messages
listlengths 3
3
|
|---|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Suppose there is a molecule that meets the following description: The molecule has Characteristic chloroform-like odor. Please write the SMILES representation of it.",
"role": "user"
},
{
"content": "C1OCOCO1",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I need a molecule that meets the following conditions: The molecule is a energy source, energy storage, membrane stabilizer, nutrient. Please represent the molecule in SMILES.",
"role": "user"
},
{
"content": "CCCC(O)CC(=O)OCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Based on the given information, generate a molecule that meets the desired specifications: The molecule is a nutrient that impacts diabetes mellitus type 2, parkinson's disease, non-alcoholic fatty liver disease, and alzheimer's disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC(O)C=CC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCCN)OC(=O)CCCCCCCCCCc1oc(CCCCC)c(C)c1C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is a inflammatory, membrane stabilizer, energy source that impacts metabolic syndrome, obesity, and atherosclerosis. The molecule is a nutrient that impacts both cancer and pancreatitis. The molecule is a fat storage and energy storage, belonging to the thyroxine treatment class of molecules, and impacts cardiovascular disease.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Come up with a molecule based on the description: The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation that impacts diabetic heart disease, aging, and barth syndrome. The molecule is a stabilizing mitochondrial structure, stabilizing cytochrome oxidase, apoptosis that impacts tangier disease and non-alcoholic fatty liver disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "The molecule is a apoptosis and a stabilizing mitochondrial structure that impacts diabetic heart disease, barth syndrome, and tangier disease. The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease and aging. Use the above information to create a molecule.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCC)OC(=O)CCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Can you create a molecule that matches the given characteristics? The molecule is a member of the cancer treatment class and affects infectious disease treatment.",
"role": "user"
},
{
"content": "NCCNC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCNC(=O)COc1cccc(C(=O)OCc2ccccc2)c1",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is a cholesterol translocation, apoptosis, proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease and barth syndrome. The molecule is a stabilizing cytochrome oxidase and a stabilizing mitochondrial structure that impacts tangier disease, aging, and diabetic heart disease.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule based on this description: The molecule is a cholesterol translocation, a nutritional supplement, and a energy storage, and it impacts tangier disease. The molecule is a apoptosis and a proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease, diabetic heart disease, and aging. The molecule is a energy source, a food additive, and a membrane stabilizer, and it impacts barth syndrome. The molecule is a surfactant, stabilizing cytochrome oxidase, stabilizing mitochondrial structure, emulsifier, and smooth.",
"role": "user"
},
{
"content": "CCC(C)CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a cholesterol translocation, stabilizing cytochrome oxidase, apoptosis that impacts barth syndrome and non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation and a stabilizing mitochondrial structure that impacts aging, diabetic heart disease, and tangier disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Can you create a molecule that matches the given characteristics? The molecule is a apoptosis that impacts aging, diabetic heart disease, barth syndrome, and tangier disease. The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Come up with a molecule based on the description: The molecule is a kinase inhibitor and belongs to both the anti proliferative and anti cancer agent classes of molecules.",
"role": "user"
},
{
"content": "NC1CCN(Cc2ccn3ncnc(Nc4ccc5c(c4)OCO5)c23)CC1",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I need a molecule that meets the following conditions: The molecule is a member of the light-emitting class and affects both electron transport and improved driving voltage. Please represent the molecule in SMILES.",
"role": "user"
},
{
"content": "c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc4c(c3)N(c3ccccc3)c3ccccc3C43c4ccccc4-c4ccccc43)n2)cc1",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Suppose there is a molecule that meets the following description: The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation that impacts aging, non-alcoholic fatty liver disease, and tangier disease. The molecule is a apoptosis, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts diabetic heart disease and barth syndrome. Please write the SMILES representation of it.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule based on this description: The molecule is a proton trap for oxidative phosphorylation and a stabilizing cytochrome oxidase, impacting both barth syndrome and aging. The molecule is a emulsifier, stabilizing mitochondrial structure, surfactant, energy source that impacts non-alcoholic fatty liver disease. The molecule is a cholesterol translocation, nutritional supplement, apoptosis, energy storage. The molecule is a food additive and a membrane stabilizer, which impacts both diabetic heart disease and tangier disease, and is characterized as smooth.",
"role": "user"
},
{
"content": "CC(C)CCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule based on this description: The molecule is a stabilizing mitochondrial structure and a cholesterol translocation that impacts tangier disease, diabetic heart disease, and barth syndrome. The molecule is a apoptosis, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease and aging.",
"role": "user"
},
{
"content": "CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Conceptualize a molecule that meets the specified attribute(s): The molecule has Mild. When heated to decomposition it emits acrid smoke and irritating fumes.",
"role": "user"
},
{
"content": "CC(C)CCCCCO",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Could you please return a molecule that adheres to this description? The molecule is a cholesterol translocation, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts aging. The molecule is a apoptosis that impacts non-alcoholic fatty liver disease, diabetic heart disease, tangier disease, and barth syndrome.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Build a molecule that meets the requirement: The molecule is a nutrient.",
"role": "user"
},
{
"content": "OCC(O)C(O)C(O)c1cnc(C(O)C(O)C(O)CO)cn1",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is photochromic.",
"role": "user"
},
{
"content": "CN1c2cc3ccccc3cc2C(C)(C)C12C=Nc1cc3c4c(c1O2)CCCN4CCC3",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Could you please return a molecule that adheres to this description? The molecule is a stabilizing mitochondrial structure that impacts aging, barth syndrome, diabetic heart disease, and non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation, apoptosis, stabilizing cytochrome oxidase, cholesterol translocation that impacts tangier disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Build a molecule that meets the requirement: The molecule is a energy source, apoptosis, food additive, cholesterol translocation. The molecule is a membrane stabilizer and a emulsifier, which impacts both barth syndrome and non-alcoholic fatty liver disease, and is characterized as smooth. The molecule is a nutritional supplement, a surfactant, and a stabilizing mitochondrial structure, and it impacts diabetic heart disease. The molecule is a energy storage, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts tangier disease and aging.",
"role": "user"
},
{
"content": "CCC(C)CCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCC(C)CC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation that impacts barth syndrome, diabetic heart disease, and aging. The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, apoptosis that impacts non-alcoholic fatty liver disease and tangier disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Come up with a molecule based on the description: The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, apoptosis, stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease. The molecule is a cholesterol translocation that impacts tangier disease, diabetic heart disease, barth syndrome, and aging.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Could you please return a molecule that adheres to this description? The molecule is a membrane stabilizer, fat storage, thyroxine treatment, energy storage, energy source that impacts obesity. It impacts cardiovascular disease, metabolic syndrome, and cancer. The molecule is a inflammatory and a nutrient, impacting both pancreatitis and atherosclerosis.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule that fulfills the requirement: It impacts aging, non-alcoholic fatty liver disease, diabetic heart disease, tangier disease, and barth syndrome. The molecule is a proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, stabilizing mitochondrial structure, cholesterol translocation, apoptosis.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule that fulfills the requirement: The molecule is a proton trap for oxidative phosphorylation and a membrane stabilizer, it impacts diabetic heart disease, and is smooth. The molecule is a food additive, cholesterol translocation, surfactant that impacts non-alcoholic fatty liver disease and tangier disease. The molecule is a emulsifier and a energy source, impacting both aging and barth syndrome. The molecule is a stabilizing mitochondrial structure, energy storage, apoptosis, nutritional supplement, stabilizing cytochrome oxidase.",
"role": "user"
},
{
"content": "CCCCCCC=CC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Could you please return a molecule that adheres to this description? The molecule is a apoptosis and a stabilizing cytochrome oxidase that impacts aging, non-alcoholic fatty liver disease, and diabetic heart disease. The molecule is a cholesterol translocation, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation that impacts tangier disease and barth syndrome.",
"role": "user"
},
{
"content": "CCCCCCC=CC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Come up with a molecule based on the description: The molecule is a stabilizing mitochondrial structure and a cholesterol translocation that impacts aging, barth syndrome, and non-alcoholic fatty liver disease. The molecule is a apoptosis, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts tangier disease and diabetic heart disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is a energy source and thyroxine treatment, impacting cancer, cardiovascular disease, obesity, and atherosclerosis. The molecule is a membrane stabilizer, a nutrient, and a energy storage. The molecule is a fat storage and a inflammatory, impacting both metabolic syndrome and pancreatitis.",
"role": "user"
},
{
"content": "CCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC(C)C)COC(=O)CCCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Build a molecule that meets the requirement: The molecule is a nutrient that impacts alzheimer's disease, diabetes mellitus type 2, parkinson's disease, and non-alcoholic fatty liver disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCCCCC(=O)OCC(COP(=O)(O)OCCN)OC(=O)CCCCCCCCCCCCCC=CCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule based on this description: The molecule is a erk inhibitor and belongs to the cancer treatment class of molecules, with the characteristic of being hyperproliferative disorder treatment.",
"role": "user"
},
{
"content": "Cc1noc(C(N)c2ccc(Cl)c(F)c2)n1",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Come up with a molecule based on the description: The molecule is a stabilizing mitochondrial structure, apoptosis, proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease and diabetic heart disease. The molecule is a stabilizing cytochrome oxidase and a cholesterol translocation that impacts barth syndrome, tangier disease, and aging.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is a nutrient that impacts non-alcoholic fatty liver disease, parkinson's disease, diabetes mellitus type 2, and alzheimer's disease.",
"role": "user"
},
{
"content": "CCCCCCCCC=CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCCN",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Can you create a molecule that matches the given characteristics? The molecule is pharmaceutical.",
"role": "user"
},
{
"content": "CC(C)(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O)OP(=O)(O)OCC1OC(n2cnc3c(N)ncnc32)C(O)C1OP(=O)(O)O",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation that impacts diabetic heart disease, aging, and non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase, apoptosis, stabilizing mitochondrial structure that impacts barth syndrome and tangier disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCC=CCC=CCC=CCC=CCC=CCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I need a molecule that meets the following conditions: The molecule is a nutrient. Please represent the molecule in SMILES.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCC=CCC1C(=O)CC(O)C1C=CC(O)CCCCC)COP(=O)(O)OCC(N)C(=O)O",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Could you please return a molecule that adheres to this description? The molecule is a nutrient that affects breast cancer by impacting cervical cancer, atherosclerosis, and ulcerative colitis.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCC=CCC=CCC=CCC=CC=CC(O)CC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I need a molecule that meets the following conditions: The molecule is a inflammatory, membrane stabilizer, and energy storage that has an effect on cancer and impacts both pancreatitis and obesity. The molecule is a nutrient that impacts both metabolic syndrome and atherosclerosis. The molecule is a energy source and fat storage, belonging to the thyroxine treatment class of molecules, and impacts cardiovascular disease. Please represent the molecule in SMILES.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule that fulfills the requirement: The molecule is a nutrient, energy source, membrane stabilizer that impacts pancreatitis, metabolic syndrome, and cardiovascular disease. The molecule is a energy storage that impacts both obesity and atherosclerosis. The molecule is a fat storage and a inflammatory, impacting both cancer and thyroxine treatment.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCC)OC(=O)CCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Come up with a molecule based on the description: The molecule is both a phosphorescent and a organic light-emitting diode.",
"role": "user"
},
{
"content": "FC(F)(P)c1ccccc1",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Come up with a molecule based on the description: The molecule is a apoptosis, cholesterol translocation, stabilizing cytochrome oxidase that impacts diabetic heart disease and non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation that impacts barth syndrome, aging, and tangier disease.",
"role": "user"
},
{
"content": "CCCCCCC=CC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "The molecule is a apoptosis and a proton trap for oxidative phosphorylation that impacts diabetic heart disease, non-alcoholic fatty liver disease, and tangier disease. The molecule is a cholesterol translocation, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts barth syndrome and aging. Use the above information to create a molecule.",
"role": "user"
},
{
"content": "CCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is a anti viral and belongs to the anti viral agent class of molecules.",
"role": "user"
},
{
"content": "NCc1c(N2CCCOSO2)cnn1CC1(Nc2ccc(F)c(F)c2)CC1",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Come up with a molecule based on the description: The molecule is a nutrient, membrane stabilizer, inflammatory, energy source that impacts cancer and cardiovascular disease. The molecule is thyroxine treatment and it impacts both metabolic syndrome and obesity. The molecule is a fat storage and a energy storage, impacting both atherosclerosis and pancreatitis.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC(C)C)COC(=O)CCCCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Based on the given information, generate a molecule that meets the desired specifications: The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation that impacts aging and diabetic heart disease. The molecule is a apoptosis and a cholesterol translocation that impacts tangier disease, non-alcoholic fatty liver disease, and barth syndrome.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC(C)CC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Suppose there is a molecule that meets the following description: It belongs to the electroluminescent device, organic electroluminescent compound, and electroluminescent classes of molecules. Please write the SMILES representation of it.",
"role": "user"
},
{
"content": "Cc1ccc(-c2ccc(-c3ccccn3)c3ccccc23)cc1",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule based on this description: The molecule is a renin inhibitor.",
"role": "user"
},
{
"content": "COc1ccc(OCc2ccc(C3CCNCC3OCc3ccc4ccccc4c3)cc2)cc1",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Can you create a molecule that matches the given characteristics? The molecule is a energy storage, inflammatory, and nutrient that has an effect on cancer and impacts both cardiovascular disease and pancreatitis. The molecule is a membrane stabilizer that impacts both atherosclerosis and metabolic syndrome. The molecule is a fat storage and a energy source, impacting both obesity and thyroxine treatment.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC)COC(=O)CCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Suppose there is a molecule that meets the following description: The molecule is a egfr inhibitor. Please write the SMILES representation of it.",
"role": "user"
},
{
"content": "COc1nc(N2CCC(N3CCN(C)CC3)CC2)ccc1Nc1ncc(Br)c(Nc2ccc3nccnc3c2P(C)(C)=O)n1.O=C(O)C(F)(F)F",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Build a molecule that meets the requirement: The molecule is a stabilizing cytochrome oxidase and a cholesterol translocation that impacts tangier disease, diabetic heart disease, and non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, apoptosis that impacts barth syndrome and aging.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Could you please return a molecule that adheres to this description? The molecule is a inflammatory, energy source, energy storage, membrane stabilizer that impacts pancreatitis and cardiovascular disease. The molecule is a nutrient that impacts both obesity and metabolic syndrome. The molecule is a fat storage and thyroxine treatment, impacting both atherosclerosis and cancer.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule based on this description: The molecule is a stabilizing cytochrome oxidase that impacts aging, diabetic heart disease, and tangier disease. The molecule is a surfactant, stabilizing mitochondrial structure, energy source, emulsifier, energy storage. The molecule is a membrane stabilizer, a food additive, and a apoptosis, and it impacts barth syndrome. The molecule is a cholesterol translocation, a proton trap for oxidative phosphorylation, and a nutritional supplement, it impacts non-alcoholic fatty liver disease and is smooth.",
"role": "user"
},
{
"content": "CC(C)CCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Come up with a molecule based on the description: The molecule is a stabilizing mitochondrial structure that impacts barth syndrome, tangier disease, diabetic heart disease, and non-alcoholic fatty liver disease. The molecule is a apoptosis, proton trap for oxidative phosphorylation, cholesterol translocation, stabilizing cytochrome oxidase that impacts aging.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Build a molecule that meets the requirement: The molecule is a nutrient that affects both cervical cancer and breast cancer, and also impacts atherosclerosis and ulcerative colitis.",
"role": "user"
},
{
"content": "CCC=CCC(O)C=CC=CC=CC=CC(O)C(O)CCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCCCCC=CCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is a food additive and a cholesterol translocation, impacting both barth syndrome and tangier disease. The molecule is a emulsifier, apoptosis, stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease and diabetic heart disease. The molecule is a energy storage, stabilizing mitochondrial structure, membrane stabilizer, nutritional supplement. The molecule is a proton trap for oxidative phosphorylation, a surfactant, and a energy source, it impacts aging and is smooth.",
"role": "user"
},
{
"content": "CCCCCCC=CC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)CC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Suppose there is a molecule that meets the following description: The molecule is a nutrient. Please write the SMILES representation of it.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OC1C(O)C(O)C(O)C(OP(=O)(O)O)C1O)OC(=O)CCCCCCCC=CC=CC(O)CC=CCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is a hiv protease inhibitor.",
"role": "user"
},
{
"content": "CCC1CNCC(CCc2c(F)cccc2NC(=O)C(N)C(c2ccc(Cl)cc2)C2CCOCC2)N1S(C)(=O)=O",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule based on this description: The molecule is a energy storage and a stabilizing cytochrome oxidase, it impacts diabetic heart disease, and is smooth. The molecule is a surfactant, stabilizing mitochondrial structure, apoptosis that impacts tangier disease and non-alcoholic fatty liver disease. The molecule is a energy source, a proton trap for oxidative phosphorylation, and a cholesterol translocation, and it impacts aging. The molecule is a food additive, membrane stabilizer, emulsifier, nutritional supplement that impacts barth syndrome.",
"role": "user"
},
{
"content": "CCC(C)CCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Build a molecule that meets the requirement: The molecule is a nutrient.",
"role": "user"
},
{
"content": "CC12C=CC3(CCC4C(C)(C)C(O)C(=O)CC4(C)C3CC1=O)C2",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Come up with a molecule based on the description: The molecule is a membrane stabilizer, a energy source, a energy storage, and smooth. The molecule is a surfactant, stabilizing mitochondrial structure, apoptosis that impacts aging and barth syndrome. The molecule is a cholesterol translocation and a food additive, impacting both non-alcoholic fatty liver disease and tangier disease. The molecule is a nutritional supplement, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, emulsifier that impacts diabetic heart disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Come up with a molecule based on the description: The molecule is a apoptosis and a stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease, barth syndrome, and aging. The molecule is a proton trap for oxidative phosphorylation, cholesterol translocation, stabilizing cytochrome oxidase that impacts diabetic heart disease and tangier disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Build a molecule that meets the requirement: The molecule is both a anti viral and a rsv inhibitor.",
"role": "user"
},
{
"content": "O=C(O)c1cc(-c2ccccn2)n2nc(Br)cc2n1",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule based on this description: The molecule is a nutrient that impacts both atherosclerosis and thyroxine treatment. The molecule is a fat storage that impacts cardiovascular disease, metabolic syndrome, and pancreatitis.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCC=CCC=CCC=CCCCCC)COC(=O)CCCCCCCCCC=CCC=CCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I need a molecule that meets the following conditions: The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, cholesterol translocation that impacts diabetic heart disease and aging. The molecule is a apoptosis and a proton trap for oxidative phosphorylation that impacts barth syndrome, tangier disease, and non-alcoholic fatty liver disease. Please represent the molecule in SMILES.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase and a proton trap for oxidative phosphorylation that impacts aging, diabetic heart disease, and barth syndrome. The molecule is a cholesterol translocation, apoptosis, stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease and tangier disease. Use the above information to create a molecule.",
"role": "user"
},
{
"content": "CCCCCCC=CC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCC(C)C)OC(=O)CCCCCCCC=CC=CCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Suppose there is a molecule that meets the following description: The molecule is a proton trap for oxidative phosphorylation and a cholesterol translocation that impacts barth syndrome, non-alcoholic fatty liver disease, and diabetic heart disease. The molecule is a apoptosis, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts aging and tangier disease. Please write the SMILES representation of it.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Suppose there is a molecule that meets the following description: The molecule is a stabilizing mitochondrial structure and a stabilizing cytochrome oxidase that impacts diabetic heart disease, aging, and barth syndrome. The molecule is a proton trap for oxidative phosphorylation, apoptosis, cholesterol translocation that impacts non-alcoholic fatty liver disease and tangier disease. Please write the SMILES representation of it.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Come up with a molecule based on the description: The molecule is a nutrient that impacts both cardiovascular disease and atherosclerosis. The molecule is a fat storage and belongs to the thyroxine treatment class of molecules, impacting both pancreatitis and metabolic syndrome.",
"role": "user"
},
{
"content": "CCCCCCC=CCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCC=CCC=CCC=CCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Build a molecule that meets the requirement: The molecule is a renin inhibitor and belongs to the hypertension treatment class of molecules.",
"role": "user"
},
{
"content": "CC1(CN)C2CCOC21",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Come up with a molecule based on the description: The molecule is a stabilizing cytochrome oxidase and a proton trap for oxidative phosphorylation that impacts tangier disease, non-alcoholic fatty liver disease, and diabetic heart disease. The molecule is a stabilizing mitochondrial structure, apoptosis, cholesterol translocation that impacts aging and barth syndrome.",
"role": "user"
},
{
"content": "CCCCCCC=CC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule that fulfills the requirement: The molecule is a apoptosis, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts diabetic heart disease and tangier disease. The molecule is a cholesterol translocation and a stabilizing mitochondrial structure that impacts aging, non-alcoholic fatty liver disease, and barth syndrome.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Suppose there is a molecule that meets the following description: The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, proton trap for oxidative phosphorylation, apoptosis that impacts barth syndrome. The molecule is a stabilizing mitochondrial structure that impacts aging, non-alcoholic fatty liver disease, diabetic heart disease, and tangier disease. Please write the SMILES representation of it.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Suppose there is a molecule that meets the following description: The molecule is a stabilizing cytochrome oxidase that impacts diabetic heart disease, aging, tangier disease, and barth syndrome. The molecule is a stabilizing mitochondrial structure, cholesterol translocation, apoptosis, proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease. Please write the SMILES representation of it.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCC=CCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Build a molecule that meets the requirement: The molecule is a anti oxidant.",
"role": "user"
},
{
"content": "Cc1cc(O[Si](C)(C)C)c(C)cc1O[Si](C)(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Come up with a molecule based on the description: The molecule is a nutrient, energy storage, fat storage that belongs to the thyroxine treatment class of molecules and impacts both pancreatitis and cancer. The molecule is a membrane stabilizer that impacts both metabolic syndrome and cardiovascular disease. The molecule is a inflammatory and a energy source, impacting both obesity and atherosclerosis.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC)COC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, stabilizing mitochondrial structure that impacts diabetic heart disease and non-alcoholic fatty liver disease. The molecule is a apoptosis and a proton trap for oxidative phosphorylation that impacts tangier disease, barth syndrome, and aging. Use the above information to create a molecule.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Suppose there is a molecule that meets the following description: The molecule is a dgat inhibitor and obesity treatment, and it impacts metabolic syndrome treatment. Please write the SMILES representation of it.",
"role": "user"
},
{
"content": "COC(=O)C(C(C)C)N(C)C(=O)c1cc(-c2ccc(NC(=O)Nc3ccccc3Cl)cc2)no1",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule based on this description: The molecule is a fat storage, energy source, inflammatory that belongs to the thyroxine treatment class of molecules and impacts both metabolic syndrome and obesity. The molecule is a energy storage that impacts both pancreatitis and cardiovascular disease. The molecule is a membrane stabilizer and a nutrient, with effects on cancer and impacts on atherosclerosis.",
"role": "user"
},
{
"content": "CCC(C)CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Come up with a molecule based on the description: The molecule is a surfactant and a proton trap for oxidative phosphorylation, it impacts tangier disease, and is smooth. The molecule is a stabilizing mitochondrial structure, cholesterol translocation, nutritional supplement that impacts aging and barth syndrome. The molecule is a food additive, a apoptosis, and a energy source, and it impacts diabetic heart disease. The molecule is a emulsifier, membrane stabilizer, stabilizing cytochrome oxidase, energy storage that impacts non-alcoholic fatty liver disease.",
"role": "user"
},
{
"content": "CCCCCCC=CC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Could you please return a molecule that adheres to this description? The molecule is a membrane stabilizer, a stabilizing cytochrome oxidase, and a surfactant, and it impacts diabetic heart disease. The molecule is a nutritional supplement and a stabilizing mitochondrial structure, which impacts both non-alcoholic fatty liver disease and barth syndrome, and is characterized as smooth. The molecule is a food additive, a emulsifier, and a energy storage, and it impacts tangier disease. The molecule is a cholesterol translocation, energy source, proton trap for oxidative phosphorylation, apoptosis that impacts aging.",
"role": "user"
},
{
"content": "CCC(C)CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Can you create a molecule that matches the given characteristics? The molecule is both a cancer treatment and a mdm2 inhibitor.",
"role": "user"
},
{
"content": "CCC(CC)N1C(=O)C(C)(CC(=O)O)CCC1c1ccc(Cl)cn1",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Could you please return a molecule that adheres to this description? The molecule is a stabilizing cytochrome oxidase and a stabilizing mitochondrial structure that impacts aging, barth syndrome, and non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation, apoptosis, cholesterol translocation that impacts diabetic heart disease and tangier disease.",
"role": "user"
},
{
"content": "CCCCCCC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Come up with a molecule based on the description: The molecule is a nutritional supplement that impacts aging, barth syndrome, and non-alcoholic fatty liver disease. The molecule is a apoptosis, a energy source, and a surfactant, it impacts diabetic heart disease and is smooth. The molecule is a cholesterol translocation, stabilizing cytochrome oxidase, energy storage, proton trap for oxidative phosphorylation. The molecule is a food additive, stabilizing mitochondrial structure, emulsifier, membrane stabilizer that impacts tangier disease.",
"role": "user"
},
{
"content": "CCC(C)CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCC(C)CC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule that fulfills the requirement: The molecule is a nutrient that impacts both cardiovascular disease and atherosclerosis. The molecule is a thyroxine treatment and a fat storage, impacting both pancreatitis and metabolic syndrome.",
"role": "user"
},
{
"content": "CCCCCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Could you please return a molecule that adheres to this description? The molecule is a nutrient that affects breast cancer by impacting cervical cancer, atherosclerosis, and ulcerative colitis.",
"role": "user"
},
{
"content": "CCCCCC=CCC=CCC=CCC1OC1CCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCCCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Come up with a molecule based on the description: The molecule is a apoptosis and a emulsifier, it impacts diabetic heart disease, and is smooth. The molecule is a nutritional supplement, proton trap for oxidative phosphorylation, cholesterol translocation, stabilizing cytochrome oxidase that impacts tangier disease. The molecule is a food additive, a energy storage, and a stabilizing mitochondrial structure, and it impacts non-alcoholic fatty liver disease. The molecule is a membrane stabilizer, energy source, surfactant that impacts barth syndrome and aging.",
"role": "user"
},
{
"content": "CC(C)CCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a proton trap for oxidative phosphorylation and a apoptosis that impacts tangier disease, diabetic heart disease, and barth syndrome. The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, cholesterol translocation that impacts aging and non-alcoholic fatty liver disease.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC(C)CC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is a wee1 inhibitor.",
"role": "user"
},
{
"content": "CCn1c(=O)c2cnc(Nc3ccc4c(c3)CCNC4)nc2n1-c1ccnc(C2(OC)COC2)c1",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Come up with a molecule based on the description: The molecule is a nutritional supplement, a cholesterol translocation, and a apoptosis, and it impacts diabetic heart disease. The molecule is a surfactant, proton trap for oxidative phosphorylation, energy storage that impacts barth syndrome and aging. The molecule is a stabilizing mitochondrial structure and a stabilizing cytochrome oxidase, it impacts tangier disease, and is smooth. The molecule is a energy source, membrane stabilizer, emulsifier, food additive that impacts non-alcoholic fatty liver disease.",
"role": "user"
},
{
"content": "CCCCCCC=CC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)CC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule that fulfills the requirement: The molecule is a stabilizing cytochrome oxidase and a apoptosis that impacts aging, non-alcoholic fatty liver disease, and barth syndrome. The molecule is a cholesterol translocation, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation that impacts diabetic heart disease and tangier disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Can you create a molecule that matches the given characteristics? The molecule is a apoptosis and a stabilizing cytochrome oxidase that impacts aging, non-alcoholic fatty liver disease, and barth syndrome. The molecule is a proton trap for oxidative phosphorylation, stabilizing mitochondrial structure, cholesterol translocation that impacts diabetic heart disease and tangier disease.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Come up with a molecule based on the description: The molecule is a stabilizing mitochondrial structure and a apoptosis that impacts tangier disease, diabetic heart disease, and aging. The molecule is a proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, cholesterol translocation that impacts barth syndrome and non-alcoholic fatty liver disease.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a proton trap for oxidative phosphorylation, stabilizing mitochondrial structure, stabilizing cytochrome oxidase that impacts aging and non-alcoholic fatty liver disease. The molecule is a cholesterol translocation and a apoptosis that impacts diabetic heart disease, barth syndrome, and tangier disease.",
"role": "user"
},
{
"content": "CCCCCCC=CC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)CC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Can you create a molecule that matches the given characteristics? The molecule is a nutrient.",
"role": "user"
},
{
"content": "C=C(C)C(CC=C(C)C)COC1OC(COC2OCC(O)C(O)C2O)C(O)C(O)C1O",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is a stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease, diabetic heart disease, barth syndrome, and aging. The molecule is a apoptosis, proton trap for oxidative phosphorylation, cholesterol translocation, stabilizing mitochondrial structure that impacts tangier disease.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCC(C)CC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Come up with a molecule based on the description: The molecule is a proton trap for oxidative phosphorylation, cholesterol translocation, stabilizing mitochondrial structure, apoptosis that impacts aging. The molecule is a stabilizing cytochrome oxidase that impacts barth syndrome, diabetic heart disease, non-alcoholic fatty liver disease, and tangier disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCC=CCC=CCC=CCC=CCC=CCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is anti cancer.",
"role": "user"
},
{
"content": "O=C(c1cc(Cl)c(Cl)[nH]1)c1ccc(O)c(O)c1O",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule that fulfills the requirement: The molecule is a food additive, nutritional supplement, signalling molecule, surfactant. The molecule is a energy source, emulsifier, membrane stabilizer, energy storage, and smooth.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCCCC(=O)NC(COC1OC(CO)C(OC2OC(CO)C(OC3OC(CO)C(O)C(OC4OC(CO)C(O)C(O)C4O)C3CC(C)=O)C(OC3(C(=O)O)CC(O)C(NC(C)=O)C(C(O)C(CO)OC4(C(=O)O)CC(O)C(NC(C)=O)C(C(O)C(O)CO)O4)O3)C2O)C(O)C1O)C(O)CCCCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule based on this description: The molecule is a liquid crystal.",
"role": "user"
},
{
"content": "CCCCCCOc1ccc(C#Cc2ccc(CC)cc2)c(F)c1F",
"role": "assistant"
}
] |
Subsets and Splits