conversation_id
int64 1
206k
| messages
list | help_channel
stringlengths 6
7
| __rowid__
stringlengths 32
32
|
|---|---|---|---|
199,965 |
[
{
"id": 1050959051355332600,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/09/2022 21:16:03",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050959660036923500,
"author_id": 584653026430681100,
"author_name": "basil",
"timestamp": "12/09/2022 21:18:28",
"content": "",
"attachments": [
{
"id": 1050959659948855300,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1050959659948855307/image.png",
"fileName": "image.png",
"fileSizeBytes": 8475
}
],
"mentions": [],
"reference": null
},
{
"id": 1050959664231239700,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/09/2022 21:18:29",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1050959660036923500,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1050959958621032600,
"author_id": 584653026430681100,
"author_name": "basil",
"timestamp": "12/09/2022 21:19:40",
"content": "help",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050960158492213400,
"author_id": 706934233012371600,
"author_name": "Ansh_",
"timestamp": "12/09/2022 21:20:27",
"content": "Use a • b = |a||b| cos A^B",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050960301195018400,
"author_id": 584653026430681100,
"author_name": "basil",
"timestamp": "12/09/2022 21:21:01",
"content": "would b be just k",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050960312767090800,
"author_id": 584653026430681100,
"author_name": "basil",
"timestamp": "12/09/2022 21:21:04",
"content": "or zk",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050960661821276200,
"author_id": 584653026430681100,
"author_name": "basil",
"timestamp": "12/09/2022 21:22:27",
"content": "?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050960963479810200,
"author_id": 584653026430681100,
"author_name": "basil",
"timestamp": "12/09/2022 21:23:39",
"content": "im so confused",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050961864097534100,
"author_id": 521464336284254200,
"author_name": "Gamer Dio",
"timestamp": "12/09/2022 21:27:14",
"content": "b would be a vector on the z axis",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050961910457188400,
"author_id": 521464336284254200,
"author_name": "Gamer Dio",
"timestamp": "12/09/2022 21:27:25",
"content": "Presumably the positive z axis",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050962490554593300,
"author_id": 584653026430681100,
"author_name": "basil",
"timestamp": "12/09/2022 21:29:43",
"content": "ah ok",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050964065729654900,
"author_id": 584653026430681100,
"author_name": "basil",
"timestamp": "12/09/2022 21:35:59",
"content": "i still dk how to do it",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050964103096713200,
"author_id": 584653026430681100,
"author_name": "basil",
"timestamp": "12/09/2022 21:36:08",
"content": "pain.",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050964209179041800,
"author_id": 706934233012371600,
"author_name": "Ansh_",
"timestamp": "12/09/2022 21:36:33",
"content": "a = i + zk\nb = z (cause you're given A^B = 150°)",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050964403517935600,
"author_id": 706934233012371600,
"author_name": "Ansh_",
"timestamp": "12/09/2022 21:37:19",
"content": "k = (i + zk) • (z) = √(k² + 1) cos 150°",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050964492818862100,
"author_id": 584653026430681100,
"author_name": "basil",
"timestamp": "12/09/2022 21:37:41",
"content": "hold on",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050964536628347000,
"author_id": 584653026430681100,
"author_name": "basil",
"timestamp": "12/09/2022 21:37:51",
"content": "can u explain why b = z pls",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050964562297487400,
"author_id": 706934233012371600,
"author_name": "Ansh_",
"timestamp": "12/09/2022 21:37:57",
"content": "because",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050964571793391600,
"author_id": 706934233012371600,
"author_name": "Ansh_",
"timestamp": "12/09/2022 21:37:59",
"content": "you",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050964575408894100,
"author_id": 706934233012371600,
"author_name": "Ansh_",
"timestamp": "12/09/2022 21:38:00",
"content": "are",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050964617884606500,
"author_id": 706934233012371600,
"author_name": "Ansh_",
"timestamp": "12/09/2022 21:38:10",
"content": "given the angle between (i + zk) and z",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050964673249423400,
"author_id": 706934233012371600,
"author_name": "Ansh_",
"timestamp": "12/09/2022 21:38:24",
"content": "and for cos A^B, you're required",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050964707831451800,
"author_id": 706934233012371600,
"author_name": "Ansh_",
"timestamp": "12/09/2022 21:38:32",
"content": "to input the angle between the two vectors a, b",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050964797350494200,
"author_id": 706934233012371600,
"author_name": "Ansh_",
"timestamp": "12/09/2022 21:38:53",
"content": "and from the whole question, there's only one angle that's entirely known",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050964909090951300,
"author_id": 584653026430681100,
"author_name": "basil",
"timestamp": "12/09/2022 21:39:20",
"content": "hm",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050965095288688600,
"author_id": 817687489992458200,
"author_name": "T Sathiya Moorthy",
"timestamp": "12/09/2022 21:40:04",
"content": "Can you help me, I am first year Bsc Mathematics student. On 22 there is exhibition in our college, can anybody suggest a working model in mathematics which can be showed as exhibit",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050968474308055200,
"author_id": 521464336284254200,
"author_name": "Gamer Dio",
"timestamp": "12/09/2022 21:53:30",
"content": "#❓how-to-get-help",
"attachments": [],
"mentions": [
{
"id": 817687489992458200,
"name": "T Sathiya Moorthy",
"discriminator": "1506",
"nickname": "T Sathiya Moorthy",
"isBot": false
}
],
"reference": null
},
{
"id": 1050969733786251300,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/09/2022 21:58:30",
"content": "@basil Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 584653026430681100,
"name": "basil",
"discriminator": "7088",
"nickname": "basil",
"isBot": false
}
],
"reference": null
},
{
"id": 1050973510480171100,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/09/2022 22:13:31",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
718ff70b922a442b9c7bae2fa48e90f6
|
199,966 |
[
{
"id": 1034373189536579600,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "10/25/2022 03:49:46",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034378669164073000,
"author_id": 596641160701804500,
"author_name": "horizon 2.0",
"timestamp": "10/25/2022 04:11:32",
"content": "Can someone explain if 1 is true or false? I think it's true but my friend says the opposite",
"attachments": [
{
"id": 1034378668891451500,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1034378668891451482/IMG-20221025-WA0004.jpg",
"fileName": "IMG-20221025-WA0004.jpg",
"fileSizeBytes": 1058835
}
],
"mentions": [],
"reference": null
},
{
"id": 1034378671059898500,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "10/25/2022 04:11:33",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1034378669164073000,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1034379017891086300,
"author_id": 607479321350635500,
"author_name": "Pure",
"timestamp": "10/25/2022 04:12:55",
"content": "A set {1,2} is not an element of {1,2,{3}} but 1 and 2 are",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034379096047767600,
"author_id": 607479321350635500,
"author_name": "Pure",
"timestamp": "10/25/2022 04:13:14",
"content": "If you had instead {{1,2},{3}} then it would be true",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034379684772851800,
"author_id": 596641160701804500,
"author_name": "horizon 2.0",
"timestamp": "10/25/2022 04:15:34",
"content": "I see so this sign is only to take as is, only if I see exactly the same thing",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034379781694832600,
"author_id": 607479321350635500,
"author_name": "Pure",
"timestamp": "10/25/2022 04:15:57",
"content": "Yes that’s what it means to be an element of a set.",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034379808328659000,
"author_id": 596641160701804500,
"author_name": "horizon 2.0",
"timestamp": "10/25/2022 04:16:04",
"content": "Do I need to close it or something or just leave?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034379839534280700,
"author_id": 607479321350635500,
"author_name": "Pure",
"timestamp": "10/25/2022 04:16:11",
"content": "I can close it for you",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034379845838323700,
"author_id": 607479321350635500,
"author_name": "Pure",
"timestamp": "10/25/2022 04:16:13",
"content": ".close",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034379848732393600,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "10/25/2022 04:16:13",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
2f6644da98e14c5bb654d288a2129c04
|
199,967 |
[
{
"id": 1050982310771695700,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/09/2022 22:48:29",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050982893649928200,
"author_id": 517978685693755400,
"author_name": "ED",
"timestamp": "12/09/2022 22:50:48",
"content": "",
"attachments": [
{
"id": 1050982893289230300,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1050982893289230396/mi7P8BixNQlHHOY8AAAAASUVORK5CYII.png",
"fileName": "mi7P8BixNQlHHOY8AAAAASUVORK5CYII.png",
"fileSizeBytes": 3430
}
],
"mentions": [],
"reference": null
},
{
"id": 1050982896044875800,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/09/2022 22:50:48",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1050982893649928200,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1050982910678798300,
"author_id": 517978685693755400,
"author_name": "ED",
"timestamp": "12/09/2022 22:50:52",
"content": "did they divide each side by 20",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050983015951646700,
"author_id": 1050395209776775300,
"author_name": "eddi117",
"timestamp": "12/09/2022 22:51:17",
"content": "Idk how I end up here lol",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050983060818100200,
"author_id": 517978685693755400,
"author_name": "ED",
"timestamp": "12/09/2022 22:51:28",
"content": "?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050983128010862600,
"author_id": 1050395209776775300,
"author_name": "eddi117",
"timestamp": "12/09/2022 22:51:44",
"content": "I’m new to discord and im lost lol",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050983158721556600,
"author_id": 517978685693755400,
"author_name": "ED",
"timestamp": "12/09/2022 22:51:51",
"content": "what do u want to do",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050983222391083000,
"author_id": 517978685693755400,
"author_name": "ED",
"timestamp": "12/09/2022 22:52:06",
"content": "on discord",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050983377425158300,
"author_id": 1050395209776775300,
"author_name": "eddi117",
"timestamp": "12/09/2022 22:52:43",
"content": "Lim as x approche infinite of ((-1)^x)",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050983381304889300,
"author_id": 261933205387477000,
"author_name": "riemann",
"timestamp": "12/09/2022 22:52:44",
"content": "yes",
"attachments": [],
"mentions": [
{
"id": 517978685693755400,
"name": "ED",
"discriminator": "5710",
"nickname": "ED",
"isBot": false
}
],
"reference": null
},
{
"id": 1050983491921260500,
"author_id": 517978685693755400,
"author_name": "ED",
"timestamp": "12/09/2022 22:53:10",
"content": "",
"attachments": [
{
"id": 1050983491686371300,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1050983491686371338/p7cLLAH3qkAAAAASUVORK5CYII.png",
"fileName": "p7cLLAH3qkAAAAASUVORK5CYII.png",
"fileSizeBytes": 2844
}
],
"mentions": [
{
"id": 261933205387477000,
"name": "riemann",
"discriminator": "2529",
"nickname": "riemann",
"isBot": false
}
],
"reference": null
},
{
"id": 1050983501958234200,
"author_id": 517978685693755400,
"author_name": "ED",
"timestamp": "12/09/2022 22:53:13",
"content": "what they do here",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050983524934635500,
"author_id": 496104403984449540,
"author_name": "Ninja8flash",
"timestamp": "12/09/2022 22:53:18",
"content": "Eddi diff channel and also DNE",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050983621353275500,
"author_id": 496104403984449540,
"author_name": "Ninja8flash",
"timestamp": "12/09/2022 22:53:41",
"content": "They took e^ to each side",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050983716622696600,
"author_id": 496104403984449540,
"author_name": "Ninja8flash",
"timestamp": "12/09/2022 22:54:04",
"content": "e^ln(x)=x",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050983746502938600,
"author_id": 517978685693755400,
"author_name": "ED",
"timestamp": "12/09/2022 22:54:11",
"content": "okay so ln(x) and e^x cancel eachother out?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050983816732364800,
"author_id": 517978685693755400,
"author_name": "ED",
"timestamp": "12/09/2022 22:54:28",
"content": "like how sqrt root and power of 2 cancel out",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050983821551620200,
"author_id": 496104403984449540,
"author_name": "Ninja8flash",
"timestamp": "12/09/2022 22:54:29",
"content": "Yes",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050983843911446700,
"author_id": 517978685693755400,
"author_name": "ED",
"timestamp": "12/09/2022 22:54:34",
"content": "oh ok",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050984068017303700,
"author_id": 517978685693755400,
"author_name": "ED",
"timestamp": "12/09/2022 22:55:28",
"content": "thank you",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050984076628205700,
"author_id": 517978685693755400,
"author_name": "ED",
"timestamp": "12/09/2022 22:55:30",
"content": ".close",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050984079585185800,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/09/2022 22:55:30",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
e78a31de296d4d08aa89336b1ef892d4
|
199,968 |
[
{
"id": 1050984789890568300,
"author_id": 517978685693755400,
"author_name": "ED",
"timestamp": "12/09/2022 22:58:20",
"content": ".reopen",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050984794999230500,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/09/2022 22:58:21",
"content": "✅",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050984804377706500,
"author_id": 517978685693755400,
"author_name": "ED",
"timestamp": "12/09/2022 22:58:23",
"content": "",
"attachments": [
{
"id": 1050984804109258800,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1050984804109258812/wdi793duzwdQAAAABJRU5ErkJggg.png",
"fileName": "wdi793duzwdQAAAABJRU5ErkJggg.png",
"fileSizeBytes": 5486
}
],
"mentions": [
{
"id": 496104403984449540,
"name": "Ninja8flash",
"discriminator": "7670",
"nickname": "Ninja8flash",
"isBot": false
}
],
"reference": null
},
{
"id": 1050984812984410100,
"author_id": 517978685693755400,
"author_name": "ED",
"timestamp": "12/09/2022 22:58:25",
"content": "what they do here",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050984893225631700,
"author_id": 496104403984449540,
"author_name": "Ninja8flash",
"timestamp": "12/09/2022 22:58:44",
"content": "Just divided by 2",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050984915455459500,
"author_id": 517978685693755400,
"author_name": "ED",
"timestamp": "12/09/2022 22:58:50",
"content": "oh ok",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050984932954087600,
"author_id": 496104403984449540,
"author_name": "Ninja8flash",
"timestamp": "12/09/2022 22:58:54",
"content": "Lul",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050984941070057600,
"author_id": 517978685693755400,
"author_name": "ED",
"timestamp": "12/09/2022 22:58:56",
"content": "also means multiplying by 1/2",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050984951698440200,
"author_id": 517978685693755400,
"author_name": "ED",
"timestamp": "12/09/2022 22:58:58",
"content": "?>\\",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050984961282424800,
"author_id": 496104403984449540,
"author_name": "Ninja8flash",
"timestamp": "12/09/2022 22:59:01",
"content": "Yeah",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050984973882110000,
"author_id": 517978685693755400,
"author_name": "ED",
"timestamp": "12/09/2022 22:59:04",
"content": "ok thank u",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050984983973605400,
"author_id": 517978685693755400,
"author_name": "ED",
"timestamp": "12/09/2022 22:59:06",
"content": "very much",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050984993008123900,
"author_id": 517978685693755400,
"author_name": "ED",
"timestamp": "12/09/2022 22:59:08",
"content": ".close",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050984997479268400,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/09/2022 22:59:09",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
4c47629fd8d048d182de7424c4579792
|
199,969 |
[
{
"id": 1050987314471514200,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/09/2022 23:08:22",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050987946209189900,
"author_id": 927994559055679500,
"author_name": "monominal",
"timestamp": "12/09/2022 23:10:52",
"content": "i need help",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050987948541223000,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/09/2022 23:10:53",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1050987946209189900,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1050987982066307100,
"author_id": 927994559055679500,
"author_name": "monominal",
"timestamp": "12/09/2022 23:11:01",
"content": "",
"attachments": [
{
"id": 1050987981785272300,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1050987981785272340/Screen_Shot_2022-12-09_at_11.10.23_PM.png",
"fileName": "Screen_Shot_2022-12-09_at_11.10.23_PM.png",
"fileSizeBytes": 38711
}
],
"mentions": [],
"reference": null
},
{
"id": 1050988010247823400,
"author_id": 927994559055679500,
"author_name": "monominal",
"timestamp": "12/09/2022 23:11:08",
"content": "i need help only on the first piecewise",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050988025062101000,
"author_id": 927994559055679500,
"author_name": "monominal",
"timestamp": "12/09/2022 23:11:11",
"content": "so only",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050988132809572500,
"author_id": 927994559055679500,
"author_name": "monominal",
"timestamp": "12/09/2022 23:11:37",
"content": "\"x, if x < -3\n _",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050988355023818900,
"author_id": 307914411648090100,
"author_name": "Stephen",
"timestamp": "12/09/2022 23:12:30",
"content": "How would u graph f(x) = x",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050988508677935100,
"author_id": 927994559055679500,
"author_name": "monominal",
"timestamp": "12/09/2022 23:13:06",
"content": "uh",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050988537190826000,
"author_id": 927994559055679500,
"author_name": "monominal",
"timestamp": "12/09/2022 23:13:13",
"content": "im not sure",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050988544790908900,
"author_id": 927994559055679500,
"author_name": "monominal",
"timestamp": "12/09/2022 23:13:15",
"content": "like",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050988555016609900,
"author_id": 927994559055679500,
"author_name": "monominal",
"timestamp": "12/09/2022 23:13:17",
"content": "find the slope",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050988561194827800,
"author_id": 927994559055679500,
"author_name": "monominal",
"timestamp": "12/09/2022 23:13:19",
"content": "so",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050988565875658900,
"author_id": 307914411648090100,
"author_name": "Stephen",
"timestamp": "12/09/2022 23:13:20",
"content": "How about y = x",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050988568375459800,
"author_id": 927994559055679500,
"author_name": "monominal",
"timestamp": "12/09/2022 23:13:21",
"content": "1/1",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050988581205852200,
"author_id": 307914411648090100,
"author_name": "Stephen",
"timestamp": "12/09/2022 23:13:24",
"content": "Yes",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050988583282020400,
"author_id": 927994559055679500,
"author_name": "monominal",
"timestamp": "12/09/2022 23:13:24",
"content": "start on 0",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050988617557884900,
"author_id": 927994559055679500,
"author_name": "monominal",
"timestamp": "12/09/2022 23:13:32",
"content": "ok",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050988641222152300,
"author_id": 927994559055679500,
"author_name": "monominal",
"timestamp": "12/09/2022 23:13:38",
"content": "then",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050988664366305300,
"author_id": 927994559055679500,
"author_name": "monominal",
"timestamp": "12/09/2022 23:13:44",
"content": "i use a closed dot",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050988686394785800,
"author_id": 927994559055679500,
"author_name": "monominal",
"timestamp": "12/09/2022 23:13:49",
"content": "to then graph 3",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050988698742833300,
"author_id": 927994559055679500,
"author_name": "monominal",
"timestamp": "12/09/2022 23:13:52",
"content": "right??",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050988720674848800,
"author_id": 425571598393671700,
"author_name": "that_one_nerd",
"timestamp": "12/09/2022 23:13:57",
"content": "-3",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050988754376081400,
"author_id": 425571598393671700,
"author_name": "that_one_nerd",
"timestamp": "12/09/2022 23:14:05",
"content": "and below/to the left",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050988814757277700,
"author_id": 927994559055679500,
"author_name": "monominal",
"timestamp": "12/09/2022 23:14:19",
"content": "yea",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050988833010892800,
"author_id": 927994559055679500,
"author_name": "monominal",
"timestamp": "12/09/2022 23:14:24",
"content": "right -3 i meant",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050988917421244400,
"author_id": 927994559055679500,
"author_name": "monominal",
"timestamp": "12/09/2022 23:14:44",
"content": "wait how does that work",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050989002699837400,
"author_id": 927994559055679500,
"author_name": "monominal",
"timestamp": "12/09/2022 23:15:04",
"content": "because it is in the positive direction",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050989064083493000,
"author_id": 927994559055679500,
"author_name": "monominal",
"timestamp": "12/09/2022 23:15:19",
"content": "but the symbol is pointing to the right",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050989135428595700,
"author_id": 927994559055679500,
"author_name": "monominal",
"timestamp": "12/09/2022 23:15:36",
"content": "and i already have the line there",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050989634768875500,
"author_id": 927994559055679500,
"author_name": "monominal",
"timestamp": "12/09/2022 23:17:35",
"content": "?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050990611244789800,
"author_id": 927994559055679500,
"author_name": "monominal",
"timestamp": "12/09/2022 23:21:28",
"content": "@Helpers",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050991002019713000,
"author_id": 927994559055679500,
"author_name": "monominal",
"timestamp": "12/09/2022 23:23:01",
"content": "",
"attachments": [
{
"id": 1050991001658986500,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1050991001658986526/Screen_Shot_2022-12-09_at_11.10.23_PM.png",
"fileName": "Screen_Shot_2022-12-09_at_11.10.23_PM.png",
"fileSizeBytes": 38711
}
],
"mentions": [],
"reference": null
},
{
"id": 1050992601395900500,
"author_id": 374795910032523260,
"author_name": "SWR",
"timestamp": "12/09/2022 23:29:22",
"content": "What do you mean by this?",
"attachments": [],
"mentions": [
{
"id": 927994559055679500,
"name": "monominal",
"discriminator": "6219",
"nickname": "monominal",
"isBot": false
}
],
"reference": null
},
{
"id": 1050993487891406800,
"author_id": 927994559055679500,
"author_name": "monominal",
"timestamp": "12/09/2022 23:32:54",
"content": "ok",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050993493117505500,
"author_id": 927994559055679500,
"author_name": "monominal",
"timestamp": "12/09/2022 23:32:55",
"content": "so",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050993499270553600,
"author_id": 927994559055679500,
"author_name": "monominal",
"timestamp": "12/09/2022 23:32:56",
"content": "x",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050993558087286800,
"author_id": 927994559055679500,
"author_name": "monominal",
"timestamp": "12/09/2022 23:33:10",
"content": "is x < witht he underline -3",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050993592124063900,
"author_id": 927994559055679500,
"author_name": "monominal",
"timestamp": "12/09/2022 23:33:18",
"content": "i found the slope for each",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050993645278470100,
"author_id": 927994559055679500,
"author_name": "monominal",
"timestamp": "12/09/2022 23:33:31",
"content": "so",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050993652786266100,
"author_id": 927994559055679500,
"author_name": "monominal",
"timestamp": "12/09/2022 23:33:33",
"content": "1, 1",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050993662059872300,
"author_id": 927994559055679500,
"author_name": "monominal",
"timestamp": "12/09/2022 23:33:35",
"content": "2, 2",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050993668628172900,
"author_id": 927994559055679500,
"author_name": "monominal",
"timestamp": "12/09/2022 23:33:37",
"content": "3, 3",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050993686349099000,
"author_id": 927994559055679500,
"author_name": "monominal",
"timestamp": "12/09/2022 23:33:41",
"content": "4, 4",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050993695744336000,
"author_id": 927994559055679500,
"author_name": "monominal",
"timestamp": "12/09/2022 23:33:43",
"content": "all the same thing",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050993758495322200,
"author_id": 927994559055679500,
"author_name": "monominal",
"timestamp": "12/09/2022 23:33:58",
"content": "but how do i follow the other expression",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050994205465509900,
"author_id": 374795910032523260,
"author_name": "SWR",
"timestamp": "12/09/2022 23:35:45",
"content": "okay but what about working backwards?\n-1, -1\n-2, -2\netc.",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050995200505425900,
"author_id": 927994559055679500,
"author_name": "monominal",
"timestamp": "12/09/2022 23:39:42",
"content": "ohhh",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050995208755630200,
"author_id": 927994559055679500,
"author_name": "monominal",
"timestamp": "12/09/2022 23:39:44",
"content": "but then",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050995256000249900,
"author_id": 927994559055679500,
"author_name": "monominal",
"timestamp": "12/09/2022 23:39:55",
"content": "it interferes witht he other line that i had",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050995315802640400,
"author_id": 374795910032523260,
"author_name": "SWR",
"timestamp": "12/09/2022 23:40:09",
"content": "Yeah but keep going",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050995345607381000,
"author_id": 374795910032523260,
"author_name": "SWR",
"timestamp": "12/09/2022 23:40:16",
"content": "You start at -3 and keep going backwards",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050995407334936600,
"author_id": 374795910032523260,
"author_name": "SWR",
"timestamp": "12/09/2022 23:40:31",
"content": "That's what if x <= -3 is saying.",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050995459403022300,
"author_id": 927994559055679500,
"author_name": "monominal",
"timestamp": "12/09/2022 23:40:44",
"content": "oh ok i got it",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050995475039404200,
"author_id": 374795910032523260,
"author_name": "SWR",
"timestamp": "12/09/2022 23:40:47",
"content": "The graph will look like y=x start at x=-3 and going backwards",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050995530840408000,
"author_id": 927994559055679500,
"author_name": "monominal",
"timestamp": "12/09/2022 23:41:01",
"content": "becuase it skipped the -2, -2",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050995678962257900,
"author_id": 927994559055679500,
"author_name": "monominal",
"timestamp": "12/09/2022 23:41:36",
"content": "would this be correct",
"attachments": [
{
"id": 1050995678840631300,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1050995678840631327/Screen_Shot_2022-12-09_at_11.41.13_PM.png",
"fileName": "Screen_Shot_2022-12-09_at_11.41.13_PM.png",
"fileSizeBytes": 47156
}
],
"mentions": [],
"reference": null
},
{
"id": 1050995895652585500,
"author_id": 374795910032523260,
"author_name": "SWR",
"timestamp": "12/09/2022 23:42:28",
"content": "*chef's kiss*",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050995963659038700,
"author_id": 927994559055679500,
"author_name": "monominal",
"timestamp": "12/09/2022 23:42:44",
"content": "thxs",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050995979769368700,
"author_id": 927994559055679500,
"author_name": "monominal",
"timestamp": "12/09/2022 23:42:48",
"content": "u helped a lot",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050995993971273700,
"author_id": 927994559055679500,
"author_name": "monominal",
"timestamp": "12/09/2022 23:42:51",
"content": "i apreciate it",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050996034014298100,
"author_id": 927994559055679500,
"author_name": "monominal",
"timestamp": "12/09/2022 23:43:01",
"content": "i been stuck on these questions since like 2 days ago",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050996040268001300,
"author_id": 927994559055679500,
"author_name": "monominal",
"timestamp": "12/09/2022 23:43:02",
"content": "thxs",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050996048530788500,
"author_id": 927994559055679500,
"author_name": "monominal",
"timestamp": "12/09/2022 23:43:04",
"content": ".close",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050996051257081900,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/09/2022 23:43:05",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
21a55dea6f6a489a847204c6d07a8aa3
|
199,970 |
[
{
"id": 1050996136271417300,
"author_id": 374795910032523260,
"author_name": "SWR",
"timestamp": "12/09/2022 23:43:25",
"content": "happy to help",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1050996145754742800,
"author_id": 374795910032523260,
"author_name": "SWR",
"timestamp": "12/09/2022 23:43:27",
"content": "good luck to ya",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051007097103450100,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 00:26:58",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051007279337578500,
"author_id": 972243220065046500,
"author_name": "motivee",
"timestamp": "12/10/2022 00:27:42",
"content": "intro stats hypothesis testing just trying to figure out which test im supposed to use on my ti84, not trying to do hand calculations or anything...",
"attachments": [
{
"id": 1051007279039774700,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051007279039774760/image.png",
"fileName": "image.png",
"fileSizeBytes": 36515
}
],
"mentions": [],
"reference": null
},
{
"id": 1051007281816412200,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 00:27:42",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051007279337578500,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051007533919252600,
"author_id": 972243220065046500,
"author_name": "motivee",
"timestamp": "12/10/2022 00:28:42",
"content": "cant figure out what test im supposed to use. tried 2 sample t test but uhhh... yeah x.x",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051011309761732600,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 00:43:43",
"content": "@motivee Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 972243220065046500,
"name": "motivee",
"discriminator": "1491",
"nickname": "motivee",
"isBot": false
}
],
"reference": null
},
{
"id": 1051015063512809500,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 00:58:38",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
37cd38e6cf4b4266905b45ba12f79f29
|
199,971 |
[
{
"id": 1051017909624913900,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 01:09:56",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051018151602688000,
"author_id": 633048785131667500,
"author_name": "GhostGib",
"timestamp": "12/10/2022 01:10:54",
"content": "",
"attachments": [
{
"id": 1051018151355220000,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051018151355220028/image.png",
"fileName": "image.png",
"fileSizeBytes": 26995
}
],
"mentions": [],
"reference": null
},
{
"id": 1051018153586597900,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 01:10:54",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051018151602688000,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051018468381687900,
"author_id": 254377887522750460,
"author_name": "poppylikecats",
"timestamp": "12/10/2022 01:12:09",
"content": "what have you tried so far",
"attachments": [],
"mentions": [
{
"id": 633048785131667500,
"name": "GhostGib",
"discriminator": "6563",
"nickname": "GhostGib",
"isBot": false
}
],
"reference": null
},
{
"id": 1051018662632505300,
"author_id": 633048785131667500,
"author_name": "GhostGib",
"timestamp": "12/10/2022 01:12:56",
"content": "I have tried the system of elimination so far",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051018805494681600,
"author_id": 261933205387477000,
"author_name": "riemann",
"timestamp": "12/10/2022 01:13:30",
"content": "Do you know what consistent means",
"attachments": [],
"mentions": [
{
"id": 633048785131667500,
"name": "GhostGib",
"discriminator": "6563",
"nickname": "GhostGib",
"isBot": false
}
],
"reference": null
},
{
"id": 1051019359725834200,
"author_id": 633048785131667500,
"author_name": "GhostGib",
"timestamp": "12/10/2022 01:15:42",
"content": "a system of linear equations with at least one set of values satisfying all equations?",
"attachments": [],
"mentions": [
{
"id": 261933205387477000,
"name": "riemann",
"discriminator": "2529",
"nickname": "riemann",
"isBot": false
}
],
"reference": null
},
{
"id": 1051019700550779000,
"author_id": 261933205387477000,
"author_name": "riemann",
"timestamp": "12/10/2022 01:17:03",
"content": "Yes",
"attachments": [],
"mentions": [
{
"id": 633048785131667500,
"name": "GhostGib",
"discriminator": "6563",
"nickname": "GhostGib",
"isBot": false
}
],
"reference": null
},
{
"id": 1051019708633206800,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "12/10/2022 01:17:05",
"content": "Okay so turn that into a matrix and row reduce",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051019770264297600,
"author_id": 261933205387477000,
"author_name": "riemann",
"timestamp": "12/10/2022 01:17:20",
"content": "Is this even for a linear algebra class?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051019797166571500,
"author_id": 261933205387477000,
"author_name": "riemann",
"timestamp": "12/10/2022 01:17:26",
"content": "Sounds like high school",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051019815906709500,
"author_id": 261933205387477000,
"author_name": "riemann",
"timestamp": "12/10/2022 01:17:31",
"content": "Or college algebra",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051019848085413900,
"author_id": 254377887522750460,
"author_name": "poppylikecats",
"timestamp": "12/10/2022 01:17:38",
"content": "row reducing seems a bit much",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051019854636924900,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "12/10/2022 01:17:40",
"content": "Mm do u know gaussian elimination @GhostGib",
"attachments": [],
"mentions": [
{
"id": 633048785131667500,
"name": "GhostGib",
"discriminator": "6563",
"nickname": "GhostGib",
"isBot": false
}
],
"reference": null
},
{
"id": 1051020007494127700,
"author_id": 633048785131667500,
"author_name": "GhostGib",
"timestamp": "12/10/2022 01:18:16",
"content": "yes it is college algebra",
"attachments": [],
"mentions": [
{
"id": 261933205387477000,
"name": "riemann",
"discriminator": "2529",
"nickname": "riemann",
"isBot": false
}
],
"reference": null
},
{
"id": 1051020138377396200,
"author_id": 261933205387477000,
"author_name": "riemann",
"timestamp": "12/10/2022 01:18:47",
"content": "I don't know how I know that",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051020186242793600,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "12/10/2022 01:18:59",
"content": "Lmao. Instinictive. Done too many matrices by this point I'm numb",
"attachments": [],
"mentions": [
{
"id": 254377887522750460,
"name": "poppylikecats",
"discriminator": "4758",
"nickname": "poppylikecats",
"isBot": false
}
],
"reference": null
},
{
"id": 1051020342568681500,
"author_id": 261933205387477000,
"author_name": "riemann",
"timestamp": "12/10/2022 01:19:36",
"content": "There's lots of ways to do this. The easiest is to multiply the first equation by a constant to make it look like the second equation",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051020428556116000,
"author_id": 261933205387477000,
"author_name": "riemann",
"timestamp": "12/10/2022 01:19:57",
"content": "What do you multiply 2x1 by to get -6x1?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051021309011841000,
"author_id": 633048785131667500,
"author_name": "GhostGib",
"timestamp": "12/10/2022 01:23:27",
"content": "-3?",
"attachments": [],
"mentions": [
{
"id": 261933205387477000,
"name": "riemann",
"discriminator": "2529",
"nickname": "riemann",
"isBot": false
}
],
"reference": null
},
{
"id": 1051021398996426800,
"author_id": 261933205387477000,
"author_name": "riemann",
"timestamp": "12/10/2022 01:23:48",
"content": "Yes",
"attachments": [],
"mentions": [
{
"id": 633048785131667500,
"name": "GhostGib",
"discriminator": "6563",
"nickname": "GhostGib",
"isBot": false
}
],
"reference": null
},
{
"id": 1051022364701360100,
"author_id": 633048785131667500,
"author_name": "GhostGib",
"timestamp": "12/10/2022 01:27:38",
"content": "and for the other one, I have to multiply by just 3?",
"attachments": [],
"mentions": [
{
"id": 261933205387477000,
"name": "riemann",
"discriminator": "2529",
"nickname": "riemann",
"isBot": false
}
],
"reference": null
},
{
"id": 1051022454786637800,
"author_id": 261933205387477000,
"author_name": "riemann",
"timestamp": "12/10/2022 01:28:00",
"content": "You shouldn't be multiplying anything else by anything",
"attachments": [],
"mentions": [
{
"id": 633048785131667500,
"name": "GhostGib",
"discriminator": "6563",
"nickname": "GhostGib",
"isBot": false
}
],
"reference": null
},
{
"id": 1051022477410705400,
"author_id": 633048785131667500,
"author_name": "GhostGib",
"timestamp": "12/10/2022 01:28:05",
"content": "oh okay",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051022521316675600,
"author_id": 261933205387477000,
"author_name": "riemann",
"timestamp": "12/10/2022 01:28:16",
"content": "Errr I take that back",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051022588056436700,
"author_id": 261933205387477000,
"author_name": "riemann",
"timestamp": "12/10/2022 01:28:32",
"content": "Just do this",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051022653948952600,
"author_id": 261933205387477000,
"author_name": "riemann",
"timestamp": "12/10/2022 01:28:47",
"content": "You figured out the constant here",
"attachments": [],
"mentions": [
{
"id": 633048785131667500,
"name": "GhostGib",
"discriminator": "6563",
"nickname": "GhostGib",
"isBot": false
}
],
"reference": null
},
{
"id": 1051022914742399000,
"author_id": 633048785131667500,
"author_name": "GhostGib",
"timestamp": "12/10/2022 01:29:49",
"content": "Oh wait I got it",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051022930387144700,
"author_id": 633048785131667500,
"author_name": "GhostGib",
"timestamp": "12/10/2022 01:29:53",
"content": "its 2/3",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051025496638509000,
"author_id": 633048785131667500,
"author_name": "GhostGib",
"timestamp": "12/10/2022 01:40:05",
"content": ".close",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051025499499008100,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 01:40:06",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
169f6b85b29a4d278b1390a59847eb7b
|
199,972 |
[
{
"id": 1051025751123701800,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 01:41:06",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051032275330011100,
"author_id": 403514874820427800,
"author_name": "youz",
"timestamp": "12/10/2022 02:07:01",
"content": "this is 1, right?",
"attachments": [
{
"id": 1051032274944139300,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051032274944139284/image.png",
"fileName": "image.png",
"fileSizeBytes": 21835
}
],
"mentions": [],
"reference": null
},
{
"id": 1051032277355876400,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 02:07:02",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051032275330011100,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051032331688878100,
"author_id": 403514874820427800,
"author_name": "youz",
"timestamp": "12/10/2022 02:07:15",
"content": "I am on limits rn and I just solved this but want to make sure it's correct or not",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051032345337135100,
"author_id": 403514874820427800,
"author_name": "youz",
"timestamp": "12/10/2022 02:07:18",
"content": "is it 1?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051033040522063900,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "12/10/2022 02:10:04",
"content": "Explain your reasoning of why it is 1",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051033310006087700,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "12/10/2022 02:11:08",
"content": "You are right; just want to make sure of what you did to conclude that",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051035570513649700,
"author_id": 403514874820427800,
"author_name": "youz",
"timestamp": "12/10/2022 02:20:07",
"content": ".close",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051035573210599600,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 02:20:07",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
2fd5361a5a274b56a515f987b0d31250
|
199,973 |
[
{
"id": 1051048570226221000,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 03:11:46",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051050749121015900,
"author_id": 785434218682908700,
"author_name": "Autumn",
"timestamp": "12/10/2022 03:20:26",
"content": "In class 11 of a college, among 40 students 20 play football, 25 play cricket and 10 play both cricket and football. Among them one has been selected at random. If the student plays football, then what is the probability of him playing cricket?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051050751096529000,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 03:20:26",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051050749121015900,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051052523261284400,
"author_id": 785434218682908700,
"author_name": "Autumn",
"timestamp": "12/10/2022 03:27:29",
"content": "I tried many ways, at first I thought it would be 10/40, because Football and Cricket = 10",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051052584426803200,
"author_id": 785434218682908700,
"author_name": "Autumn",
"timestamp": "12/10/2022 03:27:43",
"content": "But the result was 20/49 in the book",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051052812798263300,
"author_id": 785434218682908700,
"author_name": "Autumn",
"timestamp": "12/10/2022 03:28:38",
"content": "Then I thought it's conditional probability, so P(C | F) = P(F and C) / P(F).",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051052875830268000,
"author_id": 785434218682908700,
"author_name": "Autumn",
"timestamp": "12/10/2022 03:28:53",
"content": "Which is, 10/25",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051052918830276700,
"author_id": 785434218682908700,
"author_name": "Autumn",
"timestamp": "12/10/2022 03:29:03",
"content": "That too didn't match the result",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051053769137332400,
"author_id": 785434218682908700,
"author_name": "Autumn",
"timestamp": "12/10/2022 03:32:26",
"content": "If we find out how many of the 40 actually plays, then there are 35 that plays. So P(C|F) = P(C) * P(F) = (20/35) *(25/35 )",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051053839928791000,
"author_id": 785434218682908700,
"author_name": "Autumn",
"timestamp": "12/10/2022 03:32:43",
"content": "= (4/7) * (5/7) = 20/49",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051053913840812000,
"author_id": 785434218682908700,
"author_name": "Autumn",
"timestamp": "12/10/2022 03:33:00",
"content": "Which matches the result but I don't understand why the total event would be 35",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051054021877710800,
"author_id": 785434218682908700,
"author_name": "Autumn",
"timestamp": "12/10/2022 03:33:26",
"content": "I feel like if I am given another problem like this I won't be able to solve it",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051054393392386000,
"author_id": 183668144404037630,
"author_name": "Ann",
"timestamp": "12/10/2022 03:34:55",
"content": "hold up",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051054443510112300,
"author_id": 183668144404037630,
"author_name": "Ann",
"timestamp": "12/10/2022 03:35:06",
"content": "can you show the problem and the answer key in your book?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051054490796687400,
"author_id": 785434218682908700,
"author_name": "Autumn",
"timestamp": "12/10/2022 03:35:18",
"content": "It's in my language, Bangla",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051054531800215600,
"author_id": 183668144404037630,
"author_name": "Ann",
"timestamp": "12/10/2022 03:35:28",
"content": "as written, 10/25 is the correct answer for P(C | F)",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051054624230101000,
"author_id": 183668144404037630,
"author_name": "Ann",
"timestamp": "12/10/2022 03:35:50",
"content": "the reason i'm asking for this is that i suspect you're looking at the wrong place in your answer key.",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051054671348908000,
"author_id": 183668144404037630,
"author_name": "Ann",
"timestamp": "12/10/2022 03:36:01",
"content": "or maybe the book is just this bad.",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051054839196553200,
"author_id": 785434218682908700,
"author_name": "Autumn",
"timestamp": "12/10/2022 03:36:41",
"content": "I think the book has wording problems",
"attachments": [],
"mentions": [
{
"id": 183668144404037630,
"name": "Ann",
"discriminator": "0413",
"nickname": "Ann",
"isBot": false
}
],
"reference": null
},
{
"id": 1051054869164863500,
"author_id": 183668144404037630,
"author_name": "Ann",
"timestamp": "12/10/2022 03:36:48",
"content": "perhaps.",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051054944666538000,
"author_id": 183668144404037630,
"author_name": "Ann",
"timestamp": "12/10/2022 03:37:06",
"content": "i don't think there's any way to produce a question whose answer is 20/49 with the data in the problem",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051055154553696300,
"author_id": 785434218682908700,
"author_name": "Autumn",
"timestamp": "12/10/2022 03:37:56",
"content": "Okay I will try to discuss this in a Bangla forum, though I doubt it if they'll help",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051055176703819800,
"author_id": 785434218682908700,
"author_name": "Autumn",
"timestamp": "12/10/2022 03:38:01",
"content": "Thank you for your help",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051055219389235200,
"author_id": 785434218682908700,
"author_name": "Autumn",
"timestamp": "12/10/2022 03:38:11",
"content": "I will close this now?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051055866108969000,
"author_id": 183668144404037630,
"author_name": "Ann",
"timestamp": "12/10/2022 03:40:46",
"content": "you don't need to ask for permission.",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051055924615331800,
"author_id": 785434218682908700,
"author_name": "Autumn",
"timestamp": "12/10/2022 03:41:00",
"content": "Okay",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051055960656973800,
"author_id": 785434218682908700,
"author_name": "Autumn",
"timestamp": "12/10/2022 03:41:08",
"content": ".close",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051055965232963600,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 03:41:09",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
6a89267a769f49fbb7673c5885f6b2e2
|
199,974 |
[
{
"id": 1051061813967605900,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 04:04:24",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051062053399429200,
"author_id": 409286180853776400,
"author_name": "Bunnyboy",
"timestamp": "12/10/2022 04:05:21",
"content": "Different round combinations We have to start at city A and end at city A. I tried to normally do it by counting but I am off. Can anyone help me figuring out how many different round combinations there could be with letters ABCDE?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051062055815352300,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 04:05:21",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051062053399429200,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051062316143226900,
"author_id": 141791176540946430,
"author_name": "frownyfrog",
"timestamp": "12/10/2022 04:06:23",
"content": "it's not clear what trips are valid",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051062346707128400,
"author_id": 141791176540946430,
"author_name": "frownyfrog",
"timestamp": "12/10/2022 04:06:31",
"content": "can i go ABA?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051062610210070500,
"author_id": 409286180853776400,
"author_name": "Bunnyboy",
"timestamp": "12/10/2022 04:07:34",
"content": "the problem is here",
"attachments": [
{
"id": 1051062609912287400,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051062609912287332/2022-12-10_10-07-00.png",
"fileName": "2022-12-10_10-07-00.png",
"fileSizeBytes": 5274
}
],
"mentions": [],
"reference": null
},
{
"id": 1051062781333483500,
"author_id": 409286180853776400,
"author_name": "Bunnyboy",
"timestamp": "12/10/2022 04:08:14",
"content": "Each collum we add an extra city/letter",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051062812572663800,
"author_id": 141791176540946430,
"author_name": "frownyfrog",
"timestamp": "12/10/2022 04:08:22",
"content": "why does it just say ABA",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051062846177427600,
"author_id": 409286180853776400,
"author_name": "Bunnyboy",
"timestamp": "12/10/2022 04:08:30",
"content": "its an example",
"attachments": [],
"mentions": [
{
"id": 141791176540946430,
"name": "frownyfrog",
"discriminator": "3707",
"nickname": "frownyfrog",
"isBot": false
}
],
"reference": null
},
{
"id": 1051062977190694900,
"author_id": 409286180853776400,
"author_name": "Bunnyboy",
"timestamp": "12/10/2022 04:09:01",
"content": "The cities are the letters",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051063016281612300,
"author_id": 141791176540946430,
"author_name": "frownyfrog",
"timestamp": "12/10/2022 04:09:10",
"content": "ok it's ABA because there's A and B i get it",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051063251644985300,
"author_id": 141791176540946430,
"author_name": "frownyfrog",
"timestamp": "12/10/2022 04:10:07",
"content": "so you just go 3! for 4 cities, 12! for 13 cities etc.",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051063285581103100,
"author_id": 409286180853776400,
"author_name": "Bunnyboy",
"timestamp": "12/10/2022 04:10:15",
"content": "",
"attachments": [
{
"id": 1051063285199413200,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051063285199413309/2022-12-10_10-09-36.png",
"fileName": "2022-12-10_10-09-36.png",
"fileSizeBytes": 10524
}
],
"mentions": [],
"reference": null
},
{
"id": 1051063584752423000,
"author_id": 141791176540946430,
"author_name": "frownyfrog",
"timestamp": "12/10/2022 04:11:26",
"content": "it's still not really clear what routes you're allowed to take",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051063822691082200,
"author_id": 141791176540946430,
"author_name": "frownyfrog",
"timestamp": "12/10/2022 04:12:23",
"content": "you're being so teasy about it, now we can see part of the task but still have to guess the rest",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051063996570148900,
"author_id": 409286180853776400,
"author_name": "Bunnyboy",
"timestamp": "12/10/2022 04:13:04",
"content": "it dosent say what routes you are allowed to take",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051064179710247000,
"author_id": 409286180853776400,
"author_name": "Bunnyboy",
"timestamp": "12/10/2022 04:13:48",
"content": "",
"attachments": [
{
"id": 1051064179416633300,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051064179416633394/2022-12-10_10-13-28.png",
"fileName": "2022-12-10_10-13-28.png",
"fileSizeBytes": 16061
}
],
"mentions": [],
"reference": null
},
{
"id": 1051064208323788900,
"author_id": 409286180853776400,
"author_name": "Bunnyboy",
"timestamp": "12/10/2022 04:13:55",
"content": "thats the full math problem",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051064448086966300,
"author_id": 182179228840755200,
"author_name": "iCaird",
"timestamp": "12/10/2022 04:14:52",
"content": "That looks like the second part of a longer problem/question",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051064594107486200,
"author_id": 141791176540946430,
"author_name": "frownyfrog",
"timestamp": "12/10/2022 04:15:27",
"content": "yeah keep increasing the size of the screenshot",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051064620326076500,
"author_id": 141791176540946430,
"author_name": "frownyfrog",
"timestamp": "12/10/2022 04:15:33",
"content": "it consistently gets better",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051064683873980500,
"author_id": 409286180853776400,
"author_name": "Bunnyboy",
"timestamp": "12/10/2022 04:15:48",
"content": "but thats it i dont have anymore information",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051065481500565500,
"author_id": 141791176540946430,
"author_name": "frownyfrog",
"timestamp": "12/10/2022 04:18:58",
"content": "you should get 6 and 24 for 4 and 5",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051066019315195900,
"author_id": 409286180853776400,
"author_name": "Bunnyboy",
"timestamp": "12/10/2022 04:21:06",
"content": "ok I did different routes and 4 adds up to 6",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051066045466673200,
"author_id": 409286180853776400,
"author_name": "Bunnyboy",
"timestamp": "12/10/2022 04:21:13",
"content": "so thats correct",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051067126112334000,
"author_id": 409286180853776400,
"author_name": "Bunnyboy",
"timestamp": "12/10/2022 04:25:30",
"content": "now im doing 5",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051067366525644800,
"author_id": 409286180853776400,
"author_name": "Bunnyboy",
"timestamp": "12/10/2022 04:26:28",
"content": "ok your right",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051067400180727800,
"author_id": 409286180853776400,
"author_name": "Bunnyboy",
"timestamp": "12/10/2022 04:26:36",
"content": "it does add up to 24",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051067411442446300,
"author_id": 409286180853776400,
"author_name": "Bunnyboy",
"timestamp": "12/10/2022 04:26:38",
"content": "thanls",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051067423819825200,
"author_id": 409286180853776400,
"author_name": "Bunnyboy",
"timestamp": "12/10/2022 04:26:41",
"content": "thanks",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051067895045689500,
"author_id": 409286180853776400,
"author_name": "Bunnyboy",
"timestamp": "12/10/2022 04:28:34",
"content": ".close",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051067897818120200,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 04:28:34",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
2c72ccdc8f83454e89a218b35ffb513b
|
199,975 |
[
{
"id": 1051068150365569000,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 04:29:34",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051072489050091500,
"author_id": 692423267121627300,
"author_name": "vn",
"timestamp": "12/10/2022 04:46:49",
"content": "y=15? is that right",
"attachments": [
{
"id": 1051072488848769000,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051072488848769064/image.png",
"fileName": "image.png",
"fileSizeBytes": 11090
}
],
"mentions": [],
"reference": null
},
{
"id": 1051072491692499000,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 04:46:50",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051072489050091500,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051072667404468200,
"author_id": 551720541464166400,
"author_name": "Casper",
"timestamp": "12/10/2022 04:47:31",
"content": "I dont think it is",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051072735687753900,
"author_id": 1042874945451077800,
"author_name": "fredo",
"timestamp": "12/10/2022 04:47:48",
"content": "105",
"attachments": [],
"mentions": [
{
"id": 692423267121627300,
"name": "vn",
"discriminator": "0444",
"nickname": "vn",
"isBot": false
}
],
"reference": null
},
{
"id": 1051072804931514400,
"author_id": 1042874945451077800,
"author_name": "fredo",
"timestamp": "12/10/2022 04:48:04",
"content": "Y=105",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051072834937565200,
"author_id": 756743425272840200,
"author_name": "anand",
"timestamp": "12/10/2022 04:48:11",
"content": "Stop giving direct answers",
"attachments": [],
"mentions": [
{
"id": 1042874945451077800,
"name": "fredo",
"discriminator": "8304",
"nickname": "fredo",
"isBot": false
}
],
"reference": null
},
{
"id": 1051072886586232800,
"author_id": 692423267121627300,
"author_name": "vn",
"timestamp": "12/10/2022 04:48:24",
"content": "howd u",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051072888825970700,
"author_id": 692423267121627300,
"author_name": "vn",
"timestamp": "12/10/2022 04:48:24",
"content": "get",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051072890256228400,
"author_id": 1042874945451077800,
"author_name": "fredo",
"timestamp": "12/10/2022 04:48:25",
"content": "Mb",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051072893422944400,
"author_id": 692423267121627300,
"author_name": "vn",
"timestamp": "12/10/2022 04:48:25",
"content": "105",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051072974968606700,
"author_id": 551720541464166400,
"author_name": "Casper",
"timestamp": "12/10/2022 04:48:45",
"content": "We know that the sum of angles in a parrallelogram is 360 right?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051072987891245000,
"author_id": 1042874945451077800,
"author_name": "fredo",
"timestamp": "12/10/2022 04:48:48",
"content": "the sum of the parallelogram is 360",
"attachments": [],
"mentions": [
{
"id": 692423267121627300,
"name": "vn",
"discriminator": "0444",
"nickname": "vn",
"isBot": false
}
],
"reference": null
},
{
"id": 1051072999085834200,
"author_id": 692423267121627300,
"author_name": "vn",
"timestamp": "12/10/2022 04:48:50",
"content": "ohhhhh",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051073024486543500,
"author_id": 692423267121627300,
"author_name": "vn",
"timestamp": "12/10/2022 04:48:57",
"content": "i thought the sum was 180",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051073040198422500,
"author_id": 1042874945451077800,
"author_name": "fredo",
"timestamp": "12/10/2022 04:49:00",
"content": "lmao",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051073072809128000,
"author_id": 551720541464166400,
"author_name": "Casper",
"timestamp": "12/10/2022 04:49:08",
"content": "No worries, it happens",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051073083563323400,
"author_id": 692423267121627300,
"author_name": "vn",
"timestamp": "12/10/2022 04:49:11",
"content": "mb ty",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051073105994453000,
"author_id": 551720541464166400,
"author_name": "Casper",
"timestamp": "12/10/2022 04:49:16",
"content": "Good luck with the rest of your exercises!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051073175515054100,
"author_id": 1042874945451077800,
"author_name": "fredo",
"timestamp": "12/10/2022 04:49:33",
"content": "sry I’m new to this server btw",
"attachments": [],
"mentions": [
{
"id": 756743425272840200,
"name": "anand",
"discriminator": "0990",
"nickname": "anand",
"isBot": false
}
],
"reference": null
},
{
"id": 1051073398438121500,
"author_id": 756743425272840200,
"author_name": "anand",
"timestamp": "12/10/2022 04:50:26",
"content": "Just don't give direct answers",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051073441266147300,
"author_id": 756743425272840200,
"author_name": "anand",
"timestamp": "12/10/2022 04:50:36",
"content": "Servers purpose is to teach and explain how to get the ans",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051073450279698400,
"author_id": 756743425272840200,
"author_name": "anand",
"timestamp": "12/10/2022 04:50:38",
"content": "Not give em",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051073481296576600,
"author_id": 756743425272840200,
"author_name": "anand",
"timestamp": "12/10/2022 04:50:45",
"content": "👍",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051076859267391500,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 05:04:11",
"content": "@vn Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 692423267121627300,
"name": "vn",
"discriminator": "0444",
"nickname": "vn",
"isBot": false
}
],
"reference": null
},
{
"id": 1051076921351471100,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 05:04:26",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
c318ed388cf14435bf10f23f5b910f4a
|
199,976 |
[
{
"id": 1051077174033125400,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 05:05:26",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051077522747560100,
"author_id": 639774631531774000,
"author_name": "DinVin95",
"timestamp": "12/10/2022 05:06:49",
"content": "cos(x-pi/3)+2cos(x+pi/3)=0. Solve for x from 0 to 4pi",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051077524605648900,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 05:06:49",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051077522747560100,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051077540296523900,
"author_id": 639774631531774000,
"author_name": "DinVin95",
"timestamp": "12/10/2022 05:06:53",
"content": "I need steps",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051077640758513700,
"author_id": 183668144404037630,
"author_name": "Ann",
"timestamp": "12/10/2022 05:07:17",
"content": "```\n1. I don't know where to begin\n2. I have begun but got stuck midway\n3. I got an answer but I'm told it's wrong\n4. I got an answer and would like my work checked\n5. I have a question about someone else's worked solution\n6. None of the above\n```",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051077675042746500,
"author_id": 183668144404037630,
"author_name": "Ann",
"timestamp": "12/10/2022 05:07:25",
"content": "which stage are you on?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051077837823684600,
"author_id": 639774631531774000,
"author_name": "DinVin95",
"timestamp": "12/10/2022 05:08:04",
"content": "1",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051077872665755600,
"author_id": 183668144404037630,
"author_name": "Ann",
"timestamp": "12/10/2022 05:08:12",
"content": "ok",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051077956354719900,
"author_id": 183668144404037630,
"author_name": "Ann",
"timestamp": "12/10/2022 05:08:32",
"content": "a sensible first step would be to expand cos(x - pi/3) and cos(x + pi/3) via the angle sum formula for cosine",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051077998197100500,
"author_id": 639774631531774000,
"author_name": "DinVin95",
"timestamp": "12/10/2022 05:08:42",
"content": "Compound angle formula?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051078016652021800,
"author_id": 183668144404037630,
"author_name": "Ann",
"timestamp": "12/10/2022 05:08:47",
"content": "sure, if you call it that",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051078039557132400,
"author_id": 183668144404037630,
"author_name": "Ann",
"timestamp": "12/10/2022 05:08:52",
"content": "cos(x+y) = cos(x)cos(y) - sin(x)sin(y)",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051078039729098800,
"author_id": 639774631531774000,
"author_name": "DinVin95",
"timestamp": "12/10/2022 05:08:52",
"content": "Ok I’ll try",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051078042350526500,
"author_id": 183668144404037630,
"author_name": "Ann",
"timestamp": "12/10/2022 05:08:53",
"content": "this one",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051078047668899800,
"author_id": 183668144404037630,
"author_name": "Ann",
"timestamp": "12/10/2022 05:08:54",
"content": "also fyi we won't just give you all the steps",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051078061384282100,
"author_id": 639774631531774000,
"author_name": "DinVin95",
"timestamp": "12/10/2022 05:08:57",
"content": "Ok",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051078557633364100,
"author_id": 639774631531774000,
"author_name": "DinVin95",
"timestamp": "12/10/2022 05:10:56",
"content": "",
"attachments": [
{
"id": 1051078557125849100,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051078557125849129/5EA76217-D267-409C-A9D2-7D7FB9E9155A.jpg",
"fileName": "5EA76217-D267-409C-A9D2-7D7FB9E9155A.jpg",
"fileSizeBytes": 2280805
}
],
"mentions": [],
"reference": null
},
{
"id": 1051078761199697900,
"author_id": 183668144404037630,
"author_name": "Ann",
"timestamp": "12/10/2022 05:11:44",
"content": "collect like terms",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051078791931379700,
"author_id": 183668144404037630,
"author_name": "Ann",
"timestamp": "12/10/2022 05:11:52",
"content": "also prefer 1/2 over 0.5",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051078806548512800,
"author_id": 639774631531774000,
"author_name": "DinVin95",
"timestamp": "12/10/2022 05:11:55",
"content": "Ok",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051078941147922400,
"author_id": 639774631531774000,
"author_name": "DinVin95",
"timestamp": "12/10/2022 05:12:27",
"content": "",
"attachments": [
{
"id": 1051078940757856300,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051078940757856257/AB06C57C-FC5B-4D25-9FB6-5F26A574B204.jpg",
"fileName": "AB06C57C-FC5B-4D25-9FB6-5F26A574B204.jpg",
"fileSizeBytes": 2090970
}
],
"mentions": [],
"reference": null
},
{
"id": 1051079263224352800,
"author_id": 183668144404037630,
"author_name": "Ann",
"timestamp": "12/10/2022 05:13:44",
"content": "keep going now",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051079441482268700,
"author_id": 639774631531774000,
"author_name": "DinVin95",
"timestamp": "12/10/2022 05:14:26",
"content": "do I do asinx+bsinx",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051080313545179100,
"author_id": 639774631531774000,
"author_name": "DinVin95",
"timestamp": "12/10/2022 05:17:54",
"content": "I don’t know what to do next",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051080583457013800,
"author_id": 183668144404037630,
"author_name": "Ann",
"timestamp": "12/10/2022 05:18:59",
"content": "try adding 1/2 cos(x) to both sides to see if that gives you any ideas.",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051080616826896400,
"author_id": 639774631531774000,
"author_name": "DinVin95",
"timestamp": "12/10/2022 05:19:07",
"content": "Ok",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051080800185106400,
"author_id": 639774631531774000,
"author_name": "DinVin95",
"timestamp": "12/10/2022 05:19:50",
"content": "",
"attachments": [
{
"id": 1051080799966994400,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051080799966994432/92AFC665-65CA-4052-9487-AFD51DBDB729.jpg",
"fileName": "92AFC665-65CA-4052-9487-AFD51DBDB729.jpg",
"fileSizeBytes": 2032352
}
],
"mentions": [],
"reference": null
},
{
"id": 1051080874034212900,
"author_id": 639774631531774000,
"author_name": "DinVin95",
"timestamp": "12/10/2022 05:20:08",
"content": "Wait",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051080886617116700,
"author_id": 639774631531774000,
"author_name": "DinVin95",
"timestamp": "12/10/2022 05:20:11",
"content": "I can use tangent",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051080994075201500,
"author_id": 639774631531774000,
"author_name": "DinVin95",
"timestamp": "12/10/2022 05:20:37",
"content": "",
"attachments": [
{
"id": 1051080994100346900,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051080994100346910/6CA414C9-32C1-4D98-8A73-9E87379D760E.jpg",
"fileName": "6CA414C9-32C1-4D98-8A73-9E87379D760E.jpg",
"fileSizeBytes": 1709087
}
],
"mentions": [],
"reference": null
},
{
"id": 1051081259545280500,
"author_id": 639774631531774000,
"author_name": "DinVin95",
"timestamp": "12/10/2022 05:21:40",
"content": ",w arctan(1/(3sqrt3))",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051081283058548700,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "12/10/2022 05:21:46",
"content": "Results provided by WolframAlpha",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051081298913005600,
"author_id": 639774631531774000,
"author_name": "DinVin95",
"timestamp": "12/10/2022 05:21:49",
"content": "???",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051081620838437000,
"author_id": 639774631531774000,
"author_name": "DinVin95",
"timestamp": "12/10/2022 05:23:06",
"content": ",w cos(arctan(1/(3sqrt3))-pi/3)+2cos(arctan(1/(3sqrt3))+pi/3)",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051081647476445200,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "12/10/2022 05:23:12",
"content": "Results provided by WolframAlpha",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051081954243657700,
"author_id": 639774631531774000,
"author_name": "DinVin95",
"timestamp": "12/10/2022 05:24:26",
"content": "what did I do wrong?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051082393987076100,
"author_id": 639774631531774000,
"author_name": "DinVin95",
"timestamp": "12/10/2022 05:26:10",
"content": "Hi @Ann",
"attachments": [],
"mentions": [
{
"id": 183668144404037630,
"name": "Ann",
"discriminator": "0413",
"nickname": "Ann",
"isBot": false
}
],
"reference": null
},
{
"id": 1051082421291987100,
"author_id": 183668144404037630,
"author_name": "Ann",
"timestamp": "12/10/2022 05:26:17",
"content": "looking over it",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051082466716299300,
"author_id": 183668144404037630,
"author_name": "Ann",
"timestamp": "12/10/2022 05:26:28",
"content": ",w cos(x - pi/3) + 2 cos(x + pi/3) = 0",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051082485565493200,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "12/10/2022 05:26:32",
"content": "Results provided by WolframAlpha",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051082536853450800,
"author_id": 639774631531774000,
"author_name": "DinVin95",
"timestamp": "12/10/2022 05:26:44",
"content": "ohhh",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051082556617019400,
"author_id": 639774631531774000,
"author_name": "DinVin95",
"timestamp": "12/10/2022 05:26:49",
"content": "let me put it back",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051082596483870700,
"author_id": 183668144404037630,
"author_name": "Ann",
"timestamp": "12/10/2022 05:26:59",
"content": "i cannot see your screwup",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051082873354068100,
"author_id": 639774631531774000,
"author_name": "DinVin95",
"timestamp": "12/10/2022 05:28:05",
"content": ",w arctan(sqrt3)",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051082892148736000,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "12/10/2022 05:28:09",
"content": "Results provided by WolframAlpha",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051082925178884100,
"author_id": 639774631531774000,
"author_name": "DinVin95",
"timestamp": "12/10/2022 05:28:17",
"content": "Hmm",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051083016769896600,
"author_id": 183668144404037630,
"author_name": "Ann",
"timestamp": "12/10/2022 05:28:39",
"content": "wtf",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051083019697520600,
"author_id": 183668144404037630,
"author_name": "Ann",
"timestamp": "12/10/2022 05:28:40",
"content": "hold up",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051083091805995000,
"author_id": 183668144404037630,
"author_name": "Ann",
"timestamp": "12/10/2022 05:28:57",
"content": "OH",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051083195334004900,
"author_id": 183668144404037630,
"author_name": "Ann",
"timestamp": "12/10/2022 05:29:21",
"content": "",
"attachments": [
{
"id": 1051083195107508200,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051083195107508265/image.png",
"fileName": "image.png",
"fileSizeBytes": 5080235
}
],
"mentions": [],
"reference": null
},
{
"id": 1051083214753636400,
"author_id": 639774631531774000,
"author_name": "DinVin95",
"timestamp": "12/10/2022 05:29:26",
"content": "",
"attachments": [
{
"id": 1051083214334197800,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051083214334197780/E83B7260-AEB4-4234-87FF-3024069CC7FD.jpg",
"fileName": "E83B7260-AEB4-4234-87FF-3024069CC7FD.jpg",
"fileSizeBytes": 2249327
}
],
"mentions": [],
"reference": null
},
{
"id": 1051083226984226800,
"author_id": 183668144404037630,
"author_name": "Ann",
"timestamp": "12/10/2022 05:29:29",
"content": "you replaced the plus with a minus",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051083235926491100,
"author_id": 639774631531774000,
"author_name": "DinVin95",
"timestamp": "12/10/2022 05:29:31",
"content": "yea I found it",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051083253311868900,
"author_id": 639774631531774000,
"author_name": "DinVin95",
"timestamp": "12/10/2022 05:29:35",
"content": "but I got tanx=sqrt3",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051083294621564900,
"author_id": 183668144404037630,
"author_name": "Ann",
"timestamp": "12/10/2022 05:29:45",
"content": "that is now correct",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051083358689566800,
"author_id": 639774631531774000,
"author_name": "DinVin95",
"timestamp": "12/10/2022 05:30:00",
"content": "but it’s Pi/3",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051083370613968900,
"author_id": 639774631531774000,
"author_name": "DinVin95",
"timestamp": "12/10/2022 05:30:03",
"content": "+pin",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051083488746537000,
"author_id": 183668144404037630,
"author_name": "Ann",
"timestamp": "12/10/2022 05:30:31",
"content": "yes",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051083541187919900,
"author_id": 183668144404037630,
"author_name": "Ann",
"timestamp": "12/10/2022 05:30:44",
"content": "{pi/3 + npi | n in Z} = {-2pi/3 + npi | n in Z}",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051083630551781500,
"author_id": 639774631531774000,
"author_name": "DinVin95",
"timestamp": "12/10/2022 05:31:05",
"content": "",
"attachments": [
{
"id": 1051083629989736600,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051083629989736519/E126B807-F429-4DF2-90EF-0643D22B460B.jpg",
"fileName": "E126B807-F429-4DF2-90EF-0643D22B460B.jpg",
"fileSizeBytes": 2517983
}
],
"mentions": [],
"reference": null
},
{
"id": 1051083702421172400,
"author_id": 639774631531774000,
"author_name": "DinVin95",
"timestamp": "12/10/2022 05:31:22",
"content": "Is this correct?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051084338508337300,
"author_id": 183668144404037630,
"author_name": "Ann",
"timestamp": "12/10/2022 05:33:54",
"content": "yeah seems so",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051084339032641700,
"author_id": 639774631531774000,
"author_name": "DinVin95",
"timestamp": "12/10/2022 05:33:54",
"content": "Thanks anyways",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051084360679428100,
"author_id": 639774631531774000,
"author_name": "DinVin95",
"timestamp": "12/10/2022 05:33:59",
"content": "TYSM",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051088136207339600,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 05:48:59",
"content": "@DinVin95 Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 639774631531774000,
"name": "DinVin95",
"discriminator": "9220",
"nickname": "DinVin95",
"isBot": false
}
],
"reference": null
},
{
"id": 1051091913526231200,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 06:04:00",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
71a9eaa699ef46c89acb9106f018d731
|
199,977 |
[
{
"id": 1034393025918537700,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "10/25/2022 05:08:35",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034393340382286000,
"author_id": 246580750294450180,
"author_name": "Bruh Jones",
"timestamp": "10/25/2022 05:09:50",
"content": "need help with",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034393344773718000,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "10/25/2022 05:09:51",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1034393340382286000,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1034393354177364000,
"author_id": 246580750294450180,
"author_name": "Bruh Jones",
"timestamp": "10/25/2022 05:09:53",
"content": "",
"attachments": [
{
"id": 1034393353858584600,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1034393353858584616/unknown.png",
"fileName": "unknown.png",
"fileSizeBytes": 38660
}
],
"mentions": [],
"reference": null
},
{
"id": 1034393805564170200,
"author_id": 183668144404037630,
"author_name": "Ann",
"timestamp": "10/25/2022 05:11:41",
"content": "f(k) is Theta(k^k) and g(k) is Theta(2^(k^2)). the tau_i are just smokescreens as far as that goes.",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034397011916619800,
"author_id": 246580750294450180,
"author_name": "Bruh Jones",
"timestamp": "10/25/2022 05:24:25",
"content": "so it owuld be that g(k) is O(f(k)) then right?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034397090421424100,
"author_id": 246580750294450180,
"author_name": "Bruh Jones",
"timestamp": "10/25/2022 05:24:44",
"content": "as k^k is an upper bound of 2^k^2",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034400866502975500,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "10/25/2022 05:39:44",
"content": "@Bruh Jones Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 246580750294450180,
"name": "Bruh Jones",
"discriminator": "7465",
"nickname": "Bruh Jones",
"isBot": false
}
],
"reference": null
},
{
"id": 1034404643339509900,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "10/25/2022 05:54:45",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
fc9784bc3c1f449a86f52738c7bd5312
|
199,978 |
[
{
"id": 1051092165868130300,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 06:05:00",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051093323110158500,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 06:09:36",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051093320627138600,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051093673728811000,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 06:11:00",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
d9ced6e0b88e44d9b2140fbead025ce0
|
199,979 |
[
{
"id": 1051095848618049700,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 06:19:38",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051096275199733800,
"author_id": 343750954862116860,
"author_name": "AltazarRequiem",
"timestamp": "12/10/2022 06:21:20",
"content": "",
"attachments": [
{
"id": 1051096275069702100,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051096275069702175/IMG_20221210_192026.jpg",
"fileName": "IMG_20221210_192026.jpg",
"fileSizeBytes": 7150
}
],
"mentions": [],
"reference": null
},
{
"id": 1051096276940378200,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 06:21:20",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051096275199733800,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051096304140427300,
"author_id": 343750954862116860,
"author_name": "AltazarRequiem",
"timestamp": "12/10/2022 06:21:27",
"content": "",
"attachments": [
{
"id": 1051096303867801600,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051096303867801610/image.png",
"fileName": "image.png",
"fileSizeBytes": 183204
}
],
"mentions": [],
"reference": null
},
{
"id": 1051096336705003500,
"author_id": 343750954862116860,
"author_name": "AltazarRequiem",
"timestamp": "12/10/2022 06:21:35",
"content": "So like it's infinity?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051096368606892000,
"author_id": 343750954862116860,
"author_name": "AltazarRequiem",
"timestamp": "12/10/2022 06:21:42",
"content": "and is this right?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051097056514691200,
"author_id": 187850624421986300,
"author_name": "Circle",
"timestamp": "12/10/2022 06:24:26",
"content": "er",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051097087120511000,
"author_id": 187850624421986300,
"author_name": "Circle",
"timestamp": "12/10/2022 06:24:34",
"content": "a graph doesnt have a value",
"attachments": [],
"mentions": [
{
"id": 343750954862116860,
"name": "AltazarRequiem",
"discriminator": "6214",
"nickname": "AltazarRequiem",
"isBot": false
}
],
"reference": null
},
{
"id": 1051097136332275800,
"author_id": 187850624421986300,
"author_name": "Circle",
"timestamp": "12/10/2022 06:24:45",
"content": "and yes",
"attachments": [],
"mentions": [
{
"id": 343750954862116860,
"name": "AltazarRequiem",
"discriminator": "6214",
"nickname": "AltazarRequiem",
"isBot": false
}
],
"reference": null
},
{
"id": 1051097200719048700,
"author_id": 343750954862116860,
"author_name": "AltazarRequiem",
"timestamp": "12/10/2022 06:25:01",
"content": "I see, thanks for the help",
"attachments": [],
"mentions": [
{
"id": 187850624421986300,
"name": "Circle",
"discriminator": "0025",
"nickname": "💕Spirit Immortal Layer 8",
"isBot": false
}
],
"reference": null
},
{
"id": 1051097239201787900,
"author_id": 343750954862116860,
"author_name": "AltazarRequiem",
"timestamp": "12/10/2022 06:25:10",
"content": ".close",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051097241655443600,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 06:25:10",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
2badeca7cfee461a8b2710c0b99c95b8
|
199,980 |
[
{
"id": 1051097282470236200,
"author_id": 187850624421986300,
"author_name": "Circle",
"timestamp": "12/10/2022 06:25:20",
"content": "np",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051097287490805800,
"author_id": 187850624421986300,
"author_name": "Circle",
"timestamp": "12/10/2022 06:25:21",
"content": "💕",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051097379685806200,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "12/10/2022 06:25:43",
"content": "wot",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051097414855049200,
"author_id": 187850624421986300,
"author_name": "Circle",
"timestamp": "12/10/2022 06:25:52",
"content": "wot",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051097558937784300,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "12/10/2022 06:26:26",
"content": "i swear i got pinged :thinkies:",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051097570576973800,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "12/10/2022 06:26:29",
"content": "okay nvm",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051097830338596900,
"author_id": 187850624421986300,
"author_name": "Circle",
"timestamp": "12/10/2022 06:27:31",
"content": "mayb",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051097837435363300,
"author_id": 187850624421986300,
"author_name": "Circle",
"timestamp": "12/10/2022 06:27:32",
"content": "cry harder",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051098078498787300,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "12/10/2022 06:28:30",
"content": ":what:",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051114109879460000,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 07:32:12",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051114280533102700,
"author_id": 417016931590340600,
"author_name": "azuzuzuzurarrr",
"timestamp": "12/10/2022 07:32:53",
"content": "Related Rate problem about ripple. Need to know what others' answer would be so I can verify if mine is correct.\n\nJohn threw a rock at a stillwater lake and it caused a ripple that had a radius increasing at a constnt rate of 3cm/s. How fast is the area enclosed in the ripple increasing after 12s?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051114282798043100,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 07:32:53",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051114280533102700,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051118056614670500,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 07:47:53",
"content": "@azuzuzuzurarrr Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 417016931590340600,
"name": "azuzuzuzurarrr",
"discriminator": "7179",
"nickname": "azuzuzuzurarrr",
"isBot": false
}
],
"reference": null
},
{
"id": 1051125626813296800,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 08:17:58",
"content": "@azuzuzuzurarrr Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 417016931590340600,
"name": "azuzuzuzurarrr",
"discriminator": "7179",
"nickname": "azuzuzuzurarrr",
"isBot": false
}
],
"reference": null
},
{
"id": 1051140751142174700,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 09:18:04",
"content": "@azuzuzuzurarrr Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 417016931590340600,
"name": "azuzuzuzurarrr",
"discriminator": "7179",
"nickname": "azuzuzuzurarrr",
"isBot": false
}
],
"reference": null
},
{
"id": 1051140777239138400,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 09:18:10",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
e4ed9bc526024dc085628f9c0afcc153
|
199,981 |
[
{
"id": 1051141030537334800,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 09:19:10",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051141373287485400,
"author_id": 262625255946846200,
"author_name": "Durandal",
"timestamp": "12/10/2022 09:20:32",
"content": "Other than OLS, how are gram matrices useful?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051141375304929400,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 09:20:33",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051141373287485400,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051144786368803000,
"author_id": 996870091419422700,
"author_name": "草w",
"timestamp": "12/10/2022 09:34:06",
"content": "short answer: you can read Wikipedia's article on their properties.\nyou can also ask chatgpt, which does reply you with something.\nhttps://discord.com/channels/268882317391429632/268882317391429632/1051143995239190598 \nis one chatgpt reply\n\nchatgpt is referring to this in terms of kernels\nhttps://math.stackexchange.com/questions/2422612/what-is-the-difference-between-a-kernel-and-kernel-gram-matrix\ngram matrix in pca eg\nhttps://stats.stackexchange.com/questions/131140/what-exactly-is-the-procedure-to-compute-principal-components-in-kernel-pca",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051146045712765000,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 09:39:06",
"content": "@Durandal Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 262625255946846200,
"name": "Durandal",
"discriminator": "1929",
"nickname": "Durandal",
"isBot": false
}
],
"reference": null
},
{
"id": 1051146795851460600,
"author_id": 1051133703973245000,
"author_name": "최고의멋쟁이",
"timestamp": "12/10/2022 09:42:05",
"content": "hello",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051149822767403100,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 09:54:07",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
6eb58f505e5b47089708f9078aa25400
|
199,982 |
[
{
"id": 1051150074903801900,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 09:55:07",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051152246903144400,
"author_id": 460156195299262460,
"author_name": "m1nato",
"timestamp": "12/10/2022 10:03:45",
"content": "is my understanding correct?",
"attachments": [
{
"id": 1051152246504702000,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051152246504702012/image.png",
"fileName": "image.png",
"fileSizeBytes": 51140
}
],
"mentions": [],
"reference": null
},
{
"id": 1051152249482641500,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 10:03:45",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051152246903144400,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051156023156686800,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 10:18:45",
"content": "@m1nato Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 460156195299262460,
"name": "m1nato",
"discriminator": "7790",
"nickname": "m1nato",
"isBot": false
}
],
"reference": null
},
{
"id": 1051159502176669700,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 10:32:34",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
03a451d11f944cdda8830787a8dadebf
|
199,983 |
[
{
"id": 1051159529565474800,
"author_id": 460156195299262460,
"author_name": "m1nato",
"timestamp": "12/10/2022 10:32:41",
"content": ".reopen",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051159534078533800,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 10:32:42",
"content": "✅",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051163310566953100,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 10:47:42",
"content": "@m1nato Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 460156195299262460,
"name": "m1nato",
"discriminator": "7790",
"nickname": "m1nato",
"isBot": false
}
],
"reference": null
},
{
"id": 1051164308282802200,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 10:51:40",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
f343b5d5d32a4626b9ff6ab89f06d15e
|
199,984 |
[
{
"id": 1051164561111253100,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 10:52:41",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051164684939694100,
"author_id": 870878641339392000,
"author_name": "shaurya",
"timestamp": "12/10/2022 10:53:10",
"content": "i have a question",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051164687192051800,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 10:53:11",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051164684939694100,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051164739893477400,
"author_id": 870878641339392000,
"author_name": "shaurya",
"timestamp": "12/10/2022 10:53:23",
"content": "1/3 * 3 = 1",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051164896332611700,
"author_id": 1010142053474238600,
"author_name": "johanna",
"timestamp": "12/10/2022 10:54:00",
"content": "is that your question ?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051165041468133400,
"author_id": 870878641339392000,
"author_name": "shaurya",
"timestamp": "12/10/2022 10:54:35",
"content": "no",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051165060304732200,
"author_id": 870878641339392000,
"author_name": "shaurya",
"timestamp": "12/10/2022 10:54:40",
"content": "its not complete",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051165106899263500,
"author_id": 870878641339392000,
"author_name": "shaurya",
"timestamp": "12/10/2022 10:54:51",
"content": "1/3 = 0.3 bar",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051165165544026200,
"author_id": 870878641339392000,
"author_name": "shaurya",
"timestamp": "12/10/2022 10:55:05",
"content": "and 0.3 bar * 3 = 0.9 bar",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051165260184301600,
"author_id": 870878641339392000,
"author_name": "shaurya",
"timestamp": "12/10/2022 10:55:27",
"content": "so are 1 and 0.9 bar equal?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051165282271510500,
"author_id": 715875286041886800,
"author_name": "Akise",
"timestamp": "12/10/2022 10:55:33",
"content": "yes",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051165334440267900,
"author_id": 870878641339392000,
"author_name": "shaurya",
"timestamp": "12/10/2022 10:55:45",
"content": "ummm",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051165364228202600,
"author_id": 870878641339392000,
"author_name": "shaurya",
"timestamp": "12/10/2022 10:55:52",
"content": "they look different",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051165381777178600,
"author_id": 870878641339392000,
"author_name": "shaurya",
"timestamp": "12/10/2022 10:55:56",
"content": "dont they?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051165455735324800,
"author_id": 715875286041886800,
"author_name": "Akise",
"timestamp": "12/10/2022 10:56:14",
"content": "if they are not equal, find the difference",
"attachments": [],
"mentions": [
{
"id": 870878641339392000,
"name": "shaurya",
"discriminator": "5314",
"nickname": "shaurya",
"isBot": false
}
],
"reference": null
},
{
"id": 1051165579458920400,
"author_id": 870878641339392000,
"author_name": "shaurya",
"timestamp": "12/10/2022 10:56:43",
"content": "yaa 1 - 0.9 bar should be 0.1 bar?? right",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051165603798462600,
"author_id": 715875286041886800,
"author_name": "Akise",
"timestamp": "12/10/2022 10:56:49",
"content": "no",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051165624119857200,
"author_id": 870878641339392000,
"author_name": "shaurya",
"timestamp": "12/10/2022 10:56:54",
"content": "oh",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051165632915321000,
"author_id": 870878641339392000,
"author_name": "shaurya",
"timestamp": "12/10/2022 10:56:56",
"content": "mb",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051165709444591600,
"author_id": 628449189730320400,
"author_name": "MeatBagFrank",
"timestamp": "12/10/2022 10:57:14",
"content": "No",
"attachments": [],
"mentions": [
{
"id": 870878641339392000,
"name": "shaurya",
"discriminator": "5314",
"nickname": "shaurya",
"isBot": false
}
],
"reference": null
},
{
"id": 1051165845549752400,
"author_id": 318024849333288960,
"author_name": "Mortta",
"timestamp": "12/10/2022 10:57:47",
"content": "0.9 bar = x",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051165859281907700,
"author_id": 318024849333288960,
"author_name": "Mortta",
"timestamp": "12/10/2022 10:57:50",
"content": "10x = 9.9 bar",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051165928521470100,
"author_id": 318024849333288960,
"author_name": "Mortta",
"timestamp": "12/10/2022 10:58:07",
"content": "10x - x = 9x\n9.9 bar - 0.9 bar = 9",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051165934607413400,
"author_id": 318024849333288960,
"author_name": "Mortta",
"timestamp": "12/10/2022 10:58:08",
"content": "9 = 9x",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051165938768154800,
"author_id": 318024849333288960,
"author_name": "Mortta",
"timestamp": "12/10/2022 10:58:09",
"content": "x = 1",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051165974306492500,
"author_id": 870878641339392000,
"author_name": "shaurya",
"timestamp": "12/10/2022 10:58:17",
"content": "oh",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051166001301028900,
"author_id": 870878641339392000,
"author_name": "shaurya",
"timestamp": "12/10/2022 10:58:24",
"content": "i see",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051166044028407900,
"author_id": 870878641339392000,
"author_name": "shaurya",
"timestamp": "12/10/2022 10:58:34",
"content": "great explanation bro",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051166052081479800,
"author_id": 870878641339392000,
"author_name": "shaurya",
"timestamp": "12/10/2022 10:58:36",
"content": "thanks",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051166069395554300,
"author_id": 870878641339392000,
"author_name": "shaurya",
"timestamp": "12/10/2022 10:58:40",
"content": "bye",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051166123321729200,
"author_id": 870878641339392000,
"author_name": "shaurya",
"timestamp": "12/10/2022 10:58:53",
"content": ".close",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051166126010286300,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 10:58:54",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
7eeea9a1cf984821b7f44b353724037b
|
199,985 |
[
{
"id": 1051167213765279900,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 11:03:13",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051167527620845600,
"author_id": 900403687871086700,
"author_name": "CUTE BOTCHES",
"timestamp": "12/10/2022 11:04:28",
"content": "welcome",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051167532318478300,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 11:04:29",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051167527620845600,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051167625360707600,
"author_id": 756743425272840200,
"author_name": "anand",
"timestamp": "12/10/2022 11:04:51",
"content": "Wtf?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051167747570139300,
"author_id": 900403687871086700,
"author_name": "CUTE BOTCHES",
"timestamp": "12/10/2022 11:05:20",
"content": "is this my channel now?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051167768994660400,
"author_id": 750400034394210600,
"author_name": "hel(^_^)lo3018",
"timestamp": "12/10/2022 11:05:25",
"content": "Yup",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051167788678512600,
"author_id": 271637133519880200,
"author_name": "edwardborn",
"timestamp": "12/10/2022 11:05:30",
"content": "gj",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051167856647209100,
"author_id": 900403687871086700,
"author_name": "CUTE BOTCHES",
"timestamp": "12/10/2022 11:05:46",
"content": "ok soooo",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051167888024801400,
"author_id": 900403687871086700,
"author_name": "CUTE BOTCHES",
"timestamp": "12/10/2022 11:05:54",
"content": "goodmorning edward",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051167978802122800,
"author_id": 271637133519880200,
"author_name": "edwardborn",
"timestamp": "12/10/2022 11:06:15",
"content": "Yeah yeah hi botches",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051168060536528900,
"author_id": 271637133519880200,
"author_name": "edwardborn",
"timestamp": "12/10/2022 11:06:35",
"content": "Just post the problem",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051168168732786800,
"author_id": 900403687871086700,
"author_name": "CUTE BOTCHES",
"timestamp": "12/10/2022 11:07:01",
"content": "Ok just took a pic",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051168197648339200,
"author_id": 900403687871086700,
"author_name": "CUTE BOTCHES",
"timestamp": "12/10/2022 11:07:08",
"content": "",
"attachments": [
{
"id": 1051168197354729600,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051168197354729593/IMG_6856.jpg",
"fileName": "IMG_6856.jpg",
"fileSizeBytes": 1630636
}
],
"mentions": [],
"reference": null
},
{
"id": 1051168202211737600,
"author_id": 900403687871086700,
"author_name": "CUTE BOTCHES",
"timestamp": "12/10/2022 11:07:09",
"content": "PLEASE 🥺🥺",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051168253495488500,
"author_id": 900403687871086700,
"author_name": "CUTE BOTCHES",
"timestamp": "12/10/2022 11:07:21",
"content": "Wait",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051168280955596800,
"author_id": 900403687871086700,
"author_name": "CUTE BOTCHES",
"timestamp": "12/10/2022 11:07:27",
"content": "It’s not straight",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051168293194584200,
"author_id": 900403687871086700,
"author_name": "CUTE BOTCHES",
"timestamp": "12/10/2022 11:07:30",
"content": "HAHAHA",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051168295279149000,
"author_id": 271637133519880200,
"author_name": "edwardborn",
"timestamp": "12/10/2022 11:07:31",
"content": "Omg i remember you now",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051168322584060000,
"author_id": 271637133519880200,
"author_name": "edwardborn",
"timestamp": "12/10/2022 11:07:37",
"content": "You're that Greek guy",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051168362572566700,
"author_id": 900403687871086700,
"author_name": "CUTE BOTCHES",
"timestamp": "12/10/2022 11:07:47",
"content": "huh",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051168373330944000,
"author_id": 1001332337423949800,
"author_name": "asakura_akio",
"timestamp": "12/10/2022 11:07:49",
"content": ",rotate",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051168380176052400,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "12/10/2022 11:07:51",
"content": "",
"attachments": [
{
"id": 1051168379689504800,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051168379689504788/1001332337423949855.png",
"fileName": "1001332337423949855.png",
"fileSizeBytes": 1569277
}
],
"mentions": [],
"reference": null
},
{
"id": 1051168398672924800,
"author_id": 900403687871086700,
"author_name": "CUTE BOTCHES",
"timestamp": "12/10/2022 11:07:56",
"content": "YES",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051168417224331300,
"author_id": 900403687871086700,
"author_name": "CUTE BOTCHES",
"timestamp": "12/10/2022 11:08:00",
"content": "do",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051168442721505400,
"author_id": 900403687871086700,
"author_name": "CUTE BOTCHES",
"timestamp": "12/10/2022 11:08:06",
"content": "GO!!!!!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051168473901965400,
"author_id": 900403687871086700,
"author_name": "CUTE BOTCHES",
"timestamp": "12/10/2022 11:08:13",
"content": "and then ill send more",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051168479958536300,
"author_id": 1001332337423949800,
"author_name": "asakura_akio",
"timestamp": "12/10/2022 11:08:15",
"content": "not me",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051168504755261400,
"author_id": 900403687871086700,
"author_name": "CUTE BOTCHES",
"timestamp": "12/10/2022 11:08:21",
"content": "because i have more",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051168751879459000,
"author_id": 900403687871086700,
"author_name": "CUTE BOTCHES",
"timestamp": "12/10/2022 11:09:20",
"content": "@edwardborn ahh you are so smart",
"attachments": [],
"mentions": [
{
"id": 271637133519880200,
"name": "edwardborn",
"discriminator": "1999",
"nickname": "edwardborn",
"isBot": false
}
],
"reference": null
},
{
"id": 1051169038824386700,
"author_id": 900403687871086700,
"author_name": "CUTE BOTCHES",
"timestamp": "12/10/2022 11:10:28",
"content": "are YOU DOING IT NOW",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051169072856965100,
"author_id": 900403687871086700,
"author_name": "CUTE BOTCHES",
"timestamp": "12/10/2022 11:10:36",
"content": "OR IM JUST WAITING HERE",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051169186602291300,
"author_id": 271637133519880200,
"author_name": "edwardborn",
"timestamp": "12/10/2022 11:11:03",
"content": ":KermitDrinking:",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051169208068755600,
"author_id": 1001332337423949800,
"author_name": "asakura_akio",
"timestamp": "12/10/2022 11:11:08",
"content": "you're just waiting here",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051169230114013200,
"author_id": 900403687871086700,
"author_name": "CUTE BOTCHES",
"timestamp": "12/10/2022 11:11:14",
"content": "NOOOOO",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051169255472767100,
"author_id": 900403687871086700,
"author_name": "CUTE BOTCHES",
"timestamp": "12/10/2022 11:11:20",
"content": "NO EDWARD",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051169276297498800,
"author_id": 900403687871086700,
"author_name": "CUTE BOTCHES",
"timestamp": "12/10/2022 11:11:25",
"content": "EDWARD!!!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051169299038998700,
"author_id": 900403687871086700,
"author_name": "CUTE BOTCHES",
"timestamp": "12/10/2022 11:11:30",
"content": "IM DEPRESSED",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051169305015890000,
"author_id": 271637133519880200,
"author_name": "edwardborn",
"timestamp": "12/10/2022 11:11:32",
"content": "Ok fine",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051169352352792600,
"author_id": 900403687871086700,
"author_name": "CUTE BOTCHES",
"timestamp": "12/10/2022 11:11:43",
"content": "IM DEPRESSED AND I CRY ALL DAY",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051169386871922800,
"author_id": 271637133519880200,
"author_name": "edwardborn",
"timestamp": "12/10/2022 11:11:51",
"content": "Calm down botches",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051169389644361700,
"author_id": 900403687871086700,
"author_name": "CUTE BOTCHES",
"timestamp": "12/10/2022 11:11:52",
"content": "IM CRYING RIGHT NOW",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051169398171373600,
"author_id": 900403687871086700,
"author_name": "CUTE BOTCHES",
"timestamp": "12/10/2022 11:11:54",
"content": "PLEASE",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051169532145840100,
"author_id": 900403687871086700,
"author_name": "CUTE BOTCHES",
"timestamp": "12/10/2022 11:12:26",
"content": "I just want to go to my old dance class but I’m scared 😭😭😭😭",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051169547174031500,
"author_id": 271637133519880200,
"author_name": "edwardborn",
"timestamp": "12/10/2022 11:12:29",
"content": "I'm guessing what they want you to do is find the common denominator or whatever it's called and simplify the expression",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051169579885400200,
"author_id": 900403687871086700,
"author_name": "CUTE BOTCHES",
"timestamp": "12/10/2022 11:12:37",
"content": "YES!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051169651641569400,
"author_id": 271637133519880200,
"author_name": "edwardborn",
"timestamp": "12/10/2022 11:12:54",
"content": "I have no idea why they're calling that \"solve the equation\"",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051169724064612400,
"author_id": 715875286041886800,
"author_name": "Akise",
"timestamp": "12/10/2022 11:13:12",
"content": "watch Khan Academy for this stuff",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051169726828658700,
"author_id": 900403687871086700,
"author_name": "CUTE BOTCHES",
"timestamp": "12/10/2022 11:13:12",
"content": "That’s it",
"attachments": [],
"mentions": [
{
"id": 271637133519880200,
"name": "edwardborn",
"discriminator": "1999",
"nickname": "edwardborn",
"isBot": false
}
],
"reference": null
},
{
"id": 1051169767492440200,
"author_id": 900403687871086700,
"author_name": "CUTE BOTCHES",
"timestamp": "12/10/2022 11:13:22",
"content": "You got it",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051169861671342100,
"author_id": 715875286041886800,
"author_name": "Akise",
"timestamp": "12/10/2022 11:13:44",
"content": "also 4y^2-1 =(2y+1)(2y-1)",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051169895586463900,
"author_id": 1001332337423949800,
"author_name": "asakura_akio",
"timestamp": "12/10/2022 11:13:52",
"content": "this is so funny",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051170147567677400,
"author_id": 900403687871086700,
"author_name": "CUTE BOTCHES",
"timestamp": "12/10/2022 11:14:52",
"content": "omh",
"attachments": [],
"mentions": [
{
"id": 715875286041886800,
"name": "Akise",
"discriminator": "5460",
"nickname": "Akise",
"isBot": false
}
],
"reference": null
},
{
"id": 1051170162096738300,
"author_id": 900403687871086700,
"author_name": "CUTE BOTCHES",
"timestamp": "12/10/2022 11:14:56",
"content": "OMGGGG",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051170179897360500,
"author_id": 900403687871086700,
"author_name": "CUTE BOTCHES",
"timestamp": "12/10/2022 11:15:00",
"content": "RIGHT",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051170223270674400,
"author_id": 900403687871086700,
"author_name": "CUTE BOTCHES",
"timestamp": "12/10/2022 11:15:11",
"content": "RIIIIIIIIIIIIIIIIIIGHHHHHHHHHHHT",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051170265989656600,
"author_id": 900403687871086700,
"author_name": "CUTE BOTCHES",
"timestamp": "12/10/2022 11:15:21",
"content": "you know edward",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051170316342280300,
"author_id": 900403687871086700,
"author_name": "CUTE BOTCHES",
"timestamp": "12/10/2022 11:15:33",
"content": "im smart",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051170342070124500,
"author_id": 271637133519880200,
"author_name": "edwardborn",
"timestamp": "12/10/2022 11:15:39",
"content": "Yeah you are",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051170385430855800,
"author_id": 715875286041886800,
"author_name": "Akise",
"timestamp": "12/10/2022 11:15:49",
"content": "who tf is edward",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051170392355655800,
"author_id": 900403687871086700,
"author_name": "CUTE BOTCHES",
"timestamp": "12/10/2022 11:15:51",
"content": "but i hate my pick me classmate",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051170404955328500,
"author_id": 271637133519880200,
"author_name": "edwardborn",
"timestamp": "12/10/2022 11:15:54",
"content": "Thank god for that. I'm kind of busy anyway",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051170408663093200,
"author_id": 715875286041886800,
"author_name": "Akise",
"timestamp": "12/10/2022 11:15:55",
"content": "oh this guy",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051170440678211700,
"author_id": 900403687871086700,
"author_name": "CUTE BOTCHES",
"timestamp": "12/10/2022 11:16:02",
"content": "she got 10 and i got 9.25 on the test",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051170510333030500,
"author_id": 900403687871086700,
"author_name": "CUTE BOTCHES",
"timestamp": "12/10/2022 11:16:19",
"content": "IM M JEALOUS",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051170536639701100,
"author_id": 900403687871086700,
"author_name": "CUTE BOTCHES",
"timestamp": "12/10/2022 11:16:25",
"content": "TELL ME WHAT TO DO EDWARD",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051170595540324500,
"author_id": 900403687871086700,
"author_name": "CUTE BOTCHES",
"timestamp": "12/10/2022 11:16:39",
"content": "TELL ME",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051170628486578200,
"author_id": 900403687871086700,
"author_name": "CUTE BOTCHES",
"timestamp": "12/10/2022 11:16:47",
"content": "IM RYING HARDER NOW",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051170655795675300,
"author_id": 900403687871086700,
"author_name": "CUTE BOTCHES",
"timestamp": "12/10/2022 11:16:54",
"content": "IM ANGRY",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051170661378297900,
"author_id": 271637133519880200,
"author_name": "edwardborn",
"timestamp": "12/10/2022 11:16:55",
"content": "Didn't you just have an eureka moment?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051170702335672400,
"author_id": 900403687871086700,
"author_name": "CUTE BOTCHES",
"timestamp": "12/10/2022 11:17:05",
"content": "you know",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051170803892375700,
"author_id": 900403687871086700,
"author_name": "CUTE BOTCHES",
"timestamp": "12/10/2022 11:17:29",
"content": "i hate my scored and i want to go to my old dance class but im embarassed",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051170837878816800,
"author_id": 900403687871086700,
"author_name": "CUTE BOTCHES",
"timestamp": "12/10/2022 11:17:37",
"content": "PLEASE TELL ME WHAT TO DO",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051170859668217900,
"author_id": 271637133519880200,
"author_name": "edwardborn",
"timestamp": "12/10/2022 11:17:42",
"content": "What do you gotta multiply 2y/(2y + 1) with to get an identical denominator as this?",
"attachments": [],
"mentions": [
{
"id": 715875286041886800,
"name": "Akise",
"discriminator": "5460",
"nickname": "Akise",
"isBot": false
}
],
"reference": null
},
{
"id": 1051170880920756200,
"author_id": 900403687871086700,
"author_name": "CUTE BOTCHES",
"timestamp": "12/10/2022 11:17:47",
"content": "",
"attachments": [
{
"id": 1051170880539082800,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051170880539082782/6A41439C-33CB-479C-AEA5-E81CD932526A.mp4",
"fileName": "6A41439C-33CB-479C-AEA5-E81CD932526A.mp4",
"fileSizeBytes": 5165690
}
],
"mentions": [],
"reference": null
},
{
"id": 1051170909370716200,
"author_id": 900403687871086700,
"author_name": "CUTE BOTCHES",
"timestamp": "12/10/2022 11:17:54",
"content": "this was me 😭😭😭😭",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051170933391507500,
"author_id": 271637133519880200,
"author_name": "edwardborn",
"timestamp": "12/10/2022 11:18:00",
"content": "(Sorry for ping)",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051171108788899800,
"author_id": 900403687871086700,
"author_name": "CUTE BOTCHES",
"timestamp": "12/10/2022 11:18:42",
"content": "😭😭😭😭😭😭😭",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051174884652355700,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 11:33:42",
"content": "@CUTE BOTCHES Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 900403687871086700,
"name": "CUTE BOTCHES",
"discriminator": "5514",
"nickname": "CUTE BOTCHES",
"isBot": false
}
],
"reference": null
},
{
"id": 1051178661518262400,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 11:48:42",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
e295beb35ddf447ba96c60c9becf2dea
|
199,986 |
[
{
"id": 1051198342870339600,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 13:06:55",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051199754798895200,
"author_id": 480366337290403840,
"author_name": "Magnus",
"timestamp": "12/10/2022 13:12:31",
"content": "If I draw any bridge hand, what is the probability that at least 1 suit is missing?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051199757080596500,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 13:12:32",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051199754798895200,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051199761560113200,
"author_id": 480366337290403840,
"author_name": "Magnus",
"timestamp": "12/10/2022 13:12:33",
"content": "Any help?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051199853314703600,
"author_id": 480366337290403840,
"author_name": "Magnus",
"timestamp": "12/10/2022 13:12:55",
"content": "Is this a bernouli or a binomial distribution?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051201067066589300,
"author_id": 480366337290403840,
"author_name": "Magnus",
"timestamp": "12/10/2022 13:17:44",
"content": ",tex $X \\sim B(1,\\frac{3}{4}) $",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051201071860682900,
"author_id": 480366337290403840,
"author_name": "Magnus",
"timestamp": "12/10/2022 13:17:45",
"content": "?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051201078567375000,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "12/10/2022 13:17:47",
"content": "**Magnus**",
"attachments": [
{
"id": 1051201078647083000,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051201078647083008/480366337290403860.png",
"fileName": "480366337290403860.png",
"fileSizeBytes": 7152
}
],
"mentions": [],
"reference": null
},
{
"id": 1051201266631594100,
"author_id": 480366337290403840,
"author_name": "Magnus",
"timestamp": "12/10/2022 13:18:32",
"content": ",tex Isn't the chance then $\\frac{3}{4} = 75\\%$?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051201367546531800,
"author_id": 133064107380310020,
"author_name": "llspacebarll",
"timestamp": "12/10/2022 13:18:56",
"content": "what is a bridge hand?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051201373988986900,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 13:18:57",
"content": "with bridge hand its the cards right?",
"attachments": [],
"mentions": [
{
"id": 480366337290403840,
"name": "Magnus",
"discriminator": "7088",
"nickname": "Magnus",
"isBot": false
}
],
"reference": null
},
{
"id": 1051201377612865500,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "12/10/2022 13:18:58",
"content": "**Magnus**",
"attachments": [
{
"id": 1051201377654800500,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051201377654800505/480366337290403860.png",
"fileName": "480366337290403860.png",
"fileSizeBytes": 11349
}
],
"mentions": [],
"reference": null
},
{
"id": 1051201434105946200,
"author_id": 480366337290403840,
"author_name": "Magnus",
"timestamp": "12/10/2022 13:19:12",
"content": "bridge hand is 13 cards of a standard deck",
"attachments": [],
"mentions": [
{
"id": 266573406919589900,
"name": "Jigglyproff",
"discriminator": "4511",
"nickname": "Jigglyproff",
"isBot": false
}
],
"reference": null
},
{
"id": 1051201510358396900,
"author_id": 480366337290403840,
"author_name": "Magnus",
"timestamp": "12/10/2022 13:19:30",
"content": "so just random 13 cards i guess",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051201637580017700,
"author_id": 480366337290403840,
"author_name": "Magnus",
"timestamp": "12/10/2022 13:20:00",
"content": "and it asks if i draw a bridgehand (13 random cards), then whats the chance at least one suit will be missing",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051201651685462100,
"author_id": 133064107380310020,
"author_name": "llspacebarll",
"timestamp": "12/10/2022 13:20:04",
"content": "isnt it hypergeometric?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051201702520422400,
"author_id": 133064107380310020,
"author_name": "llspacebarll",
"timestamp": "12/10/2022 13:20:16",
"content": "cause you have to succeed 13 times in not getting a certain suit",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051201726818029700,
"author_id": 480366337290403840,
"author_name": "Magnus",
"timestamp": "12/10/2022 13:20:22",
"content": "i dont know what that is",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051201731746349000,
"author_id": 133064107380310020,
"author_name": "llspacebarll",
"timestamp": "12/10/2022 13:20:23",
"content": "i dont know if it would be binomial",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051201821521215500,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 13:20:44",
"content": "its also binomal lol",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051201839384768600,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 13:20:48",
"content": "chance to hit or not to hit",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051201882401542300,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 13:20:59",
"content": "2 paths each point",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051201958159077500,
"author_id": 480366337290403840,
"author_name": "Magnus",
"timestamp": "12/10/2022 13:21:17",
"content": "binomial with one trial, because it doesnt draw one card at a time but 13 cards at once i think",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051202230734291000,
"author_id": 480366337290403840,
"author_name": "Magnus",
"timestamp": "12/10/2022 13:22:22",
"content": "and then the chance to succeed (at least one suit missing) is at least 3/4 right?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051202349407944700,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 13:22:50",
"content": "how did you calculate that",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051202358467629000,
"author_id": 480366337290403840,
"author_name": "Magnus",
"timestamp": "12/10/2022 13:22:52",
"content": "i dont know, the question is just so confusing to me",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051202521563144200,
"author_id": 480366337290403840,
"author_name": "Magnus",
"timestamp": "12/10/2022 13:23:31",
"content": ",tex $\\mathbb{P}(X \\ge 3/4)$",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051202545550364700,
"author_id": 480366337290403840,
"author_name": "Magnus",
"timestamp": "12/10/2022 13:23:37",
"content": "idk",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051202575875182600,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 13:23:44",
"content": "thats for one card doe",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051202584725180400,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "12/10/2022 13:23:46",
"content": "**Magnus**",
"attachments": [
{
"id": 1051202584809050100,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051202584809050132/480366337290403860.png",
"fileName": "480366337290403860.png",
"fileSizeBytes": 6414
}
],
"mentions": [],
"reference": null
},
{
"id": 1051202621567930400,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 13:23:55",
"content": "you said yourself you want to draw 13 cards at once",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051202785699434500,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 13:24:34",
"content": "is standart deck 32 or 64?",
"attachments": [],
"mentions": [
{
"id": 480366337290403840,
"name": "Magnus",
"discriminator": "7088",
"nickname": "Magnus",
"isBot": false
}
],
"reference": null
},
{
"id": 1051202906797383700,
"author_id": 480366337290403840,
"author_name": "Magnus",
"timestamp": "12/10/2022 13:25:03",
"content": "\"A deck consists of 52 cards in 4 suits. A bridge hand consists of 13 cards from such a deck. If I draw any bridge hand, what is the probability that at least 1 suit is missing?\"",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051202926162481300,
"author_id": 480366337290403840,
"author_name": "Magnus",
"timestamp": "12/10/2022 13:25:08",
"content": "thats the full question",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051202975898546200,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 13:25:19",
"content": "that would've been extremely helpful from the start",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051203193457094800,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 13:26:11",
"content": "so either find\nP(suit not drawn in 13) or P(full set of a suit in remainder of deck)",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051203280807657500,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 13:26:32",
"content": "the first is vastly easier",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051203478011252900,
"author_id": 480366337290403840,
"author_name": "Magnus",
"timestamp": "12/10/2022 13:27:19",
"content": "yeah, but thats the problem, i dont know how to find it",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051203668562686100,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 13:28:05",
"content": "52/4 is 13\nso a suit is 13 cards big\nlets say I want to check 'can I draw 2 cards without a specific suit' how would that look like?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051203916840325100,
"author_id": 480366337290403840,
"author_name": "Magnus",
"timestamp": "12/10/2022 13:29:04",
"content": "without a specific suit you mean when 2 cards have different suits?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051204036822577300,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 13:29:32",
"content": "no",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051204163167584400,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 13:30:02",
"content": "when I want to check if from 52 objects and I draw 2, whats the chance I have one of 13 specific ones in the drawn ones",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051204257564598300,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 13:30:25",
"content": "like",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051204372161372300,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 13:30:52",
"content": "I draw 2 cards from 52, whats the chance I have not even one 'hearts' card",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051204541208613000,
"author_id": 480366337290403840,
"author_name": "Magnus",
"timestamp": "12/10/2022 13:31:33",
"content": "oh",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051204798227153000,
"author_id": 480366337290403840,
"author_name": "Magnus",
"timestamp": "12/10/2022 13:32:34",
"content": "i dont know, getting a hearts card is 1/4 and its complement is 3/4 so 3/4?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051204844431622300,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 13:32:45",
"content": "for THE first draw right?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051204871094808600,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 13:32:51",
"content": "because afterwards you have 51 cards left",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051204908067602600,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 13:33:00",
"content": "and 13/51 is not 1/4",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051204950295838700,
"author_id": 480366337290403840,
"author_name": "Magnus",
"timestamp": "12/10/2022 13:33:10",
"content": "oh",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051204953974247600,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 13:33:11",
"content": "or 12/51",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051204975977578500,
"author_id": 480366337290403840,
"author_name": "Magnus",
"timestamp": "12/10/2022 13:33:16",
"content": "yeah right so its without replacement",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051204990213034100,
"author_id": 480366337290403840,
"author_name": "Magnus",
"timestamp": "12/10/2022 13:33:20",
"content": "so its binomial with",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051205061520396400,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 13:33:37",
"content": "yeah thats what I wanted you to find out",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051205109566148600,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 13:33:48",
"content": "back to the task",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051205344510087300,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 13:34:44",
"content": "how could you write P('didnt draw hearts in 13')",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051205906488099000,
"author_id": 480366337290403840,
"author_name": "Magnus",
"timestamp": "12/10/2022 13:36:58",
"content": "i dont know",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051205972829405200,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 13:37:14",
"content": "bruh",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051206030022955100,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 13:37:28",
"content": "ok so lets do it with 2 draws again",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051206060389716000,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 13:37:35",
"content": "how could you write P('didnt draw hearts in 2')",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051206263800877200,
"author_id": 480366337290403840,
"author_name": "Magnus",
"timestamp": "12/10/2022 13:38:23",
"content": "i dont know either",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051206420210659300,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 13:39:01",
"content": "draw it as a path",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051206436362915800,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 13:39:04",
"content": "its 4 lines",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051206878937481200,
"author_id": 480366337290403840,
"author_name": "Magnus",
"timestamp": "12/10/2022 13:40:50",
"content": ",tex $\\mathbb{P}(X=1/8)$",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051206889398091800,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "12/10/2022 13:40:52",
"content": "**Magnus**",
"attachments": [
{
"id": 1051206889456808000,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051206889456807976/480366337290403860.png",
"fileName": "480366337290403860.png",
"fileSizeBytes": 5890
}
],
"mentions": [],
"reference": null
},
{
"id": 1051206894494175200,
"author_id": 480366337290403840,
"author_name": "Magnus",
"timestamp": "12/10/2022 13:40:54",
"content": "?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051207077667799200,
"author_id": 480366337290403840,
"author_name": "Magnus",
"timestamp": "12/10/2022 13:41:37",
"content": "wait",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051207179291607200,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 13:42:02",
"content": "but how",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051207269691424900,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 13:42:23",
"content": "first you want to hit 39/52 cards, then you want to hit 38/51 cards",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051207952922595500,
"author_id": 480366337290403840,
"author_name": "Magnus",
"timestamp": "12/10/2022 13:45:06",
"content": ",tex $\\mathbb{P}(X=494/867)$?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051207961898389500,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "12/10/2022 13:45:08",
"content": "**Magnus**",
"attachments": [
{
"id": 1051207961944522900,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051207961944522853/480366337290403860.png",
"fileName": "480366337290403860.png",
"fileSizeBytes": 8131
}
],
"mentions": [],
"reference": null
},
{
"id": 1051207978394599400,
"author_id": 480366337290403840,
"author_name": "Magnus",
"timestamp": "12/10/2022 13:45:12",
"content": "because 39/52*38/51?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051208056458981400,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 13:45:31",
"content": "yes",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051208136465317900,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 13:45:50",
"content": "so what is that as a binomal?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051208822095610000,
"author_id": 480366337290403840,
"author_name": "Magnus",
"timestamp": "12/10/2022 13:48:33",
"content": "whats p here tho",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051208903473504400,
"author_id": 480366337290403840,
"author_name": "Magnus",
"timestamp": "12/10/2022 13:48:53",
"content": "n is 13",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051208927578181600,
"author_id": 480366337290403840,
"author_name": "Magnus",
"timestamp": "12/10/2022 13:48:58",
"content": "k = 494/867",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051208956032340000,
"author_id": 480366337290403840,
"author_name": "Magnus",
"timestamp": "12/10/2022 13:49:05",
"content": "whats p, 1/4?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051209125402521600,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 13:49:46",
"content": "where that k from doe",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051209162605985800,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 13:49:54",
"content": "I mean you just did it",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051209533881581600,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 13:51:23",
"content": "$\\frac{39!}{2!\\times (39-2)!}$ is the numeral\\\\\n\n$\\frac{52!}{2!\\times (52-2)!}$ is the denominator",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051209595353313300,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "12/10/2022 13:51:38",
"content": "**Jigglyproff**",
"attachments": [
{
"id": 1051209595495915500,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051209595495915571/266573406919589888.png",
"fileName": "266573406919589888.png",
"fileSizeBytes": 25688
}
],
"mentions": [],
"reference": null
},
{
"id": 1051209710826696800,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 13:52:05",
"content": "what I wrote above is the same as\\\\\n$39\\times 38$\\\\",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051209720918200300,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "12/10/2022 13:52:07",
"content": "**Jigglyproff**",
"attachments": [
{
"id": 1051209720993677300,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051209720993677322/266573406919589888.png",
"fileName": "266573406919589888.png",
"fileSizeBytes": 14567
}
],
"mentions": [],
"reference": null
},
{
"id": 1051209743735201800,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 13:52:13",
"content": "and\n$52\\times 51$",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051209754229358600,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "12/10/2022 13:52:15",
"content": "**Jigglyproff**",
"attachments": [
{
"id": 1051209754011242600,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051209754011242607/266573406919589888.png",
"fileName": "266573406919589888.png",
"fileSizeBytes": 5081
}
],
"mentions": [],
"reference": null
},
{
"id": 1051209815227109400,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 13:52:30",
"content": "now you just have to put something else for the 2 to get the results of your task",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051209915433226200,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 13:52:54",
"content": "or do you want to have more explained how those binomals work?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051210121918820500,
"author_id": 480366337290403840,
"author_name": "Magnus",
"timestamp": "12/10/2022 13:53:43",
"content": ",tex this is the formula $\\binom{n}{k} \\cdot p^k \\cdot q^{n-k}$",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051210156274364500,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "12/10/2022 13:53:51",
"content": "**Magnus**",
"attachments": [
{
"id": 1051210156408586200,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051210156408586300/480366337290403860.png",
"fileName": "480366337290403860.png",
"fileSizeBytes": 15608
}
],
"mentions": [],
"reference": null
},
{
"id": 1051210195478523900,
"author_id": 480366337290403840,
"author_name": "Magnus",
"timestamp": "12/10/2022 13:54:01",
"content": "n is number of experiments/trials",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051210212465459300,
"author_id": 480366337290403840,
"author_name": "Magnus",
"timestamp": "12/10/2022 13:54:05",
"content": "which is 13 right?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051210238361079800,
"author_id": 480366337290403840,
"author_name": "Magnus",
"timestamp": "12/10/2022 13:54:11",
"content": "because were drawing 13",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051210334465171600,
"author_id": 480366337290403840,
"author_name": "Magnus",
"timestamp": "12/10/2022 13:54:34",
"content": "then k is that number inside the big P",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051210361589739500,
"author_id": 480366337290403840,
"author_name": "Magnus",
"timestamp": "12/10/2022 13:54:40",
"content": "494/867",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051210396834472100,
"author_id": 480366337290403840,
"author_name": "Magnus",
"timestamp": "12/10/2022 13:54:49",
"content": "i dont know what p is",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051210410650521600,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 13:54:52",
"content": "wait what",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051210435065548900,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 13:54:58",
"content": "where did that formula spawn from",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051210472529076400,
"author_id": 480366337290403840,
"author_name": "Magnus",
"timestamp": "12/10/2022 13:55:07",
"content": "binomial distribution?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051210506154815600,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 13:55:15",
"content": "so true",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051210531320635400,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 13:55:21",
"content": "but is p constant?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051210572298985600,
"author_id": 480366337290403840,
"author_name": "Magnus",
"timestamp": "12/10/2022 13:55:30",
"content": "yeah",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051210586727383000,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 13:55:34",
"content": "?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051210608059621400,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 13:55:39",
"content": "are you sure?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051210647544811500,
"author_id": 480366337290403840,
"author_name": "Magnus",
"timestamp": "12/10/2022 13:55:48",
"content": "no",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051210744462590100,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 13:56:12",
"content": "",
"attachments": [
{
"id": 1051210744085090400,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051210744085090435/image.png",
"fileName": "image.png",
"fileSizeBytes": 15402
}
],
"mentions": [],
"reference": null
},
{
"id": 1051210781611536500,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 13:56:20",
"content": "especially the last is critical here",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051210892685086700,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 13:56:47",
"content": "you already found out, after the first draw, the chance to not get hearts is no longer 1/4th",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051210959450026000,
"author_id": 480366337290403840,
"author_name": "Magnus",
"timestamp": "12/10/2022 13:57:03",
"content": "what am i supposed to do then?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051211034481938600,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 13:57:21",
"content": "you know what that $\\binom{n}{k}$ does?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051211044179148900,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "12/10/2022 13:57:23",
"content": "**Jigglyproff**",
"attachments": [
{
"id": 1051211044246266000,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051211044246265977/266573406919589888.png",
"fileName": "266573406919589888.png",
"fileSizeBytes": 14634
}
],
"mentions": [],
"reference": null
},
{
"id": 1051211083781779600,
"author_id": 480366337290403840,
"author_name": "Magnus",
"timestamp": "12/10/2022 13:57:32",
"content": "yeah, its a combination",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051211098088538200,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 13:57:36",
"content": "yes",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051211112009437200,
"author_id": 480366337290403840,
"author_name": "Magnus",
"timestamp": "12/10/2022 13:57:39",
"content": "n!/k!(n-k)!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051211215675867100,
"author_id": 480366337290403840,
"author_name": "Magnus",
"timestamp": "12/10/2022 13:58:04",
"content": "what distribution are we talking about here then if its not equiprobable",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051211435486740500,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 13:58:56",
"content": "your chance in the end is a fraction of combinations:\\\\\n$\\frac{ways to draw 13 out of 39}{ways to draw 13 out of 52}$",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051211446425493500,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "12/10/2022 13:58:59",
"content": "**Jigglyproff**",
"attachments": [
{
"id": 1051211446547124400,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051211446547124314/266573406919589888.png",
"fileName": "266573406919589888.png",
"fileSizeBytes": 36181
}
],
"mentions": [],
"reference": null
},
{
"id": 1051211674755023100,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 13:59:53",
"content": "that is the probability to draw 13 cards in 52 without ONE specific suit",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051211697500717200,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 13:59:59",
"content": "do you get that so far?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051211783664320600,
"author_id": 480366337290403840,
"author_name": "Magnus",
"timestamp": "12/10/2022 14:00:19",
"content": "not really",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051211960923984000,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 14:01:02",
"content": "okay",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051212108915822700,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 14:01:37",
"content": "so before we had the example of 'draw 2 without drawing hearts, out of 52 total cards, no putting back. the amount of hearts inside that deck is 13'",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051212244135972900,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 14:02:09",
"content": "we calculated the chance to be\n$\\frac{39\\times 38}{52\\times 51}$",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051212315464310900,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "12/10/2022 14:02:26",
"content": "**Jigglyproff**",
"attachments": [
{
"id": 1051212314956808300,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051212314956808373/266573406919589888.png",
"fileName": "266573406919589888.png",
"fileSizeBytes": 16723
}
],
"mentions": [],
"reference": null
},
{
"id": 1051212447249346700,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 14:02:58",
"content": "how could you write the numeral and denominator for big numbers?\nI mean, its basically a\\*(a-1)\\*(a-2)....",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051212970178392200,
"author_id": 480366337290403840,
"author_name": "Magnus",
"timestamp": "12/10/2022 14:05:02",
"content": ",tex $\\frac{\\binom{39}{13}}{\\binom{52}{13}}$",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051213154526445700,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 14:05:46",
"content": "the numeral for example is 39x38",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051213223409496000,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 14:06:03",
"content": "yeah more like it",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051213246260064400,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "12/10/2022 14:06:08",
"content": "**Magnus**",
"attachments": [
{
"id": 1051213246041952300,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051213246041952276/480366337290403860.png",
"fileName": "480366337290403860.png",
"fileSizeBytes": 9682
}
],
"mentions": [],
"reference": null
},
{
"id": 1051213303877222500,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 14:06:22",
"content": "thats 90% of the solution to your problem",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051213323607228500,
"author_id": 480366337290403840,
"author_name": "Magnus",
"timestamp": "12/10/2022 14:06:26",
"content": "i dont get why we have to divide it",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051213349196665000,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 14:06:33",
"content": "mhm?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051213394419663000,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 14:06:43",
"content": "because binomals give the amount of possibilities, not a chance",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051213407975641200,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 14:06:47",
"content": "like",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051213451059531900,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 14:06:57",
"content": "its the 'ways to draw x out of n'",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051213473964642400,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 14:07:02",
"content": "not the chance to do so",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051213489986875500,
"author_id": 480366337290403840,
"author_name": "Magnus",
"timestamp": "12/10/2022 14:07:06",
"content": "yeah",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051213548128309400,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 14:07:20",
"content": "so, we have to divide the WANTED binomal with the TOTAL binomal",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051213597130367000,
"author_id": 480366337290403840,
"author_name": "Magnus",
"timestamp": "12/10/2022 14:07:32",
"content": "oh",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051213656572043300,
"author_id": 480366337290403840,
"author_name": "Magnus",
"timestamp": "12/10/2022 14:07:46",
"content": "now i get it",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051213668748116000,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 14:07:49",
"content": "nice",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051213687567953900,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 14:07:53",
"content": "but there is one thing missing now",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051213719838920700,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 14:08:01",
"content": "thats just the chance not to hit hearts",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051213737836683400,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 14:08:05",
"content": "but there are 4 kinds of suits",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051214656930324500,
"author_id": 480366337290403840,
"author_name": "Magnus",
"timestamp": "12/10/2022 14:11:44",
"content": ",tex $\\frac{\\binom{39}{13}+\\binom{26}{13}+\\binom{13}{13}}{\\binom{52}{13}}$",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051214666191339600,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "12/10/2022 14:11:47",
"content": "**Magnus**",
"attachments": [
{
"id": 1051214666258464900,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051214666258464859/480366337290403860.png",
"fileName": "480366337290403860.png",
"fileSizeBytes": 11594
}
],
"mentions": [],
"reference": null
},
{
"id": 1051214779248808000,
"author_id": 480366337290403840,
"author_name": "Magnus",
"timestamp": "12/10/2022 14:12:13",
"content": "there must be at least one suit missing",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051215859990929400,
"author_id": 480366337290403840,
"author_name": "Magnus",
"timestamp": "12/10/2022 14:16:31",
"content": "@Jigglyproff",
"attachments": [],
"mentions": [
{
"id": 266573406919589900,
"name": "Jigglyproff",
"discriminator": "4511",
"nickname": "Jigglyproff",
"isBot": false
}
],
"reference": null
},
{
"id": 1051219635850199200,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 14:31:31",
"content": "@Magnus Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 480366337290403840,
"name": "Magnus",
"discriminator": "7088",
"nickname": "Magnus",
"isBot": false
}
],
"reference": null
},
{
"id": 1051220466464985100,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 14:34:49",
"content": "what the fuck",
"attachments": [],
"mentions": [
{
"id": 510789298321096700,
"name": "TeXit",
"discriminator": "0796",
"nickname": "TeXit",
"isBot": true
}
],
"reference": null
},
{
"id": 1051220491865698300,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 14:34:55",
"content": "yo",
"attachments": [],
"mentions": [
{
"id": 480366337290403840,
"name": "Magnus",
"discriminator": "7088",
"nickname": "Magnus",
"isBot": false
}
],
"reference": null
},
{
"id": 1051220506986164400,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 14:34:59",
"content": "thats straight up not it",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051220544579702900,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 14:35:08",
"content": "the other suits are all 13 out of 39 too",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051220573356839000,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 14:35:15",
"content": "you just had to multiply the result by 4",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051220577379172400,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 14:35:16",
"content": "xd",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051220668064215300,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 14:35:38",
"content": "like",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051220780811292800,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 14:36:04",
"content": "you have the chance for 1 suit not being inside 13 cards\nso 4 times that is the chance for 1 of 4 suits not being inside 13 cards",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051227325838147700,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 15:02:05",
"content": "@Magnus Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 480366337290403840,
"name": "Magnus",
"discriminator": "7088",
"nickname": "Magnus",
"isBot": false
}
],
"reference": null
},
{
"id": 1051227566607970300,
"author_id": 480366337290403840,
"author_name": "Magnus",
"timestamp": "12/10/2022 15:03:02",
"content": "https://math.stackexchange.com/questions/3369586/draw-13-cards-out-of-52-with-one-suit-missing",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051227826130526300,
"author_id": 480366337290403840,
"author_name": "Magnus",
"timestamp": "12/10/2022 15:04:04",
"content": "From what i see we both have it wrong",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051227891913990300,
"author_id": 480366337290403840,
"author_name": "Magnus",
"timestamp": "12/10/2022 15:04:20",
"content": "They multiply it by another combination",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051228302431490000,
"author_id": 480366337290403840,
"author_name": "Magnus",
"timestamp": "12/10/2022 15:05:58",
"content": "I dont know anymore",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051231745527263200,
"author_id": 480366337290403840,
"author_name": "Magnus",
"timestamp": "12/10/2022 15:19:39",
"content": "@Jigglyproff the results are very close tho",
"attachments": [],
"mentions": [
{
"id": 266573406919589900,
"name": "Jigglyproff",
"discriminator": "4511",
"nickname": "Jigglyproff",
"isBot": false
}
],
"reference": null
},
{
"id": 1051246852156178600,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 16:19:40",
"content": "@Magnus Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 480366337290403840,
"name": "Magnus",
"discriminator": "7088",
"nickname": "Magnus",
"isBot": false
}
],
"reference": null
},
{
"id": 1051247571911323800,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 16:22:32",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
1d83162b4598466a9f75446809fc7fc2
|
199,987 |
[
{
"id": 1051247824379068500,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 16:23:32",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051248508444889100,
"author_id": 485665875471630340,
"author_name": "ry",
"timestamp": "12/10/2022 16:26:15",
"content": "",
"attachments": [
{
"id": 1051248508159660200,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051248508159660102/Screen_Shot_2022-12-10_at_4.25.36_PM.png",
"fileName": "Screen_Shot_2022-12-10_at_4.25.36_PM.png",
"fileSizeBytes": 89938
}
],
"mentions": [],
"reference": null
},
{
"id": 1051248510856605700,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 16:26:16",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051248508444889100,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051248546394931200,
"author_id": 485665875471630340,
"author_name": "ry",
"timestamp": "12/10/2022 16:26:24",
"content": "are these 2 answers the same?",
"attachments": [
{
"id": 1051248546139087000,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051248546139086959/IMG_5110.jpg",
"fileName": "IMG_5110.jpg",
"fileSizeBytes": 1337304
}
],
"mentions": [],
"reference": null
},
{
"id": 1051250794315391100,
"author_id": 521464336284254200,
"author_name": "Gamer Dio",
"timestamp": "12/10/2022 16:35:20",
"content": "It would be if you had parenthesis around x - tanx",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051251379370467300,
"author_id": 485665875471630340,
"author_name": "ry",
"timestamp": "12/10/2022 16:37:40",
"content": "I see",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051251385599004700,
"author_id": 485665875471630340,
"author_name": "ry",
"timestamp": "12/10/2022 16:37:41",
"content": "thank you",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051251394000191500,
"author_id": 485665875471630340,
"author_name": "ry",
"timestamp": "12/10/2022 16:37:43",
"content": ".close",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051251396609056900,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 16:37:44",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
1bbef263156741cab6e2f72f500c3f95
|
199,988 |
[
{
"id": 1034408310369165300,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "10/25/2022 06:09:19",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034409296219349100,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "10/25/2022 06:13:14",
"content": "We need to find the derivative, but by using the substitution t = sinx",
"attachments": [
{
"id": 1034409295695052900,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1034409295695052890/unknown.png",
"fileName": "unknown.png",
"fileSizeBytes": 627891
}
],
"mentions": [],
"reference": null
},
{
"id": 1034409299004362800,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "10/25/2022 06:13:15",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1034409296219349100,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1034409634762600600,
"author_id": 187850624421986300,
"author_name": "Circle",
"timestamp": "10/25/2022 06:14:35",
"content": "HI AGAIN",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034409657353125900,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "10/25/2022 06:14:40",
"content": "hEYOO",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034409729956528100,
"author_id": 187850624421986300,
"author_name": "Circle",
"timestamp": "10/25/2022 06:14:58",
"content": "senior sister",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034409748650537100,
"author_id": 187850624421986300,
"author_name": "Circle",
"timestamp": "10/25/2022 06:15:02",
"content": "here is a cosmetic pill",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034409858952347800,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "10/25/2022 06:15:28",
"content": "I am a sisteR? :thonkstein:",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034409984227811300,
"author_id": 187850624421986300,
"author_name": "Circle",
"timestamp": "10/25/2022 06:15:58",
"content": "u r meng haos senior sister",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034410152486518800,
"author_id": 187850624421986300,
"author_name": "Circle",
"timestamp": "10/25/2022 06:16:38",
"content": "hm so find derivative",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034410210426617900,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "10/25/2022 06:16:52",
"content": "Anyways, this derivative is very weird, because you cannot only be considering the domain from -pi/2 to pi/2",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034410262872199300,
"author_id": 187850624421986300,
"author_name": "Circle",
"timestamp": "10/25/2022 06:17:05",
"content": "anw",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034410361362841700,
"author_id": 187850624421986300,
"author_name": "Circle",
"timestamp": "10/25/2022 06:17:28",
"content": "wot",
"attachments": [],
"mentions": [
{
"id": 1022141568737607800,
"name": "♡A(lex)♡",
"discriminator": "5050",
"nickname": "♡A(lex)♡",
"isBot": false
}
],
"reference": null
},
{
"id": 1034410388739076200,
"author_id": 187850624421986300,
"author_name": "Circle",
"timestamp": "10/25/2022 06:17:35",
"content": "whered that come from",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034410825244491800,
"author_id": 187850624421986300,
"author_name": "Circle",
"timestamp": "10/25/2022 06:19:19",
"content": "idk just",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034410842046873600,
"author_id": 187850624421986300,
"author_name": "Circle",
"timestamp": "10/25/2022 06:19:23",
"content": "work thru it as per normal",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034410861877530600,
"author_id": 187850624421986300,
"author_name": "Circle",
"timestamp": "10/25/2022 06:19:27",
"content": "hope for the best",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034410880886116400,
"author_id": 187850624421986300,
"author_name": "Circle",
"timestamp": "10/25/2022 06:19:32",
"content": "using chain rule n stuff as well",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034410904558768100,
"author_id": 187850624421986300,
"author_name": "Circle",
"timestamp": "10/25/2022 06:19:38",
"content": "quite a few stuff to use here lol",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034410940885635100,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "10/25/2022 06:19:46",
"content": "it is hard to explain",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034410953372082200,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "10/25/2022 06:19:49",
"content": "hmm",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034411011924570200,
"author_id": 187850624421986300,
"author_name": "Circle",
"timestamp": "10/25/2022 06:20:03",
"content": "idt domain matters here?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034411335783555200,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "10/25/2022 06:21:20",
"content": "the domain of x = sin^-1(t) would just be from -pi/2 to pi/2, right?",
"attachments": [],
"mentions": [
{
"id": 187850624421986300,
"name": "Circle",
"discriminator": "0025",
"nickname": "💕Spirit Immortal Layer 8",
"isBot": false
}
],
"reference": null
},
{
"id": 1034411569691508700,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "10/25/2022 06:22:16",
"content": "but we are considering sin^-1(sin3x) here",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034411654160584700,
"author_id": 187850624421986300,
"author_name": "Circle",
"timestamp": "10/25/2022 06:22:36",
"content": "no",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034411659076313200,
"author_id": 187850624421986300,
"author_name": "Circle",
"timestamp": "10/25/2022 06:22:37",
"content": "i mean",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034411675375370200,
"author_id": 187850624421986300,
"author_name": "Circle",
"timestamp": "10/25/2022 06:22:41",
"content": "udc abt the domain",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034411692270027000,
"author_id": 187850624421986300,
"author_name": "Circle",
"timestamp": "10/25/2022 06:22:45",
"content": "unless they ask for it",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034411710301343700,
"author_id": 187850624421986300,
"author_name": "Circle",
"timestamp": "10/25/2022 06:22:50",
"content": "or ur teach asks for it",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034411736893235200,
"author_id": 187850624421986300,
"author_name": "Circle",
"timestamp": "10/25/2022 06:22:56",
"content": "just pretend it doesnt exist",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034412622172409900,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "10/25/2022 06:26:27",
"content": "the graph of this function has edges every pi, which is why i said that a general derivative formula",
"attachments": [
{
"id": 1034412622004633600,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1034412622004633640/unknown.png",
"fileName": "unknown.png",
"fileSizeBytes": 32947
}
],
"mentions": [],
"reference": null
},
{
"id": 1034412637896835100,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "10/25/2022 06:26:31",
"content": "should not be valid",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034413127003033600,
"author_id": 627801784219336700,
"author_name": "Froxwin",
"timestamp": "10/25/2022 06:28:27",
"content": "why wont it be valid?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034414180872228900,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "10/25/2022 06:32:39",
"content": "",
"attachments": [
{
"id": 1034414180519911400,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1034414180519911464/unknown.png",
"fileName": "unknown.png",
"fileSizeBytes": 288515
}
],
"mentions": [
{
"id": 627801784219336700,
"name": "Froxwin",
"discriminator": "2721",
"nickname": "Froxwin",
"isBot": false
}
],
"reference": null
},
{
"id": 1034414276565286900,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "10/25/2022 06:33:02",
"content": "They all would have different slopes, no?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034414444891091000,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "10/25/2022 06:33:42",
"content": "although i guess most people would assume the interval from -pi/2 to pi/2",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034418221350125600,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "10/25/2022 06:48:42",
"content": "@♡A(lex)♡ Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 1022141568737607800,
"name": "♡A(lex)♡",
"discriminator": "5050",
"nickname": "♡A(lex)♡",
"isBot": false
}
],
"reference": null
},
{
"id": 1034418395799638000,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "10/25/2022 06:49:24",
"content": "I just need confirmation of whether this idea is actually valid here",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034420218950332500,
"author_id": 627801784219336700,
"author_name": "Froxwin",
"timestamp": "10/25/2022 06:56:38",
"content": "the derivative wont exist at the sharp points",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034420274327732200,
"author_id": 627801784219336700,
"author_name": "Froxwin",
"timestamp": "10/25/2022 06:56:51",
"content": "but you can just differentiate it ignoring that",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034420373787246700,
"author_id": 627801784219336700,
"author_name": "Froxwin",
"timestamp": "10/25/2022 06:57:15",
"content": "cuz the expression you get will not be defined at those x",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034420469878751200,
"author_id": 627801784219336700,
"author_name": "Froxwin",
"timestamp": "10/25/2022 06:57:38",
"content": "like the derivative of |x| does not exist at 0",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034420520600469500,
"author_id": 627801784219336700,
"author_name": "Froxwin",
"timestamp": "10/25/2022 06:57:50",
"content": "differentiating it gives you |x|/x",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034420548505178100,
"author_id": 627801784219336700,
"author_name": "Froxwin",
"timestamp": "10/25/2022 06:57:57",
"content": "which is not defined at 0",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034420619418275800,
"author_id": 627801784219336700,
"author_name": "Froxwin",
"timestamp": "10/25/2022 06:58:14",
"content": "because 0 on its plot is a sharp point",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034420649826988200,
"author_id": 282965984703414270,
"author_name": "Tsuwako",
"timestamp": "10/25/2022 06:58:21",
"content": "The substitution t = sin(x) can't work if t doesn't belong to [-1,1] anyway",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034421409100861600,
"author_id": 282965984703414270,
"author_name": "Tsuwako",
"timestamp": "10/25/2022 07:01:22",
"content": "So if you use this substitution, you have to say that t belongs to [-1,1] and then you'll find a derivative on the domain [-1,1] where there won't be any sharp point I think",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034421814266429400,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "10/25/2022 07:02:59",
"content": "yeah but only after considering the decreasing and the increasing slopes of |x| separately correct?",
"attachments": [],
"mentions": [
{
"id": 627801784219336700,
"name": "Froxwin",
"discriminator": "2721",
"nickname": "Froxwin",
"isBot": false
}
],
"reference": null
},
{
"id": 1034421844960366700,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "10/25/2022 07:03:06",
"content": "so why would this be any different, all in all",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034422149911433200,
"author_id": 627801784219336700,
"author_name": "Froxwin",
"timestamp": "10/25/2022 07:04:19",
"content": "no",
"attachments": [],
"mentions": [
{
"id": 1022141568737607800,
"name": "♡A(lex)♡",
"discriminator": "5050",
"nickname": "♡A(lex)♡",
"isBot": false
}
],
"reference": null
},
{
"id": 1034422251401003000,
"author_id": 627801784219336700,
"author_name": "Froxwin",
"timestamp": "10/25/2022 07:04:43",
"content": "you just differentiate it",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034422662904168400,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "10/25/2022 07:06:21",
"content": "what? you need to separate the derivative of |x| into two different cases where x < 0 and x >= 0 because the slopes of those two intervals are different to begin with",
"attachments": [],
"mentions": [
{
"id": 627801784219336700,
"name": "Froxwin",
"discriminator": "2721",
"nickname": "Froxwin",
"isBot": false
}
],
"reference": null
},
{
"id": 1034422693786820600,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "10/25/2022 07:06:28",
"content": "saying 'just differentiate it' doesn't explain much to me",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034423350048608300,
"author_id": 627801784219336700,
"author_name": "Froxwin",
"timestamp": "10/25/2022 07:09:05",
"content": "thats one way to do it",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034423405971243000,
"author_id": 627801784219336700,
"author_name": "Froxwin",
"timestamp": "10/25/2022 07:09:18",
"content": "you write it as a piecewise function",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034423410094260200,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "10/25/2022 07:09:19",
"content": "also this is just what i described, but summarised as a formula",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034423566344655000,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "10/25/2022 07:09:56",
"content": "you can't really describe the above problem with a formulaic way too like with a simple function such as |x|, unless you can, then i am glad to know",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034423882075078800,
"author_id": 627801784219336700,
"author_name": "Froxwin",
"timestamp": "10/25/2022 07:11:12",
"content": "i was just trying to explain how sharp points effect the derivative",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034424550286426100,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "10/25/2022 07:13:51",
"content": "ah i see, sorry. I thought you were trying to refute the method shown in the picture, just didn't quite understand where you were getting at",
"attachments": [],
"mentions": [
{
"id": 627801784219336700,
"name": "Froxwin",
"discriminator": "2721",
"nickname": "Froxwin",
"isBot": false
}
],
"reference": null
},
{
"id": 1034430324685422700,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "10/25/2022 07:36:48",
"content": ".close",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034430327420104800,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "10/25/2022 07:36:48",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
27ad5bc3d353400ab0ff3840c02e8ddd
|
199,989 |
[
{
"id": 1051251648615416000,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 16:38:44",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051253191133630500,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 16:44:52",
"content": "could someone explain this to me",
"attachments": [
{
"id": 1051253191032983600,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051253191032983603/image.png",
"fileName": "image.png",
"fileSizeBytes": 121775
}
],
"mentions": [],
"reference": null
},
{
"id": 1051253194640072800,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 16:44:52",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051253191133630500,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051253207315267700,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 16:44:55",
"content": "step by step",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051253300382675000,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 16:45:18",
"content": "did it in class but it dont go through my head",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051253376727384200,
"author_id": 165914200332304400,
"author_name": "Steakanator",
"timestamp": "12/10/2022 16:45:36",
"content": "what do you need explained",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051253501151412200,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 16:46:06",
"content": "i dont understand majority of it",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051253501398880300,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 16:46:06",
"content": "what godsaken assignment notation is that ;-;",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051253528498294900,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 16:46:12",
"content": "💀",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051253556960829400,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 16:46:19",
"content": "iits algorithms",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051253617950212100,
"author_id": 165914200332304400,
"author_name": "Steakanator",
"timestamp": "12/10/2022 16:46:33",
"content": "well it's small enough to go through line by line",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051253660555956200,
"author_id": 165914200332304400,
"author_name": "Steakanator",
"timestamp": "12/10/2022 16:46:44",
"content": "do you know what \"max <- A(1)\" does?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051253707767033900,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 16:46:55",
"content": "my assumption is that it retrieves the first unit from A",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051253723055280300,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 16:46:58",
"content": "which would be 1",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051253792680718300,
"author_id": 165914200332304400,
"author_name": "Steakanator",
"timestamp": "12/10/2022 16:47:15",
"content": "and it assigns that value to the variable named 'max'",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051253843809271800,
"author_id": 266573406919589900,
"author_name": "Jigglyproff",
"timestamp": "12/10/2022 16:47:27",
"content": "I find it utterly disturbing that it does stuff like list-lookups ( aka A(1) ) but that weird way of assigning right to left",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051253846086791200,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 16:47:28",
"content": "okay so max = A(1)",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051253949660930000,
"author_id": 165914200332304400,
"author_name": "Steakanator",
"timestamp": "12/10/2022 16:47:52",
"content": "next, do you know what the \"for\" is for?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051253974784802800,
"author_id": 165914200332304400,
"author_name": "Steakanator",
"timestamp": "12/10/2022 16:47:58",
"content": "that sentence is awkward but whatever",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051253995659866100,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 16:48:03",
"content": "a for loop",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051254040794767400,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 16:48:14",
"content": "i dont understnad the difference between \"for\" and \"while\" though",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051254094196650100,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 16:48:27",
"content": "can i repost it so its on the screen infront of us",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051254108293714000,
"author_id": 165914200332304400,
"author_name": "Steakanator",
"timestamp": "12/10/2022 16:48:30",
"content": "\"for\" executes the code within the loop a set number of times",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051254153474748400,
"author_id": 165914200332304400,
"author_name": "Steakanator",
"timestamp": "12/10/2022 16:48:41",
"content": "\"while\" executes the code within the loop until some condition is satisfied",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051254223674822700,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 16:48:58",
"content": "ah i get that",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051254415417409500,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 16:49:43",
"content": "so what would length be?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051254426184192100,
"author_id": 165914200332304400,
"author_name": "Steakanator",
"timestamp": "12/10/2022 16:49:46",
"content": "so when it says \"for j = 2 to length(A)\" it'll run the code with j=2, then j=3, then j=4, etc etc until j = length(A)",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051254657491673200,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 16:50:41",
"content": "until it reaches 6?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051254683752206300,
"author_id": 165914200332304400,
"author_name": "Steakanator",
"timestamp": "12/10/2022 16:50:47",
"content": "in this case yeah",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051254706929934500,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 16:50:53",
"content": "ah",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051254723589718000,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 16:50:57",
"content": "because theres 6 components in",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051254726127268000,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 16:50:58",
"content": "A",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051254741977534600,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 16:51:01",
"content": "right",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051254852795252700,
"author_id": 165914200332304400,
"author_name": "Steakanator",
"timestamp": "12/10/2022 16:51:28",
"content": "perhaps worth noting is that there's usually a \"by\" argument that alters the size of the iteration",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051254929865576600,
"author_id": 165914200332304400,
"author_name": "Steakanator",
"timestamp": "12/10/2022 16:51:46",
"content": "like if there was a \"by = 0.1\" in there, j would go 2, 2.1, 2.2, ...",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051255003630813300,
"author_id": 165914200332304400,
"author_name": "Steakanator",
"timestamp": "12/10/2022 16:52:04",
"content": "not relevant for the question but good to know methinks",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051255028444299400,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 16:52:10",
"content": "ah i get that",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051255199353819100,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 16:52:50",
"content": "so the next line would be if max is less than j?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051255243280748700,
"author_id": 165914200332304400,
"author_name": "Steakanator",
"timestamp": "12/10/2022 16:53:01",
"content": "if max is less than A(j)",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051255269230907400,
"author_id": 165914200332304400,
"author_name": "Steakanator",
"timestamp": "12/10/2022 16:53:07",
"content": "ie the element of A at index j",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051255326546084000,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 16:53:21",
"content": "ah i dont get that",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051255341276463200,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 16:53:24",
"content": "in this case, thatwould be 6?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051255390903476200,
"author_id": 165914200332304400,
"author_name": "Steakanator",
"timestamp": "12/10/2022 16:53:36",
"content": "what's \"that\"",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051255441075753000,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 16:53:48",
"content": "since j went to length",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051255447979565000,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 16:53:50",
"content": "which is 6",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051255482918129700,
"author_id": 165914200332304400,
"author_name": "Steakanator",
"timestamp": "12/10/2022 16:53:58",
"content": "well j isn't 6 yet",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051255503390507000,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 16:54:03",
"content": "ah",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051255505219240000,
"author_id": 165914200332304400,
"author_name": "Steakanator",
"timestamp": "12/10/2022 16:54:03",
"content": "it goes from 2 up to 6",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051255518792011800,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 16:54:07",
"content": "ohh",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051255528761872400,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 16:54:09",
"content": "its more like a range",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051255635192332300,
"author_id": 165914200332304400,
"author_name": "Steakanator",
"timestamp": "12/10/2022 16:54:34",
"content": "the firs time through it reads \"if max < A(2)\"",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051255766604071000,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 16:55:06",
"content": "would it reiterate it",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051255773814075400,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 16:55:07",
"content": "with each line",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051255828553932900,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 16:55:20",
"content": "for example in the first line it reads A(2)",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051255874154414100,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 16:55:31",
"content": "then A(3) with the next line",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051255954274005100,
"author_id": 165914200332304400,
"author_name": "Steakanator",
"timestamp": "12/10/2022 16:55:50",
"content": "each time it loops it increments j yes",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051255956949958700,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 16:55:51",
"content": "sorry if im coming off abit dumb rn",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051255980182229000,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 16:55:57",
"content": "ah",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051256021168959500,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 16:56:06",
"content": "so in the initial line, it would remain as A(2)",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051256094581862500,
"author_id": 165914200332304400,
"author_name": "Steakanator",
"timestamp": "12/10/2022 16:56:24",
"content": "no",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051256128492810200,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 16:56:32",
"content": "A(3) ?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051256163175514100,
"author_id": 165914200332304400,
"author_name": "Steakanator",
"timestamp": "12/10/2022 16:56:40",
"content": "it doesn't remain as anything",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051256182083440600,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 16:56:45",
"content": "ohh",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051256246944153700,
"author_id": 165914200332304400,
"author_name": "Steakanator",
"timestamp": "12/10/2022 16:57:00",
"content": "everything that is indented under the \"for\" statement is within the for loop",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051256341152411600,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 16:57:23",
"content": "okay i get that",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051256354955870200,
"author_id": 165914200332304400,
"author_name": "Steakanator",
"timestamp": "12/10/2022 16:57:26",
"content": "thus, every indented line gets run with each pass of the loop, incrementing j each time",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051256460018983000,
"author_id": 165914200332304400,
"author_name": "Steakanator",
"timestamp": "12/10/2022 16:57:51",
"content": "so it first handles:\nif max < A(2)\nmax = A(2)",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051256513924173800,
"author_id": 165914200332304400,
"author_name": "Steakanator",
"timestamp": "12/10/2022 16:58:04",
"content": "then j ticks up to 3 and it becomes:\nif max < A(3)\nmax = A(3)",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051256517451591700,
"author_id": 165914200332304400,
"author_name": "Steakanator",
"timestamp": "12/10/2022 16:58:05",
"content": "etc",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051256587492278400,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 16:58:21",
"content": "in this instance what would it be when its returned ?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051256647194001500,
"author_id": 165914200332304400,
"author_name": "Steakanator",
"timestamp": "12/10/2022 16:58:36",
"content": "the return happens once the loop has finished",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051256793461956700,
"author_id": 165914200332304400,
"author_name": "Steakanator",
"timestamp": "12/10/2022 16:59:10",
"content": "so A(2) is bigger than max (which is 1) so max gets assigned A(2) which is 5",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051256845873983600,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 16:59:23",
"content": "ohhh",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051256859379650600,
"author_id": 165914200332304400,
"author_name": "Steakanator",
"timestamp": "12/10/2022 16:59:26",
"content": "then each time it gets assigned 9, 11, 55",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051256943831941200,
"author_id": 165914200332304400,
"author_name": "Steakanator",
"timestamp": "12/10/2022 16:59:46",
"content": "at j=6, the statement \"max < A(j)\" is false since 55 is not less than 2",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051256965646528800,
"author_id": 165914200332304400,
"author_name": "Steakanator",
"timestamp": "12/10/2022 16:59:52",
"content": "so max is not reassigned",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051257113088884700,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 17:00:27",
"content": "sorry icl this is going over my head abit 😭",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051257382266749000,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 17:01:31",
"content": "so since j references 2",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051257429968560300,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 17:01:42",
"content": "would max be assigned to as A(2) throughout",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051257451606986800,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 17:01:47",
"content": "being returned as 5?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051257481503969400,
"author_id": 165914200332304400,
"author_name": "Steakanator",
"timestamp": "12/10/2022 17:01:55",
"content": "no",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051257536487116900,
"author_id": 165914200332304400,
"author_name": "Steakanator",
"timestamp": "12/10/2022 17:02:08",
"content": "j increases remember",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051257600697712800,
"author_id": 165914200332304400,
"author_name": "Steakanator",
"timestamp": "12/10/2022 17:02:23",
"content": "i tried to explain it here",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051257808282210400,
"author_id": 728158378622189700,
"author_name": "Kookiemon",
"timestamp": "12/10/2022 17:03:12",
"content": "Mind if I take a crack at it?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051257866968891500,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 17:03:26",
"content": "idm",
"attachments": [],
"mentions": [
{
"id": 728158378622189700,
"name": "Kookiemon",
"discriminator": "3404",
"nickname": "Kookiemon",
"isBot": false
}
],
"reference": null
},
{
"id": 1051257887965585400,
"author_id": 728158378622189700,
"author_name": "Kookiemon",
"timestamp": "12/10/2022 17:03:31",
"content": "",
"attachments": [
{
"id": 1051257887701356700,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051257887701356645/image.png",
"fileName": "image.png",
"fileSizeBytes": 128830
}
],
"mentions": [],
"reference": null
},
{
"id": 1051258090298802200,
"author_id": 728158378622189700,
"author_name": "Kookiemon",
"timestamp": "12/10/2022 17:04:20",
"content": "I'm going to create a hypothetical situation.\n\nSituation : You have six money bags in front of you laid out from left to right. Each money bag is enumerated with the numbers 1 through 6.",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051258185777938600,
"author_id": 728158378622189700,
"author_name": "Kookiemon",
"timestamp": "12/10/2022 17:04:42",
"content": "Problem : Determine which money bag has the largest quantity of money in it.",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051258218371887100,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 17:04:50",
"content": "mhm",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051258277171830800,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 17:05:04",
"content": "which would be 55",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051258358792982700,
"author_id": 728158378622189700,
"author_name": "Kookiemon",
"timestamp": "12/10/2022 17:05:24",
"content": "You don't know how much money is in each bag. This is the scenario that your program encounters.",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051258379319906300,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 17:05:29",
"content": "ohh",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051258434848309200,
"author_id": 728158378622189700,
"author_name": "Kookiemon",
"timestamp": "12/10/2022 17:05:42",
"content": "A program does not know anything until you give it the information.",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051258505530712200,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 17:05:59",
"content": "mhm",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051258564603293700,
"author_id": 728158378622189700,
"author_name": "Kookiemon",
"timestamp": "12/10/2022 17:06:13",
"content": "So you have six money bags in front of you numbered 1 through 6 and you do not know how much is in each.",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051258605208354800,
"author_id": 728158378622189700,
"author_name": "Kookiemon",
"timestamp": "12/10/2022 17:06:22",
"content": "How would you determine which has the most money?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051258666306785400,
"author_id": 728158378622189700,
"author_name": "Kookiemon",
"timestamp": "12/10/2022 17:06:37",
"content": "The obvious choice is to open one of the bags and count how much money is in it.",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051258752659095600,
"author_id": 728158378622189700,
"author_name": "Kookiemon",
"timestamp": "12/10/2022 17:06:58",
"content": "But we're a computer and we go in order so we start at the money bag labeled #1.",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051258755469299700,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 17:06:58",
"content": "yea",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051258801124294700,
"author_id": 728158378622189700,
"author_name": "Kookiemon",
"timestamp": "12/10/2022 17:07:09",
"content": "We open the bag and there is $1 in it.",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051258915544907900,
"author_id": 728158378622189700,
"author_name": "Kookiemon",
"timestamp": "12/10/2022 17:07:36",
"content": "For all intents and purpose, those is the MAX amount of money so far.",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051258947828469900,
"author_id": 728158378622189700,
"author_name": "Kookiemon",
"timestamp": "12/10/2022 17:07:44",
"content": "So we set MAX = 1.",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051258963771015200,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 17:07:48",
"content": "yeah i get that",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051259051457138800,
"author_id": 728158378622189700,
"author_name": "Kookiemon",
"timestamp": "12/10/2022 17:08:09",
"content": "The next step is to open bag #2. There is $5 in it.",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051259112970780700,
"author_id": 728158378622189700,
"author_name": "Kookiemon",
"timestamp": "12/10/2022 17:08:23",
"content": "We compare how much MAX with how much is in bag #2.",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051259190301167600,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 17:08:42",
"content": "yeah, understand so far",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051259199990026200,
"author_id": 728158378622189700,
"author_name": "Kookiemon",
"timestamp": "12/10/2022 17:08:44",
"content": "MAX = 1\n\nMAX < 5",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051259251881951200,
"author_id": 728158378622189700,
"author_name": "Kookiemon",
"timestamp": "12/10/2022 17:08:57",
"content": "Because MAX is less than 5, we set MAX equal to 5.",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051259317749285000,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 17:09:12",
"content": "ohh",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051259334052560900,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 17:09:16",
"content": "because max was set to 1",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051259351664443400,
"author_id": 728158378622189700,
"author_name": "Kookiemon",
"timestamp": "12/10/2022 17:09:20",
"content": "Correct.",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051259354743062500,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 17:09:21",
"content": "its less than 5",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051259365493047300,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 17:09:24",
"content": "okay",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051259453791551600,
"author_id": 728158378622189700,
"author_name": "Kookiemon",
"timestamp": "12/10/2022 17:09:45",
"content": "Now the FOR loop tells us to iterate through each of the bags.",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051259588810395800,
"author_id": 728158378622189700,
"author_name": "Kookiemon",
"timestamp": "12/10/2022 17:10:17",
"content": "Basically to open up each bag in order from 1 through 6, ie. length(A).",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051259594208456800,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 17:10:18",
"content": "yeah",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051259646578540500,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 17:10:31",
"content": "so you go through each bag",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051259650470838300,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 17:10:32",
"content": "1 by 1",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051259672465789000,
"author_id": 728158378622189700,
"author_name": "Kookiemon",
"timestamp": "12/10/2022 17:10:37",
"content": "The indented rows are contained within that FOR loop.",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051259750291091600,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 17:10:55",
"content": "mhm",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051259874794807300,
"author_id": 728158378622189700,
"author_name": "Kookiemon",
"timestamp": "12/10/2022 17:11:25",
"content": "**return MAX** has the same indentation as the FOR loop so it is outside of its scope. We just iterate through the next two lines.",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051259950560723100,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 17:11:43",
"content": "so those 2 lines are unnecessary",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051259987541901400,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 17:11:52",
"content": "as the return max is outside of the indentation",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051260001118847100,
"author_id": 728158378622189700,
"author_name": "Kookiemon",
"timestamp": "12/10/2022 17:11:55",
"content": "Inside of the FOR loop scope?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051260014242836500,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 17:11:58",
"content": "yeah",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051260068290642000,
"author_id": 728158378622189700,
"author_name": "Kookiemon",
"timestamp": "12/10/2022 17:12:11",
"content": "The two lines inside of the FOR loop are what does the magic.",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051260084791033900,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 17:12:15",
"content": "ohh",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051260154424860700,
"author_id": 728158378622189700,
"author_name": "Kookiemon",
"timestamp": "12/10/2022 17:12:32",
"content": "It does the comparison and if the comparison is true, we change the value of MAX.",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051260451423523000,
"author_id": 728158378622189700,
"author_name": "Kookiemon",
"timestamp": "12/10/2022 17:13:43",
"content": "**j <- 2** is pseudocode for placing the value of **2** into **j**.",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051260548987236500,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 17:14:06",
"content": "so that 2 is equalivent to the 2nd placement in A?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051260568629166100,
"author_id": 728158378622189700,
"author_name": "Kookiemon",
"timestamp": "12/10/2022 17:14:11",
"content": "Yes.",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051260598379360300,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 17:14:18",
"content": "okay i get that",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051260631006838900,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 17:14:25",
"content": "so that 2 = 5",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051260698371563600,
"author_id": 728158378622189700,
"author_name": "Kookiemon",
"timestamp": "12/10/2022 17:14:41",
"content": "No.",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051260731212968000,
"author_id": 728158378622189700,
"author_name": "Kookiemon",
"timestamp": "12/10/2022 17:14:49",
"content": "j = 2\nA(j=2) = 5",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051260762754138200,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 17:14:57",
"content": "ohhh",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051260778839281700,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 17:15:01",
"content": "J on its own",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051260784866508800,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 17:15:02",
"content": "without A",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051260791539646500,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 17:15:04",
"content": "is just 2",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051260818525798500,
"author_id": 728158378622189700,
"author_name": "Kookiemon",
"timestamp": "12/10/2022 17:15:10",
"content": "It's just the index.",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051260844010389600,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 17:15:16",
"content": "okay i get that",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051260861609685100,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 17:15:20",
"content": "its just giving the J a value",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051260866122752100,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 17:15:21",
"content": "to use",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051260903586275300,
"author_id": 728158378622189700,
"author_name": "Kookiemon",
"timestamp": "12/10/2022 17:15:30",
"content": "And **A** is an array that contains the values you want to know.",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051260949509722100,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 17:15:41",
"content": "yeah",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051261222445649900,
"author_id": 728158378622189700,
"author_name": "Kookiemon",
"timestamp": "12/10/2022 17:16:46",
"content": "So the pseudocode just iterates through the array **A**, does a comparison during each iteration, if the comparison is true, change the value of MAX. Once the pseudocode has iterated through the entire array, it returns MAX which should be equal to the largest value in the array.",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051261429128376400,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 17:17:36",
"content": "which is A(j=5) ? which is equivalent to the 55",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051261459172163700,
"author_id": 728158378622189700,
"author_name": "Kookiemon",
"timestamp": "12/10/2022 17:17:43",
"content": "Yes.",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051261476108771300,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 17:17:47",
"content": "ah",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051261591863165000,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 17:18:14",
"content": "i get it i think",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051261625933504600,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 17:18:23",
"content": "so its simpler than i made it out to be",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051261731139227600,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 17:18:48",
"content": "the code is replacing and updating the max",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051261806808670200,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 17:19:06",
"content": "if the new max is larger than the current max?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051261881878319200,
"author_id": 728158378622189700,
"author_name": "Kookiemon",
"timestamp": "12/10/2022 17:19:24",
"content": "Correct.",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051261963704996000,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 17:19:43",
"content": "ahh",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051262032848109700,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 17:20:00",
"content": "so the answer would be 5",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051262073654480900,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 17:20:09",
"content": "since thats what the A refers to",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051262436067520500,
"author_id": 728158378622189700,
"author_name": "Kookiemon",
"timestamp": "12/10/2022 17:21:36",
"content": "Yes.",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051262490920616000,
"author_id": 728158378622189700,
"author_name": "Kookiemon",
"timestamp": "12/10/2022 17:21:49",
"content": "Ok, I gotta head out. Hope this helped.",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051265849723465900,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 17:35:10",
"content": "@Broccoli Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 651558111538315300,
"name": "Broccoli",
"discriminator": "1889",
"nickname": "Broccoli",
"isBot": false
}
],
"reference": null
},
{
"id": 1051265933563408400,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 17:35:30",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
8e4f0eb284114a1081b48aeaf663d80a
|
199,990 |
[
{
"id": 1051266186085666800,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 17:36:30",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051266646225977300,
"author_id": 694089823769591800,
"author_name": "NightFury",
"timestamp": "12/10/2022 17:38:20",
"content": "",
"attachments": [
{
"id": 1051266645743636600,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051266645743636600/CB3FFD96-DBCE-4F68-9DF9-3CF44394CF33.jpg",
"fileName": "CB3FFD96-DBCE-4F68-9DF9-3CF44394CF33.jpg",
"fileSizeBytes": 3958487
}
],
"mentions": [],
"reference": null
},
{
"id": 1051266650109915300,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 17:38:20",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051266646225977300,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051266654950142100,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 17:38:22",
"content": null,
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051266740065140900,
"author_id": 694089823769591800,
"author_name": "NightFury",
"timestamp": "12/10/2022 17:38:42",
"content": "I am unsure what to do",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051266778484985900,
"author_id": 694089823769591800,
"author_name": "NightFury",
"timestamp": "12/10/2022 17:38:51",
"content": "I think I just bsed my way into the first answer lol",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051266889772449800,
"author_id": 485903210272391200,
"author_name": "dldh06",
"timestamp": "12/10/2022 17:39:18",
"content": "Don't open multiple channels",
"attachments": [],
"mentions": [
{
"id": 694089823769591800,
"name": "NightFury",
"discriminator": "6265",
"nickname": "NightFury",
"isBot": false
}
],
"reference": null
},
{
"id": 1051266923167486000,
"author_id": 694089823769591800,
"author_name": "NightFury",
"timestamp": "12/10/2022 17:39:26",
"content": "Sorry",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051266985331281900,
"author_id": 694089823769591800,
"author_name": "NightFury",
"timestamp": "12/10/2022 17:39:40",
"content": "Should I close this channel?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051267020240465900,
"author_id": 485903210272391200,
"author_name": "dldh06",
"timestamp": "12/10/2022 17:39:49",
"content": "Yes",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051267201811894300,
"author_id": 694089823769591800,
"author_name": "NightFury",
"timestamp": "12/10/2022 17:40:32",
"content": ".close",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051267205339283600,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 17:40:33",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
05954f8f6a7640b18f842e5cad9fb97a
|
199,991 |
[
{
"id": 1051270928006385800,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 17:55:20",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051271820961128400,
"author_id": 456945714220761100,
"author_name": "Anthony P.",
"timestamp": "12/10/2022 17:58:53",
"content": "n³+3n²-4n-12",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051271823293173800,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 17:58:54",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051271820961128400,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051272853707829400,
"author_id": 696748240758112300,
"author_name": "everg",
"timestamp": "12/10/2022 18:03:00",
"content": "what?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051272919059275800,
"author_id": 456945714220761100,
"author_name": "Anthony P.",
"timestamp": "12/10/2022 18:03:15",
"content": "how do I figure out this problem?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051272951363809300,
"author_id": 485903210272391200,
"author_name": "dldh06",
"timestamp": "12/10/2022 18:03:23",
"content": "What's the goal?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051272979792810100,
"author_id": 456945714220761100,
"author_name": "Anthony P.",
"timestamp": "12/10/2022 18:03:30",
"content": "factoring",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051273016832700400,
"author_id": 485903210272391200,
"author_name": "dldh06",
"timestamp": "12/10/2022 18:03:38",
"content": "Factor by group",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051273081395630100,
"author_id": 456945714220761100,
"author_name": "Anthony P.",
"timestamp": "12/10/2022 18:03:54",
"content": "I believe so",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051273090543399000,
"author_id": 456945714220761100,
"author_name": "Anthony P.",
"timestamp": "12/10/2022 18:03:56",
"content": "",
"attachments": [
{
"id": 1051273090631467000,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051273090631467068/image.png",
"fileName": "image.png",
"fileSizeBytes": 38513
}
],
"mentions": [],
"reference": null
},
{
"id": 1051273142032674800,
"author_id": 485903210272391200,
"author_name": "dldh06",
"timestamp": "12/10/2022 18:04:08",
"content": "I mean that's the method you should apply",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051273179051602000,
"author_id": 456945714220761100,
"author_name": "Anthony P.",
"timestamp": "12/10/2022 18:04:17",
"content": "so how do I do that?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051273278066532400,
"author_id": 485903210272391200,
"author_name": "dldh06",
"timestamp": "12/10/2022 18:04:41",
"content": "Do you know what factor by grouping is?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051273304616468500,
"author_id": 456945714220761100,
"author_name": "Anthony P.",
"timestamp": "12/10/2022 18:04:47",
"content": "not really",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051273355338199000,
"author_id": 456945714220761100,
"author_name": "Anthony P.",
"timestamp": "12/10/2022 18:04:59",
"content": "that's what I need help on",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051273451081580700,
"author_id": 485903210272391200,
"author_name": "dldh06",
"timestamp": "12/10/2022 18:05:22",
"content": "There's a lot of videos on that concept, here's one\nhttps://www.youtube.com/watch?v=Q-9l5pJQ_QY&ab_channel=TheOrganicChemistryTutor",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051273547529596900,
"author_id": 485903210272391200,
"author_name": "dldh06",
"timestamp": "12/10/2022 18:05:45",
"content": "And another \nhttps://www.youtube.com/watch?v=apCmfszdXZA&ab_channel=BrianMcLogan",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051277130987749400,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 18:19:59",
"content": "@Anthony P. Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 456945714220761100,
"name": "Anthony P.",
"discriminator": "2442",
"nickname": "Anthony P.",
"isBot": false
}
],
"reference": null
},
{
"id": 1051277159660011600,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 18:20:06",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
8dabff48ff024d2bada9d4b8c87f1615
|
199,992 |
[
{
"id": 1051284712347418800,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 18:50:07",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051290100140625900,
"author_id": 391370215931510800,
"author_name": "Pincho",
"timestamp": "12/10/2022 19:11:31",
"content": "how do i solve this",
"attachments": [
{
"id": 1051290099180114000,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051290099180114031/83B8866F-C409-4AEC-AEB2-8686252F0C1C.jpg",
"fileName": "83B8866F-C409-4AEC-AEB2-8686252F0C1C.jpg",
"fileSizeBytes": 4446105
},
{
"id": 1051290099649888300,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051290099649888276/CBF3DB58-B688-413A-915C-04B44BD32F05.jpg",
"fileName": "CBF3DB58-B688-413A-915C-04B44BD32F05.jpg",
"fileSizeBytes": 4248872
}
],
"mentions": [],
"reference": null
},
{
"id": 1051290104632717400,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 19:11:32",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051290100140625900,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051290198643851400,
"author_id": 830994230464741400,
"author_name": "destu",
"timestamp": "12/10/2022 19:11:55",
"content": "did I do this question right? Recently started learning slopes",
"attachments": [
{
"id": 1051290198165684200,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051290198165684234/318E026A-F995-4656-B94B-8F83382DC18D.jpg",
"fileName": "318E026A-F995-4656-B94B-8F83382DC18D.jpg",
"fileSizeBytes": 4498159
}
],
"mentions": [],
"reference": null
},
{
"id": 1051291898213580800,
"author_id": 330423197943988200,
"author_name": "𝚈𝚎𝚎‐𝙷𝚊𝚠 🤠",
"timestamp": "12/10/2022 19:18:40",
"content": "slope is rise over run, so your calculation is upside down",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051291988277858300,
"author_id": 391370215931510800,
"author_name": "Pincho",
"timestamp": "12/10/2022 19:19:02",
"content": "this thread is for this question please",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051295764065828900,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 19:34:02",
"content": "@Pincho Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 391370215931510800,
"name": "Pincho",
"discriminator": "9057",
"nickname": "Pincho",
"isBot": false
}
],
"reference": null
},
{
"id": 1051295976486346900,
"author_id": 220517274845577200,
"author_name": "ramonov",
"timestamp": "12/10/2022 19:34:52",
"content": "consider factoring by grouping",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051297027801239700,
"author_id": 830994230464741400,
"author_name": "destu",
"timestamp": "12/10/2022 19:39:03",
"content": "Ty",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051299540633911400,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 19:49:02",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
c4ded6d7b3594104bdfcaf3cc442ee12
|
199,993 |
[
{
"id": 1051299792820633700,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 19:50:02",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051301092555771900,
"author_id": 632480533464744000,
"author_name": "⚜GianCresent⚜",
"timestamp": "12/10/2022 19:55:12",
"content": "can someoone help me interpret this?",
"attachments": [
{
"id": 1051301092195057800,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051301092195057744/image.png",
"fileName": "image.png",
"fileSizeBytes": 360607
}
],
"mentions": [],
"reference": null
},
{
"id": 1051301095110090900,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 19:55:13",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051301092555771900,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051301787270906000,
"author_id": 104219409991626750,
"author_name": "Element118",
"timestamp": "12/10/2022 19:57:58",
"content": "what have you figured out so far",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051302012555366400,
"author_id": 632480533464744000,
"author_name": "⚜GianCresent⚜",
"timestamp": "12/10/2022 19:58:52",
"content": "here's the whole part",
"attachments": [
{
"id": 1051302011934625800,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051302011934625802/image.png",
"fileName": "image.png",
"fileSizeBytes": 543709
},
{
"id": 1051302012257566800,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051302012257566841/image.png",
"fileName": "image.png",
"fileSizeBytes": 359702
}
],
"mentions": [],
"reference": null
},
{
"id": 1051302093673210000,
"author_id": 632480533464744000,
"author_name": "⚜GianCresent⚜",
"timestamp": "12/10/2022 19:59:11",
"content": "i just need the interpretation for this",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051302164108165100,
"author_id": 632480533464744000,
"author_name": "⚜GianCresent⚜",
"timestamp": "12/10/2022 19:59:28",
"content": "but i don't know how to interpret",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051308242891968500,
"author_id": 632480533464744000,
"author_name": "⚜GianCresent⚜",
"timestamp": "12/10/2022 20:23:37",
"content": "@Helpers",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051312021561426000,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 20:38:38",
"content": "@⚜GianCresent⚜ Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 632480533464744000,
"name": "⚜GianCresent⚜",
"discriminator": "7551",
"nickname": "⚜GianCresent⚜",
"isBot": false
}
],
"reference": null
},
{
"id": 1051319613939527800,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 21:08:48",
"content": "@⚜GianCresent⚜ Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 632480533464744000,
"name": "⚜GianCresent⚜",
"discriminator": "7551",
"nickname": "⚜GianCresent⚜",
"isBot": false
}
],
"reference": null
},
{
"id": 1051321177924190200,
"author_id": 632480533464744000,
"author_name": "⚜GianCresent⚜",
"timestamp": "12/10/2022 21:15:01",
"content": ".close",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051321180897939700,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 21:15:02",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
6155542a1df94b8cbaea154a4bf8bbcf
|
199,994 |
[
{
"id": 1051321433260830800,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 21:16:02",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051322679241736300,
"author_id": 484655885067747300,
"author_name": "el Latte",
"timestamp": "12/10/2022 21:20:59",
"content": "does \"for a,b>0\" means \"for a *or* b is more than 0\" or \"for a *and* b are more than 0\"?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051322682945327100,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 21:21:00",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051322679241736300,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051322826885431400,
"author_id": 176048095543558140,
"author_name": "tushar",
"timestamp": "12/10/2022 21:21:34",
"content": "the latter",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051322863707226200,
"author_id": 484655885067747300,
"author_name": "el Latte",
"timestamp": "12/10/2022 21:21:43",
"content": "cool thanks",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051322886465536100,
"author_id": 484655885067747300,
"author_name": "el Latte",
"timestamp": "12/10/2022 21:21:48",
"content": ".close",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051322890697584800,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 21:21:49",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
3ef994c3ff72431bb909789a4161a83c
|
199,995 |
[
{
"id": 1051325212509098100,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 21:31:03",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051329105783693300,
"author_id": 1033018765622906900,
"author_name": "a4sh",
"timestamp": "12/10/2022 21:46:31",
"content": "say I have a rectangular prism, and I’m trying to find the volume of it, i don’t know it’s length, but I do know it’s width and height, so how would i be able to calculate the volume if I don’t have the length?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051329107956342800,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 21:46:32",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051329105783693300,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051329409983979500,
"author_id": 176048095543558140,
"author_name": "tushar",
"timestamp": "12/10/2022 21:47:44",
"content": "impossible",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051329534110216300,
"author_id": 176048095543558140,
"author_name": "tushar",
"timestamp": "12/10/2022 21:48:13",
"content": "if you can freely choose the length, the volume is not determined",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051329537654411400,
"author_id": 220517274845577200,
"author_name": "ramonov",
"timestamp": "12/10/2022 21:48:14",
"content": "you could introduce a variable like **L** for the unknown length and express the volume terms of that",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051329606722011100,
"author_id": 220517274845577200,
"author_name": "ramonov",
"timestamp": "12/10/2022 21:48:31",
"content": "other than that, without more info, there's not much to do",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051329617300029600,
"author_id": 1033018765622906900,
"author_name": "a4sh",
"timestamp": "12/10/2022 21:48:33",
"content": "shall i send a picture of the prism?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051329660451041300,
"author_id": 220517274845577200,
"author_name": "ramonov",
"timestamp": "12/10/2022 21:48:43",
"content": "yes",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051329701609750500,
"author_id": 220517274845577200,
"author_name": "ramonov",
"timestamp": "12/10/2022 21:48:53",
"content": "ideally you should always post the full original problem",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051329782811463800,
"author_id": 220517274845577200,
"author_name": "ramonov",
"timestamp": "12/10/2022 21:49:12",
"content": "so assumptions don't get mixed in and information isn't lost",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051329983408259100,
"author_id": 1033018765622906900,
"author_name": "a4sh",
"timestamp": "12/10/2022 21:50:00",
"content": "i sent it via dm",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051330019181473900,
"author_id": 220517274845577200,
"author_name": "ramonov",
"timestamp": "12/10/2022 21:50:09",
"content": "send it here...",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051330095350030300,
"author_id": 1033018765622906900,
"author_name": "a4sh",
"timestamp": "12/10/2022 21:50:27",
"content": "oh",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051330099556917400,
"author_id": 1033018765622906900,
"author_name": "a4sh",
"timestamp": "12/10/2022 21:50:28",
"content": "mb",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051330135275606000,
"author_id": 1033018765622906900,
"author_name": "a4sh",
"timestamp": "12/10/2022 21:50:37",
"content": "",
"attachments": [
{
"id": 1051330134931681400,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051330134931681422/IMG_1123.jpg",
"fileName": "IMG_1123.jpg",
"fileSizeBytes": 1908259
}
],
"mentions": [],
"reference": null
},
{
"id": 1051330295212814500,
"author_id": 220517274845577200,
"author_name": "ramonov",
"timestamp": "12/10/2022 21:51:15",
"content": "why do you think length isn't given",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051330361608654800,
"author_id": 1033018765622906900,
"author_name": "a4sh",
"timestamp": "12/10/2022 21:51:30",
"content": "length is given?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051330362640449700,
"author_id": 220517274845577200,
"author_name": "ramonov",
"timestamp": "12/10/2022 21:51:31",
"content": "oh wiat",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051330399508377700,
"author_id": 220517274845577200,
"author_name": "ramonov",
"timestamp": "12/10/2022 21:51:40",
"content": "> ideally you should always post the full original problem",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051330418298867800,
"author_id": 220517274845577200,
"author_name": "ramonov",
"timestamp": "12/10/2022 21:51:44",
"content": "show the words that are cutt off",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051330574540878000,
"author_id": 1033018765622906900,
"author_name": "a4sh",
"timestamp": "12/10/2022 21:52:21",
"content": "",
"attachments": [
{
"id": 1051330574129823700,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051330574129823784/35A0BB30-E239-4D0D-A61E-151C0AE52219.jpg",
"fileName": "35A0BB30-E239-4D0D-A61E-151C0AE52219.jpg",
"fileSizeBytes": 3652688
}
],
"mentions": [],
"reference": null
},
{
"id": 1051330604349788200,
"author_id": 220517274845577200,
"author_name": "ramonov",
"timestamp": "12/10/2022 21:52:28",
"content": ",rotate",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051330610611900500,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "12/10/2022 21:52:30",
"content": "",
"attachments": [
{
"id": 1051330610733514800,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051330610733514762/220517274845577216.png",
"fileName": "220517274845577216.png",
"fileSizeBytes": 1075128
}
],
"mentions": [],
"reference": null
},
{
"id": 1051330810030067700,
"author_id": 220517274845577200,
"author_name": "ramonov",
"timestamp": "12/10/2022 21:53:17",
"content": "seems there might be an issue with the diagram",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051330837012021200,
"author_id": 1033018765622906900,
"author_name": "a4sh",
"timestamp": "12/10/2022 21:53:24",
"content": "hm",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051330863452926000,
"author_id": 1033018765622906900,
"author_name": "a4sh",
"timestamp": "12/10/2022 21:53:30",
"content": "ok…",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051331017723629700,
"author_id": 330423197943988200,
"author_name": "𝚈𝚎𝚎‐𝙷𝚊𝚠 🤠",
"timestamp": "12/10/2022 21:54:07",
"content": "This diagram is breaking my brain",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051331044453929000,
"author_id": 330423197943988200,
"author_name": "𝚈𝚎𝚎‐𝙷𝚊𝚠 🤠",
"timestamp": "12/10/2022 21:54:13",
"content": "what dimension is 1.3cm",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051331044894314600,
"author_id": 220517274845577200,
"author_name": "ramonov",
"timestamp": "12/10/2022 21:54:13",
"content": "",
"attachments": [
{
"id": 1051331044814639200,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051331044814639194/image.png",
"fileName": "image.png",
"fileSizeBytes": 349780
}
],
"mentions": [],
"reference": null
},
{
"id": 1051331066440466600,
"author_id": 220517274845577200,
"author_name": "ramonov",
"timestamp": "12/10/2022 21:54:19",
"content": "it'd make more sense of the 1.3cm was pointing to that",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051331116340105200,
"author_id": 1033018765622906900,
"author_name": "a4sh",
"timestamp": "12/10/2022 21:54:30",
"content": "yeah…",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051331194844889100,
"author_id": 220517274845577200,
"author_name": "ramonov",
"timestamp": "12/10/2022 21:54:49",
"content": "adjust the diagram and approach the problem with that",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051331218534305900,
"author_id": 330423197943988200,
"author_name": "𝚈𝚎𝚎‐𝙷𝚊𝚠 🤠",
"timestamp": "12/10/2022 21:54:55",
"content": "is 1.3 the depth of the top prism?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051331267876114600,
"author_id": 1033018765622906900,
"author_name": "a4sh",
"timestamp": "12/10/2022 21:55:07",
"content": "i believe so",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051331275765600300,
"author_id": 330423197943988200,
"author_name": "𝚈𝚎𝚎‐𝙷𝚊𝚠 🤠",
"timestamp": "12/10/2022 21:55:08",
"content": "and that 4.0cm is referring to the horizontal line right next to it?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051331284301004800,
"author_id": 1033018765622906900,
"author_name": "a4sh",
"timestamp": "12/10/2022 21:55:10",
"content": "yes*",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051331313883422700,
"author_id": 1033018765622906900,
"author_name": "a4sh",
"timestamp": "12/10/2022 21:55:18",
"content": "yeah",
"attachments": [],
"mentions": [
{
"id": 330423197943988200,
"name": "𝚈𝚎𝚎‐𝙷𝚊𝚠 🤠",
"discriminator": "0001",
"nickname": "𝚈𝚎𝚎‐𝙷𝚊𝚠 🤠",
"isBot": false
}
],
"reference": null
},
{
"id": 1051331590925598700,
"author_id": 1033018765622906900,
"author_name": "a4sh",
"timestamp": "12/10/2022 21:56:24",
"content": "no the 4.0 is the vertical line",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051331732449788000,
"author_id": 1033018765622906900,
"author_name": "a4sh",
"timestamp": "12/10/2022 21:56:57",
"content": "oh yeah so the 1.3 depth wouldn’t make sense",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051331920635625500,
"author_id": 1033018765622906900,
"author_name": "a4sh",
"timestamp": "12/10/2022 21:57:42",
"content": "so should I move the 1.3 to make it the length?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051331985919975600,
"author_id": 1033018765622906900,
"author_name": "a4sh",
"timestamp": "12/10/2022 21:57:58",
"content": "or just reply that it’s “invalid”",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051332066870038500,
"author_id": 485903210272391200,
"author_name": "dldh06",
"timestamp": "12/10/2022 21:58:17",
"content": "> it'd make more sense of the 1.3cm was pointing to that",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051332097131950100,
"author_id": 485903210272391200,
"author_name": "dldh06",
"timestamp": "12/10/2022 21:58:24",
"content": "> adjust the diagram and approach the problem with that",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051332119177216000,
"author_id": 485903210272391200,
"author_name": "dldh06",
"timestamp": "12/10/2022 21:58:30",
"content": "Do what ram suggested",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051332157085327400,
"author_id": 1033018765622906900,
"author_name": "a4sh",
"timestamp": "12/10/2022 21:58:39",
"content": "alright",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051332181248704500,
"author_id": 1033018765622906900,
"author_name": "a4sh",
"timestamp": "12/10/2022 21:58:44",
"content": "thanks",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051332200756420600,
"author_id": 1033018765622906900,
"author_name": "a4sh",
"timestamp": "12/10/2022 21:58:49",
"content": "❤️",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051333002841575600,
"author_id": 220517274845577200,
"author_name": "ramonov",
"timestamp": "12/10/2022 22:02:00",
"content": "(and write a nice comment telling them to make a better diagram)",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051333036677017700,
"author_id": 1033018765622906900,
"author_name": "a4sh",
"timestamp": "12/10/2022 22:02:08",
"content": "lol",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051333049826164700,
"author_id": 1033018765622906900,
"author_name": "a4sh",
"timestamp": "12/10/2022 22:02:11",
"content": "ok",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051333111503401100,
"author_id": 1033018765622906900,
"author_name": "a4sh",
"timestamp": "12/10/2022 22:02:26",
"content": ".close",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051333114141605900,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 22:02:27",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
e5287a59efa74cb2ba345220975432c6
|
199,996 |
[
{
"id": 1051333366554820700,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 22:03:27",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051333566547644400,
"author_id": 404546189372162050,
"author_name": "Skywalker",
"timestamp": "12/10/2022 22:04:15",
"content": "Hey math people!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051333568351182800,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 22:04:15",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051333566547644400,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051333627499249800,
"author_id": 404546189372162050,
"author_name": "Skywalker",
"timestamp": "12/10/2022 22:04:29",
"content": "I've got an algorithms exam next week, and so I'm just shaking off the cobwebs",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051333696088711200,
"author_id": 404546189372162050,
"author_name": "Skywalker",
"timestamp": "12/10/2022 22:04:45",
"content": "",
"attachments": [
{
"id": 1051333695774146600,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051333695774146620/Screen_Shot_2022-12-10_at_7.04.42_PM.png",
"fileName": "Screen_Shot_2022-12-10_at_7.04.42_PM.png",
"fileSizeBytes": 529226
}
],
"mentions": [],
"reference": null
},
{
"id": 1051333761838633000,
"author_id": 404546189372162050,
"author_name": "Skywalker",
"timestamp": "12/10/2022 22:05:01",
"content": "This is a master theorem question, right? Where `a=5` and `b=2`?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051337537312014300,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 22:20:01",
"content": "@Skywalker Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 404546189372162050,
"name": "Skywalker",
"discriminator": "9340",
"nickname": "Skywalker",
"isBot": false
}
],
"reference": null
},
{
"id": 1051337624121512000,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 22:20:22",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
e2ba9f4c8ea444cca655581f5f406399
|
199,997 |
[
{
"id": 1051337875762970600,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 22:21:22",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051338801856917500,
"author_id": 811590023324893200,
"author_name": "Swan Queen",
"timestamp": "12/10/2022 22:25:03",
"content": "",
"attachments": [
{
"id": 1051338801596866600,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051338801596866580/Screen_Shot_2022-12-10_at_10.24.19_PM.png",
"fileName": "Screen_Shot_2022-12-10_at_10.24.19_PM.png",
"fileSizeBytes": 498504
}
],
"mentions": [],
"reference": null
},
{
"id": 1051338804390269000,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 22:25:03",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051338801856917500,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051339345308680200,
"author_id": 550813113566625800,
"author_name": "Helps",
"timestamp": "12/10/2022 22:27:12",
"content": "Can't quite make out for sure what is shaded?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051339499382243300,
"author_id": 550813113566625800,
"author_name": "Helps",
"timestamp": "12/10/2022 22:27:49",
"content": "The triangle ACB and a little bit more beside the line BC?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051339716194214000,
"author_id": 811590023324893200,
"author_name": "Swan Queen",
"timestamp": "12/10/2022 22:28:41",
"content": "triangle adc and then then the dcb kinda like quarter circle shape under it",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051340386083274900,
"author_id": 550813113566625800,
"author_name": "Helps",
"timestamp": "12/10/2022 22:31:21",
"content": "I can't immediately see why the line AB should bisect OC but I'm guessing that's the trick here.\n\nIt would allow you to \"swap\" some triangles.",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051340736001491000,
"author_id": 811590023324893200,
"author_name": "Swan Queen",
"timestamp": "12/10/2022 22:32:44",
"content": "what does \"swapping\" the triangles mean?",
"attachments": [],
"mentions": [
{
"id": 550813113566625800,
"name": "Helps",
"discriminator": "1399",
"nickname": "Helps",
"isBot": false
}
],
"reference": null
},
{
"id": 1051341109411983400,
"author_id": 550813113566625800,
"author_name": "Helps",
"timestamp": "12/10/2022 22:34:13",
"content": "Look at the three triangles ODB, OAD and ADC. If they're the same size you could swap the colors without changing the size of the shaded area.",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051341257819050100,
"author_id": 550813113566625800,
"author_name": "Helps",
"timestamp": "12/10/2022 22:34:48",
"content": "I'm convinced they are the same size by imagining an inscribed hexagon in the circle.",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051341506834878500,
"author_id": 550813113566625800,
"author_name": "Helps",
"timestamp": "12/10/2022 22:35:48",
"content": "Specifically if ODB was shaded and ADC was not shaded would it make the question easier?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051341788809539700,
"author_id": 811590023324893200,
"author_name": "Swan Queen",
"timestamp": "12/10/2022 22:36:55",
"content": "probably? cause isn't ob the radius",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051342321402269700,
"author_id": 811590023324893200,
"author_name": "Swan Queen",
"timestamp": "12/10/2022 22:39:02",
"content": "when it says sector oab is 4/3cm does it mean the whole like sector of the circle or just the triangle",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051346097139884200,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 22:54:02",
"content": "@Swan Queen Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 811590023324893200,
"name": "Swan Queen",
"discriminator": "9128",
"nickname": "Swan Queen",
"isBot": false
}
],
"reference": null
},
{
"id": 1051346839934341200,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/10/2022 22:56:59",
"content": "The whole sector of circle",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051347062526050300,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/10/2022 22:57:52",
"content": "What's shaded is a triangle and a triangle with a curved hypotenuse",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051347276620124200,
"author_id": 811590023324893200,
"author_name": "Swan Queen",
"timestamp": "12/10/2022 22:58:43",
"content": "so could i just multiply that 4/3pi by 3 to find the area of the whole circle",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051347376541020200,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/10/2022 22:59:07",
"content": "Sure",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051347439413633000,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/10/2022 22:59:22",
"content": "But how did you know you have to multiply by 3?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051347572821860500,
"author_id": 811590023324893200,
"author_name": "Swan Queen",
"timestamp": "12/10/2022 22:59:54",
"content": "because the angle of the sector is 120 so isn't the sector 1/3 of the circle",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051347604585332700,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/10/2022 23:00:02",
"content": "Yep",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051347930189156400,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/10/2022 23:01:19",
"content": "I suggest finding the radius and then finding OD.",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051348176050860000,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/10/2022 23:02:18",
"content": "Actually here you could use the triangle area using the angle between 2 legs",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051348291587162200,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/10/2022 23:02:45",
"content": "$$Area = 0.5ab\\sin(\\theta)$$",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051348300940464100,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "12/10/2022 23:02:48",
"content": "**VulcanOne**",
"attachments": [
{
"id": 1051348301020139600,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051348301020139611/1000057838007226480.png",
"fileName": "1000057838007226480.png",
"fileSizeBytes": 7040
}
],
"mentions": [],
"reference": null
},
{
"id": 1051348604633223200,
"author_id": 811590023324893200,
"author_name": "Swan Queen",
"timestamp": "12/10/2022 23:04:00",
"content": "so would the radius be 2 cm",
"attachments": [],
"mentions": [
{
"id": 1000057838007226500,
"name": "VulcanOne",
"discriminator": "5806",
"nickname": "VulcanOne",
"isBot": false
}
],
"reference": null
},
{
"id": 1051348664045543600,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/10/2022 23:04:14",
"content": "Yep",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051348764381687800,
"author_id": 811590023324893200,
"author_name": "Swan Queen",
"timestamp": "12/10/2022 23:04:38",
"content": "but how do i use that to find the area",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051349148194054100,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/10/2022 23:06:10",
"content": "The radius is equal to all the lines that go from the center to any point on the circle",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051349246223327200,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/10/2022 23:06:33",
"content": "So OA = OB = OC",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051349269761757200,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/10/2022 23:06:39",
"content": "= 2 cm",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051349314984755300,
"author_id": 811590023324893200,
"author_name": "Swan Queen",
"timestamp": "12/10/2022 23:06:49",
"content": "right",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051349394374537300,
"author_id": 811590023324893200,
"author_name": "Swan Queen",
"timestamp": "12/10/2022 23:07:08",
"content": "so then then would ac also be 2",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051349468458516500,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/10/2022 23:07:26",
"content": "Nope that's gonna have different conditions",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051349521126404100,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/10/2022 23:07:38",
"content": "AC isn't from the center",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051349576134701200,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/10/2022 23:07:52",
"content": "AC is a chord",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051349788903350300,
"author_id": 811590023324893200,
"author_name": "Swan Queen",
"timestamp": "12/10/2022 23:08:42",
"content": "but isn't adc the same as oda but just like flipped",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051349833010651300,
"author_id": 811590023324893200,
"author_name": "Swan Queen",
"timestamp": "12/10/2022 23:08:53",
"content": "so then the hypotenuses would be equal?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051349945162137600,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/10/2022 23:09:20",
"content": "Hmm",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051349990821347500,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/10/2022 23:09:30",
"content": "Maybe finding OD will answer that",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051350121843011600,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/10/2022 23:10:02",
"content": "If OD = 1/2 OC, then OD = DC",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051350186590470300,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/10/2022 23:10:17",
"content": "And that would make the triangles symmetric",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051350347542700200,
"author_id": 811590023324893200,
"author_name": "Swan Queen",
"timestamp": "12/10/2022 23:10:55",
"content": "right and then would both od and dc be 1cm",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051350430577328100,
"author_id": 811590023324893200,
"author_name": "Swan Queen",
"timestamp": "12/10/2022 23:11:15",
"content": "and then i could use that to find ad",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051350468913283100,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/10/2022 23:11:24",
"content": "From 2cos(60)?",
"attachments": [],
"mentions": [
{
"id": 811590023324893200,
"name": "Swan Queen",
"discriminator": "9128",
"nickname": "Swan Queen",
"isBot": false
}
],
"reference": null
},
{
"id": 1051350577768046600,
"author_id": 811590023324893200,
"author_name": "Swan Queen",
"timestamp": "12/10/2022 23:11:50",
"content": "what does that mean?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051350631593545700,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/10/2022 23:12:03",
"content": "Ooo you didn't take trigonometry",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051350700677943300,
"author_id": 811590023324893200,
"author_name": "Swan Queen",
"timestamp": "12/10/2022 23:12:20",
"content": "no, it's my first year of high school",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051350737252274200,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/10/2022 23:12:28",
"content": "Alrighty",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051350806814797800,
"author_id": 811590023324893200,
"author_name": "Swan Queen",
"timestamp": "12/10/2022 23:12:45",
"content": "I thought it was just cause like they said it bisects oc",
"attachments": [],
"mentions": [
{
"id": 550813113566625800,
"name": "Helps",
"discriminator": "1399",
"nickname": "Helps",
"isBot": false
}
],
"reference": null
},
{
"id": 1051350868680785900,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/10/2022 23:13:00",
"content": "But you know the special right triangles",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051350903720005800,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/10/2022 23:13:08",
"content": "Right?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051350933071732900,
"author_id": 811590023324893200,
"author_name": "Swan Queen",
"timestamp": "12/10/2022 23:13:15",
"content": "yeah like 30 60 90 and 45 45 90?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051350946824855600,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/10/2022 23:13:18",
"content": "Yep",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051350976390508500,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/10/2022 23:13:25",
"content": "This is a case of 30,60,90",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051351081738829800,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/10/2022 23:13:51",
"content": "The short leg is always half of the hypotenuse",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051351366687269000,
"author_id": 811590023324893200,
"author_name": "Swan Queen",
"timestamp": "12/10/2022 23:14:58",
"content": "oh right because the side length ratios are 1 2 and root 3 right?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051351421506834600,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/10/2022 23:15:12",
"content": "Yep",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051351605406085100,
"author_id": 811590023324893200,
"author_name": "Swan Queen",
"timestamp": "12/10/2022 23:15:55",
"content": "ok so then ad is root 3?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051351648917790700,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/10/2022 23:16:06",
"content": "Yep",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051351923506290700,
"author_id": 811590023324893200,
"author_name": "Swan Queen",
"timestamp": "12/10/2022 23:17:11",
"content": "so then the area of acd is root 3 divided by 2",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051351977273065600,
"author_id": 811590023324893200,
"author_name": "Swan Queen",
"timestamp": "12/10/2022 23:17:24",
"content": "but how do I find the area of dcb",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051352056373457000,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/10/2022 23:17:43",
"content": "You have the area of the sector right?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051352268982730900,
"author_id": 811590023324893200,
"author_name": "Swan Queen",
"timestamp": "12/10/2022 23:18:34",
"content": "4/3 pi I think",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051352333403029600,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/10/2022 23:18:49",
"content": "Yep",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051352495814881400,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/10/2022 23:19:28",
"content": "And you now know the area of 1 triangle out of the 4 triangles in the sector",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051352820005228700,
"author_id": 811590023324893200,
"author_name": "Swan Queen",
"timestamp": "12/10/2022 23:20:45",
"content": "ohh, so i multiply it by four and subtract that from 4/3 pi and divide by two to get the area of the little sliver and add it do the triangle area",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051352882500345900,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/10/2022 23:21:00",
"content": "Yep exactly",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051352896081502300,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/10/2022 23:21:03",
"content": ":librasmile:",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051353295299563500,
"author_id": 811590023324893200,
"author_name": "Swan Queen",
"timestamp": "12/10/2022 23:22:38",
"content": "wait but how do I do that, my calculator just gave a super long decimal",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051353553979052000,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/10/2022 23:23:40",
"content": "For the shaded region?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051353630403465300,
"author_id": 811590023324893200,
"author_name": "Swan Queen",
"timestamp": "12/10/2022 23:23:58",
"content": "for like the small curved part",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051353726130069500,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/10/2022 23:24:21",
"content": "Hmm what calculator do you have?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051353832153686000,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/10/2022 23:24:46",
"content": "Because I think you can take the answer and directly operate on it",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051353909555368000,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/10/2022 23:25:05",
"content": "Or you can store the answer on a symbol",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051353920485720200,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/10/2022 23:25:07",
"content": "I think",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051354059325575200,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/10/2022 23:25:40",
"content": "If not then you can write out that super long decimal and add the area of the triangles",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051354219157930000,
"author_id": 811590023324893200,
"author_name": "Swan Queen",
"timestamp": "12/10/2022 23:26:19",
"content": "but don't i need it in terms of pi because the multiple choice answers are in terms of pi",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051354322799173600,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/10/2022 23:26:43",
"content": "True",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051354338615890000,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/10/2022 23:26:47",
"content": "However",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051354373395066900,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/10/2022 23:26:55",
"content": "You can divide your answer by pi",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051354444614336600,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/10/2022 23:27:12",
"content": "And you'll then get the area as a number multiplied by pi",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051354631915196400,
"author_id": 811590023324893200,
"author_name": "Swan Queen",
"timestamp": "12/10/2022 23:27:57",
"content": "what?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051354673329737900,
"author_id": 811590023324893200,
"author_name": "Swan Queen",
"timestamp": "12/10/2022 23:28:07",
"content": "so do i divide 0.36... by pi",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051354692040523800,
"author_id": 811590023324893200,
"author_name": "Swan Queen",
"timestamp": "12/10/2022 23:28:11",
"content": "and then add it to the triangle",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051354719504830500,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/10/2022 23:28:18",
"content": "Wait no",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051354727188811900,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/10/2022 23:28:20",
"content": "Not now",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051354755508736000,
"author_id": 811590023324893200,
"author_name": "Swan Queen",
"timestamp": "12/10/2022 23:28:26",
"content": "ok",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051354821397053400,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/10/2022 23:28:42",
"content": "It's better if you do it after you get the total area",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051354991123775500,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/10/2022 23:29:23",
"content": "What did you get for the total area?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051355150788329600,
"author_id": 811590023324893200,
"author_name": "Swan Queen",
"timestamp": "12/10/2022 23:30:01",
"content": "oh, 2/3pi",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051355203640754200,
"author_id": 811590023324893200,
"author_name": "Swan Queen",
"timestamp": "12/10/2022 23:30:13",
"content": "my calculator just automatically changed it",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051355245004984300,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/10/2022 23:30:23",
"content": "Well sweet",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051355254156959700,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/10/2022 23:30:25",
"content": ":librasmile:",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051355339620098200,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/10/2022 23:30:46",
"content": "I got the area as a decimal but I used the trick I mentioned",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051355356888059900,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/10/2022 23:30:50",
"content": "It gave me 2/3",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051355431953498100,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/10/2022 23:31:08",
"content": "Anyways glad it worked out :librasmile:",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051355593471955000,
"author_id": 811590023324893200,
"author_name": "Swan Queen",
"timestamp": "12/10/2022 23:31:46",
"content": "yeah, me too, well tysm, that makes a lot more sense now 🙇♀️",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051355687218856000,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/10/2022 23:32:09",
"content": ":librasmile:",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051355704386146300,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/10/2022 23:32:13",
"content": "Happy to help",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051355728725672100,
"author_id": 811590023324893200,
"author_name": "Swan Queen",
"timestamp": "12/10/2022 23:32:18",
"content": ".close",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051355732840304600,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 23:32:19",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
70d7071b1b2e47b1a7ed9660f1b074d7
|
199,998 |
[
{
"id": 1051355985698095100,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 23:33:20",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051356183950278800,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 23:34:07",
"content": "hi, how can i come to this conclusion? I tried it & got a completely different answer",
"attachments": [
{
"id": 1051356183467921400,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051356183467921418/image.png",
"fileName": "image.png",
"fileSizeBytes": 58089
}
],
"mentions": [],
"reference": null
},
{
"id": 1051356186823372900,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 23:34:08",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051356183950278800,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051356263025475700,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 23:34:26",
"content": "ive never done standard deviation with a frequency",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051356287671218200,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 23:34:32",
"content": "what impact does the frequency have?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051356781244317800,
"author_id": 176048095543558140,
"author_name": "tushar",
"timestamp": "12/10/2022 23:36:29",
"content": "just tells you how many times that value appears in the data",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051356846734180400,
"author_id": 176048095543558140,
"author_name": "tushar",
"timestamp": "12/10/2022 23:36:45",
"content": "i.e. you can imagine the dataset as -66, -66, -88, -88, -88, -88, etc",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051357077773221900,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 23:37:40",
"content": "ohh so",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051357099357110300,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 23:37:45",
"content": "-66 appears twice",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051357117308735500,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 23:37:50",
"content": "-88 appears 4 times",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051357134010470500,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 23:37:54",
"content": "-74 2 times",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051357136178917500,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 23:37:54",
"content": "etc",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051357221214240800,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 23:38:14",
"content": "so, the dataset is actually a lot longer than I initially assumed (6)?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051357822589349900,
"author_id": 176048095543558140,
"author_name": "tushar",
"timestamp": "12/10/2022 23:40:38",
"content": "correct",
"attachments": [],
"mentions": [
{
"id": 651558111538315300,
"name": "Broccoli",
"discriminator": "1889",
"nickname": "Broccoli",
"isBot": false
}
],
"reference": null
},
{
"id": 1051358186105491600,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 23:42:04",
"content": "so, where would the 33 come from? since in this case there would be 13 numbers in the data set",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051358264522186900,
"author_id": 651558111538315300,
"author_name": "Broccoli",
"timestamp": "12/10/2022 23:42:23",
"content": "wouldnt the number be 13 -1 = 12 in the bottom ?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051362040465330200,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/10/2022 23:57:23",
"content": "@Broccoli Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 651558111538315300,
"name": "Broccoli",
"discriminator": "1889",
"nickname": "Broccoli",
"isBot": false
}
],
"reference": null
},
{
"id": 1051370929390878700,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 00:32:43",
"content": "@Broccoli Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 651558111538315300,
"name": "Broccoli",
"discriminator": "1889",
"nickname": "Broccoli",
"isBot": false
}
],
"reference": null
},
{
"id": 1051386221089263600,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 01:33:28",
"content": "@Broccoli Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 651558111538315300,
"name": "Broccoli",
"discriminator": "1889",
"nickname": "Broccoli",
"isBot": false
}
],
"reference": null
},
{
"id": 1051386524580728800,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 01:34:41",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
8024f67cc44a4903b237c2e03f60052f
|
199,999 |
[
{
"id": 1034430582194700400,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "10/25/2022 07:37:49",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034432358809604200,
"author_id": 316269724260499460,
"author_name": "Rayane600",
"timestamp": "10/25/2022 07:44:53",
"content": "",
"attachments": [
{
"id": 1034432358444707800,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1034432358444707860/unknown.png",
"fileName": "unknown.png",
"fileSizeBytes": 6422
}
],
"mentions": [],
"reference": null
},
{
"id": 1034432361447829500,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "10/25/2022 07:44:53",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1034432358809604200,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1034432420725932000,
"author_id": 316269724260499460,
"author_name": "Rayane600",
"timestamp": "10/25/2022 07:45:07",
"content": "this is a linear application",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034432448588681200,
"author_id": 316269724260499460,
"author_name": "Rayane600",
"timestamp": "10/25/2022 07:45:14",
"content": "but i don't understand the way it's written",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034432617837240400,
"author_id": 316269724260499460,
"author_name": "Rayane600",
"timestamp": "10/25/2022 07:45:54",
"content": "i have to say if it's injective , surjective",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034432950676238300,
"author_id": 316269724260499460,
"author_name": "Rayane600",
"timestamp": "10/25/2022 07:47:14",
"content": "and if ker(f) defines a plane of R3",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034433385923366900,
"author_id": 316269724260499460,
"author_name": "Rayane600",
"timestamp": "10/25/2022 07:48:58",
"content": "and if the image of f is a vector line of (1,1)",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034433437488128000,
"author_id": 511209824470564860,
"author_name": "Enoo58",
"timestamp": "10/25/2022 07:49:10",
"content": "what have you tried so far",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034433473026470000,
"author_id": 316269724260499460,
"author_name": "Rayane600",
"timestamp": "10/25/2022 07:49:18",
"content": "the thing is",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034433522951258200,
"author_id": 316269724260499460,
"author_name": "Rayane600",
"timestamp": "10/25/2022 07:49:30",
"content": "i don't understand how im supposed to repersent the application",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034433579645669500,
"author_id": 511209824470564860,
"author_name": "Enoo58",
"timestamp": "10/25/2022 07:49:44",
"content": "do you mean as a matrix?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034433595533701200,
"author_id": 316269724260499460,
"author_name": "Rayane600",
"timestamp": "10/25/2022 07:49:48",
"content": "yes",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034433800379318400,
"author_id": 511209824470564860,
"author_name": "Enoo58",
"timestamp": "10/25/2022 07:50:36",
"content": "so the input is a 3 vector right?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034433827055083500,
"author_id": 316269724260499460,
"author_name": "Rayane600",
"timestamp": "10/25/2022 07:50:43",
"content": "yes",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034433856620744800,
"author_id": 316269724260499460,
"author_name": "Rayane600",
"timestamp": "10/25/2022 07:50:50",
"content": "and the image is 2 vectors",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034433887083974800,
"author_id": 511209824470564860,
"author_name": "Enoo58",
"timestamp": "10/25/2022 07:50:57",
"content": "yes",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034434013311533000,
"author_id": 511209824470564860,
"author_name": "Enoo58",
"timestamp": "10/25/2022 07:51:27",
"content": "and there is a rule to what happens with the dimensions in a matrix vector multiplication",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034434325539733500,
"author_id": 511209824470564860,
"author_name": "Enoo58",
"timestamp": "10/25/2022 07:52:42",
"content": "if we have lets say a nx3 Matrix A and x is a 3x1 vector and b a 2x1 vector\nA * x = b\nnx3 * 3x1 = 2x1",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034434374243979300,
"author_id": 511209824470564860,
"author_name": "Enoo58",
"timestamp": "10/25/2022 07:52:53",
"content": "you can deduce what n has to be",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034434704524456000,
"author_id": 316269724260499460,
"author_name": "Rayane600",
"timestamp": "10/25/2022 07:54:12",
"content": "n=2 ?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034434719489720300,
"author_id": 511209824470564860,
"author_name": "Enoo58",
"timestamp": "10/25/2022 07:54:15",
"content": "exactly",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034434762644914300,
"author_id": 511209824470564860,
"author_name": "Enoo58",
"timestamp": "10/25/2022 07:54:26",
"content": "so we know A is a 2x3 matrix",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034434838037532700,
"author_id": 511209824470564860,
"author_name": "Enoo58",
"timestamp": "10/25/2022 07:54:44",
"content": "one more thing we know is that all non-zero coefficients of A have to be 1",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034434853048959100,
"author_id": 511209824470564860,
"author_name": "Enoo58",
"timestamp": "10/25/2022 07:54:47",
"content": "do you see why?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034434918459129900,
"author_id": 316269724260499460,
"author_name": "Rayane600",
"timestamp": "10/25/2022 07:55:03",
"content": "so would it be",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034434972737605800,
"author_id": 316269724260499460,
"author_name": "Rayane600",
"timestamp": "10/25/2022 07:55:16",
"content": "1 1 0",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034434990819250300,
"author_id": 316269724260499460,
"author_name": "Rayane600",
"timestamp": "10/25/2022 07:55:20",
"content": "0 1 1",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034435024637935600,
"author_id": 511209824470564860,
"author_name": "Enoo58",
"timestamp": "10/25/2022 07:55:28",
"content": "yess",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034435089003712500,
"author_id": 511209824470564860,
"author_name": "Enoo58",
"timestamp": "10/25/2022 07:55:44",
"content": "you can try it out by multiplying with (x,y,z)",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034435227931643900,
"author_id": 316269724260499460,
"author_name": "Rayane600",
"timestamp": "10/25/2022 07:56:17",
"content": "and from there can you deduce the rank of f ?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034435357397237800,
"author_id": 511209824470564860,
"author_name": "Enoo58",
"timestamp": "10/25/2022 07:56:48",
"content": "yes",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034435483654160400,
"author_id": 316269724260499460,
"author_name": "Rayane600",
"timestamp": "10/25/2022 07:57:18",
"content": "is it like 3 ?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034435533499285600,
"author_id": 316269724260499460,
"author_name": "Rayane600",
"timestamp": "10/25/2022 07:57:30",
"content": "or no no 2",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034435552646275100,
"author_id": 511209824470564860,
"author_name": "Enoo58",
"timestamp": "10/25/2022 07:57:34",
"content": "remember it cant be 3 if we have a 2x3 matrix",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034435597374341100,
"author_id": 511209824470564860,
"author_name": "Enoo58",
"timestamp": "10/25/2022 07:57:45",
"content": "yes this is correct",
"attachments": [],
"mentions": [
{
"id": 316269724260499460,
"name": "Rayane600",
"discriminator": "0784",
"nickname": "Rayane600",
"isBot": false
}
],
"reference": null
},
{
"id": 1034435609730760700,
"author_id": 316269724260499460,
"author_name": "Rayane600",
"timestamp": "10/25/2022 07:57:48",
"content": "neat",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034435923712155600,
"author_id": 316269724260499460,
"author_name": "Rayane600",
"timestamp": "10/25/2022 07:59:03",
"content": "Thanks man",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034435935854661600,
"author_id": 316269724260499460,
"author_name": "Rayane600",
"timestamp": "10/25/2022 07:59:05",
"content": ".close",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034435939050733600,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "10/25/2022 07:59:06",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
9a074b6314c24fd8953286abf71c7655
|
200,000 |
[
{
"id": 1051386776654200800,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 01:35:41",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051387079814299800,
"author_id": 820526372488347600,
"author_name": "workaholic",
"timestamp": "12/11/2022 01:36:53",
"content": "helo",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051387081512996900,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 01:36:54",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051387079814299800,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051387098332139500,
"author_id": 820526372488347600,
"author_name": "workaholic",
"timestamp": "12/11/2022 01:36:58",
"content": "https://media.discordapp.net/attachments/853903852964544522/1051385788815921202/image.png",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051387108482371600,
"author_id": 820526372488347600,
"author_name": "workaholic",
"timestamp": "12/11/2022 01:37:00",
"content": "how to do this",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051390884421312500,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 01:52:00",
"content": "@workaholic Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 820526372488347600,
"name": "workaholic",
"discriminator": "8992",
"nickname": "workaholic",
"isBot": false
}
],
"reference": null
},
{
"id": 1051398350873837600,
"author_id": 118663865264242690,
"author_name": "夢雪",
"timestamp": "12/11/2022 02:21:40",
"content": ",w Table[-7y^2 mod 5, {y, 0, 4}]",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051398358796877800,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "12/11/2022 02:21:42",
"content": "Results provided by WolframAlpha",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051401461680046100,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 02:34:02",
"content": "@workaholic Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 820526372488347600,
"name": "workaholic",
"discriminator": "8992",
"nickname": "workaholic",
"isBot": false
}
],
"reference": null
},
{
"id": 1051401763753824400,
"author_id": 820526372488347600,
"author_name": "workaholic",
"timestamp": "12/11/2022 02:35:14",
"content": "math is a scam",
"attachments": [],
"mentions": [
{
"id": 118663865264242690,
"name": "夢雪",
"discriminator": "2250",
"nickname": "snow",
"isBot": false
}
],
"reference": null
},
{
"id": 1051409013251788800,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 03:04:02",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
3cfb93a72e824f84bddb3d2a38c94205
|
200,001 |
[
{
"id": 1051414216751456300,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 03:24:43",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051416754938724400,
"author_id": 900947683148177400,
"author_name": "an enchilada",
"timestamp": "12/11/2022 03:34:48",
"content": "Hi, using my knowledge of the distributive property I was able to get `6x^2 - y^2`. I'm unsure where the middle `xy` comes from",
"attachments": [
{
"id": 1051416754594787500,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051416754594787418/image.png",
"fileName": "image.png",
"fileSizeBytes": 4642
}
],
"mentions": [],
"reference": null
},
{
"id": 1051416759023964200,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 03:34:49",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051416754938724400,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051417116273815600,
"author_id": 348696743388381200,
"author_name": "A Lonely Bean",
"timestamp": "12/11/2022 03:36:14",
"content": "(2x - y)(3x + y) = 2x * 3x + 2x * y - y * 3x - y * y = 6x^2 + 2xy - 3xy - y^2 = 6x^2 - xy - y^2",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051417202932322300,
"author_id": 895276378000359600,
"author_name": "W. White",
"timestamp": "12/11/2022 03:36:35",
"content": "Hey mate, simple one\nIf 2+b = 1\nWhat is the value of b?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051417357496631300,
"author_id": 183668144404037630,
"author_name": "Ann",
"timestamp": "12/11/2022 03:37:12",
"content": "@W. White open your own channel",
"attachments": [],
"mentions": [
{
"id": 895276378000359600,
"name": "W. White",
"discriminator": "2369",
"nickname": "W. White",
"isBot": false
}
],
"reference": null
},
{
"id": 1051417470692507600,
"author_id": 895276378000359600,
"author_name": "W. White",
"timestamp": "12/11/2022 03:37:39",
"content": "Please explain how do i do that?",
"attachments": [],
"mentions": [
{
"id": 183668144404037630,
"name": "Ann",
"discriminator": "0413",
"nickname": "Ann",
"isBot": false
}
],
"reference": null
},
{
"id": 1051417512681676800,
"author_id": 183668144404037630,
"author_name": "Ann",
"timestamp": "12/11/2022 03:37:49",
"content": "read #❓how-to-get-help for instructions",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051417563684417700,
"author_id": 895276378000359600,
"author_name": "W. White",
"timestamp": "12/11/2022 03:38:01",
"content": "Alright",
"attachments": [],
"mentions": [
{
"id": 183668144404037630,
"name": "Ann",
"discriminator": "0413",
"nickname": "Ann",
"isBot": false
}
],
"reference": null
},
{
"id": 1051417701375029400,
"author_id": 900947683148177400,
"author_name": "an enchilada",
"timestamp": "12/11/2022 03:38:34",
"content": "thanks a lot!!",
"attachments": [],
"mentions": [
{
"id": 348696743388381200,
"name": "A Lonely Bean",
"discriminator": "7998",
"nickname": "A Lonely Bean",
"isBot": false
}
],
"reference": null
},
{
"id": 1051417708425646100,
"author_id": 900947683148177400,
"author_name": "an enchilada",
"timestamp": "12/11/2022 03:38:36",
"content": ".close",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051417711265198100,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 03:38:36",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
ad89a8ec853d42298b060ad91777fe89
|
200,002 |
[
{
"id": 1051419284598956000,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 03:44:51",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051429289549103100,
"author_id": 978720838452904100,
"author_name": "dark",
"timestamp": "12/11/2022 04:24:37",
"content": "How do I solve this?",
"attachments": [
{
"id": 1051429289251323900,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051429289251323934/image.png",
"fileName": "image.png",
"fileSizeBytes": 52753
}
],
"mentions": [],
"reference": null
},
{
"id": 1051429292162154500,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 04:24:37",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051429289549103100,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051429995656007800,
"author_id": 978720838452904100,
"author_name": "dark",
"timestamp": "12/11/2022 04:27:25",
"content": "I got these two equations",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051430009430081500,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "12/11/2022 04:27:28",
"content": "**dark**",
"attachments": [
{
"id": 1051430009539153900,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051430009539153960/978720838452904009.png",
"fileName": "978720838452904009.png",
"fileSizeBytes": 7635
}
],
"mentions": [],
"reference": null
},
{
"id": 1051430068448133100,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "12/11/2022 04:27:42",
"content": "**dark**",
"attachments": [
{
"id": 1051430068515262600,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051430068515262544/978720838452904009.png",
"fileName": "978720838452904009.png",
"fileSizeBytes": 4567
}
],
"mentions": [],
"reference": null
},
{
"id": 1051430151927373800,
"author_id": 978720838452904100,
"author_name": "dark",
"timestamp": "12/11/2022 04:28:02",
"content": "Where, x is the original price per orange and n is the original amount of oranges",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051430177705578500,
"author_id": 978720838452904100,
"author_name": "dark",
"timestamp": "12/11/2022 04:28:08",
"content": "but i cant seem to solve this",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051433955611644000,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 04:43:09",
"content": "@dark Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 978720838452904100,
"name": "dark",
"discriminator": "0007",
"nickname": "dark",
"isBot": false
}
],
"reference": null
},
{
"id": 1051434090567569400,
"author_id": 978720838452904100,
"author_name": "dark",
"timestamp": "12/11/2022 04:43:41",
"content": "@Helpers Sorry for pinging but it's been 15 minutes",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051435510222032900,
"author_id": 511209824470564860,
"author_name": "Enoo58",
"timestamp": "12/11/2022 04:49:20",
"content": "what does this equation represent?",
"attachments": [],
"mentions": [
{
"id": 510789298321096700,
"name": "TeXit",
"discriminator": "0796",
"nickname": "TeXit",
"isBot": true
}
],
"reference": null
},
{
"id": 1051435747481243600,
"author_id": 511209824470564860,
"author_name": "Enoo58",
"timestamp": "12/11/2022 04:50:16",
"content": "try not to squish everythin in one equation",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051435773758558200,
"author_id": 511209824470564860,
"author_name": "Enoo58",
"timestamp": "12/11/2022 04:50:23",
"content": "make 3 seperate ones",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051435941455204400,
"author_id": 511209824470564860,
"author_name": "Enoo58",
"timestamp": "12/11/2022 04:51:03",
"content": "@dark",
"attachments": [],
"mentions": [
{
"id": 978720838452904100,
"name": "dark",
"discriminator": "0007",
"nickname": "dark",
"isBot": false
}
],
"reference": null
},
{
"id": 1051438307927654400,
"author_id": 978720838452904100,
"author_name": "dark",
"timestamp": "12/11/2022 05:00:27",
"content": "hey I tried to make a equation to get the price and amount",
"attachments": [],
"mentions": [
{
"id": 511209824470564860,
"name": "Enoo58",
"discriminator": "9243",
"nickname": "Enoo58",
"isBot": false
}
],
"reference": null
},
{
"id": 1051438345680592900,
"author_id": 978720838452904100,
"author_name": "dark",
"timestamp": "12/11/2022 05:00:36",
"content": "which ones could I make?",
"attachments": [],
"mentions": [
{
"id": 511209824470564860,
"name": "Enoo58",
"discriminator": "9243",
"nickname": "Enoo58",
"isBot": false
}
],
"reference": null
},
{
"id": 1051438441331708000,
"author_id": 511209824470564860,
"author_name": "Enoo58",
"timestamp": "12/11/2022 05:00:59",
"content": "so one for john one for jenny and one for the price difference",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051438752964300800,
"author_id": 978720838452904100,
"author_name": "dark",
"timestamp": "12/11/2022 05:02:13",
"content": "okay",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051443149291135000,
"author_id": 978720838452904100,
"author_name": "dark",
"timestamp": "12/11/2022 05:19:41",
"content": "what would they be?",
"attachments": [],
"mentions": [
{
"id": 511209824470564860,
"name": "Enoo58",
"discriminator": "9243",
"nickname": "Enoo58",
"isBot": false
}
],
"reference": null
},
{
"id": 1051443189971697700,
"author_id": 511209824470564860,
"author_name": "Enoo58",
"timestamp": "12/11/2022 05:19:51",
"content": "what have you got?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051443232812310500,
"author_id": 978720838452904100,
"author_name": "dark",
"timestamp": "12/11/2022 05:20:01",
"content": "xn = 20 for John",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051443296389578800,
"author_id": 978720838452904100,
"author_name": "dark",
"timestamp": "12/11/2022 05:20:16",
"content": "(x-0.1)(n+10) = 20 for jenny",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051443428061356200,
"author_id": 978720838452904100,
"author_name": "dark",
"timestamp": "12/11/2022 05:20:48",
"content": "thats it",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051443439994146800,
"author_id": 511209824470564860,
"author_name": "Enoo58",
"timestamp": "12/11/2022 05:20:50",
"content": "yeah this works also",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051443550753136600,
"author_id": 978720838452904100,
"author_name": "dark",
"timestamp": "12/11/2022 05:21:17",
"content": "is this enough to solve it?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051443569371656200,
"author_id": 511209824470564860,
"author_name": "Enoo58",
"timestamp": "12/11/2022 05:21:21",
"content": "yes",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051443624119902200,
"author_id": 978720838452904100,
"author_name": "dark",
"timestamp": "12/11/2022 05:21:34",
"content": "how though",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051443626632286200,
"author_id": 511209824470564860,
"author_name": "Enoo58",
"timestamp": "12/11/2022 05:21:35",
"content": "so we want to know the original amount n",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051443858107551700,
"author_id": 511209824470564860,
"author_name": "Enoo58",
"timestamp": "12/11/2022 05:22:30",
"content": "best way would be to change first equation to get x on one side",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051443882686169200,
"author_id": 511209824470564860,
"author_name": "Enoo58",
"timestamp": "12/11/2022 05:22:36",
"content": "and then put it in the second one",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051443902525227100,
"author_id": 978720838452904100,
"author_name": "dark",
"timestamp": "12/11/2022 05:22:41",
"content": "ok",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051444072671355000,
"author_id": 978720838452904100,
"author_name": "dark",
"timestamp": "12/11/2022 05:23:21",
"content": "$x=20/n$",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051444082888675300,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "12/11/2022 05:23:24",
"content": "**dark**",
"attachments": [
{
"id": 1051444083022901200,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051444083022901288/978720838452904009.png",
"fileName": "978720838452904009.png",
"fileSizeBytes": 5506
}
],
"mentions": [],
"reference": null
},
{
"id": 1051444109799325700,
"author_id": 978720838452904100,
"author_name": "dark",
"timestamp": "12/11/2022 05:23:30",
"content": "like this?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051444126693990400,
"author_id": 511209824470564860,
"author_name": "Enoo58",
"timestamp": "12/11/2022 05:23:34",
"content": "yes",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051444159782846500,
"author_id": 511209824470564860,
"author_name": "Enoo58",
"timestamp": "12/11/2022 05:23:42",
"content": "now into the second equation",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051444263096946700,
"author_id": 978720838452904100,
"author_name": "dark",
"timestamp": "12/11/2022 05:24:07",
"content": "do I expand the second equation to get x on one side",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051444382823358500,
"author_id": 511209824470564860,
"author_name": "Enoo58",
"timestamp": "12/11/2022 05:24:35",
"content": "do it the way you know best",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051444441283575800,
"author_id": 511209824470564860,
"author_name": "Enoo58",
"timestamp": "12/11/2022 05:24:49",
"content": "there is not one correct way to do it",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051444836970025000,
"author_id": 978720838452904100,
"author_name": "dark",
"timestamp": "12/11/2022 05:26:24",
"content": "ok one sec",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051444972521541600,
"author_id": 978720838452904100,
"author_name": "dark",
"timestamp": "12/11/2022 05:26:56",
"content": "$0.1n +1/ n+10 = 20/n$",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051444981228900400,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "12/11/2022 05:26:58",
"content": "**dark**",
"attachments": [
{
"id": 1051444981342154800,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051444981342154762/978720838452904009.png",
"fileName": "978720838452904009.png",
"fileSizeBytes": 6804
}
],
"mentions": [],
"reference": null
},
{
"id": 1051445127916298400,
"author_id": 978720838452904100,
"author_name": "dark",
"timestamp": "12/11/2022 05:27:33",
"content": "this gives 200",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051446887267438600,
"author_id": 978720838452904100,
"author_name": "dark",
"timestamp": "12/11/2022 05:34:32",
"content": "@Enoo58 made a small mistake but I got the correct answer which is 40",
"attachments": [],
"mentions": [
{
"id": 511209824470564860,
"name": "Enoo58",
"discriminator": "9243",
"nickname": "Enoo58",
"isBot": false
}
],
"reference": null
},
{
"id": 1051446945786372100,
"author_id": 511209824470564860,
"author_name": "Enoo58",
"timestamp": "12/11/2022 05:34:46",
"content": "yeah 40 is correct",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051447022210785300,
"author_id": 978720838452904100,
"author_name": "dark",
"timestamp": "12/11/2022 05:35:05",
"content": "idk how I didnt think of doing n=n and then subsituting the equations in",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051447092461179000,
"author_id": 978720838452904100,
"author_name": "dark",
"timestamp": "12/11/2022 05:35:21",
"content": ".close",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051447095363633200,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 05:35:22",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
86a10465871d4289b9e93c3fcbe545ba
|
200,003 |
[
{
"id": 1051447347193856000,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 05:36:22",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051447755312201900,
"author_id": 932873609221931100,
"author_name": "Lightbringer3609",
"timestamp": "12/11/2022 05:37:59",
"content": "how do I use mental math to solve for 14.59 x .5 = ?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051447758625701900,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 05:38:00",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051447755312201900,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051447886233227400,
"author_id": 932873609221931100,
"author_name": "Lightbringer3609",
"timestamp": "12/11/2022 05:38:31",
"content": "I'm taking a timed aptitude test and I want to try to solve as fast as possible",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051447896622506000,
"author_id": 183668144404037630,
"author_name": "Ann",
"timestamp": "12/11/2022 05:38:33",
"content": "dividing by two is not hard to do mentally",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051447975110516700,
"author_id": 932873609221931100,
"author_name": "Lightbringer3609",
"timestamp": "12/11/2022 05:38:52",
"content": "so just think of it as dividing by 2",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051448025530253300,
"author_id": 183668144404037630,
"author_name": "Ann",
"timestamp": "12/11/2022 05:39:04",
"content": "well multiplication by one-half is the same as dividing by two, yes",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051448447343022100,
"author_id": 932873609221931100,
"author_name": "Lightbringer3609",
"timestamp": "12/11/2022 05:40:44",
"content": "okay how do I use mental math to divide 14.59 by 2?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051448487088238600,
"author_id": 932873609221931100,
"author_name": "Lightbringer3609",
"timestamp": "12/11/2022 05:40:54",
"content": "how would you break down 14.59?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051448534144127000,
"author_id": 932873609221931100,
"author_name": "Lightbringer3609",
"timestamp": "12/11/2022 05:41:05",
"content": "10/2= 5",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051448696912478200,
"author_id": 183668144404037630,
"author_name": "Ann",
"timestamp": "12/11/2022 05:41:44",
"content": "14/2 = 7, 0.5/2 = 0.25, 0.09/2 = 0.045",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051448732102709200,
"author_id": 183668144404037630,
"author_name": "Ann",
"timestamp": "12/11/2022 05:41:52",
"content": "this is how i would do it",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051448739371421800,
"author_id": 183668144404037630,
"author_name": "Ann",
"timestamp": "12/11/2022 05:41:54",
"content": "mental math wise",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051448802491498600,
"author_id": 183668144404037630,
"author_name": "Ann",
"timestamp": "12/11/2022 05:42:09",
"content": "or you could also do it as 14.6 - 0.01",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051448844560379900,
"author_id": 183668144404037630,
"author_name": "Ann",
"timestamp": "12/11/2022 05:42:19",
"content": "and then 14.6/2 is much easier mentally",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051448930354872300,
"author_id": 932873609221931100,
"author_name": "Lightbringer3609",
"timestamp": "12/11/2022 05:42:39",
"content": "okay yes that's great just round off",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051449074680860800,
"author_id": 932873609221931100,
"author_name": "Lightbringer3609",
"timestamp": "12/11/2022 05:43:14",
"content": "14.6/2=7.3",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051449196558950400,
"author_id": 932873609221931100,
"author_name": "Lightbringer3609",
"timestamp": "12/11/2022 05:43:43",
"content": "thank you!!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051452972485324800,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 05:58:43",
"content": "@Lightbringer3609 Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 932873609221931100,
"name": "Lightbringer3609",
"discriminator": "9903",
"nickname": "Lightbringer3609",
"isBot": false
}
],
"reference": null
},
{
"id": 1051455657733275800,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 06:09:23",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
d7f16932beba4a14ba04777df7cc5ebe
|
200,004 |
[
{
"id": 1051456666899591200,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 06:13:24",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051457054180655100,
"author_id": 981255563159695500,
"author_name": "mar-",
"timestamp": "12/11/2022 06:14:56",
"content": "",
"attachments": [
{
"id": 1051457053916405800,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051457053916405810/image.png",
"fileName": "image.png",
"fileSizeBytes": 14177
}
],
"mentions": [],
"reference": null
},
{
"id": 1051457056298782800,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 06:14:57",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051457054180655100,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051457090956300400,
"author_id": 981255563159695500,
"author_name": "mar-",
"timestamp": "12/11/2022 06:15:05",
"content": "how do I go about this question",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051457116583505900,
"author_id": 981255563159695500,
"author_name": "mar-",
"timestamp": "12/11/2022 06:15:11",
"content": "is it",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051457128499519600,
"author_id": 981255563159695500,
"author_name": "mar-",
"timestamp": "12/11/2022 06:15:14",
"content": "ln x = log x",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051457204538060800,
"author_id": 987071591169011700,
"author_name": "kiritoholy",
"timestamp": "12/11/2022 06:15:32",
"content": "its simple",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051457215762026600,
"author_id": 176048095543558140,
"author_name": "tushar",
"timestamp": "12/11/2022 06:15:35",
"content": "change of base formula",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051457244186816600,
"author_id": 987071591169011700,
"author_name": "kiritoholy",
"timestamp": "12/11/2022 06:15:42",
"content": "base change",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051457252156002300,
"author_id": 987071591169011700,
"author_name": "kiritoholy",
"timestamp": "12/11/2022 06:15:44",
"content": "or",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051457253288452100,
"author_id": 981255563159695500,
"author_name": "mar-",
"timestamp": "12/11/2022 06:15:44",
"content": "my problem isn't knowing how to do it",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051457272443842700,
"author_id": 756743425272840200,
"author_name": "anand",
"timestamp": "12/11/2022 06:15:48",
"content": "Lnx is with base e and logx is with base 10",
"attachments": [],
"mentions": [
{
"id": 981255563159695500,
"name": "mar-",
"discriminator": "3229",
"nickname": "mar-",
"isBot": false
}
],
"reference": null
},
{
"id": 1051457276373909500,
"author_id": 981255563159695500,
"author_name": "mar-",
"timestamp": "12/11/2022 06:15:49",
"content": "my problem is i don't understand what the question wants",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051457298607910900,
"author_id": 987071591169011700,
"author_name": "kiritoholy",
"timestamp": "12/11/2022 06:15:55",
"content": "ln=2.303 *log",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051457312411361300,
"author_id": 981255563159695500,
"author_name": "mar-",
"timestamp": "12/11/2022 06:15:58",
"content": "lol",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051457339074543600,
"author_id": 981255563159695500,
"author_name": "mar-",
"timestamp": "12/11/2022 06:16:04",
"content": "is it ln x = log x or smth else",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051457391910203400,
"author_id": 756743425272840200,
"author_name": "anand",
"timestamp": "12/11/2022 06:16:17",
"content": ".. They are different",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051457407097765900,
"author_id": 987071591169011700,
"author_name": "kiritoholy",
"timestamp": "12/11/2022 06:16:20",
"content": "see",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051457470633103400,
"author_id": 981255563159695500,
"author_name": "mar-",
"timestamp": "12/11/2022 06:16:36",
"content": "still doesn't answer my question",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051457534432657400,
"author_id": 981255563159695500,
"author_name": "mar-",
"timestamp": "12/11/2022 06:16:51",
"content": "am i supposed to equate ln x to log x",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051457554624032800,
"author_id": 981255563159695500,
"author_name": "mar-",
"timestamp": "12/11/2022 06:16:56",
"content": "that's my question",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051457634030588000,
"author_id": 724791899730346100,
"author_name": "chris.",
"timestamp": "12/11/2022 06:17:15",
"content": "what grades are you on?",
"attachments": [],
"mentions": [
{
"id": 981255563159695500,
"name": "mar-",
"discriminator": "3229",
"nickname": "mar-",
"isBot": false
}
],
"reference": null
},
{
"id": 1051457662778351600,
"author_id": 981255563159695500,
"author_name": "mar-",
"timestamp": "12/11/2022 06:17:21",
"content": "uni math 1",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051457671062110200,
"author_id": 987071591169011700,
"author_name": "kiritoholy",
"timestamp": "12/11/2022 06:17:23",
"content": "dude",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051457686769778800,
"author_id": 756743425272840200,
"author_name": "anand",
"timestamp": "12/11/2022 06:17:27",
"content": "Hemlo Chris",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051457691492565000,
"author_id": 987071591169011700,
"author_name": "kiritoholy",
"timestamp": "12/11/2022 06:17:28",
"content": "i write it",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051457693874925600,
"author_id": 981255563159695500,
"author_name": "mar-",
"timestamp": "12/11/2022 06:17:29",
"content": "this is my introductory class so yeah",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051457705635745900,
"author_id": 724791899730346100,
"author_name": "chris.",
"timestamp": "12/11/2022 06:17:32",
"content": "hello",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051457710345961600,
"author_id": 987071591169011700,
"author_name": "kiritoholy",
"timestamp": "12/11/2022 06:17:33",
"content": "see it again",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051457755870933000,
"author_id": 756743425272840200,
"author_name": "anand",
"timestamp": "12/11/2022 06:17:44",
"content": "Bro ignoring us",
"attachments": [],
"mentions": [
{
"id": 987071591169011700,
"name": "kiritoholy",
"discriminator": "2103",
"nickname": "kiritoholy",
"isBot": false
}
],
"reference": null
},
{
"id": 1051457769695350800,
"author_id": 987071591169011700,
"author_name": "kiritoholy",
"timestamp": "12/11/2022 06:17:47",
"content": "ln=2.303*log",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051457792915034200,
"author_id": 981255563159695500,
"author_name": "mar-",
"timestamp": "12/11/2022 06:17:52",
"content": "yes i see you guys wrote that",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051457799101616100,
"author_id": 176048095543558140,
"author_name": "tushar",
"timestamp": "12/11/2022 06:17:54",
"content": "the change of base formula:",
"attachments": [
{
"id": 1051457798837391500,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051457798837391470/Screen_Shot_2022-12-11_at_10.17.45_pm.png",
"fileName": "Screen_Shot_2022-12-11_at_10.17.45_pm.png",
"fileSizeBytes": 13372
}
],
"mentions": [],
"reference": null
},
{
"id": 1051457888083779700,
"author_id": 987071591169011700,
"author_name": "kiritoholy",
"timestamp": "12/11/2022 06:18:15",
"content": "Bro want girls to explain him :).",
"attachments": [],
"mentions": [
{
"id": 756743425272840200,
"name": "anand",
"discriminator": "0990",
"nickname": "anand",
"isBot": false
}
],
"reference": null
},
{
"id": 1051457928219086800,
"author_id": 756743425272840200,
"author_name": "anand",
"timestamp": "12/11/2022 06:18:25",
"content": "Lemme change my pfp then",
"attachments": [],
"mentions": [
{
"id": 987071591169011700,
"name": "kiritoholy",
"discriminator": "2103",
"nickname": "kiritoholy",
"isBot": false
}
],
"reference": null
},
{
"id": 1051457950646026200,
"author_id": 987071591169011700,
"author_name": "kiritoholy",
"timestamp": "12/11/2022 06:18:30",
"content": "lol",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051457953464598500,
"author_id": 981255563159695500,
"author_name": "mar-",
"timestamp": "12/11/2022 06:18:31",
"content": "alright ty",
"attachments": [],
"mentions": [
{
"id": 176048095543558140,
"name": "tushar",
"discriminator": "0942",
"nickname": "tushar",
"isBot": false
}
],
"reference": null
},
{
"id": 1051457971906953200,
"author_id": 724791899730346100,
"author_name": "chris.",
"timestamp": "12/11/2022 06:18:35",
"content": "jajaja",
"attachments": [],
"mentions": [
{
"id": 756743425272840200,
"name": "anand",
"discriminator": "0990",
"nickname": "anand",
"isBot": false
}
],
"reference": null
},
{
"id": 1051458001715871700,
"author_id": 981255563159695500,
"author_name": "mar-",
"timestamp": "12/11/2022 06:18:42",
"content": "damn bro you're hilarious",
"attachments": [],
"mentions": [
{
"id": 987071591169011700,
"name": "kiritoholy",
"discriminator": "2103",
"nickname": "kiritoholy",
"isBot": false
}
],
"reference": null
},
{
"id": 1051458017935241200,
"author_id": 981255563159695500,
"author_name": "mar-",
"timestamp": "12/11/2022 06:18:46",
"content": "lol",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051458058087309400,
"author_id": 724791899730346100,
"author_name": "chris.",
"timestamp": "12/11/2022 06:18:56",
"content": "when did you start learning log?",
"attachments": [],
"mentions": [
{
"id": 981255563159695500,
"name": "mar-",
"discriminator": "3229",
"nickname": "mar-",
"isBot": false
}
],
"reference": null
},
{
"id": 1051458080828833900,
"author_id": 981255563159695500,
"author_name": "mar-",
"timestamp": "12/11/2022 06:19:01",
"content": ".close",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051458083580281000,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 06:19:02",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
d728bb75f34d421798e004fa8eabb3f7
|
200,005 |
[
{
"id": 1051458116887269500,
"author_id": 987071591169011700,
"author_name": "kiritoholy",
"timestamp": "12/11/2022 06:19:10",
"content": "in elementry classes",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051458126165061600,
"author_id": 756743425272840200,
"author_name": "anand",
"timestamp": "12/11/2022 06:19:12",
"content": "Ok so now I can explain ig",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051458126404124700,
"author_id": 987071591169011700,
"author_name": "kiritoholy",
"timestamp": "12/11/2022 06:19:12",
"content": "me",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051458149502169100,
"author_id": 987071591169011700,
"author_name": "kiritoholy",
"timestamp": "12/11/2022 06:19:17",
"content": "lol",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051458149623799800,
"author_id": 724791899730346100,
"author_name": "chris.",
"timestamp": "12/11/2022 06:19:18",
"content": "grade?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051458176245055500,
"author_id": 756743425272840200,
"author_name": "anand",
"timestamp": "12/11/2022 06:19:24",
"content": "Nvm he closed it",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051458179655024600,
"author_id": 987071591169011700,
"author_name": "kiritoholy",
"timestamp": "12/11/2022 06:19:25",
"content": "lol :).",
"attachments": [],
"mentions": [
{
"id": 756743425272840200,
"name": "anand",
"discriminator": "0990",
"nickname": "anand",
"isBot": false
}
],
"reference": null
},
{
"id": 1051458221170249700,
"author_id": 987071591169011700,
"author_name": "kiritoholy",
"timestamp": "12/11/2022 06:19:35",
"content": "cute:)>",
"attachments": [],
"mentions": [
{
"id": 756743425272840200,
"name": "anand",
"discriminator": "0990",
"nickname": "anand",
"isBot": false
}
],
"reference": null
},
{
"id": 1051458222378201100,
"author_id": 724791899730346100,
"author_name": "chris.",
"timestamp": "12/11/2022 06:19:35",
"content": ":catThink:",
"attachments": [],
"mentions": [
{
"id": 756743425272840200,
"name": "anand",
"discriminator": "0990",
"nickname": "anand",
"isBot": false
}
],
"reference": null
},
{
"id": 1051458253298602100,
"author_id": 987071591169011700,
"author_name": "kiritoholy",
"timestamp": "12/11/2022 06:19:42",
"content": "Beluga",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051458271782903800,
"author_id": 724791899730346100,
"author_name": "chris.",
"timestamp": "12/11/2022 06:19:47",
"content": "certain grade?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051458277424234500,
"author_id": 724791899730346100,
"author_name": "chris.",
"timestamp": "12/11/2022 06:19:48",
"content": "when",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051458400426414100,
"author_id": 756743425272840200,
"author_name": "anand",
"timestamp": "12/11/2022 06:20:17",
"content": "💀",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051458540050596000,
"author_id": 724791899730346100,
"author_name": "chris.",
"timestamp": "12/11/2022 06:20:51",
"content": "can you recommend me some yt channel to learn math ahead?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051458631603863600,
"author_id": 756743425272840200,
"author_name": "anand",
"timestamp": "12/11/2022 06:21:12",
"content": "Which kinda meth?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051458659059777500,
"author_id": 756743425272840200,
"author_name": "anand",
"timestamp": "12/11/2022 06:21:19",
"content": "Khan Academy is pretty gud",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051458727980568600,
"author_id": 724791899730346100,
"author_name": "chris.",
"timestamp": "12/11/2022 06:21:35",
"content": "I'm on grade 10",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051458787413852300,
"author_id": 724791899730346100,
"author_name": "chris.",
"timestamp": "12/11/2022 06:21:50",
"content": "after absolute and log what is ahead?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051458948894564400,
"author_id": 756743425272840200,
"author_name": "anand",
"timestamp": "12/11/2022 06:22:28",
"content": "Cbse?",
"attachments": [],
"mentions": [
{
"id": 724791899730346100,
"name": "chris.",
"discriminator": "3672",
"nickname": "chris.",
"isBot": false
}
],
"reference": null
},
{
"id": 1051459014493483000,
"author_id": 724791899730346100,
"author_name": "chris.",
"timestamp": "12/11/2022 06:22:44",
"content": "wut is that?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051459066154729500,
"author_id": 756743425272840200,
"author_name": "anand",
"timestamp": "12/11/2022 06:22:56",
"content": "What's ur schl board?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051459254046965800,
"author_id": 724791899730346100,
"author_name": "chris.",
"timestamp": "12/11/2022 06:23:41",
"content": "schl board?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051459521467396200,
"author_id": 724791899730346100,
"author_name": "chris.",
"timestamp": "12/11/2022 06:24:45",
"content": "wym by schl board?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051459587338940400,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 06:25:00",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051461047736864800,
"author_id": 527785067284529200,
"author_name": "emilyn",
"timestamp": "12/11/2022 06:30:48",
"content": "",
"attachments": [
{
"id": 1051461047770435600,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051461047770435634/IMG_0714.png",
"fileName": "IMG_0714.png",
"fileSizeBytes": 217145
}
],
"mentions": [],
"reference": null
},
{
"id": 1051461051952140400,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 06:30:49",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051461047736864800,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051461290272489600,
"author_id": 527785067284529200,
"author_name": "emilyn",
"timestamp": "12/11/2022 06:31:46",
"content": "Can someone solve this? I don't understand what to do",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051461591993958400,
"author_id": 938274341056045000,
"author_name": "$фцаяё ЯБ 19",
"timestamp": "12/11/2022 06:32:58",
"content": "loll same",
"attachments": [],
"mentions": [
{
"id": 527785067284529200,
"name": "emilyn",
"discriminator": "5344",
"nickname": "emilyn",
"isBot": false
}
],
"reference": null
},
{
"id": 1051462421946056800,
"author_id": 788085606483361800,
"author_name": "chartbit",
"timestamp": "12/11/2022 06:36:16",
"content": "Oh, for a second I was confused why it was \"asymptotes\" (plural), I'm slow 😂",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051462675445583900,
"author_id": 788085606483361800,
"author_name": "chartbit",
"timestamp": "12/11/2022 06:37:17",
"content": "Can you find any of the points they've mentioned, or either of the asymptotes?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051463034431881200,
"author_id": 527785067284529200,
"author_name": "emilyn",
"timestamp": "12/11/2022 06:38:42",
"content": "i think the graph intersects the zero point so that they lie at 1 point but i don't know how to prove this",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051463189944086500,
"author_id": 527785067284529200,
"author_name": "emilyn",
"timestamp": "12/11/2022 06:39:19",
"content": "And that they lay with asymptotes on one line",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051463305308418000,
"author_id": 527785067284529200,
"author_name": "emilyn",
"timestamp": "12/11/2022 06:39:47",
"content": "Lie*",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051463451047899100,
"author_id": 527785067284529200,
"author_name": "emilyn",
"timestamp": "12/11/2022 06:40:21",
"content": "Sry for bad englisch 😅",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051463548624191500,
"author_id": 788085606483361800,
"author_name": "chartbit",
"timestamp": "12/11/2022 06:40:45",
"content": "Yea I don't get what you mean by this, sorry?",
"attachments": [],
"mentions": [
{
"id": 527785067284529200,
"name": "emilyn",
"discriminator": "5344",
"nickname": "emilyn",
"isBot": false
}
],
"reference": null
},
{
"id": 1051463799267405800,
"author_id": 527785067284529200,
"author_name": "emilyn",
"timestamp": "12/11/2022 06:41:44",
"content": "I just don't know how to prove that they are all on one straight line",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051463892808769500,
"author_id": 527785067284529200,
"author_name": "emilyn",
"timestamp": "12/11/2022 06:42:07",
"content": "So no",
"attachments": [],
"mentions": [
{
"id": 788085606483361800,
"name": "chartbit",
"discriminator": "3171",
"nickname": "chartbit",
"isBot": false
}
],
"reference": null
},
{
"id": 1051464245449068700,
"author_id": 788085606483361800,
"author_name": "chartbit",
"timestamp": "12/11/2022 06:43:31",
"content": "Okay, so h intersects the x-axis when y=0, right? Similarly h intersects the y-axis when x=0, right? Does that make your life easier?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051464744269250700,
"author_id": 527785067284529200,
"author_name": "emilyn",
"timestamp": "12/11/2022 06:45:30",
"content": "Yes I know and now I need to prove its on one straight line with the interection point of the asymptotes",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051464807729070200,
"author_id": 527785067284529200,
"author_name": "emilyn",
"timestamp": "12/11/2022 06:45:45",
"content": "How do I privé that?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051464831116513300,
"author_id": 527785067284529200,
"author_name": "emilyn",
"timestamp": "12/11/2022 06:45:51",
"content": "Prove",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051464921772212400,
"author_id": 590126280289288200,
"author_name": "alihsaas",
"timestamp": "12/11/2022 06:46:12",
"content": "you can get a line passing through 2 points and prove the 3rd belongs to this line",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051465065183846500,
"author_id": 788085606483361800,
"author_name": "chartbit",
"timestamp": "12/11/2022 06:46:46",
"content": "It would be nice to have what the points we're working with are, no?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051465211816726700,
"author_id": 527785067284529200,
"author_name": "emilyn",
"timestamp": "12/11/2022 06:47:21",
"content": "You don’t het those in the question",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051465279600861200,
"author_id": 788085606483361800,
"author_name": "chartbit",
"timestamp": "12/11/2022 06:47:37",
"content": "...because you're supposed to find them yourself!",
"attachments": [],
"mentions": [
{
"id": 527785067284529200,
"name": "emilyn",
"discriminator": "5344",
"nickname": "emilyn",
"isBot": false
}
],
"reference": null
},
{
"id": 1051465321686499300,
"author_id": 527785067284529200,
"author_name": "emilyn",
"timestamp": "12/11/2022 06:47:47",
"content": "How do i prove it when 2ad-bc=0",
"attachments": [],
"mentions": [
{
"id": 590126280289288200,
"name": "alihsaas",
"discriminator": "6662",
"nickname": "alihsaas",
"isBot": false
}
],
"reference": null
},
{
"id": 1051465325033553900,
"author_id": 590126280289288200,
"author_name": "alihsaas",
"timestamp": "12/11/2022 06:47:48",
"content": "you can get them in terms of a b and c",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051469097566740600,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 07:02:48",
"content": "@emilyn Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 527785067284529200,
"name": "emilyn",
"discriminator": "5344",
"nickname": "emilyn",
"isBot": false
}
],
"reference": null
},
{
"id": 1051472874201940100,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 07:17:48",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
2d28dd983c644aafa95c9934e4233f95
|
200,006 |
[
{
"id": 1051473126556438500,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 07:18:48",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051476219926945800,
"author_id": 848914349279805400,
"author_name": "NutBadag",
"timestamp": "12/11/2022 07:31:06",
"content": "its physic problem and here it is",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051476221814378600,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 07:31:06",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051476219926945800,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051476225039810600,
"author_id": 848914349279805400,
"author_name": "NutBadag",
"timestamp": "12/11/2022 07:31:07",
"content": "The truck brought 1.5 tons of sand. What area of the yard will be covered with this sand if the thickness of the cover is 5 cm",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051476253858865200,
"author_id": 848914349279805400,
"author_name": "NutBadag",
"timestamp": "12/11/2022 07:31:14",
"content": "i translated it",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051476267775565800,
"author_id": 848914349279805400,
"author_name": "NutBadag",
"timestamp": "12/11/2022 07:31:17",
"content": "on google translate",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051476281306398700,
"author_id": 848914349279805400,
"author_name": "NutBadag",
"timestamp": "12/11/2022 07:31:20",
"content": "cuz its in georgian",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051476312826577000,
"author_id": 848914349279805400,
"author_name": "NutBadag",
"timestamp": "12/11/2022 07:31:28",
"content": "and if you understand what im talking about",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051476397903839400,
"author_id": 848914349279805400,
"author_name": "NutBadag",
"timestamp": "12/11/2022 07:31:48",
"content": "???",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051477706396676200,
"author_id": 987071591169011700,
"author_name": "kiritoholy",
"timestamp": "12/11/2022 07:37:00",
"content": "basically",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051477753972654200,
"author_id": 987071591169011700,
"author_name": "kiritoholy",
"timestamp": "12/11/2022 07:37:12",
"content": "you have to convert the volume",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051477783957737600,
"author_id": 987071591169011700,
"author_name": "kiritoholy",
"timestamp": "12/11/2022 07:37:19",
"content": "into surface area",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051477813556940800,
"author_id": 987071591169011700,
"author_name": "kiritoholy",
"timestamp": "12/11/2022 07:37:26",
"content": "with height 5cm",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051477872751157200,
"author_id": 987071591169011700,
"author_name": "kiritoholy",
"timestamp": "12/11/2022 07:37:40",
"content": "1.5/5",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051477901297602700,
"author_id": 987071591169011700,
"author_name": "kiritoholy",
"timestamp": "12/11/2022 07:37:47",
"content": "is equal to area",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051478091542822900,
"author_id": 987071591169011700,
"author_name": "kiritoholy",
"timestamp": "12/11/2022 07:38:32",
"content": "srry convert those 5cm in feet then divide",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051478155673743500,
"author_id": 987071591169011700,
"author_name": "kiritoholy",
"timestamp": "12/11/2022 07:38:47",
"content": "it by volume which 1.5ton",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051478244999831600,
"author_id": 987071591169011700,
"author_name": "kiritoholy",
"timestamp": "12/11/2022 07:39:09",
"content": "you will getthe answer",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051478263236677600,
"author_id": 987071591169011700,
"author_name": "kiritoholy",
"timestamp": "12/11/2022 07:39:13",
"content": "@NutBadag",
"attachments": [],
"mentions": [
{
"id": 848914349279805400,
"name": "NutBadag",
"discriminator": "3321",
"nickname": "NutBadag",
"isBot": false
}
],
"reference": null
},
{
"id": 1051479097760563300,
"author_id": 848914349279805400,
"author_name": "NutBadag",
"timestamp": "12/11/2022 07:42:32",
"content": "and btw how much is 169901 cm3 to square km",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051482873716289700,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 07:57:32",
"content": "@NutBadag Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 848914349279805400,
"name": "NutBadag",
"discriminator": "3321",
"nickname": "NutBadag",
"isBot": false
}
],
"reference": null
},
{
"id": 1051483776817037300,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 08:01:08",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
2b0b58deb7554d5a9a20474714e9465d
|
200,007 |
[
{
"id": 1051484686037299300,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 08:04:44",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051485219066228900,
"author_id": 219567077541806080,
"author_name": "26cc48b80be87e5a4452268465c88a13",
"timestamp": "12/11/2022 08:06:51",
"content": "",
"attachments": [
{
"id": 1051485218764234800,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051485218764234762/lol.png",
"fileName": "lol.png",
"fileSizeBytes": 2295280
}
],
"mentions": [],
"reference": null
},
{
"id": 1051485221431812200,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 08:06:52",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051485219066228900,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051485326926946300,
"author_id": 219567077541806080,
"author_name": "26cc48b80be87e5a4452268465c88a13",
"timestamp": "12/11/2022 08:07:17",
"content": "i dont understand how 2 | a implies 4 | a^2",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051485396523036700,
"author_id": 219567077541806080,
"author_name": "26cc48b80be87e5a4452268465c88a13",
"timestamp": "12/11/2022 08:07:34",
"content": "(it's a prove by contradiction for sqrt(2) = a/b)",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051485460762992800,
"author_id": 984319941417251000,
"author_name": "💜𝓁𝒶𝓎𝓁𝒶💜",
"timestamp": "12/11/2022 08:07:49",
"content": "what does 2 | a mean?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051485490039226400,
"author_id": 219567077541806080,
"author_name": "26cc48b80be87e5a4452268465c88a13",
"timestamp": "12/11/2022 08:07:56",
"content": "2 divide a",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051485526332551200,
"author_id": 984319941417251000,
"author_name": "💜𝓁𝒶𝓎𝓁𝒶💜",
"timestamp": "12/11/2022 08:08:05",
"content": "yea but",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051485603423846400,
"author_id": 984319941417251000,
"author_name": "💜𝓁𝒶𝓎𝓁𝒶💜",
"timestamp": "12/11/2022 08:08:23",
"content": "what does it mean translated to math language lol",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051485643622068200,
"author_id": 219567077541806080,
"author_name": "26cc48b80be87e5a4452268465c88a13",
"timestamp": "12/11/2022 08:08:33",
"content": "a is an even number",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051485841337368600,
"author_id": 984319941417251000,
"author_name": "💜𝓁𝒶𝓎𝓁𝒶💜",
"timestamp": "12/11/2022 08:09:20",
"content": "ok i’ll just say it means there exists an integer k such that a=2k",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051485952083755000,
"author_id": 219567077541806080,
"author_name": "26cc48b80be87e5a4452268465c88a13",
"timestamp": "12/11/2022 08:09:46",
"content": "Oh I see",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051485991669604400,
"author_id": 219567077541806080,
"author_name": "26cc48b80be87e5a4452268465c88a13",
"timestamp": "12/11/2022 08:09:56",
"content": "a^2 = 4k^2",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051486007788314800,
"author_id": 219567077541806080,
"author_name": "26cc48b80be87e5a4452268465c88a13",
"timestamp": "12/11/2022 08:09:59",
"content": "Thank you!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051486036066308100,
"author_id": 984319941417251000,
"author_name": "💜𝓁𝒶𝓎𝓁𝒶💜",
"timestamp": "12/11/2022 08:10:06",
"content": "yep exactly ^-^",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051486055125233800,
"author_id": 219567077541806080,
"author_name": "26cc48b80be87e5a4452268465c88a13",
"timestamp": "12/11/2022 08:10:11",
"content": ".close",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051486058400972900,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 08:10:11",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
5a5b8cbdfb9b4aee81807fef5a23fc1b
|
200,008 |
[
{
"id": 1051487747963101200,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 08:16:54",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051493087618273300,
"author_id": 692635975678951400,
"author_name": "Michal",
"timestamp": "12/11/2022 08:38:07",
"content": "is this equal?",
"attachments": [
{
"id": 1051493087316295700,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051493087316295680/Screenshot_2022-12-11_at_14.37.45.png",
"fileName": "Screenshot_2022-12-11_at_14.37.45.png",
"fileSizeBytes": 8347
}
],
"mentions": [],
"reference": null
},
{
"id": 1051493089761579000,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 08:38:08",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051493087618273300,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051494862450602000,
"author_id": 183668144404037630,
"author_name": "Ann",
"timestamp": "12/11/2022 08:45:11",
"content": "is + kleene plus?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051494895619145700,
"author_id": 183668144404037630,
"author_name": "Ann",
"timestamp": "12/11/2022 08:45:18",
"content": "if so then i believe $L^+ = LL^*$ by definition",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051494905937137700,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "12/11/2022 08:45:21",
"content": "**Ann**",
"attachments": [
{
"id": 1051494906062979200,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051494906062979202/183668144404037632.png",
"fileName": "183668144404037632.png",
"fileSizeBytes": 10002
}
],
"mentions": [],
"reference": null
},
{
"id": 1051496863632740400,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 08:53:08",
"content": "@Michal Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 692635975678951400,
"name": "Michal",
"discriminator": "7906",
"nickname": "Michal",
"isBot": false
}
],
"reference": null
},
{
"id": 1051497153513656300,
"author_id": 692635975678951400,
"author_name": "Michal",
"timestamp": "12/11/2022 08:54:17",
"content": "yes, i also noticed this. Right side is for sure subset of left side, but i dont know the converse",
"attachments": [],
"mentions": [
{
"id": 183668144404037630,
"name": "Ann",
"discriminator": "0413",
"nickname": "Ann",
"isBot": false
}
],
"reference": null
},
{
"id": 1051497379368534000,
"author_id": 183668144404037630,
"author_name": "Ann",
"timestamp": "12/11/2022 08:55:11",
"content": "$L^+ = LL^*$, concatenate with $L$ on both sides...",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051497387530649700,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "12/11/2022 08:55:13",
"content": "**Ann**",
"attachments": [
{
"id": 1051497387836842100,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051497387836842064/183668144404037632.png",
"fileName": "183668144404037632.png",
"fileSizeBytes": 10841
}
],
"mentions": [],
"reference": null
},
{
"id": 1051497517784780900,
"author_id": 692635975678951400,
"author_name": "Michal",
"timestamp": "12/11/2022 08:55:44",
"content": "oh, got it",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051497524046856300,
"author_id": 692635975678951400,
"author_name": "Michal",
"timestamp": "12/11/2022 08:55:45",
"content": "thanks",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051497575204794400,
"author_id": 692635975678951400,
"author_name": "Michal",
"timestamp": "12/11/2022 08:55:57",
"content": ".close",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051497577901719700,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 08:55:58",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
3b92ee86b9324255a12c46dccbc7d0e0
|
200,009 |
[
{
"id": 1051497829702586400,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 08:56:58",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051498039971418100,
"author_id": 393401187853926400,
"author_name": "Ceuca<3",
"timestamp": "12/11/2022 08:57:48",
"content": "can someone help me with this limit please idk how to approach it",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051498043482046500,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 08:57:49",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051498039971418100,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051498046418075600,
"author_id": 393401187853926400,
"author_name": "Ceuca<3",
"timestamp": "12/11/2022 08:57:50",
"content": "",
"attachments": [
{
"id": 1051498046086721500,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051498046086721586/image.png",
"fileName": "image.png",
"fileSizeBytes": 2330
}
],
"mentions": [],
"reference": null
},
{
"id": 1051500276697272400,
"author_id": 910156963181101000,
"author_name": "Galm_1",
"timestamp": "12/11/2022 09:06:41",
"content": "I got 1 there as an answer",
"attachments": [],
"mentions": [
{
"id": 393401187853926400,
"name": "Ceuca<3",
"discriminator": "4614",
"nickname": "Ceuca<3",
"isBot": false
}
],
"reference": null
},
{
"id": 1051500308037111800,
"author_id": 910156963181101000,
"author_name": "Galm_1",
"timestamp": "12/11/2022 09:06:49",
"content": "Not sure if I'm correct though",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051500397367406700,
"author_id": 910156963181101000,
"author_name": "Galm_1",
"timestamp": "12/11/2022 09:07:10",
"content": "I made the radical into fractional exponent",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051500547703853000,
"author_id": 910156963181101000,
"author_name": "Galm_1",
"timestamp": "12/11/2022 09:07:46",
"content": "so (2- n root of (2))^2 = (2 - 2^(1/n))^n",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051500573918236700,
"author_id": 910156963181101000,
"author_name": "Galm_1",
"timestamp": "12/11/2022 09:07:52",
"content": "Then I factor out 2 there",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051500708958060700,
"author_id": 910156963181101000,
"author_name": "Galm_1",
"timestamp": "12/11/2022 09:08:24",
"content": "So (2(1-2^((1-n)/n)))^n",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051500780001177700,
"author_id": 910156963181101000,
"author_name": "Galm_1",
"timestamp": "12/11/2022 09:08:41",
"content": "Since you know, I made the exponent 1+x =1/n",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051500795079692400,
"author_id": 910156963181101000,
"author_name": "Galm_1",
"timestamp": "12/11/2022 09:08:45",
"content": "Equate for x",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051500877602640000,
"author_id": 910156963181101000,
"author_name": "Galm_1",
"timestamp": "12/11/2022 09:09:05",
"content": "So x = (1-n)/n",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051500935572107400,
"author_id": 910156963181101000,
"author_name": "Galm_1",
"timestamp": "12/11/2022 09:09:18",
"content": "So that would be your new exponent for the radical part",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051500991301820400,
"author_id": 910156963181101000,
"author_name": "Galm_1",
"timestamp": "12/11/2022 09:09:32",
"content": "(2(1-2^x))^n",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051501023975440400,
"author_id": 910156963181101000,
"author_name": "Galm_1",
"timestamp": "12/11/2022 09:09:40",
"content": "And that's how I got this",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051501093537992800,
"author_id": 910156963181101000,
"author_name": "Galm_1",
"timestamp": "12/11/2022 09:09:56",
"content": "Get the limit for this using l hoptal's rule",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051501239688507400,
"author_id": 910156963181101000,
"author_name": "Galm_1",
"timestamp": "12/11/2022 09:10:31",
"content": "Since n -> infinity, then this equation can use lhoptal since it also goes infinty/infinity",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051501368495579100,
"author_id": 910156963181101000,
"author_name": "Galm_1",
"timestamp": "12/11/2022 09:11:02",
"content": "So use derivative and you will get -1",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051501455481249800,
"author_id": 910156963181101000,
"author_name": "Galm_1",
"timestamp": "12/11/2022 09:11:22",
"content": "So this would be (2(1-2^(-1)))^infinity",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051501580123373700,
"author_id": 910156963181101000,
"author_name": "Galm_1",
"timestamp": "12/11/2022 09:11:52",
"content": "(2(1-(1/2)))^infinity = (2(1/2))^infinity",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051501606480379900,
"author_id": 910156963181101000,
"author_name": "Galm_1",
"timestamp": "12/11/2022 09:11:58",
"content": "1^ infinity = 1",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051502867514659000,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 09:16:59",
"content": "@Ceuca<3 Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 393401187853926400,
"name": "Ceuca<3",
"discriminator": "4614",
"nickname": "Ceuca<3",
"isBot": false
}
],
"reference": null
},
{
"id": 1051503283660918900,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 09:18:38",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
72064005cbe24a2fa9998ed59d74da1f
|
200,010 |
[
{
"id": 1034436192789348500,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "10/25/2022 08:00:07",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034438605524959200,
"author_id": 284963695472410620,
"author_name": "Πασχάλης Χήνος",
"timestamp": "10/25/2022 08:09:42",
"content": "can someone explain the detominator of b to me?",
"attachments": [
{
"id": 1034438605227167700,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1034438605227167755/unknown.png",
"fileName": "unknown.png",
"fileSizeBytes": 277728
}
],
"mentions": [],
"reference": null
},
{
"id": 1034438609274671100,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "10/25/2022 08:09:43",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1034438605524959200,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1034438644888518700,
"author_id": 284963695472410620,
"author_name": "Πασχάλης Χήνος",
"timestamp": "10/25/2022 08:09:51",
"content": "",
"attachments": [
{
"id": 1034438644540383400,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1034438644540383303/unknown.png",
"fileName": "unknown.png",
"fileSizeBytes": 86991
}
],
"mentions": [],
"reference": null
},
{
"id": 1034442421309817000,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "10/25/2022 08:24:52",
"content": "@Πασχάλης Χήνος Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 284963695472410620,
"name": "Πασχάλης Χήνος",
"discriminator": "9018",
"nickname": "Paschalis Chinos",
"isBot": false
}
],
"reference": null
},
{
"id": 1034448941732859900,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "10/25/2022 08:50:46",
"content": "**Paschalis Chinos**",
"attachments": [
{
"id": 1034448941804171300,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1034448941804171274/284963695472410624.png",
"fileName": "284963695472410624.png",
"fileSizeBytes": 16891
}
],
"mentions": [],
"reference": null
},
{
"id": 1034456483057897500,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "10/25/2022 09:20:44",
"content": "@Πασχάλης Χήνος Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 284963695472410620,
"name": "Πασχάλης Χήνος",
"discriminator": "9018",
"nickname": "Paschalis Chinos",
"isBot": false
}
],
"reference": null
},
{
"id": 1034471611312640000,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "10/25/2022 10:20:51",
"content": "@Πασχάλης Χήνος Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 284963695472410620,
"name": "Πασχάλης Χήνος",
"discriminator": "9018",
"nickname": "Paschalis Chinos",
"isBot": false
}
],
"reference": null
},
{
"id": 1034472131486044300,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "10/25/2022 10:22:55",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
fbf81034f2d749deb4ba6ef7b1fee5cf
|
200,011 |
[
{
"id": 1051503535583400000,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 09:19:38",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051503662733742100,
"author_id": 1019598615548792800,
"author_name": "playboy",
"timestamp": "12/11/2022 09:20:09",
"content": "hi",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051503666974167200,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 09:20:10",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051503662733742100,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051504285826949100,
"author_id": 1019598615548792800,
"author_name": "playboy",
"timestamp": "12/11/2022 09:22:37",
"content": "so here is the question",
"attachments": [
{
"id": 1051504285495603200,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051504285495603251/1019598615548792843-13.png",
"fileName": "1019598615548792843-13.png",
"fileSizeBytes": 44656
}
],
"mentions": [],
"reference": null
},
{
"id": 1051504685070172200,
"author_id": 1019598615548792800,
"author_name": "playboy",
"timestamp": "12/11/2022 09:24:12",
"content": "",
"attachments": [
{
"id": 1051504685187616800,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051504685187616789/Unknown52.jpg",
"fileName": "Unknown52.jpg",
"fileSizeBytes": 63955
}
],
"mentions": [],
"reference": null
},
{
"id": 1051504746176975000,
"author_id": 1019598615548792800,
"author_name": "playboy",
"timestamp": "12/11/2022 09:24:27",
"content": "and heres the work",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051505155696238700,
"author_id": 1019598615548792800,
"author_name": "playboy",
"timestamp": "12/11/2022 09:26:05",
"content": "@Helpers",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051507607468253200,
"author_id": 1019598615548792800,
"author_name": "playboy",
"timestamp": "12/11/2022 09:35:49",
"content": "@Helpers",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051508081223286800,
"author_id": 1019598615548792800,
"author_name": "playboy",
"timestamp": "12/11/2022 09:37:42",
"content": "is g(1)=3 correct?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051508993140457500,
"author_id": 1019598615548792800,
"author_name": "playboy",
"timestamp": "12/11/2022 09:41:20",
"content": "pls",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051509666959589400,
"author_id": 1019598615548792800,
"author_name": "playboy",
"timestamp": "12/11/2022 09:44:00",
"content": "someone?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051510132535722000,
"author_id": 1019598615548792800,
"author_name": "playboy",
"timestamp": "12/11/2022 09:45:51",
"content": "ima reopen",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051510150785138800,
"author_id": 1019598615548792800,
"author_name": "playboy",
"timestamp": "12/11/2022 09:45:56",
"content": ".close",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051510154123804700,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 09:45:56",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
e768427dba2f4089ac5bfe3bbcd81b02
|
200,012 |
[
{
"id": 1051510406377636000,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 09:46:56",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051511867840938000,
"author_id": 386464668488826900,
"author_name": "xjqstin",
"timestamp": "12/11/2022 09:52:45",
"content": "The degree of the polynomial function g is 3 and its y-intercept is 6. The leading coefficient of g is 1 and (x-1) is a factor of the function. If the remainder when g(x) is divided by (x+1) is 8, what is the equation of g?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051511870688854000,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 09:52:46",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051511867840938000,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051512315327025200,
"author_id": 1029302033993433100,
"author_name": "Riki",
"timestamp": "12/11/2022 09:54:32",
"content": "Since the degree of the polynomial function `g` is 3, it can be written in the form `g(x) = ax^3 + bx^2 + cx + d`, where `a`, `b`, `c`, and `d` are constants.\n\nSince the y-intercept of `g` is 6, the constant term d in the polynomial must be equal to 6.",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051512594910937200,
"author_id": 386464668488826900,
"author_name": "xjqstin",
"timestamp": "12/11/2022 09:55:38",
"content": "yep",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051513005029982300,
"author_id": 386464668488826900,
"author_name": "xjqstin",
"timestamp": "12/11/2022 09:57:16",
"content": "ohh",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051513027503063000,
"author_id": 386464668488826900,
"author_name": "xjqstin",
"timestamp": "12/11/2022 09:57:21",
"content": "do i have to use systems for this @Riki",
"attachments": [],
"mentions": [
{
"id": 1029302033993433100,
"name": "Riki",
"discriminator": "3554",
"nickname": "Riki",
"isBot": false
}
],
"reference": null
},
{
"id": 1051513104690860000,
"author_id": 386464668488826900,
"author_name": "xjqstin",
"timestamp": "12/11/2022 09:57:40",
"content": "g(x) = x^3 + bx^2 + cx + 6",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051513119492550800,
"author_id": 386464668488826900,
"author_name": "xjqstin",
"timestamp": "12/11/2022 09:57:43",
"content": "i have to solve for b and c",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051513271796113500,
"author_id": 386464668488826900,
"author_name": "xjqstin",
"timestamp": "12/11/2022 09:58:20",
"content": "aight gimme 1 sec",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051513450448289900,
"author_id": 1029302033993433100,
"author_name": "Riki",
"timestamp": "12/11/2022 09:59:02",
"content": "Yes",
"attachments": [],
"mentions": [
{
"id": 386464668488826900,
"name": "xjqstin",
"discriminator": "2677",
"nickname": "xjqstin",
"isBot": false
}
],
"reference": null
},
{
"id": 1051513625631789000,
"author_id": 386464668488826900,
"author_name": "xjqstin",
"timestamp": "12/11/2022 09:59:44",
"content": "what do i use the y intercept for?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051514746261733500,
"author_id": 386464668488826900,
"author_name": "xjqstin",
"timestamp": "12/11/2022 10:04:11",
"content": "oh shit",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051514754759409700,
"author_id": 386464668488826900,
"author_name": "xjqstin",
"timestamp": "12/11/2022 10:04:13",
"content": "dumb question mb",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051515118082605000,
"author_id": 386464668488826900,
"author_name": "xjqstin",
"timestamp": "12/11/2022 10:05:40",
"content": "i got it thank you",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051515123786850300,
"author_id": 386464668488826900,
"author_name": "xjqstin",
"timestamp": "12/11/2022 10:05:41",
"content": ".close",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051515126961946800,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 10:05:42",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
7a407b9b070646179e3637c349476c39
|
200,013 |
[
{
"id": 1051516464093478900,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 10:11:01",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051516678686646400,
"author_id": 877944036395212800,
"author_name": "miky",
"timestamp": "12/11/2022 10:11:52",
"content": "could i get some resources that could help in solving polynomials/ordering polynomials",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051516680959951000,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 10:11:52",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051516678686646400,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051516734227624000,
"author_id": 919424513287004200,
"author_name": "PrestonLast",
"timestamp": "12/11/2022 10:12:05",
"content": "help me do this geometry homework please",
"attachments": [
{
"id": 1051516733871104100,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051516733871104090/image.png",
"fileName": "image.png",
"fileSizeBytes": 203809
}
],
"mentions": [],
"reference": null
},
{
"id": 1051516750027571200,
"author_id": 877944036395212800,
"author_name": "miky",
"timestamp": "12/11/2022 10:12:09",
"content": "no",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051516795649003600,
"author_id": 919424513287004200,
"author_name": "PrestonLast",
"timestamp": "12/11/2022 10:12:20",
"content": "oh sorry",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051516808764604400,
"author_id": 877944036395212800,
"author_name": "miky",
"timestamp": "12/11/2022 10:12:23",
"content": "have agood day",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051516822597419000,
"author_id": 919424513287004200,
"author_name": "PrestonLast",
"timestamp": "12/11/2022 10:12:26",
"content": "I was about to choose this one",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051516840452563100,
"author_id": 1029302033993433100,
"author_name": "Riki",
"timestamp": "12/11/2022 10:12:31",
"content": "Khan Academy's algebra course: https://www.khanacademy.org/math/algebra\nThe algebra section of Paul's Online Math Notes: http://tutorial.math.lamar.edu/Classes/Alg/Algebra.aspx\nThe algebra section of Purplemath: https://www.purplemath.com/modules/index.htm",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051516865744216000,
"author_id": 1029302033993433100,
"author_name": "Riki",
"timestamp": "12/11/2022 10:12:37",
"content": "its helpful",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051516878654292000,
"author_id": 1029302033993433100,
"author_name": "Riki",
"timestamp": "12/11/2022 10:12:40",
"content": "it helped me",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051516895905448000,
"author_id": 877944036395212800,
"author_name": "miky",
"timestamp": "12/11/2022 10:12:44",
"content": "thank u",
"attachments": [],
"mentions": [
{
"id": 1029302033993433100,
"name": "Riki",
"discriminator": "3554",
"nickname": "Riki",
"isBot": false
}
],
"reference": null
},
{
"id": 1051516902779928700,
"author_id": 877944036395212800,
"author_name": "miky",
"timestamp": "12/11/2022 10:12:45",
"content": "ill try",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051517252370964500,
"author_id": 877944036395212800,
"author_name": "miky",
"timestamp": "12/11/2022 10:14:09",
"content": "ok thank u",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051517258150707200,
"author_id": 877944036395212800,
"author_name": "miky",
"timestamp": "12/11/2022 10:14:10",
"content": ".close",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051517260700864600,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 10:14:11",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
1fc3c4b15cdc439b9ca3afdef7878c73
|
200,014 |
[
{
"id": 1051519212037873800,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 10:21:56",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051519966328918100,
"author_id": 968796062645125100,
"author_name": "Lyfelian",
"timestamp": "12/11/2022 10:24:56",
"content": "",
"attachments": [
{
"id": 1051519966211481600,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051519966211481662/image.png",
"fileName": "image.png",
"fileSizeBytes": 51704
}
],
"mentions": [],
"reference": null
},
{
"id": 1051519969625641000,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 10:24:57",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051519966328918100,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051521421387518200,
"author_id": 628449189730320400,
"author_name": "MeatBagFrank",
"timestamp": "12/11/2022 10:30:43",
"content": "I want to help you but the bot currently isn't rendering my answer.",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051521511103672400,
"author_id": 968796062645125100,
"author_name": "Lyfelian",
"timestamp": "12/11/2022 10:31:04",
"content": "ohh umm so can u just type it out",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051521545652146300,
"author_id": 968796062645125100,
"author_name": "Lyfelian",
"timestamp": "12/11/2022 10:31:12",
"content": "just normally",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051523450486919200,
"author_id": 968796062645125100,
"author_name": "Lyfelian",
"timestamp": "12/11/2022 10:38:46",
"content": ".close",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051523453565554800,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 10:38:47",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
d28bd4724d98445681201b285eb72630
|
200,015 |
[
{
"id": 1051523705433505900,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 10:39:47",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051523793597780100,
"author_id": 556740185539215360,
"author_name": "John Wick",
"timestamp": "12/11/2022 10:40:08",
"content": "Hello",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051523797842395100,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 10:40:09",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051523793597780100,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051523843400925200,
"author_id": 556740185539215360,
"author_name": "John Wick",
"timestamp": "12/11/2022 10:40:20",
"content": "",
"attachments": [
{
"id": 1051523843195408500,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051523843195408464/20221207_134223.jpg",
"fileName": "20221207_134223.jpg",
"fileSizeBytes": 456009
}
],
"mentions": [],
"reference": null
},
{
"id": 1051523878020714500,
"author_id": 556740185539215360,
"author_name": "John Wick",
"timestamp": "12/11/2022 10:40:28",
"content": "Can someone help me with these problems",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051523937214935200,
"author_id": 556740185539215360,
"author_name": "John Wick",
"timestamp": "12/11/2022 10:40:43",
"content": "For number 11",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051524047831306400,
"author_id": 556740185539215360,
"author_name": "John Wick",
"timestamp": "12/11/2022 10:41:09",
"content": "Pq and eg = 12",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051524065929723900,
"author_id": 556740185539215360,
"author_name": "John Wick",
"timestamp": "12/11/2022 10:41:13",
"content": "Correct?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051524736498270200,
"author_id": 791273811893944300,
"author_name": "Tjitse0279",
"timestamp": "12/11/2022 10:43:53",
"content": "x=7",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051524789719793700,
"author_id": 791273811893944300,
"author_name": "Tjitse0279",
"timestamp": "12/11/2022 10:44:06",
"content": "im just making notes",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051524958293086300,
"author_id": 791273811893944300,
"author_name": "Tjitse0279",
"timestamp": "12/11/2022 10:44:46",
"content": "yes because there congruant",
"attachments": [],
"mentions": [
{
"id": 556740185539215360,
"name": "John Wick",
"discriminator": "8006",
"nickname": "John Wick",
"isBot": false
}
],
"reference": null
},
{
"id": 1051525151952486500,
"author_id": 556740185539215360,
"author_name": "John Wick",
"timestamp": "12/11/2022 10:45:32",
"content": "So how do I find out what qr is",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051525172634587100,
"author_id": 349354952961032200,
"author_name": "Umbraleviathan",
"timestamp": "12/11/2022 10:45:37",
"content": "PQ is not congruent to EG",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051525200849678300,
"author_id": 349354952961032200,
"author_name": "Umbraleviathan",
"timestamp": "12/11/2022 10:45:44",
"content": "Look at how the triangles are named",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051525205027205100,
"author_id": 791273811893944300,
"author_name": "Tjitse0279",
"timestamp": "12/11/2022 10:45:45",
"content": "oops sorry",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051525214988673000,
"author_id": 556740185539215360,
"author_name": "John Wick",
"timestamp": "12/11/2022 10:45:47",
"content": "How",
"attachments": [],
"mentions": [
{
"id": 349354952961032200,
"name": "Umbraleviathan",
"discriminator": "3607",
"nickname": "Umbraleviathan",
"isBot": false
}
],
"reference": null
},
{
"id": 1051525271108452500,
"author_id": 349354952961032200,
"author_name": "Umbraleviathan",
"timestamp": "12/11/2022 10:46:01",
"content": "The order in which they're named is the order of corresponding parts",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051525315861676000,
"author_id": 791273811893944300,
"author_name": "Tjitse0279",
"timestamp": "12/11/2022 10:46:11",
"content": "ye sorry i fergot",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051525359729913900,
"author_id": 349354952961032200,
"author_name": "Umbraleviathan",
"timestamp": "12/11/2022 10:46:22",
"content": "PQR\nEFG\n\nLook at the first two letters. PQ ≈ EF",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051525389413007400,
"author_id": 349354952961032200,
"author_name": "Umbraleviathan",
"timestamp": "12/11/2022 10:46:29",
"content": "QR ≈ FG",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051525412242595800,
"author_id": 349354952961032200,
"author_name": "Umbraleviathan",
"timestamp": "12/11/2022 10:46:34",
"content": "RP ≈ GE",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051525474653851800,
"author_id": 791273811893944300,
"author_name": "Tjitse0279",
"timestamp": "12/11/2022 10:46:49",
"content": "if you calc y and x than you can calc qr",
"attachments": [],
"mentions": [
{
"id": 556740185539215360,
"name": "John Wick",
"discriminator": "8006",
"nickname": "John Wick",
"isBot": false
}
],
"reference": null
},
{
"id": 1051525571726819500,
"author_id": 556740185539215360,
"author_name": "John Wick",
"timestamp": "12/11/2022 10:47:12",
"content": "At least I'm getting some help now",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051525592450875400,
"author_id": 556740185539215360,
"author_name": "John Wick",
"timestamp": "12/11/2022 10:47:17",
"content": "After 2 hours",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051525721778049200,
"author_id": 556740185539215360,
"author_name": "John Wick",
"timestamp": "12/11/2022 10:47:48",
"content": "4y - 3x",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051525741751324700,
"author_id": 556740185539215360,
"author_name": "John Wick",
"timestamp": "12/11/2022 10:47:53",
"content": "2 times?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051525783878897800,
"author_id": 791273811893944300,
"author_name": "Tjitse0279",
"timestamp": "12/11/2022 10:48:03",
"content": "its very easy so 14=x-5",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051525863654572200,
"author_id": 791273811893944300,
"author_name": "Tjitse0279",
"timestamp": "12/11/2022 10:48:22",
"content": "and 12=y+2",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051525944252313600,
"author_id": 556740185539215360,
"author_name": "John Wick",
"timestamp": "12/11/2022 10:48:41",
"content": "X+5**",
"attachments": [],
"mentions": [
{
"id": 791273811893944300,
"name": "Tjitse0279",
"discriminator": "4035",
"nickname": "Tjitse0279",
"isBot": false
}
],
"reference": null
},
{
"id": 1051526004121817100,
"author_id": 791273811893944300,
"author_name": "Tjitse0279",
"timestamp": "12/11/2022 10:48:55",
"content": "sorry",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051526032970223600,
"author_id": 791273811893944300,
"author_name": "Tjitse0279",
"timestamp": "12/11/2022 10:49:02",
"content": "so you get it now?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051526053467783300,
"author_id": 556740185539215360,
"author_name": "John Wick",
"timestamp": "12/11/2022 10:49:07",
"content": "Okay so",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051526235546734700,
"author_id": 556740185539215360,
"author_name": "John Wick",
"timestamp": "12/11/2022 10:49:50",
"content": "4(12) +2 -3(14) -5?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051526372855664600,
"author_id": 791273811893944300,
"author_name": "Tjitse0279",
"timestamp": "12/11/2022 10:50:23",
"content": "no",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051526429235482800,
"author_id": 791273811893944300,
"author_name": "Tjitse0279",
"timestamp": "12/11/2022 10:50:37",
"content": "oke just calc for x",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051526462722814100,
"author_id": 791273811893944300,
"author_name": "Tjitse0279",
"timestamp": "12/11/2022 10:50:45",
"content": "what does x =",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051526544817922200,
"author_id": 556740185539215360,
"author_name": "John Wick",
"timestamp": "12/11/2022 10:51:04",
"content": "X = 5?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051526730986299400,
"author_id": 791273811893944300,
"author_name": "Tjitse0279",
"timestamp": "12/11/2022 10:51:49",
"content": "X+5=14 because their congruant",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051526768890233000,
"author_id": 791273811893944300,
"author_name": "Tjitse0279",
"timestamp": "12/11/2022 10:51:58",
"content": "so what does x equal",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051526912087961700,
"author_id": 556740185539215360,
"author_name": "John Wick",
"timestamp": "12/11/2022 10:52:32",
"content": "9",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051526925992083500,
"author_id": 791273811893944300,
"author_name": "Tjitse0279",
"timestamp": "12/11/2022 10:52:35",
"content": "yes",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051526970367824000,
"author_id": 791273811893944300,
"author_name": "Tjitse0279",
"timestamp": "12/11/2022 10:52:46",
"content": "and now the same thing for Y",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051527104069640200,
"author_id": 556740185539215360,
"author_name": "John Wick",
"timestamp": "12/11/2022 10:53:18",
"content": "Y+2=12",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051527115004190800,
"author_id": 556740185539215360,
"author_name": "John Wick",
"timestamp": "12/11/2022 10:53:20",
"content": "10",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051527136445468700,
"author_id": 791273811893944300,
"author_name": "Tjitse0279",
"timestamp": "12/11/2022 10:53:25",
"content": "ye so",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051527217156476900,
"author_id": 791273811893944300,
"author_name": "Tjitse0279",
"timestamp": "12/11/2022 10:53:45",
"content": "4Y - 3x=?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051527385977209000,
"author_id": 556740185539215360,
"author_name": "John Wick",
"timestamp": "12/11/2022 10:54:25",
"content": "13",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051527404205658100,
"author_id": 791273811893944300,
"author_name": "Tjitse0279",
"timestamp": "12/11/2022 10:54:29",
"content": "yes",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051527414355853300,
"author_id": 791273811893944300,
"author_name": "Tjitse0279",
"timestamp": "12/11/2022 10:54:32",
"content": "you got it",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051527438074650600,
"author_id": 791273811893944300,
"author_name": "Tjitse0279",
"timestamp": "12/11/2022 10:54:37",
"content": "you understand what you did?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051527481317929100,
"author_id": 556740185539215360,
"author_name": "John Wick",
"timestamp": "12/11/2022 10:54:47",
"content": "Yes I was writing it down",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051527538935083100,
"author_id": 791273811893944300,
"author_name": "Tjitse0279",
"timestamp": "12/11/2022 10:55:01",
"content": "very good",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051527658544038000,
"author_id": 556740185539215360,
"author_name": "John Wick",
"timestamp": "12/11/2022 10:55:30",
"content": "Now the next question",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051527753553428600,
"author_id": 791273811893944300,
"author_name": "Tjitse0279",
"timestamp": "12/11/2022 10:55:52",
"content": "what the next question",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051527768002793600,
"author_id": 556740185539215360,
"author_name": "John Wick",
"timestamp": "12/11/2022 10:55:56",
"content": "",
"attachments": [
{
"id": 1051527768116052000,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051527768116051968/20221207_134223.jpg",
"fileName": "20221207_134223.jpg",
"fileSizeBytes": 456009
}
],
"mentions": [],
"reference": null
},
{
"id": 1051527783530102900,
"author_id": 556740185539215360,
"author_name": "John Wick",
"timestamp": "12/11/2022 10:56:00",
"content": "12",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051527800231825500,
"author_id": 791273811893944300,
"author_name": "Tjitse0279",
"timestamp": "12/11/2022 10:56:04",
"content": "you mean 12",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051527886110203900,
"author_id": 791273811893944300,
"author_name": "Tjitse0279",
"timestamp": "12/11/2022 10:56:24",
"content": "oke",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051528090825801700,
"author_id": 791273811893944300,
"author_name": "Tjitse0279",
"timestamp": "12/11/2022 10:57:13",
"content": "i you want to make i easy just draw the question out",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051528180483235800,
"author_id": 791273811893944300,
"author_name": "Tjitse0279",
"timestamp": "12/11/2022 10:57:34",
"content": "so draw lmnp",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051528211906973700,
"author_id": 556740185539215360,
"author_name": "John Wick",
"timestamp": "12/11/2022 10:57:42",
"content": "Okay I think I got my answer already",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051528224905101300,
"author_id": 556740185539215360,
"author_name": "John Wick",
"timestamp": "12/11/2022 10:57:45",
"content": "A",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051528386964619400,
"author_id": 791273811893944300,
"author_name": "Tjitse0279",
"timestamp": "12/11/2022 10:58:23",
"content": "yes",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051528416706433000,
"author_id": 791273811893944300,
"author_name": "Tjitse0279",
"timestamp": "12/11/2022 10:58:30",
"content": "i think thats right",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051528452655824900,
"author_id": 556740185539215360,
"author_name": "John Wick",
"timestamp": "12/11/2022 10:58:39",
"content": "Ok now 13",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051528819602895000,
"author_id": 556740185539215360,
"author_name": "John Wick",
"timestamp": "12/11/2022 11:00:07",
"content": "C is not correct",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051528898678108300,
"author_id": 556740185539215360,
"author_name": "John Wick",
"timestamp": "12/11/2022 11:00:25",
"content": "So I think ABD",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051528931540484100,
"author_id": 791273811893944300,
"author_name": "Tjitse0279",
"timestamp": "12/11/2022 11:00:33",
"content": "why not?",
"attachments": [],
"mentions": [
{
"id": 556740185539215360,
"name": "John Wick",
"discriminator": "8006",
"nickname": "John Wick",
"isBot": false
}
],
"reference": null
},
{
"id": 1051529159039524900,
"author_id": 556740185539215360,
"author_name": "John Wick",
"timestamp": "12/11/2022 11:01:27",
"content": "Bc idk anything in geometry about circles",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051529210440720500,
"author_id": 556740185539215360,
"author_name": "John Wick",
"timestamp": "12/11/2022 11:01:40",
"content": "But just bc",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051529237733064800,
"author_id": 556740185539215360,
"author_name": "John Wick",
"timestamp": "12/11/2022 11:01:46",
"content": "It sounds dumb",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051529292674257000,
"author_id": 556740185539215360,
"author_name": "John Wick",
"timestamp": "12/11/2022 11:01:59",
"content": "Circles are taken to circles",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051529376052817900,
"author_id": 791273811893944300,
"author_name": "Tjitse0279",
"timestamp": "12/11/2022 11:02:19",
"content": "it sound dumb but it right i think",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051529440993218600,
"author_id": 791273811893944300,
"author_name": "Tjitse0279",
"timestamp": "12/11/2022 11:02:35",
"content": "i think b is wrong",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051529568013525100,
"author_id": 556740185539215360,
"author_name": "John Wick",
"timestamp": "12/11/2022 11:03:05",
"content": "Hm",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051529574506303500,
"author_id": 556740185539215360,
"author_name": "John Wick",
"timestamp": "12/11/2022 11:03:07",
"content": "Why",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051529588867604600,
"author_id": 791273811893944300,
"author_name": "Tjitse0279",
"timestamp": "12/11/2022 11:03:10",
"content": "because",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051529729242566700,
"author_id": 187850624421986300,
"author_name": "Circle",
"timestamp": "12/11/2022 11:03:43",
"content": "wow",
"attachments": [],
"mentions": [
{
"id": 556740185539215360,
"name": "John Wick",
"discriminator": "8006",
"nickname": "John Wick",
"isBot": false
}
],
"reference": null
},
{
"id": 1051529739166298100,
"author_id": 187850624421986300,
"author_name": "Circle",
"timestamp": "12/11/2022 11:03:46",
"content": "i take insult to that",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051529764948680700,
"author_id": 187850624421986300,
"author_name": "Circle",
"timestamp": "12/11/2022 11:03:52",
"content": "u r dumb",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051529795030224900,
"author_id": 556740185539215360,
"author_name": "John Wick",
"timestamp": "12/11/2022 11:03:59",
"content": "I am not!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051529800562516100,
"author_id": 187850624421986300,
"author_name": "Circle",
"timestamp": "12/11/2022 11:04:00",
"content": "no sry",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051529803993469000,
"author_id": 187850624421986300,
"author_name": "Circle",
"timestamp": "12/11/2022 11:04:01",
"content": "jk",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051529814634410100,
"author_id": 187850624421986300,
"author_name": "Circle",
"timestamp": "12/11/2022 11:04:04",
"content": "that was a joke",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051529839619883100,
"author_id": 187850624421986300,
"author_name": "Circle",
"timestamp": "12/11/2022 11:04:10",
"content": "i apologise",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051529962219380700,
"author_id": 556740185539215360,
"author_name": "John Wick",
"timestamp": "12/11/2022 11:04:39",
"content": "Anyways",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051529981571891200,
"author_id": 791273811893944300,
"author_name": "Tjitse0279",
"timestamp": "12/11/2022 11:04:44",
"content": "sorry i cant explain my english geometry is not good enough i can explain in dutch but that has no use",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051529992946851800,
"author_id": 187850624421986300,
"author_name": "Circle",
"timestamp": "12/11/2022 11:04:46",
"content": "no",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051530070650527700,
"author_id": 556740185539215360,
"author_name": "John Wick",
"timestamp": "12/11/2022 11:05:05",
"content": "Explain in Dutch then",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051530097011720300,
"author_id": 556740185539215360,
"author_name": "John Wick",
"timestamp": "12/11/2022 11:05:11",
"content": "I'll translate it",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051530143870492700,
"author_id": 187850624421986300,
"author_name": "Circle",
"timestamp": "12/11/2022 11:05:22",
"content": "wait sry this isnt general i saw wrong",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051530227815284700,
"author_id": 791273811893944300,
"author_name": "Tjitse0279",
"timestamp": "12/11/2022 11:05:42",
"content": "i doesnt translate it good if tried",
"attachments": [],
"mentions": [
{
"id": 556740185539215360,
"name": "John Wick",
"discriminator": "8006",
"nickname": "John Wick",
"isBot": false
}
],
"reference": null
},
{
"id": 1051530262829350900,
"author_id": 556740185539215360,
"author_name": "John Wick",
"timestamp": "12/11/2022 11:05:51",
"content": "Oh",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051530363836579800,
"author_id": 791273811893944300,
"author_name": "Tjitse0279",
"timestamp": "12/11/2022 11:06:15",
"content": "but like the rest good for sure",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051530384095060100,
"author_id": 791273811893944300,
"author_name": "Tjitse0279",
"timestamp": "12/11/2022 11:06:20",
"content": "so i has to be b",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051530640056655900,
"author_id": 791273811893944300,
"author_name": "Tjitse0279",
"timestamp": "12/11/2022 11:07:21",
"content": "sorry i cant help you more than that",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051531041363468300,
"author_id": 556740185539215360,
"author_name": "John Wick",
"timestamp": "12/11/2022 11:08:56",
"content": "ugh",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051531101866295300,
"author_id": 556740185539215360,
"author_name": "John Wick",
"timestamp": "12/11/2022 11:09:11",
"content": "Thanks for trying to help",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051532983833743400,
"author_id": 187850624421986300,
"author_name": "Circle",
"timestamp": "12/11/2022 11:16:39",
"content": "um",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051533000124399700,
"author_id": 187850624421986300,
"author_name": "Circle",
"timestamp": "12/11/2022 11:16:43",
"content": "did u try drawing the diagram",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051534766517784600,
"author_id": 556740185539215360,
"author_name": "John Wick",
"timestamp": "12/11/2022 11:23:44",
"content": "@MeatBagFrank",
"attachments": [],
"mentions": [
{
"id": 628449189730320400,
"name": "MeatBagFrank",
"discriminator": "7923",
"nickname": "MeatBagFrank",
"isBot": false
}
],
"reference": null
},
{
"id": 1051536227674882200,
"author_id": 187850624421986300,
"author_name": "Circle",
"timestamp": "12/11/2022 11:29:33",
"content": "o",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051536249007128600,
"author_id": 187850624421986300,
"author_name": "Circle",
"timestamp": "12/11/2022 11:29:38",
"content": "i feel they are just weirdly worded",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051536252123496400,
"author_id": 187850624421986300,
"author_name": "Circle",
"timestamp": "12/11/2022 11:29:39",
"content": ":c",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051538542314135600,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 11:38:45",
"content": "@John Wick Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 556740185539215360,
"name": "John Wick",
"discriminator": "8006",
"nickname": "John Wick",
"isBot": false
}
],
"reference": null
},
{
"id": 1051538579765084300,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 11:38:54",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
ebc86aa030b8423b87539861b7307a6b
|
200,016 |
[
{
"id": 1051538833117810700,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 11:39:54",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051539615267434600,
"author_id": 109677644131360770,
"author_name": "spanner",
"timestamp": "12/11/2022 11:43:00",
"content": "Hi i have this question :\n$for all numbers $1\\leq i \\leq n$, $CM[i][i]=0$.\n\n\\medskip\n\nfor all numbers $1\\leq i \\leq n-1$, we have : \n\n$CM[i][i+1]=C[i][i+1]$\n\n$P[i][i+1]=i+1$\n\n\\medskip\n\nfor each couple $1\\leq i < j \\leq n$ such as $j-i>1$, we have :\n\n$CM[i][j]=\\min_{i<k \\leq j}\\left(C[i][k]+CM[k][j] \\right)$ $,",
"attachments": [
{
"id": 1051539615003185200,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051539615003185162/image.png",
"fileName": "image.png",
"fileSizeBytes": 6692
}
],
"mentions": [],
"reference": null
},
{
"id": 1051539617477841000,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 11:43:01",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051539615267434600,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051539690328698900,
"author_id": 109677644131360770,
"author_name": "spanner",
"timestamp": "12/11/2022 11:43:18",
"content": "i have to determine the matrix CM and P",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051539795815440500,
"author_id": 109677644131360770,
"author_name": "spanner",
"timestamp": "12/11/2022 11:43:43",
"content": "using the C matrix but i have no clue where to start",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051540104444923900,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "12/11/2022 11:44:57",
"content": "it looks like the upper triangular part from an LU factorisation of a matrix",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051540180248580100,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "12/11/2022 11:45:15",
"content": "not sure if that's relevant here though",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051540281201262700,
"author_id": 109677644131360770,
"author_name": "spanner",
"timestamp": "12/11/2022 11:45:39",
"content": "well it might be",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051540462231617700,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "12/11/2022 11:46:22",
"content": "Do you have the full matrix of that?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051540673905561700,
"author_id": 109677644131360770,
"author_name": "spanner",
"timestamp": "12/11/2022 11:47:13",
"content": "that is the full matrix",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051540720005152900,
"author_id": 109677644131360770,
"author_name": "spanner",
"timestamp": "12/11/2022 11:47:24",
"content": "i think it's called dynamic programming",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051540802473570300,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "12/11/2022 11:47:43",
"content": ":thinkies: yeah i think what i am talking about is irrelevant then",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051540851307856000,
"author_id": 109677644131360770,
"author_name": "spanner",
"timestamp": "12/11/2022 11:47:55",
"content": "there's some rules for CM listed in the problem i tried to put in LateX",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051540992035131400,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "12/11/2022 11:48:29",
"content": "yeah bot is down sadly",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051541162135130200,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "12/11/2022 11:49:09",
"content": "also it is not, so thats out of the window",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051541313616625800,
"author_id": 109677644131360770,
"author_name": "spanner",
"timestamp": "12/11/2022 11:49:45",
"content": "Ahh",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051545089614282900,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 12:04:46",
"content": "@spanner Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 109677644131360770,
"name": "spanner",
"discriminator": "9285",
"nickname": "spanner",
"isBot": false
}
],
"reference": null
},
{
"id": 1051553431141224400,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 12:37:54",
"content": "@spanner Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 109677644131360770,
"name": "spanner",
"discriminator": "9285",
"nickname": "spanner",
"isBot": false
}
],
"reference": null
},
{
"id": 1051572503304216700,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 13:53:42",
"content": "@spanner Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 109677644131360770,
"name": "spanner",
"discriminator": "9285",
"nickname": "spanner",
"isBot": false
}
],
"reference": null
},
{
"id": 1051587605042561000,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 14:53:42",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
a28e4d9f160b40318b414480582fd403
|
200,017 |
[
{
"id": 1051587856268808300,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 14:54:42",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051590636022800400,
"author_id": 831267103293964300,
"author_name": "Dazzlefishe",
"timestamp": "12/11/2022 15:05:45",
"content": "",
"attachments": [
{
"id": 1051590635917938800,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051590635917938808/image.png",
"fileName": "image.png",
"fileSizeBytes": 17628
}
],
"mentions": [],
"reference": null
},
{
"id": 1051590638501634000,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 15:05:45",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051590636022800400,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051590707003003000,
"author_id": 831267103293964300,
"author_name": "Dazzlefishe",
"timestamp": "12/11/2022 15:06:02",
"content": "this change of basis matrix takes us from (v1,v2,v3) to the basis (e1,e2,e3) right? not the inverse",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051590897189539800,
"author_id": 831267103293964300,
"author_name": "Dazzlefishe",
"timestamp": "12/11/2022 15:06:47",
"content": "no i think it's the inverse",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051593880946090000,
"author_id": 334482942506041340,
"author_name": "Zybikron",
"timestamp": "12/11/2022 15:18:38",
"content": "I feel like we need some more context...",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051593926605287400,
"author_id": 334482942506041340,
"author_name": "Zybikron",
"timestamp": "12/11/2022 15:18:49",
"content": "are the columns just the vectors v1,v2,v3?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051595185882144900,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 15:23:50",
"content": "@Dazzlefishe Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 831267103293964300,
"name": "Dazzlefishe",
"discriminator": "3708",
"nickname": "Dazzlefishe",
"isBot": false
}
],
"reference": null
},
{
"id": 1051595976151945200,
"author_id": 831267103293964300,
"author_name": "Dazzlefishe",
"timestamp": "12/11/2022 15:26:58",
"content": "yes",
"attachments": [],
"mentions": [
{
"id": 334482942506041340,
"name": "Zybikron",
"discriminator": "5611",
"nickname": "Zybikron",
"isBot": false
}
],
"reference": null
},
{
"id": 1051596538566156400,
"author_id": 334482942506041340,
"author_name": "Zybikron",
"timestamp": "12/11/2022 15:29:12",
"content": "then no, you want the inverse of that.",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051596659009785900,
"author_id": 334482942506041340,
"author_name": "Zybikron",
"timestamp": "12/11/2022 15:29:41",
"content": "that's the change of basis matrix from the standard basis to the v1,v2,v3",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051601165479067800,
"author_id": 831267103293964300,
"author_name": "Dazzlefishe",
"timestamp": "12/11/2022 15:47:35",
"content": "is it right to say a change of basis matrix takes a vector from the same basis it's written into?",
"attachments": [],
"mentions": [
{
"id": 334482942506041340,
"name": "Zybikron",
"discriminator": "5611",
"nickname": "Zybikron",
"isBot": false
}
],
"reference": null
},
{
"id": 1051601221657579500,
"author_id": 831267103293964300,
"author_name": "Dazzlefishe",
"timestamp": "12/11/2022 15:47:49",
"content": "so here this matrix takes a vector from (e1,e2,e3)",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051601295854800900,
"author_id": 831267103293964300,
"author_name": "Dazzlefishe",
"timestamp": "12/11/2022 15:48:06",
"content": "and gives me one in (v1,v2,v3)",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051601954658332700,
"author_id": 334482942506041340,
"author_name": "Zybikron",
"timestamp": "12/11/2022 15:50:43",
"content": "yes, it gives you the coordinate vector with respect to v1,v2,v3",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051608846604435600,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 16:18:06",
"content": "@Dazzlefishe Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 831267103293964300,
"name": "Dazzlefishe",
"discriminator": "3708",
"nickname": "Dazzlefishe",
"isBot": false
}
],
"reference": null
},
{
"id": 1051616397811269600,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 16:48:07",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
015468ee07bf4820a374a3c264ff8f1e
|
200,018 |
[
{
"id": 1051616650555822200,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 16:49:07",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051617249523417100,
"author_id": 451551793474961400,
"author_name": "DISS",
"timestamp": "12/11/2022 16:51:30",
"content": "the only part i dont understand is the",
"attachments": [
{
"id": 1051617249271746600,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051617249271746560/Screen_Shot_2022-12-11_at_4.50.54_PM.png",
"fileName": "Screen_Shot_2022-12-11_at_4.50.54_PM.png",
"fileSizeBytes": 2132162
}
],
"mentions": [],
"reference": null
},
{
"id": 1051617252153237500,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 16:51:31",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051617249523417100,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051617301188853800,
"author_id": 451551793474961400,
"author_name": "DISS",
"timestamp": "12/11/2022 16:51:42",
"content": "orange 1/2 and 1 being multipled by orange 2 seen on top of page",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051617322370089000,
"author_id": 451551793474961400,
"author_name": "DISS",
"timestamp": "12/11/2022 16:51:47",
"content": "can someone explajn wehre that comes from",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051617447922368600,
"author_id": 788085606483361800,
"author_name": "chartbit",
"timestamp": "12/11/2022 16:52:17",
"content": "It’s multiplying by 1",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051617496463048700,
"author_id": 724453059828121600,
"author_name": "SlowBrosRUs",
"timestamp": "12/11/2022 16:52:29",
"content": "just 2/2",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051617496605655000,
"author_id": 451551793474961400,
"author_name": "DISS",
"timestamp": "12/11/2022 16:52:29",
"content": "ye ik that but why",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051617503111028900,
"author_id": 788085606483361800,
"author_name": "chartbit",
"timestamp": "12/11/2022 16:52:30",
"content": "Note the orange bits cancel each other out",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051617530957017200,
"author_id": 724453059828121600,
"author_name": "SlowBrosRUs",
"timestamp": "12/11/2022 16:52:37",
"content": "for chain rule to work",
"attachments": [],
"mentions": [
{
"id": 451551793474961400,
"name": "DISS",
"discriminator": "5995",
"nickname": "DISS",
"isBot": false
}
],
"reference": null
},
{
"id": 1051617557934768100,
"author_id": 724453059828121600,
"author_name": "SlowBrosRUs",
"timestamp": "12/11/2022 16:52:43",
"content": "you need the *2",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051617629707710600,
"author_id": 788085606483361800,
"author_name": "chartbit",
"timestamp": "12/11/2022 16:53:01",
"content": "Basically makes your life easier",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051617655032918000,
"author_id": 724453059828121600,
"author_name": "SlowBrosRUs",
"timestamp": "12/11/2022 16:53:07",
"content": "because integral of 2/(2x+1) is ln|2x+1|",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051617729209184400,
"author_id": 451551793474961400,
"author_name": "DISS",
"timestamp": "12/11/2022 16:53:24",
"content": "OHH right ln(2x+1) then we take derivative of inside",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051617747148218400,
"author_id": 451551793474961400,
"author_name": "DISS",
"timestamp": "12/11/2022 16:53:29",
"content": "and divide bc intregration",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051617761811505200,
"author_id": 724453059828121600,
"author_name": "SlowBrosRUs",
"timestamp": "12/11/2022 16:53:32",
"content": "yup",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051617822234640500,
"author_id": 451551793474961400,
"author_name": "DISS",
"timestamp": "12/11/2022 16:53:46",
"content": "ty",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051617877737885800,
"author_id": 451551793474961400,
"author_name": "DISS",
"timestamp": "12/11/2022 16:54:00",
"content": ".close",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051617880577429500,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 16:54:00",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
506d395fd04b4f9a8d59579676ba0f2d
|
200,019 |
[
{
"id": 1051622934373998700,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 17:14:05",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051623153614471300,
"author_id": 658748380125855700,
"author_name": "Lancaster",
"timestamp": "12/11/2022 17:14:58",
"content": "Can someone help me nd teach me how to solve the gravity ball solutions it's so hard to find relations between them ughh",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051623156424650900,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 17:14:58",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051623153614471300,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051623163412369500,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 17:15:00",
"content": null,
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051623389359513600,
"author_id": 485903210272391200,
"author_name": "dldh06",
"timestamp": "12/11/2022 17:15:54",
"content": "Don't open multiple channels",
"attachments": [],
"mentions": [
{
"id": 658748380125855700,
"name": "Lancaster",
"discriminator": "6187",
"nickname": "Lancaster",
"isBot": false
}
],
"reference": null
},
{
"id": 1051623396292702200,
"author_id": 485903210272391200,
"author_name": "dldh06",
"timestamp": "12/11/2022 17:15:55",
"content": ".close",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051623400117895300,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 17:15:56",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
aff4e0f849474aaaafc253c7f3cbc9c9
|
200,020 |
[
{
"id": 1051625684151316500,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 17:25:01",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051626361246203900,
"author_id": 485665875471630340,
"author_name": "ry",
"timestamp": "12/11/2022 17:27:42",
"content": "So this question asks to find the lineraziation of a function. Eventually I will need to take the derivative of f(x), but I am unsure how the (3x+2) becomes raised to the negative one?",
"attachments": [
{
"id": 1051626360881291400,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051626360881291345/Screen_Shot_2022-12-11_at_5.27.04_PM.png",
"fileName": "Screen_Shot_2022-12-11_at_5.27.04_PM.png",
"fileSizeBytes": 38054
}
],
"mentions": [],
"reference": null
},
{
"id": 1051626363624378400,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 17:27:43",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051626361246203900,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051626510907351200,
"author_id": 485665875471630340,
"author_name": "ry",
"timestamp": "12/11/2022 17:28:18",
"content": "We are never raising the (3x+2) to the numerator or anything so why are we making it have the -1 exponent",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051626675328274400,
"author_id": 485903210272391200,
"author_name": "dldh06",
"timestamp": "12/11/2022 17:28:57",
"content": "Exponent rules",
"attachments": [],
"mentions": [
{
"id": 485665875471630340,
"name": "ry",
"discriminator": "3333",
"nickname": "ry",
"isBot": false
}
],
"reference": null
},
{
"id": 1051626740532924500,
"author_id": 485903210272391200,
"author_name": "dldh06",
"timestamp": "12/11/2022 17:29:13",
"content": "$\\frac{1}{a^n} = a^{-n}$",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051627196252422300,
"author_id": 485665875471630340,
"author_name": "ry",
"timestamp": "12/11/2022 17:31:01",
"content": "so if it said something like (93x) would it be 93x^-1?",
"attachments": [],
"mentions": [
{
"id": 485903210272391200,
"name": "dldh06",
"discriminator": "2659",
"nickname": "dldh06",
"isBot": false
}
],
"reference": null
},
{
"id": 1051627262283354100,
"author_id": 485665875471630340,
"author_name": "ry",
"timestamp": "12/11/2022 17:31:17",
"content": "like that exponent rule applies to anything i suppose",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051627273230495900,
"author_id": 485665875471630340,
"author_name": "ry",
"timestamp": "12/11/2022 17:31:20",
"content": "in the denominator",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051627302661935100,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "12/11/2022 17:31:27",
"content": "**dldh06**",
"attachments": [
{
"id": 1051627302838079600,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051627302838079628/485903210272391178.png",
"fileName": "485903210272391178.png",
"fileSizeBytes": 5553
}
],
"mentions": [],
"reference": null
},
{
"id": 1051627402037567500,
"author_id": 485665875471630340,
"author_name": "ry",
"timestamp": "12/11/2022 17:31:50",
"content": "ohh",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051627496434565200,
"author_id": 485665875471630340,
"author_name": "ry",
"timestamp": "12/11/2022 17:32:13",
"content": "i guess im confused because at first there isn't an n in the problem",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051627507192967300,
"author_id": 485665875471630340,
"author_name": "ry",
"timestamp": "12/11/2022 17:32:16",
"content": "like its just 1/a",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051627598268088400,
"author_id": 485665875471630340,
"author_name": "ry",
"timestamp": "12/11/2022 17:32:37",
"content": "and then an exponent comes into the problem",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051627792002981900,
"author_id": 485903210272391200,
"author_name": "dldh06",
"timestamp": "12/11/2022 17:33:23",
"content": "$\\frac{1}{(3x +2)} = \\frac{1}{(3x +2)^1}$",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051627801146564700,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "12/11/2022 17:33:26",
"content": "**dldh06**",
"attachments": [
{
"id": 1051627801280790500,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051627801280790538/485903210272391178.png",
"fileName": "485903210272391178.png",
"fileSizeBytes": 7790
}
],
"mentions": [],
"reference": null
},
{
"id": 1051627920147349500,
"author_id": 485665875471630340,
"author_name": "ry",
"timestamp": "12/11/2022 17:33:54",
"content": "OHH",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051627981753303000,
"author_id": 485665875471630340,
"author_name": "ry",
"timestamp": "12/11/2022 17:34:09",
"content": "so if there was a 2 as an exponent then the a^-n would be (3x+2)^1?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051628021582413800,
"author_id": 485665875471630340,
"author_name": "ry",
"timestamp": "12/11/2022 17:34:18",
"content": "or would it be -2",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051628073591775200,
"author_id": 485903210272391200,
"author_name": "dldh06",
"timestamp": "12/11/2022 17:34:31",
"content": "Negative 2",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051628100418556000,
"author_id": 485665875471630340,
"author_name": "ry",
"timestamp": "12/11/2022 17:34:37",
"content": "i see now",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051628112770781200,
"author_id": 485665875471630340,
"author_name": "ry",
"timestamp": "12/11/2022 17:34:40",
"content": "thanks a bunch",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051628168546623600,
"author_id": 485665875471630340,
"author_name": "ry",
"timestamp": "12/11/2022 17:34:53",
"content": ".close",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051628171453276300,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 17:34:54",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
6664c3a3593949f387962b45187837e9
|
200,021 |
[
{
"id": 1034477361732788400,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "10/25/2022 10:43:42",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034478418420576400,
"author_id": 994645467008864400,
"author_name": "Howard Mcgill",
"timestamp": "10/25/2022 10:47:54",
"content": "",
"attachments": [
{
"id": 1034478417824981000,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1034478417824980992/IMG_6558.jpg",
"fileName": "IMG_6558.jpg",
"fileSizeBytes": 2335989
}
],
"mentions": [],
"reference": null
},
{
"id": 1034478421817950200,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "10/25/2022 10:47:55",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1034478418420576400,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1034478475186290700,
"author_id": 994645467008864400,
"author_name": "Howard Mcgill",
"timestamp": "10/25/2022 10:48:08",
"content": "i’m somehow struggling on this gcse question Q3 help please lmaooo",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034478810416029700,
"author_id": 484702191156985860,
"author_name": "themateo713",
"timestamp": "10/25/2022 10:49:28",
"content": ",w 405 * 8/27",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034478817781223600,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "10/25/2022 10:49:29",
"content": "Results provided by WolframAlpha",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034478944474386600,
"author_id": 994645467008864400,
"author_name": "Howard Mcgill",
"timestamp": "10/25/2022 10:50:00",
"content": "explanation??",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034478956402970600,
"author_id": 484702191156985860,
"author_name": "themateo713",
"timestamp": "10/25/2022 10:50:02",
"content": "if they're similar, then you can say B is A multiplied by a size factor k",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034479019632103400,
"author_id": 484702191156985860,
"author_name": "themateo713",
"timestamp": "10/25/2022 10:50:17",
"content": "then their areas are proportionate to a ratio k²",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034479041505415300,
"author_id": 484702191156985860,
"author_name": "themateo713",
"timestamp": "10/25/2022 10:50:23",
"content": "and their volumes to a ratio k^3",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034479059800948900,
"author_id": 484702191156985860,
"author_name": "themateo713",
"timestamp": "10/25/2022 10:50:27",
"content": "you're given k²",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034479068638347300,
"author_id": 994645467008864400,
"author_name": "Howard Mcgill",
"timestamp": "10/25/2022 10:50:29",
"content": "OHHHH got it",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034479081451946100,
"author_id": 994645467008864400,
"author_name": "Howard Mcgill",
"timestamp": "10/25/2022 10:50:32",
"content": "yeah thanks got it!!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034479137697566800,
"author_id": 994645467008864400,
"author_name": "Howard Mcgill",
"timestamp": "10/25/2022 10:50:46",
"content": ".close",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034479140516147200,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "10/25/2022 10:50:46",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
ffb45d0856714d85936397637244b979
|
200,022 |
[
{
"id": 1051628891065819300,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 17:37:45",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051630476097486800,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 17:44:03",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051630472960163800,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051632254230745100,
"author_id": 1051598289981690000,
"author_name": "bruh!",
"timestamp": "12/11/2022 17:51:07",
"content": ".close",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051632256831209600,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 17:51:08",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
e66933d7ba364e4a90b77048fd6297cf
|
200,023 |
[
{
"id": 1051634028371001500,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 17:58:10",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051635940461903900,
"author_id": 210880762965262340,
"author_name": "charles",
"timestamp": "12/11/2022 18:05:46",
"content": "How do I get the original function given the derivative, without using integrals?",
"attachments": [
{
"id": 1051635940130566300,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051635940130566235/image.png",
"fileName": "image.png",
"fileSizeBytes": 26529
}
],
"mentions": [],
"reference": null
},
{
"id": 1051635944152907900,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 18:05:47",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051635940461903900,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051636096095764500,
"author_id": 210880762965262340,
"author_name": "charles",
"timestamp": "12/11/2022 18:06:23",
"content": "not really sure how to start this question",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051636177364582400,
"author_id": 521464336284254200,
"author_name": "Gamer Dio",
"timestamp": "12/11/2022 18:06:43",
"content": "Whats the limit definition of an derivative?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051636359875539000,
"author_id": 210880762965262340,
"author_name": "charles",
"timestamp": "12/11/2022 18:07:26",
"content": "isnt it f'(x) = f(x+h) - f(x) / h",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051636414036574200,
"author_id": 210880762965262340,
"author_name": "charles",
"timestamp": "12/11/2022 18:07:39",
"content": "oh, lim h ->0",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051636513517084700,
"author_id": 521464336284254200,
"author_name": "Gamer Dio",
"timestamp": "12/11/2022 18:08:03",
"content": "Yes",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051636572279283700,
"author_id": 210880762965262340,
"author_name": "charles",
"timestamp": "12/11/2022 18:08:17",
"content": "but its confusing because the question says f'(a) not f'(x)",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051636573495623700,
"author_id": 521464336284254200,
"author_name": "Gamer Dio",
"timestamp": "12/11/2022 18:08:17",
"content": "Notice any similarities with the limit in the problem?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051636638171803600,
"author_id": 210880762965262340,
"author_name": "charles",
"timestamp": "12/11/2022 18:08:33",
"content": "wait",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051636656177950700,
"author_id": 521464336284254200,
"author_name": "Gamer Dio",
"timestamp": "12/11/2022 18:08:37",
"content": "f'(a) = lim h->0 (f(a + h) - f(a))/h",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051636846725181400,
"author_id": 210880762965262340,
"author_name": "charles",
"timestamp": "12/11/2022 18:09:22",
"content": "does this have to do with trig identities",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051636873791021000,
"author_id": 521464336284254200,
"author_name": "Gamer Dio",
"timestamp": "12/11/2022 18:09:29",
"content": "No",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051636944213389400,
"author_id": 521464336284254200,
"author_name": "Gamer Dio",
"timestamp": "12/11/2022 18:09:45",
"content": "Compare the limit definition to what you're given",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051637088543584300,
"author_id": 210880762965262340,
"author_name": "charles",
"timestamp": "12/11/2022 18:10:20",
"content": "alright I will give that a try",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051637843040141300,
"author_id": 210880762965262340,
"author_name": "charles",
"timestamp": "12/11/2022 18:13:20",
"content": "",
"attachments": [
{
"id": 1051637842587164700,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051637842587164722/image.png",
"fileName": "image.png",
"fileSizeBytes": 55773
}
],
"mentions": [],
"reference": null
},
{
"id": 1051637863772590100,
"author_id": 210880762965262340,
"author_name": "charles",
"timestamp": "12/11/2022 18:13:25",
"content": "I got it :))",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051637879274741800,
"author_id": 210880762965262340,
"author_name": "charles",
"timestamp": "12/11/2022 18:13:28",
"content": "Thanks",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051641656966905900,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 18:28:29",
"content": "@charles Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 210880762965262340,
"name": "charles",
"discriminator": "6679",
"nickname": "charles",
"isBot": false
}
],
"reference": null
},
{
"id": 1051641684301197300,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 18:28:36",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
1b6eb6d8105b4a43b1aae5ce78b6a808
|
200,024 |
[
{
"id": 1051641935795867600,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 18:29:36",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051644399525834800,
"author_id": 465622693992071200,
"author_name": "vvs",
"timestamp": "12/11/2022 18:39:23",
"content": "I have no idea how to begin this question",
"attachments": [
{
"id": 1051644398980571300,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051644398980571236/image.png",
"fileName": "image.png",
"fileSizeBytes": 31272
}
],
"mentions": [],
"reference": null
},
{
"id": 1051644402474430500,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 18:39:24",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051644399525834800,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051648175796142100,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 18:54:23",
"content": "@vvs Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 465622693992071200,
"name": "vvs",
"discriminator": "7777",
"nickname": "vvs",
"isBot": false
}
],
"reference": null
},
{
"id": 1051649304999252000,
"author_id": 465622693992071200,
"author_name": "vvs",
"timestamp": "12/11/2022 18:58:53",
"content": ".close",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051649307641663500,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 18:58:53",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
70147ac53010469987568bc1f71dc57b
|
200,025 |
[
{
"id": 1051649559383781500,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 18:59:53",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051650103028502700,
"author_id": 345205383373258750,
"author_name": "Thewolverine_123",
"timestamp": "12/11/2022 19:02:03",
"content": "",
"attachments": [
{
"id": 1051650102873292800,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051650102873292850/image.png",
"fileName": "image.png",
"fileSizeBytes": 108521
}
],
"mentions": [],
"reference": null
},
{
"id": 1051650105628954800,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 19:02:03",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051650103028502700,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051650117586911200,
"author_id": 345205383373258750,
"author_name": "Thewolverine_123",
"timestamp": "12/11/2022 19:02:06",
"content": "Is whats in the box correct?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051650335615230000,
"author_id": 345205383373258750,
"author_name": "Thewolverine_123",
"timestamp": "12/11/2022 19:02:58",
"content": "limit as k>inf of (k!/e^k) = infinity?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051650342800080900,
"author_id": 261933205387477000,
"author_name": "riemann",
"timestamp": "12/11/2022 19:03:00",
"content": "yes",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051650367156396200,
"author_id": 261933205387477000,
"author_name": "riemann",
"timestamp": "12/11/2022 19:03:06",
"content": ",calc 10! / e^10",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051650369257742300,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "12/11/2022 19:03:06",
"content": "Result:\n```\n164.74726512211\n```",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051650418637275100,
"author_id": 261933205387477000,
"author_name": "riemann",
"timestamp": "12/11/2022 19:03:18",
"content": ",calc 15! / e^15",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051650420386320400,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "12/11/2022 19:03:18",
"content": "Result:\n```\n4.0002062363196e+5\n```",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051650660904476800,
"author_id": 345205383373258750,
"author_name": "Thewolverine_123",
"timestamp": "12/11/2022 19:04:16",
"content": "limit as k>inf of k! is infinity and limit as k>inf of e^k is infinity.... isnt that infinity over infinity which is indeterminate?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051650806123860000,
"author_id": 254377887522750460,
"author_name": "poppylikecats",
"timestamp": "12/11/2022 19:04:50",
"content": "indeterminate means something else",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051650808095191200,
"author_id": 261933205387477000,
"author_name": "riemann",
"timestamp": "12/11/2022 19:04:51",
"content": "then don't use l'hopital",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051651546808590300,
"author_id": 345205383373258750,
"author_name": "Thewolverine_123",
"timestamp": "12/11/2022 19:07:47",
"content": "wait so if the limit of the nominator is infinity, and the limit of the denominator is infinity, then the whole limit is infinity? @riemann",
"attachments": [],
"mentions": [
{
"id": 261933205387477000,
"name": "riemann",
"discriminator": "2529",
"nickname": "riemann",
"isBot": false
}
],
"reference": null
},
{
"id": 1051651596766941200,
"author_id": 261933205387477000,
"author_name": "riemann",
"timestamp": "12/11/2022 19:07:59",
"content": "that's not what i said",
"attachments": [],
"mentions": [
{
"id": 345205383373258750,
"name": "Thewolverine_123",
"discriminator": "0829",
"nickname": "Thewolverine_123",
"isBot": false
}
],
"reference": null
},
{
"id": 1051651705957257200,
"author_id": 261933205387477000,
"author_name": "riemann",
"timestamp": "12/11/2022 19:08:25",
"content": "by that logic, $\\lim_{x \\ra \\infty} \\frac{2x}{x}$ is also infinity",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051651716447211600,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "12/11/2022 19:08:27",
"content": "**riemann**",
"attachments": [
{
"id": 1051651716501745800,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051651716501745754/261933205387477002.png",
"fileName": "261933205387477002.png",
"fileSizeBytes": 15169
}
],
"mentions": [],
"reference": null
},
{
"id": 1051652075202809900,
"author_id": 345205383373258750,
"author_name": "Thewolverine_123",
"timestamp": "12/11/2022 19:09:53",
"content": "Aha I see, but I still don't understand, does this not matter when I am finding the limits?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051652237853724700,
"author_id": 345205383373258750,
"author_name": "Thewolverine_123",
"timestamp": "12/11/2022 19:10:32",
"content": "Like how am I supposed to find the limit of this?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051652360197378200,
"author_id": 345205383373258750,
"author_name": "Thewolverine_123",
"timestamp": "12/11/2022 19:11:01",
"content": "You showed me these 2, but all these 2 say is that the limit of the top is infinity and that the limit of the bottom is infinity",
"attachments": [],
"mentions": [
{
"id": 261933205387477000,
"name": "riemann",
"discriminator": "2529",
"nickname": "riemann",
"isBot": false
}
],
"reference": null
},
{
"id": 1051652366052622500,
"author_id": 261933205387477000,
"author_name": "riemann",
"timestamp": "12/11/2022 19:11:02",
"content": "lots of ways to prove it",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051652371752698000,
"author_id": 261933205387477000,
"author_name": "riemann",
"timestamp": "12/11/2022 19:11:04",
"content": "https://math.stackexchange.com/a/351841",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051652466191634600,
"author_id": 261933205387477000,
"author_name": "riemann",
"timestamp": "12/11/2022 19:11:26",
"content": "look at the results of the calculation and compare their growth",
"attachments": [],
"mentions": [
{
"id": 345205383373258750,
"name": "Thewolverine_123",
"discriminator": "0829",
"nickname": "Thewolverine_123",
"isBot": false
}
],
"reference": null
},
{
"id": 1051652641891024900,
"author_id": 345205383373258750,
"author_name": "Thewolverine_123",
"timestamp": "12/11/2022 19:12:08",
"content": "factorial growth is bigger yes, which means the limit is infinity, but is that how to perform the divergence test for these?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051652810330091500,
"author_id": 261933205387477000,
"author_name": "riemann",
"timestamp": "12/11/2022 19:12:48",
"content": "why do you need the divergence test",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051652888381882400,
"author_id": 261933205387477000,
"author_name": "riemann",
"timestamp": "12/11/2022 19:13:07",
"content": "you just show that it's not 0",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051652970518937600,
"author_id": 261933205387477000,
"author_name": "riemann",
"timestamp": "12/11/2022 19:13:26",
"content": "this gives you the limit that it's infinity, and since that's not 0, the divergence* test tells you the series diverges",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051653212672889000,
"author_id": 345205383373258750,
"author_name": "Thewolverine_123",
"timestamp": "12/11/2022 19:14:24",
"content": "Okay so basically to find the limit of this, I need to compare the growth rates, right?",
"attachments": [
{
"id": 1051653212320583800,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051653212320583790/image.png",
"fileName": "image.png",
"fileSizeBytes": 23439
}
],
"mentions": [],
"reference": null
},
{
"id": 1051653735039893600,
"author_id": 254377887522750460,
"author_name": "poppylikecats",
"timestamp": "12/11/2022 19:16:29",
"content": "if youre allowed to use logs then you can make the problem a lot easier",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051653794783580200,
"author_id": 254377887522750460,
"author_name": "poppylikecats",
"timestamp": "12/11/2022 19:16:43",
"content": "maybe",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051654084849045600,
"author_id": 254377887522750460,
"author_name": "poppylikecats",
"timestamp": "12/11/2022 19:17:52",
"content": "actually nevermind its probably easier to just look at examples of k > 2 and then see that k/e > 1 and increasing",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051654827811274800,
"author_id": 345205383373258750,
"author_name": "Thewolverine_123",
"timestamp": "12/11/2022 19:20:49",
"content": "Okay thanks",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051654839916056600,
"author_id": 345205383373258750,
"author_name": "Thewolverine_123",
"timestamp": "12/11/2022 19:20:52",
"content": ".close",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051654842352939000,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 19:20:53",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
1845fd3d922c42458c14184d552e0d86
|
200,026 |
[
{
"id": 1051660923665928300,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 19:45:03",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051662084481495000,
"author_id": 467819503959408640,
"author_name": "Acе",
"timestamp": "12/11/2022 19:49:39",
"content": "Hi",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051662086289240200,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 19:49:40",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051662084481495000,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051662229113667600,
"author_id": 467819503959408640,
"author_name": "Acе",
"timestamp": "12/11/2022 19:50:14",
"content": "What is the difference between a density function being the integrand of a of a scalar surface integral and a density function being the integrand of a standard double integral",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051662823597555800,
"author_id": 261933205387477000,
"author_name": "riemann",
"timestamp": "12/11/2022 19:52:36",
"content": "do you have an actual problem you're solving?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051662911082340400,
"author_id": 1029302033993433100,
"author_name": "Riki",
"timestamp": "12/11/2022 19:52:56",
"content": "The main difference between a density function being the integrand of a scalar surface integral and a density function being the integrand of a standard double integral is the dimensionality of the integral.\n\nA scalar surface integral is an integral that takes a scalar-valued function (i.e. a density function) defined on a two-dimensional surface and integrates it over that surface to compute a scalar quantity. In other words, a scalar surface integral is a two-dimensional integral that integrates a density function defined on a surface.\n\nOn the other hand, a standard double integral is an integral that takes a scalar-valued function (i.e. a density function) defined on a three-dimensional region and integrates it over that region to compute a scalar quantity. In other words, a standard double integral is a three-dimensional integral that integrates a density function defined on a region in space.\n\nSo, the main difference between a density function being the integrand of a scalar surface integral and a density function being the integrand of a standard double integral is the dimensionality of the integral. A scalar surface integral is a two-dimensional integral, while a standard double integral is a three-dimensional integral.",
"attachments": [],
"mentions": [
{
"id": 467819503959408640,
"name": "Acе",
"discriminator": "4406",
"nickname": "Acе",
"isBot": false
}
],
"reference": null
},
{
"id": 1051663033769930800,
"author_id": 467819503959408640,
"author_name": "Acе",
"timestamp": "12/11/2022 19:53:26",
"content": "Sadly not, I just want to understand the concept.",
"attachments": [],
"mentions": [
{
"id": 261933205387477000,
"name": "riemann",
"discriminator": "2529",
"nickname": "riemann",
"isBot": false
}
],
"reference": null
},
{
"id": 1051663384778657800,
"author_id": 467819503959408640,
"author_name": "Acе",
"timestamp": "12/11/2022 19:54:49",
"content": "I see. So if the region was a 2D region, I would use a scalar surface integral, but if it was a 3D region, I would use a double integral?",
"attachments": [],
"mentions": [
{
"id": 1029302033993433100,
"name": "Riki",
"discriminator": "3554",
"nickname": "Riki",
"isBot": false
}
],
"reference": null
},
{
"id": 1051663566261993600,
"author_id": 1029302033993433100,
"author_name": "Riki",
"timestamp": "12/11/2022 19:55:33",
"content": "Yes, A scalar surface integral is used to integrate over a two-dimensional region, while a double integral is used to integrate over a three-dimensional region.",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051663777709441000,
"author_id": 467819503959408640,
"author_name": "Acе",
"timestamp": "12/11/2022 19:56:23",
"content": "Ah okay, and this is because a scalar surface integral is parameterized in terms of (x, y), but a double integral would be finding the volume of a 3D space?",
"attachments": [],
"mentions": [
{
"id": 1029302033993433100,
"name": "Riki",
"discriminator": "3554",
"nickname": "Riki",
"isBot": false
}
],
"reference": null
},
{
"id": 1051663856847556700,
"author_id": 1029302033993433100,
"author_name": "Riki",
"timestamp": "12/11/2022 19:56:42",
"content": "Yea",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051663969967935600,
"author_id": 1029302033993433100,
"author_name": "Riki",
"timestamp": "12/11/2022 19:57:09",
"content": "A scalar surface integral is defined as an integral of a scalar-valued function over a two-dimensional region, and is often parameterized in terms of `x` and `y`. A double integral, on the other hand, is defined as an integral of a scalar-valued function over a three-dimensional region, and is used to find the volume of a three-dimensional space.\n\nIn general, a scalar surface integral is used to integrate a function over a two-dimensional region, while a double integral is used to integrate a function over a three-dimensional region. Both types of integrals can be useful for studying various phenomena in physics, engineering, and other fields.",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051667553300271200,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 20:11:23",
"content": "@Acе Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 467819503959408640,
"name": "Acе",
"discriminator": "4406",
"nickname": "Acе",
"isBot": false
}
],
"reference": null
},
{
"id": 1051667872428085400,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 20:12:39",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
b9bbed6d91fd4e1d8fa3696d4623fd3f
|
200,027 |
[
{
"id": 1051668123301970000,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 20:13:39",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051668541444731000,
"author_id": 720403324201074700,
"author_name": "wen",
"timestamp": "12/11/2022 20:15:19",
"content": "would the interior critical point for this be (1/2, 0)",
"attachments": [
{
"id": 1051668541180493800,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051668541180493834/image.png",
"fileName": "image.png",
"fileSizeBytes": 12981
}
],
"mentions": [],
"reference": null
},
{
"id": 1051668544619811000,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 20:15:20",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051668541444731000,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051668580145569900,
"author_id": 720403324201074700,
"author_name": "wen",
"timestamp": "12/11/2022 20:15:28",
"content": "(the overall problem is to find the abs max/min)",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051672356105494700,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 20:30:28",
"content": "@wen Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 720403324201074700,
"name": "wen",
"discriminator": "2514",
"nickname": "wen",
"isBot": false
}
],
"reference": null
},
{
"id": 1051679969543205000,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 21:00:44",
"content": "@wen Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 720403324201074700,
"name": "wen",
"discriminator": "2514",
"nickname": "wen",
"isBot": false
}
],
"reference": null
},
{
"id": 1051695337032659100,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 22:01:47",
"content": "@wen Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 720403324201074700,
"name": "wen",
"discriminator": "2514",
"nickname": "wen",
"isBot": false
}
],
"reference": null
},
{
"id": 1051706875751715000,
"author_id": 261933205387477000,
"author_name": "riemann",
"timestamp": "12/11/2022 22:47:38",
"content": ".close",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051706881011351600,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 22:47:40",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
e4415c2c99d74580a6b334a6ab36d385
|
200,028 |
[
{
"id": 1051707132111765600,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 22:48:40",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051710453098754000,
"author_id": 404546189372162050,
"author_name": "Skywalker",
"timestamp": "12/11/2022 23:01:51",
"content": "Hey math people",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051710455153963100,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 23:01:52",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051710453098754000,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051710477807390700,
"author_id": 404546189372162050,
"author_name": "Skywalker",
"timestamp": "12/11/2022 23:01:57",
"content": "I need a little help with syntax",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051710528793358300,
"author_id": 404546189372162050,
"author_name": "Skywalker",
"timestamp": "12/11/2022 23:02:09",
"content": "",
"attachments": [
{
"id": 1051710528470388900,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051710528470388836/Screen_Shot_2022-12-11_at_8.02.05_PM.png",
"fileName": "Screen_Shot_2022-12-11_at_8.02.05_PM.png",
"fileSizeBytes": 131994
}
],
"mentions": [],
"reference": null
},
{
"id": 1051710574016344000,
"author_id": 404546189372162050,
"author_name": "Skywalker",
"timestamp": "12/11/2022 23:02:20",
"content": "I understand what this problem is asking for, and I understand the solution",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051710604320194600,
"author_id": 404546189372162050,
"author_name": "Skywalker",
"timestamp": "12/11/2022 23:02:27",
"content": "I'm just not sure how to express is mathematically",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051714379864866800,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 23:17:28",
"content": "@Skywalker Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 404546189372162050,
"name": "Skywalker",
"discriminator": "9340",
"nickname": "Skywalker",
"isBot": false
}
],
"reference": null
},
{
"id": 1051714398684725200,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 23:17:32",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
470b346e9d794281acb0a9ee76c0a253
|
200,029 |
[
{
"id": 1051714652431732700,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 23:18:33",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051716028540911700,
"author_id": 896755250092998800,
"author_name": "b3s4d",
"timestamp": "12/11/2022 23:24:01",
"content": "Given the mapping f : R → R^2, f(t) = (t^2, t^3). Furthermore, let M = f(R), and let U ⊆ R^2 be an open neighborhood of (0, 0) ∈ R^2 (U is an open set with (0, 0) ∈ U). Treat the following points:\n(a) Is f a smooth mapping?\nb) What does the derivative Df_t tell us about the local behavior of f (at various points t ∈ R)? Can f be seen as a diffeomorphism?\nc) Is f a homeomorphism between R and M? If so, what does f^(-1) look like?\nd) Describe the primal image f^(-1)(0, 0).\ne) Is M a manifold?\n\nHello can someone help on b)?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051716030537412700,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 23:24:01",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051716028540911700,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051719804236599300,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/11/2022 23:39:01",
"content": "@b3s4d Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 896755250092998800,
"name": "b3s4d",
"discriminator": "9845",
"nickname": "b3s4d",
"isBot": false
}
],
"reference": null
},
{
"id": 1051727725582360700,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 00:10:29",
"content": "@b3s4d Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 896755250092998800,
"name": "b3s4d",
"discriminator": "9845",
"nickname": "b3s4d",
"isBot": false
}
],
"reference": null
},
{
"id": 1051735277275730000,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 00:40:30",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
6a12c47f27074b078bd0c30a36515528
|
200,030 |
[
{
"id": 1051735529206599700,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 00:41:30",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051737175131168800,
"author_id": 449684642845556740,
"author_name": "Tez",
"timestamp": "12/12/2022 00:48:02",
"content": "",
"attachments": [
{
"id": 1051737174967582700,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051737174967582720/69251124473__355DD438-8AF6-4800-8BD9-EBAF6870FA1B.jpg",
"fileName": "69251124473__355DD438-8AF6-4800-8BD9-EBAF6870FA1B.jpg",
"fileSizeBytes": 534509
}
],
"mentions": [],
"reference": null
},
{
"id": 1051737177387712500,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 00:48:03",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051737175131168800,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051737233679470600,
"author_id": 449684642845556740,
"author_name": "Tez",
"timestamp": "12/12/2022 00:48:16",
"content": "Confused on how to setup the equations for this problem",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051737525108097000,
"author_id": 449684642845556740,
"author_name": "Tez",
"timestamp": "12/12/2022 00:49:26",
"content": "More clear image of question",
"attachments": [
{
"id": 1051737525263269900,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051737525263269898/69251124473__355DD438-8AF6-4800-8BD9-EBAF6870FA1B.jpg",
"fileName": "69251124473__355DD438-8AF6-4800-8BD9-EBAF6870FA1B.jpg",
"fileSizeBytes": 376231
}
],
"mentions": [],
"reference": null
},
{
"id": 1051741217144188900,
"author_id": 449684642845556740,
"author_name": "Tez",
"timestamp": "12/12/2022 01:04:06",
"content": "@Helpers",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051744293062201300,
"author_id": 449684642845556740,
"author_name": "Tez",
"timestamp": "12/12/2022 01:16:19",
"content": "@Helpers",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051748069005344900,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 01:31:20",
"content": "@Tez Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 449684642845556740,
"name": "Tez",
"discriminator": "1433",
"nickname": "Tez",
"isBot": false
}
],
"reference": null
},
{
"id": 1051755970214232000,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 02:02:43",
"content": "@Tez Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 449684642845556740,
"name": "Tez",
"discriminator": "1433",
"nickname": "Tez",
"isBot": false
}
],
"reference": null
},
{
"id": 1051763521693700100,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 02:32:44",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
bdc137eff56b470294dbab95bc4fd35f
|
200,031 |
[
{
"id": 1051763775138697200,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 02:33:44",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051764481476264000,
"author_id": 893512897500676100,
"author_name": "Zim",
"timestamp": "12/12/2022 02:36:33",
"content": "",
"attachments": [
{
"id": 1051764481530802200,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051764481530802186/image.png",
"fileName": "image.png",
"fileSizeBytes": 179404
}
],
"mentions": [],
"reference": null
},
{
"id": 1051764486144528400,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 02:36:34",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051764481476264000,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051768258585436200,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 02:51:33",
"content": "@Zim Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 893512897500676100,
"name": "Zim",
"discriminator": "7613",
"nickname": "Zim",
"isBot": false
}
],
"reference": null
},
{
"id": 1051775864523735000,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 03:21:47",
"content": "@Zim Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 893512897500676100,
"name": "Zim",
"discriminator": "7613",
"nickname": "Zim",
"isBot": false
}
],
"reference": null
},
{
"id": 1051791615527747600,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 04:24:22",
"content": "@Zim Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 893512897500676100,
"name": "Zim",
"discriminator": "7613",
"nickname": "Zim",
"isBot": false
}
],
"reference": null
},
{
"id": 1051806716897013800,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 05:24:22",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
77be7fdff8474ddfac24a6d8090406e0
|
200,032 |
[
{
"id": 1034480948026290200,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "10/25/2022 10:57:57",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034482914546700300,
"author_id": 480289660162146300,
"author_name": "stolas",
"timestamp": "10/25/2022 11:05:46",
"content": "Quick question: Does an integrand have to be a multiplication? Like (23x-3)2dx, or would 46x-6dx also work?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034482917042290800,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "10/25/2022 11:05:47",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1034482914546700300,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1034483332957864000,
"author_id": 183668144404037630,
"author_name": "Ann",
"timestamp": "10/25/2022 11:07:26",
"content": "(46x - 6) dx.",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034483605839298700,
"author_id": 480289660162146300,
"author_name": "stolas",
"timestamp": "10/25/2022 11:08:31",
"content": "Oh yeah, sorry i missed that. But now its pretty self explaining.",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034483702119530500,
"author_id": 480289660162146300,
"author_name": "stolas",
"timestamp": "10/25/2022 11:08:54",
"content": ".close",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034483705143623800,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "10/25/2022 11:08:55",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
45bc11c35ef3429c87b88776c44e8abb
|
200,033 |
[
{
"id": 1051806968416849900,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 05:25:22",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051811443550462000,
"author_id": 748544068656693400,
"author_name": "Chapss",
"timestamp": "12/12/2022 05:43:09",
"content": "how to know the location of an hypothenuse?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051811445500809200,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 05:43:10",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051811443550462000,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051811576673472500,
"author_id": 425086140715106300,
"author_name": "soda",
"timestamp": "12/12/2022 05:43:41",
"content": "Does anybody know what's the name of this inequality? $$x^ay^b\\leq\\frac{a}{a+b}x^{a+b}+\\frac{b}{a+b}y^{a+b}$$",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051811587851305000,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "12/12/2022 05:43:44",
"content": "**soda**",
"attachments": [
{
"id": 1051811587901632500,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051811587901632532/425086140715106314.png",
"fileName": "425086140715106314.png",
"fileSizeBytes": 28414
}
],
"mentions": [],
"reference": null
},
{
"id": 1051811623536443400,
"author_id": 348696743388381200,
"author_name": "A Lonely Bean",
"timestamp": "12/12/2022 05:43:52",
"content": "In a right triangle it's the side opposite to the 90 degrees angle",
"attachments": [],
"mentions": [
{
"id": 748544068656693400,
"name": "Chapss",
"discriminator": "4839",
"nickname": "Chapss",
"isBot": false
}
],
"reference": null
},
{
"id": 1051811700325744800,
"author_id": 348696743388381200,
"author_name": "A Lonely Bean",
"timestamp": "12/12/2022 05:44:11",
"content": "Post your question in an available help channel, but I don't think that has a name",
"attachments": [],
"mentions": [
{
"id": 425086140715106300,
"name": "soda",
"discriminator": "8322",
"nickname": "soda",
"isBot": false
}
],
"reference": null
},
{
"id": 1051811984145911800,
"author_id": 748544068656693400,
"author_name": "Chapss",
"timestamp": "12/12/2022 05:45:18",
"content": "this?",
"attachments": [
{
"id": 1051811983806181400,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051811983806181426/IMG_20221212_184542.jpg",
"fileName": "IMG_20221212_184542.jpg",
"fileSizeBytes": 282661
}
],
"mentions": [
{
"id": 348696743388381200,
"name": "A Lonely Bean",
"discriminator": "7998",
"nickname": "A Lonely Bean",
"isBot": false
}
],
"reference": null
},
{
"id": 1051812017209610200,
"author_id": 348696743388381200,
"author_name": "A Lonely Bean",
"timestamp": "12/12/2022 05:45:26",
"content": "Yes",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051812034783760400,
"author_id": 748544068656693400,
"author_name": "Chapss",
"timestamp": "12/12/2022 05:45:30",
"content": "thanks",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051812319434387500,
"author_id": 183668144404037630,
"author_name": "Ann",
"timestamp": "12/12/2022 05:46:38",
"content": "it's hypo**t**enuse btw",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051813550626193400,
"author_id": 748544068656693400,
"author_name": "Chapss",
"timestamp": "12/12/2022 05:51:32",
"content": "thank you",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051817326506430500,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 06:06:32",
"content": "@Chapss Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 748544068656693400,
"name": "Chapss",
"discriminator": "4839",
"nickname": "Chapss",
"isBot": false
}
],
"reference": null
},
{
"id": 1051817366335525000,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 06:06:41",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
741e9b47f365400c99ef29f455007c9d
|
200,034 |
[
{
"id": 1051821164856623100,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 06:21:47",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051822240427163600,
"author_id": 990280503829598300,
"author_name": "Glomz",
"timestamp": "12/12/2022 06:26:04",
"content": "hi",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051822242813710500,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 06:26:04",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051822240427163600,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051822272966557700,
"author_id": 990280503829598300,
"author_name": "Glomz",
"timestamp": "12/12/2022 06:26:11",
"content": "i have doubt",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051822443238522900,
"author_id": 990280503829598300,
"author_name": "Glomz",
"timestamp": "12/12/2022 06:26:52",
"content": "what is 39993x278347184x0",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051823035507818500,
"author_id": 220517274845577200,
"author_name": "ramonov",
"timestamp": "12/12/2022 06:29:13",
"content": "@Moderators intentional troll behaviour based on previous posts",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051823720374739000,
"author_id": 756743425272840200,
"author_name": "anand",
"timestamp": "12/12/2022 06:31:56",
"content": "A 14d temp ban will prove fruitful in this particular case ig",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051824375772487700,
"author_id": 990280503829598300,
"author_name": "Glomz",
"timestamp": "12/12/2022 06:34:33",
"content": "huh",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051824393476636800,
"author_id": 990280503829598300,
"author_name": "Glomz",
"timestamp": "12/12/2022 06:34:37",
"content": "i have a doubt",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051824400527278100,
"author_id": 990280503829598300,
"author_name": "Glomz",
"timestamp": "12/12/2022 06:34:39",
"content": "pls",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051824422752882700,
"author_id": 990280503829598300,
"author_name": "Glomz",
"timestamp": "12/12/2022 06:34:44",
"content": ".reopen",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051824482077135000,
"author_id": 990280503829598300,
"author_name": "Glomz",
"timestamp": "12/12/2022 06:34:58",
"content": "see",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051824894167503000,
"author_id": 490649542077841400,
"author_name": "tatpoj",
"timestamp": "12/12/2022 06:36:36",
"content": "about multiplying by 0?",
"attachments": [],
"mentions": [
{
"id": 990280503829598300,
"name": "Glomz",
"discriminator": "2512",
"nickname": "Glomz",
"isBot": false
}
],
"reference": null
},
{
"id": 1051824924219686900,
"author_id": 490649542077841400,
"author_name": "tatpoj",
"timestamp": "12/12/2022 06:36:43",
"content": "Your last question was about 1+1..",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051825011314409500,
"author_id": 990280503829598300,
"author_name": "Glomz",
"timestamp": "12/12/2022 06:37:04",
"content": "yes",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051825118105579500,
"author_id": 990280503829598300,
"author_name": "Glomz",
"timestamp": "12/12/2022 06:37:30",
"content": "ok im sorry. can i get to the real doubt?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051825229581799400,
"author_id": 990280503829598300,
"author_name": "Glomz",
"timestamp": "12/12/2022 06:37:56",
"content": "i cant understand linear equations in one variable.",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051827722097283100,
"author_id": 990280503829598300,
"author_name": "Glomz",
"timestamp": "12/12/2022 06:47:50",
"content": "yo",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051828679447163000,
"author_id": 220517274845577200,
"author_name": "ramonov",
"timestamp": "12/12/2022 06:51:39",
"content": "if you genuinely want help, its recommended that you don't antagonise people and waste their time\npost what you're actually stuck on",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051828922968449000,
"author_id": 990280503829598300,
"author_name": "Glomz",
"timestamp": "12/12/2022 06:52:37",
"content": "a boy is now one third of his fathers age.12 yearrs hence,he will be half as old as his father.find the present age of son and father",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051828946947280900,
"author_id": 990280503829598300,
"author_name": "Glomz",
"timestamp": "12/12/2022 06:52:42",
"content": "how to frame equation",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051829607743094900,
"author_id": 203864799870844930,
"author_name": "rat",
"timestamp": "12/12/2022 06:55:20",
"content": "@Glomz Do not open help channels/threads with silly questions like this",
"attachments": [],
"mentions": [
{
"id": 990280503829598300,
"name": "Glomz",
"discriminator": "2512",
"nickname": "Glomz",
"isBot": false
}
],
"reference": null
},
{
"id": 1051829679922872300,
"author_id": 990280503829598300,
"author_name": "Glomz",
"timestamp": "12/12/2022 06:55:37",
"content": "linear equations",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051830100586410000,
"author_id": 203864799870844930,
"author_name": "rat",
"timestamp": "12/12/2022 06:57:18",
"content": "Consider this your warning - don't do it again. If you have an actual question you need help with, great. Ask that, not something silly.",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051830207654395900,
"author_id": 990280503829598300,
"author_name": "Glomz",
"timestamp": "12/12/2022 06:57:43",
"content": "THIS IS ACTUAL QUESTION IN MA BOOK",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051830492732866600,
"author_id": 990280503829598300,
"author_name": "Glomz",
"timestamp": "12/12/2022 06:58:51",
"content": "UGH\\",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051830506922180700,
"author_id": 990280503829598300,
"author_name": "Glomz",
"timestamp": "12/12/2022 06:58:54",
"content": ".close",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051830509421985800,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 06:58:55",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
d8cbd1696f504117bb6bf41c46978c85
|
200,035 |
[
{
"id": 1051830761902313500,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 06:59:55",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051832441586860200,
"author_id": 479141318577225700,
"author_name": "L.",
"timestamp": "12/12/2022 07:06:36",
"content": "Hello",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051832444015353900,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 07:06:36",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051832441586860200,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051832533928657000,
"author_id": 479141318577225700,
"author_name": "L.",
"timestamp": "12/12/2022 07:06:58",
"content": "Can anyone Help me",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051832572554002600,
"author_id": 479141318577225700,
"author_name": "L.",
"timestamp": "12/12/2022 07:07:07",
"content": "Give me problem and solution of \nAnnuity Due And Simple Annuity",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051832579600420900,
"author_id": 479141318577225700,
"author_name": "L.",
"timestamp": "12/12/2022 07:07:09",
"content": "Pls",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051832597212319700,
"author_id": 479141318577225700,
"author_name": "L.",
"timestamp": "12/12/2022 07:07:13",
"content": "I need. Example",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051832817908187100,
"author_id": 479141318577225700,
"author_name": "L.",
"timestamp": "12/12/2022 07:08:05",
"content": "https://tenor.com/view/moon-knight-mr-knight-khonshu-steven-grant-spin-gif-25385259",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051835036648865800,
"author_id": 479141318577225700,
"author_name": "L.",
"timestamp": "12/12/2022 07:16:54",
"content": "Ples help",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051836322530213900,
"author_id": 479141318577225700,
"author_name": "L.",
"timestamp": "12/12/2022 07:22:01",
"content": "Ples help me",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051840098985062500,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 07:37:01",
"content": "@L. Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 479141318577225700,
"name": "L.",
"discriminator": "4806",
"nickname": "L.",
"isBot": false
}
],
"reference": null
},
{
"id": 1051847780819275800,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 08:07:33",
"content": "@L. Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 479141318577225700,
"name": "L.",
"discriminator": "4806",
"nickname": "L.",
"isBot": false
}
],
"reference": null
},
{
"id": 1051855332810424400,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 08:37:33",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
e4be535be2b843b1b30b722d7ee9709b
|
200,036 |
[
{
"id": 1051855585324306400,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 08:38:34",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051855713489658000,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 08:39:04",
"content": "hi",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051855716333396000,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 08:39:05",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051855713489658000,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051855820490559600,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 08:39:30",
"content": "how to do **3c**?",
"attachments": [
{
"id": 1051855820188553200,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051855820188553266/Screenshot_2022-12-12_at_6.39.17_PM.png",
"fileName": "Screenshot_2022-12-12_at_6.39.17_PM.png",
"fileSizeBytes": 278550
}
],
"mentions": [],
"reference": null
},
{
"id": 1051857571595690100,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 08:46:27",
"content": "ping me when someone answers btw i'll be doing the rest of the questions till then",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051859297568559200,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 08:53:19",
"content": "also question ***2c***",
"attachments": [
{
"id": 1051859297237205000,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051859297237205042/Screenshot_2022-12-12_at_6.53.03_PM.png",
"fileName": "Screenshot_2022-12-12_at_6.53.03_PM.png",
"fileSizeBytes": 96035
}
],
"mentions": [],
"reference": null
},
{
"id": 1051862431372148700,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 09:05:46",
"content": "p",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051862441107144800,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 09:05:48",
"content": "@Helpers pls help",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051865546355920900,
"author_id": 788085606483361800,
"author_name": "chartbit",
"timestamp": "12/12/2022 09:18:08",
"content": "Do you have a formula for finding S\\_n?",
"attachments": [],
"mentions": [
{
"id": 859072308160888800,
"name": "Hong Kong",
"discriminator": "8732",
"nickname": "Hong Kong",
"isBot": false
}
],
"reference": null
},
{
"id": 1051865587816595600,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 09:18:18",
"content": "yes",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051865600600846500,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 09:18:21",
"content": "well",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051865607726964700,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 09:18:23",
"content": "not Sn specifically",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051865688584749000,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 09:18:42",
"content": "but the formula i used for the previous 2 questions was geometric sequence formula",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051865724123107300,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 09:18:51",
"content": "Sn = A1 x R^(n-1)",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051865883804434400,
"author_id": 788085606483361800,
"author_name": "chartbit",
"timestamp": "12/12/2022 09:19:29",
"content": "That's the general term $u_n$, not the sum $S_n$",
"attachments": [],
"mentions": [
{
"id": 859072308160888800,
"name": "Hong Kong",
"discriminator": "8732",
"nickname": "Hong Kong",
"isBot": false
}
],
"reference": null
},
{
"id": 1051865893493280900,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "12/12/2022 09:19:31",
"content": "**chartbit**",
"attachments": [
{
"id": 1051865893270999000,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051865893270999060/788085606483361802.png",
"fileName": "788085606483361802.png",
"fileSizeBytes": 13424
}
],
"mentions": [],
"reference": null
},
{
"id": 1051865912959062000,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 09:19:36",
"content": "what is $",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051866048363778200,
"author_id": 788085606483361800,
"author_name": "chartbit",
"timestamp": "12/12/2022 09:20:08",
"content": "Ignore any message I send with it in, it's just the way I can make the pic above",
"attachments": [],
"mentions": [
{
"id": 859072308160888800,
"name": "Hong Kong",
"discriminator": "8732",
"nickname": "Hong Kong",
"isBot": false
}
],
"reference": null
},
{
"id": 1051866098888351700,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 09:20:20",
"content": "ok",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051866136272179200,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 09:20:29",
"content": "oh",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051866140336476200,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 09:20:30",
"content": "yea",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051866261249855500,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 09:20:59",
"content": "Sn = A1 (R^n - 1) / r - 1",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051866264114561000,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 09:21:00",
"content": "i know the formulas and all that but idk how to find N cause its in power",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051866342103466000,
"author_id": 788085606483361800,
"author_name": "chartbit",
"timestamp": "12/12/2022 09:21:18",
"content": "You know of logarithms yea?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051866394691649700,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 09:21:31",
"content": "i did them before but i've forgotten them now",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051866403654864900,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 09:21:33",
"content": "so no i guess",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051866475658485800,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 09:21:50",
"content": "you can explain the property we'll use for it and i think i might get it",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051866582743273600,
"author_id": 788085606483361800,
"author_name": "chartbit",
"timestamp": "12/12/2022 09:22:16",
"content": "Basically, tl;dr it's the way of finding the power if you don't know it",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051866609347735700,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 09:22:22",
"content": "oh",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051866616079597600,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 09:22:24",
"content": "wait i think i remember",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051866629362950300,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 09:22:27",
"content": "like",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051866677513560000,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 09:22:38",
"content": "5^n = 125\n\nlog 5^n = log125\n5n = log125",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051866761345114200,
"author_id": 788085606483361800,
"author_name": "chartbit",
"timestamp": "12/12/2022 09:22:58",
"content": "Anyways, substitute $a_1$ and $r$ into that, and try and rearrange",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051866773487632500,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "12/12/2022 09:23:01",
"content": "**chartbit**",
"attachments": [
{
"id": 1051866773563125800,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051866773563125760/788085606483361802.png",
"fileName": "788085606483361802.png",
"fileSizeBytes": 18413
}
],
"mentions": [],
"reference": null
},
{
"id": 1051866891997696100,
"author_id": 788085606483361800,
"author_name": "chartbit",
"timestamp": "12/12/2022 09:23:29",
"content": "n log(5) = log(125) for the last line but basically those",
"attachments": [],
"mentions": [
{
"id": 859072308160888800,
"name": "Hong Kong",
"discriminator": "8732",
"nickname": "Hong Kong",
"isBot": false
}
],
"reference": null
},
{
"id": 1051867019227693000,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 09:24:00",
"content": "oh",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051867032251011100,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 09:24:03",
"content": "i was making that mistake",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051867040308273200,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 09:24:05",
"content": "i would not do log 5",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051867056066277500,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 09:24:08",
"content": "thanks for clearing that up bro",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051867360102981600,
"author_id": 788085606483361800,
"author_name": "chartbit",
"timestamp": "12/12/2022 09:25:21",
"content": "Yea, anyways, from that point, you can write $S_n$ as per this, and then put that on the left hand side of $S_n > 5543$",
"attachments": [],
"mentions": [
{
"id": 859072308160888800,
"name": "Hong Kong",
"discriminator": "8732",
"nickname": "Hong Kong",
"isBot": false
}
],
"reference": null
},
{
"id": 1051867370555191300,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "12/12/2022 09:25:23",
"content": "**chartbit**",
"attachments": [
{
"id": 1051867370618101800,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051867370618101800/788085606483361802.png",
"fileName": "788085606483361802.png",
"fileSizeBytes": 34454
}
],
"mentions": [],
"reference": null
},
{
"id": 1051867601216753700,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 09:26:18",
"content": "yeah",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051867628580384800,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 09:26:25",
"content": "just simplify then logarithm and solve for n",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051867695135588400,
"author_id": 788085606483361800,
"author_name": "chartbit",
"timestamp": "12/12/2022 09:26:41",
"content": "Yea basically that :catthumbsup:",
"attachments": [],
"mentions": [
{
"id": 859072308160888800,
"name": "Hong Kong",
"discriminator": "8732",
"nickname": "Hong Kong",
"isBot": false
}
],
"reference": null
},
{
"id": 1051871404364136400,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 09:41:25",
"content": "@Hong Kong Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 859072308160888800,
"name": "Hong Kong",
"discriminator": "8732",
"nickname": "Hong Kong",
"isBot": false
}
],
"reference": null
},
{
"id": 1051873109663293600,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 09:48:12",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
c3677c1437364befac54716e700e26a2
|
200,037 |
[
{
"id": 1051873362374316000,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 09:49:12",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051873393525395600,
"author_id": 851820155225768000,
"author_name": "xela.",
"timestamp": "12/12/2022 09:49:19",
"content": "guys help me",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051873396427857900,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 09:49:20",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051873393525395600,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051873434432446600,
"author_id": 851820155225768000,
"author_name": "xela.",
"timestamp": "12/12/2022 09:49:29",
"content": "how to do division",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051873549490585600,
"author_id": 856447591834976300,
"author_name": "Ryuzaki",
"timestamp": "12/12/2022 09:49:57",
"content": "a/b",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051873753417650200,
"author_id": 774739847608139800,
"author_name": "Kohlemaennchen",
"timestamp": "12/12/2022 09:50:45",
"content": "Multiply by the multiplicative inverse of b",
"attachments": [],
"mentions": [
{
"id": 851820155225768000,
"name": "xela.",
"discriminator": "8083",
"nickname": "xela.",
"isBot": false
}
],
"reference": null
},
{
"id": 1051874177256263700,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/12/2022 09:52:26",
"content": "Hmm",
"attachments": [],
"mentions": [
{
"id": 851820155225768000,
"name": "xela.",
"discriminator": "8083",
"nickname": "xela.",
"isBot": false
}
],
"reference": null
},
{
"id": 1051874248580415600,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/12/2022 09:52:43",
"content": ":catThink:",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051874314154160100,
"author_id": 856447591834976300,
"author_name": "Ryuzaki",
"timestamp": "12/12/2022 09:52:59",
"content": "amogus",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051874364125102200,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/12/2022 09:53:11",
"content": ":sus:",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051877210618859500,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 10:04:29",
"content": "@xela. Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 851820155225768000,
"name": "xela.",
"discriminator": "8083",
"nickname": "xela.",
"isBot": false
}
],
"reference": null
},
{
"id": 1051880987740610600,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 10:19:30",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
25703d91b0bd479ebe2066479a3e0019
|
200,038 |
[
{
"id": 1051881239126220800,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 10:20:30",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051882068029734900,
"author_id": 1029760471957520400,
"author_name": "frame",
"timestamp": "12/12/2022 10:23:48",
"content": "someone help plz",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051882070638612500,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 10:23:48",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051882068029734900,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051882082252640300,
"author_id": 1029760471957520400,
"author_name": "frame",
"timestamp": "12/12/2022 10:23:51",
"content": "yeah uh lmao i jave no idea how to graph functions",
"attachments": [
{
"id": 1051882082051293300,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051882082051293265/IMG_20221212_205205.jpg",
"fileName": "IMG_20221212_205205.jpg",
"fileSizeBytes": 856016
}
],
"mentions": [],
"reference": null
},
{
"id": 1051882377523249200,
"author_id": 1029760471957520400,
"author_name": "frame",
"timestamp": "12/12/2022 10:25:01",
"content": "the second one",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051882855665504400,
"author_id": 391109417287811100,
"author_name": "Derpy",
"timestamp": "12/12/2022 10:26:55",
"content": "So, to break it down",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051882935239856300,
"author_id": 391109417287811100,
"author_name": "Derpy",
"timestamp": "12/12/2022 10:27:14",
"content": "What are they referring to when they say the function is increasing or the function is positive?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051883122788151400,
"author_id": 1029760471957520400,
"author_name": "frame",
"timestamp": "12/12/2022 10:27:59",
"content": "it's increasing when x is less than -3",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051883158418772000,
"author_id": 1029760471957520400,
"author_name": "frame",
"timestamp": "12/12/2022 10:28:08",
"content": "basically",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051883219294888100,
"author_id": 391109417287811100,
"author_name": "Derpy",
"timestamp": "12/12/2022 10:28:22",
"content": "Yes but what is the “function” referring to",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051883419258343600,
"author_id": 391109417287811100,
"author_name": "Derpy",
"timestamp": "12/12/2022 10:29:10",
"content": "In a sense the whole thing",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051883559331299300,
"author_id": 391109417287811100,
"author_name": "Derpy",
"timestamp": "12/12/2022 10:29:43",
"content": "But it might be easier to think about the y value as well",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051883616738754700,
"author_id": 1029760471957520400,
"author_name": "frame",
"timestamp": "12/12/2022 10:29:57",
"content": "idk bruv i can't make out the function",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051883685550506100,
"author_id": 391109417287811100,
"author_name": "Derpy",
"timestamp": "12/12/2022 10:30:13",
"content": "y is increasing when x is less than -1",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051883889536286700,
"author_id": 1029760471957520400,
"author_name": "frame",
"timestamp": "12/12/2022 10:31:02",
"content": "wait can you help in dms?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051883954770296800,
"author_id": 391109417287811100,
"author_name": "Derpy",
"timestamp": "12/12/2022 10:31:17",
"content": "So a good first step is to look at the greater than and less than symbols",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051883997598339100,
"author_id": 391109417287811100,
"author_name": "Derpy",
"timestamp": "12/12/2022 10:31:28",
"content": "Place open and closed circles where you’re given the information",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051884529675153400,
"author_id": 1029760471957520400,
"author_name": "frame",
"timestamp": "12/12/2022 10:33:34",
"content": "i don't understand..",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051884556535480300,
"author_id": 1029760471957520400,
"author_name": "frame",
"timestamp": "12/12/2022 10:33:41",
"content": "can you give me the solution I'll see if i can",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051884582699532300,
"author_id": 1029760471957520400,
"author_name": "frame",
"timestamp": "12/12/2022 10:33:47",
"content": "i want the function",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051884593004957700,
"author_id": 1029760471957520400,
"author_name": "frame",
"timestamp": "12/12/2022 10:33:50",
"content": "i can graph it out by myself",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051885000481574900,
"author_id": 1029760471957520400,
"author_name": "frame",
"timestamp": "12/12/2022 10:35:27",
"content": "yeah?",
"attachments": [],
"mentions": [
{
"id": 391109417287811100,
"name": "Derpy",
"discriminator": "7936",
"nickname": "Derpy",
"isBot": false
}
],
"reference": null
},
{
"id": 1051885411489820700,
"author_id": 1029760471957520400,
"author_name": "frame",
"timestamp": "12/12/2022 10:37:05",
"content": "hello",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051888157605494800,
"author_id": 1029760471957520400,
"author_name": "frame",
"timestamp": "12/12/2022 10:47:59",
"content": "@Helpers",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051888161573314600,
"author_id": 1029760471957520400,
"author_name": "frame",
"timestamp": "12/12/2022 10:48:00",
"content": "plz",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051890082287730800,
"author_id": 1029760471957520400,
"author_name": "frame",
"timestamp": "12/12/2022 10:55:38",
"content": "HELP",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051890671285448700,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 10:57:59",
"content": "@frame hi",
"attachments": [],
"mentions": [
{
"id": 1029760471957520400,
"name": "frame",
"discriminator": "9176",
"nickname": "frame",
"isBot": false
}
],
"reference": null
},
{
"id": 1051890692819005400,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 10:58:04",
"content": "what do u need help with",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051890762243121300,
"author_id": 1029760471957520400,
"author_name": "frame",
"timestamp": "12/12/2022 10:58:20",
"content": "second one",
"attachments": [
{
"id": 1051890761920155600,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051890761920155708/IMG_20221212_205205.jpg",
"fileName": "IMG_20221212_205205.jpg",
"fileSizeBytes": 856016
}
],
"mentions": [],
"reference": null
},
{
"id": 1051890808174952400,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 10:58:31",
"content": "yes",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051890817612128300,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 10:58:34",
"content": "what about it",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051890824796975200,
"author_id": 1029760471957520400,
"author_name": "frame",
"timestamp": "12/12/2022 10:58:35",
"content": "second",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051890825333837800,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 10:58:35",
"content": "its a statement",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051890845940449400,
"author_id": 1029760471957520400,
"author_name": "frame",
"timestamp": "12/12/2022 10:58:40",
"content": "how do i graph it",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051890892002308100,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 10:58:51",
"content": "do you have a graphic design calculator",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051890933601402900,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 10:59:01",
"content": "fx-9750II/III or any other GDC'",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051890943114084400,
"author_id": 1029760471957520400,
"author_name": "frame",
"timestamp": "12/12/2022 10:59:04",
"content": "no",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051890949950804000,
"author_id": 1029760471957520400,
"author_name": "frame",
"timestamp": "12/12/2022 10:59:05",
"content": "i want to",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051890964026884100,
"author_id": 1029760471957520400,
"author_name": "frame",
"timestamp": "12/12/2022 10:59:09",
"content": "understand the function",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051890985539477500,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 10:59:14",
"content": "ok well",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051890996834746400,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 10:59:16",
"content": "its a quadratic function",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051891041990619100,
"author_id": 1029760471957520400,
"author_name": "frame",
"timestamp": "12/12/2022 10:59:27",
"content": "quadratic?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051891043508961300,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 10:59:27",
"content": "meaning its gonna have a ***u*** or ***n*** shape",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051891045933264900,
"author_id": 1029760471957520400,
"author_name": "frame",
"timestamp": "12/12/2022 10:59:28",
"content": "ok",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051891059065639000,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 10:59:31",
"content": "yea",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051891064182677600,
"author_id": 1029760471957520400,
"author_name": "frame",
"timestamp": "12/12/2022 10:59:32",
"content": "okay okay",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051891071736610800,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 10:59:34",
"content": "cause x^2 + 4x",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051891108038328400,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 10:59:43",
"content": "now x^2 the coefficient is positive",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051891116502417500,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 10:59:45",
"content": "+1(x^2)",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051891131090210800,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 10:59:48",
"content": "so its gonna be opening upwards",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051891159057842200,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 10:59:55",
"content": "meaning its a ***u*** shaped quadratic function",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051891221775265800,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 11:00:10",
"content": "you can find the x intercepts of the function using quadratic formula",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051891375873999000,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 11:00:47",
"content": "and find the vertex by converting it into vertex form or using these equations\nk = (b^2 - 4ac) / 4a \nh = b/2a",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051891428734799900,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 11:00:59",
"content": "you can plot out the points on to your graph and draw it to the best of your ability",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051891525740679400,
"author_id": 1029760471957520400,
"author_name": "frame",
"timestamp": "12/12/2022 11:01:22",
"content": "wait no",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051891541511258100,
"author_id": 1029760471957520400,
"author_name": "frame",
"timestamp": "12/12/2022 11:01:26",
"content": "it says",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051891585014575100,
"author_id": 1029760471957520400,
"author_name": "frame",
"timestamp": "12/12/2022 11:01:37",
"content": "i still don't get it",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051891607265349800,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 11:01:42",
"content": "ok",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051891619751805000,
"author_id": 1029760471957520400,
"author_name": "frame",
"timestamp": "12/12/2022 11:01:45",
"content": "how did you get thdi",
"attachments": [],
"mentions": [
{
"id": 859072308160888800,
"name": "Hong Kong",
"discriminator": "8732",
"nickname": "Hong Kong",
"isBot": false
}
],
"reference": null
},
{
"id": 1051891621534380200,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 11:01:45",
"content": "do you know what quadratic formula is",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051891656657469400,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 11:01:54",
"content": "they gave us",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051891685262635100,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 11:02:00",
"content": "top left",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051891720368947200,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 11:02:09",
"content": "",
"attachments": [
{
"id": 1051891720020836400,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051891720020836392/Screenshot_2022-12-12_at_9.01.57_PM.png",
"fileName": "Screenshot_2022-12-12_at_9.01.57_PM.png",
"fileSizeBytes": 86987
}
],
"mentions": [],
"reference": null
},
{
"id": 1051891751201296400,
"author_id": 1029760471957520400,
"author_name": "frame",
"timestamp": "12/12/2022 11:02:16",
"content": "nono bro not that",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051891773456261100,
"author_id": 1029760471957520400,
"author_name": "frame",
"timestamp": "12/12/2022 11:02:21",
"content": "the second one",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051891810810740900,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 11:02:30",
"content": "they r different question?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051891888732504000,
"author_id": 1029760471957520400,
"author_name": "frame",
"timestamp": "12/12/2022 11:02:49",
"content": "the function is positive when x < -3 negative when -3<x<1 and positive when x>1",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051891894940094500,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 11:02:50",
"content": "https://cdn.discordapp.com/attachments/486844875632017408/1051890761920155708/IMG_20221212_205205.jpg",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051891900023578800,
"author_id": 1029760471957520400,
"author_name": "frame",
"timestamp": "12/12/2022 11:02:52",
"content": "yes",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051891969934237700,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 11:03:08",
"content": "ok",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051892004864409700,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 11:03:17",
"content": "so \ny = ax2 + bx + c",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051892163098706000,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 11:03:54",
"content": "if x < -3 , meaning is x is less than the number of -3",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051892182602236000,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 11:03:59",
"content": "then the y will be positive",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051892201237512300,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 11:04:03",
"content": "so y > 1",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051892258116476900,
"author_id": 1029760471957520400,
"author_name": "frame",
"timestamp": "12/12/2022 11:04:17",
"content": "soo it's like a slope",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051892335270711300,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 11:04:35",
"content": "wait idk if its linear or quadratic function",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051892351548801000,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 11:04:39",
"content": "could be like a sloe",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051892356313534500,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 11:04:40",
"content": "sloe",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051892360184860800,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 11:04:41",
"content": "slope",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051892695922114600,
"author_id": 1029760471957520400,
"author_name": "frame",
"timestamp": "12/12/2022 11:06:01",
"content": "ok soo uhhh",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051892778566688800,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 11:06:21",
"content": "yea idk how to help you with this my guy",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051892784807809000,
"author_id": 859072308160888800,
"author_name": "Hong Kong",
"timestamp": "12/12/2022 11:06:23",
"content": "sorry",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051892914239840400,
"author_id": 1029760471957520400,
"author_name": "frame",
"timestamp": "12/12/2022 11:06:53",
"content": "aaaah alrigjtnirz find",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051892923702194300,
"author_id": 1029760471957520400,
"author_name": "frame",
"timestamp": "12/12/2022 11:06:56",
"content": "it's fine*",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051896490378940400,
"author_id": 1029760471957520400,
"author_name": "frame",
"timestamp": "12/12/2022 11:21:06",
"content": "anyone else lol @Helpers",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051900266254962800,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 11:36:06",
"content": "@frame Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 1029760471957520400,
"name": "frame",
"discriminator": "9176",
"nickname": "frame",
"isBot": false
}
],
"reference": null
},
{
"id": 1051904043368337500,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 11:51:07",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
eb4807cdc6ca4d5199118afd4f602634
|
200,039 |
[
{
"id": 1051904295932543000,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 11:52:07",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051905386497712100,
"author_id": 849961886874730500,
"author_name": "SA2017",
"timestamp": "12/12/2022 11:56:27",
"content": "",
"attachments": [
{
"id": 1051905386199928800,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051905386199928842/image.png",
"fileName": "image.png",
"fileSizeBytes": 142477
}
],
"mentions": [],
"reference": null
},
{
"id": 1051905389702172700,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 11:56:28",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051905386497712100,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051905426226159700,
"author_id": 849961886874730500,
"author_name": "SA2017",
"timestamp": "12/12/2022 11:56:37",
"content": "why does it start at (pi, -1)",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051906247839973400,
"author_id": 764959481070616600,
"author_name": "Toby",
"timestamp": "12/12/2022 11:59:52",
"content": "thats the definition of the heaviside function",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051906322129485800,
"author_id": 764959481070616600,
"author_name": "Toby",
"timestamp": "12/12/2022 12:00:10",
"content": "if H is 0 if x-pi≤0",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051906775919636600,
"author_id": 849961886874730500,
"author_name": "SA2017",
"timestamp": "12/12/2022 12:01:58",
"content": "wdym",
"attachments": [],
"mentions": [
{
"id": 764959481070616600,
"name": "Toby",
"discriminator": "2275",
"nickname": "Toby",
"isBot": false
}
],
"reference": null
},
{
"id": 1051906790029283500,
"author_id": 849961886874730500,
"author_name": "SA2017",
"timestamp": "12/12/2022 12:02:02",
"content": "what is",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051906934535622800,
"author_id": 764959481070616600,
"author_name": "Toby",
"timestamp": "12/12/2022 12:02:36",
"content": "https://en.wikipedia.org/wiki/Heaviside_step_function",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051907025782706200,
"author_id": 849961886874730500,
"author_name": "SA2017",
"timestamp": "12/12/2022 12:02:58",
"content": "ye ik",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051907035320561700,
"author_id": 849961886874730500,
"author_name": "SA2017",
"timestamp": "12/12/2022 12:03:00",
"content": "what it is",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051907086407176300,
"author_id": 849961886874730500,
"author_name": "SA2017",
"timestamp": "12/12/2022 12:03:12",
"content": "",
"attachments": [
{
"id": 1051907086113571000,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051907086113570948/image.png",
"fileName": "image.png",
"fileSizeBytes": 3682
}
],
"mentions": [
{
"id": 764959481070616600,
"name": "Toby",
"discriminator": "2275",
"nickname": "Toby",
"isBot": false
}
],
"reference": null
},
{
"id": 1051907141818130600,
"author_id": 849961886874730500,
"author_name": "SA2017",
"timestamp": "12/12/2022 12:03:26",
"content": "but im just confused by this ( pi -1 )part",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051907313713283200,
"author_id": 764959481070616600,
"author_name": "Toby",
"timestamp": "12/12/2022 12:04:07",
"content": "everywhere you see x here, replace it with x-pi",
"attachments": [],
"mentions": [
{
"id": 849961886874730500,
"name": "SA2017",
"discriminator": "0103",
"nickname": "SA2017",
"isBot": false
}
],
"reference": null
},
{
"id": 1051907347024445400,
"author_id": 764959481070616600,
"author_name": "Toby",
"timestamp": "12/12/2022 12:04:15",
"content": "then thats the definition of H(x-pi)",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051907499671945300,
"author_id": 849961886874730500,
"author_name": "SA2017",
"timestamp": "12/12/2022 12:04:51",
"content": "so for 1 : x => pi?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051907547055009900,
"author_id": 849961886874730500,
"author_name": "SA2017",
"timestamp": "12/12/2022 12:05:02",
"content": "0: x < pi",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051907549902946300,
"author_id": 849961886874730500,
"author_name": "SA2017",
"timestamp": "12/12/2022 12:05:03",
"content": "?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051907585084768300,
"author_id": 764959481070616600,
"author_name": "Toby",
"timestamp": "12/12/2022 12:05:11",
"content": "yes",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051907696187691100,
"author_id": 849961886874730500,
"author_name": "SA2017",
"timestamp": "12/12/2022 12:05:38",
"content": "yh so im still confused on where this -1 has come from",
"attachments": [],
"mentions": [
{
"id": 764959481070616600,
"name": "Toby",
"discriminator": "2275",
"nickname": "Toby",
"isBot": false
}
],
"reference": null
},
{
"id": 1051907791201255600,
"author_id": 849961886874730500,
"author_name": "SA2017",
"timestamp": "12/12/2022 12:06:00",
"content": "",
"attachments": [
{
"id": 1051907791037669400,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051907791037669377/image.png",
"fileName": "image.png",
"fileSizeBytes": 8261
}
],
"mentions": [],
"reference": null
},
{
"id": 1051907950433804400,
"author_id": 764959481070616600,
"author_name": "Toby",
"timestamp": "12/12/2022 12:06:38",
"content": "f(pi)=-1",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051907972265160700,
"author_id": 764959481070616600,
"author_name": "Toby",
"timestamp": "12/12/2022 12:06:44",
"content": "because cos(pi)=-1",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051908188682858600,
"author_id": 849961886874730500,
"author_name": "SA2017",
"timestamp": "12/12/2022 12:07:35",
"content": "wat does it acc mean to say 'starts at'",
"attachments": [
{
"id": 1051908188435382300,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051908188435382292/image.png",
"fileName": "image.png",
"fileSizeBytes": 13985
}
],
"mentions": [
{
"id": 764959481070616600,
"name": "Toby",
"discriminator": "2275",
"nickname": "Toby",
"isBot": false
}
],
"reference": null
},
{
"id": 1051908191623069800,
"author_id": 849961886874730500,
"author_name": "SA2017",
"timestamp": "12/12/2022 12:07:36",
"content": "like",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051908205086777500,
"author_id": 849961886874730500,
"author_name": "SA2017",
"timestamp": "12/12/2022 12:07:39",
"content": "starts at what?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051908253040255100,
"author_id": 764959481070616600,
"author_name": "Toby",
"timestamp": "12/12/2022 12:07:51",
"content": "x=pi, f(x)=-1",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051908280957554700,
"author_id": 849961886874730500,
"author_name": "SA2017",
"timestamp": "12/12/2022 12:07:57",
"content": "i dont get what they mean to start at in the context of (pi, -1)",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051908306513436800,
"author_id": 849961886874730500,
"author_name": "SA2017",
"timestamp": "12/12/2022 12:08:03",
"content": "oh i see",
"attachments": [],
"mentions": [
{
"id": 764959481070616600,
"name": "Toby",
"discriminator": "2275",
"nickname": "Toby",
"isBot": false
}
],
"reference": null
},
{
"id": 1051909769897709600,
"author_id": 849961886874730500,
"author_name": "SA2017",
"timestamp": "12/12/2022 12:13:52",
"content": "ye perfect that makes sense",
"attachments": [],
"mentions": [
{
"id": 764959481070616600,
"name": "Toby",
"discriminator": "2275",
"nickname": "Toby",
"isBot": false
}
],
"reference": null
},
{
"id": 1051909774347878400,
"author_id": 849961886874730500,
"author_name": "SA2017",
"timestamp": "12/12/2022 12:13:53",
"content": "cheers",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051909794321137800,
"author_id": 764959481070616600,
"author_name": "Toby",
"timestamp": "12/12/2022 12:13:58",
"content": "np :)",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051909815737258000,
"author_id": 849961886874730500,
"author_name": "SA2017",
"timestamp": "12/12/2022 12:14:03",
"content": ".close",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051909818480328700,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 12:14:04",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
d1dd2a4e38584559937633d5b334a1a8
|
200,040 |
[
{
"id": 1051910071065530500,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 12:15:04",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051910451316928600,
"author_id": 761047709624303600,
"author_name": "suzy",
"timestamp": "12/12/2022 12:16:35",
"content": "how to get the exact value of sec(sin^−1 (3/5) - cos^-1 (5/13))",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051910453657337900,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 12:16:35",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051910451316928600,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051911259727073300,
"author_id": 752689126448300000,
"author_name": "vetbaitednv",
"timestamp": "12/12/2022 12:19:47",
"content": "i'm pretty sure that's its exact value",
"attachments": [],
"mentions": [
{
"id": 761047709624303600,
"name": "suzy",
"discriminator": "1919",
"nickname": "suzy",
"isBot": false
}
],
"reference": null
},
{
"id": 1051911345169244200,
"author_id": 752689126448300000,
"author_name": "vetbaitednv",
"timestamp": "12/12/2022 12:20:08",
"content": "i can't imagine that not being transcendental",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051911452505686000,
"author_id": 752689126448300000,
"author_name": "vetbaitednv",
"timestamp": "12/12/2022 12:20:33",
"content": "nevermind then",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051911554444038300,
"author_id": 752689126448300000,
"author_name": "vetbaitednv",
"timestamp": "12/12/2022 12:20:58",
"content": "welp that's out of my area of just about anything",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051911719838023700,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "12/12/2022 12:21:37",
"content": "You can work it out with trig sum rules",
"attachments": [],
"mentions": [
{
"id": 761047709624303600,
"name": "suzy",
"discriminator": "1919",
"nickname": "suzy",
"isBot": false
}
],
"reference": null
},
{
"id": 1051911743787499600,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "12/12/2022 12:21:43",
"content": "But it is going to be so tedious",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051911993692520400,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "12/12/2022 12:22:42",
"content": "Wait hm nvm",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051912037992759400,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "12/12/2022 12:22:53",
"content": "That's still impossible:clopencry:",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051912129629925500,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "12/12/2022 12:23:15",
"content": "You need to approximate a lot in that without a calculator I think",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051912246571319400,
"author_id": 761047709624303600,
"author_name": "suzy",
"timestamp": "12/12/2022 12:23:43",
"content": "we can't use a calcu T_T",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051912438242611300,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "12/12/2022 12:24:28",
"content": "Oh I'm actually tripping you can find it",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051912768275611800,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "12/12/2022 12:25:47",
"content": "Yea u just have to use like a lot of trig rules with addition formulas",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051913089525760100,
"author_id": 761047709624303600,
"author_name": "suzy",
"timestamp": "12/12/2022 12:27:04",
"content": "how do i do that",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051913483559649300,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "12/12/2022 12:28:38",
"content": "Like",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051913764531867600,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "12/12/2022 12:29:45",
"content": "\\[\n\\sec(x-y) =\\frac{1}{\\cos(x)\\cos(y)+\\sin(x)\\sin(y)}\n\\]",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051913774178762900,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "12/12/2022 12:29:47",
"content": "**♡LexQa♡**",
"attachments": [
{
"id": 1051913774250086500,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051913774250086510/1022141568737607750.png",
"fileName": "1022141568737607750.png",
"fileSizeBytes": 16030
}
],
"mentions": [],
"reference": null
},
{
"id": 1051914399385915500,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "12/12/2022 12:32:16",
"content": "@suzy",
"attachments": [],
"mentions": [
{
"id": 761047709624303600,
"name": "suzy",
"discriminator": "1919",
"nickname": "suzy",
"isBot": false
}
],
"reference": null
},
{
"id": 1051914419191435300,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "12/12/2022 12:32:21",
"content": "I will guide you through it",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051914886260740100,
"author_id": 761047709624303600,
"author_name": "suzy",
"timestamp": "12/12/2022 12:34:12",
"content": "ok",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051915643286474900,
"author_id": 761047709624303600,
"author_name": "suzy",
"timestamp": "12/12/2022 12:37:13",
"content": "i’m confused",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051919419414159500,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 12:52:13",
"content": "@suzy Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 761047709624303600,
"name": "suzy",
"discriminator": "1919",
"nickname": "suzy",
"isBot": false
}
],
"reference": null
},
{
"id": 1051923195957088300,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 13:07:13",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
0a9e733453134d4583bb4d0eb6fcd671
|
200,041 |
[
{
"id": 1051923447837638700,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 13:08:13",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051923993340432500,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 13:10:23",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051923988793807000,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051924344638537700,
"author_id": 826856329712500900,
"author_name": "Sparkle",
"timestamp": "12/12/2022 13:11:47",
"content": "local maximum yes, local minimum depends on what values of x you're considering",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051924444513308800,
"author_id": 826856329712500900,
"author_name": "Sparkle",
"timestamp": "12/12/2022 13:12:11",
"content": "I mean if x belongs to the interval [0,b]",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051924497839693800,
"author_id": 826856329712500900,
"author_name": "Sparkle",
"timestamp": "12/12/2022 13:12:24",
"content": "then local minimum is 0",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051924655289680000,
"author_id": 826856329712500900,
"author_name": "Sparkle",
"timestamp": "12/12/2022 13:13:01",
"content": "in that case yeah I guess so",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051925090385797100,
"author_id": 1014671992898715600,
"author_name": "Amer",
"timestamp": "12/12/2022 13:14:45",
"content": "You meant horizontal lines",
"attachments": [],
"mentions": [
{
"id": 332561465405866000,
"name": "Kepe",
"discriminator": "5235",
"nickname": "Kepe",
"isBot": false
}
],
"reference": null
},
{
"id": 1051925416232894500,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 13:16:03",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
da74610bf05a4e0780dd53b68e8a6e90
|
200,042 |
[
{
"id": 1051930566758506600,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 13:36:31",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051931316356128900,
"author_id": 1039407681267577000,
"author_name": "nobody2",
"timestamp": "12/12/2022 13:39:29",
"content": "sin(𝜃)(2 sin(𝜃) + 1) = 0\nHow do i solve this?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051931318088376300,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 13:39:30",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051931316356128900,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051932670722052100,
"author_id": 1037421531988508800,
"author_name": "レースガール",
"timestamp": "12/12/2022 13:44:52",
"content": "sin 0 is 0",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051932683921543300,
"author_id": 1037421531988508800,
"author_name": "レースガール",
"timestamp": "12/12/2022 13:44:55",
"content": "so 0 is a solution",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051932778540843000,
"author_id": 1037421531988508800,
"author_name": "レースガール",
"timestamp": "12/12/2022 13:45:18",
"content": "u wanna solve for sin(𝜃)=-1/2",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051932876687552500,
"author_id": 1037421531988508800,
"author_name": "レースガール",
"timestamp": "12/12/2022 13:45:41",
"content": "which is 7pi/6",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051932902268608600,
"author_id": 1037421531988508800,
"author_name": "レースガール",
"timestamp": "12/12/2022 13:45:47",
"content": ",w sin(7pi/6)",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051932919985360900,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "12/12/2022 13:45:52",
"content": "Results provided by WolframAlpha",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051933246067327100,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 13:47:09",
"content": ",w sin(x)(2 sin(x) + 1) = 0",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051933643066589300,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 13:48:44",
"content": "Well you will get 0 answer at last",
"attachments": [],
"mentions": [
{
"id": 1039407681267577000,
"name": "nobody2",
"discriminator": "8937",
"nickname": "nobody2",
"isBot": false
}
],
"reference": null
},
{
"id": 1051933679334740200,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 13:48:53",
"content": "If this is a positive integer problem",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051933753485820000,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 13:49:10",
"content": "Cause the value of sin 0° = 0",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051933903293784000,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 13:49:46",
"content": "This answer is also correct",
"attachments": [],
"mentions": [
{
"id": 510789298321096700,
"name": "TeXit",
"discriminator": "0796",
"nickname": "TeXit",
"isBot": true
}
],
"reference": null
},
{
"id": 1051934830889287700,
"author_id": 1039407681267577000,
"author_name": "nobody2",
"timestamp": "12/12/2022 13:53:27",
"content": "ooh ok, so the answer should be -1/2, and 0?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051935089296150500,
"author_id": 1039407681267577000,
"author_name": "nobody2",
"timestamp": "12/12/2022 13:54:29",
"content": "because of the 0 and sin^-1(-1/2)",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051935277570064500,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 13:55:14",
"content": "Theta = 330°\nTheta = 210°\nTheta = 0°\nIn the range of 0≥theta≥2π",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051935328107237500,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 13:55:26",
"content": "There are more answers",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051935360629887100,
"author_id": 1039407681267577000,
"author_name": "nobody2",
"timestamp": "12/12/2022 13:55:33",
"content": "oh",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051935410596622300,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 13:55:45",
"content": "Theta is = 180°",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051935438874607600,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 13:55:52",
"content": "But what was your question?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051935467379097700,
"author_id": 1039407681267577000,
"author_name": "nobody2",
"timestamp": "12/12/2022 13:55:59",
"content": "how did you get this?",
"attachments": [],
"mentions": [
{
"id": 518716603928543200,
"name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"discriminator": "6985",
"nickname": "Arnab",
"isBot": false
}
],
"reference": null
},
{
"id": 1051935509770932400,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 13:56:09",
"content": "You question ask to find the value of theta or sin?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051935561595752600,
"author_id": 1039407681267577000,
"author_name": "nobody2",
"timestamp": "12/12/2022 13:56:21",
"content": "sin(𝜃)(2 sin(𝜃) + 1) = 0 I was asked to solve the equation",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051935635734286300,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 13:56:39",
"content": "Well you have to think that how the equation could be =0",
"attachments": [],
"mentions": [
{
"id": 1039407681267577000,
"name": "nobody2",
"discriminator": "8937",
"nickname": "nobody2",
"isBot": false
}
],
"reference": null
},
{
"id": 1051935708559982700,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 13:56:56",
"content": "You have to take sin theta as x",
"attachments": [],
"mentions": [
{
"id": 1039407681267577000,
"name": "nobody2",
"discriminator": "8937",
"nickname": "nobody2",
"isBot": false
}
],
"reference": null
},
{
"id": 1051935720819920900,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 13:56:59",
"content": "Like",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051935762586796200,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 13:57:09",
"content": "(x)(2x+1)=0",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051935775664648300,
"author_id": 1039407681267577000,
"author_name": "nobody2",
"timestamp": "12/12/2022 13:57:12",
"content": "ooh ok",
"attachments": [],
"mentions": [
{
"id": 518716603928543200,
"name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"discriminator": "6985",
"nickname": "Arnab",
"isBot": false
}
],
"reference": null
},
{
"id": 1051935809424597100,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 13:57:20",
"content": "Ans find the solutions for x",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051935820916994200,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 13:57:23",
"content": "And*",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051935884024479700,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 13:57:38",
"content": "Like here x=0 or x=-1/2",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051935934750400500,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 13:57:50",
"content": "Then you could get that",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051935999573364900,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 13:58:06",
"content": "Sin theta = 0\nAnd sin theta = -1/2",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051936071228858400,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 13:58:23",
"content": "If your question says that you have to find the value of theta",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051936123972231300,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 13:58:35",
"content": "Then you will use inverse sine function",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051936134038564900,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 13:58:38",
"content": "To find it",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051936161796456400,
"author_id": 1039407681267577000,
"author_name": "nobody2",
"timestamp": "12/12/2022 13:58:45",
"content": "so sin^(-1) should be an answer?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051936181572608100,
"author_id": 1039407681267577000,
"author_name": "nobody2",
"timestamp": "12/12/2022 13:58:49",
"content": "ooh ok",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051936231962976300,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 13:59:01",
"content": "How that could be an answer",
"attachments": [],
"mentions": [
{
"id": 1039407681267577000,
"name": "nobody2",
"discriminator": "8937",
"nickname": "nobody2",
"isBot": false
}
],
"reference": null
},
{
"id": 1051936592287256700,
"author_id": 1039407681267577000,
"author_name": "nobody2",
"timestamp": "12/12/2022 14:00:27",
"content": "because sin theta = 0 and theta is x i think so sin^-1(0) should be the answer right?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051936797057355800,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 14:01:16",
"content": "Yes sin^-1(0) is right but you have written sin^-1 that didn't made any sense that's why I have said that",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051936858151592100,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 14:01:31",
"content": "And sin^-1(-1/2)",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051937051152486500,
"author_id": 1039407681267577000,
"author_name": "nobody2",
"timestamp": "12/12/2022 14:02:17",
"content": "ooh ok, thanks",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051937369097511000,
"author_id": 1039407681267577000,
"author_name": "nobody2",
"timestamp": "12/12/2022 14:03:32",
"content": "so i put these in the calculator and got 0 and -30, that should be the answer right?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051937541491806300,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 14:04:13",
"content": "Not negative 30 Actually it's 360-30 if you want a positive integer",
"attachments": [],
"mentions": [
{
"id": 1039407681267577000,
"name": "nobody2",
"discriminator": "8937",
"nickname": "nobody2",
"isBot": false
}
],
"reference": null
},
{
"id": 1051937581606129800,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 14:04:23",
"content": "You could write negative 30 also",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051937599272534000,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 14:04:27",
"content": "Depends on the question",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051937718852145300,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 14:04:56",
"content": ",w plot x^2 + {y -3/4(x^2)^(1/3)}^2 = 1",
"attachments": [],
"mentions": [
{
"id": 1039407681267577000,
"name": "nobody2",
"discriminator": "8937",
"nickname": "nobody2",
"isBot": false
}
],
"reference": null
},
{
"id": 1051937730407444500,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "12/12/2022 14:04:58",
"content": "Results provided by WolframAlpha",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051937850481967100,
"author_id": 1039407681267577000,
"author_name": "nobody2",
"timestamp": "12/12/2022 14:05:27",
"content": "ooh, do in problems like this,do i use 360 to minus the negative number?",
"attachments": [],
"mentions": [
{
"id": 518716603928543200,
"name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"discriminator": "6985",
"nickname": "Arnab",
"isBot": false
}
],
"reference": null
},
{
"id": 1051937974801141800,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 14:05:57",
"content": "Yes you could do that",
"attachments": [],
"mentions": [
{
"id": 1039407681267577000,
"name": "nobody2",
"discriminator": "8937",
"nickname": "nobody2",
"isBot": false
}
],
"reference": null
},
{
"id": 1051938012910596100,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 14:06:06",
"content": "And 210 is aslo an answer",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051938065603633300,
"author_id": 1039407681267577000,
"author_name": "nobody2",
"timestamp": "12/12/2022 14:06:18",
"content": "oh, how did you get 210",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051938167390994400,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 14:06:43",
"content": "180 is an answer 360 is also an answer",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051938227054981200,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 14:06:57",
"content": "Sine is negative in the third quadrant",
"attachments": [],
"mentions": [
{
"id": 1039407681267577000,
"name": "nobody2",
"discriminator": "8937",
"nickname": "nobody2",
"isBot": false
}
],
"reference": null
},
{
"id": 1051938291949240300,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 14:07:12",
"content": ",w sin(210)",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051938301587767300,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "12/12/2022 14:07:15",
"content": "Results provided by WolframAlpha",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051938304456655000,
"author_id": 1039407681267577000,
"author_name": "nobody2",
"timestamp": "12/12/2022 14:07:15",
"content": "ooh ok",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051938327479206000,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 14:07:21",
"content": "Yes",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051938472220446700,
"author_id": 1039407681267577000,
"author_name": "nobody2",
"timestamp": "12/12/2022 14:07:55",
"content": "how is 180 and 360 an answer?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051938892493881300,
"author_id": 1039407681267577000,
"author_name": "nobody2",
"timestamp": "12/12/2022 14:09:36",
"content": "I tried to put 0, 330, 180 and 360 as answer but its wrong. Is there anything I did wrong?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051939047863496700,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 14:10:13",
"content": "Let me see your question",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051939362046214300,
"author_id": 1039407681267577000,
"author_name": "nobody2",
"timestamp": "12/12/2022 14:11:28",
"content": "Solve the given equation. (Enter your answers as a comma-separated list. Let k be any integer. Round terms to three decimal places where appropriate. If there is no solution, enter NO SOLUTION.)\nsin(𝜃)(2 sin(𝜃) + 1) = 0",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051939598172963000,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 14:12:24",
"content": "Now try -0.5,0",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051939797180092400,
"author_id": 1039407681267577000,
"author_name": "nobody2",
"timestamp": "12/12/2022 14:13:11",
"content": "Its still wrong",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051940102378631300,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 14:14:24",
"content": "0,-30",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051940129813561300,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 14:14:31",
"content": "Bruh",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051940163686760600,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 14:14:39",
"content": "No ranges are given",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051940167549722600,
"author_id": 1039407681267577000,
"author_name": "nobody2",
"timestamp": "12/12/2022 14:14:40",
"content": "Tried this before and it is wrong",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051940180493348900,
"author_id": 1039407681267577000,
"author_name": "nobody2",
"timestamp": "12/12/2022 14:14:43",
"content": "yeah",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051940284549832700,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 14:15:07",
"content": "0,180,210,330,360",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051940306829979800,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 14:15:13",
"content": "☠️☠️☠️",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051940530793234600,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 14:16:06",
"content": "This question does not even ask that we have to find a value for theta or not",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051940624884052000,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 14:16:29",
"content": "And at last try 0",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051940629694906400,
"author_id": 1039407681267577000,
"author_name": "nobody2",
"timestamp": "12/12/2022 14:16:30",
"content": "nope",
"attachments": [],
"mentions": [
{
"id": 518716603928543200,
"name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"discriminator": "6985",
"nickname": "Arnab",
"isBot": false
}
],
"reference": null
},
{
"id": 1051940644723101700,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 14:16:33",
"content": "Only 0",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051940728806326400,
"author_id": 1039407681267577000,
"author_name": "nobody2",
"timestamp": "12/12/2022 14:16:53",
"content": "if it is find the value of theta how do i solve it",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051940803729166500,
"author_id": 1039407681267577000,
"author_name": "nobody2",
"timestamp": "12/12/2022 14:17:11",
"content": "dont think have tried that",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051940833408073700,
"author_id": 1039407681267577000,
"author_name": "nobody2",
"timestamp": "12/12/2022 14:17:18",
"content": "dont think I have tried that*",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051940902509219800,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 14:17:35",
"content": "Sin theta = -1/2\nSin theta = 0 solve for theta",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051940932917936100,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 14:17:42",
"content": "Try that once",
"attachments": [],
"mentions": [
{
"id": 1039407681267577000,
"name": "nobody2",
"discriminator": "8937",
"nickname": "nobody2",
"isBot": false
}
],
"reference": null
},
{
"id": 1051941022013329500,
"author_id": 1039407681267577000,
"author_name": "nobody2",
"timestamp": "12/12/2022 14:18:03",
"content": "so -1/2 and 0?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051941086685302800,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 14:18:19",
"content": ",w (sin (x))(2sin(x)+1)=0",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051941096999104500,
"author_id": 1039407681267577000,
"author_name": "nobody2",
"timestamp": "12/12/2022 14:18:21",
"content": "theta = -1/2 and 0",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051941106230763500,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "12/12/2022 14:18:23",
"content": "Results provided by WolframAlpha",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051941116632641700,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 14:18:26",
"content": "Yes",
"attachments": [],
"mentions": [
{
"id": 1039407681267577000,
"name": "nobody2",
"discriminator": "8937",
"nickname": "nobody2",
"isBot": false
}
],
"reference": null
},
{
"id": 1051941168033824800,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 14:18:38",
"content": "Just put 0 you know@nobody2",
"attachments": [],
"mentions": [
{
"id": 1039407681267577000,
"name": "nobody2",
"discriminator": "8937",
"nickname": "nobody2",
"isBot": false
}
],
"reference": null
},
{
"id": 1051941216515792900,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 14:18:50",
"content": "It is a positive integer solution",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051941253610209400,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 14:18:58",
"content": "-30 is also ok",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051941256558817400,
"author_id": 1039407681267577000,
"author_name": "nobody2",
"timestamp": "12/12/2022 14:18:59",
"content": "oh tried this before",
"attachments": [],
"mentions": [
{
"id": 518716603928543200,
"name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"discriminator": "6985",
"nickname": "Arnab",
"isBot": false
}
],
"reference": null
},
{
"id": 1051941350603489300,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 14:19:22",
"content": "Put only 0 in your computer",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051941396229148800,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 14:19:32",
"content": "I think it will be right",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051941577364357100,
"author_id": 1039407681267577000,
"author_name": "nobody2",
"timestamp": "12/12/2022 14:20:16",
"content": "I looked at an example answer and its theta = 11pi/6 + 2kpi. I dont know how it got to that",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051941759468437500,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 14:20:59",
"content": "I can't help you in that bro",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051941800711036900,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 14:21:09",
"content": "This is a lot easier question",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051941936757489700,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 14:21:41",
"content": "But how 11π/6+2kπ",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051941969892483200,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 14:21:49",
"content": "First of all why we need k",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051942126952382500,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 14:22:27",
"content": "As a constant",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051942171370066000,
"author_id": 1039407681267577000,
"author_name": "nobody2",
"timestamp": "12/12/2022 14:22:37",
"content": "idk",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051942242589360300,
"author_id": 1039407681267577000,
"author_name": "nobody2",
"timestamp": "12/12/2022 14:22:54",
"content": "oh",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051942378526736500,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 14:23:27",
"content": "Hm",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051942459141267600,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 14:23:46",
"content": "See the integer solution",
"attachments": [],
"mentions": [
{
"id": 510789298321096700,
"name": "TeXit",
"discriminator": "0796",
"nickname": "TeXit",
"isBot": true
}
],
"reference": null
},
{
"id": 1051942501545685000,
"author_id": 1039407681267577000,
"author_name": "nobody2",
"timestamp": "12/12/2022 14:23:56",
"content": "the question is cos(theta)(2 sin(theta)+1)",
"attachments": [],
"mentions": [
{
"id": 518716603928543200,
"name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"discriminator": "6985",
"nickname": "Arnab",
"isBot": false
}
],
"reference": null
},
{
"id": 1051942639437615100,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 14:24:29",
"content": ".",
"attachments": [],
"mentions": [
{
"id": 1039407681267577000,
"name": "nobody2",
"discriminator": "8937",
"nickname": "nobody2",
"isBot": false
}
],
"reference": null
},
{
"id": 1051942763157004400,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 14:24:58",
"content": ",w (cos(x))(2sin(x)+1)=0",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051942786301165600,
"author_id": 1039407681267577000,
"author_name": "nobody2",
"timestamp": "12/12/2022 14:25:04",
"content": "yeah, but some symbols are the symbols i have never learned before\n so couldent be that right?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051942976827424800,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "12/12/2022 14:25:49",
"content": "",
"attachments": [
{
"id": 1051942976940687500,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051942976940687502/wolf.png",
"fileName": "wolf.png",
"fileSizeBytes": 9651
}
],
"mentions": [],
"reference": null
},
{
"id": 1051942977968279600,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "12/12/2022 14:25:50",
"content": "",
"attachments": [
{
"id": 1051942978039586800,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051942978039586816/wolf.png",
"fileName": "wolf.png",
"fileSizeBytes": 16393
}
],
"mentions": [],
"reference": null
},
{
"id": 1051942979130110100,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "12/12/2022 14:25:50",
"content": "",
"attachments": [
{
"id": 1051942979297886300,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051942979297886278/wolf.png",
"fileName": "wolf.png",
"fileSizeBytes": 9299
}
],
"mentions": [],
"reference": null
},
{
"id": 1051943116342567000,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 14:26:23",
"content": "No these are not very hard",
"attachments": [],
"mentions": [
{
"id": 1039407681267577000,
"name": "nobody2",
"discriminator": "8937",
"nickname": "nobody2",
"isBot": false
}
],
"reference": null
},
{
"id": 1051943359041765500,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 14:27:20",
"content": "€ this means belongs to the z like symbol is the symbol for integer",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051943665695735800,
"author_id": 1039407681267577000,
"author_name": "nobody2",
"timestamp": "12/12/2022 14:28:34",
"content": "ooh ok",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051944558256206000,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 14:32:06",
"content": "But yes",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051944694361374800,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 14:32:39",
"content": "The answer is 11π/6+2kπ",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051944770462830600,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 14:32:57",
"content": "If it is cosx(2sin(x)+1)=0",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051944807662112800,
"author_id": 518716603928543200,
"author_name": "𝓐𝓡𝓝𝓐𝓑 𝓟𝓐𝓛",
"timestamp": "12/12/2022 14:33:06",
"content": "Ok I have to sleep it's 1pm here bye",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051947442188337200,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 14:43:34",
"content": "@nobody2 Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 1039407681267577000,
"name": "nobody2",
"discriminator": "8937",
"nickname": "nobody2",
"isBot": false
}
],
"reference": null
},
{
"id": 1051951218324414600,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 14:58:34",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
e898a28835a74f89928a84d580326938
|
200,043 |
[
{
"id": 1034485442948640800,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "10/25/2022 11:15:49",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034486137902862300,
"author_id": 923268887909384200,
"author_name": "lacertae",
"timestamp": "10/25/2022 11:18:35",
"content": "need help working this out",
"attachments": [
{
"id": 1034486137525387300,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1034486137525387325/unknown.png",
"fileName": "unknown.png",
"fileSizeBytes": 11732
}
],
"mentions": [],
"reference": null
},
{
"id": 1034486140406878200,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "10/25/2022 11:18:35",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1034486137902862300,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1034486179011248100,
"author_id": 923268887909384200,
"author_name": "lacertae",
"timestamp": "10/25/2022 11:18:44",
"content": "I have to prove that the left side = right side",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034486854289985500,
"author_id": 307914411648090100,
"author_name": "Stephen",
"timestamp": "10/25/2022 11:21:25",
"content": "Is that g supposed to be there",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034487001694617600,
"author_id": 923268887909384200,
"author_name": "lacertae",
"timestamp": "10/25/2022 11:22:01",
"content": "it's cotg alpha",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034490566458757200,
"author_id": 607479321350635500,
"author_name": "Pure",
"timestamp": "10/25/2022 11:36:10",
"content": "Hints: use a^3 + b^3, difference of two squares, simplify 1-cotx and trust that it’ll all work out",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034490697685946500,
"author_id": 923268887909384200,
"author_name": "lacertae",
"timestamp": "10/25/2022 11:36:42",
"content": "I knew it. I just wanted someone to hint me this, because it's a lot of work, and I didn't want to do trial and errors",
"attachments": [],
"mentions": [
{
"id": 607479321350635500,
"name": "Pure",
"discriminator": "9389",
"nickname": "$Pure$",
"isBot": false
}
],
"reference": null
},
{
"id": 1034490701381111800,
"author_id": 923268887909384200,
"author_name": "lacertae",
"timestamp": "10/25/2022 11:36:43",
"content": "thank you",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034490731840164000,
"author_id": 607479321350635500,
"author_name": "Pure",
"timestamp": "10/25/2022 11:36:50",
"content": ":catthumbsup:",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034490745534566500,
"author_id": 923268887909384200,
"author_name": "lacertae",
"timestamp": "10/25/2022 11:36:53",
"content": ".close",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034490748432830600,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "10/25/2022 11:36:54",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
f61f1282266f416aa8110382f7b13b69
|
200,044 |
[
{
"id": 1051951470628569100,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 14:59:34",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051951810274926600,
"author_id": 1046876681094303700,
"author_name": "Chippotle Maths",
"timestamp": "12/12/2022 15:00:55",
"content": "Could someone explain why the upper boundary for x in is y?",
"attachments": [
{
"id": 1051951809977135200,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051951809977135184/image.png",
"fileName": "image.png",
"fileSizeBytes": 40091
}
],
"mentions": [],
"reference": null
},
{
"id": 1051951813399674900,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 15:00:56",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051951810274926600,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051951885621399600,
"author_id": 1046876681094303700,
"author_name": "Chippotle Maths",
"timestamp": "12/12/2022 15:01:13",
"content": "If the maximum value of y is 2, then why is the upper bound of x not 2 as well'?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051952119021846500,
"author_id": 1046876681094303700,
"author_name": "Chippotle Maths",
"timestamp": "12/12/2022 15:02:09",
"content": "i.e why is the integral $\\int{1}^2\\int{0}^y\\frac{x}{x^2 + y^2}dxdy$, and not $\\int{1}^2\\int{0}^2\\frac{x}{x^2 + y^2}dxdy$?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051952679674462300,
"author_id": 591872343320821800,
"author_name": "Doggo",
"timestamp": "12/12/2022 15:04:23",
"content": "how's D defined?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051952874638295200,
"author_id": 1046876681094303700,
"author_name": "Chippotle Maths",
"timestamp": "12/12/2022 15:05:09",
"content": "Well, we have that $ 1 \\leq y \\leq 2$ and $0 \\leq x \\leq y$",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051952883668631600,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "12/12/2022 15:05:11",
"content": "**Chippotle Maths**",
"attachments": [
{
"id": 1051952883828006900,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051952883828006922/1046876681094303784.png",
"fileName": "1046876681094303784.png",
"fileSizeBytes": 13702
}
],
"mentions": [],
"reference": null
},
{
"id": 1051953027248038000,
"author_id": 1046876681094303700,
"author_name": "Chippotle Maths",
"timestamp": "12/12/2022 15:05:46",
"content": "Drawing this gives me a rectangle, (0,1),(0,2), (0,0),(y,0)",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051953125310877800,
"author_id": 1046876681094303700,
"author_name": "Chippotle Maths",
"timestamp": "12/12/2022 15:06:09",
"content": "However the last point must be equal to two since x has its maximum at y, which has a maximum of 2",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051953393263988900,
"author_id": 591872343320821800,
"author_name": "Doggo",
"timestamp": "12/12/2022 15:07:13",
"content": "wouldn't it be a right triangle?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051953449161465900,
"author_id": 591872343320821800,
"author_name": "Doggo",
"timestamp": "12/12/2022 15:07:26",
"content": "$0 \\leq x \\leq y$\nhere the y isn't just some constant",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051953457877237900,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "12/12/2022 15:07:28",
"content": "**Doggo**",
"attachments": [
{
"id": 1051953458061783200,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051953458061783130/591872343320821763.png",
"fileName": "591872343320821763.png",
"fileSizeBytes": 13780
}
],
"mentions": [],
"reference": null
},
{
"id": 1051953596771610800,
"author_id": 1046876681094303700,
"author_name": "Chippotle Maths",
"timestamp": "12/12/2022 15:08:01",
"content": "...., you're right!!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051953780654100600,
"author_id": 1046876681094303700,
"author_name": "Chippotle Maths",
"timestamp": "12/12/2022 15:08:45",
"content": "I'm so used to solving inequalities with x and y and where y is within another inequality that I just..",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051953787507593200,
"author_id": 1046876681094303700,
"author_name": "Chippotle Maths",
"timestamp": "12/12/2022 15:08:47",
"content": "god dammit",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051953823683457200,
"author_id": 1046876681094303700,
"author_name": "Chippotle Maths",
"timestamp": "12/12/2022 15:08:55",
"content": "@Doggo Thank you so much for pointing that out ❤️",
"attachments": [],
"mentions": [
{
"id": 591872343320821800,
"name": "Doggo",
"discriminator": "6233",
"nickname": "Doggo",
"isBot": false
}
],
"reference": null
},
{
"id": 1051957599899230200,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 15:23:56",
"content": "@Chippotle Maths Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 1046876681094303700,
"name": "Chippotle Maths",
"discriminator": "5191",
"nickname": "Chippotle Maths",
"isBot": false
}
],
"reference": null
},
{
"id": 1051961376823840900,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 15:38:56",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
eacad2fd56b54c0b9f3773cc3f2391ae
|
200,045 |
[
{
"id": 1051961629862006900,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 15:39:57",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051962325290192900,
"author_id": 542046199491067900,
"author_name": "Ayooo",
"timestamp": "12/12/2022 15:42:42",
"content": "",
"attachments": [
{
"id": 1051962325093073000,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051962325093072986/5eea21ea-640b-46fa-b870-7cdeebcace3a.jpg",
"fileName": "5eea21ea-640b-46fa-b870-7cdeebcace3a.jpg",
"fileSizeBytes": 281086
}
],
"mentions": [],
"reference": null
},
{
"id": 1051962327928406000,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 15:42:43",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051962325290192900,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051962378067132500,
"author_id": 542046199491067900,
"author_name": "Ayooo",
"timestamp": "12/12/2022 15:42:55",
"content": "How do i solve question 4",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051962428725932200,
"author_id": 542046199491067900,
"author_name": "Ayooo",
"timestamp": "12/12/2022 15:43:07",
"content": "I dont get how to simplify the expression",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051966204874600400,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 15:58:07",
"content": "@Ayooo Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 542046199491067900,
"name": "Ayooo",
"discriminator": "0793",
"nickname": "Ayooo",
"isBot": false
}
],
"reference": null
},
{
"id": 1051969981623050400,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 16:13:08",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
75a92bdbfeb247cab36ea03209693699
|
200,046 |
[
{
"id": 1051970234216624300,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 16:14:08",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051971621436522500,
"author_id": 584406164259995600,
"author_name": "Zyssalone",
"timestamp": "12/12/2022 16:19:39",
"content": "",
"attachments": [
{
"id": 1051971621059051600,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051971621059051590/20221212_212412.jpg",
"fileName": "20221212_212412.jpg",
"fileSizeBytes": 325437
}
],
"mentions": [],
"reference": null
},
{
"id": 1051971624632594600,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 16:19:40",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051971621436522500,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051971671562661900,
"author_id": 584406164259995600,
"author_name": "Zyssalone",
"timestamp": "12/12/2022 16:19:51",
"content": "Hi",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051971704366305400,
"author_id": 584406164259995600,
"author_name": "Zyssalone",
"timestamp": "12/12/2022 16:19:59",
"content": "",
"attachments": [
{
"id": 1051971703946891400,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051971703946891334/20221212_212412.jpg",
"fileName": "20221212_212412.jpg",
"fileSizeBytes": 325437
}
],
"mentions": [],
"reference": null
},
{
"id": 1051971760381235200,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "12/12/2022 16:20:12",
"content": "Hi",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051971791033225300,
"author_id": 584406164259995600,
"author_name": "Zyssalone",
"timestamp": "12/12/2022 16:20:19",
"content": "I cant send any images",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051971798721384400,
"author_id": 584406164259995600,
"author_name": "Zyssalone",
"timestamp": "12/12/2022 16:20:21",
"content": "Bruh",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051971820548522000,
"author_id": 584406164259995600,
"author_name": "Zyssalone",
"timestamp": "12/12/2022 16:20:26",
"content": ".close",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051971823677493400,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 16:20:27",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
ec6a3c9aae544cf29187777e334ce218
|
200,047 |
[
{
"id": 1051971853935198200,
"author_id": 584406164259995600,
"author_name": "Zyssalone",
"timestamp": "12/12/2022 16:20:34",
"content": ".close",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051974161230217200,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 16:29:44",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051974189315280900,
"author_id": 305117827361144800,
"author_name": "Unbearable Frequentist",
"timestamp": "12/12/2022 16:29:51",
"content": "",
"attachments": [
{
"id": 1051974188895838300,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051974188895838289/image.png",
"fileName": "image.png",
"fileSizeBytes": 52731
}
],
"mentions": [],
"reference": null
},
{
"id": 1051974191731196000,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 16:29:52",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1051974189315280900,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1051974255438475400,
"author_id": 305117827361144800,
"author_name": "Unbearable Frequentist",
"timestamp": "12/12/2022 16:30:07",
"content": "",
"attachments": [
{
"id": 1051974255132295200,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1051974255132295198/image.png",
"fileName": "image.png",
"fileSizeBytes": 52731
}
],
"mentions": [],
"reference": null
},
{
"id": 1051974481297539100,
"author_id": 305117827361144800,
"author_name": "Unbearable Frequentist",
"timestamp": "12/12/2022 16:31:01",
"content": "I'm looking to see how 11 is derived. I know a bit about integrals and derivatives.",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051978257039368200,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 16:46:01",
"content": "@Unbearable Frequentist Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 305117827361144800,
"name": "Unbearable Frequentist",
"discriminator": "4618",
"nickname": "Unbearable Frequentist",
"isBot": false
}
],
"reference": null
},
{
"id": 1051982289854267400,
"author_id": 542046199491067900,
"author_name": "Ayooo",
"timestamp": "12/12/2022 17:02:02",
"content": "Ig the helpers r all asleep",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051984056692252700,
"author_id": 261933205387477000,
"author_name": "riemann",
"timestamp": "12/12/2022 17:09:04",
"content": "i'm definitely asleep",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051984898522620000,
"author_id": 305117827361144800,
"author_name": "Unbearable Frequentist",
"timestamp": "12/12/2022 17:12:24",
"content": "It's okay. I'm sure someone will help, if not, that's totally fine. There are others I can ask.",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051984969079197700,
"author_id": 305117827361144800,
"author_name": "Unbearable Frequentist",
"timestamp": "12/12/2022 17:12:41",
"content": "It's not particularly important, but I thought it would be useful before I keep reading.",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051991298149712000,
"author_id": 374795910032523260,
"author_name": "SWR",
"timestamp": "12/12/2022 17:37:50",
"content": "where are you stuck exactly?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051993815973634200,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 17:47:50",
"content": "@Unbearable Frequentist Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 305117827361144800,
"name": "Unbearable Frequentist",
"discriminator": "4618",
"nickname": "Unbearable Frequentist",
"isBot": false
}
],
"reference": null
},
{
"id": 1051994178202128400,
"author_id": 305117827361144800,
"author_name": "Unbearable Frequentist",
"timestamp": "12/12/2022 17:49:17",
"content": "I'm not exactly sure how he got theta ^3 over 3. Note what I said above, I have some understanding of integrals and derivatives.",
"attachments": [],
"mentions": [
{
"id": 374795910032523260,
"name": "SWR",
"discriminator": "8588",
"nickname": "SWR",
"isBot": false
}
],
"reference": null
},
{
"id": 1051994210712162300,
"author_id": 305117827361144800,
"author_name": "Unbearable Frequentist",
"timestamp": "12/12/2022 17:49:24",
"content": "But I honestly don't know how he got that",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051994275698712700,
"author_id": 374795910032523260,
"author_name": "SWR",
"timestamp": "12/12/2022 17:49:40",
"content": "Integral is just opposite of derivative",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051994531182157800,
"author_id": 305117827361144800,
"author_name": "Unbearable Frequentist",
"timestamp": "12/12/2022 17:50:41",
"content": "Okay",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051994550618575000,
"author_id": 305117827361144800,
"author_name": "Unbearable Frequentist",
"timestamp": "12/12/2022 17:50:45",
"content": "Did I say something wrong",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051994669183156400,
"author_id": 374795910032523260,
"author_name": "SWR",
"timestamp": "12/12/2022 17:51:14",
"content": "No. Just wasn't sure where the confusion was.",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051994784446808000,
"author_id": 374795910032523260,
"author_name": "SWR",
"timestamp": "12/12/2022 17:51:41",
"content": "If that makes sense to you, then take the derivative of θ³/3",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051994819901264000,
"author_id": 374795910032523260,
"author_name": "SWR",
"timestamp": "12/12/2022 17:51:50",
"content": "what do you get?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051996042620588000,
"author_id": 305117827361144800,
"author_name": "Unbearable Frequentist",
"timestamp": "12/12/2022 17:56:41",
"content": "I'm not too sure",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1051997130350403700,
"author_id": 374795910032523260,
"author_name": "SWR",
"timestamp": "12/12/2022 18:01:01",
"content": "Do you know how to calculate a derivative?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052001367306277000,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 18:17:51",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
743eba550818423ea06d7fc3a25125b7
|
200,048 |
[
{
"id": 1052001619874681000,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 18:18:51",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052003377678139400,
"author_id": 668202640936534000,
"author_name": "provoletariat",
"timestamp": "12/12/2022 18:25:50",
"content": "i made simultaneous equations from this but its not going anywhere",
"attachments": [
{
"id": 1052003377401311400,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1052003377401311352/image.png",
"fileName": "image.png",
"fileSizeBytes": 10105
}
],
"mentions": [],
"reference": null
},
{
"id": 1052003379829801100,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 18:25:51",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1052003377678139400,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1052003547723604100,
"author_id": 374795910032523260,
"author_name": "SWR",
"timestamp": "12/12/2022 18:26:31",
"content": "show",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052003803215441900,
"author_id": 668202640936534000,
"author_name": "provoletariat",
"timestamp": "12/12/2022 18:27:31",
"content": "",
"attachments": [
{
"id": 1052003803039285200,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1052003803039285278/PXL_20221212_232656448.jpg",
"fileName": "PXL_20221212_232656448.jpg",
"fileSizeBytes": 334498
}
],
"mentions": [],
"reference": null
},
{
"id": 1052004650343211000,
"author_id": 668202640936534000,
"author_name": "provoletariat",
"timestamp": "12/12/2022 18:30:53",
"content": "is this the right way to approach this?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052004958700056600,
"author_id": 374795910032523260,
"author_name": "SWR",
"timestamp": "12/12/2022 18:32:07",
"content": "Your multiplication looks right",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052005024269615200,
"author_id": 374795910032523260,
"author_name": "SWR",
"timestamp": "12/12/2022 18:32:23",
"content": "Not sure how you arrived at your equations though",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052005386170937500,
"author_id": 374795910032523260,
"author_name": "SWR",
"timestamp": "12/12/2022 18:33:49",
"content": "Also, I can't read what you wrote for d=",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052005400377032700,
"author_id": 668202640936534000,
"author_name": "provoletariat",
"timestamp": "12/12/2022 18:33:52",
"content": "i may have done it wrong from memory is if (a b)=(c d) than is a +b=c+d correct?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052005454982693000,
"author_id": 668202640936534000,
"author_name": "provoletariat",
"timestamp": "12/12/2022 18:34:05",
"content": "i wrote d=a",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052006024229421000,
"author_id": 374795910032523260,
"author_name": "SWR",
"timestamp": "12/12/2022 18:36:21",
"content": "It's correct, but it's just a by product of a=c and b=d",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052006680822558700,
"author_id": 668202640936534000,
"author_name": "provoletariat",
"timestamp": "12/12/2022 18:38:58",
"content": "oh that makes more sense",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052006957587906600,
"author_id": 668202640936534000,
"author_name": "provoletariat",
"timestamp": "12/12/2022 18:40:04",
"content": "i still dont know how i can figure out a value or a d or b",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052008076112314500,
"author_id": 374795910032523260,
"author_name": "SWR",
"timestamp": "12/12/2022 18:44:30",
"content": "Perhaps any value works",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052008788481298400,
"author_id": 668202640936534000,
"author_name": "provoletariat",
"timestamp": "12/12/2022 18:47:20",
"content": "yeah thats definitely what it is",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052008822107033600,
"author_id": 668202640936534000,
"author_name": "provoletariat",
"timestamp": "12/12/2022 18:47:28",
"content": "Thank you : )",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052012078300397700,
"author_id": 668202640936534000,
"author_name": "provoletariat",
"timestamp": "12/12/2022 19:00:24",
"content": ".close",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052012081190273000,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 19:00:25",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
71678c0e558e45f59440e6deea781f7c
|
200,049 |
[
{
"id": 1052014723933155300,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 19:10:55",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052015903442731000,
"author_id": 742120650726047700,
"author_name": "𝐅𝐥𝐚𝐦𝐞",
"timestamp": "12/12/2022 19:15:36",
"content": "",
"attachments": [
{
"id": 1052015903073652700,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1052015903073652766/image.png",
"fileName": "image.png",
"fileSizeBytes": 80806
}
],
"mentions": [],
"reference": null
},
{
"id": 1052015905367916700,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 19:15:37",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1052015903442731000,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1052015970992009200,
"author_id": 742120650726047700,
"author_name": "𝐅𝐥𝐚𝐦𝐞",
"timestamp": "12/12/2022 19:15:52",
"content": "",
"attachments": [
{
"id": 1052015970539012100,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1052015970539012137/image.png",
"fileName": "image.png",
"fileSizeBytes": 94472
}
],
"mentions": [],
"reference": null
},
{
"id": 1052016019868229600,
"author_id": 742120650726047700,
"author_name": "𝐅𝐥𝐚𝐦𝐞",
"timestamp": "12/12/2022 19:16:04",
"content": "someone help",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052016798607876100,
"author_id": 742120650726047700,
"author_name": "𝐅𝐥𝐚𝐦𝐞",
"timestamp": "12/12/2022 19:19:10",
"content": "@Helpers",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052017448141988000,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:21:45",
"content": "@𝐅𝐥𝐚𝐦𝐞",
"attachments": [],
"mentions": [
{
"id": 742120650726047700,
"name": "𝐅𝐥𝐚𝐦𝐞",
"discriminator": "9999",
"nickname": "𝐅𝐥𝐚𝐦𝐞",
"isBot": false
}
],
"reference": null
},
{
"id": 1052017466454323200,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:21:49",
"content": "if i have y=f(x)",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052017501673894000,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:21:57",
"content": "and then i have y=kf(x)",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052017520338538500,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:22:02",
"content": "what does that do to the graph?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052017582397472900,
"author_id": 742120650726047700,
"author_name": "𝐅𝐥𝐚𝐦𝐞",
"timestamp": "12/12/2022 19:22:17",
"content": "If K is greater than 1, then it is a vertical stretch",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052017632250966100,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:22:29",
"content": "by a factor of...?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052017656934453200,
"author_id": 742120650726047700,
"author_name": "𝐅𝐥𝐚𝐦𝐞",
"timestamp": "12/12/2022 19:22:34",
"content": "no clue",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052017741344813000,
"author_id": 742120650726047700,
"author_name": "𝐅𝐥𝐚𝐦𝐞",
"timestamp": "12/12/2022 19:22:55",
"content": "if k is less than 1 and greater than 0 than it is a vertical compression",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052017753185341600,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:22:57",
"content": "ok you understand how functions work correct?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052017778657349600,
"author_id": 742120650726047700,
"author_name": "𝐅𝐥𝐚𝐦𝐞",
"timestamp": "12/12/2022 19:23:03",
"content": "Kind of",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052017818922655900,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:23:13",
"content": "tell me what a function is",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052017820965294100,
"author_id": 742120650726047700,
"author_name": "𝐅𝐥𝐚𝐦𝐞",
"timestamp": "12/12/2022 19:23:14",
"content": "wait",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052017848249237500,
"author_id": 742120650726047700,
"author_name": "𝐅𝐥𝐚𝐦𝐞",
"timestamp": "12/12/2022 19:23:20",
"content": "ughh",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052017883376537700,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:23:28",
"content": "whta does y=f(x) mean",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052017883431055400,
"author_id": 742120650726047700,
"author_name": "𝐅𝐥𝐚𝐦𝐞",
"timestamp": "12/12/2022 19:23:28",
"content": "U put an input",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052017923734114300,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:23:38",
"content": "is x or y the input?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052017949701062800,
"author_id": 742120650726047700,
"author_name": "𝐅𝐥𝐚𝐦𝐞",
"timestamp": "12/12/2022 19:23:44",
"content": "x input",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052017960811770000,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:23:47",
"content": "good",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052017982269821000,
"author_id": 742120650726047700,
"author_name": "𝐅𝐥𝐚𝐦𝐞",
"timestamp": "12/12/2022 19:23:52",
"content": "f(x) is f of x",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052018080609468400,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:24:15",
"content": "what is *f*?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052018145700888600,
"author_id": 742120650726047700,
"author_name": "𝐅𝐥𝐚𝐦𝐞",
"timestamp": "12/12/2022 19:24:31",
"content": "no clue our teacher just said f(x) means f of x",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052018162058678300,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:24:35",
"content": "...",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052018171751710700,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:24:37",
"content": "ok i'll tell you",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052018178382897200,
"author_id": 742120650726047700,
"author_name": "𝐅𝐥𝐚𝐦𝐞",
"timestamp": "12/12/2022 19:24:39",
"content": "I understand the problem but",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052018205218066600,
"author_id": 742120650726047700,
"author_name": "𝐅𝐥𝐚𝐦𝐞",
"timestamp": "12/12/2022 19:24:45",
"content": "idk of g(x) goes up or down",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052018228878118900,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:24:51",
"content": "basically x is an input and y is an output",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052018232971755500,
"author_id": 742120650726047700,
"author_name": "𝐅𝐥𝐚𝐦𝐞",
"timestamp": "12/12/2022 19:24:52",
"content": "thats what im getting confused lol",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052018377838833800,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:25:26",
"content": "y=f(x) basically says that you put in x into something, f(x) which does something to x, and it outputs a value y",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052018434763931600,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:25:40",
"content": "for example",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052018457367036000,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:25:45",
"content": "y=2x",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052018510668234800,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:25:58",
"content": "just means you input some value x and the output is 2x, (double the original value)",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052018560005845000,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:26:10",
"content": "like i can input x=3, and i get an output, y=6",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052018595686777000,
"author_id": 742120650726047700,
"author_name": "𝐅𝐥𝐚𝐦𝐞",
"timestamp": "12/12/2022 19:26:18",
"content": "ik",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052018610937278600,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:26:22",
"content": "now if i have y=f(x) and then y=kf(x)",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052018688137629800,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:26:40",
"content": "now can you answer how much the vertical stretch is by if k>1?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052018780051607600,
"author_id": 742120650726047700,
"author_name": "𝐅𝐥𝐚𝐦𝐞",
"timestamp": "12/12/2022 19:27:02",
"content": "idk",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052018848045477900,
"author_id": 742120650726047700,
"author_name": "𝐅𝐥𝐚𝐦𝐞",
"timestamp": "12/12/2022 19:27:18",
"content": "just give me the answer, will you 😭",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052018886121361500,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:27:28",
"content": "but you have to understand why",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052018944308953100,
"author_id": 742120650726047700,
"author_name": "𝐅𝐥𝐚𝐦𝐞",
"timestamp": "12/12/2022 19:27:41",
"content": "i got this",
"attachments": [
{
"id": 1052018944275394600,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1052018944275394600/image.png",
"fileName": "image.png",
"fileSizeBytes": 10038
}
],
"mentions": [],
"reference": null
},
{
"id": 1052018987703214100,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:27:52",
"content": "its not",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052019011568795600,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:27:57",
"content": "ok",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052019029558181900,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:28:02",
"content": "so if we have y=kf(x) right",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052019109581307900,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:28:21",
"content": "we input x and then we get some output f(x) and then it's multiplied by a constant k right",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052019143899099300,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:28:29",
"content": "lets say k was 2 right",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052019184948756500,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:28:39",
"content": "if we get an output 5 then kf(x) would be 10",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052019204750053400,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:28:43",
"content": "it doubled right?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052019213562282100,
"author_id": 742120650726047700,
"author_name": "𝐅𝐥𝐚𝐦𝐞",
"timestamp": "12/12/2022 19:28:46",
"content": "yes",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052019243887104000,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:28:53",
"content": "",
"attachments": [
{
"id": 1052019243585122300,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1052019243585122365/Screen_Shot_2022-12-13_at_11.28.47_am.png",
"fileName": "Screen_Shot_2022-12-13_at_11.28.47_am.png",
"fileSizeBytes": 66342
}
],
"mentions": [],
"reference": null
},
{
"id": 1052019250723831800,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:28:54",
"content": "for example in the question",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052019286983577700,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:29:03",
"content": "if we choose an input x=-2",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052019322811322400,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:29:12",
"content": "then f(-2)=2.5 right",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052019483990053000,
"author_id": 742120650726047700,
"author_name": "𝐅𝐥𝐚𝐦𝐞",
"timestamp": "12/12/2022 19:29:50",
"content": "yes",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052019497290178600,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:29:53",
"content": "good",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052019522502135800,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:29:59",
"content": "ok so g(-2)=5 right",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052019581826379900,
"author_id": 742120650726047700,
"author_name": "𝐅𝐥𝐚𝐦𝐞",
"timestamp": "12/12/2022 19:30:13",
"content": "no",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052019607147393000,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:30:19",
"content": "what?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052019610846777300,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:30:20",
"content": "why not",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052019649467908100,
"author_id": 742120650726047700,
"author_name": "𝐅𝐥𝐚𝐦𝐞",
"timestamp": "12/12/2022 19:30:30",
"content": "how can f(-2)=2.5 and 5 at the same time",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052019697098436600,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:30:41",
"content": "its a g not an f",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052019725485482000,
"author_id": 742120650726047700,
"author_name": "𝐅𝐥𝐚𝐦𝐞",
"timestamp": "12/12/2022 19:30:48",
"content": "oh",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052019729436508200,
"author_id": 742120650726047700,
"author_name": "𝐅𝐥𝐚𝐦𝐞",
"timestamp": "12/12/2022 19:30:49",
"content": "nvm",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052019742996697100,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:30:52",
"content": "lul",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052019751771181200,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:30:54",
"content": "makes sense?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052019762760257500,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:30:57",
"content": "g(-2)=5?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052019784344150100,
"author_id": 742120650726047700,
"author_name": "𝐅𝐥𝐚𝐦𝐞",
"timestamp": "12/12/2022 19:31:02",
"content": "yes",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052019802056708100,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:31:06",
"content": "",
"attachments": [
{
"id": 1052019801784074200,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1052019801784074290/Screen_Shot_2022-12-13_at_11.png",
"fileName": "Screen_Shot_2022-12-13_at_11.png",
"fileSizeBytes": 54865
}
],
"mentions": [],
"reference": null
},
{
"id": 1052019812756357100,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:31:08",
"content": "ok if you notice",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052019836680671200,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:31:14",
"content": "you can pick any input x on f(x)",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052019857912250400,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:31:19",
"content": "g(x) will always be double that",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052019949071245400,
"author_id": 742120650726047700,
"author_name": "𝐅𝐥𝐚𝐦𝐞",
"timestamp": "12/12/2022 19:31:41",
"content": "btw i was focusing on this question",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052019952560914400,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:31:42",
"content": "",
"attachments": [
{
"id": 1052019952271503500,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1052019952271503430/Screen_Shot_2022-12-13_at_11.31.36_am.png",
"fileName": "Screen_Shot_2022-12-13_at_11.31.36_am.png",
"fileSizeBytes": 10328
}
],
"mentions": [],
"reference": null
},
{
"id": 1052019985834315800,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:31:50",
"content": "oh shit",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052020006998773900,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:31:55",
"content": "um did you already get",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052020023356567600,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:31:59",
"content": "the other qumestion",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052020028993708000,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:32:00",
"content": "bruh",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052020045338906800,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:32:04",
"content": "sorry i just wasted your time",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052020059297546200,
"author_id": 742120650726047700,
"author_name": "𝐅𝐥𝐚𝐦𝐞",
"timestamp": "12/12/2022 19:32:07",
"content": "yeah i got this",
"attachments": [
{
"id": 1052020058882314200,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1052020058882314301/image.png",
"fileName": "image.png",
"fileSizeBytes": 7603
}
],
"mentions": [],
"reference": null
},
{
"id": 1052020088091451400,
"author_id": 742120650726047700,
"author_name": "𝐅𝐥𝐚𝐦𝐞",
"timestamp": "12/12/2022 19:32:14",
"content": "no problem",
"attachments": [],
"mentions": [
{
"id": 310599340961955840,
"name": "ed",
"discriminator": "3496",
"nickname": "ed",
"isBot": false
}
],
"reference": null
},
{
"id": 1052020104134668300,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:32:18",
"content": "oh nvm",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052020110283522200,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:32:19",
"content": "you got it wrong",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052020155053506700,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:32:30",
"content": "wait what",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052020212473544700,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:32:44",
"content": "which questino is that for",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052020221667455000,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:32:46",
"content": "this one",
"attachments": [],
"mentions": [
{
"id": 742120650726047700,
"name": "𝐅𝐥𝐚𝐦𝐞",
"discriminator": "9999",
"nickname": "𝐅𝐥𝐚𝐦𝐞",
"isBot": false
}
],
"reference": null
},
{
"id": 1052020239325474800,
"author_id": 742120650726047700,
"author_name": "𝐅𝐥𝐚𝐦𝐞",
"timestamp": "12/12/2022 19:32:50",
"content": "wait is it 1.5",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052020265544073200,
"author_id": 742120650726047700,
"author_name": "𝐅𝐥𝐚𝐦𝐞",
"timestamp": "12/12/2022 19:32:56",
"content": "oh that",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052020295105515600,
"author_id": 742120650726047700,
"author_name": "𝐅𝐥𝐚𝐦𝐞",
"timestamp": "12/12/2022 19:33:03",
"content": "this 1",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052020403415035900,
"author_id": 742120650726047700,
"author_name": "𝐅𝐥𝐚𝐦𝐞",
"timestamp": "12/12/2022 19:33:29",
"content": "",
"attachments": [
{
"id": 1052020403079479300,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1052020403079479306/image.png",
"fileName": "image.png",
"fileSizeBytes": 9444
}
],
"mentions": [],
"reference": null
},
{
"id": 1052020531165147100,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:34:00",
"content": "ok",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052020536177348600,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:34:01",
"content": "i see",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052020581320622100,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:34:12",
"content": "H is not the correct answer option",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052020659351453800,
"author_id": 742120650726047700,
"author_name": "𝐅𝐥𝐚𝐦𝐞",
"timestamp": "12/12/2022 19:34:30",
"content": "so its up",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052020665387077600,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:34:32",
"content": "f(x-k) translates k units to the right",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052020706491252700,
"author_id": 742120650726047700,
"author_name": "𝐅𝐥𝐚𝐦𝐞",
"timestamp": "12/12/2022 19:34:42",
"content": "oh...",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052020764469108700,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:34:55",
"content": "remember x is left and right",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052020774904533000,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:34:58",
"content": "y is up and down",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052020808555442200,
"author_id": 742120650726047700,
"author_name": "𝐅𝐥𝐚𝐦𝐞",
"timestamp": "12/12/2022 19:35:06",
"content": "OH YES",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052020809285242900,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:35:06",
"content": "lets say k is 2 right",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052020822795112400,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:35:09",
"content": "f(x-2)",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052020847021412400,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:35:15",
"content": "f(x) to f(x-2)",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052020847377924100,
"author_id": 742120650726047700,
"author_name": "𝐅𝐥𝐚𝐦𝐞",
"timestamp": "12/12/2022 19:35:15",
"content": "I DIDNT REALLY READ THE QUESTION",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052020861470773400,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:35:18",
"content": "what",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052020870320763000,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:35:21",
"content": "bruh",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052021007721967600,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:35:53",
"content": "you figured it out?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052021019382124700,
"author_id": 742120650726047700,
"author_name": "𝐅𝐥𝐚𝐦𝐞",
"timestamp": "12/12/2022 19:35:56",
"content": "yes",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052021053741867000,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:36:04",
"content": "nice",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052021086541316100,
"author_id": 742120650726047700,
"author_name": "𝐅𝐥𝐚𝐦𝐞",
"timestamp": "12/12/2022 19:36:12",
"content": "x-k is right",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052021103708602400,
"author_id": 742120650726047700,
"author_name": "𝐅𝐥𝐚𝐦𝐞",
"timestamp": "12/12/2022 19:36:16",
"content": "x+k is left",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052021120649404400,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:36:20",
"content": "yes",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052021326824616000,
"author_id": 742120650726047700,
"author_name": "𝐅𝐥𝐚𝐦𝐞",
"timestamp": "12/12/2022 19:37:09",
"content": "so 5 units to right?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052021934109499400,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:39:34",
"content": "es",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052021940107358300,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:39:36",
"content": "yes",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052022183288901600,
"author_id": 742120650726047700,
"author_name": "𝐅𝐥𝐚𝐦𝐞",
"timestamp": "12/12/2022 19:40:34",
"content": "so the other one is this?",
"attachments": [
{
"id": 1052022182865289200,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1052022182865289226/image.png",
"fileName": "image.png",
"fileSizeBytes": 7301
}
],
"mentions": [],
"reference": null
},
{
"id": 1052022379687182500,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:41:20",
"content": "no",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052022461597745300,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:41:40",
"content": "k=2, stretched vertically",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052022705622360200,
"author_id": 742120650726047700,
"author_name": "𝐅𝐥𝐚𝐦𝐞",
"timestamp": "12/12/2022 19:42:38",
"content": "but isnt the slope 1/2",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052022779194659000,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:42:56",
"content": "the slope doesn't matter",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052023107537350700,
"author_id": 742120650726047700,
"author_name": "𝐅𝐥𝐚𝐦𝐞",
"timestamp": "12/12/2022 19:44:14",
"content": "but **k** is the slope",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052023133021937700,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:44:20",
"content": "no its not",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052023213430939600,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:44:39",
"content": "k is the slope if its in the from $f(x)=kx+c$",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052023222037663700,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "12/12/2022 19:44:41",
"content": "**ed**",
"attachments": [
{
"id": 1052023222125740200,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1052023222125740152/310599340961955840.png",
"fileName": "310599340961955840.png",
"fileSizeBytes": 13541
}
],
"mentions": [],
"reference": null
},
{
"id": 1052023224109637800,
"author_id": 742120650726047700,
"author_name": "𝐅𝐥𝐚𝐦𝐞",
"timestamp": "12/12/2022 19:44:42",
"content": "bruh my teacher told me k is the slope",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052023230178795500,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:44:43",
"content": "form*",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052023263162810400,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:44:51",
"content": "no its not",
"attachments": [],
"mentions": [
{
"id": 742120650726047700,
"name": "𝐅𝐥𝐚𝐦𝐞",
"discriminator": "9999",
"nickname": "𝐅𝐥𝐚𝐦𝐞",
"isBot": false
}
],
"reference": null
},
{
"id": 1052023291226898400,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:44:58",
"content": "it must be in this form",
"attachments": [],
"mentions": [
{
"id": 510789298321096700,
"name": "TeXit",
"discriminator": "0796",
"nickname": "TeXit",
"isBot": true
}
],
"reference": null
},
{
"id": 1052023417727090700,
"author_id": 742120650726047700,
"author_name": "𝐅𝐥𝐚𝐦𝐞",
"timestamp": "12/12/2022 19:45:28",
"content": "then what is k",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052023586094862500,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:46:08",
"content": "f(x)-->kg(x)=vertical dilation by k",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052023810288791600,
"author_id": 742120650726047700,
"author_name": "𝐅𝐥𝐚𝐦𝐞",
"timestamp": "12/12/2022 19:47:02",
"content": "what is this.. ik the answers but my teacher never told me about k/1 and stuff",
"attachments": [
{
"id": 1052023809961644000,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1052023809961644083/image.png",
"fileName": "image.png",
"fileSizeBytes": 40351
}
],
"mentions": [],
"reference": null
},
{
"id": 1052023841934811300,
"author_id": 742120650726047700,
"author_name": "𝐅𝐥𝐚𝐦𝐞",
"timestamp": "12/12/2022 19:47:09",
"content": "this last question",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052024059212349600,
"author_id": 742120650726047700,
"author_name": "𝐅𝐥𝐚𝐦𝐞",
"timestamp": "12/12/2022 19:48:01",
"content": "in f(kx) if k is greater than 1 then its horizantal compression and if its less then stretch",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052024152179081200,
"author_id": 742120650726047700,
"author_name": "𝐅𝐥𝐚𝐦𝐞",
"timestamp": "12/12/2022 19:48:23",
"content": "and on kf(x) if k is greater than 1 than stretch",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052024236904030200,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:48:43",
"content": "should be A i think?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052024284849127400,
"author_id": 742120650726047700,
"author_name": "𝐅𝐥𝐚𝐦𝐞",
"timestamp": "12/12/2022 19:48:55",
"content": "ok",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052024329442959400,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:49:05",
"content": "the question is worded dumb",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052024342357229700,
"author_id": 742120650726047700,
"author_name": "𝐅𝐥𝐚𝐦𝐞",
"timestamp": "12/12/2022 19:49:08",
"content": "yeah",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052024392093286400,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:49:20",
"content": "idk what math you're doing but noone thinks about vertical/horizontal dilations like this",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052024428801822800,
"author_id": 742120650726047700,
"author_name": "𝐅𝐥𝐚𝐦𝐞",
"timestamp": "12/12/2022 19:49:29",
"content": "fr",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052024470086361100,
"author_id": 742120650726047700,
"author_name": "𝐅𝐥𝐚𝐦𝐞",
"timestamp": "12/12/2022 19:49:39",
"content": "my teacher said",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052024493515755600,
"author_id": 742120650726047700,
"author_name": "𝐅𝐥𝐚𝐦𝐞",
"timestamp": "12/12/2022 19:49:44",
"content": "that they changed the course a lot",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052024505666638000,
"author_id": 742120650726047700,
"author_name": "𝐅𝐥𝐚𝐦𝐞",
"timestamp": "12/12/2022 19:49:47",
"content": "this year",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052024517398118400,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:49:50",
"content": "is it A tho?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052024530383675400,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 19:49:53",
"content": "i could be wrong tbh",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052024646943375500,
"author_id": 742120650726047700,
"author_name": "𝐅𝐥𝐚𝐦𝐞",
"timestamp": "12/12/2022 19:50:21",
"content": "it was correct thanks!",
"attachments": [
{
"id": 1052024646670749700,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1052024646670749716/image.png",
"fileName": "image.png",
"fileSizeBytes": 43866
}
],
"mentions": [],
"reference": null
},
{
"id": 1052024668690858000,
"author_id": 742120650726047700,
"author_name": "𝐅𝐥𝐚𝐦𝐞",
"timestamp": "12/12/2022 19:50:26",
"content": "anyways, cya",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052024674864869400,
"author_id": 742120650726047700,
"author_name": "𝐅𝐥𝐚𝐦𝐞",
"timestamp": "12/12/2022 19:50:28",
"content": ".close",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052024677498900600,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 19:50:28",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
c34b2a9c6a0f4b5792a3e74b1008e0f0
|
200,050 |
[
{
"id": 1052024932751642600,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 19:51:29",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052025933214798000,
"author_id": 797118242741026800,
"author_name": "Collette",
"timestamp": "12/12/2022 19:55:28",
"content": "How do I solve this?",
"attachments": [
{
"id": 1052025933181222900,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1052025933181222922/Screenshot_2022-12-12_at_16.53.23.png",
"fileName": "Screenshot_2022-12-12_at_16.53.23.png",
"fileSizeBytes": 133739
}
],
"mentions": [],
"reference": null
},
{
"id": 1052025938453471400,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 19:55:29",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1052025933214798000,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1052028359221190700,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 20:05:06",
"content": "$F_g=\\frac{GMm}{r^2}$",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052028369396564100,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "12/12/2022 20:05:09",
"content": "**ed**",
"attachments": [
{
"id": 1052028369505624000,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1052028369505624114/310599340961955840.png",
"fileName": "310599340961955840.png",
"fileSizeBytes": 7658
}
],
"mentions": [],
"reference": null
},
{
"id": 1052028411792592900,
"author_id": 797118242741026800,
"author_name": "Collette",
"timestamp": "12/12/2022 20:05:19",
"content": "wait I thought it was just GM",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052028423956070400,
"author_id": 797118242741026800,
"author_name": "Collette",
"timestamp": "12/12/2022 20:05:22",
"content": "is it GMm?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052028467182579800,
"author_id": 797118242741026800,
"author_name": "Collette",
"timestamp": "12/12/2022 20:05:32",
"content": "wow ok",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052028511759651000,
"author_id": 797118242741026800,
"author_name": "Collette",
"timestamp": "12/12/2022 20:05:42",
"content": "oh I see",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052028607872114700,
"author_id": 797118242741026800,
"author_name": "Collette",
"timestamp": "12/12/2022 20:06:05",
"content": "is r = 3/4 ?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052028629837693000,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 20:06:11",
"content": "@Collette $\\frac{GM}{r^2}$",
"attachments": [],
"mentions": [
{
"id": 797118242741026800,
"name": "Collette",
"discriminator": "5424",
"nickname": "Collette",
"isBot": false
}
],
"reference": null
},
{
"id": 1052028639727857700,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "12/12/2022 20:06:13",
"content": "**ed**",
"attachments": [
{
"id": 1052028639878860800,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1052028639878860810/310599340961955840.png",
"fileName": "310599340961955840.png",
"fileSizeBytes": 9639
}
],
"mentions": [],
"reference": null
},
{
"id": 1052028654315655200,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 20:06:16",
"content": "is the gravitational acceleration",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052028683453472800,
"author_id": 797118242741026800,
"author_name": "Collette",
"timestamp": "12/12/2022 20:06:23",
"content": "ok",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052028752319754400,
"author_id": 797118242741026800,
"author_name": "Collette",
"timestamp": "12/12/2022 20:06:40",
"content": "so what do I plug into where?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052028867025584100,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 20:07:07",
"content": "G is a the gravitational constant, M is the mass of the celestial/big object, m is the mass of the small body and r is the distance between them",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052029005425029100,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 20:07:40",
"content": "do you want me to solve is for you step by step?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052029049083543600,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 20:07:51",
"content": "it&",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052029052447375400,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 20:07:51",
"content": "it*",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052029087583043700,
"author_id": 797118242741026800,
"author_name": "Collette",
"timestamp": "12/12/2022 20:08:00",
"content": "yeah",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052029099574575100,
"author_id": 797118242741026800,
"author_name": "Collette",
"timestamp": "12/12/2022 20:08:03",
"content": "r =1?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052029102971957200,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 20:08:03",
"content": "ok",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052029157288181800,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 20:08:16",
"content": "lets consider $F_a$ the force exerted by object A",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052029165932662900,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "12/12/2022 20:08:18",
"content": "**ed**",
"attachments": [
{
"id": 1052029165987176400,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1052029165987176488/310599340961955840.png",
"fileName": "310599340961955840.png",
"fileSizeBytes": 14696
}
],
"mentions": [],
"reference": null
},
{
"id": 1052029219108036700,
"author_id": 797118242741026800,
"author_name": "Collette",
"timestamp": "12/12/2022 20:08:31",
"content": "yes",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052029226573905900,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 20:08:33",
"content": "",
"attachments": [
{
"id": 1052029226250936300,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1052029226250936380/Screen_Shot_2022-12-13_at_12.08.27_pm.png",
"fileName": "Screen_Shot_2022-12-13_at_12.08.27_pm.png",
"fileSizeBytes": 133099
}
],
"mentions": [],
"reference": null
},
{
"id": 1052029325374931000,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 20:08:56",
"content": "lets just say the distance between the person and object B is r",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052029357180338200,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 20:09:04",
"content": "so the distance between the person and object A is 3r",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052029382539088000,
"author_id": 797118242741026800,
"author_name": "Collette",
"timestamp": "12/12/2022 20:09:10",
"content": "yep",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052029443964670000,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 20:09:25",
"content": "and the persons mass is m",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052029474771836900,
"author_id": 797118242741026800,
"author_name": "Collette",
"timestamp": "12/12/2022 20:09:32",
"content": "yes",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052029518967222300,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 20:09:43",
"content": "$F_a=\\frac{10GMm}{9r^2}$",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052029528664440800,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "12/12/2022 20:09:45",
"content": "**ed**",
"attachments": [
{
"id": 1052029528756731900,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1052029528756731924/310599340961955840.png",
"fileName": "310599340961955840.png",
"fileSizeBytes": 9368
}
],
"mentions": [],
"reference": null
},
{
"id": 1052029676610138200,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 20:10:20",
"content": "$F_a=\\frac{10}{9}\\cdot ]frac{GMm}{r^2}$",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052029698047225900,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 20:10:25",
"content": "oops",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052029715927552000,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 20:10:30",
"content": "$F_a=\\frac{10}{9}\\cdot ]frac{GMm}{r^2}$",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052029736903258100,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 20:10:35",
"content": "$F_a=\\frac{10}{9}\\cdot \\frac{GMm}{r^2}$",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052029745598054500,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "12/12/2022 20:10:37",
"content": "**ed**",
"attachments": [
{
"id": 1052029745417703600,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1052029745417703495/310599340961955840.png",
"fileName": "310599340961955840.png",
"fileSizeBytes": 8478
}
],
"mentions": [],
"reference": null
},
{
"id": 1052029798114934800,
"author_id": 797118242741026800,
"author_name": "Collette",
"timestamp": "12/12/2022 20:10:49",
"content": "I see",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052029802766409900,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 20:10:50",
"content": "@Collette you got that?",
"attachments": [],
"mentions": [
{
"id": 797118242741026800,
"name": "Collette",
"discriminator": "5424",
"nickname": "Collette",
"isBot": false
}
],
"reference": null
},
{
"id": 1052029841815384000,
"author_id": 797118242741026800,
"author_name": "Collette",
"timestamp": "12/12/2022 20:11:00",
"content": "yes",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052029867740369000,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 20:11:06",
"content": "now we consider $F_b$",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052029877085278200,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "12/12/2022 20:11:08",
"content": "**ed**",
"attachments": [
{
"id": 1052029877190139900,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1052029877190139914/310599340961955840.png",
"fileName": "310599340961955840.png",
"fileSizeBytes": 7161
}
],
"mentions": [],
"reference": null
},
{
"id": 1052029964578472100,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 20:11:29",
"content": "$F_b=\\frac{GMm}{r^2}$",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052029974300868600,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "12/12/2022 20:11:31",
"content": "**ed**",
"attachments": [
{
"id": 1052029974477021300,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1052029974477021265/310599340961955840.png",
"fileName": "310599340961955840.png",
"fileSizeBytes": 7594
}
],
"mentions": [],
"reference": null
},
{
"id": 1052029999714140200,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 20:11:37",
"content": "theres literally no numbers haha",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052030093012250800,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 20:11:59",
"content": "$\\frac{10}{9}>1$ so net force is to the left",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052030101648314400,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "12/12/2022 20:12:02",
"content": "**ed**",
"attachments": [
{
"id": 1052030101723824100,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1052030101723824168/310599340961955840.png",
"fileName": "310599340961955840.png",
"fileSizeBytes": 11003
}
],
"mentions": [],
"reference": null
},
{
"id": 1052030201195941900,
"author_id": 797118242741026800,
"author_name": "Collette",
"timestamp": "12/12/2022 20:12:25",
"content": "I see",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052030224688238600,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 20:12:31",
"content": "out of curiosity is this hsc physics?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052030296079474800,
"author_id": 797118242741026800,
"author_name": "Collette",
"timestamp": "12/12/2022 20:12:48",
"content": "im in high school ap physics 1",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052030300881944600,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 20:12:49",
"content": "or another school system",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052030314874155000,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 20:12:52",
"content": "oh its just us",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052030317478817800,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 20:12:53",
"content": "ok",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052030365398741000,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 20:13:04",
"content": "for proportionality questions",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052030431974920300,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 20:13:20",
"content": "like if the question is like this object is k times as heavy with m times the distance and whatever",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052030479571878000,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 20:13:32",
"content": "then just get everything in terms of GMm/r^2",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052030497078902900,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 20:13:36",
"content": "and compare which is bigger",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052030517341597800,
"author_id": 797118242741026800,
"author_name": "Collette",
"timestamp": "12/12/2022 20:13:41",
"content": "ok",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052030531757412400,
"author_id": 797118242741026800,
"author_name": "Collette",
"timestamp": "12/12/2022 20:13:44",
"content": "thanks a lot for the help",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052030547330859100,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 20:13:48",
"content": "have fun!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052030570382762000,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 20:13:53",
"content": "just remember not to stuff up variables",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052030589827563500,
"author_id": 797118242741026800,
"author_name": "Collette",
"timestamp": "12/12/2022 20:13:58",
"content": "ok",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052030605631701000,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 20:14:02",
"content": "i like writing $M_a$ for mass of A",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052030612430655500,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 20:14:03",
"content": "and whatever",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052030614183878700,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "12/12/2022 20:14:04",
"content": "**ed**",
"attachments": [
{
"id": 1052030614259380200,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1052030614259380234/310599340961955840.png",
"fileName": "310599340961955840.png",
"fileSizeBytes": 11221
}
],
"mentions": [],
"reference": null
},
{
"id": 1052030649583800300,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 20:14:12",
"content": "write a subscript to not confuse yourself",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052030676830003300,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/12/2022 20:14:19",
"content": "very cool have fun!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052030698598436900,
"author_id": 797118242741026800,
"author_name": "Collette",
"timestamp": "12/12/2022 20:14:24",
"content": "thanks, have fun!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052030707658137700,
"author_id": 797118242741026800,
"author_name": "Collette",
"timestamp": "12/12/2022 20:14:26",
"content": ".close",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052030710338306000,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 20:14:27",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
56f4b6bb77184e8d8b88ead278987cd2
|
200,051 |
[
{
"id": 1052030963481313300,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 20:15:27",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052032618557874200,
"author_id": 961429779586883700,
"author_name": "Hehehehaw",
"timestamp": "12/12/2022 20:22:02",
"content": "Hey",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052032620554358900,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 20:22:02",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1052032618557874200,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1052032695099723800,
"author_id": 961429779586883700,
"author_name": "Hehehehaw",
"timestamp": "12/12/2022 20:22:20",
"content": "How u do number 10",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052032695573688400,
"author_id": 961429779586883700,
"author_name": "Hehehehaw",
"timestamp": "12/12/2022 20:22:20",
"content": "",
"attachments": [
{
"id": 1052032694634160300,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1052032694634160209/35245E08-C842-4A47-ACCB-B0DA650B98E6.jpg",
"fileName": "35245E08-C842-4A47-ACCB-B0DA650B98E6.jpg",
"fileSizeBytes": 4621193
}
],
"mentions": [],
"reference": null
},
{
"id": 1052033383393398800,
"author_id": 374795910032523260,
"author_name": "SWR",
"timestamp": "12/12/2022 20:25:04",
"content": "ratio maybe?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052033401361805300,
"author_id": 961429779586883700,
"author_name": "Hehehehaw",
"timestamp": "12/12/2022 20:25:08",
"content": "?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052033414414467200,
"author_id": 961429779586883700,
"author_name": "Hehehehaw",
"timestamp": "12/12/2022 20:25:11",
"content": "wdym",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052033446861623300,
"author_id": 961429779586883700,
"author_name": "Hehehehaw",
"timestamp": "12/12/2022 20:25:19",
"content": "no gotta find the value fo x",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052033467338211300,
"author_id": 961429779586883700,
"author_name": "Hehehehaw",
"timestamp": "12/12/2022 20:25:24",
"content": "how do u do 10",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052033503467937800,
"author_id": 374795910032523260,
"author_name": "SWR",
"timestamp": "12/12/2022 20:25:33",
"content": "Maybe by using ratios?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052033532572225500,
"author_id": 961429779586883700,
"author_name": "Hehehehaw",
"timestamp": "12/12/2022 20:25:40",
"content": "how",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052033536942686200,
"author_id": 961429779586883700,
"author_name": "Hehehehaw",
"timestamp": "12/12/2022 20:25:41",
"content": "show me",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052033592500428900,
"author_id": 961429779586883700,
"author_name": "Hehehehaw",
"timestamp": "12/12/2022 20:25:54",
"content": "i dont think we learned how to use ratios",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052033615611056100,
"author_id": 961429779586883700,
"author_name": "Hehehehaw",
"timestamp": "12/12/2022 20:25:59",
"content": "for this",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052033857001631700,
"author_id": 374795910032523260,
"author_name": "SWR",
"timestamp": "12/12/2022 20:26:57",
"content": "Oh it's not ratio",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052033871568445600,
"author_id": 374795910032523260,
"author_name": "SWR",
"timestamp": "12/12/2022 20:27:00",
"content": "It's average",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052033872428290200,
"author_id": 961429779586883700,
"author_name": "Hehehehaw",
"timestamp": "12/12/2022 20:27:01",
"content": "yep",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052033886160429200,
"author_id": 374795910032523260,
"author_name": "SWR",
"timestamp": "12/12/2022 20:27:04",
"content": "Just looked it up",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052033888580550700,
"author_id": 961429779586883700,
"author_name": "Hehehehaw",
"timestamp": "12/12/2022 20:27:04",
"content": "ye",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052033895828308000,
"author_id": 374795910032523260,
"author_name": "SWR",
"timestamp": "12/12/2022 20:27:06",
"content": "",
"attachments": [
{
"id": 1052033895492767700,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1052033895492767744/xmedian-trapezoid.png",
"fileName": "xmedian-trapezoid.png",
"fileSizeBytes": 34258
}
],
"mentions": [],
"reference": null
},
{
"id": 1052033911653417000,
"author_id": 961429779586883700,
"author_name": "Hehehehaw",
"timestamp": "12/12/2022 20:27:10",
"content": "ye",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052033955827822600,
"author_id": 961429779586883700,
"author_name": "Hehehehaw",
"timestamp": "12/12/2022 20:27:20",
"content": "so how do u do it?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052034004339146900,
"author_id": 961429779586883700,
"author_name": "Hehehehaw",
"timestamp": "12/12/2022 20:27:32",
"content": "formula?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052034059703947300,
"author_id": 374795910032523260,
"author_name": "SWR",
"timestamp": "12/12/2022 20:27:45",
"content": "This is the formula",
"attachments": [
{
"id": 1052034059313873000,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1052034059313872978/image.png",
"fileName": "image.png",
"fileSizeBytes": 4925
}
],
"mentions": [],
"reference": null
},
{
"id": 1052034078880313500,
"author_id": 961429779586883700,
"author_name": "Hehehehaw",
"timestamp": "12/12/2022 20:27:50",
"content": "ohh ok",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052034128293396500,
"author_id": 374795910032523260,
"author_name": "SWR",
"timestamp": "12/12/2022 20:28:02",
"content": "Length of middle is average of the big and small lengths",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052034156537856000,
"author_id": 961429779586883700,
"author_name": "Hehehehaw",
"timestamp": "12/12/2022 20:28:08",
"content": "doesnt work",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052034177798770700,
"author_id": 961429779586883700,
"author_name": "Hehehehaw",
"timestamp": "12/12/2022 20:28:13",
"content": "look try number 9",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052034187206602800,
"author_id": 374795910032523260,
"author_name": "SWR",
"timestamp": "12/12/2022 20:28:16",
"content": "okay cool",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052034201400123500,
"author_id": 961429779586883700,
"author_name": "Hehehehaw",
"timestamp": "12/12/2022 20:28:19",
"content": "i got 11 without using the formula",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052034270920704000,
"author_id": 374795910032523260,
"author_name": "SWR",
"timestamp": "12/12/2022 20:28:36",
"content": "and?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052034363753242600,
"author_id": 961429779586883700,
"author_name": "Hehehehaw",
"timestamp": "12/12/2022 20:28:58",
"content": "oh wait nvm",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052034385035149300,
"author_id": 961429779586883700,
"author_name": "Hehehehaw",
"timestamp": "12/12/2022 20:29:03",
"content": "alr thx",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052034416479838300,
"author_id": 961429779586883700,
"author_name": "Hehehehaw",
"timestamp": "12/12/2022 20:29:10",
"content": ".close",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052034419453608000,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 20:29:11",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
d6f7e12d3d2d49f4ab22d4c3286ab828
|
200,052 |
[
{
"id": 1052035148083888100,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 20:32:05",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052035623541809300,
"author_id": 350747850189176800,
"author_name": "GOODBYE!",
"timestamp": "12/12/2022 20:33:58",
"content": "https://i.gyazo.com/d535b2d4090a7d4522032d0da4ebba21.png",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052035627480264700,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 20:33:59",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1052035623541809300,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1052035657356284000,
"author_id": 350747850189176800,
"author_name": "GOODBYE!",
"timestamp": "12/12/2022 20:34:06",
"content": "need help on 3.",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052035742106398700,
"author_id": 350747850189176800,
"author_name": "GOODBYE!",
"timestamp": "12/12/2022 20:34:26",
"content": "I'm confused about the brackets ik its either B or C",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052035852966047700,
"author_id": 350747850189176800,
"author_name": "GOODBYE!",
"timestamp": "12/12/2022 20:34:53",
"content": "https://i.gyazo.com/ad3c7da498babec2094885a89fe3f969.png",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052036358862020600,
"author_id": 1039605654740009000,
"author_name": "niamake",
"timestamp": "12/12/2022 20:36:53",
"content": "if x=4/3 then y = 0",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052036479662166100,
"author_id": 1039605654740009000,
"author_name": "niamake",
"timestamp": "12/12/2022 20:37:22",
"content": "y''=0",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052036514378424300,
"author_id": 1039605654740009000,
"author_name": "niamake",
"timestamp": "12/12/2022 20:37:30",
"content": "but concaving down only occurs when y'' is negative",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052036551963578400,
"author_id": 350747850189176800,
"author_name": "GOODBYE!",
"timestamp": "12/12/2022 20:37:39",
"content": "4/3 is the inflection point",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052036579197202600,
"author_id": 1039605654740009000,
"author_name": "niamake",
"timestamp": "12/12/2022 20:37:46",
"content": "yes",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052036608087556100,
"author_id": 1039605654740009000,
"author_name": "niamake",
"timestamp": "12/12/2022 20:37:53",
"content": "but at that specific point is it concaving down",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052036724865380400,
"author_id": 350747850189176800,
"author_name": "GOODBYE!",
"timestamp": "12/12/2022 20:38:21",
"content": "its concave down between -infin and 4/3",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052036764723847300,
"author_id": 350747850189176800,
"author_name": "GOODBYE!",
"timestamp": "12/12/2022 20:38:30",
"content": "concave up between 4/3 and inf",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052036799788232700,
"author_id": 1039605654740009000,
"author_name": "niamake",
"timestamp": "12/12/2022 20:38:38",
"content": "ok thats ur answer",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052036858621722600,
"author_id": 350747850189176800,
"author_name": "GOODBYE!",
"timestamp": "12/12/2022 20:38:52",
"content": "yeah but what abt the brackets",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052036879995895900,
"author_id": 1039605654740009000,
"author_name": "niamake",
"timestamp": "12/12/2022 20:38:58",
"content": "do you know the definition of brackets?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052036936115691500,
"author_id": 1039605654740009000,
"author_name": "niamake",
"timestamp": "12/12/2022 20:39:11",
"content": "() means noninclusive and [] means inclusive",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052036986803867600,
"author_id": 1039605654740009000,
"author_name": "niamake",
"timestamp": "12/12/2022 20:39:23",
"content": "is 4/3 a point where ur function is concaving down?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052037162339672000,
"author_id": 350747850189176800,
"author_name": "GOODBYE!",
"timestamp": "12/12/2022 20:40:05",
"content": "At 4/3 its just 0 so its not concave down or up",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052037220577595400,
"author_id": 350747850189176800,
"author_name": "GOODBYE!",
"timestamp": "12/12/2022 20:40:19",
"content": "its just the inflection",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052037302089678800,
"author_id": 1039605654740009000,
"author_name": "niamake",
"timestamp": "12/12/2022 20:40:38",
"content": "ok",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052037316887191600,
"author_id": 1039605654740009000,
"author_name": "niamake",
"timestamp": "12/12/2022 20:40:42",
"content": "so we dont include 4/3",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052037437083353200,
"author_id": 1039605654740009000,
"author_name": "niamake",
"timestamp": "12/12/2022 20:41:10",
"content": "(0,1) we are not including 0 or 1",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052037666276905100,
"author_id": 1039605654740009000,
"author_name": "niamake",
"timestamp": "12/12/2022 20:42:05",
"content": "does this make sense or no",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052037720563781800,
"author_id": 1039605654740009000,
"author_name": "niamake",
"timestamp": "12/12/2022 20:42:18",
"content": "[] means we include the numbers next to the brackets",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052037737479405600,
"author_id": 1039605654740009000,
"author_name": "niamake",
"timestamp": "12/12/2022 20:42:22",
"content": "() means we dont include them",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052037898775572500,
"author_id": 350747850189176800,
"author_name": "GOODBYE!",
"timestamp": "12/12/2022 20:43:00",
"content": "kinda",
"attachments": [],
"mentions": [
{
"id": 1039605654740009000,
"name": "niamake",
"discriminator": "8174",
"nickname": "niamake",
"isBot": false
}
],
"reference": null
},
{
"id": 1052037934376828900,
"author_id": 350747850189176800,
"author_name": "GOODBYE!",
"timestamp": "12/12/2022 20:43:09",
"content": "is it just (-inf, 4/3)?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052037968958857200,
"author_id": 350747850189176800,
"author_name": "GOODBYE!",
"timestamp": "12/12/2022 20:43:17",
"content": "its B right",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052038053461512200,
"author_id": 350747850189176800,
"author_name": "GOODBYE!",
"timestamp": "12/12/2022 20:43:37",
"content": "we wouldnt include brackets for this",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052038252724506600,
"author_id": 1039605654740009000,
"author_name": "niamake",
"timestamp": "12/12/2022 20:44:25",
"content": "yes",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052038391086207000,
"author_id": 350747850189176800,
"author_name": "GOODBYE!",
"timestamp": "12/12/2022 20:44:58",
"content": "ty",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052038406424772700,
"author_id": 350747850189176800,
"author_name": "GOODBYE!",
"timestamp": "12/12/2022 20:45:02",
"content": ".close",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052038409201402000,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 20:45:02",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
132f2b04914c4ac5aa6750ef7fed8fed
|
200,053 |
[
{
"id": 1052038662721896400,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 20:46:03",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052042640243306500,
"author_id": 750051018812817400,
"author_name": "InjuredCave5886",
"timestamp": "12/12/2022 21:01:51",
"content": "",
"attachments": [
{
"id": 1052042639941304300,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1052042639941304340/image.png",
"fileName": "image.png",
"fileSizeBytes": 133464
}
],
"mentions": [],
"reference": null
},
{
"id": 1052042642646634500,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 21:01:52",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1052042640243306500,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1052042687609573500,
"author_id": 750051018812817400,
"author_name": "InjuredCave5886",
"timestamp": "12/12/2022 21:02:02",
"content": "it sent my last one to hidden not sure why",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052045973238579200,
"author_id": 750051018812817400,
"author_name": "InjuredCave5886",
"timestamp": "12/12/2022 21:15:06",
"content": "@Helpers",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052049748942672000,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 21:30:06",
"content": "@InjuredCave5886 Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 750051018812817400,
"name": "InjuredCave5886",
"discriminator": "2598",
"nickname": "InjuredCave5886",
"isBot": false
}
],
"reference": null
},
{
"id": 1052058549041238100,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 22:05:04",
"content": "@InjuredCave5886 Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 750051018812817400,
"name": "InjuredCave5886",
"discriminator": "2598",
"nickname": "InjuredCave5886",
"isBot": false
}
],
"reference": null
},
{
"id": 1052067659291840500,
"author_id": 785280792036507600,
"author_name": "vfio",
"timestamp": "12/12/2022 22:41:16",
"content": "we can't actually see that picture Mister",
"attachments": [],
"mentions": [
{
"id": 750051018812817400,
"name": "InjuredCave5886",
"discriminator": "2598",
"nickname": "InjuredCave5886",
"isBot": false
}
],
"reference": null
},
{
"id": 1052074620385230800,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 23:08:56",
"content": "@InjuredCave5886 Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 750051018812817400,
"name": "InjuredCave5886",
"discriminator": "2598",
"nickname": "InjuredCave5886",
"isBot": false
}
],
"reference": null
},
{
"id": 1052074979946139600,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 23:10:21",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
5b9c138536d149f4810c690b4d9a1823
|
200,054 |
[
{
"id": 1034491000187531400,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "10/25/2022 11:37:54",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034493308577271900,
"author_id": 754314797679640600,
"author_name": "Berlin is my hero",
"timestamp": "10/25/2022 11:47:04",
"content": "Hello, I am stuck on part (c) of this question.",
"attachments": [
{
"id": 1034493308233322500,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1034493308233322557/unknown.png",
"fileName": "unknown.png",
"fileSizeBytes": 226803
}
],
"mentions": [],
"reference": null
},
{
"id": 1034493310884130800,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "10/25/2022 11:47:05",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1034493308577271900,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1034495121766490100,
"author_id": 600510288067952600,
"author_name": "GarlicBredFries",
"timestamp": "10/25/2022 11:54:17",
"content": "Add 6 to both sides",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034495239114735600,
"author_id": 600510288067952600,
"author_name": "GarlicBredFries",
"timestamp": "10/25/2022 11:54:44",
"content": "Then break into a system of equations where\ny=the parabola and\ny=x-1",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034497086474944600,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "10/25/2022 12:02:05",
"content": "@Berlin is my hero Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 754314797679640600,
"name": "Berlin is my hero",
"discriminator": "5830",
"nickname": "Berlin is my hero",
"isBot": false
}
],
"reference": null
},
{
"id": 1034497236576501900,
"author_id": 754314797679640600,
"author_name": "Berlin is my hero",
"timestamp": "10/25/2022 12:02:41",
"content": "Add 6 to both sides where?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034497274891485300,
"author_id": 754314797679640600,
"author_name": "Berlin is my hero",
"timestamp": "10/25/2022 12:02:50",
"content": "Which equation",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034498961068793900,
"author_id": 754314797679640600,
"author_name": "Berlin is my hero",
"timestamp": "10/25/2022 12:09:32",
"content": "Oh never mind i get it nolw",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034498982329712800,
"author_id": 754314797679640600,
"author_name": "Berlin is my hero",
"timestamp": "10/25/2022 12:09:37",
"content": "thank you",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1034506533171642400,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "10/25/2022 12:39:37",
"content": "@Berlin is my hero Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 754314797679640600,
"name": "Berlin is my hero",
"discriminator": "5830",
"nickname": "Berlin is my hero",
"isBot": false
}
],
"reference": null
},
{
"id": 1034507046025969700,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "10/25/2022 12:41:39",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
507f825e6ae6468eb8f6e791dc318b6a
|
200,055 |
[
{
"id": 1052075012506529900,
"author_id": 750051018812817400,
"author_name": "InjuredCave5886",
"timestamp": "12/12/2022 23:10:29",
"content": "my b",
"attachments": [],
"mentions": [
{
"id": 785280792036507600,
"name": "vfio",
"discriminator": "5808",
"nickname": "vfio",
"isBot": false
}
],
"reference": null
},
{
"id": 1052075233693139100,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 23:11:22",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052077138645356500,
"author_id": 531780884882391040,
"author_name": "dzadzo",
"timestamp": "12/12/2022 23:18:56",
"content": "",
"attachments": [
{
"id": 1052077138381127800,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1052077138381127820/IMG_20221213_081831.jpg",
"fileName": "IMG_20221213_081831.jpg",
"fileSizeBytes": 617144
}
],
"mentions": [],
"reference": null
},
{
"id": 1052077141447147600,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 23:18:57",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1052077138645356500,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1052077168781426800,
"author_id": 531780884882391040,
"author_name": "dzadzo",
"timestamp": "12/12/2022 23:19:03",
"content": "why is o1ao2",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052077181980913700,
"author_id": 531780884882391040,
"author_name": "dzadzo",
"timestamp": "12/12/2022 23:19:06",
"content": "90 degress",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052077197122338800,
"author_id": 531780884882391040,
"author_name": "dzadzo",
"timestamp": "12/12/2022 23:19:10",
"content": "?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052077257738432600,
"author_id": 244806629839732740,
"author_name": "~Martin",
"timestamp": "12/12/2022 23:19:24",
"content": "doesn't have to",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052077388361629700,
"author_id": 531780884882391040,
"author_name": "dzadzo",
"timestamp": "12/12/2022 23:19:56",
"content": "",
"attachments": [
{
"id": 1052077388063850500,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1052077388063850516/nfpb9.png",
"fileName": "nfpb9.png",
"fileSizeBytes": 17491
}
],
"mentions": [],
"reference": null
},
{
"id": 1052077393214459900,
"author_id": 531780884882391040,
"author_name": "dzadzo",
"timestamp": "12/12/2022 23:19:57",
"content": "it has to",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052077456200323200,
"author_id": 531780884882391040,
"author_name": "dzadzo",
"timestamp": "12/12/2022 23:20:12",
"content": "i forgot the proof",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052077477842915300,
"author_id": 490649542077841400,
"author_name": "tatpoj",
"timestamp": "12/12/2022 23:20:17",
"content": "In general, it isn't",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052077522919100400,
"author_id": 490649542077841400,
"author_name": "tatpoj",
"timestamp": "12/12/2022 23:20:28",
"content": "Unless there's more information missing",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052077813794078800,
"author_id": 244806629839732740,
"author_name": "~Martin",
"timestamp": "12/12/2022 23:21:37",
"content": "this would be an easy counter example",
"attachments": [
{
"id": 1052077813504676000,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1052077813504675922/image.png",
"fileName": "image.png",
"fileSizeBytes": 25851
}
],
"mentions": [],
"reference": null
},
{
"id": 1052078789468897300,
"author_id": 490649542077841400,
"author_name": "tatpoj",
"timestamp": "12/12/2022 23:25:30",
"content": "This is true if and only if the line containing each circle's radius is tangent to the other circle",
"attachments": [],
"mentions": [
{
"id": 531780884882391040,
"name": "dzadzo",
"discriminator": "6646",
"nickname": "dzadzo",
"isBot": false
}
],
"reference": null
},
{
"id": 1052081232260890800,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 23:35:12",
"content": "@dzadzo Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 531780884882391040,
"name": "dzadzo",
"discriminator": "6646",
"nickname": "dzadzo",
"isBot": false
}
],
"reference": null
},
{
"id": 1052085009135181800,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 23:50:12",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
c03641d6bdc64659a102b26b520fb3b4
|
200,056 |
[
{
"id": 1052085261175099400,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 23:51:13",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052085591518482400,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/12/2022 23:52:31",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1052085588037206000,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1052087577483681900,
"author_id": 496409778822709250,
"author_name": "Bestower",
"timestamp": "12/13/2022 00:00:25",
"content": "which question",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052087598312603600,
"author_id": 496409778822709250,
"author_name": "Bestower",
"timestamp": "12/13/2022 00:00:30",
"content": "and what have you tried for it",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052087617035976800,
"author_id": 496409778822709250,
"author_name": "Bestower",
"timestamp": "12/13/2022 00:00:34",
"content": "what do you know to do",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052087701567971300,
"author_id": 496409778822709250,
"author_name": "Bestower",
"timestamp": "12/13/2022 00:00:54",
"content": "\"h e l p\" and and then an entire document is not a question nor does it show any effort from your part",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052087826004582500,
"author_id": 425428815058173950,
"author_name": "King_Darius",
"timestamp": "12/13/2022 00:01:24",
"content": "owned",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052089167384948700,
"author_id": 425428815058173950,
"author_name": "King_Darius",
"timestamp": "12/13/2022 00:06:44",
"content": "h e l p",
"attachments": [
{
"id": 1052089167095550100,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1052089167095550042/image.png",
"fileName": "image.png",
"fileSizeBytes": 4537
}
],
"mentions": [],
"reference": null
},
{
"id": 1052089429784805500,
"author_id": 989056739448066000,
"author_name": "ebony",
"timestamp": "12/13/2022 00:07:46",
"content": "https://tenor.com/view/barf-vomit-puke-eww-gross-gif-14651615",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052089578519011500,
"author_id": 425428815058173950,
"author_name": "King_Darius",
"timestamp": "12/13/2022 00:08:22",
"content": ":glassescat:",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052089628221522000,
"author_id": 989056739448066000,
"author_name": "ebony",
"timestamp": "12/13/2022 00:08:34",
"content": "https://media.discordapp.net/attachments/917915644538802216/976113547375427594/fat.gif",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052090887489998800,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/13/2022 00:13:34",
"content": "@HLACEPOLDER Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 721786797885227000,
"name": "HLACEPOLDER",
"discriminator": "5631",
"nickname": "HLACEPOLDER",
"isBot": false
}
],
"reference": null
},
{
"id": 1052094664381059100,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/13/2022 00:28:34",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
74db6b9fc74045d1b3de4e818102821b
|
200,057 |
[
{
"id": 1052104774574678100,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/13/2022 01:08:45",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052105204587315300,
"author_id": 968350938974789600,
"author_name": "𝓣𝓻𝓲𝔁𝓲𝓮🤍",
"timestamp": "12/13/2022 01:10:27",
"content": "@Helpers",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052105206797701100,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/13/2022 01:10:28",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1052105204587315300,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1052105257439744000,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/13/2022 01:10:40",
"content": "dont ping helpers immediately",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052105291619106800,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/13/2022 01:10:48",
"content": "it",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052105298074161300,
"author_id": 785280792036507600,
"author_name": "vfio",
"timestamp": "12/13/2022 01:10:50",
"content": "can you please not open the channel this way",
"attachments": [
{
"id": 1052105297675690000,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1052105297675690026/image.png",
"fileName": "image.png",
"fileSizeBytes": 12558
}
],
"mentions": [
{
"id": 968350938974789600,
"name": "𝓣𝓻𝓲𝔁𝓲𝓮🤍",
"discriminator": "8086",
"nickname": "𝓣𝓻𝓲𝔁𝓲𝓮🤍",
"isBot": false
}
],
"reference": null
},
{
"id": 1052105301379272700,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/13/2022 01:10:51",
"content": "shit i just pinged",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052105361575907500,
"author_id": 968350938974789600,
"author_name": "𝓣𝓻𝓲𝔁𝓲𝓮🤍",
"timestamp": "12/13/2022 01:11:05",
"content": "For #5 I got 26pd , is this correct and sorry",
"attachments": [
{
"id": 1052105361139707900,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1052105361139707954/IMG_2236.jpg",
"fileName": "IMG_2236.jpg",
"fileSizeBytes": 2924096
}
],
"mentions": [],
"reference": null
},
{
"id": 1052105500247990400,
"author_id": 785280792036507600,
"author_name": "vfio",
"timestamp": "12/13/2022 01:11:38",
"content": "are you sorry though, you keep doing this and you were already instructed(probably multiple times) don't do something you'll be sorry about?",
"attachments": [],
"mentions": [
{
"id": 968350938974789600,
"name": "𝓣𝓻𝓲𝔁𝓲𝓮🤍",
"discriminator": "8086",
"nickname": "𝓣𝓻𝓲𝔁𝓲𝓮🤍",
"isBot": false
}
],
"reference": null
},
{
"id": 1052105550072131600,
"author_id": 968350938974789600,
"author_name": "𝓣𝓻𝓲𝔁𝓲𝓮🤍",
"timestamp": "12/13/2022 01:11:50",
"content": "I don’t understand what you guys mean",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052105583517511700,
"author_id": 968350938974789600,
"author_name": "𝓣𝓻𝓲𝔁𝓲𝓮🤍",
"timestamp": "12/13/2022 01:11:58",
"content": "Like do I send a picture then wait 15 min?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052105648600522800,
"author_id": 968350938974789600,
"author_name": "𝓣𝓻𝓲𝔁𝓲𝓮🤍",
"timestamp": "12/13/2022 01:12:13",
"content": "Or do I sit here for 15 min when it’s been 2 hours since I last asked a question",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052105735623938000,
"author_id": 785280792036507600,
"author_name": "vfio",
"timestamp": "12/13/2022 01:12:34",
"content": "you can just post your picture yes, then you are supposed to wait. it's double bad in your case, because you ping before you even post the question which is ridiculous",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052105806092439600,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/13/2022 01:12:51",
"content": "yes yo udo exactly that",
"attachments": [],
"mentions": [
{
"id": 968350938974789600,
"name": "𝓣𝓻𝓲𝔁𝓲𝓮🤍",
"discriminator": "8086",
"nickname": "𝓣𝓻𝓲𝔁𝓲𝓮🤍",
"isBot": false
}
],
"reference": null
},
{
"id": 1052105824673222800,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/13/2022 01:12:55",
"content": "you sent your question explain what you have tried",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052105839630090200,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/13/2022 01:12:59",
"content": "and what you're conufsed about",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052105850237485000,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/13/2022 01:13:01",
"content": "then you wait 15 minutes",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052105885457076200,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/13/2022 01:13:10",
"content": "usually someone replies in that time",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052105918298456000,
"author_id": 968350938974789600,
"author_name": "𝓣𝓻𝓲𝔁𝓲𝓮🤍",
"timestamp": "12/13/2022 01:13:18",
"content": "Alright then I’ll do that , I didn’t know if I was supposed to first ask for help THEN post it",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052105930520657900,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/13/2022 01:13:21",
"content": "because your questions aren't super advanced mathematics",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052105971880706000,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/13/2022 01:13:30",
"content": "no you post first",
"attachments": [],
"mentions": [
{
"id": 968350938974789600,
"name": "𝓣𝓻𝓲𝔁𝓲𝓮🤍",
"discriminator": "8086",
"nickname": "𝓣𝓻𝓲𝔁𝓲𝓮🤍",
"isBot": false
}
],
"reference": null
},
{
"id": 1052105987672252400,
"author_id": 785280792036507600,
"author_name": "vfio",
"timestamp": "12/13/2022 01:13:34",
"content": "what I will do is come back here in 15 minutes",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052106006013952000,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/13/2022 01:13:39",
"content": "it literally says here",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052106011982434300,
"author_id": 785280792036507600,
"author_name": "vfio",
"timestamp": "12/13/2022 01:13:40",
"content": "unless someone else makes an exception",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052106016571007000,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/13/2022 01:13:41",
"content": "",
"attachments": [
{
"id": 1052106016294191100,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1052106016294191144/Screen_Shot_2022-12-13_at_5.13.34_pm.png",
"fileName": "Screen_Shot_2022-12-13_at_5.13.34_pm.png",
"fileSizeBytes": 119645
}
],
"mentions": [],
"reference": null
},
{
"id": 1052106639647457400,
"author_id": 968350938974789600,
"author_name": "𝓣𝓻𝓲𝔁𝓲𝓮🤍",
"timestamp": "12/13/2022 01:16:10",
"content": "@Helpers",
"attachments": [
{
"id": 1052106639341260800,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1052106639341260820/v09044g40000cdp05src77udl9c0ddqg.mp4",
"fileName": "v09044g40000cdp05src77udl9c0ddqg.mp4",
"fileSizeBytes": 501017
}
],
"mentions": [],
"reference": null
},
{
"id": 1052106728600256500,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/13/2022 01:16:31",
"content": "bro just ban this person",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052106888768139300,
"author_id": 968350938974789600,
"author_name": "𝓣𝓻𝓲𝔁𝓲𝓮🤍",
"timestamp": "12/13/2022 01:17:09",
"content": "Please do special “Ed”",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052106962315264000,
"author_id": 785280792036507600,
"author_name": "vfio",
"timestamp": "12/13/2022 01:17:27",
"content": "don't abuse this ping",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052107038118903800,
"author_id": 785280792036507600,
"author_name": "vfio",
"timestamp": "12/13/2022 01:17:45",
"content": "it's not funny",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052107412678639600,
"author_id": 310599340961955840,
"author_name": "ed",
"timestamp": "12/13/2022 01:19:14",
"content": "who's the special one",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052110667752157200,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/13/2022 01:32:10",
"content": "@𝓣𝓻𝓲𝔁𝓲𝓮🤍 Has your question been resolved?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052114444714528900,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/13/2022 01:47:10",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
18e40fc179ef478cadfd5764103e5ff2
|
200,058 |
[
{
"id": 1052114696959967200,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/13/2022 01:48:11",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052115923756126200,
"author_id": 766676782770159600,
"author_name": "neida",
"timestamp": "12/13/2022 01:53:03",
"content": "Yeah I'm hi this",
"attachments": [
{
"id": 1052115923533844500,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1052115923533844480/IMG_20221210_164314__01.jpg",
"fileName": "IMG_20221210_164314__01.jpg",
"fileSizeBytes": 303644
}
],
"mentions": [],
"reference": null
},
{
"id": 1052115926595665900,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/13/2022 01:53:04",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1052115923756126200,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1052116504570761200,
"author_id": 766676782770159600,
"author_name": "neida",
"timestamp": "12/13/2022 01:55:22",
"content": "I just don't understand the whole thing like I've been sick so many times at school so I'm struggling sm",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052116547755315200,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/13/2022 01:55:32",
"content": "Ok this is an optimization problem",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052116839322374100,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/13/2022 01:56:41",
"content": "The problem wants you to maximize area while you have a set perimeter",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052116902249496600,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/13/2022 01:56:56",
"content": "Perimeter is 100m",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052116971388407800,
"author_id": 766676782770159600,
"author_name": "neida",
"timestamp": "12/13/2022 01:57:13",
"content": "Is perimeter like the maximum of m then",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052117025566240800,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/13/2022 01:57:26",
"content": "What's m?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052117040745422800,
"author_id": 766676782770159600,
"author_name": "neida",
"timestamp": "12/13/2022 01:57:29",
"content": "Meter",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052117054624374800,
"author_id": 766676782770159600,
"author_name": "neida",
"timestamp": "12/13/2022 01:57:33",
"content": "Like 100m",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052117065361797100,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/13/2022 01:57:35",
"content": "Yep",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052117078439637000,
"author_id": 766676782770159600,
"author_name": "neida",
"timestamp": "12/13/2022 01:57:38",
"content": "Ok ok",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052117105761333200,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/13/2022 01:57:45",
"content": "Maximum amount that the farmer can afford",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052117196983246800,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/13/2022 01:58:07",
"content": "And he wants maximum area",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052117273797722100,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/13/2022 01:58:25",
"content": "What is the area of the rectangle in the plan?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052117347881734100,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/13/2022 01:58:43",
"content": "In terms of x?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052117382967079000,
"author_id": 766676782770159600,
"author_name": "neida",
"timestamp": "12/13/2022 01:58:51",
"content": "2x 2y",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052117392618180600,
"author_id": 766676782770159600,
"author_name": "neida",
"timestamp": "12/13/2022 01:58:53",
"content": "Smt like that",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052117461132128300,
"author_id": 766676782770159600,
"author_name": "neida",
"timestamp": "12/13/2022 01:59:10",
"content": "Bc like 2 sides with x and 2 sides with y",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052121187351806000,
"author_id": 766676782770159600,
"author_name": "neida",
"timestamp": "12/13/2022 02:13:58",
"content": "🤷♀️",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052124963022327800,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/13/2022 02:28:58",
"content": "@neida Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 766676782770159600,
"name": "neida",
"discriminator": "2007",
"nickname": "neida",
"isBot": false
}
],
"reference": null
},
{
"id": 1052127638975676400,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/13/2022 02:39:36",
"content": "Sorry for going dead",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052127656142970900,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/13/2022 02:39:40",
"content": "My data ran out",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052127674870538200,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/13/2022 02:39:45",
"content": "Anyways",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052127709687468000,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/13/2022 02:39:53",
"content": "Your area is x(50-x)",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052127774212620300,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/13/2022 02:40:08",
"content": "@neida",
"attachments": [],
"mentions": [
{
"id": 766676782770159600,
"name": "neida",
"discriminator": "2007",
"nickname": "neida",
"isBot": false
}
],
"reference": null
},
{
"id": 1052128740307644400,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/13/2022 02:43:59",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
f5c3b3e35f074486aacd340ce2482a8d
|
200,059 |
[
{
"id": 1052128993270304800,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/13/2022 02:44:59",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052130515282563200,
"author_id": 825892892685893600,
"author_name": "...1",
"timestamp": "12/13/2022 02:51:02",
"content": "",
"attachments": [
{
"id": 1052130515093823500,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1052130515093823508/IMG_0118.jpg",
"fileName": "IMG_0118.jpg",
"fileSizeBytes": 503956
}
],
"mentions": [],
"reference": null
},
{
"id": 1052130517446828000,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/13/2022 02:51:02",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1052130515282563200,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1052130527844511700,
"author_id": 825892892685893600,
"author_name": "...1",
"timestamp": "12/13/2022 02:51:05",
"content": "I know the answer is yes but",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052130543115976700,
"author_id": 825892892685893600,
"author_name": "...1",
"timestamp": "12/13/2022 02:51:09",
"content": "how do I prove that",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052132101257961500,
"author_id": 761155030513352700,
"author_name": "Bungo",
"timestamp": "12/13/2022 02:57:20",
"content": "i'm guessing this is in the context of using a vertical line test?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052132268744908800,
"author_id": 761155030513352700,
"author_name": "Bungo",
"timestamp": "12/13/2022 02:58:00",
"content": "i mean \"f(x) = [anything], x in R\" is a function ,more or less by definition",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052132649755480000,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "12/13/2022 02:59:31",
"content": "I actually have been thinking about how to do it without vertical test shenanigans",
"attachments": [],
"mentions": [
{
"id": 761155030513352700,
"name": "Bungo",
"discriminator": "8186",
"nickname": "Bungo",
"isBot": false
}
],
"reference": null
},
{
"id": 1052132826570559600,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "12/13/2022 03:00:13",
"content": "Like clearly something like f(x) = ±x isn't a function, but is it enough to just pick a few points for which it seems like it is a function, in this case?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052132933328187400,
"author_id": 761155030513352700,
"author_name": "Bungo",
"timestamp": "12/13/2022 03:00:38",
"content": "yeah i mean it's unambiguously assigning one output to each input x",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052133047065124900,
"author_id": 761155030513352700,
"author_name": "Bungo",
"timestamp": "12/13/2022 03:01:06",
"content": "the only pedantic detail is that the codomain is not specified, which is technically part of the definition of a function",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052133079604547600,
"author_id": 761155030513352700,
"author_name": "Bungo",
"timestamp": "12/13/2022 03:01:13",
"content": "but i'm guessing they brush over that at this level",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052133132515676200,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "12/13/2022 03:01:26",
"content": "I am just assuming it is f: R -> R",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052133150698000400,
"author_id": 761155030513352700,
"author_name": "Bungo",
"timestamp": "12/13/2022 03:01:30",
"content": "yea",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052133187809194000,
"author_id": 761155030513352700,
"author_name": "Bungo",
"timestamp": "12/13/2022 03:01:39",
"content": "any set containing [0,infinity) works fine as a codomain",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052133276615200800,
"author_id": 761155030513352700,
"author_name": "Bungo",
"timestamp": "12/13/2022 03:02:00",
"content": "if you want to be cheeky you could say it's f : R -> C",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052133420517560300,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "12/13/2022 03:02:35",
"content": "Lmao what",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052133484220653600,
"author_id": 761155030513352700,
"author_name": "Bungo",
"timestamp": "12/13/2022 03:02:50",
"content": "simply because R is a subset of C",
"attachments": [],
"mentions": [
{
"id": 1022141568737607800,
"name": "♡A(lex)♡",
"discriminator": "5050",
"nickname": "♡A(lex)♡",
"isBot": false
}
],
"reference": null
},
{
"id": 1052133491124473900,
"author_id": 984319941417251000,
"author_name": "💜𝓁𝒶𝓎𝓁𝒶💜",
"timestamp": "12/13/2022 03:02:51",
"content": "f : R -> (R union anything you like)",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052133575400628200,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "12/13/2022 03:03:12",
"content": "Oh yeah I totally forgot about that",
"attachments": [],
"mentions": [
{
"id": 761155030513352700,
"name": "Bungo",
"discriminator": "8186",
"nickname": "Bungo",
"isBot": false
}
],
"reference": null
},
{
"id": 1052134834677485600,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/13/2022 03:08:12",
"content": "@...1 Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 825892892685893600,
"name": "...1",
"discriminator": "3209",
"nickname": "...1",
"isBot": false
}
],
"reference": null
},
{
"id": 1052138611434328200,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/13/2022 03:23:12",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
22521778a7ea48e3a8a796d053c40be8
|
200,060 |
[
{
"id": 1052138863491035100,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/13/2022 03:24:12",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052139771171975200,
"author_id": 873459676711383000,
"author_name": "Belle_âme",
"timestamp": "12/13/2022 03:27:49",
"content": "hello I have to diagonalize a matrix and the answer is like this",
"attachments": [
{
"id": 1052139770878369800,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1052139770878369802/Screenshot_2022-12-13_at_16.26.07.png",
"fileName": "Screenshot_2022-12-13_at_16.26.07.png",
"fileSizeBytes": 4528
}
],
"mentions": [],
"reference": null
},
{
"id": 1052139773655003100,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/13/2022 03:27:49",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1052139771171975200,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1052139873374576600,
"author_id": 873459676711383000,
"author_name": "Belle_âme",
"timestamp": "12/13/2022 03:28:13",
"content": "and I got this, is it correct?",
"attachments": [
{
"id": 1052139873043234800,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1052139873043234856/Screenshot_2022-12-13_at_16.26.44.png",
"fileName": "Screenshot_2022-12-13_at_16.26.44.png",
"fileSizeBytes": 3961
}
],
"mentions": [],
"reference": null
},
{
"id": 1052141340210774000,
"author_id": 788085606483361800,
"author_name": "chartbit",
"timestamp": "12/13/2022 03:34:03",
"content": "Sooo you basically found the same eigenvalues then?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052141536449679400,
"author_id": 873459676711383000,
"author_name": "Belle_âme",
"timestamp": "12/13/2022 03:34:50",
"content": "does the column arrangement have to be the same?",
"attachments": [],
"mentions": [
{
"id": 788085606483361800,
"name": "chartbit",
"discriminator": "3171",
"nickname": "chartbit",
"isBot": false
}
],
"reference": null
},
{
"id": 1052141751835570200,
"author_id": 873459676711383000,
"author_name": "Belle_âme",
"timestamp": "12/13/2022 03:35:41",
"content": "because I can get 3 same vector but in different order ( the column)",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052141797939351600,
"author_id": 788085606483361800,
"author_name": "chartbit",
"timestamp": "12/13/2022 03:35:52",
"content": "Not really I don’t think so",
"attachments": [],
"mentions": [
{
"id": 873459676711383000,
"name": "Belle_âme",
"discriminator": "0573",
"nickname": "Belle_âme",
"isBot": false
}
],
"reference": null
},
{
"id": 1052141956203020300,
"author_id": 788085606483361800,
"author_name": "chartbit",
"timestamp": "12/13/2022 03:36:30",
"content": "As long as your “eigenvector matrix” is in the same order as your eigenvales, if you get what I mean?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052142080924844000,
"author_id": 873459676711383000,
"author_name": "Belle_âme",
"timestamp": "12/13/2022 03:36:59",
"content": "yes I get",
"attachments": [],
"mentions": [
{
"id": 788085606483361800,
"name": "chartbit",
"discriminator": "3171",
"nickname": "chartbit",
"isBot": false
}
],
"reference": null
},
{
"id": 1052142195748110300,
"author_id": 788085606483361800,
"author_name": "chartbit",
"timestamp": "12/13/2022 03:37:27",
"content": "",
"attachments": [
{
"id": 1052142195546804400,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1052142195546804314/image0.jpg",
"fileName": "image0.jpg",
"fileSizeBytes": 52809
}
],
"mentions": [],
"reference": null
},
{
"id": 1052142309380194300,
"author_id": 788085606483361800,
"author_name": "chartbit",
"timestamp": "12/13/2022 03:37:54",
"content": "You basically have a permutation of the entries no?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052142453676847100,
"author_id": 873459676711383000,
"author_name": "Belle_âme",
"timestamp": "12/13/2022 03:38:28",
"content": "3",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052142964404662300,
"author_id": 788085606483361800,
"author_name": "chartbit",
"timestamp": "12/13/2022 03:40:30",
"content": "Yeah then as long as the first two cols of yours corresponds to the ones you get from -1 (in either order) , and the last one corresponds to the 2",
"attachments": [],
"mentions": [
{
"id": 873459676711383000,
"name": "Belle_âme",
"discriminator": "0573",
"nickname": "Belle_âme",
"isBot": false
}
],
"reference": null
},
{
"id": 1052143021312966700,
"author_id": 788085606483361800,
"author_name": "chartbit",
"timestamp": "12/13/2022 03:40:44",
"content": "Then you’re basically fine",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052143129635065900,
"author_id": 873459676711383000,
"author_name": "Belle_âme",
"timestamp": "12/13/2022 03:41:09",
"content": "oh I see I put the one with 2 first",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052143210052468900,
"author_id": 873459676711383000,
"author_name": "Belle_âme",
"timestamp": "12/13/2022 03:41:29",
"content": "I think I got it thank you so much",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052143228306067500,
"author_id": 873459676711383000,
"author_name": "Belle_âme",
"timestamp": "12/13/2022 03:41:33",
"content": ".close",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052143231648931800,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/13/2022 03:41:34",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
0c005e7f3342406296ddd3339823d8c7
|
200,061 |
[
{
"id": 1052143482950656000,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/13/2022 03:42:34",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052146677642973200,
"author_id": 400294833677402100,
"author_name": "Cephy",
"timestamp": "12/13/2022 03:55:15",
"content": "Show an example involving two different transformations where the order will not affect the final function",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052146680335695900,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/13/2022 03:55:16",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1052146677642973200,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1052148530581614600,
"author_id": 400294833677402100,
"author_name": "Cephy",
"timestamp": "12/13/2022 04:02:37",
"content": ".close i figured it out thank you",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052148533177876500,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/13/2022 04:02:38",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
aa47ced394434b699d19caa7c6ce38ce
|
200,062 |
[
{
"id": 1052172578086731800,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/13/2022 05:38:11",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052176735162081400,
"author_id": 422851207850229760,
"author_name": "sheerwood",
"timestamp": "12/13/2022 05:54:42",
"content": "what is the exponential form of this complex number please:",
"attachments": [
{
"id": 1052176734847500300,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1052176734847500288/image.png",
"fileName": "image.png",
"fileSizeBytes": 2433
}
],
"mentions": [],
"reference": null
},
{
"id": 1052176739356389500,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/13/2022 05:54:43",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1052176735162081400,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1052176815839522800,
"author_id": 422851207850229760,
"author_name": "sheerwood",
"timestamp": "12/13/2022 05:55:01",
"content": "i tried to take 1 from other side and multiply by -1",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052176836051873800,
"author_id": 422851207850229760,
"author_name": "sheerwood",
"timestamp": "12/13/2022 05:55:06",
"content": "and this did not give me any result",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052177202239778800,
"author_id": 348696743388381200,
"author_name": "A Lonely Bean",
"timestamp": "12/13/2022 05:56:33",
"content": "Modulus of that is (1 + cos(theta))^2 + sin^2(theta), which can be simplified to 2(1 + cos(theta))",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052177423912939500,
"author_id": 348696743388381200,
"author_name": "A Lonely Bean",
"timestamp": "12/13/2022 05:57:26",
"content": "And the argument, as always, is arctan(-sin(theta)/(1 + cos(theta))); Not really sure on how to go about simplifying this though",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052180611965648900,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/13/2022 06:10:06",
"content": "@sheerwood Has your question been resolved?",
"attachments": [],
"mentions": [
{
"id": 422851207850229760,
"name": "sheerwood",
"discriminator": "0218",
"nickname": "sheerwood",
"isBot": false
}
],
"reference": null
},
{
"id": 1052184388647002200,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/13/2022 06:25:06",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
4c96ab551ba146afbcc71ed0601f3b9a
|
200,063 |
[
{
"id": 1052184640535933000,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/13/2022 06:26:06",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052188180289441800,
"author_id": 924879126693838800,
"author_name": "DarkSyde",
"timestamp": "12/13/2022 06:40:10",
"content": "Hi",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052188182424326100,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/13/2022 06:40:11",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1052188180289441800,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1052188274380247000,
"author_id": 924879126693838800,
"author_name": "DarkSyde",
"timestamp": "12/13/2022 06:40:33",
"content": "I'm struggling on a parabola for 5x^2-20x+15",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052188384094851100,
"author_id": 924879126693838800,
"author_name": "DarkSyde",
"timestamp": "12/13/2022 06:40:59",
"content": "Just uncertain if I need to calculate the x(0) coordinates by factorising?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052188721883131900,
"author_id": 826856329712500900,
"author_name": "Sparkle",
"timestamp": "12/13/2022 06:42:20",
"content": "depends on what u wanna do with the parabola",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052188898605928400,
"author_id": 924879126693838800,
"author_name": "DarkSyde",
"timestamp": "12/13/2022 06:43:02",
"content": "Need to get the axis of symmetry",
"attachments": [],
"mentions": [
{
"id": 826856329712500900,
"name": "Sparkle",
"discriminator": "5459",
"nickname": "Sparkle",
"isBot": false
}
],
"reference": null
},
{
"id": 1052189009574641700,
"author_id": 924879126693838800,
"author_name": "DarkSyde",
"timestamp": "12/13/2022 06:43:28",
"content": "Caus the only thing I'm confused on is if I need to factorise the expression to find the x(0) coords",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052189120555917300,
"author_id": 220517274845577200,
"author_name": "ramonov",
"timestamp": "12/13/2022 06:43:55",
"content": "wdym by x(0)",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052189170401038300,
"author_id": 924879126693838800,
"author_name": "DarkSyde",
"timestamp": "12/13/2022 06:44:06",
"content": "nvm solved it",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052189202047049700,
"author_id": 924879126693838800,
"author_name": "DarkSyde",
"timestamp": "12/13/2022 06:44:14",
"content": "thanks",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052189256644309000,
"author_id": 826856329712500900,
"author_name": "Sparkle",
"timestamp": "12/13/2022 06:44:27",
"content": "for that, calculate the x coordinate of the maxima or mininma",
"attachments": [],
"mentions": [
{
"id": 924879126693838800,
"name": "DarkSyde",
"discriminator": "1337",
"nickname": "DarkSyde",
"isBot": false
}
],
"reference": null
},
{
"id": 1052189306569117800,
"author_id": 826856329712500900,
"author_name": "Sparkle",
"timestamp": "12/13/2022 06:44:39",
"content": "okay great",
"attachments": [],
"mentions": [
{
"id": 924879126693838800,
"name": "DarkSyde",
"discriminator": "1337",
"nickname": "DarkSyde",
"isBot": false
}
],
"reference": null
},
{
"id": 1052189316148887600,
"author_id": 924879126693838800,
"author_name": "DarkSyde",
"timestamp": "12/13/2022 06:44:41",
"content": "Ah yeah that's what I meant by x(0)",
"attachments": [],
"mentions": [
{
"id": 826856329712500900,
"name": "Sparkle",
"discriminator": "5459",
"nickname": "Sparkle",
"isBot": false
}
],
"reference": null
},
{
"id": 1052189391482789900,
"author_id": 924879126693838800,
"author_name": "DarkSyde",
"timestamp": "12/13/2022 06:44:59",
"content": ".close",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052189394309742600,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/13/2022 06:45:00",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
3c31b290d4d34c60817cb79e0330851e
|
200,064 |
[
{
"id": 1052190707663773700,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/13/2022 06:50:13",
"content": "Available help channel!",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052197365970391000,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "12/13/2022 07:16:40",
"content": "Really quickly, but would something like\n\\[\n\\frac{x(x-1)(x-2)(x-3)...(x-n)}{x(x-1)(x-2)(x-3)...(x-n)}\n\\]\nBe ever defined in $x \\in \\mathbb{N}\\cup 0$?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052197368453402600,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/13/2022 07:16:41",
"content": "Pinned a message.",
"attachments": [],
"mentions": [],
"reference": {
"messageId": 1052197365970391000,
"channelId": 486844875632017400,
"guildId": null
}
},
{
"id": 1052197445460824000,
"author_id": 411882877933060100,
"author_name": "Ｈｅｒｅｌｓ",
"timestamp": "12/13/2022 07:16:59",
"content": "what is W ?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052197499407962100,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "12/13/2022 07:17:12",
"content": "Whole numbers",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052197673568043000,
"author_id": 411882877933060100,
"author_name": "Ｈｅｒｅｌｓ",
"timestamp": "12/13/2022 07:17:54",
"content": "weird way to write this set",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052197720246468600,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "12/13/2022 07:18:05",
"content": "It is the sign for it soo",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052197822482616400,
"author_id": 411882877933060100,
"author_name": "Ｈｅｒｅｌｓ",
"timestamp": "12/13/2022 07:18:29",
"content": "well its not defined on W",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052198005337505800,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "12/13/2022 07:19:13",
"content": "Actually",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052198060278698000,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/13/2022 07:19:26",
"content": "It goes to either 1 or indeterminate",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052198063374094300,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "12/13/2022 07:19:27",
"content": "**♡LexQa♡**",
"attachments": [
{
"id": 1052198063453777900,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1052198063453777960/1022141568737607750.png",
"fileName": "1022141568737607750.png",
"fileSizeBytes": 41454
}
],
"mentions": [],
"reference": null
},
{
"id": 1052198076422574100,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "12/13/2022 07:19:30",
"content": "There u go",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052198110308356100,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "12/13/2022 07:19:38",
"content": "Fixed 😎👍🏻",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052198207511343100,
"author_id": 411882877933060100,
"author_name": "Ｈｅｒｅｌｓ",
"timestamp": "12/13/2022 07:20:01",
"content": "its not defined",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052198286565593100,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "12/13/2022 07:20:20",
"content": "How is it 1?",
"attachments": [],
"mentions": [
{
"id": 1000057838007226500,
"name": "VulcanOne",
"discriminator": "5806",
"nickname": "VulcanOne",
"isBot": false
}
],
"reference": null
},
{
"id": 1052198361199038500,
"author_id": 411882877933060100,
"author_name": "Ｈｅｒｅｌｓ",
"timestamp": "12/13/2022 07:20:38",
"content": "you didnt say what values n can take",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052198394459852800,
"author_id": 811501664367673300,
"author_name": "SilverSoldier",
"timestamp": "12/13/2022 07:20:46",
"content": "if x=0, it doesnt make sense",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052198440211316900,
"author_id": 811501664367673300,
"author_name": "SilverSoldier",
"timestamp": "12/13/2022 07:20:57",
"content": "for all other x in the naturals it is 1",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052198446444073000,
"author_id": 411882877933060100,
"author_name": "Ｈｅｒｅｌｓ",
"timestamp": "12/13/2022 07:20:58",
"content": "its not 1, unless we are talking about limits",
"attachments": [],
"mentions": [
{
"id": 1022141568737607800,
"name": "♡A(lex)♡",
"discriminator": "5050",
"nickname": "♡A(lex)♡",
"isBot": false
}
],
"reference": null
},
{
"id": 1052198516065321000,
"author_id": 811501664367673300,
"author_name": "SilverSoldier",
"timestamp": "12/13/2022 07:21:15",
"content": "why is it not 1",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052198568238256100,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/13/2022 07:21:27",
"content": "If x is continuous, then it is",
"attachments": [],
"mentions": [
{
"id": 411882877933060100,
"name": "Ｈｅｒｅｌｓ",
"discriminator": "1420",
"nickname": "Ｈｅｒｅｌｓ",
"isBot": false
}
],
"reference": null
},
{
"id": 1052198581127348400,
"author_id": 745951784526282800,
"author_name": "dog.",
"timestamp": "12/13/2022 07:21:30",
"content": "1-1 = 0 😳",
"attachments": [],
"mentions": [
{
"id": 811501664367673300,
"name": "SilverSoldier",
"discriminator": "9635",
"nickname": "SilverSoldier",
"isBot": false
}
],
"reference": null
},
{
"id": 1052198592674279400,
"author_id": 411882877933060100,
"author_name": "Ｈｅｒｅｌｓ",
"timestamp": "12/13/2022 07:21:33",
"content": "x = 1, you have 0 on the denominator",
"attachments": [],
"mentions": [
{
"id": 811501664367673300,
"name": "SilverSoldier",
"discriminator": "9635",
"nickname": "SilverSoldier",
"isBot": false
}
],
"reference": null
},
{
"id": 1052198632482406400,
"author_id": 811501664367673300,
"author_name": "SilverSoldier",
"timestamp": "12/13/2022 07:21:42",
"content": "aah i get it",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052198711943508100,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/13/2022 07:22:01",
"content": "Between the whole numbers, it is 1.",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052198785557729300,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/13/2022 07:22:19",
"content": "On the whole numbers, it is indeterminate",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052198917204361200,
"author_id": 811501664367673300,
"author_name": "SilverSoldier",
"timestamp": "12/13/2022 07:22:50",
"content": "so basically this is always undefined for x < n in the naturals?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052199045222891500,
"author_id": 411882877933060100,
"author_name": "Ｈｅｒｅｌｓ",
"timestamp": "12/13/2022 07:23:21",
"content": "its called continuity extension or idk",
"attachments": [],
"mentions": [
{
"id": 1000057838007226500,
"name": "VulcanOne",
"discriminator": "5806",
"nickname": "VulcanOne",
"isBot": false
}
],
"reference": null
},
{
"id": 1052199082803867800,
"author_id": 411882877933060100,
"author_name": "Ｈｅｒｅｌｓ",
"timestamp": "12/13/2022 07:23:30",
"content": "but its still not defined",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052199104895258600,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "12/13/2022 07:23:35",
"content": "Random but how would you say that two things belong to the same set? Like if I were to say\n\\[x, n \\in \\mathbb{W}\\]",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052199115657855000,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "12/13/2022 07:23:38",
"content": "**♡LexQa♡**",
"attachments": [
{
"id": 1052199115750125700,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1052199115750125688/1022141568737607750.png",
"fileName": "1022141568737607750.png",
"fileSizeBytes": 33283
}
],
"mentions": [],
"reference": null
},
{
"id": 1052199187556602000,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "12/13/2022 07:23:55",
"content": "Don't wanna write them separately :opencry:",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052199293018181600,
"author_id": 411882877933060100,
"author_name": "Ｈｅｒｅｌｓ",
"timestamp": "12/13/2022 07:24:20",
"content": "$(x,n) \\in \\mathbb{W}^2$ ?",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052199301868175500,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "12/13/2022 07:24:22",
"content": "**Ｈｅｒｅｌｓ**",
"attachments": [
{
"id": 1052199301977215000,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1052199301977214986/411882877933060109.png",
"fileName": "411882877933060109.png",
"fileSizeBytes": 7460
}
],
"mentions": [],
"reference": null
},
{
"id": 1052199344264187900,
"author_id": 411882877933060100,
"author_name": "Ｈｅｒｅｌｓ",
"timestamp": "12/13/2022 07:24:32",
"content": "$x, n \\in \\mathbb{W}$ works too",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052199353248383000,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "12/13/2022 07:24:34",
"content": "**Ｈｅｒｅｌｓ**",
"attachments": [
{
"id": 1052199352988340200,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1052199352988340244/411882877933060109.png",
"fileName": "411882877933060109.png",
"fileSizeBytes": 7922
}
],
"mentions": [],
"reference": null
},
{
"id": 1052199484442038300,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "12/13/2022 07:25:06",
"content": "What does it mean to be W^2 here :thinkies:",
"attachments": [],
"mentions": [
{
"id": 510789298321096700,
"name": "TeXit",
"discriminator": "0796",
"nickname": "TeXit",
"isBot": true
}
],
"reference": null
},
{
"id": 1052199534811435000,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/13/2022 07:25:18",
"content": "Or $x \\in \\mathbb{W}, n\\in \\mathbb{W}$",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052199542851915900,
"author_id": 510789298321096700,
"author_name": "TeXit",
"timestamp": "12/13/2022 07:25:19",
"content": "**VulcanOne**",
"attachments": [
{
"id": 1052199542939992000,
"url": "https://cdn.discordapp.com/attachments/486844875632017408/1052199542939992074/1000057838007226480.png",
"fileName": "1000057838007226480.png",
"fileSizeBytes": 6560
}
],
"mentions": [],
"reference": null
},
{
"id": 1052199550481346600,
"author_id": 411882877933060100,
"author_name": "Ｈｅｒｅｌｓ",
"timestamp": "12/13/2022 07:25:21",
"content": "never heard of cartesian product ?",
"attachments": [],
"mentions": [
{
"id": 1022141568737607800,
"name": "♡A(lex)♡",
"discriminator": "5050",
"nickname": "♡A(lex)♡",
"isBot": false
}
],
"reference": null
},
{
"id": 1052199616877178900,
"author_id": 745951784526282800,
"author_name": "dog.",
"timestamp": "12/13/2022 07:25:37",
"content": "ordered pairs of all elements in W",
"attachments": [],
"mentions": [
{
"id": 1022141568737607800,
"name": "♡A(lex)♡",
"discriminator": "5050",
"nickname": "♡A(lex)♡",
"isBot": false
}
],
"reference": null
},
{
"id": 1052199664377659400,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "12/13/2022 07:25:48",
"content": "Oh I never thought of it this way",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052199699345580000,
"author_id": 1000057838007226500,
"author_name": "VulcanOne",
"timestamp": "12/13/2022 07:25:57",
"content": "A plane that contains whole numbers",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052199710485643300,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "12/13/2022 07:25:59",
"content": "Amazing",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052200048395554800,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "12/13/2022 07:27:20",
"content": "Well ty",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052200055488139300,
"author_id": 1022141568737607800,
"author_name": "♡A(lex)♡",
"timestamp": "12/13/2022 07:27:22",
"content": ".close",
"attachments": [],
"mentions": [],
"reference": null
},
{
"id": 1052200058482856100,
"author_id": 805217272087838700,
"author_name": "Mathematics Bot",
"timestamp": "12/13/2022 07:27:22",
"content": "Channel closed",
"attachments": [],
"mentions": [],
"reference": null
}
] |
help-9
|
d2c7431d4e4f48d0955525edabb6a83e
|
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.