Datasets:

parameterlab
/

scaling_mia_the_pile_00_DM_Mathematics

Dataset card Data Studio Files Files and versions Community

Split (3)

train · 63.5k rows

text stringlengths 518 8.19k	meta dict
- 9 - 35y)(0y + 3y - y). -87y2 - 2y Expand (-272h3 - 2396 + 2396)(167 - 7h - 167). 1904h*4 Expand (-5c + 2c2 + 5c)(55c*2 - 7234 + 59c*2 + 7231). 228c*4 - 6c*2 Expand (-3 + 9 + 0)(-701s + 112s - 779s). -8208s Expand -f*5 + 3f*5 - 4f*5 + (0 + 0 + 2f)(2f*4 - 3 + 3) + (1 - 5 + 2)(845f4 - 1098f*4 + 710f*4)(7f + 0f - 3f). -3654f*5 Expand (-k + 0k - k)(-5983k*4 + 2034k*4 + 1612k*4). 4674k*5 Expand -3j*5 - 2j*5 + 3j*5 + (-4920j - 6184j + 12241j)(2j4 + j4 - j*4). 2272j*5 Expand (77g + 11563 - 11563)(3g - 2g + g)(-2g + 2g + 3g). 462g*3 Expand -w - 108 + 187 + 282 + (w - w + 3w)(1 + 3 - 2). 5w + 361 Expand (2 - 1 + 0)(x2 - 26 + 3x*2 + 13) - 5x*2 + 6x*2 + 0x*2 + (-x + 5x - 6x)(0x - x + 0x) + 2x2 - 5x2 - x2. 3x2 - 13 Expand (0c - 2c + c + (4c + 3c - 6c)(5 + 0 - 3) - 143c + 7312 - 7312)(1 - 1 + 2). -284c Expand (0 + 0 - 7t)(-74t4 + 209t - 209t). 518t*5 Expand (6 + 1 - 4)(-189g - 31g + 29g) + (2g - 5g + g)(-2 + 5 + 1) + g + 3g - 2g. -579g Expand (-5a*3 - 33a*3 - 13a*3)(-4a + 2a + a) + 3a4 - 4a*4 + 2a*4 + 2a2 - a4 - 2a3 + 2a*3 + (0a - 4a + 2a)(-15a*3 + 61a - 61a). 81a*4 + 2a*2 Expand (-1673j - 15 + 15 - 11926j - 16487j)(-2 + 3 + 0)(-4 + 0 + 2). 60172j Expand (3c - 2c + c)(c - 2c - 5c)((-29 - 9 - 1)(c + 2c + 4c) + 2c - 2c + 2c). 3252c*3 Expand -2n*2 + 0n*2 + 5n*2 + (0 + 1 - 2n + 2)(-1 - 5n + 0 + 6n) + 0n*2 + 12n2 + n2. 14n2 + 5n - 3 Expand (2f4 - 4f*4 + 4f*2 + 0f*4)(-179f - 307f - 16f). 1004f*5 - 2008f*3 Expand (6 - 453j*2 - 3 + 493j*2)(1 + 0 - 2). -40j2 - 3 Expand ((3l + 0l - 4l)(-2 + 0 + 3) + (-1 - 3 + 11)(-2l + 0l + 0l) + 0l + 3l - 2l)(3503 + 1290l*2 + 457l*2 - 3503). -24458l*3 Expand (-j - j - 6j)(-529 - 56j + 529) + (-2j + j - 2j)(-4j + 0j + 3j). 451j2 Expand (0 - 3 + 0)(2a2 + 0a2 + a2) + ((-3a - 4a + 6a)(-1 + 1 - 2) - 5 + 5 + 4a)(-22a - 21a + 8a). -219a*2 Expand (0s + 3s - 20s)(-s + 2s + 0s + (0 + 2 + 0)(0 + 2s + 0) + 0s - 3s + s + 393s + 22 - 207s - 204s). 255s2 - 374s Expand -9449 + 9450 + 19d2 + 39d*2 + (10d - 4 + 4)(0d + 2d - d) + 0d2 - d2 + 3d2. 70d*2 + 1 Expand -3r*5 + 11r*3 + 8r*5 - 1 - 10r*3 + 7r*4 - 7r*4 - 13r*5 + (r + r - r)(-6r4 + 0r*4 + 4r*4). -10r5 + r3 - 1 Expand (-1174l - 800l + 2496l)(0 + 0 - 3l2) - 2l*3 - 2l3 + l3. -1569l3 Expand ((0o + 0o + o3)(1 + 1 - 1) + (2o + 2 - 2)(-o*2 + 3o*2 + 2o*2))(-1 - 1 - 8)(-3o + 3o - 13o). 1170o4 Expand (q - 2q - 2q)(6397 - 1968 - 3646 + 4782 + 4307 + 8875). -56241q Expand (244 - 481d - 83 - 79 - 82)(-4d*2 - 17d*2 + 6d*2). 7215d*3 Expand -4f*4 - 2f*4 + 5f*4 + (1402f - 82f2 - 1402f)(-3f*2 - 11f + 11f). 245f*4 Expand (3c + 0c - 5c + (-c + 2 - 2)(2 - 9 - 3))(-12c3 - 88 - 79 + c2 + 159). -96c*4 + 8c*3 - 64c Expand -7f + f + 23f - 14f3 + (-f2 + 0f + 0f)(-2f + 1 - 1). -12f*3 + 17f Expand (-3y + 0y + 4y)(-6311y - 10740y + 2212y + 2575y). -12264y2 Expand (-32p + 69p - 36p - 4)(-1 + 0 + 3)(3 - 4 + 0). -2p + 8 Expand (561l + 587l - 1038l)(-2 - 4l + 2). -440l2 Expand (-4t*2 + 9 - 17 + 9)(4566 + 122t - 4566). -488t*3 + 122t Expand (-6 + 6 + 2)(2a + 4a - 2a) - 2 - 3a + 3a + 3a. 11a - 2 Expand -17r + 24r - 72r + 2r - 2r - 2r + r + 0 + 0 + (-1 - 4 + 4)(-2r - 3r + 4r) - 2r + 2r - r + (-1 + 3 + 0)(3r - 2r + 6r) + 2r - 4r + r. -53r Expand (3n - 6n + 0n)(n2 - 2n3 - n2) + (0n2 + n2 - 4n*2)(-25n2 - 24n*2 + 3n*2) + (-n - 2n + 5n)(12n - 12n - n*3). 142n*4 Expand 9 + 2x - 3x + 1 + (231 - 198 - 313)(2x + 3 - 3). -561x + 10 Expand (6y2 - 3y*2 + 6y*2)(26y - 107y - 63y). -1296y*3 Expand (-1 + 6k + 1)(-6k3 + k3 + k*3) - 1211k*2 + 43k*4 + 1211k*2 + (-3k*3 + 0k*3 + 5k*3)(-k - 2k + 2k). 17k4 Expand (1 + 3 - 3)(1517g - 3200635 + 3200635)(-4 + 5 - 4). -4551g Expand -11169c*2 + 3950c*2 - 8163c*2 + 1622c2 - c2 + 2c2 - 2c*2 + (-2c*2 - 2 + 2)(-3 + 1 + 0). -13757c2 Expand -3l*2 - 2l*2 + 4l*2 + 5011l - 1747l2 - 5011l + (-4l - l + 4l)(-3l + 4l + l). -1750l*2 Expand (-1328039z + 1328039z - 2z*3 - 633z*2)(-12z + 0z + z). 22z4 + 6963z*3 Expand (-2h3 + h3 - h*3)(0h + 4h - 6h) + h4 - 3h4 + h4 + 270h4 + 1441h*4 - 83h4 - h + h + h4. 1632h4 Expand (3 - 8 - 1 - 1 + 2 + 0 + 2 + 1 - 5 + (2 - 2 - 2)(-2 + 1 + 2))(0p2 - p2 + 0p2) + 1318 - 1318 - 23p*2. -14p2 Expand (d3 - 2 + 2)(-5d + 3d + d) + d2 - d2 + 2d*4 + (-3 + 1 + 1)(-1644d4 - 1843d*4 + 3283d*4). 205d*4 Expand (-82q*4 - 14046q - 14056q + 28093q + (-3q4 + 9q*4 + 6q*4)(2 + 2 - 2))(-2q - 2 + 2). 116q5 + 18q*2 Expand (-103r - 35 + 40r + 31r + 34r)(3 - r - 3 + (-4 + 6 - 1)(-2r + 4r - r) - r - 2r + r + 2 - r - 2 - 5 + 12r + 5). 18r*2 - 315r Expand (5r + r - 3r)(-1 + 3 + 9)(-127 - 8 + 6) + (5 - 2 - 4)(3 - 3 + 2r). -4259r Expand (3q + 9q - q)(0 + 2 - 1) - 91 - 10 + 5q + 6q - 9q - 2 + 2 - 2q. 11q - 101 Expand (19 - 7 + 20)(-68 + 183 - 92 - 5z). -160z + 736 Expand (-4i - 3i + 2i)(13 - 13 - 16i) - 11i + 9i2 - 6i*2 - 9i + (-3i + 2i + 3i)(0 + 0 - 2i). 79i*2 - 20i Expand 0z5 - 4z*5 + 2z*5 + (2z*5 + 3z*5 - 7z*5)(79 + 17 - 13) + 2z5 + z5 - 2z*5. -167z*5 Expand (-2x - x + 4x)(4x2 - 3x*2 - 4x*2 + (-1 + 3 - 5)(0x2 - 4x*2 + 6x2) - 4 + 2 + x2 + 0x2 + (0x + x + 3x)(2 - 2x - 2)). -16x*3 - 2x Expand (-3y + 12y + 20y)(-2y + 2 - 2) + (0 + 3 - 4)(-3y + 3y + 2y2) + 3y2 + y2 + 0y2. -56y*2 Expand ((-p + 0p + 2p)(4p - 2p + p) + 3p2 - 2p*2 - 3p*2)(76p3 + 15p - 32p + 17p). 76p5 Expand (-1 + 0 - 1)(-2 + 2 + 2m + (m - 2m - m)(1 - 4 + 4)(-29329 - 28443 + 58602)). 3316m Expand -w + w - 2w*2 + (-1 + 5 - 2)(636 - 636 + 23w2). 44w*2 Expand (-6g*3 + 3g*3 + 0g*3)(635g + 790g + 561g). -5958g*4 Expand (2422f*2 - 1205f*2 - 1218f*2 - 124 - 2f)((-3 - 1 + 2)(-6f + 0f + 4f) + 0 - f + 0). -3f*3 - 6f*2 - 372f Expand -27 - 30l + 27 + (-4 + 0 + 2)(2l - 6l + 2l) + 4 + l - 4 + 13 - 2l - 13. -27l Expand (13870j - 17j2 + 4j*2 - 13865j)(-3j + 6j - 2j). -13j3 + 5j*2 Expand (0u*3 - 5u*4 + 3u*3 - 5u*3)(-1 + 1 + u + (-1 - 3 + 2)(-u + 2u - 2u) - 2 - u + 2 - 42u - 255 + 255). 200u5 + 80u*4 Expand (1 - 4 - 6)(6w2 - 10w*2 + 7 - 2w + 0w2). 36w*2 + 18w - 63 Expand (10j2 - 2j*2 + 2j*2)(5 - 5 - j*3 + (j + 7j + 8j)(-8j2 + j2 + 2j*2)). -810j*5 Expand (-261r + 5r3 + 261r)(5 + 2 - 3 + 4 + 4 - 1 + (5 + 1 - 4)(-2 + 5 - 1) + 5 - 3 - 1 + 2 + 0 - 4). 70r3 Expand 5 - 5 - 2m*3 + (0 - 2m*3 + 0)((1 + 5 - 4)(-6 - 4 + 0) + 13 - 9 + 23). -16m*3 Expand (0u - u + 2u)(-5u - u + 3u) + (-5u + 5 - 5)(44 - 44 + 2u - u + 1 - 1 + (2u + 3 - 3)(0 - 2 + 0)). 12u*2 Expand (39a - 36a + 52a)(-36a*3 + 18a*3 + 22a3 + a4). 55a5 + 220a4 Expand -m2 + 0m2 + 5m*2 + (-4m*2 + 2m2 + m2)(0 + 0 - 1) + (0 + 2m + 0)(-5m + 8 - 8) - 5m2 + 6m*2 + 0m*2. -4m*2 Expand (3m - 2m2 + 0m + 3m2)(-1141m3 - 1641m*3 + 2189m*3). -593m*5 - 1779m*4 Expand (4 + 0 - 2)(-y - y - y) - 1 - 2y + 1 + 2y - 2y - 6y + 24y + 31y + 62y. 103y Expand (5290363r2 - 5290363r*2 - 3901r*3)(1 - 3r - 2r + 3r)(-1 + 0 - 1). -15604r4 + 7802r*3 Expand (0d*3 - 3d*3 - 2d*3)(-3 - 1133d - 12 + 15 - 120d). 6265d4 Expand (5 - 5 - 2s)(-3s*4 + 3s*4 - 2s*4) - 2s*5 - 1 + 1 + 4s*5 - 4s*5 - 5s*5 - 7s5 + s5 + 2s5. -7s*5 Expand (0 - 5 - 1)(-53 + 53 + 9o2 + (0 + o + 0)(-2 - 2o + 2) + 3o2 - o2 - 4o2 + (-o + 6 - 10 - 3o)(0o - o + 3o)). 18o*2 + 48o Expand (12u2 - 2u*2 - 3u*2)(-3u + 0u + u) + 4u2 - u2 + 81 + 2u - 80 + 3u3. -11u*3 + 3u*2 + 2u + 1 Expand -j + j + 2j*5 + (-4 +	{ "pile_set_name": "DM Mathematics" }
46. Let x = 1318 - 1307. Determine u(x). -42 Let c(i) = -i*3 - 8i*2 - 5i - 2. Suppose -3 = 2a - 19. Suppose 0 = -au + 29 - 85. Give c(u). -16 Let u(v) = -v*3 - 4v*2 + 2v + 3. Let a(m) = 11m2 - 6m - 9m - 9m - 24 + 16m - m3. Let z be a(10). Determine u(z). -5 Let j(y) = -2y*2 + 6y - 1. Let t(x) = 28x2 - 12x - 1. Let l(d) = -3j(d) - t(d). Determine l(1). -24 Let l(a) = -5a*2 + 12a - 1. Let z(f) = f*2 - f. Let g(n) = l(n) + 6z(n). Suppose 2h = 3m + 5, -35h - 5 = -34h. Calculate g(m). -6 Let a(z) = 3z - 6. Suppose 5d - 165 = 4w - w, -d + 21 = -3w. Let f = 39 - d. Let o be f/(-15)2 - 32/(-5). Calculate a(o). 12 Let w(p) = -p3 - 26p*2 + 25p - 47. Let v(f) = 20f + 1373. Let h be v(-70). Calculate w(h). 7 Let f(a) = -9a*3 - 13a*2 - 20a - 74. Let q(z) = -8z3 - 13z*2 - 19z - 66. Let p(b) = -7f(b) + 8q(b). Give p(-5). -150 Let s(b) = 18b - 235. Let d be s(13). Let q(p) be the first derivative of -4p4 + p2/2 + 18. What is q(d)? 15 Let x(q) = 406q - 792q + 394q - 10. Determine x(0). -10 Let n(u) be the third derivative of -u6/120 + u5/10 + 3u4/8 + u3 + 39u2. Give n(7). 20 Let v = -29 + 31. Suppose -f = 3q - 51, -vf - 33 + 117 = 5q. Let n(d) = qd2 + 0d + d - 25d2 - 1. What is n(1)? -7 Let v(c) be the first derivative of -c3/3 - 7c*2/2 + 22c + 394. Give v(-9). 4 Let q = -49079/60 + 818. Let p(g) be the third derivative of 0g - 1/2g*3 + 5/24g*4 - qg*5 - 9g*2 + 0. Give p(6). -9 Suppose -9k - 40 = 338. Let p = 44 + k. Let u(w) = -39w2 + 79w*p - 26w2. Calculate u(1). 14 Let l = -92 + 85. Let w(b) be the third derivative of -b5/60 - b*4/6 - 2b*3/3 + 244b2. Give w(l). -25 Let u(r) = r3 - 5r2 + 3r + 1. Suppose 0 = -123j + 150j - 216. Suppose -16g + jg + 16 = 0. Determine u(g). -5 Let u(z) = -z*3 + 9z*2 + 11z - 12. Suppose -h - 3p + 5 = 0, -5h - p = -6p - 65. Let t be ((-6)/15)/(h/(-275)). Determine u(t). -2 Let l(f) = -4f - 35. Suppose 24s + 30 = 22s + 2i, -28 = 4s + 4i. Give l(s). 9 Let l(k) = 336 - 175 - 6k - 163 + k*2 - 2k*2. Let b be ((-38)/6 + 5)/(6/27). Determine l(b). -2 Let r = -406 - -416. Let t(h) = rh - 48 - h*2 + 49 - 14h. What is t(-3)? 4 Suppose 13n = 29 - 3. Let s(h) = 1 - 5h2 - h3 - 7h3 + nh + 10h3. Give s(3). 16 Suppose -18f = -14f - 5o + 47, 2f - o + 13 = 0. Let p(d) = -3d*2 - 3d - 4. Give p(f). -22 Let c(l) = -1 - l - 9971l2 + 2 + 9968l*2. Let f be 11 - 15 - (-10)/1. Let w be (f/12)/(3/6). Calculate c(w). -3 Let a(n) = -59n - 294. Let l be a(-5). Let b(q) = 0 + 6q2 + 0q*2 - 5q*2 + l. Give b(4). 17 Let m(z) be the third derivative of 11z*4/24 - 3z*3 + 715z2. What is m(3)? 15 Let b(q) = q3 - 6q2 + 9q - 23. Let r(z) = 4z - 51. Let s be r(14). Let d be b(s). Let f(l) = -2l - 4. Calculate f(d). 2 Let r = -120 + 126. Let t(h) = 5h + 7. Calculate t(r). 37 Let j(h) = -35h - 72. Let s be ((-126)/441)/(3/3)7. Determine j(s). -2 Let i = 23 + 232. Let b = -253 + i. Let w(g) = g2 - 4g. Give w(b). -4 Let u(x) = -14x2 - 126x. Suppose 34j = -235 - 4 - 67. Calculate u(j). 0 Let w(o) = -o3 + 5o*2 + 4o. Let i(n) = -22n - 15. Let d be i(-4). Let g = -75 + d. Let s be (((-120)/25)/(-4))/(g/(-10)). Give w(s). -12 Suppose 0 = 5r + 4w - 36, -2r - 2w + 70 - 52 = 0. Let u(z) = z2 - z + 103. Determine u(r). 103 Let d(k) be the second derivative of -k4/12 + 13k*3/3 - 33k*2/2 - 2926k. Give d(24). 15 Let b be (1/((-34)/85))/((-4)/(-8)). Let z(q) = -20q - 109. Calculate z(b). -9 Let b(d) = d2 - 14. Let s(w) = -6w*2 - 37w + 88. Let u be s(2). Determine b(u). 86 Let m(x) = 38 + 4x + 32 - 116 + 39 - 1. What is m(-2)? -16 Suppose -19 - 5 = -3t. Suppose 113h = -110h + 218h. Suppose h = 7j - tj. Let g(a) = -a2 - 11. Calculate g(j). -11 Suppose 1704 = 392c - 108c. Let s(r) = -3r + r + 4r. Give s(c). 12 Suppose 2d - 2r = d + 8, 0 = -2d - 3r + 23. Let p(o) = -7o + 74. Let l be p(d). Let x(v) = 2v - 5. Give x(l). 3 Let o(x) = -571x*3 - 568x*3 - 11x + 1140x3 + 4x*2 + 10x + 0x2. Suppose -5a = v - 0 + 5, -2a + 5v - 29 = 0. Give o(a). 10 Suppose -9 = 3v, -x - 11v + 12v = 19. Let m(j) = 2j + 39. Calculate m(x). -5 Let k = -262 - -324. Let s = 58 - k. Let q(t) = -t*3 - 5t*2 + 4t + 6. What is q(s)? -26 Let i(k) = k*2 + 4k. Suppose a - 6a + 5x = -30, -3a + 5x + 18 = 0. Let j be 32/(-32)(-1 + a). Calculate i(j). 5 Suppose 931 - 256 = 5h. Suppose -3 = 23n + h. Let s(k) = k + 8. Calculate s(n). 2 Let w(y) = -7y*2 - 4y - 3. Let r(j) = -8j2 - 5j - 3. Suppose 0 = 5d + 12d + 51. Let g(c) = dw(c) + 2r(c). Calculate g(-2). 19 Let k(q) = q*3 - 39q*2 + 191q + 16. Let r be k(6). Let o(d) = -d*3 - 28d*2 - 49d + 86. What is o(r)? 8 Let k(v) = -9v + 1. Suppose -7c = 435 - 484. Determine k(c). -62 Let j(n) be the second derivative of -n*6/120 - 7n*5/60 + 5n*4/12 + 7n*3/6 - 33n*2/2 + 43n. Let k(h) be the first derivative of j(h). Calculate k(-8). -9 Let m(s) be the second derivative of 0s2 + 0 + 4s + 1/360s6 + 0s*3 - 11/6s*4 + 0s*5. Let l(a) be the third derivative of m(a). Calculate l(2). 4 Let o(u) = -13u*2 - 29u - 6. Let z(p) = 9p2 + 21p + 4. Let r(s) = -7o(s) - 10z(s). Let b(h) = 3h + 2. Let v = 14 - 12. Let w be b(v). Calculate r(w). 10 Let j(h) be the first derivative of 5h*2/2 + 12h + 1. Suppose 3w = -5g - 20, -4w + 35 = -4g + 51. Determine j(w). -13 Let g(i) be the second derivative of i*5/20 + 5i4/12 + i3/2 + i*2/2 + 196i. Suppose -3y + 36 = 4t, -4t + t + 22 = y. Let d = -8 + t. What is g(d)? 7 Let h = 3346 + -3341. Let d(r) = -5r*2 - 3r - 13. Calculate d(h). -153 Let f be -56/30 + -4. Let b(v) = v3 + 3v*2 - 12v - 5. What is b(f)? 5 Let m(j) = -2j3 + 4j*2 - j + 1. Let v(z) = 11z*3 - 36z*2 + 3z + 3. Let h(k) = -5m(k) - v(k). Calculate h(16). 24 Let b = 2769 + -2772. Let y be (-1)/4 + 2/8. Let k(a) = 2a*2 - 4 + a + 2 + ya. Give k(b). 13 Let u(a) = -3840 + 7a - 3808 - 3842 + 15272 - 3847. What is u(12)? 19 Suppose -5c + 3y - 6y + 249 = 0, 3c = -5y + 159. Suppose 3g + 6p = 2p + 21, -3g + 5p = -c. Let n(l) = l - 11. Calculate n(g). 0 Let j(y) = y2 + 12y + 3. Let t be j(0). Let m(w) = 4w2 - 3w + 1. Determine m(t). 28 Let m = -9 + 2. Let z(x) = 7x3 + 67x - 57. Let d(v) = -v3 + v2 - 12v + 9. Let o(t) = 6d(t) + z(t). Calculate o(m). -17 Let h(q) be the third derivative of -5q4/12 - 13q*3/2 + 2830q2. Give h(-4). 1 Let v = 27 + -25. Let s(t) = -15 + t2 + 5t - 25 + 42 - 2t*v. Calculate s(4). 6 Let d(n) = 3n*3 + n - 41. Let y(u) = -5u*3 - 7u*2 - 2u + 81. Let x(p) = 2d(p) + y(p). Suppose 0 = -2v + 3v - 5. What is x(v)? -51 Let c(l) = -20l*2 + 4023l + 8 + l*3 - 4004l - 15. What is c(19)? -7 Let o(g) = -g*2 - 6g - 4. Let h = -6 - -59. Let k = h - 9. Let w = k - 48. Give o(w). 4 Suppose 2088 + 1036 = -142x. Let m(n) = -n2 - 17n + 40. What is m(x)? -70 Let i be 18/(-4)(-8)/123. Let d(z) = i + 5 + 4 + 4z2 - 19. Suppose 0 = -2x - 2. Calculate d(x). 3 Let u(o) = o3 - o2 - 2o + 3. Suppose -13 + 51 = 19r. Let d be u(r). Let k(s) = -s*3 + 3s*2 + 2s + 2. What is k(d)? 8 Let u(p) = 12 - 7p + 297p*2 + 274p*2 - 572p*2 - 5p + 11. Determine u(-13). 10 Let l(n) = -6n2 + 10n + 2. Suppose 3o = -5a - 4, -4o - 35 = -a + 1. Give l(a). -54 Let p(i) = 1589 - 815 - 788 - i. Suppose 0 = -2w - 5k - 21, w = -w + k - 39. Determine p(w). 4 Let s(z) = 4z + 38. Let t be s(16). Let a(o) = -200o + 96o + to + 4. Calculate a(6). -8 Let u be (-56)/6498/(-581). Suppose -3v - 6 = 0, v + u = 5w - 3v. Let c(j) = -2j*2 - j + 1. Determine c(w). 1 Suppose -1370t = 2732 - 20249 - 1663. Let u(i) be the third derivative of i*5/30 - 29i*4/24 + 13i3/6 - i2. Determine u(t). -1 Suppose -6w - 33 = -9w. Let q(u) = u - 7. Let j be q(w). Suppose 2n = 3z - 3 - 18, -jn - 40 = -4z. Let i(r) = -r - 12. Determine i(n). -3 Let j(y) = -3y2 - 18y - 7. Let o = 11105 - 11110. Calculate j(o). 8 Let z(h) = 3h - 9. Let n(o) = 5o - 13. Let c(x) = -5n(x) + 7z(x). Let f be 3886/938 - 1/7. Determine c(f). -14 Let m(f) be the third derivative of f6/360 + f5/60 - f*4/6 + 5f**3	{ "pile_set_name": "DM Mathematics" }
(-4)? 1/4 (-4 - (-5)/(-10))/((-60)/3640-13) -21 What is the value of ((-3)/(-63))/((-5)/60) + (0 - 0)? -4/7 Calculate (1/3 + (-1)/(-3))/((-11466)/12285). -5/7 Evaluate 604/453((-31)/(-2) - -4). 26 What is the value of (-10 - 1815/(-132))/((-15)/144)? -36 What is 1355/275 + -6 - 3/15-4? -3/11 Calculate -95/5 - (36 - 33). -12 What is the value of 266135/(-37774) - (-14)/(-2 - -4)? -1/22 What is ((0 + 3)/3)/(21 + -31 + 11)? 1 Evaluate (1332/2960)/((-36)/(-5)). 1/16 Evaluate (-40)/(320/6)(-20)/105. 1/7 What is the value of (2/(-6 + -2))/((-23)/(2208/(-60)))? -2/5 What is (17 + (16 - 32))(-1)/14? -1/14 (-3211)/(-988) + (-483)/156 2/13 Evaluate ((2/4)/(26/(-468)))/(6/(-16)). 24 Evaluate 0 - 33 - -6(-20)/(-15). -25 Evaluate 586/22 + 681/(-33) + 21. 27 Evaluate (4 - 90/25 - 1) + (-56)/40. -2 What is the value of (1781/195 - 9)(1 - 0)? 2/15 ((-13)/26)/((-6)/4(-13)/(-663)) 17 What is (-5)/(-3)(-2088)/(-1160)? 3 What is the value of ((-140)/12 - -13)(-1 - -2)/(-4)? -1/3 10 + (-26)/((-2496)/(-880)) 5/6 What is 22/(-198) + 2786/126? 22 Calculate (-3857)/15960 - 2/(-48). -1/5 What is (-4)/2(-127)/(-889)? -2/7 What is (-12)/(-10)-1(-4950)/(-220)? -27 What is (((-488)/216)/(-61))/((-2)/6)? -1/9 Evaluate 18/15((-78)/36 - 1 - -3). -1/5 What is (-12 - 225/(-15)) + -3? 0 What is the value of (-6)/16 - 7/168-17? 1/3 Evaluate 1/(13 - 400/32). 2 What is (1/27)/(149/447)? 1/9 Calculate (5/(10/42))/3. 7 Calculate (-4346)/(-123) - 6 - ((-28)/(-12) + -3). 30 What is the value of (-208980)/(-9477) + 6/(-117)? 22 1630/2608(-816)/(-15) 34 Evaluate ((-5)/(-25)-8)/((-56)/(-20) + 0). -4/7 What is the value of (3384/(-3525))/((-6)/10)? 8/5 What is (-173)/(-279) - (-1272)/(-19716)? 5/9 What is the value of (6/5)/(18/(-90)) + 17/17? -5 (-105)/1085(-8)/(-14)14/12 -2/31 What is the value of 2 + (-14)/35-10 + -5? 1 What is (-38)/(-2) - ((-432)/27 + 24)? 11 -6 + -1 - (-1386)/165 7/5 What is (8/(-10))/((168/(-48))/(-7))? -8/5 What is the value of (-1612)/(-124) - ((-29)/(-5) - 1/(-5))? 7 What is the value of 618/721 - (-1)/7? 1 What is 524/(-22) - -2 - (-5110)/(-28105)? -22 What is the value of 2/((-2550)/(-195)) + 8/40? 6/17 What is 133/(7049/530)(-1)/4? -5/2 Evaluate 252/224(-22)/(-99). 1/4 What is the value of (-2(-1)/7)/((-3048)/(-24892))? 7/3 Calculate (1 - 7)1 + (-159)/(-27). -1/9 Calculate 0 + 6 + (-5074)/826. -1/7 Calculate (11/165)/(1 - 348/342) + 2. -9/5 (1 - 3)/(((-882)/343)/(-9)) -7 What is the value of (46 - 45)4/(-44)-2? 2/11 Evaluate (396/(-352))/((-3)/(-16)). -6 What is ((-55)/(-220))/(1/26) + -2? 9/2 What is 102(-70)/6930(-9)/(-2)? -10/11 Evaluate ((-332)/(-108) - 3)/((-223)/(-6021)). 2 (-7 - 732/(-108)) + (22/18 - 4) -3 ((-1)/2)/(12/(240/350) - 10) -1/15 Calculate -7(-1)/(-21)9. -3 What is 0 + 615/(-216)? -5/12 What is ((-2)/(-20))/(72/(-720))24? -24 (24/20)/((-126)/(-10) - 12) 2 Calculate -8 - 912/66 - (-86)/(-473). -22 ((-13)/(52/5))/(2/(-16)) 10 (-108)/408(-5 - 8(-22)/36) 1/34 (-24 - 928/(-40))(-10)/26 4/13 Evaluate -2 + -2 + 3314/105. 2/5 What is ((-1)/(-2))/((-20)/24)-3? 9/5 What is the value of 7 + -2 + 5 - 13? -3 What is the value of -7 + 1 + -319/(-9)? 1/3 Evaluate 11-230(-8)/880. 23 Calculate ((-12)/(-48))/((-2 - (-60)/16) + 3). 1/19 Calculate 19 - (2977/78 - 19). -1/6 What is (-1816)/(-681)(-5)/50? -4/15 What is 10 - (-2 + (-32)/56-14)? 4 Calculate (-200)/(-40) - (-7)/(245/(-182)). -1/5 Calculate 4 + -1 - (7 + 324/(-90)). -2/5 What is the value of (-59)/(4661/(-158))9/(-2)? -9 What is (-87)/290 + (-819)/70? -12 Evaluate 788/(-120) + (-6)/18 + 7. 1/10 Calculate -2 - -2 - 10/(-30) - (-35)/(-60). -1/4 Evaluate 8(-132)/(-176)2/(-44). -3/11 Calculate 176/(-154)21/(-6) - (-22 - 3). 29 Evaluate (-7)/1 - (11 + (-1 - 5) - 10). -2 Evaluate ((-351)/78 - (-1 - 3))6. -3 Evaluate (95/(-228))/((-25)/30 - (-6)/4). -5/8 Calculate (2 - 0)/(-4) - 31675/(-2534). 12 What is the value of (54/99)/(24/(-330))(-2)/25? 3/5 Evaluate (-3 + -1)(-108)/(-216). -2 ((-5)/2)/(-5) - 3/(-12)-3 -1/4 What is the value of ((10/(-2))/(-30))/((-2)/(-204))? 17 Evaluate (-6)/(-9) - 3741/6192. 1/16 Evaluate (-7)/(-1) + 1701/(-252). 1/4 What is the value of 1528/630(-27)/(-72)? 1/4 What is (-2)/5 - (-4 - -4) - 6/10? -1 What is the value of (-655 - -656)/(1/22)? 22 What is 119/(-35) + 4 - (-6 - 58/(-10))? 4/5 Calculate ((-7 + (-120)/(-18))4)/(20/(-285)). 19 Calculate (-2)/(-10)(-100)/280-34 - 2. 3/7 Calculate (1040/(-13))/8 + 21. 11 ((-186)/341(-4)/16)/(-2 - -1) -3/22 Evaluate (4/(-6))/(244/(-183))4/(-6). -1/3 Evaluate (2 - 1)(1 - (-19 + (9 - 0))). 11 Evaluate 2/(-18) + 65 + (-18550)/315. 6 (3 - (-495)/(-155))73/(-438) 1/31 (1/1)/((-50)/((-1200)/(-36))) -2/3 Evaluate 1/2(-19)/((-1368)/(-96)). -2/3 What is the value of 32/(-4560)-15 + (-975)/57? -17 What is (5 - 0/3) + 9 + -18 + 3? -1 Evaluate (-3150)/756 - 28/(-24). -3 Evaluate (12/9 + 0 - 1)5598/3110. 3/5 What is ((-756)/(-33))/7 - 10/3? -2/33 130/(-156)(-2)/(-5) -1/3 What is the value of 100/(-26) + (44/(-77))/(208/56)? -4 (-105)/(-30) - 11 - 1/63 -8 Calculate 35948/(-2752) - 1/(-16). -13 Calculate (14 + 1 - (87 - 85)) + 5. 18 (-112)/7 + -121743/(-1260) 3/5 49/2 - (468/(-8) - -59) 24 What is 9/((-486)/12) + (-11388)/(-702)? 16 (275/(-25) + (-61)/(-6))/((-1)/12) 10 What is (-70)/(-40) + 17 + -21? -9/4 (3/2)/(78/(-4))2 -2/13 What is (44/12)/((-14)/42)? -11 What is the value of ((-52)/(-7))/(7107/483 + -15)? -26 Calculate 4556/(-190) + 2 + 22. 2/95 (-2)/9 - (16840/(-85500) - (-26)/(-247)) 2/25 What is the value of (18/((-612)/85))/70? -1/28 What is the value of (-4416)/(-432) + -10 + -3 + (-6)/(-2)? 2/9 Evaluate 1/(-3(-35)/2118/(-40)). -4/9 What is the value of 148/814(-4)/8? -1/11 Evaluate 5 - 0 - (-18 + (-3 - -16)) - -8. 18 Calculate ((-1288)/462)/(6/9) - 8/(-2). -2/11 Evaluate (-12)/153/(-2)(-260)/(-468). 2/3 Calculate (-24)/((-1200)/175)-4. -14 -372 - -390 - (-516)/(-28) -3/7 Evaluate (17 + 525/(-42))/((225/(-6))/(-5)). 3/5 Evaluate (4/(-3))/(112/24). -2/7 Calculate 10/12(45/(-5) + 2021/235). -1/3 What is 9867/1265 - 11/(-5)? 10 82/(-10) - (4/5 + -1) -8 (3/((-10)/166))/((-6)/(-15)) -2 Evaluate 1 + 1 + 51/(-35) + 34/595. 3/5 Calculate (3/28)/(-35135/(-126000)). 20/7 What is the value of (-14 - ((-489)/18 - -12))/(-1)? -7/6 Calculate (1092/(-63) - -18)/(-6). -1/9 174/(-20) - 9/30 -9 What is the value of ((-2)/(-24))/(102/(-18496)) - 2/(-18)? -15 What is the value of (2 - 11/6)4 + -1 + 3? 8/3 What is -8 + 130/(-25) + 24/20? -12 What is the value of (57/(-105))/1 + 1072/938? 3/5 (75/(-200))/((-6)/20) + 10 + -11 1/4 12/((-468)/(-591)) + 18/(-117) 15 (-756)/44 + 17 - 1/(33/(-204)) 6 What is (-6 - 8) + (-27 - -51)? 10 (-3969)/(-783) - (18 - 13) 2/29 ((-14 - -21) + -19)/(-4 - (-1 + -1)) 6 (-18 + 21 - ((-258)/(-90) - -4)) + 4 2/15 Evaluate ((-5)/4 - (-208)/192)(0 + 6). -1 What is the value of -10 - ((-1890)/24)/7 - (-27)/(-12)? -1 What is (-6 + 4)/(-80 + 81)? -2 What is the value of (-390)/5224/15? -12 Evaluate (-16)/36 + (-2340)/2025. -8/5 Calculate (-1)/(17/(-4114)-22). -11 Calculate (17 - (-1826)/(-110))/((-57)/15). -2/19 What is the value of (-1428/(-3136))/2? 1/16 What is ((-1)/(-34))/(26/(-364) + 12/21)? 1/17 Calculate 20/12 - (-224)/6144-56. -3/8 (-8 - 1608/(-90)) + -10 -2/15 Evaluate 22540/(-1260) + 3/(-27). -18 282/(-14) - (-447 + 426) 6/7 What is the value of (-2664)/(-1620) - 4/9? 6/5 What is the value of 4/(-6)1296/96 + (49 - 72)? -32 What is the value of (9 - 3) + -3 + (-338)/114? 2/57 What is the value of 12 + ((-84)/(-56) - -2743/(-60))? -1/5 What is the value of 16/(-15)20565/18280? -6/5 (-5148)/143020/(-6) 12 Calculate (-274)/(-20) - 255/(-850). 14 What is the value of (-36)/(-120)((-9)/(-18) + 11/(-12))? -1/8 What is (-2 + (-60)/3)(-6 - (-35 + 28))? -22 What is (((-3762)/(-54))/(-19))/((-2)/242)? 22 Calculate 32/(-18)(1051 + -1060). 16 Evaluate -13828/(-4347). 4/7 Evaluate (42/84)/((-18)/4) - 84/(-27). 3 What is the value of 56/(-36)558/(-10416)? 1/12 Calculate ((-30)/(-70))/((81/(-14))/(-9)) + -2. -4/3 Evaluate 180/(-360)(18/21)/3. -1/7 Evaluate (-19)/(1/(-3) - ((-112)/21)/(-8)). 19 ((-92)/2691)/((-82)/6 + 13) 2/39 Evaluate 12 + 87/(-3) + 18. 1 What is the value of (-25172)/3255 - (0 - 1 - 7)? 4/15 487/(-238) + 2 + 496/4216 1/14 -5 + 72/50	{ "pile_set_name": "DM Mathematics" }
e nearest to 1? (a) 0.3 (b) 2/7 (c) q c Let k = 0.017 + 0.083. Which is the closest to k? (a) 3/2 (b) 2 (c) -0.2 c Let n = -1 + 0.5. Let f be (6/(-4))/(102/(-8)). Let x be (-2)/14 + 32/56. Which is the nearest to 0.1? (a) x (b) f (c) n b Let t = -0.1 - -0.1. Let d be (6/(-15))/((-12)/(-15)). Let g = -10 + 10.3. Which is the closest to t? (a) g (b) d (c) 1 a Let o = -0.31 + 0.31. Which is the closest to -1? (a) 4 (b) 2 (c) o c Let i = -0.4 - -4.4. Let q = -66 - -65. Let s be 4/(-6) + (-2)/(-6). What is the nearest to 1 in s, i, q? s Suppose -3 = -2s + 5. Let x be 11/((70/s)/5). Let p = x + -95/28. Which is the nearest to p? (a) -1/8 (b) 3/5 (c) -0.5 a Let x = 2.78 + -1.78. Suppose 0 = y - 3 - 3. Let r be (y/4)/((-6)/5). What is the nearest to -0.1 in 4, r, x? x Let q = -0.8 - 3.2. What is the closest to q in 0.2, 2/13, 0.3? 2/13 Let c = 0 - 0.1. What is the closest to c in -2, 4, 1? 1 Suppose 3j + 0r + 2r = -46, 2r = 2j + 24. Let s(f) = -f - 4. Let k be s(-6). Let t be k/(-10) - j/(-5). Which is the nearest to 0? (a) t (b) 5 (c) -1 c Let i = 0.1 - 0.1. Let h be 4/(24/9)-1. What is the closest to i in -1/7, h, -0.3? -1/7 Let u be 3((-5)/(-2) + -2). Suppose -t - 5 = -4f, -6t - 3 = -t + 2f. Which is the closest to t? (a) 5 (b) 2 (c) u c Let z = -42 - -43. What is the nearest to 3 in 3, z, -3? 3 Let o be (0 + -4 + 5)3/(-7). Which is the closest to 0.2? (a) -2/19 (b) -4 (c) o a Let r = 1.3 - 8.4. Let q = 7 + r. Let z = -82/3 + 244/9. Which is the closest to q? (a) 3 (b) z (c) -2/5 b Let i(o) = -o*2 + 5o - 3. Let g be i(3). Let p = -581/75 - -2/25. Let z = p + 89/12. Which is the closest to 1/4? (a) z (b) g (c) 1/3 c Suppose -11 = c + 2v - 2, 5c - 25 = 4v. What is the nearest to c in 1/6, -4, 9? 1/6 Let y = -2 - -1. Let n = 0.055 + -1.455. Let x = y - n. Which is the closest to -1/3? (a) 1 (b) x (c) -4 b Let n = -1.994 - 0.006. Let b be (-1)/33/4. What is the nearest to 0 in b, n, -5? b Let m be ((-4)/16)/(3/(-12)). What is the nearest to m in 5, 1, -2? 1 Let h = 1754/7 + -251. What is the closest to 1 in h, 0.4, 1/6? 0.4 Suppose 0c - 8 = 2c. What is the closest to 0.1 in 3/2, c, 0.5? 0.5 Let t = -160 - -48. Let i = 782/7 + t. Let g = -164 + 1150/7. What is the closest to g in i, 0.3, 3? 0.3 Let r be (-3 - 0) + 57/45. Let j = -7/5 - r. Which is the closest to 1? (a) j (b) -0.4 (c) 1/2 c Let o = -2.2 - -2. Let n = 15.8 + -16. What is the closest to n in -4, -2/9, o? o Let z be (2 + -1)0/(-3). Let b be (-33)/378 + (-4)/18. Let s = -1/42 + b. What is the nearest to 1 in s, z, 2/7? 2/7 Let h = 3.7 + -4. Which is the nearest to 1/2? (a) -5 (b) h (c) -4 b Let c = 1/2 - 3/14. Let y = -0.09 - 0.01. What is the closest to c in y, -0.2, 2/7? 2/7 Let z(q) = -1. Let d(m) = 5m - 5. Let l(t) = d(t) - 6z(t). Let i be l(1). Let p be 1((-10)/i - -2). What is the closest to -1 in p, -1/4, 2/5? -1/4 Let y = -0.36 + 2.36. Which is the nearest to -0.1? (a) y (b) -4 (c) -1 c Suppose -2m + i + 0i = -5, -5m + 10 = -2i. Which is the nearest to 2? (a) m (b) 0.4 (c) -0.3 b Let w = 1 + -0.5. Let n be (4(-1)/(-32))/(-1). Which is the closest to -1? (a) -0.1 (b) w (c) n c Let l = -0.2 + -0.8. What is the closest to l in 3, -0.5, 0.1? -0.5 Suppose -r + 3 = -2r. Which is the nearest to 1? (a) 0.5 (b) r (c) -1/10 a Let g = 0.8 + -0.88. Let v = g - 0.32. Suppose 5x + 4 + 11 = -5u, u - x - 1 = 0. Which is the nearest to u? (a) -5/6 (b) v (c) 5 a Let u be 0 + (-2)/(-4)6. Suppose 2i = ui. Which is the closest to i? (a) 0.4 (b) 0.3 (c) -3/7 b Suppose -2o = -3m - 6, -2o + 4o + 10 = -m. Which is the closest to 0? (a) o (b) 5/6 (c) 0.4 c Let t = 8.5 - 8. Let w = t - 0.2. Let u = 2 - 1. Which is the closest to u? (a) 0.2 (b) -1 (c) w c Suppose 2m - 42 + 2 = 0. Suppose 3x = -w - 16, -3w - m = -0w + 2x. What is the closest to 1 in 0.3, 0.4, w? 0.4 Let i = -123/46 + 4/23. Let y = -2 - -2.1. What is the nearest to y in 3, 1, i? 1 Suppose -4z - 2 = 6. Let i = 2.5 - 3. What is the nearest to 0 in -0.4, i, z? -0.4 Let z = 10 + -6. Suppose 0v - zv = -8. Suppose -2 = n + 5a, -n + v = -2n + 3a. What is the closest to n in 0.5, 0, 0.3? 0 Let x be 4/18 - 11/((-3861)/(-24)). Which is the nearest to -2/7? (a) 3/13 (b) 2 (c) x c Let l(g) = -g*2 - 4g + 1. Let p be l(-3). Let v = 0.2 + -0.2. Let q be ((-1)/(-4))/((-50)/200). What is the nearest to 0 in p, q, v? v Suppose 5 = 2t + 3. Let x = -5 + t. Let w be (-3)/(-12) + 1/x. Which is the nearest to -1/3? (a) -5 (b) 2 (c) w c Suppose -1 = -4y + 23. Let j be y/10(-20)/16. Which is the closest to 2? (a) 1/3 (b) j (c) -3 a Let c = -3 + 2. Let r be -2 + -4(-15)/24. What is the nearest to c in r, 0.2, -0.2? -0.2 Let j = 20.3 - 22.3. Let q = 3527/15 - 235. What is the nearest to -1 in 3, j, q? j Let k = -126 - -124. What is the closest to k in -0.06, -5, 2? -0.06 Let a = -0.046 + 2.046. What is the nearest to 1 in a, -5, 0.2? 0.2 Let h be (3/(-5))/(90/(-100)). What is the closest to 0 in -5, 0, h? 0 Let g(l) = l*3 - 13l*2 - 15l + 19. Let q be g(14). Let h = -1.6 + 1.6. What is the closest to h in 0.3, q, -3? 0.3 Suppose -19z = -14z. What is the nearest to z in 1/4, 0.4, 0.09? 0.09 Let d = 67 + -63. What is the nearest to -0.1 in 3/5, d, -2/7? -2/7 Let z be (166/4)/(4/8). Let w = 417/5 - z. What is the nearest to -1 in -5, 3/7, w? w Let s = 78 - 78.2. Which is the nearest to -1? (a) s (b) -8/7 (c) 0.5 b Let p = -7 - -6. Let x be -2 - (-2)/(-1) - -2. What is the nearest to 1 in p, x, -0.2? -0.2 Let k be 4-1 + 990/255. Let f = -2.6 - 0.4. Let r = 1 + -1.1. What is the closest to r in k, 0.2, f? k Let m be (-1)/(-12)10. Let h = -0.38 - -0.08. Let y = h + 0.2. Which is the nearest to -1? (a) m (b) y (c) -5 b Suppose -2t + w = -3, 5t + 5w + 0w - 30 = 0. Let y = -2 + 2. Let x = 5 - y. Which is the closest to 1? (a) x (b) 5/2 (c) t b Let w = 218 + -214. Which is the nearest to -0.1? (a) -1 (b) 2/13 (c) w b Let b = -7.27 - -0.27. What is the nearest to 0.2 in 3, 5, b? 3 Let x(p) = p3 + 9p*2 + 3. Let u be x(-9). Suppose 13 - 4 = -uj. What is the closest to j in -2/17, 0, 1? -2/17 Suppose 0a = -2a. Let z be (-1 + a)1/3. What is the closest to 0 in z, 0.5, 2/9? 2/9 Let h = 17 - 12. What is the nearest to 0 in -0.3, h, 4? -0.3 Let w = -2.93 - 0.07. Let r(v) = 3v - 14. Let l be r(5). Let g = 0.8 + -5.8. Which is the closest to l? (a) -0.2 (b) g (c) w a Let z = 20 + -18. Let d = 1 + 0. Which is the closest to -1? (a) d (b) 0.5 (c) z b Let h = 1.91 + 0.09. Which is the nearest to -0.2? (a) h (b) 0.5 (c) -0.1 c Let o = -23 - -24. Let m = 0.2 + -0.1. Let d(h) = h*2 + h - 3. Let b be d(-3). What is the closest to b in m, o, -4? o Suppose -4v + 27 = -v. Suppose 3j - 21 = -v. Which is the nearest to 0.2? (a) -2/7 (b) j (c) 3/7 c Let c be 48/(-80)(-4)/6. What is the closest to c in 5, 3, 4? 3 Let w(j) = 2j2 - 4j + 5 - j*2 - 6j*2 + 4j2. Let g be w(-5). Which is the nearest to g? (a) -2 (b) 0.4 (c) 3 b Let s(c) = c2 - 2c + 2. Suppose 2k = 3k. Let u be s(k). What is the nearest to -1 in 3, 1/4, u? 1/4 Let d = 0.1 - -0.2. Let u = -1 + d. Let w = u - -0.6. Which is the nearest to w? (a) 2 (b) -0.1 (c) -4/5 b Let z(h) = h + 19. Let g be z(-18). What is the nearest to g in 0.4, 3/4, 0.02? 3/4 Let y = -68 + 39. Let g = y + 28. Let t = -1 + 0. Which is the nearest to g? (a) t (b) 1/2 (c) -4 a Let l(x) = -x + 2. Let y be l(5). Let j = -2.7 - -3.8. Let i = 1.6 - j. Which is the closest to -1? (a) 0.1 (b) y (c) i a Let b = 4.51 - -0.09. Let x = 5 - b. What is the closest to -2 in x, 2, 0.5? x Let o = 742/15 + -324/5. Let n = 15 + o. Let a = n - 7/6. What is the closest to 0.2 in -3, -1/11, a? -1/11 Let n be ((-36)/64)/(3/2). What is the closest to 1 in n, -2/11, 4/5? 4/5 Suppose -9p = -7p. Which is the closest to p? (a) -1 (b) 2/5 (c) -2/13 c Let g = 0.8 + -3.8. Which is the closest to -1/3? (a) -0.5 (b) -1/5 (c) g b Let j = -50 - -46. What is the closest to 2/3 in j, -17, -2/3? -2/3 Let g = -5 + 4.9. Let v = 0.3 + -0.3. Which is the nearest to g? (a) v (b) 0.2 (c) -0.3 a Let z = 92 + -91.6. What is the closest to -28 in z, 1, 2/7? 2/7 Suppose -5r - 45 = -6p + p, -r = 4p - 16	{ "pile_set_name": "DM Mathematics" }
66 Calculate prob of sequence iiv when three letters picked without replacement from ivuuiv. 1/30 Calculate prob of sequence ss when two letters picked without replacement from {m: 1, f: 1, c: 4, s: 3, t: 6}. 1/35 Four letters picked without replacement from iiiiiiiipiiiiiiipiii. Give prob of sequence ippi. 1/190 What is prob of sequence qq when two letters picked without replacement from ipipiqiqiqiqqiqq? 7/40 Four letters picked without replacement from bxldmdxl. What is prob of sequence ldmx? 1/210 Three letters picked without replacement from {i: 8, o: 1, l: 8}. What is prob of sequence oll? 7/510 Calculate prob of sequence eeqr when four letters picked without replacement from rrrqqqqeqeerreqrqer. 245/23256 Two letters picked without replacement from aaattaoyaaaatyaaaq. What is prob of sequence yq? 1/153 Calculate prob of sequence yh when two letters picked without replacement from ahfyhfffaffaaaaaafau. 1/190 What is prob of sequence yy when two letters picked without replacement from yoyyoyyyyyoyyyyyyy? 35/51 Two letters picked without replacement from vvvvcvvv. Give prob of sequence vc. 1/8 Three letters picked without replacement from {s: 1, h: 8, c: 4, i: 1, e: 3}. What is prob of sequence ehe? 1/85 Calculate prob of sequence zv when two letters picked without replacement from {z: 1, l: 2, v: 1}. 1/12 Calculate prob of sequence tbv when three letters picked without replacement from tntnnnvtvnvvbvnrtnnv. 1/285 Two letters picked without replacement from ttyttttytttt. Give prob of sequence yy. 1/66 Three letters picked without replacement from {n: 4, v: 3, g: 4, f: 3}. What is prob of sequence vvf? 3/364 What is prob of sequence hhh when three letters picked without replacement from yhhyhvh? 4/35 Three letters picked without replacement from {x: 3, s: 4, m: 3, t: 3, e: 2, g: 1}. Give prob of sequence gxs. 1/280 Two letters picked without replacement from ppjpppppjp. Give prob of sequence jp. 8/45 Two letters picked without replacement from {s: 3, m: 4, q: 2, d: 1}. Give prob of sequence sq. 1/15 Three letters picked without replacement from {i: 1, n: 5, t: 3}. Give prob of sequence ini. 0 Calculate prob of sequence bwm when three letters picked without replacement from mwmbbmwmbbwwmmw. 4/91 Calculate prob of sequence uiru when four letters picked without replacement from uibubrrrkxxrii. 1/1001 Three letters picked without replacement from vsvsss. What is prob of sequence sss? 1/5 Calculate prob of sequence aao when three letters picked without replacement from {a: 4, q: 1, z: 6, o: 2, m: 3}. 1/140 Two letters picked without replacement from zaolzzzzaaocoozl. Give prob of sequence az. 3/40 Calculate prob of sequence rr when two letters picked without replacement from rissqfirhisq. 1/66 What is prob of sequence qnu when three letters picked without replacement from uonnoymqyoqonqn? 2/455 Two letters picked without replacement from bbbbfbfbbbbb. What is prob of sequence bb? 15/22 Four letters picked without replacement from {r: 2, o: 6, g: 1, w: 1, x: 5}. What is prob of sequence owgx? 1/1092 What is prob of sequence dre when three letters picked without replacement from {d: 2, e: 7, y: 4, r: 2, l: 3}? 7/1224 What is prob of sequence nd when two letters picked without replacement from ddldrlrrndorrrrlrrll? 1/95 What is prob of sequence og when two letters picked without replacement from ogggogiowwggw? 3/26 Four letters picked without replacement from {z: 16, d: 4}. What is prob of sequence dddz? 16/4845 Two letters picked without replacement from yyhh. What is prob of sequence hy? 1/3 Two letters picked without replacement from {q: 3, e: 12, x: 2, n: 3}. What is prob of sequence en? 9/95 Calculate prob of sequence rtr when three letters picked without replacement from peeirct. 0 Two letters picked without replacement from ppjjbffpbjfppfmpp. What is prob of sequence jm? 3/272 Three letters picked without replacement from {o: 2, e: 1, x: 1, b: 4, w: 1}. What is prob of sequence exb? 1/126 Four letters picked without replacement from {d: 1, q: 2, e: 3, l: 9, j: 3}. Give prob of sequence ljqq. 1/1360 Calculate prob of sequence msal when four letters picked without replacement from {s: 2, m: 3, l: 6, a: 1}. 1/330 Two letters picked without replacement from {e: 1, q: 3, k: 2, s: 1}. Give prob of sequence kk. 1/21 Two letters picked without replacement from pphchchphpchcc. What is prob of sequence cc? 10/91 Calculate prob of sequence eeye when four letters picked without replacement from {o: 3, e: 5, y: 2}. 1/42 Two letters picked without replacement from {z: 7, v: 4}. What is prob of sequence vv? 6/55 Three letters picked without replacement from {e: 3, l: 3, q: 6, w: 1, y: 2}. What is prob of sequence lye? 3/455 What is prob of sequence sq when two letters picked without replacement from {o: 2, k: 4, s: 2, h: 1, q: 2, b: 8}? 2/171 Calculate prob of sequence tthx when four letters picked without replacement from {t: 3, h: 2, x: 10}. 1/273 Calculate prob of sequence sel when three letters picked without replacement from ssssszeslssessez. 1/112 Three letters picked without replacement from {v: 1, h: 1, r: 1, b: 2}. What is prob of sequence bbh? 1/30 What is prob of sequence hmlu when four letters picked without replacement from umuhbhuluuhu? 1/660 What is prob of sequence dn when two letters picked without replacement from mnhhdhhhh? 1/72 What is prob of sequence cdjy when four letters picked without replacement from {y: 2, d: 4, j: 2, h: 1, c: 1}? 1/315 Two letters picked without replacement from cccccccwwnwnwnwccnc. What is prob of sequence nw? 10/171 Four letters picked without replacement from {f: 6, q: 4, w: 10}. Give prob of sequence wqff. 10/969 What is prob of sequence rrlu when four letters picked without replacement from {l: 3, n: 1, r: 2, u: 4}? 1/210 Calculate prob of sequence fkf when three letters picked without replacement from {k: 1, f: 13, m: 3}. 13/340 What is prob of sequence ttbh when four letters picked without replacement from {z: 5, h: 3, q: 5, t: 2, b: 3}? 1/4080 Three letters picked without replacement from essjsedsddddjsddsdd. What is prob of sequence dsd? 24/323 Four letters picked without replacement from {c: 3, s: 3}. What is prob of sequence sccc? 1/20 What is prob of sequence dyyd when four letters picked without replacement from dwmmymymmbydz? 1/1430 Four letters picked without replacement from sssssssssssssssnsn. What is prob of sequence snss? 14/153 Four letters picked without replacement from bwbbbbbbbbbwbbbbbbbb. Give prob of sequence wbbb. 8/95 Three letters picked without replacement from {w: 11, t: 2, s: 6}. What is prob of sequence ssw? 55/969 Three letters picked without replacement from zsivzzzvzizstsviim. Give prob of sequence vms. 1/544 Three letters picked without replacement from yyycyccwy. What is prob of sequence ywy? 5/126 Four letters picked without replacement from wawiwwwtkiiaaakwqtk. What is prob of sequence kiiq? 1/5168 Two letters picked without replacement from gbggbggbggggggggggbg. Give prob of sequence gb. 16/95 Calculate prob of sequence pp when two letters picked without replacement from {h: 4, p: 1, r: 2}. 0 Three letters picked without replacement from jgygyjjgyjy. Give prob of sequence jyg. 8/165 Calculate prob of sequence ccg when three letters picked without replacement from {c: 3, g: 7, d: 5, l: 1}. 1/80 Calculate prob of sequence fr when two letters picked without replacement from {f: 7, q: 6, c: 3, r: 3}. 7/114 Four letters picked without replacement from hgqhqhggqemqhhegggfg. What is prob of sequence gqfg? 7/4845 What is prob of sequence ccco when four letters picked without replacement from ooccc? 1/10 Calculate prob of sequence kg when two letters picked without replacement from {k: 1, u: 11, a: 4, p: 1, g: 1}. 1/306 Two letters picked without replacement from {s: 3, c: 5, k: 8}. What is prob of sequence ss? 1/40 Four letters picked without replacement from gspzoozszzgps. Give prob of sequence zgog. 2/2145 Three letters picked without replacement from vvzpzl. Give prob of sequence vvz. 1/30 Calculate prob of sequence kw when two letters picked without replacement from {p: 2, z: 1, c: 1, w: 6, k: 3, x: 2}. 3/35 Three letters picked without replacement from lwrcj. What is pr	{ "pile_set_name": "DM Mathematics" }
. Is 17 a factor of (-5 - l - 12)-41? True Let d(h) = 27h - 34. Let g be 15 - (0 - (3 - 7)). Let o be d(g). Suppose 2x - 268 = -3p + 3x, 3p - 2x - o = 0. Is p a multiple of 18? False Let f be 3 + 20/(-6) + 5522/6. Suppose -3c - f = -11c. Suppose -4z = 5u - 283, 3u - 5u - z = -c. Is u a multiple of 13? False Let i = -32 - -41. Suppose 5p - 13 = 2. Suppose -i = -pv + 3, 0 = k - 2v - 82. Is k a multiple of 20? False Suppose 0 = 378n - 374n - 45992. Is n a multiple of 86? False Suppose d - 16370 = 4856 + 3896. Is d a multiple of 23? False Suppose -29598 = -14k + 12k + 3b, -3b = 3k - 44427. Is k a multiple of 7? True Suppose 499m + 5478095 = 1012m - 14643817. Does 106 divide m? False Suppose 3 = -t + 3k + 2, 5t - 3k - 7 = 0. Suppose -180 = -6y + ty - 4h, -4h + 131 = 3y. Is 5 a factor of y? False Let u = -44 - -50. Let p be (-14)/28 + u/4. Is 36 a factor of (1 + p + -4)-119? False Suppose -3h - 2j - 15 = 0, -3h + j = 2j + 18. Is 2(3 + h + 475/2) a multiple of 18? False Let t(j) = 50j3 - j2 + 5j - 4. Let q be (4 + -2)/(4/(-50)). Let d = q - -26. Is 25 a factor of t(d)? True Suppose 7710 = 3r - 3o, 4r - 8o = -11o + 10252. Is 21 a factor of r? False Let t = 10608 + 11316. Does 21 divide t? True Let v(x) = 6x2 + 5x + 2549. Does 14 divide v(0)? False Let g(m) = -8m3 - 2m*2 - 24m - 97. Does 13 divide g(-6)? True Let n = 0 + 11. Suppose -4t = -8t - 2p + 20, 0 = -3t + 5p - n. Suppose -4i = 4w - 124, 4i + 64 = -tw + 187. Is 10 a factor of i? True Suppose -30b + 37b - 504 = 0. Let q = b - -195. Is q a multiple of 41? False Does 8 divide (-6)/10 + 1265345/575? True Let o = 4 + -2. Suppose 8z + 3740 = 13z + 4f, oz - 2f - 1478 = 0. Does 62 divide z? True Let b = 2 - 2. Suppose 4m = -bm - 32. Let u(h) = -3h - 2. Does 11 divide u(m)? True Let t(q) = -q3 + 14q*2 - q + 17. Let n be t(14). Let o be (10 - 2 - n)-19. Let b = 178 + o. Is 14 a factor of b? False Suppose 335 = 6n + 41. Let r = 548 - n. Suppose -2j + 49 = 4i - r, 2i - 262 = 2j. Is i a multiple of 15? True Let p(c) = 17c - 109. Let i = -6 + 16. Is 7 a factor of p(i)? False Let x(n) = 55n2 - 78n - 1578. Does 51 divide x(-16)? False Let r = -612 - -1019. Suppose 523 = 5s + m, -2s + 3m = 2s - r. Is s a multiple of 26? True Let b(m) = -6m - 2. Let u be b(-1). Let g be 305/15 + u/(-12). Suppose -g = -d + 38. Is 12 a factor of d? False Let b(t) = t3 - t2 - 2t + 140. Let v be b(0). Let m = v - 440. Let r = 455 + m. Does 24 divide r? False Let l be (-15174)/(-297) - (1 + 10/(-11)). Suppose -60x + lx = -3969. Is x a multiple of 9? True Suppose 3i - 21 = 3r, 0i + 5i = r - 5. Let n = 22 + r. Let k = n - -9. Is 17 a factor of k? False Let i be 423/81 + 4/(-18). Suppose 895 = 5j + iw, w = -3j - 0w + 531. Suppose j = 5f - f. Is 14 a factor of f? False Suppose 3q + 2l - 1079 = 0, 0 = -0q + q - 4l - 341. Let j = 425 - q. Is 4 a factor of j? True Let h = -5917 + 5956. Is h a multiple of 18? False Let i(k) = 3k + 53. Let f be i(-18). Is ((-5 - -4)/3)/f87 a multiple of 4? False Let u(n) = -3n*2 - 9n + 6. Let x be u(-6). Let a = 48 + x. Let i(t) = 5t + 140. Is i(a) a multiple of 20? True Is 12/(-9) - (-523188)/27 a multiple of 42? False Is 2/15 + 0 - 11359895/(-5475) a multiple of 25? True Let o(u) = 3u*3 + 8u*2 - 56u + 673. Does 58 divide o(13)? True Suppose 1231 + 480 = 5k + w, -4k + 1380 = -2w. Suppose -2 = 2q, 14j = 11j + q + k. Does 33 divide j? False Let t be 228/20 - (-8 + (-222)/(-30)). Let b be (-2 - -2)1-1. Suppose 4p - t = -b. Is 3 a factor of p? True Let s(c) = 3c - 72. Let b be s(21). Let q(i) = i*3 + 11i*2 - i + 31. Is q(b) a multiple of 11? False Let n(t) = 773t + 5452. Is n(37) a multiple of 14? False Let f be 132/88(-1 + (-50)/(-6)). Suppose -i + 12084 = fi. Is i a multiple of 55? False Let i(w) = 4w2 - 73w + 21. Let u be i(18). Let c(k) = 4k3 + 2k*2 - 17k + 51. Is 9 a factor of c(u)? True Let q be ((-18)/4 + 2)/(1/2). Let a(d) = -d - 5. Let o be a(q). Suppose -5j + 0l = -2l - 596, -5j - 4l + 608 = o. Does 30 divide j? True Suppose -14g + 12 = -16. Let f be (-1182)/g3/(-9). Suppose 2o + 6 = 2v - 80, -5v - 4o + f = 0. Does 33 divide v? False Let n be (49956/12)/(2/12). Suppose -n + 5595 = -21f. Does 11 divide f? False Suppose 1795 = 3u - 4z - 3043, 4u - 3z - 6460 = 0. Is 10 a factor of u? False Is (2 - (-4727)/(-116))/((-1)/64) a multiple of 20? True Is 38864/10 + 11 + (-468)/45 a multiple of 23? True Let v(k) be the second derivative of 12k3 - 9k*2 - k - 2. Does 9 divide v(4)? True Suppose -233 - 4117 = -t. Suppose -12s = -2s - t. Does 29 divide s? True Let a = 90 - 42. Suppose -4c + 2w + 2646 = -a, -5w + 657 = c. Does 21 divide c? True Let s be (7 + 235/(-25))(0 + -1910). Suppose -s = 594m - 602m. Is m a multiple of 14? False Is 49 a factor of 4/9 + -16 + (-12908)/(-36)? True Let z(b) = 2b*3 - 8b*2 + 5b - 8. Let s be z(4). Suppose s = -3j, -w - 11 = 4w + 4j. Suppose 3g + 4y = 304, y = -w + 5. Is g a multiple of 17? False Suppose -25p = 23p - 17232 - 116688. Is 10 a factor of p? True Is 4 a factor of (-44)/(-33)3 - -446? False Let f(d) = -7d - 8d - 222 - 2d - 15d. Is 14 a factor of f(-20)? False Let b = 13546 + -6269. Is b a multiple of 9? False Suppose 17278t = 17272t + 8730. Does 15 divide t? True Suppose -14 = -2w + 30. Suppose 4t = -2c + 966, w = 3t + 10. Does 19 divide c? True Suppose -7n - 25 = -12n. Suppose nr + 4i = -16, -5r + 5i + 7 + 13 = 0. Suppose 0 = -3v - 5t - 0t + 48, r = 5t + 15. Is v a multiple of 3? True Let d = -11741 + 29093. Is d a multiple of 240? False Let w(v) = -2v2 - 4v + 3. Let k be w(0). Suppose 544 = kc + 4x, -4x - 144 = -2c + 192. Does 4 divide c? True Suppose -517x + 1056 = -515x. Let u = x - 467. Is u a multiple of 3? False Suppose -15 = 2n - 5n + 5s, -2n + 2s = -10. Suppose 2c + c + 2 = 4u, -3c = nu + 11. Is 14 a factor of 40 + ((-2)/3)/(u/3)? True Let c be -6 + (8/6 - 6/(-9)). Let x(d) = -177d - 11. Let f be x(c). Suppose -97 = -2r + 3q + 173, 0 = 5r - 2q - f. Is r a multiple of 47? True Let m(h) = -7h - 114. Let y be m(-27). Suppose 3l - 296 = -2j - y, 0 = -2l - 4j + 142. Does 8 divide l? False Let u be 2 + (2-10)/4. Let k be u/(30/(-4)) + 273/5. Does 10 divide -1 + k - 28/7? True Let t = 631 - 626. Suppose 11f - 1712 = -tf. Is 15 a factor of f? False Let h = -78 + 74. Let v be -2 + (-1 - h - -474). Is ((-2)/2)/((-1430)/v + 3) a multiple of 9? False Let o be (-36)/24(-10)/3. Suppose -5v + q = -3320, -ov - 7q = -2q - 3290. Does 13 divide v? True Suppose -26k + 124032 = 88k. Is k a multiple of 68? True Suppose -s + 0s + 3 = 4p, -2s - 3p = -11. Let g = s - -2. Suppose b + 3 = g. Is b a multiple of 3? True Suppose 5j - 4 - 10 = 4r, 2j - 3r = 0. Suppose jn - 15 = 3n. Suppose 0 = nu + 43 - 178. Does 2 divide u? False Let u(b) be the first derivative of -2b - 9/2b*2 - 6 + 1/3b3. Is 20 a factor of u(11)? True Let y(p) = p2 + 2p - 18. Let w be y(3). Let x(g) = -g. Let i be x(-5). Is 9 a factor of 19/(i + w + -1)? False Suppose 4y + 26 = 2c, 3y - 7y = -5c + 35. Suppose 3f = o - 43 + 183, -co + 165 = 4f. Is f a multiple of 9? True Let t(i) = -18 + 3 - 15601i*2 + 15735i*2 - 14i. Is 9 a factor of t(-2)? True Let w(z) = -72z2 - 2z - 3. Let m be w(-1). Let g = -79 - m. Is 14 a factor of 63/g180/(-27)? True Is ((-2)/(-6))/(((-6)/(-30))/(1908/5)) even? True Let t = -201 + 197. Is (-84)/(-63)(-882)/t a multiple of 42? True Let d = -72953 + 112399. Is 12 a factor of d? False Let o(v) = 27v + 45. Let q be o(10). Suppose 346n - q = 345n. Does 15 divide n? True Does 124 divide (145719/18 - 7)(-2 - -4)? False Let z be -12 - 2(-3 + -1). Let p be 10(-28)/(-21)z/16. Suppose pc = -y + 46, -5c - 97 = 4y - 326. Does 39 divide y? False Suppose 0 = 2k - 5q - 239, -3k + 531 = -2q + 200. Suppose 103 = -5t - 26w + 30w, -5t + 2w - 99 = 0. Let b = t + k. Is 8 a factor of b? True Suppose -75c + 44c = -68c + 352610. Is 10 a factor of c? True Suppose r - 1322s + 1327s = 13427, -4s + 26806 = 2r. Does 60 divide r? False Suppose -5a = x - 27443, -109847 = -4x + a - 6a. Does 30 divide x? False	{ "pile_set_name": "DM Mathematics" }
2. 4 + 2sqrt(13) Simplify (-2(sqrt(176) + 1 + sqrt(176)) + sqrt(891) + -6(-4 + sqrt(891)))25. -13420sqrt(11) + 207075 Simplify ((-1sqrt(117)5 + -2sqrt(117) + -3)3 + 2)2. 882sqrt(13) + 51646 Simplify 6((0 + sqrt(1300))2 + sqrt(234)/sqrt(2) + 1 + sqrt(637) + 1). 60sqrt(13) + 7812 Simplify (2 + (1sqrt(567))2)-2-3. 3414 Simplify 2((sqrt(2) + (sqrt(6)/sqrt(3) + sqrt(2))2)-5 + -5)2. -100sqrt(2) - 20 Simplify -5 + (sqrt(384)/sqrt(432) - (sqrt(32) + 2sqrt(192)/sqrt(6))). -34sqrt(2)/3 - 5 Simplify 2(-1(-2sqrt(288) + 4)-6)*2. -13824sqrt(2) + 84096 Simplify -2(sqrt(50) + (sqrt(500)4)/sqrt(10))/(sqrt(490) - (sqrt(490)-1 + sqrt(490)))-4. 40sqrt(5)/7 Simplify sqrt(700) + sqrt(700) + 3 + -5 - ((sqrt(700) + -3)-2 - sqrt(700)). -8 + 50sqrt(7) Simplify sqrt(9)/(sqrt(3) + sqrt(12))3 - ((2sqrt(3) - sqrt(3)) + 0)6. -5sqrt(3) Simplify (sqrt(68) + 1sqrt(68)-6 + sqrt(68) + sqrt(68) + 1 + sqrt(68) + 1 + sqrt(68) + sqrt(68))-41. -8 Simplify ((sqrt(200) + sqrt(200) + 2sqrt(200) + sqrt(200))5)/(sqrt(4) - sqrt(8)/sqrt(2)4). -125sqrt(2)/3 Simplify ((sqrt(143) - (sqrt(143)1 - sqrt(143) - sqrt(143)))-2 - ((sqrt(143)1 + sqrt(143))4 - sqrt(143)))/(-6sqrt(11)1 + sqrt(22)/sqrt(2)-1). 11sqrt(13)/7 Simplify 6((0 + sqrt(475))-1 + 4) + 4. -30sqrt(19) + 28 Simplify ((-3sqrt(330))/sqrt(11))/(4sqrt(160)). -3sqrt(3)/16 Simplify ((sqrt(420)/(sqrt(12)6))/sqrt(7))*2 - ((sqrt(250)/sqrt(10))/sqrt(5)-4)*2. -2875/36 Simplify (sqrt(187) - (sqrt(187)-1-6 + sqrt(187)))/sqrt(11) - (sqrt(1377) + -1 + 5). -15sqrt(17) - 4 Simplify (sqrt(567)-25 + 4 + -2(sqrt(567) - (sqrt(567) - (1sqrt(567) + sqrt(567) + 0))))*2-1. -111148 + 1008sqrt(7) Simplify (-56(2sqrt(88) - sqrt(88)))/(sqrt(32)/(sqrt(16)/sqrt(4)) + 1sqrt(512)). -10sqrt(11)/3 Simplify ((((sqrt(132)-2 + sqrt(132))-4)/sqrt(11))/(3sqrt(144)2))2. 1/27 Simplify (sqrt(125) + 1)2 + 1 + (sqrt(125) - (sqrt(125) + (4 + sqrt(125) + 2 - sqrt(125)) + sqrt(125))). 5sqrt(5) + 121 Simplify (1((-2 + sqrt(832) + -4 + sqrt(832) - sqrt(832)) + -1))*2. -112sqrt(13) + 881 Simplify sqrt(972)-1 + 5 + sqrt(3) + -5(sqrt(3) + sqrt(27)). -37sqrt(3) + 5 Simplify ((-1sqrt(77)-1)/(sqrt(7) - (-4sqrt(7)-2 + sqrt(7))))2. 11/64 Simplify 5(sqrt(18)/(sqrt(9) - (sqrt(9) - sqrt(9)-2)) + sqrt(22)/(sqrt(11)-1)) + (sqrt(98) + sqrt(98) + 0 + -3 + sqrt(98) + sqrt(98) + 1 + sqrt(98) + -2)*2. -575sqrt(2)/2 + 2466 Simplify (5 + sqrt(147)-2 - (3 + sqrt(147) + 0))2 + ((sqrt(12) - (sqrt(12) + sqrt(48)))5)/((sqrt(72) + sqrt(8))/sqrt(2)). -173sqrt(3)/2 + 1327 Simplify (((sqrt(70) - -2sqrt(70))/sqrt(5) - sqrt(14))1)/(-521sqrt(7)). -sqrt(2)/5 Simplify (4sqrt(126))/(-1sqrt(8) - sqrt(8)) + -3 + (sqrt(28)/(sqrt(4)-2)6)*2. -3sqrt(7) + 60 Simplify (sqrt(136)/sqrt(72) + sqrt(17) - (-5 + (sqrt(68) - sqrt(17))))*2 + 1 + (sqrt(612) - 2sqrt(612))*2 + sqrt(612) + sqrt(612)-1 + -4 + sqrt(612). 28sqrt(17)/3 + 5723/9 Simplify (sqrt(55)/(sqrt(11)-1) + 5)*2 + ((sqrt(75)/sqrt(3) - sqrt(25))-3)/sqrt(5). -10sqrt(5) + 30 Simplify (3(sqrt(1323) + 3sqrt(1323)))/(sqrt(144) + (sqrt(144)-31 - sqrt(144)) - sqrt(144)). -21sqrt(3)/4 Simplify (sqrt(2299)1 + -3)2-2 - ((sqrt(2299)-1 + -4 + sqrt(2299))4)*2. -4872 + 132sqrt(19) Simplify (sqrt(242)/(-1(sqrt(11) + -1sqrt(11)) - sqrt(11)))/(sqrt(11) + 6(sqrt(11)1 - sqrt(11) - sqrt(11)) + sqrt(33)/sqrt(3)6). -sqrt(2) Simplify (sqrt(13)-1-1 - sqrt(13))4-3 - (5 + sqrt(52) + (1 + (sqrt(13) - sqrt(78)/sqrt(6)))2). -2sqrt(13) - 6 Simplify (-2 + sqrt(448) + 4)*2 + 1. 32sqrt(7) + 453 Simplify ((sqrt(19) - sqrt(114)/sqrt(384)) + (sqrt(19) + -3)2 + 5 + -5)2. -69sqrt(19)/2 + 12355/64 Simplify 6sqrt(68)-4 + sqrt(272)2-3. -72sqrt(17) Simplify -3 + (-3(sqrt(22) + sqrt(22)2) + sqrt(22))/(sqrt(44)1). -4sqrt(2) - 3 Simplify (sqrt(117)4-1)/(sqrt(99)/(sqrt(11)1) + sqrt(9)). -2sqrt(13) Simplify ((-6(sqrt(80)-5 - sqrt(80)))2 + -3)5. 518385 Simplify (sqrt(165)/sqrt(147))/(sqrt(275) - -5sqrt(275)) + -2. -2 + sqrt(5)/210 Simplify (sqrt(24)/(sqrt(28)/sqrt(7))-2)/((sqrt(48)/sqrt(2))/sqrt(12) + (sqrt(98)-1 + sqrt(98) - sqrt(98))). sqrt(3)/3 Simplify (4(-3 + ((sqrt(102) - 1sqrt(102))-1)/(sqrt(54)-6 - sqrt(6))))2. 144 Simplify (2sqrt(1260)2)/(4(sqrt(245) + (sqrt(245)-2 - sqrt(245)) - sqrt(245)))-1. 2sqrt(7)/7 Simplify -4-2((-11sqrt(1331) - ((sqrt(1331) + sqrt(1331)2)4)2) + -1). -1533320 - 88sqrt(11) Simplify (-5 + -4 + 4((sqrt(448) - (sqrt(448) - (sqrt(448) + -1 + sqrt(448) + sqrt(448)))) + -1))2. -3264sqrt(7) + 64801 Simplify 2 + ((-4sqrt(90)/sqrt(3))/sqrt(3))/(-5(-1sqrt(245) - sqrt(5))). -sqrt(2)/10 + 2 Simplify sqrt(252) + -3((-2sqrt(252))2 + sqrt(252)) + (sqrt(252) - (-4 + -1sqrt(252)))*2 + sqrt(252) + 3. -1997 + 90sqrt(7) Simplify ((-4 + sqrt(1800))-4 - sqrt(1800)) + -2. -150sqrt(2) + 14 Simplify (-1 + 1(sqrt(108)-4-5 + (sqrt(108) - (sqrt(108) - (sqrt(108) - ((sqrt(108) + -2)5 + sqrt(108)))))))*2. 1620sqrt(3) + 24381 Simplify sqrt(208)/sqrt(4)5-2-1-3. -60sqrt(13) Simplify ((1(sqrt(80) + 0))2 - ((sqrt(605) + 0 - sqrt(605))2 - (-1 + sqrt(5))-6))5. -30sqrt(5) + 430 Simplify ((22(0 + sqrt(108)))2 - 3(sqrt(108) + 1)6) + 1. -108sqrt(3) + 1711 Simplify ((sqrt(833) + -1sqrt(833)3 + sqrt(833))4 + (1 + sqrt(833) + -1 - (0 + sqrt(833) + 2 + sqrt(833))))2. 140sqrt(17) + 20829 Simplify ((1 + sqrt(1008) + -1)-3 + 4 + 2sqrt(1008) + (sqrt(1008) + 0)2)2. 96sqrt(7) + 1024 Simplify (5(sqrt(104) + (sqrt(104)4 - sqrt(104))))/(sqrt(8) + sqrt(24)/sqrt(243)) + -5. -5 + 18sqrt(13) Simplify (-6((sqrt(56) - sqrt(336)/sqrt(6)) + sqrt(56))-6)/(-3sqrt(128) + sqrt(8) + -2sqrt(128)). -36sqrt(7)/19 Simplify sqrt(14)/(sqrt(7)2) + sqrt(162) + 1 - (1 + -2 + sqrt(2) + sqrt(4)/sqrt(2) + -3). 5 + 15sqrt(2)/2 Simplify (5(sqrt(70) - (sqrt(70) + (sqrt(70) - ((sqrt(70) - ((-2sqrt(70) + sqrt(70))-3 + sqrt(70))) + sqrt(70))))))/(-4(sqrt(10) + sqrt(40))3). 5sqrt(7)/12 Simplify 5 + ((1sqrt(375) - sqrt(15))-4)/(1sqrt(500)1). -8sqrt(3)/5 + 5 Simplify -4 + sqrt(800)2 + sqrt(800) + (2sqrt(1152))2. 60sqrt(2) + 4604 Simplify -4(-3 + sqrt(432) + -2 + 3sqrt(432)6)2. -623908 + 9120sqrt(3) Simplify -4(((sqrt(175) + sqrt(7))4-3)2 + 2(sqrt(7) - (-3sqrt(77))/sqrt(11) - sqrt(7))2). -145656 Simplify 0 + ((4 + sqrt(605) - sqrt(605))2 - sqrt(605)) + -4 + 2. -11sqrt(5) + 14 Simplify -2(0 + -1(sqrt(2057) - (sqrt(2057)1 + -1 - sqrt(2057))2))3. -6 + 66sqrt(17) Simplify 4 + (sqrt(52)/sqrt(2))/sqrt(2) + -1 + -2. 1 + sqrt(13) Simplify (sqrt(2662) + -2sqrt(2662) - (sqrt(22) - sqrt(88)-2))/((sqrt(275)2 - sqrt(11)) + sqrt(44)/(sqrt(4) - (-1sqrt(4) - sqrt(4) - sqrt(4) - sqrt(4)))). -40sqrt(2)/23 Simplify (((sqrt(126) + (sqrt(126) + -2sqrt(126))2 - sqrt(126) - sqrt(126)) + sqrt(126))/sqrt(9))/(-5sqrt(63) - -3-2sqrt(7)). 2sqrt(2)/21 Simplify (-1 + sqrt(99) + 1 + -5-1sqrt(99) - ((0 + sqrt(99))4 + -4))2. 48sqrt(11) + 412 Simplify -6(sqrt(7) + (sqrt(63)/(sqrt(9)-2))*2) + ((1sqrt(343))*2 - sqrt(7) - ((sqrt(7) + sqrt(63))-2)*2). -231/2 - 7sqrt(7) Simplify (-6-5(sqrt(1008)2-64 + -1))2. 1036800sqrt(7) + 2090189700 Simplify -4(((sqrt(325) + sqrt(325)1 + 3)*2 - (sqrt(325) + 0 - sqrt(325) - sqrt(325))6) + (sqrt(325) - 1sqrt(325))2-53). -5236 - 360sqrt(13) Simplify -2(sqrt(425) + 0)5-5. 250sqrt(17) Simplify 6(-1 + sqrt(1300) - sqrt(1300)) + 0 + sqrt(13) + (sqrt(13) + 1)2 + -4. 4 + 3sqrt(13) Simplify ((-2sqrt(1088)4 - sqrt(1088))-2 + (0 + sqrt(1088) + sqrt(1088))3 + 1)*2-3. -1880067 - 1152sqrt(17) Simplify ((sqrt(153) - sqrt(153)1-3)6)/((2sqrt(144)2 - sqrt(144)) + sqrt(144) + sqrt(144)). 6sqrt(17)/5 Simplify (5 + (sqrt(208)13)2 + ((sqrt(208) - (-1 + sqrt(208))-6) + -3(sqrt(208) + -1))2)1. -96sqrt(13) + 5214 Simplify (-4 + (sqrt(152)/(sqrt(8) + sqrt(288) + sqrt(8) + sqrt(8) + sqrt(8)) - (sqrt(19) - (sqrt(2299) + -1 + sqrt(2299)))2))5. -41920 + 421sqrt(19)/2 Simplify (2(sqrt(36) + sqrt(1764))-5)/((sqrt(1452) + (sqrt(1452) - (sqrt(1452) - ((sqrt(1452) - sqrt(1452)-2) + sqrt(1452)))))3). -16sqrt(3)/33 Simplify (sqrt(450)/sqrt(5))/(sqrt(8)-1) - ((4 + sqrt(35)/sqrt(7) + sqrt(5))2 + -1sqrt(5)*4). -36 -	{ "pile_set_name": "DM Mathematics" }
x = 46t - 20, 0x = -45t + 2x + 84 for t. 2 Solve 4h = -3n - 492 + 481, 5n = 3h + 1 for n. -1 Solve -8350w - 7 = -8345w + 2n, 2 = w - 3n for w. -1 Solve -5g = 25, -6g + 38 = -2q - 7g + 37 for q. 2 Solve -3p - 5a + 0a = 7, p - 3a = 7 for p. 1 Solve -z + 7 = 4c + 8 + 9, 27 = -9c for z. 2 Solve -6o - 16 = -4g, 0 = 5o - 0o + 10 for g. 1 Solve 56 = -14n - u, 375u = n + 379u + 4 for n. -4 Solve 5b - 4x = -3, -38x - 33x = -67x - 8 for b. 1 Solve 2y + 14 = -r, -4y = -91r + 89r + 20 for r. -2 Solve -2a = -l + 68 - 66, -5a - 5l = 50 for a. -4 Solve 5c + 85 = -5t, -1291t - 5c - 73 = -1290t for t. -3 Solve 0 = -n + 2p + 7, 3p + 1883 - 1892 = -5n for n. 3 Solve -797r = -3k - 795r - 7, -5k = -3r + 13 for k. -5 Solve 4r + 28 = -4v, 12 = -39v - r - 109 for v. -3 Solve -121v - 20 = -124v + 4r, 0 = 4v + 5r - 6 for v. 4 Solve -x - 16 = -4l, 80x = 3l + 76x - 12 for l. 4 Solve 0 = 2g - 65 + 73, -3g = 3m + 15 for m. -1 Solve 0 = -3x + k - 7, -347x + 345x + 5k + 17 = 0 for x. -4 Solve j - 25 = -14u, 10j - 6j - 3u = -18 for j. -3 Solve o = -3d + 14, 137o - 134o - 6d = -33 for o. -1 Solve -14 = 2y - 5w, 4y - 69w = -68w + 8 for y. 3 Solve -2r = -3b + 26, -3r - 120 = 5b + 10r for b. 2 Solve 103s + 5k - 15 = 108s, 0 = 3s - k + 7 for s. -2 Solve 836w - 834w = -5j + 3, 4w + 18 = -2j for j. 3 Solve -8 = 3p - 1957s + 1956s, p = -3s - 16 for p. -4 Solve 5h - 85 = -t, -2h + t = 8t - 34 for h. 17 Solve -3w = 4a - 8, 39 = 4w + 32a - 21a for w. -4 Solve j = -2h - 7, 672j + 3h + 16 = 670j for j. -11 Solve -2l - 1607 + 1678 = w + 4w, -5w = 4l - 67 for w. 15 Solve -31r + 4w + 42 = -3r + 7r - 89, -2w + 22 = 0 for r. 5 Solve 4x = -49 + 53, 3c - 2x + 17 = 0 for c. -5 Solve 3g + 5y - 2y = 0, 5y = 2g + 35 for g. -5 Solve -2c - 2c - 12m = -4m - 13m + 6, 0 = -2c + m for c. 1 Solve 5z + 460t - 458t = 12, -2z + 8 = 4t for z. 2 Solve 5z = -15, c = 5z - 100 + 102 for c. -13 Solve 3l + 9i - 33 = 0, -3l + 2i + 36 = 3i + 27 for l. 2 Solve 13v - 16v = -2p + 5, 35 = -7p for v. -5 Solve 4n + 16 = -1463v + 1459v, 36 = 6n - 4v for n. 2 Solve 108 - 88 = 5c + 3x, 28 = 3c + 5x for c. 1 Solve 7g - 54893 + 54806 = p, -30 = 2p - 2g for p. -3 Solve -3t = n - 5, 4t = 40n - 41n + 8 for n. -4 Solve -8n - 2f + 8 = -12n, -8 = -2n + 3f for n. -5 Solve -12n - 2i = -6, 28i - 8i = -3n + 21i + 6 for n. 1 Solve -575i = -574i - 4f - 18, -4i = 8f - 48 for i. 14 Solve -2o + 15j = 126, 2o - 3 - 31 = 6j - 11j for o. -3 Solve 3p - 30 = -2x, 0 = 2p + 9x + 46 - 66 for p. 10 Solve -2273a = -f - 2278a + 1, 3f = 3a + 3 for f. 1 Solve 77a = 78a + 6s + 2, 3s = -2a - 4 for a. -2 Solve 2u = 1812s - 1809s + 24, -11u - 5s = -89 for u. 9 Solve 4z = -4h + 12, z - 42 = -5h - 43 for h. -1 Solve -3s = 2o - 47, 564o = 565o - 5s + 61 for o. 4 Solve -3k + 19 = -4f + 23, -5f + 5 = k for f. 1 Solve -439t - 2 = -6u - 443t, 2u + 4t = -10 for u. 3 Solve 0 = 5w - 2d + 13, -72w - 11 = -57w + d for w. -1 Solve 3l + 0c = -3c - 15, -2c = 25l - 8c + 94 for l. -4 Solve -k - 4p = 19, 12p - 3 = -3k + 15p for k. -3 Solve 0 = 2t + 4b - 11 - 11, 0 = t + b - 10 for t. 9 Solve 5t = -3b - 18, -2b - 4t - 4 - 10 = 0 for b. -1 Solve -9p = 2a - 12p + 13, a = 2p - 10 for a. 4 Solve -r - 10 = -2n, -184n - 21 = -187n + 3r for n. 3 Solve -2u - 3u = 5d - 15, -d + u - 5 = 0 for d. -1 Solve 5c + j + 163 = 150, 4j - 11 = c for c. -3 Solve 6i = 5c + 2i + 40 - 35, 0 = 5i for c. -1 Solve -149b = -151b + 3h - 6, 0 = -5b + 26h - 52 for b. 0 Solve -l - 16 = -4g, -4l - 5g - 228 + 227 = 0 for l. -4 Solve 3n = -5p + 5 - 18, 5 = -2p - n for p. -2 Solve 0 = -4p - 2r + 14, 141r = -p + 138r + 11 for p. 2 Solve 5s - x = -6 + 11, -5s + 5x = -x + 20 for s. 2 Solve f + 518d = 513d + 34, f = 5d - 16 for f. 9 Solve -2i = -3y + 10, 55y - 59y + i = -20 for y. 6 Solve 0 = 2a - 2m - 0m - 6, 4m + 4934 - 4946 = -2a for a. 4 Solve -30420n - 5o - 100 = -30415n, -2o = -4n + 10 for n. -5 Solve 4s + 4 = 12, 12m - s = -14 for m. -1 Solve -3j = w - 2, -211j + 4 = 2w - 214j for w. 2 Solve 16n - 4v - 68 = 0, 14 = -185n + 189n - 2v for n. 5 Solve -74 + 45 = -4d - y, -2y + 2 = 0 for d. 7 Solve 4t - 176r = -177r + 27, -15 = -5t - 5r for t. 8 Solve 0 = 4y + 71q - 76q + 49, 5y = -q - 54 for y. -11 Solve 3z = -12, -258 = d - 3d + 5z - 234 for d. 2 Solve 1046r + 1 = -4u + 1051r, -1 = -2u + 3r for u. -4 Solve 44453c - 44448c = 2l - 29, -l = -5c - 22 for l. 7 Solve -64 = -20h - 4x, -13 = -4h + 24x - 25x for h. 3 Solve -30w = a - 27w + 51, -4w - 79 = 5a for a. -3 Solve 2b = -2n - 10, 2b - 748 = 4n - 746 for b. -3 Solve 0 = -5d - 7z - 9, 2 = -61d + 65d + z for d. 1 Solve -i + 326t = 324t - 32, 2t = -2i + 34 for i. 22 Solve -m + 4q = 34 - 47, 2m - 2q = 14 for m. 5 Solve 3z + 1559 - 1531 = 5j, j = z + 8 for z. -6 Solve -f - 37 - 20 = 4i, -58 = i + 9f for i. -13 Solve -2k = -5w - 80, -13w = 152k - 157k + 209 for k. -5 Solve i = -8b + 7b - 3, -4b = -12 for i. -6 Solve 43a + 8 = 41a, -9g + a = -0a + 5 for g. -1 Solve -4f + 4a + 60 = 0, 227f + 48 = 219f - 4a for f. 1 Solve b - 4z = -32, -2z - 1018 = -b - 1034 for b. 0 Solve 2b = -4y - 4698 + 4606, 0 = -2y + 3b - 46 for y. -23 Solve -4r = u + 20, 3u + 16r - 11r = -32 for u. -4 Solve 36y - 144 = -4i, 778 = y + 2i + 757 for y. 3 Solve 0 = 5d + o + 9, d - o + 1855 = 1852 for d. -2 Solve 2a - 13 = d, -3d = -4a - 912 + 943 for a. 4 Solve t - 57 = 6j, -5t - 46 + 52 = j for j. -9 Solve -2s + 22 = 2f, 0 = -279s + 289s - f - 66 for s. 7 Solve -10 = -5j + 4s - 0s, -7s + 5 = -8s for j. -2 Solve -4o - 3b + 1 = 0, 4o - 5b - 966 + 957 = 0 for o. 1 Solve 0 = -4g - 2b + 2, 3g - 4b + 106 - 102 = 0 for g. 0 Solve -3f - 27 = 3s, 4f + 6167s - 6156s + 43 = 0 for f. -8 Solve -2p = n + 2, p + 2p = 234n - 236n for p. -4 Solve 0 = -3c - 3a + 106 - 103, c - 4a = -24 for c. -4 Solve h = c + 5, 23h = 4c + 27h + 12 for c. -4 Solve 0 = 7g - 35, 62k - 59k - 7 = -2g for k. -1 Solve 4t - 2d + 29 = 17, 3t + 9 = 3d for t. -3 Solve 4 = n - 2l, -31l - 12 = 3n - 29l for n. -2 Solve 8 = 5n + 2x, 323n - 2x = 326n - 4 for n. 2 Solve -4t = -4v - 52, 5t - 3v = 3 + 46 for t. 5 Solve c + 249g - 246g - 30 = 0, -3c + 4g = 53 for c. -3 Solve 0 = -l - 5d - 27, 2036d = -18l + 2038d - 26 for l. -2 Solve -t - 4x + 24 = 0, 5x = 3t + 75 - 62 for t. 4 Solve -28h + 403w - 120 = 398w + 20, -3h - 2w = 15 for h. -5 Solve -2m = 3k + 27, -4217k + 4218k + 119 = -8m for k. 1 Solve -4w + 43 = -2k + 45, 5k - 5w - 30 = 0 for k. 11 Solve -59 = -5s - 79, -2j + 6s = 2 - 14 for j. -6 Solve -c - h + 38 = 47, 59c + 261 = -5h for c. -4 Solve 0 = 4g + 5z - 56, 5g + 11 = 3z + 7 for g. 4 Solve -5k + 35 = 3o, 3k = 4o - 29919 + 29911 for k. 4 Solve -26 = 3p - 2h, -24357p - 4h = -24362p - 48 for p. -4 Solve 5m - 5 = -0r - 3r, -23r - 4 = -21r - 4m for r. 0 Solve -79 + 85 = 6f + 3l, -4f = 5l - 10 for f. 0 Solve 5l - 22 = -3g, 31l - 9 = -11l + 41l + 4g for l. 5 Solve -4 = 4v - 1615m + 1617m, 3m + 6 = -2v for v. 0 Solve -244n + 245n = -3v + 20, -3v = -n - 22 for n. -1 Solve 197u = -2z + 198u - 18, -11z - 45 = -u for z. -3 Solve -3d - 6l = -120, -5l + 102 = 133d - 130d for d. 4 Solve -8 - 4 = -4w + w, -o + 3w = -3 + 17 for o. -2 Solve 1157r - 1105r = -4k, 3r + 2k = 0 for r. 0 Solve -2y = -4w, y + 64 = 66 for w. 1 Solve 0 = -z - 2r - 4, -4z + 1135 = 2r + 1145 for z. -2 Solve -q + 2 = -d, -9q = 8d - 8q + 7 for d. -1 Solve 0 = -m + 2n + 3, 6 = 2m + 14n - 13n for m. 3 Solve -16 = 5t - 3c, -77t + 76t - 8 = -c for t. 4 Solve -5 = 4y + 9p - 6p, 115p - 111p - 2 = -y for y. -2 Solve 6d + 8j = -16, 598 = 5d - 3j + 592 for d. 0 Solve 13158q - 2y = 13160q + 6, -3q + 3y = -3 for q. -1 Solve -5c - 2v - 15 = 0, 4v + 76 - 85 = 3c for c. -3 Solve 3q = 34k - 39k + 29, 0 = -k + 2q - 2 for k. 4 Solve -11 = -3o - 5k, -8o + 10o + 5k = 9 for o. 2 Solve 0 = l - 4j, -5j + 7 = -5l + 2l for l. -4 Solve 4 = p, 7*	{ "pile_set_name": "DM Mathematics" }
ase 2, what is 10011 - -100110101000? 100110111011 In base 3, what is 0 + 211222220220? 211222220220 In base 7, what is -2 + -44032? -44034 In base 4, what is 13 + -10322211? -10322132 In base 12, what is -337 + -69? -3a4 In base 7, what is -316113 + -2? -316115 In base 7, what is -130 + -161151? -161311 In base 3, what is 120110000 - 10? 120102220 In base 5, what is -403 - -4434? 4031 In base 10, what is 706 - -87? 793 In base 15, what is 39 + 1c4? 20d In base 10, what is -8680 + 2? -8678 In base 9, what is -6483 + 163? -6320 In base 5, what is 3024 + -1141? 1333 In base 14, what is -1015b3 + -4? -1015b7 In base 15, what is -25 + -2623d? -26263 In base 2, what is -110110 + -11010101101110? -11010110100100 In base 11, what is -208 - 37? -244 In base 16, what is 382 + 132? 4b4 In base 10, what is 95 + -37755? -37660 In base 12, what is -36057 - 0? -36057 In base 16, what is -5a17 - -2d? -59ea In base 4, what is 201 + -222123? -221322 In base 7, what is -335006 + -3? -335012 In base 9, what is 21 - -611473? 611504 In base 12, what is -180127 - -3? -180124 In base 12, what is 64 + 1248? 12b0 In base 12, what is 5739 + -6? 5733 In base 16, what is 433cc2 + 4? 433cc6 In base 10, what is 11857 - -268? 12125 In base 6, what is -44425150 + 5? -44425141 In base 4, what is 13232 + 101? 13333 In base 2, what is 11110101000111 - 11100? 11110100101011 In base 16, what is 8 - -527c1? 527c9 In base 3, what is 1 - 202120101002? -202120101001 In base 13, what is 2 - aa94? -aa92 In base 15, what is -c682 + 10? -c672 In base 8, what is -107243 + -6? -107251 In base 14, what is 4 + -333d1? -333cb In base 16, what is 3 - -4283? 4286 In base 8, what is 224 + 24451? 24675 In base 5, what is 131 - 21334? -21203 In base 6, what is 10422 + -24? 10354 In base 4, what is 22132 + -1120? 21012 In base 8, what is -51036 - -6? -51030 In base 9, what is 432 + -5? 426 In base 7, what is 1 + 361150? 361151 In base 4, what is 301100221 - 0? 301100221 In base 2, what is -10 + 111100011100100? 111100011100010 In base 9, what is 5 + -216082? -216076 In base 2, what is -111110000000 - 10? -111110000010 In base 2, what is 101 - -11111010100010? 11111010100111 In base 12, what is 3180 + 20? 31a0 In base 5, what is 2233 + -334? 1344 In base 12, what is 7 + -3028? -3021 In base 4, what is -1101 - 3231232? -3232333 In base 4, what is 30023233212 + 2? 30023233220 In base 10, what is 0 - 77307? -77307 In base 15, what is 1b9ad - 3? 1b9aa In base 6, what is 331 - -54? 425 In base 7, what is 10 + 12536? 12546 In base 16, what is 2ce7 + 3? 2cea In base 7, what is -14255442 + -3? -14255445 In base 14, what is 3d1 + -232? 19d In base 16, what is -6a + -711? -77b In base 7, what is 1254123 + -5? 1254115 In base 10, what is -10 + 9919? 9909 In base 15, what is -37 - 163b? -1673 In base 8, what is 20314 - -16? 20332 In base 2, what is -110000 - 1000100? -1110100 In base 10, what is 1668237 - 0? 1668237 In base 13, what is 121 - -a? 12b In base 8, what is -111651 + 7? -111642 In base 15, what is 4617 - 28? 45de In base 12, what is -4a4a7 - -3? -4a4a4 In base 3, what is 212221221121 + -11? 212221221110 In base 9, what is 2 + -2015? -2013 In base 3, what is 110 + -202012? -201202 In base 5, what is 10 - 111130? -111120 In base 11, what is 85 + -357? -282 In base 9, what is 4 - -53157? 53162 In base 11, what is 3 + -44a90? -44a88 In base 16, what is -16 + e1e? e08 In base 14, what is 4 - -16b50? 16b54 In base 11, what is -2630a - 10? -2631a In base 15, what is 795974 - -3? 795977 In base 2, what is 110110101000110 - -101? 110110101001011 In base 6, what is 3 + -154153? -154150 In base 15, what is -5 + 1d9c? 1d97 In base 3, what is -11 + -221220012? -221220100 In base 13, what is -5294 - 9? -52a0 In base 10, what is 229 - 2181? -1952 In base 4, what is -10 + 31322100? 31322030 In base 7, what is -3261 - -2432? -526 In base 4, what is -300310 + 22? -300222 In base 16, what is 2a + 49d? 4c7 In base 9, what is 3712 - 10? 3702 In base 12, what is 11 + 9889? 989a In base 4, what is -1110103 - 131? -1110300 In base 9, what is -476142 + -3? -476145 In base 3, what is -2201 - -200100002? 200020101 In base 9, what is -10670 + -26? -10706 In base 4, what is -33100023031 - 11? -33100023102 In base 15, what is 8 - -ea0? ea8 In base 8, what is -2 - 4116671? -4116673 In base 14, what is -15acb - 1? -15acc In base 8, what is -32 - 4662? -4714 In base 15, what is 6 + 42093? 42099 In base 11, what is 63 - 675? -612 In base 6, what is 11443554 + 3? 11444001 In base 6, what is -1 + -300311? -300312 In base 12, what is 4 - -47? 4b In base 12, what is -44 - -173b? 16b7 In base 14, what is -39 + -b78? -bb3 In base 16, what is 471a + 3f? 4759 In base 11, what is -1 + 6981? 6980 In base 8, what is -3 - 2055? -2060 In base 6, what is -5150 - 33? -5223 In base 2, what is -10010100100010100 + 1? -10010100100010011 In base 10, what is -5 + -10367? -10372 In base 8, what is -27 - 172024? -172053 In base 8, what is -2 + 4412155? 4412153 In base 13, what is -a + 873? 866 In base 6, what is -50055 - 233? -50332 In base 10, what is 0 - -291799? 291799 In base 2, what is -1 + -1010111011111? -1010111100000 In base 6, what is 5 + -14434553? -14434544 In base 15, what is 12d0 + c? 12dc In base 14, what is -83582 - -16? -8356a In base 8, what is 11 + 45264? 45275 In base 11, what is 31847 + 3? 3184a In base 11, what is 595873 - -1? 595874 In base 9, what is -120 + 714? 584 In base 10, what is -3 - -31392? 31389 In base 2, what is -100 + 1100101000011? 1100100111111 In base 11, what is 5961a + 0? 5961a In base 2, what is 101010000001 + -100? 101001111101 In base 3, what is 1210010211202 + -10? 1210010211122 In base 4, what is -1221 - 33023? -100310 In base 4, what is 1 - -12113203? 12113210 In base 15, what is -63 + 928? 8b5 In base 5, what is 3 + -133032? -133024 In base 7, what is -50434 + 155? -50246 In base 7, what is 14452 - 1? 14451 In base 12, what is -120b - -5? -1206 In base 2, what is 10010111010001 - 111? 10010111001010 In base 7, what is 3 - 464052? -464046 In base 9, what is 4 - -5244? 5248 In base 2, what is -10110111001110101011010 - 11? -10110111001110101011101 In base 6, what is 1 + 300535? 300540 In base 5, what is 1 + -240121? -240120 In base 8, what is -4 + 17343? 17337 In base 8, what is 1 + 122676? 122677 In base 15, what is 26 + 6ed? 724 In base 11, what is 5 + 11441? 11446 In base 2, what is -1001 - 10100000100010? -10100000101011 In base 14, what is 92 - 2107? -2055 In base 14, what is -25 + 22d8? 22b3 In base 6, what is -2 + 4352314? 4352312 In base 12, what is -130 + 272? 142 In base 6, what is -1531 - 2? -1533 In base 16, what is -b - -14a3? 1498 In base 4, what is 23001 + -2000000? -1310333 In base 6, what is 2331113 + -10? 2331103 In base 2, what is 10011001101 - 11101? 10010110000 In base 3, what is 2 - 122222102122? -122222102120 In base 7, what is 6 - -40451? 40460 In base 10, what is 6 - 2520? -2514 In base 16, what is -3 + 51bf2? 51bef In base 5, what is 2332413 + -4? 2332404 In base 9, what is 576 - 2424? -1737 In base 12, what is -6229 - 70? -6299 In base 2, what is -1001001 - 111000111100? -111010000101 In base 15, what is -16 - -41? 2a In base 7, what is 4 - 64325? -64321 In base 5, what is 132 - -43143? 43330 In base 7, what is 2 - -332625? 332630 In base 9, what is -13058 - -17? -13041 In base 2, what is 1001110111001001 - -1111? 1001110111011000 In base 6, what is 2553 + -45524? -42531 In base 9, what is 5121 + 312? 5433 In base 3, what is -101121 - 211212? -1020110 In base 3, what is -120220121221 + -11? -120220122002 In base 8, what is 3540201 - 5? 3540174 In base 15, what is -6 - -93564? 9355d In base 14, what is 1d49 - -3? 1d4c In base 8, what is 120463 - 4? 120457 In base 2, what is -100100100111 - -100? -100100100011 In base 6, what is 42 - 52544? -52502 In base 16, what is 182 - -4? 186 In base 16, what is -b - 9ad97? -9ada2 In base 8, what is 455770 + -3? 455765 In base 9, what is -214 - -722? 507 In base 13, what is -b + 6b6? 6a8 In base 9, what is -10 + 70727? 70717 In base 5, what is 2 - 110044331? -110044324 In base 13, what is -2112 - 27? -2139 In base 4, what is 210 + 102201111? 102201321 In base 2, what is 1 - 1010001001000? -1010001000111 In base 15, what is -109d - -17? -1086	{ "pile_set_name": "DM Mathematics" }
2f - 0f + 6f. Let p = f - m. Calculate the remainder when 5 is divided by p. 2 Suppose 294 = -4z - 2n, 0 = 4n + 2 + 2. Let a = -49 - z. What is the remainder when a is divided by 13? 11 Let s(o) = -o - 4. Let h be ((-4)/6)/(3/36). Let q be s(h). Let n = 9 + q. Calculate the remainder when 25 is divided by n. 12 Let u(z) = 6z3 + z2 - 3z + 1. Let q(l) = l*3 + 9l*2 + 12l - 12. Calculate the remainder when u(2) is divided by q(-6). 23 Let a(j) = -2j2 - 26j + 16. What is the remainder when 45 is divided by a(-13)? 13 Let h(z) = z*2 - z + 8. Calculate the remainder when 14 is divided by h(0). 6 Let u(g) = 5g - 11. Calculate the remainder when 44 is divided by u(4). 8 Suppose 57 + 64 = n. Calculate the remainder when n is divided by 31. 28 Let i = 72 - 33. What is the remainder when i is divided by 5? 4 Let o(v) = -v*2 - 26v - 24. Calculate the remainder when 1 is divided by o(-25). 0 Suppose -g = -5v + 10, 2v + 3v = -g + 10. Suppose -3k - 50 = -7x + vx, 3k - 67 = -4x. What is the remainder when 25 is divided by x? 12 Suppose 0 = 6u - 172 - 416. Calculate the remainder when u is divided by 20. 18 Suppose 3o + 229 = 4g - 142, -2g + 2o = -188. What is the remainder when g - (-2 + -2 + 4) is divided by 23? 20 What is the remainder when 61/824 is divided by 5? 3 Suppose 4 = 2x - x. What is the remainder when 7 is divided by x? 3 Let b = 1 - -1. Let d be ((-5)/2)/((-1)/b). Suppose -3z = dv + 1 - 50, -3z + 41 = v. What is the remainder when 37 is divided by z? 11 Let c(g) = -g3 - g2 - g - 9. Let j be c(0). Let z(n) = n3 + 9n*2 + n + 13. Calculate the remainder when 5 is divided by z(j). 1 Suppose -5f = -5v + 310, 5v + 263 = 9v - f. Calculate the remainder when v is divided by 14. 11 Suppose 47 = k - 4l, -3l + 141 = 3k + 2l. Calculate the remainder when k is divided by 21 - 6 - (3 + -4). 15 Let o = -13 - -18. Suppose 5m = d - 52, 4m + 112 = od - 85. Calculate the remainder when d is divided by 19. 18 Let g be (7/4 - 1)4. Let n(z) = -z2 + 2z - 3. Let s be n(g). Let x = 10 + s. Calculate the remainder when 15 is divided by x. 3 Let k(q) be the first derivative of -5q2/2 - 4q - 2. What is the remainder when k(-7) is divided by 8? 7 Calculate the remainder when -2(-5)/(20/38) is divided by 7. 5 Suppose 2x = l - 174, -4l + x = -0x - 668. Calculate the remainder when l is divided by 21. 19 Suppose -4a - 10 - 6 = 0, -2d - 5a + 274 = 0. Calculate the remainder when d is divided by 37. 36 Let d(v) = v3 + 6v2 - 9. What is the remainder when 45 is divided by d(-5)? 13 Let x(y) = y3 - 9y2 + 14y + 16. Suppose -3 - 12 = -2c - l, -c + 4l = -21. What is the remainder when x(7) is divided by c? 7 Let v be ((-98)/70)/(1/(-5)). Suppose 0 = 3b - vb + 144. Calculate the remainder when 106 is divided by b. 34 Suppose 4v = -34 + 14. Let q = 14 + v. Let i = -17 + 33. Calculate the remainder when i is divided by q. 7 What is the remainder when -3(-481)/(-26)4/(-6) is divided by 19? 18 Suppose 0 = 5k + 15, -12 = m + k + 6. Let p be 126/m - (-4)/10. Let x(d) = d*3 + 9d*2 + d - 11. Calculate the remainder when x(p) is divided by 12. 9 Calculate the remainder when 6 is divided by 10/69/5. 0 Let l = -13 - -22. Calculate the remainder when 25 is divided by l. 7 Suppose -4g = -5l + 150, 0g - 3g + 15 = 0. Suppose 5m - 31 = -2v - 5, -4v - m + 70 = 0. Calculate the remainder when l is divided by v. 16 Suppose -3q + 32 = 5s - 19, 9 = s + q. What is the remainder when 8/12 - (-136)/s is divided by 7? 5 Let j(k) = -7k + 4. Suppose 0u - u + 15 = 0. Let p = u - 6. Calculate the remainder when j(-3) is divided by p. 7 Suppose -5k + 22 = -48. What is the remainder when k is divided by 4? 2 Let z(b) = 2b2 - 6b + 6. Calculate the remainder when 14 is divided by z(3). 2 Let z(i) = -16i + 2 + i2 + 3i - 14i2 - i3 + i2. What is the remainder when 71 is divided by z(-11)? 23 Let s(i) = 3i*2 + 8i + 7. Suppose 2q + 3q + 5o - 80 = 0, 4q - o = 69. Suppose -p + 0 = -q. Calculate the remainder when p is divided by s(-3). 7 Let i(u) = -u*3 - 4u*2 - 3u + 2. Let a be i(-3). Suppose 5 = ay + 1. What is the remainder when y is divided by 2? 0 Let p be (-2)/(-2)(-5 - -4). Let b = p - -14. Calculate the remainder when b is divided by 7. 6 Suppose 0 = 2r + 2s + 2, -7 = 4r + 5s. Let c = 2 + 2. Calculate the remainder when c is divided by r. 0 Let d(y) be the third derivative of -5y4/24 - y3/6 + y2. Suppose 5j = 2t + 17, -5t + 19 = j - 6. Calculate the remainder when d(-3) is divided by t. 2 Let g = -34 - -48. Suppose 0 = 3p - k - g, -3p = 2k - 0k - 8. What is the remainder when p is divided by 2? 0 Let f(l) = 23l. Suppose -2i - 3 = -5. Let b = 23 + -15. Calculate the remainder when f(i) is divided by b. 7 Let i(y) = -y*3 - 7y*2 - 5y - 4. Suppose -3u = -5u - 6, -f + 4u = -5. Calculate the remainder when i(f) is divided by ((-16)/2)/((-2)/4). 15 Let y = 7 + 16. Let b = y - 13. Calculate the remainder when 38 is divided by b. 8 Suppose 108 = -5q + 4k - 119, -3k = -q - 41. Let w = 79 + q. Calculate the remainder when w is divided by 2 - 7/(7/(-15)). 15 Let r be 4410/287. Suppose 3t - r = 91. What is the remainder when t is divided by 17? 16 Let l(m) = -m2 - 11m + 7. Let b(y) = -2y2 - 22y + 14. Let q(a) = -2b(a) + 5l(a). What is the remainder when q(-10) is divided by 11? 6 Let j(h) = -12h3 - h2 - h - 1. Suppose -3a + 7a = -4k + 16, -3a = k - 4. Suppose w = -kw + 30. Calculate the remainder when j(-1) is divided by w. 5 Let q = 21 + -23. Let w(r) = -2r + 2. What is the remainder when 11 is divided by w(q)? 5 Suppose h + 3 = -2. Let s(z) = z2 + 4z + 4. What is the remainder when 25 is divided by s(h)? 7 Suppose 3k - k - 3a = 190, -5a = 4k - 358. Suppose 0l - 4l + k = 0. Calculate the remainder when l is divided by (-12)/((1 - 0)-1). 11 Let v = 34 - 30. Calculate the remainder when 19 is divided by v. 3 Let c be 309/12 - 2/(-8). Let h = 36 - c. Suppose 2t + 9 = -5j - 8, -t = 4j + 16. What is the remainder when h is divided by t? 2 Suppose -4y + 6 = -6. Suppose 4 = yc - 5. Suppose -j + 5u = 2j - 6, -3j - 3u = -30. Calculate the remainder when j is divided by c. 1 Suppose 9z - 5z = 4. Calculate the remainder when 3 is divided by z. 0 Suppose i = -0i - 3l - 4, 4 = i + l. Calculate the remainder when 29 is divided by i. 5 Let f = -8 - -13. Suppose -fd + 10 = -15. Suppose 0 = dx - 3l + 2, -2x - 2l + 3l = 0. What is the remainder when 3 is divided by x? 1 Let t = -47 + 1. Calculate the remainder when ((-14)/(-4) + -4)t is divided by 5. 3 Let m = 49 - 19. What is the remainder when m is divided by 16? 14 Suppose 4q + 24 = -2i + 4i, -3i + 46 = -q. Let f(y) = -y - 1. Let c be f(11). What is the remainder when 121/4 + 3/c is divided by i? 14 Let c(x) = -x3 + 2x*2 + 3x - 3. Suppose b - 2 = -0b. Let m = -18 - -21. What is the remainder when m is divided by c(b)? 0 Suppose 22 = p - 21. Suppose -105 = 6w - 13w. Calculate the remainder when p is divided by w. 13 Let v(g) be the first derivative of -67g4/4 + g2/2 + 8. Calculate the remainder when v(-1) is divided by 17. 15 Let d = 19 - 3. Calculate the remainder when 29 is divided by d. 13 Suppose 2y - 10 = -0y. Suppose c - 4g + 9 = 0, -3g - 70 = -yc - 6g. Let q = 34 - 2. Calculate the remainder when q is divided by c. 10 Let w be (-209)/9 - 2/(-9). Let s = w + 43. Let q = s + 0. Calculate the remainder when q is divided by 11. 9 Suppose 0 = -6u + 2u - r + 10, 5r = 5u. Suppose 5w = c + 14, 2c + 2c - 54 = -uw. What is the remainder when 20 is divided by c? 9 Let y be (6-1)/(9/6). Let x(g) = -9g + 1. Let u(n) = 10n - 1. Let q(w) = 3u(w) + 4x(w). Calculate the remainder when q(y) is divided by 13. 12 Suppose -4l + 52 = -2o, 0 = 3l - 6l - 4o + 50. Calculate the remainder when 27 is divided by l. 13 Let q = 4 + 0. What is the remainder when 11 is divided by q? 3 Let b be (-1)/(15/(-6) - -2). Calculate the remainder when b/(-6) + 64/12 is divided by 2. 1 Suppose -11n + 15n = 32. What is the remainder when 35 is divided by n? 3 Suppose -5w + 4s + 13 = -12, 0 = 5w + 3s - 25. Suppose 0 = -3c + wc - 6. What is the remainder when	{ "pile_set_name": "DM Mathematics" }
Rearrange (-3d2 + 3d*2 + 9d*2)(7 - 8 + 21 + 3d) to the form cd*3 + p + td*2 + ad and give t. 180 Express -116 + 54 + 1 + 17b + 13b as z + tb and give z. -61 Express 7s*3 - 7s*3 + 1731s*2 - 2s + 1201s2 + 8s*3 - 4s*3 as us*2 + vs + cs3 + g and give u. 2932 Express (-8m + 14m + 121m)(-m2 - m2 + 3m*2) - 10m*2 + 14m*2 + 26m*3 - 2m*2 as rm + k + zm3 + xm*2 and give x. 2 Express 7923d + 3 + 7915d - 15611d in the form o + qd and give o. 3 Express (-198d - 152d - 190d - 107d - 19)(-d3 - d3 - d*3) as td*4 + fd*3 + kd*2 + gd + m and give t. 1941 Rearrange -18n - 831n - 3n2 + 16 - 16 to vn*2 + w + an and give w. 0 Express (13k - 5k + 6k)(1353k3 + 2136k*3 + 389k*3 + 5148k*3) in the form zk*3 + o + pk + xk2 + mk*4 and give m. 126364 Express (-4t3 - t3 - t*3)(-430 - 413 - 704) + t*3 - 5t*3 + 2t*3 in the form vt + ft3 + j + zt*2 and give j. 0 Express -1 + 2n + 1 + (n - n + 2n)(3 - 2 - 2) + 2808n - 1418n - 1414n in the form ln + o and give o. 0 Express -20g - g + 0g - 499 + 19g - 4g as v + kg and give k. -6 Express 88n*3 + 235n*3 + 56n - 46n - 36n in the form tn3 + in*2 + gn + s and give t. 323 Express 90678 - 430y - 9y - 67y - 90675 as vy + x and give x. 3 Express (12h + 0h - 4h)(131 + 103 - 492)(2h2 - h3 - 2h2) as uh + th2 + ph*3 + i + wh4 and give w. 2064 Rearrange q2 + 1359q3 + 1225q*3 + 1650q - 2586q3 to vq*2 + pq + k + fq3 and give v. 1 Rearrange 5916p - 6972p - 15 - 7091p + 15 to r + qp and give q. -8147 Rearrange (-q + 2q*2 + q)((2q + 0q + 0q)(2 + 0 - 3) + 0 - q - 1 + 4 - 2q + 14q + 8q - 1) to the form b + nq + tq2 + mq*3 and give t. 4 Rearrange (2 + 1 - 4)(-g + 4 - 4)(0g + 0g + g)(-10g - 539g - 383g) to the form kg + y + ag2 + ng*3 and give n. -932 Express -19931651x + 2295x2 + 19931651x in the form nx + w + gx*2 and give g. 2295 Express (1 - 4 + 4)(5f + 0f - 2f) + (12f - 25f - 37f)(8 - 1 + 26) as rf + d and give d. 0 Express (1807 + 202k - 1807)(-13 + 5k + 13)(0 + 2 - 1)(-6 + 1 + 3) as ck + s + xk2 and give x. -2020 Rearrange -705583z2 - z3 + 1 + 701z4 - 222z*4 + 705583z*2 to vz*3 + sz*4 + kz*2 + a + iz and give v. -1 Rearrange n*4 + 5n*4 + 1 + 2n - 23n4 - 86n*2 + 85n*2 + 6n*4 - 62n*3 to the form dn*3 + k + zn*4 + sn*2 + jn and give d. -62 Express -f + 3f - 3f + (-2f + 5f + 0f)(-2 + 1 + 0)(-29 - 24 - 30)(2 + 1 - 2) as a + cf and give c. 248 Rearrange (13850 - 13850 - 65n*3)(n + 30n - 3n) to the form on + a + hn*4 + dn*2 + xn*3 and give o. 0 Rearrange -47 - 4u*2 + u + 835u*3 - 83 - 838u*3 + 96 to the form wu*2 + ru*3 + y + gu and give g. 1 Rearrange 1215820 - 1215799 - 4v + 7v*2 - 5v*2 to the form rv + hv2 + b and give h. 2 Express (1199 - 1812 + 934)(-2 - 3 + 7d - 2 - 10d) in the form l + ud and give l. -2247 Express (-6s - 2s + 7s + 3s3)(18s - 238s + 53s) in the form fs*3 + v + bs*4 + hs + ys2 and give y. 167 Express (-2 + 2 - 1)(-33 - 37 + 19)(3 - 2 + 2)(-5k3 - 2k*3 - 5k*3) in the form dk*3 + f + ak*2 + pk and give d. -1836 Rearrange 20 + 64 + 35 + 8n + 59n + 34n + (4 + 1 - 3)(-n - 3n + 2n) to l + pn and give l. 119 Rearrange (-5 - 22 + 13)(2l2 - 3l*4 - 2l*2) + l - 177l*4 - 3 - 8 + 174l*4 - 2l*2 to ql*2 + s + yl + jl3 + il*4 and give q. -2 Express -1 + 63w + 2 + 56w - 140w + 26w - 141w*3 as m + pw + gw2 + hw*3 and give h. -141 Express 3i*2 - 109i - i2 + i4 + 106i - 8i*2 + 5i*2 - 509 in the form oi + ki3 + f + yi*2 + zi*4 and give f. -509 Rearrange -118g - 394g + 122g to o + dg and give d. -390 Rearrange -378571l*2 - 1 - 3l*4 + 4 - 3l*3 + 378573l*2 - 4 to il*4 + ul*3 + vl*2 + ql + x and give i. -3 Rearrange (-7w - 15w + 20w)(-1 - w + 1 + (1 - 4 + 1)(-w + w - w) + 5w - 2w - w) to the form r + nw*2 + jw and give n. -6 Rearrange -1184t + 4046 + 4047 - 8092 + 103t to z + lt and give z. 1 Express -29x*2 + 2593x*3 - 2589x*3 + 5 + 87x*2 - 2x in the form cx2 + hx + yx3 + w and give y. 4 Express 1300u - 3383u - 573u in the form su + w and give s. -2656 Express 28w + 226w4 - 8w - 42w4 - 5w*3 + 3w*3 - 116w*4 - 2w*2 - 2 in the form fw*3 + m + cw + ow4 + kw*2 and give o. 68 Express -75j*2 + 302j*2 + 108j*2 - j - 1 + 65j*2 as ij*2 + hj + l and give l. -1 Rearrange -664j4 - j3 - 3j - 5 + 659j4 + 9j to the form rj3 + ij*4 + a + gj + uj2 and give a. -5 Express -12 + 10 + 660w*3 - 636w*3 + (w - 3w + 3w)(0w2 - 3w*2 + 4w*2) in the form yw*2 + jw + d + bw3 and give b. 25 Express (31 - 23 + 24)(1 + 4 - 3)(-436p - 32041 + 32041) as kp + h and give k. -27904 Express -8 + 8 + 27538f + 7659f as h + qf and give q. 35197 Express 12w + 51w + 30w + (-1 - 4 + 6)(2w - w + 0w) as rw + g and give r. 94 Rearrange -6y*2 + 0y*2 + 8y*2 - 6y + 6y - 2247 + 2247 + 58y*2 + (-y - y + 3y)(2y + 0y - y) to the form r + jy*2 + ay and give j. 61 Rearrange 1752k + 449k + 243k to x + gk and give x. 0 Rearrange (5 + 2 + 0)(3i + 2 - 2) - 2 + 2 - 2i + (3 - 3 - 2i)(-337 + 162 - 133) to a + oi and give o. 635 Rearrange 7v + 1013v*2 - 337v2 - v3 - 4 - 336v2 - 1 - 342v*2 to c + nv*2 + zv + mv3 and give z. 7 Express 33q - 103681q2 + 103678q*2 + 3q*3 + 2q*3 as mq*2 + oq*3 + cq + x and give c. 33 Express -2 + 174s2 + 0 - 30s*2 + 232s*2 in the form j + ps*2 + us and give p. 376 Rearrange 867a3 - 431a*3 - 438a3 + a2 - 16a4 - 14a to ga2 + ha*4 + ia + xa3 + b and give g. 1 Rearrange 202x - 7x3 - 199x + 24 - 19 - 6x2 to the form ox + rx3 + l + dx*2 and give l. 5 Express -106645i*4 - 134i*2 + 2 - 10i*2 - 4 - 2i*3 + 106647i*4 - 2i in the form ni2 + hi*4 + x + oi*3 + ri and give x. -2 Express (-2x2 + 4x2 - x2)(-1112x*2 + 14200x - 14200x) + 7x*4 - 4x4 - x4 in the form kx2 + wx + vx4 + dx*3 + m and give v. -1110 Express (4 - 3 - 4)(-g - 3 + 3) - 72 + 27 + 6 + 34g + 15g in the form cg + k and give k. -39 Express (-222 - 4p + 86 + 38)(3p - 4p + 4p) as sp + f + cp*2 and give c. -12 Rearrange (617j - 38j3 - 617j)((2 + 1 - 1)(-1 + 0 + 0) + 2 - 1 + 0 - 4 - 9 + 2) to the form uj3 + bj*2 + dj + m and give u. 456 Express (-2o2 + o - 5 + 5)(4o - 4o + 3o)(-24100 - 1155o + 24100) in the form ao*3 + j + io*4 + ro*2 + qo and give i. 6930 Express 1 + 12b + 4136b*2 - 2066b*2 - 2029b*2 in the form wb + r + db2 and give w. 12 Express -5134m + 29363 - 29363 in the form w + vm and give v. -5134 Express 59 + 9y + 16y + 39y + 18y in the form m + xy and give m. 59 Rearrange (2v2 + 0 - 3v*2 + 0)(0 + 8v + 0)(-772v - 586v + 393v) to the form ov + fv4 + pv*3 + uv*2 + x and give f. 7720 Rearrange 939k + k*2 + 903k + 2 + k*4 - 1567k + 2k3 - 6 to x + qk*2 + yk + ck3 + rk*4 and give x. -4 Express 249k*2 + 93k*2 + 43874 - 43887 as t + pk + sk2 and give s. 342 Rearrange (4x*3 + 409x*2 - 2x*3 - 206x*2)(-6 + 2 + 0 + (-1 - 3 + 5)(-3 + 0 + 5)) to ox*3 + h + zx*2 + qx and give z. -406 Express (-21 + 43 + 71)(120p + 61 + 68 - 129) as sp + z and give s. 11160 Rearrange -132 + 489 + 3h*3 + 401 - h + 3h + 29 to the form nh3 + bh*2 + i + th and give b. 0 Express 11459y2 + 11479y*2 - 22940y*2 + 18627 as w + gy*2 + uy and give w. 18627 Express 2u4 - 22735u*3 + 0u*4 + 22738u*3 + 20u*2 + 28u*2 - u as ku*4 + ru + t + zu2 + yu*3 and give k. 2 Express (0y + 0y + y)((6 + 0 - 4)(-1 - 3 + 3) + 5432 + 3989 - 402) as c + jy and give j. 9017 Express j*4 - 2j*3 - 480193 + 14j*2 + 480190 + 4j*2 + 7j as qj2 + ij + dj3 + uj*4 + x and give q. 18 Rearrange 3306x - 3274x - 94 + 2x*3 + 9x*2 - 8x*2 to the form kx*3 + o + mx + yx2 and give o. -94 Express 385859h*2 - 385859h*2 + 5531h*3 - 3h*3 + 3h3 - h3 + (0 + 0 - h*2)(2h - h + 0h) in the form b + j*	{ "pile_set_name": "DM Mathematics" }
5d + 5. Let a(u) = -2f(u) - 5z(u). Let h(i) = -16i. Calculate a(h(w)). 256w2 Let p(b) = b. Let v(m) = 11m - 25m + 4m + 12m. Determine p(v(u)). 2u Let k(i) = -52i. Let u(n) = 2n - 2n + 2n. Determine u(k(t)). -104t Let s(f) = 5f. Let i(a) = 9a. Let m(g) = -4g. Let c(q) = -6i(q) - 14m(q). Give c(s(w)). 10w Let f(z) = -3z - 8. Let x(b) = -b - 3. Let k(p) = -3f(p) + 8x(p). Let v(j) be the second derivative of 3j3 - 5j - 3. Calculate k(v(n)). 18n Let m(t) = 2t - 6. Let c(h) = -18h. Give m(c(g)). -36g - 6 Let v(a) = a*2. Let k = -3 + 7. Let y(f) = -kf - 3f + 4f - 3f. Determine y(v(w)). -6w*2 Let r(f) = -3f. Let b(o) be the third derivative of -5o4/24 + 3o*2. Calculate b(r(n)). 15n Let l(a) = -14a2 - 6a. Let n(u) = -7u2. Determine l(n(h)). -686h*4 + 42h*2 Let u(t) = -2t - 92 + 53 - 3t + 52. Let k(n) = 2n*2. Determine u(k(h)). -10h2 + 13 Let i(n) = n2. Let l(k) = 10k + 8. Let u(b) = 5b + 4. Let q(v) = -3l(v) + 5u(v). What is i(q(m))? 25m2 + 40m + 16 Let d(m) = -m - 8. Let t(n) be the third derivative of -n*5/30 + 22n*2. Calculate d(t(s)). 2s*2 - 8 Let d(n) = -3n*2. Let q(k) = -3k*2 + 40. Calculate q(d(f)). -27f*4 + 40 Let a(m) = -27m + 15. Let c(d) = 4d - 2. Let y(b) = -2a(b) - 15c(b). Let z(x) = 2x*2. Determine y(z(l)). -12l*2 Let f(t) = 20t. Let n(v) = -v. Let a(h) = -f(h) - 24n(h). Let z(y) = y2. Calculate z(a(x)). 16x*2 Let o(c) = -26c + 1. Let v(n) = -2n2 + 30. Determine o(v(t)). 52t*2 - 779 Let m(y) = -2y*2. Let f(r) = 0r + 0r - 41r*2 + 43r*2. Give m(f(a)). -8a*4 Let w(g) = -5g + 6. Let m = 11 - 5. Let u(y) = -y + 1. Let r(x) = mu(x) - w(x). Let h(f) = -6f. What is r(h(b))? 6b Let z(n) be the third derivative of -n4/24 - 14n*2. Let l(w) = 6w*2 - 5. Let v(p) = -7p*2 + 6. Let f(o) = 6l(o) + 5v(o). Determine z(f(g)). -g2 Let z(k) = 7k*2. Let q(c) = -12c*2 - 20. What is q(z(v))? -588v*4 - 20 Suppose -3t = 4g - 0t - 40, 29 = 3g + 2t. Let j(n) = -7 + g + n. Let y(f) = 2f2. Determine j(y(r)). 2r*2 Let l(p) = 10p. Let v(i) = 21i + 2. Determine v(l(w)). 210w + 2 Let s(n) = 42n2. Let b(k) = -138k. Calculate s(b(q)). 799848q2 Let i(g) = -2g*2. Let c be 2/((-9)/(-6) + -1). Let t(q) = c - 4 + 36q*2 - 39q*2. Calculate i(t(j)). -18j*4 Let l(a) be the first derivative of 2a*3/3 - 1. Let j(w) = -18w + 68w - 25w - 24w. Determine j(l(d)). 2d*2 Let z(h) be the second derivative of 0h*3 - 1/4h*4 + 2h + 0h2 + 0. Let c(x) = 4x. Give c(z(s)). -12s2 Let o(u) = 2u2. Let p(d) = d3 + 3d2 - 1. Let j be p(-2). Let f(n) be the first derivative of j + 1/2n*2 + 0n. Determine o(f(w)). 2w2 Let x(s) = 94s*2. Let j(f) = -4f. Determine j(x(n)). -376n2 Let r(v) = -4v2. Let a(o) = o2. Let f be a(2). Let z = 13 + -9. Let b(l) = -z - 2l + f. Give b(r(w)). 8w*2 Let l(w) = -2w. Let s(f) be the first derivative of -f*4/6 - 4f - 3. Let j(z) be the first derivative of s(z). Determine j(l(r)). -8r2 Let k(o) = o + 7. Let l be k(-5). Let a(z) = -2z*2 + 8z*l - 4z*2. Let n(x) = -6x. Determine n(a(c)). -12c2 Let v(w) = -6w*2. Suppose 0 = 5d - 112 + 42. Let g(x) = -14x + dx + 3x2. What is g(v(l))? 108l*4 Let u(l) = 5l. Let i(o) = -14o. Suppose 24n = 21n - 18. Let m(w) = ni(w) - 17u(w). Let d(r) = r. What is m(d(f))? -f Let z(h) = 2h. Let m(g) be the first derivative of -g*3/3 - 35. Give m(z(f)). -4f2 Let n(q) = -q2. Let k = 1 + 1. Let o = 4 - k. Let x(t) = -t - 4t + ot. Calculate x(n(h)). 3h2 Let y(n) = -23n. Let c(z) = 517z2. Give c(y(t)). 273493t*2 Let u(c) = -c. Let y(n) = -2n - 265. What is u(y(z))? 2z + 265 Let h(x) = 4x*2. Let t(o) = 5o + 3. Let n(k) = 12k - 13k - 4 + 2 + 1. Let z(l) = 3n(l) + t(l). Determine z(h(j)). 8j*2 Let k(s) = 3s*2. Let w(m) = 4m. Let f(d) = -2d2 + d + 4. Let q be f(3). Let g(j) = 7j. Let x(r) = qw(r) + 6g(r). Give k(x(l)). 12l2 Let x(l) = 12 - 37l*2 + 63l*2 - 12. Let b(p) = -2p. Give x(b(w)). 104w2 Let u(j) = -j2. Let s(v) = 9v + 81. Let o be s(-9). Let p(f) be the second derivative of of2 + 0 - 5/6f*3 - f. Calculate p(u(m)). 5m2 Let b(f) = f2 + 3f - 5. Let o(t) = t - 1. Let n(p) = b(p) - 3o(p). Let i(l) be the first derivative of n(l). Let k(j) = -3j2. Determine i(k(x)). -6x*2 Let y(d) = -6d*2 - 14 + 14. Let x(b) be the second derivative of 0 + 0b*2 - 1/3b*3 + 3b. Determine x(y(h)). 12h2 Let u(r) be the second derivative of r3/3 - 47r. Let m(n) = -n. Give m(u(x)). -2x Let a(s) be the second derivative of s4/6 + 5s. Let o(n) be the first derivative of 0n + 0n*2 - 2/3n*3 - 1. Give o(a(l)). -8l*4 Let t(s) = -3s. Let o(v) be the first derivative of -v*2 - 6. Give t(o(n)). 6n Let l(a) = 2a2 - a2 + 4a*2. Let m(q) = q + 2q - 5q + q. Calculate l(m(p)). 5p*2 Let b(o) = 168o*2. Let t(f) = -26f*2. Give t(b(j)). -733824j*4 Let a(p) be the first derivative of -2p*3 + 2p3 + p3 + 5. Let u(y) = 5y. Give a(u(x)). 75x*2 Suppose 4j + 5 - 13 = -2x, -5x + 3j + 20 = 0. Let n(p) = p + 4. Let s(f) = -f - 5. Let b(a) = xs(a) + 5n(a). Let l(k) = 5k. What is l(b(r))? 5r Let f(w) = -2w. Let x(j) = 27j2 + 15j - 30. Let c(d) = -7d2 - 4d + 8. Let l(y) = -15c(y) - 4x(y). Determine f(l(s)). 6s2 Let y(j) = 144j + 1. Let n(q) = 2q2. Determine y(n(p)). 288p*2 + 1 Let f(y) = -8y. Let b(i) = 13i - 8i - 5i - i2. What is f(b(n))? 8n*2 Let d(g) = -2g*2. Let u(c) = 2c*2 - 5c + 5. Let k(f) = -3f2 + 7f - 7. Let m(y) = 5k(y) + 7u(y). Determine m(d(b)). -4b4 Let a(v) be the first derivative of 2v*3/3 - 6. Let u(i) = -16i*2. What is u(a(m))? -64m*4 Let c(o) = -4o. Let g(s) = -3s + 2s + 4s + 2s. What is c(g(d))? -20d Let k(w) = -2w2 + 14613 - 14613. Let v(a) be the second derivative of -a3/3 + a. What is v(k(y))? 4y2 Let a(f) = 19f*2. Let z(b) = -24b*2. Give a(z(m)). 10944m*4 Let q(x) = -3 + 3x + 3. Let g(p) = -24p2 + 14p*2 + 8p*2. Give q(g(i)). -6i*2 Let n(d) = 3d. Let t(r) = -1088r2. What is t(n(s))? -9792s*2 Let x(c) be the first derivative of -20c3/3 + 1. Let w(z) be the first derivative of z3/3 + 58. Calculate w(x(i)). 400i4 Let k(j) be the third derivative of 5j*4/24 + 4j*2. Let i(u) = u. Determine k(i(y)). 5y Let t(r) = 11 + r - 2r - 11. Let j(v) = 3v*2. Calculate j(t(s)). 3s*2 Let x(s) = -23s2. Let k(t) be the third derivative of -t4/24 - 11t2. Calculate x(k(h)). -23h*2 Let u(h) = -9h. Suppose 0 = 4b, -4g + 3b = 4 - 36. Let v(i) = 8 - g + 2i. Calculate u(v(a)). -18a Let t(b) = -79b + 5. Let d(c) = -118c + 8. Let f(m) = 5d(m) - 8t(m). Let o(y) = -y. What is o(f(a))? -42a Let i(y) = -2y2. Let u be 1/(1 - (-1)/(-2)). Let r(t) = 7 - 15 - 6t*u + 8. Determine r(i(s)). -24s*4 Let g(t) = 6t2 - 2. Let j(s) = s2 - 1. Let q(r) = -g(r) + 2j(r). Let z(y) = 4y*2. Calculate z(q(c)). 64c*4 Let m(r) = -4r*2 - 2r*2 + 4r*2. Let i(k) = -4k - k + 0k. Calculate i(m(d)). 10d*2 Let m(c) = c + 3c - 2c. Let n(z) = 78 - 78 + 2z. Give m(n(v)). 4v Let m(r) = 0r + r + 2r. Let d(s) = -2s*2 + 3. Let b(j) = -3j*2 + 4. Let o(i) = -3b(i) + 4d(i). Determine o(m(y)). 9y2 Let k(x) = x2 + 25. Let q(c) = -c2. What is k(q(p))? p4 + 25 Let z(x) = -x. Let r be (-2 + 3)(0 - 0). Let m(u) = 0u - 2u2 + ru + u2. Determine z(m(c)). c2 Let m(t) = 2t2. Let d(w) = -w + 393. Give d(m(o)). -2o*2 + 393 Let q(w) = -8w - 1. Let o(v) = 46v. What is o(q(s))? -368s - 46 Let j(p) = -2p - 4. Let l be j(-3). Let u(i) = 3i*2 + li*2 - 4i*2. Let m(h) = -2h*2 + 6h*2 - 3h2. Calculate u(m(z)). z4 Suppose -4j - 8 + 32 = 0. Let t(a) = 4a + 0a - 7a + ja. Let h(c) = -2c*2. What is h(t(x))? -18x*2 Let q(z) = -406z2. Let v(j) = -j2. Calculate q(v(x)). -406x4 Let o(p) be the second derivative of p4/2 - 215p. Let s(j) = 1 - 1 - j. Determine o(s(t)). 6t2 Let j(w) be the second derivative of w3/6 + 2w. Let q(a) = -3a2 + 3a2 + a2. What is j(q(i))? i*2 Let x(m) = -2m. Let l(h) be the second derivative of -17h4/12 + 24h. What is l(x(b))? -68b*2 Let i(f) be the first der	{ "pile_set_name": "DM Mathematics" }
12o = 1027 for o. -79 Solve 1073u - 36404 = -30u + 7716 for u. 40 Solve -1227p - 6758 = -134p - 20967 for p. 13 Solve 83w + 933 + 1308 = 0 for w. -27 Solve 879w + 883w = -860w + 2590w - 2368 for w. -74 Solve 4g + 102g = -41g - 2205 for g. -15 Solve 0 = -147s - 27313 + 33193 for s. 40 Solve -14293 + 27778 = 5160k - 12483 - 41112 for k. 13 Solve -253l - 5229 - 1148 = -83l + 8073 for l. -85 Solve -109869p + 109802p + 3149 = 0 for p. 47 Solve -98x - 3309 - 854 = 2207 for x. -65 Solve 108 = 280243t - 280246t for t. -36 Solve -545y - 3863 = -836y + 6031 for y. 34 Solve 147m + 2892 + 342 = 0 for m. -22 Solve -794i + 35 - 53230 = 758i + 15093 for i. -44 Solve -51p + 296p - 105p = -8303 - 2757 for p. -79 Solve 5131v + 2005v = -306848 for v. -43 Solve 69p - 22p = -73p + 9360 for p. 78 Solve -1686i = i - 107968 for i. 64 Solve 12625 = 157556514v - 157556413v for v. 125 Solve -42y - 17y + 5624 = 79y + 14y for y. 37 Solve 488t + 15702 + 11358 = 316t - 488t for t. -41 Solve -844 = 284h - 221h - 1296 - 3517 for h. 63 Solve 38i + 70i - 1254 = 70i for i. 33 Solve 8002 = -295k - 4978 for k. -44 Solve -7516 = 182u + 70u - 2416 + 6240 for u. -45 Solve 92832 = -13047b - 58325 + 35434 - 1700 for b. -9 Solve 3241u - 2733u = 10668 for u. 21 Solve -6993 + 1108 = -107z for z. 55 Solve -270w - 29780 = -585w - 7100 for w. 72 Solve 76o - 8079 = -9751 for o. -22 Solve 2372w + 33747 - 7655 = 0 for w. -11 Solve -37b = 126b - 2220 + 8251 for b. -37 Solve 645h - 1862h = 908h + 34000 for h. -16 Solve -24w - 54w + 1922 = 26w - 73w for w. 62 Solve 0 = 6375s + 75440 - 60335 - 73046 - 95059 for s. 24 Solve -6613a = -2787a + 310953 + 21909 for a. -87 Solve 50m - 67m + 111m - m = 1674 for m. 18 Solve 0 = -80i - 389i - 3616 + 18624 for i. 32 Solve 5067k + 2727k - 1838k + 5815k = 317817 for k. 27 Solve 689f - 68908 = -809f for f. 46 Solve 88f - 252f = 636f + 48800 for f. -61 Solve 7r - 175r = -8r - 3112 - 4568 for r. 48 Solve 0 = -1906k + 3550k + 9598 - 1378 for k. -5 Solve -13590 = -6y - 13440 for y. 25 Solve 224b + 277b + 24894 = 40b for b. -54 Solve 10368r + 10364r - 20682r + 367 + 683 = 0 for r. -21 Solve 63h - 111h + 13253 = 359h - 11574 for h. 61 Solve 285c - 4195 - 10910 = 0 for c. 53 Solve -798l - 11416 - 4476 = 866 for l. -21 Solve 7019f + 348f + 233144 + 363583 = 0 for f. -81 Solve -967y - 22618 - 16062 = 0 for y. -40 Solve 1504c - 23174 = 430c - 3265c - 365955 for c. -79 Solve -105b + 2591 - 947 + 3637 = 31 for b. 50 Solve -165k + 672k + 5555 = 204k + 202k for k. -55 Solve -6700 - 44193 + 221934 + 104784 = 5015p for p. 55 Solve -1349j + 2064j = 25025 for j. 35 Solve 118v - 225 = 11v - 118v for v. 1 Solve -921l + 57l - 606l = -135240 for l. 92 Solve -11064 = -1515c - 36819 for c. -17 Solve 1716 = -512n - 4428 for n. -12 Solve -70u + 534u = -153u - 26579 - 27100 for u. -87 Solve -3672 = 42074h - 42125h for h. 72 Solve -1163 - 31 = -67k + 1938 - 385 for k. 41 Solve -255u - 3302 - 13 = 0 for u. -13 Solve 4519p - 4375p = 14400 for p. 100 Solve 13498 + 24528 = -878o + 8035 - 739 for o. -35 Solve 408h - 92h + 32246 = -385h for h. -46 Solve 74x + 6552 = 229x + 989 - 7457 for x. 84 Solve -5685 + 18830 = 829r - 4575 - 17098 for r. 42 Solve 2188 + 6748 = -867r - 4936 for r. -16 Solve 0 = -2889y + 3371y - 53502 for y. 111 Solve -164i - 375i + 63600 = -152i + 673i for i. 60 Solve 0 = 4462f - 3240f + 43992 for f. -36 Solve 0 = -2790z + 2773z + 391 for z. 23 Solve -2137 + 2459 = -728q + 670q + 6992 for q. 115 Solve 1242149d - 1240575d + 179436 = 0 for d. -114 Solve -131p - 39p - 94p = 5313 - 825 for p. -17 Solve 238i - 150i + 8598 = -236i - 3066 for i. -36 Solve 7938c + 200581 - 127473 + 176031 = -195389 for c. -56 Solve 1496 - 408 = 17g for g. 64 Solve 1144h + 1171h - 21 = 2290h + 479 for h. 20 Solve 24m + 294m = 1073 + 7195 for m. 26 Solve 85956 - 342206 = 5125x for x. -50 Solve -662p + 653p + 468 = 0 for p. 52 Solve 693r + 6536 + 19072 = 3023 - 7907 for r. -44 Solve -724z = 6459z - 22650 + 260890 + 49080 for z. -40 Solve -385u + 1091u - 9394 = 552u for u. 61 Solve -86625 - 126426 = -5195b - 26031 for b. 36 Solve 759696 = 3403t - 10851t for t. -102 Solve 0 = 101k - 178k + 20k - 855 for k. -15 Solve -6717 + 7342 = -125d for d. -5 Solve -810v - 8314 + 4237 = 6453 for v. -13 Solve 3358l = -1413l + 466l - 219555 for l. -51 Solve 53n = 5837438 - 5836802 for n. 12 Solve -17762b - 188 - 342 = -17772b for b. 53 Solve 164l - 18996 = 9l - 20081 for l. -7 Solve -99h + 450h + 412h + 18312 = 0 for h. -24 Solve -2017k - 698k + 7136 = 123881 for k. -43 Solve 0 = -8102b - 3200b - 11302 for b. -1 Solve 0 = -776l - 189l + 2895 for l. 3 Solve 1919 + 5969 = -272v for v. -29 Solve 0 = 69p - 10p + 2644 - 2349 for p. -5 Solve 202d - 116738645 + 116726323 = 0 for d. 61 Solve 39235 + 30765 = -2500y for y. -28 Solve 139h - 715350 = 7716h - 1020h + 2981h for h. -75 Solve -3628b - 33826 = 16208 + 156762 for b. -57 Solve 127p + 310p + 133p = -404p - 19480 for p. -20 Solve -1096p - 63593 = 86p - 2129 for p. -52 Solve -10820k + 10741k + 1106 = 0 for k. 14 Solve -4763s + 69056 = -2605s for s. 32 Solve -2075y + 987y - 6825 = -913y for y. -39 Solve 0 = 1193w - 1087w - 8374 for w. 79 Solve 3226y - 39438 + 120664 = 837y for y. -34 Solve -340y + 18730 = -1166y + 4013 - 19149 for y. -41 Solve -1042 + 603 = -62v + 3095 for v. 57 Solve -45j - 640 = -965 - 1475 for j. 40 Solve -7j - 204j = 399j + 31110 for j. -51 Solve -1040j + 974j + 56780 = -1288j - 1617j for j. -20 Solve 22537 + 153227 = -1222y - 590y for y. -97 Solve 0 = -33871k + 33846k - 1000 for k. -40 Solve 320u = 514u - 245u + 2091 for u. 41 Solve 854y - 2484 = 762y for y. 27 Solve -212 = -15887a + 15834a for a. 4 Solve -84l + 12l - l + 0l = 88l for l. 0 Solve 78f - 704 - 130 = 1543 - 193 for f. 28 Solve -13382h = -13681h - 16635 - 10210 - 962 for h. -93 Solve 71151a = 71720a - 51779 for a. 91 Solve 0 = -2283z - 57819 - 22086 for z. -35 Solve s - 220 = -4s + 13s - 3s for s. -44 Solve 2309d + 2504d = 5209d - 18612 for d. 47 Solve -23293 - 14404 = -1062b - 2365b for b. 11 Solve -12475 + 63993 - 18941 = -1155b - 65598 for b. -85 Solve 1270z - 4702 = 12786 + 2832 for z. 16 Solve 748 + 84 = -26l for l. -32 Solve 88422 = -9623o - 65546 for o. -16 Solve -123r - 230r = 635r + 32r - 61200 for r. 60 Solve 28d - 68d + 24d + 33d = -459 for d. -27 Solve -72r - 357r + 23923 = 80r for r. 47 Solve -260z = -286z + 810 - 186 for z. 24 Solve -573p - 79367 + 10559 = -927p - 1110p for p. 47 Solve 4960 = 841n - 1626 - 1824 for n. 10 Solve 73m - 34 + 24 = -49m + 112 for m. 1 Solve 137799 - 177649 = 797h for h. -50 Solve 2078b + 736b + 89089 + 121961 = 0 for b. -75 Solve 1105s - 4974s - 2693s + 73599 = -241377 for s. 48 Solve -4743 = -4277u + 4556u for u. -17 Solve -142i - 46633 + 52881 = 0 for i. 44 Solve 769c + 14373 + 363 = 26c - 485c for c. -12 Solve -566l + 19269 = -1107 for l. 36 Solve 88x + 1742 + 3362 = 0 for x. -58 Solve 9d + 206d + 134d = -23732 for d. -68 Solve 434n + 815352 = 5442n + 199368 for n. 123 Solve 207u + 218u + 1448 = 385 - 1487 for u. -6 Solve -52y + 788y - 107730 = -910y - 244y for y. 57 Solve 0 = -1176a + 1628a + 5424 for a. -12 Solve 5k - 56082 = 1922k - 153874 - 128414 for k. 118 Solve -497b + 751b + 71568 = -882b for b. -63 Solve 51x - 32x = -84x + 28x + 4050 for x. 54 Solve 0 = 5372d - 6424d + 83108 for d. 79 Solve 0 = 426v + 1318 - 15948 - 17684 + 2068 for v. 71 Solve 6m = 39m - 169m - 478m + 52804 for m. 86 Solve -645a - 8401 = -23514 - 11332 for a. 41 Solve 0 = 8377n + 706n - 808387 for n. 89 Solve -14328 = -1041a - 153a for a. 12 Solve 2315a - 3016 = 2373a for a. -52 Solve -158r - 350r + 17671 = -77r for r. 41 Solve -90g - 1796 = -907 - 658 - 1311 for g. 12 Solve -169w = -296w + 13335 for w. 105 Solve -92z + 855z + 243z = 34204 for z. 34 Solve 138u + 92u - 10737 = -118u + 19539 for u. 87 Solve -423c - 23257 - 7205 = -5282 + 1892 for c. -64 Solve 0 = -2687u + 2155u + 76076 for u. 143 Solve 0 = -618t + 2	{ "pile_set_name": "DM Mathematics" }
241 - 13.66. Round k to 3 dps. -0.008 Let r = -3.07 + -139.93. Let p = r - -143.0119. What is p rounded to three decimal places? 0.012 Let q = -1017.9118 + 1018. What is q rounded to 3 decimal places? 0.088 Let c = -60 - -20. Let o = -39.999912 - c. What is o rounded to five decimal places? 0.00009 Let s = -1057.7412 + 1058. What is s rounded to three dps? 0.259 Let m = -0.467846 - 0.002162. Let t = -0.47 - m. Round t to five dps. 0.00001 Let k = 27325.46 - 25555.901. Let t = k - 1791.55894. Let g = t + 22. What is g rounded to five decimal places? 0.00006 Let u(h) = -5h3 - 2h*2 - 2h - 1. Let w be u(-1). Suppose j + 8519 = a, -4j + 50532 = 5a + 7964. Suppose -wz + a = 30116. Round z to the nearest 1000. -5000 Let r = -88 + 106. Suppose ry + 39400000 = 16y. Round y to the nearest 1000000. -20000000 Let w = -470.0234 - -470. Round w to three dps. -0.023 Let v = -52.7 + 15.6. Let s = v - -40. What is s rounded to the nearest integer? 3 Let j = 4.1 - 4.09678. What is j rounded to 3 dps? 0.003 Suppose 2r = -2 + 6. Suppose 0 = w + 3o - 45443, 2w - ro = -0w + 90918. Let a = w + -91455. What is a rounded to the nearest 10000? -50000 Suppose -3x + x - 2v - 5303996 = 0, -5v - 2651990 = x. Let p = -9 - -28. Let f be (-2 - p/3)x. Round f to the nearest 1000000. 22000000 Let h(s) = 2s3 - s2 + 6s - 8. Let b be h(5). Let p = 11 - 8. Let o be (12042 - 2)(b + p). Round o to the nearest one hundred thousand. 3000000 Let p = -1.2 - -0.2. Let r = p - 0.2. Let t = 1.18 + r. What is t rounded to 1 dp? 0 Let r = 4211 - 8161. Round r to the nearest 1000. -4000 Let k = 7.8 - 7. Let h = 1620745.1999845 - 1620746. Let z = h + k. What is z rounded to 6 dps? -0.000016 Let t be 1000(-2 + -48298)/1. What is t rounded to the nearest one million? -48000000 Let y = 94.84 - 95. Let k = 7404.83974 + -7405. Let m = y - k. Round m to four decimal places. 0.0003 Suppose -4z - 2k + 1443 = 157, -3k = -9. Let m be (-20625)/2z/(-6). Round m to the nearest 100000. 600000 Suppose -2o = 19424 + 178. Let v = o + -18799. What is v rounded to the nearest 10000? -30000 Let z = -240.99132 + 241. What is z rounded to 4 dps? 0.0087 Let f = 0.02 - 0.006. Let w = -1.096 - f. Let r = -10.71 - w. What is r rounded to the nearest integer? -10 Let u = 0.05 + -0.059. Let o = u - -0.008911. Round o to 5 decimal places. -0.00009 Let v = 160.644 - 157. Let y = v - 4.1. Round y to two decimal places. -0.46 Let f = -1.04930499 - -9742.04978499. Let b = -9757 + f. Let l = b + 16. What is l rounded to four dps? 0.0005 Let q(p) be the third derivative of 62501p5/60 + p4/4 + 2p2. Let g be q(-6). Round g to the nearest one hundred thousand. 2300000 Let g = -73.000035 - -73. Round g to five decimal places. -0.00004 Let t = -0.08 - -0.014. Let u = t - -0.066175. Round u to five decimal places. 0.00018 Suppose 0 = d - 4d + 24. Let u(z) be the third derivative of -70833z4/4 - 8z3/3 - z2 - 26z. Let y be u(d). Round y to the nearest 1000000. -3000000 Let w = -128 - 7. Let h = w - -147.6. Let i = 12.718 - h. What is i rounded to two decimal places? 0.12 Suppose -4m - 4n + 12 = 0, -3n = -6n. Let l(j) = -11j3 + j2 - j - 2. Let u be l(m). Let q = 833 + u. What is q rounded to the nearest one hundred? 500 Let o = 2.21 + -2.3. Let d = o - -0.1. Round d to one dp. 0 Let r be (8712/(-32))/((-2)/(-640)-4). Round r to the nearest one thousand. 22000 Let a = -34 + 33.793. Let z = -107.793 + a. Let k = z - -120.3. Round k to zero decimal places. 12 Let n = 4.4736 - 4.57. Let v = n + 0.098. What is v rounded to three dps? 0.002 Let y(x) = -2x*2 + 17x + 1. Let o be y(8). Suppose ok - 103500 = 4k. Round k to the nearest 1000. 21000 Let f = 27.7 + -27.913. Let q = 0.21300133 + f. What is q rounded to 6 decimal places? 0.000001 Suppose 4q - 824 - 7004 = -2u, 5u - 19505 = 3q. What is u rounded to the nearest 100? 3900 Let t = 5702302828.82 + -5702303499.820000918. Let f = 671 + t. Round f to 7 decimal places. -0.0000009 Let i = 12073.5253913 - 0.1053913. Let o = i + -12073.5649919. Let b = o + 0.145. Round b to 6 dps. 0.000008 Let k(f) = -26f2 + 17f + 29. Let h be k(11). What is h rounded to the nearest 100? -2900 Let l = -49.99999633 + 50. Round l to 6 decimal places. 0.000004 Let t = -100102.169945 + 100130.17. Let f = 28 - t. Round f to 5 dps. -0.00006 Let t = -0.0456 - 6.1444. Round t to 0 dps. -6 Let v be 3/9 + 3976/24. What is v rounded to the nearest integer? 166 Let o = 1.082 - -609.918. Let f = o + -610.999999641. What is f rounded to 7 dps? 0.0000004 Suppose -m = -2 - 9. Let a be (1 - m)/(-6 - (-7557)/1260). What is a rounded to the nearest one thousand? 4000 Suppose -3292318 = -0k + 2k. Let d = -156159 - k. What is d rounded to the nearest 1000000? 1000000 Let x = 947683 + -386683. Round x to the nearest 100000. 600000 Let t be 0/((-5)/5) - -1. Let f(w) = -409999w3 - w2. Let z be f(t). Round z to the nearest one hundred thousand. -400000 Let t = 62.93 + -61. Let v = -10550 + 10548.1043. Let w = t + v. What is w rounded to 3 dps? 0.034 Let u(p) = -5p*2 - 51p - 72. Let m be u(-26). What is m rounded to the nearest one hundred? -2100 Let f = 997234 - 997243.800055. Let r = -9.8 - f. What is r rounded to five decimal places? 0.00006 Suppose -3f = -129 + 963. Let j = f - -195. What is j rounded to the nearest ten? -80 Let c(o) = -86o*3 + 5o*2 + 7. Let z be c(-5). Suppose -782 + z = -n. What is n rounded to the nearest ten thousand? -10000 Let r(q) = 43469q*2 + 2q + 2 - 7 + 8 + 2. Let c be r(7). What is c rounded to the nearest 100000? 2100000 Let q = 47 - 46.61. Let c = q - 0.394. What is c rounded to two dps? 0 Let u = 5399 + -5349.272. Let y = 49 - u. What is y rounded to one decimal place? -0.7 Let h = 892.009 - 891. What is h rounded to two dps? 1.01 Let i = 70839989 + -19239993. Suppose -3j + 5j - i = -t, -3t = -j + 25800012. Round j to the nearest one million. 26000000 Suppose -20 = -8g + 3g, 2m = 4g - 598016. What is m rounded to the nearest one hundred thousand? -300000 Let w = -10 - -9.87. What is w rounded to 2 dps? -0.13 Let d = -24253 - -15988. Let w = d - -8272.0104. Let h = 7 - w. What is h rounded to 3 decimal places? -0.01 Let w = 2.6194796 - 2.62. Round w to 5 dps. -0.00052 Let g = -0.846 - -1.833. Let q = 0.057 - g. What is q rounded to one decimal place? -0.9 Let m = -2113.99996119 + 2114. What is m rounded to 6 dps? 0.000039 Let r(o) = -33o + 23. Let n be r(-13). Suppose 4z + a - n = 0, -88 - 251 = -3z + 5a. Round z to the nearest 10. 110 Let c be (494/4)/(9/144). Let r(f) = -cf*2 + 2 + 2f + 11f - 7f. Let z be r(9). What is z rounded to the nearest one hundred thousand? -200000 Let z = 14.227 - -172.983. What is z rounded to the nearest 10? 190 Let u be (-20252304)/(-24) + (-14)/(-2). Suppose -3p + 1975412 = -7p. Let z = p + u. Round z to the nearest 100000. 400000 Suppose 3u - 7u = -16, -5u = -3d + 484. Let f be 1/(-1 + d/165). Round f to the nearest ten. 60 Let k = 604 - 603.99206. What is k rounded to 3 decimal places? 0.008 Suppose 9u + 22464 = 3u. Let t = -1316 + u. What is t rounded to the nearest 1000? -5000 Let m = 2611215 + -3984387. Let r = m - -3583172. What is r rounded to the nearest one hundred thousand? 2200000 Let z(c) = -c - 1. Let h be z(2). Let s be (-6 + 3)/(h/4). Let w(u) = 32001u - 4. Let j be w(s). What is j rounded to the nearest ten thousand? 130000 Let i = -22 - -58. Let h = -36.00016 + i. What is h rounded to 4 decimal places? -0.0002 Let i = 0.0976 - 0.097599167. Round i to seven decimal places. 0.0000008 Let j = 478 - 478.0309. Let w = -0.030597 - j. Round w to 5 dps. 0.0003 Let j = -560.6015 - -14952.8555. Let b = 14384.654069 - j. Let i = b + 7.6. Round i to 5 dps. 0.00007 Let y = -5030.957993 + 5031. Let z = y - 0.042. Round z to 6 dps. 0.000007 Let o = -58.4494 + -0.0706. Round o to 0 dps. -59 Let s = -531.002145 + 531. Round s to three dps. -0.002 Let d = -98843 + 98753.039. Let p = -224 + 134. Let b = d - p. What is b rounded to two decimal places? 0.04 Let g = -108 - -56.8. Let t = g - -59. What is t rounded to the nearest integer? 8 Let l be (-26)/(-4) + 1/(-2). Let k = -4 + l. Suppose 26404 = 3a - 2y, 0 = ky + 2 + 2. What is a rounded to the nearest	{ "pile_set_name": "DM Mathematics" }
4 = -7a. Which is smaller: a or p? p Let o = 4.77 + -2.5. Let j = -1.73 - o. Which is greater: j or 23? 23 Let m(n) = -7n - 11 - 8n + 44 + n2. Let y be m(10). Do -73/4 and y have the same value? False Suppose n - 88 = 5q, 272n - 275n + 30 = -2q. Is 1 greater than or equal to q? True Let v = -64 + 79. Suppose 0 = 7m - v + 8. Is 11/10 != m? True Let q be 2-2 + 0/5 - -6. Suppose 2k = -qk + 2g + 148, -185 = -5k - 2g. Is 35 at least k? False Let f(t) = 64t2 + 11t - 27. Let q be f(2). Is 1258/5 greater than q? True Let j = -150.11 + 149. Let b = j - 2.89. Is -39 not equal to b? True Let q = 293795 - 1768279/6. Is q less than or equal to -919? False Suppose 7r - 2529 = -1920. Let g be ((-118)/(-100) + -1)145/r. Is g less than or equal to 1? True Let b = 948 - 649. Suppose 5r - b = 91. Let n = 131 - 52. Is r at most as big as n? True Let j = -1.8039 - -0.0439. Let n = j + 3.76. Is 345 at least n? True Let t(i) be the third derivative of i6/120 + 7i*5/30 - 19i*4/12 - 11i*3/2 + 3i*2 + 1. Let h be t(-18). Which is greater: -646 or h? h Let d = 394 + -281. Let c = -187 + 300. Is c >= d? True Let c = -2661 + 3254. Which is smaller: c or 590? 590 Suppose 3y = 2m - 32, 5m + 0m = -y - 5. Let g be 5/y - (-1 - -1). Let v = 19.5 - 17.5. Which is smaller: g or v? g Let n(u) = -u2 + 12u - 30. Let v be n(8). Suppose vw = 0, -29q - 5w = -24q + 65. Which is greater: -180/13 or q? q Let w = 49042 + -49037. Let i = 20/9 - 271/126. Is i <= w? True Let s = 0.0461 - 0.0245. Which is smaller: 0 or s? 0 Let d = -490 - -51452/105. Suppose w + 4 = b, 2b - w = 3w + 14. Let p be 1(b + -4 + 25 + -21). Which is greater: p or d? p Let d = 3578 + -533124/149. Is d not equal to 1? True Let z = -312711 + 312709. Let r = 8 - 9.6. Is z greater than r? False Suppose -6 = y, 33l - 40 = 31l + 5y. Which is greater: 285/59 or l? l Let k = -70787/450 + 4134/25. Which is bigger: k or 8? k Suppose 117g - 46g = -126g - 214336. Is -1088 less than or equal to g? True Let h = -5897 + 5896.7. Which is smaller: h or -135? -135 Suppose 0 = -9q + 17q + 8. Let f be 5 + -2 + 2 + (-15876)/3164. Is q < f? True Let l = -22.84771 + -0.15229. Which is smaller: l or -453? -453 Let q(v) = -3v*2 + 10v + 11. Let i(g) = -7g2 + 23g + 21. Let z(w) = 2i(w) - 5q(w). Suppose -4 - 26 = -5n. Let d be z(n). Which is smaller: d or 18/7? d Let s be (-44)/(-3)(-3)/(-2). Let p be s/(-10) + (-4)/(-20). Let r = 3/20 - -87/220. Is p != r? True Let p = 51697.4 - 51697. Let l = -6.9 - -0.9. Which is smaller: l or p? l Suppose 110 = 20l - 15l. Let i = 14 - l. Let v be (44/i)/(3/(-6)). Is 11 > v? False Let k(h) = 4821h - 458. Let v be k(1). Which is greater: 4364 or v? 4364 Let u be 2/21 + (1 - 79628/72660). Is -1 >= u? False Let y = 320 - 4162/13. Let c be 10/154 + (-63)/147. Is y less than or equal to c? False Let s = -7 - -11.5. Let j = s + -4.1. Let r = 1.5 + j. Is r != 1? True Let i be -2024/40 + 15 + -2. Are i and 74 equal? False Let b(f) = -6f + 158. Let k be b(27). Let c be 4 - ((-2)/k)/(3/18). Which is bigger: c or 27? 27 Let d = 0.0496 + -265.0496. Let f = d + 157. Let r = -110 - f. Which is greater: r or 0.12? 0.12 Let a = 224 + -187. Suppose -ao - 1968 = -25o. Is o >= -163? False Let p(t) = -t - 40. Let b be p(-5). Let h(a) = -3a. Let y be h(-4). Let c be (y/245)/(-2 - 56/b). Is 1 less than c? False Let g be 22/5 + (-3)/(-5). Suppose -gw = 4a + 12, 3a + w = 1 + 1. Suppose -3y + 21 = -ad - 2, -4y = -d - 24. Which is greater: -3 or d? -3 Let r = -49064/7 + 7016. Is r greater than 19? False Let d(f) = f*2 - 37f - 3026. Let i be d(-42). Is 294 smaller than i? False Let d(r) = -82r - 417. Let h(y) = 4y + 34. Let j be h(-10). Let p be d(j). Is p at least 74? True Suppose 5d + 115 = 5k - 0k, 0 = 2k + 5d - 32. Let l = 20 - k. Let q be (6/69)/(3/3). Which is bigger: l or q? q Let z = 0.011 + 2.709. Let f = z + 0.28. Let t = -2380 + 2398. Is f at least t? False Suppose -n - 49 = -2r, 2r - 5r + 73 = -n. Let s be (-108)/r8/(-3). Let x be (-18)/148/s. Is x > 1/4? False Suppose 0 = 6d - 3t - 249, -1833 + 1633 = -5d + 5t. Are d and 53 non-equal? True Suppose 5c - 8 = -2l + 4l, -4l = 3c - 10. Which is smaller: l or 94/65? l Let o = -529 - -529. Let u = 102.74 + 2.26. Are u and o equal? False Let t(b) = -b3 - 20b*2 + 29b + 12. Let s be t(-23). Which is bigger: s or 934? 934 Suppose 0 = 6o - 2 - 4. Suppose -3z + a + 2 = -z, 0 = z - a + o. Let m(y) = -y + 3. Let u be m(z). Is -3/8 greater than u? False Suppose -v - 1 - 21 = 0. Let m be (30/4)/((-11)/v). Let h = 163 + -163.2. Is m less than h? False Let g be (-3)/18 - 1138/72. Let b = g + 16. Let z be (-1)/(1(-2)/2). Which is bigger: z or b? z Suppose -16 = 4s + 4. Let p be 12 - 91/(-22)-4. Is p > s? True Let n = -42 - -49.5. Let t = n - 63.5. Let u = -31 - t. Is u at most as big as -0.1? False Suppose 7x - 12x = -15, -3k + 5x - 8901 = 0. Is -2962 bigger than k? False Suppose -2 = -2o, 3t + o + 5 = 12. Suppose 5f - 28 = -tb - 11, 3b = 4f - 9. Suppose 3s - 3w = -5w + 4, -fs + 4w - 8 = 0. Which is bigger: s or -13? s Let y = 2385 - 2385. Is -30/101 > y? False Let y = 2334.4 - 2334. Let h = -55 + 104. Which is greater: y or h? h Let y = -2/313438933493 - -7283568247498005689/373305769790163. Let b = y - 19511. Which is smaller: b or -1? -1 Let m be (8 - -9) + -13 - 3. Let u be (0 + 0/1)/3. Suppose u = 3f + 2o + 59, -5f + 4o = -f + 72. Which is greater: m or f? m Let x be (-70)/80 - 71379/(-168). Is 1270/3 less than x? True Let m = 25 + -22. Suppose 7w - 24 = -m. Suppose -3p - 144 = wp. Which is smaller: p or -23? p Suppose 3y - 13 = 4f - 0, 2f + 2y - 4 = 0. Let h be f + (2 - 1 - (-7)/(-7)). Suppose 5b - 3n = -6, -3b + 6 = -b + 3n. Which is greater: h or b? b Suppose -9h + 6 = -48. Let v be h/(-12) - (-380)/24. Which is smaller: -0.2 or v? -0.2 Let s = -3128 - -3053.52. Let j = s - -14.5. Let x = 60 + j. Which is smaller: x or 3? x Let p = 3802 + -3801. Which is smaller: p or 1/5135? 1/5135 Let q = -6 - 4. Let a be (-8)/(-2 + 4)312/(-96). Suppose 2v - 5 + a = 0. Is q != v? True Let a be 697/12(-318)/236. Let m = 554/59 + a. Let w = -69 - m. Is w less than or equal to 1? True Let n be ((-90)/(-12) - 5)/(5/2). Which is smaller: 2/701 or n? 2/701 Suppose -r = 2v - 1602, 16r - 15r + v - 1601 = 0. Let z = -1620 + r. Let s = 0 + -1. Which is greater: s or z? s Let r be ((-9)/(216/(-15)))/(10/4). Let v = -1.42 + 1.4. Let o = v + 0.05. Do o and r have different values? True Let n be (8/16)/(3 - (-2)/4228-6343). Which is bigger: -1055 or n? -1055 Suppose 0 = -592l + 614l + 44. Let v = -163/70 + -13/35. Is l >= v? True Suppose -3676 = 4p + 260. Which is smaller: p or -983? p Let s = -7892 + 7729. Which is greater: -162 or s? -162 Let h be 2/(-9)(-3)/10. Let m = 65988 - 65988. Is m at least as big as h? False Let h be (3/(-2))/((-6)/(-16)). Let a be ((-132)/27)/(h/(-2)). Let g be -10 + -5 - 7/(42/(-72)). Which is smaller: a or g? g Let w = -2042 - -24553/12. Suppose 5894 = -s + 5899. Which is smaller: s or w? w Let f be 1 + (411/417 - 2). Let b = 222 + -234. Let m be (-2)/b - 168/144. Are f and m equal? False Let z = -176987167/1166 + 151790. Does z = 1? False Let n = -450669/1162 + 2715/7. Which is smaller: n or -1? -1 Suppose 0 = 2k - 204k - 511 + 13843. Suppose -2z + 198 = 62. Which is bigger: k or z? z Let i be 6/(-201)(-21)/(-14). Let q = i + -195/134. Which is bigger: q or 0.06? 0.06 Let q = -10391 - -19327259/1860. Which is bigger: -1 or q? q Suppose 0 = -3g + 224 - 59. Suppose 4v + 2 - 14 = 0. Suppose va - g = -4t, 3t + 22 = 4t - 2a. Which is smaller: 61/4 or t? 61/4 Let q = 1 - -88.5. Let v = 90 - q. Which is smaller: v or 42? v Let z(w) = -3w3 + 44w*2 + 13w + 5. Let o be z(8). Which is bigger: o or 3? o Let b = 0.4 + 5.6. Let u = b - 4. Suppose -29s = -14s + 45. Is s less than u? True Suppose 5x + 15 = q, -12q + 5x = -9q - 45. Are q and 27 equal? False Let z be 12 + (6 - (2 - -3)). Let p be (-9)/z - 5/(-40)21. Let q = -0.06 + 0.05. Is q at most p? False Let x(j) = -2j2 - 10j + 6. Let a be x(-8). Let s be (318/a - -5)/(11/7). Which is smaller: -3 or s? -3 Suppose -147f + 1115 = -142f. Suppose -3*q - 12 = d	{ "pile_set_name": "DM Mathematics" }
2 for k. -1 Solve -16472u - 5r + 30 = -16472u, 2r - 5 = -7u for u. -1 Solve -5c - q + 1 = 0, 0q - 5q + 10 = 3c - 6c - 23 for c. -1 Solve 5k = 3w - 20, -2w + 29 - 10 = 19 for k. -4 Solve 0 = 4x + 34u - 310 - 248, -59 = 5x - 2u for x. -5 Solve 21d = 2f - 96, 14 = -29194d + 29189d - f for d. -4 Solve -5v = 14n - 357 - 128, -40 = 5v - n for v. -1 Solve -9h = i - 29, 1137i - 6 = -4h + 1140i for h. 3 Solve 99 = 3r - 38f, -2r - 40f = -78f + 45f + 31 for r. -5 Solve 5 = -s, 8479 - 8556 = 4o + 5s for o. -13 Solve -8660z - 7 = -8665z - 4q, 3z + 2q = 5 for z. 3 Solve -10v + 98 = -4k, 2 + 63 = -v - 14k - 20k + 30k for v. 3 Solve -6j - 5o + 63 = 0, 4o + 51 = -24j + 27j for j. 13 Solve -215361b + 2q + 40 = -215356b, -5q = 2b - 16 for b. 8 Solve 0 = 5i - 5q - 70, -6i + 8i - 2 = 12q + 6 for i. 16 Solve -117v + 119v + 5m - 39 = 0, -4m + 42 = 2v for v. 27 Solve 2y = -4g - 36, 3y = -5g - 133893 + 133843 for y. -10 Solve r + 4i - 2i - 30 = -0r + 3r, 40 = 3r + 2i for r. 2 Solve -222 = 7r + 4r + w + 4w, 0 = 5w - 20 for r. -22 Solve 4456l - 4447l = g + 228, -5l + 125 = 0 for g. -3 Solve -6272516y - 3 - 17 = -6272518y + 4p, p = 3y for y. -2 Solve k + u + 16 = 0, 1626 - 1546 = -5k - 4u for k. -16 Solve -4u - 3u - 51 = 2m - 3m, 3565u - 3568u - 27 = -3m for m. 2 Solve 16126c - i + 27 = 16121c + 3i, -2i + 27 = 11c for c. 1 Solve -5m = x - 111, 405x - 401x = 2m - 40 for x. 1 Solve 153u - 60 = -4q + 156u, -u - 9 = -5q for q. -3 Solve 5f = 4c - 7c - 2, -500f = -502f - c for f. 2 Solve -4b + 49 = -5s, s = -4b - 31899 + 31894 for b. 1 Solve 2446q - 4b = 2445q + 97, 180b = 3q + 45 for q. 105 Solve 9y - 56f = 11y - 26f + 118, -4y + 4f + 20 = -0y for y. 1 Solve -3c - 35s - 96s + 8403 = 235s, 2c = 3s - 79 for c. -5 Solve 0 = 11b - 5t + 18, 35844b - 35849b - 5t = 30 for b. -3 Solve -4k + 51 = -r, 3r + 462k - 37 = 460k - 8 for r. 1 Solve -y + 145a = 140a - 9, 28y + 5a - 15 = -53 for y. -1 Solve 0 = 3b - 2a + 50, -8b - a = -540 + 534 for b. -2 Solve 3c + 7z + 7 = 8z - 5z, c - 11 = 12z for c. -1 Solve 31 = -2v + 3v - 3b, 147b + 53 = -v + 143b for v. -5 Solve 0 = 2w - 10c + 98, 374 = -0c + 2c + 708 - 352 for w. -4 Solve 25x - 3u + 0u = u + 1530, 134 = -11x + 13x + 2u for x. 62 Solve -u - 2997l + 3001l = 46, 0 = -2l + 6 for u. -34 Solve 31u - 155 = 0, 0d - 2u + 5u = -3d - u + 71 for d. 17 Solve 2a + 53y = 77 + 73 + 28 + 64, -11 = -a + y for a. 15 Solve 11z = -3n + 173, 36 = 2n + 3z + 15 - 25 for n. -1 Solve -18 = -q - 4g, -39334291q + 39334295q = 32g + 24 for q. 14 Solve -6n + n + 4l - 1599308 + 1599360 = 0, 2l = -6n + 42 for n. 8 Solve -g - 23v = 8v + 64, -3g - 4v = -789 + 803 for g. -2 Solve -6g - 439x + 444x = 106 - 518, 126 = 2g + 4x for g. 67 Solve 4o + 24l = -8, 150160o - 12 = 150161o + l for o. -14 Solve 3r + 2k + 10 = 0, 83r - 56r + 15 = 23r - 3k for r. 0 Solve w + 19713y - 19708y - 10 = 0, 5w = 46y - 21 for w. 5 Solve 4x - 5q = 6x + 182, -388x = -386x - 21q + 78 for x. -81 Solve -4g + 3g - 18w = -16w + 19, 4w + 44 - 63 = g for g. -19 Solve 2333h - 8g = 2343h + 36, -14 = 5h + 2g for h. -2 Solve -7j = 3z + 17j - 22j + 8, j + 7 = 0 for z. 2 Solve -3w - 141 = 3m, -2w + 22m + 987 - 73 = 0 for w. -5 Solve -q - 423 + 437 = 3s, 0 = 5q - 14s - 70 for q. 14 Solve x = -0x - 3w - 21, -21x + 5w - 7w + 8 = -13x for x. 3 Solve 2v + 3h + 137 - 127 = -0v, -12 = -3h for v. -11 Solve -2a - 3a + 903m - 904m = 21, 42 = -4a - 5m for a. -3 Solve 26 = -3m - 4r, 23r - 7664 = -2m - 7783 for m. -2 Solve 22g + 16s = 18g, 2s = 4g - 54 for g. 12 Solve 201 = -4d - 5b - 8, 23 + 13 + 24 = -12b for d. -46 Solve 0 = -2a - a - 3, 3w + 87 - 24 = 7w + 5a for w. 17 Solve 6w - 265 = 177l - 74l + 2w, -3w - 30 = -l for l. -3 Solve -26c - 4l - 74 = 0, 4c + 398l = 203l + 197l - 14 for c. -3 Solve a = 705454i - 705453i - 10 - 4, -13i + 137 = -4a for i. 9 Solve 49v = 48v + 7j - 44, j = -5v + 6v + 5j - 11 for v. -9 Solve 4t + 8900 = d + 8880, 11t + 55 = -2d for t. -5 Solve 2z - 10 = 4751x - 4753x, 2z + 23x + 11 = 0 for z. 6 Solve 210q - 209q + 3d = -164, 2q + 111 - 53 = -d for q. -2 Solve -4c - 542732 + 542822 = -7y, 48 = -3y - 3c for y. -14 Solve 0 = -3l + 7f - 10, 2l - 5f - 2f + 14 - 7 = -2f - 0 for l. -1 Solve 0 = -17k - 4p + 437, 5k = -p + 381 - 253 for k. 25 Solve -124346c - 2v - 143 = -124351c, -5c + 6v = -439 for c. -1 Solve -89s + 88s + 2f = -2, 41s = -5f + 430 for s. 10 Solve 83 = 3k + 2x, -541024 = -4x - 540828 for k. -5 Solve g + 0g + 1064657k - 1064655k = 2g - 25, 22k = -110 for g. 15 Solve 5f + 4s - 399 = -178, -52f + 49f = 2s - 111 for f. 1 Solve -9s = 31s + 4l + 92, -66 = -s + 2s + 5l for s. -1 Solve g = 5o - 289, o - 29g - 3764 + 3591 = 0 for o. 57 Solve 0 = 2j, 4j + 10j = 4i + 19j - 3j - 29 - 63 for i. 23 Solve -12w - 4b = -7w - 84, 29w - 6b + 200 = 18w for w. -4 Solve 73y = 140y - 69y - 4, 17 - 3 = f - 3y for f. 8 Solve -30g + 504 = -5p + 849, p = -2g + g + 21 + 13 for g. -5 Solve 377025w - 377024w = -4l + 14, 33 = 3l - 3w for l. 5 Solve b - 11x + 19 = 0, -2b + 7022x = 7019x for b. 3 Solve -49z + 23 = -50z - 5x, -215x = 3z + 69 for z. -23 Solve 0k + 4k - 4242s + 4248s - 32 = 146, -5k - 3s = -101 for k. 4 Solve 51 = 3r - w, r - 141 = -w - 180 for r. 3 Solve 5l = -3x + 256, -12l - 32834 = -2x - 33430 for l. 50 Solve 5f + 60165p - 60162p + 113 = 0, -3f - 167 = -23p for f. -25 Solve -5a - 2b - 2 = 2b + 28, 1292a - 5b = 1294a + 29 for a. -2 Solve 3g + 195o = 197o + 22, 25o = 5g + 29o for g. 4 Solve 0 = 3y + 3q - 18, 13y - 3598 = 3q - 3456 for y. 10 Solve 58 = -11y - t, 131t + 3 - 5 = 2y + 129t + 2 for y. -5 Solve -4617p + 2309p + 2303p + 45 = 4g, -2p + 0p + 18 = -6g for g. 0 Solve -36 = -3j - 5a, 192 = 7j - 0j + 75a - 272 for j. 2 Solve 0 = -5h + 485480j - 485482j + 42, -h + 4j = -4 for h. 8 Solve -28 = -5c - 2t, 0 = 2c - 5t - 159 + 171 for c. 4 Solve -995 = 4n - 1027, -3n = -2y - 34 for y. -5 Solve 4s - 2t - 70 = 0, 5s - 26 = -2627t + 2628t for s. -3 Solve -j + b = -15, 119j = 125j - b + 2b - 111 for j. 18 Solve 0 = -g + f - 28, 3f - 278354 = g - 278328 for g. -29 Solve 2i + 10 = i + f, -i + 280 = -2f + 286 for i. -14 Solve -p - 5o - 12 = 0, -5p + 25o = -48 - 42 for p. 3 Solve -n - 3b - 44 = 0, 9153n + b - 156 = 9158n for n. -32 Solve -x + 10 = -b, -186b - 14 = -302b + 111b - 3x for b. -2 Solve -4q - 33t + 29t = 3q - 5q + 8, -55q + 225q = -t + 337 for q. 2 Solve 97 = -g + 33v, 1087v - 1091v = 2g - 16 for g. 2 Solve -2r + 119 = 5t - 47, -8452t + 119 + 213 = -8460t + 4r for t. 0 Solve 1177 - 1095 = -6o + 4t, -2o = -2t + 28 for o. -13 Solve -491o + 494o = 41g - 220, 2o = -4g + 10 for g. 5 Solve -41h - 74 = -2j + j, 0 = 6115j - 6112j + 4h + 32 for j. -8 Solve -14i + 11973s - 11972s - 617 = -2i, -2i - 5s = 77 for i. -51 Solve -2v - 7 = -r, -7r + 29v + 139 = -10r + 5r for r. -3 Solve -3132 = -3x + q - 3116, 2x = 3q + 6 for x. 6 Solve 41o + 4y - 2y - 22 = 40o, -2o + y + 59 = 0 for o. 28 Solve 22 = 5c - 4l, 17 = 5c + 5c + l - 0 for c. 2 Solve -4 = -l - 2c - 9, -3l - 5c - 20 = -4c for l. -7 Solve -34 = -11v + 2b + 7, -1775b + 22 = -1781b - 2 for v. 3 Solve 8l + 12w = -264 + 572 - 484, -3l - 36 = 2w for l. -4 Solve -32283g + 32282g = -3d - 19, 0 = -2d - g - 11 for d. -6 Solve 3p - 10838 = -4m - 10795, -7p = -4m - 2p - 61 for m. 1 Solve -4j + 4m - 176 = 0, -5j + 19392m - 212 = 19389m for j. -40 Solve 2c = -18z - 62, 3c + 2 = -5z - 11 + 8 for z. -4 Solve -u + 1229b - 578 = 1195b, -u + 68 = 4b for u. 0 Solve 3x = 10h - 105, -4h - 3x = 2200 - 2137 for h. 3 Solve 16k + 34 = 13k - 5b + 4b, -88 = 2k - 16k + 2b for k. 1 Solve 24d + a + 75 + 69 = 34, -13 = 2a + 15 for d. -4 Solve 3g - 367p - 156 = -359p, 3g + 5p + 78 = 0 for g. 4 Solve 2k - 10 = 2f - 3f, 237 - 318 = 18k + f - 171 for k. 5 Solve 0 = -9b + 5n - 410183 + 410152, -5b - 18 = -2n for b. -4 Solve 2	{ "pile_set_name": "DM Mathematics" }
2/3s2 + 4/9s*3 - 8/9s - q. -2(s - 2)2(s + 1)*2/9 What is h in -24h*3 + 8h*4 - 32h*2 - 15h*4 + 5h*4 - 2h*4 = 0? -4, -2, 0 Let d = -322 + 414. Let m be d/230 + 12/(-55). Factor -2/11r*5 + 0 + 0r + 0r3 + mr*4 + 0r*2. -2r*4(r - 1)/11 Let o(q) be the first derivative of -4q3/3 + 732q2 - 2582. Find s, given that o(s) = 0. 0, 366 Let x(m) = m2 - 17m - 105. Let z be x(22). Suppose -zq - 35 = -5s, 10s - 3q - 5 = 15s. Factor 0d + 2/3d*4 - 2d*3 + 4/3d*s + 0. 2d*2(d - 2)(d - 1)/3 Let a be (3/220-4)/(352/1920 - (-3)/(-9)). Factor 8/11n3 + an + 10/11n2 + 2/11n*4 + 0. 2n(n + 1)2(n + 2)/11 Let v(o) be the first derivative of 968/9o - 80/27o*3 - 154/9o*2 + 62 - 1/9o*4. Suppose v(r) = 0. What is r? -11, 2 Let h be (105/18 + -7)205/(-287). Factor 0 + 1/2z - hz*2 - 1/3z*3. -z(z + 3)(2z - 1)/6 Suppose g = 89 - 77. Let -5 + gx + 43x - 35x2 + 23 + 12 = 0. Calculate x. -3/7, 2 Let s(h) = h3 + 10h*2 + 8h - 4. Let x be s(-9). Suppose -xi - 25 = -3u, 0 = -0u - u + 4i + 13. Solve 4m2 + 0 + um + 4 - 1 - 1 + m3 = 0 for m. -2, -1 Let i(m) be the first derivative of -m4/9 - 4m3/9 - 4m*2/9 - 2165. Determine w, given that i(w) = 0. -2, -1, 0 Suppose -2o + 15o - 26 = 0. Solve 6 - 14 + 4b*o - 13 - 3 + 4b = 0. -3, 2 Let u(w) be the first derivative of w*6/2 + 62w*5/5 + 195w*4/4 - 456w*3 + 216w*2 + 1047. Suppose u(p) = 0. What is p? -12, 0, 1/3, 3 Let z = 63332 - 189992/3. Let d = 3/70 - -901/210. Factor zh*2 - dh + 1. (h - 3)(4h - 1)/3 Let m(q) = 4q2 - 7q - 5. Let l(w) = -2w2 + 4w + 2. Suppose 2t - 2 = -4i + 6, -t + 5i = 17. Let d = 9 - 14. Let j(c) = dl(c) + tm(c). Factor j(b). 2b(b - 3) Let u(h) be the second derivative of -h4/3 + 272h*3/3 + 834h*2 - 300h. Factor u(z). -4(z - 139)(z + 3) Suppose -10w + 72 = -w. Suppose 21l + 12l2 - 4l*4 - 8l - 4l3 - w - 9l = 0. What is l? -2, -1, 1 Suppose -23w = 4w - 95w. Let u(s) be the first derivative of -2/7s*2 + 5 + 1/14s*4 + ws - 2/21s3. Factor u(f). 2f(f - 2)(f + 1)/7 Let s(f) be the first derivative of -f*5/180 - 17f*2 - 38. Let w(n) be the second derivative of s(n). Determine m so that w(m) = 0. 0 Let l = -5067658/13 - -389820. Factor -50/13y + ly3 - 2 - 22/13y*2. 2(y - 13)(y + 1)2/13 Let p(d) = -2664d*3 - 2d*2 - 86d - 86. Let u be p(-1). Let f(q) be the second derivative of 0 - 1/5q5 + 32q - 242q3 - 11q*4 - uq*2. Factor f(g). -4(g + 11)3 Let r(j) = j3 - 6j2 + 7j - 15. Let f be r(5). Let x = 35 - f. Factor -xk3 + 10k*4 + 160 - 27k - 80k2 + 5k*5 + 107k + 0k5. 5(k - 2)*2(k + 2)*3 Let k(m) = 56m*2 + 56m. Suppose 2g + 24 = -2v - 3g, -5v - 4g = 94. Let o(c) = -c3 + 280c*2 + 281c. Let w(a) = vk(a) + 4o(a). Factor w(n). -4n(n + 1)(n + 27) Let h(r) be the third derivative of -r7/840 - 53r*6/120 - 2809r*5/40 + 107r*4/24 + 17r*2 + 1. Let f(o) be the second derivative of h(o). Factor f(n). -3(n + 53)*2 Let s = 5482/6435 - -18/143. Let l(t) be the second derivative of 0 - 20t - 121/90t4 - st*3 - 4/15t*2. Factor l(x). -2(11x + 2)2/15 Let c(v) be the first derivative of -5v*3/9 - 851v*2/6 - 170v/3 + 1742. Determine j so that c(j) = 0. -170, -1/5 Let a = 108889/12 + -9074. Let y(l) be the first derivative of l*2 - 10 + 5/9l*3 + al*4 + 0l. Factor y(m). m(m + 2)(m + 3)/3 Suppose 2v - 1 = -r, -4v - 7 = 18r - 19r. Let x(c) be the first derivative of -29 + 0c - 27/10c*2 + 1/5c*r. Factor x(u). 3u(u - 9)/5 Let s = -1162 - -1172. Suppose -g - 2m = -4, -3g = -0g + 4m - s. Factor 2/3c*g - 4/3c + 2/3. 2(c - 1)2/3 Let f be 8 - 69/(66/11015). Solve -fb2 + 14/3b - 13/3 = 0. 1, 13 Suppose 224p - 4174 + 3726 = 0. Determine k, given that 1/3k*4 + 2k - 5/3kp + 0 - 2/3k*3 = 0. -2, 0, 1, 3 Let m be (-1)/2 + 0 - 15/(-30). What is z in 2/9z + m + 10/3z3 + 14/9z*2 + 8/9z*5 + 26/9z*4 = 0? -1, -1/4, 0 Let a = -20246 + 61310/3. Let m = a - 1714/9. Find u such that 2/9u - mu2 + 4/3 = 0. -2, 3 Let t(z) be the second derivative of -z5/60 - 191z*4/2 - 218886z*3 - 250843356z*2 + 22z - 29. Factor t(u). -(u + 1146)*3/3 Suppose 6633x + 12422x - 5050 - 25x*2 + 6200x = 0. What is x? 1/5, 1010 Let d(j) = -460j + 2300. Let v be d(5). Let k(b) be the second derivative of 2/3b*4 - 1/10b*5 + 6b + vb2 + 0 + 1/3b*3 - 4/15b*6. Factor k(h). -2h(h - 1)(h + 1)(4h + 1) Suppose 4y - 11y = -30y. Let b(q) be the first derivative of 3/32q*4 + yq - 15 + 1/4q3 + 3/16q*2. Factor b(f). 3f(f + 1)2/8 Let k(x) = -5x - 2. Let r be k(-1). Find c, given that -11c4 + 15c*r - 9 + 15 - 17c + 8c5 + 5c*2 - 6c5 = 0. -1, 1/2, 1, 2, 3 Let u(w) be the second derivative of w6/1260 - 2w5/105 + 4w*4/21 + 47w*3/3 - 2w - 38. Let z(b) be the second derivative of u(b). Factor z(i). 2(i - 4)2/7 Let t(s) be the first derivative of s5/12 - 5s*4/8 - 10s3/3 - s2 + 8s + 32. Let b(l) be the second derivative of t(l). Solve b(w) = 0 for w. -1, 4 Let o be 3108/88875/7. Find g, given that -3/8g3 - og + 0 + 15/2g2 = 0. 0, 10 Determine y so that 2464y - 117y2 + 112y*2 + 217y*2 + 4y*3 - 9408 = 0. -28, 3 What is y in 23/9 + 5y - 2/9y2 = 0? -1/2, 23 Let t(l) = 28l + 2. Let k be t(0). Solve -58y3 - 960y + 53y3 + 23y*k - 40y2 - 2560 + y2 - 104y2 = 0. -8 Find r, given that 45r*3 - 378 - 3r*4 - 11988r*2 + 5916r*2 + 5841r*2 + 30r + 465r = 0. 2, 3, 7 Factor -2/3m*3 - 200/3 - 58/3m*2 - 208/3m. -2(m + 2)2(m + 25)/3 Let a(w) be the third derivative of w*6/120 - 91w*5/60 - 185w*4/24 - 31w*3/2 - 238w2. Find g such that a(g) = 0. -1, 93 Let p(i) be the second derivative of i4/48 - 47i3/12 - 291i*2/8 - 3371i. Determine b, given that p(b) = 0. -3, 97 Factor -8/5t - 1/5t*2 + 13. -(t - 5)(t + 13)/5 Let c(b) be the second derivative of 2b7/21 + 52b*6/15 + 166b*5/5 + 140b*4 + 294b*3 + 324b*2 + 3b - 8. Find q such that c(q) = 0. -18, -3, -1 Suppose 60d + 200654 = 355898 + 289490 + 213826. Factor do - 76832/9 + 2464/9o3 - 24304/9o*2 - 38/3o*4 + 2/9o*5. 2(o - 14)*4(o - 1)/9 Suppose -5i + 180p + 22 = 177p, 5p + 18 = -i. Let 24k - 7/3k*i - 20/3 = 0. Calculate k. 2/7, 10 Let s be (-6 - 432/24) + 27. Let b(t) be the second derivative of 1/16t*4 - 1/48t*s - 1/84t*7 + 1/20t*6 + 0 + 35t + 0t2 - 13/160t*5. Factor b(m). -m(m - 1)*2(2m - 1)2/8 Solve 22038 + 669 + 134975v*2 + 522v - 134972v2 = 0 for v. -87 Let k = 86281 - 86277. Suppose 2/11r*3 + 2/11r*k - 30/11r*2 + 46/11r - 20/11 = 0. Calculate r. -5, 1, 2 Suppose -p + 22 - 23 = 0. Let t(g) = 25g4 + 30g*3 + 25g*2 + 20g. Let x(z) = -z4 - z3 - z*2 - z. Let w(j) = pt(j) - 20x(j). Factor w(s). -5s*2(s + 1)*2 Let x(o) = -24o*2 - 59o - 288. Let d(s) = 3s + 26. Let v be d(-5). Let u(y) = -13y*2 - 30y - 144. Let m(n) = vu(n) - 6x(n). Factor m(w). (w + 12)*2 Suppose -991/4 + 1/4j*2 - 495/2j = 0. What is j? -1, 991 Let l be 3/5 + 153/(-5). Let r = l + 57. Factor -16 - 5 - 3q + rq - 3q2. -3(q - 7)(q - 1) Let n(w) be the second derivative of 2/15w*6 - 4/3w*3 + 2 + 18w + 0w5 + 0w2 - w4. Determine x so that n(x) = 0. -1, 0, 2 Suppose -5q - 55 + 30 = 0. Let d be (-4 - (-2 - 9)) + q. What is r in 0 - 1/2r*d + 0r = 0? 0 Suppose -2679u + 2823u = 288. What is y in 288/11yu - 194/11y*3 + 36/11y*4 - 2/11y*5 + 0 - 128/11y = 0? 0, 1, 8 Let z = 781 - 791. Let r be (3/z)/(6/(-16)). Factor -rp - 2/5p*2 + 6/5. -2(p - 1)(p + 3)/5 Factor -142 + 8z - 20z - 2z*2 - 24z + 12. -2(z + 5)(z + 13) Determine y, given that -421y2 + 4345y*2 + 364y*4 - 534y - 666y + 3372y*3 - 12y*5 + 167y*4 = 0. -4, -2, 0, 1/4, 50 Let x = -391 + 395. Suppose 190l*3 + 2l*5 + 190l*3 - 366l*3 + 4l*2 - 4l*5 + xl*4 - 4l5 = 0. Calculate l. -1, -1/3, 0, 2 Let t(r) be the third derivative of -r5/36 + 95r4/36 - 175r*3/6 + 2r*2 + 1132. Factor t(j). -5(j - 35)(j - 3)/3 Let 2775368/7 + 4712/7p + 2/7p2 = 0. What is p? -1178 Let d = 503329 + -503329. Suppose 0u + d + 2/5u3 + 24/5u	{ "pile_set_name": "DM Mathematics" }
(-5)/(20 + -5)). Suppose 30i = 2i + w. List the prime factors of i. 2, 7, 11 Let k(x) = x*3 - 5x*2 + 4x - 20. Let r be k(5). Suppose 9z = 10z - 2, r = 5a - 5z - 295. What are the prime factors of a? 61 Let n(l) = -5434l - 5011. List the prime factors of n(-2). 5857 Suppose 53 = 3k + 41. Suppose -k = -3c - 1. What are the prime factors of (1/2)/(c/226)? 113 Let l(s) = 43s*2 + 103s + 834. What are the prime factors of l(-9)? 2, 3, 5, 113 Let f = 5062 + 3832. List the prime factors of f. 2, 4447 Let g(i) = 3i2 + 4i. Let m be g(-2). Suppose mk + 703 = 3339. Suppose -k = -2u - 129. What are the prime factors of u? 5, 53 Let l(a) = -2a2 + 24a - 18. Let t be l(11). Suppose 2i - 1292 = -th, -5h + 10h - i - 1629 = 0. List the prime factors of h. 5, 13 Let b = -2834 + 2751. Let f(u) = -34u2 - 2u + 2. Let z be f(2). Let x = b - z. What are the prime factors of x? 5, 11 Let t = 29 - 18. Let m be (-4)/(-22) - 24/t. Let c(u) = -5u3 - 3u*2 - 3u - 4. List the prime factors of c(m). 2, 3, 5 List the prime factors of -130 + 7221 + (14 - 1). 2, 3, 37 Let s = -1492 - -646. Let l = s - -1216. What are the prime factors of l? 2, 5, 37 Suppose 0 = 24p + 108p - 1070377 - 1232363. List the prime factors of p. 3, 5, 1163 Let f(z) = -10 + 1 + 10. Let m(i) = i - 6. Let d(c) = 5f(c) - m(c). List the prime factors of d(-8). 19 Let y(i) = -108i - 19. Let q be y(-3). Let n = q + -193. List the prime factors of n. 2, 7 Suppose 0 = -5o - 10, 0 = -2j + 3o + o + 1048. Suppose x - 82 = -p + 30, 5p - 3x - j = 0. What are the prime factors of p? 107 Let g be 153855/105 + (-6)/21. Suppose 0w = 5w - g. List the prime factors of w. 293 Suppose b = -5, d - b - 2249 - 963 = 0. List the prime factors of d. 3, 1069 Suppose 3h + 1895 = -5218. Let w = h - -3434. What are the prime factors of w? 1063 Let s(h) = h*3 - 6h*2 - 13h + 48. Let v be s(7). Suppose 1386 = 4y - 2o, 5y + o = vo + 1720. List the prime factors of y. 349 Let a(l) = l*3 + 4l*2 - 7l - 5. Let h be a(-5). Suppose 0 = ho - 3i - 7, 3 = 4o - i - 4. Suppose -ok - 20 = -180. What are the prime factors of k? 2, 5 Let u be (-6)/(-12) - -4 - (-6)/(-4). Suppose -5h - 1835 = -k - 4k, -5h - 1091 = -uk. What are the prime factors of k? 2, 3, 31 Let s(y) be the first derivative of y*3 + 6y*2 - 82y - 252. What are the prime factors of s(21)? 1493 Let z(w) = -w*3 - 6w*2 + w + 1. Let b = 71 - 77. Let u be z(b). List the prime factors of (34/u)/(1 + 14/(-10)). 17 What are the prime factors of ((-216)/(-126))/((12/9058)/6)? 2, 3, 647 Suppose 10q - 240 = -0q. Suppose 0j + q = 3j. List the prime factors of 4/10(j - 3) + 87. 89 List the prime factors of (-1541260)/(-105) + (-22)/11 + (-8)/(-6). 2, 41, 179 Let l = -22 - -24. Suppose -lt = -10 + 20, 4t = 5a - 1605. What are the prime factors of a? 317 Let o(z) = -z3 - 4z*2 + 6z + 15. Let j = -39 - -33. What are the prime factors of o(j)? 3, 17 Let r(m) = -7275m3 - 2m*2 - 14m - 12. What are the prime factors of r(-1)? 3, 5, 97 Let a = 37851 + -22775. What are the prime factors of a? 2, 3769 Let a be ((-21)/14)/(3/412). Let h be (100 - 0)(5 + 1 - 7). Let l = h - a. What are the prime factors of l? 2, 53 Suppose 2d + 43 = 15. Let w be (-9724)/d + (-16)/28 + 1. Suppose 0 = 4x - 505 - w. List the prime factors of x. 2, 3, 5 Let q = 6009 - 3781. List the prime factors of q. 2, 557 Let a(f) = 29f*2 - 12f + 30. Let q(b) = 4b3 - 31b*2 - 6b - 11. Let u be q(8). What are the prime factors of a(u)? 5, 139 Let r = 195 + -425. Suppose -15p = -0p - 6015. Let h = p + r. What are the prime factors of h? 3, 19 Let v be (20/6)/(6/9). Let w be (4 - (-1 - 0))(v + -3). Suppose 0n - wn + 1960 = 0. What are the prime factors of n? 2, 7 What are the prime factors of 375/(-125) - (3862-1 - 1)? 2, 5, 193 Let d(w) = 12w2 + 7w - 134. Let j(z) = 3z2 + 2z - 33. Let y(k) = -6d(k) + 26j(k). What are the prime factors of y(-9)? 2, 3, 19 Suppose -4t - 62 = -o, 7t = 8t + o + 13. What are the prime factors of 0 + t/(-12) + 40070/40? 17, 59 Suppose -25w + 11w + 83538 = 0. What are the prime factors of w? 3, 13, 17 Let z = 42 - 37. Suppose -2h + 3h - z = 0, 29 = 3s + 4h. Suppose sl + 41 - 302 = 0. What are the prime factors of l? 3, 29 Suppose -5z + 2l + 8846 = 0, 4z + 3515 - 10603 = -4l. Suppose -13d + 7d + z = 0. List the prime factors of d. 5, 59 Let c = 59005 + 29277. What are the prime factors of c? 2, 37, 1193 Let g = 36604 - 490. What are the prime factors of g? 2, 3, 13, 463 Suppose 40 = 5p - 0p. Let i be 0/(-24/p). Suppose i = 14y - 2566 + 620. List the prime factors of y. 139 Suppose 2k + 13220 = 2a, a - 388 - 6222 = 3k. What are the prime factors of a? 2, 5, 661 Let a(x) = -5x*2 + x + 4. Let p be a(2). Let t = 18 + p. List the prime factors of t. 2 Let t(k) = 3624k*2 - 239k - 9. List the prime factors of t(3). 2, 3, 5, 1063 Suppose -7l = -6l + 316. Let q = -214 - l. What are the prime factors of q? 2, 3, 17 Let p = -249 + 250. List the prime factors of (-49 - -40)/((-2)/204p). 2, 3, 17 Suppose 20 = 5y + 5. Suppose 2d - 64 = 4x, yx + 2x - 5 = 0. What are the prime factors of d? 2, 17 Suppose 0g - u = g, 3u + 3 = -2g. Suppose -116 = -gz + 658. List the prime factors of z. 2, 3, 43 Suppose 5w - 2160 = -3w. Let s = w + -122. List the prime factors of s. 2, 37 Let y = -81 + -1110. Let b = 2671 + y. List the prime factors of b. 2, 5, 37 Let c(j) = j*3 + 44j*2 - 1505j + 31. What are the prime factors of c(-57)? 43579 Suppose 0p - p - 182 = y, -5p = -4y + 883. Suppose n = j - 112, -3n + 47j - 352 = 48j. Let f = n - p. List the prime factors of f. 3, 7 Let k be 2/69 - -6. Suppose 0 = -2z + 13 - k. Suppose 0 = -zu + 2c + 138, 0u - 2u + 3c + 133 = 0. List the prime factors of u. 2, 37 What are the prime factors of (184283/110)/(6/15) - (-6)/8? 59, 71 Let m(x) be the third derivative of x6/120 - 13x*5/20 - 5x*4/12 + 43x*3/6 + 158x*2. List the prime factors of m(40). 11, 113 Suppose -4t = 3g + 17, -2t + 6g - 7g = 7. List the prime factors of t + (-39886)/(-46) + 22/(-253). 5, 173 Let p(s) = s*3 + 60s*2 + 26s + 132. List the prime factors of p(-57). 3, 311 Suppose 2s - 4b = 20122, -41s - 50333 = -46s - 4b. List the prime factors of s. 3, 5, 11, 61 Let y(w) = 4w*3 + 6w*2 + 2w - 3. Let t be y(-6). Let b = t - -1013. List the prime factors of b. 2, 5, 7 Let x(a) = -5a2 + a + 2. Let q be x(4). Let m = -72 - q. List the prime factors of -31/m-62. 3, 31 Let j(a) = -32a - 6. Let g(t) = -1. Let l(b) = -g(b) + j(b). Let z be l(-3). Let u = z + -30. What are the prime factors of u? 61 List the prime factors of 37867 + 123 + -1 + 12 + 0. 3, 53, 239 Let n be -1 + -1 - -4 - -1. Suppose 4 = -2c + 4k + 26, -nk - 27 = -5c. Suppose -ch = -274 + 82. What are the prime factors of h? 2 Let s(p) = 5p*2 + 4p - 1. Let d be 6((-10)/4 + (-21)/(-7)). Let c = d - 2. What are the prime factors of s(c)? 2 Let j be (207/138)/((-1)/(-2)). Let l(h) = -77h - 2. Let s be l(-6). Suppose -5k + s = 5m, 2m - 373 = -2m - jk. What are the prime factors of m? 97 Let w = -1422 - -1811. List the prime factors of w. 389 Let r = -29214 + 83960. What are the prime factors of r? 2, 31, 883 Suppose 0 = 2t + t - 18, 0 = -4q - 3t + 718. Let b = -6 + 11. Suppose -p + q + 454 = bh, -2h = 4p - 248. List the prime factors of h. 2, 3, 7 Let u(t) = 3t*3 - 51t*2 - 34t + 145. List the prime factors of u(20). 5, 613 Let x(t) = 2t2 - 10t - 7. Let o be x(5). Let s(b) = -69b - 23. What are the prime factors of s(o)? 2, 5, 23 Let v(o) = 29o*2 + 68o + 40. List the prime factors of v(-15). 5, 1109 Let p(t) = 11t3 - 12t*2 - 12t - 25. Let h be 0 - -96/(-27)-3. Let k(v) = 2v3 - v - 1. Let m(y) = hk(y) - p(y). What are the prime factors of m(-9)? 2, 13 Let u(o) = -2 + 6o + 0o*2 + 308o*3 - 307o*3 - 6o*2. Let r be u(5). Suppose 14y = ry + 748. What are the prime factors of y? 2, 17 Suppose -37 = -5k - 117. Let q be (k/(-12))/(((-7)/18)/(-7)). List the prime factors of 122/6 - 8/q. 2, 5 Let m = 15802 - 9463. What are the prime factors of m? 3, 2113 Suppose -184 = -17y + 9y. Suppose -yo = -17o. Suppose 0 = -6p + 7p - i - 37, 5*	{ "pile_set_name": "DM Mathematics" }
ithout replacement from vtyytqqtrltvyy. 2/91 Four letters picked without replacement from qrqrrrrrrqqprqqg. Give prob of picking 2 q, 1 g, and 1 r. 6/91 What is prob of picking 2 p when two letters picked without replacement from hpmrppphphchbpbbmp? 7/51 Two letters picked without replacement from cyhyc. Give prob of picking 2 c. 1/10 Two letters picked without replacement from {e: 1, z: 3, b: 3, v: 3, y: 6}. Give prob of picking 1 e and 1 y. 1/20 Calculate prob of picking 2 j and 1 b when three letters picked without replacement from jjjhjbjrjjrhbjjhhdb. 36/323 What is prob of picking 2 k and 1 l when three letters picked without replacement from {g: 2, l: 4, a: 1, k: 2}? 1/21 What is prob of picking 1 b and 1 h when two letters picked without replacement from {e: 6, b: 2, z: 5, v: 5, u: 1, h: 1}? 1/95 What is prob of picking 4 p when four letters picked without replacement from gpspvpg? 0 Four letters picked without replacement from mpooopoom. What is prob of picking 2 p and 2 m? 1/126 Two letters picked without replacement from {z: 2, w: 2, b: 5, v: 1, l: 1, c: 2}. What is prob of picking 1 v and 1 c? 1/39 What is prob of picking 4 y when four letters picked without replacement from qyqvqvyyqyvyt? 1/143 Calculate prob of picking 1 i and 2 q when three letters picked without replacement from {q: 2, l: 6, e: 7, s: 1, i: 4}. 1/285 Three letters picked without replacement from nnnnnfvvmnfwvmwwwlm. What is prob of picking 1 n, 1 m, and 1 l? 6/323 What is prob of picking 4 s when four letters picked without replacement from {s: 10}? 1 What is prob of picking 1 k, 1 a, and 1 h when three letters picked without replacement from {h: 2, u: 1, k: 1, a: 1, j: 1, o: 1}? 2/35 Two letters picked without replacement from {q: 4, x: 16}. Give prob of picking 1 x and 1 q. 32/95 What is prob of picking 2 c when two letters picked without replacement from kkckck? 1/15 What is prob of picking 4 x when four letters picked without replacement from xxuxbbuxx? 5/126 Four letters picked without replacement from {q: 2, f: 5, w: 3, x: 6, v: 2, p: 1}. Give prob of picking 1 q, 1 f, 1 v, and 1 p. 5/969 Calculate prob of picking 1 f and 2 s when three letters picked without replacement from ssslsfflssssssfsfsfs. 13/38 Three letters picked without replacement from {u: 2, m: 1, b: 2, y: 6, q: 1}. Give prob of picking 1 u, 1 y, and 1 q. 3/55 Four letters picked without replacement from {e: 9, k: 2, x: 5}. What is prob of picking 1 e, 1 k, and 2 x? 9/91 Four letters picked without replacement from ivvjpppiviirpp. What is prob of picking 2 i, 1 r, and 1 j? 6/1001 Three letters picked without replacement from tcmccctctttcqtt. What is prob of picking 3 c? 4/91 Two letters picked without replacement from {z: 1, d: 1, m: 1, s: 1, y: 2, k: 1}. Give prob of picking 1 s and 1 k. 1/21 What is prob of picking 2 a when two letters picked without replacement from ynampac? 1/21 Calculate prob of picking 2 n and 1 w when three letters picked without replacement from {w: 3, n: 13, h: 3}. 78/323 Two letters picked without replacement from {t: 5, c: 2, u: 1, o: 1, i: 1}. Give prob of picking 2 t. 2/9 Calculate prob of picking 2 b and 1 a when three letters picked without replacement from abagabab. 3/14 Calculate prob of picking 2 g, 1 t, and 1 u when four letters picked without replacement from {t: 6, u: 1, h: 3, g: 2}. 2/165 What is prob of picking 2 s when two letters picked without replacement from {s: 2, q: 1}? 1/3 Two letters picked without replacement from {b: 5, z: 3, q: 4}. Give prob of picking 2 z. 1/22 Three letters picked without replacement from vnvisoisjiinij. Give prob of picking 1 v, 1 i, and 1 o. 5/182 Calculate prob of picking 2 d when two letters picked without replacement from ddiddddd. 3/4 Calculate prob of picking 1 e, 1 a, and 1 s when three letters picked without replacement from {i: 1, y: 3, a: 1, s: 4, e: 2, o: 1}. 2/55 Two letters picked without replacement from ryarryyyrryyahhryy. What is prob of picking 2 y? 28/153 Two letters picked without replacement from {d: 1, r: 1, w: 1, v: 4, a: 1}. Give prob of picking 1 v and 1 r. 1/7 Two letters picked without replacement from {p: 2, o: 1}. What is prob of picking 1 p and 1 o? 2/3 Three letters picked without replacement from {a: 2, u: 1, t: 7, y: 2}. What is prob of picking 1 a and 2 y? 1/110 Calculate prob of picking 1 z, 1 q, and 1 r when three letters picked without replacement from {z: 4, f: 1, q: 2, s: 1, r: 5, u: 2}. 8/91 Four letters picked without replacement from {v: 4, d: 3}. What is prob of picking 2 v and 2 d? 18/35 What is prob of picking 4 h when four letters picked without replacement from hvvhhhavaahvv? 1/143 Two letters picked without replacement from aiaaaaai. What is prob of picking 2 a? 15/28 Two letters picked without replacement from kcrmu. What is prob of picking 1 m and 1 c? 1/10 Two letters picked without replacement from uuuuu. Give prob of picking 2 u. 1 Two letters picked without replacement from {w: 1, s: 1, y: 1, u: 2, o: 1, c: 2}. What is prob of picking 1 s and 1 c? 1/14 Calculate prob of picking 1 u and 1 y when two letters picked without replacement from {o: 8, y: 2, w: 2, u: 3}. 2/35 What is prob of picking 1 l and 2 k when three letters picked without replacement from {n: 2, b: 3, k: 8, l: 3}? 3/20 What is prob of picking 2 e and 2 t when four letters picked without replacement from ttttetttte? 2/15 What is prob of picking 1 y and 1 z when two letters picked without replacement from {w: 10, z: 1, q: 1, o: 1, y: 5, f: 2}? 1/38 What is prob of picking 2 i when two letters picked without replacement from {i: 2, z: 8, b: 2, q: 2, w: 3}? 1/136 Three letters picked without replacement from {o: 4, n: 9, y: 4, t: 1, q: 2}. Give prob of picking 2 o and 1 t. 1/190 Four letters picked without replacement from cnncccnvvncvnv. What is prob of picking 3 v and 1 c? 20/1001 Three letters picked without replacement from {a: 1, b: 1, f: 4, k: 1, q: 2}. Give prob of picking 1 b, 1 q, and 1 a. 1/42 Three letters picked without replacement from wwmmmwwwwwwmwwmw. Give prob of picking 2 w and 1 m. 55/112 Four letters picked without replacement from {u: 13, s: 3, x: 3}. What is prob of picking 3 x and 1 s? 1/1292 What is prob of picking 2 i, 1 q, and 1 b when four letters picked without replacement from {j: 8, b: 1, i: 7, q: 1}? 3/340 What is prob of picking 2 h when two letters picked without replacement from zhzzzzhhhhzhz? 5/26 Calculate prob of picking 2 i and 1 s when three letters picked without replacement from isitttitirwcss. 9/182 Calculate prob of picking 1 x and 2 f when three letters picked without replacement from foxofxxooooxxfxxoxx. 9/323 Two letters picked without replacement from {e: 11, r: 1, v: 5}. What is prob of picking 1 r and 1 v? 5/136 Four letters picked without replacement from beaqeeaqqqqqwa. Give prob of picking 1 q, 1 e, 1 w, and 1 b. 18/1001 Four letters picked without replacement from bskbcokcbosccls. Give prob of picking 1 l, 1 s, and 2 b. 3/455 Three letters picked without replacement from dwddddwdwdddwy. What is prob of picking 2 w and 1 d? 27/182 Two letters picked without replacement from {n: 1, f: 1, z: 4, t: 1, l: 4, v: 1}. What is prob of picking 1 z and 1 f? 2/33 Calculate prob of picking 1 p, 1 b, and 2 v when four letters picked without replacement from {g: 7, p: 3, v: 4, b: 2, k: 1}. 9/595 What is prob of picking 1 p and 2 e when three letters picked without replacement from ppeep? 3/10 What is prob of picking 1 e and 1 l when two letters picked without replacement from lleleleeleelellleel? 10/19 Two letters picked without replacement from hpttmtmmtppmffmmmmf. Give prob of picking 1 t and 1 p. 4/57 Three letters picked without replacement from yoyzyooyyyyhoyoy. Give prob of picking 2 y and 1 z. 9/140 Calculate prob of picking 1 x and 1 a when two letters picked without replacement from {x: 1, a: 1, e: 2, y: 1}. 1/10 What is prob of picking 3 r and 1 y when four letters picked without replacement from {r: 3, y: 1, f: 1, l: 10}? 1/1365 Calculate prob of picking 2 u and 2 p when four letters picked without replacement from {p: 11, u: 2}. 1/13 Three letters picked without replacement from {z: 1, i: 2, a: 1, j: 2, r: 1, c: 1}. Give prob of picking 1 i and 2 j. 1/28 Wh	{ "pile_set_name": "DM Mathematics" }
o - 3k, -qo + 3k = 2292. Find the common denominator of -75/2 and 2/(-12)o/6. 4 Let j = 887/2 - 432. Let o = 0 - 0. What is the common denominator of j and (-43 + o/1)/8? 8 Suppose 3d = d + 2. Suppose 0 = -3x - d - 2. What is the common denominator of 103/10 and (x + (-154)/10)/(-4)? 10 Let t be (-6)/27 + 499/2232. Let m = t + -19349/3720. What is the common denominator of -19/9 and m? 45 Let l = -4814 - -2524. Let h be -1 + 1 + -3 + l. Let q = -13625/6 - h. Find the common denominator of q and -15/4. 12 What is the smallest common multiple of 72/21 - 4/(-7) and 6? 12 What is the common denominator of 302/24 + (-1)/3 and 303/36 - (-12)/16? 12 Let a = -13866297479/28 - -495078432. Let i = a - -146397. Let u = 446/7 + i. Find the common denominator of u and -23/8. 8 Find the common denominator of -79/74 and 42/(-616)(-144)/(-3). 814 Let m = 2714 + -73286/27. Find the common denominator of -5/6 and m. 54 Calculate the smallest common multiple of 6 and 297/15 + 7/35. 60 Let x = -7559 - -37912/5. Let z = 23 - x. Calculate the common denominator of z and -50. 5 Suppose 4r + 10 = 5q - 35, 2q = -5r + 18. Calculate the lowest common multiple of 10 and q. 90 Let m be 2148/(-99) + 6/27. Let h = m + 268/11. Find the common denominator of -1/5 and h. 45 Let q(s) = -6163s*2 + 2s + 1. Let g be q(-1). Let n = g - -36865/6. What is the common denominator of n and ((-2)/15)/(8/(-10))? 6 Let p be 152/56 + (-2)/(-7). Suppose -pw + 66 = 3v, v + 3v = -3w + 70. What is the smallest common multiple of w and 6? 18 Let a(m) = 19m3 - m2 + 1. Let j be a(1). Let q be 1/((-58)/j + 3). Let y = q - -74/3. What is the common denominator of -73/6 and y? 6 Let b be 34489/(-6) - (0 - -3). Suppose -4z - 11618 - 11290 = 0. Let r = b - z. Find the common denominator of r and -41/6. 6 Let a = 563 + -1221/2. What is the common denominator of a and ((-166)/6 + 0)/(240/(-90))? 8 Let c = -4139 + 33061/8. What is the common denominator of c and (-492)/140 + 4/(-14)? 40 Let w be 9/(-6) + (-194666)/(-32). Let y = w - 6085. Let t = 270/7 + -3569/84. What is the common denominator of y and t? 48 Suppose 5h - 311 = -3p, 5p - 3p + 4h = 204. Let c = p + -1345/12. What is the common denominator of c and -29/4? 12 Let g(o) = -2o - 18. What is the least common multiple of 16 and g(-11)? 16 Let b be (-2)/6 - 35/(-15). Let u be b - 2553582/80. Let k = u + 6386. What is the common denominator of k and -67/16? 80 Let x = -97 - -108. Suppose 0 = -4a + 19 + 1. Suppose 18 = 2r + 4c, -r + c = -c - a. Calculate the lowest common multiple of x and r. 77 Suppose m - 7 - 9 = 0. Suppose 3n + n - m = 0. Calculate the smallest common multiple of n and 8. 8 Suppose 0 = c - 6c + 4425. Let y = c + -3172. Let t = y - -18259/8. Calculate the common denominator of t and 87/10. 40 Suppose -4k + 41 = r, -3k + k - 3r + 23 = 0. Calculate the smallest common multiple of k and (-96)/82/(-4). 30 Let l = 2117/2828 + -476/101. What is the common denominator of l and -25/12? 84 Suppose -2y - 5 + 0 = -j, y = 4j + 8. Let r(s) = -5s. Let g = -83 - -87. Calculate the least common multiple of g and r(y). 20 Let d be (4/1448)/(3/(-2)). Let l = 35287/4344 - d. Find the common denominator of 29/8 and l. 8 Let l = -9341/3520 - 9/320. Let r = 2/1147 - 152587/20646. Find the common denominator of l and r. 198 Let p = 44/15 - 111/10. Find the common denominator of p and 67/12. 12 Let i = -5 - -4. Suppose -4f - 15 = 13. Calculate the least common multiple of 9 and f(0/1 + i). 63 Let z = 611/315 + 6/35. Suppose -5p - 128 = 2h + 12, 0 = 5p + h + 135. Calculate the common denominator of z and 3 - ((-38)/p + -2). 117 Let z = 159/13 + -2643/130. Let i(y) = 2y - 1. Let n be i(2). Find the common denominator of z and (n/6)/(20/(-138)). 20 Suppose 0 = -3s + 7s - 200. Let m = s + -28. Calculate the least common multiple of m and 12. 132 Suppose -5o + 3o + 2c = -12, 3o - 4c - 20 = 0. Suppose 0 = -oh - 3k + 46, -5 = -4k + 3. What is the lowest common multiple of 7 and h? 70 Suppose -w + 2l = -1884, -l - 2313 = 3w - 7937. Let k = w + -15041/8. Calculate the common denominator of -81/2 and k. 8 Let p = -74929/3432 - 1/1144. What is the common denominator of p and 37/4? 12 Let x = -2980 + 35623/12. What is the common denominator of x and -8/3? 12 Let p = 276697/35030 + 4/3503. Calculate the common denominator of 2-1112/44 and p. 110 Let d(q) = q2 - 6q + 8. What is the lowest common multiple of d(6) and 3? 24 Suppose -4l = 5h - 297, -l = 4h - 231 - 11. What is the least common multiple of 10 and h? 610 Let p = 41 + -21. Suppose p = -0y + 4y. Suppose 0 = yj - 8 - 12. What is the lowest common multiple of j and 2? 4 Let q = 43 - 23. What is the common denominator of (-24)/q225/(-66) and -11/10? 110 Suppose 0 = -4l + 29 + 71. Let j = l - 73. Calculate the common denominator of 57/22 and ((-1)/3)/(j/(-873)). 176 Suppose -2b + 8b + 60 = 0. Calculate the common denominator of ((-11)/b)/(2/6) and -51/22. 110 Suppose 3o + 0m = -4m - 4, -8 = o + 3m. Let d(a) = a*2 + 0a + o + 3a - 5 + 3. What is the least common multiple of d(-3) and 9? 18 Find the common denominator of 56/9 and 1/((18/142)/(-3)). 9 Let x = 3/488 - 1053/122. Calculate the common denominator of 13/3 and x. 24 Let o = -37 - -67. What is the smallest common multiple of 12 and (-36)/15o/(-4)? 36 Calculate the smallest common multiple of 5 and 3 + -4 + 2 + 12. 65 Let j(t) = 3t2 - 2t - 1. Let a be j(-2). Suppose -4s + s = a, -4n - 5s = 1. What is the smallest common multiple of 16 and n? 48 Suppose -5w + 5s = -0w - 125, 4 = -4s. Calculate the lowest common multiple of w and 3. 24 Let w(h) = -h3 + 10h*2 + 13h - 22. Calculate the least common multiple of 10 and w(10). 540 Let f = 524/2761 - 2/251. Calculate the common denominator of f and 9/4. 44 Suppose 0t + t = 1. Let f be (t/(-2))/(1/14). Let w(d) = -d2 - 4d + 5. What is the common denominator of 73/10 and w(f)? 10 Let c = 27 - 19. What is the common denominator of 21/8 and 4/2 + (-85)/c? 8 Suppose -103j - 16 = -107j. Calculate the smallest common multiple of 4 and j. 4 Let t(n) = n*2 + 2n - 2. Let c be t(2). Suppose o - c = 14. Calculate the lowest common multiple of 24 and o. 120 Let o = 211/126 + 3/14. Find the common denominator of 16/27 and o. 27 Suppose -i = h - 11, 2i + 31 = 3i - 4h. What is the lowest common multiple of i and 20? 60 What is the common denominator of (-25)/4014/(-5) and -29/38? 76 Let b = 9 - -11. Let n(i) = i*2 - 9i + 12. What is the lowest common multiple of b and n(10)? 220 Suppose -4v - 25 + 9 = 0. Find the common denominator of v/4 + 170/(-36) and 0 - 1 - (-315)/110. 198 Suppose w + 753 - 203 = 0. Let n = w - -1591/3. What is the common denominator of n and 18/7? 21 Let a = 8 + 19. Let q be ((-2)/(-70))/((-1)/a). Let j = q + -13/35. Calculate the common denominator of 41/7 and j. 7 Let z = -559 + 1155/2. Find the common denominator of z and 111/22. 22 Let t = 13 + 59. Suppose 4r + 3i = 65, 3r + 24 - t = -2i. What is the least common multiple of r and 18? 126 What is the common denominator of 37/20 and (-50)/16 + (-14)/(-7)? 40 Let t be (0/(-1 - 1))/2. Suppose 3r = -6, tr - 20 = 4x + 2r. Let a = -1 - x. What is the lowest common multiple of 11 and a? 33 Suppose 0 = -2f + 2, 3q - f - 15 = 2. Calculate the lowest common multiple of q and (1 - (0 + 0))3. 6 Let a = 29 - 26. What is the least common multiple of a and 94/18 + (-10)/45? 15 Suppose -76 = -4c + 5s, 4c - 66 - 46 = -4s. Let a(p) = 7p - 1. What is the smallest common multiple of c and a(1)? 24 Let u(o) = -595o + 3. Suppose 0 = -0p + 2p - 5a - 6, -p = 4a + 23. Let z be u(p). Let q = z - 29123/7. What is the common denominator of q and 20/3? 21 Suppose 3 = 2s - 5. Let y(q) = q2 + 7q + 5. Let h be y(-6). Let c = h - -9. What is the least common multiple of c and s? 8 Let y(v) = -v*3 - 4v*2 - 2v - 4. Let n be y(-4). Suppose -7 + 63 = -nx. What is the lowest common multiple of 26/7 + (-4)/x and 5? 20 Let q(l) = l3 + 7l*2 + 8l + 8. Let z be q(-6). Let s be (-4)/(-3)(-1 - z). Let v = 6 - s. Calculate the smallest common multiple of v and 8. 8 Let k = 5 + 1. Suppose n - kn = -55. Suppose 3*p + 15 - 48 = 0. What is the smalle	{ "pile_set_name": "DM Mathematics" }
- 2y - 23 wrt y. -36uy + 21297498y What is the second derivative of -652949w5 - 3w*2 - 120376368w wrt w? -13058980w3 - 6 Find the third derivative of 23112490i*4 - 2346i*2 - 2605 wrt i. 554699760i What is the second derivative of -249307643m2 + 2m - 83538221 wrt m? -498615286 What is the second derivative of -104349506q2 + 7923381q? -208699012 Find the second derivative of -144n2r*3 + 1972n*2r + 1386499nr*3 - 63568nr wrt r. -864n*2r + 8318994nr What is the second derivative of -14c2g*2o - 4634933c2go + 182cg2o - 3cgo + 4o - 8715 wrt c? -28g2o - 9269866go Find the third derivative of -13037480y4 + 17y*2 - 2y + 6432 wrt y. -312899520y What is the third derivative of 34798995a*3 - 2a*2 - 59a - 322? 208793970 What is the first derivative of 584j3 + 109602j*2 - 150107505? 1752j*2 + 219204j Find the third derivative of -785601562q4 - 1330q*2 + 207q + 153. -18854437488q What is the third derivative of -70l*6 - 2l*4 - 151477l*3 + 3l*2 + 62l - 81137? -8400l3 - 48l - 908862 Find the third derivative of -216700776g3 + 1051083402g*2. -1300204656 What is the second derivative of 7285252h*2 - 203h - 5894 wrt h? 14570504 What is the second derivative of 837940355t5 + 241543614t wrt t? 16758807100t3 What is the second derivative of -h2q*2y*2 + 11h*2q*2 - 334h*2y + 105hq*2y*2 + 31hq2y - hqy*2 - hy*2 + 3h - 2q wrt h? -2q*2y*2 + 22q*2 - 668y Find the third derivative of 40g4 - 2846576g*3 - 78g*2 - 328g - 24. 960g - 17079456 Find the second derivative of -11043104l*5v + 8l - 616543v wrt l. -220862080l3v What is the derivative of cu2 - 25409cu + 68c + 9354194u2 wrt c? u2 - 25409u + 68 Find the first derivative of -10616411h2 + 2586496 wrt h. -21232822h Find the second derivative of -372264825z5 - 286868540z wrt z. -7445296500z3 What is the second derivative of -166251044x*2 + 172216730x? -332502088 Find the third derivative of 13784653m4 + 61714507m*2 wrt m. 330831672m Differentiate -3299c2h - 6c2p + 48c2z + 507hpz + 3hp - 1144h + pz with respect to c. -6598ch - 12cp + 96cz What is the second derivative of -48665719y*2 - 368y + 10151 wrt y? -97331438 Find the third derivative of 123490d4 - 925d*3 + 12122754d*2. 2963760d - 5550 Find the second derivative of -170112269v2 - 499114v + 1. -340224538 Find the third derivative of -34489341s2y*3 - 170s*2y*2 + 27s*2y + 6s2 + 16y*2 + 3y wrt y. -206936046s2 Differentiate -1054099r*3 - 22r*2 + r - 73131200. -3162297r*2 - 44r + 1 What is the second derivative of -1297244190s4 + 55213s + 350? -15566930280s2 Find the third derivative of -9u*5z - 84499u3z*2 + 128u*2z2 - u2z - 2uz2 + uz + 6u wrt u. -540u*2z - 506994z2 Find the second derivative of -704455r4 + r3 + 15r - 628193. -8453460r*2 + 6r Differentiate -150769d2xz - 22d*2z + 2d2 + 19dx - 28dz + 49d - 2z + 47 wrt x. -150769d*2z + 19d Find the second derivative of -9726621h*4 + 2h*3 + 178180285h. -116719452h2 + 12h Find the third derivative of -410k6 + 151396k*5y - 2k2y + 37k2 - 114513ky wrt k. -49200k*3 + 9083760k*2y What is the second derivative of -19154037y2z*2 + 692yz2 - 37yz - y - 3z*2 + 1 wrt y? -38308074z*2 Find the second derivative of 615i*2l*2w*2 + 5663i*2w*3 + 4il2w*3 + il*2w - 895ilw3 - 34l*2w - 9w2 wrt i. 1230l*2w*2 + 11326w*3 What is the first derivative of -15807337v - 3268241 wrt v? -15807337 What is the third derivative of 126l5 + 148l*4 - 19l*3 - 5058779l*2 wrt l? 7560l*2 + 3552l - 114 Find the second derivative of 9383n5t - 37n4t + 24011427nt wrt n. 187660n3t - 444n2t Differentiate 64998iq*2 + 4287957i + 81q3 + 4 wrt q. 129996iq + 243q*2 Find the second derivative of -23340555h*3 - 2013h - 16915 wrt h. -140043330h Find the second derivative of -40b*2k*2 + 594160b*2v*2 - 18bk2v*2 + 295068bk2 - 39k*2v*2 wrt b. -80k*2 + 1188320v*2 Find the third derivative of 6f*3m + 3875669f3 - 2377f*2m - 17221f2 wrt f. 36m + 23254014 Find the second derivative of -9p5u + 19689227p4u - 276pu + p - 801u - 19 wrt p. -180p*3u + 236270724p2u Find the third derivative of -29805325g3 + g2 + 44g - 19427 wrt g. -178831950 What is the second derivative of 138024g4 + 2g*3 + 100g*2 + 33690g + 270 wrt g? 1656288g2 + 12g + 200 Find the second derivative of 25755o4 + 833o3 - o2 - 787024509o. 309060o*2 + 4998o - 2 What is the derivative of 157f2 - 17640f - 31646039? 314f - 17640 Find the second derivative of -550828607n*2 + 14n + 1524999. -1101657214 What is the second derivative of 759576750z2 - 111z - 907827? 1519153500 Find the third derivative of 8932550c6x + 8c2x - 7126c2 + 4c wrt c. 1071906000c3x Find the second derivative of 17610b3lu - 61b*3l - 122b3u*2 - 13blu*3 + 379u*2 wrt u. -244b*3 - 78blu + 758 Find the third derivative of -4w6 - 41w*5 + 534w*3 + 43w*2 - 65000w wrt w. -480w3 - 2460w*2 + 3204 Find the second derivative of 84695374rv2 + 5rv + 25r + 2v4 + v + 1434 wrt v. 169390748r + 24v2 Find the second derivative of -88i*3w + 678644i2w - 195iw - 42i + 16w - 8 wrt i. -528iw + 1357288w Differentiate 879625588l*4 + 111304309 wrt l. 3518502352l*3 Find the third derivative of 1348c*4 + 1559c*3 + 21081c*2 - 3c - 211. 32352c + 9354 Find the first derivative of -26872844uz + 19060115u wrt z. -26872844u Find the third derivative of -97329404b*3 - 24b2 - 385172. -583976424 What is the first derivative of -h4 - 43096h2 + 46h + 102520514? -4h3 - 86192h + 46 What is the third derivative of 9418k4 - 383k*3 + 420584k*2 + 20k? 226032k - 2298 What is the third derivative of 5862399d*6 - 10d*3 + 271d*2 + 20343d + 8 wrt d? 703487880d3 - 60 Find the second derivative of 136440331g*2 + 69g + 331515. 272880662 Differentiate -58747fh*3t + 19fh*3 - 81h*3t + 2h3 - 258h + 3t wrt f. -58747h*3t + 19h3 Differentiate 17755175l + 50471251 with respect to l. 17755175 Find the second derivative of 28740144k5 - 1286k + 4987 wrt k. 574802880k3 What is the second derivative of 42202641d*4 + 61342d - 103? 506431692d2 Find the first derivative of 393943658m*2 + 176503843. 787887316m What is the second derivative of -2608944h4z*3 + 4h*2z*3 - 2hz2 + 12110557z*3 wrt h? -31307328h*2z*3 + 8z*3 What is the derivative of 51q4 + q3 + q*2 - 7147q + 11204228? 204q3 + 3q*2 + 2q - 7147 What is the derivative of -2a2 + 13946639an + 631n - 13120 wrt a? -4a + 13946639n Find the second derivative of 34388r5 - 3020r*3 + 288235086r. 687760r3 - 18120r What is the second derivative of -109598043v5 - 189082410v wrt v? -2191960860v3 What is the second derivative of -26875303h4 - h2 + 6400296h? -322503636h*2 - 2 What is the second derivative of -1758039c*4 + 3c*2 - 34c - 168494 wrt c? -21096468c2 + 6 What is the derivative of -11988860j - 15213466? -11988860 Find the second derivative of 111858069j3y2 - j3y - 6j*3 - jy*2 - 5155jy - 86j - 2 wrt y. 223716138j3 - 2j Differentiate -139652d2it2 - 388d*2i - 3d2t - 2d2 + 9di + it - 1669i - 2 with respect to t. -279304d*2it - 3d*2 + i What is the derivative of -24083b*2 + 1777bz - 2b - 773110666z wrt b? -48166b + 1777z - 2 Find the second derivative of 24878919b*2 + b + 15897600 wrt b. 49757838 Find the third derivative of -77964376fg3 - 37686fg2 + 2fg + 2g*2 - g - 4 wrt g. -467786256f What is the third derivative of 5533710x5 + 17x*4 + 4x*2 - 713938x wrt x? 332022600x2 + 408x What is the first derivative of -201020905h2 + 59754098? -402041810h What is the second derivative of -96528071i3 - 20i - 954755? -579168426i Differentiate -207623aq - 266918a - 249q + 108 wrt q. -207623a - 249 Find th	{ "pile_set_name": "DM Mathematics" }
)/(-32)). Let c be (-48293)/(-210)(-5)/r. Let o = c - -751/8. What is the common denominator of o and -2/15? 90 Let v(c) = 2c*2 - 7c - 235. What is the lowest common multiple of v(-25) and 630? 10710 Let q = -37 - -40. Suppose 0 = -2t + qt + 80. What is the common denominator of -47/2 and (-188)/(-14)(-6)/t? 140 Let t = 6696713/54582768 + -1/252698. Find the common denominator of t and -151/192. 1728 Let o = 68 + -65. Suppose l = -ot + 5, 0 = 2t - 2 - 0. Calculate the lowest common multiple of 28/(-42)(l-1 + -7) and 2. 6 What is the lowest common multiple of (275/(-77))/5 - (-771)/21 and 614? 11052 Let f be (39/(-15) + 3)30/1. Suppose -f = m - 18. Let a(q) = -q + 2. Calculate the lowest common multiple of a(-5) and m. 42 Let z be 12/(-16) - ((-47)/4 + -1). Suppose s = -4s + 10. What is the smallest common multiple of ((-76)/z + 4)/((-1)/3) and s? 14 Suppose -27 + 9 = 3w. Calculate the smallest common multiple of w(-4 + 1 + 2) and 148/16 + -7 - (-1)/(-4). 6 Let s = 2112/29 + -14092801/193488. Calculate the common denominator of 71/2 and s. 6672 Let u(n) = n3 + 5n*2 - n + 4. What is the least common multiple of u(-5) and ((-1)/4)/((-1)/126)(-55660)/(-19481)? 90 Suppose -391 = -r - 367g + 368g, 4g = -2r + 776. What is the lowest common multiple of r and 1092? 5460 Calculate the common denominator of ((-7775)/19593)/(8/(-7)) and (5/(-10))/(22/29). 792 Let w(g) = g*2 + g - 15. Let d be w(-6). Suppose 2b + 2r - 24 = 0, -d = 4r - r. Suppose -by = -12y - 10. Calculate the lowest common multiple of 5 and y. 10 Let s(k) = k*3 - 104k*2 - 209k + 43. Calculate the lowest common multiple of s(106) and 2527. 2527 Let l = -18843 + 18845. What is the least common multiple of (-2)/(-5) - (-3)/5 and l? 2 Suppose -5m - 5o + 515 = -700, 749 = 3m - o. Calculate the smallest common multiple of m and 232. 7192 Let q = -73 + 599. Suppose 524x = qx - 84. Calculate the lowest common multiple of x and 14. 42 Let a = 87 + 337. What is the common denominator of ((-2)/4)/(72/a) and -11/16? 144 Let v = -48855782/1929 + 25327. Let q = 129265/42438 - v. Let b = -310/3 + 463/4. What is the common denominator of b and q? 132 Suppose -5s = -10, -2l - 4s = -0 - 12. Find the common denominator of 71/33 and 8/l - 4/((-108)/57). 99 Suppose -2556 = -4h + 4r, 3r = -h + 523 + 104. Calculate the lowest common multiple of h and 195. 41340 Let f(v) = -2v + 69. Let m be f(21). Suppose -33 = -4x + m. What is the lowest common multiple of x and 30? 30 Suppose 2j - 4w + 96 = 0, 0 = 4j + 4w + 105 + 75. Let v = 52 + j. Calculate the lowest common multiple of v and -15(4 - 56/12). 30 Let p = 4621 + -6731. Let f = 42227/20 + p. Let z = 185021/18 - 10283. Calculate the common denominator of z and f. 180 Let m = 1 + -1. Suppose m = -3s - 5s + 488. Suppose 99 = 5v - s. Calculate the least common multiple of 8 and v. 32 Let z = -9937/900 - -229/20. Calculate the common denominator of z and 143/2850. 8550 Suppose -2c + o = 3c + 329, 0 = o + 1. Let n = 1119 - 811. Find the common denominator of -89/24 and (-758)/c - (-7)/(n/8). 24 Calculate the smallest common multiple of 2772 and (-926)/(-1) - (19 - 85/5). 2772 Let i(o) = o - 17. Suppose 0 = -2q + 3q - 3. Let a be i(q). Calculate the common denominator of 61/4 and ((-17)/(-6) + -3)/(a/(-102)). 28 Let f(k) be the second derivative of -k4/12 - 2k*3 + 5k*2/2 + k. Let p be -5 - (5 - (-8 - -6)). What is the lowest common multiple of 10 and f(p)? 10 Suppose u + 674 = 2x, x + 1765 - 397 = -2u. Let l = 913 + u. Calculate the lowest common multiple of 84 and l. 924 Calculate the common denominator of (-328)/2030/180 and 47/4. 60 Suppose -49v + 50v = 44. Calculate the least common multiple of 345/9 + -3 + v/12 and 8. 312 Let o(q) = -4q3 + 3q*2 - 11q - 42. Calculate the smallest common multiple of 259 and o(-3). 4662 Let b = 27627 + -27617. Calculate the lowest common multiple of 404 and b. 2020 Suppose -5h + 69 = -11. Let i = 24980 - 24958. What is the smallest common multiple of i and h? 176 Let i(x) = -x3 + 17x*2 + 16x + 40. Let c be i(18). Suppose cz = -0z + 172. Calculate the lowest common multiple of 1/2z - (-21)/(-42) and 24. 168 Let q(p) = p2 - 11p + 25. Let n be q(8). Suppose -4x + 50 = 5o, 5x - 32 = -4o - n. What is the lowest common multiple of 82 and o? 574 Suppose -8964 = -70t + 78396. What is the smallest common multiple of t and 3? 1248 Suppose k + 5g + 6 - 104 = 0, 0 = 2k - 3g - 170. Calculate the lowest common multiple of -1 + 4 + 1 + 8360/k and 75. 2475 Suppose 36l = 15 + 849. Calculate the lowest common multiple of l and 68. 408 Let l = 73139863/14829360 + 4736/6305. Let u = -5090629/147 + 34630. Let w = u - l. Calculate the common denominator of -23/16 and w. 16 Let b = 43107 - 18827. Let z = 436897/18 - b. Calculate the common denominator of -33/4 and z. 36 Find the common denominator of 77/846 and ((-6006)/396)/(6/(-4)) + -5. 846 Let s(v) = 153v*2 - 6v - 12. What is the least common multiple of 8 and s(-2)? 1224 Suppose 112y = 100y + 14904. Calculate the common denominator of y/162(-3)/166 and 2/(-3)174/80. 1660 Suppose 0 = -3s + 1337 + 217. What is the least common multiple of 7 and s? 518 Find the common denominator of 16/1083 and 2/(-57)(-4 - 912/32). 1083 Let w = -4185707/66 + 63421. What is the common denominator of 83/5580 and w? 61380 Suppose 41h - 15081 - 14619 = -58h. What is the lowest common multiple of 420 and h? 2100 Let p = -12545/7 - -1789. Calculate the common denominator of p and ((-1)/162)/((-1 - -2)27/(-783)). 1134 What is the common denominator of 5/109550953 - (-154)/2695 and 23/8? 2504 Find the common denominator of 81/8 and (254793/(-36480))/11 + (-6)/(-10). 2432 Let c be (-1)/(-4 - 29/(-7)) - 0. What is the common denominator of 662/720 - c/((-140)/(-8)) and -83/90? 360 Let t = 99746048155/21133 - 4719919. Let f = 37583603/21133 + t. Let v = f - 1771. Calculate the common denominator of -16/35 and v. 35 Let x = -43 - -73. Let f(i) = -4i2 - 364i + 3188. Calculate the least common multiple of f(-99) and x. 60 Suppose 104 = 5u + 8c - 12c, -2c + 38 = 2u. Find the common denominator of ((-5304)/2380)/(54/u) and -40/7. 63 Let a = -106 - -129. Suppose an - 18n = -15, 0 = -l + 2n + 7. Suppose -4q + 24 = -0q. Calculate the smallest common multiple of l and q. 6 Let p = -10978808391/5060 + 2169725. Find the common denominator of p and -125/6. 15180 Let m be (-15523710)/(-144)(-2)/20. Let p = m - -10778. Let z = 4319 - 25999/6. Find the common denominator of z and p. 48 Let w be ((-576)/(-1096))/3(-10)/8. Let j = -5852/2055 + w. Find the common denominator of j and 5/33. 165 Calculate the common denominator of (8 - 0) + (6159/(-348) - (-27 - -18)) and 45/8. 232 Suppose k + 5 = 29. Suppose 2u + 59 = 197. Suppose 2i + u - 123 = 0. What is the smallest common multiple of i and k? 216 Let x be -3 + 3/(153/1578). Let v = -69503321/3939750 - -44/115875. Let g = x + v. Calculate the common denominator of -19/30 and g. 30 Let g = -4123769/2570 - -5366/257. Let t = 1590 + g. Find the common denominator of 9/100 and t. 100 Let f(a) = -11a3 - 13a*2 - 13a + 4. What is the smallest common multiple of f(-3) and 16? 3568 Let c(r) = -1800 + r2 + r2 + 1794 - 8r. What is the least common multiple of (-2)/3 + 56/21 and c(-1)? 4 Suppose 0 = -b + 2v + 53, 59 = b - v + 5. What is the smallest common multiple of (-2)/(-8) + b(-27)/(-60) and 35? 175 Suppose 0 = -4g - 31y + 34y + 1497, 5y + 370 = g. What is the smallest common multiple of g and 1000? 3000 Let b = 12964 + -233329/18. Calculate the common denominator of b and (2 - 3)11/(-2). 18 Let x = 204333/133 + -10740/7. Find the common denominator of x and 17/1198. 22762 Let z = 124 + -136. Let u(g) = -9g - 16. What is the smallest common multiple of 1 + 7 + z/(-4) + -7 and u(-6)? 76 Let y(o) = o2 + 53o - 534. Calculate the lowest common multiple of 76 and y(26). 1520 Let b = 679/16 - 9941/240. What is the common denominator of 61/618 and b? 6180 Let k = 162251/57816 - 5/6424. Find the common denominator of k and 97/4680. 4680 Let q = -16265675/6009624 - 7131/3496. Let j = -9/91 - -2265/17381. Let b = j - q. Calculate the common denominator of 63/2	{ "pile_set_name": "DM Mathematics" }
ding order. g, 2, 4 Let d(b) = 2b2 + 28b + 4. Let t be d(-14). Put t, 1, 0 in ascending order. 0, 1, t Let g be (42/(-60) - -1)5/6. Sort g, -0.1, 0.5. -0.1, g, 0.5 Let p be (1 - -1 - 2) + 4. Suppose -ph = 2a - 8, h + 1 = 2a + 3. Put 3, h, -1 in ascending order. -1, h, 3 Let o = -24 + 22.9. Let v = -0.6 - o. Sort -4, -1, v in ascending order. -4, -1, v Let f = 1.4 + -1.5. Let s = 53 + -157/3. Let w = -0.1 - -0.3. Sort w, s, f in ascending order. f, w, s Let x = 2 + -4. Sort -4, -14, x in descending order. x, -4, -14 Let f = 6 + -3. Put 4, f, 2 in descending order. 4, f, 2 Suppose -2u = 2u - 208. Let r be u/14 + (-6)/(-21). Suppose -ry - 5 - 11 = 0. Put y, 1, 4 in descending order. 4, 1, y Suppose -4m + 2 - 6 = 0. Let h be m/3(-6)/20. Sort 0.3, h, 3/5 in decreasing order. 3/5, 0.3, h Let v = 22 - 31. Let s = v - -8.7. Sort -4, -0.1, s in decreasing order. -0.1, s, -4 Suppose 0k + 4k - 4j - 28 = 0, 5k - 26 = 2j. Put k, 2, 1 in decreasing order. k, 2, 1 Let d = 5 - 15. Let x = d + 14. Let z = 8 + -8.3. Put -3, z, x in descending order. x, z, -3 Let j = -0.45 - -4.35. Let r = -4 + j. Let p = -0.05 + 2.05. Sort r, p, 1/5. r, 1/5, p Suppose -6b - 58 - 26 = 0. Let n = -16 - b. Sort -3, n, -1 in descending order. -1, n, -3 Let j = -1 + 6. Let c = 0.03 - -0.05. Let p = c + 0.32. Put p, -4, j in decreasing order. j, p, -4 Let c(w) = -w2 - 7w - 20. Let z be c(-6). Put z, 2, 4, -4 in ascending order. z, -4, 2, 4 Let z = -48 + 47. Sort -4, -4/3, z. -4, -4/3, z Let c = 3 + -1. Suppose -w - 3w + 20 = 0. Let z(r) = -r - 10. Let g be z(-7). Put g, c, w in increasing order. g, c, w Suppose 0p + 3p + 6 = 0. Let l = 0.072 - -22.628. Let f = -23 + l. Put 0.4, p, f in decreasing order. 0.4, f, p Suppose 3c = -3k - 21, c - 5 = -4c + 3k. Put -3, c, 3 in decreasing order. 3, c, -3 Let i be (-9)/1 + 1 + -1. Let w = -13 - i. Suppose -29 = -5s - 14. Sort s, -1, w. w, -1, s Let p be 2/9 + 40/63. Sort -2/11, 5, p in descending order. 5, p, -2/11 Suppose -2l + 5l + 12 = 0. Let g = 9 + 1. Suppose 2u = -2b + 12, g - 37 = -5u - 4b. Put 0, u, l in descending order. u, 0, l Let z = 1.5 - 1.2. Sort -3, 1/4, z in decreasing order. z, 1/4, -3 Let b(c) = c - 2. Let x be b(5). Suppose -2 = xw - 8. Put w, 4, -2 in increasing order. -2, w, 4 Let i(f) = f2 + 6f + 3. Let y be i(-6). Put y, 2, 6, -5 in increasing order. -5, 2, y, 6 Let v(i) = i + 8. Let s be v(-5). Sort -5, s, 13. -5, s, 13 Let a = 3.99 + 1.01. Put 0.2, a, 6/23 in descending order. a, 6/23, 0.2 Let t = -4 - -4.05. Let o = -6.95 - t. Let g = o - -4. Put 1/8, 1, g in increasing order. g, 1/8, 1 Let g = -1 + 0.5. Let w = g + -0.5. Let n = -27/7 - -263/70. Put n, -2, w in descending order. n, w, -2 Let p = 0 - 1. Let o be -31/(-3)(-30)/(-6). Put p, 2, o in ascending order. p, 2, o Suppose 3i - 8 = 4. Suppose -i = 3j - 1. Sort j, 4, -4. -4, j, 4 Let r be (-34)/(-8) + 7/(-28). Suppose b - 5p = 4b - 19, 2b + 2 = 4p. Let v(t) = 3t - 4. Let y be v(b). Sort r, -1, y in decreasing order. y, r, -1 Let f(s) = -s3 + s2 + 9. Let h be f(0). Let w be 6/(3/(h/6)). Put 5, w, -5 in increasing order. -5, w, 5 Let y = 6.984 - -0.016. Sort y, 0.3, 4. 0.3, 4, y Let l(y) = -y3 + 3y*2 - 2. Let u be l(2). Suppose 15 = -3v - 2v, 5b + 2v = -11. Sort u, b, 3 in descending order. 3, u, b Let a = -0.22 + 0.22. Sort 0.4, -5/3, a in decreasing order. 0.4, a, -5/3 Let k be 2 + -3 + (3 - 2). Put -3, 3, k in decreasing order. 3, k, -3 Let h = -53/4 + 25/2. Put 1, h, 2/83 in increasing order. h, 2/83, 1 Let i = 53 - 57. Sort 2, 2/7, i, 5/4. i, 2/7, 5/4, 2 Let w = 1.94 + 0.06. Let g = 2.1 - w. Let n = 0 + g. Sort n, 3, -2/3 in descending order. 3, n, -2/3 Let d = 21 + -22. Sort 4, d, -2. -2, d, 4 Suppose 5n - 2n - 14 = -u, -3n = -15. Let c = -3.5 + 0.5. Sort 0, u, c in decreasing order. 0, u, c Suppose 3j = 20 - 5. Let n be (-1)/((j/(-2))/(-5)). Put n, -5, 0 in decreasing order. 0, n, -5 Let d be (0 + 3/1)/1. Sort d, -1, -3. -3, -1, d Let b = 6 - 13. Let u = b - -6.7. Let y be 3 - ((-16)/5)/(-1). Sort u, -0.1, y in decreasing order. -0.1, y, u Let a(p) = -p3 + 9p*2 - 4. Let f be a(9). Sort -3, f, 4, -2. f, -3, -2, 4 Let p = -49.6 - -50. Let n = -0.24 - 0.06. Sort 3/4, p, n in descending order. 3/4, p, n Let q = -0.2 - -0.21. Let i = q - 0.01. Sort i, -2/11, -0.4 in decreasing order. i, -2/11, -0.4 Suppose -5q + 4q - 3h = 15, q + 5 = -h. Suppose -z + 1 = 2. Let v = q + z. Put v, 2, 0 in ascending order. v, 0, 2 Let g = -2.08 + 0.08. Let j = 2.3 + g. Let l = j - -0.1. Put l, -2/13, 0.2 in decreasing order. l, 0.2, -2/13 Let x = -3 - -3. Let l = 1 - -2. Put l, x, -2 in descending order. l, x, -2 Let r = -111 - -119.7. Let j = r - 9. Put 1, -5, j in ascending order. -5, j, 1 Let c(g) = 2g3 + 4g*2 + 3g - 3. Let q be c(-3). Let m = -21 - q. Let n = 4 - m. Sort n, -2, -3 in ascending order. n, -3, -2 Suppose -10 = 3p - 8p. Suppose 3a - 4 - p = 0. Sort a, -7, 4 in ascending order. -7, a, 4 Let n = 49 + -54. Let p = -1.9 - -0.7. Let l = p + 1. Put 0.2, n, l in descending order. 0.2, l, n Suppose 0m + 13 = 3d + 2m, 5d + 3m = 21. Let r = 11 + -9. Suppose 0 = 2w - 6, -2 = -rk + w - 3w. Sort k, d, 5 in descending order. 5, d, k Let z be (-4)/(-3)(-3 + 6). Let p = z + 0. Let m(c) = -c*3 - 5c*2 - 2c + 4. Let t be m(-4). Put p, t, 5 in decreasing order. 5, p, t Let h = -3 + 5. Let r = -7 - -2. Let p = r + 4.8. Put h, -3, p in ascending order. -3, p, h Let k be (30 - 18)1/2. Sort k, -2/5, 1. -2/5, 1, k Suppose 29 = 5j + 4. Suppose -4d - 4a - 28 = 0, 3d + a - ja = 14. Sort -1, d, 0 in descending order. 0, -1, d Suppose -3q + 25 = -8q. Let a(u) = -4u3 - u2 + u + 2. Let g be a(-1). Put g, q, -2 in ascending order. q, -2, g Suppose -2y + 2 = -2q, -3q + 2y + 0 = 5. Let o(p) = p + 1. Let r be o(q). Put r, -0.1, -1/9 in descending order. -0.1, -1/9, r Let m = -15.2 - 1.8. Let c = m + 22. Put c, -0.3, -1 in descending order. c, -0.3, -1 Let w(t) = t3 + 20t*2 - 2t - 36. Let z be w(-20). Put 0, 5, -5, z in increasing order. -5, 0, z, 5 Let v = -0.46 + 0.5. Let x = v + -0.07. Let d = -4.97 + x. Sort -0.3, d, -3/5 in increasing order. d, -3/5, -0.3 Let n be (-6)/96/2. Let f(m) = 3m - 6. Let b be f(5). Suppose -3h + 2h = q + 7, 3q - 3h + b = 0. Sort -3, n, q in ascending order. q, -3, n Suppose 3m + 2r + 19 = 0, 5r + 11 - 1 = 5m. Sort m, 5, -7. -7, m, 5 Let b be (11/22)/(1 - 2). Put 0, b, 1/5 in decreasing order. 1/5, 0, b Let q(u) = u*3 + 7u*2 + 11u + 2. Let v be q(-3). Put 3, -9, v in descending order. v, 3, -9 Let b = -9 + 7. Let k(f) = f*3 - 2f*2 - 4f + 2. Let v be k(3). Sort b, 1/8, v in increasing order. b, v, 1/8 Let f(h) = -4h2 + 2h + 2. Let c be f(-1). Sort -1, -3, c in decreasing order. -1, -3, c Suppose -22x + 13x - 9 = 0. Let l be (-2)/6 + (0 - -1). Put l, x, 1 in decreasing order. 1, l, x Let z = 3 - -2. Suppose -3i + i - 16 = 0. Let s = i + z. Sort -5, s, 1 in increasing order. -5, s, 1 Let z = 6 + -1. Let v be (4/6)/((-2)/(-6)). Let l(r) = r3 + 20r*2 - 20r + 20. Let c be l(-21). Put v, c, z in decreasing order. z, v, c Let w = 0 - -4. Let n = -0.13 + -4.87. Sort -2/3, w, n in decreasing order. w, -2/3, n Let r = 2 - 3. Let f = -1.33 - -0.13. Let x = f - r. Sort 2/5, 0.5, x in increasing order. x, 2/5, 0.5 Let p = -13/7 + 44/35. Sort p, 0.4, 0.2, 5 in descending order. 5, 0.4, 0.2, p Let m be 0 + (2 - (2 + -1)). Let r be (((-6)/(-1))/m)/2. Suppose -3t + t = 10. Sort 5, t, r in ascending order. t, r, 5 Let t be 3/6 - (-1)/(-2). Suppose 3d - 3 = a, 5a = -td + 3d + 9. Suppose 12 = 5o + s, -ao - 3s = -2s - 8. Sort 4, -1, o. -1, o, 4 Let m = -556.85 - -545. Let l = m + 7.8. Let n = l + 0.05. Sort n, -0.1, -0.4 in descending order. -0.1, -0.4, n Let j = 52 - 51.7. Put -2, j, 0.1 in descending order. j, 0.1, -2 Suppose 2n + 18 = 4b, -8 = -4n - 6b + 3b. Let x(f) = f + 4. Let m be x(0). Sort m, n, 5 in decreasing order. 5, m, n Let u(v) = 4v2 - v. Suppose -5b = -3b + 2. Let h be u(b). Suppose 3p - 5 = 4. Put p, 0, h in decreasing order. h, p, 0 Suppose -2x + 4n = -n - 23, -4x - 24 = 4n. Sort x, 6, 2. x, 2, 6 Let u = 1.3 + 0.4. Let b = -0.3 - u. Sort 0.1, b, 3 in ascending order. b, 0.1, 3 Let m be (-2)/7*(-56)/8.	{ "pile_set_name": "DM Mathematics" }
f + 30 for z. 3 Suppose -2w - 12h = -10h, 5w - 2h = 14. Solve 0 = -11s + 12s + 3d + 1, -2d - w = 2s for s. -1 Suppose 147t + 3i - 22 = 142t, 0 = -3t + 5i - 14. Solve 5j = tf - 1, 3f - f = -2j - 6 for j. -1 Let f(x) = x*3 + 17x*2 - 3x - 49. Let h be f(-17). Let r(c) = c*2 + 3c - 14. Let l be r(3). Solve 0 = -d + lb + 22, 5d = -b + 3 + h for d. 2 Let d(p) = -p*2 + 21p - 66. Let w(t) = t*3 + 8t*2 + 9t - 1. Let u be w(-6). Let r be d(u). Solve -3z - 18 = rz + 3n, -z = -4n - 1 for z. -3 Let z = 541 - 534. Suppose 4j = -0j + 28. Suppose a = m - j, 4m + 2 = -a - a. Solve mu = 4x + 4u - 22, -x - u = -z for x. 4 Suppose -2b + 25 = -3u, 2b - 8u = -11u - 5. Suppose 0 = -2z - 3k + 7, 5z + 1 = -4k + 15. Solve q + 3 + 1 = 3h, 3h - zq = b for h. 1 Suppose -15l + 1 + 104 = 0. Let n be 2((-6)/(-4) + l/14). Solve -3j - nc = j + 16, -4j + 5c = -20 for j. 0 Let l be 6/41748/138. Suppose -2o = -2d - o + 17, 2d = -o + l. Solve 0 = 2h - 8, -23 + d = -2r - 4h for r. -1 Let z = -30731 + 30736. Let w = 4 + -2. Solve 16 = 4b, -zb + 2 = -wg - 16 for g. 1 Let s = 39 - 22. Suppose 5i - 27 = -s. Suppose -5g + 25 = -8q + 3q, -2q + 32 = 5g. Solve 0 = -ip + 3p - 2j - g, -5j = -2p + 14 for p. 2 Let z = -57 + 57. Let q be 8/8 - (z + -1). Suppose -s + 5d - 20 = 0, -qd + 35 = 5s - 0d. Solve sn - 19 = 4r, -4r - 2 = 2 for n. 3 Suppose 42 = 2r + 4k + 14, -5k = 10. Let d(n) = -n3 + 18n*2 + 5n - 72. Let j be d(r). Solve 3 = -4o - v - 19, j = -2o - 4v for o. -5 Suppose 112 + 77 = 83c - 60. Solve -3m + 4o + 1 + 9 = 0, -3o + 3 = cm for m. 2 Suppose 109 + 493 = 2s. Suppose sk = 296k + 55. Suppose 5b = 27 - 17. Solve -2i = bh + 3 - k, 3i - 12 = h for h. 0 Suppose 6k - 11k = -10. Let a = -1054 - -1057. Solve 3p = 7p + ks - 18, 2p - 15 = -as for p. 3 Let v(w) = 28w + 201. Let s be v(-12). Let r be 18/s - (34/(-30) + -2). Solve 3x + r = q - 5q, 5q - 20 = x for x. -5 Let h = -6807 + 6807. Solve -5 = -5a, h = -s + 9a - 11a + 5 for s. 3 Suppose 2d - 5z = 18, 0 = 5d + 4z - 333 + 321. Solve -5u = 2t + 8, -6t - 20 = du - t for u. 0 Suppose 0 = 17k - 5k + 96. Let p be (-3 - (-25)/10)6 - k. Solve px - 4m = 3x, 0 = -3x - m + 14 for x. 4 Let i(q) = q*3 - 125q*2 - 100q - 3274. Let p be i(126). Solve -3 = m - x, -m - px + 5x + 3 = 0 for m. -6 Suppose 7t = 9t - 8. Suppose -1 = l, 3q + tl = -q + 48. Suppose qb - 9b = 16. Solve 5k + 2d - 9 = -d, 2d = -bk + 6 for k. 0 Suppose -4n - 2l - 12 = -34, -4n - 3l = -27. Let q be (n2/4)/((-2)/(-4)). Solve -4d - 3z - 8 = 0, -3z + 35 = -qd + 2z for d. -5 Let r be -5 + ((-1)/(-2))/((-3)/6). Let j be (2 - -2)/(8 + r). Let v be (j - -2)(-3)/(-6). Solve -c - 3u = vu - 10, -2c = -2u - 8 for c. 5 Suppose -5m + 4m + 3 = 0. Suppose -4b + 2t = -26, 2t + 5 = b + mt. Suppose 6 = bo - 6. Solve 1 = j + 3d, 7d - 4d = oj + 7 for j. -2 Let z be 246/7 - (6 - 287/49). Suppose z = 4t - d, -5t - 15 = -3d - 64. Solve 3h - 2k = -h - t, h + 5k - 9 = 0 for h. -1 Suppose -239 = -6x - 221. Solve -3p - 6 = -xy, y - 3p - 14 = 6y for y. -1 Suppose 41r = 44r - 15. Let v be (r/(-10))/((-1)/8). Let n(m) = -m2 + 7m + 80. Let x be n(-6). Solve vh + f + 8 = 4, -xh = f + 2 for h. -1 Suppose -2n + 4l - 38 = 0, -l - 2l = -5n - 102. Let c = 20 - 38. Let j = c - n. Solve -2m - 3 = jf, -5f + 2m = -0m + 21 for f. -3 Let x(y) = y2 - 4y. Let w be x(4). Let v be (-32)/24 - 13/(-3). Suppose f - 8 = -2g, -4f + 10 = -vf + g. Solve w = 2o, -f = 4l - 0o + 3o for l. -3 Suppose -3c - 5m = 6, 2c = 6c + 5m + 3. Suppose 5p - 14 = r, -cp - p - 4 = 3r. Solve pl = 4l - 4q - 12, -20 = 2l + 4q for l. -2 Suppose -8v - 25v - 15906 = 0. Let z = v + 484. Solve -2k - 14 = -a, 0a = 4a + zk - 6 for a. 4 Let l(x) = 21x + 721. Let p be l(-34). Solve 2f - pf + 40 = 3k, -k - 4f + 25 = 0 for k. 5 Let x(v) = v3 - 18v*2 + 13v + 306. Let t be x(16). Solve -5f = -2m + 22, -17 = -4m - tf + 3 for m. 6 Let t(f) = f*3 + 5f*2 + 4f + 4. Let r be t(-4). Let q be (-3 - (-3 - -1))0. Suppose qi = -9i + 36. Solve 5k = ro + 18, 0k - 4o = ik for k. 2 Suppose -5x + 12 = -2x. Suppose -63 = -0w - 4w - c, 0 = xw + 4c - 72. Let d = w - 13. Solve -24 = 4u - ds, 0 = 3u + s - 4s + 21 for u. -5 Let c(v) = 106v - 844. Let b be c(8). Solve 0 = f + bd - 18 + 11, -4d + 8 = 0 for f. -1 Let q(i) = -73i + 3516. Let v be q(48). Solve -3j + 15f = 13f - v, 5j + 5f = -5 for j. 2 Suppose -139n + 212n - 219 = 0. Solve -na + 165x = 168x - 6, -2a + 8 = 3x for a. -2 Let h(c) = -4c2 + 38c + 2083. Let b be h(28). Let v = -1 + 15. Solve v = 2d + 4m - 2, b = -2d + 5m for d. 2 Let z = -18 - -50. Suppose 4t + 36 = 8t. Suppose tc - z = c. Solve -3a + cp - 29 = 0, 5 = -5a - 0a - 2p for a. -3 Suppose -7t - 464 = 1118. Let k = -222 - t. Solve 6 = n - 3n, -kz - 3n - 25 = 0 for z. -4 Let p(o) = 3o2 + 42o + 4. Let q be p(-14). Let a(w) = -w - 3. Let j be a(-5). Let u = 119 - 116. Solve jv + 16 = -ug, -qg = 3v + v + 28 for v. -5 Suppose 2v = -3m - 1 + 11, -m - 15 = -3v. Suppose -3c - 14 = -6c - 5p, 4c - 3p - 67 = m. Solve 3g - q = c, 4q + 0q - 12 = -4g for g. 4 Suppose 0 = 2v + 3v + 4t + 3, 0 = -2v + 2t - 12. Let h = v + 5. Let x = -25419 - -25434. Solve -b - 3 = hd - 1, 0 = 5d + x for b. 4 Suppose -168 = 11a - 597. Suppose -a + 35 = -4h. Suppose -q + 1 + h = 0. Solve 3p + 2b = 0, qp = 3p + 2b for p. 0 Let d = 211 - 192. Suppose 12m = dm - 21. Solve p + mz + 9 = 6p, -3z = -6 for p. 3 Let y = 35 - 44. Let a be (-1)/(3 + 3 + 57/y). Let d be (-3)/(-6)6 - a. Solve 2 = -b - db, -5o + 20 = -5b for o. 2 Let a be ((-1391)/(-856) - 3/(-8))4. Solve -8 = 4j + aq - 4q, 0 = -j - 5q - 10 for j. 0 Suppose 5g + 3c = 13 - 15, 18 = -g - 5c. Solve -26v + 25v - 7 = go, -3v = 2o + 9 for v. -1 Let x(w) = w*3 + 10w*2 + 10w + 7. Let d be x(-9). Let y = 7 + d. Let t = 10442 - 10439. Solve i = -ti - p - 13, yp = 5i - 15 for i. -2 Let y = 2134 - 2132. Suppose -5l = 4h - 2h - 24, -3h = -2l + 2. Solve 0c = yc - ls - 6, 0 = -5c - 5s for c. 1 Let l(z) = -32z - 421. Let w be l(-14). Let f = -2 + 11. Let x = -4 + f. Solve -v + 1 = p, -3v + xp = -0v - w for v. 4 Suppose 86l + 39l - 428 = -53. Solve -3r - 11 = 5s - 15, 0 = -5s + lr + 16 for s. 2 Suppose 16z + 70 = 390. Solve 10 = -2k, 15k - zk - 50 = -5m for m. 5 Let u(r) = -6r2 - 19r - 29. Let t be u(-9). Let o = 347 + t. Solve p - 5y = o, 0p = -3p + 5y + 9 for p. 3 Suppose 314 + 13 = 109k. Solve -4i - 8 = -d - 15, -5 = -ki + d for i. 2 Let s be 3 + -10 + 0 - (-11 + -13). Solve -4r - 26 = 3v, s = r - 4r - v for r. -5 Let p be (-38)/1 - 4/(-2)1. Let n = p + 42. Suppose 3v = nv - 9. Solve 2c + vo - 4 = 1, 5c + 5o = 10 for c. 1 Suppose 3r + 15 = 0, -18r + 105 = 5a - 19r. Solve s + 6 = -3n, 5n - 13s = -18s - a for n. -1 Suppose -162 = 213g - 368 - 433. Solve -2u = 4h + 4, -3h - 2u + g = u for h. -3 Let g = 2599 + -2594. Solve x - 2 = -2h + g, -11 = x - 4h for x. 1 Suppose 3j = -m + 5, 0m + 4m - 3j = 5. Suppose -mc + 12 = 2c. Suppose y - 4k + 14 = 0, 3k = cy + 6 - 0. Solve 3x - yu = -x - 22, x - 3u = -8 for x. -5 Let h(f) = f*3 - 28f*2 - 34f + 157. Let y be h(29). Suppose -3o + 145 = -8o. Let q = o - -53. Solve 3d = -5b + q, -4b - d + y = -b for b. 3 Let l be 6 - (-1 + 4/(-16))/((-75)/120). Solve -v - 5 = 2s + l, v + 17 = -4s for v. -1 Let l(q) = -q + 9. Let w be l(7). Let b(a) = -2a*2 - 2a + 60. Let m be b(0). Suppose -12 = -md + 54d. Solve 5z + 22 = 2u, -du + 6 = -wz + z for z. -4 Let k(r) = -8r2 - 78r + 81. Let m be k(-10). Solve 0 = u + t + 1, -4t - m + 67 = 2u for u. -5 Let c(r) = -r*2 + 24 - 42 + 17 + 17 - 6r. Let j be c(-8). Let a = 3 + 2. Solve j = 3x - u + 6, -au = -u + 12 for x. -3 Let v = -1692 + 1693. Let z = 4 - 2. Solve s - b = v - 4, 5b = zs + 18 for s. 1 Let m = -26765 + 26770. Solve y + 15 = 2o, 4o + my + 22 = 17 for o. 5 Suppose 1688 = 60o + 608. Solve -17t + ot = -p, 5p - 20 = 0 for t. -4 Let b = -17 + 19. Suppose 0 = bq - 2 - 8. Solve -qs + 5f = 5, -5s - 13 = -4f + f for s. -5	{ "pile_set_name": "DM Mathematics" }
o*2/13 + 1003996o/13 - 2008096 = 0. What is o? -502024, 26 Factor 95o2 - 743815o - 274050. 5(o - 7830)(19o + 7) Suppose q4/2 - 314233q*3/2 + 24679780271q*2/2 + 913570790605q/2 + 444445348050 = 0. What is q? -36, -1, 157135 Factor s*2 - 17130892s + 17130891. (s - 17130891)(s - 1) Factor r4/6 - 3217r*3/6 + 1039095r*2/2 - 163098441r/2 - 69378841791. (r - 1161)*3(r + 266)/6 Let -c*4/6 - 121c*3 - 15541c*2/6 - 6206c + 26752/3 = 0. Calculate c. -704, -19, -4, 1 Factor -s*3/6 + 14662s*2/3 + 5459165s/6. -s(s - 29509)(s + 185)/6 Factor x*3/3 + 1501x*2/3 + 246596x/3 - 1800064/3. (x - 7)(x + 196)(x + 1312)/3 Factor 2c3 + 16c*2 - 15872c + 425984. 2(c - 64)(c - 32)(c + 104) Suppose -3t*5/4 - 91805t*4/4 - 61193t*3/4 + 275421t*2/4 + 91804t + 30601 = 0. What is t? -30601, -1, -2/3, 2 Find l, given that -4l2 - 568926968l - 20229868432354564 = 0. -71115871 Find s such that 12s4 - 1220444s*3 + 8135876s*2 - 11796804s - 4881456 = 0. -1/3, 3, 4, 101697 Determine f, given that 10f2/13 + 56092054f/13 + 22436820/13 = 0. -5609205, -2/5 Suppose 3g3 + 46509g*2 + 8938065g + 432127143 = 0. What is g? -15309, -97 Let 4o3/3 - 1516o*2 + 1022984o/3 + 688064 = 0. What is o? -2, 312, 827 Suppose 4v4/3 - 294244520v*3/3 + 5411239846876900v2/3 = 0. Calculate v. 0, 36780565 Suppose -c3 - 1882c2 - 1066956c - 160812792 = 0. Calculate c. -822, -238 Determine i so that -2i2/3 - 234473842i/3 - 234473840/3 = 0. -117236920, -1 Factor -2s4/5 + 36754s*3/5 + 330948s*2/5. -2s*2(s - 18386)(s + 9)/5 Let u5/6 - 115u*4/3 + 780u*3 - 10880u*2/3 + 13312u/3 = 0. Calculate u. 0, 2, 4, 16, 208 Factor -11w3/2 + 5007967w*2/2 - 10015901w/2 + 5007945/2. -(w - 1)*2(11w - 5007945)/2 Solve -d3/6 - 400d*2/3 - 4584d = 0 for d. -764, -36, 0 Solve -4i5 + 472966i*4 - 13980934054i*3 - 6993659586i*2 + 90879027570i - 41943511692 = 0. -3, 1/2, 2, 59121 Factor -5k4 - 2760k*3 + 25175k*2 - 39270k. -5k(k - 7)(k - 2)(k + 561) Find o, given that -4o4 - 14522568o*3 - 522808992o*2 - 6273694080o - 25094748672 = 0. -3630606, -12 Suppose -w*4/8 - 8729w*3/8 - 2400329w*2/8 - 16462075w/8 - 11696325/4 = 0. What is w? -8445, -277, -5, -2 What is w in -w*3/5 + 4994w*2/5 - 1964473w/5 - 1989468 = 0? -5, 436, 4563 Determine h so that h*3/2 - 199447h*2/2 - 5585692h - 78205176 = 0. -28, 199503 Find x, given that 5x4 - 2325x*3 - 89480x*2 + 990000x = 0. -44, 0, 9, 500 What is n in -n*4/4 - 3271n*3 - 195963n*2/4 + 235223n - 248311 = 0? -13069, -19, 2 Find z, given that -4z4/5 - 51z*3/5 + 161245z*2 + 604707z/5 - 40313 = 0. -455, -1, 1/4, 443 Suppose -71u3 + 8139u*2 + 3035u - 5175 = 0. Calculate u. -1, 45/71, 115 Find a such that -a*5/6 - 104a*4/3 - 5837a*3/6 + 129305a*2/3 + 1376400a - 4488000 = 0. -165, -40, 3, 34 Solve 5x4 - 10095x*3 + 10020x*2 + 141380x - 242160 = 0. -4, 2, 3, 2018 Factor -5j3 + 162515j*2 - 1949640j + 5848380. -5(j - 32491)(j - 6)*2 Determine j so that 25j*3 - 48915j*2 - 20006770j - 7994880 = 0. -347, -2/5, 2304 Factor -5u2 + 973035u + 9730850. -5(u - 194617)(u + 10) Factor 2b3/3 - 62590b*2/3 + 1249400b. 2b(b - 31235)(b - 60)/3 Find a such that 3a*4/4 - 220863a*3/2 - 2761149a*2 - 31589025a/2 + 74664369/4 = 0. -13, 1, 147267 Let -3f2/7 - 56901f/7 + 42891354/7 = 0. Calculate f. -19693, 726 Solve -5r2/2 - 1115r/2 + 2562275 = 0 for r. -1130, 907 Find h such that -3264h2 + 68330h - 123604 = 0. 2, 30901/1632 Let -4y5 + 5992y*4 - 2182880y*3 - 46092472y*2 + 2182884y + 46086480 = 0. What is y? -20, -1, 1, 759 Determine x so that 3x4/4 - 7007x*3/4 - 793852x*2 + 1326783x - 531180 = 0. -390, 2/3, 1, 2724 Factor -3i3 - 111i*2 + 1602i + 66960. -3(i - 24)(i + 30)(i + 31) Let 2u*3 + 2200u*2 + 86994u + 165204 = 0. What is u? -1059, -39, -2 Factor 261t2 - 1460t - 636. (t - 6)(261t + 106) Solve 50x5/7 - 65210x*4/7 + 10792988x*3/7 + 7547609332x*2/7 - 15127337038x/7 + 7568999878/7 = 0 for x. -251, 1, 3883/5 Suppose 2k4/11 - 2048k*3/11 + 56178k*2/11 - 36468k + 752976/11 = 0. What is k? 3, 7, 18, 996 Find g such that 5g3 - 203745g*2 + 1222335g - 1833435 = 0. 3, 40743 Factor 2q3/19 + 15902276q*2/19 + 31610297747522q/19. 2q(q + 3975569)*2/19 Factor 5h*3 - 28240h*2 - 2631440h - 51430400. 5(h - 5740)(h + 28)(h + 64) Suppose 3c*2/8 + 165437c/8 + 5672931/4 = 0. What is c? -55077, -206/3 Find d, given that -d*5 + 2791d*4 - 38917d*3 + 108289d*2 + 38918d - 111080 = 0. -1, 1, 4, 10, 2777 Determine f so that 225f5 + 45618f*4 - 1055727f*3 + 3472800f*2 + 3140604f + 228480 = 0. -224, -2/3, -2/25, 5, 17 Suppose 21h2 - 2077452h - 16620960 = 0. Calculate h. -8, 692540/7 Factor -o*2 + 117405o + 11397694. -(o - 117502)(o + 97) Find s such that 2s*3/9 + 9896s*2/9 + 8280650s/9 - 1166128852 = 0. -2807, 666 Factor t*2/3 - 78091t/3 + 806620. (t - 78060)(t - 31)/3 Solve 3d*2 + 7863d + 1512324 = 0. -2412, -209 Determine h, given that -h*3/2 + 883h*2 - 154443h/2 + 364095 = 0. 5, 87, 1674 Factor 101x3/2 - 327x*2/2 + 137x - 24. (x - 2)(x - 1)(101x - 24)/2 Suppose -5v*5 + 16825v*4 - 1384210v*3 - 32101840v*2 - 30700800v = 0. Calculate v. -18, -1, 0, 104, 3280 Factor -2p3/7 + 178674p*2/7 - 570116826p + 1710120762. -2(p - 44667)2(p - 3)/7 Determine f, given that 2f3/17 - 257926f*2/17 + 1031678f/17 - 773754/17 = 0. 1, 3, 128959 Factor -p*2/8 - 6385p/8 - 798. -(p + 1)(p + 6384)/8 Solve -s5 + 95s*4 + 6553s*3 - 422783s*2 - 429240s = 0. -73, -1, 0, 49, 120 Factor -2g4 + 13164g*3 - 367416g*2 + 2569168g. -2g(g - 6554)(g - 14)2 Factor -d2 + 15552068d + 31104140. -(d - 15552070)(d + 2) Let 2v*3/21 - 866v*2/21 - 49174v/7 + 8103222/7 = 0. Calculate v. -207, 111, 529 Factor 3s2/7 + 1391595s/7 - 795204. 3(s - 4)(s + 463869)/7 Find c such that -9c5 - 77458908c*4 - 180737418c*3 - 129098148c*2 - 25819629c = 0. -8606543, -1, -1/3, 0 Suppose -2d3/9 + 145066d*2/9 - 35018126d/9 + 705608354/3 = 0. Calculate d. 121, 72291 Solve 5n3 + 24545n*2 + 29638520n - 1193531820 = 0 for n. -2474, 39 Find d, given that -2d4 - 1014d*3 - 7526d*2 + 228102d - 219560 = 0. -499, -20, 1, 11 Determine r so that 4r5 - 4088r*4 - 1719048r*3 + 1727216r*2 + 1719044r - 1723128 = 0. -321, -1, 1, 1342 What is r in -76r4/7 - 1084414r*3/7 + 2597456r*2/7 + 1912326r/7 + 171252/7 = 0? -14271, -1/2, -2/19, 3 Let -3d5 + 36117d*4/2 - 440667d*3 + 413583d*2/2 + 215820d = 0. Calculate d. -1/2, 0, 1, 24, 5995 Factor 2f3 - 14449174f*2 + 26097306986510f + 78292051002150. 2(f - 3612295)2(f + 3) Suppose -3o5 + 2655o*4 - 453912o*3 + 451260o*2 = 0. Calculate o. 0, 1, 230, 654 What is z in -1225z*3 + 101819270z*2 + 23273024z + 1329888 = 0? -4/35, 83118 Solve -19827u2/4 + 6443763u/4 + 975 = 0 for u. -4/6609, 325 Factor 4t4 + 1524t*3 - 147400t*2 - 938400t. 4t(t - 85)(t + 6)(t + 460) Factor 2v2/9 - 26074v/3 + 208464. 2(v - 39087)(v - 24)/9 Find r, given that -r*2/6 - 11003363r/3 + 22006729/2 = 0. -22006729, 3 Find c, given that 2c4 + 101046c*3 - 3336354c*2 + 17289666c - 24570216 = 0. -50556, 3, 27 Factor 2g3/5 + 23750g*2 - 593120194g/5 + 712086341922/5. 2(g - 2357)2(g + 64089)/5 Factor 2892w3/11 + 2891w*2/11 - w/11. w(w + 1)(2892w - 1)/11 Suppose 5a5 + 395a*4 - 32500a*3 - 142000a*2 + 518720a + 2170880 = 0. Calculate a. -128, -4, 4, 53 Determine y so that 2y3/7 - 3774290y*2/7 - 60389024y/7 - 241556608/7 = 0. -8, 1887161 Suppose 54l5 + 62019l*4 + 17698251l*3 - 62619246l*2 + 24903936l + 5971968 = 0. Calculate l. -576, -1/6, 2/3, 3 Factor 3f2/7 - 774753f - 5423274/7. 3(f - 1807758)(f + 1)/7 Factor -p*4/9 - 91373p*3/9 + 365524p*2/3 - 4386416p/9 + 5848640/9. -(p - 4)*3(p + 91385)/9 Find a, given that -a*5/5 - 129a*4/5 + 57529a*3/5 - 3464403a*2/5 - 57528a/5 + 3464532/5 = 0. -333, -1, 1, 102 Determine f, given that f*5/9 - 142f*4/9 + 583f*3/9 + 21386f*2/3 + 22528f - 289440 = 0. -12, 5, 27, 134 Factor 3q	{ "pile_set_name": "DM Mathematics" }
inder when 69 is divided by l. 19 Suppose -9x = -15x + 420. What is the remainder when x is divided by 16? 6 Suppose 17 = 2c - 3m, -2m + 3m - 21 = -2c. Suppose 3w + w = 3p + 193, 5p - 5 = 0. What is the remainder when w is divided by c? 9 Let w = 45 - 25. Let c(k) = -2k3 + 11k*2 - 8k + 21. Let b be c(11). What is the remainder when b/(-24) + (-3)/12 is divided by w? 18 Suppose 2v + 2 = 34. Suppose 0t - 2t = -3z + 12, 1 = -z - t. Suppose 4j = 3j - zq + 19, -3j + 12 = -3q. What is the remainder when v is divided by j? 7 Suppose -2i = 3f + f - 18, 5i - 52 = -3f. Calculate the remainder when 48 is divided by i. 4 Let i(w) = 9w - 34. Suppose b - 36 = -5y, -y + 5b = 4 - 6. Calculate the remainder when 56 is divided by i(y). 27 Suppose 13 = 5m - 2a, 2a + 8 = 4m - 2a. Let l = 12 - m. Calculate the remainder when l is divided by 12/(-4) - (0 - 8). 4 Suppose 2 = -4o + 38. Suppose 2j + o = 5j. What is the remainder when 3 is divided by j? 0 Suppose 11u - 441 - 142 = 0. What is the remainder when 98 is divided by u? 45 Suppose -12 = -2s + 18. Suppose -60q + 64q - 173 = 5n, -2q + 86 = -2n. Calculate the remainder when q is divided by s. 12 Let d(c) = 3c - 4. Suppose -q - 3r = -25, 3q + 3 = 4r + 13. What is the remainder when 154 is divided by d(q)? 24 Suppose x - 8 = -r, 0r - 2r - 4x + 24 = 0. Suppose -5 = -5l, -rs + s = -l - 104. What is the remainder when 68 is divided by s? 33 Let w(r) = r3 + r2 + r. Let z(s) = -6s3 - 5s*2 - 8s - 14. Let a(l) = -5w(l) - z(l). Calculate the remainder when a(0) is divided by 8. 6 Let t = 43 - 39. Let m be -8 + 5 + (-1 - -10). Let g = 5 + m. Calculate the remainder when g is divided by t. 3 Suppose 4v - 5i = -42, 7 = -v - 0v + 3i. Let g(l) = 4l + l*2 - 11 + 0l + 5l. Calculate the remainder when g(v) is divided by 14. 13 Suppose 5y - 3k - 149 = 0, -7 = k - 4. Calculate the remainder when 37 is divided by y. 9 Let v(m) = 2m*3 + 72m*2 - 2m + 1. Calculate the remainder when 296 is divided by v(-36). 4 Let u(q) = -2q3 - 6q*2 + 7q + 9. What is the remainder when 887 is divided by u(-5)? 73 Suppose 0 = -3q + 104 + 13. Calculate the remainder when q is divided by (-1)/2 - (5 + (-39)/2). 11 Let v = 32 - 32. Suppose v = 2x - 6x + 84. What is the remainder when 103 is divided by x? 19 Let x = -86 + 124. Suppose 6 = -t - 4w, -4w - w = -5t + 70. What is the remainder when x is divided by t? 8 Suppose 234 = 3r + 4w, 0w = 2r + 2w - 154. What is the remainder when 11 is divided by (-3)/(-30)r + 8/(-20)? 4 Let t(y) = -y*3 + 6y*2 - 4y + 11. Let r = 29 - 29. Suppose 4a - 18 = -ra - k, 0 = -2a + 3k + 16. What is the remainder when 45 is divided by t(a)? 13 Let o = 82 + -75. Suppose 5j = 35 + 25. What is the remainder when j is divided by o? 5 Let f(z) = -11z - 8. Let c(v) = 32v + 23. Let m(b) = 3c(b) + 8f(b). Calculate the remainder when m(2) is divided by 8. 5 Suppose -4m - 5g = m + 355, 0 = 2m - 2g + 150. Let r = m - -119. Suppose -r = -3w + 8. What is the remainder when w is divided by 11? 7 Let c = -16 + 14. Calculate the remainder when 21 is divided by 152/16 + 3/c. 5 Suppose -9z = 7z - 320. What is the remainder when 74 is divided by z? 14 Let j(v) = -v*2 - 9v - 11. Let i be j(-7). Suppose -ik + 2k - 5h + 65 = 0, -4k + 212 = -4h. Calculate the remainder when k is divided by 15. 10 Let a = 3 + 11. Suppose -2h - i + 99 = 0, -4h + 2h + 90 = 4i. What is the remainder when h is divided by a? 9 What is the remainder when ((-1057)/14)/((-1)/2) is divided by 75? 1 Suppose 8 = -2x, -x + 20 = 4h - 4x. What is the remainder when 132 is divided by h/10 + 418/10 - -3? 42 Let b = -685 - -847. What is the remainder when b is divided by 43? 33 Let a be (-2)/(4 - 2) + 10. Suppose 0o + 24 = 4o. What is the remainder when (-23)/(a/(-12)) is divided by o? 2 Let o(q) = -18 + 38 - 6 + 2q - 3q. Suppose -u = -0u. Calculate the remainder when 39 is divided by o(u). 11 Let x = 16 + -4. What is the remainder when 93 is divided by x? 9 Let d = 2076 - 1952. Calculate the remainder when d is divided by 42. 40 Suppose -2a = -5w - 63, w + 0w - 52 = -3a. Let o = a - 8. What is the remainder when 21 is divided by o? 10 Suppose 0 = -2i - 3u + 113, 8i - 5i - 3u - 177 = 0. What is the remainder when i is divided by 34? 24 Let n(v) = 5v2 - v3 + 10v + v2 + 0v*3 + 2. Calculate the remainder when n(7) is divided by 13. 10 Let v be 4 + -12 - (1 - 5). Let s(q) = -4q - 7. Calculate the remainder when 43 is divided by s(v). 7 Suppose -5r - 5j + 75 = 0, 0 = 4r - 6r - 5j + 33. Calculate the remainder when 67 is divided by r. 11 Suppose 2m - 7 = -1. Suppose 3r - 2l + 42 = -11, r + 3l + 3 = 0. What is the remainder when m/(-9) + (-740)/r is divided by 17? 15 Let b be (1 - 2)/((-1)/(-36)). Suppose w + 55 = 6w + 5p, 4w - p = 54. Let c = w - b. Calculate the remainder when c is divided by 13. 10 Suppose 2o - 565 = r, 5o = -r - 4r + 1450. Suppose l + 3b - 11 = 12, -2b + 8 = 0. Calculate the remainder when 2/7 - o/(-7) is divided by l. 8 Let m = -19 + 19. Suppose m = 5k + 33 - 118. Suppose -z = -3i + 28 + 64, -5i - 4z + 159 = 0. Calculate the remainder when i is divided by k. 14 Suppose -124 = -5w - 2i, 5i - i = -4w + 92. What is the remainder when 77 is divided by w? 25 Suppose -192 = 6n - 612. Let r = 98 - n. Let b = -17 - -72. What is the remainder when b is divided by r? 27 Let g be ((-7)/2)/((-11)/66). Let z = 21 - g. Suppose z = -16r + 12r + 80. What is the remainder when r is divided by 8? 4 Suppose 0 = 8n - 5n - 144. What is the remainder when n is divided by 17? 14 Calculate the remainder when ((-1)/(-4))/(10/840) is divided by 10. 1 Suppose -y = -o + 197, 2y - 774 = -4o - y. What is the remainder when o is divided by 60? 15 Let q(j) = 4j - 3j + 4j + 1 + 3j*2. Calculate the remainder when 64 is divided by q(-3). 12 Let h = 5 - 54. Let q(w) = 3w*2 - 3w - 7. Calculate the remainder when q(3) is divided by 52/14 - 14/h. 3 Suppose -2p - 5j = -14, 16 = -2j + 6j. Let d = p - -3. Suppose da - a + 40 = 0. Calculate the remainder when a is divided by 11. 7 Let c(w) = w + 15. Let t be c(-3). Suppose -5p = -t - 93. Let n = -2 - -13. What is the remainder when p is divided by n? 10 Suppose 2 = 3v + 4y + 18, -2y + 10 = 0. Let q(k) = -23k*2 - 14k - 15. Let c be q(-1). Let n = v - c. What is the remainder when 47 is divided by n? 11 Let n(p) = -6p - 11. Let o(j) = 3j + 6. Let s(v) = 2n(v) + 5o(v). Suppose -9u + 5u = 10u. What is the remainder when 26 is divided by s(u)? 2 Let m = -75 + 78. Suppose 0h + f + 110 = 5h, h - 4f = m. What is the remainder when 82 is divided by h? 13 Let m(q) = -q + 3. Let d be m(0). Suppose 0 = -dl - 2l + 40. What is the remainder when 31 is divided by l? 7 Suppose 5a - 3q + 30 = q, -3a + 5q - 18 = 0. Let i(p) = 4p - 36. Calculate the remainder when i(17) is divided by ((-4)/a)/((-10)/(-135)). 5 Suppose 2i + 2h = 10, 5i - i + 5h - 22 = 0. Suppose 0 = -iu + 24 - 6. Calculate the remainder when 10 is divided by u. 4 Suppose -2u - 28 = -4u + 3d, 0 = 3d - 12. Suppose 3c = u + 85. Calculate the remainder when c is divided by 19. 16 Suppose 2344q - 96 = 2328q. Suppose 2p - 40 = -2p - h, 2h = 0. What is the remainder when p is divided by q? 4 Calculate the remainder when (144/30)/((3/(-20))/(-3)) is divided by 17. 11 Let g = -37 + 11. Let d = -4 - g. Suppose d = -0v + v. What is the remainder when 42 is divided by v? 20 Let f = -345 - -367. Calculate the remainder when 84 is divided by f. 18 What is the remainder when 35 is divided by (1 - (-7 + -3)) + (1 - -4)? 3 Let f = 12 - 4. Suppose fd - 480 = 208. What is the remainder when d is divided by 29? 28 Let v = -140 - -151. Let r(o) = o*3 - 4o*2 + 2o - 4. What is the remainder when v is divided by r(4)? 3 Let y = 55 - -77. Suppose -17u = -19u + y. Calculate the remainder when u is divided by 23. 20 Let t(o) = -o*3 + 5o*2 + 4o. Let y = 6 - -34. Let g = y + -29. What is the remainder when t(5) is divided by g? 9 Calculate the remainder when ((-15)/(-6))/(10/420) is divided by 38. 29 Let v = -191 + 196. What is the remainder when 41 is divided by v? 1 Let u = 66 + -67. Let	{ "pile_set_name": "DM Mathematics" }
+ 18, s + i = -3. Suppose 0 = 2j + a - 4a - 12, sj + 4a + 2 = 0. Solve 0 = -jr, -5x + 3r + 25 = -r for x. 5 Let i(p) be the second derivative of -p5/20 + p4/3 - p3/6 - 3p*2/2 + 2p. Let n = 18 - 15. Let y be i(n). Solve yr + 2b = -18, -r = r + b + 11 for r. -4 Let j be 20/7 - (-78)/(-91). Solve jl + l = 4h - 4, 3l = -h + 1 for l. 0 Suppose 2z = -2z + 16. Let x(q) = -176q + 1267. Let w be x(7). Solve -2i = -i + 3v + 20, -w = zi + 3v for i. -5 Let w = 2 + -5. Let x be w - (-2 + 0) - -21. Suppose -3f + x = 2f. Solve t - 11 = -4t - 4o, -ft + 12 = 4o for t. -1 Suppose 8 = -10l + 6l. Let y be 3/(-1(1 + l)). Solve 3n + 11 = -d + yd, -n + 7 = 2d for d. 4 Let d(p) = -p*2 + 19p + 3. Let i be d(19). Solve -4f - 16 = 5w + 3, -7 = iw - 2f for w. -3 Suppose -4 = -j - 24g + 26g, 2g = 0. Solve -4l + 8 = l - 2b, jb + 6 = 5l for l. 2 Let d(y) = -y + 7. Let a be d(2). Suppose 2n + 28 = al + 1, 3n = 5l - 28. Solve 0f = -2h + f + 1, -2h - f = l for h. -1 Let h be 41/((-164)/8)(-1 + 0). Solve 7l - 6l = -hn - 10, 4n + 6 = 5l for l. -2 Let t = -772 + 792. Solve 0b - t = -3z - 5b, -4z - 5b = -20 for z. 0 Suppose -44y + 27y = -170. Solve -p + y = 6n - 2n, 5n - 23 = 4p for p. -2 Let f(i) = 3i*2 + 5i*2 + 7i*2 - 16i*2 - 4i - 1. Let g be f(-3). Solve 3o - go + 21 = 4a, 0 = 2a - 4o - 14 for a. 5 Suppose 4r = 2z + 12, -9z + 26 = 4r - 4z. Solve 8 = -rg, 5c - 2g + 21 = -0c for c. -5 Let o be 8/(-2) + (-51)/1. Let a be (-10)/o + (-40)/(-22). Let z be (1 - -6) + -3 + -2. Solve -5m + 5x + 30 = 0, -am + zx = 4x for m. 3 Suppose 32i - 4i = 84. Solve 2z - 6 = b, 5z = -0z - 2b - i for z. 1 Suppose -19k + 46 = 4k. Solve 2q + i = 3, ki + 1 = q + 3i for q. 2 Let o be (-1)/((15/(-126))/5). Suppose 2i = -i + o. Suppose -a + 27 = 5m, 4m + a + a = 24. Solve 5c - 5r = -1 - i, 2r - m = c for c. -1 Let s = 544 + -542. Solve 0 = 2i + sm - 8, 8 + 4 = 2i + 4m for i. 2 Let i(l) = 3l2 + 2. Let g be i(0). Solve gr + 5d + 3 = -r, 0 = -5d for r. -1 Suppose 2x - 6 = -o, 49 = 2o + 2o + 3x. Solve -4i - 19 = -3j + o, -2i = -4j + 30 for i. -5 Let i be 11 - 5 - (-6 - -7). Solve 9z + iq = 4z + 5, 0 = -z - 3q - 1 for z. 2 Suppose -9m - 16 = 20. Let b be ((-6)/(-8))/(11/m + 3). Solve -5w - 10 = bv - 39, 4w - 25 = -3v for v. 3 Let d(i) = 4i*3 + i - 2. Let f be d(1). Suppose fl = a + 12, 0a - 2l + 22 = 4a. Solve j - 2r + 14 = aj, 4r = 20 for j. 2 Suppose 1272f - 1273f = -2. Solve -2x = 3x + 4r - 15, 0 = fx + 2r - 6 for x. 3 Let q = -65 + 102. Suppose -60 = qy - 43y. Solve -2c = y, 0r + r = -5c - 26 for r. -1 Let t be 78/(-182) + (-48)/(-14). Solve 4n + 4 = 0, tg + n + 2n - 6 = 0 for g. 3 Let r(g) = -2g*3 - 12g*2 - 6g - 33. Let h be r(-6). Solve -3f = -2d + 11, hd - 4 = -4f + d for f. -1 Let s be (-68)/(-18) - (-14)/63. Suppose sn = -1 + 21. Suppose -3x = 2x - 15, -nx = -5h + 10. Solve 4 = -2a, -h - 3 = 2v + 3a for v. -1 Suppose 16s + 10s - 286 = 0. Suppose -4c - m = -s, -7c - m - 1 = -6c. Let w be (-1 - 0)/(1 + -2). Solve ci - 27 = -5f, 0 = 3i - 8 - w for f. 3 Let z = 307 + -304. Solve 4w - 3w + 3g = 11, zw - 3g + 27 = 0 for w. -4 Let h = -19 + 24. Suppose 0 = 2o + 3o - 2f - 24, -5o + 10 = hf. Solve x + 4x - 36 = 4s, -os + 4x - 32 = 0 for s. -4 Let r(q) = -q*3 + 13q*2 + 14q. Let o be r(14). Solve 2u + 2g = o, 4u - 6 = 3g + 1 for u. 1 Suppose -3o + 6 + 0 = 0. Let n be 2/(-4)7 - 96/(-64). Let d be n(-2)/(-12)-45. Solve d = 3a - 4w, a + ow = -2a + 15 for a. 5 Let m be -12 + 14 + (2 - 3). Solve 2y - 11 - m = -4b, 5y = 4b + 16 for y. 4 Let w = 3 + 1. Suppose a = 2c + 31, -40 = -3a - 3c + 17. Suppose -26 + a = -i. Solve -3p + 20 = -wp + 5y, 4p = iy + 5 for p. 5 Suppose -3y = 2i + y, y = 8i. Solve -m = -d - 4, -2d = 2m - im for m. 2 Let w = -33 - -43. Suppose 5q - w + 10 = 0. Solve -8 = -5g - p + 3, q = 4g + 4p + 4 for g. 3 Let j be (-1292)/342 - 4/18. Let a be -3 - (-19 + (-3 - j)). Solve -4k - 22 = -2y, -5y - a = 3k - 5 for k. -5 Let m be (2/5)/((-4)/(-50)). Solve 0y = my - h + 3, -4y - 6 = -2h for y. 0 Let a = 20 - 22. Let c = a + 3. Solve -2x = -5x - l + c, -2x = 3l + 4 for x. 1 Let v = 15 - 13. Suppose -13 = vx - 21. Solve 6y - 2y + 4 = xm, -3y + 15 = 3m for m. 3 Suppose 70 = -5z - 5y, -4z + z = -4y + 7. Let p be z/3 + 1 + -1. Let j be p + (-2 + 1)-5. Solve 6s + 2i = 3s - 2, -s + ji - 14 = 0 for s. -4 Let n = 45 - 41. Solve -nw + 2s + 10 = 0, s + 5 = 4w + 4s for w. 2 Let d(f) = -f3 + 18f*2 - 56f + 170. Let n be d(15). Solve -5y + n = 2t - 4, -2y - 5t = -12 for y. 1 Let t = 2 - -3. Suppose -33w + 58w - 75 = 0. Suppose -3y - 23 = -4q + 2y, -q - 1 = y. Solve -4r + 0r = -ts, -wr = qs - 23 for r. 5 Let p(q) = -2q - 25. Let y be p(-15). Suppose -16 = -yo + w, 3w + 0w = 2o - 9. Solve 0d + 10 = -t + 3d, 3t - od + 6 = 0 for t. 2 Suppose -64 = 5c - 37c. Solve cx + 2d + 4 = 0, -6x + 2d - 24 = -x for x. -4 Let x be 6/((-12)/(-5))(-220)/(-25). Solve x = 5o + a, 0 = -5o - 5a + 15 + 15 for o. 4 Suppose -5o = -4o + 2. Let f = -2 - o. Let a = 3 - -2. Solve -ax = f, -5b - 4x = -3b - 2 for b. 1 Let z(x) = x3 - 6x*2 + 6x - 9. Let l be z(6). Let w = 52 - l. Suppose -o - w = -4h, -3 = -3o + 6. Solve 5 = -4t - 2s - h, 4t - 5s = 16 for t. -1 Let f(y) = y*3 - 17y*2 - 36y - 28. Let p be f(19). Solve 5a = 3z + p, 5 = 3z - z - a for z. 5 Let j(u) = -2u - 4. Let t be j(6). Let m = t - -12. Let g = 6 + m. Solve 2n = -3r + 15 + 2, -4r + gn = -18 for r. 5 Suppose 2005g - 24 = 1999g. Solve 5h = -f - 8, -2 - g = -4f - h for f. 2 Let k be (-4 + 1)/(2/(-8)). Suppose 15r = kr. Solve -31 = -3z + 5x + 4, r = -5z + 2x + 33 for z. 5 Let u(t) = -t*2 - 10t - 11. Let o be u(-9). Let c be (-1)/((-2)/12o/(-3)). Solve -c = -2p + 5b, 2p + b + 12 - 3 = 0 for p. -3 Suppose -14g + g = -52. Suppose -7l + 2l = 0. Solve m - 5b + 5 = 18, -m + gb + 11 = l for m. 3 Suppose 0 = 5d - 63 - 92. Suppose 5z - 106 + d = 0. Let y be (-5 + 2)/(4/(-34) + (-799)/578). Solve 4j - z = -4w + 5, 3j = -yw + 10 for j. 0 Let p be (6 + (-40)/12)/((-2)/(-3)). Solve -2f = 3o - 9, -po - 5f + 0f + 12 = 0 for o. 3 Let l = 50 + -34. Let x be (6/4)/(6/l). Suppose x + 16 = 4u. Solve 3q - 8 = g, q - 4 = -4g + ug for g. -2 Let a be (-5)/(20/(-8)) - (-2 + 0). Suppose -8k + ak = -20. Solve 5r + 5d - 15 = 0, -2r - 3d + k = -6 for r. -2 Let y = -73 - -76. Solve -2p - 3p + 3 = -2b, -p - yb + 4 = 0 for p. 1 Let d(g) = -5g - 5. Let c be d(-2). Solve -5 = -0f - 2f + 3v, 5 = -cv for f. 1 Suppose 8x + 3x - 33 = 0. Suppose 2j - 2 = 10. Solve 4g - 4a = jg - 24, -xg = -4a + 4 for g. 4 Let o be -2(-12)/32 - 27/(-12). Suppose 3 = 5a - 22. Solve -5i + x = -23, -oi + ax = -44 + 17 for i. 4 Suppose 0 = -4v + 2t + 12, -2v - 17 + 7 = -5t. Let j = 5 - 3. Suppose 5 = -x, 5l = x - 3 + 18. Solve -y - lz = -v, -jy + 35 = -7y + 2z for y. -5 Suppose -3s = -3o - 51, -5s - 2o - 2o + 58 = 0. Let k = 13 - s. Let x(i) = -4i - 2. Let d be x(k). Solve 3n + 0v = dv - 10, -2 = 2v for n. -4 Let u(k) = -k3 - 12k*2 + 13k - 6. Let f be u(-13). Let v = 1 + f. Let r = v + 9. Solve -4o = 2c - 24, -2c - o = -2o - r for c. 4 Let g = -1514 + 1514. Solve 0b = -b - s - 2, g = 3s + 9 for b. 1 Let f(j) = -j*2 + 15 + 12j - 4j + 6j. Let y be f(20). Let r be (-84)/y + (-6)/(-5). Solve 2p + 5l = 30, 18 = 2p - 0l + rl for p. 5 Let q = 136 + -129. Solve 2n = -4u - 20, 4n = -3u - 22 + q for u. -5 Let g = -340 + 343. Solve -2k - 10 = gi, -2i + 1 = 4k + 5 for i. -4 Let c = 8 + -7. Let u(f) = 2f. Let r be u(c). Suppose 3h = 3z + 21, 5h + rz + 2z = 8. Solve -o - 5 = -4v + 2v, -12 = -hv + 4o for v. 2 Suppose 2u - 3 - 1 = 0. Let x(j) be the second derivative of -j*3/3 - 3j*2/2 - 18j. Let m be x(-3). Solve uv = z, -4z + mz = -v for z. 0 Suppose 4h - 23 = -3u, 4u = -4h + 5u + 19. Solve -4i - 5c = -hi + 9, -3i - 5 = c for i. -1 Let k be (9 + -4)123/15. Suppose 6h + 23 = k. Solve hg - 5y - 16 = -g, 0 = 5g - y + 1 for g. -1 Let t = 54 + -100. Let m = 60 + t. Solve n + 5b = -2*n	{ "pile_set_name": "DM Mathematics" }
s. -24 Solve -31r + 356 + 140 = 0 for r. 16 Solve -265 + 822 + 67 = -52r for r. -12 Solve -17191 = 114d - 12631 for d. -40 Solve -2f = -1602 + 1586 for f. 8 Solve -3871 + 1155 = 97g for g. -28 Solve -296z + 30 = -302z for z. -5 Solve 34 = 369u - 352u for u. 2 Solve 147j = 85 - 1702 for j. -11 Solve -3418a + 3477a - 1357 = 0 for a. 23 Solve -554r + 329r = -315r - 1170 for r. -13 Solve 17612x - 17595x + 238 = 0 for x. -14 Solve -45q - 4103 = -4778 for q. 15 Solve -25l - 118 - 36 - 71 = 0 for l. -9 Solve -96t + 443 - 925 = 1246 for t. -18 Solve 9g = -19g - 488 + 40 for g. -16 Solve 0 = -11525g + 11626g - 2222 for g. 22 Solve -144x = -380x - 1652 for x. -7 Solve -4774 - 4374 = -721r + 3109 for r. 17 Solve 1862 = 125h + 8h for h. 14 Solve 3j - 43 = -11j - 225 for j. -13 Solve 221t - 250t + 2140 = 399t for t. 5 Solve 0 = -237o + 249o + 12 - 0 for o. -1 Solve -286v - 198 = -140v - 137v for v. -22 Solve 44 = 937q - 948q for q. -4 Solve 0 = -61c + 374c - 1750 + 7384 for c. -18 Solve -230 = -590l + 567l for l. 10 Solve 83 = -46i - 331 for i. -9 Solve -215h - 285 - 236 = 984 for h. -7 Solve c + 1 = -5 - 5 for c. -11 Solve 0 = -9081x + 9100x for x. 0 Solve -439a + 165a - 774 = 113a for a. -2 Solve -65h - 185 = -70 + 470 for h. -9 Solve 0h = 7h + 5h + 132 for h. -11 Solve 927k - 948k + 168 = 0 for k. 8 Solve -767q + 789q - 132 = 0 for q. 6 Solve 81n - 207n + 1137 = -2013 for n. 25 Solve 0 = -96r + 6r + 180 for r. 2 Solve -500h + 20 = -520h for h. -1 Solve -33k - 21k + 306 = -288 for k. 11 Solve 0 = -65z + 14z + 663 for z. 13 Solve -281b + 264b - 221 = 0 for b. -13 Solve 130 + 430 = -68k - 52 for k. -9 Solve -7772s = -7931s - 1590 for s. -10 Solve 375s + 95 = 186s + 170s for s. -5 Solve 297c - 2707 - 560 = 0 for c. 11 Solve 20h - 218 = 302 for h. 26 Solve -1006p - 429 = -967p for p. -11 Solve 65107p + 300 = 65127p for p. 15 Solve 30o + 24o = 18o - 180 for o. -5 Solve 0 = 1728g - 73g + 994g + 45033 for g. -17 Solve -116o = -137o - 178 - 11 for o. -9 Solve 746k = 783k - 555 for k. 15 Solve -386j = -611 + 5243 for j. -12 Solve 2216 - 4184 = 13t - 2150 for t. 14 Solve -42c + 12c = -91c - 976 for c. -16 Solve 90m = -29m - 1785 for m. -15 Solve 567q + 368 = 659q for q. 4 Solve 76s + 3240 = -39s - 47s for s. -20 Solve 13d = 12d - 18d - 190 for d. -10 Solve 10k - 225k - 376 - 4354 = 0 for k. -22 Solve -65 = -15c + 38c + 165 for c. -10 Solve 124 = 8u + 44 for u. 10 Solve 669h - 3817 = 13205 + 6393 for h. 35 Solve -41x - 7332 = -8111 for x. 19 Solve -4722 = -198v - 1031 + 1061 for v. 24 Solve 0 = 513y - 524y - 121 for y. -11 Solve 5562v - 825 = 5487v for v. 11 Solve 60p + 1152 = -12p - 24p for p. -12 Solve 85721o = 85716o + 10 for o. 2 Solve 269z + 43z - 2985 = -285z for z. 5 Solve 417533 = -8l + 417525 for l. -1 Solve -1303 + 225 = 98a for a. -11 Solve 380w + 124w + 8064 = 0 for w. -16 Solve 107i + 294 = 2220 for i. 18 Solve -3210 = 506t - 185t for t. -10 Solve -304t + 1436 = -2516 for t. 13 Solve -295u - 253u = -88u + 5060 for u. -11 Solve -240o + 316o = -1824 for o. -24 Solve -33 = t + t - 7 for t. -13 Solve 183y - 447 = -3741 for y. -18 Solve -26x + 0x - 77 = 235 for x. -12 Solve 78v = -3692 + 1586 for v. -27 Solve -233y - 98y = 3310 for y. -10 Solve 21c = -36c - 39c + 1440 for c. 15 Solve -230 = -109w - 1320 for w. -10 Solve 1416 + 384 = 86g + 338 for g. 17 Solve 23316a - 23499a - 4941 = 0 for a. -27 Solve 11 = 167u - 68 - 88 for u. 1 Solve 65 = -3253c + 3266c for c. 5 Solve -42992w - 102 = -42975w for w. -6 Solve -24j - 27j - 477 = 135 for j. -12 Solve -92y = -25y - 44 + 1049 for y. -15 Solve 102 = 136g + 102 for g. 0 Solve 11i - 12i + 4 = 0 for i. 4 Solve -1549 = -310j - 3674 - 7175 for j. -30 Solve 2080p - 2137p + 156 = -243 for p. 7 Solve 25q - 33 - 96 = 46 for q. 7 Solve 27w = 58w + 310 for w. -10 Solve -30q = -112q + 984 for q. 12 Solve 508g - 150 = 261g + 253g for g. -25 Solve -406l + 422l = 16 for l. 1 Solve -84a + 27a - 371 = -998 for a. 11 Solve -86k - 2666 = -344 for k. -27 Solve -1778 + 882 = 56i for i. -16 Solve 44 + 109 = -8724f + 8673f for f. -3 Solve -23z - 33 - 9 = -16z for z. -6 Solve -x + 19x + 288 = 0 for x. -16 Solve -22k + 7k + 525 = 10k for k. 21 Solve -63o + 10864 = 713o for o. 14 Solve -890h - 2 = -891h + 8 for h. 10 Solve 1150 = 45516h - 45466h for h. 23 Solve 125f = -669 + 10 - 341 for f. -8 Solve 39x - 72297 = -73038 for x. -19 Solve -9766q + 1426 = -9720q for q. 31 Solve -6q = 106q + 32q + 720 for q. -5 Solve 0n = 4n + 6n + 70 for n. -7 Solve 142y = 245 + 1206 + 111 for y. 11 Solve 34x + 170 + 46 = 46 for x. -5 Solve -17 - 14 - 13 = 4r for r. -11 Solve -113 = 80d + 55 + 72 for d. -3 Solve 501q - 607q = 106 for q. -1 Solve -42d + 240 + 726 = 0 for d. 23 Solve 9842 = 1625k + 1279k - 3163k for k. -38 Solve 54f + 12 + 42 = 0 for f. -1 Solve 10x = 49x - 11x - 140 for x. 5 Solve -2s - 8s = -0s - 20s for s. 0 Solve -362 - 1576 = -5b + 119b for b. -17 Solve 7014 = -g + 7015 for g. 1 Solve -181y + 194y = 13 for y. 1 Solve -109264h + 109189h = 1875 for h. -25 Solve -78w = 763w - 11095 + 4367 for w. 8 Solve -487g + 7973 = -18g for g. 17 Solve 13y - 28y - 120 = 0 for y. -8 Solve -193 - 104 = 7s - 34s for s. 11 Solve 1960 = 37f - f + 62f for f. 20 Solve -1645 + 2010 = -73u for u. -5 Solve -179g + 836 = -2262 + 950 for g. 12 Solve -1480 = 17g + 4g + 164g for g. -8 Solve -338 - 1367 = -252d - 445 for d. 5 Solve -63 + 129 = 30x - 144 for x. 7 Solve 93p - 45p + 144 = 0 for p. -3 Solve 1675o + 434 = 1892o for o. 2 Solve -14 = -10626w + 10628w for w. -7 Solve -30559 = -103x - 28808 for x. 17 Solve -44m + 107 = -333 for m. 10 Solve 25d - 108 = -16d + 507 for d. 15 Solve 605 = 14c + 563 for c. 3 Solve 104l + 1545 - 287 = -1030 for l. -22 Solve 15i + 0i + 97 + 8 = 0 for i. -7 Solve 36n - 232 = -232 for n. 0 Solve 0 = 6i + 4 + 15 - 7 for i. -2 Solve 0o + 144o - 447 = -5o for o. 3 Solve 0 = -414w - 10488 - 3588 for w. -34 Solve 25832j - 25803j = 116 for j. 4 Solve 346q - 1447 = -431q + 2438 for q. 5 Solve 271b - 69b + 335 = 135b for b. -5 Solve -114b = 48b + 2754 for b. -17 Solve -27r - 61r = -38r - 700 for r. 14 Solve 6a + 2a - 24 = 0 for a. 3 Solve -6c + 360 = -27c - 9c for c. -12 Solve -297 = 110w + 803 for w. -10 Solve -7i + 6i = 68 - 83 for i. 15 Solve 169 + 63 = 181o - 130 for o. 2 Solve 3749i - 240 = 3829i for i. -3 Solve -2427 + 233 = 316a + 1282 for a. -11 Solve 333h + 920 = 401h - 848 for h. 26 Solve 3867z - 3857z - 27 = 253 for z. 28 Solve -486 = 8w - 62w for w. 9 Solve -405j - 7092 - 3033 = 0 for j. -25 Solve 427v - 1490v - 106 + 23492 = 0 for v. 22 Solve 241o - 1551 = 100o for o. 11 Solve 27j - 211 = -37 + 69 for j. 9 Solve 0 = 189p - 114p - 1650 for p. 22 Solve 4o + 9o = 98o + 765 for o. -9 Solve 404 = 476f - 72f for f. 1 Solve -7652c = -7611c - 151 + 971 for c. -20 Solve -1229c + 1219c = -50 for c. 5 Solve 0 = -2d - 11588 + 11592 for d. 2 Solve 451q + 9787 - 1218 = 0 for q. -19 Solve -70g + 16g - 144 = 342 for g. -9 Solve -252p + 43 + 43 = -1426 for p. 6 Solve 8h = 102h - 674 - 1300 for h. 21 Solve -184p + 6509 = 4853 for p. 9 Solve 220p - 909 = -383 + 354 for p. 4 Solve 171 - 144 = -27s for s. -1 Solve -984m - 33239 = -10607 for m. -23 Solve -374k - 14028 = 127k for k. -28 Solve 83w - 7182 = -198w - 438 for w. 24 Solve -169l - 1284 = -1077 + 1821 for l. -12 Solve 20r + 3510 = 290r for r. 13 Solve 0 = -157j + 968 + 288 for j. 8 Solve -57 + 75 = 2b + 60 for b. -21 Solve -951 = -3m - 969 for m. -6 Solve 246o - 9462 = -252o for o. 19 Solve 540l - 508l = -197 - 155 for l. -11 Solve 165 = -17w + 64 - 69 for w. -10 Solve 209l = -50l - 518 for l. -2 Solve 365l = -5543 + 1163 for l. -12 Solve -37g - 986 + 690 = 0 for g. -8 Solve 7830q - 7815q - 165 = 0 for q. 11 Solve 144k + 148k - 288k - 20 = 0 for k. 5 Solve 940n + 2161 + 10059 = 0 for n. -13 Solve 19f - 10114 + 10361 = 0 for f. -13 Solve 19i - 129 = -319 for i. -10 Solve 18531 = 616g - 5589 + 6256 for g. 29 Solve 276q - 54q - 23008 = -497q	{ "pile_set_name": "DM Mathematics" }
is -14253 + 5? -14247 In base 14, what is 3b - 84? -47 In base 12, what is 357b - -5? 3584 In base 2, what is -1111000 - -100000? -1011000 In base 5, what is 122 - -12? 134 In base 3, what is 110221 - 11? 110210 In base 4, what is 10 - 1? 3 In base 7, what is 0 + 3? 3 In base 10, what is -1 + 7? 6 In base 8, what is -165 - -5? -160 In base 2, what is -1001 - 11000011? -11001100 In base 7, what is 160 + -14? 143 In base 5, what is 10142 - 0? 10142 In base 13, what is 371 + 2? 373 In base 7, what is -312 + 2? -310 In base 12, what is -1259 + 3? -1256 In base 10, what is 0 - -60? 60 In base 4, what is 221 - -1? 222 In base 9, what is -8 + 41? 32 In base 13, what is -5 + -376? -37b In base 13, what is 1 + -5? -4 In base 9, what is -5166 - -2? -5164 In base 13, what is -2a3 - 6? -2a9 In base 8, what is 1170 + -1? 1167 In base 4, what is -12202 + 2? -12200 In base 12, what is -4 + -1234? -1238 In base 11, what is 4 + 3? 7 In base 16, what is -38 - -4? -34 In base 3, what is -11 + 21102? 21021 In base 7, what is 163 + 5? 201 In base 4, what is -301 + 0? -301 In base 11, what is 1981 - -5? 1986 In base 12, what is 18a + -1? 189 In base 12, what is 4a - -11? 5b In base 11, what is 1194 + 0? 1194 In base 14, what is -2 + -14c? -150 In base 16, what is 4 + 3? 7 In base 9, what is 4373 - 4? 4368 In base 16, what is 45 - 0? 45 In base 3, what is -11 + -1111? -1122 In base 7, what is 100551 - 3? 100545 In base 13, what is 44c4 + -4? 44c0 In base 13, what is -309 - 1? -30a In base 3, what is 2 - 10111120? -10111111 In base 3, what is 12120211 - 10? 12120201 In base 8, what is -36263 - -5? -36256 In base 6, what is 1504 - -5? 1513 In base 15, what is 40 - 0? 40 In base 4, what is -3102 - 0? -3102 In base 12, what is 32 - -166? 198 In base 9, what is -6665 + 1? -6664 In base 16, what is 9 + -26? -1d In base 5, what is -412 - 0? -412 In base 9, what is -2 + -1207? -1210 In base 14, what is 57 + -4? 53 In base 2, what is -101000001101 - -11? -101000001010 In base 11, what is -95 - 0? -95 In base 15, what is -b - -8d8? 8cc In base 2, what is -10001101110 - 11? -10001110001 In base 2, what is 11010000 + 101000? 11111000 In base 13, what is 108c - 3? 1089 In base 5, what is -10032 + -10? -10042 In base 2, what is -11 - 1010101? -1011000 In base 4, what is -130212 + -2? -130220 In base 4, what is 110301 - 3? 110232 In base 14, what is 18 + 22? 3a In base 9, what is 4 - -855? 860 In base 13, what is -11 + -39? -4a In base 14, what is 4 + -1c2? -1bc In base 6, what is 1 + -343? -342 In base 15, what is -5 - -2a? 25 In base 14, what is -15 + -113? -128 In base 10, what is -3 + -2172? -2175 In base 11, what is 946 + 0? 946 In base 2, what is 11 + -10101100? -10101001 In base 8, what is -2555 + 0? -2555 In base 16, what is -1 - -a5? a4 In base 9, what is -3 - 117? -121 In base 14, what is bb4 + 0? bb4 In base 5, what is -3 + 201? 143 In base 9, what is -121 + 223? 102 In base 6, what is -40 + 45? 5 In base 6, what is -1331 - -10? -1321 In base 15, what is 233 + 1? 234 In base 12, what is 3 + -56a? -567 In base 5, what is 23034 - 1? 23033 In base 9, what is -2 + -513? -515 In base 8, what is -5 + -41? -46 In base 13, what is 2a0 - -4? 2a4 In base 14, what is 4 + -56a? -566 In base 15, what is 2 + 603? 605 In base 8, what is -66 + 1? -65 In base 2, what is 10001111101100 - -1? 10001111101101 In base 11, what is -193 + 81? -112 In base 7, what is -2321 + 30? -2261 In base 10, what is 1 - -69? 70 In base 12, what is 979 - 0? 979 In base 2, what is -1 + -11100100000? -11100100001 In base 15, what is 12 - 30? -1d In base 15, what is 19 + eb? 115 In base 13, what is -7 + 5? -2 In base 16, what is -137 - -1? -136 In base 13, what is 24 - -1? 25 In base 12, what is -31 + -14b? -180 In base 14, what is 1 - 84? -83 In base 10, what is 1 + -156? -155 In base 3, what is 21122001 + -11? 21121220 In base 4, what is 13 - 12033? -12020 In base 12, what is 9 - -17? 24 In base 5, what is 2 + -133? -131 In base 13, what is 4ba - -3? 4c0 In base 12, what is 68 + 5? 71 In base 6, what is 3 + 3020? 3023 In base 8, what is 5 - 3210? -3203 In base 14, what is 85 - 0? 85 In base 13, what is 8b4 + -7? 8aa In base 5, what is 13 - -3344? 3412 In base 9, what is -1540 + -1? -1541 In base 7, what is -11263 - 5? -11301 In base 5, what is 2 - -412? 414 In base 11, what is 5 + 22? 27 In base 7, what is -441 + -2? -443 In base 11, what is 397 + 2? 399 In base 4, what is -200 + -21100? -21300 In base 16, what is 14 - -c3? d7 In base 3, what is -1111 - 2? -1120 In base 8, what is 21 + 262? 303 In base 2, what is -101 + -11? -1000 In base 3, what is -210 + 2? -201 In base 10, what is 0 - -314? 314 In base 8, what is -10 - -6716? 6706 In base 5, what is 4014 + 0? 4014 In base 4, what is 10033 - -11? 10110 In base 4, what is -12 - -2021? 2003 In base 15, what is -3c - -8? -34 In base 16, what is -90b + -2? -90d In base 4, what is 10 + 211? 221 In base 9, what is 172 - 6? 165 In base 7, what is 1043 + -5? 1035 In base 15, what is -6 + -6b? -72 In base 6, what is 5 + -10? -1 In base 8, what is 43 - -37? 102 In base 2, what is 100 + -111001011101? -111001011001 In base 15, what is 0 + -2b? -2b In base 9, what is -2 - -1062? 1060 In base 11, what is 1 - 32? -31 In base 10, what is 1716 + -4? 1712 In base 4, what is -11 - 1203? -1220 In base 10, what is -140 + 5? -135 In base 16, what is -e - 3? -11 In base 12, what is 20 - -1a? 3a In base 3, what is -12 - 111210? -111222 In base 4, what is -1003013 + -10? -1003023 In base 3, what is 112 + 1020? 1202 In base 7, what is -14642 - 11? -14653 In base 3, what is 2 - -120112? 120121 In base 16, what is 3 + -2? 1 In base 11, what is 1 + 17? 18 In base 13, what is -3 - 6b1? -6b4 In base 16, what is -58 + e? -4a In base 6, what is 332 - 120? 212 In base 10, what is 1689 - 5? 1684 In base 13, what is -227 + 2? -225 In base 4, what is 11 - 1330? -1313 In base 9, what is -5 + 12? 6 In base 9, what is 11 + -5625? -5614 In base 8, what is -3 - -77? 74 In base 12, what is -5 - 109? -112 In base 3, what is -2002 - -22? -1210 In base 10, what is 78 + 2? 80 In base 12, what is -a7 + 5b? -48 In base 5, what is 2431 + 2? 2433 In base 2, what is -1100 - -10110? 1010 In base 14, what is 19 + 6? 21 In base 6, what is -5 + 2334? 2325 In base 6, what is -45 + 21? -24 In base 11, what is 33 + 5? 38 In base 2, what is 111 + -10011? -1100 In base 14, what is -c + -3? -11 In base 8, what is 10151 + 0? 10151 In base 6, what is 1 + -454? -453 In base 15, what is 3 - -8a? 8d In base 7, what is 5 + -65? -60 In base 12, what is -38 - -7? -31 In base 4, what is -201232 - -3? -201223 In base 14, what is -3 - 38? -3b In base 4, what is -200 + 3? -131 In base 8, what is 406 - 15? 371 In base 10, what is -5 - 6? -11 In base 11, what is -4 + 190? 187 In base 6, what is 50 + -4? 42 In base 3, what is 10 + 211212? 211222 In base 15, what is 0 - -16? 16 In base 3, what is -10210 - 12112? -100022 In base 9, what is 4 - 60? -55 In base 13, what is -13 + 0? -13 In base 5, what is 2 - -20404? 20411 In base 10, what is -408 + 3? -405 In base 8, what is -4 + 161? 155 In base 11, what is 5 + -5? 0 In base 13, what is 1c - -28? 47 In base 6, what is 4 + 30205? 30213 In base 13, what is -39 - 103? -13c In base 6, what is -5 - 5354? -5403 In base 9, what is -3 - 1305? -1308 In base 7, what is -2000 + -5? -2005 In base 14, what is a - -332? 33c In base 2, what is -10101 - -100? -10001 In base 16, what is -3 + f? c In base 4, what is 223233 + -32? 223201 In base 10, what is 23 + -19? 4 In base 15, what is 28 - 80? -57 In base 10, what is 3475 + 0? 3475 In base 13, what is 9 + -b6? -aa In base 11, what is 5 + -3a? -35 In base 4, what is -1301 + -10? -1311 In base 15, what is ea + 1? eb In base 5, what is -233 - 22? -310 In base 5, what is -212 - -20? -142 In base 16, what is -3d - -1? -3c In base 14, what is -423 + 4? -41d In base 6, what is -42 + -32? -114 In base 9, what is 55072 - 0? 55072 In base 10, what is -2 - 29? -31 In base 8, what is -24 - -230? 204 In base 11, what is 1 + -a26? -a25 In base 8, what is -5 - 14345? -14352 In base 8, what is -6061 - 4? -6065 In base 7, what is 26 - 33? -4 In base 13, what is 2b + -88? -5a In base 7, what is -5 + -442? -450 In base 2, what is -1011010101 + 100? -1011010001	{ "pile_set_name": "DM Mathematics" }
= -2j - 5f. Suppose -jw + 5w = -220. List the prime factors of w. 2, 11 Let t be (-4)/3(-8 + -214). Suppose 0 = 4n - j - 2j - 272, t = 4n + 3j. What are the prime factors of n? 71 Suppose -4l - 2y = -7 + 3, -5l = 5y - 15. Suppose 5r = 5x - 25, 0r - 3r - 3 = 3x. List the prime factors of x - (l - 0) - -19. 2, 11 Let u(x) = 1053x - 12. Let h(q) = 81q - 1. Let j(l) = -27h(l) + 2u(l). What are the prime factors of j(-1)? 2, 3, 7 Suppose -11j + 6j - r = -441, 0 = 3j + 2r - 266. Suppose 828 = 94y - jy. List the prime factors of y. 2, 3, 23 Let u(p) be the first derivative of -p*2/2 + 12p + 9. Let c be u(7). Let z = 1 + c. List the prime factors of z. 2, 3 Suppose -3a + 672 - 147 = 0. Suppose 0 = 9l - 4l - a. List the prime factors of l. 5, 7 Let i = -14 + 11. Let d = 31 - i. List the prime factors of d. 2, 17 Suppose -5n + 5s + 1580 = 0, 0 = 2n - s - 2s - 636. Suppose -2j = 4r - 606, 4r + 5j + n - 909 = 0. What are the prime factors of r? 3, 17 Suppose 2c - 2 - 2 = 0. Let u be (-8)/(c/((-6)/3)). Let a(w) = 4w - 12. What are the prime factors of a(u)? 2, 5 Suppose 3s + 8 = 5s. Suppose sq - 6 = -2k, 5k = k - 5q + 3. Let z = 23 + k. List the prime factors of z. 2, 5 Suppose 0 = 4w + k - 1146, 6k = -2w + 2k + 566. List the prime factors of w. 7, 41 Suppose -4g - 4b + 0b + 308 = 0, -4b = -g + 77. Let v(f) = -2f*2 - 82f + 7 + gf + 3f*2. What are the prime factors of v(-5)? 3, 19 Let z(c) = 5c*2 - 41c - 32. What are the prime factors of z(-14)? 2, 761 Let o(c) = 22c + 82. What are the prime factors of o(10)? 2, 151 What are the prime factors of (-2822)/(-6) - 1/3? 2, 5, 47 Suppose -3y = 2o - 3308, -4y + 0y = -5o - 4426. Suppose -31t - y = -37t. List the prime factors of t. 2, 23 What are the prime factors of ((-1179)/(-18) - 8)/((-1)/(-4))? 2, 5, 23 Suppose 19u = 9u + 21450. What are the prime factors of u? 3, 5, 11, 13 Let v = -711 - -1582. List the prime factors of v. 13, 67 Let n(c) = -c*3 - 20c*2 + 33c + 33. What are the prime factors of n(-22)? 5, 11 Let j(a) = -67a - 126. What are the prime factors of j(-8)? 2, 5, 41 Suppose z + 5s - 8 = 11, 0 = -z + 5s - 31. Let u be ((-4186)/21)/(4/z). List the prime factors of u/115(6 + -1). 13 Let r = 1252 + -694. Let x = r - 349. List the prime factors of x. 11, 19 Suppose 4z + 968 = -2t + 17684, -5t = 4z - 16704. What are the prime factors of z? 37, 113 Suppose -3x + 2o + 19 = 4o, 0 = -2x + 4o + 2. Suppose 0 = z + 5y - 76, -4z + 0y + 244 = xy. List the prime factors of z. 2, 7 Let m be (-1)/(12/35 - (-3)/(-15)). What are the prime factors of m - -9 - (-2)/((-6)/(-681))? 229 Let p(o) = o2 + 12o + 16. Let s(b) = -3b + 0b - 4b3 + 3b*3 + b + 1. Let r be s(2). List the prime factors of p(r). 5 Let r(b) = -2b*3 - 18b*2 + 12b - 1. Let i be r(-10). Let a = i + -70. List the prime factors of a. 3 Let x(a) = -a*3 + 5a*2 - 7. Suppose 2v = -7v - 27. List the prime factors of x(v). 5, 13 List the prime factors of ((-134)/(-5))/((-14)/(-210)). 2, 3, 67 Let g(u) = 37u3 + u2 - u + 1. Let a = 24 + -23. List the prime factors of g(a). 2, 19 Let m = -26 + 30. Suppose -mx - x = -15. Suppose 4p - xp = 47. What are the prime factors of p? 47 Suppose 0 = 6w - 7w + 1921. What are the prime factors of w? 17, 113 Suppose 0 = -13a + 23a - 290. Suppose 7c - 4c + 2q - 44 = 0, 0 = -2c + 2q + 46. Let z = a - c. List the prime factors of z. 11 Let q(l) = l*2 + 7l + 14. Let i be q(-4). Suppose io - 10 = 0, -4k + 3o - 224 = -1025. What are the prime factors of k? 2, 3, 17 What are the prime factors of 41 + -45 + 2/(2/453)? 449 Suppose 3o + 71 = 452. Let p = o - 58. Suppose -4s + p = -s. List the prime factors of s. 23 Suppose -x - 2462 = -w, -27w = -31w - 2x + 9842. List the prime factors of w. 23, 107 Let r(j) = -j*3 + 3j*2 + 2. Let x be r(3). Suppose xb = 128 + 4. Suppose -2l + b = 24. What are the prime factors of l? 3, 7 Let o be 3 - ((-21)/(-18) + (-2)/12). Suppose -1 + 4 = 3i. What are the prime factors of (i/o)/((-6)/(-72))? 2, 3 Suppose 720 = 4k + c, 6k = k + 4c + 900. Suppose d - k = -5y, 25 = -2d - 3d. What are the prime factors of y? 37 Suppose -2v - 4u - 5 = 11, -v + 3u = -12. Let l be (3 - 2) + 0 - -1. Suppose 0 = -vm + lm - 128. List the prime factors of m. 2 Let u(s) = 2s*2 - 8s - 20. Let f be u(10). What are the prime factors of (18/15)/(((-21)/f)/(-7))? 2, 5 Let i(c) = -96c - 22. What are the prime factors of i(-6)? 2, 277 Suppose -49l + 11341 = -120371. List the prime factors of l. 2, 3, 7 List the prime factors of (-76080)/200(3 - 38/6). 2, 317 Let t(j) = j3 + 2j*2 - 10j - 11. What are the prime factors of t(4)? 3, 5 Suppose 2a - s + 4 = 41, 2s - 38 = -3a. Suppose u = 2q - 43, q - 3u = 3 + a. What are the prime factors of q? 2, 11 Let j = 1898 - -2191. What are the prime factors of j? 3, 29, 47 Let v(n) = -n3 + 4 + 3n - 11 + 2n3 + 4n2. Let a be v(-4). Let y = a + 31. What are the prime factors of y? 2, 3 Let g(a) = a3 + 19a2 + 2a - 51. List the prime factors of g(-18). 3, 79 Suppose 680 = 9w + w. What are the prime factors of w? 2, 17 Let f = -19 - -1. Let i = f - -7. Let c = 52 + i. List the prime factors of c. 41 Suppose -3p - 21 + 18 = 0. List the prime factors of 10570/34 - ((-114)/102 - p). 311 Let v = 22 + -19. Suppose 4r = 5n - 548, -vr = -5n + 68 + 343. List the prime factors of r/(-3) - (-10)/(-15). 3, 5 Suppose 3l - 6 = -3k, 2k + 2l - 4 = -3l. Let x be (1 + 1-1)/2. Suppose 45 = t + 4s, kt + xs - 69 = -s. What are the prime factors of t? 3, 11 Let s = 8 - 5. Let j be (3 - (-234)/s)1. Let k = j + -56. List the prime factors of k. 5 Suppose 4n = -4u + 20, -7u + 16 = -4n - 2u. Let a(l) = 2 - 6l + 4 - n. List the prime factors of a(-6). 41 What are the prime factors of 2/2 - -16(-244)/(-8)? 3, 163 Let r(y) be the third derivative of y6/48 - 3y*5/40 + 3y*4/8 - 4y*2. Let t(j) be the second derivative of r(j). What are the prime factors of t(3)? 2, 3 Suppose 36l = 105580 + 32516. List the prime factors of l. 2, 7, 137 Suppose 0 = 4c - 7 + 71. Let s be (45/(-4))/(4/c). List the prime factors of s/(-2)(-12)/10. 3 Let b(p) = -2p3 + 8p*2 + 14p + 2. Let s be b(-3). Suppose -so = -84o - 512. List the prime factors of o. 2 Suppose -336f - 1572 = -340f. List the prime factors of f. 3, 131 Let j(o) = -2o + 12. Let d be j(4). Let z be ((0 - -8) + d)12. Suppose -5g + z = -101. List the prime factors of g. 7 Let p(f) = 2f - 8. Let m be p(6). Suppose 0 = -2x + 12 - m. List the prime factors of x/((-16)/(-12)) + 20. 23 Let j(l) = -l3 + 26l*2 + 9l. What are the prime factors of j(26)? 2, 3, 13 Suppose -h - 5y + 26 = 2h, -3h - 4y + 22 = 0. Let k be (-129)/h32/(-24). List the prime factors of (-26)/(-65) - k/(-10). 3 Let x(r) be the second derivative of -r5/20 - 2r4/3 + r3/3 - 9r2/2 + 22r. List the prime factors of x(-9). 2, 3 Suppose -31t + 1288 = -27t. List the prime factors of t. 2, 7, 23 Let b(p) = -p*3 + 23. Let w = 24 + -24. Suppose wl = 3l. List the prime factors of b(l). 23 Suppose 155p - 157p + 1476 = 0. What are the prime factors of p? 2, 3, 41 Let g be (-6)/18 - 67/(-3). Let j = g + -14. List the prime factors of (j/3)/(2/3). 2 What are the prime factors of 1682 + ((-1)/7)/(32/(-224))? 3, 11, 17 Let k = 7 + -15. Let t(d) = 3d*2 + 10d - 16. List the prime factors of t(k). 2, 3 Let r = 7346 + -3743. List the prime factors of r. 3, 1201 Let j be (-32)/1260/(-16). Let k = j + -7. Suppose -kw = -2w - 2. What are the prime factors of w? 2 Let n(a) = -10a*3 - 4a*2 - 6a - 4. Suppose 7b - 3b + 11 = 3g, -3b + g - 7 = 0. What are the prime factors of n(b)? 2, 3 Suppose -2n = -d - 0n + 351, 336 = d + 3n. Suppose 0 = -4c + d - 93. What are the prime factors of c? 3, 7 Suppose 0 = 2o + 582 - 2048. List the prime factors of o. 733 Suppose -2a + 8776 = 2n, 175a + 3n = 179a - 17559. What are the prime factors of a? 3, 7, 11, 19 Let s(b) = -b*2 + 4b + 7. Let p be s(5). Let o be 3 - ((-4)/(-1))/p. What are the prime factors of -2o/(-2)21? 3, 7 Let h(s) = -4s + 9. Let d be h(4). Let t = d - -9. Suppose -tu + 231 = 5p + 2u, 3p = -2u + 137. List t	{ "pile_set_name": "DM Mathematics" }
irst derivative of b*6/60 - 7b*3/6 - 7b*2/2 + 10. Let w(v) be the second derivative of c(v). What is the derivative of w(g) wrt g? 6g*2 Let l(u) = 4u*4 - 2u*3 + 282u*2 + 9. Let r(i) = 2i*4 + 1. Let k(b) = 2l(b) - 18r(b). Find the third derivative of k(c) wrt c. -672c - 24 Let z(x) be the second derivative of 0x5 + 0x*2 + 0x*6 - 29x + 3x4 + 0x*7 + 0 + 39/56x*8 + 0x*3. What is the third derivative of z(h) wrt h? 4680h*3 Let a(t) be the first derivative of -10t*2 - t + 11. Let d be a(-1). Find the third derivative of 0h*5 - 9h5 - h5 + 17h2 - dh*2 wrt h. -600h*2 Let o(z) = -14z*2 + 7z + 47. Let s(m) = 13m2 - 6m - 46. Let a(i) = 5o(i) + 6s(i). Find the second derivative of a(t) wrt t. 16 Differentiate -3w - 4w - 3w - 10w - 85 - 188w4 + 19w wrt w. -752w3 - 1 Let g = -1 - -8. Let o = -6 + g. What is the first derivative of -3 - o + 2b + 1 + 2 wrt b? 2 Let b(c) = c*3 + 11c*2 - 27c + 7. Let l be b(-13). What is the second derivative of -10a - 5a + la - 26a*4 + 24a wrt a? -312a2 Let g(x) = 32x*2 + 461x + 707. Let u(k) = 6k2 + 92k + 141. Let b(n) = 2g(n) - 11u(n). Differentiate b(j) with respect to j. -4j - 90 Suppose -5m + o + 16 = -12, 4m - 5 = -5o. Find the second derivative of -13b - mb*4 + 3b*4 - 4b*4 wrt b. -72b*2 Let u(r) be the second derivative of 5/24r*4 + 0r*2 - 1/60r*5 - 5/6r*3 + 0 + 5r. Let n(l) be the second derivative of u(l). Differentiate n(o) wrt o. -2 Let c = -3 + 14. Find the third derivative of -31n2 + 0n*3 + 0n*3 - cn*4 + 36n*2 wrt n. -264n Suppose 4a = -0a + 200. Suppose 0q + a = 5q. What is the second derivative of 10s4 + 9s*5 - qs*4 + 10s wrt s? 180s3 Let l(w) = w2 + 17w + 58. Let g be l(-13). Let d(h) = -h*3 + 2h*2 + 2h - 2. Let c be d(2). Differentiate 4n2 - 8n*2 + 6n*c + g wrt n. 4n Let c(o) = -18o2 + 5o. Let i(g) = -18g2 + 4g. Let h = 27 - 22. Let k(z) = hc(z) - 6i(z). Find the second derivative of k(x) wrt x. 36 Let p(d) be the second derivative of 23d5/20 - d4/2 - 139d*3/6 - 9d - 5. Find the second derivative of p(y) wrt y. 138y - 12 Find the second derivative of -71t + 102t - 103t + 134t2 wrt t. 268 Let c(d) be the first derivative of 6d*4 + 0d*2 + 20 + 0d - 1/3d3. What is the third derivative of c(h) wrt h? 144 Let u(i) = 5i*2 + 9i - 416. Let k(y) = 2y2 - 3. Let b(n) = 5k(n) + u(n). What is the derivative of b(d) wrt d? 30d + 9 Find the third derivative of -17l*6 - 10l*2 + 60l*3 + 54l*3 - 4 - 112l*3 wrt l. -2040l*3 + 12 Let n(p) = -12p*3 + 10p*2. Suppose -4d = -11d - 77. Let g(q) = -23q*3 + 21q*2. Let y(z) = dn(z) + 6g(z). Find the third derivative of y(k) wrt k. -36 Let j(v) = 149v*3 - 46v*2 + 4v + 3. Let m(k) = -148k3 + 47k*2 - 6k - 4. Let q(r) = 4j(r) + 3m(r). What is the third derivative of q(z) wrt z? 912 Let j = -45 - -48. What is the first derivative of -13 - jy2 + 20 - 18 wrt y? -6y Find the second derivative of 542g4 + 6667g*2 + 21 - 15g - 6g - 6667g*2 wrt g. 6504g*2 Let j = 1255 + -1255. Let u(f) be the second derivative of 0 + jf*3 + 5/2f*2 + 4f - 5/6f4. Find the first derivative of u(c) wrt c. -20c What is the third derivative of 65l2 + 182l + 185l2 - 182l - 180l5 wrt l? -10800l*2 Let h(l) = -26l*3 - 42l*2 + 2l - 8. Let t(q) = -77q3 - 128q*2 + 6q - 22. Let w(d) = 11h(d) - 4t(d). What is the third derivative of w(x) wrt x? 132 Let p(y) be the first derivative of -2y3/3 - 17y*2/2 - 33y + 29. Differentiate p(u) wrt u. -4u - 17 Find the second derivative of 9c - 2 + 7c + c3 - 4 - 15c*4 + 4 wrt c. -180c*2 + 6c Let t = -42 - -50. Find the third derivative of -td3 - 5d*2 + 5d*3 - 4d*3 + 15d2 wrt d. -42 Let v(m) = -m4 + m3 - m2 - m + 1. Let o(g) = 15g4 - 2g3 - g2 - 11g - 2. Let d(w) = -o(w) - 2v(w). Find the third derivative of d(c) wrt c. -312c Let u(p) be the third derivative of -p9/28 + 19p*5/20 + 24p*2 - 2. What is the third derivative of u(z) wrt z? -2160z*3 What is the second derivative of -118q*5 - 683q - 185q5 - 79q*5 wrt q? -7640q*3 Let m(k) be the third derivative of -11k*8/84 + 103k*5/60 - 27k*2 - 2k. What is the third derivative of m(i) wrt i? -2640i2 Let z(v) = -v6 - v3 - v2 - v + 1. Let l(a) = -175a*6 - 6a3 - a2 - 4a + 15. Let q(y) = l(y) - 4z(y). What is the third derivative of q(i) wrt i? -20520i3 - 12 Let f(v) = -v2 - 2v*2 + 3v*2 + 1 + 3v*2. Let k be f(3). What is the third derivative of 22m*2 + m - 5m*5 - km*2 - m wrt m? -300m*2 Let m(h) = -17h - 7. Let i be m(-3). Find the first derivative of -20t + 14t*3 - 14 - 24t + it wrt t. 42t*2 Let i be ((-110)/15)/(4/(-6)). What is the second derivative of -14l*3 + il*3 - 12l + 12l3 wrt l? 54l Suppose -42y = -43y + 4. What is the first derivative of 4 + 2by + 13b*4 + 22 wrt b? 60b*3 Let u be 3/((-6)/(-4)) + 1. What is the second derivative of 9a*5 + 14a - 8a + ua wrt a? 180a3 Let c(v) be the second derivative of -9v*5/10 + 7v*4/12 + 167v*2/2 - 2v + 38. Find the first derivative of c(w) wrt w. -54w2 + 14w Let d(k) be the third derivative of 17k6/120 - 13k*4/4 - 120k*2. What is the second derivative of d(m) wrt m? 102m Suppose j - 8 = -5g, -5j + 0g = -2g - 13. Find the second derivative of -345n3 + 345n*j + 10n*4 - 14n wrt n. 120n2 Let t(d) be the third derivative of -d7/210 - 13d*5/120 - 5d*4/8 + 10d*2. Let n(l) be the second derivative of t(l). Differentiate n(c) wrt c. -24c Let p(o) be the second derivative of -7o4/4 - 5o*3/6 + 875o*2/2 - 2o + 819. What is the first derivative of p(w) wrt w? -42w - 5 Let m(n) be the first derivative of 7/3n*3 + 28n - 26 + 0n2. Differentiate m(a) with respect to a. 14a Suppose 0 = t + 4f - 9f + 2, -3t - 5f = 6. Let z be -3 + 9 + t - -1. Find the second derivative of 11b5 + 6b - 3b5 + zb wrt b. 160b3 Suppose 3p + 2p = 60. Suppose 2z + 26 = 5c + z, 23 = 5c + 2z. What is the second derivative of 6g*c - 3g + pg + 2g*5 wrt g? 160g*3 Let m(n) = 8n + 42. Let c be m(-5). What is the second derivative of -2y - 16y*c + 37y*2 - 22y*2 + 23 wrt y? -2 Let u(o) be the second derivative of 7o + 0o2 + 13/30o*6 + 0o*5 + 0 + 13/6o*3 + 0o*4. What is the second derivative of u(t) wrt t? 156t*2 What is the second derivative of 84q + 4q4 - q4 + 1 + 24q + 0q4 + 15q*2 wrt q? 36q*2 + 30 Let l(m) be the third derivative of 0m + 0m3 - 9m*2 - 7/24m*4 + 0 + 1/10m*5. What is the second derivative of l(a) wrt a? 12 Suppose -5l - 2b + 104 = -6b, -4b + 16 = l. Let r = l - 18. What is the first derivative of 9 - 3f + 2f + 2f + rf wrt f? 3 Suppose 0 = -4t - 3x + x + 24, t = x + 6. What is the derivative of tk*4 + 2 - 6 + 22 wrt k? 24k3 Find the second derivative of p3 + 0p + 93p + 28p4 - 69p*4 wrt p. -492p*2 + 6p Find the second derivative of -15b - 2b*5 - 61b*3 - 47b*3 + 35b + 97b3 wrt b. -40b*3 - 66b Let t(v) = -465v3 - 143v*2 + 3v - 9. Let z(d) = 2d3 + d - 3. Let i(b) = 2t(b) - 6z(b). Find the third derivative of i(f) wrt f. -5652 Let p(d) = -d3 + 8d*2 - 6d - 5. Let f be p(7). Suppose 4 = c + f. Find the third derivative of 9t6 + 5tc - t6 + 6t2 wrt t. 960t*3 Let a(s) = 2s*2 - 6s - 4. Let v be a(7). Let d be -22(-117)/v. Differentiate -b + 9b2 - d + b + 0b wrt b. 18b Let a(p) = 0p*3 + 50 + 5p*3 - 46 - 14p*2. Let y(m) = -11m*3 + 28m*2 - 9. Let x(g) = 9a(g) + 4y(g). Find the third derivative of x(n) wrt n. 6 Suppose -2t = -4v + 38, 5v + 5t - 51 = 4t. What is the third derivative of k*2 + 10k*3 - 23k*2 + 13k*6 - vk*3 wrt k? 1560k*3 Suppose 0 = -5u + 25. Find the second derivative of 133au - 62a*5 - 66a*5 - 12a wrt a. 100a3 Let q = -4 - -14. Let s(m) be the first derivative of 5m*4 - 3m*4 - 3m*2 + 1 - q. What is the second derivative of s(o) wrt o? 48o Let q = -24 + 26. Suppose qt + 3o = -0o + 469, -t = 3o - 236. Find the second derivative of 3 - tk + 221k - 8k*2 - 3 wrt k.	{ "pile_set_name": "DM Mathematics" }
-3l2 - 456l + 459. -3(l - 1)(l + 153) Suppose -1018900082u3/15 - 407541976u*2/3 + 180566u/15 - 4/15 = 0. What is u? -2, 1/22571 Find q such that -q*5 - 336q*4 - 1002q*3 - 1000q*2 - 333q = 0. -333, -1, 0 Factor 2u2 - 457960u + 26215920200. 2(u - 114490)2 Find c such that -c3/2 - 107c*2/2 - 1476c - 3960 = 0. -60, -44, -3 Suppose -80r5 + 156200r*4 + 78195r*3 - 146435r*2 - 78115r - 9765 = 0. Calculate r. -1, -1/4, 1, 1953 Factor w*4/5 - 7814w*3/5 + 15194161w*2/5 + 275396616w/5 + 1242139536/5. (w - 3916)*2(w + 9)*2/5 What is u in 4u*3 + 217400u*2 + 434788u + 217392 = 0? -54348, -1 Solve 5a3 - 2090a*2 - 4200a = 0 for a. -2, 0, 420 Suppose -c*3/4 + 1649c*2/4 - 183998c + 11332228 = 0. What is c? 73, 788 Determine w, given that w*4/7 + 79w*3/7 - 327w*2/7 + 59w - 166/7 = 0. -83, 1, 2 Factor 3y2/5 - 1160778y/5 - 1160781/5. 3(y - 386927)(y + 1)/5 Determine x, given that 4x3/7 - 5388x*2 + 88924896x/7 - 88887184/7 = 0. 1, 4714 Factor 4u2 - 2570112u + 5140208. 4(u - 642526)(u - 2) Determine y so that 3y3 - 120y*2 - 828y = 0. -6, 0, 46 Let -2p2/11 + 63196p - 5491384822 = 0. Calculate p. 173789 Factor 13k2 - 8364k - 21964. (k - 646)(13k + 34) Factor 4b5/5 + 56b*4/5 + 184b*3/5 + 256b*2/5 + 164b/5 + 8. 4(b + 1)4(b + 10)/5 Find s, given that 19s4 - 17s*3 - 1370s*2 - 144s = 0. -8, -2/19, 0, 9 Solve -2f2 + 4072f + 49152 = 0. -12, 2048 What is w in -2w4/5 - 514w*3/5 + 516w*2/5 = 0? -258, 0, 1 What is t in -5t*5 - 775t*4 - 7355t*3 - 15025t*2 + 29500t + 72500 = 0? -145, -5, -2, 2 What is m in m*5/5 - 14953m*4/5 - 14963m*3/5 + 134597m*2/5 - 164498m/5 + 59816/5 = 0? -4, 1, 14954 Factor c*3 - 66c*2 - 424c - 576. (c - 72)(c + 2)(c + 4) Factor -48b3 - 7080b*2 - 10539b - 3942. -3(b + 146)(4b + 3)2 Suppose 2n*5/3 - 4412n*4/3 + 2442020n*3/3 - 3234000n*2 + 799326n + 4848804 = 0. Calculate n. -1, 2, 3, 1101 Determine c, given that 6c2 + 176c/3 + 256/3 = 0. -8, -16/9 Find y, given that -y*4/5 - 22467y*3/5 + 44938y*2/5 = 0. -22469, 0, 2 What is o in -2o*4/21 + 202o*3/7 + 1220o*2/21 = 0? -2, 0, 305 Suppose 2l*4/7 - 1278l*3/7 - 15528l*2/7 - 62368l/7 - 11904 = 0. Calculate l. -4, 651 Let 2d5 + 44d*4 + 322d*3 + 856d*2 + 576d = 0. Calculate d. -9, -8, -4, -1, 0 Let 4v2 - 3322728v + 690032585124 = 0. Calculate v. 415341 Determine q, given that -3q5 - 735q*4/4 + 3597q*3/2 - 10857q*2/4 + 2205q/2 = 0. -70, 0, 3/4, 1, 7 What is o in -2o4/5 + 440082o*3/5 = 0? 0, 220041 Determine x, given that -12x*4 - 3400x*3 - 202016x*2 + 5681152x - 3696640 = 0. -152, 2/3, 20 Factor 4z2 - 2856280z + 509895964900. 4(z - 357035)2 Factor 4k*2/5 - 40024k/5 + 80032/5. 4(k - 10004)(k - 2)/5 Factor 3t2 - 567024t + 26793018048. 3(t - 94504)2 Factor 4x*4 - 712x*3 + 8772x*2 - 31824x + 23760. 4(x - 165)(x - 6)*2(x - 1) Suppose 441o3/10 + 57288o*2/5 - 10918o/5 + 104 = 0. Calculate o. -260, 2/21 What is j in -4j5 - 316j*4 - 5364j*3 + 33084j*2 - 42120j = 0? -45, -39, 0, 2, 3 Determine m so that -2m5/5 - 16m*4/5 + 1544m*3/5 + 9412m*2/5 - 1542m/5 - 9396/5 = 0. -29, -6, -1, 1, 27 Factor -2w2/15 + 213988w/15 - 5723858018/15. -2(w - 53497)2/15 Suppose -k4/2 + 97k*3/2 + 3975k*2/2 + 40019k/2 + 60515 = 0. What is k? -19, -7, 130 Factor 4y4 + 132896y*3 + 1471867488y*2 + 5435115656320y + 10864344905792. 4(y + 2)(y + 11074)*3 Let -6v*4 + 117718v*3/5 - 115593102v*2/5 + 44604906v + 15382084/5 = 0. Calculate v. -1/15, 2, 1961 Solve q*4/3 + 186q*3 - 10351q*2/3 + 3264q = 0 for q. -576, 0, 1, 17 Solve -4w2/7 + 2552w/7 + 7692/7 = 0. -3, 641 Suppose 12g4 - 2505g*3 + 114453g*2 + 146370g + 29400 = 0. Calculate g. -1, -1/4, 70, 140 Factor -5z3/6 + 55z*2/2 + 265z/3 + 60. -5(z - 36)(z + 1)(z + 2)/6 Factor 99v*2 + 507v - 8400. 3(v - 7)(33v + 400) What is w in -w2/3 + 66w + 808/3 = 0? -4, 202 Factor -l*2/6 - 947390l/3 - 448773906050/3. -(l + 947390)*2/6 What is f in 2f*3/9 + 122f*2/9 - 12320f/9 - 774200/9 = 0? -70, 79 Factor -2k3/17 - 96k*2/17 - 62k. -2k(k + 17)(k + 31)/17 Solve 11s*2/3 - 3827s/3 - 116 = 0. -1/11, 348 Find j, given that j*5/3 - 22j*4 - 848j*3/3 + 22j*2 + 847j/3 = 0. -11, -1, 0, 1, 77 Determine j, given that -4j4 + 416j*3 + 1708j*2 + 2152j + 864 = 0. -2, -1, 108 Factor 3z4 - 234z*3 + 2787z*2 - 6336z. 3z(z - 64)(z - 11)(z - 3) Determine t, given that t*5/3 + 11431t*4/3 + 22853t*3 + 34275t*2 = 0. -11425, -3, 0 Find y, given that -3y*4/5 + 144y*3/5 + 222y*2 + 2448y/5 + 297 = 0. -3, -1, 55 Suppose -i*4 + 2329i3 + i2 - 2329i = 0. Calculate i. -1, 0, 1, 2329 Let 2h*3/5 - 4778h*2/5 + 570254h + 571210 = 0. What is h? -1, 1195 Factor 3s3 - 118041s*2 + 3303384s - 23119572. 3(s - 39319)(s - 14)*2 Factor -15d*2 + 1203d + 2426/3. -(3d + 2)(15d - 1213)/3 Let 16k*5 + 4132k*4 + 129112k*3 + 713620k*2 - 6965600k - 1784000 = 0. Calculate k. -223, -20, -1/4, 5 Determine l, given that -14l2/3 - 1492l/9 - 6410/9 = 0. -641/21, -5 Let q*5/3 - 334q*4 + 60292q*3/3 - 356734q*2 + 4169707q/3 - 1052932 = 0. Calculate q. 1, 4, 29, 939 Determine t, given that 5t3/3 - 3550t*2/3 + 9345t + 10530 = 0. -1, 9, 702 Let -3y4/2 - 1395y*3 + 3y*2/2 + 1395y = 0. Calculate y. -930, -1, 0, 1 Solve n*2 + 388n + 13300 = 0. -350, -38 Let 98k3/5 + 714k*2 + 3033k/10 + 162/5 = 0. Calculate k. -36, -3/14 Suppose -4b2/5 - 23072b - 166349120 = 0. Calculate b. -14420 Factor 6971378w2/3 + 3734w + 3/2. (3734w + 3)2/6 What is f in -f2/4 + 209f/4 - 591 = 0? 12, 197 Let -q*4/4 - 555q*3/4 - 1379q*2/2 - 1101q - 550 = 0. What is q? -550, -2, -1 Factor 2o4 - 668o*3 + 1990o*2 - 1324o. 2o(o - 331)(o - 2)(o - 1) Suppose -6d4/11 - 18d*3 - 666d*2/11 + 870d/11 = 0. Calculate d. -29, -5, 0, 1 Determine l so that -4l5/3 - 19704l*4 - 72737292l*3 + 1310867728l*2/3 - 655621120l + 291422208 = 0. -7392, 1, 4 Find g, given that -2g4 + 3152g*3 - 3148g*2 - 3152g + 3150 = 0. -1, 1, 1575 Determine r so that 328683r5 + 4605534r*4 + 19776600r*3 + 23903664r*2 + 286704r + 864 = 0. -6, -2, -2/331 Factor -5w4 - 11090w*3 - 5819385w*2 + 365992180w - 5445660020. -5(w - 29)2(w + 1138)*2 Factor 5k*3/3 - 365k*2 + 25800k - 1738060/3. 5(k - 86)2(k - 47)/3 Let n*5 - 510n*4 - 8347n*3 - 36308n*2 + 6972n + 206192 = 0. Calculate n. -7, -4, 2, 526 Factor -2g3 + 29696g*2. -2g*2(g - 14848) Suppose -106a2/9 - 920a/9 = 0. Calculate a. -460/53, 0 Solve l*4/5 + 9l*3 - 78l*2/5 - 1412l/5 + 552 = 0 for l. -46, -6, 2, 5 Factor j*2/2 - 1816839j + 3300903951921/2. (j - 1816839)*2/2 Factor -4l*2 + 1001268l - 2002520. -4(l - 250315)(l - 2) Factor 4w3 + 296w*2 - 1900w + 1600. 4(w - 5)(w - 1)(w + 80) Suppose 3z*3 - 3186z*2 - 58269z - 55080 = 0. Calculate z. -17, -1, 1080 Find f, given that 2f3/5 + 16444f*2/5 + 229824f/5 = 0. -8208, -14, 0 Factor 5f2 + 31775f. 5f(f + 6355) Find v, given that 2v3 - 54132v*2 + 432960v - 865856 = 0. 4, 27058 Factor z*3 + 121z*2 + 3191z + 3071. (z + 1)(z + 37)(z + 83) Determine f so that f*3/2 + 1036f*2 + 43071f/2 = 0. -2051, -21, 0 Find f, given that -f*3 + 140198f*2 - 4913589393f - 19656600804 = 0. -4, 70101 Suppose 13536o4 + 28946o*3 + 3514o*2 - 464o + 8 = 0. What is o? -2, -2/9, 1/47, 1/16 Factor 3k4/2 - 201k*3 + 6072k*2. 3k*2(k - 88)(k - 46)/2 Determine r, given that -r5 + 789r*4 - 1570r*3 - 3156r*2 + 6296r = 0. -2, 0, 2, 787 Factor v*2 - 2806686v + 1969371575649. (v - 1403343)*2 Factor -5m*2 + 8170m. -5m(m - 1634) Let 2z2/25 - 6428z/25 = 0. What is z? 0, 3214 Suppose 2r4/3 + 4r*3 - 2954r*2/3 + 980r = 0. Calculate r. -42, 0, 1, 35 What is a in -3a5 - 993a*4 - 14382a*3 - 50868a*2 + 104328a + 614304 = 0? -316, -6, 3 Determine q so that 5q4 - 185q*3 - 14475q*2 + 15705q + 87750 = 0. -39, -2, 3, 75 Factor 2j3/13 - 648j*2/13. 2j*2(j - 324)/13 Let 20l5 - 320l*4 - 5775l*3 - 6705l**	{ "pile_set_name": "DM Mathematics" }
res. 0.7185391 How many seconds are there in 1/24 of a day? 3600 How many months are there in 806.7007 millennia? 9680408.4 How many hours are there in ten thirds of a day? 80 How many years are there in six fifths of a century? 120 How many days are there in 2546.3058 hours? 106.096075 How many milligrams are there in 707.0324g? 707032.4 Convert 2677212.3 months to years. 223101.025 What is fifty-one fifths of a minute in seconds? 612 What is 42.85284 litres in millilitres? 42852.84 What is 173905.5l in millilitres? 173905500 How many nanometers are there in 3/32 of a millimeter? 93750 What is eleven tenths of a millimeter in micrometers? 1100 What is 78.72198ns in milliseconds? 0.00007872198 What is 34/5 of a day in minutes? 9792 How many meters are there in 94.28509 kilometers? 94285.09 Convert 23.0342 decades to years. 230.342 How many millilitres are there in 3/50 of a litre? 60 What is 962029.6kg in tonnes? 962.0296 How many micrograms are there in 655897.6 grams? 655897600000 What is one tenth of a milligram in nanograms? 100000 Convert 767013.9 litres to millilitres. 767013900 How many milliseconds are there in twenty-one eighths of a second? 2625 Convert 17.80461 decades to months. 2136.5532 Convert 6.312511 grams to kilograms. 0.006312511 Convert 855.4089 litres to millilitres. 855408.9 What is thirty-seven halves of a millimeter in micrometers? 18500 What is 152.2465 millennia in decades? 15224.65 What is seven quarters of a milligram in micrograms? 1750 How many millilitres are there in 9.582821 litres? 9582.821 What is three tenths of a day in seconds? 25920 How many years are there in six fifths of a decade? 12 What is twenty-seven halves of a century in decades? 135 How many millilitres are there in 31/5 of a litre? 6200 What is two fifteenths of a century in months? 160 How many millilitres are there in six fifths of a litre? 1200 How many months are there in 15/4 of a decade? 450 What is six fifths of a litre in millilitres? 1200 How many micrometers are there in 7/4 of a centimeter? 17500 What is 735771.4ml in litres? 735.7714 Convert 8023.084 centimeters to kilometers. 0.08023084 What is 5135.379ug in kilograms? 0.000005135379 How many centuries are there in 0.3040169 millennia? 3.040169 Convert 4.068152kg to nanograms. 4068152000000 How many microseconds are there in 0.6454144 minutes? 38724864 How many kilograms are there in 3/5 of a tonne? 600 Convert 0.0137546 weeks to hours. 2.3107728 What is 71/4 of a litre in millilitres? 17750 How many millilitres are there in twenty-seven fifths of a litre? 5400 How many millilitres are there in 12/25 of a litre? 480 What is 0.8095318 decades in centuries? 0.08095318 What is 10.32512 grams in tonnes? 0.00001032512 How many meters are there in 25/2 of a kilometer? 12500 Convert 0.0070872 meters to nanometers. 7087200 What is 6/25 of a kilogram in grams? 240 What is 7/2 of a millennium in decades? 350 What is 956955.8kg in micrograms? 956955800000000 How many micrograms are there in 1/5 of a milligram? 200 How many months are there in three tenths of a millennium? 3600 How many kilograms are there in 37/5 of a tonne? 7400 How many nanograms are there in 446721.3mg? 446721300000 What is 1/5 of a millennium in centuries? 2 Convert 15.1897545ms to days. 0.00000017580734375 How many micrometers are there in twenty-five quarters of a centimeter? 62500 What is 3/50 of a litre in millilitres? 60 How many millilitres are there in 1/10 of a litre? 100 What is eleven tenths of a meter in millimeters? 1100 What is 7/15 of a minute in milliseconds? 28000 How many millimeters are there in 242706.8 meters? 242706800 How many nanograms are there in 0.689484 tonnes? 689484000000000 How many millilitres are there in twenty-seven quarters of a litre? 6750 How many seconds are there in 5/6 of a hour? 3000 What is fifty-five quarters of a kilogram in grams? 13750 How many millimeters are there in 1/20 of a meter? 50 What is 33/5 of a litre in millilitres? 6600 What is 3/10 of a centimeter in millimeters? 3 How many grams are there in 910.4868 milligrams? 0.9104868 What is 3.349239m in centimeters? 334.9239 What is 379751.3 years in centuries? 3797.513 What is thirteen eighths of a millimeter in micrometers? 1625 What is one fifth of a millimeter in micrometers? 200 Convert 4.8436 micrometers to kilometers. 0.0000000048436 Convert 7951.548 centimeters to millimeters. 79515.48 Convert 1.697005 weeks to days. 11.879035 What is five eighths of a litre in millilitres? 625 What is 0.7535287us in nanoseconds? 753.5287 Convert 20265.039 microseconds to minutes. 0.00033775065 What is 46/5 of a litre in millilitres? 9200 What is fourty-five halves of a gram in milligrams? 22500 How many minutes are there in 1/60 of a day? 24 What is twenty-one eighths of a tonne in kilograms? 2625 Convert 0.2714321 grams to nanograms. 271432100 How many millilitres are there in 21/5 of a litre? 4200 What is one tenth of a century in months? 120 How many tonnes are there in 72.01855kg? 0.07201855 Convert 0.1365126 centuries to years. 13.65126 What is 0.2103474mm in centimeters? 0.02103474 Convert 0.4597613 years to centuries. 0.004597613 What is twenty-one halves of a tonne in kilograms? 10500 Convert 5946.082kg to grams. 5946082 What is 347317.9ug in grams? 0.3473179 How many millilitres are there in 42/5 of a litre? 8400 How many millilitres are there in three eighths of a litre? 375 How many years are there in 1/4 of a century? 25 What is 3/32 of a kilometer in millimeters? 93750 How many hours are there in seven quarters of a week? 294 How many minutes are there in eleven tenths of a day? 1584 What is 3/10 of a centimeter in millimeters? 3 What is 43/4 of a decade in months? 1290 What is seventeen halves of a litre in millilitres? 8500 What is 230.23959 hours in weeks? 1.37047375 How many minutes are there in 1/20 of a day? 72 How many meters are there in thirty-seven halves of a kilometer? 18500 Convert 0.9672694 centuries to millennia. 0.09672694 What is three tenths of a litre in millilitres? 300 How many milliseconds are there in one quarter of a minute? 15000 What is 65/3 of a decade in months? 2600 Convert 7.459843 years to months. 89.518116 How many meters are there in 5.919198 micrometers? 0.000005919198 Convert 6.67257l to millilitres. 6672.57 What is 5917.37nm in millimeters? 0.00591737 Convert 0.791507kg to micrograms. 791507000 Convert 377.5258 nanoseconds to microseconds. 0.3775258 How many micrometers are there in 27/4 of a centimeter? 67500 How many minutes are there in 3/8 of a week? 3780 How many hours are there in 7/3 of a week? 392 What is 5220.564 millilitres in litres? 5.220564 What is 30743.4 millennia in centuries? 307434 How many milligrams are there in 25/2 of a gram? 12500 What is 15/4 of a litre in millilitres? 3750 How many micrometers are there in fourty-eight fifths of a centimeter? 96000 Convert 71135.38 centuries to decades. 711353.8 What is twenty-five quarters of a litre in millilitres? 6250 Convert 4.927862 tonnes to nanograms. 4927862000000000 How many millilitres are there in 864.992l? 864992 How many millimeters are there in 43.5551 micrometers? 0.0435551 What is 26.84013 tonnes in micrograms? 26840130000000 What is 12/25 of a meter in centimeters? 48 What is 17610.27l in millilitres? 17610270 What is six fifths of a microgram in nanograms? 1200 How many centimeters are there in 2.18403 meters? 218.403 Convert 306961.2 decades to millennia. 3069.612 How many milligrams are there in twenty-nine fifths of a gram? 5800 Convert 649391.5 millilitres to litres. 649.3915 What is 42.44024us in milliseconds? 0.04244024 What is 13/4 of a minute in seconds? 195 Convert 960613.3g to nanograms. 960613300000000 What is seventy-one quarters of a millisecond in microseconds? 17750 How many millilitres are there in 1/5 of a litre? 200 How many millilitres are there in 3/25 of a litre? 120 How many milligrams are there in thirteen eighths of a gram? 1625 What is 8769.398 meters in micrometers? 8769398000 Convert 47893.29 hours to minutes. 2873597.4 Convert 379.0989ns to hours. 0.00000000010530525 How many millilitres are there in 31/2 of a litre? 15500 What is thirty-seven halves of a meter in centimete	{ "pile_set_name": "DM Mathematics" }
Let a be f(u). Let m(v) = a - 574 + 0v3 - v2 + v + v3. Give m(0). 3 Let t = -56 + 58. Let u be -3((-2)/t)/(1/(-3)). Let s(r) = -1 + 0 - 6 - r - 1. What is s(u)? 1 Let m(c) = c*2 - 169c + 16 + 351c - 168c - 4. Determine m(-12). -12 Let b(l) = -294l2 - 301l*2 + l + 904l*2 - 304l2 + 33 + l3. Give b(-6). -9 Let l(v) = 20v2 - 2 - 13 + 23 + v - 10. Determine l(1). 19 Let s(b) = -75b*3 + 154b*3 - 42 - b - 80b*3. Determine s(0). -42 Let k(m) = 2m - 4. Let g(n) be the first derivative of -7n2/2 - 53n - 24. Let x be g(-8). Calculate k(x). 2 Let w(j) = -5 + 0 - 3j2 - j3 + 2 - 2j - 2 + 8j2. Calculate w(2). 3 Let s(y) = 76y - 238y + 0y*2 + 86y + 85y + 2y*2 - 134. Determine s(-11). 9 Suppose 2d = -4o - 2, 27o - 8 = 25o. Let g(b) = -b3 + 11b*2 - 7. Let y(l) = 6l*3 - 56l*2 + l + 34. Let w(u) = 11g(u) + 2y(u). What is w(d)? -27 Let g(w) = -3w + 115. Let d be ((-3)/(-3))/((-10)/72(-91)/455). Determine g(d). 7 Let k(h) be the third derivative of -h4/8 - 5h*3/3 + 2h*2 - 4h. What is k(-11)? 23 Let g be ((-5)/(-15))/(1/1167). Let b(a) = a - ga2 + 386a*2 - 4a. Calculate b(-3). -18 Let v = 2 + 2. Let r(p) = 11p2 + 4p + 4. Let i(k) = -k*3 + 3k*2 + 7k - 14. Let x be i(2). Let g(n) = -3n2. Let l(q) = xg(q) + r(q). Calculate l(v). 4 Let f(c) be the third derivative of 5c4/8 + 61c*3/2 + 728c*2 - 8. What is f(-13)? -12 Suppose -28 = -37p + 157. Let h(i) = -i*3 + 8i*2 - 8i + 12. Give h(p). 47 Let h(z) = 4z - 29. Let c(q) = 21q - 146. Let y(g) = -2c(g) + 11h(g). Let l = 317429 + -317416. Calculate y(l). -1 Suppose -d - 13s + 16s = 21, 5d + 2s = -105. Let w(j) = -j*3 - 20j*2 + 20j - 22. Determine w(d). -1 Suppose 2x - o - 2 = 0, 0x + 2o + 4 = 3x. Let i(s) = s - 13. Determine i(x). -13 Suppose -7l + 36 = -48. Let w(b) = -b3 + 14b*2 - 11b + 4. Let z be w(13). Let n(x) = -z + 15 + l + x. Give n(0). -3 Let x = 22 - 22. Suppose -6l = -xl - 594. Let m(r) = -99 + l - 4r. Calculate m(2). -8 Let r(v) = 2v*2 + 69v - 37. Let c = -7936 - -7901. What is r(c)? -2 Let j(w) = w + 2. Suppose 5l - 4l - 3z + 5 = 0, -27 = -5l + 2z. Suppose -2y - 16 = 4r, -15 = lr - 4r + 3y. What is j(r)? -1 Let t(y) = -y*2 - 8y + 1. Suppose 0 = -4d + 3l - 0l + 81, 0 = -5l - 15. Suppose -565f + d = -567f. What is t(f)? -8 Suppose -54z = 7 + 47. Let w(o) = 5o*2 - 2o. Calculate w(z). 7 Let v(g) be the first derivative of g*3/3 + 5g*2/2 + 17g + 1463. Determine v(-4). 13 Let z(w) = -w*3 + 5w*2 - 6w + 5. Let u be 6/(-3)2 - (-3 + 94). Let x be (-4)/(-18) + 28u/(-180). Suppose xv - v = 56. Determine z(v). -3 Let q(i) = 99i*2 + 28i + 11. Let x(m) = 89m2 + 26m + 10. Let y(o) = -9q(o) + 10x(o). Suppose -9 = -3f - 5c - 2, 2c + 2 = 0. Calculate y(f). 17 Let i(k) = -4k - 2. Let m(a) = 17a + 7. Let r(y) = -21i(y) - 6m(y). Suppose -5t - 11 = 4h, h - 13 = -5t + 3h. Calculate r(t). -18 Let v(o) = -24o*3 - 78o*2 - o + 138. Let z(k) = -17k*3 - 52k*2 - k + 92. Let w(d) = -5v(d) + 7z(d). What is w(-26)? 6 Let m(s) = -s3 - 4s*2 + 3s - 3. Suppose -t - 24w = -22w - 4, -45 = -3t + 5w. Suppose 80 + t = -15r. Determine m(r). 51 Let s(i) = 114i - 192. Let q(d) = 30d - 48. Let b(z) = 15q(z) - 4s(z). Give b(7). 6 Suppose 4o + 20c = 18c - 20, 3c + 24 = -4o. Let x(i) = -49i + 5. What is x(o)? 152 Let f(n) = -5n*2 + 77n + 49. Let u be f(16). Let l(r) = -12r3 + 2r*2 + r - 2. Determine l(u). -11 Let i be (-2)/(8/4 - 3). Let z(m) = 5m*3 + 14m - 2. Let l(c) = 6c3 + 16c - 2. Let t(k) = -6l(k) + 7z(k). Calculate t(i). -6 Let p(w) = -215w - 653. Let v be p(-3). Let m(l) = -2l*3 - 14l*2 + 19l + 18. Calculate m(v). -6 Suppose 0 = 6j - 6 + 30. Let r(m) be the second derivative of 0 - 18m - m*3 + 0m*2 - 1/12m*4. Determine r(j). 8 Let l(v) = -40 - 44 - 51 + 106 + 16v + 3v2 - 4v*2. What is l(11)? 26 Let j(r) = r - 36. Let m(u) = -5u*2 - 209u - 169. Let i be m(-41). Give j(i). -41 Let j(f) = 107f - 325f - 10 + 106f + 107f. Calculate j(-5). 15 Suppose 0 = -7l - 28, 5l + 26 = 5v - 29. Let r(d) = d2 - 13d - 6. Calculate r(v). -48 Let r(i) be the third derivative of 0 - 1/15i5 - 1/6i*3 - 24i*2 + 1/8i*4 + 0i. Suppose 0 = 5g - 10g + 10. Determine r(g). -11 Suppose 5q + 10 = 0, q - 16 = -2c + 5q. Suppose 0 = 5j + v + 23, -4v - 1 = j - c. Let l(k) = 11k - 26085 - 15k + 26086 + 9k. Give l(j). -24 Suppose -10w - 16 = -86. Let r = 27 + -10. Let g(y) = -r + 33 - 11 + y. Give g(w). 12 Let z(v) = v3 + 4v*2 + v + 1. Let c(m) = m + 22. Let b be c(-5). Suppose -5w + 0f = f + b, 2f + 6 = -3w. Determine z(w). -3 Let p(y) = -45y*3 + 11y*2 - 3y - 5. Let d(o) = 22o3 - 5o*2 + o + 2. Let b be 6/5(27/6 + -2). Let n(f) = bp(f) + 7d(f). Give n(-1). -20 Let d(c) = 235 - 2c2 - 3c + 185 - 426. Suppose 12 = -4j + n, j + 0n = 4n + 12. Determine d(j). -26 Let h(b) = 7b - 8. Let f be (2-926/351)/((-4)/6). What is h(f)? 6 Let d(v) be the third derivative of -v*3 - 30v*2 + 1/12v*4 + 0 + 0v. Determine d(3). 0 Suppose -45 = f - 47. Suppose -3 = -fl + 3. Suppose -4m - 2t = -16, 0m = -lm + 5t - 14. Let j(g) = -g3 + g2 - 2g + 1. Calculate j(m). -7 Let w(i) = -12i*2 + i - 2. Let g(x) = -3x*2 + 68x - 46. Let z be g(22). Give w(z). -52 Let p(k) = -3k2 + 1279346 + 5k + 5k2 - 1279367. Determine p(3). 12 Let z = -14 + 5. Let x(i) = 2i*2 + 6i. Let r be x(-5). Let y(g) = -2g - g3 - 6g + rg2 + 6 - 30g*2. Determine y(z). -3 Let u(g) = 2g*3 + 53g*2 + 26g + 32. Suppose -260y + 255y = -l + 132, 0 = -y + 3l - 32. What is u(y)? 32 Let i(x) = 681x - 51 - 85 - 665x. What is i(9)? 8 Let x(q) = q2 - 2q - 12. Let r be 2 + 6 - (15 + -3). Calculate x(r). 12 Let p(v) = -3 + 2v - v - 2v. Let i be 1(0/(-3) - -22). Suppose -j + i = 27. Calculate p(j). 2 Let a = 12900 + -12898. Let n(q) be the third derivative of -24q*a + 1/30q*5 + 1/30q*6 + 0 - 1/6q*3 + 0q*4 + 0q. What is n(1)? 5 Suppose 0 = 2t + 4l + 10 - 2, -t + 3l + 16 = 0. Let s(w) be the first derivative of 4/3w*3 + w - 1/2w*2 - 1/4wt - 4. What is s(4)? -3 Let x(f) = f3 - 4f2 + f - 2. Let y = -47 + 51. Suppose 5 = -t, -d = 4d - yt - 30. Suppose 4w - 14 = d. Give x(w). 2 Let t(k) be the second derivative of k*3/3 + 5k*2/2 - k - 182. Calculate t(-6). -7 Let s(t) = -6t + 133. Let u(l) = -l3 + l2 - l + 22. Let n be u(0). Let o be s(n). Let r(y) = -3y2. Give r(o). -3 Let c = 322 + -306. Let i(g) = -1 + 2 + cg + g*2 + 10g - 23g. Calculate i(-3). 1 Let r = -528/17 - -1107/34. Let a(n) be the second derivative of -1/12n*4 - rn2 + 0 + n3 + 11n. What is a(5)? 2 Let g be 0 + 0 + 27/(-6) + (-660)/(-120). Let r(x) = -15x*2 + 7x + 1. Calculate r(g). -7 Let q = -19788 - -19775. Let g(r) = r*2 + 15r + 16. What is g(q)? -10 Let u(p) = p + 9. Let w be 1/((-5)/40-1). Suppose -wi + 35 = 123. Determine u(i). -2 Let v(y) be the second derivative of y*6/720 - 7y5/40 - y4/12 - 11y2/2 - 39y. Let m(c) be the third derivative of v(c). Determine m(16). -5 Suppose f - 3v + 17 = 13, v - 58 = -3f. Let b(p) = -10p + 183. What is b(f)? 13 Let q(h) be the first derivative of -21 - 1/24h*4 + 0h*3 - 29/2h*2 + 0h. Let d(s) be the second derivative of q(s). Give d(3). -3 Let l(n) = 6 + 5 - 15 + 8 - 13n + 4. Give l(6). -70 Let w = -1531 + 1534. Let j(x) be the third derivative of x6/120 - x5/30 + 2x*3/3 - 4x*2. Let m(v) be the first derivative of j(v). What is m(w)? 15 Let d be 3 + -4 + 3 - 2. Let x be (-1)/(2/(d - 4)). Suppose z - x = -z. Let n(q) = 5q*2 + q. What is n(z)? 6 Let h = 37 - 25. Let z(i) = -8i + h - 3i2 - 5i2 - i3 - 16. Let o(c) = -2c2 + 18c + 13. Let v be o(10). Give z(v). 3 Suppose 0 = -0q - 3q. Suppose -3k = a - 4a - 165, -2k + 94 = 2a. Let r(o) = k - 40 - 7o + 8o - o*2. What is r(q)? 11 Suppose 14a + 5013 - 4761 = 0. Let u(v) = -2v2 - 35v + 18. Determine u(a). 0 Let r(u) be the second derivative of -5u4/12 - 7u*3/3 + 905u. Calculate r(-3). -3 Let q(l) = -l*2 - 274l - 8565. Let d be q(-238). Let o(m) = -3m + 1. Let c(z) = z. Let t(h) = -4c(h) - o(h). Give t(d). -4 Suppose 31*c - 75 - 13 = -1	{ "pile_set_name": "DM Mathematics" }
est value? (a) n (b) -2/41 (c) 2/7 b Let z = -1845 - -9228/5. What is the fourth smallest value in z, -0.13, 0.4, 2? 2 Let m = -1 - -6. Let f = 32.9 + -33.1. Which is the fourth biggest value? (a) 4 (b) f (c) 3 (d) m b Let g(h) = 48h - 283. Let a be g(6). What is the third smallest value in a, 0.02, 26? 26 Let m be (2/(-16)2)/(15/12). Which is the second biggest value? (a) 0.3 (b) -5 (c) m c Let k = 60 - 60.4. Which is the fourth smallest value? (a) -1/9 (b) 3 (c) k (d) 0.12 b Let o(u) = -u*2 + 8u - 13. Let s be o(5). Suppose -sk - 3 - 3 = 2i, -k - 5 = 3i. Which is the third smallest value? (a) i (b) 3 (c) 4 c Let v = 13 - 9. Let r = -0.69 + -73.31. Let k = 74 + r. Which is the second biggest value? (a) v (b) 1/4 (c) k b Let z = 1 - -5.4. Let y = 6 - z. Let f be -1 + -2 + (-15)/6. Which is the second smallest value? (a) 1 (b) f (c) y c Let f = -247 - -245.81. What is the smallest value in -2/5, 3, f? f Suppose 0 = -6h - 32 + 50. Suppose t - 3 + 4 = 0. Let x be -1 - t - 5/4. Which is the second biggest value? (a) h (b) 0.07 (c) x b Let u be (3/5)/(2/20). Let b = 4 - u. Let z be b/10 - (-10)/(-25). What is the smallest value in -1/5, z, -3/7? z Suppose -43 = -3p - 3z + 74, -2p = z - 76. Let s = p - 25. Let w be -1 - (38/s + -4). Which is the third biggest value? (a) w (b) -1/3 (c) -0.5 c Suppose 5 = 4w - 5k, -w = w + k + 1. What is the second biggest value in -2/3, w, -0.6, 2/5? w Let z(l) = -3l2 - l. Let o be z(-3). Let u = o - -23. Let t be (-2)/((10/3)/u). Which is the second biggest value? (a) 3 (b) -3 (c) t c Let f = 35 + -31. What is the smallest value in f, 13, -0.1? -0.1 Let h = 0.8 + 2.2. Let f = -20 - -14. Let p be f/5 + -4 - -4. What is the second smallest value in h, p, -4? p Let m = 0.9 + -1.9. Let t = -1/10 + -11/40. Which is the third smallest value? (a) 1 (b) t (c) m (d) 0.045 d Let j = -46.088 + 0.088. Let q = j + 45.24. Let v = 0.7 + q. Which is the second smallest value? (a) v (b) 3 (c) -0.2 a Let m(v) = -v3 + 7v2 + 10v + 11. Let p be m(8). Let l be p/(-396) - (-4)/(-22). Let s = 7 - 4. Which is the smallest value? (a) l (b) 4 (c) s a Let h be (-6)/(-4) - 268/216. Let a = h - -2/27. What is the biggest value in 1/4, a, 4, -1/3? 4 Let g = -256 + 255.6. Which is the second biggest value? (a) 2/7 (b) -7 (c) 5 (d) g a Let p be (-532)/693 + 36/66. What is the third smallest value in p, 42, -2/3, 1? 1 Suppose -o + 12 - 4 = 0. Let z = -1 + 13. Let n = z - o. Which is the biggest value? (a) -1/10 (b) n (c) 2/7 b Let k = -9 + 4. Let p = 6 - 4. Which is the second smallest value? (a) p (b) -0.4 (c) k b Let z = 0.0195 + 0.2805. What is the fourth biggest value in 0.2, 0.6, z, -3? -3 Suppose 112p = 116p. What is the third smallest value in p, -20, -1/7, 0.4? p Suppose -2x + 18 = -8x. Let d be (8/x - -2)9/(-21). Suppose 4 = -4u, -k + 3 = 3k + u. Which is the third smallest value? (a) d (b) 3 (c) k b Let v = 7 - 8. Let w = -382.1 + 382. What is the third smallest value in w, v, 1/31? 1/31 Let z = 0.68 + -0.98. Let y = -2 - 1. Let k = y + 2.6. What is the third smallest value in z, 1/8, k? 1/8 Let g = -1360 - -1359.6. Which is the second biggest value? (a) g (b) -23 (c) 3 a Let i = 81 + -95. Let k = -8 - -5. Which is the third biggest value? (a) -2 (b) i (c) k b Suppose -3m = -m + 8. Let x = 35 - 32. Let l = x + -2.7. Which is the third biggest value? (a) 1/3 (b) m (c) l b Let l = -1338 - -1341. Which is the biggest value? (a) -10 (b) 2/17 (c) l (d) -0.2 c Let r = -188 + 192. Let q = 1 - 3/4. Let c = 7 - 4. What is the third smallest value in r, c, q? r Let o(z) = -5z + 21. Suppose -1 = 2f - 11. Let l be o(f). Which is the fourth biggest value? (a) 0.4 (b) 0.05 (c) 0.5 (d) l d Let p = 6.5 - 4. Let m = p + -2.1. Let k(n) = n + 8. Let z be k(-8). Which is the biggest value? (a) m (b) z (c) 1/2 c Let y = 97.0565 + -0.0565. Which is the third biggest value? (a) 5/4 (b) -5/3 (c) y b Let k = -2/1251 - 4994/6255. Suppose -v = 2h + 1, 5h + 61 = 4v - 0v. Let s = v - 28/3. Which is the second biggest value? (a) -2/9 (b) s (c) k b Let p = 0.8 + -1.1. Let s = -185 + 180. What is the second biggest value in p, 3, -3, s? p Let j = 138.71 - -2.29. Let t = j + -141.1. Let s = 0.2 - 0.2. What is the second smallest value in t, -3/5, s? t Let w = -46.8 - -47. Which is the third biggest value? (a) w (b) -1/6 (c) 0.024 b Let m = 2.14 - 0.14. Let k = 30 + -14. Let p be k/15 + 4/(-6). What is the second smallest value in m, p, -4? p Suppose 0 = 5v - y + 22, -2 = -y - 0. Let d = 10536 - 10531. What is the second smallest value in v, d, 2/43? 2/43 Let s = -3032 + 3031.5. Let o = 2 - -3. Which is the fourth biggest value? (a) -4 (b) o (c) s (d) -3 a Suppose h - 27 - 9 = -r, 66 = 2h + 4r. Let y be (2/(-36))/((-13)/h). Suppose 8 = -4f, -2f = -a - a. What is the second smallest value in y, a, -0.4? -0.4 Let o = -15.5 + 11. Let y = o - -5.5. Let f be -1 + (1 - (-1)/2). Which is the smallest value? (a) f (b) 1/3 (c) y b Let y = -93 + 94. Let v = 0.182 + -0.682. Which is the smallest value? (a) v (b) y (c) -62 c Let h = 213 + -208. Which is the third smallest value? (a) -2 (b) h (c) 3/5 b Let t = -58521/826 - -496/7. Let j = 481/1062 - t. Let m be ((-3)/(-15))/(8/(-10)). Which is the second biggest value? (a) 6 (b) j (c) m b Let k = -15 - -22. Let l = -4 - k. Let s = l - -6. What is the third biggest value in 0.2, s, 0.1? s Let s be 2/17 + 550/(-1496). Suppose -4g + 10 = 2k, g - 2k = -3g + 14. Let d = -22 + 17. Which is the second biggest value? (a) d (b) s (c) g b Let d = 215.8 + -216. Which is the smallest value? (a) -0.08 (b) d (c) -2 c Let b = -141 - -139. What is the third biggest value in -17, b, 5? -17 Let s = -173 + 177. What is the third biggest value in s, -0.2, -0.1, -2/15? -2/15 Let j = -78 - -235/3. Which is the biggest value? (a) -1 (b) 1 (c) j b Let j be (-3)/90 + -1. Let v = 0.55 - 0.65. What is the third biggest value in v, j, -2/9? j Let n = -9.9 - -8.9. Which is the biggest value? (a) -3 (b) n (c) 5 c Let j = 21 - 24. Suppose -c + 2c = -1. What is the second smallest value in c, j, -1/2? c Let l = 0.2 - 0.1. Let g = -0.212 + 0.129. Let m = g - 1.917. Which is the second biggest value? (a) m (b) -0.3 (c) l b Let m = 126.24 - -24.46. Let j = m + -151. Let t = 239/4 + -60. Which is the smallest value? (a) j (b) -8 (c) t b Let k(x) = 3x + 29. Let n be k(12). Let o = n - 135/2. Which is the second smallest value? (a) 0.4 (b) 0.2 (c) o (d) 0.3 b Let s = -42/5 - -153/20. Let t = -0.13 - 4.87. Let q = t - -3. What is the second biggest value in q, 1, s? s Let u be (-1)/(-2)-5(-14)/(-105). Which is the second smallest value? (a) 3 (b) u (c) 211 a Let w(j) = -j*2 + 9j + 20. Let z be w(11). Suppose 5f = t - 9, -t - 3t = 4f - 12. What is the biggest value in -2/15, z, 0.2, f? 0.2 Let x = 117.97 - 118. Let l = 28 + -23. What is the biggest value in x, l, -5/3? l Let d be (6/(-4))/(-3)10422/405. Let r = d - 38/3. Which is the third smallest value? (a) -3 (b) r (c) -0.2 b Let f = 5 - 1. Let r = 54 - 13. Let i = 40 - r. What is the third smallest value in i, f, 0.2? f Let h = 10.5 + -1.5. Let r = 5 - 10. Let c = h + r. What is the second biggest value in c, 0.2, -5? 0.2 Suppose -5t + 1529 = -5v - 2t, 1514 = -5v - 2t. Let p be (-4)/(v/10)-4. Let q = p + 168/247. Which is the biggest value? (a) 2 (b) q (c) 0.3 a Let x = 27151/230526 + 52/1423. Let l = x - -1/81. Suppose -18 = -n + 4g, 4n + 0n = -4g - 28. Which is the third biggest value? (a) 0.3 (b) l (c) n c Let p = -8 + 13. Let v = 0.14 - 0.25. Let w = 1.11 + v. Which is the third smallest value? (a) p (b) 4 (c) w a Let f = 4 + -2. Let v be (1 + f)/(42/4). Suppose 3w + 2i = -16, 0 = -w + i - 2 + 5. Which is the second smallest value? (a) 1 (b) v (c) w b Suppose -46 = -3i - u, -2u = -2i - 0i + 20. Let x = i - 11. What is the third biggest value in 1/3, x, 2? 1/3 Let g = 4 + 0. Let l = -1121 + 1123. What is the second biggest value in 5, g, l? g Let n be (-24)/(-72)*21 - ((-6)/2)/(-1). Let y = -466/9 - -52. Let r = -1 - -2. What is the smallest value in r, n, y? y Let b = -14 - -17. Let t = 1 + -1. Let i = t	{ "pile_set_name": "DM Mathematics" }
+ 552a Suppose -k - 3p = -3579, -5p = 6k - 3k - 10737. What is the third derivative of -25w*6 + kw*2 - 18w*6 - 3504w*2 wrt w? -5160w*3 Let s be ((-2)/4)/(6 - (-37)/(-6)). Find the second derivative of 31u*3 - 11u*3 + 34u*s + 7 + 16u*3 + 2u wrt u. 420u Let x be (-326)/(-9) - (-10)/(-45). Suppose -xs = -39s + 45. Differentiate -12 + 39r*4 - sr*4 + 1 with respect to r. 96r*3 Let m(x) be the second derivative of 51x7/7 - x5/10 - 435x4/4 - 895x. What is the third derivative of m(c) wrt c? 18360c2 - 12 Let a(p) = 37p - 7. Let k be a(1). What is the third derivative of kz3 + 33z*3 + 7z*2 - 112z*3 wrt z? -294 Let n(x) be the second derivative of 0 + 12x + 0x7 + 8/3x*4 + 1/8x*8 + 0x*6 + 0x*3 + 0x*2 + 0x*5. What is the third derivative of n(h) wrt h? 840h*3 Differentiate -337 - 394 + 75f*4 - 1010 - 244 + 459 wrt f. 300f*3 Let l = 14 + -12. Suppose 33 = lu + 29. Find the second derivative of 2w - 15w + 10w2 + 4w*u - 6w*2 wrt w. 16 Suppose -33f + 22f + 110 = 0. Find the second derivative of -fc + 68c - 137c*4 + 99c4 + 2 - c2 wrt c. -456c2 - 2 Let t(z) be the third derivative of 4729z*6/120 + 275z*4/4 + 2z*2 + 138z - 9. What is the second derivative of t(x) wrt x? 28374x Let b(s) be the first derivative of -14348s*5/5 + 1362s*2 + 11590. Find the second derivative of b(t) wrt t. -172176t*2 Let x(r) be the second derivative of -759r*4/2 + 733r*2 + 704r - 2. What is the first derivative of x(a) wrt a? -9108a What is the second derivative of i - 166 - 8i*2 - 168 + 22i*2 - 110i*2 wrt i? -192 Find the third derivative of -6l3 + l4 + 6l3 + 955l*2 + 40l*3 - 3l*4 + 9l*3 wrt l. -48l + 294 Suppose 3x + 84516 = 2z, -7729 + 134505 = 3z - 4x. Differentiate -46 - zw - 9 + 42211w wrt w. -53 What is the second derivative of -1009z - 1658z + 1339z3 - 5302 + 5302 wrt z? 8034z Let x(q) be the second derivative of 3223q5/20 + 502q*2 + 1913q. Differentiate x(k) with respect to k. 9669k2 Let y = -271 + 279. Find the third derivative of b2 - 26b*3 + 2b*5 - y + 7b*2 + 8 wrt b. 120b*2 - 156 Suppose -2i - 3l = 127, -3l = -i - 5l - 64. Let u = -49 - i. Differentiate 3k + u - 12k + 9k - 15k4 with respect to k. -60k*3 Let s(h) be the third derivative of -361h9/252 - h8/84 + 3717h5/20 - 2h*2 - 601h + 1. What is the third derivative of s(x) wrt x? -86640x3 - 240x*2 Suppose -5n - 1013 = -3r + 408, -n = -3r + 1429. Find the first derivative of -945o + ro + 470o - 43 + 7o*3 wrt o. 21o*2 + 2 Let z(a) = 2a*3 + 2a*2 - a - 9. Let k be z(-3). Let m = k - -49. What is the second derivative of 13t*3 - 7t - 13t - mt wrt t? 78t Suppose -4x - 9 = 5f, x - 7 = 3f + 5x. Let s(n) = -105n - 144. Let q(c) = -c - 1. Let z(k) = fs(k) - 2q(k). Differentiate z(o) with respect to o. 107 Let z(l) = l*2 + 4l + 1. Let y be z(-4). Let j(p) = 2p. Let a be j(y). Find the third derivative of -9m*3 - 76m*a + 54m*2 - 19m*3 wrt m. -168 Suppose 2l + 10 = g, 4g - l = 16 + 24. What is the second derivative of 16x*5 - 20x - 61x - 12x - 44x5 + gx wrt x? -560x3 Let j(p) = -1117p*3 - 2866p + 9. Let w(s) = 558s3 + 1443s - 4. Let f(x) = -4j(x) - 9w(x). Find the second derivative of f(t) wrt t. -3324t Let m(a) = -3188a*5 - 6a*3 - 1783a*2 + 4a. Let w(k) = -k*5 + 3k3 + k2 - 2k. Let z(f) = m(f) + 2w(f). What is the third derivative of z(d) wrt d? -191400d2 Let j(l) = -4l + 20. Let t be j(5). Let k be 4 - (t + (0 - -2)). Find the second derivative of -c*2 + 5c + 9c - 17c*2 - 3c*k wrt c. -42 Suppose -f - 2 + 6 = 0. Find the first derivative of -4x*f - 72x*4 - 19 - 11x*4 wrt x. -348x*3 Let b = -428 + 433. Find the third derivative of 25o*2 - 127o*2 - 8o*2 - 140o*b wrt o. -8400o*2 Find the third derivative of -4544w*3 - 4996w*3 + 29w*2 + 1 + 11220w*3 wrt w. 10080 Let o(i) = 9i - 41. Let j be o(5). Differentiate -141v4 - 166062 + 165970 - 2v*j wrt v. -572v*3 Let k(o) = -2000o - 9160. Let z(a) = -4011a - 18331. Let t(m) = -7k(m) + 4z(m). Differentiate t(d) wrt d. -2044 Let f = 239 - 231. Let q(u) be the first derivative of -f - 16/5u*5 + 0u*4 + 1/3u*3 + 0u*2 + 0u. Find the third derivative of q(w) wrt w. -384w Let s(t) be the first derivative of -30t*2 + 19/5t*5 + 20 + 0t*3 + 0t + 0t4. Find the second derivative of s(i) wrt i. 228i*2 Let t(l) = 2l*2 - 40l + 41. Suppose -p = 4p - 95. Let m be t(p). What is the third derivative of -19x*m - 17x*2 + 29x*5 + 19x*3 wrt x? 1740x*2 Suppose 655f - 57 = 652f. What is the derivative of 51 - fa*2 - 16a*2 + 110 - 264a*4 + 35a*2 wrt a? -1056a*3 Find the first derivative of 112i*2 + 352 + 1781 + 279 - 587i*2 wrt i. -950i Suppose 25g = -4g + 928. What is the second derivative of -12 - 27u2 - 90u - 20 + g wrt u? -54 Let t(m) = 28 + 122m - 36 + 102. Let s(h) be the first derivative of -41h*2/2 - 31h - 1. Let r(l) = -7s(l) - 2t(l). Differentiate r(u) wrt u. 43 Let b(a) be the second derivative of -1/14a7 - a + 0a*5 + 5 - 55/6a*3 + 0a*2 + 11/12a*4 + 0a*6. What is the second derivative of b(c) wrt c? -60c*3 + 22 Let l(j) be the third derivative of 151j*7/15 - 697j*3/2 + 25j*2 + 39. What is the derivative of l(f) wrt f? 8456f*3 Let r(m) = -6m - 14. Let y be r(-3). Let j be 11/(-44) - (-2 - 1/y). Find the second derivative of -g*2 + g + 4g*j + 4g*2 wrt g. 14 Suppose -5a = -2f + 3 + 9, -3f + a + 18 = 0. Let s(j) be the first derivative of -f - j + 15/2j2. Find the first derivative of s(i) wrt i. 15 Let w(q) be the second derivative of -1413q8/56 - q7/21 + 3q4 - 7q*3/6 + 2q - 140. Find the third derivative of w(r) wrt r. -169560r3 - 120r*2 Suppose -j = 2f - 9, 2 = f - j - 1. Let m(r) = 14r + 198. Let i be m(-14). What is the third derivative of 2 - 11n*2 - 5n*4 - i - 14n*f wrt n? -456n Let h = 8 - 4. Suppose -17 = -q + 3l, 4q - h = -0l - 4l. Find the second derivative of -2a3 - 3a*3 - qa*3 - 21a + 12a wrt a. -60a Differentiate -14398 + 7477 + 1581u4 + 7197 wrt u. 6324u*3 Let h be (-1 - (-7)/3)/(11/(-99)). Let p be (-11)/(-66) - 34/h. What is the derivative of -7g*p - 10g*3 + 17 + 2 wrt g? -51g*2 Let s(n) = 165n*2 - 359n + 3241. Let i(g) = 27g2 + 1. Let y(x) = 6i(x) - s(x). What is the derivative of y(h) wrt h? -6h + 359 Let p(x) be the first derivative of -59x*2 + 0x*3 + 28/5x*5 - 5/4x*4 + 72 + 0x. Find the second derivative of p(w) wrt w. 336w2 - 30w Let x(o) be the first derivative of 27 + 7/12o4 + 0o + 1/3o3 - 14o*2. Let a(c) be the second derivative of x(c). What is the derivative of a(m) wrt m? 14 Let s = -1603/5 + 4864/15. Let l(m) be the first derivative of 25 - 7/2m*2 + 0m + sm3. What is the second derivative of l(g) wrt g? 22 What is the third derivative of -665r*5 + 56281 - 2747r*5 - 56283 - 1666r*2 wrt r? -204720r*2 Find the third derivative of 16 + 21 - 494k*2 - 1811k*4 - 17 - 18 + 7586k*4 wrt k. 138600k Let b be (2/5)/((-42)/(-315)). What is the third derivative of v - 3v + 152v*3 - 133vb - v4 - 3v2 wrt v? -24v + 114 Let q(w) be the third derivative of 1683w7/70 - 3575w*4/12 + 2w*2 - 718. Find the second derivative of q(r) wrt r. 60588r*2 Let y(s) be the first derivative of -11 + 1018s*2 - 9 - 1053s*2 + 15s. Differentiate y(d) wrt d. -70 Let t(b) be the third derivative of b7/210 + b6/60 - 23b5/20 - 2911b*3/6 + 44b*2. What is the first derivative of t(q) wrt q? 4q*3 + 6q*2 - 138q Let a = 817 - 813. What is the second derivative of -294ja + 25j + 65j4 + 130j + 121j wrt j? -2748j*2 Let v(a) be the third derivative of 7a*4 - 150a*5 + 172a*2 - 33a*3 + 152a*5 - 7a*4. Differentiate v(o) with respect to o. 240o Let y(t) be the third derivative of 1247t8/336 - 5t*4/12 - 23t*3/2 + 3t*2 + 34. What is the second derivative of y(h) wrt h? 24940h*3 What is the third derivative of 2285h*2 + 70h*4 - 364h*3 - 9h*4 + 135h*4 + 362h*3 wrt h? 4704h - 12 Let h(m) be the second derivative of 0m7 - 13/28m**	{ "pile_set_name": "DM Mathematics" }
t as big as 17? False Is -1/3202 smaller than 0? True Does -2/1175 = 0? False Which is smaller: 1306 or -1? -1 Which is smaller: 19038/17 or 1121? 19038/17 Is 5908 != 5910? True Are 23476 and 23475 unequal? True Is -16.4 at most -1.5? True Which is smaller: -2 or 0.075? -2 Are 23 and 26 equal? False Is 0.35 < 0? False Is 164/11 at most 14? False Which is smaller: -1 or 19/131? -1 Is 0.2 less than or equal to 1.1? True Is -314 greater than -314? False Which is bigger: 1 or 0.21424? 1 Is 162 != 2? True Which is smaller: -54267 or -54268? -54268 Which is smaller: -11204 or 0.1? -11204 Which is bigger: -13/1811 or -1? -13/1811 Which is greater: -147 or 2/5? 2/5 Is -629 smaller than -630? False Is 4/7 > -0.42? True Which is bigger: 49562 or 49561? 49562 Is 2/1145 bigger than -1? True Which is smaller: 3 or -0.03? -0.03 Which is smaller: 3 or 189? 3 Which is smaller: 12/29 or 4? 12/29 Is 57/13 less than 4? False Which is greater: 1429 or 1428? 1429 Is 15 smaller than 2.1? False Which is smaller: -13/3 or -3? -13/3 Which is smaller: -1 or -2/105? -1 Is 12 > 1/2? True Is 246 bigger than 246? False Do -7/88 and 1 have the same value? False Is -1 less than -74? False Is 214 at most 214? True Which is greater: 357 or 356? 357 Which is bigger: 0 or 4/81? 4/81 Which is smaller: -0.0502 or 15/8? -0.0502 Is -621 < -618? True Which is smaller: 0.03 or 656? 0.03 Is -136 > -73? False Which is smaller: -27/19 or -1? -27/19 Is 73 > 431/6? True Which is greater: -63 or -1/4? -1/4 Are -1502/3 and -502 equal? False Is -19 bigger than 6? False Which is smaller: -159 or -201? -201 Is -17/2 less than 13? True Is 5707 not equal to 5707? False Is -1.813 at most 4? True Is 11948 <= 11948? True Which is bigger: 1/2 or 0.0277? 1/2 Do -23 and -195/8 have the same value? False Are 46 and -1/14 non-equal? True Do 1 and -1.4 have the same value? False Is 1026 > 1026? False Is 551 at most 536? False Which is smaller: -37.995 or -1/4? -37.995 Which is smaller: -0.1 or -4.74? -4.74 Which is smaller: 2/6961 or -1? -1 Is 0 less than -1/4361? False Are -1/13036 and -1 non-equal? True Is 901 greater than 921? False Which is smaller: -1/4427 or 0.1? -1/4427 Which is bigger: 4 or 9? 9 Is 70/193 at most as big as 1? True Do 0.4 and -426 have different values? True Is -151/24 smaller than 0.1? True Is 785 at least as big as 785? True Do -2 and -83/36 have the same value? False Which is greater: 14 or 91/6? 91/6 Which is bigger: -1 or 0.5157? 0.5157 Which is smaller: -7 or 687? -7 Which is bigger: -20 or -31? -20 Is 164 less than 494/3? True Is -15/131 != -2? True Which is bigger: -21 or -102/5? -102/5 Which is smaller: 4 or 6? 4 Which is greater: 16668 or 16669? 16669 Which is greater: 207/89 or 0? 207/89 Is -2076 at most as big as -2075? True Which is greater: 0 or -60/2377? 0 Which is greater: 2.11 or -0.4? 2.11 Which is smaller: 2/2133 or 1? 2/2133 Is 0 less than 117/154? True Which is greater: -141 or 3/13? 3/13 Which is greater: -1 or -7/10352? -7/10352 Are 644 and 651 nonequal? True Is 1/6144 at most 0? False Is 40/517 greater than 0? True Are -4/287 and -1 unequal? True Is -2/36333 less than or equal to -1? False Which is smaller: -0.00921 or 0.04? -0.00921 Is -569 != -571? True Which is smaller: 991/4 or -0.2? -0.2 Is 6815 != 6813? True Which is smaller: 1 or 1/26976? 1/26976 Is 1 greater than 2/1253? True Which is bigger: -1 or 6/1223? 6/1223 Which is bigger: -2/9 or 1? 1 Is 4/369 less than or equal to 0? False Which is greater: -63 or 0.03? 0.03 Which is smaller: -14 or -9? -14 Which is bigger: -163 or -162? -162 Is 326 bigger than 129? True Which is greater: 1/182 or 10.6? 10.6 Which is smaller: 253/5 or 52? 253/5 Is 1029 >= 1029? True Are 31729 and 31728 unequal? True Is 1/878 smaller than 0? False Which is smaller: 4 or -4? -4 Which is bigger: 0.02 or 16/7? 16/7 Is -179/19 bigger than -9? False Is 0 greater than or equal to -16/13? True Is -1216 greater than or equal to -1221? True Is 1 less than or equal to 1/12955? False Is 0.4 smaller than 0? False Which is smaller: -14380 or -14381? -14381 Which is greater: -2/9 or 709? 709 Is 1178 at least 1178? True Is 23/5 smaller than 1/4? False Is 58761 at most 58760? False Which is smaller: 41 or 42? 41 Which is smaller: -1 or 2/163261? -1 Is -5/13397 bigger than -1? True Which is bigger: 50 or 47? 50 Is 160 > 1? True Which is bigger: 783 or 1/11? 783 Which is smaller: -1/2 or 27? -1/2 Is -262/23 greater than -12? True Which is bigger: 0 or -46/59? 0 Is -5 at least as big as 1? False Is 135 less than or equal to 1/2? False Which is smaller: -196 or -197? -197 Which is smaller: 95/8 or 13? 95/8 Is 3/61 less than or equal to 0? False Is -4/19267 equal to 1? False Is -3/4 >= -243? True Which is bigger: 1/3336 or -1? 1/3336 Which is smaller: -6 or 160? -6 Do 3961 and 3963 have different values? True Is -2281/7 at most -325? True Which is smaller: -186 or -185? -186 Are -33 and -33 nonequal? False Which is bigger: -7/403 or -1? -7/403 Which is bigger: -3.7 or -63? -3.7 Is -198/13 less than -14? True Which is bigger: -1 or -4/9? -4/9 Is -14/1031 smaller than 1? True Which is smaller: -63 or -61? -63 Which is greater: -39 or -64? -39 Is 9153/4 equal to 2289? False Which is bigger: 1 or -2/37? 1 Which is smaller: 0 or -9/277? -9/277 Is -2442 less than or equal to -2442? True Which is greater: -203 or -201? -201 Which is smaller: -2358/11 or -213? -2358/11 Which is bigger: 1 or 1/86? 1 Which is smaller: -2/33 or 0.02? -2/33 Are 91 and 638/7 non-equal? True Is 2759 > -3? True Is -4958 less than -4960? False Which is greater: -0.4 or 15? 15 Which is bigger: 4/1149 or 0? 4/1149 Does 0 = 1/277? False Does -59 = 2? False Which is smaller: 38 or -1? -1 Which is smaller: 0.4 or 1.57? 0.4 Which is bigger: -148 or 96? 96 Which is smaller: 207 or -4/21? -4/21 Which is bigger: -11/12 or -1/14? -1/14 Is -1727 equal to -1721? False Is 9 at least 322/31? False Are 790 and 774 non-equal? True Which is greater: 5/6 or 107? 107 Are -764 and -764 nonequal? False Which is smaller: 437/7 or 63? 437/7 Is 247 >= 1/9? True Which is smaller: 0 or -2/443? -2/443 Is -2.56 at least 0? False Which is smaller: -40 or -39? -40 Is 194 at least 193? True Are 2 and -503 nonequal? True Which is smaller: -1252 or -1263? -1263 Which is bigger: 1 or 2/141? 1 Is 55 > -32? True Which is bigger: 3663 or 3657? 3663 Is -193/26 < -6? True Which is greater: -30.8 or -111? -30.8 Are -734 and -734 nonequal? False Which is greater: 1 or -3/304? 1 Is 4 greater than 1? True Is -3437 smaller than -3436? True Is -22 at least 31? False Which is bigger: 0.3 or 5.5? 5.5 Is -28/13 <= -2? True Do 0 and -15/26 have the same value? False Do -1266 and -1265 have the same value? False Which is smaller: 10 or -5? -5 Is -1 >= -1/3094? False Is 50.4 < 6/7? False Are -25 and -25 equal? True Is -209 less than or equal to -211? False Which is bigger: 3 or -0.484? 3 Which is greater: 77/3 or 27? 27 Which is bigger: 27 or 111/4? 111/4 Which is bigger: 334 or 332? 334 Is -445 less than or equal to -445? True Which is smaller: -10/39 or -1/7? -10/39 Which is smaller: 1366 or 1368? 1366 Which is greater: 129 or 143? 143 Which is greater: 47/3 or -0.3? 47/3 Are 11833 and 11833 nonequal? False Are 2 and 23/22 equal? False Which is smaller: -24 or -21? -24 Is -2/5 greater than 4392? False Do 126/29 and 4 have the same value? False Which is smaller: -39 or -38? -39 Which is greater: -1 or -5/22? -5/22 Which is greater: 18/59 or 1? 1 Which is greater: 1.4 or -409? 1.4 Which is smaller: 1 or 269/196? 1 Which is smaller: -16 or -79/5? -16 Which is bigger: -2/65 or 3/4? 3/4 Are 101 and 102 nonequal? True Is 350 equal to 350? True Is -0.1 greater than 28/95? False Is 552 >= 542? True Is 1581 > 7911/5? False Do -1095 and -5473/5 have the same value? False Which is smaller: -1 or -42/233? -1 Which is greater: -40 or -38? -38 Which is bigger: -333 or -330? -330 Which is smaller: 3491 or 3495? 3491 Is 1079 != 1083? True Are 7 and 99/13 non-equal? True Are -56/9 and -5 nonequal? True Which is smaller: -1 or -2/171? -1 Is -4130 less than or equal to -4131? False Is 3440 bigger than 3440? False Does -50/361 = 0? False Is 1 at most as big as 4/12277? False Which is greater: -115.9 or 0? 0 Is -290 < 0.09? True Are -1049 and	{ "pile_set_name": "DM Mathematics" }
s the third root of 368102617 to the nearest integer? 717 What is the cube root of 1278210436 to the nearest integer? 1085 What is the third root of 496036983 to the nearest integer? 792 What is the square root of 169430383 to the nearest integer? 13017 What is 2248257820 to the power of 1/5, to the nearest integer? 74 What is the fifth root of 691862808 to the nearest integer? 59 What is 312573478 to the power of 1/4, to the nearest integer? 133 What is the sixth root of 2411749639 to the nearest integer? 37 What is 2047938689 to the power of 1/2, to the nearest integer? 45254 What is the cube root of 33824800 to the nearest integer? 323 What is 317676920 to the power of 1/2, to the nearest integer? 17823 What is 171206369 to the power of 1/2, to the nearest integer? 13085 What is 262189687 to the power of 1/2, to the nearest integer? 16192 What is 7808068132 to the power of 1/10, to the nearest integer? 10 What is the square root of 804479365 to the nearest integer? 28363 What is the cube root of 13736358 to the nearest integer? 239 What is 3207969723 to the power of 1/2, to the nearest integer? 56639 What is 54974608 to the power of 1/2, to the nearest integer? 7414 What is the cube root of 5496313845 to the nearest integer? 1765 What is the square root of 108487345 to the nearest integer? 10416 What is the fourth root of 309334950 to the nearest integer? 133 What is 24088597 to the power of 1/2, to the nearest integer? 4908 What is the square root of 1291218161 to the nearest integer? 35934 What is 3045851264 to the power of 1/9, to the nearest integer? 11 What is the fourth root of 71323450 to the nearest integer? 92 What is 14948129 to the power of 1/10, to the nearest integer? 5 What is the square root of 2458962788 to the nearest integer? 49588 What is 1669264952 to the power of 1/2, to the nearest integer? 40857 What is the cube root of 2453757 to the nearest integer? 135 What is the third root of 37244194 to the nearest integer? 334 What is the seventh root of 10578434 to the nearest integer? 10 What is the tenth root of 1732821227 to the nearest integer? 8 What is the third root of 23760713 to the nearest integer? 287 What is 3148807685 to the power of 1/3, to the nearest integer? 1466 What is 44656184 to the power of 1/3, to the nearest integer? 355 What is the third root of 5029514858 to the nearest integer? 1713 What is the square root of 423479904 to the nearest integer? 20579 What is the cube root of 1990024055 to the nearest integer? 1258 What is 39205648 to the power of 1/2, to the nearest integer? 6261 What is the eighth root of 225765376 to the nearest integer? 11 What is the eighth root of 311129284 to the nearest integer? 12 What is the fourth root of 1659567 to the nearest integer? 36 What is the square root of 199110474 to the nearest integer? 14111 What is 634079243 to the power of 1/2, to the nearest integer? 25181 What is the cube root of 760457874 to the nearest integer? 913 What is the fifth root of 479709814 to the nearest integer? 54 What is 16377766 to the power of 1/2, to the nearest integer? 4047 What is the third root of 54394632 to the nearest integer? 379 What is 1031189788 to the power of 1/2, to the nearest integer? 32112 What is the cube root of 42422425 to the nearest integer? 349 What is 283117418 to the power of 1/8, to the nearest integer? 11 What is the cube root of 183452217 to the nearest integer? 568 What is the third root of 60774342 to the nearest integer? 393 What is the cube root of 376368043 to the nearest integer? 722 What is the fifth root of 1493009220 to the nearest integer? 68 What is 1213462435 to the power of 1/3, to the nearest integer? 1067 What is the fourth root of 2688543 to the nearest integer? 40 What is 292055821 to the power of 1/3, to the nearest integer? 663 What is 140265326 to the power of 1/10, to the nearest integer? 7 What is the square root of 48406711 to the nearest integer? 6957 What is the seventh root of 1486684292 to the nearest integer? 20 What is 44580022 to the power of 1/7, to the nearest integer? 12 What is the square root of 375556404 to the nearest integer? 19379 What is the cube root of 228372856 to the nearest integer? 611 What is 417120541 to the power of 1/3, to the nearest integer? 747 What is 534303947 to the power of 1/9, to the nearest integer? 9 What is the ninth root of 296324408 to the nearest integer? 9 What is 4354431831 to the power of 1/2, to the nearest integer? 65988 What is the cube root of 171769128 to the nearest integer? 556 What is 4342498977 to the power of 1/3, to the nearest integer? 1631 What is 603694476 to the power of 1/3, to the nearest integer? 845 What is the fourth root of 2935393616 to the nearest integer? 233 What is the ninth root of 46729129 to the nearest integer? 7 What is the square root of 1235100501 to the nearest integer? 35144 What is 74350519 to the power of 1/3, to the nearest integer? 420 What is the square root of 2479747781 to the nearest integer? 49797 What is the cube root of 444305358 to the nearest integer? 763 What is the third root of 4267933746 to the nearest integer? 1622 What is the sixth root of 357039876 to the nearest integer? 27 What is 482640583 to the power of 1/2, to the nearest integer? 21969 What is the square root of 271668565 to the nearest integer? 16482 What is the eighth root of 200978800 to the nearest integer? 11 What is the cube root of 1437915399 to the nearest integer? 1129 What is 231446787 to the power of 1/2, to the nearest integer? 15213 What is the tenth root of 17543895 to the nearest integer? 5 What is 463651021 to the power of 1/8, to the nearest integer? 12 What is the cube root of 96077660 to the nearest integer? 458 What is the third root of 1456954323 to the nearest integer? 1134 What is the third root of 3936153210 to the nearest integer? 1579 What is the third root of 10531436 to the nearest integer? 219 What is the square root of 19038884 to the nearest integer? 4363 What is 6014030 to the power of 1/5, to the nearest integer? 23 What is 149999650 to the power of 1/2, to the nearest integer? 12247 What is the tenth root of 147653572 to the nearest integer? 7 What is the tenth root of 24296199 to the nearest integer? 5 What is the square root of 37757760 to the nearest integer? 6145 What is the cube root of 449414979 to the nearest integer? 766 What is the square root of 342575122 to the nearest integer? 18509 What is the seventh root of 21724567 to the nearest integer? 11 What is 5550036295 to the power of 1/2, to the nearest integer? 74499 What is 45737279 to the power of 1/10, to the nearest integer? 6 What is the square root of 306982402 to the nearest integer? 17521 What is 996289163 to the power of 1/2, to the nearest integer? 31564 What is 62105588 to the power of 1/3, to the nearest integer? 396 What is 2814875799 to the power of 1/2, to the nearest integer? 53055 What is 14610513 to the power of 1/2, to the nearest integer? 3822 What is 4228819955 to the power of 1/3, to the nearest integer? 1617 What is the third root of 80858831 to the nearest integer? 432 What is the third root of 728226710 to the nearest integer? 900 What is the third root of 3055646860 to the nearest integer? 1451 What is the cube root of 693540385 to the nearest integer? 885 What is 449196027 to the power of 1/3, to the nearest integer? 766 What is the cube root of 62255226 to the nearest integer? 396 What is 31713123 to the power of 1/4, to the nearest integer? 75 What is the third root of 1871090691 to the nearest integer? 1232 What is the third root of 408826729 to the nearest integer? 742 What is the third root of 1944377152 to the nearest integer? 1248 What is 49594215 to the power of 1/8, to the nearest integer? 9 What is 259702213 to the power of 1/2, to the nearest integer? 16115 What is 7463342953 to the power of 1/3, to the nearest integer? 1954 What is 172638619 to the power of 1/6, to the nearest integer? 24 What is 44889450 to the power of 1/9, to the nearest integer? 7 What is the cube root of 5796999710 to the nearest integer? 1796 What is 2853686371 to the power of 1/2, to the nearest integer? 53420 What is 240202280 to the power of 1/3, to the nearest integer? 622	{ "pile_set_name": "DM Mathematics" }
05 to the nearest integer? 366 What is the eighth root of 188666350 to the nearest integer? 11 What is the square root of 834487796 to the nearest integer? 28888 What is 69890257 to the power of 1/2, to the nearest integer? 8360 What is the cube root of 28675444 to the nearest integer? 306 What is the third root of 4462128624 to the nearest integer? 1646 What is the third root of 294135808 to the nearest integer? 665 What is 223657945 to the power of 1/10, to the nearest integer? 7 What is the sixth root of 82971393 to the nearest integer? 21 What is 4687304623 to the power of 1/3, to the nearest integer? 1674 What is the cube root of 1640512706 to the nearest integer? 1179 What is the square root of 116444780 to the nearest integer? 10791 What is 14899833 to the power of 1/6, to the nearest integer? 16 What is 175358530 to the power of 1/3, to the nearest integer? 560 What is 709946654 to the power of 1/2, to the nearest integer? 26645 What is 24592984 to the power of 1/5, to the nearest integer? 30 What is the cube root of 37619351 to the nearest integer? 335 What is the square root of 70534973 to the nearest integer? 8399 What is the third root of 484320368 to the nearest integer? 785 What is 2150283044 to the power of 1/3, to the nearest integer? 1291 What is the eighth root of 40603827 to the nearest integer? 9 What is the square root of 7038516968 to the nearest integer? 83896 What is the square root of 577906599 to the nearest integer? 24040 What is 35565539 to the power of 1/7, to the nearest integer? 12 What is the tenth root of 22571560 to the nearest integer? 5 What is 17939004 to the power of 1/3, to the nearest integer? 262 What is the third root of 1160272899 to the nearest integer? 1051 What is the third root of 3348521 to the nearest integer? 150 What is 2989831436 to the power of 1/2, to the nearest integer? 54679 What is the square root of 252470001 to the nearest integer? 15889 What is the seventh root of 173084816 to the nearest integer? 15 What is 249578509 to the power of 1/2, to the nearest integer? 15798 What is the third root of 820037312 to the nearest integer? 936 What is 492162946 to the power of 1/7, to the nearest integer? 17 What is the seventh root of 224155964 to the nearest integer? 16 What is 135580435 to the power of 1/6, to the nearest integer? 23 What is 1718254907 to the power of 1/2, to the nearest integer? 41452 What is the square root of 12800904 to the nearest integer? 3578 What is 6651428 to the power of 1/6, to the nearest integer? 14 What is the fifth root of 334443745 to the nearest integer? 51 What is the fourth root of 510815302 to the nearest integer? 150 What is the third root of 597739842 to the nearest integer? 842 What is the cube root of 46343862 to the nearest integer? 359 What is the third root of 158879991 to the nearest integer? 542 What is 163512527 to the power of 1/7, to the nearest integer? 15 What is the fifth root of 85703419 to the nearest integer? 39 What is 7467763068 to the power of 1/8, to the nearest integer? 17 What is 1094755610 to the power of 1/3, to the nearest integer? 1031 What is the cube root of 3197073797 to the nearest integer? 1473 What is the third root of 5965428 to the nearest integer? 181 What is 335400436 to the power of 1/2, to the nearest integer? 18314 What is the tenth root of 10095437 to the nearest integer? 5 What is the seventh root of 38918884 to the nearest integer? 12 What is 7325478587 to the power of 1/3, to the nearest integer? 1942 What is 1864397568 to the power of 1/2, to the nearest integer? 43179 What is the seventh root of 349939553 to the nearest integer? 17 What is the square root of 602663216 to the nearest integer? 24549 What is 234626812 to the power of 1/2, to the nearest integer? 15318 What is 57597007 to the power of 1/2, to the nearest integer? 7589 What is the ninth root of 444546466 to the nearest integer? 9 What is the ninth root of 32884427 to the nearest integer? 7 What is the seventh root of 813508691 to the nearest integer? 19 What is the seventh root of 36502202 to the nearest integer? 12 What is 343701183 to the power of 1/5, to the nearest integer? 51 What is the third root of 11937133 to the nearest integer? 229 What is the fourth root of 590115299 to the nearest integer? 156 What is 79738847 to the power of 1/3, to the nearest integer? 430 What is 615107437 to the power of 1/10, to the nearest integer? 8 What is 161692704 to the power of 1/2, to the nearest integer? 12716 What is the square root of 557033402 to the nearest integer? 23602 What is 324076045 to the power of 1/2, to the nearest integer? 18002 What is 1177219316 to the power of 1/2, to the nearest integer? 34311 What is 2467300748 to the power of 1/10, to the nearest integer? 9 What is the cube root of 33851572 to the nearest integer? 323 What is the square root of 6455570 to the nearest integer? 2541 What is the tenth root of 996017941 to the nearest integer? 8 What is the seventh root of 200263357 to the nearest integer? 15 What is 1686685121 to the power of 1/6, to the nearest integer? 35 What is the third root of 2471932290 to the nearest integer? 1352 What is the ninth root of 404884746 to the nearest integer? 9 What is the square root of 3558787355 to the nearest integer? 59656 What is 205681119 to the power of 1/2, to the nearest integer? 14342 What is the ninth root of 248740406 to the nearest integer? 9 What is 1564977879 to the power of 1/8, to the nearest integer? 14 What is the fifth root of 984313514 to the nearest integer? 63 What is 2388185 to the power of 1/2, to the nearest integer? 1545 What is the tenth root of 1579075 to the nearest integer? 4 What is the ninth root of 1877613388 to the nearest integer? 11 What is 855509424 to the power of 1/2, to the nearest integer? 29249 What is 425865572 to the power of 1/2, to the nearest integer? 20637 What is 6353291036 to the power of 1/6, to the nearest integer? 43 What is the eighth root of 5912216195 to the nearest integer? 17 What is the square root of 451969727 to the nearest integer? 21260 What is the seventh root of 101390163 to the nearest integer? 14 What is 75335419 to the power of 1/2, to the nearest integer? 8680 What is 40453118 to the power of 1/8, to the nearest integer? 9 What is 6876656948 to the power of 1/8, to the nearest integer? 17 What is 193155590 to the power of 1/8, to the nearest integer? 11 What is 51661387 to the power of 1/3, to the nearest integer? 372 What is the cube root of 108041952 to the nearest integer? 476 What is 1006016235 to the power of 1/2, to the nearest integer? 31718 What is the fourth root of 547922313 to the nearest integer? 153 What is the ninth root of 1642961627 to the nearest integer? 11 What is the square root of 210929580 to the nearest integer? 14523 What is 563399937 to the power of 1/6, to the nearest integer? 29 What is the sixth root of 14119313 to the nearest integer? 16 What is the square root of 1002620640 to the nearest integer? 31664 What is the third root of 3073256881 to the nearest integer? 1454 What is 1170821849 to the power of 1/6, to the nearest integer? 32 What is the square root of 60665923 to the nearest integer? 7789 What is the third root of 1346736530 to the nearest integer? 1104 What is the fifth root of 379953437 to the nearest integer? 52 What is 291018449 to the power of 1/2, to the nearest integer? 17059 What is 22619217 to the power of 1/7, to the nearest integer? 11 What is 1261766060 to the power of 1/3, to the nearest integer? 1081 What is the square root of 157102519 to the nearest integer? 12534 What is 234424669 to the power of 1/2, to the nearest integer? 15311 What is 539042954 to the power of 1/2, to the nearest integer? 23217 What is 57277909 to the power of 1/3, to the nearest integer? 385 What is the ninth root of 107799962 to the nearest integer? 8 What is 73525846 to the power of 1/6, to the nearest integer? 20 What is the square root of 5476508590 to the nearest integer? 74003 What is 1289137879 to the power of 1/3, to the nearest integer? 1088 What is the third root of 756536757 to the nearest integer? 911 What is the square root of 87006994 to the nearest integer? 9328 What is 2705264905 to	{ "pile_set_name": "DM Mathematics" }
t -294, 5, 68, 1 in increasing order. -294, 1, 5, 68 Sort 3, -13, -9, -312, 4 in increasing order. -312, -13, -9, 3, 4 Sort 63, 5, -1, -387. -387, -1, 5, 63 Put -4, 18, 56, 15 in increasing order. -4, 15, 18, 56 Put 1/2, 64, 3714 in descending order. 3714, 64, 1/2 Sort -0.4, 1/6, -1, -0.235. -1, -0.4, -0.235, 1/6 Sort -10, 0.1, 0.72, -27, 4/7 in increasing order. -27, -10, 0.1, 4/7, 0.72 Put -40, -9, 1, 16/3 in decreasing order. 16/3, 1, -9, -40 Sort 11456, 2, 5, 31, 0 in descending order. 11456, 31, 5, 2, 0 Put -2, -24, -13, -1, 8 in increasing order. -24, -13, -2, -1, 8 Sort -5, -28.5, -0.5, -4, -11, -1/5 in decreasing order. -1/5, -0.5, -4, -5, -11, -28.5 Sort 2/19, 0.5, 0.4, 4, -0.01 in decreasing order. 4, 0.5, 0.4, 2/19, -0.01 Put -2/13, -0.4, -169/2 in increasing order. -169/2, -0.4, -2/13 Put -4, -1, 2418, -7 in decreasing order. 2418, -1, -4, -7 Sort -128, 1.8, 2, 0.4, 1/2 in descending order. 2, 1.8, 1/2, 0.4, -128 Sort -45, -4, 5, 77, 3 in decreasing order. 77, 5, 3, -4, -45 Sort 509, 3, 1 in ascending order. 1, 3, 509 Sort 4, 0.17, 17, 2/17, 143. 2/17, 0.17, 4, 17, 143 Sort -78/7, -2, 2, 0.06, -3/4 in decreasing order. 2, 0.06, -3/4, -2, -78/7 Put 6863, -1, -6 in ascending order. -6, -1, 6863 Put 10/387, 1, 11 in increasing order. 10/387, 1, 11 Put -2, 5, -97, -67 in descending order. 5, -2, -67, -97 Sort -31, -4, 1072/9, 3, 2 in increasing order. -31, -4, 2, 3, 1072/9 Put -1.3, 0.1, 1/3, 0, -0.27 in descending order. 1/3, 0.1, 0, -0.27, -1.3 Sort -7, 1, -1, 0, 105, -2 in descending order. 105, 1, 0, -1, -2, -7 Sort -11, 1, 65 in ascending order. -11, 1, 65 Put 6253, -2, -1, 16 in decreasing order. 6253, 16, -1, -2 Put 1, 0.2, -0.1, -0.2, 80, -0.3 in ascending order. -0.3, -0.2, -0.1, 0.2, 1, 80 Sort 0, -6/23, -3, 509/3 in descending order. 509/3, 0, -6/23, -3 Put -0.2, 34354, -5 in decreasing order. 34354, -0.2, -5 Put 3, 5, -5, -3, 15 in descending order. 15, 5, 3, -3, -5 Put -1, 277, -49 in decreasing order. 277, -1, -49 Put -2.2925, 4, 2/7 in ascending order. -2.2925, 2/7, 4 Sort 5, -10, -32, 2 in decreasing order. 5, 2, -10, -32 Sort -18, -14, -6, 2 in increasing order. -18, -14, -6, 2 Sort 1, 22, -3, -4, 34, -146. -146, -4, -3, 1, 22, 34 Put -5, 10, 297, -24, -1, -4 in increasing order. -24, -5, -4, -1, 10, 297 Put -229, 1101, -1, -4 in decreasing order. 1101, -1, -4, -229 Put 1/5, -479.4, -1, -2/5, 12 in decreasing order. 12, 1/5, -2/5, -1, -479.4 Put 1, 0.2, -1891 in descending order. 1, 0.2, -1891 Put 2, 6, 1439, -3 in increasing order. -3, 2, 6, 1439 Sort 4/3, 0.18, -2/227 in descending order. 4/3, 0.18, -2/227 Put -5, 13, -2628, 0, -4, 4 in decreasing order. 13, 4, 0, -4, -5, -2628 Put 4, -0.1, -2, 5, -11, -27 in descending order. 5, 4, -0.1, -2, -11, -27 Sort -122, 7, 1517 in descending order. 1517, 7, -122 Put -7, -123, -3, 13 in descending order. 13, -3, -7, -123 Sort -4, -1865, -59 in increasing order. -1865, -59, -4 Sort 2197, -5/8, -4. -4, -5/8, 2197 Put 5, -5, -951, -3, 0 in increasing order. -951, -5, -3, 0, 5 Sort -3/5, -209, 0, 3/2, -97, 8 in decreasing order. 8, 3/2, 0, -3/5, -97, -209 Sort -0.2, 4/27, -0.5, 2.2, 1/2. -0.5, -0.2, 4/27, 1/2, 2.2 Sort 6, -1, 4, -5211 in descending order. 6, 4, -1, -5211 Put -2, 2/9, -0.1465, 11 in descending order. 11, 2/9, -0.1465, -2 Sort -4617, 8, 1. -4617, 1, 8 Sort -36, -1/131, 1, 0.5 in descending order. 1, 0.5, -1/131, -36 Sort -3/7, -0.1, -139, 18/7. -139, -3/7, -0.1, 18/7 Put -1/5, -2, -44, -0.4, 0.14 in descending order. 0.14, -1/5, -0.4, -2, -44 Put -3, -11, -10 in descending order. -3, -10, -11 Sort 14, -222, -38. -222, -38, 14 Sort 0.393, 1/7, 1 in ascending order. 1/7, 0.393, 1 Put 2, 1/3, 0.03, 401 in descending order. 401, 2, 1/3, 0.03 Sort 5, -32, -1, 4, 0, 15 in ascending order. -32, -1, 0, 4, 5, 15 Put 75, 5, 2, 0, -8 in ascending order. -8, 0, 2, 5, 75 Put 3, 2, -2/13, -0.5, -6124, 4 in descending order. 4, 3, 2, -2/13, -0.5, -6124 Put 1361, -2, 12, 5 in decreasing order. 1361, 12, 5, -2 Put -1632, 1/4, -5, 2.9 in descending order. 2.9, 1/4, -5, -1632 Sort 67, 4, 50 in increasing order. 4, 50, 67 Put -4, -2, -10872 in ascending order. -10872, -4, -2 Sort 8249, 5, -4, 7, -3 in ascending order. -4, -3, 5, 7, 8249 Sort 1, 45, -474 in increasing order. -474, 1, 45 Sort 5, 14, -2, -54, 6, 4 in increasing order. -54, -2, 4, 5, 6, 14 Put 2, -3.11, -3/5, -20/11, 6, 3/5 in increasing order. -3.11, -20/11, -3/5, 3/5, 2, 6 Put -174/301, -4, 3 in descending order. 3, -174/301, -4 Put -8, 1, -107, 4, -2, 5 in decreasing order. 5, 4, 1, -2, -8, -107 Sort 2, 3, -12/11, 0.3, -0.3, 4. -12/11, -0.3, 0.3, 2, 3, 4 Put -11956, 5, -4, 22, 4 in increasing order. -11956, -4, 4, 5, 22 Sort -8, -2/45, -3, 3/2, -0.9 in descending order. 3/2, -2/45, -0.9, -3, -8 Sort -5, 6597, 71, -4 in ascending order. -5, -4, 71, 6597 Sort -81, -4, -1, 2, 5 in decreasing order. 5, 2, -1, -4, -81 Put 5, 98, 0, -2, 1, -3771 in increasing order. -3771, -2, 0, 1, 5, 98 Put 1, -1, -87, 3 in descending order. 3, 1, -1, -87 Put 4, 5, -5, -3/2, 0.12 in increasing order. -5, -3/2, 0.12, 4, 5 Put 8, -2, -3, -75 in increasing order. -75, -3, -2, 8 Sort 4, -0.78, -1065 in ascending order. -1065, -0.78, 4 Sort -872, -1, 6 in descending order. 6, -1, -872 Sort 1, -1636, -3/4, 5, -2. -1636, -2, -3/4, 1, 5 Sort 3, 11, 59.45, -6/5 in decreasing order. 59.45, 11, 3, -6/5 Sort 0.5, -233, 1/4, -4, -1 in increasing order. -233, -4, -1, 1/4, 0.5 Put -4, -40, 6, -5, 3 in ascending order. -40, -5, -4, 3, 6 Put -894, 2, 4, -5 in descending order. 4, 2, -5, -894 Put 4, 5, -6, 1 in descending order. 5, 4, 1, -6 Put -2, -3, 0.4, -4, 97 in decreasing order. 97, 0.4, -2, -3, -4 Sort 258, -69, 3 in decreasing order. 258, 3, -69 Put -1, 52, 196 in descending order. 196, 52, -1 Sort -3, -4, 181, 33, 3 in descending order. 181, 33, 3, -3, -4 Put 2, -2, -17, 5, 3 in increasing order. -17, -2, 2, 3, 5 Sort 94341, -0.1, -0.5 in decreasing order. 94341, -0.1, -0.5 Put -5, -506, 4, 94 in decreasing order. 94, 4, -5, -506 Put 38, -1, 3/142, -0.3 in decreasing order. 38, 3/142, -0.3, -1 Put 0, -22, 643, -1, -2 in decreasing order. 643, 0, -1, -2, -22 Put -21, 20, -24 in decreasing order. 20, -21, -24 Put 0.4, 1, -1, 16, -2/29 in descending order. 16, 1, 0.4, -2/29, -1 Put -24, 34, 1, -59, -1 in descending order. 34, 1, -1, -24, -59 Sort 3, -18, 2, -158, -4 in ascending order. -158, -18, -4, 2, 3 Put -90, 3, 1392 in descending order. 1392, 3, -90 Sort -1, 0.5, 2/18497 in descending order. 0.5, 2/18497, -1 Sort -1/5, -5, -1156, 5, 0.053 in ascending order. -1156, -5, -1/5, 0.053, 5 Put -1, -89, 2, 7, 3, 4 in descending order. 7, 4, 3, 2, -1, -89 Put -2, 140, -24, -2/3 in descending order. 140, -2/3, -2, -24 Put 1, 2, -1, -7, 32, -2 in decreasing order. 32, 2, 1, -1, -2, -7 Sort 0, 20, 22, 5, -5. -5, 0, 5, 20, 22 Sort 8/35, -12, 21, 0. -12, 0, 8/35, 21 Put -53, -5, 5, -2, 1 in ascending order. -53, -5, -2, 1, 5 Put 1, -2, -4, 5, -5, 8288 in ascending order. -5, -4, -2, 1, 5, 8288 Sort 28458, 2, 13. 2, 13, 28458 Put 14/15, 0.5, 0.3, -3, 0.8 in ascending order. -3, 0.3, 0.5, 0.8, 14/15 Put -2, 31, -5, 769, 3 in ascending order. -5, -2, 3, 31, 769 Put -12/4093, 0, -1 in decreasing order. 0, -12/4093, -1 Sort -9, 0, -14649. -14649, -9, 0 Put 51, -3, 0, 1.12, 0.3 in decreasing order. 51, 1.12, 0.3, 0, -3 Put -3, -2/13, -17.1 in decreasing order. -2/13, -3, -17.1 Sort -48, 4, 129 in descending order. 129, 4, -48 Sort -5, 73, -4, -2, -3, -12 in ascending order. -12, -5, -4, -3, -2, 73 Sort 4, 110, -4, -3, 2, 0 in decreasing order. 110, 4, 2, 0, -3, -4 Sort -674, 7, -1, -4, 5 in decreasing order. 7, 5, -1, -4, -674 Sort -9, -4, -1941. -1941, -9, -4 Put -4, 223, 268 in descending order. 268, 223, -4 Sort -0.3, -6, -0.1, 0.1, 114, -1. -6, -1, -0.3, -0.1, 0.1, 114 Sort 3/2, 18, 1/25, 6 in decreasing order. 18, 6, 3/2, 1/25 Sort -0.06, -1/4, 1/3, 4, -373 in increasing order. -373, -1/4, -0.06, 1/3, 4 Sort 0.4, 2/7, -77/3, -2, 5. -77/3, -2, 2/7, 0.4, 5 Sort -4, -5, -214456 in decreasing order. -4, -5, -214456 Sort 1, 2, -4/3, -703, 0.2, -0.3 in ascending order. -703, -4/3, -0.3, 0.2, 1, 2 Put -2, 4/89, -1, -62 in decreasing order. 4/89, -1, -2, -62 Sort -9, 8, -55, -4, 0 in increasing order. -55, -9, -4, 0, 8 Sort 5, 0, -4, 0.3, -6/11. -4, -6/11, 0, 0.	{ "pile_set_name": "DM Mathematics" }
84921 - m. Round y to the nearest one million. 10000000 Suppose c + 4c - 5n - 15 = 0, 0 = -3n. Suppose cd - 7294528 = -64792903. Let l = 32966125 + d. What is l rounded to the nearest one million? 14000000 Let s = -24451 + 24471.022. Let w = s - 0.022. Let f = w - 19.928. What is f rounded to 2 decimal places? 0.07 Let z = -794042.00052 + 794067. Let r = -25 + z. Round r to 4 dps. -0.0005 Let z = -1.11902 + 1.12. What is z rounded to 4 decimal places? 0.001 Let f = 7 + -6.95. What is f rounded to two decimal places? 0.05 Suppose -800000 = a + 2n, 6a = 3a - 4n - 2400000. What is a rounded to the nearest one million? -1000000 Let o = -146 - -145.9999764. What is o rounded to 6 dps? -0.000024 Suppose 64736637 + 31263413 = 5l. Suppose 5v = 2v - g + l, -4v + 3g + 25600009 = 0. Let n be v + (1 - (2 + 2)). Round n to the nearest 1000000. 6000000 Let n be (8398/(-6))/(2/(-6)) + 1. Round n to the nearest 1000. 4000 Let c = 151 + -151.0069. Round c to 3 dps. -0.007 Let v = -81.39 + 82. Let g = v + -0.01. What is g rounded to one dp? 0.6 Let c = -71.99986 + 72. Round c to 4 decimal places. 0.0001 Let j be (-10)/(-4)4/5. Suppose p = jr - 121995, -4p + 61025 = r + p. Round r to the nearest 10000. 60000 Let o = -326404.174 + 476.174. Let s = 325928.1000002 + o. Let y = s + -0.1. What is y rounded to seven decimal places? 0.0000002 Let j = -38757 + 11457. What is j rounded to the nearest 1000? -27000 Let p(f) = -2 + 21f3 + 1 + 14f*3 - 2f*3. Let k be p(1). Let c = 12 - k. Round c to the nearest ten. -20 Suppose -4i - 25 = 5a, -4i + 2a + 10 = -9i. Suppose w - 2w = i. Suppose -5y - 8084364 + 1884364 = w. Round y to the nearest one hundred thousand. -1200000 Let o = -83.8 - 20.2. Let p = o + 103.99999898. What is p rounded to seven dps? -0.000001 Let a(r) = -42r - 1. Let l be a(2). Let d = 144 + l. What is d rounded to the nearest ten? 60 Suppose -2a + 3a = 5881274. Let q = a + -3081274. Round q to the nearest one million. 3000000 Let p = -475 - -326. Let u = p + 148.37. What is u rounded to one dp? -0.6 Let t be (38/6)/(5/(-30)). Let b be ((-6)/(-5))/((-2)/(-30)). Let w = t + b. What is w rounded to the nearest 10? -20 Let d = -18.00000022 + 18. Round d to 7 dps. -0.0000002 Let a be (282/54 - 5) + 677694/27. What is a rounded to the nearest 1000? 25000 Let p be 6250/(1/(-160)12/120). Round p to the nearest 1000000. -10000000 Let b = -162.00702 - -162. Round b to three dps. -0.007 Let h = 20 - 19.2. Let c = 46146 + -46146.800048. Let g = h + c. What is g rounded to 5 dps? -0.00005 Let l = 111 + -158. Let b = l - -91. Let k = 43.99934 - b. What is k rounded to 4 dps? -0.0007 Let k = -14.73 - -15. Let c = k + -28.27. Let i = c + 28.0000152. Round i to six decimal places. 0.000015 Let n = -0.026000754 - -0.026. What is n rounded to 7 decimal places? -0.0000008 Let o(n) = 6n + 2. Let c be 3(-1)/(-6)0. Let s be (-2 - -3) + c + 1. Let v be o(s). Round v to the nearest ten. 10 Let x = 2513.946 + 26787. Let v = 29251 - x. Let j = -50 - v. What is j rounded to two decimal places? -0.05 Let k = 2284.99317 + -11.654. Let n = 2403.3398 - k. Let v = n + -130. Round v to 4 decimal places. 0.0006 Suppose -p = -2p. Let h be -5 + 7 + 0/(-1). Suppose -3w = -5o - 45, -4w - ho + 76 + 10 = p. Round w to the nearest 100. 0 Let m(t) = 2t3 - 3t*2 + 17t*3 + 5t*2 + 12t - 3. Let d be m(-9). Round d to the nearest one thousand. -14000 Let y = 15 + -15.000011. Round y to five dps. -0.00001 Let x = -5631630.880062262 - 72.120557738. Let o = x + 5631651. Let z = -52 - o. Round z to 4 decimal places. 0.0006 Let y = -25 + 24.99997. What is y rounded to four decimal places? 0 Let k(m) = 1226m3 + 3m*2 + 4m - 2. Let c be k(-5). Suppose 207595 = 3s - y, -2s + 69185 = -s + 3y. Let o = s + c. Round o to the nearest ten thousand. -80000 Let v = -1.2 + 2.1. Let d = 0.32 - v. Let i = d + 0.91. Round i to one dp. 0.3 Let v = 2 + 1. Suppose -vp + 4g = 9299980, -2g = -3g - 5. What is p rounded to the nearest one million? -3000000 Let w = 96 - 55. Let a = -206828553.9999926 + 206828595. Let z = a - w. What is z rounded to 6 decimal places? 0.000007 Let u = -4859 + 1947. Suppose 3q - 3s - 15633 = -4s, 3q = 2s + 15642. Let j = u + q. What is j rounded to the nearest one thousand? 2000 Let j = 15.1 + -13. What is j rounded to zero dps? 2 Let c = 1714.5 - 189.5. Let k = -1521.993 + c. Let x = k - 3. What is x rounded to three decimal places? 0.007 Suppose h - r - 191 = -h, 3r = -9. What is h rounded to the nearest ten? 90 Let v = 6.785 + -7. What is v rounded to 1 decimal place? -0.2 Suppose t = -1 - 5. Let f be ((-13100)/t)/(4/(-2400)). What is f rounded to the nearest one hundred thousand? -1300000 Let i = 776.2 - 715. Round i to the nearest ten. 60 Suppose 0k - 56 = 4k. Round k to the nearest integer. -14 Let h = 256.0444 - 256. What is h rounded to two dps? 0.04 Suppose -4l - 2x = 5319992, 7l - 2x = 10l + 3989992. What is l rounded to the nearest 100000? -1300000 Let x = -258.3 + 271. Let j = x + -6.9. Let n = j - 7. Round n to the nearest integer. -1 Suppose -2 = -5x + 3x. Let v be -4900001 - (2 - 3)x. What is v rounded to the nearest one million? -5000000 Suppose 5q - 10 = -2d + 209, 3q + 501 = 5d. Let r be d(-1)/(4/40). Round r to the nearest one hundred. -1000 Let c = -72122 - -142121. Let u be 2/63 + c. What is u rounded to the nearest 10000? 70000 Let i = -3 - -149. Let n = -145.07 + i. Let j = -0.979 + n. Round j to 2 decimal places. -0.05 Let o(c) be the second derivative of 0c*2 + 16c3 - c2 - 3c + 20c*3 + 0c. Let q be o(2). What is q rounded to the nearest 100? 400 Let c = -0.092 - -0.09. What is c rounded to two dps? 0 Let n = 69238 + -137833. Let a = n + 68598.000006. Let w = a + -3. Round w to five dps. 0.00001 Let a = 2490293.77832 + -2459575.03. Let l = -30516.7483091 + a. Let t = 202 - l. Round t to six dps. -0.000011 Let r = -29317.399856 + 29307.4. Let w = -10 - r. Round w to five dps. -0.00014 Let b = -0.046 + 0.045934. Round b to five decimal places. -0.00007 Let b = 369009 - 210449. Let a = -130665 - -369225. Let f = a - b. What is f rounded to the nearest 10000? 80000 Let b = -5 - -3.6. Let h = b - -1.428. Round h to 2 decimal places. 0.03 Let i(s) be the third derivative of 0 + 0s + s2 + 1/3s*4 + 8333/20s*5 + 0s3. Let t be i(8). Round t to the nearest 1000000. 2000000 Let o = -0.3 + 56.3. Let c = o - 55.999957. Round c to 5 dps. 0.00004 Let g = 8.0105 + -8. Round g to 3 decimal places. 0.011 Let c be (-56)/(-3) - (-2)/6. Let i(w) = -30 - c - 38 + w2 + 29 + w*3. Let n be i(0). What is n rounded to the nearest 10? -60 Let c(u) = 118747u - 24. Let f be c(-8). Round f to the nearest one hundred thousand. -1000000 Let c = -3.3 - 11.7. Let x = -14.996 - c. Round x to two decimal places. 0 Let n = 411 - 333.2. Round n to zero decimal places. 78 Let v(s) = 17499s + 1. Let a be v(1). Round a to the nearest 1000. 18000 Let q = 2.04 - 2. Let o = -6.4 + 6.35936. Let l = q + o. Round l to four decimal places. -0.0006 Suppose -1044437 = 5j + 7555563. What is j rounded to the nearest 100000? -1700000 Let y = 53683 - 137683. Round y to the nearest ten thousand. -80000 Let u = -1.19 - -1.3. Let v = 75 + -75.126. Let p = v + u. Round p to 2 dps. -0.02 Let l = -33.031 - -33. Round l to 2 dps. -0.03 Suppose -5024015 - 2975985 = 5*s. What is s rounded to the nearest 1000000? -2000000 Let h = 373 - 376.98. Round h to 1 decimal place. -4 Let a = 31785.35 + -31924.3399. Let u = -139 - a. Round u to 3 decimal places. -0.01 Let g = -1733.99999253 + 1734. What is g rounded to six dps? 0.000007 Let m = -7.6 - -0.5. Let v = m + 7.57. What is v rounded to one decimal place? 0.5 Let d = 68.5 + -57. What is d rounded to 0 decimal places? 12 Let w = -1.564 - -1.6. Let t = -0.0035 - -0.8875. Let a = w + t. Round a to 1 decimal place. 0.9 Let k = 29 - 63. Let u = 3.39773 - 37.40553. Let m = u - k. Round m to 3 decimal places. -0.008 Let t = -0.09 - 8.91. Let r = 5504 + -5495.014. Let i = r + t. Round i to 2 dps. -0.01 Let t = -505781 - -1170834. Let o = t + -664971.0037. Let h = 82 - o. What is h rounded to three dps? 0.004 Let r = 2.7 + -2.83. Round r to 1 decimal place. -0.1 Let f = 0.789 + -0.079. Le	{ "pile_set_name": "DM Mathematics" }
o the power of 1/5, to the nearest integer? 6 What is 671 to the power of 1/10, to the nearest integer? 2 What is 37164 to the power of 1/3, to the nearest integer? 33 What is the sixth root of 8870 to the nearest integer? 5 What is the eighth root of 2075 to the nearest integer? 3 What is 1905 to the power of 1/7, to the nearest integer? 3 What is 5343 to the power of 1/7, to the nearest integer? 3 What is the square root of 94461 to the nearest integer? 307 What is 30854 to the power of 1/3, to the nearest integer? 31 What is 48802 to the power of 1/10, to the nearest integer? 3 What is 6126 to the power of 1/8, to the nearest integer? 3 What is 1266 to the power of 1/5, to the nearest integer? 4 What is 1579 to the power of 1/7, to the nearest integer? 3 What is the square root of 325 to the nearest integer? 18 What is 457 to the power of 1/2, to the nearest integer? 21 What is 8603 to the power of 1/2, to the nearest integer? 93 What is 1622 to the power of 1/3, to the nearest integer? 12 What is the ninth root of 3184 to the nearest integer? 2 What is the tenth root of 28179 to the nearest integer? 3 What is the third root of 1213 to the nearest integer? 11 What is the seventh root of 3534 to the nearest integer? 3 What is 8528 to the power of 1/2, to the nearest integer? 92 What is 784 to the power of 1/10, to the nearest integer? 2 What is the third root of 4128 to the nearest integer? 16 What is the square root of 5466 to the nearest integer? 74 What is 28816 to the power of 1/2, to the nearest integer? 170 What is the eighth root of 624 to the nearest integer? 2 What is 8537 to the power of 1/3, to the nearest integer? 20 What is 18208 to the power of 1/2, to the nearest integer? 135 What is the square root of 4028 to the nearest integer? 63 What is the cube root of 1744 to the nearest integer? 12 What is the tenth root of 11412 to the nearest integer? 3 What is the seventh root of 30117 to the nearest integer? 4 What is the third root of 125707 to the nearest integer? 50 What is 1601 to the power of 1/2, to the nearest integer? 40 What is 398 to the power of 1/3, to the nearest integer? 7 What is the third root of 791 to the nearest integer? 9 What is the square root of 25209 to the nearest integer? 159 What is 2651 to the power of 1/2, to the nearest integer? 51 What is 833 to the power of 1/3, to the nearest integer? 9 What is the third root of 17764 to the nearest integer? 26 What is 2231 to the power of 1/3, to the nearest integer? 13 What is 3519 to the power of 1/2, to the nearest integer? 59 What is 3569 to the power of 1/9, to the nearest integer? 2 What is 7969 to the power of 1/4, to the nearest integer? 9 What is the third root of 738 to the nearest integer? 9 What is the seventh root of 332 to the nearest integer? 2 What is the square root of 16 to the nearest integer? 4 What is 4 to the power of 1/4, to the nearest integer? 1 What is the square root of 1564 to the nearest integer? 40 What is the square root of 108666 to the nearest integer? 330 What is the square root of 1731 to the nearest integer? 42 What is 4280 to the power of 1/3, to the nearest integer? 16 What is 1911 to the power of 1/3, to the nearest integer? 12 What is the square root of 341 to the nearest integer? 18 What is the sixth root of 2660 to the nearest integer? 4 What is 18823 to the power of 1/2, to the nearest integer? 137 What is 103298 to the power of 1/2, to the nearest integer? 321 What is 5721 to the power of 1/3, to the nearest integer? 18 What is 165 to the power of 1/2, to the nearest integer? 13 What is the square root of 5379 to the nearest integer? 73 What is the tenth root of 1678 to the nearest integer? 2 What is 372 to the power of 1/10, to the nearest integer? 2 What is the square root of 7586 to the nearest integer? 87 What is the eighth root of 633 to the nearest integer? 2 What is 11755 to the power of 1/2, to the nearest integer? 108 What is the square root of 4587 to the nearest integer? 68 What is the eighth root of 30694 to the nearest integer? 4 What is the eighth root of 10386 to the nearest integer? 3 What is the cube root of 13775 to the nearest integer? 24 What is the square root of 10727 to the nearest integer? 104 What is the square root of 1934 to the nearest integer? 44 What is 14003 to the power of 1/3, to the nearest integer? 24 What is 17625 to the power of 1/6, to the nearest integer? 5 What is the fifth root of 575 to the nearest integer? 4 What is 1975 to the power of 1/8, to the nearest integer? 3 What is the square root of 2514 to the nearest integer? 50 What is the third root of 3070 to the nearest integer? 15 What is the third root of 23210 to the nearest integer? 29 What is 1187 to the power of 1/2, to the nearest integer? 34 What is the cube root of 105282 to the nearest integer? 47 What is 863 to the power of 1/2, to the nearest integer? 29 What is the square root of 6133 to the nearest integer? 78 What is 614 to the power of 1/8, to the nearest integer? 2 What is 4440 to the power of 1/2, to the nearest integer? 67 What is the square root of 8278 to the nearest integer? 91 What is the cube root of 43644 to the nearest integer? 35 What is 709 to the power of 1/3, to the nearest integer? 9 What is the cube root of 2106 to the nearest integer? 13 What is 57634 to the power of 1/3, to the nearest integer? 39 What is the ninth root of 5870 to the nearest integer? 3 What is the tenth root of 20873 to the nearest integer? 3 What is the tenth root of 826 to the nearest integer? 2 What is the square root of 41896 to the nearest integer? 205 What is the cube root of 81156 to the nearest integer? 43 What is the tenth root of 87299 to the nearest integer? 3 What is 2795 to the power of 1/5, to the nearest integer? 5 What is the square root of 37149 to the nearest integer? 193 What is the sixth root of 2729 to the nearest integer? 4 What is 24769 to the power of 1/6, to the nearest integer? 5 What is the third root of 6941 to the nearest integer? 19 What is 108064 to the power of 1/2, to the nearest integer? 329 What is 8333 to the power of 1/5, to the nearest integer? 6 What is the cube root of 69 to the nearest integer? 4 What is the cube root of 664 to the nearest integer? 9 What is 54346 to the power of 1/3, to the nearest integer? 38 What is the square root of 5088 to the nearest integer? 71 What is 2985 to the power of 1/5, to the nearest integer? 5 What is 2433 to the power of 1/4, to the nearest integer? 7 What is 133836 to the power of 1/7, to the nearest integer? 5 What is the square root of 15254 to the nearest integer? 124 What is 947 to the power of 1/2, to the nearest integer? 31 What is 70989 to the power of 1/3, to the nearest integer? 41 What is the tenth root of 20015 to the nearest integer? 3 What is the fifth root of 23861 to the nearest integer? 8 What is the cube root of 402 to the nearest integer? 7 What is the tenth root of 1917 to the nearest integer? 2 What is 1877 to the power of 1/2, to the nearest integer? 43 What is the third root of 1194 to the nearest integer? 11 What is the eighth root of 11419 to the nearest integer? 3 What is the third root of 37985 to the nearest integer? 34 What is the third root of 3870 to the nearest integer? 16 What is the eighth root of 1262 to the nearest integer? 2 What is the square root of 528 to the nearest integer? 23 What is 11386 to the power of 1/2, to the nearest integer? 107 What is 2394 to the power of 1/2, to the nearest integer? 49 What is the third root of 437 to the nearest integer? 8 What is the square root of 13282 to the nearest integer? 115 What is 2429 to the power of 1/2, to the nearest integer? 49 What is the third root of 10720 to the nearest integer? 22 What is the square root of 54939 to the nearest integer? 234 What is 171519 to the power of 1/8, to the nearest integer? 5 What is the tenth root of 4312 to the nearest integer? 2 What is 2664 to the power of 1/2, to the nearest integer? 52 What is 2195 to the power of 1/5, to the nearest integer? 5 What is 16282 to the power of 1/6, to the nearest integer? 5 What is 50381 to the power of 1/7, to the nearest integer? 5 What is 1278 to the power of 1/2, to the nearest integer? 36 W	{ "pile_set_name": "DM Mathematics" }
1. What is the closest to l in z, 1/10, -3? 1/10 Let n = 0.3 + -0.3. Let v(m) = m*2 + 8m + 10. Let a be v(-5). What is the closest to n in -2, a, 0.2? 0.2 Let i = -0.21 + 0.3. Let q = 3.09 - i. Which is the closest to 0? (a) -2/11 (b) q (c) -0.1 c Let z = -446/3801 - -4/181. Let v = -1.5 - -1. Let p = v - -1. Which is the closest to 2/9? (a) 2/9 (b) z (c) p a Let d = 1 - 0. Let f = -0.055 - 1.945. Which is the closest to 0.4? (a) f (b) d (c) 0.5 c Let s = -4.3 + 4.7. Which is the nearest to 1? (a) 0.01 (b) s (c) -1/5 b Suppose 4i = 4w - 20, 3w - i = -2w + 9. Let f = 0.15 - -0.05. Which is the closest to w? (a) f (b) 0 (c) -1 a Let w(t) = t*3 - 4t*2 + 4t - 6. Let v be w(3). What is the nearest to -2 in v, 0.5, -0.02? v Let s = -31 + 33. Which is the closest to -1? (a) -1/8 (b) 0.1 (c) s a Suppose -o = 2s + 2 - 6, 4o = -16. Let u be ((-1)/(-2))/(1/s). Let t = -22/7 - -37/14. Which is the closest to 1? (a) t (b) u (c) -1/4 b Suppose 0 = -3f - 5x - 5, -3x = 5f + 19. Let k(i) = -2i - 11. Let v be k(f). Let o = -81 - -566/7. Which is the nearest to v? (a) -0.5 (b) -4 (c) o a Let x = -1.2 - -1. Let v = x + 0.3. Let o = 1.08 - 0.08. Which is the nearest to o? (a) v (b) -0.2 (c) 1/7 c Let t = 3 - 1. Let x be (10/(-6))/((-2)/6). Let u = 5 - x. Which is the closest to u? (a) t (b) -5 (c) 0.3 c Suppose 20 = 4z, -7 = 3h - z + 1. Let q = 8 + -10. Let k = -7 - q. Which is the nearest to h? (a) -0.3 (b) k (c) -0.2 a Let z = -6 + 5.9. Let q = -1.9 + z. What is the nearest to 0 in q, 0.1, -1/2? 0.1 Let x = 25 - 24.6. Let h = 0.2 + 0. Which is the nearest to 0.1? (a) x (b) 0.3 (c) h c Let q = -11 + 10. Which is the closest to q? (a) -2 (b) 0.1 (c) -2/3 c Let q = 0.03 - -3.97. Let a = -49/12 - -10/3. What is the closest to -0.1 in q, a, -2/9? -2/9 Let s = 12 + -10. What is the nearest to s in -2/3, -2/13, -3? -2/13 Let p = 230/3 + -76. Let n = -7 + 8. Which is the nearest to p? (a) -0.1 (b) n (c) 4 b Let m(p) = p3 + 7p*2 - 9p - 6. Let y(f) = -f*3 + 5f*2 - 6f. Let k be y(4). Let i be m(k). Which is the closest to 1/3? (a) 4 (b) i (c) -1 c Let k = 9 + -4. Let x = -33 + 36. Suppose p = -2p. Which is the nearest to p? (a) k (b) -1 (c) x b Suppose b = 4r - 5r - 3, -5r = 2b + 24. Let u be ((-3)/(-9))/(10/r). What is the nearest to u in -1/5, 0.4, 2/7? -1/5 Let u = -2 + 3. Suppose 3k + 5 = 2k. Let v = -4.2 + 4.1. Which is the closest to u? (a) v (b) k (c) 4 a Let t be 92/(-161)((-35)/(-18))/(-5). Let y = 2 - 1. What is the nearest to -1 in 2/29, y, t? 2/29 Let q = -7 - -6.99. Which is the closest to 0.1? (a) -1/11 (b) 0.3 (c) q c Let v = -139/946 + -3/86. Which is the closest to -3/4? (a) v (b) 1 (c) 4 a Let i = 4 + -9. Let o be (6/(-10))/((-3)/(-2)). Let d = 20 + -98/5. What is the closest to o in d, 0.3, i? 0.3 Let z = -83/44 - -18/11. Let m = 3.82 - -0.18. Let w be 2/6(-3)/5. What is the closest to z in m, w, -5? w Let y be 0/11/(-2). Let n be -3 + 12/30 + 6/10. Which is the closest to y? (a) 1/9 (b) -3 (c) n a Let c be 0/5 + 2/6. What is the nearest to c in 2, -0.1, 0.4? 0.4 Let f = -0.008 - -0.208. Which is the closest to -1/2? (a) 0.3 (b) -5 (c) f c Let n = -0.178 + 0.078. Which is the closest to n? (a) -5 (b) 1 (c) 2/7 c Let r = -4/17 + -14/85. What is the nearest to r in 2, 0.27, 4/7? 0.27 Let a(i) = i - 6. Let x be a(8). Let b = 1.4 + 1.6. What is the closest to -2/5 in x, 4/7, b? 4/7 Let t = -11 + 8.2. Let o = t - -3. Let d be (10/4)/132/80. What is the nearest to d in o, 0.5, -1/4? 0.5 Let n = 32 + -32.4. What is the nearest to -2 in n, 1, -0.3? n Let c = 1854.9 + -1855. Let s = 0.6 + -0.1. Let a = 1.5 + s. What is the closest to 0 in c, -3/7, a? c Let k = 18 - 14. What is the closest to 1.7 in k, -0.4, 5/3? 5/3 Let i be (-7)/(-7) + 1 + -1. What is the nearest to 1/7 in -2, 0, i? 0 Let f = -38 + 37. Let t be 0 + 1 + (-4)/5. Which is the closest to f? (a) -0.3 (b) 0 (c) t a Let o = -50 + 50.1. Which is the nearest to o? (a) 1.4 (b) 5 (c) -1/5 c Let u = -2 + 2.1. Let h = -69/292 - 1/73. Which is the nearest to 0.2? (a) u (b) 3 (c) h a Let p = 0.055 + 0.045. Let d be 2/(-3) - (-8)/9. Which is the closest to p? (a) d (b) 0 (c) -0.2 b Let c = -513 + 509.07. Let r = 0.07 - c. What is the nearest to -1 in r, -0.3, 3/8? -0.3 Let y = -0.02 + -1.98. Let g be (-5)/((-3)/(7 - -2)). Let x be (g/4)/(-3) - -1. Which is the nearest to y? (a) 4 (b) x (c) -4 b Let f(t) = -2t*2 - 3t + 6. Let x be f(0). Which is the closest to x? (a) 5 (b) 0 (c) -1 a Let y = -4.9 - -4.4. Which is the closest to -3? (a) 1 (b) y (c) 4 b Let i = -0.067 + 8.267. Let p = -8 + i. What is the closest to 1 in -0.3, p, -4? p Let z = 0.1 + 0.1. Let u be (1 + 3)/1 + 966/(-231). Let n = 169/4 + -42. What is the closest to -1 in n, z, u? u Let w = -70 - -73. Which is the nearest to 0? (a) w (b) -7 (c) -2/5 c Let s = -1.9 + 2. Let f = -3 + 5. Let v = -5 + f. Which is the closest to s? (a) -2 (b) 0.4 (c) v b Let o = 4/15 + 67/30. Let d = o + -3. Which is the closest to 1/4? (a) d (b) -5 (c) 2 a Let o be (-1)/((-2)/4)15/10. What is the closest to 2 in -6/11, o, 0? o Let k = -164/711 + 2/237. Let w = -24.4 - -27. Let d = w - 0.6. What is the closest to 0 in 5, k, d? k Let i = 4 + 0. Suppose -3k + 1 = -u - 3u, 0 = -u - 2k - 3. Let l = 0.2 + 0. Which is the nearest to u? (a) 1/4 (b) i (c) l c Suppose 4q - 5o + 6 + 50 = 0, 4o = 16. Let x = q + 17. Let z(p) = p - 8. Let r be z(x). Which is the nearest to r? (a) 4 (b) 0 (c) 3/4 b Let j be 2 - -1 - (6/9 + 3). Let g = -5 - -10. Let d = 0.5 - 0.6. Which is the closest to d? (a) j (b) g (c) 0 c Let f = 2.9 - 3. Let i = 3 - 1. Let m = 2 - i. What is the closest to -0.1 in m, f, -1? f Let d = 2 - 2. Let g = 0.2 - d. Let l = -4 + 4.1. Which is the nearest to g? (a) -3 (b) -0.2 (c) l c Let k = -0.0364 - -21.7364. Let i = 22 - k. What is the nearest to -4 in i, 5, 2/9? 2/9 Let c = -2.8 + 2.8. What is the nearest to 9 in c, -1, 1/5? 1/5 Let w = 7 + -4. Which is the closest to -1/4? (a) 6 (b) -0.5 (c) w b Let o(n) = 3n - 3. Let y be o(2). What is the nearest to -2 in y, 3/4, 1? 3/4 Let l = 8 + -7.8. Which is the closest to 1? (a) 3 (b) 1 (c) l b Let f = -81 + 889/11. What is the nearest to 0.1 in 1/4, -0.12, f? 1/4 Let k be 0/((-7)/((-7)/(-2))). Let t = -7/8 - -3/40. Let u = 15 - 11. What is the nearest to -1 in k, u, t? t Let m = 146 + -151. Let o = 0.4 + -0.3. What is the closest to -0.1 in m, -2/7, o? -2/7 Let j = -1 - -1. Suppose -12 = 2k - jk. Let q = -9 - k. Which is the closest to -2/5? (a) q (b) -1/8 (c) -0.2 c Suppose 17 = 2x - 19. Let q be (x/4)/(-5 + 8). What is the closest to -1 in 0, -3, q? 0 Suppose 3r + 7 = -2. Let u = 8 + -8.3. What is the closest to -0.1 in r, -0.1, u? -0.1 Let t = 3.5 - 4. Let k = t - -0.5. Let x = -0.8 - -0.5. What is the nearest to k in -5, -4, x? x Let q = 2/99 - 464/99. Let o = -4 - q. Let g = -0.19 - -3.19. Which is the closest to 1? (a) 5/2 (b) o (c) g b Let q = -29 + 30.7. Let z = 2.7 - q. Which is the nearest to z? (a) 5 (b) -5 (c) 1/4 c Let k = 86.63 + -96.6. Let x = -8 - k. Let o = 0.03 + x. What is the closest to o in 0.1, 3, -0.2? 3 Let q(h) = 4h + 1. Let p be q(-2). Let n = 6 + p. What is the nearest to n in 2, 0.5, 0? 0 Let n = 0.014 - 0.314. Suppose 0u + u = 0. Which is the closest to 0.1? (a) u (b) 5 (c) n a Let f = -5 - -7. Let y = 3 - f. Which is the closest to -3? (a) -3/8 (b) -2 (c) y b Let g = 7/3 + -5/3. Which is the nearest to -1? (a) -4 (b) g (c) -1 c Let n = 0.2 + 0. Let p = 29 - 29.5. Which is the closest to n? (a) -5/6 (b) p (c) -4 b Let i = 3.2 - 3. What is the closest to i in -4, 0.3, -0.1? 0.3 Let r be 30/45 + 2/6. What is the closest to -0.1 in -7, r, -0.5? -0.5 Let m = -2 - -3. Suppose 5b = v - 19, 4v - 35 = 5b - v. Let t be m/3 - (-1)/b. What is the closest to 1 in t, 2/13, 5? 2/13 Let m be ((-9)/6)/(2/12). Let v(r) = r3 + 9r**2 + r + 12. Let p be v(m). Which is the closest to -2/3? (a) p (b) -2/7 (c) -1/2 c Let w = -4 + 4. Let g be 4/(-2) + 20/12 + 1. What is the nearest to g in -1, 2/9, w? 2/9 Let l = 204 + -1834/9. Let h = l - 0. Let m = 270/847 + -4/121. Which is the closest to -0.1? (a) m (b) h (c) -2	{ "pile_set_name": "DM Mathematics" }
of -3k4w - 2k4 + 1549k*3w + 2k3 - 12k*2 + 6kw + 2k + 17 wrt k? -72kw - 48k + 9294w + 12 Find the third derivative of -5868y5 + 8028y*2 wrt y. -352080y*2 What is the third derivative of -48o*6 - 2o*5 - 60o*2 wrt o? -5760o*3 - 120o*2 Find the second derivative of -42y*3 + 4y - 2 wrt y. -252y What is the derivative of -2a*4 + 2462a*3 + 12854? -8a*3 + 7386a*2 What is the third derivative of -8i*3n*2w - 17i3n*2 - 6i*2n*2w - i*2n - 8iw + 2n2 wrt i? -48n*2w - 102n2 Find the third derivative of 189o*4 - 8o*2 - 39. 4536o Find the third derivative of 211i3u*3 - 3i*3u*2 + 9iu2 + u wrt u. 1266i*3 What is the second derivative of -14q*4z*3 + 2q*4 - 3q*2 + 3qz3 - 43q wrt q? -168q2z*3 + 24q*2 - 6 Differentiate -145g*3 - 145 wrt g. -435g*2 What is the first derivative of 6fu - 28f - 635u wrt f? 6u - 28 What is the second derivative of -2d3t*5 - 151d*3t*4 - 8d*3t - 6d3 wrt t? -40d*3t*3 - 1812d*3t*2 Find the third derivative of -354c*4i + c*2i + 10i wrt c. -8496ci Differentiate -6fhl + fh + 2f + 2hl*2 + 13l*2 with respect to h. -6fl + f + 2l*2 Find the third derivative of 391q*2u*4 + 2q*2u*2 - 23qu2 + 2u wrt u. 9384q2u Find the first derivative of -32d4t + 2d3t*3 - 79t*3 wrt d. -128d*3t + 6d2t3 What is the second derivative of -j3w2 - 5j*3w + 360w4 + 15w wrt w? -2j3 + 4320w*2 Differentiate -2467fu + 18u + 13 wrt f. -2467u Differentiate 15s*2y*4 - 5s*2y*3 - 133s*2 - s with respect to y. 60s*2y*3 - 15s*2y*2 What is the derivative of -26w*2y - 1542w2 wrt y? -26w*2 Differentiate 7g*3q*3 - 7g*3q + 668g3 with respect to q. 21g*3q*2 - 7g*3 Find the third derivative of 2106o*3 - 3094o2 wrt o. 12636 What is the derivative of -j2v - 913jv + 175v + 1 wrt j? -2jv - 913v Find the second derivative of -17343h*2 - 11866h wrt h. -34686 What is the first derivative of -3888i3 + 15594? -11664i*2 Find the second derivative of 13n*5 - 27n - 4 wrt n. 260n3 What is the second derivative of -26i*4 + 29i + 4? -312i2 What is the derivative of 1003n*3t*2 - 397t*2 wrt n? 3009n*2t*2 What is the third derivative of 1732j5 - j4 + 141j2 + 17 wrt j? 103920j*2 - 24j What is the first derivative of -13uv - 235u + 42v*3 wrt v? -13u + 126v2 Find the third derivative of 2670p5 + p2 + 7. 160200p2 What is the second derivative of 259u*2 + 10u wrt u? 518 What is the third derivative of 1093w5 + 2w*2 + 1900w? 65580w2 What is the second derivative of -3dn2w - dn2 - 70dnwy2 + dy*2 + 13dy - 3n*2wy2 - nw wrt y? -140dnw + 2d - 6n2w Differentiate -5i3n - 2i3 - 181n*2 - 14 wrt n. -5i*3 - 362n Find the third derivative of q*4v*2 - 177q*4v - 2q3v*2 - 31q*2 - 6qv2 wrt q. 24qv2 - 4248qv - 12v*2 Differentiate -41a*3y + 17770a3 - 45ay with respect to y. -41a*3 - 45a What is the second derivative of 1654f2l + f*2 + 3fl - 4f - 7 wrt f? 3308l + 2 Find the second derivative of 2tv2x*3 + 5tv2x + 2tv + 5t + v2x - 8x3 wrt v. 4tx3 + 10tx + 2x Find the second derivative of 9g3w - 4g3 + 5g*2w + 6g2 - 17046gw + 2g wrt g. 54gw - 24g + 10w + 12 What is the third derivative of 2c3v4 + c3v + 1122c*3 - 7035c*2v*4 - cv*2 + 2 wrt v? 48c*3v - 168840c2v What is the derivative of -2l3u*3 + 166l*3 - 5lu3 wrt u? -6l*3u*2 - 15lu2 Differentiate 245dm - 2d - m*4 - 101 with respect to m. 245d - 4m3 What is the second derivative of 229u*2 + 69u - 3? 458 What is the first derivative of -168x3 + 121 wrt x? -504x*2 What is the second derivative of -261cy2 - 7cy + 25y wrt y? -522c Find the third derivative of 2206b*3x - 1090b2x - bx wrt b. 13236x What is the second derivative of -179n4 - 437n - 1 wrt n? -2148n2 Find the first derivative of b3k*2 + 170b*3k + 65b3 + 4b*2k2 - b2 + 3b wrt k. 2b*3k + 170b3 + 8b*2k Find the second derivative of -135f2 + 77f - 1. -270 What is the third derivative of 707c3z*3 + 139c*3 + cz*2 + 2z*3 wrt z? 4242c*3 + 12 Find the third derivative of 297f*2l*3 + 2f*2l*2p + 15f2lp - 2fl3p - 6fp + 2l3 wrt l. 1782f*2 - 12fp + 12 What is the derivative of -3506i*3 + 8015 wrt i? -10518i*2 Find the second derivative of -7828c*2v2 + c2v - 11512c*2 + cv*2 + 2c wrt v. -15656c2 + 2c Find the third derivative of -272f4 - 136f*2 + f. -6528f Find the third derivative of 1059lo*3 + lo*2 + 161lo + 2l wrt o. 6354l Find the second derivative of -148n*3 - 129n + 1 wrt n. -888n Find the second derivative of 11a*5n - 45a2n - 2an - 5n wrt a. 220a*3n - 90n What is the third derivative of 1203p*3s*2 + 4p*2 - 861ps2 + p wrt p? 7218s2 Find the second derivative of -a3 + 130a2s + 8a + 7s wrt a. -6a + 260s Find the second derivative of -1241h3t*2x - 4h3tx + h3x + 7h2t*2x - 66htx - 3tx wrt t. -2482h*3x + 14h2x Differentiate -2d3h + 475d3 - 7d*2h*4 + 1 wrt h. -2d*3 - 28d*2h*3 What is the third derivative of -3af4p - 116af*4 - 2af2p + 75af - 2ap - f*4p - fp wrt f? -72afp - 2784af - 24fp Find the third derivative of -11n4u*2 - 4n*4u - 2n4 + 87n*2u + 2nu*2 wrt n. -264nu2 - 96nu - 48n What is the second derivative of -2l5y*2 - 40l*2y*2 + 4ly - 10y*2 wrt l? -40l*3y*2 - 80y*2 Find the third derivative of 34h*4 - 36h*3 + 14h*2 - 42. 816h - 216 What is the first derivative of 2hs*2 - 3hs - h - 12j*2s + 174j2 + 2js2 wrt s? 4hs - 3h - 12j2 + 4js Differentiate 1112a*2 + 1210 wrt a. 2224a Find the first derivative of -15gh*2 + 2gh + 12g - 3h2 + 44h + 1 wrt g. -15h2 + 2h + 12 Find the second derivative of 17c2m*2 - 70c*2 + cm - 18m2 + m wrt m. 34c2 - 36 What is the third derivative of -s5 - 3s4 - 48s*3 + 75s*2 + s + 36? -60s*2 - 72s - 288 Find the second derivative of -g*5 + 3g*4 - 179g wrt g. -20g3 + 36g*2 Find the third derivative of -18i*3 - 6i*2 + 4 wrt i. -108 Differentiate 2at2u + 34at - 4au + 4a - 4tu + 6u wrt t. 4atu + 34a - 4u Find the third derivative of 1093w6 - w4 - 123w2 + 10. 131160w*3 - 24w Find the third derivative of 2c3iq + 6114c*3i - c*3q + 145c2q + i + q wrt c. 12iq + 36684i - 6q Find the second derivative of -16317j2r*3 + 10401jr3 wrt j. -32634r*3 What is the third derivative of -1167g*5 - 2762g*2 wrt g? -70020g2 Find the second derivative of a4 + 2a3 - 76a*2 + 4566a. 12a2 + 12a - 152 Differentiate -634d2g - 4d2u + 7dgu2 + 71u*2 wrt g. -634d*2 + 7du2 Differentiate 173i*3 - 406. 519i*2 Find the second derivative of 2369g*2k*3 + g + 111k*3 + 4 wrt g. 4738k*3 Find the second derivative of -7672q5 + q3 - 2q2 + 3536q wrt q. -153440q3 + 6q - 4 Find the third derivative of 22cg*3q*3 - 2cg3q*2 + 155cg3 - 49cgq*3 - cgq wrt q. 132cg3 - 294cg Differentiate -32a*3s*2 + 2a*3s + 364a3 - 3as2 + 2 with respect to s. -64a*3s + 2a3 - 6as Differentiate 17dru*3 - 4dr + 2du2 + 55d + 2u3 with respect to r. 17du3 - 4d What is the third derivative of nt5 - 184nt4 - 17nt2 + nt - 2n - t2 wrt t? 60nt2 - 4416nt What is the second derivative of -86v*5 + 2v*2 - 299v - 2? -1720v3 + 4 What is the first derivative of -3fiz + 112fi - 2iz + 3z3 - z wrt z? -3fi - 2i + 9z2 - 1 What is the second derivative of 16n*4 + 4n*3 + 319n wrt n? 192n2 + 24n Find the second derivative of -50b4 + 59b. -600b2 Find the first derivative of -2131t*4 + 477. -8524t*3 What is the second derivative of 53dhn*2 + 3dhn - 2dn - 4hn*3 + hn - 21h wrt n? 106dh - 24hn Differentiate 12870x - 12028 with respect to x. 1287	{ "pile_set_name": "DM Mathematics" }
/19 - 2 - 75/171 -1/3 What is 2/3 + 6(-77)/(-198)? 3 What is the value of 12/8(-40)/(-45)? 4/3 What is the value of -6 + (5 - 1) + 1 + -1? -2 Evaluate ((-12)/(-84)0)/2. 0 What is (7/(-105))/((-13)/(-156))? -4/5 What is 3 - (36/6 + -5) - 5? -3 (2 - 2)/(1 - -3) 0 What is -10(-7)/(-14) + (-4 - 1)? -10 Evaluate 26/60 + (-3)/9. 1/10 Calculate (-161)/(-138) + 1/(-6). 1 Evaluate -3 - (-70)/(-63)(-15)/6. -2/9 What is (-6)/4(2304/27)/(-16)? 8 Evaluate 3 + -3(-28)/(-12). -4 What is the value of (-10)/(-4 + 6) + 6? 1 What is ((-1)/7)/(-1)-3? -3/7 Evaluate (-10)/321/(-14) + -1. 4 ((-4)/5)/(2808/(-780)) 2/9 What is ((-45)/7 - -6) + 4/(-7)? -1 Calculate (-455)/(-350) - (-2)/10. 3/2 Evaluate 2(-4)/(-8) - 0. 1 What is 1/(-2) - (-990)/924? 4/7 What is (-168)/(-30) - 3/5? 5 What is the value of (-1330)/315 - (8/(-9))/4? -4 Evaluate (-3)/(-9)(2 - 5). -1 What is ((-6)/(-10))/((-9)/5)? -1/3 What is -6(-2)/(-16)32/(-32)? 3/4 What is 312/52 - 34? -6 Evaluate ((-624)/(-2080))/(-26/(-20)). 1/2 What is ((-12)/9)/((-70)/(-105))? -2 Calculate (-74)/14 - (-18)/63. -5 What is the value of (-3)/(-7) - 770/882? -4/9 Calculate -66 - -63 - 11/1-1. 8 Calculate 21 + -14 + -13 + (4 - 5). -7 What is (8/(-408))/(((-3)/18)/(-1))? -2/17 ((-9)/(-108))/((-1)/(-9)) 3/4 Evaluate 258/(-126) - -3 - 12/42. 2/3 What is the value of (-84)/(-30) - 4/(-20)? 3 What is 6 + -1 + (-136)/34? 1 (-150)/180 - 2/(-4) -1/3 Calculate 30/(-30)(-1 + 1). 0 Evaluate 30/25(-10)/4-1. 3 1/1(-7 - -7) 0 Evaluate (8 - 6/3) + -17 + 14. 3 Evaluate 234/362/2 - 5. 3/2 Calculate 20/7 - 7/(-49). 3 6 + -12 - (-14 + 22) -4 Evaluate 4/(-1)1/26. -2/13 5/((-72)/252 + (-5)/7) -5 What is the value of ((-87)/(-12))/298/13? 2/13 Evaluate 11/2 + 11/2. 6 (-72)/11 - (-10 - (-728)/77) -6 What is 0/(4 - 8/4)? 0 What is ((-15)/(-20))/((567/(-24))/3)? -2/21 Evaluate 18/16(-11 - 93/(-9)). -3/4 What is the value of ((-8)/18)/((-20)/10)? 2/9 Evaluate -43/(-8)2. 3 What is (-9)/(-27)(-6)/(-1)? 2 What is 30/(-10)(-1 - 0)? 3 What is the value of 1/12 + (-4 - 17/(-4))? 1/3 ((-3 - -2)/(-2)0)/2 0 Calculate (-1 + 1 - -4)-1. -4 What is the value of (1 - (-9)/(-10))/(4/32)? 4/5 Evaluate 3 + 4 - 9/((-63)/(-35)). 2 What is the value of 46/(-368) - 2/(-16)? 0 What is the value of (8/(-10))/(168/60)? -2/7 Calculate (2/(-4) - -1)(-36 + 36). 0 -3 - (-10 + (4 - -1)) 2 Evaluate (24/14 - -3) + -5. -2/7 Evaluate (24/(-32))/(4(-9)/(-32)). -2/3 (-10)/8 - (45/20)/(-9) -1 3/(-30)(4 + 15/(-5)) -1/10 Calculate 138/161(11/(-3) + -1). -4 What is the value of 25/5 - ((-176)/(-92) + 3)? 2/23 What is the value of (100/26 - 2) + 8/52? 2 (-16)/(-14) - 288/(-336) 2 What is -5 + (-13 + 4)-1? 4 Calculate ((-2)/(-4))/(91/(-546)). -3 Evaluate 1/((-5)/(-5)-1 + 0). -1 What is (1(-2)/(-7))/(-4 + 6)? 1/7 Calculate ((-2)/(-12))/(-3 + (-21)/(-6)). 1/3 (-3)/(-8) - 16/64 1/8 (-10 - 0)/((-144)/(-72)) -5 Evaluate 2376/405 + 6/45. 6 What is (-16)/(-16) - 1/4? 3/4 What is (-15)/6(-64)/(-80)? -2 1/(-1) + (756/30)/14 4/5 Calculate (-5)/(200/(-7)) + 9/(-24). -1/5 Evaluate 39/(-2)(-54)/117. 9 What is (-12)/21 - (5 + -6)? 3/7 (-6)/(-3)(-126)/(-36)-1 -7 Calculate -1 - 2 - (-68)/(-40)-2. 2/5 Evaluate (-304)/(-90) - 3 - (-6)/(-10). -2/9 What is (-5)/10(-1)/64? 1/3 What is the value of 2300/400 - ((-5)/4 - -1)? 6 Calculate 901/(-153) - (-7 + 1). 1/9 1/(1/(-2))(-2)/(-4) -1 (-172)/112 - 10(-5)/40 -2/7 What is ((9 - 18) + 8)0? 0 Calculate (12/21)/(11/(462/228)). 2/19 What is (-4)/102-3 + 0/(-252)? 2/17 What is (96/(-30))/(32/(-40))? 4 41/(-3) + (-172 - -183) -8/3 (-24)/((-27)/9) + (-12)/3 4 What is ((-10)/(-325))/(9/(-45))? -2/13 What is the value of (-2)/(2/(-2) + 3)? -1 Evaluate (-3)/12 + (91/7 - 12). 3/4 What is (98/196)/((-26)/(-4))? 1/13 (1 - 2)(-69 - -74) -5 (-34)/51(-18)/84 1/7 Calculate ((-76)/266)/(16/(-84)). 3/2 Evaluate -4 + (90/(-105))/(12/(-56)). 0 What is the value of 2/(4/(-6)) - 2? -5 Evaluate ((-1)/5)/(3 - (-55)/(-20)). -4/5 ((-1)/2)/(-1)(-9)/(-9) 1/2 Evaluate 13 - (-16)/((-64)/36). 4 What is (-17)/((-663)/240) + 2/(-13)? 6 Calculate (459/(-85) - -5) + (-38)/(-70). 1/7 What is the value of ((-705)/(-70) - 10)/((-1)/(-2))? 1/7 Calculate 5/(-25)(-30)/8. 3/4 15/(-9) - 70/(-63)6 5 ((-2)/2)/(-2 - 35/(-15)) -3 Calculate (-5 - 0/8)/1. -5 What is the value of (-48)/22 - (-4)/22? -2 (330/24 - 13) + 50/(-88) 2/11 Evaluate 3/((1 + 0)6). 1/2 What is the value of -4 - (3 + -1 - 10)? 4 Calculate ((-7)/(-21))/(20/12) - 0. 1/5 What is the value of 15/9(-1 - -4)? 5 Evaluate 7 + -2 - (8 + -2). -1 Evaluate -14 - ((-60)/(-2))/(-3). -4 Evaluate 1(-2 + 65/35). -1/7 What is ((-2)/(-12))/((-14)/4 - -3)? -1/3 What is (1 - 0)-675/90? -5 Calculate (13/39)/(2/6) + -5. -4 What is (-1)/(-8) - 80/128? -1/2 Calculate 2/(-14)528/(-70). 2/7 What is the value of (-152)/36 + (-18)/(-81)? -4 What is (6 - -1) + (25 - 33)? -1 What is the value of (27/1355/3)/(-1)? -1/3 What is the value of 767/(-354) - 2/2-2? -1/6 (2 - 0/4)/(5 - 7) -1 What is the value of ((-28)/(-12))/((-14)/36)? -6 What is (1950/(-105))/(-13)(1 + 6)? 10 What is 18/(-2)(-8)/96? 3/4 What is (-2 + (-102)/(-48))6? 3/4 Calculate 2/22042 - 4/22. 1/5 What is the value of (-30)/204/39? -2/13 Calculate (-1550)/(-403) + (-1 - 45/(-39)). 4 What is -2 + (-6)/12 + 3/2? -1 Calculate (44/24)/11 + (-155)/30. -5 Evaluate 6/(-210)53. -3/7 Calculate ((-6)/16-4)/((-165)/20). -2/11 What is the value of (3 + -3)((-14)/4)/7? 0 What is (132/110)/((-12)/40)? -4 (108/(-15) - -8)(-10)/(-12) 2/3 What is the value of (4 - 2) + ((-140)/(-21) - 8)? 2/3 ((-1)/(-2))/((-16)/24) -3/4 What is the value of (-1 + (-7)/(-4))/(195/(-40))? -2/13 What is the value of (1/(-3))/((-7)/2 + 4)? -2/3 What is the value of (-2)/12-20? 0 ((-4)/(-6))/(798/(-72) + 11) -8 What is the value of (-1)/5 - 77/(-35)? 2 Evaluate -6(3 - 9/((-27)/(-10))). 2 Calculate 4 - (7 - (1 - 3)). -5 What is 27/(-18)(0 - 2)? 3 What is (-22)/(-18) + (-6)/27 - -7? 8 Calculate (-3 + 4)/(21/(-7)). -1/3 Evaluate (9/(-21))/((-4)/(-56)-2). 3 Calculate (-55)/(-11) - 2 - -5. 8 What is ((-704)/(-40))/(-4) - -5? 3/5 Evaluate (23/(-138))/(2/3). -1/4 What is the value of ((-225)/20 - -11)(-5 - 0)? 5/4 (-3)/5(-47 - -52) -3 What is (20/(-45))/((-8)/72)? 4 Evaluate (23/46)/(2/(-32)). -8 What is (3/24)/((-4)/16)? -1/2 What is (-13)/(-208) + 86/(-96)? -5/6 Calculate (-33/(-4))/((-237)/158). -3/2 Evaluate ((-1)/(-3))/(5/3). 1/5 What is (-5 - 94/(-10))(-95)/(-38)? 11 What is the value of 4 + 24/(-6) + -2? -2 (-25)/(-30) - (17/6)/(-17) 1 Calculate (-2822)/9711 - 2/13. -4/9 What is -1(-2)/(-12) + 93/18? 5 What is the value of ((4/5)/2)/((-128)/(-40))? 1/8 Calculate (-32)/(-7) + 1460/1960. 5 What is 42/(7 - -7) + (-38)/12? -1/6 Calculate (11/((-462)/12))/((-2)/28). 4 What is (-6)/(-720)-49-1? 3/10 What is the value of (3 - (-14)/(-6))/((-4)/(-6))? 1 What is the value of (-5 + (-108)/(-20))-5? -2 Evaluate 2/(3 - -1) - (-5)/30. 2/3 What is the value of 80/140 - (-54)/(-70)? -1/5 Calculate ((-2)/3)/(2/3). -1 Calculate 1/(3(-5)/45)1. -3 Evaluate (-4)/(-6)(-2 - -11 - 12). -2 What is the value of (4/18)/((-50)/(-675))? 3 (22/8 + (-1)/(-4))1 3 Evaluate ((-12)/18)/((-4)/6). 1 What is 18/(-4)144/108? -6 Evaluate 19/(-5) - (-43)/(-215). -4 What is the value of 4/(-14) - (-12)/14? 4/7 53 + -61 + (-66)/(-8) 1/4 Evaluate (-1 - -2)/(-8 + -3 + 10). -1 Calculate (3/(-4))/((-9)/6). 1/2 What is the value of 297/(-45) - (115/(-25) - -4)? -6 What is the value of 33/(-77) + (-11)/7 + 3? 1 Calculate 6 + 637/(-84) + 28/21. -1/4 Calculate (-2 - (-10)/4)/((-2)/(-4)). 1 What is the value of (-15)/18(-56)/70? 2/3 (7/(-105))/((-2)/(-6)) -1/5 Calculate (-9603)/(-1089) + (-2)/(-11). 9 (-35)/(-20) + (-1 - (-10)/8) 2 What is 4/(-78) + (-772)/156? -5 ((-3)/(1 + -4))/(2/(-2)) -1 What is (1 - 5/2)/((-60)/(-160))? -4 What is the value of 3/90-94 + (3 - 0)? -2/15 What is (-1)/8 + 234/(-48)? -5 Evaluate 2/3((-95)/(-15) - 6). 2/9 Evaluate (-3 + (-98)/(-34))(-2 + 1). 2/17 What is the value of -3 - ((-47)/15 + 0)? 2/15 ((-2)/((-36)/(-15)))/(15/27) -3/2 What is the value of (2 - 30/12)(6 - 2)? -2 Calculate (3/(-36))/(3/(-24)5). 2/15 What is (1 + 7 + -1)(0 - -1)? 7 Evaluate 36/20-3 + (-6)/10. -6 What is the value of 1 - (-12)/(-15) - (-60)/75? 1 What is (-2)/4 + 0 - (-130)/156? 1/3 Eval	{ "pile_set_name": "DM Mathematics" }
) -1/5 Evaluate -1(-3)/1 + 1/(-1). 2 Calculate 3 - 63/364. -4 What is the value of 116/(-1305)(-4)/((-8)/(-5))? 2/9 What is ((-90)/(-120))/((9/28)/(-3))? -7 What is the value of -5 + -7610/(-160)? -1/4 What is ((-1)/2)/((-1)/10)? 5 Evaluate (33/(-110))/(3/(-5)). 1/2 6 + 1 - 756/63 -5 Evaluate 5/2(-88)/165. -4/3 Evaluate (42 - 21) + 6 + -20. 7 What is (-10)/(-40)32/(-20)? -2/5 What is the value of (0 - 5) + -9 + 288/20? 2/5 What is the value of -5 - 0 - (21 + -24)? -2 Calculate 3 - (-33)/22(-4)/6. 2 Evaluate -2 - 4 - (-12 - -8). -2 5(6 + (-99)/15) -3 Evaluate 900/126 - (-2)/(-14). 7 44/52 - (3 + 1 - 3) -2/13 4/(-6) + 40/15 2 (6/(-10))/(-1 - (-12)/20) 3/2 What is 39/528/(-66)? -1/11 Evaluate (-7)/70(-15)/(-2). -3/4 10 + -9 + (2/(-2) - 2) -2 What is 2 + (-4 - -1)/(-3)? 3 Evaluate 51/(-34) + (-43)/(-26). 2/13 What is ((-6)/16)/((-19)/152)? 3 (-2)/15 + (-832)/(-390) 2 Calculate (4/54)/(26/(-39)). -1/9 Evaluate (-230)/(-345)(-3)/2. -1 What is ((-2)/4)/(8/(-48))? 3 Calculate (-4)/(-14)(2 - 92/60). 2/15 (-8)/1 + 4 + 8 4 (2/3)/((-28)/(-6)) 1/7 Evaluate (-182)/42 + (64/(-12))/(-4). -3 Evaluate (-4)/(-60)-3 + (-18)/10. -2 What is (-3)/15(-2 - (-24)/9)? -2/15 (80/140)/(14/49) 2 (-34 + 35)/(2/(-4)) -2 (((-77)/(-112))/(-11))/(1/6) -3/8 3/2 + (-147)/28 + 4 1/4 (-3 + (-16)/(-6))/(4 - 2) -1/6 Calculate 9/2(-1008)/567. -8 What is 6(-10)/410/50? -3 (-6)/(-18)2 + (-4)/(-30) 4/5 ((-814)/(-90) - 9)/(1/(-3)) -2/15 Evaluate (30/25)/((-1)/5). -6 Calculate (3 - ((-63)/4)/(-7))/(-3). -1/4 What is 0 - 3 - (-7 + 88/20)? -2/5 Evaluate 6/(-4)64/24. -4 What is the value of 1/(30/(-4)) - 532/60? -9 Evaluate (8/(-160)1)/((-4)/(-10)). -1/8 Calculate ((-2)/(-5))/(7/(1225/(-28))). -5/2 Calculate 2 + 0(-2)/12. 2 2/(-6) + (-12)/(-9) 1 What is the value of (1 - -6)((-126)/9 + 13)? -7 What is the value of 33/(-55) + 39/15? 2 What is (-1)/(-7 - (-1)/((-16)/(-116)))? -4 (-4)/(-18)(-171)/437 -2/23 Calculate -3 + 1 - (3 - 4). -1 What is (28/21 - (-2)/(-1)) + 0? -2/3 Calculate (-4)/120625. -5 (-3)/(72/(-66)) - (-6)/(-4) 5/4 What is the value of 2 - (-6 - 0)/3? 4 What is the value of 2/(2/5)4336/(-2710)? -8 1645/525 - (1 - (-26)/(-30)) 3 What is the value of (26/(-10) + 2)/(4/20)? -3 What is the value of -4 - (0 + 3)-2? 2 Evaluate 4 - (-4 - (3 - 5 - 6)). 0 (-1 - (-12)/10)(-35)/56 -1/8 (-102)/(-108) + 15/(-18) 1/9 Calculate -1(-1 + 42/48). 1/8 Evaluate 154/(-21) + (-6)/9. -8 Evaluate 14/(-4)(-21)/147-1. -1/2 What is the value of 7 - ((-55)/3)/((-5)/3)? -4 Calculate 6/(-1) - (-70)/8 - 3. -1/4 What is the value of 4 - (-42)/(-10) - 9/(-20)? 1/4 ((-3)/(-9))/((-146)/(-12) - 11) 2/7 (-14)/35 - 504/(-60) 8 Calculate 4/10(-20)/(-8). 1 Evaluate (9/(-7))/((-18)/42). 3 What is the value of (-49)/(-84) - ((-2)/(-8) - 0)? 1/3 Calculate (-7)/(7/6) - -3. -3 Calculate (-14)/1(-14)/49. 4 Calculate 5/((-15)/2)(-15)/70. 1/7 Evaluate (-66)/(-198)(2 - 1). 1/3 (-26)/(-7) - (3 + 2 + -1) -2/7 Calculate 27/390-5 - (-2)/4. 2/13 What is 17/119(-7)/2? -1/2 What is the value of 11/((-308)/48) - 1-2? 2/7 What is the value of 55/(-105) - 48/(-56)? 1/3 (-6)/12 + (-10)/(-20) 0 What is (-69)/(-30) + (12 - -2)/(-7)? 3/10 Evaluate 7070/(-404)8/(-14). 10 What is (9/6)/((-18)/(-4) - 3)? 1 Evaluate (2/(-5))/(171/(-15) - -12). -2/3 (-75)/72 - (-3)/8 -2/3 Evaluate (19/(-1083))/((-2)/12). 2/19 What is (3/(-6) - -1)32/12? 4/3 What is (-325)/(-65) - (0 + 6)? -1 88/(-33) + 3 + (-4)/6 -1/3 (-1)/(14/4) - 180/(-385) 2/11 What is 4/14((-26)/(-4) + -3)? 1 Calculate (-2)/(-15)(9 - 12). -2/5 Calculate (-10)/(-30) - (0 + (-1)/(-2)). -1/6 What is 4((-3)/27)/((-2)/3)? 2/3 What is the value of ((-11)/33)/(44/(-24))? 2/11 What is (-51)/68(-2)/(-3)? -1/2 Calculate 3/(-10 - 8/(-2) - 1). -3/7 (-2)/(2/(-4) + (3 - 3)) 4 What is (6/7)/(-7 - 144/(-21))? -6 Calculate 4 + 6 - (11 + 2). -3 What is the value of ((-60)/(-18) - 3)-3? -1 What is (3 - 58/20)(-55)/66? -1/12 What is -6 + 170/15 - (2 + 3)? 1/3 Calculate (-4 - 63/(-28))2/28. -1/8 What is the value of (-3)/20 + (-2)/(-5)? 1/4 Calculate -1(3 - (-24)/(-4)) + 0. 3 Evaluate ((-4)/(-6))/(5 - (-885)/(-180)). 8 Evaluate ((-3)/(-4))/(3/2). 1/2 Evaluate 2(40 - 37)1/6. 1 Calculate 92/1288 + 134/84. 5/3 What is the value of 0 + (-8)/(-10) + -1? -1/5 What is the value of 2 - ((-5)/(-5) - -3)? -2 (-20)/15(18/14)/(-3) 4/7 What is the value of (2 - (-3)/(-3)) + (-13)/39? 2/3 What is 4/(-56)(3 - -3)? -3/7 What is the value of -10 - (-13 + 9 - 10)? 4 Calculate 6 - 1/(6/24). 2 Evaluate ((-2)/5 - (-44)/10) + -9. -5 Evaluate (416/(-2795))/8(-15)/6. 2/43 What is (1/4)/(-3 - 68/(-32))? -2/7 What is (-414)/(-46) + (-86)/10? 2/5 (-10)/1 - (105 - 124) 9 What is the value of 40/(-42) + 22/33? -2/7 What is (2 - 7/2)16/(-12)? 2 What is the value of 3/(-9) + ((-78)/(-9))/2? 4 1/(-4) - 24/160 -2/5 What is -73 - -66 - 4-2? 1 Calculate -3 - ((-6)/14 - 10/5). -4/7 -1 - (0 - 3) - 4/2 0 What is the value of 232/(-64) - (-6)/(-16)? -4 What is the value of 4/18 + 2140/(-963)? -2 What is the value of 2(9 - (-78)/(-13))? 6 What is the value of ((-38)/8 - -5)/((-3)/(-4))? 1/3 10/614/(-105) -2/9 Calculate ((-27)/4 + 7)/(2/(-4)). -1/2 Calculate 2/4 + ((-585)/(-36) - 16). 3/4 What is the value of -4(2 - (-28)/(-16))? -1 What is (-4)/10 - ((-135)/25 - -2)? 3 Evaluate ((-5)/2)/((-480)/(-384)). -2 What is (-105)/(-20) - 1 - 4? 1/4 Evaluate -2 + 2/120. -2 Evaluate 1 - -3 - 1/(16/60). 1/4 Calculate (14 - (-4 - -14))-1. -4 Evaluate 8/(-32) - (-1)/4. 0 What is 252/504 - ((-11)/30 - -1)? -2/15 ((-384)/(-1600))/(3(-6)/(-45)) 3/5 What is the value of ((-12)/(-42))/((-10)/(-14))? 2/5 What is the value of 137/(-17) + (0 - (-48)/6)? -1/17 Calculate 0 + 0 - (-4)/(-22). -2/11 Calculate (10/255 - 3) + -4. -5 What is the value of (84/24 - 3)/((-2)/(-2))? 1/2 What is the value of (8 + 6/6)2/(-6)? -3 What is the value of ((-616)/(-35))/2210/14? 4/7 (-12)/3 + 260/78 -2/3 What is the value of (-3)/(-1)(-4 + 3)? -3 What is (-8)/(-6)7/2947? 2/9 ((-126)/(-24))/(-7)(-4)/8 3/8 What is (-2)/(-7 - 6 - -6)? 2/7 Evaluate (-4)/12 + 2 + (-30)/18. 0 What is the value of (4/(-3))/(3 - 18/(-6))? -2/9 What is -3 + -2 - (0 - (-3 - -8))? 0 What is (12/99)/(6/(-9))? -2/11 What is the value of 1 + 14/(-12)? 2/3 What is the value of (1 - 5/2) + 3/6? -1 Calculate -21(-7)/21 - 3/1. 4 Evaluate 29/24 - 100/75. -1/8 (6 - 6)/((-1)/1) 0 Evaluate (-169)/26 - (-5)/33. -3/2 0 + 6/(-15) - (-468)/195 2 What is 6-1((-85)/51 + 2)? -2 What is the value of (-2 - (-21)/7)/((-3)/(-9))? 3 Calculate (-42)/104 + 25/40. -2/13 (2/5)/(-46/120) -2 What is (14/49)/(0 - (-1)/7)? 2 Calculate (675/35)/3 - 7. -4/7 Evaluate 7 - 0-22/8. 7 What is 6/54-15(-4)/(-10)? -2/3 What is the value of -3(-34)/663 - (-24)/13? 2 Calculate 14/8 + -4(-3)/48. 2 Calculate -93(-4)/(-60) - (-10 + 4). -1/5 What is the value of ((-2)/(-7))/((-3)/((-18)/(-4)))? -3/7 Evaluate -3 + (-316)/(-44) - 4. 2/11 Evaluate (-63 - -70) + (-5)/1. 2 Calculate (-2)/13 - (-292)/208. 5/4 Calculate (0/(-6 + 1))/(-4). 0 (-70)/15 + (21/(-9) - -3) -4 Calculate 9/(-12) - (-287)/(-84) - -4. -1/6 2(-2 + 5)/(-15) -2/5 50/553/15 2/11 2 + 66/(1 - -10) 8 What is (-136)/(-51)(6/(-8) - -1)? 2/3 Evaluate 0 - (5 - 38/8). -1/4 Evaluate (-2006)/4130 + 4/14. -1/5 What is (11/(-33))/((-380)/(-120))? -2/19 Calculate ((-22)/3)/2 + (-3)/(-1). -2/3 3 + (-170)/(-30) - (-3)/9 9 What is the value of 2/(-4) + (5 - 207/42)? -3/7 What is the value of (-16)/(-120)(-7 - -4)? -2/5 (56/98)/((18/14)/(-3)) -4/3 What is (-14)/(-4) - 25/(-50)? 4 Calculate 450/375 + (-14)/10. -1/5 What is the value of (-4)/5 + 0 - 126/(-90)? 3/5 Evaluate (-1)/(-42) + 96/378. 1/6 What is (-4)/(-9)(-72)/(-16)? 2 Evaluate 32/208 - (-5)/(-52)-1. 1/4 Calculate -12 - -6 - (-2 + 0 - 7). 3 Calculate ((-1)/(-7))/(((-54)/(-8))/27). 4/7 What is 124/(-217) - (-2 + 1)? 3/7 (-9)/72 + 5/40 0 Evaluate ((-777)/112 - -7)6. 3/8 What is the value of ((-10)/(-20))/((-6)/8)? -2/3 What is the value of (-113)/452(-1)/(-2)? -1/8 Calculate (49/5 - 9)2/(-8). -1/5 ((-1)/(-14))/((-12)/210) -5/4 What is the value of (-7)/196-40 + -1? 3/7 What is (9/3)/((-42)/(-4) - 0)? 2/7 What is the value of (-19)/77 + ((-870)/(-70) - 12)? 2/11 What is 6/(-4)(2 - 30/20)? -3/4 What is the value of 1 + 3/((-78)/22)? 2/13 Evaluate 12/56*-26 + (-30)/(-6).	{ "pile_set_name": "DM Mathematics" }
9 + -0.29. Suppose b - 3b + 3 = -3n, 0 = 4n - b - 1. What is the smallest value in n, -4/5, j? -4/5 Let i = 2318 + -2318. Let g be ((-3)/(-7))/((-3)/2). Which is the fourth smallest value? (a) i (b) -3/7 (c) g (d) 2 d Suppose -x = 4x + 25. Suppose 10z - 24 = 7z. Let r be 6/(-8)z/10. What is the second biggest value in r, x, -2/5? r Let s = 127 - 86. Let i = 38 - s. What is the biggest value in -0.3, i, 2/15? 2/15 Let p = -90.165 - -90. Let u = p - -0.125. What is the second smallest value in u, -2/15, 1? u Let x = -1888 - -1887.9. Let u = 4 + -6. Which is the biggest value? (a) u (b) x (c) 2/3 (d) 5 d Let z be 21/54 - (-1)/2. Let c = z - 41/36. Let b = -0.1 + 0.4. What is the smallest value in b, c, 0.05? c Suppose 29u + 60 = -85. Which is the smallest value? (a) 0.3 (b) -2 (c) u (d) 4 c Let k be 8/(-6)180/(-96) + -1. Which is the third biggest value? (a) -4 (b) -2 (c) k a Let v be ((-3)/(-34))/(6/(-252)). Let r = -1163/323 - v. Which is the smallest value? (a) 0 (b) 2/9 (c) r a Let o = 2538 - 2531. What is the second smallest value in o, -0.29, -4/5, 0.2? -0.29 Let y = -2/5733 - 11456/28665. Let b = -6 + 4. What is the third biggest value in b, y, 5? b Let r = -51/2 + 25. Let g = -73 + 66.3. Let p = g + 7. What is the second smallest value in p, r, 3? p Suppose 5 = -5j, 0 = -2o - 40j + 43j - 31. Which is the third smallest value? (a) -5 (b) 4/5 (c) o b Let q(p) = -p3 - 14p*2 + 77p - 17. Let v be q(4). Let s = 3 - 3.3. Which is the fourth smallest value? (a) 1 (b) v (c) s (d) 2 b Let u(k) = k*2 + 5k + 4. Let h(g) = 3 + g*2 - g - 3. Let i(s) = -2h(s) + u(s). Let x be i(8). Which is the second smallest value? (a) x (b) -1/3 (c) 1 b Let i = -1 - -1. Let l = 8.57 - 4.57. Which is the second smallest value? (a) l (b) i (c) 2 c Let y = -229 + 248. Let j = y - 16. Let i = 0.3 - 5.3. What is the biggest value in -1/2, j, i? j Suppose 572 - 590 = -6o. Which is the second smallest value? (a) 1 (b) o (c) 8/5 (d) -2 a Let m = -7281/4 + 1821. Let x be 4/12/12. Which is the second smallest value? (a) x (b) 1/4 (c) m (d) -0.2 b Let k = -0.2 - 0. Suppose 23 = 5p - 7. Let t be (80/150)/((-4)/p). Which is the second biggest value? (a) -5 (b) k (c) t c Suppose 6v + 82 = 76. Let m(x) = x*2 - 2x. Let s be m(1). Let q be -5 + 0 + (v - s). What is the second biggest value in 0, q, 0.2? 0 Let u be (-10)/(-6) - (-1 + 2). Let g = -8914.9 - -8915. Which is the second smallest value? (a) u (b) g (c) 1/3 (d) 5 c Let r = 193 - 189. Which is the second smallest value? (a) r (b) -18 (c) -0.1 c Let n = -0.846 - 10.154. Which is the third smallest value? (a) -0.1 (b) n (c) -7 a Let c be (-22)/77 + (-26)/(-42). Let m = 2.3 - -0.7. What is the third biggest value in c, m, -2? -2 Suppose -5t + 389 = 3n, -150 = -2t + 3n - 7n. Let d = -74 + t. Which is the second smallest value? (a) d (b) -2 (c) 4 c Let z = 209 + -240.6. Let u = z - -32. Let k = u - -4.6. Which is the third biggest value? (a) -4 (b) k (c) 0.1 a Let a = 36 + -34. Let q be (a/(-16))/((-12)/16). What is the biggest value in -0.3, q, -1, 0.5? 0.5 Suppose -27p = -22p. What is the second biggest value in -109, p, 2? p Let c = 0.23 + -0.93. Let h = c + 0.7. Let l = -1 + 6. What is the second smallest value in h, l, 3? 3 Let l = 537 - 537.2. Which is the third smallest value? (a) -2/5 (b) 5 (c) -23 (d) l d Let r be 10/(-4)(-138)/(-115). Let u be 2/r - 11/(-12). What is the third biggest value in -0.5, 0.3, u? -0.5 Let v = 145/3 + -48. Let m = 365 + -371. Suppose 3f - f + 4 = 0. Which is the third smallest value? (a) f (b) v (c) m b Let b be 14/(-60) + (-70)/(-525). What is the third smallest value in -1/3, b, -3, 3.5? b Let r = 13.27 - -0.53. Let x = 0.22 - -13.78. Let h = r - x. Which is the second smallest value? (a) -5 (b) 0.4 (c) h c Let s = 21.8 + -21.84. Which is the smallest value? (a) s (b) -8 (c) -0.2 b Let t(o) = -2o*2 - 12o - 5. Let q be t(-5). Suppose 4j - 2m = 0, qj + 2m = -2m + 26. Which is the third smallest value? (a) -2 (b) j (c) 0 b Let p = -137 - -136.6. Let g be (-5)/(-4) + (1 - 2). Let u = -0.37 + 1.37. What is the third smallest value in g, p, u? u Let j = -833/3 + 281. Let r = 17/6 - j. Let v = -0.2 + -0.8. Which is the third biggest value? (a) r (b) v (c) -16 c Let f be 10/(-35) + (32/14 - -3). Let d = -0.15 + 6.15. Let r = -5.6 + d. What is the biggest value in -3, f, r? f Let r be 105/12 - 16/(-64). Suppose -5d - 8 = -5g + 7, d = -g + 5. Let z = r - g. What is the second biggest value in -7, -2/15, z? -2/15 Let f = -195.5 - -196. Let u = 5 - 4.7. Which is the second smallest value? (a) f (b) u (c) 3 (d) -2 b Let h = -52.75 - -53. Let s = h - -0.15. Let q = 41/6 + -19/3. What is the third biggest value in s, q, -3? -3 Let p = 67.3 - 69.3. What is the third biggest value in -0.4, 4, -1/2, p? -1/2 Let t = -7/3 - -19/12. Which is the smallest value? (a) -6 (b) 4 (c) 0.1 (d) t a Let p = 0.05 + -1.41. Let w = p + -0.04. Let g = w + 1.1. What is the biggest value in -2, g, -1/4? -1/4 Suppose -5t = t + 12. Which is the second biggest value? (a) t (b) -0.51 (c) -0.2 b Let g be (5/120)/((-1)/82). Let s = -455/132 - g. Let l = 10/33 - s. Which is the second smallest value? (a) 2/5 (b) l (c) -4 b Let g = 9.9 - -0.1. Let d = -10.13 + g. Let n = 0.13 + d. Which is the second biggest value? (a) 0.4 (b) n (c) -0.5 b Let w = 11.2 - -0.6. Let h = 13 - w. Let u = h + -1.19. Which is the second smallest value? (a) u (b) -0.4 (c) 0 c Let v = 684 - 689. What is the second smallest value in v, -0.3, 40, 0.4? -0.3 Let m = 0.05 - 5.05. Let x = -21599.5 - -21599. What is the fourth smallest value in x, -0.2, 0, m? 0 Let i be 13/39 + 6/9. Let p = 0.1 + -0.4. Which is the third smallest value? (a) i (b) p (c) -0.11 a Let i = 2 - 4. Let x be ((-4460)/240 - -19)((-6)/(-15) + 0). Which is the third biggest value? (a) 5 (b) x (c) i (d) 0.07 d Let a = 285 + -283. Let y = 1 - 0.6. What is the third smallest value in a, y, 0.1? a Let f = 0.02 - 0. Let w = 0.38 + f. What is the third biggest value in w, 3, -2? -2 Let t = -55 + 57. Suppose 0 = -5h - 0 - 5. Let d be h - ((-3)/(-6) - 0). Which is the smallest value? (a) d (b) t (c) -3 c Let g = -3.92 + 8.92. Which is the biggest value? (a) -0.5 (b) g (c) -3 (d) -0.4 b Let g = 1 + 1. Let t be (1/1)/(g/(-2)). Let s be t(-3)/18-4. What is the biggest value in 0.1, s, -1/7? 0.1 Let n = 421/9 + -47. Which is the second biggest value? (a) -1/7 (b) 5 (c) n a Let m = 12 - 12. Let k = -91/240 - 1/48. Which is the second smallest value? (a) m (b) k (c) -5 b Let z = 89 + -88. What is the smallest value in z, 8/3, 0? 0 Let d = 127/531 + -1/59. Suppose 14l - 15l + 6 = 0. What is the second smallest value in 4, l, d? 4 Let i = -432/5 - -86. Let u = -58/7 - -536/63. Which is the smallest value? (a) u (b) -12 (c) i b Let p(y) = 6y - 69. Let d be p(8). Which is the second smallest value? (a) 0.1 (b) d (c) 2 a Let j(h) = 5h + 57. Let m(i) = -11i - 114. Let l(t) = 7j(t) + 3m(t). Let s be l(-26). Which is the second smallest value? (a) 3 (b) 0 (c) s (d) -2/7 b Let w(p) = 2p + 3. Let z be w(-2). Let q = -1.51 + 1.11. What is the biggest value in q, 2/19, z? 2/19 Let k = -13 - -12.85. Let u = 2.15 + k. Let i = u + -1. Which is the third biggest value? (a) -0.3 (b) 2/7 (c) i a Let l = 0 - -2/5. Let w be (6/32)/(-15(-13)/390). What is the second smallest value in l, w, -1, 2/11? 2/11 Let h be (-4)/22 - ((-1800)/99)/(-10). Which is the fourth smallest value? (a) 0 (b) -3 (c) -1/4 (d) h a Let d be -1(-2)/2-1. Let t(m) = m2 + 4m + 6. Let r be (-9)/(-2)(-6)/9. Let q be t(r). Which is the third biggest value? (a) q (b) d (c) -3 c Let x = 81.8 + -82. Let i = 6 + -2. Let r = 0 + i. What is the third smallest value in x, 1, r? r Let g = 8 - 16. Let t be (3/15)/((-20)/g). Which is the third biggest value? (a) 3 (b) t (c) 0.3 b Suppose -2t = -s, -22s = -24s. Let o = 27 + -54. What is the fourth smallest value in -5, -4, t, o? t Let q be ((-13)/(-6) + 69/(-46))2. What is the smallest value in 4, q, 1.2, 0.2? 0.2 Suppose 3p + 60 - 622 = -4f, -2f = -4*p + 720. Which is the second biggest value? (a) p (b)	{ "pile_set_name": "DM Mathematics" }
List the prime factors of 2136/4(4 - 3/1). 2, 3, 89 Let c(m) = 40m. Let q be c(-5). Let i = q + 283. What are the prime factors of i? 83 Let q = 125 - 9. Suppose 5u - a = 312, -u - q = -3u - 4a. What are the prime factors of u? 2, 31 Let l(u) be the third derivative of u5/60 - u4/8 + u3 + 20u2. Let x(i) = i2 + 5i + 4. Let f be x(-5). List the prime factors of l(f). 2, 5 Let x(z) = z + 11. Suppose 4u + 6q - 2q - 172 = 0, -2u = -3q - 96. Suppose 3a + u = -2a. What are the prime factors of x(a)? 2 Suppose s = 24 - 9. Suppose -3m = -3x, -3x + 5m = -10 - 0. Let r = x + s. What are the prime factors of r? 2, 5 Suppose -4m + 2m + k = -21, 2m - 2k - 22 = 0. Let q(i) be the second derivative of i*4/12 - 4i*3/3 + 3i*2/2 - 2i. List the prime factors of q(m). 23 Let z(q) = 2q2 + 2q - 1. Let b be z(1). Let o(u) = -u*2 + 4u + 2. Let r be o(b). Suppose -rn + 120 - 45 = 0. What are the prime factors of n? 3, 5 Suppose 7f + 153 = -50. Let u = f + 31. Suppose -m = 0, um + 30 = 5z - 2m. List the prime factors of z. 2, 3 Let h(v) be the second derivative of v5/20 - 5v4/12 - v3/3 - 3v2/2 + 4v. Let l be h(4). List the prime factors of (-2)/9 - 60/l. 2 Suppose 3c - 18 = 30. Let p be (-5)/25 - c/(-5). Suppose 2h - px - 53 = 74, -4x = -2h + 122. What are the prime factors of h? 71 Suppose -24 = -5d - d. Suppose -5k - d = -k. What are the prime factors of ((-4)/8)/(k/20)? 2, 5 Suppose -5y + 2i + 14976 = 0, 4y - i - i - 11982 = 0. List the prime factors of y. 2, 3, 499 Let q = -307 - -812. List the prime factors of q. 5, 101 Suppose 0f - 72 = -4f. Let l = 85 - f. Let r = l + -30. What are the prime factors of r? 37 Let x(l) = l*3 - 21l*2 + 21l - 17. Suppose -8v + 184 - 24 = 0. List the prime factors of x(v). 3 Let g = 13 - 0. Suppose -2t + g = -5. Suppose -134 + t = -5w. What are the prime factors of w? 5 Suppose 2l = -4i + 8, 3l - 5l + 8 = -4i. Suppose i = 21g - 25g + 228. What are the prime factors of g? 3, 19 Let c be 1/((-3)/6271). Let i = 314 + c. What are the prime factors of i? 3, 5, 7 Suppose 4f = -f. Suppose f = -i + 17 + 15. What are the prime factors of i? 2 Let h = 81 + -55. Let p = h + 39. List the prime factors of p. 5, 13 What are the prime factors of (-35223)/(-10) - (-138)/(-460)? 2, 3, 587 Let p = -648 - -922. List the prime factors of p. 2, 137 Let l = 965 - 596. List the prime factors of l. 3, 41 Suppose -39s - 170 = -34s. Suppose 4d = 2p - 5p - 45, 2p + 13 = 3d. Let t = p - s. What are the prime factors of t? 23 Suppose 3b + 0b = 0. List the prime factors of (51 + b)/(-14 - -15). 3, 17 Suppose -982 = 37f - 39f. What are the prime factors of f? 491 Suppose -9 = f - 0f. Let g be 922/(-18) + (-2)/f. List the prime factors of (-5)/15g/1. 17 Let k(w) = -w3 - w + 2. Let v be k(0). Suppose 0 = -2f - 10, vb - b - f = 96. Let d = b - 62. What are the prime factors of d? 29 Suppose -4c + 5448 = 25m - 22m, -4c + 2m + 5428 = 0. What are the prime factors of c? 3, 151 Let d = 11 - 9. Suppose -4t = -5c + 96, c + dc - 40 = -2t. Suppose -c = o - 2o. What are the prime factors of o? 2 Suppose 30j - 13j = 10523. What are the prime factors of j? 619 Let h be (-1 - -9)/(2/11). Suppose 3q - 3p - 12 = 0, 4p = -0p. Suppose 180 - h = ql. What are the prime factors of l? 2, 17 Let a(d) = -2d + 17d + 15d - 47 - 3d2. Let x(i) = -i2 + 10i - 16. Let v(n) = -3a(n) + 8x(n). List the prime factors of v(11). 2, 3 Suppose 7j - 4j = -5z + 192, -4z = j - 64. Suppose -5f - 149 = -3g, -87 = -3f + 6f - 3g. Let a = j + f. What are the prime factors of a? 3, 11 Let o = 6065 - 3268. List the prime factors of o. 2797 Suppose -5t - 2u = -2885, -t - 12u + 8u = -559. Suppose -t = -24i + 21i. List the prime factors of i. 193 Let o(q) = -6q + 29. Let z(x) = -2x. Let j(a) = -o(a) - 3z(a). List the prime factors of j(4). 19 List the prime factors of 1 - 4/16 - (-135102)/88. 2, 3 Let t(h) = h2 + 10h - 1. Let j be t(12). Suppose 0 = -5o - 5l + 370, 2l - j = -4o + 25. List the prime factors of o. 2, 5, 7 List the prime factors of (-6)/18331-22. 2, 11, 31 Let s be (419/2)/(11/22). Suppose 3z + 2i = s, 2z - 3z - 4i + 123 = 0. List the prime factors of z. 11, 13 Let x(v) = v*3 + 21v*2 + 3v - 4. Let t be x(-21). Let o = 169 + t. What are the prime factors of o? 2, 3, 17 Let y(w) = 7w + 42. What are the prime factors of y(36)? 2, 3, 7 Let x be 0 + 69(-3)/(-9). Let p = x - -17. What are the prime factors of p? 2, 5 Let a(x) = -6x - 15. Suppose -g + 90 = 3g + 3o, 5g = -3o + 111. Let p be 36/(-63) + (-177)/g. List the prime factors of a(p). 3, 13 Let x = 118 + -51. Suppose 4b - 21 = x. Suppose 4p = c + 20 + 40, -2c = -p + b. What are the prime factors of p? 2, 7 List the prime factors of (-1014)/9(-36)/24. 13 Suppose -45t = -30t - 105. List the prime factors of t. 7 List the prime factors of 1436/((-9)/((-63)/14)). 2, 359 Let z be 47((-5)/1)/(-5). Suppose 0 = -45k + zk - 38. What are the prime factors of k? 19 Let k = 654 - 239. Suppose -4i + 1323 = k. List the prime factors of i. 227 Let x(o) = 4o + 8o2 + 2o + o3 + o2 - 9 + 0o. Let l be x(-8). Suppose 4s = ls - 72. List the prime factors of s. 2, 3 Suppose -12u + 744 = l - 11u, -5l = -2u - 3734. What are the prime factors of l? 2, 373 Let w(v) = -3v*3 - 14v*2 - 5v - 7. Let a(k) = 16k3 + 70k*2 + 24k + 34. Let j(p) = 2a(p) + 11w(p). What are the prime factors of j(-14)? 89 Suppose k - 20 = 4a, -5a = 5k - k + 46. Let z(o) = 3o*2 - 5o - 23. What are the prime factors of z(a)? 5, 23 Let y(k) = k*2 + 4k + 2. Let a be y(-5). Let b be 10/a + 12/21. Suppose bg + 2n = 6g - 76, 5g + 4n - 121 = 0. List the prime factors of g. 3, 7 Let h = 7 - 5. Suppose 3l = 4w + 44, 3w - hl = w - 24. Let s = w - -13. What are the prime factors of s? 5 Let v = 681 - -4893. List the prime factors of v. 2, 3, 929 Suppose -166 = -t - 4j + 200, 3j = 2t - 699. Suppose t = 4q - 122. What are the prime factors of q? 7, 17 Let f(w) = w3 + 2w*2 + 6. Let s be f(-3). Let l(x) = 67x*2 - x + 4. Let b be l(s). List the prime factors of b/14 - (-12)/28. 2, 11 Let h be (-25)/4(2 + -6). Suppose 3l - h = 8. List the prime factors of l. 11 Let i be (-8)/36 + (-11)/(-9). Suppose -t + 0 - i = 0, -2t = -f + 14. List the prime factors of f. 2, 3 Suppose 2352 = -4l + 712. Let x be (-1(-1)/(-2))/((-45)/1350). List the prime factors of (6/(-4))/(x/l). 41 Let p be 7-36/18. Let f(x) = 2x2 + 5x - 6. List the prime factors of f(p). 3, 19 Let f = 27 + -25. Suppose 2l - 2c = 8, 10 = 2l - 5c + fc. Suppose n - 5k - 51 = 0, -lk = -2n + 21 + 41. List the prime factors of n. 2, 13 Suppose -q + 2806 = -4n - n, n + 13934 = 5q. What are the prime factors of q? 2, 7, 199 Suppose 126r = 132r - 984. What are the prime factors of r? 2, 41 Let o = -64 - -68. Suppose 4k - 171 - 403 = 3d, -3d = ok - 586. List the prime factors of k. 5, 29 Let c = 797 - 287. What are the prime factors of c? 2, 3, 5, 17 Let r(d) = -95d + 6. List the prime factors of r(-4). 2, 193 Suppose -14 = v - 5y, 3v + 4y - 10 = 24. What are the prime factors of (-120)/(-10)88/v? 2, 11 Let w(f) = f3 + 4f*2 - 5f + 3. Let g be w(-5). Suppose 4u + 4 = 0, -2r - 3u = -gr - 39. Let d = r + 85. List the prime factors of d. 43 Suppose 0 = -6m + 53 - 41. List the prime factors of (-2)/(m/144-1). 2, 3 Let d be -2 + -49/(-6). Suppose 207 = di + 3v, -v - v = i - 53. List the prime factors of i. 3, 17 Suppose 130 = -6h + 7h. List the prime factors of h. 2, 5, 13 Let w(g) = g3 + 3g*2 - 3g - 3. Let a = -24 - -23. Let c be a/(-5) - (-16)/(-5). List the prime factors of w(c). 2, 3 Let s(h) = -301h - 369. What are the prime factors of s(-9)? 2, 3, 5, 13 Let a = 6 + -3. List the prime factors of 1 - a/((-6)/98). 2, 5 Let q(a) = 4349a*2 - 41a - 42. What are the prime factors of q(-1)? 2, 1087 Suppose -2a + 1680 = 3o, 2o + 791 = -2a + 2467. What are the prime factors of a? 2, 3, 139 Let z(r) = -7r - 16. Let j be z(-7). Suppose 0 = 5g - 22 - j. What are the prime factors of g? 11 Let g be (13 - 13) + (2 - 0). Suppose -u = -gd + 2u + 217, -4*u = d - 103. List the prime factors of	{ "pile_set_name": "DM Mathematics" }
? True Let n(v) be the first derivative of -v*4/4 + 7v*3/3 - 5v*2/2 + 4v + 2. Is n(6) a multiple of 9? False Let f(y) = -y*3 - 3y*2 - 4y - 1. Let m be f(-3). Suppose -2k + m = -k - 3b, 0 = -k - 4b - 10. Suppose 114 = kl + 30. Is 13 a factor of l? False Let j = 351 + -213. Is 22 a factor of j? False Suppose 3p = -4f - 28, -f = -3f - 3p - 14. Let r(a) = -7a - 2. Let l(g) = -8g - 1. Let u(d) = -5l(d) + 6r(d). Is u(f) a multiple of 6? False Let o(n) = -n*3 + 2n*2 + 3n - 3. Does 7 divide o(-2)? True Suppose g - 7g = -48. Is g a multiple of 8? True Suppose 2c - 68 = -2c. Suppose c + 47 = 4r. Is 14 a factor of r? False Let d be 2 - (-3)/((-9)/(-12)). Suppose 108 = -2z + dz. Is z a multiple of 17? False Let x = 68 + -59. Is x a multiple of 3? True Suppose 3a - 6v + v = 295, 4v + 8 = 0. Does 19 divide a? True Suppose -5y + 4l + 27 = 0, -3l + l = 5y - 9. Is 13 a factor of 1(y - -10)/1? True Let u be -1 - -3 - (-8 + -6). Suppose h + 41 = 4w, 0 = 2w - 0w - 2h - u. Does 11 divide w? True Suppose 2y - 4l = 32, -43 = -3y + 2l - 11. Does 5 divide y? False Suppose -3f + 0f + 29 = 5p, 0 = 3f + 2p - 17. Suppose b + 5u - 21 = 0, 5b - fb + 4u = 24. Suppose -bo = -4o - 40. Is o a multiple of 13? False Let y(r) = r2 - 5r + 8. Let s be y(7). Suppose -23 = 5o + s. Let a = 17 + o. Is a a multiple of 6? False Let j(z) = 108z*2 - 3z + 2. Is 6 a factor of j(1)? False Let q(t) = -12t - 12. Does 28 divide q(-8)? True Let l be 93 - (3 - 2). Suppose 0f = -2f + l. Does 9 divide f? False Let t(f) = -f*3 + 10f*2 + 2f + 7. Let l be 6/8 - (-148)/16. Is 27 a factor of t(l)? True Suppose -34 = -3d + 251. Suppose -5u - 3v = -0u - 95, 5u - v = d. Let y = u + -10. Is 9 a factor of y? True Let v(f) = 35f + 16. Is 61 a factor of v(10)? True Let i be (2 + 0 + -3)27. Let y = i - -34. Is y a multiple of 5? False Suppose 3s + 4h - 20 = 0, 3h - 8h + 16 = 3s. Is 4 a factor of s? True Suppose -3 = -l - 5m + 18, 4l - 68 = -4m. Is l a multiple of 2? True Suppose -88 = -5u + u. Is 11 a factor of (u/(-4))/(2/(-4))? True Let c = 24 + -12. Suppose -v - c = 3v. Does 3 divide ((-9)/(-6))/v-6? True Let v be (-4 + (-2)/(-2))/(-1). Suppose c = -2 - v, 3q - 4 = -c. Is 3 a factor of q? True Is (4/6)/((-9)/(-81)) a multiple of 3? True Suppose -270 = -j + 5x, -j + 0x = x - 288. Does 15 divide j? True Let h = -194 + 344. Is h a multiple of 10? True Let r be (-2)/(-5) + 38/5. Is 3 a factor of ((-12)/10)/(r/(-20))? True Suppose 9i = 6i - 5s + 375, -i + s + 125 = 0. Is i a multiple of 8? False Let o = 8 - -67. Does 15 divide o? True Suppose 0 = -41g + 39g + 122. Is g a multiple of 22? False Is 7 a factor of (-28)/(-154) + 163/11? False Let h = 78 - 51. Let z = -4 - h. Let j = 63 + z. Does 11 divide j? False Suppose -2d = -5d - 5r + 78, -r + 87 = 4d. Does 15 divide 2 + (-1)/((-1)/d)? False Suppose -704 = -2y - k, 0 = 4y - 7y + k + 1051. Is y a multiple of 41? False Is 25 a factor of (-15)/210/(-3)? True Let f(r) = 3r2 - 6. Does 17 divide f(-5)? False Let i(y) be the first derivative of -y5/60 - y4/12 - y3/3 - 1. Let t(u) be the third derivative of i(u). Is t(-3) a multiple of 2? True Let b(n) = 22n*2 + 2n + 2. Is b(-1) a multiple of 11? True Suppose 3z = 12, -7z + 14 = -3x - 2z. Suppose 0 = 4o - xo - 10. Is 3 a factor of o? False Suppose 0 = m + 4m + 205. Let a = m - -89. Does 16 divide a? True Let m(w) = 8. Let p(q) = -q - 1. Let r(k) = m(k) + 5p(k). Let t be r(-6). Let i = t - 13. Is 10 a factor of i? True Let q = 100 + -54. Let a = -31 + q. Does 9 divide a? False Let o(u) = -2u3 - 10u*2 + 10u + 8. Let k be o(-8). Does 9 divide k/22 - 4/22? False Suppose -5f = -f - 2x + 2, -5f = 4x - 4. Let a(b) = b + 4. Let j be a(f). Suppose 2q - 26 = -jm, -26 = q - 5q + 5m. Does 9 divide q? True Suppose 9 = 2p - 13. Suppose -5a = -2m - 2a - 15, 5a = -5m + 25. Is 11 a factor of m + p + (0 - -2)? False Suppose 335y = 330y + 275. Is y a multiple of 6? False Let y(z) = 59z2 - 4z + 5. Is y(1) a multiple of 20? True Let f = -4 - -28. Does 8 divide f? True Suppose -s - 4s + w - 2 = 0, 4s = -3w + 6. Suppose 4j = 3h + 90, 2j - 4h + s - 40 = 0. Does 7 divide j? False Suppose 5a + 24 = 3a. Let m = a + 44. Suppose p = 2k + m, 0 = 2p - 0k - 3k - 59. Is p a multiple of 16? False Let c(q) = -q3 - 4q*2 - 4q - 30. Does 6 divide c(-6)? True Let w(b) = 2b2 + 4b. Let y(i) = 3i2 + 9i - 1. Let f(d) = -5w(d) + 3y(d). Does 4 divide f(5)? False Let v = 62 + -36. Let f = 51 - v. Is 10 a factor of f? False Suppose -4 = 19d - 15d. Is d8/2 - -15 a multiple of 11? True Let n = 32 - 6. Does 26 divide n? True Let k(w) = 17w + 8. Is 42 a factor of k(2)? True Suppose 5i + y + 5 = 462, 0 = -2i + 2y + 178. Is 28 a factor of i? False Suppose n + 2x - 26 = -4, n + x - 24 = 0. Does 9 divide n? False Suppose u = -0u + 2. Let b be (-3)/u - (-55)/2. Let r = b - -1. Is r a multiple of 9? True Let a be 5((-26)/10 + 3). Let k = a + 7. Is k a multiple of 9? True Let r(n) = n*3 - 2n + 1. Let k be r(1). Suppose 0 = -5d - 20, 4o - d + 3d - 176 = k. Does 10 divide o? False Suppose -4m + 204 = -0m. Is 15 a factor of m? False Let u = -81 + 140. Is u a multiple of 17? False Let n = -57 + 126. Let w be -1 + 5 + 2 + -1. Suppose -2c + wc = n. Is 23 a factor of c? True Suppose -34 = 2u - 6. Let c = -2 - u. Is 4 a factor of c? True Suppose -4i = -t - 190, 2i - 50 = i - t. Is i a multiple of 48? True Is 29 a factor of (-5 - -462)1? True Let o(r) = r*3 - 5r*2 - r + 7. Let i be o(5). Suppose -k + 5n + 76 = 0, 5n + 18 = ik - 119. Suppose -k = -5s + 79. Is 14 a factor of s? True Suppose 0c - 205 = -5c. Is c a multiple of 11? False Suppose 0 = 3u + 4v - 164, -2u + 7u - 285 = 5v. Is 21 a factor of u? False Let c = 1 - -2. Suppose 3l - 18 = cj, -2j - 18 + 5 = -3l. Let p = l + 10. Does 11 divide p? True Let h(c) be the second derivative of c6/60 - c5/60 + c4/12 - c3/3 + c*2 + c. Let u(f) be the first derivative of h(f). Does 6 divide u(2)? False Let a be -67/((-42)/4). Suppose 0 = 2t - 0t - 8. Is 7 a factor of (a/10)/(t/140)? True Let r(g) = 16g - 12. Is r(2) a multiple of 5? True Let u(c) = -c3 - 2c*2 + 3c + 4. Let x be u(-3). Suppose -3g - 5k = -1, -2g - 3k - 7 = -xg. Is g even? True Let q(c) be the third derivative of -c5/60 + c4/4 + c3/2 + c2. Let k be q(6). Suppose 4l + 4m - 32 = 0, 2 = 4l - km + m. Does 2 divide l? False Let q be 84/18 - 2/3. Suppose 0 = -2d - j - 3j + 90, -qd + 188 = 4j. Is 33 a factor of d? False Suppose 2w + 122 = -0p + 3p, -3w - 88 = -2p. Is 19 a factor of p? True Let i(b) = -b*2 + 15b + 10. Does 19 divide i(10)? False Suppose 1 = 4z - 11. Suppose 2s = 4m - 76, m + 0 = -5s - z. Is 7 a factor of m? False Suppose 11 = x + 6. Is 3 a factor of x? False Let o be (-1050)/(-9) - 4/6. Let r = o + 1. Suppose 0h - 3h + r = 0. Does 18 divide h? False Let r(b) = b + 1. Let x be r(-2). Let z(y) = -25y3 - 3y - 2. Is 13 a factor of z(x)? True Suppose 10i - 5 = 5i. Suppose v = i - 36. Let z = v - -73. Does 19 divide z? True Suppose 0a = -2l - 3a + 7, l - 2 = -a. Let s(z) = -10z*2 - 5z - 4. Let g(n) = 30n2 + 14n + 11. Let h(r) = 3g(r) + 8s(r). Is 3 a factor of h(l)? True Suppose 0 = -4k + 2 + 6. Suppose ka - 56 = -v, v = 2v - 4. Is 26 a factor of a? True Let c = 43 + -7. Is c a multiple of 6? True Is 13 a factor of (-6)/4156/(-9)? True Let l(g) = g3 - g2 - g + 3. Let k(d) = -2d3 + d2 + d - 2. Let a(i) = 2k(i) + 3l(i). Does 5 divide a(0)? True Let t(q) = -q + 110q*2 + 2 + 19q*2 - 1. Let o be t(1). Suppose -5b + o = 44. Does 5 divide b? False Suppose -1 = -a + 1. Suppose ag = -g. Suppose g = u + u - 24. Is u a multiple of 6? True Let x(s) = -s3 - 8s*2 + 13s - 5. Let c(b) = 2b3 + 16b*2 - 27b + 11. Let z(g) = -2c(g) - 5x(g). Is 5 a factor of z(-9)? False Let c(l) = l + 13. Let i be c(-6). Let v(f) = -f3 - f2 + f + 10. Let r be v(0). Let o = i + r. Is 17 a factor of o? True Let i(l) = -2l + 2l - 4 + 4l. Let s = -1 + 7. Is i(s) a multiple of 20? True Does 8 divide -2((-125)/2)/5? False Suppose 0 = -5*k - 9 - 1. Let b(g) = g + 2. Let n be b(k). Let x(y)	{ "pile_set_name": "DM Mathematics" }
4 - 24 Let q(p) be the third derivative of 0p + 0 + 0p3 - 55p*2 - 5/24p*4. Let t(r) = 4r*2. Give q(t(z)). -20z*2 Let j be 4 + 3 - 6/2. Suppose -7i - 2 = -4i + jv, -16 = -4i + 4v. Let r(b) = 28bi - 12b*2 - 10b*2. Let w(p) = -p. Calculate r(w(l)). 6l*2 Let d(x) = -6x + 16. Let q(s) = -7s + 20. Let k(t) = -5d(t) + 4q(t). Let l(p) be the first derivative of -219p*2/2 + 32. Give k(l(m)). -438m Let b(a) = -4a2 + 4a + 10. Let t(d) = -15d2 + 18d + 45. Let i(l) = -9b(l) + 2t(l). Let h(q) = -59q. Calculate i(h(v)). 20886v*2 Let p(b) = 10b*2 - 237b + 177. Let l(h) = 9h2. Calculate p(l(t)). 810t*4 - 2133t*2 + 177 Let d(q) = 4q*2 - 2q + 2q. Let x(c) be the third derivative of -c5/30 - 22005c*2. Determine x(d(i)). -32i4 Let d(o) = -o2. Let r(m) = 22m - 19. Suppose -5s = 202 - 177. Let t(k) = -11k + 11. Let x(h) = st(h) - 3r(h). Calculate x(d(j)). 11j*2 + 2 Let f(k) = -16k*2. Let q(l) = 59l*2 - 1752. Give q(f(v)). 15104v4 - 1752 Let y(z) = -z2. Let m(d) be the third derivative of 21d5/20 - 7d*3/6 - 235d*2. Calculate y(m(f)). -3969f*4 + 882f2 - 49 Let c(x) = 14 + x2 - 6 - 8. Let m(t) = -105t - 7. Let v be m(-4). Let u(o) = -13o + 413 - v. Calculate c(u(f)). 169f2 Let t(x) = 46x*2. Let z(w) = 42w*2 - 3 - 44w*2 - 1 - 4w. Let c(q) = -2q2 - 5q - 5. Let v(p) = -4c(p) + 5z(p). Give v(t(a)). -4232a4 Let s(w) = -w. Let y(v) = -147063v*2 - 2v + 147043v2 + v + 4. What is y(s(d))? -20d2 + d + 4 Let j(r) = -r + 76. Let s(z) be the second derivative of z3/3 - 131z. What is j(s(x))? -2x + 76 Let c(j) = 27693 - 27693 - 30j2. Let z(d) = -1 - 1 - 4 + 6 + 2d*2. What is c(z(a))? -120a*4 Let q(l) = 12l + 107l - 122l. Let h(v) = 70v + 7. Determine h(q(o)). -210o + 7 Let h(j) = 4j2. Let i(q) = -5354q + 412. Calculate i(h(k)). -21416k2 + 412 Let n(m) = 2m - 2002. Let f(k) = 2360k. Determine f(n(c)). 4720c - 4724720 Let k(g) be the first derivative of 71/2g2 + 0g + 30. Let c(h) = h. Calculate k(c(r)). 71r Let g(o) = 182o. Let f(n) = 6460n2 - 3n + 2. Give f(g(t)). 213981040t2 - 546t + 2 Let v(o) be the third derivative of -113o2 + 0o*3 + 1/12o*5 + 0 + 0o*4 + 0o. Let i(w) = -3w + 0w + 2w2 + 3w. Calculate i(v(g)). 50g4 Let p(u) = -2u + 19. Let v(k) = 1096903k2 - 3k. What is p(v(j))? -2193806j2 + 6j + 19 Let k(m) be the third derivative of m*5/30 + 4861m*2. Let x(t) = 3725t. Give x(k(l)). 7450l2 Let q(m) be the third derivative of m4/6 - 595m2. Let w(v) be the first derivative of -v3/3 + 32. Calculate w(q(y)). -16y2 Let b(x) = -2x - 2869. Let p(w) = -19266w - 3. Give b(p(h)). 38532h - 2863 Let r be ((-3)/3 + 8)2. Suppose 4g - 6g = -r. Let a(f) = gf - 38 + 16 + 22. Let u(t) = -2t. Calculate a(u(b)). -14b Let x(w) = 2w. Suppose 0 = -17o + 23o - 12. Let y(p) = 2 - 1 + 0 - 8 + 18p*o. Give x(y(u)). 36u*2 - 14 Let z(b) = 19b + 35. Let d(y) = 4y - 6. Let j(i) = 6d(i) + z(i). Let a(p) = 8p. Calculate a(j(s)). 344s - 8 Let b(l) = -8l2 - 240. Let h(q) = -10q*2 - 245. Let x(a) = -6b(a) + 5h(a). Let i(y) = y. Give x(i(p)). -2p2 + 215 Let t(q) = -q3 - 4q2 - 4q + 3. Let z be t(-4). Let l(f) be the first derivative of -26 + f*2 + 23 + z. Let u(r) = -3r*2. Determine l(u(k)). -6k*2 Let q(a) = 57a2. Let n(y) be the second derivative of -y4/24 + 72y2 + 113y. Let w(p) be the first derivative of n(p). Give w(q(j)). -57j2 Let q(h) be the first derivative of -3h*3 - 2848. Let i(r) = 1435r. What is i(q(o))? -12915o2 Let g(a) = 59a. Let d(t) = -8t. Let z(r) = 24r*2 + 32r. Let w(f) = 4d(f) + z(f). What is w(g(n))? 83544n*2 Let u(x) = -195x. Let q(d) = 2. Let z(b) = 8 - b - 2b + 2b + 3b. Let n(j) = -4q(j) + z(j). Give u(n(i)). -390i Let n(j) be the second derivative of -2j*3/3 - 2056j. Let l(q) = q - 110. Determine l(n(g)). -4g - 110 Let q(c) = c2. Suppose 1096 = 2v + 2v. Suppose m + 81 = v. Let n(d) = m - 193 + 15d. What is q(n(t))? 225t2 Let i(y) = y2 + y. Let x(l) = -6l*2 - 3l. Suppose -11 = -4a + 3k, a - 5 = 2k + 4. Let z(o) = ax(o) - 3i(o). Let h(j) = 17j*2. Give h(z(v)). 153v4 Let t(u) be the first derivative of -u2 - 18. Let z(i) = -11i + 14 + 11i - 3i. Let b(j) = -j + 5. Let q(o) = 11b(o) - 4z(o). Calculate q(t(g)). -2g - 1 Let m(q) = -59520341q. Let l(f) = -4f*2. Determine m(l(g)). 238081364g*2 Let j(c) = 16c*2 - 11c. Let o(a) = -3a2 + 2a. Let m(z) = 2j(z) + 11o(z). Let i = 84 + -82. Let k(w) = -10w2 + 16w*i - 7w2. Determine m(k(v)). -v4 Suppose 3a + 3 = 9. Let u(h) = -71h + 2ha + 71h. Let o(k) = 30 + 36k2 + 17 - 47. Determine o(u(w)). 144w*4 Let b(z) = -3z*2 - 8z - 4. Suppose 507i = 498i + 36. Let d(o) = 2o2 + 10o + 5. Let x(c) = id(c) + 5b(c). Let w(q) = -12q2. What is w(x(p))? -588p*4 Let s(n) = -17n*2. Let w(h) = -17h - 10. Let i(g) = 3g + 3. Let j(f) = 2i(f) + w(f). Determine j(s(y)). 187y2 - 4 Let g(u) be the first derivative of -17u*3/3 - 74. Let v(x) = -21x + 4x + 10x - x. Determine g(v(s)). -1088s2 Let z(d) = -d + 5d2 + d. Let q(g) be the second derivative of g4/4 - 12837g. Give z(q(u)). 45u*4 Let f(n) = -85n*2. Suppose -6 = -5o - z, 2o + 4z + 22 = 5o. Let j(q) = -10q*2 + 6 - 6 + 9q*o. What is j(f(a))? -7225a*4 Let d(x) = 6x + 14. Let l(i) = -7675421i. What is d(l(k))? -46052526k + 14 Let q(w) = -2w. Let v(l) = -3039l + 9. Let b(s) = 3042s - 6. Let t(x) = -3b(x) - 2v(x). Calculate q(t(j)). 6096j Let y(t) = -103t2 + 8t + 16. Let f(l) = -37l2 + 3l + 6. Let g(j) = 8f(j) - 3y(j). Let w(v) = -20v2. Calculate g(w(i)). 5200i*4 Let s(g) = -112876246g. Let c(k) = 13k. Calculate s(c(m)). -1467391198m Let y(q) = -170q2. Let h(u) be the third derivative of -25u*4/12 + 3469u*2. Calculate y(h(r)). -425000r*2 Let s(b) = -1281b*2. Let j(x) = -1966x + 1966x - 5x*2. What is j(s(w))? -8204805w*4 Let w(r) = -9r. Let t(l) = -2l - 10. Let n(o) = -2o - 1733. Let x(u) = -n(u) + 2t(u). Determine x(w(k)). 18k + 1713 Let n(j) = 4j - 6j - j + 9j + 3j. Let q(k) = 3k - 15k + 4k. Let r(d) = 4d. Let p(m) = -2q(m) - 5r(m). Calculate n(p(y)). -36y Suppose 22x - 6 = 5o + 25x, -6 = 3x. Let j(t) be the second derivative of 0t*2 + 19t + 0t3 + o - 5/12t*4. Let u(l) = -9l*2. Calculate j(u(p)). -405p*4 Let t(n) = 52740361n*2. Let v(q) = -19q*2. What is t(v(h))? 19039270321h*4 Let j(i) = 2i*2. Let v(o) = 4446850o*2. What is v(j(y))? 17787400y*4 Suppose 16p - 40 = 6p. Let d(r) = -97 + 194 - 97 - pr*2. Let s(c) = -3c*2. Give d(s(w)). -36w*4 Let j(l) be the third derivative of 0l*3 + 6l*2 + 0l + 0 + 0l4 + 1/30l*5. Let i(s) be the second derivative of 5s*3/6 + 6s. Determine i(j(h)). 10h2 Let v(c) = 4c. Let w(t) = -t + 13930563. Calculate v(w(y)). -4y + 55722252 Let u(f) = 3f - 16. Let j(y) = 6y - 187. Let a(w) = -j(w) + 3u(w). Let t(x) = -2x. Give t(a(n)). -6n - 278 Let o(h) = -h*2. Let q(v) = -51v + 1. Let l(u) = 5222u - 16. Let n(g) = -l(g) - 16q(g). What is n(o(i))? 4406i2 Let o(m) = 389m - 583. Let d(l) = -16l + 1. What is d(o(b))? -6224b + 9329 Let c(m) be the second derivative of 118/3m3 - 1/12m*4 + 0m*2 + 30m + 1. Let p(d) = -2d. Calculate p(c(t)). 2t*2 - 472t Let t(s) = -8239s - 321. Let f(j) = 103j + 4. Let l = -803 - -1124. Let w(m) = lf(m) + 4t(m). Let k(a) = 2a2. What is k(w(n))? 22898n*2 Let f(c) = -2444c. Let g(r) = -r - 717. Calculate g(f(m)). 2444m - 717 Let a(v) = -6v*2 + 5. Let y(l) = -11l*2 + 9. Let n(c) = 9a(c) - 5y(c). Let p(u) = 410u*2. Calculate p(n(k)). 410k*4 Let m(h) = 77h*2 - 3h - 3. Let j(t) = 78t2 - 2t - 2. Let g(l) = -3j(l) + 2m(l). Let q(b) = 7456b - 7456b + 2b2. Calculate q(g(d)). 12800d*4 Let i = 56 - 39. Let d = -6 + i. Let z(o) = do + 14o + 11o - 37o. Let a(f) = 13f*2. Give z(a(l)). -13l*2 Let o(u) = 2u. Let f(s) = s*2 + 16056492s + 7. Give o(f(b)). 2b2 + 32112984b + 14 Let d(h) = 12328h. Let n(p) = p - 2022. Give n(d(g)). 12328g - 2022 Let q(t) be the third derivative of t*4/12 - 4t*3 + 10t**2. Let p(s	{ "pile_set_name": "DM Mathematics" }
on divisor of 90 and 198. 18 What is the highest common divisor of 180 and 75? 15 What is the greatest common factor of 4375 and 525? 175 What is the greatest common divisor of 96 and 1338? 6 Calculate the highest common factor of 27204 and 36. 12 What is the highest common divisor of 44 and 108? 4 Calculate the highest common divisor of 2241 and 581. 83 Calculate the greatest common divisor of 9 and 6849. 9 What is the highest common divisor of 4020 and 10? 10 What is the greatest common factor of 440 and 5240? 40 What is the greatest common divisor of 660 and 2090? 110 What is the highest common factor of 19045 and 65? 65 Calculate the greatest common divisor of 2197 and 1521. 169 What is the greatest common divisor of 112 and 1400? 56 Calculate the greatest common factor of 4065 and 90. 15 Calculate the highest common factor of 4 and 13. 1 Calculate the greatest common factor of 728 and 104. 104 What is the highest common factor of 129 and 3741? 129 What is the greatest common divisor of 16 and 52912? 16 What is the greatest common divisor of 72 and 27684? 36 Calculate the greatest common divisor of 232 and 8. 8 Calculate the greatest common divisor of 238 and 98. 14 Calculate the greatest common factor of 1 and 83. 1 Calculate the highest common factor of 98 and 588. 98 Calculate the greatest common divisor of 9 and 11. 1 Calculate the highest common factor of 1 and 31. 1 Calculate the highest common divisor of 99 and 22. 11 What is the highest common factor of 20 and 4? 4 What is the highest common factor of 216 and 50436? 108 Calculate the greatest common divisor of 1041 and 9. 3 What is the highest common factor of 108 and 32? 4 Calculate the greatest common factor of 1644 and 24. 12 Calculate the highest common factor of 4032 and 378. 126 What is the greatest common factor of 20 and 30? 10 What is the greatest common factor of 9 and 801? 9 What is the highest common divisor of 616 and 264? 88 Calculate the highest common divisor of 486 and 114. 6 Calculate the greatest common divisor of 9628 and 83. 83 Calculate the highest common divisor of 1342 and 770. 22 What is the greatest common factor of 6016 and 384? 128 Calculate the highest common divisor of 30 and 24105. 15 Calculate the greatest common factor of 384 and 48. 48 Calculate the highest common factor of 200 and 3475. 25 What is the highest common factor of 108 and 8? 4 What is the greatest common divisor of 204 and 1572? 12 What is the highest common factor of 30 and 18? 6 What is the highest common divisor of 2500 and 60? 20 Calculate the greatest common divisor of 64 and 544. 32 What is the highest common factor of 43 and 4429? 43 What is the highest common factor of 236 and 59? 59 Calculate the highest common factor of 54 and 3618. 54 What is the highest common factor of 575 and 50? 25 What is the greatest common divisor of 338 and 2405? 13 What is the greatest common factor of 58 and 18? 2 What is the highest common divisor of 55 and 253? 11 What is the highest common divisor of 341 and 517? 11 Calculate the highest common factor of 722 and 1330. 38 What is the highest common factor of 9 and 3897? 9 What is the greatest common divisor of 8954 and 148? 74 Calculate the greatest common divisor of 102 and 12. 6 Calculate the greatest common divisor of 184 and 24. 8 What is the greatest common divisor of 240 and 32? 16 Calculate the highest common divisor of 208 and 6682. 26 What is the highest common factor of 228 and 25878? 114 Calculate the highest common factor of 549 and 305. 61 What is the highest common divisor of 1204 and 5504? 172 What is the highest common factor of 11 and 517? 11 Calculate the highest common factor of 918 and 54. 54 Calculate the greatest common factor of 6000 and 120. 120 Calculate the greatest common divisor of 13 and 25831. 13 Calculate the highest common factor of 294 and 2499. 147 Calculate the highest common factor of 264 and 8. 8 Calculate the highest common factor of 16302 and 228. 114 What is the highest common factor of 3220 and 92? 92 Calculate the highest common factor of 84 and 300. 12 Calculate the greatest common factor of 11050 and 170. 170 What is the greatest common factor of 10 and 2945? 5 Calculate the greatest common divisor of 5920 and 15. 5 Calculate the greatest common divisor of 4237 and 114. 19 Calculate the greatest common factor of 171 and 38. 19 Calculate the greatest common divisor of 42 and 1338. 6 What is the highest common factor of 218 and 1635? 109 Calculate the highest common divisor of 25 and 38775. 25 Calculate the greatest common factor of 221 and 26. 13 What is the greatest common divisor of 548 and 4? 4 Calculate the highest common factor of 66351 and 51. 51 Calculate the greatest common factor of 90 and 810. 90 What is the highest common factor of 6 and 519? 3 Calculate the highest common factor of 259 and 407. 37 Calculate the highest common factor of 2 and 60. 2 Calculate the highest common factor of 611 and 104. 13 Calculate the greatest common divisor of 91724 and 92. 92 What is the highest common factor of 9200 and 80? 80 What is the highest common divisor of 1754 and 18? 2 What is the greatest common factor of 65 and 5? 5 What is the highest common divisor of 210 and 1302? 42 What is the greatest common divisor of 1617 and 77? 77 What is the greatest common factor of 656 and 82? 82 What is the greatest common divisor of 510 and 270? 30 Calculate the highest common factor of 56342 and 33. 11 What is the highest common factor of 2318 and 114? 38 What is the greatest common divisor of 88 and 40? 8 Calculate the highest common divisor of 243 and 3. 3 What is the highest common divisor of 119 and 7? 7 Calculate the highest common divisor of 749 and 7. 7 What is the highest common factor of 4 and 68? 4 What is the greatest common factor of 37 and 12247? 37 What is the highest common factor of 465 and 589? 31 Calculate the highest common factor of 66 and 23694. 66 What is the highest common factor of 221 and 169? 13 Calculate the greatest common divisor of 171 and 9. 9 What is the highest common factor of 81 and 83349? 81 Calculate the greatest common factor of 6 and 9726. 6 What is the greatest common divisor of 1197 and 441? 63 What is the greatest common divisor of 28 and 252? 28 Calculate the highest common divisor of 1328 and 5478. 166 What is the highest common factor of 89 and 8633? 89 Calculate the highest common divisor of 696 and 144. 24 What is the greatest common factor of 60 and 636? 12 Calculate the highest common factor of 210 and 350. 70 Calculate the greatest common divisor of 215 and 15. 5 What is the highest common factor of 8249 and 678? 113 Calculate the greatest common factor of 7661 and 47. 47 What is the greatest common factor of 6 and 534? 6 What is the highest common divisor of 1519 and 833? 49 What is the highest common divisor of 3430 and 630? 70 Calculate the greatest common factor of 5800 and 200. 200 Calculate the greatest common divisor of 238 and 1022. 14 What is the highest common factor of 286 and 22? 22 What is the greatest common divisor of 308 and 132? 44 What is the greatest common divisor of 52 and 1248? 52 What is the greatest common factor of 91 and 728? 91 What is the greatest common factor of 413 and 1121? 59 What is the greatest common factor of 16 and 240? 16 What is the highest common divisor of 16 and 504? 8 Calculate the highest common divisor of 170 and 50. 10 What is the greatest common divisor of 159 and 8904? 159 What is the greatest common divisor of 28 and 1603? 7 What is the highest common divisor of 23 and 3105? 23 Calculate the highest common divisor of 29563 and 34. 17 Calculate the greatest common factor of 10 and 128. 2 Calculate the greatest common divisor of 13208 and 520. 104 What is the greatest common divisor of 475 and 133? 19 Calculate the greatest common divisor of 105 and 21. 21 What is the greatest common divisor of 74285 and 179? 179 Calculate the greatest common factor of 55 and 275. 55 Calculate the highest common factor of 240 and 75. 15 What is the greatest common divisor of 279 and 372? 93 What is the highest common divisor of 53 and 119303? 53 What is the highest common factor of 174 and 48? 6 What is the greatest common divisor	{ "pile_set_name": "DM Mathematics" }
3 Let u(n) be the second derivative of 665n*4/6 + 635n*2 + 360n - 3. What is the first derivative of u(q) wrt q? 2660q Let h(c) = -129c + 136. Let l be h(1). Let s be (20/6)/(4/42). Find the second derivative of -li + 8i + 18i + si*3 + 9i wrt i. 210i Let d be (-1002)/(-8) + (-13)/52. Suppose 5g + d = 10g. Find the third derivative of -l2 - 39l*4 + 75l*4 - gl*2 - 34l*4 wrt l. 48l What is the first derivative of -15w4 - 4820 - 152w*2 + 14w*4 - 144w*2 + 282w*2 - 9w wrt w? -4w3 - 28w - 9 Let q(r) be the third derivative of -229r5/30 + 487r*4/4 - 3284r*2. What is the second derivative of q(g) wrt g? -916 Find the third derivative of 3584s*2 + 1256s*3 - 12s4 - s5 - 1255s3 + 2s*4 wrt s. -60s*2 - 240s + 6 Let s(a) = -186a - 208. Let m(c) be the third derivative of -23c*4/24 - 13c*3/3 - 3c*2 + 3. Let t(u) = 51m(u) - 6s(u). Differentiate t(o) wrt o. -57 What is the first derivative of -849u*2 - 52u*4 - 1615 + 284u*2 - 119u*4 + 284u*2 + 283u*2 wrt u? -684u*3 + 4u Let o = 21 + 34. Find the second derivative of 47m2 - om - 1 + 37m + 1 wrt m. 94 Find the third derivative of 3622d*6 - 3 - 16d*4 + 6 - 1 + 289d*2 - 3624d*6 wrt d. -240d*3 - 384d Let t(d) be the second derivative of d8/14 + d6/10 - 31d5/10 - 113d4/6 - d2 + 3d - 454. What is the third derivative of t(n) wrt n? 480n*3 + 72n - 372 Let z = 79 + 151. What is the third derivative of -47s + zs + s*2 - 71s*4 - 75s*4 + 3s*2 - 6s*2 + 2s*3 wrt s? -3504s + 12 Let o(s) = 1567s3 - 5s*2 + 1875. Let f(n) = 2353n*3 - 7n*2 + 2813. Let m(b) = -5f(b) + 7o(b). What is the first derivative of m(w) wrt w? -2388w*2 Suppose 3m + 0 = -3, 2c - 14 = 4m. Suppose -s = 2, 0u + cs = -u - 8. What is the derivative of i*2 - 9i*2 - 9i*u + 0 + 8 wrt i? -34i Differentiate -391 - 150 + 1668o4 - 919 + 132 with respect to o. 6672o*3 Let w(d) = 47d*2 - 2d - 8. Suppose -3l - 21 = -33. Let b be w(l). What is the third derivative of bn + 19n2 - 736n - 26n5 wrt n? -1560n*2 Let r(u) be the second derivative of 1/15u*6 + 51/5u*5 + u + 0u*3 + 0u*2 + 7/2u*4 + 4. Find the third derivative of r(t) wrt t. 48t + 1224 Let b(j) be the first derivative of j*7/7 + 25j*6 - 5578j3/3 - j2/2 + 430. Find the third derivative of b(p) wrt p. 120p3 + 9000p*2 Let y(a) = -70a*2 - 6a - 3532. Let b(n) = -32n2 - 3n - 1765. Let c(i) = 7b(i) - 4y(i). Find the first derivative of c(o) wrt o. 112o + 3 Let s(m) = -767m*2 - 10m - 294. Let x(j) = 13806j2 + 182j + 5291. Let b(f) = 91s(f) + 5x(f). What is the first derivative of b(p) wrt p? -1534p Suppose -10h = -h - 216. Suppose -5b + h = q, 7b - 4b = q + 8. What is the third derivative of -8g*4 + 55g*b - 7g*4 - 4g*2 + 29g*2 wrt g? 960g Let l = 9801 + -9784. Let r(x) be the first derivative of 15/2x2 + l + 24x. What is the first derivative of r(w) wrt w? 15 Let t(f) = 52f2 + 2. Let l be t(1). What is the second derivative of 214 + lh - 214 + 126h3 wrt h? 756h Let r(q) be the first derivative of -2q - 11/2q*4 - 3q*2 - 116 + 0q*3. Find the second derivative of r(l) wrt l. -132l Let h(c) = -578c3 - 5c*2 + 5c - 198. Let u(d) = -11d3 + d2 - d - 1. Let p(k) = 3h(k) + 15u(k). Differentiate p(r) wrt r. -5697r*2 Let z(d) be the third derivative of 0d*3 - 190d*2 + 0d + 61/30d5 - 89/12d*4 + 0 + 1/120d*6. Find the second derivative of z(b) wrt b. 6b + 244 Let d(q) be the first derivative of 1/2q6 + 71q*3 + 0q*4 + 0q - 31/5q5 + 0q*2 - 11. What is the third derivative of d(m) wrt m? 180m*2 - 744m Differentiate -3u2 - 867 - 487u + 961u + 297 - 568 - 562u with respect to u. -6u - 88 Let c(m) = -393m*3 + 215m*2 - 2m + 1. Let x(o) = o*3 - 2o + 1. Let h(u) = c(u) - x(u). What is the third derivative of h(l) wrt l? -2364 Let f(w) be the first derivative of 11129w6/6 - 11w*2/2 + 260w + 3641. What is the second derivative of f(k) wrt k? 222580k3 Let x(a) be the first derivative of 7046a*3/3 - 12a*2 + 3a - 3778. Find the second derivative of x(c) wrt c. 14092 Find the second derivative of -3978a2 - 961 + 961 + 732a*2 + 6052a wrt a. -6492 Let i(z) = -6110z + 10385. Let m(r) = -15277r + 25961. Let d(k) = 13i(k) - 5m(k). What is the first derivative of d(v) wrt v? -3045 Let a(i) be the first derivative of -125i3/3 - 2611i*2/2 + 4835. Find the second derivative of a(s) wrt s. -250 Find the second derivative of 794c*4 - 175c*4 + 3 + 980c*4 - 1569c + 195c4 wrt c. 21528c*2 Let j(i) be the second derivative of 25i + 0i6 + 11/6i*7 + 0i*4 + 2 + 0i*5 + 0i*2 + 5/3i*3. What is the second derivative of j(f) wrt f? 1540f*3 Let p(q) = -359q*2 + 1 - 204q*2 + 238q + 6. Let j(a) = -188a2 + 79a + 2. Let i(o) = 7j(o) - 2p(o). Find the second derivative of i(z) wrt z. -380 Differentiate -1116 - 113x3 + 3x - 3x - 271x*3 + 567x*3 with respect to x. 549x*2 Differentiate 4954 - 2992 + 3259 + 6207o*3 + 2932 with respect to o. 18621o*2 Let h(m) = -4m. Let u(a) = -355a - 905. Let n(z) = 2h(z) - 2u(z). Differentiate n(c) wrt c. 702 Let s(j) be the third derivative of 533j9/72 + j5/20 + j*4/8 - 35j3/6 + j2 - 96j - 3. Find the third derivative of s(w) wrt w. 447720w*3 Find the second derivative of 451q*2 + q - 13q - 22q - 6 + 8 wrt q. 902 Let w = 103 + -38. What is the first derivative of -22t - w - 20 - 59 + 19 wrt t? -22 Let x(i) be the third derivative of i*6/120 - 73i*5/60 + 13i*4/24 + 1943i*3/6 - 160i*2 + 3i + 1. Find the first derivative of x(u) wrt u. 3u2 - 146u + 13 Suppose t = -4b + 21, 5b + 0 = 2t - 3. Let x = t + -3. What is the first derivative of -2 + x + s + 7 - 2 wrt s? 1 Differentiate 103m*4 + 151 + 127 + 673 wrt m. 412m*3 Find the third derivative of -2560j*2 - 5711j*4 - 6 + 5701j*4 + 127j*2 + 7 + 101j*6 - 2 wrt j. 12120j*3 - 240j Suppose -4z - 2m + 10 = 0, 9 = -3m + 12. Differentiate -25 + 39 - 156 + 24l*z with respect to l. 48l Let q(z) = z*2 - 5z - 8. Let k be q(5). Let m be 1300/((-25)/5)14/k. Find the third derivative of -455 + 25s*3 + m + 15s*3 + 36s*2 wrt s. 240 What is the third derivative of -43 + 621v + 8v4 + 2982v*2 - 621v + 43 - 113v3 wrt v? 192v - 678 Let u(l) be the third derivative of 23/30l5 + 47l*2 + 0l*4 + 0 + 0l - 4l3. Differentiate u(b) wrt b. 92b Let o(k) be the third derivative of -110k7/21 - k4/12 - 44k*3/3 + 1707k*2. Find the second derivative of o(v) wrt v. -13200v*2 Let b be (-1 - -2) + (-3 - 1/1). Let x be b/12 + (-3)/(-12). What is the derivative of -26o*2 + xo + 9o - 9o - 15 wrt o? -52o Let q(s) be the first derivative of -25 + 182 - 108s + 3s - 7s*5 - 5s*5. Differentiate q(h) with respect to h. -240h*3 Let o(j) be the first derivative of 3/2j*2 + 0j - 2/3j3 + 0j*5 + 19/4j*4 - 1/7j*7 + 0j*6 - 22. What is the third derivative of o(v) wrt v? -120v*3 + 114 Let t(s) = 928s*2 + 9s - 277. Let j(p) = -1855p2 - 15p + 553. Let z(r) = -3j(r) - 5t(r). What is the first derivative of z(n) wrt n? 1850n Let m(a) be the second derivative of -a7/6 - 53a*5/10 - 7a4 - a2 + 3664a. What is the third derivative of m(l) wrt l? -420l*2 - 636 Let w(i) = 60561i - 76140. Let g(v) = -1514v + 1903. Let d(q) = 81g(q) + 2w(q). What is the derivative of d(j) wrt j? -1512 Let a(m) be the first derivative of 2m*7/7 + 583m4/4 - m3/3 + m*2/2 + 50m - 7829. What is the third derivative of a(f) wrt f? 240f3 + 3498 Let l = -144 + 206. Differentiate l - 60 + 79 + 41 + 78m with respect to m. 78 Let v(o) = 4020o2 + 1968o - 30. Let n(c) = 4019c2 + 1968c - 40. Let k(a) = -3n(a) + 4v(a). Find the second derivative of k(u) wrt u. 8046 Let b(g) be the first derivative of -9g4 + 7 - 2g2 + g2 + 53g - 2 - 1. Differentiate b(c) with respect to c. -108c*2 - 2 Let s be (-1 + 2)14/(34 + -27). Let d(g) be the second derivative of 0g3 - 1/2g*4 + 0 - 25/2g*s + 26g. What is the derivative of d(m) wrt m? -12m Let a(p) be the third derivative of 341p8/336 + p7/210 + 1609p5/60 + 5p	{ "pile_set_name": "DM Mathematics" }
the third derivative of o(r) wrt r. -96r Let f be 42/(-9)(-54)/21. What is the first derivative of -f + 3 - 3y - 3y + 0 wrt y? -6 Let j(o) = 10o. Let x(c) = -10c - 1. Let r(q) = 5j(q) + 4x(q). What is the derivative of r(u) wrt u? 10 Let x(f) be the first derivative of -1/3f6 + 0f + 3/2f2 + 0f*4 + 0f*3 + 0f*5 + 2. Find the second derivative of x(w) wrt w. -40w*3 Find the second derivative of 4o*3 - 4o*3 - 3o + 2o + 15o*5 wrt o. 300o*3 Suppose -w - 3k + 14 = 0, 5w + k = -4k + 30. Find the first derivative of -4 - 3y2 - 2y2 - y2 + 5yw wrt y. -2y Find the third derivative of -4d4 + 16d*3 - 16d*3 + 15d*2 wrt d. -96d Suppose 42j = 41j + 4. Let p(a) be the first derivative of a*3 - 2/3a*6 + 0a*5 + 0a*j - 3 + 0a*2 + 0a. What is the third derivative of p(x) wrt x? -240x2 Let d(a) be the second derivative of 0a*5 + 0a*6 + 1/14a*7 - 1/12a*4 + a + 0 + 0a*2 + 0a*3. Find the third derivative of d(w) wrt w. 180w*2 Suppose -4r - 25 = -9r. Suppose -4b = -rm - 37, -b + m - 2m - 2 = 0. Find the third derivative of -ab + a2 + 0a2 - 2a*2 wrt a. -6 Let k(f) = -2f*3 + 10f*2 + 7. Let r(y) = -2y*3 + 9y*2 + 6. Let c(g) = -6k(g) + 7r(g). What is the third derivative of c(h) wrt h? -12 Suppose -2x + 12 = x. Suppose -6s + 20 = -s. Find the second derivative of -sk + k + k*4 + 0k - 4kx wrt k. -36k2 Let k(u) = -u2 + 2u - 1. Let y(t) = -6t*2 + 33t - 24. Let j(h) = 4k(h) - y(h). Find the first derivative of j(d) wrt d. 4d - 25 Let c(p) be the first derivative of -5p2/2 + p + 2. Let u be c(-1). What is the third derivative of j2 - 2j*2 + uj*6 - 4j*6 + 3j*2 wrt j? 240j3 Let b(u) be the second derivative of -u9/5040 - u5/24 - u4/4 - u. Let y(t) be the third derivative of b(t). What is the derivative of y(x) wrt x? -12x3 Let d(g) be the first derivative of -g - 7 + 0g*2 + 0g*3 + 3/2g*4. What is the derivative of d(y) wrt y? 18y*2 Let q(l) be the third derivative of -2/3l*3 + 0 + 0l*5 + 0l*4 + 0l - 3l2 + 0l*6 - 1/105l*7. Differentiate q(o) with respect to o. -8o*3 Suppose a - 28 = -6a. What is the second derivative of -j + 7j + 8ja + j4 wrt j? 108j2 Let s be 3(-1)/((-9)/15). Suppose 4 = -3g - sc, 3g = -c - 4 + 8. Find the third derivative of 4w - 4w - w2 + gw*3 wrt w. 12 Suppose i + 5c = 3, 4i - 2c = 16 - 4. What is the first derivative of 4 + ix2 + 0 - 3x*2 + 4x*2 wrt x? 8x Suppose 2z - 3 = 9. Find the third derivative of 0d2 + d6 - 5d2 + 0d*z wrt d. 120d*3 Let g(j) = 7j*4 - 7j*3 - 7j*2 + 7j. Let v(u) = -3u4 + 4u*3 + 3u*2 - 4u. Let n(q) = 4g(q) + 7v(q). What is the third derivative of n(b) wrt b? 168b Let h be 1 - 1/((-3)/6). Differentiate 2y - 5 + hy2 - 2y with respect to y. 6y Let v(u) = u. Let k be v(4). What is the second derivative of 0 + 0 - 2n*4 + n + 4n*k wrt n? 24n2 Let u(x) = -x3 + x. Let i(n) = 2n4 - 7n*3 + 4n. Let r(b) = 2i(b) - 14u(b). Find the second derivative of r(z) wrt z. 48z2 Let a(f) = 2f - 9. Let z be a(6). What is the third derivative of 2j4 - j2 + zj*4 - 3j*4 + 3j*2 wrt j? 48j Let v(s) = 9 - 6s - s + 2s. Let p(g) = 1. Let w(y) = 6p(y) - v(y). What is the first derivative of w(m) wrt m? 5 Let c(v) = 2v + 2. Let g be c(-4). Let b be ((-6)/9)/(1/g). What is the first derivative of -bj + 2 + j2 + 1 + 4j wrt j? 2j Let l(s) be the first derivative of -3 - 3/4s*4 + 0s + 1/2s2 + 0s*3. What is the second derivative of l(r) wrt r? -18r Let j(m) be the second derivative of -3m3 - 2m2 + m. What is the derivative of j(c) wrt c? -18 What is the derivative of v4 + 5v4 + 1 - 2 wrt v? 24v3 Let v = 104 - 104. Let b(n) be the first derivative of n4 + vn3 + 2 - 3/2n*2 + 0n. Find the second derivative of b(m) wrt m. 24m Suppose -2a + a = -3. Find the first derivative of w*4 - 1 - a + 2w*4 + 3 wrt w. 12w3 Let b(i) be the third derivative of -i6/30 - i5/10 + i2. What is the third derivative of b(a) wrt a? -24 Let m be (-1)/3(-1 + 1). What is the derivative of -b - 5 - 1 + mb + 3 wrt b? -1 Let j(p) be the second derivative of 0 - p*2 - 4p + 1/6p3. Differentiate j(v) with respect to v. 1 Let g(j) be the first derivative of j6/30 + j3/6 - 2j - 4. Let p(o) be the first derivative of g(o). Find the second derivative of p(h) wrt h. 12h2 Let b(v) = 18v*5 + 4v*2. Let c(h) = -53h*5 - 12h*2. Let s(k) = 8b(k) + 3c(k). Find the third derivative of s(a) wrt a. -900a2 Let i(l) be the first derivative of l6/10 + l*3/2 - 3l + 2. Let p(c) be the first derivative of i(c). What is the second derivative of p(k) wrt k? 36k2 What is the first derivative of 75 + 6y*4 - 4y2 - y4 - 66 wrt y? 20y3 - 8y Let r(q) = -12q3 + 2q2. Let u(o) = -o3 + o*2. Let v(i) = r(i) - 6u(i). Find the third derivative of v(j) wrt j. -36 Let r = -7 + 10. What is the derivative of rp4 - p4 - 3p*4 + 1 wrt p? -4p*3 Let l(z) be the first derivative of 3 + 0z*2 + 0z*4 - z + 0z*3 + 3/5z*5. Find the first derivative of l(t) wrt t. 12t*3 Let x(d) = -2d*5 - 8d + 0d5 + 3d*5. Let p(y) = y. Let f(g) = -5p(g) - x(g). Find the second derivative of f(q) wrt q. -20q3 Let k(p) be the third derivative of p6/40 + 11p*5/60 + 11p2. Find the third derivative of k(h) wrt h. 18 Let u(l) be the second derivative of l7/70 - l4/24 + l2 - 7l. Let k(c) be the first derivative of u(c). Find the second derivative of k(x) wrt x. 36x2 Let h = 6 + -4. Let q(o) be the first derivative of -oh + 0o + 0o*3 + 0o*4 - 1 + 0o*5 + 1/6o*6. What is the second derivative of q(s) wrt s? 20s*3 Let c(p) = -3p*3 + 15p + 3. Let g(y) = -y. Let n(o) = -3o. Let v(l) = 4g(l) - n(l). Let b(m) = -c(m) - 15v(m). What is the first derivative of b(d) wrt d? 9d*2 Let a(h) = 4h*4 - 9h3 + 8. Let f(g) = -g4 + 2g3 - 2. Let r(b) = -2a(b) - 9f(b). Differentiate r(u) wrt u. 4u*3 Let q(i) be the second derivative of 1/2i*2 + 2i + 0 + 2/3i3. Differentiate q(m) wrt m. 4 Suppose -4j = 2l - 1 - 5, 5l = -4j + 15. What is the second derivative of g3 + g - gl - g3 wrt g? -6g Let c(h) be the second derivative of -5/2h2 + 0h*3 - 1/3h*4 + 0 + h. Differentiate c(i) with respect to i. -8i Let v(b) = 31b3 - 15b*2 - 5. Let l(i) = 32i*3 - 16i*2 - 6. Let m(x) = 5l(x) - 6v(x). What is the third derivative of m(a) wrt a? -156 What is the second derivative of 7q*2 - 3q5 - q3 + 22q - 7q*2 + 27q wrt q? -60q3 - 6q Suppose 9v - 11v = 0. Let k(f) be the third derivative of vf + 0f*4 + 3f*2 + 1/2f*3 + 1/40f*6 + 0f*5 + 0. Differentiate k(p) wrt p. 9p*2 Let i = 1 - -1. Suppose o = -0o + i. What is the first derivative of w*4 - 1 - 2w*4 + ow*4 wrt w? 4w3 Let w(a) = a2 - 2a. Let c be w(2). Suppose -5o + 0o = -20, 2p = -o + 10. What is the second derivative of pr + 2r*2 + r - r + cr*2 wrt r? 4 Let k be 6/(-27) - 148/(-18). What is the first derivative of -2 + 3 + kn*4 - 5n*4 wrt n? 12n3 Let g(n) = -n2 + 5n + 4. Let d be g(5). What is the second derivative of 7s - s*3 - 7s*3 + ds*3 wrt s? -24s Let q = -10 - -11. Suppose 2k = 4f + 30, -4f = -k + 22 - q. What is the third derivative of -3o*4 - 4o*2 + ko*2 + 2o*2 - 5o*2 wrt o? -72o Differentiate 4t4 - 2 - 13t*4 - 3 wrt t. -36t*3 Let o(p) = -8p*3 + 3p*2 + 4p. Let a(i) = -23i3 + 10i*2 + 11i. Let m(y) = 4a(y) - 11o(y). Find the third derivative of m(g) wrt g. -24 Let w be 4/6 - 21/(-9). Suppose -1 = s - w. What is the second derivative of 0m - 2m*2 + 0m + 3ms - m wrt m? 2 Let u(n) = -n4 - n3 + n2. Let v(c) = c4 - 4c*3 + 4c*2 + 2c. Let d(h) = -4u(h) + v(h). Find the second derivative of d(g) wrt g. 60g2 Let f(u) be the third derivative of -u5/5 - u*3/3 - 2u*2. What is the first derivative of f(v) wrt v? -24v What is the second derivative of -3y + 2y*3 - 3y - 8y3 wrt y? -36y Let k(y) = y3 - y2 + 1. Let g(i) = -2i4 + 10i*3 - 10i*2 + 16. Let z(h) = g(h) - 10k(h). What is the first derivative of z(t) wrt t? -8t3 Let c(j) = -4j*	{ "pile_set_name": "DM Mathematics" }
4k - 3q = -4q + 9, 0 = -5k - q + 11. Let f = 6 + -11. Let h = f + 9. Solve -ht - k - 4 = 3v, 2t = -2v - 2 for t. -3 Suppose 2k - 28 + 24 = 0. Let s be -4 + (k + 16 - 4). Suppose 0 = 2v + 3v - s. Solve 4y + 2i - 4 = -0, -vi = -5y + 14 for y. 2 Suppose 25x = -82x + 11449. Solve -3t + 110f = xf + 18, 0 = 5t - 2f + 15 for t. -1 Suppose 28d = 29d - 5. Suppose -4r + 8r + 5q = -99, -4r - 2q - 102 = 0. Let t = 26 + r. Solve du - 4n - 20 - 16 = t, 3u + 5n + 8 = 0 for u. 4 Let h be ((-34)/323)/((-8)/1292). Solve -2k + 4z = 3k + 15, 3k + h = 4z for k. 1 Let t(m) = -m*2 + 6m - 4. Let g be (-5)/(-4) - (-8)/(96/9). Let z be t(g). Suppose -zk = -0k. Solve -3o = k, -3v - 3 - 3 = 4o for v. -2 Let t = -42753 - -42755. Solve tv - 32z + 2 = -33z, 2v + 2z = -4 for v. 0 Suppose -4b = 3x - x - 180, 20 = -4b. Let n = -24 - -24. Suppose 0i - 4i + x = n. Solve -4 = -3z + 5f - 21, 5z + 5f = i for z. 1 Suppose r - 5r - 56 = -3l, 0 = -4r - 8. Let s be (-2)/29 - -178(-5)/580-2. Solve -l = -5b - sd + 13, b - 7 = -d for b. 4 Suppose 0 = 69n + 2 - 140. Solve -nz = j - 14, 5j = -3z + 2j + 27 for z. 5 Suppose 423 = 4w - 3x, 2w - 5w + 5x + 331 = 0. Suppose -d + w = 99. Solve v - 12 = -4r - 2v, -4v = -dr + 9 for r. 3 Let x(c) = c*2 + 15c + 74. Let k be x(-18). Let u = -116 + k. Solve -4y + 5d + u = 0, d - 2 + 6 = 0 for y. -2 Let s be (-30)/(-7) - 2/7. Suppose 3 = b - 3q, -10q + 8q + 12 = 4b. Solve -3r = -bo + 15, 2o + sr - 3 = -r for o. 4 Let o(l) = -l*3 + 47l*2 + 104l - 289. Let b be o(49). Solve -12 = -2c + bf, 0 = 2c + 2f - f for c. 1 Let a(r) = r*2 - 15r + 16. Let l be a(10). Let j = -72 - -131. Let c = j + l. Solve -c = 5x + y, 4x - y + 8 = -12 for x. -5 Let h be 74 + -1 + 2 + -1. Let x = 76 - h. Solve -xu + 5w - 29 = u, u - 5w + 23 = 0 for u. -3 Suppose 0q = 21q - 21. Let x be (q - 9)/(25/(-50)). Let d = 8 + 3. Solve k = -3p - 12, -5p - x - d = 4k for p. -3 Suppose -56r - 208 = -69r. Let b be ((156/r)/(-13))/(1/(-4)). Solve bu = -2o + 4u - 7, u + 7 = -5o for o. -2 Suppose -246q = -239q - 3423. Let j = 492 - q. Solve -jy + x + 3x = -26, -27 = -y + 5x for y. 2 Suppose 95v = -361v + v + 29120. Solve va - 17 = 68a + 3j, 0 = 5j + 15 for a. -2 Let d be ((-741)/(-494))/((-1)/((-16)/6)). Solve -5b = -5z - 15, -3z + db + 80 = 91 for z. -1 Let i = 1506 - 1502. Solve ip + 1 + 19 = -4z, -3p - 5z = 17 for p. -4 Let d(m) = 2m*3 - 25m*2 + 3m + 24. Let o be d(13). Let q = 249 - o. Solve 0 = 5g + 3f - 3 - q, 0 = -g + 2f - 9 for g. 1 Suppose 0 = t + 2 - 5. Suppose -7d + td = -8. Solve 2s + dl + 3l - 23 = 0, l = 3 for s. 4 Suppose 2g = 7g + 5a + 120, 2a - 92 = 3g. Let k be 8/36-642/g. Solve -3o + ky + 22 = 7y, 4o = 5y + 6 for o. 4 Let g be (-2)/83 + 9/(-36). Let y be g/(3/(-5)(-5)/(-15)). Suppose 2n + 8 = yf - 2, 3f = -5n + 37. Solve -13 = -h + 2h + ft, 5t + 20 = 0 for h. 3 Let p be 306/(-27) - 2/3. Let s be p(2 + 21/(-9)). Suppose -sb + 4 = -8. Solve 3u - 29 = -4j, 2j + b = 5u - 2 for u. 3 Let z = -989 + 1009. Solve 4j - 5y - 41 = 0, 33y - 37y = z for j. 4 Let v = 5412 - 5410. Solve -v = -l + 5y - 10, -l - 3y = -8 for l. 2 Suppose -21o + 26o + 2l = 6, 35 = -5l. Solve -n - 11f - 12 = -15f, -on - 20 = -2f for n. -4 Suppose 297 = 86n + 39. Solve -3m - m = 4v, -2m + nv = -20 for m. 4 Suppose 2h = -10 + 2. Let k(l) = -l - 5. Let i be k(h). Let c = i - -4. Solve 5v + 5 = -5x, 12 = -cx + v - 7 for x. -5 Let y be 165/40 + 3 + 3. Solve 9 + y = 4f - 5s, 3 = f - s for f. -2 Suppose -v = v - 4i - 10, -v = 5i - 19. Suppose 3g = 2d - 6d - v, 3g + 2d = -3. Solve 5j - 4 + 2 = -3t, 2j - g = -t for j. 1 Let y(a) = a - 5. Let j be y(7). Suppose -q + 260 = -3g + g, q - 256 = 3g. Let s = -268 + q. Solve 5r + 4l + 12 = 0, -l = jr - s + 3 for r. 0 Let b be (-4)/(-8)4 - -112. Suppose b = h - 7h. Let k be (h + 16)(-10)/3. Solve 2q + k = 5o, 0o - 3o = 4q - 6 for q. 0 Let t be (-3 + 1 + 2)/2. Let d(a) = -11a2 + 122a - 5. Let k be d(11). Solve t = 4o + 3b - 6, b + 4 = 3o + k for o. 0 Let x(g) = 4g3 - g2 + 5g - 5. Let u be x(1). Suppose a - 9 = 3r + 2, -ur - 9 = 0. Solve -h - 3 = 2m + 4h, -am = 4h + 2 for m. 1 Let m(y) = y3 - 19y*2 - 90y - 44. Let w be m(23). Solve 2h + q - wq - 5 = 0, h + 3q = 13 for h. 4 Let g(v) = v3 - 15v*2 + 16v + 7. Let t be g(14). Suppose 5b = -2b + t. Solve -r = -4n - 22, r = -4r - bn - 15 for r. 2 Suppose -2a + 9a = -2a + 18. Solve 0 = y - 5r + 5, ar = -y + 4 + 5 for y. 5 Suppose -26m + 1 = 209. Let j(i) = -i2 - 9i - 6. Let k be j(m). Solve -9 = -r + 5c, r - kc = -2r + 14 for r. 4 Let d(a) = 155 + 10a - a*2 + 164 - 294. Let g be d(-2). Solve 2 = -3p - 2n, p = -5n - 4 - g for p. 0 Let l = -2511 + 2515. Solve 3q - q - 16 = lt, 0 = -3t - 2q + 2 for t. -2 Suppose -4b - 108 = -4o, 6b - 123 = -5o + 5b. Solve -2f + 2 = 2x, 30x + f = ox - 15 for x. -4 Suppose -3q = 4i + 16, -4q - i - 19 + 2 = 0. Let k(c) = c*2 + 10c + 26. Let z be k(q). Solve 2j = -5p + 25, 0p - zp + 10 = 4j for p. 5 Let v be 114/18 + (-8)/24. Let c be (-1 + 4)12/9. Suppose 0s = -cs + 16. Solve 0 = y - 4n - 25, -2y + sn = vn for y. 5 Let c(m) = -m*3 + 7m*2 - 11m + 9. Let p be c(5). Suppose -2x + 4t + 14 = 9t, -pt - 8 = 0. Solve -2n + 5q = q + 8, -2n + x = q for n. 4 Let c(i) = -2i*2 - 4i - 5. Let t be c(-1). Let j be ((75/(-9))/5)/(t/144). Suppose j - 83 = -r. Solve 0h + h - 19 = rm, -2h - 4m = 12 for h. 4 Let t be (-11)/((6 + 0)/54). Let b = 101 + t. Solve -4p - 23 = s - b, 0 = -4p + 2s - 18 for p. -5 Suppose 2w - 15 = 3u, -3w - 4u - 130 = -127. Solve 3z + 45 - 36 = -wv, 2v = 4z + 24 for v. 2 Let g = 503 - 480. Solve -m - 2m + r = -11, m + 5r = -g for m. 2 Let l be (0/(-4) - -4)/(2 - 3). Let k be (-2)/l11/((-66)/(-48)). Solve -g = -5n - 4, 2g + n = -kn - 7 for g. -1 Let o(w) = 3w*2 + 17w - 4. Let i(g) = 7g - 181. Let c be i(25). Let u be o(c). Solve 5k = -3x - 32 + 10, -ux - 8 = 0 for k. -2 Let c be (-3 - (2 - 1))(-10)/8 + 6. Solve -3y = -5l - 17, -cy + 9y + 3 = 5l for l. -1 Let d be ((-15)/20)/((-3)/(-16)-1). Suppose 12 = 3v - 2k - 0k, -v - k = 1. Suppose -8 = -vc - 2c. Solve -cz + 2 = -r - dr, 2z - 2 = -r for r. 0 Let b(n) = -n3 + 7n*2 + 62n - 13. Let m be b(12). Solve i + 5 = 2a, -mi + 6i + 2a - 1 = 0 for i. 1 Let x(u) = u*3 - 15u*2 - u + 15. Let t be x(15). Suppose t = -11y + 18y - 14. Solve i + 4 = f, yf - 6 = i + 3 for f. 5 Let g be (-132)/616 - 155/(-70). Solve 5j = -r - g, -129 = 4j - r - 122 for j. -1 Let c be ((-21)/35)/(-1)180/54. Solve -4n + 21 = a, 2a + cn - 8 = 4a for a. 1 Let j be ((-620)/40 - -14)(-152)/6. Solve 4p + 4v = j - 10, 4v = -3p + 25 for p. 3 Let d(b) = -37b - 807. Let z be d(-22). Solve -3y - 10 = 5u, zy - 9y + 3u - 13 = 0 for y. -5 Suppose 0 = -4o + 5q + 121, -3o - 4q = -0o - 52. Let v be (12/(-10))/(o/(-180)). Suppose -vh + h + 160 = 0. Solve -p + 16 + 5 = 4w, 4w = h for p. 1 Suppose -176k + 787 = -93. Suppose 2 = 4v - 5s - 4, -2 = v - 3s. Suppose 5m = 7 + 63. Solve -m = -3t + kt - vg, -4t - 3g - 17 = 0 for t. -5 Suppose -2q - 8 = 8r - 9r, 3q + 9 = 0. Solve 3 = -rb + x, 9 = -3b - x + 7 for b. -1 Suppose 4s = 11s - 21. Suppose 4a + 0 = -5j + 18, -5j - sa = -16. Solve jg - 4 = 2x, 3g = -0x - 4x - 29 for x. -5 Let w be 14/448-8 - (-51)/12. Solve wr = 2n - 20, -2r + 2n = -3 + 13 for r. -5 Let j = 105 - 3. Suppose 0a + 6a = j. Let w(z) = -z*2 + 18z - 15. Let c be w(a). Solve 2h = -5p + 3h - 20, 10 = -ch for p. -5 Suppose 2d - 34b + 31b = 14, -2d + 2b + 22 = 0. Solve 4y + 5w = -d, 121y = 124y - w for y. -1 Let b = 48 + -29. Suppose 8h + 11 = b. Suppose -i - 1 = -h. Solve 5l - 2 = 3, 4d - 3l + 15 = i for d. -3 Let h be 32/6 - ((-10)/6 - -3). Solve n = f - 2, -2 = hn - f - f for n. 1 Let z(l) = -3690l + 7383. Let p be z(2). Let y = -1 + 2. Solve 4a + 13 = 5g, pg + 0 = -2a - y for g. 1 Let c = 563 + -563. Suppose -4q + 2h = 2, 4q - 18 = -cq - 2h. Solve 4x = -2l + 16, ql + 5 = 1 for x. 5 Suppose l = 3b + 3, 3b - 135l - 21 = -138*l. Solve -35	{ "pile_set_name": "DM Mathematics" }
2 - -3). Let c(a) be the first derivative of j - 2a2 + 0a - 3 - a. Give c(-1). 3 Let h(o) be the second derivative of 0o3 - 2/3o*4 + 1/20o*5 + 0 - 25o - 3o2. Calculate h(8). -6 Let m(g) = -g3 - 4g*2 - 4g. Let l be m(-3). Let y(v) = -4v2 - 33v + 36v - 15v*3 + 16v3. Determine y(l). 0 Let i(u) be the second derivative of -u8/6720 - u7/630 + u6/360 - u*5/40 - 17u*4/12 - 5u. Let z(n) be the third derivative of i(n). Determine z(-4). -11 Let o(i) be the first derivative of 3i2/2 - 4i - 2. Let z(q) = -2q + 8. Let r be z(6). Calculate o(r). -16 Let h(t) = t - 2. Let u(a) = -a3 - 4a*2 - 4. Let r be u(-4). Calculate h(r). -6 Let g(t) = -3t*2 + 7t + 5. Let s(w) = 7w2 - 15w - 11. Let k(p) = 9g(p) + 4s(p). Suppose 5 - 11 = 2i. Calculate k(i). 1 Let y(v) = 2v + 6. Let s(z) = -3z - 8. Let r(x) = -3s(x) - 4y(x). Calculate r(2). 2 Let w(o) = -8o*2 - 3o - 4. Let p(k) = 9k2 + 4k + 5. Let h(v) = 3p(v) + 4w(v). Let g = 4 - 8. Let r be (g + (0 - -3))-1. Give h(r). -6 Let v(y) = -2 + y2 - 4 + y + 4. Let d = 21 - 15. Suppose -5l - 5 = h + d, 2h + 4 = -l. Determine v(l). 0 Let v(t) = -7t*2 + 2 - 13t + 13t. Let j(m) = -15m*2 + m + 5. Let h(o) = 6j(o) - 13v(o). Give h(-6). 4 Let u(k) be the second derivative of 0 + 0k*2 - 1/120k*5 - 1/45k*6 + 0k*4 - 5/6k*3 + 5k. Let z(i) be the second derivative of u(i). Give z(-1). -7 Let d(j) = -2j3 + 12j*2 + 18j + 6. Let t(g) = -3g3 + 18g*2 + 26g + 10. Let w(p) = -7d(p) + 5t(p). Let l = 4 - -3. Give w(l). -13 Let a(v) be the second derivative of v*3/3 - 212v. Give a(-3). -6 Suppose 3k = 5h + k - 13, -h + 2k = -1. Suppose -2d + 0 = -4. Let l(a) = -3ad - 2a*3 + 4 + 3a - 3a + 3a*3. Give l(h). 4 Suppose 38p = 34p - 40. Let l(i) = -i3 - 10i*2 + 2i + 3. What is l(p)? -17 Let y be (2 + -1)/((-7)/(-35)). Let l(c) = -2c + yc - 2 + 6c. Give l(2). 16 Let j be 30/(-105) + 2/7. Let s(y) be the second derivative of y3/6 - 5y*2 - 2y. What is s(j)? -10 Let f be (-13)/(-5) + 8/20. Let m(g) = 15g - 5g + fg. Let b = 355 - 354. What is m(b)? 13 Let l(m) = m3 + 5m*2 - 8m - 9. Let r(z) = -z - 13. Let k be r(-7). What is l(k)? 3 Let i(d) be the first derivative of -d*3/3 - 11d*2/2 - 24d + 506. Determine i(-6). 6 Let c(r) = 12 + 4 + 2974r - 2973r. Determine c(-5). 11 Suppose 3b = -12, -2b + 19 = 4i + 27. Let q(m) = -3m*2 - 8m + 4. Let s(p) = 2p2 + 5p - 3. Let r(u) = 5q(u) + 8s(u). Determine r(i). -4 Let j(o) = 0o2 - 1 - 17 - 3o*2 + 10 + 10o + 2o2. Give j(6). 16 Let f(n) = n2 + 14n - 13. Suppose 163 = -18g - 107. Calculate f(g). 2 Let o(l) be the third derivative of l4/24 + 3l*3 + 4l*2 + 25. Calculate o(-15). 3 Suppose 110x = 111x + 4k - 6, 4 = 2k. Let t(p) be the third derivative of p5/30 + p4/12 + p3/3 - 2p2. Calculate t(x). 6 Let q(z) be the second derivative of z4/24 + 5z3/6 + 7z*2/2 + 10z. Let n(b) be the first derivative of q(b). Calculate n(0). 5 Let r be 296/(-56) - 4/(-14). Let a(u) be the third derivative of -u6/120 - u5/12 + u4/24 + u3/3 - 30u2. Determine a(r). -3 Let x(q) = 72q - 127q + 56q - 3. Determine x(3). 0 Let j(r) be the second derivative of r4/6 - r3/6 + 110r. Calculate j(1). 1 Let h(l) be the first derivative of -l3/3 - 7l*2 - 22l - 211. Give h(-13). -9 Let f(d) be the second derivative of d5/24 - d4/8 + 5d3/6 + 29d. Let p(l) be the second derivative of f(l). What is p(2)? 7 Let w(c) = -6c + 5. Let f = -2491 - -2488. Determine w(f). 23 Let f(p) = p2 - 5p - 26. Let j be f(9). Let n(i) = 3i2 - 12i - 1. Let w(r) = 4r2 - 13r - 2. Let z(o) = -3n(o) + 2w(o). Calculate z(j). -1 Let v(x) be the second derivative of x4/2 + x2/2 - 57x. Calculate v(-1). 7 Let d(f) = 18f3 + f2 + 2f + 1. Let b(g) = 3g*2 - 3 + 2 - 9g + 0g. Let v be b(3). Give d(v). -18 Let g(j) = -j - 2. Suppose -2q - 3q = -4l + 1, 0 = -3l - 3q - 33. Let i be l(6/(-4))/1. Let z be (-1)/(-1) - i/3. Determine g(z). 0 Let c(q) = -q3 + 3q*2 + 6q. Let r be c(4). Let l(w) = w - 3. What is l(r)? 5 Let n(o) be the second derivative of o5/20 - o2/2 + o. Let b(g) = 4g3 + 4g*2 + 3g - 9. Let k(m) = b(m) - 5n(m). Give k(3). 14 Let b(w) be the second derivative of 5w*3/3 - 15w*2/2 - 6w. Let o(g) = -7g + 10. Let u(q) = 5b(q) + 7o(q). Calculate u(5). 0 Let a(m) = -m3 - 5m*2 + m + 5. Let w(j) = -j - 7. Let k be 6/(3/1) - 4. Let h be w(k). Give a(h). 0 Let r(h) be the first derivative of -9h + 1/12h4 + 0h2 + 1 + h3. Let y(u) be the first derivative of r(u). Calculate y(-6). 0 Let c(s) be the first derivative of -s4/4 + s3/3 - 1. Let j(p) = -3p3 - 15p + 8p + 3 + p2 + 2p. Let r(k) = 4c(k) - j(k). Give r(4). 1 Let s(w) = -w3 - w2 - w - 1. Suppose r + 9 = 3v, 4v - 12 = -0r + 3r. Suppose 5m - 15 = 5l, -5m - v = -2l - 0l. Let t = l + 5. Calculate s(t). 0 Let n = -2 - -1. Let o(l) = 3l + 5. Let k(r) = 4r + 7. Let s(z) = 2k(z) - 3o(z). Let m(b) = 2b - 2. Let f(p) = m(p) - 3s(p). Determine f(n). -4 Suppose 8 = i - 3i, -2x + 5i = -24. Let c(m) = m3 - m - 1. Let b(v) = 3v*3 + 4 - 1 - 2v*3. Let a(t) = xc(t) + b(t). Give a(1). 2 Let j(f) be the third derivative of f8/20160 + f7/504 + f6/180 - f5/60 + 6f2. Let o(g) be the third derivative of j(g). What is o(-9)? -5 Let c(o) = o2 + o - 1. Let l(w) = 5w*2 + 4w - 7. Let b(k) = -6c(k) + l(k). Let f = 43 - 40. Suppose fn + j = n - 11, -19 = 4n + j. What is b(n)? -9 Let t(j) = j - 5. Let a(g) = g - 4. Let f(v) = 7a(v) - 6t(v). Give f(-6). -4 Suppose 16 = -7a + 3a. Let d(c) = -c3 - 4c*2 - c - 2. What is d(a)? 2 Let n(w) = 549w + 553w + 552w + 549w - 2199w. Suppose -3m + 2t = -2 + 6, -4t - 14 = 5m. Calculate n(m). -8 Suppose 10j - 4j - 27 = 9. Let q(x) be the first derivative of x*3/3 - 9x*2/2 + 9x - 2. What is q(j)? -9 Let r(k) be the second derivative of 7k5/20 - k3/3 + k2/2 + 2k. Let y be -3 + -3 + -3 + 10. Determine r(y). 6 Let w = 44 + -44. Let g(f) = 42 + f*3 - 45 + 2f - 4f + wf + 2f2. What is g(-3)? -6 Let p(o) = -o - 20. Let b(a) = a + 19. Let m(z) = 4b(z) + 3p(z). Give m(0). 16 Let p(z) be the first derivative of -13z4/4 + z3/3 - z*2 + z - 245. What is p(1)? -13 Let y = 51 + -41. Let g(w) = -2w - 10 + 12 - 1 - w*2 + yw. What is g(7)? 8 Let k(w) = 15w2 - 59w - 91. Let j(q) = 8q2 - 29q - 45. Let t(y) = -7j(y) + 4k(y). Let c(n) = -n*2 + 8n + 12. Let s(a) = 9c(a) + 2t(a). Give s(8). -6 Let p(u) be the second derivative of u8/6720 - u7/2520 + 11u5/120 - u4/2 + u. Let y(v) be the third derivative of p(v). Calculate y(0). 11 Suppose 0 = 6v - 31 - 5. Let p(u) = -u*2 + 8u - 8. What is p(v)? 4 Let o(j) be the first derivative of j*3/3 + 3j*2 + 2j - 615. Determine o(-7). 9 Let z(q) = 1 - 31q + 10q + 17q. Let k(h) = h. Let i(r) = -2k(r) - z(r). What is i(1)? 1 Let x(v) = -v*2 - 7v + 6. Let o be (1 - (-5)/(-2))/(3/68). Let f = o + 26. Give x(f). -2 Let o(c) be the second derivative of c*5/10 - 2c*4 - 3c*2/2 + 5c. Let x be o(12). Let t(a) = a3 + a2 - 3a - 2. Calculate t(x). -11 Let c(d) be the second derivative of 5d3/6 - d2 + d. Suppose 8u - 12 = 2u. What is c(u)? 8 Let s(g) = -g*3 - 6g*2 - 6g - 1. Let l(q) = -493q3 + 0q + 2 + 492q3 + q. Let f be l(0). Suppose ft - 13 = 5n - t, -4t = -5n - 9. Determine s(n). 4 Let b(c) = 7c - 6. Let j(d) = 10d - 9. Let w(k) = -8b(k) + 5j(k). Give w(-4). 27 Let y(c) = 11c - 3. Let n(k) = 43k - 13. Let u(g) = -9g + 9. Let r be u(2). Let t(q) = ry(q) + 2n(q). Give t(1). -12 Let c(h) = -41h2 - 9h + 3. Let n(b) = 20b2 + 4b - 1. Let u(p) = 2c(p) + 5n(p). Suppose -o - 2o - 2y = 11, -2o - 5y - 22 = 0. Calculate u(o). 17 Suppose -296z - 18 = -302z. Let m(w) be the second derivative of 1/2wz + 0 - 1/12w*4 - 11w + 0w2. Determine m(-3). -18 Let y = 26 - 36. Let m = 14 + y. Let v(q) = 0q - 55 - 2q + 55. Give v(m). -8 Suppose -3 + 19 = 4w. Suppose 0 = 5t - t + w. Let s(n) be the third derivative of -n6/120 + n4/24 + n3/6 - n2. Calculate s(t). 1 Let h(t) be the second derivative of -t4/12 + 2t*3/3 + 3t*2 + 8t. Suppose -5*	{ "pile_set_name": "DM Mathematics" }
or p? -4/11 Let p be 10/(-12) - ((-130)/(-60) + -2). Is -2/109 smaller than p? False Suppose -l - 3l - 5j - 5 = 0, 3l = -5j - 5. Let d be -1 - (69/(-60) + 2). Let g = d + 9/4. Is g greater than l? True Let a be (-2)/(-7) + 6/(-21). Suppose -5k + 2k = -r - 2, -5r - 25 = 0. Are k and a non-equal? True Let z = -0.09 + -0.01. Which is smaller: 11 or z? z Let n be 22/(-40) + (-1)/(-4). Let p = -1 + 0. Is n equal to p? False Let r = -18 + 18.13. Is -0.1 at most as big as r? True Let r(j) = -j3 - 6j*2 - 4j + 4. Suppose -2b = -6b - 5d - 40, 4b - 2d = -12. Let u be r(b). Is u at least -2/5? False Let p(w) = -2w - 9. Let l be p(-3). Are l and -13 non-equal? True Let c(w) = -w + 2. Let l be c(-4). Suppose -lq = -q + 20. Let u = q + 5. Is u <= 3/4? False Let v(q) = q + 2. Let i be v(-2). Suppose i = -4f - t - 0t - 37, 5t = -25. Let a be (-2)/(-7) + f/28. Is a bigger than 0? False Let p = 613/17290 - -2/665. Is p != -1? True Let f = 0 - 0. Let v = -0.2 + 0. Let c = -0.4 - v. Which is bigger: c or f? f Let v be 3(-4)/(-6) + 2. Suppose 0 = 3t - vt - 1. Let b = 36 - 33. Which is smaller: t or b? t Let z = 0.02 - -2.98. Let b = -0.6 + 0.6. Is z at least as big as b? True Let n = -0.91 + 1. Let a = -35/2 - -18. Which is smaller: n or a? n Let t(a) be the first derivative of -a4/4 - 2a*3 - 3a*2 - 6a - 3. Let i be t(-5). Which is smaller: -1/5 or i? i Let y(v) = v*2 + v. Let t be y(-2). Let i be t/(-7) + (-6)/(-315). Which is bigger: i or -1? i Let x = -11 - -21. Suppose 2 = -c + 12. Is x smaller than c? False Suppose 5z - 10 = 0, -z + 3z + 52 = 4i. Do i and 13 have the same value? False Suppose -3f - 15 = -5n, 5n - n = 4f + 12. Which is smaller: -1 or f? -1 Let j(q) = 4q2 - 10q + 9. Let t be 36/(-6) - (-2 + 1). Let n(r) = 5r2 - 11r + 10. Let f(b) = tn(b) + 6j(b). Let c be f(-6). Is -2 at most as big as c? True Let h = 9 + -5. Let y = 6 - 10. Let d = y + h. Is 1 not equal to d? True Let o = -27745/48 + 578. Is o at most 0? True Let h(d) = -d + 2. Let i be h(0). Let s = i - 2. Is s > 0? False Let o = -23 + 15. Which is greater: o or -9? o Suppose 0y + 18 = -y. Is y greater than -18? False Suppose 4f + 1 = 3s, -5s + f = -4f - 5. Let c be (s/2)/(-3)0. Is c less than 2? True Let w be (-4)/(-316)((3 - -1) + -2). Does -1 = w? False Suppose -5x = -5d - 13090, 3d + x - 3272 = -11142. Let b be 2/(-7) - d/(-84). Let q = b - -31. Which is greater: 0 or q? 0 Let b = 2/49 - -125/539. Are 1 and b unequal? True Suppose -5a + q - 2 = 0, -4q + 2q - 8 = 2a. Let r be 9 + (-2 + 3)-1. Let u = 6 - r. Are u and a nonequal? True Let k be -1 - 1/20. Let b be 1/4 + 36/(-16). Let i be (-9)/36 + b/8. Which is greater: k or i? i Let w(f) = -65f3 + f2 + f - 2. Let v be w(1). Which is bigger: v or -64? -64 Let c = -1604/9 - -178. Suppose 2t - 2k - 11 = 3k, -2 = 2k. Suppose 2v + 19 = a - 2v, ta - v - 2 = 0. Which is smaller: c or a? a Suppose -f + 54 = 2f. Suppose -c - f = -19. Which is bigger: 3/11 or c? c Let d = -13 + 15. Which is greater: d or 3? 3 Let v = -2051 + 533261/260. Is v != 1? True Let v = -4 + 2. Is -4/3 <= v? False Suppose -4p + 136 = 3q, -p - 2q = 4p - 163. Is 0.1 equal to p? False Let w = 11 - 7. Suppose -2v = -5d + 35, 3v + 10 = 4d - 5d. Let m = -3 - v. Is m at least as big as w? False Suppose 18 = -7c + 5c. Which is greater: c or -8? -8 Let l = 1 + 8. Is l >= 9? True Let v(a) = -a*2 - a + 1. Let k be v(-2). Which is greater: -11/9 or k? k Suppose 4o + 48 = 16. Let p(v) = v + 1. Let d be p(5). Let u = o + d. Does u = -3/2? False Let a be ((-8)/(-12))/((-4)/(-6)). Which is smaller: 7/3 or a? a Let w = -21 + 23. Which is smaller: -2/7 or w? -2/7 Let h = 106/7 + -2028/133. Which is greater: h or 0? 0 Let x = -59/5 - -403/35. Let r = -21 + 21.4. Is r < x? False Let g = -22 - -31. Let i be 3/g + (-2)/(-3). Which is smaller: i or 1/2? 1/2 Let g be 6((-8)/(-6) - 0). Let p = 10 - g. Suppose 2w + p = 6. Is 5/3 != w? True Let g = -1.7 + -1.3. Which is smaller: -0.5 or g? g Let j = -1166/7 + 166. Let n(v) = 2v - 3v - 2v3 + 2 + 5v2 + 3 + v3. Let a be n(5). Is j less than a? True Let h = -1 - 8. Does -10 = h? False Suppose p + y - 3 = 0, 0 = -5p - 5y + 2y + 9. Which is smaller: p or -1/9? -1/9 Suppose 2d + 1 = 5c - 15, -3d = -6. Suppose 0 = 2m - 10, -cj + 2 = -m + 3m. Which is smaller: 0 or j? j Let x = -10 + 10. Let v = -1/21 - 2/7. Which is bigger: v or x? x Let j = 335/6 + -56. Let n(f) = -f - 6. Let p be n(-6). Suppose -2h = 2 - p. Is h at most j? True Let p = 2 - 3. Let f be 0 + 4p/(-18). Is -1 >= f? False Suppose 0 = 2z - 5w - 5, -2 = -2z + 3w - 3. Are z and -4 nonequal? True Let y be 82(6/16 - 1). Let z = y - -51. Which is smaller: -2/5 or z? -2/5 Let v be (4/(-6))/(2/(-3)). Suppose d - 2 = v. Which is greater: 1 or d? d Let u be (3 - 1) + 224/(-110). Is 1 > u? True Let n = -79/3 - -337/12. Which is smaller: n or 1? 1 Let g = 0.08 + 0.92. Let j = -1.4 - -0.4. Let f = j + -3. Which is greater: f or g? g Let l(p) = -1 - p - 2 + 2 - 3. Let n be l(-4). Let h = -2 + n. Which is bigger: h or -0.1? -0.1 Suppose -6n - 4y + 28 = -2n, 2n + y - 11 = 0. Suppose -4h - 2p + 0 = -2, -np = 4. Is 3/7 greater than h? False Suppose 3q + 4o - 21 = 8q, o = -4q. Which is smaller: q or -3? -3 Suppose -2z + 4 - 2 = 0. Let o be z + -13 + 0. Suppose -9 = -3a - 3d, -4a - 10 = -2a - 2d. Which is greater: o or a? a Let g be 2 - (3-6 - 3). Let r(d) = 3d + 12. Let b be r(4). Which is smaller: b or g? g Suppose -4c - 2o - 14 = 12, 0 = -2c - 3o - 7. Let b be (-3)/(-27)(-2 - c). Are b and 3/8 nonequal? True Suppose -4f = -3f + 5. Let p be 3/(-1 + 7 + -7). Which is bigger: p or f? p Let l(z) = -z3 - 5z*2 - 2z - 6. Let i be l(-5). Let a = i - 3. Let f = -70 - -70. Which is bigger: a or f? a Let x be (-1(0 + 0))/(-1). Suppose p = -0p. Suppose p = -s - 4s. Is x at most s? True Suppose 6k = -0k + 18. Is 1 smaller than k? True Let t = 6/11 + -35/44. Suppose 0 = -2g - 5d + 25, -4d = -2g - 6 - 14. Are g and t nonequal? True Let p = 0 + 0.7. Let k = p + -1. Is k < 2? True Let o be (2/(-2))/(16 - 17). Which is smaller: o or 2? o Let c be 1-1(4 - 3). Is c > -4? True Let b be 4/6 + (-1)/(-3). Suppose 2y - 6 = -y. Which is greater: b or y? y Suppose -3j - l - l - 11 = 0, 0 = 2j - 2l + 24. Let n be 2/j - (-8)/14. Which is smaller: n or 0? 0 Let b = -0.03 - -20.03. Which is bigger: -2/7 or b? b Let b be 6/(-8) - (-19)/19. Is 23 >= b? True Let z = 91/3 - 449/15. Is -0.5 smaller than z? True Let i(u) = -2u2 - u + 2. Let q(w) = 0 + 3 + w3 - 5. Let n be q(0). Let o be i(n). Is -3 smaller than o? False Let g = 31.94 - 32. Which is smaller: 0.1 or g? g Let d = 53772 + -8334763/155. Let q = -3288/31 + 106. Let m = d - q. Is -1 at least as big as m? False Let p be 45/10 + 3/(-2). Which is smaller: p or 2? 2 Suppose 2h - 7h - 2o - 4 = 0, 4o = -4h + 4. Let d(j) = -9j*3 + 2j*2 + j. Let y be d(-1). Suppose yg - 5g + 5 = 0. Which is bigger: h or g? g Let p = 19 + -36. Let u be (-12)/8-2 + p. Is -15 at least u? False Let p(g) = -g*2 + 5g + 4. Let c be p(5). Suppose -cb = -0b + 12. Let j be 0/((b + 4)-1). Which is bigger: 3/5 or j? 3/5 Suppose 0 = -12u + 10u + 52. Is 21 greater than u? False Suppose h + 5p = 6, 0h - 2h = 4p - 6. Is -1/5 greater than or equal to h? False Let a(l) = -l2 - l - 1. Let b be a(0). Let n = 332 - 333. Is n < b? False Let z = -61/2 + 31. Which is bigger: z or -21? z Let b be 160/(-12) + (-1)/(-3). Let z(o) = o3 + 13o2 + 1. Let n be z(b). Is n smaller than 1? False Let c be (-20)/(-28) + (-2)/(-7). Let f(v) = v3 + 5v2 + 5v + 5. Let a be f(-5). Let t be a/(-9) + -3 + c. Is -1 < t? True Let i be (2 + -3)/4-4. Let c be (i/(-2))/((-84)/(-76)). Let j = c - 1/21. Is j less than or equal to 0.2? True Let s = -8 + -4. Let b be 5/(-15)(2 + -3). Which is greater: b or s? b Suppose 3g + 40 = -c, 4c = 3g + 1 + 49. Is -13 at most as big as g? False Let v = -72 - -72.1. Which is greater: 2 or v? 2 Let n(p) = p2 - p - 2. Let v be n(-1). Suppose -4f - 24 - 12 = v. Is -8 <= f? False Let h = -32 - -21. Is h equal to -2/5? False Let v = 6 + -5.7. Let i be 20/(-8)*6/(-5). Let n be (-2 - -2)/i - -1. Is n at most v? False Le	{ "pile_set_name": "DM Mathematics" }
second derivative of x*4/6 + 5x*3/6 + 77x*2/2 - 155x. Does 35 divide y(-7)? True Suppose -5x + 29d = 34d - 17460, 13980 = 4x + 2d. Is x a multiple of 11? True Let p(s) = -s3 - 12s*2 - 5s. Let f be p(-5). Let a = f - -517. Is a a multiple of 44? False Suppose 138d + 2694 = 141d. Let y = d + -362. Is 8 a factor of y? True Is 1/(-3) - (12 + (-203196)/36)1 a multiple of 11? True Let p be (-84)/(-18) - -3 - 2/(-6). Suppose -3r + 987 = 3h, -4h + ph = 2r + 1322. Is h a multiple of 33? True Let r = 13641 + -6417. Is r a multiple of 129? True Suppose 3v + 30 + 44 = z, -v = 0. Suppose -z - 169 = 9h. Is ((-45)/h)/(2/18) a multiple of 15? True Let g = 64 + -60. Suppose -gw = 9 - 13. Is (w + (-3 - -1))/(3/(-420)) a multiple of 28? True Let b(z) = 20z*3 - 11z + 3. Let n(c) = 13c3 - 7c + 2. Let v(q) = 5b(q) - 8n(q). Let u be v(1). Let i(l) = -l*3 - 2l*2 + 2l - 6. Does 3 divide i(u)? True Let h(v) = -4 + 4 + 1 - 18v2 + 19v*2. Let y be h(-2). Suppose 0 = yw - 8w + 291. Is w a multiple of 29? False Suppose -4v = -3h - 36, -4 = h - 2h. Let j(s) = -14s - 15. Let z(o) = -15o - 15. Let w(r) = -5j(r) + 4z(r). Is 27 a factor of w(v)? True Let z = 19345 + -12037. Is 63 a factor of z? True Let p(t) = 16t2 + 20t - 3261. Is p(42) a multiple of 141? True Suppose 4g - m + 124 = 0, 0g + 5g = -4m - 155. Let o be g/(-3) + (-1)/3. Suppose ot = 606 + 184. Does 40 divide t? False Suppose 31235l - 560274 = 31213l. Is 13 a factor of l? True Let i = -48904 + 71024. Does 71 divide i? False Suppose -6f - 106 - 7370 = 0. Let u = -746 - f. Is u a multiple of 25? True Let o(h) = h*2 + 42h - 336. Is 10 a factor of o(10)? False Suppose 1737 = 30r + 10977. Let y = -210 - r. Is y a multiple of 3? False Let l = 785 + -560. Let n = -139 + l. Does 86 divide n? True Let m be 8/52 + -4(-37)/52. Is 32 a factor of (-6)/(-15) - 5116/(-30)m? True Let l(s) = -s3 - s2 + 2s. Let o be l(1). Suppose 421 = -5t + 8t - 5z, o = 2z + 10. Is t a multiple of 31? False Is (-171)/(-20 + 1) - -10547 a multiple of 54? False Let t(l) be the second derivative of 15l4/4 - l3/2 + 3l*2 - l - 53. Is t(-2) a multiple of 16? True Suppose 366m = 368m - 6. Suppose 5z - u = 254 + 444, 146 = z + mu. Is 15 a factor of z? False Suppose 5i = 14i + 1080. Let v = i - -140. Suppose -d = -v - 56. Is 4 a factor of d? True Let i = 22850 + -18761. Is i a multiple of 21? False Is ((-1952)/366)/((-2)/3 - (-7492)/11244) a multiple of 212? False Let q(l) = -4l*2 + 4l + 4. Let f be q(3). Suppose 4w + 5u - 23 = 0, -3w - 3 - 3 = -4u. Does 21 divide w/(f/(-2)) - 11744/(-80)? True Let k = -37958 + 39812. Is 6 a factor of k? True Suppose 0 = 5k + 5h - 5290, 4k + h = -0h + 4247. Is 129 a factor of k? False Suppose 3j = -3 + 9. Let m(z) = z2 - 2z*2 + 63 + 2z*j + 3z*2. Is m(0) a multiple of 14? False Let c(k) = 1395k - 2613. Does 218 divide c(15)? True Suppose 0 = 7u - 5u - 4, 0 = 2r + 3u - 10. Suppose -6 = -ri + 72. Is i a multiple of 3? True Let k be ((-1)/(-2))/(1/252). Let h = k - 71. Let t = 1 + h. Is 16 a factor of t? False Let x(d) = 688d - 559. Does 10 divide x(4)? False Let x(u) = 37u3 + u2 - 6u - 4. Let j be x(3). Let v = 1404 - j. Suppose -p - v = -6g + 2g, 2g - 3p = 204. Is g a multiple of 15? True Let z be (-4)/6(100/8 - -1). Is 28 a factor of z/(-6) + 7770/28? False Let c(g) = 63g*3 - 49g*2 + 253g - 17. Is 14 a factor of c(8)? False Suppose 4698 = 10f - 1042. Let l = f + -275. Suppose -11y + 915 - l = 0. Is y a multiple of 7? True Suppose 6102 = 51f - 50f - a, 4f - a = 24402. Is f a multiple of 122? True Suppose 58c = 66c - 88. Suppose 3896 = cp - 6499. Is 15 a factor of p? True Let d(n) = 7n3 - n2 + 35n - 251. Is 24 a factor of d(6)? False Let n(l) = -197l + 695. Does 17 divide n(-24)? True Let p(g) = -671g - 14. Let l be p(-1). Suppose -663r + lr + 684 = 0. Is r a multiple of 4? False Let r = -1182 - -6638. Is r a multiple of 124? True Suppose 0 = v - 84 + 76. Suppose -i - 5k = -50, -3i + vk - 3k + 250 = 0. Does 5 divide i? True Suppose 6i - 2i + 5r = 277, 0 = -i - 5r + 58. Let s = 354 - i. Is 21 a factor of s? False Suppose 7i - 508 + 151 = 0. Suppose -iv + 50v + 319 = 0. Is v a multiple of 30? False Is 99 a factor of ((-6)/919274)/((-169)/39 + 4)? False Let p be (-65)/(-15) - 8/(-12). Suppose 3n - g = -0n - 29, -5 = n - pg. Let k = n - -21. Is k a multiple of 11? True Let z(r) = 2r*3 + 8r*2 - 146r - 67. Is z(11) a multiple of 19? True Suppose -251 = -4h + 4b + 5, 0 = 5h + b - 308. Suppose -3520 = -ha + 57a. Is a a multiple of 11? True Suppose -7d - 3j + 277561 = -15522, -4d + 5j = -167523. Is 42 a factor of d? False Suppose h - 38 = -3k, 0k - h + 26 = 2k. Suppose -k = 2x - 5x - 3f, 3f + 3 = 0. Suppose 0 = -xl - 9 + 129. Is l a multiple of 8? True Let i(s) be the first derivative of -2s*3/3 - 22s*2 - 10s + 89. Is i(-17) a multiple of 10? True Suppose -13h + 54593 - 8898 = 0. Suppose 0 = -0d + 3d - 5c - 2141, 5c = -5d + h. Does 7 divide d? True Let s = -10 - -62. Does 18 divide s/78 - (-104)/6? True Let a(c) be the third derivative of c*5/60 - 9c*4/8 - 16c3/3 - c2 + 49c. Is 16 a factor of a(32)? True Does 11 divide (-28)/(-462) + 3097110/99? True Is 8 a factor of 48/10(2645 + -25)? True Suppose -13674 = -8g - 4g + 6g. Is 53 a factor of g? True Suppose 22 + 14 = 6l. Suppose -o + 0 = -l. Is (o/4)/(2/32) a multiple of 4? True Suppose -5y = 5r - 29350, 2r + 4y + 2600 - 14348 = 0. Is r a multiple of 14? True Let y = 19565 + -13421. Is y a multiple of 96? True Let k = 327 + 10770. Is k a multiple of 7? False Does 19 divide 3/(-2) - ((-72)/84 + 115126/(-28))? False Suppose 36f = 121089 + 141351. Is 81 a factor of f? True Is (576/(-45))/(6(-11)/25740) a multiple of 26? True Suppose v = 5z - 19, 9 + 6 = 3z + 3v. Suppose zg - 33 = 527. Is 35 a factor of g? True Suppose -30j - 225j = -2313105. Does 47 divide j? True Let z = 5631 - 4659. Is 27 a factor of z? True Let d(s) = -3s2 - 29s - 46. Let v be d(-10). Is 42 a factor of v/6(-297)/(12 - 9)? True Suppose -3p = 4s - 21, 3p = s + p + 3. Let f be (243/162)/((-3)/(-10)). Suppose -fj = 0, 5d - sj - 940 = -4j. Does 32 divide d? False Let v(q) = 22q - 78. Let h be v(19). Suppose -7t - 130 = -h. Does 6 divide t? True Let s(t) = 8t - 6. Suppose 5p = -0p + k + 20, 2p = 3k + 21. Suppose -pj + 6 = 0, 3w + 3j = j + 25. Is 7 a factor of s(w)? False Let n(b) = b + 1. Let i(t) = 3t + 45. Let q(k) = i(k) - 4n(k). Let z(a) = a - 42. Let o(c) = 6q(c) + 5z(c). Is o(-20) a multiple of 14? True Suppose -3f - 4 = -2w + 3w, -5f - 5 = 2w. Suppose -3s + wj = -1417, -3s - j + 2j = -1421. Let i = 673 - s. Is 17 a factor of i? False Suppose 2i - 37 = 5f + 7, 66 = 3i - 5f. Suppose -5u + 3j = -24, -4u + u = 2j - i. Does 3 divide u? True Suppose -5r + 5 = 0, -2897 = 3u + 2r - 19447. Is u a multiple of 173? False Does 111 divide (-2385 + -1 - -1)(0 + (-96)/40)? False Suppose -4p + 5d - 3d = -18020, p + 3d - 4526 = 0. Is p a multiple of 196? True Let h(c) = 5c*3 + 3c*2 + 2c + 3. Let k be h(-2). Let p = k + 33. Suppose 5w - 5y + y - 56 = 0, -p = -w - y. Does 8 divide w? True Let k(d) = -19d + 6. Let o(j) = j. Let l(h) = 2k(h) + 6o(h). Suppose -33 = -5p + 16p. Is l(p) a multiple of 12? True Let h(f) = -f3 - 6f*2 + 36f + 98. Is 24 a factor of h(-17)? False Let k = -88 + 92. Suppose t + kt = -m + 21, 2t = 4m + 26. Suppose -75 = -to + 70. Is 2 a factor of o? False Let p = -720 - -722. Is 6 a factor of (14 + 408/(-60))/(p/95)? True Suppose -3s + 9117 = 36p - 33p, -9s = p - 27359. Is 32 a factor of s? True Let h = 117 - 261. Is (117/(-4) - -1)/(18/h) a multiple of 9? False Suppose 94b + 241833 = 154b - 307887. Is 18 a factor of b? True Let o(u) = 95u2 + 228u + 1576. Is 5 a factor of o(-7)? True Let h be ((-12)/5)/((-66)/220). Is 2362/h + (9/3)/(-12) a multiple of 8? False Suppose 16l + 3l - 48l = -4002. Is l a multiple of 5? False Is 34 a factor of (-4 - -2)/(32/(-148720))? False Let d = 88 + -90. Let v(u) = -15u*3 + 6u2 + u - 2. Is v(d) a multiple of 7? True Let u(x) = -x3 - 4x2 - 2x + 2. Let q be u(-2). Let	{ "pile_set_name": "DM Mathematics" }
2 - v wrt v? -70440v*3 Find the third derivative of 2058y*6 - 2030y*2. 246960y*3 Find the first derivative of -21f*3o*2 - 6f*3o - 4f3 - fo*2 - 210f wrt o. -42f3o - 6f3 - 2fo Find the third derivative of -p3q*3 + 37p*3q + 314p2q*3 + 3pq2 wrt q. -6p*3 + 1884p*2 Find the third derivative of -2g*3v*3 + 2g*2v*2 - 848v*3 wrt g. -12v3 What is the derivative of m3y + 4m*3 - my - 724y wrt m? 3m*2y + 12m2 - y Find the second derivative of 7s*3w2 - s3w - 2s*2w*2 - 9sw2 - 6s + 2w2 wrt s. 42sw2 - 6sw - 4w2 Differentiate -j2q + 2j*2 + 6jq3 + 2j - 321q4 - 111 with respect to q. -j2 + 18jq2 - 1284q*3 Differentiate -177y*4 - 359. -708y*3 Find the second derivative of 2b*2w + 945b2 - 311bw + w wrt b. 4w + 1890 What is the third derivative of 161h4 + h2 - 17h wrt h? 3864h Find the second derivative of 3a*3 - 7a*2 - 2a + 254. 18a - 14 Find the second derivative of -496f*5 + 308f wrt f. -9920f3 What is the first derivative of 21460t*3 + 16668 wrt t? 64380t2 Find the second derivative of c3f - 149c*3 + 3c*2f2 - c2 + cf2 + 9c - 24f wrt c. 6cf - 894c + 6f2 - 2 Find the third derivative of 19m*6 + 79m*5 - 74m*2 - 43 wrt m. 2280m*3 + 4740m*2 What is the second derivative of 305q*5 + 347q? 6100q3 Find the third derivative of 87q5 + q4 - 7q2 - 78. 5220q*2 + 24q What is the second derivative of -446o5 + 15o*3 + 21401o wrt o? -8920o3 + 90o What is the second derivative of -7n3 + 9n*2 - 277n + 1? -42n + 18 What is the derivative of 19o*2r - o*2 - 92or3 - 14o + 6 wrt r? 19o2 - 276or2 Find the first derivative of -51y*2 + 19y - 2886 wrt y. -102y + 19 Differentiate -86n*2r - 2976n2 + 2nr - 2r wrt r. -86n2 + 2n - 2 Find the second derivative of l*2rz2 + l2rz + 5lnrz2 - lrz2 - 9nrz - nr + nz wrt z. 2l2r + 10lnr - 2lr Find the first derivative of -b3gv3 - 949b*3g - 50b3v*2 - 3b*3v - b*2v3 wrt g. -b3v3 - 949b*3 What is the third derivative of 2f*2p*3 + 134f*2p*2 + 2f*2 + 1566fp4 + fp*2 wrt p? 12f*2 + 37584fp What is the third derivative of 2m*6 + 29m*5 - 19m4 + m2 + 58m + 10? 240m*3 + 1740m*2 - 456m Find the first derivative of -84u2 - 4u - 2974. -168u - 4 Find the third derivative of 1360o*3 - 1359o*2. 8160 What is the third derivative of -150bf4 - 2bf2 + 9f*2 wrt f? -3600bf What is the second derivative of 29p*5q*2 + 70p*5 + 1025pq2 - 2p wrt p? 580p3q*2 + 1400p*3 What is the third derivative of 1339kp3 - 2kp + 35k + 2p2 wrt p? 8034k What is the second derivative of 74c2 + 313c - 3 wrt c? 148 What is the second derivative of -2455z3 + 2817z wrt z? -14730z Find the second derivative of -7f*3 + 65f*2i + 11fi - 2f - 8i wrt f. -42f + 130i What is the third derivative of -3u5 - 4u*4 - 58u*3z - u*3 + 810u*2z + 4u2 wrt u? -180u*2 - 96u - 348z - 6 What is the derivative of -4573t*2 - 4981 wrt t? -9146t What is the third derivative of 34c2q*3 - 78c*2 - 4cq4 + q2 wrt q? 204c*2 - 96cq What is the second derivative of -z3 - 813z*2 + 6415z wrt z? -6z - 1626 What is the third derivative of 4277bg3w*3 - 22bg3w*2 - 102bg3 - bg*2w*3 - 2bgw*2 - w wrt w? 25662bg3 - 6bg2 What is the third derivative of 4080l*5 + 1212l*2 + 2l + 2? 244800l2 Find the third derivative of -220j*2m*6 - 12j*2m - 2j - 2m*2 wrt m. -26400j*2m3 What is the first derivative of -n4 - 63n2 + 7469? -4n*3 - 126n Find the second derivative of -2k3o3 + k3o + 4k*2o*3 + 58ko3 - ko - o*3 wrt k. -12ko3 + 6ko + 8o*3 What is the second derivative of -8o3 - o2 - 200o - 2? -48o - 2 What is the second derivative of -24b3l*2q - 2b3lq2 - 3b*3q + 3b3 + 12771b*2l*2q2 + b2l2 wrt q? -4b*3l + 25542b2l*2 Find the second derivative of -5x*5 + 528x*2 + 4822x. -100x3 + 1056 Find the third derivative of -t4w + 315t3w + t*2w - 113t2 + tw wrt t. -24tw + 1890w Find the second derivative of 10bn3 + 4bn2 + 35bn + n wrt n. 60bn + 8b What is the third derivative of d*6u + 2d6 + 41d*3u + 555d2 + 2du wrt d? 120d*3u + 240d3 + 246u What is the second derivative of 37o3y*3 - 2399o*3y - 2oy*4 + 5oy2 wrt y? 222o*3y - 24oy*2 + 10o What is the third derivative of -8c4 - 4c*3 - 728c*2 wrt c? -192c - 24 Find the first derivative of 3561a3 - 728. 10683a*2 What is the third derivative of 421l*2m*5 + 63l*2m*2 + 4l*2 + 2m*5 wrt m? 25260l*2m*2 + 120m*2 What is the second derivative of -79v*5 - 55v + 1? -1580v3 What is the third derivative of -3a*6 - 557a*5n*2 - 2a*2n + 9an*2 + 2n*2 wrt a? -360a*3 - 33420a*2n*2 What is the second derivative of 2bd2rx3 - 7bdrx3 + 2bd - 3br - 4d*2rx3 + 24d*2r + 3x3 wrt d? 4brx*3 - 8rx3 + 48r Find the third derivative of 4f6v*2 - 2079f*4v2 + f2v + 6f*2 + fv*2 + 277f wrt f. 480f3v*2 - 49896fv2 What is the third derivative of -206q*3 + 685q*2? -1236 What is the second derivative of -120i*3n*3 + 40i*3n wrt n? -720i3n What is the derivative of -39w - 147 wrt w? -39 What is the third derivative of -12f*3r + 2f3x*3 - 2f*3 - 7f*2rx2 - 2f*2x*2 + 2f*2 + 185rx3 wrt f? -72r + 12x3 - 12 What is the second derivative of 1728b*2z*2 - 20bz2 - 31bz - 2b wrt b? 3456z2 Differentiate 1041lz2 + 2z*2 + 333 with respect to l. 1041z*2 What is the third derivative of 14k*6t - 157k6 - 27k*2t - k*2 + 2kt + 3 wrt k? 1680k*3t - 18840k3 What is the first derivative of 61q + 1821 wrt q? 61 Find the first derivative of 8n3t*4 - 3n*3t - 2195n3 - 3t*3 wrt t. 32n*3t*3 - 3n*3 - 9t*2 Find the second derivative of -166b*2 - 20b - 3. -332 What is the third derivative of 39d4x*3 - 2d*3x*2 - 3d*2 - 75x*3 wrt d? 936dx3 - 12x*2 What is the third derivative of -36nq3s*3 + 4nq3s - 5nqs + 2ns4 - n - 3q*3s*3 + 2s*2 wrt s? -216nq3 + 48ns - 18q*3 Find the second derivative of 14119l*3 + 14l - 103. 84714l Find the third derivative of -533o*2v*3 + 97o*2v*2 - 4o*2 - 12ov3 - 2v*2 wrt v. -3198o*2 - 72o Find the first derivative of 12kt2 - t2 + 57t wrt k. 12t*2 What is the first derivative of 2acp + ac - 5ap - 24a - 6cp + 5c + 3p - 6 wrt a? 2cp + c - 5p - 24 What is the second derivative of -gp*5 - 19gp2 - 2gp + 11p wrt p? -20gp*3 - 38g What is the third derivative of 48g3u - 2g2u - 2gu + 24g wrt g? 288u What is the second derivative of 16j2m4 - j2 - 6jm*5 - 236m wrt m? 192j2m*2 - 120jm3 Find the second derivative of 20b*2k*2v + 2b2 + 48k*2v*3 - 2kv3 - 3kv2 wrt k. 40b*2v + 96v3 Find the third derivative of 7g*2s*4 + 2g*2s*2 + 123g*2s + 2gs*4 + 6s*4 wrt s. 168g*2s + 48gs + 144s What is the third derivative of -2564p*4 - 186p*2 - 4p wrt p? -61536p Find the first derivative of -15ov + 10o - 131v - 902 wrt v. -15o - 131 What is the third derivative of 3t6 - 168t*5 - 83t*2 + 2? 360t*3 - 10080t*2 Find the second derivative of 4895a*2n*2 - 59an2 - 2an + 2a - n*2 wrt a. 9790n*2 What is the second derivative of 349n*2z*2 - 2n*2 + 346nz2 + 2nz wrt n? 698z*2 - 4 Differentiate 4ln3p + 7lr - 3l + 9n*3pr - n3r - npr - pr with respect to p. 4ln3 + 9n*3r - nr - r What is the second derivative of -18x*5 + 255x*3 - 274x wrt x? -360x3 + 1530x Differentiate 3j2ot2 + 10j*2o + 8j2 + 2jot + jt4 - j wrt t. 6j*2ot + 2jo + 4jt3 What is the first derivative of 10s*3y*2 + 128s*3 - 4y wrt y? 20s3y - 4 What is the third derivative of 2b5 - 638b*3 + 333b*2 + 1? 120b**2 - 3828 Find the third derivative	{ "pile_set_name": "DM Mathematics" }
03, -437, -1111, -2459, -4715? -39d3 + 14d*2 - 3d - 175 What is the z'th term of 568709511, 1137419024, 1706128537, 2274838050, 2843547563, 3412257076? 568709513z - 2 What is the s'th term of -55540285, -55540284, -55540283? s - 55540286 What is the d'th term of 119720, 239423, 359126, 478829? 119703d + 17 What is the f'th term of -2139, -1570, -663, 576, 2141, 4026? -f*3 + 175f*2 + 51f - 2364 What is the r'th term of 183888436, 367776873, 551665310? 183888437r - 1 What is the i'th term of 93450, 186949, 280448, 373947? 93499i - 49 What is the f'th term of -28998044, -28998045, -28998046, -28998047, -28998048? -f - 28998043 What is the h'th term of 131908, 134536, 138922, 145072, 152992, 162688, 174166, 187432? h*3 + 873h*2 + 2h + 131032 What is the v'th term of 42041, 41993, 41941, 41885, 41825, 41761, 41693? -2v2 - 42v + 42085 What is the j'th term of -808, -1035, -1424, -1969, -2664, -3503? j*3 - 87j*2 + 27j - 749 What is the o'th term of -138380, -136634, -134888, -133142? 1746o - 140126 What is the h'th term of -122, -291, -564, -971, -1542, -2307, -3296? -5h*3 - 22h*2 - 68h - 27 What is the f'th term of -69451, -138882, -208313, -277744? -69431f - 20 What is the n'th term of -74804, -149660, -224516, -299372? -74856n + 52 What is the n'th term of -18008, -17880, -17744, -17594, -17424, -17228, -17000? n*3 - 2n*2 + 127n - 18134 What is the m'th term of 52153, 104740, 157327, 209914? 52587m - 434 What is the a'th term of -1190, -1767, -1924, -1655, -954, 185? a3 + 204a*2 - 1196a - 199 What is the i'th term of 946, -1768, -8148, -18194, -31906? -1833i2 + 2785i - 6 What is the a'th term of -366, -375, -462, -675, -1062? -8a3 + 9a*2 + 20a - 387 What is the m'th term of -4394, -11593, -18792? -7199m + 2805 What is the q'th term of 141356, 282740, 424076, 565340, 706508? -4q*3 + 141412q - 52 What is the a'th term of -341228, -682299, -1023370? -341071a - 157 What is the j'th term of 24510, 25187, 25864? 677j + 23833 What is the n'th term of 123252, 985700, 3326632, 7885290, 15400916, 26612752, 42260040, 63082022? 123207n3 - n + 46 What is the q'th term of -39519, -39679, -39949, -40335, -40843, -41479? -q3 - 49q*2 - 6q - 39463 What is the s'th term of 105415, 210820, 316221, 421618, 527011? -2s2 + 105411s + 6 What is the p'th term of -10438, -39464, -87076, -153274, -238058? -9293p2 - 1147p + 2 What is the f'th term of -176888, -177086, -177284, -177482, -177680, -177878? -198f - 176690 What is the g'th term of -7139177, -14278349, -21417501, -28556627, -35695721, -42834777, -49973789? g3 + 4g*2 - 7139191g + 9 What is the i'th term of 57270, 57818, 58378, 58956, 59558, 60190, 60858? i*3 + 541i + 56728 What is the q'th term of -155226, -310475, -465724? -155249q + 23 What is the u'th term of 64266, 64288, 64332, 64398, 64486, 64596? 11u*2 - 11u + 64266 What is the i'th term of 8196, 8758, 9292, 9804, 10300? i*3 - 20i*2 + 615i + 7600 What is the l'th term of -49606610, -99213216, -148819822, -198426428, -248033034, -297639640? -49606606l - 4 What is the b'th term of 188898, 191073, 193248? 2175b + 186723 What is the n'th term of -1229008, -2458031, -3687054? -1229023n + 15 What is the p'th term of -27388, -54634, -81880, -109126? -27246p - 142 What is the v'th term of 58490, 467869, 1579018, 3742817, 7310146, 12631885, 20058914? 58480v3 + 5v*2 + 4v + 1 What is the o'th term of 97, 6, -559, -1832, -4047, -7438, -12239, -18684? -39o3 - 3o*2 + 191o - 52 What is the b'th term of -380717, -380712, -380709, -380714, -380733, -380772? -b*3 + 5b*2 - 3b - 380718 What is the h'th term of 6233, 11776, 17431, 23252, 29293, 35608? 9h3 + 2h*2 + 5474h + 748 What is the l'th term of 4695, 4691, 4709, 4755, 4835, 4955? l*3 + 5l*2 - 26l + 4715 What is the r'th term of -7644, -8383, -9616, -11343, -13564? -247r2 + 2r - 7399 What is the o'th term of 6995, 7019, 7049, 7079, 7103, 7115? -o*3 + 9o*2 + 4o + 6983 What is the q'th term of 12831357, 25662715, 38494073, 51325431, 64156789? 12831358q - 1 What is the g'th term of 1711795, 6847181, 15406159, 27388729, 42794891, 61624645? 1711796g*2 - 2g + 1 What is the h'th term of 3418, 14599, 33092, 58897, 92014, 132443? 3656h2 + 213h - 451 What is the o'th term of -97819, -195629, -293439, -391249? -97810o - 9 What is the m'th term of 405, 1844, 4643, 9126, 15617, 24440, 35919? 54m*3 + 356m*2 - 7m + 2 What is the k'th term of -1253796, -1253999, -1254202, -1254405, -1254608? -203k - 1253593 What is the v'th term of 1455825, 1455816, 1455807? -9v + 1455834 What is the w'th term of 1676182, 1676164, 1676148, 1676134, 1676122, 1676112? w*2 - 21w + 1676202 What is the a'th term of -80381, -80395, -80411, -80423, -80425? a*3 - 7a2 - 80375 What is the t'th term of -1760148, -1760175, -1760200, -1760223, -1760244, -1760263? t2 - 30t - 1760119 What is the l'th term of 65507, 261875, 589031, 1046873, 1635299, 2354207, 3203495, 4183061? -17l*3 + 65496l*2 - l + 29 What is the f'th term of 468, 954, 1378, 1704, 1896, 1918, 1734, 1308? -6f*3 + 5f*2 + 513f - 44 What is the u'th term of -26116, -52222, -78332, -104446, -130564, -156686, -182812? -2u2 - 26100u - 14 What is the l'th term of 195070, 390101, 585132? 195031l + 39 What is the h'th term of 401, 1004, 1997, 3380, 5153, 7316? 195h*2 + 18h + 188 What is the f'th term of -1172657, -1172671, -1172685, -1172699, -1172713? -14f - 1172643 What is the g'th term of 28005, 111948, 251855, 447726, 699561? 27982g*2 - 3g + 26 What is the g'th term of -72, 1351, 2778, 4209, 5644? 2g2 + 1417g - 1491 What is the j'th term of 8402, 7830, 7258, 6686, 6114? -572j + 8974 What is the o'th term of 38464, 153621, 345472, 614017? 38347o*2 + 116o + 1 What is the z'th term of -1890, -1710, -1526, -1338, -1146, -950, -750? 2z2 + 174z - 2066 What is the o'th term of -4855, -4945, -5093, -5299? -29o2 - 3o - 4823 What is the j'th term of 2539, 4820, 6835, 8584? -133j2 + 2680j - 8 What is the t'th term of -2570781, -2570769, -2570755, -2570739, -2570721? t*2 + 9t - 2570791 What is the c'th term of -6179, -49526, -167179, -396290, -774011? -6192c3 - c2 + 14 What is the y'th term of 857, 1124, 1399, 1694, 2021, 2392, 2819? 2y*3 - 8y*2 + 277y + 586 What is the d'th term of -21234, -17952, -12474, -4794, 5094? d*3 + 1092d*2 - d - 22326 What is the d'th term of 12265875, 12265874, 12265873, 12265872, 12265871, 12265870? -d + 12265876 What is the h'th term of 246, 1619, 4520, 9351, 16514? 67h*3 + 362h*2 - 182h - 1 What is the o'th term of 70604, 136299, 201996, 267695? o*2 + 65692o + 4911 What is the g'th term of -58831250, -117662500, -176493750, -235325000, -294156250, -352987500? -58831250g What is the q'th term of 3797062, 7594121, 11391180, 15188239, 18985298, 22782357? 3797059q + 3 What is the s'th term of -38693, -38664, -38607, -38516, -38385, -38208, -37979? s*3 + 8s*2 - 2s - 38700 What is the t'th term of 1650, 6043, 13366, 23619? 1465t2 - 2t + 187 What is the r'th term of 916, 3257, 7092, 12421, 19244? 747r2 + 100r + 69 What is the o'th term of 394276, 394430, 394692, 395068, 395564? o*3 + 48o*2 + 3o + 394224 What is the t'th term of 4811, 9435, 13681, 17357, 20271, 22231? -32t3 + 3t*2 + 4839t + 1 What is the j'th term of 520829, 1041633, 1562437, 2083241? 520804j + 25 What is the t'th term of -64756934, -129513871, -194270808, -259027745, -323784682, -388541619? -64756937t + 3 What is the u'th term of -1302, -3808, -8000, -13890, -21490, -30812? -2u3 - 831u*2 + u - 470 What is the t'th term of 7443, 7194, 6781, 6204, 5463, 4558? -82t*2 - 3t + 7528 What is the k'th term of 3451532, 3451534, 3451536, 3451538? 2k + 3451530 What is the f'th term of -58427, -233311, -524653, -932453? -58229f*2 - 197f - 1 What is the k'th term of -1924650, -3849299, -5773948, -7698597, -9623246, -11547895? -1924649k - 1 What is the i'th term of 88019693, 88019692, 88019691, 88019690? -i + 88019694 What is the j'th term of 5257, 5312, 5409, 5548, 5729, 5952? 21j*2 - 8j + 5244 What is the o'th term of 21827678, 43655356, 65483034, 87310712, 109138390? 21827678*o What i	{ "pile_set_name": "DM Mathematics" }
ked without replacement from {s: 2, r: 1, e: 1}? 1/6 What is prob of sequence np when two letters picked without replacement from {q: 3, p: 1, m: 1, n: 6, e: 1}? 1/22 Calculate prob of sequence sns when three letters picked without replacement from evpnknks. 0 Two letters picked without replacement from {f: 3, i: 1, g: 1, r: 6, n: 1, a: 3}. What is prob of sequence ai? 1/70 Calculate prob of sequence vrrr when four letters picked without replacement from rrrrvrrrrrrv. 4/33 What is prob of sequence jhd when three letters picked without replacement from dhudjhuurhhhuj? 5/546 Two letters picked without replacement from emokekmeevem. Give prob of sequence om. 1/44 Three letters picked without replacement from {q: 2, s: 2, f: 1, m: 4, n: 1}. Give prob of sequence sqm. 1/45 Calculate prob of sequence vvk when three letters picked without replacement from {c: 1, v: 2, k: 1, p: 3}. 1/105 Two letters picked without replacement from ssysyssssssssssysyss. Give prob of sequence ys. 16/95 Two letters picked without replacement from {c: 2, z: 2, s: 1, o: 6}. Give prob of sequence sc. 1/55 Two letters picked without replacement from {e: 3, y: 2, a: 1, k: 1, t: 4}. Give prob of sequence ee. 3/55 What is prob of sequence opo when three letters picked without replacement from {z: 2, p: 7, o: 5}? 5/78 What is prob of sequence tbb when three letters picked without replacement from {t: 1, m: 3, b: 16}? 2/57 Three letters picked without replacement from zeo. Give prob of sequence ozz. 0 What is prob of sequence bvqv when four letters picked without replacement from vvvqvkvvvvkvqvvvvvb? 91/23256 What is prob of sequence dp when two letters picked without replacement from {y: 1, p: 1, d: 1, x: 1, w: 1}? 1/20 Calculate prob of sequence ni when two letters picked without replacement from innninn. 5/21 What is prob of sequence gwp when three letters picked without replacement from {a: 3, p: 1, g: 7, w: 1, k: 2}? 1/312 Four letters picked without replacement from {k: 2, j: 2, d: 4, r: 3}. Give prob of sequence kddk. 1/330 Two letters picked without replacement from {x: 3, v: 3}. Give prob of sequence vx. 3/10 Three letters picked without replacement from ogwujwgwkjku. What is prob of sequence gkj? 1/165 Three letters picked without replacement from {n: 2, w: 3, u: 1, h: 1, f: 3, p: 1}. Give prob of sequence nuw. 1/165 Calculate prob of sequence vgrv when four letters picked without replacement from grgrkvvkvgkrgkv. 2/455 What is prob of sequence eeb when three letters picked without replacement from {z: 1, l: 3, b: 4, e: 6}? 5/91 What is prob of sequence fk when two letters picked without replacement from knwwnwnwfnnnkffnw? 3/136 What is prob of sequence ly when two letters picked without replacement from {l: 7, d: 1, g: 8, h: 2, y: 2}? 7/190 Four letters picked without replacement from {o: 4, e: 2, w: 12, k: 1}. Give prob of sequence owwo. 11/646 Calculate prob of sequence ny when two letters picked without replacement from {y: 3, s: 3, n: 2}. 3/28 What is prob of sequence rrzb when four letters picked without replacement from {y: 2, b: 1, z: 1, r: 3, w: 1, k: 5}? 1/2860 What is prob of sequence ssj when three letters picked without replacement from minisjns? 1/168 What is prob of sequence yzn when three letters picked without replacement from {b: 3, y: 3, a: 3, z: 1, n: 8}? 1/204 Calculate prob of sequence wl when two letters picked without replacement from lwhqwq. 1/15 Four letters picked without replacement from dgggddddddegd. Give prob of sequence eddg. 28/2145 Three letters picked without replacement from {a: 3, g: 2, u: 4, p: 1, c: 2}. Give prob of sequence pga. 1/220 Two letters picked without replacement from ffffffzslhslhhhllf. Give prob of sequence lf. 14/153 Two letters picked without replacement from {c: 1, b: 1, l: 1}. What is prob of sequence cl? 1/6 Two letters picked without replacement from emssmmssmmsmmmmmsmm. Give prob of sequence me. 2/57 Calculate prob of sequence wsi when three letters picked without replacement from smmeewi. 1/210 Calculate prob of sequence nx when two letters picked without replacement from knnnynwxn. 5/72 Calculate prob of sequence yto when three letters picked without replacement from ztyttozzyzffoofo. 1/140 Four letters picked without replacement from knhygjg. What is prob of sequence yghg? 1/420 Three letters picked without replacement from {u: 3, r: 4, o: 2, i: 1, e: 2}. Give prob of sequence uie. 1/220 Three letters picked without replacement from aahohhhoh. What is prob of sequence ooa? 1/126 Two letters picked without replacement from gggxaggggggggmx. What is prob of sequence gm? 11/210 What is prob of sequence nvi when three letters picked without replacement from nnxxxxvgxvgvixxv? 1/420 Calculate prob of sequence fuf when three letters picked without replacement from {u: 7, f: 2}. 1/36 Calculate prob of sequence tbcr when four letters picked without replacement from {b: 5, r: 7, t: 1, c: 1, f: 5}. 35/93024 What is prob of sequence nn when two letters picked without replacement from {n: 5, j: 1, e: 5, m: 6}? 5/68 Calculate prob of sequence vvkk when four letters picked without replacement from kkvkkkvkkkv. 7/165 What is prob of sequence kkkg when four letters picked without replacement from {g: 9, k: 9}? 21/340 What is prob of sequence qsds when four letters picked without replacement from sqsqrrsrrood? 1/990 Two letters picked without replacement from vtd. What is prob of sequence tv? 1/6 Calculate prob of sequence qq when two letters picked without replacement from {q: 7}. 1 What is prob of sequence vz when two letters picked without replacement from {z: 7, v: 2}? 7/36 Four letters picked without replacement from egcgellevlbcvccebll. Give prob of sequence eccg. 1/969 What is prob of sequence qeq when three letters picked without replacement from aeasqqa? 1/105 What is prob of sequence hhe when three letters picked without replacement from {e: 4, h: 3}? 4/35 Calculate prob of sequence ll when two letters picked without replacement from {t: 7, u: 1, l: 3, p: 5}. 1/40 What is prob of sequence tt when two letters picked without replacement from qtqqtqqqqq? 1/45 Four letters picked without replacement from jjmjmjm. What is prob of sequence mmjj? 3/35 What is prob of sequence ttt when three letters picked without replacement from ttst? 1/4 Calculate prob of sequence eee when three letters picked without replacement from {u: 2, d: 11, h: 1, e: 5, z: 1}. 1/114 Four letters picked without replacement from {f: 10, a: 4, m: 6}. What is prob of sequence maff? 6/323 What is prob of sequence wwxw when four letters picked without replacement from {w: 8, m: 1, q: 1, e: 1, x: 1, o: 2}? 2/143 What is prob of sequence ot when two letters picked without replacement from {o: 5, t: 8}? 10/39 Calculate prob of sequence bxgp when four letters picked without replacement from oobpxnogbnbo. 1/3960 What is prob of sequence jl when two letters picked without replacement from {r: 11, b: 1, j: 2, l: 5}? 5/171 Four letters picked without replacement from zlllzzlzlzzzz. What is prob of sequence lllz? 4/143 Three letters picked without replacement from wwwowowwooowowwwoww. What is prob of sequence wow? 154/969 Three letters picked without replacement from {i: 2, c: 1, s: 2, b: 2, o: 1}. What is prob of sequence ibs? 1/42 Two letters picked without replacement from nnfdidaaaidmfi. What is prob of sequence aa? 3/91 Calculate prob of sequence eees when four letters picked without replacement from {e: 5, s: 2}. 1/7 Three letters picked without replacement from oooppopoxxxpp. What is prob of sequence ppp? 5/143 Four letters picked without replacement from {w: 1, r: 2, a: 1, k: 2}. Give prob of sequence krkw. 1/90 What is prob of sequence xr when two letters picked without replacement from {q: 1, x: 1, r: 2, d: 4, k: 1}? 1/36 Calculate prob of sequence ttt when three letters picked without replacement from tktttktttkt. 56/165 Two letters picked without replacement from euemuuemmmuwmbeteumm. Give prob of sequence wt. 1/380 Four letters picked without replacement from {c: 7, d: 3}. Give prob of sequence dddc. 1/120 Four letters picked without replacement from {z: 3, k: 2, l: 1, o: 6, s: 6}. What is prob of sequence kloz? 1/2040 What is prob of sequence mh	{ "pile_set_name": "DM Mathematics" }
432) - 3(sqrt(432) - 2sqrt(432))) + sqrt(147) + 1 + 5). -331sqrt(3)/6 - 6 Simplify -4((sqrt(170)14 + (4sqrt(170)-1 - sqrt(170) - sqrt(170)))/(5(sqrt(10) - sqrt(160))-5) + 0). 8sqrt(17)/75 Simplify (sqrt(280)/(sqrt(10) + -4sqrt(40)))/(-3(sqrt(24) + sqrt(48)/sqrt(2))/sqrt(6)). sqrt(7)/42 Simplify 3 + (sqrt(171)3 + sqrt(171))1 + 5 - ((-1((sqrt(171) + -1)2 + sqrt(171)))2 + 1). -1536 + 48sqrt(19) Simplify (-2 + (-4 + 1sqrt(396) + (-1(sqrt(396) + -1 + sqrt(396)) - sqrt(396)))2 + 1((sqrt(396) - (sqrt(396) + 1)) + sqrt(396))-1 + 4)2. 180sqrt(11) + 9909 Simplify (((sqrt(30) - sqrt(60)/sqrt(2))2 - sqrt(30))5)/(sqrt(66)/((sqrt(704) - -1sqrt(704)) + sqrt(704) + sqrt(704)))2 + -4. -320sqrt(5) - 4 Simplify (3 + 2 + -2 + sqrt(396) + 0 - ((sqrt(396)34 - sqrt(396)) + (sqrt(396) - (sqrt(396) - (4 + 1 + sqrt(396))))))23. 792sqrt(11) + 143760 Simplify 3 + ((-2sqrt(133)-2)/(sqrt(28)/sqrt(4)4) - (1 + 3(sqrt(1216) + -2))). -23sqrt(19) + 8 Simplify -3((sqrt(162) + 1)3 + sqrt(162) + sqrt(162) + -3 + sqrt(162) + -1 + sqrt(162) + (sqrt(162) + sqrt(162)2)-6 + 4)*2. -58833 + 1782sqrt(2) Simplify ((1((sqrt(228) - -1-1sqrt(228)) + sqrt(228) + (sqrt(228) - -1sqrt(228))2))/((1sqrt(12)2 - sqrt(12))22))2. 475/16 Simplify ((3(sqrt(85) - ((sqrt(85)3 - sqrt(85)) + sqrt(85))-6))/((sqrt(120)/sqrt(6))/sqrt(4)2)6)*25. 2485485 Simplify -4 + (sqrt(1470) + 2((5sqrt(1470) + sqrt(1470) - sqrt(1470) - sqrt(1470) - sqrt(1470)) + sqrt(1470)))/(5(4sqrt(90) + sqrt(90))) + 4. 21sqrt(3)/25 Simplify ((5-3sqrt(1617))/(sqrt(77)/(sqrt(7)-44))6)*2. 304819200 Simplify (2 + -3(-5sqrt(2448) + sqrt(17)) - (sqrt(425) + 0 + 3 + sqrt(425) + 3))21. -1336sqrt(17) + 474129 Simplify ((3(sqrt(2916) + 52sqrt(2916)))/((sqrt(60)/(sqrt(5)2 - sqrt(5)) + sqrt(12) - (sqrt(48)/sqrt(4)5 + sqrt(12)))-3))2. 29403/16 Simplify (-2sqrt(104)-2)/(sqrt(8) + (sqrt(288) - (sqrt(288) + (sqrt(288) - 1sqrt(288)) + sqrt(288)))) + (3 + sqrt(1300)2)22. 12 + 396sqrt(13)/5 Simplify -2((5 + 1sqrt(1377) + (sqrt(1377) - ((1sqrt(1377) - sqrt(1377)) + 3 - sqrt(1377))))6 + -4 + 4)*2. -892584 - 7776sqrt(17) Simplify ((sqrt(49) + 2sqrt(147)/sqrt(3) - (sqrt(392)3)/sqrt(8))/((sqrt(84)/(sqrt(8)/sqrt(4)))/(sqrt(6) + (sqrt(216) - sqrt(216)-2) + sqrt(216))))2. 0 Simplify (6((-2(sqrt(833) + sqrt(833)3) + -3 - ((sqrt(833) - -6(0 + sqrt(833))) + sqrt(833))-3) + 4))*2. 8064sqrt(17) + 7676964 Simplify ((1 + sqrt(325) + -2)-4 + (-3sqrt(13)1 - (-1 + sqrt(1053))))2. -320sqrt(13) + 13337 Simplify (((-1 + sqrt(99) + sqrt(99))-5 - sqrt(99)/((sqrt(99)2)/sqrt(11) - sqrt(9))) + (-5 + 2 + sqrt(110)/(sqrt(30)/sqrt(3)))-2)2. -726sqrt(11) + 12100 Simplify (1sqrt(1323) + sqrt(243)/(sqrt(225) - sqrt(9)))/(66sqrt(27)/(sqrt(12)/sqrt(4))). 29sqrt(3)/144 Simplify ((2sqrt(70)/sqrt(2) - sqrt(35))/sqrt(5) - (sqrt(700) + 0 + 0 + sqrt(700))2) + ((-5sqrt(1008) + 5)6)2. -21599sqrt(7) + 905300 Simplify (1(-3sqrt(80) - sqrt(80))-4)2 - (sqrt(20)/(1sqrt(64))3)2. 327635/16 Simplify (sqrt(468) - -1(sqrt(468) + -3 - sqrt(468)) - (sqrt(468) + sqrt(468) + -2sqrt(468) - sqrt(468))-2)*2 + -2(4 + (1sqrt(468))2 + -2sqrt(468)6). -467 + 180sqrt(13) Simplify (-4 + sqrt(500)-1 + 0 + (sqrt(500) + (sqrt(500) + 0)2 - (sqrt(500) + 6(sqrt(500) + sqrt(500) + (sqrt(500) - (1sqrt(500) - sqrt(500)))))))*2 + 3. 1360sqrt(5) + 144519 Simplify ((sqrt(3) - -4(-1 + sqrt(3)) - (sqrt(3) - (sqrt(6)/sqrt(2)1 + sqrt(3)))) + 53sqrt(48) + -3 + 1)*2. -792sqrt(3) + 13104 Simplify 1(6((-3 + sqrt(605)-3 + 1)4)*24 + -2). 50688sqrt(5) + 2092414 Simplify ((sqrt(99) + sqrt(99) + sqrt(99)-1-4)/(sqrt(54)/sqrt(6)-2))*2 + (sqrt(88)/sqrt(4)-1 - sqrt(22))/(sqrt(224)/sqrt(7)) + 3. -sqrt(11)/2 + 102 Simplify (1(-2 + (sqrt(1300) - (5 + -1sqrt(1300) - sqrt(1300))) + (2 + sqrt(1300)2)2) + -2)-1. -5195 - 110sqrt(13) Simplify (1((3(-2sqrt(1053) - sqrt(1053)) - (sqrt(1053) + sqrt(1053)2 + 4 - sqrt(1053))) + -3 + (sqrt(1053) - (sqrt(1053) + -2 + sqrt(1053))1)))*2-2. -303314 - 2160sqrt(13) Simplify -1 + (-6(4 + (sqrt(1377) - sqrt(17))))*2 - (-3(2sqrt(153) - sqrt(153) - sqrt(153)))/((sqrt(9) - (sqrt(9) + sqrt(9)1))3). 2304sqrt(17) + 39743 Simplify (-4(sqrt(68) + (-3 + sqrt(68) + (sqrt(68) - -4sqrt(68)) + sqrt(68) - sqrt(68)) - sqrt(68)) - (5 + (sqrt(68) - (sqrt(68) + 4)) + sqrt(68) + -4))*2. -1500sqrt(17) + 42725 Simplify ((-1 + 6(sqrt(637) + 3) + sqrt(637) + -1sqrt(637)2 + -1)-3)*2. 10080sqrt(13) + 145629 Simplify (-5 + sqrt(11) + (sqrt(11) + 0)4 + (sqrt(77)/sqrt(28))2 - (1 + (sqrt(539))26 + sqrt(11) + 1))3. -38859/4 + 12sqrt(11) Simplify (5 + (sqrt(320)3 + sqrt(320) - sqrt(320)) + -5)2 + (1 + -1sqrt(405) + (sqrt(405) + 1 - sqrt(405)) + -2)*2. 3285 Simplify (sqrt(12)/sqrt(4)-2 + (sqrt(3) - (-2 + sqrt(192) + sqrt(192)))*2)-2 + (sqrt(165)/(sqrt(33)/sqrt(3)))/(1sqrt(45)). -1358 + 373sqrt(3)/3 Simplify (-6(sqrt(325) + (sqrt(325) + 0 + sqrt(325) - sqrt(325)))-5 + -1 - -6(-2sqrt(78)/sqrt(3))/(sqrt(6)/sqrt(3)2))2. -588sqrt(13) + 1123669 Simplify ((sqrt(196)/(sqrt(4) + -3sqrt(196)))/(sqrt(112) - (sqrt(63) + sqrt(252)/sqrt(4)))1 + 4)-3. -12 - 3sqrt(7)/40 Simplify (6((-2 + (sqrt(19) + -2 - sqrt(19)) - (-4 + sqrt(19)-2)) + ((sqrt(152) - 3sqrt(152))/sqrt(8) + sqrt(19) - sqrt(19)) + -3 + sqrt(171)))2. -648sqrt(19) + 6480 Simplify (sqrt(117)-12)/(sqrt(45)/sqrt(80) + sqrt(9)) + -4 + sqrt(1872) + -2 + 5. -1 + 52sqrt(13)/5 Simplify (-5 + (sqrt(272) + 1)-4 + -4 - -3(3 + (sqrt(272) + sqrt(272)-2)2 + sqrt(272)))2. 224sqrt(17) + 13344 Simplify 4 + ((sqrt(544)-5)/(sqrt(18)4))*2 - -3((sqrt(68) - (sqrt(68) + 1) - sqrt(68))*2-4 + -3). -7072/9 - 48sqrt(17) Simplify (4(-1 + (4(1sqrt(448) + sqrt(448)) - (-2sqrt(448) + -4) - (-5 + -1 + sqrt(448)-2))) + 5)*2. 31488sqrt(7) + 1033873 Simplify ((sqrt(847) - (sqrt(847) + sqrt(847)3)6) + -1 + (-3sqrt(847) - sqrt(847)) + 3(0 + (sqrt(847) + 2 - sqrt(847))))*2. -2970sqrt(7) + 617488 Simplify (sqrt(140) - sqrt(140)-3-4 - (-3(2sqrt(140) - sqrt(140)) + sqrt(140)))/(-1(sqrt(343) - sqrt(343)-2)). 6sqrt(5)/7 Simplify 2((sqrt(90)-2 + sqrt(90))-3 + (sqrt(90) - (sqrt(90) + sqrt(90) + 6-1sqrt(90))) + sqrt(90) + sqrt(90))/((3sqrt(64))/sqrt(8)). 10sqrt(5) Simplify 1(sqrt(605) + 2) + (3-1sqrt(605))2 - (-4 + 1 + sqrt(605) + -1 + -4 + sqrt(605) + -1). -11sqrt(5) + 5456 Simplify -1 + ((sqrt(110)-1-1)/((sqrt(10) + sqrt(160))-5) + (sqrt(66)/(2sqrt(3)) + sqrt(22) + sqrt(22))/(-11sqrt(2)))*2. 174919/2500 Simplify ((sqrt(243) + 5 + sqrt(243) + sqrt(243) + sqrt(243) + 0 + sqrt(243) + -1 + sqrt(243) + 1 + sqrt(243))2)*23 + -1. 7560sqrt(3) + 143183 Simplify (sqrt(294) + -1sqrt(294)-1 + (sqrt(294) - 2sqrt(294))-2)/((sqrt(108)-1)/(sqrt(726)1)). -308sqrt(3)/3 Simplify (4 + ((sqrt(204)/((sqrt(18) + 1sqrt(18))/sqrt(3)))/((sqrt(36)/sqrt(3))/sqrt(6) - 3sqrt(18)) + 2)-3)2. -3sqrt(17)/4 + 1177/256 Simplify -4(1 + 2(sqrt(5) - (sqrt(5) + 5(sqrt(15)/sqrt(3) + sqrt(5)))) + -3(sqrt(10)/sqrt(2) + -5) + 1)*2. -11736 + 3128sqrt(5) Simplify (-6(-2(0 + sqrt(605)) + (sqrt(605) - 2sqrt(605)2) + 5))*2 + -5. -19800sqrt(5) + 545395 Simplify (((sqrt(147) + 2 - sqrt(147)) + -3)-1)2 + (3sqrt(441))/sqrt(3) + 3. 4 + 21sqrt(3) Simplify ((6(1 + sqrt(1539) - sqrt(1539)) + -3 - ((sqrt(1539) - (0 + sqrt(1539))) + 0 + 1 + sqrt(1539) + sqrt(1539)-1))4)*2 + -3. 61 Simplify (sqrt(60)/sqrt(160) - sqrt(72)/sqrt(192))/(sqrt(54)/(sqrt(2) + sqrt(18)) + sqrt(1323)1). 0 Simplify ((-3-2sqrt(95) - sqrt(95)) + sqrt(95) + (sqrt(95) - -41sqrt(95)))/(2sqrt(80)-3 - (sqrt(80) + 5sqrt(80)-2 + sqrt(80))). 11sqrt(19)/8 Simplify 4 + (sqrt(864) + sqrt(54) - -1sqrt(150))/(sqrt(192)-2 + sqrt(3) - -1sqrt(147)) + -3. -5sqrt(2)/2 + 1 Simplify (-4 + 3(1 + sqrt(612)) + (sqrt(612) + 0)2 + sqrt(612) + (4-2sqrt(612) - sqrt(612) - sqrt(612)))2-6-1. 288sqrt(17) + 58758 Simplify (6((sqrt(272) + -2)-3 + 5(-2 + sqrt(272))))2 - (5 + (-1 + sqrt(272) + 1 + -5 + sqrt(272) + 1)2). -2240sqrt(17) + 38635 Simplify 2 + -4 + (-2sqrt(14)/sqrt(2) - (-1 + 2sqrt(7) - sqrt(7)))-3. -5 + 9sqrt(7) Simplify (-1sqrt(99) + -5 + 5sqrt(99)-2)2 + (-32*sqrt(110))/(	{ "pile_set_name": "DM Mathematics" }
= -l. Let y be q(-1). Let o(h) = -6h3 - 5h2 - h + 1. Let w(f) = -f3 - f*2. Let p(i) = o(i) - 4w(i). Determine p(y). -3 Let f(q) = -2q + 7 + 5q - 2 - 1. Give f(3). 13 Let c(q) = -q*2 + 5q + 6. Let x = 5 + 1. What is c(x)? 0 Let c = 6 + -8. Let r(n) = -2n + 6. Let u(k) be the third derivative of -k4/6 + 2k3 - k2. Let s(f) = cu(f) + 5r(f). Determine s(4). -2 Let u(w) = 6w3 - 6w*2 + w. Let g(z) = 5z*3 - 5z*2 + z. Suppose 2j - 3 = 5. Let y(v) = ju(v) - 5g(v). Let a be (-3 + (1 - -2))/(-2). What is y(a)? 0 Let s = 5 - 2. Suppose c = -2 + s. Let t = c + -5. Let v(j) = -j*2 - 5j - 3. Calculate v(t). 1 Let g(t) = -t + 8 + 0 - t2 - 3. Let o be g(0). Let m(x) be the third derivative of x6/120 - x*5/15 - 5x4/24 - x3/3 + 7x2. Calculate m(o). -2 Let n(w) = w2 + 4w + 1. Let a(r) = r*3 + 7r*2 - 6r + 11. Let z be a(-8). Give n(z). 6 Let t be 5 + 0 + (1 - 5). Let y(p) be the first derivative of -2p + t - 1/2p2. Determine y(4). -6 Let c(s) = s3 + 6s2. Suppose -8k - 27 - 21 = 0. Determine c(k). 0 Let p(x) be the second derivative of x5/10 + x4/6 - x*2/2 + 20x. Let o(c) = -c*2 + 5c - 4. Let y be o(4). Suppose 0 = w - 1 - y. What is p(w)? 3 Let q = 30 - 26. Let t(a) = -a*2 + 2a + 5. Give t(q). -3 Let r(q) = -17q3 - q3 + 11q + 2q2 + 5q - 15q. Determine r(-1). 19 Let a(p) = -2p - 3p + 3p*2 + 3 + 0p3 + p3. Let d(w) = -w3 - w + w + w2 - 4. Let h be d(0). What is a(h)? 7 Let f(x) = x*2 - 1 + 31x - 30x + 2. Determine f(-3). 7 Suppose 6a = 2a - 4. Let w(b) = -b. Let t(f) = f2 + f + 3. Let o(n) = at(n) + 5w(n). Let c be o(-4). Let h(r) = r2 - 6r + 5. Give h(c). 0 Let k(h) be the first derivative of -h2/2 - h - 1. Let p be k(0). Let a(z) be the second derivative of -z4/4 + z*2/2 + 4z. Give a(p). -2 Let x be (-1)/21/((-3)/(-18)). Let o(w) = w3 + 3w*2 - 3. What is o(x)? -3 Let i(s) = 0s - 3s - 2 + 0s - 3s. What is i(-2)? 10 Suppose -2o + 12 = o. Let d(r) be the third derivative of -r5/60 + r4/8 - 5r3/6 + r2. Determine d(o). -9 Let h(y) = -y2 + 4y + 9. Suppose 12z = 10 + 74. Determine h(z). -12 Let q(v) = -v2 - 11v - 11. Let i(s) = -s*2 - 5s - 5. Let c(d) = 9i(d) - 4q(d). Let u be -1(-1 - (-1 - 1)). Let t be u/(-12/(-2)). What is c(t)? -5 Let v(b) be the third derivative of b6/120 + b5/12 + 5b4/24 - 2b3/3 - b2. Suppose -n - 3 = 2i + 5, 5n + 12 = 4i. What is v(n)? -8 Let k(o) = 5o*2 + 7o - 4. Suppose -2v = -c + 8, c + 3 - 17 = 5v. Let j(t) = 3t2 + 4t + 3 - 6 + 1. Let m(n) = ck(n) - 7j(n). Calculate m(-2). -6 Let i(u) = u*2 + 9u + 2. Suppose -4b - 30 = 3o, -1 = 4o - 3b + 14. Calculate i(o). -16 Let h(f) be the second derivative of -f - 3/2f2 - 1/2f*3 + 0 + 1/12f*4. Give h(4). 1 Let m(q) be the second derivative of -13q7/2520 - q6/720 - q5/120 - q4/12 - 4q. Let i(z) be the third derivative of m(z). Determine i(-1). -13 Let r(x) = 2x - 1. Let s = -16 + 24. Suppose -3w + 75 = 4m, -sm + 2w + 65 = -3m. Suppose 0 = -2u + 6u - 5f - 27, -3u + m = -2f. Give r(u). 5 Let u = 9 - -1. Suppose -3r = r + 2v + 16, 0 = r - 3v - u. Let i(j) = 9j - 17. Let o(h) = -5h + 9. Let z(l) = -6i(l) - 11o(l). Give z(r). 1 Let i(g) = 0g*2 + 4g + 3 - 5g2 + 6g*2. Determine i(-3). 0 Let r(g) = 2 - 2 + 6g + 3. Suppose -7i + 9 - 23 = 0. What is r(i)? -9 Let u(l) = -13 - 4 + 43 + 4l + 35. Let c(k) = k + 15. Let t(o) = -9c(o) + 2u(o). Let x be t(-10). Let a(q) = q*2 + 3q + 1. What is a(x)? 1 Suppose 2l - 5 - 1 = 0, -4l = -2k - 4. Let v(b) = b2 - 4b + 2. Give v(k). 2 Suppose 0k - 5k + 5 = 0. Let m(d) = -5d - 2. Let y(j) = -15j - 5. Let l(g) = -8m(g) + 3y(g). Calculate l(k). -4 Let g(w) = -w + 8. Let y be g(6). Let d = y - 0. Let z(l) = -d + 2l - 4l2 + 1 - l3 + 8l2. What is z(4)? 7 Let p(q) be the second derivative of q - 7/6q*3 + 1/12q*4 + 0 + 1/2q*2. What is p(6)? -5 Let b(m) = m + 4. Let u = -24 + 19. What is b(u)? -1 Let u(f) = f - 8. Let d = 25 + -35. Let r be ((-8)/d)/((-4)/(-20)). What is u(r)? -4 Suppose -3k + 9 = 36. Let t(g) = 2g + 3. Calculate t(k). -15 Let h(a) = a2 + 5a + 6. Let q be h(-4). Suppose i + qo = 10, 4i = 4o + 1 + 3. Let j(n) = n - 4 - in + 2n. What is j(0)? -4 Let u(w) = -9w*2 + 23w - 11. Let b(q) = 5q2 - 12q + 6. Let p(a) = 7b(a) + 4u(a). Let y be p(7). Let x(h) = -h*2 + 7h + 7. Give x(y). 17 Let r be (-6)/8 - (-2)/(-8). Let h(z) = 2. Let j(l) = l - 9. Suppose 47 = -4t - 5b, -b + 1 + 4 = 0. Let g(y) = th(y) - 4j(y). Determine g(r). 4 Let u be (-114)/(-9) + (-6)/9. Let h = u - 7. Let b(y) = y*3 - 6y*2 + 4y + 4. What is b(h)? -1 Let f(h) = 29h2 + 10h - 7. Let w(o) = 19o2 + 7o - 5. Let d(i) = 5f(i) - 7w(i). Calculate d(-1). 11 Let f(o) = 4o - o2 - 3o + 0o2 + 1. What is f(3)? -5 Let l(d) = -d - 5. Let t(f) = 1. Suppose -2x + 18 = -4v, 3x = 2x + 5v + 6. Suppose -3s - x = 1. Let n(r) = st(r) + l(r). What is n(-5)? -4 Let v(y) = y*3 - 5y*2 - 9y + 12. Let j be v(6). Let w(g) = -g*2 - 7g - 2. What is w(j)? 4 Let j = -1 + 3. Suppose 0 = -jl + 1 + 5. Let t(h) = h + 1. Give t(l). 4 Let a(i) = -i - 4. Suppose 0 = -v + 2 - 7. Let k(m) = -m2 - 5m + 6. Let q be k(v). Give a(q). -10 Let m(t) = 2t - 3. Let g(u) = -4u + 7. Let n(z) = 6g(z) + 13m(z). Calculate n(3). 9 Let k(v) = -2v2 + 9v + 1. Let i(l) = l*3 + 3l2 + 4. Let u be i(-3). Let g(d) = -d2 + 4d + 1. Let o(n) = uk(n) - 9g(n). What is o(0)? -5 Let q = 23 + -22. Let v(r) = -8r*2 - r + 1. Calculate v(q). -8 Let x(k) = 4k3 - k2 - 2k - 3. Let t(p) be the third derivative of p6/120 + p3/6 + p2. Let j(y) = 2t(y) + x(y). Suppose 4o + 0 + 4 = 0. Give j(o). -6 Let w(h) = 3h3 - h2 - 2h - 1. Let m(q) = q2 + q + 2. Let k be m(0). Suppose r - 2r = -k. Suppose -r - 2 = 4t. Calculate w(t). -3 Let j(h) = -h2 + 2h*2 - 3 + 3h + h + 0. Let u be j(-5). Let l(q) = q - 1. Give l(u). 1 Let x(b) = b + 1. Let s(z) = -10z - 4. Let d(t) = s(t) + 8x(t). Calculate d(5). -6 Let f(n) be the first derivative of -n6/120 - n5/60 - n4/8 - n3/3 + 3n2/2 + 6. Let q(w) be the second derivative of f(w). Calculate q(-2). 8 Let j(i) be the third derivative of -i8/6720 + i7/1260 - i5/120 + i4/8 + i2. Let x(r) be the second derivative of j(r). Determine x(1). 0 Let f(r) be the first derivative of r3/3 + 5r*2/2 - 8r - 1. Determine f(-6). -2 Let d be (0 - -3)/((-3)/(-3)). Let t(l) = -l*2 - 1 + 2l*d - 1 - 3l*3 - 2l. Let u be ((-4)/6)/(1/3). Give t(u). 6 Let a(i) be the second derivative of -i7/2520 + i6/720 + i5/30 - i4/4 - i. Let q(n) be the third derivative of a(n). Calculate q(0). 4 Let y(f) = -f*2 + 10f - 7. Let z be y(9). Let b be z/8 - (-3)/(-12). Let k(j) be the second derivative of -j*4/12 + 4j*2 + 10j. Determine k(b). 8 Let n(m) be the second derivative of -3m8/2240 + m7/1260 - m5/120 + m4/12 - 4m. Let a(f) be the third derivative of n(f). Determine a(1). -8 Let h(n) be the second derivative of -n*4/12 - 5n3/6 + n2 - 3n. Calculate h(-6). -4 Let p(x) = -x3 - 2x*2 - 2x - 1. Let n = -10 - -4. Let y be n/(-4)(-2 + 0). Give p(y). 14 Let m(u) = 7u - 6. Let f be 12/18 + (-4)/(-3). Suppose -fq - 6 = -q. Let b(z) = -15z + 13. Let r(d) = qb(d) - 13m(d). Determine r(2). -2 Suppose -4n - 12 = -4m, -4m - n + 5 = -12. Let a(h) = 2h - 4. Give a(m). 4 Let u(n) be the third derivative of -n*4/24 + 5n*3/3 + 27n*2. Calculate u(9). 1 Let l(k) = k + 3k - 5k - 4. Let x(n) = 2n + 9. Let v(h) = -13l(h) - 6x(h). Give v(1). -1 Let u(q) = -q*2 - 7q. Let t be u(-5). Let l = -6 - -9. Suppose t - 1 = lr. Let b(w) = 2w*2 - 4w. Determine b(r). 6 Let k(t) be the second derivative of -t*5/20 - 5t*4/12 + 4t*3/3 + 4t2 + t. Let r(m) = -m2 - 2m + 2. Let a be r(2). Calculate k(a). -4 Let j(h) be the second derivative of h4/12 - 5h3/6 + h2 - 2h. What is j(3)? -4 Let m(w) be the third derivative of w6/120 - w5/15 + w4/6 + 28w2. Determine m(3). 3 Let f(x) = -x2 + x. Let c be f(1). Suppose 4s - 5 = 7. Let u(l) = -2 + s + 5 + l2 + l3. Give u(c). 6 Let d(i) = -i - 1. Let m be d(-6). Let j(q) = -q3 + 3q*2 + 6q + 7. Calculate j(m). -	{ "pile_set_name": "DM Mathematics" }
4 (base 16) in base 8? -172324 -3a3ab (base 14) to base 4 -203001003 What is 2232104303 (base 5) in base 7? 60063252 Convert -315782 (base 9) to base 12. -90962 7b7093 (base 15) to base 14 ad6ad9 Convert -4951a (base 14) to base 3. -100010001010 Convert 16743 (base 9) to base 14. 42c5 What is -115234 (base 8) in base 5? -2231310 What is -1085565 (base 10) in base 7? -12140625 33333313 (base 5) to base 2 1000111100001011110 What is 514142 (base 7) in base 4? 111131033 What is 1000012101011 (base 3) in base 15? a895a Convert 845953 (base 10) to base 16. ce881 2785360 (base 11) to base 8 22224503 Convert -7c830 (base 13) to base 9. -376280 -13440102111 (base 5) to base 4 -1002301102232 111100011001101011100 (base 2) to base 9 3645882 Convert 1121111202 (base 4) to base 6. 11502030 What is -30254201 (base 7) in base 3? -11201220122212 57369 (base 11) to base 14 2233a -314352 (base 6) to base 9 -38135 -11112344432 (base 5) to base 14 -18a5642 -413da (base 14) to base 10 -157188 Convert -21301022322 (base 4) to base 15. -358ad3 What is 101010011111101110 (base 2) in base 10? 174062 -98082 (base 11) to base 13 -4cb31 Convert 100131100123 (base 4) to base 10. 4314139 Convert -10971f (base 16) to base 2. -100001001011100011111 Convert 1b3958 (base 12) to base 5. 110432401 Convert -1af5b (base 16) to base 3. -12121110220 -15243024 (base 6) to base 13 -159454 2123100301 (base 4) to base 12 268041 What is -325688 (base 9) in base 7? -1436666 Convert 458c6a (base 13) to base 5. 410211134 Convert -120120010111 (base 3) to base 8. -1126142 Convert 311253101 (base 6) to base 13. 1168678 -46b752 (base 15) to base 6 -200240135 130231420 (base 5) to base 4 2122220100 Convert 21001220010001 (base 3) to base 8. 16252444 What is -4778a3 (base 14) in base 6? -124153303 What is -1023112040 (base 5) in base 6? -114145130 1313323013 (base 4) to base 13 142772 Convert -211111000201 (base 3) to base 13. -126562 What is 5258 (base 12) in base 11? 6839 What is -72926 (base 14) in base 11? -17956a 832630 (base 9) to base 12 1b9aa6 Convert -492a28 (base 11) to base 13. -213c85 34b3a (base 13) to base 8 274173 -624399 (base 11) to base 9 -1785567 163321b (base 12) to base 9 8488775 1011100101010101000 (base 2) to base 15 776e0 What is -186b73 (base 12) in base 5? -102124014 17c41 (base 13) to base 3 2100010111 Convert 33753 (base 11) to base 7. 262223 Convert -d16591 (base 15) to base 4. -211323233023 Convert -111110010100100 (base 2) to base 7. -162012 1033442234 (base 5) to base 11 12a7257 -2122913 (base 12) to base 15 -83bd79 Convert 15057071 (base 8) to base 4. 31011320321 32893 (base 15) to base 7 1236054 11011110010001101111010 (base 2) to base 10 7283578 3451333 (base 7) to base 12 18a49a Convert ad50 (base 14) to base 7. 153430 What is 1101100000011110101 (base 2) in base 13? 126602 Convert 1142262 (base 7) to base 9. 240666 What is -367080 (base 15) in base 10? -2605620 -286ab (base 16) to base 5 -20244142 Convert -123306 (base 16) to base 10. -1192710 37008 (base 16) to base 10 225288 Convert 29433a (base 12) to base 16. a8dde What is 111302010020 (base 4) in base 13? 124c067 What is 113353215 (base 6) in base 11? 1225388 Convert -453255 (base 8) to base 11. -a5169 What is -11212020112122 (base 3) in base 4? -21312223022 -150441c (base 13) to base 6 -355241003 Convert 820b (base 16) to base 8. 101013 Convert -383997 (base 11) to base 6. -20551033 Convert -5e50a (base 16) to base 3. -201121220221 What is -2506 (base 15) in base 4? -1323021 What is -5777b (base 12) in base 2? -11100100010001111 -100020110 (base 4) to base 9 -110558 Convert 1483187 (base 9) to base 2. 11001000110011001000 1db22 (base 16) to base 10 121634 What is -1a89809 (base 11) in base 8? -15313533 What is 527217 (base 8) in base 12? 85867 What is -21522203 (base 6) in base 13? -199242 10200112211220 (base 3) to base 15 28a896 Convert -222002123 (base 4) to base 15. -36042 Convert 11655161 (base 7) to base 9. 1878312 Convert 861192 (base 10) to base 15. 12027c Convert -1873156 (base 11) to base 15. -4283db What is -8e6c52 (base 15) in base 5? -3220304102 What is 100001101100001001 (base 2) in base 11? 94749 Convert -6aa01 (base 13) to base 14. -51107 Convert 1211002210011 (base 3) to base 2. 11101011111101100000 Convert -642393 (base 10) to base 3. -1012122012100 Convert 22bd9d9 (base 14) to base 13. 35905a7 -88581 (base 10) to base 3 -11111111210 -42a1b3 (base 12) to base 16 -101697 Convert 1319554 (base 10) to base 7. 14134045 What is -a148e8 (base 15) in base 10? -7659893 What is -112122201001121 (base 3) in base 6? -434534411 -2242214 (base 7) to base 5 -32414221 3701336 (base 11) to base 10 6443773 Convert 24201230 (base 5) to base 7. 1625350 Convert -202130210020 (base 4) to base 9. -17882617 Convert -12db03 (base 15) to base 12. -378a56 What is -11000334 (base 5) in base 11? -64563 -14574b (base 12) to base 10 -341483 Convert -1003a68 (base 13) to base 9. -10078547 Convert -1041807 (base 9) to base 10. -559069 What is 731421 (base 9) in base 12? 18b26a 10010101110001110111 (base 2) to base 8 2256167 110011111111010001110 (base 2) to base 12 6a1a3a Convert -9572 (base 11) to base 9. -18330 Convert -844224 (base 12) to base 7. -23454361 -433033 (base 8) to base 4 -203120123 What is 1a0a148 (base 11) in base 12? 117902a Convert 110010010100111000 (base 2) to base 13. 72a98 -6327415 (base 8) to base 11 -a4a694 What is -1110100201120 (base 3) in base 13? -211824 What is -1b4b29a (base 12) in base 9? -11858061 What is 10020023131 (base 4) in base 10? 1082077 What is 278313 (base 10) in base 14? 735d7 What is -4a674 (base 13) in base 9? -228331 Convert 43133307 (base 8) to base 9. 18314868 -3300003300 (base 4) to base 13 -28572c Convert -495b5 (base 12) to base 8. -302031 What is -56796 (base 11) in base 9? -134610 4612e8 (base 15) to base 10 3345293 What is -4a1d8 (base 14) in base 9? -305855 What is -e845 (base 15) in base 16? -bfdb What is 6310237 (base 11) in base 10? 11127442 What is -558b95 (base 12) in base 11? -85134a -1bbede (base 16) to base 8 -6737336 924375 (base 10) to base 15 133d50 2254461 (base 7) to base 14 74d68 Convert -100010114 (base 6) to base 3. -10011101211201 -225130510 (base 6) to base 3 -21211120020220 -21141211 (base 6) to base 3 -1011111011221 What is -11356b (base 15) in base 13? -229b0b 157238 (base 10) to base 6 3211542 Convert -20100100012 (base 3) to base 15. -27022 What is -10011110000000010100 (base 2) in base 8? -2360024 Convert -210212000011 (base 3) to base 11. -274173 Convert -1a704a (base 11) to base 6. -10442452 Convert -95be1 (base 15) to base 3. -220010211111 What is -751684 (base 11) in base 8? -4455027 What is 19a5a2 (base 11) in base 3? 120120220201 Convert -243c2 (base 15) to base 7. -661022 Convert 321330301 (base 4) to base 7. 2006005 Convert -2c79a (base 13) to base 16. -14b3c Convert -958856 (base 11) to base 7. -16020204 2104441313 (base 5) to base 11 2518764 What is 163500322 (base 7) in base 13? 2402017 31757 (base 14) to base 15 255cb 13b35b0 (base 12) to base 6 221003540 -10013421 (base 5) to base 4 -103112010 What is 54895 (base 10) in base 4? 31121233 What is -48304 (base 14) in base 8? -530120 -574723 (base 8) to base 5 -22220102 Convert -11000000010110 (base 2) to base 7. -50614 What is 1100222020 (base 4) in base 11? 206242 What is -11340010 (base 9) in base 11? -3129681 Convert -1003333322 (base 5) to base 13. -555881 What is -753565 (base 9) in base 7? -3546311 -11d6ec (base 16) to base 13 -31c1c3 What is 466012 (base 8) in base 5? 20034410 Convert 14144520 (base 6) to base 15. 975d6 1300123 (base 5) to base 11 178a2 -236a7a (base 15) to base 14 -3210da What is 566b84 (base 12) in base 5? 323140003 49100 (base 16) to base 5 34034024 -6c9a4 (base 16) to base 6 -13311232 Convert -1075080 (base 10) to base 13. -2b8456 Convert -73f634 (base 16) to base 3. -112022002210012 What is -224689 (base 10) in base 7? -1624033 What is 4115759 (base 10) in base 8? 17546457 What is -704f2 (base 16) in base 15? -9147d Convert -1c501 (base 14) to base 6. -1314501 Convert 453a7a (base 12) to base 7. 12253456 What is -1332133102 (base 5) in base 16? -33d1bb 11101001111111101001010 (base 2) to base 13 1786000 147257 (base 9) to base 14 25042 -4367040	{ "pile_set_name": "DM Mathematics" }
What is (-14292)/(-136) - (-2262)/(-25636)? 105 Evaluate 9 + 3 + (-1 - 6) + -283 + 281. 3 Evaluate 0 - (0 + 4/26 - ((-13630)/130 - 15)). -120 Evaluate 6/35525188 + (-13)/(-52) - (7 + 2). 1/74 Evaluate (-67)/((-27872)/156) + (-1575)/(-24). 66 What is (8 + -2 - 1008/140)/(((-4)/(-4))/(-45))? 54 What is the value of (14 + 62 + -54)/(6 + 3 + 6)? 22/15 What is the value of 1047/(-156)(-7 + 11) + (-550)/3575? -27 Calculate 10/4 - (-391)/(-46)8/34. 1/2 Evaluate (25 + 9106/(-261))9. -89 Calculate ((-9)/(-6) + -2)/(41800/560 - 75). 7/5 ((2/35)/(11432/21435))/((-7)/16-6) 2/49 Calculate 20(-4485)/(-5750)30/63. 52/7 Calculate 2/(-2)((-205)/(-5) + -35). -6 What is (-25 + (-7922)/(-306))(-3)/(-2)(-12)/(-10)? 8/5 (-1)/(-13) - (680 - 680) 1/13 Evaluate 750/50 - (9 - 42). 48 ((-205349)/(-52195))/(-97) + 4/(-110) -1/13 Evaluate (5589/161 - 38)28/(-72)-6. -23/3 What is the value of 1-1 - 112/448-84? 20 Evaluate (-3008)/(-352) - (-18)/4(-28 + 6032/234). -16/11 Calculate -2-52(-34)/17680. -1/5 What is the value of (-1 + (-3 + -1 - -1))(179 + (-138 - 24))? -68 ((-76)/48 + 4/(-6))8848/(-15484) 9/7 What is 0/(18 + -16) + 26? 26 Calculate (-582)/(-970)70/(-6)(2 + -1). -7 -56(-840)/504(-126)/(-480) 49/2 Calculate ((-115)/(-5))/(32/(37 - 101)). -46 Evaluate (-19)/((-551)/2291) - 39. 40 What is -26 + -31 + 14654/238 + (-1 - (-1 + 10))? -38/7 Evaluate ((-12)/50)/((-1056)/64 + 14 - (-221)/90). 27/5 What is ((-4)/1 + (1425/20)/15)/(906/31408)? 26 Calculate (-1)/(-7)(-43 + 624). 83 What is -25 - (-17 - -4 - (-23 - -9))? -26 Evaluate (51/(-1020))/(4 + (-133)/56). -2/65 Evaluate (-1476)/164 + 197/29 - 2/(-1). -6/29 Evaluate (81/(-15))/(29/((-9570)/1683)). 18/17 What is (-87 - -71)2/(-176) - 2116/22? -96 What is 219(-2620)/(-19126) + 2/7 + (-10)/(-14)? 31 Calculate 22 + -4 - (-40480)/(-2760). 10/3 18504/(-14392) + (-146)/(7/2 - 0) -43 What is the value of 79 + (42 - (-75030)/(-620))? -1/62 What is (-475)/((-77425)/(-7498)) - (-134)/1? 88 What is (13229/(-156) - (615/60 + -10)) + (-580)/(-11310)? -85 What is ((-39360)/(-41))/60 - (346/24 - -1)? 7/12 What is (60/1822/88)/((3/(-18))/(-1))? 5 Calculate 126/4 - (23 - (1 + 1))/(39 + -36). 49/2 Calculate (-913)/(-249) - ((-18)/702 - (-1 + -1)). 22/13 Calculate ((-12321)/777 - -17)-42. -48 What is the value of (3 - (-12728)/(-680)) + ((-7810)/374 - -21)? -78/5 What is ((45/54)/(55/(-22)))/((-24)/(-936))? -13 What is (4/(-8))/((376/288)/47)? -18 (0 - (-2)/(-1))225121/(-168795) 10/31 What is the value of (160 + 5)((-1913)/45912)/(2/(-32))? 110 What is 74/4 - ((-1582035)/366)/(-455)? 9 Calculate -40 - -11 - (44 - (-82296)/(-1128)). -2/47 ((-2)/(-15 - -13))/((-8)/(-12) + (-32)/84) 7/2 Evaluate (-16)/(-2)(-87 - (-162 + 77)). -16 Evaluate (-23310)/3962721/(-15). 14/17 Evaluate (49320/3836 - (-1 - (-6)/7))1/7. 13/7 What is the value of (((-1540)/(-50))/14 - (14 - 12))(-55)/(-506)? 1/46 0 + -9 + 1124810/2886 11 Calculate -7 + ((-31064)/(-5376) - (-2)/6) + 144/168. -1/32 What is the value of (-161)/203 - 6/(-2)16(-20)/(-960)? 6/29 ((-600)/125)/(8/(-4)) - 447/5 -87 (-280908)/(-7803) - 523 -79 What is ((-111496)/2856 - 4/(-102)) + 7? -32 (-4 + 0)(-82)/49221195/942 15 (47 - 27 - (-5722)/(-286))-22 2/13 (20 - -76)/32(-3 - -10) 21 (-2(-1 - 0))/((-47289)/180558 + (-4)/(-21)) -28 Evaluate (2/2)/(501/(-8016)). -16 Calculate (-5)/((3510/156)/((-135)/375)). 2/25 What is the value of 16 - (-14 - -101) - (23 + -29)? -65 Evaluate (144/234)/(834/1807). 4/3 What is the value of ((-129)/(-473))/(1728/2816)? 4/9 Calculate 10/(-84)(-6363)/(-13635). -1/18 Evaluate 27 + -45 + (-7189)/(-395). 1/5 What is 16768/(-3406) + (4/18 - (-3432)/594)? 14/13 Evaluate 54 + (4416/(-36) - -66). -8/3 What is ((-27)/102)/((-340)/1445)? 9/8 Evaluate 2502/21684 + -4 + (-17193)/(-4446). -1/57 ((-8)/16)/(143/12298) -43 216/(-8208) + ((-2380)/(-399))/5 7/6 Calculate 409489/(-19798317) - (-2)/198. -2/189 Calculate (-4256)/6384 - 2/(-22)8. 2/33 What is the value of 9 - (((-1341)/(-99) - 4/(-12)) + 4) - -9? 4/33 ((-4968)/(-37260))/((-1)/150) -20 Evaluate -42((-38786)/(-258) - 152). 70 What is -78((-4774)/10230)/((-42)/15)? -13 What is the value of 1 + (-5 - 33) + 1333 + -1432? -136 (370/(-105) + 4 + (-2)/14)/(380/(-40)) -2/57 (6069/187 - 26)/((-13)/143) -71 (163/(8802/162))/((-1)/17) -51 145/29(-21)/(-2450) 3/70 What is -27 + (2736/64 + -44)/(5/(-8))? -25 Evaluate (-21)/126 - (-10 - 4/((-48)/134)). -4/3 Calculate 592/(-4215) - 7254/(-1019187). -2/15 Evaluate ((-10)/4 - -1)(4/29)/((-23340)/(-293306)). -13/5 Calculate (-5 - 190/(-35))/(1929/126 + (-157)/(-471)). 2/73 Evaluate 22/3465-7 + ((-31296)/540 - 19). -77 What is the value of -6 - (164710/3439 - 2/(-4)(-12)/(-57))? -54 What is the value of 13 - (-440)/(-16) - 16/(-12)3? -21/2 What is ((-6)/(-105)-5)/(((-19)/56)/(10/(-40)))? -4/19 What is the value of 11/(-48 - (-244880)/5120)? -64 What is ((-6570)/225 - -20)/(4/(-90)3)? 69 What is the value of (234/27 - 10)(-7)/(-2)(-5040)/245? 96 Evaluate (-20)/((-72)/18)((-21)/(-5) - 3) + 75. 81 Calculate (-2)/((-33)/2314920/42). 3/5 Evaluate -30 - (-612636)/7125 - 56. -2/125 Calculate -125/(-45)(-315)/42(-63)/(-45). -14 What is (4/4 - -4)((-90307)/97)/49? -95 Evaluate (-62135/(-13950))/((-12)/(-1240)). 62 Evaluate ((-2471)/350 - (-7 - 0))(80/(-12))/(-5). -2/25 Evaluate 153/(-1) + (-14 - (-32 - -25)). -52 What is 16/40 - ((-3692)/195 + 13)? 19/3 What is the value of 56/(-68)35581/598? -49 What is (-2)/2316/32? -1/23 What is (7/42)/(1/((-160)/(-10) + -12))? 2/3 Evaluate (-1184)/(-48) + (1 - -19)/60. 25 Evaluate 120/680 - (-538)/34. 16 What is the value of ((-396)/(-1650))/(946/1075)? 3/11 Calculate 330/(-22)72/(-60)(-20)/(-165). 24/11 Calculate -15(1 - (5 - (9 - (-267)/(-55)))). -24/11 Calculate (22/(-10))/(1611/(-5370))(-27)/2. -99 Calculate 247/399((-2260)/1560 - 2/39). -13/14 What is 1/((-10)/4(13965/350)/(-57))? 4/7 What is the value of (558/(-12))/(-2(-7)/(-2) + 4692/552)? -31 Evaluate ((-6)/(-11))/(((-6)/(-5))/((-90090)/(-6825))). 6 What is the value of (28 - (-5376)/(-210))/(1/(-20)1)? -48 What is the value of (-7 + 32 - 22) + 865/(-173)? -2 Evaluate (((-27753)/15)/29 - 17) + (-18)/15. -82 Calculate 1440/(-96) - (655/(-30) + 5 - -2). -1/6 What is ((-26)/14 + 3)/(-5 - 666/(-126))? 4 2 + (-5595)/2100 - (-91)/130 1/28 Calculate (0 - 1)(-6 - (6102/57)/(-18)). 1/19 Evaluate (-2)/39(27 - 18 - (-480)/(-36)). 2/9 Evaluate (-43)/(-172)(1 - -8) + -2(-8085)/(-264). -59 What is (-1 + -13)1 + 4510/164? 27/2 What is the value of -2136(-1)/(-24) - -26? -63 What is the value of (-1 - 4)-2(-3)/(11/(-2) + 3)? 12 What is the value of (-61404)/(-1617) + -38 - 2238/(-1386)-39? -63 What is (-72)/(-182)((-1537)/212 + 5 + (-83)/(-12))? 24/13 (66/(-110))/(-1 - 9/12-2) -6/5 Calculate (638(-270)/(-783))/(-4). -55 What is the value of (-40409)/306 - 428/(-7704)? -132 What is ((-7542)/378 + 20)12 + (3 - (-157)/7)? 26 3 + 270/(-88) + ((-5000)/275 - -18) -1/4 Evaluate ((-2)/61)/(136/(-5690 + -22)). 14 Evaluate 2/((-3)/1 - (-1)/(-1))(-50 + 128). -39 Evaluate (90/33 - 3)/((-1)/(-5)(-140)/(-112)). -12/11 Calculate (-64)/((-1)/(38/133)) + -17. 9/7 What is -67 - (-75 + -31 - -34)? 5 What is the value of (-12)/((2 - 64/33)(781/(-44) + 20))? -88 Calculate (-3512)/(-28096)92/(-3). -23/6 Calculate 0 + 976/48 + 28/(-21). 19 Evaluate (21/9 + -1)(388/(-2328))/((-2)/(-4)). -4/9 (302 + -238)33/352 6 What is 51/(-39) - (-527 + 526)? -4/13 What is (-84040)/43385650(3/2 + (2 - 0))? -2/295 ((-6)/(-15))/(13/50700-26) -60 What is (909/(-135) + -6(-147)/630)-9? 48 Evaluate (1-6 + -1074/(-111))-63. -42 Calculate (-77 + 30807/441)/(1 - 188/168). 60 What is the value of (125 - 124)16/(-40)? -2/5 Evaluate (2/10)/((-150)/15150) - 18/10. -22 What is (((-21978)/370)/99)/(36/50)? -5/6 Evaluate (-4)/(-85)2365/(-946). -2/17 1 + 2/(-9) + 4620616/41544 112 What is the value of -38 + 13 + (1 - 4) + 45/(-5)? -37 Evaluate (84303/748)/57 - (-6)/((-72)/15). 8/11 Evaluate (-21795)/11624 + 22/(-48). -7/3 (-233)/((-32620)/2352)(-10)/(-6) 28 Evaluate 4/(-22 + 16 + (-3612)/(-147) - 18). 7 What is (-382)/(-4) + (-3458)/364? 86 ((-27)/((-12150)/(-40)))/((-162)/45) 2/81 Evaluate ((-132)/(-72))/(220/(-60)). -1/2 Calculate (29260/(-275) - -108)*-55. -88 What	{ "pile_set_name": "DM Mathematics" }
. Let h be (1/w + 2)-3. Determine m(h). 8 Let p(g) = -g - 3. Let r be (-4)/14 - (-95)/(-35). Let w(s) = -s2 - s. Let c be w(r). What is p(c)? 3 Let t = 193 + -192. Let u(n) = -11n3 - n2 - n + 1. Calculate u(t). -12 Let g(a) = 2a. Let y be 1/(-2) + 63/14. What is g(y)? 8 Suppose 0t = 3t + 15. Let a(k) be the first derivative of -3k*2 + 3k2 + k2 + 7k + 2. Give a(t). -3 Suppose 2 - 8 = -3h. Let t(g) = -hg - 3g - g*2 - g + 3g2. Calculate t(4). 8 Let s(u) = u2 - u. Suppose -5n - 16 = 3n. Give s(n). 6 Suppose -26 = -9n + 4n - 2f, -20 = -2n - 4f. Let a(j) = 34 - 34 - nj. What is a(-2)? 8 Let n = 0 + 3. Let q(p) = 2p - n + 1 - p. Let v(d) = 2d - 1. Let a(w) = -2q(w) + 3v(w). Give a(2). 9 Let z(l) = -l + 2. Let t be 130/14 + 6/(-21). Let a(s) = s*3 - 6s*2 + 6s + 3. Let g be a(5). Let d = t - g. Determine z(d). 1 Let j(p) be the third derivative of -p*4/24 + 4p3/3 + p2. Let k(f) = f*2 + 4f - 6. Let m be k(-6). Determine j(m). 2 Suppose 4q = 4t + 20, 29 - 13 = 2q + 4t. Let d be (6/(-4))/(3/q). Let k be -3(2 + 1/d). Let u(m) = -2m - 6. Calculate u(k). 4 Let a(t) = 10t. Let z(u) = 31u + 3. Let g(k) = -31k - 2. Let s(o) = -4g(o) - 3z(o). Let f(l) = 7a(l) - 2s(l). What is f(-2)? -14 Suppose -5c = -5a + 30, 2c = -2a - 3c - 2. Let b(p) be the first derivative of -p*3/3 + 2p*2 + p - 3. Determine b(a). 1 Suppose 5n = 7n - 4. Let d(u) be the third derivative of -2u*n + 0u*4 - 1/60u*5 + 0u + 1/3u3 + 0. Give d(-2). -2 Suppose 3 = 3y - l - 14, l + 21 = 4y. Let q(u) = -u3 + 4u*2 - 5. Let i be q(y). Let t(b) = 2b + 4. Give t(i). -6 Let a(p) = p*2 + 5p + 4. Let f(j) = -j*3 - 5j*2 - 5j - 10. Let q be f(-4). Calculate a(q). 10 Suppose -3d - 1 = 3u - 4u, 0 = -4d - 3u + 16. Let s(f) be the second derivative of -f5/5 + f4/12 + f3/6 - f2/2 - 3f. Determine s(d). -3 Let t(n) be the first derivative of n3/3 + n2/2 - n + 3. Suppose -v - 3 = 2v. Let q = v - 0. Determine t(q). -1 Let d(a) = a3 + 4a - 2. Let b(k) = -k*3 - 3k + 2. Let j(g) = 4b(g) + 3d(g). Let y = -4 + 1. Let n(h) = -h - 3. Let q be n(y). What is j(q)? 2 Let i = -212 - -207. Let l(r) = 2r. Determine l(i). -10 Let m(x) be the second derivative of x5/20 + x3/6 + 2x*2 - 31x. What is m(0)? 4 Let h(x) = -x*3 + 19x*2 - 5. Let t be h(19). Let w(f) = 2 + f - 2. Give w(t). -5 Let i(m) be the first derivative of 0m + m*3 - 2m + 1 + 0m3. Let p(s) = s3 + 20s*2 + 19s - 2. Let n be p(-19). Give i(n). 10 Let y(t) be the first derivative of -t4/4 + t3 + t + 17. What is y(3)? 1 Let r = -1 + -6. Let f = 3 - 7. Let j = f - r. Let v(q) = q*3 - 5q*2 + 4q - 2. Give v(j). -8 Let n = 1 - 1. Let u(h) = 2h - 3h + 0 + nh2 + 2 + 2h*2. Let c be 8/3 + 2/(-3). Calculate u(c). 8 Let p(l) = l + 7. Suppose g = 6g - 4d + 38, 4g + 34 = 5d. What is p(g)? 1 Let m(n) = n3 + 4n*2 + 3n - 2. Let z be m(-3). Let a(o) be the third derivative of o5/30 - o3/3 + o2. Determine a(z). 6 Let x(a) = -a2 + 10a - 11. Let l be x(8). Let n(z) be the second derivative of 0 + 1/6z*4 + 2z + 0z2 - 1/3z*3 + 1/10z*l. Give n(-2). -4 Let l be (-8 - 0)(4 + -5). Let r(q) = -8q3 - q2 + 4q*3 - lq*3. What is r(-1)? 11 Let s(h) = -h + 1. Let n be s(-1). Suppose 13 = -3r - n. Let t(j) = j*3 + 4j*2 - 3j + 6. Give t(r). -4 Suppose 15q - 14q - 2 = 0. Let c(l) = -4l2 + 4l*q + 2l2 - 8 - l2 + 5l. What is c(-7)? 6 Let z(u) = -u2 + u - 9. Let w be z(0). Let r = 11 + w. Let l(p) = -p2 + 1. Give l(r). -3 Let l(p) = -3p - p2 + 21 - 34 + 21. Give l(-6). -10 Let w = 1 - 4. Let t(m) = -m3 - 3m2 - 2m + 3. Determine t(w). 9 Let k = 15 - 21. Let v(d) = -d + 0d + 0d + 1. What is v(k)? 7 Let q(p) be the first derivative of p4/4 + p3 - 2p2 - 2p + 10. Let s(h) = h*3 - 8h*2 + 8h - 5. Let l be s(7). Suppose -v = lv + 12. Calculate q(v). -2 Let g(s) be the second derivative of 5/6s*3 - s + 0 + 5/2s*2 - 1/12s*4. Determine g(4). 9 Suppose 2z - 1 = x + 5, -2x + 4 = 4z. Let p = -2 - z. Let q(r) = r*3 + 5r*2 + 2r - 4. Determine q(p). 4 Suppose 0 = 4s, 4g - 5s + 8 = -4. Let p(m) be the third derivative of m4/8 + m3/3 - m2. What is p(g)? -7 Let w(q) = -2q*3 - 4q*2 + 11q + 5. Let v(s) = s*3 + 2s*2 - 5s - 2. Let y(n) = 5v(n) + 2w(n). Determine y(-3). 0 Let s(j) be the third derivative of -j4/12 + j2. Let h = 14 + -11. Suppose -4o + 14 = r - 3, hr - 1 = -2o. Give s(r). 6 Let v(i) = -i2 + 195i - 189i + 7 + 0i*2. Determine v(7). 0 Let d(x) be the third derivative of 1/120x6 + x2 + 0x + 0 - 1/10x*5 + 1/6x*4 + 5/6x*3. Let z be 20/(-4)(-2 + 1). Give d(z). 0 Let r(x) = -3x - 1. Let n(o) = 5o + 3. Let t(y) = -2n(y) - 5r(y). Suppose 183b = 189b + 6. Give t(b). -6 Let o(t) be the first derivative of -11t4/4 + t3/3 + t2/2 - t - 5. Determine o(1). -10 Let p(b) = -4b*2 - 2b + 1. Suppose 5i - 35 = 5x, -16 = 3x - 2i - 0i. Give p(x). -11 Let g be (-3)/(2(-2)/4). Let c(a) = -2a2 + 3 - ag + 0 - 5a - 3a2 - 2. Give c(-4). 5 Let q(i) be the third derivative of -i5/20 + i4/24 - 13i*2. Determine q(-1). -4 Let d(g) = 2g*2 + 7g2 - g - g2. Let v(z) = -4z - 35. Let w be v(-9). Determine d(w). 7 Suppose 0 = -7v + 2v + 25. Suppose 2z - i = 10, -3 = 3i + 3. Let p(b) = -b2 - 4 + zb + 4 - 1. Calculate p(v). -6 Let c(r) = -r*2 - 2r - 1 + r3 - r2 - r*2 + 0. Determine c(3). -7 Let d be 3/(3/(-4)) - 1. Let n = -5 - d. Suppose c - 3i = n, -5c = 5i + 28 - 8. Let z(x) = x*3 + 2x2 - x + 3. What is z(c)? -3 Let t be (1 + (-3)/5)/((-5)/25). Let y(a) = a + 4. Give y(t). 2 Let a(y) = -y3 - 8y2 - 6y + 6. Suppose 3k + 3 + 2 = f, -5k - 12 = 2f. Let j(l) = 8l*3 - 2l - 1. Let s be j(f). What is a(s)? -1 Let j(d) = -5d - 9d*2 + 2 + 12d2 + 0. Give j(3). 14 Let k(b) = -b3 - 5b2 - 7. Suppose -3q + 6q = 12. Suppose -x = -5x - q. Let d be (-1)/(x - (-12)/10). Determine k(d). -7 Let z(w) = 4w2 + 3w - 1 - 4 - 8w2 + 2w*3 - 3w*3. Determine z(-5). 5 Let x(v) = -6v*2 + 6v - 1. Let d(k) = 5k2 - 5k. Let a(m) = -5d(m) - 4x(m). Let f(w) = 0w + 0 - 4 - w. Let p be f(-8). Calculate a(p). -8 Let x(g) = 5. Let d(b) = b - 20. Let w(t) = 2d(t) + 9x(t). Determine w(7). 19 Let v be -2 + (-118)/120 + 3. Let s(f) be the third derivative of 2/3f*3 + 1/12f*4 + 0f + 0 + f*2 - vf*5. What is s(4)? -4 Let h(l) = -431l - 1 + 431l + 4l2. Determine h(1). 3 Let a(d) be the first derivative of -d5/120 + d*4/12 + 2d*3/3 + 1. Let q(t) be the third derivative of a(t). Determine q(4). -2 Let b(o) = 3o3 + o2 - 3o - 2. Let y be b(-2). Let x = -16 - y. Let l(h) = h - 13. Give l(x). -13 Let q(t) be the first derivative of -3t*2 + t + 2. Determine q(1). -5 Let s = 8 + -8. Suppose s = -i - 0i. Let r(b) = b3 - b2 + b + 4. Determine r(i). 4 Let w(p) = -p - 13. Let d = 5 + 7. Suppose v - 3v - d = 0. What is w(v)? -7 Let j(s) = -23 + 23 + 25s. Let r(l) = 2l. Let h(c) = 3j(c) - 40r(c). Calculate h(3). -15 Let y(a) = -3a + 3. Let p(v) = v - 1. Let o(l) = 4p(l) + y(l). Determine o(-9). -10 Let p(c) = -2c3 - c2 + 4c + 5. Let x(l) = -l3 - l2 + 3l + 5. Let v(t) = -2p(t) + 3x(t). Give v(0). 5 Let q(x) be the first derivative of x*3/3 + 4x + 1. Let f be -2 - (1 + -13)/2. Suppose -2p = -y - 8, 4 = 4y + fp - 3p. Calculate q(y). 4 Let p(x) = -4 + 1 + 0 - x. Let m be -7 - (-2 - (3 - 6) - 2). Calculate p(m). 3 Let x(b) = 2b - b + 2 - 3. Let o(s) = -3s. Let n(y) = o(y) + 2x(y). What is n(-1)? -1 Let z(o) = -o2 - o - 1. Let n(m) = m2 - 4m - 5. Let u(r) = -3r2 + 11r + 14. Let q(s) = -11n(s) - 4u(s). Let y(h) = -q(h) + z(h). What is y(-2)? -6 Let o(p) = -p*2 - 5p + 3. Let k(h) = -4h. Let g be k(-1). Suppose a + ga + 25 = 0. Give o(a). 3 Let w(g) = -2g - 1 + 5 + g2 - 3g*2 - 2. Determine w(-2). -2 Let i(u) = -5u*3 + 7u*2 - 14u + 5. Let f(y) = 4y3 - 7y*2 + 13y - 5. Let p(l) = 6f(l) + 5i(l). Give p(-8). -5 Let g(h) = h*2 + 4h + 2. Let z = 9 - 1. Suppose 2a - 10 = -2x, 3a + 3x - 39 = zx. Let y be (-3)/(-12) + (-26)/a. Determine g(y). -1 Let b = 101 - 98. Let w(y) = 3y - 2. Determine w(b). 7 Let g be 4/(-6)*(-6)/2. Let r(v)	{ "pile_set_name": "DM Mathematics" }
o - 403. Calculate -6c(g) - 403d(g). -31g Let a = 8 + -6. Let z(f) = 4 - 2f - 4 - f*3 + 0f + f*2 - a. Let u(k) = -3k*3 + 4k*2 - 7k - 7. Give -2u(o) + 7z(o). -o3 - o2 Let n(f) = -6f3 + 5f*2 + 36f. Let k(r) = 4r3 - 3r*2 - 24r. What is 8k(s) + 5n(s)? 2s3 + s2 - 12s Let z(w) = 52w3 + 5. Let j(x) = 1457x*3 + 141. Give 5j(g) - 141z(g). -47g*3 Let q(y) = 28y*3 + 11y*2 - 17y + 13. Let u(c) = 14c3 + 5c*2 - 8c + 6. Determine 6q(t) - 13u(t). -14t3 + t2 + 2t Let o = 8 + -5. Suppose 0 = -0h - 3h + o. Let n(t) = -3t + 6. Let z(r) = 1. Calculate hn(g) - 6z(g). -3g Let h(r) = -5r. Let g(f) = f2 + 4. Let z(a) = -a - 10. Let k be z(-10). Let u be g(k). Let n(m) = 6m. Let y = -4 + 7. What is uh(q) + yn(q)? -2q Let o(j) = 2 - 5 + 3 - 6j*2. Let y(s) = 6s*2 + 5s. Let q(u) = -7u2 - 6u. Let g(d) = 5q(d) + 6y(d). What is -16g(v) - 3o(v)? 2v2 Let b(v) = v2 + v - 1. Let p(z) = z3 - z2 - 3z + 5. Suppose 5x + 4j - 11 = 0, 4 = 3x - 5j - 10. Give xb(t) + p(t). t3 + 2t2 + 2 Let v(a) be the third derivative of a4/6 + 7a3/6 - a2. Let x(s) = -11s - 3. Let w(u) = -14u - 4. Let y(j) = -4w(j) + 5x(j). Determine v(n) - 6y(n). -2n + 1 Let y(t) = 4t. Let w(h) be the third derivative of -h4/24 - h2. Let b = -43 + 34. What is bw(u) - 2y(u)? u Let h(y) = -2y3 - 3y*2 - 2y. Let j(s) = -s + 11. Let q be j(9). Let z(g) = -2g - 2g*2 - 3g3 + g3 + g*3. What is qh(m) - 3z(m)? -m3 + 2m Let k(g) = -g*3 + 2g2. Let a(q) = q3 + 7q2 + 5q - 3. Let o be a(-6). Let l(y) = -y*3 - 5y*o + 11y*2 - 2y*3 + 3y*3. Give -33k(f) + 6l(f). 3f*3 Let z(v) = 1. Let l(i) = 6i*2 + i + 1. Calculate -l(o) + 3z(o). -6o2 - o + 2 Let a(g) = 4g + 4. Let n(k) = -1. Give a(p) + 5n(p). 4p - 1 Suppose 0 = -4v - 3g - 19, -3g + 3 = -3v - 6. Let s(k) = -8k2 + 11k - 11. Let w(b) = 3b2 - 4b + 4. Determine vs(h) - 11w(h). -h2 Let s(u) be the first derivative of -u4/4 + 2u3/3 - u2/2 - u + 2. Let q be (-9)/6-4 + -4. Let p(h) = h*2 - h - 1. Determine qp(o) - s(o). o*3 - o - 1 Suppose 6 = -r + 3. Let i be 2/(1/9r). Let p(d) = -d + 4. Let f(w) = -3w + 11. Calculate if(x) + 17p(x). x + 2 Let i(g) = -g - 4. Let j(d) = -d - 4. Let h(u) = 6i(u) - 5j(u). Let f(z) = z + 3. Give 6f(v) + 4h(v). 2v + 2 Let p be 0 + 1/((-2)/30). Let h = -11 - p. Let i(v) = 6v2 - v - 2. Let l(y) = -y2. What is hl(b) + i(b)? 2b2 - b - 2 Let l(q) be the first derivative of -5q*2 - 10q - 19. Let b(s) = s - 1. Let k(t) = 5t + 1. Let a(u) = 2b(u) - k(u). Give -7a(n) + 2l(n). n + 1 Let m be 3(2/(-2) - 1). Let i = m + 8. Let n be (i/2)/((-4)/20). Let f(j) = -j3 - j2 - j + 1. Let b(w) = 6w*3 + 5w*2 + 4w - 6. Give nf(p) - b(p). -p3 + p + 1 Let f(g) = -3g*2 - 3g - 7. Let q = 2 - 8. Let r(u) = 2u2 + 2u + 4. Calculate qf(y) - 10r(y). -2y2 - 2y + 2 Let o(u) = u - 15. Let h be o(12). Let c be (-8)/(-6)9/6. Let a(x) = -cx*3 + 6x*2 + 3 + 4x3 + x2. Let i(w) = -w*3 - 3w*2 - 1. Give ha(j) - 7i(j). j3 - 2 Let b(i) = -i + 1. Let a(u) = -u. Calculate 5a(y) - b(y). -4y - 1 Let q(o) = 4o*2 - 6o - 3. Let m(h) = 3h2 - 7h - 2. Calculate 3m(k) - 2q(k). k*2 - 9k Let h(i) = -31i2. Let v(c) = 108c*2. Give 18h(n) + 5v(n). -18n*2 Let w(o) = o + 1. Suppose 8v - 10v = -y - 10, 4 = 4v + 2y. Let m(q) = -q + 1. What is vm(f) + w(f)? -2f + 4 Let p(y) = -y + 1. Let s(c) = -22 + 24 + 20c - 22 - 5c2. What is 20p(d) + s(d)? -5d2 Let m(h) = 3h + 22. Let i(o) = -4o - 21. What is 2i(f) + 3m(f)? f + 24 Let t(f) = 8f + 5. Let d = 6 + 2. Let u(i) = -26i - d + i + 2i - 6. Calculate 17t(m) + 6u(m). -2m + 1 Let b(k) be the third derivative of -7k*4/24 + 5k*3/6 - 9k*2. Let l(d) = -6d. Let j(g) = 1. Let a(o) = 4j(o) + l(o). What is 5a(z) - 4b(z)? -2z Let z(c) = -c*3 + 7c*2 - 7c. Let h be z(6). Let l(p) = -p3 - p2 - p - 1. Let o(m) = 6m + 6 - 3m*3 + 8m*3 + 6m*2 + 1. What is hl(y) - o(y)? y*3 - 1 Suppose 0 = -3m + 27 - 9. Let u(f) = -5f2 - 7f - 6. Let d(h) = 9h2 + 13h + 11. Let b = -20 - -31. Give bu(s) + md(s). -s*2 + s Suppose -7 + 27 = -4f. Let y(r) = -r + r2 - 1 + 1. Let o(z) = -z2 - 3z2 - 4z + 6z - 2 + 3z. Give fy(k) - o(k). -k2 + 2 Let w(r) = -r3 - 3r*2 + 3r - 3. Let f(k) = -2k3 - 5k*2 + 5k - 5. Let l = 64 - 58. Determine lf(h) - 10w(h). -2h3 Suppose 9a - 31a - 132 = 0. Suppose 2s = 2, -4q + 1 = -3q - s. Let c(o) = 0o - 1 + o - oq - 4. Let m(z) = -3z*2 + 3z - 14. What is am(j) + 17c(j)? j*2 - j - 1 Let j(i) = -i + 1. Suppose 3w = 7w - 4. Let m(u) = 4. Calculate wm(o) - 2j(o). 2o + 2 Suppose -5j - 3f - 27 = 2, -10 = -5f. Let x be -1 + 1 - j/(-1). Let d(w) = w - 2. Let t(l) = l - 2. Give xt(v) + 6d(v). -v + 2 Let f(u) = -4u - 1. Let o(h) = h - 1. Calculate f(l) - o(l). -5l Let t(m) = 2m + 10. Let s be 6/10 - (-2)/5. Suppose 0r - 4r - 28 = 3l, -2r = -5l - 64. Let i(y) = 1. Determine li(b) + st(b). 2b - 2 Let p(k) = -2k3 + 2k. Let z be -4 + 4 - (-4)/(-2). Let s(a) = -a + 4a3 + 1 - 6a + 2a. Calculate zs(d) - 5p(d). 2d*3 - 2 Let z(g) = -4g*2 - 3g - 4. Let u(l) = -3l2 - 2l - 3. Let d be (-1)/(-5) - 117/(-15). Let b = d - 12. What is bz(w) + 5u(w)? w*2 + 2w + 1 Let z(o) = 7o3 + 7o + 9. Let h(c) be the first derivative of c*4 + 2c*2 + 5c - 21. What is -11h(q) + 6z(q)? -2q3 - 2q - 1 Let w be -6 + (0 - -1 - 0). Let p(c) = -c. Let s(z) = -z2 + z - 1. Let f(y) = y3 + 6y2 - 11y + 7. Let b(q) = -f(q) - 6s(q). Calculate wp(h) - b(h). h3 + 1 Let g(m) = m2 - 4. Let n be g(0). Let j(v) be the second derivative of -v*4/6 + 2v*3/3 + 69v. Let u(o) = 2o2 - 5o. Determine nu(c) - 5j(c). 2c2 Let r(s) = 5s*3 + 6s. Let i(o) = 4o3 + 5o. Let w(u) = -13u2 - 1. Let f be w(-1). Let b = 8 + f. Let g be (3/b)/(1/10). What is gr(n) + 6i(n)? -n3 Let h(p) = -p + 0p + p*2 + 0p - 1. Let a be -23(-10)/12. Let v(j) = -7j2 + 4j + 5. Determine ah(x) + v(x). -2x*2 - x Let i(r) = 15r - 11. Let y(x) = 3x - 2. What is -2i(d) + 11y(d)? 3d Let w(x) = x*2 - 5. Let v be w(-2). Let g(a) = -5a - 3. Let s(r) = -r - 1. Let p(l) = -l*3 + 4l*2 - 2l. Let j be p(2). What is js(t) + vg(t)? t - 1 Suppose 1 - 15 = 4b + 5n, -3n - 7 = b. Let i(v) = -v + 1. Let t(s) = -1. What is bi(q) - 3t(q)? q + 2 Let s(c) = 17c - 1. Let u(d) = 84d - 5. Determine -11s(l) + 2u(l). -19l + 1 Let y(g) = -2g3 - 3g*2 + 8g + 3. Let v(l) = -l*3 - 2l*2 + 9l + 2. Determine 3v(o) - 2y(o). o*3 + 11o Let s(m) = -2m - 6. Let z(b) = -b + 8. Let d be z(8). Let u = 1 - d. Let c(l) = 1 + u - 3. What is -6c(h) + s(h)? -2h Let i(q) = 4q - 6. Let j(b) = 12b - 20. Let c(u) = -10i(u) + 3j(u). Let r(h) = -h. What is -c(l) + 3r(l)? l Let w(b) = -4b2 + 4b + 4. Let l(k) = -k - 1. What is 4l(q) + w(q)? -4q*2 Let j(w) = -10w*2 - 5w. Let m(u) = 4u + 18u*2 - 33u*2 + 15u*2 + 9u*2. Give -4j(v) - 5m(v). -5v2 Let j(p) = -p - 1. Let n = -91 + 85. Let i(z) = z3 - 2z - 2. What is nj(x) + 3i(x)? 3x*3 Let c(w) = 324w*2 + 27w - 27. Let d(z) = -25z2 - 2z + 2. Determine -2c(g) - 27d(g). 27g2 Let m(r) = 10r*3. Let b(o) be the second derivative of -7o*5/20 - 30o. Determine 8b(f) + 5m(f). -6f3 Let g(i) = i2 + i - 1. Let x(a) = -5a*2 - 10a + 9. Calculate 6g(q) + x(q). q2 - 4q + 3 Let t(l) = 37l - 1. Let g(n) = -185n + 6. Give 2g(h) + 11t(h). 37h + 1 Let t(u) = u3 - 11u*2 + 11u - 14. Let j be t(10). Let y(d) = -3d3 - 11d*2 - 17d + 8. Let g(n) = -n*3 - 4n*2 - 6n + 3. Give jy(k) + 11g(k). k*3 + 2k + 1 Let c(y) = 5y3 + 5y*2 + 9y - 11. Let i(n) = -2n3 - 2n*2 - 4n + 5. Calculate -4c(w) - 9i(w). -2w3 - 2w*2 - 1 Let a(f) = -5f*2 + 21. Let q(u) = 4u*2 - 21. Determine -3a(m) - 4q(m). -m2 + 21 Let k be 5 + 4 + -18 + -2. Let m(a) = 7a*3 + 6. Let b(i) = 13i*3 + 11. What is km(x) + 6b(x)? x3 Let z(p) = 4p - 6. Suppose -3m = 4j + 13, 0 = -3m + 5m + 4j + 14. Let d(s) = s - 1. Give mz(g) - 5d(g). -g - 1 Let w(q) = 10q*3 - 4q*2 - 4q + 1. Let x(v) = -v3 + v2 + v -	{ "pile_set_name": "DM Mathematics" }
+ 69 - 41, -3q - 5m - 11 = -6 for q. -5 Solve 4i + 2n = -32, 4i - 202n + 68 = -207n for i. -2 Solve 0 = -j + 2g - 9, 4j - 241 + 272 = 3g for j. -7 Solve -3x - 1 = 4y, -5x + 334 = 8y + 341 for y. -4 Solve -104 = -2x - 7i, -5x + 14261 = -2i + 14313 for x. -4 Solve -26s + 25s + 4a = 5, 0 = 2s + 5a - 29 for s. 7 Solve -2r + 5z + 57 = 0, 68r - 5z = 65r + 78 for r. 21 Solve 4c - 2p = -22, 469c + p = 476c + 41 for c. -6 Solve 5z + 15 = -3i, 564i - 559i - 9 = 3z for z. -3 Solve 3x = 2a + 8, 11a + 9 = 87x - 88x for a. -1 Solve -q = -2k - 17, -q = -3k - 161 + 137 for k. -7 Solve 5a + 4u = 10, 902u = 5a + 901u + 15 for a. -2 Solve 4v = -12y - 92, -118v - 58 = -4y - 113v for y. -3 Solve 0 = -2v - 2d + 6, 2355 - 2364 = -3v - d for v. 3 Solve -4s + 5c = 0, -10 - 12 = -2s + 6c - 9c for s. 5 Solve -101w + 5p = -99w - 16, -24 = 4w + 4p for w. -2 Solve -3x - 4 = -2f - x, 0 = -2f + 3x + 5 for f. 1 Solve -w - r = 4, 3r - 47710 = -47719 for w. -1 Solve -25 = 2a + 4k - 71, 0 = -4a + 5k - 25 for a. 5 Solve -k - 87l - 1 = -85l, k + 5 = 2l for k. -3 Solve 0 = i - 3j + 8, -10i + 5i = 4j + 2 for i. -2 Solve h + 1 = 0, -23p + 22p = 2h + 1 for p. 1 Solve -g - 21h + 20h - 5 = 0, 2g + 3h + 13 = 0 for g. -2 Solve -2d + 5 = -3v, 3v = 8d - 47 + 18 for v. 1 Solve 11t = i + 37, t + i - 3i - 11 = 0 for t. 3 Solve 2818 = 5v - 0v + f + 2839, 2f = -v + 3 for v. -5 Solve -5k = 10o - 20, -1071o - 2 = -1069o for k. 6 Solve 4r - 42 = 3c, -3r - 4948c = -4946c + 28 for r. 0 Solve 4j = -h - 1, -77 = 5h - j - 72 for h. -1 Solve 0 = -9w - 5o - 91, -3o = w + 1999 - 1984 for w. -9 Solve -2a + 2505l = 2510l - 11, l - 10 = -3a for a. 3 Solve -4f + 4y + 16 = 0, -5f - 17y - 955 = -975 for f. 4 Solve -2 = -3u - t, 17u - 13u = 2t - 14 for u. -1 Solve -5c - 880t = -885t + 10, 5 = -2c + 3t for c. -1 Solve -5z + 3w + 8 = 0, 5z + 28w - 6 = 29w for z. 1 Solve -5m + 3v - 5412 + 5399 = 0, -2m - 7v - 38 = 0 for m. -5 Solve -4f + 19 = 3d, -3d = -f + 25 - 54 for f. -2 Solve 2o = 4b + 22 - 36, 0 = o + 5 for b. 1 Solve 5q = 5l - 80, 31508l - 31505l - 44 = 2q for l. 12 Solve o - 53 = 5x, -55 = -12x + 17x for o. -2 Solve -17v = -18v - 2d, 5v - 12 = 2d for v. 2 Solve -8 = -2s, 2l - 313s - 28 = -318s for l. 4 Solve 3q + 36 - 11 = -17u, 0 = 4u - 3q + 459 - 442 for u. -2 Solve 40 = 298q - 294q - 4y, 0 = 2q - 3y - 29 for q. 1 Solve 0 = 10x - 14x + 5w - 7, 14 = 4x + 2w for x. 2 Solve -282 = 98r - 3b, 4r - 4b + 2b = -5 + 1 for r. -3 Solve -27 = 6j - 3j - 5z, -j - 31 = -9z for j. -4 Solve 0 = -3x + 2h - 93, 5x - 2h + 185 - 34 = 0 for x. -29 Solve -4u = 0, -21u = 2d - 25u - 8 for d. 4 Solve 0 = q - 2x - 67 + 79, 4q + x + 12 = 0 for q. -4 Solve 5i - 2i = -10d, 3d = -d + 3i - 42 for d. -3 Solve 0 = -5z - 4r + 5, 12r + 19 = 2z + 17r for z. -3 Solve 5i = 5s, -4s - 2i + 32 = 2i for s. 4 Solve -180p = -173p - 5m - 64, -38 = -5p + m for p. 7 Solve 8s - 7s + n = 5, -3n = s - 3 for s. 6 Solve -5g = 3x - 108, 0 = 4x + 5g + 264 - 373 for x. 1 Solve -b = 2u - 923 + 933, 0 = 2u + 6 for b. -4 Solve f - 2328 = 3a - 2371, 5a - 49 = -4f for f. -4 Solve 2829w = 2826w + 3y + 33, -7 = -2w - y for w. 6 Solve -2x + 27 = -4c + 1, x + 15 = -5c for c. -4 Solve -5b + c + 38 - 36 = 0, 4b = -c + 7 for b. 1 Solve 4m = a - 0a, -3m + 22 = -116a + 118a for m. 2 Solve -7f + x + 220 = 199, 15 = 4f - x for f. 2 Solve x - 14y + 33 - 112 = 0, -2y - 12 = 0 for x. -5 Solve -w - 5c + 174 = 161, 25 = 5w + 5c for w. 3 Solve 5x - 11 = -2t, 3x - 956t - 1 = -958t for x. 5 Solve -33 = 2u - 6u + 3b, 2b = 5u - 22 for u. 0 Solve 4d + 99 = -5m + 94, -25 = -5m + 2d for m. 3 Solve 5887v - 5884v = -s - 15, 4s - 18 = v for v. -6 Solve 0 = -5w + 2y - 516 + 510, -4y = -w + 6 for w. -2 Solve -5h + 5f + 45 = 0, 2f - 17 = h - 31 for h. 4 Solve -k - t = 1, -3k - 4t - 1635 = -1633 for k. -2 Solve -5k = -5b + 60, -b = -19k + 22k for b. 9 Solve -w = -3m - 2, 2m + 3w - 40 + 45 = 0 for m. -1 Solve -2q + 2 = -3b, 5b + 79 - 55 = -7q for b. -2 Solve o + o = 2f + 8, -197o + 25 = -192o for f. 1 Solve 3p - 4 = -4b, -4p + 2b + 62 - 42 = 0 for p. 4 Solve 6w = 12, 53w - 31 = -5l + 50w for l. 5 Solve 136r = -s + 141r - 25, -2s - 18 = -2r for s. -5 Solve 3p = 6n + 24, 3p - 91n - 22 = -86n for p. 4 Solve 0 = -4c + 5x - 60 + 69, -5c = 3x - 2 for c. 1 Solve 2r - 133 = 5a - 33, 2a + 39 = r for r. -5 Solve 2v + 1 = -m, -4108v - m + 1 = -4105v for v. 2 Solve 2r - 4g - 16 = 0, 0 = 2g - 3g - g for r. 8 Solve -6 = -3t + 2a, -t - 3a = 4t + 47 for t. -4 Solve 6x + 36 = 2c, -18x + 30 = -c - 23x for c. 0 Solve 157x = 160x + 2i + 13, -5x + i - 26 = 0 for x. -5 Solve -14s - 70 = 2i - 19s + 2, 80 = 5s for i. 4 Solve -4p + 11 = -9x - 11, -x - 7 = -5p for x. -2 Solve 2r = 5q + 10, -3q + 8q = 3q - 4 for r. 0 Solve 5a = 5t + 10, 9a - 5t - 6 = 6a for a. 2 Solve -883 = -2o - 3v - 911, -2o - 5v - 52 = 0 for o. 4 Solve -8n + 14n + 3r = 21, 5n - 40 = 5r for n. 5 Solve 3d = -4g - 15, -23d - 4g = -22d + 13 for d. -1 Solve -2x - 18 = 2t - 30, 15 = -t + 4t for x. 1 Solve -3q + 7 = -l, 8q + 14 = 10q - 3l for q. 1 Solve 93m - 88m - 50 = 5j, -9j = -2m + 90 for m. 0 Solve -21 = 3a - 3p, 3a + 3017 - 2990 = 5p for a. -4 Solve -4t = -0t - 2v + 44, -4v = -4130t + 4128t - 22 for t. -11 Solve 5p + 11o = 62 - 8, 17p + 2o - 42 = 0 for p. 2 Solve 3j = 2p + 64, -3p + 17 = j + 3 for p. -2 Solve -397x + 395x - 12 = 2w, 24 = -5w + x for w. -5 Solve -4o + 4s = 132, -5o = -14s + 16s + 200 for o. -38 Solve 5z + 4c = -28, -c = 22z - 18z + 18 for z. -4 Solve -5k + 316 = 2f + 298, 4 = 2k for f. 4 Solve 5b - 12m + 5 = 7, -m + 7 = -4b for b. -2 Solve -5g = 15, g - 22 + 15 = 5k for k. -2 Solve 326d - 653d = -326d + 5, 3s = -2d + 20 for s. 10 Solve h - 4 = 38p - 39p, -4h + 13 = 3p for p. 3 Solve 12x + 22x - 65 - 111 = 3s, 5x + 20 = 9x for s. -2 Solve 5u = -20, 4u + 14 = -2t - u for t. 3 Solve 4s - 2i = 7s - 22, -5s + 38 = 4i for s. 6 Solve 8 = -4a, 5j + 726 - 717 = -2a for j. -1 Solve -5n + 6z - 5z = -2, -2n + z - 1 = 0 for n. 1 Solve 4r - 90 = 5j + 5r, 18r + 155 = -13r for j. -17 Solve 103c - 3s - 6 = 91c, 0s - 8 = 4s for c. 0 Solve -63p = -64p - 4a - 22, 3a = 2p - 11 for p. -2 Solve 4g = -5v + 50, -3v + 28 = -3g + 5g for v. 6 Solve 5y - 5x = -30, 463 = 5y - 3x + 489 for y. -4 Solve i - 19 = 2d - 16, -d - 94 = 18i for d. -4 Solve 37x + 2 = 36x, 4u + 5x = -10 for u. 0 Solve -3w + 31 = -2d, 0 = -27d + 22d + 17w - 87 for d. -14 Solve -5t - 227i - 40 = -222i, i - 31 = 2t for t. -13 Solve 136x + 5k + 20 = 138x, x + 29 = -4k for x. -5 Solve -4a + 33 = -29y + 30y, 5a = -4y + 55 for a. 7 Solve 3g - 76p = -81p, 2g - 2p = 16 for g. 5 Solve 2z = -4g + 16, -14g - 42z + 60 = -37z for g. 5 Solve 0 = 4d + 2n - 18, -31d + 148 = -2d - 3n for d. 5 Solve 5b = -5u - 10, -3329u + 3326u = -2b + 16 for u. -4 Solve -h + 4d = 12, -81h + 79h - 12 = -4d for h. 0 Solve 5s + 5y = 30, -2y - 43 = -2s - 51 for s. 1 Solve -16 = -13l - q, -12 = -3l - 3623q + 3620q for l. 1 Solve -8i + 4p + 32 = -0i, -22 = -4i + 5p for i. 3 Solve 0 = 3l + 3b + 202 - 163, -2b - 34 = 3l for l. -8 Solve 18a + 4f + 31 = 23a, -5f = -3a + 29 for a. 3 Solve -2h - 11 = -75f + 76f, -f - 3h - 16 = 0 for f. -1 Solve b + 450 = 5g + 429, 5b = -3g + 35 for b. 4 Solve -723l - 72 = -711l, -2m = 5l + 4 + 36 for m. -5 Solve -4j - 70 = 2f, 0 = -41f - j - 23 + 46 for f. 1 Solve -5o - 23 = 4x + 67, -o - 4x - 82 = 0 for o. -2 Solve -3q - 4 = -5a, -2q - 2a = -93 + 69 for q. 7 Solve 6 = -3n + y, -14y + 15y + 20 = -10n - 2y for n. -2 Solve -67 + 80 = -3j + h, 3h = -3j + 3 for j. -3 Solve 46 - 38 = k + 2v, -2k + 5v - 20 = 0 for k. 0 Solve 10g - 4 = 12g - b, 4g + 2 = b for g. 1 Solve a + 5 = -u, 63a - 58a - 2u + 25 = -u for a. -5 Solve -k + 7 = q, 0 = 2120q - 2125q - k + 19 for q. 3 Solve -a - 4l = 20, 0 = -6a + 2a - 3l - 28 for a. -4 Solve 29c - 32c + 2*b	{ "pile_set_name": "DM Mathematics" }
hree decimal places? 0.033 What is -0.00389082 rounded to 3 decimal places? -0.004 What is 1219678.3 rounded to the nearest ten thousand? 1220000 Round -0.03128066 to three dps. -0.031 Round 0.0000739419 to five dps. 0.00007 Round -3.840607 to three decimal places. -3.841 Round 7514.6231 to the nearest 100. 7500 Round 2.7448378 to three decimal places. 2.745 Round -26394420 to the nearest 100000. -26400000 Round -2.3139655 to three decimal places. -2.314 Round -9.40142 to the nearest integer. -9 Round -1457.9323 to the nearest 100. -1500 What is -6.310577 rounded to 3 dps? -6.311 Round 0.00028629 to 4 decimal places. 0.0003 What is 2.2886047 rounded to 2 dps? 2.29 What is 0.000061048 rounded to five dps? 0.00006 Round -77.0256 to 0 decimal places. -77 Round 15588329 to the nearest 100000. 15600000 Round -176818.5 to the nearest 10000. -180000 What is 36490.9 rounded to the nearest 100? 36500 Round -2581.56 to the nearest 100. -2600 Round -0.3591475 to one dp. -0.4 What is 0.8867607 rounded to 1 dp? 0.9 What is -150.8854 rounded to the nearest integer? -151 Round -4.767572 to 3 decimal places. -4.768 What is -1402618800 rounded to the nearest one hundred thousand? -1402600000 What is 0.00891549 rounded to 4 dps? 0.0089 What is -17.1192 rounded to one dp? -17.1 Round -437.165 to the nearest 10. -440 What is -0.014885665 rounded to four dps? -0.0149 Round -4.76523 to 2 dps. -4.77 Round -1.62703 to 2 dps. -1.63 What is 0.017854545 rounded to four dps? 0.0179 What is -0.00007282823 rounded to six dps? -0.000073 What is 0.00012112086 rounded to six decimal places? 0.000121 What is -16280350 rounded to the nearest 10000? -16280000 Round -435757 to the nearest 1000. -436000 What is 0.0117917293 rounded to 4 decimal places? 0.0118 Round 1200710 to the nearest 100000. 1200000 What is 8114900 rounded to the nearest one hundred thousand? 8100000 What is -699343300 rounded to the nearest 1000000? -699000000 Round -0.17166976 to three decimal places. -0.172 Round -0.0002813232 to 7 decimal places. -0.0002813 What is -17143700 rounded to the nearest 10000? -17140000 What is 714272 rounded to the nearest one hundred thousand? 700000 Round 1138912 to the nearest one thousand. 1139000 Round -1950035 to the nearest 10000. -1950000 Round 8994820 to the nearest 100000. 9000000 What is -0.00320573 rounded to four decimal places? -0.0032 Round -6996909 to the nearest 1000000. -7000000 What is 0.002726002 rounded to 5 dps? 0.00273 What is 62.36 rounded to the nearest 100? 100 What is 0.00760911 rounded to 4 dps? 0.0076 Round 1.09419 to the nearest integer. 1 Round 0.00087124275 to 7 decimal places. 0.0008712 Round 0.1335605 to three dps. 0.134 What is 58.79133 rounded to two dps? 58.79 What is 5231.92 rounded to the nearest 100? 5200 Round 28528700 to the nearest one million. 29000000 Round 6402000 to the nearest one million. 6000000 What is 589.326 rounded to the nearest 10? 590 Round -412073 to the nearest one hundred thousand. -400000 What is -692864 rounded to the nearest 100000? -700000 Round -0.1656585 to 3 decimal places. -0.166 Round -3696.642 to the nearest 1000. -4000 Round 0.0000094358785 to six dps. 0.000009 What is -0.00005915478 rounded to 6 decimal places? -0.000059 What is 12.79973 rounded to 0 decimal places? 13 Round -2058754 to the nearest one thousand. -2059000 What is 2967.0414 rounded to the nearest 10? 2970 Round 6048.95 to the nearest 100. 6000 What is -64204.55 rounded to the nearest ten thousand? -60000 What is 709.8916 rounded to one decimal place? 709.9 Round -113019000 to the nearest 10000. -113020000 Round -688.9504 to the nearest one hundred. -700 What is 5.720583 rounded to 1 dp? 5.7 Round -3184.273 to the nearest one hundred. -3200 What is 0.831006 rounded to 2 decimal places? 0.83 Round 1263.3651 to the nearest 10. 1260 Round 7.9864 to the nearest integer. 8 What is 18.3731 rounded to the nearest 100? 0 What is 385.21 rounded to 0 decimal places? 385 Round -0.0001278402 to five dps. -0.00013 Round -475.0404 to 0 decimal places. -475 What is 383528.28 rounded to the nearest 1000? 384000 Round -1234033.9 to the nearest 100. -1234000 Round -0.0386969 to five decimal places. -0.0387 Round 18.79642 to two dps. 18.8 Round -0.1250769 to three dps. -0.125 Round -7103700 to the nearest ten thousand. -7100000 Round -0.000409321 to six decimal places. -0.000409 Round 0.0071935332 to 3 decimal places. 0.007 Round -36.2231 to the nearest 10. -40 What is -1376448.6 rounded to the nearest ten thousand? -1380000 What is -10805550 rounded to the nearest 100000? -10800000 Round -0.03687397 to 2 decimal places. -0.04 What is 231471.67 rounded to the nearest ten thousand? 230000 What is 244.91 rounded to the nearest 1000? 0 What is 0.00005154897 rounded to seven decimal places? 0.0000515 What is 22.43123 rounded to zero decimal places? 22 Round 1322773 to the nearest one hundred thousand. 1300000 Round 30971 to the nearest one hundred thousand. 0 What is -2533120 rounded to the nearest ten thousand? -2530000 Round 454995400 to the nearest 1000000. 455000000 Round 26294170 to the nearest 10000. 26290000 What is 0.000095857 rounded to five dps? 0.0001 Round 0.819891 to one dp. 0.8 Round 0.000679483 to six dps. 0.000679 Round -30.33106 to the nearest integer. -30 What is 10755258 rounded to the nearest ten thousand? 10760000 What is 359960200 rounded to the nearest 1000000? 360000000 Round 53147.38 to the nearest one thousand. 53000 Round -0.02654839 to 2 dps. -0.03 Round -0.000153319 to 6 decimal places. -0.000153 What is 382077.1 rounded to the nearest ten thousand? 380000 Round -9.2025673 to the nearest integer. -9 Round 0.000866583 to five dps. 0.00087 What is 144706.58 rounded to the nearest 1000? 145000 Round 48498.001 to the nearest 10. 48500 Round -8.52 to the nearest 10. -10 What is 0.00008448591 rounded to 5 decimal places? 0.00008 Round 664.3109 to the nearest 100. 700 Round -824.779 to the nearest 1000. -1000 Round 383368 to the nearest ten thousand. 380000 Round -43.6355 to one decimal place. -43.6 What is -1.45213 rounded to three dps? -1.452 Round 0.00000210447 to seven decimal places. 0.0000021 Round -9632.54 to the nearest ten. -9630 What is 4.733842 rounded to two dps? 4.73 What is 0.0005342941 rounded to four decimal places? 0.0005 What is 3172.69 rounded to the nearest 10? 3170 What is 0.000000110085 rounded to six decimal places? 0 Round 0.02271132 to 2 dps. 0.02 What is 4.650801 rounded to 2 decimal places? 4.65 Round -0.00730247 to 3 dps. -0.007 What is 33.941125 rounded to one dp? 33.9 What is -0.02954847 rounded to 4 decimal places? -0.0295 What is 402507 rounded to the nearest ten thousand? 400000 What is -152.6996 rounded to one decimal place? -152.7 What is 0.000262599 rounded to four dps? 0.0003 Round 7124357 to the nearest one million. 7000000 What is -0.24451 rounded to 2 decimal places? -0.24 Round 49.5374 to one decimal place. 49.5 Round 0.00000027566 to 6 dps. 0 Round 0.005067696 to four dps. 0.0051 What is -0.00000674156 rounded to 7 decimal places? -0.0000067 Round 0.0000196699 to 5 decimal places. 0.00002 Round -311134.2 to the nearest one thousand. -311000 Round 2793490 to the nearest 10000. 2790000 Round -0.1948793 to 2 decimal places. -0.19 Round -133370.93 to the nearest one thousand. -133000 What is 90941.2 rounded to the nearest one hundred? 90900 What is 111.2041 rounded to the nearest integer? 111 Round -37.9246 to 0 decimal places. -38 Round -1825.312 to 0 dps. -1825 Round 28.0995 to the nearest integer. 28 Round -11782541 to the nearest 1000000. -12000000 Round -797539 to the nearest ten thousand. -800000 Round 388059200 to the nearest 100000. 388100000 Round 6.986317 to 1 dp. 7 What is 1.611492 rounded to two decimal places? 1.61 What is 4032720000 rounded to the nearest 1000000? 4033000000 What is -12989400 rounded to the nearest one million? -13000000 What is 0.000011273733 rounded to six dps? 0.000011 Round -0.0000430657 to seven dps. -0.0000431 Round 0.0000001107916 to seven decimal places. 0.0000001 Round 0.000056325 to six dps. 0.000056 What is -1.4856297 rounded to one decimal place? -1.5 Round 341098 to the nearest ten thousand. 340000 What is 687345000 rounded to the nearest 1000000? 687000000 R	{ "pile_set_name": "DM Mathematics" }
3 (b) 1 (c) l a Let n = 0.418 + -0.318. Let g = 6 + -6. Let r = g + 4. What is the nearest to 2/3 in n, 0.2, r? 0.2 Let p = 1 + 2. Let d be 3/(-162)-214 + -4. Let f = -23/108 + d. What is the nearest to f in p, -3/8, -3? -3/8 Let k be -1(-29)/(-30) - (-4)/5. What is the nearest to 1 in k, 1, -0.29? 1 Let v = 3.022 - 0.022. What is the closest to v in -1/2, 3/2, 5, 2/15? 3/2 Let x = 0.043 + -75.043. Let y = x + 74.6. Which is the closest to 3? (a) -0.2 (b) -3 (c) y a Let o = 99 + -99.13. Let y = -1/158 - 311/790. Let h = y + 4/5. Which is the closest to h? (a) -0.3 (b) -2/13 (c) o c Let o = 51.9 + -52. What is the closest to 0 in o, 3, 5? o Let d = 0.266 + -0.366. Which is the closest to -1? (a) 0.4 (b) d (c) 1/8 b Let z = -0.36 - 12.44. Let n = z - -13. Let p = -2 - -5/2. Which is the closest to p? (a) n (b) 2/17 (c) 0.1 a Suppose -5p = -3v + 447, -3v - 15p = -11p - 447. Which is the nearest to -1/2? (a) v (b) -5 (c) 5 b Let n = -2695 + 2695.4. Let i = -2 + 2.01. Let t = 1.1 + -0.1. Which is the closest to t? (a) -1 (b) n (c) i b Suppose 5q - b - 1 + 24 = 0, 3 = 3q + 5b. Let z be (-12)/(q - 25/(-10)). What is the nearest to 0 in 0.5, z, -0.4? -0.4 Let v = 244 + -247. Suppose -11 = -h + 12h. Which is the closest to 0? (a) h (b) -1/3 (c) v b Let o be (-186)/(-18) + (-2)/6 - -2. Suppose 63n - 59n - o = 0. What is the nearest to -1/3 in -4, 0.1, n? 0.1 Let u = -64 + 64. What is the closest to u in 2/15, -0.02, -5? -0.02 Let r = 3 - 5. Let j = 304 - 6386/21. Which is the closest to r? (a) -0.5 (b) -1/3 (c) j a Suppose -3h - 4i - 2 = 0, h - 101 + 106 = 3i. Let n = -13 + 8. What is the closest to h in -2/7, n, -1/2? -1/2 Let w be (-64)/48 - ((-282)/(-99) + -4). What is the nearest to -0.7 in 2/5, -2/3, w, -4? -2/3 Let a = -3.9 + -2.4. Let f = a + 10.3. What is the closest to -1/3 in 1, -6, f? 1 Let q be 2/1 + -31. Let x be 2 + q + (-66)/54. Let j = -61 + 61. What is the nearest to j in 3, -2/13, x? -2/13 Let d be (-1 + 16 - (-1)/1)/2. Let n be 2 - (-2 + (22 - 2)). Let r be ((-6)/d)/(120/n). Which is the closest to 0? (a) 0 (b) -3 (c) r a Suppose 104i - 119i + 60 = 0. Let d = -7 + 25. Let j = d + -13. Which is the nearest to 0.2? (a) 0.1 (b) i (c) j a Let s be (-14887)/(-15384)(-12)/24. Let m = 3/641 + s. Let p = -3/16 + m. What is the nearest to p in 1/6, -7, 0.5? 1/6 Let j(t) = -t + 4. Let b = 8 - 8. Let m be j(b). What is the nearest to 0.1 in -4, -5, m? m Let x = 1493 - 1493.1. Let s = -4 - -8. What is the nearest to x in 0, s, 2? 0 Let d = 0.005 - -44.995. Let m = -44.8 + d. What is the closest to m in -2, -3, -0.1? -0.1 Suppose -9t = 4i - 4t + 11, -2i - 5t = 13. Which is the closest to i? (a) -3 (b) -24 (c) 2/11 c Let j = -56 - 36. Let y = -92 - j. Suppose 0 - 3 = -3l. Which is the closest to 0.1? (a) y (b) -6 (c) l a Let v = 0.05 - 3.05. Suppose -12 = m + 11m. What is the closest to -2/21 in m, 0.4, v? 0.4 Suppose 9u - 96 = 3u. Let b = 101.9 + -102. What is the closest to 0 in u, -0.5, b? b Let y = -10.81 - -10.9. Let q = 0.19 - y. What is the closest to 0.1 in q, -1/3, 0.2? q Let x = 11 + -10.2. Let q = -12 - -10.8. Let z = q - x. Which is the closest to -2/5? (a) z (b) 5 (c) 0.3 c Let u = -49 - -197/4. Let r be 156/(-27) - (8 - (-98)/(-7)). What is the closest to u in -0.4, 1, r? r Let k = 1.2 + -0.2. Let c = -638 + 686.7. Let m = -49 + c. What is the nearest to k in -5, m, 3/7? 3/7 Let i = -42 + 35. Let q be (3/6)/((-7)/(70/15)). What is the closest to q in i, -4, -3? -3 Let o = 1006.2 - 1006. Which is the closest to -3? (a) 4 (b) -4 (c) -0.4 (d) o b Let f = -353 + 351. What is the closest to -2 in f, -0.5, -0.07, -1? f Let j = -247 + 1728/7. Which is the closest to 4? (a) 0.2 (b) j (c) 14 a Let k be (-32)/28((-9)/(-3))/12. Let u be 112/3 - (-3 - -1). Let s = u - 39. Which is the nearest to s? (a) -0.5 (b) k (c) 0.4 c Suppose -5y - 1 = -3z + 2z, -y = -5z + 5. Which is the nearest to 0? (a) z (b) -64 (c) 0.4 c Let w(z) = -z*3 - z. Suppose 5f - 2k - 1 - 4 = 0, 5k = -3f + 3. Let x be w(f). Let c be (-10)/8 - 1/x. What is the nearest to 0 in c, -2/13, -3/7? -2/13 Let y = 3.4 + 0.6. Let t = 59 + -62. What is the closest to -1 in 0.5, y, t? 0.5 Let k = -341/4 - -86. Let q = 74 + -71.1. Let f = q + 1.1. What is the nearest to -1 in 2/3, f, k? 2/3 Let p = -6.84 + -2.16. What is the closest to 2/7 in 2, 0.2, -0.05, p? 0.2 Let z(j) be the first derivative of -4j*2 + 6j + 1. Let l be z(5). Let i be (-52)/39(-3)/l. Which is the closest to 2? (a) -1/2 (b) -3 (c) i c Let y = -18/35 - 2/7. What is the nearest to 23 in 2, -0.1, y? 2 Let z be 9/18((-2)/24)/((-24)/(-64)). Let y = -0.4 + 0.3. Which is the nearest to y? (a) z (b) 2 (c) 1 a Suppose -4a = 611 + 645. Let k = a + 4084/13. What is the nearest to 5 in 0.3, k, 0.2? 0.3 Let p be 7 + -4 + -7 - 66/(-18). Which is the nearest to -6? (a) p (b) -2/13 (c) 3 a Let t = -0.1783 - 0.1217. What is the closest to 0.1 in -0.1, 0, t? 0 Let q = -0.133 - 0.267. Which is the closest to 2/3? (a) q (b) 3 (c) -5 a Let j = 89 + -621/7. Let h = -57 - -123.5. Let d = 66 - h. What is the nearest to 1/2 in d, -1/12, j? j Suppose 11z + 44 = 11. What is the closest to 2 in z, -4, -0.3? -0.3 Let g = 14.9 - 3.9. Which is the nearest to 1? (a) 1 (b) g (c) -6 a Let m = -403.7 - -404. Let d = -10 + 7. What is the nearest to m in 3, 3/2, d? 3/2 Let u be (-8)/101/4. Let l = -40.24 + 41. Let i = -0.26 + l. Which is the closest to 0? (a) -5 (b) u (c) i b Let n = 1.4 + -1. Let t = 2591/14 - 1296/7. What is the nearest to t in -2, 0.2, n? 0.2 Suppose 0 = i - 3o + o + 5, 4o - 16 = 0. Let j = -67 - -62. What is the nearest to 1 in i, j, 0.2? 0.2 Let r = -0.03 + -0.27. Let i = -4 + 5. Let y = -3.9 + 0.9. Which is the nearest to i? (a) 0.1 (b) y (c) r a Let y be (0 - 1527/12)-1. Suppose -3m = -3z + 372, 0 = -2z + 4m - 0m + 240. Let w = z - y. Which is the nearest to -1/2? (a) 2/5 (b) w (c) 1/4 c Let f = -2.9123 + -0.0877. Let u = 4.3 - 4. Let q = u + 0.7. What is the closest to 3 in f, -0.3, q? q Let b be (-39)/(-910) + (1 - 0). Let t = -9/14 + b. Let d = -0.06 - -0.56. What is the nearest to t in d, 2, -4/3? d Let i = 1303/15 + -87. Let k = -16.04 - -0.04. Let r = k + 15. Which is the nearest to r? (a) 0.5 (b) -4/5 (c) i b Let y = -7 - -12. Let z = 7 - y. Let n = 12/127 - 338/889. Which is the closest to z? (a) -3/8 (b) -2 (c) n c Let n be (-236)/177 + (110/3)/2. What is the closest to 0.8 in -3, n, -1? -1 Let i be 0 - ((-7 - -10) + 0). Which is the nearest to 1/3? (a) 1/3 (b) 9 (c) i a Suppose 7h - 16 = 3h. Suppose v = -m + 3, -3 = m - 0m + hv. Let l = -1.105 - -0.805. Which is the nearest to 0? (a) -4 (b) m (c) l c Suppose 2 = 20m - 18m. Suppose -5j + 2s - 19 = 6s, s = -m. Which is the nearest to 1/3? (a) j (b) 4 (c) -2 c Let q = 88.6 + -109. Let r = 20 + q. Let j = 0.3 - 0.4. What is the nearest to j in 4, -3, r? r Let t = -2.2 + 2. Let k = 12.86 - 12.86. Which is the nearest to t? (a) -0.2 (b) 1/2 (c) k a Let z = 187 - 188. Which is the closest to z? (a) -3 (b) 0.1 (c) -33 b Suppose 0 = -6m + 3m + 24. Let h = 9.05 + -0.05. Let i = h - 9.1. What is the nearest to -1/4 in m, 2, i? i Let m = -299 + 298.7. Let a = -13 - -13.3. What is the nearest to a in -0.5, m, -1/5? -1/5 Let l(w) = w*2 - 7w - 4. Let i be l(8). Let u be 3216/(-378) + 8 - 2/(-9). Let t = 22/105 + -1/15. What is the nearest to u in t, 0.1, i? 0.1 Let f = 0 - -2. Let s = -6.29 + 6.59. What is the closest to f in -2, s, -5? s Let t = 425 - 427. Which is the nearest to 1? (a) -3/5 (b) t (c) -5 a Let f be ((12/(-10))/(1302/620))/(-2). Suppose 5q = 5p, -q + 5q = -p. Suppose q = -3w + 5w. Which is the closest to 0? (a) -1 (b) w (c) f b Let z = 266 - 264.876. Let u = z + -0.124. What is the closest to 0.1 in 2/11, u, 0? 2/11 Let f(h) = 3h*2 - h. Let r be f(1). Suppose 3p = -rp. Suppose z - 4 + 2 = p. Which is the nearest to z? (a) -0.2 (b) -1 (c) 0 c Let c be (12/(-102))/(2/(-2) - 0). What is the closest to 0.1 in -8, 3, c, 4? c Suppose 4v = -5y + 2 + 1, -4v = -4y - 12. Let h be 12/420/12. Suppose 8 + 6 = hi - d, 2i - 4d = v. What is the closest to 1/2 in i, -3/4, 0? 0 Suppose -3a + 2*a	{ "pile_set_name": "DM Mathematics" }
rms in -11z - 211 - 210 + 421 + 12z. z Collect the terms in -3b3 + 7b*3 - 1 + 0. 4b*3 - 1 Collect the terms in -3 + 3 + 95z - 93z. 2z Collect the terms in 7r + 12 + 2 - 14. 7r Collect the terms in -25 + 0h + h + 2. h - 23 Collect the terms in -160k + 178k - 2 + 2. 18k Collect the terms in -7s - 13s - 22s + 46s. 4s Collect the terms in -269 + 33s*3 + 269. 33s*3 Collect the terms in 1 - 56x - 1 - 157x. -213x Collect the terms in -699u2 + 350u*2 + 0u + 355u2 + 0u. 6u2 Collect the terms in -5j - j - 41j - 22j. -69j Collect the terms in 8i*2 - 2 - 2 + 4. 8i*2 Collect the terms in 62 - 4d*2 - 62 + 3d2. -d2 Collect the terms in -57j2 - 3j - j + 1 + 4j. -57j*2 + 1 Collect the terms in -39u*3 + 63u*3 - 31u*3. -7u*3 Collect the terms in 227p*2 + 65p*2 + 32p*2. 324p*2 Collect the terms in 7826607c - 7826607c - c2. -c2 Collect the terms in -3f*2 + 12f*2 + 7f*2 - 6f*2. 10f*2 Collect the terms in -12 - a + 12. -a Collect the terms in 111h + 4h2 - 111h - 1. 4h2 - 1 Collect the terms in 191v*2 - 191v*2 + 5v*3. 5v*3 Collect the terms in -6i - 6i - 12 - 11 + 10i. -2i - 23 Collect the terms in -j - 5 + 1 + 17j. 16j - 4 Collect the terms in 105p + 2908p + 347p. 3360p Collect the terms in -1604t + 3t2 + 797t + 807t. 3t*2 Collect the terms in 17z*3 - 7z*3 - 6z*3 - 8z*3. -4z*3 Collect the terms in -1573v*2 - 1572v*2 + 4718v*2 - 1571v*2. 2v*2 Collect the terms in 3m - 777 + 777. 3m Collect the terms in -129p*2 + 68p*2 + 61p*2 + 2p3 - p3. p*3 Collect the terms in h - 3h - h*3 + 2h. -h*3 Collect the terms in 18l*2 + 1 + 21l*2 - 1 - 46l*2. -7l*2 Collect the terms in 22m - 10m + 6m + 26m. 44m Collect the terms in 6k3 + 5k*3 - 7k*3. 4k*3 Collect the terms in -4k*3 + 7k3 - k3. 2k3 Collect the terms in 2689y*2 - 1339y*2 - 1347y*2. 3y*2 Collect the terms in 16i - 8 + 12 - 5. 16i - 1 Collect the terms in 14c - 760 + 760 + 4c - 24c. -6c Collect the terms in 5860f*2 + 5873f*2 - 11731f*2. 2f*2 Collect the terms in -62v*3 + 59v*3 - 73v*3 - 61v*3. -137v*3 Collect the terms in 12b - 3b - 18b + 7b + b. -b Collect the terms in 12f - 57f + 19f + 25f. -f Collect the terms in 2t*3 - 39840t*2 + 39840t*2. 2t*3 Collect the terms in 45t*2 - 147t + 147t. 45t2 Collect the terms in b3 + 13b3 - 7b*3 - 6. 7b*3 - 6 Collect the terms in -243 + 55i + 243 - 204i. -149i Collect the terms in 231s2 - 425s*2 + 189s*2. -5s*2 Collect the terms in -464q - 147q - 48q + 32q. -627q Collect the terms in -338 + 338 - 6f. -6f Collect the terms in -2y - y - 11y*2 - 4y*2 + 11y*2. -4y*2 - 3y Collect the terms in 384 - 384 - 4y3 - 7y*3. -11y*3 Collect the terms in -6c*2 - 5c - 8c + 11c. -6c2 - 2c Collect the terms in 15 - 17l2 - 12 - 3. -17l*2 Collect the terms in 4o + 47o2 - 4o - 46o2. o2 Collect the terms in 13h + 4 + 3 - 7. 13h Collect the terms in 3r + 2r + 77r*2 - 5r - 74r2. 3r*2 Collect the terms in 23t*3 - 8t*3 - 13t*3. 2t*3 Collect the terms in -30p - 24p - 8p - 4p. -66p Collect the terms in -142 - 6j3 + 142 - 28j*3. -34j*3 Collect the terms in -1159 - 3c*2 + 1159. -3c*2 Collect the terms in -2x2 + x2 - 34x2. -35x*2 Collect the terms in 1 + 73s*3 - 1. 73s*3 Collect the terms in -135 + 11q*3 + 135. 11q*3 Collect the terms in -2x*2 + 6x*2 - 2x*2. 2x*2 Collect the terms in -17y*3 + 3y*2 - 3y*2 + 9y*3 + 15y*3. 7y*3 Collect the terms in 8w*2 - 7w*2 + 9w2 - w3 + 2w2 + 16w2. -w3 + 28w2 Collect the terms in 93p*3 - 44p*3 - 50p3. -p3 Collect the terms in -25y - 2y + 10y - 32y. -49y Collect the terms in -w3 + 132 + 93 - 25. -w3 + 200 Collect the terms in -12t*2 + 4t*2 + 2t*2. -6t*2 Collect the terms in 1 + 2973z - 39z2 - 1 - 2975z. -39z2 - 2z Collect the terms in 22l2 + 10l*2 - 53l*2 - 44l*2 - 2. -65l*2 - 2 Collect the terms in 3p*3 - 7p*3 - 5p*3. -9p*3 Collect the terms in -288a + 288a + a2 + 0a2. a2 Collect the terms in -1 - c + 3c - 2c + 2c. 2c - 1 Collect the terms in -21s2 - 43s*2 + 8s*2. -56s*2 Collect the terms in 1561u - 815u + 2478u. 3224u Collect the terms in 3l2 + l2 - 607l + 163l. 4l2 - 444l Collect the terms in 55u2 - u2 + 60u*2. 114u*2 Collect the terms in -2238 - 10t + 2238. -10t Collect the terms in -1650 + j - 2j + 0j. -j - 1650 Collect the terms in -19u*3 - 4u*2 + 24u*3 + 23u*3. 28u*3 - 4u*2 Collect the terms in 8662v - 8662v - v2. -v2 Collect the terms in 12f*3 - 11f*3 - 10f*3. -9f*3 Collect the terms in 5f - 5f + 7f*3 + 7f*3 - 4f*3. 10f3 Collect the terms in 833 - 416 - f2 - 417. -f*2 Collect the terms in -27 - 31 - 34 + 92 + 2f. 2f Collect the terms in -6r - 16 + 16. -6r Collect the terms in 6a + 6a + 6a - 4a. 14a Collect the terms in 5d3 - 8d*3 + 20d*3. 17d*3 Collect the terms in -54o*2 + 52o + 55o + 56o - 161o. -54o*2 + 2o Collect the terms in 12u + 8u - 20u + 13u*3. 13u*3 Collect the terms in 4539l - 9089l + 4543l. -7l Collect the terms in 127p*3 - 91p*3 - 39p*3. -3p*3 Collect the terms in -1751w + 876w + 876w. w Collect the terms in 65q3 - 120q*3 + 64q*3. 9q*3 Collect the terms in 0 - 2j*2 + 16 - 16. -2j*2 Collect the terms in 3298964 - 3298964 + 2r*3. 2r*3 Collect the terms in 0p - 98p2 + 6p - 4p. -98p*2 + 2p Collect the terms in -9c3 - 17c*3 - 5c*3 - 3c*3. -34c*3 Collect the terms in -7h + 16h - 3h*2 - 9h + 2h3. 2h*3 - 3h*2 Collect the terms in -36m*3 - 96m*3 + 131m3. -m3 Collect the terms in -3r + 4r + 9r. 10r Collect the terms in -48z2 + 6z - 6z - 81z*2. -129z*2 Collect the terms in 0n*2 + 10n*2 + 0n*2 - 3n*2 - 9n*2. -2n*2 Collect the terms in -6w - 3w - 5 + 18w - 4w. 5w - 5 Collect the terms in 3 - 4z + 4 + 3. -4z + 10 Collect the terms in -4t - 5t - 2t + 3t. -8t Collect the terms in 29w*2 - w + w + 12w*2 + 1. 41w*2 + 1 Collect the terms in -12h*2 + 37793h + 2h2 - 5h*2 - 37793h. -15h2 Collect the terms in 185 - 3x*2 - 185. -3x*2 Collect the terms in 10k*2 - 17 + 49 - 32. 10k*2 Collect the terms in -15b*2 + 20b*2 - 9b*2. -4b*2 Collect the terms in 6k + 0k - 5k + k. 2k Collect the terms in 235b - 12 + 12. 235b Collect the terms in 319f*2 - 149f*2 + 408f*2. 578f*2 Collect the terms in -4 - 9 - 35m - 25 + 38. -35m Collect the terms in -7d*2 - 11d2 + d2 + 15d2. -2d*2 Collect the terms in -41a*3 - 53a*3 + 25a*3. -69a*3 Collect the terms in 56 + 2t - 56 - 5t. -3t Collect the terms in 31a3 - 71a*3 + 36a*3 - 3a*2 + 3a*2. -4a*3 Collect the terms in 0 + 1 + 10m + 3m - 2. 13m - 1 Collect the terms in 10z2 + 12z*2 + 11z*2 + 7z*2. 40z*2 Collect the terms in -2f*3 - 7f*2 - 7f - 2f2 + 7f. -2f3 - 9f*2 Collect the terms in 27q*2 - 48q*2 + 27q*2. 6q*2 Collect the terms in -66 + 66 + 93v*2. 93v*2 Collect the terms in 12i + 13i - 50i + 19i. -6i Collect the terms in 5605 + 14q - 5605. 14q Collect the terms in -5p + 469 - 469. -5p Collect the terms in 5 - 5 + 1270l3 - 1273l*3. -3l*3 Collect the terms in -142g*2 + 142g*2 + 3g*3. 3g*3 Collect the terms in 1796v*3 - 901v*3 - 897v*3. -2v*3 Collect the terms in 9 + 23 - 32 + 0a + 2a. 2a Collect the terms in -10l2 - l - 4l + 3l. -10l*2 - 2l Collect the terms in 11c2 + 20c*2 - 32c2. -c2 Collect the terms in -8x + 8x - 4x2 - x3 + 4x2. -x3 Collect the terms in 2n - 2n + 731n2 - 742n*2. -11n*2 Collect the terms in -83 + 2p*3 + 83. 2p*3 Collect the terms in 31i + 28i - 68i. -9i Collect the terms in 3p*3 - 7 + 6 + 1 + 0. 3p*3 Collect the terms in -10p + 15p + 7p + 12p. 24p Collect the terms in 3a3 - a3 - 179a*2 - 123a*2. 2a*3 - 302a*2 Collect the terms in -5j - 1713j2 + 5j - 2111j2. -3824j*2 Collect the terms in 7x + 0 + 3 - 6. 7*x - 3 Co	{ "pile_set_name": "DM Mathematics" }
uppose 2o + 5 = -3. Is 41/on a composite number? False Suppose 115t - 403606 = 101t. Is t a prime number? False Is 5(-5026)/(-105)(-3)/(-2) a composite number? False Is (0 - (-92)/6)/(54/7209) a prime number? False Let x be 4/221 + 40/22. Suppose -4l - 2v + 1937 + 283 = 0, 2v - 1106 = -xl. Is l a prime number? True Let z(y) = -y*3 - 8y*2 - 12y + 2. Let l be z(-6). Suppose -lv + 2348 = 2v. Is v a prime number? True Suppose 9h = 15h - 84. Suppose 26765 = ha - 6261. Is a prime? False Let r be ((-2)/2 - -1)/(-2) - -3. Suppose -2k - 2h + 1592 = -rh, 5k - 3h - 3979 = 0. Is k a composite number? False Let z(g) = g*3 - 6g*2 - 25g - 27. Let s(r) = -4r3 + 24r*2 + 101r + 108. Let m(y) = 2s(y) + 9z(y). Is m(14) a composite number? True Suppose u = 2b + 3080, u - 4b + 6160 = 3u. Let q = -1321 + u. Is q a prime number? True Let t(n) = -n2 - 14n - 1. Let d be t(-10). Suppose 4r + 31 = d. Is 87 + r + 0 + -4 a prime number? False Is 5714/(-6)-1 + 74/111 composite? False Suppose 44098 = 11v - 39073. Is v prime? True Is (34/4 + -8)161306 a composite number? True Let h = -11728 - -17109. Suppose 0 = 4n + 3t - h, 5n + 0n - 2t - 6709 = 0. Is n composite? True Is ((-13)/(-39))/((-1)/(-14583)) a prime number? True Let t be 770/50 - (-2)/(-5). Suppose -9 = 2z + 3u, 0 = u - 4u - t. Suppose k + 109 = zf, f - 1 - 34 = k. Is f a prime number? True Let x be (-982394)/(-35) + 3 - 2/5. Suppose 13p + 7700 = x. Is p composite? False Let g(f) = 221f - 58. Is g(49) prime? True Let m(g) = g2 - 1366. Let k be m(0). Let w = k - -2909. Is w a composite number? False Suppose 3z + 130 = -110. Let m = z + 28. Let y = -37 - m. Is y a prime number? False Suppose 0 = -o + 3, -2c + 12 = 2o. Is 1(-207)/6(-74)/c a composite number? True Let t be 18/(-21)-1(7 - 0). Suppose -h = 3l - th - 2056, 4h - 3365 = -5l. Is l prime? True Let c(w) = -7w + 2. Let k(v) = -v + 1. Let f(y) = c(y) - 4k(y). Let g be f(-2). Suppose -1513 - 1075 = -gh. Is h prime? True Let l = 56885 - 37728. Is l a prime number? True Let t be 4 + 5/(15/9). Let z be 2/(t/((-49)/(-2))). Suppose za - 4a - 399 = 0. Is a composite? True Suppose -5m - t + 7640 = -3t, -m + 1528 = 2t. Suppose 4n + 4i = m, 2n + 4i - 1054 = -296. Let l = -174 + n. Is l prime? True Let u(t) = 77t + 9. Suppose -1 = -2m - g - 0, 0 = -5m - 2g + 4. Is u(m) a composite number? False Let y(m) = m*2 + 4m + 8. Let g be y(-12). Suppose a - 5t - g = 0, 3a - 5t - 388 + 36 = 0. Suppose 5l - 4h = 307, l = 3l - 2h - a. Is l prime? True Suppose 5 + 27 = -4m. Is (0 - -1347)m/(-24) a composite number? False Let q = -50 + 53. Is (2439/21)/q - 4/(-14) a composite number? True Let g = -4 - -3. Let v(o) = -85o - 2. Is v(g) composite? False Suppose 4z - 5 = 59. Suppose f = -f + z. Suppose 1865 = 5x + 3o, 365 = x + o - f. Is x a prime number? True Let q = 21255 + -13993. Is q prime? False Suppose 4f - 3k + 79 = 0, -f - 3 = 2k + 3. Let m be 3 - 4/(f/12). Let y(a) = 3a2 - 7a - 8. Is y(m) composite? True Let d(l) = -l3 + l2 - 1. Let a be d(0). Is a/4 + 25839/44 composite? False Suppose 2v = -2o + 10, 2o = 4v - 0 - 20. Is (1362 - -2) + o + -3 composite? False Let c = -856 + 207. Let b = -227 - c. Is b a composite number? True Suppose -3j = -7j + 12. Let u be 200/(-6)18/(-4). Suppose jz + 337 = 5a, 2a - u = 5z - 0. Is a a composite number? True Suppose t = -5y, 3y - t = y. Let g(q) = -q + 485. Is g(y) a composite number? True Is 50990/(-25)-5 - 5 composite? False Suppose 0 = -f + 4u + 2312, -5u + 6851 = -0f + 3f. Suppose 4a - 10 = -p, -3p - 8a = -4a - 14. Suppose f = 4b - 2y - 3y, py = 0. Is b a prime number? False Is ((-10)/(-4))/((-24)/(-156432)) a prime number? False Suppose -5b = -3b. Suppose ba + 4 = 2a. Suppose -3v = -av - 413. Is v a composite number? True Suppose -24208 - 136715 = -21z. Is z composite? True Let p(f) = 6f*3 + 2f*2 + 6f + 5. Suppose -g + 13 = 3a, 0g - 2a + 26 = 5g. Is p(g) composite? True Let b(m) = m*2 - 6m + 2. Let l be b(6). Let w be (24/36)/(l/9). Suppose 2 = -wj + 59. Is j a prime number? True Let t(n) = 2n*3 - 15n*2 - 6n + 16. Let r(u) = -u*3 + 8u*2 + 3u - 8. Let x(c) = 7r(c) + 4t(c). Let g be x(4). Is ((-23)/(-2))/(g/(-8)) composite? False Suppose -13a + 245241 + 55540 = 0. Is a prime? False Let d = 6123 + -3262. Is d a composite number? False Suppose z + 5h + 15 = -4z, 3z + 15 = -h. Let g(m) = -16m3 - 4m*2 + 13m - 11. Is g(z) prime? False Let q(l) = 2l2 - 3l + 1. Let w be q(2). Suppose -wg = -0g. Suppose t + 3o - 217 = g, 3o - 663 = -2t - t. Is t composite? False Let u be (66/9)/(6/837). Let p = u + 1198. Suppose 5w - 4r = p, 4w - 1334 = w + r. Is w a composite number? True Suppose -8g - g = -36. Suppose -4o + 3o - 3s + 1372 = 0, o + gs = 1369. Is o a composite number? False Suppose -q = 3j - 2q - 98983, 2q = -j + 32999. Is j composite? True Let o(u) be the third derivative of -7u6/40 + u5/30 - u4/24 + u3/3 + 6u*2. Is o(-4) composite? True Suppose -k + 4675 = 4j, -22j + 26j = -5k + 23327. Is k a prime number? True Is 120/(-80)(-10268)/6 composite? True Let l(h) = -66h3 - 21h*2 + 25h - 17. Is l(-10) a prime number? False Let h = -59 + 50. Let y(r) = 25r2 - 6r + 20. Is y(h) prime? True Let f(x) = -21x3 + x2 - x - 3. Let a be (14/(-77) + 24/11)-2. Is f(a) composite? False Let z = 44861 + -30264. Is z composite? True Suppose 6g = 2g + 8. Let a be -1 + (2 - -342)/g. Let t = 152 + a. Is t composite? True Let o(p) be the first derivative of -7p2/2 - p + 2. Is o(-8) a composite number? True Suppose 62n = 39n + 209921. Is n composite? False Suppose 5c - 2p - 31724 = 988, 4c + 5p = 26196. Suppose 11l - 30183 = -c. Is l a composite number? True Suppose -3v = -2455 - 998. Is v a prime number? True Let z(j) = 9j*3 + 5j*2 + 6j + 12. Let p be z(-9). Let i = -3701 - p. Is i a composite number? True Is -3 + 24945/5 + 1 a prime number? True Suppose 6m = u + 4m - 12365, 5m - 49512 = -4u. Is u a prime number? True Let w(h) = -h - 3. Let l be w(-5). Suppose 24 = -4r + 44. Suppose -918 = -lq + 4i, ri - 2370 = -5q - 0i. Is q prime? False Let b(r) = 15r2 - 7r + 1. Let y be b(8). Suppose -i + 2z + 274 = 0, -2z - 1370 = i - 6i. Let d = y - i. Is d composite? False Suppose 7s = -36 - 6. Let i(h) = -48h + 4. Let b(k) = -145k + 11. Let t(d) = 3b(d) - 8i(d). Is t(s) a prime number? True Suppose 3q + 6 = 5q. Let s(u) = qu + u + 0 - 1 - 5u2 + u3. Is s(6) a composite number? False Suppose 3d + 148 = 934. Let f = 69 + d. Is f a prime number? True Let k(o) = -7o3 - o2 - 2o + 21. Let j be k(4). Is (2 - j) + 5 + -9 a prime number? True Suppose -3o = -0o - 3, o - 2391 = -5z. Suppose -6p - 34 = -z. Is p composite? True Suppose -25a = -27a + 4926. Suppose 5t = -3g + g + a, 4g = 3t - 1483. Is t prime? False Let i = -6 + 6. Suppose -3y - 4h = -7, -2y + ih + 4h + 18 = 0. Suppose 0 = -2q - 4, -yt + 2q + 3q + 80 = 0. Is t prime? False Let s be (-2)/((-2)/5)5. Let f = 25 - s. Suppose 4v = 2y - 1050, -2y + 5v = -fy - 1051. Is y prime? True Is 529/46(-92)/4-2 composite? True Let h be (52/(-6) - -1) + (-24)/(-36). Is (7/(-2))/h(3120 - -2) a composite number? True Suppose 3p + 338 = 5p. Suppose 15 = -2h + p. Is h composite? True Let s be -6(-1)/(-2) - 6. Is 5 + s + 0 + 705 composite? False Suppose -11s + 101311 = -57276. Suppose -5w - 8w + s = 0. Is w composite? False Let l(y) = -y*3 + 2471. Let a = -152 - -152. Is l(a) prime? False Suppose 410660 = 32l - 8124. Is l a composite number? True Let a be 139 + -1 + 3 + -1. Let g(b) = -b*3 + 4b*2 + 7b - 5. Let c be g(3). Suppose i = -j + a, 0 = i - j - 125 - c. Is i a prime number? False Suppose -5v = -4v - 3. Suppose 2946 = 5b - 3f + 748, -vf = 2b - 875. Is b prime? True Suppose -35h = -725661 - 64534. Is h a composite number? True Suppose -3l - 10p = -14p - 5, 4p = -2l + 30. Let m(b) = b*2 - 5b - 4. Let f be m(5). Is 251/(f + l + -2) prime? True Let w = -2565 - -3988. Is w prime? True Suppose 11c = 13c - 1574. Suppose 0j - c = -j. Suppose 5v - 3b - b - 1957 = 0, -3b - j = -2*v. Is v a composite number? False L	{ "pile_set_name": "DM Mathematics" }
+ 4u. Suppose 12 - 7 = j. Let p(s) = -s - j + 0s + 4 + 0. What is 6p(a) - v(a)? -2a + 1 Let s(z) = -5z + 5. Let p be (12/(-9))/((-2)/3). Let k(q) = -q + 1. Determine ps(v) - 9k(v). -v + 1 Let m(b) = 3b*3 + 3b*2 + 8b - 3. Let n(o) = -9o3 - 8o*2 - 23o + 8. Determine 8m(p) + 3n(p). -3p3 - 5p Let s(i) = 2i3 + 4i - 3. Let n(c) = -3c3 - 7c + 5. Give -6n(v) - 11s(v). -4v3 - 2v + 3 Let q(y) = -16y3 - 4y. Let f(r) = -15r3 - 5r. Give 2f(m) - 3q(m). 18m3 + 2m Let o(v) = -5v2 + 4v + 3. Suppose 0 = f - 6 + 1. Suppose 2q - 14 = -4p, -p - 4q = -4p + f. Let y(u) = 6u2 - 5u - 4. What is py(i) + 4o(i)? -2i2 + i Let r(d) = -d - 1. Let t be r(-4). Let v(n) = 5n3 + n2 + n + 3. Let g(j) = -9j3 - 2j*2 - j - 5. Determine tg(p) + 5v(p). -2p3 - p2 + 2p Let z(m) = -3m*2 + 2. Let f = -5 + 8. Suppose 0 = -fw + w - 4. Let n(a) = 4a2 - 3. Give wn(s) - 3z(s). s2 Let p(a) = a3 + a2. Let d(h) = -22h*2. What is d(t) + 22p(t)? 22t3 Let c(a) = 8a - 10. Let y(i) = i - 1. Suppose 2t = -t - 6. Calculate tc(g) + 18y(g). 2g + 2 Let r(x) = 11x - 5. Let i(j) be the third derivative of 2j*4/3 - 7j3/6 + j2. Let q(m) = -19m - 280. Let p be q(-15). Determine pi(g) - 7r(g). 3g Let a(x) = -x*3 + x - 1. Let r(g) = -4g*3 - 6g + 6. Give 6a(k) + r(k). -10k*3 Let z(y) = 10y + 1. Let s(l) = 4l + 50. Let r be s(-13). Let x(c) = 3c. Give rz(w) + 7x(w). w - 2 Let w(v) = -3v + 8. Let u(a) = 3a + 0a - 3a - a + 1. What is -5u(y) + w(y)? 2y + 3 Let a(v) = -2v2 - 7 + 3v*2 + 3v*2 + 3. Let g(q) be the third derivative of 0 - 1/60q*5 + 0q4 - q2 + 0q + 1/6q*3. Calculate a(p) + 2g(p). 2p2 - 2 Let r(h) = h3 + 32h. Let d(y) = y*3 + 33y. Calculate 5d(c) - 6r(c). -c*3 - 27c Let t(c) = 11c2 + 5c - 14. Suppose -4q - 4z + 4 = -0z, -z - 4 = 0. Let r(l) = -7l*2 - 3l + 9. Calculate qt(y) + 8r(y). -y2 + y + 2 Let n(t) = -t3 - 4t2 + 4. Let b(r) = -7r*3 + 5r*3 - 10r*2 + 8 + 0r*3 + 2. Determine 5b(f) - 12n(f). 2f*3 - 2f*2 + 2 Let q(i) = -5i*3 + 17i*2 - 9i + 9. Let a be (-21)/(-12) - 2/(-8). Let v(y) = y*3 - 4y*2 + 2y - 2. Calculate aq(t) + 9v(t). -t*3 - 2t*2 Let b(l) = -11l + 11. Let s(d) = -5d + 5. Give -2b(p) + 5s(p). -3p + 3 Let k(t) = 3t3 + 4t*2 + 4t - 4. Let s(b) = -2b3 + 145b*2 - 148b*2 + 0b - 3b + 3. Give 3k(z) + 4s(z). z3 Let c(j) = -j - 1. Let u(p) = -p - 7. Calculate 2c(b) - u(b). -b + 5 Let l(z) = -3z3 - z2 - 2z + 4. Let p(i) = -4i3 - 2i*2 - 3i + 5. Determine -3l(u) + 2p(u). u3 - u2 - 2 Let g(c) = -5c3 + c2 + 2c + 4. Let z(a) = -3a3 + 4a*2 - 3a*2 - a + 3 + 2a - a*3. Calculate 3g(v) - 4z(v). v3 - v2 + 2v Let j(o) = o*2 + o. Let i(z) = 4z + 0z2 - 2 + 4z2 - z2. Give i(y) - 4j(y). -y2 - 2 Let v(k) = -3k + 7. Let f(a) be the second derivative of a3/6 - a2 + 9a. Let j = -1 + 15. Calculate jf(h) + 4v(h). 2h Let m(q) = 6q2 + 5q + 5. Suppose 5w - 2o + 26 = 0, -6 - 2 = 4o. Let s = -4 - w. Let j(r) = 3r*2 + 2r + 2. Determine sm(b) - 5j(b). -3b2 Let j(d) = -6d - 4. Let x(q) = -8q - 9. Let a(k) = 3k + 3. Let c(h) = -7a(h) - 2x(h). Calculate -5c(z) + 4j(z). z - 1 Let l(n) = -8n3 - 6 - 6n*3 + 18n*3 - 6n*2. Let q(f) = 11f*3 - 17f*2 - 17. Determine 17l(c) - 6q(c). 2c3 Let a(s) = -s2 + 3s - 2. Let c be a(4). Let b(o) = -3o*3 + 3o*2. Let f(t) = 3t*3 - 4t*2. What is cb(i) - 5f(i)? 3i*3 + 2i2 Let n(v) = v2 - v - 1. Let a(k) = 64k2 + 2k + 2. What is a(g) + 2n(g)? 66g*2 Let i(v) = 1. Let s(o) = 2o*3 - 10o*2 - 2o + 6. Calculate 6i(y) - s(y). -2y*3 + 10y*2 + 2y Let b(r) = r + 1. Let p(t) = 6t + 3. Let z(l) = -2l - 5. Let k(u) = u + 6. Let i(q) = 4k(q) + 3z(q). Let j be i(7). Calculate jb(h) + p(h). h - 2 Let r(y) = y - y - y2 + y + 1 + 0y. Let a(k) = 2k2 - 3k - 3. Give 5a(z) + 15r(z). -5z2 Let r(f) = f. Let a(c) = 6c - 2c + 22c - 3. Let w(s) = -9s + 1. Let q(v) = -6a(v) - 17w(v). Calculate q(m) + 2r(m). -m + 1 Let t(w) = 4w - 1. Let n(l) = 3l - l - 4l + 3l - 1. Calculate 3n(k) - t(k). -k - 2 Let b(d) = 38d + 3. Let i(x) = -3838x - 304. What is 304b(u) + 3i(u)? 38u Let z(c) be the first derivative of 2c3 + 11c*2/2 - 6c + 11. Let j(k) = k*2 + 2k - 1. What is -22j(y) + 4z(y)? 2y2 - 2 Let d(g) be the second derivative of 4g3/3 - g2 - 24g. Let q(p) = -4p + 1. What is -3d(m) - 5q(m)? -4m + 1 Let w(x) = 3x*2 + 3. Let z be 78/3(-2)/(-4). Let y = 14 - z. Let n(q) = q*2 + 1. Give yw(j) - 4n(j). -j2 - 1 Let k(u) = -16u*3 + 11u*2 - 21u - 4. Let z(i) = 3i3 - 2i*2 + 4i + 1. Let w(g) = 2k(g) + 11z(g). Let a(t) = -2t3 - 3t - 4. Give 2a(o) + 3w(o). -o*3 + 1 Let h(t) = -11t*2 - t + 5. Let v(y) = 16y*2 + y - 7. What is 7h(q) + 5v(q)? 3q*2 - 2q Let z(i) = 3i2 - 3i. Let h(l) = 3l2 - 4l. Determine 3h(g) - 4z(g). -3g2 Let d(s) = -s. Let q(m) = -27m + 1. Give -2d(i) + q(i). -25i + 1 Let f(o) be the second derivative of -o4/2 - o3/2 + o*2 - 16o. Let n(h) be the first derivative of h3/3 + h2/2 - 1. Give -f(l) - 4n(l). 2l*2 - l - 2 Let b(j) = -15j*3 - 13j*2 - 9. Let m(q) = 4 - 2q*3 + 1 + 10q*3 + 4q*2 + 3q*2. Determine 6b(h) + 11m(h). -2h3 - h2 + 1 Let n(a) = -a*3 + 2a + 1. Let v be n(2). Let i(z) = -5z - 1. Let c(m) = m. What is vc(y) - i(y)? 2y + 1 Let j(v) = v2 - v. Let d(q) = 0 - 4 + 8 - 5 - q3 - 6q + 6q2. Calculate -d(o) + 6j(o). o*3 + 1 Let a(j) = 152j*3 + 28j + 100. Let h(k) = 17k3 + 3k + 11. Let c(z) = 3a(z) - 28h(z). Let r(o) = -7o3 - 3. Give -3c(l) + 8r(l). 4l*3 Let u(a) = -4a - 8. Let q(r) = 17r + 32. What is 2q(p) + 9u(p)? -2p - 8 Let z(q) = 5q + 12. Let f(v) = 4v + 11. What is 7f(p) - 6z(p)? -2p + 5 Suppose 9a = 4a + 4y, y - 3 = 2a. Let u(g) = -5g - 3. Let f(w) = -11w - 7. Give af(p) + 9u(p). -p + 1 Let n(q) = -2q*2 - 9q - 12. Let m(a) = a + 1. What is -6m(f) - n(f)? 2f*2 + 3f + 6 Let n(a) = a*2 - 2a. Let z be -1 - -1 - 30/(-6). Let y be (-4)/(-6) - (-13)/3. Let p = 3 - y. Let u(g) = 3g2 - 5g - 1. Determine pu(b) + zn(b). -b*2 + 2 Let b(v) = 4 - v - 6 - v. Let a be b(2). Let c(l) = 2l2 + 6. Let y(w) be the second derivative of w4/2 + 17w2/2 + 2w - 4. What is ay(o) + 17c(o)? -2o2 Let o(h) be the second derivative of 2h*2 - 2/3h*3 + h + 0. Let x be 48/(-20) - (-6)/(-10). Let w(u) = -u + 1. Calculate xw(a) + o(a). -a + 1 Suppose -7k = -5k + 4. Let h = k + 10. Let v(c) = -9c + 5. Let w(d) = 14d - 8. Give hv(a) + 5w(a). -2a Let l(j) = -2j*2 + 7j + 2. Let o(b) = 2b2 - 6b - 2. Give -6l(k) - 7o(k). -2k2 + 2 Let u(w) be the third derivative of -11w*4/24 - 2w*3/3 + 5w*2. Let o(b) = -b + 8. Let m(a) = -7. Let y(n) = -6m(n) - 5o(n). What is -6u(q) - 13y(q)? q - 2 Let g(v) = -5v*2 - 5v - 2. Let t(f) = -4f2 - 4f - 2. Give -5g(w) + 6t(w). w2 + w - 2 Let p(a) be the third derivative of -a4/8 - a*3/3 - 36a*2. Let x(r) = -14r - 11. Calculate 11p(c) - 2x(c). -5c Let o(r) = -r + 1. Let t(h) = 7h - 4. Determine 4o(g) + t(g). 3g Let o(v) = -v. Let x(t) = 5t - 4. Let q(p) = -6p + 5. Let w(s) = -4q(s) - 5x(s). Give -3o(g) + 4w(g). -g Let x = 16 + -12. Let i(u) = u - 1. Let y(q) = 6q - 5. What is xi(b) - y(b)? -2b + 1 Let w(c) = -6c*3 + 2c*2 - 2c - 2. Let a(p) = p*3. Determine -4a(d) - w(d). 2d3 - 2d*2 + 2d + 2 Let f(g) = 6g3 + 2g*2 + 8g + 8. Let j(c) = 4c3 + c2 + 5c + 5. Let p = -20 + 11. Let r = 13 + -9. Let k = r + p. Calculate kf(x) + 8j(x). 2x3 - 2x2 Let x(d) = d2. Let m(o) = -7o2. Let a = -71 - -32. What is ax(s) - 6m(s)? 3s*2 Let l(d) = 15d*2 - 3d + 1. Let j(h) = -10h2 + 2h - 1. Determine -8j(t) - 5l(t). 5t2 - t + 3 Let c(z) = 4z - 7. Let n(h) = 4h - 6. What is -3c(f) + 2n(f)? -4f + 9 Let n(d) = 6d2 - d - 9 - 3d - 8d3 + 4 - 2d. Suppose -q = 3q - 20. Let m(p) = 7p*3 - 5p*2 + 5p + 4. Give qn(u) + 6m(u). 2u3 - 1 Let m(z) be the second derivative of 2z*3/3 + 7z*2/2 - z. Let f(d) = 6d + 2. Let t(a) = a. Let h(v) = f(v) - 5*t(v). Wh	{ "pile_set_name": "DM Mathematics" }
mainder when 468 is divided by 237? 231 Calculate the remainder when 207 is divided by 26. 25 What is the remainder when 42 is divided by 10? 2 What is the remainder when 44 is divided by 4? 0 Calculate the remainder when 3016 is divided by 108. 100 Calculate the remainder when 983 is divided by 33. 26 What is the remainder when 800 is divided by 792? 8 Calculate the remainder when 10 is divided by 10. 0 What is the remainder when 2035 is divided by 170? 165 What is the remainder when 4434 is divided by 4? 2 Calculate the remainder when 199 is divided by 53. 40 What is the remainder when 652 is divided by 627? 25 What is the remainder when 129 is divided by 50? 29 What is the remainder when 30 is divided by 13? 4 What is the remainder when 19 is divided by 11? 8 What is the remainder when 77 is divided by 39? 38 Calculate the remainder when 122 is divided by 114. 8 Calculate the remainder when 26619 is divided by 416. 411 Calculate the remainder when 363 is divided by 61. 58 What is the remainder when 200 is divided by 97? 6 What is the remainder when 384 is divided by 11? 10 What is the remainder when 85 is divided by 19? 9 Calculate the remainder when 3140 is divided by 55. 5 What is the remainder when 157 is divided by 51? 4 What is the remainder when 1358 is divided by 85? 83 What is the remainder when 257 is divided by 86? 85 What is the remainder when 111 is divided by 21? 6 What is the remainder when 14012 is divided by 4668? 8 Calculate the remainder when 248 is divided by 241. 7 Calculate the remainder when 410 is divided by 137. 136 Calculate the remainder when 19 is divided by 14. 5 What is the remainder when 35 is divided by 18? 17 Calculate the remainder when 242 is divided by 81. 80 What is the remainder when 744 is divided by 47? 39 Calculate the remainder when 696 is divided by 142. 128 Calculate the remainder when 1195 is divided by 16. 11 Calculate the remainder when 523 is divided by 140. 103 What is the remainder when 2471 is divided by 79? 22 Calculate the remainder when 1225 is divided by 3. 1 What is the remainder when 130 is divided by 49? 32 What is the remainder when 63 is divided by 42? 21 What is the remainder when 49 is divided by 30? 19 What is the remainder when 737 is divided by 273? 191 Calculate the remainder when 22003 is divided by 163. 161 What is the remainder when 66 is divided by 13? 1 What is the remainder when 481 is divided by 18? 13 Calculate the remainder when 841 is divided by 354. 133 What is the remainder when 4551 is divided by 134? 129 What is the remainder when 612 is divided by 590? 22 Calculate the remainder when 1111 is divided by 60. 31 What is the remainder when 429 is divided by 209? 11 Calculate the remainder when 1300 is divided by 31. 29 What is the remainder when 487 is divided by 238? 11 What is the remainder when 1288 is divided by 80? 8 What is the remainder when 1005 is divided by 14? 11 Calculate the remainder when 2479 is divided by 22. 15 What is the remainder when 2065 is divided by 687? 4 What is the remainder when 4765 is divided by 1566? 67 Calculate the remainder when 3062 is divided by 15. 2 Calculate the remainder when 526 is divided by 523. 3 Calculate the remainder when 242 is divided by 41. 37 What is the remainder when 1098 is divided by 25? 23 Calculate the remainder when 51 is divided by 13. 12 Calculate the remainder when 1942 is divided by 329. 297 Calculate the remainder when 26 is divided by 2. 0 Calculate the remainder when 3720 is divided by 919. 44 Calculate the remainder when 280 is divided by 48. 40 Calculate the remainder when 141 is divided by 48. 45 What is the remainder when 1037 is divided by 106? 83 Calculate the remainder when 814 is divided by 24. 22 Calculate the remainder when 112 is divided by 20. 12 What is the remainder when 13496 is divided by 10? 6 What is the remainder when 3464 is divided by 1730? 4 What is the remainder when 939 is divided by 307? 18 Calculate the remainder when 725 is divided by 43. 37 Calculate the remainder when 82 is divided by 24. 10 What is the remainder when 176 is divided by 89? 87 What is the remainder when 976 is divided by 35? 31 What is the remainder when 2310 is divided by 763? 21 Calculate the remainder when 638 is divided by 32. 30 What is the remainder when 33 is divided by 18? 15 What is the remainder when 702 is divided by 3? 0 Calculate the remainder when 940 is divided by 23. 20 Calculate the remainder when 36 is divided by 16. 4 What is the remainder when 428 is divided by 33? 32 Calculate the remainder when 88 is divided by 70. 18 Calculate the remainder when 237 is divided by 50. 37 What is the remainder when 69 is divided by 10? 9 Calculate the remainder when 48 is divided by 24. 0 Calculate the remainder when 418 is divided by 30. 28 What is the remainder when 498 is divided by 167? 164 Calculate the remainder when 196 is divided by 66. 64 Calculate the remainder when 530 is divided by 254. 22 What is the remainder when 126 is divided by 47? 32 Calculate the remainder when 6189 is divided by 86. 83 Calculate the remainder when 212 is divided by 66. 14 Calculate the remainder when 1708 is divided by 350. 308 Calculate the remainder when 266 is divided by 34. 28 What is the remainder when 92 is divided by 86? 6 What is the remainder when 1061 is divided by 152? 149 Calculate the remainder when 96 is divided by 17. 11 Calculate the remainder when 35 is divided by 10. 5 Calculate the remainder when 766 is divided by 24. 22 Calculate the remainder when 174 is divided by 146. 28 What is the remainder when 33 is divided by 12? 9 What is the remainder when 256 is divided by 97? 62 Calculate the remainder when 44 is divided by 15. 14 Calculate the remainder when 190 is divided by 190. 0 Calculate the remainder when 7070 is divided by 18. 14 What is the remainder when 5291 is divided by 12? 11 Calculate the remainder when 191 is divided by 65. 61 What is the remainder when 15516 is divided by 21? 18 Calculate the remainder when 246 is divided by 229. 17 What is the remainder when 1400 is divided by 236? 220 What is the remainder when 1803 is divided by 175? 53 What is the remainder when 2177 is divided by 121? 120 Calculate the remainder when 291 is divided by 36. 3 What is the remainder when 80 is divided by 26? 2 Calculate the remainder when 128 is divided by 23. 13 Calculate the remainder when 1758 is divided by 16. 14 Calculate the remainder when 5826 is divided by 24. 18 What is the remainder when 3300 is divided by 257? 216 Calculate the remainder when 250 is divided by 15. 10 Calculate the remainder when 262 is divided by 26. 2 What is the remainder when 792 is divided by 13? 12 What is the remainder when 300 is divided by 43? 42 Calculate the remainder when 653 is divided by 41. 38 Calculate the remainder when 597 is divided by 120. 117 Calculate the remainder when 538 is divided by 106. 8 Calculate the remainder when 242 is divided by 46. 12 Calculate the remainder when 67 is divided by 28. 11 Calculate the remainder when 59 is divided by 15. 14 What is the remainder when 85 is divided by 13? 7 Calculate the remainder when 176 is divided by 49. 29 What is the remainder when 740 is divided by 14? 12 What is the remainder when 4481 is divided by 83? 82 Calculate the remainder when 124 is divided by 53. 18 What is the remainder when 986 is divided by 327? 5 Calculate the remainder when 883 is divided by 13. 12 What is the remainder when 53 is divided by 16? 5 Calculate the remainder when 35813 is divided by 37. 34 What is the remainder when 11017 is divided by 688? 9 Calculate the remainder when 81 is divided by 28. 25 What is the remainder when 80 is divided by 33? 14 What is the remainder when 554 is divided by 138? 2 What is the remainder when 3892 is divided by 118? 116 What is the remainder when 892 is divided by 156? 112 What is the remainder when 1901 is divided by 932? 37 What is the remainder when 57 is divided by 1? 0 Calculate the remainder when 108 is divided by 20. 8 What is the remainder when 961 is divided by 128? 65 Calculate the remainder when 148 is divided by 14. 8 Calculate the remainder when 4717 is divided by 143. 141 Calculate the remainder when 14129 is divided by 10. 9 W	{ "pile_set_name": "DM Mathematics" }
c))/cc) assuming c is positive. c(-61/5) Simplify m12/m(2/7)(m/m*(-1/3))/mm/(m/m(2/31)) assuming m is positive. m(7885/651) Simplify ((v*(-15)/vv(-12))(-33))(-36) assuming v is positive. v(-33264) Simplify (a((aaa(-1/3)a)/a)/aaa/a*5a*(-5)/aa(2/13))(-22) assuming a is positive. a(6160/39) Simplify ((z(-1/11)zzzz*(-4/13)zz)/((z/(zz3/z))/z(-1)))(5/8) assuming z is positive. z(4005/1144) Simplify ((s/((ss/(s(-3/7)s))/s)s(-2/9)ss)/(s8/(ss/(s/(sss*(-2/13)ss)))))(-26) assuming s is positive. s(1318/63) Simplify ((h/(h(-2/5)h)h)/(h(-13)h))/(h*(-9)/(h/((hh/h*(-5/3))/hh))) assuming h is positive. h(296/15) Simplify ((y(4/7)/y)/y(-30))/(y13y)(13/7) assuming y is positive. y(25/7) Simplify ((f/(ff*(-1)/f)f)*(-2/5)/((ff/(ff(-1)))/f)(4/15))(-8/3) assuming f is positive. f(176/45) Simplify ((h(h*(1/5)/h)/hh)/h*(-4/7))/((hh(-10/9))/h)(-41) assuming h is positive. h*(-14107/315) Simplify ((yyy/y(3/16)y)(-3/13))26 assuming y is positive. y(-183/8) Simplify (((l2/l)(-39))(-40))32 assuming l is positive. l49920 Simplify ((v/(v(vv*(5/7)v)/v))/vv18)(-44) assuming v is positive. v(-4708/7) Simplify ((p3/p(-3))0)(22/7) assuming p is positive. 1 Simplify (l(-1/4)l/(l*(-4/13)/l))/(ll/(l*(11/4)l)ll0) assuming l is positive. l(73/26) Simplify (w(1/11))(-1/25)/((ww(1/10)/w)/(w/(ww/(w(-3/10)/w)))) assuming w is positive. w(-661/275) Simplify (w/(w/((w/(w*(-4)/w))/w)w))*(5/21)w12/w(-4/11) assuming w is positive. w(3076/231) Simplify (y(-2/5)/(y(-15)/y))(-1/41) assuming y is positive. y(-78/205) Simplify ((s4/ss)/(s/s(-1/4))s/((s/(s*(-4/5)/s))/s)s(-3/5))(-5/7) assuming s is positive. s*(-27/28) Simplify (n/(nn*(2/25)n))*(-7/5)(n(n/(nn/(n/(n/(n(n3/n)/nn))n))n)/nn)48 assuming n is positive. n(30189/125) Simplify x(-2/11)x*(-4)/x(x15)(2/39) assuming x is positive. x*(-631/143) Simplify ((mmm(2/3))(-25)/((m/((m/(m(m/(m/m0))/m))/m))/(m/(m(-1/14)/m))))(-2/7) assuming m is positive. m(2755/147) Simplify ((qq/(q5/q)q)/q(6/5))/(q(-5)/(qq4)) assuming q is positive. q(39/5) Simplify (((ddd7)/d(-2/29))/((dd(-4))/d(-1/4)))(-24) assuming d is positive. d(-8226/29) Simplify c6/(c/(c/c(3/11)ccc)c)(c/c(3/7))/c(2/53) assuming c is positive. c(33713/4081) Simplify ((lll(-8)ll)/lll)/(l(2/27)l)ll*(-8)l(20/9)/l assuming l is positive. l(-266/27) Simplify (r/(rr/((r/r(-1/9))/r))(r*12/rr)/r)/((r/r*(6/7)r)/r8) assuming r is positive. r(1069/63) Simplify (((u/(((u*(-4)/u)/u)/u))/(uu*(-2/17)))/(uu*6u/(u/(u(2/3)/u))))6 assuming u is positive. u(46/17) Simplify (g(-2/5))*(1/12)/((g(g/(gg8))/gg)/g(2/41)) assuming g is positive. g(8629/1230) Simplify ll(-15)lll*(7/3)ll(4/5)(lll(l/(ll(l18l)/ll)ll)/ll)/l assuming l is positive. l(-358/15) Simplify ((b33)(-11/5))43 assuming b is positive. b*(-15609/5) Simplify (s/(ss/s*(-4/11)sss)s10)/((s/(ssss*(1/9)s))/(ss(2/33)s)) assuming s is positive. s*(1070/99) Simplify (uu3)(-4/15)/((u*(-3)u)/u)(-21) assuming u is positive. u(-961/15) Simplify ((r/(r/(r(12/7)/r)))/r(-13))/(rr/(rr(-5)))(10/13) assuming r is positive. r(828/91) Simplify (z10zz/(z((zz/(zz(-9)))/z)/z))/((z/(zzzz*(-7))z)/zz/(((z5/z)/zzzzz)/zz)) assuming z is positive. z*4 Simplify ((tt(-4/5)/t)(-21))(8/5) assuming t is positive. t(672/25) Simplify c/(ccc*(-2)/cc)c(-1)c*1/(c/(cc*(-5)c)) assuming c is positive. c*(-3) Simplify (pp*6(p/p*7)/p(pp(-1))(-25))(-12) assuming p is positive. 1 Simplify ((a(-8/5))(-8/7))(-1/16) assuming a is positive. a(-4/35) Simplify (y(1/11)y(yy*(-6)y)/yy/(yy*(-1/9)y)(yy(-7))/y)(2/113) assuming y is positive. y(-2336/11187) Simplify (m(-1/12)mmm)(-6)(m/m(1/4))(-7) assuming m is positive. m*(-91/4) Simplify (((o/(o/(o(oo3)/o)o))/o15)(3/7))(1/15) assuming o is positive. o(-12/35) Simplify m(3/7)/(m/((m10m)/m)m)m10/m11 assuming m is positive. m(52/7) Simplify (oo(-1))(-1/7)(o(1/3))(-21) assuming o is positive. o(-7) Simplify ((z21)(-31/2))(-4) assuming z is positive. z1302 Simplify (q/q(-1/6))(-23)qq/((q/(qq*(-1/6)q))/qq)(q/q*9)/qq assuming q is positive. q*(-32) Simplify ((j/(j(j/(j*(-1/10)j)j)/j))/(j/(j(j*(-21)j)/j)))20 assuming j is positive. j(-422) Simplify (f(2/57)/(f(3/5)f))/((ff*21f)/(ff(-15)f)) assuming f is positive. f*(-10706/285) Simplify (k/(kkk/(kk*(-22))k))/(k/(k*(-5/9)k))k(-21)k/(kk/(kk*(2/21))k) assuming k is positive. k*(-2927/63) Simplify ((ss/(s/(s/((s/s*(-1))/s))s))*(2/27)ss(-2/7)s(-3))(2/107) assuming s is positive. s(-32/749) Simplify a(-16)/a*19a(-9/5)/((a(-6)/a)/a) assuming a is positive. a*(-144/5) Simplify (j(jj(4/9)j)/jj8)/(j(-8)jj/((j/j(-2/25))/j)j) assuming j is positive. j(3493/225) Simplify j(-9/4)(jjj/j(-23)j)/jj(3/20)j(-1/4) assuming j is positive. j(473/20) Simplify (oo/((oo/((ooo*(-6/7)ooo)/o))/o)oo)*25(o/(oo/o(-18)o))/(o/(oo(2/17))) assuming o is positive. o(15909/119) Simplify f(-27)ff(f/(f*(1/30)f))/ff(f0)(-34) assuming f is positive. f(-751/30) Simplify (d(-17)/(((d/(d(d/d(-2/45))/d))/d)/d))/((d(2/39)dd)/(d(2/3)d)) assuming d is positive. d*(-8974/585) Simplify ((zz*(1/5)/zz)*(-31)(zz(-1/4))/z(zz0)/z)(9/7) assuming z is positive. z(-963/20) Simplify ((m(3/4))(-3))(-32) assuming m is positive. m72 Simplify (k/k(13/4))/kkk(-8)kk/k38k/(((kk(-9/8))/k)/k) assuming k is positive. k(-345/8) Simplify (ttttt/(t/t(-2/37)))/(t(19/3)t)(t/(t(t*(-4/13)t)/tt))/t(12/7) assuming t is positive. t(-58525/10101) Simplify ((m/m21)/m(4/17))/((m(-9/7)m)/(m/(mmm*4mm))) assuming m is positive. m(-3207/119) Simplify ((((q(-2)/q)/q)/q(q*(-1/9)q)/qq)/(q0qq)(5/2))(-46) assuming q is positive. q(3772/9) Simplify (z(-2/23)/z)42/(z(1/8)/z(-6)) assuming z is positive. z(-9527/184) Simplify (h(-1/3)/(hhhhh7/hhh)(h*6/hh)/h(-1))(2/21) assuming h is positive. h*(-32/63) Simplify ((qq(-1/2))(-3/8)/(q*(-5)qq/(q/(qq(-2/5)))))(-23/5) assuming q is positive. q(-5911/400) Simplify ((b(2/23)bb(3/10))43)(-1/14) assuming b is positive. b(-13717/3220) Simplify (k*16/kk)/kkk/k*29kkkk(-10)/(k(-13)/k) assuming k is positive. k(-5) Simplify ((y(2/5))(-6)(yy/(y(1/5)/y))(-36))(-15/8) assuming y is positive. y(387/2) Simplify (c/((c(-6/19)c)/c)cc19)(-1/10) assuming c is positive. c(-81/38) Simplify ((q(-19)q)/(q/(((qqq(-5))/qqq)/q)))/(q(-2/5)q*(-20)q) assuming q is positive. q(-13/5) Simplify ((((n(2/7)n)/n)(-1/26))(-3/14))(19/3) assuming n is positive. n(19/1274) Simplify ((a(-7/4)a)/a*(-40))/((a/((aaa(-40)a)/a))/((a(-2/35)/a)/a)) assuming a is positive. a(-253/140) Simplify ((kk(2/7)kk(2/35))(-47))(1/28) assuming k is positive. k(-1927/490) Simplify ((((z/z0zz)/z)(-13))(-24/11))39 assuming z is positive. z(24336/11) Simplify (n/(n/(n/(nn*(-6))))n)/(n/(n/(((nn12nnn)/nn)/n)))(n0/n)4 assuming n is positive. n*(-12) Simplify (((d/(dd/((dddd0)/d)d))(-6))(-9/5))*48 assuming d is positive. 1 Simplify (ss/(ss(-7/4)))/(ss*(-7))(s(-2)/s)/s(-15) assuming s is positive. s*(83/4) Simplify (i(i*(2/35)i)/i)*(-1/51)i19/((i(2/21)i)/i) assuming i is positive. i(11236/595) Simplify ((r/r37)/r(-8))/(((r(-13)/r)/r)/r35) assuming r is positive. r22 Simplify c(2/33)/c(-8/9)(cc(4/5))(-29) assuming c is positive. c(-25369/495) Simplify (p(-6)pp5p(p/(pp/p*4p))/(pp(-6)))(2/95) assuming p is positive. p(16/95) Simplify ((p/((pp/p3)/p))/p1)/(p*(1/5)/pp(-5)/p) assuming p is positive. p(44/5) Simplify b*(-12)bb6b*(-3)/bb((b/(b*(3/5)/b))/	{ "pile_set_name": "DM Mathematics" }
13 = 5m - 68. Let x = m + -12. What is the tens digit of (104/((-16)/4))/x? 2 Let o(q) = -7q + 5. Let z be o(2). Let r be ((-144)/10)/(z/30). What is the tens digit of 1/((-2)/r-2)? 1 Let f = -36 + 39. Let a(b) = -b3 + 3b*2 + 4b - 1. What is the units digit of a(f)? 1 Let v = -1 + 69. Suppose -20 = 6h - 2h, -h = t - v. What is the units digit of t? 3 Let l = -390 + 1118. What is the hundreds digit of l? 7 Let y be 0/4 + 6/3. Let s(l) = -6l - 2. Let c be s(-6). What is the tens digit of (y - (3 + 1)) + c? 3 Suppose 6y - 4y - 110 = 0. What is the units digit of y? 5 Let h(o) = -o + 11. Let p be h(5). Let j = -178 - -254. Suppose -g = z - 20, -5g - j = 3z - pz. What is the tens digit of z? 2 Let g(z) be the first derivative of z*4/4 - 10z3/3 - z2/2 + 10z + 6. Let v be g(10). Suppose 3l - 110 - 52 = v. What is the units digit of l? 4 Let a = 4547 - 2303. What is the units digit of a? 4 Let k(d) be the second derivative of d4/4 - d3/6 - 5d2 + 11d. What is the tens digit of k(-6)? 0 Suppose -4g = 5b, b = 3g + 2g. Suppose v - 45 - 88 = g. What is the hundreds digit of v? 1 Suppose 4m - 5f - 36 = -0m, 0 = 2f. What is the units digit of (-5)/10 - m/(-2)? 4 Suppose -5g + 195 = w, g = 3w - 3 + 26. Let b = g + -19. What is the units digit of b? 9 Let s = 23 - 18. Suppose -352 = -sc - 67. Suppose -k + 3l - 12 + c = 0, 5k - 155 = l. What is the units digit of k? 0 Let j(z) = 13 + 19z - 6z - 7z. Let v be j(-9). Let l = -8 - v. What is the tens digit of l? 3 Let a = 30 - 25. Let y be (-12)/1010/(-1). Let h = y - a. What is the units digit of h? 7 Suppose 4h = 4p - 20, 5h - 2p - 2p + 30 = 0. What is the units digit of 23 + h/(-35) + (-38)/(-14)? 6 Let y(h) = -1406h - 2. Let i be y(-3). Let z be i/20 - 8/10. What is the tens digit of ((-24)/60)/((-2)/z)? 4 Suppose 0 = -5q - 4x + 4805, -4x - 338 = -4q + 3542. Suppose -4m - q = -3k, -m - 2m - 966 = -3k. What is the units digit of k? 3 What is the hundreds digit of 32/6(12/(-3) - -262)? 3 Suppose 4d - 17 + 1 = 0. Suppose -dx = -x - 78. What is the tens digit of x? 2 Let i be 31/(3 + (-35)/10). Let v = i + 105. What is the units digit of v? 3 Suppose -255484 = -85b + 64626. What is the hundreds digit of b? 7 What is the units digit of -1(-45)/(-5) + 15? 6 Let x = 424 + -336. What is the units digit of x? 8 Let q = -11 + 14. Let z be (-126)/(-49)14/q. Let d = 26 - z. What is the tens digit of d? 1 Let o(j) be the first derivative of 13j*2/2 - 20j - 12. What is the units digit of o(8)? 4 Let o be 3 - (-150 - (-12)/(-3)). Suppose -4n - o = -805. What is the units digit of n? 2 Suppose -3a + 119 + 4 = 0. Suppose 2i - 111 = -a. What is the units digit of i? 5 Suppose -160q + 159q + 36 = 0. What is the units digit of q? 6 Let s(t) = -t + 13. Let w be s(17). Let f(r) = 7r*2 - 6r + 3. What is the hundreds digit of f(w)? 1 Suppose 0 = -3k - 0k + 6, -33 = -j + 2k. Let m = -21 + j. Let p = -12 + m. What is the units digit of p? 4 Let h(z) = -z3 - 10z*2 - 18z - 5. Let y be h(-8). Let x be 1(2 + 1 + -3). Suppose x = -2i + 59 - y. What is the tens digit of i? 2 Let i(k) be the first derivative of 2k2 + 4k + 8. What is the units digit of i(8)? 6 Let p = 6648 + -2144. What is the hundreds digit of p? 5 Let l(b) = 0b - 1 + 0 + 6b. Let h = -6 - -8. What is the tens digit of l(h)? 1 What is the hundreds digit of 2470/96 - (-328)/246? 6 Let d = -485 - -430. Let f be (-124)/(-12) - (-2)/3. What is the units digit of (-10)/d - (-108)/f? 0 What is the hundreds digit of (-8810)/(-26) + 4/26? 3 Suppose -29s - 26780 = -49s. What is the tens digit of s? 3 Let t(d) = -d - 7. Let s be t(-10). Suppose 3h = -p + 29, -3h - sp + 15 = -2h. What is the tens digit of 33 - h - (2 + -2)? 2 Let c(b) = b2 - 2b - 8. Let f be c(-7). Let n = f + 29. What is the units digit of n? 4 Let b = 4 + -9. Let g = 16 + b. Suppose h = -0h + g. What is the tens digit of h? 1 Let t = 83 + -23. Let f = -87 - -89. Suppose -fj + t = 2j. What is the tens digit of j? 1 Suppose -1449 = -2d - 399. What is the units digit of d? 5 Let c be -1 - 32/(-6) - (-3)/(-9). Suppose 4k = 2q + 8, -k - q = ck - 3. What is the units digit of k? 1 Let s = -5566 - -10640. What is the thousands digit of s? 5 What is the units digit of -2((-239)/2 + 2)? 5 Let w = -384 + 788. Suppose 0 = 7u - w + 26. What is the tens digit of u? 5 Let z(i) = i3 - 9i*2 + 11i - 19. Let d be z(9). Suppose -c + d + 30 = 0. What is the tens digit of c? 1 Let w(q) = q*3 - 5q*2 + 2q + 6. Let r be w(5). Let x = -39 + 57. Let d = x - r. What is the units digit of d? 2 Let r(s) = 5s + 616. What is the hundreds digit of r(0)? 6 Let o = 2 + 26. Let b be (-7)/o - (-78)/(-8). Let x = b + 20. What is the tens digit of x? 1 Let p(j) = -511j - 16. What is the hundreds digit of p(-1)? 4 Suppose 0 = -10t + 5t - 45. What is the units digit of 699/(1/(-3)t)? 3 Let h be 6((-30)/(-9) + -3). Suppose -224 = -hs + t, -4s + 244 + 204 = -5t. What is the hundreds digit of s? 1 Let c(q) = 8q - 9 + 3 - 3. Suppose 11b = 31 + 2. What is the tens digit of c(b)? 1 Let f(d) = -10d - 26. Let t be f(-9). Let h = t + -49. What is the tens digit of h? 1 What is the tens digit of (-18)/(-15) - 47328/(-85)? 5 Let l(d) be the third derivative of d5/60 + d4/12 - d*3/6 - 9d*2. What is the units digit of l(-4)? 7 Suppose 6307 - 319 = 4j. What is the thousands digit of j? 1 Suppose 15g - 17g = -376. Let k = g - 86. What is the units digit of k? 2 Let z = 153 + -150. Suppose -5k = -5g + 755, 0g + zk = -g + 143. What is the hundreds digit of g? 1 Let p(r) = r*2 + 8r + 1. Let x be p(-8). Let i be 2 + x - (1 + -158). Suppose 0 = 4v - i + 60. What is the tens digit of v? 2 Suppose -j = 28 - 97. Let z be (52 + -3)/(-1 + 18/9). Let s = j - z. What is the units digit of s? 0 Let o(h) = -331h + 60. What is the units digit of o(-6)? 6 Let y be (-1656)/(-20) + (-1)/(-5). Suppose 45 = -2t - y. Let n = t + 138. What is the units digit of n? 4 Suppose 3l = -2v + 23, -2l - 5v = -4l + 28. Let y = l + 18. Let g = y - 26. What is the units digit of g? 1 Let a = 19 - 3. Suppose aw - 137 = 167. What is the tens digit of w? 1 What is the thousands digit of 4/(-26) - 58389/(-39)? 1 Let h(m) = -m2 - 30m + 0 - 12 + 4 - 5. What is the tens digit of h(-26)? 9 Let d be (4 + -1)/(-3) + 87. Let m = d - 47. What is the tens digit of m? 3 Suppose 37 - 202 = -15m. Let k(g) be the second derivative of -g4/12 + 7g*3/3 - 5g*2 - g. What is the units digit of k(m)? 3 Let t be 30/(-2 - 0)-3. Suppose 5v = 16 + 9. Suppose -w + vw = 3d + t, -5d + 3 = 2w. What is the units digit of w? 9 Let d(r) be the first derivative of 1/2r*2 + 1 - 6r. What is the units digit of d(9)? 3 Let i be ((-4)/(-10))/((-4)/(-140)). Suppose 4 + 2 = -2g, -k = -g - i. What is the units digit of k? 1 Suppose -5c + 22 = -3s, 3s - 10 = -3c + 8s. Suppose cf = -2y - y + 6, -2f = 5y - 10. Suppose -y = -u + 13. What is the units digit of u? 5 Suppose -v + 2 = -0. Suppose 8p - 7p + v = 0. What is the units digit of (51/(-2))/(p/4)? 1 Suppose -58 = 21v - 23v. Suppose -u - 4r = -v, r - 19 + 68 = u. What is the units digit of u? 5 Suppose -y = 5y + 222. Suppose -f + d = 3f + 50, 0 = 3f + d + 41. Let v = f - y. What is the units digit of v? 4 Let c be ((-129)/(-45) - -1) + (-6)/(-45). Suppose -cn = -343 - 325. What is the tens digit of n? 6 Suppose 15p + 240 = 19p. What is the units digit of p? 0 Let j(v) = 27v*2 + 2v. Let l be j(2). Let b = 188 - l. What is the units digit of b? 6 Suppose -2i = v + 681 - 3263, 12886 = 5v - 2i. What is the units digit of v? 8 Let i(n) = 34n*3 + 2n*2 + n - 7. Let f = -144 + 146. What is the tens digit of i(f)? 7 Let p(k) = 10k*2 + 57k + 17. What is the tens digit of p(-12)? 7 Let n(o) = -362o + 58. What is the hundreds digit of n(-2)? 7 Let g(j) = 14j - 1. Let b be g(-1). Let x = -14 - b. What is the units digit of (2x)/((-2)/(-20))? 0 Let l = 19 + -19. Suppose -j + 412 = -4b + 1336, b = l. What is the tens digit of 2/12 - j/72? 1 What is the tens digit of (-17460)/(-28) - (-45)/105? 2 Suppose -4s = 2x - 754, -2s + s + 193 = 5x. What is the units digit of s? 8 Let u(q) = 3q - 6q +	{ "pile_set_name": "DM Mathematics" }
t is the units digit of 93940? 0 What is the thousands digit of 7075808? 5 What is the hundred thousands digit of 7539587? 5 What is the hundreds digit of 1632183? 1 What is the tens digit of 2249505? 0 What is the units digit of 27715561? 1 What is the millions digit of 1391006? 1 What is the hundreds digit of 671422? 4 What is the units digit of 1585866? 6 What is the hundreds digit of 389172? 1 What is the hundred thousands digit of 3639009? 6 What is the millions digit of 22908350? 2 What is the units digit of 2702? 2 What is the thousands digit of 8545088? 5 What is the thousands digit of 1237011? 7 What is the units digit of 13031390? 0 What is the tens digit of 941661? 6 What is the tens digit of 2560596? 9 What is the hundred thousands digit of 904868? 9 What is the ten thousands digit of 474581? 7 What is the thousands digit of 2237563? 7 What is the hundreds digit of 207079? 0 What is the thousands digit of 885910? 5 What is the millions digit of 9837899? 9 What is the hundred thousands digit of 223485? 2 What is the units digit of 558939? 9 What is the hundreds digit of 324972? 9 What is the thousands digit of 151845? 1 What is the thousands digit of 176402? 6 What is the hundreds digit of 38799836? 8 What is the hundred thousands digit of 165607? 1 What is the hundred thousands digit of 14177136? 1 What is the hundred thousands digit of 6660334? 6 What is the thousands digit of 892528? 2 What is the thousands digit of 734180? 4 What is the millions digit of 1920909? 1 What is the ten thousands digit of 273683? 7 What is the ten millions digit of 15120922? 1 What is the tens digit of 191163? 6 What is the units digit of 658049? 9 What is the units digit of 564760? 0 What is the ten thousands digit of 140501? 4 What is the hundreds digit of 1371061? 0 What is the thousands digit of 384998? 4 What is the hundreds digit of 1790177? 1 What is the hundreds digit of 673660? 6 What is the thousands digit of 795807? 5 What is the hundred thousands digit of 6164829? 1 What is the hundred thousands digit of 963931? 9 What is the thousands digit of 710893? 0 What is the thousands digit of 11906249? 6 What is the units digit of 1605326? 6 What is the millions digit of 1368686? 1 What is the units digit of 1085256? 6 What is the ten thousands digit of 452434? 5 What is the ten thousands digit of 257083? 5 What is the hundred thousands digit of 3397553? 3 What is the ten thousands digit of 1697248? 9 What is the tens digit of 779080? 8 What is the ten thousands digit of 2614541? 1 What is the thousands digit of 2418444? 8 What is the millions digit of 2248162? 2 What is the units digit of 11297306? 6 What is the ten thousands digit of 14602748? 0 What is the thousands digit of 3711? 3 What is the tens digit of 874304? 0 What is the tens digit of 127928? 2 What is the hundreds digit of 9920742? 7 What is the ten thousands digit of 2015077? 1 What is the hundreds digit of 5327785? 7 What is the units digit of 724134? 4 What is the hundreds digit of 399479? 4 What is the hundreds digit of 489763? 7 What is the hundred thousands digit of 105698? 1 What is the tens digit of 370552? 5 What is the thousands digit of 181099? 1 What is the millions digit of 5971616? 5 What is the tens digit of 40302? 0 What is the hundred thousands digit of 3269973? 2 What is the hundreds digit of 25435097? 0 What is the units digit of 258666? 6 What is the millions digit of 5514748? 5 What is the hundreds digit of 2117325? 3 What is the thousands digit of 351955? 1 What is the millions digit of 33438107? 3 What is the ten thousands digit of 42611008? 1 What is the hundred thousands digit of 1463611? 4 What is the ten thousands digit of 267834? 6 What is the ten thousands digit of 278550? 7 What is the ten thousands digit of 3475123? 7 What is the tens digit of 797253? 5 What is the hundred thousands digit of 179994? 1 What is the ten thousands digit of 883554? 8 What is the units digit of 580189? 9 What is the units digit of 9610785? 5 What is the thousands digit of 3755309? 5 What is the hundred thousands digit of 10972010? 9 What is the hundreds digit of 9149671? 6 What is the units digit of 686787? 7 What is the hundreds digit of 838100? 1 What is the thousands digit of 105938? 5 What is the hundreds digit of 691031? 0 What is the units digit of 668350? 0 What is the hundreds digit of 835032? 0 What is the tens digit of 410762? 6 What is the millions digit of 1945245? 1 What is the hundreds digit of 283545? 5 What is the units digit of 31590716? 6 What is the ten thousands digit of 1286027? 8 What is the thousands digit of 237103? 7 What is the units digit of 204595? 5 What is the thousands digit of 513736? 3 What is the tens digit of 21839? 3 What is the units digit of 278244? 4 What is the thousands digit of 57851? 7 What is the ten thousands digit of 26277238? 7 What is the thousands digit of 374836? 4 What is the thousands digit of 164725? 4 What is the ten thousands digit of 4738870? 3 What is the hundreds digit of 686370? 3 What is the tens digit of 215147? 4 What is the thousands digit of 425279? 5 What is the units digit of 29537? 7 What is the tens digit of 308799? 9 What is the ten thousands digit of 537909? 3 What is the units digit of 797235? 5 What is the hundreds digit of 925257? 2 What is the tens digit of 83458? 5 What is the hundred thousands digit of 255667? 2 What is the hundred thousands digit of 2029086? 0 What is the hundred thousands digit of 1655964? 6 What is the ten millions digit of 13019179? 1 What is the thousands digit of 88539? 8 What is the hundred thousands digit of 1478290? 4 What is the hundreds digit of 4718845? 8 What is the units digit of 817668? 8 What is the thousands digit of 4668928? 8 What is the hundred thousands digit of 8587516? 5 What is the hundred thousands digit of 398247? 3 What is the units digit of 2029010? 0 What is the hundred thousands digit of 794075? 7 What is the ten millions digit of 25561214? 2 What is the units digit of 591360? 0 What is the thousands digit of 67127? 7 What is the millions digit of 14729014? 4 What is the millions digit of 5663205? 5 What is the hundreds digit of 15493508? 5 What is the units digit of 1523786? 6 What is the ten thousands digit of 2280285? 8 What is the units digit of 6103634? 4 What is the hundred thousands digit of 4574232? 5 What is the hundred thousands digit of 136586? 1 What is the ten thousands digit of 248948? 4 What is the tens digit of 629457? 5 What is the hundred thousands digit of 195150? 1 What is the units digit of 470942? 2 What is the thousands digit of 1127549? 7 What is the ten thousands digit of 427821? 2 What is the hundreds digit of 1371954? 9 What is the millions digit of 2725637? 2 What is the tens digit of 1297635? 3 What is the thousands digit of 463401? 3 What is the tens digit of 81879? 7 What is the tens digit of 5858910? 1 What is the thousands digit of 233509? 3 What is the hundred thousands digit of 1654644? 6 What is the hundreds digit of 104026? 0 What is the thousands digit of 1490163? 0 What is the hundreds digit of 11592089? 0 What is the tens digit of 4566093? 9 What is the ten thousands digit of 771327? 7 What is the hundreds digit of 11607084? 0 What is the hundreds digit of 61470? 4 What is the hundreds digit of 334843? 8 What is the units digit of 893704? 4 What is the hundreds digit of 380033? 0 What is the hundreds digit of 218935? 9 What is the units digit of 6757502? 2 What is the units digit of 4084289? 9 What is the units digit of 708000? 0 What is the millions digit of 24887129? 4 What is the hundred thousands digit of 185315? 1 What is the hundreds digit of 164302? 3 What is the hundreds digit of 125997? 9 What is the hundred thousands digit of 439411? 4 What is the thousands digit of 8836473? 6 What is the ten thousands digit of 180130? 8 What is the hundred thousands digit of 376291? 3 What is the hundreds digit of 841663? 6 What is the tens digit of 1102685? 8 What is the tens digit of 322183? 8 What is the hundred thousands digit of 4873388? 8 What is the hundreds digit of 1794782? 7 What is the units digit of 417263? 3 What is the ten thousands digit of 105647? 0 What is the millions digit of 22125721? 2 What is the	{ "pile_set_name": "DM Mathematics" }
he remainder when 439232 is divided by 21. 17 Calculate the remainder when 95244 is divided by 532. 16 What is the remainder when 2744 is divided by 156? 92 Calculate the remainder when 1585 is divided by 70. 45 What is the remainder when 232959 is divided by 208? 207 What is the remainder when 102949 is divided by 219? 19 What is the remainder when 72969 is divided by 62? 57 Calculate the remainder when 3271356 is divided by 69. 66 Calculate the remainder when 4803 is divided by 1593. 24 Calculate the remainder when 459 is divided by 452. 7 What is the remainder when 78524 is divided by 2? 0 What is the remainder when 3406 is divided by 1689? 28 What is the remainder when 10732 is divided by 11? 7 Calculate the remainder when 499332 is divided by 6935. 12 Calculate the remainder when 11561 is divided by 2890. 1 Calculate the remainder when 117 is divided by 15. 12 What is the remainder when 378069 is divided by 6? 3 What is the remainder when 70446 is divided by 117? 12 Calculate the remainder when 12570 is divided by 463. 69 Calculate the remainder when 7846 is divided by 309. 121 What is the remainder when 9995 is divided by 941? 585 What is the remainder when 41838 is divided by 211? 60 What is the remainder when 1057 is divided by 78? 43 Calculate the remainder when 2519 is divided by 43. 25 What is the remainder when 28929 is divided by 19? 11 Calculate the remainder when 6092 is divided by 1191. 137 Calculate the remainder when 5091 is divided by 29. 16 Calculate the remainder when 145619 is divided by 17. 14 Calculate the remainder when 83406 is divided by 47. 28 Calculate the remainder when 165622 is divided by 25. 22 Calculate the remainder when 3601 is divided by 257. 3 What is the remainder when 643 is divided by 149? 47 Calculate the remainder when 592021 is divided by 42286. 17 What is the remainder when 806 is divided by 386? 34 Calculate the remainder when 691095 is divided by 54. 3 What is the remainder when 2523507 is divided by 24? 3 What is the remainder when 32124 is divided by 946? 906 What is the remainder when 33135 is divided by 30? 15 Calculate the remainder when 43991 is divided by 60. 11 Calculate the remainder when 19095 is divided by 291. 180 What is the remainder when 170607 is divided by 235? 232 Calculate the remainder when 2306 is divided by 551. 102 Calculate the remainder when 108071 is divided by 127. 121 Calculate the remainder when 30866 is divided by 245. 241 What is the remainder when 29057 is divided by 9? 5 Calculate the remainder when 3139 is divided by 382. 83 What is the remainder when 18707 is divided by 103? 64 What is the remainder when 26748 is divided by 165? 18 Calculate the remainder when 12871 is divided by 61. 0 What is the remainder when 14744 is divided by 301? 296 What is the remainder when 6877 is divided by 629? 587 What is the remainder when 33497 is divided by 250? 247 What is the remainder when 3102 is divided by 13? 8 What is the remainder when 6682 is divided by 844? 774 What is the remainder when 69 is divided by 5? 4 What is the remainder when 7083 is divided by 18? 9 What is the remainder when 1923 is divided by 60? 3 What is the remainder when 4344771 is divided by 658? 655 Calculate the remainder when 23975 is divided by 358. 347 What is the remainder when 16034 is divided by 4006? 10 What is the remainder when 715899 is divided by 118? 111 What is the remainder when 87292 is divided by 3637? 4 Calculate the remainder when 13310 is divided by 4426. 32 Calculate the remainder when 24224 is divided by 24. 8 Calculate the remainder when 128687 is divided by 711. 707 Calculate the remainder when 678365 is divided by 688. 685 What is the remainder when 657 is divided by 17? 11 Calculate the remainder when 7395418 is divided by 230. 228 Calculate the remainder when 106347 is divided by 326. 71 Calculate the remainder when 7139 is divided by 21. 20 Calculate the remainder when 1347 is divided by 477. 393 Calculate the remainder when 14420 is divided by 764. 668 What is the remainder when 434320 is divided by 18? 16 Calculate the remainder when 78476 is divided by 628. 604 Calculate the remainder when 14438 is divided by 314. 308 Calculate the remainder when 5480 is divided by 1820. 20 Calculate the remainder when 3087 is divided by 13. 6 What is the remainder when 655757 is divided by 20? 17 What is the remainder when 30560 is divided by 3804? 128 Calculate the remainder when 86791 is divided by 1422. 49 What is the remainder when 55834 is divided by 206? 8 Calculate the remainder when 21696 is divided by 21696. 0 What is the remainder when 96280 is divided by 54? 52 What is the remainder when 12219 is divided by 939? 12 Calculate the remainder when 14598 is divided by 7275. 48 What is the remainder when 277018 is divided by 60? 58 Calculate the remainder when 7663 is divided by 453. 415 What is the remainder when 1096159 is divided by 41? 24 Calculate the remainder when 103597 is divided by 103532. 65 Calculate the remainder when 3557 is divided by 573. 119 Calculate the remainder when 12174 is divided by 811. 9 Calculate the remainder when 17051 is divided by 5583. 302 Calculate the remainder when 64 is divided by 17. 13 What is the remainder when 2912 is divided by 207? 14 What is the remainder when 36504 is divided by 36498? 6 Calculate the remainder when 1216 is divided by 133. 19 Calculate the remainder when 3857470 is divided by 662. 658 What is the remainder when 11993 is divided by 431? 356 What is the remainder when 96963 is divided by 3877? 38 What is the remainder when 5068 is divided by 556? 64 What is the remainder when 5392 is divided by 114? 34 What is the remainder when 364477 is divided by 23? 19 What is the remainder when 4165 is divided by 1372? 49 What is the remainder when 17110 is divided by 32? 22 What is the remainder when 781 is divided by 339? 103 What is the remainder when 2699 is divided by 308? 235 What is the remainder when 399259 is divided by 8? 3 Calculate the remainder when 49337 is divided by 345. 2 Calculate the remainder when 5957 is divided by 367. 85 What is the remainder when 3592287 is divided by 1568? 1567 Calculate the remainder when 91001 is divided by 279. 47 Calculate the remainder when 15862 is divided by 26. 2 What is the remainder when 59123 is divided by 14776? 19 What is the remainder when 1124 is divided by 63? 53 Calculate the remainder when 4468 is divided by 2230. 8 What is the remainder when 45447 is divided by 52? 51 What is the remainder when 268 is divided by 15? 13 Calculate the remainder when 1115 is divided by 112. 107 What is the remainder when 115364 is divided by 57661? 42 Calculate the remainder when 5919 is divided by 89. 45 Calculate the remainder when 3809 is divided by 512. 225 What is the remainder when 23724 is divided by 3917? 222 What is the remainder when 6568 is divided by 170? 108 Calculate the remainder when 539 is divided by 85. 29 What is the remainder when 38159 is divided by 81? 8 Calculate the remainder when 106498 is divided by 30. 28 Calculate the remainder when 303619 is divided by 170. 169 What is the remainder when 3354 is divided by 154? 120 Calculate the remainder when 2298 is divided by 1007. 284 What is the remainder when 26430 is divided by 781? 657 Calculate the remainder when 12625 is divided by 400. 225 Calculate the remainder when 24866 is divided by 8285. 11 Calculate the remainder when 12272 is divided by 941. 39 What is the remainder when 7079 is divided by 60? 59 What is the remainder when 26538 is divided by 344? 50 What is the remainder when 192492 is divided by 15? 12 What is the remainder when 9234 is divided by 298? 294 What is the remainder when 11033 is divided by 48? 41 What is the remainder when 241825 is divided by 28? 17 Calculate the remainder when 632 is divided by 180. 92 Calculate the remainder when 1200496 is divided by 39. 37 Calculate the remainder when 26822 is divided by 46. 4 What is the remainder when 3991 is divided by 502? 477 Calculate the remainder when 55692 is divided by 5563. 62 Calculate the remainder when 324327 is divided by 57. 54 Calculate the remainder when 37817 is divided by 305. 302 Calculate the remainder when 25849 is divided by 23. 20 W	{ "pile_set_name": "DM Mathematics" }
j2 + oj + tj3 and give v. -2 Express -4882 + 9761 - 4879 + 359y + 203y as l + ty and give t. 562 Express 1459h - 224h - 388h + 1622h - 3h as oh + u and give o. 2466 Express (-11 + 13 + 362s - 1 + 1)(-8s3 + 0s*3 - 4s*3) as g + ds*2 + ms*4 + hs + ws3 and give w. -24 Rearrange -163p + 1648p + 76p + 936p + 4866p + 1 to the form jp + y and give y. 1 Rearrange (n2 - 10 - 1305n + 1564n + 14)(-2n2 + 3n*2 + 2n*2) to fn + tn2 + ln*3 + gn*4 + b and give g. 3 Express -2762v*2 + 1828v*2 + 6 - 1 + 1702v*2 as c + mv*2 + sv and give m. 768 Express -274a2 - 1158000a + 6 + 1158000a as va*2 + ya + z and give v. -274 Rearrange -8c2 - 2c*2 + 4c*2 + (6c - 2c - 2c)(3839541 - 3839541 + 734c) to gc + mc*2 + k and give m. 1462 Express (-323c - 391c - 22c)(-6c3 + c3 + 3c3) + (c - 5c + 2c)(c3 - c3 + c*3) in the form hc*2 + n + dc*4 + fc*3 + mc and give d. 1470 Rearrange 4858 - 1622 - 1622 - 1297h3 - 1618 to the form vh*3 + n + th + qh2 and give n. -4 Rearrange 110i + 147i - 458i*2 + 49i + 456i2 - 77i to p + ai + ki*2 and give k. -2 Rearrange -904m + 3965m + 1003m + 2988m - 623m to jm + c and give j. 6429 Rearrange z + 1819 - 912 + 0z - 916 + (z + 3 - 3)(-2 + 3 + 3) to the form vz + j and give v. 5 Express -5j3 - j + j4 - 133j*2 + 4j*2 + 129j*2 + 2j*2 - 15 as oj*4 + vj + f + aj3 + ij*2 and give v. -1 Express (0 + 1 - 2 + (-1 + 0 + 3)(0 - 1 + 2) + 2 - 4 - 5)(-8h - 2h + 11h - 60) as sh + m and give m. 360 Express -41n*2 - 18n*3 - 39n*3 + 41n*3 in the form an*2 + b + zn*3 + xn and give a. -41 Express (298 + 340 + 41)(0d + 5d - 3d + (1 + 2 - 5)(4d + 0d - d)) as fd + a and give f. -2716 Express 11585o - 11600o - 2o4 + 2o2 + o2 - o*3 in the form qo*4 + io + ko3 + u + go*2 and give i. -15 Rearrange -2 + 2255g*2 - 4633g*2 - 3g*4 + 3083g*2 to n + ig*3 + zg*4 + lg + kg2 and give z. -3 Rearrange 52i*2 - 159i*2 + 38i*2 + 57i*2 + 132i to fi + yi*2 + h and give y. -12 Rearrange -80i*3 + 5630i4 - i2 + 81i3 + 56 - 5632i*4 - 2i to oi4 + ai*3 + ui*2 + p + ci and give c. -2 Rearrange 38h - 5h - h3 - h3 + 2h4 + 2h*2 - 24h - 13 + 6h to the form gh + m + bh4 + kh*3 + ch*2 and give k. -2 Express -105713t + 6t2 + 105597t - 2t2 in the form f + zt + ut2 and give z. -116 Rearrange (-2 + 5 - 1)(-38l + 9l - 25l)(-155 + 186 + 205 + 80) to b + wl and give w. -34128 Express (0f - 3f - 2f)(25f - 35f + 35f)(-5 + 99f + 7 - 2 + 320f) in the form hf*3 + r + qf*2 + if and give h. -52375 Rearrange (-2s + 4s - 3s)(-2 + 6 - 1)(2s - 3s + 2s) + 24s2 - 187s + 376s - 3 - 195s to hs + js*2 + q and give q. -3 Rearrange (-3y + 7 - 7)(-y - 4y + 3y)(5y + 7y - 5y)(-7 + 6 - 10) to the form k + dy2 + ay + fy3 and give f. -462 Express (2 - 3 - 1)(-4557 + 4c + 1401 + 1854) as d + zc and give z. -8 Express 5083113 + 3253h - 5083113 in the form q + lh and give l. 3253 Rearrange -21 + 6551v + 12 + 9 - 39961v to the form i + tv and give t. -33410 Express -223q + 82q2 + 478q - 4 - 255q as w + gq + sq2 and give w. -4 Rearrange (4 - 4y - 2 + 3y)(-8248y - 3744437 + 3744437 + (-2 + 2 - y)(1 - 2 - 1)) to jy2 + zy + u and give z. -16492 Rearrange 212y + 1586y + 741y + 189y to the form b + ry and give r. 2728 Rearrange (-2x*2 - 2x*2 + 2x*2)(2x2 - 5x*2 + 4x*2) + 13095 + 466x*4 - 13095 to jx*4 + n + hx*3 + ix*2 + zx and give j. 464 Express 153b3 + 134b*3 + 63b*3 - 3b*4 - 99b*3 - 7b + 6b - b2 as hb + l + ib2 + pb*4 + wb*3 and give w. 251 Express -157 + 14 - 7 - 14 + 21 - 3d in the form u + fd and give u. -143 Express 7 - 33 + 44t*3 - 37t3 - t2 - 5t2 + 5215t - 5213t in the form ut*2 + kt + y + it3 and give y. -26 Rearrange -5t + 302 + 0t + t3 + 31t*4 - 607 - 33t*4 + 312 - 10t*2 to the form ft*4 + yt + bt3 + wt*2 + s and give y. -5 Express (-3w + 4w + w)((40 - 12 + 136)(15 - 18 - 2w - 17) + 4w - 3w + 0w) as g + mw*2 + sw and give m. -654 Express 60d2 - 3711 + 1752 + 1846 in the form hd*2 + od + z and give h. 60 Rearrange 3019 - 1519 - a - 1472 - 2a2 + a3 to the form fa*3 + ra + ga2 + o and give r. -1 Rearrange (2 + 2n - 2 + (4n - 2n - 6n)(0 - 1 + 0))(-94n + 115n - 52n - 4) + (3 - 3 - n)(-2 + 2 - 2n) to the form u + ln2 + in and give l. -184 Express 1193m2 + 16m + 8m - 37m + 13m in the form v + im*2 + wm and give i. 1193 Rearrange 70r - 70r + 457r2 + (0r*2 - 4r*2 + 3r*2)(-1 - 1 + 1) + (-r + 2r - 6r)(0 - 2r + 0) to i + hr2 + tr and give h. 468 Express 17w3 - 10w - 66w2 - 5w + 11w3 - 33w*3 + 13w as qw3 + dw*2 + g + cw and give d. -66 Express -96b2 + 579b + 136b - 91b*2 + 284b*2 - 2 - 96b*2 in the form h + db + ub2 and give u. 1 Express (-22 + 628d*2 - 313d*2 - 311d*2)(-230d - 1 + 95d + 95d) in the form pd + vd2 + m + yd*3 and give y. -160 Rearrange 72i*3 - 52i*3 + 82i*3 + (0i*3 - 4i*3 + 2i*3)(0 + 0 - 10) to gi2 + si + ui3 + r and give u. 122 Rearrange -342u + 3 - 2 + 7 - 480u + 377u + (-3 + 3 - 1)(-1 + u + 1) to the form yu + s and give y. -446 Rearrange 16w4 + 99w*4 - 259w*4 + (2w*3 - 3w*3 + 2w*3)(22 - 22 - 30w) to the form h + zw*3 + aw*4 + mw*2 + iw and give a. -174 Express (-75k - 11210 - 179k + 256k)(1 + 1 - 4 + 2k) in the form h + zk*2 + sk and give s. -22424 Express (3 + 3 - 4)(148684p + 155129p - 291426p) as n + rp and give r. 24774 Rearrange (-2 + 2m*2 + 2)(-1 + 1 - 10)(-28m + 2 - 79m + 18m) to the form x + fm + im*3 + nm*2 and give n. -40 Rearrange (124 - 87 - 444)(-p + 4 - 4)(0 - 1 + 5) to hp + v and give h. 1628 Rearrange -2g + 0g - 9096g3 + 4550g*3 - 181g*2 + 4544g*3 + 2 + 1 to hg*3 + jg*2 + og + s and give j. -181 Express (-2j2 + 2j*2 + 8j - 2j2)((-1 + 11 + 1)(-2 - 2 + 3) + 0 - 3 + 4)(2 - 5 + 4)(2j + 0j - 3j) as rj3 + fj*2 + lj + p and give r. -20 Express (1288x - 5655x + 334x)(-4x2 + x2 + 2x*2) as g + dx*3 + ox*2 + wx and give o. 0 Rearrange 5495a + 3218a + 2394a + 752a to pa + m and give p. 11859 Express 2460v - 6207v + 1747v in the form n + lv and give n. 0 Express (-147z - 261z - 289z + 31 - 13 - 18)(-1 - z + 1) as xz*2 + d + yz and give x. 697 Rearrange -1331j - 822j + 1 - 371j + 1 + 0 to the form mj + t and give m. -2524 Rearrange -38i - 1 - 20i - 22i - 45i + 2 to di + g and give g. 1 Express (-b2 + 4b*2 - 2b*2)(-1410 - 2403 - 1745 + 285) - b*2 - 2 + 2 in the form sb + n + pb2 and give p. -5274 Express -6c + 3c + 1498c*2 - 2210c*2 in the form gc + a + vc2 and give v. -712 Rearrange 197v + 33v - 32v + 42v + 78614 - 78669 to the form z + lv and give l. 240 Rearrange -152 + 31q - 149 - 26q + 218 - 125 to i + nq and give i. -208 Rearrange (-53004 - 13f*2 + 242f + 53004)((0 - 3 + 2)(0 - 3 + 2) + (2 + 0 + 0)(-2 + 0 + 0) - 1 + 3 - 1) to the form w + yf*2 + if and give i. -484 Rearrange (2i2 + 0 + 0)(-257i - 149i + 105 - 32 - 56) to ri3 + ji + ai2 + d and give r. -812 Rearrange d + 3d + 256d3 - 335d*3 - 430d*3 to the form b + ld*2 + pd*3 + id and give i. 4 Rearrange -42516r3 + 49 - 29r*2 + 42517r*3 - 152 to cr*3 + kr + w + fr2 and give f. -29 Express -69x*3 + 203x*3 + 2x + 6x2 - 64x*3 - 71x*3 in the form yx*3 + z + jx + ix2 and give j. 2 Express -3k - 182k3 - 209k*3 + 630k*3 - 123k*3 in the form xk*3 + ck*2 + ik + w and give i. -3 Express (-1 + 2l2 + 1)(-2 - 6 + 2) - 204l + 205l - 2l2 - 49 + l2 as nl + zl2 + q and give n. 1 Rearrange (26g*2 + 2g*2 - 4g*2)(2 + 2 - 1)(-33 + 71 + 71 + (0 + 2 + 0)(1 + 0 - 2)) to the form fg + d + wg*2 and give w. 7704 Rearrange (351b - 25b - 51b)(-2 + 0 + 1)(-4 + 1 + 4) + (6 - 3 - 2)(5b + 3b + b) - 4b + 0b + 6b to the form w + ib and give i. -264 Rearrange 232 - 165 - 4l - 4l - 587 - 172 to n + cl and give c. -8 Rearra	{ "pile_set_name": "DM Mathematics" }
f 6342131? 1783, 3557 List the prime factors of 12365559. 3, 23, 31, 41, 47 List the prime factors of 635784. 2, 3, 59, 449 List the prime factors of 362264. 2, 7, 6469 List the prime factors of 4675360. 2, 5, 29221 What are the prime factors of 314166? 2, 3, 52361 List the prime factors of 11467917. 3, 89, 103, 139 List the prime factors of 1302719. 11, 118429 What are the prime factors of 4117949? 11, 374359 What are the prime factors of 3183657? 3, 53, 20023 What are the prime factors of 2623735? 5, 409, 1283 List the prime factors of 3763254. 2, 3, 11, 19, 3001 What are the prime factors of 1633998? 2, 3, 272333 What are the prime factors of 69646? 2, 97, 359 List the prime factors of 2782682. 2, 7, 47, 4229 What are the prime factors of 330373? 37, 8929 List the prime factors of 3653530. 2, 5, 283, 1291 List the prime factors of 4691309. 7, 19, 5039 List the prime factors of 415974. 2, 3, 13, 5333 List the prime factors of 2583860. 2, 5, 129193 List the prime factors of 569231. 13, 43787 What are the prime factors of 25229? 25229 What are the prime factors of 3593474? 2, 23, 191, 409 List the prime factors of 488384. 2, 13, 587 List the prime factors of 3694466. 2, 1847233 What are the prime factors of 5187142? 2, 17, 152563 What are the prime factors of 3045787? 109, 27943 List the prime factors of 231577. 367, 631 List the prime factors of 36025458. 2, 3, 7, 857749 What are the prime factors of 4007166? 2, 3, 667861 What are the prime factors of 33291784? 2, 167, 24919 List the prime factors of 200282. 2, 239, 419 What are the prime factors of 2201829? 3, 7, 104849 What are the prime factors of 3417748? 2, 17, 50261 What are the prime factors of 1746966? 2, 3, 13, 22397 What are the prime factors of 694265? 5, 11, 13, 971 List the prime factors of 30799939. 149, 421, 491 List the prime factors of 2800151. 1181, 2371 What are the prime factors of 157264? 2, 9829 What are the prime factors of 3512270? 2, 5, 59, 5953 What are the prime factors of 1122857? 1122857 What are the prime factors of 8616918? 2, 3, 19, 131, 577 What are the prime factors of 537648? 2, 3, 23, 487 What are the prime factors of 820857? 3, 19, 14401 List the prime factors of 12862338. 2, 3, 61, 113, 311 What are the prime factors of 3619870? 2, 5, 31, 11677 What are the prime factors of 47662? 2, 23831 What are the prime factors of 336840? 2, 3, 5, 7, 401 What are the prime factors of 369353? 369353 List the prime factors of 59624. 2, 29, 257 List the prime factors of 1114692. 2, 3, 19, 4889 List the prime factors of 1491001. 1491001 What are the prime factors of 1609237? 7, 17, 13523 List the prime factors of 22339503. 3, 827389 What are the prime factors of 501939? 3, 43, 1297 List the prime factors of 164147. 164147 List the prime factors of 294986. 2, 79, 1867 What are the prime factors of 2324472? 2, 3, 23, 4211 What are the prime factors of 1923668? 2, 181, 2657 List the prime factors of 1930303. 59, 32717 List the prime factors of 286086. 2, 3, 47681 What are the prime factors of 2164024? 2, 19, 23, 619 List the prime factors of 1304927. 13, 100379 List the prime factors of 34007155. 5, 7, 13, 31, 2411 What are the prime factors of 674784? 2, 3, 11, 71 List the prime factors of 688240. 2, 5, 7, 1229 What are the prime factors of 31269? 3, 7, 1489 What are the prime factors of 2025083? 103, 19661 What are the prime factors of 1026752? 2, 61, 263 What are the prime factors of 2494726? 2, 13, 229, 419 List the prime factors of 678728. 2, 37, 2293 List the prime factors of 4000854. 2, 3, 11, 13, 4663 List the prime factors of 11923753. 1303, 9151 What are the prime factors of 2929237? 2929237 What are the prime factors of 1933896? 2, 3, 19, 4241 List the prime factors of 39328242. 2, 3, 17, 385571 What are the prime factors of 353738? 2, 7, 11, 2297 What are the prime factors of 978329? 11, 19, 31, 151 What are the prime factors of 2986103? 2986103 List the prime factors of 36733909. 41, 71, 12619 What are the prime factors of 1218486? 2, 3, 31, 6551 What are the prime factors of 12589085? 5, 107, 23531 List the prime factors of 196104. 2, 3, 8171 List the prime factors of 88502. 2, 17, 19, 137 List the prime factors of 29727034. 2, 14863517 List the prime factors of 642920. 2, 5, 16073 List the prime factors of 137258. 2, 11, 17, 367 What are the prime factors of 166069? 71, 2339 What are the prime factors of 1836542? 2, 859, 1069 List the prime factors of 19467235. 5, 61, 83, 769 List the prime factors of 2209375. 5, 7, 101 What are the prime factors of 1370630? 2, 5, 41, 3343 What are the prime factors of 24471944? 2, 7, 436999 What are the prime factors of 2600567? 2600567 List the prime factors of 12458241. 3, 1384249 What are the prime factors of 2562512? 2, 17, 9421 List the prime factors of 33603. 3, 23, 487 What are the prime factors of 12852719? 11, 313, 3733 What are the prime factors of 6426? 2, 3, 7, 17 List the prime factors of 9194696. 2, 7, 164191 What are the prime factors of 8779988? 2, 7, 313571 What are the prime factors of 186023? 186023 What are the prime factors of 5281469? 1123, 4703 What are the prime factors of 260206? 2, 281, 463 List the prime factors of 3183897. 3, 307, 3457 What are the prime factors of 465616? 2, 29101 What are the prime factors of 12158862? 2, 3, 971, 2087 What are the prime factors of 3184? 2, 199 What are the prime factors of 201719? 7, 28817 What are the prime factors of 305377? 305377 List the prime factors of 629313. 3, 209771 List the prime factors of 9239264. 2, 179, 1613 List the prime factors of 413676. 2, 3, 11491 List the prime factors of 12632586. 2, 3, 2105431 What are the prime factors of 7283828? 2, 1820957 What are the prime factors of 2221286? 2, 1110643 What are the prime factors of 8932897? 397, 22501 What are the prime factors of 1459556? 2, 7, 52127 What are the prime factors of 295304? 2, 36913 What are the prime factors of 1999687? 59, 33893 List the prime factors of 2325786. 2, 3, 387631 What are the prime factors of 2435988? 2, 3, 202999 List the prime factors of 923201. 923201 List the prime factors of 105304. 2, 13163 List the prime factors of 59511. 3, 83, 239 What are the prime factors of 10228301? 10228301 List the prime factors of 13357137. 3, 4452379 What are the prime factors of 3265452? 2, 3, 61, 1487 What are the prime factors of 241241? 7, 11, 13, 241 What are the prime factors of 17598089? 709, 24821 What are the prime factors of 1113876? 2, 3, 30941 What are the prime factors of 24496829? 7, 73, 47939 List the prime factors of 374805. 3, 5, 8329 What are the prime factors of 13822370? 2, 5, 1382237 List the prime factors of 313972. 2, 53, 1481 List the prime factors of 10303410. 2, 3, 5, 13, 29, 911 List the prime factors of 14549929. 14549929 What are the prime factors of 283863? 3, 94621 List the prime factors of 677809. 11, 43, 1433 What are the prime factors of 52324? 2, 103, 127 What are the prime factors of 255110? 2, 5, 97, 263 What are the prime factors of 2748074? 2, 7, 196291 List the prime factors of 1604123. 1604123 List the prime factors of 3451861. 7, 493123 List the prime factors of 4553169. 3, 211, 7193 What are the prime factors of 3058021? 29, 105449 List the prime factors of 10831068. 2, 3, 23, 103, 127 List the prime factors of 918073. 13, 70621 What are the prime factors of 422287? 422287 What are the prime factors of 26906419? 31, 47, 59, 313 What are the prime factors of 2905? 5, 7, 83 What are the prime factors of 103069? 103069 List the prime factors of 257882. 2, 128941 What are the prime factors of 8506127? 7, 1215161 List the prime factors of 144644. 2, 36161 What are the prime factors of 13218030? 2, 3, 5, 7, 20981 What are the prime factors of 21958304? 2, 686197 List the prime factors of 16942491. 3, 67, 28097 List the prime factors of 2161046. 2, 1080523 What are the prime factors of 23255? 5, 4651 List the prime factors of 163019. 163019 What are the prime factors of 82995? 3, 5, 11, 503 List the prime factors of 488283. 3, 47, 3463 What are the prime factors of 326738? 2, 23, 7103 What are the prime factors of 1994152? 2, 37, 6737 What are the prime factors of 11449693? 29, 394817 List the prime factors of 496051. 496051 What are the prime f	{ "pile_set_name": "DM Mathematics" }
here between 1:56 PM and 8:42 PM? 406 What is 693 minutes after 6:18 AM? 5:51 PM What is 714 minutes after 7:29 PM? 7:23 AM How many minutes are there between 11:27 AM and 6:36 PM? 429 How many minutes are there between 10:45 PM and 11:44 PM? 59 What is 331 minutes after 1:21 PM? 6:52 PM What is 421 minutes after 7:33 PM? 2:34 AM What is 367 minutes after 6:59 PM? 1:06 AM What is 644 minutes before 9:03 AM? 10:19 PM How many minutes are there between 11:22 AM and 1:34 PM? 132 What is 424 minutes after 9:48 AM? 4:52 PM How many minutes are there between 9:07 PM and 6:31 AM? 564 How many minutes are there between 11:02 AM and 6:26 PM? 444 How many minutes are there between 12:18 AM and 8:00 AM? 462 What is 700 minutes before 7:05 PM? 7:25 AM What is 482 minutes before 6:12 AM? 10:10 PM How many minutes are there between 4:07 PM and 2:14 AM? 607 What is 584 minutes after 5:50 PM? 3:34 AM What is 27 minutes after 2:50 AM? 3:17 AM How many minutes are there between 7:55 PM and 7:07 AM? 672 How many minutes are there between 11:01 PM and 1:25 AM? 144 How many minutes are there between 9:48 AM and 12:03 PM? 135 How many minutes are there between 11:31 PM and 9:43 AM? 612 What is 557 minutes before 10:03 AM? 12:46 AM How many minutes are there between 12:50 PM and 12:23 AM? 693 How many minutes are there between 8:59 AM and 2:12 PM? 313 How many minutes are there between 11:54 AM and 7:33 PM? 459 What is 51 minutes after 5:18 PM? 6:09 PM What is 148 minutes before 5:15 PM? 2:47 PM How many minutes are there between 12:04 PM and 1:03 PM? 59 What is 697 minutes before 2:08 PM? 2:31 AM What is 664 minutes after 1:02 PM? 12:06 AM How many minutes are there between 4:30 PM and 1:46 AM? 556 What is 558 minutes before 8:54 PM? 11:36 AM How many minutes are there between 2:16 AM and 1:45 PM? 689 What is 445 minutes after 1:56 AM? 9:21 AM What is 454 minutes before 12:15 PM? 4:41 AM What is 371 minutes before 7:27 AM? 1:16 AM What is 488 minutes before 10:21 PM? 2:13 PM How many minutes are there between 9:30 PM and 10:30 PM? 60 How many minutes are there between 4:03 PM and 3:49 AM? 706 What is 685 minutes before 5:45 PM? 6:20 AM How many minutes are there between 2:52 AM and 3:04 AM? 12 How many minutes are there between 7:28 AM and 10:06 AM? 158 What is 318 minutes before 10:06 AM? 4:48 AM How many minutes are there between 10:44 PM and 5:30 AM? 406 What is 493 minutes before 5:21 PM? 9:08 AM What is 197 minutes after 3:10 AM? 6:27 AM What is 459 minutes before 3:34 AM? 7:55 PM What is 657 minutes before 7:48 PM? 8:51 AM What is 560 minutes after 1:32 PM? 10:52 PM What is 400 minutes after 5:10 AM? 11:50 AM What is 662 minutes before 6:59 PM? 7:57 AM How many minutes are there between 11:23 PM and 4:45 AM? 322 How many minutes are there between 11:08 AM and 10:50 PM? 702 What is 246 minutes after 7:55 AM? 12:01 PM What is 279 minutes before 3:42 PM? 11:03 AM What is 564 minutes before 9:51 AM? 12:27 AM What is 298 minutes before 7:16 AM? 2:18 AM How many minutes are there between 4:44 PM and 2:29 AM? 585 How many minutes are there between 6:30 PM and 11:52 PM? 322 What is 142 minutes after 9:26 AM? 11:48 AM How many minutes are there between 5:56 PM and 8:28 PM? 152 How many minutes are there between 7:22 PM and 4:25 AM? 543 How many minutes are there between 5:45 AM and 7:29 AM? 104 What is 231 minutes after 5:11 AM? 9:02 AM How many minutes are there between 6:58 AM and 4:53 PM? 595 How many minutes are there between 9:12 PM and 8:52 AM? 700 How many minutes are there between 10:59 PM and 5:06 AM? 367 What is 165 minutes before 3:21 PM? 12:36 PM How many minutes are there between 3:53 PM and 6:18 PM? 145 How many minutes are there between 10:20 AM and 4:27 PM? 367 How many minutes are there between 7:55 PM and 2:58 AM? 423 How many minutes are there between 5:13 PM and 12:23 AM? 430 How many minutes are there between 10:48 PM and 12:16 AM? 88 What is 665 minutes after 9:41 PM? 8:46 AM What is 11 minutes before 7:25 PM? 7:14 PM How many minutes are there between 8:11 AM and 3:21 PM? 430 How many minutes are there between 5:34 AM and 5:24 PM? 710 How many minutes are there between 11:18 AM and 4:21 PM? 303 What is 320 minutes after 8:21 PM? 1:41 AM What is 715 minutes before 2:10 PM? 2:15 AM How many minutes are there between 7:36 AM and 2:03 PM? 387 How many minutes are there between 11:13 PM and 11:32 PM? 19 What is 416 minutes after 6:04 PM? 1:00 AM What is 526 minutes before 4:23 AM? 7:37 PM How many minutes are there between 12:38 PM and 12:25 AM? 707 What is 439 minutes before 4:58 AM? 9:39 PM What is 399 minutes after 1:40 AM? 8:19 AM How many minutes are there between 5:00 AM and 3:47 PM? 647 How many minutes are there between 9:30 PM and 1:43 AM? 253 How many minutes are there between 3:43 AM and 2:13 PM? 630 How many minutes are there between 12:25 AM and 10:20 AM? 595 What is 491 minutes before 1:12 PM? 5:01 AM How many minutes are there between 12:42 AM and 4:52 AM? 250 What is 302 minutes before 11:22 PM? 6:20 PM How many minutes are there between 8:10 PM and 12:40 AM? 270 How many minutes are there between 6:36 AM and 4:00 PM? 564 What is 418 minutes after 11:15 AM? 6:13 PM How many minutes are there between 5:41 PM and 1:31 AM? 470 What is 647 minutes before 11:43 PM? 12:56 PM What is 715 minutes after 11:09 PM? 11:04 AM How many minutes are there between 7:58 AM and 11:56 AM? 238 How many minutes are there between 8:55 PM and 5:06 AM? 491 How many minutes are there between 5:26 AM and 6:48 AM? 82 What is 623 minutes before 3:33 AM? 5:10 PM What is 444 minutes before 9:04 AM? 1:40 AM How many minutes are there between 4:42 PM and 11:10 PM? 388 How many minutes are there between 9:22 PM and 10:39 PM? 77 How many minutes are there between 11:54 PM and 6:00 AM? 366 What is 678 minutes after 3:35 PM? 2:53 AM What is 493 minutes after 10:38 PM? 6:51 AM How many minutes are there between 7:09 PM and 10:52 PM? 223 What is 589 minutes before 11:18 AM? 1:29 AM How many minutes are there between 5:44 PM and 8:55 PM? 191 What is 33 minutes before 9:11 PM? 8:38 PM What is 388 minutes before 3:24 PM? 8:56 AM What is 344 minutes before 7:36 PM? 1:52 PM How many minutes are there between 3:47 PM and 11:39 PM? 472 How many minutes are there between 3:17 AM and 5:08 AM? 111 What is 304 minutes after 8:37 PM? 1:41 AM What is 634 minutes before 12:56 AM? 2:22 PM How many minutes are there between 10:27 AM and 5:37 PM? 430 What is 538 minutes before 12:17 AM? 3:19 PM What is 502 minutes after 9:51 AM? 6:13 PM How many minutes are there between 12:20 AM and 7:20 AM? 420 What is 706 minutes before 10:16 AM? 10:30 PM What is 175 minutes after 10:33 AM? 1:28 PM What is 443 minutes after 5:22 AM? 12:45 PM How many minutes are there between 9:50 AM and 10:40 AM? 50 What is 643 minutes after 1:41 PM? 12:24 AM How many minutes are there between 8:58 AM and 5:03 PM? 485 How many minutes are there between 4:18 AM and 1:56 PM? 578 How many minutes are there between 2:34 AM and 12:45 PM? 611 How many minutes are there between 8:10 AM and 1:14 PM? 304 How many minutes are there between 5:30 PM and 3:03 AM? 573 What is 48 minutes after 6:44 AM? 7:32 AM How many minutes are there between 6:21 AM and 2:03 PM? 462 How many minutes are there between 7:07 AM and 9:58 AM? 171 How many minutes are there between 5:22 PM and 4:37 AM? 675 What is 424 minutes after 7:36 PM? 2:40 AM What is 670 minutes before 3:16 PM? 4:06 AM What is 60 minutes before 7:39 PM? 6:39 PM What is 209 minutes after 8:27 AM? 11:56 AM What is 423 minutes after 1:16 PM? 8:19 PM How many minutes are there between 9:06 PM and 8:06 AM? 660 What is 502 minutes before 1:26 PM? 5:04 AM How many minutes are there between 3:42 PM and 9:37 PM? 355 What is 59 minutes after 7:58 AM? 8:57 AM What is 102 minutes before 7:03 PM? 5:21 PM What is 719 minutes after 10:16 PM? 10:15 AM What is 313 minutes before 11:03 AM? 5:50 AM How many minutes are there between 2:02 PM and 11:00 PM? 538 How many minutes are there between 11:57 AM and 7:21 PM? 444 What is 97 minutes after 2:15 AM? 3:52 AM What is 54 minutes after 10:12 AM? 11:06 AM What is 35 minutes after 7:25 PM? 8:00 PM What is 473 minutes before 11:37 PM? 3:44 PM How ma	{ "pile_set_name": "DM Mathematics" }
-cs + x = s for s. 4 Suppose 4 = -4a + 16. Suppose 2m = 3s - 11, 12 = s - 3m + 4m. Solve an + s = -2 for n. -3 Let t(o) = 0o - 12 + o + 2 - 6. Let q be t(10). Let d be q/(-15) - (-23)/5. Solve -di = 6 + 9 for i. -3 Suppose 0n - 10n - 3n = 0. Solve n = 7u - 5u + 10 for u. -5 Let h(w) = w - 6. Let b be h(-2). Let o be (-38)/b - (-6)/(-8). Let n(s) = s*2 + s - 2. Let t be n(-2). Solve v + 1 + o = t for v. -5 Suppose 4a + 0 = 32. Solve 2g - a = -2g for g. 2 Let b be 5/7 - 8/(-28). Let m be 1 + (-2 - -2) + b. Solve -ml = l - 3 for l. 1 Let u = 2 + 0. Let c be 15/25 - (-4)/10. Suppose 5 = -2g + 3l, -l - u - c = -3g. Solve -gd + 4d + 4 = 0 for d. -2 Let k = -12 + 18. Let v be 63/k + 1. Solve 0 = vz - 7z for z. 0 Let q be ((-3)/4)/((-2)/((-80)/(-15))). Suppose -2a + 7a - 29 = 2k, -5a + 3k = -31. Let u be (a - 2) + 2/2. Solve -uh = -qh + 4 for h. -2 Suppose -1 + 3 = 4x - g, 0 = -3g - 6. Let p(d) = 7 + x + d - 2d. Let l be p(3). Solve -l = -3w - w for w. 1 Let w(g) = g - 2 - 3g + 4g - g*2 + 0g2 + g3. Let v be w(2). Solve -5p + v + 4 = 0 for p. 2 Let s be ((-31)/(-2))/(2/4). Let k = s + -15. Solve -3f = -7f + k for f. 4 Let z be -4(-2 - (-2 + 1)). Suppose 3y - 3j = 1 - 13, 3y = -j + z. Solve -3h + 8 + 4 = y for h. 4 Let m(l) = l + 10. Let s be m(0). Suppose 0 = 3o - 2 - 13. Suppose 0 = -3x + o + 7. Solve s = xd - 2d for d. 5 Let k(o) = -2o - 1. Let d be k(-3). Suppose 3 - d = -m. Solve -m = -4t + 2 for t. 1 Let r = -14 - -17. Solve -2 = rl + 13 for l. -5 Suppose 4z + 0z = -2a - 16, 5z + 25 = 0. Solve 5k + a = -3 for k. -1 Let c(l) = -l + 3. Let j be c(-3). Solve -6 = 4r + j for r. -3 Let f be 1 - -12 - (0 - -1). Let b(v) = v - 8. Let g be b(f). Solve 0 = 2p - g - 4 for p. 4 Suppose -2s = s - 9. Solve sp + 10 = p for p. -5 Suppose -57 + 21 = -4c. Solve -b - c = -4 for b. -5 Suppose -4j + 6 = t, -5j + 3j - 2 = -2t. Solve j - 7 = 3k for k. -2 Suppose 3j + 5 = 2c + 1, -c + j + 3 = 0. Let w(u) = -4 + u*2 + c + 5u - 5u. Let v be w(-1). Solve vb = 3b - 3 for b. 3 Let h(q) = 0q + 0q + 2q - 3q + 1 + 4q*2. Let g be h(1). Solve 0y - 16 = gy for y. -4 Suppose 0o - 15 = -2a + 5o, 2a - 3o = 9. Solve -2g - 3g + 20 = a for g. 4 Let k(y) = 4y - 8y2 + y3 + 0y + 4y - 3. Let v = -110 + 117. Let n be k(v). Solve -no = -0o - 16 for o. 4 Suppose 0 = h + 3 + 2. Let u(w) = w + 7. Let i be u(h). Suppose 5 = ia + 3. Solve -y + a = -4 for y. 5 Let i be 2/(-6) + 6/18. Solve 5t - 6 - 19 = i for t. 5 Suppose -3p + 20 = p. Solve -2o - 1 = p for o. -3 Suppose 0 = -i - 8i + 27. Solve -im = m + 12 for m. -3 Suppose 6 = -o - 2n, 3n - n + 14 = o. Let g be (4/(-6) - 0)-3. Suppose -ga - 32 = -oa. Solve 0 = 3v + a - 1 for v. -5 Let s(b) = -b*3 - 10b*2 - b - 10. Let o be s(-10). Solve -2p - 1 - 3 = o for p. -2 Let j be 9/(-15) + (-8)/(-5). Suppose f - 3c + j = 0, -3c + 10 = 3f + c. Solve -ft - 1 = 3 for t. -2 Suppose 46 = 4v + 5q + 11, -3q + 34 = 5v. Let u = -69 - -104. Let o = u + -18. Solve o = vi - 8 for i. 5 Let k = -77 + 79. Solve 6g - 8g - k = 0 for g. -1 Suppose 2y - 6 = -0. Suppose 6 = -2u + 4c, 0 = -2u + u - c - y. Let g = 7 + u. Solve f = 3f + g for f. -2 Let w(q) = -q*3 + 7q*2 + 10q - 11. Let i be w(8). Suppose -4b = -i - 7. Let v be 2/11 - 212/(-44). Solve -r - v = -b for r. -2 Let n = 23 - 21. Solve 5 = 3l + n for l. 1 Suppose 0 = -4r + k + 17, 3r = -0k + 3k + 15. Let u(g) = -g*2 + 5g - 2. Let t be u(r). Solve -z - tz - 15 = 0 for z. -5 Suppose -4z - 3 = -5x, -3 = -5z - 5x + 9x. Solve -2k = zk for k. 0 Let r be 4/6 - (-2288)/24. Let x be r/44 - 2/11. Solve -xj - 5 = 3j for j. -1 Let t(p) = -p*2 - 11p - 5. Let d be t(-10). Suppose dy + 8 = 9y. Solve ya = 6a for a. 0 Let q be 156/48 + 3/4. Solve -10 = -qi + 2 for i. 3 Let v be 20(6/4)/3. Let x(c) = c*2 - 2c. Let q be x(4). Suppose 3n = qn. Solve n = m + 4m + v for m. -2 Let o be (-12)/20 - (-1 + (-52)/20). Solve ot - 3 = -6 for t. -1 Suppose -r + 1 = 2d - 5, -2r - 3 = -d. Suppose -7 = -4m - dc, 3c + 0 = 5m - 2. Solve 2o - 1 = m for o. 1 Let d(j) = j - 4. Let f be d(10). Let a be -2 + f/37. Let c(b) = b*3 + 5b*2 - 6b + 2. Let g be c(-6). Solve -k = gk - a for k. 4 Let y be 2 - 4(-1 + 0). Let s = -1 - 0. Let a be -2 + ((-3)/s - -1). Solve ax + y = -x for x. -2 Let x = -41 - -43. Solve 4l - 6 = x for l. 2 Suppose 0 = 4g - 0y + 3y - 60, 2y - 68 = -5g. Let h = -18 + 10. Let v = g + h. Solve -p = -vp + 3 for p. 1 Let f be 2/3 + 52/(-6). Let m be (-65)/(-20) - (-2)/f. Let p = -1 + 1. Solve p = -a - ma - 20 for a. -5 Let s be -5 + 1 - (-6 - -2). Solve -3x - 6 = -s for x. -2 Let x = 0 - 0. Let m(r) = r - 1. Let s be m(4). Solve -k + xk = s for k. -3 Let u(c) = -c3 + 4c*2 - c - 2. Let i be 2 - 227/6. Let v = i + 10. Let s be u(v). Solve -1 + s = -g for g. -3 Let c(s) = -s*2 - 14s + 3. Let y be c(-14). Solve -7f + yf = 16 for f. -4 Let h(u) = -u*2 - 7u + 3. Let j be h(-7). Let c = 7 - j. Let a be 30/4(-8)/(-5). Solve cr + 4 = -a for r. -4 Let p(s) = 2s - 3. Suppose -5i = -x - 33, -3i + 8x = 3x - 11. Suppose -2m = -n - 9, m - 4n - i = -n. Let b be p(m). Solve -3 = -br + 2r for r. 1 Suppose 4c + 10 - 2 = 0. Suppose -4m + 2u + 10 = 0, 2u + 2u = 2m - 8. Let h = c + m. Solve -3t = -ht for t. 0 Let j = -66 + 69. Solve jv + 6 + 9 = 0 for v. -5 Let m(p) = -p + 10. Let r be (-22)/(-6) - 2/(-6). Suppose -rj + 9j = 25. Let q be m(j). Solve 14 + 11 = qx for x. 5 Suppose 1 = 3w + 2x - 21, w = -5x + 29. Solve -t + wt = 0 for t. 0 Let w be 1(-9)/(-3)2. Suppose -3y + 2y + w = 0. Suppose 4c = 0, -t - 5c = -y + 2. Solve -tr + r = 0 for r. 0 Suppose 2a - 10 = 6. Let h = a + -4. Let k be (0 - 2 - -3)h. Solve 0d = -kd for d. 0 Suppose 4t = 5 + 11. Solve -m - 6 = -tm for m. 2 Suppose b + 3 = -2k, 18 = 2b - b - 5k. Suppose -2p + 9 = 3f + 3, 2p + 6 = bf. Suppose 0 = fg - 4g. Solve -5 = -gr - r for r. 5 Let c be 1/22 + -1. Let f be -24 - 0/(-2 + 0). Let l = -21 - f. Solve -6 + c = -la for a. 2 Let c be (32/(-12))/((-1)/6). Let f = -10 + c. Suppose 0 = -d - 2d + f. Solve d = -j + 5 for j. 3 Suppose 4x - 1 = m, 3m + 4 = -3x - m. Suppose l = -xl + 2. Solve w - 15 = -lw for w. 5 Let d(y) = 4y2 - 1. Let p be d(-1). Solve 3 = pt - 0 for t. 1 Let d be 6/(-8) - (-63)/(-12). Let v be (-12)/99/d. Solve 0 = vy + 3y for y. 0 Let d(i) = 7i + 37. Let l be d(-5). Let m(r) = 2r2 + 3. Let j(x) = 3x*2 + 5. Let h(a) = -3j(a) + 5m(a). Let z be h(-1). Solve lq - z - 3 = 0 for q. 2 Let k(y) = 10y2 + y. Suppose 2h - 22 = 4m, 4 = -3m - 11. Let w be k(h). Suppose 4g = -r + 17, -g = 5r - w + 2. Solve -gp + 10 + 2 = 0 for p. 3 Let u(h) = -h3 - 9h2 + h + 10. Let c be u(-9). Let j(r) be the third derivative of r4/6 + r*2. Let n be j(c). Solve 1 = -nq - 15 for q. -4 Let w(o) be the third derivative of o4/24 - o3/6 + 3o2. Let k be w(3). Suppose -24 = kn - 6n. Solve -4 = p - n for p. 2 Let x(l) = l3 - 3l*2 - 3l - 2. Let c be x(4). Let h be (-1)/(-1 + c/4). Solve 3p + 4 = -h for p. -2 Let m = -2 - -3. Let j(d) = -8d + 4 + d*2 + 3 - 11. Let q be j(9). Solve 4f = -m + q for f. 1 Let j = 4 - 0. Solve -3 = -a - j for a. -1 Let h(o) = o*2 - 4o + 3. Suppose -y - 12 = -3t, -t = -y - 3y - 15. Let i be h(t). Suppose 2u = -2u. Solve u = -2n - i - 8 for n. -4 Let t(i) = i. Let u be t(-1). Let s(m) = -6m3 - m2 - m - 1. Let v be s(u). Solve -v - 1 = 3f for f. -2 Suppose -5p = -3p - 2. Let v(t) = -t2 - 6t - 1. Let x be v(-5). Let u(i) = -2i - 19. Let r be u(-11). Solve x = rm + p for m. 1 Suppose -4k - l + 8 = -5l, -4l = k - 22. Suppose -kd + 3d = -6. Solve dz + 2z = 12 for z. 3 Suppose 4c = c - 6, 0 = 2v + 2c - 22. Let a = 0 - -3. Suppose -j + 1 = 2s + 6, -s - v = -aj. Solve q - 4q - j = 0 for q. -1 Let a be (3 - (0 + 2) - 1)/(-2). Solve -2z + 4z - 8 = a for z. 4 Let u = -128 - -131. Solve 2x = -u + 1 for x. -1 Let h(z) = 14z - 2 - 2z - 12 - z*2 - 2z. Let f be h(8). Solve -fa + 12 = -6a for a. -3 Let u(g) = -g - 3. Let p be u(-7). Solve 3 = -pw - 1 for w. -1 Suppose -5l = -8 - 12. Solve -8 = a - l for a. -4 Suppose 8u = 4u. Let r be u/(-7) + -1 + 4	{ "pile_set_name": "DM Mathematics" }
1 AM and 8:45 AM? 354 What is 572 minutes after 9:07 AM? 6:39 PM How many minutes are there between 10:57 AM and 11:49 AM? 52 What is 204 minutes after 10:22 AM? 1:46 PM What is 48 minutes before 1:55 PM? 1:07 PM What is 136 minutes after 2:14 PM? 4:30 PM What is 237 minutes before 1:46 AM? 9:49 PM How many minutes are there between 1:22 AM and 2:14 AM? 52 What is 652 minutes before 9:45 AM? 10:53 PM What is 195 minutes after 8:06 AM? 11:21 AM How many minutes are there between 8:43 PM and 6:15 AM? 572 How many minutes are there between 7:03 AM and 4:33 PM? 570 How many minutes are there between 9:30 PM and 12:02 AM? 152 How many minutes are there between 3:57 AM and 1:13 PM? 556 How many minutes are there between 2:03 AM and 6:27 AM? 264 How many minutes are there between 8:21 AM and 7:46 PM? 685 How many minutes are there between 11:55 AM and 9:28 PM? 573 How many minutes are there between 7:46 AM and 4:45 PM? 539 How many minutes are there between 5:46 PM and 3:53 AM? 607 What is 173 minutes before 2:52 AM? 11:59 PM What is 546 minutes before 11:11 AM? 2:05 AM How many minutes are there between 1:05 PM and 12:02 AM? 657 How many minutes are there between 10:27 PM and 5:25 AM? 418 How many minutes are there between 1:43 PM and 11:40 PM? 597 What is 111 minutes before 8:26 AM? 6:35 AM What is 127 minutes after 5:16 AM? 7:23 AM What is 424 minutes after 6:12 AM? 1:16 PM How many minutes are there between 10:10 AM and 9:57 PM? 707 How many minutes are there between 10:56 AM and 2:00 PM? 184 How many minutes are there between 3:00 AM and 12:20 PM? 560 What is 42 minutes after 12:35 PM? 1:17 PM What is 156 minutes after 8:50 PM? 11:26 PM How many minutes are there between 11:45 PM and 11:29 AM? 704 What is 708 minutes after 4:27 PM? 4:15 AM What is 702 minutes after 12:53 AM? 12:35 PM How many minutes are there between 2:24 PM and 5:10 PM? 166 What is 366 minutes before 9:42 PM? 3:36 PM How many minutes are there between 4:22 PM and 10:48 PM? 386 How many minutes are there between 10:15 AM and 7:56 PM? 581 How many minutes are there between 2:33 AM and 4:58 AM? 145 What is 454 minutes before 1:52 PM? 6:18 AM How many minutes are there between 1:56 PM and 1:03 AM? 667 What is 91 minutes before 1:40 PM? 12:09 PM How many minutes are there between 8:44 AM and 1:21 PM? 277 What is 454 minutes after 4:52 AM? 12:26 PM How many minutes are there between 12:05 AM and 3:11 AM? 186 How many minutes are there between 4:37 AM and 11:04 AM? 387 What is 371 minutes before 10:37 PM? 4:26 PM How many minutes are there between 1:23 AM and 10:07 AM? 524 What is 439 minutes after 12:04 AM? 7:23 AM How many minutes are there between 12:13 PM and 3:28 PM? 195 How many minutes are there between 6:17 PM and 4:35 AM? 618 How many minutes are there between 3:39 PM and 2:39 AM? 660 How many minutes are there between 2:09 PM and 12:04 AM? 595 How many minutes are there between 10:53 PM and 11:05 PM? 12 How many minutes are there between 12:11 AM and 9:20 AM? 549 How many minutes are there between 3:59 AM and 11:47 AM? 468 How many minutes are there between 5:48 PM and 3:18 AM? 570 What is 313 minutes after 9:53 AM? 3:06 PM What is 687 minutes before 12:13 PM? 12:46 AM What is 564 minutes before 8:04 PM? 10:40 AM What is 391 minutes before 7:57 PM? 1:26 PM How many minutes are there between 6:14 AM and 1:00 PM? 406 What is 246 minutes after 4:00 AM? 8:06 AM What is 371 minutes after 2:52 PM? 9:03 PM What is 255 minutes after 3:32 PM? 7:47 PM What is 136 minutes before 10:16 PM? 8:00 PM What is 472 minutes after 3:24 AM? 11:16 AM How many minutes are there between 8:57 AM and 11:36 AM? 159 How many minutes are there between 3:39 AM and 10:25 AM? 406 How many minutes are there between 10:45 PM and 10:13 AM? 688 How many minutes are there between 2:57 AM and 9:09 AM? 372 What is 587 minutes before 6:02 PM? 8:15 AM How many minutes are there between 6:01 PM and 9:44 PM? 223 How many minutes are there between 2:48 AM and 11:43 AM? 535 What is 560 minutes after 12:35 PM? 9:55 PM What is 341 minutes after 11:18 PM? 4:59 AM How many minutes are there between 4:20 AM and 12:47 PM? 507 What is 317 minutes before 5:15 PM? 11:58 AM How many minutes are there between 10:44 PM and 6:21 AM? 457 What is 429 minutes after 9:56 PM? 5:05 AM How many minutes are there between 9:27 AM and 9:10 PM? 703 How many minutes are there between 2:48 AM and 5:05 AM? 137 How many minutes are there between 1:50 AM and 1:23 PM? 693 What is 110 minutes after 12:14 AM? 2:04 AM What is 202 minutes after 2:45 AM? 6:07 AM What is 156 minutes after 8:29 AM? 11:05 AM How many minutes are there between 7:46 PM and 11:37 PM? 231 What is 62 minutes before 1:50 AM? 12:48 AM How many minutes are there between 11:26 PM and 11:35 PM? 9 What is 249 minutes after 3:03 PM? 7:12 PM What is 324 minutes before 6:19 PM? 12:55 PM How many minutes are there between 4:29 AM and 5:09 AM? 40 What is 207 minutes after 11:24 PM? 2:51 AM How many minutes are there between 9:33 PM and 9:20 AM? 707 What is 547 minutes after 10:02 PM? 7:09 AM What is 160 minutes before 8:23 PM? 5:43 PM What is 402 minutes before 3:41 AM? 8:59 PM How many minutes are there between 11:04 AM and 3:28 PM? 264 What is 38 minutes after 6:45 AM? 7:23 AM What is 63 minutes after 5:04 PM? 6:07 PM What is 419 minutes after 9:51 PM? 4:50 AM What is 344 minutes before 9:16 PM? 3:32 PM How many minutes are there between 11:41 PM and 5:54 AM? 373 What is 663 minutes after 11:04 AM? 10:07 PM How many minutes are there between 9:45 PM and 4:43 AM? 418 How many minutes are there between 12:25 PM and 2:06 PM? 101 What is 345 minutes before 2:05 AM? 8:20 PM What is 631 minutes after 12:08 AM? 10:39 AM How many minutes are there between 6:30 AM and 10:44 AM? 254 What is 504 minutes before 4:43 AM? 8:19 PM What is 121 minutes after 8:52 AM? 10:53 AM How many minutes are there between 2:24 PM and 9:14 PM? 410 What is 687 minutes before 3:33 AM? 4:06 PM How many minutes are there between 9:53 PM and 8:17 AM? 624 What is 669 minutes before 6:31 PM? 7:22 AM How many minutes are there between 8:14 PM and 3:15 AM? 421 What is 243 minutes before 11:28 PM? 7:25 PM How many minutes are there between 7:42 PM and 8:38 PM? 56 What is 687 minutes after 12:47 AM? 12:14 PM What is 443 minutes before 7:35 AM? 12:12 AM What is 609 minutes before 3:33 AM? 5:24 PM How many minutes are there between 9:47 PM and 8:44 AM? 657 What is 167 minutes before 5:21 PM? 2:34 PM How many minutes are there between 5:11 AM and 12:21 PM? 430 What is 359 minutes after 1:12 AM? 7:11 AM What is 502 minutes before 3:38 AM? 7:16 PM How many minutes are there between 8:56 AM and 3:30 PM? 394 How many minutes are there between 8:29 PM and 10:44 PM? 135 How many minutes are there between 4:49 AM and 4:18 PM? 689 How many minutes are there between 5:19 AM and 9:39 AM? 260 What is 144 minutes before 1:28 AM? 11:04 PM How many minutes are there between 5:03 AM and 1:40 PM? 517 What is 27 minutes before 10:04 AM? 9:37 AM How many minutes are there between 6:51 AM and 8:35 AM? 104 How many minutes are there between 2:41 PM and 6:44 PM? 243 How many minutes are there between 7:01 AM and 11:44 AM? 283 What is 56 minutes before 9:00 AM? 8:04 AM What is 159 minutes before 11:32 AM? 8:53 AM How many minutes are there between 6:08 PM and 3:00 AM? 532 How many minutes are there between 6:17 PM and 10:20 PM? 243 What is 170 minutes after 5:19 AM? 8:09 AM What is 585 minutes after 4:20 PM? 2:05 AM What is 103 minutes before 12:07 PM? 10:24 AM What is 277 minutes after 6:08 PM? 10:45 PM What is 385 minutes before 3:05 PM? 8:40 AM What is 328 minutes after 10:06 AM? 3:34 PM How many minutes are there between 6:53 AM and 7:18 AM? 25 How many minutes are there between 11:22 AM and 6:46 PM? 444 How many minutes are there between 1:37 PM and 8:11 PM? 394 What is 175 minutes after 7:07 AM? 10:02 AM How many minutes are there between 1:45 AM and 9:28 AM? 463 What is 42 minutes before 4:38 PM? 3:56 PM What is 353 minutes after 10:18 AM? 4:11 PM What is 388 minutes after 8:28 AM? 2:56 PM How many minutes are there between 10:59 PM and 10:06 AM? 667 What is 473 minutes after 3:56 AM? 11:49 AM What is 126 minutes after 4:14 AM? 6:20 AM Wh	{ "pile_set_name": "DM Mathematics" }
9) to base 15 -36 Convert 40 (base 7) to base 14. 20 6 (base 14) to base 5 11 Convert 146 (base 7) to base 16. 53 2 (base 7) to base 16 2 What is 38 (base 10) in base 4? 212 Convert c (base 13) to base 16. c -42 (base 13) to base 14 -3c Convert -6 (base 16) to base 12. -6 -1 (base 15) to base 11 -1 -16 (base 12) to base 11 -17 Convert -3 (base 15) to base 7. -3 Convert 4d (base 14) to base 5. 234 Convert -2 (base 5) to base 12. -2 What is -1000100 (base 2) in base 13? -53 6 (base 8) to base 15 6 2 (base 12) to base 8 2 Convert 64 (base 8) to base 2. 110100 What is -44 (base 6) in base 12? -24 Convert 2 (base 8) to base 11. 2 Convert -302 (base 5) to base 8. -115 -65 (base 15) to base 8 -137 What is 4 (base 13) in base 14? 4 What is -9 (base 13) in base 8? -11 Convert 0 (base 5) to base 8. 0 Convert -6 (base 8) to base 10. -6 What is 26 (base 13) in base 6? 52 Convert -14b (base 14) to base 2. -100000111 Convert -121 (base 4) to base 7. -34 What is -10111 (base 2) in base 15? -18 4a (base 13) to base 16 3e 3 (base 5) to base 11 3 Convert 343 (base 5) to base 15. 68 Convert 34 (base 14) to base 10. 46 5 (base 13) to base 6 5 What is 0 (base 8) in base 13? 0 Convert -1201 (base 4) to base 12. -81 4 (base 7) to base 9 4 1 (base 2) to base 4 1 Convert 11 (base 5) to base 16. 6 114 (base 5) to base 6 54 What is -145 (base 10) in base 11? -122 What is 10111101 (base 2) in base 10? 189 What is 20 (base 9) in base 4? 102 Convert 28 (base 9) to base 12. 22 Convert -100010 (base 2) to base 16. -22 Convert 14 (base 7) to base 11. 10 -40 (base 7) to base 10 -28 -101 (base 3) to base 6 -14 What is 22 (base 4) in base 5? 20 -44 (base 7) to base 4 -200 2 (base 16) to base 15 2 Convert -6 (base 10) to base 15. -6 37 (base 15) to base 6 124 Convert 1211 (base 3) to base 7. 100 Convert 60 (base 12) to base 14. 52 Convert -253 (base 11) to base 15. -150 Convert 2 (base 4) to base 6. 2 What is -333 (base 4) in base 5? -223 Convert 330 (base 4) to base 13. 48 -121 (base 8) to base 16 -51 -6 (base 9) to base 16 -6 -30 (base 6) to base 2 -10010 Convert 101110 (base 2) to base 7. 64 Convert 4 (base 10) to base 14. 4 16 (base 15) to base 12 19 Convert 3e (base 15) to base 13. 47 What is 3 (base 14) in base 4? 3 Convert 116 (base 11) to base 3. 12010 What is a (base 13) in base 5? 20 What is -12 (base 3) in base 7? -5 10 (base 5) to base 13 5 What is -25 (base 8) in base 7? -30 What is -10 (base 2) in base 11? -2 What is 17 (base 14) in base 3? 210 What is 103 (base 10) in base 14? 75 Convert -175 (base 10) to base 7. -340 -2 (base 12) to base 16 -2 What is -8 (base 9) in base 11? -8 2 (base 7) to base 8 2 Convert 110 (base 2) to base 16. 6 What is -4 (base 7) in base 2? -100 What is 12 (base 10) in base 12? 10 Convert 132 (base 5) to base 3. 1120 What is -6 (base 13) in base 15? -6 What is -c8 (base 14) in base 6? -452 What is 5c (base 16) in base 5? 332 What is 1100 (base 2) in base 3? 110 Convert -c (base 14) to base 13. -c Convert 120 (base 3) to base 16. f -11 (base 3) to base 2 -100 Convert 210 (base 3) to base 8. 25 Convert 23 (base 9) to base 10. 21 What is 2002 (base 3) in base 8? 70 What is -43 (base 7) in base 13? -25 Convert -1 (base 2) to base 10. -1 411 (base 7) to base 8 314 Convert -1 (base 7) to base 4. -1 Convert -1 (base 7) to base 13. -1 Convert -124 (base 12) to base 3. -20101 Convert -2 (base 3) to base 12. -2 What is 115 (base 11) in base 6? 345 Convert 32 (base 13) to base 3. 1112 -11 (base 12) to base 14 -d Convert 216 (base 8) to base 3. 12021 What is -3 (base 11) in base 6? -3 -74 (base 9) to base 5 -232 What is 122 (base 3) in base 8? 21 Convert -25 (base 14) to base 6. -53 What is 6 (base 7) in base 8? 6 What is 4 (base 14) in base 7? 4 What is -8 (base 14) in base 13? -8 7 (base 8) to base 9 7 Convert 21 (base 7) to base 12. 13 11 (base 5) to base 7 6 Convert -25 (base 6) to base 14. -13 What is -3 (base 15) in base 2? -11 30 (base 4) to base 14 c What is 2 (base 11) in base 7? 2 What is 23 (base 9) in base 15? 16 Convert 40 (base 16) to base 7. 121 -123 (base 8) to base 3 -10002 What is 28 (base 16) in base 13? 31 -131 (base 9) to base 16 -6d What is 5 (base 13) in base 10? 5 -160 (base 11) to base 13 -115 0 (base 6) to base 5 0 What is 116 (base 16) in base 8? 426 Convert 10 (base 13) to base 3. 111 Convert -1 (base 3) to base 11. -1 What is 1 (base 12) in base 10? 1 What is 120 (base 3) in base 7? 21 4 (base 10) to base 7 4 Convert -1022 (base 4) to base 7. -134 -140 (base 8) to base 4 -1200 85 (base 9) to base 3 2212 What is 4 (base 14) in base 2? 100 162 (base 11) to base 13 117 What is d0 (base 15) in base 5? 1240 -2 (base 11) to base 2 -10 Convert 15 (base 9) to base 14. 10 What is -1000 (base 3) in base 16? -1b Convert 0 (base 15) to base 5. 0 Convert 30 (base 4) to base 13. c Convert 3 (base 13) to base 10. 3 0 (base 10) to base 14 0 Convert -100011 (base 2) to base 3. -1022 Convert -16 (base 9) to base 12. -13 Convert 1132 (base 4) to base 7. 163 -2011 (base 3) to base 16 -3a What is -302 (base 5) in base 9? -85 What is 0 (base 9) in base 4? 0 What is -30 (base 15) in base 2? -101101 -8b (base 15) to base 7 -245 What is -11 (base 6) in base 2? -111 Convert 20 (base 15) to base 16. 1e What is -24 (base 8) in base 12? -18 Convert -7 (base 12) to base 13. -7 Convert -18 (base 14) to base 16. -16 -412 (base 5) to base 13 -83 What is c (base 14) in base 16? c -2 (base 14) to base 4 -2 Convert -1 (base 9) to base 11. -1 70 (base 15) to base 6 253 37 (base 13) to base 3 1201 Convert 5 (base 7) to base 12. 5 What is 233 (base 5) in base 15? 48 Convert -a9 (base 13) to base 5. -1024 What is -3 (base 5) in base 3? -10 Convert 45 (base 10) to base 7. 63 What is 16 (base 8) in base 10? 14 1 (base 15) to base 10 1 -127 (base 16) to base 10 -295 Convert 205 (base 10) to base 11. 177 What is -63 (base 8) in base 12? -43 -11 (base 15) to base 6 -24 -6 (base 10) to base 12 -6 Convert 9 (base 16) to base 9. 10 125 (base 8) to base 9 104 What is 3d (base 15) in base 3? 2011 What is 13 (base 11) in base 13? 11 -10 (base 3) to base 8 -3 Convert -10101 (base 2) to base 15. -16 What is 6 (base 12) in base 4? 12 Convert -1 (base 8) to base 9. -1 What is -3 (base 11) in base 3? -10 -14 (base 13) to base 15 -12 Convert -14 (base 13) to base 11. -16 -261 (base 9) to base 4 -3121 Convert 7b (base 16) to base 15. 83 2 (base 16) to base 4 2 What is -bb (base 13) in base 9? -181 Convert 41 (base 13) to base 7. 104 Convert -33 (base 7) to base 4. -120 -522 (base 7) to base 5 -2021 What is 1 (base 5) in base 2? 1 Convert 3 (base 7) to base 3. 10 What is -120 (base 5) in base 15? -25 Convert -1 (base 7) to base 6. -1 Convert -d (base 15) to base 8. -15 Convert -f (base 16) to base 13. -12 What is 1011101 (base 2) in base 6? 233 3 (base 9) to base 15 3 Convert -15 (base 7) to base 4. -30 Convert -31 (base 9) to base 7. -40 What is 0 (base 11) in base 5? 0 What is -10 (base 3) in base 9? -3 134 (base 5) to base 8 54 21 (base 3) to base 16 7 What is -2 (base 13) in base 16? -2 -12 (base 4) to base 8 -6 What is -2 (base 7) in base 8? -2 2 (base 15) to base 14 2 Convert -1 (base 13) to base 15. -1 Convert 30 (base 10) to base 2. 11110 2 (base 15) to base 8 2 What is 6e (base 16) in base 9? 132 What is 3 (base 8) in base 16? 3 Convert -2 (base 7) to base 5. -2 5 (base 12) to base 14 5 Convert -30 (base 13) to base 12. -33 Convert -11110 (base 2) to base 12. -26 63 (base 13) to base 10 81 What is 0 (base 12) in base 10? 0 -3 (base 4) to base 2 -11 Convert -2 (base 3) to base 15. -2 -104 (base 5) to base 9 -32 2 (base 14) to base 13 2 Convert 14 (base 16) to base 9. 22 Convert 4 (base 8) to base 16. 4 What is -1 (base 2) in base 7? -1 -3 (base 5) to base 6 -3 -24 (base 14) to base 2 -100000 Convert 3 (base 9) to base 3. 10 0 (base 2) to base 3 0 -79 (base 12) to base 10 -93 11b (base 14) to base 13 140 Convert -12 (base 6) to base 7. -11 What is 4 (base 7) in base 8? 4 Convert 2 (base 3) to base 6. 2 What is 7 (base 9) in base 7? 10 4 (base 7) to base 11 4 Convert -111110 (base 2) to base 13. -4a 157 (base 9) to base 3 11221 7 (base 9) to base 7 10 What is 1020 (base 3) in base 7? 45 -20 (base 3) to base 2 -110 What is 30 (base 5) in base 3? 120 -c5 (base 14) to base	{ "pile_set_name": "DM Mathematics" }
for i. 3 Let g(j) = j*2 + 1 - 2j*2 - 3j*2 - 2j*3 + 5j*2 + 2j. Let c be 1/1(-3)/(-3)-1. Let v be g(c). Solve 12 = -vy + 2 for y. -5 Let n(i) = -i2 + 3i + 28. Let v be n(6). Suppose s + 0s = -t + 4, 0 = 5t + 10. Solve -v = -b + sb for b. -2 Suppose -4f + 8 = 5d, -2f + f = d - 3. Suppose -fc = -0 - 14. Solve cx = x for x. 0 Suppose 0 = -5j - 5u + 35, -u = 2j + 4 - 15. Solve -3v - 1 = -j for v. 1 Let s be 6 + (1 - -1 - 3). Let x = -92 + 95. Let q be 19 + 0 + 3/x. Solve sg + 0g + q = 0 for g. -4 Let x(o) = 9o - 2. Let j be x(3). Let k = j - 22. Suppose kb + 4 = 4b. Solve bc = c for c. 0 Let p = -1043 + 1047. Let n(w) = -w*3 + 2w*2 + 4w - 3. Let o be n(3). Solve o = 3m - p + 1 for m. 1 Suppose 12 + 9 = 5c + 2u, -5u - 10 = 0. Suppose -ck + 42 = 22. Let q be -2((-9)/1 + k). Solve q = -4t - 10 for t. -5 Let s = -7 + 57. Suppose 0 = -8g + 18g - s. Solve -gl + 1 = -4 for l. 1 Suppose -2c = -c + 4f - 10, -3f = 2c - 5. Let a = 7 + c. Solve 17 + 3 = ak for k. 4 Let j(o) = -24o - 99. Let y be j(-10). Solve -4t + y - 161 = 0 for t. -5 Let k(x) = -x2 + 20x + 228. Let p be k(28). Let u = 2 + -2. Solve po + 14 + 2 = u for o. -4 Suppose -25 = -50f + 45f. Solve -b + f = 2 for b. 3 Let m = 513 + -502. Solve -6l = -ml + 10 for l. 2 Suppose 2 = 4d - 4q - 6, 4d + 2q - 8 = 0. Suppose -5o = 0, df - 5o - 5 = 1. Solve fu - 4 = 2 for u. 2 Let h be 2(-70)/20 + 35. Solve 3y - 13 = -h for y. -5 Suppose 0 = -a - 4a. Suppose a = -5w - w + 6. Solve -5r + w + 9 = 0 for r. 2 Let t(k) = -k*2 - 5k - 3. Let h = 35 - 38. Let s be t(h). Solve -2 - s = -y for y. 5 Suppose 0 = -3s - 0s + 57. Let g = -13 + s. Solve -v = -gv for v. 0 Let f be -1 + 5 + (12 - 13). Solve 3d = 4d - f for d. 3 Let t be (3/1)/(96/352). Solve -7h = -4 + t for h. -1 Let p = -20 - -22. Suppose 18 = 3r + pl, -2r + l - 3l + 10 = 0. Let t = -18 + 21. Solve 5h = r - t for h. 1 Suppose -3o + 11 = -1. Suppose 2l = -ol + 12. Suppose -11 = -lz - 7. Solve -2w = -3w + z for w. 2 Let u = 1032 + -1017. Solve 0h + 3h + u = 0 for h. -5 Let t be 11/22 - (-15)/(-2). Suppose 0 = -3j + 4z - 35, -2z - 2 + 12 = 0. Let q = j - t. Solve -f = 1 - q for f. 1 Let s be 146/10 - 2/(-5). Suppose 4k - 79 = 5p - 29, -2p - 5k = 20. Let z = p + s. Solve 0 = -zi + i + 8 for i. 2 Suppose -13t + 159 - 3 = 0. Solve 2n + t = 8n for n. 2 Suppose -5f + 2l - 32 = -12, 5 = -5f - l. Let w(c) = 22c - 7c - 21c - 2. Let p be w(f). Solve r = -4r - p for r. -2 Suppose 30 = 5g + 5j, g - 5j - 1 = 5. Suppose -3f - 5a - 12 = 0, -a - 3a - 8 = 4f. Let x be (-2 - 0) + (12 - f). Solve -g = -3p + x for p. 5 Let y(j) = -5j - 21. Let h be y(-10). Solve 29 = -2a + h for a. 0 Let m be 6912/312 - ((-15)/(-13) - 1). Solve mx - 27x = 5 for x. -1 Let l(m) = -m2 + 5m - 5. Let b be l(4). Let d = b + 5. Let k(j) = j + 2. Let c be k(d). Solve 3f = -0f + c for f. 2 Let x(u) = -u*2 + 14u + 4. Let l be x(13). Let w = -13 + l. Solve -3p + 4p + w = 0 for p. -4 Suppose -6 + 50 = 4z + n, -z = -n - 6. Solve -2 = 4h - z for h. 2 Let q = -44 - -75. Suppose s = -24 + 5. Let r = s + q. Solve u + 3u + r = 0 for u. -3 Let g = 103 - 73. Let p = g - 41. Let j be p/33 + 22/3. Solve -j = -2v + 3 for v. 5 Suppose -5d + 8 = -2i, 1 + 3 = d - i. Let q(p) = 19p - 150. Let t be q(8). Solve -tj = -dj for j. 0 Let q = -20 - -20. Suppose 9w - 8w = q. Solve -4v + 6 + 2 = w for v. 2 Let j(f) = f*3 + 5f*2 - 7f - 9. Let i be j(-6). Let a = i + 9. Suppose -2k = k - 3. Solve o - k + a = 0 for o. -5 Let p be (4 + -3)216/(-6). Let h = 40 + p. Solve 0 = hg + 7 + 5 for g. -3 Let u(o) = -2o*2 - 5o + 3. Let p be u(0). Solve -pq + 5q = 6 for q. 3 Let v = -9116 - -9121. Suppose -l - y + 13 = 0, 0 = -5l - y + 5y + 56. Solve vt = t + l for t. 3 Let q be (-11 - -39)/(1/(-2)). Let h be (-5)/2q/35. Suppose o + ho = 0. Solve -4n + on = -16 for n. 4 Let z(y) = y3 + 2y*2 + 3y + 2. Let a be z(-1). Solve a = 3b - 2b for b. 0 Let s be 15/6(-1 - -3). Let v = -12 - -16. Suppose 2c = 5j - 17, -c + v + 0 = 0. Solve 0d - s = -jd for d. 1 Suppose -l = 5, 0r - 25 = 4r + 5l. Suppose -d = -r - 6. Solve dv - 4v = 6 for v. 3 Let n(k) = k*3 - 19k*2 + 28k + 106. Let x be n(17). Solve xi = 17i for i. 0 Suppose 0 = 3r - 10 + 151. Let l = -32 - r. Let a = 20 - l. Solve au - 6 + 1 = 0 for u. 1 Suppose 0 = 2c + 4z - 12, 5z - 11 = -2c + 1. Solve 0a = -6a + c for a. 1 Let u = -115 - -117. Solve 2c = -0c + u for c. 1 Let r = 4 + 1. Solve -9 = -rh + 11 for h. 4 Let p = 14 + -9. Suppose 4s + 5x = 26, -2s + x + 1 = -p. Solve -sl = -4 - 0 for l. 1 Let w(s) = 4s*2 - 3s - 2. Let o = 6 - 8. Let u be w(o). Suppose -u = -4h + 4. Solve 0 = -5x - 14 - h for x. -4 Let a = -3 + 8. Let g(k) = -2k + 14. Let f(h) = -1. Let x(w) = 12f(w) - g(w). Let c be x(13). Solve -a = p - cp for p. -5 Let x(v) = -2v*2 + 9v - 5. Let i be 110/77 + (-1 - 22/(-14)). Let j be x(i). Solve -15 = -jq + 8q for q. -5 Suppose 3n = 5b - 4, -3n = 2b + 3b - 16. Let l be (-18)/12b/(-3). Solve 5w = -l + 6 for w. 1 Let u = -7 - -13. Suppose -3s + 265 = -5d, -207 - 155 = -4s - 2d. Let z = s - 90. Solve zw + 2w = u for w. 3 Suppose -h + 128 = 5l, -5h = -2l + 284 - 924. Solve h = -6r + 134 for r. 1 Suppose 2w = 7w, 3t = 3w + 15. Suppose tu = -h + 16, -5u - 2 = 3h - 30. Solve 3g + 6 = hg for g. 2 Let t = 741 + -637. Solve -t + 113 = -3r for r. -3 Let p(y) = -y3 + 26y*2 - y + 33. Suppose 0 = 5o - 82 - 48. Let m be p(o). Solve 0 = -5l + m - 17 for l. -2 Suppose 2x - 4x = -w - 1, 5x = -2w + 16. Let m be 0 + w + 1 + 2. Solve -6o = -3o - m for o. 2 Let t(w) = 2w*3 + 11w*2 - 26w + 3. Let b be t(-7). Solve -43l + 5 = -bl for l. 1 Suppose -r + 552 = 544. Solve 4v + 2v = rv for v. 0 Let i be 48/(-64)48/(-2). Solve -187w + 183w - i = 0 for w. -3 Suppose 6p - 17 + 5 = 0. Suppose -pu = u + 2u. Solve -3t + 0t = u for t. 0 Suppose -66 = 6f - 8f. Suppose 0 = 4g - 4b, -13 = 2g + 3b - f. Let q(i) = -i*3 + 3i*2 + 3. Let x be q(3). Solve x = -gt + 15 for t. 3 Let i(k) = 7k + 49. Let z be i(-6). Solve zv = -24 + 10 for v. -2 Let m be ((-64)/20)/810-1. Suppose -mz = 3w - 9z - 29, 2z + 8 = 0. Solve 0t - t - w = 0 for t. -3 Let s be -1(2 - 0)3/(-6). Solve 4 = y - s for y. 5 Suppose 3r - 24 = -r. Suppose 27k - 32k + 10 = 0. Let n = r - k. Solve nu + 5 = 5u for u. 5 Suppose 0 = 3f - 9 - 0. Solve fb - 19 + 4 = 0 for b. 5 Suppose 4g = g + 12. Let k be (7/(-4))/((-1)/g). Let j(l) = -l - 1. Let d be j(-3). Solve -dn + kn = -5 for n. -1 Let g(l) = l - 11. Let y be g(14). Let x(c) = c2 + 5c - 4. Let z be x(y). Let p = z - 15. Solve -12 = -pf + f for f. 3 Suppose -3y = 3s - 111, -3s + 129 - 20 = y. Solve s = 40m - 28m for m. 3 Let m = -21 + 32. Solve -mz = -6z + 25 for z. -5 Let x = 4 + 1. Suppose 4t + 131 = 5r, 3 = r - 0. Let u = -23 - t. Solve -u = xi + 4 for i. -2 Let d(q) = 20q*2 + 5q + 5. Suppose a - 5 = -1. Let t(m) = -7m2 - 2m - 2. Let y(o) = ad(o) + 11t(o). Let j be y(2). Solve 2u + 0u = j for u. 3 Let h(v) = 2v - 10. Suppose -3m = -31 + 10. Let u be h(m). Let k = 50 - 30. Solve 0 = -0w - uw + k for w. 5 Let s = -24 - -27. Let a(j) = sj3 + 7j - 2j3 + 7j*2 + 1 + 0 + 7. Let z be a(-6). Solve -4 = -zo - 0o for o. 2 Let w(q) = 4q*2 + 19q - 101. Let g be w(-8). Solve -gn + n = 3n for n. 0 Let t(b) be the third derivative of -b6/120 - b5/10 - b*4/6 + 5b*3/6 - 5b*2. Let u be t(-5). Suppose uq = q. Solve q = 2w - 6w for w. 0 Let m(t) = -6 - 3 - 6t + 7. Let l be m(-1). Suppose -5p + 2h = -7, -p + 22 = p + lh. Solve pn = -n + 8 for n. 2 Let v be (-7 + 2 - -47)9/(-6). Let h = v + 66. Solve 20 = q + hq for q. 5 Let x(u) = -8u - 1. Let v be x(-1). Let f = 12 - v. Suppose 2w = 3w - f. Solve 3y = -2 + w for y. 1 Suppose 2 = -2q + 4j + 4, -4j + 34 = 2q. Suppose -4n + qn = 5. Solve h - n = 4 for h. 5 Let r be (-152)/(-15) - 2/906. Solve -5f - r - 5 = 0 for f. -3 Let l be (-7 + 13)5/((-45)/(-6)). Solve -7q = lq + 33 for q. -3 Let d(q) = -q*3 - 8q*2 - 8q - 3. Suppose 0 = y - 1 - 1. Let l be 1/(-2) - 13/y. Let u be d(l). Solve 4*v + u = -16 for v. -5 Let a =	{ "pile_set_name": "DM Mathematics" }
- -16 and n. 10 Let i(a) = 5a + 7. Let z be i(-2). Let g be (-47)/15 - z - 2473791/(-720). Let c = 3439 - g. What is the common denominator of -65/2 and c? 16 Let g = -35 + 30. Let v = -7 - g. Calculate the least common multiple of v11(-4)/8 and 1. 11 Suppose 10978u = 10974u + 2364. Calculate the lowest common multiple of u and 153. 30141 Let b = 173 + -120. Let g = b + -23. Calculate the common denominator of 75/4 and 0 + (-123)/g - 3. 20 Suppose -6516 = -282w + 5249 + 13615. Calculate the smallest common multiple of 700 and w. 6300 What is the lowest common multiple of 479 and (3632/2 - -3) + -10 + 17? 958 Suppose 0 = -6j - 4347 - 2877. Let q = 4171 + -425477/102. What is the common denominator of q and (4/(-28))/(40/j)? 510 Suppose 19811 - 115409 = -9k. What is the least common multiple of k and 2? 10622 Let f = -160663627/396 - -405716. Find the common denominator of 19/828 and f. 9108 Let k = 1513 - 1507. Suppose -3t - 14 = -2t. Calculate the lowest common multiple of (2 - t/(-6))-42 and k. 42 Let v = -3/4694 - 204165/37552. Let s be (1-1 - 0) + 285/105. Let f = s + -3/14. Find the common denominator of v and f. 16 What is the common denominator of -81/56 and (-34995)/(-8680) - ((-1)/1)/((-17)/68)? 1736 Let s = 1197/11 - 74597/693. Calculate the common denominator of -83/294 and s. 882 Find the common denominator of 107/2145 and (-16)/(178464/91) - 0. 4290 Let d = -142 - -139. What is the common denominator of (-111)/(-16)(-10)/(-135)-3 and (1 - (-91)/(-96))d? 96 Let k = 140 + -137. Suppose -kr + l + 45 = -56, -4l - 98 = -3r. Let m = -6 + 16. What is the lowest common multiple of m and r? 170 Suppose -h + 11 = -13. What is the lowest common multiple of 263/29 + 32/(-464) and h? 72 Let v = -136977709/525 - -260910. What is the common denominator of -191/1050 and v? 1050 Calculate the common denominator of 36/5 and (-4)/22 + 8528/31416. 1785 Suppose -8c = -13c + 615. What is the lowest common multiple of c and 6? 246 Suppose 569 = 5j - 4p, 3j + 18p = 14p + 367. Let q = 302 - 159. What is the smallest common multiple of q and j? 1287 Let a = -41912/11 + 3809. Find the common denominator of a and 29/705. 7755 Calculate the lowest common multiple of (-60)/6 - -5 - (-4 - (0 - -309)) and 176. 1232 Let s = -16361 + 17538. What is the lowest common multiple of s and 44? 4708 Let k = 15258 + -15038. What is the smallest common multiple of 200 and k? 2200 What is the lowest common multiple of 11 and (44642/(-78))/(((-2)/(-9))/((-16)/24))? 18887 What is the lowest common multiple of 36/(15 + 1053/(-72)) and 96? 96 Let c = 86 - 83. Suppose 83 = cz + 5y, 0 = y + y - 8. Let l = 41 - z. What is the smallest common multiple of 8 and l? 40 Let m = -40851/106426288 - 3/19169. Find the common denominator of m and 51/11. 61072 Let z(q) = 10q*3 - 2q*2 + 5q - 8. Let o be z(2). What is the common denominator of o/(-16) + 165/20 + -8 and 2 - (112/9 + -2)? 72 Let k be (-12)/313/(-104)4. Suppose 3b - 3 = 0, -11 = -kf + 3b + 6. What is the smallest common multiple of f and 40? 40 Find the common denominator of 53/45 and (-1417)/(-11445)33/16. 5040 Suppose -36h = -19h + 6477. Let i = -319 - h. Calculate the least common multiple of 18 and i. 558 Suppose -3h - 5l = -39, 44h - l = 47h - 27. Suppose -5n = -g + 12, 0 = -3g - 2n + 44 - h. Calculate the smallest common multiple of g and 24. 24 Suppose -u + 4f = 2u - 138, 5u = 3f + 219. What is the lowest common multiple of 81 and u/10 + 2/(-10)6? 81 Let a = -9641/570 + 265/19. Let b = -14814 + 814716/55. Calculate the common denominator of b and a. 330 Let h(x) = 8x3 + 2x*2 - 8x + 7. Suppose 0 = -29i + 26i + 6. Calculate the least common multiple of 15 and h(i). 315 Suppose -268 = 6a - 1468. Let j = -715125/92 + 7773. Calculate the common denominator of -5((-158)/a - (-150)/200) and j. 460 Let k(d) = -d*2 + 5d - 2. Let u be k(5). Calculate the common denominator of (-60)/4554/(-4) and u/(-6) + 590/(-24). 4 Suppose 0 = -31m + 7934 + 2699. Suppose -m - 125 = -6y. What is the lowest common multiple of y and 16? 624 Calculate the common denominator of (2360/(-144))/(-1)-31/(-3050) and 145/2928. 14640 Suppose -2m + 3m - 8 = 0. Let l be ((45/6)/(-3))/((-3)/6). Suppose -122 = -13j - l. What is the smallest common multiple of m and j? 72 Suppose 3823 = -11y + 3900. Calculate the lowest common multiple of y and 86. 602 Suppose 4v - 3v + 3q - 22 = 0, -5v = 4q - 55. Let j be 1 - ((-2)/v - 38/14). Suppose 80 = r + jr. What is the least common multiple of 32 and r? 32 What is the common denominator of 1176/107660((-1)/(-2) - -2) and -41/6? 4614 Let s be (-9 - 686/(-70))10/31244. Let r = s + -226603/328062. Find the common denominator of r and 49. 42 Suppose -3m - 4t + 1370 = 0, -127m + 129m - 908 = -4t. Calculate the lowest common multiple of 132 and m. 924 Let i = -1/1733 - -46801/17330. Let p be (-1196)/10 - (1 - (-9)/(-15)). Calculate the common denominator of 2416/p + 2/(-10) and i. 30 Let m(k) = -7k2 + 0 + 12k + k*3 - 5 - 3k. Let y(u) = 19u - 524. Calculate the lowest common multiple of y(28) and m(6). 104 What is the common denominator of 45/133 and ((-104)/(-12) - (-9 - -11))/((-133)/(-6))? 133 Let b(m) = -m3 - 16m*2 - 8m - 49. Let o be b(-16). Suppose 4c - 86 = -k, 2k - 74c + oc - 166 = 0. Calculate the smallest common multiple of k and 104. 312 Let l = 202984 - 202867. Suppose r + 4r = 195. Calculate the smallest common multiple of r and l. 117 Suppose -69v + 12051 + 11441 = 2585. Calculate the smallest common multiple of v and 7. 2121 Suppose -2i - 7 = 5a - 44, 4i - a - 85 = 0. What is the lowest common multiple of 24 and i? 168 Let n = -633 + 689. Suppose 0 = 3g + 3o - 156, 6o = g + 9o - n. Calculate the lowest common multiple of g and 50. 50 Let b be 0 - (-5)/(-25) - (-1998)/(-10). Let l = b - -212. Calculate the lowest common multiple of l and 12. 12 Suppose 3c - 6 = 0, g - 4 = 3g - 3c. Let q be 4143220/(-480) + 1/g. Let d = q - -8632. Find the common denominator of d and -77/16. 48 Let p = 60 + -19. What is the common denominator of 4/(p - -3)-5 and (456/(-28))/((-72)/(-16))? 231 Suppose -4z = a + 55, -5a + z = 3z + 239. Let v = 81 + a. Suppose -50q - 1478 = -423q + 1133. Calculate the smallest common multiple of q and v. 238 Let a = 393 - 917. Let h be -3 - (6/26)/(20/a). Let d = h - 13327/2860. Find the common denominator of 17/32 and d. 352 Find the common denominator of (1 + 1012/(-1042))(-1120)/1008 and -53/15. 7815 What is the lowest common multiple of ((-3108)/189)/37 - ((-48138)/(-27))/(-2) and 162? 1782 Let b = -63 + 207. Calculate the least common multiple of 154105/9520 + 9/(-48) and b. 144 Let g = 5 - -1. Calculate the least common multiple of (9/8)/(((-75)/(-600))/(5 + -3)) and g. 18 Let k(m) = -2m + 91. Let r be k(20). What is the common denominator of (r/(-136))/((-9)/44) and -37/10? 30 Let m be (1 + 7-3)-1. Let h = m - 8. What is the lowest common multiple of h and ((-24)/10)/(-2 + 36/20)? 12 Let l(j) = -j*3 - 15j*2 - 43j - 10. Let n be l(-10). Let i = n - -88. Calculate the lowest common multiple of i and 1. 8 Suppose 3u - u - 168 = 4d, -5u = 4d + 168. Let y be 6/d + 824385/(-266). Let v = -2633 - y. Find the common denominator of -103/12 and v. 228 Let i = 265017 - 386394937/1458. Calculate the common denominator of i and -107/756. 20412 Let s = 5167 - 5097. Calculate the smallest common multiple of 294 and s. 1470 Let j = -181 + 191. Suppose -8x - 560 = -jx. What is the lowest common multiple of 20 and x? 280 Let j = 2 - -2. Let r = -2585 + 2609. What is the smallest common multiple of r and j? 24 Let f = 42 + -36. Let t(h) = -270h*2 + 8h - 3. Let j be t(f). Let a = j - -232061/24. Calculate the common denominator of a and -10/27. 216 Suppose -17r + 164 = -13r. Let m = 46 - r. Suppose mj = j + 28. Calculate the lowest common multiple of 12 and j. 84 Suppose r + 2a + 1 = -0, -3 = -3a. What is the smallest common multiple of 40 and (8/r)/(45/(-945))? 280 Let l be ((-3)/(-9)0)/1. Suppose lv + 3w - 232 = -4v, 2w = 0. What is the lowest common multiple of 24 and v? 696 What is the common denominator of 83/464 and 304428/188232 - (-4)/62? 5104 Suppose 4 = -	{ "pile_set_name": "DM Mathematics" }
= -23 - -9. Let i(a) = 138a3 - a2 + a - 1. Let j be i(1). Let u = j - w. What is the units digit of u? 1 Let m(j) = -j + 6. Let a = -23 + 34. Let b be m(a). Let o(d) = -d2 - 6d + 1. What is the units digit of o(b)? 6 Let i = -22 - -30. Suppose j + 5l + i = 0, -4 = -2j + 2l + 4. Suppose 2w - 54 = -jk, 0k + 3w + 44 = 2k. What is the tens digit of k? 2 Let n = 14326 + 7066. What is the ten thousands digit of n? 2 Let g(u) = -50u + 1. Let t be g(-5). Let h be (-116)/3-9 + 0 + 7. Let o = h - t. What is the units digit of o? 4 Let r(f) = -52f2 - 88f - 34. Let u(k) = -26k2 - 45k - 17. Let d(h) = -3r(h) + 5u(h). What is the thousands digit of d(-7)? 1 Suppose -2y - 42 - 8 = 0. Let v = 29 + y. Suppose 4p - 158 = w, 7p - vw = 4p + 125. What is the tens digit of p? 3 Let c be (82110/(-12))/(-17)4/5. Suppose -l + c + 239 = 0. What is the hundreds digit of l? 5 What is the hundreds digit of -65/4-871776/128? 6 Suppose 54d = 172136 + 435148. What is the thousands digit of d? 1 Let k(n) = 45n3 + n2 + 2n - 2. Let y = 6 - 5. Let q be k(y). Suppose 0 = 38o - qo + 1432. What is the hundreds digit of o? 1 Suppose -331873 + 14317 = -132q + 1084152. What is the hundreds digit of q? 6 Let u = 16 - 16. Let d be 512/20 + u. Suppose h - 2p = 49, p + p + 167 = dh. What is the tens digit of h? 5 What is the hundreds digit of 105/126 + 24268/24? 0 Let l(i) = i*2 + 22i - 21. Let q be l(-16). Let u = -78 - q. What is the units digit of u? 9 Let k(r) = -r*3 + 3r*2 + 3r - 3. Suppose -3b + 17 = -10. Let i be (-2)/((-42)/b + 4). What is the units digit of k(i)? 6 Let t = -8210 - -20407. What is the units digit of t? 7 Let m(l) = 44l + 70. Suppose -6i - 48 = -18i. What is the units digit of m(i)? 6 Let a(j) = -1938j - 3647. What is the hundreds digit of a(-8)? 8 Let k(h) = -25h*2 + 2089h - 178. What is the hundreds digit of k(57)? 6 Let i(b) = -57b - 17. Let g be ((-6)/4)/(7 - (-65)/(-10)). What is the hundreds digit of i(g)? 1 Let d(u) = -31u*2 - 3u - 2. Let i be d(-1). What is the units digit of 4/((-8)/(-10))(-2532)/i? 2 Suppose -a - 2m = 2, 7 + 10 = -5a - 3m. What is the tens digit of -5 - 1200/(-32)a/(-1)? 4 Let d(l) = -6l + 1. Suppose -4r + 16 = 4a, -4a + 1 + 19 = 0. Let h be d(r). Let y(j) = 3j*2 - j - 17. What is the hundreds digit of y(h)? 1 Let b be 245 - -2 - (60/(-5))/(-3). Let o = b + -83. What is the tens digit of o? 6 Let k(a) = 17a + 67. Let m be k(-6). What is the hundreds digit of 4/(-10) + (-1 - 31339/m)? 8 Suppose 8g = -544 + 1824. Suppose 862 = 6q + g. What is the tens digit of q? 1 Suppose 0 = -5q + 4m - 21 - 79, q = 2m - 20. Let x(o) = -o2 - 21o - 18. Let z be x(q). Suppose -2v = zn - 158, 1 = v + 5. What is the tens digit of n? 8 What is the thousands digit of (-44682)/(-2) - (-6 + (19 - 7))? 2 Let y be (46/(-115))/((-2)/10). Let n be 70/20 - (-1)/y. Suppose -32 = -2z + nk + 138, -2k = 6. What is the tens digit of z? 7 Suppose -d + 3 = 4g - 4, -g = -2d + 5. What is the tens digit of d(2/462 + -4)? 8 Let d = 18052 + -7733. What is the tens digit of d? 1 Let m(q) be the third derivative of q4/24 + 11q*3/2 - 7q*2. Let b be m(-14). Let i = b - -41. What is the units digit of i? 0 Let v(o) = -9o - 1. Let g be v(3). Suppose x = 2h + 2, h - 6 = 3h. What is the tens digit of (-321)/x + (-21)/g? 8 Let c = -1383 - -3042. Suppose -5i + 4k - 1504 = -4301, 0 = -3i - 4k + c. What is the hundreds digit of i? 5 Suppose 0 = 340z + 26z - 7861680. What is the hundreds digit of z? 4 Let y(a) = 317a + 74. Let o be y(2). What is the hundreds digit of 7/1 - (-51 - o)? 7 Let n = 3954 + -2776. Suppose -4a + n = 2b - 4b, -a + b + 296 = 0. Suppose -7t = 20 - a. What is the units digit of t? 9 Let p(b) = -10b*2 - 26b + 34. Let x(y) = 7y2 + 17y - 23. Let q(c) = -5p(c) - 7x(c). What is the units digit of q(-22)? 3 Suppose 36101 = 12m - 45319. Suppose 42r - 47r = -m. What is the units digit of r? 7 Let r(p) = 3p + 9. Let f(i) = 1. Let l(g) = -10f(g) - 2r(g). Let j be l(-5). Suppose -jv - 2v + 256 = -5b, -3b + 150 = 2v. What is the tens digit of v? 6 Let v = -1214 - -3948. What is the hundreds digit of v? 7 Let r = -209 - -376. Let i = r + 2. What is the hundreds digit of i? 1 Suppose 0 = 598t - 893467 - 173365. What is the tens digit of t? 8 Let t be (-314)/13 - (-34)/221. What is the tens digit of (16/t)/(2/(-1227))? 0 Suppose -v - 39 = -2m, 0 = -5m + 4v - 2v + 99. Let t(j) = 20j + 103. What is the hundreds digit of t(m)? 5 Suppose 3i + 14 = 17. What is the hundreds digit of 413 + 17 + 2/(-2) + i? 4 Let k(m) = 29m2 + 7m + 16 + 8m2 - 36m*2 + 5m*3. What is the units digit of k(6)? 4 Suppose 49h - 49497 = 170905. What is the thousands digit of h? 4 Let h(t) be the third derivative of 91t4/8 - 37t*3/6 - 76t*2. What is the tens digit of h(2)? 0 Let o(l) = 22l3 - l2 + l - 1. Let p be o(-2). Let v = 5 + -39. Let q = v - p. What is the units digit of q? 9 Suppose -4z - z = -4u - 2571, 4z + u - 2040 = 0. Suppose 5y = -4p + z, 13p - y = 8p + 675. What is the units digit of p? 4 Let d = 2479 + -248. What is the units digit of d? 1 Suppose -60 = -7w + 4w. Suppose 0 = -28v + 29v + w. Let a = 51 + v. What is the units digit of a? 1 Let d(k) = -43368k - 714. What is the units digit of d(-1)? 4 Let y be (4/3)/((-4)/(-6)). Let o = -2788 + 2813. Suppose -o = 2n + yi - 197, 0 = -4n + i + 344. What is the tens digit of n? 8 Let c = -69 + 65. What is the tens digit of c/202 - 1088/(-20)? 5 Suppose 5j = k + 44090, -46k + 43k + 44110 = 5j. What is the hundreds digit of j? 8 Let b be -4 - 120/(-28) - (-19)/7. Suppose -bq - 5u = -608, -5q - 4u = -1560 + 538. Let h = q - 101. What is the units digit of h? 5 Suppose 573 = -3i + 5f, 5f - 59 = -i - 230. Let v be (-7)/(35/(-20)) - i. Let m = v + -71. What is the tens digit of m? 1 Let c = -16 - -129. Let y be (c + 0)/(-19 - -20). What is the tens digit of (8 + -9)/((-1)/y)? 1 Let r(v) = 105v*3 - 2v*2 + 5v - 4. Let u be r(2). Suppose -254 = -2s + 2g + u, -3g - 6 = 0. What is the tens digit of s? 4 Suppose 18g - 3c - 11499 = 15g, 3c + 3833 = g. What is the hundreds digit of g? 8 Let i(v) = -4v*2 + 10v + 10. Let u be i(5). Let a = u + 44. What is the units digit of a/(-34) + (-2384)/(-34)? 0 Let m be -5 + -4 + 6 - 174. Let k = m - -406. What is the hundreds digit of k? 2 Let p be (-7)/2(-84)/98. Suppose x = -ph + 4x + 13089, -3h - 3x = -13119. What is the units digit of (-1)/2 + h/32? 6 Suppose 11 + 37 = 3o. Suppose -3p - 4q - o = -4p, -3q = 3p - 3. What is the tens digit of 0/(-1) + -2 + 104 + p? 0 Let s(o) = 13o*2 + 9o + 5. Suppose -2t - 27 = 2t + b, 4b = -4t - 36. What is the units digit of s(t)? 9 Suppose -3a + 11 = 2s, 7a - 3a - 30 = 5s. Let u be (-53)/(s(-2)/(-8)). Let t = 340 - u. What is the units digit of t? 4 What is the thousands digit of (-7 - 66/18)274-18? 2 Let y = -15833 + 34078. What is the ten thousands digit of y? 1 Suppose 3 = -2k + 9. Suppose -4u + 3u - 3f = 710, 0 = -2u + kf - 1420. What is the units digit of u/(-20)(3 + -1)? 1 Suppose -c + 4x = -1977 - 2387, x - 21694 = -5c. What is the units digit of c? 0 Suppose -1737n + 36176 = -1718n. What is the thousands digit of n? 1 Suppose -41d = -61d + 80. Suppose -dk + 8181 = -2r + 2019, k - 1518 = 5r. What is the hundreds digit of k? 5 Suppose -5x + 20 - 5 = -5m, -29 = -2m - 5x. Suppose 481 = ms - 39. What is the units digit of s? 0 What is the thousands digit of (3 + -1 - 3)(-2354 - -115)? 2 Let l = -11359 + 13092. What is the units digit of l? 3 Let c(n) = 40n2. Let z be c(-1). Let a be -6((-13564)/z - 6/15). Suppose 11v = a - 464. What is the units digit of v? 3 Let j(k) = -2k - 1. Let p(n) = 31n + 249. Let l(h) = 6j(h) + p(h). What is the tens digit of l(15)? 2 What is the tens digit of 63101 + (-11)/(242/(-66))? 0 Suppose 0 = 4v - 8, 3t = 5t + 4v - 5362. Let j = t - 1546. What is the hundreds digit of j? 1 What is the ten thousands digit of (-76)/(-3)1650894/1288? 3 Suppose -8c = -11c. Let q be (-5)/20c/(-1). Suppose -s - 3j + 69 = q, 2s + 2j = -0s + 126. What is the tens digit of s? 6 Let c be ((-6)/5)/(90/1500). Le	{ "pile_set_name": "DM Mathematics" }
: 2, r: 8, v: 5}? 8/1365 Calculate prob of sequence cn when two letters picked without replacement from ccnnnccccccccccc. 13/80 Four letters picked without replacement from wgwwggnnwnyngnwgw. What is prob of sequence wyww? 1/476 Two letters picked without replacement from xaaaaaxaaaaaaaaaaaa. Give prob of sequence ax. 17/171 Calculate prob of sequence tik when three letters picked without replacement from ctiiiikiikc. 2/165 Calculate prob of sequence er when two letters picked without replacement from {y: 2, f: 1, e: 2, r: 1, i: 2}. 1/28 Two letters picked without replacement from {q: 2, i: 1}. What is prob of sequence qi? 1/3 Two letters picked without replacement from qqlilooleloqoqo. What is prob of sequence li? 2/105 Three letters picked without replacement from ggrbrrrrrbrrbrigbr. What is prob of sequence igg? 1/816 Two letters picked without replacement from {b: 3, a: 4, d: 1, i: 2, f: 3, o: 4}. What is prob of sequence do? 1/68 Calculate prob of sequence ccc when three letters picked without replacement from ccyccvvaycyc. 1/11 Calculate prob of sequence fo when two letters picked without replacement from {f: 1, k: 1, o: 2, y: 2}. 1/15 Two letters picked without replacement from dycmbcyyyodc. What is prob of sequence mb? 1/132 What is prob of sequence fqfv when four letters picked without replacement from qftffffffffvftf? 11/3276 Three letters picked without replacement from {l: 2, a: 3}. Give prob of sequence aaa. 1/10 Three letters picked without replacement from {g: 8, v: 2, o: 4, r: 5}. What is prob of sequence oro? 10/969 What is prob of sequence gjq when three letters picked without replacement from jeehehhhhheeeegeheqe? 1/6840 What is prob of sequence go when two letters picked without replacement from {o: 12, t: 3, g: 3}? 2/17 Four letters picked without replacement from esvzssvsesrvezsztzv. Give prob of sequence ztes. 1/1292 Four letters picked without replacement from hffzhffh. What is prob of sequence zhfh? 1/70 Calculate prob of sequence gggg when four letters picked without replacement from {g: 6}. 1 Four letters picked without replacement from {j: 2, b: 2}. Give prob of sequence jbjb. 1/6 What is prob of sequence tt when two letters picked without replacement from ttttt? 1 Calculate prob of sequence vlls when four letters picked without replacement from sllvlsvvvll. 2/99 Three letters picked without replacement from {w: 6, g: 1, z: 3, o: 6, q: 1}. Give prob of sequence oog. 1/136 Three letters picked without replacement from qbb. What is prob of sequence qbb? 1/3 Two letters picked without replacement from {a: 2, q: 3, x: 2, i: 4, n: 3, m: 2}. Give prob of sequence ii. 1/20 Three letters picked without replacement from bzbbbbbbzzb. Give prob of sequence zbb. 28/165 What is prob of sequence tt when two letters picked without replacement from tjjathuujj? 1/45 Two letters picked without replacement from {k: 1, i: 2, l: 3, u: 1, a: 1, d: 3}. What is prob of sequence kl? 3/110 Calculate prob of sequence krr when three letters picked without replacement from krrr. 1/4 What is prob of sequence mv when two letters picked without replacement from {x: 6, b: 1, z: 2, v: 2, m: 3}? 3/91 What is prob of sequence em when two letters picked without replacement from {m: 12, e: 1}? 1/13 Two letters picked without replacement from {b: 2, e: 10, m: 1, t: 1, j: 3}. What is prob of sequence mj? 3/272 Four letters picked without replacement from tmmmtmsmmttyemstm. What is prob of sequence mmmm? 1/34 What is prob of sequence fs when two letters picked without replacement from {f: 2, s: 4}? 4/15 What is prob of sequence ii when two letters picked without replacement from ediiijdjoi? 2/15 Calculate prob of sequence vvt when three letters picked without replacement from vtttvtvhttv. 4/55 What is prob of sequence zwv when three letters picked without replacement from {a: 2, w: 5, v: 1, z: 1, s: 5, l: 5}? 5/5814 Calculate prob of sequence ncw when three letters picked without replacement from {l: 2, w: 1, j: 1, n: 1, k: 8, c: 2}. 1/1365 Calculate prob of sequence ug when two letters picked without replacement from ggggggguuug. 12/55 What is prob of sequence lggg when four letters picked without replacement from gglgglgg? 1/7 Calculate prob of sequence ve when two letters picked without replacement from cxyewceycevxewycccyv. 2/95 Three letters picked without replacement from {m: 1, e: 1, d: 1, j: 1, v: 1}. Give prob of sequence vej. 1/60 Two letters picked without replacement from {m: 2, u: 1, v: 5, t: 7, w: 3}. Give prob of sequence uw. 1/102 Two letters picked without replacement from taakkktbahhaxkattah. What is prob of sequence ba? 1/57 Two letters picked without replacement from {p: 3, j: 2, g: 4}. What is prob of sequence gp? 1/6 Calculate prob of sequence bgg when three letters picked without replacement from gbbbgbbbbb. 1/45 Three letters picked without replacement from igiiiiiigiiggg. What is prob of sequence gii? 15/91 What is prob of sequence bb when two letters picked without replacement from qqbbq? 1/10 Two letters picked without replacement from ooojgooogss. Give prob of sequence oo. 3/11 What is prob of sequence wfw when three letters picked without replacement from {f: 7, w: 3}? 7/120 What is prob of sequence yyy when three letters picked without replacement from ysyy? 1/4 Two letters picked without replacement from xuuruirxuiuuuxxxixx. What is prob of sequence uu? 7/57 Four letters picked without replacement from {d: 9, m: 2}. Give prob of sequence mddd. 7/55 Three letters picked without replacement from tlxxlxmztclz. What is prob of sequence ttl? 1/220 Four letters picked without replacement from {h: 11, z: 1, d: 2}. What is prob of sequence dhzh? 5/546 Four letters picked without replacement from {q: 3, v: 5, z: 1}. Give prob of sequence qvvq. 5/126 Calculate prob of sequence vv when two letters picked without replacement from nvvvnsnyszvvvnnny. 15/136 What is prob of sequence ee when two letters picked without replacement from {g: 5, j: 1, b: 2, s: 5, e: 3}? 1/40 What is prob of sequence gbgg when four letters picked without replacement from gxbggbbabgaaabaaaax? 5/3876 Three letters picked without replacement from ppppeep. What is prob of sequence ppe? 4/21 Three letters picked without replacement from {s: 3, a: 3, r: 2, d: 2, e: 7, m: 1}. Give prob of sequence dde. 7/2448 Two letters picked without replacement from cmwmwesgcwwgcwm. What is prob of sequence es? 1/210 Four letters picked without replacement from {f: 1, l: 7, m: 4, a: 2, x: 2, b: 1}. What is prob of sequence xmam? 1/1190 Calculate prob of sequence bd when two letters picked without replacement from ohbdnbndxndxdbxdn. 15/272 Three letters picked without replacement from nnynkynnknnnknnnny. What is prob of sequence kyn? 3/136 Two letters picked without replacement from rohgyyogrobb. Give prob of sequence rh. 1/66 Calculate prob of sequence eck when three letters picked without replacement from ckeaz. 1/60 What is prob of sequence qq when two letters picked without replacement from qjjqqjjjjj? 1/15 Two letters picked without replacement from {l: 3, z: 1, q: 3, a: 2, p: 4, b: 4}. Give prob of sequence zb. 1/68 Calculate prob of sequence to when two letters picked without replacement from ost. 1/6 Two letters picked without replacement from wwmwmsswwmsswwmm. What is prob of sequence ms? 1/12 Three letters picked without replacement from ooccoocococcocccoocc. What is prob of sequence ooc? 11/95 What is prob of sequence hheh when four letters picked without replacement from hhekhehkkke? 1/110 Four letters picked without replacement from lulouiulliciiuclci. What is prob of sequence iilc? 5/1224 Four letters picked without replacement from chcniccnhnf. Give prob of sequence cnfh. 1/330 Calculate prob of sequence xid when three letters picked without replacement from {x: 2, k: 1, d: 2, r: 1, i: 2, y: 5}. 2/429 Four letters picked without replacement from ljulyluublbblqllyq. What is prob of sequence julq? 7/12240 Two letters picked without replacement from {m: 1, a: 4, u: 2, p: 3, b: 7}. Give prob of sequence au. 1/34 Calculate prob of sequence gg when two letters picked without replacement from {g: 7, w: 7}. 3/13 What is prob of sequence vvnv when four letters picked withou	{ "pile_set_name": "DM Mathematics" }
). 4 Let b be (-2)/(-5)20/8. Suppose p = 3 + b. Let g(d) = 0d*2 - 3 + 2d*2 - 2 - 3d*2 + 7d. What is g(p)? 7 Let f be 8/20 + (-16)/(-10). Let k(j) = -j*3 - j - 3 + 0j + 2j2 + 2j*f. Let d be -3 + 3 + -1 + 5. What is k(d)? -7 Let c(t) = -298t + 591t - 5t*2 - 293t. Let b = -1 - -2. Give c(b). -5 Let t(i) = -i + 2. Let a(r) = -r + 1. Let u be a(0). Suppose -l - 3l = -5k + 21, 0 = 5k - 3l - 22. Let f be (1 + u)/(-2)k. Calculate t(f). 7 Let l be 0 + 0 - (0 + -2). Suppose -lk + 22 = -0k. Let o = k + -6. Let f(c) = c2 - 5c - 4. Calculate f(o). -4 Suppose 0 = 3c - m - 34, 0 = -5c + 2m + 14 + 42. Suppose 4p - c = 7p. Let j(v) = v3 + 5v*2 + 5v + 5. Give j(p). 1 Let d = -18 - -12. Let s(a) = -4a + 5. Let b(c) = 3c - 6. Let w(i) = db(i) - 7s(i). Give w(-1). -9 Let f be (-1)/(11/(-8)). Suppose -3q - 3 = 3x, x - f = -0x - 4q. Let l(m) = 0m*2 + 0m*2 - 4m + 2 - 4m2 + 3m*2. Determine l(x). 2 Suppose -15 - 1 = 8h. Let j(w) = w. What is j(h)? -2 Let l be 2 + 0 + (-2)/(-1). Let x(t) = 22t - 18. Let c(r) = 7r - 6. Let p(w) = -16c(w) + 5x(w). Determine p(l). -2 Let w(h) = h - 4. Let a be w(6). Let v(i) = i*2 + 2i - 2. Calculate v(a). 6 Let w(p) = -5p3 - 3p*2 - 2p. Let n(t) = -t. Let u(j) = 2n(j) - w(j). Let s(r) = -11r*3 - 7r*2. Let h(a) = 4s(a) + 9u(a). Determine h(0). 0 Let s(b) = -b3 + 3b - 1. Let h = -3 - -6. Let t(l) = 3l - lh + 5l*2 + 2l + 8 + 0l. Let f be t(6). Determine s(f). -3 Let x(f) be the third derivative of f7/2520 - f6/144 - f5/60 + f4/4 + 3f*2. Let y(t) be the second derivative of x(t). What is y(5)? -2 Suppose 5s - 21 = -4i, 0 = -3i - 9s + 7s + 14. Let t(z) be the second derivative of z4/12 - z3/3 + z*2 + 2z. Determine t(i). 10 Suppose -3 = -3g + 4v - 7, 3v - 3 = 4g. Let n(u) = u*2 - 3. Give n(g). -3 Let m(x) = -2x - 21 + 0x + 13 + 3x. Give m(-6). -14 Suppose -4 - 2 = -2k. Let q(r) = -4r*2 + 4r + 0 - 7 + 2rk - 3r3. Calculate q(-5). -2 Let q(l) = l2 + 5l - 5. Let y be ((-12)/(-36))/(1/15). Suppose -t - 29 = 4w, yw + 40 = t - 3t. Calculate q(w). 1 Let i(q) be the first derivative of 5q + 1/2q*2 - 3. Calculate i(-5). 0 Let a(j) = 4j + 1. Suppose 4h + 18 = 2s, -44 + 14 = -4s + 5h. Let d(w) = w - 6. Let q be d(s). Let m = 2 + q. Give a(m). 5 Let o(d) = -9d + 13. Let j(y) = -3y + 4. Let h(i) = 8j(i) - 3o(i). What is h(5)? 8 Let f(a) be the third derivative of a5/30 - a4/24 + 11a2. Calculate f(-1). 3 Let r(v) = v2 + 3v + 3. Let o be -2(-3)/(3/(-1)). Give r(o). 1 Suppose 0 = 4f + y - 7, -2y = 3f - f + 4. Let a(u) = -u*3 + 2u*2 + 3u + 1. Let s be a(f). Let t(l) = -3l3 - l2 - l + 1. Calculate t(s). -4 Suppose 5g + 9 = 2m, 0 = -2g - 3m - 0m + 4. Let a be g/(3 - (-11)/(-4)). Let t(l) = 2l + 1. Give t(a). -7 Let w = -13 - -16. Let x be 1 - (2 - (0 - w)). Let d(z) = z3 + 3z*2 - 4z - 4. Determine d(x). -4 Let d(y) = 16y3 + 20y*2 - 11y. Let g(o) = 3o3 + 4o*2 - 2o. Let q(s) = -2d(s) + 11g(s). Give q(-4). 0 Let z(o) = o - 11. Let q be z(9). Let b(x) = x*3 + 3x*2 - 2x - 1. Calculate b(q). 7 Let w(j) = 0j2 + 6j - 1 + j*2 + 0j + 0j2. Give w(-6). -1 Let d(n) = -6 + 12 - 2n + 2n2 - 7 + 2n*3. Give d(-2). -5 Let d(o) = -5o*3 - 10o2 - o - 6. Let r(b) = b3 + b*2. Let m(h) = -d(h) - 4r(h). What is m(-6)? 0 Let p(d) = -7 + 0d - d - 2. Let r(m) = 2m + 5. Let c be r(-5). What is p(c)? -4 Suppose 2w - 8 = 0, 5h - 3h + 3w = 20. Let f(v) = -3v + 6. Determine f(h). -6 Let m(c) be the second derivative of c4/4 + c3/6 - c2/2 - 4c. Let d be (-58)/(-4) + 1/2. Suppose -d = 5p - 4n, 3n + n - 21 = -p. Calculate m(p). 3 Let r(v) be the third derivative of -v6/360 + v5/40 - v4/24 + v2. Let a(c) be the second derivative of r(c). Let u = 13 + -8. Calculate a(u). -7 Let g(l) be the second derivative of -l3/6 - 2l. Calculate g(-4). 4 Let k(i) = -i. Let t be (-1)/1 - 5-1. Let l be t - (0 - -2) - -1. Suppose lo = 5o + h + 1, -5 = -h. Give k(o). 3 Suppose 4x - 3 - 1 = -p, -2p = x + 6. Let s(n) = -5 - 6n - 1 + n - n*3 - 5n2. Give s(p). -2 Let z(q) = -q2 + 4q - 4. Suppose -9 = 4f - 1. Let h = f - -6. Determine z(h). -4 Let r(a) = a*2 - 6a + 7. Let u be r(5). Let s(j) = u + 3j2 + 2j + j*2 - 8j*2 + 2j*3. Let f be 2(2 + -1 + 0). Calculate s(f). 6 Let n(w) = 2w - 2. Let u(d) = 3d + 7. Let j(b) = -5b - 11. Let x(v) = -5j(v) - 8u(v). Let o be x(5). What is n(o)? 6 Let p = -34 + 28. Let k(y) = y2 + 5y. Give k(p). 6 Let f(u) = -2u - 2. Let x be f(-2). Let i(g) = 4 - 6g + 6g2 - 2 - 5g*x. Give i(4). -6 Let o(t) = -t + 1. Let f = -1 - -5. Suppose f = 4p - 0. Determine o(p). 0 Suppose -4l + 0p = -2p - 4, 2l - 4p - 2 = 0. Let j(k) = -k - 3k + 7 - l + 2k. Calculate j(5). -4 Let u(f) be the first derivative of -f6/360 - f5/24 + f4/4 - f3 + 2. Let y(t) be the third derivative of u(t). Calculate y(-5). 6 Let o(l) = 8l + 1. Let w be -2 - ((0 - -1) + -8). Suppose g - 15 = -3t, -t + 6t = 5g + w. Suppose -1 = -gq - 4. Determine o(q). -7 Let h(b) be the first derivative of -4b2 + 4b - 16. What is h(3)? -20 Let k(n) = n*2 + 6n + 7. Let h be -3(1 - 20/(-15)). What is k(h)? 14 Let x(w) = w2 + 6w. Let d = -3 - -3. Suppose 3l = -dl + 81. Let t be 23/(-5) + l/45. Calculate x(t). -8 Let w(z) = z*2 - 4z - 2. Let h be w(5). Let p(i) = hi2 - i3 - i2 + 1 - i + 3i*2. Determine p(4). 13 Let v(t) = t - 4t*2 + 5 + 0 + 3t*2. Suppose 2b = 3 + 5. Calculate v(b). -7 Let q(o) be the third derivative of 0o3 + 0 + 0o - 1/8o4 - 4o*2 - 1/15o*5. Determine q(-2). -10 Let a(u) = 10u + 46. Let y(v) = -7v - 31. Let h(s) = -5a(s) - 7y(s). What is h(-7)? -6 Let d(j) = -9j*2 + 2j + 7. Let o(p) = 7p2 - 3p - 6. Let u(h) = 3d(h) + 4o(h). Calculate u(6). -3 Let q be 13 - 12/6. Let t = -1 + q. Let y be (1 - t)(-2)/2. Let a(k) = 8k3 + k2. Give a(y). -7 Let y(x) be the second derivative of -x6/36 + x5/120 - 2x*3/3 - 3x. Let p(k) be the second derivative of y(k). Calculate p(1). -9 Suppose -13q = -14 + 79. Let d(u) = u2 + 4u - 6. Determine d(q). -1 Let s(w) = -w. Let j be s(-2). Let t(d) = jd2 + d + d2 + 10 - 2d*2 + 0d*2. Determine t(0). 10 Suppose -19w - 5 = -20w. Let t(j) = -j3 + 5j*2 - j + 1. What is t(w)? -4 Let d(q) be the second derivative of 0 + 2/3q*3 - 2q*2 - 1/12q*4 + q. Calculate d(4). -4 Suppose -4m - 3u - 16 = -2u, 5m - 3u = -3. Let d(z) = -z2 - z. Let c(p) = p3 - 3p - 1. Let n(q) = -c(q) + 3d(q). What is n(m)? 1 Suppose 0 = k + 2 - 0. Let g(f) = -2f - 1. Let d(u) = 3u + 2. Let o(z) = -3d(z) - 4g(z). What is o(k)? 0 Let f be 10/3(-6)/(-5). Let u(w) be the second derivative of -w4/12 + w2/2 + 2w. Let i(j) = -j*2 - 7j + 8. Let v(m) = i(m) - 2u(m). What is v(f)? -6 Let b(v) = 0v + 4v - 3v + 9v. Suppose 21 = 4a - u + 4, 0 = -5a - 5u - 10. Suppose 0 = 2n + aq + 13, 3 = -4n - 4q - 13. Give b(n). 10 Let j(g) = -g*2 + 4g - 1. Let w be j(5). Let s be 1/(3/w-1). Let k(i) = -i - 1. What is k(s)? -3 Suppose -4q + 12 = 2m + m, -4q - 20 = -5m. Let x = -2 - -3. Let c(p) = -5 + 0p + 2p - x. What is c(m)? 2 Let u be (-9)/54 + 25/6. Let v(r) = ur - 3r + 4 + r. Calculate v(-5). -6 Let d(q) be the first derivative of 1/3q*3 + 4q*2 + 7 - 4q. Determine d(-6). -16 Suppose 5a + 2f - 60 = -0f, 4a = -3f + 48. Suppose -a = 2m + m. Let h(g) = 2g + 3. What is h(m)? -5 Let a(f) = 2f + 4. Suppose l - 7 = r, 3r + 3 = -3. Suppose -3q = -5w + 5, -5q = lw + 6 + 29. Let n be w/6 - 56/12. Calculate a(n). -6 Let h(j) = -7j*2 + 2j + j + 3j2 + 0j2 + j3. Determine h(2). -2 Suppose 4s - 6 = 2s. Let h(n) be the first derivative of -n*4/4 + 2n3/3 + n2/2 - 3n - 4. Determine h(s). -9 Let s(o) be the third derivative of -o6/120 + o5/20 + o4/6 - 2o3/3 + o2. Suppose 61 = 27m - 47. Determine s(m). -4 Let a = -1 - -5. Suppose 4m = 3r + 6, -3r - 2m = -ar - 4. Let x(i) = i*3 - 2i*2 - i. Calculate x(r). -2 Let s(v) = -v + 1. Let a be s(-4). Let p(o) = -ao - 3o2 + 2o*2 + 3 - 3 - 2. Give p(-3). 4 Let k(y) = -65y + 28y + 7 + 32y - y*2. Calculate k(-6). 1 Let t = 145 + -143. Let c(o) = -1 + 3o	{ "pile_set_name": "DM Mathematics" }
6o2 Suppose 0 = 3n - 5n + 12. What is the derivative of -1 + 8a + 3 + n + 3 wrt a? 8 Let a(d) be the first derivative of -9d5/5 - d3/3 + 41d - 95. What is the first derivative of a(g) wrt g? -36g3 - 2g Let h(m) be the first derivative of -61m5/5 + m4/2 + 10m + 96. Differentiate h(l) with respect to l. -244l3 + 6l*2 What is the second derivative of 6765c - 274c2 - 3418c - 3425c wrt c? -548 Find the third derivative of 41k - 99k3 - 34k*3 + 17k*3 + 76k*2 - 74k*2 wrt k. -696 Let x(j) be the second derivative of 4j6/15 - j4/4 - 41j. Find the third derivative of x(g) wrt g. 192g Let t(n) = 2n2 - 3n + 1. Let d be t(2). Suppose 5x + 8g - 80 = 3g, 0 = 4x - 3g - 57. Find the second derivative of -a + da - xa5 + 11a*5 wrt a. -80a*3 Let o be ((-8)/(-6))/((-12)/(-27)1). Differentiate -17ho + 124h - 124h + 30 with respect to h. -51h*2 Suppose -42 = -2s + 4n, -48 = -2s - 2s - n. What is the first derivative of 10 - 8f - 7f + sf wrt f? -2 Let n(d) = -5d - 1. Let y be n(-1). Suppose -yi + 16 = -0. Differentiate -24z3 + 31z*3 + 7 + 4z - iz with respect to z. 21z*2 Let w(y) be the first derivative of 4y*5/5 - 5y*4/2 - 24y*3 - y - 108. Find the third derivative of w(v) wrt v. 96v - 60 Suppose 12 = -0h - 4h. Let z = 5 + h. Find the third derivative of 3d3 - 1 + dz + 1 - d3 wrt d. 12 Let d = 37 - 19. Let m be (-3)/(-2)60/d. Find the second derivative of 2i - mi + 4i4 + 0i*4 wrt i. 48i*2 Suppose -58 = z - 60. Find the third derivative of -139g*2 + 59g*2 + 66g*z - 22g*5 wrt g. -1320g2 Let c(u) = u6 + u5 + u2. Let z(o) = -32o6 + 6o*5 + 2o*4 + 59o*2. Let r(v) = 6c(v) - z(v). Find the third derivative of r(f) wrt f. 4560f3 - 48f Let u(p) be the third derivative of -6p7/35 + p5/20 + p3/3 + 41p*2 + 2. Find the third derivative of u(m) wrt m. -864m Let k(n) be the third derivative of -16n7/7 + 5n*4/4 - 488n*2. What is the second derivative of k(r) wrt r? -5760r2 Let g(z) be the second derivative of -z8/480 - z*7/420 - 5z*4/12 - 16z. Let m(n) be the third derivative of g(n). Find the third derivative of m(x) wrt x. -84 Let x(w) be the first derivative of 0w + 31 + 25/3w*3 - 19/2w*2. Find the second derivative of x(b) wrt b. 50 Let s(m) = -559m*5 + 5m*4 + 7m*2 + 3m. Let h(j) = -280j5 + 3j*4 + 3j*2 + j. Let k(b) = 5h(b) - 3s(b). Find the third derivative of k(n) wrt n. 16620n*2 Let u(z) = 53z*4 + 6z*2 + 3z - 63. Let i(w) = 106w4 + 14w*2 + 7w - 126. Let o(q) = 3i(q) - 7u(q). Differentiate o(x) with respect to x. -212x3 Let c = 55 - 33. Find the first derivative of -44d + cd - 16 + 24d + 4d2 - 26 wrt d. 8d + 2 Differentiate -25 - 3 + 54r2 - 14 wrt r. 108r Let g be (-2)/(-2) - (-7 + 2). Find the second derivative of m*2 - gm + 7m2 - m2 + m2 wrt m. 16 Differentiate -13 + 13g*2 - 87g*2 - 12g*2 with respect to g. -172g Let w(z) = -513z2 + 10z - 13. Let l(v) = -3v - 3. Let p(c) = 3l(c) - w(c). What is the second derivative of p(t) wrt t? 1026 Let v(r) be the third derivative of -73r9/72 - 827r*5/60 + 155r*2. What is the third derivative of v(w) wrt w? -61320w*3 Find the second derivative of -11t*5 + 8t*4 - 14t*4 - 2t*4 - 197t - 2t4 wrt t. -220t*3 - 120t*2 Let n(j) = j - 14. Let p be n(16). Let l = 1 - 1. Find the first derivative of 0g + lg + gp + 0g + 3 wrt g. 2g What is the third derivative of -8t*6 - 379t*2 + 268t*2 + 370t*2 + 8t*3 wrt t? -960t*3 + 48 Let q(g) be the first derivative of -3g*4/2 - 13g*3 + 97g*2/2 - 445. Find the second derivative of q(y) wrt y. -36y - 78 Suppose 0 = 3u + 4 - 10. What is the second derivative of -16s*2 - 16s + 2s2 + 2s*u wrt s? -24 Find the third derivative of 151h*3 - 29h*2 + 182h*2 + 9h + 7h2 - 9h wrt h. 906 Let g(k) be the third derivative of 23k5/20 - 31k4/8 - k3/3 + 2k2 + 173. Find the second derivative of g(t) wrt t. 138 Let p(d) be the first derivative of 10d3/3 + d2 - 218d - 87. Find the second derivative of p(c) wrt c. 20 Let z = 83 - 81. What is the third derivative of 5n*6 + 10n*z - 1 + 1 + 4n*2 wrt n? 600n*3 Let a(x) be the first derivative of -352x*7/7 - 245x*3/3 + 392. Find the third derivative of a(q) wrt q. -42240q*3 Let a(h) = -36h + 41. Suppose 2v - 7v = -85. Let f(c) = -12c + 14. Let l(b) = vf(b) - 6a(b). Differentiate l(w) with respect to w. 12 Let h(u) be the first derivative of 0u*3 + 9/2u*4 - 11 - 43/2u*2 + 0u. What is the second derivative of h(d) wrt d? 108d Let n be (2 + -5)14/(-21) + 2. Find the third derivative of 0d2 + 66d*3 - 35d*3 - n + 2d*2 wrt d. 186 Let h = 5 + 7. What is the third derivative of hm2 - m6 + 35m5 - 35m*5 wrt m? -120m*3 Let l(c) be the first derivative of 0c*3 - 19/5c*5 + 19 + 0c*4 + 0c*2 + 17c. What is the derivative of l(o) wrt o? -76o3 What is the third derivative of 17l*2 - 30l - 25l + 100l*3 + 55l + 3l2 wrt l? 600 Let h(y) be the third derivative of -5y8/42 + y6/40 - y*5/60 - 4y*2 + 72y. What is the third derivative of h(r) wrt r? -2400r2 + 18 Suppose -11 - 3 = 2q. Let z(a) = -2a - 10. Let r be z(q). Find the third derivative of 53t*3 - 53t*3 + 6t*2 - rt*6 wrt t. -480t*3 Let f(j) = -34j + 11. Let z(s) = 1. Let q(g) = -g3 + g2 + 2g + 1. Let l be q(2). Let m(p) = lf(p) - 2z(p). Differentiate m(k) with respect to k. -34 Let d = 18 - -21. Differentiate -125j*3 + 61j*3 + 66j*3 + 24 + 15 + dj*2 with respect to j. 6j*2 + 78j Differentiate -16 - 27l3 + 4 - 24l*3 with respect to l. -153l*2 Suppose 2p - 5o + 11 = 0, -5p - 4o - 1 = -23. Suppose pk + 3g + 13 = 0, 4k + 4g = 2k - 18. Differentiate -6 - 2b2 - 2 - k + 2 wrt b. -4b Let v = -95 - -99. Differentiate 1 - 25fv - 62f + 62f with respect to f. -100f*3 What is the first derivative of 123g*3 - 4g*3 + 127g*3 - 83 + 4 wrt g? 738g*2 Let v(p) be the first derivative of 16p6/3 + p4 - 92p3/3 + 114. Find the third derivative of v(j) wrt j. 1920j*2 + 24 Let n(w) = 165w*3 - 181w*2 + 6w + 6. Let r(i) = -i*2 + 2i + 2. Let q(u) = -n(u) + 3r(u). Find the third derivative of q(y) wrt y. -990 Let m(w) be the third derivative of -w7/42 + w6/30 - 13w*5/5 - 6w*2 + 14w. What is the third derivative of m(k) wrt k? -120k + 24 Let p be 32/(-20)(-15)/6. Suppose p + 2 = 2w. Differentiate -y3 + 4y*w - 3 + 4 with respect to y. 9y*2 Let t(f) be the second derivative of -87f*5/20 - 97f*2/2 - 84f + 1. Differentiate t(b) wrt b. -261b2 What is the second derivative of 0q*4 + 5 - 25q + 3q3 - q5 - 2 - 4 + 0q*4 wrt q? -20q*3 + 18q Suppose -662x + 661x + 3 = 0. Let y(k) be the second derivative of 1/2k4 + 3k*2 + 0k*x - 2k + 0. Find the first derivative of y(g) wrt g. 12g Let w(a) = -32a*3 - 6a*2 - 2a + 153. Let t(i) = 96i3 + 17i*2 + 5i - 462. Let d(p) = 6t(p) + 17w(p). Differentiate d(h) with respect to h. 96h2 - 4 Let m(o) = 6o3 - o2 - 4o + 4. Let c be m(1). Let l(z) = 12z + 17. Let q(h) = 11h + 17. Let j(w) = cq(w) - 6l(w). Differentiate j(k) with respect to k. -17 Suppose f + 5z - 24 = 0, -z = -2f - 0 + 4. What is the first derivative of 33 + 7y*f + 5 - 18y*4 - 14y*4 wrt y? -100y*3 What is the second derivative of -856r + 386r4 + 205r*4 + 47r*4 - 24r*4 wrt r? 7368r2 Let l(n) be the first derivative of n8/48 - 4n6/45 - 31n*3/3 - 25. Let m(s) be the third derivative of l(s). What is the third derivative of m(o) wrt o? 840o Suppose -5a + 12 = 2. Suppose -5q + 32 = -q. What is the third derivative of -3va - 2v*5 + 2v*2 + qv*2 wrt v? -120v*2 What is the second derivative of -1467s*3 + 250s - 136s5 + 1467s*3 wrt s? -2720s*3 Find the second derivative of 9f*2 + 320f*4 - 9f*2 + 5f + 286 - 240 wrt f. 3840f2 Let r(a) be the first derivative of -9a*5/20 - 8a*2 - 7a + 7. Let c(b) be the first derivative of r(b). Differentiate c(d) with respect to d. -27d2 Let b(y) be the first derivative of 40y*3/3 - 117y - 14. Let a(c) = 19c2 - 59. Let l(x) = 5a	{ "pile_set_name": "DM Mathematics" }
+ 1)/5 Let w(u) be the third derivative of u7/490 + u6/70 + 3u5/70 + u4/14 + u3/14 - 6u2. Determine p, given that w(p) = 0. -1 Let d(p) = p4 - p*3 - 1. Let r(s) = -7s*5 - 5s*4 - 10s*3 - 6. Let m(j) = -30d(j) + 5r(j). What is i in m(i) = 0? -1, -4/7, 0 Let y be (1/3)/((-14)/(-21) + 1). Factor -1/5k*3 + yk - 1/5k2 + 1/5. -(k - 1)(k + 1)*2/5 Let z = 6 + -4. Suppose -p = zp - 6. Suppose -1/2v + 1/2vp + 0 = 0. What is v? 0, 1 Let f(j) be the third derivative of -j9/3024 + j7/420 - j5/120 - j*3/2 + 5j*2. Let m(o) be the first derivative of f(o). Factor m(r). -r(r - 1)*2(r + 1)*2 Solve -1/4k*5 - 1/2k*2 + 0k*4 + 0 + 0k + 3/4k3 = 0. -2, 0, 1 Let w(f) be the second derivative of 4f - 1/80f5 + 0 - 1/48f*4 + 0f*2 + 1/120f*6 + 1/24f*3. Let w(z) = 0. What is z? -1, 0, 1 Let 0o*2 + 1/2o*3 + 0 - 1/4o - 1/4o5 + 0o*4 = 0. What is o? -1, 0, 1 Factor 36 + 3l - 43l + 4l*2 + 0l*2 + 64. 4(l - 5)2 Let p(t) be the first derivative of -t4 - 4/5t5 + 0t + 4/3t3 + 2t*2 + 1. Factor p(d). -4d(d - 1)(d + 1)*2 Let j(o) = -o + 8. Let m be j(10). Let s be 0/4 - (m + 0). What is g in 8/9g*5 - 2/9 - 16/9g*4 + 2/9g*3 - 2/9g + 10/9gs = 0? -1/2, 1 Suppose 4f = i - 3i + 28, 5i = 3f - 21. Find q, given that 8q - 26q2 + f - 12 + 13 + 10q*3 = 0. -2/5, 1, 2 Let r(k) = -15k - 12. Let y(m) = m*2 + m - 1. Let b(p) = -r(p) - 3y(p). Factor b(q). -3(q - 5)(q + 1) Let x(a) be the first derivative of 2a3/45 + 8a*2/15 + 32a/15 + 6. Factor x(o). 2(o + 4)2/15 Let q(b) = 12b*2 + 2b - 1. Let j be q(1). Suppose -j = -4d - 1. What is v in -2/7v*5 + 0 + 2/7v*d + 0v - 2/7v4 + 2/7v*2 = 0? -1, 0, 1 Let c(t) = t + 7. Let k be c(-5). Suppose 2q*3 + kq*2 - 3q + 0q3 - 3 + q3 + q2 = 0. What is q? -1, 1 Let p(i) = i4 + 5i*3 + 6i*2 - 7i - 11. Let m(z) = -2z4 - 10z*3 - 12z*2 + 13z + 21. Let l(x) = -3m(x) - 5p(x). Factor l(t). (t - 1)(t + 2)3 Let -2d2 - d3 - 5d3 + 0d*4 + 8d*4 = 0. What is d? -1/4, 0, 1 Suppose 0u = -3u - n + 50, 44 = 2u - 2n. Suppose -3o + u = -3j, -4o - 5j + 24 = -0. Factor -18c*5 - o - 74c*3 + 40c*2 + 60c*4 - 8c + 6. -2c(c - 1)*2(3c - 2)2 Let o be 1(-8)/(-2) - 0. Let 6 - o + 2z2 - 4z + 0z2 = 0. What is z? 1 Let n(t) be the second derivative of 2t*2 - 2/3t*4 + 1/3t*3 - 1/5t*5 - t + 1/21t*7 + 0 + 2/15t*6. Find s such that n(s) = 0. -2, -1, 1 Let o be (8/50)/((-154)/(-35) + -4). Find s such that os*5 + 2/5s*3 + 0s*2 + 0s + 0 + 4/5s4 = 0. -1, 0 Let w be -122(3525/(-3537) - -1). Let k = 4/131 - w. Determine o, given that -2/3o4 - 4/9o*3 - 2/9o*5 + 2/9 + 2/3o + ko2 = 0. -1, 1 Let r(c) be the first derivative of c6/16 + 21c*5/20 + 6c*4 + 8c*3 - 48c*2 - 192c - 25. Find m, given that r(m) = 0. -4, 2 Let n = 92 + -92. Let c(y) be the first derivative of 1/5y2 + 1 + 2/15y*3 + ny. Factor c(p). 2p(p + 1)/5 Let o = 7/30 - -1/10. Let g(h) be the first derivative of -2 - 2h - 3/2h*2 - oh*3. Factor g(b). -(b + 1)(b + 2) Let f(r) be the second derivative of -1/15r4 + 0r*3 + 0r*2 + 0 - 1/50r*5 - 6r. Factor f(x). -2x2(x + 2)/5 Let o(j) be the third derivative of 6j2 - 1/360j*6 + 0 + 1/72j*4 + 0j + 0j3 + 0j*5. Factor o(r). -r(r - 1)(r + 1)/3 Let h(x) = x3 - 3x*2 + 3x. Let w be h(2). Let j(r) be the second derivative of -1/12r3 + 0 + 0r*w - r - 1/24r*4. Factor j(z). -z(z + 1)/2 Let m(q) = q*3 - 4q*2 + 4q + 1. Let g be 1/(-2)12/(-2). Let c be m(g). Factor 0 + 2a*2 + 2a*3 + 2/3a*c + 2/3a. 2a(a + 1)*3/3 Suppose 0 = -2d - 0d + 10. Let o be -1(-4 - -3)d. Factor -oc*2 + 2c2 + c3 - 3c3 - c3. -3c*2(c + 1) Let l(c) be the first derivative of 2 + c*2 - 2/3c*3 - 1/2c*4 + 2c. Determine v so that l(v) = 0. -1, 1 Let r be 344/72 - 2/(-9). Let p(j) be the first derivative of j - 2 - j*2 - 1/5j*r + 0j*3 + 1/2j*4. Suppose p(f) = 0. Calculate f. -1, 1 Let w(i) = 2i*3 - 8i*2 + 10i + 3. Let q(l) = -l*3 + 4l*2 - 5l - 1. Let o(m) = 7q(m) + 3w(m). Factor o(n). -(n - 2)(n - 1)2 Let -5a - 3a3 - 2a*2 + 0a*2 + 4a + 2a = 0. What is a? -1, 0, 1/3 Let d = -59 + 64. Let s(j) be the third derivative of 0 - 1/3j*3 + 0j + j*2 - 1/15j*d - 5/24j*4 - 1/120j*6. Suppose s(m) = 0. What is m? -2, -1 Let z(f) be the second derivative of -1/7f*2 + 2/35f*5 - 2f - 3/14f4 + 0 + 2/7f*3. Factor z(w). 2(w - 1)*2(4w - 1)/7 Suppose -10 = -8i + 3i. Suppose m3 - mi - 1 - m + 0m + 2m2 = 0. Calculate m. -1, 1 Let w = -3 + 4. Let g(r) = 3r3 + r2 - 2r + 1. Let p be g(w). Find v, given that -4/7v + 2/7vp + 0 - 2/7v*2 = 0. -1, 0, 2 Suppose 0 = -o - t + 6, -3o + 22 = o + 2t. Factor 10k - ok2 + 10k + 27 + 8k2 - 2k. 3(k + 3)2 Let f(n) = 200n*4 + 455n*3 + 335n*2 + 55n + 25. Let q(p) = -25p4 - 57p*3 - 42p*2 - 7p - 3. Let z(s) = -3f(s) - 25q(s). Factor z(a). 5a(a + 1)*2(5a + 2) Let u(k) be the second derivative of -k6/30 - k5/60 + k4/18 + 2k. Factor u(y). -y*2(y + 1)(3y - 2)/3 Solve 16l - 5l*2 - 4l*3 + 9l*2 + 32 - 12l*2 = 0. -2, 2 Let r(l) be the first derivative of -3/8l*4 + 0l + 0l2 - 2 + l3 - 3/10l*5. Factor r(v). -3v*2(v - 1)(v + 2)/2 Factor 2/5y + 0 + 4/5y2. 2y(2y + 1)/5 Let c = -78 + 36. Let g be (2/4)/((-7)/c). Let 2/3 - 5/3n - 2/3n*2 + 5/3n*g = 0. Calculate n. -1, 2/5, 1 Let 4/3q*4 - 4q*3 - 12q*2 + 0 + 36q = 0. What is q? -3, 0, 3 Let v(l) be the third derivative of -l7/1155 - l6/660 + l*5/55 + 50l*2. Factor v(u). -2u*2(u - 2)(u + 3)/11 Let s(b) be the first derivative of -b6/180 - b5/20 - b4/6 + 5b*3/3 + 3. Let a(r) be the third derivative of s(r). Factor a(t). -2(t + 1)(t + 2) Let w(b) = -b5 + b4 - 3b*3 + 5b2 + 2. Let p(t) = t5 - t3 - t2 - 1. Let f(x) = -6p(x) - 3w(x). Factor f(o). -3o2(o - 1)*2(o + 3) Let s(i) be the second derivative of 11i7/168 - 13i*6/120 - 9i*5/80 + 13i4/48 - i3/12 - 2i. What is c in s(c) = 0? -1, 0, 2/11, 1 Let v(y) = 3y4 + y3 + y*2 - 5y - 4. Let n(x) = -4x4 - 2x*3 - 2x*2 + 6x + 5. Let m(a) = 4n(a) + 5v(a). Factor m(q). -q(q + 1)3 Suppose -2 = -5y + 13. Let j be 14/15 + y/(-5). Let -10/3w5 + 1/3w*4 + 4w*3 - 2/3w - jw2 + 0 = 0. What is w? -1, -2/5, 0, 1/2, 1 Let u(x) = -1 + 2 + 6x + 2x2 + 7. Let n(i) = 0i - 5 - 4i - i2 + 0. Let s(r) = -8n(r) - 5u(r). Factor s(l). -2l(l - 1) Suppose 5k + 6 = 7k. Let c = 1 + k. Suppose 0p*2 + 0p + 2/7pc + 0 - 2/7p*3 = 0. Calculate p. 0, 1 Suppose 3k - 9 = 6. Let q(u) be the second derivative of 0u3 - u + 0u*k - 1/45u*6 + 1/18u*4 + 0 + 0u*2. Let q(y) = 0. Calculate y. -1, 0, 1 Let d(g) = -3g*2 + 4g + 1. Let h(v) be the first derivative of -v3/3 + v2/2 - v + 9. Let z(j) = -d(j) + 2h(j). Let z(p) = 0. What is p? -1, 3 Let a be 9/(-120)(-15)/(-126). Let c = a + 169/112. Factor 9/4h2 - ch - h3 + 1/4. -(h - 1)2(4h - 1)/4 Factor -1/2i3 + 0 + 0i - 7/2i2. -i2(i + 7)/2 Let p(b) be the first derivative of b*5 + 5b*4/2 - 5b*2 - 5b + 1. Determine x, given that p(x) = 0. -1, 1 Suppose -7y = -3y. Let h be (y - -1)/(4/8). Determine k so that 0k + 2/9 - 2/9k*h = 0. -1, 1 Factor 18r*4 - 2r*5 + 0r*5 + 2r*3 - 2r*2 - 16r*4. -2r*2(r - 1)*2(r + 1) Let a(z) = 2z2 - z - 1. Let i(d) = -14d*2 + 6d + 8. Let l be (-2)/(-3)(3 - -63). Let c(f) = la(f) + 6i(f). Solve c(b) = 0 for b. 1 Factor l2 - 4/3l + 1/3. (l - 1)(3l - 1)/3 Suppose -4 = -m - 1. Suppose -a + 8 = ma. Factor 0v + 8/3 - 2/3v3 - av*2. -2(v - 1)(v + 2)2/3 Let n = -119 - -122. Determine k so that -2k*n + 0 - 1/2k*2 - 2k*4 + 0k = 0. -1/2, 0 Suppose 0g + 2g = -4x + 22, 4g - 5x = -21. Let k be g0/2 + 2. What is d in 10/9d4 + 0 + kd*2 + 4/9d + 8/3d3 = 0? -1, -2/5, 0 Let d(g) be the first derivative of g3/24 + 3g*2/8 - 31. Let d(v) = 0. What is v? -6, 0 Let n(y) be the second derivative of 0y*2 - 6y - 2/3y3 + 0y*4 + 1/20y*5 + 0. Factor n(o). o(o - 2)(o + 2) Let u(n) be the first derivative of n4/2 - 16n*3/3 + 16n**2 +	{ "pile_set_name": "DM Mathematics" }
ower of 1/8, to the nearest integer? 4 What is 35075 to the power of 1/2, to the nearest integer? 187 What is the tenth root of 191865 to the nearest integer? 3 What is the seventh root of 391328 to the nearest integer? 6 What is 1032518 to the power of 1/3, to the nearest integer? 101 What is the square root of 386551 to the nearest integer? 622 What is the seventh root of 44058 to the nearest integer? 5 What is the ninth root of 554727 to the nearest integer? 4 What is 8017924 to the power of 1/7, to the nearest integer? 10 What is the square root of 15934623 to the nearest integer? 3992 What is the square root of 21097031 to the nearest integer? 4593 What is 311705 to the power of 1/3, to the nearest integer? 68 What is 15379773 to the power of 1/2, to the nearest integer? 3922 What is the third root of 513978 to the nearest integer? 80 What is 3912270 to the power of 1/2, to the nearest integer? 1978 What is the eighth root of 233509 to the nearest integer? 5 What is 731720 to the power of 1/2, to the nearest integer? 855 What is the square root of 10313797 to the nearest integer? 3212 What is the square root of 17944159 to the nearest integer? 4236 What is 8376071 to the power of 1/4, to the nearest integer? 54 What is 5247149 to the power of 1/2, to the nearest integer? 2291 What is the seventh root of 1763388 to the nearest integer? 8 What is 29294389 to the power of 1/10, to the nearest integer? 6 What is the cube root of 14787 to the nearest integer? 25 What is the tenth root of 147831 to the nearest integer? 3 What is the cube root of 27013878 to the nearest integer? 300 What is 2818870 to the power of 1/9, to the nearest integer? 5 What is the third root of 1422006 to the nearest integer? 112 What is the ninth root of 2246088 to the nearest integer? 5 What is the third root of 25826063 to the nearest integer? 296 What is the eighth root of 10070761 to the nearest integer? 8 What is the square root of 3931296 to the nearest integer? 1983 What is the square root of 1801877 to the nearest integer? 1342 What is 124187 to the power of 1/3, to the nearest integer? 50 What is the square root of 670692 to the nearest integer? 819 What is 4804001 to the power of 1/9, to the nearest integer? 6 What is 525302 to the power of 1/3, to the nearest integer? 81 What is 381916 to the power of 1/2, to the nearest integer? 618 What is 4013254 to the power of 1/9, to the nearest integer? 5 What is 439172 to the power of 1/2, to the nearest integer? 663 What is the square root of 18718554 to the nearest integer? 4326 What is 533004 to the power of 1/2, to the nearest integer? 730 What is the square root of 743338 to the nearest integer? 862 What is 215660 to the power of 1/8, to the nearest integer? 5 What is 79617 to the power of 1/3, to the nearest integer? 43 What is 1683923 to the power of 1/2, to the nearest integer? 1298 What is the tenth root of 15646507 to the nearest integer? 5 What is the square root of 562929 to the nearest integer? 750 What is the tenth root of 1397987 to the nearest integer? 4 What is 7230500 to the power of 1/7, to the nearest integer? 10 What is the square root of 121652 to the nearest integer? 349 What is the cube root of 254552 to the nearest integer? 63 What is the square root of 415229 to the nearest integer? 644 What is 10090629 to the power of 1/3, to the nearest integer? 216 What is 20142879 to the power of 1/3, to the nearest integer? 272 What is 255874 to the power of 1/2, to the nearest integer? 506 What is 21407799 to the power of 1/5, to the nearest integer? 29 What is 2710379 to the power of 1/5, to the nearest integer? 19 What is the fourth root of 341142 to the nearest integer? 24 What is 71025 to the power of 1/3, to the nearest integer? 41 What is the ninth root of 1604674 to the nearest integer? 5 What is the tenth root of 720955 to the nearest integer? 4 What is 1114656 to the power of 1/3, to the nearest integer? 104 What is the square root of 570223 to the nearest integer? 755 What is 398461 to the power of 1/3, to the nearest integer? 74 What is the square root of 108240 to the nearest integer? 329 What is 129036 to the power of 1/2, to the nearest integer? 359 What is 194463 to the power of 1/3, to the nearest integer? 58 What is 869043 to the power of 1/2, to the nearest integer? 932 What is 33223 to the power of 1/4, to the nearest integer? 14 What is 628137 to the power of 1/4, to the nearest integer? 28 What is 223868 to the power of 1/8, to the nearest integer? 5 What is the square root of 761371 to the nearest integer? 873 What is the sixth root of 628912 to the nearest integer? 9 What is the third root of 1307885 to the nearest integer? 109 What is the cube root of 7509874 to the nearest integer? 196 What is the square root of 630148 to the nearest integer? 794 What is the sixth root of 397865 to the nearest integer? 9 What is the cube root of 2900460 to the nearest integer? 143 What is the third root of 203572 to the nearest integer? 59 What is the third root of 561304 to the nearest integer? 82 What is the third root of 162186 to the nearest integer? 55 What is 7209420 to the power of 1/3, to the nearest integer? 193 What is the third root of 4242019 to the nearest integer? 162 What is the square root of 4125919 to the nearest integer? 2031 What is 7635620 to the power of 1/3, to the nearest integer? 197 What is 174238 to the power of 1/2, to the nearest integer? 417 What is the tenth root of 11182604 to the nearest integer? 5 What is the third root of 55599 to the nearest integer? 38 What is the tenth root of 1787106 to the nearest integer? 4 What is 7419288 to the power of 1/3, to the nearest integer? 195 What is the seventh root of 1579018 to the nearest integer? 8 What is 22211 to the power of 1/9, to the nearest integer? 3 What is the square root of 5638980 to the nearest integer? 2375 What is the ninth root of 16819405 to the nearest integer? 6 What is 12075260 to the power of 1/7, to the nearest integer? 10 What is 1648995 to the power of 1/3, to the nearest integer? 118 What is 3458561 to the power of 1/3, to the nearest integer? 151 What is 2614213 to the power of 1/2, to the nearest integer? 1617 What is 1232331 to the power of 1/2, to the nearest integer? 1110 What is 1393361 to the power of 1/3, to the nearest integer? 112 What is 8240647 to the power of 1/5, to the nearest integer? 24 What is the eighth root of 4942778 to the nearest integer? 7 What is the square root of 2589270 to the nearest integer? 1609 What is 1148495 to the power of 1/2, to the nearest integer? 1072 What is 2608319 to the power of 1/2, to the nearest integer? 1615 What is the third root of 140013 to the nearest integer? 52 What is 4702519 to the power of 1/2, to the nearest integer? 2169 What is the sixth root of 600040 to the nearest integer? 9 What is 540997 to the power of 1/9, to the nearest integer? 4 What is the cube root of 1558665 to the nearest integer? 116 What is the fifth root of 3752193 to the nearest integer? 21 What is 396637 to the power of 1/9, to the nearest integer? 4 What is the cube root of 933552 to the nearest integer? 98 What is the tenth root of 247306 to the nearest integer? 3 What is the sixth root of 886578 to the nearest integer? 10 What is the square root of 2534419 to the nearest integer? 1592 What is the eighth root of 38607221 to the nearest integer? 9 What is the square root of 164894 to the nearest integer? 406 What is 5922802 to the power of 1/2, to the nearest integer? 2434 What is 5830277 to the power of 1/10, to the nearest integer? 5 What is the third root of 11830557 to the nearest integer? 228 What is the third root of 9503764 to the nearest integer? 212 What is the fourth root of 1022850 to the nearest integer? 32 What is the square root of 244811 to the nearest integer? 495 What is the tenth root of 233460 to the nearest integer? 3 What is the square root of 295175 to the nearest integer? 543 What is the cube root of 3715210 to the nearest integer? 155 What is 6819577 to the power of 1/3, to the nearest integer? 190 What is the fourth root of 3174172 to the nearest integer? 42 What is the square root of 13359244 to the nearest integer? 3655 What is 607890 t	{ "pile_set_name": "DM Mathematics" }
u(j). 3j*2 Let a(d) = -2d + 3. Let r(q) = q*2 + 5q - 51. Let w be r(-10). Let b(f) = 4. Let m(k) = 1. Let j(s) = -b(s) + 3m(s). Determine wa(z) - 3j(z). 2z Let m(z) be the third derivative of z*6/40 - 7z5/60 - z2 - 79. Let o(n) be the second derivative of -n5/20 + n4/4 + n. Give -3m(l) - 7o(l). -2l3 Let k(i) = -14i - 643. Let o be k(-46). Let g(b) = -b - 1. Let h(c) = 10c + 8. Determine oh(j) + 6g(j). 4j + 2 Let d(f) = -f - 1. Let m(b) = 2b - 18. What is -3d(p) - m(p)? p + 21 Let i(x) = x - 1. Let v(q) = -6q + 4. Let g be 7/(840/(-104)) - (-4)/(-30). Calculate gv(k) - 4i(k). 2k Let v(a) = -a*2 - 2a + 1. Let h(t) = -88t2 - 31t - 37. Let x(y) = h(y) + 2v(y). Let d(n) = -10n*2 - 4n - 4. Calculate -35d(f) + 4x(f). -10f2 Let w(b) = 5b - 2. Let h be w(1). Suppose 0 = a + h - 2. Let g(p) = p2 - 2. Let r(j) = -j2. Determine ag(q) - 2r(q). q*2 + 2 Let j(w) = -w - 182. Let i(z) = z + 187. Calculate 2i(y) + 3j(y). -y - 172 Let u(f) = -6f*3 - 2f*2 + 4f + 106. Let w(j) = 20j3 + 7j*2 - 14j - 318. Calculate 7u(o) + 2w(o). -2o3 + 106 Let o(c) = -10860c*2 - 181c. Let m(v) = -181v2 - 3v. What is 181m(l) - 3o(l)? -181l2 Let c(q) = -2q*2 - 3q. Let a(s) = -s*2 - 1. Determine 5a(f) - c(f). -3f2 + 3f - 5 Let p(j) = -j2 + j + 2. Let h(t) be the second derivative of t4/4 - t*3/2 - 7t*2/2 + 253t. Suppose 0z - z + 2 = 0. Determine zh(a) + 7p(a). -a2 + a Let w(h) = -2h - 11. Let r = -35 + 34. Let x(u) = 1. Let d(b) = rw(b) + 6x(b). Let t(c) = c + 6. What is 3d(a) - 8t(a)? -2a + 3 Let y(a) = -a + 2. Let m(p) = 1. Let u(r) = -m(r) - y(r). Let o(w) = -7w - 5. Let g(q) = q + 1. Let h(i) = -6g(i) - o(i). Determine -2h(k) + u(k). -k - 1 Suppose 5y + 7h - 61 = 5h, y - 5h + 4 = 0. Let g(x) = x + 2. Let d(z) = 6z + 9. Determine yg(q) - 2d(q). -q + 4 Suppose 0 = -4v - 3g, -696v + 694v = 5g + 14. Let b(m) = 11m3 + 15m*2 - m - 8. Let n(r) = -4r*3 - 5r*2 + 3. What is vb(f) + 8n(f)? f3 + 5f*2 - 3f Let k be (-2)/9 - (-74)/9. Let a(s) = -4s + 1. Let p(y) = 17y - 5. Let g(n) = -9a(n) - 2p(n). Let l(d) = 6d - 3 + 3 + 3. What is kg(t) - 3l(t)? -2t - 1 Let q(m) = 2m2 - 2. Suppose -3l + 0 + 6 = 0. Let p be q(l). Let d(c) = -7c2 + 1 + 0c*2 + pc*2 + 4. Let s(v) = -1. What is -d(u) - 6s(u)? u*2 + 1 Let w(u) = 151u*2 - 67u*2 + 5u + 2 - 85u2 - 5u. Let s(q) be the first derivative of 2q3 - 11q - 1. Give -4s(k) - 22w(k). -2k2 Let w(c) = c2 - 12c - 8. Let q(n) = -n*2 + 10n + 9. What is 5q(y) + 4w(y)? -y*2 + 2y + 13 Let g(w) = -w*2 + 1. Let n(y) = 17 + 3y*2 - 21 + 4y*2 - 3y - y*2 - 2y*2. What is -6g(h) - n(h)? 2h2 + 3h - 2 Let o(y) = -4y - 48. Let d be -11(-3)/15 + 2/(-10). Let i(a) = 1. Let c(v) = do(v) + 88i(v). Let s(p) = 3p + 3. What is 5c(r) + 14s(r)? 2r + 2 Let a(c) = -129c2 + 11c - 5. Let w(z) = -386z2 + 36z - 16. Give -16a(d) + 5w(d). 134d2 + 4d Let q(g) = -101g3 + 101g - 101. Let t(c) = c*3 + c - 1. Give q(p) - 101t(p). -202p3 Let p(y) = 4y + 12. Let m(x) = 7x + 22. What is -3m(q) + 5p(q)? -q - 6 Let w = 333 + -334. Let u(s) = s2 - s - 1. Let n(m) = m2 - 3. Calculate wn(y) + 3u(y). 2y*2 - 3y Let o(w) = -5w3 + 8w - 6. Let l(t) = t*3 - t + 1. Let g(v) = -12v - 30. Let b be g(-3). Give bl(a) + o(a). a3 + 2a Let x(y) = -y + 1. Let p be x(0). Let r(d) be the third derivative of -d6/120 - d4/24 - 636d2. Let m(j) = 7j*3 + 4j. Calculate pm(u) + 4r(u). 3u3 Let s(a) = -26a - 28. Let u(y) = -9y - 9. Give -5s(x) + 16u(x). -14x - 4 Let v = 1 + 1. Suppose -4d = -7d - 15, -3c + d = -14. Let s(o) = o + 3 + v - co - 1. Let x(b) = -2b + 5. Calculate -5s(l) + 4x(l). 2l Let h(f) = 32f3 - 5f - 2. Let j(d) = 95d3 - 14d - 6. What is -11h(g) + 4j(g)? 28g3 - g - 2 Let u(j) = j2 - 2j + 2. Let s(i) = -i - 9. Let c(a) = 2a + 20. Let m(b) = -4c(b) - 9s(b). Calculate -2m(z) - u(z). -z2 - 4 Let k be (47/188)/(0 - 1/(-16)). Let v(h) = h2 - h - 4. Let x(d) = d*2 - d - 4. Calculate kx(q) - 3v(q). q2 - q - 4 Let a(f) = -4f*2 + f - 3. Let h(x) = 21x*2 - 4x + 15. Determine -11a(u) - 2h(u). 2u2 - 3u + 3 Let a(s) = s3 - s2 - 1. Let r(p) = 18p3 - 30p*2 - 24. Calculate 30a(d) - r(d). 12d3 - 6 Let s(t) = 614t*3 + 2t*2 + 2t - 2. Let c(w) = -138769w3 - 453w*2 - 453w + 453. Determine 2c(z) + 453s(z). 604z3 Let y(r) = -127r*2 - 13r - 14. Let o(i) = 32i2 + 3i + 3. What is 18o(a) + 4y(a)? 68a2 + 2a - 2 Let u(q) = 8q + 3. Let a be (13 - 12) + -11. Suppose -2w + 6 = -4y, 11 = -ay - 4y + w. Let k(h) = -7h - 2. What is yu(m) - 5k(m)? 3m - 2 Let i(w) = -5w2 - 12w + 20. Let g(o) = o*3 + 9o*2 + 22o - 39. Determine 6g(c) + 11i(c). 6c3 - c2 - 14 Let d(s) = 11s*3 + 2. Let f(v) = 1. Suppose 3a - 4k - 10 = 0, -8a = -5a - 5k - 11. Determine af(m) - d(m). -11m*3 Let o(r) = 3r*3 - 5r*2 + 6. Let v(n) = -8n*3 + 10n*2 - 4n + 1. Let z(g) = -g3 + g2 - g + 2. Let i(d) = -v(d) + 4z(d). What is 6i(j) - 7o(j)? 3j3 - j2 Let m(w) = -5w2 + 6w - 6. Let l(u) = u*2 - u + 1. Let i(s) = 6l(s) + m(s). Let f = -14 + 15. Let b(k) = 3k2 - k. Calculate fb(g) - 2i(g). g2 - g Let r(a) = -78a*2 - 3. Let d(y) = -2575y*2 - 100. Give -3d(x) + 100r(x). -75x*2 Let f(a) = -17a - 5. Let y(w) = 42w + 12. Suppose -7g - 24 = -59. Calculate gy(q) + 12f(q). 6q Let v(j) = -101j3 - j2 - 3j - 3. Let g(d) = -101d3 - d2 - 4d - 4. Give -3g(s) + 4v(s). -101s3 - s2 Let c(z) = -25047z + 1012. Let f(v) = -248v + 10. What is -5c(g) + 506f(g)? -253g Let y(m) = 4m + 1. Let k(z) = -7z - 1. Let b(w) = -3k(w) - 5y(w). Let n = 636 - 647. Let q(o) = -3o + 5. Suppose 0 = 5l + 20. Calculate lq(h) + nb(h). h + 2 Let p(j) = 3j. Suppose 15n = 20n + g + 11, -3g + 3 = 3n. Let s be 41(-1 - 0). Let z(i) = -i*2 - 4i. Calculate nz(c) + sp(c). 3c2 Let j(u) = -11u*2 + 4u2 - u3 + 1 + 7u2. Let v be (-12)/16 - (-3)/(-12). Let a be (-2)/6-3 + -3. Let b(p) = p*2 - 2. Determine aj(n) + vb(n). 2n3 - n2 Let x(n) = -198n + 39. Let f(t) = -15t + 3. Determine -27f(c) + 2x(c). 9c - 3 Let l(b) = -26b - 4. Let d(f) = -132f - 20. Calculate -3d(s) + 16l(s). -20s - 4 Let w(b) = -13b2 + 9b. Let f(c) = -28c2 + 19c - 1. Calculate -6f(g) + 13w(g). -g*2 + 3g + 6 Let f(x) = -3x2 - 4x - 12. Let q(b) = 8b2 + 11b + 35. What is 11f(a) + 4q(a)? -a*2 + 8 Let n(w) = -17w*3 - 55w*2 - 5w - 11. Let i(z) = -3z3 - 11z*2 - z - 2. Give -11i(t) + 2n(t). -t3 + 11t*2 + t Let f(x) = 265x*3 - 113x. Let g(s) = 264s3 - 114s. Let i(w) = 5f(w) - 6g(w). Let b(a) = -13a3 + 6a. Give 119b(k) - 6i(k). 7k3 Let a(n) = 28n*2 + 2n - 53. Let x(w) = 14w2 + w - 24. Give 6a(f) - 13x(f). -14f2 - f - 6 Let t(l) = l2 + 2l. Let r(x) = -15x*2 + x + 4. Give -r(z) + t(z). 16z*2 + z - 4 Let a = -3 - 1. Let v(w) = -5w*2 + 2w - 3. Let j = 70 + -63. Suppose 4l = y + 2 + j, 0 = -l + 4. Let r(h) = -9h*2 + 3h - 5. What is ar(m) + yv(m)? m*2 + 2m - 1 Let i(g) = 7g2. Let o(j) = 12 + 14 - 38 + 12 - j2. Calculate -i(p) + o(p). -8p*2 Let z(y) = -2y*2 + 36y - 14. Let d(a) = -a*2 - a - 4. Calculate -4d(i) + z(i). 2i2 + 40i + 2 Let p = 204 - 201. Let m(z) = -23z - 3. Let j(r) = 23r + 2. Determine pj(o) + 2m(o). 23o Suppose b + 4j - 25 = -0b, -4b + 61 = 3j. Let c(o) = -2o*2 + 13o + 3. Let l(r) = -r*2 + 6r + 2. Determine bl(u) - 6c(u). -u2 + 8 Let p(c) = c3 - 8c2 + 4. Let u be (-15)/40 - 765/(-120). Let g(v) = -v3 + 9v*2 - 5. Give up(t) + 5g(t). t3 - 3t*2 - 1 Let f(s) = 8s*3 + 16s*2 + 16s. Let a(l) = -l3 - l2 - l. Suppose -r - 40 = -4n - 16, 0 = -3n + 6. Calculate ra(q) - f(q). 8q3 Let k = -2152 - -2147. Let i(o) = -o3 - 3o2 - 1. Suppose 0 = 4r - 12 + 4. Let l(z) = -2z3 - 7z*2 - 2. Give ki(m) + rl(m). m3 + m2 + 1 Let u(i) = 10 - 10 - 6i*2. Let o(m) = 4m*2 - 6m + 6. Let t(k) = k*2 - k + 1. Let l(s) = o(s) - 6t(s). What is 5l(n) - 2u(n)? 2n2 Let k(o) = 2o. Let n(t) = t*2 - 7t + 7. Let h be n(5). Le	{ "pile_set_name": "DM Mathematics" }
+ 4f = 3f - 13. Solve 7k + 4q = tk + 9, -3q + 4 = jk for k. -1 Suppose 39r = 7r. Solve r = 2w + 28 - 20, 28 = 2l - 5w for l. 4 Suppose 6y - 3y - 27 = 0. Let m be 6/2 + 28 + -7 + -3. Solve m = -5g + 2j, y = 5j - 6 for g. -3 Suppose -113 = -2j + 71. Let n = 3279 + -3187. Let a = j - n. Solve -2c + 1 = m - 12, a = m - 4c + 17 for m. 3 Let o be (1 - 3/4)(215 - 207). Let r be 1 + 0 + -2 + 1. Suppose r = 4c - 0c - 28. Solve 0 = 3n - 3w, -cn + 3n = ow + 12 for n. -2 Suppose -2b + 2053 = 2049. Solve 4m - 2i = -12, -13m + 18m + bi = -15 for m. -3 Let j(v) = 29v + 1249. Let w be j(-43). Solve 0 = wx - 3k + 5, 2x = 3k + k - 8 for x. 2 Let c(r) = -r3 + 41r*2 - 116r + 91. Let y be c(38). Suppose -5n = s - y, -8n + 7n + 3 = s. Solve 0g + 4g + 26 = -3o, 2o + 4 = s for g. -5 Let c(m) = m3 + 123m*2 - 646m - 758. Let b be c(-128). Let u be (0 - -1) + 4 + -1. Solve -3z + b = -8z, 3z - 6 = -ui for i. 3 Let t = -131 - -70. Let x = -40 - t. Suppose -24 = -3k + 5p, p - 4p = -4k + x. Solve 0 = kr - 5r + 8, -3r = -l - 14 for l. -2 Let m = 1715 + -1000. Suppose -95 = 10c - m. Let j = 66 - c. Solve -4w + 3w + 1 = a, 0 = -jw + 4a + 28 for w. 4 Let s = 0 - -2. Suppose 2h = 4r + 48, -4h - 17r + 93 = -22r. Solve -l + s = 3x + h, 0 = -3x - 3l - 30 for x. -5 Suppose 9o - 1215 = -0o. Suppose 4b = o - 35. Suppose 2w = 3w + 4k - 23, 5k - b = 0. Solve -2n - wu = -25, 0 = 2u - 2 - 8 for n. 5 Suppose -5j + 12j = 189. Suppose 0 = 3f + j - 39. Solve 2u + 3k = -k + 10, fk = 3u - 5 for u. 3 Suppose 5z + s - 21 = 0, -s + 4s = 3. Let a(y) = y2 - 33y + 144. Let d be a(28). Solve dk = -2r + 3r + 1, zr + 4 = k for r. -1 Suppose 20 = 4u + 16, 3x = -5u - 31. Let j be (44/x + 5 + -2)-3. Solve 4 = -4l - 4p, 3l + p + 1 = -j for l. -1 Let r = -2902 - -2921. Solve -5x = -2y - r, -14x = -18x + 12 for y. -2 Suppose -677 = -b - 653. Solve -y - 3m = -5y + b, 3m + 9 = -y for y. 3 Suppose 53q - 32q = 42. Solve 5k - 3m = -1, 3 = -qk + 2m + 5 for k. -2 Let m be (5 - (-1 - 5))1. Suppose -2p = u - 16, 0 = -u - 0u - 3p + 17. Suppose -10j - 8 = -uj. Solve 5h + m = 4s, -h - 4 = -js + h for s. -1 Let r = -5689 + 5701. Solve -r = f - 7, 0 = 3s - f + 10 for s. -5 Let n(z) = -3z2 - 28z + 126. Let f(w) = 2w2 + 14w - 64. Let s(x) = 5f(x) + 3n(x). Let r be s(6). Solve -3u - 1 = 3m - r, 1 = -m + u for m. 1 Suppose 45g - 50g + 15 = 0. Let d be -5(g - (-36)/(-10)). Let n be 4/18 - 86d/(-54). Solve 0v - 4q + 7 = v, 0 = nq - 15 for v. -5 Let j be (2/(4/5))/((-10)/(-220)11). Solve -jl + 32 = 4i, 4i - 5l = -2l for i. 3 Let o(c) = c2 + 5c + 3. Suppose 2m + 23 - 9 = 0. Let t be o(m). Let k = -3661 + 3664. Solve -5w = 3a + 32, -ka - t = 2w + 3 for w. -4 Let a = -844 - -864. Let m be (-108)/(-15)5/3. Solve -2u + m + 0 = t, 0 = 3u + 2t - a for u. 4 Suppose -38 = j + j. Let f = -13 - j. Let l = 66 - 62. Solve 3r + c = -1, -24 = -4r + fr - lc for r. -2 Suppose -38 = -5o + 32. Let p(f) = f*3 - 14f*2 - f + 14. Let t be p(o). Solve x + v = -0x + 9, -4x + 4v + 4 = t for x. 5 Let g = -69 + 68. Let t be ((-18)/27)/(g/6). Suppose -v + 6 = o, -o - 7 - 2 = -2v. Solve -2b = vf + 18, 4f + tb + 21 = -3 for f. -2 Let h be 12 - (4 + 6 + -7). Let f(y) = y2 - 13y + 46. Let l be f(h). Solve 9a + l = 5v + 4a, 0 = -v + 2a + 1 for v. 3 Let g = 187 - 67. Let n = g - 129. Let b be n/(-6)(100/(-6))/(-1). Solve -2i = -0i - 4c - 30, 0 = 5c + b for i. 5 Suppose -24b - 134b + 247 = -543. Solve 0 = -12a + 9a + y - 10, 0 = -ba + 4y - 5 for a. -5 Suppose 7k = 68 + 44. Suppose w - kd - 7 = -15d, 3d + 27 = 5w. Solve -5g = wl + 23, 0 = -3l + 4l - g - 3 for l. -1 Let v be (0 + 0)/(-7 + 8). Solve 5q + 2p + 21 + 24 = v, q = p - 2 for q. -7 Let b be (6534/(-1936))/((-3)/16). Solve 9 = t - 4s, -7 = -5t - bs + 19s for t. 1 Let b = -134 - -44. Let u be ((-72)/b)/((-2)/(-10)). Suppose -o + 3 = -0, -us + 7 = -3o. Solve 3f = a + 7, 2a + sf = 7 + 19 for a. 5 Suppose -117x + 75 + 25 = -112x. Solve -x = 3i - k - 14, -3i - 2k + 3 = 0 for i. -1 Let h be (-50)/(-20)(-34)/(-5) + 1. Suppose -4d + h = 6. Let w be (14/(-21))/(2/12-2). Solve 5t + 20 = -5c, -wt = -5c + dc + 4 for t. -3 Suppose -2o + 2g = -20 - 22, 0 = -2o + 4g + 52. Suppose oj - 5j - 55 = 0. Let a = -8 + 11. Solve -2t + 2 = -ah, -2t + jh + 4 = t for t. -2 Let o(y) = -3 + y*3 + 10 - 19y*2 - 4 + 0y*3 - 42y. Let p be o(21). Solve pn + 4t + 4 = 0, 0t = 2n - 3t - 3 for n. 0 Let g be (6 - 3)/(42/2464). Suppose -184v + gv + 24 = 0. Solve vi + 17 = -3c - 2c, 5c + 25 = 5i for i. 1 Let n(z) be the first derivative of z*3/3 + 15z*2/2 + 2z - 1. Let u be n(-9). Let m = u + 73. Solve -2w + 5w - 3r = -3, 5r - m = -3w for w. 2 Let o = 31 - 24. Let z = 9 - o. Let g be 56/21 - z/3. Solve 6 = -3w, 4w = -5k + 2k - g for k. 2 Let g be 9/(-36)06/(-12). Solve g = 2r - 6, -14 = 2p + 2r - 20 for p. 0 Let b be (-22)/12(-54)/9 - -31. Solve 8j - 4j = -4i + 32, 4j + i = b for j. 2 Suppose 5 = f + 6, -3p - f + 59 = 0. Solve g + v + 21 = p, -2g = v - 2 for g. 3 Let d be ((-6)/(-30) + 38/10)-3. Let z = d - -14. Solve -6t = zg - 4t - 10, 5g + 3t - 15 = 0 for g. 0 Let z be (0 + (-3)/(-6))/((-155)/(-620)). Solve 0 = 5o + zf + 18, -o + 16 = 4f + 34 for o. -2 Let q = -2845 - -2856. Solve -t + 18 = -3v, -5v - 31 = 9t - qt for t. 3 Let s be (-4 + (-1 - -3))(-65)/(-10). Let i be 0/s + -650/(-3). Let m = -83 + i. Solve -4q + 3x + m = 0, -3q + 15 = -2x + 2 for q. 5 Let j be (-46)/(-14) + (-4)/14. Let g = 60568 + -60567. Solve 4d + 2m = 5m - g, 2d = -jm - 5 for d. -1 Let u(b) = 2b2 - 179b + 532. Let h be u(3). Solve 3q + 4 = -5j, 17q - h = 2j + 22q for j. 1 Let s = -8119 + 8130. Solve -26 = -3r - 5h + s, -3r + 3h = 3 for r. 4 Suppose 24v = 42v - 450. Solve 4c + 4k - 15 = v, -4c + 30 = 2k for c. 5 Let j(p) = p2 + p - 43. Let l be j(0). Let t(m) = -436m - 1261. Let f be t(-3). Let b = f + l. Solve a - bh = -4a + 8, -7 = -4a + 3h for a. 4 Suppose 4s = 2s. Let u(i) = 2 + i*2 + 0 - 46i*3 - 2i + 47i3. Let p be u(2). Solve 5t = 4x - p, s = 3x - 5x + 5t for x. 5 Let j = -409474 - -409480. Suppose 0 = -5g - f - f + 12, g = -f. Solve l - gx = 2, jx = l + 5x + 1 for l. -2 Suppose -5p + 18 = -2l, 3p - 29l = -28l + 10. Solve 4y = pq - 12, -3q = y - 5y - 16 for y. -1 Let q(i) = -43i - 49. Let k be q(-7). Let b = k - 252. Solve b = f + 5s + 18, 4s + 12 = 5f - 14 for f. 2 Let j = 808 + -793. Let m(g) = g3 + 3g*2 + 3. Let a be m(0). Solve -5h + j = -6s + s, -as - 5 = -5h for s. -5 Let o(f) be the third derivative of 7f*4/12 + 77f*3/6 - 2f*2 + 11. Let a be o(-5). Solve 3n - 5 - a = -3m, 2n = 4m + 8 for n. 4 Let f be (-16 + 134/8)/((-3)/(-20)). Solve -3 = fr - 3y, 3r + 31 - 2 = -5y for r. -3 Let z(y) = -y3 + y2 + y. Let j be z(2). Let f = 0 - j. Let m be (6/(-8))/(301/(-56) + 5). Solve 3d = -3w - 24, -fd = -w + m + 2 for d. -4 Let d = -3083 - -3106. Suppose 3c - f = -0f - 49, 5c = -f - 71. Let a = -10 - c. Solve aq - 3g - d = -0g, -4q + 19 = -3g for q. 4 Suppose -5j = 5y - 140, -10y = -8y - j - 47. Let n = y + -25. Solve 0 = -5g - k - 28, 2g + nk + 25 = -5k for g. -5 Suppose 21 + 0 = 3m + 6. Solve -7j - 4h + 20 = -12j, 0 = j + h - m for j. 0 Suppose s - 2o = -2s + 95, -o + 2 = 0. Let k be ((-972)/30)/(-9) + (12/5 - 2). Solve -2h + 0p = -p + 12, -kp + s = -5h for h. -5 Suppose -3u = -3, -2m + 2u - 5 = -13. Solve -2z = mf - 13, -9f = 4z - 6f + 9 for z. -6 Let u = -5481 - -5499. Let q be ((4 - 2) + -2)/2. Solve q = 4k + 5f - 2f - u, k - 7 = -2f for k. 3 Suppose 4a = a. Suppose -o = -ao - 3. Let r be (-170 + 178)(-18)/(-16). Solve -18 = -h - 5j, 4j - r = o for h. 3 Let c be 30/45 + (1 - (-50)/(-3)). Let m be (-56)/(-6) + 5/c. Let j(d) = d2 - 11d + 18. Let o be j(m). Solve o = 4z + 5u - 29, -3 - 5 = 2z - 2u for z. 1 Let c(m) = -m*2 + 6m. Let t be (-56)/(-12) + 2/(-3). Let f be c(t). Suppose 230a - 1620 = 149a. Solve -4i + o + f = -2i, -2i + 4o = -a for i. 2 Let d be (-18)/(-4)8/6. Suppose -w - d + 13 = 0. Solve -7l - v - w	{ "pile_set_name": "DM Mathematics" }
m2 + 3 + 2m*2 - 4m. Let t be l(2). Let x(v) = -v*3 - 6v*2 + 3v - 3. What is the tens digit of x(t)? 2 Suppose -x + 1987 + 2929 = 2m, -m = -x + 4910. What is the tens digit of x? 1 Suppose 0 = 75h - 71h - 340. What is the tens digit of h? 8 Let o be (-1)/(-3) - 6/(-9). What is the tens digit of o - (7 + -3) - -35? 3 Let v(b) = b3 - 3b*2 + 4b + 7. Let c be v(5). Let d = c + -26. Suppose g - 6g - 4z + d = 0, -g + z = -3. What is the units digit of g? 7 Let q(s) = s*3 + 21s*2 - 11s + 9. Let m be q(-21). Suppose -3b + 84 + m = 0. What is the units digit of b? 8 Let n = 220 + -137. What is the units digit of n? 3 Let j = 26 + -24. Suppose -4z + jb = -470, 452 = -0z + 4z + 4b. What is the hundreds digit of z? 1 Let u = 89 - 35. Let m = u + -109. What is the units digit of -3(-12)/9 - m? 9 Let a(x) = 68x*2 - 4x + 6. Let c = 152 + -150. What is the hundreds digit of a(c)? 2 Suppose -6 = 3m - 2a - 18, -4a = 0. What is the units digit of 1/m + (-297)/(-12)? 5 Suppose -5u = -27 + 7. Suppose 21 = -uh + 165. What is the units digit of h? 6 Suppose -5x = 3k - 9468, k - 3k - x = -6305. What is the hundreds digit of k? 1 Let k(v) = 15 - 9v - 6v - v + v2. Let z(y) = -y2 - 21y - 22. Let s be z(-19). What is the tens digit of k(s)? 1 What is the units digit of 3/4 + (-54306)/(-72)? 5 Let j = -19 + 61. Suppose 38u = ju - 808. What is the units digit of u? 2 Suppose 3p - 6p + 3351 = 0. What is the tens digit of p? 1 Let i = 8 - 4. Suppose -3o + 2o + 3 = 0. Suppose ia - d - od - 76 = 0, -d + 35 = 2a. What is the tens digit of a? 1 Suppose -5f + 47 = 4x - 1, -2f - 13 = -3x. Suppose -3r + 3 = -g, x = r + 4r - g. Suppose -4v - 4o = 4, -rv + 3 = o + 1. What is the units digit of v? 3 Suppose -4n - 6b + 3b + 1232 = 0, -5b = n - 325. Suppose -2f + 7f - n = 0. What is the tens digit of f? 6 Suppose 0 = s - 18s + 11322. What is the tens digit of s? 6 Let f = -319 + 551. What is the hundreds digit of f? 2 Let h(w) = 4w3 - 9w*2 + 9w + 13. What is the hundreds digit of h(6)? 6 Let w = 335 - 78. What is the units digit of w? 7 Let j(p) = -p + 12. Let o = -14 + 5. Let n be j(o). Suppose -2y + 3y - n = 0. What is the units digit of y? 1 Suppose 19b = -13b + 32000. What is the units digit of b? 0 Suppose 0 = 4s + 4o - 8520, -2o + 2564 - 8969 = -3s. What is the tens digit of s? 3 Suppose 2r + 18 = r - 5w, 5r = -3w - 2. What is the units digit of ((-30)/25)/(r/(-5))? 3 Let u = 1337 + -750. What is the hundreds digit of u? 5 Suppose 0 = -17j + 27444 + 15532. What is the units digit of j? 8 Suppose -63p + 33471 + 297 = 0. What is the units digit of p? 6 Let c = 551 + -268. Let x = -125 + c. What is the tens digit of x? 5 Suppose -m + 2q = 66, 2q - 288 = 6m - 2m. Let w = 112 + m. What is the units digit of w? 8 Let l = 11 - 25. Let o = 19 + l. Suppose 0 = 5a - 3a + 3d - 29, -a - 3 = od. What is the tens digit of a? 2 Suppose 4k - 2k = 0. Suppose 5j + 1 + 29 = k. What is the units digit of (-144)/(-40)(-1 - j)? 8 Let j be 46/312/(-8). Let x(s) = s3 + 6s*2 - 2s. Let g be x(-4). Let f = g + j. What is the tens digit of f? 1 Let g be (-3)/6(3 + (-12)/4). Let j be ((-4)/(-2))/(4/6). Suppose 0k - 28 = -l - 2k, g = -l - jk + 31. What is the tens digit of l? 2 Suppose 0 = 2n - n - 33. Suppose 2c = 8, -a - 2c + n = -9. What is the tens digit of (-12)/30(-1 - a)? 1 Suppose 7m + 6 = 5m, -34 = -5w + 3m. Suppose 0 = 2k - wg - 291, 125 + 308 = 3k - 4g. What is the units digit of k? 3 Suppose -4n + 9380 - 1856 = 4p, 3774 = 2p - n. What is the hundreds digit of p? 8 Let g(f) be the third derivative of -f6/60 + f5/20 + f4/8 - f3/2 + 6f*2. Let m be g(-3). Let h = m + -40. What is the tens digit of h? 2 Let f = 455 + 1988. What is the thousands digit of f? 2 Let t = 462 - 304. What is the units digit of t? 8 Suppose -6q - 82 = 20. Let i(d) = -d - 1. What is the tens digit of i(q)? 1 Let s = -9234 - -13445. What is the hundreds digit of s? 2 Let g(v) = -5v + 2. Let l be g(-7). Let k = l - 31. Suppose 22 = 4w + k. What is the units digit of w? 4 Suppose 0 = 71u - 95u + 70152. What is the hundreds digit of u? 9 Suppose -a - 3v + 339 = 0, -5v = 21 - 1. What is the units digit of a? 1 Let s = -54 + 57. Suppose -2c - 97 = -n - 0n, -5n - sc + 459 = 0. What is the tens digit of n? 9 Suppose -3o + 45 = -9. Let h be o/3 + 0 + 0. Suppose j - 73 = -5u, 85 = 5u - j + hj. What is the units digit of u? 4 Let q(f) = -f*2 + 10f + 24. Let m be q(11). Let g(n) = -n*2 + 16n - 18. What is the units digit of g(m)? 1 Let g(n) = 2n2 + 16n - 18. Let m be g(14). Suppose 368 = 7l - m. What is the units digit of l? 8 Let a = 554 - -2245. What is the tens digit of a? 9 Let p be -2 + (11 - (-4)/(-1)). Suppose 2 = py - 28. What is the units digit of y? 6 Suppose 4u + 28 = 64. Suppose 2o = uo - 609. What is the tens digit of o? 8 Let c(y) = 3y*3 + 32y*2 + 4y + 20. What is the tens digit of c(-6)? 0 Let g = 146 + -104. Suppose 0 = -gj + 37j + 1145. What is the hundreds digit of j? 2 Suppose -6w - 575 = -83. Let d = 143 + w. What is the units digit of d? 1 Suppose -q + 146 = -4d - d, d - 5q = -34. Let p = 24 - 36. Let f = p - d. What is the units digit of f? 7 Let k(p) be the first derivative of 2p3/3 - p2/2 + 17p + 25. What is the units digit of k(6)? 3 Let l be 10/(-75) - 20915/75. Let j = 486 + l. What is the units digit of j? 7 Let q be (1/3)/(4/456). Let n = q + 5. What is the tens digit of n? 4 Suppose -5v = -4m + 1065, 0 = -0v - 3v + m - 639. Let y = v + 446. What is the hundreds digit of y? 2 Let w(o) = -o3 - 5o*2 - 4o + 5. Let t be w(-4). Let u(k) = k*3 + 11k - 4. What is the tens digit of u(t)? 7 Let x(j) = j + 4. Suppose -2b - 4g = -6, 0b + 2b + 5g = 8. Let l be b/6 + (-39)/(-18). What is the units digit of x(l)? 6 Let t(f) = -f3 + 19f*2 - 15f - 22. Let a be (36/7)/((-4)/(-14)). What is the units digit of t(a)? 2 What is the thousands digit of (-32 - 10556)2/(-8)? 2 Let b(y) = -82y - 2. Let a be b(-5). Suppose 12o - 144 = a. What is the units digit of o? 6 Suppose -5g + 4g + 4o = -33, 0 = -3g + 3o + 144. Suppose g = h + 13. What is the units digit of h? 0 Suppose -5m = 3k - 385, 3m - 4k - 260 = -0. Let w = -14 + m. What is the units digit of w? 6 Suppose 18 = 5u + 3i, 3u + 5i - 3 = 11. Let z be 30/u(-1)/(-2). Suppose -zv = -v - 88. What is the units digit of v? 2 Let l = -2 - -8. Let k be 27/l + 1/2. Suppose d = -3o + 25, d - 14 = -o - k. What is the units digit of o? 8 Let x = 9 - -16. Suppose -30o + 455 = -xo. What is the units digit of o? 1 What is the hundreds digit of (-9)/6 + (-5)/((-70)/39291)? 8 Let z(h) = -5h*3 - 3h*2 - 4h - 15. What is the tens digit of z(-6)? 8 Let n(l) = 4l - 3. Let a = -9 + 12. Let k be n(a). What is the tens digit of k(1 - -1) - 0? 1 Suppose -21h = -29h + 552. What is the units digit of h? 9 Let c be (-2 + 0)14/(-4). Let o(b) be the second derivative of 5b3/6 - b2 + 13b + 2. What is the tens digit of o(c)? 3 Let w be 3 - (-2 - (-8)/4). Let o(n) = nw + 11n + 7n2 - 5n - 12 - 9n. What is the tens digit of o(-6)? 4 Let y = 146 - 142. What is the hundreds digit of y/28 + -741(-2)/14? 1 Let u(o) = 3o3 - 4o*2 + 9o - 8. Let s(i) = -10i3 + 11i*2 - 28i + 24. Let a(x) = 2s(x) + 7u(x). What is the units digit of a(5)? 2 Suppose -9 + 15 = 2b. What is the tens digit of 3 - (2 - b) - -53? 5 Let a(r) = 7r*2 - 1. Let o(x) = -6 - 2x - 1 + 5x - x. Let s be o(3). What is the units digit of a(s)? 6 Suppose v - 4p - 54 = 0, -4p + 2 = -6. Suppose -v = 3h - 245. Suppose 2j - 25 = -5t, 3j - 3t - h = 29. What is the units digit of j? 5 Let m be (-920)/6 - 4/6. Let o = m - -289. What is the units digit of o? 5 Suppose 51z - 3 = 50z. Suppose -zm + 64 = -2y, 3y - 85 = -4m + 23. What is the units digit of m? 4 Suppose -2f = 2x + 28, -2f - 4x - 38 = -0f. Suppose 34 + 51 = 5d. Let l = f + d. What is the units digit of l? 8 Let r be (2/3)/((-4)/(-54)). Suppose r - 29 = -4u. Suppose 2l + 7 = p, -up - 5l + 18 = -2. What is the units digit of p? 5 Suppose 0w - 4w + 340 = 4d, 0 = -d - 2w + 81. What is the units digit of d? 9 Let q be (	{ "pile_set_name": "DM Mathematics" }
ivided by 29? 26 What is the remainder when 23329 is divided by 76? 73 What is the remainder when 12317 is divided by 160? 157 What is the remainder when 30937 is divided by 65? 62 Calculate the remainder when 209 is divided by 71. 67 What is the remainder when 243 is divided by 61? 60 What is the remainder when 480 is divided by 23? 20 What is the remainder when 169 is divided by 13? 0 Calculate the remainder when 210 is divided by 39. 15 Calculate the remainder when 8063 is divided by 16. 15 Calculate the remainder when 3399 is divided by 566. 3 Calculate the remainder when 64 is divided by 48. 16 What is the remainder when 303 is divided by 72? 15 What is the remainder when 139 is divided by 20? 19 Calculate the remainder when 906 is divided by 228. 222 What is the remainder when 117 is divided by 100? 17 What is the remainder when 33 is divided by 7? 5 Calculate the remainder when 1029 is divided by 34. 9 Calculate the remainder when 319 is divided by 59. 24 What is the remainder when 202 is divided by 53? 43 Calculate the remainder when 51 is divided by 19. 13 What is the remainder when 48 is divided by 10? 8 Calculate the remainder when 1000 is divided by 24. 16 What is the remainder when 9 is divided by 3? 0 Calculate the remainder when 637 is divided by 226. 185 Calculate the remainder when 826 is divided by 22. 12 What is the remainder when 966 is divided by 121? 119 What is the remainder when 121 is divided by 16? 9 Calculate the remainder when 183 is divided by 77. 29 What is the remainder when 193 is divided by 93? 7 What is the remainder when 13948 is divided by 90? 88 What is the remainder when 252 is divided by 63? 0 Calculate the remainder when 1475 is divided by 61. 11 What is the remainder when 1678 is divided by 120? 118 Calculate the remainder when 250 is divided by 25. 0 What is the remainder when 2684 is divided by 168? 164 Calculate the remainder when 197 is divided by 29. 23 What is the remainder when 26 is divided by 4? 2 Calculate the remainder when 951 is divided by 4. 3 Calculate the remainder when 112 is divided by 44. 24 What is the remainder when 586 is divided by 74? 68 Calculate the remainder when 92 is divided by 3. 2 Calculate the remainder when 1181 is divided by 93. 65 Calculate the remainder when 312 is divided by 79. 75 Calculate the remainder when 9786 is divided by 89. 85 What is the remainder when 169 is divided by 27? 7 Calculate the remainder when 44 is divided by 16. 12 Calculate the remainder when 657 is divided by 35. 27 Calculate the remainder when 1686 is divided by 140. 6 What is the remainder when 44 is divided by 16? 12 What is the remainder when 317 is divided by 51? 11 Calculate the remainder when 20 is divided by 9. 2 Calculate the remainder when 364 is divided by 37. 31 Calculate the remainder when 2046 is divided by 64. 62 Calculate the remainder when 2349 is divided by 780. 9 What is the remainder when 10219 is divided by 146? 145 What is the remainder when 166 is divided by 24? 22 What is the remainder when 826 is divided by 12? 10 What is the remainder when 1846 is divided by 22? 20 What is the remainder when 127 is divided by 16? 15 What is the remainder when 69 is divided by 12? 9 What is the remainder when 1409 is divided by 94? 93 Calculate the remainder when 117 is divided by 23. 2 What is the remainder when 4170 is divided by 321? 318 Calculate the remainder when 1218 is divided by 53. 52 What is the remainder when 382 is divided by 37? 12 What is the remainder when 129 is divided by 13? 12 What is the remainder when 1097 is divided by 19? 14 What is the remainder when 427 is divided by 118? 73 What is the remainder when 104 is divided by 15? 14 Calculate the remainder when 439 is divided by 70. 19 What is the remainder when 47 is divided by 25? 22 Calculate the remainder when 293 is divided by 42. 41 Calculate the remainder when 335 is divided by 88. 71 What is the remainder when 1627 is divided by 326? 323 What is the remainder when 3375 is divided by 102? 9 What is the remainder when 197 is divided by 96? 5 Calculate the remainder when 1783 is divided by 94. 91 What is the remainder when 987 is divided by 6? 3 Calculate the remainder when 59 is divided by 7. 3 What is the remainder when 262 is divided by 47? 27 Calculate the remainder when 1056 is divided by 14. 6 Calculate the remainder when 1327 is divided by 19. 16 What is the remainder when 40 is divided by 14? 12 Calculate the remainder when 455 is divided by 38. 37 Calculate the remainder when 346 is divided by 103. 37 Calculate the remainder when 9318 is divided by 13. 10 Calculate the remainder when 69 is divided by 57. 12 Calculate the remainder when 69 is divided by 24. 21 Calculate the remainder when 10531 is divided by 439. 434 Calculate the remainder when 4938 is divided by 48. 42 Calculate the remainder when 559 is divided by 19. 8 Calculate the remainder when 169 is divided by 32. 9 What is the remainder when 336 is divided by 119? 98 Calculate the remainder when 145 is divided by 103. 42 What is the remainder when 1503 is divided by 172? 127 Calculate the remainder when 67 is divided by 14. 11 Calculate the remainder when 507 is divided by 58. 43 What is the remainder when 24 is divided by 8? 0 Calculate the remainder when 69 is divided by 68. 1 What is the remainder when 212 is divided by 61? 29 What is the remainder when 189 is divided by 64? 61 Calculate the remainder when 5303 is divided by 102. 101 Calculate the remainder when 1136 is divided by 162. 2 Calculate the remainder when 339 is divided by 176. 163 What is the remainder when 616 is divided by 158? 142 Calculate the remainder when 156 is divided by 25. 6 Calculate the remainder when 1268 is divided by 27. 26 What is the remainder when 46 is divided by 34? 12 What is the remainder when 38 is divided by 3? 2 What is the remainder when 703 is divided by 11? 10 What is the remainder when 70 is divided by 19? 13 Calculate the remainder when 505 is divided by 35. 15 What is the remainder when 1117 is divided by 14? 11 What is the remainder when 301 is divided by 112? 77 What is the remainder when 556 is divided by 191? 174 What is the remainder when 49 is divided by 17? 15 Calculate the remainder when 507 is divided by 85. 82 What is the remainder when 569 is divided by 152? 113 Calculate the remainder when 164 is divided by 52. 8 Calculate the remainder when 51 is divided by 24. 3 Calculate the remainder when 81 is divided by 26. 3 Calculate the remainder when 159 is divided by 31. 4 Calculate the remainder when 15 is divided by 15. 0 Calculate the remainder when 101 is divided by 65. 36 What is the remainder when 348 is divided by 22? 18 Calculate the remainder when 151 is divided by 31. 27 Calculate the remainder when 562 is divided by 21. 16 Calculate the remainder when 1084 is divided by 35. 34 Calculate the remainder when 170 is divided by 54. 8 Calculate the remainder when 502 is divided by 37. 21 Calculate the remainder when 450 is divided by 13. 8 Calculate the remainder when 407 is divided by 34. 33 What is the remainder when 403 is divided by 134? 1 What is the remainder when 28 is divided by 10? 8 Calculate the remainder when 140 is divided by 73. 67 What is the remainder when 674 is divided by 672? 2 What is the remainder when 126 is divided by 19? 12 Calculate the remainder when 120 is divided by 22. 10 Calculate the remainder when 692 is divided by 87. 83 What is the remainder when 211 is divided by 113? 98 Calculate the remainder when 387 is divided by 54. 9 What is the remainder when 205 is divided by 71? 63 What is the remainder when 406 is divided by 34? 32 Calculate the remainder when 302 is divided by 28. 22 What is the remainder when 154 is divided by 6? 4 Calculate the remainder when 3318 is divided by 2. 0 What is the remainder when 1651 is divided by 72? 67 What is the remainder when 123 is divided by 14? 11 Calculate the remainder when 2015 is divided by 20. 15 Calculate the remainder when 1263 is divided by 156. 15 What is the remainder when 20 is divided by 11? 9 What is the remainder when 1121 is divided by 51? 50 What is the remainder when 809 is divided by 12? 5 Calculate the remainder when 7095 is divided by 91. 88 W	{ "pile_set_name": "DM Mathematics" }
206? 109 What is the next term in -76, -137, -178, -181, -128, -1, 218, 547? 1004 What is the next term in 588, 1428, 2264, 3096, 3924, 4748, 5568? 6384 What is next in 440, 880, 1320, 1760, 2200, 2640? 3080 What is the next term in -2881, -5760, -8611, -11434, -14229, -16996, -19735? -22446 What is the next term in 1411, 1513, 1809, 2395, 3367, 4821, 6853? 9559 What is the next term in -14936, -29868, -44800, -59732? -74664 What is the next term in 99, 956, 3363, 8094, 15923, 27624? 43971 What comes next: -8848, -17661, -26474, -35287, -44100, -52913? -61726 What comes next: -4531, -18129, -40793, -72523? -113319 What comes next: -20, 21, 180, 511, 1068, 1905? 3076 What is the next term in 14, 54, 114, 182, 246? 294 What is the next term in 438, 1717, 3838, 6801? 10606 What is next in 76310, 152631, 228956, 305285? 381618 What is the next term in -20094, -40166, -60238, -80310? -100382 What comes next: -74867, -74868, -74869? -74870 What comes next: 1310, 1389, 1592, 1979, 2610, 3545, 4844? 6567 What comes next: -34281, -137187, -308703, -548835, -857589? -1234971 What comes next: -895760, -1791518, -2687276, -3583034, -4478792, -5374550? -6270308 What is next in -402, -2893, -9548, -22449, -43678, -75317, -119448, -178153? -253514 What comes next: 37907, 75792, 113671, 151544, 189411? 227272 What is the next term in -197, -130, 55, 418, 1019, 1918? 3175 What comes next: -1594, -1540, -1446, -1312, -1138? -924 What comes next: 514, 1033, 1556, 2077, 2590, 3089, 3568, 4021? 4442 What is next in -3950, -7914, -11880, -15848? -19818 What is next in 5312, 9620, 13928? 18236 What is the next term in 24528, 49051, 73574? 98097 What comes next: -417, -443, -477, -519? -569 What is the next term in 45961, 45972, 45997, 46042, 46113, 46216, 46357? 46542 What is next in 28177, 112762, 253745, 451132, 704929, 1015142? 1381777 What is the next term in -320, -683, -1078, -1505? -1964 What is next in 2239, 2238, 2235, 2230, 2223? 2214 What is the next term in -663, -670, -675, -678, -679, -678? -675 What is the next term in -33, 4, 89, 240, 475, 812, 1269, 1864? 2615 What is next in 7, 3, 5, 13, 27, 47? 73 What is the next term in 672, 841, 1022, 1221, 1444, 1697, 1986, 2317? 2696 What comes next: -3676, -3625, -3560, -3475, -3364, -3221, -3040, -2815? -2540 What comes next: 10493, 21004, 31533, 42080, 52645? 63228 What is the next term in -108, -369, -800, -1401? -2172 What comes next: 7413, 7396, 7379? 7362 What is next in 566, 2297, 5190, 9251, 14486, 20901? 28502 What comes next: -890, -873, -856, -839, -822? -805 What is next in -26, -95, -212, -377, -590? -851 What is the next term in 15983, 15975, 15953, 15911, 15843, 15743, 15605, 15423? 15191 What is the next term in 56019, 56025, 56035, 56049, 56067, 56089, 56115? 56145 What is the next term in 6642, 26531, 59680, 106089, 165758? 238687 What is the next term in -88982, -177961, -266940, -355919? -444898 What comes next: 149, 560, 1223, 2138, 3305? 4724 What is the next term in 4976, 4572, 4168, 3764, 3360, 2956? 2552 What comes next: 207, 1495, 4953, 11667, 22723, 39207, 62205, 92803? 132087 What is next in -322067, -322065, -322063, -322061, -322059, -322057? -322055 What comes next: -511, -986, -1463, -1942, -2423? -2906 What is next in -273, -512, -751? -990 What is the next term in -240, -574, -928, -1314, -1744? -2230 What is next in -174, -1194, -3896, -9120, -17706? -30494 What is next in -768, -3115, -7066, -12645, -19876? -28783 What is the next term in -826, -1050, -1658, -2842, -4794, -7706? -11770 What is next in 121411, 242822, 364233, 485644, 607055, 728466? 849877 What is next in 2950, 11825, 26616, 47323, 73946? 106485 What is the next term in -504, -839, -1704, -3351, -6032? -9999 What is the next term in 194680, 194678, 194676, 194674, 194672? 194670 What comes next: 120120, 120099, 120068, 120021, 119952, 119855? 119724 What is the next term in -1641, -1687, -1733, -1779, -1825? -1871 What is next in 96, 328, 954, 2172, 4180, 7176? 11358 What is next in 8327, 9059, 10273, 11963, 14123, 16747, 19829? 23363 What is next in 3400, 2854, 1952, 700, -896, -2830? -5096 What is next in -1480, -1472, -1460, -1444, -1424, -1400? -1372 What is the next term in -1307, -2129, -2949, -3767? -4583 What is next in -1108, -1129, -1150? -1171 What is next in -3050, -6130, -9260, -12464, -15766, -19190? -22760 What comes next: 93, 368, 821, 1452, 2261, 3248? 4413 What is the next term in 704, 384, 100, -130, -288? -356 What comes next: 519, 2079, 4689, 8355, 13083? 18879 What comes next: -44067, -44070, -44073, -44076, -44079, -44082? -44085 What comes next: -863, -2211, -3559, -4907, -6255, -7603? -8951 What comes next: 194, 316, 456, 614, 790, 984? 1196 What is the next term in -188, -420, -652, -884, -1116? -1348 What is next in 2792, 2950, 3108, 3266? 3424 What comes next: -151, -362, -643, -994? -1415 What is the next term in 137, 62, -231, -742, -1471, -2418, -3583? -4966 What is next in -19, -160, -305, -454, -607? -764 What is the next term in 82, 193, 330, 499, 706, 957, 1258, 1615? 2034 What is the next term in -640, -781, -1006, -1309, -1684, -2125, -2626, -3181? -3784 What is next in -708, -1420, -2132, -2844? -3556 What is the next term in -458439, -458431, -458417, -458397, -458371, -458339, -458301? -458257 What is next in 96632, 193252, 289858, 386450, 483028? 579592 What is the next term in 852, 1704, 2550, 3390, 4224, 5052, 5874? 6690 What comes next: -57, -160, -259, -360, -469? -592 What is next in 34947, 69887, 104821, 139749, 174671, 209587, 244497? 279401 What comes next: -88, -364, -814, -1444, -2260? -3268 What is next in -5879, -5858, -5817, -5756? -5675 What is next in 2776, 5561, 8346, 11131, 13916, 16701? 19486 What comes next: -518, -850, -1182, -1514? -1846 What is the next term in -9, -391, -773, -1155, -1537, -1919? -2301 What comes next: -1395, -5541, -12449, -22119, -34551? -49745 What is the next term in 23204, 46171, 69136, 92099, 115060, 138019? 160976 What is next in 342, 411, 546, 771, 1110, 1587, 2226, 3051? 4086 What comes next: -36, -10, 64, 186, 356, 574? 840 What is next in -10362, -10400, -10484, -10632, -10862, -11192, -11640? -12224 What is next in 11067, 22173, 33279, 44385, 55491? 66597 What is next in 65510, 130993, 196478, 261965, 327454, 392945? 458438 What is next in 113, 961, 3291, 7853, 15397, 26673? 42431 What is the next term in 2971, 12185, 27591, 49183, 76955, 110901? 151015 What comes next: -3501, -7002, -10503, -14004, -17505? -21006 What comes next: 1829, 1953, 2077, 2201, 2325? 2449 What is the next term in -947, -2128, -4105, -6884, -10471? -14872 What is next in -12341, -12356, -12371? -12386 What is next in 1098128, 2196260, 3294392? 4392524 What is next in -3272, -6537, -9802, -13067, -16332, -19597? -22862 What is next in -223, -1240, -3033, -5602, -8947, -13068? -17965 What is the next term in -354005, -708008, -1062011, -1416014? -1770017 What is the next term in -4016, -4033, -4060, -4097, -4144? -4201 What is the next term in 93, 356, 771, 1332, 2033, 2868, 3831, 4916? 6117 What comes next: -25, -70, -151, -274, -445, -670? -955 What comes next: 88, 109, 122, 127, 124, 113? 94 What is next in 334, 1326, 2978, 5296, 8286, 11954, 16306, 21348? 27086 What comes next: 58, 155, 308, 547, 902, 1403, 2080? 2963 What is the next term in -191, -393, -583, -761, -927, -1081? -1223 What comes next: 10045, 10047, 10049, 10051, 10053, 10055? 10057 What is the next term in 1443, 1355, 1209, 1005, 743, 423, 45? -391 What is next in 144938, 579725, 1304370, 2318873, 3623234, 5217453? 7101530 What is the next term in -201, -323, -369, -339? -233 What is next in -252, -861, -1858, -3243, -5016? -7177 What comes next: -150, -1414, -4838, -11502, -22486? -38870 What is next in -52, -397, -1338, -3175, -6208, -10737, -17062, -25483? -36300 What is the next term in 2881, 5840, 8801, 11764? 14729 What comes next: 7219357, 7219358, 7219361, 7219366, 7219373? 7219382 What comes next: -1213, -1098, -971, -826, -657? -458 What is next in 201, 716, 1537, 2664, 4097, 5836, 7881? 10232 What is next in 394, -517, -2034, -4157, -6886? -10221 What comes next: 2172, 8896, 20104, 35796, 55972, 80632, 109776? 143404 What is the next term in -1215, -2512,	{ "pile_set_name": "DM Mathematics" }
- 4. Calculate the highest common divisor of a and 15. 15 Let m be ((-126)/84)/(1/((-14)/3)). Calculate the highest common divisor of 35 and m. 7 Let g = -224 + 226. What is the highest common divisor of 80 and g? 2 Suppose -3l = 3p + p - 28, 0 = -4l. Calculate the highest common factor of p and 35. 7 Suppose 95q = 88q + 504. Suppose -4d - 10 - 34 = -3j, -d - 45 = -5j. What is the highest common divisor of q and j? 8 Let v(i) = 6i + 5. Let w be v(5). Suppose 0u + 6 = 3u. Let m be (-5)/u(-5 + 3). Calculate the highest common factor of w and m. 5 Suppose 64b - 68b + 180 = 0. What is the highest common divisor of b and 225? 45 Let u(i) = -23i - 17i + 41i + i2 - 14 - 12. Let w be u(5). What is the highest common factor of w and 40? 4 Suppose -u + 5l + 11 = 0, -3u + 6l = 2l. Let c be (-3 - -12)(-4)/(-36). Let j be (-7696)/(-64) + c/u. Calculate the greatest common divisor of j and 48. 24 Suppose 160 = -301o + 309o. What is the highest common divisor of o and 2500? 20 Let y be ((-8 - -1)/1 + 1)-6. Let p = -3 + 2. Let o be (911 - p) + -2. What is the greatest common divisor of y and o? 18 Let l be 1986(-4)/(-18) - 1/3. Let v = l - 224. Calculate the highest common factor of 31 and v. 31 Suppose -4f + 4y = -y - 310, 4f + 2y = 296. Let c(j) = -4j - 66. Let g be c(-24). What is the greatest common divisor of f and g? 15 Let w(l) = l + 2. Let o be w(-2). Let j be (-12 - (o + -3))-1. Calculate the highest common divisor of 27 and j. 9 Suppose -13x + 1044 - 199 = 0. Let l(n) = -n*3 - 7n*2 - 6n + 5. Let q be l(-6). Calculate the highest common divisor of q and x. 5 Let f(n) = -n*3 - 16n*2 + 18n + 17. Let i be f(-17). Suppose i = o - 8 - 1. What is the highest common factor of o and 9? 9 Let z = 87 - 171. Let u = z - -97. What is the highest common factor of u and 52? 13 Suppose -3f - 25 = -3t + f, -5t = -4f - 31. Suppose 60 = 5l + 5a, -18 + 3 = -ta. Calculate the greatest common divisor of l and 63. 7 Suppose 2d = -4w + 4168, d = w - 5w + 4172. Calculate the greatest common divisor of w and 36. 36 Let r = 132 - -678. Calculate the highest common factor of r and 30. 30 Let n = 224 - 147. Calculate the highest common divisor of n and 88. 11 Let d = -182 - -245. Let g = 2 - 2. Suppose 3q = -3h + 33, g = -0q - q + 2. What is the greatest common divisor of h and d? 9 Let k be ((-6)/4)/((-6)/180). Let n(q) = -7q - 227. Let b be n(-35). Calculate the highest common divisor of k and b. 9 Let p(w) = -22w3 - 2w. Let n be p(-1). Calculate the greatest common divisor of n and 312. 24 Suppose 0 = 5j - 227 - 33. Suppose 5x + 0b = 4b + 133, 2x - b - j = 0. What is the greatest common divisor of x and 75? 25 Suppose -a + 30 = 5w + 79, 3w + 119 = -2a. Let l = 68 + a. What is the greatest common factor of 44 and l? 4 Let p = -418 - -1012. Calculate the highest common factor of p and 12. 6 Suppose -1916 - 2116 = -7p. Calculate the highest common factor of p and 9. 9 Let y(m) = 4m - 22. Let q be y(8). Let p be ((-3)/(-1))/((-3)/(-30)3). Calculate the highest common divisor of p and q. 10 Let a(d) = d3 + 14d*2 - 17d - 6. Let z be a(-15). Suppose h - z = -h. What is the greatest common divisor of h and 60? 12 Suppose 54i - 19i - 120 = 27i. Suppose 98 - 638 = -4k. Calculate the greatest common divisor of k and i. 15 Let x(k) = -4k2 + 82k + 2. Let q be x(18). Calculate the greatest common divisor of q and 126. 14 Let r be -7(-3 + -3 + 5). Let n(k) = k2 - 4k - 12. Let p be n(r). Calculate the greatest common factor of 54 and p. 9 Let y = -95 + 113. What is the greatest common divisor of y and 16? 2 Let q be (-4)/(-22) - (575262/99)/(-18). Calculate the highest common factor of 17 and q. 17 Let q be 1/(0 - 3/(-123)). Suppose -3s = -i - i - 138, s - q = -i. Suppose 5o - o - s = -t, -o - t + 8 = 0. Calculate the greatest common divisor of o and 84. 12 Let a = -1694 + 1698. Calculate the highest common factor of a and 164. 4 Let s = 25 - 15. Let f = 26 - -63. Suppose 0 = r - 3w - f, 46 - 123 = -r - w. Calculate the greatest common factor of r and s. 10 Let j(y) be the second derivative of -y4/12 + 17y*3/6 - 2y*2 + 13y. Let g be j(13). What is the greatest common divisor of g and 120? 24 Suppose -2x - t - 65 = 0, 4t = 5x + 119 + 76. Let v = -22 - x. What is the highest common factor of v and 13? 13 Suppose 2p = 5 + 75. Suppose 7g - 82 + p = 0. Calculate the highest common factor of 30 and g. 6 Let m(o) be the second derivative of -5o*3/6 - 69o*2/2 + 47o. Let t be m(-14). What is the highest common factor of t and 8? 1 Let x be (-16)/(-28) + 465/7. What is the highest common divisor of 1809 and x? 67 Let f(j) = 17j + 1. Let g be f(1). Let h = 688 + -1048. Let p be (h/(-21))/((-2)/(-21)). Calculate the greatest common divisor of p and g. 18 Let x be (1/(-3))/((-1)/12 - 0). Suppose 2n - xz - 112 = -0n, 4n + 3z - 268 = 0. Let b be (-4)/(((-6)/8)/3). What is the highest common divisor of n and b? 16 Suppose 2j - 115 + 13 = -3z, -5j - z = -229. Let d be 24/(-44) - 2040/(-110). Calculate the highest common factor of j and d. 9 Suppose -b - 8 + 61 = 0. Suppose -b = -4r + 5w, 3w = 2r - 41 + 14. Let q = r + -7. What is the greatest common divisor of 10 and q? 5 Let y = -368 - -458. What is the greatest common factor of 330 and y? 30 Let i(y) = 26y - 990. Let s be i(39). Suppose -3c + 17 + 79 = 0. Calculate the highest common divisor of s and c. 8 Let q(i) = 3i*2 + i + 2. Let j be q(-2). Suppose 3d - 353 = 4m - 49, 545 = 5d + m. Suppose 36 = -2c + d. Calculate the highest common factor of j and c. 12 Let z(q) = -5q - 34. Let v(t) = -4t - 33. Let x(l) = -4v(l) + 3z(l). Let g be x(-14). Let u = g + -2. Calculate the highest common divisor of 21 and u. 7 Let a be 4(66/24 - 2). Let j(f) = f*3 - 8f*2 - 10f + 12. Let r be j(9). Calculate the highest common divisor of r and a. 3 Let j be 22 + 0 + -2(-7)/7. Let i(u) = -2u*2 - 3 + 3u*3 - 2u*3 + 7u*2 - 3u. Let r be i(-5). What is the greatest common factor of r and j? 12 Let c be (-176)/33(-69)/4. Calculate the highest common factor of 506 and c. 46 Suppose 0 = 7s - s - 108. Let m be (-9)/s20-1. What is the highest common factor of m and 110? 10 Let u be 36 - (13 + -2 + -6). Let h be 4/6102/4. Let s = h + u. What is the greatest common divisor of s and 12? 12 Let t(w) = w3 - 12w*2 + 8w + 12. Let l be t(13). Let b be (-3)/(-5) - l/(-25). What is the greatest common divisor of b and 8? 4 Let k(t) = 12t2 - 14t - 14. Let m be k(11). Suppose -66 = -6f + m. Calculate the greatest common divisor of 25 and f. 25 Suppose 0 = 3w - 8w + 40. Suppose -wp + 10 = -6p. Calculate the greatest common factor of p and 40. 5 Let g(t) = -t + 2. Let m be g(0). Let p be -106/(-15) + m. What is the greatest common divisor of 48 and p? 6 Let v = 49 + -3. Let b be (-72)/(-5) - (v/(-10) - -4). Let r be 16 + (1-2)/2. Calculate the highest common factor of r and b. 15 Let p be (5 + -4 - -1)/((-2)/(-110)). Calculate the highest common divisor of p and 77. 11 Suppose 2x + 3x - 3w - 628 = 0, -108 = -x + 5w. What is the greatest common factor of 24 and x? 8 Let f(q) = 2q*2 + 15q - 2. Let y be f(10). Suppose -4x + y = -120. Let m be 2/(-8) + 159/12. What is the highest common factor of m and x? 13 Suppose 5695 - 195 = 10q. What is the greatest common factor of q and 100? 50 Let f be ((-72)/63)/(-2) + (-1949)/(-7). Calculate the highest common divisor of f and 9. 9 Let m(w) = w*3 + 5w*2 + 4w - 1. Let s be m(-3). Suppose -3 - 22 = -sv. Let g be (v/3)/((-1)/(-9)). Calculate the highest common factor of g and 5. 5 Suppose 3y + 29 = -7. Let q = y + 21. What is the greatest common divisor of q and 3? 3 Let m be 10(336/40 + 0). Calculate the greatest common divisor of 12 and m. 12 Let l be 34 + (-11 - (-28)/7). Calculate the greatest common factor of l and 144. 9 Suppose -5q = -3l - 143, 2q = -l - 4l + 82. Let j = -449 + 728. Calculate the highest common divisor of q and j. 31 Suppose -4c + 3 + 54 = -3w, 0 = 4c - 2w - 54. Let h be (-2 + 15/20)/((-3)/c). What is the greatest common factor of 85 and h? 5 Let s = -22 + 26. Suppose -sl + 6c = c - 2903, 0 = -4l + 2*c + 2918. Let z be 2/14 + l/21. What is	{ "pile_set_name": "DM Mathematics" }
many minutes are there between 12:14 AM and 1:23 AM? 69 How many minutes are there between 8:26 PM and 8:10 AM? 704 What is 386 minutes before 1:26 AM? 7:00 PM What is 708 minutes after 12:41 AM? 12:29 PM What is 644 minutes after 5:35 AM? 4:19 PM How many minutes are there between 1:19 AM and 8:20 AM? 421 What is 265 minutes after 8:29 PM? 12:54 AM How many minutes are there between 1:27 AM and 4:41 AM? 194 How many minutes are there between 4:50 PM and 7:22 PM? 152 What is 136 minutes after 12:10 PM? 2:26 PM What is 657 minutes after 1:43 PM? 12:40 AM What is 360 minutes after 10:27 PM? 4:27 AM How many minutes are there between 1:03 AM and 5:56 AM? 293 What is 252 minutes after 4:03 PM? 8:15 PM How many minutes are there between 8:50 PM and 9:44 PM? 54 What is 50 minutes before 6:37 PM? 5:47 PM What is 704 minutes before 3:07 AM? 3:23 PM How many minutes are there between 3:47 AM and 10:18 AM? 391 What is 302 minutes before 2:05 PM? 9:03 AM How many minutes are there between 12:08 PM and 9:28 PM? 560 What is 391 minutes after 12:41 PM? 7:12 PM What is 293 minutes after 9:01 AM? 1:54 PM How many minutes are there between 10:43 AM and 1:28 PM? 165 What is 402 minutes before 9:49 AM? 3:07 AM What is 191 minutes before 7:40 PM? 4:29 PM How many minutes are there between 10:16 PM and 10:01 AM? 705 What is 669 minutes before 11:09 PM? 12:00 PM What is 318 minutes after 7:37 AM? 12:55 PM What is 371 minutes after 2:38 PM? 8:49 PM How many minutes are there between 7:00 AM and 6:01 PM? 661 What is 77 minutes after 10:18 AM? 11:35 AM What is 528 minutes before 9:46 PM? 12:58 PM What is 12 minutes before 11:16 AM? 11:04 AM What is 538 minutes before 5:46 AM? 8:48 PM What is 372 minutes before 4:58 PM? 10:46 AM How many minutes are there between 7:33 PM and 7:22 AM? 709 What is 618 minutes before 8:34 PM? 10:16 AM How many minutes are there between 4:39 AM and 4:11 PM? 692 How many minutes are there between 4:41 AM and 11:29 AM? 408 What is 62 minutes before 2:32 PM? 1:30 PM How many minutes are there between 11:32 AM and 12:32 PM? 60 How many minutes are there between 5:23 PM and 6:23 PM? 60 What is 400 minutes after 3:46 PM? 10:26 PM How many minutes are there between 2:56 AM and 2:14 PM? 678 How many minutes are there between 3:42 PM and 7:33 PM? 231 What is 325 minutes after 2:02 PM? 7:27 PM What is 359 minutes after 4:34 PM? 10:33 PM How many minutes are there between 12:46 AM and 11:04 AM? 618 How many minutes are there between 1:28 PM and 2:50 PM? 82 What is 581 minutes before 7:07 AM? 9:26 PM What is 63 minutes before 4:17 AM? 3:14 AM What is 19 minutes after 3:30 AM? 3:49 AM How many minutes are there between 8:54 PM and 10:24 PM? 90 How many minutes are there between 4:54 PM and 6:55 PM? 121 How many minutes are there between 11:55 PM and 10:20 AM? 625 How many minutes are there between 12:01 AM and 9:48 AM? 587 What is 204 minutes after 3:02 PM? 6:26 PM How many minutes are there between 1:51 AM and 4:44 AM? 173 How many minutes are there between 6:14 AM and 10:39 AM? 265 What is 341 minutes after 3:52 PM? 9:33 PM How many minutes are there between 10:30 PM and 7:14 AM? 524 How many minutes are there between 1:43 PM and 9:31 PM? 468 How many minutes are there between 5:28 PM and 6:20 PM? 52 What is 630 minutes after 10:49 AM? 9:19 PM What is 398 minutes after 10:33 AM? 5:11 PM How many minutes are there between 5:46 PM and 11:23 PM? 337 What is 76 minutes before 6:16 PM? 5:00 PM What is 416 minutes before 12:45 PM? 5:49 AM How many minutes are there between 3:41 PM and 3:47 PM? 6 How many minutes are there between 12:57 AM and 10:03 AM? 546 How many minutes are there between 11:17 AM and 11:06 PM? 709 How many minutes are there between 7:09 AM and 4:45 PM? 576 How many minutes are there between 12:31 PM and 9:50 PM? 559 How many minutes are there between 8:45 PM and 1:19 AM? 274 What is 530 minutes after 2:54 AM? 11:44 AM What is 672 minutes before 12:11 PM? 12:59 AM How many minutes are there between 10:51 PM and 1:25 AM? 154 What is 170 minutes after 4:01 PM? 6:51 PM What is 587 minutes before 6:33 PM? 8:46 AM How many minutes are there between 12:19 AM and 3:42 AM? 203 What is 98 minutes after 9:54 PM? 11:32 PM How many minutes are there between 10:11 PM and 12:18 AM? 127 How many minutes are there between 12:18 PM and 9:02 PM? 524 How many minutes are there between 5:19 AM and 8:41 AM? 202 How many minutes are there between 6:35 AM and 3:25 PM? 530 How many minutes are there between 11:50 AM and 2:37 PM? 167 What is 270 minutes before 12:04 AM? 7:34 PM What is 627 minutes before 1:12 AM? 2:45 PM What is 250 minutes before 7:26 PM? 3:16 PM How many minutes are there between 6:58 AM and 6:15 PM? 677 What is 4 minutes after 6:47 AM? 6:51 AM What is 156 minutes after 12:02 PM? 2:38 PM What is 576 minutes after 3:35 AM? 1:11 PM How many minutes are there between 11:10 PM and 1:31 AM? 141 How many minutes are there between 9:33 PM and 2:03 AM? 270 What is 538 minutes before 2:16 PM? 5:18 AM What is 646 minutes after 9:25 PM? 8:11 AM What is 366 minutes before 12:06 AM? 6:00 PM How many minutes are there between 9:56 PM and 2:58 AM? 302 What is 502 minutes after 11:56 PM? 8:18 AM What is 283 minutes after 10:31 AM? 3:14 PM What is 300 minutes before 12:19 AM? 7:19 PM What is 468 minutes after 7:27 PM? 3:15 AM What is 560 minutes after 5:35 AM? 2:55 PM How many minutes are there between 2:00 PM and 3:22 PM? 82 What is 697 minutes after 6:26 PM? 6:03 AM How many minutes are there between 12:43 AM and 6:01 AM? 318 How many minutes are there between 6:54 AM and 5:41 PM? 647 How many minutes are there between 4:30 PM and 8:42 PM? 252 How many minutes are there between 3:26 PM and 2:54 AM? 688 How many minutes are there between 4:00 PM and 1:06 AM? 546 What is 67 minutes before 5:44 PM? 4:37 PM How many minutes are there between 12:23 PM and 4:33 PM? 250 How many minutes are there between 5:57 PM and 6:17 PM? 20 What is 402 minutes after 9:03 AM? 3:45 PM How many minutes are there between 9:41 PM and 1:03 AM? 202 What is 439 minutes after 8:52 AM? 4:11 PM How many minutes are there between 5:55 PM and 2:29 AM? 514 How many minutes are there between 3:32 AM and 4:24 AM? 52 How many minutes are there between 1:08 PM and 7:56 PM? 408 What is 587 minutes after 11:14 AM? 9:01 PM What is 160 minutes after 11:45 AM? 2:25 PM How many minutes are there between 11:59 AM and 6:33 PM? 394 What is 424 minutes before 8:55 PM? 1:51 PM How many minutes are there between 9:10 PM and 9:21 PM? 11 How many minutes are there between 2:31 PM and 12:09 AM? 578 What is 2 minutes before 12:11 AM? 12:09 AM How many minutes are there between 6:08 PM and 5:13 AM? 665 What is 98 minutes before 6:11 PM? 4:33 PM How many minutes are there between 5:12 AM and 6:44 AM? 92 What is 49 minutes after 10:45 PM? 11:34 PM What is 172 minutes after 12:40 AM? 3:32 AM What is 394 minutes after 4:28 AM? 11:02 AM What is 41 minutes before 1:42 AM? 1:01 AM How many minutes are there between 10:51 AM and 9:16 PM? 625 How many minutes are there between 5:07 AM and 6:14 AM? 67 How many minutes are there between 12:22 PM and 3:09 PM? 167 How many minutes are there between 8:07 PM and 6:54 AM? 647 What is 366 minutes before 1:12 AM? 7:06 PM How many minutes are there between 11:15 PM and 2:37 AM? 202 What is 300 minutes before 11:10 PM? 6:10 PM What is 158 minutes before 5:05 AM? 2:27 AM What is 644 minutes after 1:42 PM? 12:26 AM How many minutes are there between 5:44 AM and 2:11 PM? 507 What is 663 minutes after 10:28 AM? 9:31 PM How many minutes are there between 12:30 PM and 8:30 PM? 480 What is 91 minutes after 6:57 PM? 8:28 PM What is 366 minutes after 9:07 PM? 3:13 AM How many minutes are there between 12:28 AM and 10:01 AM? 573 How many minutes are there between 3:53 PM and 1:25 AM? 572 What is 453 minutes before 9:03 PM? 1:30 PM What is 691 minutes after 1:38 AM? 1:09 PM How many minutes are there between 12:54 PM and 7:07 PM? 373 What is 399 minutes after 11:23 AM? 6:02 PM What is 418 minutes after 11:09 PM? 6:07 AM What is 104 minutes after 6:08 AM? 7:52 AM How many minutes are there between 4:41 PM and 8:45 PM? 244 How many minutes are there between 3:19 AM and 11:20 AM? 481 How m	{ "pile_set_name": "DM Mathematics" }
f wrt f. -774f Suppose -27g = 17g + 41 - 41. Let a(t) be the first derivative of -t + 16 + 0t2 + gt*3 + 9/4t*4. What is the derivative of a(j) wrt j? 27j*2 Let n be (0/1(61 + -60))/5. Let v(i) be the first derivative of 7 + ni3 + i2 - 1/2i*4 + 0i. Find the second derivative of v(a) wrt a. -12a Let g(k) = -15757k*3 - 17788k. Let u(i) = -5252i3 - 5929i. Let r(d) = -4g(d) + 11u(d). What is the second derivative of r(x) wrt x? 31536x Let p(o) = 2106o*3 + 2o*2 - 2o + 989. Let u(t) = 4t3 + t2 - t + 6. Let j(n) = p(n) - 2u(n). What is the first derivative of j(y) wrt y? 6294y2 Let c(x) = 4x + 12. Let s be c(-6). Let h be (-322)/s - (0 + (-5)/30). What is the third derivative of 40d4 - h + 11 - 39d*2 + 16 wrt d? 960d Let y(o) be the first derivative of 2453o4/2 + 3595o*3/3 + 2927. Find the third derivative of y(j) wrt j. 29436 Suppose -5r + 20 = -v, 2r = -v + 21 - 13. Find the second derivative of -7 + 23 + a - ra + 9 + 161a2 + 14a*2 wrt a. 350 Let z be (13 - 375/30) + (-179)/(-2). Differentiate -6 + 6 - 56 + 11 - z - 179b*4 wrt b. -716b*3 Suppose -8f + 9f + 1 = 2k, 3k = -3f + 15. What is the second derivative of 160b3 - 279b*f + 155b*3 + 56b - b wrt b? 216b Let k(v) be the third derivative of 0v*3 - 3v*2 + 13 + 0v*4 + 0v - 43/60v6 + 1/105v*7 - 11/30v*5. Find the third derivative of k(h) wrt h. 48h - 516 Find the third derivative of -22878 - 22878 + 2o2 + 45756 + 3908o*3 + 9437o - 3o2 wrt o. 23448 What is the third derivative of 61898887 - 4108n*2 - 61898887 + 5438n*3 wrt n? 32628 Suppose -97q - 35 = -104q. Find the third derivative of 4b*3 - 176 + 8b*3 + 55b*2 + 2b*q + 176 wrt b. 120b*2 + 72 Let j(n) be the second derivative of -7n*6/30 - 21n*3/2 + 316n*2 + 1779n + 2. Find the first derivative of j(r) wrt r. -28r3 - 63 Let u(x) be the first derivative of -548x*5/5 - 628x*3/3 + 45. Find the third derivative of u(q) wrt q. -13152q Let a be 15/(-30) - 37/(-2). Let i = a + 13. Differentiate 70t2 - it*4 - 3 - 70t*2 wrt t. -124t*3 What is the derivative of 0z*3 + 3229z + 9z3 - z2 - 3312z - 8z3 - 10495 wrt z? 3z*2 - 2z - 83 Suppose 0 + 14 = q - 3a, 10 = 3q - a. Find the second derivative of -134k + 1348k*2 - 14k*4 - 1350k*q + 33k wrt k. -168k2 - 4 Let b(a) be the third derivative of -a6/120 - 911a5/60 - a4/24 + 1664a3/3 - 2a*2 + 383. Differentiate b(t) with respect to t. -3t*2 - 1822t - 1 Let a(w) = -6w - 32. Let x be a(-19). Let u = x - 69. What is the second derivative of -10h - uh - 6h*3 + 20h*5 + 6h*3 wrt h? 400h*3 Suppose 5w + 13 = -3i + 10w, -5 = -w. Find the third derivative of -51k4 + 0k*i - 117k*4 + 67k*2 wrt k. -4032k Let a = 781 + -775. Let x = 20 + -9. Find the first derivative of ar + 9r - 13r - x wrt r. 2 What is the third derivative of -370f*2 + 372f*2 + 7f*4 + 64f*3 + 790f - 66f3 + 1228f*4 wrt f? 29640f - 12 Let o(r) = 7r - 11r + 6r - 7. Let g be o(5). What is the first derivative of 28 - 25q*g + 9q - 7q - 2q wrt q? -75q2 Let g(t) be the first derivative of -t6/3 - 6143t4/4 - t2/2 + 532t + 9158. What is the second derivative of g(r) wrt r? -40r*3 - 36858r What is the second derivative of -150o - 725o*2 - 795o + 144o2 - 196o*2 wrt o? -1554 Let w(h) = -2280h*2 + 45h - 21. Let i(j) = -7j2 + 1. Let o(v) = -3i(v) + w(v). Find the second derivative of o(q) wrt q. -4518 Let z(c) = 2c + 34. Let i be z(-14). Let l be (-39)/(-6) - i/4. Find the second derivative of rl - 6r + 0r3 + 0r*3 + 0r wrt r. 20r3 Suppose -7 = 3z + 32. Let x = 15 + z. Differentiate -3g4 + 8g*4 + xg*4 - 13 + 2 wrt g. 28g*3 Suppose 3n = 4g - 0 + 3, 4n - g = 17. Let j be 38160/52 - 4/(-26). Find the third derivative of -734v - nv*2 + jv + 3v4 wrt v. 72v Let k(b) be the second derivative of 3b + 21/4b*4 + 0b*5 + 0b*7 + 0b*3 + 0b*6 - 8 + 0b*2 - 37/56b*8. What is the third derivative of k(g) wrt g? -4440g*3 What is the second derivative of 127835 - 127835 - 1164j*2 + 665j wrt j? -2328 Let x(d) be the third derivative of 227d7/105 - d5/30 - d4/12 - 59d*3/3 - 1264d*2. What is the second derivative of x(i) wrt i? 5448i*2 - 4 What is the third derivative of 63k + 24k3 + 4 + 2k*2 + 3k*4 + 8k*5 - 84k - 9k5 - k5 + 100k*3 wrt k? -120k*2 + 72k + 744 Let h be 14 + 39/(-741)-247. Let d(p) be the first derivative of hp2 + 0p - 29 - 38/3p3. What is the second derivative of d(k) wrt k? -76 Suppose 14f = 8f + 24. Suppose 0 = fq - 4u - 52, u = -0q - q + 15. What is the derivative of 70 + 70 - qb2 - 145 wrt b? -28b Let w = 120 + -104. Suppose -3t + 6t - 39 = 2z, w = 2t + 2z. What is the second derivative of -805 - c + 805 - 25c*4 - tc wrt c? -300c2 Let x(y) = y - 22. Let b be x(42). Suppose -v = 6 - 37. What is the second derivative of -2s*3 - vs*5 + 9s + 2s3 + bs wrt s? -620s3 Let z(o) be the third derivative of -2263o*7/210 + 3o*5/4 + 7o*4/12 - 1227o*2 - 2o - 2. What is the third derivative of z(d) wrt d? -54312d Let r(g) be the third derivative of 241g7/210 - g6/60 + g*4/12 + 194g*3/3 + 2345g*2. What is the second derivative of r(l) wrt l? 2892l*2 - 12l Let u = -9 + 12. Suppose -r = -0r - u. What is the second derivative of -10o*4 + 3o - 6o4 + ro wrt o? -192o2 Suppose 3j + 3l - 6 = 6l, -j = l - 2. What is the second derivative of -120ij - 2i*2 + 66i*2 - 29i wrt i? -112 Let b(i) be the first derivative of 8i3/3 - 135i*2/2 - 5588i + 1633. What is the derivative of b(a) wrt a? 16a - 135 Let h(j) = j3 - j2 - j + 40. Let q be h(0). Let s = 43 - q. What is the third derivative of 12o*s + 13o*2 - 15o*2 - 12o*2 wrt o? 72 What is the first derivative of 101085o*4 - 3o*3 - 2651 - 100045o*4 + 3o*3 wrt o? 4160o*3 Let t(i) = 56i*3 - 43i*2 - 3i. Let j(s) = s3 + s2 + s. Let a = 47 - 44. Let r(p) = aj(p) + t(p). Find the third derivative of r(c) wrt c. 354 Let c = -34 - -37. What is the third derivative of -uc - 142u*2 + 1623u*4 - 49u*2 + 0u*3 - 1663u*4 wrt u? -960u - 6 Let a be ((-2)/(-4))/((-45)/(-11070)). What is the second derivative of -94h2 - 33h*2 - 8h - ah2 - 40h wrt h? -500 Let f(y) = -4296y3 + 208y*2 - 4y - 2109. Let x(j) = 2147j3 - 96j*2 + 2j + 1055. Let k(p) = -6f(p) - 13x(p). Differentiate k(i) with respect to i. -6405i2 - 2 Let x(n) = 8n*5 + 9n*4 + 67n*3 - 147n + 6. Let s(f) = -f*5 - 3f*4 + 2f - 1. Let j(t) = -3s(t) - x(t). Find the second derivative of j(i) wrt i. -100i*3 - 402i Let n(p) = -209p2 + p + 81. Let v(y) = -1 + 21y*2 - 6y*2 - 9y*2 - 5y*2 - y. Let q(h) = -n(h) - 2v(h). Find the second derivative of q(b) wrt b. 414 Let p(o) be the first derivative of -1/3o3 + 21 + 33o + 0o4 - 54/5o*5 + 0o*2. Find the third derivative of p(b) wrt b. -1296b What is the second derivative of 352c + 5141c*2 - 635c + 517c + 1239c + 924c wrt c? 10282 Let x(j) be the third derivative of 0 - 17/6j*3 + 0j*4 + 0j + 1/60j6 - 41j*2 + 1/30j*5 + 17/210j*7. Find the third derivative of x(k) wrt k. 408k + 12 Suppose -59f + 70f - 55 = 0. Let j(o) = -2o3 - 106o2 - 53. Let i(s) = s2 - 3. Let b(c) = fi(c) - j(c). Find the first derivative of b(m) wrt m. 6m*2 + 222m Find the third derivative of -771i3 - 11i*2 - 21 + 32i*2 - 14 + 53 - 14 wrt i. -4626 Suppose -w - 12i = -15i - 1, 0 = -4w - 5i + 21. What is the second derivative of -21j*5 + 222j5 - j4 + 0jw - 28j - 191j + 41j*5 wrt j? 4840j*3 - 12j*2 Find the third derivative of 402m*3 - 4m*2 - 2171m*6 - 11 - 402m*3 - 247m*5 + 247m*5 wrt m. -260520m*3 Let u(x) be the third derivative of 1/12x*4 + 1/20x5 + x3 + 0x - 6 + 2x*2. What is the second derivative of u(b) wrt b? 6 Let x = 84 - 79. What is the third derivative of -268o*5 + 143o*5 - 3o*3 + 130o*x + 2o*2 - 7 wrt o? 300o*2 - 18 Let y be (-45)/60(-96)/9. What is the second derivative of -8x3 + x2 - 167x*4 - 34x + yx3 + 168x*4 wrt x? 12x*2 + 2 Suppose 53k -	{ "pile_set_name": "DM Mathematics" }
b = 0. Let y be (-2)/8 + (-7755)/(-44). Calculate the greatest common divisor of x and y. 22 Let r = -109 - -239. Let o(a) = 5a2 + 221a + 57. Let t be o(-44). What is the highest common factor of t and r? 13 Let q be ((-4)/4)/(-1) + 2. Suppose -2z + 110 = qz. What is the greatest common factor of 88 and z? 22 Let m = 387 - 349. What is the highest common divisor of m and 95? 19 Suppose -5r + 20 = -3r. Let w be 4/12(-3 + 153). Calculate the highest common divisor of w and r. 10 Suppose 5r = -r + 96. Suppose -12c - 400 = -rc. Suppose 4w - 15 = 25. What is the highest common factor of w and c? 10 Let k be ((-14)/3)/(2/(-30)). Let g(j) = -j2 + 10j - 14. Let p be g(4). Calculate the highest common factor of p and k. 10 Let i = -41 + 2. Let a = i + 69. Let q = -199 - -209. What is the highest common factor of a and q? 10 Suppose 31 = 5g - 4o, -o - 3 = 1. Suppose -gu - 4 = -n + 10, 2 = -n - u. Let t = 10 - -8. What is the greatest common divisor of t and n? 2 Suppose -4s = -3s - 9. Suppose 0 = v + 21v - 4840. Suppose -5w = -6 + 26, 0 = -3x + w + v. What is the highest common divisor of s and x? 9 Let w be ((-16)/(-12))/(2/21). Suppose 7 + w = u. What is the highest common factor of u and 3? 3 Suppose -37b + 32b - 5n = -215, -207 = -4b + 3n. Suppose -114 + 314 = 5u. Let c = 56 - u. What is the greatest common factor of c and b? 16 Let o(l) = 3l2 + 5l + 4. Let t be o(-3). What is the greatest common factor of 2 and t? 2 Suppose -3j + b = -37, 2j - 4b - 16 + 8 = 0. Calculate the greatest common factor of j and 686. 14 Let g = -16 + 8. Let a be (g/(0 + 2))/((-2)/8). Calculate the greatest common divisor of 12 and a. 4 Suppose -a = 4l - 76, l + 5 = 4. Let q(y) = y*3 - 4y*2 - 4y + 10. Let o be q(5). Let p be 50/o(0 + 3). Calculate the highest common divisor of a and p. 10 Let f be (1/(-2))/(22/(-7436)). Suppose 2x - f = 7. Calculate the greatest common factor of x and 11. 11 Let r(w) = w*2 - 11w + 12. Let p be r(10). Let d be (10/4 - p)(77 + 13). Calculate the highest common divisor of 45 and d. 45 Let d(c) = 2c*2 + 6c + 2. Let s be d(-8). Let b = -81 + s. Calculate the highest common divisor of 3 and b. 1 Let z(v) = v*2 - 1. Let n be -9(0 + (-8)/(-12)). Let j be z(n). What is the greatest common factor of j and 14? 7 Let o be 8/52 - (-6360)/65. Suppose -3a = 2i - 0i - 38, -a + 12 = i. What is the highest common divisor of o and a? 14 Let t = -16 - -18. Suppose -5s - 3a + 81 = -6a, -ts = 3a - 24. What is the greatest common divisor of 165 and s? 15 Suppose 0 = 2n + 3z - 65, 0n = 5n + 3z - 167. Let w = -50 + n. Let r = w - -50. Calculate the greatest common divisor of 51 and r. 17 Let o(b) = -b3 - 14b*2 + 12b + 17. Let y be o(-14). Let v = y + 259. What is the greatest common divisor of v and 12? 12 Let j = -6 + 9. Suppose 3i - 16 = 5v, -i - jv = -0v + 4. Let f be -2 + 4/2 + -2 + 14. Calculate the highest common divisor of f and i. 2 Suppose -5x + v - 72 = 0, -32 = 2x + x + 5v. Let u = 18 + -14. Let c be 1252/28 - u/x. Calculate the highest common factor of c and 5. 5 Let g(z) = 3z + 308. Let y(l) = -l - 103. Let c(i) = 4g(i) + 11y(i). Let u be c(0). Let v be 94/10 - 4/10. Calculate the highest common factor of v and u. 9 Suppose -1500 = -14k - k. Calculate the highest common factor of 70 and k. 10 Let f be (-44)/693-7 - (-1832)/9. Calculate the greatest common factor of 12 and f. 12 Let o(v) be the first derivative of v3/3 - v2/2 + 20v - 35. Let u be o(6). Calculate the highest common divisor of u and 25. 25 Let k = 78 - 26. Suppose -39 = -3w + 6w. Let t be w1/(-1)1. Calculate the greatest common divisor of k and t. 13 Let t(b) = -b2 + 12b - 3. Let k be t(9). Let y = -30 + k. Let h = 12 - y. Calculate the greatest common divisor of h and 6. 6 Let q be (819/(-28))/13(-3 + -141). Calculate the highest common divisor of 252 and q. 36 Let y be -6 + 2 - (-18 + -38). What is the greatest common divisor of y and 130? 26 Suppose 4b = 134 + 82. What is the greatest common divisor of b and 270? 54 Let t = 127 + -109. Let b be 8/(-1 + 3)18. Calculate the highest common divisor of b and t. 18 Let j be 24/(3 - (1 - 4/(-4))). What is the highest common divisor of 9 and j? 3 Let f(b) = -5b + 18. Let q be f(8). Let z = q + 33. What is the greatest common factor of z and 110? 11 Let k = 1238 - 1142. What is the greatest common divisor of 1200 and k? 48 Suppose -5g = 4b + 688, -3g + b = -4g - 137. Let n be 474/7 + (-5)/(g/8). Calculate the greatest common divisor of 4 and n. 4 Let l be (-206)/(-10) - 6/(-15). Let k be (12/l)/((-8)/(-28)). Suppose 4b = w - 5w + 436, 5w = kb - 239. Calculate the greatest common factor of 16 and b. 16 Let i = -576 - -632. Calculate the greatest common factor of i and 154. 14 Let p(x) = -16x - 94. Let r be p(-6). Suppose -9 = -3w - 0w. Suppose wv + 5f = -0 + 23, -f - 21 = -v. What is the greatest common factor of v and r? 2 Let v = 36 + -32. Suppose 0 = 4k - v + 24, -5d = 2k - 515. What is the greatest common factor of d and 42? 21 Suppose -23t + 4 = -27t, -1077 = -4q - 3t. Calculate the greatest common factor of 162 and q. 54 Let f(b) = -3b - 18. Suppose 0 = 3j - 5g + 56, j + 3g + 4 = g. Let p be f(j). Calculate the highest common divisor of p and 9. 9 Let b(r) = -r*3 + 10r*2 - 25r + 81. Let d be b(5). What is the highest common factor of 459 and d? 27 Let g(b) = 6b + 14. Let q(r) = r + 1. Let c be q(0). Let k = c - -6. Let h be g(k). What is the greatest common divisor of 8 and h? 8 Let i = -11 + 15. Suppose -3a + 1 = il, -2l + 29 = -l - 5a. Suppose y - l = 0, 0 = -4v + v + 2y + 145. Calculate the greatest common divisor of v and 17. 17 Let p(v) = v3 + 3v*2 - 2v - 5. Let i be p(-2). Calculate the highest common divisor of 39 and i. 3 Let s(r) = 80r - 157. Let m be s(5). What is the highest common factor of 9 and m? 9 Let o(u) = -3u*2 + 3u + 1. Let n be o(4). Let q be (-268)/(-14) - (-5)/n. Calculate the highest common divisor of q and 171. 19 Let w be 0-1(-4)/(-24). Let j be (w - (-1)/1) + 12 + 23. Calculate the greatest common divisor of 4 and j. 4 Let u(m) = 2m + 22. Let o be u(14). Calculate the highest common divisor of 50 and o. 50 Let o(s) = 7s + 29. Let h be o(-2). What is the highest common divisor of 375 and h? 15 Let o be 30/1 - (-2)/1. Suppose 4y = -8 + o. Let k be (-1)/y - 37/(-6). What is the greatest common divisor of k and 4? 2 Suppose 0 = -5f - 2t + 6t, 0 = 4t - 20. Suppose 323 = fs + 99. Suppose -3y - s = -7y. What is the greatest common divisor of y and 21? 7 Let h(w) be the third derivative of w6/120 - w5/60 + 5w*3/2 + 13w*2. Let t be h(0). Calculate the highest common factor of 105 and t. 15 Suppose 0w - 3w = -3i - 609, 0 = 4w - 2i - 806. Calculate the greatest common factor of w and 80. 40 Let f(h) = 2h2 - 18h + 156. Let d be f(9). What is the highest common factor of 390 and d? 78 Let t = 240 + 19. Calculate the highest common divisor of t and 28. 7 Let l(p) = 3p2 + 34p. Let i be l(-16). What is the greatest common divisor of 28 and i? 28 Let r(z) = -z*2 - 25z + 93. Let l be r(-23). Calculate the highest common factor of 1529 and l. 139 Suppose j + 5d - 47 = 0, 5j - 50 = -4d + 101. Let f be 981/4 - ((-24309)/148)/(-73). Calculate the greatest common factor of j and f. 27 Let c be (-3 + (-102)/(-14))/((-48)/(-896)). Calculate the greatest common factor of c and 40. 40 Suppose 9b + 5 - 23 = 0. Suppose 0 = bw + w - 90. What is the highest common factor of w and 75? 15 Suppose 20y - 7y = 39. What is the highest common divisor of 123 and y? 3 Suppose 5k + 17 = 2b - 43, 188 = 5b - 3k. Suppose -t - 14 = -b. What is the highest common factor of 4 and t? 2 Suppose 32 - 12 = 4w. Suppose -wo = -168 + 3. Suppose -21 - o = -2h. What is the greatest common factor of h and 189? 27 Suppose 5v = -3i - 134, 130 - 340 = 5i - 5v. Let m = 65 + i. Calculate the greatest common divisor of m and 242. 22 Suppose 61q - 53q - 504 = 0. What is the highest common divisor of q and 9? 9 Suppose 0 = 3v - 17p + 14p - 132, 0 = 3v + 3p - 144. What is the greatest common divisor of 23 and v? 23 Let x be (-18)/47700/(-105). Let c be (36/10)/(1/15). Su	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.