messages
listlengths 2
2
| images
images listlengths 1
1
|
---|---|
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C\\1=C/C(=N\\Br)/C(=C/C1=N/Br)Cl"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CSP1(=S)SP(=S)(S1)SC"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CCCCCCCCCCCCCCCCSCCCCPCOO"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C[C@@H]1CC[C@H]2[C@@]3(CO3)C(O[C@H]4[C@@]25[C@H]1CC[C@](O4)(OO5)C)O"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C1C[C@H]([C@@H](C1)O)CCCO"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C1=CC=NC(=C1)N2C=CSN2"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CCSN1CCN(CC1)SCC"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "B(C(C(O)F)N(CCO)CCO)(F)F"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C1(=C(C(=O)SC1=O)Cl)Cl"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CSC[C@@H](C(=O)O)N"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "[2H]C1=CC(=C(C=C1C([2H])([2H])[2H])[2H])C"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CN(C)C1=CC1=NC#N"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CC(C)(C#N)[C@@H]1CC=C(C1)OS(=O)(=O)C(F)(F)F"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CC(=C[C@@H]1[C@@H](C1(C)C)C(=O)O)C"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CC(/C=C/C#N)C=O"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C[C@@H](/C=C/[C@@]1([C@](CCCC1(C)C)(C)O)O)O"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C(=NSN=C=O)=O"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C([C@H]([C@H]([C@@H]([C@H](C(=O)O)O)O)O)O)O"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CO/C(=C/C1=CC=CC=C1)/C#N"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CSC(=S)C(SC)(SC)SC"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "B(Cl)(/C=C/Cl)/C=C/Cl"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C1=C(NC=N1)C[C@@H](C(=O)O)N"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C[C@@H]1CCCC1C"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C1=C(SC(=O)N1)CCl"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C(=NC(C(F)(F)Br)(F)Br)=O"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "B1BBB1"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CC(C)(C)OC(=O)NNC[C@@H]1CCOC1=O"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "B(=C(C)CC)OC#N"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "B(CC)(CC)OS(=O)(=O)OB(CC)CC"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C1CCC(CC1)N=P(C(Cl)(Cl)Cl)(C(Cl)(Cl)Cl)Cl"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CC(C)(C)S/C(=C(\\Cl)/Br)/Cl"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C[C@@H]1CCC[C@H](C1C)C"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CCO[C@@H]1C[C@H]2[C@H]3CC[C@H](C3)[C@H]2CO1"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CCCCOC(=O)[C@@H]([C@H](C(=O)OCCCC)O)O"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CC(C)(C#N)N=S(C1=CC=C(C=C1)Cl)Cl"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CP(C)P(=O)(C)C"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "[B](C(C)O)C(OCC)OCC"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CCC(=O)C[C@H](C)C(C)C"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "[C@H]([C@@H]([C@@H](C(=O)O)O)O)([C@H](C(=O)O)O)O"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C([C@@H]([C@H](C(=O)CO)O)O)O"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CO[C@H]1C[C@H]2[C@H]3CC[C@H](C3)[C@H]2CO1"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C1CN[C@@H]1C(=O)O"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C1=CN=C(N=C1)P(=O)(O)O"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C[C@@H]([C@@H](CC1=CC=CC=C1)Br)O"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C1(=O)N=NC(=O)S1"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C=CN1C=CN=N1"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C[C@@]12CC[C@@H]3[C@@](C1)(CC[C@H]2Br)[C@H](CC3(C)C)OC"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C[C@@H]1CC[C@@]2([C@@H]3[C@@H]1CC[C@@]2(CC3(C)C)C)O"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CC1(CON(O1)C(=O)N(C)C)C"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C[C@@]1(CCC2C1(CCC3C2CCC4=C3CCC(=O)C4)C)O"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C(=N\\OP(=O)(O)O)(\\N)/OP(=O)(O)OP(=O)(O)O"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C(=NP(=S)(N=C=S)N=C=S)=S"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CN(C)C(=O)SSC(=O)N(C)C"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C1[C@@H]([C@H](O[C@H]1N2C=C(C(=O)NC2=O)C(F)(F)F)CO)O"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C1=C(C=NN1C(=O)NC(=O)CCl)Br"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CC(C1=PC=PC=P1)O"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CC(C)N(C(=O)F)SN(C(C)C)C(=O)F"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CCOC(=O)[C@H](CC(=O)C1=CC=CC=C1)N[C@@H](C)C(=O)OC"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CC(C)[C@H]1CC[C@@]2([C@@H]3[C@H]1[C@H](C24CO4)[C@@H]([C@@H]3O)O)C"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "COC(=O)[C@H](CC1=CC(=C(C=C1)O)O)N"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CC1=C(C1=O)C"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C(OSC(=O)SO)F"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CCP1C(=C)[P-]P(C(=C)[P-]1)CC"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CN(C)P(=NC(=O)C(Br)(Br)Br)(N(C)C)N(C)C"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "COC(=O)/C(=N\\Cl)/N(Cl)Cl"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C(=O)=S(F)P(P)PP"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CC1(COCN1SSN2COCC2(C)C)C"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C1=C(SSSSS1)N"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "[2H]C([2H])([2H])OCOC"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CCN1C(C(SCC1=O)Cl)Cl"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C1=C2C(=CC(=NC#N)S2)SC1=NC#N"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C(=N/OBr)\\Cl"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C1C(=NNC(=O)N)CSS1"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CC12CC[C@H]3C([C@@H]1CC[C@H]2O)CCC4=C3C=CC(=C4)O"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "[2H]C([2H])([2H])C(C(=O)O)(C([2H])([2H])Cl)O"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "[2H]/C(=C(\\C)/O)/C(=O)C"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "[SiH]#[Zr]"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CC1=CCC(C[C@@H]1O)C(C)(C)O"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CCOC(C)(OCC)OP(=O)(CC)CF"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C[C@]12CCC(=O)C[C@@H]1CC[C@@H]3[C@@H]2CC[C@]4([C@H]3CC[C@@H]4O)C"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C1=NNC2=C1SSSSS2"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CC(=O)O[C@H]1CCCN2[C@@H]1C3=C(CC2)C4=CC=CC=C4N3"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CCC/C=C(/SCC#C)\\SOS(=O)Cl"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C(F)(F)(S(=O)S(=O)C(F)(F)Br)Cl"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "O=[Sn]1O[Sn]2(O1)O[Sn](=O)O2"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CC(C)[C@@H]1C[C@@H]([C@]2(CCCC(=C)[C@@H]2[C@H]1O)C)O"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C1([Si]2=[Si]1C2(F)F)(F)F"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C/C=C(\\C)/C/C(=N\\Cl)/OC"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C(C(N)P(=O)(O)O)S(=O)(=O)O"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "COS(#N)=P[P+]#P"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CP(=S)(CC1=CC=CC=C1)P(=S)(C)CC2=CC=CC=C2"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CC1([C@@H]([C@H](CN1C)C(=O)OC)C(=O)OC)C(=O)OC"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C[C@H]1C[C@H]2CC3=CC=CC=C3N2N1"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C[S-](#C)OOOOO"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C[C@]12CC[C@H](C1(C)C)C[C@@H]2S(=O)C(=C)C3=CCCCC3"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CC1=C(CCO1)OC(=O)Cl"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "CC(C)(C)OC(=O)N[C@H]1CC[C@@H](C1)O"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C=P(C1CC1)(C2CC2)C3=CC=CC=C3"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "O=S(I(Cl)Br)I(Cl)Br"
}
] | |
[
{
"role": "user",
"content": "Simplified molecular-input line-entry system (SMILES) notation of the given molecule: "
},
{
"role": "assistant",
"content": "C(N(COS(=O)(=O)O)COS(=O)(=O)O)OS(=O)(=O)O"
}
] |
End of preview. Expand
in Dataset Viewer.
README.md exists but content is empty.
Use the Edit dataset card button to edit it.
- Downloads last month
- 3