id
int64 0
129k
| molecules
dict | messages
listlengths 3
3
| ground_truth
stringclasses 1
value |
---|---|---|---|
128,500 | {
"selfies": [
"[C][C][Branch1][C][C][C][C][=Branch1][C][=O][C][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][=N][N][Branch2][Ring1][#Branch2][C][=C][C][=C][Branch1][=Branch1][C][Branch1][C][N][=O][C][Branch1][=Branch2][N][C][C][Branch1][C][O][C][O][=C][Ring1][#C][C][=Ring2][Ring1][Branch2][C][Ring2][Ring1][=C]"
],
"smiles": [
"CC1(C)CC(=O)c2c(C(F)(F)F)nn(-c3ccc(C(N)=O)c(NCC(O)CO)c3)c2C1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Could you tell which reactants might have been used to generate the following product? <molecule_2d>",
"role": "user"
},
{
"content": "CC1(C)CC(=O)c2c(C(F)(F)F)nn(-c3ccc(C#N)c(NCC(O)CO)c3)c2C1.OO",
"role": "assistant"
}
] | |
128,501 | {
"selfies": [
"[C][C][Branch2][Ring1][C][C][O][Si][Branch1][C][C][Branch1][C][C][C][Branch1][C][C][Branch1][C][C][C][O][C][=Branch1][C][=O][C][=C][C][=C][C][=C][Ring1][=Branch1][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1]"
],
"smiles": [
"CC(CO[Si](C)(C)C(C)(C)C)OC(=O)c1ccccc1OCc1ccccc1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "To synthesis <molecule_2d>, what are the possible reactants? Write in the SMILES representation.",
"role": "user"
},
{
"content": "CC(O)CO[Si](C)(C)C(C)(C)C.O=C(O)c1ccccc1OCc1ccccc1",
"role": "assistant"
}
] | |
128,502 | {
"selfies": [
"[C][N][C][C][C][Branch2][Branch1][C][N][Branch1][C][C][C][=Branch1][C][=O][C][C][C][N][Branch2][Ring1][=C][C][=C][C][=C][Branch1][C][F][C][Branch1][P][C][=N][C][=C][C][Branch1][C][Cl][=C][C][=C][Ring1][#Branch1][NH1][Ring1][#Branch2][=C][Ring1][P][C][C][Ring2][Ring1][#Branch1][C][Ring2][Ring1][S]"
],
"smiles": [
"CN1CCC(N(C)C(=O)C2CCN(c3ccc(F)c(-c4nc5cc(Cl)ccc5[nH]4)c3)CC2)C1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Provide the potential reactants that may be used to produce the product <molecule_2d> .",
"role": "user"
},
{
"content": "The potential reactants: CNC1CCN(C)C1.O=C(O)C1CCN(c2ccc(F)c(-c3nc4cc(Cl)ccc4[nH]3)c2)CC1 .",
"role": "assistant"
}
] | |
128,503 | {
"selfies": [
"[C][O][C][=C][C][=C][Branch2][Branch1][O][N][C][N][Branch1][P][C][C][=C][C][=C][C][Branch1][=Branch1][C][=Branch1][C][=O][O][=C][Ring1][=Branch2][C][=Branch1][C][=O][C][Ring1][S][C][C][N][Branch2][Ring1][Ring2][C][C][C][N][C][=Branch1][C][=O][S][C][=C][C][=C][C][=C][Ring1][=Branch1][Ring1][#Branch2][C][C][Ring2][Ring1][Ring1][C][=C][Ring2][Ring2][Branch2]"
],
"smiles": [
"COc1ccc(N2CN(Cc3cccc(C(=O)O)c3)C(=O)C23CCN(CCCn2c(=O)sc4ccccc42)CC3)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "<molecule_2d> Given the product provided, propose some possible reactants that could have been employed in its formation.",
"role": "user"
},
{
"content": "Here are possible reactants: COC(=O)c1cccc(CN2CN(c3ccc(OC)cc3)C3(CCN(CCCn4c(=O)sc5ccccc54)CC3)C2=O)c1 .",
"role": "assistant"
}
] | |
128,504 | {
"selfies": [
"[C][O][C][=C][C][=C][Branch1][Ring2][C][C][#N][C][=C][Ring1][=Branch2][O][C][C][C][C][Ring1][Ring1]"
],
"smiles": [
"COc1ccc(CC#N)cc1OCC1CC1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Could you tell which reactants might have been used to generate the following product? <molecule_2d>",
"role": "user"
},
{
"content": "COc1ccc(CCl)cc1OCC1CC1.[C-]#N",
"role": "assistant"
}
] | |
128,505 | {
"selfies": [
"[O][=C][Branch1][C][O][C][=C][N][Branch1][#C][C][=C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=N][Ring1][#Branch2][C][=C][C][=C][C][=C][Ring2][Ring1][Ring1][Ring1][=Branch1]"
],
"smiles": [
"O=C(O)c1cn(-c2cc3ccccc3cn2)c2ccccc12"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "<molecule_2d> Given the product provided, propose some possible reactants that could have been employed in its formation.",
"role": "user"
},
{
"content": "Here are possible reactants: COC(=O)c1cn(-c2cc3ccccc3cn2)c2ccccc12 .",
"role": "assistant"
}
] | |
128,506 | {
"selfies": [
"[C][C][=C][C][Branch1][Branch2][O][C][C][=Branch1][C][=O][O][=C][C][=C][Ring1][O][N][C][=Branch1][C][=O][C][=C][C][=C][Branch2][Ring1][Branch2][N][C][C][N][Branch1][=C][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C][C][C][Ring1][=N][C][=C][Ring2][Ring1][Ring1]"
],
"smiles": [
"Cc1cc(OCC(=O)O)ccc1NC(=O)c1ccc(N2CCN(C(=O)OC(C)(C)C)CC2)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Can you list the reactants that might result in the chemical product <molecule_2d> ?",
"role": "user"
},
{
"content": "CCOC(=O)COc1ccc(NC(=O)c2ccc(N3CCN(C(=O)OC(C)(C)C)CC3)cc2)c(C)c1",
"role": "assistant"
}
] | |
128,507 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][C][C][N][Branch2][Ring1][Ring2][C][=C][C][=N][C][=C][C][=C][Ring1][=Branch1][C][=C][Ring1][#Branch2][N+1][=Branch1][C][=O][O-1][C][C][Ring2][Ring1][Ring1]"
],
"smiles": [
"CC(C)(C)OC(=O)NCC1CCN(c2cc3ncccc3cc2[N+](=O)[O-])CC1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Identify possible reactants that could have been used to create the specified product. <molecule_2d>",
"role": "user"
},
{
"content": "CC(C)(C)OC(=O)NCC1CCNCC1.O=[N+]([O-])c1cc2cccnc2cc1Cl",
"role": "assistant"
}
] | |
128,508 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][Branch1][#Branch2][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=Branch1][C][=O][C][C][C][=Branch1][C][=O][O]"
],
"smiles": [
"CC(C)(C)OC(=O)NC(Cc1ccccc1)C(=O)CCC(=O)O"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Could you tell which reactants might have been used to generate the following product? <molecule_2d>",
"role": "user"
},
{
"content": "CCOC(=O)CCC(=O)C(Cc1ccccc1)NC(=O)OC(C)(C)C",
"role": "assistant"
}
] | |
128,509 | {
"selfies": [
"[C][C][=Branch1][Ring1][=N][O][C][=C][C][Branch1][C][O][=C][C][=C][Ring1][#Branch1][O]"
],
"smiles": [
"CC(=NO)c1cc(O)ccc1O"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "To synthesis <molecule_2d>, what are the possible reactants? Write in the SMILES representation.",
"role": "user"
},
{
"content": "CC(=O)c1cc(O)ccc1O.NO",
"role": "assistant"
}
] | |
128,510 | {
"selfies": [
"[C][C][Branch1][C][S][C][N][C][=Branch1][C][=O][O][C][C][=C][C][=C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][C][=C][Ring1][=Branch2]"
],
"smiles": [
"CC(S)CNC(=O)OCc1ccc([N+](=O)[O-])cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Do retrosynthesis with the product <molecule_2d> .",
"role": "user"
},
{
"content": "OK. The reactants may be CC(S)CN.O=C(Cl)OCc1ccc([N+](=O)[O-])cc1 .",
"role": "assistant"
}
] | |
128,511 | {
"selfies": [
"[C][S][=Branch1][C][=O][=Branch1][C][=O][C][C][N][C][C][C][Branch2][Ring2][=Branch1][C][=C][C][=C][Branch1][P][N][C][=Branch1][C][=O][C][=N][C][=C][Branch1][Ring1][C][#N][NH1][Ring1][#Branch1][C][Branch1][=Branch2][C][=C][C][C][C][C][Ring1][=Branch1][=N][Ring2][Ring1][=Branch1][C][C][Ring2][Ring1][N]"
],
"smiles": [
"CS(=O)(=O)CCN1CCC(c2ccc(NC(=O)c3ncc(C#N)[nH]3)c(C3=CCCCC3)n2)CC1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Given the following product, please provide possible reactants. <molecule_2d>",
"role": "user"
},
{
"content": "Possible reactant(s): CS(=O)(=O)CCOS(C)(=O)=O.N#Cc1cnc(C(=O)Nc2ccc(C3CCNCC3)nc2C2=CCCCC2)[nH]1 .",
"role": "assistant"
}
] | |
128,512 | {
"selfies": [
"[C][C][C][=Branch1][C][=O][N][C][C][C][=C][C][C][=C][C][Branch1][C][F][=C][Branch1][Ring1][O][C][C][=C][Ring1][=Branch2][Ring1][N]"
],
"smiles": [
"CCC(=O)NCCC1=CCc2cc(F)c(OC)cc21"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Based on the given product, provide some plausible reactants that might have been utilized to prepare it. <molecule_2d>",
"role": "user"
},
{
"content": "CCC(=O)Cl.COc1cc2c(cc1F)CC=C2CCN",
"role": "assistant"
}
] | |
128,513 | {
"selfies": [
"[C][O][C][C][C][=C][Branch1][=Branch1][C][Branch1][C][C][=O][C][Branch1][Branch1][O][C][O][C][=C][C][Branch1][Branch1][O][C][O][C][=C][Ring1][P][C][=C][C][=C][C][Branch1][O][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1][=C][Ring1][=C]"
],
"smiles": [
"COCCc1c(C(C)=O)c(OCOC)cc(OCOC)c1-c1cccc(OCc2ccccc2)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Given the following product, please provide possible reactants. <molecule_2d>",
"role": "user"
},
{
"content": "Possible reactant(s): BrCc1ccccc1.COCCc1c(C(C)=O)c(OCOC)cc(OCOC)c1-c1cccc(O)c1 .",
"role": "assistant"
}
] | |
128,514 | {
"selfies": [
"[C][O][C][=Branch1][C][=O][C][C][=C][C][=C][C][Branch2][Ring2][S][O][C][C][C][N][Branch2][Ring1][Ring2][C][C][=C][C][=C][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][=C][Ring1][#Branch2][C][C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][C][=C][Ring1][=Branch1][=C][Ring2][Ring2][Ring2]"
],
"smiles": [
"COC(=O)Cc1cccc(OCCCN(Cc2cccc(C(F)(F)F)c2)CC(c2ccccc2)c2ccccc2)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Suggest possible substances that may have been involved in the synthesis of the presented compound. <molecule_2d>",
"role": "user"
},
{
"content": "COC(=O)Cc1cccc(OCCCNCC(c2ccccc2)c2ccccc2)c1.FC(F)(F)c1cccc(CBr)c1",
"role": "assistant"
}
] | |
128,515 | {
"selfies": [
"[N][#C][C][Branch1][=C][C][C][=C][C][=C][C][Branch1][C][Cl][=C][Ring1][#Branch1][Cl][C][=Branch1][C][=O][O]"
],
"smiles": [
"N#CC(Cc1cccc(Cl)c1Cl)C(=O)O"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Do retrosynthesis with the product <molecule_2d> .",
"role": "user"
},
{
"content": "OK. The reactants may be CCOC(=O)C(C#N)Cc1cccc(Cl)c1Cl .",
"role": "assistant"
}
] | |
128,516 | {
"selfies": [
"[O][=C][Branch1][C][O][C][=C][C][Branch1][=C][N][C][C][N][C][C][C][Ring1][#Branch1][C][C][Ring1][=Branch1][=N][C][=C][Ring1][#C][N+1][=Branch1][C][=O][O-1]"
],
"smiles": [
"O=C(O)c1cc(N2CCN3CCC2CC3)ncc1[N+](=O)[O-]"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Can you identify the reactant(s) that might result in the given product <molecule_2d> ?",
"role": "user"
},
{
"content": "COC(=O)c1cc(N2CCN3CCC2CC3)ncc1[N+](=O)[O-]",
"role": "assistant"
}
] | |
128,517 | {
"selfies": [
"[O][=C][Branch1][C][O][C][=C][C][Branch1][C][Br][=N][N][Ring1][=Branch1][C][=N][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][Cl]"
],
"smiles": [
"O=C(O)c1cc(Br)nn1-c1ncc(Cl)cc1Cl"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Could you tell which reactants might have been used to generate the following product? <molecule_2d>",
"role": "user"
},
{
"content": "CCOC(=O)c1cc(Br)nn1-c1ncc(Cl)cc1Cl",
"role": "assistant"
}
] | |
128,518 | {
"selfies": [
"[C][C][Branch1][C][C][Branch2][Ring1][Ring2][N][C][=Branch1][C][=O][C][=C][C][=C][Branch1][C][F][C][Branch1][C][Cl][=C][Ring1][Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1]"
],
"smiles": [
"CC(C)(NC(=O)c1ccc(F)c(Cl)c1)c1ccccc1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "With the given product <molecule_2d>, suggest some likely reactants that were used in its synthesis.",
"role": "user"
},
{
"content": "CC(C)(N)c1ccccc1.O=C(Cl)c1ccc(F)c(Cl)c1",
"role": "assistant"
}
] | |
128,519 | {
"selfies": [
"[C][C][O][C][=Branch1][C][=O][N][C][C][#N]"
],
"smiles": [
"CCOC(=O)NCC#N"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Suggest possible substances that may have been involved in the synthesis of the presented compound. <molecule_2d>",
"role": "user"
},
{
"content": "CCOC(=O)Cl.N#CCN",
"role": "assistant"
}
] | |
128,520 | {
"selfies": [
"[C][C][=C][C][=C][Branch1][P][S][=Branch1][C][=O][=Branch1][C][=O][N][C][=Branch1][C][=N][N][C][C][O][C][=C][Ring1][S]"
],
"smiles": [
"Cc1ccc(S(=O)(=O)NC(=N)NCCO)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Given the following product, please provide possible reactants. <molecule_2d>",
"role": "user"
},
{
"content": "Possible reactant(s): Cc1ccc(S(=O)(=O)NC(=N)NCCOCc2ccccc2)cc1 .",
"role": "assistant"
}
] | |
128,521 | {
"selfies": [
"[O][=C][Branch1][=C][O][C][C][=C][C][=C][C][Branch1][C][F][=C][Ring1][#Branch1][C][C][N][C][C][C][Ring1][=Branch1][C][C][Ring1][=Branch1]"
],
"smiles": [
"O=C(OCc1cccc(F)c1)C1CN2CCC1CC2"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Based on the given product, provide some plausible reactants that might have been utilized to prepare it. <molecule_2d>",
"role": "user"
},
{
"content": "O=C(O)C1CN2CCC1CC2.OCc1cccc(F)c1",
"role": "assistant"
}
] | |
128,522 | {
"selfies": [
"[O][=C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=Branch1][C][=O][N][Ring1][#Branch2][C][=C][N][=C][C][=Branch1][Ring2][=C][Ring1][=Branch1][C][Branch1][C][Br][=C][N][Ring1][#Branch1][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][=C][C][=C][Ring1][=Branch1]"
],
"smiles": [
"O=C1c2ccccc2C(=O)N1c1cnc2c(c1)c(Br)cn2S(=O)(=O)c1ccccc1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Do retrosynthesis with the product <molecule_2d> .",
"role": "user"
},
{
"content": "OK. The reactants may be O=C1c2ccccc2C(=O)N1c1cnc2[nH]cc(Br)c2c1.O=S(=O)(Cl)c1ccccc1 .",
"role": "assistant"
}
] | |
128,523 | {
"selfies": [
"[C][C][C][=C][Branch2][Ring2][C][N][C][=Branch1][C][=O][N][C][C][N][Branch2][Ring1][C][C][=N][C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][=N][S][Ring1][O][C][C][Ring1][P][S][N][=Ring2][Ring1][=Branch2]"
],
"smiles": [
"Cc1cc(NC(=O)N2CCN(c3nc(-c4ccccc4)ns3)CC2)sn1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Provide the potential reactants that may be used to produce the product <molecule_2d> .",
"role": "user"
},
{
"content": "The potential reactants: Cc1cc(NC(=O)OCC(Cl)(Cl)Cl)sn1.c1ccc(-c2nsc(N3CCNCC3)n2)cc1 .",
"role": "assistant"
}
] | |
128,524 | {
"selfies": [
"[C][C][Branch2][Ring1][Ring2][C][C][=C][C][=C][Branch1][=Branch2][S][=Branch1][C][=O][=Branch1][C][=O][Cl][C][=C][Ring1][#Branch2][N][C][=Branch1][C][=O][C][Branch1][C][F][Branch1][C][F][F]"
],
"smiles": [
"CC(Cc1ccc(S(=O)(=O)Cl)cc1)NC(=O)C(F)(F)F"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "<molecule_2d> Given the product provided, propose some possible reactants that could have been employed in its formation.",
"role": "user"
},
{
"content": "Here are possible reactants: CC(Cc1ccccc1)NC(=O)C(F)(F)F.O=S(=O)(O)Cl .",
"role": "assistant"
}
] | |
128,525 | {
"selfies": [
"[C][C][C][C][=C][C][Branch1][Ring1][C][Br][=C][C][Branch1][Ring2][C][C][C][=C][Ring1][O][O][C][=C][C][=C][C][=C][Ring1][=Branch1][C][C][=Branch1][C][=O][O][C]"
],
"smiles": [
"CCCc1cc(CBr)cc(CCC)c1Oc1ccccc1CC(=O)OC"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Based on the given product, provide some plausible reactants that might have been utilized to prepare it. <molecule_2d>",
"role": "user"
},
{
"content": "BrP(Br)Br.CCCc1cc(CO)cc(CCC)c1Oc1ccccc1CC(=O)OC",
"role": "assistant"
}
] | |
128,526 | {
"selfies": [
"[C][=C][C][O][C][C][N][Branch1][Branch2][C][=Branch1][C][=O][O][C][C][C][C][C][Ring1][O][N][C][=Branch1][C][=O][C][NH1][C][Branch1][C][C][=C][Branch1][C][Cl][C][=Ring1][#Branch1][C][#N]"
],
"smiles": [
"C=CCOC1CN(C(=O)OCC)CCC1NC(=O)c1[nH]c(C)c(Cl)c1C#N"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "With the given product <molecule_2d>, suggest some likely reactants that were used in its synthesis.",
"role": "user"
},
{
"content": "C=CCOC1CN(C(=O)OCC)CCC1N.Cc1[nH]c(C(=O)O)c(C#N)c1Cl",
"role": "assistant"
}
] | |
128,527 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][=Branch1][C][=Branch1][C][=O][O][N][C][=C][Branch1][C][I][C][=C][N][=C][Branch1][C][Cl][N][=C][Ring1][#Branch1][Ring1][O]"
],
"smiles": [
"CC(C)(C(=O)O)n1cc(I)c2cnc(Cl)nc21"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Based on the given product, provide some plausible reactants that might have been utilized to prepare it. <molecule_2d>",
"role": "user"
},
{
"content": "COC(=O)C(C)(C)n1cc(I)c2cnc(Cl)nc21",
"role": "assistant"
}
] | |
128,528 | {
"selfies": [
"[O][=C][Branch1][C][O][C][=C][NH1][C][=C][Branch1][=Branch2][C][=C][C][=N][C][=C][Ring1][=Branch1][C][Branch1][N][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1][=N][N][Ring2][Ring1][C][C][Ring2][Ring1][=Branch1][=O]"
],
"smiles": [
"O=C(O)c1c[nH]c2c(-c3ccncc3)c(-c3ccc(F)cc3)nn2c1=O"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Provide the potential reactants that may be used to produce the product <molecule_2d> .",
"role": "user"
},
{
"content": "The potential reactants: CCOC(=O)c1c[nH]c2c(-c3ccncc3)c(-c3ccc(F)cc3)nn2c1=O .",
"role": "assistant"
}
] | |
128,529 | {
"selfies": [
"[O][C][C][C][C][C][=C][C][=C][S][Ring1][Branch1]"
],
"smiles": [
"OCCCCc1cccs1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Could you tell which reactants might have been used to generate the following product? <molecule_2d>",
"role": "user"
},
{
"content": "COC(=O)CCCc1cccs1",
"role": "assistant"
}
] | |
128,530 | {
"selfies": [
"[C][O][C][=C][C][=C][Branch1][P][C][=C][C][=C][C][=Branch1][Ring2][=C][Ring1][=Branch1][C][O][C][Ring1][=Branch1][=O][C][Branch1][Branch2][O][C][C][=Branch1][C][=O][O][=C][Ring2][Ring1][Branch1][O][C][C][C][C][Ring1][Ring1]"
],
"smiles": [
"COc1ccc(-c2ccc3c(c2)COC3=O)c(OCC(=O)O)c1OCC1CC1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Could you tell which reactants might have been used to generate the following product? <molecule_2d>",
"role": "user"
},
{
"content": "CCOC(=O)COc1c(-c2ccc3c(c2)COC3=O)ccc(OC)c1OCC1CC1",
"role": "assistant"
}
] | |
128,531 | {
"selfies": [
"[C][C][Branch1][C][C][C][C][C][N][Branch1][#Branch2][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Branch1][N][C][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][N][Ring2][Ring1][=Branch1][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C]"
],
"smiles": [
"CC(C)CC1CN(Cc2ccccc2)C(COCc2ccccc2)CN1C(=O)OC(C)(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Identify possible reactants that could have been used to create the specified product. <molecule_2d>",
"role": "user"
},
{
"content": "CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.CC(C)CC1CN(Cc2ccccc2)C(COCc2ccccc2)CN1",
"role": "assistant"
}
] | |
128,532 | {
"selfies": [
"[C][C][=C][Branch1][C][Br][C][=C][Branch1][Ring1][C][#N][C][=Branch1][C][=O][N][Ring1][#Branch2][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1]"
],
"smiles": [
"Cc1c(Br)cc(C#N)c(=O)n1-c1ccc(F)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Can you identify the reactant(s) that might result in the given product <molecule_2d> ?",
"role": "user"
},
{
"content": "Cc1ccc(C#N)c(=O)n1-c1ccc(F)cc1.O=C1CCC(=O)N1Br",
"role": "assistant"
}
] | |
128,533 | {
"selfies": [
"[C][C][C][C][O][C][=C][C][=N][C][Branch1][Ring1][C][O][=C][Ring1][Branch2][C]"
],
"smiles": [
"CCCCOc1ccnc(CO)c1C"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Can you list the reactants that might result in the chemical product <molecule_2d> ?",
"role": "user"
},
{
"content": "CCCCOc1ccnc(COC(C)=O)c1C",
"role": "assistant"
}
] | |
128,534 | {
"selfies": [
"[O][C][=N][C][=C][C][=C][Ring1][=Branch1][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1]"
],
"smiles": [
"Oc1ncccc1OCc1ccccc1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Provide the potential reactants that may be used to produce the product <molecule_2d> .",
"role": "user"
},
{
"content": "The potential reactants: BrCc1ccccc1.Oc1cccnc1O .",
"role": "assistant"
}
] | |
128,535 | {
"selfies": [
"[C][C][=N][C][Branch1][S][C][=C][C][=C][Branch1][=Branch1][C][=Branch1][C][=O][O][C][=C][Ring1][=Branch2][=N][C][=C][C][=C][Branch1][C][O][C][=C][Ring2][Ring1][Ring2][Ring1][#Branch1]"
],
"smiles": [
"Cc1nc(-c2ccc(C(=O)O)cc2)nc2ccc(O)cc12"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "With the given product <molecule_2d>, suggest some likely reactants that were used in its synthesis.",
"role": "user"
},
{
"content": "COc1ccc2nc(-c3ccc(C(=O)O)cc3)nc(C)c2c1",
"role": "assistant"
}
] | |
128,536 | {
"selfies": [
"[F][C][=C][C][=C][Branch1][=Branch2][C][C][=N][N][=N][NH1][Ring1][Branch1][C][=C][Ring1][N]"
],
"smiles": [
"Fc1ccc(Cc2nnn[nH]2)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Could you tell which reactants might have been used to generate the following product? <molecule_2d>",
"role": "user"
},
{
"content": "N#CCc1ccc(F)cc1.[N-]=[N+]=[N-]",
"role": "assistant"
}
] | |
128,537 | {
"selfies": [
"[C][C][C][C][C][C][C][C][C][=Branch1][C][=O][C][=C][C][=C][Branch1][Ring1][C][=O][C][=C][Ring1][Branch2]"
],
"smiles": [
"CCCCCCCCC(=O)c1ccc(C=O)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Given the following product, please provide possible reactants. <molecule_2d>",
"role": "user"
},
{
"content": "Possible reactant(s): CCCCCCCCC(O)c1ccc(C=O)cc1 .",
"role": "assistant"
}
] | |
128,538 | {
"selfies": [
"[C][C][C][C][C][C][C][=Branch1][C][=O][O][C][N][C][=Branch1][C][=O][N][Branch1][Branch1][C][C][C][Cl][C][=C][C][=C][C][=C][Ring1][=Branch1][Ring1][=C]"
],
"smiles": [
"CCCCCCC(=O)OCn1c(=O)n(CCCCl)c2ccccc21"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Identify possible reactants that could have been used to create the specified product. <molecule_2d>",
"role": "user"
},
{
"content": "CCCCCCC(=O)Cl.O=c1n(CO)c2ccccc2n1CCCCl",
"role": "assistant"
}
] | |
128,539 | {
"selfies": [
"[C][C][=C][C][=C][Branch1][C][S][C][Branch1][Ring1][C][=O][=C][Ring1][=Branch2]"
],
"smiles": [
"Cc1ccc(S)c(C=O)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Suggest possible substances that may have been involved in the synthesis of the presented compound. <molecule_2d>",
"role": "user"
},
{
"content": "CN(C)C=O.Cc1ccc(S)cc1",
"role": "assistant"
}
] | |
128,540 | {
"selfies": [
"[C][C][=C][C][Branch1][=N][O][C][C][C][S][Branch1][C][C][=Branch1][C][=O][=O][=C][C][Branch1][C][C][=C][Ring1][#C][C][=C][C][=C][C][Branch1][Ring1][C][=O][=C][Ring1][Branch2]"
],
"smiles": [
"Cc1cc(OCCCS(C)(=O)=O)cc(C)c1-c1cccc(C=O)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Can you identify the reactant(s) that might result in the given product <molecule_2d> ?",
"role": "user"
},
{
"content": "Cc1cc(OCCCS(C)(=O)=O)cc(C)c1Br.O=Cc1cccc(B(O)O)c1",
"role": "assistant"
}
] | |
128,541 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][Branch1][Ring2][C][C][O][C][=C][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][=C][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][=C][Ring1][=C]"
],
"smiles": [
"CC(C)(C)OC(=O)N(CCO)c1cc(C(F)(F)F)cc(C(F)(F)F)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "With the given product <molecule_2d>, suggest some likely reactants that were used in its synthesis.",
"role": "user"
},
{
"content": "CC(C)(C)OC(=O)N(CCO[Si](C)(C)C(C)(C)C)c1cc(C(F)(F)F)cc(C(F)(F)F)c1",
"role": "assistant"
}
] | |
128,542 | {
"selfies": [
"[N][#C][C][=C][C][Branch1][N][C][=C][C][=C][C][Branch1][C][F][=C][Ring1][#Branch1][=C][C][=C][Branch1][C][N][N][=C][N][=C][Ring2][Ring1][C][Ring1][#Branch1]"
],
"smiles": [
"N#Cc1cc(-c2cccc(F)c2)cc2c(N)ncnc12"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Identify possible reactants that could have been used to create the specified product. <molecule_2d>",
"role": "user"
},
{
"content": "N#Cc1cc(Cl)cc2c(N)ncnc12.OB(O)c1cccc(F)c1",
"role": "assistant"
}
] | |
128,543 | {
"selfies": [
"[C][C][=C][C][=C][Branch1][=N][O][C][=C][C][=C][Branch1][C][N][N][=C][Ring1][#Branch1][C][=C][Ring1][=C][N][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C]"
],
"smiles": [
"Cc1ccc(Oc2ccc(N)nc2)cc1NC(=O)OC(C)(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Based on the given product, provide some plausible reactants that might have been utilized to prepare it. <molecule_2d>",
"role": "user"
},
{
"content": "Cc1ccc(Oc2ccc([N+](=O)[O-])nc2)cc1NC(=O)OC(C)(C)C",
"role": "assistant"
}
] | |
128,544 | {
"selfies": [
"[N][C][C][=C][C][=C][C][Branch1][Ring1][C][O][=C][Ring1][Branch2]"
],
"smiles": [
"NCc1cccc(CO)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Could you tell which reactants might have been used to generate the following product? <molecule_2d>",
"role": "user"
},
{
"content": "CC(C)(C)OC(=O)NCc1cccc(CO)c1",
"role": "assistant"
}
] | |
128,545 | {
"selfies": [
"[C][N][C][Branch1][Ring1][C][=O][=C][C][=C][C][Branch1][P][N][C][=Branch1][C][=O][C][=C][C][=C][Branch1][C][Br][C][=C][Ring1][#Branch1][=C][C][=C][Ring1][S][Ring2][Ring1][Branch1]"
],
"smiles": [
"Cn1c(C=O)cc2cc(NC(=O)c3ccc(Br)cc3)ccc21"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "With the given product <molecule_2d>, suggest some likely reactants that were used in its synthesis.",
"role": "user"
},
{
"content": "Cn1c(CO)cc2cc(NC(=O)c3ccc(Br)cc3)ccc21",
"role": "assistant"
}
] | |
128,546 | {
"selfies": [
"[C][C][=C][C][=C][Branch2][Ring1][=Branch2][C][=C][C][=C][N][=C][Branch1][C][C][C][Branch1][=Branch1][C][=Branch1][C][=O][O][=C][C][Ring1][#Branch2][=C][Ring1][=C][C][=C][Ring2][Ring1][Ring2]"
],
"smiles": [
"Cc1ccc(-c2ccc3nc(C)c(C(=O)O)cc3c2)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "<molecule_2d> Given the product provided, propose some possible reactants that could have been employed in its formation.",
"role": "user"
},
{
"content": "Here are possible reactants: COC(=O)c1cc2cc(-c3ccc(C)cc3)ccc2nc1C .",
"role": "assistant"
}
] | |
128,547 | {
"selfies": [
"[C][O][C][=Branch1][C][=O][C][=C][C][=C][C][N][=C][N][Branch1][S][C][C][N][C][C][N][C][C][C][Ring1][=Branch1][C][C][Ring1][=Branch1][C][Ring2][Ring1][Ring2][=Ring1][S]"
],
"smiles": [
"COC(=O)c1cccc2ncn(CCNC3CN4CCC3CC4)c12"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Suggest possible substances that may have been involved in the synthesis of the presented compound. <molecule_2d>",
"role": "user"
},
{
"content": "COC(=O)c1cccc2ncn(CC=O)c12.NC1CN2CCC1CC2",
"role": "assistant"
}
] | |
128,548 | {
"selfies": [
"[C][O][C][=N][C][Branch1][S][N][C][C][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][Cl][=C][C][Branch1][S][N][C][C][C][C][Branch1][=Branch1][C][=Branch1][C][=O][O][C][Ring1][=Branch2][=N][Ring2][Ring1][#Branch2]"
],
"smiles": [
"COc1nc(NCCc2ccc(Cl)cc2Cl)cc(N2CCCC(C(=O)O)C2)n1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Can you identify the reactant(s) that might result in the given product <molecule_2d> ?",
"role": "user"
},
{
"content": "COc1nc(Cl)cc(NCCc2ccc(Cl)cc2Cl)n1.O=C(O)C1CCCNC1",
"role": "assistant"
}
] | |
128,549 | {
"selfies": [
"[C][C][C][C][=C][Branch1][C][C][C][C][Branch1][C][C][C][C][Branch1][Ring1][O][C][C][O][C][Branch1][C][O][Branch2][=Branch1][O][C][=Branch1][C][=O][C][=Branch1][C][=O][N][C][C][C][C][C][Ring1][=Branch1][C][=Branch1][C][=O][O][C][Branch2][Ring1][Branch1][C][Branch1][C][C][=C][C][C][C][C][Branch1][C][O][C][Branch1][Ring1][O][C][C][Ring1][=Branch2][C][Branch1][C][C][C][Branch1][P][O][Si][Branch1][C][C][Branch1][C][C][C][Branch1][C][C][Branch1][C][C][C][C][C][Ring2][Branch1][=Branch1][=O][C][Branch1][C][C][C][C][Ring2][Ring2][S][O][C]"
],
"smiles": [
"CCC1C=C(C)CC(C)CC(OC)C2OC(O)(C(=O)C(=O)N3CCCCC3C(=O)OC(C(C)=CC3CCC(O)C(OC)C3)C(C)C(O[Si](C)(C)C(C)(C)C)CC1=O)C(C)CC2OC"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Do retrosynthesis with the product <molecule_2d> .",
"role": "user"
},
{
"content": "OK. The reactants may be CCC1C=C(C)CC(C)CC(OC)C2OC(O)(C(=O)C(=O)N3CCCCC3C(=O)OC(C(C)=CC3CCC(O[Si](C)(C)C(C)(C)C)C(OC)C3)C(C)C(O[Si](C)(C)C(C)(C)C)CC1=O)C(C)CC2OC .",
"role": "assistant"
}
] | |
128,550 | {
"selfies": [
"[C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][N][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C]"
],
"smiles": [
"Cc1ccccc1CNC(=O)OC(C)(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "To synthesis <molecule_2d>, what are the possible reactants? Write in the SMILES representation.",
"role": "user"
},
{
"content": "CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.Cc1ccccc1CN",
"role": "assistant"
}
] | |
128,551 | {
"selfies": [
"[C][O][N][=C][Branch2][Ring2][O][C][=Branch1][C][=O][N][C][C][=Branch1][C][=O][N][C][Branch1][=Branch1][C][=Branch1][C][=O][O][=C][Branch1][=N][C][Branch1][C][C][S][C][=N][N][=N][NH1][Ring1][Branch1][C][S][C][Ring2][Ring1][Ring2][Ring1][P][C][=N][S][C][Branch1][C][N][=N][Ring1][=Branch1]"
],
"smiles": [
"CON=C(C(=O)NC1C(=O)N2C(C(=O)O)=C(C(C)Sc3nnn[nH]3)CSC12)c1nsc(N)n1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Can you list the reactants that might result in the chemical product <molecule_2d> ?",
"role": "user"
},
{
"content": "CC(Sc1nnn[nH]1)C1=C(C(=O)O)N2C(=O)C(N)C2SC1.CON=C(C(=O)O)c1nsc(N)n1",
"role": "assistant"
}
] | |
128,552 | {
"selfies": [
"[C][N][S][=Branch1][C][=O][=Branch1][C][=O][C][C][C][=C][C][=C][Branch1][C][N][C][Branch1][C][Br][=C][Ring1][Branch2]"
],
"smiles": [
"CNS(=O)(=O)CCc1ccc(N)c(Br)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Identify possible reactants that could have been used to create the specified product. <molecule_2d>",
"role": "user"
},
{
"content": "CNS(=O)(=O)CCc1ccc(N)cc1.O=C1CCC(=O)N1Br",
"role": "assistant"
}
] | |
128,553 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][C][C][=C][Branch1][S][N][C][=Branch1][C][=O][O][C][C][Branch1][C][Cl][Branch1][C][Cl][Cl][N][Branch1][#C][C][=C][C][=N][C][Branch1][Branch1][O][C][C][O][=C][Ring1][#Branch2][N][=Ring2][Ring1][Branch2]"
],
"smiles": [
"CC(C)(C)c1cc(NC(=O)OCC(Cl)(Cl)Cl)n(-c2ccnc(OCCO)c2)n1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Do retrosynthesis with the product <molecule_2d> .",
"role": "user"
},
{
"content": "OK. The reactants may be CC(C)(C)c1cc(N)n(-c2ccnc(OCCO)c2)n1.O=C(Cl)OCC(Cl)(Cl)Cl .",
"role": "assistant"
}
] | |
128,554 | {
"selfies": [
"[N][#C][C][C][C][C][C][C][N][Branch2][Ring1][Ring2][C][C][N][C][=Branch1][C][=O][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Ring1][#Branch2][=O][C][C][N][C][=Branch1][C][=O][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Ring1][#Branch2][=O]"
],
"smiles": [
"N#CCCCCCCN(CCN1C(=O)c2ccccc2C1=O)CCN1C(=O)c2ccccc2C1=O"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "<molecule_2d> Given the product provided, propose some possible reactants that could have been employed in its formation.",
"role": "user"
},
{
"content": "Here are possible reactants: N#CCCCCCCBr.O=C1c2ccccc2C(=O)N1CCNCCN1C(=O)c2ccccc2C1=O .",
"role": "assistant"
}
] | |
128,555 | {
"selfies": [
"[O][=C][Branch1][C][O][C][=C][C][=C][Branch1][O][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][Ring1][=C][NH1][Ring1][P]"
],
"smiles": [
"O=C(O)c1cc2c(OCc3ccccc3)cccc2[nH]1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "<molecule_2d> Given the product provided, propose some possible reactants that could have been employed in its formation.",
"role": "user"
},
{
"content": "Here are possible reactants: CCOC(=O)c1cc2c(OCc3ccccc3)cccc2[nH]1 .",
"role": "assistant"
}
] | |
128,556 | {
"selfies": [
"[C][C][=C][C][=C][Branch1][C][O][C][Branch2][Ring1][=Branch1][C][=C][Branch1][C][F][C][Branch1][C][F][=C][Branch1][C][F][C][Branch1][C][F][=C][Ring1][#Branch2][F][=C][Ring2][Ring1][C]"
],
"smiles": [
"Cc1ccc(O)c(-c2c(F)c(F)c(F)c(F)c2F)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Identify possible reactants that could have been used to create the specified product. <molecule_2d>",
"role": "user"
},
{
"content": "COc1ccc(C)cc1-c1c(F)c(F)c(F)c(F)c1F",
"role": "assistant"
}
] | |
128,557 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][C][C][=C][Branch1][S][N][C][=Branch1][C][=O][O][C][C][Branch1][C][Cl][Branch1][C][Cl][Cl][N][Branch2][Ring1][=Branch1][C][C][=N][N][Branch1][=N][C][C][C][O][C][C][C][C][C][O][Ring1][=Branch1][C][=Ring1][#C][N][=Ring2][Ring1][=N]"
],
"smiles": [
"CC(C)(C)c1cc(NC(=O)OCC(Cl)(Cl)Cl)n(-c2cnn(CCCOC3CCCCO3)c2)n1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Provide the potential reactants that may be used to produce the product <molecule_2d> .",
"role": "user"
},
{
"content": "The potential reactants: CC(C)(C)c1cc(N)n(-c2cnn(CCCOC3CCCCO3)c2)n1.O=C(Cl)OCC(Cl)(Cl)Cl .",
"role": "assistant"
}
] | |
128,558 | {
"selfies": [
"[O][C][C][=C][C][Branch1][C][Cl][=C][C][Branch1][C][Cl][=C][Ring1][Branch2]"
],
"smiles": [
"OCc1cc(Cl)cc(Cl)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Based on the given product, provide some plausible reactants that might have been utilized to prepare it. <molecule_2d>",
"role": "user"
},
{
"content": "O=C(O)c1cc(Cl)cc(Cl)c1",
"role": "assistant"
}
] | |
128,559 | {
"selfies": [
"[C][C][N][Branch1][Ring1][C][C][C][C][C][C][C][C][N][Ring1][=Branch1][C][C][N][C][=Branch1][C][=O][N][C][=C][C][=C][Branch1][C][C][C][=C][Ring1][#Branch1][C][=Branch1][C][=O][N][C][=C][C][=C][N][=C][Ring1][=Branch1][Ring1][P]"
],
"smiles": [
"CCN(CC)CC1CCCCN1CCNC(=O)N1c2ccc(C)cc2C(=O)Nc2cccnc21"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Identify possible reactants that could have been used to create the specified product. <molecule_2d>",
"role": "user"
},
{
"content": "CCN(CC)CC1CCCCN1CCN.Cc1ccc2c(c1)C(=O)Nc1cccnc1N2C(=O)Cl",
"role": "assistant"
}
] | |
128,560 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][=C][C][=C][Branch1][=Branch1][C][=Branch1][C][=O][O][C][=C][Ring1][=Branch2][Br]"
],
"smiles": [
"CC(C)(C)OC(=O)NCc1ccc(C(=O)O)cc1Br"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "What reactants could lead to the production of the following product? <molecule_2d>",
"role": "user"
},
{
"content": "COC(=O)c1ccc(CNC(=O)OC(C)(C)C)c(Br)c1",
"role": "assistant"
}
] | |
128,561 | {
"selfies": [
"[F][C][Branch1][C][F][Branch1][C][F][C][=C][C][=C][Branch1][#Branch2][O][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][Ring1][=N][C][Br]"
],
"smiles": [
"FC(F)(F)c1ccc(Oc2ccccc2)cc1CBr"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Provide the potential reactants that may be used to produce the product <molecule_2d> .",
"role": "user"
},
{
"content": "The potential reactants: BrP(Br)Br.OCc1cc(Oc2ccccc2)ccc1C(F)(F)F .",
"role": "assistant"
}
] | |
128,562 | {
"selfies": [
"[C][C][Branch1][C][C][C][=C][C][=C][C][Branch1][=Branch1][C][Branch1][C][C][C][=C][Ring1][=Branch2][N][C][=Branch1][C][=O][C][C][C][C][C][C][Br]"
],
"smiles": [
"CC(C)c1cccc(C(C)C)c1NC(=O)CCCCCCBr"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Suggest possible substances that may have been involved in the synthesis of the presented compound. <molecule_2d>",
"role": "user"
},
{
"content": "CC(C)c1cccc(C(C)C)c1N.O=C(O)CCCCCCBr",
"role": "assistant"
}
] | |
128,563 | {
"selfies": [
"[C][C][=C][Branch2][Ring1][Branch2][C][=Branch1][C][=O][N][C][=C][C][=C][Branch1][=Branch2][S][Branch1][C][C][=Branch1][C][=O][=O][C][=C][Ring1][#Branch2][C][=C][Branch1][Ring2][C][C][O][N][Ring2][Ring1][Branch1][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1][C][Branch1][C][F][Branch1][C][F][F]"
],
"smiles": [
"Cc1c(C(=O)Nc2ccc(S(C)(=O)=O)cc2)cc(CCO)n1-c1ccc(F)cc1C(F)(F)F"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "With the given product <molecule_2d>, suggest some likely reactants that were used in its synthesis.",
"role": "user"
},
{
"content": "Cc1c(C(=O)Nc2ccc(S(C)(=O)=O)cc2)cc(CCOCc2ccccc2)n1-c1ccc(F)cc1C(F)(F)F",
"role": "assistant"
}
] | |
128,564 | {
"selfies": [
"[C][C][Branch1][C][C][C][=Branch1][C][=O][N][C][C][N][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C]"
],
"smiles": [
"CC(C)C(=O)NCCNC(=O)OC(C)(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Can you identify the reactant(s) that might result in the given product <molecule_2d> ?",
"role": "user"
},
{
"content": "CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.CC(C)C(=O)NCCN",
"role": "assistant"
}
] | |
128,565 | {
"selfies": [
"[C][C][=Branch1][C][=O][O][C][=C][C][Branch1][C][N][=C][C][=C][Ring1][#Branch1][O][C][Branch1][C][C][Branch1][C][C][C][Ring1][#Branch1]"
],
"smiles": [
"CC(=O)Oc1cc(N)cc2c1OC(C)(C)C2"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "With the given product <molecule_2d>, suggest some likely reactants that were used in its synthesis.",
"role": "user"
},
{
"content": "CC(=O)Oc1cc([N+](=O)[O-])cc2c1OC(C)(C)C2",
"role": "assistant"
}
] | |
128,566 | {
"selfies": [
"[C][C][=C][C][Branch1][C][F][=C][C][=C][Ring1][#Branch1][C][C][C][Branch2][Ring2][=C][C][C][N][Ring1][=Branch1][C][=Branch1][C][=O][N][Branch1][C][C][C][Branch1][C][C][C][=C][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][=C][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][=C][Ring1][=C][C][C][C][Branch1][C][C][Branch1][O][C][O][Si][Branch1][C][C][Branch1][C][C][C][N][Ring2][Ring2][Ring1]"
],
"smiles": [
"Cc1cc(F)ccc1C1CC2(CCN1C(=O)N(C)C(C)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)CCC(C)(CO[Si](C)(C)C)N2"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Do retrosynthesis with the product <molecule_2d> .",
"role": "user"
},
{
"content": "OK. The reactants may be C[Si](C)(C)Cl.Cc1cc(F)ccc1C1CC2(CCN1C(=O)N(C)C(C)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)CCC(C)(CO)N2 .",
"role": "assistant"
}
] | |
128,567 | {
"selfies": [
"[C][C][C][C][C][C][C][C][=C][C][O][C][C][Branch1][C][C][C][Branch1][Ring1][O][C][C][Ring1][=Branch2][O][C][=Branch1][C][=O][C][N][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C]"
],
"smiles": [
"CCCCCCCC=CC1OCC(C)C(OC)C1OC(=O)CNC(=O)OC(C)(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Given the following product, please provide possible reactants. <molecule_2d>",
"role": "user"
},
{
"content": "Possible reactant(s): CC(C)(C)OC(=O)NCC(=O)O.CCCCCCCC=CC1OCC(C)C(OC)C1O .",
"role": "assistant"
}
] | |
128,568 | {
"selfies": [
"[C][C][Branch1][Ring1][C][=O][C][O][Si][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Branch1][C][C][Branch1][C][C][C]"
],
"smiles": [
"CC(C=O)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Do retrosynthesis with the product <molecule_2d> .",
"role": "user"
},
{
"content": "OK. The reactants may be CC(CO)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C .",
"role": "assistant"
}
] | |
128,569 | {
"selfies": [
"[C][O][C][O][C][=C][C][=C][Branch1][Ring2][C][=N][O][C][=C][Ring1][=Branch2][C]"
],
"smiles": [
"COCOc1ccc(C=NO)cc1C"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Provide the potential reactants that may be used to produce the product <molecule_2d> .",
"role": "user"
},
{
"content": "The potential reactants: COCOc1ccc(C=O)cc1C.NO .",
"role": "assistant"
}
] | |
128,570 | {
"selfies": [
"[C][C][O][C][=C][C][Branch1][Ring1][C][O][=C][C][=C][Ring1][Branch2][O][C][C][Br]"
],
"smiles": [
"CCOc1cc(CO)ccc1OCCBr"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "With the given product <molecule_2d>, suggest some likely reactants that were used in its synthesis.",
"role": "user"
},
{
"content": "BrCCBr.CCOc1cc(CO)ccc1O",
"role": "assistant"
}
] | |
128,571 | {
"selfies": [
"[O][=C][Branch1][C][O][C][=N][C][Branch1][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1][Br][=N][C][Branch1][C][O][=C][Ring1][#C][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1]"
],
"smiles": [
"O=C(O)c1nc(Cc2ccccc2Br)nc(O)c1OCc1ccccc1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Based on the given product, provide some plausible reactants that might have been utilized to prepare it. <molecule_2d>",
"role": "user"
},
{
"content": "CC(C)(C)OC(=O)c1nc(Cc2ccccc2Br)nc(O)c1OCc1ccccc1",
"role": "assistant"
}
] | |
128,572 | {
"selfies": [
"[C][C][Branch1][C][C][C][C][Branch1][C][O][C][=Branch1][C][=O][N][C][C][N][Branch2][Ring1][=Branch2][C][=N][C][Branch1][C][Cl][=N][C][=C][C][Branch1][=Branch1][C][=Branch1][C][=O][O][=C][C][=C][Ring1][=C][Ring1][=Branch2][C][C][Ring2][Ring1][Ring2]"
],
"smiles": [
"CC(C)CC(O)C(=O)N1CCN(c2nc(Cl)nc3cc(C(=O)O)ccc23)CC1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Do retrosynthesis with the product <molecule_2d> .",
"role": "user"
},
{
"content": "OK. The reactants may be CC(C)CC(O)C(=O)N1CCNCC1.O=C(O)c1ccc2c(Cl)nc(Cl)nc2c1 .",
"role": "assistant"
}
] | |
128,573 | {
"selfies": [
"[C][C][=C][Branch1][C][N][C][=C][C][=C][Ring1][#Branch1][C][=C][N][C][=C][N][=C][Ring1][Branch1][C][Branch2][Ring1][Branch1][N][C][=C][C][=C][Branch1][#Branch2][C][N][C][C][O][C][C][Ring1][=Branch1][C][=C][Ring1][=N][=N][Ring2][Ring1][#Branch1]"
],
"smiles": [
"Cc1c(N)cccc1-c1cn2ccnc2c(Nc2ccc(CN3CCOCC3)cc2)n1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Do retrosynthesis with the product <molecule_2d> .",
"role": "user"
},
{
"content": "OK. The reactants may be Cc1c(N)cccc1-c1cn2ccnc2c(Nc2ccc(C(=O)N3CCOCC3)cc2)n1 .",
"role": "assistant"
}
] | |
128,574 | {
"selfies": [
"[C][C][C][C][C][C][C][N][Branch1][=C][C][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1][F][C][=Branch1][C][=O][C][C][C][=C][C][=C][Branch1][S][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=Branch1][C][=O][O][C][=C][Ring1][P]"
],
"smiles": [
"CCCCCCCN(Cc1ccc(F)cc1F)C(=O)CCc1ccc(OCc2ccccc2C(=O)O)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Based on the given product, provide some plausible reactants that might have been utilized to prepare it. <molecule_2d>",
"role": "user"
},
{
"content": "CCCCCCCN(Cc1ccc(F)cc1F)C(=O)CCc1ccc(OCc2ccccc2C(=O)OC)cc1",
"role": "assistant"
}
] | |
128,575 | {
"selfies": [
"[C][C][O][C][=Branch1][C][=O][C][C][=C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][N][Branch1][C][C][C][=Ring1][N][C]"
],
"smiles": [
"CCOC(=O)c1cc(-c2ccccc2)n(C)c1C"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Identify possible reactants that could have been used to create the specified product. <molecule_2d>",
"role": "user"
},
{
"content": "CCOC(=O)c1cc(-c2ccccc2)[nH]c1C.CI",
"role": "assistant"
}
] | |
128,576 | {
"selfies": [
"[C][C][C][Branch2][Branch1][=Branch2][C][#C][C][=C][C][=C][Branch2][Ring2][#Branch2][C][Branch1][Ring1][C][C][Branch1][Ring1][C][C][C][=C][C][=C][Branch2][Ring1][C][C][=C][C][=C][Branch1][Branch2][C][C][=Branch1][C][=O][O][C][C][=C][Ring1][O][C][Branch1][C][C][=C][Ring2][Ring1][C][C][=C][Ring2][Ring1][=N][C][Branch1][Ring1][C][C][O][Si][Branch1][C][C][Branch1][C][C][C]"
],
"smiles": [
"CCC(C#Cc1ccc(C(CC)(CC)c2ccc(-c3ccc(CC(=O)OC)cc3)c(C)c2)cc1C)(CC)O[Si](C)(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Identify possible reactants that could have been used to create the specified product. <molecule_2d>",
"role": "user"
},
{
"content": "CCC(C#Cc1ccc(C(CC)(CC)c2ccc(B3OC(C)(C)C(C)(C)O3)c(C)c2)cc1C)(CC)O[Si](C)(C)C.COC(=O)Cc1ccc(Br)cc1",
"role": "assistant"
}
] | |
128,577 | {
"selfies": [
"[C][N][Branch2][Ring2][O][C][C][C][=C][Branch1][#C][C][=C][C][=C][C][Branch1][Ring2][C][=N][O][=C][Ring1][=Branch2][F][N][Branch1][S][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][=C][N][=C][Ring1][=Branch1][C][=Ring2][Ring1][Branch2][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C]"
],
"smiles": [
"CN(Cc1cc(-c2cccc(C=NO)c2F)n(S(=O)(=O)c2cccnc2)c1)C(=O)OC(C)(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Identify possible reactants that could have been used to create the specified product. <molecule_2d>",
"role": "user"
},
{
"content": "CN(Cc1cc(-c2cccc(C=O)c2F)n(S(=O)(=O)c2cccnc2)c1)C(=O)OC(C)(C)C.NO",
"role": "assistant"
}
] | |
128,578 | {
"selfies": [
"[O][C][C][=C][C][Branch1][C][Cl][=C][Branch1][=N][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1][F][C][Branch1][C][Cl][=C][Ring1][S]"
],
"smiles": [
"OCc1cc(Cl)c(-c2ccc(F)cc2F)c(Cl)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Can you identify the reactant(s) that might result in the given product <molecule_2d> ?",
"role": "user"
},
{
"content": "OB(O)c1ccc(F)cc1F.OCc1cc(Cl)c(I)c(Cl)c1",
"role": "assistant"
}
] | |
128,579 | {
"selfies": [
"[C][C][O][C][=Branch1][C][=O][C][=C][C][=C][C][Branch1][#Branch2][N][C][C][Branch1][C][N][C][Ring1][Branch1][=C][Ring1][O]"
],
"smiles": [
"CCOC(=O)c1cccc(N2CC(N)C2)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Do retrosynthesis with the product <molecule_2d> .",
"role": "user"
},
{
"content": "OK. The reactants may be CCOC(=O)c1cccc(N2CC(NC(=O)OC(C)(C)C)C2)c1 .",
"role": "assistant"
}
] | |
128,580 | {
"selfies": [
"[C][C][Branch1][Branch2][N][C][=Branch1][C][=O][C][Cl][Branch1][N][C][=C][C][=C][C][Branch1][C][Br][=C][Ring1][#Branch1][C][C][=C][NH1][N][=Ring1][Branch1]"
],
"smiles": [
"CC(NC(=O)CCl)(c1cccc(Br)c1)c1cc[nH]n1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "To synthesis <molecule_2d>, what are the possible reactants? Write in the SMILES representation.",
"role": "user"
},
{
"content": "CC(N)(c1cccc(Br)c1)c1cc[nH]n1.O=C(Cl)CCl",
"role": "assistant"
}
] | |
128,581 | {
"selfies": [
"[C][N][C][=C][C][=C][C][Branch1][Ring1][C][N][=C][C][=C][Ring1][Branch2][Ring1][O]"
],
"smiles": [
"Cn1ccc2cc(CN)ccc21"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "What reactants could lead to the production of the following product? <molecule_2d>",
"role": "user"
},
{
"content": "Cn1ccc2cc(C#N)ccc21",
"role": "assistant"
}
] | |
128,582 | {
"selfies": [
"[C][C][O][C][=Branch1][C][=O][C][=C][C][=C][C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][=C][Ring1][=Branch2][O]"
],
"smiles": [
"CCOC(=O)c1cccc([N+](=O)[O-])c1O"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Could you tell which reactants might have been used to generate the following product? <molecule_2d>",
"role": "user"
},
{
"content": "CCO.O=C(O)c1cccc([N+](=O)[O-])c1O",
"role": "assistant"
}
] | |
128,583 | {
"selfies": [
"[O][=N+1][Branch1][C][O-1][C][=C][C][=C][N][=C][Ring1][=Branch1][N][C][C][N][Branch1][#C][C][=C][C][=C][C][=C][C][=C][C][Ring1][=Branch1][=N][Ring1][#Branch2][C][Ring1][=C]"
],
"smiles": [
"O=[N+]([O-])c1cccnc1NC1CN(c2ccc3ccccc3n2)C1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Can you identify the reactant(s) that might result in the given product <molecule_2d> ?",
"role": "user"
},
{
"content": "NC1CN(c2ccc3ccccc3n2)C1.O=[N+]([O-])c1cccnc1Cl",
"role": "assistant"
}
] | |
128,584 | {
"selfies": [
"[C][C][C][N][Branch1][=C][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C][C][C][N][Ring1][=N]"
],
"smiles": [
"CC1CN(C(=O)OC(C)(C)C)CCN1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Based on the given product, provide some plausible reactants that might have been utilized to prepare it. <molecule_2d>",
"role": "user"
},
{
"content": "CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.CC1CNCCN1",
"role": "assistant"
}
] | |
128,585 | {
"selfies": [
"[C][C][O][C][=Branch1][C][=O][C][C][=C][C][=C][Branch2][Ring1][Ring2][N][C][=Branch1][C][=O][C][=N][C][=C][C][=C][C][=C][C][=C][Ring1][#Branch2][Ring1][=Branch1][C][Branch1][C][Br][=C][Ring2][Ring1][Ring2]"
],
"smiles": [
"CCOC(=O)Cc1ccc(NC(=O)c2nccc3ccccc23)c(Br)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "With the given product <molecule_2d>, suggest some likely reactants that were used in its synthesis.",
"role": "user"
},
{
"content": "CCOC(=O)Cc1ccc(N)c(Br)c1.O=C(O)c1nccc2ccccc12",
"role": "assistant"
}
] | |
128,586 | {
"selfies": [
"[C][O][C][=C][C][=N][C][Branch1][S][N][C][=C][C][Branch1][C][C][=C][C][Branch1][C][Br][=C][Ring1][Branch2][=N][Ring1][#C]"
],
"smiles": [
"COc1ccnc(Nc2cc(C)cc(Br)c2)n1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Can you list the reactants that might result in the chemical product <molecule_2d> ?",
"role": "user"
},
{
"content": "COc1ccnc(Cl)n1.Cc1cc(N)cc(Br)c1",
"role": "assistant"
}
] | |
128,587 | {
"selfies": [
"[N][C][=Branch1][C][=O][C][C][C][Branch2][Ring2][P][N][C][=Branch1][C][=O][C][=C][C][=C][Branch2][Ring1][Branch2][N][C][Branch1][=Branch2][C][N][C][=C][N][=C][Ring1][Branch1][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1][C][=C][Ring2][Ring1][Branch1][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=Branch1][C][=O][O]"
],
"smiles": [
"NC(=O)CCC(NC(=O)c1ccc(NC(Cn2ccnc2)c2ccc(F)cc2)cc1-c1ccccc1)C(=O)O"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Given the following product, please provide possible reactants. <molecule_2d>",
"role": "user"
},
{
"content": "Possible reactant(s): CC(C)(C)OC(=O)C(CCC(N)=O)NC(=O)c1ccc(NC(Cn2ccnc2)c2ccc(F)cc2)cc1-c1ccccc1 .",
"role": "assistant"
}
] | |
128,588 | {
"selfies": [
"[C][C][=Branch1][C][=O][O][C][=C][Branch1][C][C][C][=C][C][=Branch1][Branch1][=C][Ring1][#Branch1][C][C][Branch1][C][C][C][N][Ring1][Branch2][C][Branch1][C][C][=O]"
],
"smiles": [
"CC(=O)Oc1c(C)cc2c(c1C)C(C)CN2C(C)=O"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Can you identify the reactant(s) that might result in the given product <molecule_2d> ?",
"role": "user"
},
{
"content": "CC(=O)N1CC(C)c2c1cc(C)c(O)c2C.CC(=O)OC(C)=O",
"role": "assistant"
}
] | |
128,589 | {
"selfies": [
"[N][C][=N][C][Branch1][C][Cl][=C][C][Branch2][Ring1][#C][N][C][C][O][C][Branch2][Ring1][Ring1][C][=N][C][Branch1][#Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][Cl][=C][NH1][Ring1][N][C][Ring2][Ring1][C][=N][Ring2][Ring1][=Branch2]"
],
"smiles": [
"Nc1nc(Cl)cc(N2CCOC(c3nc(-c4ccccc4Cl)c[nH]3)C2)n1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Can you list the reactants that might result in the chemical product <molecule_2d> ?",
"role": "user"
},
{
"content": "Clc1ccccc1-c1c[nH]c(C2CNCCO2)n1.Nc1nc(Cl)cc(Cl)n1",
"role": "assistant"
}
] | |
128,590 | {
"selfies": [
"[C][O][C][=C][C][=C][C][Branch2][Branch1][Ring1][C][=C][NH1][C][=N][C][=N][C][Branch2][Ring1][P][N][C][Branch1][C][C][C][=N][N][C][=C][C][Branch1][C][C][=C][Ring1][=Branch1][C][=Branch1][C][=O][N][Ring1][O][C][=C][C][=C][C][=C][Ring1][=Branch1][=C][Ring2][Ring1][=N][Ring2][Ring1][#Branch2][=C][Ring2][Ring2][Ring1][O]"
],
"smiles": [
"COc1cccc(-c2c[nH]c3ncnc(NC(C)c4nn5ccc(C)c5c(=O)n4-c4ccccc4)c23)c1O"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Can you list the reactants that might result in the chemical product <molecule_2d> ?",
"role": "user"
},
{
"content": "COc1cccc(-c2cn(COCC[Si](C)(C)C)c3ncnc(NC(C)c4nn5ccc(C)c5c(=O)n4-c4ccccc4)c23)c1O",
"role": "assistant"
}
] | |
128,591 | {
"selfies": [
"[C][N][C][C][C][Branch1][Ring1][C][#N][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][C][Ring1][=C]"
],
"smiles": [
"CN1CCC(C#N)(c2ccccc2)CC1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "To synthesis <molecule_2d>, what are the possible reactants? Write in the SMILES representation.",
"role": "user"
},
{
"content": "C=O.N#CC1(c2ccccc2)CCNCC1",
"role": "assistant"
}
] | |
128,592 | {
"selfies": [
"[N][#C][C][=C][Branch1][=Branch2][N][C][C][O][C][C][Ring1][=Branch1][S][C][Branch1][=Branch1][C][=Branch1][C][=O][O][=C][Ring1][=C][C][Branch1][Ring2][C][C][O][C][=C][C][=C][Branch1][C][Cl][C][Branch1][C][Cl][=C][Ring1][Branch2]"
],
"smiles": [
"N#Cc1c(N2CCOCC2)sc(C(=O)O)c1C(CCO)c1ccc(Cl)c(Cl)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "What reactants could lead to the production of the following product? <molecule_2d>",
"role": "user"
},
{
"content": "CCOC(=O)c1sc(N2CCOCC2)c(C#N)c1C(CCO)c1ccc(Cl)c(Cl)c1",
"role": "assistant"
}
] | |
128,593 | {
"selfies": [
"[C][C][=Branch1][C][=O][C][=C][C][=C][Branch1][P][O][S][=Branch1][C][=O][=Branch1][C][=O][C][Branch1][C][F][Branch1][C][F][F][C][=C][Ring1][=C][C]"
],
"smiles": [
"CC(=O)c1ccc(OS(=O)(=O)C(F)(F)F)cc1C"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "<molecule_2d> Given the product provided, propose some possible reactants that could have been employed in its formation.",
"role": "user"
},
{
"content": "Here are possible reactants: CC(=O)c1ccc(O)cc1C.O=S(=O)(OS(=O)(=O)C(F)(F)F)C(F)(F)F .",
"role": "assistant"
}
] | |
128,594 | {
"selfies": [
"[C][N][C][Branch1][=Branch2][C][Branch1][C][C][Branch1][C][C][C][=C][C][=Branch2][Ring1][O][=N][C][=Branch1][C][=O][C][=C][C][Branch1][C][N][=C][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][=C][Ring1][O][N][Ring2][Ring1][#Branch1][C][C][C][C][C][O][Ring1][Branch1]"
],
"smiles": [
"Cn1c(C(C)(C)C)cc(=NC(=O)c2cc(N)cc(C(F)(F)F)c2)n1CC1CCCO1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Identify possible reactants that could have been used to create the specified product. <molecule_2d>",
"role": "user"
},
{
"content": "Cn1c(C(C)(C)C)cc(=NC(=O)c2cc([N+](=O)[O-])cc(C(F)(F)F)c2)n1CC1CCCO1",
"role": "assistant"
}
] | |
128,595 | {
"selfies": [
"[C][C][C][=Branch1][C][=O][N][C][C][C][C][C][C][=C][C][Branch1][C][Br][=C][Branch1][C][O][C][=C][Ring1][Branch2][Ring1][O]"
],
"smiles": [
"CCC(=O)NCCC1CCc2cc(Br)c(O)cc21"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Can you list the reactants that might result in the chemical product <molecule_2d> ?",
"role": "user"
},
{
"content": "CCC(=O)NCCC1CCc2cc(Br)c(OC)cc21",
"role": "assistant"
}
] | |
128,596 | {
"selfies": [
"[C][C][C][Branch1][C][C][N][N][=C][N][Branch2][Ring2][Branch1][C][=C][C][=C][Branch2][Ring1][=Branch1][N][C][C][N][Branch1][N][C][=C][C][=C][Branch1][C][O][C][=C][Ring1][#Branch1][C][C][Ring1][=N][C][Branch1][C][F][=C][Ring2][Ring1][Ring2][C][Ring2][Ring1][=Branch2][=O]"
],
"smiles": [
"CCC(C)n1ncn(-c2ccc(N3CCN(c4ccc(O)cc4)CC3)c(F)c2)c1=O"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Based on the given product, provide some plausible reactants that might have been utilized to prepare it. <molecule_2d>",
"role": "user"
},
{
"content": "CCC(C)n1ncn(-c2ccc(N3CCN(c4ccc(OC)cc4)CC3)c(F)c2)c1=O",
"role": "assistant"
}
] | |
128,597 | {
"selfies": [
"[O][=C][C][C][N][C][=C][C][Branch1][O][O][C][C][N][C][=C][N][=C][Ring1][Branch1][=C][C][=C][Ring1][=C][Ring2][Ring1][C]"
],
"smiles": [
"O=C1CCNc2cc(OCCn3ccnc3)ccc21"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Given the following product, please provide possible reactants. <molecule_2d>",
"role": "user"
},
{
"content": "Possible reactant(s): O=C1CCNc2cc(O)ccc21.OCCn1ccnc1 .",
"role": "assistant"
}
] | |
128,598 | {
"selfies": [
"[N][#C][C][=C][C][=C][Branch1][#Branch1][N][C][C][C][C][O][C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][=C][Ring1][#C]"
],
"smiles": [
"N#Cc1ccc(NCCCCO)c([N+](=O)[O-])c1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Can you list the reactants that might result in the chemical product <molecule_2d> ?",
"role": "user"
},
{
"content": "N#Cc1ccc(Cl)c([N+](=O)[O-])c1.NCCCCO",
"role": "assistant"
}
] | |
128,599 | {
"selfies": [
"[C][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][C][=O]"
],
"smiles": [
"Cc1ccc(Cl)cc1C=O"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "To synthesis <molecule_2d>, what are the possible reactants? Write in the SMILES representation.",
"role": "user"
},
{
"content": "CN(C)C=O.Cc1ccc(Cl)cc1Br",
"role": "assistant"
}
] |
Subsets and Splits