hexsha
stringlengths 40
40
| size
int64 5
1.05M
| ext
stringclasses 98
values | lang
stringclasses 21
values | max_stars_repo_path
stringlengths 3
945
| max_stars_repo_name
stringlengths 4
118
| max_stars_repo_head_hexsha
stringlengths 40
78
| max_stars_repo_licenses
sequencelengths 1
10
| max_stars_count
int64 1
368k
⌀ | max_stars_repo_stars_event_min_datetime
stringlengths 24
24
⌀ | max_stars_repo_stars_event_max_datetime
stringlengths 24
24
⌀ | max_issues_repo_path
stringlengths 3
945
| max_issues_repo_name
stringlengths 4
118
| max_issues_repo_head_hexsha
stringlengths 40
78
| max_issues_repo_licenses
sequencelengths 1
10
| max_issues_count
int64 1
134k
⌀ | max_issues_repo_issues_event_min_datetime
stringlengths 24
24
⌀ | max_issues_repo_issues_event_max_datetime
stringlengths 24
24
⌀ | max_forks_repo_path
stringlengths 3
945
| max_forks_repo_name
stringlengths 4
135
| max_forks_repo_head_hexsha
stringlengths 40
78
| max_forks_repo_licenses
sequencelengths 1
10
| max_forks_count
int64 1
105k
⌀ | max_forks_repo_forks_event_min_datetime
stringlengths 24
24
⌀ | max_forks_repo_forks_event_max_datetime
stringlengths 24
24
⌀ | content
stringlengths 5
1.05M
| avg_line_length
float64 1
1.03M
| max_line_length
int64 2
1.03M
| alphanum_fraction
float64 0
1
|
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
6af2260d8337329bb05afb8c35bc9ceca5df6bcf | 4,241 | h | C | src/Pegasus/Compiler/valueFactory.h | natronkeltner/openpegasus | e64f383c1ed37826041fc63e83b4e65fc1c679ae | [
"ICU",
"Unlicense",
"OpenSSL",
"MIT"
] | 1 | 2021-11-12T21:28:50.000Z | 2021-11-12T21:28:50.000Z | src/Pegasus/Compiler/valueFactory.h | natronkeltner/openpegasus | e64f383c1ed37826041fc63e83b4e65fc1c679ae | [
"ICU",
"Unlicense",
"OpenSSL",
"MIT"
] | 39 | 2021-01-18T19:28:41.000Z | 2022-03-27T20:55:36.000Z | src/Pegasus/Compiler/valueFactory.h | natronkeltner/openpegasus | e64f383c1ed37826041fc63e83b4e65fc1c679ae | [
"ICU",
"Unlicense",
"OpenSSL",
"MIT"
] | 4 | 2021-07-09T12:52:33.000Z | 2021-12-21T15:05:59.000Z | //%LICENSE////////////////////////////////////////////////////////////////
//
// Licensed to The Open Group (TOG) under one or more contributor license
// agreements. Refer to the OpenPegasusNOTICE.txt file distributed with
// this work for additional information regarding copyright ownership.
// Each contributor licenses this file to you under the OpenPegasus Open
// Source License; you may not use this file except in compliance with the
// License.
//
// Permission is hereby granted, free of charge, to any person obtaining a
// copy of this software and associated documentation files (the "Software"),
// to deal in the Software without restriction, including without limitation
// the rights to use, copy, modify, merge, publish, distribute, sublicense,
// and/or sell copies of the Software, and to permit persons to whom the
// Software is furnished to do so, subject to the following conditions:
//
// The above copyright notice and this permission notice shall be included
// in all copies or substantial portions of the Software.
//
// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS
// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
// IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
// CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
// TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
// SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
//
//////////////////////////////////////////////////////////////////////////
//
//%/////////////////////////////////////////////////////////////////////////////
//
// Header for a class to generate CIMValue objects from String values
//
#ifndef _VALUEFACTORY_H_
#define _VALUEFACTORY_H_
#include <Pegasus/Common/String.h>
#include <Pegasus/Common/CIMValue.h>
#include <Pegasus/Compiler/Linkage.h>
PEGASUS_USING_PEGASUS;
PEGASUS_USING_STD;
// The valueFactory builds a CIMValue object given an indication of
// whether this is a Array type, the CIM type to be coerced, and
// a String representation of the value.
//
class PEGASUS_COMPILER_LINKAGE valueFactory
{
public:
/**
Escape any character comma found in the input string
@param str String to be processed.
@return String the processed string
*/
static String stringEscapeComma(String str);
/**
Converts a String to a Uint64 according to the DMTF specification for
MOF encoding. A CIMType specification also allows for overflow
checking of smaller unsigned integer type (e.g., Uint8, Uint16,
Uint32).
@param val The String to convert
@param type A CIMType to use for bounds checking
@exception Exception if the conversion is unsuccessful
@return The converted Uint64 value
*/
static Uint64 stringToUint(
const String& val,
CIMType type);
/**
Converts a String to a Sint64 according to the DMTF specification for
MOF encoding. A CIMType specification also allows for overflow
checking of smaller unsigned integer type (e.g., Sint8, Sint16,
Sint32).
@param val The String to convert
@param type A CIMType to use for bounds checking
@exception Exception if the conversion is unsuccessful
@return The converted Sint64 value
*/
static Sint64 stringToSint(
const String& val,
CIMType type);
/**
Converts a String to a Rint64 according to the DMTF specification for
MOF encoding.
@param val The String to convert
@param type A CIMType to use in an exception message
@exception Exception if the conversion is unsuccessful
@return The converted Real64 value
*/
static Real64 stringToReal(
const String& val,
CIMType type);
static CIMValue * createValue(CIMType type, int arrayDimension,
Boolean isNull,
int ParseType,
const String *rep);
private:
static CIMValue* _buildArrayValue(
CIMType type,
const String& rep);
static Boolean compareTypeToParseType(CIMType type, int expectedType );
};
#endif
| 36.560345 | 80 | 0.676491 |
5870acdc0d2103d90163c9fd34073b4063e555a9 | 2,017 | rb | Ruby | lib/rtunesu/associations.rb | trek/rtunesu | d880bcefd5ad23f10c326f0f7bf8940194056b78 | [
"MIT"
] | 1 | 2016-05-08T10:15:36.000Z | 2016-05-08T10:15:36.000Z | lib/rtunesu/associations.rb | trek/rtunesu | d880bcefd5ad23f10c326f0f7bf8940194056b78 | [
"MIT"
] | null | null | null | lib/rtunesu/associations.rb | trek/rtunesu | d880bcefd5ad23f10c326f0f7bf8940194056b78 | [
"MIT"
] | null | null | null | module RTunesU
class SubentityAssociationProxy
delegate :inspect, :to => :target
def initialize(source_xml, owner, name)
@source_xml = source_xml
@owner = owner
@owner.edits[name] = self
@edits = []
end
end
class HasAEntityCollectionProxy < SubentityAssociationProxy
delegate :class, :to => :target
attr_reader :target
def self.new_or_nil(source_xml, owner, name)
return nil if source_xml.empty?
proxy = self.new(source_xml, owner, name)
proxy.from_xml(name)
return proxy
end
def self.new_from_target(target, owner, name)
proxy = self.new(nil, owner, name)
proxy.instance_variable_set("@target", target)
return proxy
end
def from_xml(name)
if @source_xml
@target = "RTunesU::#{name}".constantize.new(:source_xml => @source_xml.first, :parent_handle => @owner.handle)
else
@target = "RTunesU::#{name}".constantize.new(:parent_handle => @owner.handle)
end
end
def to_xml(xml_builder = Builder::XmlMarkup.new)
@target.to_xml(xml_builder) if @target.edits.any?
end
def method_missing(method_name, *args)
@target.send(method_name, args)
end
end
class HasNEntityCollectionProxy < SubentityAssociationProxy
delegate :[], :at, :first, :last, :size, :clear, :to => :target
attr_reader :target, :edits
def initialize(source_xml, owner, name)
super
self.from_xml(name)
end
def from_xml(name)
if @source_xml
@target = @source_xml.collect {|el| "RTunesU::#{name}".constantize.new(:source_xml => el, :parent_handle => @owner.handle)}
else
@target = []
end
end
def to_xml(builder)
self.edits.each {|entity| entity.to_xml(builder)}
end
def <<(entity)
@target << entity
@edits << entity
end
def []=(index,entity)
@target[index] = entity
@entity[index] = entity
end
end
end | 25.858974 | 130 | 0.619732 |
268259fbbcad46c2d8e79ab37488ad4b307e2b63 | 2,376 | dart | Dart | lib/Helpers/dominant_color.dart | cesartob/The-glory-of-music | 07d2439a4df0db91d85edf3ff54a4770a162fb41 | [
"MIT"
] | null | null | null | lib/Helpers/dominant_color.dart | cesartob/The-glory-of-music | 07d2439a4df0db91d85edf3ff54a4770a162fb41 | [
"MIT"
] | null | null | null | lib/Helpers/dominant_color.dart | cesartob/The-glory-of-music | 07d2439a4df0db91d85edf3ff54a4770a162fb41 | [
"MIT"
] | null | null | null | /*
* This file is part of BlackHole (https://github.com/Sangwan5688/BlackHole).
*
* BlackHole is free software: you can redistribute it and/or modify
* it under the terms of the GNU Lesser General Public License as published by
* the Free Software Foundation, either version 3 of the License, or
* (at your option) any later version.
*
* BlackHole is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
* GNU Lesser General Public License for more details.
*
* You should have received a copy of the GNU Lesser General Public License
* along with BlackHole. If not, see <http://www.gnu.org/licenses/>.
*
* Copyright (c) 2021-2022, Ankit Sangwan
*/
import 'package:blackhole/Helpers/config.dart';
import 'package:flutter/material.dart';
import 'package:get_it/get_it.dart';
import 'package:palette_generator/palette_generator.dart';
Future<List<Color>> getColors({
required ImageProvider imageProvider,
required bool useDominantAndDarkerColors,
}) async {
PaletteGenerator paletteGenerator;
paletteGenerator = await PaletteGenerator.fromImageProvider(imageProvider);
final Color dominantColor =
paletteGenerator.dominantColor?.color ?? Colors.black;
Color darkMutedColor = paletteGenerator.darkMutedColor?.color ?? Colors.black;
final Color lightMutedColor =
paletteGenerator.lightMutedColor?.color ?? dominantColor;
if (useDominantAndDarkerColors == false) {
darkMutedColor = Colors.black;
}
if (dominantColor.computeLuminance() < darkMutedColor.computeLuminance()) {
// checks if the luminance of the darkMuted color is > than the luminance of the dominant
GetIt.I<MyTheme>().playGradientColor = [
darkMutedColor,
dominantColor,
];
return [
darkMutedColor,
dominantColor,
];
} else if (dominantColor == darkMutedColor) {
// if the two colors are the same, it will replace dominantColor by lightMutedColor
GetIt.I<MyTheme>().playGradientColor = [
lightMutedColor,
darkMutedColor,
];
return [
lightMutedColor,
darkMutedColor,
];
} else {
GetIt.I<MyTheme>().playGradientColor = [
dominantColor,
darkMutedColor,
];
return [
dominantColor,
darkMutedColor,
];
}
}
| 33.942857 | 93 | 0.720539 |
3014cb10e3a4f4c1758f00eadbe4eba4345c60b4 | 5,983 | swift | Swift | Sources/DistributedActors/Cluster/DistributedNodeDeathWatcher.swift | apple/swift-distributed-actors | 9c2c2732068ec74c89ffb2c7c17e8d4a47c3e9a1 | [
"Apache-2.0"
] | 183 | 2021-10-29T18:16:37.000Z | 2022-03-22T00:25:14.000Z | Sources/DistributedActors/Cluster/DistributedNodeDeathWatcher.swift | apple/swift-distributed-actors | 9c2c2732068ec74c89ffb2c7c17e8d4a47c3e9a1 | [
"Apache-2.0"
] | 33 | 2021-11-01T01:21:11.000Z | 2022-03-19T03:43:11.000Z | Sources/DistributedActors/Cluster/DistributedNodeDeathWatcher.swift | apple/swift-distributed-actors | 9c2c2732068ec74c89ffb2c7c17e8d4a47c3e9a1 | [
"Apache-2.0"
] | 15 | 2021-10-29T20:17:23.000Z | 2022-03-19T07:45:46.000Z | //===----------------------------------------------------------------------===//
//
// This source file is part of the Swift Distributed Actors open source project
//
// Copyright (c) 2018-2022 Apple Inc. and the Swift Distributed Actors project authors
// Licensed under Apache License v2.0
//
// See LICENSE.txt for license information
// See CONTRIBUTORS.md for the list of Swift Distributed Actors project authors
//
// SPDX-License-Identifier: Apache-2.0
//
//===----------------------------------------------------------------------===//
import Distributed
import Logging
/// Implements ``LifecycleWatch`` semantics in presence of ``Node`` failures.
///
/// Depends on a failure detector (e.g. SWIM) to actually detect a node failure, however once detected,
/// it handles notifying all _local_ actors which have watched at least one actor the terminating node.
///
/// ### Implementation
/// In order to avoid every actor having to subscribe to cluster events and individually handle the relationship between those
/// and individually watched actors, the watcher handles subscribing for cluster events on behalf of actors which watch
/// other actors on remote nodes, and messages them upon a node becoming down.
///
/// Actor which is notified automatically when a remote actor is `context.watch()`-ed.
///
/// Allows manually mocking membership changes to trigger terminated notifications.
internal actor DistributedNodeDeathWatcher {
// TODO(distributed): actually use this actor rather than the behavior
typealias ActorSystem = ClusterSystem
private let log: Logger
private let selfNode: UniqueNode
private var membership: Cluster.Membership = .empty
/// Members which have been `removed`
// TODO: clear after a few days, or some max count of nodes, use sorted set for this
private var nodeTombstones: Set<UniqueNode> = []
/// Mapping between remote node, and actors which have watched some actors on given remote node.
private var remoteWatchCallbacks: [UniqueNode: Set<WatcherAndCallback>] = [:]
private var eventListenerTask: Task<Void, Error>?
init(actorSystem: ActorSystem) async {
var log = actorSystem.log
self.log = log
self.selfNode = actorSystem.cluster.uniqueNode
// initialized
let events = actorSystem.cluster.events
self.eventListenerTask = Task {
for try await event in events {
switch event {
case .membershipChange(let change):
self.membershipChanged(change)
case .snapshot(let membership):
let diff = Cluster.Membership._diff(from: .empty, to: membership)
for change in diff.changes {
self.membershipChanged(change)
}
case .leadershipChange, .reachabilityChange:
break // ignore those, they don't affect downing
}
}
}
}
func watchActor(
on remoteNode: UniqueNode,
by watcher: ClusterSystem.ActorID,
whenTerminated nodeTerminatedFn: @escaping @Sendable (UniqueNode) async -> Void
) {
guard !self.nodeTombstones.contains(remoteNode) else {
// the system the watcher is attempting to watch has terminated before the watch has been processed,
// thus we have to immediately reply with a termination system message, as otherwise it would never receive one
Task {
await nodeTerminatedFn(remoteNode)
}
return
}
let record = WatcherAndCallback(watcherID: watcher, callback: nodeTerminatedFn)
self.remoteWatchCallbacks[remoteNode, default: []].insert(record)
}
func removeWatcher(id: ClusterSystem.ActorID) {
// TODO: this can be optimized a bit more I suppose, with a reverse lookup table
let removeMe = WatcherAndCallback(watcherID: id, callback: { _ in () })
for (node, var watcherAndCallbacks) in self.remoteWatchCallbacks {
if watcherAndCallbacks.remove(removeMe) != nil {
self.remoteWatchCallbacks[node] = watcherAndCallbacks
}
}
}
func cleanupTombstone(node: UniqueNode) {
_ = self.nodeTombstones.remove(node)
}
func membershipChanged(_ change: Cluster.MembershipChange) {
guard let change = self.membership.applyMembershipChange(change) else {
return // no change, nothing to act on
}
// TODO: make sure we only handle ONCE?
if change.status >= .down {
// can be: down, leaving or removal.
// on any of those we want to ensure we handle the "down"
self.handleAddressDown(change)
}
}
func handleAddressDown(_ change: Cluster.MembershipChange) {
let terminatedNode = change.node
if let watchers = self.remoteWatchCallbacks.removeValue(forKey: terminatedNode) {
for watcher in watchers {
Task {
await watcher.callback(terminatedNode)
}
}
}
// we need to keep a tombstone, so we can immediately reply with a terminated,
// in case another watch was just in progress of being made
self.nodeTombstones.insert(terminatedNode)
}
func cancel() {
self.eventListenerTask?.cancel()
self.eventListenerTask = nil
}
}
extension DistributedNodeDeathWatcher {
struct WatcherAndCallback: Hashable {
/// Address of the local watcher which had issued this watch
let watcherID: ClusterSystem.ActorID
let callback: @Sendable (UniqueNode) async -> Void
func hash(into hasher: inout Hasher) {
hasher.combine(self.watcherID)
}
static func == (lhs: WatcherAndCallback, rhs: WatcherAndCallback) -> Bool {
lhs.watcherID == rhs.watcherID
}
}
}
| 38.352564 | 126 | 0.634464 |
8b3f5e5952cf8badf2955ee494963db4d67b15eb | 417 | rb | Ruby | app/decorators/models/solidus_tracking/spree/order/disable_confirm_email.rb | printivity/solidus_tracking | e62fe88d1127aa23b1d7af9f33da896e0e2a6c6d | [
"BSD-3-Clause"
] | 2 | 2020-09-25T15:49:28.000Z | 2021-03-30T00:11:19.000Z | app/decorators/models/solidus_tracking/spree/order/disable_confirm_email.rb | printivity/solidus_tracking | e62fe88d1127aa23b1d7af9f33da896e0e2a6c6d | [
"BSD-3-Clause"
] | 24 | 2020-09-18T12:49:54.000Z | 2021-09-24T16:48:43.000Z | app/decorators/models/solidus_tracking/spree/order/disable_confirm_email.rb | printivity/solidus_tracking | e62fe88d1127aa23b1d7af9f33da896e0e2a6c6d | [
"BSD-3-Clause"
] | 5 | 2020-12-28T16:58:19.000Z | 2022-02-15T15:54:35.000Z | # frozen_string_literal: true
module SolidusTracking
module Spree
module Order
module DisableConfirmEmail
def deliver_order_confirmation_email
super unless SolidusTracking.configuration.disable_builtin_emails
end
end
end
end
end
if Spree.solidus_gem_version < Gem::Version.new('2.9.0')
Spree::Order.prepend(SolidusTracking::Spree::Order::DisableConfirmEmail)
end
| 23.166667 | 75 | 0.743405 |
05c30aaeb0dcbe5f7b955869b6f67650a025a8c9 | 3,620 | py | Python | uvicore/database/OBSOLETE/db_OLD_sync.py | coboyoshi/uvicore | 9cfdeeac83000b156fe48f068b4658edaf51c8de | [
"MIT"
] | 11 | 2021-03-22T22:07:49.000Z | 2022-03-08T16:18:33.000Z | uvicore/database/OBSOLETE/db_OLD_sync.py | coboyoshi/uvicore | 9cfdeeac83000b156fe48f068b4658edaf51c8de | [
"MIT"
] | 12 | 2021-03-04T05:51:24.000Z | 2021-09-22T05:16:18.000Z | uvicore/database/OBSOLETE/db_OLD_sync.py | coboyoshi/uvicore | 9cfdeeac83000b156fe48f068b4658edaf51c8de | [
"MIT"
] | 2 | 2021-03-25T14:49:56.000Z | 2021-11-17T23:20:29.000Z | import uvicore
from typing import Dict, List
from uvicore.contracts import Connection
from uvicore.contracts import Database as DatabaseInterface
from uvicore.support.dumper import dd, dump
import sqlalchemy as sa
# from sqlalchemy import MetaData as SaMetaData
# from sqlalchemy.engine import Engine as SaEngine
# from sqlalchemy.engine import Connection as SaConnection
class _Db(DatabaseInterface):
@property
def default(self) -> str:
return self._default
@property
def connections(self) -> Dict[str, Connection]:
return self._connections
@property
def engines(self) -> Dict[str, str]:
return self._engines
@property
def metadatas(self) -> Dict[str, sa.MetaData]:
return self._metadatas
@default.setter
def default(self, value: str) -> None:
self._default = value
def __init__(self) -> None:
self._default = None
self._connections = {}
self._engines = {}
self._metadatas = {}
def init(self, default: str, connections: List[Connection]) -> None:
self._default = default
for connection in connections:
self._connections[connection.name] = connection
self._engines[connection.metakey] = sa.create_engine(connection.url)
self._metadatas[connection.metakey] = sa.MetaData()
def packages(self, connection: str = None, metakey: str = None) -> Connection:
"""Get all packages with the metakey derived from the connection name
or passed in metakey.
"""
if not metakey:
if not connection: connection = self.default
metakey = self.connection(connection).metakey
packages = []
for package in uvicore.app.packages.values():
for conn in package.connections:
if conn.metakey == metakey:
packages.append(package)
return packages
def connection(self, connection: str = None) -> Connection:
"""Get one connection by connection name"""
if not connection: connection = self.default
return self.connections.get(connection)
def metadata(self, connection: str = None, metakey: str = None) -> sa.MetaData:
"""Get one metadata by connection name or metakey"""
if metakey:
return self.metadatas.get(metakey)
else:
if not connection: connection = self.default
metakey = self.connection(connection).metakey
return self.metadatas.get(metakey)
def engine(self, connection: str = None, metakey: str = None) -> sa.engine.Engine:
"""get one engine by connection name or metakey"""
if metakey:
return self.engines.get(metakey)
else:
if not connection: connection = self.default
metakey = self.connection(connection).metakey
return self.engines.get(metakey)
def connect(self, connection: str = None, metakey: str = None) -> sa.engine.Connection:
"""Connect to one engine by connection name or metakey"""
if metakey:
return self.engine(metakey=metakey).connect()
else:
if not connection: connection = self.default
return self.engine(connection).connect()
def execute(self, entity, *args, **kwargs):
conn = self.connect(entity.__connection__)
return conn.execute(*args, **kwargs)
def fetchone(self, entity, query):
return self.execute(entity, query).fetchone()
def fetchall(self, entity, query):
return self.execute(entity, query).fetchall()
| 34.807692 | 91 | 0.643094 |
b2cad89b8bb4441baa10305d3df61aa2ab368bac | 5,160 | css | CSS | lib/jvCharts/jv.css | jlazar/jlazar-personal-website | b6ec9ecdd0cf506ce8edad104388fdab27d9131b | [
"MIT"
] | null | null | null | lib/jvCharts/jv.css | jlazar/jlazar-personal-website | b6ec9ecdd0cf506ce8edad104388fdab27d9131b | [
"MIT"
] | null | null | null | lib/jvCharts/jv.css | jlazar/jlazar-personal-website | b6ec9ecdd0cf506ce8edad104388fdab27d9131b | [
"MIT"
] | null | null | null | .edit-div {
z-index: 6;
display: none;
width: 220px;
height: auto;
}
.jv-inline {
display: inline-block;
}
.jv-pointer {
cursor: pointer;
}
.jv-center {
text-align: center;
}
.jv-full-width {
width: 100%;
}
.jv-pull-left {
float: left;
}
.jv-pull-right {
float: right;
}
.jv-tip-side-margins {
margin: 0 10px 0 10px;
}
.jv-top-margin {
margin-top: 5px;
}
.jv-button {
color: #2E3133;
box-shadow: 0 1px 2px rgba(0, 0, 0, 0.09);
background-color: white;
border-radius: 2px;
border: 1px solid #B7BFC5;
outline: none;
padding: 3px 8px;
font-size: .9em;
}
.jv-button.jv-button-green {
color: white;
text-shadow: 0 1px 0 rgba(0, 0, 0, 0.2);
background: #15B994;
border: 1px solid #15B994;
}
.d3-tooltip-circle {
width: 10px;
height: 10px;
}
#exitEditMode{
margin-top: -5px;
}
.jv-edit-mode-input {
display: inline-block;
margin-bottom: 10px;
}
.semoss-d3-tip {
z-index: 10000;
margin: 0;
padding: 5px;
min-width: 200px;
background-color: #FFFFFF;
border: 1px solid rgba(122,122,122,0.6);
color: #000000;
}
.semoss-d3_v3-tip {
z-index: 10000;
margin: 0;
padding: 5px;
min-width: 200px;
background-color: #FFFFFF;
border: 1px solid rgba(122,122,122,0.6);
color: #000000;
}
.editable-pie {
opacity: 1;
transition: .2s;
}
.pie-container:hover .editable-pie {
opacity: 1;
transform: scale(1.05, 1.05);
transition: .2s;
}
.pie-container:hover .editable-pie:not(:hover) {
opacity: 0.7;
transform: scale(1, 1);
transition: .2s;
}
/* Creates a small triangle extender for the tooltip */
.semoss-d3-tip:after {
display: none;
}
.chart-div {
-webkit-user-select: none; /* Chrome all / Safari all */
-moz-user-select: none; /* Firefox all */
-ms-user-select: none; /* IE 10+ */
user-select: none;
}
.commentbox-readonly {
z-index: 6;
pointer-events: none;
}
.commentbox-annotate {
outline: none;
border: none;
}
.commentbox {
width: 205px;
height: auto;
background-color: #e6e6e6;
color: #000000;
padding: 5px;
margin: 0px;
z-index: 6;
}
.commentbox-edit {
width: 205px;
height: auto;
background-color: #e6e6e6;
color: #000000;
padding: 5px;
margin: 0px;
z-index: 6;
}
.commentbox-close{
position: absolute;
padding: 3px 8px;
font-size: .9em;
outline: none;
top: 0;
right: 0;
border: 0 none;
background: transparent;
}
.commentbox-submit{
float: right;
}
.tip-line {
pointer-events: none;
}
.topbar-button.font {
font-size: 1.1em;
padding: 3px 4px 3px 4px;
}
.topbar-button {
font-size: 1.3em;
padding: 3px 5px 3px 5px;
}
.comment-textarea {
max-width: 190px;
outline: none;
}
.brusharea {
visibility: visible !important;
}
.brusharea .background {
fill: blue;
visibility: visible;
z-index: 10;
}
.brusharea .extent {
visibility: visible;
fill: #E6E6E6;
z-index: 11;
fill-opacity: .7;
shape-rendering: crispEdges;
stroke: #E6E6E6;
}
.brusharea .resize {
visibility: visible !important;
fill: #00E753;
z-index: 12;
}
.jv-tooltip {
z-index: 10000;
/*opacity: .6;*/
/*background: rgba(255,255,255,0.95);*/
background: #f2f2f2;
width: auto;
max-width: 50%;
/*border: 1px solid black;*/
position: absolute;
color: black;
}
/*---------------------------------VIZ SPECIFIC------------------------------------------------------*/
/*Circle Packing CSS*/
.node {
cursor: pointer;
}
.node:hover {
stroke: #000;
stroke-width: 1.5px;
}
.node:hover text{
stroke: none;
stroke-width: 0;
}
.node--leaf {
fill: transparent;
}
.label {
font-size: .75em;
text-anchor: middle;
}
.label,
.node--root,
.node--leaf {
pointer-events: none;
}
.node rect {
cursor: move;
fill-opacity: .9;
shape-rendering: crispEdges;
}
.node text {
pointer-events: none;
}
.sankey-link {
fill: none;
stroke: #000;
stroke-opacity: .2;
}
.sankey-link:hover {
stroke-opacity: .5;
}
.chord {
fill-opacity: .67;
}
text.text-highlight {
opacity: .2;
}
.rect-highlight {
opacity: .2;
}
.rect-border {
stroke: black;
stroke-width: 2px;
}
.line-threshold {
stroke: url(#line-gradient);
}
.area-threshold {
fill: url(#line-gradient);
}
.heatLegend {
height: 100%;
position: fixed;
top: auto;
right: 0;
left: 0;
bottom: 0;
}
.jvDoodle-container {
position: absolute;
right: 49px;
top: 20px;
}
.jvDoodle-container ul {
padding-left: 0;
list-style: none;
}
#jvDoodle-modes {
cursor: pointer;
}
#jvDoodle-canvas {
position: absolute;
left: 0;
background: rgba(0,0,0,0);
}
#jvDoodle-modes btn {
opacity: .5
}
#jvDoodle-modes btn:hover {
opacity: 1;
}
#jvDoodle-modes .jvDoodle-active {
opacity: 1;
}
#jvDoodle-modes #jvDoodle-color {
background: none;
border: none;
width: 20px;
position: relative;
right: 3px;
cursor: pointer;
} | 14.827586 | 103 | 0.581202 |
6890fd3b2ec845588627dc003316c2fd68b91c12 | 605 | php | PHP | app/Models/NotaSerasa/NotaSerasa.php | Renato27/api_teste | 4b46877092b605ae8768396b962fdc14f14b320d | [
"MIT"
] | null | null | null | app/Models/NotaSerasa/NotaSerasa.php | Renato27/api_teste | 4b46877092b605ae8768396b962fdc14f14b320d | [
"MIT"
] | null | null | null | app/Models/NotaSerasa/NotaSerasa.php | Renato27/api_teste | 4b46877092b605ae8768396b962fdc14f14b320d | [
"MIT"
] | null | null | null | <?php
namespace App\Models\NotaSerasa;
use App\Models\Clientes\cliente;
use App\Models\Nota\Nota;
use Illuminate\Database\Eloquent\Factories\HasFactory;
use Illuminate\Database\Eloquent\Model;
use Illuminate\Database\Eloquent\SoftDeletes;
class NotaSerasa extends Model
{
use HasFactory, SoftDeletes;
protected $date = ['deleted_at'];
protected $fillable = ['nota_id', 'cliente_id'];
public function nota()
{
return $this->belongsTo(Nota::class, 'nota_id');
}
public function cliente()
{
return $this->belongsTo(cliente::class, 'cliente_id');
}
}
| 21.607143 | 62 | 0.699174 |
4550ae581a536b11f675f20d45a0203cf027945a | 622 | py | Python | homework/lesson-4/exercise-5/main.py | ai-nikolaev/repo-pybasics | bb34fdd0ef5dc562ef1708268917a0f29e7ae4d4 | [
"MIT"
] | null | null | null | homework/lesson-4/exercise-5/main.py | ai-nikolaev/repo-pybasics | bb34fdd0ef5dc562ef1708268917a0f29e7ae4d4 | [
"MIT"
] | null | null | null | homework/lesson-4/exercise-5/main.py | ai-nikolaev/repo-pybasics | bb34fdd0ef5dc562ef1708268917a0f29e7ae4d4 | [
"MIT"
] | null | null | null | # 5. Реализовать формирование списка, используя функцию range()
# и возможности генератора. В список должны войти четные числа
# от 100 до 1000 (включая границы). Необходимо получить результат
# вычисления произведения всех элементов списка.
# Подсказка: использовать функцию reduce().
from functools import reduce
# функция вычисления произведения
def my_func(prev_el, el):
# prev_el - предыдущий элемент
# el - текущий элемент
return prev_el * el
# формирование списка
my_list = [a for a in range(100, 1001) if a % 2 == 0]
# вывод итоговых данных
print(f'Вывод результата: {reduce(my_func, my_list)}')
| 28.272727 | 65 | 0.749196 |
9cc87639ba75eba40e8fc5d698ebb6fd38d1a15c | 1,623 | rs | Rust | proxy/src/ctx/transport.rs | hawkw/conduit | 2ae7d48339d00a806a591f791b3289bfd1695fbd | [
"Apache-2.0"
] | null | null | null | proxy/src/ctx/transport.rs | hawkw/conduit | 2ae7d48339d00a806a591f791b3289bfd1695fbd | [
"Apache-2.0"
] | null | null | null | proxy/src/ctx/transport.rs | hawkw/conduit | 2ae7d48339d00a806a591f791b3289bfd1695fbd | [
"Apache-2.0"
] | null | null | null | use std::net::SocketAddr;
use std::sync::Arc;
use ctx;
#[derive(Clone, Debug, PartialEq, Eq, Hash)]
pub enum Ctx {
Client(Arc<Client>),
Server(Arc<Server>),
}
/// Identifies a connection from another process to a proxy listener.
#[derive(Clone, Debug, PartialEq, Eq, Hash)]
pub struct Server {
pub proxy: Arc<ctx::Proxy>,
pub remote: SocketAddr,
pub local: SocketAddr,
pub orig_dst: Option<SocketAddr>,
}
/// Identifies a connection from the proxy to another process.
#[derive(Clone, Debug, PartialEq, Eq, Hash)]
pub struct Client {
pub proxy: Arc<ctx::Proxy>,
pub remote: SocketAddr,
}
impl Ctx {
pub fn proxy(&self) -> &Arc<ctx::Proxy> {
match *self {
Ctx::Client(ref ctx) => &ctx.proxy,
Ctx::Server(ref ctx) => &ctx.proxy,
}
}
}
impl Server {
pub fn new(
proxy: &Arc<ctx::Proxy>,
local: &SocketAddr,
remote: &SocketAddr,
orig_dst: &Option<SocketAddr>,
) -> Arc<Server> {
let s = Server {
proxy: Arc::clone(proxy),
local: *local,
remote: *remote,
orig_dst: *orig_dst,
};
Arc::new(s)
}
}
impl Client {
pub fn new(proxy: &Arc<ctx::Proxy>, remote: &SocketAddr) -> Arc<Client> {
let c = Client {
proxy: Arc::clone(proxy),
remote: *remote,
};
Arc::new(c)
}
}
impl From<Arc<Client>> for Ctx {
fn from(c: Arc<Client>) -> Self {
Ctx::Client(c)
}
}
impl From<Arc<Server>> for Ctx {
fn from(s: Arc<Server>) -> Self {
Ctx::Server(s)
}
}
| 21.077922 | 77 | 0.552064 |
0a9ffd1200454e1442ea0a440d3a98e325d12676 | 4,400 | cs | C# | TrAIngle Unmodified/Assets/Scripts/ArtificialIntelligence/Neural/Crossover.cs | ERGeorgiev/TrAIngle | 282840971ee358176a956b3b81ace928e01ccd67 | [
"MIT"
] | null | null | null | TrAIngle Unmodified/Assets/Scripts/ArtificialIntelligence/Neural/Crossover.cs | ERGeorgiev/TrAIngle | 282840971ee358176a956b3b81ace928e01ccd67 | [
"MIT"
] | null | null | null | TrAIngle Unmodified/Assets/Scripts/ArtificialIntelligence/Neural/Crossover.cs | ERGeorgiev/TrAIngle | 282840971ee358176a956b3b81ace928e01ccd67 | [
"MIT"
] | null | null | null | using System;
using System.Collections.Generic;
using Artificialintelligence.Genetic;
namespace Artificialintelligence.Neural
{
public class Crossover
{
public static float ratio = 0.7f;
private static Random random = new Random();
public static List<Gene<NeuronLayer>> NeuronLayer(Gene<NeuronLayer> geneA, Gene<NeuronLayer> geneB, CrossoverType crossoverType)
{
switch(crossoverType)
{
case CrossoverType.SinglePoint:
return SinglePoint(geneA, geneB);
case CrossoverType.MultiPoint:
return MultiPoint(geneA, geneB);
case CrossoverType.OrderBased:
return OrderBased(geneA, geneB);
default:
throw new NotImplementedException("More research is needed");
}
}
private static List<Gene<NeuronLayer>> SinglePoint(Gene<NeuronLayer> geneA, Gene<NeuronLayer> geneB)
{
Gene<NeuronLayer> childA = new Gene<NeuronLayer>(geneA);
Gene<NeuronLayer> childB = new Gene<NeuronLayer>(geneB);
int maxLayers = Math.Min(childA.Allele.Count, childA.Allele.Count);
for (int i = 0; i < maxLayers; i++)
{
if ((float)random.NextDouble() >= ratio)
continue;
SinglePoint(childA.Allele[i], geneB.Allele[i]);
SinglePoint(childB.Allele[i], geneA.Allele[i]);
}
return new List<Gene<NeuronLayer>>()
{
childA,
childB
};
}
private static void SinglePoint(NeuronLayer layerA, NeuronLayer layerB)
{
int maxNeurons = Math.Min(layerA.Count, layerB.Count);
int position = random.Next(0, maxNeurons);
for (int i = position; i < maxNeurons; i++)
{
layerA.neurons[i] = new Neuron(layerB.neurons[i]);
}
}
private static List<Gene<NeuronLayer>> MultiPoint(Gene<NeuronLayer> geneA, Gene<NeuronLayer> geneB)
{
Gene<NeuronLayer> childA = new Gene<NeuronLayer>(geneA);
Gene<NeuronLayer> childB = new Gene<NeuronLayer>(geneB);
int maxLayers = Math.Min(childA.Allele.Count, childA.Allele.Count);
for (int i = 0; i < maxLayers; i++)
{
if ((float)random.NextDouble() >= ratio)
continue;
MultiPoint(childA.Allele[i], geneB.Allele[i]);
MultiPoint(childB.Allele[i], geneA.Allele[i]);
}
return new List<Gene<NeuronLayer>>()
{
childA,
childB
};
}
private static void MultiPoint(NeuronLayer layerA, NeuronLayer layerB)
{
int maxNeurons = Math.Min(layerA.Count, layerB.Count);
int positionA = random.Next(0, maxNeurons);
int positionB = random.Next(positionA, maxNeurons);
for (int i = positionA; i <= positionB; i++)
{
layerA.neurons[i] = new Neuron(layerB.neurons[i]);
}
}
private static List<Gene<NeuronLayer>> OrderBased(Gene<NeuronLayer> geneA, Gene<NeuronLayer> geneB)
{
Gene<NeuronLayer> childA = new Gene<NeuronLayer>(geneA);
Gene<NeuronLayer> childB = new Gene<NeuronLayer>(geneB);
int maxLayers = Math.Min(childA.Allele.Count, childA.Allele.Count);
for (int i = 0; i < maxLayers; i++)
{
if ((float)random.NextDouble() >= ratio)
continue;
OrderBased(childA.Allele[i], geneB.Allele[i]);
OrderBased(childB.Allele[i], geneA.Allele[i]);
}
return new List<Gene<NeuronLayer>>()
{
childA,
childB
};
}
private static void OrderBased(NeuronLayer layerA, NeuronLayer layerB)
{
int maxNeurons = Math.Min(layerA.Count, layerB.Count);
for (int i = 0; i < maxNeurons; i++)
{
if ((float)random.NextDouble() >= 0.5f)
continue;
layerA.neurons[i] = new Neuron(layerB.neurons[i]);
}
}
}
}
| 34.920635 | 136 | 0.531364 |
b328efc2e5e2255ab68e10b3d063a09ee14a42e8 | 6,173 | py | Python | ElectreCredibilityWithCounterVeto/ElectreCredibilityWithCounterVeto.py | sbigaret/electre_diviz | ccfb990a2543799acdf3bb21cf8b0c7499a5a3b5 | [
"MIT"
] | 5 | 2018-01-13T16:19:04.000Z | 2020-11-28T22:09:49.000Z | ElectreCredibilityWithCounterVeto/ElectreCredibilityWithCounterVeto.py | sbigaret/electre_diviz | ccfb990a2543799acdf3bb21cf8b0c7499a5a3b5 | [
"MIT"
] | 4 | 2015-02-22T14:01:20.000Z | 2019-01-02T18:45:04.000Z | ElectreCredibilityWithCounterVeto/ElectreCredibilityWithCounterVeto.py | sbigaret/electre_diviz | ccfb990a2543799acdf3bb21cf8b0c7499a5a3b5 | [
"MIT"
] | 4 | 2015-01-08T23:04:11.000Z | 2018-11-06T08:07:34.000Z | #!/usr/bin/env python
"""
ElectreCredibilityWithCounterVeto - computes credibility matrix using procedure
which is common to the most methods from the Electre family.
This module is an extended version of 'ElectreCredibility' in that it is
designed to work with the 'counter-veto' concept - i.e. it requires an
additional input file ('counter_veto_crossed.xml') produced by
'ElectreDiscordance' module, which contains the information for which pairs of
variants and on which criteria the 'counter-veto' threshold has been crossed.
Please note that unlike 'ElectreCredibility', this module can accept
discordance indices only in non-aggregated form (i.e. one index per criterion).
Usage:
ElectreCredibilityWithCounterVeto.py -i DIR -o DIR
Options:
-i DIR Specify input directory. It should contain the following files:
alternatives.xml
classes_profiles.xml (optional)
concordance.xml
counter_veto_crossed.xml
discordance.xml
method_parameters.xml
-o DIR Specify output directory. Files generated as output:
credibility.xml
messages.xml
--version Show version.
-h --help Show this screen.
"""
from __future__ import absolute_import, division, print_function, unicode_literals
import os
import sys
import traceback
from docopt import docopt
from common import comparisons_to_xmcda, create_messages_file, get_dirs, \
get_error_message, get_input_data, write_xmcda, Vividict
__version__ = '0.1.0'
def get_credibility(comparables_a, comparables_b, concordance, discordance,
with_denominator, only_max_discordance, cv_crossed):
def _get_credibility_idx(x, y, num_crossed, only_max_discordance):
discordance_values = discordance[x][y].values()
if set(discordance_values) == set([0]): # only zeros
c_idx = concordance[x][y]
elif 1 in discordance_values: # at least one '1'
if not concordance[x][y] < 1:
raise RuntimeError("When discordance == 1, "
"concordance must be < 1.")
c_idx = 0.0
elif only_max_discordance and not with_denominator:
c_idx = concordance[x][y] * (1 - max(discordance_values))
else:
factors = []
for d in discordance_values:
if with_denominator:
if d > concordance[x][y]:
factor = (1 - d) / (1 - concordance[x][y])
else:
factor = None
else:
factor = (1 - d)
if factor:
factors.append(factor)
if factors == []:
c_idx = concordance[x][y]
else:
discordance_aggr = reduce(lambda f1, f2: f1 * f2, factors)
c_idx = (concordance[x][y] *
discordance_aggr ** (1 - num_crossed / num_total))
return c_idx
two_way_comparison = True if comparables_a != comparables_b else False
# 'num_total' == total number of criteria.
# Instead of this monstrosity below, maybe it would be better to provide
# 'criteria.xml' as another input..?
num_total = len(discordance.values()[0].values()[0].keys())
credibility = Vividict()
for a in comparables_a:
for b in comparables_b:
num_crossed = len(cv_crossed[a][b])
credibility[a][b] = _get_credibility_idx(a, b, num_crossed,
only_max_discordance)
if two_way_comparison:
credibility[b][a] = _get_credibility_idx(b, a, num_crossed,
only_max_discordance)
return credibility
def main():
try:
args = docopt(__doc__, version=__version__)
output_dir = None
input_dir, output_dir = get_dirs(args)
filenames = [
# every tuple below == (filename, is_optional)
('alternatives.xml', False),
('classes_profiles.xml', True),
('concordance.xml', False),
('counter_veto_crossed.xml', False),
('discordance.xml', False),
('method_parameters.xml', False),
]
params = [
'alternatives',
'categories_profiles',
'comparison_with',
'concordance',
'cv_crossed',
'discordance',
'only_max_discordance',
'with_denominator',
]
d = get_input_data(input_dir, filenames, params, use_partials=True)
# getting the elements to compare
comparables_a = d.alternatives
if d.comparison_with in ('boundary_profiles', 'central_profiles'):
# central_profiles is a dict, so we need to get the keys
comparables_b = [i for i in d.categories_profiles]
else:
comparables_b = d.alternatives
credibility = get_credibility(comparables_a, comparables_b,
d.concordance, d.discordance,
d.with_denominator,
d.only_max_discordance, d.cv_crossed)
# serialization etc.
if d.comparison_with in ('boundary_profiles', 'central_profiles'):
mcda_concept = 'alternativesProfilesComparisons'
else:
mcda_concept = None
comparables = (comparables_a, comparables_b)
xmcda = comparisons_to_xmcda(credibility, comparables,
mcda_concept=mcda_concept)
write_xmcda(xmcda, os.path.join(output_dir, 'credibility.xml'))
create_messages_file(None, ('Everything OK.',), output_dir)
return 0
except Exception, err:
err_msg = get_error_message(err)
log_msg = traceback.format_exc()
print(log_msg.strip())
create_messages_file((err_msg, ), (log_msg, ), output_dir)
return 1
if __name__ == '__main__':
sys.exit(main())
| 38.823899 | 82 | 0.590151 |
07c7b7c9f662421bdd343fbe9858d631830057ca | 429 | rb | Ruby | db/migrate/20180122160447_change_comments.rb | kagron/irb | 2290c7c6247c4e228dc11b0a05e9ce08627202d4 | [
"MIT"
] | null | null | null | db/migrate/20180122160447_change_comments.rb | kagron/irb | 2290c7c6247c4e228dc11b0a05e9ce08627202d4 | [
"MIT"
] | null | null | null | db/migrate/20180122160447_change_comments.rb | kagron/irb | 2290c7c6247c4e228dc11b0a05e9ce08627202d4 | [
"MIT"
] | null | null | null | class ChangeComments < ActiveRecord::Migration[5.1]
def change
remove_column :comments, :documents_id
add_column :comments, :document_id, :integer, :limit => 8
add_index :comments, :document_id
add_foreign_key :comments, :documents
remove_column :comments, :users_id
add_column :comments, :user_id, :integer, :limit => 8
add_index :comments, :user_id
add_foreign_key :comments, :users
end
end
| 33 | 61 | 0.724942 |
38ff551954ae10b272f898e07f2cbbdd3b34e97b | 752 | swift | Swift | Moya-Pretty/SubSpec/Japx/Sources/JsonApiHeaderPlugin.swift | PKLOT/Moya-Pretty | 1686cd1e977948bb9ec968ff96e3c763b791bd79 | [
"MIT"
] | 15 | 2018-07-08T20:31:59.000Z | 2022-01-03T06:23:25.000Z | Moya-Pretty/SubSpec/Japx/Sources/JsonApiHeaderPlugin.swift | PKLOT/Moya-Pretty | 1686cd1e977948bb9ec968ff96e3c763b791bd79 | [
"MIT"
] | 3 | 2021-07-15T13:30:59.000Z | 2021-07-15T13:31:03.000Z | Moya-Pretty/SubSpec/Japx/Sources/JsonApiHeaderPlugin.swift | PKLOT/Moya-Pretty | 1686cd1e977948bb9ec968ff96e3c763b791bd79 | [
"MIT"
] | 3 | 2018-12-19T15:07:34.000Z | 2022-01-19T06:47:14.000Z | //
// JsonApiHeaderPlugin.swift
// Moya-Pretty
//
// Created by Kao Ming-Hsiu on 2018/8/27.
//
import Foundation
import Moya
public struct JsonApiAcceptHeaderPlugin: PluginType {
public init() {}
public func prepare(_ request: URLRequest, target: TargetType) -> URLRequest {
var newRequest = request
newRequest.allHTTPHeaderFields?.updateValue("application/vnd.api+json", forKey: "Accept")
return newRequest
}
}
public struct JsonApiContentTypeHeaderPlugin: PluginType {
public init() {}
public func prepare(_ request: URLRequest, target: TargetType) -> URLRequest {
var newRequest = request
newRequest.allHTTPHeaderFields?.updateValue("application/vnd.api+json", forKey: "Content-Type")
return newRequest
}
}
| 26.857143 | 99 | 0.735372 |
8dabec2998fcc31f5c2fce2bae80df8b123d86bd | 411 | js | JavaScript | demo/performance-test.js | jinghua000/shadow-fns | d0b9f38488df5bd2044f2b2a6c795516dc67f701 | [
"MIT"
] | 3 | 2019-10-15T15:00:30.000Z | 2020-05-13T22:52:10.000Z | demo/performance-test.js | jinghua000/shadow-fns | d0b9f38488df5bd2044f2b2a6c795516dc67f701 | [
"MIT"
] | null | null | null | demo/performance-test.js | jinghua000/shadow-fns | d0b9f38488df5bd2044f2b2a6c795516dc67f701 | [
"MIT"
] | null | null | null | const { add, times } = require('../lib')
function invokeWithCurry () {
return add(1)(2)
}
function invokeWithoutCurry () {
return add(1, 2)
}
console.time('invokeWithCurry')
times(1e6, invokeWithCurry)()
console.timeEnd('invokeWithCurry')
console.time('invokeWithoutCurry')
times(1e6, invokeWithoutCurry)()
console.timeEnd('invokeWithoutCurry')
// => invokeWithoutCurry much faster than invokeWithCurry | 21.631579 | 57 | 0.744526 |
0ea2ba0d5d5dd918f484db201d6a9fc3d846295d | 279 | asm | Assembly | Source Codes Testing/ADDITION.asm | aravindvnair99/emu8086 | 1713febd30618f0d03f09c6a7f8eb6c4a68888b8 | [
"MIT"
] | 11 | 2018-12-31T08:56:38.000Z | 2022-02-28T15:49:14.000Z | Source Codes Testing/ADDITION.asm | aravindvnair99/emu8086 | 1713febd30618f0d03f09c6a7f8eb6c4a68888b8 | [
"MIT"
] | null | null | null | Source Codes Testing/ADDITION.asm | aravindvnair99/emu8086 | 1713febd30618f0d03f09c6a7f8eb6c4a68888b8 | [
"MIT"
] | 4 | 2020-11-10T01:29:54.000Z | 2022-01-20T04:50:08.000Z | ;Adding two single byte numbers stored in memory location num1 and num2.
.MODEL small
.STACK
.DATA ; variable declaration section
num1 db 01h
num2 db 02h
; code section
.CODE
.STARTUP
mov bh,num1
add bh, num2
.EXIT
END ; end of the program
| 19.928571 | 72 | 0.659498 |
dbc6be99da081d2b4e2fedc51fe2f052370d5d6b | 5,008 | php | PHP | src/Generator/MessageGenerator.php | qiqizjl/phpkafka | 018ed24287b32a07618d00ed75ca05d0ccb54b28 | [
"Apache-2.0"
] | 172 | 2020-10-16T03:15:19.000Z | 2021-06-10T23:05:09.000Z | src/Generator/MessageGenerator.php | qiqizjl/phpkafka | 018ed24287b32a07618d00ed75ca05d0ccb54b28 | [
"Apache-2.0"
] | 30 | 2020-10-28T06:43:24.000Z | 2021-06-10T05:06:29.000Z | src/Generator/MessageGenerator.php | qiqizjl/phpkafka | 018ed24287b32a07618d00ed75ca05d0ccb54b28 | [
"Apache-2.0"
] | 15 | 2020-11-10T08:39:52.000Z | 2021-03-30T15:24:15.000Z | <?php
declare(strict_types=1);
namespace longlang\phpkafka\Generator;
class MessageGenerator extends AbstractGenerator
{
/**
* @var string
*/
protected $dirName;
/**
* @var bool
*/
protected $isHeader = false;
/**
* @var int[]
*/
protected $flexibleVersions;
/**
* @var array
*/
protected $generatedTypes = [];
/**
* @var int
*/
protected $apiKey;
public function __construct(\stdClass $data)
{
$this->messageGenerator = $this;
$this->data = $data;
$this->apiName = $this->parseApiName($data);
$this->dirName = \dirname(__DIR__) . '/Protocol/' . $this->apiName;
$this->validVersions = $this->parseVersionsToArray($data->validVersions);
$this->maxSupportVersion = $maxSupportVersion = max(0, ...$this->validVersions);
$this->flexibleVersions = isset($data->flexibleVersions) ? $this->parseVersionsToArray($data->flexibleVersions, $maxSupportVersion) : [];
$this->apiKey = $this->data->apiKey ?? -1;
}
public function getDirName(): string
{
return $this->dirName;
}
public function getIsHeader(): bool
{
return $this->isHeader;
}
public function getSaveFileName(): string
{
return $this->dirName . '/' . $this->data->name . '.php';
}
public function getFlexibleVersions(): array
{
return $this->flexibleVersions;
}
public function getApiKey(): int
{
return $this->apiKey;
}
public function generate(): void
{
$this->generateCommonStructs();
[$classProperties, $constructMethod, $methods] = $this->generateCode();
$className = $this->data->name;
$flexibleVersionsStr = json_encode($this->flexibleVersions);
switch ($this->data->type) {
case 'request':
$extendsClassName = 'AbstractRequest';
$constructMethod .= <<<CODE
public function getRequestApiKey(): ?int
{
return {$this->apiKey};
}
public function getMaxSupportedVersion(): int
{
return {$this->maxSupportVersion};
}
public function getFlexibleVersions(): array
{
return {$flexibleVersionsStr};
}
CODE;
break;
case 'response':
$extendsClassName = 'AbstractResponse';
$constructMethod .= <<<CODE
public function getRequestApiKey(): ?int
{
return {$this->apiKey};
}
public function getFlexibleVersions(): array
{
return {$flexibleVersionsStr};
}
CODE;
break;
case 'header':
if ('RequestHeader' === $this->data->name) {
$extendsClassName = 'AbstractRequestHeader';
} elseif ('ResponseHeader' === $this->data->name) {
$extendsClassName = 'AbstractResponseHeader';
} else {
throw new \InvalidArgumentException(sprintf('Invalid name %s', $this->data->name));
}
$constructMethod .= <<<CODE
public function getFlexibleVersions(): array
{
return {$flexibleVersionsStr};
}
CODE;
break;
case 'struct':
$extendsClassName = 'AbstractStruct';
$constructMethod .= <<<CODE
public function getFlexibleVersions(): array
{
return {$flexibleVersionsStr};
}
CODE;
break;
default:
throw new \InvalidArgumentException(sprintf('Invalid type %s', $this->data->type));
}
$classContent = <<<CODE
<?php
declare(strict_types=1);
namespace longlang\phpkafka\Protocol\\{$this->apiName};
use longlang\phpkafka\Protocol\\{$extendsClassName};
use longlang\phpkafka\Protocol\ProtocolField;
class {$className} extends {$extendsClassName}
{
{$classProperties}
{$constructMethod}
{$methods}
}
CODE;
$this->save($classContent);
}
public function generateCommonStructs(): void
{
if (!isset($this->data->commonStructs)) {
return;
}
foreach ($this->data->commonStructs as $struct) {
$this->generateStruct($struct->name, $struct);
}
}
public function hasGenerated(string $type): bool
{
return isset($this->generatedTypes[$type]);
}
public function generateStruct(string $type, \stdClass $field): void
{
$generator = new SubStructGenerator($this, $field);
$generator->generate();
$this->generatedTypes[$type] = true;
}
protected function parseApiName(\stdClass $data): string
{
$matches = null;
if (preg_match('/^(.+)(Request|Response|Struct|(?<header>Header))$/', $data->name, $matches) <= 0) {
throw new \RuntimeException(sprintf('Invalid name %s', $data->name));
}
$header = $matches['header'] ?? '';
if ('' !== $header) {
$this->isHeader = true;
}
return $matches[1] . $header;
}
}
| 24.193237 | 145 | 0.57508 |
eb563132dd0775fadbf844a70fe2ffe95c87662c | 796 | kt | Kotlin | src/test/kotlin/com/senacor/ci/simpleprovider/search/SearchServiceTest.kt | gonzo12/simple-provider | 1f69523b239baa170ee60c6fa229f1f8cd0e3d89 | [
"MIT"
] | null | null | null | src/test/kotlin/com/senacor/ci/simpleprovider/search/SearchServiceTest.kt | gonzo12/simple-provider | 1f69523b239baa170ee60c6fa229f1f8cd0e3d89 | [
"MIT"
] | null | null | null | src/test/kotlin/com/senacor/ci/simpleprovider/search/SearchServiceTest.kt | gonzo12/simple-provider | 1f69523b239baa170ee60c6fa229f1f8cd0e3d89 | [
"MIT"
] | 1 | 2021-04-16T08:41:38.000Z | 2021-04-16T08:41:38.000Z | package com.senacor.ci.simpleprovider.search
import org.junit.jupiter.api.Assertions.assertEquals
import org.junit.jupiter.api.Assertions.assertNotNull
import org.junit.jupiter.api.BeforeEach
import org.junit.jupiter.api.Test
import org.junit.jupiter.api.extension.ExtendWith
import org.mockito.junit.jupiter.MockitoExtension
@ExtendWith(MockitoExtension::class)
internal class SearchServiceTest {
lateinit var subject: SearchService
@BeforeEach
fun setup() {
subject = SearchService()
}
@Test
fun `search without name param finds 3 items`() {
assertNotNull(subject.search())
assertEquals(3, subject.search().size)
}
@Test
fun `search with name param finds 1 item`() {
assertEquals(1, subject.search("screw").size)
}
} | 26.533333 | 53 | 0.726131 |
a18b548c9cf3dc0809134ddc06b894a0bdefdcf0 | 5,822 | ts | TypeScript | projects/fsastorefrontlib/src/cms-components/my-account/inbox/inbox-tab/inbox-messages/inbox-messages.component.ts | SebastianWolf-SAP/spartacus-financial-services-accelerator | 4f45994d5627c040d5a6d7ab0b6c34b3fa672c44 | [
"Apache-2.0"
] | 1 | 2020-12-17T16:05:28.000Z | 2020-12-17T16:05:28.000Z | projects/fsastorefrontlib/src/cms-components/my-account/inbox/inbox-tab/inbox-messages/inbox-messages.component.ts | SebastianWolf-SAP/spartacus-financial-services-accelerator | 4f45994d5627c040d5a6d7ab0b6c34b3fa672c44 | [
"Apache-2.0"
] | 300 | 2020-12-08T12:31:43.000Z | 2022-03-29T09:29:03.000Z | projects/fsastorefrontlib/src/cms-components/my-account/inbox/inbox-tab/inbox-messages/inbox-messages.component.ts | SebastianWolf-SAP/spartacus-financial-services-accelerator | 4f45994d5627c040d5a6d7ab0b6c34b3fa672c44 | [
"Apache-2.0"
] | 2 | 2021-08-20T07:20:48.000Z | 2022-02-27T09:09:56.000Z | import {
ChangeDetectionStrategy,
Component,
Input,
OnDestroy,
OnInit,
} from '@angular/core';
import { PaginationModel } from '@spartacus/core';
import { Observable, Subscription } from 'rxjs';
import { filter, map, tap } from 'rxjs/operators';
import { InboxService } from '../../../../../core/my-account/facade/inbox.service';
import {
FSSearchConfig,
InboxMessage,
} from '../../../../../core/my-account/services/inbox-data.service';
@Component({
selector: 'cx-fs-inbox-messages',
templateUrl: './inbox-messages.component.html',
changeDetection: ChangeDetectionStrategy.OnPush,
})
export class InboxMessagesComponent implements OnInit, OnDestroy {
constructor(protected inboxService: InboxService) {}
private subscription: Subscription = new Subscription();
messagesObject$: Observable<any>;
messageGroup: string;
pagination: PaginationModel;
searchConfig: FSSearchConfig = {
currentPage: 0,
};
loadedMessages: InboxMessage[] = [];
envelopState = false;
mainCheckboxChecked = false;
@Input() initialGroup: string;
@Input() mobileTabs: string[];
@Input() mobileInitialTab: string;
mobileGroupTitle: string;
displayMobileGroups = false;
activeTabIndex = 0;
defaultSortOrder = 'desc';
ghostData: any;
ngOnInit() {
this.messageGroup = 'generalMessageGroup';
this.loadCurrentMessageGroup();
this.messagesObject$ = this.inboxService.messages;
}
loadCurrentMessageGroup() {
this.subscription.add(
this.inboxService.activeMessageGroupAndTitle
.pipe(
map(group => {
if (
group &&
group.messageGroup &&
group.messageGroup !== this.messageGroup
) {
this.clearSearchData();
}
this.mainCheckboxChecked = false;
this.loadedMessages = null;
this.messageGroup =
group && group.messageGroup
? group.messageGroup
: this.initialGroup;
this.mobileGroupTitle =
group && group.title ? group.title : this.mobileInitialTab;
this.getMessages();
})
)
.subscribe()
);
}
getMessages() {
const newMessageList = [];
this.subscription.add(
this.inboxService
.getMessages(this.messageGroup, this.searchConfig)
.pipe(
tap(response => {
this.ghostData = response;
this.inboxService.messagesSource.next(false);
}),
filter(response => !response.values),
map(response => {
this.pagination = {
currentPage: response.pagination.page,
pageSize: response.pagination.count,
totalPages: response.pagination.totalPages,
totalResults: response.pagination.totalCount,
};
this.inboxService.messagesSource.next(response);
if (response.sorts.length > 0 && response.pagination) {
this.searchConfig.currentPage = response.pagination.page;
this.searchConfig.sortCode = response.sorts[0].code;
this.searchConfig.sortOrder =
response.sorts[0].asc === true ? 'asc' : 'desc';
}
response.messages.forEach(message => {
newMessageList.push(this.buildDisplayMessage(message));
});
this.loadedMessages = newMessageList;
})
)
.subscribe()
);
}
readMessage(message: InboxMessage) {
this.loadedMessages.forEach(msg => {
if (!msg.read && msg.uid === message.uid) {
msg.read = true;
this.subscription.add(
this.inboxService
.setMessagesState([msg.uid], true)
.pipe(tap(() => this.inboxService.setUnreadMessageState(msg.read)))
.subscribe()
);
}
});
}
pageChange(pageNumber: number) {
this.mainCheckboxChecked = false;
this.searchConfig.currentPage = pageNumber;
this.loadCurrentMessageGroup();
}
clearSearchData() {
this.searchConfig.currentPage = 0;
}
checkMessage(messageUid: string, checked: boolean) {
if (!checked) {
this.mainCheckboxChecked = false;
}
this.loadedMessages.forEach(message => {
if (message.uid === messageUid) {
message.checked = checked;
}
});
}
checkAllCheckboxes(checked: boolean) {
this.mainCheckboxChecked = !this.mainCheckboxChecked;
this.loadedMessages.forEach(message => {
message.checked = checked;
});
}
changeSelectedMessages(toRead: boolean) {
this.envelopState = !this.envelopState;
const selectedMessages = this.loadedMessages
.filter(message => message.checked)
.map(message => {
message.read = toRead;
message.opened = false;
return message.uid;
});
if (selectedMessages.length > 0) {
this.subscription.add(
this.inboxService
.setMessagesState(selectedMessages, toRead)
.pipe(tap(() => this.inboxService.setUnreadMessageState(true)))
.subscribe()
);
}
}
sortMessages(sortCode, sortOrder) {
this.searchConfig.sortCode = sortCode;
this.searchConfig.sortOrder = sortOrder;
this.getMessages();
}
buildDisplayMessage(message: any): InboxMessage {
return {
uid: message.uid,
subject: message.subject,
body: message.body,
richContent: message.richContent,
sentDate: message.sentDate,
documents: message.documents,
read: message.readDate != null ? true : false,
checked: false,
opened: false,
};
}
ngOnDestroy() {
this.inboxService.setTitleAndMessageGroup(null, null);
if (this.subscription) {
this.subscription.unsubscribe();
}
}
}
| 28.539216 | 83 | 0.614565 |
464957d168974f21e3574b3ced64a13281dda05d | 1,826 | php | PHP | resources/lang/it/admin/users/general.php | jorgedsilva/snipe-it-master | 70d5baf0cc7ab2122013200591fde0bba55f4db5 | [
"Apache-2.0"
] | null | null | null | resources/lang/it/admin/users/general.php | jorgedsilva/snipe-it-master | 70d5baf0cc7ab2122013200591fde0bba55f4db5 | [
"Apache-2.0"
] | null | null | null | resources/lang/it/admin/users/general.php | jorgedsilva/snipe-it-master | 70d5baf0cc7ab2122013200591fde0bba55f4db5 | [
"Apache-2.0"
] | null | null | null | <?php
return array(
'activated_help_text' => 'Questo utente può effettuare il login',
'activated_disabled_help_text' => 'Non puoi modificare lo stato di attivazione del proprio account.',
'assets_user' => 'Bene assegnato a :name',
'bulk_update_warn' => 'Stai per modificare le proprietà di: user_count users. Tieni presente che non puoi modificare i tuoi attributi utente utilizzando questo modulo e devi modificare individualmente il tuo utente.',
'bulk_update_help' => 'Questo modulo consente di aggiornare più utenti contemporaneamente. Inserisci solo i campi che devi modificare. Tutti i campi lasciati vuoti rimarranno invariati.',
'current_assets' => 'Asset assegnato a questo utente',
'clone' => 'Clona Utente',
'contact_user' => 'Contatta :name',
'edit' => 'Modifica Utente',
'filetype_info' => 'I formati di file permessi sono png, gif, jpg, jpeg, doc, docx, pdf, txt, zip, e rar.',
'history_user' => 'Storico per :name',
'info' => 'Informazioni',
'restore_user' => 'Clicca qui per ripristinarli.',
'last_login' => 'Ultimo accesso',
'ldap_config_text' => 'Le impostazioni di configurazione di LDAP possono essere trovate su Admin > Impostazioni. La posizione selezionata (facoltativa) verrà impostata per tutti gli utenti importati.',
'print_assigned' => 'Stampa tutti assegnati',
'software_user' => 'Software estratto a :name',
'view_user' => 'Visualizza Utente :name',
'usercsv' => 'CSV file',
'two_factor_admin_optin_help' => 'Le impostazioni correnti di amministratore consentono l\'esecuzione selettiva dell\'autenticazione a due fattori.',
'two_factor_enrolled' => 'Apparecchio 2FA iscritto',
'two_factor_active' => '2FA attivo',
);
| 65.214286 | 221 | 0.682913 |
1448b1f0b058b4f0f3a2ae270c8ca15b774f7849 | 372 | swift | Swift | Tests/Modules/Foo/FooAssembly.swift | locationlabs/Cobra | b60e8f6fd842e71acecb822694fd3a7d70948097 | [
"Apache-2.0"
] | 12 | 2016-10-12T04:16:18.000Z | 2019-11-01T15:24:02.000Z | Tests/Modules/Foo/FooAssembly.swift | locationlabs/Cobra | b60e8f6fd842e71acecb822694fd3a7d70948097 | [
"Apache-2.0"
] | null | null | null | Tests/Modules/Foo/FooAssembly.swift | locationlabs/Cobra | b60e8f6fd842e71acecb822694fd3a7d70948097 | [
"Apache-2.0"
] | 5 | 2016-12-17T00:51:15.000Z | 2021-09-08T09:33:33.000Z | import Swinject
import Cobra
class FooAssembly: Constructible {
required init() {}
}
// MARK: - AssemblyType
extension FooAssembly: Assembly {
func assemble(container: Container) {
// feature
container.register(FooFeatureType.self) { _ in
return FooFeature()
}
}
func loaded(resolver: Resolver) {
}
}
| 15.5 | 54 | 0.610215 |
9fd42b97c34b13a93659d6be724c9aa1ca2315f7 | 161 | py | Python | piccolo/apps/asgi/piccolo_app.py | coder3112/piccolo | f5f72c6b24782f1b6e04c31549654cd27fd3a148 | [
"MIT"
] | null | null | null | piccolo/apps/asgi/piccolo_app.py | coder3112/piccolo | f5f72c6b24782f1b6e04c31549654cd27fd3a148 | [
"MIT"
] | null | null | null | piccolo/apps/asgi/piccolo_app.py | coder3112/piccolo | f5f72c6b24782f1b6e04c31549654cd27fd3a148 | [
"MIT"
] | null | null | null | from piccolo.conf.apps import AppConfig
from .commands.new import new
APP_CONFIG = AppConfig(
app_name="asgi", migrations_folder_path="", commands=[new]
)
| 20.125 | 62 | 0.757764 |
9c531e517f94e4b7e458f8adf44a89c21b71c5e0 | 17 | sh | Shell | tests/fixtures/shellcheck-tests/single-quoted6/source.sh | corwin-of-amber/js-shell-parse | dfe52a305e2329248aa7452cbfedf931b8d0a933 | [
"MIT"
] | 60 | 2015-03-28T02:06:18.000Z | 2022-03-28T17:30:59.000Z | tests/fixtures/shellcheck-tests/single-quoted6/source.sh | corwin-of-amber/js-shell-parse | dfe52a305e2329248aa7452cbfedf931b8d0a933 | [
"MIT"
] | 11 | 2015-12-30T00:06:17.000Z | 2017-07-11T00:10:28.000Z | tests/fixtures/shellcheck-tests/single-quoted6/source.sh | corwin-of-amber/js-shell-parse | dfe52a305e2329248aa7452cbfedf931b8d0a933 | [
"MIT"
] | 13 | 2015-03-14T22:04:54.000Z | 2021-11-29T11:42:26.000Z | foo='bar cow 'arg | 17 | 17 | 0.705882 |
6b2b0e84a07a935cfdfa52800d303638fc61caf3 | 19,901 | js | JavaScript | src/chart/bar.js | gec/d3-traits | 32d41969bbb55d8418f330d21ac72692cd8ed25d | [
"Apache-2.0"
] | 2 | 2015-02-10T16:26:12.000Z | 2016-01-04T14:59:17.000Z | src/chart/bar.js | gec/d3-traits | 32d41969bbb55d8418f330d21ac72692cd8ed25d | [
"Apache-2.0"
] | null | null | null | src/chart/bar.js | gec/d3-traits | 32d41969bbb55d8418f330d21ac72692cd8ed25d | [
"Apache-2.0"
] | null | null | null | /**
* Copyright 2013 Green Energy Corp.
*
* Licensed to Green Energy Corp (www.greenenergycorp.com) under one or more
* contributor license agreements. See the NOTICE file distributed with this
* work for additional information regarding copyright ownership. Green Energy
* Corp licenses this file to you under the Apache License, Version 2.0 (the
* "License"); you may not use this file except in compliance with the License.
* You may obtain a copy of the License at
*
* http://www.apache.org/licenses/LICENSE-2.0
*
* Unless required by applicable law or agreed to in writing, software
* distributed under the License is distributed on an "AS IS" BASIS, WITHOUT
* WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the
* License for the specific language governing permissions and limitations under
* the License.
*
* Author: Flint O'Brien
*/
(function(d3, trait) {
var debug = false
var INSETS_NONE = 'none', // Don't adjust insets
INSETS_EXTEND_DOMAIN = 'extend-domain', // Extend the domain extents so bars are completely visible
INSETS_INSET_RANGE = 'inset-range' // Inset the scales range so bars are completely visible
/**
* @param config
* @param scale - The x-scale. If the scale is ordinal with rangeBand, then justification is left by default.
* @returns { width:, gap:, justification, insets:, stacked:}
*/
function barConfig(config, scale) {
if( config.stacked === 'true')
console.error( 'chart.bar config stacked:\'true\' should not have quotes. Ignored.')
var justification = config.justification !== undefined ? config.justification
: scale !== null && typeof scale === 'function' && scale.rangeBand ? 'left'
: 'center',
defaultGap = scale.rangeBand ? 0 : 0.1,
gap = d3.trait.utils.configFloat(config.gap, defaultGap),
outerGap = d3.trait.utils.configFloat(config.outerGap, gap),
c = {
width: config.width || 'auto',
// gap is percentage of bar width (0-1)
gap: gap,
// outerGap can be 0 to greater than 1
outerGap: outerGap,
justification: justification,
//insets: 'none' 'extend-domain', 'inset-range', {top: 0, right: 0, bottom: 0, left: 0}
insets: config.insets || INSETS_INSET_RANGE,
stacked: config.stacked === true
}
return c
}
/**
*
* Domain Range
* 5 +----------- 0
* 4 1
* 3 y ___ 2
* 2 |***| 3
* 1 |***| 4
* 0 y0 +-----------+ 5 chartHeight
* -1 |***| y0 6
* -2 |***| 7
* -3 --- y 8 chartHeight
*
* y = y < 0 ? y0 : y same as Math.max( y, y0)
* h = y(0) - y( abs(y-y0))
*
* @param access
* @param barDimensions
* @param chartHeight
* @param x1
* @param y
* @returns {{x: x, y: y, width: *, height: height}}
*/
function barAttr(access, barDimensions, chartHeight, x1, y, stacked) {
// NOTE: for transition from enter, use y(0) for y: and height:
// x is middle of bar.
// y is top of bar. Remember, the scale range is flipped for y.
// height - chartHeight - y OR y0 - y for stacked.
function xxx( d, i) {
return x1(access.x(d,i)) + barDimensions.offset;
}
function getY( d, i) {
return y(access.y(d,i))
}
function getYStacked( d, i) {
var yValue = access.y(d,i)
return yValue >= 0 ? y(d.y0 + yValue) : y(d.y0)
}
function getHeight( d, i) {
return y(0) - y( Math.abs(access.y(d,i)))
}
function getHeightStacked( d, i) {
return Math.abs(y(d.y0) - y(d.y0 + access.y(d,i)))
}
// For pos/neg bars:
// x - same
// y - pos: same. neg:
//
return {
x: xxx, //function(d,i) { return x1(access.x(d,i)) + barDimensions.offset; },
y: stacked ? getYStacked : getY,
width: barDimensions.width,
height: stacked ? getHeightStacked : getHeight
// height: function(d) { return chartHeight - y( Math.abs( access.y(d,i))); }
}
}
function barOffsetForJustification(justification, width, gap) {
var offset = 0
switch( justification ) {
case 'left':
offset = Math.round(gap / 2);
break;
case 'right':
offset = Math.round(0 - width - gap / 2);
break;
default:
// center
offset = 0 - Math.round(width / 2);
break;
}
return offset
}
function rangeExtentOfBarsAndOuterGapForOneSeries(data, indicesExtent, accessor, scale, width, gap, outerGap, justification) {
var i, minValue, maxValue,
offsetLeft = barOffsetForJustification(justification, width, gap) - outerGap,
offsetRight = barOffsetForJustification(justification, width, gap) + width + outerGap
if( !indicesExtent )
return scale.range()
i = indicesExtent[0]
minValue = scale(accessor(data[i], i)) + offsetLeft
i = indicesExtent[1]
maxValue = scale(accessor(data[i], i)) + offsetRight
return [Math.floor(minValue), Math.ceil(maxValue)]
}
function rangeExtentOfBarsAndOuterGap(filteredData, indicesExtents, seriesData, accessor, scale, barWidth, gap, outerGap, justification) {
var rangeExtents = filteredData.map(function(s, i) { return rangeExtentOfBarsAndOuterGapForOneSeries(seriesData(s), indicesExtents[i], accessor, scale, barWidth, gap, outerGap, justification) })
var min = d3.min(rangeExtents, function(extent, i) { return extent[0]})
var max = d3.min(rangeExtents, function(extent, i) { return extent[1]})
return [min, max]
}
/**
* Handle pathological case where outer bars are centered on scale extents (so half off chart).
*
* Original inset-range extend-domain
* | | | | | |
* _|_ _|_ | ___ ___ | | ___ ___ |
* |*|*| |*|*| | |***| |***| | | |***| |***| |
* +-----+ ---+-----+--- +----+-----+----+
* 1 2 1 2 0 1 2 3
*
* Calculate the first and last bar outer edges plus a nice "inset" and scale that down
* to fit in the pixels available (current range).
*/
function getBarDimensions(filteredData, accessSeriesData, accessor, c, scale, chartWidth) {
// minimum scale distance between any two adjacent bars visible within the current domain.
var width,
minRangeMargin = null,
domainExtent = null,
gap = 0,
outerGap = 0
if( scale.rangeBand ) {
width = c.width === 'auto' ? scale.rangeBand() : c.width
if( debug)
console.log( 'getBarDimmensions scale.rangeBand width ' + width + ', domain ' + JSON.stringify(scale.domain()) + ', range ' + JSON.stringify(scale.range()))
// gap isn't known with range bands
} else {
var scaleDomain = scale.domain(),
// Find the data indices (across all series) for what's visible with current domain.
indicesExtents = filteredData.map(function(s) { return trait.chart.utils.dataIndicesExtentForDomainExtent(accessSeriesData(s), accessor, scaleDomain) }),
// Get the minimum distance between bar centers across all data in all series
minDistanceX = d3.min(filteredData, function(s, i) { return trait.chart.utils.minDistanceBetween(accessSeriesData(s), indicesExtents[i], accessor, scale) })
width = c.width === 'auto' ? Math.max(1, Math.floor(minDistanceX * (1 - c.gap))) : c.width
gap = Math.round(width * c.gap)
outerGap = Math.floor(width * c.outerGap)
// Get the minimun distance between bar centers across all data in all series
var rangeExtent = rangeExtentOfBarsAndOuterGap(filteredData, indicesExtents, accessSeriesData, accessor, scale, width, gap, outerGap, c.justification),
min = rangeExtent[0],
max = rangeExtent[1]
//console.log( "minDistanceX: " + minDistanceX + " width: " + width + " rangeExtent: " + rangeExtent)
if( min < 0 || max > chartWidth ) {
if( c.insets === INSETS_INSET_RANGE ) {
// Careful, one bar may be within chart and one bar off chart.
var totalWidth = Math.max(max, chartWidth) - Math.min(0, min),
scaleItDown = chartWidth / totalWidth
if( c.width === 'auto' ) {
width = Math.max(1, Math.floor(width * scaleItDown))
gap = Math.round(width * c.gap)
outerGap = Math.floor(width * c.outerGap)
}
if( c.insets === INSETS_INSET_RANGE ) {
rangeExtent = rangeExtentOfBarsAndOuterGap(filteredData, indicesExtents, accessSeriesData, accessor, scale, width, gap, outerGap, c.justification)
min = rangeExtent[0]
max = rangeExtent[1]
if( min < 0 || max > chartWidth ) {
minRangeMargin = {}
if( min < 0 )
minRangeMargin.left = 1 - min
if( max > chartWidth )
minRangeMargin.right = max - chartWidth
}
}
} else if( c.insets === INSETS_EXTEND_DOMAIN ) {
var domainMin = min < 0 ? scale.invert(min) : scaleDomain[0] ,
domainMax = max > chartWidth ? scale.invert(max) : scaleDomain[ scaleDomain.length - 1]
domainExtent = [domainMin, domainMax]
}
}
}
var offset = barOffsetForJustification(c.justification, width, gap)
//console.log( "barDimensions: width, gap, offset: " + width + ", " + gap + ", " + offset)
return {
width: width,
gap: gap,
outerGap: outerGap,
offset: offset,
domainExtent: domainExtent,
minRangeMargin: minRangeMargin
}
}
// Modified from http://bl.ocks.org/micahstubbs/a40254b6cb914018ff81
function stackLayoutPositiveAndNegativeValues(data, access) {
var di = access.seriesData(data[0]).length
while (di--) {
var d, si, y,
length = data.length,
positiveBase = 0,
negativeBase = 0
for( si = 0; si < length; si++) {
d = access.seriesData(data[si])
d = d[di]
y = access.y(d)
d.size = Math.abs(y)
if (y < 0) {
d.y0 = negativeBase
negativeBase -= d.size
} else
{
d.y0 = positiveBase
positiveBase += d.size
}
}
}
data.extent = d3.extent(
d3.merge(
d3.merge(
data.map(function(e) {
return access.seriesData(e).map(function(f) { return [f.y0,f.y0+f.size] })
})
)
)
)
}
/**
*
* Example Bar Chart Configurations
*
* ONE TWO THREE FOUR FIVE
* Linear Axis Linear Axis Ordinal Axis Ordinal Axis Ordinal Grouped
* Tick centered Tick centered Tick centered Tick left Tick left
* x(0) == 0 x(0) > 0
* 0 label No 0 label Label left
* scale != data Scale == data
* _________ _________ _________ _________ _______________
* | _ | | _ | | _ | | _ | | _ _ |
* | _ |*| | | _ |*| | | _ |*| | | _ |*| | | _ |~| |*| _ |
* | |*| |*| | | |*| |*| | | |*| |*| | | |*| |*| | | |*||~| |*||~| |
* +--+---+--+ --+---+-- --+---+-- -+---+--- -+------+------+
* 0 1 2 3 1 2 A B A B A B
*
* ONE
* Linear axis with scala extents outside of data min/max.
* Auto bar width based on min data distance
* Auto extents based on domain extent and bar width. I.e. Don't want have of the first bar off the chart.
*
* TWO
* Linear axis with scale extents equal to data min/max.
* Auto inset for axis so x(1) is not left edge of chart
* No axis labels outside of data domain. noAxisLabelsOnExtents.
*
* insets: 'none' 'extend-domain', 'inset-range', {top: 0, right: 0, bottom: 0, left: 0}
* justification: centered, right or left
*
* THREE & FOUR
* Oridnal axis with ticks centered or left.
*
* @param _super
* @param _config
* @returns {chartBar}
* @private
*/
function _chartBar(_super, _config) {
// Store the group element here so we can have multiple bar charts in one chart.
// A second "bar chart" might have a different y-axis, style or orientation.
var group, series, filteredData, bars, barDimensions, lastDomainMax, // stackLayout,
axes = trait.config.axes( _config),
access = trait.config.accessorsXY( _config, axes),
x1 = _super[axes.x](),
y = _super[axes.y](),
yExtendDomainKey = axes.y + 'ExtendDomain',
dispatch = d3.dispatch('customHover'),
c = barConfig(_config, x1),
focusConfig = d3.trait.focus.utils.makeConfig(_config),
x1IsRangeBand = typeof x1.rangeBand === "function",
seriesFilter = _config.seriesFilter ? function( s) {return s.filter(_config.seriesFilter)} : function( s) { return s}
//if( c.stacked) {
// stackLayout = d3.layout.stack()
// .values( access.seriesData)
// .x( access.x)
// .y( access.y)
//}
function chartBar(_selection) {
var self = chartBar
_selection.each(function(_data) {
var element = this,
chartWidth = _super.chartWidth()
if( debug)
console.log( 'chartBar._selection.each begin -------------------------------')
filteredData = seriesFilter(_data)
barDimensions = getBarDimensions(filteredData, access.seriesData, access.x, c, x1, chartWidth)
if( barDimensions.minRangeMargin || barDimensions.domainExtent ) {
if( barDimensions.minRangeMargin ) {
self.minRangeMargin('x1', barDimensions.minRangeMargin)
} else if( barDimensions.domainExtent ) {
_super.x1Domain(barDimensions.domainExtent)
}
barDimensions = getBarDimensions(filteredData, access.seriesData, access.x, c, x1, chartWidth)
}
if( !group ) {
var classes = _config.chartClass ? "chart-bar " + _config.chartClass : 'chart-bar'
group = this._chartGroup.append('g').classed(classes, true);
}
if(c.stacked)
stackLayoutPositiveAndNegativeValues( filteredData, access)
// DATA JOIN
series = group.selectAll(".series")
.data(filteredData)
{
// UPDATE
// ENTER
series.enter()
.append("g")
.attr("class", "series")
.style("fill", self.color);
}
// DATA JOIN
bars = series.selectAll("rect")
.data(access.seriesData)
function barColorFromSeries( d, i, seriesIndex) {
return self.color( filteredData[seriesIndex])
}
// ENTER
bars.enter().append('rect')
.classed('bar', true)
.attr(barAttr(access, barDimensions, self.chartHeight(), x1, y, c.stacked))
.style("fill", barColorFromSeries)
.on('mouseover', dispatch.customHover);
// UPDATE
bars.transition()
.duration(0).delay(0).ease(self.ease())
.attr(barAttr(access, barDimensions, self.chartHeight(), x1, y, c.stacked));
// EXIT
bars.exit()
.transition()
.style({opacity: 0})
.remove();
lastDomainMax = d3.trait.utils.extentMax(x1.domain())
})
}
/**
* When called from selection.each it passes us data. When called from .update, we
* use our previous data.
*
* @param domain {[]} The current domain extent from the scale
* @param data {[]} The data series or undefined.
* @returns {Array}
*/
chartBar[yExtendDomainKey] = function( domain, data) {
var extent,
methodName = 'chartArea.' + yExtendDomainKey
domain = this._super( domain, data)
if( debug) console.log( methodName + ': begin')
if( data)
filteredData = seriesFilter( data)
if( filteredData.length === 0)
return domain
if( c.stacked) {
if( debug) console.log( methodName + ': before stackLayout')
stackLayoutPositiveAndNegativeValues( filteredData, access)
extent = filteredData.extent
} else {
if( debug) console.log( methodName + ' unstacked : before extentFromData')
extent = trait.utils.extentFromData(filteredData, access, 0, domain)
}
if( trait.utils.isExtentExtended( domain, extent)) {
domain = trait.utils.extendExtent( domain, extent)
if( debug)
console.log( methodName + ' updated domain:' + domain)
}
return domain
}
chartBar.update = function(type, duration) {
this._super(type, duration)
if( debug)
console.log( 'chartBar.update begin ++++++++++++++++++++++++++++++++')
var chartWidth = _super.chartWidth()
// TODO: The x1.range() needs to be wider, so we draw the new line off the right
// then translate it to the left with a transition animation.
if( debug)
console.log( 'chartBar.update x1.domain ' + JSON.stringify(x1.domain()) + ', range ' + JSON.stringify(x1.range()))
var domainMax = d3.trait.utils.extentMax(x1.domain())
var translateX = lastDomainMax !== undefined && domainMax !== undefined ? x1(lastDomainMax) - x1(domainMax) : 0
// I don't think we need this because chartBar[yExtendDomainKey] calls stackLayout..
//stackLayoutPositiveAndNegativeValues( filteredData, access)
barDimensions = getBarDimensions(filteredData, access.seriesData, access.x, c, x1, chartWidth)
// redraw the line and no transform
series.attr("transform", null)
bars = series.selectAll("rect")
.data(access.seriesData)
// UPDATE
bars.attr(barAttr(access, barDimensions, _super.chartHeight(), x1, y, c.stacked));
// ENTER
bars.enter().append('rect')
.classed('bar', true)
.attr(barAttr(access, barDimensions, _super.chartHeight(), x1, y, c.stacked))
bars.exit()
.transition().duration(duration)
.style({opacity: 0})
.remove();
// slide the bars left
if( duration === 0 ) {
series.attr("transform", "translate(" + translateX + ")")
} else {
series.transition()
.duration(duration || _super.duration())
.ease("linear")
.attr("transform", "translate(" + translateX + ")")
//.each("end", tick);
}
lastDomainMax = d3.trait.utils.extentMax(x1.domain())
// Could pop the data off the front (off the left side of chart)
return this;
};
chartBar.getFocusItems = function(focusPoint) {
var foci = this._super(focusPoint),
myFoci = trait.focus.utils.getFocusItems( filteredData, focusPoint, focusConfig, access, x1, y, chartBar.color, c.stacked)
foci = foci.concat( myFoci)
return foci
}
d3.rebind(chartBar, dispatch, 'on');
// _super.onRangeMarginChanged( 'chartBar', chartBar)
return chartBar;
}
trait.chart.bar = _chartBar
trait.chart.barUtils = {
barConfig: barConfig,
barAttr: barAttr,
barOffsetForJustification: barOffsetForJustification,
rangeExtentOfBarsAndOuterGapForOneSeries: rangeExtentOfBarsAndOuterGapForOneSeries,
rangeExtentOfBarsAndOuterGap: rangeExtentOfBarsAndOuterGap,
getBarDimensions: getBarDimensions
}
}(d3, d3.trait));
| 35.793165 | 198 | 0.577207 |
b7332285abed8567e5bc8f7b99b90db387413c24 | 3,040 | sql | SQL | src/test/regress/sql/skew_statistic_single_col.sql | opengauss-mirror/openGauss-graph | 6beb138fd00abdbfddc999919f90371522118008 | [
"MulanPSL-1.0"
] | 360 | 2020-06-30T14:47:34.000Z | 2022-03-31T15:21:53.000Z | src/test/regress/sql/skew_statistic_single_col.sql | opengauss-mirror/openGauss-graph | 6beb138fd00abdbfddc999919f90371522118008 | [
"MulanPSL-1.0"
] | 4 | 2020-06-30T15:09:16.000Z | 2020-07-14T06:20:03.000Z | src/test/regress/sql/skew_statistic_single_col.sql | opengauss-mirror/openGauss-graph | 6beb138fd00abdbfddc999919f90371522118008 | [
"MulanPSL-1.0"
] | 133 | 2020-06-30T14:47:36.000Z | 2022-03-25T15:29:00.000Z | /*
################################################################################
# TESTCASE NAME : skew_statistic_single_col.py
# COMPONENT(S) : 测试单列分布键的倾斜场景
# PREREQUISITE : skew_hint_setup.py
# PLATFORM : all
# DESCRIPTION : single col's skew
# TAG : single col
# TC LEVEL : Level 1
################################################################################
*/
--I1.设置guc参数
set current_schema to skew_join;
--S1.skew_option=normal
set skew_option=normal;
--S2.设置计划格式
set explain_perf_mode=normal;
--S3.设置计划生成参数
set enable_broadcast = off;
--S4.设置计划生成参数
set enable_mergejoin = off;
--S5.设置计划生成参数
set enable_nestloop = off;
set query_dop = 1002;
--I2.单列重分布，单值倾斜
--S1.执行计划
explain (costs off) select count(*) from skew_scol s, test_scol t where s.b = t.b;
--S2.执行查询
select count(*) from skew_scol s, test_scol t where s.b = t.b;
--I3.单列重分布，基表有NULL值
--S1.执行计划
explain (costs off) select count(*) from skew_scol s, test_scol t where s.c = t.c;
--S2.执行查询
select count(*) from skew_scol s, test_scol t where s.c = t.c;
--I4.单列重分布，倾斜列带有过滤条件
--S1.执行计划，简单表达式，倾斜值被过滤
explain (costs off) select count(*) from skew_scol s, test_scol t where s.b = t.b and s.b > 1;
--S2.执行计划，简单表达式，倾斜值被过滤
explain (costs off) select count(*) from skew_scol s, test_scol t where s.b = t.b and s.b != 1;
--S3.执行计划，简单表达式，倾斜值不被过滤
explain (costs off) select count(*) from skew_scol s, test_scol t where s.b = t.b and s.b < 100;
--S4.执行计划，简单表达式，倾斜值不被过滤
explain (costs off) select count(*) from skew_scol s, test_scol t where s.b = t.b and s.b + 50 > 10;
--S5.执行计划，复杂表达式，倾斜值被过滤
explain (costs off) select count(*) from skew_scol s, test_scol t where s.b = t.b and sqrt(s.b) > 1;
--S6.执行计划，复杂表达式，倾斜值不被过滤
explain (costs off) select count(*) from skew_scol s, test_scol t where s.b = t.b and sqrt(s.b) < 10;
--S7.执行计划，多列表达式，倾斜值不一定被过滤
explain (costs off) select count(*) from skew_scol s, test_scol t where s.b = t.b and s.a + s.b > 1;
--I5.单列重分布，其他列带有过滤条件
--S1.设置保守策略，其他列带有简单表达式
set skew_option = lazy;
--S2.执行计划
explain (costs off) select count(*) from skew_scol s, test_scol t where s.b = t.b and s.c > 1;
--S3.设置激进策略，其他列带有简单表达式
set skew_option = normal;
--S4.执行计划
explain (costs off) select count(*) from skew_scol s, test_scol t where s.b = t.b and s.c > 1;
--S5.设置保守策略，其他列带有复杂表达式
set skew_option = lazy;
--S6.执行计划
explain (costs off) select count(*) from skew_scol s, test_scol t where s.b = t.b and sqrt(s.c) < 10;
--S7.设置激进策略，其他列带有简单表达式
set skew_option = normal;
--S8.执行计划
explain (costs off) select count(*) from skew_scol s, test_scol t where s.b = t.b and sqrt(s.c) < 10;
--I6.单列重分布，双侧倾斜
--S1.双侧倾斜值不同。执行计划
explain (costs off) select count(*) from skew_scol s, skew_scol1 s1 where s.b = s1.c;
--S2.双侧倾斜值不同，执行查询
select count(*) from skew_scol s, skew_scol1 s1 where s.b = s1.c;
--S1.双侧倾斜值相同。执行计划
explain (costs off) select count(*) from skew_scol s, skew_scol1 s1 where s.b = s1.b;
--S2.双侧倾斜值相同，执行查询
select count(*) from skew_scol s, skew_scol1 s1 where s.b = s1.b;
--I7.删除表数据
drop schema skew_join cascade;
set query_dop = 2002;
| 35.348837 | 101 | 0.667105 |
b5a434f8736623fae39855886d17a8be3037754f | 1,849 | rs | Rust | git-repository/src/easy/ext/object.rs | mellowagain/gitoxide | dc58eca510e5a067acdeaad4b595a34b4598a0cd | [
"Apache-2.0",
"MIT"
] | null | null | null | git-repository/src/easy/ext/object.rs | mellowagain/gitoxide | dc58eca510e5a067acdeaad4b595a34b4598a0cd | [
"Apache-2.0",
"MIT"
] | null | null | null | git-repository/src/easy/ext/object.rs | mellowagain/gitoxide | dc58eca510e5a067acdeaad4b595a34b4598a0cd | [
"Apache-2.0",
"MIT"
] | null | null | null | use std::ops::DerefMut;
use git_hash::ObjectId;
use crate::{
easy,
easy::{object, ObjectRef},
odb::{Find, FindExt},
};
pub fn find_object<A: easy::Access + Sized>(
access: &A,
id: impl Into<ObjectId>,
) -> Result<easy::ObjectRef<'_, A>, object::find::existing::Error> {
let state = access.state();
let id = id.into();
let kind = {
let mut buf = access.state().try_borrow_mut_buf()?;
let obj = access
.repo()?
.odb
.find_existing(&id, &mut buf, state.try_borrow_mut_pack_cache()?.deref_mut())?;
obj.kind
};
ObjectRef::from_current_buf(id, kind, access).map_err(Into::into)
}
pub fn try_find_object<A: easy::Access + Sized>(
access: &A,
id: impl Into<ObjectId>,
) -> Result<Option<easy::ObjectRef<'_, A>>, object::find::Error> {
let state = access.state();
let id = id.into();
access
.repo()?
.odb
.find(
&id,
state.try_borrow_mut_buf()?.deref_mut(),
state.try_borrow_mut_pack_cache()?.deref_mut(),
)?
.map(|obj| {
let kind = obj.kind;
drop(obj);
ObjectRef::from_current_buf(id, kind, access).map_err(Into::into)
})
.transpose()
}
pub trait ObjectAccessExt: easy::Access + Sized {
// NOTE: in order to get the actual kind of object, is must be fully decoded from storage in case of packs
// even though partial decoding is possible for loose objects, it won't matter much here.
fn find_object(&self, id: impl Into<ObjectId>) -> Result<ObjectRef<'_, Self>, object::find::existing::Error> {
find_object(self, id)
}
fn try_find_object(&self, id: impl Into<ObjectId>) -> Result<Option<ObjectRef<'_, Self>>, object::find::Error> {
try_find_object(self, id)
}
}
| 29.822581 | 116 | 0.590049 |
386655752d1c419bca625b804df7856e77b7acf8 | 427 | php | PHP | Pool/IConnection.php | leevels/protocol | f59e37fb8feb369bedbcdacddcbea502a9a0a5fd | [
"MIT"
] | 59 | 2017-09-04T01:09:37.000Z | 2022-03-25T06:57:42.000Z | Pool/IConnection.php | leevels/protocol | f59e37fb8feb369bedbcdacddcbea502a9a0a5fd | [
"MIT"
] | 122 | 2017-05-24T01:15:29.000Z | 2021-11-17T07:54:49.000Z | Pool/IConnection.php | leevels/protocol | f59e37fb8feb369bedbcdacddcbea502a9a0a5fd | [
"MIT"
] | 5 | 2018-01-16T01:56:47.000Z | 2021-11-09T07:13:20.000Z | <?php
declare(strict_types=1);
namespace Leevel\Protocol\Pool;
/**
* 连接池连接驱动接口.
*/
interface IConnection
{
/**
* 归还连接池.
*/
public function release(): void;
/**
* 设置是否归还连接池.
*/
public function setShouldRelease(bool $shouldRelease): void;
/**
* 设置关联连接池.
*/
public function setPool(IPool $pool): void;
/**
* 关闭连接.
*/
public function close(): void;
}
| 13.34375 | 64 | 0.555035 |
678fcd87d3edd51c2f1a48a99ea51306a3bc4b92 | 560 | lua | Lua | app/src/init.lua | Goruti/esp32_lux | 1106b86e798e8ae1410f36734f77a7a54db975e4 | [
"MIT"
] | null | null | null | app/src/init.lua | Goruti/esp32_lux | 1106b86e798e8ae1410f36734f77a7a54db975e4 | [
"MIT"
] | null | null | null | app/src/init.lua | Goruti/esp32_lux | 1106b86e798e8ae1410f36734f77a7a54db975e4 | [
"MIT"
] | 1 | 2021-11-15T01:08:05.000Z | 2021-11-15T01:08:05.000Z | -- ESP32 FW ADDED MODULES: file,http,i2c,net,node,sjson,tmr,wifi
-- Load config & modules
dofile('config.lua')
dofile('wifi.lua')
dofile('server.lua')
dofile('read_lux.lua')
---------------------------
-- Init Device Access Point
--print('access point ready...')
if wifi.getmode() ~= wifi.STATION then
wifi.mode(wifi.STATIONAP, true)
wifi.ap.config(WIFI_AP_CONFIG)
end
wifi.start()
----------------------------
-- init GPIO
gpio.config({gpio={RED_LED, BLUE_LED}, dir=gpio.OUT})
-- init server
server_start()
-- init reading_lux
lux_reading_start() | 22.4 | 65 | 0.642857 |
4d0f5b89168eabdb489f9108a4b4cd49ca81a231 | 1,593 | cs | C# | Ay/ay/SDK/CONTROLLIB/Large/PropertyGrid/Converters/PropertyItemEditorConverter.cs | ay2015/AYUI8 | 1bb32ae9d5a98913b999ae8fcd4fadb6bd9bad45 | [
"MIT"
] | null | null | null | Ay/ay/SDK/CONTROLLIB/Large/PropertyGrid/Converters/PropertyItemEditorConverter.cs | ay2015/AYUI8 | 1bb32ae9d5a98913b999ae8fcd4fadb6bd9bad45 | [
"MIT"
] | null | null | null | Ay/ay/SDK/CONTROLLIB/Large/PropertyGrid/Converters/PropertyItemEditorConverter.cs | ay2015/AYUI8 | 1bb32ae9d5a98913b999ae8fcd4fadb6bd9bad45 | [
"MIT"
] | null | null | null | using System;
using System.Globalization;
using System.Reflection;
using System.Windows;
using System.Windows.Controls.Primitives;
using System.Windows.Data;
namespace Xceed.Wpf.Toolkit.PropertyGrid.Converters
{
public class PropertyItemEditorConverter : IMultiValueConverter
{
public object Convert(object[] values, Type targetType, object parameter, CultureInfo culture)
{
if (values == null || values.Length != 2)
{
return null;
}
object obj = values[0];
bool? flag = values[1] as bool?;
if (obj == null || !flag.HasValue)
{
return obj;
}
Type type = obj.GetType();
PropertyInfo property = type.GetProperty("IsReadOnly");
if (property != null)
{
if (!IsPropertySetLocally(obj, TextBoxBase.IsReadOnlyProperty))
{
property.SetValue(obj, flag, null);
}
}
else
{
PropertyInfo property2 = type.GetProperty("IsEnabled");
if (property2 != null && !IsPropertySetLocally(obj, UIElement.IsEnabledProperty))
{
property2.SetValue(obj, !flag, null);
}
}
return obj;
}
public object[] ConvertBack(object value, Type[] targetTypes, object parameter, CultureInfo culture)
{
throw new NotImplementedException();
}
private bool IsPropertySetLocally(object editor, DependencyProperty dp)
{
if (dp == null)
{
return false;
}
DependencyObject dependencyObject = editor as DependencyObject;
if (dependencyObject == null)
{
return false;
}
return DependencyPropertyHelper.GetValueSource(dependencyObject, dp).BaseValueSource == BaseValueSource.Local;
}
}
}
| 24.890625 | 113 | 0.69366 |
0871d44931864ffd1969e1f28d502b2257ae9711 | 2,469 | swift | Swift | Sources/Cocoa/Components/UIImage/ImageFetcher/CompositeImageFetcher.swift | mstana/xcore.swift | d637b9827b65149968d93cc910059853b62842fb | [
"MIT"
] | null | null | null | Sources/Cocoa/Components/UIImage/ImageFetcher/CompositeImageFetcher.swift | mstana/xcore.swift | d637b9827b65149968d93cc910059853b62842fb | [
"MIT"
] | 1 | 2020-03-02T19:43:19.000Z | 2020-03-02T19:43:19.000Z | Sources/Cocoa/Components/UIImage/ImageFetcher/CompositeImageFetcher.swift | mstana/xcore.swift | d637b9827b65149968d93cc910059853b62842fb | [
"MIT"
] | null | null | null | //
// Xcore
// Copyright © 2018 Xcore
// MIT license, see LICENSE file for details
//
import UIKit
final class CompositeImageFetcher: ImageFetcher, ExpressibleByArrayLiteral {
/// The registered list of fetchers.
private var fetchers: [ImageFetcher] = []
init(_ fetchers: [ImageFetcher]) {
self.fetchers = fetchers
}
init(arrayLiteral elements: ImageFetcher...) {
self.fetchers = elements
}
/// Add given fetcher if it's not already included in the collection.
///
/// - Note: This method ensures there are no duplicate fetchers.
func add(_ fetcher: ImageFetcher) {
guard !fetchers.contains(where: { $0.id == fetcher.id }) else {
return
}
fetchers.append(fetcher)
}
/// Add list of given fetchers if they are not already included in the
/// collection.
///
/// - Note: This method ensures there are no duplicate fetchers.
func add(_ fetchers: [ImageFetcher]) {
fetchers.forEach(add)
}
/// Removes the given fetcher.
func remove(_ fetcher: ImageFetcher) {
let ids = fetchers.map { $0.id }
guard let index = ids.firstIndex(of: fetcher.id) else {
return
}
fetchers.remove(at: index)
}
}
extension CompositeImageFetcher {
var id: String {
fetchers.map { $0.id }.joined(separator: "_")
}
func canHandle(_ image: ImageRepresentable) -> Bool {
image.imageSource.isValid
}
func fetch(_ image: ImageRepresentable, in imageView: UIImageView?, _ callback: @escaping ResultBlock) {
guard image.imageSource.isValid else {
#if DEBUG
Console.error("Unable to fetch image because of invalid image source.")
#endif
callback(.failure(ImageFetcherError.notFound))
return
}
// 1. Reverse fetchers so the third-party fetchers are always prioritized over
// built-in ones.
// 2. Find the first one that can handle the request.
// 3. Fetch the requested image.
guard let fetcher = fetchers.reversed().first(where: { $0.canHandle(image) }) else {
callback(.failure(ImageFetcherError.notFound))
return
}
imageView?.imageRepresentableSource = image.imageSource
fetcher.fetch(image, in: imageView, callback)
}
func removeCache() {
fetchers.forEach { $0.removeCache() }
}
}
| 28.37931 | 108 | 0.616849 |
9dac1d5056b1ebf37f62a6812558a429a662ae83 | 784 | swift | Swift | Sources/Switchcraft/Notification.swift | steamclock/switchcraft | e7153153d0f9796f9bf053f473e61f08bb40541e | [
"MIT"
] | 5 | 2018-05-16T19:18:44.000Z | 2021-11-12T16:12:29.000Z | Sources/Switchcraft/Notification.swift | steamclock/switchcraft | e7153153d0f9796f9bf053f473e61f08bb40541e | [
"MIT"
] | 18 | 2018-06-09T00:01:29.000Z | 2021-11-24T17:13:51.000Z | Sources/Switchcraft/Notification.swift | steamclock/switchcraft | e7153153d0f9796f9bf053f473e61f08bb40541e | [
"MIT"
] | 2 | 2018-05-20T21:51:58.000Z | 2021-11-24T15:05:32.000Z | //
// Notification.swift
// Switchcraft
//
// Created by Brendan Lensink on 2018-05-04.
//
import Foundation
extension Notification {
/**
* Namespace for public notification keys.
*/
public struct Key {
/**
* User info dictionary key containing the new `Endpoint`.
*/
public static let Endpoint = "switchcraftEndpoint"
}
}
extension Notification.Name {
/**
* Posted when an `Endpoint` is selected.
* The notification `object` contains a reference to the `Switchcraft` instance that sent it.
* The `UserInfo` dictionary contains an Endpoint accessed with the key `Notification.Key.Endpoint`
*/
public static let SwitchcraftDidSelectEndpoint = Notification.Name("switchcraftDidSelectEndpoint")
}
| 26.133333 | 103 | 0.674745 |
f243a17745e3a61ca96785f3a966c8483fb5a296 | 858 | php | PHP | tests/TestCaseBase.php | MA7/graphql-php | ceb6e94f5789ad21dc86ee1fd642fc3f2a01802f | [
"MIT"
] | null | null | null | tests/TestCaseBase.php | MA7/graphql-php | ceb6e94f5789ad21dc86ee1fd642fc3f2a01802f | [
"MIT"
] | null | null | null | tests/TestCaseBase.php | MA7/graphql-php | ceb6e94f5789ad21dc86ee1fd642fc3f2a01802f | [
"MIT"
] | null | null | null | <?php declare(strict_types=1);
namespace GraphQL\Tests;
use GraphQL\Language\AST\Node;
use GraphQL\Language\Printer;
use PHPUnit\Framework\TestCase;
abstract class TestCaseBase extends TestCase
{
/**
* Useful to test code with no observable behaviour other than not crashing.
*
* In contrast to PHPUnit's native method, this lets the test case count towards coverage.
*
* @see TestCase::expectNotToPerformAssertions()
*/
public static function assertDidNotCrash(): void
{
// @phpstan-ignore-next-line this truism is required to prevent a PHPUnit warning
self::assertTrue(true);
}
protected static function assertASTMatches(string $expected, ?Node $node): void
{
self::assertInstanceOf(Node::class, $node);
self::assertSame($expected, Printer::doPrint($node));
}
}
| 28.6 | 94 | 0.692308 |
f65967a614d415e3dd4256e6d33476b1d14e53de | 2,729 | hpp | C++ | include/tudocomp/compressors/MTFCompressor.hpp | dominiKoeppl/tudocomp | b5512f85f6b3408fb88e19c08899ec4c2716c642 | [
"ECL-2.0",
"Apache-2.0"
] | 17 | 2017-03-04T13:04:49.000Z | 2021-12-03T06:58:20.000Z | include/tudocomp/compressors/MTFCompressor.hpp | dominiKoeppl/tudocomp | b5512f85f6b3408fb88e19c08899ec4c2716c642 | [
"ECL-2.0",
"Apache-2.0"
] | 27 | 2016-01-22T18:31:37.000Z | 2021-11-27T10:50:40.000Z | include/tudocomp/compressors/MTFCompressor.hpp | dominiKoeppl/tudocomp | b5512f85f6b3408fb88e19c08899ec4c2716c642 | [
"ECL-2.0",
"Apache-2.0"
] | 16 | 2017-03-14T12:46:51.000Z | 2021-06-25T18:19:50.000Z | #pragma once
#include <tudocomp/util.hpp>
#include <tudocomp/Compressor.hpp>
#include <tudocomp/Env.hpp>
#include <numeric>
#include <tudocomp/def.hpp>
namespace tdc {
/**
* Encodes a character 'v' by Move-To-Front Coding
* Needs and modifies a lookup table storing the last-used characters
*/
template<class value_type = uliteral_t>
value_type mtf_encode_char(const value_type v, value_type*const table, const size_t table_size) {
for(size_t i = 0; i < table_size; ++i) {
if(table[i] == v) {
for(size_t j = i; j > 0; --j) {
table[j] = table[j-1];
}
table[0] = v;
return i;
}
}
DCHECK(false) << v << "(" << static_cast<size_t>(static_cast<typename std::make_unsigned<value_type>::type>(v)) << " not in " << arr_to_debug_string(table,table_size);
return 0;
}
/**
* Decodes a character encoded as 'v' by Move-To-Front Coding
* Needs and modifies a lookup table storing the last-used characters
*/
template<class value_type = uliteral_t>
value_type mtf_decode_char(const value_type v, value_type*const table) {
const value_type return_value = table[v];
for(size_t j = v; j > 0; --j) {
table[j] = table[j-1];
}
table[0] = return_value;
return return_value;
}
template<class char_type = uliteral_t>
void mtf_encode(std::basic_istream<char_type>& is, std::basic_ostream<char_type>& os) {
typedef typename std::make_unsigned<char_type>::type value_type; // -> default: uint8_t
static constexpr size_t table_size = std::numeric_limits<value_type>::max()+1;
value_type table[table_size];
std::iota(table, table+table_size, 0);
char_type c;
while(is.get(c)) {
os << mtf_encode_char(static_cast<value_type>(c), table, table_size);
}
}
template<class char_type = uliteral_t>
void mtf_decode(std::basic_istream<char_type>& is, std::basic_ostream<char_type>& os) {
typedef typename std::make_unsigned<char_type>::type value_type; // -> default: uint8_t
static constexpr size_t table_size = std::numeric_limits<value_type>::max()+1;
value_type table[table_size];
std::iota(table, table+table_size, 0);
char_type c;
while(is.get(c)) {
os << mtf_decode_char(static_cast<value_type>(c), table);
}
}
class MTFCompressor : public Compressor {
public:
inline static Meta meta() {
Meta m("compressor", "mtf", "Move To Front Compressor");
return m;
}
inline MTFCompressor(Env&& env)
: Compressor(std::move(env)) {
}
inline virtual void compress(Input& input, Output& output) override {
auto is = input.as_stream();
auto os = output.as_stream();
mtf_encode(is,os);
}
inline virtual void decompress(Input& input, Output& output) override {
auto is = input.as_stream();
auto os = output.as_stream();
mtf_decode(is,os);
}
};
}//ns
| 28.427083 | 168 | 0.698791 |
0d74b97a64d91ec85993269235d6459b66ff6e3b | 2,276 | kt | Kotlin | Lecture 3/githubclient/app/src/main/java/com/avast/android/lecture/github/Settings.kt | LaudateCorpus1/android-lectures | edafe7bf572df354cb0de98da1abdb14268f939a | [
"Apache-2.0"
] | 28 | 2015-11-12T20:30:14.000Z | 2022-01-05T05:37:31.000Z | Lecture 3/githubclient/app/src/main/java/com/avast/android/lecture/github/Settings.kt | LaudateCorpus1/android-lectures | edafe7bf572df354cb0de98da1abdb14268f939a | [
"Apache-2.0"
] | null | null | null | Lecture 3/githubclient/app/src/main/java/com/avast/android/lecture/github/Settings.kt | LaudateCorpus1/android-lectures | edafe7bf572df354cb0de98da1abdb14268f939a | [
"Apache-2.0"
] | 11 | 2016-09-15T21:35:45.000Z | 2022-02-02T13:36:14.000Z | package com.avast.android.lecture.github
import android.content.Context
import android.content.SharedPreferences
import android.util.Log
import androidx.datastore.core.DataStore
import androidx.datastore.preferences.core.Preferences
import androidx.datastore.preferences.core.edit
import androidx.datastore.preferences.core.intPreferencesKey
import androidx.datastore.preferences.core.stringPreferencesKey
import androidx.datastore.preferences.preferencesDataStore
import com.avast.android.lecture.github.utils.SingletonHolder
import kotlinx.coroutines.flow.Flow
import kotlinx.coroutines.flow.first
import kotlinx.coroutines.flow.map
/**
* Wraps access to [SharedPreferences].
*/
class Settings private constructor(private val context: Context) {
//TODO: exercise 6,7
private val Context.dataStore: DataStore<Preferences> by preferencesDataStore(name = "settings")
/**
* Get how many times the application was launched.
*/
suspend fun getAppLaunchesCount(): Int = context.dataStore.data.map { preferences ->
preferences[KEY_APP_LAUNCH_COUNT] ?: 0
}.first()
/**
* Increase app launched counter.
*/
suspend fun increaseAppLaunchesCount() {
context.dataStore.edit { preferences ->
val actualCount = preferences[KEY_APP_LAUNCH_COUNT] ?: 0
preferences[KEY_APP_LAUNCH_COUNT] = (actualCount + 1).also {
Log.d(App::class.java.simpleName, "Increased app count: $it")
}
Log.d(App::class.java.simpleName, "Increased app launch")
}
}
/**
* Read last username from preferences
*/
fun getLastUsername(): Flow<String> {
return context.dataStore.data.map { preferences ->
preferences[KEY_USERNAME].orEmpty()
}
}
/**
* Set username to preferences
*/
suspend fun setLastUsername(username: String) {
context.dataStore.edit { preferences ->
preferences[KEY_USERNAME] = username
}
}
companion object: SingletonHolder<Settings, Context>(::Settings) {
const val APP_PREFERENCES = "github_client"
val KEY_APP_LAUNCH_COUNT = intPreferencesKey("app_launches")
val KEY_USERNAME = stringPreferencesKey("username")
}
} | 32.056338 | 100 | 0.699912 |
bc89c5003f21c4a920592f790ae2edc7bf6668a0 | 114 | sh | Shell | all-delete.sh | s4s0l/betelgeuse-vboxtools | a576d2bd97703258bacd23e1853b14c50e27f961 | [
"Apache-2.0"
] | null | null | null | all-delete.sh | s4s0l/betelgeuse-vboxtools | a576d2bd97703258bacd23e1853b14c50e27f961 | [
"Apache-2.0"
] | null | null | null | all-delete.sh | s4s0l/betelgeuse-vboxtools | a576d2bd97703258bacd23e1853b14c50e27f961 | [
"Apache-2.0"
] | null | null | null | #!/bin/bash
. $(dirname $0)/lib/init.sh
remove-all-dhcp-servers
remove-all-host-only-network
remove-all-machines
| 16.285714 | 28 | 0.745614 |
a35e78c4368592a3858fc4d75647cc14485cb9f9 | 8,502 | java | Java | src/main/java/su/svn/showcase/domain/Record.java | vskurikhin/daybook | c6119805f29cc9396317161d1856b721bdb8503e | [
"Unlicense"
] | 1 | 2020-03-31T17:22:22.000Z | 2020-03-31T17:22:22.000Z | src/main/java/su/svn/showcase/domain/Record.java | vskurikhin/daybook | c6119805f29cc9396317161d1856b721bdb8503e | [
"Unlicense"
] | 55 | 2020-01-31T13:17:47.000Z | 2020-07-14T16:48:57.000Z | src/main/java/su/svn/showcase/domain/Record.java | vskurikhin/daybook | c6119805f29cc9396317161d1856b721bdb8503e | [
"Unlicense"
] | 1 | 2021-07-09T18:11:12.000Z | 2021-07-09T18:11:12.000Z | /*
* This file was last modified at 2020.07.09 14:59 by Victor N. Skurikhin.
* This is free and unencumbered software released into the public domain.
* For more information, please refer to <http://unlicense.org>
* Record.java
* $Id: a35e78c4368592a3858fc4d75647cc14485cb9f9 $
*/
package su.svn.showcase.domain;
import lombok.AllArgsConstructor;
import lombok.Builder;
import lombok.Getter;
import lombok.NoArgsConstructor;
import lombok.Setter;
import lombok.ToString;
import org.wildfly.common.annotation.Nullable;
import su.svn.showcase.interfaces.Typing;
import su.svn.showcase.utils.MapUtil;
import javax.annotation.Nonnull;
import javax.persistence.CascadeType;
import javax.persistence.Column;
import javax.persistence.Entity;
import javax.persistence.FetchType;
import javax.persistence.Id;
import javax.persistence.JoinColumn;
import javax.persistence.JoinTable;
import javax.persistence.ManyToMany;
import javax.persistence.ManyToOne;
import javax.persistence.NamedQueries;
import javax.persistence.NamedQuery;
import javax.persistence.OneToOne;
import javax.persistence.Table;
import javax.validation.constraints.NotNull;
import java.io.Serializable;
import java.time.LocalDateTime;
import java.util.*;
import static su.svn.showcase.domain.Record.*;
@Builder
@NoArgsConstructor
@AllArgsConstructor
@ToString(exclude = {"tags"})
@Entity
@Table(schema = "db", name = "db_record")
@SuppressWarnings({"SingleElementAnnotation", "JpaQlInspection"})
@NamedQueries({
@NamedQuery(
name = FIND_ALL,
query = "SELECT DISTINCT e FROM Record e"
),
@NamedQuery(
name = FIND_ALL_IDS,
query = "SELECT DISTINCT e.id FROM Record e"
),
@NamedQuery(
name = FIND_ALL_WHERE_ID_IN,
query = "SELECT DISTINCT e FROM Record e" +
" WHERE e.id IN (:ids)"
),
@NamedQuery(
name = FIND_ALL_BY_DAY,
query = "SELECT DISTINCT e FROM Record e" +
" WHERE e.editDateTime BETWEEN :startDate AND :endDate"
),
@NamedQuery(
name = FIND_ALL_IDS_BY_DAY,
query = "SELECT DISTINCT e.id FROM Record e" +
" WHERE e.editDateTime BETWEEN :startDate AND :endDate"
),
@NamedQuery(
name = FETCH_ALL,
query = "SELECT DISTINCT e FROM Record e" +
" LEFT JOIN FETCH e.userLogin u" +
" LEFT JOIN FETCH e.article a" +
" LEFT JOIN FETCH e.newsEntry n" +
" LEFT JOIN FETCH e.newsLinks l" +
" LEFT JOIN FETCH e.tags t" +
" LEFT JOIN FETCH a.link al" +
" LEFT JOIN FETCH n.newsGroup ng" +
" LEFT JOIN FETCH l.newsGroup lg" +
" LEFT JOIN FETCH l.descriptions ld"
),
@NamedQuery(
name = FETCH_BY_ID,
query = "SELECT DISTINCT e FROM Record e" +
" LEFT JOIN FETCH e.userLogin u" +
" LEFT JOIN FETCH e.article a" +
" LEFT JOIN FETCH e.newsEntry n" +
" LEFT JOIN FETCH e.newsLinks l" +
" LEFT JOIN FETCH e.tags t" +
" LEFT JOIN FETCH a.link al" +
" LEFT JOIN FETCH n.newsGroup ng" +
" LEFT JOIN FETCH l.newsGroup lg" +
" LEFT JOIN FETCH l.descriptions ld" +
" WHERE e.id = :id"
),
@NamedQuery(
name = FETCH_ALL_WHERE_ID_IN,
query = "SELECT DISTINCT e FROM Record e" +
" LEFT JOIN FETCH e.userLogin u" +
" LEFT JOIN FETCH e.article a" +
" LEFT JOIN FETCH e.newsEntry n" +
" LEFT JOIN FETCH e.newsLinks l" +
" LEFT JOIN FETCH e.tags t" +
" LEFT JOIN FETCH a.link al" +
" LEFT JOIN FETCH n.newsGroup ng" +
" LEFT JOIN FETCH l.newsGroup lg" +
" LEFT JOIN FETCH l.descriptions ld" +
" WHERE e.id IN (:ids)"
),
})
public class Record implements DBEntity<UUID>, Serializable, Typing {
private static final long serialVersionUID = 235L;
public static final String FIND_ALL = "RecordDao.findAll";
public static final String FIND_ALL_IDS = "RecordDao.findAllIds";
public static final String FIND_ALL_WHERE_ID_IN = "RecordDao.findAllWhereIdIn";
public static final String FIND_ALL_BY_DAY = "RecordDao.findAllByDay";
public static final String FIND_ALL_IDS_BY_DAY = "RecordDao.findAllIdsByDay";
public static final String FETCH_BY_ID = "RecordDao.fetchById";
public static final String FETCH_ALL = "RecordDao.fetchAll";
public static final String FETCH_ALL_WHERE_ID_IN = "RecordDao.fetchAllWhereIdIn";
public static final String FETCH_ALL_BY_DAY = "RecordDao.fetchAllByDay";
public static final String COUNT_BY_DAY
= "SELECT COUNT(e.id) FROM Record e WHERE e.editDateTime BETWEEN :startDate AND :endDate";
@Getter
private static final LinkedHashMap<String, Boolean> defaultOrderMap
= new MapUtil.Builder<String, Boolean>()
.key("editDateTime").value(false)
.key("index").value(true)
.linkedHashMap();
@Getter
@NotNull
@Id
@Column(name = "id", nullable = false, updatable = false)
private UUID id;
@Getter
@Setter
@Nullable
@OneToOne(cascade = CascadeType.ALL, fetch = FetchType.EAGER, mappedBy = "record")
private Article article;
@Getter
@Setter
@Nullable
@OneToOne(cascade = CascadeType.ALL, fetch = FetchType.EAGER, mappedBy = "record")
private NewsEntry newsEntry;
@Getter
@Setter
@Nullable
@OneToOne(fetch = FetchType.EAGER,
cascade = {CascadeType.MERGE, CascadeType.PERSIST, CascadeType.REFRESH, CascadeType.DETACH})
@JoinColumn(name = "id")
private NewsLinks newsLinks;
@Sort
@Getter
@Setter
@NotNull
@Column(name = "create_date_time", nullable = false, updatable = false)
private LocalDateTime createDateTime;
@Getter
@Setter
@NotNull
@Sort(decrease = true, cluster = {"index"})
@Column(name = "edit_date_time", nullable = false)
private LocalDateTime editDateTime;
@Getter
@Setter
@Sort
private int index;
@Getter
@Setter
@NotNull
@Column(name = "type", nullable = false, updatable = false)
private String type;
@Getter
@Setter
@NotNull
@ManyToOne(fetch = FetchType.LAZY, cascade = {CascadeType.MERGE, CascadeType.PERSIST, CascadeType.DETACH})
@JoinColumn(name = "db_user_login_id", nullable = false)
private UserLogin userLogin;
@Getter
@Setter
@ManyToMany(fetch = FetchType.LAZY, cascade = {CascadeType.ALL})
@JoinTable(
schema = "db",
name = "db_record_tag",
joinColumns = @JoinColumn(name = "db_record_id"),
inverseJoinColumns = @JoinColumn(name = "tag_id"))
private Set<Tag> tags;
public Record(@Nonnull UUID id) {
this.id = id;
this.createDateTime = LocalDateTime.now();
this.editDateTime = LocalDateTime.now();
this.index = 100;
this.type = Record.class.getSimpleName();
this.tags = new HashSet<>();
}
public Record(@Nonnull UUID id, @Nonnull UserLogin userLogin) {
this.id = id;
this.createDateTime = LocalDateTime.now();
this.editDateTime = LocalDateTime.now();
this.index = 100;
this.type = Record.class.getSimpleName();
this.userLogin = userLogin;
this.tags = new HashSet<>();
}
@Override
public boolean equals(Object o) {
if (this == o) return true;
if (o == null || getClass() != o.getClass()) return false;
Record record = (Record) o;
return Objects.equals(id, record.id) &&
Objects.equals(createDateTime, record.createDateTime) &&
Objects.equals(type, record.type);
}
@Override
public int hashCode() {
return Objects.hash(id, createDateTime, type);
}
}
//EOF
| 34.008 | 110 | 0.598918 |
118b9e2b3537864cc5dccfb7c03a39d4cef44b49 | 3,259 | swift | Swift | DappMX/Vendor/DappPOSCode/DappPOSCodeHelper.swift | DappPayments/Dapp-SDK-iOS | 353cfe84620f221ba872b15eec845d8cabb47a3c | [
"MIT"
] | 1 | 2018-07-19T08:17:18.000Z | 2018-07-19T08:17:18.000Z | DappMX/Vendor/DappPOSCode/DappPOSCodeHelper.swift | DappPayments/Dapp-SDK-iOS | 353cfe84620f221ba872b15eec845d8cabb47a3c | [
"MIT"
] | null | null | null | DappMX/Vendor/DappPOSCode/DappPOSCodeHelper.swift | DappPayments/Dapp-SDK-iOS | 353cfe84620f221ba872b15eec845d8cabb47a3c | [
"MIT"
] | null | null | null | //
// DappPOSCodeHelper.swift
// DappMX
//
// Created by Rodrigo Rivas on 3/31/20.
// Copyright © 2020 Dapp. All rights reserved.
//
import Foundation
internal protocol DappPOSCodeHelperDelegate: AnyObject {
func dappPOSCodeHelper(_ helper: DappPOSCodeHelper, codePayed payment: DappPayment)
func dappPOSCodeHelper(_ helper: DappPOSCodeHelper, didFailWithError error: DappError)
}
internal protocol DappPOSCodeActionsDelegate: AnyObject {
func listenToCode(id: String, delegate: DappPOSCodeHelperDelegate)
func stopListening()
}
internal class DappPOSCodeHelper: DappPOSCodeActionsDelegate {
public var delegate: DappPOSCodeHelperDelegate?
private var id: String!
private var timer: Timer!
private var retries = 0
private var isListening = false
private var wsClient: DappWSClient?
public func listenToCode(id: String, delegate: DappPOSCodeHelperDelegate) {
if isListening {
return
}
isListening = true
self.delegate = delegate
self.id = id
if DappWSClient.isAvailable() {
wsClient = DappApiVendor.dappCodeSocket(id)
wsClient?.delegate = self
wsClient?.connect()
}
else {
setTimer()
}
}
public func stopListening() {
isListening = false
if let t = timer {
t.invalidate()
}
wsClient?.disconnect()
delegate = nil
}
private func setTimer() {
timer = Timer.scheduledTimer(timeInterval: 5, target: self, selector: #selector(httpRequestCodeStatus), userInfo: nil, repeats: false)
}
@objc private func httpRequestCodeStatus() {
DappApiVendor.dappCodePayment(id) { (data, error) in
if let e = error {
switch e {
case .error:
self.retries += 1
if self.retries >= 3 {
self.delegate?.dappPOSCodeHelper(self, didFailWithError: e)
self.stopListening()
}
else {
self.setTimer()
}
default:
self.delegate?.dappPOSCodeHelper(self, didFailWithError: e)
self.stopListening()
}
return
}
if let d = data {
self.delegate?.dappPOSCodeHelper(self, codePayed: DappPayment(with: d))
self.stopListening()
return
}
self.setTimer()
}
}
}
extension DappPOSCodeHelper: DappSocketDelegate {
func didChangeStatus(_ status: DappSocketStatus) {
switch status {
case .connected:
break
case .disconnected:
if isListening {
httpRequestCodeStatus()
}
case .data(let txt):
if let data = txt.data(using: .utf8), let json = try? JSONSerialization.jsonObject(with: data) as? [String: Any] {
isListening = false
delegate?.dappPOSCodeHelper(self, codePayed: DappPayment(with: json))
}
}
}
}
| 28.840708 | 142 | 0.55784 |
835ea2ef03ec4aa25db46ff9c904acd14e1d86c0 | 714 | ts | TypeScript | src/app/pages/post/post.page.ts | felixhhyeung/Instagram-Package-Viewer | 2db1c4bab2bbb7350e05bfe15eb9be097f67e7b5 | [
"MIT"
] | null | null | null | src/app/pages/post/post.page.ts | felixhhyeung/Instagram-Package-Viewer | 2db1c4bab2bbb7350e05bfe15eb9be097f67e7b5 | [
"MIT"
] | null | null | null | src/app/pages/post/post.page.ts | felixhhyeung/Instagram-Package-Viewer | 2db1c4bab2bbb7350e05bfe15eb9be097f67e7b5 | [
"MIT"
] | null | null | null | import { Component, OnInit } from '@angular/core';
import { ActivatedRoute } from "@angular/router";
import { PackageService, Post, Media } from '../../services/package.service';
@Component({
selector: 'app-post',
templateUrl: './post.page.html',
styleUrls: ['./post.page.scss'],
})
export class PostPage implements OnInit {
post: Post;
constructor(
private activatedRoute: ActivatedRoute,
private packageService: PackageService,
) { }
ngOnInit() {
this.activatedRoute.queryParams.subscribe(params => {
this.post = this.packageService.getTempObject(params["postHash"]);
console.log(`this.post: ${JSON.stringify(this.post)}`);
});
}
mediaOnClick(media: Media) {
}
}
| 26.444444 | 77 | 0.680672 |
e7055f433e0994ee97bd3f7d85b6b83a046a1dac | 13,439 | php | PHP | application/index/controller/Test.php | zhangchen0923/myTest | e9a8a1f19d9e3f4a7a0a926dee0fba3d1c33e7eb | [
"Apache-2.0"
] | null | null | null | application/index/controller/Test.php | zhangchen0923/myTest | e9a8a1f19d9e3f4a7a0a926dee0fba3d1c33e7eb | [
"Apache-2.0"
] | null | null | null | application/index/controller/Test.php | zhangchen0923/myTest | e9a8a1f19d9e3f4a7a0a926dee0fba3d1c33e7eb | [
"Apache-2.0"
] | null | null | null | <?php
namespace app\index\controller;
use think\db;
use PHPExcel;
use think\Controller;
use think\Request;
class Test extends Controller
{
protected $money_data;
protected $business_data;
public function __initialize()
{
}
public function index()
{
// if(empty(input('dh'))||empty(input('zh'))||empty(input('pw'))||empty(input('num'))){
// $this->error('请填写完整的数据');
// }else{
$post = array(
'user_identification' => '13818220572',
'password' => '111111',
'auto_login' => 'true'
);
$url = "http://www.tuochetong.com/ws-truck/user/login"; //登录地址， 和原网站一致
$num=input('num');//想获取的信息数目
$s_time=input('s_time');//开始时间 格式:2017-03-01
$e_time=input('e_time');//结束时间
$business_id=input('$business_id');
$_SESSION['business_id']=$business_id;
$cookie = dirname(__FILE__).'/cookie_ydma.txt'; //设置cookie保存的路径
$url2 = "http://ys.cttms.com/report/incomeStatement.action"; //登录后要获取信息的地址
$this->login_post($url,$cookie,$post); //调用模拟登录
exit;
//$page=ceil($num/5);
//dump($page);exit;
/* for ($x=1; $x<=$page; $x++) {
$content =$this->get_content($url2, $cookie,$x,$s_time,$e_time); //登录后，调用get_content()函数获取登录后指定的页面信息
file_put_contents(dirname(__FILE__).'/save'.$x.'.html', $content);
$success=$this->html($x);
unlink (dirname(__FILE__).'/save'.$x.'.html');
}*/
$url3 = "http://ys.cttms.com/report/incomeStatement.action"; //财务应付
$contents =$this->get_content_new($url3, $cookie,$s_time,$e_time);
file_put_contents(dirname(__FILE__).'/caiwu.html', $contents);
$url4 = "http://ys.cttms.com/report/incomeStatement.action"; //财务应收
$contents =$this->get_content_new($url4, $cookie,$s_time,$e_time);
file_put_contents(dirname(__FILE__).'/caiwu_pay.html', $contents);
$success=$this->html1();
unlink (dirname(__FILE__).'/caiwu.html');
unlink (dirname(__FILE__).'/caiwu_pay.html');
$business_data=$this->business_data;
$money=$this->money_data;
dump($money);exit;
//合并数组 $business_data $money
$new_data=array();
foreach ($business_data as $k=>$v){
foreach ($money as $k1=>$v1){
if($v['提单号']==rtrim($v1['提单号'])){
$new_data[]=array_merge($v,$v1);
}
}
}
//将数组转化为json 存入数据库
foreach($new_data as $k=>$v){
$data[]=array('content'=>json_encode($v),
'business_id'=>$business_id
);
}
$rus=db('business')->insertAll($data);
if($rus){
echo 'it`s OK';
}
// }
}
function login_post($url, $cookie, $post){
$ch = curl_init(); //初始化curl模块
curl_setopt($ch, CURLOPT_URL, $url); //登录提交的地址
curl_setopt($ch, CURLOPT_HEADER,0); //是否显示头信息
// 追踪内部跳转
curl_setopt($ch, CURLOPT_MAXREDIRS, 100);
curl_setopt($ch, CURLOPT_FOLLOWLOCATION, 1);
curl_setopt($ch, CURLOPT_RETURNTRANSFER, 0); //是否自动显示返回的信息
$header = [
'Accept:text/html,application/xhtml+xml,application/xml;q=0.9,*/*;q=0.8',
'Accept-Encoding:gzip, deflate',
'Accept-Language:zh-CN,zh;q=0.8,en-US;q=0.5,en;q=0.3',
'Host:'. 'www.tuochetong.com', //必填
'X-Requested-With:XMLHttpRequest', // 设置ajax请求头
];
curl_setopt($ch, CURLOPT_HTTPHEADER, $header);
curl_setopt($ch, CURLOPT_COOKIEJAR, $cookie); //设置cookie信息保存在指定的文件夹中
curl_setopt($ch, CURLOPT_POST, 1); //以POST方式提交
curl_setopt($ch, CURLOPT_POSTFIELDS, http_build_query($post));//要执行的信息
$a=curl_exec($ch); //执行CURL
//echo $ch;
}
/*
上例中声明的函数login_post()，需要提供一个url地址，一个保存cookie文
件，以及post的数据（用户名和密码等信息），注意php自带的http_build_query()
函数可以将数组转换成相连接的字符串，如果通过该函数登录成功后，我们要获取
登录成功个页面信息。声明函数的代码如下所示：
*/
function get_content($url, $cookie,$page,$s_time,$e_time){
//最大条目数量为200
$post = array(
'pager.pageSize' => '5',
'pager.currentPage' => $page,
'search.beginTime' =>$s_time,
'search.endTime' =>$e_time
);
$ch = curl_init(); //初始化curl模块
curl_setopt($ch, CURLOPT_URL, $url); //登录提交的地址
curl_setopt($ch, CURLOPT_HEADER, 0); //是否显示头信息
curl_setopt($ch, CURLOPT_RETURNTRANSFER, 1); //是否自动显示返回的信息
curl_setopt($ch, CURLOPT_COOKIEFILE, $cookie);//设置cookie信息保存在指定的文件夹中
curl_setopt($ch, CURLOPT_POST, 1); //以POST方式提交
curl_setopt($ch, CURLOPT_POSTFIELDS, http_build_query($post));//要执行的信息
$rs = curl_exec($ch); //执行curl转去页面内容
curl_close($ch);
return $rs; //返回字符串
}
function get_content_new($url, $cookie,$s_time,$e_time){
$post = array(
'search.beginTime' =>$s_time,
'search.endTime' =>$e_time,
);
$ch = curl_init(); //初始化curl模块
curl_setopt($ch, CURLOPT_URL, $url); //登录提交的地址
curl_setopt($ch, CURLOPT_HEADER, 0); //是否显示头信息
curl_setopt($ch, CURLOPT_RETURNTRANSFER, 1); //是否自动显示返回的信息
curl_setopt($ch, CURLOPT_COOKIEFILE, $cookie);//设置cookie信息保存在指定的文件夹中
curl_setopt($ch, CURLOPT_POST, 1); //以POST方式提交
curl_setopt($ch, CURLOPT_POSTFIELDS, http_build_query($post));//要执行的信息
$rs = curl_exec($ch); //执行curl转去页面内容
curl_close($ch);
return $rs; //返回字符串
}
/*
get_content()中用curlopt_cookiefile可以读取到登录保存的cookie信
息 最后讲页面内容返回.我们的目的是获取到模拟登录后的信息，也就是
只有正常登录成功后菜能获取的有用的信息，下面举例代码
*/
public function html($x){
require_once("simple_html_dom.php");
$htmls = file_get_html(dirname(__FILE__).'/save'.$x.'.html');
$html = $htmls->find('#table')[0]->find('tr');
if($html){
$new_data=array();
$new_data_value=array();
$new_data_name=array();
$new_data_count=array();
foreach($html as $k1=>$e1) {
foreach ($e1->find('td') as $e) {
$new_data[$k1][]= $e->innertext;
}
foreach ($e1->find('td input') as $e) {
$new_data_value[$k1][] = $e->value;
$new_data_name[$k1][] = $e->name;
}
//键值合并
if(!empty($new_data_name)||!empty($new_data_value)){
foreach ($new_data_name as $k2=>$v2) {
foreach ($new_data_value as $k3=>$v3) {
if($k3==$k2){
foreach ($v2 as $k4=>$v4) {
foreach ($v3 as $k5=>$v5) {
if($k4==$k5){
$new_data_count[$k1][$v4] =$v5;
}
}
}
}
}
}
}
}
}
$html = $htmls->find('#table thead th');
foreach($html as $k2=>$e2) {
$new_data_key[] = $e2->innertext;
}
$marge_data=array();
foreach($new_data as $k=>$v){
foreach($v as $k1=>$v1){
foreach($new_data_key as $k2=>$v2) {
if($k1==$k2){
$marge_data[$k][$v2]=$v1;
}
}
}
}
//合并数组
$arrs=array();
foreach($new_data_count as $k1=>$v1) {
foreach($marge_data as $k=>$v){
if ($k==$k1) {
$arr[] = array_merge($v1, $v);
foreach($arr as $k2=>$v2){
foreach($v2 as $k3=>$v3) {
if (strlen($v3)<= 100) {
$arrs[$k2][$k3] = $v3;
}
}
}
}
}
}
foreach($arrs as $k=>$v){
$this->business_data[]= $v;
}
}
public function html1(){
require_once ("simple_html_dom.php");
//应收
$html = file_get_html(dirname(__FILE__).'/caiwu.html');
foreach($html->find('#table tr') as $k1=>$e) {
foreach ($e->find('td') as $e1) {
$new_data[$k1][] = $e1->innertext;
}
}
$html = $html->find('#table thead th');
foreach($html as $k2=>$e2) {
$new_data_key[] = $e2->innertext;
}
$marge_data=array();
foreach($new_data as $k=>$v){
foreach($v as $k1=>$v1){
foreach($new_data_key as $k2=>$v2) {
if($k1==$k2){
$marge_data[$k][$v2]=$v1;
}
}
}
}
//应付
$html = file_get_html(dirname(__FILE__).'/caiwu_pay.html');
foreach($html->find('#table tr') as $k1=>$e) {
foreach ($e->find('td') as $e1) {
$new_data_pay[$k1][] = $e1->innertext;
}
}
$html = $html->find('#table thead th');
foreach($html as $k2=>$e2) {
$new_data_key_pay[] = $e2->innertext;
}
$marge_data_pay=array();
foreach($new_data_pay as $k=>$v){
foreach($v as $k1=>$v1){
foreach($new_data_key_pay as $k2=>$v2) {
if($k1==$k2){
$marge_data_pay[$k][$v2]=$v1;
}
}
}
}
foreach($marge_data as $k=>$v){
$marge_data[$k]['应收小计']=$v['小计'];
}
//将应付应收合并
$array_merge=array();
foreach($marge_data as $k=>$v){
foreach($marge_data_pay as $k1=>$v1){
if($k==$k1){
$array_merge[$k]=array_merge($v,$v1);
}
}
}
foreach($array_merge as $k=>$v){
$this->money_data[]= $v;
}
}
//财务表导出
public function sqltoxls(){
//导入PhpExcel
$list=db('business')->field('content')->where('business_id',$_SESSION['business_id'])->group('content')->select();
if(empty($list)){
echo '先请插入数据';exit;
}
\think\Loader::import('.PHPExcel');//引入类文件
$objPHPExcel = new \PHPExcel();
$key = 65;
//将json转数组
$list_new=array();
foreach($list as $k=>$v){
$list_new[]=json_decode( $v['content'],true);
};
// dump($list_new);exit;
foreach($list_new[0] as $k=>$v){
if($key<91){
$letter= chr($key);
}elseif ($key>=91&&$key<117){
$letter= "A".chr($key-26);
}elseif ($key>=117&&$key<143){
$letter= "B".chr($key-52);
}elseif ($key>=143){
$letter= "C".chr($key-78);
}
$key++;
$objPHPExcel->setActiveSheetIndex(0)
->setCellValue($letter.'1', $k);
}
$keys = 1;
foreach($list_new as $key=>$value) {
$key = 65;
$keys++;
foreach ($value as $k => $v) {
if ($key < 91) {
$letter = chr($key);
} elseif ($key >= 91 && $key < 117) {
$letter = "A" . chr($key - 26);
} elseif ($key >= 117 && $key < 143) {
$letter = "B" . chr($key - 52);
} elseif ($key >= 143) {
$letter = "C" . chr($key - 78);
}
$key++;
$objPHPExcel->setActiveSheetIndex(0)
->setCellValue($letter.$keys, $v);
}
}
$objPHPExcel->getActiveSheet()->setTitle('信息页');
header("Accept-Ranges:bytes");
header("Content-type:application/vnd.ms-excel");
header("Content-Disposition:attachment;filename=" . '信息表'.'-'.time() . ".xls");
header("Pragma: no-cache");
header("Expires: 0");
\think\Loader::import('.PHPExcel.IOFactory.PHPExcel_IOFactory');
$objWriter = \PHPExcel_IOFactory::createWriter($objPHPExcel, 'Excel5');
$objWriter->save('php://output');
exit;
}
public function view(){
return $this->fetch('index');
}
public function importDatabase(){
$log_grab=db('log_grab')->group('bill_of_loading_num')->select();
$log_grab_money=db('log_grab_money')->group('bill_of_loading_num')->select();
if(!$log_grab||!$log_grab_money){
$this->SystemError('暂无数据'); exit;
}
foreach($log_grab as $key=>$vo){
$list[] = array_merge($vo,$log_grab_money[$key]);
}
}
public function getname()
{
//$use=M('');
$db=db('business')->getDbFields();
$arr = $db[0] ? $db[0] : '';
foreach($arr as $key => $value)
{
$arrKey[] = $key;
}
}
}
| 25.213884 | 122 | 0.465808 |
05dbfcf8b89bbc56d036e597eec51697babb764c | 5,710 | py | Python | certsrv/certsrv.py | degagne/python-certsrv | 38fa73dedb087e9228a88a7877e8f3d18f5c460f | [
"MIT"
] | 1 | 2021-12-08T21:04:11.000Z | 2021-12-08T21:04:11.000Z | certsrv/certsrv.py | degagne/python-certsrv | 38fa73dedb087e9228a88a7877e8f3d18f5c460f | [
"MIT"
] | null | null | null | certsrv/certsrv.py | degagne/python-certsrv | 38fa73dedb087e9228a88a7877e8f3d18f5c460f | [
"MIT"
] | null | null | null | import re
import os
import requests
from contextlib import suppress
from typing import NoReturn, Union
from requests.auth import HTTPBasicAuth
from requests_ntlm3 import HttpNtlmAuth
from certsrv.utils import handle_response, find_error_response, retrieve_cert
from certsrv import DEFAULT_CA_FILE, USER_AGENT, PKI_HEADER, PKCS7_HEADER
from certsrv.errors import RequestDeniedError, CertificatePendingError
class Certsrv:
"""
Microsoft Active Directory Certificate Services.
This class provides an interface into the Certification Authority
Web Enrollment service, to create and retrieve certificates from
the Active Directory Certificate Servers (ADCS).
:param server: The FQDN of the Active Directory Certificate Service server.
:param username: The username for authentication
:param password: The password for authentication
:param auth_method: The authentication method. Either 'basic' or 'ntlm'.
Defaults to 'basic'.
:param cafile: A PEM file containing the CA certificates. Defaults to a
filesystem path defined by the OpenSSL library.
"""
def __init__(
self,
server: str,
username: str,
password: str,
auth_method: str = "basic",
cafile: str = None
) -> NoReturn:
""" class constructor """
self.server = server
self.auth_method = auth_method
self.session = requests.Session()
self.session.auth = self._set_credentials(username, password)
self.session.verify = cafile or DEFAULT_CA_FILE
self.session.headers = {"User-Agent": USER_AGENT}
def _set_credentials(
self,
username: str,
password: str
) -> Union[HttpNtlmAuth, HTTPBasicAuth]:
""" set credentials for ADCS authentication """
return HttpNtlmAuth(username, password, send_cbt=True) \
if self.auth_method == "ntlm" \
else HTTPBasicAuth(username, password)
@handle_response(expected_status_codes={200})
def _get(self, path: str, **kwargs: dict) -> requests.Response:
""" submit a get request to the ADCS server """
return self.session.get(os.path.join(self.server, path), **kwargs)
@handle_response(expected_status_codes={200, 201, 204})
def _post(self, path: str, **kwargs: dict) -> requests.Response:
""" submit a post request to the ADCS server """
return self.session.post(os.path.join(self.server, path), **kwargs)
def get_cert(self, csr: bytes, template: str, encoding="b64") -> str:
"""
Requests a certificate from the ADCS server.
:param csr: The certificate signing request (CSR) to submit.
:param template: The certificate template the certificate should
be issued from.
:param encoding: The desired encoding for the returned certificate.
:return: The issued certificate.
:raise CertificatePendingError: The request needs to be approved by
the CA admin.
:raise RequestDeniedError: The request was denied by the ADCS server.
"""
response = self._post("certsrv/certfnsh.asp", data={
"Mode": "newreq",
"CertRequest": csr,
"CertAttrib": f"CertificateTemplate:{template}",
"FriendlyType": "Saved-Request Certificate",
"TargetStoreFlags": "0",
"SaveCert": "yes"
})
try:
req_id = re.search(r'certnew.cer\?ReqID\=([0-9]+)', response.text).group(1)
except AttributeError:
if re.search(f"Certificate Pending", response.text):
with suppress(AttributeError):
req_id = re.search(
f"Your Request Id is ([0-9]+).", response.text).group(1)
raise CertificatePendingError(req_id)
raise RequestDeniedError(find_error_response(response.text))
return self.get_existing_cert(req_id, encoding)
@retrieve_cert(PKI_HEADER)
def get_existing_cert(self, req_id: int, encoding: str = "b64") -> str:
"""
Get an already created certificate from the ADCS server.
:param req_id: The request ID to retrieve.
:param encoding: The desired encoding for the returned certificate.
:return: The issued certificate.
:raise CertificateRetrievalError: If the certificate cannot be
retrieved.
"""
return self._get("certsrv/certnew.cer", params={
"ReqID": req_id,
"Enc": encoding
})
@retrieve_cert(PKI_HEADER)
def get_ca_cert(self, encoding: str = "b64") -> str:
"""
Get the latest CA certificate from the ADCS server.
:param encoding: The desired encoding for the returned certificate.
:return: The latest CA certificate.
:raise CertificateRetrievalError: If the certificate cannot be
retrieved.
"""
return self._get("certsrv/certnew.cer", params={
"ReqID": "CACert",
"Enc": encoding,
"Renewal": -1 # targets the latest certificate
})
@retrieve_cert(PKCS7_HEADER)
def get_ca_chain(self, encoding="b64") -> str:
"""
Get the CA chain from the ADCS server.
:param encoding: The desired encoding for the returned certificate.
:return: The CA chain in PKCS#7 format.
:raise CertificateRetrievalError: If the certificate cannot be
retrieved.
"""
return self._get("certsrv/certnew.p7b", params={
"ReqID": "CACert",
"Enc": encoding,
"Renewal": -1 # targets the latest certificate
})
| 37.81457 | 87 | 0.636953 |
a3989f3fe91c2ff92f89edf71ad0a5adb96cc3f8 | 10,521 | sql | SQL | bla/sql/Mycle_Produtos_08-04-2019.sql | gabriel-adel/MycleTestes | c3a777869a4934d6b160274d6fe7960ccb24ad24 | [
"Apache-2.0"
] | null | null | null | bla/sql/Mycle_Produtos_08-04-2019.sql | gabriel-adel/MycleTestes | c3a777869a4934d6b160274d6fe7960ccb24ad24 | [
"Apache-2.0"
] | null | null | null | bla/sql/Mycle_Produtos_08-04-2019.sql | gabriel-adel/MycleTestes | c3a777869a4934d6b160274d6fe7960ccb24ad24 | [
"Apache-2.0"
] | null | null | null | INSERT into Produtos(nomeProduto, cor, valorAtacad,valorVarejo,descProduto, codigoProduto, dataProduto,tamanhoMinimo,tamanhoMaximo,tag)
value('KarateGI Básico Mirim','branco','70.00','89.9','Básico 100% algodão','KBM',now(),2,8,'karate kimono infantil mirin algodão'),
('KarateGI Básico Infantil','branco','90.0','115.6','Básico 100% algodão','KB1',now(),10,40,'karate kimono infantil algodão'),
('KarateGI Básico Adulto','branco','105.0','134.9','Básico 100% algodão','KB2',now(),42,48,'karate kimono aldulto mirin algodão'),
('KarateGI Básico Adulto extra','branco','120.0','154.2','Básico 100% algodão','KB3',now(),50,56,'karate kimono adulto extra mirin algodão'),
('KarateGI MaxiPro Mirim','branco','90.0','115.6','MaxiPro PA 67%algod 33%poliest.','MPKM',now(),2,8,'karate kimono poliester infantil mirin algodão'),
('KarateGI MaxiPro Infantil','branco','115.0','147.7','MaxiPro PA 67%algod 33%poliest.','MPK1',now(),10,40,'karate kimono poliester infantil algodão'),
('KarateGI MaxiPro Adulto','branco','135.0','173.4','MaxiPro PA 67%algod 33%poliest.','MPK2',now(),42,48,'karate kimono adulto poliester algodão'),
('KarateGI MaxiPro Adulto extra','branco','160.0','205.5','MaxiPro PA 67%algod 33%poliest.','MPK3',now(),50,56,'karate kimono adulto extra poliester algodão'),
('KarateGI MaxiPro Mirim','preto','100.0','128.5','MaxiPro Preto - (Kobudo)','KBDM',now(),2,8,'karate kimono infantil mirin'),
('KarateGI MaxiPro Infantil','preto','125.0','160.6','MaxiPro Preto - (Kobudo)','KBD1',now(),10,40,'karate kimono infantil'),
('KarateGI MaxiPro Adulto','preto','150.0','192.7','MaxiPro Preto - (Kobudo)','KBD2',now(),42,48,'karate kimono adulto'),
('KarateGI MaxiPro Adulto extra','preto','185.0','237.7','MaxiPro Preto - (Kobudo)','KBD3',now(),50,56,'karate kimono adulto extra'),
('KarateGI "Europa" Mirim','branco','110.0','141.3','Europa liso e ou canelado (Lona PA 50%alg.50%poliest)','EPAM',now(),2,8,'karate kimono infantil poliester mirin algodão'),
('KarateGI "Europa" Infantil','branco','135.0','173.4','Europa liso e ou canelado (Lona PA 50%alg.50%poliest)','EPA1',now(),10,40,'karate kimono infantil poliester algodão'),
('KarateGI "Europa" Adulto','branco','165.0','212.0','Europa liso e ou canelado (Lona PA 50%alg.50%poliest)','EPA2',now(),42,48,'karate kimono adulto poliester algodão'),
('KarateGI "Europa" Adulto extra','branco','190.0','244.1','Europa liso e ou canelado (Lona PA 50%alg.50%poliest)','EPA3',now(),50,56,'karate kimono adulto poliester extra algodão'),
('KarateGI "Star" Mirim','branco','85.0','109.2','Olimpic Star (PAestrela Branco - 50%algod. 50%poliester)','OPSM',now(),2,8,'karate kimono infantil mirin poliester algodão'),
('KarateGI "Star" Infantil','branco','105.0','134.9','Olimpic Star (PAestrela Branco - 50%algod. 50%poliester)','OPS1',now(),10,40,'karate kimono infantil poliester algodão'),
('KarateGI "Star" Adulto','branco','125.0','160.6','Olimpic Star (PAestrela Branco - 50%algod. 50%poliester)','OPS2',now(),42,48,'karate kimono adulto poliester algodão'),
('KarateGI "Star" Adulto extra','branco','145.0','186.3','Olimpic Star (PAestrela Branco - 50%algod. 50%poliester)','OPS3',now(),50,56,'karate kimono poliester adulto extra algodão'),
('KarateGI "Olimpic" Mirim','branco','85.0','109.2','"OlimpicCanel" (PACnelado Branco-50%algod 50%poliester)','OPCM',now(),2,8,'karate kimono infantil mirin poliester algodão'),
('KarateGI "Olimpic" Infantil','branco','105.0','134.9','"OlimpicCanel" (PACnelado Branco-50%algod 50%poliester)','OPC1',now(),10,40,'karate kimono infantil poliester algodão'),
('KarateGI "Olimpic" Adulto','branco','125.0','160.6','"OlimpicCanel" (PACnelado Branco-50%algod 50%poliester)','OPC2',now(),42,48,'karate kimono adulto poliester algodão'),
('KarateGI "Olimpic" Adulto extra','branco','145.0','186.3','"OlimpicCanel" (PACnelado Branco-50%algod 50%poliester)','OPC3',now(),50,56,'karate kimono poliester adulto extra algodão'),
('KarateGI "Premium" Mirim','branco','168.0','215.8','Premium - indicado para KATA -100% algodão Branco','P10.M',now(),2,8,'karate kimono infantil mirin algodão'),
('KarateGI "Premium" Infantil','branco','210.0','269.8','Premium - indicado para KATA -100% algodão Branco','P10.1',now(),10,40,'karate kimono infantil algodão'),
('KarateGI "Premium" Adulto','branco','250.0','321.1','Premium - indicado para KATA -100% algodão Branco','P10.2',now(),42,48,'karate kimono adulto algodão'),
('KarateGI "Premium" Adulto extra','branco','292.0','375.1','Premium - indicado para KATA -100% algodão Branco','P10.3',now(),50,56,'karate kimono adulto extra algodão'),
('KarateGI Fight Mirim','branco','65.0','83.5','FIGHT microfibra 100% poliester - indicado para Shiai - Branco','ATVM',now(),2,8,'karate kimono infantil mirin algodão'),
('KarateGI Fight Infantil','branco','75.0','96.3','FIGHT microfibra 100% poliester - indicado para Shiai - Branco','ATV1',now(),10,40,'karate kimono infantil algodão'),
('KarateGI Fight Adulto','branco','90.0','115.6','FIGHT microfibra 100% poliester - indicado para Shiai - Branco','ATV2',now(),42,48,'karate kimono adulto algodão'),
('KarateGI Fight Adulto extra','branco','105.0','134.9','FIGHT microfibra 100% poliester - indicado para Shiai - Branco','ATV3',now(),50,56,'karate kimono adulto extra algodão'),
('AikidoGI Básico Mirim','branco','70.00','89.9','Básico 100% algodão','AKBM',now(),2,8,'aikido infantil mirin algodao kimono'),
('AikidoGI Básico Infantil','branco','90.0','115.6','Básico 100% algodão','AKB1',now(),10,40,'aikido infantil algodao kimono'),
('AikidoGI Básico Adulto','branco','105.0','134.9','Básico 100% algodão','AKB2',now(),42,48,'aikido adulto algodao kimono'),
('AikidoGI Básico Adulto extra','branco','120.0','154.2','Básico 100% algodão','AKB3',now(),50,56,'aikido adulto extra algodao kimono'),
('AikidoGI MaxiPro Mirim','branco','90.0','115.6','"MaxiPro" Reforçado branco','MPAM',now(),2,8,'aikido infantil mirim algodao kimono'),
('AikidoGI MaxiPro Infantil','branco','115.0','147.7','"MaxiPro" Reforçado branco','MPA1',now(),10,40,'aikido infantil algodao kimono'),
('AikidoGI MaxiPro Adulto','branco','135.0','173.4','"MaxiPro" Reforçado branco','MPB2',now(),42,48,'aikido adulto algodao kimono'),
('AikidoGI MaxiPro Adulto extra','branco','160.0','205.5','"MaxiPro" Reforçado branco','MPC3',now(),50,56,'aikido adulto extra algodao kimono'),
('AikidoGI Trançadinho Mirim','preto','80.0','102.8','"Trançadinho" Reforçado 100% Algodão Branco','TIAKM',now(),2,8,'trançadinho aikido infantil mirim kobudo algodao kimono'),
('AikidoGI Trançadinho Infantil','preto','95.0','122.6','"Trançadinho" Reforçado 100% Algodão Branco','TIAK1',now(),10,40,'trançadinho aikido infantil kobudo algodao kimono'),
('AikidoGI Trançadinho Adulto','preto','115.0','147.7','"Trançadinho" Reforçado 100% Algodão Branco','TIAK2',now(),42,48,'trançadinho aikido adulto kobudo algodao kimono'),
('AikidoGI Trançadinho Adulto extra','preto','135.0','173.4','"Trançadinho" Reforçado 100% Algodão Branco','TIAK3',now(),50,56,'trançadinho aikido adulto extra kobudo algodao kimono'),
('AikidoGI "Europeu" Mirim','branco','110.0','141.3','Europa liso e ou canelado (Lona PA 50%alg.50%poliest)','EAKM',now(),2,8,'aikido europeu mirim algodao poliester infantil algodao kimono'),
('AikidoGI "Europeu" Infantil','branco','135.0','173.4','Europa liso e ou canelado (Lona PA 50%alg.50%poliest)','EAK1',now(),10,40,'aikido trançadinho infantil algodao algodao poliester kimono'),
('AikidoGI "Europeu" trançadinho Adulto','branco','165.0','212.0','Europa liso e ou canelado (Lona PA 50%alg.50%poliest)','EAK2',now(),42,48,'aikido trançadinho adulto algodao poliester algodao kimono'),
('AikidoGI "Europeu" Adulto trançadinho extra','branco','190.0','244.1','Europa liso e ou canelado (Lona PA 50%alg.50%poliest)','EAK3',now(),50,56,'aikido trançadinho adulto extra algodao poliester algodao kimono'),
('AikidoGI "Canelado" Mirim','branco','110.0','141.3','OlimpicStar (PAestrela Branco - 50%algod. 50%poliester)','OAKM',now(),2,8,'aikido infantil mirim algodao poliester algodao kimono'),
('AikidoGI "Canelado" Infantil','branco','135.0','173.4','OlimpicStar (PAestrela Branco - 50%algod. 50%poliester)','OAK1',now(),10,40,'aikido infantil algodao poliester algodao kimono'),
('AikidoGI "Canelado" Adulto','branco','165.0','212.0','OlimpicStar (PAestrela Branco - 50%algod. 50%poliester)','OAK2',now(),42,48,'aikido adulto algodao poliester algodao kimono'),
('AikidoGI "Canelado" Adulto extra','branco','190.0','244.1','OlimpicStar (PAestrela Branco - 50%algod. 50%poliester)','OPS3',now(),50,56,'aikido adulto extra algodao poliester algodao kimono'),
('AikidoGI "Star" Mirim','branco','85.0','109.0','OlimpicStar (PAestrela Branco - 50%algod. 50%poliester)','OASM',now(),2,8,'aikido infantil mirim algodao kimono'),
('AikidoGI "Star" Infantil','branco','105.0','134.9','OlimpicStar (PAestrela Branco - 50%algod. 50%poliester)','OAS1',now(),10,40,'aikido infantil algodao kimono'),
('AikidoGI "Star" Adulto','branco','125.0','160.6','OlimpicStar (PAestrela Branco - 50%algod. 50%poliester)','OAS2',now(),42,48,'aikido adulto algodao kimono'),
('AikidoGI "Star" Adulto extra','branco','145.0','186.3','OlimpicStar (PAestrela Branco - 50%algod. 50%poliester)','OAS3',now(),50,56,'aikido adulto extra algodao kimono'),
('AikidoGI Trançado Mirim','branco','110.0','141.3','"Trançado XLVIII" Reforçado 100% algodão Branco','TAKM',now(),2,8,'aikido infantil mirim algodao kimono'),
('AikidoGI Trançado Infantil','branco','130.0','167.0','"Trançado XLVIII" Reforçado 100% algodão Branco','TAK1',now(),10,40,'aikido infantil algodao kimono'),
('AikidoGI Trançado Adulto','branco','160.0','205.5','"Trançado XLVIII" Reforçado 100% algodão Branco','TAK2',now(),42,48,'aikido adulto algodao kimono'),
('AikidoGI Trançado Adulto extra','branco','185.0','237.7','"Trançado XLVIII" Reforçado 100% algodão Branco','TAK3',now(),50,56,'aikido adulto extra algodao kimono'),
('AikidoGI Losango Mirim','branco','110.0','141.3','FIGHT - indicado para KATA -100% algodão','ALSM',now(),2,8,'aikido infantil mirim algodao kimono'),
('AikidoGI Losango Infantil','branco','135.0','173.4','FIGHT - indicado para KATA -100% algodão','ALS1',now(),10,40,'aikido infantil algodao kimono'),
('AikidoGI Losango Adulto','branco','160.0','205.5','FIGHT - indicado para KATA -100% algodão','ALS2',now(),42,48,'aikido adulto algodao kimono'),
('AikidoGI Losango Adulto extra','branco','190.0','244.1','FIGHT - indicado para KATA -100% algodão','ALS3',now(),50,56,'aikido adulto extra algodao kimono');
| 154.720588 | 215 | 0.71286 |
0173d90dcdb3c7a1dcf0d997c1847b07447f4422 | 11,978 | sql | SQL | bankedhour.sql | Tajjammul/Bank-Hours-Managemant-System | 7a174d5d244e6e0c6a2e08c9edf3bdddcf833e0e | [
"MIT"
] | null | null | null | bankedhour.sql | Tajjammul/Bank-Hours-Managemant-System | 7a174d5d244e6e0c6a2e08c9edf3bdddcf833e0e | [
"MIT"
] | 2 | 2021-03-10T16:46:59.000Z | 2022-02-19T01:35:16.000Z | bankedhour.sql | Tajjammul/Bank-Hours-Managemant-System | 7a174d5d244e6e0c6a2e08c9edf3bdddcf833e0e | [
"MIT"
] | null | null | null | -- phpMyAdmin SQL Dump
-- version 4.7.4
-- https://www.phpmyadmin.net/
--
-- Host: 127.0.0.1
-- Generation Time: May 01, 2020 at 01:47 PM
-- Server version: 10.1.28-MariaDB
-- PHP Version: 7.2.12
SET SQL_MODE = "NO_AUTO_VALUE_ON_ZERO";
SET AUTOCOMMIT = 0;
START TRANSACTION;
SET time_zone = "+00:00";
/*!40101 SET @OLD_CHARACTER_SET_CLIENT=@@CHARACTER_SET_CLIENT */;
/*!40101 SET @OLD_CHARACTER_SET_RESULTS=@@CHARACTER_SET_RESULTS */;
/*!40101 SET @OLD_COLLATION_CONNECTION=@@COLLATION_CONNECTION */;
/*!40101 SET NAMES utf8mb4 */;
--
-- Database: `bankedhour`
--
-- --------------------------------------------------------
--
-- Table structure for table `clients`
--
CREATE TABLE `clients` (
`id` bigint(20) UNSIGNED NOT NULL,
`first_name` varchar(191) COLLATE utf8mb4_unicode_ci NOT NULL,
`middle_name` varchar(191) COLLATE utf8mb4_unicode_ci DEFAULT NULL,
`last_name` varchar(191) COLLATE utf8mb4_unicode_ci NOT NULL,
`phone` varchar(191) COLLATE utf8mb4_unicode_ci NOT NULL,
`email` varchar(191) COLLATE utf8mb4_unicode_ci NOT NULL,
`country` varchar(191) COLLATE utf8mb4_unicode_ci NOT NULL,
`city` varchar(191) COLLATE utf8mb4_unicode_ci NOT NULL,
`state` varchar(191) COLLATE utf8mb4_unicode_ci NOT NULL,
`zip` varchar(191) COLLATE utf8mb4_unicode_ci NOT NULL,
`timezone` varchar(191) COLLATE utf8mb4_unicode_ci NOT NULL,
`website` varchar(191) COLLATE utf8mb4_unicode_ci NOT NULL,
`about` longtext COLLATE utf8mb4_unicode_ci NOT NULL,
`picture` varchar(191) COLLATE utf8mb4_unicode_ci DEFAULT NULL,
`created_at` timestamp NULL DEFAULT NULL,
`updated_at` timestamp NULL DEFAULT NULL
) ENGINE=InnoDB DEFAULT CHARSET=utf8mb4 COLLATE=utf8mb4_unicode_ci;
--
-- Dumping data for table `clients`
--
INSERT INTO `clients` (`id`, `first_name`, `middle_name`, `last_name`, `phone`, `email`, `country`, `city`, `state`, `zip`, `timezone`, `website`, `about`, `picture`, `created_at`, `updated_at`) VALUES
(1, 'tajjammul', NULL, 'Zaman', '455521', '[email protected]', 'Pakistan', 'Lahore', 'Lahore', '55444', 'pakistan', 'https://www.repairplus.ae/', 'this is a test clients', NULL, '2020-04-22 10:14:11', '2020-04-28 04:45:44');
-- --------------------------------------------------------
--
-- Table structure for table `companies`
--
CREATE TABLE `companies` (
`id` bigint(20) UNSIGNED NOT NULL,
`name` varchar(191) COLLATE utf8mb4_unicode_ci NOT NULL,
`email` varchar(191) COLLATE utf8mb4_unicode_ci NOT NULL,
`country` varchar(191) COLLATE utf8mb4_unicode_ci NOT NULL,
`city` varchar(191) COLLATE utf8mb4_unicode_ci NOT NULL,
`state` varchar(191) COLLATE utf8mb4_unicode_ci NOT NULL,
`zip` varchar(191) COLLATE utf8mb4_unicode_ci NOT NULL,
`lead_person` varchar(191) COLLATE utf8mb4_unicode_ci NOT NULL,
`website` varchar(191) COLLATE utf8mb4_unicode_ci NOT NULL,
`created_at` timestamp NULL DEFAULT NULL,
`updated_at` timestamp NULL DEFAULT NULL
) ENGINE=InnoDB DEFAULT CHARSET=utf8mb4 COLLATE=utf8mb4_unicode_ci;
--
-- Dumping data for table `companies`
--
INSERT INTO `companies` (`id`, `name`, `email`, `country`, `city`, `state`, `zip`, `lead_person`, `website`, `created_at`, `updated_at`) VALUES
(1, 'NextBridge', '[email protected]', 'Pakistan', 'Lahore', 'Lahore', '55444', 'Majid Ali', 'http://nxb.com.pk', '2020-04-29 03:43:34', '2020-04-29 03:43:34');
-- --------------------------------------------------------
--
-- Table structure for table `failed_jobs`
--
CREATE TABLE `failed_jobs` (
`id` bigint(20) UNSIGNED NOT NULL,
`connection` text COLLATE utf8mb4_unicode_ci NOT NULL,
`queue` text COLLATE utf8mb4_unicode_ci NOT NULL,
`payload` longtext COLLATE utf8mb4_unicode_ci NOT NULL,
`exception` longtext COLLATE utf8mb4_unicode_ci NOT NULL,
`failed_at` timestamp NOT NULL DEFAULT CURRENT_TIMESTAMP
) ENGINE=InnoDB DEFAULT CHARSET=utf8mb4 COLLATE=utf8mb4_unicode_ci;
-- --------------------------------------------------------
--
-- Table structure for table `migrations`
--
CREATE TABLE `migrations` (
`id` int(10) UNSIGNED NOT NULL,
`migration` varchar(191) COLLATE utf8mb4_unicode_ci NOT NULL,
`batch` int(11) NOT NULL
) ENGINE=InnoDB DEFAULT CHARSET=utf8mb4 COLLATE=utf8mb4_unicode_ci;
--
-- Dumping data for table `migrations`
--
INSERT INTO `migrations` (`id`, `migration`, `batch`) VALUES
(1, '2014_10_12_000000_create_users_table', 1),
(2, '2014_10_12_100000_create_password_resets_table', 1),
(3, '2019_08_19_000000_create_failed_jobs_table', 1),
(4, '2020_04_22_115235_create_clients_table', 2),
(5, '2020_04_28_091346_create_companies_table', 3),
(6, '2020_04_28_120411_create_projects_table', 4),
(7, '2020_04_29_110520_create_project_client_relation_table', 5),
(8, '2020_04_29_110708_create_project_company_relation_table', 5),
(10, '2020_05_01_092800_create_tasks_table', 6);
-- --------------------------------------------------------
--
-- Table structure for table `password_resets`
--
CREATE TABLE `password_resets` (
`email` varchar(191) COLLATE utf8mb4_unicode_ci NOT NULL,
`token` varchar(191) COLLATE utf8mb4_unicode_ci NOT NULL,
`created_at` timestamp NULL DEFAULT NULL
) ENGINE=InnoDB DEFAULT CHARSET=utf8mb4 COLLATE=utf8mb4_unicode_ci;
-- --------------------------------------------------------
--
-- Table structure for table `projects`
--
CREATE TABLE `projects` (
`id` bigint(20) UNSIGNED NOT NULL,
`name` varchar(191) COLLATE utf8mb4_unicode_ci NOT NULL,
`description` longtext COLLATE utf8mb4_unicode_ci NOT NULL,
`staging_url` varchar(191) COLLATE utf8mb4_unicode_ci NOT NULL,
`live_url` varchar(191) COLLATE utf8mb4_unicode_ci NOT NULL,
`document` varchar(191) COLLATE utf8mb4_unicode_ci NOT NULL,
`git` varchar(191) COLLATE utf8mb4_unicode_ci NOT NULL,
`created_at` timestamp NULL DEFAULT NULL,
`updated_at` timestamp NULL DEFAULT NULL
) ENGINE=InnoDB DEFAULT CHARSET=utf8mb4 COLLATE=utf8mb4_unicode_ci;
--
-- Dumping data for table `projects`
--
INSERT INTO `projects` (`id`, `name`, `description`, `staging_url`, `live_url`, `document`, `git`, `created_at`, `updated_at`) VALUES
(1, 'NextBridge', 'this is atesting demo', 'http://staging.com', 'http://test.com', 'http://127.0.0.1:8000/file/upload/1588169802.txt', 'http://testgit.com', '2020-04-29 05:58:53', '2020-04-29 09:26:06');
-- --------------------------------------------------------
--
-- Table structure for table `project_client_relation`
--
CREATE TABLE `project_client_relation` (
`id` bigint(20) UNSIGNED NOT NULL,
`client_id` bigint(20) NOT NULL,
`project_id` bigint(20) NOT NULL,
`created_at` timestamp NULL DEFAULT NULL,
`updated_at` timestamp NULL DEFAULT NULL
) ENGINE=InnoDB DEFAULT CHARSET=utf8mb4 COLLATE=utf8mb4_unicode_ci;
--
-- Dumping data for table `project_client_relation`
--
INSERT INTO `project_client_relation` (`id`, `client_id`, `project_id`, `created_at`, `updated_at`) VALUES
(3, 1, 1, '2020-04-29 09:26:07', '2020-04-29 09:26:07');
-- --------------------------------------------------------
--
-- Table structure for table `project_company_relation`
--
CREATE TABLE `project_company_relation` (
`id` bigint(20) UNSIGNED NOT NULL,
`company_id` bigint(20) NOT NULL,
`project_id` bigint(20) NOT NULL,
`created_at` timestamp NULL DEFAULT NULL,
`updated_at` timestamp NULL DEFAULT NULL
) ENGINE=InnoDB DEFAULT CHARSET=utf8mb4 COLLATE=utf8mb4_unicode_ci;
-- --------------------------------------------------------
--
-- Table structure for table `tasks`
--
CREATE TABLE `tasks` (
`id` bigint(20) UNSIGNED NOT NULL,
`title` varchar(191) COLLATE utf8mb4_unicode_ci NOT NULL,
`description` longtext COLLATE utf8mb4_unicode_ci,
`status` varchar(191) COLLATE utf8mb4_unicode_ci NOT NULL,
`progress` double NOT NULL,
`consumed_hours` int(11) NOT NULL,
`consumed_mins` int(11) NOT NULL,
`parent_id` bigint(20) DEFAULT NULL,
`project_id` bigint(20) NOT NULL,
`created_at` timestamp NULL DEFAULT NULL,
`updated_at` timestamp NULL DEFAULT NULL
) ENGINE=InnoDB DEFAULT CHARSET=utf8mb4 COLLATE=utf8mb4_unicode_ci;
--
-- Dumping data for table `tasks`
--
INSERT INTO `tasks` (`id`, `title`, `description`, `status`, `progress`, `consumed_hours`, `consumed_mins`, `parent_id`, `project_id`, `created_at`, `updated_at`) VALUES
(2, 'Task 1', 'lorem ipsum dolar site amet', 'under process', 23, 3, 0, NULL, 1, '2020-05-01 06:02:43', '2020-05-01 06:02:43');
-- --------------------------------------------------------
--
-- Table structure for table `users`
--
CREATE TABLE `users` (
`id` bigint(20) UNSIGNED NOT NULL,
`name` varchar(191) COLLATE utf8mb4_unicode_ci NOT NULL,
`email` varchar(191) COLLATE utf8mb4_unicode_ci NOT NULL,
`email_verified_at` timestamp NULL DEFAULT NULL,
`password` varchar(191) COLLATE utf8mb4_unicode_ci NOT NULL,
`remember_token` varchar(100) COLLATE utf8mb4_unicode_ci DEFAULT NULL,
`created_at` timestamp NULL DEFAULT NULL,
`updated_at` timestamp NULL DEFAULT NULL
) ENGINE=InnoDB DEFAULT CHARSET=utf8mb4 COLLATE=utf8mb4_unicode_ci;
--
-- Dumping data for table `users`
--
INSERT INTO `users` (`id`, `name`, `email`, `email_verified_at`, `password`, `remember_token`, `created_at`, `updated_at`) VALUES
(1, 'Tajjammul Zaman', '[email protected]', NULL, '$2y$10$gNXMxgknOXYC6v.Z7ASwKeKXifU43ITUz.MwMs6ejMS.e2VAer4f2', NULL, '2020-04-21 09:41:24', '2020-04-21 09:41:24');
--
-- Indexes for dumped tables
--
--
-- Indexes for table `clients`
--
ALTER TABLE `clients`
ADD PRIMARY KEY (`id`);
--
-- Indexes for table `companies`
--
ALTER TABLE `companies`
ADD PRIMARY KEY (`id`);
--
-- Indexes for table `failed_jobs`
--
ALTER TABLE `failed_jobs`
ADD PRIMARY KEY (`id`);
--
-- Indexes for table `migrations`
--
ALTER TABLE `migrations`
ADD PRIMARY KEY (`id`);
--
-- Indexes for table `password_resets`
--
ALTER TABLE `password_resets`
ADD KEY `password_resets_email_index` (`email`);
--
-- Indexes for table `projects`
--
ALTER TABLE `projects`
ADD PRIMARY KEY (`id`);
--
-- Indexes for table `project_client_relation`
--
ALTER TABLE `project_client_relation`
ADD PRIMARY KEY (`id`);
--
-- Indexes for table `project_company_relation`
--
ALTER TABLE `project_company_relation`
ADD PRIMARY KEY (`id`);
--
-- Indexes for table `tasks`
--
ALTER TABLE `tasks`
ADD PRIMARY KEY (`id`);
--
-- Indexes for table `users`
--
ALTER TABLE `users`
ADD PRIMARY KEY (`id`),
ADD UNIQUE KEY `users_email_unique` (`email`);
--
-- AUTO_INCREMENT for dumped tables
--
--
-- AUTO_INCREMENT for table `clients`
--
ALTER TABLE `clients`
MODIFY `id` bigint(20) UNSIGNED NOT NULL AUTO_INCREMENT, AUTO_INCREMENT=2;
--
-- AUTO_INCREMENT for table `companies`
--
ALTER TABLE `companies`
MODIFY `id` bigint(20) UNSIGNED NOT NULL AUTO_INCREMENT, AUTO_INCREMENT=2;
--
-- AUTO_INCREMENT for table `failed_jobs`
--
ALTER TABLE `failed_jobs`
MODIFY `id` bigint(20) UNSIGNED NOT NULL AUTO_INCREMENT;
--
-- AUTO_INCREMENT for table `migrations`
--
ALTER TABLE `migrations`
MODIFY `id` int(10) UNSIGNED NOT NULL AUTO_INCREMENT, AUTO_INCREMENT=11;
--
-- AUTO_INCREMENT for table `projects`
--
ALTER TABLE `projects`
MODIFY `id` bigint(20) UNSIGNED NOT NULL AUTO_INCREMENT, AUTO_INCREMENT=2;
--
-- AUTO_INCREMENT for table `project_client_relation`
--
ALTER TABLE `project_client_relation`
MODIFY `id` bigint(20) UNSIGNED NOT NULL AUTO_INCREMENT, AUTO_INCREMENT=4;
--
-- AUTO_INCREMENT for table `project_company_relation`
--
ALTER TABLE `project_company_relation`
MODIFY `id` bigint(20) UNSIGNED NOT NULL AUTO_INCREMENT;
--
-- AUTO_INCREMENT for table `tasks`
--
ALTER TABLE `tasks`
MODIFY `id` bigint(20) UNSIGNED NOT NULL AUTO_INCREMENT, AUTO_INCREMENT=3;
--
-- AUTO_INCREMENT for table `users`
--
ALTER TABLE `users`
MODIFY `id` bigint(20) UNSIGNED NOT NULL AUTO_INCREMENT, AUTO_INCREMENT=2;
COMMIT;
/*!40101 SET CHARACTER_SET_CLIENT=@OLD_CHARACTER_SET_CLIENT */;
/*!40101 SET CHARACTER_SET_RESULTS=@OLD_CHARACTER_SET_RESULTS */;
/*!40101 SET COLLATION_CONNECTION=@OLD_COLLATION_CONNECTION */;
| 31.856383 | 230 | 0.698197 |
eee158e5dd153c87f7445449e061f1bd39bb5598 | 6,891 | go | Go | pkg/install.go | borkod/kindly | f6de65b1fe94a266e5669c7e2f99cb512f5b0642 | [
"Apache-2.0"
] | null | null | null | pkg/install.go | borkod/kindly | f6de65b1fe94a266e5669c7e2f99cb512f5b0642 | [
"Apache-2.0"
] | 7 | 2021-04-25T15:43:32.000Z | 2021-04-25T15:54:09.000Z | pkg/install.go | borkod/kindly | f6de65b1fe94a266e5669c7e2f99cb512f5b0642 | [
"Apache-2.0"
] | null | null | null | package pkg
import (
"bufio"
"bytes"
"context"
"crypto/sha256"
"encoding/hex"
"errors"
"io"
"io/ioutil"
"net"
"net/http"
"os"
"path/filepath"
"strings"
"text/template"
"time"
)
// Install function implements install command
func (k Kindly) Install(ctx context.Context, p string, f bool, u bool) (err error) {
if f && u {
return errors.New("Only one of 'file' or 'url' flags can be set.")
}
if u {
if !isValidUrl(p) {
return errors.New("Invalid URL.")
}
}
// Create a temporary directory where files will be downloaded
tmpDir, err := ioutil.TempDir("", "kindly_")
if err != nil {
k.logger.Println(err)
os.Exit(1)
}
// Clean up temporary directory
defer os.RemoveAll(tmpDir)
var tmpFile string
var yc KindlyStruct
var dl dlInfo
if dl, yc, err = k.getValidYConfig(ctx, p, f, u); err != nil {
return err
}
// Applies Version values to the URL template
if dl.URL, dl.URLSHA, err = executeURL(dl, yc); err != nil {
return err
}
// Downloads package file and package SHA file.
// Calculates package SHA value
// Compares package SHA value to SHA value in the SHA file
if tmpFile, err = k.processFile(ctx, dl, tmpDir); err != nil {
return err
}
// decompress tmpFile into tmpDir
if strings.Contains(tmpFile, "tar.gz") {
if err = decompress(tmpDir, tmpFile); err != nil {
return err
}
}
if strings.Contains(tmpFile, "zip") {
if _, err = unzip(tmpFile, tmpDir); err != nil {
return err
}
}
var l pkgManifest
l.Name = dl.Name
l.Date = time.Now().Format("2006-01-02 15:04:05")
l.Version = dl.Version
l.Source = dl.Source
// Copy all extracted bin files from tmpDir into OutBinDir
for _, n := range yc.Spec.Bin {
if strings.Contains(strings.ReplaceAll(n, " ", ""), "{{.OS}}") ||
strings.Contains(strings.ReplaceAll(n, " ", ""), "{{.Arch}}") {
if n, err = executeBin(n, k.cfg.OS, k.cfg.Arch); err != nil {
k.logger.Println("ERROR")
k.logger.Println(err)
continue
}
}
if k.cfg.OS == "windows" {
n = n + ".exe"
}
cpBool := false
if cpBool, err = copyFile(k.cfg.OutBinDir, tmpDir, n); err != nil {
k.logger.Println("ERROR")
k.logger.Println(err)
}
if cpBool {
l.Bin = append(l.Bin, n)
}
}
// Copy all extracted completion files from tmpDir into OutCompletionDir
for _, n := range yc.Spec.Completion[k.cfg.Completion] {
cpBool := false
if cpBool, err = copyFile(k.cfg.OutCompletionDir, tmpDir, n); err != nil {
k.logger.Println("ERROR")
k.logger.Println(err)
}
if cpBool {
l.Completion = append(l.Completion, n)
}
}
// Copy all extracted man pages files from tmpDir into OutManDir
for _, n := range yc.Spec.Man {
cpBool := false
if cpBool, err = copyFile(k.cfg.OutManDir, tmpDir, n); err != nil {
k.logger.Println("ERROR")
k.logger.Println(err)
}
if cpBool {
l.Man = append(l.Man, n)
}
}
// Write the package manifest file
if err = writeManifest(l, k.cfg.ManifestDir); err != nil {
k.logger.Println(("ERROR"))
k.logger.Println(err)
}
return nil
}
// Downloads package file and package SHA file.
// Calculates package SHA value
// Compares package SHA value to SHA value in the SHA file
func (k Kindly) processFile(ctx context.Context, dl dlInfo, tmpDir string) (string, error) {
// Get the data
if k.cfg.Verbose {
k.logger.Println("Downloading file: ", dl.URL)
}
const ConnectMaxWaitTime = 1 * time.Second
const RequestMaxWaitTime = 5 * time.Second
client := http.Client{
Transport: &http.Transport{
DialContext: (&net.Dialer{
Timeout: ConnectMaxWaitTime,
}).DialContext,
},
}
ctx, cancel := context.WithTimeout(ctx, RequestMaxWaitTime)
defer cancel()
req, err := http.NewRequestWithContext(ctx, http.MethodGet, dl.URL, nil)
if err != nil {
return "", err
}
resp, err := client.Do(req)
if err != nil {
return "", err
}
defer resp.Body.Close()
// DO I REALLY NEED TWO COPIES!?
var buf1, buf2 bytes.Buffer
w := io.MultiWriter(&buf1, &buf2)
if _, err := io.Copy(w, resp.Body); err != nil {
return "", err
}
if k.cfg.Verbose {
k.logger.Println("Download finished.")
}
// Calculate SHA256 of downloaded file
hash := sha256.New()
if _, err := io.Copy(hash, &buf1); err != nil {
return "", err
}
sum := hex.EncodeToString(hash.Sum(nil))
if k.cfg.Verbose {
k.logger.Println("Calculated SHA256 value: ", sum)
}
// Get the sha file
if len(dl.URLSHA) > 1 {
if k.cfg.Verbose {
k.logger.Println("Downloading SHA256 file: ", dl.URLSHA)
}
req, err := http.NewRequestWithContext(ctx, http.MethodGet, dl.URLSHA, nil)
if err != nil {
return "", err
}
respSha, err := client.Do(req)
if err != nil {
return "", err
}
defer respSha.Body.Close()
//buf := new(bytes.Buffer)
newStr := ""
//buf.ReadFrom(respSha.Body)
scanner := bufio.NewScanner(respSha.Body)
for scanner.Scan() {
shaLine := strings.SplitN(scanner.Text(), " ", 2)
if len(shaLine) > 1 {
if strings.Contains(shaLine[1], k.cfg.OS) && strings.Contains(shaLine[1], k.cfg.Arch) {
newStr = shaLine[0]
}
} else {
newStr = shaLine[0]
}
}
// Get the sha file
if k.cfg.Verbose {
k.logger.Println("SHA256 file hash value: ", newStr)
}
// Check if SHA256 values match
if newStr != sum {
return "", errors.New("SHA MISMATCH")
}
} else if k.cfg.Verbose {
k.logger.Println("NO SHA FILE PROVIDED. SKIPPING SHA VALUE CHECK")
}
// Create the output file in temporary
urlPath := strings.Split(dl.URL, "/")
filepath := filepath.Join(tmpDir, urlPath[len(urlPath)-1])
if k.cfg.Verbose {
k.logger.Println("Writing output file: ", filepath)
}
out, err := os.Create(filepath)
if err != nil {
return "", err
}
defer out.Close()
// Write the body to file
_, err = io.Copy(out, &buf2)
return filepath, err
}
// Applies OS and Architecture values to the binary file names template
func executeBin(n string, os string, arch string) (string, error) {
binT, err := template.New("bin").Parse(n)
if err != nil {
return "", err
}
type binS struct {
OS string
Arch string
}
nS := binS{os, arch}
var buf bytes.Buffer
if err = binT.Execute(&buf, nS); err != nil {
return "", err
}
newStr := buf.String()
if os == "windows" {
newStr = newStr + ".exe"
}
return newStr, nil
}
// Applies Version values to the URL template
func executeURL(dl dlInfo, yc KindlyStruct) (string, string, error) {
urlT, err := template.New("url").Parse(yc.Spec.Assets[dl.osArch].URL)
if err != nil {
return "", "", err
}
urlShaT, err := template.New("urlSha").Parse(yc.Spec.Assets[dl.osArch].ShaURL)
if err != nil {
return "", "", err
}
var buf bytes.Buffer
if err = urlT.Execute(&buf, dl); err != nil {
return "", "", err
}
url := buf.String()
buf.Reset()
if err = urlShaT.Execute(&buf, dl); err != nil {
return "", "", err
}
urlSha := buf.String()
return url, urlSha, nil
}
| 21.73817 | 92 | 0.639385 |
38957a566d3866537b705375e40110549222dd61 | 2,621 | php | PHP | resources/views/footer.blade.php | BorislavStrings/SpaceEducation | 9e3a4544368fb0669326ae47d33bba7f8d29335b | [
"MIT"
] | null | null | null | resources/views/footer.blade.php | BorislavStrings/SpaceEducation | 9e3a4544368fb0669326ae47d33bba7f8d29335b | [
"MIT"
] | null | null | null | resources/views/footer.blade.php | BorislavStrings/SpaceEducation | 9e3a4544368fb0669326ae47d33bba7f8d29335b | [
"MIT"
] | null | null | null | <footer>
<div class="container">
<div class="row">
<div class="col-lg-4 copyright col-xs-12 col-sm-12">
Copyright 2016 - All rights reserved
</div>
<div class="col-lg-5 col-xs-12 col-sm-12">
<nav class="links">
<div class="item"><a href="https://www.spaceedu.net/about-the-program/" target="_blank">{{ trans('footer.about_us') }}</a></div>
<div class="item"><a href="https://www.spaceedu.net/#filter=.contact" target="_blank">{{ trans('footer.contact_us') }}</a></div>
<div class="item"><a href="https://www.spaceedu.net/terms-and-conditions/" target="_blank">{{ trans('footer.terms') }}</a></div>
</nav>
<a class="partner" href="http://www.americaforbulgaria.org" target="_blank" rel="nofollow">
<img src="https://cdn.spaceedu.net/images/Logo-America-for-Bulgaria.png" alt="America for Bulgaria - Partner" width="115px" height="62px">
</a>
</div>
<div class="col-lg-3 col-xs-12 col-sm-12">
<a class="social_button" href="https://www.facebook.com/SpaceChallenges" target="_blank" rel="nofollow">
<img title="Facebook" alt="Facebook" src="https://cdn.spaceedu.net/images/facebook.png" width="40" height="40">
</a>
<a class="social_button" href="https://www.instagram.com/spacechallenges/" target="_blank" rel="nofollow">
<img title="Instagram" alt="Instagram" src="https://cdn.spaceedu.net/images/instagram.png" width="40" height="40">
</a>
<a class="social_button" href="https://plus.google.com/u/0/b/111184476547955784344/111043486892084047315/about?pageId=111184476547955784344" target="_blank" rel="nofollow">
<img title="Google Plus" alt="Google Plus" src="https://cdn.spaceedu.net/images/google.png" width="40" height="40">
</a>
<a class="social_button" href="https://twitter.com/spacechallenges/" target="_blank" rel="nofollow">
<img title="Instagram" alt="Twitter" src="https://cdn.spaceedu.net/images/twitter.png" width="40" height="40">
</a>
<a class="social_button" href="https://www.youtube.com/user/SpaceChallenges/" target="_blank" rel="nofollow">
<img title="YouTube" alt="YouTube" src="https://cdn.spaceedu.net/images/youtube.png" width="40" height="40">
</a>
</div>
</div>
</div>
</footer> | 72.805556 | 188 | 0.571156 |
25ee0cce5911b464b5db074d42d1a1791c47266a | 557 | cs | C# | Engine/LivingCreature.cs | sarahjfreitas/SuperAdventure | 0260988baa9734378b87a0a5254ae76fcdbbc598 | [
"MIT"
] | null | null | null | Engine/LivingCreature.cs | sarahjfreitas/SuperAdventure | 0260988baa9734378b87a0a5254ae76fcdbbc598 | [
"MIT"
] | null | null | null | Engine/LivingCreature.cs | sarahjfreitas/SuperAdventure | 0260988baa9734378b87a0a5254ae76fcdbbc598 | [
"MIT"
] | null | null | null | using System;
using System.Collections.Generic;
using System.Linq;
using System.Text;
using System.Threading.Tasks;
namespace Engine
{
public class LivingCreature
{
public int MaximumHitPoints { get; set; }
public int CurrentHitPoints { get; set; }
public int Level { get; set; }
public LivingCreature(int currentHitPoints, int maximumHitPoints, int level = 1)
{
CurrentHitPoints = currentHitPoints;
MaximumHitPoints = maximumHitPoints;
Level = level;
}
}
}
| 24.217391 | 88 | 0.642729 |
a9546c5df716a4900a59e28200e4975f5cceff7a | 302 | sql | SQL | src/sql/laboratory.sql | usnistgov/NeXLDatabase.jl | 7c1cd0bbf1407a7216b3760bcf361490a3dbc8b0 | [
"Unlicense"
] | null | null | null | src/sql/laboratory.sql | usnistgov/NeXLDatabase.jl | 7c1cd0bbf1407a7216b3760bcf361490a3dbc8b0 | [
"Unlicense"
] | null | null | null | src/sql/laboratory.sql | usnistgov/NeXLDatabase.jl | 7c1cd0bbf1407a7216b3760bcf361490a3dbc8b0 | [
"Unlicense"
] | null | null | null | CREATE TABLE LABORATORY (
PKEY INTEGER PRIMARY KEY AUTOINCREMENT,
NAME TEXT NOT NULL,
CONTACT INT NOT NULL,
FOREIGN KEY(CONTACT) REFERENCES PERSON(PKEY)
);
CREATE INDEX LABORATORY_NAME_INDEX ON LABORATORY(NAME);
INSERT INTO LABORATORY ( NAME, CONTACT ) VALUES ( "NIST MML MMSD", 1 );
| 27.454545 | 71 | 0.731788 |
43b8ed6a8a12bab37fd2b54110bca98817242f8b | 495 | ts | TypeScript | src/main/typescript/wcardinal/ui/d-picker-time-bound-constant.ts | kagechan/winter-cardinal-ui | c5303cc46e27636cb7989d5a88974678dec423dd | [
"Apache-2.0"
] | 24 | 2019-12-08T11:34:00.000Z | 2022-01-22T18:55:59.000Z | src/main/typescript/wcardinal/ui/d-picker-time-bound-constant.ts | kagechan/winter-cardinal-ui | c5303cc46e27636cb7989d5a88974678dec423dd | [
"Apache-2.0"
] | 18 | 2020-01-15T10:57:58.000Z | 2021-12-24T03:23:48.000Z | src/main/typescript/wcardinal/ui/d-picker-time-bound-constant.ts | kagechan/winter-cardinal-ui | c5303cc46e27636cb7989d5a88974678dec423dd | [
"Apache-2.0"
] | 12 | 2019-11-12T07:38:30.000Z | 2021-12-24T02:00:09.000Z | /*
* Copyright (C) 2019 Toshiba Corporation
* SPDX-License-Identifier: Apache-2.0
*/
export interface DPickerTimeBoundConstantSecond {
min: number;
max: number;
}
export interface DPickerTimeBoundConstantMinute {
min: number;
max: number;
}
export interface DPickerTimeBoundConstantHour {
min: number;
max: number;
}
export interface DPickerTimeBoundConstant {
second: DPickerTimeBoundConstantSecond;
minute: DPickerTimeBoundConstantMinute;
hour: DPickerTimeBoundConstantHour;
}
| 19.038462 | 49 | 0.789899 |
bb3f1f02597fcdbb3ac470b7574d40c3995bd2a6 | 451 | cs | C# | CP/Games/BladesOfSteelCP/Logic/CustomSort.cs | musictopia2/GamingPackXV3 | dbc6ee2127f829b600fb084fc30b26f9020b8fde | [
"MIT"
] | null | null | null | CP/Games/BladesOfSteelCP/Logic/CustomSort.cs | musictopia2/GamingPackXV3 | dbc6ee2127f829b600fb084fc30b26f9020b8fde | [
"MIT"
] | null | null | null | CP/Games/BladesOfSteelCP/Logic/CustomSort.cs | musictopia2/GamingPackXV3 | dbc6ee2127f829b600fb084fc30b26f9020b8fde | [
"MIT"
] | null | null | null | namespace BladesOfSteelCP.Logic;
[SingletonGame]
public class CustomSort : ISortObjects<RegularSimpleCard>
{
int IComparer<RegularSimpleCard>.Compare(RegularSimpleCard? x, RegularSimpleCard? y)
{
if (x!.Color != y!.Color)
{
return x.Color.CompareTo(y.Color);
}
if (x.Suit != y.Suit)
{
return x.Suit.CompareTo(y.Suit);
}
return x.Value.CompareTo(y.Value);
}
} | 26.529412 | 88 | 0.596452 |
3934da4a8d84067da0519c3a4fc3953e5f05fc67 | 263,436 | py | Python | IsabelaFunctions/langlais_coeff.py | de-oliveira/IsabelaFunctions | 6ea9f181f1e9eda90db3e2542d72eaf00caf977b | [
"MIT"
] | null | null | null | IsabelaFunctions/langlais_coeff.py | de-oliveira/IsabelaFunctions | 6ea9f181f1e9eda90db3e2542d72eaf00caf977b | [
"MIT"
] | null | null | null | IsabelaFunctions/langlais_coeff.py | de-oliveira/IsabelaFunctions | 6ea9f181f1e9eda90db3e2542d72eaf00caf977b | [
"MIT"
] | null | null | null | import numpy as np
glm = np.array([[0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[-1.5155, -0.60564, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[-0.15374, 0.70921, 1.19916, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.83958, -0.82935, -0.99586, -0.93899, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[-1.02799, -0.92497, 0.08424, 2.22136, 0.47529, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.64218, 0.32097, 0.44752, -0.36357, 0.41367, 0.55534, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[-1.06227, -0.2204, -0.09208, -1.76409, 0.45798, 0.35756, -0.96139, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.96538, 1.23446, -0.74965, 0.46143, 0.15813, 0.55421, 1.07348, 1.41776, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[-0.76442, -3.25832, 0.78112, 1.36215, -0.80495, -0.98059, -1.04749, -2.06498, -0.86578, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[-0.94414, 3.15645, 1.54292, -1.66451, -0.30795, 0.68555, 0.57788, 0.50422, 0.5573, 1.59523, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[2.5935, -0.49887, -4.00854, -0.65887, 1.66064, 0.70543, -0.54557, -0.07971, -0.84307, -1.72513, -0.73739, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[-2.08006, -2.14315, 2.9719, 2.3537, -1.08972, -2.02342, -0.43627, 0.18272, 0.50667, 0.3827, 0.8528, 0.90739, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.93189, 3.18106, -0.11722, -2.1353, -1.71276, 0.66639, 1.1459, -0.04227, -0.02509, 0.90292, -1.39346, -2.31881, -3.13754, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.24093, -2.85358, -2.16069, 2.16929, 3.67268, 1.24134, -0.35545, -0.57465, 0.10119, 0.10829, 0.97516, 2.25809, 2.12674, -0.13523, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[-2.35592, 0.63503, 2.82827, -0.97903, -2.21268, -1.94436, -0.15679, 0.86194, 0.43952, 0.32452, 1.06926, -1.27508, -1.80253, -2.43556, -1.41117, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[4.05725, 0.51204, -2.9472, -1.70947, 0.50607, 2.10193, 0.15709, -0.24833, -0.97953, -1.21571, -1.15694, -0.32746, 0.78837, 2.58633, 1.83378, 0.65848, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[-2.44942, -3.27923, 2.05704, 3.8915, -0.00178, -1.54316, -0.84831, -0.69152, 0.50387, 0.48771, 0.95693, 1.06582, 0.40607, 0.30273, -2.32341, -0.98586, -0.02905, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[-1.36871, 5.7046, 0.41908, -4.16925, -1.02438, 1.67099, 2.56121, -0.3734, -0.30484, -0.35588, -0.33602, -0.92903, -0.29956, -0.61372, 2.19843, 1.29236, 1.35369, 1.18515, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[3.56374, -5.72205, -4.13209, 1.72975, 2.82639, -0.07192, -1.76058, 1.17628, -0.23558, 0.53706, 0.9105, 1.56688, 1.86311, 0.79711, -0.32267, -0.62623, -0.25477, 0.13943, -0.98134, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[-2.43479, 0.34094, 6.17564, 0.9878, -2.97511, -2.11623, 0.5414, 1.62612, 0.25974, -0.69426, -1.43141, -2.9068, -2.7987, -0.60521, -0.0399, 1.03965, 0.18374, 0.12325, 1.30728, -1.79652, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[3.85912, 3.54126, -5.45178, -3.54919, 2.07964, 1.94309, -0.43215, -1.74278, 1.39727, 0.55232, 1.10477, 2.85747, 2.31721, 1.54812, 0.42315, -0.01396, 0.43012, 0.53749, 0.72354, 0.92676, -0.53274, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[-2.91027, -3.43377, 2.19916, 4.42864, 0.51932, -0.15899, 0.14284, 0.79714, -0.87497, -0.14148, 1.13845, -0.23216, -1.38679, -2.84757, -1.17074, -0.71398, 0.37481, 0.79361, -0.58515, -0.95551, -1.07909, -1.31293, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.76846, 3.67351, 1.23884, -3.57814, -2.2402, 0.20884, 0.62894, -0.49189, -0.7695, 1.02594, -1.74758, -1.44326, 1.15662, 1.73269, 0.88763, -0.67239, -2.07135, -0.56819, 0.49272, 0.72389, 1.06311, 0.25423, 1.31339, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[1.82737, -4.83325, -2.83467, 2.95243, 1.93658, -1.1008, -0.56904, 0.36826, 1.65085, -1.31733, -1.39317, 1.2282, 0.09377, -1.28632, -1.80374, 1.51852, 1.65424, 0.96964, 1.06748, -0.88174, 0.21715, -1.41702, -1.07414, 0.95738, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[-1.52494, 3.06541, 1.80458, -1.41966, -1.0946, -0.04909, -0.36367, -0.98439, -0.84206, 0.93618, 2.75796, -1.16308, -1.60305, 1.11522, 2.18714, -0.23413, -1.25578, -2.08189, -1.69004, -1.16096, -0.39159, 0.46522, 1.70346, 1.64567, 1.85926, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[1.25929, 0.30123, -1.34128, -0.67798, 2.80681, 1.39871, -0.14989, 0.14507, -0.49408, 0.17954, -0.41412, -0.12692, 0.06837, -0.83066, -2.23756, -2.36646, 1.35627, 2.56043, 0.8697, 1.22877, -1.30292, -0.91607, -0.26306, -2.28372, -0.23442, -0.21208, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[-0.65702, -0.32241, 2.23185, 1.01259, -2.79659, -0.57494, 0.18022, -0.16528, -0.55029, -2.38183, -1.67365, 2.41435, 1.07985, 0.04637, 1.08344, 3.62048, 0.04386, -0.82567, 0.26827, -1.1302, -0.45616, -0.00034, 0.76886, 1.65609, 1.5085, 2.51149, 0.04162, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.73786, -0.08855, -2.15711, 0.24647, 0.22625, 0.69303, 0.49392, 0.87845, 1.75956, 0.43072, -0.67673, -1.88545, 1.28321, 1.26393, -0.28354, -1.98309, -2.35488, -1.95059, -0.58086, -0.70904, 0.74532, -0.05053, -0.37671, -0.02238, -2.84055, -2.18994, -0.21686, 0.27656, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[-0.98237, 0.60265, 1.13821, 1.29569, 1.23138, -1.32403, 0.45351, 0.29274, -1.04609, 1.61117, 1.73308, -1.57993, -1.69431, -0.99098, -0.89832, 1.63411, 3.16818, 1.04649, 0.1947, 2.29116, 1.18202, 1.10806, 1.78664, 0.74349, 1.58162, 1.82248, 0.94797, -1.35655, -0.53633, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.06227, -1.12984, -0.60316, -1.57082, 1.23664, 1.03712, -2.06114, -1.91064, -1.02127, -0.19067, 0.52861, 0.55482, -1.55065, 0.72503, 0.6701, -1.23108, -2.19042, -0.05156, -0.14456, -1.66855, -2.20666, -1.80173, 0.21949, 0.20515, 1.79193, -1.49674, -1.37301, 1.01438, -0.55805, -0.45342, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[-0.62934, 0.2805, 0.06159, -0.13657, -1.0982, -0.01892, -0.1506, 1.16229, 1.92567, -1.6801, -1.98447, 0.51704, 1.63703, -0.5232, 0.08542, 0.40991, 1.63404, 1.11905, -0.01135, 0.34598, 3.54907, 0.95676, 0.73627, -0.02, -1.34569, 0.86504, 0.2949, 0.43978, -0.4837, -0.75094, 1.73951, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[2.01547, 0.39213, -0.91218, 0.43548, -0.83268, 1.77788, 3.37542, -0.49469, -1.54648, 0.16263, -0.32513, 0.1926, 1.04283, -0.3034, -0.45909, 0.47304, -2.69932, -2.57189, -0.6968, -0.35951, -1.92384, -0.31975, -1.81323, -0.45155, -1.11671, -0.00288, 1.29369, 1.08165, 0.53963, 1.62041, -0.44052, -1.25369, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[-0.92111, 0.1872, 0.55544, 0.25495, 1.5989, -1.27895, -2.06059, -0.45339, -0.039, 2.05203, 1.27051, -1.42985, -1.59113, -0.84872, -1.03587, -1.81674, 1.80361, 4.51447, 1.60764, 0.49001, 0.27036, 3.06479, 0.87529, 0.23127, 1.69246, -0.48007, -1.21009, -0.97529, -0.10898, 0.5858, -1.25602, 1.70738, 0.86722, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.10745, -0.75039, -0.87253, -0.59822, 0.84229, -1.10972, 0.58817, 2.94769, -0.24994, -1.52507, -0.58781, -0.82866, -0.13228, 1.76442, 2.15582, 2.03459, 1.8283, -2.89236, -3.51169, -0.79587, 1.41616, -2.20909, 0.36576, -2.16909, -0.92575, -0.46188, -0.67706, 1.11056, -0.6453, 1.25802, 2.53264, -0.17355, -0.27835, -0.88709, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[-0.8579, 0.21066, 2.52018, -0.70717, -2.79495, 2.05676, -0.24531, -1.03759, 0.83546, -0.73675, -0.61222, 2.20717, 1.40569, -1.13026, -1.10788, -1.92586, -5.31125, -0.90576, 4.10161, 2.36693, -0.10854, -0.67486, 0.3081, 1.31649, -1.3892, 0.24891, 1.08298, 0.03296, 0.11425, -0.82986, -1.11944, 0.98138, 0.06396, -1.20249, -2.29998, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[3.18545, 0.84923, -3.51331, 0.12854, 1.14594, 1.34143, 1.02056, 0.34606, 1.21151, -0.1873, 0.6505, 0.81517, -1.19215, -1.98207, 0.24046, 1.6728, 3.73628, 3.62731, -1.42997, -2.96374, -2.09145, 1.69535, 0.42282, 1.90394, 0.85547, -0.6494, 1.81595, -0.61278, -0.63695, 0.11907, -0.11612, 0.91174, 1.77582, 1.81684, 0.53554, -1.7808, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[-2.38543, -3.19663, 1.05623, 3.88225, 1.38505, -3.2749, 0.59849, -1.37625, -1.35029, 2.1471, 0.08039, -4.99317, -1.75372, 2.28159, 0.99162, -0.1934, 1.02277, -3.77327, -2.53072, 2.10193, 2.92546, 0.70782, -0.46627, -2.00554, -0.11323, -1.2209, -0.72497, 0.12228, -0.23736, 1.08204, 1.79865, -0.45025, -1.31427, -1.47629, 0.78417, -1.83015, -3.50506, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.09572, 4.20228, -0.22793, -5.31675, -1.58894, 0.60936, -1.06234, 2.32267, 1.56881, -0.5641, -1.37356, 2.61201, 4.39803, 0.81068, -2.85228, -1.24009, -1.04528, 2.87219, 4.22058, 0.82391, -1.7592, -3.12417, -1.28529, -0.05423, 0.59062, 2.16379, -0.4494, 1.18226, -1.21217, -1.60771, -0.72521, 0.11929, 0.47058, -0.83658, -1.17312, 2.24953, 2.45224, -0.41496, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[2.56513, -2.91601, -0.68953, 0.93361, 1.20395, 2.3309, 0.21192, -0.62004, -1.98449, -0.56997, 3.9389, 2.58557, -5.28731, -4.26212, 0.78311, -0.21939, -1.09475, -1.20408, -3.69741, -2.93554, 0.57138, 3.24018, 2.43126, 1.21002, -0.50812, -0.78894, -0.17861, -0.63746, -0.8064, -0.29225, 0.04024, 2.22921, -0.54975, 0.55455, 1.00517, -1.68171, -0.86808, -0.12303, 1.30769, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[-1.89132, 2.65968, 2.57981, 0.54755, -0.525, -0.93654, 0.05085, -1.52927, 2.45717, 0.87881, -2.53242, -3.45213, 1.78235, 5.03881, 3.17383, -0.26309, 0.9653, -0.14413, 2.24333, 2.8175, 0.71082, -0.54011, -2.27089, -2.24625, -0.77972, -1.80561, 1.54064, 0.14174, 1.68183, -1.29537, -3.11391, -2.93018, 0.16503, -0.37791, -0.63454, -0.81535, -0.74922, -0.18956, -0.57979, -0.31698, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.70826, -1.56048, -2.99641, 0.71751, -0.13082, -2.12395, 0.74814, 1.73846, -1.5103, -2.19687, -0.86052, 3.66629, 3.16154, -4.02632, -4.03028, -0.32342, -0.33565, 0.20211, -0.24442, -2.24197, -1.97079, -0.73555, 0.83129, 1.12874, 0.62862, 0.98107, -0.34612, -0.46188, -1.53137, -0.82762, 2.10092, 1.49983, 0.86202, -2.17158, 0.98953, 1.60911, 2.26747, 1.59843, 0.41219, 1.98221, 3.06587, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[-1.29057, 0.02138, 2.00778, -1.47701, -0.72351, 2.13103, -1.0676, -0.37223, 0.62569, 3.17138, 2.21638, -3.01052, -3.78268, 1.83898, 3.46251, 2.48022, -0.23832, 0.20986, -0.75679, 2.34919, 2.03144, -0.13883, 0.10296, -1.45796, -0.99776, -0.42403, -1.28925, 0.49559, 0.88595, 1.3284, 0.53906, -0.41613, -1.98313, -0.00032, -1.59531, -0.22543, -0.54749, -1.43697, -0.5364, -1.04366, -0.18895, 0.29915, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[4.0612, 0.83011, -2.54164, 1.07516, 3.422, -0.64671, -1.62498, -0.62363, 0.93496, -1.96554, -1.21019, 0.24126, 2.42869, 1.41646, -2.17178, -1.7686, -1.37915, -1.49602, 0.06088, -1.12525, -2.29569, -0.33299, 1.59994, 2.07342, 0.20445, -0.7981, -0.22727, 0.18362, 0.83771, -1.34347, -2.27709, 1.36148, 1.78278, 1.10687, 0.47278, -1.85493, 0.59309, 1.35434, 2.95249, 3.57922, 1.38757, 1.07729, -0.32166, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[-2.35681, -2.11812, 1.94338, 1.17679, -3.92472, -0.72636, 2.59869, -1.56321, -2.39958, -0.1493, 1.85075, 2.53002, -0.71724, -3.49096, 1.32938, 1.39476, 2.39199, 1.67588, 0.31869, -1.71724, 2.18976, 1.81977, -2.45831, -1.65826, -0.88095, 0.07442, 1.25522, -0.58092, -0.91064, -0.44773, 0.73531, 1.30174, 1.61131, -0.88931, -0.23312, 0.67632, 1.65704, 0.76319, -1.99055, -2.24221, -1.73156, 0.64823, 0.56144, 0.39246, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[-0.69194, 3.94166, -1.25037, -4.94191, 2.71075, 3.05262, -1.40805, 0.89507, 0.94729, 0.78401, -2.34476, -1.6402, 0.42583, 2.86912, -0.58042, -0.12776, -0.00934, -0.81093, -1.78303, 0.57835, -1.1051, -3.05422, -1.21508, 0.90757, 3.40307, 0.95097, -1.56594, -1.07248, 0.3182, 1.21013, -0.79533, -3.06579, -0.34535, 0.79034, 0.21675, 0.9486, -2.29392, -1.77416, -1.22437, 1.46631, 1.72514, 1.03075, 0.24211, -0.22298, -1.24484, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[2.54264, -1.88543, -0.63402, 3.43929, 0.11977, -3.94906, 0.28302, 2.58906, -0.07558, -1.39663, 0.20403, 0.02295, 1.08258, 0.86106, -0.72467, 1.03453, -1.17012, 0.36433, 3.0518, 1.80717, -1.32102, 1.23151, 2.34704, -1.63975, -2.53142, -1.63126, 0.71343, 1.73392, 1.64637, 0.53641, -0.08648, 0.10279, -0.65645, 0.03109, -0.42516, -1.48293, 1.105, 1.65135, 2.88701, -1.22068, -1.11299, -0.22025, -1.69165, 0.31167, 0.18016, -2.53878, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[-0.62077, -1.37471, 3.26865, -0.66929, -4.86468, 3.26805, 1.90262, -4.02471, -0.73968, 1.03356, 1.73381, -1.10606, -1.71945, -1.10504, 1.81602, -1.94253, 0.32169, 1.2063, -1.39893, -1.5869, 1.01391, 0.90602, -0.99877, -1.13398, -0.33485, 2.05063, 2.0468, -1.45438, -2.19474, -1.2503, 0.17038, 0.74507, 0.0074, 0.03941, 0.54693, 0.42884, -0.16684, -1.45959, -3.35969, -1.86767, -0.98915, 0.68427, 0.53858, 0.44218, -0.74909, 0.57443, 0.62434, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.61991, 2.12435, -4.2914, -0.46704, 4.41188, -0.4712, -3.12784, 1.04932, 1.61444, 0.28488, -2.46855, 0.13134, 0.20401, 0.0545, 0.89676, 1.94387, 2.45458, -0.91273, -1.58578, 1.26062, 0.51434, -1.23476, -0.31514, 1.16765, -0.71862, -2.92015, -1.86195, 0.02775, 0.96855, 2.17939, 0.73927, 0.34868, 0.6867, 0.46883, 0.5878, -0.311, -1.86513, -1.66675, 0.13982, 2.53317, 0.20808, -0.68428, 0.13002, 0.29057, -0.13282, -1.44484, -0.3795, -0.72757, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.32452, -0.30668, 0.51238, 2.1157, -1.80487, -3.60619, 3.07445, 3.45734, -2.51177, -0.86516, 0.97549, 2.49218, 0.72129, -0.54521, -1.01215, 0.56798, -3.18997, -0.39607, 2.08154, 0.09566, -2.57117, -0.66371, 0.38257, 0.61314, 1.55417, 1.30778, 1.72511, 2.11818, 0.24016, -0.67211, -0.39234, -1.24195, -1.56821, -1.14473, -1.96569, 0.07406, 2.13449, 1.64375, -0.29954, -1.92787, 0.27398, 0.82041, -0.13356, -0.22654, 0.98352, 0.92699, 0.42881, 0.17202, 0.30871, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[-0.38114, 2.23939, 2.34955, -5.55348, -0.37609, 3.81101, -2.34151, -3.50236, 1.44042, 1.28352, 1.13655, -2.33298, -0.80179, 0.46635, -0.17028, -0.36138, 2.71272, 1.60808, -0.69239, -0.61019, 2.04412, 1.2187, 0.67303, -1.34619, -0.76547, -1.12377, -2.27357, -1.88052, 0.08056, -0.93124, 1.61816, 0.75746, 0.24286, 1.98759, 0.25703, 0.74163, 1.01121, 0.58033, -0.61639, -0.89768, -1.60576, -0.81872, 0.17203, 0.36447, -1.4743, 0.11122, 0.81755, 0.06874, -0.05854, -0.0299, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[1.26293, -1.65835, -2.56982, 3.48625, 2.13482, -2.3, -1.79873, 2.06521, 1.55115, -2.76957, -2.12397, 0.4984, 0.66613, -0.63171, 0.23627, 1.18363, -0.1127, -1.70343, 0.3201, 2.19415, 0.33766, -0.93585, -1.20558, -1.12382, -1.77102, -0.34283, 0.55666, 0.27519, 0.70241, 0.39321, -0.36248, 0.9862, 0.36059, -0.34836, 0.70328, -1.19998, -2.3704, -2.05458, -0.30517, 0.81093, 0.39105, -0.4761, -0.17466, 1.78941, 0.94207, -1.04084, -0.95258, -1.66732, 2.06283, 1.0565, -0.93478, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[-2.48338, -0.29844, 2.61554, 0.63597, -5.45367, 1.50535, 4.57574, -1.08703, -3.49974, 1.51871, 1.61803, -0.11115, -1.59302, 0.51106, 0.36062, -1.33696, -1.20596, 3.50165, 1.88776, -1.84705, -2.394, -0.5049, 0.4028, 2.5223, 1.84684, 0.98001, 0.31767, -0.14954, -0.4163, 0.33012, 0.36083, 0.95471, 1.74548, -0.62208, 0.36938, 0.14825, 0.51373, 1.59569, 1.00731, -0.14223, 0.00285, -0.32888, -0.27043, -1.55723, -0.5818, 0.39495, 1.00697, 1.16066, -1.63683, 0.41485, 1.0624, 1.05631, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[2.60883, 3.06432, -2.84413, -3.07071, 5.07087, 0.55718, -3.96487, 0.55777, 2.84848, 1.33382, -0.83036, -1.24516, 1.55923, 0.62976, -1.21524, -0.31873, 0.91583, -2.73141, -2.89136, 0.44231, 2.50471, 2.60993, 1.43781, -0.04689, 0.54711, -0.54835, -0.20288, 0.0721, -0.45921, -0.76086, -0.81118, -2.90791, -1.15218, 0.90293, -0.80106, 0.29086, 0.44024, -0.16618, -0.77666, -1.75609, -0.478, 0.57783, -0.58958, 0.10089, 0.63373, -0.18128, -1.20702, -0.49664, -0.31882, -2.1302, 0.60515, -2.05067, -1.2738, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[-0.24034, -3.62264, 2.0161, 3.41113, -2.43595, -5.20166, 0.87225, 3.09796, -0.7468, -2.68284, 0.79355, 1.2331, -1.70433, -2.31113, 0.55916, 1.55506, -0.26421, -0.63291, 4.61706, 1.93495, -0.90331, -1.10972, -2.54738, -3.25812, -0.47905, 0.9057, -0.08041, -0.25378, 1.04662, 2.32329, 0.31335, 1.60666, 1.44444, 2.35682, -0.37501, 0.03156, -0.30189, 0.27383, -0.70004, 1.69465, 0.66523, -0.40107, -0.95, -0.25775, -0.37779, 0.94509, -0.57231, 0.10242, 2.51228, 0.46638, -1.29902, 0.37275, 0.41416, 1.26698, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[-2.72605, 3.96691, 0.28114, -4.42165, -1.78452, 6.05182, 0.56777, -4.22876, -0.32229, 1.99587, 0.28732, 0.66309, 0.46329, 1.53529, 0.27115, -1.41669, 0.13474, 1.76471, -3.02273, -3.56506, -1.02998, 0.35352, 0.88933, 2.22066, 0.52085, -0.2942, 0.36352, 1.52258, 0.98825, -1.18879, -0.47541, -0.55677, -1.02019, -3.70508, -0.10097, -0.94402, -0.93905, -0.73162, -0.21477, 0.7729, -0.77946, -0.01894, -0.18584, -1.70229, -0.58588, -1.1682, 0.09726, -0.95186, -1.03608, -0.41243, -0.80769, 0.61943, -1.86658, -1.31983, -1.98169, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[2.40953, -1.86418, -2.44239, 2.77685, 4.21283, -3.01601, -3.70333, 1.28264, 1.40072, -1.02513, -0.66554, -0.60165, 1.06367, -0.7238, -1.72026, 0.02433, -0.24124, -0.50281, 0.73012, 5.23786, 1.96011, -0.06083, 1.86985, 0.19032, -1.4294, -1.41725, 1.42005, -0.71675, -2.58102, -0.29042, 2.08563, -1.01284, -0.3958, 0.52635, 1.77006, 0.80407, -0.74487, -0.75186, 1.23849, -1.27161, -0.25948, -0.36368, 0.65062, 1.04126, 0.50491, 0.27745, 0.3851, 0.30939, -0.70923, 0.28226, 1.8051, -1.64476, 0.93363, -1.0296, 0.10129, -0.58695, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[-1.15211, -1.21297, 3.98116, -0.21718, -4.9078, -0.39606, 5.15822, 0.76528, -1.99123, 0.41299, 0.4041, -1.22856, 0.11069, 0.19187, 2.10882, 1.04025, 0.1013, -0.03043, 0.83926, -2.35689, -1.72273, -0.50192, -1.02086, -1.61858, 1.20444, 0.84144, -1.59589, -1.04765, 1.08896, 2.27102, -1.03441, 0.44698, 0.88062, 1.79244, -2.17843, -0.29821, 0.34876, 0.34761, -0.88134, -0.06593, -0.04728, 0.7984, -0.54752, -1.20927, -1.29733, 0.45315, -0.88111, -1.73631, -1.13723, 0.37506, -0.26121, -0.47494, -0.38755, 2.40528, -0.7578, 0.02507, -0.34928, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[1.27432, 2.42583, -3.26053, -1.22765, 2.70573, 2.8761, -3.79984, -1.50271, 1.14689, 0.58985, -0.91916, 0.04613, -1.05481, -0.16537, -0.60061, -1.42906, 0.00338, -1.3963, -1.53552, 0.6888, 3.71442, 0.91405, -0.98024, 1.87692, 1.40948, 0.67006, -0.23086, 1.99327, 1.99865, -3.10201, -1.80113, 0.88307, -0.38441, -2.28143, 0.12493, 0.38306, 0.20487, -0.04696, -0.46408, 1.1439, -0.02161, 1.05263, -0.84409, -0.26249, 0.78652, 1.38976, 2.54938, 1.53654, 0.92928, -1.21199, -0.21478, 1.07241, -0.54597, 0.10495, 0.44306, 2.11885, 0.37687, 1.01018, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.61193, -1.14221, -0.30232, 2.53806, -0.5718, -4.32613, 0.17139, 2.64114, -0.72148, -0.87867, 0.77432, 0.90719, 0.78203, 0.6923, -0.89563, 1.01796, 1.41833, 1.38131, 0.67612, -1.26102, -3.12997, -0.84842, 1.36433, -0.10133, -2.12958, -0.92517, 0.33595, -1.30552, -0.89868, 1.12195, 2.77613, -1.02168, -0.5875, 0.15225, 2.22795, -0.52844, -0.77161, 0.72042, 0.28429, -0.2505, -0.30377, -0.49201, 0.86749, -0.62105, -0.12345, -1.03352, -0.49314, 0.08098, 0.00875, 0.98865, -1.01832, -0.11418, -0.40979, -1.18767, -0.33146, -0.41209, 1.12549, 1.08556, 0.99799, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[-1.85297, 0.11212, 2.83001, -2.39806, -1.66373, 3.15735, 2.13243, -2.73648, -0.29294, 0.54687, 1.40733, -0.1632, -0.67117, -1.68783, 0.43701, -0.24694, -1.70914, 0.68366, -0.0983, -0.29, 1.03118, 2.19742, 0.27561, -2.01968, 1.98172, 2.47184, 1.11073, 0.1326, 0.28055, 2.31692, -0.12049, -0.15874, 1.03893, 0.30787, -3.51032, -0.65562, -0.39673, -0.00611, -0.42868, 0.42699, -0.48052, 0.99812, 1.06463, 0.87247, -1.52371, 0.61241, 0.58878, 1.81409, 1.07595, 1.3207, 1.46732, 0.68847, -0.23075, 0.88103, 0.6122, 2.5311, -0.91366, 0.1992, 1.04169, 1.81376, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[1.36059, 1.13119, -1.85902, 0.32758, 2.6271, -0.32948, -3.32744, 2.22014, 1.79905, -0.68981, -1.1476, -1.1276, 0.29027, 1.88524, 1.01957, -0.74474, 0.76831, 0.19555, 0.54591, 1.31836, -0.65515, -2.10592, -0.54798, -0.1291, 0.77222, -0.99174, -0.79737, -0.02531, -1.98341, -1.98414, -0.281, 1.78011, 1.45021, 0.50688, 1.59669, 2.08059, 1.71735, -0.36315, 0.13397, 0.61473, -0.81293, -0.0603, -2.67588, -0.96101, -0.57588, -0.23522, -1.39555, -0.51848, -0.72984, 0.75649, 1.21225, -1.22107, -0.87929, -1.05101, -1.39184, -2.66601, -1.97492, -0.96021, 0.06298, 0.29795, 2.36915, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[1.36958, -2.02601, -0.72208, 2.96916, -2.84884, -2.34198, 2.59001, 1.05283, -2.75969, -0.04752, 0.58142, 1.56908, 0.76802, -1.12239, -1.55908, 0.40446, -0.3784, -2.2731, -0.34379, -0.76536, -0.69109, 0.80073, 0.56007, 0.56418, -2.4103, -0.49543, 1.37929, 1.82763, 2.91188, 0.65961, 0.71748, -0.76428, -0.74268, -0.73046, 0.75007, -2.80617, -1.59988, -0.5831, -0.75622, -0.40175, 0.33005, -0.55775, 0.96562, 2.09732, 2.92545, -0.60729, 2.51582, 1.23284, 0.21932, -0.78006, -0.36704, 1.22098, 1.02998, 1.45566, 1.19426, 1.97042, 1.89858, 1.06172, -0.597, -0.70032, -1.42015, -1.0311, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[-1.41899, 1.14543, 1.89289, -2.35985, 0.09432, 3.25041, -1.42689, -2.92895, 2.2535, 1.54578, 0.77245, -0.40201, -1.83937, -0.18748, 1.66683, 0.87479, 0.85955, 2.52166, 0.83556, -0.16391, 1.2993, 0.12732, -0.17785, 0.49588, 0.80937, 0.54549, -0.60404, -0.74602, -0.81752, -0.89808, -1.48292, -0.69406, -0.33203, 0.60261, 0.52717, 0.83104, 0.35233, 1.60242, 0.63481, 0.30796, -0.15869, 0.37837, 0.14574, -0.86095, -3.66701, -1.74823, -1.17147, -1.73421, -0.9797, 1.18037, 0.90352, 0.94822, -1.9027, -3.38768, -0.56671, -0.66842, -0.36579, -1.83871, -0.75976, 0.29232, 0.79809, -0.33211, -0.21545, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[1.64899, 0.8633, -0.85487, 0.56865, 3.27421, -2.86242, -2.34737, 2.2848, -0.19005, -1.76625, -0.42572, -0.2415, 1.35864, 1.17299, -0.46437, -0.90062, 0.60654, -0.72448, -2.17327, 0.24965, -0.07592, -0.88256, -0.72362, -1.51563, 1.65209, 0.41913, -0.52023, -0.38538, -1.18134, 2.2542, 2.26483, 1.20209, 0.47331, -0.13581, -0.76564, 0.69037, -1.07999, -0.94143, -0.2873, 0.54801, -0.8727, 0.44252, -1.29723, 0.42298, 0.95089, 0.96028, -0.95795, 0.92642, 0.86852, 1.58172, 1.00821, -0.26356, 0.26461, 0.60151, -0.09981, 0.22004, 0.35963, 1.65605, 0.72913, -0.78269, 1.14125, 0.45749, 0.28378, -2.51209, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[-0.80463, -0.86913, 1.52158, -0.0278, -3.91113, 0.47313, 3.66226, -0.95276, -2.28496, 1.87651, 0.4364, 0.67733, 0.34879, -1.71159, -0.77451, 0.48481, -1.1796, 0.53078, 2.59477, -0.09994, -1.61275, 0.44932, 0.66293, 0.29291, 0.73968, -0.73096, -0.36672, 0.61604, 0.29513, -0.64116, -0.78451, -1.32884, -0.01597, -1.06285, -0.50334, 0.10286, 1.23985, 0.29385, 1.03068, 0.90355, 0.14934, -0.30032, 0.22972, 0.5247, 0.63468, -0.74935, -0.49837, -0.4382, -0.15768, -0.94196, 0.05274, 0.88302, 1.73199, 0.09016, -0.91142, -0.06746, -0.78131, -0.14674, 0.31571, 0.73189, 0.32247, 0.99441, 0.79493, 1.11487, -0.6215, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.3119, 1.47851, -2.11379, -1.15234, 1.83844, 3.07116, -2.91341, -0.97362, 2.42275, -0.5595, -0.08214, -0.63022, -0.52812, 0.00268, 0.91248, -0.39303, -0.31541, 0.24613, -0.85218, -0.84352, 0.90198, 1.10808, -0.25043, -1.31022, -2.39007, 0.62981, 1.79522, 1.75111, 1.11938, -2.15804, -0.1188, 1.65711, 0.84226, 1.20145, 0.42826, -1.81187, -0.09264, -1.42872, -1.89213, -1.15839, 0.92304, 1.30592, -0.76616, -0.79654, 0.48948, 2.11014, 0.56736, -1.31739, -1.28466, -1.21059, -2.35837, 0.41052, 0.56243, -0.07577, 0.68513, 1.04637, -0.22333, 0.05667, 0.29626, -1.1236, -1.56325, 0.63664, 1.79467, 0.81892, 2.08013, -0.53155, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[1.42107, -2.78889, 1.02386, 3.25317, 0.56826, -3.84531, 0.62878, 2.75227, -0.42811, -0.84209, 0.76013, -0.21086, 0.42064, 0.87106, -0.46191, -1.0774, 0.1039, -0.52975, 0.20045, 1.96758, 0.45881, -1.67893, -0.39696, 1.3681, 1.61946, 0.07361, -1.85296, -1.83461, -1.16489, 1.33193, 0.4445, 0.09407, -1.06098, -0.37346, -0.55147, 0.2807, -0.12221, 1.56865, 0.12558, 1.23493, 0.61196, -0.13541, -0.26838, 1.04168, -0.16693, -1.28848, 0.01314, 0.49025, 1.42963, 1.73116, 0.59815, -1.06627, -1.09005, -0.16859, 2.23752, 1.35202, 0.33023, -0.21843, 0.15908, 0.84808, 1.03459, -1.03032, 0.99864, -0.17952, 1.13347, -0.54775, -0.07628, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[-0.64627, 2.3531, 1.486, -2.82884, -1.39854, 1.7182, 2.1887, -2.16944, -1.06629, 0.72449, -1.05929, 0.64637, 0.32042, -0.86677, -0.63324, 1.0693, 1.01561, 0.39146, 0.32777, -1.43285, -1.1397, -0.30633, 0.56708, -0.44137, -1.28638, -1.87478, -0.63557, 1.67156, 0.82883, 1.37417, 0.17866, -1.81836, 0.79825, 0.576, 0.878, 0.40691, -1.2641, -0.23472, -0.26454, -2.01116, -2.34609, -0.50414, 0.69511, 0.16878, -0.56011, -0.85781, 2.49051, 1.50961, -0.12313, -0.99161, -0.83505, -0.78303, -0.40612, -0.36082, -0.55889, -1.39557, 0.90196, 0.33895, -0.16128, -0.11893, 0.6559, -0.82902, -1.26682, 0.08835, -0.48431, 1.04038, 0.71742, 0.22253, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[1.99127, -0.33646, -3.36969, 0.3036, 1.77507, -0.59719, -2.84323, -0.17438, 1.19027, 0.84861, 0.98797, -0.07488, 0.59141, 0.95361, 0.8824, 0.40697, -0.67432, -0.5968, -0.96186, 0.24093, 0.43935, 0.25036, -1.02617, -0.70353, 2.51615, 2.68082, 0.99862, -0.82512, -0.93005, -2.08863, -0.23424, 0.93646, 0.48407, -0.56477, -0.28151, -0.74613, 0.45558, -0.57442, 1.23425, 1.18577, 2.46146, 1.1801, -0.34988, 0.27483, 1.06745, 1.06375, -2.31529, -1.37273, -0.83605, 0.74748, 1.40534, 1.13289, -0.44258, -1.39639, 0.0037, 1.58225, 0.73648, 1.50934, -0.09677, -0.32974, 0.61819, 0.13394, 0.29316, 0.63648, 0.34702, -0.78529, 0.90332, 0.31842, -0.33954, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[-1.46335, -2.19097, 3.24667, 1.16685, -1.37771, -0.48464, 1.36908, 1.18297, -0.22125, -0.17703, 0.06074, -0.82931, 0.37865, -0.48563, -0.61993, -1.04136, -0.0876, 0.00205, -0.27054, 1.27024, 1.08978, 0.91457, 1.30334, 0.58609, -1.94842, -2.59812, -1.38492, 0.14971, 1.13265, 0.5305, 0.40402, 1.24364, -2.14597, -1.07548, 0.17951, 1.74883, 0.44442, -0.53675, -0.51339, 0.33859, -2.68553, -0.51079, -0.36105, 0.77769, -0.58295, -1.20685, -0.65637, 1.5693, 2.34662, -0.29079, -1.02771, -0.05502, -0.38887, 0.32153, 1.08288, -0.80713, -1.12464, -0.76071, 1.00561, 0.01676, -0.08992, 0.08615, 1.50502, 0.22454, 0.00391, -1.17707, -1.05825, -0.42481, -0.57631, -0.56025, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.30483, 2.51756, -0.21049, -1.42675, 1.85416, 1.7302, -0.13907, -1.17158, -0.17634, -0.65419, 0.67044, 0.63489, -1.55638, -0.6389, 0.70918, 0.53477, 0.80999, 0.7465, 1.24213, -0.80686, -0.56193, -0.84124, -0.96297, -1.01982, -0.53723, 1.25403, 1.12215, -0.26578, -1.81556, -0.46161, -0.473, -0.61471, 1.17394, 0.8826, 0.05222, -0.13894, -0.21356, 0.30173, -0.19353, -0.6233, 0.4126, 0.49626, 0.72046, -0.52767, 0.26822, 2.1686, 2.00635, -1.61314, -1.07424, -0.42522, -0.62962, 0.59669, -0.14294, 0.53789, -0.27625, 0.52825, 1.66966, 1.12585, -0.12736, 0.24465, -0.01956, 0.31396, -0.96195, -1.42904, 0.84079, 1.54786, -0.39375, 0.25267, 0.09273, 0.29223, -0.05727, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[1.25204, -0.78957, -1.93296, 1.56829, -0.44618, -1.90066, 0.36206, 0.89088, 0.6782, 0.38268, -0.32565, -0.77577, 1.86887, 1.51295, -0.42701, -0.49218, -0.03904, -0.01573, -0.57216, -0.74022, -0.31139, -0.29999, 0.21546, 2.49982, 2.1588, -0.17135, -2.02775, -1.29185, 0.64337, 1.4031, 0.28031, -0.26364, 1.38685, -0.74772, -1.27286, -1.54306, 0.14663, 0.40154, 0.67498, 0.61288, 2.04033, -1.62065, -0.38676, -0.00142, 0.5238, -0.18493, -1.17967, -0.83985, 0.04637, 1.10917, -0.80776, -1.53347, -0.35573, -0.25255, -0.08813, -0.70078, -0.71746, -0.46467, 0.34859, 1.92782, -0.63346, -1.71011, -0.12013, 1.56768, -0.69201, -0.9496, -1.04767, 0.15599, 1.13628, -1.00413, 0.10074, -0.58619, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[-0.45896, -0.75979, 2.02063, -1.43165, -1.43266, 0.5602, 0.6334, -1.25769, -0.50156, 0.28803, -0.38397, 0.92576, 0.41465, -1.72946, -0.08282, 0.59891, -0.81234, -0.75027, 0.38285, 1.84609, 0.07157, 0.49979, 0.4847, -1.45756, -1.83717, -0.15087, 1.14364, 0.89029, 0.86842, -1.01009, -0.56997, -0.49555, -1.33583, 0.33221, 0.72907, 0.81269, -0.33183, -0.03449, -0.49173, 0.05645, -1.19425, 0.99399, -1.03591, 0.05853, -1.20424, -0.13922, 0.85476, 1.88171, 0.43679, -0.82683, 0.61208, 0.75025, 0.80388, -0.5113, -0.57903, 0.73074, 0.68952, -0.40942, 0.38139, -0.14957, 0.26237, -0.56554, 1.83689, 0.03648, -0.23528, 0.63373, 0.83869, -0.57851, -1.2363, -0.04907, -1.17625, 0.0998, -0.59754, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[-0.72068, 0.89708, 0.92479, -0.79403, 2.02314, 0.0517, -1.51857, -0.32683, 0.57331, 0.14798, 0.53578, -1.36088, -1.41257, 0.68931, 1.43737, 0.3239, 0.0053, 0.29544, -0.31478, -1.30577, 0.44395, 0.46555, 0.06266, -0.95632, 1.27827, 0.95796, 0.28183, -0.67147, -1.82322, -0.59373, -0.16247, 0.04407, -1.04996, 0.14895, 0.69055, 0.15615, -0.94482, -1.0729, -0.95097, -0.73428, 0.35665, 0.75893, -0.02907, -0.04873, 0.18908, -0.40915, -0.42273, -0.85138, 0.21238, -0.36639, 0.28619, -0.16027, -1.75972, -0.63448, 0.26178, -0.5247, -1.76553, -1.05673, -1.18156, 0.59157, 0.59417, 0.83341, -1.37321, -1.00622, -0.54116, -1.074, -0.44796, -0.99094, 0.14182, 0.4523, 0.74081, -1.1001, 1.7077, 1.25218, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[1.46174, -0.17304, -1.83711, 1.27656, -0.09362, -0.99454, 1.47662, 1.01121, -0.18733, -0.07346, 0.51487, 0.36772, 1.33433, -0.43319, -1.56641, 0.02122, 0.52666, 0.03463, -0.26814, 0.14385, 0.16343, -1.35748, -0.38319, 1.97566, -0.01279, -1.00087, -0.02452, 0.44444, 0.0936, 1.54949, 1.09717, 0.84215, 0.85217, -0.96652, 0.993, 0.40562, 0.74366, 0.86133, 0.70923, -0.4215, 0.00111, -0.92994, 1.37601, -0.55913, -0.47937, -0.76141, -0.15462, 0.34989, -0.03835, -0.49533, 0.112, 0.5518, 0.91077, 1.99853, 1.03708, -0.31217, 1.19372, 0.53073, 0.62449, 0.79086, -1.70111, -0.04998, 0.5568, 0.55127, 1.52685, 0.79775, -0.41459, 1.71659, 0.07568, -0.50763, -0.59363, -0.49594, -1.30995, -0.32709, 0.75226, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[-0.70533, -2.24484, 0.63289, 0.16451, -0.00832, 0.98132, -0.17642, -1.05565, 0.06143, 0.39509, 0.83965, 0.67546, -0.52908, -0.63154, -0.32476, -0.52123, 0.19349, 1.07903, 1.44565, -1.26229, -2.03498, 0.62695, 0.79006, 0.2525, -0.40427, 0.36362, -0.72783, 0.17251, 1.00602, -0.99154, -0.73957, -2.10445, -0.365, -0.63931, -2.24151, -0.78826, -0.03609, 0.89675, -0.4399, 0.14853, -0.69608, 0.33069, -0.48003, 0.35038, 0.111, 1.26081, -1.0069, 0.43531, -0.17436, 1.449, -0.64669, -1.15422, -0.77167, -1.3241, -0.718, -0.13352, 0.02049, -0.39355, -1.20972, -1.02025, 1.1568, 0.09545, -0.23028, -0.01776, -0.37066, -0.35933, -1.07165, -0.91635, 0.46866, 0.35072, 0.64666, 1.11009, -0.11641, 1.19322, 0.70664, -0.40247, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[-0.84988, 2.53847, 1.25174, -1.51674, 0.18811, -0.14081, -1.66173, 0.14743, 0.25733, -0.28002, -0.30067, -0.95583, 0.39943, 1.14285, -0.27744, -0.17365, 0.061, -1.39551, -0.68989, 0.84817, 2.56688, 1.03348, -1.09198, -1.69353, -0.1393, 0.31894, 0.4863, 0.89818, -0.08957, -1.0739, 0.74939, 1.62131, 0.71526, 0.34684, 0.45997, 1.71256, 0.3569, -1.49823, -0.65157, 0.38925, 0.13919, -0.29193, -0.41392, 0.46313, 0.93257, -0.45381, -0.46946, -0.75386, 0.55227, -0.38074, 0.32044, 0.72664, 0.469, 0.15162, 0.99386, 1.80788, 0.42873, 0.03824, -0.02361, 1.2134, -0.11835, 0.07168, 0.40448, 1.20315, -0.25033, -0.45461, 0.62641, -0.00817, -0.38891, -0.29763, -0.32558, -0.85359, -0.0355, -0.86199, 1.33015, 0.48233, 0.53832, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[2.36192, -1.56137, -1.14496, 0.2533, 0.16603, 0.01945, 1.70861, -0.26862, -0.44614, -0.62002, -0.63326, 0.69646, 1.06822, -0.39393, 1.14788, 0.10704, -1.40511, -0.39773, 0.93595, 1.64739, -1.10399, -2.51816, -0.1398, 1.02446, 1.02696, 1.31443, 1.56887, -1.17371, -0.75511, 1.90433, -0.35952, -1.65251, -2.65494, -0.7146, 0.6363, -1.49498, -0.96835, -0.18692, 0.71832, 0.92522, 0.88639, -0.62917, 0.15831, -0.1334, -0.28006, -0.33869, 1.10505, 0.12711, -0.46737, -0.42516, 1.31341, -0.22825, -0.41514, -1.02207, -0.92662, -1.33584, 0.70129, 0.6096, 0.69208, -0.74366, -0.76838, 0.51409, -0.91422, 0.02268, 1.00944, 0.26616, 0.40634, 0.46004, -1.29232, -0.08835, 0.48473, 0.89297, -0.39915, -1.11138, -0.98751, 0.58053, 0.84401, 0.01076, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[-2.50189, -1.18929, 1.00148, 0.21315, -0.1826, 0.42258, -0.24018, -0.93716, 0.34888, 0.7173, 1.06741, 0.3317, -0.66413, -0.2389, -0.2938, -0.50032, 1.4548, 1.2118, -1.67044, -3.06816, -1.0108, 1.53683, 1.58448, 0.54862, -0.94624, -2.07963, -1.96308, 0.71518, 1.78192, 0.37728, -0.06134, 1.11533, 2.10391, 0.41769, -1.18564, 0.22576, 2.36813, 0.70014, -1.07507, -0.96069, -1.03396, 0.03261, -0.23909, 0.49696, -0.22115, 0.85675, -0.41096, 0.70477, -0.21305, 0.74722, -1.03378, 0.03732, 1.15461, 1.19896, 0.96155, -0.20295, 1.15794, -0.24624, 0.12251, 0.19013, -0.21066, -0.32789, 0.63047, 0.43415, 0.52638, -0.08576, -1.46688, 0.57714, 1.41285, 0.37544, -0.84148, -1.84176, -0.42043, 0.73068, 0.13067, 0.27804, 0.01376, 0.17663, 0.23741, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.43726, 1.72012, -0.87942, -0.35803, -0.00036, -0.84464, -0.23981, 1.13857, 0.5204, 0.50261, -0.54229, -1.80989, 0.5448, 0.22405, -0.54464, 0.39027, 0.14979, -1.05265, -0.14501, 1.35795, 1.64541, -0.22385, -1.33585, -1.19667, 0.03244, 1.4566, 2.47698, 1.69546, -0.73082, -1.29972, 1.06538, -0.08187, -1.73853, -1.92165, -0.38265, 0.06329, -1.94186, -0.61608, -0.07185, 0.14539, 0.91696, 1.48782, 0.48528, -0.9009, -0.24322, -0.07226, -0.79375, -0.56411, 0.16384, -0.12122, -0.86064, -0.15043, -0.56631, 0.08809, -0.23585, 0.13381, -0.76302, -0.73948, 0.55857, 0.45787, -1.08925, -0.88456, 0.23113, -0.85651, -0.73565, -0.01477, 0.68251, -0.10054, -0.32477, -0.66831, -0.43196, 0.86112, 0.34817, -0.61317, -1.07133, -0.32753, 0.51897, 0.44232, 0.43842, 0.64148, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[1.36665, -2.53331, 0.22003, 0.20293, -0.12326, 0.61383, 1.02724, -1.35518, -1.04622, -0.83483, -0.06308, 1.09691, 1.12961, -0.16508, -0.12072, -0.21872, -1.22326, 0.45694, 1.89662, 0.55928, -1.43468, -1.21298, 0.54556, 0.60363, 0.69715, 0.27562, -2.25995, -2.92296, -0.13461, 1.17395, -0.76475, -0.16432, 2.45027, 3.33069, 1.44564, -0.83624, 0.49503, 1.2841, -0.03102, -0.91066, -0.07127, -0.60203, -0.79824, -0.20693, 0.56959, -0.0241, 1.56849, 0.58083, 0.86233, 0.70064, 1.57956, 0.14312, -0.00151, 0.11791, 1.18747, -0.54996, 0.11509, 0.48591, 0.33583, -0.06234, 0.11973, 0.25772, -0.07014, 0.67578, 1.01131, 0.67895, 0.46852, -0.63173, 0.58289, 1.25318, 0.05603, -1.02843, -0.30152, -0.55811, -0.65792, -1.41682, -0.08273, 0.35752, -0.90216, -0.77106, -0.35267, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[-1.61968, -0.10035, 1.35145, -0.77767, 0.44009, 0.26121, -1.26743, -0.48633, 0.62521, 0.4861, 0.90186, -0.21605, -0.67761, 0.27105, 0.1464, 0.09209, 0.36138, 0.12152, -0.81891, -1.3457, -0.02023, 0.77693, 0.1415, -0.91757, -1.40497, -1.23096, 1.28533, 3.56283, 1.23128, 0.46662, 0.77079, 0.56138, -0.74782, -2.9602, -2.2315, 0.34058, -0.10113, -1.35481, -0.25606, 0.68417, -0.26096, -0.05364, 1.15183, 1.63284, -0.73083, -1.36952, -1.33947, -0.44288, -1.85389, -0.45118, -0.5403, -0.76556, -1.25324, -0.88912, -0.19637, -0.02497, 1.35845, -0.21752, -0.29269, -0.49894, 0.19555, -0.52236, -1.86109, -0.21947, 0.41804, -0.22108, -0.57525, -0.00474, -0.12225, 0.8718, 0.11052, 0.1293, -0.14487, -0.20284, 0.33903, 0.56405, -0.41881, 0.03758, 1.22053, 0.47858, 0.11175, -0.27161, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.97128, 1.34455, -1.5201, -0.17879, 0.01521, -0.79597, 0.72588, 1.68978, -0.18644, -0.33175, -0.83831, -0.91023, 0.76249, 0.57053, 0.37258, 0.40027, 0.73872, -0.56388, -1.15542, 0.01489, 0.84106, -0.07787, -0.43824, 0.54945, 0.9775, 0.84358, 0.76309, -1.2479, -2.04791, -0.17338, -0.23381, -1.17696, -0.85468, 1.90021, 2.98136, 1.59383, -0.08215, 0.83267, 0.87323, -0.53032, -1.5379, 0.11732, -0.09345, -0.85323, -0.60872, 0.4673, -0.0654, 0.35491, 1.12357, 0.60231, 0.54685, 1.65954, 1.58706, 0.94757, -0.38228, -0.01807, -1.10141, -2.0857, -0.07512, -0.29965, -0.04268, -0.09251, 0.42792, -0.61042, 0.32974, 0.36656, 0.64713, 1.18098, 1.07518, -0.45524, 1.03922, 0.02802, -0.42981, -0.31782, -0.09728, -0.77952, -0.67333, -0.43981, -0.24549, 0.5543, -0.96882, -0.82108, -0.5102, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.34592, -2.55972, 0.33529, 0.62739, -0.32025, 0.9492, 0.33236, -1.73236, 0.05512, 0.25008, 0.0215, 0.23564, -0.12059, -0.64706, -0.24619, -0.64211, -0.4057, 0.23186, 1.15274, -0.00199, -0.73114, 0.24458, 0.25445, 0.1128, -0.62947, -0.6621, -1.29914, -0.08177, 2.56637, 0.12907, 0.42461, 2.01889, 1.81172, -0.1851, -1.87905, -2.02063, -0.23341, -0.14326, -0.53726, -0.12139, 1.44634, 0.36964, -0.38845, 0.04682, 1.81776, 0.54651, -0.32421, -0.6138, -0.72034, -1.33904, -1.63724, -1.21463, -0.77421, -1.36574, -0.12324, -0.23498, 0.48133, 0.7781, 0.41294, -0.24813, -0.68684, 0.05689, 0.16448, -0.46146, -0.44988, -0.94069, 0.42602, 0.13087, -0.85623, -0.52727, 0.17965, 0.55406, 0.60067, -0.21203, 0.02072, 0.23035, 0.03724, 1.26176, 0.57728, -0.44483, -0.21836, 0.34994, 0.16215, -1.28533, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[-1.18508, 0.71967, 1.25413, -0.4861, 0.19802, -0.13888, -0.59558, 0.09916, 0.55992, -0.37963, 0.55366, 0.27637, 0.27202, -0.26292, -0.81386, 0.69454, 0.57728, 1.19939, 0.22656, -1.2524, -0.30998, -0.04081, 0.0571, -0.11891, 0.81915, 0.50338, -0.1422, 0.23383, -1.05902, -0.87172, -0.50617, -0.9486, -1.45047, -0.80039, 1.25223, 2.21776, 1.0481, 0.40574, 0.32517, -0.22823, -0.14564, -0.65396, -0.39311, 0.09617, -0.51645, -0.98947, -0.29099, 0.1046, 0.39876, 0.76404, 0.73792, -0.02845, 0.7604, 1.05174, 1.14682, -0.08964, 0.8431, -0.57799, -0.6661, -1.3799, -0.27871, -0.41463, 0.00491, 0.29994, -0.31899, 0.07643, -0.51086, -0.54588, 0.83392, 0.93759, 0.87559, 1.11548, -0.10345, -0.53257, -0.00038, 0.06426, 0.03314, -0.84911, -0.56942, 0.28226, 0.28857, -0.69313, 0.14084, 1.07227, 0.1685, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[1.10258, -0.51143, -1.88765, -0.28618, -0.22565, -0.49888, 0.82536, 0.46514, -0.53459, 0.21482, 0.29064, -0.73323, 0.36535, 0.68133, 1.06421, -0.15419, -1.12709, -1.24091, -0.53892, 1.04016, 0.19653, -0.41903, -0.45056, -0.24987, -0.99985, -0.56276, 0.574, 0.28642, 0.38603, 1.35288, 0.23649, 0.85546, 1.80359, 1.66351, -0.50083, -1.04931, -1.24545, -0.58617, -0.57085, 0.57372, -0.15967, 0.71468, 0.16172, 0.46452, -0.17924, 0.77432, 0.0244, 0.05089, 0.12386, 0.3822, 0.02761, -0.20993, -0.45658, -0.46087, -1.45781, -0.71553, -0.25422, 0.10518, 1.3088, 0.6715, 0.19039, 0.52741, 0.33911, -0.07298, 0.40653, -0.34707, 0.03893, 0.45088, -0.59495, -1.06337, -0.82606, -0.70017, 0.65278, 0.07318, 0.30786, -0.36489, 0.54559, 0.61538, 0.4853, 0.52792, -0.51461, -0.79855, -1.08732, 0.11203, -0.52723, -0.16661, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[-0.20165, -1.5767, 1.17984, 0.04353, 0.23551, 0.19729, -0.0459, -0.09389, 0.10525, -0.20378, -0.72201, 0.06319, 0.47292, 0.07131, -1.12009, -0.88005, 1.18276, 0.99321, 0.35242, -0.31585, -0.66553, -0.15374, -0.18006, -0.30029, 0.41932, 1.03852, 0.86074, -0.3315, -0.31697, -1.15048, 0.23104, -0.20656, -1.15325, -1.45873, -0.28801, 1.00837, 1.79721, 0.65021, 0.72019, -0.35287, -0.91713, -0.73847, 0.1667, -0.36687, -0.10532, 0.00974, 0.24314, 0.06443, 0.35604, -0.58922, 0.055, 0.6017, 0.48154, 0.43531, 0.10396, 0.33409, 0.20653, -0.3931, 0.23856, 0.24647, 0.47857, -0.55331, -0.05977, 0.07707, -0.22563, 0.27837, -0.00537, -0.12138, 0.74649, 0.19169, -0.05069, 0.05075, 0.29252, 0.15842, -0.06756, 0.14082, 0.20652, -0.41646, -0.32809, -0.10407, 0.86934, 0.66058, 0.65414, 0.34673, 0.46503, 0.95946, 0.63353, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.75882, 0.82879, 0.02113, -0.40595, 0.20284, 0.06288, -0.41569, -0.72313, -0.07878, 0.27069, 0.14968, -0.30125, -0.75826, -0.61662, 0.70612, 1.72201, 0.08714, -0.79473, -0.62323, -0.97013, 0.68947, 1.1442, 0.79958, 0.17411, -0.7324, -1.92545, -1.737, -0.13741, 0.06091, 0.39257, -0.1915, -0.12719, 0.55889, 2.01913, 1.45104, -0.89046, -1.3439, 0.00106, 0.31365, -0.31849, 1.36449, 1.05777, 0.48914, 0.26369, 0.33633, 0.25392, 0.70631, -0.85693, -0.37149, 0.12603, 0.66474, 0.41508, 0.0662, -0.33958, 0.78255, 0.06947, 0.26168, -0.64362, 0.51933, 0.49646, 0.61706, 0.07825, 0.99146, 0.27383, 0.1075, -0.71822, -0.52651, -0.46082, 0.07694, 0.0131, -0.50211, -0.30767, -1.01507, -0.42737, -0.21765, -0.35861, 0.17639, 0.19782, 0.34237, 0.25399, 0.15129, -1.12024, -0.2378, -0.18162, -0.07551, -0.61722, 0.4115, 0.74511, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.36551, -1.40392, -0.15785, 0.38883, -0.58717, 0.06094, 0.51656, 0.64257, 0.50671, -0.63605, -0.20263, 0.36563, 1.15328, 0.86051, -0.16275, -1.24898, -0.60661, 1.3866, 0.89769, 0.65152, -0.27475, -0.93982, -1.06022, -0.60798, 0.0149, 0.8549, 1.40902, 0.92389, 0.12861, -0.37945, -1.16854, 0.35452, -0.37712, -1.0247, -1.07226, -0.08644, 1.13034, 1.38662, -0.36352, 0.11959, -0.19764, -0.67434, -1.01967, -0.22767, -0.64254, -0.10277, -0.67931, 0.88707, 0.38084, 0.84239, -0.18984, -0.65964, -0.20417, 0.14332, 0.3321, -0.51129, 0.03915, 0.46208, 0.18707, -0.79426, 0.46468, 0.90044, 0.66977, -0.17814, -0.06118, 0.1261, 0.22408, -0.33857, 0.15849, 0.80286, 0.18611, 0.18005, 0.68623, 0.00243, -0.51585, 0.37912, 0.65738, -0.04302, -0.59897, -0.53954, -0.25882, 0.38674, 0.12124, 1.13256, -0.22425, 0.55825, -0.27619, -0.74689, 0.16652, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[-0.09159, 0.08257, 0.02801, -0.72101, 0.31715, 0.28294, 0.07544, -0.15051, -1.00476, 0.52625, 0.88151, -0.83851, -0.81813, -0.61326, -0.36005, 0.91651, 0.65951, -0.68005, -0.26272, -0.77795, -0.77223, -0.40349, 1.03277, 1.38414, 0.60678, -0.09123, -1.43343, -1.64556, -0.24024, 0.17421, 1.25976, -0.27065, -0.0692, 0.14023, 1.21023, 1.4888, -0.8216, -1.29788, -0.28103, 0.49868, 0.11407, 0.42117, 1.43002, 0.76452, 0.51844, 0.12374, 0.70858, 0.05685, -0.24061, -0.76005, -0.11757, 0.17499, 0.57795, 0.50077, -0.8324, 0.16034, 0.26802, 0.29849, -0.25691, 0.50351, 0.86906, -0.63809, -0.48177, 0.65802, 0.92104, -0.23566, -0.51726, 0.21277, -0.11383, -0.94025, -0.29184, -0.70715, -0.56113, -0.35824, 0.23275, -0.27852, -0.41262, 0.11365, -0.37685, 0.41413, -0.10941, -0.28004, -0.23407, -0.52544, 0.80223, 0.43759, 0.08737, 0.03787, -0.08361, -0.28992, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.73955, -0.92892, 0.10001, 0.8335, -0.16809, -0.22175, -0.24804, 0.12408, 1.30473, 0.04953, -1.48906, -0.42741, 1.21386, 0.80553, 0.33132, -0.42857, -0.37064, 0.44209, 0.50835, 0.42081, 1.13019, 1.26867, -0.25394, -0.93017, -0.70207, 0.17265, 0.72039, 0.65232, 0.25619, 0.13818, -0.14721, -0.47657, -0.13634, -0.55528, -0.65646, -0.7779, 0.17489, 1.02192, 1.11868, -0.27086, -0.53234, -0.91323, -0.12483, -0.6379, -0.12881, -0.31071, -0.24491, -0.99452, 0.34017, -0.15547, 0.81155, 0.5894, -0.1874, -0.87162, 0.30262, 0.09425, 0.27584, -1.04376, 0.39524, 0.15028, 0.1597, -0.24752, 0.77768, -0.31797, -0.34135, -0.00407, 0.3421, -0.9373, -0.60421, 0.26232, 0.09191, 0.44507, -0.42307, -0.12758, 0.06333, 0.68957, -0.15036, 0.00043, 0.82293, -0.23735, -0.53653, 0.54584, 0.20534, -0.03336, 0.41212, 0.18119, -0.68775, -0.78737, -0.0578, -0.0282, -0.31063, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.41014, 0.31801, -0.0551, -0.98751, -0.39936, 0.77433, 0.29654, -0.39486, -0.602, -0.42209, 1.2342, 1.09008, -0.99005, -0.9866, -0.39628, 0.50348, 0.90781, -0.48568, -0.18993, 0.49523, -0.37988, -1.04027, -1.12922, 0.1534, 0.64549, -0.04622, -0.07031, -0.27924, -0.8684, -0.85144, -0.5652, 1.10867, 0.07206, 1.0746, 0.0853, -0.06178, 0.37609, -0.55847, -0.75376, 0.0616, 0.61465, 0.83764, -0.02608, 0.48007, 0.25263, 0.46821, 0.26504, 1.10857, -0.19883, -0.25777, -0.59367, -0.44371, -0.15216, 0.8841, 0.6309, -0.57075, -0.43469, 0.49222, -0.09268, -1.20688, 0.08891, 0.95432, 0.30224, -0.86929, 0.29198, 0.04437, 0.13521, 0.10115, 0.7252, 0.47428, -0.56815, -0.28923, -0.08181, -0.19301, 0.07281, -0.32798, 0.58288, 0.47384, -0.31704, -0.21962, -0.0589, 0.04368, -0.06909, -0.09854, -0.06733, 0.41424, 0.0431, -0.11358, 0.22882, 0.02606, -0.3858, -0.39367, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.5085, -1.45606, -0.74452, 0.66344, 0.59981, -0.91835, -0.30826, 0.28913, 0.30071, 0.79823, -0.67159, -1.86118, 0.61803, 1.48455, 0.33164, -0.78871, -1.10182, 0.96396, 0.75611, -0.81031, -0.58948, 0.84831, 1.39364, -0.07597, -0.30654, 0.21766, 0.59667, 0.649, 0.80597, 0.25287, 0.49486, -0.31271, 0.0245, -0.34511, -0.9385, -0.15694, 0.07513, 0.28521, 0.39918, 0.42376, 0.05681, -0.4545, -0.56877, -0.53917, -0.29727, -0.34019, -0.42529, -0.03268, -0.04926, -0.04923, -0.03502, 0.13173, 0.4112, -0.14983, -1.12654, -0.39506, 0.48139, 0.37984, -0.9325, -0.24284, 0.45716, -0.06478, -0.40253, 0.31851, 0.19888, -0.64551, 0.08985, -0.25185, -0.44561, -0.40348, 0.56332, 0.12189, 0.1762, -0.38415, -0.29668, 0.19133, -0.51475, -0.45446, -0.17597, 0.50157, -0.32083, -0.08111, -0.2758, -0.1349, 0.12901, 0.43329, 0.73342, -0.0387, -0.17242, 0.75047, 0.67277, 0.17658, 0.51387, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[-0.13976, 0.5748, 1.24461, -0.83109, -1.13914, 0.20943, 0.92654, 0.33677, -0.63139, -1.00294, 0.08717, 1.09015, 0.80317, -1.14209, -0.67007, 0.53367, 1.11108, -0.41883, -1.39762, -0.222, 1.07147, 0.07793, -0.60293, -0.07102, 0.21, -0.53833, -1.06594, -0.34522, 0.33114, -0.2168, -0.92696, -0.69119, -0.29865, -0.19998, 1.25424, 0.6695, -0.13644, -0.04727, -0.58597, -0.24068, 0.13855, 0.35885, 0.96503, -0.32979, 0.42121, 0.26608, 0.32614, -0.31589, 0.86, -0.23128, 0.27591, 0.1689, 0.02999, -0.10263, 1.06731, 0.8917, 0.33825, -0.23084, 0.72482, -0.06095, -0.99184, -0.78957, 0.15986, -0.24803, 0.13665, -0.37514, 0.06574, 0.15712, 0.20695, 0.36666, 0.37008, -0.05727, 0.06352, 0.40379, 0.11138, 0.01575, 0.38095, 0.41711, 0.26452, 0.22572, -0.08655, 0.25201, 0.02471, 0.11443, 0.18782, -0.34621, -0.04611, -0.0613, -0.16192, 0.09376, 0.68481, 0.11058, 0.326, 0.12079, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[1.18323, -0.30175, -1.12975, -0.30667, 1.06785, 0.49076, -1.19637, -0.67685, 0.74935, 0.79872, 0.51927, -1.03674, -1.24821, 1.10075, 1.15362, 0.07593, -1.20592, -0.10178, 1.4351, 0.59563, -1.04752, -0.75028, 0.01945, 0.24471, -0.57646, 0.15125, 0.73668, 0.21539, -0.39538, -0.11857, 0.27064, 0.53715, -0.12907, 0.2641, -0.43825, -0.79864, -0.25964, 0.18015, 0.45184, -0.00428, -0.29583, -0.2078, -0.35822, -0.04024, 0.04592, -0.22266, -0.0544, 0.18703, 0.03955, 0.21266, -0.45879, -0.474, -0.44781, -0.08586, -0.3474, -1.16829, -0.86439, 0.05724, 0.26768, -0.65222, -0.22407, 0.0066, 0.55205, -0.22115, 0.06525, -0.32794, -0.18487, -0.12494, 0.37467, -0.25597, -0.033, 0.55563, 0.10543, 0.44362, 0.31263, 0.22721, 0.23329, -0.18791, 0.1579, -0.31193, -0.20694, -0.05465, -0.11321, 0.42175, -0.13581, -0.49261, 0.0971, 0.7146, 0.26369, -0.13322, 0.55922, 0.41457, 0.38727, 0.50876, 0.00245, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[-0.32831, -0.6448, 0.80866, 0.38428, -0.73023, -0.8611, 0.15492, 0.73084, -0.25884, -0.6375, -0.46897, 0.40716, 0.84934, -0.36404, -1.3248, 0.05214, 1.47621, 0.66968, -0.78135, -1.12988, 0.05449, 0.79778, 0.05052, -0.47188, 1.10626, 0.43038, -0.39436, -1.02348, -0.20329, 1.09018, 0.4636, -0.22181, 0.0631, -0.16641, -0.50346, 0.29904, 0.41408, 0.13935, -0.16668, -0.01398, 0.00847, 0.41036, 0.34075, 0.25308, -0.51297, 0.06961, 0.4866, 0.08878, -0.489, 0.03054, 0.35077, 0.44329, 0.73728, 0.60745, 0.17015, 0.56595, 0.44923, 0.17486, -0.13613, 0.73479, 0.22393, 0.38114, -0.3595, -0.25829, -0.10724, 0.04545, 0.48419, -0.57664, -0.23835, 0.05469, 0.39996, -0.01191, 0.28102, 0.03918, 0.02794, 0.04859, 0.12788, 0.16341, -0.19878, 1.01008, 0.49149, -0.09828, -0.34586, 0.17096, -0.42267, 0.0595, -0.32253, -0.50802, -0.2973, -0.11552, -0.14505, 0.24887, 0.35239, 0.38587, 0.59171, 0.60377, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.23281, -0.07563, -0.21987, -1.04679, 0.27065, 1.04994, 0.22952, -0.72286, -0.02276, 0.55284, 0.44152, -0.23783, -0.51151, -0.34626, 1.12292, 0.25741, -1.04985, -0.56056, 0.72403, 1.35188, 0.24903, -0.4143, -0.01563, 0.14253, -0.79884, -0.74292, 0.20652, 1.19414, 0.44619, -0.98257, -0.80483, -0.20412, -0.29581, -0.07361, 0.44376, -0.1925, -0.58054, -0.30865, 0.04326, 0.37351, 0.23883, -0.32422, -0.25804, -0.21097, 0.04675, -0.27776, -0.05242, -0.47176, 0.07912, 0.09407, 0.38986, -0.29119, -0.68914, -0.52313, -0.46979, -0.51943, 0.13323, -0.67089, 0.14144, -0.45964, -0.69802, -0.65172, 0.4138, 0.45228, 0.24861, -0.19865, -0.29695, -0.16847, 0.64248, 0.2971, -0.15786, -0.01262, 0.45033, 0.17889, 0.01121, -0.16955, 0.05275, 0.14259, 0.32839, -0.1014, -0.35041, 0.02434, 0.02795, 0.45016, 0.62123, 0.24062, -0.0598, -0.18275, 0.30552, -0.10753, -0.17628, -0.40842, -0.56645, -0.4025, -0.0208, 0.17322, -0.19181, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.36522, -0.8567, 0.55488, 0.42297, 0.10459, -0.56049, -0.4708, 0.69789, 0.14531, -0.77933, -0.41608, -0.16672, 0.49185, 0.64424, -1.00531, -0.68183, 0.87777, 0.76931, -0.37946, -1.34215, -0.35683, 0.19655, -0.00179, -0.08074, -0.09852, 0.86355, 0.33193, -0.69468, -0.74097, 0.1146, 0.83481, 0.38374, -0.0501, 0.11935, 0.10681, -0.17461, 0.0222, 0.40773, -0.02908, -0.25839, -0.18137, -0.0776, 0.40073, 0.18939, 0.31102, -0.25405, 0.32424, 0.60341, 0.29666, -0.30901, -0.29307, 0.32755, 0.42579, 0.45077, 0.76194, 0.44304, 0.07014, 0.1487, 0.14812, 0.55867, 0.68123, 0.43313, 0.2291, -0.1936, -0.03821, -0.4235, -0.0759, -0.62027, -0.26953, -0.35677, 0.42872, 0.13363, -0.07745, 0.33942, 0.18381, 0.39363, -0.23712, -0.37742, -0.07303, 0.1347, 0.62924, 0.18172, 0.10723, -0.25403, -0.23477, -0.06374, 0.08299, 0.05708, -0.4794, 0.16157, -0.16422, 0.06834, 0.19868, -0.01876, -0.21662, 0.02854, 0.69412, 0.09146, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.3094, 0.25203, -0.11785, -0.54182, -1.2245, 0.27004, 0.48413, -0.46928, -0.25401, 0.50357, 0.31832, 0.0946, -0.11297, -0.43457, 0.50313, 1.12375, -0.61882, -1.01325, 0.08184, 0.91516, 0.84665, 0.13852, 0.03401, 0.39165, 0.53134, -0.6294, -0.58929, 0.1519, 0.83393, 0.68292, -0.52989, -0.22071, -0.08746, -0.3834, -0.20387, 0.69532, 0.32001, -0.07317, -0.36631, 0.26982, 0.26882, 0.12211, -0.43414, -0.20008, -0.05885, -0.09595, -0.34767, -0.08483, -0.56957, -0.38532, 0.11084, 0.32068, -0.20632, -0.46677, -0.58589, -0.53434, -0.67379, -0.01719, -0.11185, -0.21726, -0.40682, -0.2791, -0.34197, -0.25549, 0.24224, 0.49607, 0.62121, 0.06913, 0.22505, 0.12045, -0.27813, -0.38089, 0.39748, -0.03888, 0.04742, -0.0027, 0.11979, -0.15773, -0.23063, -0.12037, -0.32015, 0.02315, 0.00183, -0.19352, -0.18781, -0.07426, -0.2129, -0.35308, -0.20261, -0.20738, -0.15817, -0.37457, 0.18455, -0.27523, -0.70213, -0.09987, -0.24762, -0.20947, -0.04643, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.26912, -0.54789, -0.2953, 0.09174, 0.64063, -0.06223, -0.3432, 0.00102, 0.49785, -0.2665, 0.24394, -0.07179, -0.35644, -0.18201, -0.07976, -0.86661, 0.23211, 1.13286, 0.58915, -0.75948, -1.4182, -0.03275, -0.14225, -0.41178, -0.10388, 0.48751, 0.87327, -0.04048, -0.56495, -0.53953, 0.2411, 0.47392, 0.38661, 0.29195, 0.09137, -0.50282, -0.45374, -0.23525, 0.38163, 0.20358, 0.10095, -0.04809, 0.07345, -0.04828, -0.1979, 8e-05, 0.21571, 0.18864, 0.47879, 0.23584, -0.13965, -0.04491, 0.65297, 0.394, 0.031, 0.64903, 0.91652, -0.07814, -0.0498, -0.04505, 0.52621, 0.46028, 0.27663, 0.53869, 0.19756, -0.35051, -0.33662, -0.32329, 0.17523, -0.23441, -0.09746, -0.18701, -0.02343, -0.34048, -0.06058, 0.0381, 0.09535, 0.44976, -0.28272, 0.24949, 0.12093, 0.08884, 0.18176, 0.50316, 0.00472, -0.23032, -0.38458, -0.19996, 0.33228, -0.07603, -0.08382, 0.27233, 0.01134, 0.22172, 0.62728, -0.24359, -0.01485, 0.10324, -0.1395, -0.36294, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.00974, -0.48447, 0.48022, 0.0465, -0.16293, -0.41164, 0.38211, -0.02115, -0.59751, 0.38233, -0.11655, -0.22342, 0.11821, -0.11231, -0.22027, 0.46534, -0.02034, -0.94412, -0.76334, 0.46714, 0.91256, 0.31134, 0.36969, 0.0254, 0.12671, -0.2014, -0.50808, -0.01515, 0.32063, 0.40546, -0.2724, -0.37242, -0.12338, -0.10976, -0.3626, -0.11671, 0.41634, 0.46064, -0.29094, -0.16373, 0.16936, 0.08805, 0.40879, 0.19134, 0.10343, 0.10821, -0.04544, -0.52311, 0.28283, -0.40074, -0.5347, -0.54731, -0.47308, -0.26817, -0.38805, -0.43919, -0.55435, -0.53402, -0.18735, -0.2585, -0.31219, -0.68248, -0.13706, -0.12649, -0.17575, -0.24209, 0.01509, -0.15932, -0.07494, 0.29485, 0.71563, -0.05591, -0.5591, -0.25487, -0.00238, 0.01005, -0.20204, 0.13785, 0.13531, -0.24271, -0.332, 0.07426, -0.03836, -0.48934, -0.11887, 0.12071, -0.18966, -0.53375, -0.48545, -0.47917, 0.12449, -0.04219, -0.36812, 0.20028, -0.08968, 0.20773, 0.20086, -0.05525, -0.08762, 0.51304, -0.22782, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[-0.12154, 0.08926, 0.37219, -0.62317, -0.04237, 0.7384, -0.32497, 0.00551, 0.10191, -0.74628, -0.16074, 0.68591, 0.46473, -0.15004, -0.25116, -0.07116, -0.11758, 0.60974, 0.93436, -0.14605, -0.63909, -0.47588, -0.0654, -0.14368, -0.48544, -0.04863, 0.48353, 0.50231, -0.23307, -0.47102, -0.15785, 0.18584, 0.01978, 0.21872, 0.49123, 0.51585, 0.02377, -0.18653, -0.07056, 0.27555, -0.15372, -0.02912, 0.03893, 0.19661, -0.08146, -0.08427, -0.15023, 0.149, -0.07373, 0.2219, 0.23953, 0.46011, 0.50503, 0.49402, 0.45021, 0.09345, 0.28749, 0.86538, 0.15979, -0.08969, 0.08852, 0.21546, 0.12035, -0.19107, -0.08212, 0.03293, -0.01061, -0.48953, -0.21919, -0.28329, -0.15997, -0.26193, 0.43309, 0.06758, -0.21793, -0.57134, 0.00288, 0.11901, 0.16827, -0.00338, 0.23843, 0.38626, -0.03481, 0.43486, 0.30194, -0.16703, -0.55838, -0.24993, -0.17161, 0.45458, -0.12126, -0.36911, 0.39978, -0.09391, -0.03301, -0.26222, 0.22696, 0.16556, 0.04669, 0.03978, 0.27828, 0.37648, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.53782, -0.60565, -0.52245, 0.12329, -0.27191, -0.45026, 0.08976, -0.00852, -0.04311, 0.54341, 0.5866, -0.68742, -0.42572, 0.38117, 0.52209, 0.15096, 0.03716, -0.38523, -0.7672, -0.32426, 0.41924, 0.22679, -0.06724, 0.34123, 0.28834, 0.09822, -0.28203, -0.42119, 0.13174, 0.78592, 0.4591, -0.2101, -0.20539, 0.00768, -0.24299, -0.38767, -0.12291, -0.05905, 0.25251, -0.05865, 0.15526, -0.06993, -0.52698, -0.08762, 0.29854, 0.01896, 0.26735, 0.08735, -0.38492, 0.12164, -0.14455, -0.26041, -0.36036, -0.58578, -0.53127, -0.33381, -0.67435, -0.69818, -0.12741, -0.00689, -0.00463, -0.14806, -0.41742, -0.17569, 0.42762, 0.14931, 0.28012, 0.14427, 0.11998, -0.3616, 0.18867, 0.27487, -0.1605, -0.47814, -0.06432, -0.00451, -0.18158, -0.29432, -0.16575, 0.02759, 0.05238, -0.10917, 0.09643, 0.16438, -0.14033, -0.28141, -0.23708, -0.00532, -0.07201, -0.28383, 0.1751, 0.24141, -0.12922, 0.23078, 0.00024, 0.19295, -0.46017, 0.19828, 0.27759, -0.05165, 0.06135, 0.26631, 0.03175, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[-0.40122, -0.5422, 0.92472, -0.1304, -0.31437, 0.13266, 0.30772, -0.05083, 0.61482, -0.08973, -0.88377, 0.05074, 0.34819, -0.2734, -0.68716, -0.41514, -0.03367, 0.08524, 0.73914, 0.43083, -0.05519, -0.35228, -0.28756, -0.03968, -0.0036, -0.01559, 0.20203, 0.17974, 0.05843, -0.32141, -0.42096, -0.01934, 0.22357, -0.22394, -0.34646, -0.13652, 0.06169, 0.00663, -0.08932, 0.16908, 0.03524, -0.06518, 0.28354, -0.02932, -0.15961, -0.04484, 0.19247, 0.00558, 0.37537, 0.05125, -0.03703, -0.03065, 0.3159, 0.54136, 0.76029, 0.39669, 0.48095, 0.40949, 0.41069, 0.19164, 0.18779, 0.42461, 0.13784, 0.01453, -0.77681, -0.52737, -0.09974, -0.15992, -0.31954, -0.52723, 0.06791, -0.23729, -0.08033, 0.17172, 0.11483, -0.13939, -0.12857, 0.07013, -0.02575, 0.23264, -0.20997, 0.0991, 0.28109, 0.14553, 0.32203, 0.3444, 0.05791, -0.33078, -0.51683, -0.16702, 0.24802, -0.0529, -0.45694, -0.11356, 0.27884, -0.06856, 0.0752, 0.06597, -0.17109, 0.03453, 0.05974, -0.32093, 0.3176, -0.01732, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.87352, 0.12555, -0.76952, -0.23153, 0.74392, 0.00769, -0.54966, -0.01727, -0.61981, -0.03751, 0.8775, 0.04637, -0.66258, -0.31598, 0.88509, 0.56328, -0.05008, -0.24059, -0.24984, -0.28852, -0.00423, 0.47287, 0.18422, -0.04389, 0.15592, -0.05, 0.14629, -0.15505, -0.33019, 0.20727, 0.18803, 0.34382, -0.35088, 0.098, 0.55436, 0.40684, 0.07591, -0.03314, -0.43933, -0.17893, -0.21788, 0.41032, -0.0891, -0.49347, -0.14587, 0.15592, 0.02409, -0.0943, -0.14256, -0.10129, -0.0263, -0.04264, -0.15785, -0.29158, -0.50356, -0.0199, -0.13174, -0.26645, -0.50824, -0.17139, 0.10792, -0.33773, 0.28168, -0.04495, 0.29976, 0.26852, 0.03353, 0.20355, 0.66479, 0.65691, 0.06851, -0.17126, 0.04643, -0.25135, 0.12468, 0.09112, 0.06742, -0.01186, 0.0581, -0.21648, -0.23539, -0.15967, -0.10138, 0.16253, 0.19664, -0.23102, -0.22037, -0.17403, 0.20378, 0.00911, 0.1462, 0.07988, 0.22426, 0.3432, 0.12747, 0.0965, -0.31887, -0.05122, 0.1232, -0.0951, 0.06106, 0.29882, 0.11692, -0.11867, -0.15012, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[-0.53135, -1.18583, 0.56649, 0.38771, -0.73418, -0.13959, 0.41019, -0.10302, 0.30413, 0.26403, -0.4169, -0.26736, 0.60291, 0.29897, -0.71569, -0.5756, 0.17795, 0.55286, 0.14305, 0.16681, 0.17491, -0.04965, -0.20229, -0.09999, -0.24184, -0.22494, 0.01112, 0.42624, 0.3535, -0.0818, -0.37565, -0.28102, 0.34904, -0.0777, -0.33748, -0.37454, -0.09675, -0.05396, 0.01273, -0.14087, 0.06071, -0.43354, 0.00874, 0.42331, 0.29909, -0.12722, -0.42093, 0.02745, -0.0175, 0.04511, 0.1362, 0.25195, 0.1866, 0.13482, 0.36717, 0.40139, -0.04022, 0.02123, 0.43897, 0.43547, -0.05714, 0.03089, -0.02825, 0.05539, -0.08599, -0.16155, -0.15982, -0.1274, -0.29543, -0.56094, 0.07871, 0.27674, 0.34473, -0.17768, -0.13009, -0.16872, 0.21246, 0.1598, 0.19791, 0.20974, 0.0535, 0.1673, 0.05084, 0.02037, -0.13219, 0.12438, 0.10278, 0.11084, -0.38212, 0.28534, -0.16875, 0.00681, -0.03524, -0.43084, -0.20321, 0.25572, 0.26196, 0.16394, 0.1627, 0.16059, -0.03947, -0.05614, 0.23157, 0.01487, -0.54844, -0.10867, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.46995, 0.73389, -0.21646, -0.84517, 0.18723, 0.53218, -0.00024, -0.22619, -0.04004, -0.37275, 0.26112, 0.54253, -0.37995, -0.6668, 0.21477, 0.59829, 0.2322, -0.48897, -0.21982, -0.0795, -0.24039, -0.21698, 0.36555, 0.15391, 0.08194, 0.16713, -0.1256, -0.22265, -0.27702, 0.13093, 0.57976, 0.39979, 0.03949, -0.29187, -0.1597, 0.48707, 0.34429, 0.24166, 0.13539, 0.09747, 0.14654, -0.05716, 0.19243, 0.07825, -0.24879, -0.22043, 0.10511, 0.17644, -0.07843, -0.11104, -0.12512, -0.29386, -0.07096, -0.09213, -0.15242, -0.5306, 0.10157, 0.16208, -0.09481, -0.13388, 0.27935, 0.22104, 0.14381, 0.22279, 0.18245, 0.17637, 0.159, 0.08093, 0.01101, 0.00748, 0.02569, -0.24187, 0.00671, 0.20364, -0.10838, 0.10097, -0.03988, -0.07786, 0.09308, 0.10312, -0.04763, -0.11953, -0.25457, -0.03537, 0.12144, -0.20482, -0.05112, -3e-05, -0.05197, -0.17001, 0.23572, 0.07263, -0.03484, -0.03619, -0.15252, -0.00361, -0.1281, -0.08252, -0.08585, 0.10479, 0.03569, -0.13507, -0.15985, 0.05567, 0.43827, -0.22397, -0.20233, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.04787, -1.45075, 0.27053, 0.70143, -0.12388, -0.67427, 0.24623, 0.28874, -0.06989, 0.37052, 0.08158, -0.53781, 0.1046, 0.47065, -0.03769, -0.79622, -0.54895, 0.40923, 0.61188, -0.00513, 0.12885, 0.16047, -0.28139, 0.00265, 0.16392, -0.01521, -0.31385, 0.1124, 0.28652, 0.2989, -0.30538, -0.4738, 0.01094, 0.5025, -0.0876, -0.42211, -0.52117, -0.08152, 0.22321, 0.0019, -0.16503, -0.11489, -0.45851, -0.08145, 0.07075, 0.3667, 0.14446, -0.26465, -0.08009, -0.00625, -0.09292, -0.00599, -0.16169, 0.10347, -0.07725, 0.20083, 0.22474, -0.15677, -0.22571, 0.11649, 0.28878, -0.00376, -0.11033, -0.20666, -0.21275, -0.18356, -0.1017, -0.07135, -0.00694, 0.14324, -0.00467, 0.0443, 0.16541, 0.00119, 0.09915, -0.08318, 0.09072, -0.11803, -0.05837, 0.46763, -0.0464, -0.14565, -0.01562, -0.08862, 0.0317, -0.06914, -0.12164, -0.37469, 0.04791, -0.25813, 0.01388, 0.0114, -0.03152, -0.11491, -0.18779, -0.00921, -0.05244, 0.19523, -0.0147, 0.24715, 0.196, 0.37936, 0.23993, -0.03561, 0.16229, 0.19868, -0.22661, -0.28084, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[-0.04784, 0.46757, 0.18215, -0.73621, 0.0044, 0.32118, 0.0731, -0.18944, -0.15258, -0.12697, -0.27515, 0.26434, 0.23383, -0.42138, -0.13717, 0.71702, 0.58441, -0.19253, -0.55875, 0.17033, 0.19276, -0.4154, -0.17513, 0.03244, -0.08654, -0.08522, 0.37383, -0.01504, -0.31391, -0.45006, 0.1553, 0.5516, 0.25612, -0.28427, -0.11847, 0.30519, 0.49112, 0.12326, -0.2519, -0.19842, 0.23493, 0.33115, 0.32582, 0.29558, 0.19256, 0.04757, 0.17525, 0.25867, 0.19502, 0.00207, 0.04445, 0.13457, -0.1329, -0.27686, -0.25807, -0.04294, -0.25557, -0.08966, -0.26017, -0.0534, -0.29495, -0.09658, 0.00359, -0.0468, 0.35856, 0.27349, 0.32417, 0.19667, 0.06815, -0.02497, -0.19461, -0.17004, -0.07331, -0.09868, 0.39668, -0.06889, 0.21491, 0.12642, 0.07664, -0.19995, -0.09984, 0.07075, 0.02295, -0.10204, -0.13083, -0.12391, -0.03077, -0.00336, -0.0622, -0.06344, -0.29306, 0.31271, 0.22776, 0.19086, 0.27065, 0.05857, -0.08051, -0.16084, -0.09595, -0.28851, 0.0243, 0.05653, 0.01814, 0.02236, 0.10393, 0.0978, -0.02916, -0.18965, -0.04904, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.47865, -0.91898, -0.34637, 0.4627, 0.08882, -0.50754, -0.21524, 0.31683, 0.22689, -0.0041, 0.38083, 0.18001, -0.30678, 0.10822, 0.16328, -0.39975, -0.7225, -0.03643, 0.62462, -0.02197, -0.15963, 0.40091, 0.14055, -0.19964, 0.17974, 0.15554, -0.18066, -0.16539, 0.05589, 0.49801, 0.16609, -0.17942, -0.41244, 0.21435, 0.45158, -0.01335, -0.33584, -0.37561, 0.01731, 0.18002, -0.09995, -0.23314, -0.28682, -0.4575, -0.08263, -0.08263, 0.03155, -0.03362, -0.23986, -0.01395, 0.02348, 0.04399, 0.0684, 0.04207, 0.22061, 0.00801, -0.00866, 0.04348, 0.27253, -0.21228, 0.16057, 0.41323, 0.1606, 0.22345, -0.09972, -0.36491, -0.29712, 0.09885, -0.11268, -0.04221, -0.00994, 0.19459, 0.05818, 0.00645, -0.15648, 0.07229, 0.04519, -0.04394, -0.18247, 0.045, 0.38609, -0.00365, -0.35226, 0.09243, -0.00486, -0.14624, -0.08482, -0.10257, -0.12523, 0.16021, -0.05988, -0.24797, -0.1324, -0.21162, -0.052, 0.06486, 0.07662, 0.18048, -0.12882, 0.04405, -0.0649, -0.17313, 0.04407, 0.10449, -0.00285, -0.02338, 0.07078, 0.29437, -0.13064, 0.05081, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[-0.14094, 0.07754, 0.36208, -0.55851, -0.27856, 0.48534, 0.41563, -0.21753, -0.0798, 0.08268, -0.09564, -0.55158, 0.14935, -0.01774, -0.21461, 0.15623, 0.82043, 0.27856, -0.41089, -0.27228, 0.0831, -0.09683, -0.18649, 0.19781, -0.23145, -0.25907, -0.06919, 0.29745, 0.06681, -0.45879, -0.33048, 0.07262, 0.41487, 0.03186, -0.55003, -0.17278, 0.33064, 0.52221, 0.04502, -0.16137, -0.14323, 0.0232, 0.19933, 0.29908, 0.06467, -0.0405, -0.05701, 0.11952, 0.20396, 0.02223, -0.04731, 0.07012, 0.05333, 0.01018, -0.20694, -0.36427, -0.10168, 0.04459, -0.1529, -0.05868, -0.072, -0.0622, -0.33997, -0.2751, 0.04623, 0.26247, 0.34378, -0.03881, 0.14038, 0.05812, 0.01701, -0.12567, -0.20822, -0.17937, -0.12761, 0.2322, 0.14407, 0.05128, 0.11948, -0.22908, -0.37759, 0.22025, -0.0397, 0.01061, -0.14957, -0.1608, 0.07003, -0.05651, 0.21037, -0.17864, 0.29037, 0.16894, 0.08024, 0.10975, 0.06332, 0.2765, 0.24566, 0.07996, -0.1199, -0.03988, -0.09292, -0.1652, -0.14671, -0.0967, 0.13964, -0.11114, -0.06773, -0.07338, -0.09645, 0.11907, -0.18881, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.24919, -0.55945, -0.15179, 0.22459, 0.34766, -0.28166, -0.37349, -0.07363, 0.07887, 0.04739, -0.23571, 0.59049, 0.27272, -0.10711, 0.1171, 0.0443, -0.69022, -0.36334, 0.44495, 0.34485, -0.18546, -0.05679, 0.09914, -0.26417, -0.08405, 0.21288, 0.09425, -0.24878, -0.35014, 0.17018, 0.50838, 0.13631, -0.13204, -0.17368, 0.43679, 0.25269, -0.26671, -0.20495, -0.06287, 0.19148, 0.14555, -0.1416, -0.09669, -0.16306, -0.17142, -0.00719, 0.01905, 0.03783, -0.1868, -0.06402, -0.04359, -0.12837, -0.18144, 0.01961, 0.14102, 0.39203, -0.05446, -0.08039, -0.02492, 0.0279, 0.06447, -0.02625, 0.02256, 0.09362, -0.04575, -0.08153, -0.22799, 0.07228, 0.173, 0.05657, -0.11074, 0.05543, 0.24503, 0.14339, -0.04655, -0.52849, 0.0689, 0.13625, 0.15102, 0.14425, 0.20339, 0.01702, 0.06152, -0.11471, -0.01029, 0.15239, -0.21328, -0.03717, -0.09102, 0.13888, 0.00299, -0.00301, -0.0563, 0.16144, 0.04751, -0.10791, 0.09942, 0.08029, -0.02141, -0.06669, -0.1106, 0.05129, 0.0315, -0.01194, -0.09716, 0.11266, -0.12007, 0.03043, -0.17325, -0.07878, 0.28841, 0.16292, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.11069, -0.0051, 0.21173, -0.32849, -0.36916, 0.00909, 0.41534, 0.17893, -0.22049, 0.02335, 0.45198, -0.14811, -0.52511, -0.15875, -0.06577, -0.04243, 0.41995, 0.47967, -0.11806, -0.2341, 0.29218, 0.08374, -0.21134, 0.17544, 0.29999, -0.18632, -0.40585, 0.08283, 0.42937, 0.1432, -0.38044, -0.30618, -0.03042, 0.25413, -0.16414, -0.28234, -0.05242, 0.01714, -0.15038, -0.26386, -0.25486, -0.04636, 0.2562, 0.13844, 0.11755, -0.02713, -0.05476, -0.01058, 0.13034, 0.12659, 0.02433, 0.07789, 0.01439, -0.06041, 0.09182, -0.06032, -0.14569, -0.07255, 0.0107, -0.1179, -0.127, 0.09414, 0.25449, 0.13891, -0.21685, -0.081, 0.21159, -0.06518, -0.08394, -0.05696, -0.05205, 0.04603, -0.11955, -0.04592, -0.06888, 0.08813, -0.01213, -0.02895, -0.0412, -0.00573, -0.19053, -0.2352, -0.08941, -0.05223, -0.08876, -0.12924, 0.09901, -0.07434, -0.13114, 0.01195, -0.18749, 0.21509, 0.34804, 0.06244, 0.09292, 0.13301, 0.10051, -0.10552, -0.01976, -0.11328, 0.02814, -0.0297, -0.07104, -0.25746, -0.00692, -0.12126, -0.04937, 0.04529, 0.00694, -0.14531, 0.09709, 0.15289, -0.02703, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.28492, -0.59675, -0.33956, 0.17088, 0.28627, -0.12251, -0.05035, 0.0872, 0.15736, -0.03258, -0.34334, -0.11537, 0.48927, 0.23598, -0.17074, 0.11074, -0.21662, -0.45871, 0.08628, 0.34609, -0.29306, -0.17767, 0.13025, -0.0153, -0.35129, -0.05806, 0.34072, 0.11524, -0.40143, -0.22611, 0.2337, 0.3083, -0.02669, -0.06748, -0.02149, 0.36608, 0.19895, -0.03345, 0.18264, 0.15418, 0.30255, 0.06959, -0.21529, -0.22323, -0.12583, 0.01457, 0.09031, -0.01714, -0.05391, -0.16774, -0.01496, 0.22701, 0.05802, -0.03723, -0.26173, 0.11763, 0.11835, -0.03685, 3e-05, 0.03376, 0.10842, -0.05547, -0.22821, 0.0036, -0.00843, 0.05233, -0.23166, -0.12411, 0.05277, 0.10801, -0.01354, -0.06074, -0.17771, 0.01213, -0.06725, -0.17086, -0.46122, -0.09943, 0.01962, -0.17363, 0.08251, 0.28414, 0.10212, 0.03869, -0.22463, -0.0658, 0.07234, -0.03065, 0.04091, 0.02774, 0.13556, -0.07217, -0.13884, -0.12227, 0.02808, 0.17215, 0.03299, 0.29817, -0.04825, -0.22103, -0.49238, -0.19505, 0.18636, 0.26425, 0.25574, -0.02215, -0.00413, 0.06795, 0.14981, 0.01636, -0.33552, 0.20079, 0.07169, 0.09703, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[-0.20487, 0.04156, 0.3792, -0.38749, -0.16961, -0.0033, 0.14334, 0.03365, -0.08169, -0.00768, 0.27605, 0.33927, -0.3268, -0.37595, 0.12483, -0.11168, 0.02799, 0.44463, 0.04224, -0.47967, 0.08917, 0.3942, 0.00409, -0.07069, 0.26669, 0.18669, -0.24233, -0.46948, 0.18256, 0.29875, 0.17913, -0.11168, 0.08691, 0.01377, -0.13285, -0.27902, -0.11264, 0.2059, -0.04229, -0.33599, -0.33566, -0.18561, 0.1111, 0.31305, 0.23703, -0.01298, -0.14532, -0.09819, -0.11794, 0.06899, 0.09158, -0.18184, -0.05112, 0.055, -0.05704, 0.00025, -0.0963, 0.10103, -0.09632, -0.17347, -0.15636, 0.00698, -0.03522, 0.13997, 0.07837, 0.15325, 0.12999, 0.24343, 0.13287, -0.0665, -0.1851, -0.10342, 0.09261, 0.09672, 0.077, -0.02441, 0.20274, -0.04794, -0.1004, 0.04192, 0.03279, -0.05516, -0.19904, 0.08561, 0.1907, 0.04634, -0.28758, 0.06084, 0.03913, 0.03937, -0.0583, -0.12319, 0.13901, 0.31106, 0.12028, 0.10549, 0.18231, -0.05442, 0.03489, 0.03303, -0.01694, -0.09732, 0.10533, -0.05415, 0.22999, 0.10609, 0.1381, -0.09551, -0.0602, 0.03729, 0.00196, 0.00762, 0.02966, 0.26653, 0.073, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.34373, -0.41606, -0.28211, 0.10002, 0.24288, -0.16169, -0.32834, -0.00431, 0.14389, 0.20901, -0.20217, -0.23232, 0.23263, 0.38918, -0.0077, 0.02135, -0.03482, -0.26543, -0.10229, 0.42209, 0.16999, -0.40277, -0.21425, 0.18443, -0.05042, -0.28883, 0.01112, 0.43333, -0.09776, -0.38918, -0.23883, 0.09218, 0.04947, 0.05881, 0.10447, 0.12964, -0.04678, -0.19069, -0.03218, 0.33903, 0.19604, 0.10484, -0.0209, -0.17758, -0.3007, -0.08286, 0.24649, 0.26749, 0.32046, 0.05244, -0.12992, 0.04342, 0.04454, 0.17164, 0.1056, -0.05422, 0.05571, -0.12968, -0.30605, -0.06015, 0.13165, 0.03107, 0.00655, -0.14731, -0.02519, 0.02677, -0.14721, -0.25144, -0.01108, 0.18899, 0.11105, -0.02777, -0.19458, -0.21445, -0.16806, 0.05781, 0.04661, -0.10164, -0.03856, -0.0701, -0.2261, -0.23926, -0.02301, -0.16538, -0.10449, -0.01498, 0.06976, -0.02713, -0.04629, -0.04242, -0.07574, 0.14082, -0.20936, -0.02425, -0.09038, -0.05624, 0.20736, 0.11151, 0.24388, -0.02404, 0.04048, -0.19178, -0.3034, 0.06042, 0.25488, 0.16002, 0.13126, 0.00542, 0.08157, -0.00195, 0.11819, -0.25846, -0.34885, -0.06461, -0.00344, 0.30667, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[-0.12255, -0.1387, 0.42668, -0.25609, -0.33589, 0.07836, 0.24253, 0.04669, -0.16115, -0.21924, 0.1892, 0.28849, 0.0456, -0.39061, -0.11573, 0.17148, 0.05151, 0.22275, 0.21671, -0.24983, -0.49809, 0.19103, 0.15744, -0.08543, -0.0376, 0.27587, 0.12167, -0.19788, -0.00534, 0.39222, 0.17387, -0.07208, 0.00568, 0.12511, 0.14735, -0.09565, -0.02548, 0.00983, 0.17388, -0.06781, -0.16633, -0.12749, 0.08004, 0.07679, 0.22391, 0.08, -0.0624, -0.23287, -0.24629, -0.17063, 0.08772, 0.12423, -0.15925, -0.15709, -0.06393, -0.04211, -0.01076, 0.06715, 0.20701, 0.14907, -0.24794, -0.14445, -0.11524, 0.09573, 0.01792, 0.0821, 0.00962, 0.27422, 0.17681, 0.03985, 0.07797, -0.15071, -0.05448, 0.17904, 0.03055, 0.04965, 0.05256, 0.3595, 0.25643, 0.02864, 0.03151, 0.05215, -0.05906, 0.02118, 0.04984, 0.0598, -0.0999, -0.05416, 0.01497, 0.08952, 0.09672, -0.08595, 0.04635, -0.06126, 0.14543, 0.17705, 0.06905, 0.21388, -0.18108, 0.10713, -0.01346, 0.0913, 0.10635, -0.01754, 0.12418, 0.06183, 0.12782, 0.27458, 0.05759, 0.19948, 0.02925, 0.03633, -0.12126, 0.10792, -0.11152, -0.21331, 0.06463, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.38534, -0.42526, -0.35708, 0.12195, 0.41956, -0.03275, -0.25482, -0.09776, 0.06838, 0.24614, -0.13636, -0.36835, -0.16714, 0.28987, 0.09639, -0.02505, -0.11074, -0.1916, -0.18224, 0.05509, 0.52027, 0.08927, -0.1498, -0.12362, 0.10773, -0.01611, -0.22849, -0.0007, 0.19034, -0.17661, -0.13149, 0.0178, -0.01256, -0.12111, -0.05631, 0.09205, 0.10071, -0.09629, -0.34042, -0.09567, 0.1931, 0.0933, -0.15155, -0.06316, -0.13369, -0.34957, -0.13654, -0.01837, 0.14166, 0.28995, -0.04445, 0.00344, 0.06838, 0.04136, 0.04833, 0.10846, -0.06914, 0.05103, -0.18693, -0.29006, 0.00812, 0.12676, 0.11537, -0.0735, -0.13214, 0.13127, 0.04785, -0.10702, -0.23399, 0.01611, -0.07206, 0.02242, -0.07425, 0.06385, -0.13894, 0.03879, -0.08918, -0.15574, -0.08655, 0.0249, 0.15941, 0.10689, -0.0939, -0.16729, -0.29161, -0.09414, 0.0736, 0.14978, 0.01594, -0.0469, -0.13821, -0.013, 0.01525, -0.08837, 0.13101, 0.12234, -0.06402, -0.03142, 0.32843, -0.09557, 0.05842, -0.08862, -0.08796, 0.04156, 0.14086, 0.07485, 0.15386, -0.03519, 0.13828, 0.14118, -0.02122, 0.17455, -0.03408, -0.18444, 0.1272, -0.03849, 0.04786, -0.04061, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[-0.30577, -0.0905, 0.35558, -0.13136, -0.41154, -0.02994, 0.32314, 0.01745, -0.03229, -0.09515, 0.07825, 0.24929, 0.0299, -0.28128, -0.16231, 0.02607, 0.08872, 0.19749, 0.259, -0.0036, -0.43292, -0.25816, 0.15254, 0.20865, -0.10907, -0.10348, 0.12953, 0.00105, -0.24324, 0.10682, 0.23839, 0.1051, -0.07216, 0.05359, -0.04853, 0.01046, -0.04962, 0.16634, 0.2147, 0.00933, -0.12075, 0.02219, 0.15724, 0.13609, 0.12862, 0.19604, 0.21307, -0.01385, -0.25611, -0.29093, -0.13713, -0.02392, -0.05607, -0.07969, -0.08373, -0.05021, -0.158, -0.07839, -0.02556, 0.27209, -0.00108, -0.12668, -0.08673, -0.05807, 0.06527, -0.01381, -0.07323, -0.01515, 0.26516, 0.17788, 0.20516, 0.09526, 0.15321, -0.09008, 0.07925, -0.05447, 0.04903, 0.17326, 0.23166, 0.1912, 0.06905, -0.07521, -0.06825, -0.03459, 0.13028, 0.19652, -0.21031, -0.11407, 0.10785, 0.08269, 0.03197, -0.07266, -0.24803, 0.06944, -0.0503, 0.0355, 0.10827, 0.18622, 0.19951, 0.09409, -0.16196, -0.06879, -0.00966, -0.1092, -0.01044, 0.12531, 0.09838, 0.17464, -0.04489, 0.04981, 0.14998, 0.01367, -0.02754, -0.13944, -0.10862, 0.05625, 0.01821, -0.06721, -0.16257, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.4434, -0.23889, -0.42518, -0.06963, 0.43429, 0.02112, -0.20707, -0.07165, 0.06933, 0.11495, 0.06293, -0.10066, -0.10303, 0.17107, 0.05445, 0.06285, -0.02732, -0.13471, -0.20418, -0.0582, 0.16933, 0.22012, -0.0965, -0.02112, -0.08227, 0.02926, 0.0003, 0.0588, 0.11442, -0.09265, -0.07394, -0.08636, 0.10157, -0.00533, 0.05559, 0.01794, 0.0127, -0.00364, -0.08983, -0.02305, 0.04499, -0.01665, -0.05456, -0.20011, -0.07456, -0.13789, -0.30292, -0.14956, 0.18679, 0.19127, 0.22963, -0.00169, 0.08562, 0.19727, 0.03182, 0.01933, 0.04124, -0.08579, -0.08747, -0.19301, -0.23521, 0.11028, 0.11465, 0.06631, -0.21803, -0.16188, -0.03847, 0.19524, -0.15817, -0.08856, -0.07339, -0.12943, -0.27076, -0.09095, -0.19104, 0.15668, 0.25253, -0.00323, -0.16367, -0.0566, -0.06124, 0.14476, 0.00889, -0.01988, -0.20329, -0.2404, -0.06637, 0.04045, 0.05722, 0.08349, 0.07469, -0.06318, 0.06163, -0.13625, -0.08056, 0.03873, 0.15772, -0.00167, 0.03741, 0.11369, 0.16996, 0.0544, -0.22323, 0.04005, 0.06839, 0.03101, 0.07591, -0.13956, -0.02184, 0.08056, 0.01945, 0.10816, 0.00869, -0.00069, -0.18104, 0.05697, 0.06548, 0.18478, 0.08697, -0.00224, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[-0.34367, -0.21692, 0.41061, 0.01091, -0.41282, -0.21717, 0.20053, 0.12425, -0.13078, -0.03869, 0.04085, 0.26388, 0.18692, -0.23477, -0.1859, -0.08401, 0.00327, 0.09183, 0.20968, 0.14619, -0.08355, -0.19808, -0.08313, 0.10658, 0.14119, -0.01077, -0.08736, -0.07514, 0.04013, -0.03391, 0.06299, 0.06771, -0.0164, 0.0555, 0.02092, -0.09915, -0.16462, -0.15482, 0.1619, 0.07357, -0.12532, -0.0479, 0.12597, 0.252, 0.12008, 0.06829, 0.24173, 0.13962, -0.09261, -0.20721, -0.22436, -0.08037, -0.08425, -0.12495, -0.11328, 0.04444, 0.11427, 0.06914, 0.00947, 0.10877, 0.22509, 0.01759, -0.10762, 0.11067, 0.1002, 0.09057, 0.05928, -0.13862, -0.02847, 0.12053, 0.0319, -0.01396, -0.06251, 0.15518, 0.04151, -0.06827, -0.3447, -0.05653, 0.0903, 0.11039, 0.2494, 0.10173, 0.12524, 0.11427, -0.00591, 0.00484, -0.09281, -0.20239, -0.36484, 0.03657, 0.04659, 0.13486, -0.10281, -0.07263, -0.01622, -0.07529, -0.00157, 0.06444, 0.04521, 0.1518, 0.09262, -0.05389, -0.03134, -0.14522, 0.0714, -0.13968, -0.04604, 0.10385, 0.23684, 0.0228, -0.17108, -0.02582, 0.1201, -0.2502, 0.04153, -0.03085, 0.04086, 0.1942, 0.10558, 0.22579, 0.03473, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.36835, -0.06923, -0.3936, -0.24191, 0.40853, 0.15658, -0.26426, -0.10093, 0.12266, 0.03975, 0.03374, -0.19117, -0.23911, 0.03123, 0.24685, 0.08987, 0.05459, 0.01593, -0.19949, -0.25644, 0.01858, 0.1666, 0.02608, -0.04045, -0.0713, -0.05406, -0.04044, 0.13424, 0.05168, 0.02731, -0.0516, -0.01072, -0.09469, -0.08453, -0.01253, 0.12963, 0.10264, 0.11817, -0.02402, -0.07283, 0.08926, 0.06861, -0.17107, -0.20681, -0.12065, 0.10353, -0.16226, -0.29448, -0.09648, 0.14336, 0.20343, 0.201, 0.03989, 0.14159, 0.13294, 0.10772, -0.03567, -0.0419, -0.03404, -0.09948, -0.27958, -0.13088, -0.06783, 0.02281, 0.04239, -0.0916, -0.12259, -0.05132, -0.06495, -0.07946, -0.06717, 0.02322, 0.09601, -0.09291, -0.05314, -0.1557, 0.03922, 0.211, -0.09242, -0.22767, -0.12995, 0.02337, 0.0786, -0.10417, -0.10285, -0.02126, -0.02094, -0.0578, 0.02359, 0.06495, -0.04231, 0.02283, 0.08835, 0.20032, 0.11483, 0.05188, -0.07833, 0.11727, 0.072, -0.05654, 0.08375, -0.04791, 0.0118, 0.04098, 0.02405, 0.22237, 0.08381, -0.12105, -0.03795, 0.03984, 0.13, 0.12953, -0.08908, -0.02732, -0.03052, -0.12805, -0.1408, 0.1374, 0.09678, -0.08922, 0.1293, -0.01842, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[-0.28392, -0.40448, 0.39145, 0.15842, -0.293, -0.29314, 0.16358, 0.08327, -0.15076, -0.11458, -0.08195, 0.20138, 0.18903, 0.08358, -0.14013, -0.00656, -0.15755, 0.0273, 0.20849, 0.21381, 0.02196, -0.14908, -0.12785, -0.07943, 0.10085, 0.0647, 0.07982, -0.21238, -0.13012, 0.15064, 0.09127, 0.02613, 0.04283, 0.16851, 0.11368, -0.09954, -0.07614, -0.14485, -0.05387, 0.10967, 0.00422, -0.10889, 0.06895, 0.12121, 0.11097, -0.14741, 0.05509, 0.26231, 0.14499, -0.11666, -0.09646, -0.1722, -0.02951, -0.05164, -0.13067, -0.12492, -0.02928, 0.11942, -0.00397, 0.07063, 0.19097, 0.26582, 0.05726, -0.06205, -0.0022, 0.08213, 0.06454, 0.13876, 0.03715, 0.08801, 0.04129, -0.02736, -0.17041, -0.09567, -0.10348, 0.021, 0.01577, -0.13783, -0.05068, 0.00188, 0.01026, 0.09644, -0.04926, 0.09242, 0.00429, 0.09939, 0.01919, -0.1522, -0.06546, -0.1971, -0.10585, -0.00875, -0.06703, -0.20959, -0.12775, -0.09434, -0.00785, -0.05481, -0.16655, 0.00802, 0.05648, 0.18968, -0.00082, -0.03605, -0.14129, -0.17238, -0.00315, -0.09285, -0.03549, 0.04905, -0.03645, -0.07421, 0.00206, 0.04205, -0.05175, -0.00409, 0.04009, -0.07742, -0.03951, 0.23593, 0.00709, -0.05324, 0.1731, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.26055, 0.16911, -0.23368, -0.38002, 0.24327, 0.25858, -0.14334, -0.21831, 0.1821, 0.16971, 0.04521, 0.02748, -0.12517, -0.16421, -0.02501, 0.01765, 0.08194, 0.07854, 0.02861, -0.14087, -0.1061, 0.04156, 0.15537, 0.1395, -0.06909, -0.08392, -0.08783, 0.12104, 0.0482, -0.05013, -0.07657, -0.03707, 0.07144, -0.12221, -0.10668, 0.06809, 0.0904, 0.06969, 0.031, -0.06739, -0.01109, 0.105, 0.05331, -0.05914, -0.08723, 0.05936, 0.03872, -0.25889, -0.24157, -0.1191, -0.01722, 0.09599, 0.05428, 0.09607, 0.09737, 0.12879, 0.04353, -0.09351, -0.08798, -0.04823, -0.16165, -0.25665, -0.04965, 0.05179, -0.02991, 0.07202, 0.01385, -0.04071, 0.04957, -0.01411, -0.08804, -0.07803, -0.10236, 0.10258, -0.01194, 0.07694, -0.16119, 0.04871, 0.13166, -0.01633, -0.13489, -0.0253, 0.00712, 0.1912, -0.02696, -0.12493, -0.14513, 0.01169, -0.08591, 0.05772, -0.05311, -0.01023, 0.14054, 0.10332, 0.08034, 0.13823, -0.03616, -0.06451, 0.07971, -0.02568, 0.09477, 0.05449, 0.12421, 0.13099, 0.1823, 0.1538, 0.1331, 0.11758, 0.03352, 0.06096, 0.03951, 0.04257, 0.08476, 0.10407, 0.0128, -0.07157, -0.00837, 0.05136, 0.04329, 0.02734, -0.00972, 0.10168, 0.00018, -0.01746, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[-0.15306, -0.50357, 0.18719, 0.34108, -0.27509, -0.3059, 0.09991, 0.21184, -0.07665, -0.14112, 0.00104, -0.03459, 0.05973, -0.00381, 0.08805, 0.09356, -0.13401, -0.21427, -0.04777, 0.13471, 0.19852, 0.0786, -0.16137, -0.13892, -0.06479, 0.14503, 0.17245, -0.00916, -0.16868, -0.03055, 0.13194, -0.03792, -0.12843, -0.01159, 0.06293, 0.06622, -0.03501, 0.00297, -0.019, -0.01108, 0.05629, -0.04362, -0.1555, 0.01116, 0.06812, -0.0801, -0.14149, 0.07892, 0.20336, 0.03607, -0.14575, -0.05831, -0.08743, -0.17587, -0.11794, -0.16249, -0.06427, -0.03585, 0.08687, 0.06668, 0.03544, 0.09333, 0.07132, 0.13047, 0.03428, -0.0621, -0.06332, 0.03826, 0.00109, 0.06071, 0.14776, 0.10844, 0.0252, -0.10851, -0.04371, -0.07646, 0.09102, 0.03375, -0.06641, 0.0153, 0.081, -0.04466, -0.01276, 0.0057, -0.05722, 0.10361, 0.15708, 0.07801, -0.0572, 0.02898, -0.03914, -0.01296, -0.20531, 0.04689, -0.071, 0.01869, 0.01697, 0.03857, -0.1249, -0.09533, -0.17895, -0.0685, -0.04099, 0.0055, 0.05137, -0.09605, 0.08121, 0.0076, 0.00677, 0.03541, -0.03683, -0.00622, -0.14234, 0.01241, 0.15407, 0.06493, 0.06101, -0.08784, -0.00474, -0.04589, 0.01768, 0.07359, -0.08465, -0.00895, 0.03847, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.156, 0.10309, 0.01874, -0.39824, 0.1219, 0.20857, -0.04092, -0.26458, -0.072, 0.20648, 0.05912, 0.00426, -0.01971, 0.01971, -0.03313, -0.09689, 0.04997, 0.17869, 0.07343, -0.06437, -0.13653, -0.15223, -0.02101, 0.12542, 0.09979, -0.09063, -0.17597, -0.03566, 0.18899, 0.06552, -0.03081, -0.01885, 0.13792, 0.14612, -0.02571, -0.07585, 0.02933, 0.05582, 0.04662, 0.04213, -0.0512, 0.02023, 0.06104, 0.01621, 0.00682, 0.09589, 0.09325, -0.08817, -0.19947, -0.05184, -0.02864, -0.01007, 0.10496, 0.04031, 0.13133, 0.09908, 0.01599, -0.01347, -0.16435, -0.03294, 0.01018, -0.05077, -0.11164, -0.09068, -0.07188, 0.04017, 0.11207, 0.05226, -0.00073, 0.0036, -0.06668, -0.00374, -0.04452, 0.01273, -0.06533, 0.12584, -0.00547, -0.01066, -0.0788, -0.01922, -0.03393, -0.01971, 0.06738, -0.0097, -0.0173, 0.0004, -0.09421, -0.07103, -0.04451, -0.09511, 0.05527, 0.02378, -0.01794, 0.05907, 0.05636, 0.06043, 0.03328, -0.10814, -0.04512, 0.00629, -0.12792, 0.01479, 0.03129, 0.11955, 0.01856, 0.08993, -0.05139, 0.00495, 0.15192, -0.04138, 0.13041, 0.03743, -0.12672, 0.07069, -0.0493, 0.13634, 0.00946, 0.12648, -0.01759, 0.03474, 0.04715, 0.02048, -0.04358, -0.09369, 0.14035, -0.01294, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.01367, -0.43926, -0.10126, 0.36208, 0.02793, -0.36912, -0.01536, 0.23942, 0.03981, -0.13628, -0.01812, 0.11353, 0.03359, -0.02639, -0.02364, 0.13133, 0.07177, -0.13175, -0.09072, 0.02276, 0.04409, 0.12048, 0.15844, 0.00376, -0.13162, -0.10531, 0.13073, 0.06577, -0.15609, -0.02777, 0.06273, 0.12956, -0.12354, -0.11506, -0.02583, -0.04912, -0.09457, -0.09929, -0.00106, -0.05776, -0.12254, 0.04546, -0.00526, -0.0704, 0.02498, -0.01497, -0.05093, -0.0094, 0.1129, 0.11184, -0.05593, -0.1876, -0.08163, -0.03659, -0.23083, -0.10694, -0.07161, -0.07606, -0.03808, 0.00255, 0.02686, -0.00915, -0.01038, 0.01926, 0.08804, -0.02759, -0.14621, -0.09638, 0.0198, 0.00403, 0.12246, 0.03957, 0.00889, -0.02221, -0.10204, -0.11708, 0.01532, 0.11708, 0.17707, 0.09522, -0.02121, 0.06892, -0.10753, 0.03742, -0.04168, 0.07062, 0.03569, 0.10429, 0.02787, 0.00515, 0.13961, 0.09317, -0.09833, -0.15305, 0.11121, 0.08891, 0.02028, 0.05198, -0.07369, -0.0166, -0.07727, -0.06706, 0.09492, -0.06381, 0.01913, 0.14062, 0.01447, 0.01732, -0.04178, 0.17051, 0.00963, 0.01516, 0.07031, -0.12055, 0.03268, -0.03558, 0.06453, -0.03577, -0.0044, 0.02269, -0.09566, 0.10996, 0.02347, -0.04844, -0.01911, -0.03032, 0.06717, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[-0.04452, 0.1115, 0.10063, -0.30933, -0.01046, 0.24107, 0.05287, -0.15796, -0.0622, 0.07093, 0.11777, -0.06729, -0.02076, 0.00166, 0.04634, -0.14898, -0.08195, 0.18185, 0.11514, 0.04617, -0.02012, -0.03442, -0.25958, -0.1174, 0.05052, 0.09417, -0.05468, -0.02558, 0.07996, 0.05448, -0.04233, -0.11986, 0.04295, 0.10391, 0.03853, 0.08503, 0.09667, 0.05049, 0.02787, 0.06239, 0.13564, -0.05222, -0.04174, -0.02763, -0.03288, 0.05127, 0.13189, 0.0173, -0.09581, -0.09378, 0.02099, 0.13587, 0.10608, 0.08973, 0.16691, 0.14116, 0.14926, 0.10003, 0.04757, -0.14186, 0.01619, 0.11307, 0.04695, 0.04939, -0.10818, 0.01223, 0.04859, 0.14757, 0.08182, -0.02352, -0.13477, -0.11577, -0.04898, -0.03886, 0.02899, 0.06786, -0.0239, 0.04658, 0.02574, -0.102, -0.03923, -0.02596, 0.08804, -0.04347, -0.02477, -0.02837, -0.05894, 0.12125, 0.00711, 0.05256, -0.11279, 0.01646, -0.1203, 0.01667, -0.17664, -0.01619, -0.04937, 0.12165, 0.06248, -0.03181, 0.09565, 0.06571, -0.06801, 0.0516, 0.07627, -0.04548, -0.11454, -0.15526, -0.00482, -0.12823, 0.02855, 0.0277, 0.00761, -0.03844, -0.11393, -0.06682, 0.09516, 0.052, 0.08727, 0.02665, -0.01876, -0.03684, -0.03965, -0.00976, 0.00072, -0.12008, 0.10322, -0.04252, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.10575, -0.3111, -0.09468, 0.0998, 0.08265, -0.26972, -0.09529, 0.16996, 0.11943, -0.04461, -0.09162, 0.09596, 0.01904, -0.02035, -0.02854, 0.09924, 0.03474, -0.07515, -0.11009, -0.0157, 0.09364, 0.0156, 0.19995, 0.13598, 0.05921, -0.06854, -0.03998, -0.01186, -0.07684, -0.12406, 0.13635, 0.24816, 0.10409, -0.14609, -0.08866, -0.0358, -0.11244, -0.08416, -0.06099, 0.00894, -0.18532, -0.11157, 0.05719, 0.07415, -0.03713, -0.03935, -0.09734, -0.00279, 0.06025, 0.12965, 0.04837, -0.08016, -0.09956, -0.03776, -0.10322, -0.22326, -0.12849, -0.1009, -0.01982, 0.02773, -0.03256, -0.03339, -0.04064, -0.03724, 0.00866, -0.00637, -0.0983, -0.15728, -0.11176, 0.02387, 0.00569, 0.03554, 0.02911, 0.02756, -0.05108, -0.09342, -0.12215, -0.08658, -0.00098, 0.16214, 0.10946, 0.04759, 0.01516, 0.02555, 0.03963, -0.03027, -0.03969, -0.07849, 0.02848, -0.045, -0.00917, 0.1611, 0.08619, 0.00603, 0.02568, 0.05618, 0.17954, 0.02442, -0.18388, -0.07379, -0.20299, -0.05513, 0.05497, 0.03547, -0.08554, -0.08264, -0.01019, 0.02495, 0.01091, -0.05478, 0.0027, 0.10098, -0.02407, 0.10458, -0.03118, -0.00155, -0.0082, -0.08895, -0.05586, -0.01041, 0.01434, 0.00282, 0.03326, 0.07062, 0.0663, -0.03089, -0.07532, 0.00301, -0.08352, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[-0.06927, -0.05576, 0.13307, -0.27097, -0.11108, 0.13841, 0.09571, -0.17992, -0.0789, 0.01477, 0.12093, -0.028, 0.03535, 0.0245, 0.07032, -0.05279, -0.16334, 0.11639, 0.13607, 0.02497, -0.03301, 0.06381, -0.06958, -0.12316, -0.05407, -0.01396, -0.06597, 0.05218, 0.07872, 0.13878, -0.08748, -0.22077, -0.16334, 0.1624, 0.09462, 0.01017, 0.09738, 0.10026, 0.05798, -0.02568, 0.09894, 0.11393, -0.05913, -0.11704, -0.03291, 0.02476, 0.05318, 0.00611, -0.07325, -0.14964, -0.11568, -0.01294, 0.06586, 0.11115, 0.14033, 0.204, 0.15288, 0.1529, 0.09152, 0.0472, -0.02614, 0.01185, 0.05957, 0.09552, 0.0848, 0.00624, -0.03901, 0.01341, 0.07604, 0.07784, -0.01849, -0.07888, -0.09321, -0.03562, 0.02264, 0.10264, 0.06137, 0.0121, -0.01667, -0.01444, -0.07423, -0.04467, -0.02719, 0.01564, -0.15508, -0.00445, -0.13379, 0.11276, 0.06139, -0.0286, 0.03519, -0.00546, 0.07699, 0.01726, -0.13572, -0.03661, 0.01205, -0.0721, 0.00851, 0.03938, 0.09803, 0.03925, -0.05561, -0.03184, 0.0771, 0.17432, -0.04503, -0.0489, -0.10144, -0.06392, -0.05278, -0.09175, -0.00765, 0.04984, 0.073, 0.03661, -0.05411, 0.0013, 0.10538, -0.04783, -0.04385, 0.01681, 0.07674, -0.05274, -0.1365, 0.02843, 0.06511, -0.07712, -0.1129, 0.01302, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.12632, -0.24397, -0.09868, 0.19261, 0.15406, -0.22965, -0.09002, 0.1702, 0.06075, 0.00203, -0.10703, 0.0466, 0.08702, -0.07998, -0.07045, 0.084, 0.08328, -0.05554, -0.12341, -0.03407, -0.01705, -0.0852, -0.0504, 0.15971, 0.10463, 0.06095, 0.05876, -0.02832, -0.0717, -0.12336, 0.03232, 0.21838, 0.2891, -0.01052, -0.15219, -0.05939, -0.0535, -0.11582, -0.04418, -0.00662, -0.10942, -0.14831, -0.06602, 0.02493, 0.02939, -0.0241, 0.0056, 0.0082, 0.11177, 0.12032, 0.10512, 0.12401, 0.01811, -0.14766, -0.12861, -0.13694, -0.16734, -0.16045, -0.0553, -0.03308, 0.11283, -0.00283, -0.04241, -0.06847, -0.08234, -0.09398, -0.02833, -0.09695, -0.10813, -0.13256, -0.05956, -0.04751, 0.05179, 0.05411, 0.01749, -0.045, -0.08037, 0.01982, -0.03901, -0.05922, 0.0942, 0.10691, 0.03659, -0.06049, 0.14614, 0.10853, -0.01885, -0.09043, -0.09965, 0.01176, -0.10234, -0.0271, -0.07143, 0.05966, 0.08228, 0.09831, -0.01349, 0.14225, 0.01856, -0.03417, -0.11256, -0.14124, 0.03293, 0.05397, 0.01853, -0.12502, 0.00942, -0.10199, -0.09442, 0.09663, 0.03396, 0.00738, 0.04815, -0.09346, 0.00848, 0.06578, 0.06492, -0.10839, -0.09815, 0.06563, 0.00781, 0.0799, -0.09468, -0.02936, 0.10633, 0.00125, -0.04079, 0.00423, -0.08157, -0.10868, 0.00465, 0.0, 0.0, 0.0, 0.0, ],
[-0.05228, -0.07351, 0.23729, -0.17125, -0.20272, 0.12357, 0.08332, -0.19332, -0.07326, 0.05945, 0.04664, -0.0512, -0.09061, 0.11538, 0.08474, -0.07153, -0.07137, 0.03447, 0.15939, 0.0761, 0.07512, 0.10862, 0.04001, -0.13201, -0.10793, 0.01524, -0.08567, -0.08039, 0.04798, 0.14626, 0.11253, -0.10979, -0.28047, -0.06358, 0.14617, 0.06882, -0.00378, 0.08387, 0.0857, -0.01522, 0.04143, 0.15274, 0.05889, -0.03305, -0.01875, 0.01338, -0.04143, -0.01323, -0.05196, -0.10815, -0.13244, -0.13408, -0.05858, 0.05747, 0.15438, 0.14888, 0.0934, 0.05773, 0.05332, 0.00055, -0.06566, -0.02312, 0.076, 0.10027, 0.0898, 0.07998, -0.02113, 0.07824, -0.03961, 0.07673, 0.03225, -0.05763, -0.02691, -0.16877, -0.02407, 0.05549, 0.09714, 0.11304, -0.00037, -0.03388, -0.0443, -0.05148, -0.00728, 0.03626, -0.02037, -0.03671, -0.03622, -0.00771, 0.15239, 0.11762, 0.01917, -0.04232, 0.03264, 0.11026, -0.11476, -0.08142, -0.03293, 0.00877, -0.06568, -0.03508, -0.03246, 0.25564, 0.0417, 0.02318, -0.10316, -0.06216, -0.03175, 0.01986, 0.04951, -0.10076, -0.03497, -0.11391, -0.05418, -0.01088, 0.00956, 0.05657, -0.09428, -0.01184, 0.06786, -0.11017, -0.03001, -0.07689, -0.0964, 0.08381, 0.0367, 0.02616, 0.00107, -0.00704, 0.0372, 0.00662, -0.06835, -0.07697, 0.0, 0.0, 0.0, ],
[0.10426, -0.17182, -0.21184, 0.04723, 0.18394, -0.17424, -0.09764, 0.19836, 0.11709, -0.06422, 0.00964, 0.0561, 0.08546, -0.08054, -0.10396, 0.0933, 0.10285, -0.01235, -0.16531, -0.11003, 0.02194, -0.0176, -0.11325, 0.07494, 0.05284, -0.0558, 0.05948, 0.1105, -0.08112, -0.12073, -0.10691, 0.02612, 0.21187, 0.18206, -0.06427, -0.1157, 0.00966, -0.05428, 0.0065, 0.02493, -0.08564, -0.1823, -0.07998, 0.02814, 0.01588, 0.03643, -0.00158, 0.07527, 0.08994, 0.11246, 0.00442, 0.06504, 0.11086, 0.0555, -0.12689, -0.15245, -0.12723, -0.04478, -0.10085, -0.03553, 0.02846, 0.01196, -0.09018, -0.03339, -0.02202, -0.06148, -0.05133, -0.01153, 0.01669, 0.04579, 0.00669, 0.05066, -0.0801, 0.04825, 0.07546, 0.00675, -0.06372, -0.1528, 0.01855, 0.02025, 0.01114, -0.01231, 0.0312, -0.03959, -0.07005, -0.02412, -0.03449, 0.00949, -0.15365, -0.07326, -0.07862, -0.03049, 0.04974, -0.07011, 0.04974, 0.10397, 0.08133, -0.03293, 0.07934, -0.02339, -0.08432, -0.13725, -0.02525, -0.06452, 0.00525, 0.02548, -0.05476, 0.00885, -0.08709, -0.01463, -0.03021, 0.08444, -0.01102, 0.00918, -0.05136, 0.02036, 0.04066, 0.02269, 0.03928, 0.01964, 0.04696, 0.03898, 0.12664, -0.05185, -0.08661, 0.09677, 0.15333, -0.07079, -0.09153, -0.04102, 0.11745, 0.04627, 0.08674, 0.0, 0.0, ],
[0.04529, -0.13648, 0.12971, -0.02562, -0.14631, -0.00706, 0.1896, -0.16723, -0.23593, 0.02651, 0.06291, -0.02605, -0.09287, -0.00236, 0.13601, -0.00297, -0.12909, 0.03632, 0.09849, 0.08727, -0.00128, 0.05796, 0.09146, 0.0141, -0.05084, -0.03194, -0.03044, -0.03242, -0.00292, 0.07354, 0.12778, 0.05264, -0.1116, -0.20557, -0.02037, 0.10735, -0.02524, -0.03597, 0.03331, 0.00787, 0.0818, 0.12618, 0.10153, -0.06345, -0.03388, -0.04854, 0.00064, -0.10584, -0.05626, -0.10286, 0.04117, -0.03638, -0.07434, -0.04887, 0.04191, 0.1793, 0.20527, 0.10694, 0.06714, -0.01917, 0.02468, -0.10665, 0.01951, 0.01847, 0.07359, 0.05844, -0.01407, -0.10979, -0.08425, -0.09073, -0.03391, -0.05941, -0.01956, -0.00156, -0.11683, -0.05956, -0.02695, 0.15149, 0.09435, 0.0238, -0.1043, -0.12316, -0.1008, 0.03127, 0.12469, 0.10525, 0.09001, -0.00312, 0.03726, 0.15461, 0.16625, -0.09009, -0.18048, 0.06644, 0.05328, 0.06618, -0.03297, 0.14023, 0.07732, 0.04191, -0.17787, -0.01733, 0.03688, 0.0172, 0.04947, -0.03508, 0.11446, -0.04872, 0.0804, 0.00587, 0.04258, -0.05605, -0.09242, -0.08885, 0.00073, -0.03073, -0.01057, -0.0077, -0.03311, -0.0388, -0.02544, -0.08164, -0.13855, -0.00979, 0.12694, 0.0342, -0.02756, 0.0275, 0.0242, -0.0631, -0.03272, 0.15233, 0.0617, -0.02979, 0.0, ],
[0.0497, -0.11303, -0.09292, -0.01966, 0.15283, -0.1182, -0.26888, 0.14893, 0.2758, 0.0108, -0.08438, 0.08008, 0.12915, 0.02481, -0.09682, -0.05029, 0.11071, 0.09875, -0.06561, -0.12511, -0.01674, -0.01587, -0.11356, -0.01793, 0.15705, 0.01193, -0.02468, 0.04517, 0.00498, -0.08222, -0.0679, -0.05695, 0.02959, 0.16205, 0.03352, -0.08549, -0.06409, -0.00171, 0.0018, -0.00755, -0.06228, -0.09113, -0.15927, 0.03638, 0.02966, 0.04956, 0.05256, 0.10891, 0.12777, 0.12821, 0.01408, 0.02186, 0.06581, 0.13148, 0.0515, -0.07818, -0.22865, -0.07732, -0.04813, -0.02285, 0.03226, 0.11893, 0.04177, -0.02578, -0.04418, -0.00125, -0.04749, -0.04969, 0.08116, 0.10827, 0.12199, 0.01537, 0.03705, -0.05743, 0.06258, 0.00404, 0.06421, -0.08178, -0.06416, -0.08111, 0.00308, 0.06614, -0.01937, -0.03507, -0.10466, -0.09155, -0.00139, 0.01085, -0.04787, -0.00398, -0.03012, -0.00419, 0.01081, -0.03847, -0.02241, -0.05968, -0.01402, -0.06963, -0.0124, 0.00939, 0.07449, -0.00325, -0.05675, 0.08256, -0.0958, 0.02415, -0.12748, -0.06391, 0.02476, 0.10952, 0.0182, 0.00419, 0.12092, -0.03844, -0.02667, 0.03557, 0.0164, -0.00768, 0.05355, -0.02118, -0.01642, 0.06634, 0.15504, 0.10363, 0.09658, -0.06376, 0.07863, 0.06652, -0.01278, -0.02272, 0.13331, -0.00481, -0.05682, 0.09322, -0.04824, ],
])
hlm = np.array([[0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -0.26751, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, 0.06849, 1.13444, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, 0.29819, -0.92189, -0.38288, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -1.46565, -0.93302, 0.27265, 0.58741, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, 1.81621, 0.98584, -1.21071, -1.14333, -1.04763, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -0.75425, 0.0469, 0.03553, 0.74994, 1.30901, 0.22895, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -0.52618, 0.50458, 0.68283, -0.27157, 0.21041, -0.26751, -0.64529, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -0.33244, -1.95798, -1.08109, -0.77559, -0.38829, 1.96278, 1.11803, -0.3063, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, 0.89431, 1.76589, 0.85997, 0.24306, -0.15646, -0.33576, -0.85287, 0.27315, -1.01895, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -0.31029, -0.73417, -1.2369, 0.09755, -0.50794, -1.63209, 0.3747, 0.70937, 0.58931, 0.52507, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -0.53477, -0.35601, 0.55873, 0.43063, 0.85486, 1.47499, 0.56782, -0.44179, -0.03158, -1.81279, -1.37782, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, 0.23557, -0.83592, -0.41658, -0.8517, -0.91991, -0.425, -0.85838, -0.56984, -0.27286, 1.99416, 1.38788, 1.28311, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -0.15588, 1.77768, 0.50836, -0.49469, -0.6896, -0.01688, 0.73137, 0.17068, 1.10211, 0.15976, -1.73104, -1.99021, -1.22464, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, 0.40826, -0.45007, -1.24474, 1.35795, 1.21777, -0.28328, -0.57022, 0.13056, -0.08518, 0.40319, 2.65662, 0.64462, 0.38135, 0.0898, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -2.04983, -1.56604, 1.50811, 0.42952, -0.511, -0.34707, 0.94847, 0.74842, -0.40437, 0.37039, 0.16613, 0.13419, -0.08171, -0.90474, 0.37628, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, 1.22943, 0.90371, -0.46603, -1.98953, 0.35366, 1.8549, -0.7502, -1.74265, -1.24532, -2.1772, -2.20103, 0.73652, 0.64268, -0.29219, -0.39227, -3.03862, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, 0.90625, -0.2539, -2.00113, 0.69108, -0.6465, -2.30834, -1.44269, 1.57971, 1.62367, 2.29636, 1.38431, -0.85401, -0.52481, 0.42198, -0.51105, 1.07061, 0.66099, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -2.69632, 0.56302, 1.31783, 1.27763, 0.19899, 0.64517, 2.83176, 0.64469, -0.27944, -1.51448, -0.93534, -0.96631, 0.94375, 0.92349, 0.86614, 0.26307, -1.00354, -1.59046, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -0.03168, -0.97017, 0.50432, -1.5699, 0.32715, 0.31219, -2.77396, -2.71694, -1.63518, 0.10002, 1.80337, 1.94097, -1.27255, 0.00818, -0.27803, -3.33581, -0.21342, 0.8603, 1.10469, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, 1.24131, -1.66171, -1.19422, -0.72486, -0.40969, 0.74074, 0.99135, 2.56694, 1.72126, 1.26462, -2.1316, -0.14306, 0.12879, -0.10731, 0.92467, 1.82213, 1.62132, 0.34748, 0.04464, 0.02804, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, 0.63418, 1.7318, -0.08734, 0.93187, -0.58163, -1.08368, 1.03106, -0.60776, -0.60669, -1.77523, -0.57611, -0.13056, 1.53906, 0.52043, 1.86411, 1.33946, -2.01164, -1.82303, -0.94138, 0.99176, 2.49249, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -1.30504, -0.93739, -0.70237, 0.1754, 1.0684, -0.54591, -0.76441, -0.03454, 1.40217, 2.45054, 2.67155, -0.85018, -1.77382, -0.364, -2.33537, -1.01589, 0.70301, 0.97946, 1.95997, -0.66098, -1.66637, -0.08704, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -0.57099, -1.05252, 1.33027, 0.68492, 0.63581, 1.53266, -0.27888, -0.19788, -1.5739, -0.42267, -1.75845, 1.4849, 0.50801, 0.14003, 0.52361, 0.68055, 1.8175, 0.46905, -1.40119, -1.2315, -0.15995, 2.52055, 1.01189, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, 1.96649, 0.64206, -2.61935, -2.78365, -1.60247, -0.63146, -0.27568, 0.28934, 1.37579, -1.07172, 0.34252, 0.5774, -0.60844, -0.80904, 0.55028, -1.66674, -2.11517, -1.21424, 0.41997, 1.96985, 0.10546, -3.06022, -1.43147, -0.02102, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -0.593, -0.2454, 0.01488, 0.03753, 0.48791, -0.07828, 1.69806, 0.86627, -0.40205, -0.10653, 0.85286, -1.15943, -0.09533, 0.55226, -0.46309, 2.34497, 1.6953, 1.27321, 0.43674, -2.87971, -1.00145, 1.36091, 1.33298, 0.60046, -1.72881, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -0.7678, 0.69589, 1.4635, 0.44326, 0.03052, -0.47353, -1.68272, -2.64202, -0.81964, 1.91878, -0.53748, 0.0317, 0.28241, -0.09505, -1.7166, -0.68068, -0.108, -0.97506, -1.16524, -0.79117, -0.0613, -0.05572, -0.79865, 0.17003, 0.74489, -1.46023, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, 1.19355, -1.69105, -0.79668, 0.18816, -0.71548, -0.84482, 0.17356, 2.12862, 1.25085, -1.29987, -1.55581, 0.45246, 0.62944, 0.38992, 0.76884, 0.15114, 0.89348, 0.47006, 2.78327, 2.40338, -2.39141, -2.39564, -0.92098, 1.75157, 0.73283, -0.75733, -2.00346, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -0.24408, 0.26119, -0.83226, -0.45025, -0.5907, 0.5923, 0.09286, -0.46995, -1.17865, 0.40559, 2.29807, -0.04261, -0.81046, -0.43021, 0.08375, -0.53242, -2.38692, -0.19068, -1.77889, -1.62148, 1.56428, 1.30671, 1.43435, -0.29212, -1.01269, 3.64538, 1.64799, -0.33737, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -0.11335, 3.14308, 0.25671, -0.29586, 1.17284, -0.41388, -0.56978, -0.40511, 1.6964, 1.66468, -0.67906, -1.20401, 0.66539, 1.45972, -0.24109, -0.13728, 0.86403, 0.86939, -0.90062, 0.82958, 2.34154, 0.27472, -1.1909, -0.06313, -0.76566, -0.74713, -0.18294, -1.69133, -0.1887, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, 0.0092, -1.94493, 0.41067, -0.06973, -0.68825, -0.76702, -0.57703, -0.75122, -1.52992, -1.58789, -0.31296, 1.8003, -0.35066, -1.98694, -1.24205, 1.1895, 1.06695, -1.60579, -0.10874, -0.37219, -0.57605, 1.37954, 3.33554, 1.85129, 2.07666, -0.70059, -0.52113, 1.74116, 0.99801, 0.77373, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -1.98435, -2.37284, 0.90217, -0.48042, -1.101, 0.43528, -0.39417, -0.38874, -0.04967, 0.41747, 0.50108, 0.75488, -0.12257, 0.23265, 1.50521, -0.28264, -0.56242, 0.99743, 0.73758, -0.77803, -1.10916, -2.21844, -1.39667, -1.42382, -0.2051, 1.58475, 0.85803, -1.84157, -2.66995, -1.3581, 1.25588, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, 1.7373, 2.98566, -2.51261, 0.13175, 1.14278, 0.34405, 0.98645, 0.61724, -0.10617, -0.8697, -0.35513, -0.43338, 0.96941, 0.46169, -1.02396, -1.26627, -1.07915, 0.10099, -1.2579, 0.78066, 0.30074, 1.56376, 1.10121, 1.39942, -0.67057, 0.97548, 0.07796, 1.03174, 1.56846, -0.41318, 0.74239, 1.39011, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, 0.94885, -0.72181, 0.56284, 1.23304, -1.08389, -2.35321, -0.41791, -0.66529, -0.18516, 0.56057, 0.06276, -1.46991, -1.48254, 0.39735, 0.61535, 0.51578, 0.49692, 0.19557, 0.19389, 1.60335, 0.92147, 1.09171, -0.03185, -1.37013, -1.61853, -1.6116, 2.5134, 1.40717, 0.022, -0.58766, -1.70274, -1.84973, 0.10865, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -2.98752, -0.13555, 2.17909, -3.04625, -0.77109, 1.76097, -0.74805, -0.65102, -0.06897, 0.60588, -0.64533, 0.92894, 1.50819, 0.77496, -0.32212, -0.85709, 1.12394, 0.55281, -0.37211, -2.30255, -0.79156, -1.44742, 0.09423, 0.93831, 0.43331, -0.93401, -1.83637, -0.26144, 0.81158, 0.28751, 0.83487, 0.72052, 0.15939, 1.19001, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, 1.03109, -1.36912, -2.03764, 2.58112, 2.5839, -0.56035, -1.19536, 1.52138, -0.68593, -1.66388, 0.59005, 1.32823, -0.62241, -2.04239, 0.08871, 0.9639, -1.01858, -0.70426, 0.32393, 0.10088, 0.40753, 1.06823, 0.80832, -0.69226, 0.5073, 1.91745, -0.1775, 0.73584, -0.36136, 0.5488, 0.85672, -0.51777, -0.08033, -2.78502, -0.70878, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, 1.54927, -0.79358, -0.02163, 0.73961, -2.57766, -0.14431, 2.5533, 0.18543, -0.32156, 0.92316, 0.82907, -2.71336, -1.57505, 0.95597, 1.21006, 0.10746, -0.59182, 1.30162, 0.27975, 1.25516, -0.57393, 0.28799, -0.83066, 0.07728, 0.38237, -0.55614, 1.06136, -1.40689, 0.5349, -1.72296, 0.28975, 0.72085, 0.6201, 1.31141, -1.33574, -1.0202, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -1.01907, 2.36656, -1.39142, -2.36935, 1.62344, 0.83167, -1.90233, -2.16405, 1.49041, -0.32918, -1.44547, 0.04367, 2.21337, 0.046, -1.67902, 0.00209, 1.82796, -0.89469, 0.33462, 0.89065, 0.25996, -0.28471, -0.35575, 0.4367, -0.94415, -1.84309, 2.25065, 1.56213, 1.25404, 1.09398, 1.01182, -1.1642, 0.42795, -1.01482, -0.35986, 0.91526, -1.58618, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -0.91109, 0.28003, 0.36903, 0.48066, -0.66096, -1.67108, 0.33344, 1.74182, -1.27071, -1.78811, 0.86074, 2.78961, -1.33042, -0.89516, -0.66137, 0.5415, -0.44994, 0.15618, 1.21924, -1.3416, -0.71614, 0.58293, 1.15363, -0.48852, -0.25793, 0.47867, -1.41361, 0.43884, -3.51809, -1.63422, -0.489, 1.11215, 0.43947, 0.82045, 0.65928, -2.58628, -0.5565, 0.06396, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, 0.66966, -2.13449, 1.44019, -0.03218, -0.01467, 2.30729, 1.1135, 0.06621, 0.00717, 2.51971, -0.36187, -1.42385, -0.65521, 0.68864, 0.8703, -2.2029, -1.09932, 0.29629, -2.64351, 0.57611, 1.5676, 0.6988, 0.18503, 1.58811, 0.92635, 1.11199, -0.70773, 1.23929, 1.94071, 0.2879, 0.7854, 0.17602, -0.22036, -2.02572, -0.58996, 1.46164, -0.76375, 1.46287, -0.71543, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, 0.27699, -0.27942, -0.75545, 0.26771, 0.03964, -2.06457, -0.44616, 0.15558, 1.39347, -1.18747, -1.78146, -1.70861, 0.42125, -1.50913, 0.85481, 0.28199, 0.75349, -0.42207, 1.0874, 2.3155, -0.05386, -2.11792, -1.82096, -1.24366, -1.11791, -2.22679, 0.50251, -1.55061, 0.18858, -3.01298, -2.49363, -1.1122, -0.50867, 0.97749, 0.01941, -0.13583, -0.40672, -1.84996, -0.7313, 0.35452, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, 0.031, 0.5257, -2.47009, 0.38085, 0.27837, -1.00287, 0.34938, 0.49389, -1.65516, -0.051, 2.80784, 1.34934, 0.39369, 1.39615, -0.14306, 0.79854, 0.4695, 0.60273, 0.21458, -3.12672, -0.09754, 2.19771, 1.48395, 0.65534, 0.78354, 0.22009, 1.43209, 1.18397, 0.95312, 1.09394, 0.08541, -0.15161, 1.20921, -0.52492, -1.00753, -0.27693, -0.14413, 1.23856, 1.19068, 0.55252, 0.70663, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -0.63288, -0.06541, 2.52486, -0.13932, -1.0927, 1.00265, -0.6241, 0.00385, 1.62446, 1.73225, -0.67636, 0.17454, -1.36676, -1.58636, -2.7647, -0.34061, -1.36852, -0.46521, -1.43282, 0.51081, 1.55013, 0.03916, -0.82199, -0.67343, -1.06936, 0.58946, -2.67664, -1.10685, -1.32651, 0.79482, 0.32693, -0.63047, -1.47808, -1.51981, -1.20397, -0.97881, 0.21804, -0.31628, -2.33732, 1.62977, 1.68447, -0.02952, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, 0.92462, 1.18409, -0.17249, -2.26806, 0.73959, 1.22277, -0.82716, -1.76505, 1.31882, -1.56328, -0.97622, -0.57212, 0.73051, 0.77167, 3.31132, 0.14199, 0.29668, 0.15277, 1.20503, 1.43108, -1.36179, -0.67889, 1.66254, 0.68607, 1.75838, 0.85643, -0.22332, 0.84079, 1.7183, -0.50141, 0.3913, 0.58179, 0.90932, 1.15515, 0.60961, 0.39631, -0.00651, 1.54314, 1.19342, -1.45672, 0.74125, 0.81439, 0.98945, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -0.8928, -1.24496, -0.80018, 2.19023, 0.38494, -2.05631, 0.53123, 0.39735, -1.95587, 0.72539, 1.6676, -0.65186, 0.47403, -1.30126, -1.66952, -0.48168, 0.54865, -0.84833, -1.11111, -2.6352, -1.65629, 0.94021, -0.04251, -1.11743, -2.46839, -2.04879, 0.87119, 0.41158, -0.54794, -0.19748, -0.45916, 0.55054, 1.14867, 0.22587, -1.09796, -1.42709, -1.74365, -0.32905, -0.20255, 0.85188, -1.59983, -0.29088, 0.14445, 0.6988, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -0.43702, 0.15261, 0.83541, -0.31088, -0.8662, 0.72072, 0.49575, -0.50042, -0.8779, 1.74597, 0.19804, 1.75314, 0.61856, 1.0901, -1.2102, 0.83674, -0.49742, -0.39526, 1.135, 1.43825, 0.98703, 0.13962, -0.4038, 0.79855, 0.93869, 1.3177, 0.91807, -1.30142, -0.85645, 1.83519, -0.02222, -0.38002, -1.36596, -0.45326, 1.13584, 2.64059, 2.08703, -0.17456, -0.35359, 0.09958, 0.10785, 0.05207, -0.38023, 0.6317, 0.6574, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, 0.76185, -1.42731, 0.345, -0.07573, 0.51468, -1.17247, -0.6968, 1.29041, 2.7399, -2.58012, -0.62422, 0.50959, -1.32017, -0.1711, -0.05521, -1.34601, -0.45468, 0.34421, -0.19622, 0.01029, -0.97397, -2.52331, -0.25182, -0.0032, 0.91624, -0.77396, -2.12749, -0.85481, 0.40506, -1.51075, -1.11223, 0.33167, 2.58195, 0.60848, -0.02456, -1.46615, -1.23426, 0.62318, -0.48096, -0.38471, -0.14424, -0.03037, 1.12634, -0.71613, -1.40316, -1.63583, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -0.01125, 0.75618, -0.45369, -0.12904, 0.28677, 1.21484, 0.60058, -1.61573, -1.37605, -0.24529, 0.03637, -1.91501, 0.76165, 1.04938, 2.76138, 1.23773, 0.89424, -0.54165, -0.25793, 1.0788, 1.2631, 1.54385, -0.87412, -0.54829, -0.6978, -0.87183, 0.83003, 1.30802, 0.82843, 0.18486, 0.75222, 0.05818, -0.80838, -0.25211, -1.24599, 0.24442, 0.02856, 0.27361, 0.9332, -0.21669, -0.35244, 0.02559, -0.50823, 0.66562, 0.83969, 1.41899, -0.55092, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, 0.32332, 0.00082, -1.52035, 1.00296, 0.80265, -1.14999, -2.10229, -0.25937, 0.08796, 3.06954, 0.87388, 1.04982, 0.96736, -1.25354, -2.02432, -0.90229, -0.8489, -0.70185, -1.43104, -1.67445, -1.16794, 1.08135, -1.0184, -1.06826, -0.14559, 0.33742, 0.66632, -0.71606, -1.92228, 0.39548, -0.78791, -1.15797, -0.10157, 1.88124, 1.23358, 0.16843, -0.60772, -0.84167, -0.44137, 0.89797, 0.07817, 0.87961, -0.02046, -0.52599, 1.52182, 0.6847, -0.1561, -0.27833, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, 0.03936, -0.31996, 0.8677, -0.63368, -1.73081, 0.17711, 2.87753, 1.27093, -1.10585, -1.90951, 0.52967, 1.30766, -1.13256, 1.05742, 0.88912, 1.25513, -0.15616, 0.29657, -0.05765, 0.19983, 1.14036, 1.26755, 3.01636, 0.42409, -0.01729, 0.76401, -0.28328, -0.40187, 0.87168, 0.69484, 0.50188, 0.06202, 0.12705, -0.1882, 0.23216, -0.37312, 0.59307, -1.39577, -1.25663, -0.18179, -0.85652, -0.08222, 1.94054, 0.46771, -0.09309, -1.13865, 1.26267, -0.21557, -1.4416, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, 0.60502, -0.64576, -0.07883, -0.34109, 1.9116, 0.25194, -1.50882, -0.94992, 0.89375, -0.0061, -0.49736, -0.84276, 0.65076, 0.43088, 0.82618, -1.26824, -0.59224, 1.45399, 1.95858, -0.67614, -2.12657, -3.87559, -1.97751, -0.49177, -1.39691, -0.34902, -1.09275, -0.72286, -0.05857, -0.56039, 0.20745, -0.63689, -1.42726, 0.24172, -0.28458, 1.36609, -0.28324, 1.09302, -0.15818, 0.17725, 1.95232, 0.86362, -1.26263, 1.59478, 0.89184, 0.05111, -0.13447, 1.33718, -0.11805, 0.93113, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -0.86416, 0.5672, 0.28193, 0.20555, -1.18663, -1.52125, 0.39647, 1.37502, -0.28491, -0.55092, -0.59545, 0.33457, 1.22827, -0.58619, -0.8554, 1.50798, 1.24096, -0.53416, -1.80065, -0.33657, 1.26997, 1.90205, 0.76631, 2.41318, 0.15394, -1.53378, 0.70726, 0.59662, 1.17708, -0.17677, 0.41401, 1.8799, 1.25314, -0.30106, 0.69397, 0.79326, 0.31186, 1.28742, -1.31047, -2.02625, -1.15428, -2.48772, -1.47964, -0.38447, 1.01827, -0.05588, -0.38362, -1.6797, -0.90213, 0.78509, 0.70614, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, 1.156, 0.60408, -2.34312, -0.0665, 0.75658, 1.87266, 0.18742, -2.17335, -0.9462, 1.40417, 1.444, -0.04944, -1.42873, -0.09102, -0.15234, 2.45585, -0.67734, -2.77098, 0.08412, 2.44133, -0.03425, -0.32733, -1.71397, -3.08277, -0.88617, -0.91292, 0.65782, 0.46, -1.92996, -1.09329, -0.09301, -0.44395, -0.83242, -1.23663, 0.42354, -1.21082, -0.24913, -2.67167, 0.05395, -0.14038, 0.53299, 2.98423, 2.45758, 0.47375, 1.18169, 1.30523, 0.47857, 1.01063, -0.41756, -1.72535, -1.78232, 0.93495, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -0.69353, -1.13046, 1.89546, 0.38959, 0.11905, 0.11653, -0.04481, 1.71914, 1.93562, -1.0657, -1.92474, -1.1708, 0.62955, 2.45088, 1.8973, -2.82103, -1.25326, 2.29454, 1.81624, -1.21969, -1.67749, -0.2027, 1.66566, 2.59759, 3.86295, 2.65334, -1.94609, -1.19797, -0.1096, 1.27455, 0.93155, 0.38445, 0.91501, 1.09256, -0.81292, 0.63717, 0.77142, 1.22567, 0.41785, 1.76095, 0.97361, 0.18605, -1.21736, -2.00516, -2.21554, -0.16011, 1.23294, 0.4001, 0.05985, -0.34318, -1.48359, 0.01912, 0.70634, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, 0.17683, 1.55513, 0.44172, -2.36133, -0.11226, 0.23635, 0.10893, 0.31467, -1.32349, -0.25086, 0.68735, 1.93167, 0.28478, -2.84016, -1.91874, -0.7666, 3.12912, 1.257, -2.31399, -1.64987, 1.89217, 0.17552, -1.19087, -1.13686, -4.25669, -2.74373, -0.68809, 0.89498, 2.37404, -0.64522, -0.85335, 0.67178, -0.82112, 0.13695, -0.83588, -0.22122, -1.10262, 0.69731, -1.0151, -1.32055, -2.37634, -1.23035, 0.42748, 1.24909, 0.08245, 0.47111, 1.29112, 0.63176, 0.32676, 2.40972, 0.07535, 0.44421, -1.056, 0.04763, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -0.26446, -1.14896, -1.46114, 0.76217, -0.72546, -0.90507, -0.511, -0.1554, 1.09494, 2.55334, 0.65426, -2.29695, -2.26518, 1.06198, 2.4828, 3.7822, -1.85054, -3.81674, 0.56323, 2.44564, 0.11955, 0.64433, -1.03317, -0.35586, 1.1207, 2.80849, 3.65414, 0.13918, -0.8095, 0.17818, 0.54464, -1.27337, 0.48492, 0.52565, 0.29732, -1.50316, -0.91314, -0.3192, -0.13784, -1.53607, 2.13199, 2.12909, 0.14404, -0.75727, 0.11139, -0.17022, -1.61829, -0.20583, 0.76246, 0.17034, -0.54975, -1.83331, -0.42436, 0.57484, -1.22792, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -0.33369, -0.42342, 0.30024, 0.68649, 0.7381, 0.61948, 0.21913, -0.63364, 0.66637, -1.7435, -0.80778, 1.56008, 3.3963, 0.8557, -3.76438, -2.78593, -0.45459, 3.23834, 2.50482, -0.317, -2.24, -0.37638, 0.56025, -0.64594, 1.37834, -2.19575, -3.68156, -1.63207, -0.73206, 0.71897, -0.54623, 0.19409, 1.84866, -0.73889, -0.46064, 0.42024, 0.4933, -0.33335, 0.06671, 0.25371, 0.19421, -1.18214, -1.26877, -0.88972, -0.87531, -1.20147, 0.10925, -0.01003, -0.0879, -0.35128, 1.27827, 2.13532, 1.09726, 0.65905, 0.85775, -0.61692, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, 1.06531, 0.22155, 0.94756, -0.04375, 0.21646, -0.23208, 0.33561, -0.25815, -1.8134, -0.74205, 2.02245, 0.66571, -2.44884, -2.28375, 2.65095, 2.21718, 2.61609, -1.06591, -3.44217, -0.21519, 1.86528, 1.29234, 2.20189, -0.50859, -1.6889, 1.0304, 0.96704, 2.51642, 0.29663, -0.81608, 1.37076, 1.73845, -1.6691, 0.23533, 0.67649, -0.03716, -0.60952, -0.82058, 0.16009, 0.38723, -2.4181, -1.29455, 0.84724, 1.28922, -0.85231, 0.11699, -0.27413, -0.0784, -0.06268, -1.2087, -0.53304, 0.06358, -2.08994, -1.6069, -0.66308, -1.26245, 0.68369, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -0.26957, 1.02659, -1.37041, -1.5708, -0.7745, 1.76215, 0.15356, -0.11209, 0.28468, 2.15175, -2.21036, -2.4251, 1.0094, 3.42412, 0.46343, -3.9265, -2.61511, -0.04116, 2.11042, 1.61002, 1.03169, -1.04595, -2.0631, -0.74777, -1.62919, -0.15247, -0.26689, -1.85148, -0.88254, -0.33181, -0.42254, -2.58571, -0.09957, 2.05581, 0.63933, 0.29674, -0.04793, 0.69936, 0.20538, 0.18633, 1.10836, 0.47992, 1.00714, -0.94668, 0.9002, 0.4919, 0.55661, -1.33171, -0.70116, 1.20118, 0.23564, -1.26148, 1.36511, 2.00714, 1.39922, 0.28699, -1.06785, -0.17105, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -1.15065, -0.5118, -0.2286, 1.05366, 1.09607, -1.63399, -0.41429, 1.77439, 0.20772, -2.1132, -0.35249, 2.62777, 0.8167, -3.25291, -2.22778, 3.76576, 2.62408, 0.51856, -0.4753, -2.51107, -1.61026, 0.86276, 0.74762, 3.61087, 1.83149, -0.91431, 1.32467, 0.4301, 0.77928, -0.0937, -1.9197, 0.41357, 2.30208, -1.71089, -0.17727, -0.49692, -1.07032, -0.85671, 0.24003, 0.1152, 1.26724, 0.0816, -0.63031, -1.48646, -1.41659, 0.21181, 1.56738, 1.50522, 0.2562, -0.41928, 0.99184, 0.0273, -0.58243, -0.54796, -1.12799, -0.09638, 0.67572, -0.61805, 0.62449, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, 0.74889, -0.28871, 2.28959, -0.57546, -1.04156, -0.34204, 1.28952, -1.77443, -1.16801, 1.53274, 3.5335, -1.72361, -2.35551, 2.25636, 3.33803, -0.45711, -3.24613, -1.97238, 0.32622, 1.55521, 1.06016, 1.59793, 1.15146, -2.46794, 0.00862, -1.03204, -1.95097, -0.28194, -0.25754, 1.34541, 0.97632, 0.58179, -3.08413, -0.73211, 0.20275, 1.72042, 1.82047, 0.73453, 0.84201, 0.08134, -1.91956, -0.4598, -0.04579, 1.34766, 0.93275, 0.92824, -0.4451, 0.92603, 0.89847, -0.43827, -1.37857, 0.68942, -0.99567, -0.42361, 1.20677, 1.22242, 1.1809, -1.5253, -0.87808, -0.9467, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, 0.59251, -0.83657, -2.35244, 0.38299, 0.71553, 1.86705, -1.08056, 0.57432, 1.65585, -0.43813, -3.07833, -1.24241, 2.33245, 0.7675, -2.87501, -2.72805, 2.83397, 3.00692, 0.03314, -0.15678, -0.35469, -1.31332, -1.39516, -0.60633, 2.38395, 1.28413, -0.50206, 1.28191, -0.03836, -0.3675, 0.53094, 0.05397, 0.73112, 1.94212, 0.23576, -0.31964, 0.20582, -0.84743, -1.37924, -0.62373, -1.20015, -0.66204, 0.95694, 0.41053, -0.94956, -1.10121, -0.15001, -0.74881, -0.19, 0.57545, 1.40959, 0.66009, 0.95528, -1.14134, 0.5477, -0.13752, -0.29269, 0.27974, 1.66978, 1.83938, 1.80503, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -1.3962, 1.15686, 0.10807, 0.99175, -0.26883, -0.10615, 1.2972, 0.81168, -2.28339, -1.45608, 2.1075, 3.30128, -1.08066, -2.51006, 1.80952, 2.6091, -0.99782, -2.84366, -1.71994, 0.7348, 0.37106, -0.39286, 0.7776, 1.58449, -1.38251, 0.42798, 2.05409, -1.94422, -1.0619, -0.8638, 0.67608, 0.71293, 1.97792, -1.61024, -0.87471, -2.2032, -0.40885, 0.99349, 2.16719, 2.03751, 3.39545, -0.26713, -0.27973, -2.08011, 0.53043, 2.13668, 0.65502, -0.12238, -0.16131, -0.34737, 0.49511, -0.75672, -1.06672, -0.43, -1.07059, -0.50032, 0.78248, -0.00363, -1.4425, -1.12828, -0.65295, -0.08918, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, 0.35927, 1.56727, 0.81451, -1.92259, -0.24119, -0.24905, 0.5752, -1.09427, 0.90384, 2.71231, -0.17533, -3.39808, -1.00142, 3.14365, 1.6459, -1.305, -0.75668, 1.21232, 1.92644, -1.17188, -0.63762, 2.05778, 0.56054, -1.07057, -1.1326, 0.48512, 0.41309, 0.79191, 2.39676, 0.3447, -2.41931, -0.62751, -1.68344, 0.89791, 0.26327, 1.18841, 0.57121, 0.42631, -1.77837, -2.08084, -0.63618, -1.13708, -1.17569, 0.1799, 1.04985, -1.72698, -1.06899, 0.21414, -0.22657, -1.51699, -1.67453, -1.33384, 0.20671, 1.3206, 0.07994, -1.14618, 1.08788, 0.09744, 1.50764, -0.59287, 1.57722, 0.88235, 0.41565, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, 1.40462, -1.28808, -0.94083, -0.05766, 1.1385, 0.51768, -0.92608, 1.46348, 0.49129, -2.26063, -1.9762, 2.31398, 3.44601, -0.56567, -1.89985, 1.07891, 2.10308, 0.10415, -1.34407, -1.40552, 0.78662, 0.68841, -0.62656, 0.10461, 1.63578, -2.12786, -0.76116, 1.73589, -1.63289, -1.03448, 0.81525, 1.76506, 1.24694, 1.22353, 0.00256, 1.17179, -0.538, -0.93819, -0.22932, 2.23732, 0.59696, 1.86139, 1.5941, 0.23466, -2.12836, -1.10436, 0.05804, 1.48574, -0.23365, 0.31617, 1.84354, 1.83822, -0.96964, -2.57531, -0.05035, -0.59224, -0.98732, -1.02509, 0.37611, -1.00065, -1.6586, -1.65358, -0.48873, 0.19542, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -0.81513, -1.02779, -0.12386, 1.6697, -0.96934, -0.77507, 0.01459, 0.0573, -1.62218, 0.64042, 3.46831, 1.17512, -2.91387, -1.83359, 1.52704, 0.82701, -1.22034, -0.01798, 0.35529, 1.79914, -1.61793, -2.78355, 0.67779, 0.53195, 0.28878, 0.27226, 0.40243, -1.09845, -0.05449, 2.1758, 1.20335, -1.89357, -0.55737, -1.33901, 0.8546, -1.95598, -0.74448, -0.16736, 1.89567, 0.35291, -1.50907, -0.69404, 0.72103, -0.88603, -0.18218, 0.41128, -0.72477, -1.68927, -0.981, 0.93287, 0.61166, -1.43755, -1.54546, -0.37727, 0.47736, 0.16266, 0.51107, 0.52722, -1.21925, 0.46502, 0.72602, 1.66826, 0.2846, 0.55048, 0.10644, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -0.97239, 2.48723, 0.13967, -1.68567, -0.28087, 2.04561, 1.115, -1.38228, 1.12599, 1.6937, -1.36629, -3.11588, 0.77645, 2.65136, 0.2928, -1.21931, -0.04482, 0.86278, -0.24697, -0.33142, 0.16785, 1.52921, 0.75702, 0.16459, 1.00955, 1.05756, -0.81762, 0.37342, 1.8696, -1.48053, -1.77207, 0.00327, 0.49536, 1.21477, 0.30307, 0.15279, 0.03483, 1.57277, -1.48679, -0.90177, 1.09719, 0.19539, -0.74843, 1.12892, 1.49203, -0.48946, 0.47603, 1.16423, 0.69112, 0.49936, -0.94292, -0.56317, 2.12747, 0.51534, -1.28941, 0.49825, -1.60325, 0.3406, 1.46593, 0.57846, -0.61909, -1.62985, -0.59824, -2.57648, -2.20274, -0.97057, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, 1.17644, 0.15554, -0.65385, 1.29021, 1.97021, -0.50277, -0.77609, 1.48268, -0.13767, -2.25561, -1.2363, 2.27653, 1.57913, -1.51068, -0.42832, 1.30156, 1.02913, -1.04896, 0.13887, 0.97409, 1.82716, -0.56578, -2.70782, -0.4588, -0.37968, -1.54698, -0.05339, 0.07684, -2.17248, -0.7354, 1.32575, 1.95986, -1.07234, -0.63846, -0.79201, 2.1368, 0.45552, -1.96361, -1.41312, -0.46816, -0.28867, -0.45007, -0.50042, 0.40297, 0.34726, -0.82101, -1.77291, -0.98207, -2.08509, -1.5501, 0.23472, 2.0381, -0.62222, -0.54788, -0.64045, -0.20996, 0.6947, -1.62146, 0.21518, -0.52568, -0.07353, 0.44998, 1.32766, 2.53329, 2.20069, 0.14276, 0.2067, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, 0.3028, -0.80801, 0.75009, -0.54358, -2.23109, -0.44628, 2.14499, 0.00472, -1.94039, 0.87753, 2.85286, 0.56132, -1.96125, 0.31158, 1.5513, 0.04738, -1.18368, 0.24998, 0.04166, -1.53855, -2.18832, -0.33691, 1.46817, 0.31316, 0.31967, 2.11728, 1.25363, -0.05079, 2.1705, 2.62376, -0.1448, -1.10391, 0.34001, -0.52091, 0.51379, -1.27281, 0.27831, -0.78098, 1.15814, 0.81105, 0.26918, 2.04049, 0.95519, -1.94018, 0.48222, 0.72211, 0.89835, 0.73242, 2.18837, 2.56501, 1.3292, -1.43296, -0.64185, -0.06876, 1.30115, 0.55628, 0.63047, -0.70728, -0.8819, 1.50771, 0.24647, 0.45479, -0.99587, -0.94267, 0.87642, 0.41793, -1.31677, -1.01337, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -0.68547, 0.26969, -0.97006, -0.47005, 1.44245, 1.0528, -2.37768, -0.37698, 2.18895, 1.22499, -1.36814, -2.12113, 1.13345, 1.8225, -0.71045, 0.24564, 0.99211, 0.972, -1.41766, 0.30081, 1.80931, 0.71041, -0.54823, -1.64776, 1.02623, -0.07668, -1.37782, 0.17232, -0.19081, -2.61744, -1.27619, 0.06544, 0.67542, -0.18476, -0.96299, -1.28057, 0.37804, 2.51312, -0.12022, -0.6455, -1.91452, -1.95338, -1.78117, 0.4208, 0.28583, -0.41482, -0.4787, -0.98039, -0.73027, -1.81235, -1.9226, -1.10215, 0.32772, -0.12406, -0.73447, -0.28245, -2.29137, 0.63855, 0.79635, -0.50191, -0.62873, -0.72992, 0.84044, 1.79235, 0.9672, 1.1706, 1.70984, 2.61073, 0.16106, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -0.37155, 0.9199, 1.20055, 0.81225, -0.82896, -1.35769, 1.42671, 1.77885, -0.93306, -1.45653, -0.25122, 1.70212, 0.83703, -0.82788, 0.83536, 0.60791, -0.78195, -1.34075, 0.98121, 1.64451, -1.01135, -2.24868, 0.18482, 2.52926, 0.02976, -1.95396, 0.97007, 0.41979, -0.99117, 1.82812, 2.10615, 1.19133, 0.49655, 1.75312, 0.66977, 1.16014, -0.52416, -1.01426, -1.0583, 0.02742, 0.59286, 1.43708, 2.05895, 1.28477, -0.18785, 0.62483, -0.11656, 0.31047, 0.34602, 1.62817, 2.21183, 2.64472, -0.25685, -1.20896, -0.70971, 1.47466, 1.05136, -0.00125, 0.22202, 0.04798, 2.67747, 0.28967, -0.70606, -0.95349, -1.14101, -0.00894, 0.84346, 1.20006, 1.4538, 1.91846, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, 1.12112, 0.15783, -1.13086, -0.62558, 1.35948, 2.53531, 0.97495, -2.01642, -0.51869, 1.72006, 1.15438, -0.0952, -1.11092, -0.64682, -0.16549, -0.05114, 0.60289, 0.99663, 0.1639, -1.34678, 0.24329, 2.47025, 1.01411, -1.40991, -2.13264, 0.3824, 0.4658, -0.23733, 0.45437, 0.18192, -2.19281, -1.34079, -0.63865, -0.99047, -0.19578, 0.15554, -0.20302, -0.64443, 1.67952, 0.54841, 1.69263, -0.90517, -2.58153, -1.76464, -0.03177, -0.98679, 0.34654, -0.00536, -0.8575, -0.99951, -0.25218, -1.41168, -0.88962, -0.92336, 0.95734, 0.17035, -0.77709, -0.28109, 0.39817, 0.22583, -2.12644, 0.42096, 0.30227, 1.40611, 0.46713, -0.10437, -0.07839, -1.12385, -1.8202, 0.14893, 0.41129, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -0.73192, -0.77309, -0.31433, 1.04428, -0.86992, -0.65153, -0.29832, 1.23247, 0.05113, -1.00115, 0.26891, -0.0608, 0.87516, 1.2752, 0.72684, 1.11359, 0.65804, -0.38676, -1.27451, 0.30345, 0.58307, -1.63726, -2.83709, -0.26837, 2.78466, 0.72509, -1.96066, -0.12512, 0.29939, -1.12138, 2.27892, 1.32348, 0.01592, -0.00839, 1.08964, 0.64992, 1.816, 0.36492, 0.07435, -0.06166, -1.20019, -0.18364, 0.91912, 2.70885, 0.10763, -0.47036, 0.9936, 0.24316, -0.06323, -0.78253, -0.30175, 0.02043, 2.67224, 1.84079, 0.06937, 0.56157, -0.26561, 0.1117, -0.83121, 0.18606, 0.59096, 2.16277, 1.22269, -0.17559, 0.31113, -0.39716, -2.01713, 0.75421, 0.71822, 0.67194, 1.07206, 0.70044, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, 0.08466, 1.28922, 0.32306, -1.29935, -0.50159, 0.66712, 0.51068, -0.09521, -0.55657, 0.32003, -0.52778, 0.06423, 1.40406, 1.05516, -0.02056, -1.16004, -0.66685, 0.55177, 0.59671, 0.84245, -0.94412, -0.96894, 2.01015, 2.18155, -0.01929, -0.94308, 0.51696, 0.34925, -0.01321, 0.61655, -0.97421, -1.21378, -0.34317, 0.03864, -1.31732, -1.48763, -1.21314, -0.09439, -1.43926, 0.7326, 0.9178, 1.98368, 1.26883, -2.00729, -0.77218, 0.22086, -0.92826, -1.58192, 0.34936, 0.73658, -0.59327, -0.87522, -1.38402, -1.99718, -1.432, -0.76685, 0.20441, 0.18453, 0.63208, 1.09799, 0.90559, -3.35481, -1.98627, -0.04425, 1.31856, 1.50747, 0.44793, -0.72341, -1.33473, -2.04166, -1.24053, -1.26164, -1.19338, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, 0.63105, -0.53427, 0.35497, 1.47538, 0.94841, -2.57219, -0.51122, 1.16305, 1.27924, -1.1785, -1.35437, 0.51385, -0.80417, -1.41407, 0.94845, 2.1007, -0.32219, -0.31334, 0.3524, -0.31572, 1.24684, 1.5216, -0.38076, -2.48737, -1.05479, 0.49683, 0.38378, -1.03615, -1.35756, -0.81051, -1.30085, 1.9549, 1.1766, -0.90732, 0.24371, 1.09948, 0.43951, 0.7062, 0.05602, -0.70376, 0.44759, -1.43751, -2.18973, 0.22639, 1.69704, 0.40891, -0.2864, 0.31386, 1.05589, -0.85868, 0.32088, -1.0986, 0.67871, 0.20713, 0.76402, 0.86166, 1.26564, -0.30989, 0.13875, -0.3386, -1.10992, 0.64248, 1.28382, 1.77475, -1.56002, -1.07733, 0.45167, -0.46509, 0.87929, -0.37042, -0.65004, -1.13887, -0.02611, -0.07379, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -1.01452, 0.26947, 0.00245, -0.55014, -0.30046, 1.95298, 1.26703, 0.15372, -1.04618, 1.0401, 2.12147, -0.96821, -0.91839, 1.57671, 2.06597, 0.19685, -0.76024, -0.10377, -0.63154, -0.98909, 0.288, 0.10636, -0.86722, -0.25446, 0.84963, 0.02356, 0.03791, 0.62531, 0.27412, 1.77779, 1.40914, -1.25006, -1.40136, -0.04218, 1.61435, 0.49489, 0.58224, -1.20723, 0.20112, -1.12159, -1.30109, -0.25395, 1.43089, 1.73893, -0.89759, -1.30887, 0.02947, -0.02594, -0.73309, -0.523, 0.87003, 0.09109, -0.00782, -0.45869, 0.41706, -2.07832, -2.39254, -0.22361, -1.00303, 0.44492, 0.79418, 0.66409, -1.37185, -0.7152, -0.68618, 0.24133, 0.62427, -0.23706, -0.22081, 2.42028, 0.08368, -0.3765, -0.08438, -0.309, 0.02689, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, 0.14539, 0.25189, -1.12616, 0.15516, 1.28259, 0.66752, -0.84907, -0.35059, 0.59528, 0.8243, -0.23635, 0.10013, 1.10096, -0.26455, -2.82679, -0.61897, 1.88366, 0.22327, -0.03655, 0.46179, -0.82607, -0.56705, 1.02833, 2.13135, 0.01918, -0.33721, -0.73932, -0.66431, -0.35623, -0.76642, -0.86939, -1.12319, 1.07767, 0.99696, -1.67146, -1.10405, -0.52129, 0.5252, 0.70314, 1.13288, -0.52204, 1.01277, -0.28648, -2.35999, -0.87834, 0.94725, 0.3048, -0.05611, -0.2619, 0.80887, -0.56288, -0.94646, -0.22317, -0.62663, -0.38126, -0.04216, -0.27485, -0.19081, 1.32948, -0.18704, 0.47983, -0.81181, -0.08607, -0.67836, 0.38876, -0.53133, -1.63354, 0.02213, 0.18805, -0.46124, 0.77388, 0.07231, 0.18196, -1.1075, -1.22279, 0.48008, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, 0.49392, 0.12007, 1.16772, 0.04563, -1.6351, -0.46274, 0.68842, -0.05016, -0.3287, -0.89979, -0.09826, 0.79327, -1.02415, -0.9026, 1.61799, 1.94281, 0.1728, 0.2188, 1.27139, -0.22384, -0.80603, -0.28454, 1.09083, -0.02675, -1.44497, -0.42381, -0.31595, 0.24637, 0.60531, -0.98319, 0.73904, 1.37445, -0.64853, -0.96417, -0.17291, 0.55492, 0.4923, 1.88158, 0.11216, -0.07211, 0.2868, -1.25919, -0.41008, 0.80958, 1.79667, 0.57087, -0.76261, -0.88313, 0.40807, 0.1245, 0.45581, 0.41435, 0.14859, -0.99533, 0.76266, 2.36654, 0.04692, -1.3813, -1.31644, -1.43653, -0.50869, 0.16375, 0.31849, 1.27447, -0.33239, 0.01649, -0.49663, -0.37308, 0.9082, 0.14419, 0.85347, 1.21156, 0.56752, 0.43802, 0.51113, -0.28794, 0.49406, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, 0.08828, -0.64289, 0.29471, 0.66241, 0.26973, -0.20548, -0.2835, 0.77789, 0.20236, 0.00257, -0.57168, -0.01924, 1.58638, 1.87992, 0.572, -1.92208, -1.0161, -0.06449, -0.67091, 0.71189, 1.49267, -0.36401, -1.56991, -1.38451, 1.64433, 1.76687, 0.88603, -0.30897, -1.31121, 0.03096, -0.80674, -0.88035, -0.61831, 0.36739, 0.85979, -0.10467, -0.12185, -2.13375, -1.10749, -0.61268, 0.98984, -0.16391, 0.43642, -0.17154, -1.75618, -1.54564, 0.01299, -0.12197, 0.7079, -0.03016, 0.54918, -0.69049, -0.01235, -0.68512, 0.44087, -2.25386, -0.14247, 0.2946, -0.1374, 1.10459, -0.64742, -0.01379, -0.24699, -0.64226, -0.84673, -0.7104, -0.14279, -0.28372, -1.1194, -0.30796, -0.02413, 0.10871, -0.30632, -0.41762, -0.264, -0.66339, 0.17265, 1.69653, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -1.09892, 0.36362, -0.22999, 0.09643, -0.14195, -0.14145, 1.13346, 0.33899, -0.16097, 0.81573, 0.77634, 0.01228, -0.30066, -0.83616, -0.03626, 0.66322, 0.29933, -0.19993, 0.08402, 0.13364, -1.25988, -0.03281, 0.4083, 1.37984, 0.99263, -0.96552, -1.1064, 0.14784, 0.61466, 0.77469, -0.60029, 0.15943, 0.188, -0.81895, -0.66509, 0.41495, -0.08214, 0.38089, 1.46559, 1.28061, 0.21278, 1.37443, -0.46558, 0.49329, 0.83881, 1.38801, 1.40241, 0.51351, -1.40466, -0.73507, 0.24481, 0.79755, 1.30297, -0.24875, -1.39468, 0.30217, 2.0364, 1.20436, 0.0106, -0.54486, 1.19753, -0.59712, -1.14496, -0.69472, 0.94003, 0.45284, -0.82298, 0.15014, 0.40944, 0.63908, 1.14435, 1.44791, 0.05943, 0.22501, 0.19894, 0.43122, -0.88217, -1.10724, 0.44931, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, 0.96765, -0.30091, -1.45505, 0.6526, 0.81292, 0.60039, -1.33793, -0.80487, 0.81335, 0.13362, -0.33084, -1.30204, -0.46909, 0.69736, 0.60906, 0.45514, 0.16514, 0.02377, -0.78998, -1.26045, 1.01308, 1.5092, 1.43739, -0.7648, -2.033, 0.22115, 1.23202, 0.54812, -0.39954, -1.24578, 0.79991, -0.74435, -1.20562, -0.36675, -0.28937, -0.43996, -0.47563, 0.51697, -1.00802, -1.63156, -0.96502, -0.8473, -0.28713, 0.13363, 0.00267, -1.37691, -1.65644, -0.06928, 0.27165, 0.71367, -0.04294, 0.07328, -0.16002, 1.07419, 1.07096, 0.11011, -1.39583, -1.35653, -1.29577, -0.27628, -0.03159, -0.65856, 0.60629, 0.59863, -0.40183, -1.16206, -1.1019, -0.65087, 0.14468, -1.23301, -0.8552, -0.47841, -0.2332, -0.1955, 0.34277, 0.36813, 0.03634, 1.02688, 0.58133, 0.11258, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -0.90739, -0.09136, 1.50029, 0.07204, -0.03041, -0.019, -0.20947, 0.23973, -0.3717, -0.37479, 0.43259, 1.14544, 0.75246, -0.99817, -1.06195, 0.95237, 0.89884, 0.21279, 0.96127, 0.85414, -0.17003, -1.71419, -1.09762, 0.27796, 0.98001, 0.64806, -0.55215, -0.78012, -0.21058, 0.10131, -0.15772, -0.27203, 1.37365, 1.13953, -0.55044, -0.31914, 0.79885, -0.26707, -0.40455, 0.55066, 1.10649, 0.15831, 1.42549, 0.5526, 0.90604, -0.06756, 1.3271, 0.69445, 1.60371, -0.03575, 0.11747, -0.52872, 0.73133, 0.16662, 0.70054, -0.18232, 0.64509, 1.31532, 0.94387, 0.43131, -0.45958, 0.71512, 0.68977, 0.24167, -1.18655, -0.33685, 1.36243, 0.55503, -0.7802, -0.0441, 0.1147, 0.19816, 1.55977, 0.29672, -1.00758, -0.87627, -0.06229, -0.51613, 0.08309, 0.11881, 0.02775, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, 0.42249, 0.93849, -1.03322, -0.93975, 0.10462, -0.0186, 1.03083, -0.00439, 0.12341, 0.0796, -0.16239, 0.2498, -0.17147, 0.17635, 0.94206, -0.33683, -1.56656, 0.40989, 0.45054, -1.08812, -1.5571, 0.04889, 0.51552, 1.06262, 0.08709, -0.81852, 0.02308, 1.49546, 1.18907, 0.3371, -1.26274, 0.71056, -0.56295, -2.03412, -0.69572, -0.06701, -0.25066, 0.03742, -0.61749, 0.04566, -0.54844, -0.13508, -1.01808, -0.91271, -0.6048, 0.67541, -1.28408, -1.19792, -1.08733, -0.22798, 0.35431, 0.2242, -0.27853, -0.05254, 1.24395, 0.37693, 0.28908, 0.15835, -0.22098, -1.41823, -1.71345, -0.48347, -0.13572, -0.53892, 0.59663, 1.01597, -0.91648, -1.17595, -0.17372, 0.58419, 0.25727, -1.28024, -1.02626, -0.10389, 0.04982, 0.6838, -0.00807, -0.64142, 0.3341, 0.50427, -0.97466, -0.97082, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -0.07305, -1.46315, -0.14659, 0.7523, -0.68188, 0.76184, 0.05696, 0.53011, -0.37763, -0.37217, 0.04017, 0.05184, 0.87452, 0.74036, -0.54495, -1.16203, 0.57467, 0.21848, -0.7502, 0.49726, 1.92806, 0.78387, -0.3516, -0.80385, 0.30903, 0.68026, 0.24653, -0.49488, -0.5026, 0.00104, 0.4576, -0.98511, -0.97753, 0.95002, 1.63043, -0.39025, -0.61142, 0.88187, 0.02533, -0.30372, -0.17368, -0.31817, -0.53779, 0.90316, 0.46912, 0.01848, 0.20784, 0.73224, 0.5073, 0.76242, -0.41187, 0.24797, -0.27787, 0.4346, -0.09449, -0.10258, 0.11717, 0.82419, 0.26046, 0.27598, -0.07549, -0.30461, -0.30177, 0.26497, 0.99146, -0.82962, -0.71043, 0.93392, 0.48852, -0.33039, 0.1524, -0.19634, 0.2162, 0.02342, 0.30836, -0.40612, 0.55646, 0.24717, 0.17913, 1.24043, 1.14295, -0.17142, 0.32596, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -0.23374, 0.79846, 0.70064, 0.44288, 0.5251, -0.75152, -1.30382, 0.40917, 0.50091, 0.15195, -0.13626, -0.76791, -0.44286, -0.56439, 0.66805, 1.50807, 0.14132, -1.0035, 0.28555, 0.23407, -0.50673, -0.86884, 0.0543, 0.51332, -0.25589, 0.0632, -0.09696, -0.04403, 0.27343, 0.05748, 0.46283, -0.17747, 1.17899, 0.21021, -1.41884, -1.42774, -0.3554, 0.47875, 1.19086, -0.27142, -0.10693, 0.03665, 0.91354, -0.21979, -0.23806, -0.84514, 0.67042, -1.12009, -0.6139, -1.02506, 0.00092, 0.12277, 0.62769, -0.96158, 0.50593, 1.13193, -0.07541, -1.24137, -0.54831, 0.07328, -0.12357, -1.31141, -0.00369, -0.06953, -0.67414, 0.05171, -0.09479, -0.15768, -0.5308, -0.68458, -0.62757, 0.18687, -0.31419, -1.16013, -0.53576, 0.71529, 0.47882, 0.18233, -0.54692, -0.44018, 0.13441, -0.04886, -0.38331, -0.10856, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -0.11002, 0.46808, -1.02867, 0.2865, -0.20253, -0.19518, 1.59746, -0.02692, -0.05932, -0.33895, 0.49313, -0.092, -0.29693, 0.73587, 0.3372, -0.08226, -0.27321, 1.03052, 0.18824, -0.88266, -0.30027, 1.03153, 0.45332, -0.11049, -0.06813, 0.84391, 0.49195, -0.19294, -0.51118, -0.23568, -0.06506, 0.21673, -0.72116, -0.84401, 0.68883, 1.96088, -0.02228, -0.9546, -0.36193, 0.08227, 0.18745, 0.50094, -0.64303, -0.5023, -0.21084, 0.77537, -0.43526, 0.54574, -0.11807, -0.04375, 0.21675, -0.39076, -0.69011, -0.55849, 0.22246, -0.17648, 0.13063, -0.34047, 0.76598, -0.23773, -0.97144, 0.03513, -0.49647, -0.10575, 0.5916, 0.66551, 0.15303, -0.32234, -0.08747, 0.23798, 0.38924, 0.51959, 0.74813, 0.64318, -0.46205, -0.67138, -0.12852, 0.66285, 0.43079, 0.4002, 0.14019, 0.5921, 0.17328, -0.1389, 0.01386, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -0.64809, -0.28919, -0.16759, -0.15259, 0.53608, 0.94524, -1.1866, -0.58803, 0.86089, 0.44404, -0.00297, 0.42394, 0.24662, -0.62544, -1.04177, -0.46095, 0.43156, -0.34565, -0.64046, 0.18239, 0.17431, -0.41608, -0.48543, 0.03923, 0.02507, -1.04523, -0.44234, 0.92567, 1.65775, 0.45671, 0.00435, -0.10055, -0.20235, 0.80985, -0.05362, -1.25218, -1.15697, -0.89124, -0.90584, 0.92058, -0.36859, -0.07516, 0.26309, -0.13566, -0.53707, -0.17041, -0.346, 0.27847, -0.15986, 0.41343, 0.18397, -0.13064, 0.29519, 1.45545, -0.73357, -0.01725, 1.11353, 0.5726, -0.94825, -0.73767, -0.44596, -0.11647, 0.02165, -0.33711, 0.56041, 0.35704, -0.59231, 0.00746, 0.17882, -0.2787, -0.15959, -0.09385, -0.07256, -0.75943, 0.03656, 0.53388, -0.46631, -0.12444, 0.11913, -0.6478, -0.2585, 0.69937, -0.05995, 0.79255, -0.40219, 0.60932, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -0.13318, 0.0714, 0.26359, -0.29063, -0.52324, -0.8505, 0.78577, 1.50765, -0.48411, -0.90319, 0.08567, 0.45081, -0.11266, -0.96392, 0.99626, 0.58102, -0.72274, -0.23976, 0.94919, 0.78174, -0.38904, -0.25195, 0.96112, 0.42168, 0.02359, 0.74711, 1.34418, 0.14854, -0.98562, -0.84235, 0.18692, 0.58169, 0.80815, -0.74491, -0.5696, 0.32827, 1.90384, 0.97464, -0.20596, -0.34359, -0.08643, -0.46693, 0.48122, 0.48284, 0.44957, 0.03951, 0.0283, -1.07999, 0.96791, 0.0226, -0.07972, 0.362, 0.62502, -0.85268, -1.06402, -0.62131, -0.30421, -0.33851, -0.50915, 0.21888, 0.60106, -0.54914, -0.33164, -0.44573, -0.30936, -0.28256, 0.49388, 0.95081, -0.44161, -0.47259, 0.03912, 0.29283, 0.47689, 0.84439, 0.40651, -0.1515, -0.17092, 0.55104, 0.01162, 0.43523, 0.36643, -0.14447, -0.26946, -1.1893, -0.34016, 0.21797, -0.09107, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, 0.22696, 0.00333, 0.13232, -0.05794, 0.12065, 1.12238, 0.13554, -1.62178, -0.43249, 1.22153, 0.0209, -1.31832, 0.03349, 1.13879, -0.02331, -0.12212, 0.09186, 0.16872, -0.72348, -0.94024, 0.06873, 0.01158, -1.17513, -0.48294, 0.0966, -0.63056, -1.71786, -1.05685, 0.47719, 1.46095, 0.24562, -0.25584, -0.51132, -0.38732, 0.79307, -0.01347, -0.89889, -0.58331, -0.1176, -0.3967, 0.16999, 0.07424, -0.34557, 0.66575, 0.26901, -0.65978, -0.14099, 0.83653, -0.37871, -0.82555, -0.1537, 0.85972, -0.04917, 0.13959, 1.1033, 0.32667, 0.37271, 0.52634, 0.92975, -0.3408, 0.16075, 0.11649, 1.13415, 0.02817, -1.0851, 0.04182, 0.41536, -0.30929, 0.37667, 0.46475, -0.33454, 0.19386, 0.35598, -0.03771, 0.2403, 0.56141, 0.45945, 0.08889, -0.21545, -0.70572, -0.6692, -0.20214, 0.46159, 0.67064, -0.25304, -0.307, -0.36665, 0.02972, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -0.4109, 0.41981, -0.24631, 0.74677, 0.40053, -1.25895, -0.96775, 1.02275, 1.24612, -0.69335, -0.65248, 0.65701, 1.08486, -0.44873, -1.23439, 0.70383, 0.50565, -0.61838, -0.14307, 0.11713, 0.30178, -0.13229, 0.5095, 0.42898, 0.08652, 0.17791, 1.21689, 1.70683, 0.54359, -1.25359, -1.08354, 0.16467, 0.27726, 1.58683, -0.115, -0.74884, 0.05221, 1.10708, 0.53478, 0.28096, -0.50321, 0.11421, -0.43473, -0.71719, -0.45413, 0.82848, 0.3611, 0.12446, -0.92392, 0.56427, 0.31317, -0.61115, 0.4516, 0.91143, -0.2073, -0.36914, -0.50643, -0.31558, -0.22126, -0.16105, -0.47346, 0.10158, -0.10128, 0.20085, 0.66871, -0.56813, -0.45432, -0.25501, 0.07659, 0.12008, 0.16966, 0.00933, -0.08216, 0.76589, 0.11165, -0.62995, -0.5037, 0.41267, -0.41882, 0.26733, 0.35878, -0.05017, -0.65745, -0.01482, -0.46886, -0.47557, 0.34927, 0.26341, 0.646, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -0.18576, 0.24899, -0.10846, -0.48664, -0.65025, 0.56081, 1.31384, 0.15905, -0.61861, 0.03537, 1.21102, 0.24049, -1.27315, -0.09516, 0.89462, -0.86298, -0.38451, 0.70448, 0.27082, -0.43494, -0.08815, 0.56505, -0.03926, -0.80468, -0.08875, 0.38114, -0.99747, -1.8294, -0.30245, 0.48978, 1.31744, 0.33618, 0.28921, -0.87521, -0.4583, 0.28176, -0.04168, -0.63864, -0.83176, 0.30412, 0.55915, 0.44704, 0.53352, 0.04888, 0.93182, 0.34191, -0.50061, -0.34054, 1.17006, 0.09704, -0.56877, -0.37542, 0.13169, -0.08398, -0.4458, -0.06425, 0.50252, 0.54632, -0.38509, 0.10533, 0.39685, 0.17358, 0.71254, 0.94506, 0.41529, -0.07202, -0.13551, 0.11562, -0.01163, 0.20686, -0.18088, -0.63849, -0.02678, -0.49548, -0.04186, 1.18541, 0.15814, -0.21115, -0.41177, -0.42838, -0.07031, 0.23929, -0.0914, 0.43711, 0.77428, -0.19123, -0.45516, -0.26833, -0.65289, 0.09703, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, 0.25638, -0.48905, -0.10181, 0.57581, 0.87423, 0.12583, -0.82539, -0.05714, 0.39264, 0.08466, -1.04504, -0.6255, 0.7624, 0.38876, -0.18711, 0.08737, 0.41213, 0.15141, 0.17019, 0.13145, -0.23252, -0.4225, -0.36895, 0.58275, 0.16062, -0.85443, 0.27888, 1.29474, 0.33313, 0.03476, -0.42412, -0.82991, -0.19565, 0.01481, 1.2434, 0.54863, 0.2254, 0.20839, 0.36209, -0.37381, -0.33853, -0.33172, 0.17329, -0.32529, -0.56383, -0.5378, 0.60371, 0.26651, -0.30526, -0.59199, -0.2556, -0.01753, -0.3592, 0.13582, 0.69521, 0.18288, -0.00451, -0.27871, 0.39076, -0.13012, -0.14729, -1.15157, -0.13051, -0.15286, 0.19021, -0.01877, -0.5878, -0.28656, 0.09538, -0.25796, -0.41614, 0.4424, 0.47921, 0.67449, 0.62983, -0.52637, 0.14267, -0.34236, -0.25661, 0.26135, -0.40879, -0.30289, 0.34101, 0.27065, -0.25575, 0.02381, 0.56908, -0.24282, 0.27228, 0.31355, -0.15693, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -0.41399, 0.66874, 0.35756, 0.4118, -0.57273, -0.35205, 0.05486, 0.34535, -0.17468, -0.19216, 0.52462, 0.85509, 0.08744, -0.95898, 0.44853, 1.05816, -0.53837, -0.39749, 0.08018, -0.34707, 0.20022, 0.73102, 0.36078, -0.25246, -0.13949, 0.61809, 0.56318, -0.91313, -1.39161, 0.12129, 0.7263, 0.80043, -0.0935, 0.45269, -0.34098, -0.09649, -0.3162, 0.09117, -0.22421, -0.35773, 0.04993, 0.88387, 0.06082, 0.76914, 0.35974, 0.58051, -0.25504, -0.31398, -0.31561, 1.04293, 0.79354, -0.01876, -0.15231, -0.22398, -0.1718, -0.23341, -0.5806, 0.10439, 0.27172, 0.10967, 0.34454, 0.62364, 0.20342, 0.18107, 0.08074, 0.2674, 0.37803, -0.06246, -0.27497, 0.14763, -0.09635, -0.12762, -0.76633, -0.50651, 0.28802, 0.99037, 0.0629, -0.02189, -0.76727, -1.0269, -0.80084, -0.23641, -0.20153, 0.08516, 0.12041, 0.15019, 0.13155, -0.48372, -0.13836, -0.34298, -0.18594, 0.31072, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -0.08613, 0.48257, -1.02469, -0.4984, 0.50946, 0.44367, 0.4212, -0.35806, 0.70502, 0.44027, -0.30724, -0.8386, -0.24055, 0.60903, -0.49562, -0.93258, 0.40587, 0.49568, 0.20689, 0.90728, 0.54117, -0.62536, -0.80552, -0.11825, 0.58893, -0.23401, -0.51997, 0.82073, 1.66709, -0.31665, -0.55312, -0.10486, 0.24681, 0.01043, -0.29096, -0.2836, 0.2207, 0.58655, 0.7627, 0.62271, -0.19936, -0.78945, -0.27715, -0.27234, -0.63506, -0.49801, -0.20699, 0.58711, -0.00554, -0.60237, -0.48785, -0.08212, -0.6499, -0.52665, -0.20375, -0.11777, 0.19961, 0.12138, -0.36044, -0.55325, -0.59757, 0.00429, -0.70561, -0.48919, 0.04184, -0.02008, 0.00333, -0.48484, -0.03158, 0.4964, -0.07357, -0.60422, 0.07277, -0.18511, 0.09129, 0.12576, 0.233, 0.09768, 0.18898, -0.08373, -0.25233, -0.49438, -0.23405, -0.29577, -0.03972, 0.20381, 0.12647, 0.33909, 0.21386, 0.31464, 0.03403, -0.35743, -0.10889, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, 0.17196, -0.54421, 0.44485, 0.70668, 0.27781, -0.31168, -0.30138, 0.27407, -0.21116, -0.47942, -0.19409, 0.54142, 0.72872, -0.33894, -0.57499, 0.28102, 0.4324, -0.30055, -0.50724, -0.80831, -0.45592, 0.31528, 0.95162, 0.3804, -0.55251, -0.20295, 0.56685, -0.27487, -1.09125, -0.60805, 0.3826, 0.22809, -0.15688, -0.39435, 0.24974, 0.34147, 0.44941, -0.33691, -0.63186, -0.2792, 0.14305, 0.40639, 0.91, 0.07613, 0.76195, 0.64504, 0.96029, -0.36645, -0.33131, -0.12276, 0.56682, 0.94936, 0.95767, 0.62417, 0.24244, 0.0004, 0.08955, 0.2565, 0.3349, 0.03706, -0.0619, -0.2604, 0.48699, -0.17954, 0.18269, -0.08327, -0.61779, 0.49962, 0.28398, 0.13192, -0.27569, -0.22054, -0.19353, -0.22236, -0.12929, 0.44698, 0.38429, -0.27044, 0.46041, 0.11699, -0.33502, -0.49457, -0.07313, 0.07758, -0.04423, -0.09569, -0.21081, -0.45754, 0.48155, -0.13954, -0.31965, -0.08882, 0.43226, -0.19308, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -0.38673, 0.66859, 0.42413, -0.34004, -0.9607, -0.14071, 0.31409, 0.3242, 0.07334, 0.38027, 0.42333, -0.21847, -0.34043, 0.11872, 0.8731, 0.19765, -0.91969, -0.37665, 0.11373, 0.37473, 0.9782, 0.55593, -0.59938, -0.65812, -0.13266, 0.17406, -0.57809, -0.28827, 0.79998, 1.23113, -0.49729, -0.57434, 0.29825, 0.7249, 0.36576, 0.1562, -0.60007, -0.0258, 0.46178, 0.51275, 0.03103, -0.39023, -0.82075, -0.08551, -0.21434, -0.42846, -0.58996, -0.27817, 0.1725, -0.00322, -0.89415, -0.60815, -0.44517, -1.02395, -0.82424, -0.56668, -0.45398, -0.33786, -0.05909, -0.15354, 0.09634, -0.14119, -0.55132, -0.3847, -0.42615, -0.09371, 0.011, -0.51621, -0.78167, 0.14419, 0.73695, 0.54487, -0.34553, -0.2409, -0.24754, -0.14586, 0.07217, 0.28793, -0.29097, -0.05865, -0.41109, -0.57255, -0.3398, -0.34204, -0.21875, 0.30506, 0.11285, 0.1217, 0.24468, -0.39244, -0.01015, -0.49014, -0.26467, -0.17885, 0.08877, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, 0.085, 0.29089, -0.84379, 0.18421, 0.76282, 0.32386, -0.13644, -0.1689, 0.17039, -0.30179, -0.2356, 0.1882, 0.47293, 0.28999, -0.42183, -0.12676, 0.51424, 1.06736, -0.03485, -0.61063, -0.79079, -0.85092, 0.03841, 0.47676, 0.77755, -0.02741, 0.39506, 0.29699, -0.70661, -0.84315, 0.43229, 0.79464, -0.17086, -0.76822, -0.69241, -0.50142, 0.3314, 0.49155, -0.55152, -0.3252, 0.10035, 0.43751, 0.47092, 0.43352, 0.19826, 0.40495, 0.49092, 1.21541, 0.2895, -0.18255, 0.00587, 0.67666, 0.63409, 0.987, 0.61869, 0.65077, 0.04554, 0.02319, 0.12531, 0.16099, -0.1072, 0.21138, 0.41124, 0.33573, -0.04283, -0.20672, -0.07308, 0.61172, 0.75365, 0.03299, -0.15306, 0.16118, 0.06707, 0.0731, 0.11551, -0.24519, 0.11008, 0.34332, -0.00678, -0.14886, 0.08768, 0.15953, 0.23632, -0.06743, 0.47692, -0.37414, -0.11863, -0.06305, -0.04772, 0.24176, 0.00275, 0.0879, 0.01141, 0.07806, -0.64664, -0.09103, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -0.27738, -0.24889, 0.6548, 0.59512, 0.15683, -0.62082, -0.36864, 0.29347, -0.01321, -0.15953, 0.17052, 0.11314, -0.38844, -0.41958, -0.13326, 0.38146, 0.27901, -0.88265, -0.39529, 0.08218, 0.49692, 0.80837, 0.40769, -0.3463, -0.76939, -0.19609, -0.10903, -0.37871, 0.42708, 0.57827, -0.12908, -0.89436, -0.3383, 0.56912, 0.69383, 0.16096, 0.09779, -0.48129, 0.11719, 0.37911, 0.32886, -0.07626, -0.46646, -0.7784, -0.1407, -0.52188, -0.29598, -0.73801, -0.12269, -0.31527, -0.06997, -0.54629, -0.47305, -0.20471, -0.6337, -0.91836, -0.17759, -0.55741, -0.30453, -0.19588, -0.15241, 0.10204, -0.08221, -0.15322, -0.02937, -0.03377, -0.42444, -0.42082, -0.59927, -0.25687, 0.15389, 0.42418, 0.00478, 0.03358, -0.30542, -0.07231, 0.0681, 0.05839, -0.31689, -0.09216, -0.19046, -0.50361, -0.89914, -0.1373, -0.11806, 0.10204, 0.25102, 0.37822, 0.26158, 0.07673, -0.08413, -0.6046, -0.12513, -0.31722, 0.00209, -0.13841, 0.04463, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, 0.37386, 0.3015, -0.31252, -0.38206, -0.17239, 0.80383, 0.45686, -0.16129, 0.0665, 0.14257, -0.50554, -0.01202, 0.74239, 0.61244, 0.22246, -0.44723, -0.37544, 0.91317, 1.0856, -0.20544, -0.38915, -0.35432, -0.38964, -0.20397, 0.0168, 0.60329, 0.11806, 0.12619, -0.40375, -0.68153, -0.48785, 0.6325, 0.61688, -0.06571, -0.71882, -0.24941, -0.34326, 0.2754, 0.08298, -0.41917, -0.30295, 0.53603, 0.67635, 0.50046, 0.36864, 0.239, 0.37794, 0.23574, 0.20111, 0.55278, 0.37986, 0.31275, 0.47445, 0.41362, 0.47882, 0.47499, 0.40615, 0.55448, 0.26522, 0.16417, 0.23021, -0.31425, 0.54357, 0.29258, 0.05538, -0.25265, -0.4115, -0.02845, 0.45299, 0.84002, 0.00189, 0.37128, 0.50833, 0.30342, 0.07427, -0.29511, -0.13258, 0.07221, 0.30045, -0.03996, -0.24281, -0.3108, -0.06341, -0.03422, 0.1601, 0.14535, 0.00012, -0.47345, -0.06105, 0.08951, 0.13351, 0.31067, -0.2183, 0.18491, 0.06095, 0.08859, 0.23546, 0.22899, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -0.1836, -0.19457, -0.48851, 0.31044, 0.12111, -0.06719, -0.50533, -0.02527, 0.29799, -0.04852, 0.28571, 0.32345, -0.33141, -0.34545, 0.09483, 0.54819, 0.32201, -0.457, -1.03736, -0.16728, 0.17869, 0.21563, 0.40964, 0.46578, 0.06784, -0.65215, -0.3144, 0.14116, 0.55401, 1.0645, 0.93145, -0.37657, -0.73678, -0.30225, 0.67105, 0.43893, 0.03043, -0.03292, -0.40697, 0.1157, -0.06123, -0.62035, -0.38299, -0.54195, -0.52424, -0.09884, -0.42556, -0.10665, -0.26781, 0.01276, -0.39884, -0.18014, -0.29383, -0.27677, -0.24788, -0.21215, -0.53493, 0.08967, -0.26831, 0.08254, -0.32139, -0.21474, -0.1421, -0.01454, 0.3087, 0.43084, 0.48155, 0.13011, -0.31882, -0.13729, 0.05791, -0.22928, 0.1545, 0.26585, 0.04337, -0.13221, -0.08495, 0.17933, -0.15441, -0.21014, -0.2156, -0.22873, -0.10094, -0.32374, -0.35577, -0.45381, -0.04146, 0.29085, 0.0017, -0.10084, -0.21606, -0.30077, -0.06175, 0.04024, 0.21861, 0.10367, 0.11424, -0.22356, 0.17639, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -0.04418, 0.86649, 0.20677, -0.06972, -0.19096, -0.30659, 0.53302, 0.32214, -0.04489, 0.14908, -0.24338, -0.53219, -0.11051, 0.09431, 0.32376, -0.07331, -0.62627, -0.06755, 0.96446, 0.574, -0.05284, -0.04748, 0.11887, -0.44968, -0.0287, 0.29007, 0.67895, 0.10041, -0.66565, -1.10217, -0.6687, 0.09357, 0.44374, 0.3733, -0.39023, -0.41164, 0.09056, 0.05213, 0.11625, -0.11897, -0.16413, 0.41154, 0.66446, 0.69879, 0.62903, 0.1211, 0.47745, 0.42501, 0.39779, -0.50031, 0.00974, 0.20448, 0.22597, 0.12589, 0.38364, 0.42743, 0.21055, 0.29849, 0.35683, 0.32973, 0.31204, 0.34257, 0.08997, 0.21161, 0.1584, 0.1578, 0.16037, 0.01215, -0.1121, 0.06912, -0.06761, -0.03578, -0.14439, -0.0481, -0.07966, 0.241, -0.20658, -0.19125, -0.00662, 0.24898, -0.16893, -0.00271, -0.44584, 0.00346, 0.29025, 0.31308, -0.26218, -0.39376, -0.39914, -0.00066, 0.11001, -0.02889, 0.2256, 0.00324, -0.09812, -0.00159, -0.07294, 0.0462, 0.56175, -0.16439, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -0.08785, 0.00317, 0.24581, 0.12436, 0.15508, 0.14027, -0.18439, -0.10735, -0.19765, -0.28609, 0.26351, 0.51928, 0.44935, -0.40328, -0.75042, 0.19676, 0.83565, 0.35635, -0.89766, -0.65257, 0.141, 0.04992, -0.38989, 0.12874, 0.54912, 0.19332, -0.89033, -0.40346, 0.32517, 0.8682, 0.74669, 0.351, -0.06987, -0.06891, 0.00548, 0.44037, -0.05185, -0.19407, -0.11313, 0.12416, 0.50254, -0.04796, -0.75382, -0.7, -0.55983, -0.53033, -0.08329, -0.62776, -0.56555, -0.24833, 0.32804, 0.16374, -0.14316, -0.03473, -0.25673, -0.33861, -0.06948, -0.34375, -0.09993, -0.08758, 0.10678, -0.22409, 0.0589, -0.15231, -0.21396, -0.19871, -0.14068, 0.25507, 0.40236, 0.49662, 0.05528, 0.32514, 0.05963, 0.36641, -0.00366, -0.01696, -0.16761, -0.05305, 0.04568, -0.01424, -0.2265, -0.58934, 0.05735, -0.0586, -0.29439, -0.17481, 0.13542, -0.13009, 0.15327, 0.40277, 0.04081, -0.25971, -0.52785, 0.16276, 0.23291, 0.22451, 0.10708, -0.16816, -0.45088, -0.09057, -0.34436, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -0.23287, 0.01494, 0.01757, -0.12887, -0.25031, 0.19821, 0.05721, 0.17745, 0.09672, 0.43987, -0.18353, -0.23131, -0.2416, 0.43275, 0.28868, 0.15022, -0.5381, -0.30987, 0.64761, 0.35948, -0.0556, -0.12169, 0.32779, 0.04315, -0.53318, -0.47844, 0.78275, 0.79464, 0.16296, -0.79511, -0.9311, -0.39599, 0.12913, 0.20186, -0.00942, -0.4057, -0.03603, 0.38702, 0.33042, 0.12486, -0.35007, -0.03675, 0.33459, 0.79479, 0.76791, 0.40635, 0.19876, 0.52082, 0.53403, 0.37722, -0.27896, -0.2356, 0.07591, 0.05676, -0.14207, 0.26728, -0.17693, -0.0536, -0.15232, 0.45037, 0.01728, -0.02315, -0.24501, -0.02104, 0.3179, 0.08393, 0.02783, -0.05234, -0.00572, 0.34504, 0.30106, -0.34335, -0.42019, -0.53426, -0.21244, -0.10122, -0.09482, -0.02083, -0.04655, 0.07959, 0.12948, -0.09618, -0.44932, -0.0823, -0.28626, 0.26514, -0.16665, -0.107, -0.21943, -0.08468, -0.0641, 0.03118, 0.0814, 0.04224, 0.19903, 0.06206, 0.05619, -0.16659, -0.1221, 0.10438, 0.07672, -0.21302, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, 0.09201, 0.30007, -0.54634, 0.3223, 0.44356, -0.12569, -0.26216, 0.17797, 0.18883, -0.5289, -0.31725, 0.36682, 0.56532, -0.0208, -0.10887, -0.16963, 0.29515, 0.54737, -0.41158, -0.84934, -0.10525, 0.27549, -0.08293, -0.31301, -0.02438, 0.4854, -0.38166, -0.73154, -0.22399, 0.76893, 0.78471, 0.26576, 0.07837, 0.05611, 0.20469, 0.42526, 0.25746, -0.22984, -0.42446, -0.2545, 0.21147, 0.35877, 0.10878, -0.36592, -0.78218, -0.35044, -0.19832, -0.30324, -0.1891, -0.61526, -0.21644, 0.16258, 0.08495, -0.17186, 0.0993, -0.30194, 0.11145, 0.27221, -0.05676, 0.07164, 0.13279, 0.48176, 0.13853, -0.09068, -0.29642, -0.35018, 0.08461, 0.08637, -0.18211, 0.00498, -0.14801, 0.18143, 0.15154, 0.23122, -0.07445, -0.24636, -0.33146, -0.04131, -0.07525, -0.27257, -0.03992, 0.08274, 0.14294, -0.13532, -0.02139, -0.1619, -0.22619, -0.1087, 0.14866, 0.36933, 0.39722, 0.52691, -0.27707, -0.0248, 0.00447, 0.22827, -0.08898, -0.04078, -0.13145, -0.25863, 0.00251, 0.05233, 0.0977, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, 0.01725, -0.04976, 0.21986, 0.11156, -0.27641, -0.18856, 0.40342, 0.1619, -0.10945, 0.34053, 0.55996, -0.24504, -0.59878, -0.11206, 0.23369, 0.08822, -0.43446, -0.74071, 0.37164, 0.8241, -0.06719, -0.3203, 0.13564, 0.46462, 0.07824, -0.40238, 0.20543, 0.67865, 0.38471, -0.42849, -0.76517, -0.32247, 0.05003, 0.0285, -0.14492, -0.39478, -0.44137, 0.06221, 0.34965, 0.50801, 0.07886, -0.27751, -0.33308, -0.00258, 0.71125, 0.57803, 0.51721, -0.00081, 0.49729, 0.31658, -0.00059, -0.10127, -0.1066, 0.26364, 0.2174, 0.15385, 0.12337, -0.17658, -0.19905, -0.14431, 0.0197, -0.09874, -0.12843, -0.26998, -0.03656, 0.13939, -0.2378, -0.23497, 0.24554, 0.1665, 0.42087, 0.22417, -0.54464, -0.19278, -0.37863, 0.19974, -0.35572, -0.10715, -0.36277, 0.16894, 0.29383, 0.09177, -0.09624, -0.25395, 0.22341, -0.06257, -0.40592, -0.15205, -0.16857, -0.16136, -0.08269, -0.09394, 0.00903, -0.19905, -0.03432, 0.36153, 0.25716, 0.37392, 0.36225, -0.17452, -0.26496, 0.07358, 0.04538, -0.1855, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -0.36815, 0.52154, 0.10711, -0.45614, 0.32266, 0.46904, -0.39387, -0.15567, 0.21341, 0.14438, -0.64774, -0.15366, 0.48093, 0.10621, -0.48857, 0.13155, 0.48737, 0.85493, 0.12396, -0.64821, 0.01417, 0.36457, -0.18146, -0.53906, 0.01329, 0.33972, 0.22088, -0.88124, -0.73612, 0.13065, 0.60238, 0.37691, -0.1452, -0.09505, 0.031, 0.20407, 0.29622, 0.00449, -0.49192, -0.4563, -0.45628, 0.1115, 0.34867, 0.24072, -0.24897, -0.54337, -0.17513, 0.11759, -0.24142, -0.17204, -0.09324, -0.06612, 0.41538, 0.08128, -0.33296, 0.02676, -0.25839, 0.07082, 0.13993, 0.18217, 0.14244, 0.44013, 0.35141, 0.37373, 0.00553, -0.11774, -0.29771, -0.07227, -0.30495, -0.10664, -0.01908, 0.20002, 0.31151, 0.10918, 0.13855, -0.0033, -0.10455, -0.43326, -0.03092, -0.04166, -0.19418, 0.09067, 0.18336, 0.33128, -0.04576, -0.04225, 0.16074, -0.12383, -0.03534, 0.04459, 0.44302, 0.52426, 0.21602, 0.08287, 0.01977, 0.09144, -0.14902, -0.31288, -0.18547, 0.45042, 0.41604, 0.2841, 0.21975, 0.22178, 0.38108, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, 0.28407, -0.05539, -0.57378, 0.36342, -0.19326, -0.14192, 0.17606, 0.39968, -0.17839, -0.39522, 0.60168, 0.49803, -0.41396, -0.17234, 0.60631, 0.27716, -0.14687, -0.82829, -0.50932, 0.51536, 0.39539, -0.43101, -0.07719, 0.39924, 0.16945, -0.43749, -0.40505, 0.77311, 0.82596, 0.06802, -0.51991, -0.52543, 0.14332, 0.33981, 0.18698, -0.08662, -0.12782, -0.13872, 0.08, 0.48318, 0.50565, 0.09196, -0.1451, -0.30427, -0.34599, 0.18565, 0.39332, 0.15484, 0.10936, 0.2932, 0.65194, -0.02562, -0.39888, -0.23654, 0.29019, 0.25881, 0.42894, 0.42496, -0.23827, -0.20556, -0.13357, -0.13799, -0.10683, -0.31169, -0.23352, -0.033, 0.42728, 0.14912, -0.09698, 0.26826, 0.07188, 0.08344, -0.14051, -0.32375, -0.17721, 0.12672, -0.02948, 0.44632, -0.10619, -0.28214, -0.16533, 0.17185, 0.19416, 0.42158, 0.09752, 0.21855, 0.04163, -0.07786, -0.09542, 0.12524, 0.05085, -0.30039, -0.29313, -0.02757, 0.05024, -0.27438, 0.27471, 0.1986, -0.0434, -0.41217, 0.15115, 0.20472, 0.02333, 0.29499, -0.1453, 0.13795, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -0.63134, 0.08385, 0.47081, -0.08235, -0.01087, 0.1551, 0.18403, -0.21755, 0.21308, 0.22566, -0.27946, -0.55839, 0.17313, 0.41449, -0.30278, -0.62538, 0.02811, 0.91053, 0.58769, -0.25958, -0.5549, 0.56823, 0.28816, -0.37133, -0.26737, 0.24291, 0.47581, -0.0983, -0.71778, -0.27955, 0.28565, 0.43116, 0.15058, -0.51933, -0.33069, 0.00504, -0.11845, 0.14374, -0.03562, -0.46965, -0.53948, -0.37874, 0.05036, 0.19814, 0.12157, 0.00671, -0.3594, -0.249, 0.05522, -0.37115, -0.17939, -0.11577, 0.26625, 0.56308, 0.14271, -0.26445, -0.00493, -0.16463, 0.16283, 0.24756, 0.06796, 0.15581, 0.22966, 0.64065, 0.4591, -0.00591, -0.19288, -0.34734, -0.18192, -0.24723, -0.25854, 0.12297, -0.01441, 0.37489, -0.18491, 0.18971, 0.00541, -0.2186, -0.47602, 0.30572, 0.03364, 0.07611, 0.08787, -0.10189, 0.3217, 0.02339, 0.02209, 0.13966, 0.00418, -0.20254, 0.19061, 0.48425, 0.02913, -0.01688, -0.15964, 0.20754, -0.00098, 0.08483, -0.00661, 0.11992, 0.07683, 0.07896, -0.12807, -0.09394, 0.20503, 0.07485, 0.02126, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, 0.33539, 0.62791, -0.34468, -0.06623, 0.21237, -0.29311, -0.17063, 0.44159, 0.37686, -0.06122, -0.22021, 0.66364, 0.2249, -0.70675, -0.087, 0.5769, 0.06559, -0.44945, -0.22193, -0.07842, 0.56465, -0.39644, -0.55148, 0.33909, 0.41577, -0.1452, -0.51523, -0.29926, 0.62832, 0.33827, 0.02429, -0.33634, -0.10093, 0.36119, 0.20877, 0.09942, 0.01906, 0.07856, 0.00398, 0.42717, 0.66411, 0.51096, 0.00219, -0.00777, -0.01235, -0.01998, -0.07253, 0.01735, 0.11043, -0.02705, 0.03555, 0.27325, -0.02836, -0.26977, -0.22927, 0.10672, 0.03763, -0.00427, 0.0599, 0.06805, -0.05272, 0.04346, -0.27356, -0.2569, -0.37206, -0.20355, 0.08588, 0.38016, 0.04924, -0.27403, -0.05349, 0.20754, 0.09777, -0.06227, -0.17085, -0.06775, -0.00918, 0.33232, 0.40099, -0.11418, -0.37159, -0.15451, 0.01157, 0.16925, 0.04233, 0.20416, 0.11588, 0.06942, 0.09683, -0.14332, 0.25539, -0.08633, 0.07149, -0.40547, -0.24063, -0.16759, 0.01124, -0.18915, 0.10005, 0.06903, 0.05184, 0.21501, -0.04024, -0.17843, -0.01687, -0.05227, 0.09559, -0.36069, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -0.24538, -0.51022, 0.02102, 0.04204, -0.17186, 0.23081, 0.11728, 0.00192, -0.28351, 0.11888, 0.28888, -0.4639, -0.40065, 0.38856, 0.2164, -0.23264, -0.33109, 0.35507, 0.40948, 0.09429, -0.27295, 0.16555, 0.62787, -0.31568, -0.51, 0.16268, 0.55559, 0.41124, -0.3536, -0.36782, -0.2505, 0.16669, 0.19069, -0.01448, -0.23368, -0.07798, -0.14996, -0.33369, -0.0845, -0.12915, -0.6025, -0.51945, -0.1301, 0.22944, 0.10178, 0.1717, 0.21017, 0.09975, 0.01666, 0.11206, 0.1212, -0.3186, -0.40521, -0.06832, 0.24035, 0.1683, 0.00257, -0.03035, -0.10255, -0.05363, -0.05578, -0.12034, -0.05543, 0.12362, 0.50288, 0.1851, -0.04632, -0.14521, 0.09867, 0.386, -0.02939, -0.13469, -0.00509, 0.19148, 0.18303, 0.0821, -0.0919, -0.22959, -0.45855, -0.0885, 0.07378, 0.06644, -0.00554, 0.21682, 0.0156, 0.17592, -0.10295, -0.16267, 0.01323, 0.06354, -0.0603, 0.1563, 0.12566, 0.16005, 0.17576, -0.00549, 0.06878, 0.15256, -0.04511, -0.15991, 0.0454, 0.00374, 0.35175, -0.0144, -0.43938, -0.04397, -0.12187, -0.13521, 0.10143, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -0.16019, 0.39485, 0.09508, -0.16702, 0.30613, -0.03169, -0.14966, -0.02632, 0.37848, 0.07646, -0.27613, 0.17306, 0.62082, 0.02976, -0.25727, 0.22747, 0.31171, -0.3457, -0.38583, 0.18613, 0.30899, -0.0504, -0.55371, -0.04974, 0.52073, 0.10893, -0.29753, -0.33395, 0.14585, 0.41878, 0.19588, -0.20031, -0.07669, 0.1485, 0.36715, 0.0261, 0.21105, 0.15012, 0.16295, 0.06957, 0.38936, 0.62411, 0.41321, -0.04487, -0.08583, -0.03278, 0.19706, -0.11869, -0.06676, -0.13588, 0.08, 0.26225, 0.27772, 0.01544, -0.116, -0.1253, 0.04507, 0.0082, -0.10101, -0.12513, -0.00077, 0.2418, 0.01123, -0.04508, -0.38109, -0.14313, -0.04503, -0.00296, -0.01288, -0.31856, -0.28985, -0.08699, -0.05844, 0.10125, -0.26019, -0.06976, 0.03854, 0.31031, 0.04304, 0.11242, -0.18188, 0.02647, -0.09254, -0.1109, -0.04358, -0.06659, 0.11211, 0.00028, -0.00635, -0.07396, -0.13876, -0.0771, -0.01788, -0.15226, -0.30139, -0.03172, -0.01861, -0.20118, -0.11896, 0.00462, 0.15647, 0.10384, 0.00779, 0.16842, -0.09132, -0.18294, 0.03463, 0.07926, -0.49044, -0.25658, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, 0.02216, 0.09389, -0.28534, 0.15312, -0.13428, -0.03098, 0.12271, 0.19831, 0.01328, -0.07246, 0.35247, 0.1765, -0.56961, -0.45344, 0.18693, -0.0252, -0.24686, 0.13746, 0.43286, -0.12809, -0.28601, -0.01684, 0.58717, 0.43674, -0.54007, -0.56703, 0.16181, 0.1368, 0.01878, -0.25309, -0.04981, 0.15064, 0.02318, -0.17719, -0.32063, 0.03496, 0.04661, 0.08215, -0.31475, -0.15781, -0.41858, -0.53006, -0.54551, -0.08279, 0.1515, 0.12011, -0.20503, -0.06929, 0.10194, -0.04263, -0.11284, 0.0534, 0.03398, -0.15686, -0.11444, -0.00501, -0.06099, -0.1621, -0.02246, 0.06626, 0.21795, 0.15311, -0.00614, 0.03245, 0.11176, 0.33957, 0.02544, 0.05075, 0.05831, 0.31406, 0.24899, 0.05973, -0.09299, 0.16438, 0.15051, 0.17554, -0.09303, 0.01298, -0.2411, -0.17166, -0.16196, -0.06159, 0.07145, 0.09454, 0.13576, 0.14845, 0.05939, 0.1122, 0.0457, 0.1788, 0.25173, 0.02375, 0.13128, -0.12009, -0.02285, -0.02377, 0.01947, 0.09151, 0.19519, -0.23474, -0.14424, -0.08961, 0.09878, -0.00526, 0.08587, 0.04818, -0.06095, 0.3373, 0.23554, 0.02968, 0.17035, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, 0.1086, 0.12127, 0.03201, -0.10621, 0.11834, 0.10596, -0.14715, -0.17446, 0.09101, 0.19833, -0.16763, -0.28384, 0.37141, 0.47106, -0.0878, -0.05853, 0.4043, 0.11439, -0.36569, -0.07919, 0.34958, 0.04907, -0.50673, -0.45787, 0.28449, 0.62536, -0.07183, -0.16445, -0.19569, 0.03722, 0.10968, -0.12985, -0.09513, 0.14958, 0.42794, 0.21034, -0.04502, -0.05655, 0.11754, 0.30082, 0.25868, 0.37088, 0.59286, 0.28008, -0.08645, -0.05662, 0.24543, 0.28252, -0.0244, 0.04298, -0.09724, -0.06031, 0.05017, 0.11001, 0.16349, 0.08437, 0.0293, 0.04623, -0.12103, -0.39006, -0.40717, -0.18343, -0.09521, -0.07075, -0.15698, -0.47681, -0.24106, -0.163, 0.10478, -0.02758, -0.04408, -0.03489, 0.05625, -0.0655, -0.0017, -0.0607, -0.07367, -0.09071, -0.06712, -0.02337, 0.01247, 0.08093, -0.04776, 0.03771, -0.16317, 0.01126, -0.0671, 0.04713, -0.10719, 0.05974, 0.04766, -0.21712, -0.14693, -0.12074, 0.0718, 0.00103, 0.21421, -0.02628, -0.15222, -0.01643, 0.01637, -0.05882, -0.09691, 0.08782, -0.208, -0.01877, 0.06424, 0.29201, -0.13706, -0.22927, -0.11046, 0.2846, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -0.27457, -0.00488, -0.00843, -0.06885, 0.01647, -0.08322, 0.10369, 0.30947, 0.05731, -0.29783, 0.02217, 0.61263, 0.07701, -0.46793, -0.17965, 0.19197, -0.23054, 0.01787, 0.5196, 0.11873, -0.49411, -0.2584, 0.33282, 0.35267, -0.08237, -0.41638, -0.05189, 0.24469, 0.02657, -0.11173, -0.03575, 0.07662, 0.27413, -0.14535, -0.43588, -0.3757, -0.14825, 0.06083, 0.19836, -0.04747, -0.28325, -0.4897, -0.41466, -0.27774, -0.1164, 0.14345, -0.04268, -0.24652, -0.05425, 0.05344, 0.12007, -0.05663, -0.05288, -0.1857, 0.03783, 0.13898, 0.0557, 0.0398, -0.06189, 0.01576, 0.24865, 0.26663, 0.19827, 0.25661, 0.18338, 0.38718, 0.17183, 0.01306, -0.18631, 0.12543, 0.15714, 0.22895, 0.11676, -0.01077, 0.00012, 0.09277, -0.02924, 0.06645, -0.00171, 0.03714, -0.19912, -0.29836, -0.25545, 0.15032, 0.13881, -0.09328, 0.12678, 0.07036, 0.10228, 0.087, -0.06672, 0.3078, -0.02047, -0.03011, -0.16433, -0.12169, -0.14857, -0.02697, 0.01134, -0.07339, -0.01451, -0.08504, -0.12782, -0.08708, -0.07975, 0.05446, -0.19057, 0.13808, 0.18678, 0.09015, 0.07462, 0.00983, 0.33936, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, 0.06826, 0.36294, 0.06146, -0.14352, 0.10941, 0.31957, 0.10997, -0.08478, -0.00237, 0.27443, -0.01025, -0.49396, -0.25199, 0.33779, 0.31326, -0.26397, 0.00476, 0.09196, -0.20009, -0.13551, 0.53902, 0.3504, -0.22817, -0.45166, -0.12218, 0.28315, 0.10877, -0.24495, -0.1178, 0.15977, 0.05174, -0.13919, -0.3325, -0.02787, 0.30297, 0.53141, 0.2131, -0.03311, -0.22651, -0.24541, 0.16637, 0.33397, 0.35095, 0.49924, 0.23137, -0.11499, -0.18153, 0.19345, 0.16557, -0.11128, -0.04968, 0.01815, -0.04215, 0.05236, 0.01748, 0.15305, 0.01624, 0.02627, 0.24444, -0.12842, -0.27952, -0.25741, -0.30959, -0.23077, -0.22423, -0.26914, -0.35904, -0.15325, -0.04224, -0.20188, -0.32015, 0.02275, -0.10247, 0.12969, -0.12513, -0.01125, -0.09222, -0.01387, -0.20911, 0.02382, -0.07208, 0.24217, 0.00922, -0.20815, -0.04157, -0.05892, 0.10717, 0.14384, 0.01267, -0.22326, 0.07551, -0.00755, -0.02805, -0.11974, -0.1655, -0.14254, -0.03784, 0.09651, -0.02911, -0.11964, -0.20271, -0.19108, 0.16353, -0.03486, -0.1117, -0.14866, -0.15235, 0.15141, 0.13975, 0.23403, -0.23577, -0.02573, 0.09818, 0.11499, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -0.16182, -0.17041, -0.10236, 0.03434, 0.07387, -0.23226, -0.20712, 0.03837, 0.42209, -0.00034, -0.31952, 0.25544, 0.58986, -0.1898, -0.44218, 0.04405, 0.09519, -0.12321, 0.20115, 0.31927, -0.32304, -0.49887, 0.07442, 0.4919, 0.09902, -0.34349, -0.14862, 0.11652, 0.20121, -0.16922, -0.2089, 0.07046, 0.24369, 0.3735, -0.05875, -0.44262, -0.29764, -0.0897, 0.17502, 0.32788, -0.05155, -0.1985, -0.33196, -0.34446, -0.16325, 0.20012, 0.18678, -0.11132, -0.13608, -0.01866, 0.14087, 0.17568, 0.03909, 0.00799, -0.15613, -0.06788, 0.02055, 0.06908, -0.04229, 0.06175, 0.08644, 0.16283, 0.18236, 0.2195, 0.18959, 0.18304, 0.28144, 0.18702, 0.06918, 0.25174, 0.20506, -0.09596, -0.05602, -0.15636, -0.00805, -0.00261, 0.01113, -0.10441, -0.19214, -0.11915, -0.0228, 0.08093, -0.11821, -0.15533, -0.25384, 0.06441, -0.24939, 0.09882, 0.05721, 0.18901, 0.139, 0.08794, -0.0566, -0.10376, -0.037, -0.05376, -0.12955, -0.18451, -0.10118, -0.10019, -0.09969, -0.06128, -0.18358, 0.2204, 0.17763, 0.05793, -0.08102, -0.12724, 0.15765, 0.04046, -0.04445, -0.27771, -0.31916, 0.06983, 0.07598, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, 0.0177, 0.19543, 0.1133, -0.22638, -0.14208, 0.14231, 0.19854, 0.03761, -0.14807, 0.14479, 0.39423, 0.03472, -0.45182, 0.07882, 0.43278, 0.1867, -0.05168, 0.05489, -0.13659, -0.30335, 0.20348, 0.57693, 0.05897, -0.43571, -0.24785, 0.14569, 0.2767, -0.10479, -0.34058, -0.0653, 0.23464, 0.13103, -0.14882, -0.36019, -0.11624, 0.21031, 0.29602, 0.11128, -0.0778, -0.19596, -0.12823, 0.1156, 0.28136, 0.1882, 0.15362, 0.16665, 0.03678, -0.02059, 0.25806, 0.13452, -0.11111, -0.14008, -0.04317, -0.12436, -0.01811, -0.09472, 0.03108, -0.01114, -0.01287, -0.0187, -0.05197, -0.0983, -0.16656, -0.1876, -0.20808, -0.0902, -0.18323, -0.10704, -0.03554, -0.07471, -0.26185, -0.05, 0.15726, 0.12303, -0.01963, -0.17464, -0.06226, 0.01423, -0.03724, 0.06726, 0.03626, -0.03954, 0.04471, 0.16694, 0.01502, -0.1548, -0.05878, -0.04184, 0.11603, 0.11637, -0.23088, -0.37921, -0.178, 0.08613, -0.01487, 0.00629, -0.06967, 0.15667, -0.01065, 0.00374, -0.11632, 0.00765, -0.04344, -0.28699, -0.0238, 0.0999, -0.03807, -0.06028, -0.02456, -0.0881, -0.00179, 0.01967, -0.0926, 0.00546, -0.05349, 0.02493, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, 0.0359, -0.12915, -0.14393, 0.13771, 0.16945, 0.08407, -0.18452, -0.00072, 0.08245, 0.10056, -0.18052, -0.17076, 0.53373, 0.22652, -0.31394, -0.32141, 0.04344, 0.05176, 0.05181, 0.23134, 0.00745, -0.51471, -0.19216, 0.30766, 0.3097, -0.1207, -0.38075, 0.12714, 0.27477, 0.24456, -0.11424, -0.24166, -0.02183, 0.21656, 0.36431, -0.00185, -0.28695, -0.23206, -0.01327, 0.13356, 0.15391, -0.02534, -0.20316, -0.03993, -0.07032, -0.05032, 0.06283, 0.09851, -0.16001, -0.06016, 0.09953, 0.1286, 0.16482, 0.06484, 0.17086, 0.15046, 0.1182, 0.07889, 0.01043, -0.00875, 0.01846, 0.11542, 0.16053, 0.2861, 0.23063, 0.08391, 0.0979, 0.06615, -0.04841, 0.11486, 0.16909, 0.26046, -0.19795, -0.19676, -0.29926, 0.19578, 0.09753, 0.16767, -0.04486, -0.19827, -0.24013, 0.11751, -0.01076, -0.07243, -0.19799, -0.06156, -0.08266, -0.21243, -0.01675, -0.08367, 0.00321, 0.18682, 0.15938, -0.21853, -0.25388, -0.07281, -0.08638, -0.09745, -0.13443, -0.04031, 0.01488, -0.24531, -0.1657, -0.18331, 0.15742, 0.11769, -0.01319, 0.12399, 0.17587, 0.12948, 0.1652, 0.15403, -0.1666, -0.14265, -0.14288, -0.04948, -0.04788, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -0.02197, 0.17658, 0.20705, -0.12129, -0.17549, -0.06158, 0.09488, -0.0297, -0.10745, -0.22453, 0.12178, 0.28329, -0.34125, -0.41733, 0.31001, 0.45979, 0.05381, 0.04003, -0.06217, -0.25353, -0.09717, 0.33214, 0.30405, -0.08929, -0.28785, 0.00213, 0.34537, 0.20594, -0.19392, -0.24028, -0.03673, 0.16318, 0.04146, -0.06282, -0.13805, 0.05517, 0.20679, 0.16772, -0.02144, -0.23082, -0.20714, -0.02612, 0.21928, 0.11775, -0.0773, -0.10295, -0.05563, -0.08944, 0.05164, 0.09658, -0.09619, -0.01546, -0.12097, -0.14692, -0.15358, -0.13549, -0.21755, -0.02176, -0.07183, 0.00403, 0.00177, -0.13672, -0.12004, -0.16769, -0.20298, 0.04025, -0.02259, -0.05774, 0.15869, 0.16506, 0.03219, -0.18956, -0.00169, 0.14906, 0.26425, -0.14957, -0.18895, -0.01187, -0.02648, 0.059, 0.03891, 0.07859, 0.10675, 0.00231, 0.09692, 0.02036, -0.20564, 0.24202, -0.07436, 0.02204, 0.07691, 0.02109, -0.11933, -0.04892, 0.00878, -0.08819, -0.06557, -0.11735, 0.01731, 0.0455, 0.1244, 0.26468, 0.17518, 0.08876, -0.19146, -0.21127, -0.00718, 0.137, -0.08476, 0.08279, 0.06536, -0.08535, 0.02954, 0.03223, 0.15597, -0.12559, -0.02768, -0.02301, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -0.03526, 0.10515, -0.239, -0.0063, 0.28912, 0.13496, -0.11575, 0.00989, 0.33162, 0.21361, -0.17624, -0.18852, 0.14818, 0.44572, -0.03498, -0.34334, -0.16989, 0.03967, 0.17079, 0.18492, 0.31162, -0.27394, -0.30782, -0.02163, 0.19183, 0.00909, -0.353, -0.30939, 0.10396, 0.22686, 0.14116, 0.00626, -0.06208, 0.01872, 0.05382, -0.01292, -0.14914, -0.19238, -0.06687, 0.11162, 0.09137, 0.05112, -0.10052, -0.02763, 0.10971, 0.08008, 0.12377, 0.10246, -0.11353, -0.27706, 0.05685, 0.10722, 0.12889, 0.0824, 0.01864, 0.01054, 0.08314, 0.04621, 0.02328, 0.02514, 0.06273, 0.17396, 0.13501, 0.06251, 0.11811, 0.13717, 0.00333, 0.10391, 0.09098, 0.11232, 0.08696, 0.20293, 0.10059, 0.04231, -0.13518, 0.00647, 0.05397, 0.0306, 0.06489, 0.13466, -0.13199, 0.02137, 0.02597, 0.05023, -0.03644, 0.06353, 0.04016, -0.07567, 0.06888, 0.00025, -0.23182, -0.36524, -0.11585, 0.02212, -0.12703, -0.08476, -0.09893, -0.09685, -0.26983, -0.13286, -0.05728, -0.19503, -0.04262, -0.01794, 0.02453, 0.03762, 0.03477, -0.10136, 0.0028, 0.10416, 0.114, 0.02651, -0.06316, 0.07121, -0.06501, -0.08908, -0.0376, -0.20903, -0.0728, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, 0.03906, -0.06556, 0.17389, 0.16276, -0.24917, -0.1159, 0.17753, 0.10463, -0.14208, -0.18727, 0.00388, 0.23985, 0.05015, -0.42622, -0.16167, 0.38398, 0.20995, -0.06857, -0.07297, -0.18029, -0.28328, 0.13293, 0.22378, 0.12865, -0.15495, -0.03145, 0.23371, 0.30764, 0.00851, -0.15423, -0.1301, 0.05331, 0.0919, 0.11041, -0.11999, 0.05587, 0.22864, 0.2378, 0.07378, -0.0556, -0.08079, -0.08108, 0.07392, 0.18465, 0.10526, -0.14929, -0.17893, -0.14958, -0.01388, 0.24239, 0.04025, -0.18767, -0.15833, -0.13382, -0.00937, -0.03351, -0.15952, -0.10765, -0.17486, -0.21461, -0.06897, -0.02239, -0.09492, 0.01995, -0.09735, -0.06147, 0.04455, -0.11941, 0.0459, 0.15197, 0.01779, 0.04033, -0.00794, 0.03812, 0.01506, -0.05154, 0.11173, 0.09465, -0.178, -0.02879, -0.0575, -0.00381, -0.14629, 0.06342, 0.03766, -0.02135, -0.15757, -0.14087, 0.02753, -0.0676, -0.006, 0.01719, 0.04469, -0.06529, 0.10884, 0.01631, -0.00801, 0.01276, 0.03973, 0.03877, -0.12739, -0.04038, -0.03514, -0.01149, 0.16042, -0.00992, -0.01852, 0.00421, 0.03087, 0.07352, -0.07566, 0.17139, 0.22493, -0.01503, 0.11573, 0.0591, -0.08588, 0.1133, -0.08036, 0.09405, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -0.18926, 0.16882, -0.01872, -0.25794, 0.10486, 0.2242, -0.07926, -0.19253, 0.22208, 0.31125, 0.01094, -0.24566, 0.02975, 0.38128, 0.22806, -0.23247, -0.27183, 0.0134, 0.1392, 0.15532, 0.16026, 0.08001, -0.16705, -0.04643, 0.10047, 0.11178, -0.07572, -0.26005, -0.05939, 0.12538, 0.16229, -0.10892, -0.18412, -0.13824, 0.1887, -0.02339, -0.20306, -0.22801, -0.12733, -0.04156, 0.10446, -0.04854, -0.22671, -0.1977, -0.01802, 0.15884, 0.14582, 0.18587, 0.15974, -0.16822, -0.17714, 0.02724, 0.18472, -0.01771, 0.09144, 0.13232, 0.18036, 0.18043, 0.14841, 0.17144, 0.01769, -0.02871, 0.06939, 0.23221, 0.06853, 0.02014, -0.04818, 0.0096, -0.04149, -0.00874, 0.04806, 0.16341, -0.03097, -0.0219, -0.0647, 0.02281, 0.05424, -0.03778, -0.06347, 0.05943, 0.17949, 0.27331, 0.20357, 0.17308, 0.05367, 0.08357, -0.02565, 0.01374, -0.06425, 0.15125, -0.01845, -0.00762, -0.21958, -0.13306, -0.08744, -0.06747, 0.00561, -0.02284, -0.17738, -0.19735, -0.0972, -0.07175, 0.12097, 0.00912, 0.07988, 0.1214, -0.02761, 0.02526, -0.08763, 0.04758, 0.14815, -0.06865, -0.06312, -0.04594, 0.08461, 0.02608, -0.00134, -0.00505, 0.00903, -0.08861, -0.01365, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, 0.17282, 0.00616, -0.08447, 0.29711, -0.00191, -0.22655, 0.01786, 0.21929, -0.08389, -0.16652, -0.11097, 0.11903, 0.07892, -0.21592, -0.08604, 0.13422, 0.25418, 0.03952, -0.20257, -0.09573, -0.1034, -0.21099, 0.10784, -0.02142, -0.10309, -0.20835, 0.04398, 0.22915, 0.11871, -0.07482, -0.13107, 0.08628, 0.16116, 0.21904, -0.065, -0.0821, 0.02681, 0.21328, 0.08621, -0.03194, -0.10219, 0.16157, 0.29596, 0.24339, 0.15238, 0.06387, -0.18238, -0.1965, -0.15354, -0.02363, 0.21211, 0.1383, -0.03659, -0.0282, -0.20713, -0.07451, -0.11532, -0.15327, -0.04016, -0.13048, -0.21476, -0.03161, 0.0102, -0.16666, -0.02713, -0.04859, 0.00888, 0.01992, -0.04265, -0.00796, 0.04927, -0.02704, 0.05242, 0.15595, 0.12293, 0.00485, -0.1969, -0.03179, 0.04299, -0.12577, -0.22753, -0.19189, -0.15984, -0.2224, 0.03964, 0.0642, -0.02653, -0.01166, -0.06349, -0.13702, -0.06647, 0.00446, -0.1099, -0.12004, -0.07012, 0.05835, 0.00092, -0.02717, 0.06772, 0.1155, 0.07332, 0.04606, -0.16896, -0.26965, -0.08047, -0.17633, 0.06077, 0.00025, 0.15245, 0.14333, 0.08997, -0.04969, -0.01767, 0.13838, 0.03612, 0.02885, 0.0555, 0.02033, 0.11373, 0.06508, 0.03702, -0.01203, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -0.22074, -0.01401, 0.14385, -0.13632, -0.02385, 0.12655, 0.04085, -0.2548, -0.06548, 0.2665, 0.10326, -0.11384, -0.14491, 0.23776, 0.21397, -0.01647, -0.21292, -0.03666, 0.12864, 0.11941, 0.10527, 0.07486, -0.02351, 0.0446, 0.13758, 0.19316, -0.01542, -0.11581, -0.16376, 0.14921, 0.12512, 0.07916, -0.11728, -0.12317, 0.00986, 0.10777, -0.01283, -0.22682, -0.10894, -0.01473, 0.02505, -0.07212, -0.25716, -0.35309, -0.26689, -0.04001, 0.18553, 0.11149, 0.14513, 0.08255, -0.06315, -0.1169, 0.01958, 0.14094, 0.15006, 0.01634, 0.0704, 0.23577, 0.14972, 0.19971, 0.11072, 0.07542, -0.01757, -0.01975, 0.10416, 0.1964, 0.04972, 0.02201, 0.03177, 0.03157, -0.00174, -0.02024, -0.03891, -0.09626, -0.14945, -0.11023, 0.12644, 0.18229, 0.01576, -0.07571, -0.09968, 0.31421, 0.17367, 0.20499, -0.07431, -0.04384, 0.16927, -0.07417, -0.08154, 0.00137, 0.08475, -0.13803, 0.00818, -0.10119, 0.06098, -0.12273, -0.13512, 0.07052, 0.03739, -0.13748, -0.12002, -0.01814, 0.1098, 0.1892, 0.03074, 0.16636, 0.01386, -0.01743, -0.05769, -0.09264, -0.00308, 0.13963, 0.07751, -0.18065, 0.01118, 0.1157, -0.08675, -0.08577, 0.11371, 0.0269, 0.17549, -0.02469, 0.07236, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, 0.13724, 0.0732, -0.14371, 0.02505, 0.11669, -0.09135, -0.10104, 0.22136, 0.18664, -0.21848, -0.10439, 0.07693, 0.12242, -0.09375, -0.18104, 0.14956, 0.17557, 0.1961, -0.05422, -0.26136, -0.06485, -0.04662, 0.0011, 0.0002, -0.13895, -0.21594, -0.0823, 0.12741, 0.19191, -0.10895, -0.17992, -0.16884, 0.09554, 0.15619, 0.01908, -0.06532, -0.02599, 0.15386, 0.27495, -0.00328, -0.09431, -0.08935, 0.18647, 0.40636, 0.2965, 0.02515, -0.04273, -0.09905, -0.01333, -0.13675, -0.02703, 0.07445, -0.03677, -0.02227, 0.03779, -0.02464, 0.05131, -0.0928, -0.16094, -0.04581, -0.04499, -0.00849, -0.0554, 0.06999, -0.01977, -0.09444, -0.08773, 0.00645, -0.02447, -0.05844, 0.04741, 0.11272, -0.05107, 0.07582, 0.04916, 0.04359, -0.13191, -0.29349, -0.10695, 0.01564, 0.01407, -0.06468, -0.03368, 0.02488, -0.23032, 0.02306, -0.05827, 0.00075, -0.09236, 0.05604, -0.02511, -0.0778, -0.08859, -0.18457, -0.18153, 0.00924, 0.10149, -0.034, -0.01856, 0.01342, 0.10417, 0.08617, 0.14766, -0.02943, -0.00293, -0.07288, 0.09596, 0.02018, -0.0536, 0.14858, 0.03962, -0.08832, -0.01969, -0.10525, 0.05654, -0.03979, -0.046, 0.08735, -0.01006, -0.07804, 0.1734, 0.10811, -0.04382, -0.1079, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -0.119, 0.022, 0.05517, 0.01828, -0.08866, 0.16088, 0.1384, -0.14515, -0.14127, 0.13765, 0.07167, -0.09416, -0.14578, 0.0267, 0.20759, -0.10135, -0.23535, -0.17646, 0.08282, 0.19096, 0.17275, 0.07582, -0.06872, 0.01138, 0.07908, 0.21964, 0.20903, -0.07468, -0.21352, -0.03498, 0.19771, 0.15451, -0.07279, -0.13302, -0.04955, 0.14808, 0.05698, -0.12239, -0.28302, -0.03541, 0.08776, 0.13681, -0.12779, -0.31011, -0.36013, -0.15193, -0.03646, -0.05611, -0.07479, 0.0221, -0.0249, -0.10709, 0.00194, -0.07878, 0.01119, 0.03654, -0.10186, 0.00892, 0.106, 0.08618, 0.09491, 0.08006, 0.11377, 0.06828, -0.07168, -0.04561, 0.09225, 0.04902, 0.04171, 0.10833, 0.04396, -0.04064, 0.00732, 0.01968, -0.02411, -0.00055, 0.07179, 0.27809, 0.19658, 0.06343, -0.15658, -0.11446, 0.00722, 0.09582, 0.14752, -0.16244, -0.06572, 0.15234, 0.01727, -0.02107, -0.0918, -0.09735, -0.13106, 0.039, -0.13966, -0.05789, -0.06133, 0.02279, 0.07874, 0.00729, -0.08406, -0.13459, -0.10945, -0.0546, 0.2148, 0.05149, 0.08496, 0.17064, 0.09464, -0.00171, 0.05525, 0.01518, 0.08169, 0.06309, 0.02391, -0.00519, 0.09874, -0.1541, -0.11454, -0.02087, 0.13088, -0.15952, 0.07516, 0.03214, -0.13218, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, 0.12907, 0.08856, -0.0512, -0.01951, 0.06957, -0.10008, -0.22479, 0.02486, 0.28336, -0.03078, -0.16787, 0.00873, 0.06364, -0.00911, -0.07389, 0.13277, 0.21998, 0.11606, 0.03091, -0.18026, -0.22113, -0.01306, 0.0665, -0.0155, -0.01575, -0.06526, -0.18242, 0.03013, 0.16351, 0.1004, -0.17631, -0.26122, -0.01738, 0.23005, 0.1269, -0.08279, -0.10589, 0.04557, 0.24295, 0.19143, -0.12373, -0.1413, -0.01748, 0.18518, 0.3783, 0.20608, -0.01514, -0.00851, 0.03274, -0.02734, -0.0548, 0.06253, 0.02575, -0.06888, -0.0944, -0.0179, 0.0335, 0.13095, -0.02985, -0.08072, -0.13795, -0.03847, -0.06619, 0.0391, 0.13698, 0.12593, -0.05433, -0.05382, -0.03675, 0.01519, 0.01087, 0.0375, 0.10772, 0.01554, 0.01773, -0.0927, -0.00123, -0.14062, -0.22234, -0.12189, 0.04222, 0.09605, -0.05798, 0.04817, -0.01411, -0.03853, -0.09465, -0.17559, -0.07218, 0.02437, 0.25, 0.19662, 0.10406, -0.22556, -0.12103, -0.19589, 0.08673, 0.06005, 0.0197, 0.10854, -0.14237, -0.02692, -0.08877, 0.10477, -0.01955, -0.02826, 0.0137, 0.03466, 0.13404, -0.02762, -0.06824, -0.0055, -0.18182, -0.01286, -0.03398, 0.02621, 0.0125, 0.06325, 0.00731, -0.0196, 0.05004, -0.0063, 0.03854, -0.12701, 0.00932, 0.02411, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -0.14838, 0.02454, 0.04701, -0.03682, -0.0342, 0.01758, 0.2055, -0.00373, -0.20539, 0.0833, 0.11323, -0.00025, -0.04827, 0.05913, 0.09484, -0.00198, -0.183, -0.12999, -0.06805, 0.07373, 0.10035, 0.05678, -0.05294, -0.03908, -0.00732, -0.03233, 0.13516, 0.07575, -0.01941, -0.07215, 0.07481, 0.2509, 0.09887, -0.18542, -0.23172, -0.01967, 0.13296, 0.03277, -0.18933, -0.21522, 0.09863, 0.13712, 0.084, -0.13796, -0.33047, -0.24719, 0.05614, 0.01595, -0.08727, -0.14296, 0.04787, -0.05445, -0.06177, -0.05411, 0.00416, 0.01188, -0.03235, -0.14469, -0.0353, 0.08152, 0.12703, 0.11646, 0.01752, 0.02253, -0.00011, -0.06471, -0.04787, 0.02762, 0.10297, 0.04169, -0.00239, -0.00203, -0.02994, 0.03473, -0.06871, 0.09851, -0.00984, 0.10781, 0.19726, 0.11562, -0.00267, 0.02559, 0.07558, 0.10735, -0.05712, -0.11089, -0.12332, 0.07664, 0.09588, -0.04351, -0.18312, -0.05968, -0.07094, -0.02166, -0.03177, -0.00238, -0.14468, -0.13669, -0.061, 0.04314, 0.20318, 0.01589, 0.02653, -0.09515, 0.02145, 0.08021, 0.02965, 0.15012, 0.09501, 0.10368, 0.12809, -0.008, 0.13359, -0.09547, 0.09402, 0.01911, 0.02647, 0.08081, -0.0915, 0.00406, 0.03794, -0.04598, -0.11726, -0.09834, 0.09721, -0.20718, -0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, 0.11821, 0.16115, 0.02134, 0.05785, 0.02959, 0.12744, -0.15307, -0.08975, 0.21746, 0.03661, -0.16494, -0.07821, 0.12801, -0.06682, -0.12271, -0.0378, 0.21493, 0.13754, 0.12641, 0.00251, -0.10425, -0.1227, 0.0566, 0.07062, -0.03819, 0.03666, -0.02625, -0.10514, -0.00613, 0.12446, 0.02437, -0.25648, -0.24457, 0.13344, 0.22967, 0.05146, -0.11379, -0.07839, 0.04066, 0.17485, -0.00269, -0.08658, -0.06297, 0.10947, 0.23193, 0.22798, -0.00034, -0.03873, 0.08712, 0.08965, -0.12351, -0.07575, 0.00567, 0.04924, -0.00916, -0.03006, -0.06619, 0.04507, 0.06148, -0.08155, -0.07634, -0.11195, -0.06036, 0.11769, -0.0405, 0.04719, 0.02479, -0.05918, 0.00325, -0.05251, 0.0529, -0.00826, 0.03666, -0.01834, 0.08768, -0.05637, -0.03555, -0.02582, -0.01163, -0.0225, 0.00694, 0.01074, -0.04793, -0.00151, 0.07257, 0.11967, 0.00836, -0.08437, -0.112, -0.03695, -0.01342, 0.11511, 0.04768, -0.01772, -0.00309, -0.1004, -0.00783, 0.05986, 0.15467, 0.15623, -0.13507, -0.07453, -0.04615, -0.08258, 0.01305, -0.06836, 0.07323, -0.15754, 0.04481, 0.12739, 0.00346, -0.0016, -0.20819, -0.18727, -0.00591, -0.09127, 0.14085, -0.01356, 0.07085, -0.08958, 0.02101, 0.04564, 0.10074, -0.08415, 0.03633, -0.03194, -0.03108, -0.05205, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -0.16823, -0.08476, -0.04932, 0.01595, 0.02533, -0.141, 0.09884, 0.09949, -0.05543, -0.04081, 0.108, -0.00517, -0.14106, 0.10163, 0.17329, 0.13056, -0.19149, -0.10482, -0.08343, -0.01845, 0.10622, 0.06192, -0.10567, -0.04646, 0.02881, 0.00707, -0.00657, 0.04816, 0.02646, -0.08346, -0.01358, 0.14738, 0.23801, -0.01826, -0.19076, -0.06044, 0.0555, 0.13121, 0.02615, -0.10355, -0.1028, 0.04826, 0.06893, -0.07118, -0.1703, -0.15036, -0.06181, 0.03113, 0.03037, -0.07268, -3e-05, 0.07056, 0.06583, -0.00836, -0.01939, -0.01248, 0.11165, 0.04141, -0.09587, 0.06904, 0.03923, 0.13255, 0.19205, 0.09542, 0.0533, 0.1152, 0.0123, 0.02296, -0.02726, 0.12247, 0.0079, -0.01146, -0.11008, -0.0022, -0.05232, -0.05251, 0.11072, 0.03606, -0.0097, 0.00738, -0.0583, -0.05937, 0.03171, 0.05271, 0.12051, -0.00183, -0.11827, -0.05687, 0.09454, 0.18897, 0.08103, -0.15883, -0.10085, -0.03752, -0.03238, -0.01048, -0.01944, -0.04056, -0.1432, -0.16566, 0.04109, 0.11975, 0.0051, 0.03521, -0.10545, -0.00592, -0.10987, 0.16241, 0.05079, -0.06408, -0.0121, -0.03317, 0.18196, 0.20248, -0.00489, 0.03826, -0.00709, -0.06977, 0.02357, -0.05055, -0.10482, 0.11772, 0.07846, -0.03692, -0.06593, 0.01458, -0.00564, -0.0814, 0.01011, 0.0, 0.0, 0.0, 0.0, 0.0, ],
[0.0, 0.09843, 0.06268, 0.05661, 0.00336, -0.00498, 0.00792, 0.02203, -0.08132, 0.10621, 0.13471, -0.09551, -0.1047, 0.0659, 0.05819, -0.12139, -0.14571, 0.13065, 0.17185, -0.0222, -0.01028, 0.01005, -0.07496, 0.10414, 0.03195, -0.01358, -0.05015, 0.04191, 0.06352, -0.00656, 0.03488, 0.02737, -0.06831, -0.19136, -0.08647, 0.15914, 0.05021, -0.12647, -0.08329, 0.03455, 0.05089, -0.01649, -0.08877, -0.03592, 0.04264, 0.17749, 0.06891, -0.04693, -0.07449, 0.00638, 0.11679, 0.0778, -0.0959, -0.08226, -0.01528, 0.00252, -0.01985, -0.06081, -0.06582, 0.05357, -0.01233, -0.02214, -0.09531, -0.17161, -0.0993, -0.01029, -0.03834, -0.0124, -0.11544, -0.08744, -0.01673, -0.02748, 0.00168, 0.06555, 0.08501, 0.02276, 0.08531, -0.05886, -0.03343, -0.05097, 0.07264, 0.08682, 0.11047, 0.0465, -0.03874, -0.115, 0.03709, -0.03064, -0.04752, -0.03902, -0.07365, -0.08342, 0.10768, 0.08954, 0.00546, -0.05934, -0.05885, 0.0481, -0.03505, 0.00043, 0.00433, 0.02414, -0.05614, -0.02675, -0.02452, -0.012, -0.0253, 0.10422, -0.05615, 0.04535, 0.09025, 0.10526, 0.14875, -0.07972, -0.12881, 0.02697, 0.03585, 0.03623, 0.01308, -0.00614, 0.03516, 0.08128, -0.14892, -0.07301, -0.06795, 0.08161, -0.07464, -0.00156, -0.00534, -0.25228, -0.07363, 0.0, 0.0, 0.0, 0.0, ],
[0.0, -0.04703, 0.0398, -0.08735, -0.06155, 0.08718, 0.03057, -0.05938, 0.08014, -0.03902, -0.08924, 0.1371, 0.097, -0.08872, -0.09011, 0.11558, 0.17542, -0.05552, -0.12582, -0.02453, -0.01225, 0.04782, 0.10526, -0.10548, -0.00581, 0.03157, 0.04353, -0.03295, -0.06889, -0.00521, -0.04236, -0.02612, 0.0643, 0.1152, 0.16671, -0.11646, -0.07995, 0.06593, 0.07714, -0.01076, 0.01095, -0.01486, 0.0279, 0.0222, 0.01126, -0.12146, -0.12376, 0.10591, 0.08113, -0.02703, -0.07532, -0.06279, 0.0168, 0.00657, 0.03648, 0.07334, 0.0225, 0.05997, 0.13096, -0.01123, -0.03417, 0.0449, 0.0812, 0.12931, 0.17182, 0.11938, 0.04418, 0.0078, -0.00217, 0.07061, 0.02483, 0.12257, -0.01024, -0.12053, -0.16243, 0.06619, -0.09971, -0.05381, 0.07164, 0.05697, 0.03233, -0.00862, -0.08022, -0.09332, -0.01021, -0.02008, 0.0912, 0.02595, 0.0366, -0.02425, 0.13883, 0.11245, 0.08482, -0.0281, -0.05315, 0.07914, 0.03622, -0.08313, 0.03685, 0.07972, -0.05282, -0.06221, 0.05147, 0.02203, -0.03601, 0.00804, -0.04288, -0.06779, -0.00773, 0.12519, 0.00256, -0.09499, -0.16149, -0.04538, -0.03621, 0.19639, 0.07367, 0.09762, 0.07206, -0.0152, -0.0346, -0.09222, -0.05311, 0.12235, 0.04819, -0.18725, -0.00713, 0.0732, -0.0427, -0.0125, 0.18539, 0.08542, 0.0, 0.0, 0.0, ],
[0.0, 0.02876, 0.04677, 0.06119, 0.09143, 0.02438, -0.01033, 0.00784, -0.05549, 0.09212, 0.12152, -0.10842, -0.15598, 0.05455, 0.09494, -0.02503, -0.08966, -0.01778, 0.10544, 0.05873, -0.05063, -0.03868, -0.05967, 0.06181, 0.05172, -0.07516, -0.03907, -0.00501, 0.09697, 0.10666, 0.09633, 0.03457, -0.06426, -0.06213, -0.16328, 0.07474, 0.13414, -0.03573, -0.1736, -0.07252, 0.0513, 0.00324, -0.1156, -0.11762, -0.03233, 0.04038, 0.18372, 0.00584, -0.12287, -0.04326, 0.06437, 0.15088, 0.05402, -0.08324, -0.08155, -0.08519, -0.05919, -2e-05, -0.14849, -0.0377, 0.05276, -0.01305, -0.03205, -0.0946, -0.0913, -0.13076, -0.00349, -0.06338, 0.01921, -0.08153, -0.03461, -0.00042, 0.04242, 0.03964, 0.10528, -0.00778, 0.00549, 0.02393, -0.01159, 0.05462, -0.02965, 0.03384, 0.1039, 0.15907, 0.02807, 0.02148, -0.0495, -0.00347, -0.05721, -0.09706, -0.02854, -0.11649, -0.02307, -0.07511, -0.03235, -0.05284, -0.14209, -0.03569, 0.042, -0.00361, -0.05341, -0.0627, 0.02978, 0.01399, 0.01693, -0.04142, -0.05857, -0.15571, -0.12237, -0.1144, 0.0675, 0.10089, 0.20181, 0.04385, 0.02832, -0.09552, -0.03108, 0.05268, -0.03728, -0.02859, 0.05314, 0.01597, 0.04956, -0.06613, -0.07841, -0.10894, -0.01524, 0.00071, 0.01163, -0.02641, -0.15279, -0.08879, -0.01401, 0.0, 0.0, ],
[0.0, -0.01675, 0.03365, -0.02792, -0.07133, -0.0673, 0.009, 0.06102, 0.01467, 0.04763, -0.09098, 0.01601, 0.12655, -0.05973, -0.07554, 0.00101, 0.12453, 0.03006, -0.03742, 0.02917, -0.01498, 0.00208, 0.08156, -0.03716, -0.09522, 0.02149, 0.03962, 0.01427, -0.09624, -0.11829, -0.1033, -0.06975, 0.06321, 0.08668, 0.10646, 0.01236, -0.10505, -0.00876, 0.16391, 0.17298, 0.03144, -0.01816, 0.06766, 0.11754, 0.03834, -0.03279, -0.11852, -0.08266, 0.11634, 0.07895, -0.0401, -0.12706, -0.09947, 0.09261, 0.02948, -0.03826, 0.01653, -0.03572, 0.00467, 0.04747, -0.04112, -0.07158, 0.01556, 0.10846, 0.11734, 0.13431, 0.09771, 0.04465, -0.04801, 0.00498, 0.04128, 0.0205, 0.0962, -0.01269, -0.04242, -0.07412, -0.00389, -0.00313, -0.09134, -0.05039, 0.02447, 0.00123, 0.04756, -0.10823, 0.0083, -0.04547, -0.0464, -0.06297, 0.01564, 0.05744, 0.09931, 0.07005, 0.02679, 0.13401, 0.06899, 0.03786, 0.06296, 0.07212, -0.09498, -0.01142, -0.03047, -0.01732, -0.09313, -0.03153, 0.0338, -0.0062, -0.02627, 0.02555, 0.11463, -0.01063, -0.10637, -0.04506, -0.10615, -0.03216, -0.05006, -0.06548, 0.02582, 0.06676, 0.00831, 0.05684, 0.05972, 0.01867, -0.01847, -0.06465, 0.03124, 0.06373, 0.0071, 0.04147, 0.03731, -0.09357, -0.14005, 0.06715, 0.0842, 0.08255, 0.0, ],
[0.0, -0.00844, 0.02619, 0.04699, 0.05321, 0.06913, -0.01571, 0.04031, 0.01788, -0.04175, 0.13261, 0.05407, -0.15857, -0.01909, 0.04945, 0.00565, -0.08107, 0.02767, 0.05448, -0.03635, -0.06565, -0.05378, -0.06417, 0.00415, 0.16294, 0.02724, -0.07803, -0.06459, 0.07266, 0.08208, 0.11391, 0.05366, -0.06485, -0.11165, -0.04047, -0.02953, 0.06767, 0.05259, -0.06376, -0.14385, -0.14221, -0.01937, -0.02788, -0.11072, -0.04462, -0.003, 0.00503, 0.10707, -0.04364, -0.11775, -0.0377, 0.02452, 0.1701, 0.00913, -0.01147, 0.01015, 0.02599, 0.06052, -0.00218, -0.04429, -0.03891, 0.00444, -0.03225, -0.0173, -0.09872, -0.0892, -0.06903, -0.07748, 0.02574, 0.00107, -0.06888, 0.01887, -0.04962, -0.034, 0.02648, 0.03484, 0.04912, 0.03213, -0.00719, 0.08471, 0.05851, 0.04009, -0.11097, -0.00178, 0.00791, 0.00673, 0.04014, 0.01584, 0.06952, -0.03039, -0.05125, -0.1179, -0.03819, -0.12233, 0.06749, 0.03456, -0.02092, -0.03426, 0.02538, 0.12073, 0.0242, 0.03533, -0.13139, 0.02662, -0.04349, 0.00857, 0.01931, -0.01057, -0.15476, -0.01576, 0.04189, 0.0344, 0.02443, 0.00378, 0.01113, 0.00558, -0.04184, -0.04901, 0.0494, 0.11032, -0.03473, -0.11145, -0.11351, 0.0218, -0.02304, -0.03787, -0.15172, 0.00869, 0.04001, -0.00163, 0.01104, -0.03348, -0.05628, -0.04641, 0.03121, ],
])
| 951.032491 | 1,277 | 0.546061 |
52c50df36fbe13b139fcf0e0ab434654ac62fba6 | 237 | lua | Lua | MMOCoreORB/bin/scripts/object/custom_content/tangible/food/generic/drink_ruby_bliel.lua | V-Fib/FlurryClone | 40e0ca7245ec31b3815eb6459329fd9e70f88936 | [
"Zlib",
"OpenSSL"
] | 18 | 2017-02-09T15:36:05.000Z | 2021-12-21T04:22:15.000Z | MMOCoreORB/bin/scripts/object/custom_content/tangible/food/generic/drink_ruby_bliel.lua | V-Fib/FlurryClone | 40e0ca7245ec31b3815eb6459329fd9e70f88936 | [
"Zlib",
"OpenSSL"
] | 61 | 2016-12-30T21:51:10.000Z | 2021-12-10T20:25:56.000Z | MMOCoreORB/bin/scripts/object/custom_content/tangible/food/generic/drink_ruby_bliel.lua | V-Fib/FlurryClone | 40e0ca7245ec31b3815eb6459329fd9e70f88936 | [
"Zlib",
"OpenSSL"
] | 71 | 2017-01-01T05:34:38.000Z | 2022-03-29T01:04:00.000Z | object_tangible_food_generic_drink_ruby_bliel = object_tangible_food_generic_shared_drink_ruby_bliel:new {
}
ObjectTemplates:addTemplate(object_tangible_food_generic_drink_ruby_bliel, "object/tangible/food/generic/drink_ruby_bliel.iff")
| 237 | 237 | 0.907173 |
d7d03b9779c512324068ddc3ff52f71024475ae2 | 787 | c | C | Chapter10_Structs/Structs/Main.c | itsmeRoland/UdemyC | 27b460377178d28ab8f32257771e09ce5300e03f | [
"MIT"
] | null | null | null | Chapter10_Structs/Structs/Main.c | itsmeRoland/UdemyC | 27b460377178d28ab8f32257771e09ce5300e03f | [
"MIT"
] | null | null | null | Chapter10_Structs/Structs/Main.c | itsmeRoland/UdemyC | 27b460377178d28ab8f32257771e09ce5300e03f | [
"MIT"
] | 1 | 2022-02-11T09:09:39.000Z | 2022-02-11T09:09:39.000Z | #include <stdio.h>
struct Friend
{
char name[50];
char prename[50];
unsigned int year;
unsigned int month;
unsigned int day;
};
int main()
{
struct Friend jan = {.name = "Schaffranek", .prename = "Jan", .year = 1994U, .month = 2U, .day = 24U};
struct Friend peter = {.name = "Lustig", .prename = "Peter", .year = 1959U, .month = 8U, .day = 13};
struct Friend hans = {.name = "Meier", .prename = "Hans", .year = 1970U, .month = 12U, .day = 31};
printf("%s\n", jan.name);
printf("%s\n", jan.prename);
printf("%u\n", jan.year);
printf("%s\n", peter.name);
printf("%s\n", peter.prename);
printf("%u\n", peter.year);
printf("%s\n", hans.name);
printf("%s\n", hans.prename);
printf("%u\n", hans.year);
return 0;
}
| 23.848485 | 106 | 0.559085 |
1704dd803e789e902c36d50d1b757f57d8ce09ad | 484 | cs | C# | src/SixtenLabs.SpawnOfVulkan/Structs/PipelineColorBlendAttachmentState.cs | SixtenLabs/SpawnOfVulkan | 58aa8362d6283f57bb5d4730e60f1c2ef26de9f9 | [
"Unlicense"
] | null | null | null | src/SixtenLabs.SpawnOfVulkan/Structs/PipelineColorBlendAttachmentState.cs | SixtenLabs/SpawnOfVulkan | 58aa8362d6283f57bb5d4730e60f1c2ef26de9f9 | [
"Unlicense"
] | 15 | 2016-05-13T04:09:55.000Z | 2016-05-29T18:49:21.000Z | src/SixtenLabs.SpawnOfVulkan/Structs/PipelineColorBlendAttachmentState.cs | SixtenLabs/SpawnOfVulkan | 58aa8362d6283f57bb5d4730e60f1c2ef26de9f9 | [
"Unlicense"
] | null | null | null | using System;
namespace SixtenLabs.SpawnOfVulkan
{
public struct PipelineColorBlendAttachmentState
{
internal uint BlendEnable;
internal BlendFactor SrcColorBlendFactor;
internal BlendFactor DstColorBlendFactor;
internal BlendOp ColorBlendOp;
internal BlendFactor SrcAlphaBlendFactor;
internal BlendFactor DstAlphaBlendFactor;
internal BlendOp AlphaBlendOp;
internal ColorComponentFlags ColorWriteMask;
}
} | 30.25 | 52 | 0.739669 |
d1b01ff482c82b67405f2f1aae9a2fca399b1c42 | 3,106 | lua | Lua | voxconvert/scripts/modules/perlin.lua | dj24/com.vox.importer | 32dacbec7682c15923add10e76cd8feaf12fba5d | [
"MIT"
] | null | null | null | voxconvert/scripts/modules/perlin.lua | dj24/com.vox.importer | 32dacbec7682c15923add10e76cd8feaf12fba5d | [
"MIT"
] | null | null | null | voxconvert/scripts/modules/perlin.lua | dj24/com.vox.importer | 32dacbec7682c15923add10e76cd8feaf12fba5d | [
"MIT"
] | null | null | null | local module = {}
module.p = {}
module.permutation = {
151,
160,
137,
91,
90,
15,
131,
13,
201,
95,
96,
53,
194,
233,
7,
225,
140,
36,
103,
30,
69,
142,
8,
99,
37,
240,
21,
10,
23,
190,
6,
148,
247,
120,
234,
75,
0,
26,
197,
62,
94,
252,
219,
203,
117,
35,
11,
32,
57,
177,
33,
88,
237,
149,
56,
87,
174,
20,
125,
136,
171,
168,
68,
175,
74,
165,
71,
134,
139,
48,
27,
166,
77,
146,
158,
231,
83,
111,
229,
122,
60,
211,
133,
230,
220,
105,
92,
41,
55,
46,
245,
40,
244,
102,
143,
54,
65,
25,
63,
161,
1,
216,
80,
73,
209,
76,
132,
187,
208,
89,
18,
169,
200,
196,
135,
130,
116,
188,
159,
86,
164,
100,
109,
198,
173,
186,
3,
64,
52,
217,
226,
250,
124,
123,
5,
202,
38,
147,
118,
126,
255,
82,
85,
212,
207,
206,
59,
227,
47,
16,
58,
17,
182,
189,
28,
42,
223,
183,
170,
213,
119,
248,
152,
2,
44,
154,
163,
70,
221,
153,
101,
155,
167,
43,
172,
9,
129,
22,
39,
253,
19,
98,
108,
110,
79,
113,
224,
232,
178,
185,
112,
104,
218,
246,
97,
228,
251,
34,
242,
193,
238,
210,
144,
12,
191,
179,
162,
241,
81,
51,
145,
235,
249,
14,
239,
107,
49,
192,
214,
31,
181,
199,
106,
157,
184,
84,
204,
176,
115,
121,
50,
45,
127,
4,
150,
254,
138,
236,
205,
93,
222,
114,
67,
29,
24,
72,
243,
141,
128,
195,
78,
66,
215,
61,
156,
180
}
module.size = 256
module.gx = {}
module.gy = {}
module.randMax = 256
function module:load()
for i = 1, self.size do
self.p[i] = self.permutation[i]
self.p[256 + i] = self.p[i]
end
end
function module:noise(x, y, z)
local X = math.floor(x) % 256
local Y = math.floor(y) % 256
local Z = math.floor(z) % 256
x = x - math.floor(x)
y = y - math.floor(y)
z = z - math.floor(z)
local u = module.fade(x)
local v = module.fade(y)
local w = module.fade(z)
local A = self.p[X + 1] + Y
local AA = self.p[A + 1] + Z
local AB = self.p[A + 2] + Z
local B = self.p[X + 2] + Y
local BA = self.p[B + 1] + Z
local BB = self.p[B + 2] + Z
return module.lerp(
w,
module.lerp(
v,
module.lerp(u, module.grad(self.p[AA + 1], x, y, z), module.grad(self.p[BA + 1], x - 1, y, z)),
module.lerp(u, module.grad(self.p[AB + 1], x, y - 1, z), module.grad(self.p[BB + 1], x - 1, y - 1, z))
),
module.lerp(
v,
module.lerp(u, module.grad(self.p[AB + 2], x, y, z - 1), module.grad(self.p[BA + 2], x - 1, y, z - 1)),
module.lerp(u, module.grad(self.p[AB + 2], x, y - 1, z - 1), module.grad(self.p[BB + 2], x - 1, y - 1, z - 1))
)
)
end
function module.fade(t)
return t * t * t * (t * (t * 6 - 15) + 10)
end
function module.lerp(t, a, b)
return a + t * (b - a)
end
function module.grad(hash, x, y, z)
local h = hash % 16
local u = h < 8 and x or y
local v = h < 4 and y or ((h == 12 or h == 14) and x or z)
return ((h % 2) == 0 and u or -u) + ((h % 3) == 0 and v or -v)
end
--[[
normalize the noise range from [-1/1] to [0/1]
--]]
function module:norm(v)
return (v + 1.0) / 2.0
end
return module
| 9.440729 | 113 | 0.512878 |
752ae1d1fd114619bef3775625ea48b02478c6d1 | 1,009 | kt | Kotlin | vertx-lang-kotlin/src/main/kotlin/io/vertx/kotlin/ext/shell/system/Process.kt | jo5ef/vertx-stack-generation | 15be5c0e93e68aa64e4daffe97d60580c081d1cc | [
"Apache-2.0"
] | null | null | null | vertx-lang-kotlin/src/main/kotlin/io/vertx/kotlin/ext/shell/system/Process.kt | jo5ef/vertx-stack-generation | 15be5c0e93e68aa64e4daffe97d60580c081d1cc | [
"Apache-2.0"
] | null | null | null | vertx-lang-kotlin/src/main/kotlin/io/vertx/kotlin/ext/shell/system/Process.kt | jo5ef/vertx-stack-generation | 15be5c0e93e68aa64e4daffe97d60580c081d1cc | [
"Apache-2.0"
] | null | null | null | package io.vertx.kotlin.ext.shell.system
import io.vertx.ext.shell.system.Process
import io.vertx.kotlin.coroutines.awaitEvent
suspend fun Process.terminatedHandlerAwait() : Int {
return awaitEvent{
this.terminatedHandler(it)
}
}
suspend fun Process.resumeAwait() : Unit {
return awaitEvent{
this.resume({ v -> it.handle(null) })}
}
suspend fun Process.resumeAwait(foreground : Boolean) : Unit {
return awaitEvent{
this.resume(foreground, { v -> it.handle(null) })}
}
suspend fun Process.suspendAwait() : Unit {
return awaitEvent{
this.suspend({ v -> it.handle(null) })}
}
suspend fun Process.terminateAwait() : Unit {
return awaitEvent{
this.terminate({ v -> it.handle(null) })}
}
suspend fun Process.toBackgroundAwait() : Unit {
return awaitEvent{
this.toBackground({ v -> it.handle(null) })}
}
suspend fun Process.toForegroundAwait() : Unit {
return awaitEvent{
this.toForeground({ v -> it.handle(null) })}
}
| 24.02381 | 62 | 0.666997 |
dd577729f7e7a3d29c2fc1a34c06b9d90f4e4b59 | 516 | java | Java | cq-component-maven-plugin/src/main/java/com/citytechinc/cq/component/touchuidialog/widget/richtexteditor/Toolbar.java | d-wells/cq-component-maven-plugin | 3355f18e7a85bdde3e9cb2367e8c1a372674b0f3 | [
"Apache-2.0"
] | 12 | 2016-11-22T16:17:45.000Z | 2018-12-20T02:05:22.000Z | cq-component-maven-plugin/src/main/java/com/citytechinc/cq/component/touchuidialog/widget/richtexteditor/Toolbar.java | d-wells/cq-component-maven-plugin | 3355f18e7a85bdde3e9cb2367e8c1a372674b0f3 | [
"Apache-2.0"
] | 33 | 2016-10-12T23:20:35.000Z | 2019-01-16T16:17:24.000Z | cq-component-maven-plugin/src/main/java/com/citytechinc/cq/component/touchuidialog/widget/richtexteditor/Toolbar.java | d-wells/cq-component-maven-plugin | 3355f18e7a85bdde3e9cb2367e8c1a372674b0f3 | [
"Apache-2.0"
] | 24 | 2016-10-20T15:06:04.000Z | 2018-11-30T20:58:08.000Z | package com.citytechinc.cq.component.touchuidialog.widget.richtexteditor;
import com.citytechinc.cq.component.touchuidialog.AbstractTouchUIDialogElement;
public class Toolbar extends AbstractTouchUIDialogElement {
public static final String PRIMARY_TYPE = "nt:unstructured";
private final String[] toolbar;
public Toolbar(ToolbarParameters parameters) {
super(parameters);
toolbar = parameters.getToolbar();
}
public String[] getToolbar() {
return toolbar;
}
}
| 24.571429 | 79 | 0.738372 |
02b5bb9265bb91309d903aabeea6f808b28c3303 | 11,217 | cpp | C++ | src/i2c_bus.cpp | Robo-Wunderkind/RoboWunderkinduino | 09a01b6e417b6a8196fe152c592bf13c227d909b | [
"Apache-2.0"
] | 3 | 2022-02-08T18:38:03.000Z | 2022-02-08T19:53:01.000Z | src/i2c_bus.cpp | Robo-Wunderkind/RoboWunduino | 09a01b6e417b6a8196fe152c592bf13c227d909b | [
"Apache-2.0"
] | null | null | null | src/i2c_bus.cpp | Robo-Wunderkind/RoboWunduino | 09a01b6e417b6a8196fe152c592bf13c227d909b | [
"Apache-2.0"
] | null | null | null | #include <driver/i2c.h>
#include <Wire.h>
#include "i2c_bus.h"
#include "module_handler.h"
static uint8_t i2c_devices[MAX_DYNAMIC_I2C_ADD+1] = {0};
static uint8_t i2c_devices_new[MAX_DYNAMIC_I2C_ADD+1] = {0};
static uint8_t i2c_devices_disconnection_count[MAX_DYNAMIC_I2C_ADD+1] = {0};
static SemaphoreHandle_t i2c_mutex = NULL;
void reset_i2c_devices()
{
for(uint8_t i = 0; i < MAX_DYNAMIC_I2C_ADD+1; i ++)
{
i2c_devices_disconnection_count[i] = 0;
i2c_devices[i] = 0;
}
}
void i2c_confirm_module_existence_in_scanner(uint8_t address)
{
i2c_devices_new[address] = 2;
}
void init_i2c(void)
{
vSemaphoreCreateBinary(i2c_mutex);
Wire.begin(I2C_SDA_PIN, I2C_SCL_PIN);
Wire.setClock(100000);
//if( i2c_mutex != NULL ) printf("Created Semaphore!\n");
}
// -------------------------------- I2C MODULE COMMUNICATION ---------------------------------------------------
bool i2c_write_module(uint8_t address, uint8_t *data, size_t size)
{
uint8_t espRc = 0xff;
if( xSemaphoreTake(i2c_mutex, I2C_WAIT_TICKS_SM) == pdTRUE)
{
Wire.beginTransmission(address);
Wire.write(data, size);
espRc = Wire.endTransmission();
xSemaphoreGive( i2c_mutex );
}
else
{
//printf("Unable to aquire i2c write\n");
}
if(espRc != 0)
{
//printf("Bad I2C Transmit\n");
return false;
}
else
{
//printf("I2C Transmit OK\n");
return true;
}
}
uint8_t i2c_read_module_data(uint8_t i2c_address, uint8_t* data_rd, size_t size)
{
uint8_t i = 0;
if( xSemaphoreTake(i2c_mutex, I2C_WAIT_TICKS_SM) == pdTRUE)
{
Wire.requestFrom(i2c_address, size);
while ((Wire.available()) && (i <= size))
{
int c = Wire.read();
data_rd[i] = c;
//printf("I2C: Read Data - 0x%02X\n", data_rd[i]);
i++;
}
//printf("I2C: Read - DONE\n");
xSemaphoreGive(i2c_mutex);
//if(i != 0) printf("I2C Read Data Successful\n");
//else printf("I2C Read Module Failed\n");
return i;
}
else
{
//printf("Unable to aquire i2c read data\n");
}
return i;
}
uint8_t i2c_read_module_info(uint8_t i2c_address, uint8_t code, uint8_t* data_rd, size_t size)
{
uint8_t i = 0;
if( xSemaphoreTake(i2c_mutex, I2C_WAIT_TICKS_SM) == pdTRUE)
{
Wire.beginTransmission(i2c_address);
Wire.write(code);
Wire.endTransmission();
Wire.requestFrom(i2c_address, size);
while ((Wire.available()) && (i <= size))
{
int c = Wire.read();
data_rd[i] = c;
//printf("I2C: Read Info - 0x%02X\n", data_rd[i]);
i++;
}
//printf("I2C: Read - DONE\n");
xSemaphoreGive(i2c_mutex);
//if(i != 0) printf("I2C Read Info Successful\n");
//else printf("I2C Read Info Failed\n");
return i;
}
else
{
//printf("Unable to aquire i2c read info\n");
}
return i;
}
uint8_t i2c_eeprom_module_id(uint8_t address)
{
uint8_t data[3] = {0};
i2c_read_module_info(address, 0x05, data, 3);
return data[0];
}
void i2c_set_modules_address(uint8_t old_address, uint8_t bitpos, uint8_t new_address1, uint8_t new_address2)
{
uint8_t data[5];
data[0] = 0x01;
data[1] = 0x00;
i2c_write_module(old_address, data, 2);
data[0] = 0x04;
data[1] = bitpos;
data[2] = new_address1;
data[3] = new_address2;
i2c_write_module(old_address, data, 4);
}
void i2c_scan(void)
{
uint8_t i = 0;
uint8_t j = 0;
uint8_t conflict_add_count = 0;
uint8_t data_rd[25] = {0};
uint8_t module_counter = 0;
uint8_t error;
uint8_t bitpos = 0;
uint8_t new_add0 = 0;
uint8_t new_add1 = 0;
uint32_t bitmask = 0;
uint32_t modules_id = 0;
uint32_t modules_id_n = 0;
uint8_t data[3] = {0};
// Check the whole i2c address range for connect or disconnect events.
for (i = BOOTLOADER_I2C_ADD; i <= MAX_DYNAMIC_I2C_ADD; i++)
{
usleep(40);
Wire.beginTransmission(i);
error = Wire.endTransmission();
if (error == 0) //module found at i.
{
//usleep(40); // 4 i2c cycles 40 only sleep after we get a response
if((i2c_devices[i] == ADD_DETECTION_CYCLES) && (i >= MIN_DYNAMIC_I2C_ADD) && (i <= MAX_DYNAMIC_I2C_ADD))
{
/*
* This can happen if the module could not be detected in one cycle but reappears in the next, so its existence is
* confirmed and the module disconnection cycle is interrupted.
*/
//printf("SCANNER: Confirming 0x%02x\n", i);
module_counter ++;
confirm_modules_existance(i);
i2c_devices_disconnection_count[i] = 0;
continue;
}
// Module counts as connected as soon as i2c_devices_new[i] is = ADD_DETECTION_CYCLES, so it needs to be detected for at least two cycles.
else if (i2c_devices[i] != ADD_DETECTION_CYCLES)
{
i2c_devices_new[i]++;
//printf("Connection Count of 0x%02x = %d\n", i, i2c_devices_new[i]);
}
}
else
{
//i2c_devices_new[i] = 0;
// If this module is connected increment disconnect count
if(i2c_devices[i] == ADD_DETECTION_CYCLES) i2c_devices_disconnection_count[i]++;
// else we are dealing with a module we have not discovered, move on
else
{
i2c_devices[i] = i2c_devices_new[i] = 0;// this is not a confirmed module, and we have failed to contact it so we will clear its values
continue; // else we are dealing with a module we have not discovered, move on
}
//printf("Disconnection Count of 0x%02x = %d\n", i, i2c_devices_disconnection_count[i]);
// If our disconnect count is over the threshold then reset our detection count so we can begin disconnect routine
if(i2c_devices_disconnection_count[i] >= DELETE_DETECTION_CYCLES)
{
i2c_devices_new[i] = 0; // reset the detection count
i2c_devices_disconnection_count[i] = 0;
}
}
}
//printf("SCANNER: Total Connected Modules = %d\n", module_counter);
module_counter = 0;
// After checking for changes on the bus, handle changes according to the address range and the module state.
for (i = BOOTLOADER_I2C_ADD; i <= MAX_DYNAMIC_I2C_ADD; i++)
{
//usleep(40); // 2 i2c cycles
if (i2c_devices_new[i] != i2c_devices[i])
{
// Means that a module has been confrimed on the bus.
if (i2c_devices_new[i] == ADD_DETECTION_CYCLES)
{
//usleep(40);
//printf("SCANNER: Module detected twice at 0x%02x\n", i);
if (i == BOOTLOADER_I2C_ADD)
{
//printf("SCANNER: Bootloader detected\n");
}
/*
* In this address range the module has not been initialised and added to the system yet.
* The module, when powered, appears on the bus with a random address in the RANDOM_I2C_ADD range.
* The system will check if there is an address conflict, if yes, assign the modules two different addresses
* out of the CONFLICT_SOLVING_I2C_ADD range and continue to do so as long as there is only one module at
* each address. The last step is to assign the module its address out of the DYNAMIC_I2C_ADD range, initialize
* it and add it to the system.
*/
if (i >= MIN_RANDOM_I2C_ADD && i <= MAX_CONFLICT_SOLVING_I2C_ADD)
{
// Manipulate module out buffer to check for an address conflict.
i2c_read_module_data(i, data_rd, 9);
modules_id = (uint8_t)data_rd[1] | ((uint8_t)data_rd[3] << 8) | ((uint8_t)data_rd[5] << 16) | ((uint8_t)data_rd[7] << 24);
modules_id_n = ((uint8_t)(data_rd[2] ^ 0xff)) | ((uint8_t)(data_rd[4] ^ 0xff) << 8) | ((uint8_t)(data_rd[6] ^ 0xff)<< 16) | ((uint8_t)(data_rd[8] ^ 0xff)<< 24);
//printf("SCANNER: modules_id = 0x%02X & modules_id_n = 0x%02X\n", modules_id, modules_id_n);
// Check for address conflict
if ((data_rd[1] != (data_rd[2] ^ 0xff)) || (data_rd[3] != (data_rd[4] ^ 0xff)) || (data_rd[5] != (data_rd[6] ^ 0xff)) || (data_rd[7] != (data_rd[8] ^ 0xff)))
{
bitpos = 0;
new_add0 = 0;
new_add1 = 0;
bitmask = 0;
// Find the first different bit in the data array manipulated above, needed to assign module solving addresses to the two modules on the same address.
for (j = 0; j < 32; j++)
{
bitmask = (1 << j);
if ((modules_id ^ modules_id_n) & bitmask)
{
bitpos = j;
break;
}
}
// Find next free module solving address.
new_add0 = MIN_CONFLICT_SOLVING_I2C_ADD + conflict_add_count;
conflict_add_count++;
// Find next free module solving address.
new_add1 = MIN_CONFLICT_SOLVING_I2C_ADD + conflict_add_count;
conflict_add_count++;
if((conflict_add_count + MIN_CONFLICT_SOLVING_I2C_ADD) == MAX_CONFLICT_SOLVING_I2C_ADD) conflict_add_count = 0;
/*
* Assign module solving addresses to the two modules on the same address.
* In case there are more then two modules on the same address, two will reappear on the bus with the same conflict solving address,
* the system will detect this again and assign them new conflict solving addresses.
*/
//printf("SCANNER: Address conflict detected at 0x%02x, bit %d, trying to solve, new addresses are 0x%02x and 0x%02x\n", i, bitpos, new_add0, new_add1);
i2c_set_modules_address(i, bitpos, new_add0, new_add1);
}
else
{
//If there is no address conflict, the module will be added to the system.
if(i2c_devices[i] == ADD_DETECTION_CYCLES - 1)
{
//printf("SCANNER: Adding module at 0x%02x, unique ID = %d\n", i, modules_id);
i2c_read_module_info(i, 0x01, data_rd, 9);
uint8_t eeprom = i2c_eeprom_module_id(i);
add_module(i, eeprom, data_rd);
}
}
}
if ((i >= MIN_DYNAMIC_I2C_ADD) && (i <= MAX_DYNAMIC_I2C_ADD))
{
/*
* This can happen if the module could not be detected in one cycle but reappears in the next, so its existence is
* confirmed and the module disconnection cycle is interrupted.
*/
//printf("SCANNER: Confirming 0x%02x\n", i);
confirm_modules_existance(i);
i2c_devices_disconnection_count[i] = 0;
}
}
else if (i2c_devices_new[i] == 0)
{
// The module disappeared from the bus, the disconnection cycle is initiated.
// Only remove if it is a real module that is currently connected
if ((i > MAX_CONFLICT_SOLVING_I2C_ADD) && i2c_devices[i] == ADD_DETECTION_CYCLES)
{
initiate_module_disconnection(i);
//printf("SCANNER: Module disconnected at 0x%02x, dev is %d\n", i, i2c_devices[i]);
}
}
else
{
//printf("SCANNER: New module detected at 0x%02x\n", i);
}
}
i2c_devices[i] = i2c_devices_new[i];
}
}
| 34.835404 | 170 | 0.608719 |
af2617356da33a1a2a443e9d75c0c43c7803552e | 682 | py | Python | forms.py | benjithorpe/puny | 4429bb6c4b99a3a5839054d863609e9f87e3a2d5 | [
"MIT"
] | null | null | null | forms.py | benjithorpe/puny | 4429bb6c4b99a3a5839054d863609e9f87e3a2d5 | [
"MIT"
] | null | null | null | forms.py | benjithorpe/puny | 4429bb6c4b99a3a5839054d863609e9f87e3a2d5 | [
"MIT"
] | null | null | null | from flask_wtf import FlaskForm
from wtforms import StringField, SubmitField, PasswordField
from wtforms.validators import DataRequired
class LoginForm(FlaskForm):
username = StringField("Username", validators=[DataRequired()])
password = PasswordField("Password", validators=[DataRequired()])
login_btn = SubmitField("Log In")
class SignupForm(FlaskForm):
fullname = StringField("Full Name", validators=[DataRequired()])
username = StringField("Username", validators=[DataRequired()])
email = StringField("Email", validators=[DataRequired()])
password = PasswordField("Password", validators=[DataRequired()])
signup_btn = SubmitField("Sign Up")
| 37.888889 | 69 | 0.747801 |
7786651908342bb4bcd4a638ab5fcb639a0bf068 | 19,216 | c | C | postgresql/src/backend/executor/execTuples.c | anjingbin/starccm | 70db48004aa20bbb82cc24de80802b40c7024eff | [
"BSD-3-Clause"
] | 2 | 2020-01-06T07:43:30.000Z | 2020-07-11T20:53:53.000Z | postgresql/src/backend/executor/execTuples.c | anjingbin/starccm | 70db48004aa20bbb82cc24de80802b40c7024eff | [
"BSD-3-Clause"
] | null | null | null | postgresql/src/backend/executor/execTuples.c | anjingbin/starccm | 70db48004aa20bbb82cc24de80802b40c7024eff | [
"BSD-3-Clause"
] | null | null | null | /*-------------------------------------------------------------------------
*
* execTuples.c
* Routines dealing with the executor tuple tables. These are used to
* ensure that the executor frees copies of tuples (made by
* ExecTargetList) properly.
*
* Routines dealing with the type information for tuples. Currently,
* the type information for a tuple is an array of FormData_pg_attribute.
* This information is needed by routines manipulating tuples
* (getattribute, formtuple, etc.).
*
* Portions Copyright (c) 1996-2001, PostgreSQL Global Development Group
* Portions Copyright (c) 1994, Regents of the University of California
*
*
* IDENTIFICATION
* $Header: /home/hjcvs/OB-CCM-1.0/postgresql/src/backend/executor/execTuples.c,v 1.2 2004/07/05 08:55:28 SuLiang Exp $
*
*-------------------------------------------------------------------------
*/
/*
* INTERFACE ROUTINES
*
* TABLE CREATE/DELETE
* ExecCreateTupleTable - create a new tuple table
* ExecDropTupleTable - destroy a table
*
* SLOT RESERVATION
* ExecAllocTableSlot - find an available slot in the table
*
* SLOT ACCESSORS
* ExecStoreTuple - store a tuple in the table
* ExecFetchTuple - fetch a tuple from the table
* ExecClearTuple - clear contents of a table slot
* ExecSetSlotDescriptor - set a slot's tuple descriptor
* ExecSetSlotDescriptorIsNew - diddle the slot-desc-is-new flag
*
* SLOT STATUS PREDICATES
* TupIsNull - true when slot contains no tuple(Macro)
*
* CONVENIENCE INITIALIZATION ROUTINES
* ExecInitResultTupleSlot \ convenience routines to initialize
* ExecInitScanTupleSlot \ the various tuple slots for nodes
* ExecInitExtraTupleSlot / which store copies of tuples.
* ExecInitNullTupleSlot /
*
* Routines that probably belong somewhere else:
* ExecTypeFromTL - form a TupleDesc from a target list
*
* EXAMPLE OF HOW TABLE ROUTINES WORK
* Suppose we have a query such as retrieve (EMP.name) and we have
* a single SeqScan node in the query plan.
*
* At ExecStart()
* ----------------
* - InitPlan() calls ExecCreateTupleTable() to create the tuple
* table which will hold tuples processed by the executor.
*
* - ExecInitSeqScan() calls ExecInitScanTupleSlot() and
* ExecInitResultTupleSlot() to reserve places in the tuple
* table for the tuples returned by the access methods and the
* tuples resulting from preforming target list projections.
*
* During ExecRun()
* ----------------
* - SeqNext() calls ExecStoreTuple() to place the tuple returned
* by the access methods into the scan tuple slot.
*
* - ExecSeqScan() calls ExecStoreTuple() to take the result
* tuple from ExecProject() and place it into the result tuple slot.
*
* - ExecutePlan() calls ExecRetrieve() which gets the tuple out of
* the slot passed to it by calling ExecFetchTuple(). this tuple
* is then returned.
*
* At ExecEnd()
* ----------------
* - EndPlan() calls ExecDropTupleTable() to clean up any remaining
* tuples left over from executing the query.
*
* The important thing to watch in the executor code is how pointers
* to the slots containing tuples are passed instead of the tuples
* themselves. This facilitates the communication of related information
* (such as whether or not a tuple should be pfreed, what buffer contains
* this tuple, the tuple's tuple descriptor, etc). Note that much of
* this information is also kept in the ExprContext of each node.
* Soon the executor will be redesigned and ExprContext's will contain
* only slot pointers. -cim 3/14/91
*
* NOTES
* The tuple table stuff is relatively new, put here to alleviate
* the process growth problems in the executor. The other routines
* are old (from the original lisp system) and may someday become
* obsolete. -cim 6/23/90
*
* In the implementation of nested-dot queries such as
* "retrieve (EMP.hobbies.all)", a single scan may return tuples
* of many types, so now we return pointers to tuple descriptors
* along with tuples returned via the tuple table. This means
* we now have a bunch of routines to diddle the slot descriptors
* too. -cim 1/18/90
*
* The tuple table stuff depends on the executor/tuptable.h macros,
* and the TupleTableSlot node in execnodes.h.
*
*/
#include "postgres.h"
#include "access/heapam.h"
#include "catalog/pg_type.h"
#include "executor/executor.h"
/* ----------------------------------------------------------------
* tuple table create/delete functions
* ----------------------------------------------------------------
*/
/* --------------------------------
* ExecCreateTupleTable
*
* This creates a new tuple table of the specified initial
* size. If the size is insufficient, ExecAllocTableSlot()
* will grow the table as necessary.
*
* This should be used by InitPlan() to allocate the table.
* The table's address will be stored in the EState structure.
* --------------------------------
*/
TupleTable /* return: address of table */
ExecCreateTupleTable(int initialSize) /* initial number of slots in
* table */
{
TupleTable newtable; /* newly allocated table */
TupleTableSlot *array; /* newly allocated slot array */
/*
* sanity checks
*/
Assert(initialSize >= 1);
/*
* Now allocate our new table along with space for the pointers to the
* tuples.
*/
newtable = (TupleTable) palloc(sizeof(TupleTableData));
array = (TupleTableSlot *) palloc(initialSize * sizeof(TupleTableSlot));
/*
* clean out the slots we just allocated
*/
MemSet(array, 0, initialSize * sizeof(TupleTableSlot));
/*
* initialize the new table and return it to the caller.
*/
newtable->size = initialSize;
newtable->next = 0;
newtable->array = array;
return newtable;
}
/* --------------------------------
* ExecDropTupleTable
*
* This frees the storage used by the tuple table itself
* and optionally frees the contents of the table also.
* It is expected that this routine be called by EndPlan().
* --------------------------------
*/
void
ExecDropTupleTable(TupleTable table, /* tuple table */
bool shouldFree) /* true if we should free slot
* contents */
{
int next; /* next available slot */
TupleTableSlot *array; /* start of table array */
int i; /* counter */
/*
* sanity checks
*/
Assert(table != NULL);
/*
* get information from the table
*/
array = table->array;
next = table->next;
/*
* first free all the valid pointers in the tuple array and drop
* refcounts of any referenced buffers, if that's what the caller
* wants. (There is probably no good reason for the caller ever not
* to want it!)
*/
if (shouldFree)
{
for (i = 0; i < next; i++)
{
ExecClearTuple(&array[i]);
if (array[i].ttc_shouldFreeDesc &&
array[i].ttc_tupleDescriptor != NULL)
FreeTupleDesc(array[i].ttc_tupleDescriptor);
}
}
/*
* finally free the tuple array and the table itself.
*/
pfree(array);
pfree(table);
}
/* ----------------------------------------------------------------
* tuple table slot reservation functions
* ----------------------------------------------------------------
*/
/* --------------------------------
* ExecAllocTableSlot
*
* This routine is used to reserve slots in the table for
* use by the various plan nodes. It is expected to be
* called by the node init routines (ex: ExecInitNestLoop)
* once per slot needed by the node. Not all nodes need
* slots (some just pass tuples around).
* --------------------------------
*/
TupleTableSlot *
ExecAllocTableSlot(TupleTable table)
{
int slotnum; /* new slot number */
TupleTableSlot *slot;
/*
* sanity checks
*/
Assert(table != NULL);
/*
* if our table is full we have to allocate a larger size table. Since
* ExecAllocTableSlot() is only called before the table is ever used
* to store tuples, we don't have to worry about the contents of the
* old table. If this changes, then we will have to preserve the
* contents. -cim 6/23/90
*
* Unfortunately, we *cannot* do this. All of the nodes in the plan that
* have already initialized their slots will have pointers into
* _freed_ memory. This leads to bad ends. We now count the number
* of slots we will need and create all the slots we will need ahead
* of time. The if below should never happen now. Fail if it does.
* -mer 4 Aug 1992
*/
if (table->next >= table->size)
elog(ERROR, "Plan requires more slots than are available"
"\n\tsend mail to your local executor guru to fix this");
/*
* at this point, space in the table is guaranteed so we reserve the
* next slot, initialize and return it.
*/
slotnum = table->next;
table->next++;
slot = &(table->array[slotnum]);
/* Make sure the allocated slot is valid (and empty) */
slot->type = T_TupleTableSlot;
slot->val = (HeapTuple) NULL;
slot->ttc_shouldFree = true;
slot->ttc_descIsNew = true;
slot->ttc_shouldFreeDesc = true;
slot->ttc_tupleDescriptor = (TupleDesc) NULL;
slot->ttc_buffer = InvalidBuffer;
return slot;
}
/* --------------------------------
* MakeTupleTableSlot
*
* This routine makes an empty standalone TupleTableSlot.
* It really shouldn't exist, but there are a few places
* that do this, so we may as well centralize the knowledge
* of what's in one ...
* --------------------------------
*/
TupleTableSlot *
MakeTupleTableSlot(void)
{
TupleTableSlot *slot = makeNode(TupleTableSlot);
/* This should match ExecAllocTableSlot() */
slot->val = (HeapTuple) NULL;
slot->ttc_shouldFree = true;
slot->ttc_descIsNew = true;
slot->ttc_shouldFreeDesc = true;
slot->ttc_tupleDescriptor = (TupleDesc) NULL;
slot->ttc_buffer = InvalidBuffer;
return slot;
}
/* ----------------------------------------------------------------
* tuple table slot accessor functions
* ----------------------------------------------------------------
*/
/* --------------------------------
* ExecStoreTuple
*
* This function is used to store a tuple into a specified
* slot in the tuple table.
*
* tuple: tuple to store
* slot: slot to store it in
* buffer: disk buffer if tuple is in a disk page, else InvalidBuffer
* shouldFree: true if ExecClearTuple should pfree() the tuple
* when done with it
*
* If 'buffer' is not InvalidBuffer, the tuple table code acquires a pin
* on the buffer which is held until the slot is cleared, so that the tuple
* won't go away on us.
*
* shouldFree is normally set 'true' for tuples constructed on-the-fly.
* It must always be 'false' for tuples that are stored in disk pages,
* since we don't want to try to pfree those.
*
* Another case where it is 'false' is when the referenced tuple is held
* in a tuple table slot belonging to a lower-level executor Proc node.
* In this case the lower-level slot retains ownership and responsibility
* for eventually releasing the tuple. When this method is used, we must
* be certain that the upper-level Proc node will lose interest in the tuple
* sooner than the lower-level one does! If you're not certain, copy the
* lower-level tuple with heap_copytuple and let the upper-level table
* slot assume ownership of the copy!
*
* Return value is just the passed-in slot pointer.
* --------------------------------
*/
TupleTableSlot *
ExecStoreTuple(HeapTuple tuple,
TupleTableSlot *slot,
Buffer buffer,
bool shouldFree)
{
/*
* sanity checks
*/
Assert(slot != NULL);
/* passing shouldFree=true for a tuple on a disk page is not sane */
Assert(BufferIsValid(buffer) ? (!shouldFree) : true);
/* clear out any old contents of the slot */
ExecClearTuple(slot);
/*
* store the new tuple into the specified slot and return the slot
* into which we stored the tuple.
*/
slot->val = tuple;
slot->ttc_buffer = buffer;
slot->ttc_shouldFree = shouldFree;
/*
* If tuple is on a disk page, keep the page pinned as long as we hold
* a pointer into it.
*/
if (BufferIsValid(buffer))
IncrBufferRefCount(buffer);
return slot;
}
/* --------------------------------
* ExecClearTuple
*
* This function is used to clear out a slot in the tuple table.
*
* NB: only the tuple is cleared, not the tuple descriptor (if any).
* --------------------------------
*/
TupleTableSlot * /* return: slot passed */
ExecClearTuple(TupleTableSlot *slot) /* slot in which to store tuple */
{
HeapTuple oldtuple; /* prior contents of slot */
/*
* sanity checks
*/
Assert(slot != NULL);
/*
* get information from the tuple table
*/
oldtuple = slot->val;
/*
* free the old contents of the specified slot if necessary.
*/
if (slot->ttc_shouldFree && oldtuple != NULL)
heap_freetuple(oldtuple);
slot->val = (HeapTuple) NULL;
slot->ttc_shouldFree = true; /* probably useless code... */
/*
* Drop the pin on the referenced buffer, if there is one.
*/
if (BufferIsValid(slot->ttc_buffer))
ReleaseBuffer(slot->ttc_buffer);
slot->ttc_buffer = InvalidBuffer;
return slot;
}
/* --------------------------------
* ExecSetSlotDescriptor
*
* This function is used to set the tuple descriptor associated
* with the slot's tuple.
* --------------------------------
*/
void
ExecSetSlotDescriptor(TupleTableSlot *slot, /* slot to change */
TupleDesc tupdesc, /* new tuple descriptor */
bool shouldFree) /* is desc owned by slot? */
{
if (slot->ttc_shouldFreeDesc &&
slot->ttc_tupleDescriptor != NULL)
FreeTupleDesc(slot->ttc_tupleDescriptor);
slot->ttc_tupleDescriptor = tupdesc;
slot->ttc_shouldFreeDesc = shouldFree;
}
/* --------------------------------
* ExecSetSlotDescriptorIsNew
*
* This function is used to change the setting of the "isNew" flag
* --------------------------------
*/
void
ExecSetSlotDescriptorIsNew(TupleTableSlot *slot, /* slot to change */
bool isNew) /* "isNew" setting */
{
slot->ttc_descIsNew = isNew;
}
/* ----------------------------------------------------------------
* tuple table slot status predicates
* ----------------------------------------------------------------
*/
/* ----------------------------------------------------------------
* convenience initialization routines
* ----------------------------------------------------------------
*/
/* --------------------------------
* ExecInit{Result,Scan,Extra}TupleSlot
*
* These are convenience routines to initialize the specified slot
* in nodes inheriting the appropriate state. ExecInitExtraTupleSlot
* is used for initializing special-purpose slots.
* --------------------------------
*/
#define INIT_SLOT_DEFS \
TupleTable tupleTable; \
TupleTableSlot* slot
#define INIT_SLOT_ALLOC \
tupleTable = (TupleTable) estate->es_tupleTable; \
slot = ExecAllocTableSlot(tupleTable);
/* ----------------
* ExecInitResultTupleSlot
* ----------------
*/
void
ExecInitResultTupleSlot(EState *estate, CommonState *commonstate)
{
INIT_SLOT_DEFS;
INIT_SLOT_ALLOC;
commonstate->cs_ResultTupleSlot = slot;
}
/* ----------------
* ExecInitScanTupleSlot
* ----------------
*/
void
ExecInitScanTupleSlot(EState *estate, CommonScanState *commonscanstate)
{
INIT_SLOT_DEFS;
INIT_SLOT_ALLOC;
commonscanstate->css_ScanTupleSlot = slot;
}
/* ----------------
* ExecInitExtraTupleSlot
* ----------------
*/
TupleTableSlot *
ExecInitExtraTupleSlot(EState *estate)
{
INIT_SLOT_DEFS;
INIT_SLOT_ALLOC;
return slot;
}
/* ----------------
* ExecInitNullTupleSlot
*
* Build a slot containing an all-nulls tuple of the given type.
* This is used as a substitute for an input tuple when performing an
* outer join.
* ----------------
*/
TupleTableSlot *
ExecInitNullTupleSlot(EState *estate, TupleDesc tupType)
{
TupleTableSlot *slot = ExecInitExtraTupleSlot(estate);
/*
* Since heap_getattr() will treat attributes beyond a tuple's t_natts
* as being NULL, we can make an all-nulls tuple just by making it be
* of zero length. However, the slot descriptor must match the real
* tupType.
*/
HeapTuple nullTuple;
Datum values[1];
char nulls[1];
static struct tupleDesc NullTupleDesc; /* we assume this inits to
* zeroes */
ExecSetSlotDescriptor(slot, tupType, false);
nullTuple = heap_formtuple(&NullTupleDesc, values, nulls);
return ExecStoreTuple(nullTuple, slot, InvalidBuffer, true);
}
/* ----------------------------------------------------------------
* ExecTypeFromTL
*
* Generate a tuple descriptor for the result tuple of a targetlist.
* Note that resjunk columns, if any, are included in the result.
*
* Currently there are about 4 different places where we create
* TupleDescriptors. They should all be merged, or perhaps
* be rewritten to call BuildDesc().
* ----------------------------------------------------------------
*/
TupleDesc
ExecTypeFromTL(List *targetList)
{
List *tlitem;
TupleDesc typeInfo;
Resdom *resdom;
Oid restype;
int len;
/*
* examine targetlist - if empty then return NULL
*/
len = ExecTargetListLength(targetList);
if (len == 0)
return NULL;
/*
* allocate a new typeInfo
*/
typeInfo = CreateTemplateTupleDesc(len);
/*
* scan list, generate type info for each entry
*/
foreach(tlitem, targetList)
{
TargetEntry *tle = lfirst(tlitem);
if (tle->resdom != NULL)
{
resdom = tle->resdom;
restype = resdom->restype;
TupleDescInitEntry(typeInfo,
resdom->resno,
resdom->resname,
restype,
resdom->restypmod,
0,
false);
#ifdef NOT_USED
ExecSetTypeInfo(resdom->resno - 1,
typeInfo,
(Oid) restype,
resdom->resno,
resdom->reslen,
NameStr(*resdom->resname),
get_typbyval(restype),
get_typalign(restype));
#endif
}
else
{
/* XXX this branch looks fairly broken ... tgl 12/2000 */
Resdom *fjRes;
List *fjTlistP;
List *fjList = lfirst(tlitem);
#ifdef SETS_FIXED
TargetEntry *tle;
Fjoin *fjNode = ((TargetEntry *) lfirst(fjList))->fjoin;
tle = fjNode->fj_innerNode; /* ??? */
#endif
fjRes = tle->resdom;
restype = fjRes->restype;
TupleDescInitEntry(typeInfo,
fjRes->resno,
fjRes->resname,
restype,
fjRes->restypmod,
0,
false);
#ifdef NOT_USED
ExecSetTypeInfo(fjRes->resno - 1,
typeInfo,
(Oid) restype,
fjRes->resno,
fjRes->reslen,
(char *) fjRes->resname,
get_typbyval(restype),
get_typalign(restype));
#endif
foreach(fjTlistP, lnext(fjList))
{
TargetEntry *fjTle = lfirst(fjTlistP);
fjRes = fjTle->resdom;
TupleDescInitEntry(typeInfo,
fjRes->resno,
fjRes->resname,
restype,
fjRes->restypmod,
0,
false);
#ifdef NOT_USED
ExecSetTypeInfo(fjRes->resno - 1,
typeInfo,
(Oid) fjRes->restype,
fjRes->resno,
fjRes->reslen,
(char *) fjRes->resname,
get_typbyval(fjRes->restype),
get_typalign(fjRes->restype));
#endif
}
}
}
return typeInfo;
}
| 28.426036 | 121 | 0.626821 |
0db2f3a8db81fa48165aa403551fc37a48342f86 | 446 | cs | C# | Solid.InterfaceSegregation/PaymentProcessors/After/CashPaymentProcessor.cs | fooberichu150/solid-icp | ae427b367015291aedbae64adb18c678841d60b6 | [
"MIT"
] | 1 | 2020-08-15T06:14:27.000Z | 2020-08-15T06:14:27.000Z | Solid.InterfaceSegregation/PaymentProcessors/After/CashPaymentProcessor.cs | fooberichu150/solid-icp | ae427b367015291aedbae64adb18c678841d60b6 | [
"MIT"
] | null | null | null | Solid.InterfaceSegregation/PaymentProcessors/After/CashPaymentProcessor.cs | fooberichu150/solid-icp | ae427b367015291aedbae64adb18c678841d60b6 | [
"MIT"
] | null | null | null | using System;
using Solid.InterfaceSegregation.Models;
namespace Solid.InterfaceSegregation.PaymentProcessors.After
{
public class CashPaymentProcessor : ICapturablePaymentProcessor
{
public void Initialize(IPaymentItem payment)
{
Payment = payment;
}
public IPaymentItem Payment { get; private set; }
public bool Capture()
{
Payment.PaymentStatus = PaymentStatus.Approved;
return true;
}
}
}
| 19.391304 | 65 | 0.717489 |
6877c97b739468a8806ccf5ae93c901b297bbb2e | 185 | dart | Dart | web/main.dart | pikalaw/mdc-web-dart | ebfb71bea7455dd7e1df60920a0aff2bf57cd02c | [
"MIT"
] | null | null | null | web/main.dart | pikalaw/mdc-web-dart | ebfb71bea7455dd7e1df60920a0aff2bf57cd02c | [
"MIT"
] | null | null | null | web/main.dart | pikalaw/mdc-web-dart | ebfb71bea7455dd7e1df60920a0aff2bf57cd02c | [
"MIT"
] | null | null | null | import 'package:angular/angular.dart';
import 'package:mdc_web/src/mdc_web_demo/mdc_web_demo_component.template.dart' as ng;
void main() {
runApp(ng.MdcWebDemoComponentNgFactory);
}
| 26.428571 | 85 | 0.8 |
e0065509e3634115bdd63caa24958bdd3a03fad8 | 614 | h | C | RDV+RT/RDV+RT/Custom/Libs/UIImage+Image.h | snowboy234/RDV-RT | 29c12972eb9cb457f951e6507b52e6807a3b0d00 | [
"Apache-2.0"
] | null | null | null | RDV+RT/RDV+RT/Custom/Libs/UIImage+Image.h | snowboy234/RDV-RT | 29c12972eb9cb457f951e6507b52e6807a3b0d00 | [
"Apache-2.0"
] | null | null | null | RDV+RT/RDV+RT/Custom/Libs/UIImage+Image.h | snowboy234/RDV-RT | 29c12972eb9cb457f951e6507b52e6807a3b0d00 | [
"Apache-2.0"
] | null | null | null | //
// UIImage+Image.h
// BuDeJie
//
// Created by 田伟 on 2017/1/18.
// Copyright © 2017年 公司. All rights reserved.
//
#import <UIKit/UIKit.h>
@interface UIImage (Image)
/** 创建一个内容可拉伸，而边角不拉伸的图片 */
+ (instancetype)imageWithStretchableName:(NSString *)imageName;
/** 根据图片名返回一张能够自由拉伸的图片 */
+(instancetype)resizedImage:(NSString *)imageName;
/** 快速创建一个平铺的图片*/
+ (instancetype)imageTileWithName:(NSString *)imageName;
/** 快速创建一个不渲染的图片 */
+ (instancetype)imageOriginalWithName:(NSString *)imageName;
/** 将图片变成圆形 */
- (instancetype)tw_circleImage;
+ (instancetype)tw_circleImageNamed:(NSString *)imageName;
@end
| 20.466667 | 63 | 0.723127 |
b0c631245ca3559a2ae221817f1108e7fe23e99c | 3,948 | lua | Lua | tests/unit/high_level_database.lua | LuaDist-testing/luchia | 0887d079a2cbf1f0225d391cfae06fbdf3f610f3 | [
"BSD-3-Clause"
] | 11 | 2015-08-13T23:43:50.000Z | 2016-11-07T19:13:40.000Z | tests/unit/high_level_database.lua | LuaDist-testing/luchia | 0887d079a2cbf1f0225d391cfae06fbdf3f610f3 | [
"BSD-3-Clause"
] | 2 | 2015-01-17T19:02:42.000Z | 2019-01-03T16:12:11.000Z | tests/unit/high_level_database.lua | LuaDist-testing/luchia | 0887d079a2cbf1f0225d391cfae06fbdf3f610f3 | [
"BSD-3-Clause"
] | 1 | 2015-02-24T21:18:00.000Z | 2015-02-24T21:18:00.000Z | local lunatest = require "lunatest"
local assert_equal = lunatest.assert_equal
local assert_function = lunatest.assert_function
local assert_table = lunatest.assert_table
local common = require "common_test_functions"
local database = require "luchia.database"
local good_protocol = common.server_good_protocol
local good_host = common.server_good_host
local good_port = common.server_good_port
local user = common.server_user
local password = common.server_password
local request_function = common.server_request
local example_database = common.server_example_database
local conf = {
default = {
server = {
protocol = good_protocol,
host = good_host,
port = good_port,
},
},
}
local tests = {}
local function new_with_default_server_params()
local params = {
custom_configuration = conf,
custom_request_function = request_function,
}
local db = database:new(params)
assert_table(db, "db")
return db
end
function tests.test_new_with_default_server_params_returns_valid_server()
local db = new_with_default_server_params()
assert_table(db.server, "db.server")
assert_function(db.server.request, "db.server:request")
end
function tests.test_new_with_default_server_params_returns_only_server()
local db = new_with_default_server_params()
assert_equal(1, common.table_length(db), "db length")
end
local function new_with_custom_server_params()
local db = database:new(conf.default.server)
assert_table(db, "db")
return db
end
function tests.test_new_with_custom_server_params_returns_valid_server()
local db = new_with_custom_server_params()
assert_table(db.server, "db.server")
assert_function(db.server.request, "db.server:request")
end
function tests.test_new_with_custom_server_params_returns_only_server()
local db = new_with_custom_server_params()
assert_equal(1, common.table_length(db), "db length")
end
function tests.test_list_databases_returns_valid_list()
local db = new_with_default_server_params()
local response, response_code, headers, status = db:list()
assert_table(response)
end
function tests.test_info_with_database_name_returns_valid_database_info()
local db = new_with_default_server_params()
local response, response_code, headers, status = db:info(example_database)
assert_table(response)
assert_equal(response.db_name, example_database)
end
function tests.test_info_with_no_database_name_returns_nil()
local db = new_with_default_server_params()
local response, response_code, headers, status = db:info()
assert_equal(response, nil)
end
function tests.test_create_with_database_name_returns_valid_response()
local db = new_with_default_server_params()
local response, response_code, headers, status = db:create(example_database)
assert_table(response)
assert_equal(response.ok, true)
end
function tests.test_create_with_no_database_name_returns_nil()
local db = new_with_default_server_params()
local response, response_code, headers, status = db:create()
assert_equal(response, nil)
end
function tests.test_delete_with_database_name_returns_valid_response()
local db = new_with_default_server_params()
local response, response_code, headers, status = db:delete(example_database)
assert_table(response)
assert_equal(response.ok, true)
end
function tests.test_delete_with_no_database_name_returns_nil()
local db = new_with_default_server_params()
local response, response_code, headers, status = db:delete()
assert_equal(response, nil)
end
function tests.test_response_ok_with_ok_response_returns_true()
local db = new_with_default_server_params()
local response = {ok = true}
local bool = db:response_ok(response)
assert_equal(bool, true)
end
function tests.test_response_ok_with_not_ok_response_returns_false()
local db = new_with_default_server_params()
local response = {ok = false}
local bool = db:response_ok(response)
assert_equal(bool, false)
end
return tests
| 31.086614 | 78 | 0.802178 |
4da6b69b9cb903be67da186cf1e29bd550f3c21e | 5,198 | dart | Dart | lib/projects.dart | jarrodg05/Kickstarter-Tracker | 876196de7aca01b75ecb13ecaafe6b98216c6522 | [
"MIT"
] | null | null | null | lib/projects.dart | jarrodg05/Kickstarter-Tracker | 876196de7aca01b75ecb13ecaafe6b98216c6522 | [
"MIT"
] | null | null | null | lib/projects.dart | jarrodg05/Kickstarter-Tracker | 876196de7aca01b75ecb13ecaafe6b98216c6522 | [
"MIT"
] | null | null | null | import 'package:cloud_firestore/cloud_firestore.dart';
import 'package:flutter/foundation.dart';
import 'package:flutter/material.dart';
import 'pledge.dart';
/// a class that stores and manages/delegates all the information for a particular project
class Project
{
String id;
Widget image;
String name;
String publisher;
DateTime date;
String link;
ProjectStatus status;
Pledges pledges;
Project(
{
required this.id, // kinda want this to be late, but it seems dart doesn't like it
required this.image,
required this.name,
required this.publisher,
required this.date,
required this.link,
required this.status,
pledges,
}) : this.pledges = pledges ?? Pledges( null );
void addPledge( pledge )
{
pledges.addPledge( pledge );
ProjectsDatabase.database.updatePledges( pledge, this.id, true );
}
/// load a project from a firestore document of that project
static Project getFromFirestore( QueryDocumentSnapshot<Map<String,dynamic>> projectDocument )
{
return Project
(
image: Container( decoration: const BoxDecoration( color: Colors.blue ), ),
name: projectDocument['name'],
publisher: projectDocument['publisher'],
link: projectDocument['link'],
date: DateTime.parse( projectDocument['date'] ),
status: getAsStatus( projectDocument['status'] ),
id: projectDocument.id,
pledges: Pledges.getFromFirestore( projectDocument.reference.collection('pledges') ),
);
}
/// returns a map that can be used for storing this project in the firestore
Map<String, dynamic> toMap()
{
return
{
'name': name,
'publisher': publisher,
'link': link,
'date': date.toString(),
'status': describeEnum( status ),
};
}
}
/// turn a stringified status into the enum
ProjectStatus getAsStatus( String value )
{
return ProjectStatus.values.firstWhere( (element) => describeEnum(element) == value );
}
/// the current status of the project
enum ProjectStatus
{
PreLaunch,
Campaign,
Successful,
LatePledge,
Production,
Shipping,
Delivered,
}
/// a class for handling the connection to the firestore that stores everything
class ProjectsDatabase
{
//////////////////////////////////////////////////
// CONSTRUCTORS
//////////////////////////////////////////////////
ProjectsDatabase._privateConstructor()
{
loadProjects( null );
}
//---------------------------------------------------------
// STATIC VARIABLES
//---------------------------------------------------------
static final ProjectsDatabase database = ProjectsDatabase._privateConstructor();
//---------------------------------------------------------
// INSTANCE VARIABLES
//---------------------------------------------------------
List<Project> _projects = [];
final _projectFirebase = FirebaseFirestore.instance.collection( 'projects' );
bool upToDate = false;
//---------------------------------------------------------
// INSTANCE METHODS
//---------------------------------------------------------
/// returns the list of loaded projects, to be sure the list is up to date
/// a call should be made to [checkProjects] first, which provides a way for
/// a synchronus method to get the projects
List<Project> getProjects()
{
return _projects;
}
/// check if the projects are up to date, and request an async reload if not,
/// should be called prior to call to [getProjects]. If the projects need to be
/// updated the reload function will be called once the projects are loaded
bool checkProjects( void Function() reload )
{
if( !upToDate )
{
loadProjects( reload );
return false;
}
return true;
}
/// add a project to the firestore
void addProject( Project project ) async
{
var doc = _projectFirebase.doc();
project.id = doc.id;
upToDate = false;
await _projectFirebase.doc( project.id ).set( project.toMap() );
CollectionReference<Map<String, dynamic>> pledgesCollection = _projectFirebase.doc( project.id ).collection( 'pledges' );
project.pledges.addToFirestore(pledgesCollection);
loadProjects( null );
}
void updateProject( Map<String, dynamic> updates, String projectId ) async
{
upToDate = false;
await _projectFirebase.doc( projectId ).update( updates );
loadProjects( null );
}
void deleteProject( String projectId ) async
{
upToDate = false;
await _projectFirebase.doc( projectId ).delete();
loadProjects( null );
}
/// updates a pledge on a particular project
void updatePledges( Pledge pledge, String projectId, bool newPledge )
{
if( newPledge )
{
_projectFirebase.doc( projectId )
.collection( 'pledges' )
.add( pledge.toMap() );
}
else
{
}
}
/// load the projects from the firestore
void loadProjects( void Function()? reload ) async
{
// TODO there is almost certainly a better way to do this
await _projectFirebase
.get()
.then( (snapshot) {
List<QueryDocumentSnapshot<Map<String, dynamic>>> projects = snapshot.docs;
_projects = projects.map( (snapshot) => Project.getFromFirestore(snapshot) ).toList();
upToDate = true;
if( reload != null )
{
reload.call();
}
});
}
} | 26.793814 | 123 | 0.634475 |
641f05b97594a95090cc684863a9544b61050717 | 2,483 | py | Python | fastapi+filesUpdate/main.py | DeSireFire/Fastapi-sample | a7999aedfc25494f5fd6120c7b8042aa8d130693 | [
"MIT"
] | null | null | null | fastapi+filesUpdate/main.py | DeSireFire/Fastapi-sample | a7999aedfc25494f5fd6120c7b8042aa8d130693 | [
"MIT"
] | null | null | null | fastapi+filesUpdate/main.py | DeSireFire/Fastapi-sample | a7999aedfc25494f5fd6120c7b8042aa8d130693 | [
"MIT"
] | null | null | null | #!/usr/bin/env python3
# -*- coding: utf-8 -*-
# Author : RaXianch
# CreatDATE : 2021/8/21
# CreatTIME : 20:15
# Blog : https://blog.raxianch.moe/
# Github : https://github.com/DeSireFire
__author__ = 'RaXianch'
from typing import List
import uvicorn
import time
from fastapi import FastAPI, File, UploadFile
from starlette.responses import HTMLResponse
app = FastAPI()
# file: bytes = File(...), # 把文件对象转为bytes类型，这种类型的文件无法保存
# fileb: UploadFile = File(...), # UploadFile转为文件对象，可以保存文件到本地
# notes: str = Form(...) # 获取普通键值对
@app.post("/file/")
async def create_files(file: bytes = File(...)):
with open('./base.jpg', 'wb') as f:
f.write(file)
return {"fileSize": len(file)}
@app.post('/uploadFile')
async def uploadFile(file: UploadFile = File(...)):
"""缺少验证是否上传文件"""
content = await file.read()
with open('./test.jpg', 'wb') as f:
f.write(content)
return {"filename": file.filename}
@app.post("/files/")
async def create_files(
files: List[bytes] = File(...)
):
print(type(files))
print(files)
for i in files:
with open(f'./{time.time()}.jpg', 'wb') as f:
f.write(i)
return {"file_sizes": [len(file) for file in files]}
@app.post("/uploadfiles/")
async def create_upload_files(
files: List[UploadFile] = File(...)
):
for i in files:
content = await i.read()
if content:
print(content)
with open(f'./{time.time()*1000}.jpg', 'wb') as f:
f.write(content)
return {"filenames": [file.filename for file in files]}
@app.get("/")
async def main():
content = """
<body>
<form action="/file/" enctype="multipart/form-data" method="post">
<input name="file" type="file">
<input type="submit" value="file上传">
</form>
<form action="/files/" enctype="multipart/form-data" method="post">
<input name="files" type="file" multiple>
<input type="submit" value="files上传">
</form>
<form action="/uploadFile/" enctype="multipart/form-data" method="post">
<input name="file" type="file">
<input type="submit" value="uploadFile上传">
</form>
<form action="/uploadfiles/" enctype="multipart/form-data" method="post">
<input name="files" type="file" multiple>
<input type="submit" value="uploadfiles上传">
</form>
</body>
"""
return HTMLResponse(content=content)
if __name__ == '__main__':
uvicorn.run(app)
| 26.136842 | 77 | 0.604913 |
4d7bdc3d915789bd94a31681a08428ab457493a5 | 1,001 | cs | C# | src/Inflatable/QueryProvider/CachedResult.cs | cjwang/Inflatable | 64601b3ce6d46e5752a77b6f72dbc8764c3517a9 | [
"Apache-2.0"
] | 1 | 2020-10-09T06:17:44.000Z | 2020-10-09T06:17:44.000Z | src/Inflatable/QueryProvider/CachedResult.cs | cjwang/Inflatable | 64601b3ce6d46e5752a77b6f72dbc8764c3517a9 | [
"Apache-2.0"
] | null | null | null | src/Inflatable/QueryProvider/CachedResult.cs | cjwang/Inflatable | 64601b3ce6d46e5752a77b6f72dbc8764c3517a9 | [
"Apache-2.0"
] | null | null | null | using BigBook;
using System;
namespace Inflatable.QueryProvider
{
/// <summary>
/// Cached result
/// </summary>
public class CachedResult
{
/// <summary>
/// Initializes a new instance of the <see cref="QueryResults"/> class.
/// </summary>
/// <param name="value">The value.</param>
/// <param name="objectType">Type of the object.</param>
/// <exception cref="ArgumentNullException">query</exception>
public CachedResult(Dynamo value, Type objectType)
{
Value = value ?? throw new ArgumentNullException(nameof(value));
ObjectType = objectType;
}
/// <summary>
/// Gets the type of the object.
/// </summary>
/// <value>The type of the object.</value>
public Type ObjectType { get; }
/// <summary>
/// Gets the value.
/// </summary>
/// <value>The value.</value>
public Dynamo Value { get; }
}
} | 28.6 | 79 | 0.547453 |
bd4a8510140eed17efcc57dfabf8a4652f9b3cc0 | 363 | sql | SQL | Aula06.sql | TulioEstrelaMarques/CeV--MySQL | ff85549ff0cebb95a58d5fea3385c9960ac30114 | [
"MIT"
] | null | null | null | Aula06.sql | TulioEstrelaMarques/CeV--MySQL | ff85549ff0cebb95a58d5fea3385c9960ac30114 | [
"MIT"
] | null | null | null | Aula06.sql | TulioEstrelaMarques/CeV--MySQL | ff85549ff0cebb95a58d5fea3385c9960ac30114 | [
"MIT"
] | null | null | null | desc gafanhotos;
alter table pessoas
rename to gafanhotos;
alter table pessoas
add column profissao varchar(10) after nome;
alter table pessoas
modify profissao varchar(20) not null default '';
alter table pessoas
change profissao prof varchar(20);
alter table pessoas
add codigo int first;
alter table pessoas
drop column profissao;
select * from pessoas; | 17.285714 | 49 | 0.796143 |
552a4a4c12ac398e670cfd3f44d94b90a7236ec5 | 4,248 | cs | C# | Controllers/PDF/AdventureCycleController.cs | ESA-Security-Group/ej2-aspnetmvc-samples | b62e3643d8aeca022b479f80629b9d822d395e83 | [
"Net-SNMP",
"Xnet"
] | null | null | null | Controllers/PDF/AdventureCycleController.cs | ESA-Security-Group/ej2-aspnetmvc-samples | b62e3643d8aeca022b479f80629b9d822d395e83 | [
"Net-SNMP",
"Xnet"
] | null | null | null | Controllers/PDF/AdventureCycleController.cs | ESA-Security-Group/ej2-aspnetmvc-samples | b62e3643d8aeca022b479f80629b9d822d395e83 | [
"Net-SNMP",
"Xnet"
] | null | null | null | using System;
using System.Collections.Generic;
using System.Web.Mvc;
using Syncfusion.Mvc.Pdf;
using Syncfusion.Pdf;
using Syncfusion.Pdf.Graphics;
using Syncfusion.Pdf.Grid;
using System.Data;
using System.Drawing;
namespace EJ2MVCSampleBrowser.Controllers.PDF
{
public partial class PdfController : Controller
{
# region Private Members
# endregion
//
// GET: /AdventureCycle/
public ActionResult AdventureCycle()
{
List<string> styleList = new List<string>();
foreach (var style in Enum.GetValues(typeof(PdfGridBuiltinStyle)))
{
styleList.Add(style.ToString());
}
ViewData.Add("styleName", new SelectList(styleList));
return View();
}
[AcceptVerbs(HttpVerbs.Post)]
public ActionResult AdventureCycle(string styleName, string Header, string Bandedrow, string Bandedcolumn, string Firstcolumn, string Lastcolumn, string Lastrow, string InsideBrowser)
{
if (styleName == "")
styleName = "GridTable4";
//Create PDF document
PdfDocument doc = new PdfDocument();
//Set font
PdfFont font = new PdfStandardFont(PdfFontFamily.Helvetica, 7);
//Create Pdf ben for drawing broder
PdfPen borderPen = new PdfPen(PdfBrushes.DarkBlue);
borderPen.Width = 0;
//Create DataTable for source
PdfPage page = doc.Pages.Add();
//Use DataTable as source
PdfGrid grid = new PdfGrid();
//Create dataset with the "Customers" table from Norwind database
DataSet dataSet = GetReportsDataSet1();
DataTable dt = dataSet.Tables[0];
string[] unwantedColumns = { "Freight", "EmployeeID", "OrderDate", "RequiredDate", "ShippedDate", "ShipVia", "ShipRegion" };
foreach (string columnIndex in unwantedColumns)
{
dt.Columns.Remove(columnIndex);
}
grid.Style.AllowHorizontalOverflow = true;
//Set Data source
grid.DataSource = dt;
#region PdfGridBuiltinStyleSettings
PdfGridBuiltinStyleSettings setting = new PdfGridBuiltinStyleSettings();
setting.ApplyStyleForHeaderRow = Header!=null ? true : false;
setting.ApplyStyleForBandedRows = Bandedrow != null ? true : false;
setting.ApplyStyleForBandedColumns = Bandedcolumn != null ? true : false;
setting.ApplyStyleForFirstColumn = Firstcolumn != null ? true : false;
setting.ApplyStyleForLastColumn = Lastcolumn != null ? true : false;
setting.ApplyStyleForLastRow = Lastrow != null ? true : false;
#endregion
//Set layout properties
PdfLayoutFormat format = new PdfLayoutFormat();
format.Break = PdfLayoutBreakType.FitElement;
format.Layout = PdfLayoutType.Paginate;
PdfGridBuiltinStyle style = ConvertToPdfGridBuiltStyle(styleName);
grid.ApplyBuiltinStyle(style, setting);
grid.Style.Font = font;
//Draw table
grid.Draw(page, PointF.Empty, format);
//Save to disk
//Stream the output to the browser.
if (InsideBrowser == "Browser")
return doc.ExportAsActionResult("sample.pdf", HttpContext.ApplicationInstance.Response, HttpReadType.Open);
else
return doc.ExportAsActionResult("sample.pdf", HttpContext.ApplicationInstance.Response, HttpReadType.Save);
}
# region Helpher Methods
private PdfGridBuiltinStyle ConvertToPdfGridBuiltStyle(string styleName)
{
PdfGridBuiltinStyle value = (PdfGridBuiltinStyle)Enum.Parse(typeof(PdfGridBuiltinStyle), styleName);
return value;
}
private DataSet GetReportsDataSet1()
{
DataSet dataSet = new DataSet();
dataSet.ReadXml(ResolveApplicationDataPath("Orders.xml"));
return dataSet;
}
#endregion
}
}
| 35.4 | 191 | 0.605461 |
f6047b76f879576f6b508db222ab767c8389dd2d | 42 | sql | SQL | src/main/resources/com/intirix/openmm/server/mt/technical/sql/user_delete.sql | intirix/openmm-server | be8216786cf0ed2a5d4caf8b12df666bf30dae7e | [
"MIT"
] | null | null | null | src/main/resources/com/intirix/openmm/server/mt/technical/sql/user_delete.sql | intirix/openmm-server | be8216786cf0ed2a5d4caf8b12df666bf30dae7e | [
"MIT"
] | null | null | null | src/main/resources/com/intirix/openmm/server/mt/technical/sql/user_delete.sql | intirix/openmm-server | be8216786cf0ed2a5d4caf8b12df666bf30dae7e | [
"MIT"
] | null | null | null | DELETE FROM OPENMM_USERS WHERE USER_ID = ? | 42 | 42 | 0.809524 |
af3e99a26c03f2c02ecef61a164d1637f51c55f6 | 31,425 | py | Python | TOFAnalyzer_DRS4_New_Hit_Finder.py | stevenblock2/DRS4-Analysis-Code-Python | 699c6a18d256bc35d2d378fe580e9a74aeb5d094 | [
"MIT"
] | null | null | null | TOFAnalyzer_DRS4_New_Hit_Finder.py | stevenblock2/DRS4-Analysis-Code-Python | 699c6a18d256bc35d2d378fe580e9a74aeb5d094 | [
"MIT"
] | null | null | null | TOFAnalyzer_DRS4_New_Hit_Finder.py | stevenblock2/DRS4-Analysis-Code-Python | 699c6a18d256bc35d2d378fe580e9a74aeb5d094 | [
"MIT"
] | null | null | null | #!/usr/bin/python3
"""
October 25, 2018
Author: Steven Block
TOF_Analyzer_DRS4.py
This program takes data from a DRS4 data file and computes:
Per Channel:
Pulse height distributions
Rise/Fall Times based on polarity
A Combination of possible Time of Flights to establish best two detectors.
Future work:
- Multiple peaks per events
- more configuration settings?
"""
import sys
import subprocess
import timeFinder as tf
print(sys.version_info[1])
if sys.version_info[0] < 3 and sys.version_info[1] < 7:
raise Exception("Must be using Python 3.7!!!!")
try:
import pip
except ImportError:
print("Pip not present on system! Installing Pip...")
try:
subprocess.call([sys.executable,'-m','ensurepip','--default-pip'],shell =True)
subprocess.call([sys.executable, "easy_install", "python3-pip"],shell =True)
except:
print('Could not install pip automatically, please install pip manually by typing "easy_install pip" into your terminal application')
def install_and_import(package):
import importlib
try:
importlib.import_module(package)
except:
subprocess.call([sys.executable, "-m", "pip", "install", package])
finally:
globals()[package] = importlib.import_module(package)
install_and_import('matplotlib')
install_and_import('numpy')
install_and_import('scipy')
install_and_import('uncertainties')
install_and_import('pandas')
install_and_import('lmfit')
install_and_import('tqdm')
from itertools import combinations
from tqdm import tqdm
import matplotlib
matplotlib.use('TkAgg')
import matplotlib.pyplot as plt
import numpy as np
import struct
import array
import pandas as pd
from math import *
#from scipy.stats import poisson
try:
import Tkinter as tk # this is for python2
except:
import tkinter as tk # this is for python3
#from tkinter.filedialog import askopenfilename,askopenfilenames
from tkfilebrowser import askopenfilenames
import os
import scipy.signal as scisig
from drs4 import DRS4BinaryFile
from scipy import stats
from time import sleep
from matplotlib.ticker import EngFormatter
from scipy.optimize import curve_fit,least_squares
from scipy.misc import factorial
from scipy.optimize import minimize
from lmfit.models import GaussianModel,Model
# Print iterations progress
import warnings
warnings.simplefilter(action='ignore', category=FutureWarning)
def poisson(p,k):
lamb,amp=p[0],p[1]
lnl = amp*(lamb**(k))/factorial(k) * np.exp(-lamb)
return lnl
def PEModel(x,A,sigma,gain,mu,n):
prob = np.exp(-mu)*mu**n/factorial(n)
print(A,sigma,gain,mu,n)
return A*prob*[1/np.sqrt(2*np.pi*sigma)*np.exp((x-n*gain)**2/(2*sigma**2))]
def poissonMinimizer(p,k,Y):
lamb,amp=p[0],p[1]
lnl = amp*(lamb**(k))/factorial(k) * np.exp(-lamb)-Y
return np.log(lnl**2)
def printProgressBar (iteration, total, prefix = '', suffix = '', decimals = 1, length = 100, fill = '*'):
"""
Call in a loop to create terminal progress bar
@params:
iteration - Required : current iteration (Int)
total - Required : total iterations (Int)
prefix - Optional : prefix string (Str)
suffix - Optional : suffix string (Str)
decimals - Optional : positive number of decimals in percent complete (Int)
length - Optional : character length of bar (Int)
fill - Optional : bar fill character (Str)
"""
percent = ("{0:." + str(decimals) + "f}").format(100 * (iteration / float(total)))
filledLength = int(length * iteration // total)
bar = fill * filledLength + '-' * (length - filledLength)
print('\r%s |%s| %s%% %s' % (prefix, bar, percent, suffix), end = '\r')
# Print New Line on Complete
if iteration == total:
print()
def weighted_avg_and_std(values, weights):
"""
Return the weighted average and standard deviation.
values, weights -- Numpy ndarrays with the same shape.
"""
values = np.array(values)
values = values[np.isfinite(values)]
average = np.nanmean(values)
# Fast and numerically precise:
std = np.nanstd(values)
return [np.round(average,3), np.round(std,3)]
def Interpolator(X, Y, TimeleftIndex, TimeRightIndex,YValue):
"""
Interpolate exact time Y == YValue using 4 points around closest data point to YValue
Returns a tuple with time and error associated.
"""
Y1 = Y[TimeleftIndex]
Y2 = Y[TimeRightIndex]
X2 = X[TimeRightIndex]
X1 = X[TimeleftIndex]
slope = (Y2 - Y1) / (X2 - X1)
if slope != 0:
X0 = (YValue - Y1) / slope + X1
return X0
else:
return 0
def filterData(Y):
return scisig.savgol_filter(x=Y, window_length=51, polyorder=11)
def gauss(x, *p):
A, mu, sigma = p
return A*np.exp(-(x-mu)**2/(2.*sigma**2))
def gaussMinimizer(p,x,Y):
A, mu, sigma = p[0],p[1],p[2]
return np.log((A*np.exp(-(x-mu)**2/(2.*sigma**2))-Y)**2+1)
def hifinderScipy(p):
#p = filterData(Y)
NoiseSigma = 7
baseline = np.mean(p[:50])
noiserms = np.std(p[:50])
hitStartIndexList = []
hitEndIndexList = []
hitPeakAmplitude = []
hitPeakIndexArray = []
Max = abs(max(p[100:900]))
Min = abs(min(p[100:900]))
#print(baseline - (baseline-NoiseSigma*noiserms))
if Max > Min and max(p[100:900]) > baseline + NoiseSigma*noiserms:
peaks, properties = scipy.signal.find_peaks(p, prominence=.005, width=6,height = baseline - (baseline-NoiseSigma*noiserms))
elif Min > Max and min(p[100:900]) < baseline - NoiseSigma*noiserms:
peaks, properties = scipy.signal.find_peaks(-p, prominence=.005, width=6,height = baseline - (baseline-NoiseSigma*noiserms))
else:
peaks, properties = [],{'widths':[]}
for (peak,width) in zip(peaks,properties['widths']):
hitAmplitude = p[peak]
#ThresholdADC = baseline - (.3 * (baseline - hitAmplitude))
hitEndIndex = peak + int(width)
hitStartIndex = peak - int(width)
if abs(hitAmplitude) < 500 and hitStartIndex != 0 and hitEndIndex !=0 and peak !=0 and hitEndIndex < 1023 and peak < hitEndIndex and peak > hitStartIndex and peak - int(width) > 100 and peak + int(width) < 900:
if eventNumber % SubDivider == 0:
PersistanceData.append(Data)
PersistanceTime.append(np.arange(0,1024)*.2)
hitStartIndexList = np.append(hitStartIndexList, hitStartIndex)
hitEndIndexList = np.append(hitEndIndexList,hitEndIndex)
hitPeakAmplitude = np.append(hitPeakAmplitude, hitAmplitude)
hitPeakIndexArray = np.append(hitPeakIndexArray, peak)
return [[int(x) for x in hitStartIndexList], hitPeakAmplitude, [int(x) for x in hitPeakIndexArray],[int(x) for x in hitEndIndexList], baseline, noiserms]
def hitfinder(Y):
#noiserms = np.std(Y[:50])**2
p = Y# scisig.savgol_filter(x=Y, window_length=25, polyorder=5)
NoiseSigma = 3
baseline = np.mean(Y[:50])
noiserms = np.std(Y[:50])
durationTheshold=5
adjDurationThreshold=5
#plt.plot(Y)
#plt.show()
#print(baseline,NoiseSigma,abs(baseline) + NoiseSigma * noiserms)
p_diff = np.diff(p)
#1mV per tick = .001
#2mV per tick = .002
#etc...
if abs(min(Y)) > abs(max(Y)):
hitLogic = np.array([(True if pi < baseline - NoiseSigma * noiserms else False) for pi in Y])
else:
hitLogic = np.array([(True if pi > baseline + NoiseSigma * noiserms else False) for pi in Y])
for i in range(1, np.size(hitLogic)):
if ((not hitLogic[i - 1]) and hitLogic[i]) and hitLogic[i]:
countDuration = 0
for j in range(i, np.size(hitLogic) - 1):
if hitLogic[j]:
countDuration = countDuration + 1
if not hitLogic[j + 1]:
break
if countDuration < durationTheshold:
for j in range(i, i + countDuration):
hitLogic[j] = False
for i in range(1, np.size(hitLogic)):
if (hitLogic[i - 1] and (not hitLogic[i])) and (not hitLogic[i]):
countDuration = 0
for j in range(i, np.size(hitLogic) - 1):
if (not hitLogic[j]):
countDuration = countDuration + 1
if hitLogic[j + 1]:
break
if countDuration < adjDurationThreshold:
for j in range(i, i + countDuration):
hitLogic[j] = True
hitStartIndexList = []
hitEndIndexList = []
hitPeakAmplitude = []
hitPeakIndexArray = []
hitEndIndex = 0
hitStartIndex = 0
hitPeakIndex = 0
eventNumber = 0
global SubDivider
global PersistanceData
global PersistanceTime
for i in range(1, np.size(hitLogic)):
if ((not hitLogic[i - 1]) and hitLogic[i]) and hitLogic[i]:
hitAmplitude = 0
hitPeakIndex = i
for j in range(i, np.size(hitLogic) - 1):
if abs(p[j]) > abs(hitAmplitude):
hitAmplitude = p[j]
hitPeakIndex = j
if not hitLogic[j + 1]:
break
ThresholdADC = baseline - (.3 * (baseline - hitAmplitude))
hitStartIndex = i
for j in range(hitPeakIndex, 0, -1):
if (abs(p[j]) >= abs(ThresholdADC) and abs(p[j - 1]) < abs(ThresholdADC)):
hitStartIndex = int(j)
break
for j in range(hitPeakIndex, np.size(hitLogic) - 1, 1):
if not hitLogic[j]:
hitEndIndex = int(j)
break
#print(hitStartIndex,hitEndIndex,hitPeakIndex,hitAmplitude)
#print(bool(hitStartIndex-hitEndIndex > 3))
if abs(hitEndIndex-hitStartIndex) > 10 and abs(hitAmplitude) < .5 and hitStartIndex != 0 and hitEndIndex !=0 and hitPeakIndex !=0 and hitEndIndex < 1023 and hitPeakIndex < hitEndIndex and hitPeakIndex > hitStartIndex:
if eventNumber % SubDivider == 0:
PersistanceData.append(Data)
PersistanceTime.append(np.arange(0,1024)*.2)
hitStartIndexList = np.append(hitStartIndexList, hitStartIndex)
hitEndIndexList = np.append(hitEndIndexList,hitEndIndex)
hitPeakAmplitude = np.append(hitPeakAmplitude, hitAmplitude)
hitPeakIndexArray = np.append(hitPeakIndexArray, hitPeakIndex)
i = hitEndIndex
#print([hitStartIndexList, hitPeakAmplitude, hitPeakIndexArray, baseline, NoiseSigma])
if len(hitPeakAmplitude) > 1:
minpeak = min(hitPeakAmplitude)
maxpeak = max(hitPeakAmplitude)
if abs(maxpeak) > abs(minpeak):
Indexes = np.nonzero(hitPeakAmplitude > 0)
else:
Indexes = np.nonzero(hitPeakAmplitude < 0)
hitStartIndexList = hitStartIndexList[Indexes]
hitEndIndexList = hitEndIndexList[Indexes]
hitPeakAmplitude = hitPeakAmplitude[Indexes]
hitPeakIndexArray = hitPeakIndexArray[Indexes]
return [[int(x) for x in hitStartIndexList], hitPeakAmplitude, [int(x) for x in hitPeakIndexArray],[int(x) for x in hitEndIndexList], baseline, noiserms]
def RisetimeFinder(X, Y,startIndex,peakIndex,baseline):
"""
Find peak location for proper interpolotion
Returns a returns time that waveform hit 40% of peak value
"""
# Channel1Data is from first TOF
# Channel2Data is from second TOF
hitAmplitude = Y[peakIndex]
UpperThreshold = baseline - (.7 * (baseline - hitAmplitude))
LowerThreshold = baseline - (.3 * (baseline - hitAmplitude))
riseTimestart = 0
riseTimeend = 0
riseIndex = 0
fallIndex = 0
diffs = Y[startIndex:peakIndex]-UpperThreshold
value = np.min(abs(diffs))
noiserms = np.std(Y[:50])*5
YStart = Y[startIndex]
YSign =np.sign(Y[startIndex])
#print(value,diffs)
#print(np.where(value == abs(diffs))[0][0])
riseIndex = int(np.where(value == abs(diffs))[0][0]) + startIndex
diffs = Y[startIndex:peakIndex]-LowerThreshold
value = np.min(abs(diffs))
fallIndex = int(np.where(value == abs(diffs))[0][0]) + startIndex
riseTimestart = Interpolator(X, Y, riseIndex-1,riseIndex+1,UpperThreshold)
riseTimeend = Interpolator(X, Y, fallIndex-1,fallIndex+1,LowerThreshold)
#print(UpperThreshold,LowerThreshold)
result = dict()
result['risetime'] = riseTimestart-riseTimeend
result['starttime'] = riseTimeend
if riseTimestart < X[startIndex] or riseTimestart > X[EndIndex] or riseTimeend < X[startIndex] or riseTimeend > X[EndIndex]:
result['risetime']= False
if riseTimestart - riseTimeend > (X[EndIndex] - X[startIndex]):
result['risetime']= False
if riseTimestart - riseTimeend <= 0:
result['risetime']= False
if riseIndex == 0 or fallIndex ==0:
result['risetime']= False
if YSign > 0:
if(YStart > baseline + noiserms):
result['risetime']= False
if YSign < 0:
if(YStart < baseline - noiserms):
result['risetime']= False
if len(np.unique(np.sign(np.diff(Y[fallIndex:startIndex])))) > 1:
result['risetime']= False
return result
def Lowpass(Y):
CutoffFreq = 5000
pedestle = list(Y[:50])
pedestle.extend(np.zeros(len(Y)-50))
fftpedestle= scipy.fft(pedestle)# (G) and (H)
fft= scipy.fft(Y)
newfft = fft-fftpedestle
bp=newfft[:]
# for i in range(len(bp)): # (H-red)
# if i>=CutoffFreq:bp[i]=0
ibp=scipy.ifft(bp) # (I), (J), (K) and (L)
return ibp
def DCS(Y):
step = 80
newY = np.ones(len(Y)-step-1)
for i in range(0,len(Y)-step-1):
newY[i] = Y[i+step] - Y[i]
plt.plot(Y,label= 'RAW')
plt.plot(newY,label= 'DCS')
plt.legend(loc='best')
plt.show()
def reject_outliers(TimeDeltas,TimeRes, m):
"""
Conducts m-sigma rejection for a given dataset to ensure statistical outliers do not affect results
Returns inputs with all statistical outliers removed
"""
mean,stdev = weighted_avg_and_std(TimeDeltas, TimeRes)
maskMin = mean - stdev * m
maskMax = mean + stdev * m
Indexes = np.where(abs(TimeDeltas-mean)>m*stdev)[0]
TimeDeltas = np.delete(TimeDeltas,Indexes)
TimeRes = np.delete(TimeRes,Indexes)
return TimeDeltas,TimeRes
def ChargeCalculator(Y,startIndex,EndIndex):
C = 1
Gain = 31
e = 1.602E-19
return (np.trapz(Y[startIndex:EndIndex],dx = .2E-9)*C/e)
def get_hist(ax,nbins):
n,bins = [],[]
finaln,finalbins = [],[]
bin = 0
iteration = 0
for rect in ax.patches:
((x0, y0), (x1, y1)) = rect.get_bbox().get_points()
n.append(y1-y0)
bins.append(x0) # left edge of each bin
finaln = [n[i:i + nbins] for i in range(0, len(n), nbins)]
finalbins = [bins[i:i + nbins] for i in range(0, len(bins), nbins)]
#print(finaln)
i = 0
for (arrayn,arrabins) in zip(finaln,finalbins):
if i ==0:
n = arrayn
bins = arrabins
else:
n = [n[i]+arrayn[i] for i in range(0,len(arrayn))]
i+=1
bins.append(x1) # also get right edge of last bin
return np.asarray(n,dtype=np.float32),np.asarray(bins,dtype=np.float32)
def FindHistPeaks(Y):
peaks, properties = scipy.signal.find_peaks(Y, width=10,height =5,prominence= 2,distance = 15)
return peaks,properties
root = tk.Tk()
root.withdraw()
print('I owe a million dollars!')
FileNames = askopenfilenames(parent=root, initialfile='tmp',
filetypes=[("Binary Files", "*.dat")])
with DRS4BinaryFile(FileNames[0]) as events:
length = len(list(events))
itertor = 1
GainArray = []
GainErrorArray = []
for i in tqdm(range(len(FileNames)),'Files',dynamic_ncols=True,unit = 'Files'):
FileName = FileNames[i]
directory = os.path.dirname(FileName)
newDirectory = os.path.join(directory,FileName[:-4])
path,name = os.path.split(FileName)
if not os.path.exists(newDirectory):
os.mkdir(newDirectory)
with DRS4BinaryFile(FileName) as events:
length = len(list(events))
Data1 = pd.DataFrame()
Data2 = pd.DataFrame()
Data3 = pd.DataFrame()
Data4 = pd.DataFrame()
Divider = 1
SubDivider = 1000
PersistanceData = []
PersistanceTime = []
with DRS4BinaryFile(FileName) as f:
BoardID = f.board_ids[0]
NumberofChannels = f.channels[BoardID]
if len(NumberofChannels) > 1:
ReferenceChannel = NumberofChannels[0]
TimeWidths = f.time_widths[f.board_ids[0]][ReferenceChannel]
Time = np.arange(0,1024)*.2
eventNumber = 0
#printProgressBar(0, length, prefix = 'Progress:', suffix = 'Complete', length = 50)
for i in tqdm(range(length),'Events',dynamic_ncols=True,unit = 'Events'):
event = next(f)
RC = event.range_center
ADCData = event.adc_data
triggerCell = event.trigger_cells[BoardID]
for i in NumberofChannels:
if (eventNumber % Divider == 0):
Data = (ADCData[BoardID][i]/65535 + (RC/1000 - .5))
#DCS(Data)
Data = filterData(Data)
[hitStartIndexList, hitPeakAmplitude, hitPeakIndexArray,hitEndIndexList, baseline, rmsnoise] = hifinderScipy(Data) #hitfinder(Data)
#print(hitStartIndexList)
if hitStartIndexList:
for (startIndex,EndIndex,hitAmplitude,hitAmplitudeIndex) in zip(hitStartIndexList,hitEndIndexList,hitPeakAmplitude,hitPeakIndexArray):
#print(startIndex,EndIndex,hitAmplitude,hitAmplitudeIndex)
resultrt = RisetimeFinder(Time,Data,startIndex,hitAmplitudeIndex,baseline)
RiseTime,StartTime = resultrt['risetime'],resultrt['starttime']
if RiseTime == False:
continue
PulseHeight = hitAmplitude
Charge = ChargeCalculator(Data,startIndex,EndIndex)
PeakTime = Time[hitAmplitudeIndex]
ChargePedestle = ChargeCalculator(Data,0,50)
TempData = pd.DataFrame(data = {'0':[RiseTime],'1':[PulseHeight],'2':[Charge],'3':[PeakTime],'4':[rmsnoise],'5':[baseline],'6':[baseline+rmsnoise],'7':[ChargePedestle],'8':[StartTime]})
#print(TempData)
if eventNumber % SubDivider == 0:
plt.plot(Time,Data,'k')
plt.axvline(Time[startIndex],color = 'r',ymax = 1,linewidth=.2)
plt.axvline(Time[hitAmplitudeIndex],color = 'g',ymax = 1,linewidth=.2)
plt.axvline(Time[EndIndex],color = 'b',ymax = 1,linewidth=.2)
if i == 1:
Data1 = Data1.append(TempData,ignore_index=True)
if i == 2:
Data2 = Data2.append(TempData,ignore_index=True)
if i == 3:
Data3 = Data3.append(TempData,ignore_index=True)
if i == 4:
Data4 = Data4.append(TempData,ignore_index=True)
#sleep(0.001)
#printProgressBar(eventNumber + 1, length, prefix = 'Progress:', suffix = 'Complete', length = 50)
eventNumber = eventNumber + 1
columnNames = []
plt.savefig(os.path.join(newDirectory,'Persistance.png'))
for i in NumberofChannels:
if i == NumberofChannels[0]:
columnNames = ["Channel {} Rise Time".format(i),"Channel {} Pulse Height".format(i),"Channel {} Cummulative Charge".format(i),"Channel {} Pulse Time".format(i),"Channel {} RMS Noise".format(i),"Channel {} Baseline".format(i),"Channel {} Pedestle".format(i),"Channel {} Charge Pedestle".format(i),"Channel {} Peak Start Time".format(i)]
else:
columnNames.extend(["Channel {} Rise Time".format(i),"Channel {} Pulse Height".format(i),"Channel {} Cummulative Charge".format(i),"Channel {} Pulse Time".format(i),"Channel {} RMS Noise".format(i),"Channel {} Baseline".format(i),"Channel {} Pedestle".format(i),"Channel {} Charge Pedestle".format(i),"Channel {} Peak Start Time".format(i)])
if 1 == NumberofChannels[0]:
Data = Data1
if 2 == NumberofChannels[0]:
Data = Data2
if 3 == NumberofChannels[0]:
Data = Data3
if 4 == NumberofChannels[0]:
Data = Data4
if 1 in NumberofChannels and 1 != NumberofChannels[0]:
Data = pd.concat([Data,Data1],axis=1,ignore_index=True)
if 2 in NumberofChannels and 2 != NumberofChannels[0]:
Data = pd.concat([Data,Data2],axis=1,ignore_index=True)
if 3 in NumberofChannels and 3 != NumberofChannels[0]:
Data = pd.concat([Data,Data3],axis=1,ignore_index=True)
if 4 in NumberofChannels and 4 != NumberofChannels[0]:
Data = pd.concat([Data,Data4],axis=1,ignore_index=True)
# print(Data.head(30),[e for e in columnNames if 'Channel' in e])
#Data= Data[(np.abs(stats.zscore(Data)) < 3).all(axis=1)]
#Data= Data[(np.abs(stats.zscore(Data)) < 3).all(axis=1)]
Data.columns = [e for e in columnNames if 'Channel' in e]
PulseHeightColumns = []
PulseHeightColumns = [column for column in columnNames if "Pulse Height" in column]
PulseandNoiseColumns = [column for column in columnNames if "Pulse Height" in column]
ChargeColumns = [column for column in columnNames if "Cummulative Charge" in column]
StartTimes = [column for column in columnNames if "Start Time" in column]
histPulseHieghts = Data.plot.hist(y = PulseandNoiseColumns,bins =1000,alpha = .3,subplots=False,title = 'Pulse Height Distributions',log=False,sharex = True)
plt.xlabel('Pulse Height (mV)')
plt.savefig(os.path.join(newDirectory,'Pulse_Height_Distribution.png'))
histCharge = Data.plot.hist(y = ChargeColumns,bins =1000,alpha = .3,subplots=False,title = 'Pulse Area Distribution',log=False,sharex = True)
plt.xlabel(r'Area ($\frac{pC}{e}$)')
plt.legend(ChargeColumns)
#print(n)
# for column in ChargeColumns:
# print("{} Statistics: \nMean Charge: {}\nVariance of Charge: {}".format(column,Data[column].mean(),Data[column].std()**2))
text = []
mu = []
variance = []
lammaList = []
amp = []
n, bins = get_hist(histCharge,1000)
bincenters = np.asarray([(bins[i]+bins[i-1])/2 for i in range(1,len(bins))],np.float32)
print([N for N in n])
if any(isinstance(el, list) for el in n):
print(n)
peaks,properties = FindHistPeaks(n)
#plt.plot(bincenters[peaks],n[peaks],'g+')
widths = scipy.signal.peak_widths(n, peaks, rel_height=0.5)
j = 0
scale = .5
for (peak,width) in zip(peaks,widths[0]):
try:
true_width = abs(bincenters[int(peak - width/2)]-bincenters[int(peak + width/2)])
X = bincenters[int(peak - width):int(peak + width)]
Y = n[int(peak - width):int(peak + width)]
mean,std = weighted_avg_and_std(X,Y)
p0 = [n[peak], mean, std]
bounds = [(0,.5*mean,.5*std),(n[peak],1.5*mean,1.5*std)]
res = least_squares(gaussMinimizer, p0, loss='linear', f_scale=scale,args=(X,Y),bounds = bounds,xtol = 1E-20,ftol = 1E-15,x_scale = 'jac',tr_solver = 'lsmr',max_nfev=1E4)
mu.append(res.x[1])
variance.append(res.x[2]**2)
amp.append(res.x[0])
except:
pass
print(mu,len(mu))
j = j+1
# for i in range(0,len(mu)+1):
# if i==0 and i < len(mu):
# mod = Model(PEModel,prefix = 'f{}_'.format(i))
# pars = mod.make_params(verbose = True)
# pars['f{}_n'.format(i)].set(value = i+1,vary = False)
# pars['f{}_A'.format(i)].set(value = amp[i],min = 0)
# pars['f{}_mu'.format(i)].set(value = 1,min = 0,max = 100)
# pars['f{}_sigma'.format(i)].set(min = 0,value = np.sqrt(variance[i]))
# pars['f{}_gain'.format(i)].set(brute_step= 1E5,min = 1E5,max = 1E10,value = 1E8)
# elif i == 0 and not len(mu):
# mod = Model(PEModel,prefix = 'f{}_'.format(i))
# pars = mod.make_params(verbose = True)
# pars['f{}_n'.format(i)].set(value = i+1,vary = False)
# pars['f{}_A'.format(i)].set(value = amp[i],min = 0)
# pars['f{}_mu'.format(i)].set(value = 1,min = 0,max = 100)
# pars['f{}_sigma'.format(i)].set(min = 0)
# pars['f{}_gain'.format(i)].set(brute_step= 1E5,min = 1E5,max = 1E10,value = 1E8)
# else:
# tempmod = Model(PEModel,prefix = 'f{}_'.format(i))
# temppars = tempmod.make_params(verbose = True)
# temppars['f{}_n'.format(i)].set(value = i+1,vary = False)
# mod+=tempmod
# pars+=temppars
# pars['f{}_gain'.format(i)].set(expr ='f{}_gain'.format(i-1) )
# pars['f{}_mu'.format(i)].set(expr = 'f{}_mu'.format(i-1))
# pars['f{}_sigma'.format(i)].set(min = 0)
# pars['f{}_A'.format(i)].set(value = 50,min = 0)
#WORKING
for i in range(0,len(mu)+1):
if i == 0 and i < len(mu):
mod = GaussianModel(prefix = 'f{}_'.format(i))
pars = mod.guess(n,x=bincenters, sigma=np.sqrt(variance[i]),height = amp[i],center = mu[i])
if len(mu) >=2:
pars.add('G',value = mu[i+1]-mu[i],brute_step=.01*mu[i],min = .1*(mu[i+1]-mu[i]),max = 5*(mu[i+1]-mu[i]))
else:
pars.add('G',value = 1E8,min=1E5,max=1E10,brute_step = .1E5)
elif i >= len(mu) and i !=0:
tempmod = GaussianModel(prefix = 'f{}_'.format(i))
temppars = tempmod.guess(n,x=bincenters)
pars += temppars
pars['f{}_center'.format(i)].set(expr='G+f{}_center'.format(i-1))
mod += tempmod
elif i < len(mu):
tempmod = GaussianModel(prefix = 'f{}_'.format(i))
temppars = tempmod.guess(n,x=bincenters,center = mu[i], sigma=np.sqrt(variance[i]),height = amp[i])
pars += temppars
pars['f{}_center'.format(i)].set(expr='G+f{}_center'.format(i-1))
#pars['f{}_center'.format(i-1)].set(expr='G-f{}_center'.format(i))
mod += tempmod
elif not len(mu) and i==0:
mod = GaussianModel(prefix = 'f{}_'.format(i))
pars = mod.guess(n,x=bincenters)
pars.add('G',value = 1E8,min=1E5,max=1E10,brute_step = .1E5)
else:
pass
result = mod.fit(n, pars, x=bincenters)
print(result.fit_report())
#plt.plot(bincenters,n,'y')
#plt.plot(mu,amp,'k+')
vals = result.params.valuesdict()
mu = []
amp = []
for (key,value) in vals.items():
if 'center' in key:
mu.append(value)
if 'height' in key:
amp.append(value)
mu = [0] +mu
amp = [0]+amp
#print(mu,amp)
plt.plot(mu,amp,'g+')
vals = pars.valuesdict()
#print(result.params['G'].value)
GainError = result.params['G'].stderr
Gain = result.params['G'].value
#print(result.params["*_center"])
if GainError == None:
GainError = 1
print('Error approximation failed!')
GainArray.append(Gain)
GainErrorArray.append(GainError)
lamd = 0
if len(mu) >= 2:
newmu = np.arange(0,len(mu)) #print(result.params['G'].stderr)
newamp = np.array(amp)#/np.linalg.norm(amp) #[x/np.linalg.norm(amp) for x in amp]
p0= [1,newamp[1]*10]
bounds = [(0,newamp[1]),(newmu[-1],20*newamp[1])]
res = least_squares(poissonMinimizer, p0, loss='linear',args=(newmu, newamp),bounds=bounds,gtol = 1E-50,xtol = 1E-50,ftol = 1E-50,x_scale = 'jac',tr_solver = 'lsmr',max_nfev=1E4)
fit = poisson(res.x,newmu)
lamd = res.x[0]
#plt.stem(newmu*Gain, fit, 'r--',label =r"<$\mu$> = {}".format(np.round(res.x[0],3)))
plt.plot(bincenters,result.best_fit,'k',label = 'Gain = {:.2e} +/- {:.2e}, <$\mu$> = {}'.format(Gain,GainError,np.round(lamd,3)))
plt.legend(loc = 'best')
plt.savefig(os.path.join(newDirectory,'Pulse_Area_Distribution.png'))
Text = []
for i in NumberofChannels:
values = np.array(Data['Channel {} Rise Time'.format(i)].values)
values = values[np.isfinite(values)]
values = [x for x in values if abs(x - np.nanmean(values)) < 3*np.std(values)]
[ToFMean, TofStd] = weighted_avg_and_std(values,np.ones(len(Data.index)))
Text.append(r'$\tau_{}: \mu = {}ns; \sigma = {}ns$'.format(i,ToFMean,TofStd))
ristimeColumns = [column for column in columnNames if "Rise Time" in column]
histRiseTimes = Data.plot.hist(y =ristimeColumns,bins = 1000,alpha = .3,subplots=False,title = 'Rise Time Distributions')
plt.legend(Text)
plt.xlabel('Rise Times (ns)')
plt.savefig(os.path.join(newDirectory,'Rise_Time_Distribution.png'))
itertor = itertor +1
if len(FileNames) != 1:
plt.close('all')
#TOF Plotting
plt.figure()
if len(NumberofChannels) >1:
comb = combinations(NumberofChannels, 2)
for i in list(comb):
#print(i,Data['Channel {} Peak Start Time'.format(i[0])])
value1 = np.array(Data['Channel {} Peak Start Time'.format(i[0])].values)
#value1 = value1[np.isfinite(value1)]
value2 = np.array(Data['Channel {} Peak Start Time'.format(i[1])].values)
#value2 = value2[np.isfinite(value2)]
tofs = value1-value2
tofs = [x for x in tofs if abs(x - np.nanmean(tofs)) < 3*np.nanstd(tofs)]
tof = np.nanmean(tofs)
tofres = np.nanstd(tofs)
string = "TOF Between Inputs {} and {}: {}ns +/- {}ns".format(i[0],i[1],tof,tofres)
plt.hist(tofs,bins = 1000,alpha = .3,label = string)
plt.title('TOF Histogram')
plt.legend(loc='best')
plt.savefig(os.path.join(newDirectory,'TOF_Distributions.png'))
if len(FileNames) == 1:
plt.show()
#sys.exit()
else:
GainPlotting = str(input("Voltage Based Gain Plotting? (y/n): "))
plt.figure()
if GainPlotting == 'y':
LowVoltage = float(input("Lower Voltage?: "))
HighVoltage = float(input("Higher Voltage?: "))
Breakdown = float(input("Breakdown Voltage?: "))
X = np.linspace(LowVoltage,HighVoltage,len(GainArray)) - Breakdown
plt.xlabel('Breakdown Voltage (V)')
else:
X = [1,2,3,4,5.8,8]
print(X,GainArray,GainErrorArray)
#plt.errorbar(voltages, GainArray, yerr=GainErrorArray, fmt='o')
plt.errorbar(X, GainArray, yerr=GainErrorArray, fmt='o')
p = np.polyfit(X,GainArray,deg = 1)
p = np.poly1d(p)
plt.plot(X,p(X),label =r'Fit: m = {:.2E}, b = {:.2E}, $\mu$ = {:.2E}'.format(p[1],p[0],np.mean(GainArray)))
plt.legend(loc = 'best')
plt.ylabel('Gain')
plt.xlabel('Light Intensity (A.U)')
plt.ylim(1E6,2E8)
plt.savefig('Gain_Plot.png')
print("Analysis of Files Complete!")
plt.show()
#sys.exit()
| 42.124665 | 353 | 0.601623 |
05a1b393a2b21fbdf2f4c35ecd5816be8d29078a | 1,685 | py | Python | tests/server_test.py | SpringerPE/newrelic-alerts-manager | 5e7178aef2a7a4763857c3f0d50ccb38bacb006d | [
"MIT"
] | null | null | null | tests/server_test.py | SpringerPE/newrelic-alerts-manager | 5e7178aef2a7a4763857c3f0d50ccb38bacb006d | [
"MIT"
] | null | null | null | tests/server_test.py | SpringerPE/newrelic-alerts-manager | 5e7178aef2a7a4763857c3f0d50ccb38bacb006d | [
"MIT"
] | null | null | null | import unittest
import requests
import requests_mock
import yaml
import json
import datetime
from newrelic_alerting.server import ServersManager, ServersDataManager
two_hours_ago = (
datetime.datetime.utcnow() - datetime.timedelta(hours=2)
).strftime('%Y-%m-%dT%H:%M:%S+00:00')
just_now = (datetime.datetime.utcnow()).strftime('%Y-%m-%dT%H:%M:%S+00:00')
all_servers = [
{
'id': 86867839,
'account_id': 1111111,
'name': 'cell_z2-32-live-diego',
'host': 'cell_z2-32-live-diego',
'health_status': 'green',
'reporting': True,
'last_reported_at': just_now,
'summary': {
'cpu': 11.4,
'cpu_stolen': 0.0,
'disk_io': 0.03,
'memory': 24.3,
'memory_used': 6151995392,
'memory_total': 25282215936,
'fullest_disk': 38.6,
'fullest_disk_free': 1861000000
},
'links': {}
},
{
'id': 86713155,
'account_id': 1111111,
'name': 'cell_z2-33-dev-diego',
'host': 'cell_z2-33-dev-diego',
'health_status': 'green',
'reporting': False,
'last_reported_at': two_hours_ago,
'summary': {
'cpu': 11.4,
'cpu_stolen': 0.0,
'disk_io': 0.03,
'memory': 24.3,
'memory_used': 6151995392,
'memory_total': 25282215936,
'fullest_disk': 38.6,
'fullest_disk_free': 1861000000
},
'links': {}
}]
class MockServersDataManager(object):
def delete_server(self, server_id, params):
pass
def get_servers(self, params):
return all_servers
class TestServerManager(unittest.TestCase):
def setUp(self):
self.sdm = MockServersDataManager()
def test_cleanup_not_reporting_servers(self):
sm = ServersManager(self.sdm)
not_reporting = sm.get_not_reporting_servers(1)
self.assertEqual(len(not_reporting), 1)
self.assertEqual(not_reporting[0]["id"], 86713155)
| 21.602564 | 75 | 0.698516 |
b042d7e2b23075d8bbab3fe77f9c5aab496ac644 | 543 | py | Python | {{cookiecutter.project_name}}/{{cookiecutter.app_name}}/extensions.py | T8840/FlaskSkeleton | 544d2a509d992c0d3d7f20855811c384fca1a7f5 | [
"MIT"
] | null | null | null | {{cookiecutter.project_name}}/{{cookiecutter.app_name}}/extensions.py | T8840/FlaskSkeleton | 544d2a509d992c0d3d7f20855811c384fca1a7f5 | [
"MIT"
] | null | null | null | {{cookiecutter.project_name}}/{{cookiecutter.app_name}}/extensions.py | T8840/FlaskSkeleton | 544d2a509d992c0d3d7f20855811c384fca1a7f5 | [
"MIT"
] | null | null | null | """扩展模块。每个扩展在app.py中的app工厂中初始化."""
from flask_bcrypt import Bcrypt
from flask_caching import Cache
from flask_cors import CORS
from flask_debugtoolbar import DebugToolbarExtension
from flask_sqlalchemy import SQLAlchemy
from flask_migrate import Migrate
from flask_marshmallow import Marshmallow
from {{cookiecutter.app_name}}.commons.apispec import APISpecExt
bcrypt = Bcrypt()
db = SQLAlchemy()
migrate = Migrate(db=db)
cache = Cache()
cors = CORS()
apispec = APISpecExt()
debug_toolbar = DebugToolbarExtension()
serialize = Marshmallow()
| 27.15 | 64 | 0.815838 |
b9f057feb651d7d65ea41c20cfe548e182ec071b | 699 | dart | Dart | lib/design_patterns/builder/burger_builders/hamburger_builder.dart | victorcatn/flutter-design-patterns | ad8a65230bc29e785156ba574631da2fd51600de | [
"MIT"
] | 650 | 2020-12-07T06:17:27.000Z | 2022-03-31T18:04:51.000Z | lib/design_patterns/builder/burger_builders/hamburger_builder.dart | victorcatn/flutter-design-patterns | ad8a65230bc29e785156ba574631da2fd51600de | [
"MIT"
] | 12 | 2020-12-13T12:54:47.000Z | 2022-02-25T11:32:44.000Z | lib/design_patterns/builder/burger_builders/hamburger_builder.dart | victorcatn/flutter-design-patterns | ad8a65230bc29e785156ba574631da2fd51600de | [
"MIT"
] | 136 | 2020-12-07T17:32:07.000Z | 2022-03-29T16:54:27.000Z | import '../burger_builder_base.dart';
import '../ingredients/index.dart';
class HamburgerBuilder extends BurgerBuilderBase {
HamburgerBuilder() {
price = 1.0;
}
@override
void addBuns() {
burger.addIngredient(RegularBun());
}
@override
void addCheese() {
// Not needed
}
@override
void addPatties() {
burger.addIngredient(BeefPatty());
}
@override
void addSauces() {
burger.addIngredient(Ketchup());
burger.addIngredient(Mustard());
}
@override
void addSeasoning() {
burger.addIngredient(GrillSeasoning());
}
@override
void addVegetables() {
burger.addIngredient(Onions());
burger.addIngredient(PickleSlices());
}
}
| 17.04878 | 50 | 0.660944 |
b909222bddaf0414336790ed23872ec1ea1532c0 | 168 | cc | C++ | c_src/allocators.cc | silviucpp/ezlib | f7b74e29d26a9359062894c2e05649be2fca1868 | [
"MIT"
] | 16 | 2016-01-12T21:36:32.000Z | 2022-01-13T13:28:43.000Z | c_src/allocators.cc | silviucpp/ezlib | f7b74e29d26a9359062894c2e05649be2fca1868 | [
"MIT"
] | 2 | 2016-01-11T22:20:01.000Z | 2018-10-09T20:11:07.000Z | c_src/allocators.cc | silviucpp/ezlib | f7b74e29d26a9359062894c2e05649be2fca1868 | [
"MIT"
] | 3 | 2016-01-11T16:12:50.000Z | 2020-12-02T21:44:31.000Z | #include "allocators.h"
#include "erl_nif.h"
void* mem_allocate(size_t size)
{
return enif_alloc(size);
}
void mem_deallocate(void* ptr)
{
enif_free(ptr);
}
| 12 | 31 | 0.690476 |
2c7e801237ea626ae741f5008f2cad677b7389ef | 6,536 | cpp | C++ | Homeworks/miscellaneous/LW15/grade_calculator.cpp | sameer-h/CSCE121 | b6a302bfc248bfaedd03ab38060e12163458c7f8 | [
"MIT"
] | 1 | 2020-11-01T21:02:03.000Z | 2020-11-01T21:02:03.000Z | Homeworks/miscellaneous/LW15/grade_calculator.cpp | sameer-h/CSCE121 | b6a302bfc248bfaedd03ab38060e12163458c7f8 | [
"MIT"
] | null | null | null | Homeworks/miscellaneous/LW15/grade_calculator.cpp | sameer-h/CSCE121 | b6a302bfc248bfaedd03ab38060e12163458c7f8 | [
"MIT"
] | null | null | null | #include <vector>
#include <string>
#include <fstream>
#include <stdexcept>
#include "grade_calculator.h"
////////////////////////////////////////////////////////////////////////////////
// TODO(student): implement these methods
double GradeCalculator::exam_average() const {
// TODO(student)
double grade = 0;
int countGrades = 0;
double average;
for (size_t i = 0; i < exam_grades.size(); ++i) {
grade += exam_grades.at(i);
countGrades++;
}
grade += final_exam;
countGrades++;
double examAvg = grade / countGrades;
if (final_exam > examAvg) {
return final_exam;
}
average = grade / countGrades;
return average;
}
double GradeCalculator::zybook_average() const {
// TODO(student)
double grade = 0;
int countGrades = 0;
double average;
for (size_t i = 0; i < zybook_participation_grades.size(); ++i) {
grade += zybook_participation_grades.at(i);
countGrades++;
}
for (size_t i = 0; i < zybook_challenge_grades.size(); ++i) {
grade += zybook_challenge_grades.at(i);
countGrades++;
}
double zybookAvg = grade / countGrades;
if (zybookAvg >= 85) {
return 100;
}
average = zybookAvg + 15;
return average;
}
double GradeCalculator::hw_average() const {
// TODO(student)
double grade = 0;
int countGrades = 0;
double average;
for (size_t i = 0; i < hw_grades.size(); ++i) {
if (hw_redemption_grades.size() > i) {
if (hw_redemption_grades.at(i) > hw_grades.at(i)) {
grade += (hw_redemption_grades.at(i) - hw_grades.at(i)) / 2;
}
}
grade += hw_grades.at(i);
countGrades++;
}
average = grade / countGrades;
return average;
}
double GradeCalculator::lw_average() const {
// TODO(student)
double grade = 0;
int countGrades = 0;
double average;
for (size_t i = 0; i < lw_grades.size(); ++i) {
grade += lw_grades.at(i);
countGrades++;
}
average = 100 * (grade / countGrades);
return average;
}
double GradeCalculator::final_grade_numeric() const {
// TODO(student)
double grade = exam_average() * (0.5) +
zybook_average() * (0.07) +
hw_average() * (0.35) +
lw_average() * (0.08);
return grade;
}
char GradeCalculator::final_grade_letter() const {
// TODO(student)
double course_avg = final_grade_numeric();
if (!has_syllabus_ack || course_avg < 60) { // no syllabus acknowledgement
return 'F';
} else if (exam_average() < 60 || course_avg < 70) {
return 'D';
} else if (course_avg < 80) {
return 'C';
} else if (course_avg < 90) {
return 'B';
} else {
return 'A';
}
}
////////////////////////////////////////////////////////////////////////////////
void GradeCalculator::read_final_exam(std::ifstream& fin) {
has_final_exam = true;
fin >> final_exam;
if (fin.fail()) {
throw std::runtime_error("failed to read final exam grade");
}
}
void GradeCalculator::read_exam_hw_redemption_zybook(std::ifstream& fin, const std::string& category) {
unsigned number;
fin >> number;
if (fin.fail()) {
throw std::runtime_error("failed to read " + category + " number");
}
std::vector<double>* vec;
if (category == "exam") {
vec = &exam_grades;
} else if (category == "hw") {
vec = &hw_grades;
} else if (category == "hw-redemption") {
vec = &hw_redemption_grades;
} else if (category == "zybook") {
char type;
fin >> type;
if (fin.fail()) {
// HOW TO REACH THIS?
throw std::runtime_error("failed to read " + category + " type");
}
switch (type) {
case 'p': vec = &zybook_participation_grades; break;
case 'c': vec = &zybook_challenge_grades; break;
default: throw std::runtime_error("unrecognized zybook assignment type: " + type);
}
} else {
throw std::runtime_error("unrecognized category: " + category);
}
double grade;
fin >> grade;
if (fin.fail()) {
throw std::runtime_error("failed to read "+category+" grade");
}
while (number > vec->size()) {
vec->push_back(0);
}
vec->at(number-1) = grade;
}
void GradeCalculator::read_lw(std::ifstream& fin) {
unsigned number;
fin >> number;
if (fin.fail()) {
throw std::runtime_error("failed to read lw number");
}
std::string str;
fin >> str;
if (fin.fail()) {
// HOW TO REACH THIS?
throw std::runtime_error("failed to read lw grade");
}
while (number > lw_grades.size()) {
lw_grades.push_back(false);
}
if (str == "0" || str == "false") {
lw_grades.at(number-1) = false;
} else if (str == "1" || str == "true") {
lw_grades.at(number-1) = true;
} else {
throw std::runtime_error("invalid lw grade value: " + str);
}
}
void GradeCalculator::read_syllabus_ack(std::ifstream& fin) {
std::string str;
fin >> str;
if (fin.fail()) {
// HOW TO REACH THIS?
throw std::runtime_error("failed to read syllabus-ack type");
}
if (str == "0" || str == "false") {
has_syllabus_ack = false;
} else if (str == "1" || str == "true") {
has_syllabus_ack = true;
} else {
throw std::runtime_error("invalid syllabus-ack grade value: " + str);
}
}
void GradeCalculator::load_grades(const std::string& filename) {
std::ifstream fin(filename);
if (!fin.is_open()) {
throw std::runtime_error("could not open file");
}
while (!fin.eof()) {
std::string category;
fin >> category;
if (fin.fail()) {
if (fin.eof()) {
continue;
}
// HOW TO REACH THIS?
throw std::runtime_error("failed to read category");
}
if (category == "final-exam") {
read_final_exam(fin);
} else if (category == "exam" || category == "hw" || category == "hw-redemption" || category == "zybook") {
read_exam_hw_redemption_zybook(fin, category);
} else if (category == "lw") {
read_lw(fin);
} else if (category == "syllabus-ack") {
read_syllabus_ack(fin);
} else {
throw std::runtime_error("invalid category: " + category);
}
}
} | 25.333333 | 116 | 0.544829 |
96ee07a318220b1755b8e88d53e69da25f26c709 | 458 | cs | C# | UptimeKumaRemoteProbe/GlobalUsings.cs | zimbres/UptimeKumaRemoteProbe | 91a2ae88b2d5bd81c857826b017f5ecd269e19e2 | [
"MIT"
] | 1 | 2022-03-29T22:46:45.000Z | 2022-03-29T22:46:45.000Z | UptimeKumaRemoteProbe/GlobalUsings.cs | zimbres/UptimeKumaRemoteProbe | 91a2ae88b2d5bd81c857826b017f5ecd269e19e2 | [
"MIT"
] | null | null | null | UptimeKumaRemoteProbe/GlobalUsings.cs | zimbres/UptimeKumaRemoteProbe | 91a2ae88b2d5bd81c857826b017f5ecd269e19e2 | [
"MIT"
] | null | null | null | global using Microsoft.EntityFrameworkCore;
global using Microsoft.Extensions.DependencyInjection.Extensions;
global using Microsoft.Extensions.Http;
global using System.Diagnostics;
global using System.Net.NetworkInformation;
global using System.Net.Sockets;
global using System.Reflection;
global using UptimeKumaRemoteProbe;
global using UptimeKumaRemoteProbe.Data;
global using UptimeKumaRemoteProbe.Models;
global using UptimeKumaRemoteProbe.Services;
| 38.166667 | 65 | 0.868996 |
dfdcf6b1ba4fa6af0a384fb503b2ac31a029d2a2 | 246 | cs | C# | TBNMobile/TBNMobile/DependencyServices/IAudioPlayer.cs | Surye/tbnmobile | d03ed9d3d137b4811242fc022fe013cf0aac5609 | [
"MIT"
] | null | null | null | TBNMobile/TBNMobile/DependencyServices/IAudioPlayer.cs | Surye/tbnmobile | d03ed9d3d137b4811242fc022fe013cf0aac5609 | [
"MIT"
] | null | null | null | TBNMobile/TBNMobile/DependencyServices/IAudioPlayer.cs | Surye/tbnmobile | d03ed9d3d137b4811242fc022fe013cf0aac5609 | [
"MIT"
] | null | null | null | namespace TBNMobile.DependencyServices
{
public interface IAudioPlayer
{
void Init();
void PlayStreamingAudio(string uri, string title = "");
void PauseStreamingAudio();
void StopStreamingAudio();
}
}
| 22.363636 | 63 | 0.642276 |
c983009778406c6e38266a986819f2cb38f53a30 | 4,194 | ts | TypeScript | src/app/shared/components/create-invoice-form/create-invoice-form.component.ts | valitydev/dashboard | 604926d0554f16e169ab4145b1aa08484f331bc9 | [
"Apache-2.0"
] | 1 | 2022-01-14T12:18:26.000Z | 2022-01-14T12:18:26.000Z | src/app/shared/components/create-invoice-form/create-invoice-form.component.ts | valitydev/dashboard | 604926d0554f16e169ab4145b1aa08484f331bc9 | [
"Apache-2.0"
] | 11 | 2022-01-13T16:15:57.000Z | 2022-03-02T13:07:56.000Z | src/app/shared/components/create-invoice-form/create-invoice-form.component.ts | valitydev/dashboard | 604926d0554f16e169ab4145b1aa08484f331bc9 | [
"Apache-2.0"
] | null | null | null | import { ChangeDetectionStrategy, Component, Injector, Input, OnInit, Output, EventEmitter } from '@angular/core';
import { FormArray, FormBuilder, FormGroup } from '@ngneat/reactive-forms';
import { UntilDestroy, untilDestroyed } from '@ngneat/until-destroy';
import { provideValueAccessor, WrappedFormControlSuperclass } from '@s-libs/ng-core';
import { InvoiceLineTaxVAT } from '@vality/swag-anapi-v2';
import { Shop } from '@vality/swag-payments';
import isEqual from 'lodash-es/isEqual';
import isNil from 'lodash-es/isNil';
import * as moment from 'moment';
import { Moment } from 'moment';
import { distinctUntilChanged, map, shareReplay, startWith } from 'rxjs/operators';
import { Overwrite } from 'utility-types';
import { SHARE_REPLAY_CONF } from '@dsh/operators';
import { replaceFormArrayValue, getFormValueChanges, toMinor, getFormValidationChanges, toMajor } from '@dsh/utils';
export const WITHOUT_VAT = Symbol('without VAT');
export const EMPTY_CART_ITEM: CartItem = { product: '', quantity: null, price: null, taxVatRate: WITHOUT_VAT };
export const EMPTY_FORM_DATA: FormData = {
shopID: null,
dueDate: null,
product: '',
description: '',
currency: '',
cart: [EMPTY_CART_ITEM],
};
interface CartItem {
product: string;
quantity: number;
price: number;
taxVatRate: string | typeof WITHOUT_VAT;
}
export interface FormData {
shopID: string;
dueDate: Moment;
product: string;
description: string;
currency: string;
cart: CartItem[];
}
@UntilDestroy()
@Component({
selector: 'dsh-create-invoice-form',
templateUrl: 'create-invoice-form.component.html',
styleUrls: ['create-invoice-form.component.scss'],
changeDetection: ChangeDetectionStrategy.OnPush,
providers: [provideValueAccessor(CreateInvoiceFormComponent)],
})
export class CreateInvoiceFormComponent extends WrappedFormControlSuperclass<FormData> implements OnInit {
@Input() shops: Shop[];
@Output() valid = new EventEmitter<boolean>();
@Output() empty = new EventEmitter<boolean>();
form = this.fb.group<Overwrite<FormData, { cart: FormArray<FormGroup<CartItem>> }>>({
...EMPTY_FORM_DATA,
cart: this.fb.array<FormGroup<CartItem>>([this.fb.group(EMPTY_CART_ITEM)]),
});
totalAmount$ = this.form.controls.cart.valueChanges.pipe(
startWith(this.form.controls.cart.value),
map((v) =>
v
.map(({ price, quantity }) => price * quantity)
.reduce((sum, s) => sum + s, 0)
.toFixed(2)
),
shareReplay(SHARE_REPLAY_CONF)
);
taxVatRates = Object.values(InvoiceLineTaxVAT.RateEnum);
withoutVAT = WITHOUT_VAT;
get minDate(): Moment {
return moment().add('2', 'day').startOf('day');
}
constructor(private fb: FormBuilder, injector: Injector) {
super(injector);
}
ngOnInit(): void {
getFormValueChanges(this.form)
.pipe(untilDestroyed(this))
.subscribe((v) =>
this.emitOutgoingValue({ ...v, cart: v.cart.map((i) => ({ ...i, price: toMinor(i.price) })) })
);
getFormValueChanges(this.form)
.pipe(
map((v) => isEqual(v, EMPTY_FORM_DATA)),
distinctUntilChanged(),
untilDestroyed(this)
)
.subscribe((v) => this.empty.emit(v));
getFormValidationChanges(this.form)
.pipe(untilDestroyed(this))
.subscribe((v) => this.valid.emit(v));
}
handleIncomingValue(value: FormData): void {
value = {
...EMPTY_FORM_DATA,
...(value || {}),
cart: (value?.cart || [EMPTY_CART_ITEM]).map((v) => ({
...v,
price: isNil(v.price) ? v.price : toMajor(v.price),
})),
};
replaceFormArrayValue(this.form.controls.cart, value.cart, (v) => this.fb.group(v));
this.form.setValue(value);
}
addCartItem(): void {
this.form.controls.cart.push(this.fb.group(EMPTY_CART_ITEM));
}
removeCartItem(idx: number): void {
this.form.controls.cart.removeAt(idx);
}
}
| 34.661157 | 116 | 0.628517 |
21d245e04d1dbd2970c466e0da6a84a87325274b | 7,015 | js | JavaScript | src/parser.js | ogonkov/djanjucks | 36c0e58b0ae8805f6a4a31fbde36e880ee30f2cc | [
"MIT"
] | 6 | 2019-07-15T09:40:14.000Z | 2021-07-01T15:29:01.000Z | src/parser.js | ogonkov/djanjucks | 36c0e58b0ae8805f6a4a31fbde36e880ee30f2cc | [
"MIT"
] | 5 | 2019-09-10T20:32:43.000Z | 2021-05-10T01:38:05.000Z | src/parser.js | ogonkov/djanjucks | 36c0e58b0ae8805f6a4a31fbde36e880ee30f2cc | [
"MIT"
] | 2 | 2019-09-10T20:16:16.000Z | 2019-10-27T22:45:26.000Z | import lexer from 'nunjucks/src/lexer';
import { Parser } from 'nunjucks/src/parser';
import nodes from './nodes';
class DjangoParser extends Parser {
// Nunjucks wants kwargs in tags to be comma separated.
// However this is not required in django.
// This parserSignature bypasses that requirement
parseSignature(tolerant, noParens) {
let tok = this.peekToken();
if (!noParens && tok.type !== lexer.TOKEN_LEFT_PAREN) {
if (tolerant) {
return null;
} else {
this.fail('expected arguments', tok.lineno, tok.colno);
}
}
if (tok.type === lexer.TOKEN_LEFT_PAREN) {
tok = this.nextToken();
}
const args = new nodes.NodeList(tok.lineno, tok.colno);
const kwargs = new nodes.KeywordArgs(tok.lineno, tok.colno);
while (1) {
// eslint-disable-line no-constant-condition
tok = this.peekToken();
if (!noParens && tok.type === lexer.TOKEN_RIGHT_PAREN) {
this.nextToken();
break;
} else if (noParens && tok.type === lexer.TOKEN_BLOCK_END) {
break;
}
const arg = this.parseExpression();
if (this.skipValue(lexer.TOKEN_OPERATOR, '=')) {
kwargs.addChild(
new nodes.Pair(arg.lineno, arg.colno, arg, this.parseExpression())
);
} else {
args.addChild(arg);
}
}
if (kwargs.children.length) {
args.addChild(kwargs);
}
return args;
}
// A variation of parseSignature that expects a single argument
parseFilterSignature() {
let tok = this.peekToken();
if (tok.type === lexer.TOKEN_COLON) {
tok = this.nextToken();
}
tok = this.peekToken();
const args = new nodes.NodeList(tok.lineno, tok.colno);
const arg = this.parsePrimary();
args.addChild(arg);
return args;
}
// Django Filters take a single argument
parseFilter(node) {
while (this.skip(lexer.TOKEN_PIPE)) {
const name = this.parseFilterName();
node = new nodes.Filter(
name.lineno,
name.colno,
name,
new nodes.NodeList(
name.lineno,
name.colno,
[node].concat(this.parseFilterArgs(node))
)
);
}
return node;
}
parseFilterPostfix(node) {
let tok = this.peekToken();
if (tok.type === lexer.TOKEN_COLON) {
// Function call
node = new nodes.FunCall(
tok.lineno,
tok.colno,
node,
this.parseFilterSignature()
);
}
return node;
}
parseInclude() {
const tagName = 'include';
const token = this.peekToken();
if (!this.skipSymbol(tagName)) {
this.fail('parseInclude: expected ' + tagName);
}
const node = new nodes.Include(token.lineno, token.colno);
node.template = this.parsePrimary();
if (this.skipSymbol('with')) {
// Cheekily use parseSignature here.
// Arg should be compared to "only"
const kwargs = this.parseSignature(null, true);
if (kwargs.children[0].value === 'only') {
node.only = true;
}
if (kwargs.children[kwargs.children.length - 1]) {
node.kwargs = kwargs.children[kwargs.children.length - 1];
}
}
this.advanceAfterBlockEnd(token.value);
return node;
}
parseFilterArgs(node) {
if (this.peekToken().type === lexer.TOKEN_COLON) {
// Get a FunCall node and add the parameters to the
// filter
const call = this.parseFilterPostfix(node);
return call.args.children;
}
return [];
}
parseFor() {
// Taken verbatim from Nunjucks.
// Add support for empty & reversed.
var forTok = this.peekToken();
var node;
var endBlock;
if (this.skipSymbol('for')) {
node = new nodes.For(forTok.lineno, forTok.colno);
endBlock = 'endfor';
} else if (this.skipSymbol('asyncEach')) {
node = new nodes.AsyncEach(forTok.lineno, forTok.colno);
endBlock = 'endeach';
} else if (this.skipSymbol('asyncAll')) {
node = new nodes.AsyncAll(forTok.lineno, forTok.colno);
endBlock = 'endall';
} else {
this.fail('parseFor: expected for{Async}', forTok.lineno, forTok.colno);
}
node.name = this.parsePrimary();
if (!(node.name instanceof nodes.Symbol)) {
this.fail('parseFor: variable name expected for loop');
}
const type = this.peekToken().type;
if (type === lexer.TOKEN_COMMA) {
// key/value iteration
const key = node.name;
node.name = new nodes.Array(key.lineno, key.colno);
node.name.addChild(key);
while (this.skip(lexer.TOKEN_COMMA)) {
const prim = this.parsePrimary();
node.name.addChild(prim);
}
}
if (!this.skipSymbol('in')) {
this.fail(
'parseFor: expected "in" keyword for loop',
forTok.lineno,
forTok.colno
);
}
node.arr = this.parseExpression();
node.reversed = this.skipSymbol('reversed');
this.advanceAfterBlockEnd(forTok.value);
node.body = this.parseUntilBlocks(endBlock, 'empty');
if (this.skipSymbol('empty')) {
this.advanceAfterBlockEnd('empty');
node.empty = this.parseUntilBlocks(endBlock);
}
this.advanceAfterBlockEnd();
return node;
}
parseStatement() {
var tok = this.peekToken();
var node;
if (tok.type !== lexer.TOKEN_SYMBOL) {
this.fail('tag name expected', tok.lineno, tok.colno);
}
if (this.breakOnBlocks && this.breakOnBlocks.indexOf(tok.value) !== -1) {
return null;
}
switch (tok.value) {
case 'raw':
return this.parseRaw();
case 'verbatim':
return this.parseRaw('verbatim');
case 'if':
case 'ifAsync':
return this.parseIf();
case 'for':
case 'asyncEach':
case 'asyncAll':
return this.parseFor();
case 'block':
return this.parseBlock();
case 'extends':
return this.parseExtends();
case 'set':
return this.parseSet();
case 'macro':
return this.parseMacro();
case 'call':
return this.parseCall();
case 'import':
return this.parseImport();
case 'from':
return this.parseFrom();
case 'filter':
return this.parseFilterStatement();
case 'switch':
return this.parseSwitch();
default:
if (this.extensions.length) {
for (let i = 0; i < this.extensions.length; i++) {
const ext = this.extensions[i];
const tags = ext.tags || [];
if (tags.indexOf(tok.value) !== -1) {
return ext.parse(this, nodes, lexer);
}
}
}
this.fail('unknown block tag: ' + tok.value, tok.lineno, tok.colno);
}
return node;
}
}
export default {
parse(src, extensions, opts) {
var p = new DjangoParser(lexer.lex(src, opts));
if (extensions !== undefined) {
p.extensions = extensions;
}
return p.parseAsRoot();
},
Parser: DjangoParser
};
| 25.233813 | 78 | 0.586458 |
c3dd90e5294e18cba3c3c0a679503ce1d01f73be | 122 | cs | C# | Assets/Dark Forces Showcase/Menu/ShowcaseList.cs | The-MAZZTer/DarkForces | dfc1a9469b84569f5b73dcd75f7a4bf1dee5b591 | [
"MIT"
] | 1 | 2021-08-24T06:48:25.000Z | 2021-08-24T06:48:25.000Z | Assets/Dark Forces Showcase/Menu/ShowcaseList.cs | The-MAZZTer/DarkForces | dfc1a9469b84569f5b73dcd75f7a4bf1dee5b591 | [
"MIT"
] | null | null | null | Assets/Dark Forces Showcase/Menu/ShowcaseList.cs | The-MAZZTer/DarkForces | dfc1a9469b84569f5b73dcd75f7a4bf1dee5b591 | [
"MIT"
] | null | null | null | using MZZT.DataBinding;
namespace MZZT.DarkForces.Showcase {
public class ShowcaseList : DataboundList<Showcase> {
}
}
| 17.428571 | 54 | 0.778689 |
e7335cced147cdd0c6b5fc759587041015ff5462 | 1,548 | php | PHP | resources/views/gestion-administrativa/estado/edit.blade.php | sergio41291/mrp | 464f1c6ed78e88fc547d478acc97bcf5dabb9104 | [
"MIT"
] | null | null | null | resources/views/gestion-administrativa/estado/edit.blade.php | sergio41291/mrp | 464f1c6ed78e88fc547d478acc97bcf5dabb9104 | [
"MIT"
] | null | null | null | resources/views/gestion-administrativa/estado/edit.blade.php | sergio41291/mrp | 464f1c6ed78e88fc547d478acc97bcf5dabb9104 | [
"MIT"
] | null | null | null | @extends ('layouts.menu')
@section('title', 'Gestión Administrativa | MRP')
@section('styles')
<style>
.row {
text-align: center !important;
padding-left: 20px;
padding-right: 20px;
}
.info {
padding-top: 40px;
}
</style>
@endsection
@section('contenido-central')
<div class="row">
<div class="col-lg-6 col-md-6 col-sm-6 col-xs-12">
<h3>Editar Estado(Departamento): {{ $estado->nombre }}</h3>
@if (count($errors)>0)
<div class="alert alert-danger">
<ul>
@foreach ($errors->all() as $error)
<li>{{ $error }}</li>
@endforeach
</ul>
</div>
@endif
{!! Form::model($estado,['method'=>'PATCH','route'=>['estado.update',$estado->id]])!!}
{{ Form::token() }}
<div class="form-group">
<label for="codigo">Codigo</label>
<input type="text" name="codigo" class="form-control" value="{{ $estado->codigo }}" placeholder="Codigo...">
</div>
<div class="form-group">
<label for="nombre">Nombre</label>
<input type="text" name="nombre" class="form-control" value="{{ $estado->nombre }}" placeholder="Nombre...">
</div>
<div class="form-group">
<button class="btn btn-primary" type="submit">Guardar</button>
<button class="btn btn-danger" type="reset">Cancelar</button>
</div>
{!! Form::close() !!}
</div>
</div>
@endsection | 29.769231 | 121 | 0.514212 |
5de684c7717dbf2a1d68490ef2667d6945ae4c94 | 454 | cc | C++ | src/Plugin.cc | DynamiteAI/bro-community-id | abcff5b3de25e6d70fb22d6e63e4b123f2e6106f | [
"BSD-2-Clause",
"BSD-3-Clause"
] | 18 | 2018-06-23T17:55:15.000Z | 2020-04-03T05:36:55.000Z | src/Plugin.cc | DynamiteAI/bro-community-id | abcff5b3de25e6d70fb22d6e63e4b123f2e6106f | [
"BSD-2-Clause",
"BSD-3-Clause"
] | 12 | 2020-04-19T20:56:52.000Z | 2022-03-05T01:05:29.000Z | src/Plugin.cc | DynamiteAI/bro-community-id | abcff5b3de25e6d70fb22d6e63e4b123f2e6106f | [
"BSD-2-Clause",
"BSD-3-Clause"
] | 13 | 2018-02-02T00:36:53.000Z | 2020-04-03T12:08:08.000Z |
#include "Plugin.h"
namespace plugin { namespace Corelight_CommunityID { Plugin plugin; } }
using namespace plugin::Corelight_CommunityID;
zeek::plugin::Configuration Plugin::Configure()
{
zeek::plugin::Configuration config;
config.name = "Corelight::CommunityID";
config.description = "\"Community ID\" flow hash support in the connection log";
config.version.major = 3;
config.version.minor = 2;
config.version.patch = 0;
return config;
}
| 25.222222 | 81 | 0.746696 |
6b708590fdba2f493bd5b4ec0ae8a09e6d124a99 | 1,432 | js | JavaScript | demos/tyadmin_demo_finish/tyadmin/src/pages/AutoGenPage/RichTextDemoList/service.js | a24zlab/django-antd-tyadmin | 49797ecbb477b00fc934b774fbc33a4dc23f9d80 | [
"MIT"
] | 308 | 2021-02-04T08:18:13.000Z | 2022-03-30T10:38:30.000Z | demos/tyadmin_demo_finish/tyadmin/src/pages/AutoGenPage/RichTextDemoList/service.js | a24zlab/django-antd-tyadmin | 49797ecbb477b00fc934b774fbc33a4dc23f9d80 | [
"MIT"
] | 23 | 2021-02-02T08:29:02.000Z | 2022-03-08T13:14:55.000Z | demos/tyadmin_demo_finish/tyadmin/src/pages/AutoGenPage/RichTextDemoList/service.js | a24zlab/django-antd-tyadmin | 49797ecbb477b00fc934b774fbc33a4dc23f9d80 | [
"MIT"
] | 90 | 2021-02-03T08:03:17.000Z | 2022-03-31T19:03:02.000Z | import request from 'umi-request';
import { buildFileFormData } from '@/utils/utils'
export async function queryRichTextDemo(params) {
return request('/api/xadmin/v1/rich_text_demo', {
params,
});
}
export async function removeRichTextDemo(params) {
return request(`/api/xadmin/v1/rich_text_demo/${params}`, {
method: 'DELETE',
});
}
export async function addRichTextDemo(params) {
let fileFieldList = []
let fileData = buildFileFormData(params, fileFieldList);
return request('/api/xadmin/v1/rich_text_demo', {
method: 'POST',
data: fileData,
});
}
export async function updateRichTextDemo(params, id) {
let fileFieldList = []
let fileData = buildFileFormData(params, fileFieldList);
return request(`/api/xadmin/v1/rich_text_demo/${id}`, {
method: 'PUT',
data: fileData,
});
}
export async function queryRichTextDemoVerboseName(params) {
return request('/api/xadmin/v1/rich_text_demo/verbose_name', {
params,
});
}
export async function queryRichTextDemoListDisplay(params) {
return request('/api/xadmin/v1/rich_text_demo/list_display', {
params,
});
}
export async function queryRichTextDemoDisplayOrder(params) {
return request('/api/xadmin/v1/rich_text_demo/display_order', {
params,
});
}
export async function updateUserPassword(params) {
return request('/api/xadmin/v1/list_change_password', {
method: 'POST',
data: { ...params},
});
}
| 27.018868 | 65 | 0.710196 |
eba79ea45328ff544f8f5295fa09ae63718edfb4 | 17,659 | css | CSS | dist/profession_hospital_card/css/index.css | wepayui/wepayui | a36ed554397bfd072664e32e7ba153b2b48103ea | [
"MIT"
] | 439 | 2016-12-01T05:21:54.000Z | 2021-12-21T02:34:05.000Z | dist/profession_hospital_card/css/index.css | wepayui/wepayui | a36ed554397bfd072664e32e7ba153b2b48103ea | [
"MIT"
] | 5 | 2016-12-22T13:28:00.000Z | 2018-10-22T06:47:16.000Z | src/project/profession/profession_hospital_card/css/index.css | wepayui/wepayui | a36ed554397bfd072664e32e7ba153b2b48103ea | [
"MIT"
] | 96 | 2016-12-05T08:52:32.000Z | 2021-12-21T02:33:56.000Z | /* ============================================================
样式重置
============================================================ */
ul,dl,ol{list-style:none;}
img,fieldset,input[type="submit"]{border:0 none;}
img{display:inline-block;overflow:hidden;vertical-align:top;}
em{font-style:normal;}
strong{font-weight:normal;}
table{border-collapse:collapse;border-spacing:0;}
button,input[type="button"]{cursor:pointer;border:0 none;}
textarea{word-wrap:break-word;resize:none;} /* word-wrap for opera, resize for webkit */
menu{margin:0;padding:0;}
body{-webkit-user-select:none;-webkit-text-size-adjust:100%!important;font-family:Helvetica;}
input[type="number"]{-webkit-user-select:text;}
a,button,input,img{-webkit-touch-callout:none;}/* 1.ios 长按时不触发系统的菜单 2.禁止长按时下载图片 */
input,select,textarea{outline:none;}
/* ============================================================
公用模块
============================================================ */
.hide{display: none!important;}
.onepxradius:before{content:'';position:absolute;top:-50%;bottom:-50%;left:-50%;right:-50%;-webkit-transform:scale(0.5);transform:scale(0.5);-webkit-box-sizing:border-box;box-sizing:border-box;border-style:solid;border-width:1px;-webkit-border-radius:10px;border-radius:10px;}
.onepxborder-b{position: relative;}
.onepxborder-b:after{content: '';position: absolute;width: 100%;height: 1px;background-color: #D9D9D9;left: 0;bottom: 0;-webkit-transform: scale(1, 0.5);transform: scale(1, 0.5);-webkit-transform-origin: left bottom;transform-origin: left bottom;}
/* flex */
.flex{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;}
.flex-v{-webkit-box-orient:vertical;-webkit-flex-direction:column;-ms-flex-direction:column;flex-direction:column;}
.flex-1{-webkit-box-flex:1;-webkit-flex:1;-ms-flex:1;flex:1;}
.flex-align-center{-webkit-box-align:center;-webkit-align-items:center;-ms-flex-align:center;align-items:center;}
.flex-pack-center{-webkit-box-pack:center;-webkit-justify-content:center;-ms-flex-pack:center;justify-content:center;}
.flex-pack-justify{-webkit-box-pack:justify;-webkit-justify-content:space-between;-ms-flex-pack:justify;justify-content:space-between;}
/*素材*/
.ico-heart,.ico-subbranding,.ico-time,.ico-wxzf{display: inline-block;background: url(../img/sprites.png) 0 0 no-repeat;-webkit-background-size: 86px auto;background-size: 86px auto;}
.ico-heart{width:14px;height:13px;background-position:0 0}
.ico-subbranding{width:86px;height:86px;background-position:0 -14px}
.ico-time{width:13px;height:13px;background-position:0 -101px}
.ico-wxzf{width:80px;height:20px;background-position:0 -114px}
/* ============================================================
页面内容
============================================================ */
body{background-color: #f6f5fb;line-height: 1;}
.index{padding-bottom: 20px;position: relative;z-index: 1;background-color: #f6f5fb;}
.index-head{position: relative;padding: 15px 15px 15px 90px;}
.index-head .photo{position: absolute;width: 65px;height: 65px;left: 15px;top: 15px;-webkit-border-radius: 5px;border-radius: 5px;-webkit-box-sizing: border-box;box-sizing: border-box;}
.index-head .photo:before{border-color: #A7A7AB;}
.index-head .photo img{width: 65px;height: 65px;-webkit-border-radius: 5px;border-radius: 5px;}
.index-head .title{font-size: 16px;}
.index-head .info{font-size: 14px;margin-top: 14px;}
.index-head .job{font-size: 14px;margin-top: 7px;}
.index-main{padding-left: 15px;background-color: #FFFFFF;}
.index-main-li{padding: 16px 0;position: relative;}
.index-main-li .title{font-size: 14px;position: relative;padding-left: 20px;}
.index-main-li .title [class*="ico-"]{position: absolute;left: 1px;top: 0;}
.index-main-li .cnt{margin-top: 13px;color: #888888;line-height: 18px;font-size: 14px;padding-right: 15px;}
.index-main-li .more{padding-right: 15px;text-align: right;font-size: 14px;}
.index-main-li .more .txt,.index-main-li .more .txt:visited{color: #007AFF;padding: 5px 0;}
.index-btn{margin: 18px 10px 0;}
.dateselect-wrap{position: fixed;left: 0;top: 0;z-index: 500;height: 100%;width: 100%;background-color: rgba(0,0,0,0.5);}
.dateselect{position: absolute;left: 0;bottom: 0;width: 100%;height: 356px;background-color: #EAEAEB;-webkit-box-sizing: border-box;box-sizing: border-box;}
.dateselect-title{text-align: center;padding-top: 15px;font-size: 14px;}
.dateselect-month{margin-top: 18px;padding-left: 15px;font-size: 16px;}
.dateselect-cnt{margin: 10px 15px 0;position: relative;overflow: hidden;}
.dateselect-cnt ul{position: relative;background-color: #FFFFFF;width: 100%;}
.dateselect-cnt ul:before{content:'';position:absolute;z-index: 0;top:-50%;bottom:-50%;left:-50%;right:-50%;-webkit-transform:scale(0.5);transform:scale(0.5);-webkit-box-sizing:border-box;box-sizing:border-box;border: 1px solid #D9D9D9;}
.dateselect-cnt ul:after{content: '';display: block;clear: both;visibility: hidden;overflow: hidden;height: 0;}
.dateselect-cnt ul li{float: left;position: relative;background-color: #FFFFFF;width: 25%;height: 86px;text-align: center;padding-top: 28px;-webkit-box-sizing: border-box;box-sizing: border-box;}
.dateselect-cnt ul li:before{content:'';position:absolute;height: 100%;width: 1px;background-color: #D9D9D9;right: 0;top: 0;-webkit-transform:scale(0.5,1);transform:scale(0.5,1);-webkit-transform-origin: right center;transform-origin: right center;}
.dateselect-cnt ul li:after{content:'';position:absolute;width: 100%;height: 1px;background-color: #D9D9D9;bottom: 0;left: 0;-webkit-transform:scale(1,0.5);transform:scale(1,0.5);-webkit-transform-origin: left bottom;transform-origin: left bottom;}
.dateselect-cnt ul li .date{font-size: 20px;}
.dateselect-cnt ul li .month{font-size: 11px;margin-top: 13px;}
.dateselect-cnt ul li .full{display: none;position: absolute;right: 0;top: 0;}
.dateselect-cnt ul li.show-full{background-color: #F5F5F5;}
.dateselect-cnt ul li.show-full .full{display: block;}
.dateselect-cnt ul li .txt{position: absolute;color: #ABABAB;font-size: 13px;z-index: 2;right: 2px;top: 2px;}
.dateselect-cnt ul li .ico-angle{position: absolute;z-index: 1;right: 1px;top: 1px;display:inline-block;width:0;height:0;overflow:hidden;font-size:0;border-right:30px solid #EEEEEF;border-bottom:30px dashed transparent}
.dateselect-btn{display: block;height: 50px;line-height: 50px;background-color: #FFFFFF;color: #454545;text-align: center;font-size: 18px;box-shadow: 0 -10px 15px #EAEAEB;position: relative;z-index: 2;}
/*选中医生挂号*/
.selectdoctor{padding-bottom: 20px;position: relative;z-index: 1;}
.selectdoctor-time{padding: 9px 15px;}
.selectdoctor-time .li{width: 50px;height: 50px;text-align: center;line-height: 1;-webkit-tap-highlight-color: rgba(0,0,0,0);}
.selectdoctor-time a.on{background-color: #33AD37;-webkit-border-radius: 25px;border-radius: 25px;}
.selectdoctor-time a.on .week,
.selectdoctor-time a.on .date{color: #FFFFFF;}
.selectdoctor-time .li .week{font-size: 18px;color: #333333;padding-top: 10px;}
.selectdoctor-time .li .date{font-size: 10px;color: #999999;padding-top: 2px;}
.selectdoctor-doctor{margin-bottom: 5px;}
.selectdoctor-doctor-intro{position: relative;background-color: #FFFFFF;padding: 15px 0 15px 86px;}
.selectdoctor-doctor-intro .photo{position: absolute;width: 56px;height: 56px;-webkit-border-radius: 28px;border-radius: 28px;left: 15px;top: 15px;border: 2px solid rgba(239,239,239,0.8);}
.selectdoctor-doctor-intro .detail{padding-right: 10px;}
.selectdoctor-doctor-intro .detail-title{padding-top: 10px;}
.selectdoctor-doctor-intro .detail-title strong{font-size: 18px;color: #333333;line-height: 1;}
.selectdoctor-doctor-intro .detail-title em{font-size: 10px;color: #333333;line-height: 1;margin-left: 11px;}
.selectdoctor-doctor-intro .detail-info{font-size: 10px;color: #000;color: #999999;line-height: 15px;}
.selectdoctor-doctor-intro .state,.selectdoctor-doctor-intro .state-over{width: 104px;height: 60px;line-height: 60px;border-left: 1px solid #EFEFEF;text-align: center;font-size: 24px;color: #33AD37;}
.selectdoctor-doctor-intro .state-over{color: #F39700; }
.selectdoctor-doctor-num{padding-left: 15px;background-color: #F7F7F7;position: relative;}
.selectdoctor-doctor-num:after,.selectdoctor-doctor-num:before{content: '';position: absolute;width:0;height:0;overflow:hidden;font-size:0;display:inline-block;border-width:8px 6px;border-color:transparent transparent #D9D9D9 transparent;border-style: dashed dashed solid dashed;top: -16px;right: 45px;z-index: 2;}
.selectdoctor-doctor-num:before{border-color:transparent transparent #F7F7F7 transparent;top: -15px;z-index: 3;}
.selectdoctor-doctor-num-li{height: 50px;line-height: 50px;color: #595959;font-size: 15px;position: relative;}
.selectdoctor-doctor-num-li:before{width: 9px;height: 16px;background: url(../img/ico-arrow-right-gray.png) 0 0 no-repeat;-webkit-background-size: 9px auto;background-size: 9px auto;}
.selectdoctor-doctor-num-li:before{content: '';position: absolute;right: 15px;top: 50%;-webkit-transform: translate(0, -50%);transform: translate(0, -50%);}
.selectdoctor-doctor-num-li:last-child{border-bottom: none; }
.selectdoctor-doctor-num-li .time,
.selectdoctor-doctor-num-li .info{width: 50%;}
.selectdoctor-doctor-num-li .info em{color: #33AD37;}
.selectdoctor-doctor-num,.state-over,
.show-over .state{display: none;}
.show-num .selectdoctor-doctor-num,
.show-over .state-over{display: block;}
/*挂号信息*/
.form{width:100%;-webkit-box-sizing:border-box;box-sizing:border-box;}
.form input::-webkit-input-placeholder,.form textarea::-webkit-input-placeholder{color:#AAAAAA;}
.form input:focus::-webkit-input-placeholder,.form textarea:focus::-webkit-input-placeholder{color:#EEEEEE;}
.form legend{display:none;}
.form-line{}
.form-line .info{padding-left:10px;font-size:12px;color:#999999;margin-top:6px;}
.form-line .label{display:block;padding-left:10px;font-size:12px;color:#666666;margin-bottom:6px;}
.form-line .element{padding-bottom:6px;}
.form-btn{margin:30px 15px 0;}
.ico-clear{display:inline-block;width:22px;height:22px;padding:11px;background:url("data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAACwAAAAsCAYAAAAehFoBAAAAAXNSR0IArs4c6QAAAARnQU1BAACxjwv8YQUAAAAJcEhZcwAADsMAAA7DAcdvqGQAAAM7SURBVFhH1ZnNbhoxEMfpuXmL9l2a3qrk0DR9nYi8QA99hJJTlWM4cOFDAg4E8VFAXBBwCpWKUFELwp3/xouWrT/GaycRK1nZsGPPz7Mz47E3l/O4Wq3W60ql8q5Wq+Wr1ep3aj26X9DfP2jyvodnUuYUfTxUuncVQrwigFMCKFD7TU04NvQpYAyM5U7g0IMUnZGiliOgdkIYi97QBwcEnmi5XH5Dg9+FAk2Pg7Ghg0djkaLBP9KAv54KNh5X6rjIDC199eqpQRXWvnL2bQn75blhE/q+OkHT67l+QdgoSMHAcg8Svnhp2Fg/ZZBPRmiZDbQBRklftNtt17zrI780Zg9T6hqPx+RWj9dkMvGB2PcdDAZitVqJ6XRqytV3SitjUdC5QrPZFLvdbg8cAno0Gh2MOZvNTEY4O4CWWUG7gtXrdbHZbA6AfaDTsBgLltYZjN78/UHWkAWM8TV3Oh2x3W69oVWweHtwD1Owo/bYW5n++cbJDL7QOlj8btMPxggY5R4Jr20d4udZoX1gpe51VJpy3CE9GVfoALDRGwBrjm7yXOsm5bjQoWCl7jyAb7MAo48NOjAsrHwL4H5WYBP0YrH4L3cjG3ACzMDTz1H0PfgAm6CTOTAALAqiBwBjs2hNKzYZnXsAOgQs9IM1GDAGRE2guuAetglznsfA3i4BZaoAS8KHKJgil/ANOg5swCqv75XWdLDwWbhHiNoj5SpRWsu0cJhg49Rly9Mcv03J5BF0OMVxDgruohASOqrYXIsfjmXTBggE/Vj84OKWl1lgY/gA0IVkPcxyC64b6FzME/r9Hlhuke5NvjwcDoPUBjrobrfL3yKBnGC1m1BMBHuuULWBCrrX65kC/1y5czZt85PLbojaANDxxnY+n5tgi9rDFBxakDWXOtcANCxt2zBy02Sj0RA4nDHIL8mIb42nP9T5eI6q4pkc1WEgoI/uuDUBfRwH2kknJ/e4fK5PBqTnM+tM2CaESKVgLHKjP4Nc0ZoNbJCq5wRyjoO5DEDK1CU/oakXhSyAqj4yIFF73FBbZ4BHnxuUik7fMUJMoFQqnch6GpsAHMj0qf2k3/6i4Z7aDzxDqoQs+vjo/gcu5hKkyDDBRAAAAABJRU5ErkJggg==") center center no-repeat;background-size:22px 22px;text-indent:-9999px;}
.form .ico-clear{position:absolute;top:1px;right:0;z-index:1;display:none;}
.form .show-clear .ico-clear{display:inline-block;}
.input{position:relative;}
.input .text{-webkit-appearance:none;appearance:none;border:none;font-size:16px;padding:12px 10px;display:block;width:100%;-webkit-box-sizing:border-box;box-sizing:border-box;background-color: #FFFFFF;color: #333333;}
.input-extend{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;}
.input-extend .txt{position:relative;height:100%;color:#888888;padding:12px 14px;font-size:18px;-webkit-box-sizing:border-box;box-sizing:border-box;background-color:#FFFFFF;border-radius:4px 0 0 4px;text-align:right;}
.input-extend .text{border-radius: 0 4px 4px 0;-webkit-box-flex:1;-webkit-flex:1;-ms-flex:1;flex:1;}
.input-wrap{position:relative;}
.input-wrap .input{position:relative;border-radius:0;}
.input-wrap .input:last-child{border-bottom:none;}
.input-wrap .input .text{border-radius:0;}
.input-extend-wrap{position:relative;padding-left: 15px;background-color: #FFFFFF;}
.input-extend-wrap .input{position:relative;border-radius:0;}
.input-extend-wrap .input .text{border-radius:0;}
.input-extend-wrap .input .txt{border-radius:0;}
.registerinfo-form{padding: 15px 0 20px;-webkit-box-sizing: border-box;box-sizing: border-box;position: relative;z-index: 1;background-color: #f6f5fb;}
.registerinfo-form .change-form-line{background-color: #FFFFFF;padding-bottom: 0;position: relative;}
.registerinfo-form .change-form-line .input-extend{padding-left: 15px;}
.registerinfo-form .change-form-line .change{position: absolute;right: 0;top: 50%;-webkit-transform: translate(0, -50%);transform: translate(0, -50%);color: #0066FF;font-size: 14px;padding: 15px;}
.registerinfo-form .input-extend .job{margin-left: 18px;color: #333333;font-size: 13px;}
/* 挂号成功、预约检查、药品清单、药品缴费 */
.suc-wrap{overflow: hidden;position: relative;z-index: 1;}
.suc-tit-s{background: url(../img/bg-green.png) repeat 0 0;-webkit-background-size: 40px auto;background-size: 40px auto;overflow:hidden;}
.suc-tit{padding: 32px 35px 95px;overflow: hidden;}
.suc-titm{font-size: 22px;font-weight: normal;color: #FFFFFF;text-align: center;padding-bottom: 17px;}
.suc-order-titm{font-size: 20px;}
.suc-titf{text-align: center;font-size: 12px;color: #FFEE63;font-weight: bold;}
.suc-line{width: 12px;height: 1px;background-color: #FFEE63;display: block;}
.suc-titf span{padding: 0 8px;overflow: hidden;}
.suc-inf-s{margin: -70px 10px 0;overflow: hidden;background-color: #FFFFFF;border: 1px solid #FFFFFF;-webkit-box-shadow: 3px 3px 0 rgba(0,0,0,0.06);box-shadow: 3px 3px 0 rgba(0,0,0,0.06);font-size: 13px;color: #999999;}
.suc-inf-box{padding: 20px 25px;-webkit-box-shadow: inset 0 0 10px rgba(0,0,0,0.08);box-shadow: inset 0 0 21px rgba(0,0,0,0.08);}
.suc-items{line-height: 18px;margin-bottom: 17px;}
.suc-items:after{content: '.';height: 0;display: block;clear: both;visibility: hidden;}
.suc-lb,.suc-inf{float: left;display: block;overflow: hidden;}
.suc-lb{width: 30%;}
.suc-inf{width: 70%;}
.suc-lb-w{width: 23%;}
.suc-inf-w{width: 77%;color: #000000;}
.suc-inf a{color: #0066FF;}
.suc-f-12{font-size: 12px;}
.suc-inf-18{font-size: 18px;color: #000000;}
.suc-pdLeft{padding-left: 10px;}
.suc-inf-p{font-size: 9px;margin-left: 5px;color: #000000;}
.suc-inf-p i{font-style: normal;}
.suc-gap-line{background: url(../img/suc-gaps.png) repeat-x 0 0;height: 8px;-webkit-background-size: 7.5px auto;background-size: 7.5px auto;margin-top: -3px;margin-bottom: 27px;}
.suc-about-s{padding: 20px 25px;overflow: hidden;color: #999999;font-size: 11px;line-height: 18px;}
.suc-about{padding-bottom: 22px;}
.suc-about-tit{font-size: 13px;margin-bottom: 13px;}
.suc-btn{height: 40px;color: #FFFFFF;line-height: 40px;}
.suc-red-btn{background-color: #EF4F4F;border: 1px solid #DA3A3A;}
.suc-grey-btn{background-color: #A7A7A7;border: 1px solid #9C9C9C;}
.suc-fl{float: left;overflow: hidden;}
.suc-fr{float: right;overflow: hidden;}
.suc-1{width: 44%;}
.suc-2{width: 56%;}
.suc-about-tit span{display: block;}
.suc-ico-arrow{background: url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAABYAAAANCAMAAACae25RAAAAGXRFWHRTb2Z0d2FyZQBBZG9iZSBJbWFnZVJlYWR5ccllPAAAA3FpVFh0WE1MOmNvbS5hZG9iZS54bXAAAAAAADw/eHBhY2tldCBiZWdpbj0i77u/IiBpZD0iVzVNME1wQ2VoaUh6cmVTek5UY3prYzlkIj8+IDx4OnhtcG1ldGEgeG1sbnM6eD0iYWRvYmU6bnM6bWV0YS8iIHg6eG1wdGs9IkFkb2JlIFhNUCBDb3JlIDUuMy1jMDExIDY2LjE0NTY2MSwgMjAxMi8wMi8wNi0xNDo1NjoyNyAgICAgICAgIj4gPHJkZjpSREYgeG1sbnM6cmRmPSJodHRwOi8vd3d3LnczLm9yZy8xOTk5LzAyLzIyLXJkZi1zeW50YXgtbnMjIj4gPHJkZjpEZXNjcmlwdGlvbiByZGY6YWJvdXQ9IiIgeG1sbnM6eG1wTU09Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC9tbS8iIHhtbG5zOnN0UmVmPSJodHRwOi8vbnMuYWRvYmUuY29tL3hhcC8xLjAvc1R5cGUvUmVzb3VyY2VSZWYjIiB4bWxuczp4bXA9Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC8iIHhtcE1NOk9yaWdpbmFsRG9jdW1lbnRJRD0ieG1wLmRpZDo3YzMyZGRlOS1mOTY5LWY3NGMtOTViZC1jYWM4NmI5Y2QxZWIiIHhtcE1NOkRvY3VtZW50SUQ9InhtcC5kaWQ6QkY4NDdCQkE5NkQ5MTFFNDkyOEVGRTNDRTYwMDcxNEEiIHhtcE1NOkluc3RhbmNlSUQ9InhtcC5paWQ6QkY4NDdCQjk5NkQ5MTFFNDkyOEVGRTNDRTYwMDcxNEEiIHhtcDpDcmVhdG9yVG9vbD0iQWRvYmUgUGhvdG9zaG9wIENDIChXaW5kb3dzKSI+IDx4bXBNTTpEZXJpdmVkRnJvbSBzdFJlZjppbnN0YW5jZUlEPSJ4bXAuaWlkOjA5M2UzOGQwLTI4M2EtMmQ0Ny05MjI3LWQyMmQyYjBkNGNmOCIgc3RSZWY6ZG9jdW1lbnRJRD0ieG1wLmRpZDphNmNjNTdmNS00Y2RlLTc5NDctYTE1Zi1iMDliYzVjYmZiYmMiLz4gPC9yZGY6RGVzY3JpcHRpb24+IDwvcmRmOlJERj4gPC94OnhtcG1ldGE+IDw/eHBhY2tldCBlbmQ9InIiPz7zuW8MAAAAJ1BMVEWIiIi2trb+/v61tbW7u7uOjo7BwcGMjIy3t7eZmZmNjY28vLz////kphxkAAAADXRSTlP///////////////8APegihgAAAFVJREFUeNpkzkkCgDAIBMEJQtzm/+/VCIlB+1inRj1O5tQqsQJb0gIYoQBKVighS/KmRQgmD7159q6Nh8vQh8MndXbfXw12n46C+fnsTFFT/jl3CTAA0LUIsCxo7VoAAAAASUVORK5CYII=) no-repeat 0 0;width: 11px;height: 6px;-webkit-background-size: 11px auto;background-size: 11px auto;margin-top: 6px;}
.suc-about-detail{display: none;}
.show-detail .suc-about-detail{display: block;}
.show-detail .suc-ico-arrow{-webkit-transform: rotate(180deg);transform: rotate(180deg);}
.suc-layer-s{position: fixed;z-index: 999;left: 0;top: 0;width: 100%;height: 100%;background-color: rgba(0,0,0,0.8);}
.suc-layer{background-color: #EDEDED;position: absolute;bottom: 0;width: 100%;}
.suc-player-div{padding: 18px 15px;}
.suc-player-div p{padding-bottom: 22px;color: #454545;font-size: 18px;line-height: 22px;text-align: center;}
| 92.455497 | 1,704 | 0.7736 |
b8c99cd096f50bd8c32f73c930e9f88b628ae9ba | 1,958 | h | C | src/resource/types.h | seedhartha/revan | b9a98007ca2f510b42894ecd09fb623571b433dc | [
"MIT"
] | 37 | 2020-06-27T18:50:48.000Z | 2020-08-02T14:13:51.000Z | src/resource/types.h | seedhartha/revan | b9a98007ca2f510b42894ecd09fb623571b433dc | [
"MIT"
] | null | null | null | src/resource/types.h | seedhartha/revan | b9a98007ca2f510b42894ecd09fb623571b433dc | [
"MIT"
] | 1 | 2020-07-14T13:32:15.000Z | 2020-07-14T13:32:15.000Z | /*
* Copyright (c) 2020-2022 The reone project contributors
*
* This program is free software: you can redistribute it and/or modify
* it under the terms of the GNU General Public License as published by
* the Free Software Foundation, either version 3 of the License, or
* (at your option) any later version.
*
* This program is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
* GNU General Public License for more details.
*
* You should have received a copy of the GNU General Public License
* along with this program. If not, see <https://www.gnu.org/licenses/>.
*/
#pragma once
namespace reone {
namespace resource {
constexpr int kDefaultProviderId = -1;
/**
* Used together with a ResRef to locate game resources.
*/
enum class ResourceType : uint16_t {
Res = 0,
Bmp = 1,
Tga = 3,
Wav = 4,
Plt = 6,
Ini = 7,
Txt = 10,
Mdl = 2002,
Nss = 2009,
Ncs = 2010,
Are = 2012,
Set = 2013,
Ifo = 2014,
Bic = 2015,
Wok = 2016,
TwoDa = 2017,
Txi = 2022,
Git = 2023,
Bti = 2024,
Uti = 2025,
Btc = 2026,
Utc = 2027,
Dlg = 2029,
Itp = 2030,
Utt = 2032,
Dds = 2033,
Uts = 2035,
Ltr = 2036,
Gff = 2037,
Fac = 2038,
Ute = 2040,
Utd = 2042,
Utp = 2044,
Dft = 2045,
Gic = 2046,
Gui = 2047,
Utm = 2051,
Dwk = 2052,
Pwk = 2053,
Jrl = 2056,
Mod = 2057,
Utw = 2058,
Ssf = 2060,
Ndb = 2064,
Ptm = 2065,
Ptt = 2066,
Lyt = 3000,
Vis = 3001,
Pth = 3003,
Lip = 3004,
Tpc = 3007,
Mdx = 3008,
Mp3 = 0x1000,
Invalid = 0xffff
};
enum class PEResourceType {
Cursor = 1,
Icon = 3,
CursorGroup = 12,
IconGroup = 14,
Version = 16,
Manifest = 24
};
} // namespace resource
} // namespace reone
| 19.58 | 73 | 0.589377 |
33a67fc384b29ea840c34e10e6eab33aba6c4130 | 37,687 | go | Go | pkg/chaosdaemon/pb/chaosdaemon.pb.go | at15/chaos-mesh | 8f063e6ccd725db72781b7ff5cd5e884feee5723 | [
"Apache-2.0"
] | null | null | null | pkg/chaosdaemon/pb/chaosdaemon.pb.go | at15/chaos-mesh | 8f063e6ccd725db72781b7ff5cd5e884feee5723 | [
"Apache-2.0"
] | null | null | null | pkg/chaosdaemon/pb/chaosdaemon.pb.go | at15/chaos-mesh | 8f063e6ccd725db72781b7ff5cd5e884feee5723 | [
"Apache-2.0"
] | null | null | null | // Code generated by protoc-gen-go. DO NOT EDIT.
// source: chaosdaemon.proto
package chaosdaemon
import (
context "context"
fmt "fmt"
math "math"
proto "github.com/golang/protobuf/proto"
empty "github.com/golang/protobuf/ptypes/empty"
grpc "google.golang.org/grpc"
codes "google.golang.org/grpc/codes"
status "google.golang.org/grpc/status"
)
// Reference imports to suppress errors if they are not otherwise used.
var _ = proto.Marshal
var _ = fmt.Errorf
var _ = math.Inf
// This is a compile-time assertion to ensure that this generated file
// is compatible with the proto package it is being compiled against.
// A compilation error at this line likely means your copy of the
// proto package needs to be updated.
const _ = proto.ProtoPackageIsVersion3 // please upgrade the proto package
type Rule_Action int32
const (
Rule_ADD Rule_Action = 0
Rule_DELETE Rule_Action = 1
)
var Rule_Action_name = map[int32]string{
0: "ADD",
1: "DELETE",
}
var Rule_Action_value = map[string]int32{
"ADD": 0,
"DELETE": 1,
}
func (x Rule_Action) String() string {
return proto.EnumName(Rule_Action_name, int32(x))
}
func (Rule_Action) EnumDescriptor() ([]byte, []int) {
return fileDescriptor_143136706133b591, []int{7, 0}
}
type Rule_Direction int32
const (
Rule_INPUT Rule_Direction = 0
Rule_OUTPUT Rule_Direction = 1
)
var Rule_Direction_name = map[int32]string{
0: "INPUT",
1: "OUTPUT",
}
var Rule_Direction_value = map[string]int32{
"INPUT": 0,
"OUTPUT": 1,
}
func (x Rule_Direction) String() string {
return proto.EnumName(Rule_Direction_name, int32(x))
}
func (Rule_Direction) EnumDescriptor() ([]byte, []int) {
return fileDescriptor_143136706133b591, []int{7, 1}
}
type ContainerAction_Action int32
const (
ContainerAction_KILL ContainerAction_Action = 0
ContainerAction_GETPID ContainerAction_Action = 1
)
var ContainerAction_Action_name = map[int32]string{
0: "KILL",
1: "GETPID",
}
var ContainerAction_Action_value = map[string]int32{
"KILL": 0,
"GETPID": 1,
}
func (x ContainerAction_Action) String() string {
return proto.EnumName(ContainerAction_Action_name, int32(x))
}
func (ContainerAction_Action) EnumDescriptor() ([]byte, []int) {
return fileDescriptor_143136706133b591, []int{9, 0}
}
type ContainerRequest struct {
Action *ContainerAction `protobuf:"bytes,1,opt,name=action,proto3" json:"action,omitempty"`
ContainerId string `protobuf:"bytes,2,opt,name=container_id,json=containerId,proto3" json:"container_id,omitempty"`
XXX_NoUnkeyedLiteral struct{} `json:"-"`
XXX_unrecognized []byte `json:"-"`
XXX_sizecache int32 `json:"-"`
}
func (m *ContainerRequest) Reset() { *m = ContainerRequest{} }
func (m *ContainerRequest) String() string { return proto.CompactTextString(m) }
func (*ContainerRequest) ProtoMessage() {}
func (*ContainerRequest) Descriptor() ([]byte, []int) {
return fileDescriptor_143136706133b591, []int{0}
}
func (m *ContainerRequest) XXX_Unmarshal(b []byte) error {
return xxx_messageInfo_ContainerRequest.Unmarshal(m, b)
}
func (m *ContainerRequest) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) {
return xxx_messageInfo_ContainerRequest.Marshal(b, m, deterministic)
}
func (m *ContainerRequest) XXX_Merge(src proto.Message) {
xxx_messageInfo_ContainerRequest.Merge(m, src)
}
func (m *ContainerRequest) XXX_Size() int {
return xxx_messageInfo_ContainerRequest.Size(m)
}
func (m *ContainerRequest) XXX_DiscardUnknown() {
xxx_messageInfo_ContainerRequest.DiscardUnknown(m)
}
var xxx_messageInfo_ContainerRequest proto.InternalMessageInfo
func (m *ContainerRequest) GetAction() *ContainerAction {
if m != nil {
return m.Action
}
return nil
}
func (m *ContainerRequest) GetContainerId() string {
if m != nil {
return m.ContainerId
}
return ""
}
type ContainerResponse struct {
Pid uint32 `protobuf:"varint,1,opt,name=pid,proto3" json:"pid,omitempty"`
XXX_NoUnkeyedLiteral struct{} `json:"-"`
XXX_unrecognized []byte `json:"-"`
XXX_sizecache int32 `json:"-"`
}
func (m *ContainerResponse) Reset() { *m = ContainerResponse{} }
func (m *ContainerResponse) String() string { return proto.CompactTextString(m) }
func (*ContainerResponse) ProtoMessage() {}
func (*ContainerResponse) Descriptor() ([]byte, []int) {
return fileDescriptor_143136706133b591, []int{1}
}
func (m *ContainerResponse) XXX_Unmarshal(b []byte) error {
return xxx_messageInfo_ContainerResponse.Unmarshal(m, b)
}
func (m *ContainerResponse) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) {
return xxx_messageInfo_ContainerResponse.Marshal(b, m, deterministic)
}
func (m *ContainerResponse) XXX_Merge(src proto.Message) {
xxx_messageInfo_ContainerResponse.Merge(m, src)
}
func (m *ContainerResponse) XXX_Size() int {
return xxx_messageInfo_ContainerResponse.Size(m)
}
func (m *ContainerResponse) XXX_DiscardUnknown() {
xxx_messageInfo_ContainerResponse.DiscardUnknown(m)
}
var xxx_messageInfo_ContainerResponse proto.InternalMessageInfo
func (m *ContainerResponse) GetPid() uint32 {
if m != nil {
return m.Pid
}
return 0
}
type NetemRequest struct {
Netem *Netem `protobuf:"bytes,1,opt,name=netem,proto3" json:"netem,omitempty"`
ContainerId string `protobuf:"bytes,2,opt,name=container_id,json=containerId,proto3" json:"container_id,omitempty"`
XXX_NoUnkeyedLiteral struct{} `json:"-"`
XXX_unrecognized []byte `json:"-"`
XXX_sizecache int32 `json:"-"`
}
func (m *NetemRequest) Reset() { *m = NetemRequest{} }
func (m *NetemRequest) String() string { return proto.CompactTextString(m) }
func (*NetemRequest) ProtoMessage() {}
func (*NetemRequest) Descriptor() ([]byte, []int) {
return fileDescriptor_143136706133b591, []int{2}
}
func (m *NetemRequest) XXX_Unmarshal(b []byte) error {
return xxx_messageInfo_NetemRequest.Unmarshal(m, b)
}
func (m *NetemRequest) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) {
return xxx_messageInfo_NetemRequest.Marshal(b, m, deterministic)
}
func (m *NetemRequest) XXX_Merge(src proto.Message) {
xxx_messageInfo_NetemRequest.Merge(m, src)
}
func (m *NetemRequest) XXX_Size() int {
return xxx_messageInfo_NetemRequest.Size(m)
}
func (m *NetemRequest) XXX_DiscardUnknown() {
xxx_messageInfo_NetemRequest.DiscardUnknown(m)
}
var xxx_messageInfo_NetemRequest proto.InternalMessageInfo
func (m *NetemRequest) GetNetem() *Netem {
if m != nil {
return m.Netem
}
return nil
}
func (m *NetemRequest) GetContainerId() string {
if m != nil {
return m.ContainerId
}
return ""
}
type Netem struct {
Time uint32 `protobuf:"varint,1,opt,name=time,proto3" json:"time,omitempty"`
Jitter uint32 `protobuf:"varint,2,opt,name=jitter,proto3" json:"jitter,omitempty"`
DelayCorr float32 `protobuf:"fixed32,3,opt,name=delay_corr,json=delayCorr,proto3" json:"delay_corr,omitempty"`
Limit uint32 `protobuf:"varint,4,opt,name=limit,proto3" json:"limit,omitempty"`
Loss float32 `protobuf:"fixed32,5,opt,name=loss,proto3" json:"loss,omitempty"`
LossCorr float32 `protobuf:"fixed32,6,opt,name=loss_corr,json=lossCorr,proto3" json:"loss_corr,omitempty"`
Gap uint32 `protobuf:"varint,7,opt,name=gap,proto3" json:"gap,omitempty"`
Duplicate float32 `protobuf:"fixed32,8,opt,name=duplicate,proto3" json:"duplicate,omitempty"`
DuplicateCorr float32 `protobuf:"fixed32,9,opt,name=duplicate_corr,json=duplicateCorr,proto3" json:"duplicate_corr,omitempty"`
Reorder float32 `protobuf:"fixed32,10,opt,name=reorder,proto3" json:"reorder,omitempty"`
ReorderCorr float32 `protobuf:"fixed32,11,opt,name=reorder_corr,json=reorderCorr,proto3" json:"reorder_corr,omitempty"`
Corrupt float32 `protobuf:"fixed32,12,opt,name=corrupt,proto3" json:"corrupt,omitempty"`
CorruptCorr float32 `protobuf:"fixed32,13,opt,name=corrupt_corr,json=corruptCorr,proto3" json:"corrupt_corr,omitempty"`
XXX_NoUnkeyedLiteral struct{} `json:"-"`
XXX_unrecognized []byte `json:"-"`
XXX_sizecache int32 `json:"-"`
}
func (m *Netem) Reset() { *m = Netem{} }
func (m *Netem) String() string { return proto.CompactTextString(m) }
func (*Netem) ProtoMessage() {}
func (*Netem) Descriptor() ([]byte, []int) {
return fileDescriptor_143136706133b591, []int{3}
}
func (m *Netem) XXX_Unmarshal(b []byte) error {
return xxx_messageInfo_Netem.Unmarshal(m, b)
}
func (m *Netem) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) {
return xxx_messageInfo_Netem.Marshal(b, m, deterministic)
}
func (m *Netem) XXX_Merge(src proto.Message) {
xxx_messageInfo_Netem.Merge(m, src)
}
func (m *Netem) XXX_Size() int {
return xxx_messageInfo_Netem.Size(m)
}
func (m *Netem) XXX_DiscardUnknown() {
xxx_messageInfo_Netem.DiscardUnknown(m)
}
var xxx_messageInfo_Netem proto.InternalMessageInfo
func (m *Netem) GetTime() uint32 {
if m != nil {
return m.Time
}
return 0
}
func (m *Netem) GetJitter() uint32 {
if m != nil {
return m.Jitter
}
return 0
}
func (m *Netem) GetDelayCorr() float32 {
if m != nil {
return m.DelayCorr
}
return 0
}
func (m *Netem) GetLimit() uint32 {
if m != nil {
return m.Limit
}
return 0
}
func (m *Netem) GetLoss() float32 {
if m != nil {
return m.Loss
}
return 0
}
func (m *Netem) GetLossCorr() float32 {
if m != nil {
return m.LossCorr
}
return 0
}
func (m *Netem) GetGap() uint32 {
if m != nil {
return m.Gap
}
return 0
}
func (m *Netem) GetDuplicate() float32 {
if m != nil {
return m.Duplicate
}
return 0
}
func (m *Netem) GetDuplicateCorr() float32 {
if m != nil {
return m.DuplicateCorr
}
return 0
}
func (m *Netem) GetReorder() float32 {
if m != nil {
return m.Reorder
}
return 0
}
func (m *Netem) GetReorderCorr() float32 {
if m != nil {
return m.ReorderCorr
}
return 0
}
func (m *Netem) GetCorrupt() float32 {
if m != nil {
return m.Corrupt
}
return 0
}
func (m *Netem) GetCorruptCorr() float32 {
if m != nil {
return m.CorruptCorr
}
return 0
}
type IpSetRequest struct {
Ipset *IpSet `protobuf:"bytes,1,opt,name=ipset,proto3" json:"ipset,omitempty"`
ContainerId string `protobuf:"bytes,2,opt,name=container_id,json=containerId,proto3" json:"container_id,omitempty"`
XXX_NoUnkeyedLiteral struct{} `json:"-"`
XXX_unrecognized []byte `json:"-"`
XXX_sizecache int32 `json:"-"`
}
func (m *IpSetRequest) Reset() { *m = IpSetRequest{} }
func (m *IpSetRequest) String() string { return proto.CompactTextString(m) }
func (*IpSetRequest) ProtoMessage() {}
func (*IpSetRequest) Descriptor() ([]byte, []int) {
return fileDescriptor_143136706133b591, []int{4}
}
func (m *IpSetRequest) XXX_Unmarshal(b []byte) error {
return xxx_messageInfo_IpSetRequest.Unmarshal(m, b)
}
func (m *IpSetRequest) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) {
return xxx_messageInfo_IpSetRequest.Marshal(b, m, deterministic)
}
func (m *IpSetRequest) XXX_Merge(src proto.Message) {
xxx_messageInfo_IpSetRequest.Merge(m, src)
}
func (m *IpSetRequest) XXX_Size() int {
return xxx_messageInfo_IpSetRequest.Size(m)
}
func (m *IpSetRequest) XXX_DiscardUnknown() {
xxx_messageInfo_IpSetRequest.DiscardUnknown(m)
}
var xxx_messageInfo_IpSetRequest proto.InternalMessageInfo
func (m *IpSetRequest) GetIpset() *IpSet {
if m != nil {
return m.Ipset
}
return nil
}
func (m *IpSetRequest) GetContainerId() string {
if m != nil {
return m.ContainerId
}
return ""
}
type IpSet struct {
Name string `protobuf:"bytes,1,opt,name=name,proto3" json:"name,omitempty"`
Ips []string `protobuf:"bytes,2,rep,name=ips,proto3" json:"ips,omitempty"`
XXX_NoUnkeyedLiteral struct{} `json:"-"`
XXX_unrecognized []byte `json:"-"`
XXX_sizecache int32 `json:"-"`
}
func (m *IpSet) Reset() { *m = IpSet{} }
func (m *IpSet) String() string { return proto.CompactTextString(m) }
func (*IpSet) ProtoMessage() {}
func (*IpSet) Descriptor() ([]byte, []int) {
return fileDescriptor_143136706133b591, []int{5}
}
func (m *IpSet) XXX_Unmarshal(b []byte) error {
return xxx_messageInfo_IpSet.Unmarshal(m, b)
}
func (m *IpSet) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) {
return xxx_messageInfo_IpSet.Marshal(b, m, deterministic)
}
func (m *IpSet) XXX_Merge(src proto.Message) {
xxx_messageInfo_IpSet.Merge(m, src)
}
func (m *IpSet) XXX_Size() int {
return xxx_messageInfo_IpSet.Size(m)
}
func (m *IpSet) XXX_DiscardUnknown() {
xxx_messageInfo_IpSet.DiscardUnknown(m)
}
var xxx_messageInfo_IpSet proto.InternalMessageInfo
func (m *IpSet) GetName() string {
if m != nil {
return m.Name
}
return ""
}
func (m *IpSet) GetIps() []string {
if m != nil {
return m.Ips
}
return nil
}
type IpTablesRequest struct {
Rule *Rule `protobuf:"bytes,1,opt,name=rule,proto3" json:"rule,omitempty"`
ContainerId string `protobuf:"bytes,2,opt,name=container_id,json=containerId,proto3" json:"container_id,omitempty"`
XXX_NoUnkeyedLiteral struct{} `json:"-"`
XXX_unrecognized []byte `json:"-"`
XXX_sizecache int32 `json:"-"`
}
func (m *IpTablesRequest) Reset() { *m = IpTablesRequest{} }
func (m *IpTablesRequest) String() string { return proto.CompactTextString(m) }
func (*IpTablesRequest) ProtoMessage() {}
func (*IpTablesRequest) Descriptor() ([]byte, []int) {
return fileDescriptor_143136706133b591, []int{6}
}
func (m *IpTablesRequest) XXX_Unmarshal(b []byte) error {
return xxx_messageInfo_IpTablesRequest.Unmarshal(m, b)
}
func (m *IpTablesRequest) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) {
return xxx_messageInfo_IpTablesRequest.Marshal(b, m, deterministic)
}
func (m *IpTablesRequest) XXX_Merge(src proto.Message) {
xxx_messageInfo_IpTablesRequest.Merge(m, src)
}
func (m *IpTablesRequest) XXX_Size() int {
return xxx_messageInfo_IpTablesRequest.Size(m)
}
func (m *IpTablesRequest) XXX_DiscardUnknown() {
xxx_messageInfo_IpTablesRequest.DiscardUnknown(m)
}
var xxx_messageInfo_IpTablesRequest proto.InternalMessageInfo
func (m *IpTablesRequest) GetRule() *Rule {
if m != nil {
return m.Rule
}
return nil
}
func (m *IpTablesRequest) GetContainerId() string {
if m != nil {
return m.ContainerId
}
return ""
}
type Rule struct {
Action Rule_Action `protobuf:"varint,1,opt,name=action,proto3,enum=chaosdaemon.Rule_Action" json:"action,omitempty"`
Direction Rule_Direction `protobuf:"varint,2,opt,name=direction,proto3,enum=chaosdaemon.Rule_Direction" json:"direction,omitempty"`
Set string `protobuf:"bytes,3,opt,name=set,proto3" json:"set,omitempty"`
XXX_NoUnkeyedLiteral struct{} `json:"-"`
XXX_unrecognized []byte `json:"-"`
XXX_sizecache int32 `json:"-"`
}
func (m *Rule) Reset() { *m = Rule{} }
func (m *Rule) String() string { return proto.CompactTextString(m) }
func (*Rule) ProtoMessage() {}
func (*Rule) Descriptor() ([]byte, []int) {
return fileDescriptor_143136706133b591, []int{7}
}
func (m *Rule) XXX_Unmarshal(b []byte) error {
return xxx_messageInfo_Rule.Unmarshal(m, b)
}
func (m *Rule) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) {
return xxx_messageInfo_Rule.Marshal(b, m, deterministic)
}
func (m *Rule) XXX_Merge(src proto.Message) {
xxx_messageInfo_Rule.Merge(m, src)
}
func (m *Rule) XXX_Size() int {
return xxx_messageInfo_Rule.Size(m)
}
func (m *Rule) XXX_DiscardUnknown() {
xxx_messageInfo_Rule.DiscardUnknown(m)
}
var xxx_messageInfo_Rule proto.InternalMessageInfo
func (m *Rule) GetAction() Rule_Action {
if m != nil {
return m.Action
}
return Rule_ADD
}
func (m *Rule) GetDirection() Rule_Direction {
if m != nil {
return m.Direction
}
return Rule_INPUT
}
func (m *Rule) GetSet() string {
if m != nil {
return m.Set
}
return ""
}
type TimeRequest struct {
ContainerId string `protobuf:"bytes,1,opt,name=container_id,json=containerId,proto3" json:"container_id,omitempty"`
Sec int64 `protobuf:"varint,2,opt,name=sec,proto3" json:"sec,omitempty"`
Nsec int64 `protobuf:"varint,3,opt,name=nsec,proto3" json:"nsec,omitempty"`
ClkIdsMask uint64 `protobuf:"varint,4,opt,name=clk_ids_mask,json=clkIdsMask,proto3" json:"clk_ids_mask,omitempty"`
XXX_NoUnkeyedLiteral struct{} `json:"-"`
XXX_unrecognized []byte `json:"-"`
XXX_sizecache int32 `json:"-"`
}
func (m *TimeRequest) Reset() { *m = TimeRequest{} }
func (m *TimeRequest) String() string { return proto.CompactTextString(m) }
func (*TimeRequest) ProtoMessage() {}
func (*TimeRequest) Descriptor() ([]byte, []int) {
return fileDescriptor_143136706133b591, []int{8}
}
func (m *TimeRequest) XXX_Unmarshal(b []byte) error {
return xxx_messageInfo_TimeRequest.Unmarshal(m, b)
}
func (m *TimeRequest) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) {
return xxx_messageInfo_TimeRequest.Marshal(b, m, deterministic)
}
func (m *TimeRequest) XXX_Merge(src proto.Message) {
xxx_messageInfo_TimeRequest.Merge(m, src)
}
func (m *TimeRequest) XXX_Size() int {
return xxx_messageInfo_TimeRequest.Size(m)
}
func (m *TimeRequest) XXX_DiscardUnknown() {
xxx_messageInfo_TimeRequest.DiscardUnknown(m)
}
var xxx_messageInfo_TimeRequest proto.InternalMessageInfo
func (m *TimeRequest) GetContainerId() string {
if m != nil {
return m.ContainerId
}
return ""
}
func (m *TimeRequest) GetSec() int64 {
if m != nil {
return m.Sec
}
return 0
}
func (m *TimeRequest) GetNsec() int64 {
if m != nil {
return m.Nsec
}
return 0
}
func (m *TimeRequest) GetClkIdsMask() uint64 {
if m != nil {
return m.ClkIdsMask
}
return 0
}
type ContainerAction struct {
Action ContainerAction_Action `protobuf:"varint,1,opt,name=action,proto3,enum=chaosdaemon.ContainerAction_Action" json:"action,omitempty"`
XXX_NoUnkeyedLiteral struct{} `json:"-"`
XXX_unrecognized []byte `json:"-"`
XXX_sizecache int32 `json:"-"`
}
func (m *ContainerAction) Reset() { *m = ContainerAction{} }
func (m *ContainerAction) String() string { return proto.CompactTextString(m) }
func (*ContainerAction) ProtoMessage() {}
func (*ContainerAction) Descriptor() ([]byte, []int) {
return fileDescriptor_143136706133b591, []int{9}
}
func (m *ContainerAction) XXX_Unmarshal(b []byte) error {
return xxx_messageInfo_ContainerAction.Unmarshal(m, b)
}
func (m *ContainerAction) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) {
return xxx_messageInfo_ContainerAction.Marshal(b, m, deterministic)
}
func (m *ContainerAction) XXX_Merge(src proto.Message) {
xxx_messageInfo_ContainerAction.Merge(m, src)
}
func (m *ContainerAction) XXX_Size() int {
return xxx_messageInfo_ContainerAction.Size(m)
}
func (m *ContainerAction) XXX_DiscardUnknown() {
xxx_messageInfo_ContainerAction.DiscardUnknown(m)
}
var xxx_messageInfo_ContainerAction proto.InternalMessageInfo
func (m *ContainerAction) GetAction() ContainerAction_Action {
if m != nil {
return m.Action
}
return ContainerAction_KILL
}
func init() {
proto.RegisterEnum("chaosdaemon.Rule_Action", Rule_Action_name, Rule_Action_value)
proto.RegisterEnum("chaosdaemon.Rule_Direction", Rule_Direction_name, Rule_Direction_value)
proto.RegisterEnum("chaosdaemon.ContainerAction_Action", ContainerAction_Action_name, ContainerAction_Action_value)
proto.RegisterType((*ContainerRequest)(nil), "chaosdaemon.ContainerRequest")
proto.RegisterType((*ContainerResponse)(nil), "chaosdaemon.ContainerResponse")
proto.RegisterType((*NetemRequest)(nil), "chaosdaemon.NetemRequest")
proto.RegisterType((*Netem)(nil), "chaosdaemon.Netem")
proto.RegisterType((*IpSetRequest)(nil), "chaosdaemon.IpSetRequest")
proto.RegisterType((*IpSet)(nil), "chaosdaemon.IpSet")
proto.RegisterType((*IpTablesRequest)(nil), "chaosdaemon.IpTablesRequest")
proto.RegisterType((*Rule)(nil), "chaosdaemon.Rule")
proto.RegisterType((*TimeRequest)(nil), "chaosdaemon.TimeRequest")
proto.RegisterType((*ContainerAction)(nil), "chaosdaemon.ContainerAction")
}
func init() { proto.RegisterFile("chaosdaemon.proto", fileDescriptor_143136706133b591) }
var fileDescriptor_143136706133b591 = []byte{
// 748 bytes of a gzipped FileDescriptorProto
0x1f, 0x8b, 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0xff, 0xa4, 0x55, 0xdd, 0x4e, 0xdb, 0x4a,
0x10, 0xc6, 0x71, 0x12, 0xe2, 0x31, 0x81, 0x64, 0x75, 0x84, 0xcc, 0xaf, 0x72, 0x7c, 0x84, 0x94,
0x9b, 0x13, 0x2a, 0xda, 0x9b, 0xaa, 0x17, 0x15, 0x4d, 0x52, 0x1a, 0x81, 0x00, 0x99, 0xd0, 0x1b,
0x2e, 0x90, 0xb1, 0x87, 0xb0, 0xad, 0x63, 0xbb, 0xf6, 0xa6, 0x12, 0x6f, 0x58, 0xf5, 0x51, 0xfa,
0x14, 0xd5, 0xce, 0xda, 0x6e, 0x12, 0x52, 0x40, 0xe2, 0x2a, 0xb3, 0x33, 0xf3, 0x7d, 0xf3, 0xed,
0xcc, 0x78, 0x03, 0x4d, 0xef, 0xce, 0x8d, 0x52, 0xdf, 0xc5, 0x71, 0x14, 0x76, 0xe2, 0x24, 0x12,
0x11, 0x33, 0xa7, 0x5c, 0x9b, 0x5b, 0xa3, 0x28, 0x1a, 0x05, 0xb8, 0x4f, 0xa1, 0x9b, 0xc9, 0xed,
0x3e, 0x8e, 0x63, 0x71, 0xaf, 0x32, 0xed, 0xaf, 0xd0, 0xe8, 0x46, 0xa1, 0x70, 0x79, 0x88, 0x89,
0x83, 0xdf, 0x26, 0x98, 0x0a, 0xf6, 0x06, 0xaa, 0xae, 0x27, 0x78, 0x14, 0x5a, 0x5a, 0x4b, 0x6b,
0x9b, 0x07, 0xdb, 0x9d, 0xe9, 0x0a, 0x45, 0xfa, 0x21, 0xe5, 0x38, 0x59, 0x2e, 0xfb, 0x17, 0x56,
0xbc, 0x3c, 0x74, 0xcd, 0x7d, 0xab, 0xd4, 0xd2, 0xda, 0x86, 0x63, 0x16, 0xbe, 0x81, 0x6f, 0xef,
0x41, 0x73, 0xaa, 0x58, 0x1a, 0x47, 0x61, 0x8a, 0xac, 0x01, 0x7a, 0xcc, 0x7d, 0x2a, 0x55, 0x77,
0xa4, 0x69, 0x5f, 0xc1, 0xca, 0x29, 0x0a, 0x1c, 0xe7, 0x7a, 0xda, 0x50, 0x09, 0xe5, 0x39, 0x93,
0xc3, 0x66, 0xe4, 0xa8, 0x4c, 0x95, 0xf0, 0x1c, 0x0d, 0xbf, 0x4a, 0x50, 0x21, 0x0c, 0x63, 0x50,
0x16, 0x7c, 0x8c, 0x59, 0x65, 0xb2, 0xd9, 0x3a, 0x54, 0xbf, 0x70, 0x21, 0x30, 0x21, 0x68, 0xdd,
0xc9, 0x4e, 0x6c, 0x07, 0xc0, 0xc7, 0xc0, 0xbd, 0xbf, 0xf6, 0xa2, 0x24, 0xb1, 0xf4, 0x96, 0xd6,
0x2e, 0x39, 0x06, 0x79, 0xba, 0x51, 0x92, 0xb0, 0x7f, 0xa0, 0x12, 0xf0, 0x31, 0x17, 0x56, 0x99,
0x50, 0xea, 0x20, 0x0b, 0x04, 0x51, 0x9a, 0x5a, 0x15, 0x4a, 0x27, 0x9b, 0x6d, 0x81, 0x21, 0x7f,
0x15, 0x4f, 0x95, 0x02, 0x35, 0xe9, 0x20, 0x9a, 0x06, 0xe8, 0x23, 0x37, 0xb6, 0x96, 0x55, 0x2b,
0x46, 0x6e, 0xcc, 0xb6, 0xc1, 0xf0, 0x27, 0x71, 0xc0, 0x3d, 0x57, 0xa0, 0x55, 0xcb, 0xca, 0xe6,
0x0e, 0xb6, 0x07, 0xab, 0xc5, 0x41, 0x31, 0x1a, 0x94, 0x52, 0x2f, 0xbc, 0x44, 0x6b, 0xc1, 0x72,
0x82, 0x51, 0xe2, 0x63, 0x62, 0x01, 0xc5, 0xf3, 0xa3, 0xec, 0x57, 0x66, 0x2a, 0xb8, 0x49, 0x61,
0x33, 0xf3, 0xe5, 0x60, 0x19, 0x9a, 0xc4, 0xc2, 0x5a, 0x51, 0xe0, 0xec, 0xa8, 0x9a, 0x4d, 0xa6,
0x02, 0xd7, 0x15, 0x38, 0xf3, 0x49, 0xb0, 0x9c, 0xe4, 0x20, 0xbe, 0x40, 0x31, 0x35, 0x49, 0x1e,
0xa7, 0x28, 0x16, 0x4e, 0x52, 0x65, 0xaa, 0x84, 0xe7, 0x4c, 0xf2, 0x7f, 0xa8, 0x10, 0x44, 0xf6,
0x39, 0x74, 0xb3, 0x41, 0x1a, 0x0e, 0xd9, 0xb2, 0x95, 0x3c, 0x4e, 0xad, 0x52, 0x4b, 0x6f, 0x1b,
0x8e, 0x34, 0xed, 0x2b, 0x58, 0x1b, 0xc4, 0x43, 0xf7, 0x26, 0xc0, 0x34, 0x97, 0xb3, 0x07, 0xe5,
0x64, 0x12, 0x60, 0xa6, 0xa6, 0x39, 0xa3, 0xc6, 0x99, 0x04, 0xe8, 0x50, 0xf8, 0x39, 0x5a, 0x7e,
0x68, 0x50, 0x96, 0x08, 0xf6, 0x6a, 0xe6, 0xdb, 0x59, 0x3d, 0xb0, 0x1e, 0x90, 0x76, 0xe6, 0xbe,
0x9b, 0xb7, 0x60, 0xf8, 0x3c, 0x41, 0x05, 0x2a, 0x11, 0x68, 0xeb, 0x21, 0xa8, 0x97, 0xa7, 0x38,
0x7f, 0xb2, 0xe5, 0x25, 0x65, 0x33, 0x75, 0xd2, 0x23, 0x4d, 0x7b, 0x07, 0xaa, 0x8a, 0x9e, 0x2d,
0x83, 0x7e, 0xd8, 0xeb, 0x35, 0x96, 0x18, 0x40, 0xb5, 0xd7, 0x3f, 0xe9, 0x0f, 0xfb, 0x0d, 0xcd,
0xb6, 0xc1, 0x28, 0x88, 0x98, 0x01, 0x95, 0xc1, 0xe9, 0xf9, 0xe5, 0x50, 0xe5, 0x9c, 0x5d, 0x0e,
0xa5, 0xad, 0xd9, 0x9f, 0xc1, 0x1c, 0xf2, 0x31, 0xe6, 0x3d, 0x9a, 0xbf, 0xbc, 0xf6, 0xe0, 0xf2,
0x4a, 0x86, 0x47, 0xda, 0x75, 0x29, 0xc3, 0xa3, 0x89, 0x48, 0x97, 0x4e, 0x2e, 0xb2, 0xed, 0x10,
0xd6, 0xe6, 0x9e, 0x0e, 0xf6, 0x6e, 0xae, 0x59, 0xff, 0x3d, 0xf6, 0xd0, 0xcc, 0xf5, 0xcd, 0xde,
0x2d, 0xae, 0x5a, 0x83, 0xf2, 0xf1, 0xe0, 0xe4, 0x44, 0xdd, 0xe3, 0xa8, 0x3f, 0x3c, 0x1f, 0xf4,
0x1a, 0xda, 0xc1, 0xcf, 0x32, 0x98, 0x5d, 0x49, 0xd7, 0x23, 0x3a, 0xf6, 0x1e, 0x6a, 0x17, 0x28,
0xd4, 0xa7, 0xbf, 0xb1, 0xe0, 0x09, 0x51, 0xf7, 0xdd, 0x5c, 0xef, 0xa8, 0xe7, 0xb2, 0x93, 0x3f,
0x97, 0x9d, 0xbe, 0x7c, 0x2e, 0xed, 0x25, 0xf6, 0x01, 0xcc, 0x1e, 0x06, 0x28, 0xf0, 0x05, 0x1c,
0x87, 0x00, 0x1f, 0x83, 0x49, 0x7a, 0xa7, 0x16, 0x77, 0x63, 0xc1, 0xfe, 0x3f, 0x49, 0x71, 0x04,
0xf5, 0x8c, 0x42, 0xd0, 0x32, 0xb3, 0xed, 0x39, 0x96, 0x99, 0x1d, 0x7f, 0x84, 0xa8, 0x0b, 0xf5,
0x0b, 0x14, 0x72, 0xd6, 0x67, 0xb7, 0xb7, 0xf2, 0x9b, 0x9b, 0xdd, 0xd5, 0xa9, 0x25, 0x78, 0x54,
0x4d, 0xd3, 0x41, 0x2f, 0xfa, 0x8e, 0xc9, 0x0b, 0x89, 0x3e, 0x41, 0xbd, 0x18, 0xf8, 0x31, 0x0f,
0x02, 0xb6, 0xb3, 0x78, 0x19, 0x9e, 0x66, 0x72, 0xa6, 0x16, 0xed, 0x08, 0xc5, 0x39, 0xf7, 0x9f,
0xe2, 0xda, 0xfd, 0x5b, 0x58, 0xfd, 0x45, 0xd9, 0x4b, 0x37, 0x55, 0xaa, 0xf2, 0xfa, 0x77, 0x00,
0x00, 0x00, 0xff, 0xff, 0xd2, 0xe9, 0x6e, 0x83, 0x6c, 0x07, 0x00, 0x00,
}
// Reference imports to suppress errors if they are not otherwise used.
var _ context.Context
var _ grpc.ClientConn
// This is a compile-time assertion to ensure that this generated file
// is compatible with the grpc package it is being compiled against.
const _ = grpc.SupportPackageIsVersion4
// ChaosDaemonClient is the client API for ChaosDaemon service.
//
// For semantics around ctx use and closing/ending streaming RPCs, please refer to https://godoc.org/google.golang.org/grpc#ClientConn.NewStream.
type ChaosDaemonClient interface {
SetNetem(ctx context.Context, in *NetemRequest, opts ...grpc.CallOption) (*empty.Empty, error)
DeleteNetem(ctx context.Context, in *NetemRequest, opts ...grpc.CallOption) (*empty.Empty, error)
FlushIpSet(ctx context.Context, in *IpSetRequest, opts ...grpc.CallOption) (*empty.Empty, error)
FlushIptables(ctx context.Context, in *IpTablesRequest, opts ...grpc.CallOption) (*empty.Empty, error)
SetTimeOffset(ctx context.Context, in *TimeRequest, opts ...grpc.CallOption) (*empty.Empty, error)
RecoverTimeOffset(ctx context.Context, in *TimeRequest, opts ...grpc.CallOption) (*empty.Empty, error)
ContainerKill(ctx context.Context, in *ContainerRequest, opts ...grpc.CallOption) (*empty.Empty, error)
ContainerGetPid(ctx context.Context, in *ContainerRequest, opts ...grpc.CallOption) (*ContainerResponse, error)
}
type chaosDaemonClient struct {
cc *grpc.ClientConn
}
func NewChaosDaemonClient(cc *grpc.ClientConn) ChaosDaemonClient {
return &chaosDaemonClient{cc}
}
func (c *chaosDaemonClient) SetNetem(ctx context.Context, in *NetemRequest, opts ...grpc.CallOption) (*empty.Empty, error) {
out := new(empty.Empty)
err := c.cc.Invoke(ctx, "/chaosdaemon.ChaosDaemon/SetNetem", in, out, opts...)
if err != nil {
return nil, err
}
return out, nil
}
func (c *chaosDaemonClient) DeleteNetem(ctx context.Context, in *NetemRequest, opts ...grpc.CallOption) (*empty.Empty, error) {
out := new(empty.Empty)
err := c.cc.Invoke(ctx, "/chaosdaemon.ChaosDaemon/DeleteNetem", in, out, opts...)
if err != nil {
return nil, err
}
return out, nil
}
func (c *chaosDaemonClient) FlushIpSet(ctx context.Context, in *IpSetRequest, opts ...grpc.CallOption) (*empty.Empty, error) {
out := new(empty.Empty)
err := c.cc.Invoke(ctx, "/chaosdaemon.ChaosDaemon/FlushIpSet", in, out, opts...)
if err != nil {
return nil, err
}
return out, nil
}
func (c *chaosDaemonClient) FlushIptables(ctx context.Context, in *IpTablesRequest, opts ...grpc.CallOption) (*empty.Empty, error) {
out := new(empty.Empty)
err := c.cc.Invoke(ctx, "/chaosdaemon.ChaosDaemon/FlushIptables", in, out, opts...)
if err != nil {
return nil, err
}
return out, nil
}
func (c *chaosDaemonClient) SetTimeOffset(ctx context.Context, in *TimeRequest, opts ...grpc.CallOption) (*empty.Empty, error) {
out := new(empty.Empty)
err := c.cc.Invoke(ctx, "/chaosdaemon.ChaosDaemon/SetTimeOffset", in, out, opts...)
if err != nil {
return nil, err
}
return out, nil
}
func (c *chaosDaemonClient) RecoverTimeOffset(ctx context.Context, in *TimeRequest, opts ...grpc.CallOption) (*empty.Empty, error) {
out := new(empty.Empty)
err := c.cc.Invoke(ctx, "/chaosdaemon.ChaosDaemon/RecoverTimeOffset", in, out, opts...)
if err != nil {
return nil, err
}
return out, nil
}
func (c *chaosDaemonClient) ContainerKill(ctx context.Context, in *ContainerRequest, opts ...grpc.CallOption) (*empty.Empty, error) {
out := new(empty.Empty)
err := c.cc.Invoke(ctx, "/chaosdaemon.ChaosDaemon/ContainerKill", in, out, opts...)
if err != nil {
return nil, err
}
return out, nil
}
func (c *chaosDaemonClient) ContainerGetPid(ctx context.Context, in *ContainerRequest, opts ...grpc.CallOption) (*ContainerResponse, error) {
out := new(ContainerResponse)
err := c.cc.Invoke(ctx, "/chaosdaemon.ChaosDaemon/ContainerGetPid", in, out, opts...)
if err != nil {
return nil, err
}
return out, nil
}
// ChaosDaemonServer is the server API for ChaosDaemon service.
type ChaosDaemonServer interface {
SetNetem(context.Context, *NetemRequest) (*empty.Empty, error)
DeleteNetem(context.Context, *NetemRequest) (*empty.Empty, error)
FlushIpSet(context.Context, *IpSetRequest) (*empty.Empty, error)
FlushIptables(context.Context, *IpTablesRequest) (*empty.Empty, error)
SetTimeOffset(context.Context, *TimeRequest) (*empty.Empty, error)
RecoverTimeOffset(context.Context, *TimeRequest) (*empty.Empty, error)
ContainerKill(context.Context, *ContainerRequest) (*empty.Empty, error)
ContainerGetPid(context.Context, *ContainerRequest) (*ContainerResponse, error)
}
// UnimplementedChaosDaemonServer can be embedded to have forward compatible implementations.
type UnimplementedChaosDaemonServer struct {
}
func (*UnimplementedChaosDaemonServer) SetNetem(ctx context.Context, req *NetemRequest) (*empty.Empty, error) {
return nil, status.Errorf(codes.Unimplemented, "method SetNetem not implemented")
}
func (*UnimplementedChaosDaemonServer) DeleteNetem(ctx context.Context, req *NetemRequest) (*empty.Empty, error) {
return nil, status.Errorf(codes.Unimplemented, "method DeleteNetem not implemented")
}
func (*UnimplementedChaosDaemonServer) FlushIpSet(ctx context.Context, req *IpSetRequest) (*empty.Empty, error) {
return nil, status.Errorf(codes.Unimplemented, "method FlushIpSet not implemented")
}
func (*UnimplementedChaosDaemonServer) FlushIptables(ctx context.Context, req *IpTablesRequest) (*empty.Empty, error) {
return nil, status.Errorf(codes.Unimplemented, "method FlushIptables not implemented")
}
func (*UnimplementedChaosDaemonServer) SetTimeOffset(ctx context.Context, req *TimeRequest) (*empty.Empty, error) {
return nil, status.Errorf(codes.Unimplemented, "method SetTimeOffset not implemented")
}
func (*UnimplementedChaosDaemonServer) RecoverTimeOffset(ctx context.Context, req *TimeRequest) (*empty.Empty, error) {
return nil, status.Errorf(codes.Unimplemented, "method RecoverTimeOffset not implemented")
}
func (*UnimplementedChaosDaemonServer) ContainerKill(ctx context.Context, req *ContainerRequest) (*empty.Empty, error) {
return nil, status.Errorf(codes.Unimplemented, "method ContainerKill not implemented")
}
func (*UnimplementedChaosDaemonServer) ContainerGetPid(ctx context.Context, req *ContainerRequest) (*ContainerResponse, error) {
return nil, status.Errorf(codes.Unimplemented, "method ContainerGetPid not implemented")
}
func RegisterChaosDaemonServer(s *grpc.Server, srv ChaosDaemonServer) {
s.RegisterService(&_ChaosDaemon_serviceDesc, srv)
}
func _ChaosDaemon_SetNetem_Handler(srv interface{}, ctx context.Context, dec func(interface{}) error, interceptor grpc.UnaryServerInterceptor) (interface{}, error) {
in := new(NetemRequest)
if err := dec(in); err != nil {
return nil, err
}
if interceptor == nil {
return srv.(ChaosDaemonServer).SetNetem(ctx, in)
}
info := &grpc.UnaryServerInfo{
Server: srv,
FullMethod: "/chaosdaemon.ChaosDaemon/SetNetem",
}
handler := func(ctx context.Context, req interface{}) (interface{}, error) {
return srv.(ChaosDaemonServer).SetNetem(ctx, req.(*NetemRequest))
}
return interceptor(ctx, in, info, handler)
}
func _ChaosDaemon_DeleteNetem_Handler(srv interface{}, ctx context.Context, dec func(interface{}) error, interceptor grpc.UnaryServerInterceptor) (interface{}, error) {
in := new(NetemRequest)
if err := dec(in); err != nil {
return nil, err
}
if interceptor == nil {
return srv.(ChaosDaemonServer).DeleteNetem(ctx, in)
}
info := &grpc.UnaryServerInfo{
Server: srv,
FullMethod: "/chaosdaemon.ChaosDaemon/DeleteNetem",
}
handler := func(ctx context.Context, req interface{}) (interface{}, error) {
return srv.(ChaosDaemonServer).DeleteNetem(ctx, req.(*NetemRequest))
}
return interceptor(ctx, in, info, handler)
}
func _ChaosDaemon_FlushIpSet_Handler(srv interface{}, ctx context.Context, dec func(interface{}) error, interceptor grpc.UnaryServerInterceptor) (interface{}, error) {
in := new(IpSetRequest)
if err := dec(in); err != nil {
return nil, err
}
if interceptor == nil {
return srv.(ChaosDaemonServer).FlushIpSet(ctx, in)
}
info := &grpc.UnaryServerInfo{
Server: srv,
FullMethod: "/chaosdaemon.ChaosDaemon/FlushIpSet",
}
handler := func(ctx context.Context, req interface{}) (interface{}, error) {
return srv.(ChaosDaemonServer).FlushIpSet(ctx, req.(*IpSetRequest))
}
return interceptor(ctx, in, info, handler)
}
func _ChaosDaemon_FlushIptables_Handler(srv interface{}, ctx context.Context, dec func(interface{}) error, interceptor grpc.UnaryServerInterceptor) (interface{}, error) {
in := new(IpTablesRequest)
if err := dec(in); err != nil {
return nil, err
}
if interceptor == nil {
return srv.(ChaosDaemonServer).FlushIptables(ctx, in)
}
info := &grpc.UnaryServerInfo{
Server: srv,
FullMethod: "/chaosdaemon.ChaosDaemon/FlushIptables",
}
handler := func(ctx context.Context, req interface{}) (interface{}, error) {
return srv.(ChaosDaemonServer).FlushIptables(ctx, req.(*IpTablesRequest))
}
return interceptor(ctx, in, info, handler)
}
func _ChaosDaemon_SetTimeOffset_Handler(srv interface{}, ctx context.Context, dec func(interface{}) error, interceptor grpc.UnaryServerInterceptor) (interface{}, error) {
in := new(TimeRequest)
if err := dec(in); err != nil {
return nil, err
}
if interceptor == nil {
return srv.(ChaosDaemonServer).SetTimeOffset(ctx, in)
}
info := &grpc.UnaryServerInfo{
Server: srv,
FullMethod: "/chaosdaemon.ChaosDaemon/SetTimeOffset",
}
handler := func(ctx context.Context, req interface{}) (interface{}, error) {
return srv.(ChaosDaemonServer).SetTimeOffset(ctx, req.(*TimeRequest))
}
return interceptor(ctx, in, info, handler)
}
func _ChaosDaemon_RecoverTimeOffset_Handler(srv interface{}, ctx context.Context, dec func(interface{}) error, interceptor grpc.UnaryServerInterceptor) (interface{}, error) {
in := new(TimeRequest)
if err := dec(in); err != nil {
return nil, err
}
if interceptor == nil {
return srv.(ChaosDaemonServer).RecoverTimeOffset(ctx, in)
}
info := &grpc.UnaryServerInfo{
Server: srv,
FullMethod: "/chaosdaemon.ChaosDaemon/RecoverTimeOffset",
}
handler := func(ctx context.Context, req interface{}) (interface{}, error) {
return srv.(ChaosDaemonServer).RecoverTimeOffset(ctx, req.(*TimeRequest))
}
return interceptor(ctx, in, info, handler)
}
func _ChaosDaemon_ContainerKill_Handler(srv interface{}, ctx context.Context, dec func(interface{}) error, interceptor grpc.UnaryServerInterceptor) (interface{}, error) {
in := new(ContainerRequest)
if err := dec(in); err != nil {
return nil, err
}
if interceptor == nil {
return srv.(ChaosDaemonServer).ContainerKill(ctx, in)
}
info := &grpc.UnaryServerInfo{
Server: srv,
FullMethod: "/chaosdaemon.ChaosDaemon/ContainerKill",
}
handler := func(ctx context.Context, req interface{}) (interface{}, error) {
return srv.(ChaosDaemonServer).ContainerKill(ctx, req.(*ContainerRequest))
}
return interceptor(ctx, in, info, handler)
}
func _ChaosDaemon_ContainerGetPid_Handler(srv interface{}, ctx context.Context, dec func(interface{}) error, interceptor grpc.UnaryServerInterceptor) (interface{}, error) {
in := new(ContainerRequest)
if err := dec(in); err != nil {
return nil, err
}
if interceptor == nil {
return srv.(ChaosDaemonServer).ContainerGetPid(ctx, in)
}
info := &grpc.UnaryServerInfo{
Server: srv,
FullMethod: "/chaosdaemon.ChaosDaemon/ContainerGetPid",
}
handler := func(ctx context.Context, req interface{}) (interface{}, error) {
return srv.(ChaosDaemonServer).ContainerGetPid(ctx, req.(*ContainerRequest))
}
return interceptor(ctx, in, info, handler)
}
var _ChaosDaemon_serviceDesc = grpc.ServiceDesc{
ServiceName: "chaosdaemon.ChaosDaemon",
HandlerType: (*ChaosDaemonServer)(nil),
Methods: []grpc.MethodDesc{
{
MethodName: "SetNetem",
Handler: _ChaosDaemon_SetNetem_Handler,
},
{
MethodName: "DeleteNetem",
Handler: _ChaosDaemon_DeleteNetem_Handler,
},
{
MethodName: "FlushIpSet",
Handler: _ChaosDaemon_FlushIpSet_Handler,
},
{
MethodName: "FlushIptables",
Handler: _ChaosDaemon_FlushIptables_Handler,
},
{
MethodName: "SetTimeOffset",
Handler: _ChaosDaemon_SetTimeOffset_Handler,
},
{
MethodName: "RecoverTimeOffset",
Handler: _ChaosDaemon_RecoverTimeOffset_Handler,
},
{
MethodName: "ContainerKill",
Handler: _ChaosDaemon_ContainerKill_Handler,
},
{
MethodName: "ContainerGetPid",
Handler: _ChaosDaemon_ContainerGetPid_Handler,
},
},
Streams: []grpc.StreamDesc{},
Metadata: "chaosdaemon.proto",
}
| 35.221495 | 174 | 0.713615 |
420b111c8af47343eab05b19b20823d89547a2b4 | 1,399 | swift | Swift | twitter_alamofire_demo/ProfileViewController.swift | tuotuoZ/simple_twitter | c3a2194ed3478219ad60f899a3007b13f83915ac | [
"Apache-2.0"
] | null | null | null | twitter_alamofire_demo/ProfileViewController.swift | tuotuoZ/simple_twitter | c3a2194ed3478219ad60f899a3007b13f83915ac | [
"Apache-2.0"
] | 1 | 2018-10-25T10:21:08.000Z | 2018-11-13T09:43:52.000Z | twitter_alamofire_demo/ProfileViewController.swift | tuotuoZ/simple_twitter | c3a2194ed3478219ad60f899a3007b13f83915ac | [
"Apache-2.0"
] | null | null | null | //
// ProfileViewController.swift
// twitter_alamofire_demo
//
// Created by Tony Zhang on 11/13/18.
// Copyright © 2018 Charles Hieger. All rights reserved.
//
import UIKit
class ProfileViewController: UIViewController {
@IBOutlet weak var profileImage: UIImageView!
@IBOutlet weak var fullName: UILabel!
@IBOutlet weak var userName: UILabel!
@IBOutlet weak var following: UILabel!
@IBOutlet weak var followers: UILabel!
@IBOutlet weak var tweets: UILabel!
override func viewDidLoad() {
super.viewDidLoad()
fullName.text = User.current?.name
userName.text = User.current?.screenName
let followingCount = User.current?.friends_count as! Int
following.text = String(followingCount)
let followerCount = User.current?.followers_count as! Int
followers.text = String(followerCount)
profileImage.af_setImage(withURL: (User.current?.profilepic)!)
// Do any additional setup after loading the view.
}
/*
// MARK: - Navigation
// In a storyboard-based application, you will often want to do a little preparation before navigation
override func prepare(for segue: UIStoryboardSegue, sender: Any?) {
// Get the new view controller using segue.destination.
// Pass the selected object to the new view controller.
}
*/
}
| 27.98 | 106 | 0.673338 |
8c01e71b4471f503877c14ab1307dee4a5436a71 | 134 | cs | C# | src/Fibon.Messages/Events/IEvent.cs | yavuzmurat/Fibon | 4cdf1e6ed22285048ae880e8838707983a9cd72d | [
"MIT"
] | 16 | 2017-06-26T16:51:49.000Z | 2020-06-09T18:54:36.000Z | src/Fibon.Messages/Events/IEvent.cs | yavuzmurat/Fibon | 4cdf1e6ed22285048ae880e8838707983a9cd72d | [
"MIT"
] | null | null | null | src/Fibon.Messages/Events/IEvent.cs | yavuzmurat/Fibon | 4cdf1e6ed22285048ae880e8838707983a9cd72d | [
"MIT"
] | 26 | 2017-06-24T08:35:52.000Z | 2021-01-24T00:56:21.000Z | using System.Threading.Tasks;
namespace Fibon.Messages.Events
{
//Marker interface
public interface IEvent
{
}
}
| 13.4 | 31 | 0.664179 |
4d4964b793e73d56f6d3f8ca0b9545e2c5000901 | 165 | cs | C# | source/BaseCommand.cs | jmanuelcorral/RedisRemoteClient | 218aaddeff97c072daa282bc573dde6d7041584c | [
"MIT"
] | null | null | null | source/BaseCommand.cs | jmanuelcorral/RedisRemoteClient | 218aaddeff97c072daa282bc573dde6d7041584c | [
"MIT"
] | null | null | null | source/BaseCommand.cs | jmanuelcorral/RedisRemoteClient | 218aaddeff97c072daa282bc573dde6d7041584c | [
"MIT"
] | null | null | null | namespace LiteServer
{
public class BaseCommand
{
public string RemoteCommand { get; set; }
public string RemoteOutput { get; set; }
}
} | 20.625 | 49 | 0.618182 |
8348dcf75523a7212d2f000b872c4aa3b8c12951 | 409 | ts | TypeScript | grid-packages/ag-grid-vue3/lib/VueComponentFactory.d.ts | stevenhankin/ag-grid | 0c1f3688c38149d430224dd7702f491b186694b1 | [
"MIT"
] | 2 | 2021-12-11T02:20:11.000Z | 2021-12-11T02:23:53.000Z | grid-packages/ag-grid-vue3/lib/VueComponentFactory.d.ts | stevenhankin/ag-grid | 0c1f3688c38149d430224dd7702f491b186694b1 | [
"MIT"
] | null | null | null | grid-packages/ag-grid-vue3/lib/VueComponentFactory.d.ts | stevenhankin/ag-grid | 0c1f3688c38149d430224dd7702f491b186694b1 | [
"MIT"
] | null | null | null | import { AgGridVue } from './AgGridVue';
export declare class VueComponentFactory {
private static getComponentDefinition;
private static createComponentParams;
static createAndMountComponent(component: any, params: any, parent: AgGridVue): {
mountedComponent: import("vue").App<Element>;
componentInstance: any;
} | undefined;
private static searchForComponentInstance;
}
| 37.181818 | 85 | 0.738386 |
a320ce471bbe61eb116a4ba492c618de1602affc | 318 | java | Java | baremaps-stream/src/main/java/com/baremaps/stream/ConsumerUtils.java | shahzadbacha/baremaps | 79f8542828b95180c511d082ab2f94db45211bef | [
"Apache-2.0"
] | null | null | null | baremaps-stream/src/main/java/com/baremaps/stream/ConsumerUtils.java | shahzadbacha/baremaps | 79f8542828b95180c511d082ab2f94db45211bef | [
"Apache-2.0"
] | null | null | null | baremaps-stream/src/main/java/com/baremaps/stream/ConsumerUtils.java | shahzadbacha/baremaps | 79f8542828b95180c511d082ab2f94db45211bef | [
"Apache-2.0"
] | null | null | null | package com.baremaps.stream;
import java.util.function.Consumer;
import java.util.function.Function;
public class ConsumerUtils {
private ConsumerUtils() {
}
public static <T> Function<T, T> consumeThenReturn(Consumer<T> consumer) {
return t -> {
consumer.accept(t);
return t;
};
}
}
| 15.9 | 76 | 0.672956 |
b47c01f32a111218e62ea0375550f3355938a530 | 1,133 | dart | Dart | lib/pages/product/ProductManager.dart | ea2305/Grocery-list | 952d8d30e0fc3aa791a13d247b0d9a167908d5a9 | [
"MIT"
] | null | null | null | lib/pages/product/ProductManager.dart | ea2305/Grocery-list | 952d8d30e0fc3aa791a13d247b0d9a167908d5a9 | [
"MIT"
] | null | null | null | lib/pages/product/ProductManager.dart | ea2305/Grocery-list | 952d8d30e0fc3aa791a13d247b0d9a167908d5a9 | [
"MIT"
] | null | null | null | import 'package:flutter/material.dart';
// Components - Widget
import 'package:product_list/components/ProductPreview.dart';
class ProductManager extends StatefulWidget {
@override
State<StatefulWidget> createState() {
return _ProductManager();
}
}
class _ProductManager extends State {
// Text content
List<String> products = ['Shampoo', 'Soap', 'Oranges'];
@override
Widget build(BuildContext context) {
return Scaffold(
// Title aplication
appBar: AppBar(
title: Text('Shop List'),
),
// Scaffold content app
body: ProductPreview(products),
// Float bottom
bottomNavigationBar: BottomAppBar(
child: Container(
height: 50.0,
),
),
floatingActionButton: FloatingActionButton(
// Add more products
onPressed: () => {
setState(() => {products.add('New element in list')})
},
tooltip: 'Increment Counter',
child: Icon(Icons.add),
),
floatingActionButtonLocation: FloatingActionButtonLocation.endFloat);
}
}
| 26.348837 | 77 | 0.606355 |
b0e16130d9096e5db8578a68e90406cbba2777c3 | 9,485 | py | Python | tests/integration/test_integration.py | windies21/loopchain | 6e96c8a7e006747af04187155678f2fae59e1389 | [
"Apache-2.0"
] | 105 | 2018-04-03T05:29:08.000Z | 2022-01-28T17:33:20.000Z | testcase/integration/test_integration.py | laurenceyoon/loopchain | e87032779be4715c135c2c91d2757d9c63bf4e31 | [
"Apache-2.0"
] | 135 | 2018-09-04T07:11:02.000Z | 2021-12-15T06:25:47.000Z | testcase/integration/test_integration.py | laurenceyoon/loopchain | e87032779be4715c135c2c91d2757d9c63bf4e31 | [
"Apache-2.0"
] | 46 | 2018-05-07T09:12:07.000Z | 2022-02-23T09:58:37.000Z | import random
import time
import pytest
from iconsdk.builder.transaction_builder import MessageTransactionBuilder
from iconsdk.icon_service import IconService
from iconsdk.providers.http_provider import HTTPProvider
from iconsdk.signed_transaction import SignedTransaction
from iconsdk.wallet.wallet import KeyWallet
from loopchain import conf
from loopchain import utils
from loopchain.blockchain.blocks import Block, BlockSerializer
from loopchain.blockchain.transactions import TransactionVerifier
from loopchain.blockchain.transactions import TransactionVersioner
from loopchain.blockchain.types import VarBytes
from . import conftest
from .conftest import Loopchain
# Global variables
peer_conf_path_list = [] # Peer config file path list. Needed to query peers' information.
genesis_data: dict = {} # Genesis tx content. Compared with tx in genesis block.
@pytest.fixture(scope="class", autouse=True)
def loopchain_proc(xprocess, request, generate_peer_conf_path_list_extended):
"""Set up loopchain launcher for integration test"""
# Define test environment
global peer_conf_path_list
global genesis_data
proc_info_list = [] # Loopchain process info. Needed to tear down processes.
peer_type = request.config.getoption("--peer-type")
peer_count = int(request.config.getoption("--peer-count"))
channel_count = int(request.config.getoption("--channel-count"))
channel_list = [f"channel_{i}" for i in range(channel_count)]
print(f"\n*--- Test env:\n Peer Type: {peer_type}, Peer Count: {peer_count}, Channel Count: {channel_count}")
Loopchain.pattern = fr"BroadcastScheduler process\(channel_{channel_count - 1}\) start"
Loopchain.end_line = 80 * peer_count * channel_count
# Generate configure files. Run only one time at the beginning of the test.
print("*--- Generate peer configure path list...")
peer_conf_path_list, channel_manage_data_path = \
generate_peer_conf_path_list_extended(peer_count=peer_count, channel_list=channel_list)
print("> peer_conf_path: ", peer_conf_path_list)
print("> channel_manage_data_path: ", channel_manage_data_path)
genesis_data = conftest.get_genesis_data(conf_path_list=peer_conf_path_list)
# Run Each peer
for peer_order in range(peer_count):
peer_conf_path = peer_conf_path_list[peer_order]
Loopchain.args = ["loop", peer_type, "-d", "-o", peer_conf_path]
proc_name = f"peer{peer_order}"
print(f"==========PEER_{peer_order} READY TO START ==========")
xprocess.ensure(proc_name, Loopchain)
# Store process information for terminate processes at the end of the test
proc_info = xprocess.getinfo(proc_name)
proc_info_list.append(proc_info)
print(f"==========ALL GREEN ==========")
time.sleep(0.5 * peer_count * channel_count)
yield
# Executed here after this fixture's scope ends.
for proc_info in proc_info_list:
proc_info.terminate()
time.sleep(3) # For additional tests, wait for a moment to cool down.
class TestLoopchain:
sent_tx_data = {} # Sent tx data. Needed to be compared whether it equals with the queried one.
tx_hash_by_channel = {} # Tx hashes. It collects return values of 'send_transaction'.
@pytest.mark.parametrize("port, channel_name", conftest.port_channel_list)
def test_health_check_before_test(self, port, channel_name):
"""Health check before test starts
**Assertion Tests**:
- Compare values of `accounts`, `message` and `nid` between queried genesis tx and origin data
"""
global genesis_data
expected_data = genesis_data["transaction_data"]
url = utils.normalize_request_url(str(port), conf.ApiVersion.v3, channel_name)
print("Req url: ", url)
icon_service = IconService(HTTPProvider(url))
genesis_block: dict = icon_service.get_block(0)
# TODO: dummy data to deserialize block. Fix in iconsdk
genesis_block["commit_state"] = None
genesis_block["confirmed_transaction_list"][0]["nid"] = "0x3"
tx_versioner = TransactionVersioner()
block_serializer = BlockSerializer.new("0.1a", TransactionVersioner())
genesis_block: Block = block_serializer.deserialize(block_dumped=genesis_block)
genesis_tx = list(genesis_block.body.transactions.values())[0]
print("genesis_tx: ", genesis_tx)
tv = TransactionVerifier.new("genesis", genesis_tx.type(), tx_versioner)
tv.verify(genesis_tx)
assert expected_data["accounts"] == genesis_tx.raw_data["accounts"]
assert expected_data["message"] == genesis_tx.raw_data["message"]
assert expected_data["nid"] == genesis_tx.raw_data["nid"]
@pytest.mark.parametrize("port, channel_name", conftest.port_channel_list)
def test_get_lastest_block_has_no_error(self, port, channel_name):
"""Test that getLastBlock API has no issue"""
url = utils.normalize_request_url(str(port), conf.ApiVersion.v3, channel_name)
icon_service = IconService(HTTPProvider(url))
block = icon_service.get_block("latest")
print("REQ url: ", url)
print("RES block: ", block)
assert "error" not in block
def test_send_tx_message(self, request):
"""Test for 'send_transaction'
.. note::
Test steps:
1. Get peer info from first peer
2. Extract key and password and make wallet
3. Build message transaction and sign it
4. Send Tx to first channel.
5. Await consensus time(currently 0.5 * <<Number of peers>> 'sec')
6. Repeat from '3'
.. warnings:: Interval await time is essential, due to consensus completion.
**Assertion Test**:
- Check that return value of send_transaction has valid tx hash format.
"""
global peer_conf_path_list
channel_count = int(request.config.getoption("--channel-count"))
from_peer = conftest.get_peer_info(conf_path_list=peer_conf_path_list, order=0)
key_path = from_peer["PRIVATE_PATH"]
key_pass = from_peer["PRIVATE_PASSWORD"]
wallet = KeyWallet.load(key_path, key_pass)
for channel_order in range(channel_count):
# Create message
byte_msg = f"test_msg on {random.randint(0, 44444)}".encode("utf-8")
msg = VarBytes(byte_msg).hex_0x()
# Address
from_to_address = wallet.get_address()
# Store tx data to compare with queried one later.
channel_name = f"channel_{channel_order}"
TestLoopchain.sent_tx_data[channel_name] = {
"from": from_to_address,
"to": from_to_address,
"msg": msg
}
# Build transaction and sign it with wallet
transaction_data = {
"from": from_to_address,
"to": from_to_address,
"step_limit": 100000000,
"nid": 3,
"nonce": 100,
"data": msg,
}
transaction = MessageTransactionBuilder().from_dict(transaction_data).build()
signed_transaction = SignedTransaction(transaction, wallet)
# Send tx
url = utils.normalize_request_url("9000", conf.ApiVersion.v3, channel_name)
print("Req url: ", url)
icon_service = IconService(HTTPProvider(url))
tx_hash = icon_service.send_transaction(signed_transaction)
print("Tx hash: ", tx_hash)
assert tx_hash.startswith("0x")
TestLoopchain.tx_hash_by_channel[channel_name] = tx_hash
await_sec = 0.5 * len(peer_conf_path_list)
print(f"Await consensus...({await_sec})")
time.sleep(await_sec)
print("ALL TXs by channel: ", TestLoopchain.tx_hash_by_channel)
final_await_sec = 1 * channel_count
print(f"Await consensus final...({final_await_sec})")
time.sleep(final_await_sec)
@pytest.mark.parametrize("port, channel_name", conftest.port_channel_list)
def test_sent_tx_is_synced(self, port, channel_name):
"""Following test of 'test_send_tx_message'
Check that send_transaction is successfully completed.
**Test steps**:
1. Get tx_hash from previous test
2. Query tx_hash to first channel
3. Compare queried tx with original data
4. Repeat until the channel order reaches to the end
**Assertion Tests**:
Check Tx values below
1. From address
2. To address
3. Data (message)
"""
print("sent_tx_data: ", TestLoopchain.sent_tx_data)
url = utils.normalize_request_url(str(port), conf.ApiVersion.v3, channel_name)
print("Req url: ", url)
icon_service = IconService(HTTPProvider(url))
tx_hash = TestLoopchain.tx_hash_by_channel[channel_name]
print("Tx hash to be queried: ", tx_hash)
queried_tx = icon_service.get_transaction(tx_hash)
print("Tx result: ", queried_tx)
assert queried_tx["from"] == TestLoopchain.sent_tx_data[channel_name]["from"]
assert queried_tx["to"] == TestLoopchain.sent_tx_data[channel_name]["to"]
assert queried_tx["data"] == TestLoopchain.sent_tx_data[channel_name]["msg"]
time.sleep(0.5)
| 41.060606 | 113 | 0.66758 |
435fefc5879906d7c07439ce92634f1270bfc7b8 | 1,151 | tsx | TypeScript | frontend/src/patientApp/timeOfTest/TermsOfService.tsx | jeremyzitomer-usds/prime-simplereport | 8b8e70bb437ebdb3838c9f95bf0fe585ab8840d7 | [
"CC0-1.0"
] | null | null | null | frontend/src/patientApp/timeOfTest/TermsOfService.tsx | jeremyzitomer-usds/prime-simplereport | 8b8e70bb437ebdb3838c9f95bf0fe585ab8840d7 | [
"CC0-1.0"
] | null | null | null | frontend/src/patientApp/timeOfTest/TermsOfService.tsx | jeremyzitomer-usds/prime-simplereport | 8b8e70bb437ebdb3838c9f95bf0fe585ab8840d7 | [
"CC0-1.0"
] | null | null | null | import React, { useState } from "react";
import { Redirect, RouteComponentProps, withRouter } from "react-router";
import Button from "../../app/commonComponents/Button";
import ToS from "./ToS";
const TermsOfService: React.FunctionComponent<RouteComponentProps> = (
props
) => {
const [nextPage, setNextPage] = useState(false);
if (nextPage) {
console.info(props.location);
return (
<Redirect push to={`/birth-date-confirmation${props.location.search}`} />
);
}
return (
<main className="patient-app padding-bottom-4 bg-base-lightest">
<form className="grid-container maxw-tablet">
<h1 className="font-heading-lg margin-top-3 margin-bottom-2">
Terms of Service
</h1>
<div className="tos-content prime-formgroup usa-prose height-card-lg overflow-x-hidden font-body-3xs">
<ToS />
</div>
<Button
id="tos-consent-button"
label="I consent to the Terms of Service"
onClick={() => setNextPage(true)}
className="margin-top-3"
/>
</form>
</main>
);
};
export default withRouter(TermsOfService);
| 28.073171 | 110 | 0.629887 |
46545d32d3e5eb2397ca12163cba62779a02e011 | 663 | php | PHP | src/Interfaces/PathTranslator.php | mcn-fredw/php-xmi-tools | f8331ccb13e0e606b7db5880f521b1a0fb764c9b | [
"MIT"
] | null | null | null | src/Interfaces/PathTranslator.php | mcn-fredw/php-xmi-tools | f8331ccb13e0e606b7db5880f521b1a0fb764c9b | [
"MIT"
] | null | null | null | src/Interfaces/PathTranslator.php | mcn-fredw/php-xmi-tools | f8331ccb13e0e606b7db5880f521b1a0fb764c9b | [
"MIT"
] | 1 | 2020-12-06T10:35:04.000Z | 2020-12-06T10:35:04.000Z | <?php
namespace XMITools\Interfaces;
/**
* Interface PathTranslator
* Public API for translating module full name to file system path.
*/
interface PathTranslator
{
/**
* Creates directories for a file path.
* @param string Full file path.
* @return string Input path.
*/
public function createDirectories($path);
/**
* Translates module full name to file system path.
* @param string $name Module full name string.
* @return string File system path for name.
*/
public function pathForName($name);
/**
* Gets project path.
* @return string.
*/
public function projectPath();
}
| 22.1 | 67 | 0.644042 |
daa70029c9959e7f320d211b1326f4bbe557171c | 2,051 | php | PHP | resources/views/admin.blade.php | wisnukm41/laravel_uts | 823143e11b1ab11f644316e1dc86ca5b01ccee42 | [
"MIT"
] | null | null | null | resources/views/admin.blade.php | wisnukm41/laravel_uts | 823143e11b1ab11f644316e1dc86ca5b01ccee42 | [
"MIT"
] | 1 | 2021-02-02T18:29:00.000Z | 2021-02-02T18:29:00.000Z | resources/views/admin.blade.php | wisnukm41/laravel_uts | 823143e11b1ab11f644316e1dc86ca5b01ccee42 | [
"MIT"
] | null | null | null | @extends('admin_template')
@section('link')
<link rel="stylesheet" type="text/css" href="https://cdn.datatables.net/1.10.20/css/jquery.dataTables.css">
<script type="text/javascript" charset="utf8" src="https://cdn.datatables.net/1.10.20/js/jquery.dataTables.js"></script>
@endsection
@section('name','Dashboard')
@section('content')
@if (session('status'))
<div class="container">
<div class="green white-text" style="padding:3px">{{ session('status') }}</div>
</div>
@endif
<div class="row">
<div class="col s12">
<table id="table_id">
<thead>
<tr>
<td width="8%">No</td>
<td>Topic</td>
<td>Image</td>
<td width="30%">Description</td>
<td>Action</td>
</tr>
</thead>
<tbody>
@if (!empty($allNews))
@foreach ($allNews as $news)
<tr>
<td>{{++$i}}</td>
<td style="max-width:200px">{{ $news->topic }}</td>
<td><img style="height:100px; max-width:250px" src="{{ asset('assets/img/news').'/'.$news->image }}" ></td>
<td style="max-width:450px"><p style="font-size:1rem;word-wrap: break-word;"> {{ trunctString($news->description, 200) }}
</p></td>
<td>
<div class="action__buttons">
<a href="/admin/news/edit/{{$news->slug}}" class="waves-effect waves-light btn-small --edit"><i class="material-icons">create</i></a>
<a href="/admin/news/delete/{{$news->slug}}" class="waves-effect waves-light btn-small --delete"><i class="material-icons" onclick="return confirm('Are You Sure?')">delete</i></a>
</div>
</td>
</tr>
@endforeach
@endif
</tbody>
</table>
</div>
</div>
@endsection
@section('js')
<script>
$(document).ready( function () {
$('#table_id').DataTable();
} );
</script>
@endsection | 34.762712 | 201 | 0.50902 |
79e866b62329d5dfac3149fc39fe7dee656a9650 | 2,265 | php | PHP | resources/views/emails/feedback.blade.php | technoexponent02/angular1 | 711218057c802b5741ca84499e2ae20de1aa129b | [
"MIT"
] | null | null | null | resources/views/emails/feedback.blade.php | technoexponent02/angular1 | 711218057c802b5741ca84499e2ae20de1aa129b | [
"MIT"
] | null | null | null | resources/views/emails/feedback.blade.php | technoexponent02/angular1 | 711218057c802b5741ca84499e2ae20de1aa129b | [
"MIT"
] | null | null | null | <table style="width:600px; max-width:100%; margin:0 auto; font-family:Arial; margin:0 auto; font-size:16px; color:#222222; background-color:#f2f2f2;" cellpadding="12" cellspacing="0">
<tr>
<td style="text-align:center; vertical-align:top; padding:16px 16px 10px 16px; background-color:#505050;">
<img src="https://swolk.com/assets/img/logo_white.png" alt="" style="display:inline-block; width:148px; height:auto;"/>
</td>
</tr>
<tr>
<td style="text-align:left; font-size:16px; line-height:22px; vertical-align:top; padding:30px 16px 0px 16px;">
Hi <small><b>{{$email}}!</b></small>
</td>
</tr>
<tr>
<td style="text-align:center; font-size:20px; line-height:26px; vertical-align:top; padding:30px 16px 0px 16px;">
<b>Feedback from swolk user</b>
</td>
</tr>
<tr>
<td style="text-align:center; font-size:20px; line-height:26px; vertical-align:top; padding:30px 16px 0px 16px; color:#008275;">
Topic
</td>
</tr>
<tr>
<td style="text-align:left; font-size:13px; line-height:18px; vertical-align:top; color:#3e3e3e; padding:10px 16px 16px 16px;">
{{ $topic }}
</td>
</tr>
<tr>
<td style="text-align:center; font-size:20px; line-height:26px; vertical-align:top; padding:30px 16px 0px 16px; color:#008275;">
Message
</td>
</tr>
<tr>
<td style="text-align:left; font-size:13px; line-height:18px; vertical-align:top; color:#3e3e3e; padding:10px 16px 16px 16px;">
{{ $feedback_message }}
</td>
</tr>
<tr>
<td height="10px"></td>
</tr>
<tr>
<td style="text-align:left; font-size:13px; line-height:19px; vertical-align:top; color:#3e3e3e; padding:16px;">
From:<br/>
<b>
{{ $fullname . '@' . $username }})
</b>
</td>
</tr>
<tr>
<td style="text-align:center; font-size:11px; line-height:18px; vertical-align:top; padding-top:0; color:#848484; padding:16px; border-top:1px solid #ddd;">
Copyright © 2016 <strong style="color:#545454;">Swolk.</strong> All rights reserved.
</td>
</tr>
</table> | 42.735849 | 183 | 0.5766 |
81d330fabbda8b597c572173562ab8600c9b37f9 | 501 | php | PHP | application/controllers/Home.php | BrianAdamo/Reporteria_Medicos | c168e534d46fe1e78f41407660175201ee484ac2 | [
"MIT"
] | null | null | null | application/controllers/Home.php | BrianAdamo/Reporteria_Medicos | c168e534d46fe1e78f41407660175201ee484ac2 | [
"MIT"
] | null | null | null | application/controllers/Home.php | BrianAdamo/Reporteria_Medicos | c168e534d46fe1e78f41407660175201ee484ac2 | [
"MIT"
] | null | null | null | <?php
defined('BASEPATH') OR exit('No direct script access allowed');
class Home extends CI_Controller {
public function __construct()
{
parent::__construct();
}
public function index($id)
{
// $idEmpresa = $this->session->userdata('UsIdEmpresa');
$sucursal = $this->consultas_adm->consultaGral("proy_sucursal","SucIdEmpresa",$id,1);
$dataSidebar['sucursal']=$sucursal;
$dataSidebar['id']=$id;
$this->load->view('home',$dataSidebar);
}
}
?> | 20.04 | 93 | 0.630739 |
1f04398436aae44c8f2cbfb4f219b952a157ecc9 | 590 | cs | C# | demo/Demo.Library/Abstraction/IUserService.cs | zzq424/Monica | 2a71c0797c4e073d38c06f28f92a074e1537828c | [
"MIT"
] | 6 | 2019-10-08T03:26:49.000Z | 2020-01-07T17:39:27.000Z | demo/Demo.Library/Abstraction/IUserService.cs | zzq424/Monica | 2a71c0797c4e073d38c06f28f92a074e1537828c | [
"MIT"
] | 1 | 2021-09-09T12:41:37.000Z | 2021-09-09T12:41:37.000Z | demo/Demo.Library/Abstraction/IUserService.cs | zzq424/Monica | 2a71c0797c4e073d38c06f28f92a074e1537828c | [
"MIT"
] | 3 | 2019-10-08T04:51:42.000Z | 2019-10-15T08:58:52.000Z | using Demo.Library.Dto;
using Microsoft.Extensions.DependencyInjection;
using System;
using System.Collections.Generic;
using System.Linq;
using System.Text;
using System.Threading.Tasks;
namespace Demo.Library.Abstraction
{
[Injection(ServiceLifetime.Scoped, InjectionPolicy.Replace)]
public interface IUserService
{
/// <summary>
/// 获取用户基础信息
/// </summary>
/// <param name="appId"></param>
/// <param name="userId"></param>
/// <returns></returns>
Task<UserInfoDto> GetBasicUserAsync(int appId,int userId);
}
}
| 23.6 | 66 | 0.662712 |
0d30f51ad4c4c05f8089a1ff32c8a3700bbc0c08 | 1,861 | h | C | algorithm/Pods/RITLKit/RITLKit/View/Button/RITLItemButton.h | gs01md/algorithm | f63c1f9052ea6a2aafbd5ae7163473808bd8820c | [
"MIT"
] | 132 | 2016-09-16T06:50:26.000Z | 2021-01-29T09:21:40.000Z | algorithm/Pods/RITLKit/RITLKit/View/Button/RITLItemButton.h | gs01md/algorithm | f63c1f9052ea6a2aafbd5ae7163473808bd8820c | [
"MIT"
] | 14 | 2017-05-04T10:11:04.000Z | 2020-05-11T03:05:51.000Z | algorithm/Pods/RITLKit/RITLKit/View/Button/RITLItemButton.h | gs01md/algorithm | f63c1f9052ea6a2aafbd5ae7163473808bd8820c | [
"MIT"
] | 30 | 2016-08-19T05:53:46.000Z | 2020-10-21T08:24:18.000Z | //
// RITLTabBarItem.h
// XiaoNongDingClient
//
// Created by YueWen on 2017/5/4.
// Copyright © 2017年 ryden. All rights reserved.
//
#import <UIKit/UIKit.h>
NS_ASSUME_NONNULL_BEGIN
/// 自定义的RITLButtonItem
@interface RITLItemButton : UIControl
/// 文字标签
@property (nonatomic, strong) UILabel * titleLabel;
/// 文字标签上的图片
@property (nonatomic, strong) UIImageView * imageView;
/// titleLabel的内距，默认为(5,0,0,0)
@property (nonatomic, assign) UIEdgeInsets titleLabelEdgeInsets;
/// imageView的内距，默认为(0,0,0,0)
@property (nonatomic, assign) UIEdgeInsets imageViewEdgeInsets;
/// 是否自动调整imageView, 默认为true, 自动调整imageView为 宽:高 = 1:1
@property (nonatomic, assign, getter=isAutoAdjustImageView) BOOL autoAdjustImageView;
/// 保证图片的带下，默认为(23,23) //保证最小的
@property (nonatomic, assign)CGSize imageSize;
/// badge数量，默认为nil
@property (nonatomic, copy) NSString *badgeValue;
/// badge背景颜色，默认为(255,85,85)
@property (nonatomic, strong) UIColor *badgeBarTintColor;
/// badge文本颜色，默认为白色
@property (nonatomic, strong) UIColor *badgeTextColor;
/// badge文本的字体,默认为systemFontOfSize:10
@property (nonatomic, strong) UIFont *badgeTextFont;
/// badge文本大于99（99+）时的字体，默认为 badgeTextFont
@property (nonatomic, strong) UIFont *badgeMaxTextFont;
/// badge的大小范围，矩形，默认为(20,15)
@property (nonatomic, assign) CGSize badgeSize;
/// badge视图的偏移，默认为(2,0,0,2)
@property (nonatomic, assign) UIEdgeInsets badgeInset;
/*** image 属性 ***/
/// 正常状态下的image
@property (nonatomic, strong) UIImage * normalImage;
/// 正常状态下的image网络图的url
@property (nonatomic, copy) NSString * normalImageURL;
/// 选中状态下的image,默认normalImage
@property (nonatomic, strong) UIImage * selectedImage;
/// 选中状态下的image网络图url,默认normalImageURL
@property (nonatomic, copy) NSString * selectedImageURL;
/// 显示badge
- (void)showBadge;
/// 隐藏badge
- (void)hiddenBadge;
@end
//typedef RITLItemButton RITLTabBarItem;
NS_ASSUME_NONNULL_END
| 27.367647 | 85 | 0.756045 |
2cc90b7810bdaed73909a516e876826a4a64bb4c | 2,104 | cpp | C++ | uppdev/SvoValue/Checks.cpp | dreamsxin/ultimatepp | 41d295d999f9ff1339b34b43c99ce279b9b3991c | [
"BSD-2-Clause"
] | 2 | 2016-04-07T07:54:26.000Z | 2020-04-14T12:37:34.000Z | uppdev/SvoValue/Checks.cpp | dreamsxin/ultimatepp | 41d295d999f9ff1339b34b43c99ce279b9b3991c | [
"BSD-2-Clause"
] | null | null | null | uppdev/SvoValue/Checks.cpp | dreamsxin/ultimatepp | 41d295d999f9ff1339b34b43c99ce279b9b3991c | [
"BSD-2-Clause"
] | null | null | null | #include "SvoValue.h"
void DumpNumber(const Value& v)
{
RDUMP((int)v);
RDUMP((double)v);
RDUMP((int64)v);
RDUMP((bool)v);
}
int xx;
Value Opt0();
void Opt() {
Value v = Opt0();
xx = v;
}
void CheckString()
{
Value v = "ahoj";
for(int i = 0; i < 2; i++) {
String s = v;
RDUMP(s);
ASSERT(s == "ahoj");
WString ws = v;
RDUMP(ws);
ASSERT(ws == WString("ahoj"));
v = ws;
}
v = String("ahoj");
Value w = WString("ahoj");
ASSERT(v == w);
RDUMP(GetHashValue(v));
RDUMP(GetHashValue(w));
ASSERT(GetHashValue(v) == GetHashValue(w));
}
void CheckDateTime()
{
Time tm = GetSysTime();
Date dt = tm;
Value c;
Value v = tm;
RDUMP(v);
ASSERT(v == dt);
Date xx = v;
ASSERT(xx == dt);
c = v;
RDUMP(c);
ASSERT(c == dt);
Value cv = v;
RDUMP(cv);
ASSERT(cv == dt);
Value v2 = tm;
RDUMP(v2);
ASSERT(v2 == v);
c = v;
RDUMP(c);
ASSERT(c == dt);
ASSERT(c == tm);
v = dt;
v2 = ToTime(v);
ASSERT(v == v2);
ASSERT(GetHashValue(v) == GetHashValue(v2));
}
void CheckValueMap()
{
RLOG("------------------------------");
RLOG("CheckValueMap");
Value x = 123;
Value y = x;
ValueMap h;
h.Add("0", 123);
RDUMP(h["0"]);
h.Add("1", Date(2001, 12, 1));
h.Add("2", "test");
Value v = h;
ASSERT(v.GetCount() == 3);
RDUMP(v["0"]);
ASSERT(v["0"] == 123);
ASSERT(v["1"] == Date(2001, 12, 1));
ASSERT(v["2"] == "test");
ValueMap hh = v;
ASSERT(hh == h);
}
void OtherChecks()
{
Value c;
ASSERT(c.IsVoid());
RDUMP(c.IsVoid());
Value x = "Ahoj";
String xx = x;
RDUMP(xx);
ASSERT(xx == "Ahoj");
Value xw = WString("Ahoj");
RDUMP(xw);
RDUMP(xw == x);
Value xc = x;
RDUMP(xc);
c = xc;
RDUMP(c);
Value y = 123;
int yy = y;
RDUMP(yy);
Value xn = (int)Null;
RDUMP(IsNull(xn));
RDUMP(IsNull(yy));
Value yc = y;
RDUMP(y);
c = y;
RDUMP(c);
Value v2 = 123.0;
Value v3 = 123;
Value v4 = 125;
RDUMP(v2 == y);
RDUMP(v3 == y);
RDUMP(v4 == y);
RDUMP(v4 == v2);
Value uu = Uuid::Create();
RDUMP(uu);
Value uuc = uu;
RDUMP(uuc);
{
Color c = Blue;
Value v = c;
RDUMP(v);
Value v2 = v;
c = v2;
RDUMP(c);
}
}
| 13.662338 | 45 | 0.532795 |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.