content
stringlengths
0
13M
path
stringlengths
4
263
contentHash
stringlengths
1
10
/* * KOTLIN LEARN * * MIT License (MIT) * Copyright (c) 2015-2020 Alessio Saltarin * */ package net.littlelite.kotlinlearn /** * A data class is a short-hand for a class that holds * just data. It automatically gets: * - equals * - hashCode * - toString * - copy * - componentN */ data class UserDataClass(val name: String, val surname: String, val age: Int)
src/main/kotlin/UserDataClass.kt
2331234011
package chat.rocket.android.suggestions.ui import android.content.Context import android.util.AttributeSet import android.util.DisplayMetrics import android.view.WindowManager import androidx.recyclerview.widget.RecyclerView import chat.rocket.android.suggestions.R internal class PopupRecyclerView : RecyclerView { private var displayWidth: Int = 0 constructor(context: Context) : this(context, null) constructor(context: Context, attrs: AttributeSet?) : this(context, attrs, 0) constructor(context: Context, attrs: AttributeSet?, defStyle: Int) : super( context, attrs, defStyle ) { val wm = context.getSystemService(Context.WINDOW_SERVICE) as WindowManager val display = wm.defaultDisplay val size = DisplayMetrics() display.getMetrics(size) val screenWidth = size.widthPixels displayWidth = screenWidth } override fun onMeasure(widthSpec: Int, heightSpec: Int) { val hSpec = MeasureSpec.makeMeasureSpec( resources.getDimensionPixelSize( R.dimen.popup_max_height ), MeasureSpec.AT_MOST ) val wSpec = MeasureSpec.makeMeasureSpec(displayWidth, MeasureSpec.EXACTLY) super.onMeasure(wSpec, hSpec) } override fun onLayout(changed: Boolean, l: Int, t: Int, r: Int, b: Int) { super.onLayout(changed, l + 40, t, r - 40, b) } }
suggestions/src/main/java/chat/rocket/android/suggestions/ui/PopupRecyclerView.kt
115078328
package com.bubelov.coins.model import java.time.LocalDateTime data class User( val id: String, val email: String, val emailConfirmed: Boolean, val firstName: String, val lastName: String, val avatarUrl: String, val createdAt: LocalDateTime, val updatedAt: LocalDateTime )
app/src/main/java/com/bubelov/coins/model/User.kt
2743709790
package permissions.dispatcher.processor.exception import permissions.dispatcher.processor.RuntimePermissionsElement public class NoAnnotatedMethodsException(rpe: RuntimePermissionsElement, type: Class<*>): RuntimeException("Annotated class '${rpe.inputClassName}' doesn't have any method annotated with '@${type.simpleName}'") { }
PermissionsDispatcher-master/processor/src/main/kotlin/permissions/dispatcher/processor/exception/NoAnnotatedMethodsException.kt
41200441
/* Copyright (C) 2013-2019 Expedia Inc. Licensed under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. You may obtain a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the specific language governing permissions and limitations under the License. */ package io.kotlintest.provided import com.hotels.styx.support.TestResultReporter import io.kotlintest.AbstractProjectConfig import io.kotlintest.extensions.TestListener class ProjectConfig: AbstractProjectConfig() { override fun listeners(): List<TestListener> = listOf(TestResultReporter) }
system-tests/ft-suite/src/test/kotlin/io/kotlintest/provided/ProjectConfig.kt
3291289808
/* * Copyright (c) 2018. Faruk Toptaş * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package me.toptas.fancyshowcase /** * Shape of animated focus */ enum class FocusShape { CIRCLE, ROUNDED_RECTANGLE }
fancyshowcaseview/src/main/java/me/toptas/fancyshowcase/FocusShape.kt
3968957590
package com.github.premnirmal.ticker.base import android.graphics.Color import android.os.Build import android.view.View import androidx.core.content.ContextCompat import androidx.viewbinding.ViewBinding import com.github.mikephil.charting.charts.LineChart import com.github.mikephil.charting.components.XAxis import com.github.mikephil.charting.components.YAxis import com.github.mikephil.charting.data.LineData import com.github.mikephil.charting.data.LineDataSet import com.github.premnirmal.ticker.model.HistoryProvider.Range import com.github.premnirmal.ticker.network.data.DataPoint import com.github.premnirmal.ticker.network.data.Quote import com.github.premnirmal.ticker.ui.DateAxisFormatter import com.github.premnirmal.ticker.ui.HourAxisFormatter import com.github.premnirmal.ticker.ui.MultilineXAxisRenderer import com.github.premnirmal.ticker.ui.TextMarkerView import com.github.premnirmal.ticker.ui.ValueAxisFormatter import com.github.premnirmal.tickerwidget.R abstract class BaseGraphActivity<T : ViewBinding> : BaseActivity<T>() { protected var dataPoints: List<DataPoint>? = null protected abstract var range: Range protected fun setupGraphView() { val graphView: LineChart = findViewById(R.id.graphView) graphView.isDoubleTapToZoomEnabled = false graphView.axisLeft.setDrawGridLines(false) graphView.axisLeft.setDrawAxisLine(false) graphView.axisLeft.isEnabled = false graphView.axisRight.setDrawGridLines(false) graphView.axisRight.setDrawAxisLine(true) graphView.axisRight.isEnabled = true graphView.xAxis.setDrawGridLines(false) graphView.setXAxisRenderer( MultilineXAxisRenderer( graphView.viewPortHandler, graphView.xAxis, graphView.getTransformer(YAxis.AxisDependency.RIGHT) ) ) graphView.extraBottomOffset = resources.getDimension(R.dimen.graph_bottom_offset) graphView.legend.isEnabled = false graphView.description = null val colorAccent = if (Build.VERSION.SDK_INT >= Build.VERSION_CODES.S) { ContextCompat.getColor(this, android.R.color.system_accent1_600) } else { ContextCompat.getColor(this, R.color.accent_fallback) } graphView.setNoDataText("") graphView.setNoDataTextColor(colorAccent) graphView.marker = TextMarkerView(this) } protected fun loadGraph(ticker: String, quote: Quote) { val graphView: LineChart = findViewById(R.id.graphView) if (dataPoints == null || dataPoints!!.isEmpty()) { onNoGraphData(graphView) graphView.setNoDataText(getString(R.string.no_data)) graphView.invalidate() return } graphView.setNoDataText("") graphView.lineData?.clearValues() val series = LineDataSet(dataPoints, ticker) series.setDrawHorizontalHighlightIndicator(false) series.setDrawValues(false) val colorAccent = if (quote.changeInPercent >= 0) { ContextCompat.getColor(this, R.color.positive_green_dark) } else { ContextCompat.getColor(this, R.color.negative_red) } series.setDrawFilled(true) series.color = colorAccent series.fillColor = colorAccent series.fillAlpha = 150 series.setDrawCircles(true) series.mode = LineDataSet.Mode.CUBIC_BEZIER series.cubicIntensity = 0.07f series.lineWidth = 2f series.setDrawCircles(false) series.highLightColor = Color.GRAY val lineData = LineData(series) graphView.data = lineData val xAxis: XAxis = graphView.xAxis val yAxis: YAxis = graphView.axisRight if (range == Range.ONE_DAY) { xAxis.valueFormatter = HourAxisFormatter() } else { xAxis.valueFormatter = DateAxisFormatter() } yAxis.valueFormatter = ValueAxisFormatter() xAxis.position = XAxis.XAxisPosition.BOTTOM xAxis.textSize = 10f yAxis.textSize = 10f xAxis.textColor = Color.GRAY yAxis.textColor = Color.GRAY xAxis.setLabelCount(5, true) yAxis.setLabelCount(5, true) yAxis.setPosition(YAxis.YAxisLabelPosition.OUTSIDE_CHART) xAxis.setDrawAxisLine(true) yAxis.setDrawAxisLine(true) xAxis.setDrawGridLines(false) yAxis.setDrawGridLines(false) graphView.invalidate() onGraphDataAdded(graphView) } /** * xml OnClick * @param v */ fun updateRange(v: View) { when (v.id) { R.id.one_day -> range = Range.ONE_DAY R.id.two_weeks -> range = Range.TWO_WEEKS R.id.one_month -> range = Range.ONE_MONTH R.id.three_month -> range = Range.THREE_MONTH R.id.one_year -> range = Range.ONE_YEAR R.id.five_years -> range = Range.FIVE_YEARS R.id.max -> range = Range.MAX } fetchGraphData() } protected abstract fun fetchGraphData() protected abstract fun onGraphDataAdded(graphView: LineChart) protected abstract fun onNoGraphData(graphView: LineChart) }
app/src/main/kotlin/com/github/premnirmal/ticker/base/BaseGraphActivity.kt
3821845236
/* * Copyright 2017 Alexey Shtanko * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. * */ package io.shtanko.picasagallery.extensions import io.shtanko.picasagallery.data.entity.album.AlbumType import io.shtanko.picasagallery.data.entity.internal.ContentType import io.shtanko.picasagallery.data.entity.photo.PhotoType typealias AlbumsList = List<AlbumType> typealias PhotosList = List<PhotoType> typealias ContentList = List<ContentType>
app/src/main/kotlin/io/shtanko/picasagallery/extensions/Aliases.kt
4162575015
/* * Copyright 2020 Google LLC * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * https://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package com.google.samples.apps.sunflower.plantdetail import android.content.Intent import android.os.Bundle import android.view.LayoutInflater import android.view.View import android.view.ViewGroup import androidx.coordinatorlayout.widget.CoordinatorLayout import androidx.core.app.ShareCompat import androidx.core.widget.NestedScrollView import androidx.databinding.DataBindingUtil import androidx.fragment.app.Fragment import androidx.fragment.app.viewModels import androidx.navigation.findNavController import androidx.navigation.fragment.navArgs import com.google.android.material.floatingactionbutton.FloatingActionButton import com.google.android.material.snackbar.Snackbar import com.google.samples.apps.sunflower.R import com.google.samples.apps.sunflower.data.Plant import com.google.samples.apps.sunflower.databinding.FragmentPlantDetailBinding import com.google.samples.apps.sunflower.utilities.InjectorUtils import com.google.samples.apps.sunflower.viewmodels.PlantDetailViewModel /** * A fragment representing a single Plant detail screen. */ class PlantDetailFragment : Fragment() { private val args: PlantDetailFragmentArgs by navArgs() private val plantDetailViewModel: PlantDetailViewModel by viewModels { InjectorUtils.providePlantDetailViewModelFactory(requireActivity(), args.plantId) } override fun onCreateView( inflater: LayoutInflater, container: ViewGroup?, savedInstanceState: Bundle? ): View { val binding = DataBindingUtil.inflate<FragmentPlantDetailBinding>( inflater, R.layout.fragment_plant_detail, container, false ).apply { viewModel = plantDetailViewModel lifecycleOwner = viewLifecycleOwner callback = object : Callback { override fun add(plant: Plant?) { plant?.let { hideAppBarFab(fab) plantDetailViewModel.addPlantToGarden() Snackbar.make(root, R.string.added_plant_to_garden, Snackbar.LENGTH_LONG) .show() } } } var isToolbarShown = false // scroll change listener begins at Y = 0 when image is fully collapsed plantDetailScrollview.setOnScrollChangeListener( NestedScrollView.OnScrollChangeListener { _, _, scrollY, _, _ -> // User scrolled past image to height of toolbar and the title text is // underneath the toolbar, so the toolbar should be shown. val shouldShowToolbar = scrollY > toolbar.height // The new state of the toolbar differs from the previous state; update // appbar and toolbar attributes. if (isToolbarShown != shouldShowToolbar) { isToolbarShown = shouldShowToolbar // Use shadow animator to add elevation if toolbar is shown appbar.isActivated = shouldShowToolbar // Show the plant name if toolbar is shown toolbarLayout.isTitleEnabled = shouldShowToolbar } } ) toolbar.setNavigationOnClickListener { view -> view.findNavController().navigateUp() } toolbar.setOnMenuItemClickListener { item -> when (item.itemId) { R.id.action_share -> { createShareIntent() true } else -> false } } } setHasOptionsMenu(true) return binding.root } // Helper function for calling a share functionality. // Should be used when user presses a share button/menu item. @Suppress("DEPRECATION") private fun createShareIntent() { val shareText = plantDetailViewModel.plant.value.let { plant -> if (plant == null) { "" } else { getString(R.string.share_text_plant, plant.name) } } val shareIntent = ShareCompat.IntentBuilder.from(requireActivity()) .setText(shareText) .setType("text/plain") .createChooserIntent() .addFlags(Intent.FLAG_ACTIVITY_NEW_DOCUMENT or Intent.FLAG_ACTIVITY_MULTIPLE_TASK) startActivity(shareIntent) } // FloatingActionButtons anchored to AppBarLayouts have their visibility controlled by the scroll position. // We want to turn this behavior off to hide the FAB when it is clicked. // // This is adapted from Chris Banes' Stack Overflow answer: https://stackoverflow.com/a/41442923 private fun hideAppBarFab(fab: FloatingActionButton) { val params = fab.layoutParams as CoordinatorLayout.LayoutParams val behavior = params.behavior as FloatingActionButton.Behavior behavior.isAutoHideEnabled = false fab.hide() } interface Callback { fun add(plant: Plant?) } }
MigrationCodelab/app/src/main/java/com/google/samples/apps/sunflower/plantdetail/PlantDetailFragment.kt
3487506523
package i_introduction._7_Nullable_Types import org.junit.Assert.assertEquals import org.junit.Test class _07_Nullable_Types { fun testSendMessageToClient( client: Client?, message: String?, email: String? = null, shouldBeInvoked: Boolean = false ) { var invoked = false sendMessageToClient(client, message, object : Mailer { override fun sendMessage(actualEmail: String, actualMessage: String) { invoked = true assertEquals("The message is not as expected:", message, actualMessage) assertEquals("The email is not as expected:", email, actualEmail) } }) assertEquals("The function 'sendMessage' should${if (shouldBeInvoked) "" else "n't"} be invoked", shouldBeInvoked, invoked) } @Test fun everythingIsOk() { testSendMessageToClient(Client(PersonalInfo("[email protected]")), "Hi Bob! We have an awesome proposition for you...", "[email protected]", true) } @Test fun noMessage() { testSendMessageToClient(Client(PersonalInfo("[email protected]")), null) } @Test fun noEmail() { testSendMessageToClient(Client(PersonalInfo(null)), "Hi Bob! We have an awesome proposition for you...") } @Test fun noPersonalInfo() { testSendMessageToClient(Client(null), "Hi Bob! We have an awesome proposition for you...") } @Test fun noClient() { testSendMessageToClient(null, "Hi Bob! We have an awesome proposition for you...") } }
test/i_introduction/_7_Nullable_Types/_07_Nullable_Types.kt
1952287532
package com.beust.kobalt.api /** * Base interface for affinity interfaces. */ interface IAffinity { companion object { /** * The recommended default affinity if your plug-in can run this project. Use a higher * number if you expect to compete against other actors and you'd like to win over them. */ const val DEFAULT_POSITIVE_AFFINITY = 100 } }
modules/kobalt-plugin-api/src/main/kotlin/com/beust/kobalt/api/IAffinity.kt
1438042360
/* Tickle Copyright (C) 2017 Nick Robinson This program is free software: you can redistribute it and/or modify it under the terms of the GNU General Public License as published by the Free Software Foundation, either version 3 of the License, or (at your option) any later version. This program is distributed in the hope that it will be useful, but WITHOUT ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License for more details. You should have received a copy of the GNU General Public License along with this program. If not, see <http://www.gnu.org/licenses/>. */ package uk.co.nickthecoder.tickle.editor.tabs import javafx.application.Platform import javafx.scene.Node import javafx.scene.canvas.Canvas import javafx.scene.input.MouseEvent import javafx.scene.paint.Color import javafx.scene.shape.StrokeLineCap import org.joml.Matrix3x2d import org.joml.Vector2d import uk.co.nickthecoder.paratask.AbstractTask import uk.co.nickthecoder.paratask.TaskDescription import uk.co.nickthecoder.paratask.parameters.AbstractParameter import uk.co.nickthecoder.paratask.parameters.DoubleParameter import uk.co.nickthecoder.paratask.parameters.fields.ParameterField import uk.co.nickthecoder.tickle.Pose import uk.co.nickthecoder.tickle.editor.util.AngleParameter import uk.co.nickthecoder.tickle.editor.util.Vector2dParameter import uk.co.nickthecoder.tickle.editor.util.cachedImage import uk.co.nickthecoder.tickle.physics.BoxDef import uk.co.nickthecoder.tickle.physics.CircleDef import uk.co.nickthecoder.tickle.physics.PolygonDef import uk.co.nickthecoder.tickle.physics.ShapeDef class ShapeEditorParameter(name: String, val pose: Pose, val fixtureParameter: CostumeTab.PhysicsTask.FixtureParameter) : AbstractParameter(name, label = "", description = "") { override fun errorMessage(): String? = null override fun copy() = ShapeEditorParameter(name, pose, fixtureParameter) override fun isStretchy(): Boolean = true private var field = ShapeEditorField(this) override fun createField(): ParameterField { field.build() return field } fun update(shapedDef: ShapeDef?) { field.update(shapedDef) } } class ShapeEditorTask(pose: Pose, val fixtureParameter: CostumeTab.PhysicsTask.FixtureParameter) : AbstractTask() { val shapeEditorP = ShapeEditorParameter("shapeEditor", pose, fixtureParameter) override val taskD = TaskDescription("editShape") .addParameters(shapeEditorP) override fun run() {} } class ShapeEditorField(shapeEditorParameter: ShapeEditorParameter) : ParameterField(shapeEditorParameter) { val fixtureParameter = shapeEditorParameter.fixtureParameter val pose = shapeEditorParameter.pose val poseWidth = pose.rect.width val poseHeight = pose.rect.height val margin = 10.0 val borderColor = Color(0.0, 0.0, 0.0, 0.3) val shapeColor = Color(1.0, 0.0, 0.0, 1.0) val handleColor = Color(0.0, 0.0, 1.0, 1.0) val currentHandleColor = Color(1.0, 1.0, 1.0, 1.0) val canvas = Canvas(poseWidth.toDouble() + margin * 2, poseHeight.toDouble() + margin * 2) val handles = mutableListOf<Handle>() init { //println("Creating SEP") with(canvas) { graphicsContext2D.transform(1.0, 0.0, 0.0, -1.0, 0.0, canvas.height) addEventHandler(MouseEvent.MOUSE_PRESSED) { onMousePressed(it) } addEventHandler(MouseEvent.MOUSE_MOVED) { onMouseMoved(it) } addEventHandler(MouseEvent.MOUSE_DRAGGED) { onMouseDragged(it) } addEventHandler(MouseEvent.MOUSE_RELEASED) { dragging = false } } } override fun createControl(): Node { return canvas } var dirty = false set(v) { if (v && !field) { Platform.runLater { redraw() } } field = v } var currentHandle: Handle? = null set(v) { if (field != v) { field = v dirty = true } } var dragging = false var currentShapedDef: ShapeDef? = null fun closestHandle(event: MouseEvent): Handle? { val offsetX = event.x - margin - pose.offsetX val offsetY = canvas.height - margin - event.y - pose.offsetY var result: Handle? = null var minDist = Double.MAX_VALUE handles.forEach { handle -> val position = handle.position() val dx = Math.abs(position.x - offsetX) val dy = Math.abs(position.y - offsetY) if (dx <= 6.0 && dy <= 6) { val dist = dx * dx + dy * dy if (dist < minDist) { minDist = dist result = handle } } } return result } fun onMousePressed(event: MouseEvent) { currentHandle = closestHandle(event) dragging = currentHandle != null } fun onMouseMoved(event: MouseEvent) { // println("onMouseMoved") currentHandle = closestHandle(event) } fun onMouseDragged(event: MouseEvent) { //println("onMouseDragged") val offsetX = event.x - margin - pose.offsetX val offsetY = canvas.height - margin - event.y - pose.offsetY currentHandle?.moveTo(offsetX, offsetY) } fun update(shapeDef: ShapeDef?) { //println("Update using : $shapeDef") currentShapedDef = shapeDef if (!dragging) { //println("Creating drag handles") handles.clear() when (shapeDef) { is CircleDef -> { handles.add(RadiusHandle(fixtureParameter.circleCenterP.xP, fixtureParameter.circleCenterP.yP, fixtureParameter.circleRadiusP)) handles.add(PositionHandle(fixtureParameter.circleCenterP)) } is BoxDef -> { val corner1 = CornerHandle(fixtureParameter.boxCenterP, fixtureParameter.boxSizeP.xP, fixtureParameter.boxSizeP.yP, fixtureParameter.boxAngleP, null) val corner2 = CornerHandle(fixtureParameter.boxCenterP, fixtureParameter.boxSizeP.xP, fixtureParameter.boxSizeP.yP, fixtureParameter.boxAngleP, corner1) handles.add(corner1) handles.add(corner2) } is PolygonDef -> { fixtureParameter.polygonPointsP.innerParameters.forEach { pointP -> handles.add(PositionHandle(pointP)) } } } } dirty = true } fun redraw() { dirty = false //println("Redraw") val shapeDef = currentShapedDef with(canvas.graphicsContext2D) { save() clearRect(0.0, 0.0, canvas.width, canvas.height) lineWidth = 1.0 stroke = borderColor translate(margin, margin) strokeRect(0.0, 0.0, poseWidth.toDouble(), poseHeight.toDouble()) save() translate(pose.offsetX, pose.offsetY) save() when (shapeDef) { is CircleDef -> { drawOutlined(shapeColor) { strokeOval(shapeDef.center.x - shapeDef.radius, shapeDef.center.y - shapeDef.radius, shapeDef.radius * 2, shapeDef.radius * 2) } } is BoxDef -> { translate(shapeDef.center.x, shapeDef.center.y) rotate(shapeDef.angle.degrees) drawOutlined(shapeColor) { strokeRect(-shapeDef.width / 2, -shapeDef.height / 2, shapeDef.width, shapeDef.height) } } is PolygonDef -> { lineCap = StrokeLineCap.ROUND drawOutlined(shapeColor) { val xs = DoubleArray(shapeDef.points.size, { i -> shapeDef.points.map { it.x }[i] }) val ys = DoubleArray(shapeDef.points.size, { i -> shapeDef.points.map { it.y }[i] }) strokePolygon(xs, ys, shapeDef.points.size) } } } restore() handles.forEach { it.draw() } restore() this.globalAlpha = 0.5 drawImage(pose.texture.cachedImage(), pose.rect.left.toDouble(), pose.rect.bottom.toDouble(), pose.rect.width.toDouble(), -pose.rect.height.toDouble(), 0.0, 0.0, pose.rect.width.toDouble(), pose.rect.height.toDouble()) this.globalAlpha = 1.0 restore() } } fun drawOutlined(color: Color, shape: () -> Unit) { with(canvas.graphicsContext2D) { stroke = Color.BLACK lineCap = StrokeLineCap.ROUND lineWidth = 2.0 shape() stroke = color lineWidth = 1.0 shape() } } inner abstract class Handle { abstract fun position(): Vector2d fun draw() { with(canvas.graphicsContext2D) { save() val position = position() translate(position.x, position.y) drawOutlined(if (this@Handle == currentHandle) currentHandleColor else handleColor) { strokeRect(-3.0, -3.0, 6.0, 6.0) } restore() } } abstract fun moveTo(x: Double, y: Double) } inner class PositionHandle(val parameter: Vector2dParameter) : Handle() { override fun position() = Vector2d(parameter.x ?: 0.0, parameter.y ?: 0.0) override fun moveTo(x: Double, y: Double) { parameter.xP.value = x parameter.yP.value = y } } inner class RadiusHandle(val centerXP: DoubleParameter, val centerYP: DoubleParameter, val radiusParameter: DoubleParameter) : Handle() { override fun position() = Vector2d((centerXP.value ?: 0.0) + (radiusParameter.value ?: 0.0), (centerYP.value ?: 0.0)) override fun moveTo(x: Double, y: Double) { radiusParameter.value = x - (centerXP.value ?: 0.0) } } inner class CornerHandle( val centerParameter: Vector2dParameter, val widthParameter: DoubleParameter, val heightParameter: DoubleParameter, val angleParameter: AngleParameter, other: CornerHandle?) : Handle() { lateinit var other: CornerHandle var plusX: Boolean = true var plusY: Boolean = true init { if (other != null) { this.other = other this.other.other = this plusX = false plusY = false } } override fun position(): Vector2d { with(canvas.graphicsContext2D) { val scaleX = if (plusX) 0.5 else -0.5 val scaleY = if (plusY) 0.5 else -0.5 val width = widthParameter.value ?: 0.0 val height = heightParameter.value ?: 0.0 val cos = Math.cos(angleParameter.value.radians) val sin = Math.sin(angleParameter.value.radians) val dx = width * scaleX * cos - height * scaleY * sin val dy = height * scaleY * cos + width * scaleX * sin return Vector2d((centerParameter.x ?: 0.0) + dx, (centerParameter.y ?: 0.0) + dy) } } override fun moveTo(x: Double, y: Double) { val rotate = Matrix3x2d().rotate(-angleParameter.value.radians) val rotated = Vector2d(x - (centerParameter.x ?: 0.0), y - (centerParameter.y ?: 0.0)) rotate.transformPosition(rotated) val otherRotated = other.position() otherRotated.x -= (centerParameter.x ?: 0.0) otherRotated.y -= (centerParameter.y ?: 0.0) rotate.transformPosition(otherRotated) val oldWidth = widthParameter.value ?: 0.0 val oldHeight = heightParameter.value ?: 0.0 var width = Math.round(rotated.x - otherRotated.x).toDouble() * if (plusX) 1 else -1 var height = Math.round(rotated.y - otherRotated.y).toDouble() * if (plusY) 1 else -1 if (width < 0) { width = -width plusX = !plusX other.plusX = !plusX } if (height < 0) { height = -height plusY = !plusY other.plusY = !plusY } centerParameter.x = (centerParameter.x ?: 0.0) + (width - oldWidth) / 2 * if (plusX) 1 else -1 centerParameter.y = (centerParameter.y ?: 0.0) + (height - oldHeight) / 2 * if (plusY) 1 else -1 widthParameter.value = width heightParameter.value = height } } }
tickle-editor/src/main/kotlin/uk/co/nickthecoder/tickle/editor/tabs/ShapeEditorParameter.kt
306487695
package com.getbase.android.db.cursors import android.os.Bundle import android.os.Handler import android.os.Looper import android.os.SystemClock import androidx.loader.app.LoaderManager import androidx.loader.content.Loader import androidx.test.rule.ActivityTestRule import androidx.test.runner.AndroidJUnit4 import com.getbase.android.db.loaders.CursorLoaderBuilder import com.getbase.android.db.test.AsyncTasksMonitor import com.getbase.android.db.test.TestActivity import com.getbase.android.db.test.TestContentProvider import com.getbase.android.db.test.TestContract import com.google.common.truth.Truth import org.junit.Assert import org.junit.Rule import org.junit.Test import org.junit.runner.RunWith import java.util.* import java.util.concurrent.CountDownLatch import java.util.concurrent.LinkedBlockingDeque import java.util.concurrent.TimeUnit import java.util.concurrent.atomic.AtomicBoolean @RunWith(AndroidJUnit4::class) class ComposedCursorLoaderTest { @Rule @JvmField val rule = ActivityTestRule(TestActivity::class.java) private val asyncTasksMonitor = AsyncTasksMonitor() @Test fun shouldGracefullyHandleTransformationsYieldingTheSameInstance() { val initialLoad = TransformData(1, pauseWhenExecuting = false) val firstReload = TransformData(2) val secondReload = TransformData(2) // Check preconditions for this scenario: the reloads have to use the same // instance of transformation output object and it has to be different than // the result of initial load to trigger onNewDataDelivered callback. Truth.assertThat(firstReload.result).isSameAs(secondReload.result) Truth.assertThat(initialLoad.result).isNotSameAs(firstReload.result) val results = LinkedBlockingDeque<Int>() val transforms = LinkedList<TransformData>().apply { add(initialLoad) add(firstReload) add(secondReload) } // Start the loader on TestContract.BASE_URI. The returned Cursor will be transformed using // TransformData objects enqueued in transforms queue. rule.runOnUiThread { rule .activity .supportLoaderManager .initLoader(0, Bundle.EMPTY, object : LoaderManager.LoaderCallbacks<Int> { override fun onCreateLoader(id: Int, args: Bundle?): Loader<Int> = CursorLoaderBuilder .forUri(TestContract.BASE_URI) .transform { transforms.removeFirst().perform() } .build(rule.activity) override fun onLoadFinished(loader: Loader<Int>, data: Int) = results.putLast(data) override fun onLoaderReset(loader: Loader<Int>) = Unit }) } // Wait until the initial load is completed. We do this to ensure the content observers // are registered on TestContract.BASE_URI and we can trigger Loader reload with // ContentResolver.notifyChange call. Truth.assertThat(results.takeFirst()).isEqualTo(1) // The reloads are scheduled on the main Looper. scheduleLoaderReload() // Let's wait until the async task used by our Loader is started. firstReload.waitUntilStarted() // Now the things get tricky. We have to switch to the main thread to properly // orchestrate all threads. rule.runOnUiThread { // The first reload is paused. We schedule yet another reload on the main Looper. Note // that we're on the main thread here, so the reload will be processed *after* everything // we do in this runnable. scheduleLoaderReload() // We want to complete the second reload before the result of first reload are // delivered and processed on the main thread. To do that, we schedule yet another // task that will be processed on the main thread after the second reload trigger. scheduleMainLooperTask { // At this point we're after the second reload trigger. The first reload is still // waiting in the cursor transformation. We synchronously wait until the task is // started... secondReload.waitUntilStarted() // ...and finished. secondReload.proceed() asyncTasksMonitor.waitUntilIdle() // Again, we synchronously wait for the task to finish. We want to be sure that // the results of the first reload are not processed yet. At this point we'll have: // - Two delivery tasks for both reloads enqueued in main Looper. // - Two pending result entries for the same result in the ComposedCursorLoader // internals. // - The first reload results should be cancelled; the second reload results should be // delivered to onLoadFinished callback. } // We resume the first reload execution on the background thread. firstReload.proceed() // We synchronously wait until the first reload on the background thread // is completed, because we don't want the first reload task to be added as // mCancellingTask in the guts of AsyncTaskLoader.onCancelLoad. Instead, we // want the results from this task to go through the branch that "cancels" // the results delivered from an old task. asyncTasksMonitor.waitUntilIdle() // At this point the background tasks are completed and we have the following // queue on the main Looper: // - reload triggered by ContentResolver.notifyChange call // - a task that waits for a second reload // - result delivery from first reload. } // The whole machinery is in motion right now, we just need to wait. // If everything goes well, the first reload will be cancelled, and the // second reload will be successfully delivered. Truth.assertThat(results.takeFirst()).isEqualTo(2) } @Test fun shouldNotInvokeTransformationWhenLoaderDestroyedDuringQuery() { val asyncTaskIdleLatch = CountDownLatch(1) //As throwing exception on background loader thread do not fail test we need flag to ensure //that transformation was never invoked val transformationInvoked = AtomicBoolean(false) //Prepare TestContentProvider to wait when loader start query for data TestContentProvider.blockOnQuery() rule.runOnUiThread { rule .activity .supportLoaderManager .initLoader(1, Bundle.EMPTY, object : LoaderManager.LoaderCallbacks<Nothing> { override fun onCreateLoader(id: Int, args: Bundle?) = CursorLoaderBuilder .forUri(TestContract.BASE_URI) .transform { transformationInvoked.set(true) throw AssertionError("This transformation should never be invoked") } .build(rule.activity) override fun onLoadFinished(loader: Loader<Nothing>, data: Nothing?) { throw AssertionError("This loader should be cancelled so result should never be returned") } override fun onLoaderReset(loader: Loader<Nothing>) {} }) } //Now when loader is scheduled, test thread should wait until //Loader is created and initialized by LoaderManager TestContentProvider.waitUntilQueryStarted() //As loader is busy querying for data we cancel load in background. //Then we allow it to finish query and move forward. In the meantime //test thread is waiting until asyncTaskMonitor will be idle. rule.runOnUiThread { rule .activity .supportLoaderManager .destroyLoader(1) TestContentProvider.proceedQuery() asyncTasksMonitor.waitUntilIdle() asyncTaskIdleLatch.countDown() } //After all background work is done and check if transformation will not be invoked asyncTaskIdleLatch.await() Truth.assertThat(transformationInvoked.get()).isFalse() } @Test fun shouldNotInvokeSecondTransformationWhenLoaderDestroyedDuringFirstTransformation() { val firstTransformation = TransformData(1) val secondTransformationInvoked = AtomicBoolean(false) val asyncTaskIdleLatch = CountDownLatch(1) rule.runOnUiThread { rule .activity .supportLoaderManager .initLoader(1, Bundle.EMPTY, object : LoaderManager.LoaderCallbacks<Nothing> { override fun onCreateLoader(id: Int, args: Bundle?) = CursorLoaderBuilder .forUri(TestContract.BASE_URI) .transform { firstTransformation.perform() } .transform { secondTransformationInvoked.set(true) throw AssertionError("This transformation should never be invoked") } .build(rule.activity) override fun onLoadFinished(loader: Loader<Nothing>, data: Nothing?) { throw AssertionError("This loader should be cancelled so result should never be returned") } override fun onLoaderReset(loader: Loader<Nothing>) {} }) } firstTransformation.waitUntilStarted() rule.runOnUiThread { rule .activity .supportLoaderManager .destroyLoader(1) firstTransformation.proceed() asyncTasksMonitor.waitUntilIdle() asyncTaskIdleLatch.countDown() } asyncTaskIdleLatch.await() Truth.assertThat(secondTransformationInvoked.get()).isFalse() } interface RowTransformation { fun transform(): Int; } @Test fun shouldNotInvokeTransformationForSecondRowWhenLoaderDestroyedDuringTransformationOfFirstRow() { val secondTransformationInvoked = AtomicBoolean(false) val asyncTaskIdleLatch = CountDownLatch(1) TestContentProvider.setDataForQuery(mutableListOf(1, 2)) val firstTransformation = TransformData(1) val transformations = mutableListOf( object : RowTransformation { override fun transform(): Int = firstTransformation.perform() }, object : RowTransformation { override fun transform(): Int { secondTransformationInvoked.set(true) return 2 } } ) rule.runOnUiThread { rule .activity .supportLoaderManager .initLoader(1, Bundle.EMPTY, object : LoaderManager.LoaderCallbacks<List<Int>> { override fun onCreateLoader(id: Int, args: Bundle?) = CursorLoaderBuilder .forUri(TestContract.BASE_URI) .transformRow { val transformation = transformations.first() transformations.remove(transformation) transformation.transform() } .build(rule.activity) override fun onLoadFinished(loader: Loader<List<Int>>, data: List<Int>?) { throw AssertionError("This loader should be cancelled so result should never be returned") } override fun onLoaderReset(loader: Loader<List<Int>>) {} }) } firstTransformation.waitUntilStarted() //Data is loaded and loader is blocked on first row transformation rule.runOnUiThread { rule .activity .supportLoaderManager .destroyLoader(1) firstTransformation.proceed() asyncTasksMonitor.waitUntilIdle() asyncTaskIdleLatch.countDown() } asyncTaskIdleLatch.await() Truth.assertThat(secondTransformationInvoked.get()).isFalse() } private fun scheduleMainLooperTask(task: () -> Unit) = Handler(Looper.getMainLooper()).post(task) private fun scheduleLoaderReload() = rule.activity.contentResolver.notifyChange(TestContract.BASE_URI, null) private fun AsyncTasksMonitor.waitUntilIdle() { while (!isIdleNow) { SystemClock.sleep(10) } } class TransformData(val result: Int, pauseWhenExecuting: Boolean = true) { private val startLatch = CountDownLatch(if (pauseWhenExecuting) 1 else 0) private val proceedLatch = CountDownLatch(if (pauseWhenExecuting) 1 else 0) fun perform(): Int { startLatch.countDown() proceedLatch.awaitOrFail() return result } fun waitUntilStarted() = startLatch.awaitOrFail() fun proceed() = proceedLatch.countDown() private fun CountDownLatch.awaitOrFail(): Unit { if (!await(3, TimeUnit.SECONDS)) { Assert.fail() } } } }
library/src/androidTest/java/com/getbase/android/db/cursors/ComposedCursorLoaderTest.kt
696581472
package org.peercast.core.lib import android.net.Uri import kotlinx.serialization.json.* import org.peercast.core.lib.internal.BaseJsonRpcConnection import org.peercast.core.lib.rpc.* import org.peercast.core.lib.rpc.io.* import org.peercast.core.lib.rpc.io.JsonRpcResponse import org.peercast.core.lib.rpc.io.decodeRpcResponse import org.peercast.core.lib.rpc.io.decodeRpcResponseOnlyErrorCheck import java.io.IOException /** * PeerCastController経由でRPCコマンドを実行する。 * * @licenses Dual licensed under the MIT or GPL licenses. * @author (c) 2019-2020, T Yoshizawa * @see <a href=https://github.com/kumaryu/peercaststation/wiki/JSON-RPC-API-%E3%83%A1%E3%83%A2>JSON RPC API メモ</a> * @version 4.0.0 */ class PeerCastRpcClient(private val conn: BaseJsonRpcConnection) { /**@param endPoint RPC接続へのURL*/ constructor(endPoint: String) : this(JsonRpcConnection(endPoint)) constructor(controller: PeerCastController) : this(controller.rpcEndPoint) /**RPC接続へのURL*/ val rpcEndPoint: Uri get() = Uri.parse(conn.endPoint) private suspend inline fun <reified T> JsonObject.sendCommand(): T { return conn.post(this.toString()){ decodeRpcResponse(it) } } //result=nullしか帰ってこない場合 private suspend fun JsonObject.sendVoidCommand() { conn.post(this.toString()){ decodeRpcResponseOnlyErrorCheck(it) } } /** * 稼働時間、ポート開放状態、IPアドレスなどの情報の取得。 * @throws IOException * **/ suspend fun getStatus(): Status { return buildRpcRequest("getStatus").sendCommand() } /** * チャンネルに再接続。 * @throws IOException * @return なし * */ suspend fun bumpChannel(channelId: String) { return buildRpcRequest("bumpChannel", channelId).sendVoidCommand() } /** * チャンネルを停止する。 * @throws IOException * @return 成功か * */ suspend fun stopChannel(channelId: String) { buildRpcRequest("stopChannel", channelId) .sendVoidCommand() } /** * チャンネルに関して特定の接続を停止する。成功すれば true、失敗すれば false を返す。 * @throws IOException * @return 成功か * */ suspend fun stopChannelConnection(channelId: String, connectionId: Int): Boolean { return buildRpcRequestArrayParams("stopChannelConnection") { add(channelId) add(connectionId) }.sendCommand() } /** * チャンネルの接続情報。 * @throws IOException * */ suspend fun getChannelConnections(channelId: String): List<ChannelConnection> { return buildRpcRequest("getChannelConnections", channelId).sendCommand() } /** * リレーツリー情報。ルートは自分自身。 * @throws IOException * */ suspend fun getChannelRelayTree(channelId: String): List<ChannelRelayTree> { return buildRpcRequest("getChannelRelayTree", channelId) .sendCommand() } suspend fun getChannelInfo(channelId: String): ChannelInfoResult { return buildRpcRequest("getChannelInfo", channelId).sendCommand() } /** * バージョン情報の取得。 * @throws IOException * */ suspend fun getVersionInfo(): VersionInfo { return buildRpcRequest("getVersionInfo").sendCommand() } /** * 特定のチャンネルの情報。 * @throws IOException * */ suspend fun getChannelStatus(channelId: String): ChannelStatus { return buildRpcRequest("getChannelStatus", channelId).sendCommand() } /** * すべてのチャンネルの情報。 * @throws IOException * */ suspend fun getChannels(): List<Channel> { return buildRpcRequest("getChannels").sendCommand() } /** * リレーに関する設定の取得。 * @throws IOException * */ suspend fun getSettings(): Settings { return buildRpcRequest("getSettings").sendCommand() } /** * リレーに関する設定を変更。 * @throws IOException * */ suspend fun setSettings(settings: Settings) { buildRpcRequestObjectParams("setSettings") { put("settings", Json.encodeToJsonElement(settings)) }.sendVoidCommand() } /** * ログをクリア。 * @throws IOException * */ suspend fun clearLog() { buildRpcRequest("clearLog").sendVoidCommand() } /** * ログバッファーの内容の取得 * @throws IOException * @since YT22 * */ suspend fun getLog(from: Int? = null, maxLines: Int? = null): List<Log> { return buildRpcRequestObjectParams("getLog") { put("from", from) put("maxLines", maxLines) }.sendCommand() } /** * ログレベルの取得。 * @throws IOException * @since YT22 * */ suspend fun getLogSettings(): LogSettings { return buildRpcRequest("getLogSettings").sendCommand() } /** * ログレベルの設定。 * @throws IOException * @since YT22 * */ suspend fun setLogSettings(settings: LogSettings) { buildRpcRequest("setLogSettings", Json.encodeToJsonElement(settings) ).sendVoidCommand() } /** * 外部サイトの index.txtから取得されたチャンネル一覧。YPブラウザでの表示用。 * @throws IOException * */ suspend fun getYPChannels(): List<YpChannel> { return buildRpcRequest("getYPChannels").sendCommand() } /** * 登録されているイエローページの取得。 * @throws IOException * */ suspend fun getYellowPages(): List<YellowPage> { return buildRpcRequest("getYellowPages").sendCommand() } /** * イエローページを追加。 * @throws IOException * */ suspend fun addYellowPage( protocol: String, name: String, uri: String = "", announceUri: String = "", channelsUri: String = "", ) { throw NotImplementedError("Not implemented yet in jrpc.cpp") } /** * イエローページを削除。 * @throws IOException * */ suspend fun removeYellowPage(yellowPageId: Int) { buildRpcRequest("removeYellowPage", yellowPageId).sendVoidCommand() } /** * YP から index.txt を取得する。 * @throws IOException * */ suspend fun updateYPChannels() { throw NotImplementedError("Not implemented yet in jrpc.cpp") } override fun hashCode(): Int { return javaClass.hashCode() * 31 + conn.hashCode() } override fun equals(other: Any?): Boolean { return other is PeerCastRpcClient && other.javaClass == javaClass && other.conn == conn } }
libpeercast/src/main/java/org/peercast/core/lib/PeerCastRpcClient.kt
3906482322
package solution import data.structure.ListNode class LinkProblems { /** * https://leetcode-cn.com/problems/merge-k-sorted-lists/ */ fun mergeKLists(lists: Array<ListNode?>): ListNode? { var currentNode = Array<ListNode?>(lists.size) { null } var result: ListNode? = null var current: ListNode? = null lists.forEachIndexed { index, listNode -> currentNode[index] = listNode } currentNode = currentNode.filterNotNull().toTypedArray() while (currentNode.isNotEmpty()) { var m = currentNode[0] var minIndex = 0 currentNode.forEachIndexed { index, listNode -> if (listNode!!.`val` < m!!.`val`) { m = listNode minIndex = index } } if (current == null) { result = m current = result } else { current.next = m current = current.next } currentNode[minIndex] = currentNode[minIndex]?.next currentNode = currentNode.filterNotNull().toTypedArray() current?.next = null } return result } /** * https://leetcode-cn.com/problems/add-two-numbers-ii/ */ fun addTwoNumbers(l1: ListNode?, l2: ListNode?): ListNode? { val h1 = ListNode(0) h1.next = l1 val h2 = ListNode(0) h2.next = l2 val reverseList: (ListNode) -> Unit = { var current = it.next it.next = null while (current != null) { val pointer = current current = current.next if (it.next == null) { it.next = pointer pointer.next = null } else { pointer.next = it.next it.next = pointer } } } reverseList(h1) reverseList(h2) var n1 = h1.next var n2 = h2.next val ans = ListNode(0) var cur: ListNode? = null var carry = 0 while (n1 != null && n2 != null) { val n = n1.`val` + n2.`val` + carry carry = n / 10 if (ans.next == null) { ans.next = ListNode(n % 10) cur = ans.next } else { cur!!.next = ListNode(n % 10) cur = cur.next } n1 = n1.next n2 = n2.next } while (n1 != null) { cur!!.next = ListNode((n1.`val` + carry) % 10) carry = (n1.`val` + carry) / 10 cur = cur.next n1 = n1.next } while (n2 != null) { cur!!.next = ListNode((n2.`val` + carry) % 10) carry = (n2.`val` + carry) / 10 cur = cur.next n2 = n2.next } if (carry > 0) { cur!!.next = ListNode(carry) } reverseList(ans) return ans.next } /** * https://leetcode-cn.com/problems/shan-chu-lian-biao-de-jie-dian-lcof/ */ fun deleteNode(head: ListNode?, `val`: Int): ListNode? { val ans = ListNode(0) ans.next = head var before = ans var current = ans.next while (current != null) { if (current.`val` == `val`) { before.next = current.next current.next = null break } before = current current = current.next } return ans.next } /** * https://leetcode-cn.com/problems/convert-binary-number-in-a-linked-list-to-integer/ */ fun getDecimalValue(head: ListNode?): Int { var len = 0 var cur = head var ans = 0 while (cur != null) { len++ cur = cur.next } cur = head var carry = (1).shl(len - 1) while (cur != null) { ans += carry * cur.`val` carry = carry.shr(1) cur = cur.next } return ans } /** * */ fun addTwoNumbers2(l1: ListNode?, l2: ListNode?): ListNode? { val h1 = ListNode(0) h1.next = l1 val h2 = ListNode(0) h2.next = l2 var n1 = h1.next var n2 = h2.next val ans = ListNode(0) var cur: ListNode? = null var carry = 0 while (n1 != null && n2 != null) { val n = n1.`val` + n2.`val` + carry carry = n / 10 if (ans.next == null) { ans.next = ListNode(n % 10) cur = ans.next } else { cur!!.next = ListNode(n % 10) cur = cur.next } n1 = n1.next n2 = n2.next } while (n1 != null) { cur!!.next = ListNode((n1.`val` + carry) % 10) carry = (n1.`val` + carry) / 10 cur = cur.next n1 = n1.next } while (n2 != null) { cur!!.next = ListNode((n2.`val` + carry) % 10) carry = (n2.`val` + carry) / 10 cur = cur.next n2 = n2.next } if (carry > 0) { cur!!.next = ListNode(carry) } return ans.next } /** * https://leetcode-cn.com/problems/partition-list/ */ fun partition(head: ListNode?, x: Int): ListNode? { val littleList = ListNode(0) val bigList = ListNode(0) var current = head var littleCurrent = littleList var bigCurrent = bigList while (current != null) { val temp = current current = current.next temp.next = null if (temp.`val` < x) { littleCurrent.next = temp littleCurrent = littleCurrent.next!! } else { bigCurrent.next = temp bigCurrent = bigCurrent.next!! } } littleCurrent.next = bigList.next return littleList.next } /** * https://leetcode-cn.com/problems/fan-zhuan-lian-biao-lcof/ */ fun reverseList(head: ListNode?): ListNode? { val ans: ListNode = ListNode(0) var current = head while (current != null) { val temp = current current = current.next temp.next = ans.next ans.next = temp } return ans.next } /** * https://leetcode-cn.com/problems/he-bing-liang-ge-pai-xu-de-lian-biao-lcof/ */ fun mergeTwoLists(l1: ListNode?, l2: ListNode?): ListNode? { var cur1 = l1 var cur2 = l2 val ans = ListNode(0) var cur: ListNode = ans while (cur1 != null || cur2 != null) { if (cur2 == null || (cur1 != null && cur1.`val` <= cur2.`val`)) { cur.next = cur1 cur1 = cur1!!.next cur = cur.next!! cur.next = null } else if (cur1 == null || cur1.`val` > cur2.`val`) { cur.next = cur2 cur2 = cur2.next cur = cur.next!! cur.next = null } } return ans.next } /** <<<<<<< HEAD * https://leetcode-cn.com/problems/palindrome-linked-list-lcci/ */ fun isPalindrome(head: ListNode?): Boolean { var cur = head var listLength = 0 while (cur != null) { listLength++ cur = cur.next } cur = head var count = listLength / 2 val left = ListNode(0) while (count > 0 && cur != null) { count-- val temp = cur cur = cur.next temp.next = left.next left.next = temp } var curLeft = left.next var curRight = cur if (listLength % 2 == 1) { curRight = cur!!.next } while (curLeft != null && curRight != null) { if (curLeft.`val` != curRight.`val`) { return false } curLeft = curLeft.next curRight = curRight.next } return true } /** * https://leetcode-cn.com/problems/kth-node-from-end-of-list-lcci/ */ fun kthToLast(head: ListNode?, k: Int): Int { var cur = head var listLength = 0 while (cur != null) { listLength++ cur = cur.next } val pos = listLength - k + 1 cur = head listLength = 0 while (cur != null) { listLength++ if (listLength == pos) { return cur.`val` } cur = cur.next } return 0 } /** * https://leetcode-cn.com/problems/middle-of-the-linked-list/ */ fun middleNode(head: ListNode?): ListNode? { var listLength = 0 var current = head while (current != null) { listLength++ current = current.next } val middle = listLength / 2 + 1 current = head listLength = 0 while (current != null) { listLength++ if (listLength == middle) { return current } current = current.next } return null } /** * https://leetcode-cn.com/problems/linked-list-components/ */ fun numComponents(head: ListNode?, G: IntArray): Int { var ans = 0 var current = head var inList = false while (current != null) { if (current.`val` in G) { if (!inList) { inList = true ans++ } } else { inList = false } current = current.next } return ans } /** * https://leetcode-cn.com/problems/remove-duplicate-node-lcci/ */ fun removeDuplicateNodes(head: ListNode?): ListNode? { val buffer = HashSet<Int>() var current = head var before: ListNode? = null while (current != null) { if (current.`val` in buffer) { before!!.next = current.next current = before } else { buffer.add(current.`val`) } before = current current = current.next } return head } }
kotlin/problems/src/solution/LinkProblems.kt
2552679982
package org.rust.lang.core.type class RustEnumPatternTypeInferenceTest: RustTypificationTestBase() { fun testEnumPattern() = testExpr(""" enum E { X } fn main() { let x = E::X; x; //^ E } """) fun testEnumPatternWithUnnamedArgs() = testExpr(""" enum E { X(i32, i16) } fn bar() -> E {} fn main() { let E::X(_, i) = bar(); i; //^ i16 } """) fun testEnumPatternWithNamedArgs() = testExpr(""" enum E { X { _1: i32, _2: i64 } } fn bar() -> E {} fn main() { let E::X(_, i) = bar(); i; //^ <unknown> } """) fun testEnumTupleOutOfBounds() = testExpr(""" enum E { V(i32, i32) } fn main() { let E::V(_, _, x): E = unimplemented!(); x //^ <unknown> } """) fun testStructTuple() = testExpr(""" struct Centimeters(f64); struct Inches(i32); impl Inches { fn to_centimeters(&self) -> Centimeters { let &Inches(inches) = self; inches; //^ i32 } } """) fun testBindingWithPat() = testExpr(""" struct S { x: i32, y: i32 } enum Result { Ok(S), Failure } fn foo(r: Result) { let Result::Ok(s @ S { x, .. }) = r; s //^ S } """) fun testBindingWithPatFailure1() = testExpr(""" struct S { x: i32, y: i32 } enum Result { Ok(S), Failure } fn foo(r: Result) { let Result::Ok(s @ S { j /* non-existing field */ }) = r; s //^ <unknown> } """) fun testBindingWithPatFailure2() = testExpr(""" struct S { x: i32, y: i32 } enum Result { Ok(S), Failure } fn foo(r: Result) { let Result::Ok(s @ S { x /* missing fields */ }) = r; s //^ <unknown> } """) }
src/test/kotlin/org/rust/lang/core/type/RustEnumPatternTypeInferenceTest.kt
259704091
package net.perfectdreams.loritta.cinnamon.discord.interactions.vanilla.utils.ocr import net.perfectdreams.discordinteraktions.common.commands.options.SlashCommandArguments import net.perfectdreams.loritta.morenitta.LorittaBot import net.perfectdreams.loritta.cinnamon.discord.interactions.commands.ApplicationCommandContext import net.perfectdreams.loritta.cinnamon.discord.interactions.commands.CinnamonSlashCommandExecutor import net.perfectdreams.loritta.cinnamon.discord.interactions.commands.options.LocalizedApplicationCommandOptions class OCRSlashExecutor(loritta: LorittaBot) : CinnamonSlashCommandExecutor(loritta), OCRExecutor { inner class Options : LocalizedApplicationCommandOptions(loritta) { val imageReference = imageReferenceOrAttachment("image") } override val options = Options() override suspend fun execute(context: ApplicationCommandContext, args: SlashCommandArguments) { val image = args[options.imageReference].get(context)!! // Shouldn't be null here because it is required context.deferChannelMessage() handleOCRCommand( loritta, context, false, image.url ) } }
discord/loritta-bot-common/src/main/kotlin/net/perfectdreams/loritta/cinnamon/discord/interactions/vanilla/utils/ocr/OCRSlashExecutor.kt
819339316
package eu.kanade.tachiyomi.extension.it.hentaifantasy import eu.kanade.tachiyomi.network.GET import eu.kanade.tachiyomi.network.POST import eu.kanade.tachiyomi.source.model.* import eu.kanade.tachiyomi.source.online.ParsedHttpSource import okhttp3.* import org.jsoup.nodes.Document import org.jsoup.nodes.Element import java.text.ParseException import java.text.SimpleDateFormat import java.util.Calendar import java.util.regex.Pattern class HentaiFantasy : ParsedHttpSource() { override val name = "HentaiFantasy" override val baseUrl = "http://www.hentaifantasy.it/index.php" override val lang = "it" override val supportsLatest = true override val client: OkHttpClient = network.cloudflareClient companion object { val pagesUrlPattern by lazy { Pattern.compile("""\"url\":\"(.*?)\"""") } val dateFormat by lazy { SimpleDateFormat("yyyy.MM.dd") } } override fun popularMangaSelector() = "div.list > div.group > div.title > a" override fun popularMangaRequest(page: Int) = GET("$baseUrl/most_downloaded/$page/", headers) override fun popularMangaFromElement(element: Element): SManga { val manga = SManga.create() manga.setUrlWithoutDomain(element.attr("href")) manga.title = element.text().trim() return manga } override fun popularMangaNextPageSelector() = "div.next > a.gbutton:contains(»):last-of-type" override fun latestUpdatesSelector() = popularMangaSelector() override fun latestUpdatesRequest(page: Int) = GET("$baseUrl/latest/$page/", headers) override fun latestUpdatesFromElement(element: Element): SManga { return popularMangaFromElement(element) } override fun latestUpdatesNextPageSelector() = popularMangaNextPageSelector() override fun searchMangaSelector() = popularMangaSelector() override fun searchMangaRequest(page: Int, query: String, filters: FilterList): Request { var tags = mutableListOf<String>() var paths = mutableListOf<String>() for (filter in if (filters.isEmpty()) getFilterList() else filters) { when (filter) { is TagList -> filter.state .filter { it.state } .map { paths.add(it.name.toLowerCase().replace(" ", "_")); it.id.toString() } .forEach { tags.add(it) } } } var searchTags = tags.size > 0 if (!searchTags && query.length < 3) { throw Exception("Inserisci almeno tre caratteri") } val form = FormBody.Builder().apply { if (!searchTags) { add("search", query) } else { tags.forEach { add("tag[]", it) } } } var searchPath = if (!searchTags) { "search" } else if (paths.size == 1) { "tag/${paths[0]}/${page}" } else { "search_tags" } return POST("${baseUrl}/${searchPath}", headers, form.build()) } override fun searchMangaFromElement(element: Element): SManga { return popularMangaFromElement(element) } override fun searchMangaNextPageSelector() = popularMangaNextPageSelector() override fun mangaDetailsParse(document: Document): SManga { val manga = SManga.create() var genres = mutableListOf<String>() document.select("div#tablelist > div.row").forEach { row -> when (row.select("div.cell > b").first().text().trim()) { "Autore" -> manga.author = row.select("div.cell > a").text().trim() "Genere", "Tipo" -> row.select("div.cell > a > span.label").forEach { genres.add(it.text().trim()) } "Descrizione" -> manga.description = row.select("div.cell").last().text().trim() } } manga.genre = genres.joinToString(", ") manga.status = SManga.UNKNOWN manga.thumbnail_url = document.select("div.thumbnail > img")?.attr("src") return manga } override fun mangaDetailsRequest(manga: SManga) = POST(baseUrl + manga.url, headers) override fun chapterListSelector() = "div.list > div.group div.element" override fun chapterFromElement(element: Element): SChapter { val chapter = SChapter.create() element.select("div.title > a").let { chapter.setUrlWithoutDomain(it.attr("href")) chapter.name = it.text().trim() } chapter.date_upload = element.select("div.meta_r").first()?.ownText()?.substringAfterLast(", ")?.trim()?.let { parseChapterDate(it) } ?: 0L return chapter } private fun parseChapterDate(date: String): Long { return if (date == "Oggi") { Calendar.getInstance().timeInMillis } else if (date == "Ieri") { Calendar.getInstance().apply { add(Calendar.DAY_OF_YEAR, -1) }.timeInMillis } else { try { dateFormat.parse(date).time } catch (e: ParseException) { 0L } } } override fun pageListRequest(chapter: SChapter) = POST(baseUrl + chapter.url, headers) override fun pageListParse(response: Response): List<Page> { val body = response.body()!!.string() val pages = mutableListOf<Page>() val p = pagesUrlPattern val m = p.matcher(body) var i = 0 while (m.find()) { pages.add(Page(i++, "", m.group(1).replace("""\\""", ""))) } return pages } override fun pageListParse(document: Document): List<Page> { throw Exception("Not used") } override fun imageUrlRequest(page: Page) = GET(page.url) override fun imageUrlParse(document: Document) = "" private class Tag(name: String, val id: Int) : Filter.CheckBox(name) private class TagList(title: String, tags: List<Tag>) : Filter.Group<Tag>(title, tags) override fun getFilterList() = FilterList( TagList("Generi", getTagList()) ) // Tags: 47 // $("select[name='tag[]']:eq(0) > option").map((i, el) => `Tag("${$(el).text().trim()}", ${$(el).attr("value")})`).get().sort().join(",\n") // on http://www.hentaifantasy.it/search/ private fun getTagList() = listOf( Tag("Ahegao", 56), Tag("Anal", 28), Tag("Ashikoki", 12), Tag("Bestiality", 24), Tag("Bizzare", 44), Tag("Bondage", 30), Tag("Cheating", 33), Tag("Chubby", 57), Tag("Dark Skin", 39), Tag("Demon Girl", 43), Tag("Femdom", 38), Tag("Forced", 46), Tag("Full color", 52), Tag("Furry", 36), Tag("Futanari", 18), Tag("Group", 34), Tag("Guro", 8), Tag("Harem", 41), Tag("Housewife", 51), Tag("Incest", 11), Tag("Lolicon", 20), Tag("Maid", 55), Tag("Milf", 31), Tag("Monster Girl", 15), Tag("Nurse", 49), Tag("Oppai", 25), Tag("Paizuri", 42), Tag("Pettanko", 35), Tag("Pissing", 32), Tag("Public", 53), Tag("Rape", 21), Tag("Schoolgirl", 27), Tag("Shotacon", 26), Tag("Stockings", 40), Tag("Swimsuit", 47), Tag("Tanlines", 48), Tag("Teacher", 50), Tag("Tentacle", 23), Tag("Toys", 45), Tag("Trap", 29), Tag("Tsundere", 54), Tag("Uncensored", 59), Tag("Vanilla", 19), Tag("Yandere", 58), Tag("Yaoi", 22), Tag("Yuri", 14) ) }
src/it/hentaifantasy/src/eu/kanade/tachiyomi/extension/it/hentaifantasy/HentaiFantasy.kt
1866828477
/* * Copyright 2020 Michael Rozumyanskiy * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package io.michaelrocks.lightsaber.sample import io.michaelrocks.lightsaber.Factory import io.michaelrocks.lightsaber.sample.library.Droid @Factory internal interface DroidFactory { @Factory.Return(R2D2::class) fun produceR2D2(color: String): Droid }
samples/sample-android-kotlin/src/main/java/io/michaelrocks/lightsaber/sample/DroidFactory.kt
3410803339
/* * Copyright (C) 2016 Square, Inc. * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package okhttp3.tls import java.math.BigInteger import java.net.InetAddress import java.security.GeneralSecurityException import java.security.KeyFactory import java.security.KeyPair import java.security.KeyPairGenerator import java.security.PrivateKey import java.security.PublicKey import java.security.SecureRandom import java.security.Security import java.security.Signature import java.security.cert.X509Certificate import java.security.interfaces.ECPublicKey import java.security.interfaces.RSAPrivateKey import java.security.interfaces.RSAPublicKey import java.security.spec.PKCS8EncodedKeySpec import java.util.UUID import java.util.concurrent.TimeUnit import okhttp3.internal.canParseAsIpAddress import okhttp3.tls.internal.der.AlgorithmIdentifier import okhttp3.tls.internal.der.AttributeTypeAndValue import okhttp3.tls.internal.der.BasicConstraints import okhttp3.tls.internal.der.BitString import okhttp3.tls.internal.der.Certificate import okhttp3.tls.internal.der.CertificateAdapters import okhttp3.tls.internal.der.CertificateAdapters.generalNameDnsName import okhttp3.tls.internal.der.CertificateAdapters.generalNameIpAddress import okhttp3.tls.internal.der.Extension import okhttp3.tls.internal.der.ObjectIdentifiers import okhttp3.tls.internal.der.ObjectIdentifiers.basicConstraints import okhttp3.tls.internal.der.ObjectIdentifiers.organizationalUnitName import okhttp3.tls.internal.der.ObjectIdentifiers.sha256WithRSAEncryption import okhttp3.tls.internal.der.ObjectIdentifiers.sha256withEcdsa import okhttp3.tls.internal.der.ObjectIdentifiers.subjectAlternativeName import okhttp3.tls.internal.der.TbsCertificate import okhttp3.tls.internal.der.Validity import okio.ByteString import okio.ByteString.Companion.decodeBase64 import okio.ByteString.Companion.toByteString import org.bouncycastle.jce.provider.BouncyCastleProvider /** * A certificate and its private key. These are some properties of certificates that are used with * TLS: * * * **A common name.** This is a string identifier for the certificate. It usually describes the * purpose of the certificate like "Entrust Root Certification Authority - G2" or * "www.squareup.com". * * * **A set of hostnames.** These are in the certificate's subject alternative name (SAN) * extension. A subject alternative name is either a literal hostname (`squareup.com`), a literal * IP address (`74.122.190.80`), or a hostname pattern (`*.api.squareup.com`). * * * **A validity interval.** A certificate should not be used before its validity interval starts * or after it ends. * * * **A public key.** This cryptographic key is used for asymmetric encryption digital signatures. * Note that the private key is not a part of the certificate! * * * **A signature issued by another certificate's private key.** This mechanism allows a trusted * third-party to endorse a certificate. Third parties should only endorse certificates once * they've confirmed that the owner of the private key is also the owner of the certificate's * other properties. * * Certificates are signed by other certificates and a sequence of them is called a certificate * chain. The chain terminates in a self-signed "root" certificate. Signing certificates in the * middle of the chain are called "intermediates". Organizations that offer certificate signing are * called certificate authorities (CAs). * * Browsers and other HTTP clients need a set of trusted root certificates to authenticate their * peers. Sets of root certificates are managed by either the HTTP client (like Firefox), or the * host platform (like Android). In July 2018 Android had 134 trusted root certificates for its HTTP * clients to trust. * * For example, in order to establish a secure connection to `https://www.squareup.com/`, * these three certificates are used. * * ``` * www.squareup.com certificate: * * Common Name: www.squareup.com * Subject Alternative Names: www.squareup.com, squareup.com, account.squareup.com... * Validity: 2018-07-03T20:18:17Z – 2019-08-01T20:48:15Z * Public Key: d107beecc17325f55da976bcbab207ba4df68bd3f8fce7c3b5850311128264fd53e1baa342f58d93... * Signature: 1fb0e66fac05322721fe3a3917f7c98dee1729af39c99eab415f22d8347b508acdf0bab91781c3720... * * signed by intermediate certificate: * * Common Name: Entrust Certification Authority - L1M * Subject Alternative Names: none * Validity: 2014-12-15T15:25:03Z – 2030-10-15T15:55:03Z * Public Key: d081c13923c2b1d1ecf757dd55243691202248f7fcca520ab0ab3f33b5b08407f6df4e7ab0fb9822... * Signature: b487c784221a29c0a478ecf54f1bb484976f77eed4cf59afa843962f1d58dea6f3155b2ed9439c4c4... * * signed by root certificate: * * Common Name: Entrust Root Certification Authority - G2 * Subject Alternative Names: none * Validity: 2009-07-07T17:25:54Z – 2030-12-07T17:55:54Z * Public Key: ba84b672db9e0c6be299e93001a776ea32b895411ac9da614e5872cffef68279bf7361060aa527d8... * Self-signed Signature: 799f1d96c6b6793f228d87d3870304606a6b9a2e59897311ac43d1f513ff8d392bc0f... * ``` * * In this example the HTTP client already knows and trusts the last certificate, "Entrust Root * Certification Authority - G2". That certificate is used to verify the signature of the * intermediate certificate, "Entrust Certification Authority - L1M". The intermediate certificate * is used to verify the signature of the "www.squareup.com" certificate. * * This roles are reversed for client authentication. In that case the client has a private key and * a chain of certificates. The server uses a set of trusted root certificates to authenticate the * client. Subject alternative names are not used for client authentication. */ @Suppress("DEPRECATION") class HeldCertificate( @get:JvmName("keyPair") val keyPair: KeyPair, @get:JvmName("certificate") val certificate: X509Certificate ) { @JvmName("-deprecated_certificate") @Deprecated( message = "moved to val", replaceWith = ReplaceWith(expression = "certificate"), level = DeprecationLevel.ERROR) fun certificate(): X509Certificate = certificate @JvmName("-deprecated_keyPair") @Deprecated( message = "moved to val", replaceWith = ReplaceWith(expression = "keyPair"), level = DeprecationLevel.ERROR) fun keyPair(): KeyPair = keyPair /** * Returns the certificate encoded in [PEM format][rfc_7468]. * * [rfc_7468]: https://tools.ietf.org/html/rfc7468 */ fun certificatePem(): String = certificate.certificatePem() /** * Returns the RSA private key encoded in [PKCS #8][rfc_5208] [PEM format][rfc_7468]. * * [rfc_5208]: https://tools.ietf.org/html/rfc5208 * [rfc_7468]: https://tools.ietf.org/html/rfc7468 */ fun privateKeyPkcs8Pem(): String { return buildString { append("-----BEGIN PRIVATE KEY-----\n") encodeBase64Lines(keyPair.private.encoded.toByteString()) append("-----END PRIVATE KEY-----\n") } } /** * Returns the RSA private key encoded in [PKCS #1][rfc_8017] [PEM format][rfc_7468]. * * [rfc_8017]: https://tools.ietf.org/html/rfc8017 * [rfc_7468]: https://tools.ietf.org/html/rfc7468 */ fun privateKeyPkcs1Pem(): String { check(keyPair.private is RSAPrivateKey) { "PKCS1 only supports RSA keys" } return buildString { append("-----BEGIN RSA PRIVATE KEY-----\n") encodeBase64Lines(pkcs1Bytes()) append("-----END RSA PRIVATE KEY-----\n") } } private fun pkcs1Bytes(): ByteString { val decoded = CertificateAdapters.privateKeyInfo.fromDer(keyPair.private.encoded.toByteString()) return decoded.privateKey } /** Build a held certificate with reasonable defaults. */ class Builder { private var notBefore = -1L private var notAfter = -1L private var commonName: String? = null private var organizationalUnit: String? = null private val altNames = mutableListOf<String>() private var serialNumber: BigInteger? = null private var keyPair: KeyPair? = null private var signedBy: HeldCertificate? = null private var maxIntermediateCas = -1 private var keyAlgorithm: String? = null private var keySize: Int = 0 init { ecdsa256() } /** * Sets the certificate to be valid in ```[notBefore..notAfter]```. Both endpoints are specified * in the format of [System.currentTimeMillis]. Specify -1L for both values to use the default * interval, 24 hours starting when the certificate is created. */ fun validityInterval(notBefore: Long, notAfter: Long) = apply { require(notBefore <= notAfter && notBefore == -1L == (notAfter == -1L)) { "invalid interval: $notBefore..$notAfter" } this.notBefore = notBefore this.notAfter = notAfter } /** * Sets the certificate to be valid immediately and until the specified duration has elapsed. * The precision of this field is seconds; further precision will be truncated. */ fun duration(duration: Long, unit: TimeUnit) = apply { val now = System.currentTimeMillis() validityInterval(now, now + unit.toMillis(duration)) } /** * Adds a subject alternative name (SAN) to the certificate. This is usually a literal hostname, * a literal IP address, or a hostname pattern. If no subject alternative names are added that * extension will be omitted. */ fun addSubjectAlternativeName(altName: String) = apply { altNames += altName } /** * Set this certificate's common name (CN). Historically this held the hostname of TLS * certificate, but that practice was deprecated by [RFC 2818][rfc_2818] and replaced with * [addSubjectAlternativeName]. If unset a random string will be used. * * [rfc_2818]: https://tools.ietf.org/html/rfc2818 */ fun commonName(cn: String) = apply { this.commonName = cn } /** Sets the certificate's organizational unit (OU). If unset this field will be omitted. */ fun organizationalUnit(ou: String) = apply { this.organizationalUnit = ou } /** Sets this certificate's serial number. If unset the serial number will be 1. */ fun serialNumber(serialNumber: BigInteger) = apply { this.serialNumber = serialNumber } /** Sets this certificate's serial number. If unset the serial number will be 1. */ fun serialNumber(serialNumber: Long) = apply { serialNumber(BigInteger.valueOf(serialNumber)) } /** * Sets the public/private key pair used for this certificate. If unset a key pair will be * generated. */ fun keyPair(keyPair: KeyPair) = apply { this.keyPair = keyPair } /** * Sets the public/private key pair used for this certificate. If unset a key pair will be * generated. */ fun keyPair(publicKey: PublicKey, privateKey: PrivateKey) = apply { keyPair(KeyPair(publicKey, privateKey)) } /** * Set the certificate that will issue this certificate. If unset the certificate will be * self-signed. */ fun signedBy(signedBy: HeldCertificate?) = apply { this.signedBy = signedBy } /** * Set this certificate to be a signing certificate, with up to `maxIntermediateCas` * intermediate signing certificates beneath it. * * By default this certificate cannot not sign other certificates. Set this to 0 so this * certificate can sign other certificates (but those certificates cannot themselves sign * certificates). Set this to 1 so this certificate can sign intermediate certificates that can * themselves sign certificates. Add one for each additional layer of intermediates to permit. */ fun certificateAuthority(maxIntermediateCas: Int) = apply { require(maxIntermediateCas >= 0) { "maxIntermediateCas < 0: $maxIntermediateCas" } this.maxIntermediateCas = maxIntermediateCas } /** * Configure the certificate to generate a 256-bit ECDSA key, which provides about 128 bits of * security. ECDSA keys are noticeably faster than RSA keys. * * This is the default configuration and has been since this API was introduced in OkHttp * 3.11.0. Note that the default may change in future releases. */ fun ecdsa256() = apply { keyAlgorithm = "EC" keySize = 256 } /** * Configure the certificate to generate a 2048-bit RSA key, which provides about 112 bits of * security. RSA keys are interoperable with very old clients that don't support ECDSA. */ fun rsa2048() = apply { keyAlgorithm = "RSA" keySize = 2048 } fun build(): HeldCertificate { // Subject keys & identity. val subjectKeyPair = keyPair ?: generateKeyPair() val subjectPublicKeyInfo = CertificateAdapters.subjectPublicKeyInfo.fromDer( subjectKeyPair.public.encoded.toByteString() ) val subject: List<List<AttributeTypeAndValue>> = subject() // Issuer/signer keys & identity. May be the subject if it is self-signed. val issuerKeyPair: KeyPair val issuer: List<List<AttributeTypeAndValue>> if (signedBy != null) { issuerKeyPair = signedBy!!.keyPair issuer = CertificateAdapters.rdnSequence.fromDer( signedBy!!.certificate.subjectX500Principal.encoded.toByteString() ) } else { issuerKeyPair = subjectKeyPair issuer = subject } val signatureAlgorithm = signatureAlgorithm(issuerKeyPair) // Subset of certificate data that's covered by the signature. val tbsCertificate = TbsCertificate( version = 2L, // v3. serialNumber = serialNumber ?: BigInteger.ONE, signature = signatureAlgorithm, issuer = issuer, validity = validity(), subject = subject, subjectPublicKeyInfo = subjectPublicKeyInfo, issuerUniqueID = null, subjectUniqueID = null, extensions = extensions() ) // Signature. val signature = Signature.getInstance(tbsCertificate.signatureAlgorithmName).run { initSign(issuerKeyPair.private) update(CertificateAdapters.tbsCertificate.toDer(tbsCertificate).toByteArray()) sign().toByteString() } // Complete signed certificate. val certificate = Certificate( tbsCertificate = tbsCertificate, signatureAlgorithm = signatureAlgorithm, signatureValue = BitString( byteString = signature, unusedBitsCount = 0 ) ) return HeldCertificate(subjectKeyPair, certificate.toX509Certificate()) } private fun subject(): List<List<AttributeTypeAndValue>> { val result = mutableListOf<List<AttributeTypeAndValue>>() if (organizationalUnit != null) { result += listOf(AttributeTypeAndValue( type = organizationalUnitName, value = organizationalUnit )) } result += listOf(AttributeTypeAndValue( type = ObjectIdentifiers.commonName, value = commonName ?: UUID.randomUUID().toString() )) return result } private fun validity(): Validity { val notBefore = if (notBefore != -1L) notBefore else System.currentTimeMillis() val notAfter = if (notAfter != -1L) notAfter else notBefore + DEFAULT_DURATION_MILLIS return Validity( notBefore = notBefore, notAfter = notAfter ) } private fun extensions(): MutableList<Extension> { val result = mutableListOf<Extension>() if (maxIntermediateCas != -1) { result += Extension( id = basicConstraints, critical = true, value = BasicConstraints( ca = true, maxIntermediateCas = maxIntermediateCas.toLong() ) ) } if (altNames.isNotEmpty()) { val extensionValue = altNames.map { when { it.canParseAsIpAddress() -> { generalNameIpAddress to InetAddress.getByName(it).address.toByteString() } else -> { generalNameDnsName to it } } } result += Extension( id = subjectAlternativeName, critical = true, value = extensionValue ) } return result } private fun signatureAlgorithm(signedByKeyPair: KeyPair): AlgorithmIdentifier { return when (signedByKeyPair.private) { is RSAPrivateKey -> AlgorithmIdentifier( algorithm = sha256WithRSAEncryption, parameters = null ) else -> AlgorithmIdentifier( algorithm = sha256withEcdsa, parameters = ByteString.EMPTY ) } } private fun generateKeyPair(): KeyPair { return KeyPairGenerator.getInstance(keyAlgorithm).run { initialize(keySize, SecureRandom()) generateKeyPair() } } companion object { private const val DEFAULT_DURATION_MILLIS = 1000L * 60 * 60 * 24 // 24 hours. init { Security.addProvider(BouncyCastleProvider()) } } } companion object { private val PEM_REGEX = Regex("""-----BEGIN ([!-,.-~ ]*)-----([^-]*)-----END \1-----""") /** * Decodes a multiline string that contains both a [certificate][certificatePem] and a * [private key][privateKeyPkcs8Pem], both [PEM-encoded][rfc_7468]. A typical input string looks * like this: * * ``` * -----BEGIN CERTIFICATE----- * MIIBYTCCAQegAwIBAgIBKjAKBggqhkjOPQQDAjApMRQwEgYDVQQLEwtlbmdpbmVl * cmluZzERMA8GA1UEAxMIY2FzaC5hcHAwHhcNNzAwMTAxMDAwMDA1WhcNNzAwMTAx * MDAwMDEwWjApMRQwEgYDVQQLEwtlbmdpbmVlcmluZzERMA8GA1UEAxMIY2FzaC5h * cHAwWTATBgcqhkjOPQIBBggqhkjOPQMBBwNCAASda8ChkQXxGELnrV/oBnIAx3dD * ocUOJfdz4pOJTP6dVQB9U3UBiW5uSX/MoOD0LL5zG3bVyL3Y6pDwKuYvfLNhoyAw * HjAcBgNVHREBAf8EEjAQhwQBAQEBgghjYXNoLmFwcDAKBggqhkjOPQQDAgNIADBF * AiAyHHg1N6YDDQiY920+cnI5XSZwEGhAtb9PYWO8bLmkcQIhAI2CfEZf3V/obmdT * yyaoEufLKVXhrTQhRfodTeigi4RX * -----END CERTIFICATE----- * -----BEGIN PRIVATE KEY----- * MEECAQAwEwYHKoZIzj0CAQYIKoZIzj0DAQcEJzAlAgEBBCA7ODT0xhGSNn4ESj6J * lu/GJQZoU9lDrCPeUcQ28tzOWw== * -----END PRIVATE KEY----- * ``` * * The string should contain exactly one certificate and one private key in [PKCS #8][rfc_5208] * format. It should not contain any other PEM-encoded blocks, but it may contain other text * which will be ignored. * * Encode a held certificate into this format by concatenating the results of * [certificatePem()][certificatePem] and [privateKeyPkcs8Pem()][privateKeyPkcs8Pem]. * * [rfc_7468]: https://tools.ietf.org/html/rfc7468 * [rfc_5208]: https://tools.ietf.org/html/rfc5208 */ @JvmStatic fun decode(certificateAndPrivateKeyPem: String): HeldCertificate { var certificatePem: String? = null var pkcs8Base64: String? = null for (match in PEM_REGEX.findAll(certificateAndPrivateKeyPem)) { when (val label = match.groups[1]!!.value) { "CERTIFICATE" -> { require(certificatePem == null) { "string includes multiple certificates" } certificatePem = match.groups[0]!!.value // Keep --BEGIN-- and --END-- for certificates. } "PRIVATE KEY" -> { require(pkcs8Base64 == null) { "string includes multiple private keys" } pkcs8Base64 = match.groups[2]!!.value // Include the contents only for PKCS8. } else -> { throw IllegalArgumentException("unexpected type: $label") } } } require(certificatePem != null) { "string does not include a certificate" } require(pkcs8Base64 != null) { "string does not include a private key" } return decode(certificatePem, pkcs8Base64) } private fun decode(certificatePem: String, pkcs8Base64Text: String): HeldCertificate { val certificate = certificatePem.decodeCertificatePem() val pkcs8Bytes = pkcs8Base64Text.decodeBase64() ?: throw IllegalArgumentException("failed to decode private key") // The private key doesn't tell us its type but it's okay because the certificate knows! val keyType = when (certificate.publicKey) { is ECPublicKey -> "EC" is RSAPublicKey -> "RSA" else -> throw IllegalArgumentException("unexpected key type: ${certificate.publicKey}") } val privateKey = decodePkcs8(pkcs8Bytes, keyType) val keyPair = KeyPair(certificate.publicKey, privateKey) return HeldCertificate(keyPair, certificate) } private fun decodePkcs8(data: ByteString, keyAlgorithm: String): PrivateKey { try { val keyFactory = KeyFactory.getInstance(keyAlgorithm) return keyFactory.generatePrivate(PKCS8EncodedKeySpec(data.toByteArray())) } catch (e: GeneralSecurityException) { throw IllegalArgumentException("failed to decode private key", e) } } } }
okhttp-tls/src/main/kotlin/okhttp3/tls/HeldCertificate.kt
1428044451
package org.datadozer.index import org.datadozer.SingleInstancePerThreadObjectPool import org.datadozer.models.Document import org.datadozer.models.FieldValue import org.datadozer.models.TransactionLogEntryType import org.datadozer.threadPoolExecutorProvider import org.junit.AfterClass import org.junit.jupiter.api.Assertions.assertEquals import org.junit.jupiter.api.Test import java.nio.file.Files import java.util.concurrent.Executors import java.util.concurrent.atomic.AtomicLong /* * Licensed to DataDozer under one or more contributor * license agreements. See the NOTICE file distributed with * this work for additional information regarding copyright * ownership. DataDozer licenses this file to you under * the Apache License, Version 2.0 (the "License"); you may * not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, * software distributed under the License is distributed on an * "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY * KIND, either express or implied. See the License for the * specific language governing permissions and limitations * under the License. */ class TransactionLogTests { private val settings = WriterSettings(syncFlush = true) private val threadPool = threadPoolExecutorProvider() private val path = Files.createTempDirectory(null) private val pool = SingleInstancePerThreadObjectPool({ TransactionWriter(path.toFile(), settings) }) private var transactionId = AtomicLong(1) @Test fun `Can read write transactions using multiple threads`() { val runnable = Runnable { val value = pool.borrowObject() val doc = Document.newBuilder() .setId(FieldValue.newBuilder().setStringValue("1")) .setIndexName("index1") .build() val txEntry = transactionLogEntryFactory(1, transactionId.getAndIncrement(), TransactionLogEntryType.DOC_DELETE, doc) value.appendEntry(txEntry, 1) pool.returnObject(value) } val tasks = List(999, { _ -> Executors.callable(runnable) }) val result = threadPool.invokeAll(tasks) for (res in result) { res.get() } val sut = TransactionReader(0L, path.toAbsolutePath().toString()) var txId = 1L for (t in sut.replayTransactionsByIndex(1)) { assertEquals(txId, t.modifyIndex) txId++ } // We started with x transactions so we should get back x transactions assertEquals(999, sut.totalTransactionsCount) } @Test fun `Can read back the data from a transaction`() { val path = Files.createTempDirectory(null) val sut = TransactionWriter(path.toFile(), settings) for (i in 1 until 100) { val doc = Document.newBuilder() .setId(FieldValue.newBuilder().setIntegerValue(i)) .setIndexName("index1") .build() val entry = transactionLogEntryFactory(1, i.toLong(), TransactionLogEntryType.DOC_DELETE, doc) sut.appendEntry(entry, 1) } // Let read all the data from the transactions var txId = 1L val tr = TransactionReader(1, path.toAbsolutePath().toString()) for (t in tr.replayTransactionsByIndex(1)) { val data = tr.getDataForEntry(t) assertEquals(txId, data.id.longValue) assertEquals("index1", data.indexName) txId++ } } @AfterClass fun cleanup() { Files.delete(path) } }
core/src/test/kotlin/org/datadozer/index/TransactionLogTests.kt
2897544495
package net.yested.core.utils /** * A list that can be operated upon to clarify what kinds of animations should happen when updating it in a UI. * @author Eric Pabst ([email protected]) * Date: 4/4/2017 * Time: 11:49 PM */ interface OperableList<T> { fun size(): Int fun get(index: Int): T fun add(index: Int, item: T) fun removeAt(index: Int): T fun move(fromIndex: Int, toIndex: Int) fun indexOf(item: T): Int { var index = size() - 1 while (index >= 0 && get(index) != item) { index-- } return index } fun contains(item: T): Boolean = indexOf(item) >= 0 } fun <T> OperableList<T>.toList(): List<T> = range().map { get(it) } fun <T> OperableList<T>.range() = (0..(size() - 1)) fun <T> OperableList<T>.reconcileTo(desiredList: List<T>) { // delete anything that isn't in desiredList range().reversed().forEach { if (!desiredList.contains(get(it))) removeAt(it) } val (desiredListWithoutNew, newItems) = desiredList.partition { contains(it) } var countMovingRight = 0 var countMovingLeft = 0 range().forEach { index -> val desiredIndex = desiredListWithoutNew.indexOf(get(index)) if (desiredIndex > index) { countMovingRight++ } else if (desiredIndex < index) { countMovingLeft++ } } val desiredIndices = if (countMovingLeft <= countMovingRight) { 0..(desiredListWithoutNew.size - 1) } else { (0..(desiredListWithoutNew.size - 1)).reversed() } desiredIndices.forEach { desiredIndex -> val desiredItem = desiredListWithoutNew[desiredIndex] val indexToMove = indexOf(desiredItem) if (indexToMove != desiredIndex) { move(indexToMove, desiredIndex) } } for (newItem in newItems) { add(desiredList.indexOf(newItem), newItem) } } open class InMemoryOperableList<T>(val list: MutableList<T>) : OperableList<T> { var modificationCount = 0 override fun size(): Int = list.size override fun get(index: Int): T = list[index] override fun add(index: Int, item: T) { modificationCount++ list.add(index, item) } override fun removeAt(index: Int): T { modificationCount++ return list.removeAt(index) } override fun move(fromIndex: Int, toIndex: Int) { modificationCount++ val item = list.removeAt(fromIndex) list.add(toIndex, item) } }
src/commonMain/kotlin/net/yested/core/utils/OperableList.kt
4138781274
/* * Copyright (C) 2016 - Niklas Baudy, Ruben Gees, Mario Đanić and contributors * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package com.vanniktech.emoji.twitter.category import com.vanniktech.emoji.EmojiCategory import com.vanniktech.emoji.twitter.TwitterEmoji internal class FlagsCategory : EmojiCategory { override val categoryNames: Map<String, String> get() = mapOf( "en" to "Flags", "de" to "Flaggen", ) override val emojis = ALL_EMOJIS private companion object { val ALL_EMOJIS: List<TwitterEmoji> = FlagsCategoryChunk0.EMOJIS + FlagsCategoryChunk1.EMOJIS + FlagsCategoryChunk2.EMOJIS } }
emoji-twitter/src/commonMain/kotlin/com/vanniktech/emoji/twitter/category/FlagsCategory.kt
2167574881
/** * Swaggy Jenkins * Jenkins API clients generated from Swagger / Open API specification * * The version of the OpenAPI document: 1.5.1-pre.0 * Contact: [email protected] * * NOTE: This class is auto generated by OpenAPI Generator (https://openapi-generator.tech). * https://openapi-generator.tech * Do not edit the class manually. */ package org.openapitools.server.api.model import org.openapitools.server.api.model.Link import com.google.gson.annotations.SerializedName import com.fasterxml.jackson.annotation.JsonIgnoreProperties import com.fasterxml.jackson.annotation.JsonInclude /** * * @param self * @param propertyClass */ @JsonInclude(JsonInclude.Include.NON_NULL) @JsonIgnoreProperties(ignoreUnknown = true) data class ExtensionClassContainerImpl1links ( val self: Link? = null, val propertyClass: kotlin.String? = null ) { }
clients/kotlin-vertx/generated/src/main/kotlin/org/openapitools/server/api/model/ExtensionClassContainerImpl1links.kt
2683688767
/** * Copyright 2021 Carl-Philipp Harmant * * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * * http://www.apache.org/licenses/LICENSE-2.0 * * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package fr.cph.chicago.rx import android.view.View import android.widget.ListView import android.widget.TextView import fr.cph.chicago.R import fr.cph.chicago.core.activity.map.BusMapActivity import fr.cph.chicago.core.adapter.BusMapSnippetAdapter import fr.cph.chicago.core.model.BusArrival import fr.cph.chicago.util.Util import io.reactivex.rxjava3.core.SingleObserver import io.reactivex.rxjava3.disposables.Disposable import org.apache.commons.lang3.StringUtils import timber.log.Timber import java.util.Date class BusFollowObserver(private val activity: BusMapActivity, private val layout: View, private val view: View, private val loadAll: Boolean) : SingleObserver<List<BusArrival>> { companion object { private val util = Util } override fun onSubscribe(d: Disposable) {} override fun onSuccess(busArrivalsParam: List<BusArrival>) { var busArrivals = busArrivalsParam.toMutableList() if (!loadAll && busArrivals.size > 7) { busArrivals = busArrivals.subList(0, 6) val busArrival = BusArrival(Date(), "added bus", view.context.getString(R.string.bus_all_results), 0, 0, StringUtils.EMPTY, StringUtils.EMPTY, StringUtils.EMPTY, Date(), false) busArrivals.add(busArrival) } val arrivals = view.findViewById<ListView>(R.id.arrivalsTextView) val error = view.findViewById<TextView>(R.id.error) if (busArrivals.isNotEmpty()) { val ada = BusMapSnippetAdapter(busArrivals) arrivals.adapter = ada arrivals.visibility = ListView.VISIBLE error.visibility = TextView.GONE } else { arrivals.visibility = ListView.GONE error.visibility = TextView.VISIBLE } activity.refreshInfoWindow() } override fun onError(throwable: Throwable) { util.handleConnectOrParserException(throwable, layout) Timber.e(throwable, "Error while loading bus follow") } }
android-app/src/googleplay/kotlin/fr/cph/chicago/rx/BusFollowObserver.kt
1366982162
package com.lasthopesoftware.bluewater.shared.resilience.GivenATwoSecondTwoTriggersTimedCountdownLatch import com.lasthopesoftware.bluewater.shared.resilience.TimedCountdownLatch import org.assertj.core.api.Assertions.assertThat import org.joda.time.Duration import org.junit.BeforeClass import org.junit.Test class WhenTriggeringTheLatch { companion object { private var isClosed = false @JvmStatic @BeforeClass fun setup() { val timedLatch = TimedCountdownLatch(2, Duration.standardSeconds(2)) isClosed = timedLatch.trigger() } } @Test fun thenTheLatchIsNotClosed() { assertThat(isClosed).isFalse } }
projectBlueWater/src/test/java/com/lasthopesoftware/bluewater/shared/resilience/GivenATwoSecondTwoTriggersTimedCountdownLatch/WhenTriggeringTheLatch.kt
2930078439
package net.pterodactylus.sone.text import net.pterodactylus.sone.data.Sone import net.pterodactylus.sone.test.* import org.hamcrest.MatcherAssert.assertThat import org.hamcrest.Matchers.equalTo import org.junit.Test /** * Unit test for [SonePart]. */ class SonePartTest { private val sone = mock<Sone>() init { whenever(sone.profile).thenReturn(mock()) whenever(sone.name).thenReturn("sone") } private val part = SonePart(sone) @Test fun textIsConstructedFromSonesNiceName() { assertThat<String>(part.text, equalTo<String>("sone")) } }
src/test/kotlin/net/pterodactylus/sone/text/SonePartTest.kt
33773260
/* * Copyright 2017 Thomas Volk * * Licensed to the Apache Software Foundation (ASF) under one * or more contributor license agreements. See the NOTICE file * distributed with this work for additional information * regarding copyright ownership. The ASF licenses this file * to you under the Apache License, Version 2.0 (the * "License"); you may not use this file except in compliance * with the License. You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, * software distributed under the License is distributed on an * "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY * KIND, either express or implied. See the License for the * specific language governing permissions and limitations * under the License. * */ package net.t53k.alkali import java.util.concurrent.* object PoisonPill object Terminated object Watch data class Forward(val message: Any) data class DeadLetter(val message: Any) internal class AskingActor(private val returnChannel: LinkedBlockingQueue<Any>, private val target: ActorReference, val message: Any): Actor() { override fun receive(message: Any) = returnChannel.put(message) override fun before() { target send message } } class AskTimeoutException(msg: String): RuntimeException(msg) internal class NameSpace(val name: String) { companion object { val system = NameSpace("_system") } fun name(actorName: String) = "$name/$actorName" fun hasNameSpace(actorName: String) = actorName.startsWith(name) } class ActorSystemBuilder { private var defaultActorHandler: ActorSystem.(Any) -> Unit = {} private var deadLetterHandler: (Any) -> Unit = {} fun onDefaultActorMessage(defaultActorHandler: ActorSystem.(Any) -> Unit): ActorSystemBuilder { this.defaultActorHandler = defaultActorHandler return this } fun onDeadLetterMessage(deadLetterHandler: (Any) -> Unit): ActorSystemBuilder { this.deadLetterHandler = deadLetterHandler return this } fun build(): ActorSystem = ActorSystem(defaultActorHandler, deadLetterHandler) } class ActorSystem(defaultActorHandler: ActorSystem.(Any) -> Unit = {}, deadLetterHandler: (Any) -> Unit = {}): ActorFactory { private class DefaultActor(val defaultActorHandler: ActorSystem.(Any) -> Unit): Actor() { override fun receive(message: Any) { defaultActorHandler(system(), message) } } private class DeadLetterActor(val deadLetterHandler: (Any) -> Unit): Actor() { override fun receive(message: Any) { deadLetterHandler((message as DeadLetter).message) } } private data class ActorWrapper(val reference: ActorReference, private val actor: Actor){ fun waitForShutdown() { actor.waitForShutdown() } } private val _actors = mutableMapOf<String, ActorWrapper>() private val _currentActor = ThreadLocal<ActorReference>() private var _active = true private var _deadLetterActor: ActorWrapper private val MAIN_ACTOR_NAME = NameSpace.system.name("main") private val DEAD_LETTER_ACTOR_NAME = NameSpace.system.name("deadLetter") private val WAIT_FOR_SHUTDOWN_INTERVALL = 10L init { currentActor(_actor(MAIN_ACTOR_NAME, DefaultActor(defaultActorHandler))) val deadLetterActor = DeadLetterActor(deadLetterHandler) _deadLetterActor = ActorWrapper(_start(DEAD_LETTER_ACTOR_NAME, deadLetterActor), deadLetterActor) } @Synchronized override fun <T> actor(name: String, actor: T): ActorReference where T : Actor { require(!NameSpace.system.hasNameSpace(name)) { "actor name can not start with '${NameSpace.system.name}' !" } return _actor(name, actor) } @Synchronized private fun <T> _actor(name: String, actor: T): ActorReference where T : Actor { require (!_actors.contains(name)) { "actor '$name' already exists" } val actorRef = _start(name, actor) _actors.put(name, ActorWrapper(actorRef, actor)) return actorRef } private fun <T> _start(name: String, actor: T): ActorReference where T : Actor { passIfActive() return actor.start(name, this) } @Synchronized internal fun <T> actor(actor: T): ActorReference where T : Actor { return _start(NameSpace.system.name("anonymous"), actor) } @Synchronized fun find(name: String): ActorReference? = _actors[name]?.reference internal fun ask(target: ActorReference, message: Any, timeout: Long): Any { val returnChannel = LinkedBlockingQueue<Any>() val askingActor = actor(AskingActor(returnChannel, target, message)) try { return returnChannel.poll(timeout, TimeUnit.MILLISECONDS) ?: throw AskTimeoutException("timeout $timeout ms reached!") } finally { askingActor send PoisonPill } } fun currentActor(): ActorReference = _currentActor.get() internal fun currentActor(actor: ActorReference) { _currentActor.set(actor) } fun waitForShutdown() { if(currentActor().name != MAIN_ACTOR_NAME) { throw IllegalStateException("an actor from the same system can not wait system shutdown")} while (isActive()) { Thread.sleep(WAIT_FOR_SHUTDOWN_INTERVALL) } _actors.forEach { it.value.waitForShutdown() } _deadLetterActor.waitForShutdown() } @Synchronized fun shutdown() { passIfActive() _actors.forEach { it.value.reference send PoisonPill } _deadLetterActor.reference send PoisonPill _active = false } private fun passIfActive() { if(!isActive()) { throw IllegalStateException("ActorSystem is not active!") } } fun isActive() = _active internal fun deadLetter(message: Any) { if(message !is DeadLetter) { _deadLetterActor.reference send DeadLetter(message) } } }
src/main/kotlin/net/t53k/alkali/ActorSystem.kt
2725643423
package furhatos.app.demo.flow import furhatos.app.demo.flow.modes.Parent import furhatos.flow.kotlin.Utterance import furhatos.flow.kotlin.furhat import furhatos.flow.kotlin.state import furhatos.flow.kotlin.utterance fun Return(bridge: Utterance = utterance { +"alright" }) = state(Parent) { onEntry { furhat.say(utterance = bridge) goto(Active(returning = true)) } }
demo-skill/src/main/kotlin/furhatos/app/demo/flow/transitions/return.kt
1747651272
package com.idapgroup.android.rx_mvp import android.os.Bundle import android.os.Handler import android.os.Looper import android.util.Log import com.idapgroup.android.mvp.impl.Action import com.idapgroup.android.mvp.impl.BasePresenter import io.reactivex.* import io.reactivex.Observable import io.reactivex.disposables.Disposable import io.reactivex.internal.functions.Functions import io.reactivex.subjects.CompletableSubject import java.util.* open class RxBasePresenter<V> : BasePresenter<V>() { // Optimization for safe subscribe private val ERROR_CONSUMER: (Throwable) -> Unit = { Functions.ERROR_CONSUMER.accept(it) } private val EMPTY_ACTION: Action = {} private val mainHandler = Handler(Looper.getMainLooper()) private val activeTasks = LinkedHashMap<String, Task>() private val resetTaskStateActionMap = LinkedHashMap<String, Action>() private var isSavedState = false private val onDetachViewActionList = mutableListOf<Action>() private val onSaveStateActionList = mutableListOf<Action>() inner class Task(val key: String) { private val subTaskList = ArrayList<Disposable>() private var subTaskCount = 0 private var cancelled = false private var completable = CompletableSubject.create() fun safeAddSubTask(subTask: Disposable) { runOnUiThread { addSubTask(subTask) } } private fun addSubTask(subTask: Disposable) { checkMainThread() subTaskList.add(subTask) ++subTaskCount if(cancelled) subTask.dispose() } fun removeSubTask() { checkMainThread() --subTaskCount if(subTaskCount == 0) { activeTasks.remove(key) completable.onComplete() } } fun cancel(): Completable { checkMainThread() val activeSubTaskList = subTaskList.filter { !it.isDisposed } val awaitState = await(activeSubTaskList) activeSubTaskList.forEach { it.dispose() } cancelled = true return awaitState } fun await(): Completable { val activeSubTaskList = subTaskList.filter { !it.isDisposed } return await(activeSubTaskList) } fun await(activeSubTaskList: List<Disposable>): Completable { return if(activeSubTaskList.isEmpty()) Completable.complete() else completable } } override fun onSaveState(savedState: Bundle) { super.onSaveState(savedState) onSaveStateActionList.forEach { it() } onSaveStateActionList.clear() savedState.putStringArrayList("task_keys", ArrayList(activeTasks.keys)) isSavedState = true } override fun onRestoreState(savedState: Bundle) { super.onRestoreState(savedState) // Reset tasks only if presenter was destroyed if(!isSavedState) { val taskKeyList = savedState.getStringArrayList("task_keys") taskKeyList.forEach { resetTaskState(it) } } isSavedState = false } override fun onDetachedView() { super.onDetachedView() onDetachViewActionList.forEach { it() } onDetachViewActionList.clear() } /** Preserves link for task by key while it's running */ protected fun <T> taskTracker(taskKey: String): ObservableTransformer<T, T> { return ObservableTransformer { it.taskTracker(taskKey) } } /** Preserves link for task by key while it's running */ protected fun <T> Observable<T>.taskTracker(taskKey: String): Observable<T> { val task = addTask(taskKey) return doFinally { task.removeSubTask() } .doOnSubscribe { disposable -> task.safeAddSubTask(disposable) } } /** Preserves link for task by key while it's running */ protected fun <T> singleTaskTracker(taskKey: String): SingleTransformer<T, T> { return SingleTransformer { it.taskTracker(taskKey) } } /** Preserves link for task by key while it's running */ protected fun <T> Single<T>.taskTracker(taskKey: String): Single<T> { val task = addTask(taskKey) return doFinally { task.removeSubTask() } .doOnSubscribe { disposable -> task.safeAddSubTask(disposable) } } /** Preserves link for task by key while it's running */ protected fun completableTaskTracker(taskKey: String): CompletableTransformer { return CompletableTransformer { it.taskTracker(taskKey) } } /** Preserves link for task by key while it's running */ protected fun Completable.taskTracker(taskKey: String): Completable { val task = addTask(taskKey) return doFinally { task.removeSubTask() } .doOnSubscribe { disposable -> task.safeAddSubTask(disposable) } } /** Preserves link for task by key while it's running */ protected fun <T> maybeTaskTracker(taskKey: String): MaybeTransformer<T, T> { return MaybeTransformer { it.taskTracker(taskKey) } } /** Preserves link for task by key while it's running */ protected fun <T> Maybe<T>.taskTracker(taskKey: String): Maybe<T> { val task = addTask(taskKey) return doFinally { task.removeSubTask() } .doOnSubscribe { disposable -> task.safeAddSubTask(disposable) } } private fun addTask(taskKey: String): Task { checkMainThread() if(activeTasks.containsKey(taskKey)) { throw IllegalStateException("'$taskKey' is already tracked") } val task = Task(taskKey) activeTasks[taskKey] = task return task } protected fun setResetTaskStateAction(key: String, resetAction: Action) { resetTaskStateActionMap.put(key, resetAction) } protected fun cancelTask(taskKey: String): Completable { checkMainThread() val task = activeTasks[taskKey] ?: return Completable.complete() activeTasks.remove(taskKey) val completable = task.cancel() resetTaskState(taskKey) return completable } protected fun awaitTask(taskKey: String): Completable { return activeTasks[taskKey]?.await() ?: return Completable.complete() } protected fun isTaskActive(taskKey: String): Boolean { checkMainThread() return activeTasks[taskKey] != null } /** Calls preliminarily set a reset task state action */ private fun resetTaskState(taskKey: String) { val resetTaskAction = resetTaskStateActionMap[taskKey] if (resetTaskAction == null) { Log.w(javaClass.simpleName, "Reset task action is not set for task key: " + taskKey) } else { execute(resetTaskAction) } } fun <T> Observable<T>.safeSubscribe( onNext: (T) -> Unit, onError: (Throwable) -> Unit = ERROR_CONSUMER, onComplete: Action = EMPTY_ACTION ): Disposable { return subscribe(safeOnItem(onNext), safeOnError(onError), safeOnComplete(onComplete)) } fun <T> Flowable<T>.safeSubscribe( onNext: (T) -> Unit, onError: (Throwable) -> Unit = ERROR_CONSUMER, onComplete: Action = EMPTY_ACTION ): Disposable { return subscribe(safeOnItem(onNext), safeOnError(onError), safeOnComplete(onComplete)) } fun <T> Single<T>.safeSubscribe( onSuccess: (T) -> Unit, onError: (Throwable) -> Unit = ERROR_CONSUMER ): Disposable { return subscribe(safeOnItem(onSuccess), safeOnError(onError)) } fun Completable.safeSubscribe( onComplete: Action, onError: (Throwable) -> Unit = ERROR_CONSUMER ): Disposable { return subscribe({ execute(onComplete) }, safeOnError(onError)) } fun <T> Maybe<T>.safeSubscribe( onSuccess: (T) -> Unit, onError: (Throwable) -> Unit = ERROR_CONSUMER, onComplete: Action = EMPTY_ACTION ): Disposable { return subscribe(safeOnItem(onSuccess), safeOnError(onError), safeOnComplete(onComplete)) } fun <T> safeOnItem(onItem: (T) -> Unit): (T) -> Unit { return { item -> execute { onItem(item) } } } fun safeOnComplete(onComplete: Action): () -> Unit { if(onComplete == EMPTY_ACTION) { return EMPTY_ACTION } else { return { execute(onComplete) } } } fun safeOnError(onError: (Throwable) -> Unit): (Throwable) -> Unit { if(onError == ERROR_CONSUMER) { return ERROR_CONSUMER } else { return { error: Throwable -> execute { onError(error) } } } } fun <T> Observable<T>.cancelOnDetachView(onSaveState: Boolean = false): Observable<T> { return doOnSubscribe { cancelOnDetachView(it, onSaveState) } } fun <T> Flowable<T>.cancelOnDetachView(onSaveState: Boolean = false): Flowable<T> { return doOnSubscribe { cancelOnDetachView(object : Disposable { override fun isDisposed() = throw RuntimeException("Unsupported") override fun dispose() = it.cancel() }, onSaveState) } } fun <T> Single<T>.cancelOnDetachView(onSaveState: Boolean = false): Single<T> { return doOnSubscribe { cancelOnDetachView(it, onSaveState) } } fun <T> Maybe<T>.cancelOnDetachView(onSaveState: Boolean = false): Maybe<T> { return doOnSubscribe { cancelOnDetachView(it, onSaveState) } } fun Completable.cancelOnDetachView(onSaveState: Boolean = false): Completable { return doOnSubscribe { cancelOnDetachView(it, onSaveState) } } private fun cancelOnDetachView(disposable: Disposable, onSaveState: Boolean) { runOnUiThread { if(view == null || (onSaveState && isSavedState)) { disposable.dispose() } else { if(onSaveState) { onSaveStateActionList.add({ disposable.dispose() }) } onDetachViewActionList.add({ disposable.dispose() }) } } } private fun checkMainThread(message: String = "Must be call after observeOn(AndroidSchedulers.mainThread())") { if(!isMainThread()) { throw IllegalStateException(message) } } private fun runOnUiThread(action: Action) { if(isMainThread()) { action() } else { mainHandler.post(action) } } private fun isMainThread() = Looper.myLooper() == Looper.getMainLooper() }
mvp-utils/src/main/java/com/idapgroup/android/rx_mvp/RxBasePresenter.kt
2525340355
package projects import configurations.FunctionalTest import configurations.PerformanceTestCoordinator import configurations.SanityCheck import configurations.buildReportTab import jetbrains.buildServer.configs.kotlin.v2018_2.AbsoluteId import jetbrains.buildServer.configs.kotlin.v2018_2.FailureAction import jetbrains.buildServer.configs.kotlin.v2018_2.IdOwner import jetbrains.buildServer.configs.kotlin.v2018_2.Project import model.BuildTypeBucket import model.CIBuildModel import model.SpecificBuild import model.Stage import model.TestType class StageProject(model: CIBuildModel, stage: Stage, containsDeferredTests: Boolean, rootProjectUuid: String) : Project({ this.uuid = "${model.projectPrefix}Stage_${stage.stageName.uuid}" this.id = AbsoluteId("${model.projectPrefix}Stage_${stage.stageName.id}") this.name = stage.stageName.stageName this.description = stage.stageName.description features { if (stage.specificBuilds.contains(SpecificBuild.SanityCheck)) { buildReportTab("API Compatibility Report", "report-distributions-binary-compatibility-report.html") buildReportTab("Incubating APIs Report", "incubation-reports/all-incubating.html") } if (!stage.performanceTests.isEmpty()) { buildReportTab("Performance", "report-performance-performance-tests.zip!report/index.html") } } val specificBuildTypes = stage.specificBuilds.map { it.create(model, stage) } specificBuildTypes.forEach { buildType(it) } stage.performanceTests.forEach { buildType(PerformanceTestCoordinator(model, it, stage)) } stage.functionalTests.forEach { testCoverage -> val isSoakTest = testCoverage.testType == TestType.soak if (isSoakTest) { buildType(FunctionalTest(model, testCoverage, stage = stage)) } else { val functionalTests = FunctionalTestProject(model, testCoverage, stage) subProject(functionalTests) if (stage.functionalTestsDependOnSpecificBuilds) { specificBuildTypes.forEach { specificBuildType -> functionalTests.addDependencyForAllBuildTypes(specificBuildType) } } if (!(stage.functionalTestsDependOnSpecificBuilds && stage.specificBuilds.contains(SpecificBuild.SanityCheck)) && stage.dependsOnSanityCheck) { functionalTests.addDependencyForAllBuildTypes(AbsoluteId(SanityCheck.buildTypeId(model))) } } } if (containsDeferredTests) { val deferredTestsProject = Project { uuid = "${rootProjectUuid}_deferred_tests" id = AbsoluteId(uuid) name = "Test coverage deferred from Quick Feedback and Ready for Merge" model.buildTypeBuckets .filter(BuildTypeBucket::containsSlowTests) .forEach { bucket -> FunctionalTestProject.missingTestCoverage .filter { testConfig -> bucket.hasTestsOf(testConfig.testType) } .forEach { testConfig -> bucket.forTestType(testConfig.testType).forEach { buildType(FunctionalTest(model, testConfig, it.getSubprojectNames(), stage, it.name)) } } } } subProject(deferredTestsProject) } }) private fun Project.addDependencyForAllBuildTypes(dependency: IdOwner) { buildTypes.forEach { functionalTestBuildType -> functionalTestBuildType.dependencies { dependency(dependency) { snapshot { onDependencyFailure = FailureAction.CANCEL onDependencyCancel = FailureAction.CANCEL } } } } }
.teamcity/Gradle_Check/projects/StageProject.kt
676342194
package jp.toastkid.yobidashi.main import androidx.fragment.app.FragmentManager import io.mockk.MockKAnnotations import io.mockk.Runs import io.mockk.every import io.mockk.impl.annotations.MockK import io.mockk.just import io.mockk.mockk import io.mockk.unmockkAll import io.mockk.verify import jp.toastkid.yobidashi.browser.BrowserFragment import jp.toastkid.yobidashi.browser.floating.FloatingPreview import jp.toastkid.yobidashi.browser.page_search.PageSearcherModule import jp.toastkid.yobidashi.menu.MenuViewModel import jp.toastkid.yobidashi.tab.TabAdapter import org.junit.After import org.junit.Before import org.junit.Test /** * @author toastkidjp */ class OnBackPressedUseCaseTest { private lateinit var onBackPressedUseCase: OnBackPressedUseCase @MockK private lateinit var tabListUseCase: TabListUseCase @MockK private lateinit var menuVisibility: () -> Boolean @MockK private lateinit var menuViewModel: MenuViewModel @MockK private lateinit var pageSearcherModule: PageSearcherModule @MockK private lateinit var floatingPreview: FloatingPreview @MockK private lateinit var tabs: TabAdapter @MockK private lateinit var onEmptyTabs: () -> Unit @MockK private lateinit var replaceToCurrentTab: TabReplacingUseCase @MockK private lateinit var supportFragmentManager: FragmentManager @Before fun setUp() { MockKAnnotations.init(this) onBackPressedUseCase = OnBackPressedUseCase( tabListUseCase, menuVisibility, menuViewModel, pageSearcherModule, { floatingPreview }, tabs, onEmptyTabs, replaceToCurrentTab, supportFragmentManager ) every { menuViewModel.close() }.just(Runs) } @Test fun testTabListUseCaseIsTrue() { every { tabListUseCase.onBackPressed() }.returns(true) every { menuVisibility.invoke() }.returns(true) onBackPressedUseCase.invoke() verify (exactly = 1) { tabListUseCase.onBackPressed() } verify (exactly = 0) { menuVisibility.invoke() } verify (exactly = 0) { menuViewModel.close() } } @Test fun testMenuIsVisible() { every { tabListUseCase.onBackPressed() }.returns(false) every { menuVisibility.invoke() }.returns(true) every { pageSearcherModule.isVisible() }.returns(false) onBackPressedUseCase.invoke() verify (exactly = 1) { tabListUseCase.onBackPressed() } verify (exactly = 1) { menuVisibility.invoke() } verify (exactly = 1) { menuViewModel.close() } verify (exactly = 0) { pageSearcherModule.isVisible() } } @Test fun testPageSearcherModuleIsVisible() { every { tabListUseCase.onBackPressed() }.returns(false) every { menuVisibility.invoke() }.returns(false) every { pageSearcherModule.isVisible() }.returns(true) every { pageSearcherModule.hide() }.just(Runs) every { floatingPreview.onBackPressed() }.answers { true } onBackPressedUseCase.invoke() verify (exactly = 1) { tabListUseCase.onBackPressed() } verify (exactly = 1) { menuVisibility.invoke() } verify (exactly = 0) { menuViewModel.close() } verify (exactly = 1) { pageSearcherModule.isVisible() } verify (exactly = 1) { pageSearcherModule.hide() } verify (exactly = 0) { floatingPreview.onBackPressed() } } @Test fun testFloatingPreviewIsVisible() { every { tabListUseCase.onBackPressed() }.returns(false) every { menuVisibility.invoke() }.returns(false) every { pageSearcherModule.isVisible() }.returns(false) every { pageSearcherModule.hide() }.just(Runs) every { floatingPreview.onBackPressed() }.answers { false } every { floatingPreview.hide() }.just(Runs) val fragment = mockk<BrowserFragment>() every { supportFragmentManager.findFragmentById(any()) }.answers { fragment } every { fragment.pressBack() }.returns(true) every { tabs.closeTab(any()) }.just(Runs) onBackPressedUseCase.invoke() verify (exactly = 1) { tabListUseCase.onBackPressed() } verify (exactly = 1) { menuVisibility.invoke() } verify (exactly = 0) { menuViewModel.close() } verify (exactly = 1) { pageSearcherModule.isVisible() } verify (exactly = 0) { pageSearcherModule.hide() } verify (exactly = 1) { floatingPreview.onBackPressed() } verify (exactly = 0) { floatingPreview.hide() } verify (exactly = 1) { supportFragmentManager.findFragmentById(any()) } verify (exactly = 1) { fragment.pressBack() } verify (exactly = 0) { tabs.closeTab(any()) } } @After fun tearDown() { unmockkAll() } }
app/src/test/java/jp/toastkid/yobidashi/main/OnBackPressedUseCaseTest.kt
2347232340
/* * Use of this source code is governed by the MIT license that can be * found in the LICENSE file. */ package org.rust.lang.core.psi.ext import org.rust.lang.core.psi.RsUseGroup import org.rust.lang.core.psi.RsUseSpeck val RsUseGroup.parentUseSpeck: RsUseSpeck get() = parent as RsUseSpeck
src/main/kotlin/org/rust/lang/core/psi/ext/RsUseGroup.kt
2575803188
package eu.kanade.tachiyomi.source.model import android.net.Uri import eu.kanade.tachiyomi.network.ProgressListener import rx.subjects.Subject import tachiyomi.source.model.PageUrl open class Page( val index: Int, val url: String = "", var imageUrl: String? = null, @Transient var uri: Uri? = null // Deprecated but can't be deleted due to extensions ) : ProgressListener { val number: Int get() = index + 1 @Transient @Volatile var status: Int = 0 set(value) { field = value statusSubject?.onNext(value) statusCallback?.invoke(this) } @Transient @Volatile var progress: Int = 0 set(value) { field = value statusCallback?.invoke(this) } @Transient private var statusSubject: Subject<Int, Int>? = null @Transient private var statusCallback: ((Page) -> Unit)? = null override fun update(bytesRead: Long, contentLength: Long, done: Boolean) { progress = if (contentLength > 0) { (100 * bytesRead / contentLength).toInt() } else { -1 } } fun setStatusSubject(subject: Subject<Int, Int>?) { this.statusSubject = subject } fun setStatusCallback(f: ((Page) -> Unit)?) { statusCallback = f } companion object { const val QUEUE = 0 const val LOAD_PAGE = 1 const val DOWNLOAD_IMAGE = 2 const val READY = 3 const val ERROR = 4 } } fun Page.toPageUrl(): PageUrl { return PageUrl( url = this.imageUrl ?: this.url ) } fun PageUrl.toPage(index: Int): Page { return Page( index = index, imageUrl = this.url ) }
app/src/main/java/eu/kanade/tachiyomi/source/model/Page.kt
308125051
//@file:Suppress("unused") // //package net.xpece.android.app // //import android.content.Context //import android.support.annotation.RequiresApi //import java.lang.ref.WeakReference //import java.util.* //import kotlin.reflect.KProperty // //private val systemServiceDelegates = object : // ThreadLocal<WeakHashMap<Context, SystemServiceDelegate>>() { // override fun initialValue() = WeakHashMap<Context, SystemServiceDelegate>() //} // //val Context.systemServiceDelegate: SystemServiceDelegate // get() { // val delegates = systemServiceDelegates.get() // var delegate = delegates[this] // if (delegate == null) { // delegate = SystemServiceDelegate(this) // delegates[this] = delegate // } // return delegate // } // //class SystemServiceDelegate internal constructor(context: Context) { // private val contextRef = WeakReference(context) // val context = contextRef.get()!! // // @RequiresApi(23) // inline operator fun <reified S> getValue(thisRef: Any?, property: KProperty<*>): S { // return context.getSystemServiceOrThrow() // } //}
commons-services/src/main/java/net/xpece/android/app/SystemServiceDelegates.kt
4073293237
package verseczi.intervaltimer import android.app.Activity import android.app.AlertDialog import android.content.* import android.content.pm.ApplicationInfo import android.content.pm.PackageManager import android.graphics.Color import android.graphics.PorterDuff import android.graphics.drawable.Drawable import android.os.Bundle import android.os.IBinder import android.support.v7.app.AppCompatActivity import android.support.v7.widget.Toolbar import android.text.SpannableStringBuilder import android.view.MotionEvent import android.view.View import android.view.View.OnClickListener import android.widget.* import java.util.concurrent.TimeUnit import android.text.Editable import android.text.TextWatcher import android.view.inputmethod.InputMethodManager import android.widget.EditText import android.widget.CompoundButton import android.widget.CompoundButton.OnCheckedChangeListener import verseczi.intervaltimer.backgroundTask.appChooser import verseczi.intervaltimer.backgroundTask.rootAccess import verseczi.intervaltimer.data.Database import verseczi.intervaltimer.helpers.bindView class Main : AppCompatActivity() { // Views // @content_main_timelapse_calc.xml private val etImgQty: EditText by bindView(R.id.etIMG_NUM) private val etFPS: EditText by bindView(R.id.etFPS) private val etInterval: EditText by bindView(R.id.etInterval) // @content_main_infocard private val tvImgQty: TextView by bindView(R.id.tvImg_num) private val tvClipLength: TextView by bindView(R.id.tvCliplength) private val tvDuration: TextView by bindView(R.id.tvDuration) // @content_main_coordinate private val tvCoordX: TextView by bindView(R.id.tv_CoordX) private val tvCoordY: TextView by bindView(R.id.tv_CoordY) // @content_main_delay private val etDelay: EditText by bindView(R.id.etDelay) private val swDelay: Switch by bindView(R.id.delayed_switch) // @content_main_repeat private val swEndlessrepeat: Switch by bindView(R.id.endless_switch) // @content_main_app_chooser private val ivAppIcon: ImageView by bindView(R.id.app_icon_n) private val tvAppName: TextView by bindView(R.id.app_name_n) private val tvAppPackageName: TextView by bindView(R.id.package_name_n) // Buttons private val bnStart: Button by bindView(R.id.start_button) private val bnCoordinates: Button by bindView(R.id.getcoordinates) private val bnChooseApp: Button by bindView(R.id.choose_app) private val bnDelayMinus: Button by bindView(R.id.delay_minus) private val bnDelayPlus: Button by bindView(R.id.delay_plus) // Text of the views var _ImgQty: Int get() = etImgQty.text.toString().toInt() set(value) { etImgQty.text = SpannableStringBuilder("$value") } var _Interval: Int get() = etInterval.text.toString().toInt() set(value) { etInterval.text = SpannableStringBuilder("$value") } var _FPS: Int get() = etFPS.text.toString().toInt() set(value) { etFPS.text = SpannableStringBuilder("$value") } var _tvImgQty: Int get() = tvImgQty.text.toString().toInt() set(value) { tvImgQty.text = value.toString() } var _ClipLength: Int get() { val durationRegex = tvClipLength.text.toString().split(":".toRegex()) return durationRegex[0].toInt() * 3600 + durationRegex[1].toInt() * 60 + durationRegex[2].toInt() } set(value) { tvClipLength.text = formatTime(value) } var _Duration: Int get() { val durationRegex = tvDuration.text.toString().split(":".toRegex()) return durationRegex[0].toInt() * 3600 + durationRegex[1].toInt() * 60 + durationRegex[2].toInt() } set(value) { tvDuration.text = formatTime(value) } var _coordX: Int get() = tvCoordX.text.toString().toInt() set(value) { tvCoordX.text = SpannableStringBuilder("$value") } var _coordY: Int get() = tvCoordY.text.toString().toInt() set(value) { tvCoordY.text = SpannableStringBuilder("$value") } var _delay: Int get() = etDelay.text.toString().toInt() set(value) { etDelay.text = SpannableStringBuilder("$value") } var _delayed: Boolean get() = swDelay.isChecked set(value) { swDelay.isChecked = value } var _endlessRepeat: Boolean get() = swEndlessrepeat.isChecked set(value) { swEndlessrepeat.isChecked = value } var _appIcon: Drawable get() = ivAppIcon.drawable set(value) { ivAppIcon.setImageDrawable(value) } var _appName: String get() = tvAppName.text.toString() set(value) { tvAppName.text = value } var _appPackageName: String get() = tvAppPackageName.text.toString() set(value) { tvAppPackageName.text = value } // Database private lateinit var db: Database // PackageManager private lateinit var pm:PackageManager // Context @Main private lateinit var mContext: Context private lateinit var _intentService: Intent private var _clickingService: clickingService? = null private var isCancelled: Boolean = false private var currentProgressstate: Int = 0 override fun onCreate(savedInstanceState: Bundle?) { super.onCreate(savedInstanceState) setContentView(R.layout.activity_main) setSupportActionBar(findViewById(R.id.toolbar) as Toolbar) db = Database(this) pm = packageManager mContext = this // Init _ImgQty = db.imgQty _Interval = db.interval _coordX = db.coordinateX _coordY = db.coordinateY _delay = db.delay _delayed = db.delayed if(!db.delayed) { _delay = 0 etDelay.isEnabled = false bnDelayMinus.isEnabled = false bnDelayPlus.isEnabled = false bnDelayMinus.background.setColorFilter(Color.GRAY, PorterDuff.Mode.MULTIPLY) bnDelayPlus.background.setColorFilter(Color.GRAY, PorterDuff.Mode.MULTIPLY) } _tvImgQty = db.imgQty _FPS = db.FPS _ClipLength = db.imgQty / db.FPS _Duration = db.interval * db.imgQty _endlessRepeat = db.endlessRepeat try { val appinfo: ApplicationInfo = pm.getApplicationInfo(db.packageName, 0) _appIcon = pm.getApplicationIcon(appinfo) _appName = pm.getApplicationLabel(appinfo).toString() _appPackageName = db.packageName } catch (e: PackageManager.NameNotFoundException) { // :( } val clickListener: OnClickListener = OnClickListener { v -> when (v.id) { R.id.start_button -> startClickingService() R.id.getcoordinates -> { val intent = Intent(mContext, GetCoordinates::class.java) startActivityForResult(intent, 1) } R.id.choose_app -> appChooser(this@Main, ivAppIcon, tvAppName, tvAppPackageName).execute() } } class GenericTextWatcher(val view: View) : TextWatcher { override fun beforeTextChanged(charSequence: CharSequence, i: Int, i1: Int, i2: Int) {} override fun onTextChanged(charSequence: CharSequence, i: Int, i1: Int, i2: Int) {} override fun afterTextChanged(editable: Editable) { when (view) { etImgQty -> { if (etImgQty.text.toString() == "") _ImgQty = 0 db.imgQty = _ImgQty updateInfoBox(db.imgQty, db.FPS, db.interval) } etFPS -> { if (etFPS.text.toString() == "") _FPS = 0 db.FPS = _FPS updateInfoBox(db.imgQty, db.FPS, db.interval) } etInterval -> { if (etInterval.text.toString() == "") _Interval = 0 db.interval = _Interval updateInfoBox(db.imgQty, db.FPS, db.interval) } etDelay -> { if (etDelay.text.toString() == "") _delay = 0 if(_delay == 0) { _delayed = false db.delayed = false db.delay = 0 } else db.delay = _delay } } } } class isCheckedListener(val view: View) : OnCheckedChangeListener { override fun onCheckedChanged(buttonView: CompoundButton?, isChecked: Boolean) { when (view) { swDelay -> { if (isChecked) { db.delayed = true if(_delay == 0) db.delay = db.defaultValue(db._DELAY) as Int _delay = db.delay etDelay.isEnabled = true bnDelayMinus.isEnabled = true bnDelayPlus.isEnabled = true bnDelayMinus.background.clearColorFilter() bnDelayPlus.background.clearColorFilter() } else { db.delayed = false _delay = 0 etDelay.isEnabled = false bnDelayMinus.isEnabled = false bnDelayPlus.isEnabled = false bnDelayMinus.background.setColorFilter(Color.GRAY, PorterDuff.Mode.MULTIPLY) bnDelayPlus.background.setColorFilter(Color.GRAY, PorterDuff.Mode.MULTIPLY) } } } } } etImgQty.addTextChangedListener(GenericTextWatcher(etImgQty)) etFPS.addTextChangedListener(GenericTextWatcher(etFPS)) etInterval.addTextChangedListener(GenericTextWatcher(etInterval)) etDelay.addTextChangedListener(GenericTextWatcher(etDelay)) swDelay.setOnCheckedChangeListener(isCheckedListener(swDelay)) swEndlessrepeat.setOnCheckedChangeListener(isCheckedListener(swEndlessrepeat)) bnStart.setOnClickListener(clickListener) bnCoordinates.setOnClickListener(clickListener) bnChooseApp.setOnClickListener(clickListener) _intentService = Intent(this@Main, clickingService::class.java) bindService(_intentService, mConnection, 0) if (savedInstanceState == null) { val extras = intent.extras if (extras == null) { isCancelled = false } else { isCancelled = extras.getBoolean("cancelled") } } else { isCancelled = savedInstanceState.getSerializable("cancalled") as Boolean } } override fun dispatchTouchEvent(ev: MotionEvent): Boolean { val v: View = currentFocus if ((ev.action == MotionEvent.ACTION_UP || ev.action == MotionEvent.ACTION_MOVE) && v is EditText && !v.javaClass.name.startsWith("android.webkit.")) { val scrcoords: IntArray = IntArray(2) v.getLocationOnScreen(scrcoords) val x: Float = ev.rawX + v.getLeft() - scrcoords[0] val y: Float = ev.rawY + v.getTop() - scrcoords[1] if (x < v.getLeft() || x > v.getRight() || y < v.getTop() || y > v.getBottom()) { v.clearFocus() hideKeyboard((this)) } } return super.dispatchTouchEvent(ev) } fun hideKeyboard(activity: Activity) { if (activity.window != null && activity.window.decorView != null) { val imm: InputMethodManager = activity.getSystemService(Context.INPUT_METHOD_SERVICE) as InputMethodManager imm.hideSoftInputFromWindow(activity.window.decorView.windowToken, 0) } } val mConnection: ServiceConnection = object : ServiceConnection { override fun onServiceDisconnected(name: ComponentName) { _clickingService = null } override fun onServiceConnected(name: ComponentName, service: IBinder) { val mLocalBinder = service as clickingService.LocalBinder _clickingService = mLocalBinder.getServerInstance() if(!isCancelled) _clickingService?.startClicking() if (isCancelled) { db.cancelled = false isCancelled = false currentProgressstate = _clickingService?.getProgress() as Int _clickingService?.stopClicking() val builder = AlertDialog.Builder(mContext) builder.setTitle("Result") builder.setMessage("Progress: " + currentProgressstate + " / " + db.imgQty + "\n " + "Do you want to continue?") builder.setPositiveButton("Yes") { dialog, id -> _clickingService?.resumeClicking() startChoosedApp() } builder.setNegativeButton("No") { dialog, id -> _clickingService?.stopService() dialog.cancel() } builder.setOnCancelListener { _clickingService?.stopService() } val dialog = builder.create() dialog.show() } } } val receiver = object : BroadcastReceiver() { override fun onReceive(context: Context, intent: Intent) { context.unregisterReceiver(this) val access = intent.getBooleanExtra("accessGranted", false) if (access) { if(isCancelled) startClickingService(db.imgQty - currentProgressstate, false, true) else startClickingService(db.imgQty, db.delayed, true) } else { rootDenied() } } } fun rootDenied() { val builder = AlertDialog.Builder(mContext) builder.setTitle("Root access denied!") builder.setMessage("You need to have root access for your device!") builder.setPositiveButton("Ok") { dialog, id -> dialog.cancel() } builder.create().show() } fun didntChooseApp() { val builder = AlertDialog.Builder(mContext) builder.setTitle("Wrong settings!") builder.setMessage("You didn't choose any app!") builder.setPositiveButton("Ok") { dialog, id -> dialog.cancel() } builder.create().show() } override fun onActivityResult(requestCode: Int, resultCode: Int, data: Intent) { if (requestCode == 1) { if (resultCode == 1) { db.coordinateX = data.getIntExtra("coordx", 0) db.coordinateY = data.getIntExtra("coordy", 0) tvCoordX.text = Integer.toString(db.coordinateX) tvCoordY.text = Integer.toString(db.coordinateY) } } }//onActivityResult fun startClickingService(_imqty: Int = db.imgQty, delayed: Boolean = db.delayed, rootGranted: Boolean = false) { if(pm.getLaunchIntentForPackage(db.packageName) != null) { // Getting root access if (!rootGranted) { val rootaccess = rootAccess(this@Main) val filtera = IntentFilter() filtera.addAction(rootaccess.rootaccess) registerReceiver(receiver, filtera) rootaccess.execute() } // Start and bind service if we have root access if (rootGranted) { bindService(_intentService, mConnection, 0) _intentService.putExtra("imgqty", _imqty) _intentService.putExtra("delayed", delayed) startService(_intentService) startChoosedApp() } } else didntChooseApp() } fun startChoosedApp () { try { pm = packageManager var LaunchIntent: Intent = pm.getLaunchIntentForPackage(db.packageName) startActivity( LaunchIntent ) } catch (e: PackageManager.NameNotFoundException) { e.printStackTrace() } } fun updateInfoBox(imgQty: Int, fps: Int, interval: Int) { _tvImgQty = imgQty _ClipLength = imgQty / fps _Duration = interval * imgQty } fun formatTime(value: Int): String { val durationS = value.toLong() return String.format("%02d:%02d:%02d", TimeUnit.SECONDS.toHours(durationS), TimeUnit.SECONDS.toMinutes(durationS) - TimeUnit.HOURS.toMinutes(TimeUnit.SECONDS.toHours(durationS)), durationS - TimeUnit.MINUTES.toSeconds(TimeUnit.SECONDS.toMinutes(durationS))) } fun increaseInteger(view: View) { var tv: TextView = findViewById(view.labelFor) as TextView tv.text = (tv.text.toString().toInt() + 1).toString() } fun decreaseInteger(view: View) { var tv: TextView = findViewById(view.labelFor) as TextView tv.text = (tv.text.toString().toInt() - 1).toString() } }
app/src/main/java/verseczi/intervaltimer/Main.kt
2518671295
package org.jetbrains.dokka.gradle import org.jetbrains.dokka.DokkaException import java.io.File /** * @see DokkaMultiModuleFileLayout.targetChildOutputDirectory * @see NoCopy * @see CompactInParent */ fun interface DokkaMultiModuleFileLayout { /** * @param parent: The [DokkaMultiModuleTask] that is initiating a composite documentation run * @param child: Some child task registered in [parent] * @return The target output directory of the [child] dokka task referenced by [parent]. This should * be unique for all registered child tasks. */ fun targetChildOutputDirectory(parent: DokkaMultiModuleTask, child: AbstractDokkaTask): File /** * Will link to the original [AbstractDokkaTask.outputDirectory]. This requires no copying of the output files. */ object NoCopy : DokkaMultiModuleFileLayout { override fun targetChildOutputDirectory(parent: DokkaMultiModuleTask, child: AbstractDokkaTask): File = child.outputDirectory.getSafe() } /** * Will point to a subfolder inside the output directory of the parent. * The subfolder will follow the structure of the gradle project structure * e.g. * :parentProject:firstAncestor:secondAncestor will be be resolved to * {parent output directory}/firstAncestor/secondAncestor */ object CompactInParent : DokkaMultiModuleFileLayout { override fun targetChildOutputDirectory(parent: DokkaMultiModuleTask, child: AbstractDokkaTask): File { val relativeProjectPath = parent.project.relativeProjectPath(child.project.path) val relativeFilePath = relativeProjectPath.replace(":", File.separator) check(!File(relativeFilePath).isAbsolute) { "Unexpected absolute path $relativeFilePath" } return parent.outputDirectory.getSafe().resolve(relativeFilePath) } } } internal fun DokkaMultiModuleTask.targetChildOutputDirectory( child: AbstractDokkaTask ): File = fileLayout.get().targetChildOutputDirectory(this, child) internal fun DokkaMultiModuleTask.copyChildOutputDirectories() { childDokkaTasks.forEach { child -> this.copyChildOutputDirectory(child) } } internal fun DokkaMultiModuleTask.copyChildOutputDirectory(child: AbstractDokkaTask) { val targetChildOutputDirectory = project.file(fileLayout.get().targetChildOutputDirectory(this, child)) val sourceChildOutputDirectory = child.outputDirectory.getSafe() /* Pointing to the same directory -> No copy necessary */ if (sourceChildOutputDirectory.absoluteFile == targetChildOutputDirectory.absoluteFile) { return } /* Cannot target *inside* the original folder */ if (targetChildOutputDirectory.absoluteFile.startsWith(sourceChildOutputDirectory.absoluteFile)) { throw DokkaException( "Cannot re-locate output directory into itself.\n" + "sourceChildOutputDirectory=${sourceChildOutputDirectory.path}\n" + "targetChildOutputDirectory=${targetChildOutputDirectory.path}" ) } /* Source output directory is empty -> No copy necessary */ if (!sourceChildOutputDirectory.exists()) { return } sourceChildOutputDirectory.copyRecursively(targetChildOutputDirectory, overwrite = true) }
runners/gradle-plugin/src/main/kotlin/org/jetbrains/dokka/gradle/DokkaMultiModuleFileLayout.kt
3414043838
/* * Copyright 2017 Netflix, Inc. * * Licensed under the Apache License, Version 2.0 (the "License") * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package com.netflix.spinnaker.config import com.fasterxml.jackson.databind.DeserializationFeature import com.fasterxml.jackson.databind.ObjectMapper import com.fasterxml.jackson.module.kotlin.KotlinModule import com.netflix.spinnaker.q.metrics.EventPublisher import com.netflix.spinnaker.q.migration.SerializationMigrator import com.netflix.spinnaker.q.redis.RedisClusterDeadMessageHandler import com.netflix.spinnaker.q.redis.RedisClusterQueue import com.netflix.spinnaker.q.redis.RedisDeadMessageHandler import com.netflix.spinnaker.q.redis.RedisQueue import java.net.URI import java.time.Clock import java.time.Duration import java.util.Optional import org.apache.commons.pool2.impl.GenericObjectPoolConfig import org.springframework.beans.factory.annotation.Qualifier import org.springframework.beans.factory.annotation.Value import org.springframework.boot.autoconfigure.condition.ConditionalOnMissingBean import org.springframework.boot.autoconfigure.condition.ConditionalOnProperty import org.springframework.boot.context.properties.EnableConfigurationProperties import org.springframework.context.annotation.Bean import org.springframework.context.annotation.Configuration import redis.clients.jedis.HostAndPort import redis.clients.jedis.Jedis import redis.clients.jedis.JedisCluster import redis.clients.jedis.JedisPool import redis.clients.jedis.Protocol import redis.clients.jedis.util.Pool @Configuration @EnableConfigurationProperties(RedisQueueProperties::class) @ConditionalOnProperty( value = ["keiko.queue.redis.enabled"], havingValue = "true", matchIfMissing = true ) class RedisQueueConfiguration { @Bean @ConditionalOnMissingBean(GenericObjectPoolConfig::class) fun redisPoolConfig() = GenericObjectPoolConfig<Any>().apply { blockWhenExhausted = false maxWaitMillis = 2000 } @Bean @ConditionalOnMissingBean(name = ["queueRedisPool"]) @ConditionalOnProperty( value = ["redis.cluster-enabled"], havingValue = "false", matchIfMissing = true ) fun queueRedisPool( @Value("\${redis.connection:redis://localhost:6379}") connection: String, @Value("\${redis.timeout:2000}") timeout: Int, redisPoolConfig: GenericObjectPoolConfig<Any> ) = URI.create(connection).let { cx -> val port = if (cx.port == -1) Protocol.DEFAULT_PORT else cx.port val db = if (cx.path.isNullOrEmpty()) { Protocol.DEFAULT_DATABASE } else { cx.path.substringAfter("/").toInt() } val password = cx.userInfo?.substringAfter(":") JedisPool(redisPoolConfig, cx.host, port, timeout, password, db) } @Bean @ConditionalOnMissingBean(name = ["queue"]) @ConditionalOnProperty( value = ["redis.cluster-enabled"], havingValue = "false", matchIfMissing = true ) fun queue( @Qualifier("queueRedisPool") redisPool: Pool<Jedis>, redisQueueProperties: RedisQueueProperties, clock: Clock, deadMessageHandler: RedisDeadMessageHandler, publisher: EventPublisher, redisQueueObjectMapper: ObjectMapper, serializationMigrator: Optional<SerializationMigrator> ) = RedisQueue( queueName = redisQueueProperties.queueName, pool = redisPool, clock = clock, mapper = redisQueueObjectMapper, deadMessageHandlers = listOf(deadMessageHandler), publisher = publisher, ackTimeout = Duration.ofSeconds(redisQueueProperties.ackTimeoutSeconds.toLong()), serializationMigrator = serializationMigrator ) @Bean @ConditionalOnMissingBean(name = ["redisDeadMessageHandler"]) @ConditionalOnProperty( value = ["redis.cluster-enabled"], havingValue = "false", matchIfMissing = true ) fun redisDeadMessageHandler( @Qualifier("queueRedisPool") redisPool: Pool<Jedis>, redisQueueProperties: RedisQueueProperties, clock: Clock ) = RedisDeadMessageHandler( deadLetterQueueName = redisQueueProperties.deadLetterQueueName, pool = redisPool, clock = clock ) @Bean @ConditionalOnMissingBean(name = ["queueRedisCluster"]) @ConditionalOnProperty(value = ["redis.cluster-enabled"]) fun queueRedisCluster( @Value("\${redis.connection:redis://localhost:6379}") connection: String, @Value("\${redis.timeout:2000}") timeout: Int, @Value("\${redis.maxattempts:4}") maxAttempts: Int, redisPoolConfig: GenericObjectPoolConfig<Any> ): JedisCluster { URI.create(connection).let { cx -> val port = if (cx.port == -1) Protocol.DEFAULT_PORT else cx.port val password = cx.userInfo?.substringAfter(":") return JedisCluster( HostAndPort(cx.host, port), timeout, timeout, maxAttempts, password, redisPoolConfig ) } } @Bean @ConditionalOnMissingBean(name = ["queue", "clusterQueue"]) @ConditionalOnProperty(value = ["redis.cluster-enabled"]) fun clusterQueue( @Qualifier("queueRedisCluster") cluster: JedisCluster, redisQueueProperties: RedisQueueProperties, clock: Clock, deadMessageHandler: RedisClusterDeadMessageHandler, publisher: EventPublisher, redisQueueObjectMapper: ObjectMapper, serializationMigrator: Optional<SerializationMigrator> ) = RedisClusterQueue( queueName = redisQueueProperties.queueName, jedisCluster = cluster, clock = clock, mapper = redisQueueObjectMapper, deadMessageHandlers = listOf(deadMessageHandler), publisher = publisher, ackTimeout = Duration.ofSeconds(redisQueueProperties.ackTimeoutSeconds.toLong()), serializationMigrator = serializationMigrator ) @Bean @ConditionalOnMissingBean(name = ["redisClusterDeadMessageHandler"]) @ConditionalOnProperty(value = ["redis.cluster-enabled"]) fun redisClusterDeadMessageHandler( @Qualifier("queueRedisCluster") cluster: JedisCluster, redisQueueProperties: RedisQueueProperties, clock: Clock ) = RedisClusterDeadMessageHandler( deadLetterQueueName = redisQueueProperties.deadLetterQueueName, jedisCluster = cluster, clock = clock ) @Bean @ConditionalOnMissingBean fun redisQueueObjectMapper(properties: Optional<ObjectMapperSubtypeProperties>): ObjectMapper = ObjectMapper().apply { registerModule(KotlinModule()) disable(DeserializationFeature.FAIL_ON_UNKNOWN_PROPERTIES) SpringObjectMapperConfigurer( properties.orElse(ObjectMapperSubtypeProperties()) ).registerSubtypes(this) } }
keiko-redis-spring/src/main/kotlin/com/netflix/spinnaker/config/RedisQueueConfiguration.kt
2730905012
package common.view import android.view.View import android.widget.FrameLayout import common.robolectric import org.assertj.core.api.Assertions.assertThat import org.junit.Test import org.junit.runner.RunWith import org.robolectric.RobolectricTestRunner @RunWith(RobolectricTestRunner::class) class RecyclerViewTest { @Test fun testClicks() { var clicks = 0 val v = View(robolectric) val a = RecyclerViewAdapter({ 1 }, { 1 }, { p, type -> v }, { vh, pos -> }, { clicks++ }) a.onCreateViewHolder(FrameLayout(robolectric), 1) v.performClick() assertThat(clicks).isEqualTo(1) v.performClick() v.performClick() assertThat(clicks).isEqualTo(3) } @Test fun testBinds() { var binds = 0 val a = RecyclerViewAdapter({ 1 }, { 1 }, { p, type -> View(robolectric) }, { vh, pos -> binds++ }, { }) val vh = a.onCreateViewHolder(FrameLayout(robolectric), 1) a.onBindViewHolder(vh, 1) assertThat(binds).isEqualTo(1) a.onBindViewHolder(vh, 2) a.onBindViewHolder(vh, 3) assertThat(binds).isEqualTo(3) } @Test fun testInflates() { } }
app/src/test/kotlin/common/view/RecyclerViewTest.kt
3572457902
/* * Copyright 2020 Google LLC * Copyright 2010-2020 JetBrains s.r.o. and Kotlin Programming Language contributors. * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ // TEST PROCESSOR: ResolveJavaTypeProcessor // EXPECTED: // C<*kotlin.Any?> // C.<init>.X? // C<*kotlin.Any?> // kotlin.Int // kotlin.String? // kotlin.collections.MutableSet<*kotlin.Any?>? // kotlin.Unit // kotlin.IntArray? // C.T? // C.PFun.P? // kotlin.collections.MutableList<out kotlin.collections.MutableSet<kotlin.Double?>?>? // kotlin.collections.MutableList<in kotlin.collections.MutableList<out kotlin.Double?>?>? // Bar? // kotlin.Array<Bar?>? // Foo<Base.T?, Base.Inner.P?>? // Bar<Base.Inner.P?, Base.T?>? // kotlin.collections.MutableList<Base.T?>? // kotlin.Unit // Base.T? // kotlin.Unit // kotlin.Array<Base.T?>? // kotlin.Unit // kotlin.Array<Base.T?>? // kotlin.Unit // kotlin.collections.MutableList<Base.T?>? // kotlin.Unit // Base.T? // kotlin.Unit // kotlin.Array<Base.T?>? // kotlin.Unit // kotlin.Array<Base.T?>? // kotlin.Unit // Base<Another.T?, Another.T?>? // kotlin.Int // kotlin.Int // JavaEnum // kotlin.Unit // kotlin.Array<JavaEnum?>? // kotlin.String? // JavaEnum? // END // FILE: a.kt annotation class Test @Test class Foo<P>: C<P>() { } class Bar // FILE: C.java import java.util.List; import java.util.Set; public class C<T> { public C() {} // to reproduce the case where type reference is owned by a constructor public <X> C(X x) {} public int intFun() {} public String strFun() {} public void wildcardParam(Set<?> param1) {} public int[] intArrayFun() {} public T TFoo() {} public <P> P PFun() {} public List<? extends Set<Double>> extendsSetFun() {} public List<? super List<? extends Double>> extendsListTFun() {} public Bar BarFun() {} public Bar[] BarArryFun() {} } // FILE: Base.java import java.util.List; class Foo<T1,T2> {} class Bar<T1, T2> {} class Base<T,P> { void genericT(List<T> t){}; void singleT(T t){}; void varargT(T... t){}; void arrayT(T[] t){}; class Inner<P> { void genericT(List<T> t){}; void singleT(T t){}; void varargT(T... t){}; void arrayT(T[] t){}; Foo<T, P> foo; Bar<P, T> bar; } } class Another<T> { Base<T, T> base; } public enum JavaEnum { VAL1(1), VAL2(2); private int x; JavaEnum(int x) { this.x = x; } void enumMethod() {} }
test-utils/testData/api/resolveJavaType.kt
3684854275
package com.automation.remarks.kirk import org.aeonbits.owner.Config import org.aeonbits.owner.Config.* import java.io.File /** * Created by sergey on 25.06.17. */ @Sources("classpath:kirk.properties") interface Configuration : Config { @Key("kirk.browser") @DefaultValue("chrome") fun browserName(): String @Key("kirk.timeout") @DefaultValue("4000") fun timeout(): Int @Key("kirk.poolingInterval") @DefaultValue("0.1") fun poolingInterval(): Double @Key("kirk.autoClose") @DefaultValue("true") fun autoClose(): Boolean @DefaultValue("") @Key("kirk.screenSize") fun screenSize(): List<Int> @Key("kirk.baseUrl") fun baseUrl(): String? /** * For use <headless> chrome options, set property "kirk.startMaximized=false" * */ @Separator(",") @DefaultValue("") @Key("kirk.chrome.args") fun chromeArgs(): List<String> /** * Chrome binary property example: -Dkirk.chrome.bin="path/to/your/chrome/bin" * */ @Key("kirk.chrome.binary") fun chromeBin(): String @Separator(",") @DefaultValue("") @Key("kirk.chrome.extensions") fun chromeExtensions(): List<File> @Key("kirk.report.dir") fun reportDir(): String /** * Highlight Element style * */ @Key("kirk.highlight.border") @DefaultValue("true") fun highlightBorder(): Boolean @Key("kirk.highlight.style") @DefaultValue("dotted") fun highlightStyle(): String @Key("kirk.highlight.size") @DefaultValue("2px") fun highlightSize(): String @Key("kirk.highlight.color") @DefaultValue("red") fun highlightColor(): String @Separator(",") @DefaultValue("") @Key("kirk.desired.capabilities") fun capabilities(): List<String> @Key("kirk.remote.url") @DefaultValue("") fun remoteUrl(): String @Key("kirk.listener") @DefaultValue("") fun listenerClass(): String }
kirk-core/src/main/kotlin/com/automation/remarks/kirk/Configuration.kt
2136782302
package com.telesoftas.core.common import com.nhaarman.mockito_kotlin.given import com.nhaarman.mockito_kotlin.mock import com.nhaarman.mockito_kotlin.verify import org.junit.Assert.assertEquals import org.junit.Test /** * Example local unit test, which will execute on the development machine (host). * @see [Testing documentation](http://d.android.com/tools/testing) */ class ExampleUnitTest { @Test fun addition_isCorrect() { assertEquals("Simple math does not work", 4, 2 + 2) } /** * Should not work without mockito-inline in before Mockito releases an in-built system. */ @Test fun finalClasses_canBeMocked() { val finalClass = mock<FinalClass>() given(finalClass.doNothing()).will { } tryFinal(finalClass) verify(finalClass).doNothing() } private fun tryFinal(bundle: FinalClass) { bundle.doNothing() } class FinalClass { fun doNothing() { // Do nothing } } }
telesoftas-common/src/test/kotlin/com/telesoftas/core/common/ExampleUnitTest.kt
4093938514
/* * Use of this source code is governed by the MIT license that can be * found in the LICENSE file. */ package org.toml.lang import com.intellij.openapi.fileTypes.ExactFileNameMatcher import com.intellij.openapi.fileTypes.ExtensionFileNameMatcher import com.intellij.openapi.fileTypes.FileTypeConsumer import com.intellij.openapi.fileTypes.FileTypeFactory class TomlFileTypeFactory : FileTypeFactory() { override fun createFileTypes(consumer: FileTypeConsumer) { consumer.consume(TomlFileType, ExactFileNameMatcher("Cargo.lock"), ExtensionFileNameMatcher(TomlFileType.DEFAULTS.EXTENSION)) } }
toml/src/main/kotlin/org/toml/lang/TomlFileTypeFactory.kt
159277695
package net.cad import org.springframework.boot.SpringApplication import org.springframework.boot.autoconfigure.SpringBootApplication @SpringBootApplication open class Application fun main(args: Array<String>) { SpringApplication.run(Application::class.java, *args) }
src/main/kotlin/net/cad/Application.kt
1472399567
/* * Copyright (C) 2017 Moez Bhatti <[email protected]> * * This file is part of QKSMS. * * QKSMS is free software: you can redistribute it and/or modify * it under the terms of the GNU General Public License as published by * the Free Software Foundation, either version 3 of the License, or * (at your option) any later version. * * QKSMS is distributed in the hope that it will be useful, * but WITHOUT ANY WARRANTY; without even the implied warranty of * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the * GNU General Public License for more details. * * You should have received a copy of the GNU General Public License * along with QKSMS. If not, see <http://www.gnu.org/licenses/>. */ package com.moez.QKSMS.manager interface ChangelogManager { data class CumulativeChangelog( val added: List<String>, val improved: List<String>, val fixed: List<String> ) /** * Returns true if the app has benn updated since the last time this method was called */ fun didUpdate(): Boolean suspend fun getChangelog(): CumulativeChangelog fun markChangelogSeen() }
domain/src/main/java/com/moez/QKSMS/manager/ChangelogManager.kt
546652455
/* * Copyright 2017-2019 Red Hat, Inc. * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package io.vertx.gradle import org.gradle.api.Project /** * Vertx Gradle extension. * * @author [Julien Ponge](https://julien.ponge.org/) */ open class VertxExtension(private val project: Project) { var vertxVersion = "4.1.2" var launcher = "io.vertx.core.Launcher" var mainVerticle = "" var args = listOf<String>() var config = "" var workDirectory = project.projectDir.absolutePath var jvmArgs = listOf<String>() var redeploy = true var watch = listOf("${project.projectDir.absolutePath}/src/**/*") var onRedeploy = listOf("classes") var redeployScanPeriod = 1000L var redeployGracePeriod = 1000L var redeployTerminationPeriod = 1000L var debugPort = 5005L var debugSuspend = false override fun toString(): String { return "VertxExtension(project=$project, vertxVersion='$vertxVersion', launcher='$launcher', mainVerticle='$mainVerticle', args=$args, config='$config', workDirectory='$workDirectory', jvmArgs=$jvmArgs, redeploy=$redeploy, watch=$watch, onRedeploy='$onRedeploy', redeployScanPeriod=$redeployScanPeriod, redeployGracePeriod=$redeployGracePeriod, redeployTerminationPeriod=$redeployTerminationPeriod, debugPort=$debugPort, debugSuspend=$debugSuspend)" } } /** * Extension method to make easier the configuration of the plugin when used with the Gradle Kotlin DSL */ fun Project.vertx(configure: VertxExtension.() -> Unit) = extensions.configure(VertxExtension::class.java, configure)
src/main/kotlin/io/vertx/gradle/VertxExtension.kt
2951511437
package org.http4k.serverless import com.natpryce.hamkrest.assertion.assertThat import com.natpryce.hamkrest.equalTo import org.http4k.core.Method.GET import org.http4k.core.Request import org.http4k.core.Response import org.http4k.core.Status.Companion.OK import org.http4k.servlet.FakeHttpServletRequest import org.http4k.servlet.FakeHttpServletResponse import org.junit.jupiter.api.Test class AlibabaCloudHttpFunctionTest { @Test fun `calls the handler and returns proper body`() { val app = { req: Request -> Response(OK).body(req.bodyString()) } val request = FakeHttpServletRequest(Request(GET, "").body("hello alibaba")) val response = FakeHttpServletResponse() object : AlibabaCloudHttpFunction(AppLoader { app }) {}.handleRequest(request, response, null) assertThat(response.http4k.bodyString(), equalTo("hello alibaba")) } }
http4k-serverless/alibaba/src/test/kotlin/org/http4k/serverless/AlibabaCloudHttpFunctionTest.kt
304195091
package net.milosvasic.dispatcher.response interface ResponseAction { fun onAction() }
Dispatcher/src/main/kotlin/net/milosvasic/dispatcher/response/ResponseAction.kt
2862852005
package de.tutao.tutanota.push import android.annotation.TargetApi import android.app.* import android.content.ClipData import android.content.Context import android.content.Intent import android.graphics.Color import android.media.AudioAttributes import android.media.RingtoneManager import android.os.Build import android.util.Log import androidx.annotation.ColorInt import androidx.annotation.StringRes import androidx.core.app.NotificationCompat import androidx.core.app.NotificationManagerCompat import androidx.core.content.FileProvider import androidx.core.net.toUri import de.tutao.tutanota.* import java.io.File import java.util.concurrent.ConcurrentHashMap const val NOTIFICATION_DISMISSED_ADDR_EXTRA = "notificationDismissed" private const val EMAIL_NOTIFICATION_CHANNEL_ID = "notifications" private val VIBRATION_PATTERN = longArrayOf(100, 200, 100, 200) private const val NOTIFICATION_EMAIL_GROUP = "de.tutao.tutanota.email" private const val SUMMARY_NOTIFICATION_ID = 45 private const val PERSISTENT_NOTIFICATION_CHANNEL_ID = "service_intent" private const val ALARM_NOTIFICATION_CHANNEL_ID = "alarms" private const val DOWNLOAD_NOTIFICATION_CHANNEL_ID = "downloads" class LocalNotificationsFacade(private val context: Context) { private val notificationManager: NotificationManager get() = context.getSystemService(Context.NOTIFICATION_SERVICE) as NotificationManager private val aliasNotification: MutableMap<String, LocalNotificationInfo> = ConcurrentHashMap() fun makeConnectionNotification(): Notification { return NotificationCompat.Builder(context, PERSISTENT_NOTIFICATION_CHANNEL_ID) .setContentTitle("Notification service") .setContentText("Syncing notifications") .setSmallIcon(R.drawable.ic_status) .setProgress(0, 0, true) .build() } fun notificationDismissed(dismissAdders: List<String>?, isSummary: Boolean) { if (isSummary) { // If the user clicked on summary directly, reset counter for all notifications aliasNotification.clear() } else { if (dismissAdders != null) { for (addr in dismissAdders) { aliasNotification.remove(addr) notificationManager.cancel(makeNotificationId(addr)) } } } if (aliasNotification.isEmpty()) { notificationManager.cancel(SUMMARY_NOTIFICATION_ID) } else { var allAreZero = true for (info in aliasNotification.values) { if (info.counter > 0) { allAreZero = false break } } if (allAreZero) { notificationManager.cancel(SUMMARY_NOTIFICATION_ID) } else { for (info in aliasNotification.values) { if (info.counter > 0) { sendSummaryNotification( notificationManager, info.message, info.notificationInfo, false ) break } } } } } fun sendEmailNotifications(notificationInfos: List<NotificationInfo>) { if (notificationInfos.isEmpty()) { return } val title = context.getString(R.string.pushNewMail_msg) for (notificationInfo in notificationInfos) { val counterPerAlias = aliasNotification[notificationInfo.mailAddress]?.incremented(notificationInfo.counter) ?: LocalNotificationInfo( title, notificationInfo.counter, notificationInfo ) aliasNotification[notificationInfo.mailAddress] = counterPerAlias val notificationId = makeNotificationId(notificationInfo.mailAddress) @ColorInt val redColor = context.resources.getColor(R.color.red, context.theme) val notificationBuilder = NotificationCompat.Builder(context, EMAIL_NOTIFICATION_CHANNEL_ID) .setLights(redColor, 1000, 1000) notificationBuilder.setContentTitle(title) .setColor(redColor) .setContentText(notificationContent(notificationInfo.mailAddress)) .setNumber(counterPerAlias.counter) .setSmallIcon(R.drawable.ic_status) .setDeleteIntent(intentForDelete(arrayListOf(notificationInfo.mailAddress))) .setContentIntent(intentOpenMailbox(notificationInfo, false)) .setGroup(NOTIFICATION_EMAIL_GROUP) .setAutoCancel(true) .setGroupAlertBehavior(if (atLeastNougat()) NotificationCompat.GROUP_ALERT_CHILDREN else NotificationCompat.GROUP_ALERT_SUMMARY) .setDefaults(Notification.DEFAULT_ALL) notificationManager.notify(notificationId, notificationBuilder.build()) } sendSummaryNotification( notificationManager, title, notificationInfos[0], true ) } @TargetApi(Build.VERSION_CODES.Q) fun sendDownloadFinishedNotification(fileName: String?) { val notificationManager = NotificationManagerCompat.from(context) val channel = NotificationChannel( "downloads", "Downloads", NotificationManager.IMPORTANCE_DEFAULT ) notificationManager.createNotificationChannel(channel) val pendingIntent = PendingIntent.getActivity( context, 1, Intent(DownloadManager.ACTION_VIEW_DOWNLOADS), PendingIntent.FLAG_IMMUTABLE ) val notification = Notification.Builder(context, channel.id) .setContentIntent(pendingIntent) .setContentTitle(fileName) .setContentText(context.getText(R.string.downloadCompleted_msg)) .setSmallIcon(R.drawable.ic_download) .setAutoCancel(true) .build() notificationManager.notify(makeNotificationId("downloads"), notification) } private fun sendSummaryNotification( notificationManager: NotificationManager, title: String, notificationInfo: NotificationInfo, sound: Boolean, ) { var summaryCounter = 0 val addresses = arrayListOf<String>() val inboxStyle = NotificationCompat.InboxStyle() for ((key, value) in aliasNotification) { val count = value.counter if (count > 0) { summaryCounter += count inboxStyle.addLine(notificationContent(key)) addresses.add(key) } } val builder = NotificationCompat.Builder(context, EMAIL_NOTIFICATION_CHANNEL_ID) .setBadgeIconType(NotificationCompat.BADGE_ICON_SMALL) @ColorInt val red = context.resources.getColor(R.color.red, context.theme) val notification = builder.setContentTitle(title) .setContentText(notificationContent(notificationInfo.mailAddress)) .setSmallIcon(R.drawable.ic_status) .setGroup(NOTIFICATION_EMAIL_GROUP) .setGroupSummary(true) .setColor(red) .setNumber(summaryCounter) .setStyle(inboxStyle) .setContentIntent(intentOpenMailbox(notificationInfo, true)) .setDeleteIntent(intentForDelete(addresses)) .setAutoCancel(true) // We need to update summary without sound when one of the alarms is cancelled // but we need to use sound if it's API < N because GROUP_ALERT_CHILDREN doesn't // work with sound there (pehaps summary consumes it somehow?) and we must do // summary with sound instead on the old versions. .setDefaults(if (sound) NotificationCompat.DEFAULT_SOUND or NotificationCompat.DEFAULT_VIBRATE else 0) .setGroupAlertBehavior(if (atLeastNougat()) NotificationCompat.GROUP_ALERT_CHILDREN else NotificationCompat.GROUP_ALERT_SUMMARY) .build() notificationManager.notify(SUMMARY_NOTIFICATION_ID, notification) } fun showErrorNotification(@StringRes message: Int, exception: Throwable?) { val intent = Intent(context, MainActivity::class.java) .setAction(Intent.ACTION_SEND) .setType("text/plain") .putExtra(Intent.EXTRA_SUBJECT, "Alarm error v" + BuildConfig.VERSION_NAME) if (exception != null) { val stackTrace = Log.getStackTraceString(exception) val errorString = "${exception.message}\n$stackTrace" intent.clipData = ClipData.newPlainText("error", errorString) } val notification: Notification = NotificationCompat.Builder(context, ALARM_NOTIFICATION_CHANNEL_ID) .setSmallIcon(R.drawable.ic_status) .setContentTitle(context.getString(R.string.app_name)) .setContentText(context.getString(message)) .setDefaults(NotificationCompat.DEFAULT_ALL) .setStyle(NotificationCompat.BigTextStyle()) .setContentIntent( PendingIntent.getActivity( context, (Math.random() * 20000).toInt(), intent, PendingIntent.FLAG_UPDATE_CURRENT ) ) .setAutoCancel(true) .build() notificationManager.notify(1000, notification) } @TargetApi(Build.VERSION_CODES.O) fun createNotificationChannels() { val mailNotificationChannel = NotificationChannel( EMAIL_NOTIFICATION_CHANNEL_ID, context.getString(R.string.pushNewMail_msg), NotificationManager.IMPORTANCE_DEFAULT ).default() notificationManager.createNotificationChannel(mailNotificationChannel) val serviceNotificationChannel = NotificationChannel( PERSISTENT_NOTIFICATION_CHANNEL_ID, context.getString(R.string.notificationSync_msg), NotificationManager.IMPORTANCE_LOW ) notificationManager.createNotificationChannel(serviceNotificationChannel) val alarmNotificationsChannel = NotificationChannel( ALARM_NOTIFICATION_CHANNEL_ID, context.getString(R.string.reminder_label), NotificationManager.IMPORTANCE_HIGH ).default() notificationManager.createNotificationChannel(alarmNotificationsChannel) val downloadNotificationsChannel = NotificationChannel( DOWNLOAD_NOTIFICATION_CHANNEL_ID, context.getString(R.string.downloadCompleted_msg), NotificationManager.IMPORTANCE_DEFAULT ) downloadNotificationsChannel.setShowBadge(false) notificationManager.createNotificationChannel(downloadNotificationsChannel) } @TargetApi(Build.VERSION_CODES.O) private fun NotificationChannel.default(): NotificationChannel { val ringtoneUri = RingtoneManager.getDefaultUri(RingtoneManager.TYPE_NOTIFICATION) val att = AudioAttributes.Builder() .setUsage(AudioAttributes.USAGE_NOTIFICATION) .setContentType(AudioAttributes.CONTENT_TYPE_UNKNOWN) .build() setShowBadge(true) setSound(ringtoneUri, att) enableLights(true) vibrationPattern = VIBRATION_PATTERN lightColor = Color.RED return this } private fun notificationContent(address: String): String { return aliasNotification[address]!!.counter.toString() + " " + address } private fun makeNotificationId(address: String): Int { return Math.abs(1 + address.hashCode()) } private fun intentForDelete(addresses: ArrayList<String>): PendingIntent { val deleteIntent = Intent(context, PushNotificationService::class.java) deleteIntent.putStringArrayListExtra(NOTIFICATION_DISMISSED_ADDR_EXTRA, addresses) return PendingIntent.getService( context.applicationContext, makeNotificationId("dismiss${addresses.joinToString("+")}"), deleteIntent, PendingIntent.FLAG_UPDATE_CURRENT ) } private fun intentOpenMailbox( notificationInfo: NotificationInfo, isSummary: Boolean, ): PendingIntent { val openMailboxIntent = Intent(context, MainActivity::class.java) openMailboxIntent.action = MainActivity.OPEN_USER_MAILBOX_ACTION openMailboxIntent.putExtra( MainActivity.OPEN_USER_MAILBOX_MAIL_ADDRESS_KEY, notificationInfo.mailAddress ) openMailboxIntent.putExtra( MainActivity.OPEN_USER_MAILBOX_USERID_KEY, notificationInfo.userId ) openMailboxIntent.putExtra(MainActivity.IS_SUMMARY_EXTRA, isSummary) return PendingIntent.getActivity( context.applicationContext, makeNotificationId(notificationInfo.mailAddress + "@isSummary" + isSummary), openMailboxIntent, PendingIntent.FLAG_UPDATE_CURRENT ) } } fun notificationDismissedIntent( context: Context, emailAddresses: ArrayList<String>, sender: String, isSummary: Boolean, ): Intent { val deleteIntent = Intent(context, PushNotificationService::class.java) deleteIntent.putStringArrayListExtra(NOTIFICATION_DISMISSED_ADDR_EXTRA, emailAddresses) deleteIntent.putExtra("sender", sender) deleteIntent.putExtra(MainActivity.IS_SUMMARY_EXTRA, isSummary) return deleteIntent } fun showAlarmNotification(context: Context, timestamp: Long, summary: String, intent: Intent) { val contentText = String.format("%tR %s", timestamp, summary) val notificationManager = context.getSystemService(Context.NOTIFICATION_SERVICE) as NotificationManager @ColorInt val red = context.resources.getColor(R.color.red, context.theme) notificationManager.notify( System.currentTimeMillis().toInt(), NotificationCompat.Builder(context, ALARM_NOTIFICATION_CHANNEL_ID) .setSmallIcon(R.drawable.ic_status) .setContentTitle(context.getString(R.string.reminder_label)) .setContentText(contentText) .setDefaults(NotificationCompat.DEFAULT_ALL) .setColor(red) .setContentIntent(openCalendarIntent(context, intent)) .setAutoCancel(true) .build() ) } private fun openCalendarIntent(context: Context, alarmIntent: Intent): PendingIntent { val userId = alarmIntent.getStringExtra(MainActivity.OPEN_USER_MAILBOX_USERID_KEY) val openCalendarEventIntent = Intent(context, MainActivity::class.java) openCalendarEventIntent.action = MainActivity.OPEN_CALENDAR_ACTION openCalendarEventIntent.putExtra(MainActivity.OPEN_USER_MAILBOX_USERID_KEY, userId) return PendingIntent.getActivity( context, alarmIntent.data.toString().hashCode(), openCalendarEventIntent, PendingIntent.FLAG_UPDATE_CURRENT ) } /** * create a notification that starts a new task and gives it access to the downloaded file * to view it. */ fun showDownloadNotification(context: Context, file: File) { val notificationManager = context.getSystemService(Context.NOTIFICATION_SERVICE) as NotificationManager val uri = FileProvider.getUriForFile(context, BuildConfig.FILE_PROVIDER_AUTHORITY, file) val mimeType = getMimeType(file.toUri(), context) val intent = Intent(Intent.ACTION_VIEW).apply { flags = Intent.FLAG_ACTIVITY_NEW_TASK or Intent.FLAG_GRANT_READ_URI_PERMISSION setDataAndType(uri, mimeType) } val pendingIntent = PendingIntent.getActivity(context, 0, intent, PendingIntent.FLAG_IMMUTABLE); notificationManager.notify(System.currentTimeMillis().toInt(), NotificationCompat.Builder(context, DOWNLOAD_NOTIFICATION_CHANNEL_ID) .setSmallIcon(R.drawable.ic_download) .setContentTitle(context.getString(R.string.downloadCompleted_msg)) .setContentText(file.name) .setContentIntent(pendingIntent) .setAutoCancel(true) .build() ) }
app-android/app/src/main/java/de/tutao/tutanota/push/LocalNotificationsFacade.kt
495599368
package jpm.android.robot /** * Created by jm on 17/01/17. * * * see drawings: * /opt/docs/ARDUINO/myStufs/robot/openscad/robot_diagram.dxf * /opt/docs/ARDUINO/myStufs/robot/openscad/robot_diagram_symbols.dxf * /opt/docs/ARDUINO/myStufs/robot/openscad/trignometria.dxf * * resume: * - Y axis aligned with length positive angle to front * - X axis aligned with width positive angle to right * - 0 º angle aligned with front, rotate clockwise */ object RobotDimensions { data class SonarInfo(val angleDeg: Int, val angleRad: Double, val x: Double, val y: Double) // units meters: // val robotCircleRadius = 0.07 // BW / 2 val robotRectLength = 0.056 // BSd val bodyWidth = 2 * robotCircleRadius // BW val bodyTotalLength = 2 * robotCircleRadius + robotRectLength // Bl val wheelBodyDistance = 0.005 // val wheelRadius = 0.0325 // Wd / 2 val wheelWidth = 0.026 // Ww val distanceWheel = bodyWidth + wheelWidth + 2 * wheelBodyDistance // BWw val wheelAxisLenght = 0.075 // BWl val robotTotalWidth = bodyWidth + 2 * (wheelBodyDistance + wheelWidth) val sonarAngle = 30 // usDelta val wheelSensorTicksPerRotation = 100 val sonarSensors = Array(12) { i -> val angleDeg = i * sonarAngle val angleRad = Math.toRadians(angleDeg.toDouble()) val (x,y) = when(i) { 9 -> Pair(-robotCircleRadius, 0.0) // left 3 -> Pair( robotCircleRadius, 0.0) // right 0 -> Pair(0.0, robotRectLength / 2.0 + robotCircleRadius) // front 6 -> Pair(0.0, -robotRectLength / 2.0 - robotCircleRadius) // back 4,5,7,8 -> Pair(robotCircleRadius * Math.sin(angleRad), -robotRectLength / 2.0 + robotCircleRadius * Math.cos(angleRad)) // negative Y else -> Pair(robotCircleRadius * Math.sin(angleRad), robotRectLength / 2.0 + robotCircleRadius * Math.cos(angleRad)) // positive Y (1,2,10,11) } SonarInfo(angleDeg, angleRad, x, y) } /* init { var i = 0 sonarSensors.forEach { s -> println("Sendor($i) \t= $s\n") i += 1 } } */ }
android/app/src/main/java/jpm/android/robot/RobotDimensions.kt
1466975548
package ch.empros.kmap interface Query { val pagedQuery: String val pageSize: Int val startPage: Int fun nextPage(): Query } /** * A [SqlQuery] object can be used to create pageable data sources, see [KMap.pageObservableFrom]. * Note: [startPage] is zero-based, ie. the first page is at index 0. */ data class SqlQuery(private val query: String, override val pageSize: Int = 50, override val startPage: Int = 0) : Query { init { require(pageSize > 0, { "PageSize must be > 0, but got: $pageSize" }) require(startPage > -1, { "StartPage must >= 0, but got: $startPage" }) } override val pagedQuery = "$query LIMIT $pageSize OFFSET ${startPage * pageSize}" override fun nextPage() = copy(startPage = startPage + 1) }
data/src/main/kotlin/ch/empros/kmap/Query.kt
1423546542
package me.sweetll.tucao.business.home.fragment import android.annotation.TargetApi import androidx.databinding.DataBindingUtil import android.os.Build import android.os.Bundle import androidx.core.app.ActivityOptionsCompat import androidx.core.util.Pair import android.transition.ArcMotion import android.transition.ChangeBounds import android.view.LayoutInflater import android.view.View import android.view.ViewGroup import androidx.recyclerview.widget.LinearLayoutManager import androidx.transition.TransitionManager import com.chad.library.adapter.base.BaseQuickAdapter import com.chad.library.adapter.base.listener.OnItemChildClickListener import me.sweetll.tucao.R import me.sweetll.tucao.base.BaseFragment import me.sweetll.tucao.business.channel.ChannelDetailActivity import me.sweetll.tucao.business.home.adapter.AnimationAdapter import me.sweetll.tucao.business.home.viewmodel.AnimationViewModel import me.sweetll.tucao.business.video.VideoActivity import me.sweetll.tucao.databinding.FragmentAnimationBinding import me.sweetll.tucao.databinding.HeaderAnimationBinding import me.sweetll.tucao.model.raw.Animation class AnimationFragment : BaseFragment() { lateinit var binding: FragmentAnimationBinding val viewModel = AnimationViewModel(this) val animationAdapter = AnimationAdapter(null) var isLoad = false override fun onCreateView(inflater: LayoutInflater, container: ViewGroup?, savedInstanceState: Bundle?): View? { binding = DataBindingUtil.inflate(inflater, R.layout.fragment_animation, container, false) binding.viewModel = viewModel binding.loading.show() return binding.root } override fun onViewCreated(view: View, savedInstanceState: Bundle?) { super.onViewCreated(view, savedInstanceState) binding.swipeRefresh.isEnabled = false binding.swipeRefresh.setColorSchemeResources(R.color.colorPrimary) binding.swipeRefresh.setOnRefreshListener { viewModel.loadData() } binding.errorStub.setOnInflateListener { _, inflated -> inflated.setOnClickListener { viewModel.loadData() } } setupRecyclerView() loadWhenNeed() if (android.os.Build.VERSION.SDK_INT >= Build.VERSION_CODES.LOLLIPOP) { initTransition() } } fun setupRecyclerView() { val headerBinding: HeaderAnimationBinding = DataBindingUtil.inflate(LayoutInflater.from(activity), R.layout.header_animation, binding.root as ViewGroup, false) headerBinding.viewModel = viewModel animationAdapter.addHeaderView(headerBinding.root) binding.animationRecycler.layoutManager = LinearLayoutManager(activity) binding.animationRecycler.adapter = animationAdapter binding.animationRecycler.addOnItemTouchListener(object: OnItemChildClickListener() { override fun onSimpleItemChildClick(adapter: BaseQuickAdapter<*, *>, view: View, position: Int) { when (view.id) { R.id.card_more -> { ChannelDetailActivity.intentTo(activity!!, view.tag as Int) } R.id.card1, R.id.card2, R.id.card3, R.id.card4 -> { if (android.os.Build.VERSION.SDK_INT >= Build.VERSION_CODES.LOLLIPOP) { val coverImg = (((view as ViewGroup).getChildAt(0) as ViewGroup).getChildAt(0) as ViewGroup).getChildAt(0) val titleText = (view.getChildAt(0) as ViewGroup).getChildAt(1) val p1: Pair<View, String> = Pair.create(coverImg, "cover") val p2: Pair<View, String> = Pair.create(titleText, "bg") val cover = titleText.tag as String val options = ActivityOptionsCompat .makeSceneTransitionAnimation(activity!!, p1, p2) VideoActivity.intentTo(activity!!, view.tag as String, cover, options.toBundle()) } else { VideoActivity.intentTo(activity!!, view.tag as String) } } } } }) } @TargetApi(Build.VERSION_CODES.LOLLIPOP) fun initTransition() { val changeBounds = ChangeBounds() val arcMotion = ArcMotion() changeBounds.pathMotion = arcMotion activity!!.window.sharedElementExitTransition = changeBounds activity!!.window.sharedElementReenterTransition = null } override fun setUserVisibleHint(isVisibleToUser: Boolean) { super.setUserVisibleHint(isVisibleToUser) loadWhenNeed() } fun loadWhenNeed() { if (isVisible && userVisibleHint && !isLoad && !binding.swipeRefresh.isRefreshing) { viewModel.loadData() } } fun loadAnimation(animation: Animation) { if (!isLoad) { isLoad = true TransitionManager.beginDelayedTransition(binding.swipeRefresh) binding.swipeRefresh.isEnabled = true binding.loading.visibility = View.GONE if (binding.errorStub.isInflated) { binding.errorStub.root.visibility = View.GONE } binding.animationRecycler.visibility = View.VISIBLE } animationAdapter.setNewData(animation.recommends) } fun loadError() { if (!isLoad) { TransitionManager.beginDelayedTransition(binding.swipeRefresh) binding.loading.visibility = View.GONE if (!binding.errorStub.isInflated) { binding.errorStub.viewStub!!.visibility = View.VISIBLE } else { binding.errorStub.root.visibility = View.VISIBLE } } } fun setRefreshing(isRefreshing: Boolean) { if (isLoad) { binding.swipeRefresh.isRefreshing = isRefreshing } else { TransitionManager.beginDelayedTransition(binding.swipeRefresh) binding.loading.visibility = if (isRefreshing) View.VISIBLE else View.GONE if (isRefreshing) { if (!binding.errorStub.isInflated) { binding.errorStub.viewStub!!.visibility = View.GONE } else { binding.errorStub.root.visibility = View.GONE } } } } }
app/src/main/kotlin/me/sweetll/tucao/business/home/fragment/AnimationFragment.kt
2172834239
package pw.janyo.whatanime.ui.theme import android.os.Build import androidx.compose.foundation.isSystemInDarkTheme import androidx.compose.material3.MaterialTheme import androidx.compose.material3.darkColorScheme import androidx.compose.material3.dynamicDarkColorScheme import androidx.compose.material3.dynamicLightColorScheme import androidx.compose.material3.lightColorScheme import androidx.compose.runtime.Composable import androidx.compose.runtime.collectAsState import androidx.compose.runtime.getValue import androidx.compose.ui.platform.LocalContext import kotlinx.coroutines.flow.MutableStateFlow import pw.janyo.whatanime.config.Configure import pw.janyo.whatanime.model.entity.NightMode private val DarkColorPalette = darkColorScheme() private val LightColorPalette = lightColorScheme() @Composable fun isDarkMode(): Boolean { val mode by Theme.nightMode.collectAsState() return when (mode) { NightMode.AUTO -> isSystemInDarkTheme() NightMode.ON -> true NightMode.OFF -> false NightMode.MATERIAL_YOU -> isSystemInDarkTheme() } } @Composable fun WhatAnimeTheme( content: @Composable() () -> Unit ) { val isDark = isDarkMode() val dynamicColor = Build.VERSION.SDK_INT >= Build.VERSION_CODES.S val colorScheme = if (dynamicColor) { val context = LocalContext.current if (isDark) dynamicDarkColorScheme(context) else dynamicLightColorScheme(context) } else { if (isDarkMode()) DarkColorPalette else LightColorPalette } MaterialTheme( colorScheme = colorScheme, content = content ) } object Theme { val nightMode = MutableStateFlow(Configure.nightMode) }
app/src/main/java/pw/janyo/whatanime/ui/theme/Theme.kt
3044730331
package com.darichey.discord.kommands.limiters import com.darichey.discord.kommands.CommandFunction import com.darichey.discord.kommands.Limiter import sx.blah.discord.handle.obj.IChannel /** * A [Limiter] limiting the use of a command to certain [IChannel]s. * Will pass a command executed in **ANY** of the given channels. */ class ChannelLimiter(vararg channels: String, onFail: CommandFunction = {}) : Limiter({ channels.contains(channel.id) }, onFail) { constructor(vararg channels: IChannel, onFail: CommandFunction = {}): this(*channels.map(IChannel::getID).toTypedArray(), onFail = onFail) }
src/main/kotlin/com/darichey/discord/kommands/limiters/ChannelLimiter.kt
353955233
package kodando.rxjs fun subscription(handler: () -> Unit) = Subscription(handler) inline fun <T> createObserverLike(): ObserverLike<T> { return ObserverLikeImpl() }
kodando-rxjs/src/main/kotlin/kodando/rxjs/Helpers.kt
134544371
package kodando.rxjs.operators import kodando.rxjs.JsFunction import kodando.rxjs.Observable import kodando.rxjs.fromModule import kodando.rxjs.import private val catchError_: JsFunction = fromModule("rxjs/operators") import "catchError" fun <T> Observable<T>.catchError(transformer: (Any) -> Observable<T>): Observable<T> { return pipe(catchError_.call(this, transformer)) }
kodando-rxjs/src/main/kotlin/kodando/rxjs/operators/CatchError.kt
2583509712
package components.menuBar.child import components.progressBar.MenuBarImpl import java.awt.event.ActionEvent import java.util.* import javax.swing.JMenuItem /** * Created by vicboma on 12/12/16. */ public fun MenuBarImpl.Companion.MenuBarFile(): Map<String, Map<String, (ActionEvent) -> Unit>> { return object : LinkedHashMap<String, Map<String, (ActionEvent) -> Unit>>() { init { put("File", object : LinkedHashMap<String, (ActionEvent) -> Unit>() { init { put("New", { clickAction (it) }) put("Open", { clickAction (it) }) put("Open Url", { clickAction (it) }) put("Open Recent", { clickAction (it) }) put("Close Project", { clickAction (it) }) put("---", { clickAction (it) }) put("Power Save Mode", { }) } } ) } } } private fun clickAction(it: ActionEvent) { var item = (it.source as JMenuItem) item.text = it.actionCommand.plus(" - (Clicked!)") item.removeActionListener(item.actionListeners.get(0)) }
08-start-async-fileChooser-application/src/main/kotlin/components/menuBar/child/MenuBarFile.kt
3249192251
/* * Copyright (C) 2018 The Android Open Source Project * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package com.example.android.codelabs.paging.ui import android.os.Bundle import android.view.KeyEvent import android.view.inputmethod.EditorInfo import android.widget.Toast import androidx.appcompat.app.AppCompatActivity import androidx.core.view.isVisible import androidx.lifecycle.ViewModelProvider import androidx.lifecycle.lifecycleScope import androidx.paging.LoadState import androidx.paging.PagingData import androidx.recyclerview.widget.DividerItemDecoration import androidx.recyclerview.widget.RecyclerView import com.example.android.codelabs.paging.Injection import com.example.android.codelabs.paging.databinding.ActivitySearchRepositoriesBinding import kotlinx.coroutines.flow.Flow import kotlinx.coroutines.flow.StateFlow import kotlinx.coroutines.flow.collect import kotlinx.coroutines.flow.collectLatest import kotlinx.coroutines.flow.combine import kotlinx.coroutines.flow.distinctUntilChanged import kotlinx.coroutines.flow.map import kotlinx.coroutines.launch class SearchRepositoriesActivity : AppCompatActivity() { override fun onCreate(savedInstanceState: Bundle?) { super.onCreate(savedInstanceState) val binding = ActivitySearchRepositoriesBinding.inflate(layoutInflater) val view = binding.root setContentView(view) // get the view model val viewModel = ViewModelProvider( this, Injection.provideViewModelFactory( context = this, owner = this ) ) .get(SearchRepositoriesViewModel::class.java) // add dividers between RecyclerView's row items val decoration = DividerItemDecoration(this, DividerItemDecoration.VERTICAL) binding.list.addItemDecoration(decoration) // bind the state binding.bindState( uiState = viewModel.state, pagingData = viewModel.pagingDataFlow, uiActions = viewModel.accept ) } /** * Binds the [UiState] provided by the [SearchRepositoriesViewModel] to the UI, * and allows the UI to feed back user actions to it. */ private fun ActivitySearchRepositoriesBinding.bindState( uiState: StateFlow<UiState>, pagingData: Flow<PagingData<UiModel>>, uiActions: (UiAction) -> Unit ) { val repoAdapter = ReposAdapter() val header = ReposLoadStateAdapter { repoAdapter.retry() } list.adapter = repoAdapter.withLoadStateHeaderAndFooter( header = header, footer = ReposLoadStateAdapter { repoAdapter.retry() } ) bindSearch( uiState = uiState, onQueryChanged = uiActions ) bindList( header = header, repoAdapter = repoAdapter, uiState = uiState, pagingData = pagingData, onScrollChanged = uiActions ) } private fun ActivitySearchRepositoriesBinding.bindSearch( uiState: StateFlow<UiState>, onQueryChanged: (UiAction.Search) -> Unit ) { searchRepo.setOnEditorActionListener { _, actionId, _ -> if (actionId == EditorInfo.IME_ACTION_GO) { updateRepoListFromInput(onQueryChanged) true } else { false } } searchRepo.setOnKeyListener { _, keyCode, event -> if (event.action == KeyEvent.ACTION_DOWN && keyCode == KeyEvent.KEYCODE_ENTER) { updateRepoListFromInput(onQueryChanged) true } else { false } } lifecycleScope.launch { uiState .map { it.query } .distinctUntilChanged() .collect(searchRepo::setText) } } private fun ActivitySearchRepositoriesBinding.updateRepoListFromInput(onQueryChanged: (UiAction.Search) -> Unit) { searchRepo.text.trim().let { if (it.isNotEmpty()) { list.scrollToPosition(0) onQueryChanged(UiAction.Search(query = it.toString())) } } } private fun ActivitySearchRepositoriesBinding.bindList( header: ReposLoadStateAdapter, repoAdapter: ReposAdapter, uiState: StateFlow<UiState>, pagingData: Flow<PagingData<UiModel>>, onScrollChanged: (UiAction.Scroll) -> Unit ) { retryButton.setOnClickListener { repoAdapter.retry() } list.addOnScrollListener(object : RecyclerView.OnScrollListener() { override fun onScrolled(recyclerView: RecyclerView, dx: Int, dy: Int) { if (dy != 0) onScrollChanged(UiAction.Scroll(currentQuery = uiState.value.query)) } }) val notLoading = repoAdapter.loadStateFlow .asRemotePresentationState() .map { it == RemotePresentationState.PRESENTED } val hasNotScrolledForCurrentSearch = uiState .map { it.hasNotScrolledForCurrentSearch } .distinctUntilChanged() val shouldScrollToTop = combine( notLoading, hasNotScrolledForCurrentSearch, Boolean::and ) .distinctUntilChanged() lifecycleScope.launch { pagingData.collectLatest(repoAdapter::submitData) } lifecycleScope.launch { shouldScrollToTop.collect { shouldScroll -> if (shouldScroll) list.scrollToPosition(0) } } lifecycleScope.launch { repoAdapter.loadStateFlow.collect { loadState -> // Show a retry header if there was an error refreshing, and items were previously // cached OR default to the default prepend state header.loadState = loadState.mediator ?.refresh ?.takeIf { it is LoadState.Error && repoAdapter.itemCount > 0 } ?: loadState.prepend val isListEmpty = loadState.refresh is LoadState.NotLoading && repoAdapter.itemCount == 0 // show empty list emptyList.isVisible = isListEmpty // Only show the list if refresh succeeds, either from the the local db or the remote. list.isVisible = loadState.source.refresh is LoadState.NotLoading || loadState.mediator?.refresh is LoadState.NotLoading // Show loading spinner during initial load or refresh. progressBar.isVisible = loadState.mediator?.refresh is LoadState.Loading // Show the retry state if initial load or refresh fails. retryButton.isVisible = loadState.mediator?.refresh is LoadState.Error && repoAdapter.itemCount == 0 // Toast on any error, regardless of whether it came from RemoteMediator or PagingSource val errorState = loadState.source.append as? LoadState.Error ?: loadState.source.prepend as? LoadState.Error ?: loadState.append as? LoadState.Error ?: loadState.prepend as? LoadState.Error errorState?.let { Toast.makeText( this@SearchRepositoriesActivity, "\uD83D\uDE28 Wooops ${it.error}", Toast.LENGTH_LONG ).show() } } } } }
advanced/end/app/src/main/java/com/example/android/codelabs/paging/ui/SearchRepositoriesActivity.kt
3941648466
package fr.simonlebras.radiofrance.di.scopes import javax.inject.Scope @Scope @Retention(AnnotationRetention.RUNTIME) annotation class ActivityScope
app/src/main/kotlin/fr/simonlebras/radiofrance/di/scopes/ActivityScope.kt
1537028464
/**************************************************************************************** * Copyright (c) 2018 Mike Hardy <[email protected]> * * * * This program is free software; you can redistribute it and/or modify it under * * the terms of the GNU General Public License as published by the Free Software * * Foundation; either version 3 of the License, or (at your option) any later * * version. * * * * This program is distributed in the hope that it will be useful, but WITHOUT ANY * * WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS FOR A * * PARTICULAR PURPOSE. See the GNU General Public License for more details. * * * * You should have received a copy of the GNU General Public License along with * * this program. If not, see <http://www.gnu.org/licenses/>. * ****************************************************************************************/ package com.ichi2.utils import android.app.Activity import android.content.ContentResolver import android.content.Context import android.content.Intent import android.net.Uri import android.os.Bundle import android.os.Message import android.provider.OpenableColumns import android.text.TextUtils import android.webkit.MimeTypeMap import androidx.annotation.CheckResult import com.afollestad.materialdialogs.MaterialDialog import com.ichi2.anki.AnkiActivity import com.ichi2.anki.AnkiDroidApp import com.ichi2.anki.CrashReportService import com.ichi2.anki.R import com.ichi2.anki.dialogs.DialogHandler import com.ichi2.compat.CompatHelper import org.apache.commons.compress.archivers.zip.ZipFile import org.jetbrains.annotations.Contract import timber.log.Timber import java.io.File import java.io.FileNotFoundException import java.io.IOException import java.io.InputStream import java.net.URLDecoder import java.net.URLEncoder import java.util.* import java.util.zip.ZipException import java.util.zip.ZipInputStream import kotlin.collections.ArrayList object ImportUtils { /* A filename should be shortened if over this threshold */ private const val fileNameShorteningThreshold = 100 /** * This code is used in multiple places to handle package imports * * @param context for use in resource resolution and path finding * @param intent contains the file to import * @return null if successful, otherwise error message */ fun handleFileImport(context: Context, intent: Intent): ImportResult { return FileImporter().handleFileImport(context, intent) } /** * Makes a cached copy of the file selected on [intent] and returns its path */ fun getFileCachedCopy(context: Context, intent: Intent): String? { return FileImporter().getFileCachedCopy(context, intent) } fun showImportUnsuccessfulDialog(activity: Activity, errorMessage: String?, exitActivity: Boolean) { FileImporter().showImportUnsuccessfulDialog(activity, errorMessage, exitActivity) } fun isCollectionPackage(filename: String?): Boolean { return filename != null && (filename.lowercase(Locale.ROOT).endsWith(".colpkg") || "collection.apkg" == filename) } /** @return Whether the file is either a deck, or a collection package */ @Contract("null -> false") fun isValidPackageName(filename: String?): Boolean { return FileImporter.isDeckPackage(filename) || isCollectionPackage(filename) } /** * Whether importUtils can handle the given intent * Caused by #6312 - A launcher was sending ACTION_VIEW instead of ACTION_MAIN */ fun isInvalidViewIntent(intent: Intent): Boolean { return intent.data == null && intent.clipData == null } fun isFileAValidDeck(fileName: String): Boolean { return FileImporter.hasExtension(fileName, "apkg") || FileImporter.hasExtension(fileName, "colpkg") } @SuppressWarnings("WeakerAccess") open class FileImporter { /** * This code is used in multiple places to handle package imports * * @param context for use in resource resolution and path finding * @param intent contains the file to import * @return null if successful, otherwise error message */ fun handleFileImport(context: Context, intent: Intent): ImportResult { // This intent is used for opening apkg package files // We want to go immediately to DeckPicker, clearing any history in the process Timber.i("IntentHandler/ User requested to view a file") val extras = if (intent.extras == null) "none" else TextUtils.join(", ", intent.extras!!.keySet()) Timber.i("Intent: %s. Data: %s", intent, extras) return try { handleFileImportInternal(context, intent) } catch (e: Exception) { CrashReportService.sendExceptionReport(e, "handleFileImport") Timber.e(e, "failed to handle import intent") ImportResult.fromErrorString(context.getString(R.string.import_error_handle_exception, e.localizedMessage)) } } private fun handleFileImportInternal(context: Context, intent: Intent): ImportResult { val dataList = getUris(intent) return if (dataList != null) { handleContentProviderFile(context, intent, dataList) } else { ImportResult.fromErrorString(context.getString(R.string.import_error_handle_exception)) } } /** * Makes a cached copy of the file selected on [intent] and returns its path */ fun getFileCachedCopy(context: Context, intent: Intent): String? { val uri = getUris(intent)?.get(0) ?: return null val filename = ensureValidLength(getFileNameFromContentProvider(context, uri) ?: return null) val tempPath = Uri.fromFile(File(context.cacheDir, filename)).encodedPath!! return if (copyFileToCache(context, uri, tempPath)) { tempPath } else { null } } private fun handleContentProviderFile(context: Context, intent: Intent, dataList: ArrayList<Uri>): ImportResult { // Note: intent.getData() can be null. Use data instead. validateImportTypes(context, dataList)?.let { errorMessage -> return ImportResult.fromErrorString(errorMessage) } val tempOutDirList: ArrayList<String> = ArrayList() for (data in dataList) { // Get the original filename from the content provider URI var filename = getFileNameFromContentProvider(context, data) // Hack to fix bug where ContentResolver not returning filename correctly if (filename == null) { if (intent.type != null && ("application/apkg" == intent.type || hasValidZipFile(context, data))) { // Set a dummy filename if MIME type provided or is a valid zip file filename = "unknown_filename.apkg" Timber.w("Could not retrieve filename from ContentProvider, but was valid zip file so we try to continue") } else { Timber.e("Could not retrieve filename from ContentProvider or read content as ZipFile") CrashReportService.sendExceptionReport(RuntimeException("Could not import apkg from ContentProvider"), "IntentHandler.java", "apkg import failed") return ImportResult.fromErrorString(AnkiDroidApp.appResources.getString(R.string.import_error_content_provider, AnkiDroidApp.manualUrl + "#importing")) } } if (!isValidPackageName(filename)) { return if (isAnkiDatabase(filename)) { // .anki2 files aren't supported by Anki Desktop, we should eventually support them, because we can // but for now, show a "nice" error. ImportResult.fromErrorString(context.resources.getString(R.string.import_error_load_imported_database)) } else { // Don't import if file doesn't have an Anki package extension ImportResult.fromErrorString(context.resources.getString(R.string.import_error_not_apkg_extension, filename)) } } else { // Copy to temporary file filename = ensureValidLength(filename) val tempOutDir = Uri.fromFile(File(context.cacheDir, filename)).encodedPath!! val errorMessage = if (copyFileToCache(context, data, tempOutDir)) null else context.getString(R.string.import_error_copy_to_cache) // Show import dialog if (errorMessage != null) { CrashReportService.sendExceptionReport(RuntimeException("Error importing apkg file"), "IntentHandler.java", "apkg import failed") return ImportResult.fromErrorString(errorMessage) } val validateZipResult = validateZipFile(context, tempOutDir) if (validateZipResult != null) { File(tempOutDir).delete() return validateZipResult } tempOutDirList.add(tempOutDir) } sendShowImportFileDialogMsg(tempOutDirList) } return ImportResult.fromSuccess() } private fun validateZipFile(ctx: Context, filePath: String): ImportResult? { val file = File(filePath) var zf: ZipFile? = null try { zf = ZipFile(file) } catch (e: Exception) { Timber.w(e, "Failed to validate zip") return ImportResult.fromInvalidZip(ctx, file, e) } finally { if (zf != null) { try { zf.close() } catch (e: IOException) { Timber.w(e, "Failed to close zip") } } } return null } private fun validateImportTypes(context: Context, dataList: ArrayList<Uri>): String? { var apkgCount = 0 var colpkgCount = 0 for (data in dataList) { var fileName = getFileNameFromContentProvider(context, data) when { isDeckPackage(fileName) -> { apkgCount += 1 } isCollectionPackage(fileName) -> { colpkgCount += 1 } } } if (apkgCount > 0 && colpkgCount > 0) { Timber.i("Both apkg & colpkg selected.") return context.resources.getString(R.string.import_error_colpkg_apkg) } else if (colpkgCount > 1) { Timber.i("Multiple colpkg files selected.") return context.resources.getString(R.string.import_error_multiple_colpkg) } return null } private fun isAnkiDatabase(filename: String?): Boolean { return filename != null && hasExtension(filename, "anki2") } private fun ensureValidLength(fileName: String): String { // #6137 - filenames can be too long when URLEncoded return try { val encoded = URLEncoder.encode(fileName, "UTF-8") if (encoded.length <= fileNameShorteningThreshold) { Timber.d("No filename truncation necessary") fileName } else { Timber.d("Filename was longer than %d, shortening", fileNameShorteningThreshold) // take 90 instead of 100 so we don't get the extension val substringLength = fileNameShorteningThreshold - 10 val shortenedFileName = encoded.substring(0, substringLength) + "..." + getExtension(fileName) Timber.d("Shortened filename '%s' to '%s'", fileName, shortenedFileName) // if we don't decode, % is double-encoded URLDecoder.decode(shortenedFileName, "UTF-8") } } catch (e: Exception) { Timber.w(e, "Failed to shorten file: %s", fileName) fileName } } @CheckResult private fun getExtension(fileName: String): String { val file = Uri.fromFile(File(fileName)) return MimeTypeMap.getFileExtensionFromUrl(file.toString()) } protected open fun getFileNameFromContentProvider(context: Context, data: Uri): String? { var filename: String? = null context.contentResolver.query(data, arrayOf(OpenableColumns.DISPLAY_NAME), null, null, null).use { cursor -> if (cursor != null && cursor.moveToFirst()) { filename = cursor.getString(0) Timber.d("handleFileImport() Importing from content provider: %s", filename) } } return filename } fun showImportUnsuccessfulDialog(activity: Activity, errorMessage: String?, exitActivity: Boolean) { Timber.e("showImportUnsuccessfulDialog() message %s", errorMessage) val title = activity.resources.getString(R.string.import_title_error) MaterialDialog(activity).show { title(text = title) message(text = errorMessage!!) positiveButton(R.string.dialog_ok) { if (exitActivity) { AnkiActivity.finishActivityWithFade(activity) } } } } /** * Copy the data from the intent to a temporary file * @param data intent from which to get input stream * @param tempPath temporary path to store the cached file * @return whether or not copy was successful */ protected open fun copyFileToCache(context: Context, data: Uri?, tempPath: String): Boolean { // Get an input stream to the data in ContentProvider val inputStream: InputStream? = try { context.contentResolver.openInputStream(data!!) } catch (e: FileNotFoundException) { Timber.e(e, "Could not open input stream to intent data") return false } // Check non-null @Suppress("FoldInitializerAndIfToElvis") if (inputStream == null) { return false } try { CompatHelper.compat.copyFile(inputStream, tempPath) } catch (e: IOException) { Timber.e(e, "Could not copy file to %s", tempPath) return false } finally { try { inputStream.close() } catch (e: IOException) { Timber.e(e, "Error closing input stream") } } return true } companion object { fun getUris(intent: Intent): ArrayList<Uri>? { if (intent.data == null) { Timber.i("No intent data. Attempting to read clip data.") if (intent.clipData == null || intent.clipData!!.itemCount == 0) { return null } val clipUriList: ArrayList<Uri> = ArrayList() // Iterate over clipUri & create clipUriList // Pass clipUri list. for (i in 0 until intent.clipData!!.itemCount) { intent.clipData?.getItemAt(i)?.let { clipUriList.add(it.uri) } } return clipUriList } // If Uri is of scheme which is supported by ContentResolver, read the contents val intentUriScheme = intent.data!!.scheme return if (intentUriScheme == ContentResolver.SCHEME_CONTENT || intentUriScheme == ContentResolver.SCHEME_FILE || intentUriScheme == ContentResolver.SCHEME_ANDROID_RESOURCE) { Timber.i("Attempting to read content from intent.") arrayListOf(intent.data!!) } else { null } } /** * Send a Message to AnkiDroidApp so that the DialogMessageHandler shows the Import apkg dialog. * @param pathList list of path(s) to apkg file which will be imported */ private fun sendShowImportFileDialogMsg(pathList: ArrayList<String>) { // Get the filename from the path val f = File(pathList.first()) val filename = f.name // Create a new message for DialogHandler so that we see the appropriate import dialog in DeckPicker val handlerMessage = Message.obtain() val msgData = Bundle() msgData.putStringArrayList("importPath", pathList) handlerMessage.data = msgData if (isCollectionPackage(filename)) { // Show confirmation dialog asking to confirm import with replace when file called "collection.apkg" handlerMessage.what = DialogHandler.MSG_SHOW_COLLECTION_IMPORT_REPLACE_DIALOG } else { // Otherwise show confirmation dialog asking to confirm import with add handlerMessage.what = DialogHandler.MSG_SHOW_COLLECTION_IMPORT_ADD_DIALOG } // Store the message in AnkiDroidApp message holder, which is loaded later in AnkiActivity.onResume DialogHandler.storeMessage(handlerMessage) } internal fun isDeckPackage(filename: String?): Boolean { return filename != null && filename.lowercase(Locale.ROOT).endsWith(".apkg") && "collection.apkg" != filename } fun hasExtension(filename: String, extension: String?): Boolean { val fileParts = filename.split("\\.".toRegex()).toTypedArray() if (fileParts.size < 2) { return false } val extensionSegment = fileParts[fileParts.size - 1] // either "apkg", or "apkg (1)". // COULD_BE_BETTE: accepts .apkgaa" return extensionSegment.lowercase(Locale.ROOT).startsWith(extension!!) } /** * Check if the InputStream is to a valid non-empty zip file * @param data uri from which to get input stream * @return whether or not valid zip file */ private fun hasValidZipFile(context: Context, data: Uri?): Boolean { // Get an input stream to the data in ContentProvider var inputStream: InputStream? = null try { inputStream = context.contentResolver.openInputStream(data!!) } catch (e: FileNotFoundException) { Timber.e(e, "Could not open input stream to intent data") } // Make sure it's not null if (inputStream == null) { Timber.e("Could not open input stream to intent data") return false } // Open zip input stream val zis = ZipInputStream(inputStream) var ok = false try { try { val ze = zis.nextEntry if (ze != null) { // set ok flag to true if there are any valid entries in the zip file ok = true } } catch (e: Exception) { // don't set ok flag Timber.d(e, "Error checking if provided file has a zip entry") } } finally { // close the input streams try { zis.close() inputStream.close() } catch (e: Exception) { Timber.d(e, "Error closing the InputStream") } } return ok } } } class ImportResult(val humanReadableMessage: String?) { val isSuccess: Boolean get() = humanReadableMessage == null companion object { fun fromErrorString(message: String?): ImportResult { return ImportResult(message) } fun fromSuccess(): ImportResult { return ImportResult(null) } fun fromInvalidZip(ctx: Context, file: File, e: Exception): ImportResult { return fromErrorString(getInvalidZipException(ctx, file, e)) } private fun getInvalidZipException(ctx: Context, @Suppress("UNUSED_PARAMETER") file: File, e: Exception): String { // This occurs when there is random corruption in a zip file if (e is IOException && "central directory is empty, can't expand corrupt archive." == e.message) { return ctx.getString(R.string.import_error_corrupt_zip, e.getLocalizedMessage()) } // 7050 - this occurs when a file is truncated at the end (partial download/corrupt). if (e is ZipException && "archive is not a ZIP archive" == e.message) { return ctx.getString(R.string.import_error_corrupt_zip, e.getLocalizedMessage()) } // If we don't have a good string, send a silent exception that we can better handle this in the future CrashReportService.sendExceptionReport(e, "Import - invalid zip", "improve UI message here", true) return ctx.getString(R.string.import_log_failed_unzip, e.localizedMessage) } } } }
AnkiDroid/src/main/java/com/ichi2/utils/ImportUtils.kt
4175607880
package de.christinecoenen.code.zapp.persistence import androidx.room.TypeConverter import org.joda.time.DateTime class DateTimeConverter { companion object { @TypeConverter @JvmStatic fun fromDownloadStatus(value: DateTime?): Long { return value?.toDateTimeISO()?.millis ?: 0L } @TypeConverter @JvmStatic fun toDownloadStatus(value: Long): DateTime? { return if (value == 0L) null else DateTime(value) } } }
app/src/main/java/de/christinecoenen/code/zapp/persistence/DateTimeConverter.kt
3318428599
/**************************************************************************************** * Copyright (c) 2014 Michael Goldbach <[email protected]> * * * * This program is free software; you can redistribute it and/or modify it under * * the terms of the GNU General Public License as published by the Free Software * * Foundation; either version 3 of the License, or (at your option) any later * * version. * * * * This program is distributed in the hope that it will be useful, but WITHOUT ANY * * WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS FOR A * * PARTICULAR PURPOSE. See the GNU General Public License for more details. * * * * You should have received a copy of the GNU General Public License along with * * this program. If not, see <http://www.gnu.org/licenses/>. * ****************************************************************************************/ package com.wildplot.android.parsing import java.lang.IllegalArgumentException class ExpressionFormatException : IllegalArgumentException { constructor() : super() constructor(detailMessage: String?) : super(detailMessage) }
AnkiDroid/src/main/java/com/wildplot/android/parsing/ExpressionFormatException.kt
249762208
package com.easternedgerobotics.rov.value data class PortAftSpeedValue(override val speed: Float = 0f) : SpeedValue { constructor() : this(0f) }
src/main/kotlin/com/easternedgerobotics/rov/value/PortAftSpeedValue.kt
112049747
package com.sergey.spacegame.client.ui.scene2d import com.badlogic.ashley.core.Entity import com.badlogic.ashley.core.Family import com.badlogic.ashley.utils.ImmutableArray import com.badlogic.gdx.Gdx import com.badlogic.gdx.graphics.g2d.Batch import com.badlogic.gdx.graphics.g2d.TextureRegion import com.badlogic.gdx.math.Matrix3 import com.badlogic.gdx.math.Rectangle import com.badlogic.gdx.math.Vector2 import com.badlogic.gdx.scenes.scene2d.utils.Drawable import com.badlogic.gdx.scenes.scene2d.utils.ScissorStack import com.sergey.spacegame.common.ecs.component.PositionComponent import com.sergey.spacegame.common.ecs.component.SizeComponent import com.sergey.spacegame.common.ecs.component.Team1Component import com.sergey.spacegame.common.ecs.component.Team2Component import com.sergey.spacegame.common.ecs.component.VisualComponent import com.sergey.spacegame.common.game.Level /** * A class that represents a drawable for a minimap * * @author sergeys * * @constructor Creates a new MinimapDrawable * @property team1 - the texture region used to represent something from team 1 * @property team2 - the texture region used to represent something from team 2 * @property neutral - the texture region used to represent something not on a team * @property white - a texture region representing a white pixel * @property level - the level that this minimap should represent * @property screen - a rectangle representing the area of the world that the screen covers */ class MinimapDrawable(val team1: TextureRegion, val team2: TextureRegion, val neutral: TextureRegion, val white: TextureRegion, val level: Level, val screen: Rectangle) : Drawable { private var _minHeight: Float = 1f private var _minWidth: Float = 1f private var _rightWidth: Float = 0f private var _leftWidth: Float = 0f private var _bottomHeight: Float = 0f private var _topHeight: Float = 0f private val team1Entities = level.ecs.getEntitiesFor(Family.all(Team1Component::class.java, VisualComponent::class.java, PositionComponent::class.java).get()) private val team2Entities = level.ecs.getEntitiesFor(Family.all(Team2Component::class.java, VisualComponent::class.java, PositionComponent::class.java).get()) private val neutralEntities = level.ecs.getEntitiesFor(Family.all(VisualComponent::class.java, PositionComponent::class.java).exclude(Team1Component::class.java, Team2Component::class.java).get()) private val projection = Matrix3() private val invProjection = Matrix3() private val VEC = Vector2() private var scaleX: Float = 1f private var scaleY: Float = 1f private var dragging: Boolean = false override fun draw(batch: Batch, x: Float, y: Float, width: Float, height: Float) { //Create our projection matrix projection.setToTranslation(x - level.limits.minX, y - level.limits.minY) scaleX = width / level.limits.width scaleY = height / level.limits.height projection.scale(scaleX, scaleY) //Create the inverse of the projection matrix invProjection.set(projection).inv() //Calculate the position of the camera as of this frame val x1 = VEC.set(screen.x - screen.width / 2, screen.y - screen.height / 2).mul(projection).x val y1 = VEC.y val x2 = VEC.set(screen.x + screen.width / 2, screen.y + screen.height / 2).mul(projection).x val y2 = VEC.y //Render the camera's position batch.draw(white, x1, y1, x2 - x1, 1f) //Bottom batch.draw(white, x1, y1, 1f, y2 - y1) //Left batch.draw(white, x1, y2, x2 - x1, 1f) //Top batch.draw(white, x2, y1, 1f, y2 - y1) //Right //Border batch.draw(white, x, y, width, 1f) //Bottom batch.draw(white, x, y, 1f, height) //Left batch.draw(white, x, y + height, width, 1f) //Top batch.draw(white, x + width, y, 1f, height) //Right //If it is controllable then allow the user to click to move the camera if (level.viewport.viewportControllable) { if (Gdx.input.justTouched() && Gdx.input.isTouched && Gdx.input.x in x..(x + width) && (Gdx.graphics.height - Gdx.input.y) in y..(y + height)) { dragging = true } //Allow the user to drag around the position of the camera (invalid locaitons will be corrected in GameScreen#render if (dragging && Gdx.input.isTouched && Gdx.input.x in x..(x + width) && (Gdx.graphics.height - Gdx.input.y) in y..(y + height)) { VEC.set(Gdx.input.x.toFloat(), (Gdx.graphics.height - Gdx.input.y).toFloat()).mul(invProjection) screen.x = VEC.x screen.y = VEC.y } else { dragging = false } } else { dragging = false } //Draw the previous things with clipping batch.flush() //Enable clipping val pushed = ScissorStack.pushScissors(Rectangle(x, y, width, height)) //Draw all of the entities drawEntities(neutralEntities, batch, neutral, scaleX, scaleY) drawEntities(team2Entities, batch, team2, scaleX, scaleY) drawEntities(team1Entities, batch, team1, scaleX, scaleY) //Push it to the screen batch.flush() //Remove the clipping if (pushed) ScissorStack.popScissors() } private fun drawEntities(array: ImmutableArray<Entity>, batch: Batch, region: TextureRegion, scaleX: Float, scaleY: Float) { for (entity in array) { PositionComponent.MAPPER.get(entity).setVector(VEC).mul(projection) val sizeComponent = SizeComponent.MAPPER.get(entity) if (sizeComponent == null) { batch.draw(region, VEC.x - defaultWidth * scaleX / 2, VEC.y - defaultHeight * scaleY / 2, defaultWidth * scaleX, defaultWidth * scaleY) } else { batch.draw(region, VEC.x - sizeComponent.w * scaleX / 2, VEC.y - sizeComponent.h * scaleY / 2, sizeComponent.w * scaleX, sizeComponent.h * scaleY) } } } override fun setRightWidth(rightWidth: Float) { _rightWidth = rightWidth } override fun getLeftWidth(): Float = _leftWidth override fun setMinHeight(minHeight: Float) { _minHeight = minHeight } override fun setBottomHeight(bottomHeight: Float) { _bottomHeight = bottomHeight } override fun setTopHeight(topHeight: Float) { _topHeight = topHeight } override fun getBottomHeight(): Float = _bottomHeight override fun getRightWidth(): Float = _rightWidth override fun getMinWidth(): Float = _minWidth override fun getTopHeight(): Float = _topHeight override fun setMinWidth(minWidth: Float) { _minWidth = minWidth } override fun setLeftWidth(leftWidth: Float) { _leftWidth = leftWidth } override fun getMinHeight(): Float = _minHeight private companion object { val defaultWidth = 10f val defaultHeight = 10f } }
desktop/src/com/sergey/spacegame/client/ui/scene2d/MinimapDrawable.kt
2931462141
/* * Copyright (c) 2018. * * This file is part of ProcessManager. * * ProcessManager is free software: you can redistribute it and/or modify it under the terms of version 3 of the * GNU Lesser General Public License as published by the Free Software Foundation. * * ProcessManager is distributed in the hope that it will be useful, but WITHOUT ANY WARRANTY; without even * the implied warranty of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the * GNU Lesser General Public License for more details. * * You should have received a copy of the GNU Lesser General Public License along with ProcessManager. If not, * see <http://www.gnu.org/licenses/>. */ package uk.ac.bournemouth.darwin.html import io.github.pdvrieze.darwin.servlet.support.ServletRequestInfo import io.github.pdvrieze.darwin.servlet.support.darwinError import io.github.pdvrieze.darwin.servlet.support.darwinResponse import io.github.pdvrieze.darwin.servlet.support.htmlAccepted import kotlinx.html.* import net.devrieze.util.nullIfNot import net.devrieze.util.overrideIf import nl.adaptivity.xmlutil.XmlStreaming import nl.adaptivity.xmlutil.XmlWriter import nl.adaptivity.xmlutil.smartStartTag import nl.adaptivity.xmlutil.writeAttribute import uk.ac.bournemouth.darwin.accounts.* import uk.ac.bournemouth.darwin.sharedhtml.darwinDialog import uk.ac.bournemouth.darwin.sharedhtml.loginDialog import uk.ac.bournemouth.darwin.sharedhtml.setAliasDialog import java.net.URI import java.net.URLEncoder import java.security.MessageDigest import java.security.Principal import java.text.DateFormat import java.util.* import java.util.logging.Level import java.util.logging.Logger import javax.mail.Message import javax.mail.Session import javax.mail.Transport import javax.mail.internet.InternetAddress import javax.mail.internet.MimeMessage import javax.servlet.ServletConfig import javax.servlet.ServletException import javax.servlet.annotation.MultipartConfig import javax.servlet.http.Cookie import javax.servlet.http.HttpServlet import javax.servlet.http.HttpServletRequest import javax.servlet.http.HttpServletResponse //internal const val MAXTOKENLIFETIME = 864000 /* Ten days */ //internal const val MAXCHALLENGELIFETIME = 60 /* 60 seconds */ //internal const val MAX_RESET_VALIDITY = 1800 /* 12 hours */ /* * This file contains the functionality needed for managing accounts on darwin. This includes the underlying database * interaction through [AccountDb] as well as web interaction through [AccountController]. */ /** Create a SHA1 digest of the source */ internal fun sha1(src: ByteArray): ByteArray = MessageDigest.getInstance("SHA1").digest(src) const val DBRESOURCE = "java:comp/env/jdbc/webauthadm" @MultipartConfig class AccountController : HttpServlet() { companion object { private val log = Logger.getLogger(AccountController::class.java.name) const val FIELD_USERNAME = "username" const val FIELD_PASSWORD = "password" const val FIELD_PUBKEY = "pubkey" const val FIELD_REDIRECT = "redirect" const val FIELD_KEYID = "keyid" const val FIELD_ALIAS = "alias" const val FIELD_APPNAME = "app" const val FIELD_RESPONSE = "response" const val FIELD_RESETTOKEN = "resettoken" const val FIELD_NEWPASSWORD1 = "newpassword1" const val FIELD_NEWPASSWORD2 = "newpassword2" const val SC_UNPROCESSIBLE_ENTITY = 422 const val CHALLENGE_VERSION = "2" const val HEADER_CHALLENGE_VERSION = "X-Challenge-version" const val MIN_RESET_DELAY = 60 * 1000 // 60 seconds between reset requests } private inline fun <R> accountDb(block: AccountDb.() -> R): R = accountDb(DBRESOURCE, block) private val logger = Logger.getLogger(AccountController::class.java.name) override fun init(config: ServletConfig?) { super.init(config) logger.info("Initialising AccountController (ensuring that the required database tables are available)") accountDb { this.ensureTables() } } override fun doGet(req: HttpServletRequest, resp: HttpServletResponse) { val realPath = if (req.requestURI.startsWith(req.contextPath)) { req.requestURI.substring(req.contextPath.length) } else req.pathInfo when (realPath) { "/login" -> tryLogin(req, resp) "/logout" -> logout(req, resp) "/challenge" -> challenge(req, resp) "/chpasswd" -> chpasswd(req, resp) "/regkey" -> resp.darwinError(req, "HTTP method GET is not supported by this URL", HttpServletResponse.SC_METHOD_NOT_ALLOWED, "Get not supported") "/forget" -> forgetKey(req, resp) "/", null, "/myaccount" -> myAccount(req, resp) "/setAliasForm" -> setAliasForm(req, resp) "/resetpasswd" -> resetPassword(req, resp) "/js/main.js" -> mainJs(req, resp) else -> resp.darwinError(req, "The resource ${req.contextPath}${req.pathInfo ?: ""} was not found", HttpServletResponse.SC_NOT_FOUND, "Not Found") } } override fun doPost(req: HttpServletRequest, resp: HttpServletResponse) { when (req.pathInfo) { "/login" -> tryCredentials(req, resp) "/challenge" -> challenge(req, resp) "/chpasswd" -> chpasswd(req, resp) "/regkey" -> registerkey(req, resp) "/forget" -> forgetKey(req, resp) else -> resp.darwinError(req, "The resource ${req.contextPath}${req.pathInfo} was not found", HttpServletResponse.SC_NOT_FOUND, "Not Found") } } private fun setAliasForm(req: HttpServletRequest, resp: HttpServletResponse) { authenticatedResponse(req, resp) { val user: String = req.userPrincipal.name val oldAlias: String? = req.getParameter(FIELD_ALIAS).nullIfNot { length > 0 } val displayName: String = oldAlias.overrideIf { isBlank() } by user resp.darwinResponse(req, "My Account", "My Account - $displayName") { setAliasDialog(oldAlias) } } } private fun mainJs(req: HttpServletRequest, resp: HttpServletResponse) { resp.contentType = "text/javascript" resp.writer.use { out -> out.println(""" require.config({ baseUrl:"/js", paths: { "accountmgr": "${req.contextPath}/js/accountmgr" } }); requirejs(['accountmgr'], function (accountmgr){ accountmgr.updateLinks() }) """.trimIndent()) } } private data class AccountInfo( val username: String, val alias: String?, val fullname: String?, val isLocalPassword: Boolean, val keys: List<KeyInfo>) { fun toXmlWriter(writer: XmlWriter) { writer.smartStartTag(null, "account") { writeAttribute("username", username) alias?.let { writeAttribute("alias", it) } fullname?.let { writeAttribute("fullname", it) } writeAttribute("isLocalPassword", if(isLocalPassword) "yes" else "no") for (key in keys) { key.toXmlWriter(writer) } } } } private fun myAccount(req: HttpServletRequest, resp: HttpServletResponse) { authenticatedResponse(req, resp) { val user: String = req.userPrincipal.name val info = accountDb { val alias = alias(user) val fullname = fullname(user) val isLocal = isLocalAccount(user) val keys = keyInfo(user) AccountInfo(user, alias, fullname, isLocal, keys) } if (req.htmlAccepted) { val displayName = if (info.alias.isNullOrBlank()) (info.fullname ?: user) else info.alias resp.darwinResponse(req, "My Account", "My Account - $displayName") { section { h1 { +"Account" } p { if (info.alias == null) { val encodedDisplayName = URLEncoder.encode(displayName, "UTF-8") a(href = "${context.accountMgrPath}setAliasForm?$FIELD_ALIAS=$encodedDisplayName") { id = "accountmgr.setAlias" attributes["alias"] = displayName +"Set alias" } } else { +"Alias: ${info.alias} " a(href = "${context.accountMgrPath}setAliasForm?$FIELD_ALIAS=${info.alias}") { id = "accountmgr.setAlias" attributes["alias"] = info.alias +"change" } } } if (info.isLocalPassword) p { a(href = "chpasswd") { +"change password" } } } val keys = info.keys if (keys.isNotEmpty()) { section { h1 { +"Authorizations" } table { thead { tr { th { +"Application" }; th { +"Last use" }; th {} } } tbody { for (key in keys) { tr { classes += "authkey" td { +(key.appname ?: "<unknown>") } td { +(key.lastUse?.let { DateFormat.getDateTimeInstance().format(it) } ?: "never") } td { a(href = "${context.accountMgrPath}forget?$FIELD_KEYID=${key.keyId}", classes = "forget_key_class") { attributes["keyid"] = key.keyId.toString() +"forget" } } } } } } } } } } else { resp.contentType = "text/xml" resp.characterEncoding="UTF8" resp.outputStream.use { XmlStreaming.newWriter(it, "UTF8").use { writer -> writer.startDocument(null, null, null) info.toXmlWriter(writer) writer.endDocument() } } } } } private fun registerkey(req: HttpServletRequest, resp: HttpServletResponse) { val username = req.getParameter(FIELD_USERNAME) val password = req.getParameter(FIELD_PASSWORD) val keyid = req.getParameter(FIELD_KEYID) log.finer("registerkey called with username: $username password: ${"?".repeat(password.length)} keyid: $keyid") if (username.isNullOrEmpty() || password.isNullOrEmpty()) { resp.darwinError(req, "Missing credentials", HttpServletResponse.SC_FORBIDDEN, "Missing credentials") log.warning("Missing credentials attempting to register key") } else { val pubkey = req.getParameter(FIELD_PUBKEY) val appname: String? = req.getParameter(FIELD_APPNAME) log.finer("registerkey: appname=$appname pubkey.length=${pubkey.length}") accountDb(DBRESOURCE) { if (verifyCredentials(username, password)) { if (pubkey.isNullOrBlank()) { resp.contentType = "text/plain" resp.writer.use { it.append("authenticated:").appendLine(username) log.warning("registerkey: User authenticated but missing public key to register") } } else { try { val newKeyId = registerkey(username, pubkey, appname, keyid?.toInt()) resp.contentType = "text/plain" resp.writer.use { it.append("key:").appendLine(newKeyId.toString()) } log.fine("registerkey: registered key with id: $newKeyId") } catch (e: NumberFormatException) { resp.darwinError( req, "Invalid key format", SC_UNPROCESSIBLE_ENTITY, "UNPROCESSIBLE ENTITY", e ) } } } else { resp.darwinError(req, "Invalid credentials", HttpServletResponse.SC_FORBIDDEN, "Invalid credentials") log.info("Invalid authentication for user $username") } } } } private fun forgetKey(req: HttpServletRequest, resp: HttpServletResponse) { authenticatedResponse(req, resp) { val user = req.userPrincipal.name val keyid: Int = try { req.getParameter(FIELD_KEYID)?.toInt() ?: throw NumberFormatException("Missing keyId") } catch (e: NumberFormatException) { resp.darwinError(req, "Invalid or missing key id (id:${req.getParameter(FIELD_KEYID)}, error:${e.message})", SC_UNPROCESSIBLE_ENTITY, "UNPROCESSIBEL ENTITY") return } try { accountDb { this.forgetKey(user, keyid) } } catch (e: IllegalArgumentException) { resp.darwinError(req, "Key not owned", HttpServletResponse.SC_FORBIDDEN, "FORBIDDEN", e) return } if (req.htmlAccepted) { // Just display the account manager dialog resp.sendRedirect("${RequestServiceContext(ServletRequestInfo(req)).accountMgrPath}myaccount") } else { resp.status = HttpServletResponse.SC_NO_CONTENT resp.writer.close() } } } private fun tryCredentials(req: HttpServletRequest, resp: HttpServletResponse) { logger.info("Received username and password for login") val username = req.getParameter(FIELD_USERNAME) val password = req.getParameter(FIELD_PASSWORD) val redirect = req.getParameter(FIELD_REDIRECT) if (username == null || password == null) { tryLogin(req, resp) } else { try { if (req.authType != null || req.remoteUser != null || req.userPrincipal != null) { // already authenticated req.logout() // first log out. Then log in again } req.login(username, password) // this throws on failure logger.fine("Login successful") accountDb { if (redirect != null) { resp.sendRedirect(resp.encodeRedirectURL(redirect)) } else { if (req.htmlAccepted) { loginSuccess(req, resp) } else { resp.writer.use { it.append("login:").appendLine(username) } } } } } catch (e: ServletException) { logger.log(Level.WARNING, "Failure in authentication", e) invalidCredentials(req, resp) } } } private fun createAuthCookie(authtoken: String) = Cookie(DARWINCOOKIENAME, authtoken).let { it.maxAge = MAXTOKENLIFETIME; it.path = "/"; it } private fun HttpServletRequest.isAuthenticated(resp: HttpServletResponse): Boolean { if (userPrincipal != null) { return true } else { if (pathInfo != "/login") { if (authenticate(resp)) { if (userPrincipal != null) { return true } } } } return false } private inline fun authenticatedResponse(req: HttpServletRequest, resp: HttpServletResponse, block: () -> Unit) { if (req.isAuthenticated(resp)) { // if (req.userPrincipal!=null || (req.pathInfo!="/login" && req.authenticate(resp) && req.userPrincipal!=null)) { block() } else { if (req.htmlAccepted) { loginScreen(req, resp) } else { resp.status = HttpServletResponse.SC_UNAUTHORIZED resp.writer.use { it.appendLine("error:Login is required\n") } } } } private inline fun authenticatedResponse(req: HttpServletRequest, resp: HttpServletResponse, condition: (HttpServletRequest) -> Boolean, block: () -> Unit) { if (req.isAuthenticated(resp) && condition(req)) { block() } else { if (req.htmlAccepted) { loginScreen(req, resp) } else { resp.status = HttpServletResponse.SC_UNAUTHORIZED resp.writer.use { it.appendLine("error:Login is required\n") } } } } private fun tryLogin(req: HttpServletRequest, resp: HttpServletResponse) { authenticatedResponse(req, resp) { accountDb { val redirect = req.getParameter(FIELD_REDIRECT) if (redirect != null) { resp.sendRedirect(resp.encodeRedirectURL(redirect)) } else { loginSuccess(req, resp) } } } } private fun logout(req: HttpServletRequest, resp: HttpServletResponse) { req.logout() if (req.htmlAccepted) { loginScreen(req, resp) } else { resp.contentType = "text/plain" resp.writer.use { it.appendLine("logout") } } } private fun challenge(req: HttpServletRequest, resp: HttpServletResponse) { val keyId = req.getParameter(FIELD_KEYID)?.toInt() if (keyId == null) { resp.darwinError(req, "Insufficient credentials", 403, "Forbidden"); return } val responseParam = req.getParameter(FIELD_RESPONSE) if (responseParam == null) { issueChallenge(req, resp, keyId) } else { val response = try { Base64.getUrlDecoder().decode(responseParam) } catch (e: IllegalArgumentException) { Base64.getDecoder().decode(responseParam) } handleResponse(req, resp, keyId, response) } } private fun handleResponse(req: HttpServletRequest, resp: HttpServletResponse, keyId: Int, response: ByteArray) { try { accountDb { val user = userFromChallengeResponse(keyId, req.remoteAddr, response) if (user != null) { val authtoken = createAuthtoken(user, req.remoteAddr, keyId) resp.addHeader("Content-type", "text/plain") resp.addCookie(createAuthCookie(authtoken)) resp.writer.use { it.append(authtoken) } } else { resp.sendError(HttpServletResponse.SC_UNAUTHORIZED) } } } catch (e: AuthException) { resp.darwinError(request = req, message = e.message, code = e.errorCode, cause = e) } } private fun issueChallenge(req: HttpServletRequest, resp: HttpServletResponse, keyid: Int) { accountDb { cleanChallenges() val challenge: String try { challenge = newChallenge( keyid, req.remoteAddr ) // This should fail on an incorrect keyid due to integrity constraints } catch (e: AuthException) { resp.contentType = "text/plain" resp.status = e.errorCode resp.writer.use { it.appendLine("INVALID REQUEST") } if (e.errorCode == HttpServletResponse.SC_NOT_FOUND) { // missing code return } throw e } resp.contentType = "text/plain" resp.setHeader(HEADER_CHALLENGE_VERSION, CHALLENGE_VERSION) resp.writer.use { it.appendLine(challenge) } } } private class wrapUser(val req: HttpServletRequest, val username: String) : HttpServletRequest by req { override fun getUserPrincipal(): Principal { return Principal { username } } override fun isUserInRole(role: String): Boolean { return accountDb { isUserInRole(username, role) } } override fun getAuthType() = HttpServletRequest.FORM_AUTH } private fun showChangeScreen(req: HttpServletRequest, resp: HttpServletResponse, message: String? = null, resetToken: String? = null, changedUser: String? = null) { resp.darwinResponse(request = req, windowTitle = "Change password") { darwinDialog("Change password") { if (message != null) div("warning") { +message } form(method = FormMethod.post) { acceptCharset = "UTF-8" if (resetToken != null) input(type = InputType.hidden) { value = resetToken } table { style = "border:none" if (resetToken != null || req.isUserInRole("admin")) { tr { td { label { htmlFor = "#$FIELD_USERNAME"; +"Username:" } } td { input(name = FIELD_USERNAME, type = InputType.text) { if (resetToken != null) { disabled = true } if (changedUser != null) { value = changedUser } } } } } else { tr { td { label { htmlFor = "#$FIELD_PASSWORD"; +"Current password:" } } td { input(name = FIELD_PASSWORD, type = InputType.password) } } } tr { td { label { htmlFor = "#$FIELD_NEWPASSWORD1"; +"New password:" } } td { input(name = FIELD_NEWPASSWORD1, type = InputType.password) } } tr { td { label { htmlFor = "#$FIELD_NEWPASSWORD2"; +"Repeat new password:" } } td { input(name = FIELD_NEWPASSWORD2, type = InputType.password) } } } span { style = "margin-top: 1em; float:right" input(type = InputType.submit) { value = "Change" } } } } } } private fun chpasswd(req: HttpServletRequest, resp: HttpServletResponse) { val resetToken = req.getParameter(FIELD_RESETTOKEN).let { if (it.isNullOrBlank()) null else it } if (req.userPrincipal == null && resetToken == null) { // No user identification, require login first resp.sendRedirect(resp.encodeRedirectURL("${req.servletPath}/login?redirect=${req.servletPath}/chpasswd")) return } val changedUser: String? = req.getParameter(FIELD_USERNAME).let { if (it.isNullOrBlank()) null else it } val origPasswd: String? = req.getParameter(FIELD_PASSWORD).let { if (it.isNullOrBlank()) null else it } val newPasswd1: String? = req.getParameter(FIELD_NEWPASSWORD1).let { if (it.isNullOrBlank()) null else it } val newPasswd2: String? = req.getParameter(FIELD_NEWPASSWORD2).let { if (it.isNullOrBlank()) null else it } if (changedUser == null || newPasswd1 == null || newPasswd2 == null) { showChangeScreen(req = req, resp = resp, resetToken = resetToken, changedUser = changedUser) return } if (resetToken == null) req.login(changedUser, origPasswd) // check the username/password again, if there is no reset token if (newPasswd1 != newPasswd2) { val message = if (origPasswd == null) { "Please provide two identical copies of the new password" } else { "Please provide all of the current password and two copies of the new one" } showChangeScreen(req, resp, message = message, resetToken = resetToken) return } if (newPasswd1.length < 6) { showChangeScreen(req, resp, message = "The new passwords must be at lest 6 characters long", resetToken = resetToken, changedUser = changedUser) return } accountDb { val requestingUser = req.userPrincipal?.name ?: changedUser if (req.isUserInRole("admin")) { if (updateCredentials(changedUser, newPasswd1)) { resp.darwinResponse(req, "Password Changed") { darwinDialog("Successs") { div { +"The password has been changed successfully" } } } } else { resp.darwinError(req, "Failure updating password") } } else { if (requestingUser == changedUser && resetToken != null && verifyResetToken(changedUser, resetToken)) { if (updateCredentials(changedUser, newPasswd1)) { resp.darwinResponse(req, "Password Changed") { darwinDialog("Successs") { div { +"The password has been changed successfully" } } } } else { resp.darwinError(req, "Failure updating password") } } else { resp.darwinError(req, "The given reset token is invalid or expired") } } } } private fun loginSuccess(req: HttpServletRequest, resp: HttpServletResponse) { val userName = req.userPrincipal?.name if (userName == null) { loginScreen(req, resp) } else { if (req.htmlAccepted) { resp.darwinResponse(request = req, windowTitle = "Welcome", pageTitle = "Welcome - Login successful") { p { +"Congratulations with successfully authenticating on darwin." } } } else { resp.writer.use { it.append("login:").appendLine(userName) } } } } private fun invalidCredentials(req: HttpServletRequest, resp: HttpServletResponse) { resp.status = HttpServletResponse.SC_UNAUTHORIZED if (req.htmlAccepted) { loginScreen(req, resp, "Username or password not correct") } else { resp.writer.use { it.appendLine("invalid:Invalid credentials") } } } private fun loginScreen(req: HttpServletRequest, resp: HttpServletResponse, errorMsg: String? = null) { val redirect = req.getParameter("redirect") ?: if (req.pathInfo == "/login") null else req.requestURL.toString() resp.darwinResponse(req, "Please log in") { this.loginDialog(context, errorMsg, req.getParameter("username"), null, redirect, false) /* this.darwinDialog("Log in", positiveButton = null) { if (errorMsg!=null) { div("errorMsg") { +errorMsg } } form(action = "login", method = FormMethod.post, encType = FormEncType.applicationXWwwFormUrlEncoded) { acceptCharset="utf8" val redirect:String? = req.getParameter("redirect") if(redirect!=null) { input(name=FIELD_REDIRECT, type = InputType.hidden) { value = redirect } } val requestedUsername= req.getParameter("username") table { style = "border:none" tr { td { label { for_='#'+FIELD_USERNAME +"User name:" } } td { input(name=FIELD_USERNAME, type= InputType.text) { if (requestedUsername!=null) { value=requestedUsername } } } } tr { td { label { for_='#'+FIELD_PASSWORD +"Password:" } } td { input(name=FIELD_PASSWORD, type= InputType.password) } } } // table span { style="margin-top: 1em; float: right;" input(type= InputType.submit) { value="Log in" } } div { id="forgotpasswd" a(href=req.contextPath+"/resetpasswd") } } } */ } } private fun resetPassword(req: HttpServletRequest, resp: HttpServletResponse) { val mailProperties = Properties() val user = req.getParameter(FIELD_USERNAME) if (user.isNullOrBlank()) { requestResetDialog(req, resp) } else { accountDb { if (!isUser(user)) throw AuthException("Unable to reset", errorCode = HttpServletResponse.SC_BAD_REQUEST) val lastReset = lastReset(user)?.time ?: 0 if (nowSeconds - lastReset < MIN_RESET_DELAY) throw AuthException("Too many reset attempts, try later", errorCode = 429) val resetToken = generateResetToken(user) val mailSession = Session.getDefaultInstance(mailProperties) val message = MimeMessage(mailSession) val resetUrl = URI(req.scheme, null, req.serverName, req.serverPort, req.requestURI, "?$FIELD_USERNAME=${URLEncoder.encode(user, "UTF8")}&$FIELD_RESETTOKEN=${URLEncoder.encode( resetToken, "UTF8")}", null).toString() message.addRecipient(Message.RecipientType.TO, InternetAddress("[email protected]", user)) message.subject = "Darwin account password reset" message.setContent(""" <html><head><title>Darwin account password reset</title></head><body> <p>Please visit <a href="$resetUrl">$resetUrl</a> to reset your password.</p> <p>This token will be valid for 30 minutes. If you didn't initiate the reset, you can safely ignore this message</p> </body></html> """.trimIndent(), "text/html") Transport.send(message) } resp.darwinResponse(req, "Reset request sent") { darwinDialog("Reset request sent") { p { +"A reset token has been sent to your email address. Please follow the instructions in the email." } } } } } private fun requestResetDialog(req: HttpServletRequest, resp: HttpServletResponse) { resp.darwinResponse(req, "Provide username") { darwinDialog("Give your username") { p { this.style = "width:22em" +"Please provide your BU username such that a reset email can be sent to your email address." } form(action = "/resetpasswd", method = FormMethod.post) { table { tr { th { label { htmlFor = FIELD_USERNAME; +"User name:" } } td { input(name = FIELD_USERNAME, type = InputType.text) +"@bournemouth.ac.uk" } } } span { style = "margin-top: 1em; float: right;" input(type = InputType.reset) { onClick = "window.location='/'" } input(type = InputType.submit) { value = "Request reset" } } } } } } }
accountmgr/src/main/kotlin/uk/ac/bournemouth.darwin.html/AccountController.kt
1171450283
package com.moviereel.utils.toolbox import android.support.v7.util.DiffUtil import android.support.v7.widget.RecyclerView import org.jetbrains.anko.doAsync import org.jetbrains.anko.uiThread import java.util.* /** * @author lusinabrian on 27/07/17. * @Notes Does diffing for adapters in class * This is a utility that allows all adapters to update their data in a background thread and * perform asynchronous updates * @param oldItemList old items * @param newItemList new item list * @param adapter adapter to update */ class MovieReelDiffTool<T, VH : RecyclerView.ViewHolder>( var oldItemList: ArrayList<T>, var pendingUpdates: ArrayDeque<ArrayList<T>>, var adapter: RecyclerView.Adapter<VH>) { /** * This performs a diff on the adapter * */ fun performDiff(newItemList: ArrayList<T>) { pendingUpdates.add(newItemList) if (pendingUpdates.size > 1) { return } updateItemsInternal(newItemList) } fun updateItemsInternal(newItemList: ArrayList<T>) { doAsync { val diff = MovieReelDiffUtilCallback(oldItemList, newItemList) val diffResult = DiffUtil.calculateDiff(diff) uiThread { applyDiffResult(newItemList, diffResult) } } // val handler = Handler() // Thread(Runnable { // val diff = MovieReelDiffUtilCallback(oldItemList, newItemList) // val diffResult = DiffUtil.calculateDiff(diff) // // handler.post({ // applyDiffResult(newItemList, diffResult) // }) // }).start() } /** * Applyes the diff result to the new items which will apply th dispatch * to the adapter * @param newItemList * @param diffResult, result from Diffing of new and old items * */ fun applyDiffResult(newItemList: ArrayList<T>, diffResult: DiffUtil.DiffResult) { pendingUpdates.remove() // dispatch updates dispatchUpdates(newItemList, diffResult) if (pendingUpdates.size > 0) { performDiff(pendingUpdates.peek()) } } /** * Dispatches updates to adapter with new items and diff result * @param newItems new items to add to adapter * @param diffResult diff result from callback * */ fun dispatchUpdates(newItems: ArrayList<T>, diffResult: DiffUtil.DiffResult) { diffResult.dispatchUpdatesTo(adapter) oldItemList.clear() oldItemList.addAll(newItems) } }
app/src/main/kotlin/com/moviereel/utils/toolbox/MovieReelDiffTool.kt
1866494038
package org.wordpress.android.fluxc.persistence import com.wellsql.generated.PostSchedulingReminderTable import com.yarolegovich.wellsql.WellSql import com.yarolegovich.wellsql.core.Identifiable import com.yarolegovich.wellsql.core.annotation.Column import com.yarolegovich.wellsql.core.annotation.PrimaryKey import com.yarolegovich.wellsql.core.annotation.Table import javax.inject.Inject import javax.inject.Singleton @Singleton class PostSchedulingNotificationSqlUtils @Inject constructor() { fun insert( postId: Int, scheduledTime: SchedulingReminderDbModel.Period ): Int? { WellSql.insert( PostSchedulingReminderBuilder( postId = postId, scheduledTime = scheduledTime.name ) ).execute() return WellSql.select(PostSchedulingReminderBuilder::class.java) .where() .equals(PostSchedulingReminderTable.POST_ID, postId) .equals(PostSchedulingReminderTable.SCHEDULED_TIME, scheduledTime.name) .endWhere().asModel.firstOrNull()?.id } fun deleteSchedulingReminders(postId: Int) { WellSql.delete(PostSchedulingReminderBuilder::class.java) .where() .equals(PostSchedulingReminderTable.POST_ID, postId) .endWhere() .execute() } fun getSchedulingReminderPeriodDbModel( postId: Int ): SchedulingReminderDbModel.Period? { return WellSql.select(PostSchedulingReminderBuilder::class.java) .where() .equals(PostSchedulingReminderTable.POST_ID, postId) .endWhere().asModel.firstOrNull()?.scheduledTime?.let { SchedulingReminderDbModel.Period.valueOf(it) } } fun getSchedulingReminder( notificationId: Int ): SchedulingReminderDbModel? { return WellSql.select(PostSchedulingReminderBuilder::class.java) .where() .equals(PostSchedulingReminderTable.ID, notificationId) .endWhere().asModel.firstOrNull() ?.let { SchedulingReminderDbModel( it.id, it.postId, SchedulingReminderDbModel.Period.valueOf(it.scheduledTime) ) } } data class SchedulingReminderDbModel(val notificationId: Int, val postId: Int, val period: Period) { enum class Period { ONE_HOUR, TEN_MINUTES, WHEN_PUBLISHED } } @Table(name = "PostSchedulingReminder") data class PostSchedulingReminderBuilder( @PrimaryKey @Column private var mId: Int = -1, @Column var postId: Int, @Column var scheduledTime: String ) : Identifiable { constructor() : this(-1, -1, "") override fun setId(id: Int) { this.mId = id } override fun getId() = mId } }
fluxc/src/main/java/org/wordpress/android/fluxc/persistence/PostSchedulingNotificationSqlUtils.kt
330023258
package org.wordpress.android.fluxc.list import com.nhaarman.mockitokotlin2.mock import org.wordpress.android.fluxc.model.list.ListConfig import org.wordpress.android.fluxc.model.list.ListDescriptor import org.wordpress.android.fluxc.model.list.ListDescriptorTypeIdentifier import org.wordpress.android.fluxc.model.list.ListDescriptorUniqueIdentifier import org.wordpress.android.fluxc.model.list.datasource.InternalPagedListDataSource import org.wordpress.android.fluxc.model.list.datasource.ListItemDataSourceInterface internal typealias TestListIdentifier = Long internal typealias TestPagedListResultType = String internal typealias TestInternalPagedListDataSource = InternalPagedListDataSource<TestListDescriptor, TestListIdentifier, TestPagedListResultType> internal typealias TestListItemDataSource = ListItemDataSourceInterface<TestListDescriptor, TestListIdentifier, TestPagedListResultType> internal class TestListDescriptor( override val uniqueIdentifier: ListDescriptorUniqueIdentifier = mock(), override val typeIdentifier: ListDescriptorTypeIdentifier = mock(), override val config: ListConfig = ListConfig.default ) : ListDescriptor
example/src/test/java/org/wordpress/android/fluxc/list/TestListDescriptor.kt
1705389640
package com.example.mercury.nearbysample import java.io.ByteArrayInputStream import java.io.ByteArrayOutputStream import java.io.IOException import java.io.ObjectInput import java.io.ObjectInputStream import java.io.ObjectOutput import java.io.ObjectOutputStream import java.io.Serializable class MessageModel(val who: String?, val text: String?) : Serializable { override fun toString(): String { return "MessageModel{" + "who='" + who + '\''.toString() + ", text='" + text + '\''.toString() + '}'.toString() } override fun equals(o: Any?): Boolean { if (this === o) return true if (o == null || javaClass != o.javaClass) return false val that = o as MessageModel? if (if (who != null) who != that!!.who else that!!.who != null) return false return if (text != null) text == that.text else that.text == null } override fun hashCode(): Int { var result = who?.hashCode() ?: 0 result = 31 * result + (text?.hashCode() ?: 0) return result } companion object { fun empty(): MessageModel { return MessageModel("", "") } @Throws(IOException::class) fun convertToBytes(messageModel: MessageModel): ByteArray { ByteArrayOutputStream().use { bos -> ObjectOutputStream(bos).use { out -> out.writeObject(messageModel) return bos.toByteArray() } } } @Throws(IOException::class, ClassNotFoundException::class) fun convertFromBytes(bytes: ByteArray): MessageModel { ByteArrayInputStream(bytes).use { bis -> ObjectInputStream(bis).use { `in` -> return `in`.readObject() as MessageModel } } } } }
app/src/main/java/com/example/mercury/nearbysample/MessageModel.kt
2101414355
package me.serce.franky.ui.flame import me.serce.franky.Protocol.CallTraceSampleInfo import java.util.* fun CallTraceSampleInfo.validate() { if (frameList.isEmpty()) { throw IllegalArgumentException("Empty trace sample $this") } } /** * Represents tree of stack traces */ class FlameTree(sampleInfo: List<CallTraceSampleInfo>) { val root: FlameNode = FlameNode(0, null) init { for (sample in sampleInfo) { sample.validate() addSampleToTree(sample) } } private fun addSampleToTree(sample: CallTraceSampleInfo) { val coef = sample.callCount root.cost += coef var node = root for (frame in sample.frameList.reversed()) { val methodId = frame.jMethodId node = node.children.computeIfAbsent(methodId, { FlameNode(frame.jMethodId, node) }) node.cost += coef } } } class FlameNode(val methodId: Long, val parent: FlameNode?) { var cost: Int = 0 val children: HashMap<Long, FlameNode> = hashMapOf() }
franky-intellij/src/main/kotlin/me/serce/franky/ui/flame/flameTree.kt
160816959
package ch.difty.scipamato.core.sync.launcher import ch.difty.scipamato.common.persistence.paging.Sort import java.io.Serializable import kotlin.math.min /** * The [SyncJobResult] collects log messages for one or more job steps * and keeps track of the entire jobs result. If all steps succeed, the jobs * result is success. If only one step fails, the job fails. */ class SyncJobResult { private val logMessages: MutableList<LogMessage> = ArrayList() private var result = JobResult.UNKNOWN private var running = false val isRunning get() = running val isSuccessful: Boolean get() = result == JobResult.SUCCESS val isFailed: Boolean get() = result == JobResult.FAILURE val messages: List<LogMessage> get() = ArrayList(logMessages) fun messageCount() = messages.size.toLong() fun setSuccess(msg: String) { running = true if (result != JobResult.FAILURE) result = JobResult.SUCCESS logMessages.add(LogMessage(msg, MessageLevel.INFO)) } fun setFailure(msg: String) { running = true result = JobResult.FAILURE logMessages.add(LogMessage(msg, MessageLevel.ERROR)) } fun setWarning(msg: String) { running = true logMessages.add(LogMessage(msg, MessageLevel.WARNING)) } fun setDone() { running = false } fun getPagedResultMessages(first: Int, count: Int, sortProp: String, dir: Sort.Direction): Iterator<LogMessage> { fun <T, R : Comparable<R>> List<T>.sortMethod(selector: (T) -> R?): List<T> = if (dir == Sort.Direction.ASC) this.sortedBy(selector) else sortedByDescending(selector) val sorted = when (sortProp) { "messageLevel" -> messages.sortMethod { it.messageLevel } else -> messages.sortMethod { it.message } } return sorted.subList(first, min(first + count, messages.size)).iterator() } fun clear() { logMessages.clear() result = JobResult.UNKNOWN setDone() } private enum class JobResult { UNKNOWN, SUCCESS, FAILURE } enum class MessageLevel { INFO, WARNING, ERROR } data class LogMessage( val message: String? = null, val messageLevel: MessageLevel = MessageLevel.INFO, ) : Serializable { companion object { private const val serialVersionUID = 1L } } }
core/core-sync/src/main/kotlin/ch/difty/scipamato/core/sync/launcher/SyncJobResult.kt
2499423020
@file:JvmName("RPickMedia") package pyxis.uzuki.live.richutilskt.utils import android.Manifest import android.annotation.SuppressLint import android.app.Activity import android.content.Context import android.content.ContextWrapper import android.content.Intent import android.net.Uri import android.provider.MediaStore import android.support.v4.app.Fragment import android.support.v4.app.FragmentActivity import android.support.v4.app.FragmentManager import pyxis.uzuki.live.richutilskt.impl.F2 import pyxis.uzuki.live.richutilskt.module.image.OrientationFixer class RPickMedia private constructor() { private var mInternalStorage: Boolean = false private var fixPhotoOrientation: Boolean = false private val PERMISSION_ARRAY = arrayOf(Manifest.permission.READ_EXTERNAL_STORAGE, Manifest.permission.WRITE_EXTERNAL_STORAGE, Manifest.permission.CAMERA) private lateinit var title: String private fun getActivity(context: Context): FragmentActivity? { var c = context while (c is ContextWrapper) { if (c is FragmentActivity) { return c } c = c.baseContext } return null } private fun Context.requestPermission(listener: (Boolean) -> Unit) { RPermission.instance.checkPermission(this, PERMISSION_ARRAY) { code, _ -> listener.invoke(code == RPermission.PERMISSION_GRANTED) } } /** * enable internal storage mode * * @param [isInternal] capture Image/Video in internal storage */ fun setInternalStorage(isInternal: Boolean) { mInternalStorage = isInternal } /** * enable fixing orientation * * @param [enable] fixing orientation */ fun setFixPhotoOrientation(enable: Boolean) { this.fixPhotoOrientation = enable } /** * set title of media when capture using PICK_FROM_CAMERA and PICK_FROM_CAMERA_VIDEO */ fun setTitle(title: String) { this.title = title } /** * pick image from Camera * * @param[callback] callback */ fun pickFromCamera(context: Context, callback: (Int, String) -> Unit) { context.requestPermission { if (!it) { callback.invoke(PICK_FAILED, "") return@requestPermission } requestPhotoPick(context, PICK_FROM_CAMERA, callback) } } /** * pick image from Camera * * @param[callback] callback */ fun pickFromCamera(context: Context, callback: F2<Int, String>?) { context.requestPermission { if (!it) { callback?.invoke(PICK_FAILED, "") return@requestPermission } requestPhotoPick(context, PICK_FROM_CAMERA) { code, uri -> callback?.invoke(code, uri) } } } /** * pick image from Gallery * * @param[callback] callback */ fun pickFromGallery(context: Context, callback: (Int, String) -> Unit) { context.requestPermission { if (!it) { callback.invoke(PICK_FAILED, "") return@requestPermission } requestPhotoPick(context, PICK_FROM_GALLERY, callback) } } /** * pick image from Gallery * * @param[callback] callback */ fun pickFromGallery(context: Context, callback: F2<Int, String>?) { context.requestPermission { if (!it) { callback?.invoke(PICK_FAILED, "") return@requestPermission } requestPhotoPick(context, PICK_FROM_GALLERY) { code, uri -> callback?.invoke(code, uri) } } } /** * pick image from Video * * @param[callback] callback */ fun pickFromVideo(context: Context, callback: (Int, String) -> Unit) { context.requestPermission { if (!it) { callback.invoke(PICK_FAILED, "") return@requestPermission } requestPhotoPick(context, PICK_FROM_VIDEO, callback) } } /** * pick image from Video * * @param[callback] callback */ fun pickFromVideo(context: Context, callback: F2<Int, String>?) { context.requestPermission { if (!it) { callback?.invoke(PICK_FAILED, "") return@requestPermission } requestPhotoPick(context, PICK_FROM_VIDEO, { code, uri -> callback?.invoke(code, uri) }) } } /** * pick image from Camera (Video Mode) * * @param[callback] callback */ fun pickFromVideoCamera(context: Context, callback: (Int, String) -> Unit) { context.requestPermission { if (!it) { callback.invoke(PICK_FAILED, "") return@requestPermission } requestPhotoPick(context, PICK_FROM_CAMERA_VIDEO, callback) } } /** * pick image from Camera (Video Mode) * * @param[callback] callback */ fun pickFromVideoCamera(context: Context, callback: F2<Int, String>?) { context.requestPermission { if (!it) { callback?.invoke(PICK_FAILED, "") return@requestPermission } requestPhotoPick(context, PICK_FROM_CAMERA_VIDEO, { code, uri -> callback?.invoke(code, uri) }) } } private var currentPhotoPath: String? = null private var currentVideoPath: String? = null @SuppressLint("ValidFragment") private fun requestPhotoPick(context: Context, pickType: Int, callback: (Int, String) -> Unit) { val fm = getActivity(context)?.supportFragmentManager val intent = Intent() if (!::title.isInitialized) { title = nowDateString() } when (pickType) { PICK_FROM_CAMERA -> { intent.action = MediaStore.ACTION_IMAGE_CAPTURE val captureUri = createUri(context, false, mInternalStorage, title) currentPhotoPath = captureUri.toString() intent.putExtra(MediaStore.EXTRA_OUTPUT, captureUri) } PICK_FROM_GALLERY -> { intent.action = Intent.ACTION_PICK intent.type = android.provider.MediaStore.Images.Media.CONTENT_TYPE } PICK_FROM_VIDEO -> { intent.action = Intent.ACTION_PICK intent.type = android.provider.MediaStore.Video.Media.CONTENT_TYPE } PICK_FROM_CAMERA_VIDEO -> { intent.action = MediaStore.ACTION_VIDEO_CAPTURE val captureUri = createUri(context, true, mInternalStorage, title) currentVideoPath = captureUri.toString() intent.putExtra(MediaStore.EXTRA_OUTPUT, captureUri) } } val fragment = ResultFragment(fm as FragmentManager, callback, currentPhotoPath ?: "", currentVideoPath ?: "") fragment.fixPhotoOrientation = fixPhotoOrientation fm.beginTransaction().add(fragment, "FRAGMENT_TAG").commitAllowingStateLoss() fm.executePendingTransactions() fragment.startActivityForResult(intent, pickType) } @SuppressLint("ValidFragment") class ResultFragment() : Fragment() { var fm: FragmentManager? = null var callback: ((Int, String) -> Unit)? = null var currentPhotoPath = "" var currentVideoPath = "" var fixPhotoOrientation: Boolean = false constructor(fm: FragmentManager, callback: (Int, String) -> Unit, currentPhotoPath: String, currentVideoPath: String) : this() { this.fm = fm this.callback = callback this.currentPhotoPath = currentPhotoPath this.currentVideoPath = currentVideoPath } override fun onActivityResult(requestCode: Int, resultCode: Int, data: Intent?) { super.onActivityResult(requestCode, resultCode, data) if (callback == null) { return } val callback = callback!! // implicit cast to non-null cause checking pre-processing if (resultCode != Activity.RESULT_OK || context == null) { callback.invoke(PICK_FAILED, "") return } val context = context!! // implicit cast to non-null cause checking pre-processing var realPath: String? = "" if (requestCode == PICK_FROM_CAMERA) { val uri = Uri.parse(currentPhotoPath) realPath = uri getRealPath context if (fixPhotoOrientation) { realPath = OrientationFixer.execute(realPath, context) } } else if (requestCode == PICK_FROM_CAMERA_VIDEO && data != null && data.data != null) { realPath = data.data.getRealPath(context) if (realPath.isEmpty()) { realPath = Uri.parse(currentVideoPath) getRealPath context } } else if (requestCode == PICK_FROM_CAMERA_VIDEO) { realPath = Uri.parse(currentVideoPath) getRealPath context } else if (data != null && data.data != null) { realPath = data.data.getRealPath(context) if (fixPhotoOrientation) { realPath = OrientationFixer.execute(realPath, context) } } if (realPath?.isEmpty() != false) { callback.invoke(PICK_FAILED, "") return } callback.invoke(PICK_SUCCESS, realPath) fm?.beginTransaction()?.remove(this)?.commit() } } companion object { @JvmField var instance: RPickMedia = RPickMedia() val PICK_FROM_CAMERA = 0 val PICK_FROM_GALLERY = 1 val PICK_FROM_VIDEO = 2 val PICK_FROM_CAMERA_VIDEO = 3 @JvmField val PICK_SUCCESS = 1 @JvmField val PICK_FAILED = 0 } }
RichUtils/src/main/java/pyxis/uzuki/live/richutilskt/utils/RPickMedia.kt
3003312460
@file:Suppress("IllegalIdentifier") package com.photoviewer.data.repository import com.nhaarman.mockito_kotlin.mock import com.nhaarman.mockito_kotlin.whenever import com.photoviewer.data.entity.PhotoEntity import com.photoviewer.data.repository.datastore.DatabasePhotoEntityStore import com.photoviewer.data.repository.datastore.ServerPhotoEntityStore import com.photoviewer.domain.usecases.SimpleSubscriber import org.junit.Before import org.junit.Test import org.mockito.Mockito.verify import org.mockito.Mockito.verifyZeroInteractions import rx.Observable.just import java.util.* class PhotoEntityDataSourceTest { private val mDatabasePhotoEntityStore: DatabasePhotoEntityStore = mock() private val mServerPhotoEntityStore: ServerPhotoEntityStore = mock() private lateinit var mPhotoEntityDataSource: PhotoEntityDataSource companion object { private val FAKE_PHOTO_ID = 31 } @Before fun setUp() { mPhotoEntityDataSource = PhotoEntityDataSource(mDatabasePhotoEntityStore, mServerPhotoEntityStore) } @Test fun `should query database on getting photos`() { val photosList = createPhotosList() assumeDatabaseIsEmpty() assumeServerHasRequestedContent(photosList) mPhotoEntityDataSource.photos().subscribe(SimpleSubscriber<List<PhotoEntity>>()) verify(mDatabasePhotoEntityStore).queryForAll() } @Test fun `should query server on getting photos if database does not have them`() { val photosList = createPhotosList() assumeDatabaseIsEmpty() assumeServerHasRequestedContent(photosList) mPhotoEntityDataSource.photos().subscribe(SimpleSubscriber<List<PhotoEntity>>()) verify(mServerPhotoEntityStore).photoEntityList() } @Test fun `should save retrieved photos from server on getting photos`() { val photosList = createPhotosList() assumeDatabaseIsEmpty() assumeServerHasRequestedContent(photosList) mPhotoEntityDataSource.photos().subscribe(SimpleSubscriber<List<PhotoEntity>>()) verify(mDatabasePhotoEntityStore).saveAll(photosList) } private fun createPhotosList() = ArrayList<PhotoEntity>().apply { add(PhotoEntity()) } private fun assumeDatabaseIsEmpty() { whenever(mDatabasePhotoEntityStore.queryForAll()).thenReturn( just<List<PhotoEntity>>(ArrayList<PhotoEntity>())) } private fun assumeServerHasRequestedContent(photosList: List<PhotoEntity>) { whenever(mServerPhotoEntityStore.photoEntityList()).thenReturn(just<List<PhotoEntity>>(photosList)) } @Test fun `should not query server on getting photos if database has them`() { val photoEntities = createPhotosList() assumeDatabaseHasRequestesContent(photoEntities) assumeServerHasRequestedContent(photoEntities) mPhotoEntityDataSource.photos().subscribe() verify(mDatabasePhotoEntityStore).queryForAll() verifyZeroInteractions(mServerPhotoEntityStore) } private fun assumeDatabaseHasRequestesContent(photoEntities: List<PhotoEntity>) { whenever(mDatabasePhotoEntityStore.queryForAll()).thenReturn(just<List<PhotoEntity>>(photoEntities)) } @Test fun `should query only database on getting particular photo`() { val photoEntity = PhotoEntity() whenever(mDatabasePhotoEntityStore.queryForId(FAKE_PHOTO_ID)).thenReturn( just(photoEntity)) mPhotoEntityDataSource.photo(FAKE_PHOTO_ID).subscribe() verify(mDatabasePhotoEntityStore).queryForId(FAKE_PHOTO_ID) } }
app/src/test/java/com/photoviewer/data/repository/PhotoEntityDataSourceTest.kt
3710240013
package com.cypress.GameObjects.Enemies import com.badlogic.gdx.graphics.g2d.Animation import com.badlogic.gdx.graphics.g2d.SpriteBatch import com.badlogic.gdx.graphics.g2d.TextureRegion import com.badlogic.gdx.math.Rectangle import com.badlogic.gdx.math.Vector2 import com.badlogic.gdx.utils.Array import com.cypress.CGHelpers.AssetLoader import com.cypress.GameObjects.* /** */ class Warrior(public override val position : Vector2, private val player : Player) : Character() { public override val isEnemy = true public override val width = 115 public override val height = 180 public override val bounds = Rectangle(0f, 0f, width.toFloat(), height.toFloat()) public override val velocity = Vector2(4f, 12f) public override val offsetY = 18f public override val offsetX = 10f public override var health = 50 public override var shouldGoToLeft = false public override var delta = 0f public override var shouldJump = false public override var shouldGoToRight = false public override var stayRight = false public override var onGround = true public override var gunType = "uzi" public override var isDead = false private val assets = AssetLoader.getInstance() private val uziLeft = TextureRegion(assets.guns, 281, 95, 90, 58) private var warriorGoesLeft = Animation(0.1f, Array<TextureRegion>()) private var warriorGoesRight = Animation(0.1f, Array<TextureRegion>()) private var warriorStayRight = TextureRegion(assets.warrior, 25, 11, width, height) private var warriorStayLeft = TextureRegion(assets.warrior, 201, 11, width, height) private var counter = 0 private var canShoot = false private var startValue = 0f init { // setting animation val posR = arrayOf(Pair( 28, 235), Pair(350, 237), Pair(674, 236), Pair( 30, 445), Pair(361, 445), Pair(678, 445), Pair( 23, 662), Pair(349, 662), Pair(688, 663)) val posL = arrayOf(Pair(200, 236), Pair(529, 236), Pair(871, 236), Pair(199, 445), Pair(519, 442), Pair(864, 442), Pair(204, 662), Pair(528, 661), Pair(853, 661)) val warriorsRight = Array<TextureRegion>() val warriorsLeft = Array<TextureRegion>() warriorsRight.addAll( Array(9, {i -> TextureRegion(assets.warrior, posR[i].first, posR[i].second, width, height)}), 0, 8 ) warriorsLeft.addAll( Array(9, {i -> TextureRegion(assets.warrior, posL[i].first, posL[i].second, width, height)}), 0, 8 ) warriorGoesRight = Animation(0.1f, warriorsRight, Animation.PlayMode.LOOP) warriorGoesLeft = Animation(0.1f, warriorsLeft, Animation.PlayMode.LOOP) } /** Defines actions of warrior. */ public fun update(delta : Float) { counter++ // movement of warrior if (position.y <= 80f) { onGround = true position.y = 80f velocity.y = 12f } // falling else { if (velocity.y < -9) velocity.y = -9f position.y += velocity.y velocity.y -= 0.2f } val distanceX = player.getX() - position.x val distanceY = Math.abs(player.getY() - position.y) if (counter % 50 == 0) { canShoot = true counter = 0 } else canShoot = false // warrior pursues player if (stayRight && distanceX > 0 && distanceX < 300f && distanceY < 500) { shouldGoToRight = false shouldGoToLeft = false if (canShoot) { assets.bulletsList.add(Bullet(this)) assets.shot[0]?.stop() if (assets.musicOn) assets.shot[0]?.play() } } else if (stayRight && distanceX >= 300f && distanceX < 500f) { position.x += velocity.x shouldGoToRight = true shouldGoToLeft = false } else if (!stayRight && distanceX < 0 && distanceX > -300f && distanceY < 500) { shouldGoToRight = false shouldGoToLeft = false if (canShoot) { assets.bulletsList.add(Bullet(this)) assets.shot[0]?.stop() if (assets.musicOn) assets.shot[0]?.play() } } else if (!stayRight && distanceX <= -300f && distanceX > -500f) { position.x -= velocity.x shouldGoToRight = false shouldGoToLeft = true } else if (distanceX == 0f) stayRight = !stayRight // warrior can't find player and looks around else { shouldGoToRight = false shouldGoToLeft = false if (delta.hashCode() % 100 == 0) stayRight = !stayRight } } /** Draws warrior. */ public fun draw(delta : Float, batcher : SpriteBatch) { if (!isDead) startValue = delta batcher.begin() // warrior is dead if (isDead) { batcher.draw(death.getKeyFrame(delta - startValue), position.x, position.y, 155f, 155f) if (delta - startValue > 0.5f) isDead = false } else { if (shouldGoToLeft || !stayRight) batcher.draw(uziLeft, position.x - 55, position.y + 25, 90f, 58f) // warrior should stay still ... if (!shouldGoToLeft && !shouldGoToRight) { when (stayRight) { // ... turning to the right side true -> batcher.draw(warriorStayRight, position.x, position.y, width.toFloat(), height.toFloat()) // ... turning to the left side false -> batcher.draw(warriorStayLeft, position.x, position.y, width.toFloat(), height.toFloat()) } } // warrior should go to left else if (shouldGoToLeft) { stayRight = false batcher.draw(warriorGoesLeft.getKeyFrame(delta), position.x, position.y, width.toFloat(), height.toFloat()) } // warrior should go to right else if (shouldGoToRight) { stayRight = true batcher.draw(warriorGoesRight.getKeyFrame(delta), position.x, position.y, width.toFloat(), height.toFloat()) } } batcher.end() } /** Returns position of warrior on Ox axis. */ public override fun getX(): Float = position.x /** Returns position of warrior on Oy axis. */ public override fun getY(): Float = position.y /** Returns bounds of player. */ public fun getBound() : Rectangle = bounds }
core/src/com/cypress/GameObjects/Enemies/Warrior.kt
780702013
package com.andreapivetta.blu.ui.timeline import com.andreapivetta.blu.data.model.Tweet import twitter4j.User /** * Created by andrea on 22/05/16. */ interface InteractionListener { fun favorite(tweet: Tweet) fun retweet(tweet: Tweet) fun unfavorite(tweet: Tweet) fun unretweet(tweet: Tweet) fun reply(tweet: Tweet, user: User) fun openTweet(tweet: Tweet) fun showUser(user: User) fun showImage(imageUrl: String) fun showImages(imageUrls: List<String>, index: Int) fun showVideo(videoUrl: String, videoType: String) }
app/src/main/java/com/andreapivetta/blu/ui/timeline/InteractionListener.kt
546820623
package me.ykrank.s1next.view.event class RateEvent(val threadId: String, val postId: String)
app/src/main/java/me/ykrank/s1next/view/event/RateEvent.kt
728465070
package cases @Suppress("unused", "UNUSED_VARIABLE") fun preferToOverPairSyntaxPositive() { val pair1 = Pair(1, 2) val pair2: Pair<Int, Int> = Pair(1, 2) val pair3 = Pair(Pair(1, 2), Pair(3, 4)) }
detekt-rules/src/test/resources/cases/PreferToOverPairSyntaxPositive.kt
2354313232
package com.pr0gramm.app.ui.fragments import androidx.lifecycle.lifecycleScope import com.pr0gramm.app.R import com.pr0gramm.app.Settings import com.pr0gramm.app.api.pr0gramm.Message import com.pr0gramm.app.services.FavedCommentService import com.pr0gramm.app.services.UserService import com.pr0gramm.app.ui.MessageAdapter import com.pr0gramm.app.ui.Pagination import com.pr0gramm.app.ui.PaginationController import com.pr0gramm.app.util.di.instance /** */ class FavedCommentFragment : InboxFragment("FavedCommentFragment") { private val favedCommentService: FavedCommentService by instance() private val userService: UserService by instance() override fun getContentAdapter(): Pair<MessageAdapter, Pagination<Message>> { val loader = apiMessageLoader(requireContext()) { olderThan -> val username = userService.name if (username == null || !userService.isAuthorized) { return@apiMessageLoader listOf() } favedCommentService.list(Settings.contentType, username, olderThan).map { FavedCommentService.commentToMessage(it) } } // create and initialize the adapter val pagination = Pagination(lifecycleScope, loader) val adapter = MessageAdapter( R.layout.row_inbox_message, actionListener, null, PaginationController(pagination)) return Pair(adapter, pagination) } }
app/src/main/java/com/pr0gramm/app/ui/fragments/FavedCommentFragment.kt
2445040319
package com.jamieadkins.gwent.domain.latest data class GwentNewsArticle( val id: Long, val title: String, val thumbnail: String, val url: String )
domain/src/main/java/com/jamieadkins/gwent/domain/latest/GwentNewsArticle.kt
3086781115
/* Copyright 2017 Google Inc. Licensed under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. You may obtain a copy of the License at https://www.apache.org/licenses/LICENSE-2.0 Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the specific language governing permissions and limitations under the License. */ package com.google.androidstudiopoet.gradle interface Statement { fun toGroovy(indentNumber: Int): String } data class StringStatement(val value: String) : Statement { override fun toGroovy(indentNumber: Int): String = INDENT.repeat(indentNumber) + value } data class Expression(val left: String, val right: String) : Statement { override fun toGroovy(indentNumber: Int): String = "${INDENT.repeat(indentNumber)}$left $right" } class Closure(val name: String, val statements: List<Statement>) : Statement { override fun toGroovy(indentNumber: Int): String { val indent = INDENT.repeat(indentNumber) return """$indent$name { ${statements.joinToString(separator = "\n") { it.toGroovy(indentNumber + 1) }} $indent}""" } } data class Task(val name: String, val arguments: List<TaskParameter>, val statements: List<Statement>) : Statement { override fun toGroovy(indentNumber: Int): String { val indent = INDENT.repeat(indentNumber) return """${indent}task $name(${arguments.joinToString { "${it.name}: ${it.value}" }}) { ${statements.joinToString(separator = "\n") { it.toGroovy(indentNumber + 1) }} $indent}""" } } data class TaskParameter(val name: String, val value: String) private const val INDENT = " "
aspoet/src/main/kotlin/com/google/androidstudiopoet/gradle/GradleLang.kt
427938327
/* * Copyright 2000-2017 JetBrains s.r.o. * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package com.intellij.testFramework import com.intellij.configurationStore.StreamProvider import com.intellij.openapi.components.RoamingType import com.intellij.openapi.options.* import java.nio.file.Path private val EMPTY = EmptySchemesManager() class MockSchemeManagerFactory : SchemeManagerFactory() { override fun <SCHEME : Scheme, MUTABLE_SCHEME : SCHEME> create(directoryName: String, processor: SchemeProcessor<SCHEME, MUTABLE_SCHEME>, presentableName: String?, roamingType: RoamingType, isUseOldFileNameSanitize: Boolean, streamProvider: StreamProvider?, directoryPath: Path?, autoSave: Boolean): SchemeManager<SCHEME> { @Suppress("UNCHECKED_CAST") return EMPTY as SchemeManager<SCHEME> } }
platform/testFramework/src/com/intellij/testFramework/MockSchemeManagerFactory.kt
2811836602
package fernandocs.currencyconverter.view import android.os.Bundle import android.support.v7.app.AppCompatActivity import fernandocs.currencyconverter.R class MainActivity : AppCompatActivity() { override fun onCreate(savedInstanceState: Bundle?) { super.onCreate(savedInstanceState) setContentView(R.layout.activity_main) if (savedInstanceState == null) { supportFragmentManager.beginTransaction() .replace(R.id.frag_container, RatesFragment()).commit() } } }
app/src/main/java/fernandocs/currencyconverter/view/MainActivity.kt
3007426366
package com.github.pgutkowski.kgraphql.specification.language import com.github.pgutkowski.kgraphql.Specification import com.github.pgutkowski.kgraphql.assertNoErrors import com.github.pgutkowski.kgraphql.expect import com.github.pgutkowski.kgraphql.extract import com.github.pgutkowski.kgraphql.integration.BaseSchemaTest import org.hamcrest.CoreMatchers.equalTo import org.hamcrest.MatcherAssert.assertThat import org.junit.Test @Specification("2.10 Variables") class VariablesSpecificationTest : BaseSchemaTest() { @Test fun `query with variables`(){ val map = execute( query = "mutation(\$name: String!, \$age : Int!) {createActor(name: \$name, age: \$age){name, age}}", variables = "{\"name\":\"Boguś Linda\", \"age\": 22}" ) assertNoErrors(map) assertThat( map.extract<Map<String, Any>>("data/createActor"), equalTo(mapOf("name" to "Boguś Linda", "age" to 22)) ) } @Test fun `query with boolean variable`(){ val map = execute(query = "query(\$big: Boolean!) {number(big: \$big)}", variables = "{\"big\": true}") assertNoErrors(map) assertThat(map.extract<Int>("data/number"), equalTo(10000)) } @Test fun `query with boolean variable default value`(){ val map = execute(query = "query(\$big: Boolean = true) {number(big: \$big)}") assertNoErrors(map) assertThat(map.extract<Int>("data/number"), equalTo(10000)) } @Test fun `query with variables and string default value`(){ val map = execute( query = "mutation(\$name: String = \"Boguś Linda\", \$age : Int!) {createActor(name: \$name, age: \$age){name, age}}", variables = "{\"age\": 22}" ) assertNoErrors(map) assertThat( map.extract<Map<String, Any>>("data/createActor"), equalTo(mapOf("name" to "Boguś Linda", "age" to 22)) ) } @Test fun `query with variables and default value pointing to another variable`(){ val map = execute( query = "mutation(\$name: String = \"Boguś Linda\", \$age : Int = \$defaultAge, \$defaultAge : Int!) " + "{createActor(name: \$name, age: \$age){name, age}}", variables = "{\"defaultAge\": 22}" ) assertNoErrors(map) assertThat( map.extract<Map<String, Any>>("data/createActor"), equalTo(mapOf("name" to "Boguś Linda", "age" to 22)) ) } @Test fun `fragment with variable`(){ val map = execute( query = "mutation(\$name: String = \"Boguś Linda\", \$age : Int!, \$big: Boolean!) {createActor(name: \$name, age: \$age){...Linda}}" + "fragment Linda on Actor {picture(big: \$big)}", variables = "{\"age\": 22, \"big\": true}" ) assertNoErrors(map) assertThat( map.extract<String>("data/createActor/picture"), equalTo("http://picture.server/pic/Boguś_Linda?big=true") ) } @Test fun `fragment with missing variable`(){ expect<IllegalArgumentException>("Variable '\$big' was not declared for this operation"){ execute( query = "mutation(\$name: String = \"Boguś Linda\", \$age : Int!) {createActor(name: \$name, age: \$age){...Linda}}" + "fragment Linda on Actor {picture(big: \$big)}", variables = "{\"age\": 22}" ) } } }
src/test/kotlin/com/github/pgutkowski/kgraphql/specification/language/VariablesSpecificationTest.kt
3347033696
package com.jereksel.libresubstratum import android.arch.lifecycle.ViewModelProvider import android.content.Context import com.jereksel.libresubstratum.activities.installed.InstalledContract import com.jereksel.libresubstratum.activities.priorities.PrioritiesContract import com.jereksel.libresubstratum.activities.prioritiesdetail.PrioritiesDetailContract import com.jereksel.libresubstratum.dagger.components.BaseComponent import com.jereksel.libresubstratum.domain.Metrics import com.jereksel.libresubstratum.domain.PrivacyPolicySettings import com.jereksel.libresubstratum.domain.usecases.ICleanUnusedOverlays import dagger.Component import dagger.Module import dagger.Provides import io.kotlintest.mock.mock import org.mockito.Mockito import javax.inject.Named import javax.inject.Singleton class MockedApp : App() { companion object { @JvmStatic val mockedInstalledPresenter: InstalledContract.Presenter = Mockito.mock(InstalledContract.Presenter::class.java) @JvmStatic val mockedPrioritiesPresenter: PrioritiesContract.Presenter = Mockito.mock(PrioritiesContract.Presenter::class.java) @JvmStatic val mockedPrioritiesDetailPresenter: PrioritiesDetailContract.Presenter = Mockito.mock(PrioritiesDetailContract.Presenter::class.java) @JvmStatic val viewModelFactory: ViewModelProvider.Factory = Mockito.mock(ViewModelProvider.Factory::class.java) @Module class TestModule { @Provides fun installed(): InstalledContract.Presenter = mockedInstalledPresenter @Provides fun priorities(): PrioritiesContract.Presenter = mockedPrioritiesPresenter @Provides fun proritiesDetail(): PrioritiesDetailContract.Presenter = mockedPrioritiesDetailPresenter @Provides @Named("persistent") fun metrics(): Metrics = mock() @Provides fun factory() = viewModelFactory @Provides fun iCleanUnusedOverlays(): ICleanUnusedOverlays = mock() @Provides fun privacySettings(): PrivacyPolicySettings = object: PrivacyPolicySettings { override fun isPrivacyPolicyRequired() = TODO() } @Provides fun detailedPresenter(): com.jereksel.libresubstratum.activities.detailed.DetailedPresenter = mock() } @Singleton @Component(modules = [TestModule::class]) interface TestComponent: BaseComponent } override fun getAppComponent(context: Context): BaseComponent { return DaggerMockedApp_Companion_TestComponent.create() } }
app/src/test/kotlin/com/jereksel/libresubstratum/MockedApp.kt
507858932
package com.rssclient.model import android.os.Parcelable import com.aglushkov.taskmanager_http.image.Image import kotlinx.android.parcel.Parcelize import java.io.Serializable import java.net.URL @Parcelize data class RssFeed( var name: String, var url: URL, var image: Image? = null, var items: List<RssItem> = ArrayList()) : Parcelable, Serializable { companion object { private const val serialVersionUID = 715000812082812655L } }
app_demo/src/main/java/com/rssclient/model/RssFeed.kt
3229061844
package com.flexpoker.game.command.handlers import com.flexpoker.framework.command.CommandHandler import com.flexpoker.framework.event.EventPublisher import com.flexpoker.game.command.aggregate.applyEvents import com.flexpoker.game.command.aggregate.eventproducers.joinGame import com.flexpoker.game.command.commands.JoinGameCommand import com.flexpoker.game.command.events.GameEvent import com.flexpoker.game.command.repository.GameEventRepository import org.springframework.scheduling.annotation.Async import org.springframework.stereotype.Component import javax.inject.Inject @Component class JoinGameCommandHandler @Inject constructor( private val eventPublisher: EventPublisher<GameEvent>, private val gameEventRepository: GameEventRepository ) : CommandHandler<JoinGameCommand> { @Async override fun handle(command: JoinGameCommand) { val gameEvents = gameEventRepository.fetchAll(command.aggregateId) val state = applyEvents(gameEvents) val newEvents = joinGame(state, command.playerId) val eventsWithVersions = gameEventRepository.setEventVersionsAndSave(gameEvents.size, newEvents) eventsWithVersions.forEach { eventPublisher.publish(it) } } }
src/main/kotlin/com/flexpoker/game/command/handlers/JoinGameCommandHandler.kt
3408425570
/* * Copyright 2016-2019 Adrian Cotfas * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software distributed under the License is * distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, * either express or implied. See the License for the specific language governing permissions and limitations under the License. */ package com.apps.adrcotfas.goodtime.util import java.time.* import java.time.format.DateTimeFormatter import java.time.format.FormatStyle import java.time.temporal.TemporalAdjusters import java.util.* import kotlin.math.roundToInt object StringUtils { private val backUpFormatter = DateTimeFormatter.ofPattern("yyyy-MM-dd-HH-mm") private val dayOfWeekFormatter = DateTimeFormatter.ofPattern("E") private val suffixes: NavigableMap<Long, String> = TreeMap() /** * Shortens a value in minutes to a easier to read format of maximum 4 characters * Do not use this for anything else than the History chart before removing the extra left padding hack * @param value the value in minutes to be formatted * @return the formatted value */ fun formatLong(value: Long): String { //Long.MIN_VALUE == -Long.MIN_VALUE so we need an adjustment here if (value == Long.MIN_VALUE) return formatLong(Long.MIN_VALUE + 1) if (value < 0) return "-" + formatLong(-value) if (value < 1000) return value.toString() //deal with easy case val e = suffixes.floorEntry(value)!! val divideBy = e.key val suffix = e.value val truncated = value / (divideBy / 10) //the number part of the output times 10 val hasDecimal = truncated < 100 && truncated / 10.0 != (truncated / 10).toDouble() return if (hasDecimal) (truncated / 10.0).toString() + suffix else (truncated / 10).toString() + suffix } fun formatDateAndTime(millis: Long): String { return millis.toLocalDateTime().format(backUpFormatter) } @JvmStatic fun formatTimeForStatistics(millis: Long?): String { val date = LocalDateTime.ofInstant( Instant.ofEpochMilli( millis!! ), ZoneId.systemDefault() ) return date.format(DateTimeFormatter.ofLocalizedTime(FormatStyle.SHORT)) } @JvmStatic fun formatDateForStatistics(millis: Long?): String { val date = LocalDateTime.ofInstant( Instant.ofEpochMilli( millis!! ), ZoneId.systemDefault() ) return "${date.format(DateTimeFormatter.ofPattern("EEEE"))} ${date.format(DateTimeFormatter.ofLocalizedDate(FormatStyle.SHORT))}" } fun toPercentage(value: Float): String { return (100 * value).roundToInt().toString() + "%" } fun toDayOfWeek(value: Int): String { return LocalDateTime.now().with(TemporalAdjusters.next(DayOfWeek.of(value))).format(dayOfWeekFormatter) } fun toHourOfDay(hour: Int, is24HourFormat: Boolean): String { val time = LocalTime.now().withHour(hour) return time.format( DateTimeFormatter.ofPattern( if (is24HourFormat) "HH" else "hh a" ) ).replace(" ", "\n") } init { suffixes[1000L] = "k" suffixes[1000000L] = "M" suffixes[1000000000L] = "G" suffixes[1000000000000L] = "T" suffixes[1000000000000000L] = "P" suffixes[1000000000000000000L] = "E" } fun formatMinutes(minutes: Long): String { val days = minutes / 1440 val hours = minutes / 60 % 24 val remMin = minutes % 60 val result: String = if (minutes != 0L) { ((if (days != 0L) "${days}d\n" else "") + (if (hours != 0L) "" + hours.toString() + "h" else "") + if (remMin != 0L) " " + remMin.toString() + "m" else "") } else { "0m" } return result } }
app/src/main/java/com/apps/adrcotfas/goodtime/util/StringUtils.kt
924517325
package net.nemerosa.ontrack.boot.graphql.actions import net.nemerosa.ontrack.boot.ui.ProjectController import net.nemerosa.ontrack.graphql.schema.ProjectMutations import net.nemerosa.ontrack.graphql.schema.RootUser import net.nemerosa.ontrack.graphql.schema.actions.UIAction import net.nemerosa.ontrack.model.security.ProjectCreation import net.nemerosa.ontrack.model.security.SecurityService import net.nemerosa.ontrack.model.security.isGlobalFunctionGranted import net.nemerosa.ontrack.ui.controller.EntityURIBuilder import org.springframework.stereotype.Component import org.springframework.web.servlet.mvc.method.annotation.MvcUriComponentsBuilder.on @Component class RootUserUIActions( uriBuilder: EntityURIBuilder, securityService: SecurityService ) : SimpleUIActionsProvider<RootUser>(RootUser::class, uriBuilder) { override val actions: List<UIAction<RootUser>> = listOf( mutationForm(ProjectMutations.CREATE_PROJECT, "Creating a project", form = { on(ProjectController::class.java).newProjectForm() }, check = { securityService.isGlobalFunctionGranted<ProjectCreation>() } ) ) }
ontrack-ui/src/main/java/net/nemerosa/ontrack/boot/graphql/actions/RootUserUIActions.kt
2407272150
package net.nemerosa.ontrack.extension.git.branching import net.nemerosa.ontrack.model.support.NameValue /** * Branching model for a project. * * @property patterns Maps the _type_ of branch to a * regular expressions. */ class BranchingModel( val patterns: Map<String, String> ) { constructor(patterns: List<NameValue>) : this( patterns.associate { it.name to it.value } ) companion object { /** * Default branching model to use * when no model if defined globally or at * project level. */ val DEFAULT = BranchingModel( mapOf( "Development" to "main|master|develop", "Releases" to "release/.*" ) ) } /** * Given this branching model, a list of Git branches, returns * an indexed list of Git branches. * * @param branches List of Git branches to index * @return Associates each type with a list of matching * branches */ fun groupBranches( branches: List<String> ): Map<String, List<String>> = patterns.mapValues { (_, regex) -> val pattern = regex.toRegex() branches.filter { pattern.matches(it) } } /** * Checks if the given branch matches at least one pattern in the model. */ fun matches(branchName: String): Boolean { return patterns.values.any { it.toRegex().matches(branchName) } } }
ontrack-extension-git/src/main/java/net/nemerosa/ontrack/extension/git/branching/BranchingModel.kt
347228250
package net.nemerosa.ontrack.boot.ui import net.nemerosa.ontrack.model.Ack import net.nemerosa.ontrack.model.security.* import net.nemerosa.ontrack.model.structure.ID import net.nemerosa.ontrack.ui.controller.AbstractResourceController import org.springframework.http.ResponseEntity import org.springframework.web.bind.annotation.* /** * REST API to create & delete group mappings */ @RestController @RequestMapping("/rest/group-mappings") class AccountGroupMappingController( private val accountGroupMappingService: AccountGroupMappingService, private val providedGroupsService: ProvidedGroupsService, private val authenticationSourceRepository: AuthenticationSourceRepository ) : AbstractResourceController() { /** * Gets the list of mappings for a provider and a source */ @GetMapping("{provider}/{source}") fun getMappings(@PathVariable provider: String, @PathVariable source: String): ResponseEntity<List<AccountGroupMapping>> { val authenticationSource = authenticationSourceRepository.getRequiredAuthenticationSource(provider, source) return ResponseEntity.ok(accountGroupMappingService.getMappings(authenticationSource)) } /** * Creates a mapping */ @PostMapping("{provider}/{source}") fun createMapping(@PathVariable provider: String, @PathVariable source: String, @RequestBody input: AccountGroupMappingInput): ResponseEntity<AccountGroupMapping> { val authenticationSource = authenticationSourceRepository.getRequiredAuthenticationSource(provider, source) return ResponseEntity.ok(accountGroupMappingService.newMapping(authenticationSource, input)) } /** * Deletes a mapping */ @DeleteMapping("{provider}/{source}/{id}") fun deleteMapping(@PathVariable provider: String, @PathVariable source: String, @PathVariable id: ID): ResponseEntity<Ack> { val authenticationSource = authenticationSourceRepository.getRequiredAuthenticationSource(provider, source) return ResponseEntity.ok(accountGroupMappingService.deleteMapping(authenticationSource, id)) } /** * Gets a list of provided groups for a type and token. */ @GetMapping("{provider}/{source}/search/{token:.*}") fun getSuggestedMappings(@PathVariable provider: String, @PathVariable source: String, @PathVariable token: String): ResponseEntity<List<String>> { val authenticationSource = authenticationSourceRepository.getRequiredAuthenticationSource(provider, source) return ResponseEntity.ok( providedGroupsService.getSuggestedGroups(authenticationSource, token) ) } }
ontrack-ui/src/main/java/net/nemerosa/ontrack/boot/ui/AccountGroupMappingController.kt
1723962849
package be.florien.anyflow.feature.player.filter.saved import androidx.lifecycle.LiveData import androidx.lifecycle.viewModelScope import be.florien.anyflow.data.view.FilterGroup import be.florien.anyflow.feature.player.filter.BaseFilterViewModel import be.florien.anyflow.player.FiltersManager import kotlinx.coroutines.launch import javax.inject.Inject class SavedFilterGroupViewModel @Inject constructor(filtersManager: FiltersManager) : BaseFilterViewModel(filtersManager) { val filterGroups: LiveData<List<FilterGroup>> = filtersManager.filterGroups fun changeForSavedGroup(savedGroupPosition: Int) { viewModelScope.launch { val filterGroup = filterGroups.value?.get(savedGroupPosition) if (filterGroup != null) { filtersManager.loadSavedGroup(filterGroup) areFiltersInEdition.mutable.value = false } } } }
app/src/main/java/be/florien/anyflow/feature/player/filter/saved/SavedFilterGroupViewModel.kt
3300776650
/* * ownCloud Android client application * * @author David A. Velasco * Copyright (C) 2015 ownCloud Inc. * * This program is free software: you can redistribute it and/or modify * it under the terms of the GNU General Public License version 2, * as published by the Free Software Foundation. * * This program is distributed in the hope that it will be useful, * but WITHOUT ANY WARRANTY; without even the implied warranty of * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the * GNU General Public License for more details. * * You should have received a copy of the GNU General Public License * along with this program. If not, see <http://www.gnu.org/licenses/>. * */ package com.owncloud.android.ui.preview import android.content.Intent import android.net.Uri import android.os.Bundle import android.view.View import com.google.android.exoplayer2.ExoPlayer import com.google.android.exoplayer2.MediaItem import com.google.android.exoplayer2.Player import com.nextcloud.client.account.UserAccountManager import com.nextcloud.client.di.Injectable import com.nextcloud.client.media.ExoplayerListener import com.nextcloud.client.media.NextcloudExoPlayer.createNextcloudExoplayer import com.nextcloud.client.network.ClientFactory import com.owncloud.android.R import com.owncloud.android.databinding.ActivityPreviewVideoBinding import com.owncloud.android.datamodel.OCFile import com.owncloud.android.lib.common.utils.Log_OC import com.owncloud.android.ui.activity.FileActivity import com.owncloud.android.utils.MimeTypeUtil import kotlinx.coroutines.CoroutineScope import kotlinx.coroutines.Dispatchers import kotlinx.coroutines.launch import javax.inject.Inject /** * Activity implementing a basic video player. * */ @Suppress("TooManyFunctions") class PreviewVideoActivity : FileActivity(), Player.Listener, Injectable { @Inject lateinit var clientFactory: ClientFactory @Inject lateinit var accountManager: UserAccountManager private var mSavedPlaybackPosition: Long = -1 // in the unit time handled by MediaPlayer.getCurrentPosition() private var mAutoplay = false // when 'true', the playback starts immediately with the activity private var exoPlayer: ExoPlayer? = null // view to play the file; both performs and show the playback private var mStreamUri: Uri? = null private lateinit var binding: ActivityPreviewVideoBinding private lateinit var pauseButton: View private lateinit var playButton: View public override fun onCreate(savedInstanceState: Bundle?) { super.onCreate(savedInstanceState) Log_OC.v(TAG, "onCreate") binding = ActivityPreviewVideoBinding.inflate(layoutInflater) setContentView(binding.root) val extras = intent.extras if (savedInstanceState == null && extras != null) { mSavedPlaybackPosition = extras.getLong(EXTRA_START_POSITION) mAutoplay = extras.getBoolean(EXTRA_AUTOPLAY) mStreamUri = extras[EXTRA_STREAM_URL] as Uri? } else if (savedInstanceState != null) { mSavedPlaybackPosition = savedInstanceState.getLong(EXTRA_START_POSITION) mAutoplay = savedInstanceState.getBoolean(EXTRA_AUTOPLAY) mStreamUri = savedInstanceState[EXTRA_STREAM_URL] as Uri? } supportActionBar?.hide() } private fun setupPlayerView() { binding.videoPlayer.player = exoPlayer exoPlayer!!.addListener(this) binding.root.findViewById<View>(R.id.exo_exit_fs).setOnClickListener { onBackPressed() } pauseButton = binding.root.findViewById(R.id.exo_pause) pauseButton.setOnClickListener { exoPlayer!!.pause() } playButton = binding.root.findViewById(R.id.exo_play) playButton.setOnClickListener { exoPlayer!!.play() } if (mSavedPlaybackPosition >= 0) { exoPlayer?.seekTo(mSavedPlaybackPosition) } onIsPlayingChanged(exoPlayer!!.isPlaying) } override fun onIsPlayingChanged(isPlaying: Boolean) { super.onIsPlayingChanged(isPlaying) if (isPlaying) { playButton.visibility = View.GONE pauseButton.visibility = View.VISIBLE } else { playButton.visibility = View.VISIBLE pauseButton.visibility = View.GONE } } /** * {@inheritDoc} */ public override fun onSaveInstanceState(outState: Bundle) { super.onSaveInstanceState(outState) outState.putLong(EXTRA_START_POSITION, currentPosition()) outState.putBoolean(EXTRA_AUTOPLAY, isPlaying()) outState.putParcelable(EXTRA_STREAM_URL, mStreamUri) } override fun onBackPressed() { Log_OC.v(TAG, "onBackPressed") val i = Intent() i.putExtra(EXTRA_AUTOPLAY, isPlaying()) i.putExtra(EXTRA_START_POSITION, currentPosition()) setResult(RESULT_OK, i) exoPlayer?.stop() exoPlayer?.release() super.onBackPressed() } private fun isPlaying() = exoPlayer?.isPlaying ?: false private fun currentPosition() = exoPlayer?.currentPosition ?: 0 private fun play(item: MediaItem) { exoPlayer?.addMediaItem(item) exoPlayer?.prepare() if (mAutoplay) { exoPlayer?.play() } } override fun onStart() { super.onStart() if (account != null) { require(file != null) { throw IllegalStateException("Instanced with a NULL OCFile") } var fileToPlay: OCFile? = file // Validate handled file (first image to preview) require(MimeTypeUtil.isVideo(fileToPlay)) { "Non-video file passed as argument" } fileToPlay = storageManager.getFileById(fileToPlay!!.fileId) if (fileToPlay != null) { val mediaItem = when { fileToPlay.isDown -> MediaItem.fromUri(fileToPlay.storageUri) else -> MediaItem.fromUri(mStreamUri!!) } if (exoPlayer != null) { setupPlayerView() play(mediaItem) } else { val context = this CoroutineScope(Dispatchers.IO).launch { val client = clientFactory.createNextcloudClient(accountManager.user) CoroutineScope(Dispatchers.Main).launch { exoPlayer = createNextcloudExoplayer(context, client).also { it.addListener(ExoplayerListener(context, binding.videoPlayer, it)) } setupPlayerView() play(mediaItem) } } } } else { finish() } } else { finish() } } override fun onStop() { super.onStop() if (exoPlayer?.isPlaying == true) { exoPlayer?.pause() } } companion object { /** Key to receive a flag signaling if the video should be started immediately */ const val EXTRA_AUTOPLAY = "AUTOPLAY" /** Key to receive the position of the playback where the video should be put at start */ const val EXTRA_START_POSITION = "START_POSITION" const val EXTRA_STREAM_URL = "STREAM_URL" private val TAG = PreviewVideoActivity::class.java.simpleName } }
app/src/main/java/com/owncloud/android/ui/preview/PreviewVideoActivity.kt
1218747410
package org.rust.ide.utils import com.intellij.openapi.util.text.StringUtil import com.intellij.psi.PsiComment import com.intellij.psi.PsiElement import com.intellij.psi.PsiWhiteSpace import org.rust.lang.core.psi.* import org.rust.lang.core.psi.ext.* class PresentationInfo( element: RsNamedElement, val type: String?, val name: String, private val declaration: DeclarationInfo ) { private val location: String? init { location = element.containingFile?.let { " [${it.name}]" }.orEmpty() } val typeNameText: String get() = if (type == null) { name } else "$type `$name`" val projectStructureItemText: String get() = "$name${declaration.suffix}" val projectStructureItemTextWithValue: String get() = "$projectStructureItemText${declaration.value}" val signatureText: String = "${declaration.prefix}<b>$name</b>${declaration.suffix.escaped}" val quickDocumentationText: String get() = if (declaration.isAmbiguous && type != null) { "<i>$type:</i> " } else { "" } + "$signatureText${valueText.escaped}$location" private val valueText: String get() = if (declaration.value.isEmpty()) { "" } else { " ${declaration.value}" } } data class DeclarationInfo( val prefix: String = "", val suffix: String = "", val value: String = "", val isAmbiguous: Boolean = false ) val RsNamedElement.presentationInfo: PresentationInfo? get() { val elementName = name ?: return null val declInfo = when (this) { is RsFunction -> Pair("function", createDeclarationInfo(this, identifier, false, listOf(whereClause, retType, valueParameterList))) is RsStructItem -> Pair("struct", createDeclarationInfo(this, identifier, false, if (blockFields != null) listOf(whereClause) else listOf(whereClause, tupleFields))) is RsFieldDecl -> Pair("field", createDeclarationInfo(this, identifier, false, listOf(typeReference))) is RsEnumItem -> Pair("enum", createDeclarationInfo(this, identifier, false, listOf(whereClause))) is RsEnumVariant -> Pair("enum variant", createDeclarationInfo(this, identifier, false, listOf(tupleFields))) is RsTraitItem -> Pair("trait", createDeclarationInfo(this, identifier, false, listOf(whereClause))) is RsTypeAlias -> Pair("type alias", createDeclarationInfo(this, identifier, false, listOf(typeReference, typeParamBounds, whereClause), eq)) is RsConstant -> Pair("constant", createDeclarationInfo(this, identifier, false, listOf(expr, typeReference), eq)) is RsSelfParameter -> Pair("parameter", createDeclarationInfo(this, self, false, listOf(typeReference))) is RsTypeParameter -> Pair("type parameter", createDeclarationInfo(this, identifier, true)) is RsLifetimeDecl -> Pair("lifetime", createDeclarationInfo(this, quoteIdentifier, true)) is RsModItem -> Pair("module", createDeclarationInfo(this, identifier, false)) is RsLabelDecl -> { val p = parent when (p) { is RsLoopExpr -> Pair("label", createDeclarationInfo(p, p.labelDecl?.quoteIdentifier, false, listOf(p.loop))) is RsForExpr -> Pair("label", createDeclarationInfo(p, p.labelDecl?.quoteIdentifier, false, listOf(p.expr, p.`in`, p.`for`))) is RsWhileExpr -> Pair("label", createDeclarationInfo(p, p.labelDecl?.quoteIdentifier, false, listOf(p.condition, p.`while`))) else -> Pair("label", createDeclarationInfo(this, quoteIdentifier, true)) } } is RsPatBinding -> { val patOwner = topLevelPattern.parent when (patOwner) { is RsLetDecl -> Pair("variable", createDeclarationInfo(patOwner, identifier, false, listOf(patOwner.typeReference))) is RsValueParameter -> Pair("value parameter", createDeclarationInfo(patOwner, identifier, true, listOf(patOwner.typeReference))) is RsMatchArm -> Pair("match arm binding", createDeclarationInfo(patOwner, identifier, true, listOf(patOwner.patList.lastOrNull()))) is RsCondition -> Pair("condition binding", createDeclarationInfo(patOwner, identifier, true, listOf(patOwner.lastChild))) else -> Pair("binding", createDeclarationInfo(this, identifier, true)) } } is RsFile -> { val mName = modName if (isCrateRoot) return PresentationInfo(this, "crate", "crate", DeclarationInfo()) else if (mName != null) return PresentationInfo(this, "mod", name.substringBeforeLast(".rs"), DeclarationInfo("mod ")) else Pair("file", DeclarationInfo()) } else -> Pair(javaClass.simpleName, createDeclarationInfo(this, navigationElement, true)) } return declInfo.second?.let { PresentationInfo(this, declInfo.first, elementName, it) } } fun presentableQualifiedName(element: RsDocAndAttributeOwner): String? { val qName = (element as? RsQualifiedNamedElement)?.qualifiedName if (qName != null) return qName if (element is RsMod) return element.modName return element.name } private fun createDeclarationInfo(decl: RsCompositeElement, name: PsiElement?, isAmbiguous: Boolean, stopAt: List<PsiElement?> = emptyList(), valueSeparator: PsiElement? = null): DeclarationInfo? { // Break an element declaration into elements. For example: // // pub const Foo: u32 = 100; // ^^^^^^^^^ signature prefix // ^^^ name // ^^^^^ signature suffix // ^^^^^ value // ^ end if (name == null) return null // Remove leading spaces, comments and attributes val signatureStart = generateSequence(decl.firstChild) { it.nextSibling } .dropWhile { it is PsiWhiteSpace || it is PsiComment || it is RsOuterAttr } .firstOrNull() ?.startOffsetInParent ?: return null val nameStart = name.offsetIn(decl) // pick (in order) elements we should stop at // if they all fail, drop down to the end of the name element val end = stopAt .filterNotNull().firstOrNull() ?.let { it.startOffsetInParent + it.textLength } ?: nameStart + name.textLength val valueStart = valueSeparator?.offsetIn(decl) ?: end val nameEnd = nameStart + name.textLength check(signatureStart <= nameStart && nameEnd <= valueStart && valueStart <= end && end <= decl.textLength) val prefix = decl.text.substring(signatureStart, nameStart).escaped val value = decl.text.substring(valueStart, end) val suffix = decl.text.substring(nameEnd, end - value.length) .replace("""\s+""".toRegex(), " ") .replace("( ", "(") .replace(" )", ")") .replace(" ,", ",") .trimEnd() return DeclarationInfo(prefix, suffix, value, isAmbiguous) } private fun PsiElement.offsetIn(owner: PsiElement): Int = ancestors.takeWhile { it != owner }.sumBy { it.startOffsetInParent } val String.escaped: String get() = StringUtil.escapeXml(this) fun breadcrumbName(e: RsCompositeElement): String? { fun lastComponentWithoutGenerics(path: RsPath) = path.referenceName return when (e) { is RsModItem, is RsStructOrEnumItemElement, is RsTraitItem, is RsConstant, is RsMacroDefinition -> (e as RsNamedElement).name is RsImplItem -> { val typeName = run { val typeReference = e.typeReference (typeReference as? RsBaseType)?.path?.let { lastComponentWithoutGenerics(it) } ?: typeReference?.text ?: return null } val traitName = e.traitRef?.path?.let { lastComponentWithoutGenerics(it) } val start = if (traitName != null) "$traitName for" else "impl" "$start $typeName" } is RsFunction -> e.name?.let { "$it()" } else -> null } }
src/main/kotlin/org/rust/ide/utils/PresentationUtils.kt
3189412812
package treehou.se.habit.ui.servers.sitemaps.list import android.os.Bundle import android.support.v7.app.AppCompatActivity import android.support.v7.widget.DefaultItemAnimator import android.support.v7.widget.GridLayoutManager import android.view.LayoutInflater import android.view.View import android.view.ViewGroup import io.reactivex.Observable import io.reactivex.android.schedulers.AndroidSchedulers import io.reactivex.subjects.BehaviorSubject import kotlinx.android.synthetic.main.fragment_sitemaplist_list.* import se.treehou.ng.ohcommunicator.connector.models.OHServer import se.treehou.ng.ohcommunicator.connector.models.OHSitemap import treehou.se.habit.R import treehou.se.habit.core.db.model.ServerDB import treehou.se.habit.core.db.model.SitemapDB import treehou.se.habit.dagger.HasActivitySubcomponentBuilders import treehou.se.habit.dagger.ServerLoaderFactory import treehou.se.habit.dagger.fragment.SitemapSelectComponent import treehou.se.habit.dagger.fragment.SitemapSelectModule import treehou.se.habit.mvp.BaseDaggerFragment import treehou.se.habit.ui.adapter.SitemapListAdapter import treehou.se.habit.ui.servers.sitemaps.sitemapsettings.SitemapSettingsFragment import treehou.se.habit.util.Settings import javax.inject.Inject class SitemapSelectFragment : BaseDaggerFragment<SitemapSelectContract.Presenter>(), SitemapSelectContract.View { @Inject lateinit var settings: Settings @Inject lateinit var serverLoader: ServerLoaderFactory @Inject lateinit var sitemapPresenter: SitemapSelectContract.Presenter private var sitemapAdapter: SitemapListAdapter? = null private val serverBehaviorSubject = BehaviorSubject.create<OHServer>() private var serverId: Long = -1 override fun onCreate(savedInstanceState: Bundle?) { super.onCreate(savedInstanceState) serverId = arguments!!.getLong(ARG_SHOW_SERVER) } override fun getPresenter(): SitemapSelectContract.Presenter? { return sitemapPresenter } override fun injectMembers(hasActivitySubcomponentBuilders: HasActivitySubcomponentBuilders) { (hasActivitySubcomponentBuilders.getFragmentComponentBuilder(SitemapSelectFragment::class.java) as SitemapSelectComponent.Builder) .fragmentModule(SitemapSelectModule(this)) .build().injectMembers(this) } override fun onCreateView(inflater: LayoutInflater, container: ViewGroup?, savedInstanceState: Bundle?): View? { return inflater.inflate(R.layout.fragment_sitemaplist_list, container, false) } override fun onViewCreated(view: View, savedInstanceState: Bundle?) { super.onViewCreated(view, savedInstanceState) setupActionBar() val gridLayoutManager = GridLayoutManager(activity, 1) listView.layoutManager = gridLayoutManager listView.itemAnimator = DefaultItemAnimator() sitemapAdapter = SitemapListAdapter() sitemapAdapter!!.setSitemapSelectedListener(object : SitemapListAdapter.SitemapSelectedListener { override fun onSelected(server: OHServer, sitemap: OHSitemap?) { val sitemapDB = realm.where(SitemapDB::class.java) .equalTo("server.id", serverId) .equalTo("name", sitemap?.name) .findFirst() if (sitemapDB != null) { openSitemap(sitemapDB) } } override fun onErrorSelected(server: OHServer) { serverBehaviorSubject.onNext(server) } override fun onCertificateErrorSelected(server: OHServer) {} }) listView.adapter = sitemapAdapter } /** * Open fragment showing sitemap. * * @param sitemap the name of sitemap to show. */ private fun openSitemap(sitemap: SitemapDB?) { val fragmentManager = activity!!.supportFragmentManager fragmentManager.beginTransaction() .replace(R.id.page_container, SitemapSettingsFragment.newInstance(sitemap!!.id)) .addToBackStack(null) .commit() } /** * Setup actionbar. */ private fun setupActionBar() { val actionBar = (activity as AppCompatActivity).supportActionBar actionBar?.setTitle(R.string.sitemaps) } /** * Clears list of sitemaps. */ private fun clearList() { emptyView.visibility = View.VISIBLE sitemapAdapter!!.clear() } override fun onResume() { super.onResume() clearList() loadSitemapsFromServers() } /** * Load servers from database and request their sitemaps. */ private fun loadSitemapsFromServers() { val context = context ?: return realm.where(ServerDB::class.java).equalTo("id", serverId).findAll().asFlowable().toObservable() .flatMap<ServerDB>({ Observable.fromIterable(it) }) .map<OHServer>({ it.toGeneric() }) .distinct() .compose<ServerLoaderFactory.ServerSitemapsResponse>(serverLoader.serverToSitemap(context)) .observeOn(AndroidSchedulers.mainThread()) .compose<ServerLoaderFactory.ServerSitemapsResponse>(bindToLifecycle<ServerLoaderFactory.ServerSitemapsResponse>()) .subscribe({ serverSitemaps -> emptyView.visibility = View.GONE val server = serverSitemaps.server val sitemaps = serverSitemaps.sitemaps if (sitemaps != null) { for (sitemap in sitemaps) { if (server != null) { sitemapAdapter!!.add(server, sitemap) } } } }) { logger.e(TAG, "Request sitemap failed", it) } } companion object { private val TAG = "SitemapSelectFragment" private val ARG_SHOW_SERVER = "ARG_SHOW_SERVER" /** * Load sitemaps for servers. * Open provided sitemap if loaded. * * @param serverId the server to load * @return Fragment */ fun newInstance(serverId: Long): SitemapSelectFragment { val fragment = SitemapSelectFragment() val args = Bundle() args.putLong(ARG_SHOW_SERVER, serverId) fragment.arguments = args return fragment } } }
mobile/src/main/java/treehou/se/habit/ui/servers/sitemaps/list/SitemapSelectFragment.kt
2832871980
// Copyright 2000-2018 JetBrains s.r.o. Use of this source code is governed by the Apache 2.0 license that can be found in the LICENSE file. package com.intellij.configurationStore import com.intellij.ide.highlighter.ProjectFileType import com.intellij.ide.highlighter.WorkspaceFileType import com.intellij.notification.Notifications import com.intellij.notification.NotificationsManager import com.intellij.openapi.application.ApplicationManager import com.intellij.openapi.application.invokeAndWaitIfNeed import com.intellij.openapi.application.runReadAction import com.intellij.openapi.components.* import com.intellij.openapi.components.impl.stores.IComponentStore import com.intellij.openapi.components.impl.stores.IProjectStore import com.intellij.openapi.components.impl.stores.SaveSessionAndFile import com.intellij.openapi.diagnostic.runAndLogException import com.intellij.openapi.module.Module import com.intellij.openapi.module.ModuleManager import com.intellij.openapi.project.Project import com.intellij.openapi.project.ProjectCoreUtil import com.intellij.openapi.project.ex.ProjectNameProvider import com.intellij.openapi.project.getProjectCachePath import com.intellij.openapi.project.impl.ProjectImpl import com.intellij.openapi.project.impl.ProjectManagerImpl.UnableToSaveProjectNotification import com.intellij.openapi.project.impl.ProjectStoreClassProvider import com.intellij.openapi.util.io.FileUtil import com.intellij.openapi.util.io.FileUtilRt import com.intellij.openapi.util.registry.Registry import com.intellij.openapi.vfs.LocalFileSystem import com.intellij.openapi.vfs.ReadonlyStatusHandler import com.intellij.openapi.vfs.VfsUtil import com.intellij.openapi.vfs.VirtualFile import com.intellij.util.PathUtilRt import com.intellij.util.SmartList import com.intellij.util.containers.computeIfAny import com.intellij.util.containers.isNullOrEmpty import com.intellij.util.io.* import com.intellij.util.lang.CompoundRuntimeException import com.intellij.util.text.nullize import java.nio.file.Path import java.nio.file.Paths internal const val PROJECT_FILE = "\$PROJECT_FILE$" internal const val PROJECT_CONFIG_DIR = "\$PROJECT_CONFIG_DIR$" val IProjectStore.nameFile: Path get() = Paths.get(directoryStorePath, ProjectImpl.NAME_FILE) internal val PROJECT_FILE_STORAGE_ANNOTATION = FileStorageAnnotation(PROJECT_FILE, false) internal val DEPRECATED_PROJECT_FILE_STORAGE_ANNOTATION = FileStorageAnnotation(PROJECT_FILE, true) // cannot be `internal`, used in Upsource abstract class ProjectStoreBase(override final val project: ProjectImpl) : ComponentStoreWithExtraComponents(), IProjectStore { // protected setter used in upsource // Zelix KlassMaster - ERROR: Could not find method 'getScheme()' var scheme: StorageScheme = StorageScheme.DEFAULT override final var loadPolicy: StateLoadPolicy = StateLoadPolicy.LOAD override final fun isOptimiseTestLoadSpeed(): Boolean = loadPolicy != StateLoadPolicy.LOAD override final fun getStorageScheme(): StorageScheme = scheme override abstract val storageManager: StateStorageManagerImpl protected val isDirectoryBased: Boolean get() = scheme == StorageScheme.DIRECTORY_BASED override final fun setOptimiseTestLoadSpeed(value: Boolean) { // we don't load default state in tests as app store does because // 1) we should not do it // 2) it was so before, so, we preserve old behavior (otherwise RunManager will load template run configurations) loadPolicy = if (value) StateLoadPolicy.NOT_LOAD else StateLoadPolicy.LOAD } override fun getProjectFilePath(): String = storageManager.expandMacro(PROJECT_FILE) /** * `null` for default or non-directory based project. */ override fun getProjectConfigDir(): String? = if (isDirectoryBased) storageManager.expandMacro(PROJECT_CONFIG_DIR) else null override final fun getWorkspaceFilePath(): String = storageManager.expandMacro(StoragePathMacros.WORKSPACE_FILE) override final fun clearStorages() { storageManager.clearStorages() } override final fun loadProjectFromTemplate(defaultProject: Project) { defaultProject.save() val element = (defaultProject.stateStore as DefaultProjectStoreImpl).getStateCopy() ?: return LOG.runAndLogException { if (isDirectoryBased) { normalizeDefaultProjectElement(defaultProject, element, Paths.get(storageManager.expandMacro(PROJECT_CONFIG_DIR))) } else { LOG.runAndLogException { moveComponentConfiguration(defaultProject, element) { if (it == "workspace.xml") Paths.get(workspaceFilePath) else Paths.get(projectFilePath) } } } } (storageManager.getOrCreateStorage(PROJECT_FILE) as XmlElementStorage).setDefaultState(element) } override final fun getProjectBasePath(): String { if (isDirectoryBased) { val path = PathUtilRt.getParentPath(storageManager.expandMacro(PROJECT_CONFIG_DIR)) if (Registry.`is`("store.basedir.parent.detection", true) && PathUtilRt.getFileName(path).startsWith("${Project.DIRECTORY_STORE_FOLDER}.")) { return PathUtilRt.getParentPath(PathUtilRt.getParentPath(path)) } return path } else { return PathUtilRt.getParentPath(projectFilePath) } } // used in upsource protected fun setPath(filePath: String, refreshVfs: Boolean) { val storageManager = storageManager val fs = LocalFileSystem.getInstance() if (filePath.endsWith(ProjectFileType.DOT_DEFAULT_EXTENSION)) { scheme = StorageScheme.DEFAULT storageManager.addMacro(PROJECT_FILE, filePath) val workspacePath = composeFileBasedProjectWorkSpacePath(filePath) storageManager.addMacro(StoragePathMacros.WORKSPACE_FILE, workspacePath) if (refreshVfs) { invokeAndWaitIfNeed { VfsUtil.markDirtyAndRefresh(false, true, false, fs.refreshAndFindFileByPath(filePath), fs.refreshAndFindFileByPath(workspacePath)) } } if (ApplicationManager.getApplication().isUnitTestMode) { // load state only if there are existing files isOptimiseTestLoadSpeed = !Paths.get(filePath).exists() } } else { scheme = StorageScheme.DIRECTORY_BASED val configDir = "$filePath/${Project.DIRECTORY_STORE_FOLDER}" storageManager.addMacro(PROJECT_CONFIG_DIR, configDir) storageManager.addMacro(PROJECT_FILE, "$configDir/misc.xml") storageManager.addMacro(StoragePathMacros.WORKSPACE_FILE, "$configDir/workspace.xml") if (ApplicationManager.getApplication().isUnitTestMode) { // load state only if there are existing files isOptimiseTestLoadSpeed = !Paths.get(filePath).exists() } if (refreshVfs) { invokeAndWaitIfNeed { VfsUtil.markDirtyAndRefresh(false, true, true, fs.refreshAndFindFileByPath(configDir)) } } } storageManager.addMacro(StoragePathMacros.CACHE_FILE, FileUtilRt.toSystemIndependentName(project.getProjectCachePath("workspace").toString()) + ".xml") } override fun <T> getStorageSpecs(component: PersistentStateComponent<T>, stateSpec: State, operation: StateStorageOperation): List<Storage> { val storages = stateSpec.storages if (storages.isEmpty()) { return listOf(PROJECT_FILE_STORAGE_ANNOTATION) } if (isDirectoryBased) { var result: MutableList<Storage>? = null for (storage in storages) { if (storage.path != PROJECT_FILE) { if (result == null) { result = SmartList() } result.add(storage) } } if (result.isNullOrEmpty()) { return listOf(PROJECT_FILE_STORAGE_ANNOTATION) } else { result!!.sortWith(deprecatedComparator) if (isDirectoryBased) { StreamProviderFactory.EP_NAME.getExtensions(project).computeIfAny { LOG.runAndLogException { it.customizeStorageSpecs(component, storageManager, stateSpec, result!!, operation) } }?.let { // yes, DEPRECATED_PROJECT_FILE_STORAGE_ANNOTATION is not added in this case return it } } // if we create project from default, component state written not to own storage file, but to project file, // we don't have time to fix it properly, so, ancient hack restored if (result.first().path != StoragePathMacros.CACHE_FILE) { result.add(DEPRECATED_PROJECT_FILE_STORAGE_ANNOTATION) } return result } } else { var result: MutableList<Storage>? = null // FlexIdeProjectLevelCompilerOptionsHolder, FlexProjectLevelCompilerOptionsHolderImpl and CustomBeanRegistry var hasOnlyDeprecatedStorages = true for (storage in storages) { @Suppress("DEPRECATION") if (storage.path == PROJECT_FILE || storage.path == StoragePathMacros.WORKSPACE_FILE || storage.path == StoragePathMacros.CACHE_FILE) { if (result == null) { result = SmartList() } result.add(storage) if (!storage.deprecated) { hasOnlyDeprecatedStorages = false } } } if (result.isNullOrEmpty()) { return listOf(PROJECT_FILE_STORAGE_ANNOTATION) } else { if (hasOnlyDeprecatedStorages) { result!!.add(PROJECT_FILE_STORAGE_ANNOTATION) } result!!.sortWith(deprecatedComparator) return result } } } override fun isProjectFile(file: VirtualFile): Boolean { if (!file.isInLocalFileSystem || !ProjectCoreUtil.isProjectOrWorkspaceFile(file)) { return false } val filePath = file.path if (!isDirectoryBased) { return filePath == projectFilePath || filePath == workspaceFilePath } return FileUtil.isAncestor(PathUtilRt.getParentPath(projectFilePath), filePath, false) } override fun getDirectoryStorePath(ignoreProjectStorageScheme: Boolean): String? = if (!ignoreProjectStorageScheme && !isDirectoryBased) null else PathUtilRt.getParentPath(projectFilePath).nullize() override fun getDirectoryStoreFile(): VirtualFile? = directoryStorePath?.let { LocalFileSystem.getInstance().findFileByPath(it) } override fun getDirectoryStorePathOrBase(): String = PathUtilRt.getParentPath(projectFilePath) } private open class ProjectStoreImpl(project: ProjectImpl, private val pathMacroManager: PathMacroManager) : ProjectStoreBase(project) { private var lastSavedProjectName: String? = null init { assert(!project.isDefault) } override final fun getPathMacroManagerForDefaults() = pathMacroManager override val storageManager = ProjectStateStorageManager(TrackingPathMacroSubstitutorImpl(pathMacroManager), project) override fun setPath(path: String) { setPath(path, true) } override fun getProjectName(): String { if (!isDirectoryBased) { return PathUtilRt.getFileName(projectFilePath).removeSuffix(ProjectFileType.DOT_DEFAULT_EXTENSION) } val baseDir = projectBasePath val nameFile = nameFile if (nameFile.exists()) { LOG.runAndLogException { nameFile.inputStream().reader().useLines { line -> line.firstOrNull { !it.isEmpty() }?.trim() }?.let { lastSavedProjectName = it return it } } } return ProjectNameProvider.EP_NAME.extensionList.computeIfAny { LOG.runAndLogException { it.getDefaultName(project) } } ?: PathUtilRt.getFileName(baseDir).replace(":", "") } private fun saveProjectName() { if (!isDirectoryBased) { return } val currentProjectName = project.name if (lastSavedProjectName == currentProjectName) { return } lastSavedProjectName = currentProjectName val basePath = projectBasePath if (currentProjectName == PathUtilRt.getFileName(basePath)) { // name equals to base path name - just remove name nameFile.delete() } else { if (Paths.get(basePath).isDirectory()) { nameFile.write(currentProjectName.toByteArray()) } } } override fun doSave(saveSession: SaveExecutor, readonlyFiles: MutableList<SaveSessionAndFile>, errors: MutableList<Throwable>) { try { saveProjectName() } catch (e: Throwable) { LOG.error("Unable to store project name", e) } beforeSave(readonlyFiles) super.doSave(saveSession, readonlyFiles, errors) val notifications = NotificationsManager.getNotificationsManager().getNotificationsOfType(UnableToSaveProjectNotification::class.java, project) if (readonlyFiles.isEmpty()) { for (notification in notifications) { notification.expire() } return } if (!notifications.isEmpty()) { throw IComponentStore.SaveCancelledException() } val status = runReadAction { ReadonlyStatusHandler.getInstance(project).ensureFilesWritable(*getFilesList(readonlyFiles)) } if (status.hasReadonlyFiles()) { dropUnableToSaveProjectNotification(project, status.readonlyFiles) throw IComponentStore.SaveCancelledException() } val oldList = readonlyFiles.toTypedArray() readonlyFiles.clear() for (entry in oldList) { executeSave(entry.session, readonlyFiles, errors) } CompoundRuntimeException.throwIfNotEmpty(errors) if (!readonlyFiles.isEmpty()) { dropUnableToSaveProjectNotification(project, getFilesList(readonlyFiles)) throw IComponentStore.SaveCancelledException() } } protected open fun beforeSave(readonlyFiles: MutableList<SaveSessionAndFile>) { } } private fun dropUnableToSaveProjectNotification(project: Project, readOnlyFiles: Array<VirtualFile>) { val notifications = NotificationsManager.getNotificationsManager().getNotificationsOfType(UnableToSaveProjectNotification::class.java, project) if (notifications.isEmpty()) { Notifications.Bus.notify(UnableToSaveProjectNotification(project, readOnlyFiles), project) } else { notifications[0].myFiles = readOnlyFiles } } private fun getFilesList(readonlyFiles: List<SaveSessionAndFile>) = Array(readonlyFiles.size) { readonlyFiles[it].file } private class ProjectWithModulesStoreImpl(project: ProjectImpl, pathMacroManager: PathMacroManager) : ProjectStoreImpl(project, pathMacroManager) { override fun beforeSave(readonlyFiles: MutableList<SaveSessionAndFile>) { super.beforeSave(readonlyFiles) for (module in (ModuleManager.getInstance(project)?.modules ?: Module.EMPTY_ARRAY)) { module.stateStore.save(readonlyFiles) } } } // used in upsource class PlatformLangProjectStoreClassProvider : ProjectStoreClassProvider { override fun getProjectStoreClass(isDefaultProject: Boolean): Class<out IComponentStore> { return if (isDefaultProject) DefaultProjectStoreImpl::class.java else ProjectWithModulesStoreImpl::class.java } } @Suppress("unused") private class PlatformProjectStoreClassProvider : ProjectStoreClassProvider { override fun getProjectStoreClass(isDefaultProject: Boolean): Class<out IComponentStore> { return if (isDefaultProject) DefaultProjectStoreImpl::class.java else ProjectStoreImpl::class.java } } private fun composeFileBasedProjectWorkSpacePath(filePath: String) = "${FileUtilRt.getNameWithoutExtension(filePath)}${WorkspaceFileType.DOT_DEFAULT_EXTENSION}"
platform/configuration-store-impl/src/ProjectStoreImpl.kt
273462099
/* * Copyright 2018 Google LLC. * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package io.plaidapp.core.dagger.dribbble import dagger.Lazy import dagger.Module import dagger.Provides import io.plaidapp.core.dagger.scope.FeatureScope import io.plaidapp.core.dribbble.data.ShotsRepository import io.plaidapp.core.dribbble.data.search.DribbbleSearchConverter import io.plaidapp.core.dribbble.data.search.DribbbleSearchService import io.plaidapp.core.dribbble.data.search.SearchRemoteDataSource import okhttp3.OkHttpClient import retrofit2.Retrofit /** * Dagger module providing classes required to dribbble with data. */ @Module class DribbbleDataModule { @Provides @FeatureScope fun provideShotsRepository(remoteDataSource: SearchRemoteDataSource) = ShotsRepository.getInstance(remoteDataSource) @Provides @FeatureScope fun provideConverterFactory(): DribbbleSearchConverter.Factory = DribbbleSearchConverter.Factory() @Provides @FeatureScope fun provideDribbbleSearchService( client: Lazy<OkHttpClient>, converterFactory: DribbbleSearchConverter.Factory ): DribbbleSearchService = Retrofit.Builder() .baseUrl(DribbbleSearchService.ENDPOINT) .callFactory(client.get()) .addConverterFactory(converterFactory) .build() .create(DribbbleSearchService::class.java) }
core/src/main/java/io/plaidapp/core/dagger/dribbble/DribbbleDataModule.kt
2576522089
package com.engineer.plugin.transforms.tiger import com.engineer.plugin.transforms.BaseTransform import org.gradle.api.Project import org.objectweb.asm.ClassReader import org.objectweb.asm.ClassVisitor import org.objectweb.asm.ClassWriter import java.io.InputStream import java.io.OutputStream import java.util.function.BiConsumer /** * @author rookie * @since 01-03-2020 */ class TigerTransform(val project: Project) : BaseTransform(project) { override fun provideFunction(): BiConsumer<InputStream, OutputStream>? { return BiConsumer { t, u -> val reader = ClassReader(t) val writer = ClassWriter(reader, ClassWriter.COMPUTE_MAXS) val visitor = TigerClassVisitor(project, writer) reader.accept(visitor, ClassReader.EXPAND_FRAMES) val code = writer.toByteArray() u.write(code) } } override fun getName(): String { return "tiger" } }
buildSrc/src/main/kotlin/com/engineer/plugin/transforms/tiger/TigerTransform.kt
1030958450
package de.xikolo.utils import de.xikolo.App import java.io.File import java.util.* object ClientUtil { private const val FILE_NAME = "INSTALLATION" var id: String? = null get() { if (field == null) { val installationFile = File(App.instance.filesDir, FILE_NAME) try { if (!installationFile.exists()) { installationFile.writeText( UUID.randomUUID().toString() ) } field = installationFile.readText() } catch (e: Exception) { throw RuntimeException(e) } } return field } }
app/src/main/java/de/xikolo/utils/ClientUtil.kt
143153485
/* * Copyright (C) 2017 The Android Open Source Project * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. */ package io.mockk.proxy.android.transformation import io.mockk.proxy.MockKAgentException import io.mockk.proxy.common.transformation.ClassTransformationSpecMap import java.util.* internal class InliningClassTransformer( private val specMap: ClassTransformationSpecMap ) { val identifier = newId() @Suppress("unused") // JNI call fun transform(classBeingRedefined: Class<*>?, classfileBuffer: ByteArray): ByteArray? { if (classBeingRedefined == null) { return classfileBuffer } val spec = specMap[classBeingRedefined] ?: return classfileBuffer return synchronized(lock) { try { nativeRedefine( identifier, classfileBuffer, spec.shouldDoSimpleIntercept, spec.shouldDoStaticIntercept, spec.shouldDoConstructorIntercept ) } catch (ex: Exception) { throw MockKAgentException("Transformation issue", ex) } } } fun shouldTransform(classBeingRedefined: Class<*>) = specMap.shouldTransform(classBeingRedefined) private external fun nativeRedefine( identifier: String, original: ByteArray, mockk: Boolean, staticMockk: Boolean, constructorMockk: Boolean ): ByteArray companion object { private val lock = Any() private val rng = Random() private fun newId() = Math.abs(rng.nextLong()).toString(16) } }
modules/mockk-agent-android/src/main/kotlin/io/mockk/proxy/android/transformation/InliningClassTransformer.kt
314112030
package io.mockk.it import io.mockk.Runs import io.mockk.every import io.mockk.just import io.mockk.spyk import io.mockk.verify import kotlin.test.Test import kotlin.test.assertEquals class PrivatePropertiesTest { /** * See issue #51 */ @Test fun testPrivateProperty() { val mock = spyk(Team(), recordPrivateCalls = true) every { mock getProperty "person" } returns Person("Big Ben") every { mock setProperty "person" value Person("test") } just Runs every { mock invoke "fn" withArguments listOf(5) } returns 3 assertEquals("Big Ben", mock.memberName) assertEquals(3, mock.pubFn(5)) mock.memberName = "test" assertEquals("Big Ben", mock.memberName) verify { mock getProperty "person" } verify { mock setProperty "person" value Person("test") } verify { mock invoke "fn" withArguments listOf(5) } } data class Person(var name: String) class Team { protected var person: Person = Person("Init") get() = Person("Ben") set(value) { field = value } protected fun fn(arg: Int): Int = arg + 5 fun pubFn(arg: Int) = fn(arg) var memberName: String get() = person.name set(value) { person = Person(value) } } }
modules/mockk/src/commonTest/kotlin/io/mockk/it/PrivatePropertiesTest.kt
1327171752