename in the argument. """ s = [] ar = links.keys() ar.sort() if mylang in config.interwiki_englishfirst: if 'en' in ar: del ar[ar.index('en')] ar[:0]=['en'] for code in ar: try: s.append(links[code].aslink()) except AttributeError: s.append('[[%s:%s]]' % (code, links[code])) s=config.interwiki_langs_separator.join(s) + '\r\n' return html2unicode(s, language = incode)	b62f0c7652f84c145d97d46d58d9c2d64f35ee08 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/4404/b62f0c7652f84c145d97d46d58d9c2d64f35ee08/wikipedia.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1554, 13044, 1630, 12, 7135, 16, 316, 710, 4672, 3536, 1684, 279, 10631, 533, 358, 787, 279, 21137, 1363, 23570, 434, 1554, 11999, 330, 754, 87, 864, 487, 279, 3880, 434, 981, 30, 9095, 1069, 316, 326, 1237, 18, 3536, 272, 273, 5378, 419, 273, 4716, 18, 2452, 1435, 419, 18, 3804, 1435, 309, 3399, 4936, 316, 642, 18, 2761, 13044, 67, 275, 13740, 3645, 30, 309, 296, 275, 11, 316, 419, 30, 1464, 419, 63, 297, 18, 1615, 2668, 275, 6134, 65, 419, 10531, 20, 65, 33, 3292, 275, 3546, 364, 981, 316, 419, 30, 775, 30, 272, 18, 6923, 12, 7135, 63, 710, 8009, 345, 1232, 10756, 1335, 6394, 30, 272, 18, 6923, 2668, 63, 14451, 87, 5319, 87, 65, 3864, 738, 261, 710, 16, 4716, 63, 710, 22643, 272, 33, 1425, 18, 2761, 13044, 67, 4936, 87, 67, 11287, 18, 5701, 12, 87, 13, 397, 2337, 86, 64, 82, 11, 327, 5252, 461, 12, 87, 16, 2653, 273, 316, 710, 13, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1554, 13044, 1630, 12, 7135, 16, 316, 710, 4672, 3536, 1684, 279, 10631, 533, 358, 787, 279, 21137, 1363, 23570, 434, 1554, 11999, 330, 754, 87, 864, 487, 279, 3880, 434, 981, 30, 9095, 1069, 316, 326, 1237, 18, 3536, 272, 273, 5378, 419, 273, 4716, 18, 2452, 1435, 419, 18, 3804, 1435, 309, 3399, 4936, 316, 642, 18, 2761, 13044, 67, 275, 13740, 3645, 30, 309, 296, 275, 11, 316, 419, 30, 1464, 419, 63, 297, 18, 1615, 2668, 275, 6134, 65, 419, 10531, 20, 65, 33, 3292, 275, 3546, 364, 981, 316, 419, 30, 775, 30, 272, 18, 6923, 12, 7135, 63, 710, 8009, 345, 1232, 10756, 1335, 6394, 30, 272, 18, 6923, 2668, 63, 14451, 2 ]
sync_open = sync_open sync_read = sync_read sync_close = sync_close		def producer_stalled (self): return not ( self.async_closed or len (self.async_buffers) > 0 )	d682bff8b8919db3c121c9b1fc5bed856eb8f68b /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/2577/d682bff8b8919db3c121c9b1fc5bed856eb8f68b/synchronized.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 12608, 67, 334, 4502, 261, 2890, 4672, 327, 486, 261, 365, 18, 3810, 67, 12204, 578, 562, 261, 2890, 18, 3810, 67, 28101, 13, 405, 374, 262, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 12608, 67, 334, 4502, 261, 2890, 4672, 327, 486, 261, 365, 18, 3810, 67, 12204, 578, 562, 261, 2890, 18, 3810, 67, 28101, 13, 405, 374, 262, 225, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
def unicode_internal_decode( unistr,errors='strict'): """None """ if type(unistr) == unicode: return unistr,len(unistr) else: return unicode(unistr),len(unistr)		def utf_16_be_encode( obj,errors='strict'): """None """ res = PyUnicode_EncodeUTF16(obj,len(obj),errors,'big') res = ''.join(res) return res, len(res)	43ce23feb40aadc6a6a9c31d19c968e0351f9245 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/6934/43ce23feb40aadc6a6a9c31d19c968e0351f9245/inprogress__codecs.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 7718, 67, 2313, 67, 2196, 67, 3015, 12, 1081, 16, 4324, 2218, 13948, 11, 4672, 3536, 7036, 3536, 400, 273, 4707, 16532, 67, 5509, 5159, 2313, 12, 2603, 16, 1897, 12, 2603, 3631, 4324, 11189, 14002, 6134, 400, 273, 875, 18, 5701, 12, 455, 13, 327, 400, 16, 562, 12, 455, 13, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 7718, 67, 2313, 67, 2196, 67, 3015, 12, 1081, 16, 4324, 2218, 13948, 11, 4672, 3536, 7036, 3536, 400, 273, 4707, 16532, 67, 5509, 5159, 2313, 12, 2603, 16, 1897, 12, 2603, 3631, 4324, 11189, 14002, 6134, 400, 273, 875, 18, 5701, 12, 455, 13, 327, 400, 16, 562, 12, 455, 13, 225, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
dir.Append(Function(VideoItem(PlayVideo,video.text,thumb=R(ICON),art=R(ART)),link = video.get("href")))	dir.Append(Function(VideoItem(PlayVideo,video.text),link = video.get("href")))	def ParseSearchResults(sender, query=None): dir = MediaContainer(viewGroup="InfoList") results = HTML.ElementFromURL('http://www.khanacademy.org/search?page_search_query='+query).xpath("//section[@class='videos']//dt/a") if results == []: return MessageContainer('No Results','No video file could be found for the following query: '+query) for video in results: dir.Append(Function(VideoItem(PlayVideo,video.text,thumb=R(ICON),art=R(ART)),link = video.get("href"))) return dir	f4c8dcb66d81d6ad90a3b46a428caddbc823b2dd /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/14350/f4c8dcb66d81d6ad90a3b46a428caddbc823b2dd/__init__.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 2884, 2979, 3447, 12, 15330, 16, 843, 33, 7036, 4672, 225, 1577, 273, 6128, 2170, 12, 1945, 1114, 1546, 17914, 7923, 225, 1686, 273, 3982, 18, 1046, 1265, 1785, 2668, 2505, 2207, 5591, 18, 79, 25842, 1077, 2486, 4811, 18, 3341, 19, 3072, 35, 2433, 67, 3072, 67, 2271, 2218, 15, 2271, 2934, 18644, 2932, 759, 3464, 14782, 1106, 2218, 6768, 538, 3546, 759, 7510, 19, 69, 7923, 225, 309, 1686, 422, 5378, 30, 327, 2350, 2170, 2668, 2279, 10351, 17023, 2279, 6191, 585, 3377, 506, 1392, 364, 326, 3751, 843, 30, 15126, 2271, 13, 225, 364, 6191, 316, 1686, 30, 1577, 18, 5736, 12, 2083, 12, 10083, 1180, 12, 11765, 10083, 16, 9115, 18, 955, 3631, 1232, 273, 6191, 18, 588, 2932, 7547, 6, 20349, 225, 327, 1577, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 2884, 2979, 3447, 12, 15330, 16, 843, 33, 7036, 4672, 225, 1577, 273, 6128, 2170, 12, 1945, 1114, 1546, 17914, 7923, 225, 1686, 273, 3982, 18, 1046, 1265, 1785, 2668, 2505, 2207, 5591, 18, 79, 25842, 1077, 2486, 4811, 18, 3341, 19, 3072, 35, 2433, 67, 3072, 67, 2271, 2218, 15, 2271, 2934, 18644, 2932, 759, 3464, 14782, 1106, 2218, 6768, 538, 3546, 759, 7510, 19, 69, 7923, 225, 309, 1686, 422, 5378, 30, 327, 2350, 2170, 2668, 2279, 10351, 17023, 2279, 6191, 585, 3377, 506, 1392, 364, 326, 3751, 843, 30, 15126, 2271, 13, 225, 364, 6191, 316, 1686, 30, 1577, 18, 5736, 12, 2083, 12, 10083, 1180, 12, 11765, 10083, 16, 9115, 18, 955, 3631, 1232, 2 ]
def __init__(self, out=None):	def __init__(self, out=None, encoding="iso-8859-1"):	def __init__(self, out=None): if out is None: import sys out = sys.stdout handler.ContentHandler.__init__(self) self._out = out	d2e8ed58c83ecc5390d6cf99651b791350b04e61 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/8125/d2e8ed58c83ecc5390d6cf99651b791350b04e61/saxutils.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 2890, 16, 596, 33, 7036, 16, 2688, 1546, 9699, 17, 17258, 17, 21, 6, 4672, 309, 596, 353, 599, 30, 1930, 2589, 596, 273, 2589, 18, 10283, 1838, 18, 1350, 1503, 16186, 2738, 972, 12, 2890, 13, 365, 6315, 659, 273, 596, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 2890, 16, 596, 33, 7036, 16, 2688, 1546, 9699, 17, 17258, 17, 21, 6, 4672, 309, 596, 353, 599, 30, 1930, 2589, 596, 273, 2589, 18, 10283, 1838, 18, 1350, 1503, 16186, 2738, 972, 12, 2890, 13, 365, 6315, 659, 273, 596, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
output(u'Image deleted before getting the Hash. Skipping...')	output(u'File deleted before getting the Hash. Skipping...')	def getHash(self): """ Function that return the Hash of an image in oder to understand if two Images are the same or not. """ if self.exists(): params = { 'action' :'query', 'titles' :self.title(), 'prop' :'imageinfo', 'iiprop' :'sha1', } # First of all we need the Hash that identify an image data = query.GetData(params, useAPI = True, encodeTitle = False) pageid = data['query']['pages'].keys()[0] try: hash_found = data['query']['pages'][pageid][u'imageinfo'][0][u'sha1'] except (KeyError, IndexError): if self.exists(): raise NoHash('No Hash found in the APIs! Maybe the regex to catch it is wrong or someone has changed the APIs structure.') else: output(u'Image deleted before getting the Hash. Skipping...') return None else: return hash_found else: output(u'Image deleted before getting the Hash. Skipping...') return None	b4e6dbf405f65d45e84baeb5508d02d04da189c0 /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/4404/b4e6dbf405f65d45e84baeb5508d02d04da189c0/wikipedia.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 16075, 12, 2890, 4672, 3536, 4284, 716, 327, 326, 2474, 434, 392, 1316, 316, 320, 765, 358, 22413, 309, 2795, 23022, 854, 326, 1967, 578, 486, 18, 3536, 309, 365, 18, 1808, 13332, 859, 273, 288, 296, 1128, 11, 565, 22974, 2271, 2187, 296, 17643, 11, 565, 294, 2890, 18, 2649, 9334, 296, 5986, 11, 1377, 22974, 2730, 1376, 2187, 296, 77, 625, 1764, 11, 565, 22974, 7819, 21, 2187, 289, 468, 5783, 434, 777, 732, 1608, 326, 2474, 716, 9786, 392, 1316, 501, 273, 843, 18, 967, 751, 12, 2010, 16, 999, 2557, 273, 1053, 16, 2017, 4247, 273, 1083, 13, 1363, 350, 273, 501, 3292, 2271, 21712, 7267, 29489, 2452, 1435, 63, 20, 65, 775, 30, 1651, 67, 7015, 273, 501, 3292, 2271, 21712, 7267, 3546, 63, 30974, 6362, 89, 11, 2730, 1376, 3546, 63, 20, 6362, 89, 1807, 3395, 21, 3546, 1335, 261, 653, 668, 16, 10195, 4672, 309, 365, 18, 1808, 13332, 1002, 2631, 2310, 2668, 2279, 2474, 1392, 316, 326, 19947, 5, 14024, 326, 3936, 358, 1044, 518, 353, 7194, 578, 18626, 711, 3550, 326, 19947, 3695, 1093, 13, 469, 30, 876, 12, 89, 11, 812, 4282, 1865, 8742, 326, 2474, 18, 27455, 7821, 13, 327, 599, 469, 30, 327, 1651, 67, 7015, 469, 30, 876, 12, 89, 11, 812, 4282, 1865, 8742, 326, 2474, 18, 27455, 7821, 13, 327, 599, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 16075, 12, 2890, 4672, 3536, 4284, 716, 327, 326, 2474, 434, 392, 1316, 316, 320, 765, 358, 22413, 309, 2795, 23022, 854, 326, 1967, 578, 486, 18, 3536, 309, 365, 18, 1808, 13332, 859, 273, 288, 296, 1128, 11, 565, 22974, 2271, 2187, 296, 17643, 11, 565, 294, 2890, 18, 2649, 9334, 296, 5986, 11, 1377, 22974, 2730, 1376, 2187, 296, 77, 625, 1764, 11, 565, 22974, 7819, 21, 2187, 289, 468, 5783, 434, 777, 732, 1608, 326, 2474, 716, 9786, 392, 1316, 501, 273, 843, 18, 967, 751, 12, 2010, 16, 999, 2557, 273, 1053, 16, 2017, 4247, 273, 1083, 13, 1363, 350, 273, 501, 3292, 2271, 21712, 7267, 29489, 2452, 1435, 63, 20, 65, 775, 30, 2 ]
if dep1[0] == 'T' or dep1[0:2] == 'IT': return depUpdateRules[dep2][dep1] return depUpdateRules[dep1][dep2]	dep1_required = isRequiredDep(dep1) dep1_direct = isDirectDep(dep1) dep1_lib = isLibDep(dep1) dep2_required = isRequiredDep(dep2) dep2_direct = isDirectDep(dep2) dep2_lib = isLibDep(dep2) selectedDep = False if dep1 == dep2: newDep = dep1 selectedDep = True if not selectedDep: if dep1_required and not dep2_required: newDep = dep1 selectedDep = True elif not dep1_required and dep2_required: newDep = dep2 selectedDep = True if not selectedDep: if dep1_direct and not dep2_direct: newDep = dep1 selectedDep = True elif not dep1_direct and dep2_direct: newDep = dep2 selectedDep = True if not selectedDep: if dep1_lib and not dep2_lib: newDep = dep1 selectedDep = True elif not dep1_lib and dep2_lib: newDep = dep2 selectedDep = True assert(selectedDep) return newDep	def updatePackageDep(dep1, dep2): if dep1[0] == 'T' or dep1[0:2] == 'IT': return depUpdateRules[dep2][dep1] return depUpdateRules[dep1][dep2]	14ce9fd4920947e5f8b1813e1f49ee4adffd7eaf /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/1130/14ce9fd4920947e5f8b1813e1f49ee4adffd7eaf/TrilinosDependencies.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1089, 2261, 16316, 12, 15037, 21, 16, 5993, 22, 4672, 565, 5993, 21, 67, 4718, 273, 14967, 16316, 12, 15037, 21, 13, 5993, 21, 67, 7205, 273, 353, 5368, 16316, 12, 15037, 21, 13, 5993, 21, 67, 2941, 273, 353, 5664, 16316, 12, 15037, 21, 13, 225, 5993, 22, 67, 4718, 273, 14967, 16316, 12, 15037, 22, 13, 5993, 22, 67, 7205, 273, 353, 5368, 16316, 12, 15037, 22, 13, 5993, 22, 67, 2941, 273, 353, 5664, 16316, 12, 15037, 22, 13, 225, 3170, 16316, 273, 1083, 225, 309, 5993, 21, 422, 5993, 22, 30, 394, 16316, 273, 5993, 21, 3170, 16316, 273, 1053, 282, 309, 486, 3170, 16316, 30, 309, 5993, 21, 67, 4718, 471, 486, 5993, 22, 67, 4718, 30, 394, 16316, 273, 5993, 21, 3170, 16316, 273, 1053, 1327, 486, 5993, 21, 67, 4718, 471, 5993, 22, 67, 4718, 30, 394, 16316, 273, 5993, 22, 3170, 16316, 273, 1053, 282, 309, 486, 3170, 16316, 30, 309, 5993, 21, 67, 7205, 471, 486, 5993, 22, 67, 7205, 30, 394, 16316, 273, 5993, 21, 3170, 16316, 273, 1053, 1327, 486, 5993, 21, 67, 7205, 471, 5993, 22, 67, 7205, 30, 394, 16316, 273, 5993, 22, 3170, 16316, 273, 1053, 282, 309, 486, 3170, 16316, 30, 309, 5993, 21, 67, 2941, 471, 486, 5993, 22, 67, 2941, 30, 394, 16316, 273, 5993, 21, 3170, 16316, 273, 1053, 1327, 486, 5993, 21, 67, 2941, 471, 5993, 22, 67, 2941, 30, 394, 16316, 273, 5993, 22, 3170, 16316, 2 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1089, 2261, 16316, 12, 15037, 21, 16, 5993, 22, 4672, 565, 5993, 21, 67, 4718, 273, 14967, 16316, 12, 15037, 21, 13, 5993, 21, 67, 7205, 273, 353, 5368, 16316, 12, 15037, 21, 13, 5993, 21, 67, 2941, 273, 353, 5664, 16316, 12, 15037, 21, 13, 225, 5993, 22, 67, 4718, 273, 14967, 16316, 12, 15037, 22, 13, 5993, 22, 67, 7205, 273, 353, 5368, 16316, 12, 15037, 22, 13, 5993, 22, 67, 2941, 273, 353, 5664, 16316, 12, 15037, 22, 13, 225, 3170, 16316, 273, 1083, 225, 309, 5993, 21, 422, 5993, 22, 30, 394, 16316, 273, 5993, 21, 3170, 16316, 273, 1053, 282, 309, 486, 3170, 16316, 30, 309, 5993, 21, 67, 4718, 471, 486, 5993, 2 ]
interncolumns = ("process_id", "coinc_def_id", "time_slide_id")	interncolumns = ("process_id", "coinc_def_id", "time_slide_id", "instruments")	def __init__(self, **kwargs): for name, value in kwargs.items(): setattr(self, name, value)	000180bdcfe2998f4dda83d9ae557ed3d6f0b3aa /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/3589/000180bdcfe2998f4dda83d9ae557ed3d6f0b3aa/lsctables.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 2890, 16, 2826, 4333, 4672, 364, 508, 16, 460, 316, 1205, 18, 3319, 13332, 9241, 12, 2890, 16, 508, 16, 460, 13, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 2890, 16, 2826, 4333, 4672, 364, 508, 16, 460, 316, 1205, 18, 3319, 13332, 9241, 12, 2890, 16, 508, 16, 460, 13, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
database doesn't exist).	database doesn't exist). defaults to 0.	def newdb(request): """Create a new database. Accepts POST requests only. If the database already exists: - if overwrite is 1, replaces the database completely with a new one (deleting all the contents). - otherwise, returns an error. Supported parameters: - `db_name`: contains the name of the database. - `fields`: the field parameters (see the client for documentation for now: major FAIL, FIXME) - `overwrite`: if 1, the database already exists, instead of returning an error, remove it and create it anew. (doesn't affect behaviour if database doesn't exist). """ params = validate_params(request.POST, { 'db_name': (1, 1, '^\w+$', None), 'fields': (1, 1, None, None), 'overwrite': (0, 1, '^[01]$', [0]), }) db_name = params['db_name'][0] db_path = os.path.realpath(get_db_path(db_name)) if os.path.exists(db_path): if not params['overwrite']: raise DatabaseExistsError("The path for '%s' is already in use" % db_path) else: shutil.rmtree(db_path) if not os.path.exists(os.path.dirname(db_path)): os.makedirs(os.path.dirname(db_path)) db = xappy.IndexerConnection(db_path) try: try: # Set up the field actions from fields config = simplejson.loads(params['fields'][0]) # FIXME -perhaps we should validate here? for settings in config: validate_dict_entries(settings, valid_field_config_keys, 'Invalid field setting parameter(s): %s') field_name = settings.get('field_name', None) if field_name is None: raise ValidationError("Missing field_name parameter") field_type = settings.get('type', 'text') if field_type not in ('text', 'date', 'float', 'geo'): raise ValidationError("Unknown field_type parameter %s" % field_type) if settings.get('store', False): db.add_field_action(field_name, xappy.FieldActions.STORE_CONTENT) #spelling_word_source = settings.get('spelling_word_source', False) #collapsible = settings.get('collapsible', False) #sortable = settings.get('sortable', False) #range_searchable = settings.get('range_searchable', False) #is_document_weight = settings.get('is_document_weight', False) noindex = settings.get('noindex', False) freetext_params = settings.get('freetext', None) exacttext_params = settings.get('exacttext', None) if (freetext_params is not None and exacttext_params is not None): raise ValidationError( "Field settings for %s specify both 'freetext' and " "'exacttext' for a single field - at most one may be " "specified") if freetext_params is not None and noindex: raise ValidationError( "Field settings for %s specify both 'freetext' and " "'noindex' for a single field - at most one may be " "specified") if exacttext_params is not None and noindex: raise ValidationError( "Field settings for %s specify both 'exacttext' and " "'noindex' for a single field - at most one may be " "specified") if (freetext_params is not None or exacttext_params is not None): if field_type != 'text': raise ValidationError( "Text searching options specified, but field type " "is not text") if freetext_params is not None or ( field_type == 'text' and freetext_params is None and exacttext_params is None and not noindex): if freetext_params is None: freetext_params = {} validate_dict_entries(freetext_params, valid_freetext_options, 'Invalid freetext option(s): %s') opts = {} lang = freetext_params.get('language', None) if lang is not None: opts['language'] = lang opts['weight'] = freetext_params.get('term_frequency_multiplier', 1) phrase = freetext_params.get('enable_phrase_search', True) if not phrase: opts['nopos'] = True index_groups = freetext_params.get('index_groups', ['_FIELD_INDEX', '_GENERAL_INDEX']) db.add_field_action(field_name, xappy.FieldActions.INDEX_FREETEXT, **opts) if exacttext_params is not None: #FIXME - implement raise ValidationError("exacttext not yet implemented") geo_params = settings.get('geo', None) if geo_params is not None and noindex: raise ValidationError( "Field settings for %s specify both 'geo' and " "'noindex' for a single field - at most one may be " "specified") if geo_params is not None: if field_type != 'geo': raise ValidationError( "Text searching options specified, but field type " "is not text") if geo_params is not None or ( field_type == 'geo' and geo_params is None and not noindex): if geo_params is None: geo_params = {} validate_dict_entries(geo_params, valid_geo_options, 'Invalid freetext option(s): %s') bounding_box_search = geo_params.get('enable_bounding_box_search', True) range_search = geo_params.get('enable_range_search', True) # Geolocation action (for sorting by distance). db.add_field_action(field_name, xappy.FieldActions.GEOLOCATION) if bounding_box_search or range_search: pass # FIXME - need to do something to index these. db.flush() finally: db.close() except: del db shutil.rmtree(db_path) dircache.reset() raise dircache.reset() return {'ok': 1}	3260c6ea689f17a1576be97ccd98b27460457131 /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/9909/3260c6ea689f17a1576be97ccd98b27460457131/search.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 394, 1966, 12, 2293, 4672, 3536, 1684, 279, 394, 2063, 18, 225, 27158, 5485, 3285, 1338, 18, 225, 971, 326, 2063, 1818, 1704, 30, 300, 309, 6156, 353, 404, 16, 12878, 326, 2063, 14416, 598, 279, 394, 1245, 261, 19003, 310, 777, 326, 2939, 2934, 300, 3541, 16, 1135, 392, 555, 18, 225, 19503, 1472, 30, 225, 300, 1375, 1966, 67, 529, 68, 30, 1914, 326, 508, 434, 326, 2063, 18, 300, 1375, 2821, 68, 30, 326, 652, 1472, 261, 5946, 326, 1004, 364, 7323, 364, 2037, 30, 7888, 15806, 16, 9852, 13, 300, 1375, 19274, 68, 30, 309, 404, 16, 326, 2063, 1818, 1704, 16, 3560, 434, 5785, 392, 555, 16, 1206, 518, 471, 752, 518, 392, 359, 18, 261, 20657, 82, 1404, 13418, 14273, 309, 2063, 3302, 1404, 1005, 2934, 225, 3467, 358, 374, 18, 225, 3536, 859, 273, 1954, 67, 2010, 12, 2293, 18, 3798, 16, 288, 296, 1966, 67, 529, 4278, 261, 21, 16, 404, 16, 10731, 64, 91, 26020, 2187, 599, 3631, 296, 2821, 4278, 261, 21, 16, 404, 16, 599, 16, 599, 3631, 296, 19274, 4278, 261, 20, 16, 404, 16, 10731, 63, 1611, 65, 8, 2187, 306, 20, 65, 3631, 289, 13, 1319, 67, 529, 273, 859, 3292, 1966, 67, 529, 3546, 63, 20, 65, 1319, 67, 803, 273, 1140, 18, 803, 18, 7688, 803, 12, 588, 67, 1966, 67, 803, 12, 1966, 67, 529, 3719, 225, 309, 1140, 18, 803, 18, 1808, 12, 1966, 67, 803, 4672, 309, 2 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 394, 1966, 12, 2293, 4672, 3536, 1684, 279, 394, 2063, 18, 225, 27158, 5485, 3285, 1338, 18, 225, 971, 326, 2063, 1818, 1704, 30, 300, 309, 6156, 353, 404, 16, 12878, 326, 2063, 14416, 598, 279, 394, 1245, 261, 19003, 310, 777, 326, 2939, 2934, 300, 3541, 16, 1135, 392, 555, 18, 225, 19503, 1472, 30, 225, 300, 1375, 1966, 67, 529, 68, 30, 1914, 326, 508, 434, 326, 2063, 18, 300, 1375, 2821, 68, 30, 326, 652, 1472, 261, 5946, 326, 1004, 364, 7323, 364, 2037, 30, 7888, 15806, 16, 9852, 13, 300, 1375, 19274, 68, 30, 309, 404, 16, 326, 2063, 1818, 1704, 16, 3560, 434, 5785, 392, 555, 16, 1206, 518, 471, 752, 518, 392, 2 ]
if __debug__: onScreenDebug.render()	onScreenDebug.render()	def igLoop(self, state): if __debug__: # We render the watch variables for the onScreenDebug as soon # as we reasonably can before the renderFrame(). onScreenDebug.render()	f86c6e322c7a566a9780a7fa8a58bfb11a1e2b39 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/8543/f86c6e322c7a566a9780a7fa8a58bfb11a1e2b39/ShowBase.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 18158, 6452, 12, 2890, 16, 919, 4672, 309, 1001, 4148, 972, 30, 468, 1660, 1743, 326, 4267, 3152, 364, 326, 603, 7956, 2829, 487, 17136, 468, 487, 732, 3971, 6906, 848, 1865, 326, 1743, 3219, 7675, 603, 7956, 2829, 18, 5902, 1435, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 18158, 6452, 12, 2890, 16, 919, 4672, 309, 1001, 4148, 972, 30, 468, 1660, 1743, 326, 4267, 3152, 364, 326, 603, 7956, 2829, 487, 17136, 468, 487, 732, 3971, 6906, 848, 1865, 326, 1743, 3219, 7675, 603, 7956, 2829, 18, 5902, 1435, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
def _posHprBroadcast(self, task=DummyTask):	def _posHprBroadcast(self, task=None):	def _posHprBroadcast(self, task=DummyTask): # TODO: we explicitly stagger the initial task timing in # startPosHprBroadcast; we should at least make an effort to keep # this task accurately aligned with its period and starting time. self.d_broadcastPosHpr() task.setDelay(self.__broadcastPeriod) return Task.again	c1f013a2c877e639a2da7ee3915e0a8cf22af867 /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/7242/c1f013a2c877e639a2da7ee3915e0a8cf22af867/DistributedSmoothNodeBase.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 917, 44, 683, 15926, 12, 2890, 16, 1562, 33, 7036, 4672, 468, 2660, 30, 732, 8122, 384, 7594, 326, 2172, 1562, 15538, 316, 468, 16013, 44, 683, 15926, 31, 732, 1410, 622, 4520, 1221, 392, 23445, 358, 3455, 468, 333, 1562, 19361, 5173, 13939, 598, 2097, 3879, 471, 5023, 813, 18, 365, 18, 72, 67, 19805, 1616, 44, 683, 1435, 1562, 18, 542, 6763, 12, 2890, 16186, 19805, 5027, 13, 327, 3837, 18, 23095, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 917, 44, 683, 15926, 12, 2890, 16, 1562, 33, 7036, 4672, 468, 2660, 30, 732, 8122, 384, 7594, 326, 2172, 1562, 15538, 316, 468, 16013, 44, 683, 15926, 31, 732, 1410, 622, 4520, 1221, 392, 23445, 358, 3455, 468, 333, 1562, 19361, 5173, 13939, 598, 2097, 3879, 471, 5023, 813, 18, 365, 18, 72, 67, 19805, 1616, 44, 683, 1435, 1562, 18, 542, 6763, 12, 2890, 16186, 19805, 5027, 13, 327, 3837, 18, 23095, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
column.set_sort_column_id(next_column)	if sort_name is not None: column.set_sort_column_id(next_column+1) else: column.set_sort_column_id(next_column)	def new( self): if not hasattr( self, 'callback'): self.callback = None	d04c533b5d76014416b59855c0d2055d4c8f86c1 /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/12778/d04c533b5d76014416b59855c0d2055d4c8f86c1/gui.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 394, 12, 365, 4672, 309, 486, 3859, 12, 365, 16, 296, 3394, 11, 4672, 365, 18, 3394, 273, 599, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 394, 12, 365, 4672, 309, 486, 3859, 12, 365, 16, 296, 3394, 11, 4672, 365, 18, 3394, 273, 599, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
with io.open(support.TESTFN, self.write_mode, buffering=0) as raw:	with self.open(support.TESTFN, self.write_mode, buffering=0) as raw:	def test_threads(self): try: # Write out many bytes from many threads and test they were # all flushed. N = 1000 contents = bytes(range(256)) * N sizes = cycle([1, 19]) n = 0 queue = deque() while n < len(contents): size = next(sizes) queue.append(contents[n:n+size]) n += size del contents # We use a real file object because it allows us to # exercise situations where the GIL is released before # writing the buffer to the raw streams. This is in addition # to concurrency issues due to switching threads in the middle # of Python code. with io.open(support.TESTFN, self.write_mode, buffering=0) as raw: bufio = self.tp(raw, 8) errors = [] def f(): try: while True: try: s = queue.popleft() except IndexError: return bufio.write(s) except Exception as e: errors.append(e) raise threads = [threading.Thread(target=f) for x in range(20)] for t in threads: t.start() time.sleep(0.02) # yield for t in threads: t.join() self.assertFalse(errors, "the following exceptions were caught: %r" % errors) bufio.close() with io.open(support.TESTFN, "rb") as f: s = f.read() for i in range(256): self.assertEquals(s.count(bytes([i])), N) finally: support.unlink(support.TESTFN)	540d576d7a9562b3f2b22d53da6ef10922fb5986 /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/12029/540d576d7a9562b3f2b22d53da6ef10922fb5986/test_io.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1842, 67, 12495, 12, 2890, 4672, 775, 30, 468, 2598, 596, 4906, 1731, 628, 4906, 7403, 471, 1842, 2898, 4591, 468, 777, 22604, 18, 423, 273, 4336, 2939, 273, 1731, 12, 3676, 12, 5034, 3719, 380, 423, 8453, 273, 8589, 3816, 21, 16, 5342, 5717, 290, 273, 374, 2389, 273, 21147, 1435, 1323, 290, 411, 562, 12, 3980, 4672, 963, 273, 1024, 12, 11914, 13, 2389, 18, 6923, 12, 3980, 63, 82, 30, 82, 15, 1467, 5717, 290, 1011, 963, 1464, 2939, 468, 1660, 999, 279, 2863, 585, 733, 2724, 518, 5360, 584, 358, 468, 24165, 28474, 1625, 326, 611, 2627, 353, 15976, 1865, 468, 7410, 326, 1613, 358, 326, 1831, 8205, 18, 1220, 353, 316, 2719, 468, 358, 17752, 8296, 6541, 358, 30882, 7403, 316, 326, 7689, 468, 434, 6600, 981, 18, 598, 365, 18, 3190, 12, 13261, 18, 16961, 19793, 16, 365, 18, 2626, 67, 3188, 16, 25056, 33, 20, 13, 487, 1831, 30, 16083, 273, 365, 18, 6834, 12, 1899, 16, 1725, 13, 1334, 273, 5378, 1652, 284, 13332, 775, 30, 1323, 1053, 30, 775, 30, 272, 273, 2389, 18, 5120, 4482, 1435, 1335, 10195, 30, 327, 16083, 18, 2626, 12, 87, 13, 1335, 1185, 487, 425, 30, 1334, 18, 6923, 12, 73, 13, 1002, 7403, 273, 306, 5930, 310, 18, 3830, 12, 3299, 33, 74, 13, 364, 619, 316, 1048, 12, 3462, 25887, 364, 268, 316, 7403, 30, 268, 18, 1937, 1435, 813, 18, 19607, 12, 20, 18, 3103, 13, 468, 2824, 2 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1842, 67, 12495, 12, 2890, 4672, 775, 30, 468, 2598, 596, 4906, 1731, 628, 4906, 7403, 471, 1842, 2898, 4591, 468, 777, 22604, 18, 423, 273, 4336, 2939, 273, 1731, 12, 3676, 12, 5034, 3719, 380, 423, 8453, 273, 8589, 3816, 21, 16, 5342, 5717, 290, 273, 374, 2389, 273, 21147, 1435, 1323, 290, 411, 562, 12, 3980, 4672, 963, 273, 1024, 12, 11914, 13, 2389, 18, 6923, 12, 3980, 63, 82, 30, 82, 15, 1467, 5717, 290, 1011, 963, 1464, 2939, 468, 1660, 999, 279, 2863, 585, 733, 2724, 518, 5360, 584, 358, 468, 24165, 28474, 1625, 326, 611, 2627, 353, 15976, 1865, 468, 7410, 326, 1613, 358, 326, 1831, 8205, 18, 1220, 353, 316, 2719, 468, 2 ]
else: moveOffset = scale * self.assy.o.right moveOffset += scale * self.assy.o.down	else: moveOffset = initial_offset_for_other_pastables moveOffset += scale * self.assy.o.right moveOffset += scale * self.assy.o.down self._initial_paste_offset_for_other_pastables = moveOffset	of def filterChunks	8b748f35206882452325a1386b28bfd7edbaaa4f /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/11221/8b748f35206882452325a1386b28bfd7edbaaa4f/ops_copy.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 434, 1652, 1034, 14975, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 434, 1652, 1034, 14975, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]
self.eventprocessor.logMessage(_("Queued upload request: %s") % str(vars(msg)), 5)	self.eventprocessor.logMessage(_("Queued upload request: User %s, %s") % (user, str(vars(msg))), 5)	def QueueUpload(self, msg): """ Peer remotely(?) queued a download (upload here) """ user = None for i in self.peerconns: if i.conn is msg.conn.conn: user = i.username if user is None: return addr = msg.conn.addr[0] if not self.fileIsQueued(user, msg.file): friend = user in [i[0] for i in self.eventprocessor.userlist.userlist] if friend and self.eventprocessor.config.sections["transfers"]["friendsnolimits"]: limits = 0 else: limits = 1 checkuser, reason = self.eventprocessor.CheckUser(user, addr) if not checkuser: self.queue.put(slskmessages.QueueFailed(conn = msg.conn.conn, file = msg.file, reason = reason)) elif limits and self.queueLimitReached(user): uploadslimit = self.eventprocessor.config.sections["transfers"]["queuelimit"] limitmsg = "User limit of %i megabytes exceeded" %(uploadslimit) self.queue.put(slskmessages.QueueFailed(conn = msg.conn.conn, file = msg.file, reason = limitmsg)) elif limits and self.fileLimitReached(user): filelimit = self.eventprocessor.config.sections["transfers"]["filelimit"] limitmsg = "User limit of %i files exceeded" %(filelimit) self.queue.put(slskmessages.QueueFailed(conn = msg.conn.conn, file = msg.file, reason = limitmsg)) elif self.fileIsShared(user, msg.file): self.uploads.append(Transfer(user = user, filename = msg.file, path = os.path.dirname(msg.file.replace('\\', os.sep)), status = "Queued", timequeued = time.time(), size = self.getFileSize(msg.file))) self.uploadspanel.update(self.uploads[-1]) self.addQueued(user, msg.file) else: self.queue.put(slskmessages.QueueFailed(conn = msg.conn.conn, file = msg.file, reason = "File not shared" )) self.eventprocessor.logMessage(_("Queued upload request: %s") % str(vars(msg)), 5) self.checkUploadQueue()	e9ab064556a6a654dda329fc639c9e7883afe3e8 /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/8738/e9ab064556a6a654dda329fc639c9e7883afe3e8/transfers.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 7530, 4777, 12, 2890, 16, 1234, 4672, 3536, 10669, 26693, 2357, 3680, 13, 12234, 279, 4224, 261, 6327, 2674, 13, 3536, 729, 273, 599, 364, 277, 316, 365, 18, 12210, 591, 2387, 30, 309, 277, 18, 4646, 353, 1234, 18, 4646, 18, 4646, 30, 729, 273, 277, 18, 5053, 309, 729, 353, 599, 30, 327, 3091, 273, 1234, 18, 4646, 18, 4793, 63, 20, 65, 309, 486, 365, 18, 768, 2520, 21039, 12, 1355, 16, 1234, 18, 768, 4672, 24271, 273, 729, 316, 306, 77, 63, 20, 65, 364, 277, 316, 365, 18, 2575, 8700, 18, 1355, 1098, 18, 1355, 1098, 65, 309, 24271, 471, 365, 18, 2575, 8700, 18, 1425, 18, 11657, 9614, 2338, 18881, 6, 6362, 6, 74, 22259, 82, 355, 1038, 87, 11929, 30, 8181, 273, 374, 469, 30, 8181, 273, 404, 225, 866, 1355, 16, 3971, 273, 365, 18, 2575, 8700, 18, 1564, 1299, 12, 1355, 16, 3091, 13, 309, 486, 866, 1355, 30, 365, 18, 4000, 18, 458, 12, 2069, 7771, 6833, 18, 3183, 2925, 12, 4646, 273, 1234, 18, 4646, 18, 4646, 16, 585, 273, 1234, 18, 768, 16, 3971, 273, 3971, 3719, 1327, 8181, 471, 365, 18, 4000, 3039, 23646, 12, 1355, 4672, 3617, 2069, 1038, 273, 365, 18, 2575, 8700, 18, 1425, 18, 11657, 9614, 2338, 18881, 6, 6362, 6, 1857, 89, 19741, 11929, 1800, 3576, 273, 315, 1299, 1800, 434, 738, 77, 312, 1332, 24383, 1078, 12428, 6, 8975, 6327, 2069, 1038, 13, 365, 18, 4000, 18, 2 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 7530, 4777, 12, 2890, 16, 1234, 4672, 3536, 10669, 26693, 2357, 3680, 13, 12234, 279, 4224, 261, 6327, 2674, 13, 3536, 729, 273, 599, 364, 277, 316, 365, 18, 12210, 591, 2387, 30, 309, 277, 18, 4646, 353, 1234, 18, 4646, 18, 4646, 30, 729, 273, 277, 18, 5053, 309, 729, 353, 599, 30, 327, 3091, 273, 1234, 18, 4646, 18, 4793, 63, 20, 65, 309, 486, 365, 18, 768, 2520, 21039, 12, 1355, 16, 1234, 18, 768, 4672, 24271, 273, 729, 316, 306, 77, 63, 20, 65, 364, 277, 316, 365, 18, 2575, 8700, 18, 1355, 1098, 18, 1355, 1098, 65, 309, 24271, 471, 365, 18, 2575, 8700, 18, 1425, 18, 11657, 9614, 2338, 18881, 6, 6362, 2 ]
if not bober_is_good: if first_warning: print "WARNING: bober's implementation is broken on this platform or this size of n." first_warning=False		def number_of_partitions(n,k=None, algorithm='default'): r""" Returns the size of partitions_list(n,k). INPUT: n -- an integer k -- (default: None); if specified, instead returns the cardinality of the set of all (unordered) partitions of the positive integer n into sums with k summands. algorithm -- (default: 'default') 'default' -- if k is given use Gap. Otherwise, on x86 when n > 3000, use 'bober' On non x86 use 'pari'. 'bober' -- use Jonathon Bober's implementation 'gap' -- use GAP (VERY slow) 'pari' -- use PARI. Speed seems the same as GAP until $n$ is in the thousands, in which case PARI is faster. But PARI has a bug, e.g., on 64-bit Linux PARI-2.3.2 outputs numbpart(147007)%1000 as 536, but it should be 533!. So do not use this option. IMPLEMENTATION: Wraps GAP's NrPartitions or PARI's numbpart function. Use the function \code{partitions(n)} to return a generator over all partitions of $n$. It is possible to associate with every partition of the integer n a conjugacy class of permutations in the symmetric group on n points and vice versa. Therefore p(n) = NrPartitions(n) is the number of conjugacy classes of the symmetric group on n points. EXAMPLES: sage: v = list(partitions(5)); v [(1, 1, 1, 1, 1), (1, 1, 1, 2), (1, 2, 2), (1, 1, 3), (2, 3), (1, 4), (5,)] sage: len(v) 7 sage: number_of_partitions(5, algorithm='gap') 7 sage: number_of_partitions(5, algorithm='pari') 7 sage: number_of_partitions(5, algorithm='bober') 7 The input must be a nonnegative integer or a ValueError is raised. sage: number_of_partitions(-5) Traceback (most recent call last): ... ValueError: n (=-5) must be a nonnegative integer sage: number_of_partitions(10,2) 5 sage: number_of_partitions(10) 42 sage: number_of_partitions(3) 3 sage: number_of_partitions(10) 42 sage: number_of_partitions(3, algorithm='pari') 3 sage: number_of_partitions(10, algorithm='pari') 42 sage: number_of_partitions(40) 37338 sage: number_of_partitions(100) 190569292 sage: number_of_partitions(100000) 27493510569775696512677516320986352688173429315980054758203125984302147328114964173055050741660736621590157844774296248940493063070200461792764493033510116079342457190155718943509725312466108452006369558934464248716828789832182345009262853831404597021307130674510624419227311238999702284408609370935531629697851569569892196108480158600569421098519 A generating function for p(n) is given by the reciprocal of Euler's function: \[ \sum_{n=0}^\infty p(n)x^n = \prod_{k=1}^\infty \left(\frac {1}{1-x^k} \right). \] We use SAGE to verify that the first several coefficients do instead agree: sage: q = PowerSeriesRing(QQ, 'q', default_prec=9).gen() sage: prod([(1-q^k)^(-1) for k in range(1,9)]) ## partial product of 1 + q + 2q^2 + 3q^3 + 5q^4 + 7q^5 + 11q^6 + 15q^7 + 22q^8 + O(q^9) sage: [number_of_partitions(k) for k in range(2,10)] [2, 3, 5, 7, 11, 15, 22, 30] REFERENCES: http://en.wikipedia.org/wiki/Partition_%28number_theory%29 TESTS: sage: n = 500 + randint(0,500) sage: number_of_partitions( n - (n % 385) + 369) % 385 == 0 True sage: n = 1500 + randint(0,1500) sage: number_of_partitions( n - (n % 385) + 369) % 385 == 0 True sage: n = 1000000 + randint(0,1000000) sage: number_of_partitions( n - (n % 385) + 369) % 385 == 0 True sage: n = 1000000 + randint(0,1000000) sage: number_of_partitions( n - (n % 385) + 369) % 385 == 0 True sage: n = 1000000 + randint(0,1000000) sage: number_of_partitions( n - (n % 385) + 369) % 385 == 0 True sage: n = 1000000 + randint(0,1000000) sage: number_of_partitions( n - (n % 385) + 369) % 385 == 0 True sage: n = 1000000 + randint(0,1000000) sage: number_of_partitions( n - (n % 385) + 369) % 385 == 0 True sage: n = 1000000 + randint(0,1000000) sage: number_of_partitions( n - (n % 385) + 369) % 385 == 0 True sage: n = 100000000 + randint(0,100000000) # takes a long time sage: number_of_partitions( n - (n % 385) + 369) % 385 == 0 True sage: n = 100000000 + randint(0,100000000) # takes a long time sage: number_of_partitions( n - (n % 385) + 369) % 385 == 0 True sage: n = 100000000 + randint(0,100000000) # takes a long time sage: number_of_partitions( n - (n % 385) + 369) % 385 == 0 True Another consistency test for n up to 500: sage: len([n for n in [1..500] if number_of_partitions(n) != number_of_partitions(n,algorithm='pari')]) 0 """ n = ZZ(n) if n < 0: raise ValueError, "n (=%s) must be a nonnegative integer"%n elif n == 0: return ZZ(1) global first_warning PROCESSOR = os.uname()[-1] bober_is_good = 'x86' in PROCESSOR if k is not None: algorithm = 'gap' elif algorithm == 'default': if bober_is_good: algorithm = 'bober' elif PROCESSOR in ['x86', 'Power Macintosh']: algorithm = 'pari' else: algorithm = 'gap' if algorithm == 'gap': if k is None: ans=gap.eval("NrPartitions(%s)"%(ZZ(n))) else: ans=gap.eval("NrPartitions(%s,%s)"%(ZZ(n),ZZ(k))) return ZZ(ans) if k is not None: raise ValueError, "only the GAP algorithm works if k is specified." if algorithm == 'bober': if not bober_is_good: if first_warning: print "WARNING: bober's implementation is broken on this platform or this size of n." first_warning=False return partitions_ext.number_of_partitions(n) elif algorithm == 'pari': if n > 3000 and 'x86_64' in PROCESSOR: if first_warning: print "WARNING*: Pari's numbpart is very buggy on x86_64 (fixed in svn, so don't report to pari-dev)" first_warning = False return ZZ(pari(ZZ(n)).numbpart()) raise ValueError, "unknown algorithm '%s'"%algorithm	f0f9a1fa3f7057ce6c279f53361876ef7f50795f /local1/tlutelli/issta_data/temp/all_python//python/2007_temp/2007/9890/f0f9a1fa3f7057ce6c279f53361876ef7f50795f/combinat.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1300, 67, 792, 67, 21275, 12, 82, 16, 79, 33, 7036, 16, 4886, 2218, 1886, 11, 4672, 436, 8395, 2860, 326, 963, 434, 10060, 67, 1098, 12, 82, 16, 79, 2934, 225, 12943, 30, 290, 1493, 392, 3571, 417, 1493, 261, 1886, 30, 599, 1769, 309, 1269, 16, 3560, 1135, 326, 14379, 434, 326, 444, 434, 777, 261, 318, 9885, 13, 10060, 434, 326, 6895, 3571, 290, 1368, 26608, 598, 417, 2142, 889, 87, 18, 4886, 1493, 261, 1886, 30, 296, 1886, 6134, 296, 1886, 11, 1493, 309, 417, 353, 864, 999, 611, 438, 18, 5272, 16, 603, 619, 5292, 1347, 290, 405, 29839, 16, 999, 296, 1075, 744, 11, 2755, 1661, 619, 5292, 999, 296, 1065, 77, 10332, 296, 1075, 744, 11, 1493, 999, 804, 265, 29900, 17980, 744, 1807, 4471, 296, 14048, 11, 1493, 999, 611, 2203, 261, 17529, 380, 87, 821, 12437, 296, 1065, 77, 11, 1493, 999, 3939, 45, 18, 225, 348, 5868, 12001, 326, 1967, 487, 611, 2203, 3180, 271, 82, 8, 353, 316, 326, 286, 24810, 16, 316, 1492, 648, 3939, 45, 353, 12063, 18, 380, 31167, 14, 3939, 45, 711, 279, 7934, 16, 425, 18, 75, 12990, 603, 5178, 17, 3682, 13318, 3939, 45, 17, 22, 18, 23, 18, 22, 6729, 818, 70, 2680, 12, 3461, 26874, 27, 13, 9, 18088, 487, 1381, 5718, 16, 1496, 518, 1410, 506, 1381, 3707, 5, 18, 225, 6155, 741, 486, 999, 333, 1456, 18, 225, 15694, 7618, 2689, 30, 678, 7506, 611, 2 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1300, 67, 792, 67, 21275, 12, 82, 16, 79, 33, 7036, 16, 4886, 2218, 1886, 11, 4672, 436, 8395, 2860, 326, 963, 434, 10060, 67, 1098, 12, 82, 16, 79, 2934, 225, 12943, 30, 290, 1493, 392, 3571, 417, 1493, 261, 1886, 30, 599, 1769, 309, 1269, 16, 3560, 1135, 326, 14379, 434, 326, 444, 434, 777, 261, 318, 9885, 13, 10060, 434, 326, 6895, 3571, 290, 1368, 26608, 598, 417, 2142, 889, 87, 18, 4886, 1493, 261, 1886, 30, 296, 1886, 6134, 296, 1886, 11, 1493, 309, 417, 353, 864, 999, 611, 438, 18, 5272, 16, 603, 619, 5292, 1347, 290, 405, 29839, 16, 999, 296, 1075, 744, 11, 2755, 1661, 619, 5292, 999, 296, 1065, 77, 2 ]
sage: G.derived_series()	sage: G.derived_series()	def derived_series(self): """ Return the derived series of this group as a list of permutation groups.	1658b04d4cf7d534376d011a40bb52f192eac894 /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/9890/1658b04d4cf7d534376d011a40bb52f192eac894/permgroup.py	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 10379, 67, 10222, 12, 2890, 4672, 3536, 2000, 326, 10379, 4166, 434, 333, 1041, 487, 279, 666, 434, 17440, 3252, 18, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]	[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 10379, 67, 10222, 12, 2890, 4672, 3536, 2000, 326, 10379, 4166, 434, 333, 1041, 487, 279, 666, 434, 17440, 3252, 18, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]

def errcheck(result, func, arguments): if result < 0: errno = ctypes.get_errno() raise OSError(errno, os.strerror(errno)) return result libc = ctypes.CDLL(ctypes.util.find_library("c"), use_errno=True) libc.inotify_init.argtypes = [] libc.inotify_init.errcheck = errcheck libc.inotify_init1.argtypes = [ctypes.c_int] libc.inotify_init1.errcheck = errcheck libc.inotify_add_watch.argtypes = [ctypes.c_int, ctypes.c_char_p, ctypes.c_uint32] libc.inotify_add_watch.errcheck = errcheck libc.inotify_rm_watch.argtypes = [ctypes.c_int, ctypes.c_int] libc.inotify_rm_watch.errcheck = errcheck

def errcheck(result, func, arguments): if result < 0: errno = ctypes.get_errno() raise OSError(errno, os.strerror(errno)) return result

cd4adef5bbe7c15f648d858e0fd291f85642892b /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/13731/cd4adef5bbe7c15f648d858e0fd291f85642892b/__init__.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 393, 1893, 12, 2088, 16, 1326, 16, 1775, 4672, 309, 563, 411, 374, 30, 8402, 273, 6983, 18, 588, 67, 19088, 1435, 1002, 10002, 12, 19088, 16, 1140, 18, 701, 1636, 12, 19088, 3719, 225, 327, 563, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 393, 1893, 12, 2088, 16, 1326, 16, 1775, 4672, 309, 563, 411, 374, 30, 8402, 273, 6983, 18, 588, 67, 19088, 1435, 1002, 10002, 12, 19088, 16, 1140, 18, 701, 1636, 12, 19088, 3719, 225, 327, 563, 225, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]

tf.close()

def createPackedInputSandbox(sandbox_files,inws,name): """Put all sandbox_files into tarball called name and write it into to the input workspace. This function is called by Ganga client at the submission time. Arguments: 'sandbox_files': a list of File or FileBuffer objects. 'inws': a InputFileWorkspace object Return: a list containing a path to the tarball """

3975c813beb1813bd20f0bfbca2b9570fe12bca8 /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/1488/3975c813beb1813bd20f0bfbca2b9570fe12bca8/Sandbox.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 752, 4420, 329, 1210, 17881, 12, 27004, 67, 2354, 16, 267, 4749, 16, 529, 4672, 3536, 6426, 777, 15202, 67, 2354, 1368, 29441, 2566, 508, 471, 1045, 518, 1368, 358, 326, 810, 6003, 18, 1220, 445, 353, 2566, 635, 611, 539, 69, 1004, 622, 326, 8515, 813, 18, 13599, 30, 296, 27004, 67, 2354, 4278, 279, 666, 434, 1387, 578, 1387, 1892, 2184, 18, 296, 267, 4749, 4278, 279, 2741, 812, 8241, 733, 2000, 30, 279, 666, 4191, 279, 589, 358, 326, 29441, 3536, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 752, 4420, 329, 1210, 17881, 12, 27004, 67, 2354, 16, 267, 4749, 16, 529, 4672, 3536, 6426, 777, 15202, 67, 2354, 1368, 29441, 2566, 508, 471, 1045, 518, 1368, 358, 326, 810, 6003, 18, 1220, 445, 353, 2566, 635, 611, 539, 69, 1004, 622, 326, 8515, 813, 18, 13599, 30, 296, 27004, 67, 2354, 4278, 279, 666, 434, 1387, 578, 1387, 1892, 2184, 18, 296, 267, 4749, 4278, 279, 2741, 812, 8241, 733, 2000, 30, 279, 666, 4191, 279, 589, 358, 326, 29441, 3536, 225, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]

if not f in self.cexecuted:

if not self.cexecuted.has_key(f):

def canonicalize_filenames(self): for filename, lineno in self.c.keys(): if filename == '<string>': # Can't do anything useful with exec'd strings, so skip them. continue f = self.canonical_filename(filename) if not f in self.cexecuted: self.cexecuted[f] = {} self.cexecuted[f][lineno] = 1 self.c = {}

6554c74cd9574cf89b8acd0a0333651afacbfa8e /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/11312/6554c74cd9574cf89b8acd0a0333651afacbfa8e/coverage.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 25839, 67, 19875, 12, 2890, 4672, 364, 1544, 16, 7586, 316, 365, 18, 71, 18, 2452, 13332, 309, 1544, 422, 2368, 1080, 1870, 30, 468, 4480, 1404, 741, 6967, 5301, 598, 1196, 14271, 2064, 16, 1427, 2488, 2182, 18, 1324, 284, 273, 365, 18, 18288, 67, 3459, 12, 3459, 13, 309, 486, 365, 18, 26155, 557, 4817, 18, 5332, 67, 856, 12, 74, 4672, 365, 18, 26155, 557, 4817, 63, 74, 65, 273, 2618, 365, 18, 26155, 557, 4817, 63, 74, 6362, 17782, 65, 273, 404, 365, 18, 71, 273, 2618, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 25839, 67, 19875, 12, 2890, 4672, 364, 1544, 16, 7586, 316, 365, 18, 71, 18, 2452, 13332, 309, 1544, 422, 2368, 1080, 1870, 30, 468, 4480, 1404, 741, 6967, 5301, 598, 1196, 14271, 2064, 16, 1427, 2488, 2182, 18, 1324, 284, 273, 365, 18, 18288, 67, 3459, 12, 3459, 13, 309, 486, 365, 18, 26155, 557, 4817, 18, 5332, 67, 856, 12, 74, 4672, 365, 18, 26155, 557, 4817, 63, 74, 65, 273, 2618, 365, 18, 26155, 557, 4817, 63, 74, 6362, 17782, 65, 273, 404, 365, 18, 71, 273, 2618, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]

Return the quartic twist of this curve by D.

Return the quartic twist of this curve by D, which must be nonzero.

def quartic_twist(self, D): """ Return the quartic twist of this curve by D.

317b135e24525174c25bb62d554be485f9c82093 /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/9417/317b135e24525174c25bb62d554be485f9c82093/ell_generic.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 719, 485, 335, 67, 11246, 376, 12, 2890, 16, 463, 4672, 3536, 2000, 326, 719, 485, 335, 2339, 376, 434, 333, 8882, 635, 463, 18, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 719, 485, 335, 67, 11246, 376, 12, 2890, 16, 463, 4672, 3536, 2000, 326, 719, 485, 335, 2339, 376, 434, 333, 8882, 635, 463, 18, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]

if isinstance(property_uri, (list, tuple, QuerySet)): result_prop_uri = property_uri

def get_property_uris(self, prop, rdfMeta=None): if not rdfMeta: rdfMeta = self.rdfMeta() rdfprops = rdfMeta[prop] # -- get the value of this property dbval = getattr(self, rdfprops["property"]) if "property" in rdfprops else getattr(self, prop) # --- if this is a relation type of property if hasattr(dbval, 'all') and callable(dbval.all): rval = self.objects_as_rdf_list(dbval.all()) # --- if this is a literal ? else: rval = self.property_to_string(prop) # -- property property_uri = rdfMeta[prop]["uri"] # -- repack

d6c797f4a2089543ac6cb76bfb9c014053f177e3 /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/11435/d6c797f4a2089543ac6cb76bfb9c014053f177e3/rdf.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 336, 67, 4468, 67, 23510, 12, 2890, 16, 2270, 16, 9160, 2781, 33, 7036, 4672, 309, 486, 9160, 2781, 30, 9160, 2781, 273, 365, 18, 19299, 2781, 1435, 9160, 9693, 273, 9160, 2781, 63, 5986, 65, 468, 1493, 336, 326, 460, 434, 333, 1272, 1319, 1125, 273, 3869, 12, 2890, 16, 9160, 9693, 9614, 4468, 6, 5717, 309, 315, 4468, 6, 316, 9160, 9693, 469, 3869, 12, 2890, 16, 2270, 13, 468, 9948, 309, 333, 353, 279, 2533, 618, 434, 1272, 309, 3859, 12, 1966, 1125, 16, 296, 454, 6134, 471, 4140, 12, 1966, 1125, 18, 454, 4672, 14267, 273, 365, 18, 6911, 67, 345, 67, 19299, 67, 1098, 12, 1966, 1125, 18, 454, 10756, 468, 9948, 309, 333, 353, 279, 7158, 692, 469, 30, 14267, 273, 365, 18, 4468, 67, 869, 67, 1080, 12, 5986, 13, 468, 1493, 1272, 1272, 67, 1650, 273, 9160, 2781, 63, 5986, 6362, 6, 1650, 11929, 468, 1493, 2071, 484, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 336, 67, 4468, 67, 23510, 12, 2890, 16, 2270, 16, 9160, 2781, 33, 7036, 4672, 309, 486, 9160, 2781, 30, 9160, 2781, 273, 365, 18, 19299, 2781, 1435, 9160, 9693, 273, 9160, 2781, 63, 5986, 65, 468, 1493, 336, 326, 460, 434, 333, 1272, 1319, 1125, 273, 3869, 12, 2890, 16, 9160, 9693, 9614, 4468, 6, 5717, 309, 315, 4468, 6, 316, 9160, 9693, 469, 3869, 12, 2890, 16, 2270, 13, 468, 9948, 309, 333, 353, 279, 2533, 618, 434, 1272, 309, 3859, 12, 1966, 1125, 16, 296, 454, 6134, 471, 4140, 12, 1966, 1125, 18, 454, 4672, 14267, 273, 365, 18, 6911, 67, 345, 67, 19299, 67, 1098, 12, 1966, 1125, 18, 454, 10756, 468, 9948, 309, 2 ]

op.add_option('-d', '--debug', dest='debug', action='store_true',

op.add_option('-g', '--debug', dest='debug', action='store_true',

def run_tests(tests, test_dir, lib_dir): pb = None if not OPTIONS.hide_progress and not OPTIONS.show_cmd: try: from progressbar import ProgressBar pb = ProgressBar('', len(tests), 13) except ImportError: pass failures = [] complete = False doing = 'before starting' try: for i, test in enumerate(tests): doing = 'on %s'%test.path ok, out, err = run_test(test, lib_dir) doing = 'after %s'%test.path if not ok: failures.append(test.path) if OPTIONS.tinderbox: if ok: print('TEST-PASS | trace-test.py | %s'%test.path) else: lines = [ _ for _ in out.split('\n') + err.split('\n') if _ != '' ] if len(lines) >= 1: msg = lines[-1] else: msg = '' print('TEST-UNEXPECTED-FAIL | trace-test.py | %s: %s'% (test.path, msg)) n = i + 1 if pb: pb.label = '[%3d|%3d|%3d]'%(n - len(failures), len(failures), n) pb.update(n) complete = True except KeyboardInterrupt: pass if pb: pb.finish() if failures: if OPTIONS.write_failures: try: out = open(OPTIONS.write_failures, 'w') for test in failures: out.write(os.path.relpath(test, test_dir) + '\n') out.close() except IOError: sys.stderr.write("Exception thrown trying to write failure file '%s'\n"% OPTIONS.write_failures) traceback.print_exc() sys.stderr.write('---\n') print('FAILURES:') for test in failures: if OPTIONS.show_failed: print(' ' + subprocess.list2cmdline(get_test_cmd(test, lib_dir))) else: print(' ' + test) else: print('PASSED ALL' + ('' if complete else ' (partial run -- interrupted by user %s)'%doing))

7bf18187bf331c61553e8ba72d890bd5fd4cc385 /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/11102/7bf18187bf331c61553e8ba72d890bd5fd4cc385/trace-test.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1086, 67, 16341, 12, 16341, 16, 1842, 67, 1214, 16, 2561, 67, 1214, 4672, 6386, 273, 599, 309, 486, 16726, 18, 11248, 67, 8298, 471, 486, 16726, 18, 4500, 67, 4172, 30, 775, 30, 628, 31730, 1930, 27793, 6386, 273, 27793, 2668, 2187, 562, 12, 16341, 3631, 5958, 13, 1335, 11308, 30, 1342, 225, 11720, 273, 5378, 3912, 273, 1083, 9957, 273, 296, 5771, 5023, 11, 775, 30, 364, 277, 16, 1842, 316, 4241, 12, 16341, 4672, 9957, 273, 296, 265, 738, 87, 11, 9, 3813, 18, 803, 1529, 16, 596, 16, 393, 273, 1086, 67, 3813, 12, 3813, 16, 2561, 67, 1214, 13, 9957, 273, 296, 5205, 738, 87, 11, 9, 3813, 18, 803, 225, 309, 486, 1529, 30, 11720, 18, 6923, 12, 3813, 18, 803, 13, 225, 309, 16726, 18, 88, 14055, 2147, 30, 309, 1529, 30, 1172, 2668, 16961, 17, 10884, 571, 2606, 17, 3813, 18, 2074, 571, 738, 87, 11, 9, 3813, 18, 803, 13, 469, 30, 2362, 273, 306, 389, 364, 389, 316, 596, 18, 4939, 2668, 64, 82, 6134, 397, 393, 18, 4939, 2668, 64, 82, 6134, 309, 389, 480, 875, 308, 309, 562, 12, 3548, 13, 1545, 404, 30, 1234, 273, 2362, 18919, 21, 65, 469, 30, 1234, 273, 875, 1172, 2668, 16961, 17, 2124, 27409, 17, 12319, 571, 2606, 17, 3813, 18, 2074, 571, 738, 87, 30, 738, 87, 11, 9, 261, 3813, 18, 803, 16, 1234, 3719, 225, 290, 273, 277, 397, 404, 309, 6386, 30, 6386, 2 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1086, 67, 16341, 12, 16341, 16, 1842, 67, 1214, 16, 2561, 67, 1214, 4672, 6386, 273, 599, 309, 486, 16726, 18, 11248, 67, 8298, 471, 486, 16726, 18, 4500, 67, 4172, 30, 775, 30, 628, 31730, 1930, 27793, 6386, 273, 27793, 2668, 2187, 562, 12, 16341, 3631, 5958, 13, 1335, 11308, 30, 1342, 225, 11720, 273, 5378, 3912, 273, 1083, 9957, 273, 296, 5771, 5023, 11, 775, 30, 364, 277, 16, 1842, 316, 4241, 12, 16341, 4672, 9957, 273, 296, 265, 738, 87, 11, 9, 3813, 18, 803, 1529, 16, 596, 16, 393, 273, 1086, 67, 3813, 12, 3813, 16, 2561, 67, 1214, 13, 9957, 273, 296, 5205, 738, 87, 11, 9, 3813, 18, 803, 225, 309, 486, 2 ]

if pkg["name"] != name:

if rpm["name"] != name:

def checkDeps(rpms): # Add all packages in. resolver = RpmResolver() for pkg in rpms: resolver.addPkg(pkg) # Check for obsoletes. for name in resolver.obsoletes_list.deps.keys(): for (flag, version, rpm) in resolver.obsoletes_list.deps[name]: for pkg in searchDep(name, flag, version, resolver.mydeps.get(name, [])): if pkg["name"] != name: print "Warning:", pkg.getFilename(), "is obsoleted by", \ depString(name, flag, version), "from", rpm.getFilename() # Check all requires. for name in resolver.requires_list.deps.keys(): if name.startswith("rpmlib("): continue for (flag, version, rpm) in resolver.requires_list.deps[name]: if not resolver.searchDependency(name, flag, version): print "Warning:", rpm.getFilename(), \ "did not find a package for:", \ depString(name, flag, version) # Check all conflicts. for name in resolver.conflicts_list.deps.keys(): for (flag, version, rpm) in resolver.conflicts_list.deps[name]: for pkg in resolver.searchDependency(name, flag, version): print "Warning:", rpm.getFilename(), "contains a conflict", \ depString(name, flag, version), "with", pkg.getFilename() # Check for fileconflicts. for dirname in resolver.filenames_list.path.keys(): for basename in resolver.filenames_list.path[dirname].keys(): s = resolver.filenames_list.path[dirname][basename] if len(s) < 2: continue filename = dirname + basename for j in xrange(len(s) - 1): (rpm1, i1) = s[j] for k in xrange(j + 1, len(s)): (rpm2, i2) = s[k] if not S_ISREG(rpm1["filemodes"][i1]) or \ not S_ISREG(rpm2["filemodes"][i2]): continue if rpm1["filemd5s"][i1] != rpm2["filemd5s"][i2]: print "fileconflict for", filename, "in", \ rpm1.getFilename(), rpm2.getFilename()

1fec9a43376b6b9bfe41360a3ad6f07af8f8af71 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/1143/1fec9a43376b6b9bfe41360a3ad6f07af8f8af71/oldpyrpm.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 866, 14430, 12, 13832, 959, 4672, 468, 1436, 777, 5907, 316, 18, 5039, 273, 534, 7755, 4301, 1435, 364, 3475, 316, 8715, 959, 30, 5039, 18, 1289, 11264, 12, 10657, 13, 468, 2073, 364, 7160, 355, 278, 281, 18, 364, 508, 316, 5039, 18, 10992, 355, 278, 281, 67, 1098, 18, 14877, 18, 2452, 13332, 364, 261, 6420, 16, 1177, 16, 25228, 13, 316, 5039, 18, 10992, 355, 278, 281, 67, 1098, 18, 14877, 63, 529, 14542, 364, 3475, 316, 1623, 16316, 12, 529, 16, 2982, 16, 1177, 16, 5039, 18, 4811, 14877, 18, 588, 12, 529, 16, 5378, 3719, 30, 309, 25228, 9614, 529, 11929, 480, 508, 30, 1172, 315, 6210, 2773, 16, 3475, 18, 588, 5359, 9334, 315, 291, 7160, 355, 278, 329, 635, 3113, 521, 5993, 780, 12, 529, 16, 2982, 16, 1177, 3631, 315, 2080, 3113, 25228, 18, 588, 5359, 1435, 468, 2073, 777, 4991, 18, 364, 508, 316, 5039, 18, 18942, 67, 1098, 18, 14877, 18, 2452, 13332, 309, 508, 18, 17514, 1918, 2932, 13832, 781, 495, 2932, 4672, 1324, 364, 261, 6420, 16, 1177, 16, 25228, 13, 316, 5039, 18, 18942, 67, 1098, 18, 14877, 63, 529, 14542, 309, 486, 5039, 18, 3072, 7787, 12, 529, 16, 2982, 16, 1177, 4672, 1172, 315, 6210, 2773, 16, 25228, 18, 588, 5359, 9334, 521, 315, 14044, 486, 1104, 279, 2181, 364, 2773, 16, 521, 5993, 780, 12, 529, 16, 2982, 16, 1177, 13, 468, 2073, 777, 14450, 18, 364, 508, 316, 5039, 2 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 866, 14430, 12, 13832, 959, 4672, 468, 1436, 777, 5907, 316, 18, 5039, 273, 534, 7755, 4301, 1435, 364, 3475, 316, 8715, 959, 30, 5039, 18, 1289, 11264, 12, 10657, 13, 468, 2073, 364, 7160, 355, 278, 281, 18, 364, 508, 316, 5039, 18, 10992, 355, 278, 281, 67, 1098, 18, 14877, 18, 2452, 13332, 364, 261, 6420, 16, 1177, 16, 25228, 13, 316, 5039, 18, 10992, 355, 278, 281, 67, 1098, 18, 14877, 63, 529, 14542, 364, 3475, 316, 1623, 16316, 12, 529, 16, 2982, 16, 1177, 16, 5039, 18, 4811, 14877, 18, 588, 12, 529, 16, 5378, 3719, 30, 309, 25228, 9614, 529, 11929, 480, 508, 30, 1172, 315, 6210, 2773, 16, 3475, 18, 588, 5359, 2 ]

if hasattr( left, "radius" ):

if hasattr(left, "radius"):

def __call__( self, left, right ): """pygame.sprite.collide_circle_radio(ratio)(left, right): return bool collision detection between two sprites, using scaled circles.

d9760f3e4782abb02dd98080337626eefdad67ee /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/1298/d9760f3e4782abb02dd98080337626eefdad67ee/sprite.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 1991, 972, 12, 365, 16, 2002, 16, 2145, 262, 30, 3536, 2074, 13957, 18, 1752, 796, 18, 1293, 8130, 67, 18970, 67, 17006, 12, 9847, 21433, 4482, 16, 2145, 4672, 327, 1426, 17740, 11649, 3086, 2795, 1694, 24047, 16, 1450, 12304, 5886, 9558, 18, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 1991, 972, 12, 365, 16, 2002, 16, 2145, 262, 30, 3536, 2074, 13957, 18, 1752, 796, 18, 1293, 8130, 67, 18970, 67, 17006, 12, 9847, 21433, 4482, 16, 2145, 4672, 327, 1426, 17740, 11649, 3086, 2795, 1694, 24047, 16, 1450, 12304, 5886, 9558, 18, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]

if v:

print v if v is not None:

def get_all_keys(self, headers=None, **params): """ A lower-level method for listing contents of a bucket. This closely models the actual S3 API and requires you to manually handle the paging of results. For a higher-level method that handles the details of paging for you, you can use the list method. @type maxkeys: int @param maxkeys: The maximum number of keys to retrieve @type prefix: string @param prefix: The prefix of the keys you want to retrieve @type marker: string @param marker: The "marker" of where you are in the result set @type delimiter: string @param delimiter: "If this optional, Unicode string parameter is included with your request, then keys that contain the same string between the prefix and the first occurrence of the delimiter will be rolled up into a single result element in the CommonPrefixes collection. These rolled-up keys are not returned elsewhere in the response."

ab75072a7d8b8462fc6ae179a49f86427823f303 /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/1098/ab75072a7d8b8462fc6ae179a49f86427823f303/bucket.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 336, 67, 454, 67, 2452, 12, 2890, 16, 1607, 33, 7036, 16, 2826, 2010, 4672, 3536, 432, 2612, 17, 2815, 707, 364, 11591, 2939, 434, 279, 2783, 18, 225, 1220, 1219, 1786, 93, 3679, 326, 3214, 348, 23, 1491, 471, 4991, 1846, 358, 10036, 1640, 326, 17859, 434, 1686, 18, 225, 2457, 279, 10478, 17, 2815, 707, 716, 7372, 326, 3189, 434, 17859, 364, 1846, 16, 1846, 848, 999, 326, 666, 707, 18, 225, 632, 723, 943, 2452, 30, 509, 632, 891, 943, 2452, 30, 1021, 4207, 1300, 434, 1311, 358, 4614, 225, 632, 723, 1633, 30, 533, 632, 891, 1633, 30, 1021, 1633, 434, 326, 1311, 1846, 2545, 358, 4614, 225, 632, 723, 5373, 30, 533, 632, 891, 5373, 30, 1021, 315, 11145, 6, 434, 1625, 1846, 854, 316, 326, 563, 444, 225, 632, 723, 5654, 30, 533, 632, 891, 5654, 30, 315, 2047, 333, 3129, 16, 9633, 533, 1569, 353, 5849, 598, 3433, 590, 16, 1508, 1311, 716, 912, 326, 1967, 533, 3086, 326, 1633, 471, 326, 1122, 13083, 434, 326, 5654, 903, 506, 28693, 731, 1368, 279, 2202, 563, 930, 316, 326, 5658, 11700, 1849, 18, 8646, 28693, 17, 416, 1311, 854, 486, 2106, 25795, 316, 326, 766, 1199, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 336, 67, 454, 67, 2452, 12, 2890, 16, 1607, 33, 7036, 16, 2826, 2010, 4672, 3536, 432, 2612, 17, 2815, 707, 364, 11591, 2939, 434, 279, 2783, 18, 225, 1220, 1219, 1786, 93, 3679, 326, 3214, 348, 23, 1491, 471, 4991, 1846, 358, 10036, 1640, 326, 17859, 434, 1686, 18, 225, 2457, 279, 10478, 17, 2815, 707, 716, 7372, 326, 3189, 434, 17859, 364, 1846, 16, 1846, 848, 999, 326, 666, 707, 18, 225, 632, 723, 943, 2452, 30, 509, 632, 891, 943, 2452, 30, 1021, 4207, 1300, 434, 1311, 358, 4614, 225, 632, 723, 1633, 30, 533, 632, 891, 1633, 30, 1021, 1633, 434, 326, 1311, 1846, 2545, 358, 4614, 225, 632, 723, 5373, 30, 533, 632, 2 ]

transport = Transport()

if type == "https": transport = SafeTransport() else: transport = Transport()

def __init__(self, uri, transport=None): # establish a "logical" server connection

80ead46c3b0b9513bc116e8fe08faa2f91145a91 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/4325/80ead46c3b0b9513bc116e8fe08faa2f91145a91/xmlrpclib.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 2890, 16, 2003, 16, 4736, 33, 7036, 4672, 468, 18312, 279, 315, 20300, 6, 1438, 1459, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 2890, 16, 2003, 16, 4736, 33, 7036, 4672, 468, 18312, 279, 315, 20300, 6, 1438, 1459, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]

log.msg("Downloading %s\n" % (PackageName) )

log.msg("Downloading %s.%s\n" % (PackageName, LINE_OVERWRITE_FULL) )

def run(request, response, func=find_first_match): '''Get items from the request Queue, process them with func(), put the results along with the Thread's name into the response Queue. Stop running when item is None.''' while 1: tuple_item_key = request.get() if tuple_item_key is None: break (key, item) = tuple_item_key (url, file, download_size, checksum) = stripper(item) thread_name = threading.currentThread().getName() if key == 'Update': temp_file = file.split("_") PackageName = temp_file[0] PackageName += " - " + temp_file[len(temp_file) - 1] del temp_file #INFO: We pass None as a filename here because we don't want to do a tree search of # update files. Update files are changed daily and there is no point in doing a search of # them in the cache_dir response.put(func(cache_dir, None) ) #INFO: exit_status here would be False because for updates there's no need to do a # find_first_match # This is more with the above statement where None is passed as the filename exit_status = response.get() if exit_status == False: log.msg("Downloading %s\n" % (PackageName) ) if FetcherInstance.download_from_web(url, file, download_path) == True: log.success("\r%s done.%s\n" % (PackageName, LINE_OVERWRITE_FULL) ) if ArgumentOptions.zip_it: if FetcherInstance.compress_the_file(ArgumentOptions.zip_update_file, file) != True: log.err("Couldn't archive %s to file %s.%s\n" % (file, ArgumentOptions.zip_update_file, LINE_OVERWRITE_MID) ) sys.exit(1) else: log.verbose("%s added to archive %s.%s\n" % (file, ArgumentOptions.zip_update_file, LINE_OVERWRITE_FULL) ) os.unlink(os.path.join(download_path, file) ) else: errlist.append(file) elif key == 'Upgrade': PackageName = file.split("_")[0] response.put(func(cache_dir, file) ) #INFO: find_first_match() returns False or a file name with absolute path full_file_path = response.get() #INFO: If we find the file in the local cache_dir, we'll execute this block. if full_file_path != False: # We'll first check for its md5 checksum if ArgumentOptions.disable_md5check is False: if FetcherInstance.md5_check(full_file_path, checksum) is True: log.verbose("md5checksum correct for package %s.%s\n" % (PackageName, LINE_OVERWRITE_FULL) ) if ArgumentOptions.deb_bugs: bug_fetched = 0 log.verbose("Fetching bug reports for package %s.%s\n" % (PackageName, LINE_OVERWRITE_FULL) ) if FetchBugReportsDebian.FetchBugsDebian(PackageName): log.verbose("Fetched bug reports for package %s.%s\n" % (PackageName, LINE_OVERWRITE_FULL) ) bug_fetched = 1 else: log.verbose("Couldn't fetch bug reports for package %s.%s\n" % (PackageName, LINE_OVERWRITE_MID) ) if ArgumentOptions.zip_it: if FetcherInstance.compress_the_file(ArgumentOptions.zip_upgrade_file, full_file_path) is True: log.success("%s copied from local cache directory %s.%s\n" % (PackageName, cache_dir, LINE_OVERWRITE_MID) ) else: log.err("Couldn't add %s to archive %s.%s\n" % (file, ArgumentOptions.zip_upgrade_file, LINE_OVERWRITE_MID) ) sys.exit(1) #INFO: If no zip option enabled, simply copy the downloaded package file # along with the downloaded bug reports. else: try: shutil.copy(full_file_path, download_path) log.success("%s copied from local cache directory %s.%s\n" % (PackageName, cache_dir, LINE_OVERWRITE_MID) ) except shutil.Error: log.verbose("%s already available in %s. Skipping copy!!!%s\n\n" % (file, download_path, LINE_OVERWRITE_MID) ) if bug_fetched == 1: for x in os.listdir(os.curdir): if (x.startswith(PackageName) and x.endswith(pypt_bug_file_format) ): shutil.move(x, download_path) log.verbose("Moved %s file to %s folder.%s\n" % (x, download_path, LINE_OVERWRITE_FULL) ) #INFO: Damn!! The md5chesum didn't match :-( # The file is corrupted and we need to download a new copy from the internet else: log.verbose("%s MD5 checksum mismatch. Skipping file.%s\n" % (file, LINE_OVERWRITE_FULL) ) log.msg("Downloading %s - %d KB%s\n" % (PackageName, download_size/1024, LINE_OVERWRITE_FULL) ) if FetcherInstance.download_from_web(url, file, download_path) == True: log.success("\r%s done.%s\n" % (PackageName, LINE_OVERWRITE_FULL) ) #Add to cache_dir if possible if ArgumentOptions.cache_dir: try: shutil.copy(file, cache_dir) log.verbose("%s copied to local cache directory %s.%s\n" % (file, ArgumentOptions.cache_dir, LINE_OVERWRITE_MID) ) except shutil.Error: log.verbose("Couldn't copy %s to %s.%s\n\n" % (file, ArgumentOptions.cache_dir, LINE_OVERWRITE_FULL) ) #Fetch bug reports if ArgumentOptions.deb_bugs: if FetchBugReportsDebian.FetchBugsDebian(PackageName): log.verbose("Fetched bug reports for package %s.%s\n" % (PackageName, LINE_OVERWRITE_MID) ) else: log.verbose("Couldn't fetch bug reports for package %s.%s\n" % (PackageName, LINE_OVERWRITE_MID) ) if ArgumentOptions.zip_it: if FetcherInstance.compress_the_file(ArgumentOptions.zip_upgrade_file, file) != True: log.err("Couldn't archive %s to file %s.%s\n" % (file, ArgumentOptions.zip_upgrade_file, LINE_OVERWRITE_SMALL) ) sys.exit(1) else: log.verbose("%s added to archive %s.%s\n" % (file, ArgumentOptions.zip_upgrade_file, LINE_OVERWRITE_SMALL) ) os.unlink(os.path.join(download_path, file) ) #INFO: You're and idiot. # You should NOT disable md5checksum for any files else: if ArgumentOptions.deb_bugs: bug_fetched = 0 if FetchBugReportsDebian.FetchBugsDebian(PackageName): log.verbose("Fetched bug reports for package %s.%s\n" % (PackageName, LINE_OVERWRITE_MID) ) bug_fetched = 1 else: log.verbose("Couldn't fetch bug reports for package %s.%s\n" % (PackageName, LINE_OVERWRITE_MID) ) #FIXME: Don't know why this was really required. If this has no changes, delete it. #file = full_file_path.split("/") #file = file[len(file) - 1] #file = download_path + "/" + file if ArgumentOptions.zip_it: if FetcherInstance.compress_the_file(ArgumentOptions.zip_upgrade_file, file) != True: log.err("Couldn't archive %s to file %s.%s\n" % (file, ArgumentOptions.zip_upgrade_file, LINE_OVERWRITE_SMALL) ) sys.exit(1) else: log.verbose("%s added to archive %s.%s\n" % (file, ArgumentOptions.zip_upgrade_file, LINE_OVERWRITE_SMALL) ) os.unlink(os.path.join(download_path, file) ) else: # Since zip file option is not enabled let's copy the file to the target folder try: shutil.copy(full_file_path, download_path) log.success("%s copied from local cache directory %s.%s\n" % (file, cache_dir, LINE_OVERWRITE_SMALL) ) except shutil.Error: log.verbose("%s already available in dest_dir. Skipping copy!!!%s\n\n" % (file, LINE_OVERWRITE_SMALL) ) # And also the bug reports if bug_fetched == 1: for x in os.listdir(os.curdir): if (x.startswith(PackageName) and x.endswith(pypt_bug_file_format) ): shutil.move(x, download_path) log.verbose("Moved %s file to %s folder.%s\n" % (x, download_path, LINE_OVERWRITE_MID) ) else: #INFO: This block gets executed if the file is not found in local cache_dir or cache_dir is None # We go ahead and try to download it from the internet log.verbose("%s not available in local cache %s.%s\n" % (file, ArgumentOptions.cache_dir, LINE_OVERWRITE_MID) ) log.msg("Downloading %s - %d KB%s\n" % (PackageName, download_size/1024, LINE_OVERWRITE_FULL) ) if FetcherInstance.download_from_web(url, file, download_path) == True: #INFO: This block gets executed if md5checksum is allowed if ArgumentOptions.disable_md5check is False: if FetcherInstance.md5_check(file, checksum) is True: if ArgumentOptions.cache_dir: try: shutil.copy(file, ArgumentOptions.cache_dir) log.verbose("%s copied to local cache directory %s.%s\n" % (file, ArgumentOptions.cache_dir, LINE_OVERWRITE_MID) ) except shutil.Error: log.verbose("%s already available in %s. Skipping copy!!!%s\n\n" % (file, ArgumentOptions.cache_dir, LINE_OVERWRITE_MID) ) if ArgumentOptions.deb_bugs: if FetchBugReportsDebian.FetchBugsDebian(PackageName): log.verbose("Fetched bug reports for package %s.%s\n" % (PackageName, LINE_OVERWRITE_MID) ) else: log.verbose("Couldn't fetch bug reports for package %s.%s\n" % (PackageName, LINE_OVERWRITE_MID) ) if ArgumentOptions.zip_it: if FetcherInstance.compress_the_file(ArgumentOptions.zip_upgrade_file, file) != True: log.err("Couldn't archive %s to file %s.%s\n" % (file, ArgumentOptions.zip_upgrade_file, LINE_OVERWRITE_SMALL) ) sys.exit(1) else: log.verbose("%s added to archive %s.%s\n" % (file, ArgumentOptions.zip_upgrade_file, LINE_OVERWRITE_SMALL) ) os.unlink(os.path.join(download_path, file) ) else: if ArgumentOptions.deb_bugs: if FetchBugReportsDebian.FetchBugsDebian(PackageName): log.verbose("Fetched bug reports for package %s.%s\n" % (PackageName, LINE_OVERWRITE_MID) ) else: log.verbose("Couldn't fetch bug reports for package %s.%s\n" % (PackageName, LINE_OVERWRITE_MID) ) if ArgumentOptions.zip_it: if FetcherInstance.compress_the_file(ArgumentOptions.zip_upgrade_file, file) != True: log.err("Couldn't archive %s to file %s.%s\n" % (file, ArgumentOptions.zip_upgrade_file, LINE_OVERWRITE_SMALL) ) sys.exit(1) else: log.verbose("%s added to archive %s.%s\n" % (file, ArgumentOptions.zip_upgrade_file, LINE_OVERWRITE_SMALL) ) os.unlink(os.path.join(download_path, file) ) log.success("\r%s done.%s\n" % (PackageName, LINE_OVERWRITE_FULL) ) else: #log.err("Couldn't find %s\n" % (PackageName) ) errlist.append(PackageName) else: raise FetchDataKeyError

f9cf927078f9b55d9b348831720ac6187f897284 /local1/tlutelli/issta_data/temp/all_python//python/2007_temp/2007/12499/f9cf927078f9b55d9b348831720ac6187f897284/pypt_core.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1086, 12, 2293, 16, 766, 16, 1326, 33, 4720, 67, 3645, 67, 1916, 4672, 9163, 967, 1516, 628, 326, 590, 7530, 16, 1207, 2182, 598, 1326, 9334, 1378, 326, 1686, 7563, 598, 326, 4884, 1807, 508, 1368, 326, 766, 7530, 18, 225, 5131, 3549, 1347, 761, 353, 599, 1093, 6309, 225, 1323, 404, 30, 3193, 67, 1726, 67, 856, 273, 590, 18, 588, 1435, 309, 3193, 67, 1726, 67, 856, 353, 599, 30, 898, 261, 856, 16, 761, 13, 273, 3193, 67, 1726, 67, 856, 261, 718, 16, 585, 16, 4224, 67, 1467, 16, 6697, 13, 273, 2569, 457, 12, 1726, 13, 2650, 67, 529, 273, 17254, 18, 2972, 3830, 7675, 17994, 1435, 225, 309, 498, 422, 296, 1891, 4278, 1906, 67, 768, 273, 585, 18, 4939, 2932, 67, 7923, 7508, 461, 273, 1906, 67, 768, 63, 20, 65, 7508, 461, 1011, 315, 300, 315, 397, 1906, 67, 768, 63, 1897, 12, 5814, 67, 768, 13, 300, 404, 65, 1464, 1906, 67, 768, 225, 468, 5923, 30, 1660, 1342, 599, 487, 279, 1544, 2674, 2724, 732, 2727, 1404, 2545, 358, 741, 279, 2151, 1623, 434, 468, 1089, 1390, 18, 2315, 1390, 854, 3550, 18872, 471, 1915, 353, 1158, 1634, 316, 9957, 279, 1623, 434, 468, 2182, 316, 326, 1247, 67, 1214, 766, 18, 458, 12, 644, 12, 2493, 67, 1214, 16, 599, 13, 262, 225, 468, 5923, 30, 2427, 67, 2327, 2674, 4102, 506, 1083, 2724, 364, 4533, 1915, 1807, 1158, 1608, 358, 741, 279, 468, 2 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1086, 12, 2293, 16, 766, 16, 1326, 33, 4720, 67, 3645, 67, 1916, 4672, 9163, 967, 1516, 628, 326, 590, 7530, 16, 1207, 2182, 598, 1326, 9334, 1378, 326, 1686, 7563, 598, 326, 4884, 1807, 508, 1368, 326, 766, 7530, 18, 225, 5131, 3549, 1347, 761, 353, 599, 1093, 6309, 225, 1323, 404, 30, 3193, 67, 1726, 67, 856, 273, 590, 18, 588, 1435, 309, 3193, 67, 1726, 67, 856, 353, 599, 30, 898, 261, 856, 16, 761, 13, 273, 3193, 67, 1726, 67, 856, 261, 718, 16, 585, 16, 4224, 67, 1467, 16, 6697, 13, 273, 2569, 457, 12, 1726, 13, 2650, 67, 529, 273, 17254, 18, 2972, 3830, 7675, 17994, 1435, 225, 309, 498, 422, 296, 2 ]

'now': datetime.datetime.now().isoformat(' '),

'now': datetime.datetime.now().isoformat(' ')[0:-7] + '+0000',

def write_infos(self, modules): import release self.buffer.write("# Translation of %(project)s.\n" \ "# This file contains the translation of the following modules:\n" \ "%(modules)s" \ "#\n" \ "msgid \"\"\n" \ "msgstr \"\"\n" \ '''"Project-Id-Version: %(project)s %(version)s\\n"\n''' \ '''"Report-Msgid-Bugs-To: %(bugmail)s\\n"\n''' \ '''"POT-Creation-Date: %(now)s\\n"\n''' \ '''"PO-Revision-Date: %(now)s\\n"\n''' \ '''"Last-Translator: <>\\n"\n''' \ '''"Language-Team: \\n"\n''' \ '''"MIME-Version: 1.0\\n"\n''' \ '''"Content-Type: text/plain; charset=UTF-8\\n"\n''' \ '''"Content-Transfer-Encoding: \\n"\n''' \ '''"Plural-Forms: \\n"\n''' \ "\n"

c3cea6e6c2e847862ef84de55d56dd5fa5610e3b /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/12853/c3cea6e6c2e847862ef84de55d56dd5fa5610e3b/translate.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1045, 67, 18227, 12, 2890, 16, 4381, 4672, 1930, 3992, 365, 18, 4106, 18, 2626, 2932, 7, 17427, 434, 8975, 4406, 13, 87, 8403, 82, 6, 521, 6619, 1220, 585, 1914, 326, 4794, 434, 326, 3751, 4381, 5581, 82, 6, 521, 22061, 6400, 13, 87, 6, 521, 6619, 64, 82, 6, 521, 315, 3576, 350, 1239, 31670, 82, 6, 521, 315, 27439, 313, 1239, 31670, 82, 6, 521, 875, 4970, 4109, 17, 548, 17, 1444, 30, 8975, 4406, 13, 87, 8975, 1589, 13, 87, 1695, 82, 12691, 82, 26418, 521, 875, 4970, 4820, 17, 3332, 350, 17, 31559, 17, 774, 30, 8975, 925, 4408, 13, 87, 1695, 82, 12691, 82, 26418, 521, 875, 4970, 52, 1974, 17, 9906, 17, 1626, 30, 8975, 3338, 13, 87, 1695, 82, 12691, 82, 26418, 3639, 521, 875, 4970, 2419, 17, 7939, 17, 1626, 30, 8975, 3338, 13, 87, 1695, 82, 12691, 82, 26418, 540, 521, 875, 4970, 3024, 17, 12233, 30, 2813, 1695, 82, 12691, 82, 26418, 521, 875, 4970, 3779, 17, 8689, 30, 1736, 82, 12691, 82, 26418, 282, 521, 875, 4970, 18178, 17, 1444, 30, 404, 18, 20, 1695, 82, 12691, 82, 26418, 521, 875, 4970, 1350, 17, 559, 30, 977, 19, 7446, 31, 4856, 33, 5159, 17, 28, 1695, 82, 12691, 82, 26418, 282, 521, 875, 4970, 1350, 17, 5912, 17, 4705, 30, 1736, 82, 12691, 82, 26418, 4202, 521, 875, 4970, 12968, 17, 18529, 30, 1736, 82, 12691, 82, 26418, 565, 521, 1548, 82, 6, 2, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1045, 67, 18227, 12, 2890, 16, 4381, 4672, 1930, 3992, 365, 18, 4106, 18, 2626, 2932, 7, 17427, 434, 8975, 4406, 13, 87, 8403, 82, 6, 521, 6619, 1220, 585, 1914, 326, 4794, 434, 326, 3751, 4381, 5581, 82, 6, 521, 22061, 6400, 13, 87, 6, 521, 6619, 64, 82, 6, 521, 315, 3576, 350, 1239, 31670, 82, 6, 521, 315, 27439, 313, 1239, 31670, 82, 6, 521, 875, 4970, 4109, 17, 548, 17, 1444, 30, 8975, 4406, 13, 87, 8975, 1589, 13, 87, 1695, 82, 12691, 82, 26418, 521, 875, 4970, 4820, 17, 3332, 350, 17, 31559, 17, 774, 30, 8975, 925, 4408, 13, 87, 1695, 82, 12691, 82, 26418, 521, 875, 4970, 52, 1974, 17, 9906, 2 ]

@param address: any address in the breakpoint range

@param ea: any address in the breakpoint range

def SetBptCnd(ea, cnd): """ Set breakpoint condition @param address: any address in the breakpoint range @param cnd: breakpoint condition @return: success """ bpt = idaapi.bpt_t() if not idaapi.get_bpt(ea, bpt): return False bpt.condition = cnd return idaapi.update_bpt(bpt)

e44bdcd4de27699ae0ecbd6c9dc2f42ebbbc110e /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/3410/e44bdcd4de27699ae0ecbd6c9dc2f42ebbbc110e/idc.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1000, 38, 337, 39, 4880, 12, 24852, 16, 276, 4880, 4672, 3536, 1000, 18820, 2269, 225, 632, 891, 24164, 30, 1281, 1758, 316, 326, 18820, 1048, 632, 891, 276, 4880, 30, 18820, 2269, 225, 632, 2463, 30, 2216, 3536, 324, 337, 273, 612, 69, 2425, 18, 70, 337, 67, 88, 1435, 225, 309, 486, 612, 69, 2425, 18, 588, 67, 70, 337, 12, 24852, 16, 324, 337, 4672, 327, 1083, 225, 324, 337, 18, 4175, 273, 276, 4880, 225, 327, 612, 69, 2425, 18, 2725, 67, 70, 337, 12, 70, 337, 13, 282, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1000, 38, 337, 39, 4880, 12, 24852, 16, 276, 4880, 4672, 3536, 1000, 18820, 2269, 225, 632, 891, 24164, 30, 1281, 1758, 316, 326, 18820, 1048, 632, 891, 276, 4880, 30, 18820, 2269, 225, 632, 2463, 30, 2216, 3536, 324, 337, 273, 612, 69, 2425, 18, 70, 337, 67, 88, 1435, 225, 309, 486, 612, 69, 2425, 18, 588, 67, 70, 337, 12, 24852, 16, 324, 337, 4672, 327, 1083, 225, 324, 337, 18, 4175, 273, 276, 4880, 225, 327, 612, 69, 2425, 18, 2725, 67, 70, 337, 12, 70, 337, 13, 282, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]

:returns: :class:`celery.result.AsyncResult`.

:returns :class:`celery.result.AsyncResult`:

def delay_task(task_name, *args, **kwargs): """Delay a task for execution by the ``celery`` daemon. :param task_name: the name of a task registered in the task registry. :param \*args: positional arguments to pass on to the task. :param \*\*kwargs: keyword arguments to pass on to the task. :raises celery.exceptions.NotRegistered: exception if no such task has been registered in the task registry. :returns: :class:`celery.result.AsyncResult`. Example >>> r = delay_task("update_record", name="George Costanza", age=32) >>> r.ready() True >>> r.result "Record was updated" """ return apply_async(tasks[task_name], args, kwargs)

d789a8f203274d33dba847c85f5b19a934ff74df /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/2024/d789a8f203274d33dba847c85f5b19a934ff74df/__init__.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 4624, 67, 4146, 12, 4146, 67, 529, 16, 380, 1968, 16, 2826, 4333, 4672, 3536, 6763, 279, 1562, 364, 4588, 635, 326, 12176, 2183, 627, 10335, 8131, 18, 225, 294, 891, 1562, 67, 529, 30, 326, 508, 434, 279, 1562, 4104, 316, 326, 1562, 4023, 18, 294, 891, 521, 14, 1968, 30, 16780, 1775, 358, 1342, 603, 358, 326, 1562, 18, 294, 891, 521, 12174, 14, 4333, 30, 4932, 1775, 358, 1342, 603, 358, 326, 1562, 18, 225, 294, 354, 6141, 25357, 627, 18, 11855, 18, 1248, 10868, 30, 1520, 309, 1158, 4123, 1562, 711, 2118, 4104, 316, 326, 1562, 4023, 18, 225, 294, 6154, 294, 1106, 28288, 2183, 627, 18, 2088, 18, 2771, 1253, 68, 30, 225, 5090, 225, 4080, 436, 273, 4624, 67, 4146, 2932, 2725, 67, 3366, 3113, 508, 1546, 18809, 280, 908, 7695, 541, 11939, 3113, 9388, 33, 1578, 13, 4080, 436, 18, 1672, 1435, 1053, 4080, 436, 18, 2088, 315, 2115, 1703, 3526, 6, 225, 3536, 327, 2230, 67, 3810, 12, 9416, 63, 4146, 67, 529, 6487, 833, 16, 1205, 13, 282, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 4624, 67, 4146, 12, 4146, 67, 529, 16, 380, 1968, 16, 2826, 4333, 4672, 3536, 6763, 279, 1562, 364, 4588, 635, 326, 12176, 2183, 627, 10335, 8131, 18, 225, 294, 891, 1562, 67, 529, 30, 326, 508, 434, 279, 1562, 4104, 316, 326, 1562, 4023, 18, 294, 891, 521, 14, 1968, 30, 16780, 1775, 358, 1342, 603, 358, 326, 1562, 18, 294, 891, 521, 12174, 14, 4333, 30, 4932, 1775, 358, 1342, 603, 358, 326, 1562, 18, 225, 294, 354, 6141, 25357, 627, 18, 11855, 18, 1248, 10868, 30, 1520, 309, 1158, 4123, 1562, 711, 2118, 4104, 316, 326, 1562, 4023, 18, 225, 294, 6154, 294, 1106, 28288, 2183, 627, 18, 2088, 18, 2771, 1253, 68, 30, 225, 2 ]

return _('Factors of %d') % ( self.level_multiple[self.curlevel-1] ) def setLevel(self, n): self.curlevel = n

return _('Factors of %d') % ( self.level_multiple[self.cur_sublevel-1] ) def setLevel(self, level, sublevel): self.curlevel = level self.cur_sublevel = sublevel

def getTitle(self): return _('Factors of %d') % ( self.level_multiple[self.curlevel-1] )

af34e64d38be11ba68a4418286816d4e15a20114 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/11306/af34e64d38be11ba68a4418286816d4e15a20114/gnumch.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 10786, 12, 2890, 4672, 327, 389, 2668, 23535, 434, 738, 72, 6134, 738, 261, 365, 18, 2815, 67, 9622, 63, 2890, 18, 1397, 2815, 17, 21, 65, 262, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 10786, 12, 2890, 4672, 327, 389, 2668, 23535, 434, 738, 72, 6134, 738, 261, 365, 18, 2815, 67, 9622, 63, 2890, 18, 1397, 2815, 17, 21, 65, 262, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]

'onclick="toggle(\'%s\'); return false;">-</a>\\2' %

'onclick="return toggle(\'%s\');">-</a>\\2' %

def mark_def(self, s, name): replacement = ('<a name="%s"></a><div id="%s-def">\\1' '<a class="py-toggle" href="#" id="%s-toggle" ' 'onclick="toggle(\'%s\'); return false;">-</a>\\2' % (name, name, name, name)) return re.sub('(.*) (<span class="py-line">.*)\Z', replacement, s)

cd4d6e5fbca5f698866ebe3598f5c2ca592983e0 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/11420/cd4d6e5fbca5f698866ebe3598f5c2ca592983e0/html_colorize.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 2267, 67, 536, 12, 2890, 16, 272, 16, 508, 4672, 6060, 273, 7707, 32, 69, 508, 11613, 87, 13762, 69, 4438, 2892, 612, 11613, 87, 17, 536, 6441, 1695, 21, 11, 2368, 69, 667, 1546, 2074, 17, 14401, 6, 3897, 1546, 17133, 612, 11613, 87, 17, 14401, 6, 296, 296, 265, 7475, 1546, 2463, 10486, 21923, 9, 87, 3730, 1769, 6441, 17, 1757, 69, 34, 1695, 22, 11, 738, 261, 529, 16, 508, 16, 508, 16, 508, 3719, 327, 283, 18, 1717, 2668, 14361, 261, 32, 3969, 667, 1546, 2074, 17, 1369, 6441, 4509, 5153, 62, 2187, 6060, 16, 272, 13, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 2267, 67, 536, 12, 2890, 16, 272, 16, 508, 4672, 6060, 273, 7707, 32, 69, 508, 11613, 87, 13762, 69, 4438, 2892, 612, 11613, 87, 17, 536, 6441, 1695, 21, 11, 2368, 69, 667, 1546, 2074, 17, 14401, 6, 3897, 1546, 17133, 612, 11613, 87, 17, 14401, 6, 296, 296, 265, 7475, 1546, 2463, 10486, 21923, 9, 87, 3730, 1769, 6441, 17, 1757, 69, 34, 1695, 22, 11, 738, 261, 529, 16, 508, 16, 508, 16, 508, 3719, 327, 283, 18, 1717, 2668, 14361, 261, 32, 3969, 667, 1546, 2074, 17, 1369, 6441, 4509, 5153, 62, 2187, 6060, 16, 272, 13, 225, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]

sender, conn = sender

def _pongHandler(sender, id=node.id, host=node.host, port=node.port, table=self.table): sender, conn = sender if id != 20 * ' ' and id != sender['id'].data: # whoah, got response from different peer than we were expecting pass else: sender['host'] = host sender['port'] = port n = Node().initWithDict(sender) table.insertNode(n) return

30d0bd614dd718bb2c3fd331b3c1fd56786a02aa /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/665/30d0bd614dd718bb2c3fd331b3c1fd56786a02aa/khashmir.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 500, 75, 1503, 12, 15330, 16, 612, 33, 2159, 18, 350, 16, 1479, 33, 2159, 18, 2564, 16, 1756, 33, 2159, 18, 655, 16, 1014, 33, 2890, 18, 2121, 4672, 309, 612, 480, 4200, 380, 296, 296, 471, 612, 480, 5793, 3292, 350, 29489, 892, 30, 468, 10354, 9795, 16, 2363, 766, 628, 3775, 4261, 2353, 732, 4591, 17012, 1342, 469, 30, 5793, 3292, 2564, 3546, 273, 1479, 5793, 3292, 655, 3546, 273, 1756, 290, 273, 2029, 7675, 2738, 1190, 5014, 12, 15330, 13, 1014, 18, 6387, 907, 12, 82, 13, 327, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 500, 75, 1503, 12, 15330, 16, 612, 33, 2159, 18, 350, 16, 1479, 33, 2159, 18, 2564, 16, 1756, 33, 2159, 18, 655, 16, 1014, 33, 2890, 18, 2121, 4672, 309, 612, 480, 4200, 380, 296, 296, 471, 612, 480, 5793, 3292, 350, 29489, 892, 30, 468, 10354, 9795, 16, 2363, 766, 628, 3775, 4261, 2353, 732, 4591, 17012, 1342, 469, 30, 5793, 3292, 2564, 3546, 273, 1479, 5793, 3292, 655, 3546, 273, 1756, 290, 273, 2029, 7675, 2738, 1190, 5014, 12, 15330, 13, 1014, 18, 6387, 907, 12, 82, 13, 327, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]

ttfont = self.setupFont(font, fontsize * scale_bias)

ttfont = self.setupFont(font, fontsize)

def truetypeText(self, xy, string, **kwargs): scale_bias = 4 fill = kwargs.get('fill') font = kwargs.get('font') fontsize = kwargs.get('fontsize', 11)

b648335863326a7794f99ca7f1c81399a501eb5e /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/81/b648335863326a7794f99ca7f1c81399a501eb5e/DiagramDraw.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 433, 89, 5872, 1528, 12, 2890, 16, 7668, 16, 533, 16, 2826, 4333, 4672, 3159, 67, 13931, 273, 1059, 3636, 273, 1205, 18, 588, 2668, 5935, 6134, 3512, 273, 1205, 18, 588, 2668, 5776, 6134, 14869, 273, 1205, 18, 588, 2668, 23055, 2187, 4648, 13, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 433, 89, 5872, 1528, 12, 2890, 16, 7668, 16, 533, 16, 2826, 4333, 4672, 3159, 67, 13931, 273, 1059, 3636, 273, 1205, 18, 588, 2668, 5935, 6134, 3512, 273, 1205, 18, 588, 2668, 5776, 6134, 14869, 273, 1205, 18, 588, 2668, 23055, 2187, 4648, 13, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]

msg = 'No Candidate Sites in Mask'

def checkJob(self,job): """This method controls the checking of the job. """ self.log.verbose('Job %s will be processed' % (job)) #First check whether the job has an input data requirement result = self.jobDB.getInputData(job) if not result['OK']: self.log.warn('Failed to get input data from JobDB for %s' % (job)) self.log.error(result['Message'])

6a41e53ca0e8385ad60a7fc3b43a5923a12510f3 /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/12864/6a41e53ca0e8385ad60a7fc3b43a5923a12510f3/JobSchedulingAgent.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 866, 2278, 12, 2890, 16, 4688, 4672, 3536, 2503, 707, 11022, 326, 6728, 434, 326, 1719, 18, 3536, 365, 18, 1330, 18, 11369, 2668, 2278, 738, 87, 903, 506, 5204, 11, 738, 261, 4688, 3719, 468, 3759, 866, 2856, 326, 1719, 711, 392, 810, 501, 12405, 563, 273, 365, 18, 4688, 2290, 18, 588, 1210, 751, 12, 4688, 13, 309, 486, 563, 3292, 3141, 3546, 30, 365, 18, 1330, 18, 8935, 2668, 2925, 358, 336, 810, 501, 628, 3956, 2290, 364, 738, 87, 11, 738, 261, 4688, 3719, 365, 18, 1330, 18, 1636, 12, 2088, 3292, 1079, 19486, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 866, 2278, 12, 2890, 16, 4688, 4672, 3536, 2503, 707, 11022, 326, 6728, 434, 326, 1719, 18, 3536, 365, 18, 1330, 18, 11369, 2668, 2278, 738, 87, 903, 506, 5204, 11, 738, 261, 4688, 3719, 468, 3759, 866, 2856, 326, 1719, 711, 392, 810, 501, 12405, 563, 273, 365, 18, 4688, 2290, 18, 588, 1210, 751, 12, 4688, 13, 309, 486, 563, 3292, 3141, 3546, 30, 365, 18, 1330, 18, 8935, 2668, 2925, 358, 336, 810, 501, 628, 3956, 2290, 364, 738, 87, 11, 738, 261, 4688, 3719, 365, 18, 1330, 18, 1636, 12, 2088, 3292, 1079, 19486, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]

self.roomsmodel.append([room, users, users])

self.roomsmodel.append([room, users, 0])

def SetRoomList(self, msg): if self.autojoin: self.autojoin = 0 if self.joinedrooms.keys(): list = self.joinedrooms.keys() else: list = self.frame.np.config.sections["server"]["autojoin"]

bd22d9a79d709d993463602575ff87e47daaa60e /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/8738/bd22d9a79d709d993463602575ff87e47daaa60e/chatrooms.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1000, 13646, 682, 12, 2890, 16, 1234, 4672, 225, 309, 365, 18, 6079, 5701, 30, 365, 18, 6079, 5701, 273, 374, 309, 365, 18, 5701, 329, 13924, 87, 18, 2452, 13332, 666, 273, 365, 18, 5701, 329, 13924, 87, 18, 2452, 1435, 469, 30, 666, 273, 365, 18, 3789, 18, 6782, 18, 1425, 18, 11657, 9614, 3567, 6, 6362, 6, 6079, 5701, 11929, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1000, 13646, 682, 12, 2890, 16, 1234, 4672, 225, 309, 365, 18, 6079, 5701, 30, 365, 18, 6079, 5701, 273, 374, 309, 365, 18, 5701, 329, 13924, 87, 18, 2452, 13332, 666, 273, 365, 18, 5701, 329, 13924, 87, 18, 2452, 1435, 469, 30, 666, 273, 365, 18, 3789, 18, 6782, 18, 1425, 18, 11657, 9614, 3567, 6, 6362, 6, 6079, 5701, 11929, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]

Individual.__getattr__ = ind_getInfo2

Individual.__getattr__ = Individual.info

def ind_getInfo3(self, field): if field == 'this': return self.__dict__['this'] else: return self.info(field)

11ebaaa64ca7a29581921643e7054787bddf7835 /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/401/11ebaaa64ca7a29581921643e7054787bddf7835/__init__.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1547, 67, 588, 966, 23, 12, 2890, 16, 652, 4672, 309, 652, 422, 296, 2211, 4278, 327, 365, 16186, 1576, 972, 3292, 2211, 3546, 469, 30, 327, 365, 18, 1376, 12, 1518, 13, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1547, 67, 588, 966, 23, 12, 2890, 16, 652, 4672, 309, 652, 422, 296, 2211, 4278, 327, 365, 16186, 1576, 972, 3292, 2211, 3546, 469, 30, 327, 365, 18, 1376, 12, 1518, 13, 225, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]

value = theDuration.strftime (self.durationFormat)

if theDuration is not None: value = self.formattedDuration (theDuration, '') else: value = 'hh:mm'

def loadAttributeIntoWidget(self, item, widget): """" Update the widget display based on the value in the attribute. """ try: theDuration = item.duration except AttributeError: value = '?' else: value = theDuration.strftime (self.durationFormat) widget.SetValue (value)

3f9d10450d98d9f910b82730307316ba3d4cf615 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/9228/3f9d10450d98d9f910b82730307316ba3d4cf615/Detail.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1262, 1499, 5952, 4609, 12, 2890, 16, 761, 16, 3604, 4672, 3536, 6, 2315, 326, 3604, 2562, 2511, 603, 326, 460, 316, 326, 1566, 18, 3536, 775, 30, 326, 5326, 273, 761, 18, 8760, 1335, 6394, 30, 460, 273, 6787, 469, 30, 309, 326, 5326, 353, 486, 599, 30, 460, 273, 365, 18, 14897, 5326, 261, 5787, 5326, 16, 28707, 469, 30, 460, 273, 296, 21622, 30, 7020, 11, 3604, 18, 694, 620, 261, 1132, 13, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1262, 1499, 5952, 4609, 12, 2890, 16, 761, 16, 3604, 4672, 3536, 6, 2315, 326, 3604, 2562, 2511, 603, 326, 460, 316, 326, 1566, 18, 3536, 775, 30, 326, 5326, 273, 761, 18, 8760, 1335, 6394, 30, 460, 273, 6787, 469, 30, 309, 326, 5326, 353, 486, 599, 30, 460, 273, 365, 18, 14897, 5326, 261, 5787, 5326, 16, 28707, 469, 30, 460, 273, 296, 21622, 30, 7020, 11, 3604, 18, 694, 620, 261, 1132, 13, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]

if t._checked == True: return if not t: raise BoardCoordOutOfRangeExcepton, "Tile coordinate (%d,%d) out of bounds"%(x,y)

if not t: return if t._checked: return

def reveal(self,player,x,y, list=[]): if list==[]: first=True else: first=False t = self.get_tile(x,y) if t._checked == True: return if not t: raise BoardCoordOutOfRangeExcepton, "Tile coordinate (%d,%d) out of bounds"%(x,y) t._checked = True if t.uncovered == 0: t.uncovered = player list.append(t) if t.adjacency==0: for a in self.get_adjacent_tiles(x, y): self.reveal(player,*a.pos,list=list) if first: for l in self.tiles: for t in l: t._checked = False

76b80045ff8fc568b5b27e58828689805a12f2d7 /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/14104/76b80045ff8fc568b5b27e58828689805a12f2d7/game.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 283, 24293, 12, 2890, 16, 14872, 16, 92, 16, 93, 16, 666, 33, 8526, 4672, 309, 666, 631, 8526, 30, 1122, 33, 5510, 469, 30, 1122, 33, 8381, 268, 273, 365, 18, 588, 67, 15368, 12, 92, 16, 93, 13, 309, 486, 268, 30, 327, 309, 268, 6315, 4532, 30, 327, 268, 6315, 4532, 273, 1053, 309, 268, 18, 551, 1643, 329, 422, 374, 30, 268, 18, 551, 1643, 329, 273, 7291, 666, 18, 6923, 12, 88, 13, 309, 268, 18, 13829, 1077, 2075, 631, 20, 30, 364, 279, 316, 365, 18, 588, 67, 13829, 25897, 67, 28366, 12, 92, 16, 677, 4672, 365, 18, 266, 24293, 12, 14872, 16, 14, 69, 18, 917, 16, 1098, 33, 1098, 13, 309, 1122, 30, 364, 328, 316, 365, 18, 28366, 30, 364, 268, 316, 328, 30, 268, 6315, 4532, 273, 1083, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 283, 24293, 12, 2890, 16, 14872, 16, 92, 16, 93, 16, 666, 33, 8526, 4672, 309, 666, 631, 8526, 30, 1122, 33, 5510, 469, 30, 1122, 33, 8381, 268, 273, 365, 18, 588, 67, 15368, 12, 92, 16, 93, 13, 309, 486, 268, 30, 327, 309, 268, 6315, 4532, 30, 327, 268, 6315, 4532, 273, 1053, 309, 268, 18, 551, 1643, 329, 422, 374, 30, 268, 18, 551, 1643, 329, 273, 7291, 666, 18, 6923, 12, 88, 13, 309, 268, 18, 13829, 1077, 2075, 631, 20, 30, 364, 279, 316, 365, 18, 588, 67, 13829, 25897, 67, 28366, 12, 92, 16, 677, 4672, 365, 18, 266, 24293, 12, 14872, 16, 14, 69, 18, 917, 16, 1098, 33, 1098, 2 ]

iter = model.get_iter_root() while iter:

__iter = model.get_iter_root() while __iter:

def get_selected_operations(self): """Return a list of the IDs of the selected operations in the tree view""" r = [] model = self.tree_store.get_model() iter = model.get_iter_root() while iter: #print "debug: get_selected_operations: iter id = '%s', value='%s'" % (model[iter][2], model[iter][1]) if True == model[iter][1]: r.append(model[iter][2]) iter = model.iter_next(iter) return r

9d492cae068d04dccea7b824cceed2984729452a /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/7853/9d492cae068d04dccea7b824cceed2984729452a/GUI.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 336, 67, 8109, 67, 17542, 12, 2890, 4672, 3536, 990, 279, 666, 434, 326, 7115, 434, 326, 3170, 5295, 316, 326, 2151, 1476, 8395, 436, 273, 5378, 938, 273, 365, 18, 3413, 67, 2233, 18, 588, 67, 2284, 1435, 1001, 2165, 273, 938, 18, 588, 67, 2165, 67, 3085, 1435, 1323, 1001, 2165, 30, 468, 1188, 315, 4148, 30, 336, 67, 8109, 67, 17542, 30, 1400, 612, 273, 1995, 87, 2187, 460, 28713, 87, 4970, 738, 261, 2284, 63, 2165, 6362, 22, 6487, 938, 63, 2165, 6362, 21, 5717, 309, 1053, 422, 938, 63, 2165, 6362, 21, 14542, 436, 18, 6923, 12, 2284, 63, 2165, 6362, 22, 5717, 1400, 273, 938, 18, 2165, 67, 4285, 12, 2165, 13, 327, 436, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 336, 67, 8109, 67, 17542, 12, 2890, 4672, 3536, 990, 279, 666, 434, 326, 7115, 434, 326, 3170, 5295, 316, 326, 2151, 1476, 8395, 436, 273, 5378, 938, 273, 365, 18, 3413, 67, 2233, 18, 588, 67, 2284, 1435, 1001, 2165, 273, 938, 18, 588, 67, 2165, 67, 3085, 1435, 1323, 1001, 2165, 30, 468, 1188, 315, 4148, 30, 336, 67, 8109, 67, 17542, 30, 1400, 612, 273, 1995, 87, 2187, 460, 28713, 87, 4970, 738, 261, 2284, 63, 2165, 6362, 22, 6487, 938, 63, 2165, 6362, 21, 5717, 309, 1053, 422, 938, 63, 2165, 6362, 21, 14542, 436, 18, 6923, 12, 2284, 63, 2165, 6362, 22, 5717, 1400, 273, 938, 18, 2165, 67, 4285, 12, 2165, 13, 2 ]

96889010407L 96889010407

96889010407

def cardinality(self): r""" Returns the number of words of length n from alphabet.

dcebd36667c37501e3ed85d2815782c98473a1c8 /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/9417/dcebd36667c37501e3ed85d2815782c98473a1c8/words.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 14379, 12, 2890, 4672, 436, 8395, 2860, 326, 1300, 434, 4511, 434, 769, 290, 628, 10877, 18, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 14379, 12, 2890, 4672, 436, 8395, 2860, 326, 1300, 434, 4511, 434, 769, 290, 628, 10877, 18, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]

def archive_db(): print "STATUS: archiving old database" archive_db = "psql template1 postgres -qc " \ " 'ALTER DATABASE %s RENAME TO %s;';" \ " createdb -U postgres %s > /dev/null; " % \ (database, archived_database, database)

def archive_db(database, archived_database): print "Status: archiving old database" archive_db = " dropdb -U postgres %s; > /dev/null 2>&1" \ " psql template1 postgres -qc " \ " 'ALTER DATABASE %s RENAME TO %s;';" \ " createdb -U postgres %s > /dev/null; " % \ (archived_database, database, archived_database, database)

def archive_db(): print "STATUS: archiving old database" archive_db = "psql template1 postgres -qc " \ " 'ALTER DATABASE %s RENAME TO %s;';" \ " createdb -U postgres %s > /dev/null; " % \ (database, archived_database, database) exit_status = os.system(archive_db) if exit_status: print "ERROR: unable to archive database. Upgrade failed" sys.exit(1) print "STATUS: %s has been archived. now named %s" % (database, archived_database)

af98851618b632afb0a950644c796b7c633ace40 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/7598/af98851618b632afb0a950644c796b7c633ace40/upgrade-db.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 5052, 67, 1966, 12, 6231, 16, 23276, 67, 6231, 4672, 225, 1172, 315, 1482, 30, 6637, 9288, 1592, 2063, 6, 5052, 67, 1966, 273, 315, 3640, 1966, 300, 57, 1603, 14107, 738, 87, 31, 405, 342, 5206, 19, 2011, 576, 22393, 21, 6, 521, 315, 4250, 1217, 1542, 21, 1603, 14107, 300, 30675, 315, 521, 315, 296, 18843, 17998, 738, 87, 534, 21150, 8493, 738, 87, 4359, 4868, 521, 315, 2522, 70, 300, 57, 1603, 14107, 738, 87, 405, 342, 5206, 19, 2011, 31, 315, 738, 521, 261, 991, 2950, 67, 6231, 16, 2063, 16, 23276, 67, 6231, 16, 2063, 13, 2427, 67, 2327, 273, 1140, 18, 4299, 12, 10686, 67, 1966, 13, 309, 2427, 67, 2327, 30, 1172, 315, 3589, 30, 13496, 358, 5052, 2063, 18, 17699, 2535, 6, 2589, 18, 8593, 12, 21, 13, 1172, 315, 8608, 30, 738, 87, 711, 2118, 23276, 18, 2037, 4141, 738, 87, 6, 738, 261, 6231, 16, 23276, 67, 6231, 13, 282, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 5052, 67, 1966, 12, 6231, 16, 23276, 67, 6231, 4672, 225, 1172, 315, 1482, 30, 6637, 9288, 1592, 2063, 6, 5052, 67, 1966, 273, 315, 3640, 1966, 300, 57, 1603, 14107, 738, 87, 31, 405, 342, 5206, 19, 2011, 576, 22393, 21, 6, 521, 315, 4250, 1217, 1542, 21, 1603, 14107, 300, 30675, 315, 521, 315, 296, 18843, 17998, 738, 87, 534, 21150, 8493, 738, 87, 4359, 4868, 521, 315, 2522, 70, 300, 57, 1603, 14107, 738, 87, 405, 342, 5206, 19, 2011, 31, 315, 738, 521, 261, 991, 2950, 67, 6231, 16, 2063, 16, 23276, 67, 6231, 16, 2063, 13, 2427, 67, 2327, 273, 1140, 18, 4299, 12, 10686, 67, 1966, 13, 309, 2427, 67, 2327, 30, 2 ]

return cmp(map(int, a.split('.')), map(int, b.split('.')))

aa = a.split('.') bb = b.split('.') for index in range(min(len(aa), len(bb))): result = cmp(int(aa[index]), int(bb[index])) if result != 0: return result return 0

def CompareVersions(a, b): if (a.find('.') < 0) or (b.find('.') < 0): return -1 return cmp(map(int, a.split('.')), map(int, b.split('.')))

1331841a3d5d1a886c5e30836daef2c3d23ecce2 /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/14747/1331841a3d5d1a886c5e30836daef2c3d23ecce2/util.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 11051, 5940, 12, 69, 16, 324, 4672, 309, 261, 69, 18, 4720, 2668, 1093, 13, 411, 374, 13, 578, 261, 70, 18, 4720, 2668, 1093, 13, 411, 374, 4672, 327, 300, 21, 540, 12391, 273, 279, 18, 4939, 2668, 1093, 13, 7129, 273, 324, 18, 4939, 2668, 1093, 13, 364, 770, 316, 1048, 12, 1154, 12, 1897, 12, 7598, 3631, 562, 12, 9897, 3719, 4672, 563, 273, 9411, 12, 474, 12, 7598, 63, 1615, 65, 3631, 509, 12, 9897, 63, 1615, 22643, 309, 563, 480, 374, 30, 327, 563, 327, 374, 282, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 11051, 5940, 12, 69, 16, 324, 4672, 309, 261, 69, 18, 4720, 2668, 1093, 13, 411, 374, 13, 578, 261, 70, 18, 4720, 2668, 1093, 13, 411, 374, 4672, 327, 300, 21, 540, 12391, 273, 279, 18, 4939, 2668, 1093, 13, 7129, 273, 324, 18, 4939, 2668, 1093, 13, 364, 770, 316, 1048, 12, 1154, 12, 1897, 12, 7598, 3631, 562, 12, 9897, 3719, 4672, 563, 273, 9411, 12, 474, 12, 7598, 63, 1615, 65, 3631, 509, 12, 9897, 63, 1615, 22643, 309, 563, 480, 374, 30, 327, 563, 327, 374, 282, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]

conn.settimeout(5)

conn.settimeout(10)

def _recv(self): data = '' conn = socket.socket(socket.AF_INET, socket.SOCK_STREAM) conn.connect(self.__addr) conn.settimeout(5) conn.send('++read' + self.__term) while data.find(self.__term) < 0: data += conn.recv(1024) conn.close() return data[:data.find(self.__term)]

c9fb5cb45e19096da2005d67889aea2b141a7f0e /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/14654/c9fb5cb45e19096da2005d67889aea2b141a7f0e/synth_agent.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 18334, 12, 2890, 4672, 501, 273, 875, 1487, 273, 2987, 18, 7814, 12, 7814, 18, 6799, 67, 18819, 16, 2987, 18, 3584, 3507, 67, 13693, 13, 1487, 18, 3612, 12, 2890, 16186, 4793, 13, 1487, 18, 542, 4538, 12, 2163, 13, 1487, 18, 4661, 2668, 9904, 896, 11, 397, 365, 16186, 6408, 13, 1323, 501, 18, 4720, 12, 2890, 16186, 6408, 13, 411, 374, 30, 501, 1011, 1487, 18, 18334, 12, 2163, 3247, 13, 1487, 18, 4412, 1435, 327, 501, 10531, 892, 18, 4720, 12, 2890, 16186, 6408, 25887, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 18334, 12, 2890, 4672, 501, 273, 875, 1487, 273, 2987, 18, 7814, 12, 7814, 18, 6799, 67, 18819, 16, 2987, 18, 3584, 3507, 67, 13693, 13, 1487, 18, 3612, 12, 2890, 16186, 4793, 13, 1487, 18, 542, 4538, 12, 2163, 13, 1487, 18, 4661, 2668, 9904, 896, 11, 397, 365, 16186, 6408, 13, 1323, 501, 18, 4720, 12, 2890, 16186, 6408, 13, 411, 374, 30, 501, 1011, 1487, 18, 18334, 12, 2163, 3247, 13, 1487, 18, 4412, 1435, 327, 501, 10531, 892, 18, 4720, 12, 2890, 16186, 6408, 25887, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]

lex = shlex.shlex(StringIO(s))

lex = shlex.shlex(io.StringIO(s))

def oldSplit(self, s): ret = [] lex = shlex.shlex(StringIO(s)) tok = lex.get_token() while tok: ret.append(tok) tok = lex.get_token() return ret

826980d93aa913cc6fc217b1207fb7d5fd98aad3 /local1/tlutelli/issta_data/temp/all_python//python/2007_temp/2007/8125/826980d93aa913cc6fc217b1207fb7d5fd98aad3/test_shlex.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1592, 5521, 12, 2890, 16, 272, 4672, 325, 273, 5378, 5275, 273, 27180, 18, 674, 4149, 12, 1594, 18, 780, 4294, 12, 87, 3719, 946, 273, 5275, 18, 588, 67, 2316, 1435, 1323, 946, 30, 325, 18, 6923, 12, 17692, 13, 946, 273, 5275, 18, 588, 67, 2316, 1435, 327, 325, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1592, 5521, 12, 2890, 16, 272, 4672, 325, 273, 5378, 5275, 273, 27180, 18, 674, 4149, 12, 1594, 18, 780, 4294, 12, 87, 3719, 946, 273, 5275, 18, 588, 67, 2316, 1435, 1323, 946, 30, 325, 18, 6923, 12, 17692, 13, 946, 273, 5275, 18, 588, 67, 2316, 1435, 327, 325, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]

self.__p = int(parent.residue_characteristic())

self.__p = integer.Integer(parent.residue_characteristic())

def __init__(self, parent, x, big_oh=infinity, ordp=None, construct=False): r""" INPUT: parent -- a p-adic field. x -- anything that can be coerced to a p-adic number. big_oh -- is such that, e.g. 3^(-1) + 1 + 2 * 3 + (3^2) has big_oh equal to 2. """ field_element.FieldElement.__init__(self, parent) if construct: self.__parent = parent (self.__p, self.__unit, self.__ordp, self.__prec) = x return

2524dc6cf63145fc327980456b747492a7ca7be7 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/9417/2524dc6cf63145fc327980456b747492a7ca7be7/padic.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 2890, 16, 982, 16, 619, 16, 5446, 67, 16699, 33, 267, 7850, 16, 4642, 84, 33, 7036, 16, 4872, 33, 8381, 4672, 436, 8395, 12943, 30, 982, 1493, 279, 293, 17, 20333, 652, 18, 619, 1493, 6967, 716, 848, 506, 12270, 72, 358, 279, 293, 17, 20333, 1300, 18, 5446, 67, 16699, 1493, 353, 4123, 716, 16, 425, 18, 75, 18, 890, 66, 19236, 21, 13, 397, 404, 397, 576, 380, 890, 397, 261, 23, 66, 22, 13, 711, 5446, 67, 16699, 3959, 358, 576, 18, 3536, 652, 67, 2956, 18, 974, 1046, 16186, 2738, 972, 12, 2890, 16, 982, 13, 309, 4872, 30, 365, 16186, 2938, 273, 982, 261, 2890, 16186, 84, 16, 365, 16186, 4873, 16, 365, 16186, 517, 84, 16, 365, 16186, 4036, 13, 273, 619, 327, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 2890, 16, 982, 16, 619, 16, 5446, 67, 16699, 33, 267, 7850, 16, 4642, 84, 33, 7036, 16, 4872, 33, 8381, 4672, 436, 8395, 12943, 30, 982, 1493, 279, 293, 17, 20333, 652, 18, 619, 1493, 6967, 716, 848, 506, 12270, 72, 358, 279, 293, 17, 20333, 1300, 18, 5446, 67, 16699, 1493, 353, 4123, 716, 16, 425, 18, 75, 18, 890, 66, 19236, 21, 13, 397, 404, 397, 576, 380, 890, 397, 261, 23, 66, 22, 13, 711, 5446, 67, 16699, 3959, 358, 576, 18, 3536, 652, 67, 2956, 18, 974, 1046, 16186, 2738, 972, 12, 2890, 16, 982, 13, 309, 4872, 30, 365, 16186, 2938, 273, 982, 261, 2890, 16186, 84, 16, 2 ]

def retry_command(cmd, retries, timeout, sleeptime):

def retry_command(cmd, retries, timeout, sleeptime, stdout_regexp=None, stderr_regexp=None, fail_if_match=False):

def retry_command(cmd, retries, timeout, sleeptime): # Which iteration we're on i = 0 # Current return code rc = False while True: i += 1 rc = run_with_timeout(cmd, timeout) if rc: break if retries > 0 and i >= retries: log.info("Number of retries exceeded maximum (%i), giving up.", retries) break if sleeptime: log.info("Sleeping for %i.", sleeptime) time.sleep(sleeptime) return rc

c43e77b901baa29ea327693e697bb61fd7622486 /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/6206/c43e77b901baa29ea327693e697bb61fd7622486/retry.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 3300, 67, 3076, 12, 4172, 16, 9453, 16, 2021, 16, 272, 11182, 10650, 16, 3909, 67, 17745, 33, 7036, 16, 4514, 67, 17745, 33, 7036, 16, 2321, 67, 430, 67, 1916, 33, 8381, 4672, 468, 21918, 6532, 732, 4565, 603, 277, 273, 374, 225, 468, 6562, 327, 981, 4519, 273, 1083, 225, 1323, 1053, 30, 277, 1011, 404, 225, 4519, 273, 1086, 67, 1918, 67, 4538, 12, 4172, 16, 2021, 13, 225, 309, 4519, 30, 898, 225, 309, 9453, 405, 374, 471, 277, 1545, 9453, 30, 613, 18, 1376, 2932, 1854, 434, 9453, 12428, 4207, 6142, 77, 3631, 21057, 731, 1199, 16, 9453, 13, 898, 225, 309, 272, 11182, 10650, 30, 613, 18, 1376, 2932, 20768, 310, 364, 738, 77, 1199, 16, 272, 11182, 10650, 13, 813, 18, 19607, 12, 87, 11182, 10650, 13, 225, 327, 4519, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 3300, 67, 3076, 12, 4172, 16, 9453, 16, 2021, 16, 272, 11182, 10650, 16, 3909, 67, 17745, 33, 7036, 16, 4514, 67, 17745, 33, 7036, 16, 2321, 67, 430, 67, 1916, 33, 8381, 4672, 468, 21918, 6532, 732, 4565, 603, 277, 273, 374, 225, 468, 6562, 327, 981, 4519, 273, 1083, 225, 1323, 1053, 30, 277, 1011, 404, 225, 4519, 273, 1086, 67, 1918, 67, 4538, 12, 4172, 16, 2021, 13, 225, 309, 4519, 30, 898, 225, 309, 9453, 405, 374, 471, 277, 1545, 9453, 30, 613, 18, 1376, 2932, 1854, 434, 9453, 12428, 4207, 6142, 77, 3631, 21057, 731, 1199, 16, 9453, 13, 898, 225, 309, 272, 11182, 10650, 30, 613, 18, 1376, 2932, 20768, 310, 364, 2 ]

return t + data[9] - time.timezone

return t - data[9] - time.timezone

def mktime_tz(data): """Turn a 10-tuple as returned by parsedate_tz() into a UTC timestamp. Minor glitch: this first interprets the first 8 elements as a local time and then compensates for the timezone difference; this may yield a slight error around daylight savings time switch dates. Not enough to worry about for common use. """ t = time.mktime(data[:8] + (0,)) return t + data[9] - time.timezone

9aa8e8179b2162a324553202bc68d6aa11f490ac /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/3187/9aa8e8179b2162a324553202bc68d6aa11f490ac/rfc822.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 21977, 67, 12994, 12, 892, 4672, 3536, 15858, 279, 1728, 17, 8052, 487, 2106, 635, 1109, 712, 67, 12994, 1435, 1368, 279, 9951, 2858, 18, 225, 29007, 5118, 1437, 30, 333, 1122, 10634, 87, 326, 1122, 1725, 2186, 487, 279, 1191, 813, 471, 1508, 1161, 773, 815, 364, 326, 6371, 7114, 31, 333, 2026, 2824, 279, 20049, 555, 6740, 2548, 5099, 4087, 899, 813, 1620, 7811, 18, 225, 2288, 7304, 358, 26784, 2973, 364, 2975, 999, 18, 225, 3536, 268, 273, 813, 18, 24816, 957, 12, 892, 10531, 28, 65, 397, 261, 20, 16, 3719, 327, 268, 300, 501, 63, 29, 65, 300, 813, 18, 12690, 282, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 21977, 67, 12994, 12, 892, 4672, 3536, 15858, 279, 1728, 17, 8052, 487, 2106, 635, 1109, 712, 67, 12994, 1435, 1368, 279, 9951, 2858, 18, 225, 29007, 5118, 1437, 30, 333, 1122, 10634, 87, 326, 1122, 1725, 2186, 487, 279, 1191, 813, 471, 1508, 1161, 773, 815, 364, 326, 6371, 7114, 31, 333, 2026, 2824, 279, 20049, 555, 6740, 2548, 5099, 4087, 899, 813, 1620, 7811, 18, 225, 2288, 7304, 358, 26784, 2973, 364, 2975, 999, 18, 225, 3536, 268, 273, 813, 18, 24816, 957, 12, 892, 10531, 28, 65, 397, 261, 20, 16, 3719, 327, 268, 300, 501, 63, 29, 65, 300, 813, 18, 12690, 282, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]

self.colorkey(1)

if self["key_green"].getBoolean(): self.colorkey(1)

def keyGreen(self): self.colorkey(1)

71dcc2c21cb3488861444e6f4e82a25b77df70ed /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/6652/71dcc2c21cb3488861444e6f4e82a25b77df70ed/AudioSelection.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 498, 21453, 12, 2890, 4672, 365, 18, 1293, 778, 402, 12, 21, 13, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 498, 21453, 12, 2890, 4672, 365, 18, 1293, 778, 402, 12, 21, 13, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]

sage: latex(r(2))

def _latex_(self): r""" Return LaTeX representation of this R object.

42a77e19371576e2f0fa4a64916832f43f940a8c /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/9890/42a77e19371576e2f0fa4a64916832f43f940a8c/r.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 26264, 67, 12, 2890, 4672, 436, 8395, 2000, 21072, 21575, 60, 4335, 434, 333, 534, 733, 18, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 26264, 67, 12, 2890, 4672, 436, 8395, 2000, 21072, 21575, 60, 4335, 434, 333, 534, 733, 18, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]

if krawly == m.j or m.i == 0:

if krawlj == m.j or m.i == 0:

def movebaddy(enemy): "Tactical movement for the bad guys." next = coord(); look = coord() irun = False # This should probably be just (game.quadrant in game.state.kcmdr) + (game.state.kscmdr==game.quadrant) if game.skill >= SKILL_EXPERT: nbaddys = (((game.quadrant in game.state.kcmdr)*2 + (game.state.kscmdr==game.quadrant)*2+game.klhere*1.23+game.irhere*1.5)/2.0) else: nbaddys = (game.quadrant in game.state.kcmdr) + (game.state.kscmdr==game.quadrant) dist1 = enemy.kdist mdist = int(dist1 + 0.5); # Nearest integer distance # If SC, check with spy to see if should hi-tail it if enemy.type==IHS and \ (enemy.kpower <= 500.0 or (game.condition=="docked" and not damaged(DPHOTON))): irun = True motion = -QUADSIZE else: # decide whether to advance, retreat, or hold position forces = enemy.kpower+100.0*len(game.enemies)+400*(nbaddys-1) if not game.shldup: forces += 1000; # Good for enemy if shield is down! if not damaged(DPHASER) or not damaged(DPHOTON): if damaged(DPHASER): # phasers damaged forces += 300.0 else: forces -= 0.2*(game.energy - 2500.0) if damaged(DPHOTON): # photon torpedoes damaged forces += 300.0 else: forces -= 50.0*game.torps else: # phasers and photon tubes both out! forces += 1000.0 motion = 0 if forces <= 1000.0 and game.condition != "docked": # Typical situation motion = ((forces + randreal(200))/150.0) - 5.0 else: if forces > 1000.0: # Very strong -- move in for kill motion = (1.0 - randreal())**2 * dist1 + 1.0 if game.condition=="docked" and (game.options & OPTION_BASE): # protected by base -- back off ! motion -= game.skill*(2.0-randreal()**2) if idebug: proutn("=== MOTION = %d, FORCES = %1.2f, " % (motion, forces)) # don't move if no motion if motion==0: return # Limit motion according to skill if abs(motion) > game.skill: if motion < 0: motion = -game.skill else: motion = game.skill # calculate preferred number of steps if motion < 0: nsteps = -motion else: nsteps = motion if motion > 0 and nsteps > mdist: nsteps = mdist; # don't overshoot if nsteps > QUADSIZE: nsteps = QUADSIZE; # This shouldn't be necessary if nsteps < 1: nsteps = 1; # This shouldn't be necessary if idebug: proutn("NSTEPS = %d:" % nsteps) # Compute preferred values of delta X and Y m = game.sector - enemy.kloc if 2.0 * abs(m.i) < abs(m.j): m.i = 0 if 2.0 * abs(m.j) < abs(game.sector.i-enemy.kloc.i): m.j = 0 if m.i != 0: if m.i*motion < 0: m.i = -1 else: m.i = 1 if m.j != 0: if m.j*motion < 0: m.j = -1 else: m.j = 1 next = enemy.kloc # main move loop for ll in range(nsteps): if idebug: proutn(" %d" % (ll+1)) # Check if preferred position available look = next + m if m.i < 0: krawlx = 1 else: krawlx = -1 if m.j < 0: krawly = 1 else: krawly = -1 success = False attempts = 0; # Settle mysterious hang problem while attempts < 20 and not success: attempts += 1 if look.i < 0 or look.i >= QUADSIZE: if motion < 0 and tryexit(enemy, look, irun): return if krawlx == m.i or m.j == 0: break look.i = next.i + krawlx krawlx = -krawlx elif look.j < 0 or look.j >= QUADSIZE: if motion < 0 and tryexit(enemy, look, irun): return if krawly == m.j or m.i == 0: break look.j = next.j + krawly krawly = -krawly elif (game.options & OPTION_RAMMING) and game.quad[look.i][look.j] != IHDOT: # See if enemy should ram ship if game.quad[look.i][look.j] == game.ship and \ (enemy.type == IHC or enemy.type == IHS): collision(rammed=True, enemy=enemy) return if krawlx != m.i and m.j != 0: look.i = next.i + krawlx krawlx = -krawlx elif krawly != m.j and m.i != 0: look.j = next.j + krawly krawly = -krawly else: break; # we have failed else: success = True if success: next = look if idebug: proutn(`next`) else: break; # done early if idebug: skip(1) if enemy.move(next): if not damaged(DSRSENS) or game.condition == "docked": proutn(_("*** %s from Sector %s") % (cramen(enemy.type), enemy.kloc)) if enemy.kdist < dist1: proutn(_(" advances to ")) else: proutn(_(" retreats to ")) prout("Sector %s." % next)

9166a6df132fa18c32881b2019e1fcc41716a3ab /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/3176/9166a6df132fa18c32881b2019e1fcc41716a3ab/sst.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 3635, 70, 31934, 12, 275, 351, 93, 4672, 315, 56, 621, 1706, 26017, 364, 326, 5570, 3058, 1900, 1199, 1024, 273, 2745, 5621, 2324, 273, 2745, 1435, 277, 2681, 273, 1083, 468, 1220, 1410, 8656, 506, 2537, 261, 13957, 18, 21733, 6890, 316, 7920, 18, 2019, 18, 79, 4172, 86, 13, 397, 261, 13957, 18, 2019, 18, 79, 1017, 1264, 86, 631, 13957, 18, 21733, 6890, 13, 309, 7920, 18, 7771, 737, 1545, 12038, 15125, 67, 2294, 3194, 56, 30, 4264, 1289, 1900, 273, 261, 12443, 13957, 18, 21733, 6890, 316, 7920, 18, 2019, 18, 79, 4172, 86, 17653, 22, 397, 261, 13957, 18, 2019, 18, 79, 1017, 1264, 86, 631, 13957, 18, 21733, 6890, 17653, 22, 15, 13957, 18, 16391, 14852, 14, 21, 18, 4366, 15, 13957, 18, 481, 14852, 14, 21, 18, 25, 13176, 22, 18, 20, 13, 469, 30, 4264, 1289, 1900, 273, 261, 13957, 18, 21733, 6890, 316, 7920, 18, 2019, 18, 79, 4172, 86, 13, 397, 261, 13957, 18, 2019, 18, 79, 1017, 1264, 86, 631, 13957, 18, 21733, 6890, 13, 2411, 21, 273, 570, 351, 93, 18, 79, 4413, 3481, 376, 273, 509, 12, 4413, 21, 397, 374, 18, 25, 1769, 468, 7455, 8945, 3571, 3888, 468, 971, 8795, 16, 866, 598, 21459, 358, 2621, 309, 1410, 10118, 17, 13101, 518, 309, 570, 351, 93, 18, 723, 631, 45, 13173, 471, 521, 261, 275, 351, 93, 18, 79, 12238, 1648, 6604, 18, 20, 578, 261, 13957, 18, 4175, 31713, 72, 2 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 3635, 70, 31934, 12, 275, 351, 93, 4672, 315, 56, 621, 1706, 26017, 364, 326, 5570, 3058, 1900, 1199, 1024, 273, 2745, 5621, 2324, 273, 2745, 1435, 277, 2681, 273, 1083, 468, 1220, 1410, 8656, 506, 2537, 261, 13957, 18, 21733, 6890, 316, 7920, 18, 2019, 18, 79, 4172, 86, 13, 397, 261, 13957, 18, 2019, 18, 79, 1017, 1264, 86, 631, 13957, 18, 21733, 6890, 13, 309, 7920, 18, 7771, 737, 1545, 12038, 15125, 67, 2294, 3194, 56, 30, 4264, 1289, 1900, 273, 261, 12443, 13957, 18, 21733, 6890, 316, 7920, 18, 2019, 18, 79, 4172, 86, 17653, 22, 397, 261, 13957, 18, 2019, 18, 79, 1017, 1264, 86, 631, 13957, 18, 21733, 6890, 17653, 22, 15, 2 ]

plugin_api.AddToolbarItem(self.tb_button)

plugin_api.add_toolbar_item(self.button)

def activate(self, plugin_api): self.menu_item = gtk.MenuItem("Start task in Hamster") self.menu_item.connect('activate', self.browser_cb, plugin_api) self.tb_button=gtk.ToolButton() self.tb_button.set_label("Start") self.tb_button.set_icon_name('hamster-applet') self.tb_button.set_tooltip_text("Start a new activity in Hamster Time Tracker based on the selected task") self.tb_button.connect('clicked', self.browser_cb, plugin_api) # add a menu item to the menu bar plugin_api.AddMenuItem(self.menu_item) # saves the separator's index to later remove it self.separator = plugin_api.AddToolbarItem(gtk.SeparatorToolItem()) # add a item (button) to the ToolBar plugin_api.AddToolbarItem(self.tb_button)

7172602e6dde54005cdbf7139d595e8248bd20d0 /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/7036/7172602e6dde54005cdbf7139d595e8248bd20d0/hamster.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 10235, 12, 2890, 16, 1909, 67, 2425, 4672, 365, 18, 5414, 67, 1726, 273, 22718, 18, 12958, 2932, 1685, 1562, 316, 670, 301, 8190, 7923, 365, 18, 5414, 67, 1726, 18, 3612, 2668, 10014, 2187, 365, 18, 11213, 67, 7358, 16, 1909, 67, 2425, 13, 225, 365, 18, 18587, 67, 5391, 33, 4521, 79, 18, 6364, 3616, 1435, 365, 18, 18587, 67, 5391, 18, 542, 67, 1925, 2932, 1685, 7923, 365, 18, 18587, 67, 5391, 18, 542, 67, 3950, 67, 529, 2668, 31698, 8190, 17, 438, 1469, 6134, 365, 18, 18587, 67, 5391, 18, 542, 67, 19798, 67, 955, 2932, 1685, 279, 394, 5728, 316, 670, 301, 8190, 2647, 11065, 264, 2511, 603, 326, 3170, 1562, 7923, 365, 18, 18587, 67, 5391, 18, 3612, 2668, 7475, 329, 2187, 365, 18, 11213, 67, 7358, 16, 1909, 67, 2425, 13, 225, 468, 527, 279, 3824, 761, 358, 326, 3824, 4653, 1909, 67, 2425, 18, 986, 12958, 12, 2890, 18, 5414, 67, 1726, 13, 225, 468, 14649, 326, 4182, 1807, 770, 358, 5137, 1206, 518, 365, 18, 11287, 273, 1909, 67, 2425, 18, 986, 17907, 1180, 12, 4521, 79, 18, 6581, 6364, 1180, 10756, 468, 527, 279, 761, 261, 5391, 13, 358, 326, 13288, 5190, 1909, 67, 2425, 18, 986, 17907, 1180, 12, 2890, 18, 18587, 67, 5391, 13, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 10235, 12, 2890, 16, 1909, 67, 2425, 4672, 365, 18, 5414, 67, 1726, 273, 22718, 18, 12958, 2932, 1685, 1562, 316, 670, 301, 8190, 7923, 365, 18, 5414, 67, 1726, 18, 3612, 2668, 10014, 2187, 365, 18, 11213, 67, 7358, 16, 1909, 67, 2425, 13, 225, 365, 18, 18587, 67, 5391, 33, 4521, 79, 18, 6364, 3616, 1435, 365, 18, 18587, 67, 5391, 18, 542, 67, 1925, 2932, 1685, 7923, 365, 18, 18587, 67, 5391, 18, 542, 67, 3950, 67, 529, 2668, 31698, 8190, 17, 438, 1469, 6134, 365, 18, 18587, 67, 5391, 18, 542, 67, 19798, 67, 955, 2932, 1685, 279, 394, 5728, 316, 670, 301, 8190, 2647, 11065, 264, 2511, 603, 326, 3170, 1562, 7923, 365, 2 ]

if country.adminarea_set.filter(active=True).filter(Q(name=data.capitalize())|Q(abbrev=data.upper())).count() != 1:

if country.adminarea_set.filter(active=True).filter(Q(name=data)|Q(abbrev=data)|Q(name=data.capitalize())|Q(abbrev=data.upper())).count() != 1:

def clean_state(self): data = self.cleaned_data.get('state') if self._local_only: country = self._default_country else: country = self.fields['country'].clean(self.data['country']) if country.adminarea_set.filter(active=True).count() > 0: if not data or data == selection and not self._billing_data_optional: raise forms.ValidationError( self._local_only and _('This field is required.') \ or _('State is required for your country.')) if country.adminarea_set.filter(active=True).filter(Q(name=data.capitalize())|Q(abbrev=data.upper())).count() != 1: raise forms.ValidationError(_('Invalid state or province.')) return data

ee4e1486c68d9e1c6870b61b5e55c294fb67e2aa /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/13656/ee4e1486c68d9e1c6870b61b5e55c294fb67e2aa/forms.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 2721, 67, 2019, 12, 2890, 4672, 501, 273, 365, 18, 6200, 329, 67, 892, 18, 588, 2668, 2019, 6134, 309, 365, 6315, 3729, 67, 3700, 30, 5251, 273, 365, 6315, 1886, 67, 9082, 469, 30, 5251, 273, 365, 18, 2821, 3292, 9082, 29489, 6200, 12, 2890, 18, 892, 3292, 9082, 19486, 309, 5251, 18, 3666, 5036, 67, 542, 18, 2188, 12, 3535, 33, 5510, 2934, 1883, 1435, 405, 374, 30, 309, 486, 501, 578, 501, 422, 4421, 471, 486, 365, 6315, 16360, 67, 892, 67, 10444, 30, 1002, 10138, 18, 12101, 12, 365, 6315, 3729, 67, 3700, 471, 389, 2668, 2503, 652, 353, 1931, 1093, 13, 521, 578, 389, 2668, 1119, 353, 1931, 364, 3433, 5251, 1093, 3719, 309, 5251, 18, 3666, 5036, 67, 542, 18, 2188, 12, 3535, 33, 5510, 2934, 2188, 12, 53, 12, 529, 33, 892, 14047, 53, 12, 378, 27216, 33, 892, 14047, 53, 12, 529, 33, 892, 18, 5909, 7053, 554, 10756, 96, 53, 12, 378, 27216, 33, 892, 18, 5797, 10756, 2934, 1883, 1435, 480, 404, 30, 1002, 10138, 18, 12101, 24899, 2668, 1941, 919, 578, 17197, 2410, 1093, 3719, 327, 501, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 2721, 67, 2019, 12, 2890, 4672, 501, 273, 365, 18, 6200, 329, 67, 892, 18, 588, 2668, 2019, 6134, 309, 365, 6315, 3729, 67, 3700, 30, 5251, 273, 365, 6315, 1886, 67, 9082, 469, 30, 5251, 273, 365, 18, 2821, 3292, 9082, 29489, 6200, 12, 2890, 18, 892, 3292, 9082, 19486, 309, 5251, 18, 3666, 5036, 67, 542, 18, 2188, 12, 3535, 33, 5510, 2934, 1883, 1435, 405, 374, 30, 309, 486, 501, 578, 501, 422, 4421, 471, 486, 365, 6315, 16360, 67, 892, 67, 10444, 30, 1002, 10138, 18, 12101, 12, 365, 6315, 3729, 67, 3700, 471, 389, 2668, 2503, 652, 353, 1931, 1093, 13, 521, 578, 389, 2668, 1119, 353, 1931, 364, 3433, 5251, 1093, 3719, 2 ]

{'summary': 'Yo é'}]}

{ 'title': 'Yo é', 'summary': 'Yo é' }]}

def test_blog_entries(self, mock_feedparser_parse): mock_feedparser_parse.return_value = { 'entries': [ {'summary': 'Yo é'}]} entries = mysite.customs.feed._blog_entries() self.assertEqual(entries[0]['unicode_text'], u'Yo \xe9')

f50ea125e2e5610b3ed4d02dbf938f738eeffad7 /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/11976/f50ea125e2e5610b3ed4d02dbf938f738eeffad7/tests.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1842, 67, 11439, 67, 8219, 12, 2890, 16, 5416, 67, 7848, 4288, 67, 2670, 4672, 5416, 67, 7848, 4288, 67, 2670, 18, 2463, 67, 1132, 273, 288, 296, 8219, 4278, 306, 288, 296, 2649, 4278, 296, 61, 83, 473, 73, 1077, 624, 31, 2187, 296, 7687, 4278, 296, 61, 83, 473, 73, 1077, 624, 4359, 289, 18322, 3222, 273, 312, 1900, 1137, 18, 3662, 87, 18, 7848, 6315, 11439, 67, 8219, 1435, 365, 18, 11231, 5812, 12, 8219, 63, 20, 23962, 9124, 67, 955, 17337, 582, 11, 61, 83, 521, 6554, 29, 6134, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1842, 67, 11439, 67, 8219, 12, 2890, 16, 5416, 67, 7848, 4288, 67, 2670, 4672, 5416, 67, 7848, 4288, 67, 2670, 18, 2463, 67, 1132, 273, 288, 296, 8219, 4278, 306, 288, 296, 2649, 4278, 296, 61, 83, 473, 73, 1077, 624, 31, 2187, 296, 7687, 4278, 296, 61, 83, 473, 73, 1077, 624, 4359, 289, 18322, 3222, 273, 312, 1900, 1137, 18, 3662, 87, 18, 7848, 6315, 11439, 67, 8219, 1435, 365, 18, 11231, 5812, 12, 8219, 63, 20, 23962, 9124, 67, 955, 17337, 582, 11, 61, 83, 521, 6554, 29, 6134, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]

for x in ipath: cmd = cmd + ' -I"' + dotdots + x + '"'

for x in ipath: cmd = cmd + ' -I' + dotdots + x

def Interrogate(ipath=0, opts=0, outd=0, outc=0, src=0, module=0, library=0, files=0): if ((ipath==0)|(opts==0)|(outd==0)|(outc==0)|(src==0)|(module==0)|(library==0)|(files==0)): sys.exit("syntax error in Interrogate directive") ALLIN.append(outd) ipath = [PREFIX+"/tmp"] + ipath + [PREFIX+"/include"] outd = PREFIX+"/pandac/input/"+outd outc = PREFIX+"/tmp/"+outc paths = xpaths(src+"/",files,"") dep = CxxCalcDependenciesAll(paths, ipath) dotdots = "" for i in range(0,src.count("/")+1): dotdots = dotdots + "../" building = 0 for x in opts: if (x[:9]=="BUILDING_"): building = x[9:] if (older(outc, dep) or older(outd, dep)): if (COMPILER=="MSVC7"): cmd = '"' + dotdots + PREFIX+'/bin/interrogate.exe"' cmd = cmd + ' -DCPPPARSER -D__STDC__=1 -D__cplusplus -longlong __int64 -D_X86_ -DWIN32_VC -D_WIN32' cmd = cmd + ' -D"_declspec(param)=" -D_near -D_far -D__near -D__far -D__stdcall' if (OPTIMIZE==1): cmd = cmd + ' ' if (OPTIMIZE==2): cmd = cmd + ' ' if (OPTIMIZE==3): cmd = cmd + ' -DFORCE_INLINING' if (OPTIMIZE==4): cmd = cmd + ' -DFORCE_INLINING' cmd = cmd + ' -S"' + dotdots + PREFIX+'/include/parser-inc"' cmd = cmd + ' -I"' + dotdots + PREFIX+'/python/include"' if (COMPILER=="LINUXA"): cmd = '"' + dotdots + PREFIX + '/bin/interrogate"' cmd = cmd + ' -DCPPPARSER -D__STDC__=1 -D__cplusplus -D__i386__ -D__const=const' if (OPTIMIZE==1): cmd = cmd + ' ' if (OPTIMIZE==2): cmd = cmd + ' ' if (OPTIMIZE==3): cmd = cmd + ' ' if (OPTIMIZE==4): cmd = cmd + ' ' cmd = cmd + ' -S"' + dotdots + PREFIX+'/include/parser-inc" -S"/usr/include"' cmd = cmd + ' -I"' + dotdots + PREFIX+'/python/include"' cmd = cmd + ' -oc "' + dotdots + outc + '" -od "' + dotdots + outd + '"' cmd = cmd + ' -fnames -string -refcount -assert -python' for x in ipath: cmd = cmd + ' -I"' + dotdots + x + '"' if (building): cmd = cmd + " -DBUILDING_"+building if (opts.count("WITHINPANDA")): cmd = cmd + " -DWITHIN_PANDA" for pkg in PACKAGES: if (PkgSelected(opts,pkg)): cmd = cmd + ' -I"' + dotdots + THIRDPARTY + pkg.lower() + "/include" + '"' cmd = cmd + ' -module "' + module + '" -library "' + library + '"' if ((COMPILER=="MSVC7") and opts.count("DXSDK")): cmd = cmd + ' -I"' + DIRECTXSDK + '/include"' if ((COMPILER=="MSVC7") and opts.count("MAYA5")): cmd = cmd + ' -I"' + Maya5SDK + 'include"' if ((COMPILER=="MSVC7") and opts.count("MAYA6")): cmd = cmd + ' -I"' + Maya6SDK + 'include"' for x in files: cmd = cmd + ' ' + x oslocalcmd(src, cmd) updatefiledate(outd) updatefiledate(outc)

e743cb25c4127c99b6bf2de385cf618b18e32531 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/7242/e743cb25c4127c99b6bf2de385cf618b18e32531/makepanda.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 5294, 15283, 12, 625, 421, 33, 20, 16, 1500, 33, 20, 16, 596, 72, 33, 20, 16, 596, 71, 33, 20, 16, 1705, 33, 20, 16, 1605, 33, 20, 16, 5313, 33, 20, 16, 1390, 33, 20, 4672, 309, 14015, 625, 421, 631, 20, 14047, 12, 4952, 631, 20, 14047, 12, 659, 72, 631, 20, 14047, 12, 659, 71, 631, 20, 14047, 12, 4816, 631, 20, 14047, 12, 2978, 631, 20, 14047, 12, 12083, 631, 20, 14047, 12, 2354, 631, 20, 3719, 30, 2589, 18, 8593, 2932, 14308, 555, 316, 5294, 15283, 8655, 7923, 8061, 706, 18, 6923, 12, 659, 72, 13, 277, 803, 273, 306, 6307, 9078, 19, 5645, 11929, 397, 277, 803, 397, 306, 6307, 9078, 19, 6702, 11929, 596, 72, 273, 17154, 9078, 19, 84, 464, 1077, 19, 2630, 4898, 15, 659, 72, 596, 71, 273, 17154, 9078, 19, 5645, 4898, 15, 659, 71, 2953, 273, 619, 4481, 12, 4816, 9078, 19, 3113, 2354, 16, 3660, 13, 5993, 273, 385, 5279, 25779, 8053, 1595, 12, 4481, 16, 277, 803, 13, 3928, 72, 6968, 273, 1408, 364, 277, 316, 1048, 12, 20, 16, 4816, 18, 1883, 2932, 4898, 27921, 21, 4672, 3928, 72, 6968, 273, 3928, 72, 6968, 397, 315, 838, 4898, 10504, 273, 374, 364, 619, 316, 1500, 30, 309, 261, 92, 10531, 29, 65, 31713, 20215, 1360, 9548, 4672, 10504, 273, 619, 63, 29, 26894, 309, 261, 1498, 12, 659, 71, 16, 5993, 13, 578, 12156, 12, 659, 72, 16, 5993, 3719, 2 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 5294, 15283, 12, 625, 421, 33, 20, 16, 1500, 33, 20, 16, 596, 72, 33, 20, 16, 596, 71, 33, 20, 16, 1705, 33, 20, 16, 1605, 33, 20, 16, 5313, 33, 20, 16, 1390, 33, 20, 4672, 309, 14015, 625, 421, 631, 20, 14047, 12, 4952, 631, 20, 14047, 12, 659, 72, 631, 20, 14047, 12, 659, 71, 631, 20, 14047, 12, 4816, 631, 20, 14047, 12, 2978, 631, 20, 14047, 12, 12083, 631, 20, 14047, 12, 2354, 631, 20, 3719, 30, 2589, 18, 8593, 2932, 14308, 555, 316, 5294, 15283, 8655, 7923, 8061, 706, 18, 6923, 12, 659, 72, 13, 277, 803, 273, 306, 6307, 9078, 19, 5645, 11929, 397, 277, 803, 397, 306, 6307, 9078, 2 ]

self._write(self.write_term_index, directory, 'term-index.html', indices)

self._write(self.write_link_index, directory, 'term-index.html', indices, 'Term Definition Index', 'term-index.html', 'term')

def write(self, directory=None): """ Write the documentation to the given directory.

5c410b5b6e25df3bdbc6da266f7773518165cb02 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/3512/5c410b5b6e25df3bdbc6da266f7773518165cb02/html.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1045, 12, 2890, 16, 1867, 33, 7036, 4672, 3536, 2598, 326, 7323, 358, 326, 864, 1867, 18, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1045, 12, 2890, 16, 1867, 33, 7036, 4672, 3536, 2598, 326, 7323, 358, 326, 864, 1867, 18, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]

self.model["card"] = zdc.ObjectView(card)

self.model["card"] = [zdc.ObjectView(card)]

def act_confirm(self): import zebra, zdc #@TODO: make a .fromDict or .consult for zdc.RecordObjects # for now, we'll assume this is okay, since the classes have # already validated everything in here: bill = zikebase.Contact(); bill._data = self.billData ship = zikebase.Contact(); ship._data = self.shipData card = zikeshop.Card(); card._data = self.cardData

8f9da0ecdf1f4ffe43c7c8552ad5e88ade81637e /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/8821/8f9da0ecdf1f4ffe43c7c8552ad5e88ade81637e/checkout.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1328, 67, 10927, 12, 2890, 4672, 1930, 26637, 15397, 16, 998, 7201, 468, 36, 6241, 30, 1221, 279, 263, 2080, 5014, 578, 263, 8559, 406, 364, 998, 7201, 18, 2115, 4710, 468, 364, 2037, 16, 732, 5614, 6750, 333, 353, 21194, 16, 3241, 326, 3318, 1240, 468, 1818, 10266, 7756, 316, 2674, 30, 20714, 273, 998, 2547, 1969, 18, 6567, 5621, 20714, 6315, 892, 273, 365, 18, 17240, 751, 24316, 273, 998, 2547, 1969, 18, 6567, 5621, 24316, 6315, 892, 273, 365, 18, 3261, 751, 5270, 273, 998, 1766, 4607, 556, 18, 6415, 5621, 5270, 6315, 892, 273, 365, 18, 3327, 751, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1328, 67, 10927, 12, 2890, 4672, 1930, 26637, 15397, 16, 998, 7201, 468, 36, 6241, 30, 1221, 279, 263, 2080, 5014, 578, 263, 8559, 406, 364, 998, 7201, 18, 2115, 4710, 468, 364, 2037, 16, 732, 5614, 6750, 333, 353, 21194, 16, 3241, 326, 3318, 1240, 468, 1818, 10266, 7756, 316, 2674, 30, 20714, 273, 998, 2547, 1969, 18, 6567, 5621, 20714, 6315, 892, 273, 365, 18, 17240, 751, 24316, 273, 998, 2547, 1969, 18, 6567, 5621, 24316, 6315, 892, 273, 365, 18, 3261, 751, 5270, 273, 998, 1766, 4607, 556, 18, 6415, 5621, 5270, 6315, 892, 273, 365, 18, 3327, 751, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]

class DocstringTestCase(unittest.TestCase):

class DocstringTestCase(SecureTestCase):

def getModuleObjects(folder, rootName, typ): "Get a list of all function objects defined *somewhere* in a package." folders = [folder] + subFoldersOfFolder(folder) objects = [] for f in folders: sys.path.insert(0, f) os.chdir(f) pattern = os.path.join('*.py') prefix = f[string.find(f, rootName):] prefix = string.replace(prefix, os.sep, '.') modNames = glob.glob(pattern) modNames = filter(lambda m:string.find(m, '__init__.py') == -1, modNames) # Make module names fully qualified. for i in range(len(modNames)): modNames[i] = prefix + '.' + modNames[i][:string.find(modNames[i], '.')] for mName in modNames: module = __import__(mName) # Get the 'real' (leaf) module # (__import__ loads only the top-level one). if string.find(mName, '.') != -1: for part in string.split(mName, '.')[1:]: module = getattr(module, part) # Find the objects in the module's content. modContentNames = dir(module) # Handle modules. if typ == types.ModuleType: if string.find(module.__name__, 'reportlab') > -1: objects.append((mName, module)) continue for n in modContentNames: obj = eval(mName + '.' + n) # Handle functions and classes. if typ in (types.FunctionType, types.ClassType): if type(obj) == typ: objects.append((mName, obj)) # Handle methods. elif typ == types.MethodType: if type(obj) == types.ClassType: for m in dir(obj): a = getattr(obj, m) if type(a) == typ: cName = obj.__name__ objects.append(("%s.%s" % (mName, cName), a)) del sys.path[0] return objects

b5a2e28469e8eb9f8edf3d66ca5ecf2c5f7f3905 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/3878/b5a2e28469e8eb9f8edf3d66ca5ecf2c5f7f3905/test_docstrings.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 11251, 4710, 12, 5609, 16, 1365, 461, 16, 3815, 4672, 315, 967, 279, 666, 434, 777, 445, 2184, 2553, 380, 87, 362, 359, 14852, 14, 316, 279, 2181, 1199, 225, 9907, 273, 306, 5609, 65, 397, 720, 14885, 951, 3899, 12, 5609, 13, 225, 2184, 273, 5378, 364, 284, 316, 9907, 30, 2589, 18, 803, 18, 6387, 12, 20, 16, 284, 13, 1140, 18, 343, 1214, 12, 74, 13, 1936, 273, 1140, 18, 803, 18, 5701, 2668, 11146, 2074, 6134, 1633, 273, 284, 63, 1080, 18, 4720, 12, 74, 16, 1365, 461, 4672, 65, 1633, 273, 533, 18, 2079, 12, 3239, 16, 1140, 18, 10814, 16, 2611, 13, 681, 1557, 273, 4715, 18, 10581, 12, 4951, 13, 681, 1557, 273, 1034, 12, 14661, 312, 30, 1080, 18, 4720, 12, 81, 16, 4940, 2738, 25648, 2074, 6134, 422, 300, 21, 16, 681, 1557, 13, 468, 4344, 1605, 1257, 7418, 9348, 18, 364, 277, 316, 1048, 12, 1897, 12, 1711, 1557, 3719, 30, 681, 1557, 63, 77, 65, 273, 1633, 397, 2611, 397, 681, 1557, 63, 77, 6362, 30, 1080, 18, 4720, 12, 1711, 1557, 63, 77, 6487, 2611, 25887, 364, 312, 461, 316, 681, 1557, 30, 1605, 273, 1001, 5666, 972, 12, 81, 461, 13, 468, 968, 326, 296, 7688, 11, 261, 12070, 13, 1605, 468, 261, 972, 5666, 972, 6277, 1338, 326, 1760, 17, 2815, 1245, 2934, 309, 533, 18, 4720, 12, 81, 461, 16, 2611, 13, 480, 300, 21, 30, 364, 1087, 316, 533, 18, 2 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 11251, 4710, 12, 5609, 16, 1365, 461, 16, 3815, 4672, 315, 967, 279, 666, 434, 777, 445, 2184, 2553, 380, 87, 362, 359, 14852, 14, 316, 279, 2181, 1199, 225, 9907, 273, 306, 5609, 65, 397, 720, 14885, 951, 3899, 12, 5609, 13, 225, 2184, 273, 5378, 364, 284, 316, 9907, 30, 2589, 18, 803, 18, 6387, 12, 20, 16, 284, 13, 1140, 18, 343, 1214, 12, 74, 13, 1936, 273, 1140, 18, 803, 18, 5701, 2668, 11146, 2074, 6134, 1633, 273, 284, 63, 1080, 18, 4720, 12, 74, 16, 1365, 461, 4672, 65, 1633, 273, 533, 18, 2079, 12, 3239, 16, 1140, 18, 10814, 16, 2611, 13, 681, 1557, 273, 4715, 18, 10581, 12, 4951, 13, 681, 2 ]

FakeProxyHandler.digest_auth_handler.set_qop("auth")

self.digest_auth_handler.set_qop("auth")

def test_proxy_with_bad_password_raises_httperror(self): self._digest_auth_handler.add_password(self.REALM, self.URL, self.USER, self.PASSWD+"bad") FakeProxyHandler.digest_auth_handler.set_qop("auth") self.assertRaises(urllib2.HTTPError, self.opener.open, self.URL)

f03c42f0ab4b4fc0705e2717a89af1254820fed3 /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/8546/f03c42f0ab4b4fc0705e2717a89af1254820fed3/test_urllib2_localnet.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1842, 67, 5656, 67, 1918, 67, 8759, 67, 3664, 67, 354, 6141, 67, 2505, 1636, 12, 2890, 4672, 365, 6315, 10171, 67, 1944, 67, 4176, 18, 1289, 67, 3664, 12, 2890, 18, 31052, 49, 16, 365, 18, 1785, 16, 365, 18, 4714, 16, 365, 18, 10884, 16006, 9078, 8759, 7923, 365, 18, 10171, 67, 1944, 67, 4176, 18, 542, 67, 85, 556, 2932, 1944, 7923, 365, 18, 11231, 12649, 6141, 12, 718, 2941, 22, 18, 3693, 668, 16, 365, 18, 25098, 18, 3190, 16, 365, 18, 1785, 13, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1842, 67, 5656, 67, 1918, 67, 8759, 67, 3664, 67, 354, 6141, 67, 2505, 1636, 12, 2890, 4672, 365, 6315, 10171, 67, 1944, 67, 4176, 18, 1289, 67, 3664, 12, 2890, 18, 31052, 49, 16, 365, 18, 1785, 16, 365, 18, 4714, 16, 365, 18, 10884, 16006, 9078, 8759, 7923, 365, 18, 10171, 67, 1944, 67, 4176, 18, 542, 67, 85, 556, 2932, 1944, 7923, 365, 18, 11231, 12649, 6141, 12, 718, 2941, 22, 18, 3693, 668, 16, 365, 18, 25098, 18, 3190, 16, 365, 18, 1785, 13, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]

def test_chainHandling(self): """PDBModel chain handling and writing test"""

def test_chainBreaks(self): """PDBModel chain break handling and writing test"""

def test_chainHandling(self): """PDBModel chain handling and writing test""" self.m4 = B.PDBModel( T.testRoot()+'/com/1BGS_original.pdb') self.assertEqual( self.m4.lenChains(), 9 ) self.assertEqual( self.m4.lenChains( breaks=1 ), 138 ) self.m4.writePdb( self.fout_pdb, ter=2 )

d1c3d5f9c43c1af7d5e068db8407753d7aed3a40 /local1/tlutelli/issta_data/temp/all_python//python/2007_temp/2007/482/d1c3d5f9c43c1af7d5e068db8407753d7aed3a40/PDBModel.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1842, 67, 5639, 26806, 12, 2890, 4672, 3536, 52, 2290, 1488, 2687, 898, 5057, 471, 7410, 1842, 8395, 365, 18, 81, 24, 273, 605, 18, 52, 2290, 1488, 12, 399, 18, 3813, 2375, 1435, 6797, 19, 832, 19, 21, 38, 16113, 67, 8830, 18, 17414, 6134, 365, 18, 11231, 5812, 12, 365, 18, 81, 24, 18, 1897, 15945, 9334, 2468, 262, 365, 18, 11231, 5812, 12, 365, 18, 81, 24, 18, 1897, 15945, 12, 16217, 33, 21, 262, 16, 5958, 28, 262, 365, 18, 81, 24, 18, 2626, 52, 1966, 12, 365, 18, 617, 322, 67, 17414, 16, 19272, 33, 22, 262, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1842, 67, 5639, 26806, 12, 2890, 4672, 3536, 52, 2290, 1488, 2687, 898, 5057, 471, 7410, 1842, 8395, 365, 18, 81, 24, 273, 605, 18, 52, 2290, 1488, 12, 399, 18, 3813, 2375, 1435, 6797, 19, 832, 19, 21, 38, 16113, 67, 8830, 18, 17414, 6134, 365, 18, 11231, 5812, 12, 365, 18, 81, 24, 18, 1897, 15945, 9334, 2468, 262, 365, 18, 11231, 5812, 12, 365, 18, 81, 24, 18, 1897, 15945, 12, 16217, 33, 21, 262, 16, 5958, 28, 262, 365, 18, 81, 24, 18, 2626, 52, 1966, 12, 365, 18, 617, 322, 67, 17414, 16, 19272, 33, 22, 262, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]

if self._sampleNum < 60*60:

if self._memSampleNum < 60*60:

def _nextMemSample(self): curUsage = self._getValue() self._usage.append(curUsage) maxUsage = self._maxUsage[-1] if curUsage>maxUsage: maxUsage = curUsage lastMaxChangeTime = time.time() self._textNode1.text = ("Last increase in maximum: " +time.strftime("%H:%M:%S", time.localtime(lastMaxChangeTime))) self._maxUsage.append(maxUsage) self._sampleNum += 1 if self._sampleNum % 60 == 0: lastMinuteAverage = sum(self._usage[-60:])/60 self._minutesUsage.append(lastMinuteAverage) self._minutesMaxUsage.append(maxUsage)

5db631b9081e9af0ba5615613d6fbe26fed5b363 /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/7300/5db631b9081e9af0ba5615613d6fbe26fed5b363/AVGAppStarter.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 4285, 3545, 8504, 12, 2890, 4672, 662, 5357, 273, 365, 6315, 24805, 1435, 365, 6315, 9167, 18, 6923, 12, 1397, 5357, 13, 943, 5357, 273, 365, 6315, 1896, 5357, 18919, 21, 65, 309, 662, 5357, 34, 1896, 5357, 30, 943, 5357, 273, 662, 5357, 1142, 2747, 3043, 950, 273, 813, 18, 957, 1435, 365, 6315, 955, 907, 21, 18, 955, 273, 7566, 3024, 10929, 316, 4207, 30, 315, 397, 957, 18, 701, 9982, 27188, 44, 5319, 49, 5319, 55, 3113, 813, 18, 3729, 957, 12, 2722, 2747, 3043, 950, 20349, 365, 6315, 1896, 5357, 18, 6923, 12, 1896, 5357, 13, 365, 6315, 6358, 2578, 1011, 404, 309, 365, 6315, 6358, 2578, 738, 4752, 422, 374, 30, 1142, 18329, 17115, 273, 2142, 12, 2890, 6315, 9167, 18919, 4848, 30, 5717, 19, 4848, 365, 6315, 17916, 5357, 18, 6923, 12, 2722, 18329, 17115, 13, 365, 6315, 17916, 2747, 5357, 18, 6923, 12, 1896, 5357, 13, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 4285, 3545, 8504, 12, 2890, 4672, 662, 5357, 273, 365, 6315, 24805, 1435, 365, 6315, 9167, 18, 6923, 12, 1397, 5357, 13, 943, 5357, 273, 365, 6315, 1896, 5357, 18919, 21, 65, 309, 662, 5357, 34, 1896, 5357, 30, 943, 5357, 273, 662, 5357, 1142, 2747, 3043, 950, 273, 813, 18, 957, 1435, 365, 6315, 955, 907, 21, 18, 955, 273, 7566, 3024, 10929, 316, 4207, 30, 315, 397, 957, 18, 701, 9982, 27188, 44, 5319, 49, 5319, 55, 3113, 813, 18, 3729, 957, 12, 2722, 2747, 3043, 950, 20349, 365, 6315, 1896, 5357, 18, 6923, 12, 1896, 5357, 13, 365, 6315, 6358, 2578, 1011, 404, 309, 365, 6315, 6358, 2578, 738, 4752, 422, 374, 30, 1142, 2 ]

if po.arch != installed_pkg.arch and (isMultiLibArch(po.arch) or isMultiLibArch(installed_pkg.arch)):

if (po.arch != installed_pkg.arch and (rpmUtils.arch.isMultiLibArch(po.arch) or rpmUtils.arch.isMultiLibArch(installed_pkg.arch))):

def installLocal(self, pkg, po=None, updateonly=False): """ handles installs/updates of rpms provided on the filesystem in a local dir (ie: not from a repo)

ec1fb3b9c8487a021e86a34d3a3b0d580a5ac49e /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/5445/ec1fb3b9c8487a021e86a34d3a3b0d580a5ac49e/__init__.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 3799, 2042, 12, 2890, 16, 3475, 16, 8275, 33, 7036, 16, 1089, 3700, 33, 8381, 4672, 3536, 7372, 31011, 19, 14703, 434, 8715, 959, 2112, 603, 326, 6496, 316, 279, 1191, 1577, 261, 1385, 30, 486, 628, 279, 3538, 13, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 3799, 2042, 12, 2890, 16, 3475, 16, 8275, 33, 7036, 16, 1089, 3700, 33, 8381, 4672, 3536, 7372, 31011, 19, 14703, 434, 8715, 959, 2112, 603, 326, 6496, 316, 279, 1191, 1577, 261, 1385, 30, 486, 628, 279, 3538, 13, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]

debug(" domain %s is in user block-list", cookie.domain)

_debug(" domain %s is in user block-list", cookie.domain)

def set_ok_domain(self, cookie, request): if self.is_blocked(cookie.domain): debug(" domain %s is in user block-list", cookie.domain) return False if self.is_not_allowed(cookie.domain): debug(" domain %s is not in user allow-list", cookie.domain) return False if cookie.domain_specified: req_host, erhn = eff_request_host(request) domain = cookie.domain if self.strict_domain and (domain.count(".") >= 2): # XXX This should probably be compared with the Konqueror # (kcookiejar.cpp) and Mozilla implementations, but it's a # losing battle. i = domain.rfind(".") j = domain.rfind(".", 0, i) if j == 0: # domain like .foo.bar tld = domain[i+1:] sld = domain[j+1:i] if sld.lower() in ("co", "ac", "com", "edu", "org", "net", "gov", "mil", "int", "aero", "biz", "cat", "coop", "info", "jobs", "mobi", "museum", "name", "pro", "travel", "eu") and len(tld) == 2: # domain like .co.uk debug(" country-code second level domain %s", domain) return False if domain.startswith("."): undotted_domain = domain[1:] else: undotted_domain = domain embedded_dots = (undotted_domain.find(".") >= 0) if not embedded_dots and domain != ".local": debug(" non-local domain %s contains no embedded dot", domain) return False if cookie.version == 0: if (not erhn.endswith(domain) and (not erhn.startswith(".") and not ("."+erhn).endswith(domain))): debug(" effective request-host %s (even with added " "initial dot) does not end end with %s", erhn, domain) return False if (cookie.version > 0 or (self.strict_ns_domain & self.DomainRFC2965Match)): if not domain_match(erhn, domain): debug(" effective request-host %s does not domain-match " "%s", erhn, domain) return False if (cookie.version > 0 or (self.strict_ns_domain & self.DomainStrictNoDots)): host_prefix = req_host[:-len(domain)] if (host_prefix.find(".") >= 0 and not IPV4_RE.search(req_host)): debug(" host prefix %s for domain %s contains a dot", host_prefix, domain) return False return True

feb0a3bdbccc7b45bc8b960aa4c3434838b52d05 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/8546/feb0a3bdbccc7b45bc8b960aa4c3434838b52d05/cookielib.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 444, 67, 601, 67, 4308, 12, 2890, 16, 3878, 16, 590, 4672, 309, 365, 18, 291, 67, 23156, 12, 8417, 18, 4308, 4672, 389, 4148, 2932, 282, 2461, 738, 87, 353, 316, 729, 1203, 17, 1098, 3113, 3878, 18, 4308, 13, 327, 1083, 309, 365, 18, 291, 67, 902, 67, 8151, 12, 8417, 18, 4308, 4672, 1198, 2932, 282, 2461, 738, 87, 353, 486, 316, 729, 1699, 17, 1098, 3113, 3878, 18, 4308, 13, 327, 1083, 309, 3878, 18, 4308, 67, 13827, 30, 1111, 67, 2564, 16, 6445, 76, 82, 273, 16419, 67, 2293, 67, 2564, 12, 2293, 13, 2461, 273, 3878, 18, 4308, 309, 365, 18, 13948, 67, 4308, 471, 261, 4308, 18, 1883, 2932, 1199, 13, 1545, 576, 4672, 468, 11329, 1220, 1410, 8656, 506, 15843, 598, 326, 1475, 265, 25734, 280, 468, 261, 79, 8417, 11930, 18, 4057, 84, 13, 471, 19058, 10745, 16164, 16, 1496, 518, 1807, 279, 468, 437, 2470, 324, 4558, 298, 18, 277, 273, 2461, 18, 86, 4720, 2932, 1199, 13, 525, 273, 2461, 18, 86, 4720, 2932, 1199, 16, 374, 16, 277, 13, 309, 525, 422, 374, 30, 225, 468, 2461, 3007, 263, 11351, 18, 3215, 23373, 273, 2461, 63, 77, 15, 21, 26894, 272, 1236, 273, 2461, 63, 78, 15, 21, 30, 77, 65, 309, 272, 1236, 18, 8167, 1435, 316, 7566, 2894, 3113, 315, 1077, 3113, 315, 832, 3113, 315, 28049, 3113, 315, 3341, 3113, 315, 2758, 3113, 315, 75, 1527, 3113, 315, 81, 330, 3113, 2 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 444, 67, 601, 67, 4308, 12, 2890, 16, 3878, 16, 590, 4672, 309, 365, 18, 291, 67, 23156, 12, 8417, 18, 4308, 4672, 389, 4148, 2932, 282, 2461, 738, 87, 353, 316, 729, 1203, 17, 1098, 3113, 3878, 18, 4308, 13, 327, 1083, 309, 365, 18, 291, 67, 902, 67, 8151, 12, 8417, 18, 4308, 4672, 1198, 2932, 282, 2461, 738, 87, 353, 486, 316, 729, 1699, 17, 1098, 3113, 3878, 18, 4308, 13, 327, 1083, 309, 3878, 18, 4308, 67, 13827, 30, 1111, 67, 2564, 16, 6445, 76, 82, 273, 16419, 67, 2293, 67, 2564, 12, 2293, 13, 2461, 273, 3878, 18, 4308, 309, 365, 18, 13948, 67, 4308, 471, 261, 4308, 18, 1883, 2932, 1199, 13, 2 ]

print "str: %s" % self.description

if self.verbose: print "str: %s" % self.description

def unserializeExtra(self,data): print "found %d extra bytes." % len(data)

5ec5c46b0b6b12f6dd38c8d54dc0815bac382b0e /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/8136/5ec5c46b0b6b12f6dd38c8d54dc0815bac382b0e/pyemf.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 10954, 7800, 12, 2890, 16, 892, 4672, 1172, 315, 7015, 738, 72, 2870, 1731, 1199, 738, 562, 12, 892, 13, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 10954, 7800, 12, 2890, 16, 892, 4672, 1172, 315, 7015, 738, 72, 2870, 1731, 1199, 738, 562, 12, 892, 13, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]

musicianship.play_instrument( char, instrument, result )

skills.musicianship.play_instrument( char, instrument, result )

def response( char, args, target ): if not char.socket.hastag( 'peacemaking_instrument' ): return 0 # you can only target chars if not target.char: return 1 instrument = wolfpack.finditem( char.socket.gettag( 'peacemaking_instrument' ) ) if not instrument: return 0 if skills.skilltable[ PEACEMAKING ][ skills.UNHIDE ] and char.hidden: char.removefromview() char.hidden = False char.update() char.socket.deltag( 'peacemaking_instrument' ) char.socket.settag( 'skill_delay', int( wolfpack.time.currenttime() + PEACE_DELAY ) ) # if target him/her self : standard (regional) mode # anyone including npcs can re-target and start fight peace_range = skills.musicianship.bard_range( char ) if char == target.char: result = char.checkskill( MUSICIANSHIP, 0, 1000 ) musicianship.play_instrument( char, instrument, result ) # fail to play well if not result: char.socket.clilocmessage( 500612, "", 0x3b2, 3 ) return 1 result = char.checkskill( PEACEMAKING, 0, 1000 ) # fail on peacemaking if not result: char.socket.clilocmessage( 500613, "", 0x3b2, 3 ) return 1 char.socket.clilocmessage( 500615, "", 0x3b2, 3 ) creatures = wolfpack.chars( char.pos.x, char.pos.y, char.pos.map, peace_range ) for creature in creatures: if char.canreach( creature, peace_range ): # stop combat # player chars if creature.socket: creature.socket.clilocmessage( 500616, "", 0x3b2, 3 ) # target on an npc - effect will go some duration else: if char.canreach( target.char, peace_range ): char.socket.clilocmessage( 500618, "", 0x3b2, 3 ) return 1 if not target.char.npc: return 1 # bard difficulty - later, we should get these from the xml defs. loskill = 0 hiskill = 1000 result = char.checkskill( MUSICIANSHIP, loskill, hiskill ) musicianship.play_instrument( char, instrument, result ) if not result: char.socket.clilocmessage( 500612, "", 0x3b2, 3 ) return 1 result = char.checkskill( PEACEMAKING, loskill, hiskill ) if not result: char.socket.clilocmessage( 500613, "", 0x3b2, 3 ) return 1 # FIXME : duration ( 5 sec ~ 65 sec ) duration = 5000 + char.skill[ PEACEMAKING ] * 60 # stop combat # if npc, do not start combat for the duration while not attacked creature.settag( 'peacemaking', 1 ) creature.addtimer( duration, release, [] ) return 1

ad2fb5c1af41304c615892963957d7cff3e3439e /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/2534/ad2fb5c1af41304c615892963957d7cff3e3439e/peacemaking.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 766, 12, 1149, 16, 833, 16, 1018, 262, 30, 309, 486, 1149, 18, 7814, 18, 76, 689, 346, 12, 296, 347, 623, 19718, 67, 22818, 11, 262, 30, 327, 374, 468, 1846, 848, 1338, 1018, 5230, 309, 486, 1018, 18, 3001, 30, 327, 404, 10353, 273, 341, 355, 74, 2920, 18, 4720, 1726, 12, 1149, 18, 7814, 18, 588, 2692, 12, 296, 347, 623, 19718, 67, 22818, 11, 262, 262, 309, 486, 10353, 30, 327, 374, 225, 309, 15667, 87, 18, 7771, 737, 2121, 63, 16628, 6312, 5535, 47, 1360, 308, 63, 15667, 87, 18, 2124, 44, 10385, 308, 471, 1149, 18, 6345, 30, 1149, 18, 4479, 2080, 1945, 1435, 1149, 18, 6345, 273, 1083, 1149, 18, 2725, 1435, 225, 1149, 18, 7814, 18, 3771, 2692, 12, 296, 347, 623, 19718, 67, 22818, 11, 262, 1149, 18, 7814, 18, 542, 2692, 12, 296, 7771, 737, 67, 10790, 2187, 509, 12, 341, 355, 74, 2920, 18, 957, 18, 2972, 957, 1435, 397, 16628, 6312, 67, 26101, 262, 262, 225, 468, 309, 1018, 366, 381, 19, 1614, 365, 294, 4529, 261, 6858, 287, 13, 1965, 468, 1281, 476, 6508, 1130, 2143, 848, 283, 17, 3299, 471, 787, 284, 750, 2804, 623, 67, 3676, 273, 15667, 87, 18, 81, 407, 14463, 634, 5310, 18, 70, 1060, 67, 3676, 12, 1149, 262, 309, 1149, 422, 1018, 18, 3001, 30, 563, 273, 1149, 18, 1893, 7771, 737, 12, 490, 57, 2320, 7266, 1258, 20101, 16, 374, 16, 4336, 262, 15667, 87, 2 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 766, 12, 1149, 16, 833, 16, 1018, 262, 30, 309, 486, 1149, 18, 7814, 18, 76, 689, 346, 12, 296, 347, 623, 19718, 67, 22818, 11, 262, 30, 327, 374, 468, 1846, 848, 1338, 1018, 5230, 309, 486, 1018, 18, 3001, 30, 327, 404, 10353, 273, 341, 355, 74, 2920, 18, 4720, 1726, 12, 1149, 18, 7814, 18, 588, 2692, 12, 296, 347, 623, 19718, 67, 22818, 11, 262, 262, 309, 486, 10353, 30, 327, 374, 225, 309, 15667, 87, 18, 7771, 737, 2121, 63, 16628, 6312, 5535, 47, 1360, 308, 63, 15667, 87, 18, 2124, 44, 10385, 308, 471, 1149, 18, 6345, 30, 1149, 18, 4479, 2080, 1945, 1435, 1149, 18, 6345, 273, 1083, 1149, 18, 2725, 2 ]

pbuffer(True,define_buffer)

pbufferStr(define_buffer + "\n")

def parseSource(sfile, vars_dict): i = 0; #line counter in_v_comment = False; #Flag for lines inside a verilog comment block in_p_block = False; #Flag for lines inside a preprocessor block #Run through the file character by character using a DFA state = DEFAULT # State variable err_code = NOERR # Code variable for syntax errors pre_seg_begin_line = 0 # Line number of a preprocessor section start v_com_begin_line = 0 # Line number of a Verilog block comment start pre_expr_begin_line = 0 # Line number of a preprocessor expression start line_count = 0 # Current line number char_count = 0 # Current character number (in line) pre_seg_buffer = "" # Character buffer for preprocessor segments pre_expr_buffer = "" # Character buffer for preprocessor expressions define_buffer = "" # Character buffer for DEFINE statements sfile.seek(0) char = sfile.read(1) while char and state != ERROR: # DEFAULT if state == DEFAULT: if char == "/": state = DEF_FOUND_FSLASH pbuffer(False,char) elif char == "%": state = PRE_COM elif char == "`": state = DEFINE pbuffer(False,char) elif char == "<": state = DEF_FOUND_LCARET else: pbuffer(False,char) # DEF_FOUND_FSLASH elif state == DEF_FOUND_FSLASH: if char == "*": state = V_COM v_com_begin_line = line_count pbuffer(False,char) elif char == "/": state = V_COM_LINE pbuffer(False,char) else: state = DEFAULT pbuffer(False,char) # V_COM_LINE elif state == V_COM_LINE: if char == "\n": state = DEFAULT pbuffer(False,char) # V_COM elif state == V_COM: if char == "*": state = V_COM_FOUND_AST pbuffer(False,char) # V_COM_FOUND_AST elif state == V_COM_FOUND_AST: if char == "/": state = DEFAULT elif not char == "*": state = V_COM pbuffer(False,char) # DEFINE elif state == DEFINE: if char == "\n": state = DEFAULT parseDefine(define_buffer,vars_dict) pbuffer(True,define_buffer) define_buffer = "" else: define_buffer = define_buffer + char # DEF_FOUND_LCARET elif state == DEF_FOUND_LCARET: if char == "?": state = PRE_SEG pre_seg_begin_line = line_count else: state = DEFAULT pbuffer(False, "<" + char) # have to put a < because prev state didn't write one # PRE_COM elif state == PRE_COM: if char == "\n": state = DEFAULT # PRE_SEG elif state == PRE_SEG: if char == "{": state = PRE_EXPR pre_expr_begin_line = line_count elif char == "<": state = PRE_FOUND_LCARET elif char == "?": state = PRE_FOUND_QUEST else: pre_seg_buffer = pre_seg_buffer + char # PRE_EXPR elif state == PRE_EXPR: if char == "}": state = PRE_SEG if pre_expr_buffer != "": parsePreExpr(pre_expr_buffer,pre_seg_buffer,vars_dict) pre_expr_buffer = "" elif char == "\n": state = ERROR err_code = NEWLINE_IN_PRE_EXPR else: pre_expr_buffer = pre_expr_buffer + char # PRE_FOUND_QUEST elif state == PRE_FOUND_QUEST: if char == ">": state = DEFAULT parsePreSeg(pre_seg_buffer, vars_dict) pre_seg_buffer = "" else: state = PRE_SEG pre_seg_buffer = pre_seg_buffer + "?" + char # PRE_FOUND_LCARET elif state == PRE_FOUND_LCARET: if char == "?": state = ERROR err_code = DUP_PRE_BEGIN else: state = PRE_SEG pre_seg_buffer = pre_seg_buffer + "<" + char # Update line count and char count if state != ERROR: char_count = char_count + 1 if char == "\n": line_count = line_count + 1 char_count = 0 # Read the next character char = sfile.read(1) #end while #Check to make sure EOF did not occur in an invalid state if state == V_COM: err_code = UNCLOSED_V_COM elif state == PRE_EXPR: err_code = UNCLOSED_PRE_EXPR elif state == PRE_FOUND_LCARET: err_code = UNCLOSED_PRE_EXPR elif state == PRE_FOUND_QUEST: err_code = UNCLOSED_PRE_SEG #If an error occured, report it if err_code != NOERR: if err_code == UNCLOSED_V_COM: print "Error: Unclosed Verilog block comment (beginning at line " + `v_com_begin_line` + ")\n" sys.exit(1) elif err_code == NEWLINE_IN_PRE_EXPR: print "Error: Newline occurred in preprocessor expression: at line " + `line_count` +"\n" sys.exit(1) elif err_code == UNCLOSED_PRE_EXPR: print "Error: Unclosed preprocessor expression (beginning at line " + `pre_expr_begin_line` + ")\n" sys.exit(1) elif err_code == DUP_PRE_BEGIN: print "Error: Nested preprocessor tags: at line " + `line_count` + "\n" sys.exit(1) elif err_code == UNCLOSED_PRE_SEG: print "Error: Unclosed preprocessor tags (beginning at line " + `pre_seg_begin_line` + ")\n" sys.exit(1)

bc7caa6020ce9c0d3efd9e0dbbc8e121c4373dda /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/3352/bc7caa6020ce9c0d3efd9e0dbbc8e121c4373dda/preprocessor.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1109, 1830, 12, 87, 768, 16, 4153, 67, 1576, 4672, 225, 277, 273, 374, 31, 5375, 468, 1369, 3895, 316, 67, 90, 67, 3469, 273, 1083, 31, 282, 468, 4678, 364, 2362, 4832, 279, 1924, 21947, 2879, 1203, 316, 67, 84, 67, 2629, 273, 1083, 31, 377, 468, 4678, 364, 2362, 4832, 279, 31445, 1203, 225, 468, 1997, 3059, 326, 585, 3351, 635, 3351, 1450, 279, 463, 2046, 919, 273, 3331, 2398, 468, 3287, 2190, 393, 67, 710, 273, 3741, 9712, 5411, 468, 3356, 2190, 364, 6279, 1334, 675, 67, 5680, 67, 10086, 67, 1369, 273, 374, 1377, 468, 5377, 1300, 434, 279, 31445, 2442, 787, 331, 67, 832, 67, 10086, 67, 1369, 273, 374, 3639, 468, 5377, 1300, 434, 279, 6160, 21947, 1203, 2879, 787, 675, 67, 8638, 67, 10086, 67, 1369, 273, 374, 377, 468, 5377, 1300, 434, 279, 31445, 2652, 787, 980, 67, 1883, 273, 374, 2868, 468, 6562, 980, 1300, 1149, 67, 1883, 273, 374, 2868, 468, 6562, 3351, 1300, 261, 267, 980, 13, 225, 675, 67, 5680, 67, 4106, 273, 1408, 540, 468, 6577, 1613, 364, 31445, 5155, 675, 67, 8638, 67, 4106, 273, 1408, 3639, 468, 6577, 1613, 364, 31445, 8041, 4426, 67, 4106, 273, 1408, 1850, 468, 6577, 1613, 364, 25957, 3740, 6317, 225, 272, 768, 18, 16508, 12, 20, 13, 1149, 273, 272, 768, 18, 896, 12, 21, 13, 225, 1323, 1149, 471, 919, 480, 5475, 30, 225, 468, 3331, 309, 919, 422, 3331, 30, 309, 1149, 422, 2 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1109, 1830, 12, 87, 768, 16, 4153, 67, 1576, 4672, 225, 277, 273, 374, 31, 5375, 468, 1369, 3895, 316, 67, 90, 67, 3469, 273, 1083, 31, 282, 468, 4678, 364, 2362, 4832, 279, 1924, 21947, 2879, 1203, 316, 67, 84, 67, 2629, 273, 1083, 31, 377, 468, 4678, 364, 2362, 4832, 279, 31445, 1203, 225, 468, 1997, 3059, 326, 585, 3351, 635, 3351, 1450, 279, 463, 2046, 919, 273, 3331, 2398, 468, 3287, 2190, 393, 67, 710, 273, 3741, 9712, 5411, 468, 3356, 2190, 364, 6279, 1334, 675, 67, 5680, 67, 10086, 67, 1369, 273, 374, 1377, 468, 5377, 1300, 434, 279, 31445, 2442, 787, 331, 67, 832, 67, 10086, 67, 1369, 273, 374, 3639, 468, 5377, 2 ]

if op1.sign == -1: result.sign = -1

if op1.sign == 1: result.sign = 1

def __add__(self, other, context=None): """Returns self + other.

ce77754a7a9856b4ea3aec633c8021212c8039a7 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/8125/ce77754a7a9856b4ea3aec633c8021212c8039a7/decimal.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 1289, 972, 12, 2890, 16, 1308, 16, 819, 33, 7036, 4672, 3536, 1356, 365, 397, 1308, 18, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 1289, 972, 12, 2890, 16, 1308, 16, 819, 33, 7036, 4672, 3536, 1356, 365, 397, 1308, 18, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]

description= "Create a "+name, category = "PGL Object Generator", nodemodule = "objectgenerator", nodeclass = name+'Node', **kargs)

def generate_factory(name, **kargs): return Factory( name= name, description= "Create a "+name, category = "PGL Object Generator", nodemodule = "objectgenerator", nodeclass = name+'Node', **kargs)

2a6da979b8a59c13d5a15249a32414ef9a1f6adb /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/799/2a6da979b8a59c13d5a15249a32414ef9a1f6adb/__wralea__.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 2103, 67, 6848, 12, 529, 16, 2826, 79, 1968, 4672, 327, 7822, 12, 508, 33, 508, 16, 2477, 33, 315, 1684, 279, 13773, 529, 16, 3150, 273, 315, 52, 11261, 1033, 10159, 3113, 756, 2978, 273, 315, 1612, 8812, 3113, 756, 1106, 273, 508, 6797, 907, 2187, 2826, 79, 1968, 13, 282, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 2103, 67, 6848, 12, 529, 16, 2826, 79, 1968, 4672, 327, 7822, 12, 508, 33, 508, 16, 2477, 33, 315, 1684, 279, 13773, 529, 16, 3150, 273, 315, 52, 11261, 1033, 10159, 3113, 756, 2978, 273, 315, 1612, 8812, 3113, 756, 1106, 273, 508, 6797, 907, 2187, 2826, 79, 1968, 13, 282, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]

except AttributeError: fp_size = None

def do_grep(self, fp): """ Do a full grep.

73b5557e048342a519cecab38c11b31b4cc2dac6 /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/10903/73b5557e048342a519cecab38c11b31b4cc2dac6/grin.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 741, 67, 11556, 84, 12, 2890, 16, 4253, 4672, 3536, 2256, 279, 1983, 23366, 18, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 741, 67, 11556, 84, 12, 2890, 16, 4253, 4672, 3536, 2256, 279, 1983, 23366, 18, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]

info = document.toxml(encoding='utf-16') obj.info = info

obj.info = document

def create_elem(): elem = document.createElement(self.tag_name) parent = document.getElementsByTagName(self.parent)[0] parent.appendChild(elem) return elem

5cbe331c0791d5ce5030fc48987fd5072a9a9db7 /local1/tlutelli/issta_data/temp/all_python//python/2007_temp/2007/9125/5cbe331c0791d5ce5030fc48987fd5072a9a9db7/meta.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 752, 67, 10037, 13332, 3659, 273, 1668, 18, 2640, 1046, 12, 2890, 18, 2692, 67, 529, 13, 982, 273, 1668, 18, 588, 3471, 10401, 12, 2890, 18, 2938, 25146, 20, 65, 982, 18, 6923, 1763, 12, 10037, 13, 327, 3659, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 752, 67, 10037, 13332, 3659, 273, 1668, 18, 2640, 1046, 12, 2890, 18, 2692, 67, 529, 13, 982, 273, 1668, 18, 588, 3471, 10401, 12, 2890, 18, 2938, 25146, 20, 65, 982, 18, 6923, 1763, 12, 10037, 13, 327, 3659, 225, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]

self.indiType = self.data and self.methods.get(self.data.domain[self.selectedAttr].name, (0, ""))[0] or 0

if self.data: attr = self.data.domain[self.selectedAttr] self.indiType, value = self.methods.get(attr.name, False) or (-1, "") if self.indiType >= 0: if attr.varType == orange.VarTypes.Discrete: self.indiValueCtrl.setCurrentItem(value) else: self.indiValueCtrl.setText(value)

def setIndiType(self): self.indiType = self.data and self.methods.get(self.data.domain[self.selectedAttr].name, (0, ""))[0] or 0

5a20988f1aa69f170b9d5db9340463971696fdfe /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/6366/5a20988f1aa69f170b9d5db9340463971696fdfe/OWImpute.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 444, 382, 3211, 559, 12, 2890, 4672, 309, 365, 18, 892, 30, 1604, 273, 365, 18, 892, 18, 4308, 63, 2890, 18, 8109, 3843, 65, 365, 18, 728, 77, 559, 16, 460, 273, 365, 18, 5163, 18, 588, 12, 1747, 18, 529, 16, 1083, 13, 578, 24927, 21, 16, 1408, 13, 309, 365, 18, 728, 77, 559, 1545, 374, 30, 309, 1604, 18, 1401, 559, 422, 578, 726, 18, 1537, 2016, 18, 1669, 6883, 30, 365, 18, 728, 77, 620, 12418, 18, 542, 3935, 1180, 12, 1132, 13, 469, 30, 365, 18, 728, 77, 620, 12418, 18, 542, 1528, 12, 1132, 13, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 444, 382, 3211, 559, 12, 2890, 4672, 309, 365, 18, 892, 30, 1604, 273, 365, 18, 892, 18, 4308, 63, 2890, 18, 8109, 3843, 65, 365, 18, 728, 77, 559, 16, 460, 273, 365, 18, 5163, 18, 588, 12, 1747, 18, 529, 16, 1083, 13, 578, 24927, 21, 16, 1408, 13, 309, 365, 18, 728, 77, 559, 1545, 374, 30, 309, 1604, 18, 1401, 559, 422, 578, 726, 18, 1537, 2016, 18, 1669, 6883, 30, 365, 18, 728, 77, 620, 12418, 18, 542, 3935, 1180, 12, 1132, 13, 469, 30, 365, 18, 728, 77, 620, 12418, 18, 542, 1528, 12, 1132, 13, 225, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]

else

else:

def __init__(data = None) if data == None: quickfix.StringField.__init__(self, 568) else quickfix.StringField.__init__(self, 568, data)

484890147d4b23aac4b9d0e85e84fceab7e137c3 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/8819/484890147d4b23aac4b9d0e85e84fceab7e137c3/quickfix_fields.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 892, 273, 599, 13, 309, 501, 422, 599, 30, 9549, 904, 18, 780, 974, 16186, 2738, 972, 12, 2890, 16, 1381, 9470, 13, 469, 30, 9549, 904, 18, 780, 974, 16186, 2738, 972, 12, 2890, 16, 1381, 9470, 16, 501, 13, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 892, 273, 599, 13, 309, 501, 422, 599, 30, 9549, 904, 18, 780, 974, 16186, 2738, 972, 12, 2890, 16, 1381, 9470, 13, 469, 30, 9549, 904, 18, 780, 974, 16186, 2738, 972, 12, 2890, 16, 1381, 9470, 16, 501, 13, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]

info = None

def createFields(self): # This stupid shit gets the LSB, not the MSB... self.info("Note info: 0x%02X" % self.stream.readBits(self.absolute_address, 8, LITTLE_ENDIAN)) yield RealBit(self, "is_extended") info = None if self["is_extended"].value: info = NoteInfo(self, "info") yield info if info["has_note"].value: yield Enum(UInt8(self, "note"), NOTE_NAME) else: yield Enum(Bits(self, "note", 7), NOTE_NAME)

c99931bfecc0c1d1ea8ca2bff60774c9102dc066 /local1/tlutelli/issta_data/temp/all_python//python/2007_temp/2007/9327/c99931bfecc0c1d1ea8ca2bff60774c9102dc066/xm.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 752, 2314, 12, 2890, 4672, 468, 1220, 384, 416, 350, 699, 305, 5571, 326, 511, 14541, 16, 486, 326, 9238, 38, 2777, 365, 18, 1376, 2932, 8067, 1123, 30, 374, 92, 9, 3103, 60, 6, 738, 365, 18, 3256, 18, 896, 6495, 12, 2890, 18, 12547, 67, 2867, 16, 1725, 16, 511, 30972, 900, 67, 30597, 3719, 2824, 15987, 5775, 12, 2890, 16, 315, 291, 67, 14948, 7923, 309, 365, 9614, 291, 67, 14948, 6, 8009, 1132, 30, 1123, 273, 3609, 966, 12, 2890, 16, 315, 1376, 7923, 2824, 1123, 309, 1123, 9614, 5332, 67, 7652, 6, 8009, 1132, 30, 2824, 6057, 12, 14342, 28, 12, 2890, 16, 315, 7652, 6, 3631, 5219, 67, 1985, 13, 469, 30, 2824, 6057, 12, 6495, 12, 2890, 16, 315, 7652, 3113, 2371, 3631, 5219, 67, 1985, 13, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 752, 2314, 12, 2890, 4672, 468, 1220, 384, 416, 350, 699, 305, 5571, 326, 511, 14541, 16, 486, 326, 9238, 38, 2777, 365, 18, 1376, 2932, 8067, 1123, 30, 374, 92, 9, 3103, 60, 6, 738, 365, 18, 3256, 18, 896, 6495, 12, 2890, 18, 12547, 67, 2867, 16, 1725, 16, 511, 30972, 900, 67, 30597, 3719, 2824, 15987, 5775, 12, 2890, 16, 315, 291, 67, 14948, 7923, 309, 365, 9614, 291, 67, 14948, 6, 8009, 1132, 30, 1123, 273, 3609, 966, 12, 2890, 16, 315, 1376, 7923, 2824, 1123, 309, 1123, 9614, 5332, 67, 7652, 6, 8009, 1132, 30, 2824, 6057, 12, 14342, 28, 12, 2890, 16, 315, 7652, 6, 3631, 5219, 67, 1985, 13, 469, 30, 2 ]

str='No MIB info for %s (distant parent %s)' % (oid, mibNode)

str='No MIB info for %s (closest parent %s)' % (oid, mibNode.name)

def oidToInstanceName(mibView, oid): oid, label, suffix = mibView.getNodeNameByOid(tuple(oid)) modName, symName, __suffix = mibView.getNodeLocation(oid) mibNode, = mibView.mibBuilder.importSymbols( modName, symName ) if hasattr(mibNode, 'getColumnInitializer'): # table column __modName, __symName, __s = mibView.getNodeLocation(oid[:-1]) rowNode, = mibView.mibBuilder.importSymbols(__modName, __symName) return (symName, modName), rowNode.getIndicesFromInstId(suffix) elif not suffix or suffix == (0,): # scalar/identifier return (symName, modName), suffix else: raise NoSuchInstanceError( str='No MIB info for %s (distant parent %s)' % (oid, mibNode) )

d1a4bbb6950ea6d7df3f385cc62df9731e497a70 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/587/d1a4bbb6950ea6d7df3f385cc62df9731e497a70/mibvar.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 7764, 774, 22520, 12, 81, 495, 1767, 16, 7764, 4672, 7764, 16, 1433, 16, 3758, 273, 312, 495, 1767, 18, 588, 18948, 858, 19105, 12, 8052, 12, 839, 3719, 681, 461, 16, 5382, 461, 16, 1001, 8477, 273, 312, 495, 1767, 18, 588, 907, 2735, 12, 839, 13, 312, 495, 907, 16, 273, 312, 495, 1767, 18, 81, 495, 1263, 18, 5666, 14821, 12, 681, 461, 16, 5382, 461, 262, 309, 3859, 12, 81, 495, 907, 16, 296, 588, 1494, 14729, 11, 4672, 468, 1014, 1057, 1001, 1711, 461, 16, 1001, 8117, 461, 16, 1001, 87, 273, 312, 495, 1767, 18, 588, 907, 2735, 12, 839, 10531, 17, 21, 5717, 1027, 907, 16, 273, 312, 495, 1767, 18, 81, 495, 1263, 18, 5666, 14821, 12, 972, 1711, 461, 16, 1001, 8117, 461, 13, 327, 261, 8117, 461, 16, 681, 461, 3631, 1027, 907, 18, 588, 8776, 1265, 10773, 548, 12, 8477, 13, 1327, 486, 3758, 578, 3758, 422, 261, 20, 16, 4672, 468, 4981, 19, 5644, 327, 261, 8117, 461, 16, 681, 461, 3631, 3758, 469, 30, 1002, 5823, 1442, 668, 12, 609, 2218, 2279, 490, 13450, 1123, 364, 738, 87, 261, 7550, 7781, 982, 738, 87, 2506, 738, 261, 839, 16, 312, 495, 907, 18, 529, 13, 262, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 7764, 774, 22520, 12, 81, 495, 1767, 16, 7764, 4672, 7764, 16, 1433, 16, 3758, 273, 312, 495, 1767, 18, 588, 18948, 858, 19105, 12, 8052, 12, 839, 3719, 681, 461, 16, 5382, 461, 16, 1001, 8477, 273, 312, 495, 1767, 18, 588, 907, 2735, 12, 839, 13, 312, 495, 907, 16, 273, 312, 495, 1767, 18, 81, 495, 1263, 18, 5666, 14821, 12, 681, 461, 16, 5382, 461, 262, 309, 3859, 12, 81, 495, 907, 16, 296, 588, 1494, 14729, 11, 4672, 468, 1014, 1057, 1001, 1711, 461, 16, 1001, 8117, 461, 16, 1001, 87, 273, 312, 495, 1767, 18, 588, 907, 2735, 12, 839, 10531, 17, 21, 5717, 1027, 907, 16, 273, 312, 495, 1767, 18, 2 ]

self.add_row(path[0])

self.add_row(os.path.join(defs.HOME_THEME_DIR, path[0]))

def extract_file(self, fname): tar = tarfile.open(fname, "r:gz") filelist = tar.getmembers() theme_found = False thumb_found = False for f in filelist: path = os.path.split(f.name) if path[1] == self.AWN_CONFIG: theme_found = True if path[1] == self.AWN_THUMB: thumb_found = True if theme_found and thumb_found: if hasattr(tar, 'extractall'): tar.extractall(defs.HOME_THEME_DIR) #new in python 2.5 else: [tar.extract(f, defs.HOME_THEME_DIR) for f in tar.getnames()] tar.close() self.add_row(path[0]) message = "Theme Successfully Added" message2 = "" success = gtk.MessageDialog(parent=None, flags=0, type=gtk.MESSAGE_WARNING, buttons=gtk.BUTTONS_OK, message_format=message) icon_path = os.path.join(defs.HOME_THEME_DIR, path[0], self.AWN_CUSTOM_ICONS) if os.path.exists(icon_path): message2 = "Custom icons included can be found at:\n " + os.path.join(defs.HOME_THEME_DIR, path[0], self.AWN_CUSTOM_ICONS) success.format_secondary_text(message2) success.run() success.destroy() return True else: return False

fbbad571f1ee3b50f3b4afce97428d348e7cce32 /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/8416/fbbad571f1ee3b50f3b4afce97428d348e7cce32/awnTheme.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 2608, 67, 768, 12, 2890, 16, 5299, 4672, 8232, 273, 25857, 18, 3190, 12, 12749, 16, 315, 86, 30, 9764, 7923, 26204, 273, 8232, 18, 588, 7640, 1435, 5006, 67, 7015, 273, 1083, 11156, 67, 7015, 273, 1083, 364, 284, 316, 26204, 30, 589, 273, 1140, 18, 803, 18, 4939, 12, 74, 18, 529, 13, 309, 589, 63, 21, 65, 422, 365, 18, 37, 5665, 67, 7203, 30, 5006, 67, 7015, 273, 1053, 309, 589, 63, 21, 65, 422, 365, 18, 37, 5665, 67, 2455, 2799, 38, 30, 11156, 67, 7015, 273, 1053, 309, 5006, 67, 7015, 471, 11156, 67, 7015, 30, 309, 3859, 12, 11718, 16, 296, 8004, 454, 11, 4672, 8232, 18, 8004, 454, 12, 12537, 18, 14209, 67, 24644, 958, 67, 4537, 13, 468, 2704, 316, 5790, 576, 18, 25, 469, 30, 306, 11718, 18, 8004, 12, 74, 16, 17588, 18, 14209, 67, 24644, 958, 67, 4537, 13, 364, 284, 316, 8232, 18, 588, 1973, 1435, 65, 8232, 18, 4412, 1435, 365, 18, 1289, 67, 492, 12, 538, 18, 803, 18, 5701, 12, 12537, 18, 14209, 67, 24644, 958, 67, 4537, 16, 589, 63, 20, 22643, 883, 273, 315, 8335, 11958, 4095, 25808, 6, 883, 22, 273, 1408, 2216, 273, 22718, 18, 1079, 6353, 12, 2938, 33, 7036, 16, 2943, 33, 20, 16, 618, 33, 4521, 79, 18, 8723, 67, 9511, 16, 9502, 33, 4521, 79, 18, 20068, 55, 67, 3141, 16, 883, 67, 2139, 33, 2150, 13, 4126, 67, 803, 273, 1140, 2 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 2608, 67, 768, 12, 2890, 16, 5299, 4672, 8232, 273, 25857, 18, 3190, 12, 12749, 16, 315, 86, 30, 9764, 7923, 26204, 273, 8232, 18, 588, 7640, 1435, 5006, 67, 7015, 273, 1083, 11156, 67, 7015, 273, 1083, 364, 284, 316, 26204, 30, 589, 273, 1140, 18, 803, 18, 4939, 12, 74, 18, 529, 13, 309, 589, 63, 21, 65, 422, 365, 18, 37, 5665, 67, 7203, 30, 5006, 67, 7015, 273, 1053, 309, 589, 63, 21, 65, 422, 365, 18, 37, 5665, 67, 2455, 2799, 38, 30, 11156, 67, 7015, 273, 1053, 309, 5006, 67, 7015, 471, 11156, 67, 7015, 30, 309, 3859, 12, 11718, 16, 296, 8004, 454, 11, 4672, 8232, 18, 8004, 454, 12, 12537, 2 ]

nic = InstanceCatalog.InstanceCatalog()

nic = InstanceCatalog()

def makeCatalogFromQuery(self, result): if os.environ.has_key("CATALOG_DESCRIPTION_PATH"): catalogDescriptionPath = os.environ["CATALOG_DESCRIPTION_PATH"] else: raise Exception("Environment variable CATALOG_DESCRIPTION_PATH not set to location of the catalog description files") nic = InstanceCatalog.InstanceCatalog() nic.catalogDescription = CatalogDescription.CatalogDescription( catalogDescriptionPath+"requiredMetadata.dat", catalogDescriptionPath+"requiredSchemaFields.dat", catalogDescriptionPath+"requiredDerivedFields.dat", catalogDescriptionPath+"outputFormat.dat") nic.metadata.catalogDescription = nic.catalogDescription nic.catalogType = self.filetypes data = {} for k in self.cdm.objectTypes['POINT'].keys(): data[k] = [] for s in result: for k in self.cdm.objectTypes['POINT'].keys():

11976c942f9ebf4a51cb090a8c8fcb77b4828536 /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/91/11976c942f9ebf4a51cb090a8c8fcb77b4828536/queryDB.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1221, 9769, 1265, 1138, 12, 2890, 16, 563, 4672, 309, 1140, 18, 28684, 18, 5332, 67, 856, 2932, 14130, 18683, 67, 15911, 67, 4211, 6, 4672, 6222, 3291, 743, 273, 1140, 18, 28684, 9614, 14130, 18683, 67, 15911, 67, 4211, 11929, 469, 30, 1002, 1185, 2932, 5494, 2190, 30210, 18683, 67, 15911, 67, 4211, 486, 444, 358, 2117, 434, 326, 6222, 2477, 1390, 7923, 11562, 273, 5180, 9769, 1435, 11562, 18, 7199, 3291, 273, 14953, 3291, 18, 9769, 3291, 12, 6222, 3291, 743, 9078, 4718, 2277, 18, 3404, 3113, 6222, 3291, 743, 9078, 4718, 3078, 2314, 18, 3404, 3113, 6222, 3291, 743, 9078, 4718, 21007, 2314, 18, 3404, 3113, 6222, 3291, 743, 9078, 2844, 1630, 18, 3404, 7923, 11562, 18, 4165, 18, 7199, 3291, 273, 225, 11562, 18, 7199, 3291, 11562, 18, 7199, 559, 273, 365, 18, 7540, 15180, 501, 273, 2618, 364, 417, 316, 365, 18, 4315, 81, 18, 1612, 2016, 3292, 8941, 29489, 2452, 13332, 501, 63, 79, 65, 273, 5378, 364, 272, 316, 563, 30, 364, 417, 316, 365, 18, 4315, 81, 18, 1612, 2016, 3292, 8941, 29489, 2452, 13332, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1221, 9769, 1265, 1138, 12, 2890, 16, 563, 4672, 309, 1140, 18, 28684, 18, 5332, 67, 856, 2932, 14130, 18683, 67, 15911, 67, 4211, 6, 4672, 6222, 3291, 743, 273, 1140, 18, 28684, 9614, 14130, 18683, 67, 15911, 67, 4211, 11929, 469, 30, 1002, 1185, 2932, 5494, 2190, 30210, 18683, 67, 15911, 67, 4211, 486, 444, 358, 2117, 434, 326, 6222, 2477, 1390, 7923, 11562, 273, 5180, 9769, 1435, 11562, 18, 7199, 3291, 273, 14953, 3291, 18, 9769, 3291, 12, 6222, 3291, 743, 9078, 4718, 2277, 18, 3404, 3113, 6222, 3291, 743, 9078, 4718, 3078, 2314, 18, 3404, 3113, 6222, 3291, 743, 9078, 4718, 21007, 2314, 18, 3404, 3113, 6222, 3291, 743, 9078, 2844, 1630, 18, 3404, 7923, 2 ]

assert allclose(struve(v, z), value, atol=err), (v, z)

assert_tol_equal(struve(v, z), value, rtol=0, atol=err), (v, z)

def test_vs_series(self): """Check Struve function versus its power series""" for v in [-20, -10, -7.99, -3.4, -1, 0, 1, 3.4, 12.49, 16]: for z in [1, 10, 19, 21, 30]: value, err = self._series(v, z) assert allclose(struve(v, z), value, atol=err), (v, z)

9bfb2390def95a96da5a56f3a02a6b962e87c293 /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/12971/9bfb2390def95a96da5a56f3a02a6b962e87c293/test_basic.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1842, 67, 6904, 67, 10222, 12, 2890, 4672, 3536, 1564, 3978, 89, 537, 445, 14690, 407, 2097, 7212, 4166, 8395, 364, 331, 316, 23059, 3462, 16, 300, 2163, 16, 300, 27, 18, 2733, 16, 300, 23, 18, 24, 16, 300, 21, 16, 374, 16, 404, 16, 890, 18, 24, 16, 2593, 18, 7616, 16, 2872, 14542, 364, 998, 316, 306, 21, 16, 1728, 16, 5342, 16, 9035, 16, 5196, 14542, 460, 16, 393, 273, 365, 6315, 10222, 12, 90, 16, 998, 13, 1815, 777, 4412, 12, 701, 89, 537, 12, 90, 16, 998, 3631, 460, 16, 26322, 33, 370, 3631, 261, 90, 16, 998, 13, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1842, 67, 6904, 67, 10222, 12, 2890, 4672, 3536, 1564, 3978, 89, 537, 445, 14690, 407, 2097, 7212, 4166, 8395, 364, 331, 316, 23059, 3462, 16, 300, 2163, 16, 300, 27, 18, 2733, 16, 300, 23, 18, 24, 16, 300, 21, 16, 374, 16, 404, 16, 890, 18, 24, 16, 2593, 18, 7616, 16, 2872, 14542, 364, 998, 316, 306, 21, 16, 1728, 16, 5342, 16, 9035, 16, 5196, 14542, 460, 16, 393, 273, 365, 6315, 10222, 12, 90, 16, 998, 13, 1815, 777, 4412, 12, 701, 89, 537, 12, 90, 16, 998, 3631, 460, 16, 26322, 33, 370, 3631, 261, 90, 16, 998, 13, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]

self.app = app

self.rootapp = rootapp self.apps = apps

def __init__(self, app): trace("ISAPISimpleHandler.__init__") self.app = app

742beb9f59a980a41b87dc069bb870643ade7d03 /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/4963/742beb9f59a980a41b87dc069bb870643ade7d03/isapi_wsgi.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 2890, 16, 595, 4672, 2606, 2932, 5127, 2557, 5784, 1503, 16186, 2738, 972, 7923, 365, 18, 2910, 273, 595, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 2890, 16, 595, 4672, 2606, 2932, 5127, 2557, 5784, 1503, 16186, 2738, 972, 7923, 365, 18, 2910, 273, 595, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]

src_piece = self.locs[src]

src_piece = self[src]

def move(self, sym, src, dst, options): """a (parsed) move is: (piece, src, dst, options), where dict options may contain the following keys: promote (None, R, Q, B, N), capture (True, False), hybrid, i.e. 'going to hybrid' (True, False), check (None, check, mate). all keys except 'promote' may be ignored""" src_piece = self.locs[src] if src_piece == E: raise IllegalMove, ("source position %s is empty" % str(src)) (src_sym, src_col) = src_piece if src_col != self.turn: raise IllegalMove, "attempt to move enemy's piece" movingPiece = pieceObjects[sym] NotImplemented

3776bd3cb848913021c849d965c97d087e6dc8c1 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/5164/3776bd3cb848913021c849d965c97d087e6dc8c1/board.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 3635, 12, 2890, 16, 5382, 16, 1705, 16, 3046, 16, 702, 4672, 3536, 69, 261, 10817, 13, 3635, 353, 30, 261, 30100, 16, 1705, 16, 3046, 16, 702, 3631, 1625, 2065, 702, 2026, 912, 326, 3751, 1311, 30, 28374, 261, 7036, 16, 534, 16, 2238, 16, 605, 16, 423, 3631, 7477, 261, 5510, 16, 1083, 3631, 30190, 16, 277, 18, 73, 18, 296, 8162, 358, 30190, 11, 261, 5510, 16, 1083, 3631, 866, 261, 7036, 16, 866, 16, 312, 340, 2934, 777, 1311, 1335, 296, 17401, 1168, 11, 2026, 506, 5455, 8395, 225, 1705, 67, 30100, 273, 365, 63, 4816, 65, 309, 1705, 67, 30100, 422, 512, 30, 1002, 2141, 7607, 16, 7566, 3168, 1754, 738, 87, 353, 1008, 6, 738, 609, 12, 4816, 3719, 261, 4816, 67, 8117, 16, 1705, 67, 1293, 13, 273, 1705, 67, 30100, 309, 1705, 67, 1293, 480, 365, 18, 20922, 30, 1002, 2141, 7607, 16, 315, 11764, 358, 3635, 570, 351, 93, 1807, 11151, 6, 225, 12499, 22607, 273, 11151, 4710, 63, 8117, 65, 10051, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 3635, 12, 2890, 16, 5382, 16, 1705, 16, 3046, 16, 702, 4672, 3536, 69, 261, 10817, 13, 3635, 353, 30, 261, 30100, 16, 1705, 16, 3046, 16, 702, 3631, 1625, 2065, 702, 2026, 912, 326, 3751, 1311, 30, 28374, 261, 7036, 16, 534, 16, 2238, 16, 605, 16, 423, 3631, 7477, 261, 5510, 16, 1083, 3631, 30190, 16, 277, 18, 73, 18, 296, 8162, 358, 30190, 11, 261, 5510, 16, 1083, 3631, 866, 261, 7036, 16, 866, 16, 312, 340, 2934, 777, 1311, 1335, 296, 17401, 1168, 11, 2026, 506, 5455, 8395, 225, 1705, 67, 30100, 273, 365, 63, 4816, 65, 309, 1705, 67, 30100, 422, 512, 30, 1002, 2141, 7607, 16, 7566, 3168, 1754, 738, 87, 353, 2 ]

def haselement(self,mycat,mypkg,ename): "boolean -- is the specified cat/pkg listed in this package's elements file?" mycmp=mycat+"/"+mypkg for x in self.getelements(ename): if x == mycmp: return 1 return 0 def hasprovide(self,mycat,mypkg): return self.haselement(mycat,mypkg,"PROVIDE") def getprovides(self): "get a list of virtual packages provided by this package." return self.getelements("PROVIDE") def setprovides(self,mylist=None,oldprovides=None): "set virtual packages provided by this package, and also update virtual links" if not mylist: mylist=self.getelements("PROVIDE") if not oldprovides: oldprovides=self.getelements("PROVIDE") for x in mylist: if x not in oldprovides: mypsplit=string.split(x,"/") mylink=dblink(mypsplit[0],mypsplit[1]) myvirts=plink.getvirtuals() if self.cat+"/"+self.pkg in myvirts: myvirts.remove(self.cat+"/"+self.pkg) mylink.setvirtuals(myvirts) for x in oldprovides: if x not in mylist: mypsplit=string.split(x,"/") mylink=dblink(mypsplit[0],mypsplit[1]) myvirts=plink.getvirtuals() if not self.cat+"/"+self.pkg in myvirts: myvirts.append(self.cat+"/"+self.pkg) mylink.setvirtuals(myvirts) return self.setelements(mylist,"PROVIDE") def isprovide(self): return os.path.exists(self.dbdir+"/PROVIDE") def hasvirtual(self,mycat,mypkg): return self.haselement(mycat,mypkg,"VIRTUAL") def getvirtuals(self): "get a list of packages providing this virtual package." return self.getelements("VIRTUAL") def setvirtuals(self,mylist): "set a list of packages providing this virtual package." return self.setelements(mylist,"VIRTUAL") def isvirtual(self): "is this a virtual package? boolean." return os.path.exists(self.dbdir+"/VIRTUAL")

def isregular(self): "Is this a regular package (does it have a CATEGORY file? A dblink can be virtual *and* regular)" return os.path.exists(self.dbdir+"/CATEGORY")

def haselement(self,mycat,mypkg,ename): "boolean -- is the specified cat/pkg listed in this package's elements file?" mycmp=mycat+"/"+mypkg for x in self.getelements(ename): if x == mycmp: return 1 return 0

e2aa1d10ca9e8b9fc4c5050206871cfb8f47522d /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/2807/e2aa1d10ca9e8b9fc4c5050206871cfb8f47522d/portage.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 711, 2956, 12, 2890, 16, 4811, 2574, 16, 81, 879, 14931, 16, 1069, 4672, 315, 6494, 1493, 353, 326, 1269, 6573, 19, 10657, 12889, 316, 333, 2181, 1807, 2186, 585, 7225, 3399, 9625, 33, 4811, 2574, 9078, 4898, 15, 81, 879, 14931, 364, 619, 316, 365, 18, 588, 6274, 12, 1069, 4672, 309, 619, 422, 3399, 9625, 30, 327, 404, 327, 374, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 711, 2956, 12, 2890, 16, 4811, 2574, 16, 81, 879, 14931, 16, 1069, 4672, 315, 6494, 1493, 353, 326, 1269, 6573, 19, 10657, 12889, 316, 333, 2181, 1807, 2186, 585, 7225, 3399, 9625, 33, 4811, 2574, 9078, 4898, 15, 81, 879, 14931, 364, 619, 316, 365, 18, 588, 6274, 12, 1069, 4672, 309, 619, 422, 3399, 9625, 30, 327, 404, 327, 374, 225, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]

self.out.write("void %s::SendContents(Bridge* b)\n" % classname)

self.out.write("void %s::SendContents(Bridge* b) const\n" % classname)

def sendcontents_im(self, obj, statics): classname = classize(obj.attr['id'].value) self.out.write("void %s::SendContents(Bridge* b)\n" % classname) self.out.write("{\n") for attr in statics: self.out.write(' Send%s(b);\n' % classize(attr.name)) parent = obj.attr['parents'].value[0] self.out.write(" %s::SendContents(b);\n" % classize(parent)) self.out.write("}\n\n")

9735567828cceff0576f75d0dc23ff6b13b4f601 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/12931/9735567828cceff0576f75d0dc23ff6b13b4f601/gen_cc.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1366, 3980, 67, 381, 12, 2890, 16, 1081, 16, 760, 87, 4672, 7479, 273, 667, 554, 12, 2603, 18, 1747, 3292, 350, 29489, 1132, 13, 365, 18, 659, 18, 2626, 2932, 6459, 738, 87, 2866, 3826, 6323, 12, 13691, 14, 324, 13, 1866, 64, 82, 6, 738, 7479, 13, 365, 18, 659, 18, 2626, 2932, 23241, 82, 7923, 364, 1604, 316, 760, 87, 30, 365, 18, 659, 18, 2626, 2668, 565, 2479, 9, 87, 12, 70, 20472, 82, 11, 738, 667, 554, 12, 1747, 18, 529, 3719, 982, 273, 1081, 18, 1747, 3292, 12606, 29489, 1132, 63, 20, 65, 365, 18, 659, 18, 2626, 2932, 565, 738, 87, 2866, 3826, 6323, 12, 70, 20472, 82, 6, 738, 667, 554, 12, 2938, 3719, 365, 18, 659, 18, 2626, 2932, 6280, 82, 64, 82, 7923, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1366, 3980, 67, 381, 12, 2890, 16, 1081, 16, 760, 87, 4672, 7479, 273, 667, 554, 12, 2603, 18, 1747, 3292, 350, 29489, 1132, 13, 365, 18, 659, 18, 2626, 2932, 6459, 738, 87, 2866, 3826, 6323, 12, 13691, 14, 324, 13, 1866, 64, 82, 6, 738, 7479, 13, 365, 18, 659, 18, 2626, 2932, 23241, 82, 7923, 364, 1604, 316, 760, 87, 30, 365, 18, 659, 18, 2626, 2668, 565, 2479, 9, 87, 12, 70, 20472, 82, 11, 738, 667, 554, 12, 1747, 18, 529, 3719, 982, 273, 1081, 18, 1747, 3292, 12606, 29489, 1132, 63, 20, 65, 365, 18, 659, 18, 2626, 2932, 565, 738, 87, 2866, 3826, 6323, 12, 70, 20472, 82, 6, 738, 667, 2 ]

resp, subs = s.xhdr('subject', first + '-' + last)

resp, subs = s.xhdr('subject', '{0}-{1}'.format(first, last))

def quit(self): """Process a QUIT command and close the socket. Returns: - resp: server response if successful"""

eb96c4e975fd746fcc8b85f47c3592472b8d6b15 /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/3187/eb96c4e975fd746fcc8b85f47c3592472b8d6b15/nntplib.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 9706, 12, 2890, 4672, 3536, 2227, 279, 10110, 1285, 1296, 471, 1746, 326, 2987, 18, 225, 2860, 30, 300, 1718, 30, 1438, 766, 309, 6873, 8395, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 9706, 12, 2890, 4672, 3536, 2227, 279, 10110, 1285, 1296, 471, 1746, 326, 2987, 18, 225, 2860, 30, 300, 1718, 30, 1438, 766, 309, 6873, 8395, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]

self._write_namespace(namespace, shlib)

self._write_namespace(namespace, shlibs)

def _write_repository(self, namespace, shlib, includes=set()): attrs = [ ('version', '1.0'), ('xmlns', 'http://www.gtk.org/introspection/core/1.0'), ('xmlns:c', 'http://www.gtk.org/introspection/c/1.0'), ('xmlns:glib', 'http://www.gtk.org/introspection/glib/1.0'), ] with self.tagcontext('repository', attrs): for include in includes: self._write_include(include) self._write_namespace(namespace, shlib)

9045f204f1f911867c2dae885904f13f83b9ddab /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/2770/9045f204f1f911867c2dae885904f13f83b9ddab/girwriter.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 2626, 67, 9071, 12, 2890, 16, 1981, 16, 699, 2941, 16, 6104, 33, 542, 1435, 4672, 3422, 273, 306, 7707, 1589, 2187, 296, 21, 18, 20, 19899, 7707, 16741, 2187, 296, 2505, 2207, 5591, 18, 4521, 79, 18, 3341, 19, 474, 26362, 19, 3644, 19, 21, 18, 20, 19899, 7707, 16741, 30, 71, 2187, 296, 2505, 2207, 5591, 18, 4521, 79, 18, 3341, 19, 474, 26362, 19, 71, 19, 21, 18, 20, 19899, 7707, 16741, 30, 75, 2941, 2187, 296, 2505, 2207, 5591, 18, 4521, 79, 18, 3341, 19, 474, 26362, 19, 75, 2941, 19, 21, 18, 20, 19899, 308, 598, 365, 18, 2692, 2472, 2668, 9071, 2187, 3422, 4672, 364, 2341, 316, 6104, 30, 365, 6315, 2626, 67, 6702, 12, 6702, 13, 365, 6315, 2626, 67, 4937, 12, 4937, 16, 699, 2941, 13, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 2626, 67, 9071, 12, 2890, 16, 1981, 16, 699, 2941, 16, 6104, 33, 542, 1435, 4672, 3422, 273, 306, 7707, 1589, 2187, 296, 21, 18, 20, 19899, 7707, 16741, 2187, 296, 2505, 2207, 5591, 18, 4521, 79, 18, 3341, 19, 474, 26362, 19, 3644, 19, 21, 18, 20, 19899, 7707, 16741, 30, 71, 2187, 296, 2505, 2207, 5591, 18, 4521, 79, 18, 3341, 19, 474, 26362, 19, 71, 19, 21, 18, 20, 19899, 7707, 16741, 30, 75, 2941, 2187, 296, 2505, 2207, 5591, 18, 4521, 79, 18, 3341, 19, 474, 26362, 19, 75, 2941, 19, 21, 18, 20, 19899, 308, 598, 365, 18, 2692, 2472, 2668, 9071, 2187, 3422, 4672, 364, 2341, 316, 6104, 30, 365, 6315, 2 ]

def __add__(self, s): """ Returns the sum of two streams. EXAMPLES:: sage: from sage.combinat.species.stream import Stream sage: s = Stream(ZZ) sage: ss = s + s sage: [ss[i] for i in range(10)] [0, 2, -2, 4, -4, 6, -6, 8, -8, 10] """ if not isinstance(s, Stream_class): raise TypeError, "s must be a Stream" return Stream((a+b for (a,b) in itertools.izip(self,s))) def __mul__(self, s): """ Returns the product of two streams. EXAMPLES: We can use a stream to represent the polynomial 1+x and use it to compute the coefficients of (1+x)2. :: sage: from sage.combinat.species.stream import Stream sage: s = Stream([1,1,0]) sage: ss = s*s sage: [ss[i] for i in range(5)] [1, 2, 1, 0, 0] """ if not isinstance(s, Stream_class): raise TypeError, "s must be a Stream" return Stream((self._times_naive(s, n) for n in _integers_from(0))) def _times_naive(self, s, n): """ Returns the nth entry in the product of self and s via the naive multiplication algorithm. Note that this requires that all entries for self and s in range(n+1) be computed. EXAMPLES:: sage: from sage.combinat.species.stream import Stream sage: s = Stream([1,1,0]) sage: s._times_naive(s, 0) 1 sage: s._times_naive(s, 1) 2 sage: s._times_naive(s, 2) 1 """ t = 0 for k in range(n+1): sk = self[k] if sk == 0: continue t += sk * s[n-k] return t

def __add__(self, s): """ Returns the sum of two streams.

ebfc2d1b32c8b0153b7c6921bae684dee1185427 /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/9417/ebfc2d1b32c8b0153b7c6921bae684dee1185427/stream.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 1289, 972, 12, 2890, 16, 272, 4672, 3536, 2860, 326, 2142, 434, 2795, 8205, 18, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 1289, 972, 12, 2890, 16, 272, 4672, 3536, 2860, 326, 2142, 434, 2795, 8205, 18, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]

autocomplete="off" onkeypress="upArrow(this, event)"><br>

autocomplete="off"><br>

def make_repost_button(environ): url = request.construct_url(environ) if environ['REQUEST_METHOD'] == 'GET': return ('<button onclick="window.location.href=%r">' 'Re-GET Page</button><br>' % url) else: # @@: I'd like to reconstruct this, but I can't because # the POST body is probably lost at this point, and # I can't get it back :( return None # @@: Use or lose the following code block """ fields = [] for name, value in request.parse_formvars( environ, include_get_vars=False).items(): if hasattr(value, 'filename'): # @@: Arg, we'll just submit the body, and leave out # the filename :( value = value.value fields.append( '<input type="hidden" name="%s" value="%s">' % (html_quote(name), html_quote(value))) return '''

b236391d16e3eae856284a48117e19a19e9b54f1 /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/12946/b236391d16e3eae856284a48117e19a19e9b54f1/evalexception.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1221, 67, 266, 2767, 67, 5391, 12, 28684, 4672, 880, 273, 590, 18, 10062, 67, 718, 12, 28684, 13, 309, 5473, 3292, 5519, 67, 5327, 3546, 422, 296, 3264, 4278, 327, 7707, 32, 5391, 22324, 1546, 5668, 18, 3562, 18, 7547, 5095, 86, 7918, 296, 426, 17, 3264, 3460, 1757, 5391, 4438, 2848, 1870, 738, 880, 13, 469, 30, 468, 22175, 30, 467, 14271, 3007, 358, 23243, 333, 16, 1496, 467, 848, 1404, 2724, 468, 326, 5485, 1417, 353, 8656, 13557, 622, 333, 1634, 16, 471, 468, 467, 848, 1404, 336, 518, 1473, 294, 12, 327, 599, 468, 22175, 30, 2672, 578, 29612, 326, 3751, 981, 1203, 3536, 1466, 273, 5378, 364, 508, 16, 460, 316, 590, 18, 2670, 67, 687, 4699, 12, 5473, 16, 2341, 67, 588, 67, 4699, 33, 8381, 2934, 3319, 13332, 309, 3859, 12, 1132, 16, 296, 3459, 11, 4672, 468, 22175, 30, 14448, 16, 732, 5614, 2537, 4879, 326, 1417, 16, 471, 8851, 596, 468, 326, 1544, 294, 12, 460, 273, 460, 18, 1132, 1466, 18, 6923, 12, 2368, 2630, 618, 1546, 6345, 6, 508, 11613, 87, 6, 460, 11613, 87, 7918, 738, 261, 2620, 67, 6889, 12, 529, 3631, 1729, 67, 6889, 12, 1132, 20349, 327, 9163, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1221, 67, 266, 2767, 67, 5391, 12, 28684, 4672, 880, 273, 590, 18, 10062, 67, 718, 12, 28684, 13, 309, 5473, 3292, 5519, 67, 5327, 3546, 422, 296, 3264, 4278, 327, 7707, 32, 5391, 22324, 1546, 5668, 18, 3562, 18, 7547, 5095, 86, 7918, 296, 426, 17, 3264, 3460, 1757, 5391, 4438, 2848, 1870, 738, 880, 13, 469, 30, 468, 22175, 30, 467, 14271, 3007, 358, 23243, 333, 16, 1496, 467, 848, 1404, 2724, 468, 326, 5485, 1417, 353, 8656, 13557, 622, 333, 1634, 16, 471, 468, 467, 848, 1404, 336, 518, 1473, 294, 12, 327, 599, 468, 22175, 30, 2672, 578, 29612, 326, 3751, 981, 1203, 3536, 1466, 273, 5378, 364, 508, 16, 460, 316, 590, 18, 2 ]

self.session.gotoLocation()

self.view.send.gotoLocation()

def on_location_editing_done(self, location): self.session.gotoLocation()

4fadf73203be069e1abb0745e50de808e949d82c /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/9377/4fadf73203be069e1abb0745e50de808e949d82c/gnomoire.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 603, 67, 3562, 67, 4619, 310, 67, 8734, 12, 2890, 16, 2117, 4672, 365, 18, 3184, 18, 75, 6302, 2735, 1435, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 603, 67, 3562, 67, 4619, 310, 67, 8734, 12, 2890, 16, 2117, 4672, 365, 18, 3184, 18, 75, 6302, 2735, 1435, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]

self.fps = nsteps / (end_time - start_time + .001 )

duration = min(1.5, time.time() - start_time + .001) self.fps = nsteps / duration

def animateView(self, q2, s2, p2, z2, animate=True): "Animate current view to quat (viewpoint) q2, scale s2, pov p2, and zoom factor z2" # Check User Preference "General | Standard Views: Animate" if not animate or not env.prefs[animateStandardViews_prefs_key]: self.quat = Q(q2) self.pov = V(p2[0], p2[1], p2[2]) self.zoomFactor = z2 self.scale = s2 self.gl_update() return # Disable standard view actions on toolbars/menus. self.win.enableViews(False) wxyz1 = V(self.quat.w, self.quat.x, self.quat.y, self.quat.z) s1 = self.scale pov1 = V(self.pov[0], self.pov[1], self.pov[2]) z1 = self.zoomFactor wxyz2 = V(q2.w, q2.x, q2.y, q2.z) pov2 = V(p2[0], p2[1], p2[2]) # The rotation path may turn either the "short way" (less than 180) or the "long way" (more than 180). # Long paths can be prevented by negating one end (if the dot product is negative). if dot(wxyz1, wxyz2) < 0: wxyz2 = V(-q2.w, -q2.x, -q2.y, -q2.z) off = wxyz2 -wxyz1

5fb22f777c91adb971bce1f786163070dfd13fc4 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/11221/5fb22f777c91adb971bce1f786163070dfd13fc4/GLPane.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 14671, 1767, 12, 2890, 16, 1043, 22, 16, 272, 22, 16, 293, 22, 16, 998, 22, 16, 14671, 33, 5510, 4672, 315, 979, 4988, 783, 1476, 358, 25847, 261, 1945, 1153, 13, 1043, 22, 16, 3159, 272, 22, 16, 293, 1527, 293, 22, 16, 471, 7182, 5578, 998, 22, 6, 225, 468, 2073, 2177, 29125, 315, 12580, 571, 8263, 31117, 30, 1922, 4988, 6, 309, 486, 14671, 578, 486, 1550, 18, 1484, 2556, 63, 304, 4988, 8336, 9959, 67, 1484, 2556, 67, 856, 14542, 365, 18, 372, 270, 273, 2238, 12, 85, 22, 13, 365, 18, 84, 1527, 273, 776, 12, 84, 22, 63, 20, 6487, 293, 22, 63, 21, 6487, 293, 22, 63, 22, 5717, 365, 18, 14932, 6837, 273, 998, 22, 365, 18, 5864, 273, 272, 22, 365, 18, 7043, 67, 2725, 1435, 327, 225, 468, 10639, 4529, 1476, 4209, 603, 12748, 87, 19, 26065, 18, 365, 18, 8082, 18, 7589, 9959, 12, 8381, 13, 225, 341, 17177, 21, 273, 776, 12, 2890, 18, 372, 270, 18, 91, 16, 365, 18, 372, 270, 18, 92, 16, 365, 18, 372, 270, 18, 93, 16, 365, 18, 372, 270, 18, 94, 13, 272, 21, 273, 365, 18, 5864, 293, 1527, 21, 273, 776, 12, 2890, 18, 84, 1527, 63, 20, 6487, 365, 18, 84, 1527, 63, 21, 6487, 365, 18, 84, 1527, 63, 22, 5717, 998, 21, 273, 365, 18, 14932, 6837, 225, 341, 17177, 22, 273, 776, 12, 85, 22, 18, 91, 16, 1043, 22, 2 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 14671, 1767, 12, 2890, 16, 1043, 22, 16, 272, 22, 16, 293, 22, 16, 998, 22, 16, 14671, 33, 5510, 4672, 315, 979, 4988, 783, 1476, 358, 25847, 261, 1945, 1153, 13, 1043, 22, 16, 3159, 272, 22, 16, 293, 1527, 293, 22, 16, 471, 7182, 5578, 998, 22, 6, 225, 468, 2073, 2177, 29125, 315, 12580, 571, 8263, 31117, 30, 1922, 4988, 6, 309, 486, 14671, 578, 486, 1550, 18, 1484, 2556, 63, 304, 4988, 8336, 9959, 67, 1484, 2556, 67, 856, 14542, 365, 18, 372, 270, 273, 2238, 12, 85, 22, 13, 365, 18, 84, 1527, 273, 776, 12, 84, 22, 63, 20, 6487, 293, 22, 63, 21, 6487, 293, 22, 63, 22, 5717, 365, 18, 2 ]

for key in request.session['shares'].iterkeys(): try: session_key = "S:%s if share_connectors.has_key(session_key): share_connectors.get(session_key).seppuku() del share_connectors[session_key] except: logger.error(traceback.format_exc())

try: for key in request.session['shares'].iterkeys(): try: session_key = "S:%s if share_connectors.has_key(session_key): share_connectors.get(session_key).seppuku() del share_connectors[session_key] except: logger.error(traceback.format_exc()) except KeyError: pass

def logout(request, **kwargs): conn = None try: conn = kwargs["conn"] except: logger.error(traceback.format_exc()) return handlerInternalError("Connection is not available. Please contact your administrator.") for key in request.session['shares'].iterkeys(): try: session_key = "S:%s#%s#%s" % (request.session.session_key,request.session['server'], key) if share_connectors.has_key(session_key): share_connectors.get(session_key).seppuku() del share_connectors[session_key] except: logger.error(traceback.format_exc()) try: del request.session['shares'] except KeyError: logger.error(traceback.format_exc()) try: session_key = "S:%s#%s" % (request.session.session_key,request.session['server']) if connectors.has_key(session_key): conn.seppuku() del connectors[session_key] except: logger.error(traceback.format_exc()) try: del request.session['server'] except KeyError: logger.error(traceback.format_exc()) try: del request.session['host'] except KeyError: logger.error(traceback.format_exc()) try: del request.session['port'] except KeyError: logger.error(traceback.format_exc()) try: del request.session['username'] except KeyError: logger.error(traceback.format_exc()) try: del request.session['password'] except KeyError: logger.error(traceback.format_exc()) try: del request.session['sessionUuid'] except KeyError: logger.error(traceback.format_exc()) try: del request.session['groupId'] except KeyError: logger.error(traceback.format_exc()) try: del request.session['experimenter'] except KeyError: logger.error(traceback.format_exc()) pass try: del request.session['imageInBasket'] except KeyError: logger.error(traceback.format_exc()) try: del request.session['nav'] except KeyError: logger.error(traceback.format_exc()) request.session.set_expiry(1) return HttpResponseRedirect("/%s/" % (settings.WEBCLIENT_ROOT_BASE))

ad77f06d874b17f64116bf1142bc099dabd5d3da /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/12409/ad77f06d874b17f64116bf1142bc099dabd5d3da/views.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 12735, 12, 2293, 16, 2826, 4333, 4672, 1487, 273, 599, 775, 30, 1487, 273, 1205, 9614, 4646, 11929, 1335, 30, 1194, 18, 1636, 12, 21696, 18, 2139, 67, 10075, 10756, 327, 1838, 20980, 2932, 1952, 353, 486, 2319, 18, 7801, 5388, 3433, 22330, 1199, 13, 225, 364, 498, 316, 590, 18, 3184, 3292, 30720, 29489, 2165, 2452, 13332, 775, 30, 1339, 67, 856, 273, 315, 55, 5319, 87, 7, 9, 87, 7, 9, 87, 6, 738, 261, 2293, 18, 3184, 18, 3184, 67, 856, 16, 2293, 18, 3184, 3292, 3567, 17337, 498, 13, 309, 7433, 67, 4646, 18886, 18, 5332, 67, 856, 12, 3184, 67, 856, 4672, 7433, 67, 4646, 18886, 18, 588, 12, 3184, 67, 856, 2934, 10814, 11938, 31562, 1435, 1464, 7433, 67, 4646, 18886, 63, 3184, 67, 856, 65, 1335, 30, 1194, 18, 1636, 12, 21696, 18, 2139, 67, 10075, 10756, 225, 775, 30, 1464, 590, 18, 3184, 3292, 30720, 3546, 1335, 4999, 30, 1194, 18, 1636, 12, 21696, 18, 2139, 67, 10075, 10756, 225, 775, 30, 1339, 67, 856, 273, 315, 55, 5319, 87, 7, 9, 87, 6, 738, 261, 2293, 18, 3184, 18, 3184, 67, 856, 16, 2293, 18, 3184, 3292, 3567, 19486, 309, 28473, 18, 5332, 67, 856, 12, 3184, 67, 856, 4672, 1487, 18, 10814, 11938, 31562, 1435, 1464, 28473, 63, 3184, 67, 856, 65, 1335, 30, 1194, 18, 1636, 12, 21696, 18, 2139, 67, 10075, 10756, 225, 775, 30, 1464, 590, 18, 3184, 3292, 3567, 3546, 1335, 4999, 2 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 12735, 12, 2293, 16, 2826, 4333, 4672, 1487, 273, 599, 775, 30, 1487, 273, 1205, 9614, 4646, 11929, 1335, 30, 1194, 18, 1636, 12, 21696, 18, 2139, 67, 10075, 10756, 327, 1838, 20980, 2932, 1952, 353, 486, 2319, 18, 7801, 5388, 3433, 22330, 1199, 13, 225, 364, 498, 316, 590, 18, 3184, 3292, 30720, 29489, 2165, 2452, 13332, 775, 30, 1339, 67, 856, 273, 315, 55, 5319, 87, 7, 9, 87, 7, 9, 87, 6, 738, 261, 2293, 18, 3184, 18, 3184, 67, 856, 16, 2293, 18, 3184, 3292, 3567, 17337, 498, 13, 309, 7433, 67, 4646, 18886, 18, 5332, 67, 856, 12, 3184, 67, 856, 4672, 7433, 67, 4646, 18886, 18, 588, 12, 3184, 67, 856, 2934, 2 ]

if not self.abort: self.parent.gauge1.SetValue(0.0) self.parent.thisvideo.append(self.parent.videos[self.parent.converting]) self.filename=REGEX_FILE_CLEANUP_FILENAME.sub('',self.parent.meta[self.parent.videos[self.parent.converting]]['name']) self.profile=int(self.parent.meta[self.parent.videos[self.parent.converting]]['profile']) self.outdir=self.parent.prefs.getp(self.profile,'Outdir') if self.outdir[-1:]==os.sep: self.outdir=self.outdir[0:-1] if not os.path.lexists(self.outdir): os.makedirs(self.outdir) elif not os.path.isdir(self.outdir): os.remove(self.outdir) os.makedirs(self.outdir) self.outdir=self.outdir+os.sep if os.path.lexists(self.uri): self.stream=self.uri

self.parent.gauge1.SetValue(0.0) self.parent.thisvideo.append(self.parent.videos[self.parent.converting]) self.filename=REGEX_FILE_CLEANUP_FILENAME.sub('',self.parent.meta[self.parent.videos[self.parent.converting]]['name']) self.profile=int(self.parent.meta[self.parent.videos[self.parent.converting]]['profile']) self.outdir=self.parent.prefs.getp(self.profile,'Outdir') if self.outdir[-1:]==os.sep: self.outdir=self.outdir[0:-1] if not os.path.lexists(self.outdir): os.makedirs(self.outdir) elif not os.path.isdir(self.outdir): os.remove(self.outdir) os.makedirs(self.outdir) self.outdir=self.outdir+os.sep if os.path.lexists(self.uri): self.stream=self.uri else: self.stream='-' if self.profile==-1: try: failed=False if self.stream=='-': src=DamnURLPicker(self.uris) total=int(src.info()['Content-Length']) try: tmpuri=src.info()['Content-Disposition'][src.info()['Content-Disposition'].find('filename=')+9:] except: tmpuri='video.avi' else: total=int(os.lstat(self.stream).st_size) src=open(self.stream,'rb') tmpuri=self.stream if REGEX_URI_EXTENSION_EXTRACT.search(tmpuri): ext='.'+REGEX_URI_EXTENSION_EXTRACT.sub('\\1',tmpuri) else: ext='.avi' self.filename=self.getfinalfilename(self.outdir,self.filename,ext) dst=open(self.outdir+self.filename+ext,'wb') keepgoing=True copied=0.0 self.parent.SetStatusText('Copying '+self.parent.meta[self.parent.videos[self.parent.converting]]['name']+' to '+self.filename+ext+'...') while keepgoing and not self.abort: i=src.read(256) if len(i): dst.write(i) copied+=256.0 else: copied=total keepgoing=False self.parent.gauge1.SetValue(min((100.0,copied/total*100.0))) except: failed=True self.grabberrun=False if self.abort or failed: self.parent.meta[self.parent.videos[self.parent.converting]]['status']='Failure.' self.parent.list.SetStringItem(self.parent.converting,ID_COL_VIDSTAT,'Failure.')

def run(self): self.abort=False if True:#for self.uri in self.uris: self.uri=self.uris[0] if not self.abort: self.parent.gauge1.SetValue(0.0) self.parent.thisvideo.append(self.parent.videos[self.parent.converting]) self.filename=REGEX_FILE_CLEANUP_FILENAME.sub('',self.parent.meta[self.parent.videos[self.parent.converting]]['name']) self.profile=int(self.parent.meta[self.parent.videos[self.parent.converting]]['profile']) self.outdir=self.parent.prefs.getp(self.profile,'Outdir') if self.outdir[-1:]==os.sep: self.outdir=self.outdir[0:-1] if not os.path.lexists(self.outdir): os.makedirs(self.outdir) elif not os.path.isdir(self.outdir): os.remove(self.outdir) os.makedirs(self.outdir) self.outdir=self.outdir+os.sep if os.path.lexists(self.uri): self.stream=self.uri # It's a file stream, ffmpeg will take care of it else: self.stream='-' # It's another stream, spawn a downloader thread to take care of it and feed the content to ffmpeg via stdin if self.profile==-1: # Do not encode, just copy try: failed=False if self.stream=='-': # Spawn a downloader src=urllib.urlopen(self.uri) total=int(src.info()['Content-Length']) try: tmpuri=src.info()['Content-Disposition'][src.info()['Content-Disposition'].find('filename=')+9:] except: tmpuri='video.avi' # And pray for the best! else: # Just copy the file, lol total=int(os.lstat(self.stream).st_size) src=open(self.stream,'rb') tmpuri=self.stream if REGEX_URI_EXTENSION_EXTRACT.search(tmpuri): ext='.'+REGEX_URI_EXTENSION_EXTRACT.sub('\\1',tmpuri) else: ext='.avi' # And pray for the best again! self.filename=self.getfinalfilename(self.outdir,self.filename,ext) dst=open(self.outdir+self.filename+ext,'wb') keepgoing=True copied=0.0 self.parent.SetStatusText('Copying '+self.parent.meta[self.parent.videos[self.parent.converting]]['name']+' to '+self.filename+ext+'...') while keepgoing and not self.abort: i=src.read(256) if len(i): dst.write(i) copied+=256.0 else: copied=total keepgoing=False self.parent.gauge1.SetValue(min((100.0,copied/total*100.0))) except: failed=True self.grabberrun=False if self.abort or failed: self.parent.meta[self.parent.videos[self.parent.converting]]['status']='Failure.' self.parent.list.SetStringItem(self.parent.converting,ID_COL_VIDSTAT,'Failure.') else: self.parent.meta[self.parent.videos[self.parent.converting]]['status']='Success!' self.parent.list.SetStringItem(self.parent.converting,ID_COL_VIDSTAT,'Success!') self.parent.go(aborted=self.abort) return os_exe_ext='' if os.name=='nt': os_exe_ext='.exe' self.passes=1 cmd=[DV_BIN_PATH+'ffmpeg'+os_exe_ext,'-i','?DAMNVID_VIDEO_STREAM?','-y','-title',self.parent.meta[self.parent.videos[self.parent.converting]]['name'],'-comment','Converted by DamnVid '+DV_VERSION+'.','-deinterlace','-passlogfile',DV_TMP_PATH+'pass'] for i in DV_PREFERENCES.keys(): if i[0:25]=='damnvid-profile:encoding_': i=i[16:] pref=self.parent.prefs.getp(self.profile,i) if pref: if type(DV_PREFERENCES['damnvid-profile:'+i]['kind']) is types.StringType: if DV_PREFERENCES['damnvid-profile:'+i]['kind'][0]=='%': pref=str(round(float(pref),0)) # Round if i=='encoding_pass': pref='?DAMNVID_VIDEO_PASS?' cmd.extend(['-'+i[9:],pref]) vidformat=self.parent.prefs.getp(self.profile,'Encoding_f') self.vcodec=self.parent.prefs.getp(self.profile,'Encoding_vcodec') self.totalpasses=self.parent.prefs.getp(self.profile,'Encoding_pass') if not self.totalpasses: self.totalpasses=1 else: self.totalpasses=int(self.totalpasses) if vidformat and DV_FILE_EXT.has_key(vidformat): ext='.'+DV_FILE_EXT[vidformat] else: if self.vcodec and DV_FILE_EXT_BY_CODEC.has_key(self.vcodec): ext='.'+DV_FILE_EXT_BY_CODEC[self.vcodec] else: ext='.avi' self.filename=self.getfinalfilename(self.outdir,self.filename,ext) self.filenamenoext=self.filename self.tmpfilename=self.gettmpfilename(DV_TMP_PATH,self.filenamenoext,ext) cmd.append('?DAMNVID_OUTPUT_FILE?') self.filename=self.filenamenoext+ext self.duration=None self.parent.SetStatusText('Converting '+self.parent.meta[self.parent.videos[self.parent.converting]]['name']+' to '+self.filename+'...') while int(self.passes)<=int(self.totalpasses) and not self.abort: if self.passes!=1: self.stream=DV_TMP_PATH+self.tmpfilename self.tmpfilename=self.gettmpfilename(DV_TMP_PATH,self.filenamenoext,ext) tmpf=open('stderr.txt','a') tmpf.write('\n\n--------\n\n') self.process=DamnSpawner(self.cmd2str(cmd),stderr=subprocess.PIPE,stdin=subprocess.PIPE,cwd=os.path.dirname(DV_TMP_PATH)) if self.stream=='-': self.feeder=DamnDownloader(self.uri,self.process.stdin) self.feeder.start() curline='' while self.process.poll()==None and not self.abort: c=self.process.stderr.read(1) tmpf.write(c) curline+=c if c=="\r" or c=="\n": self.parseLine(curline) curline='' self.passes+=1 tmpf.close() self.parent.gauge1.SetValue(100.0) result=self.process.poll() # The process is complete, but .poll() still returns the process's return code time.sleep(.25) # Wait a bit self.grabberrun=False # That'll make the DamnConverterGrabber wake up just in case if result and os.path.lexists(DV_TMP_PATH+self.tmpfilename): os.remove(DV_TMP_PATH+self.tmpfilename) # Delete the output file if ffmpeg has exitted with a bad return code for i in os.listdir(os.path.dirname(DV_TMP_PATH)): if i[0:8]=='damnvid-': i=i[8:] if i==self.tmpfilename and not result: try: os.rename(DV_TMP_PATH+i,self.outdir+self.filename) except: # Maybe the file still isn't unlocked, it happens... Wait moar and retry try: time.sleep(2) os.rename(DV_TMP_PATH+i,self.outdir+self.filename) except: # Now this is really bad, alert the user dlg=wx.MessageDialog(None,'DamnVid successfully converted the file but something prevents it from moving it to the output directory.\nAll hope is not lost, you can still move the file by yourself. It is here:\n'+DV_TMP_PATH+i,'Cannot move file!',wx.OK|wx.ICON_EXCLAMATION) dlg.SetIcon(DV_ICON) dlg.ShowModal() dlg.Destroy() else: try: os.remove(DV_TMP_PATH+i) except: pass if not result: self.parent.meta[self.parent.videos[self.parent.converting]]['status']='Success!' self.parent.list.SetStringItem(self.parent.converting,ID_COL_VIDSTAT,'Success!') self.parent.go(aborted=self.abort) return self.parent.meta[self.parent.videos[self.parent.converting]]['status']='Failure.' self.parent.list.SetStringItem(self.parent.converting,ID_COL_VIDSTAT,'Failure.') self.parent.go(aborted=self.abort)

7ad6098b40f1a39c4d76402fede5772f656b7b13 /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/11142/7ad6098b40f1a39c4d76402fede5772f656b7b13/DamnVid.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1086, 12, 2890, 4672, 365, 18, 18623, 33, 8381, 309, 1053, 27363, 1884, 365, 18, 1650, 316, 365, 18, 23510, 30, 365, 18, 1650, 33, 2890, 18, 23510, 63, 20, 65, 365, 18, 2938, 18, 75, 8305, 21, 18, 694, 620, 12, 20, 18, 20, 13, 365, 18, 2938, 18, 2211, 9115, 18, 6923, 12, 2890, 18, 2938, 18, 6768, 538, 63, 2890, 18, 2938, 18, 6283, 310, 5717, 365, 18, 3459, 33, 12472, 67, 3776, 67, 39, 10439, 3079, 67, 16080, 18, 1717, 2668, 2187, 2890, 18, 2938, 18, 3901, 63, 2890, 18, 2938, 18, 6768, 538, 63, 2890, 18, 2938, 18, 6283, 310, 13563, 3292, 529, 19486, 365, 18, 5040, 33, 474, 12, 2890, 18, 2938, 18, 3901, 63, 2890, 18, 2938, 18, 6768, 538, 63, 2890, 18, 2938, 18, 6283, 310, 13563, 3292, 5040, 19486, 365, 18, 659, 1214, 33, 2890, 18, 2938, 18, 1484, 2556, 18, 588, 84, 12, 2890, 18, 5040, 11189, 1182, 1214, 6134, 309, 365, 18, 659, 1214, 18919, 21, 26894, 631, 538, 18, 10814, 30, 365, 18, 659, 1214, 33, 2890, 18, 659, 1214, 63, 20, 30, 17, 21, 65, 309, 486, 1140, 18, 803, 18, 4149, 1486, 12, 2890, 18, 659, 1214, 4672, 1140, 18, 81, 9477, 10539, 12, 2890, 18, 659, 1214, 13, 1327, 486, 1140, 18, 803, 18, 291, 1214, 12, 2890, 18, 659, 1214, 4672, 1140, 18, 4479, 12, 2890, 18, 659, 1214, 13, 1140, 18, 81, 9477, 10539, 12, 2890, 18, 659, 1214, 2 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1086, 12, 2890, 4672, 365, 18, 18623, 33, 8381, 309, 1053, 27363, 1884, 365, 18, 1650, 316, 365, 18, 23510, 30, 365, 18, 1650, 33, 2890, 18, 23510, 63, 20, 65, 365, 18, 2938, 18, 75, 8305, 21, 18, 694, 620, 12, 20, 18, 20, 13, 365, 18, 2938, 18, 2211, 9115, 18, 6923, 12, 2890, 18, 2938, 18, 6768, 538, 63, 2890, 18, 2938, 18, 6283, 310, 5717, 365, 18, 3459, 33, 12472, 67, 3776, 67, 39, 10439, 3079, 67, 16080, 18, 1717, 2668, 2187, 2890, 18, 2938, 18, 3901, 63, 2890, 18, 2938, 18, 6768, 538, 63, 2890, 18, 2938, 18, 6283, 310, 13563, 3292, 529, 19486, 365, 18, 5040, 33, 474, 12, 2890, 18, 2938, 2 ]

self.parser.openElements.pop()

if self.parser.openElements[-1] == name: self.parser.openElements.pop() else: self.parser.parseError()

def endTagTitleStyleScript(self, name): self.parser.openElements.pop()

9968d62be9415e0f0c75be992d56b7adab3b89d3 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/4487/9968d62be9415e0f0c75be992d56b7adab3b89d3/parser.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 29765, 4247, 2885, 3651, 12, 2890, 16, 508, 4672, 309, 365, 18, 4288, 18, 3190, 3471, 18919, 21, 65, 422, 508, 30, 365, 18, 4288, 18, 3190, 3471, 18, 5120, 1435, 469, 30, 365, 18, 4288, 18, 2670, 668, 1435, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 29765, 4247, 2885, 3651, 12, 2890, 16, 508, 4672, 309, 365, 18, 4288, 18, 3190, 3471, 18919, 21, 65, 422, 508, 30, 365, 18, 4288, 18, 3190, 3471, 18, 5120, 1435, 469, 30, 365, 18, 4288, 18, 2670, 668, 1435, 225, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]

def eval(self, *args, **kwds):

def eval(self, code, globals=None, locals=None, synchronize=True, *args, **kwds):

def eval(self, *args, **kwds): """ Evaluates a command inside the R interpreter and returns the output as a string. EXAMPLES: sage: r.eval('1+1') '[1] 2'

27b9dddb1083d54aec9102ed84a9441f2f76eb42 /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/9890/27b9dddb1083d54aec9102ed84a9441f2f76eb42/r.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 5302, 12, 2890, 16, 981, 16, 10941, 33, 7036, 16, 8985, 33, 7036, 16, 16978, 33, 5510, 16, 380, 1968, 16, 2826, 25577, 4672, 3536, 10271, 815, 279, 1296, 4832, 326, 534, 16048, 471, 1135, 326, 876, 487, 279, 533, 18, 225, 5675, 8900, 11386, 30, 272, 410, 30, 436, 18, 8622, 2668, 21, 15, 21, 6134, 5271, 21, 65, 576, 11, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 5302, 12, 2890, 16, 981, 16, 10941, 33, 7036, 16, 8985, 33, 7036, 16, 16978, 33, 5510, 16, 380, 1968, 16, 2826, 25577, 4672, 3536, 10271, 815, 279, 1296, 4832, 326, 534, 16048, 471, 1135, 326, 876, 487, 279, 533, 18, 225, 5675, 8900, 11386, 30, 272, 410, 30, 436, 18, 8622, 2668, 21, 15, 21, 6134, 5271, 21, 65, 576, 11, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]

HandlerAPI.DeliverToList(self, msg, newdata=msgdata)

HandlerAPI.DeliverToList(self, msg, msgdata)

def __handlepost(self, record, value, comment): # For backwards compatibility with pre 2.0beta3 if len(record) == 5: ptime, sender, subject, reason, filename = record msgdata = {} else: # New format of record ptime, sender, subject, reason, filename, msgdata = record path = os.path.join(mm_cfg.DATA_DIR, filename) rejection = None if value == 0: # Approved try: fp = open(path) except IOError: # we lost the message text file. clean up our housekeeping # and raise an exception. raise Errors.LostHeldMessage(path) msg = Message.Message(fp) msgdata['approved'] = 1 # ignore return value HandlerAPI.DeliverToList(self, msg, newdata=msgdata) elif value == 1: # Rejected rejection = 'Refused' if not self.dont_respond_to_post_requests: self.__refuse('Posting of your message titled "%s"' % subject, sender, comment or '[No reason given]') else: assert value == 2 # Discarded rejection = 'Discarded' # Log the rejection def strquote(s): return string.replace(s, '%', '%%')

18950fcd77ad9afe6dbee3c2be29fd019aabcd9a /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/2120/18950fcd77ad9afe6dbee3c2be29fd019aabcd9a/ListAdmin.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 4110, 2767, 12, 2890, 16, 1409, 16, 460, 16, 2879, 4672, 468, 2457, 12727, 8926, 598, 675, 576, 18, 20, 5758, 23, 309, 562, 12, 3366, 13, 422, 1381, 30, 293, 957, 16, 5793, 16, 3221, 16, 3971, 16, 1544, 273, 1409, 1234, 892, 273, 2618, 469, 30, 468, 1166, 740, 434, 1409, 293, 957, 16, 5793, 16, 3221, 16, 3971, 16, 1544, 16, 1234, 892, 273, 1409, 589, 273, 1140, 18, 803, 18, 5701, 12, 7020, 67, 7066, 18, 4883, 67, 4537, 16, 1544, 13, 283, 3710, 273, 599, 309, 460, 422, 374, 30, 468, 1716, 685, 2155, 775, 30, 4253, 273, 1696, 12, 803, 13, 1335, 8340, 30, 468, 732, 13557, 326, 883, 977, 585, 18, 225, 2721, 731, 3134, 23867, 10102, 310, 468, 471, 1002, 392, 1520, 18, 1002, 9372, 18, 19024, 44, 488, 1079, 12, 803, 13, 1234, 273, 2350, 18, 1079, 12, 7944, 13, 1234, 892, 3292, 25990, 3546, 273, 404, 468, 2305, 327, 460, 4663, 2557, 18, 20813, 25772, 12, 2890, 16, 1234, 16, 1234, 892, 13, 1327, 460, 422, 404, 30, 468, 868, 6059, 283, 3710, 273, 296, 1957, 3668, 11, 309, 486, 365, 18, 72, 1580, 67, 17863, 67, 869, 67, 2767, 67, 11420, 30, 365, 16186, 1734, 1202, 2668, 3349, 310, 434, 3433, 883, 268, 305, 1259, 2213, 87, 5187, 738, 3221, 16, 5793, 16, 2879, 578, 5271, 2279, 3971, 864, 3864, 13, 469, 30, 1815, 460, 422, 576, 468, 3035, 16500, 283, 3710, 273, 296, 2 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 4110, 2767, 12, 2890, 16, 1409, 16, 460, 16, 2879, 4672, 468, 2457, 12727, 8926, 598, 675, 576, 18, 20, 5758, 23, 309, 562, 12, 3366, 13, 422, 1381, 30, 293, 957, 16, 5793, 16, 3221, 16, 3971, 16, 1544, 273, 1409, 1234, 892, 273, 2618, 469, 30, 468, 1166, 740, 434, 1409, 293, 957, 16, 5793, 16, 3221, 16, 3971, 16, 1544, 16, 1234, 892, 273, 1409, 589, 273, 1140, 18, 803, 18, 5701, 12, 7020, 67, 7066, 18, 4883, 67, 4537, 16, 1544, 13, 283, 3710, 273, 599, 309, 460, 422, 374, 30, 468, 1716, 685, 2155, 775, 30, 4253, 273, 1696, 12, 803, 13, 1335, 8340, 30, 468, 732, 13557, 326, 883, 977, 585, 2 ]

tc = 1.0/max(abs(vals.real)) T = arange(0,8*tc,8*tc / float(N))

tc = 1.0/max(abs(real(vals))) T = arange(0,10*tc,10*tc / float(N))

def impulse(system, X0=None, T=None, N=None): if isinstance(system, lti): sys = system else: sys = lti(*system) if X0 is None: B = sys.B else: B = sys.B + X0 if N is None: N = 100 if T is None: vals = linalg.eigvals(sys.A) tc = 1.0/max(abs(vals.real)) T = arange(0,8*tc,8*tc / float(N)) h = zeros(T.shape, sys.A.typecode()) for k in range(len(h)): eA = Mat(linalg.expm(sys.A*T[k])) B,C = map(Mat, (B,sys.C)) h[k] = squeeze(C*eA*B) return T, h

268e9b5bffbd8a297de272073e03dd07dffaa5bc /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/12971/268e9b5bffbd8a297de272073e03dd07dffaa5bc/ltisys.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1646, 24667, 12, 4299, 16, 1139, 20, 33, 7036, 16, 399, 33, 7036, 16, 423, 33, 7036, 4672, 309, 1549, 12, 4299, 16, 20197, 4672, 2589, 273, 2619, 469, 30, 2589, 273, 20197, 30857, 4299, 13, 309, 1139, 20, 353, 599, 30, 605, 273, 2589, 18, 38, 469, 30, 605, 273, 2589, 18, 38, 397, 1139, 20, 309, 423, 353, 599, 30, 423, 273, 2130, 309, 399, 353, 599, 30, 5773, 273, 11818, 18, 22663, 4524, 12, 9499, 18, 37, 13, 1715, 273, 404, 18, 20, 19, 1896, 12, 5113, 12, 7688, 12, 4524, 20349, 399, 273, 9660, 12, 20, 16, 2163, 14, 5111, 16, 2163, 14, 5111, 342, 1431, 12, 50, 3719, 366, 273, 4922, 12, 56, 18, 4867, 16, 2589, 18, 37, 18, 723, 710, 10756, 364, 417, 316, 1048, 12, 1897, 12, 76, 3719, 30, 425, 37, 273, 14493, 12, 80, 11521, 18, 2749, 81, 12, 9499, 18, 37, 14, 56, 63, 79, 22643, 605, 16, 39, 273, 852, 12, 15947, 16, 261, 38, 16, 9499, 18, 39, 3719, 366, 63, 79, 65, 273, 17173, 12, 39, 14, 73, 37, 14, 38, 13, 327, 399, 16, 366, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1646, 24667, 12, 4299, 16, 1139, 20, 33, 7036, 16, 399, 33, 7036, 16, 423, 33, 7036, 4672, 309, 1549, 12, 4299, 16, 20197, 4672, 2589, 273, 2619, 469, 30, 2589, 273, 20197, 30857, 4299, 13, 309, 1139, 20, 353, 599, 30, 605, 273, 2589, 18, 38, 469, 30, 605, 273, 2589, 18, 38, 397, 1139, 20, 309, 423, 353, 599, 30, 423, 273, 2130, 309, 399, 353, 599, 30, 5773, 273, 11818, 18, 22663, 4524, 12, 9499, 18, 37, 13, 1715, 273, 404, 18, 20, 19, 1896, 12, 5113, 12, 7688, 12, 4524, 20349, 399, 273, 9660, 12, 20, 16, 2163, 14, 5111, 16, 2163, 14, 5111, 342, 1431, 12, 50, 3719, 366, 273, 4922, 12, 56, 2 ]

if type_datum is UnicodeType:

type_datum = type(datum) if type_datum == UnicodeType:

def SearchableText(self): """All fields marked as 'searchable' are concatenated together here for indexing purpose""" data = [] charset = self.getCharset() for field in self.Schema().fields(): if not field.searchable: continue method = field.getAccessor(self) try: datum = method(mimetype="text/plain") except TypeError: # retry in case typeerror was raised because accessor doesn't # handle the mimetype argument try: datum = method() except: continue

f0ae295d4e54409254bff207c9403071e6554fe7 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/12165/f0ae295d4e54409254bff207c9403071e6554fe7/BaseObject.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 5167, 429, 1528, 12, 2890, 4672, 3536, 1595, 1466, 9350, 487, 296, 3072, 429, 11, 854, 22080, 9475, 2674, 364, 14403, 13115, 8395, 501, 273, 5378, 4856, 273, 365, 18, 588, 9652, 1435, 364, 652, 316, 365, 18, 3078, 7675, 2821, 13332, 309, 486, 652, 18, 3072, 429, 30, 1324, 707, 273, 652, 18, 588, 8235, 12, 2890, 13, 775, 30, 12059, 273, 225, 707, 12, 22571, 1546, 955, 19, 7446, 7923, 1335, 3580, 30, 468, 3300, 316, 648, 618, 1636, 1703, 11531, 2724, 9789, 3302, 1404, 468, 1640, 326, 12595, 1237, 775, 30, 12059, 273, 225, 707, 1435, 1335, 30, 1324, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 5167, 429, 1528, 12, 2890, 4672, 3536, 1595, 1466, 9350, 487, 296, 3072, 429, 11, 854, 22080, 9475, 2674, 364, 14403, 13115, 8395, 501, 273, 5378, 4856, 273, 365, 18, 588, 9652, 1435, 364, 652, 316, 365, 18, 3078, 7675, 2821, 13332, 309, 486, 652, 18, 3072, 429, 30, 1324, 707, 273, 652, 18, 588, 8235, 12, 2890, 13, 775, 30, 12059, 273, 225, 707, 12, 22571, 1546, 955, 19, 7446, 7923, 1335, 3580, 30, 468, 3300, 316, 648, 618, 1636, 1703, 11531, 2724, 9789, 3302, 1404, 468, 1640, 326, 12595, 1237, 775, 30, 12059, 273, 225, 707, 1435, 1335, 30, 1324, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]

except EOFError: typ, dat = None, [None]

except: typ, dat = 'NO', ['%s: %s' % sys.exc_info()[:2]]

def logout(self): """Shutdown connection to server.

30d7469fec69eeeae9057b22a126d4a00278147c /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/12029/30d7469fec69eeeae9057b22a126d4a00278147c/imaplib.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 12735, 12, 2890, 4672, 3536, 10961, 1459, 358, 1438, 18, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 12735, 12, 2890, 4672, 3536, 10961, 1459, 358, 1438, 18, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]

class TopVirusesDetected(reports.Graph):

class TopWebVirusesDetected(reports.Graph):

def get_plot(self, end_date, report_days, host=None, user=None, email=None): ed = DateFromMx(end_date) one_week = DateFromMx(end_date - mx.DateTime.DateTimeDelta(report_days))

105b5e27bf63d007da247194879b178db12c5076 /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/87/105b5e27bf63d007da247194879b178db12c5076/untangle_base_virus.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 336, 67, 4032, 12, 2890, 16, 679, 67, 712, 16, 2605, 67, 9810, 16, 1479, 33, 7036, 16, 729, 33, 7036, 16, 2699, 33, 7036, 4672, 1675, 273, 2167, 1265, 49, 92, 12, 409, 67, 712, 13, 1245, 67, 10741, 273, 2167, 1265, 49, 92, 12, 409, 67, 712, 300, 7938, 18, 5096, 18, 5096, 9242, 12, 6006, 67, 9810, 3719, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 336, 67, 4032, 12, 2890, 16, 679, 67, 712, 16, 2605, 67, 9810, 16, 1479, 33, 7036, 16, 729, 33, 7036, 16, 2699, 33, 7036, 4672, 1675, 273, 2167, 1265, 49, 92, 12, 409, 67, 712, 13, 1245, 67, 10741, 273, 2167, 1265, 49, 92, 12, 409, 67, 712, 300, 7938, 18, 5096, 18, 5096, 9242, 12, 6006, 67, 9810, 3719, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]

"Could not find example root directory. Do you have the " \

"Could not find example root directory. Do you have the" \

def test_get_test_path(): assert os.path.isdir(get_example_path('')), \ "Could not find example root directory. Do you have the " \ + " whole repository structure checked out?"

51cce200bcae1cb17e93d25a05a967a88116f114 /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/7711/51cce200bcae1cb17e93d25a05a967a88116f114/jmitest.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1842, 67, 588, 67, 3813, 67, 803, 13332, 1815, 1140, 18, 803, 18, 291, 1214, 12, 588, 67, 8236, 67, 803, 2668, 6134, 3631, 521, 315, 4445, 486, 1104, 3454, 1365, 1867, 18, 2256, 1846, 1240, 326, 6, 521, 397, 315, 7339, 3352, 3695, 5950, 596, 7225, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1842, 67, 588, 67, 3813, 67, 803, 13332, 1815, 1140, 18, 803, 18, 291, 1214, 12, 588, 67, 8236, 67, 803, 2668, 6134, 3631, 521, 315, 4445, 486, 1104, 3454, 1365, 1867, 18, 2256, 1846, 1240, 326, 6, 521, 397, 315, 7339, 3352, 3695, 5950, 596, 7225, 225, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]

guess = self.add(bank, 077777 & ~bugger)

guess = self._add(bank, 077777 & ~bugger)

def __init__(self, context): self.context = context # Assembler context. self.objectCode = {}

17f6f0cbe742001a56ee33de28087b87c16288b2 /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/8152/17f6f0cbe742001a56ee33de28087b87c16288b2/binary.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 2890, 16, 819, 4672, 365, 18, 2472, 273, 819, 2868, 468, 2970, 5747, 749, 819, 18, 365, 18, 1612, 1085, 273, 2618, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 2890, 16, 819, 4672, 365, 18, 2472, 273, 819, 2868, 468, 2970, 5747, 749, 819, 18, 365, 18, 1612, 1085, 273, 2618, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]

(cSuccess, cResult), (sSuccess, sResult) = util.deferredResult(d) self.failIf(cSuccess) self.failIf(sSuccess) errors = log.flushErrors(SSL.Error)

def afterLost(((cSuccess, cResult), (sSuccess, sResult))): self.failIf(cSuccess) self.failIf(sSuccess) return d.addCallback(afterLost)

def testRefusedAnonymousClientConnection(self): onServerLost = defer.Deferred() onClientLost = defer.Deferred() self.loopback(sslverify.OpenSSLCertificateOptions(privateKey=self.sKey, certificate=self.sCert, verify=True, caCerts=[self.sCert], requireCertificate=True), sslverify.OpenSSLCertificateOptions(requireCertificate=False), onServerLost=onServerLost, onClientLost=onClientLost)

6305a011c61d2e3075143d6d1aac62b453e35f67 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/8962/6305a011c61d2e3075143d6d1aac62b453e35f67/test_sslverify.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1842, 1957, 3668, 18792, 1227, 1952, 12, 2890, 4672, 603, 2081, 19024, 273, 2220, 18, 16886, 1435, 603, 1227, 19024, 273, 2220, 18, 16886, 1435, 365, 18, 6498, 823, 12, 8157, 8705, 18, 3678, 6745, 4719, 1320, 12, 1152, 653, 33, 2890, 18, 87, 653, 16, 4944, 33, 2890, 18, 87, 5461, 16, 3929, 33, 5510, 16, 3474, 16273, 22850, 2890, 18, 87, 5461, 6487, 2583, 4719, 33, 5510, 3631, 5832, 8705, 18, 3678, 6745, 4719, 1320, 12, 6528, 4719, 33, 8381, 3631, 603, 2081, 19024, 33, 265, 2081, 19024, 16, 603, 1227, 19024, 33, 265, 1227, 19024, 13, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1842, 1957, 3668, 18792, 1227, 1952, 12, 2890, 4672, 603, 2081, 19024, 273, 2220, 18, 16886, 1435, 603, 1227, 19024, 273, 2220, 18, 16886, 1435, 365, 18, 6498, 823, 12, 8157, 8705, 18, 3678, 6745, 4719, 1320, 12, 1152, 653, 33, 2890, 18, 87, 653, 16, 4944, 33, 2890, 18, 87, 5461, 16, 3929, 33, 5510, 16, 3474, 16273, 22850, 2890, 18, 87, 5461, 6487, 2583, 4719, 33, 5510, 3631, 5832, 8705, 18, 3678, 6745, 4719, 1320, 12, 6528, 4719, 33, 8381, 3631, 603, 2081, 19024, 33, 265, 2081, 19024, 16, 603, 1227, 19024, 33, 265, 1227, 19024, 13, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]

return html2unicode(s, language = incode)

return unicodeName(s, language = incode)

def interwikiFormat(links, incode): """Create a suitable string to start a wikipedia page consisting of interwikilinks given as a dictionary of code:pagename in the argument. """ s = [] ar = links.keys() ar.sort() if mylang in config.interwiki_englishfirst: if 'en' in ar: del ar[ar.index('en')] ar[:0]=['en'] for code in ar: try: s.append(links[code].aslink()) except AttributeError: s.append('[[%s:%s]]' % (code, links[code])) s=config.interwiki_langs_separator.join(s) + '\r\n' return html2unicode(s, language = incode)

b62f0c7652f84c145d97d46d58d9c2d64f35ee08 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/4404/b62f0c7652f84c145d97d46d58d9c2d64f35ee08/wikipedia.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1554, 13044, 1630, 12, 7135, 16, 316, 710, 4672, 3536, 1684, 279, 10631, 533, 358, 787, 279, 21137, 1363, 23570, 434, 1554, 11999, 330, 754, 87, 864, 487, 279, 3880, 434, 981, 30, 9095, 1069, 316, 326, 1237, 18, 3536, 272, 273, 5378, 419, 273, 4716, 18, 2452, 1435, 419, 18, 3804, 1435, 309, 3399, 4936, 316, 642, 18, 2761, 13044, 67, 275, 13740, 3645, 30, 309, 296, 275, 11, 316, 419, 30, 1464, 419, 63, 297, 18, 1615, 2668, 275, 6134, 65, 419, 10531, 20, 65, 33, 3292, 275, 3546, 364, 981, 316, 419, 30, 775, 30, 272, 18, 6923, 12, 7135, 63, 710, 8009, 345, 1232, 10756, 1335, 6394, 30, 272, 18, 6923, 2668, 63, 14451, 87, 5319, 87, 65, 3864, 738, 261, 710, 16, 4716, 63, 710, 22643, 272, 33, 1425, 18, 2761, 13044, 67, 4936, 87, 67, 11287, 18, 5701, 12, 87, 13, 397, 2337, 86, 64, 82, 11, 327, 5252, 461, 12, 87, 16, 2653, 273, 316, 710, 13, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1554, 13044, 1630, 12, 7135, 16, 316, 710, 4672, 3536, 1684, 279, 10631, 533, 358, 787, 279, 21137, 1363, 23570, 434, 1554, 11999, 330, 754, 87, 864, 487, 279, 3880, 434, 981, 30, 9095, 1069, 316, 326, 1237, 18, 3536, 272, 273, 5378, 419, 273, 4716, 18, 2452, 1435, 419, 18, 3804, 1435, 309, 3399, 4936, 316, 642, 18, 2761, 13044, 67, 275, 13740, 3645, 30, 309, 296, 275, 11, 316, 419, 30, 1464, 419, 63, 297, 18, 1615, 2668, 275, 6134, 65, 419, 10531, 20, 65, 33, 3292, 275, 3546, 364, 981, 316, 419, 30, 775, 30, 272, 18, 6923, 12, 7135, 63, 710, 8009, 345, 1232, 10756, 1335, 6394, 30, 272, 18, 6923, 2668, 63, 14451, 2 ]

sync_open = sync_open sync_read = sync_read sync_close = sync_close

def producer_stalled (self): return not ( self.async_closed or len (self.async_buffers) > 0 )

d682bff8b8919db3c121c9b1fc5bed856eb8f68b /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/2577/d682bff8b8919db3c121c9b1fc5bed856eb8f68b/synchronized.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 12608, 67, 334, 4502, 261, 2890, 4672, 327, 486, 261, 365, 18, 3810, 67, 12204, 578, 562, 261, 2890, 18, 3810, 67, 28101, 13, 405, 374, 262, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 12608, 67, 334, 4502, 261, 2890, 4672, 327, 486, 261, 365, 18, 3810, 67, 12204, 578, 562, 261, 2890, 18, 3810, 67, 28101, 13, 405, 374, 262, 225, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]

def unicode_internal_decode( unistr,errors='strict'): """None """ if type(unistr) == unicode: return unistr,len(unistr) else: return unicode(unistr),len(unistr)

def utf_16_be_encode( obj,errors='strict'): """None """ res = PyUnicode_EncodeUTF16(obj,len(obj),errors,'big') res = ''.join(res) return res, len(res)

43ce23feb40aadc6a6a9c31d19c968e0351f9245 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/6934/43ce23feb40aadc6a6a9c31d19c968e0351f9245/inprogress__codecs.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 7718, 67, 2313, 67, 2196, 67, 3015, 12, 1081, 16, 4324, 2218, 13948, 11, 4672, 3536, 7036, 3536, 400, 273, 4707, 16532, 67, 5509, 5159, 2313, 12, 2603, 16, 1897, 12, 2603, 3631, 4324, 11189, 14002, 6134, 400, 273, 875, 18, 5701, 12, 455, 13, 327, 400, 16, 562, 12, 455, 13, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 7718, 67, 2313, 67, 2196, 67, 3015, 12, 1081, 16, 4324, 2218, 13948, 11, 4672, 3536, 7036, 3536, 400, 273, 4707, 16532, 67, 5509, 5159, 2313, 12, 2603, 16, 1897, 12, 2603, 3631, 4324, 11189, 14002, 6134, 400, 273, 875, 18, 5701, 12, 455, 13, 327, 400, 16, 562, 12, 455, 13, 225, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]

dir.Append(Function(VideoItem(PlayVideo,video.text,thumb=R(ICON),art=R(ART)),link = video.get("href")))

dir.Append(Function(VideoItem(PlayVideo,video.text),link = video.get("href")))

def ParseSearchResults(sender, query=None): dir = MediaContainer(viewGroup="InfoList") results = HTML.ElementFromURL('http://www.khanacademy.org/search?page_search_query='+query).xpath("//section[@class='videos']//dt/a") if results == []: return MessageContainer('No Results','No video file could be found for the following query: '+query) for video in results: dir.Append(Function(VideoItem(PlayVideo,video.text,thumb=R(ICON),art=R(ART)),link = video.get("href"))) return dir

f4c8dcb66d81d6ad90a3b46a428caddbc823b2dd /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/14350/f4c8dcb66d81d6ad90a3b46a428caddbc823b2dd/__init__.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 2884, 2979, 3447, 12, 15330, 16, 843, 33, 7036, 4672, 225, 1577, 273, 6128, 2170, 12, 1945, 1114, 1546, 17914, 7923, 225, 1686, 273, 3982, 18, 1046, 1265, 1785, 2668, 2505, 2207, 5591, 18, 79, 25842, 1077, 2486, 4811, 18, 3341, 19, 3072, 35, 2433, 67, 3072, 67, 2271, 2218, 15, 2271, 2934, 18644, 2932, 759, 3464, 14782, 1106, 2218, 6768, 538, 3546, 759, 7510, 19, 69, 7923, 225, 309, 1686, 422, 5378, 30, 327, 2350, 2170, 2668, 2279, 10351, 17023, 2279, 6191, 585, 3377, 506, 1392, 364, 326, 3751, 843, 30, 15126, 2271, 13, 225, 364, 6191, 316, 1686, 30, 1577, 18, 5736, 12, 2083, 12, 10083, 1180, 12, 11765, 10083, 16, 9115, 18, 955, 3631, 1232, 273, 6191, 18, 588, 2932, 7547, 6, 20349, 225, 327, 1577, 225, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 2884, 2979, 3447, 12, 15330, 16, 843, 33, 7036, 4672, 225, 1577, 273, 6128, 2170, 12, 1945, 1114, 1546, 17914, 7923, 225, 1686, 273, 3982, 18, 1046, 1265, 1785, 2668, 2505, 2207, 5591, 18, 79, 25842, 1077, 2486, 4811, 18, 3341, 19, 3072, 35, 2433, 67, 3072, 67, 2271, 2218, 15, 2271, 2934, 18644, 2932, 759, 3464, 14782, 1106, 2218, 6768, 538, 3546, 759, 7510, 19, 69, 7923, 225, 309, 1686, 422, 5378, 30, 327, 2350, 2170, 2668, 2279, 10351, 17023, 2279, 6191, 585, 3377, 506, 1392, 364, 326, 3751, 843, 30, 15126, 2271, 13, 225, 364, 6191, 316, 1686, 30, 1577, 18, 5736, 12, 2083, 12, 10083, 1180, 12, 11765, 10083, 16, 9115, 18, 955, 3631, 1232, 2 ]

def __init__(self, out=None):

def __init__(self, out=None, encoding="iso-8859-1"):

def __init__(self, out=None): if out is None: import sys out = sys.stdout handler.ContentHandler.__init__(self) self._out = out

d2e8ed58c83ecc5390d6cf99651b791350b04e61 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/8125/d2e8ed58c83ecc5390d6cf99651b791350b04e61/saxutils.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 2890, 16, 596, 33, 7036, 16, 2688, 1546, 9699, 17, 17258, 17, 21, 6, 4672, 309, 596, 353, 599, 30, 1930, 2589, 596, 273, 2589, 18, 10283, 1838, 18, 1350, 1503, 16186, 2738, 972, 12, 2890, 13, 365, 6315, 659, 273, 596, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 2890, 16, 596, 33, 7036, 16, 2688, 1546, 9699, 17, 17258, 17, 21, 6, 4672, 309, 596, 353, 599, 30, 1930, 2589, 596, 273, 2589, 18, 10283, 1838, 18, 1350, 1503, 16186, 2738, 972, 12, 2890, 13, 365, 6315, 659, 273, 596, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]

output(u'Image deleted before getting the Hash. Skipping...')

output(u'File deleted before getting the Hash. Skipping...')

def getHash(self): """ Function that return the Hash of an image in oder to understand if two Images are the same or not. """ if self.exists(): params = { 'action' :'query', 'titles' :self.title(), 'prop' :'imageinfo', 'iiprop' :'sha1', } # First of all we need the Hash that identify an image data = query.GetData(params, useAPI = True, encodeTitle = False) pageid = data['query']['pages'].keys()[0] try: hash_found = data['query']['pages'][pageid][u'imageinfo'][0][u'sha1'] except (KeyError, IndexError): if self.exists(): raise NoHash('No Hash found in the APIs! Maybe the regex to catch it is wrong or someone has changed the APIs structure.') else: output(u'Image deleted before getting the Hash. Skipping...') return None else: return hash_found else: output(u'Image deleted before getting the Hash. Skipping...') return None

b4e6dbf405f65d45e84baeb5508d02d04da189c0 /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/4404/b4e6dbf405f65d45e84baeb5508d02d04da189c0/wikipedia.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 16075, 12, 2890, 4672, 3536, 4284, 716, 327, 326, 2474, 434, 392, 1316, 316, 320, 765, 358, 22413, 309, 2795, 23022, 854, 326, 1967, 578, 486, 18, 3536, 309, 365, 18, 1808, 13332, 859, 273, 288, 296, 1128, 11, 565, 22974, 2271, 2187, 296, 17643, 11, 565, 294, 2890, 18, 2649, 9334, 296, 5986, 11, 1377, 22974, 2730, 1376, 2187, 296, 77, 625, 1764, 11, 565, 22974, 7819, 21, 2187, 289, 468, 5783, 434, 777, 732, 1608, 326, 2474, 716, 9786, 392, 1316, 501, 273, 843, 18, 967, 751, 12, 2010, 16, 999, 2557, 273, 1053, 16, 2017, 4247, 273, 1083, 13, 1363, 350, 273, 501, 3292, 2271, 21712, 7267, 29489, 2452, 1435, 63, 20, 65, 775, 30, 1651, 67, 7015, 273, 501, 3292, 2271, 21712, 7267, 3546, 63, 30974, 6362, 89, 11, 2730, 1376, 3546, 63, 20, 6362, 89, 1807, 3395, 21, 3546, 1335, 261, 653, 668, 16, 10195, 4672, 309, 365, 18, 1808, 13332, 1002, 2631, 2310, 2668, 2279, 2474, 1392, 316, 326, 19947, 5, 14024, 326, 3936, 358, 1044, 518, 353, 7194, 578, 18626, 711, 3550, 326, 19947, 3695, 1093, 13, 469, 30, 876, 12, 89, 11, 812, 4282, 1865, 8742, 326, 2474, 18, 27455, 7821, 13, 327, 599, 469, 30, 327, 1651, 67, 7015, 469, 30, 876, 12, 89, 11, 812, 4282, 1865, 8742, 326, 2474, 18, 27455, 7821, 13, 327, 599, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 16075, 12, 2890, 4672, 3536, 4284, 716, 327, 326, 2474, 434, 392, 1316, 316, 320, 765, 358, 22413, 309, 2795, 23022, 854, 326, 1967, 578, 486, 18, 3536, 309, 365, 18, 1808, 13332, 859, 273, 288, 296, 1128, 11, 565, 22974, 2271, 2187, 296, 17643, 11, 565, 294, 2890, 18, 2649, 9334, 296, 5986, 11, 1377, 22974, 2730, 1376, 2187, 296, 77, 625, 1764, 11, 565, 22974, 7819, 21, 2187, 289, 468, 5783, 434, 777, 732, 1608, 326, 2474, 716, 9786, 392, 1316, 501, 273, 843, 18, 967, 751, 12, 2010, 16, 999, 2557, 273, 1053, 16, 2017, 4247, 273, 1083, 13, 1363, 350, 273, 501, 3292, 2271, 21712, 7267, 29489, 2452, 1435, 63, 20, 65, 775, 30, 2 ]

if dep1[0] == 'T' or dep1[0:2] == 'IT': return depUpdateRules[dep2][dep1] return depUpdateRules[dep1][dep2]

dep1_required = isRequiredDep(dep1) dep1_direct = isDirectDep(dep1) dep1_lib = isLibDep(dep1) dep2_required = isRequiredDep(dep2) dep2_direct = isDirectDep(dep2) dep2_lib = isLibDep(dep2) selectedDep = False if dep1 == dep2: newDep = dep1 selectedDep = True if not selectedDep: if dep1_required and not dep2_required: newDep = dep1 selectedDep = True elif not dep1_required and dep2_required: newDep = dep2 selectedDep = True if not selectedDep: if dep1_direct and not dep2_direct: newDep = dep1 selectedDep = True elif not dep1_direct and dep2_direct: newDep = dep2 selectedDep = True if not selectedDep: if dep1_lib and not dep2_lib: newDep = dep1 selectedDep = True elif not dep1_lib and dep2_lib: newDep = dep2 selectedDep = True assert(selectedDep) return newDep

def updatePackageDep(dep1, dep2): if dep1[0] == 'T' or dep1[0:2] == 'IT': return depUpdateRules[dep2][dep1] return depUpdateRules[dep1][dep2]

14ce9fd4920947e5f8b1813e1f49ee4adffd7eaf /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/1130/14ce9fd4920947e5f8b1813e1f49ee4adffd7eaf/TrilinosDependencies.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1089, 2261, 16316, 12, 15037, 21, 16, 5993, 22, 4672, 565, 5993, 21, 67, 4718, 273, 14967, 16316, 12, 15037, 21, 13, 5993, 21, 67, 7205, 273, 353, 5368, 16316, 12, 15037, 21, 13, 5993, 21, 67, 2941, 273, 353, 5664, 16316, 12, 15037, 21, 13, 225, 5993, 22, 67, 4718, 273, 14967, 16316, 12, 15037, 22, 13, 5993, 22, 67, 7205, 273, 353, 5368, 16316, 12, 15037, 22, 13, 5993, 22, 67, 2941, 273, 353, 5664, 16316, 12, 15037, 22, 13, 225, 3170, 16316, 273, 1083, 225, 309, 5993, 21, 422, 5993, 22, 30, 394, 16316, 273, 5993, 21, 3170, 16316, 273, 1053, 282, 309, 486, 3170, 16316, 30, 309, 5993, 21, 67, 4718, 471, 486, 5993, 22, 67, 4718, 30, 394, 16316, 273, 5993, 21, 3170, 16316, 273, 1053, 1327, 486, 5993, 21, 67, 4718, 471, 5993, 22, 67, 4718, 30, 394, 16316, 273, 5993, 22, 3170, 16316, 273, 1053, 282, 309, 486, 3170, 16316, 30, 309, 5993, 21, 67, 7205, 471, 486, 5993, 22, 67, 7205, 30, 394, 16316, 273, 5993, 21, 3170, 16316, 273, 1053, 1327, 486, 5993, 21, 67, 7205, 471, 5993, 22, 67, 7205, 30, 394, 16316, 273, 5993, 22, 3170, 16316, 273, 1053, 282, 309, 486, 3170, 16316, 30, 309, 5993, 21, 67, 2941, 471, 486, 5993, 22, 67, 2941, 30, 394, 16316, 273, 5993, 21, 3170, 16316, 273, 1053, 1327, 486, 5993, 21, 67, 2941, 471, 5993, 22, 67, 2941, 30, 394, 16316, 273, 5993, 22, 3170, 16316, 2 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1089, 2261, 16316, 12, 15037, 21, 16, 5993, 22, 4672, 565, 5993, 21, 67, 4718, 273, 14967, 16316, 12, 15037, 21, 13, 5993, 21, 67, 7205, 273, 353, 5368, 16316, 12, 15037, 21, 13, 5993, 21, 67, 2941, 273, 353, 5664, 16316, 12, 15037, 21, 13, 225, 5993, 22, 67, 4718, 273, 14967, 16316, 12, 15037, 22, 13, 5993, 22, 67, 7205, 273, 353, 5368, 16316, 12, 15037, 22, 13, 5993, 22, 67, 2941, 273, 353, 5664, 16316, 12, 15037, 22, 13, 225, 3170, 16316, 273, 1083, 225, 309, 5993, 21, 422, 5993, 22, 30, 394, 16316, 273, 5993, 21, 3170, 16316, 273, 1053, 282, 309, 486, 3170, 16316, 30, 309, 5993, 21, 67, 4718, 471, 486, 5993, 2 ]

interncolumns = ("process_id", "coinc_def_id", "time_slide_id")

interncolumns = ("process_id", "coinc_def_id", "time_slide_id", "instruments")

def __init__(self, **kwargs): for name, value in kwargs.items(): setattr(self, name, value)

000180bdcfe2998f4dda83d9ae557ed3d6f0b3aa /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/3589/000180bdcfe2998f4dda83d9ae557ed3d6f0b3aa/lsctables.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 2890, 16, 2826, 4333, 4672, 364, 508, 16, 460, 316, 1205, 18, 3319, 13332, 9241, 12, 2890, 16, 508, 16, 460, 13, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1001, 2738, 972, 12, 2890, 16, 2826, 4333, 4672, 364, 508, 16, 460, 316, 1205, 18, 3319, 13332, 9241, 12, 2890, 16, 508, 16, 460, 13, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]

database doesn't exist).

database doesn't exist). defaults to 0.

def newdb(request): """Create a new database. Accepts POST requests only. If the database already exists: - if overwrite is 1, replaces the database completely with a new one (deleting all the contents). - otherwise, returns an error. Supported parameters: - `db_name`: contains the name of the database. - `fields`: the field parameters (see the client for documentation for now: major FAIL, FIXME) - `overwrite`: if 1, the database already exists, instead of returning an error, remove it and create it anew. (doesn't affect behaviour if database doesn't exist). """ params = validate_params(request.POST, { 'db_name': (1, 1, '^\w+$', None), 'fields': (1, 1, None, None), 'overwrite': (0, 1, '^[01]$', [0]), }) db_name = params['db_name'][0] db_path = os.path.realpath(get_db_path(db_name)) if os.path.exists(db_path): if not params['overwrite']: raise DatabaseExistsError("The path for '%s' is already in use" % db_path) else: shutil.rmtree(db_path) if not os.path.exists(os.path.dirname(db_path)): os.makedirs(os.path.dirname(db_path)) db = xappy.IndexerConnection(db_path) try: try: # Set up the field actions from fields config = simplejson.loads(params['fields'][0]) # FIXME -perhaps we should validate here? for settings in config: validate_dict_entries(settings, valid_field_config_keys, 'Invalid field setting parameter(s): %s') field_name = settings.get('field_name', None) if field_name is None: raise ValidationError("Missing field_name parameter") field_type = settings.get('type', 'text') if field_type not in ('text', 'date', 'float', 'geo'): raise ValidationError("Unknown field_type parameter %s" % field_type) if settings.get('store', False): db.add_field_action(field_name, xappy.FieldActions.STORE_CONTENT) #spelling_word_source = settings.get('spelling_word_source', False) #collapsible = settings.get('collapsible', False) #sortable = settings.get('sortable', False) #range_searchable = settings.get('range_searchable', False) #is_document_weight = settings.get('is_document_weight', False) noindex = settings.get('noindex', False) freetext_params = settings.get('freetext', None) exacttext_params = settings.get('exacttext', None) if (freetext_params is not None and exacttext_params is not None): raise ValidationError( "Field settings for %s specify both 'freetext' and " "'exacttext' for a single field - at most one may be " "specified") if freetext_params is not None and noindex: raise ValidationError( "Field settings for %s specify both 'freetext' and " "'noindex' for a single field - at most one may be " "specified") if exacttext_params is not None and noindex: raise ValidationError( "Field settings for %s specify both 'exacttext' and " "'noindex' for a single field - at most one may be " "specified") if (freetext_params is not None or exacttext_params is not None): if field_type != 'text': raise ValidationError( "Text searching options specified, but field type " "is not text") if freetext_params is not None or ( field_type == 'text' and freetext_params is None and exacttext_params is None and not noindex): if freetext_params is None: freetext_params = {} validate_dict_entries(freetext_params, valid_freetext_options, 'Invalid freetext option(s): %s') opts = {} lang = freetext_params.get('language', None) if lang is not None: opts['language'] = lang opts['weight'] = freetext_params.get('term_frequency_multiplier', 1) phrase = freetext_params.get('enable_phrase_search', True) if not phrase: opts['nopos'] = True index_groups = freetext_params.get('index_groups', ['_FIELD_INDEX', '_GENERAL_INDEX']) db.add_field_action(field_name, xappy.FieldActions.INDEX_FREETEXT, **opts) if exacttext_params is not None: #FIXME - implement raise ValidationError("exacttext not yet implemented") geo_params = settings.get('geo', None) if geo_params is not None and noindex: raise ValidationError( "Field settings for %s specify both 'geo' and " "'noindex' for a single field - at most one may be " "specified") if geo_params is not None: if field_type != 'geo': raise ValidationError( "Text searching options specified, but field type " "is not text") if geo_params is not None or ( field_type == 'geo' and geo_params is None and not noindex): if geo_params is None: geo_params = {} validate_dict_entries(geo_params, valid_geo_options, 'Invalid freetext option(s): %s') bounding_box_search = geo_params.get('enable_bounding_box_search', True) range_search = geo_params.get('enable_range_search', True) # Geolocation action (for sorting by distance). db.add_field_action(field_name, xappy.FieldActions.GEOLOCATION) if bounding_box_search or range_search: pass # FIXME - need to do something to index these. db.flush() finally: db.close() except: del db shutil.rmtree(db_path) dircache.reset() raise dircache.reset() return {'ok': 1}

3260c6ea689f17a1576be97ccd98b27460457131 /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/9909/3260c6ea689f17a1576be97ccd98b27460457131/search.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 394, 1966, 12, 2293, 4672, 3536, 1684, 279, 394, 2063, 18, 225, 27158, 5485, 3285, 1338, 18, 225, 971, 326, 2063, 1818, 1704, 30, 300, 309, 6156, 353, 404, 16, 12878, 326, 2063, 14416, 598, 279, 394, 1245, 261, 19003, 310, 777, 326, 2939, 2934, 300, 3541, 16, 1135, 392, 555, 18, 225, 19503, 1472, 30, 225, 300, 1375, 1966, 67, 529, 68, 30, 1914, 326, 508, 434, 326, 2063, 18, 300, 1375, 2821, 68, 30, 326, 652, 1472, 261, 5946, 326, 1004, 364, 7323, 364, 2037, 30, 7888, 15806, 16, 9852, 13, 300, 1375, 19274, 68, 30, 309, 404, 16, 326, 2063, 1818, 1704, 16, 3560, 434, 5785, 392, 555, 16, 1206, 518, 471, 752, 518, 392, 359, 18, 261, 20657, 82, 1404, 13418, 14273, 309, 2063, 3302, 1404, 1005, 2934, 225, 3467, 358, 374, 18, 225, 3536, 859, 273, 1954, 67, 2010, 12, 2293, 18, 3798, 16, 288, 296, 1966, 67, 529, 4278, 261, 21, 16, 404, 16, 10731, 64, 91, 26020, 2187, 599, 3631, 296, 2821, 4278, 261, 21, 16, 404, 16, 599, 16, 599, 3631, 296, 19274, 4278, 261, 20, 16, 404, 16, 10731, 63, 1611, 65, 8, 2187, 306, 20, 65, 3631, 289, 13, 1319, 67, 529, 273, 859, 3292, 1966, 67, 529, 3546, 63, 20, 65, 1319, 67, 803, 273, 1140, 18, 803, 18, 7688, 803, 12, 588, 67, 1966, 67, 803, 12, 1966, 67, 529, 3719, 225, 309, 1140, 18, 803, 18, 1808, 12, 1966, 67, 803, 4672, 309, 2 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 394, 1966, 12, 2293, 4672, 3536, 1684, 279, 394, 2063, 18, 225, 27158, 5485, 3285, 1338, 18, 225, 971, 326, 2063, 1818, 1704, 30, 300, 309, 6156, 353, 404, 16, 12878, 326, 2063, 14416, 598, 279, 394, 1245, 261, 19003, 310, 777, 326, 2939, 2934, 300, 3541, 16, 1135, 392, 555, 18, 225, 19503, 1472, 30, 225, 300, 1375, 1966, 67, 529, 68, 30, 1914, 326, 508, 434, 326, 2063, 18, 300, 1375, 2821, 68, 30, 326, 652, 1472, 261, 5946, 326, 1004, 364, 7323, 364, 2037, 30, 7888, 15806, 16, 9852, 13, 300, 1375, 19274, 68, 30, 309, 404, 16, 326, 2063, 1818, 1704, 16, 3560, 434, 5785, 392, 555, 16, 1206, 518, 471, 752, 518, 392, 2 ]

if __debug__: onScreenDebug.render()

onScreenDebug.render()

def igLoop(self, state): if __debug__: # We render the watch variables for the onScreenDebug as soon # as we reasonably can before the renderFrame(). onScreenDebug.render()

f86c6e322c7a566a9780a7fa8a58bfb11a1e2b39 /local1/tlutelli/issta_data/temp/all_python//python/2006_temp/2006/8543/f86c6e322c7a566a9780a7fa8a58bfb11a1e2b39/ShowBase.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 18158, 6452, 12, 2890, 16, 919, 4672, 309, 1001, 4148, 972, 30, 468, 1660, 1743, 326, 4267, 3152, 364, 326, 603, 7956, 2829, 487, 17136, 468, 487, 732, 3971, 6906, 848, 1865, 326, 1743, 3219, 7675, 603, 7956, 2829, 18, 5902, 1435, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 18158, 6452, 12, 2890, 16, 919, 4672, 309, 1001, 4148, 972, 30, 468, 1660, 1743, 326, 4267, 3152, 364, 326, 603, 7956, 2829, 487, 17136, 468, 487, 732, 3971, 6906, 848, 1865, 326, 1743, 3219, 7675, 603, 7956, 2829, 18, 5902, 1435, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]

def _posHprBroadcast(self, task=DummyTask):

def _posHprBroadcast(self, task=None):

def _posHprBroadcast(self, task=DummyTask): # TODO: we explicitly stagger the initial task timing in # startPosHprBroadcast; we should at least make an effort to keep # this task accurately aligned with its period and starting time. self.d_broadcastPosHpr() task.setDelay(self.__broadcastPeriod) return Task.again

c1f013a2c877e639a2da7ee3915e0a8cf22af867 /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/7242/c1f013a2c877e639a2da7ee3915e0a8cf22af867/DistributedSmoothNodeBase.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 917, 44, 683, 15926, 12, 2890, 16, 1562, 33, 7036, 4672, 468, 2660, 30, 732, 8122, 384, 7594, 326, 2172, 1562, 15538, 316, 468, 16013, 44, 683, 15926, 31, 732, 1410, 622, 4520, 1221, 392, 23445, 358, 3455, 468, 333, 1562, 19361, 5173, 13939, 598, 2097, 3879, 471, 5023, 813, 18, 365, 18, 72, 67, 19805, 1616, 44, 683, 1435, 1562, 18, 542, 6763, 12, 2890, 16186, 19805, 5027, 13, 327, 3837, 18, 23095, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 389, 917, 44, 683, 15926, 12, 2890, 16, 1562, 33, 7036, 4672, 468, 2660, 30, 732, 8122, 384, 7594, 326, 2172, 1562, 15538, 316, 468, 16013, 44, 683, 15926, 31, 732, 1410, 622, 4520, 1221, 392, 23445, 358, 3455, 468, 333, 1562, 19361, 5173, 13939, 598, 2097, 3879, 471, 5023, 813, 18, 365, 18, 72, 67, 19805, 1616, 44, 683, 1435, 1562, 18, 542, 6763, 12, 2890, 16186, 19805, 5027, 13, 327, 3837, 18, 23095, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]

column.set_sort_column_id(next_column)

if sort_name is not None: column.set_sort_column_id(next_column+1) else: column.set_sort_column_id(next_column)

def new( self): if not hasattr( self, 'callback'): self.callback = None

d04c533b5d76014416b59855c0d2055d4c8f86c1 /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/12778/d04c533b5d76014416b59855c0d2055d4c8f86c1/gui.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 394, 12, 365, 4672, 309, 486, 3859, 12, 365, 16, 296, 3394, 11, 4672, 365, 18, 3394, 273, 599, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 394, 12, 365, 4672, 309, 486, 3859, 12, 365, 16, 296, 3394, 11, 4672, 365, 18, 3394, 273, 599, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]

with io.open(support.TESTFN, self.write_mode, buffering=0) as raw:

with self.open(support.TESTFN, self.write_mode, buffering=0) as raw:

def test_threads(self): try: # Write out many bytes from many threads and test they were # all flushed. N = 1000 contents = bytes(range(256)) * N sizes = cycle([1, 19]) n = 0 queue = deque() while n < len(contents): size = next(sizes) queue.append(contents[n:n+size]) n += size del contents # We use a real file object because it allows us to # exercise situations where the GIL is released before # writing the buffer to the raw streams. This is in addition # to concurrency issues due to switching threads in the middle # of Python code. with io.open(support.TESTFN, self.write_mode, buffering=0) as raw: bufio = self.tp(raw, 8) errors = [] def f(): try: while True: try: s = queue.popleft() except IndexError: return bufio.write(s) except Exception as e: errors.append(e) raise threads = [threading.Thread(target=f) for x in range(20)] for t in threads: t.start() time.sleep(0.02) # yield for t in threads: t.join() self.assertFalse(errors, "the following exceptions were caught: %r" % errors) bufio.close() with io.open(support.TESTFN, "rb") as f: s = f.read() for i in range(256): self.assertEquals(s.count(bytes([i])), N) finally: support.unlink(support.TESTFN)

540d576d7a9562b3f2b22d53da6ef10922fb5986 /local1/tlutelli/issta_data/temp/all_python//python/2009_temp/2009/12029/540d576d7a9562b3f2b22d53da6ef10922fb5986/test_io.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1842, 67, 12495, 12, 2890, 4672, 775, 30, 468, 2598, 596, 4906, 1731, 628, 4906, 7403, 471, 1842, 2898, 4591, 468, 777, 22604, 18, 423, 273, 4336, 2939, 273, 1731, 12, 3676, 12, 5034, 3719, 380, 423, 8453, 273, 8589, 3816, 21, 16, 5342, 5717, 290, 273, 374, 2389, 273, 21147, 1435, 1323, 290, 411, 562, 12, 3980, 4672, 963, 273, 1024, 12, 11914, 13, 2389, 18, 6923, 12, 3980, 63, 82, 30, 82, 15, 1467, 5717, 290, 1011, 963, 1464, 2939, 468, 1660, 999, 279, 2863, 585, 733, 2724, 518, 5360, 584, 358, 468, 24165, 28474, 1625, 326, 611, 2627, 353, 15976, 1865, 468, 7410, 326, 1613, 358, 326, 1831, 8205, 18, 1220, 353, 316, 2719, 468, 358, 17752, 8296, 6541, 358, 30882, 7403, 316, 326, 7689, 468, 434, 6600, 981, 18, 598, 365, 18, 3190, 12, 13261, 18, 16961, 19793, 16, 365, 18, 2626, 67, 3188, 16, 25056, 33, 20, 13, 487, 1831, 30, 16083, 273, 365, 18, 6834, 12, 1899, 16, 1725, 13, 1334, 273, 5378, 1652, 284, 13332, 775, 30, 1323, 1053, 30, 775, 30, 272, 273, 2389, 18, 5120, 4482, 1435, 1335, 10195, 30, 327, 16083, 18, 2626, 12, 87, 13, 1335, 1185, 487, 425, 30, 1334, 18, 6923, 12, 73, 13, 1002, 7403, 273, 306, 5930, 310, 18, 3830, 12, 3299, 33, 74, 13, 364, 619, 316, 1048, 12, 3462, 25887, 364, 268, 316, 7403, 30, 268, 18, 1937, 1435, 813, 18, 19607, 12, 20, 18, 3103, 13, 468, 2824, 2 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1842, 67, 12495, 12, 2890, 4672, 775, 30, 468, 2598, 596, 4906, 1731, 628, 4906, 7403, 471, 1842, 2898, 4591, 468, 777, 22604, 18, 423, 273, 4336, 2939, 273, 1731, 12, 3676, 12, 5034, 3719, 380, 423, 8453, 273, 8589, 3816, 21, 16, 5342, 5717, 290, 273, 374, 2389, 273, 21147, 1435, 1323, 290, 411, 562, 12, 3980, 4672, 963, 273, 1024, 12, 11914, 13, 2389, 18, 6923, 12, 3980, 63, 82, 30, 82, 15, 1467, 5717, 290, 1011, 963, 1464, 2939, 468, 1660, 999, 279, 2863, 585, 733, 2724, 518, 5360, 584, 358, 468, 24165, 28474, 1625, 326, 611, 2627, 353, 15976, 1865, 468, 7410, 326, 1613, 358, 326, 1831, 8205, 18, 1220, 353, 316, 2719, 468, 2 ]

else: moveOffset = scale * self.assy.o.right moveOffset += scale * self.assy.o.down

else: moveOffset = initial_offset_for_other_pastables moveOffset += scale * self.assy.o.right moveOffset += scale * self.assy.o.down self._initial_paste_offset_for_other_pastables = moveOffset

of def filterChunks

8b748f35206882452325a1386b28bfd7edbaaa4f /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/11221/8b748f35206882452325a1386b28bfd7edbaaa4f/ops_copy.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 434, 1652, 1034, 14975, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 434, 1652, 1034, 14975, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]

self.eventprocessor.logMessage(_("Queued upload request: %s") % str(vars(msg)), 5)

self.eventprocessor.logMessage(_("Queued upload request: User %s, %s") % (user, str(vars(msg))), 5)

def QueueUpload(self, msg): """ Peer remotely(?) queued a download (upload here) """ user = None for i in self.peerconns: if i.conn is msg.conn.conn: user = i.username if user is None: return addr = msg.conn.addr[0] if not self.fileIsQueued(user, msg.file): friend = user in [i[0] for i in self.eventprocessor.userlist.userlist] if friend and self.eventprocessor.config.sections["transfers"]["friendsnolimits"]: limits = 0 else: limits = 1 checkuser, reason = self.eventprocessor.CheckUser(user, addr) if not checkuser: self.queue.put(slskmessages.QueueFailed(conn = msg.conn.conn, file = msg.file, reason = reason)) elif limits and self.queueLimitReached(user): uploadslimit = self.eventprocessor.config.sections["transfers"]["queuelimit"] limitmsg = "User limit of %i megabytes exceeded" %(uploadslimit) self.queue.put(slskmessages.QueueFailed(conn = msg.conn.conn, file = msg.file, reason = limitmsg)) elif limits and self.fileLimitReached(user): filelimit = self.eventprocessor.config.sections["transfers"]["filelimit"] limitmsg = "User limit of %i files exceeded" %(filelimit) self.queue.put(slskmessages.QueueFailed(conn = msg.conn.conn, file = msg.file, reason = limitmsg)) elif self.fileIsShared(user, msg.file): self.uploads.append(Transfer(user = user, filename = msg.file, path = os.path.dirname(msg.file.replace('\\', os.sep)), status = "Queued", timequeued = time.time(), size = self.getFileSize(msg.file))) self.uploadspanel.update(self.uploads[-1]) self.addQueued(user, msg.file) else: self.queue.put(slskmessages.QueueFailed(conn = msg.conn.conn, file = msg.file, reason = "File not shared" )) self.eventprocessor.logMessage(_("Queued upload request: %s") % str(vars(msg)), 5) self.checkUploadQueue()

e9ab064556a6a654dda329fc639c9e7883afe3e8 /local1/tlutelli/issta_data/temp/all_python//python/2010_temp/2010/8738/e9ab064556a6a654dda329fc639c9e7883afe3e8/transfers.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 7530, 4777, 12, 2890, 16, 1234, 4672, 3536, 10669, 26693, 2357, 3680, 13, 12234, 279, 4224, 261, 6327, 2674, 13, 3536, 729, 273, 599, 364, 277, 316, 365, 18, 12210, 591, 2387, 30, 309, 277, 18, 4646, 353, 1234, 18, 4646, 18, 4646, 30, 729, 273, 277, 18, 5053, 309, 729, 353, 599, 30, 327, 3091, 273, 1234, 18, 4646, 18, 4793, 63, 20, 65, 309, 486, 365, 18, 768, 2520, 21039, 12, 1355, 16, 1234, 18, 768, 4672, 24271, 273, 729, 316, 306, 77, 63, 20, 65, 364, 277, 316, 365, 18, 2575, 8700, 18, 1355, 1098, 18, 1355, 1098, 65, 309, 24271, 471, 365, 18, 2575, 8700, 18, 1425, 18, 11657, 9614, 2338, 18881, 6, 6362, 6, 74, 22259, 82, 355, 1038, 87, 11929, 30, 8181, 273, 374, 469, 30, 8181, 273, 404, 225, 866, 1355, 16, 3971, 273, 365, 18, 2575, 8700, 18, 1564, 1299, 12, 1355, 16, 3091, 13, 309, 486, 866, 1355, 30, 365, 18, 4000, 18, 458, 12, 2069, 7771, 6833, 18, 3183, 2925, 12, 4646, 273, 1234, 18, 4646, 18, 4646, 16, 585, 273, 1234, 18, 768, 16, 3971, 273, 3971, 3719, 1327, 8181, 471, 365, 18, 4000, 3039, 23646, 12, 1355, 4672, 3617, 2069, 1038, 273, 365, 18, 2575, 8700, 18, 1425, 18, 11657, 9614, 2338, 18881, 6, 6362, 6, 1857, 89, 19741, 11929, 1800, 3576, 273, 315, 1299, 1800, 434, 738, 77, 312, 1332, 24383, 1078, 12428, 6, 8975, 6327, 2069, 1038, 13, 365, 18, 4000, 18, 2 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 7530, 4777, 12, 2890, 16, 1234, 4672, 3536, 10669, 26693, 2357, 3680, 13, 12234, 279, 4224, 261, 6327, 2674, 13, 3536, 729, 273, 599, 364, 277, 316, 365, 18, 12210, 591, 2387, 30, 309, 277, 18, 4646, 353, 1234, 18, 4646, 18, 4646, 30, 729, 273, 277, 18, 5053, 309, 729, 353, 599, 30, 327, 3091, 273, 1234, 18, 4646, 18, 4793, 63, 20, 65, 309, 486, 365, 18, 768, 2520, 21039, 12, 1355, 16, 1234, 18, 768, 4672, 24271, 273, 729, 316, 306, 77, 63, 20, 65, 364, 277, 316, 365, 18, 2575, 8700, 18, 1355, 1098, 18, 1355, 1098, 65, 309, 24271, 471, 365, 18, 2575, 8700, 18, 1425, 18, 11657, 9614, 2338, 18881, 6, 6362, 2 ]

if not bober_is_good: if first_warning: print "*WARNING*: bober's implementation is broken on this platform or this size of n." first_warning=False

def number_of_partitions(n,k=None, algorithm='default'): r""" Returns the size of partitions_list(n,k). INPUT: n -- an integer k -- (default: None); if specified, instead returns the cardinality of the set of all (unordered) partitions of the positive integer n into sums with k summands. algorithm -- (default: 'default') 'default' -- if k is given use Gap. Otherwise, on x86 when n > 3000, use 'bober' On non x86 use 'pari'. 'bober' -- use Jonathon Bober's implementation 'gap' -- use GAP (VERY *slow*) 'pari' -- use PARI. Speed seems the same as GAP until $n$ is in the thousands, in which case PARI is faster. *But* PARI has a bug, e.g., on 64-bit Linux PARI-2.3.2 outputs numbpart(147007)%1000 as 536, but it should be 533!. So do not use this option. IMPLEMENTATION: Wraps GAP's NrPartitions or PARI's numbpart function. Use the function \code{partitions(n)} to return a generator over all partitions of $n$. It is possible to associate with every partition of the integer n a conjugacy class of permutations in the symmetric group on n points and vice versa. Therefore p(n) = NrPartitions(n) is the number of conjugacy classes of the symmetric group on n points. EXAMPLES: sage: v = list(partitions(5)); v [(1, 1, 1, 1, 1), (1, 1, 1, 2), (1, 2, 2), (1, 1, 3), (2, 3), (1, 4), (5,)] sage: len(v) 7 sage: number_of_partitions(5, algorithm='gap') 7 sage: number_of_partitions(5, algorithm='pari') 7 sage: number_of_partitions(5, algorithm='bober') 7 The input must be a nonnegative integer or a ValueError is raised. sage: number_of_partitions(-5) Traceback (most recent call last): ... ValueError: n (=-5) must be a nonnegative integer sage: number_of_partitions(10,2) 5 sage: number_of_partitions(10) 42 sage: number_of_partitions(3) 3 sage: number_of_partitions(10) 42 sage: number_of_partitions(3, algorithm='pari') 3 sage: number_of_partitions(10, algorithm='pari') 42 sage: number_of_partitions(40) 37338 sage: number_of_partitions(100) 190569292 sage: number_of_partitions(100000) 27493510569775696512677516320986352688173429315980054758203125984302147328114964173055050741660736621590157844774296248940493063070200461792764493033510116079342457190155718943509725312466108452006369558934464248716828789832182345009262853831404597021307130674510624419227311238999702284408609370935531629697851569569892196108480158600569421098519 A generating function for p(n) is given by the reciprocal of Euler's function: \[ \sum_{n=0}^\infty p(n)x^n = \prod_{k=1}^\infty \left(\frac {1}{1-x^k} \right). \] We use SAGE to verify that the first several coefficients do instead agree: sage: q = PowerSeriesRing(QQ, 'q', default_prec=9).gen() sage: prod([(1-q^k)^(-1) for k in range(1,9)]) ## partial product of 1 + q + 2*q^2 + 3*q^3 + 5*q^4 + 7*q^5 + 11*q^6 + 15*q^7 + 22*q^8 + O(q^9) sage: [number_of_partitions(k) for k in range(2,10)] [2, 3, 5, 7, 11, 15, 22, 30] REFERENCES: http://en.wikipedia.org/wiki/Partition_%28number_theory%29 TESTS: sage: n = 500 + randint(0,500) sage: number_of_partitions( n - (n % 385) + 369) % 385 == 0 True sage: n = 1500 + randint(0,1500) sage: number_of_partitions( n - (n % 385) + 369) % 385 == 0 True sage: n = 1000000 + randint(0,1000000) sage: number_of_partitions( n - (n % 385) + 369) % 385 == 0 True sage: n = 1000000 + randint(0,1000000) sage: number_of_partitions( n - (n % 385) + 369) % 385 == 0 True sage: n = 1000000 + randint(0,1000000) sage: number_of_partitions( n - (n % 385) + 369) % 385 == 0 True sage: n = 1000000 + randint(0,1000000) sage: number_of_partitions( n - (n % 385) + 369) % 385 == 0 True sage: n = 1000000 + randint(0,1000000) sage: number_of_partitions( n - (n % 385) + 369) % 385 == 0 True sage: n = 1000000 + randint(0,1000000) sage: number_of_partitions( n - (n % 385) + 369) % 385 == 0 True sage: n = 100000000 + randint(0,100000000) # takes a long time sage: number_of_partitions( n - (n % 385) + 369) % 385 == 0 True sage: n = 100000000 + randint(0,100000000) # takes a long time sage: number_of_partitions( n - (n % 385) + 369) % 385 == 0 True sage: n = 100000000 + randint(0,100000000) # takes a long time sage: number_of_partitions( n - (n % 385) + 369) % 385 == 0 True Another consistency test for n up to 500: sage: len([n for n in [1..500] if number_of_partitions(n) != number_of_partitions(n,algorithm='pari')]) 0 """ n = ZZ(n) if n < 0: raise ValueError, "n (=%s) must be a nonnegative integer"%n elif n == 0: return ZZ(1) global first_warning PROCESSOR = os.uname()[-1] bober_is_good = 'x86' in PROCESSOR if k is not None: algorithm = 'gap' elif algorithm == 'default': if bober_is_good: algorithm = 'bober' elif PROCESSOR in ['x86', 'Power Macintosh']: algorithm = 'pari' else: algorithm = 'gap' if algorithm == 'gap': if k is None: ans=gap.eval("NrPartitions(%s)"%(ZZ(n))) else: ans=gap.eval("NrPartitions(%s,%s)"%(ZZ(n),ZZ(k))) return ZZ(ans) if k is not None: raise ValueError, "only the GAP algorithm works if k is specified." if algorithm == 'bober': if not bober_is_good: if first_warning: print "*WARNING*: bober's implementation is broken on this platform or this size of n." first_warning=False return partitions_ext.number_of_partitions(n) elif algorithm == 'pari': if n > 3000 and 'x86_64' in PROCESSOR: if first_warning: print "*WARNING*: Pari's numbpart is very buggy on x86_64 (fixed in svn, so don't report to pari-dev)" first_warning = False return ZZ(pari(ZZ(n)).numbpart()) raise ValueError, "unknown algorithm '%s'"%algorithm

f0f9a1fa3f7057ce6c279f53361876ef7f50795f /local1/tlutelli/issta_data/temp/all_python//python/2007_temp/2007/9890/f0f9a1fa3f7057ce6c279f53361876ef7f50795f/combinat.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1300, 67, 792, 67, 21275, 12, 82, 16, 79, 33, 7036, 16, 4886, 2218, 1886, 11, 4672, 436, 8395, 2860, 326, 963, 434, 10060, 67, 1098, 12, 82, 16, 79, 2934, 225, 12943, 30, 290, 1493, 392, 3571, 417, 1493, 261, 1886, 30, 599, 1769, 309, 1269, 16, 3560, 1135, 326, 14379, 434, 326, 444, 434, 777, 261, 318, 9885, 13, 10060, 434, 326, 6895, 3571, 290, 1368, 26608, 598, 417, 2142, 889, 87, 18, 4886, 1493, 261, 1886, 30, 296, 1886, 6134, 296, 1886, 11, 1493, 309, 417, 353, 864, 999, 611, 438, 18, 5272, 16, 603, 619, 5292, 1347, 290, 405, 29839, 16, 999, 296, 1075, 744, 11, 2755, 1661, 619, 5292, 999, 296, 1065, 77, 10332, 296, 1075, 744, 11, 1493, 999, 804, 265, 29900, 17980, 744, 1807, 4471, 296, 14048, 11, 1493, 999, 611, 2203, 261, 17529, 380, 87, 821, 12437, 296, 1065, 77, 11, 1493, 999, 3939, 45, 18, 225, 348, 5868, 12001, 326, 1967, 487, 611, 2203, 3180, 271, 82, 8, 353, 316, 326, 286, 24810, 16, 316, 1492, 648, 3939, 45, 353, 12063, 18, 380, 31167, 14, 3939, 45, 711, 279, 7934, 16, 425, 18, 75, 12990, 603, 5178, 17, 3682, 13318, 3939, 45, 17, 22, 18, 23, 18, 22, 6729, 818, 70, 2680, 12, 3461, 26874, 27, 13, 9, 18088, 487, 1381, 5718, 16, 1496, 518, 1410, 506, 1381, 3707, 5, 18, 225, 6155, 741, 486, 999, 333, 1456, 18, 225, 15694, 7618, 2689, 30, 678, 7506, 611, 2 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 1300, 67, 792, 67, 21275, 12, 82, 16, 79, 33, 7036, 16, 4886, 2218, 1886, 11, 4672, 436, 8395, 2860, 326, 963, 434, 10060, 67, 1098, 12, 82, 16, 79, 2934, 225, 12943, 30, 290, 1493, 392, 3571, 417, 1493, 261, 1886, 30, 599, 1769, 309, 1269, 16, 3560, 1135, 326, 14379, 434, 326, 444, 434, 777, 261, 318, 9885, 13, 10060, 434, 326, 6895, 3571, 290, 1368, 26608, 598, 417, 2142, 889, 87, 18, 4886, 1493, 261, 1886, 30, 296, 1886, 6134, 296, 1886, 11, 1493, 309, 417, 353, 864, 999, 611, 438, 18, 5272, 16, 603, 619, 5292, 1347, 290, 405, 29839, 16, 999, 296, 1075, 744, 11, 2755, 1661, 619, 5292, 999, 296, 1065, 77, 2 ]

sage: G.derived_series()

def derived_series(self): """ Return the derived series of this group as a list of permutation groups.

1658b04d4cf7d534376d011a40bb52f192eac894 /local1/tlutelli/issta_data/temp/all_python//python/2008_temp/2008/9890/1658b04d4cf7d534376d011a40bb52f192eac894/permgroup.py

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 10379, 67, 10222, 12, 2890, 4672, 3536, 2000, 326, 10379, 4166, 434, 333, 1041, 487, 279, 666, 434, 17440, 3252, 18, 2, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 ]

[ 1, 8585, 326, 22398, 316, 326, 981, 30, 1652, 10379, 67, 10222, 12, 2890, 4672, 3536, 2000, 326, 10379, 4166, 434, 333, 1041, 487, 279, 666, 434, 17440, 3252, 18, 2, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100, -100 ]