Id
int64 1.68k
75.6M
| PostTypeId
int64 1
2
| AcceptedAnswerId
int64 1.7k
75.6M
⌀ | ParentId
int64 1.68k
75.6M
⌀ | Score
int64 -60
3.16k
| ViewCount
int64 8
2.68M
⌀ | Body
stringlengths 1
41.1k
| Title
stringlengths 14
150
⌀ | ContentLicense
stringclasses 3
values | FavoriteCount
int64 0
1
⌀ | CreationDate
stringlengths 23
23
| LastActivityDate
stringlengths 23
23
| LastEditDate
stringlengths 23
23
⌀ | LastEditorUserId
int64 -1
21.3M
⌀ | OwnerUserId
int64 1
21.3M
⌀ | Tags
list |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
73,753,639 | 2 | null | 73,753,320 | 3 | null | Besides filling up or completing the data to include all years another option would be to use `ggh4x::facetted_pos_scales` which adds the flexibility to set the scale for each facet separately. Doing so allows to set the limits/breaks according to the displayed interval per facet. To this end I use a custom function to create the scale for all facets using `lapply`:
```
library(tidyverse)
library(ggh4x)
year_ranges <- levels(df_data$year_5)
make_scale <- function(x) {
x <- as.numeric(str_extract(x, "\\d+")[[1]])
xmin <- x[[1]] + 1
xmax <- x[[1]] + 5
scale_x_continuous(limits = c(xmin, xmax), breaks = seq(xmin, xmax, 1), expand = c(0, .6))
}
x_scales <- lapply(year_ranges, make_scale)
ggplot(df_data, aes(x = year, y = value)) +
geom_bar(,
stat = "identity"
) +
facet_wrap(vars(year_5), scales = "free_x") +
ggh4x::facetted_pos_scales(x = x_scales)
```
[](https://i.stack.imgur.com/mt4Ck.png)
| null | CC BY-SA 4.0 | null | 2022-09-17T09:20:48.267 | 2022-09-17T09:29:08.470 | 2022-09-17T09:29:08.470 | 12,993,861 | 12,993,861 | null |
73,753,812 | 2 | null | 49,816,515 | 0 | null | The green tick answer by Chronocidal requires use of Macro.
Personally, I don't think it is necessary to go through such cumbersome process.
Suppose merged cells are in Column A; first merged data is in cell A2.
Make a new column on the right of merged cell column [B Column].
In the cell B2, type =IF(LEN(A2)=0,B1,A2) and drag this formula down.
It will fill data correctly and you can apply filter on column B.
Note: Formula checks length of characters of left cell. If it is zero, uses cell directly above as answer; otherwise uses left cell as is.
[Excel Snapshot of Formula](https://i.stack.imgur.com/dv46S.png)
| null | CC BY-SA 4.0 | null | 2022-09-17T09:46:30.513 | 2022-09-17T09:46:30.513 | null | null | 20,018,711 | null |
73,753,871 | 2 | null | 73,753,320 | 2 | null | It's pretty straightforward to just fill the missing years with zeros:
```
library(tidyverse)
df_data <- data.frame(
year = c(1971L,1972L,1973L,1976L,1977L,1979L,
1980L,1981L,1982L,1983L,1989L,1990L,1991L,1992L,1993L,
1994L,1995L,1996L,1998L,1999L),
value = c(2L,3L,4L,7L,8L,10L,11L,12L,13L,14L,
20L,21L,22L,23L,24L,25L,26L,27L,29L,30L)
)
df_data %>%
complete(year = 1970:1999, fill = list(value = 0)) %>%
mutate(year_5 = paste(5 * floor(year/5), 5 * floor(year/5) + 4, sep ="-")) %>%
ggplot(aes(year, value)) +
geom_col() +
facet_wrap(vars(year_5), scales = "free_x")
```
[reprex v2.0.2](https://reprex.tidyverse.org)
| null | CC BY-SA 4.0 | null | 2022-09-17T09:54:55.673 | 2022-09-17T09:54:55.673 | null | null | 12,500,315 | null |
73,754,045 | 2 | null | 52,832,452 | 1 | null | I have done some research on how to make icons size bigger in VSCode sidebar and found the only way i.e. load custom CSS.
This can be achieved with custom CSS and JS loader extension.
[https://marketplace.visualstudio.com/items?itemName=be5invis.vscode-custom-css](https://marketplace.visualstudio.com/items?itemName=be5invis.vscode-custom-css)
For installation and setup please refer instruction from this link page.
Create a css file on your system with any name you like and paste this css in that file.
```
.sidebar .monaco-list-row {
font-size: 16px;
}
.sidebar .codicon {
font-size: 20px;
}
.sidebar .monaco-icon-label:before {
background-size: 20px;
}
```
Note: Font size related changes are optional and you can change background-size as per your need.
Save this file after paste and copy this file's path.
Open VSCode Settings and click on JSON option
[](https://i.stack.imgur.com/Wjail.png)
After that paste this line in settings.
```
"vscode_custom_css.imports": ["file:///cssFilePath"],
```
After doing this, the setting will look like this.
[](https://i.stack.imgur.com/kW0gL.png)
In my case I am using linux. The file path structure may vary in case of windows or mac.
Once that is done, press ctrl+sfift+p to open VSCode command palette.
Type Enable Custom CSS and JS and press enter.
It will trigger one popup at bottom like this.
[](https://i.stack.imgur.com/7mzLP.png)
Click on Restart Visual Studio Code button from that popup.
The icon size will be updated after restart.
In case it won't, you can open command palette again and type Reload custom CSS and JS and press Enter.
It will again give you popup and ask for restart, and once you restart the icon size be updated.
Final result will look like this
[](https://i.stack.imgur.com/vOusp.png)
| null | CC BY-SA 4.0 | null | 2022-09-17T10:24:17.523 | 2022-09-17T10:24:17.523 | null | null | 12,804,254 | null |
73,754,333 | 2 | null | 9,174,540 | 1 | null | 10 years have passed since I've posted the question. Since I've been working with Node.JS and discovered Handlebars and how it is pretty easy to get it to parse JSON instead of HTML template. [The Handlebars project has been converted to .NET.](https://github.com/Handlebars-Net/Handlebars.Net)
You can use a special `ITextEncoder` to let Handlebars generate JSON:
```
using HandlebarsDotNet;
using System.Text;
public class JsonTextEncoder : ITextEncoder
{
public void Encode(StringBuilder text, TextWriter target)
{
Encode(text.ToString(), target);
}
public void Encode(string text, TextWriter target)
{
if (text == null || text == "") return;
text = System.Web.HttpUtility.JavaScriptStringEncode(text);
target.Write(text);
}
public void Encode<T>(T text, TextWriter target) where T : IEnumerator<char>
{
var str = text?.ToString();
if (str == null) return;
Encode(str, target);
}
}
```
Let's see it in action:
```
using HandlebarsDotNet;
var handlebars = Handlebars.Create();
handlebars.Configuration.TextEncoder = new JsonTextEncoder();
var sourceTemplate = @"{
""id"": ""{{Key}}"",
""name"": ""{{Name}}"",
""related "": ""{{Related.Name}}""
}";
var template = handlebars.Compile(sourceTemplate);
var json = template(new
{
Key = "Alpha",
Name = "Beta",
Related = new
{
Name = "Gamme"
}
});
Console.WriteLine(json);
```
This will write the following:
```
{
"id": "Alpha",
"name": "Beta",
"related ": "Gamme"
}
```
I did a small write-up on the topic on my blog: [Handlebars.Net & JSON templates](https://keestalkstech.com/2022/09/handlebars-net-json-templates/). In this blog I also discuss how to improve debugging these templates.
| null | CC BY-SA 4.0 | null | 2022-09-17T11:07:29.877 | 2022-09-17T11:07:29.877 | null | null | 201,482 | null |
73,754,548 | 2 | null | 73,684,957 | 0 | null | You just need to add a font that contains the characters/glyphs in question into the set of font that pdfHTML uses for conversion. By default pdfHTML's set of fonts does not guarantee the presence of each and every Unicode character.
In my case a font that has the desired symbols that I was able to locate on my Windows system is Segoe UI Symbol.
If I add this font into the Font Provider and pass the font provider into Converter Properties as follows, I get the desired result.
```
ConverterProperties properties = new ConverterProperties();
FontProvider fontProvider = new DefaultFontProvider();
fontProvider.addFont("C:/Windows/Fonts/seguisym.ttf");
properties.setFontProvider(fontProvider);
HtmlConverter.convertToPdf(new File("path/to/file.html"),
new File("path/to/file.pdf"), properties);
```
[](https://i.stack.imgur.com/tAg6W.png)
| null | CC BY-SA 4.0 | null | 2022-09-17T11:43:05.433 | 2022-09-17T11:43:05.433 | null | null | 2,333,458 | null |
73,754,597 | 2 | null | 73,752,083 | 0 | null | Always read the full help page of the functions you use. Here `?barplot` reveals that you may use `names.arg=`.
```
barplot(statecount$n, names.arg=statecount$st)
```
[](https://i.stack.imgur.com/wuMy2.png)
| null | CC BY-SA 4.0 | null | 2022-09-17T11:51:55.310 | 2022-09-17T11:51:55.310 | null | null | 6,574,038 | null |
73,754,911 | 2 | null | 12,438,209 | 0 | null | I believe it is action. So my way of writing this nicely is:
```
val playButtonAction = register("play_button_action") {
main.looper?.player?.asStarted { it.stop() }
}
```
so you can do:
```
override fun onDestroy() {
super.onDestroy()
unregister(playButtonAction)
}
```
using:
```
fun Context.register(action: String, function: () -> void): BroadcastReceiver =
register(IntentFilter(action)) { _, _ -> function() }
fun Context.register(intent: IntentFilter,
function: (Intent, BroadcastReceiver) -> void): BroadcastReceiver {
val receiver = object : BroadcastReceiver() {
override fun onReceive(context: Context, intent: Intent) = function(intent, this)
}
registerReceiver(receiver, intent)
return receiver
}
fun Context.unregister(receiver: BroadcastReceiver) {
unregisterReceiver(receiver)
}
```
And also u use playButtonAction:
```
val stopIntent = PendingIntent.getBroadcast(this, 0, Intent("play_button_action"),
FLAG_UPDATE_CURRENT or FLAG_IMMUTABLE);
```
This is my complete Service class:
```
class LooperPlayNotificationService : Service() {
companion object {
val NOTIFICATIONS_CHANNEL = "${app.packageName} notifications"
}
override fun onBind(intent: Intent): IBinder? = null
override fun onStartCommand(intent: Intent, flags: Int, startId: Int): Int {
super.onStartCommand(intent, flags, startId)
start()
return START_STICKY
}
override fun onCreate() {
super.onCreate()
start()
}
private val playButtonActionId = "play_button_action"
private lateinit var playButtonAction: BroadcastReceiver
private var started = false
// https://stackoverflow.com/questions/6619143/start-sticky-foreground-android-service-goes-away-without-notice
// There's a bug in 2.3 (not sure if it was fixed yet) where when a Service is killed and restarted,
// its onStartCommand() will NOT be called again. Instead you're going to have to do any setting up in onCreate()
private fun start() {
if (started) return
started = true
startForeground(647823876, createNotification())
playButtonAction = register(playButtonActionId) {
main.looper?.player?.asStarted { it.stop() }
}
}
override fun onDestroy() {
super.onDestroy()
unregister(this.playButtonAction)
}
private fun createNotification() = Builder(this, NOTIFICATIONS_CHANNEL)
.setSmallIcon(outline_all_inclusive_24)
.setContentIntent(getActivity(this, 0, Intent<InstrumentsActivity>(this),
FLAG_UPDATE_CURRENT or FLAG_IMMUTABLE))
.setPriority(PRIORITY_DEFAULT)
.setAutoCancel(false).setOngoing(true)
.addAction(ic_stop_circle_black_24dp, "Stop",
getBroadcast(this, 0, Intent(playButtonActionId),
FLAG_UPDATE_CURRENT or FLAG_IMMUTABLE))
.setContentText(getString(R.string.app_name))
.setContentText(main.looper?.preset?.item?.value?.title?.value).build()
}
```
| null | CC BY-SA 4.0 | null | 2022-09-17T12:37:31.193 | 2022-09-17T12:45:43.290 | 2022-09-17T12:45:43.290 | 925,135 | 925,135 | null |
73,755,037 | 2 | null | 16,852,591 | 0 | null | The Python library [pomegranate](https://github.com/jmschrei/pomegranate) has good support for Hidden Markov Models. It includes functionality for defining such models, learning it from data, doing inference, and visualizing the transitions graph (as you request here).
Below is example code for defining a model, and plotting the states and transitions. The image output will be like this:
[](https://i.stack.imgur.com/oYpEX.png)
```
from pomegranate import HiddenMarkovModel, State, DiscreteDistribution
from matplotlib import pyplot as plt
def build_model():
d1 = DiscreteDistribution({'A' : 0.50, 'B' : 0.50})
d2 = DiscreteDistribution({'A' : 0.10, 'B' : 0.90})
d3 = DiscreteDistribution({'A' : 0.90, 'B' : 0.10})
s1 = State(d1, name="s1")
s2 = State(d2, name="s2")
s3 = State(d3, name="s3")
model = HiddenMarkovModel(name='my model')
model.add_states(s1, s2, s3)
model.add_transition(model.start, s1, 1.0)
model.add_transition(s1, s1, 0.7)
model.add_transition(s1, s2, 0.3) # s1->s2
model.add_transition(s2, s2, 0.8)
model.add_transition(s2, s3, 0.0) # no transition from s2 to s3
model.add_transition(s1, s3, 0.1) # indirect from s1 to s3
model.add_transition(s3, s1, 0.1) # indirect from s3 to s1
model.add_transition(s3, s3, 0.9)
model.add_transition(s3, model.end, 0.1)
model.start.name = 'start'
model.end.name = 'end'
model.bake()
return model
model = build_model()
fig, ax = plt.subplots(1)
model.plot(ax=ax, precision=2)
fig.savefig('model.png')
```
| null | CC BY-SA 4.0 | null | 2022-09-17T12:57:06.877 | 2022-09-17T12:57:06.877 | null | null | 1,967,571 | null |
73,755,547 | 2 | null | 73,755,450 | 0 | null | Just wrap the `nav` and the `text-box` divs with the header section. It looks like you closed the header section right away and haven't wrapped it with anything, modify the part like this:
```
<section class="header">
<nav>
<a href="index.html"><img src="img/GYSD7530-modified.png"></a>
<div class="nav-links">
<i class="fa fa-times"></i>
<ul>
<li><a href="">About</a></li>
<li><a href="">Experience</a></li>
<li><a href="">Work</a></li>
<li><a href="">Contact</a></li>
<li><a href="">Resume</a></li>
</ul>
</div>
<i class="fa fa-bars"></i>
</nav>
<div class="text-box">
<h1>UI/UX Designer, Frontend Developer & Learner</h1>
<p>I design and code gorgeously simple things, and I love what I do</p>
<a href="" class="hero-btn">Explore</a>
</div>
</section>
```
This should work fine
| null | CC BY-SA 4.0 | null | 2022-09-17T14:10:34.147 | 2022-09-17T14:10:34.147 | null | null | 17,091,911 | null |
73,755,558 | 2 | null | 73,755,450 | 0 | null | You can make it transparent by use the css property:
`background-color: transparent;`
Also to make the nav bar go to top try putting it in div instead of nav.
| null | CC BY-SA 4.0 | null | 2022-09-17T14:11:31.587 | 2022-09-17T14:11:31.587 | null | null | 19,387,694 | null |
73,755,701 | 2 | null | 73,683,573 | 0 | null | I was able to do what I needed, in part. I added a counter to display the shortcode between two numbers:
```
// get variations for a given product ID and shows the above shortcode
function display_price_in_variation_options( $term, $term_obj ) {
$counter = 0;
$product = wc_get_product();
$id = $product->get_id();
if ( empty( $term ) || empty( $id ) ) {
return $term;
}
if ( $product->is_type( 'variable' ) && $product->get_id() === 30917 ) {
$product_variations = $product->get_available_variations();
} else {
return $term;
}
foreach ( $product_variations as $variation ) {
$counter++;
if ( count( $variation['attributes'] ) > 1 ) {
return $term;
}
$attribute = array_values( $variation['attributes'] )[0];
if ( $attribute === $term_obj->slug && max(min($counter, 4), 1) == $counter ) { // checks variation 1 to 4
$term .= ' (' . do_shortcode('[prox_meses cant="0"]') . ')';
} elseif ( $attribute === $term_obj->slug && max(min($counter, 8), 4) == $counter ) {
$term .= ' (' . do_shortcode('[prox_meses cant="1"]') . ')'; // shows current month+1
} elseif ( $attribute === $term_obj->slug && max(min($counter, 12), 8) == $counter ) {
$term .= ' (' . do_shortcode('[prox_meses cant="2"]') . ')';
}
}
return $term;
}
add_filter( 'woocommerce_variation_option_name', 'display_price_in_variation_options', 10, 2 );
```
It works fine, but the variation doesn't show in the cart or the order, so it's no useful for me since I have no idea what the customer purchased.
I think allowing a shortcode inside the variation name is the best way to do this.
| null | CC BY-SA 4.0 | null | 2022-09-17T14:31:54.327 | 2022-09-17T14:31:54.327 | null | null | 5,204,005 | null |
73,756,622 | 2 | null | 73,749,697 | 0 | null | Is this working for you:
```
ggplot() +
geom_point(data = World, aes(x = pop_age, y = peace_index_score)) +
labs(title = "Youth Buldge and Instability", x = "Median Age in Country",y = "Overall Peacefulness of Country") +
theme_economist() +
ylim(0,4) +
xlim(15,45) +
geom_smooth(data = World, aes(x = pop_age, y = peace_index_score), method = lm, color = "red") +
geom_text(data = World, aes(x = pop_age, y = peace_index_score, label = country))
```
| null | CC BY-SA 4.0 | null | 2022-09-17T16:31:01.597 | 2022-09-17T16:31:01.597 | null | null | 8,307,260 | null |
73,757,144 | 2 | null | 72,538,993 | 0 | null | Could you use a `linear` curve as a work around?
```
<script src="https://cdn.jsdelivr.net/npm/mermaid/dist/mermaid.min.js"></script>
<div class="mermaid">
%%{init: {'flowchart' : {'curve' : 'linear'}}}%%
flowchart TD
A((A))
A --- B
A --- C
A --- D
A --- E
B --- B1
B --- B2
</div>
```
| null | CC BY-SA 4.0 | null | 2022-09-17T17:36:04.503 | 2022-09-17T17:36:04.503 | null | null | 372,319 | null |
73,757,589 | 2 | null | 73,753,672 | 11 | null | Try this solution [https://github.com/dotnet/sdk/issues/27082#issuecomment-1211143446](https://github.com/dotnet/sdk/issues/27082#issuecomment-1211143446) for me it solved the problem
| null | CC BY-SA 4.0 | null | 2022-09-17T18:38:56.367 | 2022-09-17T18:38:56.367 | null | null | 10,899,263 | null |
73,757,642 | 2 | null | 73,298,724 | 0 | null | that's a silly problem, you are sending the requests to the [http://127.0.0.1](http://127.0.0.1) not the host! you have to send the request to for expample [https://hostname.com](https://hostname.com) not [http://127.0.0.1](http://127.0.0.1)
| null | CC BY-SA 4.0 | null | 2022-09-17T18:48:03.413 | 2022-09-17T18:48:03.413 | null | null | 16,786,195 | null |
73,758,151 | 2 | null | 73,757,813 | 0 | null | You can use `group by rollup`:
```
select department, coalesce(EmpName, 'Total'), Sum(Debi), sum(Credi)
from Total_Income
group by rollup (department, EmpName)
having department is not null
order by department, case when EmpName is null then 0 else 1 end, EmpName
```
(Optional SQL standard feature T431, Extended grouping capabilities.)
| null | CC BY-SA 4.0 | null | 2022-09-17T20:03:16.387 | 2022-09-17T20:59:56.187 | 2022-09-17T20:59:56.187 | 3,706,016 | 3,706,016 | null |
73,758,138 | 2 | null | 73,751,757 | 0 | null | You can generate normals with the same mean and standard deviation as a given geometric or binomial, but you generally can't go the other way. That's because all distributions are characterized by parameters, but for most distributions the mean and standard deviation are not the defining parameters, but rather they are functions of the parameters. Let's look at the two specific distributions named in your question. In both cases we'll treat variance and standard deviation as equivalent for your interests, since the latter is the square root of the former.
Given a geometric random variable with its single parameter , the mean and variance are 1/ and (1-)/, respectively. They can't be independent values chosen arbitrarily.
Similarly, a binomial random variable is fully determined by its parameters (number of samples taken) and (probability that a given sample is a "success"). Its mean and variance are and , respectively. Again, you can't just choose any old values because arbitrary choices may not yield feasible solutions of the requirements that integer >0 and 0≤≤1 produce the target values for mean and variance.
Going the other way is generally not a problem though. Given a binomial, geometric, exponential, Poisson,… with associated parameterization, you can calculate the corresponding mean and variance/standard-deviation and use those values to parameterize a normal. The exception would be some pathological distributions which don't have finite moments, such as the [Cauchy distribution](https://en.wikipedia.org/wiki/Cauchy_distribution).
| null | CC BY-SA 4.0 | null | 2022-09-17T20:01:55.210 | 2022-09-17T20:01:55.210 | null | null | 2,166,798 | null |
73,758,217 | 2 | null | 73,758,195 | 1 | null | Do you have `@Controller('api/v1/products')` on your `ProductsController`? If not, you don't ever configure the test application to be served from `/api/v1`, you'd need to set the global prefix and enable versioning (assuming you usually do these in your `main.ts`). For a simple fix, remove the `/api/v1` from your `.post()` method.
| null | CC BY-SA 4.0 | null | 2022-09-17T20:14:04.610 | 2022-09-17T20:14:04.610 | null | null | 9,576,186 | null |
73,758,323 | 2 | null | 73,758,287 | 1 | null | Self is use to indicate a method belong to a class. It is not a argument pass to method as you did in your code.Use this link for more info:
[What is the purpose of the `self` parameter? Why is it needed?](https://stackoverflow.com/questions/2709821/what-is-the-purpose-of-the-self-parameter-why-is-it-needed)
| null | CC BY-SA 4.0 | null | 2022-09-17T20:30:50.510 | 2022-09-17T20:30:50.510 | null | null | 19,966,820 | null |
73,758,454 | 2 | null | 31,235,376 | 0 | null | --WINDOWS--
if using Pycharm GUI package installer works fine for installing packages for your virtual environment but you cannot do the same in the terminal,
this is because you did not setup virtual env in your terminal, instead, your terminal uses Power Shell which doesn't use your virtual env
[there should be (venv) before you're command line as shown instead of (PS)](https://i.stack.imgur.com/y5eQI.png)
if you have (PS), this means your terminal is using Power Shell instead of cmd
to fix this, click on the down arrow and select the command prompt
[select command prompt](https://i.stack.imgur.com/U54ns.png)
now you will get (venv) and just type pip install #package name# and the package will be added to your virtual environment
| null | CC BY-SA 4.0 | null | 2022-09-17T20:54:44.347 | 2022-09-17T20:54:44.347 | null | null | 11,082,590 | null |
73,758,843 | 2 | null | 73,758,821 | 1 | null | For MAUI use [CommunityToolkit.Maui](https://www.nuget.org/packages/CommunityToolkit.Maui) package instead of Xamarin.CommunityToolkit.
- [Official repo](https://github.com/CommunityToolkit/Maui)- [Official docs](https://learn.microsoft.com/en-us/dotnet/communitytoolkit/maui/)
| null | CC BY-SA 4.0 | null | 2022-09-17T22:03:11.007 | 2022-09-17T22:09:55.690 | 2022-09-17T22:09:55.690 | 5,228,202 | 5,228,202 | null |
73,758,963 | 2 | null | 73,543,322 | 0 | null | The question is if your input mesh consist on plain triangles (in which case you can't have neighbors, because you can have several neighbors by each edge) or your mesh consist on "triangle shaped polygons".
If your input are triangles, meshlab won't solve your problem.
If you have polygons, you can use the "convert mesh into pure triangles" filter.
| null | CC BY-SA 4.0 | null | 2022-09-17T22:29:20.797 | 2022-09-17T22:29:20.797 | null | null | 3,715,819 | null |
73,759,156 | 2 | null | 63,543,422 | 2 | null | Just choose if you are using :
[](https://i.stack.imgur.com/Znjrt.png)
| null | CC BY-SA 4.0 | null | 2022-09-17T23:24:26.050 | 2022-09-17T23:24:26.050 | null | null | 10,832,700 | null |
73,759,504 | 2 | null | 73,759,464 | 0 | null | This is a Visual Studio Code setting, you can access the vscode json file settings by pressing `F1` and typing `>Preferences: Open User Settings (JSON)`, select the first option and it will open the file.
Paste the line `"html.format.wrapLineLength": 0`, inside the json object.
For more info: [https://code.visualstudio.com/docs/languages/html#_formatting](https://code.visualstudio.com/docs/languages/html#_formatting)
| null | CC BY-SA 4.0 | null | 2022-09-18T01:12:50.617 | 2022-09-18T01:13:15.930 | 2022-09-18T01:13:15.930 | 17,776,680 | 17,776,680 | null |
73,759,515 | 2 | null | 73,759,464 | 0 | null | you can use `<pre></pre>` to make sure your text `\n` (enter) to be readable into your browser, you can see the example below.
```
<div style="max-width: 100%">
<pre>Contrary to popular belief, Lorem Ipsum is not simply random text.
It has roots in a piece of classical Latin literature from 45 BC, making it over 2000 years old. Richard McClintock, a Latin professor at Hampden-Sydney College in Virginia, looked up one of the more obscure Latin words, consectetur,
from a Lorem Ipsum passage, and going through the cites of the word in classical literature, discovered the undoubtable source. Lorem Ipsum comes from sections 1.10.32 and 1.10.33 of "de Finibus Bonorum et Malorum" (The Extremes of Good and Evil) by Cicero, written in 45 BC.
This book is a treatise on the theory of ethics, very popular during the Renaissance. The first line of Lorem Ipsum, "Lorem ipsum dolor sit amet..", comes from a line in section 1.10.32.
The standard chunk of Lorem Ipsum used since the 1500s is reproduced below for those interested.
Sections 1.10.32 and 1.10.33 from "de Finibus Bonorum et Malorum" by Cicero are also reproduced in their exact original form, accompanied by English versions from the 1914 translation by H. Rackham. </pre>
</div>
```
| null | CC BY-SA 4.0 | null | 2022-09-18T01:19:14.807 | 2022-09-18T01:19:14.807 | null | null | 5,811,263 | null |
73,759,964 | 2 | null | 73,759,932 | 0 | null | If you only have to add the property to the node that you're showing that'd be:
```
firebase.database().ref('18-9/Working/TimeOut').set('5:20:30');
```
Or
```
firebase.database().ref('18-9/Working').update({ TimeOut: '5:20:30' });
```
| null | CC BY-SA 4.0 | null | 2022-09-18T03:37:18.427 | 2022-09-18T03:37:18.427 | null | null | 209,103 | null |
73,759,965 | 2 | null | 15,153,603 | 1 | null | Of course today, float is no longer needed, as the flexbox is available:
[https://developer.mozilla.org/en-US/docs/Learn/CSS/CSS_layout/Flexbox](https://developer.mozilla.org/en-US/docs/Learn/CSS/CSS_layout/Flexbox)
Also, grid is amazing:
[https://developer.mozilla.org/en-US/docs/Learn/CSS/CSS_layout/Grids](https://developer.mozilla.org/en-US/docs/Learn/CSS/CSS_layout/Grids)
| null | CC BY-SA 4.0 | null | 2022-09-18T03:37:32.633 | 2022-09-18T03:37:32.633 | null | null | 19,497,610 | null |
73,760,057 | 2 | null | 73,759,726 | 1 | null | We are trying to change each item separately, but using single variable to control the list. So once the value changes, the full list get changes. You can create another list to control the list or include a variable on model class.
With another list to control text.
```
class _SwitchWidgetsScreenState extends State<SwitchWidgetsScreen> {
List<ItemInfo> infoTypes =
List.generate(items.length, (index) => ItemInfo.price);
Widget buildItemCards(int index) {
Item item = items[index];
return GestureDetector(
onTap: () {
setState(() {
if (infoTypes[index] == ItemInfo.price) {
infoTypes[index] = ItemInfo.detail;
} else {
infoTypes[index] = ItemInfo.price;
}
});
},
child: Card(
child: ListTile(
title: Text(item.name),
subtitle: infoTypes[index] == ItemInfo.price
? Text('Price: ${item.price}G')
: Text(item.detail),
),
),
);
}
@override
Widget build(BuildContext context) {
return Scaffold(
appBar: AppBar(
title: const Text('Items'),
),
body: ListView.builder(
itemCount: items.length,
itemBuilder: (_, index) {
return buildItemCards(index);
},
),
);
}
}
```
Or adding variable or extending Item class
```
class Item {
int id;
String name;
int price;
String detail;
ItemInfo itemInfo;
Item(
{required this.id,
required this.name,
required this.price,
required this.detail,
this.itemInfo = ItemInfo.price});
}
class _SwitchWidgetsScreenState extends State<SwitchWidgetsScreen> {
Widget buildItemCards(int index) {
Item item = items[index];
return GestureDetector(
onTap: () {
setState(() {
if (items[index].itemInfo == ItemInfo.price) {
items[index].itemInfo = ItemInfo.detail;
} else {
items[index].itemInfo = ItemInfo.price;
}
});
},
child: Card(
child: ListTile(
title: Text(item.name),
subtitle: items[index].itemInfo == ItemInfo.price
? Text('Price: ${item.price}G')
: Text(item.detail),
),
),
);
}
@override
Widget build(BuildContext context) {
return Scaffold(
appBar: AppBar(
title: const Text('Items'),
),
body: ListView.builder(
itemCount: items.length,
itemBuilder: (_, index) {
return buildItemCards(index);
},
),
);
}
}
```
I prefer using final variable with copyWith method.
| null | CC BY-SA 4.0 | null | 2022-09-18T04:05:16.267 | 2022-09-18T04:05:16.267 | null | null | 10,157,127 | null |
73,760,214 | 2 | null | 29,739,751 | 0 | null | I think your code is not working as expected because you forgot to delete 2 identical frontier cells in your list of frontier cells. Note that two passage cells can share the same frontier cell
| null | CC BY-SA 4.0 | null | 2022-09-18T04:57:55.873 | 2022-09-18T04:57:55.873 | null | null | 16,714,170 | null |
73,760,402 | 2 | null | 66,518,813 | 0 | null |
1. Use the terminal in Admin mode.
2. pip uninstall robotframework
3. upgrade pip
4. again pip install robotframework
| null | CC BY-SA 4.0 | null | 2022-09-18T05:49:36.563 | 2022-09-18T05:49:36.563 | null | null | 1,297,934 | null |
73,760,477 | 2 | null | 73,755,313 | 0 | null | I solved it without field parameters. You need to use unpivot columns first in the query editor:
Your Initial Data set :
[](https://i.stack.imgur.com/msNHP.png)
should be converted Into this using unpivot other columns:
[](https://i.stack.imgur.com/PjqVU.png)
You can access unpivot function like you can see below:
[](https://i.stack.imgur.com/wTm9h.png)
Full M-Code in Power Query Editor:
```
let
Source = Table.FromRows(Json.Document(Binary.Decompress(Binary.FromText("i45WCjRU0lEyMtL1SswDMgJywJSpOZCwNAISxsYgFhCbGSjF6qArd0wuKU3MKQayTMwI6XBLTUKywAJImIOVgzSCeGamWJQjLDA1gOswx67DN7EIYYE5WBCkytgALA0isChH8oEJTIeRJZKOWAA=", BinaryEncoding.Base64), Compression.Deflate)), let _t = ((type nullable text) meta [Serialized.Text = true]) in type table [Quarter = _t, Month = _t, Status = _t, De = _t, Di = _t, In = _t, Iv = _t, Ri = _t]),
#"Unpivoted Other Columns" = Table.UnpivotOtherColumns(Source, {"Quarter", "Month", "Status"}, "Attribute", "Value"),
#"Renamed Columns" = Table.RenameColumns(#"Unpivoted Other Columns",{{"Attribute", "Metric"}}),
#"Changed Type" = Table.TransformColumnTypes(#"Renamed Columns",{{"Value", Int64.Type}})
in
#"Changed Type"
```
then create a simple measure for value field to be used as slice/dice:
```
Total = SUM('Power BI Fact Table'[Value])
```
Then start shaping your bar/column chart:
[](https://i.stack.imgur.com/Lo4oT.png)
To build slicer, just put metric field Into it simply:
If we test it:
[](https://i.stack.imgur.com/VLN6b.png)
[](https://i.stack.imgur.com/qKHxE.png)
[](https://i.stack.imgur.com/79joo.png)
| null | CC BY-SA 4.0 | null | 2022-09-18T06:06:57.487 | 2022-09-18T12:39:11.583 | 2022-09-18T12:39:11.583 | 19,469,088 | 19,469,088 | null |
73,760,486 | 2 | null | 73,756,370 | 0 | null | `longStop` is of type `series`. That means, it will have historical data for each bar.
With your last line, you change the value of `longStop` depending on your condition.
Then on the next execution, you have this statement: `longStopPrev = longStop[1]`. Here you access `longStop`'s previous value.
So, what's happening here is, with your last line, you change `longStop`'s value and therefore `longStop[1]` returns a different value on the next execution.
| null | CC BY-SA 4.0 | null | 2022-09-18T06:09:24.207 | 2022-09-18T06:09:24.207 | null | null | 7,209,631 | null |
73,760,678 | 2 | null | 73,760,345 | 1 | null | Firebase Realtime Database and Cloud Firestore are different databases. In this case, you are using RTDB but importing the Firestore SDK. Adding the Realtime DB SDK should resolve the issue:
```
import "firebase/compat/database"
```
| null | CC BY-SA 4.0 | null | 2022-09-18T06:54:04.253 | 2022-09-18T06:54:04.253 | null | null | 13,130,697 | null |
73,760,711 | 2 | null | 73,760,686 | 0 | null | because `li` is a DOM, not a string, using innerHTML for get string from tag html
try `console.log(titleinfo[1]==li.innerHTML)` on `line 446`
| null | CC BY-SA 4.0 | null | 2022-09-18T07:02:13.537 | 2022-09-18T07:02:54.460 | 2022-09-18T07:02:54.460 | 14,685,679 | 14,685,679 | null |
73,761,092 | 2 | null | 73,755,313 | 1 | null | The problem here is the half-baked data model and especially a pivot table will bring you nowhere in Power BI. So the work starts in Power Query, where you have to unpivot your Attribute columns Debit, Digital, Internal, IVT and Risk to get a stacked table like shown below
```
Table.UnpivotOtherColumns(#"Changed Type", {"Quarter", "Month", "Status"}, "Attribute", "Value")
```
[](https://i.stack.imgur.com/hZeJW.png)
From here everything becomes plain vanilla and you can simply pull in the new Attribute column and use it as a slicer:
[](https://i.stack.imgur.com/mu57Q.png)
| null | CC BY-SA 4.0 | null | 2022-09-18T08:12:40.333 | 2022-09-18T08:12:40.333 | null | null | 7,108,589 | null |
73,761,097 | 2 | null | 73,760,549 | 0 | null | Where is the `PayPalButtons` component in the first code sample?
Consider using the full [sample the package provides](https://paypal.github.io/react-paypal-js/?path=/docs/example-paypalbuttons--default) as a base. There's a currency variable set in two locations (line 10 and later within the PayPalScriptProvider) for whatever reason.
| null | CC BY-SA 4.0 | null | 2022-09-18T08:13:43.333 | 2022-09-18T08:13:43.333 | null | null | 2,069,605 | null |
73,761,349 | 2 | null | 73,664,780 | 0 | null | So it couldn't find my tests because i had no solution, the video i watched created projects through cmd, he explained that in an other video after that.
| null | CC BY-SA 4.0 | null | 2022-09-18T08:57:59.753 | 2022-09-18T08:57:59.753 | null | null | 15,030,319 | null |
73,761,388 | 2 | null | 73,761,290 | 0 | null | For this you have to use exact key work in Navlink like this:
```
<NavLink to='/' exact={true}>
Main
</NavLink>
```
because'/' is active for all routes that's why you are getting this.
| null | CC BY-SA 4.0 | null | 2022-09-18T09:04:13.703 | 2022-09-18T09:04:13.703 | null | null | 13,022,604 | null |
73,761,838 | 2 | null | 73,462,296 | 11 | null |
As many of you noticed, we recently began rolling out global slash commands to bot profiles last week for verified apps. This week, we're rolling them out to 100% of verified apps.
With this update, a max of 5 of your app's most-used global slash commands are now visible in your bot profile (as long as your app is verified). These commands are directly invokable, making them more discoverable and usable for users across Discord :sparklies:
You don't have to do anything! As long as your app is verified and has at least one global slash command, a max of 5 will be displayed in your bot profile automatically.
No, at the moment you can't control which commands are present
: Discord Developers
| null | CC BY-SA 4.0 | null | 2022-09-18T10:11:29.617 | 2022-09-18T10:11:29.617 | null | null | 18,811,847 | null |
73,761,870 | 2 | null | 12,980,767 | 0 | null | In my case I just had to wait for half an hour after which everything works.
But this was the first start up of my 'hello world' app on my Android phone.
The IDE ran on Ubuntu linux.
| null | CC BY-SA 4.0 | null | 2022-09-18T10:17:15.527 | 2022-09-18T10:17:15.527 | null | null | 8,960,611 | null |
73,761,964 | 2 | null | 73,761,290 | 2 | null | For react-router v6, if you want your root route (`"/"`) to be active only at this route, you should add an `end` prop to `<NavLink>`:
```
<NavLink to="/" end>
Main
</NavLink>
```
| null | CC BY-SA 4.0 | null | 2022-09-18T10:30:36.350 | 2022-09-18T10:36:27.577 | 2022-09-18T10:36:27.577 | 9,718,056 | 17,160,279 | null |
73,762,032 | 2 | null | 55,809,932 | 0 | null | Besides what eciavatta mentioned, another possible reason for the Hololens 2 is the selected Plug-in provider, which should be
Go to and select
[](https://i.stack.imgur.com/veT7n.jpg)
| null | CC BY-SA 4.0 | null | 2022-09-18T10:40:49.847 | 2022-09-18T10:40:49.847 | null | null | 1,773,841 | null |
73,762,478 | 2 | null | 69,911,805 | 1 | null | Try using [cypress-real-events](https://github.com/dmtrKovalenko/cypress-real-events):
```
cy.get('#element')
.realMouseDown({ position: "center" })
.realMouseMove(50, 0)
.realMouseUp()
```
| null | CC BY-SA 4.0 | null | 2022-09-18T11:42:28.380 | 2022-09-18T11:42:28.380 | null | null | 999,270 | null |
73,762,489 | 2 | null | 56,158,474 | -1 | null | You try insert with attr enctype="multiple/form-data" when you create form
```
<form method="POST" role="form" enctype="multiple/form-data">
<div class="form-group">
<label for="">Username</label>
<input type="text" class="form-control" id="" name="username" />
</div>
<input type="submit" class="btn btn-primary" value="Submit"/>
</form>
```
| null | CC BY-SA 4.0 | null | 2022-09-18T11:43:53.887 | 2022-09-18T11:46:06.397 | 2022-09-18T11:46:06.397 | 19,602,498 | 19,602,498 | null |
73,762,594 | 2 | null | 22,357,171 | 0 | null | Thanks @Dung Nguyen, for his answer. I found that his solution works well on iOS devices, but not working on macOS when trying to update an attachment in a large NSAttributedString. So I searched for my own solution for that. Here it is
```
let newSize: NSSize = \\ the new size for the image attachment
let originalAttachment: NSTextAttachment = \\ wherever the attachment comes from
let range: NSRange = \\ the range of the original attachment in a wholeAttributedString object which is an NSMutableAttributedString
if originalAttachment.fileWrapper != nil,
originalAttachment.fileWrapper!.isRegularFile {
if let contents = originalAttachment.fileWrapper!.regularFileContents {
let newAttachment = NSTextAttachment()
newAttachment.image = NSImage(data: contents)
#if os(iOS)
newAttachment.fileType = originalAttachment.fileType
newAttachment.contents = originalAttachment.contents
newAttachment.fileWrapper = originalAttachment.fileWrapper
#endif
newAttachment.bounds = CGRect(x: originalAttachment.bounds.origin.x,
y: originalAttachment.bounds.origin.y,
width: newSize.width, height: newSize.height)
let newAttachmentString = NSAttributedString(attachment: newAttachment)
wholeAttributedString.replaceCharacters(in: range, with: newAttachmentString)
}
}
```
Also, on different OS, the image size or bounds an image attachment returns can be different. In order to extract the correct image size, I wrote the following extensions:
```
extension FileWrapper {
func imageSize() -> CPSize? {
if self.isRegularFile {
if let contents = self.regularFileContents {
if let image: CPImage = CPImage(data: contents) {
#if os(iOS)
return image.size
#elseif os(OSX)
if let rep = image.representations.first {
return NSMakeSize(CGFloat(rep.pixelsWide),
CGFloat(rep.pixelsHigh))
}
#endif
}
}
}
return nil
}
}
extension NSTextAttachment {
func imageSize() -> CPSize? {
var imageSize: CPSize?
if self.fileType != nil &&
AttachmentFileType(rawValue: self.fileType!) != nil {
if self.bounds.size.width > 0 {
imageSize = self.bounds.size
} else if self.image?.size != nil {
imageSize = self.image!.size
} else if let fileWrapper = self.fileWrapper {
if let imageSizeFromFileWrapper = fileWrapper.imageSize() {
imageSize = imageSizeFromFileWrapper
}
}
}
return imageSize
}
}
#if os(iOS)
import UIKit
public typealias CPSize = CGSize
#elseif os(OSX)
import Cocoa
public typealias CPSize = NSSize
#endif
#if os(iOS)
import UIKit
public typealias CPImage = UIImage
#elseif os(OSX)
import AppKit
public typealias CPImage = NSImage
#endif
enum AttachmentFileType: String {
case jpeg = "public.jpeg"
case jpg = "public.jpg"
case png = "public.png"
case gif = "public.gif"
}
```
| null | CC BY-SA 4.0 | null | 2022-09-18T11:57:04.397 | 2022-09-20T03:22:25.867 | 2022-09-20T03:22:25.867 | 560,808 | 560,808 | null |
73,762,720 | 2 | null | 73,762,658 | 0 | null | `results.StudentResults` is not of `string` type and your DB framework attempt to convert it to `string`, usually by using `ToString()` method available in all objects. You have to tell the program to convert it into JSON, see [How to serialize and deserialize (marshal and unmarshal) JSON in .NET](https://learn.microsoft.com/en-us/dotnet/standard/serialization/system-text-json-how-to):
```
mycommand.Parameters.AddWithValue(
"@StudentResults",
JsonSerializer.Serialize(results.StudentResults));
```
`System.Collections.Generic.List`1` text is the default `ToString` behavior when you don't implement one yourself.
| null | CC BY-SA 4.0 | null | 2022-09-18T12:15:34.107 | 2022-09-18T12:26:02.087 | 2022-09-18T12:26:02.087 | 653,457 | 653,457 | null |
73,762,815 | 2 | null | 73,759,464 | 0 | null | ```
<div style="max-width: 100%; line-height:30px ">
<p>Contrary to popular belief, Lorem Ipsum is not simply random text.
It has roots in a piece of classical Latin literature from 45 BC, making it over 2000 years old. Richard McClintock, a Latin professor at Hampden-Sydney College in Virginia, looked up one of the more obscure Latin words, consectetur,
from a Lorem Ipsum passage, and going through the cites of the word in classical literature, discovered the undoubtable source. Lorem Ipsum comes from sections 1.10.32 and 1.10.33 of "de Finibus Bonorum et Malorum" (The Extremes of Good and Evil) by Cicero, written in 45 BC.
This book is a treatise on the theory of ethics, very popular during the Renaissance. The first line of Lorem Ipsum, "Lorem ipsum dolor sit amet..", comes from a line in section 1.10.32.
The standard chunk of Lorem Ipsum used since the 1500s is reproduced below for those interested.
Sections 1.10.32 and 1.10.33 from "de Finibus Bonorum et Malorum" by Cicero are also reproduced in their exact original form, accompanied by English versions from the 1914 translation by H. Rackham. </p>
</div>
```
| null | CC BY-SA 4.0 | null | 2022-09-18T12:30:59.320 | 2022-09-18T12:30:59.320 | null | null | 19,995,768 | null |
73,763,461 | 2 | null | 73,763,125 | 0 | null | Try this:
```
function myfunk() {
const ss = SpreadsheetApp.getActive();
const sh = ss.getSheetByName("Sheet0");
const vs = sh.getRange(3,1,sh.getLastRow() - 2,3).getDisplayValues();
const osh = ss.getSheetByName("Sheet1");
osh.clearContents();
let obj = {pA:[]};
vs.forEach((r,i) => {
if(!obj.hasOwnProperty(r[0])) {
obj[r[0]] = {user:[r[1]],sum:Number(r[2])};
obj.pA.push(r[0]);
} else {
obj[r[0]].user.push(r[1]);
obj[r[0]].user = [...new Set(obj[r[0]].user)];
obj[r[0]].sum += Number(r[2])
}
});
let o = [["Date","sumTotal","unique user count"]];
obj.pA.forEach(p => {
o.push([p,obj[p].user.length,obj[p].sum]);
});
osh.getRange(1,1,o.length,o[0].length).setValues(o);
}
```
Data:
| Date | User | Total |
| ---- | ---- | ----- |
| 09/09/2022 | Abc | 100 |
| 09/09/2022 | Hola1 | 100 |
| 09/09/2022 | boygrey | 100 |
| 09/09/2022 | JJ11 | 100 |
| 09/09/2022 | King | 100 |
| 09/09/2022 | Bite00 | 100 |
| 09/09/2022 | Jacob22 | 100 |
| 09/09/2022 | Abc | 50 |
| 09/09/2022 | Hola1 | 50 |
| 09/09/2022 | boygrey | 50 |
| 09/09/2022 | JJ11 | 50 |
| 09/09/2022 | BB12 | 50 |
| 09/09/2022 | toyroom | 50 |
| 10/09/2022 | James | 100 |
Output:
| Date | unique user count | sumTotal |
| ---- | ----------------- | -------- |
| 09/09/2022 | 9 | 1000 |
| 10/09/2022 | 1 | 100 |
| null | CC BY-SA 4.0 | null | 2022-09-18T14:14:25.910 | 2022-09-18T14:14:25.910 | null | null | 7,215,091 | null |
73,763,500 | 2 | null | 73,763,162 | 0 | null | The structure you needs for this is:
```
Users (collection)
$uid (documents)
Todos (collection)
$todoId (documents)
```
After the user is signed in, you can then add a Todo to their collection with:
```
const uid = auth.currentUser.uid;
const todos = collection(db, "Users", uid, "Todos");
const docRef = await addDoc(todos, {
text: input,
completed: false,
});
```
| null | CC BY-SA 4.0 | null | 2022-09-18T14:20:12.107 | 2022-09-18T14:20:12.107 | null | null | 209,103 | null |
73,763,696 | 2 | null | 55,172,274 | 0 | null | If you have a Motorola device running Android 12 or higher (e.g. Moto G62), you can use the "GIF maker" Quick Settings tile:
[](https://i.stack.imgur.com/ZQunPh.png)
| null | CC BY-SA 4.0 | null | 2022-09-18T14:47:40.480 | 2022-09-18T14:47:40.480 | null | null | 1,071,320 | null |
73,763,738 | 2 | null | 59,021,924 | 0 | null | This works like Charm
> npm update eslint
| null | CC BY-SA 4.0 | null | 2022-09-18T14:52:32.163 | 2022-09-18T14:52:32.163 | null | null | 12,961,462 | null |
73,764,225 | 2 | null | 73,761,159 | 0 | null | I'm assuming that as the day of arrival goes with the first night, if someone arrived on 30th April and left on 1st May, that would count one night in April and zero nights in May. Using a slightly modified [overlap formula](https://exceljet.net/formula/calculate-date-overlap-in-days):
```
=IF(MIN(EDATE(C$1,1),$B2)<=MAX(C$1,$A2),"",MIN(EDATE(C$1,1),$B2)-MAX(C$1,$A2))
```
[](https://i.stack.imgur.com/i2pll.png)
assuming that a formula solution is OK.
| null | CC BY-SA 4.0 | null | 2022-09-18T15:55:32.810 | 2022-09-18T16:00:45.813 | 2022-09-18T16:00:45.813 | 3,894,917 | 3,894,917 | null |
73,764,264 | 2 | null | 4,854,839 | 0 | null | To anyone in the future reading this awesome thread and trying to un-pre-multiply colors .
Learned it after 4 hours of trial and error.
| null | CC BY-SA 4.0 | null | 2022-09-18T15:59:40.857 | 2022-09-18T15:59:40.857 | null | null | 19,232,348 | null |
73,764,771 | 2 | null | 73,763,125 | 0 | null | Use double query, first to group by and get unique and second to aggregate:
```
=QUERY(QUERY(A1:C15,"Select A,count(B),sum(C) group by A,B"),"Select Col1,count(Col2),sum(Col3) group by Col1",1)
```
| null | CC BY-SA 4.0 | null | 2022-09-18T17:01:38.960 | 2022-09-18T17:01:38.960 | null | null | 8,404,453 | null |
73,764,830 | 2 | null | 73,764,608 | 1 | null | The way you describe means the image is processed in quite a number of steps to find the coordinates to be used for cropping.
Maybe use these coordinates, but do not crop the processed picture but the original one. With that you should not just get a black page and it may get easier to find if the crop edges were detected correctly.
| null | CC BY-SA 4.0 | null | 2022-09-18T17:09:31.523 | 2022-09-18T17:09:31.523 | null | null | 4,222,206 | null |
73,765,468 | 2 | null | 12,296,904 | 0 | null | Tested on Swift 5.7 / iOS 16 (obviously would work in much earlier versions)
This solution makes use of nested functions to keep handlers and setup local to limited use cases.
```
extension MyViewController : UITableViewDelegate {
@objc func findRowOfTappedButton(sender: UIButton?, event: UIEvent) {
let touches = event.allTouches
let touch = touches!.first
guard let touchPosition = touch?.location(in: self.tableView) else { return }
if let indexPath = tableView.indexPathForRow(at: touchPosition) {
tableView(self.tableView, accessoryButtonTappedForRowWith: indexPath)
}
}
// Note: By implementing the following handler as appropriate delegate method,
// the scheme will still work if accessoryType changes to OS-provided type.
func tableView(_ tableView: UITableView, accessoryButtonTappedForRowWith indexPath: IndexPath) {
tableView.delegate?.tableView!(tableView, didSelectRowAt: indexPath)
// Do whatever when button at this row is pressed.
}
func tableView(_ tableView: UITableView, heightForRowAt indexPath: IndexPath) -> CGFloat {
return 44
}
func tableView(_ tableView: UITableView, didSelectRowAt indexPath: IndexPath) {
// Do whatever when row is selected w/o button press.
}
}
extension MyViewController : UITableViewDataSource {
func numberOfSections(in tableView: UITableView) -> Int {
return 1
}
func tableView(_ tableView: UITableView, numberOfRowsInSection section: Int) -> Int {
return myContent.count
}
func tableView(_ tableView: UITableView, cellForRowAt indexPath: IndexPath) -> UITableViewCell {
func addAccessoryButtonToCell(_ cell : UITableViewCell) {
let image = UIImage(systemName: "paintpalette")
let button = UIButton(type: .custom)
button.frame = CGRect(x:0, y:0, width: 20, height: 20)
button.setImage(image, for: .normal)
button.addTarget(self, action: #selector(findRowOfTappedButton(sender:event:)), for: .touchUpInside)
cell.accessoryView = button
}
let cell = tableView.dequeueReusableCell(withIdentifier: "MyReusableCell", for: indexPath)
addAccessoryButtonToCell()
content.attributedText = NSAttributedString(string: myContent[indexPath.row], attributes: myAttributes[indexPath.row])
}
}
```
| null | CC BY-SA 4.0 | null | 2022-09-18T18:34:06.980 | 2022-09-18T18:34:06.980 | null | null | 2,079,103 | null |
73,765,672 | 2 | null | 73,765,616 | 1 | null | Maybe a combination of two gradients:
```
.box {
width: 250px;
aspect-ratio: 1;
background: linear-gradient(red 20%, blue);
position: relative;
z-index: 0;
}
.box:before {
content: "";
position: absolute;
z-index: -1;
inset: 0;
background: inherit; /* use the same gradient */
transform: rotate(-90deg); /* rotate it */
clip-path: polygon(100% 0, 100% 100%, 0 100%); /* show only half of the element */
}
```
```
<div class="box"></div>
```
| null | CC BY-SA 4.0 | null | 2022-09-18T19:02:19.923 | 2022-09-18T19:02:19.923 | null | null | 8,620,333 | null |
73,765,926 | 2 | null | 70,986,530 | 32 | null | Here is how to open the Android Studion Emulator in a separate window.
- `File``Settings...`- `Tools``Emulator``Launch in a tool window`
[](https://i.stack.imgur.com/aru76.png)
| null | CC BY-SA 4.0 | null | 2022-09-18T19:41:40.993 | 2022-11-17T11:54:06.917 | 2022-11-17T11:54:06.917 | 4,718,406 | 4,718,406 | null |
73,767,144 | 2 | null | 73,766,724 | 0 | null |
```
=ArrayFormula(COUNTA(B1:E2)-SUM(IF(B1:E2=TRUE,1,0)))
```
[](https://i.stack.imgur.com/580sK.png)
## Named functions - why not
Go to: Data > named functions
Lets name the function DEUCECOUNTA
and paste this in formula definition
```
=ArrayFormula(COUNTA(range)-SUM(IF(range=TRUE,1,0)))
```
Paste "" this in the argument place holders and press enter.
```
=DEUCECOUNTA(B1:E2)
```
[](https://i.stack.imgur.com/LUvFn.png)
## Demo
[](https://i.stack.imgur.com/dA9tj.gif)
| null | CC BY-SA 4.0 | null | 2022-09-18T23:58:35.490 | 2022-09-19T01:40:18.440 | 2022-09-19T01:40:18.440 | 19,529,694 | 19,529,694 | null |
73,767,309 | 2 | null | 73,766,724 | 1 | null | try this:
```
=8-SUMPRODUCT(B1:E2)
```
[](https://i.stack.imgur.com/Gx9Fw.png)
| null | CC BY-SA 4.0 | null | 2022-09-19T00:45:31.183 | 2022-09-19T00:45:31.183 | null | null | 5,632,629 | null |
73,767,631 | 2 | null | 73,749,060 | 0 | null | The solution was:
```
panel.border = element_rect(fill = NA,
size=1.3, linetype="solid",
colour ="grey50")
```
| null | CC BY-SA 4.0 | null | 2022-09-19T01:54:20.070 | 2022-09-19T01:54:20.070 | null | null | 19,926,767 | null |
73,768,798 | 2 | null | 71,761,490 | 0 | null | First navigate to the directory where the manifest is present.Then use the below code:
`az deployment group create --resource-group learnStorage1 --template-file azuredeploy.json`
| null | CC BY-SA 4.0 | null | 2022-09-19T05:18:51.340 | 2022-09-19T05:18:51.340 | null | null | 20,030,502 | null |
73,769,302 | 2 | null | 73,730,503 | 0 | null | My guess is that you have some pre-processing done on your test data that is not performed on the new images. Specifically, I would look into image normalization: In most image processing neural networks input images are normalized to have (roughly) zero mean and unit variance. If this kind of normalization is part of your training/evaluation code you must have the same normalization also for the new images before processing them by the trained U-net.
| null | CC BY-SA 4.0 | null | 2022-09-19T06:31:50.753 | 2022-09-19T06:31:50.753 | null | null | 1,714,410 | null |
73,769,395 | 2 | null | 71,681,015 | 3 | null | I had this same issue, and after updating the Android emulator to the latest stable version (31.3.10-8807927), I have not experienced this anymore.
I did the update via Android Studio's "Check for updates".
| null | CC BY-SA 4.0 | null | 2022-09-19T06:42:55.937 | 2022-09-19T06:42:55.937 | null | null | 729,282 | null |
73,771,322 | 2 | null | 73,669,372 | 0 | null | This is purely related to Delphi and not the DBMS (MySQL or others). What you are trying to achieve is showing data from your main form's dataset on a second form for details (shown as modal).
You need to be more specific about your implementation :
- - -
---
Here are the possible steps for your case :
Suppose your dataset control is named ''Dataset'', your main form is ''Form1'', and the detail form is ''Form2''.
If your dataset is on your main form, to avoid circular dependency you have to declare :
- -
If your dataset is on an independent "DataModule", then you have to declare :
- -
Go to the DBGrid "OnCellClick" event (since you only want to click on the cell), write a code to check the column's FieldName if it is ''Id'' or ''Last Name'' or whatever you want, then show the detail form (ShowModal)
```
procedure TForm1.DBGrid1CellClick(Column: TColumn);
begin
//Add whatever fields you want
If (Column.FieldName = 'Id') or (Column.FieldName = 'Last Name') then
Form2.ShowModal;
end;
```
In the detail form, there are two possible Implementations :
- -
```
procedure TForm2.FormShow(Sender: TObject);
begin
Label1.Caption := Format('Details of %s %s - Id : %u', [Form1.Dataset.FirstNameField.AsString, Form1.Dataset.LastNameField.AsString, Form1.Dataset.IdField.AsInteger]);
end;
```
Or like this :
```
procedure TForm2.FormShow(Sender: TObject);
var
FirstName, LastName: string;
Id: Integer;
begin
FirstName := Form1.Dataset.FirstNameField.AsString;
LastName := Form1.Dataset.LastNameField.AsString;
Id := Form1.Dataset.IdField.AsInteger;
end;
```
There is a known issue, the second form ''OnShow" event is fired only on the first call to ''ShowModal'' after form creation, and not in subsequent calls.
As a workaround, you have to either release or hide the detail form when you close it.
You can do this through the detail form ''OnClose'' event, by setting a value for the close action (''caFree'' or ''caHide'').
```
procedure TForm2.FormClose(Sender: TObject; var Action: TCloseAction);
begin
Action := caHide;
end;
```
If you want to update the current record from the detail form, you have to put a control (like a button) for validation in the detail form with an "OnClick" event handler that will commit the changes to the dataset and close the detail form.
There is also the form's ''ModalResult'' property that, when assigned a non-zero value, will close the modal form and return that value to the function ''ShowModal'' called in the main form :
- -
If you call the Close method in a modal form, then "ModalResult" is automatically set to "mrCancel".
Here is an example for updating the record without need for ''ModalResult''property (if your dataset is on a DataModule, then replace "Form1" with the name of the DataModule) :
```
procedure TForm2.BtnSaveClick(Sender: TObject);
begin
try
Form1.Dataset.Edit;
try
Form1.Dataset.FirstNameField.AsString := EditFirstName.Caption;
Form1.Dataset.LastNameField.AsString := EditLastName.Caption;
Form1.Dataset.Post;
except
Form1.Dataset.Cancel;
end;
finally
Close;
end;
end;
```
| null | CC BY-SA 4.0 | null | 2022-09-19T09:30:53.087 | 2022-09-19T10:17:15.283 | 2022-09-19T10:17:15.283 | 15,611,794 | 15,611,794 | null |
73,771,371 | 2 | null | 73,761,986 | 2 | null | So from what I can see from your code, this is not a svelte problem - rather something you need to fix when implementing the daisyUI modal component.
I'm not any daisyUI developer, but from what I can tell the `<label for="my-modal-6" class="btn modal-button">open modal</label>` is pointing to `<input type="checkbox" id="my-modal-6" class="modal-toggle" />` and opening the modal by the id `my-modal-6`.
So it seems like you are creating all the proper modals with the correct data, but you are giving them the same id.
You also need to change this id so it's unique.
Otherwise, like in your example, you're only going to open that specific or the first found modal with that id (my-modal-6).
Here is an example to fix it:
```
{#each seller.products as product(product.Products_id.id)}
<label for="my-modal-{product.Products_id.id}" class="btn modal-button">open modal</label>
<input type="checkbox" id="my-modal-{product.Products_id.id}" class="modal-toggle" />
<div class="modal modal-bottom sm:modal-middle">
<div class="modal-box">
<h3 class="font-bold text-lg">{product.Products_id.name}</h3>
<figure>
<img src="http://localhost:8055/assets/{product.Products_id.image.id}?fit=cover&width=400&height=225&quality=100" alt="Shoes" />
</figure>
<p class="py-4">{product.Products_id.description}</p>
<div class="modal-action">
<label for="my-modal-{product.Products_id.id}" class="btn">add to cart</label>
</div>
</div>
</div>
{/each}
```
| null | CC BY-SA 4.0 | null | 2022-09-19T09:35:56.410 | 2022-09-19T09:35:56.410 | null | null | 14,372,912 | null |
73,771,410 | 2 | null | 73,770,603 | 0 | null | You method will be very slow when both table is large.
I have deal with similar problem. The logic is like that:
```
Dim Range1 as Variant, Range2 as Variant
Range1 = ....
Range2 = .... (include 1 more column at the end)
Use for loop to put row number into the last column of Range2.
Call quicksort(Range2,1,norow2)
For i = 1 to norow1
result = Search(Range1(i,1),Range2)
If result >0 (you can do anything you want here)
next i
```
You can find quicksort and search function with nlogn speed instead of n^2 speed in stackoverflow easily. I just show the logic, the above is not VBA code.
| null | CC BY-SA 4.0 | null | 2022-09-19T09:38:14.603 | 2022-09-19T09:38:14.603 | null | null | 17,453,013 | null |
73,772,118 | 2 | null | 71,637,468 | 0 | null | I tried [https://googlechrome.github.io/devtools-samples/jank/](https://googlechrome.github.io/devtools-samples/jank/) and set the CPU "6x slowdown" in the Performance tab. The animation became significantly janky, while the Frame Rate was still very close to 60 fps.
It seems that the FPS meter is not accurate.
| null | CC BY-SA 4.0 | null | 2022-09-19T10:39:45.590 | 2022-09-19T10:39:45.590 | null | null | 227,701 | null |
73,772,115 | 2 | null | 73,771,872 | 0 | null | A1 is not null, B1 is not "East". Both are true for C1. You're looking for `and`. See [De Morgan's law](https://en.wikipedia.org/wiki/De_Morgan%27s_laws): When you negate, you use `and`.
```
=QUERY(A1:B14,"Select * Where A is not null and B<>'West' and B<>'East'")
```
Or
```
=QUERY(A1:B14,"Select * Where A is not null and not (B='West' or B='East')")
```
| null | CC BY-SA 4.0 | null | 2022-09-19T10:39:33.360 | 2022-09-19T10:39:33.360 | null | null | 8,404,453 | null |
73,772,226 | 2 | null | 73,771,872 | 0 | null | use:
```
=QUERY(A1:B14, "where A is not null and not B matches 'West|East'", )
```
| null | CC BY-SA 4.0 | null | 2022-09-19T10:49:59.200 | 2022-09-19T10:49:59.200 | null | null | 5,632,629 | null |
73,772,289 | 2 | null | 73,770,163 | 0 | null | use:
```
=ARRAYFORMULA(IF(B3:B=TRUE, E3:E, ))
```
[](https://i.stack.imgur.com/OedyU.png)
or skip the blanks like:
```
=FILTER(E3:E, B3:B=TRUE)
```
| null | CC BY-SA 4.0 | null | 2022-09-19T10:55:39.767 | 2022-09-19T10:55:39.767 | null | null | 5,632,629 | null |
73,772,425 | 2 | null | 71,591,971 | 12 | null | I just had this problem on a new Macbook Pro with macOS Monterey, and the below worked for me using Homebrew.
Using `alias` is not necessary when using Pyenv. Tested with Atom 1.60.0 and atom-python-run 0.9.7.
1. Install pyenv (https://github.com/pyenv/pyenv#installation) and its dependencies (https://github.com/pyenv/pyenv/wiki#suggested-build-environment): brew install pyenv
brew install openssl readline sqlite3 xz zlib tcl-tk
2. Install Python 3.10.6 but I assume other 3.x versions should work as well: pyenv install 3.10.6
3. Add Pyenv to your shell according to the instructions in https://github.com/pyenv/pyenv#set-up-your-shell-environment-for-pyenv. In your home directory: echo 'export PYENV_ROOT="$HOME/.pyenv"' >> ~/.zshrc
echo 'command -v pyenv >/dev/null || export PATH="$PYENV_ROOT/bin:$PATH"' >> ~/.zshrc
echo 'eval "$(pyenv init -)"' >> ~/.zshrc
4. Make the installed Python available everywhere (this can be overridden per project or folder, if necessary): pyenv global 3.10.6
Now, the output looks like this:
```
% which python
/Users/jl/.pyenv/shims/python
% python --version
Python 3.10.6
```
If some scripts still fail, check that you have added Pyenv to the necessary shell startup file(s) as mentioned in step 3 above.
| null | CC BY-SA 4.0 | null | 2022-09-19T11:07:26.373 | 2022-09-19T22:43:36.193 | 2022-09-19T22:43:36.193 | 505,650 | 505,650 | null |
73,772,947 | 2 | null | 73,772,247 | 0 | null | what us the purpose of the inline subquery
```
((SELECT ProjectInformationId_PK FROM Project_Information WHERE ProjectInformationId_PK = @ProjectInformationId_FK)
```
I believe it is redundant ,you are assigning the same value to ProjectInformationId_FK again , so you can omit it and user the following
```
values ( @ProjectInformationId_FK, @PastExperienceInDomain, @PastExperienceInTechnology, @MultipleTechnologiesOrPlatforms, @ClarityOfRequirements, @AverageAgeOfApplication, @QualityOfApplication, @ResourceCapability, @UsageOfProductivityTools, @InterdependenceWithOtherModules, @ComplexityInDatabaseChanges, @TestEnvironmentStability, @ComplexityOfTesting, @BusinessCriticality, @IsOverrideCalculation, @ProductivityFactor, @PermanentRatio, @RotationalRatio, @OffshoreRatio, @Remarks)";
```
| null | CC BY-SA 4.0 | null | 2022-09-19T11:51:07.097 | 2022-09-19T11:51:07.097 | null | null | 14,105,365 | null |
73,773,049 | 2 | null | 73,771,642 | 0 | null | I install the 2.1.1 version of phantomjs.
Follow this [https://gist.github.com/julionc/7476620](https://gist.github.com/julionc/7476620) but replace 1.9.8 by 2.1.1.
It works !
| null | CC BY-SA 4.0 | null | 2022-09-19T12:00:24.423 | 2022-09-19T12:00:24.423 | null | null | 17,242,570 | null |
73,773,184 | 2 | null | 73,773,038 | 2 | null | Because the x axis is discrete, you need to ensure that you give each x value the same `group` aesthetic:
```
library(ggplot2)
ggplot(data, aes(age, result, group = 1)) +
geom_smooth(method = "glm", formula = y ~ x, colour = "black",
method.args = list(family = binomial))
```
[](https://i.stack.imgur.com/FkL4k.png)
---
However, I'm not sure how meaningful this end result is, since your x axis groups are discrete, and it therefore doesn't make a lot of sense to have a continuous line or SE between them. If this were me, I would probably use point estimates with error bars:
```
pred_df <- data.frame(age = c('50 and older', '18-49 years old'))
fit <- predict(model, newdata = pred_df, se.fit = TRUE, type = 'response')
pred_df$fit <- fit$fit
pred_df$upper <- fit$fit + 1.96 * fit$se.fit
pred_df$lower <- fit$fit - 1.96 * fit$se.fit
ggplot(pred_df, aes(age, fit)) +
geom_errorbar(aes(ymin = lower, ymax = upper), width = 0.25) +
geom_point(size = 3) +
ylim(c(0, 1))
```
[](https://i.stack.imgur.com/G6UuE.png)
```
set.seed(1)
data <- data.frame(age = rep(c('50 and older', '18-49 years old'), each = 3000),
result = rbinom(6000, 1, rep(c(0.3, 0.5), each = 3000)))
```
| null | CC BY-SA 4.0 | null | 2022-09-19T12:13:40.277 | 2022-09-19T12:22:06.320 | 2022-09-19T12:22:06.320 | 12,500,315 | 12,500,315 | null |
73,773,215 | 2 | null | 71,272,359 | 0 | null | The problem is that a subpage does not have all the pixels. The sum of the two subpages results in a complete frame. When there are fast movements you will always find this problem, because each subpage has been captured at different times and the object is in another place. In the data sheet "Reading patterns" you can read the explanation and see that there are two different patterns. default chess
[chess pattern](https://i.stack.imgur.com/XzjeJ.jpg)
Some libraries allow you to read a subpage instead of the full frame, that is useful because you could interpolate the missing pixels, with the advantage of not getting the pattern, and getting "more frames per second", but you will lose definition.
edit:
Also,the refresh rate also influences, you can configure it to from 0.5hz to 64hz.
| null | CC BY-SA 4.0 | null | 2022-09-19T12:16:00.097 | 2022-09-19T12:19:57.377 | 2022-09-19T12:19:57.377 | 20,032,678 | 20,032,678 | null |
73,773,217 | 2 | null | 73,770,905 | 8 | null | [Nic Schraudolph](https://stackoverflow.com/a/50379934/2144669), author of the paper describing the exponential approximation that the previous version of this answer uses, suggests the following. It has error 0.5%.
Java implementation (for portable bit munging):
```
public class Tanh {
private static final float m = (float)((1 << 23) / Math.log(2));
private static final int b = Float.floatToRawIntBits(1);
private static float tanh(float x) {
int y = (int)(m * x);
float exp_x = Float.intBitsToFloat(b + y);
float exp_minus_x = Float.intBitsToFloat(b - y);
return (exp_x - exp_minus_x) / (exp_x + exp_minus_x);
}
public static void main(String[] args) {
double error = 0;
int end = Float.floatToRawIntBits(10);
for (int i = 0; i <= end; i++) {
float x = Float.intBitsToFloat(i);
error = Math.max(error, Math.abs(tanh(x) - Math.tanh(x)));
}
System.out.println(error);
}
}
```
| null | CC BY-SA 4.0 | null | 2022-09-19T12:16:30.527 | 2022-09-19T15:06:38.017 | 2022-09-19T15:06:38.017 | 2,144,669 | 2,144,669 | null |
73,773,322 | 2 | null | 73,763,947 | 0 | null | The issue was that the procedure `populateTree` needed to be `::populateTree` so it could be found within the namespace.
: I still can't print selection to console...
| null | CC BY-SA 4.0 | null | 2022-09-19T12:26:28.443 | 2022-09-25T18:53:17.487 | 2022-09-25T18:53:17.487 | 14,393,739 | 20,003,976 | null |
73,773,470 | 2 | null | 73,773,440 | 1 | null | Use the `despine=False` option of [PairGrid](https://seaborn.pydata.org/generated/seaborn.PairGrid.html):
```
import seaborn as sns
penguins = sns.load_dataset("penguins")
g = sns.PairGrid(penguins, despine=False)
g.map(sns.scatterplot)
```
Example:
[](https://i.stack.imgur.com/e5MhM.png)
| null | CC BY-SA 4.0 | null | 2022-09-19T12:38:36.800 | 2022-09-19T12:38:36.800 | null | null | 16,343,464 | null |
73,773,536 | 2 | null | 73,772,962 | 2 | null | Use 6 colspan instead of 5 in `<th width="70%" colspan="6">Janvier</th>` use 2 colspan for `Mercredi` like this `<th colspan="2">Mercredi</th>` use 3 colspan for each `tache` like this
```
<td colspan="3">tache1</td>
<td colspan="3">tache2</td>
```
Also In your setup, Equip1 is taking 2 rows but its content to the right take only 1 row.
so use rowspan"1" for both Equipe1 and 2.
```
<table width="600" border="2" cellspacing="1" cellpadding="1">
<tr>
<th width="15%" rowspan="2">Equipes</th>
<th width="70%" colspan="6">Janvier</th>
<td width="15%" rowspan="2"></td>
</tr>
<tr>
<th>Lundi</th>
<th>Mardi</th>
<th colspan="2">Mercredi</th>
<th>Jeudi</th>
<th>Vendredi</th>
</tr>
<tr>
<td rowspan="1">Equipe1</td>
<td colspan="3">tache1</td>
<td colspan="3">tache2</td>
<td rowspan="2">Semaine1</td>
</tr>
<tr>
<td rowspan="1">Equipe2</td>
<td colspan="3">tache1</td>
<td colspan="3">tache2</td>
</tr>
</table>
```
| null | CC BY-SA 4.0 | null | 2022-09-19T12:43:59.903 | 2022-09-19T13:48:13.363 | 2022-09-19T13:48:13.363 | 6,467,902 | 6,467,902 | null |
73,775,367 | 2 | null | 73,775,189 | 4 | null | It looks like this data set has the wrong projection associated with it. Its units imply that the projection should be SWEREF99, which is EPSG:3006, so the following code should fix it:
```
ggplot(st_set_crs(x, 3006)) + geom_sf()
```
[](https://i.stack.imgur.com/EwUfS.png)
You'll get a warning that you are not re-projecting the data; this is OK, since you are fixing the wrong projection rather than transforming the projection.
| null | CC BY-SA 4.0 | null | 2022-09-19T14:52:14.817 | 2022-09-19T14:58:42.343 | 2022-09-19T14:58:42.343 | 12,500,315 | 12,500,315 | null |
73,775,385 | 2 | null | 62,896,294 | 0 | null | As mentioned in [this answer](https://stackoverflow.com/a/21626506/6908282), you can use `https://accounts.google.com/o/oauth2/revoke?token=" + current_token)` to allow the user to revoke access to the api.
Below is the function for the same:
```
function revokeToken() {
user_info_div.innerHTML = "";
chrome.identity.getAuthToken({ interactive: false },
function (current_token) {
if (!chrome.runtime.lastError) {
// @corecode_begin removeAndRevokeAuthToken
// @corecode_begin removeCachedAuthToken
// Remove the local cached token
chrome.identity.removeCachedAuthToken({token: current_token}, function(){});
// @corecode_end removeCachedAuthToken
// Make a request to revoke token in the server
var xhr = new XMLHttpRequest();
xhr.open(
"GET",
"https://accounts.google.com/o/oauth2/revoke?token=" + current_token);
xhr.send();
// @corecode_end removeAndRevokeAuthToken
// Update the user interface accordingly
changeState(STATE_START);
sampleSupport.log("Token revoked and removed from cache. " +
"Check chrome://identity-internals to confirm.");
}
});
}
```
| null | CC BY-SA 4.0 | null | 2022-09-19T14:53:10.937 | 2022-09-19T14:53:10.937 | null | null | 6,908,282 | null |
73,775,570 | 2 | null | 73,773,889 | 0 | null | you can add these lines of code to remove the backgroundColor from AppBar widget.
```
backgroundColor: Colors.transparent,
elevation: 0
```
If you want to implement it from zero, you can use a Row with 2 children. First child (a Text) for the title and the second one (a Row) for buttons. Don't remember to set mainAxisAlignment to `MainAxisAlignment.spaceBetween`.
I hope this help you
---
Here is the code:
```
import 'dart:ui';
import 'package:flutter/material.dart';
class MyHomePage extends StatefulWidget {
const MyHomePage({Key? key, this.title = "Hallo"}) : super(key: key);
final String title;
@override
_MyHomePageState createState() => _MyHomePageState();
}
class _MyHomePageState extends State<MyHomePage> {
@override
Widget build(BuildContext context) {
return Scaffold(
body: Container(
decoration: const BoxDecoration(
// color: Colors.cyan,
image: DecorationImage(
alignment: Alignment.topRight,
image: AssetImage("lib/assets/images/Bg.png"),
),
),
child: Container(
decoration: const BoxDecoration(
image: DecorationImage(
alignment: Alignment.topRight,
image: AssetImage(
"lib/assets/images/Bg2.png",
),
scale: 1.05,
),
),
child: CustomScrollView(
slivers: [
SliverAppBar(
elevation: 0,
shape: const RoundedRectangleBorder(
borderRadius: BorderRadius.vertical(
bottom: Radius.circular(30),
),
),
backgroundColor: Colors.transparent,
automaticallyImplyLeading: false,
floating: false,
snap: false,
pinned: true,
stretch: true,
actions: [
Container(
decoration: BoxDecoration(
gradient: LinearGradient(
colors: [
const Color.fromARGB(255, 197, 193, 193),
const Color.fromARGB(255, 167, 156, 156)
.withOpacity(0.8),
],
begin: Alignment.topLeft,
end: Alignment.bottomRight,
),
borderRadius: BorderRadius.circular(12)),
padding: const EdgeInsets.all(2),
child: const Icon(Icons.notifications),
),
const SizedBox(width: 10),
//Profile
ClipOval(
child: Container(
decoration: BoxDecoration(
gradient: LinearGradient(
colors: [
const Color(0xFFFFFFFF),
const Color(0xFF000000).withOpacity(0),
],
begin: Alignment.topLeft,
end: Alignment.bottomRight,
),
borderRadius: BorderRadius.circular(16),
),
padding: const EdgeInsets.all(10),
child: Container(
decoration: BoxDecoration(
borderRadius: BorderRadius.circular(10),
image: const DecorationImage(
image:
ExactAssetImage('lib/assets/images/baki.jpg'),
fit: BoxFit.fill,
),
),
),
),
),
],
title: const Text(
"Startseite",
style: TextStyle(color: Colors.black),
),
bottom: AppBar(
elevation: 0,
automaticallyImplyLeading: false,
backgroundColor: Colors.transparent,
title: Container(
decoration:
BoxDecoration(borderRadius: BorderRadius.circular(12)),
child: Row(
mainAxisAlignment: MainAxisAlignment.spaceBetween,
children: [
Padding(
padding: const EdgeInsets.only(bottom: 10.0),
child: Stack(
children: [
Padding(
padding: const EdgeInsets.only(top: 3.0),
child: Container(
width:
MediaQuery.of(context).size.width * 0.5,
height: MediaQuery.of(context).size.height *
0.025,
decoration: BoxDecoration(
gradient: LinearGradient(
colors: [
const Color(0xFF4B4646)
.withOpacity(0.6),
const Color(0xFFFFFFFF)
.withOpacity(0.2),
],
begin: Alignment.centerLeft,
end: Alignment.centerRight,
),
borderRadius: BorderRadius.circular(12),
),
child: Padding(
padding: const EdgeInsets.symmetric(
vertical: 5.0),
child: Padding(
padding: const EdgeInsets.only(left: 4.0),
child: Text(
"Suchen",
textAlign: TextAlign.start,
style: TextStyle(
fontFamily: "Acme-Regular",
color: Colors.grey.shade200,
fontSize: 10),
),
),
),
),
),
Padding(
padding: const EdgeInsets.only(
left: 170.0,
),
child: Container(
decoration: BoxDecoration(
color:
Colors.grey.shade300.withOpacity(0.4),
borderRadius: BorderRadius.circular(12)),
padding: const EdgeInsets.all(5),
child: const Icon(Icons.search,
size: 20, color: Colors.green),
),
),
],
),
),
Padding(
padding: const EdgeInsets.only(bottom: 12),
child: Container(
decoration: BoxDecoration(
color: Colors.grey.shade300.withOpacity(0.4),
borderRadius: BorderRadius.circular(12)),
child: const Icon(Icons.filter_alt,
size: 22, color: Colors.green),
),
),
],
),
),
),
),
SliverFillRemaining(
child: Expanded(
child: ListView(
padding: const EdgeInsets.all(8),
children: <Widget>[
Container(
height: 50,
color: Colors.amber[600],
child: const Center(child: Text('Entry A')),
),
Container(
height: 50,
color: Colors.amber[500],
child: const Center(child: Text('Entry B')),
),
Container(
height: 50,
color: Colors.amber[100],
child: const Center(child: Text('Entry C')),
),
],
),
),
),
],
),
),
),
);
}
}
```
| null | CC BY-SA 4.0 | null | 2022-09-19T15:06:54.603 | 2022-09-20T05:27:01.090 | 2022-09-20T05:27:01.090 | 13,008,581 | 13,008,581 | null |
73,775,636 | 2 | null | 73,775,476 | 0 | null | Use `query` to groupby and `sortn` to sort and limit to top 10
```
=SORTN(QUERY(A1:A15,"select A, count(A) group by A"),10,1,2,0)
```
| null | CC BY-SA 4.0 | null | 2022-09-19T15:12:03.740 | 2022-09-19T15:12:03.740 | null | null | 8,404,453 | null |
73,775,764 | 2 | null | 73,771,942 | 0 | null | ```
function patienttoggle() {
let patientTable = document.getElementById("Patient-Table");
if(patientTable.style.display == "none") {
patientTable.style.display = "block";
}else{
patientTable.style.display = "none";
}
}
```
Heres my upadted JS CODE
| null | CC BY-SA 4.0 | null | 2022-09-19T15:21:10.097 | 2022-09-19T15:21:10.097 | null | null | 17,963,317 | null |
73,776,541 | 2 | null | 73,776,337 | 0 | null | You could combine two lists (even and odds of the DataFrame column) to switch the values around:
```
df["bowler_PCA"] = [z for x, y in zip(df["bowler_PCA"].iloc[1::2], df["bowler_PCA"].iloc[::2]) for z in [x, y]]
```
| null | CC BY-SA 4.0 | null | 2022-09-19T16:28:15.253 | 2022-09-19T16:28:15.253 | null | null | 18,571,565 | null |
73,776,900 | 2 | null | 73,774,836 | 0 | null |
### Add Y to range with searched for substrings
```
function fss() {
const ss = SpreadsheetApp.getActive():
const sh = ss.getSheetByName("AC3");
const sh0 = ss.getSheetByName("Tracking");
const sA = sh0.getRange(2,1,sh.getLastRow() - 1).getValues().flat();//names
const rg = sh.getRange("C4:N" + sh.getLastRow());//search range
sa.forEach((s,i) => {
rg.createTextFinder(s).matchEntireCell(false).findAll().forEach(r => {
r.setValue(r.getValue() + "Y")
});
});
}
```
| null | CC BY-SA 4.0 | null | 2022-09-19T17:01:38.710 | 2022-09-19T18:37:26.067 | 2022-09-19T18:37:26.067 | 7,215,091 | 7,215,091 | null |
73,777,233 | 2 | null | 73,727,517 | 5 | null | I was facing the same problem
That's how I solved it:
1. You have to access the section where the Xcode accounts are. To access it you can do it through the View accounts button that appears in the warning or through the Xcode > Preferences > Accounts menu.
2. Once there, select the account that appears in the warning and click on the - button at the bottom of the dialog.
3. Once the account is removed, in the same section, click on the + button and add that account again by selecting Apple ID account type (it will ask you to log in).
4. Restart Xcode to apply the changes (although the warning should be gone by now).
Hope this helps!
| null | CC BY-SA 4.0 | null | 2022-09-19T17:34:00.537 | 2022-09-19T17:36:02.913 | 2022-09-19T17:36:02.913 | 14,378,554 | 14,378,554 | null |
73,777,427 | 2 | null | 72,971,833 | 0 | null | `plt.tight_layout()` may fix the problem.
| null | CC BY-SA 4.0 | null | 2022-09-19T17:50:49.303 | 2022-09-19T17:50:49.303 | null | null | 8,081,835 | null |
73,777,704 | 2 | null | 38,068,774 | 0 | null | enter dev.off() command and Enter, it will fix the problem.
| null | CC BY-SA 4.0 | null | 2022-09-19T18:18:47.977 | 2022-09-19T18:18:47.977 | null | null | 19,344,697 | null |
73,778,075 | 2 | null | 73,777,733 | 0 | null | Assuming that by DEVOPS variables, you mean environment variables were created, then you would be able to access them using `$_ENV['VARIABLE_NAME']`
| null | CC BY-SA 4.0 | null | 2022-09-19T18:53:46.260 | 2022-09-19T18:53:46.260 | null | null | 11,585,079 | null |
73,778,152 | 2 | null | 73,776,337 | 0 | null | This one here seems to work:
```
data = pd.DataFrame({"matchId": [1, 1, 2, 2], "bowler_PCA": [-1, 1, -2, 2]})
data["bowler_PCA"] = data.groupby("matchId")["bowler_PCA"].transform(lambda x: x.iloc[::-1].values)
```
With output
```
a b
0 1 1
1 1 -1
2 2 2
3 2 -2
```
| null | CC BY-SA 4.0 | null | 2022-09-19T19:00:48.063 | 2022-09-19T19:00:48.063 | null | null | 5,985,921 | null |
73,778,343 | 2 | null | 73,774,836 | 0 | null | I think I just found a useable code, actually:
```
=IF(ISTEXT(INDEX(FILTER('AC 3'!$B$4:$B,SEARCH($A20,'AC 3'!$B$4:$B)),1)),"Y","")
```
There is one more element I would like to implement from the previous code. In the previous code, it searched for the named range `courseACs`, and if the title (`$A$1`) is found in the name range, it would have a designated number of columns needed for that webinar duration (three columns per hour of duration).
Let's say the webinar title `Ethics` is two hours long and would need six columns for chat records. The formula then looks at the column and if it is in a column that resides after the sixth column for attentiveness tracking (Column K) then `-` will reflect in the cell. The original code is shown below:
```
=IF(IFERROR(E$5<=SEARCH(RIGHT($A$1,LEN($A$1)-15),courseACs,4),true),IF(OR(ISNUMBER(MATCH($A6,'AC 1'!C$4:C$2000,0))),"Y"," "),"-")
```
| null | CC BY-SA 4.0 | null | 2022-09-19T19:22:11.233 | 2022-09-27T21:25:20.923 | 2022-09-27T21:25:20.923 | 3,025,856 | 17,916,934 | null |
73,778,661 | 2 | null | 32,743,794 | 0 | null | I'm not sure I understand what you want to achieve. Is it something like this :
```
<svg id="main-box" viewBox="0 0 100 40" preserveAspectRatio="none" xmlns="http://www.w3.org/2000/svg">
<polygon points="0,0 73,0 100,40 27,40" />
</svg>
```
| null | CC BY-SA 4.0 | null | 2022-09-19T19:58:16.870 | 2022-09-19T19:58:16.870 | null | null | 8,803,312 | null |
73,779,153 | 2 | null | 73,779,094 | 1 | null | Use redux or react context please,
props drilling is bad practice
[https://reactjs.org/docs/context.html](https://reactjs.org/docs/context.html)
[https://redux.js.org/](https://redux.js.org/)
| null | CC BY-SA 4.0 | null | 2022-09-19T20:50:21.903 | 2022-09-19T20:50:21.903 | null | null | 18,217,435 | null |
73,779,243 | 2 | null | 73,779,094 | 1 | null |
### Through useState + props (less recommended)
You can do that by having that state in your App component and passing the setState as a property
```
const App = () => {
const [maximize, setMaximize] = useState(false);
const handleToggle = (newState) => {
setState(newState)
}
return (
<div>
<Panel toggleState={toggleState} maximize={maximize} />
</div>
)
}
```
And in your Panel component:
```
const Panel = ({toggleState, maximize}) => {
const handleToggle = () => {
toggleState(!maximize)
}
return (
<AiOutlineExpandAlt onClick={handleToggle} />
)
}
```
### Through useContext hook
useContext allows you to store variables and access them on all child components within that context provider.
```
import React, {useState, useContext} from "react";
//creating your contexts
const MaximizeContext = React.createContext();
const MaximizeUpdateContext = React.createContext();
// create a custom hook
export const useUpdate = () => {
return useContext(MaximizeUpdateContext)
}
export const useMaximize = () => {
return usecContext(MaximizeContext)
}
//creating your component that will wrap the child components
const MaximizeProvider = ({children}) => {
const [maximize, setMaximize] = useState(false)
// Your toggle to switch the state
const toggle = () => {
setMaximize(prevState => !prevState)
}
return (
<MaximizeContext.Provider value={maximize}>
<MaximizeUpdateContext.Provider value={toggle}>
{children}
</MaximizeUpdateContext.Provider>
</MaximizeContext.Provider>
)
}
export {MAximizeProvider}
```
Both providers allow you to access both the state and the setState
```
import React, {useState} from "react";
// your context component
import {MaximizeProvider} from "./MaximizeProvider";
// a button component
import {ButtonComponent} from "./ButtonComponent";
const App = () => {
return (
<>
<MaximizeProvider>
<ButtonComponent/>
</MaximizeProvider>
< />
);
}
export {App};
```
in the App, you are wrapping the elements that need your context.
as long as the elements and even children of children are in the wrap, it would have access to it the same way as in the button component.
```
import {useMaximize, useUpdate} from "./MaximizeProvider";
const ButtonComponent = () => {
const toggle = useUpdate();
const state = useMaximize()
return (
<button onClick={toggle}>Click</button>
);
}
export {ButtonComponent};
```
I hope this helps, I am not an expert, so there might be better ways to do it, but this seems to work for me.
| null | CC BY-SA 4.0 | null | 2022-09-19T20:59:42.557 | 2022-09-20T06:09:47.133 | 2022-09-20T06:09:47.133 | 14,476,782 | 14,476,782 | null |
73,779,320 | 2 | null | 73,779,194 | 1 | null | Yes, its a relative link.
You could use something like that
```
base_url = "https://wuzzuf.net"
links.append(f"{base_url}{jobtitles[i].find('a').attrs['href']}")
```
| null | CC BY-SA 4.0 | null | 2022-09-19T21:09:12.293 | 2022-09-19T21:09:12.293 | null | null | 20,027,803 | null |
73,779,717 | 2 | null | 49,228,926 | 0 | null | `SELECT DISTINCT CITY FROM STATION WHERE lower(right(CITY,1)) not in('a','e','i','o','u');`
| null | CC BY-SA 4.0 | null | 2022-09-19T22:01:43.177 | 2022-09-19T22:01:43.177 | null | null | 10,843,785 | null |
73,779,715 | 2 | null | 45,309,447 | 0 | null | ```
function Median(arr){
let len = arr.length;
arr = arr.sort();
let result = 0;
let mid = Math.floor(len/2);
if(len % 2 !== 0){
result += arr[mid];
}
if(len % 2 === 0){
result += (arr[mid] + arr[mid+1])/2
}
return result;
}
console.log(`The median is ${Median([0,1,2,3,4,5,6])}`)
```
| null | CC BY-SA 4.0 | null | 2022-09-19T22:01:05.293 | 2022-09-19T22:01:05.293 | null | null | 18,919,446 | null |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.