instruction
stringlengths 84
477
| input
stringclasses 1
value | output
stringlengths 11
209
|
---|---|---|
COC(=O)c1ccc(C2(N)CC2)cc1.O=C(O)c1cc(Cl)cnc1N1CCC(Oc2ccc(F)cc2)C1.Cl Given the above reactants and reagents, what could be a probable product of their reaction? | A probable product could be COC(=O)c1ccc(C2(NC(=O)c3cc(Cl)cnc3N3CCC(Oc4ccc(F)cc4)C3)CC2)cc1 . |
|
Given the following reactants and reagents, please provide a possible product. COc1ccc(CCNCc2ccc(C(C)(C)C)cc2)cc1.O=C(O)c1cccc2cc[nH]c12.CCN(C(C)C)C(C)C.CN(C)C(On1nnc2ccccc21)=[N+](C)C.CN(C)C=O.F[B-](F)(F)F.O | COc1ccc(CCN(Cc2ccc(C(C)(C)C)cc2)C(=O)c2cccc3cc[nH]c23)cc1 . |
|
Using CC1(CN)NC(=O)NC1=O.Cc1cc(COc2ccc(CC(=O)O)cc2)c2ccccc2n1.O=C(O)C(F)(F)F.O=C1CNC(=O)N1 as the reactants and reagents, tell me the potential product. | Cc1cc(COc2ccc(CC(=O)NCC3(C)NC(=O)NC3=O)cc2)c2ccccc2n1 . |
|
Please provide a feasible product that could be formed using these reactants and reagents: CCOC(=O)C(Cc1ccc(-c2ccccc2OC)c(C(C)=O)c1)NC(=O)c1c(Cl)cccc1Cl.CO.[BH4-].[Na+] . | CCOC(=O)C(Cc1ccc(-c2ccccc2OC)c(C(C)O)c1)NC(=O)c1c(Cl)cccc1Cl . |
|
Using CC(O)CN.O=[N+]([O-])c1cccnc1Cl.CCN(CC)CC.CCO as the reactants and reagents, tell me the potential product. | CC(O)CNc1ncccc1[N+](=O)[O-] . |
|
Consider that for a chemical reaction, if C=CCBr.Oc1cc(F)c(F)cc1Br.CCOCC.CN(C)C=O.O=C([O-])[O-].[K+].[K+] is/are the reactants and reagents, what can be the product? | C=CCOc1cc(F)c(F)cc1Br . |
|
Using COc1cc(-c2cc3nccc(-c4cccc(C#N)c4)c3o2)cc(OC)c1OC.CO.N.[Ni] as the reactants and reagents, tell me the potential product. | COc1cc(-c2cc3nccc(-c4cccc(CN)c4)c3o2)cc(OC)c1OC . |
|
Consider that for a chemical reaction, if CCOc1c(C(C)=O)cc(Cl)c(C#N)c1Br.CO.[BH4-].[Na+] is/are the reactants and reagents, what can be the product? | CCOc1c(C(C)O)cc(Cl)c(C#N)c1Br . |
|
Given the following reactants and reagents, please provide a possible product. CNC.O=C(COc1ccc(Cl)cc1Cl)Nc1cccc(C(=O)O)c1.CCN(C(C)C)C(C)C.CN(C)Cc1cc(CN(C)C)c(O)c(CN(C)C)c1.ClCCCl.On1nnc2ccccc21 | CN(C)C(=O)c1cccc(NC(=O)COc2ccc(Cl)cc2Cl)c1 . |
|
Can you tell me the potential product of a chemical reaction that uses Cc1cc(CCCCCBr)on1.Oc1ccc(-c2nnco2)cc1.CC#N.O=C([O-])[O-].[I-].[K+].[K+].[Na+] as the reactants and reagents? | Sure. A potential product: Cc1cc(CCCCCOc2ccc(-c3nnco3)cc2)on1 . |
|
Please provide a feasible product that could be formed using these reactants and reagents: CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.NC1CCN(Cc2ccccc2)C1.CC(C)(C)O.[Na+].[OH-] . | CC(C)(C)OC(=O)NC1CCN(Cc2ccccc2)C1 . |
|
CO.O=C(O)Cc1ccc(I)cc1.C1COCCO1.Cl Given the above reactants and reagents, what could be a probable product of their reaction? | A probable product could be COC(=O)Cc1ccc(I)cc1 . |
|
Please provide a feasible product that could be formed using these reactants and reagents: CC(C)(C)OC(=O)N1CCc2c(cccc2Oc2cc(Cl)ccc2[N+](=O)[O-])C1.C.CCOC(C)=O.[Pd] . | CC(C)(C)OC(=O)N1CCc2c(cccc2Oc2cc(Cl)ccc2N)C1 . |
|
CCC(CC)(c1ccc(OCC(O)C(C)(C)C)c(C)c1)c1cc2cc(C(=O)OC)ccc2o1.C1CCOC1.CO.[Na+].[OH-] Based on the reactants and reagents given above, suggest a possible product. | A possible product can be CCC(CC)(c1ccc(OCC(O)C(C)(C)C)c(C)c1)c1cc2cc(C(=O)O)ccc2o1 . |
|
Please provide a feasible product that could be formed using these reactants and reagents: O=C1CCC(=O)N1Br.O=C1COc2ncc(-c3ccccc3)cc2N1.CCOC(C)=O.CN(C)C=O . | O=C1COc2nc(Br)c(-c3ccccc3)cc2N1 . |
|
Predict a possible product from the listed reactants and reagents. CNC(=O)Cc1cn(C)c2ccc(F)c(OCc3cccc(Cl)c3)c12.C1CCOC1.O.O=S(=O)([O-])[O-].[Al+3].[Al+3].[Cl-].[Cl-].[Cl-].[H-].[H-].[H-].[H-].[Li+].[Na+].[Na+] | CNCCc1cn(C)c2ccc(F)c(OCc3cccc(Cl)c3)c12 . |
|
Given the following reactants and reagents, please provide a possible product. CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.COC(=O)CCc1c[nH]c2ccccc12.CN(C)c1ccncc1.ClCCl | COC(=O)CCc1cn(C(=O)OC(C)(C)C)c2ccccc12 . |
|
Can you tell me the potential product of a chemical reaction that uses COc1ccc2scnc2c1[N+](=O)[O-].CO.[H][H].[Pd] as the reactants and reagents? | Sure. A potential product: COc1ccc2scnc2c1N . |
|
Can you tell me the potential product of a chemical reaction that uses O=C1NC(C(=O)O)Cc2ccc([N+](=O)[O-])cc21.CC(=O)O.O=[Pt]=O as the reactants and reagents? | Sure. A potential product: Nc1ccc2c(c1)C(=O)NC(C(=O)O)C2 . |
|
Predict the product of a chemical reaction with CCc1cc(C=O)ccc1Cl.O=C(O)c1ccc(N2CC3(CCNCC3)OC2=O)cc1.Cl as the reactants and reagents. | CCc1cc(CN2CCC3(CC2)CN(c2ccc(C(=O)O)cc2)C(=O)O3)ccc1Cl . |
|
Based on the given reactants and reagents: CC(C)(C)C(=O)Cl.CC1(C)OB(c2ccc(N)nc2)OC1(C)C.CCN(CC)CC.CCOC(C)=O.c1ccncc1, what product could potentially be produced? | The product can be CC(C)(C)C(=O)Nc1ccc(B2OC(C)(C)C(C)(C)O2)cn1 . |
|
Consider that for a chemical reaction, if NCc1ccccn1.O=C1Cc2cc(C(=O)O)ccc2N1.CC#N.CCN(C(C)C)C(C)C.CN(C)C(On1nnc2ccccc21)=[N+](C)C.CN(C)C=O.F[B-](F)(F)F.O.O=C([O-])O.On1nnc2ccccc21.[Na+] is/are the reactants and reagents, what can be the product? | O=C1Cc2cc(C(=O)NCc3ccccn3)ccc2N1 . |
|
Predict the product of a chemical reaction with CC(C)(C)OC(=O)NC(Cc1ccc(Cl)cc1)C(=O)O.c1ccn2c(N3CCNCC3)cnc2c1.CCN(CC)CC.CCN=C=NCCCN(C)C.CN(C)C=O.Cl.Cl.Cl.O.On1nnc2ccccc21.[Na+].[OH-] as the reactants and reagents. | CC(C)(C)OC(=O)NC(Cc1ccc(Cl)cc1)C(=O)N1CCN(c2cnc3ccccn23)CC1 . |
|
A chemical reaction has started with the substance(s) NC(=O)OCC1=C(C(=O)OC(c2ccccc2)c2ccccc2)N2C(=O)C(N)C2SC1.O=C(O)C(=NOCC1CC1)c1csc(NC(c2ccccc2)(c2ccccc2)c2ccccc2)n1.CN(C)C=O.CN(C)c1ccccc1.ClCCl.O=C(Cl)C(=O)Cl as the reactants and reagents, what could be a probable product? | A probable product: NC(=O)OCC1=C(C(=O)OC(c2ccccc2)c2ccccc2)N2C(=O)C(NC(=O)C(=NOCC3CC3)c3csc(NC(c4ccccc4)(c4ccccc4)c4ccccc4)n3)C2SC1 . |
|
Predict a possible product from the listed reactants and reagents. CC1(C)OC(=O)C(Cc2ccc(OCc3ccccc3)cc2)O1.CCOC(C)=O.[Pd] | CC1(C)OC(=O)C(Cc2ccc(O)cc2)O1 . |
|
Based on the given reactants and reagents: COc1cc(Cl)c(-c2ccc(Cl)cc2)cc1C(=O)O.N#CC1CNCCN1.CCN(CC)CC.CCN=C=NCCCN(C)C.ClCCl.On1nnc2ccccc21, what product could potentially be produced? | The product can be COc1cc(Cl)c(-c2ccc(Cl)cc2)cc1C(=O)N1CCNC(C#N)C1 . |
|
Predict the product of a chemical reaction with CC(C)(C)OC(=O)NC1CCCNC1.Fc1ccc(Br)cc1.CC(C)(C)P(c1ccccc1-c1ccccc1)C(C)(C)C.CC(C)(C)[O-].Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.O=C(C=Cc1ccccc1)C=Cc1ccccc1.[Na+].[Pd].[Pd] as the reactants and reagents. | CC(C)(C)OC(=O)NC1CCCN(c2ccc(F)cc2)C1 . |
|
Consider that for a chemical reaction, if CC(=O)Cc1ccc(OCc2cccnc2)cc1.NCC(O)c1cccc(Cl)c1.O is/are the reactants and reagents, what can be the product? | CC(Cc1ccc(OCc2cccnc2)cc1)NCC(O)c1cccc(Cl)c1 . |
|
Predict a possible product from the listed reactants and reagents. COc1cc(Cl)ccc1[N+](=O)[O-].O=C1CCC(=O)N1I.O=S(=O)(O)O.O=S(=O)(OS(=O)(=O)C(F)(F)F)C(F)(F)F | COc1cc(Cl)c(I)cc1[N+](=O)[O-] . |
|
Please provide a feasible product that could be formed using these reactants and reagents: COCC1CN(c2ccc(C3CCCCC3)c([N+](=O)[O-])c2)C(=O)O1.CCO.[Pd] . | COCC1CN(c2ccc(C3CCCCC3)c(N)c2)C(=O)O1 . |
|
CCOC(=O)COCc1noc(C(CCCC2CCCCC2)CC(=O)NO)n1.C1COCCO1.O.O.[Li+].[OH-] Based on the reactants and reagents given above, suggest a possible product. | A possible product can be O=C(O)COCc1noc(C(CCCC2CCCCC2)CC(=O)NO)n1 . |
|
Predict the product of a chemical reaction with Cn1c(N2CCNCC2)cc(=O)n(C)c1=O.O=c1cc(-c2ccccc2)oc2cccc(OCC3CO3)c12.CCO as the reactants and reagents. | Cn1c(N2CCN(CC(O)COc3cccc4oc(-c5ccccc5)cc(=O)c34)CC2)cc(=O)n(C)c1=O . |
|
Propose a potential product given these reactants and reagents. COC(=O)c1ccc2c(C3CCCCC3)c(-c3ccccc3N)[nH]c2c1.O=C(Cl)CCl.C1CCOC1.CC(=O)O.CC(=O)[O-].O=C([O-])O.[Na+].[Na+] | COC(=O)c1ccc2c(C3CCCCC3)c(-c3ccccc3NC(=O)CCl)[nH]c2c1 . |
|
Propose a potential product given these reactants and reagents. CCOC(=O)c1cc(OC)[nH]n1.C1CCOC1.Cl.[Na+].[OH-] | COc1cc(C(=O)O)n[nH]1 . |
|
Consider that for a chemical reaction, if CN1CCCn2c1cc(Cl)nc2=O.N#Cc1cc(CO)ccc1Oc1cccc(C(F)(F)F)c1.CN(C)C=O.Cl.[H-].[Na+] is/are the reactants and reagents, what can be the product? | CN1CCCn2c1cc(OCc1ccc(Oc3cccc(C(F)(F)F)c3)c(C#N)c1)nc2=O . |
|
Propose a potential product given these reactants and reagents. CC1(C)C=C(c2ccc3ccccc3c2)c2ccc(O)cc2O1.CCN(CC)CCCl.CN(C)CCOc1ccc2c(c1)OC(C)(C)CC2c1ccc(C(F)(F)F)cc1.Cl | CCN(CC)CCOc1ccc2c(c1)OC(C)(C)C=C2c1ccc2ccccc2c1 . |
|
O=C(O)COc1ncc(C(=O)Nc2ccc(F)cc2)cn1.Oc1ccccc1.CCCCCC.CCOC(C)=O Based on the reactants and reagents given above, suggest a possible product. | A possible product can be O=C(COc1ncc(C(=O)Nc2ccc(F)cc2)cn1)Oc1ccccc1 . |
|
Propose a potential product given these reactants and reagents. CC1CC(O)CC(C)(C)C1.Oc1cccc(O)c1.C1CCOC1.CC(C)OC(=O)N=NC(=O)OC(C)C.c1ccc(P(c2ccccc2)c2ccccc2)cc1 | CC1CC(Oc2cccc(O)c2)CC(C)(C)C1 . |
|
Given the following reactants and reagents, please provide a possible product. CC(C)(C)c1cccc(C=O)c1O.NO.CC#N.CCN(CC)CC.Cl | CC(C)(C)c1cccc(C=NO)c1O . |
|
Based on the given reactants and reagents: CCOC(=O)C=Cc1cn(Cc2ccccc2)nc1OCc1ccc(OCc2nc(-c3ccco3)oc2C)c(OC)c1.C1CCOC1.CCO.Cl.O.[Na+].[OH-], what product could potentially be produced? | The product can be COc1cc(COc2nn(Cc3ccccc3)cc2C=CC(=O)O)ccc1OCc1nc(-c2ccco2)oc1C . |
|
CCCCBr.Oc1c(F)c(F)cc(F)c1F.CCC(C)=O.CCCC[N+](CCCC)(CCCC)CCCC.O.O=C([O-])[O-].[Br-].[K+].[K+] Given the above reactants and reagents, what could be a probable product of their reaction? | A probable product could be CCCCOc1c(F)c(F)cc(F)c1F . |
|
Please provide a feasible product that could be formed using these reactants and reagents: CCN(CC(C)Nc1c(C)cccc1C)C(C)=O.CCOCC.[Al+3].[H-].[H-].[H-].[H-].[Li+] . | CCN(CC)CC(C)Nc1c(C)cccc1C . |
|
Consider that for a chemical reaction, if CC(=O)Cl.NCC1CN(c2ccc3cc(-c4ccccc4C(F)(F)F)[nH]c(=O)c3c2)C(=O)O1.Cl.c1ccncc1 is/are the reactants and reagents, what can be the product? | CC(=O)NCC1CN(c2ccc3cc(-c4ccccc4C(F)(F)F)[nH]c(=O)c3c2)C(=O)O1 . |
|
COC(=O)c1ccc2ncccc2c1.C1CCOC1.CCOCC.O.[Al+3].[H-].[H-].[H-].[H-].[Li+].[Na+].[OH-] Considering the given starting materials, what might be the resulting product in a chemical reaction? | OCc1ccc2ncccc2c1 . |
|
A chemical reaction has started with the substance(s) CCOC(=O)C1C2CNCC21.O=C1CCC1.CC(=O)O.CC(=O)O[BH-](OC(C)=O)OC(C)=O.ClCCl.O=C([O-])O.[Na+].[Na+] as the reactants and reagents, what could be a probable product? | A probable product: CCOC(=O)C1C2CN(C3CCC3)CC21 . |
|
COC(=O)c1cccc(Oc2ccc(Cl)cc2Nc2ccnc3nc(C)ccc23)c1.C1CCOC1.CC(=O)O.O.[Li+].[OH-] Based on the reactants and reagents given above, suggest a possible product. | A possible product can be Cc1ccc2c(Nc3cc(Cl)ccc3Oc3cccc(C(=O)O)c3)ccnc2n1 . |
|
A chemical reaction has started with the substance(s) COC(=O)C1CC1C(=O)c1cc(Br)c(N)c(Br)c1.C1CCOC1.O.O.[Br-].[K+].[Li+].[OH-] as the reactants and reagents, what could be a probable product? | A probable product: Nc1c(Br)cc(C(=O)C2CC2C(=O)O)cc1Br . |
|
Based on the given reactants and reagents: CCC(N)c1ccccc1.O=C(O)c1ccn2c1CCCC2.CCN=C=NCCCN(C)C.CN(C)C=O.Cl.On1nnc2ccccc21, what product could potentially be produced? | The product can be CCC(NC(=O)c1ccn2c1CCCC2)c1ccccc1 . |
|
Consider that for a chemical reaction, if O=[N+]([O-])c1ncccc1OC(F)F.CCO.O.[Cl-].[Fe].[NH4+] is/are the reactants and reagents, what can be the product? | Nc1ncccc1OC(F)F . |
|
CCOC(=O)c1cccc(NC(=O)NC2CN(C(=O)CC(C)C)c3ccc(C)cc3N(CC(=O)c3ccccc3C)C2=O)c1.C1CCOC1.CO.O.[Li+].[OH-] Given the above reactants and reagents, what could be a probable product of their reaction? | A probable product could be Cc1ccc2c(c1)N(CC(=O)c1ccccc1C)C(=O)C(NC(=O)Nc1cccc(C(=O)O)c1)CN2C(=O)CC(C)C . |
|
Predict the product of a chemical reaction with CCOC(=O)CCNC(=O)c1ccc(C(Nc2cnc3ccccc3c2)C2CC(C)(C)C2)cc1.C1CCOC1.CCOC(C)=O.CO.Cl.O.[Na+].[OH-] as the reactants and reagents. | CC1(C)CC(C(Nc2cnc3ccccc3c2)c2ccc(C(=O)NCCC(=O)O)cc2)C1 . |
|
Can you tell me the potential product of a chemical reaction that uses CS(=O)(=O)OCCCn1c(=O)[nH]c2cc(Cl)ccc21.O=C1NCN(c2ccccc2)C12CCNCC2.CN(C)C=O.[Na] as the reactants and reagents? | Sure. A potential product: O=C1NCN(c2ccccc2)C12CCN(CCCn1c(=O)[nH]c3cc(Cl)ccc31)CC2 . |
|
Can you tell me the potential product of a chemical reaction that uses CC(C)(C)OC(=O)NC(Cc1ccc(OC2CCCC2)cc1)C(=O)O.CN.ClCCl.On1nnc2ccccc21 as the reactants and reagents? | Sure. A potential product: CNC(=O)C(Cc1ccc(OC2CCCC2)cc1)NC(=O)OC(C)(C)C . |
|
Propose a potential product given these reactants and reagents. O=[N+]([O-])c1ccc(-c2cc[nH]n2)cc1.CO.NN.O.[Ni] | Nc1ccc(-c2cc[nH]n2)cc1 . |
|
Based on the given reactants and reagents: CCCCC12Cc3cc(OCOC)ccc3C1=C(C)C(=O)C(CC=O)C2.CCOC(C)=O.CO.Cl, what product could potentially be produced? | The product can be CCCCC12Cc3cc(O)ccc3C1=C(C)C(=O)C(CC=O)C2 . |
|
Using N#CC1(c2ncc(C3CC3C(F)(F)F)cc2Cl)CC1.CO.N.[Ni] as the reactants and reagents, tell me the potential product. | NCC1(c2ncc(C3CC3C(F)(F)F)cc2Cl)CC1 . |
|
CNC(=O)C(=NOC)c1ccccc1Oc1cccc(O)c1.O=C(Cl)c1ccccc1.CCN(CC)CC.CCOCC.ClCCl Given the above reactants and reagents, what could be a probable product of their reaction? | A probable product could be CNC(=O)C(=NOC)c1ccccc1Oc1cccc(OC(=O)c2ccccc2)c1 . |
|
A chemical reaction has started with the substance(s) CCOC(=O)Cl.CNC1C2CCC1CN(CCCNc1ccc(C#N)cc1)C2.CN(C)C=O.ClC(Cl)Cl.O=C([O-])[O-].[K+].[K+] as the reactants and reagents, what could be a probable product? | A probable product: CCOC(=O)N(C)C1C2CCC1CN(CCCNc1ccc(C#N)cc1)C2 . |
|
A chemical reaction has started with the substance(s) CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.COC(=O)C1CC(N)CN1C(=O)CN(C)C(=O)OC(C)(C)C.C1CCOC1 as the reactants and reagents, what could be a probable product? | A probable product: COC(=O)C1CC(NC(=O)OC(C)(C)C)CN1C(=O)CN(C)C(=O)OC(C)(C)C . |
|
Cc1ccc(S(=O)(=O)n2ccc3c(-c4ccc(F)c(C(F)(F)F)c4)nc(C#N)nc32)cc1.CC(=O)N(C)C Considering the given starting materials, what might be the resulting product in a chemical reaction? | N#Cc1nc(-c2ccc(F)c(C(F)(F)F)c2)c2cc[nH]c2n1 . |
|
Given the following reactants and reagents, please provide a possible product. CC(C)c1cc(N)n(-c2ccc3ncsc3c2)n1.O=C(Cl)OCC(Cl)(Cl)Cl.ClCCl.c1ccncc1 | CC(C)c1cc(NC(=O)OCC(Cl)(Cl)Cl)n(-c2ccc3ncsc3c2)n1 . |
|
Propose a potential product given these reactants and reagents. CC(C)(C)OC(=O)N1CCC(C)(c2nc(-c3cccc(N)c3F)c(-c3ccnc(Cl)n3)s2)CC1.O=S(=O)(Cl)c1c(F)cccc1F.c1ccncc1 | CC(C)(C)OC(=O)N1CCC(C)(c2nc(-c3cccc(NS(=O)(=O)c4c(F)cccc4F)c3F)c(-c3ccnc(Cl)n3)s2)CC1 . |
|
COc1cc(-c2cc(C)nn2-c2cccc(C)c2)ccn1.Br.CC(=O)O.O.[NH4+].[OH-] Considering the given starting materials, what might be the resulting product in a chemical reaction? | Cc1cccc(-n2nc(C)cc2-c2cc[nH]c(=O)c2)c1 . |
|
Propose a potential product given these reactants and reagents. Cc1ccccc1CC1CCCN1.Cc1nc(-c2cn3c(n2)-c2cnc(Cl)cc2OCC3)n(CC(F)(F)F)n1.CCN(CC)CC.CN1CCCC1=O | Cc1nc(-c2cn3c(n2)-c2cnc(N4CCCC4Cc4ccccc4C)cc2OCC3)n(CC(F)(F)F)n1 . |
|
A chemical reaction has started with the substance(s) CCOC(=O)NC(C)C(=O)c1cc(C#N)c2c(c1)CCN2CCCO[Si](C)(C)C(C)(C)C.CC[SiH](CC)CC.Cc1ccccc1.O=C(O)C(F)(F)F as the reactants and reagents, what could be a probable product? | A probable product: CCOC(=O)NC(C)Cc1cc(C#N)c2c(c1)CCN2CCCO[Si](C)(C)C(C)(C)C . |
|
CCOC(=O)Cl.CC1COCCN1c1nc(Cl)nc2c1CNC2.C1CCOC1.Cl.O=C([O-])O.[Na+] Based on the reactants and reagents given above, suggest a possible product. | A possible product can be CCOC(=O)N1Cc2nc(Cl)nc(N3CCOCC3C)c2C1 . |
|
CC(C)c1noc(N2CCC(O)CC2)n1.Cc1c(Cl)ncnc1Cl.C1CCOC1.CC(C)(C)[O-].[K+] Based on the reactants and reagents given above, suggest a possible product. | A possible product can be Cc1c(Cl)ncnc1OC1CCN(c2nc(C(C)C)no2)CC1 . |
|
Predict the product of a chemical reaction with CCCCc1cc(-c2ccc(Cn3ccnc3)cc2)c(S(=O)(=O)NC(C)(C)C)s1.Brc1ccc(Cn2ccnc2)cc1.COc1ccccc1.O=C(O)C(F)(F)F as the reactants and reagents. | CCCCc1cc(-c2ccc(Cn3ccnc3)cc2)c(S(N)(=O)=O)s1 . |
|
Based on the given reactants and reagents: COC(=O)Cc1ccc(NCC(=O)CCN2CCC(OC(=O)Nc3ccccc3-c3ccccc3)CC2)cc1.CC#N.Cl.O.[Li+].[OH-], what product could potentially be produced? | The product can be O=C(O)Cc1ccc(NCC(=O)CCN2CCC(OC(=O)Nc3ccccc3-c3ccccc3)CC2)cc1 . |
|
Predict the product of a chemical reaction with CCc1cc(-c2noc(-c3cc(C)c(CC(C)C)cn3)n2)cc(C)c1OCC(O)CNCCC(=O)OC.CCO.[Na+].[OH-] as the reactants and reagents. | CCc1cc(-c2noc(-c3cc(C)c(CC(C)C)cn3)n2)cc(C)c1OCC(O)CNCCC(=O)O . |
|
Based on the given reactants and reagents: CC(=O)C1(C)CC1CC1CC=C(C)C1(C)C.[BH4-].[Na+], what product could potentially be produced? | The product can be CC1=CCC(CC2CC2(C)C(C)O)C1(C)C . |
|
Predict a possible product from the listed reactants and reagents. CSc1ccc(C#N)cc1.NO.CO.Cl.O.O=C([O-])[O-].[Na+].[Na+] | CSc1ccc(C(=N)NO)cc1 . |
|
Please provide a feasible product that could be formed using these reactants and reagents: CC(C)(C)OC(=O)NCC(CO)CCn1ccc(=O)[nH]c1=O.ClC(c1ccccc1)(c1ccccc1)c1ccccc1.c1ccncc1 . | CC(C)(C)OC(=O)NCC(CCn1ccc(=O)[nH]c1=O)COC(c1ccccc1)(c1ccccc1)c1ccccc1 . |
|
Propose a potential product given these reactants and reagents. NC1CC1.O=C(O)Cc1ccc(F)cc1.CCN=C=NCCCN(C)C.CN(C)C=O.O.On1nnc2ccccc21 | O=C(Cc1ccc(F)cc1)NC1CC1 . |
|
COC(=O)c1ccc(C(=O)OC)c(Cl)c1.C1CCOC1.CO.Cl.O.O.[Li+].[OH-] Considering the given starting materials, what might be the resulting product in a chemical reaction? | COC(=O)c1ccc(C(=O)O)cc1Cl . |
|
A chemical reaction has started with the substance(s) C=CCc1ccc(OC)cc1C(=O)OC.CO.[Pd] as the reactants and reagents, what could be a probable product? | A probable product: CCCc1ccc(OC)cc1C(=O)OC . |
|
Consider that for a chemical reaction, if COC(=O)c1cc([N+](=O)[O-])c2sc(Nc3c(C)cc(C)cc3C)nc2c1.C1CCOC1.CCOCC.[BH4-].[Li+] is/are the reactants and reagents, what can be the product? | Cc1cc(C)c(Nc2nc3cc(CO)cc([N+](=O)[O-])c3s2)c(C)c1 . |
|
Based on the given reactants and reagents: C1CCC(NCC2CC2)CC1.CNS(=O)(=O)c1ccc(NC(=O)c2cc(Cl)ncn2)c(C)c1.CC(C)NC(C)C.CCO, what product could potentially be produced? | The product can be CNS(=O)(=O)c1ccc(NC(=O)c2cc(N(CC3CC3)C3CCCCC3)ncn2)c(C)c1 . |
|
Cc1cc([N+](=O)[O-])cc(Cl)c1Br.CC(=O)O.CCO.O.O=C([O-])O.[Fe].[Na+] Given the above reactants and reagents, what could be a probable product of their reaction? | A probable product could be Cc1cc(N)cc(Cl)c1Br . |
|
Please provide a feasible product that could be formed using these reactants and reagents: COc1ccc(F)cc1C(C)(C)CC(O)(CNc1ccnc2ccccc12)C(F)(F)F.BrB(Br)Br.CO.ClCCl.ClCCl . | CC(C)(CC(O)(CNc1ccnc2ccccc12)C(F)(F)F)c1cc(F)ccc1O . |
|
Can you tell me the potential product of a chemical reaction that uses Nc1ccc([N+](=O)[O-])cc1.O=C(Cl)c1ccc(F)cc1F.Cl.[Cl-].[Cl-].[Zn+2] as the reactants and reagents? | Sure. A potential product: Nc1ccc([N+](=O)[O-])cc1C(=O)c1ccc(F)cc1F . |
|
CC(C)Cn1ncc2cc(Oc3ccc(F)cc3F)c(C(=O)O)cc21.COC(=O)C(N)CCN1CCCCC1.CCN(C(C)C)C(C)C.CCN=C=NCCCN(C)C.Cl.Cl.ClCCl.On1nnc2ccccc21 Given the above reactants and reagents, what could be a probable product of their reaction? | A probable product could be COC(=O)C(CCN1CCCCC1)NC(=O)c1cc2c(cnn2CC(C)C)cc1Oc1ccc(F)cc1F . |
|
Propose a potential product given these reactants and reagents. COC(=O)C(Cc1ccccc1)NC(=O)c1cnccn1.CC(C)=O.Cl.[Na+].[OH-] | O=C(NC(Cc1ccccc1)C(=O)O)c1cnccn1 . |
|
A chemical reaction has started with the substance(s) CC1(C)OB(c2ccc(C3(C#N)CCC3)cc2)OC1(C)C.B.C1CCOC1 as the reactants and reagents, what could be a probable product? | A probable product: CC1(C)OB(c2ccc(C3(CN)CCC3)cc2)OC1(C)C . |
|
CC1CN(c2ccc([N+](=O)[O-])nc2)C1.CCO.CCOC(C)=O Considering the given starting materials, what might be the resulting product in a chemical reaction? | CC1CN(c2ccc(N)nc2)C1 . |
|
Can you tell me the potential product of a chemical reaction that uses CSc1ncc(C(C)N)nn1.O=C(O)c1cccc(Br)c1.CCN(CC)CC.CN(C)C(On1nnc2cccnc21)=[N+](C)C.CN(C)C=O.Cl as the reactants and reagents? | Sure. A potential product: CSc1ncc(C(C)NC(=O)c2cccc(Br)c2)nn1 . |
|
Based on the given reactants and reagents: CC(C)(C)OC(=O)N1CCC(c2nc(-c3ccc(F)c(Cl)c3)cn2CCN)CC1.O=C(Cl)OCc1ccccc1.CCN(C(C)C)C(C)C.ClCCl, what product could potentially be produced? | The product can be CC(C)(C)OC(=O)N1CCC(c2nc(-c3ccc(F)c(Cl)c3)cn2CCNC(=O)OCc2ccccc2)CC1 . |
|
Can you tell me the potential product of a chemical reaction that uses CN(C)C(=O)C(CC(=O)OC(C)(C)C)c1ccc(OCc2cccc(-c3ccc(C(F)(F)F)cc3)c2)cc1.ClCCl.O=C(O)C(F)(F)F as the reactants and reagents? | Sure. A potential product: CN(C)C(=O)C(CC(=O)O)c1ccc(OCc2cccc(-c3ccc(C(F)(F)F)cc3)c2)cc1 . |
|
Predict a possible product from the listed reactants and reagents. NC1CN2CCC1CC2.O=C(O)c1cc(Cl)cc2oc(-c3ccsc3)nc12.CCN(CC)CC.CCN=C=NCCCN(C)C.CN(C)C=O.Cl.Cl.Cl.ClCCl.On1nnc2ccccc21 | O=C(NC1CN2CCC1CC2)c1cc(Cl)cc2oc(-c3ccsc3)nc12 . |
|
A chemical reaction has started with the substance(s) CC(C)(C)[Si](Cl)(c1ccccc1)c1ccccc1.O=C(O)CC(CO)NC(=O)OCc1ccccc1.C1CCOC1.CCOC(C)=O.CN(C)C=O.CO.Cl.O.O=C([O-])[O-].[K+].[K+].c1c[nH]cn1 as the reactants and reagents, what could be a probable product? | A probable product: CC(C)(C)[Si](OCC(CC(=O)O)NC(=O)OCc1ccccc1)(c1ccccc1)c1ccccc1 . |
|
Consider that for a chemical reaction, if Cc1ccc(CO)c(C(=O)O)c1.C1CCOC1.O=[Mn]=O is/are the reactants and reagents, what can be the product? | Cc1ccc(C=O)c(C(=O)O)c1 . |
|
Based on the given reactants and reagents: BrC(Br)(Br)Br.CC(=O)OCc1ccc(Cl)cc1N(C(C)CCCO)S(=O)(=O)c1ccc(Cl)cc1.CC#N.[Cl-].[NH4+].c1ccc(P(c2ccccc2)c2ccccc2)cc1, what product could potentially be produced? | The product can be CC(=O)OCc1ccc(Cl)cc1N(C(C)CCCBr)S(=O)(=O)c1ccc(Cl)cc1 . |
|
FC(F)(F)c1ccccc1OC1CCNCC1.O=C(O)CNC(=O)c1cn(-c2ccccc2)cn1.CCN(C(C)C)C(C)C.CCN=C=NCCCN(C)C.CN(C)C=O.O.O=C(O)C(F)(F)F.On1nnc2ccccc21 Given the above reactants and reagents, what could be a probable product of their reaction? | A probable product could be O=C(NCC(=O)N1CCC(Oc2ccccc2C(F)(F)F)CC1)c1cn(-c2ccccc2)cn1 . |
|
Please provide a feasible product that could be formed using these reactants and reagents: CCO.Cc1cc2c(cc1C(=O)O)OCCO2.CCOCC.Cl.O=S(Cl)Cl . | CCOC(=O)c1cc2c(cc1C)OCCO2 . |
|
Using CCOC(=O)c1cc(C(=O)OCC)c2ccccn2c1=O.C[Si](C)(C)I.ClC(Cl)Cl as the reactants and reagents, tell me the potential product. | CCOC(=O)c1cc(C(=O)O)c(=O)n2ccccc12 . |
|
Based on the given reactants and reagents: CCCCc1noc(CO)c1COc1ccc(C(=O)OC)cn1.C1COCCO1.[Na+].[OH-], what product could potentially be produced? | The product can be CCCCc1noc(CO)c1COc1ccc(C(=O)O)cn1 . |
|
Propose a potential product given these reactants and reagents. N#Cc1cccc(NC(=O)N2CCNC(CN3CCC(Cc4ccc(F)cc4)CC3)C2)c1.O=Cc1ccccc1.CC(=O)O[BH-](OC(C)=O)OC(C)=O.CC(Cl)Cl.Cl.Cl.[Na+] | N#Cc1cccc(NC(=O)N2CCN(Cc3ccccc3)C(CN3CCC(Cc4ccc(F)cc4)CC3)C2)c1 . |
|
O=Cc1ccc(O)cc1.O=[N+]([O-])c1ccc(F)cc1.CN(C)C=O.O.[H-].[Na+] Based on the reactants and reagents given above, suggest a possible product. | A possible product can be O=Cc1ccc(Oc2ccc([N+](=O)[O-])cc2)cc1 . |
|
Using N#Cc1ccc(CBr)cc1.O=C1CCC2(CCNCC2)Nc2ccccc21.C1CCOC1 as the reactants and reagents, tell me the potential product. | N#Cc1ccc(CN2CCC3(CCC(=O)c4ccccc4N3)CC2)cc1 . |
|
Consider that for a chemical reaction, if COC(=O)c1ccc(C(=O)NN=C(C)c2nn(C)c(-c3ccc(Cl)c(Cl)c3)c2O)cc1[N+](=O)[O-].[Na+].[OH-] is/are the reactants and reagents, what can be the product? | CC(=NNC(=O)c1ccc(C(=O)O)c([N+](=O)[O-])c1)c1nn(C)c(-c2ccc(Cl)c(Cl)c2)c1O . |
Subsets and Splits