Datasets:

timaeus
/

pile-dm_mathematics

Dataset card Data Studio Files Files and versions Community

Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
14514. Calculate the greatest common factor of 13 and g. 13 Let q be (-60)/(-90)(-54)/(-1). What is the highest common factor of 684 and q? 36 Let k = -1426 + 1431. Let o be (-4 - 1)/(1/(-7)). Calculate the greatest common divisor of k and o. 5 Let l(z) = 22z - 629. Let t be l(48). What is the greatest common factor of t and 244? 61 Let r(y) = y*2 - 6y + 67. Let c be r(4). Calculate the greatest common factor of c and 1. 1 Let w = -5 + -2. Let n = -52 - -90. Let q = n - w. What is the highest common factor of 5 and q? 5 Let y be (779/35 - (-21)/35)7. Calculate the highest common factor of y and 128. 32 Let q(k) = 4k*2 + 3k + 6. Let s = -21 + 26. Let a be q(s). Let v be ((-2)/(4/(-22)))/1. What is the greatest common divisor of v and a? 11 Let i(q) = -2q3 + 12q*2 - 5q - 13. Let f be i(4). What is the greatest common divisor of 3503 and f? 31 Let b = -14 + 16. Suppose bn - 4 = -0n. Calculate the highest common factor of n and 10. 2 Let i = -8 + 0. Let b be (-4)/i + 5/(-10). Suppose b = d + 3 - 4. Calculate the greatest common factor of 1 and d. 1 Suppose -3d = -5l - 252, -2l + d = 2l + 203. Let z = -38 - l. What is the greatest common factor of 143 and z? 13 Let p be 29/(-145) + 216/5. What is the highest common divisor of p and 86? 43 Let j(x) = 4x + 18. Let o be j(3). Let f = 34 - o. Calculate the highest common divisor of 2 and f. 2 Let a be (5 + 37/(-3))-12. What is the greatest common divisor of 286 and a? 22 Let i(d) = 72d2 + 12. Let n be i(-3). What is the highest common factor of n and 36? 12 Let a = -870 - -1478. Calculate the greatest common factor of a and 19. 19 Let t(i) = i2 - 6i - 47. Let j be t(11). What is the highest common factor of 8 and j? 8 Let a(i) = 3i2 - i - 5. Let x be a(2). What is the highest common divisor of 85 and x? 5 Let w(j) = -15j. Let q be w(-2). Let p be (-375)/75 + (-20)/(-1). Calculate the highest common divisor of q and p. 15 Suppose 2k - 197 = 167. Let i(x) = -8x + 598. Let t be i(73). Calculate the highest common divisor of t and k. 14 Suppose -3 = 3l - 153. Let y = l - 10. Let u be 0 + -1 + 3 + y. What is the highest common factor of u and 21? 21 Let u = 7 + 1. Suppose -3l + u + 7 = 0. Suppose -2m - 2t + 3t = -25, 73 = lm + t. What is the highest common factor of m and 14? 14 Let u be (-9)/(-1 + (-2)/(-4)). Let x be 44/16 + -25/(-40). Suppose 4 = -2c + w + 26, -31 = -xc + w. Calculate the greatest common factor of c and u. 9 Let m = 398 - 370. What is the highest common divisor of m and 14? 14 Let c(i) = i3 + 10i*2 + 6i - 20. Let s be c(-8). What is the highest common divisor of s and 345? 15 Let n be (-4)/(-6) - 2744/(-294). Let m = 7 + 18. What is the highest common factor of n and m? 5 Suppose -2v + 5z + 79 - 14 = 0, -2 = 2z. Let h = v - 25. What is the highest common divisor of h and 40? 5 Let k = 21 + -19. Suppose 0x - kx = -48. Let l = -15 + x. Calculate the highest common factor of l and 45. 9 Suppose 460 = 27z - 23z. What is the highest common divisor of z and 69? 23 Let j = 48 - 48. Suppose -40t + 41t - 30 = j. What is the highest common divisor of 150 and t? 30 Let i(p) = -p3 - 7p*2 + 17p - 31. Let b be i(-12). Calculate the highest common factor of 5 and b. 5 Suppose 0 = 52v + 6v - 4872. Calculate the greatest common divisor of v and 156. 12 Let y(i) = -i*2 + 20i + 46. Let l be y(22). Suppose lx - 39 = -x. What is the greatest common divisor of x and 65? 13 Let h(z) be the third derivative of -7z*4/12 - 10z*3/3 + 9z*2. Let a be h(-10). What is the greatest common divisor of a and 20? 20 Suppose 0g - 4n = -4g + 428, 103 = g - 5n. Suppose -4a = 3y + 39, 3y = 15 - 6. Let p be 0(-5)/15 - a. What is the highest common divisor of p and g? 12 Suppose -112 + 14 = -2t. Let x be (4 - 4)(1 - 0). Suppose y - t = -3d - xy, -3d - 4y = -52. Calculate the highest common factor of d and 64. 16 Let m(k) = k3 - 8k*2 + 9k - 6. Let i be m(7). Let a = i + -9. Let y be (18/(-7))/(a/14). What is the greatest common divisor of 9 and y? 9 Let g(l) = 4l + 8 + 3l*2 - 6l*2 - 10. Let i be g(2). Let h be 0 - (i - 0/4). What is the highest common factor of 30 and h? 6 Let p = -3 + 4. Let d = 167 + -160. Calculate the greatest common divisor of p and d. 1 Suppose -2x = -2u + 30 + 14, 5u - 3x = 104. Calculate the highest common factor of u and 19. 19 Let a(b) = -b3 + 10b*2 - 8b - 8. Let m be a(9). Let u = -2 + m. Let p be u + 16 + -8 + 5. Calculate the highest common divisor of p and 132. 12 Suppose -2 = 4q + 6. Let g be 3 + -4 + (47 - q). Calculate the highest common factor of g and 8. 8 Let l be 2772/(-165)(-10)/3. Let f = 6 + -10. Let k = 10 - f. Calculate the greatest common divisor of k and l. 14 Suppose 0 = -q + 20 + 36. Suppose 4o - 328 = -4x, 0 = -5o - 2x + 5x + 386. Let z = 87 - o. Calculate the highest common divisor of z and q. 8 Suppose 30 = 3z - 21. Let v = z - 24. Let x = v - -25. What is the greatest common factor of 36 and x? 18 Suppose -87 = -7h + 284. What is the highest common divisor of 2703 and h? 53 Let t be ((-8)/(-10) - 12/40)6. Suppose 5 = tr - 7. Let a = 1 + 1. Calculate the highest common divisor of a and r. 2 Let a be (11/(-33))/((-3)/63). Suppose -11c + ac + 48 = 0. What is the greatest common divisor of c and 6? 6 Suppose 7w - 11 - 528 = 0. Calculate the greatest common factor of w and 44. 11 Let k be (4 - 8 - -85 - 0)2. What is the highest common divisor of k and 24? 6 Suppose 0 = 11o - 7 - 37. Suppose 0 = 2x + 4c - 7c - 78, -3x + 118 = -oc. What is the highest common divisor of 6 and x? 6 Let s(c) = 13c + 182. Let o be s(-11). Calculate the greatest common factor of o and 6. 3 Let u = 1092 + -1047. Suppose -6k + 72 = -2k. Calculate the greatest common divisor of u and k. 9 Let c(b) be the second derivative of -5b3/6 - b2/2 + 8b. Let i be c(-3). Calculate the highest common factor of 56 and i. 14 Let h = 7 - -16. Let g be (18/(-15))/(6/(-460)). Calculate the highest common divisor of g and h. 23 Suppose 4d - 2 = -4m + 2, -3m - 5d = 7. Let h(a) = 5a - 10a - 9 - 7a + 0a - a*2. Let s be h(-11). What is the highest common divisor of m and s? 2 Let k = 267 - 169. Suppose -7n + 10n - 42 = 0. What is the greatest common factor of n and k? 14 Let c be (-4)/((9 - 7)(-2)/16). Let f be (14/(-6))/(c/(-12))12. What is the greatest common factor of f and 147? 21 Let v be 207 - 2 - (-2 - -3). What is the greatest common factor of v and 12? 12 Suppose 157 = 3n - 5a, 3n + 3a = 5n - 106. Suppose 2y = -t + 35, -5y + 5t + n = -2y. What is the greatest common divisor of 2 and y? 2 Let r be ((-153)/18 + 8)/(4/(-24)). Suppose n + 3n = 0. Let h(u) = u2 + 3. Let i be h(n). Calculate the highest common factor of r and i. 3 Let s(j) = 7j*2 - j + 1. Let n be s(1). Let o be 8 - (-3 - 0/1). Let u = o + 17. What is the greatest common factor of n and u? 7 Suppose 47l - 50l = 1005. Let d be (-8)/52 - l/65. Calculate the greatest common factor of d and 15. 5 Suppose z = -2d - 2z + 441, -z - 1111 = -5d. Suppose 3s - b - 129 = -3b, -b + d = 5s. What is the highest common divisor of 18 and s? 9 Suppose -5x + 4j = -10 - 105, 0 = 3j - 15. Suppose -2m - 7 = -x. Calculate the highest common factor of m and 15. 5 Suppose 3 = l + 6, 5n - 3l = -1. Let v be n + (-4)/(-4) - -41. Calculate the greatest common factor of 8 and v. 8 Suppose 4c = 37 + 3. Suppose 2r + 4 - c = 0. Suppose 2z = -h + 54, -2h + 3h - 81 = -3z. Calculate the greatest common divisor of r and z. 3 Let l(v) = 0 + 11v + 32v2 + 1 - 10v + 129v2. Let p be l(-1). Calculate the greatest common factor of 23 and p. 23 Suppose -170m + 167m = -288. Suppose 0 = -3c + 6 + 66. Calculate the greatest common divisor of m and c. 24 Suppose 5b = -6o + 3o + 65, 5b - 25 = 5o. What is the highest common factor of 110 and b? 10 Let z = -320 - -496. Let w(s) = -s3 - 8s*2 + s + 7. Let a be w(-7). Let g = -27 - a. What is the highest common factor of g and z? 22 Let k be (-1)/((-6)/(-7) + (-1160)/1288). Calculate the highest common divisor of 713 and k. 23 Suppose -155a + 160a - 1060 = 0. Calculate the greatest common divisor of 4 and a. 4 Let r(j) = 2j + 9. Let a be r(-7). Let z = 10 + a	{ "pile_set_name": "DM Mathematics" }
, 5r + 51 - 25 = 2k for r. -4 Solve 5i + 5w - 44 = -74, 14 = -2i - 4w for i. -5 Solve 13 = -v - 2o, -3o + 22 = -4v + 25 for v. -3 Solve -w - 3 = -2l, -4l = 3w - 0 - 11 for l. 2 Solve -120f - 1 = -119f + 5u, -4u + 8 = 3f for f. 4 Solve 3c + f = -c + 18, c - 3 = -f for c. 5 Solve m + 4v + 15 = -2m, 0 = 2m - 2v + 10 for m. -5 Solve 4i + 23 = -5g, -4i + 5g + 7 = -0g for i. -2 Solve -4 = 2v + v + p, -4p = -8 for v. -2 Solve -15k - 4t = -10k - 45, 7k - 45 = -2t for k. 5 Solve 0 = -4w + a - 5, -4a = -w - 20 for w. 0 Solve v = 3c + c - 11, -5c = -v - 14 for v. 1 Solve -r + 3s = 52 - 38, 0 = -4s + 20 for r. 1 Solve -4i + 4 = -0i, -5 = 3p + 4i for p. -3 Solve 4l - h + 15 = 0, 5h + 0h = -l - 30 for l. -5 Solve -2r = -7r + q + 12, -5r + 18 = q for r. 3 Solve 11m - 13m + 5x = 35, 4x - 5 = -3m for m. -5 Solve -z + j - 2 = 0, -j + 0j + 2 = -5z for z. 0 Solve 0 = 5r - 6r - 5s, 4 = 4s for r. -5 Solve -35b + 30b = -f - 26, -2f = 4b - 18 for b. 5 Solve o - 3l + 624 = 638, -l - 9 = 4o for o. -1 Solve 0 = -4n - 5x + 13, 3n - 6 = -x - 10 for n. -3 Solve -l = -r - 3, 21r + 2l = 26r + 3 for r. 1 Solve 5l = 4h - 2h + 8, -2l - 4 = h for l. 0 Solve j + 4z + 5 = 0, 0z = 5j - 3z + 2 for j. -1 Solve 3f - 3 = -2n, 0 = -5f + 6f + 1 for n. 3 Solve -19l = -22l - 4o + 5, 2l - 5 = -o for l. 3 Solve s + 5u - 10 = -31, -4 = u for s. -1 Solve 11 = h + 4v, 8v - 10v = 4h + 12 for h. -5 Solve 2a - 35 = -5n, -4a + 2n + 30 = 4n for a. 5 Solve 0 = -3s - 12, -4s = -5h + 9h for h. 4 Solve 6j = 4k + 2j - 8, 0 = -4k - 4j + 32 for k. 5 Solve -24m - 5k - 35 = -28m, k - 22 = -5m for m. 5 Solve 3c + 4 = 2u, c - 2 = -u + 5u for u. -1 Solve 2b + 6z = z + 23, 4z = -3b + 24 for b. 4 Solve k - 2m - 2 = -2k, 0 = 5m + 20 for k. -2 Solve 0 = -2l + 2, -7 = 3p + 5l - 18 for p. 2 Solve 0 = -20v + 23v + 3d, -4d = -v - 20 for v. -4 Solve 13 = 2x + 3s, -7x + 2x + 29 = 4s for x. 5 Solve -2j - 4 = v, 5j - 1 = -4v - 14 for j. -1 Solve -3p - 4g + 5 = 0, 5p - 10 - 3 = -2g for p. 3 Solve 17d - 13d + 2t + 2 = 0, 5t + 5 = -4d for d. 0 Solve 0 = -s - 2, 5h - 22 = -3s - 3 for h. 5 Solve 12 = -3q - 4v + 38, -v + 15 = 5q for q. 2 Solve 4v + 13 = -5w + 7v, 0 = 4w - 3v + 8 for w. -5 Solve 35 - 15 = 2s + 5v, s + 2v - 9 = 0 for s. 5 Solve -5l = 5o, 3l - 9o + 6o - 12 = 0 for l. 2 Solve -12 = 5c + 2o, -26o + 25o + 28 = -6c for c. -4 Solve 0 = 2j + 4c - 26, -4j - 4c = -5j - 17 for j. 3 Solve 5s = -2o + 19, 4 = 4o - 4 for s. 3 Solve -2k - u = 0, 4u = -2k + 5k for k. 0 Solve -2c + 5i - 5 = 0, -2c = 3i - 4 + 1 for c. 0 Solve 0 = x - 4w - 35, x - w - 9 = 2 for x. 3 Solve -4u - 3 = -5a, 5a - 3u - 5 = 2u for a. -1 Solve 3o - 2p = 14, -3o - 8p + 10 = -6p for o. 4 Solve -5 - 6 = 5y + 4f, -14 = 3y - 5f for y. -3 Solve -u + 0 = -l - 1, 4l + 6 = 2u for l. -2 Solve -75 + 63 = 3j, -3j = 2b + 14 for b. -1 Solve -4f + s = 18 + 2, 0 = 2f - 5s + 10 for f. -5 Solve 4z + 28 = -4t, 0 = 2t - 3t - 3 for z. -4 Solve -9b = -5b - 5d + 11, 3b - d = 0 for b. 1 Solve 0 = a + 3v - 9, 21a - 20a + 3 = 3v for a. 3 Solve -x - 51u + 48u + 2 = 0, -u = -2x - 17 for x. -7 Solve -f = 2o + 3, -o = 5f - 12 + 27 for o. 0 Solve -2o + 2d = -8, -d + 14 = 5o - 3d for o. 2 Solve 4x = i - 14 - 15, -3i = x - 9 for x. -6 Solve 3b = -b + 2d - 26, -19 = 2b - 3d for b. -5 Solve -d + 14 = 5h, h + d = 5h - 13 for h. 3 Solve 4v - 2v = q - 7, 4q = v + 14 for v. -2 Solve -34r + 5v = -37r + 8, 2 = -2r + 4v for r. 1 Solve 22 = o + 5p, 15p - 12 = 12p for o. 2 Solve -4z = -2l + 8, 8 = 2l - 0z + 2z for l. 4 Solve -62 + 85 = 5n + 2a, -5a = 3n - 29 for n. 3 Solve -9v - 2z = -5v + 12, 5v - 5z = 15 for v. -1 Solve -n = 26 - 29, 3n - 4 = -5y for y. -1 Solve 6o - 4o + w = -5, -2w = -3o - 11 for o. -3 Solve 0 = 3o - 55u + 57u + 17, -4o + 2u = 4 for o. -3 Solve -3i = -2f + 5, -2f - 30 = -0f + 4i for f. -5 Solve 0 = -5o - 3t + 2, 9t = -o + 6t - 2 for o. 1 Solve -2p + 4w + 8 = 0, p + 2w - 2 = -10 for p. -2 Solve j - 1 = 4m, -3m - 2j - 237 = -228 for m. -1 Solve -3z = 3d, d = 4d - 4z + 21 for d. -3 Solve 9d - 8 = 7d - 2i, 0 = -2d - 4i + 6 for d. 5 Solve -2n = 3w + 3 - 2, 18 = 3n - 2w for n. 4 Solve -5t - z + 9 = 17, 8 = t + 5z for t. -2 Solve 5o - 5 = -5x, 340o = 342o + 4x - 4 for o. 0 Solve -11 = -4g - 3x, 8g + 4x - 17 = 5g for g. -1 Solve -n + 2l - 7l = -18, 0 = -n - 2l + 6 for n. -2 Solve 2t + 25 = -5d, 2t - 10d + 1 = -7d for t. -5 Solve -2v + 4j - 5 = 1, -18 = 4v - 2j for v. -5 Solve 3b - b - 3k = -1, 0 = -5b + 4k + 8 for b. 4 Solve -t = 3g + 7, -2g = -17t + 19t + 6 for t. -1 Solve 13z - 15z - 4k = -20, -3z - k = -5 for z. 0 Solve 3h - 2u = -6u - 20, -3u + 14 = -5h for h. -4 Solve -2d - 5 = -3l - 4, 0 = 5d - l - 4 for d. 1 Solve -5m + 2l = -1 + 14, 2m + 4l - 14 = 0 for m. -1 Solve -4n + 3 = -5y, 5y = 4y + n for y. -3 Solve 0 = 3o + 4t - 3, -o + 2 = -t - 6 for o. 5 Solve -3q - 12 = -3u, -2 = 5q - 10u + 14u for q. -2 Solve 2 = f, -9d + 3f + 4 = -7d for d. 5 Solve g - 14 = -5j, -2j - 16 = -0j - 5g for j. 2 Solve 0 = -5c - l - 3l - 40, -4c + 4l = -4 for c. -4 Solve -2o - 2b = -4, 0 = 4o + b - 4 - 1 for o. 1 Solve -4v + 4t + 12 = 0, t - 12 = 4v - 6v for v. 5 Solve -3y - 20 = -5c, 4c - c + 7 = -2y for y. -5 Solve 21 = 2s - 3v, 5v + 13 = s + 3v for s. 3 Solve -4u = 0, 3u + 0u + 6 = 3n for n. 2 Solve 0 = -7b - t + 22, 2b + 14 = t + 19 for b. 3 Solve 0 = 4d + y - 1, 2d + 1 = y - 0y for d. 0 Solve 3v + 21 = -3x, -3x + 8v - 3v + 19 = 0 for x. -2 Solve 0 = -0u + 3u - 2k - 14, 2k = -5u + 2 for u. 2 Solve -5b - 15 = y, -15 = -0y - 3y + 5b for y. 0 Solve -2c + 0 = 2, -2c - 1 = -d for d. -1 Solve -t + 4l = -23, -4t + 2 = 17l - 15l for t. 3 Solve 5h + 8 = 10d - 6d, 0 = 5d + 5h - 10 for d. 2 Solve g - v = 83 - 90, 0 = -4g + 2v - 18 for g. -2 Solve 0 = -4s + 4p + 28, -8s = -4s - p - 19 for s. 4 Solve 0 = -0n - 5n - j - 8, -6 = -3j for n. -2 Solve 4o - 3o = 1, -3g + 2o + 1 = 0 for g. 1 Solve -2m - 10 = 4w, -w = -4w - 3m - 12 for w. -1 Solve -2j + 0j = t + 3, 0 = -2j - 5t - 15 for j. 0 Solve w + 4z + 9 - 4 = 0, 2w - 5z - 3 = 0 for w. -1 Solve 0 = 3x - 0a - 5a - 27, -a = -5x + 23 for x. 4 Solve -2r = l - 4, -r + 5r - 8 = 5l for r. 2 Solve -z = -3g + z + 18, 0 = 5g - z - 23 for g. 4 Solve 2q = -2w - 2q - 8, -3w = -3q - 6 for w. 0 Solve 2d + k = -4, 0k = -2d + 2k - 10 for d. -3 Solve -19 = -3c + 4k, -c + k + 0 = -5 for c. 1 Solve t + 19 = -4r, t + 3t + 2r + 6 = 0 for t. 1 Solve -9o + 4t + 11 + 21 = 0, 3o = 5t + 7 for o. 4 Solve -2y + t = 11, 36t = 31t + 25 for y. -3 Solve 5h + 4j + 9 - 4 = 0, 0 = -2h + 4j + 26 for h. 3 Solve 0 = x + 5t - 23, -2x + t - 14 = -5 for x. -2 Solve -q + 11 = 2a, -9q - 25 = -12q - 4a for q. 3 Solve 2l - 10 = -68h + 66h, 6h + 3l = 15 for h. 0 Solve 2w = -3x - 9, 39 = -w - 2x + 36 for w. -9 Solve -4b = -0x + 5x + 45, -5b - 5 = -4x for x. -5 Solve 0 = -4b + 3b - l + 7, 3b - 4l + 7 = 0 for b. 3 Solve 4w = -2x - 2 + 8, -5w - 2x = -6 for w. 0 Solve 4u + 35k - 30k + 19 = 0, -u + 4k + 11 = 0 for u. -1 Solve 13 = -3v - 2n, v = -24n + 21n - 16 for v. -1 Solve 3q + 9 = 3s, 9s - 12s - 11 = q for s. -2 Solve 27z = 28z + 4w - 5, 9 = 5z + 4w for z. 1 Solve 15 = 7x - 10x + 4a, -2a = 4x - 2 for x. -1 Solve -10p + 22 = -2s - 5p, -2s - 5p = -18 for s. -1 Solve -18l + 22l - 10y = -38, 3l - 3y = -6 for l. 3 Solve -3f - 3t = -15, 20t - 25t = -10 for f. 3 Solve 2t - 4h + 3h = -11, -t - 19 = 4h for t. -7 Solve 2n + 4v - 8 = -2n, -2n - 3v = -5 for n. 1 Solve 3d = w, 3 = -4w + d - 8 for w. -3 Solve -239l + 5t + 20 = -240l, 4l + 3t = -29 for l. -5 Solve 6 = -3i + i - 4x, -3x - 7 = 4i for i. -1 Solve -2k - 8 = 2g, 4g - g - 6 = 3k for k. -3 Solve -2j + 10 = 5q, 4j + 9q = 14q - 10 for j. 0 Solve -k - x = -5, 2 = -3k + k + 2x for k. 2 Solve u = 5u - 2k + 16, 10 = -u + 2k for u. -2 Solve -3b + a = 10, -5b - 3a - 3 = -3b for b. -3 Solve 6b + 3*t - 8 =	{ "pile_set_name": "DM Mathematics" }
-4825? -6519 What comes next: -542, -1055, -1556, -2039, -2498, -2927, -3320, -3671? -3974 What comes next: -52, -35, -6, 41, 112, 213? 350 What comes next: 324, 329, 336, 345, 356, 369? 384 What comes next: -78, -31, 100, 357, 782, 1417, 2304, 3485? 5002 What is the next term in 5, -6, -33, -82, -159, -270, -421, -618? -867 What comes next: -8, -43, -130, -293, -556, -943, -1478? -2185 What is next in -34, -64, -94, -124, -154, -184? -214 What comes next: 597, 1193, 1789, 2385? 2981 What comes next: 32, 52, 66, 74? 76 What comes next: 224, 221, 216, 209, 200? 189 What is the next term in 25, 104, 235, 418, 653, 940, 1279? 1670 What comes next: 360, 359, 356, 351? 344 What is next in 292, 588, 890, 1204, 1536, 1892, 2278? 2700 What is the next term in 70, 135, 198, 259, 318, 375? 430 What is the next term in 489, 492, 495? 498 What comes next: 49, 336, 823, 1516, 2421, 3544? 4891 What comes next: 19, -228, -897, -2198, -4341, -7536? -11993 What comes next: -64, -129, -194? -259 What comes next: 22, 9, -6, -23, -42, -63? -86 What is the next term in -87826, -87824, -87820, -87814, -87806? -87796 What comes next: -100, -192, -280, -364, -444? -520 What comes next: 31, 12, -21, -68, -129, -204, -293? -396 What is next in 1698, 1688, 1666, 1626, 1562, 1468, 1338, 1166? 946 What is the next term in 37, 109, 229, 397, 613, 877, 1189? 1549 What is the next term in -209, -418, -627, -836, -1045, -1254? -1463 What comes next: -37, -92, -159, -244, -353? -492 What comes next: 48, 102, 158, 216, 276? 338 What comes next: 83, 195, 301, 401, 495, 583, 665? 741 What is the next term in 545, 549, 543, 521, 477? 405 What is next in -1128, -1113, -1084, -1035, -960, -853? -708 What is the next term in -18, -30, -30, -18, 6? 42 What is next in 6374, 12739, 19102, 25463, 31822, 38179? 44534 What is the next term in 359, 357, 355, 353, 351? 349 What is next in 14, 20, 18, 8? -10 What is next in 74, 120, 180, 260, 366, 504? 680 What is next in 10418, 10416, 10406, 10382, 10338? 10268 What comes next: 15471, 15469, 15467, 15465? 15463 What comes next: 265, 545, 833, 1129, 1433, 1745, 2065? 2393 What comes next: 209, 208, 207? 206 What is next in -4, -38, -72, -106, -140? -174 What is next in -29, -35, -53, -89, -149, -239? -365 What is the next term in -1823, -1822, -1821, -1820? -1819 What is next in -128, -260, -394, -530, -668, -808, -950? -1094 What comes next: -94, 538, 2260, 5618, 11158, 19426, 30968, 46330? 66058 What is next in 10615, 21230, 31845, 42460, 53075, 63690? 74305 What comes next: 88, 106, 142, 202, 292, 418, 586, 802? 1072 What comes next: -28836, -28837, -28838, -28839, -28840? -28841 What comes next: 77, 164, 241, 302, 341? 352 What comes next: 12, 31, 50? 69 What is the next term in -3233, -6465, -9685, -12887, -16065, -19213, -22325? -25395 What is the next term in 77, 146, 215, 284? 353 What is the next term in 3, -8, -19, -30, -41, -52? -63 What is next in 121, 240, 357, 472? 585 What is the next term in -167, -185, -213, -257, -323? -417 What comes next: -1013, -1010, -1005, -998, -989? -978 What is next in 2873, 2876, 2879, 2882, 2885, 2888? 2891 What comes next: -52, -103, -154, -205, -256? -307 What is the next term in -133, -257, -377, -493, -605, -713, -817? -917 What comes next: -854, -856, -858, -860, -862? -864 What is next in -77, -80, -83? -86 What is next in 17507, 17511, 17515, 17519, 17523, 17527? 17531 What is next in -68, -68, -84, -122, -188, -288, -428, -614? -852 What comes next: 15, 16, 27, 54, 103, 180? 291 What is next in -1296, -1304, -1314, -1326? -1340 What is next in 5, -11, -49, -115, -215, -355? -541 What comes next: 63, 126, 189, 252? 315 What comes next: -28, -20, -10, 2, 16, 32, 50? 70 What is the next term in 57, 86, 173, 348, 641, 1082, 1701, 2528? 3593 What is next in -387, -402, -419, -432, -435, -422? -387 What comes next: -1095, -2194, -3289, -4380, -5467, -6550, -7629? -8704 What is next in 16, 87, 210, 385, 612? 891 What is the next term in -24, -43, -62, -81, -100? -119 What is the next term in -1074, -1072, -1070, -1068, -1066, -1064? -1062 What comes next: 25, 14, -11, -50, -103, -170, -251? -346 What is next in 299, 606, 911, 1208, 1491, 1754, 1991? 2196 What comes next: 288, 222, 104, -72, -312, -622, -1008? -1476 What is the next term in 123, 240, 357, 474? 591 What comes next: -71, -65, -47, -11, 49, 139? 265 What is the next term in -14228, -14226, -14222, -14216, -14208, -14198? -14186 What is next in -25, -22, -19, -16? -13 What comes next: -2410, -2408, -2404, -2398? -2390 What comes next: -29, -21, -13, -11, -21, -49? -101 What comes next: 419, 1675, 3769, 6701, 10471, 15079, 20525? 26809 What comes next: 58, 64, 58, 34, -14, -92, -206? -362 What is next in 44, 43, 40, 35, 28, 19, 8? -5 What is next in -923, -913, -919, -947, -1003, -1093? -1223 What is next in 5, -6, -25, -52, -87, -130, -181? -240 What is next in -16, -19, 2, 59, 164? 329 What comes next: 2, 11, 30, 59, 98? 147 What is next in -4, -12, -42, -106, -216? -384 What comes next: -298, -275, -214, -97, 94? 377 What is next in 366, 365, 364, 363, 362? 361 What is the next term in -355, -333, -299, -247, -171, -65, 77, 261? 493 What comes next: -62, -124, -184, -242, -298? -352 What comes next: -108, -103, -100, -99, -100, -103, -108? -115 What comes next: -172, -148, -124, -100, -76? -52 What is the next term in -212, -201, -182, -155, -120, -77? -26 What is next in -428, -857, -1284, -1709? -2132 What comes next: 41, 80, 115, 146? 173 What comes next: 131, 248, 443, 716, 1067? 1496 What is next in 344, 262, 120, -88, -368, -726, -1168, -1700? -2328 What comes next: 960, 3867, 8718, 15519, 24276, 34995, 47682? 62343 What is the next term in 0, 5, 10, 15? 20 What comes next: -3351, -6703, -10055, -13407, -16759, -20111? -23463 What is the next term in 1377, 1373, 1369, 1365? 1361 What is next in -29, -55, -75, -83, -73, -39, 25? 125 What comes next: -35, -254, -845, -1994, -3887, -6710, -10649, -15890? -22619 What is the next term in -3, -25, -69, -135, -223, -333, -465? -619 What comes next: -168, -176, -182, -186? -188 What comes next: 130, 261, 392, 523, 654? 785 What is the next term in -35, -78, -121, -164? -207 What comes next: -38, -39, -40? -41 What is the next term in 71, 93, 123, 161, 207, 261? 323 What is the next term in 56, 110, 164, 218? 272 What comes next: 119, 250, 379, 506? 631 What comes next: 5, 34, 101, 224, 421, 710, 1109, 1636? 2309 What is next in 325, 648, 971? 1294 What comes next: -75, -152, -229? -306 What is the next term in 117, 233, 349, 465, 581, 697? 813 What is next in 1, -5, -29, -83, -179, -329, -545, -839? -1223 What is next in -12, -5, 2, 9, 16? 23 What comes next: -61, -122, -185, -250, -317, -386? -457 What comes next: -13, -26, -49, -82, -125? -178 What is the next term in 15753, 15754, 15755? 15756 What is next in -357, -758, -1159, -1560? -1961 What is the next term in 344, 345, 346, 347, 348, 349? 350 What is the next term in 131, 515, 1153, 2045? 3191 What is the next term in 4, 17, 28, 31, 20, -11, -68? -157 What is the next term in -5, -24, -79, -188, -369, -640? -1019 What comes next: 4, -44, -126, -242? -392 What comes next: -242, -244, -246, -248? -250 What is the next term in -440, -1767, -3978, -7073? -11052 What is the next term in -19, -33, -41, -43, -39, -29, -13? 9 What is next in 1169, 2340, 3511? 4682 What is the next term in -348, -1405, -3174, -5661, -8872? -12813 What is next in -44, -69, -78, -65, -24? 51 What is the next term in -53, -105, -157, -209, -261, -313? -365 What is next in -11, -7, -1, 7, 17? 29 What is next in 138, 139, 140, 141, 142, 143? 144 What is next in 21, -20, -89, -192, -335? -524 What is the next term in 103, 390, 847, 1456, 2199, 3058, 4015? 5052 What comes next: -51, -102, -139, -156, -147? -106 What is the next term in -799, -1601, -2407, -3217, -4031, -4849? -5671 What is next in 773, 1544, 2301, 3038, 3749? 4428 What comes next: -1025, -1023, -1021, -1019? -1017 What is the next term in -162, -156, -146, -132, -114, -92? -66 What is next in 1154, 1157, 1162, 1169, 1178? 1189 What is next in -26, -13, 12, 49? 98 What is the next term in 300, 298, 294, 288, 280, 270, 258? 244 What is the next term in -3, -30, -83, -168, -291, -458, -675,	{ "pile_set_name": "DM Mathematics" }
(b*28bb))41 assuming b is positive. b(-6232/5) Simplify (hh/h*(-4)h*(-13))/(h(hhh*(7/8)h)/hh38) assuming h is positive. h(-391/8) Simplify i1i*9i(i(-3))(3/20) assuming i is positive. i(211/20) Simplify ((((vv/(vv(2/9)v)v)/v)/((v/v11)/v))/(vv*4vv/((v/v5)/v)))(2/173) assuming v is positive. v(-22/1557) Simplify (h7h/(h/h*(-1))h(h/h(-2))/((((hh/(h*(-1/7)h))/h)/h)/h))(-35) assuming h is positive. h(-415) Simplify (l(-28)/(l/(l/(l4l))))(-10/17) assuming l is positive. l(330/17) Simplify (u(-4/5))(1/6)((uu8)/u)/(uu(3/7)) assuming u is positive. u(676/105) Simplify oo(-4/5)/oo/o*(-1/14)(o*(6/5)o)/(o/(o*(5/4)o)o) assuming o is positive. o(381/140) Simplify n(-1/8)nn(2/15)nn(-9)/(n/n(-1)n) assuming n is positive. n(-1199/120) Simplify ((g/g(-13))/gg(1/16))(1/33) assuming g is positive. g(19/48) Simplify a/(a/a(-10))a*3a14/a(-31) assuming a is positive. a38 Simplify (a(-4))(-39)/(a(-6)a/(a/(aa/(aa2)))) assuming a is positive. a163 Simplify ((p(2/7)p)*(-1)/(pp0)36)(10/9) assuming p is positive. p(-290/7) Simplify (((ppp(-3/4))(-11/3))41)37 assuming p is positive. p(-83435/12) Simplify m(-3/2)/(mm(-5/11)/m)(m*24mmm)(2/53) assuming m is positive. m(-31/1166) Simplify (r(-3/4)/r)(-1/14)/((rr/r10r)/r(-5/8)) assuming r is positive. r(13/2) Simplify (xx/(x/x(3/23)))/x(5/6)x/x*(2/59)x*1x assuming x is positive. x(26569/8142) Simplify ((a/(a/((a/a0)/aa)))2a/(a*(-3/4)a)a(1/4))(-25) assuming a is positive. a(-75) Simplify (g(2/7))(6/13)g(-2/3)/(g9/g) assuming g is positive. g(-2330/273) Simplify (x/(x/((x/x4x)/x)x))/x*(-17)xxx*(-12)x(-6/7) assuming x is positive. x(15/7) Simplify (i(2/5))(-11/8)(ii*(-2/25)/iii)/(((ii*(2/13)i)/i)/i) assuming i is positive. i(1581/1300) Simplify (((w(-2/5)/w)(-2))(-21/4))(-35) assuming w is positive. w(1029/2) Simplify (w*(1/25)ww18)/(w(8/5)w13) assuming w is positive. w(111/25) Simplify (((ss(-2)s)/ss(-4/7))(-1/3))12 assuming s is positive. s(44/7) Simplify (kk/(k*(6/5)k)(k(1/15)k)/k)45 assuming k is positive. k(-6) Simplify ((yy(2/13)/yyy(-2/15))/((y0y)/yyy)(1/3))(-45) assuming y is positive. y(-207/13) Simplify (((c/c(-2/41))/ccc)14)6 assuming c is positive. c(7056/41) Simplify (a(1/3))*(-20/9)a/a*(-1/8)aa(3/8) assuming a is positive. a(95/54) Simplify (((v/v2v)(1/38))(-1/3))24 assuming v is positive. 1 Simplify (j(-1/4))*49j(-1/7)/j15 assuming j is positive. j*(-767/28) Simplify ((hh(-3))/h(2/11)h/h(-2/9)h(-1/3))(-10/19) assuming h is positive. h(1280/1881) Simplify ((p0)*(1/19)/(pppp*1pp)(11/7))6 assuming p is positive. p(-396/7) Simplify (b(-16/5))(-2/21)(bbb28)42 assuming b is positive. b(132332/105) Simplify (v(3/7)v)29((vv(1/10))/v)(-10) assuming v is positive. v(283/7) Simplify (h(16/9)h(-22))/(h/((h(5/2)/hh)/h))(1/42) assuming h is positive. h(-5093/252) Simplify c4/((cc*(1/9)ccc)/cc)c(4/7)/(c/c(-6)) assuming c is positive. c(-412/63) Simplify (g(-2/21)g)/gg*(4/7)((((gg(1/2))/g)/g)/g)/g(((g((g/(g(-1/37)g))/gggg)/g)/g)/ggg)/g assuming g is positive. g(-1549/1554) Simplify (o/(o/(o((o/(oo(-5/3)))/o)/oo)))/(oo(-4/3)o)o(-19)/oo/o(-23) assuming o is positive. o5 Simplify ((i/(i*(1/7)i))/((i/(i/(i/i(28/9))))/i))(-2/3) assuming i is positive. i*(-374/189) Simplify (ss(-14))(20/3)/(s*24s(-2/95)) assuming s is positive. s(-31534/285) Simplify (p(-9/2)/(((p21/p)/p)/p))/(p(-2/17)/p)(-3/8) assuming p is positive. p*(-3117/136) Simplify ((v/(v/(vv*(1/17)v)))/(vv/v5))/(v(-3/2)vv11v) assuming v is positive. v*(-219/34) Simplify ((f/(f/(ff*(-18)f))f)/f)13f(-10)/(f(-25)f) assuming f is positive. f(-194) Simplify (((q/q3)(-7/5))(-5/4))(-37) assuming q is positive. q(259/2) Simplify ((k/k17)(15/8))(-5) assuming k is positive. k150 Simplify (w(-4)/(w(-5/6)/w)(w/w*1)/www1)19 assuming w is positive. w(-133/6) Simplify ((w(-8)/w)/w(-2/7)((w/(w/w*(1/3)))/ww)10)(-2/77) assuming w is positive. w(226/1617) Simplify (l(-1))*(-41)(l(2/9))(-5/18) assuming l is positive. l(3316/81) Simplify (c(-13)c(5/2)/c)/((cc*(-8/7)ccc)/(c/c12)) assuming c is positive. c(-355/14) Simplify ((yy/((yy/(y/(y/(y/(y(y/y(10/9))/y)))yy)yyy)/yyy))(-19/4))14 assuming y is positive. y(532/9) Simplify (g/g(1/3)g(g*(2/3)g)/g(ggg(-1))(-1/62))4 assuming g is positive. g(862/93) Simplify ((o10o)46)(-36) assuming o is positive. o*(-18216) Simplify (g/(gg*(-1/4)/g)g*14g)/(g/(g(g/g(-8))/g))(-8/9) assuming g is positive. g(329/36) Simplify (((p(-1/3)p)15)34)(-12) assuming p is positive. p(-4080) Simplify (aa/(a(aaaa(-8))/a))/(a(1/9)/a)(a(-1))(-47) assuming a is positive. a(494/9) Simplify (g37/g)/(gg/(g(-22)/g)g)((g(-13)g)/g)(-15) assuming g is positive. g205 Simplify (jjj(16/9))/j27(j/(jj23))/(j/(((j/j(-14/11))/j)/j)) assuming j is positive. j(-4648/99) Simplify ((c14/c(-16))(1/36))8 assuming c is positive. c(20/3) Simplify (b(1/4))(-2/13)/(b*(-4)b(-2/17)) assuming b is positive. b(1803/442) Simplify (d*(-7)/ddd(-8)d/(d/(d/d*(-1/2)))d(-3)/d)(-46) assuming d is positive. d805 Simplify ((n(-5)/nn(-3))/(n6n/n(-7)))9 assuming n is positive. n(-207) Simplify (k/(k(4/9)/k)k(2/19))/((kk/(kk/k3kk))/k)8 assuming k is positive. k(284/171) Simplify ((f(3/7)ff)/f)(3/34)/(f/(f/((f/f(-6))/f)f)ff(-6)) assuming f is positive. f(15/119) Simplify ((bb(-12/11))/b5)14 assuming b is positive. b(-784/11) Simplify (cccc*4cc/(cccc*(8/3)ccc)c((c/(c(2/3)/c))/c)(-4/15))40 assuming c is positive. c(448/9) Simplify (hhh/(hhh*(-3)h))/hh(hhh*(-11)hhhh)/hhh(4/3)h/h*(-11)h assuming h is positive. h(37/3) Simplify ((c/(c/(c/(c/(c/c(-4))))))/c)*(-3/2)/((cc*10cc)/(c/(cc*(-1/18))c)) assuming c is positive. c(-323/18) Simplify (j(5/6)j(-29)jj)/((j((j/j(1/17))/j)/j)/j(-15)) assuming j is positive. j(-4193/102) Simplify (((o5o)/o)/o0o*(1/3)/(o/((o/(oo/(o(o/((o/((o/(oo*(-7)))/o))/o))/oo)))/o)))(1/8) assuming o is positive. o(31/24) Simplify d*6d*(-2/21)/d((d/(d/(d*(-7)/d)))/d)/dd5 assuming d is positive. d(-2/21) Simplify q(-11)/q(-10/3)(q(-4))(-1/3) assuming q is positive. q(-19/3) Simplify (g(1/4)/g(g/g*(1/4))/gg/(g*(6/7)/g)gg4)19 assuming g is positive. g(684/7) Simplify (v/v(-2/37)v)/((v/v*(-33))/vvv)v*(-4/17)vvv(v10v)/vv assuming v is positive. v(-12065/629) Simplify f(-8)/ff*(7/8)(ff(-4))(-13/4) assuming f is positive. f(13/8) Simplify ((z(-2/3)zz)/z)(-13/6)/((zz*(2/7)z)/(zz/(((z/(z(-2/3)z))/z)/z))) assuming z is positive. z*(41/126) Simplify (((d/(d/(dd*4))d)(-1/26))(-2/25))(2/21) assuming d is positive. d(4/2275) Simplify (((g/(gg(g*7/g)/ggg))/g)/g)25/(g0g)(4/15) assuming g is positive. g(-3754/15) Simplify q*(5/9)q*15(q/(q/(q/(q/(((qq/(qq*(5/6)))/q)/q)))q)q)/q(4/11) assuming q is positive. q(2645/198) Simplify (t(-3))(-3/10)tt(-1/35)tt/(t/(t/(t/(t/t17t)))) assuming t is positive. t*(-849/70) Simplify (pp((((p/(p/p(4/21)))/p)/pp)/p)/pppp(-1/7))(12/11) assuming p is positive. p(8/7) Simplify x/x(-1/9)(x/x*(2/37)x)/xxx(x(x*(-5)x)/x)10 assuming x is positive. x(-11969/333) Simplify ((qq(-16/5)q)/((q*28q)/q))/(q*(-5)qq/(qqq11/q)) assuming q is positive. q(-71/5) Simplify ((jjj((j/(j/(j/(j/j(-8/3)))))/j)/j)/j(-6))/(j/(j/j*16)j(2/35)) assuming j is positive. j(-1231/105) Simplify (u*(-18)/uuu/(uuu(-18/11)/uu))/(((u*(2/13)/uu)/u)/u(-4)) assuming u is positive. u(-2934/143) Simplify ((ppp/(pp/(pp/p*(-1/2))p)p)(-1/10)/(p(2/9))*(	{ "pile_set_name": "DM Mathematics" }
nearest ten. -38910 What is 99.0893788 rounded to 2 dps? 99.09 Round 7.738920696 to 1 decimal place. 7.7 Round -5.86059471 to zero dps. -6 Round 11357476.6 to the nearest one hundred thousand. 11400000 What is 101.8386529 rounded to the nearest ten? 100 Round -34799.191 to the nearest ten thousand. -30000 Round -2.832110662 to one dp. -2.8 What is -0.001931486937 rounded to five dps? -0.00193 Round 33.18662955 to the nearest 10. 30 What is -0.000000569786773 rounded to seven dps? -0.0000006 Round 67773882.4 to the nearest one million. 68000000 What is -181187297.7 rounded to the nearest one million? -181000000 What is -0.5288990648 rounded to four dps? -0.5289 What is 15.40651537 rounded to the nearest integer? 15 Round -12081.49925 to the nearest one hundred. -12100 What is -2662.8854 rounded to the nearest 100? -2700 Round -0.00531331232 to seven dps. -0.0053133 Round -0.00095669771 to six dps. -0.000957 What is 47010.4768 rounded to zero dps? 47010 What is -299.577275 rounded to the nearest integer? -300 Round 51.5989952 to the nearest 10. 50 What is -55116435 rounded to the nearest 10000? -55120000 What is 22001689110 rounded to the nearest 1000000? 22002000000 What is -265.59935 rounded to the nearest one hundred? -300 What is 0.0001280243082 rounded to 5 decimal places? 0.00013 Round -3650243.417 to the nearest one million. -4000000 What is 630062387 rounded to the nearest one hundred thousand? 630100000 Round -1660646.642 to the nearest 10000. -1660000 What is -0.00005822986995 rounded to 7 decimal places? -0.0000582 What is -0.0001373799114 rounded to 5 dps? -0.00014 Round -0.00236359207 to 3 decimal places. -0.002 What is -0.08675377 rounded to three dps? -0.087 What is 8363558.7 rounded to the nearest one hundred thousand? 8400000 What is 7660022.52 rounded to the nearest ten thousand? 7660000 Round 1.31850392 to three dps. 1.319 Round 492645.0353 to the nearest 1000. 493000 What is -397986218 rounded to the nearest 1000000? -398000000 What is -0.00052091497 rounded to 6 decimal places? -0.000521 Round -2032949190 to the nearest one million. -2033000000 What is 0.000287145541 rounded to seven decimal places? 0.0002871 What is 91716522.5 rounded to the nearest one hundred thousand? 91700000 Round -10718.71025 to one dp. -10718.7 Round 0.0010301113 to four decimal places. 0.001 Round 6977.6645 to the nearest one thousand. 7000 What is 0.03857603848 rounded to 5 decimal places? 0.03858 What is 90118.2759 rounded to the nearest ten thousand? 90000 Round 0.07826099 to 4 dps. 0.0783 Round 38176.45894 to the nearest one thousand. 38000 What is -48.2251943 rounded to three decimal places? -48.225 Round 316088050 to the nearest 1000000. 316000000 Round 0.0002342640102 to 6 decimal places. 0.000234 Round -10651639.54 to the nearest 100000. -10700000 Round 0.0084422391 to five dps. 0.00844 Round -0.0064796592 to 4 decimal places. -0.0065 Round -8040.07435 to the nearest one hundred. -8000 Round -98.86279 to 1 decimal place. -98.9 What is -2312023000 rounded to the nearest one million? -2312000000 What is 2.59061814 rounded to one decimal place? 2.6 Round 512991.212 to the nearest 1000. 513000 What is -915.49089 rounded to the nearest ten? -920 What is -0.008125919 rounded to 5 dps? -0.00813 Round -0.070840605 to two decimal places. -0.07 Round 0.003324198248 to 7 dps. 0.0033242 What is -76.9367584 rounded to the nearest integer? -77 What is 107127560 rounded to the nearest 100000? 107100000 What is -628514.11 rounded to the nearest one hundred thousand? -600000 What is -0.0618970431 rounded to 5 decimal places? -0.0619 What is -458.4030947 rounded to zero dps? -458 Round -0.255810345 to four dps. -0.2558 What is 0.001540718094 rounded to 3 decimal places? 0.002 Round -0.8862631 to one decimal place. -0.9 What is -289.810839 rounded to 0 decimal places? -290 What is 2078455758.8 rounded to the nearest ten thousand? 2078460000 What is 0.305195501 rounded to 3 decimal places? 0.305 What is -0.1211090046 rounded to 3 decimal places? -0.121 Round 26259538.74 to the nearest one hundred thousand. 26300000 Round 14.4765074 to two decimal places. 14.48 What is -0.0000111950309 rounded to seven dps? -0.0000112 Round 0.00138245342 to seven decimal places. 0.0013825 What is 0.127467465 rounded to four dps? 0.1275 Round -0.0000007826808998 to seven dps. -0.0000008 Round 30654.1952 to the nearest integer. 30654 Round -0.0330447432 to five dps. -0.03304 What is 0.0258482829 rounded to 5 dps? 0.02585 What is 86.553146 rounded to one dp? 86.6 Round 0.0007929329 to five dps. 0.00079 What is -84575.4482 rounded to the nearest ten thousand? -80000 Round 5.63476675 to 1 dp. 5.6 Round -547697.663 to the nearest ten thousand. -550000 What is 236.61673 rounded to the nearest 100? 200 Round 0.000000159795119 to seven dps. 0.0000002 What is 42611456.8 rounded to the nearest 100000? 42600000 Round -15032994.616 to the nearest one hundred thousand. -15000000 What is -382419.596 rounded to the nearest ten thousand? -380000 Round -0.0004059145473 to 5 decimal places. -0.00041 What is 0.002342285076 rounded to 6 dps? 0.002342 What is -34.021 rounded to the nearest integer? -34 Round 86698.682 to the nearest ten thousand. 90000 Round 243916.517 to the nearest one thousand. 244000 What is 0.1378771229 rounded to four decimal places? 0.1379 What is -0.50253167 rounded to 1 decimal place? -0.5 What is 397861 rounded to the nearest 1000? 398000 Round -1290.118379 to the nearest 100. -1300 Round 279420.819 to the nearest one thousand. 279000 Round -37479.2618 to the nearest 10. -37480 Round -31452232.74 to the nearest 1000. -31452000 Round 0.29582629 to one decimal place. 0.3 Round 1931911.95 to the nearest ten thousand. 1930000 Round 4390788410 to the nearest 1000000. 4391000000 What is -0.000053470692 rounded to six decimal places? -0.000053 What is 0.0000051609123 rounded to seven dps? 0.0000052 Round -746604.577 to the nearest 100000. -700000 What is -1206.00651 rounded to the nearest one hundred? -1200 Round 4.23331314 to one dp. 4.2 What is 27926.9568 rounded to the nearest ten thousand? 30000 Round -0.00034841058 to 6 decimal places. -0.000348 What is 1686.13037 rounded to the nearest integer? 1686 Round -1.134319164 to four dps. -1.1343 What is 26463630.08 rounded to the nearest one thousand? 26464000 What is -0.0740329626 rounded to 5 decimal places? -0.07403 What is 2128.215535 rounded to the nearest ten? 2130 Round -0.0370662897 to two decimal places. -0.04 What is -0.0297392207 rounded to two decimal places? -0.03 Round -164338286.1 to the nearest 10000. -164340000 What is 17449237.6 rounded to the nearest 1000000? 17000000 What is -0.0494961383 rounded to 2 decimal places? -0.05 Round -0.41909756 to 3 dps. -0.419 What is 22980636.2 rounded to the nearest 1000? 22981000 Round 261224.9119 to the nearest 100000. 300000 Round 0.6515349029 to three dps. 0.652 What is 0.000005910444 rounded to six decimal places? 0.000006 What is -4460315 rounded to the nearest one hundred thousand? -4500000 Round 0.0000017676126 to 7 decimal places. 0.0000018 Round -0.000084121478 to 7 dps. -0.0000841 What is -2.06106354 rounded to zero decimal places? -2 Round -581.797287 to the nearest integer. -582 What is 61.8744496 rounded to two decimal places? 61.87 Round -24.12871491 to 3 decimal places. -24.129 What is 5458268.85 rounded to the nearest 100? 5458300 What is -0.0092261859 rounded to one decimal place? 0 What is 118009.642 rounded to the nearest one thousand? 118000 What is 1768106.31 rounded to the nearest one hundred thousand? 1800000 What is 1.46643148 rounded to 3 decimal places? 1.466 What is 0.114390627 rounded to 3 decimal places? 0.114 Round -1.202730024 to three dps. -1.203 What is -76.271485 rounded to 2 decimal places? -76.27 What is 348.3047983 rounded to the nearest 100? 300 What is 63.829421 rounded to two dps? 63.83 What is 2193.572985 rounded to 1 dp? 2193.6 What is 84.370089 rounded to 2 decimal places? 84.37 What is -12.63036106 rounded to 2 dps? -12.63 Round 0.00000261798594 to 7 dps. 0.0000026 What is 0.00000264028731 rounded to 7 dps? 0.0000026 What is 0.0001744730034 rounded to six dps? 0.000174 Round 0.01061467 to 1 decimal place. 0 What is -49051744.92 r	{ "pile_set_name": "DM Mathematics" }
s = 1427 - 1433. Let c be ((-4)/24s)/(-4 + 5). Is c > j? True Let f(v) = -2v*3 - 10v*2 + 92v + 590. Let d be f(-6). Is 120 != d? True Suppose 0 = -5m - 10m - 2040. Let r = 114 + m. Which is bigger: -19 or r? -19 Let g = -112810/13 + 8705. Which is smaller: -3/5 or g? -3/5 Let t be -1 + 8 - ((-8)/(-2))/(46/69). Which is greater: -43/257 or t? t Let m be (-34)/14 + -2 + 45/105. Let o be 5 - m/(36/(-47)). Which is smaller: 0.5 or o? o Suppose 3 = l + 2h, -2l = l + 4h - 7. Let d be l + 11/7 + -1 + -1. Which is bigger: d or 2? 2 Suppose 480 = -2t + 8t. Let v = t + -125. Let u = v - -45. Which is bigger: 13 or u? 13 Suppose 158g + 24 = 164g. Suppose g = 4f - 8f. Is -1/32 at most f? False Suppose -3x + 2d + 116 = 1283, -x + 4d - 379 = 0. Let r = 1577/4 + x. Which is bigger: r or 4? 4 Suppose 0 = -5u - 2v + 30, 4u - 5v = -8v + 24. Suppose uo + 26 = t + 2o, 5t + 3o = 130. Which is greater: t or 20? t Let i be (1/2)/((-25)/(-70) - 12/14). Which is bigger: 15/239 or i? 15/239 Let a be -110/(-45) + 38144/72. Is a bigger than 527? True Suppose 5m = -2144 + 539. Let b = m + 319. Let o = -11.4 - 1.6. Which is smaller: b or o? o Let u be 70015/(-2255) + 8/164. Let p = -79/8 + -157/8. Which is smaller: p or u? u Let l = -27896 - -27894. Which is greater: 0.0053 or l? 0.0053 Let n = -550 + 625.9. Let t = -76 + n. Which is greater: t or -20.3? t Let j(l) = l3 + 11l*2 - 26l - 396. Let a be j(-9). Is 2 bigger than a? True Let b(a) = 8a - 61. Let d be b(8). Suppose 1 = 3r - h, -dh = 53r - 56r + 9. Which is smaller: r or -34/15? -34/15 Let q be -3 + 79/77 + 6/3. Is 16 greater than or equal to q? True Let z = 24/1493 + 6913/34339. Is -14 <= z? True Let n = 210 + -208. Suppose -4f + 4o = -f + 17, 2f + no = -2. Is -54/17 greater than f? False Let k = 4.14 + -4.14. Is k at most as big as -1346? False Suppose -2j = 8j + 50. Let n(s) = s2 + 5s + 8. Let u be n(-3). Suppose r = -3r - 2b - 14, 2r + 10 = -ub. Which is greater: r or j? r Suppose -4i + 11 = 2l - 3, -2l - 2i + 14 = 0. Suppose 189 = -16m + lm. Which is bigger: m or -22? m Let d = 4655 + -18621/4. Is 1500 <= d? False Let f = -26019/8 + 3253. Let c(o) = -o*3. Suppose -4p = -p. Let i be c(p). Is f smaller than i? False Suppose 0 = 5k - 4f + 7372, 0 = -4k - 36f + 33f - 5879. Which is bigger: -1473 or k? k Let i be (11 - -1)(-4)/16. Let l be (4 + 1 + i)(-14)/4. Which is bigger: l or 1.6? 1.6 Let n = 4789 - 4799. Is n equal to -14? False Let n = 3.8804 + -4.1804. Is 1449 < n? False Let b = -1376057863/5829 + 236071. Which is smaller: b or 1? b Let k(j) = 299j + 10131. Let y be k(-35). Which is greater: y or -341? y Let t be ((-60)/(-28) - -2) + 2/(-14). Suppose -f - t + 5 = 0. Suppose 0 = 7w + f - 8. Which is greater: w or 4/5? w Let j = 1042.67828 + -0.68228. Let r = j + -1040. Let a = r - -0.004. Do a and -0.02 have the same value? False Let r be -123(-2 - -3)/((-63)/1008). Is r not equal to 367? True Let k be (-3)/(-90) - (-1)/(-5). Let m = -0.55 + 0.543. Let z = 0.093 - m. Which is bigger: z or k? z Let w be -8 + (-30)/(-2) + 143 + 8 + -1. Which is greater: 234 or w? 234 Let h = 19.0253 - 0.0253. Let i = -49 - -48.99. Which is bigger: i or h? h Let v(a) be the first derivative of -10a*3/3 + 57a*2/2 - 30a + 231. Let m be v(5). Is m less than or equal to 54? True Let n = 6342 - 6341. Are 2/3395 and n equal? False Let b(a) = 3a2 + 73a + 25. Let w be b(-24). Which is bigger: 46/131 or w? w Let g be (-1)/(-2) + 560/(-1888). Which is greater: g or -1? g Suppose 9b - 4b + 30 = 5z, 5z = b + 14. Suppose -131 = -2k - 3w + 47, 0 = -zk + w + 162. Let g = -82 + k. Which is smaller: 5/24 or g? 5/24 Suppose 0 = -v - 5t - 1929, t = -35v + 31v - 7678. Let j = 1935 + v. Suppose -3r - 3h + 32 = -r, -48 = -4r + 2h. Which is greater: r or j? j Let u = 9310 - 9295.858. Let t = u - 0.142. Let d = 6 + -4. Which is smaller: d or t? d Let s = 4.31 - 1.01. Let t = s - 3.9. Let f = 0.6 + t. Which is greater: f or -2/287? f Let x = 25572/935 - -148/85. Is 28 greater than or equal to x? False Let p = -3751.08 - -3751. Is 17.1 != p? True Let w = -9705.5 - -9715. Does 6 = w? False Let j = -107.79 + -2161.21. Which is greater: j or -0.2? -0.2 Let u be (-3)/(9/(-12)) + 1-2. Let w be u - (3/(-15))/((-8)/(-14500)). Let i = w - 372. Are -9 and i nonequal? True Let t(s) = -8s. Let u = -25 - -23. Let k be t(u). Let j(f) = f - 16. Let a be j(k). Which is smaller: 16/9 or a? a Let u = 144.42 - 146. Suppose -2m = -10, 4b - 4m = -46 + 22. Which is greater: b or u? b Suppose -34694 = 12l + 10l. Let q = l + 23669/15. Suppose -2v = 2i + 10, -4v - 20 + 0 = -4i. Is q >= i? True Let w = 1/2129 + 25519/61741. Let g(a) = -a - 13. Let n be g(-14). Does w = n? False Let l = -6219766327/1606 + 3872831. Let q = 3/146 + l. Is -1 >= q? False Let j = 308 + -3374/11. Let y(z) be the first derivative of z2/2 + 11z - 15. Let s be y(-9). Which is smaller: j or s? j Let p = -31684/5 + 6096. Are 0.2 and p equal? False Let r be (-1)/4 - -21181/16. Let j = 135 - r. Which is greater: 2 or j? j Let v = 22427/3 - 7476. Does 4.5 = v? False Let u = 14946.217627 + -21.718627. Let o = -14722.6 + u. Let c = o - 202. Which is greater: 0 or c? 0 Let m be 0 + 2/40. Suppose -4 = 4z - m. Let s = -1.672 - 2.428. Which is greater: z or s? z Let k be (-22)/4 + 21/(-6) + 3. Let d be 117/264/k. Let v be d(4 + (-37)/12 + -1). Which is bigger: -46 or v? v Let j be (-1171 - 13) + (-10)/(-4)2. Let n be 1/(-3)(-108)/j. Are -1 and n unequal? True Let y be (-312)/52 + 46/8. Is y at least -0.062? False Let q(v) = v3 + 9v*2 - 7v + 22. Let n be q(-10). Let i be 764/(-21) + n/28. Is i less than or equal to -38? False Let w(z) = -2z3 + 41z*2 - 26z + 136. Let l be w(20). Which is smaller: l or 316/19? l Let t = 0.0195 + 0.0805. Let r = 20.019 - 0.019. Let v = 4 + r. Do v and t have different values? True Let n(q) = 4q + 95. Let g = -30 - -6. Let r be n(g). Which is smaller: r or -5/19? r Suppose 10 + 158 = -8x. Let o = x - -15. Let k be (1 - -5)/((-16)/18). Which is greater: k or o? o Let b be 2/(-6)-3150/225. Which is smaller: b or 0.3358? 0.3358 Let p = -543614/947330919 + 16/31543. Which is smaller: p or -1? -1 Let y = -3904 - -3957. Is y greater than or equal to -3? True Let q(u) = -105u + 3497. Let d be q(33). Which is smaller: d or 36? d Let m be 20/(((-18)/(-24))/((-3)/8)). Let g be (-14)/m - (-146)/(-90). Are -5 and g non-equal? True Let l = 22632 - 22488. Which is smaller: l or 129? 129 Let b = -3.377 - -2.067. Which is smaller: b or -5.9? -5.9 Let n be (-5)/(((-4)/(-30))/((-26)/39)). Suppose 0 = 5s + n, 3 + 3 = -3l + 3s. Let i be 1 - (6/(-1) - -3). Which is smaller: l or i? l Let j(b) be the first derivative of b*7/840 + 2b6/45 + b5/8 - b*4/24 - 4b3 - 8. Let q(c) be the third derivative of j(c). Let s be q(-15). Is 0 != s? True Let c = -11 + 15. Suppose -t + 5 = c. Let a = 4 - t. Does a = 2? False Let u = 11 - 19. Let l = -43 + 52. Let y = u + l. Which is smaller: y or -1? -1 Let z be (-29246)/203 - 9/((-261)/2). Which is smaller: -133 or z? z Let y = -28 + 33. Let u(r) = -r3 + 12r2 + 3r - 4. Let l be u(y). Suppose -38 = 5j + 2x + l, 2x + 48 = -j. Is j bigger than -45? True Suppose 0 = 10i - 20. Let k(r) = 8r2 + 0r*i + 9r - 4r2 + 5 - 3r*2. Let x be k(-12). Which is greater: 42 or x? 42 Let f = 1.2515 - 3.3595. Is -3/7 < f? False Suppose -2j = -4i + 28, 6j + 31 = 3i + 2j. Suppose ib + 12 = 2b. Let z be b(44/(-16) + 3). Which is bigger: z or 2/37? 2/37 Let m be (-6)/(-32)104/(-78). Let a = -617/6 - -195/2. Are a and m nonequal? True Let k(u) = -u + 4. Suppose -n + 6n - 5h = 40, -3n + h + 20 = 0. Let a be k(n). Let x = a - 40. Which is greater: x or -41? -41 Suppose g + 15 = 11. Suppose -4x + 13 + 9 = 3u, 2 = -3u + 2x. Let o be (-2)/212(u - g). Is o at most 0? True Let t be (-3)/15 + 1 + (-16328)/20420. Let k = t - -148029/40840. Is k greater than 5? False Let f = 256.9574 + 1.0826. Let s = -258 + f. Is -1/19 at most s? True Let y = -3356 + 3355.99. Does y = -0.228? False Suppose 23w = 142 - 4. Let s be (-10)/537/(-2). Let y = s + -147/4. Which is smaller: w or y? y Suppose -2k + o = 98, 2o + 99 = -4*k - 121. Is	{ "pile_set_name": "DM Mathematics" }
r? 4 What is 428 to the power of 1/3, to the nearest integer? 8 What is 737 to the power of 1/2, to the nearest integer? 27 What is 1946 to the power of 1/2, to the nearest integer? 44 What is 152427 to the power of 1/2, to the nearest integer? 390 What is 845 to the power of 1/2, to the nearest integer? 29 What is 5740 to the power of 1/2, to the nearest integer? 76 What is the square root of 5291 to the nearest integer? 73 What is the ninth root of 7937 to the nearest integer? 3 What is the third root of 941 to the nearest integer? 10 What is the third root of 88785 to the nearest integer? 45 What is 75405 to the power of 1/2, to the nearest integer? 275 What is 4280 to the power of 1/3, to the nearest integer? 16 What is 569 to the power of 1/3, to the nearest integer? 8 What is 99063 to the power of 1/8, to the nearest integer? 4 What is 1507 to the power of 1/4, to the nearest integer? 6 What is the square root of 15834 to the nearest integer? 126 What is the cube root of 2208 to the nearest integer? 13 What is 6338 to the power of 1/3, to the nearest integer? 19 What is the tenth root of 2662 to the nearest integer? 2 What is the square root of 8083 to the nearest integer? 90 What is the cube root of 9499 to the nearest integer? 21 What is 13995 to the power of 1/3, to the nearest integer? 24 What is the third root of 6032 to the nearest integer? 18 What is the eighth root of 634 to the nearest integer? 2 What is 60 to the power of 1/8, to the nearest integer? 2 What is 13179 to the power of 1/2, to the nearest integer? 115 What is the sixth root of 18820 to the nearest integer? 5 What is 7938 to the power of 1/3, to the nearest integer? 20 What is the third root of 2912 to the nearest integer? 14 What is the third root of 400 to the nearest integer? 7 What is 926 to the power of 1/3, to the nearest integer? 10 What is the cube root of 2634 to the nearest integer? 14 What is 2227 to the power of 1/9, to the nearest integer? 2 What is the third root of 5843 to the nearest integer? 18 What is the sixth root of 23343 to the nearest integer? 5 What is the square root of 4039 to the nearest integer? 64 What is the square root of 9528 to the nearest integer? 98 What is 2810 to the power of 1/9, to the nearest integer? 2 What is 28454 to the power of 1/7, to the nearest integer? 4 What is 3587 to the power of 1/9, to the nearest integer? 2 What is the third root of 4702 to the nearest integer? 17 What is 910 to the power of 1/8, to the nearest integer? 2 What is 37004 to the power of 1/8, to the nearest integer? 4 What is the square root of 11808 to the nearest integer? 109 What is the cube root of 21171 to the nearest integer? 28 What is the sixth root of 37979 to the nearest integer? 6 What is the fifth root of 9234 to the nearest integer? 6 What is 15589 to the power of 1/2, to the nearest integer? 125 What is 2959 to the power of 1/2, to the nearest integer? 54 What is the square root of 47429 to the nearest integer? 218 What is 1014 to the power of 1/5, to the nearest integer? 4 What is the eighth root of 1006 to the nearest integer? 2 What is the square root of 2778 to the nearest integer? 53 What is the tenth root of 2285 to the nearest integer? 2 What is 34432 to the power of 1/3, to the nearest integer? 33 What is the cube root of 31713 to the nearest integer? 32 What is the square root of 57 to the nearest integer? 8 What is the ninth root of 2343 to the nearest integer? 2 What is the third root of 558 to the nearest integer? 8 What is 10071 to the power of 1/3, to the nearest integer? 22 What is 1620 to the power of 1/4, to the nearest integer? 6 What is the fifth root of 694 to the nearest integer? 4 What is the square root of 776 to the nearest integer? 28 What is the ninth root of 21553 to the nearest integer? 3 What is the tenth root of 1013 to the nearest integer? 2 What is the square root of 2222 to the nearest integer? 47 What is the cube root of 1168 to the nearest integer? 11 What is the square root of 5405 to the nearest integer? 74 What is 2770 to the power of 1/3, to the nearest integer? 14 What is 54 to the power of 1/9, to the nearest integer? 2 What is the eighth root of 35201 to the nearest integer? 4 What is the cube root of 9634 to the nearest integer? 21 What is 278 to the power of 1/3, to the nearest integer? 7 What is the eighth root of 16476 to the nearest integer? 3 What is the square root of 12841 to the nearest integer? 113 What is the square root of 10173 to the nearest integer? 101 What is the seventh root of 474 to the nearest integer? 2 What is the cube root of 81782 to the nearest integer? 43 What is the third root of 11840 to the nearest integer? 23 What is 3632 to the power of 1/3, to the nearest integer? 15 What is the square root of 1319 to the nearest integer? 36 What is 5155 to the power of 1/9, to the nearest integer? 3 What is the seventh root of 21519 to the nearest integer? 4 What is the fourth root of 7493 to the nearest integer? 9 What is the fourth root of 9049 to the nearest integer? 10 What is the ninth root of 162080 to the nearest integer? 4 What is 7552 to the power of 1/10, to the nearest integer? 2 What is the square root of 29332 to the nearest integer? 171 What is 1841 to the power of 1/3, to the nearest integer? 12 What is 714 to the power of 1/6, to the nearest integer? 3 What is the third root of 949 to the nearest integer? 10 What is 735 to the power of 1/3, to the nearest integer? 9 What is the cube root of 363 to the nearest integer? 7 What is the ninth root of 1798 to the nearest integer? 2 What is 1702 to the power of 1/2, to the nearest integer? 41 What is 20699 to the power of 1/3, to the nearest integer? 27 What is 1235 to the power of 1/2, to the nearest integer? 35 What is the cube root of 121951 to the nearest integer? 50 What is 2224 to the power of 1/7, to the nearest integer? 3 What is the fourth root of 30757 to the nearest integer? 13 What is 586 to the power of 1/3, to the nearest integer? 8 What is 12539 to the power of 1/7, to the nearest integer? 4 What is 120 to the power of 1/2, to the nearest integer? 11 What is 794 to the power of 1/2, to the nearest integer? 28 What is 24298 to the power of 1/2, to the nearest integer? 156 What is the square root of 1109 to the nearest integer? 33 What is 61882 to the power of 1/8, to the nearest integer? 4 What is the cube root of 305 to the nearest integer? 7 What is 3064 to the power of 1/2, to the nearest integer? 55 What is the fifth root of 8132 to the nearest integer? 6 What is the cube root of 58665 to the nearest integer? 39 What is the square root of 30 to the nearest integer? 5 What is the fifth root of 10291 to the nearest integer? 6 What is the third root of 2325 to the nearest integer? 13 What is the third root of 69728 to the nearest integer? 41 What is 8450 to the power of 1/3, to the nearest integer? 20 What is the third root of 2156 to the nearest integer? 13 What is the eighth root of 478 to the nearest integer? 2 What is the square root of 19762 to the nearest integer? 141 What is the seventh root of 55272 to the nearest integer? 5 What is 1436 to the power of 1/2, to the nearest integer? 38 What is the eighth root of 158714 to the nearest integer? 4 What is 23710 to the power of 1/4, to the nearest integer? 12 What is the third root of 9944 to the nearest integer? 22 What is 483 to the power of 1/3, to the nearest integer? 8 What is 198 to the power of 1/5, to the nearest integer? 3 What is the third root of 2495 to the nearest integer? 14 What is 3861 to the power of 1/2, to the nearest integer? 62 What is the square root of 1020 to the nearest integer? 32 What is 50570 to the power of 1/6, to the nearest integer? 6 What is 90375 to the power of 1/9, to the nearest integer? 4 What is 15204 to the power of 1/2, to the nearest integer? 123 What is the seventh root of 6324 to the nearest integer? 3 What is the ninth root of 1080 to the nearest integer? 2 What is the third root of 1732 to the nearest integer? 12 What is the seventh root of 17969 to the nearest integer? 4 What is the cube root of 1243 to the nearest integer? 11 What is 16629 to the power of 1/3, to the nearest integer? 26 What is the	{ "pile_set_name": "DM Mathematics" }
/5)))/y))/yy16/y assuming y is positive. y(-60) Simplify (c(-1/27)(c(4/15)/c)/c)/(c(-5)/c8) assuming c is positive. c(1516/135) Simplify k*(-1)k*(1/14)kk/(k/(kk/(k*(-8)k)))k/(k/(k(-1/17)/k)) assuming k is positive. k(1907/238) Simplify (p(-2/9)(p*(-16)p)/p)/((p(-1/14)/p)/p(-1/6)) assuming p is positive. p*(-965/63) Simplify dd/d*(-7)d(d/(dd*(5/7)))/d(dddd(-5/2)/d)(-38/5) assuming d is positive. d(423/35) Simplify (p(-5))44(((p/p*(-1/13)p)/pp)/p)/(pp(-6/11)) assuming p is positive. p(-31371/143) Simplify (n/((n/((n*(2/29)n)/n))/n))/((((n/((n/n*(-14))/n))/nn)/n)/n)(n/(n0n))/(n*13/nn) assuming n is positive. n(89/29) Simplify (d(-13)d(-4/11))/(d(-2)/d(-2/23)) assuming d is positive. d(-2897/253) Simplify (t(-13)t)/t*8((tt/t(-23))/t)/tttt(-8) assuming t is positive. t(-3) Simplify (a0)(2/37)/(aa11a2) assuming a is positive. a(-14) Simplify ((n((n(n/(n/n*0))/n)/n)/nn)/n(-1))/(n/n(2/5)n)(-7) assuming n is positive. n(61/5) Simplify (u(2/9)uu(-1/10)/u)/(u(-7)u(2/9)) assuming u is positive. u(69/10) Simplify (((a9/a)/a(-1/7))/(a/a(-2/5))16)7 assuming a is positive. a(-499/5) Simplify (c(2/31)/c(-14/9))(-2/9) assuming c is positive. c(-904/2511) Simplify ((p*(-2/7)p)*(-25)/(ppp(-1/8)p5))(-49) assuming p is positive. p*(9695/8) Simplify ((zz/z*(-1/3)zz)(-22)/((z1/z)/z)37)(1/2) assuming z is positive. z(-175/6) Simplify v(-2/19)(vv/(v26/v))/vvv(v/(v*(5/2)v))/vvv/((v/(v*26v))/v) assuming v is positive. v(129/38) Simplify (h(-1/29)h(-1/20))(-37) assuming h is positive. h(1813/580) Simplify (zz4/z)(-47)/(z(-11))(-24) assuming z is positive. z*(-452) Simplify (pp*5p)*(-11)p/(p/(pp/(p/(p(-12)/p))p))p(-7)p assuming p is positive. p(-94) Simplify ((q1)*(-31)/(((qq/q*(-1/2))/q)/(qqq(-8))))(2/35) assuming q is positive. q(-11/5) Simplify ((t(4/3)t/((ttt2)/t))(4/9))(-6/23) assuming t is positive. t(16/207) Simplify (y/((y/(y/(y/y*(-7/6))))/y)y(1/24))/(y/y(-2/5))(1/10) assuming y is positive. y(-53/200) Simplify (n(3/2))(-2)/(nn/(n/((n/((nnn/(n(n/(n/(nn19n))n)/nn)nn)/n)n)/n))n(1/30)) assuming n is positive. n(-721/30) Simplify (((h*(-7)h)(6/11))46)(-9/8) assuming h is positive. h(1863/11) Simplify (((h*8/h)/((hh/h(-3/2))/h))(-43))(-2/7) assuming h is positive. h(387/7) Simplify (u(-11))50/((u/u(4/5))/u(-4)) assuming u is positive. u(-2771/5) Simplify (c/c11c(1/6))(-2/57) assuming c is positive. c(59/171) Simplify (((gg*(-6)g)/g)/(g/g*(2/17)))/(gg(1/25)/g)(-1/26) assuming g is positive. g(-64983/11050) Simplify (l(1/3))(2/117)/(l(-1/16)ll/((l/l*(-1/5))/l)l) assuming l is positive. l(-76709/28080) Simplify (n(-13)n)(-5)(n/(((n/(n*5/nn))/n)/n)n)(-3/4) assuming n is positive. n54 Simplify tt/(tt18)t*(-1/12)(t/(t*10/t))/(tt11) assuming t is positive. t(-445/12) Simplify (((ff(-1/6))/f(5/4))/((ff*(-2/9)f)/(ff(-1/4)ff)))(-2/91) assuming f is positive. f(-10/819) Simplify ((u/(u/(u/u(-12/13)))u)/u(1/16))/(u/(u/u(-7/3)))40 assuming u is positive. u(60025/624) Simplify (f2)(-33)(f(-2/17)/f)/(f/(fff(-11)f)f) assuming f is positive. f(-1311/17) Simplify (a/(a/a(4/3))a/a26)(1/46) assuming a is positive. a(-71/138) Simplify s(7/3)/(s/(s*(-8/11)s))(s(-1/7))(2/21) assuming s is positive. s(2575/1617) Simplify (n/(nn*(18/11))(n/n*(-6))/n)/(nnn(2/23)/nn)(-12) assuming n is positive. n(7440/253) Simplify x*(-8)x*(1/8)((x/(((x/(x/(x/(xx(3/2)/xx))))/x)/x))/xx)4 assuming x is positive. x(81/8) Simplify (((xx(-6))/(x/x2))/(xx/x(-6)xx4))(-1/8) assuming x is positive. x(17/8) Simplify ((qq(-1/3))(16/3)(qq*(-9))/(q/(qq*(5/4)qq)))(-9) assuming q is positive. q(43/4) Simplify ((l/(ll*(-4)))/ll*31)/(ll*(-15)ll)(4/3) assuming l is positive. l50 Simplify (tt3)/(t/((t/t(-8)t)/t)tt)t*(-5/3)t(-2/57) assuming t is positive. t(473/57) Simplify ((d(2/19))(-1/22))37 assuming d is positive. d(-37/209) Simplify u(-2/13)/u(-1/28)(u(-1/10)/u)39 assuming u is positive. u(-78293/1820) Simplify (((t/(t/(t(-3)t)))(-42))(-11/2))(-2/5) assuming t is positive. t(924/5) Simplify h13/h1(h(h/(hhhhh/h*1))/h)/hh0 assuming h is positive. h8 Simplify (t/t20)(-1)((t/((t(-30)/t)/tt))/tt)/(t/(((tt*12t)/t)/t)) assuming t is positive. t62 Simplify ((k(-1)/k*(-2/19))/(((kkk/(kkk(8/3)))/k)/k(-6)))(-2/61) assuming k is positive. k(482/3477) Simplify ((oo*(-4)o)/(((o/o(5/2))/o)/o))/(o/((o(4/7)o)/o))16 assuming o is positive. o(-75/14) Simplify (l/l(-2/43)l1/l)(-3) assuming l is positive. l(-135/43) Simplify v9(vv*(-4))/vv(v(-3))(-43) assuming v is positive. v135 Simplify (k(-4)kk/(kk/k*(-5/4)kk)(kkk/k(2/3))/(k/(k4/k)k))(7/4) assuming k is positive. k(-329/48) Simplify (t(-1/9))(9/11)/(t/t(-7)tt/(t4/t)t) assuming t is positive. t(-89/11) Simplify (m(2/11)/m)*(2/45)m*9m(1/2) assuming m is positive. m(1041/110) Simplify ((kk/k(-5/11))/(k/(k/k(-13))))/(k15)(2/123) assuming k is positive. k(6860/451) Simplify zzzz*(-1/6)zzz*7/zzzzz/(zz*(-4)/z)(zz/(z(-2/7)z))/zz assuming z is positive. z(845/42) Simplify (((c/c(-1/14))/cc)(-2/5))(-3/8) assuming c is positive. c(9/56) Simplify (l(-4/5))(4/37)/(l/l(-3/4)(ll27)/l) assuming l is positive. l(-21339/740) Simplify ((ff17)/f(-15))/(f(-3/8)f/f(5/2)) assuming f is positive. f(279/8) Simplify ((oo/o0)/o(-4))/(o(5/8)o(3/14)) assuming o is positive. o(289/56) Simplify (nn(-3)/n)36(n((nn*(-2/11))/n)/n)/(nnn(8/7)/nnnn) assuming n is positive. n*(-8726/77) Simplify (aa(-2/15))(2/43)a(-14)/(a/(a(-2/11)a)) assuming a is positive. a(-100334/7095) Simplify (b7)35/(b(-27)b(-6/25)) assuming b is positive. b(6806/25) Simplify ((((j(-9)/j)/j)/j)/jjjj(4/13))(-1/34) assuming j is positive. j*(139/442) Simplify (hh*(-6)/hhh(-4/9))/(h(3/7))(1/3) assuming h is positive. h(-352/63) Simplify (a(-4/5)/(aa((a/a(-7/6))/aa)/a))/(a(-2))25 assuming a is positive. a(1381/30) Simplify (s/s15)/s*(3/10)(s/s(2/19))(-42) assuming s is positive. s*(-9857/190) Simplify (((a((a/a*(1/6))/a)/a)/aa*(1/8)a)/(a(-1))(1/4))(-9) assuming a is positive. a(-15/8) Simplify g*6g*(-6/7)/gg*0gg(-7)g assuming g is positive. g*(-6/7) Simplify (q((q*(-9)q)/qq)/qq*(4/7)q)/((q*(-9)q)/qq/q(4/3)q) assuming q is positive. q(40/21) Simplify ((f/f(-2))*(-40)/((ff/f*2)/(f/(ff(4/5)))))(-2) assuming f is positive. f*(1208/5) Simplify (((cc*4)/(cc(-8/5)))/(c4((cc*(-4/9)cc)/cc)/c))(-43) assuming c is positive. c(-86/45) Simplify ((ccc*(-3/4))/cc)(-1)/(c4)(-3/5) assuming c is positive. c(23/20) Simplify (k(14/5)/k(-31))(4/19) assuming k is positive. k(676/95) Simplify i*(-10)i/((ii(-8))/i)ii(i*(-2/17)i)/ii(-13) assuming i is positive. i(-206/17) Simplify y1/(y/(y/(yy*(2/17))))(((y1/y)/y)/y)(-3/7) assuming y is positive. y*(88/119) Simplify (j/(jjjjj/((jj/((jj/(jj(-18)))/j))/j)))41(jjj(-1/8)j)/(j/(j/j(-2/51))) assuming j is positive. j(-350099/408) Simplify (((gg1g)/gg)(18/11)/(g(-1/2))(4/7))36 assuming g is positive. g(14400/77) Simplify (m(-1/5))(-1/8)/(m/(mm/m*(-3)m))(4/23) assuming m is positive. m(823/920) Simplify ((g*(-2/5)g)(2/39))20 assuming g is positive. g(8/13) Simplify ((m/m1mmm(-4)mmm)(3/28))22 assuming m is positive. m*(33/14) Simplify (bb/(b/((b*(-9)/b)/bb))bb(-1))/(b8/(b*(1/9)b)) assuming b is positive. b(-143/9) Simplify ((m/m(-2/7))/m)*(11/9)(m/m(-3))(-7) assuming m is positive. m*(-1742/63) Simplify (d(dd(-7))/d)(4/21)/(d(-4/7)(d/d(-2/27))/d) assuming d is positive. d(-122/189) Simplify (	{ "pile_set_name": "DM Mathematics" }
= x. Let a = 19 + t. Is 10 a factor of a? True Suppose 0 = 68i - 66i + 5m - 2078, 2i - 2062 = -m. Is i a multiple of 144? False Let n = -131 + 409. Let c = n + -188. Is c a multiple of 10? True Suppose -2l - 232 - 32 = 0. Let g = l + 146. Is g a multiple of 7? True Let o be -4 + 6 + -3 - -25. Let n = 90 - o. Is 22 a factor of n? True Let p(t) = 3t*2 - 26t - 61. Is 37 a factor of p(20)? False Let i = 1073 + 627. Is i a multiple of 34? True Let w = -138 - -229. Is 13 a factor of w? True Let u = -221 + 244. Is 10 a factor of u? False Let q(t) = -t - 8. Let k be q(-10). Let x be 27 - (k - (-1 - 0)). Is 8/(-6)(-396)/x a multiple of 8? False Let k(h) be the second derivative of 5/2h*2 + 0 - 6h + h*3. Is 14 a factor of k(6)? False Suppose 2a = 3t + 403, 5t - 29 = a - 234. Is a a multiple of 40? True Suppose 2a + 12 = 6a. Let b(s) = 0s + 8s + 435 - 440. Does 19 divide b(a)? True Let c(a) = -3a - 12. Let g(q) = 7q + 25. Let x(j) = -9c(j) - 4g(j). Let h be x(9). Does 3 divide 8 + 3 + h + -2? False Let z(c) = 27c + 40. Is z(12) a multiple of 14? True Does 49 divide (4431/6 - 1) + (-55)/22? True Let n = -308 - -530. Is 5 a factor of n? False Let r(p) = -p2 - 7p - 2. Let t be r(-6). Suppose 0 = tc + c - 20. Suppose 20 = 4h, 12 + 88 = cv + 4h. Does 9 divide v? False Is (5 - 9) + (4590/3)/3 a multiple of 22? True Suppose -t - 4t = -15. Let a(l) = -l2 + 3l - 4. Let s be a(t). Does 3 divide s + 7 - (-4 - -1)? True Let l = -71 + 116. Suppose -5w = -10, -2z + 4w = -15 - l. Let o = z + -24. Is 9 a factor of o? False Let n be 0 + ((-6)/3 - -10). Suppose -n = 3l + l. Is 11 a factor of (-3 + 25)(-3)/l? True Suppose 7g - 581 - 616 = 0. Is 5 a factor of g? False Let r = 10 - 8. Suppose 4s - 268 = -4z, rs + 221 = 3z - 0s. Is 11 a factor of z? False Suppose -151 = 5d + 4u - 381, 190 = 4d + 2u. Is d a multiple of 10? True Let h(m) = m3 - 2m + 12 - 22 + 6m2 + 13. Is 25 a factor of h(-5)? False Let f(g) = 2g*3 - 3g*2 + 4g - 1. Let s be f(3). Suppose -2u - 2 = -4. Suppose -p = -s + u. Does 28 divide p? False Let g(u) = 11u*3 + 12u*2 - 2u - 39. Does 27 divide g(8)? True Let t = -24 - -18. Let h be 55/2 + 3/t. Let f = h - 8. Does 5 divide f? False Let l be (0 + -2)(-9)/(-2). Let f = l + 6. Does 13 divide (f - -2)/((-3)/57)? False Suppose -4a + 4 = -8. Suppose 0 = -0b - ab - g + 90, 4b - 121 = -g. Does 5 divide b? False Let c = -4 - -5. Let b be (5 + c)/(12/(-18)). Let t = b - -39. Is t a multiple of 11? False Let t be 2/3 + (-342)/(-54). Is 670/t + 12/42 a multiple of 32? True Suppose 0h - 17 = -5h - 2i, -3 = h + 2i. Let s(n) = n3 - 4n*2 - n - 6. Is 14 a factor of s(h)? True Let b be (-2)/(-13) - (-2)/((-26)/(-37)). Suppose -t - bn + 56 = 14, 0 = 3t - 2n - 104. Is 6 a factor of t? True Let i(j) be the second derivative of 2j3 + j2 - 16j + 7j + 6j. Does 16 divide i(3)? False Let d = 26 - 5. Suppose d + 21 = g. Does 6 divide g? True Suppose -234 = -8j + 2j. Suppose j + 421 = 4c. Does 31 divide c? False Let f = 611 + -88. Is 48 a factor of f? False Let m = -863 - -929. Is m a multiple of 2? True Let c(w) = -w3 - 19w*2 + 11w - 46. Let x be c(-20). Let r = 190 - x. Is 5 a factor of r? False Let r = 171 - 118. Let u = 151 - r. Is u a multiple of 24? False Let m(h) be the third derivative of -h*4/12 + 10h*3/3 + 11h2. Does 7 divide m(-11)? True Suppose t = 37 - 8. Let u = 89 - t. Is u a multiple of 20? True Let v = 933 - 882. Is 17 a factor of v? True Let u(l) = l3 + l*2 + 5l + 4. Let f be u(-3). Let s = 42 + f. Let z = s + 15. Is z a multiple of 9? False Let d(p) = 2p3 + p2 + p + 2. Let u be d(-2). Let s = 12 + u. Suppose -4y = s, 2y + 29 + 1 = 3t. Is 10 a factor of t? True Suppose -105y + 104y = 5t - 3655, 5t + 25 = 0. Is 16 a factor of y? True Let b be (-72)/(0 + -2)1. Let y = b + -22. Is 7 a factor of y? True Suppose -2i + i = -6. Does 16 divide (-128)/i(-9)/6? True Let y = -66 - -63. Let a(c) = -c3 + 6c + 6. Is 5 a factor of a(y)? True Let y = 1068 + -1012. Does 8 divide y? True Let q be 0 - (0 + (-2)/1). Suppose -2g = -h - 0g - 1, 11 = 5h - qg. Suppose hy + 0y = 141. Is y a multiple of 12? False Let v(a) = 5a2 - 10a - 24. Let j be v(-10). Suppose j = 8d - 240. Is 34 a factor of d? True Let d = -60 - -42. Let n be -4 - -1 - d/(-6). Is 13 a factor of (-256)/n + 4/12? False Suppose -54o = -55o + 15. Let v(s) = s2 - 9s - 45. Is 39 a factor of v(o)? False Let a = -59 - -59. Suppose -9h + 1038 + 168 = a. Does 15 divide h? False Let w = -427 + 715. Let t = 496 - w. Suppose 3k - t = -k. Does 26 divide k? True Let a = 134 + 698. Is 28 a factor of a? False Let a(h) = -21h2 + 6h - 11. Let z(k) = 10k2 - 3k + 5. Let m(t) = -2a(t) - 5z(t). Let v be m(-4). Let c = -100 - v. Is 16 a factor of c? False Let z(c) = -c*2 + 11c + 29. Let f be z(13). Let g = 7 - f. Suppose 2k - 3u - 112 = 29, -2k + 144 = -gu. Is 18 a factor of k? False Let n(b) = 906b + 100. Does 23 divide n(2)? False Is (3 + (-492 - -7))/(-2) a multiple of 12? False Suppose 140 = 6k + 2. Let c = 31 + k. Does 18 divide c? True Let z be ((-24)/(-18))/((-8)/12). Is 4 a factor of ((-6)/(0 + z))/(9/258)? False Suppose -6y = 5t - 4y - 122, -2 = -2y. Is t a multiple of 3? True Suppose i - 2 = w + 8, 4i = w + 22. Let s(y) = 10y - 29. Let a(x) = 9x - 28. Let t(z) = ws(z) + 7a(z). Is 26 a factor of t(16)? True Let k = -29 - -44. Let q(f) = f2 + k + f2 + 15f - 6f2 + 5f*2. Does 6 divide q(-15)? False Suppose -f + 41 = b + 2f, 0 = -b - 5f + 49. Let t = b + -31. Let y(k) = -4k3 + k2 - 3k - 2. Is y(t) a multiple of 20? True Let k(q) be the third derivative of q5/20 + q4/8 + q3/6 + 5q*2. Let t(c) be the first derivative of k(c). Is 27 a factor of t(13)? True Let c = -40 - -42. Suppose 0 = b - 3. Suppose 0 = -bj + 12, -cj + 2 = m - 5j. Is m a multiple of 14? True Let z(a) = -44a3 - 8a*2 + 4a + 2. Is z(-3) a multiple of 14? True Let u = -16 - -9. Let f = u - -22. Let g = f + 1. Is g a multiple of 16? True Suppose -m + 7 = -194. Is 37 a factor of m? False Suppose -5m + 20 = 0, -2m - 2m + 538 = 3j. Suppose 4p - j = 90. Is 9 a factor of p? False Suppose -2p + 446 = -522. Does 44 divide p? True Let g(o) = o*3 - 13o*2 - 2o - 24. Is 16 a factor of g(14)? True Suppose 17q = 12986 + 46021. Is q a multiple of 39? True Let s(v) = -v3 - 10v*2 + 13v - 30. Is s(-15) a multiple of 90? True Let w be 8/23/(3/(-14)). Let d = w + 184. Does 32 divide d? True Let y(u) = 106u*2 + u - 12. Is 23 a factor of y(4)? False Let g(q) = 27q + 10. Let n be g(4). Suppose n = 2f - f. Is f a multiple of 26? False Suppose -5u + 3626 = 9u. Is u a multiple of 37? True Suppose -5t + 10 = -10t. Does 12 divide t/13 - 21686/(-182)? False Suppose -j - 49 = -5q, 3j - 4j - 9 = -q. Suppose 8y - qy + 342 = 0. Does 19 divide y? True Suppose 3v - 6 = 0, -25a - 2v - 2876 = -27a. Is a a multiple of 40? True Let y be 0(-1)/4-1. Suppose -5w + w + 5m + 149 = y, -4w + 104 = 4m. Is w a multiple of 31? True Let j be ((-1)/(-4))/(6/120). Suppose m - 600 = -jm. Let s = m - 60. Does 5 divide s? True Suppose 11z + 9z - 300 = 0. Is z a multiple of 15? True Let t(d) = -47d + 33. Is t(-21) a multiple of 20? True Suppose -q + 30 = 4q. Suppose -qu - 228 = -8u. Is 26 a factor of u? False Let l = 7 - 4. Suppose -la + 28 - 4 = 0. Suppose -3b + 4b = a. Is 4 a factor of b? True Let j(r) = r*2 + r + 1. Let f(k) = -6k*2 - 16k + 6. Let w(c) = f(c) + 5j(c). Does 19 divide w(-7)? False Let g(z) = -38z + 7. Is 14 a factor of g(-22)? False Suppose -305 = 2g - 7g. Let a = 106 - g. Is 3 a factor of a? True Does 15 divide (-160)/(-24)(-135)/(-6)? True Let b = -10 - -10. Suppose br + f = -r + 827, -4135 = -5r + 2f. Is 15 a factor of r/11 - 4/22? True Let x = 19 + -19. Suppose x = -11f + 6f - 85. Let n = f - -31. Is n a multiple of 4? False Let j(h) = -h2 + 1. Let w(y) = -y3 - 5y2 + 2y - 2. Let k(q) = 5j(q) - w(q). Is 9 a factor of k(4)? True Suppose 5s = -2r - 40, -94 = 4r - 0s + 3s. Is ((-15)/r)/(1/205) a multiple of 38? False Let q be 290/3 + (-3)/(-9). Let k(o) = o + 109. Let g be k(0). Suppose 5j + 4l - 47 - q = 0, -4j + g = -3l. Is 4	{ "pile_set_name": "DM Mathematics" }
Let n be (-13 - -41)/(2/5200). What is n rounded to the nearest ten thousand? 70000 Let x = 1090.00615 + -1090. Round x to four decimal places. 0.0062 Let m = 0.9208 - 0.0748. Let p = 1.335 - m. What is p rounded to one decimal place? 0.5 Let x = 0.453 - 0.452997781. Round x to seven decimal places. 0.0000022 Let z = -752.22 + 759. What is z rounded to 1 dp? 6.8 Let i be 2(180/(-3))/2. Let p be ((-329)/(-3))/((-2)/i). What is p rounded to the nearest 100? 3300 Suppose q + 36964001 = 4j, 58q - 61q = 3. Round j to the nearest 100000. 9200000 Let o = 8.34 + -0.65. What is o rounded to zero decimal places? 8 Let p be (-8)/(-4) - (-3 - 4). Let z = p + -3. Suppose -zj - 32 = -2j. What is j rounded to the nearest 10? -10 Let o = -61500 + 15400. Round o to the nearest one thousand. -46000 Let i be (-52503 - -3)/(4/(-400)). What is i rounded to the nearest 1000000? 5000000 Let b = -398.63 - 16.57. Round b to the nearest ten. -420 Suppose -27c - 24c + 1002150 = 0. What is c rounded to the nearest ten thousand? 20000 Let u = -298 - -297.9998862. What is u rounded to 4 decimal places? -0.0001 Let k(r) = -4r3 - 2r*2 - 19r + 5. Let h be k(-23). Let m = h + 948. What is m rounded to the nearest 10000? 50000 Suppose -2u + l = -5040001, 0 = -3u - 0l + 3l + 7560003. Round u to the nearest one million. 3000000 Let h = -3.95 - -2.4. Let t = -1.5499883 - h. Round t to six decimal places. 0.000012 Let s = -580661 + 2107461. What is s rounded to the nearest 10000? 1530000 Let w = -284803188 - -284803219.9999943. Let v = w - 32. Round v to six decimal places. -0.000006 Let k = -30 - -40. Let j be (-45)/k-2346/6. What is j rounded to the nearest 100? 500 Let g = -2391.61 - -2372. Let z = -288 - -286.59. Let i = z - g. Round i to 0 decimal places. 18 Let t = 2224 - 2224.0002038. Round t to four dps. -0.0002 Let s = -19 - -27.5. Let x = s + -8.602. What is x rounded to two dps? -0.1 Let z = 1374 + -1373.9998174. What is z rounded to 6 decimal places? 0.000183 Let y = -431470.7850007 + 431496.785. Let h = 25.9806 + 0.0194. Let g = y - h. Round g to six dps. -0.000001 Let f(t) = 2t - 4. Let q be f(5). Let m(x) = -x2 + 5x + 6. Let i be m(q). Suppose i = 2d - 3d. Round d to zero decimal places. 0 Let d(j) = 1866666j + 12. Let n be d(9). Suppose -2x = 4t - n, -4t = -t - 3x - 12599991. Round t to the nearest one million. 4000000 Suppose 0 = -9t + 113371 - 375271. What is t rounded to the nearest one thousand? -29000 Let d = -1183676 + 835676. What is d rounded to the nearest 10000? -350000 Let x = -5782 + 5782.4489. What is x rounded to 2 decimal places? 0.45 Let t = 235665 - -6335. Round t to the nearest ten thousand. 240000 Let y = -0.622 + -1588.378. Let k = y - -1789.6. Let f = k - 185. Round f to the nearest integer. 16 Let k(v) = v*3 + 7v*2 + 2v - 14. Let x be k(-6). Let t be 56/x + 4/10. Suppose tb = -10619754 - 7980246. What is b rounded to the nearest 1000000? -3000000 Let k = 7.3 - 6. Let y = -1.638 - -0.34. Let j = y + k. What is j rounded to three decimal places? 0.002 Suppose 242592 = 4b + 4j, -5b + j + 301274 = -1966. Suppose 5p = 4u - u - 43, -3u + p = -23. Suppose 0 = uh + b + 149352. Round h to the nearest 1000. -35000 Let h = 474 - 473.999621. What is h rounded to four dps? 0.0004 Let h = 213703.99871 + -213700. Let x = -0.0845 - 3.9155. Let t = h + x. Round t to four dps. -0.0013 Let x = -8 - -14.5. Let s = x - 6.21. Let p = s - 0.290088. What is p rounded to 5 decimal places? -0.00009 Let o be (160/(-15) + 3)-4053. Let h = 15927 + o. Round h to the nearest 10000. 50000 Let m be (-2204)/2 - ((-289)/(-17) - 20). What is m rounded to the nearest 100? -1100 Let i be (270/(-25))/(6/(-20)). Let r be (-18)/i508000/(-1). Round r to the nearest 100000. 300000 Let c be (-371)/21 - -18 - 4840/(-6). What is c rounded to the nearest 10? 810 Suppose -150r - 16860 = -162r. Let u be (105/(-4))/(3/(-12)). Let p = u - r. Round p to the nearest 100. -1300 Suppose -13w + 4613004 = -11w. Suppose 661502 - w = 5m. Round m to the nearest 10000. -330000 Let p = -795.001935 - -795. Round p to 4 decimal places. -0.0019 Suppose -15o - 77459 = 26626. Round o to the nearest one thousand. -7000 Let t be 0 + -4 - (-14)/1. Let x = t - 10. Let y be x/19 + (-300001 - -1). Round y to the nearest one hundred thousand. -300000 Suppose -3j - 8180990 = 5p, -j + 10p - 12p - 2726996 = 0. What is j rounded to the nearest one million? -3000000 Suppose 3 = -2n + 1. Let y = n - -2. Suppose -3v - 16399 = -2s - 2v, 0 = v - y. Round s to the nearest 1000. 8000 Let s be (8/5)/(36/90). Let o be 436-2(-10)/s. Round o to the nearest one hundred. 2200 Suppose -m + 13m = -197160. What is m rounded to the nearest 100? -16400 Suppose -65 = -4j - 13. Let q = -2 + j. What is q rounded to the nearest ten? 10 Let y = -96148195.000063 + 96148149. Let o = y - -46. What is o rounded to five decimal places? -0.00006 Let d = 1.5414 - 1.44461. What is d rounded to three dps? 0.097 Let m = -5697083971 - -1537935836. Let j = m - -4159148599.0000219. Let b = -464 + j. Round b to six dps. 0.000022 Let d = 26067.9982 + -26072. Let k = 84 - 88. Let c = d - k. Round c to 3 dps. -0.002 Let d(k) = k*2 + 11k + 34. Let r(i) = -13i3 + i2 - 4i + 4. Let c be r(1). Let o be d(c). Round o to the nearest 10. 50 Let a be 1 + (-2 - -1) + 0. Suppose 6y + 44708 - 2174708 = a. What is y rounded to the nearest 10000? 360000 Suppose -c - 6 = -2c. Let t(y) = -y + 3y - 7y + cy2 + 6 - 2y. Let o be t(6). What is o rounded to the nearest 100? 200 Let s = -477322 + 1172322. Suppose 7q - s = 2q. What is q rounded to the nearest ten thousand? 140000 Let f(g) = 257g. Let y be f(1). Let p be 9y(-65351)/(-39). Suppose -p = o + 1724183. Round o to the nearest 1000000. -6000000 Let j be (102002)/(7/((-21350)/3)). Round j to the nearest one million. -21000000 Let n = 68 + -67.829. Let k = n - 0.1821. What is k rounded to three decimal places? -0.011 Let c(f) = f*3 + 10 - 5 - 14f*2 - 8f + 6. Let y(t) = t*2 + 7t + 3. Let p be y(-8). Let x be c(p). Round x to the nearest one hundred. -400 Let d = -672 - -670.494. Round d to one dp. -1.5 Let r = -126521498052.5644 - -126510131074.66440003. Let a = r + 11366978. Let x = -0.1 + a. What is x rounded to seven decimal places? 0 Let a = -75874 - -75874.71086. Let x = 0.71 - a. What is x rounded to four dps? -0.0009 Let w = -472 + 472.000003567. What is w rounded to 7 dps? 0.0000036 Let o = -2.18 - 5.79. What is o rounded to the nearest integer? -8 Let v = 9625.3596 + -9628. Let j = -6.64072 - v. Let r = j + 4. What is r rounded to four decimal places? -0.0003 Let n = -0.036 + 1.736. Let h = n - 1.70007. What is h rounded to 4 dps? -0.0001 Let y = -15 + 14.53. Let x = -0.5 - y. Let p = x - -0.030005. Round p to five dps. 0.00001 Let i = -54 - -331. What is i rounded to the nearest 100? 300 Let g = -10.5 - -10.50000507. What is g rounded to 7 dps? 0.0000051 Let k(v) = 34v2 - 144v - 77. Let z be k(-19). Round z to the nearest one thousand. 15000 Let j = -1.102 + -669.898. Let r = 666.91 + j. Round r to one decimal place. -4.1 Let k be ((-8)/6)/((-2)/3). Let t be 5k + (-9 - -7). Let m be 11(t/4 - -18). What is m rounded to the nearest 100? 200 Let j(u) = 36u3 - 20u*3 - 17u*3 - 3u - 20 - 8u2. Let s be j(-8). Suppose sm = 2m + 100000. Round m to the nearest one hundred thousand. 100000 Let a be ((-312)/54 - -6) + (-4586)/(-18). Let l be (-30)/(1 + (-245)/a). What is l rounded to the nearest one hundred? -800 Let m = 1013818063 + -1013818032.00000005. Let z = m - 31. What is z rounded to seven dps? -0.0000001 Suppose 99k + 207 = 90k. Suppose -4x - 96 = -c, x + 22 = -c + 3. Let h = x - k. What is h rounded to the nearest one hundred? 0 Let g = -32618 - -96927. Suppose 4*a = -g + 1729. Let r = a + 31645. Round r to the nearest ten thousand. 20000 Let x = -0.1 - 1.6. Let y = x - -1.6. Let t = y + 0.09975. Round t to four dps. -0.0003 Let m = 1096 + -1850. Let w = m - -690.2. Let t = -54 - w. Round t to the nearest integer. 10 Let n = 0.1227 + -0.1227010384. Round n to seven dps. -0.000001 Let j = -24 + 13. Let f be (-980099982)/(-99) - 2/j. What is f rounded to the nearest one million? 10000000 Let i = -6.519914	{ "pile_set_name": "DM Mathematics" }
ind the third derivative of -55v2 - 5v*6 + 51948v*3 + 2v*4 - 51948v*3 wrt v. -600v*3 + 48v Suppose -45 = 9q - 12q. Find the first derivative of -q + 9 + 36b2 + 20 wrt b. 72b What is the third derivative of p*3 - 55p*2 - 199 + 201 + 201p*4 - 195p*4 wrt p? 144p + 6 Let s(j) = -20j2 + 3. Let r(q) = 10q*2 - 2. Suppose -35 = 3k + 4k. Let i(o) = kr(o) - 2s(o). Find the first derivative of i(t) wrt t. -20t Suppose -z - 4 = -u, -2u - 10 = -6u + z. What is the third derivative of -6p4 - 6p*u + 4p*2 + 11p*2 wrt p? -144p Let d(f) be the first derivative of -43f5/5 + 103f + 431. What is the first derivative of d(b) wrt b? -172b3 Let z be 1 - (-4)/(4/4). What is the first derivative of 9l*2 - 2 - z - 14l*2 - 1 wrt l? -10l Let d(u) = -402u3 + 3u*2 - 32u - 60. Let k(x) = 403x3 - 3x*2 + 33x + 50. Let w(g) = 5d(g) + 6k(g). Find the third derivative of w(n) wrt n. 2448 Find the second derivative of 166o - 1584o*2 + 1584o*2 - 85o*5 - 101o*5 + 2 wrt o. -3720o3 Let m(o) = o2 - 2o + 10. Let j be m(3). Find the second derivative of -2960r*3 + 2960r*3 - jr*4 - 18r wrt r. -156r2 Let h(x) = 463x*3 - 11x*2 - 9x + 86. Let n(v) = -231v3 + 6v*2 + 5v - 42. Let y(d) = -6h(d) - 11n(d). Find the second derivative of y(i) wrt i. -1422i Suppose 0 = r + 3r. Suppose 0 = b + 4m + 7, rb - 2m - 2 = 2b. What is the first derivative of 3 - b + 3 + 3v4 wrt v? 12v*3 Let c(z) be the third derivative of 89z*5/12 + 29z*4/8 - 7z*2 - 36z. Find the second derivative of c(d) wrt d. 890 Suppose -2m - 72 = -6m. Find the second derivative of 12k - 27 + mk*4 + 0k + 27 wrt k. 216k2 Let j(x) = 62x*3 - 3x*2 - 79. Let y(b) = 62b*3 - 2b*2 - 79. Let l(v) = -2j(v) + 3y(v). What is the first derivative of l(d) wrt d? 186d*2 Let t(p) = 82p*3 - 5p*2 + 36p. Let z(c) = -81c3 + 4c*2 - 36c. Let w(u) = 4t(u) + 5z(u). Find the second derivative of w(b) wrt b. -462b Let n(d) = -37d*3 + 3d*2 + 8d + 1. Let z(h) = -36h3 + 2h*2 + 8h. Let j(g) = -3n(g) + 4z(g). What is the second derivative of j(x) wrt x? -198x - 2 Let t(u) = -u3 - 5u*2 + 3u - 127. Let o(k) = -3k3 - 11k*2 + 7k - 254. Let q(p) = -3o(p) + 7t(p). What is the derivative of q(l) wrt l? 6l2 - 4l Let a(k) be the first derivative of 17k4/4 - k2/2 + 70k + 84. Differentiate a(g) with respect to g. 51g2 - 1 Let g(c) be the first derivative of -6c*2 - 24 - 5c*2 + 2 - 2c*3. What is the second derivative of g(j) wrt j? -12 Let z = -20 - -22. What is the third derivative of -5k*3 + 3k*3 + zk2 + k2 + 2k2 wrt k? -12 Let d(m) be the second derivative of m5/5 + 3m*4/4 - 25m*3/6 + 5m*2/2 + 336m. Find the second derivative of d(u) wrt u. 24u + 18 Find the third derivative of -108x*2 + 119x*2 - 2x*5 - 4 + 3 wrt x. -120x2 Let c(l) be the third derivative of l6/40 + 7l5/60 - 5l*3/6 - 45l*2. Find the first derivative of c(z) wrt z. 9z*2 + 14z Let x(s) = -57s4 + 5s*3 - 14. Let u(w) = 29w*4 - 3w*3 + 7. Suppose -2 + 7 = g. Let v(y) = gu(y) + 3x(y). Find the first derivative of v(q) wrt q. -104q3 Let s(d) = d5 - d*4 + 2d3 - d2 - 30d + 2. Let z(k) = -k5 - k3 + k2 - 1. Let p(y) = -s(y) - 2z(y). What is the third derivative of p(h) wrt h? 60h2 + 24h Let o(w) be the second derivative of 29w7/2520 - w5/5 - w4/2 - 40w. Let b(s) be the third derivative of o(s). What is the derivative of b(a) wrt a? 58a Let m(q) = 30q*4 - 8q*2 + 10q - 550. Let z(c) = 10c4 - 3c*2 + 4c - 184. Let x(s) = 3m(s) - 8z(s). What is the first derivative of x(n) wrt n? 40n3 - 2 Let r(q) be the first derivative of 0q*5 + 0q*4 + 4q + 7 + 7/6q6 + 1/3q*3 + 4q*2. Find the second derivative of r(o) wrt o. 140o*3 + 2 Suppose d = -5f - d + 28, -2d = 3f - 20. Let s(q) = -q*2 + 9q - 7. Let m be s(7). What is the second derivative of -f + 5 - i*2 - 1 - mi wrt i? -2 Suppose 89 = 33v - 10. Let h(q) be the first derivative of 0qv + q4 + 0q + 5 + 5/2q*2. What is the second derivative of h(s) wrt s? 24s Let d be (0 - 0/1) + 2. Suppose 10 = 3h - z, -2z - 10 = -dh + h. What is the derivative of 5y*4 + h - 2y4 + y4 wrt y? 16y3 What is the third derivative of -60p*2 + p - 191p*6 - 11p*3 - 202p*2 + 11p*3 wrt p? -22920p3 Let d(j) be the third derivative of j6/90 - j*5/8 + 7j*3/3 + 3j*2. Let w(f) be the first derivative of d(f). Find the second derivative of w(t) wrt t. 8 Suppose 4p + p + 15 = 0, -2u = -4p - 20. Suppose 4o + c = 13, uc + c + 4 = 3o. Differentiate -ov*4 + 4v*4 - 3v*4 + 8 - 5 wrt v. -8v*3 Let q(w) = -7w - 17. Let j be q(-4). What is the second derivative of -5 - js + 17 - 12 + 4s*5 wrt s? 80s3 Let x(o) be the first derivative of o9/126 - 2o5/15 + 9o*2/2 - 5. Let j(f) be the second derivative of x(f). Find the third derivative of j(t) wrt t. 480t*3 What is the second derivative of -12a + 4a + 33a*2 + 3 + 4a + 66a2 - 27a*2 wrt a? 144 Find the second derivative of 4 - 43c*4 + 2 + 10c - 3c - 13 - 2c*2 wrt c. -516c*2 - 4 Find the second derivative of 4736g - 4683g - g2 + 101g*2 wrt g. 200 Suppose -t - 8 = -3w, w = 3t - 0 + 8. Suppose wj - 6 = 2. Find the third derivative of 7g4 + g2 + g4 + 5g*2 + 0g*j wrt g. 192g Let a(r) = -2r + 2. Let j(m) = 5m + 28. Let u(v) = 15a(v) + 3j(v). What is the derivative of u(g) wrt g? -15 Let h be ((-15)/(-10))/((-3)/(-4)). What is the derivative of 23f - 19f + 37 - 12f3 - hf wrt f? -36f2 + 2 Let y = 33 + -20. What is the derivative of 61 + 17q*3 + yq*3 - 6q*3 - 6q*3 wrt q? 54q*2 Let t(d) = -4d*3 - 9d*2 + 14d. Let g(q) = -10q3 - 17q*2 + 28q. Let j(w) = 3g(w) - 7t(w). Find the second derivative of j(o) wrt o. -12o + 24 Let p(k) be the first derivative of k5/4 - 5k*4/12 - 3k - 11. Let j(s) be the first derivative of p(s). What is the third derivative of j(q) wrt q? 30 Let s(k) = 16k2 + 1. Let t be s(1). Suppose -z + 4j + 11 = 2j, z = -5j - t. Differentiate 0 + 6o2 + 14o - 14o - z with respect to o. 12o Let r(a) be the second derivative of 123a5/20 - 115a*2/2 - 256a. Differentiate r(j) with respect to j. 369j2 Let x be (-7)/((-42)/(-16))-3. What is the second derivative of -3y2 + xy*2 + 3y - 6y - y wrt y? 10 Let v = 74 + -72. Find the third derivative of -109y*2 - 113y*v + 214y*2 + 35y*4 wrt y. 840y Let w be -4 - (4 - 7)/((-3)/(-8)). What is the second derivative of 86u4 + 86u*w - 139u*4 + 37u wrt u? 396u2 Let m(x) be the first derivative of -464x5/5 + x3/3 + 123x2/2 + 475. What is the third derivative of m(g) wrt g? -11136g Let l be (-39)/(-3) + (2 - -1) + 4. Let a(m) = m*2 - 3m - 3. Let g be a(-2). Differentiate 6d - 14d + g + ld wrt d. 12 Let z(b) = -2b - 7. Let p be z(-5). What is the second derivative of 15t3 + 7t - 7 + 10 - p wrt t? 90t Let m(j) be the third derivative of 19j*5/6 - 11j*4/24 + 128j*2 + 2j. What is the second derivative of m(g) wrt g? 380 Let f(x) = x*2 + 6x - 4. Let l be f(-7). Suppose 10o - lo = 0. Find the third derivative of 11a2 - 6a*6 - 2a*6 + oa*2 + 0a*2 wrt a. -960a*3 Let v = 7 - 7. Let h = -20 + 22. Find the second derivative of -3p*2 + vp*2 + 5p + 0ph wrt p. -6 Let j(s) = 15s*4 - 12s*3 + 10s*2 - 94. Let u(i) = -8i*4 + 6i*3 - 6i*2 + 47. Let q(k) = -4j(k) - 7u(k). Find the third derivative of q(y) wrt y. -96y + 36 Let a = 41 - 39. Differentiate 25ca + 0c - 14c2 + 0c + 13 wrt c. 22c Suppose 2b - 62 = 5n, -n - n = -3b + 104. Differentiate 3 + 271d - 271d + bd3 wrt d. 108d*2 Let m(s) be the third derivative of -1/42s*7 - 2s + 0s3 + 0 - 5/6s*4 - 1/30s*6 + 0s*5 - 13s*2. Find the second derivative of m(h) wrt h. -60h*2 - 24h Let a(b) be the third derivative of -30b2 + 0b + 0b4 + 41/60b*5 + 0 + 31/6b*3. What is the first derivative of a(x) wrt x? 82x Let w(p) be the second derivative of -p*6/8 + 19p*4/24 + 19p*2/2 - 3p. Let d(y) be the first derivative of w(y). Find the second derivative of d(m) wrt m. -90*m Let v(s) = s - 1.	{ "pile_set_name": "DM Mathematics" }
se 4, what is -12220 - 10? -12230 In base 8, what is 1334 + 2? 1336 In base 10, what is 6643 - 2? 6641 In base 3, what is 20 - -1220? 2010 In base 7, what is -2 + -420? -422 In base 10, what is -14 - 706? -720 In base 12, what is 5 - 98? -93 In base 3, what is 10200212 + 12? 10201001 In base 6, what is -51 - 50? -141 In base 3, what is 2121 - 12000? -2102 In base 12, what is -7 + -6? -11 In base 16, what is 3 + ac? af In base 3, what is -10201 + -11? -10212 In base 14, what is 35 - -c? 43 In base 7, what is 253 + -10? 243 In base 9, what is -2 + 75? 73 In base 14, what is -a3 - 2? -a5 In base 5, what is 243 + -1112? -314 In base 6, what is 10 - 25? -15 In base 4, what is -3 - -1112? 1103 In base 16, what is -ca7 - -5? -ca2 In base 7, what is -3 + 4? 1 In base 5, what is 210403 - -10? 210413 In base 8, what is -5 - 634? -641 In base 12, what is -16 + -16? -30 In base 4, what is -22101 - -23? -22012 In base 4, what is -102121 - -3? -102112 In base 2, what is 101100101 - -10? 101100111 In base 8, what is -23 + 1? -22 In base 12, what is 116 + -24? b2 In base 15, what is -168 + 1? -167 In base 9, what is 1 - 0? 1 In base 9, what is 43 + 3? 46 In base 6, what is 232 + 2? 234 In base 7, what is -60 + 242? 152 In base 14, what is a - 8ca? -8c0 In base 10, what is 16 + -242? -226 In base 13, what is -187 - -12? -175 In base 3, what is 0 + -10100122? -10100122 In base 10, what is 894 + -4? 890 In base 9, what is -5 + -427? -433 In base 8, what is -2 + 1322? 1320 In base 6, what is -554 - 1? -555 In base 8, what is 3 + 25? 30 In base 15, what is 18 + a? 23 In base 13, what is 11 + -142? -131 In base 10, what is -45 + -94? -139 In base 12, what is -16 + -5? -1b In base 13, what is -5 + c70? c68 In base 9, what is 3314 - 4? 3310 In base 2, what is 11 - 11101? -11010 In base 12, what is 30 - -83? b3 In base 16, what is -94c - 5? -951 In base 8, what is 2 - -13345? 13347 In base 11, what is 31 + 6? 37 In base 3, what is 2121 + 10020? 12211 In base 10, what is 5 + -52? -47 In base 10, what is -13 + 29? 16 In base 10, what is -2 + -1814? -1816 In base 3, what is 20122 - -2? 20201 In base 11, what is -50 - -4? -47 In base 7, what is -355 - -12? -343 In base 15, what is -3 + -3? -6 In base 11, what is 118 - 34? 94 In base 13, what is -4 - -7a? 76 In base 16, what is 1b - 6? 15 In base 4, what is 20111 + 11? 20122 In base 6, what is 132020 + -4? 132012 In base 6, what is 2 - 522? -520 In base 6, what is 5 + -30? -21 In base 14, what is -9 + -822? -82b In base 6, what is -540 - 1? -541 In base 13, what is 0 - -9? 9 In base 10, what is -3 - 388? -391 In base 13, what is 1324 + -1? 1323 In base 10, what is -2 - -45? 43 In base 4, what is 110210 - 32? 110112 In base 12, what is 5 - ba? -b5 In base 13, what is -38 + -1a? -55 In base 15, what is -5ad - -3? -5aa In base 16, what is -3 + 2? -1 In base 8, what is -12005 + 1? -12004 In base 14, what is 4 - a57? -a53 In base 8, what is -432 - -12? -420 In base 10, what is 92 - -1? 93 In base 16, what is 1 + 4d? 4e In base 5, what is -232140 - -4? -232131 In base 2, what is -10111111 - 11? -11000010 In base 9, what is 114 + 21? 135 In base 6, what is -4131 + -5? -4140 In base 6, what is -4 + -12533? -12541 In base 16, what is -384c - 3? -384f In base 14, what is -4 + 573? 56d In base 8, what is 53170 - -1? 53171 In base 12, what is -544 - 14? -558 In base 5, what is -3044 - 10? -3104 In base 12, what is 3000 + 3? 3003 In base 14, what is 1d - -5? 24 In base 7, what is -123 + -22? -145 In base 2, what is -1011100 - 10011101? -11111001 In base 8, what is 467 - -5? 474 In base 8, what is 12 + -7? 3 In base 3, what is -102201 + -1? -102202 In base 7, what is 141 - 13? 125 In base 16, what is -2e + 4? -2a In base 5, what is 3412 + -3? 3404 In base 9, what is -12567 + 2? -12565 In base 16, what is -56e - 2? -570 In base 11, what is 248 - -1? 249 In base 9, what is -74 - -28? -45 In base 16, what is 1 - 1f6? -1f5 In base 14, what is -3 + -7? -a In base 12, what is 125 - 1? 124 In base 4, what is -3002 - 22? -3030 In base 15, what is -a - -256? 24b In base 15, what is -11 - -194? 183 In base 13, what is -39 + 108? 9c In base 16, what is -f + -2f? -3e In base 10, what is 3 + -21? -18 In base 12, what is -2 + -37? -39 In base 4, what is 23 + 1021? 1110 In base 6, what is 3 - 54332? -54325 In base 15, what is 0 - 1c0? -1c0 In base 10, what is 7 + 40? 47 In base 11, what is 5 + 16? 20 In base 3, what is -101100 - -1001? -100022 In base 14, what is -5 + 9b? 96 In base 3, what is -10 - 100102? -100112 In base 10, what is -48 + -3? -51 In base 12, what is -4 - 3b? -43 In base 7, what is 13232 + 11? 13243 In base 15, what is 2 + -25? -23 In base 16, what is -a - 34? -3e In base 7, what is -1 + 112? 111 In base 12, what is 1 - 1592? -1591 In base 16, what is -d1e + 3? -d1b In base 2, what is -1 - 100000111? -100001000 In base 10, what is 198 - -4? 202 In base 13, what is -1926 + -5? -192b In base 3, what is -210 - 1221? -2201 In base 11, what is -35 + 0? -35 In base 12, what is 4 + -31? -29 In base 10, what is -300 + -5? -305 In base 6, what is -5 - -1411? 1402 In base 7, what is 5 - -3? 11 In base 11, what is 0 + 20? 20 In base 7, what is 24 - 105? -51 In base 9, what is 1 + -3315? -3314 In base 10, what is -1 + 26? 25 In base 2, what is 10101011111 + -101? 10101011010 In base 16, what is 4 - -e5? e9 In base 9, what is -131 + 7? -123 In base 9, what is -4 + -257? -262 In base 2, what is 110 + -10100000? -10011010 In base 16, what is 7a8 + -1? 7a7 In base 8, what is 32 + -102? -50 In base 13, what is 93c - -5? 944 In base 6, what is 3 + -4013? -4010 In base 7, what is -5 - 22? -30 In base 10, what is -368 - 7? -375 In base 3, what is 100 + 20020? 20120 In base 5, what is -1 - -4233? 4232 In base 2, what is -1 + -1011? -1100 In base 14, what is -3 + 123? 120 In base 5, what is -10 - 4? -14 In base 14, what is -4 - 7d? -83 In base 11, what is -5 - 530? -535 In base 6, what is 4 + -12511? -12503 In base 13, what is -88 - c? -97 In base 13, what is 1 - -23a? 23b In base 12, what is -1a - -1a? 0 In base 7, what is 4 - 1142? -1135 In base 2, what is 11111101 + -10011110? 1011111 In base 16, what is e - -2? 10 In base 14, what is -11 + 8? -7 In base 9, what is 38755 - 0? 38755 In base 9, what is -758 - -3? -755 In base 6, what is -10 + 30? 20 In base 2, what is 11001 + -1? 11000 In base 11, what is -62 + 4? -59 In base 3, what is -2 + -10022? -10101 In base 14, what is 3563 + 4? 3567 In base 2, what is 0 + -1101110110? -1101110110 In base 8, what is -27 - -24? -3 In base 3, what is 11 + -202222? -202211 In base 9, what is 0 + -183? -183 In base 8, what is 11676 + 4? 11702 In base 6, what is -15042 + -2? -15044 In base 6, what is 0 - -245? 245 In base 9, what is -4 - 2623? -2627 In base 8, what is -4551 + -11? -4562 In base 16, what is -34 + 5? -2f In base 4, what is -12 - 1001? -1013 In base 11, what is -6 + 436? 430 In base 4, what is 2 - -3310? 3312 In base 7, what is 3432 + 0? 3432 In base 2, what is -1010110110 + 10? -1010110100 In base 11, what is -73 - -12? -61 In base 9, what is 2 - -254? 256 In base 13, what is -129b - -5? -1296 In base 10, what is -963 - -2? -961 In base 8, what is 140 - 144? -4 In base 14, what is -1 - 2abb? -2abc In base 6, what is 5114 - 0? 5114 In base 8, what is -7 - -227? 220 In base 14, what is 55 + 9? 60 In base 4, what is -3 - -1010? 1001 In base 4, what is 1 - 122111? -122110 In base 10, what is 22 + -4? 18 In base 8, what is -24 - -2? -22 In base 8, what is -124 - 76? -222 In base 7, what is 53 + -56? -3 In base 3, what is 20 + -10? 10 In base 7, what is -142 + -4? -146 In base 12, what is 146 - -30? 176 In base 7, what is -4 + -46? -53 In base 9, what is -3 + 745? 742 In base 15, what is 3 + 58? 5b In base 11, what is 24 - -1a? 43 In base 12, what is 68 - -183? 22b In base 9, what is -2 - 2328? -2331 In base 11, what is 3 + 8a2? 8a5 In base 13, what is 3 - -30? 33 In base 15, what is -16 + 7? -e In base 3, what is -120 - 1202? -2022 In base 8, what is 55 + -57? -2 In base 6, what is 0 + 4005? 4005 In base 6, what is -3140 + -24? -3204 In base 16, what is -3 + 1215? 1212 In base 15, what is 2 + -9c? -9a In base 8, what is 447 + -15? 432 In base 13, what is 5 + 7b? 83 In base 4, what is -3202 - -2? -3200 In	{ "pile_set_name": "DM Mathematics" }
What is 2192 to the power of 1/3, to the nearest integer? 13 What is the cube root of 260 to the nearest integer? 6 What is 13683 to the power of 1/2, to the nearest integer? 117 What is the ninth root of 73773 to the nearest integer? 3 What is the tenth root of 9601 to the nearest integer? 3 What is 8322 to the power of 1/9, to the nearest integer? 3 What is the third root of 39204 to the nearest integer? 34 What is 1341 to the power of 1/5, to the nearest integer? 4 What is the square root of 5131 to the nearest integer? 72 What is the square root of 9807 to the nearest integer? 99 What is the seventh root of 39510 to the nearest integer? 5 What is 12772 to the power of 1/2, to the nearest integer? 113 What is the tenth root of 7104 to the nearest integer? 2 What is the square root of 3833 to the nearest integer? 62 What is the square root of 1470 to the nearest integer? 38 What is the ninth root of 8431 to the nearest integer? 3 What is 142 to the power of 1/2, to the nearest integer? 12 What is 28370 to the power of 1/4, to the nearest integer? 13 What is the square root of 1738 to the nearest integer? 42 What is 3874 to the power of 1/2, to the nearest integer? 62 What is 12929 to the power of 1/4, to the nearest integer? 11 What is the fourth root of 9370 to the nearest integer? 10 What is 205 to the power of 1/3, to the nearest integer? 6 What is 19793 to the power of 1/10, to the nearest integer? 3 What is 39035 to the power of 1/2, to the nearest integer? 198 What is the third root of 7995 to the nearest integer? 20 What is the fifth root of 38336 to the nearest integer? 8 What is 6175 to the power of 1/2, to the nearest integer? 79 What is the third root of 2364 to the nearest integer? 13 What is 47081 to the power of 1/2, to the nearest integer? 217 What is 8502 to the power of 1/2, to the nearest integer? 92 What is 14548 to the power of 1/5, to the nearest integer? 7 What is the cube root of 111531 to the nearest integer? 48 What is the cube root of 6199 to the nearest integer? 18 What is the third root of 3111 to the nearest integer? 15 What is the third root of 6924 to the nearest integer? 19 What is the third root of 10762 to the nearest integer? 22 What is 34939 to the power of 1/5, to the nearest integer? 8 What is the ninth root of 30811 to the nearest integer? 3 What is the cube root of 113 to the nearest integer? 5 What is 2833 to the power of 1/2, to the nearest integer? 53 What is the seventh root of 77628 to the nearest integer? 5 What is the cube root of 74245 to the nearest integer? 42 What is the square root of 23266 to the nearest integer? 153 What is 22039 to the power of 1/4, to the nearest integer? 12 What is the square root of 1112 to the nearest integer? 33 What is the square root of 18603 to the nearest integer? 136 What is 757 to the power of 1/2, to the nearest integer? 28 What is 2410 to the power of 1/2, to the nearest integer? 49 What is the seventh root of 2822 to the nearest integer? 3 What is the third root of 873 to the nearest integer? 10 What is the ninth root of 23024 to the nearest integer? 3 What is the third root of 777 to the nearest integer? 9 What is 27766 to the power of 1/3, to the nearest integer? 30 What is 1278 to the power of 1/3, to the nearest integer? 11 What is 1294 to the power of 1/2, to the nearest integer? 36 What is the square root of 1878 to the nearest integer? 43 What is 7846 to the power of 1/2, to the nearest integer? 89 What is the eighth root of 726 to the nearest integer? 2 What is 10944 to the power of 1/6, to the nearest integer? 5 What is the square root of 4285 to the nearest integer? 65 What is the ninth root of 375 to the nearest integer? 2 What is the square root of 9701 to the nearest integer? 98 What is the square root of 62 to the nearest integer? 8 What is 155002 to the power of 1/2, to the nearest integer? 394 What is the cube root of 10259 to the nearest integer? 22 What is the fourth root of 810 to the nearest integer? 5 What is 6332 to the power of 1/8, to the nearest integer? 3 What is the cube root of 4349 to the nearest integer? 16 What is the square root of 2121 to the nearest integer? 46 What is the square root of 8793 to the nearest integer? 94 What is 3367 to the power of 1/2, to the nearest integer? 58 What is 7723 to the power of 1/8, to the nearest integer? 3 What is the ninth root of 134893 to the nearest integer? 4 What is the square root of 18968 to the nearest integer? 138 What is 1310 to the power of 1/2, to the nearest integer? 36 What is 1229 to the power of 1/9, to the nearest integer? 2 What is the square root of 30119 to the nearest integer? 174 What is the third root of 7025 to the nearest integer? 19 What is 147208 to the power of 1/3, to the nearest integer? 53 What is the fourth root of 2012 to the nearest integer? 7 What is the square root of 4268 to the nearest integer? 65 What is 635 to the power of 1/2, to the nearest integer? 25 What is 6071 to the power of 1/3, to the nearest integer? 18 What is the tenth root of 60843 to the nearest integer? 3 What is the third root of 7652 to the nearest integer? 20 What is 505 to the power of 1/7, to the nearest integer? 2 What is 2835 to the power of 1/2, to the nearest integer? 53 What is 1630 to the power of 1/6, to the nearest integer? 3 What is the cube root of 5263 to the nearest integer? 17 What is the square root of 16867 to the nearest integer? 130 What is 2201 to the power of 1/2, to the nearest integer? 47 What is 1350 to the power of 1/10, to the nearest integer? 2 What is 2758 to the power of 1/9, to the nearest integer? 2 What is the cube root of 6740 to the nearest integer? 19 What is the third root of 283 to the nearest integer? 7 What is 622 to the power of 1/6, to the nearest integer? 3 What is the ninth root of 719 to the nearest integer? 2 What is the tenth root of 9038 to the nearest integer? 2 What is the third root of 21738 to the nearest integer? 28 What is 2006 to the power of 1/5, to the nearest integer? 5 What is 12423 to the power of 1/2, to the nearest integer? 111 What is 150297 to the power of 1/2, to the nearest integer? 388 What is 100886 to the power of 1/4, to the nearest integer? 18 What is the square root of 24333 to the nearest integer? 156 What is the eighth root of 5666 to the nearest integer? 3 What is 16658 to the power of 1/6, to the nearest integer? 5 What is 1752 to the power of 1/10, to the nearest integer? 2 What is the cube root of 25866 to the nearest integer? 30 What is 405 to the power of 1/5, to the nearest integer? 3 What is the eighth root of 473 to the nearest integer? 2 What is 5530 to the power of 1/3, to the nearest integer? 18 What is 12432 to the power of 1/5, to the nearest integer? 7 What is the tenth root of 514 to the nearest integer? 2 What is the fifth root of 17271 to the nearest integer? 7 What is 105356 to the power of 1/2, to the nearest integer? 325 What is 15818 to the power of 1/3, to the nearest integer? 25 What is the third root of 11848 to the nearest integer? 23 What is the cube root of 2076 to the nearest integer? 13 What is the third root of 7705 to the nearest integer? 20 What is the square root of 33636 to the nearest integer? 183 What is 1256 to the power of 1/2, to the nearest integer? 35 What is 12500 to the power of 1/4, to the nearest integer? 11 What is the cube root of 1411 to the nearest integer? 11 What is the tenth root of 95877 to the nearest integer? 3 What is the sixth root of 109624 to the nearest integer? 7 What is the cube root of 6914 to the nearest integer? 19 What is the square root of 17392 to the nearest integer? 132 What is 4026 to the power of 1/2, to the nearest integer? 63 What is the seventh root of 1681 to the nearest integer? 3 What is 30539 to the power of 1/3, to the nearest integer? 31 What is 20554 to the power of 1/9, to the nearest integer? 3 What is the tenth root of 1685 to the nearest integer? 2 What is the third root of 865 to the nearest integer? 10 What is the square root of 15906 to the nearest integer? 126 What is 117 to the power of 1/4, to the nearest integer? 3 What is 15475 to the power of 1/3, to the nearest integer? 25 What is 1022 to the power of 1/2, to th	{ "pile_set_name": "DM Mathematics" }
AM? 8:53 PM How many minutes are there between 6:20 AM and 10:03 AM? 223 How many minutes are there between 2:31 AM and 2:51 AM? 20 What is 67 minutes after 11:15 PM? 12:22 AM How many minutes are there between 6:18 AM and 9:40 AM? 202 How many minutes are there between 1:41 AM and 8:09 AM? 388 What is 313 minutes before 11:21 PM? 6:08 PM How many minutes are there between 9:14 AM and 11:36 AM? 142 How many minutes are there between 9:28 AM and 5:50 PM? 502 What is 702 minutes after 6:31 PM? 6:13 AM What is 444 minutes after 12:31 AM? 7:55 AM How many minutes are there between 2:58 AM and 10:37 AM? 459 How many minutes are there between 9:14 AM and 10:17 AM? 63 What is 517 minutes before 3:31 AM? 6:54 PM What is 320 minutes after 4:42 AM? 10:02 AM What is 19 minutes after 2:41 AM? 3:00 AM What is 496 minutes after 2:54 PM? 11:10 PM How many minutes are there between 11:25 PM and 12:55 AM? 90 What is 121 minutes before 12:39 AM? 10:38 PM How many minutes are there between 10:06 AM and 7:38 PM? 572 How many minutes are there between 11:37 AM and 2:22 PM? 165 How many minutes are there between 7:04 PM and 8:59 PM? 115 What is 49 minutes before 1:53 PM? 1:04 PM How many minutes are there between 12:54 AM and 12:58 AM? 4 How many minutes are there between 12:37 PM and 12:56 PM? 19 How many minutes are there between 3:35 AM and 5:50 AM? 135 How many minutes are there between 6:37 PM and 2:13 AM? 456 What is 528 minutes before 8:49 AM? 12:01 AM What is 646 minutes after 2:26 AM? 1:12 PM How many minutes are there between 10:49 PM and 3:42 AM? 293 How many minutes are there between 5:17 AM and 9:17 AM? 240 How many minutes are there between 1:40 PM and 12:41 AM? 661 What is 373 minutes before 11:30 AM? 5:17 AM What is 419 minutes after 11:42 PM? 6:41 AM What is 56 minutes after 6:15 PM? 7:11 PM How many minutes are there between 4:26 PM and 8:09 PM? 223 What is 184 minutes after 6:37 PM? 9:41 PM What is 293 minutes before 5:31 AM? 12:38 AM What is 547 minutes before 4:10 AM? 7:03 PM How many minutes are there between 12:20 PM and 4:59 PM? 279 What is 374 minutes before 2:45 PM? 8:31 AM What is 35 minutes before 5:00 AM? 4:25 AM How many minutes are there between 3:24 AM and 10:33 AM? 429 How many minutes are there between 11:59 PM and 12:19 AM? 20 How many minutes are there between 1:12 AM and 6:05 AM? 293 What is 532 minutes before 2:16 AM? 5:24 PM How many minutes are there between 7:49 AM and 2:30 PM? 401 How many minutes are there between 12:57 AM and 2:41 AM? 104 How many minutes are there between 4:14 AM and 11:04 AM? 410 What is 123 minutes before 12:41 PM? 10:38 AM How many minutes are there between 12:46 PM and 4:42 PM? 236 What is 165 minutes before 2:06 PM? 11:21 AM What is 581 minutes after 7:05 PM? 4:46 AM What is 467 minutes before 6:54 PM? 11:07 AM How many minutes are there between 7:13 AM and 10:44 AM? 211 How many minutes are there between 6:37 PM and 11:50 PM? 313 How many minutes are there between 4:13 AM and 6:49 AM? 156 What is 416 minutes after 2:53 PM? 9:49 PM How many minutes are there between 6:20 PM and 10:33 PM? 253 What is 82 minutes after 2:11 PM? 3:33 PM What is 675 minutes before 8:42 AM? 9:27 PM What is 266 minutes before 11:52 AM? 7:26 AM How many minutes are there between 3:22 PM and 1:09 AM? 587 What is 429 minutes before 2:19 AM? 7:10 PM What is 402 minutes before 7:26 PM? 12:44 PM What is 691 minutes before 12:30 AM? 12:59 PM How many minutes are there between 4:27 AM and 2:03 PM? 576 How many minutes are there between 6:17 AM and 2:11 PM? 474 What is 472 minutes after 5:22 AM? 1:14 PM What is 669 minutes before 7:10 PM? 8:01 AM How many minutes are there between 4:33 PM and 4:52 PM? 19 How many minutes are there between 6:03 PM and 3:15 AM? 552 What is 457 minutes after 8:26 AM? 4:03 PM How many minutes are there between 5:29 PM and 3:16 AM? 587 How many minutes are there between 1:20 AM and 1:04 PM? 704 How many minutes are there between 2:39 PM and 12:50 AM? 611 How many minutes are there between 9:34 AM and 1:54 PM? 260 What is 2 minutes before 7:40 PM? 7:38 PM What is 657 minutes after 9:44 PM? 8:41 AM How many minutes are there between 6:18 AM and 4:05 PM? 587 What is 714 minutes after 10:41 AM? 10:35 PM What is 676 minutes after 4:23 AM? 3:39 PM What is 692 minutes after 6:44 PM? 6:16 AM How many minutes are there between 6:12 PM and 9:26 PM? 194 What is 304 minutes after 9:43 PM? 2:47 AM How many minutes are there between 9:30 PM and 1:36 AM? 246 What is 96 minutes after 9:22 PM? 10:58 PM What is 466 minutes after 7:56 AM? 3:42 PM What is 292 minutes before 3:25 PM? 10:33 AM How many minutes are there between 11:30 PM and 6:29 AM? 419 How many minutes are there between 2:17 AM and 12:22 PM? 605 How many minutes are there between 9:53 PM and 11:48 PM? 115 How many minutes are there between 11:36 AM and 7:02 PM? 446 How many minutes are there between 12:29 AM and 5:47 AM? 318 What is 631 minutes before 6:10 PM? 7:39 AM How many minutes are there between 11:22 AM and 5:07 PM? 345 What is 71 minutes before 9:51 AM? 8:40 AM What is 101 minutes before 7:39 PM? 5:58 PM How many minutes are there between 6:06 PM and 10:02 PM? 236 What is 274 minutes after 2:35 AM? 7:09 AM What is 250 minutes after 3:11 AM? 7:21 AM What is 385 minutes before 6:51 AM? 12:26 AM How many minutes are there between 1:17 AM and 7:48 AM? 391 What is 36 minutes before 1:34 PM? 12:58 PM What is 39 minutes after 2:06 AM? 2:45 AM What is 292 minutes before 6:01 PM? 1:09 PM How many minutes are there between 5:31 PM and 10:31 PM? 300 How many minutes are there between 1:36 PM and 5:00 PM? 204 What is 583 minutes before 2:22 PM? 4:39 AM How many minutes are there between 4:15 PM and 11:15 PM? 420 What is 488 minutes after 2:43 AM? 10:51 AM What is 526 minutes after 7:39 PM? 4:25 AM What is 408 minutes before 8:43 AM? 1:55 AM How many minutes are there between 6:08 AM and 4:42 PM? 634 How many minutes are there between 8:30 AM and 12:55 PM? 265 How many minutes are there between 11:31 PM and 7:25 AM? 474 What is 581 minutes after 6:00 PM? 3:41 AM How many minutes are there between 8:27 AM and 6:26 PM? 599 How many minutes are there between 8:40 AM and 12:44 PM? 244 What is 127 minutes before 8:21 AM? 6:14 AM How many minutes are there between 5:54 PM and 12:08 AM? 374 What is 144 minutes after 2:16 PM? 4:40 PM What is 4 minutes after 11:57 PM? 12:01 AM How many minutes are there between 1:24 AM and 3:39 AM? 135 How many minutes are there between 12:07 PM and 5:17 PM? 310 What is 708 minutes after 7:06 AM? 6:54 PM How many minutes are there between 11:46 PM and 10:27 AM? 641 What is 367 minutes after 12:54 PM? 7:01 PM How many minutes are there between 1:43 AM and 6:22 AM? 279 What is 680 minutes after 10:21 PM? 9:41 AM What is 689 minutes before 10:35 AM? 11:06 PM What is 428 minutes before 9:03 PM? 1:55 PM What is 582 minutes after 8:29 PM? 6:11 AM What is 676 minutes before 8:52 PM? 9:36 AM What is 661 minutes after 2:48 AM? 1:49 PM How many minutes are there between 3:37 PM and 6:51 PM? 194 What is 707 minutes after 6:10 AM? 5:57 PM What is 52 minutes before 7:56 AM? 7:04 AM How many minutes are there between 3:25 AM and 9:32 AM? 367 What is 391 minutes after 8:10 PM? 2:41 AM What is 323 minutes after 7:14 AM? 12:37 PM How many minutes are there between 11:37 AM and 4:07 PM? 270 What is 532 minutes after 2:51 AM? 11:43 AM What is 457 minutes after 12:01 PM? 7:38 PM What is 429 minutes before 7:47 PM? 12:38 PM How many minutes are there between 10:52 PM and 5:37 AM? 405 How many minutes are there between 12:53 PM and 4:08 PM? 195 How many minutes are there between 8:49 PM and 5:41 AM? 532 What is 145 minutes after 5:17 AM? 7:42 AM What is 687 minutes before 3:47 PM? 4:20 AM What is 323 minutes after 7:54 AM? 1:17 PM What is 429 minutes after 1:44 AM? 8:53 AM What is 564 minutes before 11:30 PM? 2:06 PM How many minutes are there between 2:03 PM and 3:47 PM? 104 What is 195 minutes after 2:09 AM? 5:24 AM How many minutes are there between 5:42 AM and 12:46 PM? 424 What is 667 minutes before 9:28 PM? 10:21 AM How many minutes are there between 5:27 PM and 11:58 PM? 391 How many minutes are there between 6:33 PM and 9:34 PM? 181 How many mi	{ "pile_set_name": "DM Mathematics" }
1034. Is d a prime number? False Suppose 5o - 5 = 15. Suppose -b - 242 = -g - ob, -4b = 20. Is g prime? True Suppose -28w + 10844 = -136464. Is w a prime number? True Suppose 4c - 376 = -2k, 4c + 711 = 4k - 5. Suppose 2g - k = 144. Is g a composite number? False Let h(b) = b3 + 4b*2 + b + 4. Let y be h(-4). Let g(m) = 19 + ym + 2m - m + 3m. Is g(9) prime? False Let c(b) = 12b3 - 106b*2 + 3b - 28. Is c(19) a prime number? True Suppose 15 = a + 12. Suppose -275 = 5k + 5y, -4y + 0y = ak + 167. Let j = k - -111. Is j composite? True Suppose -8a + 1213 = -5627. Suppose 0 = 5y - 2m - 744 - a, -m = y - 317. Let t = y - -598. Is t composite? True Is 1341/1 + 17 + -11 composite? True Suppose -713b - 49287 = -716b. Is b prime? False Let i = 0 - -2. Suppose 46 = ip + 3x, 4p + 0x = 2x + 92. Let t = -4 + p. Is t a prime number? True Is (9 - 7)2037/6 a prime number? False Let f(k) = 10 + k*2 - 2 + 757k*3 + 3k - 758k3. Is f(-7) a composite number? False Let i = 17205 - -9288. Is i a composite number? True Is 748/22892/8 a prime number? False Is 17 - (-1245435)/21 - (-3)/(-7) prime? False Suppose 11m + 5337 - 19384 = 0. Is m composite? False Let x(q) = 3q + 14. Let p be x(-5). Is (p/(-3))/(-1) - 4864/(-3) a prime number? True Suppose -5364 = 5y - 17y. Is y composite? True Suppose 6n - 5823 - 4563 = 0. Is n a prime number? False Let b be (-2)/(-18) + (-368)/72. Is 2016/60 - 2/b composite? True Let u = 42362 + -25639. Is u composite? True Let n be 2/(-8) - (-90)/40. Suppose -nv + 2l - 3l = -823, v - 5l = 384. Is v a composite number? False Let w(m) be the third derivative of m4/24 - 2m*3/3 - 4m*2. Let y be w(5). Is (y - -21)/(2/19) prime? False Suppose -5i = -2d - 19, 7 = 3i + 2d + 2. Suppose -5b = -b + 3m - 8, 2b - 3m = 4. Suppose 91 = v + bu, 5v - iu + 221 = 650. Is v prime? False Let z(p) = -p*3 - 7p*2 - 3p - 2. Let a be ((-39)/9)/((-6)/18). Suppose -5u + 3o = 20, 4u = -3o + 6o - a. Is z(u) a prime number? True Suppose 3n + 159 = 5w - 118, 346 = -4n - 5w. Let q = n + 406. Is q prime? True Let g = -30 + 35. Suppose 2q - 160 = 3y, 58 = q + gy - y. Is q prime? False Let b be (12/8 - 2)-530. Suppose -3x + b = -77. Suppose 0 = -r - r + x. Is r prime? False Let b(v) = -v3 - v2. Let n be ((-1 - -3) + -2)/1. Let x be b(n). Suppose -4k + 0d + 3d = -154, -5d - 10 = x. Is k a composite number? False Let r be (3/9)/((-71)/24 + 3). Let t(b) = -7b + 3. Let i(p) = -28p + 12. Let c(u) = 2i(u) - 9t(u). Is c(r) composite? False Is (147588/30 - 1)5 prime? True Let t = 3491 - -446. Is t a composite number? True Is (1/3)/(5/82785) a composite number? False Let p = 9 - 3. Suppose -d + 4d - p = 0. Suppose -df + 74 + 0 = 0. Is f composite? False Let m(b) = 3b*3 - 40b*2 + 143b + 27. Is m(28) a prime number? False Suppose 2598 = 6q - 102. Is (-5)/((-15)/(-12)) + q a composite number? True Let r(t) = 82t + 8. Let y be (-1)/(20/(-12)(-2)/(-10)). Is r(y) prime? False Let m(k) = -2k*3 - 5k*2 + 5k + 1. Let g be m(-5). Suppose 0 = 2x - 103 - g. Let n = 185 - x. Is n a composite number? False Suppose 6h + 8 - 32 = 0. Let u(s) = -s*3 + 6s*2 - 4s - 2. Let x be u(5). Is (x - (-166)/h)6 a composite number? True Let o(p) = 2p - 4. Let j be o(10). Let f be (j/6)/((-3)/(-18)). Suppose -w + f = 3. Is w prime? True Let k(c) = 3c2 - c - 1. Let v be k(-1). Suppose -6s + vs = -o - 2084, 0 = -4s - 5o + 2785. Is s a composite number? True Suppose -3k = -11k. Let l(o) = -2o + 59. Is l(k) composite? False Let q(x) = x3 + x2 - 60. Let a be q(0). Let w = a + 19. Let t = w - -376. Is t composite? True Suppose 0 = 11f - 20f + 12249. Is f prime? True Suppose -a - 2 = m, -5a + 10 = -4m - m. Let x be (-1266 - a)/(6/(-4)). Let l = -463 + x. Is l a prime number? False Let d(q) = -q*2 + q. Let z be d(2). Is 1694 - (-6)/(-3) - (z + 1) composite? False Suppose 0 = -114s + 125s - 185273. Is s composite? False Suppose 19w - 141554 - 273387 = 0. Is w a composite number? False Suppose 24535 = 17r + 18r. Is r a composite number? False Let f = -4202 + 8403. Is f a prime number? True Suppose 9f = -2g + 10f + 5929, -4f - 14821 = -5g. Is g a composite number? True Suppose 1582 = -185v + 187v. Is v composite? True Suppose -16f + 17f - 1 = 0. Is (38 - -1865)/(-1 + f2) a composite number? True Let g = 655 + -312. Suppose 2p = -2p + 2376. Let z = p - g. Is z a prime number? True Let h = -73 - -57. Let b(y) = -60y - 39. Is b(h) prime? False Suppose 5l - 72 + 17 = 5h, -2h = 2l + 2. Let x(n) = n + 3. Let k be x(h). Is -2 - (-60 + k)/3 a composite number? False Let q(u) = 11u - 2. Let f(v) = v*3 - 6v*2 - v + 7. Let c be f(6). Let l be q(c). Is (l/(-27))/(2/(-534)) prime? True Suppose 0 = 3o - 3h - 4707, -2h + 5h = o - 1559. Suppose -3y - 173 = -o. Is y a composite number? False Is 740865/19 + (-1 - (-252)/228) a composite number? False Let n be 6/27 + (-512)/36. Let o(y) = -y*3 - 14y*2 - 2y - 21. Let k be o(n). Is 51(-3)/((-9)/k) a prime number? False Let k(j) = j3 - j2 - j + 1. Let g(q) = -q3 + 6q*2 + 6q + 7. Let l be g(7). Let i be k(l). Is i + (-12)/(-2)9 a composite number? True Suppose w - 2w - 770 = 0. Let x = 3814 + w. Suppose 2y + 2y - x = 0. Is y a composite number? False Let u(v) = -9v3 + v2. Let j be u(-1). Let m be (-2)/j - 48438/(-15). Suppose 0w - 2r = 5w - m, 3w - 2r - 1947 = 0. Is w prime? True Suppose -9858 - 7021 = -u. Is u a prime number? True Let v(k) = k + 27. Let y be v(-18). Let o(c) = 5c2 + 27c - 13. Is o(y) composite? True Suppose 0 = -5y + 5d, -5d - 1 = 4y - 10. Is ((-4197)/(-9))/(y/3) prime? True Let f(o) = -10o3 - 4o*2 - 3o - 4. Let p be f(-3). Suppose 2q - p = 207. Suppose -q = 10r - 11r. Is r prime? True Let k(q) = -q3 + 8q*2 + 12q - 11. Let o be k(8). Suppose 0 = -5a + 4p + 2, -a - 5p = -3a - 6. Suppose aj = j + o. Is j composite? True Suppose 596154 = 73d - 47d. Is d composite? True Let c(x) = 97 + 83x - 44x - 37x. Is c(0) a composite number? False Let y = 21993 - 8684. Is y prime? True Let c(s) = 27s - 1. Let r be c(-1). Let g = -15 - r. Is g prime? True Is (1 + -2)/(465201/116301 - 4) composite? False Let o = 109 - 28. Let u be (-1412/3)/2. Let q = o + u. Is q prime? False Let w(g) be the second derivative of -g*5/20 - 2g*4/3 - g. Let y be w(-8). Suppose 3d + 0d - 471 = y. Is d prime? True Suppose -3s = 23s - 131326. Is s a prime number? True Suppose 11m + 7m = 53766. Is m composite? True Let v(z) = -z3 + 5z*2 + 3z + 2. Let t be v(5). Let o = t + -15. Suppose 0 = -og + g + 1141. Is g a composite number? True Let s = 37985 - -2324. Is s prime? False Suppose -79329 - 35415 = -56r. Is r prime? False Let o(d) = d*3 + 18d*2 - 2d + 2. Let t be o(-18). Suppose 2s - t = 558. Is s prime? False Let m(l) = -3l*3 + l + 2. Let f be m(2). Let k = f - 19. Is k(10/6 + -2) a composite number? False Let a be 11/(-77) + (-170)/(-14). Let c = -19 + a. Is (-694)/(-8) + c/(-28) a composite number? True Is (5 - (-144)/(-30)) + (-246456)/(-20) a prime number? True Let w(d) = -d*3 - 13d*2 + 13d - 7. Let b be w(-14). Let p = b + 19. Is p prime? False Let z = -233 + 526. Is z a composite number? False Suppose 3d + 2d + 29700 = 0. Let j be d/(-70) + (-2)/(-14). Suppose j = 3z - 518. Is z prime? False Let d(w) = -918w + 67. Is d(-35) prime? False Let i(h) = 3 - h*3 + 1 + 2h*2 + 2h - 1. Is i(-4) a prime number? False Suppose -m + 665 - 108 = 0. Suppose 26 = -2y + 694. Let n = m - y. Is n prime? True Suppose 7 = -r - 14. Is (r/(-7))/(3/77) prime? False Suppose 5h = 2z + 3h - 9998, -5h = -4z + 19996. Is z a composite number? False Let m = 9970 - 5819. Is m a prime number? False Let m(i) = -i*2 + 4i + 7. Let y be m(6). Is y/(25/20) - -1287 a composite number? False Let u be ((-55)/22)/(2/(-1532)). Suppose 2f = -4i + 1278, -3f + 6f - u = -5i. Let r = f - 100. Is r prime? False Let d = -110771 - -173950. Is d prime? True Let z = 6 + -3. Suppose 0f - 2f - zv - 6 = 0, -v - 2 = -2f. Suppose -r - k + 5k + 37 = 0, 2r + 5k - 22 = f. Is r a prime number? False Suppose 4i + 5092 = 4d, 4d - 5100 = 2i - 0i. Is d a prime number? True Suppose 2g +	{ "pile_set_name": "DM Mathematics" }
ose 0 = -85q - 830 + 35170. What are the prime factors of q? 2, 101 Suppose -6f + 2156 = x - 3095, 0 = -5x + 5. List the prime factors of f. 5, 7 List the prime factors of 4/(-7) + 26252/28. 937 Suppose -f - 4f = -100. Suppose -f = -d - 3d. Suppose 0 = -2i + 2, -160 = -2y - 3y + di. List the prime factors of y. 3, 11 Let v(p) = -13p*2 + 9p + 4. Let u(o) = -38o2 + 26o + 12. Let x(f) = -6u(f) + 17v(f). List the prime factors of x(-3). 2, 17 Let k(o) = -2o - 23. Let a be k(-13). Let p be 1/(a/30) - 0. Suppose 2x = 5z + 107, -48 = -x + 4z + p. What are the prime factors of x? 2, 23 Let f = 2042 + -1303. List the prime factors of f. 739 Let l(c) = -c*2 - 5c - 4. Let o be l(-3). Suppose 4b - 2b - 6 = 0. Suppose -bt = 2z - 64, -2t - 4z = ot - 92. List the prime factors of t. 2, 3 Let k = 60 + 246. List the prime factors of k. 2, 3, 17 Let v be (-1 - 2 - -4)(-2 + 824). Suppose v + 96 = 6a. What are the prime factors of a? 3, 17 Suppose 14u - 2512 = 2668. List the prime factors of u. 2, 5, 37 Let s be 34/6 - 2/3. Let t(g) be the second derivative of 8g3/3 - 17g*2/2 + 130g. What are the prime factors of t(s)? 3, 7 Let r be 30/(-40) - 58/8. List the prime factors of ((-4)/r107)/((-3)/(-6)). 107 Let k(i) = i2 + 2i + 2. Let v be k(-2). Suppose -vy - 1688 = 3y - 3b, 0 = 3y - b + 1016. List the prime factors of 7/(-2)y/35. 2, 17 Let d = 8 + -15. Let x = 81 - 83. Let s = x - d. What are the prime factors of s? 5 Let c(g) = g3 - 5g*2 - 6g - 8. Let d be c(6). Let n = -5 - d. What are the prime factors of (11 - 2) + -3 + n? 3 Let r(a) = -4a3 - 4a*2 + 18a + 51. What are the prime factors of r(-10)? 3, 13, 89 Let q(k) = 7k2 + 19k + 7. List the prime factors of q(-11). 3, 5, 43 Suppose 5l + 0l = 3t + 19, 2l = -2t + 14. What are the prime factors of (200/(-12))/(152/78 - t)? 5, 13 Let h = 17 + -17. Suppose -37 = -3u + 4c - hc, 5c = 10. List the prime factors of -219(-5)/u1. 73 Let n = 2476 + -1408. List the prime factors of n. 2, 3, 89 Suppose 4790 = 16h - 6426. List the prime factors of h. 701 Let s = -146 + 272. List the prime factors of s. 2, 3, 7 Suppose -39 = 2g - 9. Let h = 37 + g. Let a = h - 16. What are the prime factors of a? 2, 3 Let p = 608 - 582. List the prime factors of p. 2, 13 Suppose -4k - 13 = -2w - 5k, 3w - 4k = -8. Suppose wo - 23 = 85. Let v = 66 - o. List the prime factors of v. 3, 13 Let k(r) be the third derivative of 0 - 1/10r*5 + 1/120r*6 + 0r - 1/12r4 - 7r*2 - 2/3r3. What are the prime factors of k(7)? 31 Let w(x) be the third derivative of x5/60 - 2x4/3 - x3/2 + x2. Suppose -m = -3z - 3m + 44, -z + 2m + 28 = 0. List the prime factors of w(z). 3, 11 Let d = -10 - -15. Let f be -23/(-6)41. Suppose do - f = 4o. What are the prime factors of o? 41 Let o(n) = 4n + 2. Suppose 4r = r + x - 3, 12 = 4x. List the prime factors of o(r). 2 Let g = 89 + -87. Suppose 2q + 2q = -20, 3u = gq + 130. What are the prime factors of u? 2, 5 Suppose -5z + 9z = 128. Let h be (z/(-5))/((-5)/25). Suppose 24 + h = 4a. What are the prime factors of a? 2, 7 What are the prime factors of -4 - (3 + 1 + 3 + -449)? 2, 3, 73 Let t(s) = -3s - 5. Let q be t(-3). Suppose 0 = -9i + qi + 175. What are the prime factors of i? 5, 7 Let l(i) = 3i*2 - 71i - 50. List the prime factors of l(26). 2, 3, 11 Let k(i) = -i*2 + 11i + 15. Let c be k(12). Let m(q) = -q + 4. Let u be m(c). Let a = 3 - u. What are the prime factors of a? 2 Let k(w) = -w*3 + 4w*2 - w + 20. Let r be k(0). Let s = 6 + -3. Suppose sx = -r + 236. List the prime factors of x. 2, 3 Let a = -3 - -20. Suppose 2j + 27 - 105 = -5h, 4h + 140 = 3j. Let l = j - a. List the prime factors of l. 3 Let j(t) = -4t3 + 13t*2 - 16t - 11. List the prime factors of j(-9). 2, 7, 293 What are the prime factors of (-48)/9 - -6 - (-490)/3? 2, 41 Let c(a) = -17a + 124. What are the prime factors of c(-14)? 2, 181 Suppose v - 145 = -2l, 104 - 317 = -3l + 3v. Let m = -134 + 89. Let r = l + m. What are the prime factors of r? 3 Suppose 0 = 5f + 10, 4f - 43 = -3n + 171. Let t = 106 - n. List the prime factors of t. 2 Suppose 5v - 12199 = -25b + 21b, -b = 4v - 9768. What are the prime factors of v? 7, 349 Suppose 0 = -67q - 22144 + 99529. What are the prime factors of q? 3, 5, 7, 11 Let g(z) = 21z2 + 5z + 1. What are the prime factors of g(-6)? 727 Suppose -939 + 199 = -4p - 4n, -p - 3n = -181. List the prime factors of p. 11, 17 Let j = -100 - -106. Let h(v) = -v3 + 4v*2 + 6v - 3. Let t be h(5). Suppose -28 = -tq + j. What are the prime factors of q? 17 Let d(y) = -y3 + 17y*2 - 22y - 12. Let h be d(12). Let u = h + -281. What are the prime factors of u? 163 Let l(a) = -a*2 - 8a - 8. Let z be l(-5). Let f(d) = 3d2 - 6d + 2. Let j be f(z). Suppose -5y + j = -83. What are the prime factors of y? 2, 19 What are the prime factors of (121/2 + 1)/((-37)/(-592))? 2, 3, 41 Suppose 0 = 3q - 255 - 249. Suppose 5n - q - 302 = 0. List the prime factors of n. 2, 47 Let n(l) be the third derivative of -l5/60 + 3l4/8 + l3/3 + 3l2. List the prime factors of n(4). 2, 11 Suppose -4r + 26 = -2r + 5x, 20 = 2r + 2x. Suppose -rf + 6f = -4. What are the prime factors of 130/(-20)f-1? 13 Let q = -10 - -7. Let h be 4/(0 - 1 - q). Suppose 3s - hx - 15 - 1 = 0, 0 = -x - 2. What are the prime factors of s? 2 Suppose 2r + 2l = -2r + 38, 3r - 26 = -l. Suppose rs - 4s = 27. What are the prime factors of s? 3 Let j = -12 - -16. Suppose -340 = -jr + z, 6r = r + 3z + 425. List the prime factors of r. 5, 17 Let s be -1214/(-4). List the prime factors of (620/16)/(s/16). 2, 5, 31 Suppose -2d + 2645 = 5y, 4y - 3 = -7. List the prime factors of d. 5, 53 Suppose t + 4i = 186, -7i + 11i + 1002 = 5t. What are the prime factors of t? 2, 3, 11 Let q = -19 + -18. Suppose -20n = -28n + 512. Let g = q + n. What are the prime factors of g? 3 Let n be ((-19)/(-3))/(3/54). Let o = -41 + n. List the prime factors of o. 73 List the prime factors of (3 - -146)/(-4 + 5). 149 Let d(a) = -a3 - 8a*2 - a - 11. Let q be d(-8). What are the prime factors of q/(-9) - (-1614)/18? 2, 3, 5 Let t = 30 + -18. Let s(a) = -5a - 6. Let j be s(t). Let p = -33 - j. List the prime factors of p. 3, 11 Suppose k - 2951 = -3j, j = -78k + 83k + 973. List the prime factors of j. 983 Let q(w) = w2 - 8w - 10. Let k be q(9). What are the prime factors of ((-54)/4 - k)-2? 5 Let b be (-66)/(-18)(-6)/2. Let a = -16 - b. Let c(u) = 2u2 - 3u - 6. List the prime factors of c(a). 59 Let v(k) = 4k2 - 10k - 41. What are the prime factors of v(18)? 5, 43 Let r be -10 + 15 - (2 - 1). Suppose -rj + 4o = -2j - 466, 3j = -5o + 754. List the prime factors of j. 3 Let i = -30 - 9. Let c = -644 - -654. List the prime factors of 1 - i - (-10)/c. 41 Let s = -175 - -185. What are the prime factors of s? 2, 5 Let g = -78 - -78. Suppose -3m + 4z = -327 - 92, g = -z - 2. What are the prime factors of m? 137 Suppose -3o + 9 = -2o + 2a, a + 20 = 3o. Let r = o - -9. Let u = r - 11. List the prime factors of u. 5 Let n(q) = -17q*3 + 4. List the prime factors of n(-4). 2, 3, 7, 13 Let h be (-92)/(-15) - 2/15. Let k(j) = 18j + 16. List the prime factors of k(h). 2, 31 Let d be (-2)/(-3) - 5278/42. Let q = 275 + d. Suppose 0 = 5u + n - q, 0u + 2n = 2u - 48. What are the prime factors of u? 29 Let s(z) = -3z3 - z2 + 6z + 4. List the prime factors of s(-5). 2, 3 List the prime factors of ((-341)/(-33) + -11)/((-2)/2469). 823 Suppose -2k - 4f + 2f - 6 = 0, -6 = -5k + 2f. Suppose -j + 0j + 23 = k. Let l = -14 + j. List the prime factors of l. 3 List the prime factors of (-4)/(-1)(-4688)/(-32). 2, 293 Let n be -4 - -3 - (-15 + -4). Let x(p) = -p2 + 7p + 4. Let r be x(6). Suppose 0 = 4j + r - n. What are the prime factors of j? 2 Let f = 50 - 36. Let l(n) = n3 - 14n2 + n - 17. Let o be l(f). What are the prime factors of 3 + o/((-6)/44)? 5 Let i = -30 + 34. What are the prime factors of ((-328)/i)/(1/((-1)/2))? 41 Let z(j) = j2 - 11j + 14. Let p be z(10). List the prime factors of (-8734)/(-121) + p/(-22). 2, 3 Let v be -2 + (-2 - (-63 - 1)). Suppose -a = -5s + 3*	{ "pile_set_name": "DM Mathematics" }
1161u3 + 3550? 3483u*2 Find the third derivative of -909a*3x2 + a2x2 - 77x*2 + x wrt a. -5454x*2 Find the third derivative of 3muv*3z*2 - muv - 4mv3z*2 - 2mv2z - mv2 - 10uz2 + 22v3 - z2 wrt v. 18muz2 - 24mz2 + 132 What is the second derivative of 102h*2r*2 + 8h*2r + 2hr*5 - hr*3 + 7 wrt r? 204h*2 + 40hr3 - 6hr Find the second derivative of -1932q*4 - 2101q wrt q. -23184q2 What is the derivative of 198qz + 2q - 153z - 3 wrt q? 198z + 2 What is the second derivative of -23905a2y + 18ay + a - y - 12 wrt a? -47810y What is the first derivative of 4g*2n + 173g2 - 2gn + 511n + 5 wrt g? 8gn + 346g - 2n What is the second derivative of 9t4 - 14t*3 + 4t*2 + 35t + 92 wrt t? 108t2 - 84t + 8 Find the first derivative of 988j2l + 492j2 wrt l. 988j*2 Find the third derivative of 3556c*5 - 2c*2 - 2c + 364. 213360c2 Find the first derivative of -42v*2 + 18v - 1508. -84v + 18 What is the first derivative of -dg*2 + dg - 520d - 79g*3 wrt g? -2dg + d - 237g*2 What is the first derivative of -97kw + 819k - 3w + 1 wrt w? -97k - 3 Find the third derivative of 1324h3 - 77h*2 + 6h wrt h. 7944 Find the second derivative of -230d3 + 2d*2 + 1904d wrt d. -1380d + 4 Differentiate 4l*4o - 94l3o + 3450o wrt l. 16l*3o - 282l2o What is the first derivative of -11997q2 + q + 4011 wrt q? -23994q + 1 What is the first derivative of -330j + 622 wrt j? -330 What is the derivative of -169c*2t2 - c2 - 2ct*3 + 272 wrt t? -338c*2t - 6ct*2 Find the third derivative of 48r*3t*3w2 + r3tw2 + r2t3w*2 - 2r*2tw - 11w*2 wrt r. 288t*3w*2 + 6tw2 Find the third derivative of -i4r - 3i4 - 3i*3r + 9i3 + i2r + 2194i2 + 2 wrt i. -24ir - 72i - 18r + 54 What is the third derivative of 22g*2y*3 - 382g*2y*2 - gy*3 + 19y*3 - 2y*2 wrt y? 132g*2 - 6g + 114 What is the third derivative of -821z5 - 342z*2 - 2 wrt z? -49260z*2 Find the second derivative of 80b5 + b3 - 158b. 1600b*3 + 6b Differentiate -1079fq*3 - 2fqw + 567fw + 2f + w - 1 with respect to q. -3237fq2 - 2fw What is the first derivative of -9moq - 2mot + 36mq2t - 2oq*2 + 2q*2t - q*2 - 2q wrt o? -9mq - 2mt - 2q2 What is the first derivative of -1745j + 1500 wrt j? -1745 Find the first derivative of -1638h2j*3 + 2969h*2 + 5hj3 + 3 wrt j. -4914h*2j*2 + 15hj2 What is the third derivative of -35i*2q*6 + 99i*2q*3 + 9i*2q*2 - 47iq2 + 5iq wrt q? -4200i*2q*3 + 594i*2 Find the first derivative of -6851r*3 + 21835. -20553r*2 What is the second derivative of 10n*2y*2z - 24n2yz + n2 + ny*2z - 554ny*2 + z wrt n? 20y*2z - 48yz + 2 Find the second derivative of r*4 + 4894r3 - r2 + 225r wrt r. 12r*2 + 29364r - 2 Find the third derivative of 114h3 + 9h*2 + 5h wrt h. 684 Find the third derivative of -5l6 + 3l*2 - 33l. -600l3 What is the second derivative of -g3w*2 - 2g*3w + 3g3 - 71g*2w - 3g2 - 1290gw2 - 6w*2 wrt w? -2g*3 - 2580g - 12 What is the second derivative of i*4 + 25i*2 - 673i wrt i? 12i2 + 50 What is the third derivative of -460k*6 + 405k*2? -55200k*3 What is the second derivative of 21v*5 - 41v - 1 wrt v? 420v3 What is the second derivative of 332y5 - y4 - 344y? 6640y*3 - 12y*2 What is the second derivative of 5k*3s + k*2s + 29k2 - 96ks + 41s wrt k? 30ks + 2s + 58 What is the first derivative of -5171g + 4435 wrt g? -5171 Find the third derivative of 15g3w3 - g3 - 184g2w*2 + 5gw5 - 2w*4 wrt w. 90g*3 + 300gw2 - 48w What is the second derivative of -d*4jw + 28d*2j3 - d2w + 4dj3 - 47dj2 + 2j*3w wrt d? -12d2jw + 56j*3 - 2w What is the third derivative of 378x6 + x2 - 181x? 45360x3 What is the second derivative of -n3y + 5n3 + 3n*2y + 4ny + 4y wrt n? -6ny + 30n + 6y Find the third derivative of -b3kw3 + 83b*3kw + 12b*3w*3 - 2b*2w*2 + 15bkw*3 + 19w*3 wrt b. -6kw3 + 498kw + 72w*3 What is the first derivative of -3240r*2 + 62? -6480r Find the second derivative of -a*5 + 210a*2 - 205a wrt a. -20a3 + 420 Find the third derivative of 35u*4 - 3u*3 + 169u*2 wrt u. 840u - 18 What is the third derivative of 1413k3 - 1022k*2 wrt k? 8478 What is the first derivative of -608g*2o*3 - 620g*2 wrt o? -1824g*2o*2 Find the second derivative of -11690p*3 + 20124p wrt p. -70140p What is the second derivative of -60n*2 - 10n + 6? -120 Differentiate g*2iz - 4g*2z + 48gi - 22iz - 2i + 12z wrt g. 2giz - 8gz + 48i What is the first derivative of 23adw2 + 2aw2 + aw - 3dw*2 + 3w*2 + 2w wrt a? 23dw*2 + 2w*2 + w Differentiate 25w - 113 with respect to w. 25 Find the first derivative of 32p3s*3 - 12s*3 - 11s wrt p. 96p2s*3 Find the third derivative of 3bd2l*4 - 21bd2 - 2bl2 + 251dl4 - 16l*2 wrt l. 72bd2l + 6024dl Find the third derivative of u*4 - 763u*3 + 16u*2 - 14u - 3 wrt u. 24u - 4578 What is the derivative of 3rw3 - ry + 58r + w3y - 3w2y wrt w? 9rw*2 + 3w*2y - 6wy What is the first derivative of 4t3 - 365t - 7345 wrt t? 12t2 - 365 What is the third derivative of 39n*3 + 36n*2 - n? 234 Find the second derivative of 32p*5 - 2p*3v - p*2v - 4pv - 42v wrt p. 640p*3 - 12pv - 2v Find the second derivative of 11rt*3 - 5rt2 + rt - 2t3 - 272t wrt t. 66rt - 10r - 12t What is the first derivative of 44g3tw - 3gt + gw - 5tw - 10w wrt g? 132g*2tw - 3t + w What is the first derivative of -74k3 - k - 107? -222k*2 - 1 Find the third derivative of -3923v*5 - 2v*2 + 271v. -235380v2 Differentiate -84d*4z - d*4 + 888z with respect to d. -336d3z - 4d3 Find the first derivative of -r2u*2 - 26r*2 + 88u*2 wrt u. -2r*2u + 176u What is the first derivative of c3m - 216c3 - 202c*2m2 wrt m? c3 - 404c2m What is the first derivative of 2ms*3 + 95ms + 4s*3 - 6s*2 wrt m? 2s*3 + 95s Find the second derivative of -12j2l*3 - 184j*2l*2 - 2j*2l + 2jl*3 + 234j wrt l. -72j2l - 368j2 + 12jl Differentiate 13a*2i*2 + 2a*2k - a*2 - 4ai2k*2 - 2a + 3i2k*2 with respect to k. 2a*2 - 8ai2k + 6i2k Find the first derivative of -322b - 180 wrt b. -322 Differentiate 15h*4 + 76h*2 + 2239. 60h*3 + 152h What is the derivative of 99j + 266? 99 What is the second derivative of 2d*3m*5 + 7d*3mo + 6dm - 3do + 135m*3o wrt m? 40d3m*3 + 810mo What is the third derivative of 7325x*5 + 17x*2 + 5x + 26? 439500x2 Find the first derivative of 2l*4 + 2446l*3 - 5026 wrt l. 8l*3 + 7338l*2 What is the second derivative of -150k*3y*2 - 4k*3 - ky3 + y2 - 56y wrt y? -300k*3 - 6ky + 2 Find the second derivative of 2a*3t*5 - 1555a*3 - 2a*2t - 526at4 + t2 wrt t. 40a3t*3 - 6312at2 + 2 Find the second derivative of -10t*4 - 79t*3 - 1846t wrt t. -120t2 - 474t Find the second derivative of 12b2d3 + b2d2 - 68b - 2d3 wrt b. 24d*3 + 2d2 What is the third derivative of m5t + 3m*3t*2 + 27m*3 + 10m2 - t2 wrt m? 60m2t + 18t2 + 162 What is the third derivative of -326bny*3 - bny2 - 10by2 - b - ny*3 + 5ny2 wrt y? -1956bn - 6n Find the third derivative of 7078y5 - 4y*2 + 1485y wrt y. 424680y2 Differentiate -3932i*2 + 3077 wrt i. -7864i Differentiate -4056q + 7818. -4056 Differentiate -2627j*3 - 1314 with respect to j. -7881j*2 Find the first derivative of -1221n + 518 wrt n. -1221 What is the third derivative of -4q3 - 4759q*2 wrt q? -24 What is the derivative of -2h*2i - 78h2 + 2hi3 - 2h + 100i3 wrt i? -2h*2 + 6hi2 + 300i*2 Find the second derivative of 3b*5i - 11b2q + 8biq + 2bi - 2bq wrt b. 60b*3i - 22*q Find the first deriva	{ "pile_set_name": "DM Mathematics" }
. Let c be a(3). Let v be 7/((-14)/3)2. Calculate the remainder when -1 + v(c - 13) is divided by 10. 9 Suppose -452 = -3f + h - 2h, 5f + 4h = 751. Suppose 6r = r + 5n - 115, 5r + 105 = 3n. What is the remainder when 66 is divided by f/9 - 4/r? 15 Let m(r) = -r*3 + 7r*2 - 2r + 6. Let z be m(7). Let g(n) = -n - 6. Let y be g(z). What is the remainder when (y - -4)(-10)/(-6) is divided by 4? 2 Let t(f) = -95f - 1. Calculate the remainder when 181 is divided by t(-1). 87 Let t = 390 - 323. What is the remainder when t is divided by 43? 24 Let r be (-4 - 219/(-12))/((-1)/4). Let x = r - -80. What is the remainder when x is divided by 14? 9 Let o(c) = c*3 + 4c*2 + c + 2. Let l be (2 - (-4 + 2)) + -17. Let n = 8 - l. What is the remainder when n is divided by o(-3)? 5 Let p = 14 - 2. Suppose p = 3s, -2n + 3s - 6s = -40. Let a = 6 + -2. What is the remainder when n is divided by a? 2 Suppose -143g = -147g - 20. Let a(t) = -t3 - 4t*2 + t - 1. Calculate the remainder when 130 is divided by a(g). 16 Suppose 5g - 252 = -4g. Let n = g - -4. What is the remainder when 61 is divided by n? 29 Suppose -131 - 91 = -5k - 4s, 5k - 2s - 204 = 0. What is the remainder when k is divided by 1? 0 Suppose 98g = 94g + 304. Suppose 9z - g - 221 = 0. What is the remainder when z is divided by 13? 7 Let y(i) = i*3 - 9i*2 + i - 52. What is the remainder when 239 is divided by y(10)? 7 Let t(u) = 2u*3 - 5u*2 - 3u + 7. Let h(b) = -3b3 + 9b*2 + 5b - 13. Let s(m) = -4h(m) - 7t(m). Calculate the remainder when 11 is divided by s(0). 2 Let b(y) = 8y - 9y - 4y. Let i(n) = n3 - 9n*2 + 7n + 6. Let a be i(8). Calculate the remainder when b(a) is divided by 6. 4 Let m be 243/12 + 1/(-4). Suppose 4o = -0o + m. Suppose -ot + 10 = -20. What is the remainder when 11 is divided by t? 5 Let h = -33 - -39. Suppose 0 = -a + ha - 340. Calculate the remainder when a is divided by 14. 12 Let i(w) = -w*2 + 9w - 10. Let s be i(7). Suppose 25 = -sc + 4q + 121, q + 93 = 4c. What is the remainder when c is divided by -1(-4 + 1) - -3? 5 Suppose 3t = -12, -3y - 14 = -0t + 5t. What is the remainder when 508/(-8)(y + -1)-2 is divided by 33? 28 Let n(p) = p*3 - 4p*2 - 13p + 2. Let s be n(6). Let y = s + -6. Calculate the remainder when 9 is divided by (2/y)/(2/(-50)). 4 Suppose -5c + 4 + 6 = 0. Suppose 150 = 4f + 4w + w, 0 = cf - 3w - 86. Let v = f + -24. Calculate the remainder when 29 is divided by v. 13 Let q = 690 - 676. Calculate the remainder when 97 is divided by q. 13 Calculate the remainder when 167 is divided by (-2)/(-4)840/453. 27 Suppose 0 = 2y - 10, 2c = -5y + 34 + 9. Suppose 3n - 7 = -s, 5s - c = -2n - 0n. What is the remainder when 8 is divided by n? 0 Let r = 7 + -4. What is the remainder when r + (0 - 19)/(-1) is divided by 112/10 - (-32)/40? 10 Let w(m) = -2m - 2. Suppose -2749t + 2767t - 162 = 0. What is the remainder when w(-6) is divided by t? 1 Suppose 5v - 120 = -5b, -7b + 50 = -5b + 3v. What is the remainder when b is divided by 64/10 - 2/5? 4 Let t(j) = -j*3 - 3j*2 + 2j + 4. Suppose -34 = 5r - 9, -2m + 44 = 2r. Let h = 8 + m. Calculate the remainder when h is divided by t(-4). 11 Suppose -2c = a - 2a + 34, -2c + 134 = 3a. Let d(u) = 60u + 1992. Calculate the remainder when a is divided by d(-33). 6 Let w(u) = u3 - u2 + 22. Let l be w(0). Let m be l/33 - 136/6. Let i = -15 - m. Calculate the remainder when 33 is divided by i. 5 What is the remainder when 522 is divided by (-258)/4-2 + 4? 123 Let c(p) = 23p + 13. Calculate the remainder when c(4) is divided by 55. 50 Suppose -65d + 5282 = -27d. Calculate the remainder when d is divided by 46. 1 Let c = 8 + 19. Suppose 4d + 2 = -18, 2p = -5d - 167. Let j = 87 + p. Calculate the remainder when c is divided by j. 11 Suppose 2p = 2q + 78, q = 1 - 6. Suppose 0 = 4a + 2y + 6, a + a - 9 = 3y. Let n = a + p. What is the remainder when 67 is divided by n? 33 Let u be (36/(-27))/(1/(-3)). Suppose 0 = -5t + u + 11. Suppose 7z - tz = 56. Calculate the remainder when 39 is divided by z. 11 Let s(y) = 5y - 28. Let r(x) = x*2 - 11x - 5. Let d be r(12). Calculate the remainder when 20 is divided by s(d). 6 Let q = -476 + 495. What is the remainder when 49 is divided by q? 11 Let k = 304 + -172. Let v(s) = 93s2 + 1. What is the remainder when v(-1) is divided by k/6 + (-2)/(-1)? 22 Suppose -52g = -64g + 708. What is the remainder when g is divided by 16? 11 Calculate the remainder when 27 is divided by (0 + 34/(-4))/(28/(-56)). 10 Let t be (-2 + 3)4 + (-5 - -1). Suppose t = -r + 5c + 22, c + 0c + 1 = 0. What is the remainder when 453/7 + (-4)/(-14) is divided by r? 14 Let t(v) = 3 - 32v2 - 2 - v3 - 16 - 2v + 12v2. What is the remainder when 48 is divided by t(-20)? 23 Suppose 4w - 169 = -b, -4b + b = -4w - 443. Suppose -8y = -5y - b. What is the remainder when y is divided by 14? 9 Suppose -2a = -v - 4v - 27, a + 4v = 20. Calculate the remainder when 42 is divided by a. 10 Let m = 112 - 111. Calculate the remainder when 72 is divided by (340/8 - 5) + m/(-2). 35 Suppose 137n = 144n - 546. What is the remainder when 221 is divided by n? 65 Suppose 374d - 105 = 367d. Let y(x) = 5x*2 + 2x + 3. Calculate the remainder when y(-5) is divided by d. 13 Suppose n - 23 - 101 = 0. What is the remainder when n is divided by 26? 20 Let n(g) = 2g + 11. Let f(h) = -1. Let d(b) = 4f(b) - n(b). Suppose -m = 3z + 20, -17 = 5m - 4z + 26. Calculate the remainder when 12 is divided by d(m). 5 Suppose -70 - 63 = -7d. What is the remainder when 124 is divided by d? 10 Suppose -y = 7r - 6r - 4, 4r + 5y - 12 = 0. What is the remainder when 53 is divided by r? 5 Suppose 4d = -147 - 1797. Calculate the remainder when d/45(-20)/6 is divided by 20. 16 Suppose 8j - 14j = -234. Let o = j + -24. Calculate the remainder when 37 is divided by o. 7 What is the remainder when (2 - 4/(-8))(-402)/(-15) is divided by 25? 17 Let k = 22 - -3. Let b be (-5)/2(-380)/k. Suppose 3h + b = 5h. What is the remainder when h is divided by 10? 9 Let r = -19 + 95. Let a = -49 + r. Let j = a - -27. Calculate the remainder when j is divided by 14. 12 Let r = 19 - -45. Let h = r + -57. Calculate the remainder when 12 is divided by h. 5 Let d(f) = -f*3 - 7f*2 + f - 6. Let c be d(-7). Let s = 21 + 5. Let r = s + c. Calculate the remainder when 51 is divided by r. 12 Let t = -77 + 101. Suppose t = -4r + 36. Calculate the remainder when 6 is divided by r. 0 Suppose 6w - 480 = -14w. What is the remainder when 73 is divided by w? 1 Let a(p) = p*3 - 10p*2 + 10p - 5. Let r be a(9). Suppose 4n = 5t - 16, 0n - 2t + 12 = rn. What is the remainder when 46 is divided by n - (-1 + -2)5? 14 Let o(r) = 13r2 + 3r + 3. Suppose d + 4d = -x + 26, -4d + 104 = 4x. What is the remainder when o(3) is divided by x? 25 Let s(w) = 2w - 7. Suppose -7y = -2y - 65. What is the remainder when y is divided by s(6)? 3 Suppose 0 = -3a + p + 2p + 177, -2p - 6 = 0. What is the remainder when a is divided by 22? 12 Let t be ((-66)/(-55))/(4/10). Suppose 2k = 4k + 3c - 15, 5c - 6 = tk. Suppose k = 5z - 22. Calculate the remainder when 7 is divided by z. 2 Let i = 115 + -100. Calculate the remainder when i is divided by 1(8 + (-2 - -2)). 7 Let y = -199 + 852. What is the remainder when y is divided by 9? 5 Suppose -6 = 3y - 5v - 93, -v - 6 = 0. Let h(j) = -j*3 - 6j*2 + 10j + 5. Calculate the remainder when h(-8) is divided by y. 15 Suppose -l + 7 = -3b, -4l - 12b = -14b - 28. Calculate the remainder when 32 is divided by l. 4 Suppose 3p - 9 = 3h, -2p - p = -2h - 6. What is the remainder when ((-77)/2 + 1)/(h/4) is divided by (26/(-3))/((-4)/6)? 11 Suppose 3q - 5s = 13 + 46, 88 = 5q + 2s. Let o = -5 + 8. Suppose -4d = 3g - 207, 3d + og - 200 = -44. What is the remainder when d is divided by q? 15 Suppose 3n = 10n - 5656. What is the remainder when n is divided by 9? 7 What is the remainder when 49 is divided by (-6 - (-26)/13)/(4/(-26))? 23 Suppose 4l - 3b - 56 = -0l, -3l = 3b - 63. Let i = l + -3. Calculate the remainder when i is divided by 9. 5 Suppose 4s = 5y + 129, 5s - 4s = -4y	{ "pile_set_name": "DM Mathematics" }
2)/357 + 20/35. Let j = m + 603/136. Find the common denominator of j and (8 + -4)/28742/12. 24 Let h = -42 - -106. What is the common denominator of 65/2 and (2/h)/((-40)/(-2480))? 16 Let p = 165494157/15614 + -23977/422. Let z = -10541 + p. What is the common denominator of 34 and z? 37 Let b = -63 + 89. Let z = -18 + b. Calculate the lowest common multiple of 3286/62 + 1 + 8/2 and z. 232 Let j = 11469 + -11457. What is the least common multiple of j and 925? 11100 Let q = -1/226593 + 4229737/226593. Find the common denominator of q and 2/2 + (-43)/9. 9 Let n(u) = -5u - 8. Let p be n(0). Let j be (-198)/p - 0 - (-13)/52. Suppose 3b = -2i + i + j, -b + 15 = -3i. What is the least common multiple of 15 and b? 45 What is the common denominator of -5 + 3 - 120/(-90)7517/5068 and -43/6? 7602 Let b be 278/10 + 0 + 26/130. Suppose 21l = 19l + b. What is the lowest common multiple of l and 12 - (1 - -10) - 53/(-1)? 378 Let f = -3 + 5. Let s be f/2510/15. Suppose 5v = 134 - s. What is the smallest common multiple of 6 and v? 60 Suppose -99 = 19i - 30i. Suppose 2 = -0o + 5o - 3r, 0 = 5o + 4r - i. Calculate the common denominator of 77/8 and (-275)/7 - o - 16/(-56). 8 Let d = -4774827093 - -811724544891/170. Let s = d + -23171. Calculate the common denominator of -89/102 and s. 510 Suppose -14935 + 97689 = 128a + 33a. What is the least common multiple of 2827 and a? 5654 Suppose 0 = -12a + 42 + 6. Suppose 4f - 5 = o, 0 = -5f - ao - 0o + 1. Calculate the smallest common multiple of 5 and f. 5 Suppose -21p - 104 = 85. What is the smallest common multiple of (-6)/p + 678(-3)/(-27) and 4? 76 Let c = -1610 - -2186. What is the lowest common multiple of 216 and c? 1728 Let l = 6/101 + -4985/606. What is the common denominator of (21/(-133))/((105/(-260))/(-7)) and l? 114 What is the smallest common multiple of ((-6)/7)/(6/(-172788)11) and 612? 6732 Let t = -114272759732015/3699234 + 1575437057/51. Let f be (-98915)/49455 + -4 + 6. Let z = f - t. Calculate the common denominator of z and 97/40. 440 Calculate the common denominator of (-24)/(2018520/41463) + (12/14)/2 and 1/240. 21360 Let t = 73/3 + -557/18. Let m = 11961949/126 + -94935. What is the common denominator of m and t? 126 Let c(y) = 2y*2 + 15y + 8. Let x be c(-6). Let q be (-9)/(-2)x/(-5). Calculate the least common multiple of 9 and (6/(-4) + 1)(1 - q). 36 Let g be 5 - (-3 + 9) - (-4262)/(-924). Let k = g - -93/14. Calculate the common denominator of k and 88/21. 231 Let s = -23470/4059 - -2/451. Let l = -53577 + 31365. Find the common denominator of 3/(-57) + l/(-6156) and s. 9 Let v = 32 - 85. Let q = 1611 + -1549. Let o = v + q. What is the least common multiple of 21 and o? 63 Suppose k + 3o = 8o + 13, -4o = -5k + 23. Suppose 2m + kc = -c - 26, c - 4 = 3m. Calculate the common denominator of -95/8 and m + -1326/24-2. 24 Let f(x) = 63x + 14. Let b be f(1). Let n = b + -62. What is the smallest common multiple of n and 40? 120 Let z = -268/11 + 34003/1397. Let r = 671/1524 + z. Find the common denominator of r and -11/45. 180 Let p = 91/17 - 1958/153. Let x be 48397/18 + (-8 - -4). Let q = x - 2684. What is the common denominator of p and q? 18 Suppose -4j + 2i + 92 = -3i, -3i - 12 = 0. Suppose -5t + 50o - 48o = -36, -5o = 15. What is the smallest common multiple of t and j? 18 Suppose -3l = -5n + 3209, -l + 3n - 973 = 98. Calculate the common denominator of (-1)/(-90)(-3 + l/8) and -56/93. 1860 Let j be (233971/(-2))/(-17)(-2)/42. Let h = j + 2190/7. Calculate the common denominator of h and 5/4 + (1 - 1). 12 Let y = 9718/5697 + -4/1899. What is the common denominator of -70/2787 and y? 25083 Let w = -349 - -269. Calculate the common denominator of 64/(w/25) and -95/92. 92 Let a be 3705/10 + (-1)/2. Let w = 376 - a. What is the smallest common multiple of 8/(-10)(-28 + -2) and w? 24 Suppose 52h - 57h = -9530. Let d be (-2)/((-36)/(-34107)) - -3. Let v = d + h. Calculate the common denominator of -49/6 and v. 6 Let t be 2 + -1 - 272/(-8). Let j be (-5)/t + 44/14. Suppose -2n + 0a = -a - 47, n - 41 = -ja. What is the smallest common multiple of 10 and n? 130 Suppose 16h - 2h = -98. Find the common denominator of -7/11 and 1498/24h/(-196). 528 Suppose 856 = 2l + 3m - 2195, -2m = 5l - 7600. Let a be l/(-44)(-4)/3. Calculate the least common multiple of 34 and (a/115)/((-2)/(-50)). 170 What is the common denominator of 34/9 and (6 - (-4 + (-33114)/(-4680))) + 10 + -13? 2340 Let r = 77597/40 + -1939. Calculate the common denominator of 6/42 - 489/(-350) and r. 200 Let s(x) = -x*2 - 3x + 34. Let i be s(-5). Suppose 0 = 6j - 10j + i. Calculate the lowest common multiple of j and 189. 378 Let r(u) = -u*2 - 20u + 248. What is the smallest common multiple of r(8) and 376? 1128 What is the common denominator of 12625/(-1710) - (-3 - -3 - 4) and -42/95? 855 Let f be -11 + 2176/160. Let x = f - 9/5. What is the common denominator of x and 285/24 - (-1)/4? 40 What is the common denominator of ((-28)/(-161280)-15)/(1/(-101)) and 51/44? 4224 Let p = -48784691285140956631/1214580 + 40165893794681. Let k = p + -1/40486. Find the common denominator of 89/20 and k. 60 Suppose -13t = -33t + 100. Let b(z) = -9z*3 + 2z + 1. Let d(m) = m + 2. Let u be d(-3). Calculate the lowest common multiple of t and b(u). 40 What is the common denominator of ((-37)/(-6327))/(-5 + 6740/1356) and -27/32? 9120 Let a(q) be the first derivative of -3q2 + 4q + 3. Find the common denominator of 6/(-10) - -1 - (-6230)/300 and a(8). 6 Calculate the common denominator of 35/12626 and 3 - -2260/320. 50504 Let s = 68003/30 - 2270. Find the common denominator of s and 1/151192/16. 30 Let k(i) = -15i + 245. What is the least common multiple of k(10) and 15? 285 Let i = -149504 + 120799193/808. Let c = i - -577/707. What is the common denominator of 53/8 and c? 56 What is the common denominator of -32/117 and (24/26)/(390/(-52))10/156? 1521 Let z be (3/(-5))/((-3)/15). Let k(r) = -3rz + 9r2 + r3 + 5r3 + r - 3 - 4r*3. Calculate the lowest common multiple of k(9) and 2. 6 Find the common denominator of 101/200 and 413/700 - ((-112)/20 - -6). 200 Let j be (-3)/(-12) + 42/24. Suppose jc - 522 = 54. What is the least common multiple of 22 and c/28 + (-4)/14? 110 Let j be ((-1)/60)/((-327285)/(-23285390)). Let t = j - -2/28053. Find the common denominator of 101/50 and t. 350 Suppose 255i + 203 = 284i. Calculate the least common multiple of i and 10. 70 Let r = -792849839/20616 - -41900/859. Let q = 38415 + r. Calculate the common denominator of q and 781/154 + (-4)/(-6)-3 + -9. 168 Let n = 41/19870 + -1261913/28970460. Find the common denominator of n and 37/180. 14580 Let q = 663519 - 541431421/816. Find the common denominator of 151/1224 and q. 2448 Calculate the common denominator of -99/8 and (-21566)/(-96382) + (-2382)/10322. 29656 Find the common denominator of 89/842 and 4/61755/180. 842 Let d = -4899/110 - -425/11. Calculate the common denominator of d and 50/319. 3190 Let z = 6962 + -6958. What is the smallest common multiple of 792 and z? 792 Find the common denominator of (-1)/(-1)-156/(-720) and -97/126. 504 Find the common denominator of 2/(-4)(-112 + (-6528)/(-540)) and -35/144. 720 What is the common denominator of (-135115)/(-400980) - ((-6)/12 - 15/(-18)) and 17/18? 240588 Let g(l) = l*3 - 16l2 - l + 68. What is the lowest common multiple of g(16) and 90? 2340 Let m = 567 - 645. Find the common denominator of -83/255 and 6 + (362/(-72))/((-130)/m). 1020 Let m = -32 + -43. Let u = -853645/11 + 77609. Find the common denominator of (m/(-6))/((-22)/4) and u. 11 Let p be (2/(-7))/1 - (-130000750)/9450. Let q = p + -13758. Let k = -167291/24 + 6976. What is the common denominator of q and k? 216 Let k(f) = -f3 + 17f2 - 25f + 18. Let j be k(13). Let x = 635 - j. Calculate the lowest common multiple of 6 and x. 798 Let i = -799561/2781600 + 295/1159. Calculate the common denominator of 17/6 and i. 2400 Suppose 400t - 463t + 9688 = 49. Calculate the least common multiple of t and ((-40)/30)/((-2)/9). 306 Let x be (35/7 + 3)(-2)/(-8). Let r be (-15)/3 - x-8. Suppose ro - 9o = 16. What is the least common multi	{ "pile_set_name": "DM Mathematics" }
((x*(1/20)x)/x)(1/27) assuming x is positive. x(1/540) Simplify (m/(mmm*(-2/7))m)5/(m(4/7)/(m((m/(mmm(-4)))/m)/m)) assuming m is positive. m(20/7) Simplify (i(-3/2)/i)/i(-2) assuming i is positive. 1/sqrt(i) Simplify ((l(-3)/l)/l(-8))/(l(1/2)/lll)(-28) assuming l is positive. l46 Simplify ((m(-5)/m)/((mm(2/11))/m))/(m1)29 assuming m is positive. m(-387/11) Simplify ((q*(-2/27)/q)/(qqq(2/23)))(-33) assuming q is positive. q(21593/207) Simplify ((h/(h/h(-1/6)))8)(-1/2) assuming h is positive. h(2/3) Simplify (z2/z)/(z/(z(zz(-1/9))/z))(zz(-4/7))/(zz/((zzzzz/(z*4/zz))/z)z) assuming z is positive. z(-106/63) Simplify bb/((b/(bbb/((b/(b/(b/b*(1/7))))/bbbbb))b)/b)b(-3/8)/b(b(2/23)/b)/b(-2/15) assuming b is positive. b(-38869/19320) Simplify (a/a(-9)aa*(-2/13)a)/(a(-3)/(a/(a/(((a(-6/7)/aa)/a)/aa)))) assuming a is positive. a*(1182/91) Simplify bbb/(bb*(-1/7))bbb(bbb(6/13)/bbb)/bb((b(-2)b)/b)(-9) assuming b is positive. b(2421/91) Simplify t*13tt(-15/4)/t assuming t is positive. t(37/4) Simplify p(-30)/(p(1/10)/p) assuming p is positive. p(-291/10) Simplify t(-1/24)/tt(-1/2) assuming t is positive. t(-37/24) Simplify ((b/(b1/b))(-2/57))23 assuming b is positive. b(-46/57) Simplify (zz3z)(-32) assuming z is positive. z(-160) Simplify (a/(aa(-1)a))(1/4) assuming a is positive. 1 Simplify ((b/b(-6/13))/(b(bb*(2/3)b)/b))(-39) assuming b is positive. b47 Simplify n*(2/13)/(n(nnn*(3/4))/n)(n/n*(2/3))/(n/(nnn(-1/3)n)) assuming n is positive. n(-31/52) Simplify p37/p(-1/15) assuming p is positive. p(556/15) Simplify (aa/(a(-2/5)a))/a*(-1/8)a*(4/7)/(aaa/a(4/9)) assuming a is positive. a(-1157/2520) Simplify (((oo(-1))/o)/o)(-8)(o/(oo(1/2)/o))(-12) assuming o is positive. o10 Simplify c13/(c/(c*17c)) assuming c is positive. c30 Simplify ((j6jj)/j*(-1/4))/(jj*(-2/9)j6) assuming j is positive. j(53/36) Simplify (v/v(2/13))(-37) assuming v is positive. v(-407/13) Simplify (k/((k(-20)k)/k))(-1) assuming k is positive. k(-21) Simplify (o28)(3/14) assuming o is positive. o6 Simplify ((((g/g(-4)g)/g)/g)/g)/(g*(-1/2)g)(g(-1))(1/47) assuming g is positive. g(233/94) Simplify ((qq(1/7))/q(1/8))/(q*1/(q/(qq(-8)))) assuming q is positive. q(449/56) Simplify (t*(-1/2)(t/(t/(t(-1/5)/t)))/t)5 assuming t is positive. t(-27/2) Simplify p(-5/8)/(p/((p/p*(1/2))/p)p) assuming p is positive. p(-25/8) Simplify z(12/11)z/z(2/21)z assuming z is positive. z(692/231) Simplify (a/(((a(6/5)/a)/a)/a)a3)(1/14) assuming a is positive. a(29/70) Simplify l(-12)l(-2/9) assuming l is positive. l(-110/9) Simplify (o/(o/((o/o(-2/7))/o)))(1/18)o/(oo*(-7))((oo(-2))/o)/o assuming o is positive. o(253/63) Simplify (t1)(-27)t/t*1t(4/9) assuming t is positive. t(-239/9) Simplify ff/(f/f21)f*(-6/11)ff assuming f is positive. f(258/11) Simplify (mm/(m/m(-8/5)))/(m(-9)/m) assuming m is positive. m*(47/5) Simplify dd/(dd/(d/((d/(dd*(2/21))d)/d))d)dd/((d22d)/d) assuming d is positive. d*(-418/21) Simplify jj*0jjjj/(jj*(-1/3))jj(-3/8)(j*(3/2)/jj)/j assuming j is positive. j(131/24) Simplify (x2/xx/x(1/4))/(xxx/(x0/x)xxx(-7)) assuming x is positive. x(11/4) Simplify (k/(k/(k/(kk7))))/k18 assuming k is positive. k(-25) Simplify (i(2/17)/i(-1/4))(-46) assuming i is positive. i(-575/34) Simplify n(-7/2)nn/(nn/((n/n*(7/2))/n))(n(2/7))(16/5) assuming n is positive. n(-213/35) Simplify (n/n(-37))26 assuming n is positive. n988 Simplify ((b6)(6/11))(1/12) assuming b is positive. b(3/11) Simplify ((a*(-1/6)aa)(-5/8))(3/2) assuming a is positive. a(-55/32) Simplify ((bb(1/2))20)(-6/11) assuming b is positive. b(-180/11) Simplify ((k/(k/k*0)k)/k)*(3/26) assuming k is positive. 1 Simplify w/(ww/w*(5/4))w(-4/11) assuming w is positive. w(-5/44) Simplify ii(-1/7)(ii/(i/i(1/2))i)/i assuming i is positive. i*(33/14) Simplify (xxx0)/((xx/(x(x/x1x)/x)x)/x)(x*(-4/7)/x)/xx/x1 assuming x is positive. x(-11/7) Simplify (y*(-5)y*(-2/5))/(yy*(-7)yy(4/5)/y) assuming y is positive. y(-1/5) Simplify l(2/23)/(l(-1/3)l)(l/l0)(-5/2) assuming l is positive. l(-425/138) Simplify (y(4/5)/(y(2/3)/y))/(y(2/9)y/y(-6/11)) assuming y is positive. y(-314/495) Simplify w*(1/8)w/(ww/w8) assuming w is positive. w(57/8) Simplify ((o/(o/(o(-5)o)o))/(oo(-4/3)))/(o(2/9)oo(-2/13)) assuming o is positive. o(-671/117) Simplify ((t/(tt(-3)tt))/(t/(t8t)))26 assuming t is positive. t234 Simplify (r3/r)(7/3) assuming r is positive. r(14/3) Simplify p(-9)/(p*(-2/41)p) assuming p is positive. p(-408/41) Simplify (f(2/5))*(-9/5)f3/f(3/5) assuming f is positive. f*(42/25) Simplify oo/o*(-3)o*(-2/29)(o1/o)(-32) assuming o is positive. o(143/29) Simplify w(-6)w(3/4) assuming w is positive. w(-21/4) Simplify (k/(kkkk*(6/7)kkk))(8/3) assuming k is positive. k(-328/21) Simplify (h*(-1/4)/hhh)(11/6)/(h(-4)/(hhh/h0hh)) assuming h is positive. h(83/8) Simplify ((aa*(2/3))/aa)/aa/(a(-7)a)(a/((a/((a1a)/a))/a))(2/9) assuming a is positive. a(73/9) Simplify (p*(1/3)p(pp*(-12)pp)/p)(-1/6) assuming p is positive. p(13/9) Simplify (f(2/3)ff(3/2))/(f/(f/((ff*(-10))/f))((f/(f*(-6)/f))/ff)/f) assuming f is positive. f*(37/6) Simplify ((v(v*(-2/3)/v)/vv)/v)(-1/24)/(v(-2/23)v(-2/7)) assuming v is positive. v(5125/11592) Simplify (m(-6)mm/((m6/m)/m))/(m(-2/3))(30/7) assuming m is positive. m(-36/7) Simplify y0/yyy((yy(4/3)/y)/y)/y assuming y is positive. y(1/3) Simplify tttt*(-36)tt(3/11) assuming t is positive. t(-349/11) Simplify (s4/s)/sss(-16) assuming s is positive. s(-13) Simplify (dd*21d)/(d/(ddd*15dddd)) assuming d is positive. d43 Simplify i(16/5)i(-1/6) assuming i is positive. i(91/30) Simplify nnn*(-16)n(-15) assuming n is positive. n(-29) Simplify (((bb(3/7))/b)/(b(-2/7)b))/((b/(b*(2/7)bbb))/((b/(bbbbb*0)b)/b)) assuming b is positive. 1/b Simplify ((ccc*(-3)c)/c(-8/3))(-35) assuming c is positive. c(-280/3) Simplify v4v(-6)v/(v/(vv/((vvvv*(2/9))/v))v)vv6 assuming v is positive. v(34/9) Simplify (b(3/16)/b)/(b/(b/(b/b(-9)))b) assuming b is positive. b(-189/16) Simplify ((b(-2/5))(-27))(2/77) assuming b is positive. b(108/385) Simplify (v15vvv/(v((v/(((v(-9)vv)/v)/vv)v)/v)/v))6 assuming v is positive. v54 Simplify (f(-2/7)/f)4/(((f/f(-1/3)f)/f)/f6) assuming f is positive. f(-10/21) Simplify (n(-1/2))(-27)/(n/(n/((((nn2)/n)/n)/n)))(2/11) assuming n is positive. n(27/2) Simplify j/j(1/3)jj/(((j/(j/(j/(jj/((j*(-17/5)j)/j))j)))/jj)/j) assuming j is positive. j(106/15) Simplify m22(mm11)/m assuming m is positive. m33 Simplify vv/v(-7)vvv/((vvv*(3/2))/v)v(vv7)/(v/(v(1/10)/v)) assuming v is positive. v(83/5) Simplify h(-7/8)h/(h(-14/5)h)h assuming h is positive. h(117/40) Simplify (j(-1/10)jj)/j(3/14) assuming j is positive. j(59/35) Simplify (s(4/9)/s)6 assuming s is positive. s(-10/3) Simplify (l2)(-1)/((l/(l/l(-2)))/ll*7l) assuming l is positive. l(-7) Simplify (m(-1))(-3/31)/(m(-1))(11/5) assuming m is positive. m(356/155) Simplify (hhh(-1))27(hh(h((h/(h/(h(h/((((hh*(-3)h)/h)/h)/h))/hh)))/hh)/hh)/h)/((hh*(-5))/hhh) assuming h is positive. h38 Simplify (j(-1/6)/(jj*(-3/7)/jj))/(j*(1/2)j(8/5)) assuming j is positive. j(-298/105) Simplify o(2/29)/(o(-12/11)o) assuming o is positive. o(51/319) Simplify z(-9)/z(-1/4)(z*2zz)37 assuming z is positive. z(557/4) Simplify (b/(bb/b*0b))*(8/9)/((bb(-2/37))/b5) assuming b is positive. b*(758/333) Simplify ((ff*5)/(f/(f/(fff(1/10)))))*25 assum	{ "pile_set_name": "DM Mathematics" }
d -40/39591. 3721554 Calculate the smallest common multiple of 104148 and 1952775. 7811100 What is the common denominator of 31/963 and -131/2565126? 274468482 Calculate the common denominator of 7/265355 and -16/411. 109060905 What is the lowest common multiple of 145 and 3466145? 100518205 Calculate the least common multiple of 2097061 and 27261793. 27261793 Calculate the least common multiple of 103 and 566759. 58376177 What is the least common multiple of 497580 and 1990320? 1990320 Calculate the least common multiple of 22971588 and 11265. 114857940 What is the smallest common multiple of 39518 and 47822? 944914898 What is the smallest common multiple of 19627936 and 512? 314046976 Calculate the smallest common multiple of 4925014 and 131724. 88650252 Calculate the common denominator of -34/39 and -11/219348. 2851524 What is the least common multiple of 110986650 and 40695105? 1220853150 What is the common denominator of 13/16697100 and 19/8? 33394200 Calculate the smallest common multiple of 1130649 and 9299. 19221033 Calculate the common denominator of -167/215220 and -17/664650. 22598100 Calculate the least common multiple of 42 and 308. 924 Find the common denominator of 10/525256653 and 16/821655. 7878849795 Calculate the smallest common multiple of 44048 and 227. 9998896 Find the common denominator of 32/1539 and -67/117048. 60045624 What is the least common multiple of 2072 and 7569228? 3920860104 What is the common denominator of 8/4374675 and -23/8749350? 8749350 Calculate the common denominator of 43/348 and -57/57536. 172608 Calculate the least common multiple of 4428000 and 10260. 84132000 Calculate the lowest common multiple of 50 and 2979356. 74483900 Calculate the common denominator of 39/22615919 and -49/9. 203543271 What is the least common multiple of 1134562 and 14749306? 14749306 Calculate the least common multiple of 2938103 and 5. 14690515 What is the lowest common multiple of 6365094 and 25460376? 25460376 What is the common denominator of 53/1345890 and 32/5655? 1345890 What is the smallest common multiple of 36325 and 1082485? 5412425 What is the common denominator of 101/880 and 181/47005440? 517059840 What is the common denominator of 85/264 and 29/6138440? 18415320 Calculate the lowest common multiple of 1733304 and 36. 5199912 Calculate the smallest common multiple of 61910902 and 1324. 123821804 Calculate the common denominator of -87/15602678 and -97/126. 140424102 Calculate the common denominator of 75/892 and 11/84028. 18738244 Find the common denominator of 25/6171 and -56/109939. 39907857 Find the common denominator of -27/438265 and 117/464324. 85899940 Find the common denominator of -69/161078 and -149/342. 27544338 Calculate the common denominator of -27/164008 and -77/936. 1476072 What is the least common multiple of 7720 and 2178? 8407080 What is the lowest common multiple of 76381440 and 480? 76381440 Calculate the least common multiple of 97603818 and 42. 683226726 What is the lowest common multiple of 300519 and 24041520? 24041520 Calculate the least common multiple of 1608 and 14318436. 28636872 What is the common denominator of 91/859212 and -7/18486? 882410724 Calculate the common denominator of -67/1743414 and 107/11041622. 33124866 What is the common denominator of -35/329052 and 41/1590418? 9542508 Calculate the lowest common multiple of 280 and 18288. 640080 Calculate the common denominator of -103/1055786 and 73/18476255. 36952510 Calculate the common denominator of -131/170 and -29/222746. 18933410 Find the common denominator of 34/158516401 and 61/471074. 317032802 Calculate the common denominator of -47/942804 and 133/234. 12256452 Calculate the least common multiple of 3212252 and 1649. 3212252 What is the common denominator of 34/7839 and 83/1998945? 1998945 Calculate the common denominator of -111/161357870 and -9/58516. 322715740 Calculate the common denominator of 53/1584914 and 51/1522076. 345511252 What is the least common multiple of 33 and 4539441? 49933851 Find the common denominator of -131/360 and -49/217044. 2170440 Calculate the lowest common multiple of 182260 and 380055. 1065674220 Calculate the least common multiple of 19833 and 3551910. 39071010 Find the common denominator of 7/3405 and -37/8415. 1910205 What is the least common multiple of 23230 and 6356? 73824940 Calculate the least common multiple of 9222 and 3732. 5736084 Find the common denominator of -35/2 and -77/116656. 116656 What is the common denominator of -7/419465 and -19/87795? 3775185 Calculate the lowest common multiple of 45 and 14589010. 131301090 Calculate the smallest common multiple of 8 and 24425585. 195404680 Calculate the least common multiple of 13722 and 2369. 32507418 Find the common denominator of 93/3520 and -69/28772480. 28772480 What is the common denominator of -49/1494 and 125/17784? 1476072 What is the least common multiple of 113400 and 4900? 793800 Find the common denominator of -191/72527910 and -61/1637727. 507695370 Find the common denominator of 21/24572960 and -133/11990. 270302560 What is the lowest common multiple of 17216946 and 47? 17216946 Calculate the least common multiple of 4500630 and 376052640. 3384473760 Find the common denominator of -169/12078 and -48/7991. 1582218 Calculate the common denominator of 85/48 and 32/2450379. 39206064 What is the common denominator of -107/18330900 and -95/1218? 18330900 Calculate the common denominator of 115/50118894 and 29/47334511. 852021198 What is the common denominator of -77/453876 and -71/15528? 587315544 Find the common denominator of -29/8 and 34/605950407. 4847603256 Calculate the smallest common multiple of 3540000 and 14750. 3540000 What is the common denominator of 49/218773 and -9/1514? 437546 Calculate the lowest common multiple of 13945596 and 142302. 13945596 What is the smallest common multiple of 506300 and 8961510? 89615100 What is the least common multiple of 3416316 and 353412? 10248948 What is the least common multiple of 397551 and 469833? 5168163 Calculate the smallest common multiple of 23856112 and 659616. 143136672 Find the common denominator of 10/103 and 1/12635129. 1301418287 What is the lowest common multiple of 179874 and 11611866? 104506794 Calculate the least common multiple of 51677 and 216710. 6718010 Calculate the smallest common multiple of 5914760 and 242770. 65062360 Calculate the common denominator of -28/15441 and 95/732. 3767604 What is the common denominator of -57/1386248 and 71/8480576? 144169792 Calculate the least common multiple of 1416 and 279616. 49492032 What is the common denominator of -68/367191 and -40/32679999? 32679999 Calculate the lowest common multiple of 18 and 71478. 71478 What is the common denominator of -101/7267300 and 64/35? 50871100 Calculate the lowest common multiple of 3974248 and 1480. 735235880 What is the least common multiple of 49978330 and 1588? 99956660 What is the least common multiple of 3828 and 6670812? 73378932 Calculate the smallest common multiple of 113274 and 1651608. 51199848 What is the common denominator of -143/13928088 and -125/66? 153208968 Calculate the common denominator of 89/26419432 and -53/44. 290613752 Find the common denominator of -62/22725 and 199/6202410. 93036150 Find the common denominator of -123/3967760 and 73/99194. 3967760 What is the common denominator of -139/1239294 and 79/7272699? 276362562 Find the common denominator of 32/1006635 and 45/2842. 408693810 Calculate the common denominator of -61/47360 and 109/63104. 23348480 Calculate the common denominator of -127/38097840 and -37/2640. 38097840 What is the common denominator of 95/24048 and -53/1325980? 47735280 Find the common denominator of 67/9666952 and 28/95461151. 763689208 Find the common denominator of -31/21187837 and 34/48154175. 529695925 What is the common denominator of 91/1763120 and 149/3270? 576540240 Find the common denominator of -33/11855 and 73/531104. 2655520 What is the least common multiple of 832818 and 16566? 9160998 What is the least common multiple of 56 and 38730184? 271111288 What is the least common multiple of 27320370 and 6? 27320370 Find the common denominator of -107/13875000 and 149/83250. 41625000 Find the common denominator of	{ "pile_set_name": "DM Mathematics" }
e (-12)/(-28) - 1/((-14)/610). Let x = z + -41. Suppose i = -xi + 400. Round i to the nearest 1000. 0 Let h = -726.237 - -1.237. Let b = 486 + h. Let w = -238.9999887 - b. Round w to six dps. 0.000011 Let j = -8 + 8.018. Let u = 0.039 + j. Let y = u - 0.05753. Round y to four decimal places. -0.0005 Let i = -0.146977 + 0.078594. Round i to three decimal places. -0.068 Let c = -274.3 - -274.3050197. Round c to 3 dps. 0.005 Let x = -185.5 - 847.5. Let h = -1033.00000633 - x. What is h rounded to 7 decimal places? -0.0000063 Let r = 8535905 - 12105905. Round r to the nearest 100000. -3600000 Suppose 212 = 6i + 236. Let j be 0 + (3/i - 105599/(-52)). What is j rounded to the nearest 100? 2000 Let a = 540 - 540.0000010043. Round a to seven decimal places. -0.000001 Let d = -2371.804334923 + 1026971.434338323. Let v = d + -1024600. Let g = 0.37 + v. Round g to six dps. 0.000003 Let x = -3744.78 - -3018.4. Round x to the nearest 100. -700 Suppose r - 11 = 60j - 59j, -5j = 0. Suppose 54b - rb = -43817000. What is b rounded to the nearest 10000? -1020000 Let h = -6054 - -6161.849. Round h to the nearest ten. 110 Let o = -34.3128 - -0.0128. Let x = 57.6 + o. Round x to the nearest integer. 23 Let v = 21893.9 - 21894.91083. Let z = 1.85 - 0.84. Let n = v + z. Round n to 4 dps. -0.0008 Let k = -46 + 43.9. Let i = -51.9 + k. Let r = 54.0318 + i. What is r rounded to three dps? 0.032 Let c = -0.53 - -14.03. Let q = c - 17. Let g = -4.4 - q. What is g rounded to zero decimal places? -1 Let b = -806 + 805.1056. Let q = b + 0.836. Round q to two decimal places. -0.06 Suppose q + 5s + 20 = 0, 5q + 24 - 8 = -4s. Suppose 0 = -qd + 6d + 24360000. What is d rounded to the nearest 100000? -4100000 Let a = -4731 - -4702.25. What is a rounded to 0 dps? -29 Suppose 8k = -43829475 + 2181579. Let o = -3419987 - k. Round o to the nearest one hundred thousand. 1800000 Let m(a) = -260a - 24. Let q be m(-3). Suppose u - 1924 = q. Suppose -413 = 4j - 4h + 2267, -u = 4j - 2h. Round j to the nearest 1000. -1000 Let o = -112.1 + 109.607. What is o rounded to 0 dps? -2 Let t = -343.0777 - -0.0777. Let q = -342.722 - t. Round q to 1 decimal place. 0.3 Let u = 485081 + -485192.9966. Let i = 110.2 - -1.8. Let s = i + u. Round s to 3 dps. 0.003 Let b = 819 - 464. Let j = b + -128. What is j rounded to the nearest 10? 230 Suppose p = -3p + 848. Let l = -2262 - -2266. Suppose -lg = -2q - p, -3q - 4g - 388 = q. What is q rounded to the nearest one thousand? 0 Let z = -0.21 - -15.01. Let o = 14.29 - z. Round o to 1 decimal place. -0.5 Let d = 166786.881 - 166782.96099989. Let k = d + -3.92. What is k rounded to six decimal places? 0 Suppose 2l = x + 48, 5x + 58 = 2l + l. Let a be -7 - -1 - (l - 723032). Round a to the nearest one hundred thousand. 700000 Let a = -67482.11 - -67184. What is a rounded to the nearest ten? -300 Let p = -13.2551 + 9.809. What is p rounded to 2 dps? -3.45 Let s = -2690.353049 + 0.053049. What is s rounded to the nearest 100? -2700 Let i = -2526.9999995315 + 2527. Round i to seven decimal places. 0.0000005 Let w = 217.2 - 315. Let k = w + -67. Round k to the nearest 10. -160 Let r = 0.129184 + -0.13036. Round r to four decimal places. -0.0012 Let u = -29.71 - -29.709999591. What is u rounded to seven decimal places? -0.0000004 Let o = -2.447 + 2.38. Let n = -1295.27580071 - -1295.3428. Let r = n + o. Round r to six dps. -0.000001 Let f = 56.87897 - -0.04103. What is f rounded to the nearest ten? 60 Let h = 13641 - 13641.00006547. What is h rounded to 6 dps? -0.000065 Let o = 0.041557 + -0.084128. Round o to two decimal places. -0.04 Let w = -1147415.713495551 + 1147329.73401. Let x = -0.020670449 + w. Let b = x - -86. What is b rounded to five dps? -0.00016 Let b(g) = 435g3 + 5g*2 - 32g + 9. Let y be b(7). Suppose -y + 685635 = -9w. Round w to the nearest one thousand. -60000 Let h be -5 - -5 - (4 + -8). Suppose -1868 = 2n + 3x, 6x = -hn + x - 3732. Round n to the nearest 10. -930 Let i = 519.8 + -519.79957075. Round i to five decimal places. 0.00043 Let p be 3 - ((-37)/(-3))/(1 - (-23734048)/(-23734056)). Round p to the nearest one million. -37000000 Let h = 562 + -562.1083. Let f = 0.12834 + h. Let w = f + -0.02. What is w rounded to five dps? 0.00004 Let u = -2016 - 675. Let r = 2690.98807 + u. What is r rounded to three dps? -0.012 Let w = -0.2586522 + 0.08866. Let c = -0.51 - -0.34. Let u = c - w. Round u to six decimal places. -0.000008 Let g = 92 + 390. Let q = -482.0489 + g. What is q rounded to two decimal places? -0.05 Let f = -574282975.9260681 - -574282943. Let x = f + 0.9260761. Let h = x + 32. What is h rounded to 5 decimal places? 0.00001 Let f(y) = y2 - 16y + 23. Let g be f(15). Suppose 5q + g = 7q. Suppose -8r - 10 = -3r, -qr - 13008 = t. Round t to the nearest ten thousand. -10000 Let p = -577518116.299198047 + 577518116. Let i = p - -0.2992. Round i to 7 decimal places. 0.000002 Let r = 0.5863 + 0.1107. Let k = 133.4 + -131.817. Let n = k - r. Round n to 1 dp. 0.9 Let i = 0.38269 - 675.43269. What is i rounded to the nearest one hundred? -700 Let s = 42972 + -42971.9999942206. What is s rounded to seven dps? 0.0000058 Suppose 8w = 5w + 864. Let y = w - 423. What is y rounded to the nearest ten? -140 Let z = 944.843312 + -1368.5418. Let j = -293.698627 - z. Let r = -130 + j. Round r to 5 decimal places. -0.00014 Let i = 8811 + -376. What is i rounded to the nearest one thousand? 8000 Let i = 72.7 - 66. Let v = 2.168172 - 8.8687. Let o = v + i. What is o rounded to four decimal places? -0.0005 Let t = -3.0175 + 3.0194455. What is t rounded to 4 decimal places? 0.0019 Let s = 24729 + -63312. Let u = 130783 + s. What is u rounded to the nearest one thousand? 92000 Let y(g) be the third derivative of 294688g*4/3 - 8g*3/3 - 2g2 + 43. Let o be y(4). Round o to the nearest 1000000. 9000000 Let u(h) = -h3 + 41h2 - 75h - 25. Let a be u(36). Let p = a + -2185. Round p to the nearest 1000. 2000 Let b = -315 + 214. Let g = b + 101.0294. Let k = g - 0.053. Round k to three dps. -0.024 Suppose -4u + 2h = 65391 + 130965, 2h - 147267 = 3u. Let c = u + -420911. What is c rounded to the nearest ten thousand? -470000 Let x = -37.67 - -19.57. Let m = -1583682455 + 1583682436.89999726. Let o = m - x. Round o to 7 decimal places. -0.0000027 Let s = -3392.9994553 + 3393. Round s to 5 dps. 0.00054 Let u = -7.45 - 52.28. Let w = u - -5.33. Round w to the nearest 10. -50 Let m be 22/6 - 4/6. Let t = 0 - 0. Suppose 0 = -2u - tk - k - 17804, mu = 5k - 26680. What is u rounded to the nearest one thousand? -9000 Suppose 2g + 11 = -2o - 1, -4g = -2o - 6. Let l(w) = -2587697w + 2. Let f be l(g). Let b = f - 1787699. Round b to the nearest one million. 1000000 Let j = 12962 - 12561.1. Round j to the nearest 1000. 0 Let u = 117 - 117.146. Let g = u + 0.399. What is g rounded to 2 decimal places? 0.25 Let l = -515947 + 515920.4143. Let s = -0.361 - 26.239. Let b = l - s. Round b to 3 dps. 0.014 Let x = 849 + -465. Let y = x - 850. Let v = y - -465.9501. Round v to two decimal places. -0.05 Let w be 5/5(-104389)/(-1). Suppose -22q - w = 30691. What is q rounded to the nearest 1000? -6000 Let c = 8631 - 8630.9994345. What is c rounded to five dps? 0.00057 Suppose 0 = -4q - 4y - 165552, -4q - 111331 = y + 54227. What is q rounded to the nearest 10000? -40000 Let c = -1021.87556 + -0.22444. Round c to the nearest 100. -1000 Let k = 222.249995333 - 222.25. What is k rounded to 6 dps? -0.000005 Let v = 223 + -176. Let u be -450*(0 - (v/3 + 1)). What is u rounded to the nearest 1000? 8000 Let b = -154.6 + 150. Let y = -8.6 + 0.6. Let r = y - b. What is r rounded to 1 decimal place? -3.4 Let c = -53.908422 - -53.91. What is c rounded to 4 decimal places? 0.0016 Let f = 1225000 - 554400. What is f rounded to the nearest 100000? 700000 Let q = -50633.29193804355 + 0.31594704355. Let y = q + 50633. Let w = -0.024 + y. Round w to five decimal places. 0.00001 Let b = 48115933 + -32358933. What is b rounded to the nearest 1000000? 16000000 Let r = 1.31 + -4.22. Let k = r - -2.90999896. Round k to six decimal places. -0.000001 Let n = -37205 - -38082.49. Let m = n - 927. What is m rounded to zero decimal places	{ "pile_set_name": "DM Mathematics" }
4n for n. 0 Solve 121y + 110 = 143y for y. 5 Solve 62 = h + 59 for h. 3 Solve 28d - 180 - 44 = 0 for d. 8 Solve -4z + 42 - 50 = 0 for z. -2 Solve -26 = -16f + 38 for f. 4 Solve 33h + 49 + 50 = 0 for h. -3 Solve 19 - 62 = 43z for z. -1 Solve 7 = 31b - 30b for b. 7 Solve -14f - 6 = -15f for f. 6 Solve -20g = -85g - 195 for g. -3 Solve -30o + 31 = 151 for o. -4 Solve -27p + 58 = 2p for p. 2 Solve -17s = -34s - 119 for s. -7 Solve 3j + 9 = 6 for j. -1 Solve 0 = -20y + 15y - 15 for y. -3 Solve 5 = 15m + 5 for m. 0 Solve -6c - 37 = -1 for c. -6 Solve -43k = 9 + 77 for k. -2 Solve 35o + 36 - 211 = 0 for o. 5 Solve -171k = -215k - 484 for k. -11 Solve 3h = 27 - 42 for h. -5 Solve 1534b - 25 = 1529b for b. 5 Solve 64t = 162 + 222 for t. 6 Solve -4q + 1 + 3 = 0 for q. 1 Solve 22m + 53 + 57 = 0 for m. -5 Solve 12 = -40c + 52 for c. 1 Solve -21j + 25j + 12 = 0 for j. -3 Solve 25c - 28 = 18c for c. 4 Solve 355r = 373r - 18 for r. 1 Solve 10j = 35j + 50 for j. -2 Solve 0 = 157q - 171q + 42 for q. 3 Solve -26z - 12 - 170 = 0 for z. -7 Solve 12b - 111 + 3 = 0 for b. 9 Solve -13n = -11 + 24 for n. -1 Solve 69d + 248 = 731 for d. 7 Solve -41q = -36q + 25 for q. -5 Solve 3 + 0 = n for n. 3 Solve 257 = -6v + 275 for v. 3 Solve 0 = 8y + 7y + 90 for y. -6 Solve -20s - 214 = -334 for s. 6 Solve 0 = 736s - 727s + 9 for s. -1 Solve -15 = -24k + 27k for k. -5 Solve 156p - 148p + 32 = 0 for p. -4 Solve -72x = -85x + 130 for x. 10 Solve -53 = -33l + 178 for l. 7 Solve 0 = -23i + 28i for i. 0 Solve 4l - 12 + 4 = 0 for l. 2 Solve -4 - 6 = -2s for s. 5 Solve -34k - 75k = 109 for k. -1 Solve 8 = 5g + 3 for g. 1 Solve 0 = 19x - 9x + 30 for x. -3 Solve -3t = 2 + 7 for t. -3 Solve -15o = -27o - 36 for o. -3 Solve 13b + 1 = 14b for b. 1 Solve -3w + 99 = 87 for w. 4 Solve -2t - 13t = 30 for t. -2 Solve -61m - 47 - 14 = 0 for m. -1 Solve 12c - 8 = 28 for c. 3 Solve -6f + 40 = 16 for f. 4 Solve -61u + 68u + 56 = 0 for u. -8 Solve 1295v - 1286v - 9 = 0 for v. 1 Solve 714k - 15 = 711k for k. 5 Solve 2b - 34b + 32 = 0 for b. 1 Solve -3h - 11h = -2h for h. 0 Solve -7 = -2c - 3 for c. 2 Solve -436 = 5d - 401 for d. -7 Solve -6 = -5p + 19 for p. 5 Solve 23i - 20 = 49 for i. 3 Solve 6n - 50 = -80 for n. -5 Solve 145i - 133i - 60 = 0 for i. 5 Solve 0 = 7t + 24 - 10 for t. -2 Solve 0 = 640c - 636c + 12 for c. -3 Solve 54 = 8j + 14 for j. 5 Solve -661 = -3g - 688 for g. -9 Solve -60t + 65t + 35 = 0 for t. -7 Solve 6s + 11s = -85 for s. -5 Solve -19w - 29w = -38w for w. 0 Solve -10 = -3g + 8g for g. -2 Solve 403 = -27i + 430 for i. 1 Solve 40g - 23g + 68 = 0 for g. -4 Solve 297 = -9f + 225 for f. -8 Solve -3 = 4w - w for w. -1 Solve -63y + 61y = 6 for y. -3 Solve 14f = 16f + 6 for f. -3 Solve -16 + 12 = l for l. -4 Solve -5o = -56 + 26 for o. 6 Solve -6n - 22 + 52 = 0 for n. 5 Solve 0 = -39g - 23 - 211 for g. -6 Solve 0 = -17g + 78 - 44 for g. 2 Solve -3z = -10z - 6z for z. 0 Solve -26d + 12 + 14 = 0 for d. 1 Solve 5p - 68 + 38 = 0 for p. 6 Solve 1 = 12g + 1 for g. 0 Solve 3t = -25t + 84 for t. 3 Solve -30 - 14 = -11r for r. 4 Solve 0 = -17m + 563 - 614 for m. -3 Solve -4d + 0d = 7d for d. 0 Solve -55n = -62n for n. 0 Solve 0 = -7r + 28 - 7 for r. 3 Solve 485y = 486y + 5 for y. -5 Solve 53g - 106 - 212 = 0 for g. 6 Solve -137u = -132u + 40 for u. -8 Solve 13i = 7 - 46 for i. -3 Solve 3w + 5 = 20 for w. 5 Solve 39 = -18g + 21 for g. -1 Solve 45 = -429i + 420i for i. -5 Solve -50i + 45i + 30 = 0 for i. 6 Solve 7q = -0 + 7 for q. 1 Solve 0 = -8g + 19g + 33 for g. -3 Solve g + 10 = 11g for g. 1 Solve -11w - 10 = 34 for w. -4 Solve -27u - 77 = 139 for u. -8 Solve 10f + 32 = 18f for f. 4 Solve 101u - 146u = 90 for u. -2 Solve 27q - 195 = -12q for q. 5 Solve 3t = t for t. 0 Solve -58 + 226 = 84y for y. 2 Solve 2s = -3s + 15 for s. 3 Solve 0 = -f - 902 + 897 for f. -5 Solve -8h + 16 = -0h for h. 2 Solve 30 = 9078t - 9088t for t. -3 Solve 20 = 14q - 10q for q. 5 Solve 0 = -198o + 186o + 72 for o. 6 Solve -8x = -7x + 3 for x. -3 Solve -17x - 88 = -28x for x. 8 Solve 0 = l - 2 + 3 for l. -1 Solve -2t + 431 = 441 for t. -5 Solve 3n + 178 = 169 for n. -3 Solve -t + 164 = 167 for t. -3 Solve -10z = -17z - 35 for z. -5 Solve -8w - w - 45 = 0 for w. -5 Solve 15 = 2n + 5 for n. 5 Solve -14q + 90 = 4q for q. 5 Solve 0 = -25x - 26 + 1 for x. -1 Solve -6j = -46j - 200 for j. -5 Solve -9w = 3w - 5w for w. 0 Solve 78 = -7u + 78 for u. 0 Solve -48k = -33k + 45 for k. -3 Solve 0 = -8i + 148 - 156 for i. -1 Solve -157 = 6d - 127 for d. -5 Solve 28s + 66 = -46 for s. -4 Solve 3m + m - 20 = 0 for m. 5 Solve 32 = -14z + 18 for z. -1 Solve -4h + 28 = 36 for h. -2 Solve 8b - 48 = 24 for b. 9 Solve -12i + 1 + 35 = 0 for i. 3 Solve -6l = 3l + 18 for l. -2 Solve -84t - 544 - 44 = 0 for t. -7 Solve 0 = 51u + 4 + 47 for u. -1 Solve -12f + 16 + 8 = 0 for f. 2 Solve -3i + 27 = 6i for i. 3 Solve 245a = 257a - 96 for a. 8 Solve 6 = 29l - 32l for l. -2 Solve 10k + 69 = 33k for k. 3 Solve 0 = -57t + 50t for t. 0 Solve -13k - 26 = 26 for k. -4 Solve 1031g - 24 = 1007g for g. 1 Solve -151h = -143h - 64 for h. 8 Solve 0 = d - 23 + 19 for d. 4 Solve 0 = 37h - 41h + 20 for h. 5 Solve 0 = 35p + 123 + 192 for p. -9 Solve 5 = -5n + 5 for n. 0 Solve -47h + 36h = 0 for h. 0 Solve 23 = -5d + 28d for d. 1 Solve 9a = 111 - 30 for a. 9 Solve 2t = 3t + 1 for t. -1 Solve 7t = -14 - 14 for t. -4 Solve 8k + 23 = -1 for k. -3 Solve 48f - 147 = -3 for f. 3 Solve s + 5 = 2 for s. -3 Solve 10a = -7a - 119 for a. -7 Solve 0 = 11k - 14 - 30 for k. 4 Solve 5u - 34 = -29 for u. 1 Solve 4o + 9 + 19 = 0 for o. -7 Solve -4s - 8 = 12 for s. -5 Solve -64 = -10t - 124 for t. -6 Solve -15a = -31a - 48 for a. -3 Solve 0 = 2h + 66 - 70 for h. 2 Solve 18 = -13n + 57 for n. 3 Solve 113 = 4y + 129 for y. -4 Solve -234v + 233v + 1 = 0 for v. 1 Solve 38o - 318 = 24 for o. 9 Solve 0 = 10u + 66 - 26 for u. -4 Solve 42 - 62 = -4b for b. 5 Solve -29 = -12o - 41 for o. -1 Solve 29203 = 9s + 29149 for s. 6 Solve 0 = 55x - 76x - 21 for x. -1 Solve -5b - 23 = -8 for b. -3 Solve 167c - 72 = 155c for c. 6 Solve -15 = 123q - 120q for q. -5 Solve -5n = 28 - 38 for n. 2 Solve -28v - 126 = -7v for v. -6 Solve 5i = -2i + 7 for i. 1 Solve 1 = -3b - 5 for b. -2 Solve 0 = -52g + 47g for g. 0 Solve 0 = -4g - 4 for g. -1 Solve 357z - 362z = -5 for z. 1 Solve 0 = -5v + 20 + 5 for v. 5 Solve 0 = 11b - 46 - 9 for b. 5 Solve 0 = 98d - 101d + 6 for d. 2 Solve 68x = 72x + 12 for x. -3 Solve -5i - 42 = -17 for i. -5 Solve -8c - 30 = 2 for c. -4 Solve 0 = -195s + 190s - 5 for s. -1 Solve -6 = 170d - 173d for d. 2 Solve 33 = -11i - 33 for i. -6 Solve -59 = 106i + 259 for i. -3 Solve 3t - 631 = -625 for t. 2 Solve -92f + 81f - 33 = 0 for f. -3 Solve 12 - 67 = -11m for m. 5 Solve 120q = 122q + 10 for q. -5 Solve 0 = 792i - 782i - 10 for i. 1 Solve 0 = -2y + 4y + 6 for y. -3 Solve -11g - 127 = -61 for g. -6 Solve -140 = 24x + 28 for x. -7 Solve 15j = 249 - 354 for j. -7 Solve -15 = -4a - 11 for a. 1 Solve 21 = 16c - 23c for c. -3 Solve -70z + 69z + 1 = 0 for z. 1 Solve c + 13c = -5c for c. 0 Solve 3u - 42 = 17u for u. -3 Solve -5g + 177 = 177 for g. 0 Solve 6 = 3y + 18 for y. -4 Solve -33 = -58r + 47r for r. 3 Solve -7i + 3i + 16 = 0 for i. 4 Solve 2 - 12 = -5d for d. 2 Solve -19 = -b - 23 for b. -4 Solve -26r + 128 + 54 = 0 for r. 7 Solve 0 = 8n - 18n - 40 for n. -4 Solve 65 = 4t + 77 for t. -3 Solve 7h + 698 - 649 = 0 for h. -7 Solve 0 = -6i + 34 - 64 for i. -5 Solve 3b = -6 + 12 for b. 2 Solve -36c - 100 + 316 = 0 for c. 6 Solve -496i + 509i = -39 for i. -3 Solve 0 = -189a + 172a - 34 for a. -2 Solve d = -3d - 12 for d. -3 Solve 16 + 15 = -31j for j. -1 Solve 206g - 201g + 30 = 0 for g. -6 Solve -43y = -64y + 84 for y. 4 Solve 62 = -11w + 117 for w. 5 Solve -6p - 22 = 8 for p. -5 Solve 0 = 3y + 6 + 9 for y. -5 Solve -4 = 8x + 28 for x. -4 Solve 8z = 7z + 3 for z. 3 Solve -4w - 66 = -54 for w. -3 Solve 11b + 250 - 206 = 0 for b. -4 Solve -13q + 19q -	{ "pile_set_name": "DM Mathematics" }
1 - (-28 - -26). Calculate the greatest common factor of l and 128. 16 Let j = 9 - 3. Suppose -3i = -3b - 5 - 19, 0 = -2i - 2b + 8. Calculate the highest common factor of j and i. 6 Let r(a) = a - 1. Let q be r(5). What is the highest common divisor of q and 36? 4 Let o(b) = b*3 - 7b*2 + 4. Let q be o(7). Suppose 488 = -4v - 4t, -v + 394 = -qv + 4t. Let a = -78 - v. What is the highest common factor of 6 and a? 6 Let g(l) be the first derivative of 13l*3/3 - l - 4. Let u be g(-1). Calculate the greatest common divisor of 6 and u. 6 Let z(o) = 3o + 36. Let d be z(-10). What is the highest common divisor of d and 24? 6 Suppose -75 = -2b + 21. What is the highest common factor of b and 32? 16 Suppose -2w - 4p + 487 = 121, 9 = 3p. Let y = w - 34. Calculate the greatest common divisor of y and 13. 13 Let h(q) = q3 + q2 + 2q + 2. Let p be h(2). Calculate the highest common divisor of p and 90. 18 Let p be 60/35(23 - 2). Calculate the highest common factor of 27 and p. 9 Suppose 3k - 2k + 16 = 0. Let c = -34 + 60. Let d = c + k. Calculate the greatest common factor of 20 and d. 10 Suppose c - 9 + 65 = 3j, -2j - 3c = -52. Let d be (0 + 2)(-4)/(-1). What is the greatest common divisor of j and d? 4 Let i be -11(2 - (2 - 1)). Let z = -7 - i. Let k be 1(-2)/(z/(-162)). Calculate the greatest common factor of 9 and k. 9 Let o be (1/2)/((-1)/(-24)). Calculate the greatest common divisor of o and 132. 12 Suppose -3k = -3z + 339, -3k + 147 = 4z - 298. Calculate the highest common factor of 16 and z. 16 Let t = 275 - 215. Calculate the greatest common factor of t and 12. 12 Let c be 4/6 + 68/6. Suppose 268 = 2d + z, 0 = -6d + 2d - 5z + 548. Calculate the greatest common factor of c and d. 12 Let m(l) = -l*3 + 10l*2 + l - 13. Let q be m(9). Calculate the greatest common divisor of q and 11. 11 Suppose -5f + 3f = -5u + 25, 2u + 2f = -4. Suppose -4l = 3b + 29, -ub - 3l - 24 = -0b. Let w = b - -5. What is the greatest common factor of w and 14? 2 Suppose -2o + 14 = -5z, -4o - 2z + 72 = -z. Let i = -18 - -35. Calculate the highest common divisor of o and i. 17 Let q = 99 - 47. What is the greatest common divisor of 39 and q? 13 Suppose -2i - 3d + 16 = -0d, -3i + 2d + 24 = 0. Let y = i - 3. Let l be ((-8)/(-12))/(4/12). Calculate the greatest common divisor of y and l. 1 Let i(d) = -11d + 1. Let v be (3/4)/((-1)/8). Let m be (-10)/3v/(-5). Let z be i(m). What is the highest common factor of 5 and z? 5 Let g be ((-2)/3)/(2/(-15)). Suppose -56 = gp - 7p. Calculate the greatest common factor of 112 and p. 28 Suppose 0 = -2p + 2 + 4. Let x be (16/p)/(32/144). What is the highest common divisor of 48 and x? 24 Suppose -z = 2z - 9. Suppose 5p - 3y - 20 = 4, zp + 4y = 26. Suppose -c + pc = 210. Calculate the highest common factor of c and 6. 6 Let n = 9 - 0. Suppose 4u = u + 420. Let h = -95 + u. What is the greatest common factor of n and h? 9 Let m(j) = j*3 + 9. Let o = 8 - 8. Let s be m(o). Calculate the greatest common factor of 63 and s. 9 Let w be (1 + -3)/((-13)/156). Let h be 481/4 - (-2)/(-8). What is the highest common factor of w and h? 24 Suppose 0b + 64 = 2b. Suppose -38 = -5r + b. Calculate the greatest common divisor of 70 and r. 14 Let m be 3/4 - (-332)/(-16). Let t = -10 - m. What is the highest common divisor of 90 and t? 10 Let m(j) = j*3 + 9j*2 + 3j - 21. Let x be m(-7). Calculate the greatest common factor of 42 and x. 14 Suppose a + 2a - 27 = 3z, z = 4a - 30. Let c be (-1)/((-1)/28 - 0). Calculate the greatest common factor of c and a. 7 Suppose 2y = 2r + 16, 5y - 35 = -5r + 35. Let l be 196/6 + 1/3. What is the greatest common factor of l and y? 11 Let s = -1 + 4. Let v be 723/9 - 1/s. What is the highest common divisor of 10 and v? 10 Suppose -g + 1 = -1. Suppose gk - 42 = -k. Let r = 67 + k. What is the highest common factor of 9 and r? 9 Let a = -15 + 27. What is the greatest common factor of a and 2? 2 Suppose -2j = 2i + 2i - 60, 3i = -4j + 110. Let v be 0 + 2 + 18/27. What is the greatest common factor of j and v? 13 Let k(g) = -g*2 - 3g - 1. Let x be k(-2). Let o be (2/x)/(6/87). Suppose 3j = l + o, 42 + 8 = 5j - 2l. What is the greatest common factor of j and 64? 8 Suppose 3p + 5h = 444, -5p - 2h + 1062 = 341. Suppose 0 = -4c + 2l + p - 7, -l = 4c - 136. Calculate the highest common factor of 51 and c. 17 Let q = 79 + 71. What is the highest common divisor of 30 and q? 30 Let w(b) be the second derivative of b5/20 - b4/6 + b3/3 - b2/2 - 4b. Let c be w(3). Calculate the highest common factor of c and 14. 14 Let r = -40 - -45. What is the greatest common factor of 15 and r? 5 Let d(g) = -g - 2. Let q = -13 - -6. Let h be d(q). What is the highest common factor of 35 and h? 5 Let p be 2320(-36)/(-90). What is the highest common factor of 23 and p? 23 Let l = 60 - 36. Calculate the greatest common divisor of l and 60. 12 Let d(t) = t2 + 3t - 7. Let p be d(3). Let c(g) = g + 3. Let f be c(0). Let w = p + f. Calculate the highest common factor of 35 and w. 7 Let m(g) = 3g2 - 4g + 1. Let l be m(3). Let x = -12 + l. What is the highest common divisor of x and 16? 4 Let c = 43 - 38. Calculate the greatest common factor of 65 and c. 5 Let t = 4 + -4. Suppose -4q + 32 + 100 = t. Calculate the greatest common factor of 3 and q. 3 Suppose 4s - 767 = -5v, -v = -6v - 25. What is the highest common divisor of 22 and s? 22 Let n(s) = s + 1. Let l be n(-1). Suppose 0 = -la + 2a - 2. Let o(f) = f*2 - 8f - 1. Let u be o(9). What is the greatest common divisor of a and u? 1 Suppose -4x + 35 = -21. Let v be (-34)/(-6) - 4/6. Suppose 3u + 65 = 3s - 2s, -5u = vs - 265. Calculate the highest common divisor of s and x. 14 Suppose 4k + 4a = 20, 7k + 3a - 23 = 2k. Suppose -3s = -s - 12. Let i = k + s. What is the highest common factor of 2 and i? 2 Let c be (-2)/2 + 150/6. Calculate the greatest common factor of 168 and c. 24 Let j = -13 - -109. Let i = -41 + j. What is the greatest common divisor of 22 and i? 11 Let u be (0 + (-2)/(-4))0. Suppose f + 4f + x = 221, 4x + 16 = u. What is the greatest common divisor of 9 and f? 9 Let b(c) = 4c - 10. Let h be b(5). Calculate the greatest common divisor of 40 and h. 10 Suppose 4f - 2z = 120, 0f - f + 5z + 48 = 0. Calculate the highest common factor of f and 4. 4 Let v(m) = 17m2 + 3m + 4. Let s be v(-1). What is the highest common factor of 216 and s? 18 Suppose 4t = -20, -a + 48 = -0a + 3t. What is the highest common factor of a and 9? 9 Let t be 1 + 1 - 5-2. Let k be (22/4)/(2/t). Calculate the greatest common divisor of k and 22. 11 Let g be ((-4)/(-8))/((-1)/(-36)). Suppose -g = i - 2i. What is the highest common divisor of 12 and i? 6 Suppose 2s = 4f - 126, -3f - 3s + 63 + 18 = 0. Calculate the highest common divisor of f and 6. 6 Let b(d) = -34d*3 - d. Let h be b(-1). Suppose 3v + 47 = -4m, -3m = -0v - 5v - 1. Let g = m - -13. What is the greatest common factor of g and h? 5 Let k(n) = 4n + 11n - 3n + 2n2 + 11 - n. Let u be k(-7). What is the highest common divisor of 8 and u? 8 Let n(p) = -p3 + 10p2 + 2p - 14. Let l be n(10). Calculate the highest common factor of 42 and l. 6 Let n = 22 - -24. What is the highest common divisor of 115 and n? 23 Let u(q) = q*3 + 10q*2 - 3q. Let h be u(-10). What is the highest common factor of 10 and h? 10 Suppose 4k - 1 = 7. Suppose -1 = -kc + 3. Suppose 0 = 2y - 4 - c. Calculate the greatest common factor of y and 15. 3 Let y = -25 + 28. Suppose 0 = -3f - 3z + 3, -3f + 5 = -5z + 2. Calculate the greatest common divisor of y and f. 1 Let x be 22/4 - (-1)/2. Suppose 0 = -f + 7 - 5. What is the highest common divisor of f and x? 2 Let l(m) = -21m - 31. Let k be l(-13). What is the highest common divisor of 22 and k? 22 Suppose 4x - 53 = 2v + 3v, 3x = -2v + 34. Let z(l) = 3l + 0 - 2 - 2l. Let f be z(6). Calculate the highest common factor of f and x. 4 Let d = -1 + 1. Let x(j) = j2 + j3 + 3j + 3j - 4j + 12 - 3j. Let k be x(d). What is the greatest common factor of 30 and k? 6 Let a = 14 + -2. Let u(b) = -b3 - 9b*2 - 7b + 11. Let r be u(-8). Calculate the greatest common	{ "pile_set_name": "DM Mathematics" }
s) be the first derivative of 70s3/3 + 34s - 90. Differentiate y(m) wrt m. 140m Let w(r) be the second derivative of 0r*2 - 12r + 5/6r4 + 0 - 16/3r*3. What is the second derivative of w(t) wrt t? 20 Let a = 0 + 2. Find the second derivative of aq*5 + 15q*3 + 11q - 15q3 + 2q wrt q. 40q3 Let y(p) = -2 + 0p + 14p2 + 2p + p. Let f be y(2). What is the second derivative of 4n4 - 60n*2 - n + fn*2 wrt n? 48n*2 Suppose q = -2p - 3, 5q + 3p = -2p. Find the third derivative of -5l*2 + ql6 - l6 + 2l6 wrt l. 480l*3 Find the third derivative of -7l*2 + 9 - 2205l*4 + 2216l*4 + 0l5 + l5 wrt l. 60l2 + 264l Let v(w) be the first derivative of 31w2/2 - 134w + 50. What is the first derivative of v(s) wrt s? 31 Let z(a) be the third derivative of -13a6/40 + a5/20 + 89a*4/3 - 677a*2. What is the second derivative of z(v) wrt v? -234v + 6 Let x be 0 + (2 - 8/(-4)). What is the second derivative of 943 + xs5 - 943 - 11s wrt s? 80s3 Let y(t) = 2t - 238 + 234 + 4t - t3. Let f(k) = -k3 + 5k - 3. Let n = -12 + 8. Let s(o) = nf(o) + 3y(o). Find the second derivative of s(q) wrt q. 6q Let q(j) be the second derivative of 14j*6 + 45j*2/2 + 134j + 2. Find the first derivative of q(a) wrt a. 1680a3 Let g(d) = d3 - 17d*2 + 16d + 4. Let l be g(16). Find the first derivative of -11x4 - 9x*l - 12 + 39 wrt x. -80x*3 Let z(a) be the first derivative of 3/5a*5 + 0a*2 + 6 + 0a*3 - 12a + 0a4. What is the derivative of z(s) wrt s? 12s*3 Let t(x) be the first derivative of -22 + 0x*5 + 0x*4 + 25/6x*6 + 0x + 0x3 - 6x*2. Find the second derivative of t(y) wrt y. 500y*3 Find the third derivative of -55l*4 + l + 208l*2 - 4l - 207l2 wrt l. -1320l Suppose -2k - 20 = -2p + 3k, p + 2k = 10. Find the first derivative of -18 + 37 - 35 - pq2 wrt q. -20q Let h(f) = -145f4 + f2 + 93. Let v(n) = 72n*4 - 46. Let l(r) = 3h(r) + 5v(r). Find the third derivative of l(t) wrt t. -1800t Find the second derivative of -27c5 + 145c*5 + 111c + 106c5 + 437c*5 wrt c. 13220c*3 Let d = -140 - -143. Differentiate 44o*d - 27o*3 + 10o*3 - 36 wrt o. 81o2 Let o(m) = m3 + 9m2 - 3m - 21. Let i be o(-9). What is the derivative of -2 + i + 6n + 8 - 1 wrt n? 6 Let i(v) = -v3 + v2 - v + 1. Let r(t) = 53t5 - t3 - 3t2 - t - 3. Let j(p) = i(p) - r(p). What is the third derivative of j(n) wrt n? -3180n*2 Let g(r) be the third derivative of 0 + 0r*7 - 5/168r*8 - 31r*2 + 29/60r*5 + 0r*3 + 0r + 0r6 + 0r*4. What is the third derivative of g(m) wrt m? -600m*2 Let y(g) = -g. Let j be y(-4). Let b be (2/3)/(j/12). Differentiate 0f*2 + 4f*4 + 3 + 0f*b with respect to f. 16f*3 Suppose 0 = -4f - 2f + 54. Find the second derivative of fd*4 - 4d3 + d3 + 3d3 - 21d wrt d. 108d2 Let d(w) = 612w*2 - 16w - 50. Let i(j) = 305j2 - 8j - 26. Let f(a) = 3d(a) - 5i(a). Find the second derivative of f(q) wrt q. 622 Suppose -18 = -3d + 12. Find the second derivative of -du*5 + 41u - 28u - 20u wrt u. -200u3 Let r(i) be the first derivative of -2i*6/3 + 15i*4 - 3i*2/2 - 13i - 352. What is the second derivative of r(m) wrt m? -80m3 + 360m Let z(p) be the first derivative of p6/30 - p5/20 - p*3 + 2. Let v(w) be the third derivative of z(w). Find the second derivative of v(c) wrt c. 24 Find the first derivative of 0m2 + 108 - m2 + 522m3 - 513m*3 wrt m. 27m*2 - 2m What is the third derivative of -1169l + 577l + 587l - 54l*3 - 2l*4 + 24l*2 wrt l? -48l - 324 Let u(q) = 27q. Let m be u(1). What is the second derivative of 0j*3 - 2j*3 - mj + 25j wrt j? -12j Let j(c) be the third derivative of -11/6c3 + 0c + 0c6 + 0c*4 + 0c*5 + 0 + 2/21c*7 + 2c*2. What is the derivative of j(f) wrt f? 80f*3 Let q(l) = 115l*4 - 4l*3 - 129l. Let n(d) = d4 + d3 - d. Let a(i) = 4n(i) + q(i). Find the second derivative of a(w) wrt w. 1428w*2 Let m = -1 + 12. What is the third derivative of -6f*2 - 2 + 2 + 11f*3 + mf*2 wrt f? 66 Let w(z) = 122z*3 - 16z*2 + 8z + 21. Let a(g) = 61g3 - 8g*2 + 4g + 9. Let o(x) = 7a(x) - 3w(x). What is the third derivative of o(s) wrt s? 366 Let s(b) = b*2 + 6b - 9. Let c be s(-8). Let k be 4/(-7)c/(-2). Find the third derivative of -t6 - 4t*2 + 9t*k + 3t*6 wrt t. 240t3 Let n(h) be the third derivative of -h3 - 1/30h5 + 0h4 + 0 - h2 + 0h. Differentiate n(v) wrt v. -4v Let q(o) be the second derivative of 657o5/20 + 65o*4/2 + 64o - 2. What is the third derivative of q(a) wrt a? 3942 Let j(h) be the first derivative of -15/2h2 - 9 - 9h. Differentiate j(n) wrt n. -15 Let x(v) be the first derivative of 9/2v2 + 19 - 11v. Find the first derivative of x(a) wrt a. 9 Let n = 167 + 113. Find the second derivative of s + ns3 - 280s*3 - 6s*5 wrt s. -120s3 Let r(d) = d4 + d*2 - d - 1. Let t(h) = 2h*4 - 61h*2 - 33h - 4. Let k(c) = r(c) - t(c). What is the second derivative of k(n) wrt n? -12n2 + 124 Let f(y) be the first derivative of -10y*7/21 + 3y*4/4 - 14y + 20. Let c(d) be the first derivative of f(d). What is the third derivative of c(g) wrt g? -1200g2 Let o(c) = c2 - c + 4. Let k be o(0). What is the third derivative of -15u*2 + 6u*4 - 6u*5 - 10u*k + 4u*4 wrt u? -360u*2 Let c(s) be the first derivative of -71s6/6 - s2/2 + 22s + 94. Find the second derivative of c(h) wrt h. -1420h*3 Let n(w) be the first derivative of 1/4w*4 + 7/2w*2 + 2 + 0w*3 + 0w. What is the second derivative of n(l) wrt l? 6l Let u(l) be the second derivative of l4/12 - 5l*3/3 + 265l*2/2 - 48l - 2. Find the first derivative of u(m) wrt m. 2m - 10 Let v(y) be the first derivative of 19y*3/3 + 36y*2 + 13. Find the second derivative of v(k) wrt k. 38 Let k(n) be the first derivative of 2n*7/7 + 115n*4/2 + 62n*3/3 + 431. What is the third derivative of k(o) wrt o? 240o*3 + 1380 Let o be 2/(-3) - (-187)/33. Find the third derivative of -21d*2 + 93d*5 - 93d*o + 15d*6 wrt d. 1800d*3 What is the derivative of 56v + 0v2 - 454 + v2 + 496 wrt v? 2v + 56 Let b(l) be the third derivative of -5/6l5 + 1/15l*7 - 46l*2 + 1/120l*6 + 0l*3 + 0l*4 + 0l + 0. Find the third derivative of b(n) wrt n. 336n + 6 Let j(i) be the third derivative of 6i*2 + 0 + 7/30i*5 + 0i*3 + 0i + 0i4 + 11/120i*6. Find the third derivative of j(v) wrt v. 66 Find the second derivative of 34h*3 + 2h - 48h3 - 6h + 422 + 6h - 164h*3 - 3h*2 wrt h. -1068h - 6 Suppose 6g - 2g - 3 = 3o, 3o = 9. Differentiate 23d3 + 1 - 15d*g - 3 with respect to d. 24d**2	{ "pile_set_name": "DM Mathematics" }
-145 + j. Let g be -10(-2)/(-9) + 2. Which is the third smallest value? (a) g (b) t (c) 4 c Let z = -6 - -20. Let f be (-2 - (-9)/6)6. What is the third smallest value in -0.4, z, f, -0.5? -0.4 Let a = -9392.92 - -7731. Let f = a - -1696. Let o = 34 - f. What is the second biggest value in 4, 2/7, o? 2/7 Let p(g) = 2g3 - 26g*2 - 22g - 87. Let i be p(14). Which is the third smallest value? (a) 0.4 (b) i (c) 2.781 c Let p = -12.8722 - -12.7722. Let l = -83/3 + 28. What is the third smallest value in 5, l, p, 1? 1 Let v = -2.7966 + -0.2034. What is the smallest value in -0.3, v, -0.195? v Let t = -0.3 + 0.4. Let y = -16436 - -16439. What is the third smallest value in 0, t, y, -3? t Let k = -203.6 + 226. Let f = k + 2.6. Let j = -24 + f. Which is the fourth biggest value? (a) j (b) -1/7 (c) -2/5 (d) 3 c Let u = -76.745 - 0.055. Let o = 77 + u. Which is the third smallest value? (a) o (b) -5 (c) -0.2 (d) -7 c Let r = -356 + 596. Let g = 240.3 - r. Let n = -0.32 + 0.02. Which is the second smallest value? (a) g (b) -2 (c) 1/8 (d) n d Suppose -19u = -4u - 5640. Let q = u + -380. What is the third smallest value in 0.37, q, -0.1? 0.37 Let u = 3.168 + 0.032. Let c = u + 37.8. Let l = 41.2 - c. What is the biggest value in -0.1, 0.3, l, -0.3? 0.3 Let j = 32 - 28.2. Let b = -5.8 + j. Let x = b - 20. What is the third biggest value in x, 2, -4/7? x Suppose 2m = 0, -3m = 2j - 1 - 1. Let p = 7 + -6. Let f be p/(-2) + (-13)/(-18). Which is the smallest value? (a) 0 (b) f (c) j (d) -3 d Let t = -0.354 + 4.334. Let v = -0.02 - t. Let j = 1.16 - 0.16. What is the second smallest value in j, v, -0.4? -0.4 Let v = -3.7 - -2.3. Let r(j) = 156j + 9521. Let o be r(-61). What is the fourth biggest value in -1/5, -2, v, o? -2 Let c = 365 - 365.048. Let d = -1.952 + c. What is the second smallest value in 3/5, d, 4/17? 4/17 Let f = -729 + 713. Which is the third biggest value? (a) -2 (b) 0.027 (c) -0.5 (d) f a Let m(f) = -f*3 - 8f*2 - 10f - 19. Let i be m(-7). Let s = -2.1 + 1.6. What is the third biggest value in s, i, 0.5, 1/6? 1/6 Let g = -2140/9 + 238. Let u be 4/6(-27)/(-99). Which is the third smallest value? (a) -0.3 (b) u (c) g c Let k = -10.2301 - -10.3. Let x = k + -2.0699. Let r = 0.09 + 3.91. Which is the smallest value? (a) r (b) 1/2 (c) x (d) 1/4 c Let s = 4.5 - 5. Let w = 57.4 - 67. Let x = w + 4.6. What is the second biggest value in s, 5/4, x, 5? 5/4 Let l be (-910/(-360))/((-33)/24). Which is the fourth biggest value? (a) 0.04 (b) 23 (c) l (d) -0.4 d Let g = -0.6 - -0.1. Let r = 9615/19 + -506. What is the biggest value in 0.2, 0, g, r? 0.2 Let z = 6.9 + -2.52. Let d = -4.734 + z. Let t = -0.054 - d. What is the second smallest value in 1/5, 1, t, -2? 1/5 Let l = 9122.5 - 9123. Which is the fifth smallest value? (a) -1 (b) l (c) -5 (d) 3/5 (e) 0.1 d Let g = -537.41 + 538. Let t = -4.41 - g. What is the third biggest value in -21, t, -0.06? -21 Let r = -1.13 + -48.87. Let o = 77 - 123. Let i = r - o. Which is the third smallest value? (a) 2 (b) -10 (c) i a Let t = -512 + 557. What is the second smallest value in 3/7, 2, t, -4? 3/7 Let s = -2.63 + 2.469. Let k = -0.539 + s. Which is the smallest value? (a) k (b) 1/4 (c) 4 a Let o = 3 - 11/5. Let b = -1076 + 1076. What is the second biggest value in 3, o, 2, b? 2 Suppose 2x - 164 = x + 5x. What is the fifth smallest value in -1/10, x, 1/4, 1/8, 3/7? 3/7 Let b = 794 + -794.5. What is the smallest value in b, -2/3, 2/15, 3? -2/3 Let h = 0.01 - -0.29. Let b = 132.36 - 134. Let n = b + 1.24. What is the biggest value in -2, -3/2, h, n? h Let a(g) = 2g2 + 7g - 17. Let o be a(-5). Let w be (-4)/((-12)/15) + -3. Suppose 5s - w = 8. What is the fourth smallest value in s, o, -3/2, 5? 5 Let s = 6 + -1. Let y = 65978.05 - 65978. Which is the second smallest value? (a) 2/5 (b) y (c) s a Let s = 116916.5 - 116917. Suppose -h - 2k - 4 = 0, -7h + 2k = -4h - 12. Which is the fourth smallest value? (a) h (b) s (c) 2/7 (d) 29 d Let y = -2884.1 + 2734. Let x = y - -150. What is the second biggest value in 4, x, 0.1? 0.1 Let i = 497/8 - 62. Let g be 1 + (-545)/345 + 12/18. What is the second biggest value in 3, i, g? i Let t = 86 - 146.6. Let p = 59.6 + t. Which is the third biggest value? (a) -0.09 (b) p (c) 1/6 (d) -4 b Let w = -908.9 - -909. Let s = 121 - 130. Which is the third smallest value? (a) w (b) s (c) -1/4 a Let i = 97 + -89. Let s = 8.5 - i. Let d be 2 + 3 - (5 + -3). What is the biggest value in d, s, 0, -0.1? d Let m = 59/28 - 6/7. Which is the smallest value? (a) -9/7 (b) m (c) 3/2 (d) 2 a Let i be (-3 - (-75)/27) + 38/171. Let l = 238 - 237.88. Which is the fourth smallest value? (a) i (b) -0.3 (c) 1 (d) l c Let s = -241.6 - -241.45. Which is the biggest value? (a) 0 (b) 2 (c) s b Let m = 0.487 + 326.513. Let x = m + -331. Let j = -0.35 + 0.05. Which is the second biggest value? (a) x (b) -2/7 (c) j c Let y = 69.4504 + -0.4504. Which is the third biggest value? (a) -0.4 (b) y (c) -1 (d) -4 (e) -1/2 e Let q(o) = -o3 - 5o*2 - 2o + 3. Let k be q(-4). Let p be (180/1425)/(26/(-3315)) - -16. What is the third biggest value in k, p, 2/3? k Suppose -15h + 1045 = 4h. Let g be 6/5 - h/25. Which is the biggest value? (a) g (b) 5 (c) -0.14 b Let i = 121124 - 121129. Suppose -3l + 17 = -10. Which is the second smallest value? (a) 2/7 (b) i (c) l (d) 0.3 a Let f = 0.051 - 461.051. Let z = f + 466. What is the fourth smallest value in 0, -0.4, 2/7, z? z Let x be (-10)/14 + (-4)/14. Let h be (18 - 82 - -73) + (92/(-10))/1. What is the fourth biggest value in h, 5, -2/3, x? x Let j(i) = 2i*2 + 55i + 375. Let f be j(-14). Let l = 6 - 8. What is the biggest value in 4, 20, f, l? 20 Let g = 3748 - 3716. Which is the smallest value? (a) 2 (b) 0.3 (c) -4 (d) g c Let w = 0.152 - 3.152. Let x(m) = m*3 + 4m*2 + m + 4. Let k be x(-4). Let h be 2 - (-2 - (1 + k)). What is the smallest value in w, h, -0.5? w Let n = -9403 - -9402. Let x be (2 + 0)-2 - -2. What is the second smallest value in 6, x, n? n Let b = 13.46 + -13.46. Let u = 6.1 - 5.1. What is the third smallest value in 2/17, u, -6, b? 2/17 Let v = 474.8 - 474.3. What is the smallest value in 5.4, 3, v, -0.5? -0.5 Let a = -0.02 - 6.98. Let w = 0.977 - -0.353. Let x = -2.33 + w. What is the second biggest value in x, -0.3, a? x Let x = 0.942 - 0.522. What is the second biggest value in 0.4, x, 17/5, 0.1? x Let h = -544 + 558. Let i = 17.66 - -0.34. Let w = i - h. Which is the biggest value? (a) 0.5 (b) 0.4 (c) 2 (d) w d Let z = -4 + 2. Let y = 64 + -38. Let k be ((-16)/24)/(y/6 + -1). Which is the second biggest value? (a) z (b) 0.3 (c) -1/9 (d) k c Let u = 1161 - 1261.8. Let z = 101 + u. What is the third smallest value in -4, z, 4? 4 Let m = -0.056 - 1.184. Let x = m + -0.06. Suppose 4o + 23 = -3s, 4o = s + o - 1. Which is the second smallest value? (a) -0.2 (b) s (c) x c Let t be 37/7 + 7/(343/(-14)). What is the third smallest value in t, 0, 3, -0.258? 3 Let v = 0.02334 - 0.42334. What is the fourth biggest value in 1/4, 2, v, -7? -7 Let l = -63.873 - 0.127. Let f = -5583 + 5643. Let g = f + l. Which is the second smallest value? (a) g (b) 9 (c) -0.4 (d) 0.4 c Let o = -9 - -9. Let r = -22811 - -159674/7. Let x = 0.02 - -0.38. What is the second smallest value in o, r, x, 3? o Let h = -19.26 - -15.26. Let g = -154 - -1081/7. What is the biggest value in 0.5, g, h? 0.5 Let v = 185 + -185.5. What is the fourth smallest value in -3, 1.356, 1/5, -0.4, v? 1/5 Let f = 262 - 252.85. Let h = -14.15 + f. Which is the third smallest value? (a) -0.03 (b) h (c) -0.1 a Let u = -2820.5 + 2820.9. What is the third biggest value in 2, 304, 4, u? 2 Suppose -3b + 4b - 2 = 0. Let k = 10993/29304 + -1/7326. What is the second smallest value in b, k, -27? k Suppose 5 = -498m + 503m. Let y = 28.5 + -4.4. Let u = y - 24. Which is the second smallest value? (a) -2/9 (b) m (c) u (d) -0.01 d Let a = 105698.6 + -105698. Let p = 4 - 7. What is the smallest value in p, a, 2, -0.4? p Let p = -0.2 - 3.8. Let o = p - 0. Let z be ((-7)/2 + 1)(-136)/170. What is the second biggest value in 5, o, z? z Let z = -1.491 + 1.491. What is	{ "pile_set_name": "DM Mathematics" }
1 in 0.3, s, 3? 0.3 Suppose 9v - 4v + 20 = 0. Let w = 0.24 + -2.24. What is the closest to 0 in w, v, 1/3? 1/3 Let j be (-6)/(-4) - 58/44. Let l = 4 + -4. Let b be l + 3/2-2. What is the nearest to 1/3 in b, -2, j? j Let n = 333/4 + -83. Let r = 3 - 3.1. Which is the nearest to r? (a) n (b) -1/4 (c) -4 b Suppose 7 + 8 = 3o. What is the closest to -4 in o, -3, 0.5? -3 Let j = 0.5 + -0.1. Let y = -6 - -4.9. Let w = -0.1 - y. Which is the nearest to w? (a) j (b) 4 (c) 3/4 c Suppose -3 = -5v + 2. Let z = 3 + v. Which is the closest to z? (a) -2/13 (b) -4 (c) 4/9 c Let h = -120 + 126. What is the nearest to h in 0.2, 5, 3? 5 Let w be (1/(-2))/(18/8). Let p = -0.27 + 0.28. Which is the nearest to -1? (a) w (b) p (c) -1/4 c Let h = -0.6 - 1.4. What is the closest to h in 6/7, -2/21, -0.3? -0.3 Let q be -3 - 33/18(-6)/3. What is the nearest to q in 2, 4/5, -1/4? 4/5 Suppose -5v + 2x = 23, 9v - 3x = 4v - 22. Let s = 0.04 - -4.96. Let q = -1 - -5. Which is the closest to 0.1? (a) v (b) s (c) q c Let z(h) = h3 + 3h - 5. Let v be z(0). Which is the closest to 3/2? (a) v (b) -1/4 (c) 7 b Let d = 0.12 - 0.1. Let q = -2.02 + d. Which is the nearest to q? (a) -4 (b) -0.4 (c) -5 b Let z = -10 - -10. Let d = -2 + z. What is the closest to 0.2 in d, -3, 5? d Let u = 61 - 65. Which is the closest to -1/4? (a) -0.02 (b) u (c) 5 a Let r = -247/192 + -3/64. Let m = 0.01 + -6.01. Let h = 5 + m. What is the nearest to 0.2 in -0.3, h, r? -0.3 Let x = -38.2 + 38. Which is the nearest to 0.1? (a) -0.3 (b) 1/6 (c) x b Suppose 6n + 1 = -5. Which is the closest to 0.3? (a) -3/5 (b) 3 (c) n a Let g = -664/7 + 95. Let o = 0 - 0.4. What is the nearest to -1/2 in g, o, -3? o Let d = -17 + 13. Let n = d + 4.1. What is the closest to 2/3 in -0.3, n, 3? n Let y = 0.3 + -0.2. Let k = 0 - y. Which is the nearest to k? (a) -1/2 (b) -6/5 (c) -2/5 c Let x = -27 - -28. Which is the closest to -1? (a) x (b) 0.3 (c) 2 b Let g = 149/39 - 11/3. Let t = -0.1 - -0.1. Which is the nearest to t? (a) -2 (b) -5 (c) g c Let m = 10.5 + -10.9. Which is the nearest to 2? (a) -2/7 (b) 2/17 (c) m b Let v = -806/5 - -160. Suppose -t - t + 8 = 0. Let f be (-2)/10 - (-2)/5. What is the closest to 1 in f, t, v? f Suppose 3 - 1 = 4q + 3p, 2q - 14 = 5p. Let h be 2 + 108/(-26) + q. Let m be 5/(75/(-6)) + 1. What is the nearest to 1 in h, m, 0? m Let m(r) = r + 3. Let n be m(0). Let l = -0.12 - -0.02. Which is the closest to -0.4? (a) l (b) n (c) -2 a Let n = 3.7 + -4. What is the nearest to -0.4 in -3, n, 3? n Let i = -0.4 - 0.1. Suppose 2s = 3s + 1. Let o = 2 + s. Which is the nearest to o? (a) i (b) -2/3 (c) 1 c Let y be 156/432 + (-2)/8. What is the nearest to 0 in 0.5, y, -3? y Let i = -5 - -7. Let q = i + -3. Which is the closest to q? (a) 3 (b) 0.3 (c) 1 b Let i = 2.94 - 0.04. Let u = i + 0.1. What is the nearest to 0.2 in u, -2, -5? -2 Let x = 1.463 - -0.537. Let r be 6/(-10)(-4)/6. Let t = -0.1 + -0.1. What is the closest to r in x, t, 0? 0 Let b = 2.5 + 0.5. What is the nearest to b in 4, 10, 1/11? 4 Let t be -1 + (-10)/45-3. What is the closest to 3/5 in t, 3/2, 1/4? 1/4 Let z = -3 - 2. Let n = 0.2 - 0.2. Which is the nearest to n? (a) z (b) -4 (c) -1/6 c Let q = 39 - -35. Let p = 3037/41 - q. Let k = p - -99/328. What is the nearest to 1/3 in 0.2, -2/5, k? k Let h = -5.8 - -0.8. Let x = -16.5 - -1.5. Let d = 13 + x. Which is the closest to -1? (a) d (b) 0.2 (c) h a Let y be (-4)/90(-45)/9. Suppose -6g + g = 0. What is the nearest to -1 in y, g, 1/6? g Suppose 0 = 4a - 8 + 12. What is the closest to 0 in -2/17, a, -1/2? -2/17 Let g = -1/70 - -143/210. Which is the closest to -1? (a) -1/3 (b) g (c) -0.2 a Let p = 1.9 + -2. Let v = -17 - -16.7. Which is the nearest to p? (a) v (b) 3/7 (c) 1 a Let j = -0.38 + 0.08. Let i = j + 1.3. Let g = -0.8 + i. Which is the closest to 1/4? (a) 0 (b) -0.4 (c) g c Let q = -9/4 + 5/2. What is the closest to q in 1, -4, 0.3? 0.3 Let v be (-32)/(-6) + 2/(-6). Let l = -7 + v. Let k = -0.481 + -0.019. Which is the nearest to l? (a) -0.2 (b) 4 (c) k c Let q = 8 + -8.03. Let l = 0.33 + q. Let b = l - 5.3. What is the closest to -2/7 in -3/2, b, -2/23? -2/23 Suppose -2n - 22 + 0 = 0. Let y = n - -5. Let w be 6/(-28) - 3/y. Which is the nearest to -1/2? (a) -5 (b) 1 (c) w c Let w = 0 + 0. Let i be 26/6 - (-6)/9. Let m = i - 1. Which is the closest to w? (a) 0 (b) m (c) -0.1 a Let n = 22 - 23. Let u = -8 - -5. Let z be u/14(-1 + -1). What is the closest to 0 in z, -0.3, n? -0.3 Let m = 11 + -8. Let z = 6 - m. Let q = -2.5 - -2. What is the nearest to 0 in q, -5, z? q Let h = -0.2 - 0.2. Let v = -4 + 5. Let n = v - 5/4. Which is the closest to -1? (a) -1 (b) n (c) h a Let t be -2 - 3/(-9)5. Let r be (20/(-8))/((-2)/(-4)). What is the closest to -0.1 in 2/3, r, t? t Let u be (0 - 4/13) + (-6)/(-39). Which is the nearest to -1? (a) -1/6 (b) 3/13 (c) u a Let o = -171 - -169. What is the nearest to o in 0.2, 3, 2? 0.2 Let v = 16 + -11. Suppose -7 - 8 = -vr. Which is the nearest to -1/4? (a) r (b) -0.1 (c) 4 b Let a = 0 + -0.3. Let c = -0.2 + 0. Let r = 0.09 + 2.91. What is the closest to c in a, r, -2/9? -2/9 Let i = 80 - 81. What is the nearest to 0 in 0, i, 0.3? 0 Let p = -0.3 + 0.7. Let i = 5 + -9. Which is the nearest to -0.1? (a) p (b) -4/7 (c) i b Let x(s) = s*3 - 10s*2 + s - 10. Let q be x(10). Which is the closest to -1/4? (a) -1/4 (b) -4/7 (c) q a Let g = 7.5 - 8. What is the closest to 0.3 in -5/4, g, -1/5? -1/5 Suppose -5h = -22 + 2. Let p be h/(-15) + (-6)/(-9). Let d = -1/5 - -8/15. Which is the nearest to 0? (a) d (b) -4 (c) p a Let q = 0 + 0.1. Suppose -s = -3t + 6, 4t + 4 + 4 = -4s. Suppose t = -0o - o. What is the nearest to q in o, 4, -4? o Let l = 19 - 18. Let g = -3.9 + 4. Which is the nearest to l? (a) 1 (b) g (c) -1 a Let q = 0.15 + 5.85. Let m = q + -10. Which is the closest to 1? (a) -0.2 (b) 1/4 (c) m b Let s = -311 - -302.93. Let h = s - -0.17. Let z = -8 - h. What is the closest to z in 2, 5, 4? 2 Let h = 20 + -27. What is the closest to 0.1 in -1/2, h, -5? -1/2 Let c(f) = -f*2 - 6f. Let y be c(-6). Let h be y/(-1) - 3/18. Let s = -193/210 - -11/14. What is the closest to -3 in s, h, 5? h Suppose -2i + 4k = 4, -3 = 5i - k + 7. Let d be (i/3)/((-12)/(-18)). Let w be 14/(-63) + 50/(-18). What is the nearest to d in -0.1, w, -2/5? -2/5 Let r = 0.17 + -0.07. Let w = r + 0.1. Let a be (-2)/(-18)12/10. What is the nearest to w in -1, -0.5, a? a Let s = -0.049 + 0.919. Let t = 0.17 - s. Let r = t + 0.5. What is the nearest to 0 in -3, r, -5? r Let u = 7 - 4. Let i = -0.2 - 0.3. Which is the nearest to 1/4? (a) u (b) 1/4 (c) i b Let w = -0.4 + 7.4. Let d = w - 6.8. What is the nearest to 0 in d, -3, 1? d Let l = -49 + 46. Which is the closest to 1? (a) -1 (b) l (c) -2/15 c Let m(p) = p*3 + 14p*2 - 16p - 15. Let l be m(-15). What is the closest to 0.1 in -1/3, l, 2/7? l Let o = -3/23 - -67/161. Suppose -r = -6i + i + 10, -r = -i + 2. Suppose r = -3s + 2s + 4. Which is the closest to o? (a) s (b) -1 (c) -4 b Let q = -4.9 + 5. Let u = -5 - -4. Let t = 0.4 - 0.4. Which is the nearest to u? (a) q (b) t (c) 1 b Let l = -18 - -16. Let z(k) = -k3 + 3k*2 + k - 2. Let d be z(3). Which is the closest to -6? (a) l (b) -0.2 (c) d a Let h be 18/(-20) + (-2)/(-5). Let i = 3.1 - 3. Let o = 2 + 2. Which is the closest to h? (a) i (b) o (c) -2 a Let x = 0.3 + -0.3. Let s = x - 3. Let u = 1 + s. Which is the nearest to u? (a) 1/3 (b) -0.5 (c) -1 c Let d = 0.2 + 0.2. Suppose 3u - 5 = -2u. What is the nearest to -1 in 5, d, u? d Let w be 6/15 - 3/(-5). Let s = w - 0. Let t = 0.49 + 0.01. Which is the nearest to 1? (a) s (b) 0.3 (c) t a Let z = 48 + -47.7. Which is the closest to -2? (a) 1 (b) z (c) -2/17 c Suppose 4s = 3g - 6, 5g - 4 = 4s - 2. Suppose -4n - 4 = -0n. Let v = -2112/5 + 422. What is the closest to n in 2/5, v, g? v Let v = -0.2 + 1.2. Let r = v + 1. Let p = -2.2 + 2.7. What is the nearest to -0.1 in p, r, -2/25? -2/25 Suppose -t - 3v - 13 = -5v, 4t + 8 = -3*v. What is the closest to -2/5 in 0.2, t, 0? 0 Let g = -20.3 - -20.3. Let j = -1 + 1. Which is the nearest to g? (a) j	{ "pile_set_name": "DM Mathematics" }
or of 8848 and 134540. 28 Calculate the greatest common factor of 116595620 and 67652. 5204 Calculate the highest common divisor of 293148 and 187884. 612 What is the greatest common factor of 5559207 and 94? 47 Calculate the greatest common factor of 209479384 and 3320. 664 What is the greatest common factor of 982291016 and 8120? 1624 Calculate the greatest common divisor of 48916723 and 236. 59 Calculate the highest common divisor of 473211 and 4. 1 What is the highest common divisor of 86420 and 602910? 290 What is the highest common factor of 8397 and 16001883? 2799 Calculate the highest common divisor of 5332776 and 120. 24 Calculate the greatest common factor of 77726726 and 1070. 214 Calculate the highest common factor of 987317 and 13. 1 Calculate the highest common factor of 1696898 and 455182. 854 What is the greatest common factor of 7146670 and 71390? 590 Calculate the greatest common divisor of 388278 and 8162. 1166 What is the greatest common divisor of 80100 and 13293396? 3204 What is the highest common factor of 1027932 and 5892? 12 Calculate the greatest common divisor of 25785 and 40003995. 2865 What is the highest common factor of 182 and 9321468? 26 Calculate the greatest common factor of 14442 and 14210. 58 What is the highest common factor of 101409 and 701961? 1317 Calculate the highest common factor of 3280 and 4421850. 410 Calculate the highest common factor of 916168 and 5742. 638 What is the greatest common divisor of 12 and 39123796? 4 Calculate the highest common divisor of 614975 and 17000. 425 Calculate the highest common divisor of 2328 and 29046747. 291 Calculate the highest common divisor of 164000 and 52014650. 2050 Calculate the greatest common factor of 320 and 3319830. 10 Calculate the greatest common divisor of 5319 and 167373. 27 What is the highest common factor of 5564296 and 1? 1 What is the highest common divisor of 8 and 134125104? 8 Calculate the greatest common divisor of 4891958896 and 88. 88 Calculate the highest common factor of 14856562 and 3616. 226 What is the greatest common factor of 129376478 and 2198? 2198 Calculate the highest common factor of 14605 and 2913761. 127 What is the greatest common factor of 1064 and 4761960? 56 Calculate the highest common divisor of 596 and 895639. 149 Calculate the highest common factor of 152977321 and 7. 7 Calculate the greatest common divisor of 234 and 41219958. 78 What is the greatest common divisor of 182 and 87892922? 26 What is the greatest common divisor of 11639130 and 30? 30 Calculate the highest common factor of 819070 and 3290. 70 What is the highest common factor of 127 and 639959? 1 Calculate the highest common divisor of 44668772 and 152. 76 Calculate the highest common factor of 672 and 78622992. 336 What is the highest common factor of 14 and 36804229? 7 What is the highest common factor of 15 and 146562705? 15 Calculate the highest common divisor of 848235 and 48. 3 Calculate the greatest common factor of 21098154 and 1540. 154 What is the greatest common divisor of 282764 and 2349604? 1268 What is the highest common divisor of 1193600 and 5450? 50 Calculate the highest common divisor of 18871 and 66299. 167 What is the highest common divisor of 448 and 233554? 2 Calculate the highest common factor of 12710 and 42635695. 6355 Calculate the highest common divisor of 546 and 46566429. 273 Calculate the highest common factor of 14800 and 66094950. 1850 What is the highest common divisor of 94851 and 4446? 9 Calculate the highest common divisor of 11031417 and 20304. 1269 Calculate the highest common factor of 12718448 and 1569476. 8132 What is the greatest common divisor of 15 and 48838005? 15 What is the greatest common factor of 2486904 and 1806? 42 Calculate the greatest common factor of 48498394 and 434. 14 Calculate the highest common factor of 449388 and 784458. 3942 What is the highest common factor of 69306516 and 10096? 2524 What is the highest common factor of 42 and 21943716? 6 Calculate the highest common factor of 763320 and 456. 24 Calculate the highest common factor of 2009179 and 1028065. 1619 Calculate the greatest common factor of 40930526 and 3094. 3094 Calculate the highest common divisor of 1363221 and 18. 9 What is the highest common divisor of 7146 and 131778? 18 Calculate the highest common divisor of 189878034 and 3918. 3918 Calculate the greatest common factor of 124136 and 46138. 118 What is the highest common factor of 6097315 and 148225? 245 Calculate the highest common factor of 446760 and 847620. 3060 What is the greatest common factor of 414248 and 12084? 212 Calculate the highest common divisor of 8721460 and 27840. 580 Calculate the greatest common divisor of 288208 and 20400. 16 Calculate the greatest common divisor of 36 and 94668012. 36 What is the highest common factor of 1972 and 84821636? 1972 Calculate the greatest common divisor of 108 and 1364572. 4 What is the highest common factor of 8209862 and 137? 137 What is the greatest common factor of 104 and 13036036? 52 What is the highest common factor of 245163 and 1325499? 213 Calculate the greatest common divisor of 127982811 and 33. 33 Calculate the greatest common divisor of 835587 and 703071. 3681 Calculate the highest common factor of 13811592 and 132936. 4584 What is the greatest common divisor of 237552 and 57848? 56 What is the highest common divisor of 17936 and 2105238? 2242 Calculate the highest common factor of 1278795 and 373065. 1995 What is the greatest common divisor of 45050502 and 6? 6 What is the greatest common divisor of 18879176 and 1184? 296 Calculate the greatest common divisor of 1739061 and 118803. 597 What is the highest common divisor of 5431503 and 15? 3 Calculate the greatest common divisor of 135 and 1182087. 27 Calculate the greatest common factor of 8120 and 10480484. 812 Calculate the greatest common divisor of 7581 and 8730785. 2527 Calculate the greatest common divisor of 550697142 and 183. 183 Calculate the greatest common factor of 391 and 195593449. 391 What is the greatest common divisor of 2270528 and 45760? 832 Calculate the highest common factor of 17166008 and 1723022. 10702 What is the greatest common divisor of 133 and 2778181? 7 Calculate the greatest common factor of 1395 and 63344160. 1395 Calculate the highest common divisor of 2194977 and 6372. 177 Calculate the greatest common factor of 141346 and 153990. 58 Calculate the greatest common divisor of 510 and 6370665. 255 Calculate the greatest common factor of 14 and 2366017. 1 What is the greatest common divisor of 166528372 and 1784? 892 What is the highest common divisor of 336 and 35627676? 84 Calculate the highest common divisor of 3349216 and 18260. 332 What is the greatest common factor of 12776 and 480? 8 Calculate the highest common factor of 474 and 5892. 6 Calculate the greatest common factor of 30744 and 3475458. 126 Calculate the greatest common divisor of 1057518 and 1144. 22 What is the greatest common divisor of 1676 and 913125024? 1676 Calculate the highest common divisor of 111724942 and 14. 14 Calculate the greatest common factor of 370487 and 13. 13 What is the highest common factor of 2338085 and 20? 5 What is the greatest common divisor of 15865 and 33082700? 835 Calculate the highest common factor of 3402971 and 1197482. 7579 What is the highest common factor of 472 and 342392? 8 Calculate the highest common factor of 24108 and 188412. 84 Calculate the greatest common factor of 687810 and 34340. 1010 Calculate the greatest common factor of 60 and 286215. 15 Calculate the highest common divisor of 3915 and 18711351. 783 Calculate the greatest common factor of 264297270 and 85745. 7795 What is the highest common divisor of 18030459 and 433527? 7107 What is the highest common factor of 293300 and 21140? 140 Calculate the highest common factor of 129636 and 1979172. 468 What is the highest common divisor of 145 and 204378341? 29 Calculate the greatest common factor of 5583839575 and 25. 25 Calculate the greatest common divisor of 501382 and 1431913. 4249 Calculate the highest common factor of 26 and 679078. 2 What is the greatest common divisor of 1474 and 50271507? 737 What is the highest common divisor of 1224 and 30068784?	{ "pile_set_name": "DM Mathematics" }
+ 0x7 + 0 + 1/4x*4. What is the third derivative of f(v) wrt v? 360v*3 Let s(x) = 34x*4 - 11x*3 + 16x + 11. Let c(g) = 7g4 - 2g*3 + 3g + 2. Let m(r) = -11c(r) + 2s(r). What is the second derivative of m(i) wrt i? -108i2 Let a(n) = n2 + 3n - 5. Let z be a(-5). What is the third derivative of 3j5 - 2jz + j2 - 2j5 wrt j? -60j*2 Let v(n) be the second derivative of 0 - 1/3n*3 + 1/4n*4 + 0n*2 + 2n. What is the second derivative of v(m) wrt m? 6 Suppose -4n + n = -c - 11, 0 = 3n + 3c + 9. What is the third derivative of -s2 + s4 - 4s*n - 4s*4 + 4s*2 wrt s? -72s What is the second derivative of 12d4 - 4d - 6d5 - 12d*4 wrt d? -120d*3 Let j(k) = -210k*3 - 265k. Let q(p) = -19p3 - 24p. Let o(f) = -4j(f) + 45q(f). What is the second derivative of o(n) wrt n? -90n What is the second derivative of 4t - 3t - 5t - 2t4 + 6t*4 wrt t? 48t*2 Let r(o) = -3 - o + 5 - 3. Let c(k) = -11. Let b(s) = c(s) - 6r(s). Find the first derivative of b(i) wrt i. 6 Let v(g) be the first derivative of 0g - g - g2 - 2 - 1 + 3g. Find the first derivative of v(a) wrt a. -2 Let c(j) be the third derivative of -5j8/112 - 7j*4/12 + 14j*2. What is the second derivative of c(a) wrt a? -300a*3 What is the third derivative of -12s*2 - 23s4 - s2 + 45s2 wrt s? -552s Let x(m) be the second derivative of 0m7 + 0m*5 + 0m*3 + 0 - 1/4m*4 - 2m + 0m2 + 0m*6 + 1/56m*8. What is the third derivative of x(f) wrt f? 120f*3 What is the second derivative of -78w*3 + 78w*3 + 0w*5 - 10w + 3w5 wrt w? 60w*3 Let y(n) = -22n - 2. Let l(w) = -22w - 1. Let q(k) = 5l(k) - 4y(k). What is the first derivative of q(b) wrt b? -22 Find the third derivative of -z2 - 12z*5 + 9z*2 + 8z*2 - 2z*5 wrt z. -840z2 Let d(y) = -y3 + 3y2 + 4y - 3. Let p be d(3). Find the third derivative of -2u2 + 5u*2 - pu*2 - 5u*5 wrt u. -300u*2 What is the second derivative of -2 + 2 + 104f*2 - 4f - 97f2 wrt f? 14 Let q = 8 + -3. Let x(a) = 1. Let v(o) = 5o*2 + 2o - 5. Let y(u) = qx(u) + v(u). Find the second derivative of y(f) wrt f. 10 Let m be (-2)/(-3) + 11 + -11. Let x(g) be the first derivative of -1 + 0g - mg3 + 0g*2 + 1/2g*4. Find the third derivative of x(i) wrt i. 12 Let p be -4-11/1. Suppose 3m - 31 = -3z - 2m, 0 = -3z - 4m + 26. What is the second derivative of y - yz - 4 + p wrt y? -2 Find the third derivative of q3 + 0q3 - 38q*2 + 30q*2 wrt q. 6 Let j(b) = 2b*3 - 3b*2 - 3b + 1. Let t(c) = -2c3 + 4c*2 + 4c. Let n = -3 + 7. Let o(m) = nj(m) + 3t(m). Differentiate o(k) with respect to k. 6k2 Find the second derivative of -12s - s*4 + 7s + 6s wrt s. -12s2 Let j(o) = -o3 - o + 1. Let i(q) = 40q3 + 33q - 4. Let m(y) = -i(y) - 4j(y). What is the second derivative of m(v) wrt v? -216v Find the first derivative of 4 + 2 + 1 - 6r2 - 3 wrt r. -12r Let z be (-9)/12 + (-15)/(-20). Let o(n) be the second derivative of -2n + 1/12n*4 - 1/3n*3 + 0 + zn*2. What is the second derivative of o(k) wrt k? 2 Let d = 8 - 4. Differentiate 2 - d + 3 + 2u - 2 wrt u. 2 Suppose -3u + 6 = -0u. Find the first derivative of uq - q - 1 - 3q + 2 wrt q. -2 Let a(z) be the second derivative of 29z6/30 - 2z*2 + 20z. Differentiate a(b) with respect to b. 116b3 Let r = 40 + -36. Let d(n) be the third derivative of 0 + 0n + 1/60n5 - 1/6n*r + 0n*3 - 3n2. What is the second derivative of d(i) wrt i? 2 Let s(u) be the first derivative of u6/10 + 2u2 + u + 2. Let a(q) be the first derivative of s(q). Differentiate a(t) wrt t. 12t*3 Suppose 3y + 6 = y. Let a = 0 - y. Differentiate aq3 - 43q*2 - 4 + 43q*2 wrt q. 9q*2 Let g(x) be the third derivative of -5x9/504 + x8/48 - 47x5/60 - 7x*2 + 2. Find the third derivative of g(o) wrt o. -600o*3 + 420o*2 Let y be 13(4 - 3). What is the third derivative of yu3 - u3 - 3u2 - 8u*3 wrt u? -36 Let c be (6/(-8))/(1/(-92)). Let j be c/15 - 2/(-5). Find the second derivative of -2o + o*j - 2o*5 + 3o wrt o. -20o3 Let i(g) be the second derivative of 7g*6/15 - 14g*2 + 8g. Differentiate i(h) with respect to h. 56h3 Differentiate 8 - 16t*3 - 7t*2 + 7t*2 - 21 wrt t. -48t*2 Let z(p) = p + 18. Let d be z(-15). What is the first derivative of 2 - ds*3 + 2s*3 - 13 wrt s? -3s*2 Let f(v) = v + 4. Let h be f(-4). Let j(o) be the first derivative of -1/4o*4 - 1 - 1/2o*2 + ho*3 + 0o. Find the second derivative of j(x) wrt x. -6x Let y = -10 - -17. Find the first derivative of -1 + u + 4 - y wrt u. 1 Let l(w) be the second derivative of w5/60 + w4/12 + w2 - 2w. Let i(t) be the first derivative of l(t). What is the second derivative of i(r) wrt r? 2 Let r(k) be the third derivative of -7k5/30 - 3k*3 - 16k*2. Find the first derivative of r(v) wrt v. -28v Find the third derivative of -4d4 + 4d*2 - 3d*2 - 3d*4 wrt d. -168d Find the third derivative of -6y2 + 4y4 + y6 - 4y4 wrt y. 120y*3 Let t be ((-27)/6 + 4)-16. Let c(n) be the first derivative of 3 + 1/3n*3 - tn + 0n2. Differentiate c(a) wrt a. 2a Let a = 2 - 1. What is the third derivative of 3j2 - 2j*4 - 1 - 4j*4 + a wrt j? -144j Let y(v) be the first derivative of v*4 + 3/2v*2 + 0v*3 + 0v - 3. What is the second derivative of y(x) wrt x? 24x Let b be (6/9)/(2/6). What is the third derivative of -y + y + by5 + y5 - 3y2 wrt y? 180y*2 Let y = -13 - -22. Let k = -4 + y. What is the second derivative of -3w + w + 0w - 2w*k wrt w? -40w*3 Find the third derivative of -25z*2 + 6z*2 - 136z*5 + 158z*5 wrt z. 1320z2 Let j(z) = z5 - z4 + z2 + z. Let q = 14 - 10. Let o(n) = -6n5 + 4n4 - n2 - 4n. Let t(a) = qj(a) + o(a). Find the third derivative of t(g) wrt g. -120g2 Let h(r) be the second derivative of -29r7/42 + r4/6 - 7r3/2 - 55r + 1. Find the third derivative of h(j) wrt j. -1740j2 Let r(i) be the second derivative of -9i5/10 + i4/3 + 14i. Find the third derivative of r(v) wrt v. -108 Let a(f) = f3 + 5f*2 - f + 3. Let j be a(-5). Find the third derivative of 0w5 - w5 - jw2 + 3w*5 wrt w. 120w2 Let m(f) be the third derivative of -f7/840 - f4/8 - f3/6 - 3f2. Let c(g) be the first derivative of m(g). Differentiate c(h) with respect to h. -3h*2 Find the third derivative of 10g*6 + 0g*2 - 4g*2 - 4g*6 wrt g. 720g*3 Let g be (-2 - -1)(1 + -3). Find the second derivative of 6k2 - 3k - 6kg + 3k*4 wrt k. 36k*2 Let t(n) = n. Let g be t(2). What is the third derivative of 5y*g + 2y - y*6 - 2y wrt y? -120y3 Let a = -9 + 12. What is the second derivative of 5m - 3m3 - ma - m3 wrt m? -30m Let k(x) = -1. Let v(n) = n*2 + 1. Let y(t) = -k(t) + 4v(t). What is the first derivative of y(i) wrt i? 8i Let s be 1/(-3)-151. Suppose -3w = -4x + 2w + 28, 0 = sx + 5w + 10. What is the first derivative of -x + d - d - 2d wrt d? -2 Let q = 10 + -39/4. Let u(c) be the first derivative of 1 + c2 + qc*4 + 0c + 0c3. What is the second derivative of u(i) wrt i? 6i Let v(i) = 3i - 6. Let c be v(4). Let y = c - 2. Find the first derivative of -py - 1 - 2 + 0p*2 + 0p*2 wrt p. -4p*3 Let s(n) be the first derivative of 5 - 5n - n + 0n - n2 + 5n. Find the first derivative of s(g) wrt g. -2 Differentiate -6 + 9i + 1 - 8 + 17 wrt i. 9 Suppose -2v + 2u + 34 = 0, 4u + 15 = 2v - 21. Find the first derivative of 14 - 5c*2 - 28 + v wrt c. -10c Suppose -4j + 104 = -24. Find the third derivative of 2o*4 - 32 - 2o*2 + j wrt o. 48o Let l(t) = t - 1. Suppose -3x - 8 = -4g, -3g + 12 + 7 = x. Let q(k) = -2k - 2k + k + 4k. Let h(d) = gq(d) - 3l(d). Differentiate h(m) wrt m. 2 Let j = -5/6 - -7/6. Let k(q) be the second derivative of 0 + 1/6q4 + 0q*2 - q + jq*3. What is the second derivative of k(h) wrt h? 4 What is the second derivative of 3w - 9w - 19w*5 - 7w wrt w? -380w3 Let k(q) be the third derivative of 8q9/63 - q5/4 + 8q2 + 1. What is the third derivative of k(d) wrt d? 7680d*3 Find the third derivative of -1026r*3 - 5r**4 +	{ "pile_set_name": "DM Mathematics" }
8). 7 Let p(h) = -7h2 - 90h + 21. What is p(-13)? 8 Let s(f) = f*2 - 682f + 30388. Determine s(48). -44 Let m(y) = -8y2 - 14y + 7. What is m(-3)? -23 Let z(j) = 2j3 + 5j2 + j - 35. Give z(4). 177 Let d(l) = -l3 + 99l2 - 91l - 820. What is d(98)? -134 Let u(d) = -d*3 + 5d*2 + 86d - 508. Determine u(7). -4 Let s(l) = -3l2 - 39l + 84. Give s(2). -6 Let s(a) = -a*3 - 8a*2 + 48a - 65. Give s(-15). 790 Let f(u) = -2u3 - 28u*2 + 63u - 19. Calculate f(-16). -3 Let s(m) = -17395m + 2. What is s(0)? 2 Let g(a) = a3 - 2a*2 - 18a - 28. Give g(-3). -19 Let g(v) = 4v + 106. Determine g(0). 106 Let t(v) = -v3 - 3v*2 - v + 3. Give t(-5). 58 Let v(c) = 3c*2 - 7c + 12. Determine v(5). 52 Let r(s) = -87s3 - 4s*2 + 4s - 1. Give r(1). -88 Let g(m) = 5m2 + 322m + 119. Determine g(-64). -9 Let q(n) = 70n + 52. Give q(-4). -228 Let q(n) = -n3 - 18n*2 - 53n + 25. What is q(-11)? -239 Let p(y) = 53y + 710. Calculate p(-13). 21 Let j(n) = 56n*3 - n. Give j(-1). -55 Let w(j) = -9j*2 + 63j - 8. Give w(7). -8 Let f(z) = z*2 - 99z + 87. Determine f(98). -11 Let j(h) = 4569h - 45690. Determine j(10). 0 Let u(c) = -1344c - 6698. What is u(-5)? 22 Let s(j) = -46j + 3324. What is s(76)? -172 Let p(j) = -j2 + 148j - 4984. What is p(96)? 8 Let j(i) = -8i3 - 18i*2 + 18i + 1. Give j(1). -7 Let l(h) = -115h + 117. Determine l(-1). 232 Let b(l) = 2l*3 - 174l*2 - 906l + 31. Determine b(-5). -39 Let w(j) = 2j2 + 9j - 8. Calculate w(-8). 48 Let a(f) = -f*3 - 163f*2 - 5236f - 1. What is a(-119)? -1 Let j(t) = 9t3 - 46t*2 + 22t - 10. Calculate j(5). 75 Let l(k) = 2k2 + 187k + 2705. Calculate l(-18). -13 Let k(a) = 89a - 962. Calculate k(9). -161 Let c(b) = 270b + 6209. Calculate c(-23). -1 Let u(q) = -2q3 + 20q*2 + 4q - 18. What is u(9)? 180 Let m(j) = -j*3 - 4j*2 - 194j - 1234. What is m(-6)? 2 Let m(n) = -n*2 - 30n - 49. What is m(-23)? 112 Let t(b) = 4b2 - 67b + 282. What is t(8)? 2 Let p(i) = 2i2 - 33i - 58. Determine p(19). 37 Let j(p) = 2p2 - 11p - 29. What is j(-8)? 187 Let s(r) = -3r2 - 67r + 22. Determine s(-22). 44 Let l(y) = -63y + 602. Give l(9). 35 Let l(n) = 19n + 151. Determine l(-24). -305 Let c(o) = -o*3 - 4o*2 + 18o - 31. Determine c(-8). 81 Let w(i) = -410i2 + 63145i - 770. Calculate w(154). 0 Let i(x) = 11x3 + 4x2 - 4. What is i(-1)? -11 Let g(y) = y3 - 6y2 - 17y + 51. Give g(7). -19 Let x(k) = -k*3 - 4k*2 - 2k + 14. Determine x(-3). 11 Let k(z) = -696z - 20864. Give k(-30). 16 Let g(w) = -w2 - 10. Calculate g(9). -91 Let p(b) = b2 + 13b + 9. Give p(-5). -31 Let s(l) = l*2 - 74l + 349. Calculate s(5). 4 Let z(f) = 3f2 + 49f + 157. What is z(-3)? 37 Let g(c) = 108c - 15. Determine g(-1). -123 Let n(c) = c3 + 6c*2 - 22c - 26. Calculate n(-9). -71 Let s(w) = 25w2 + 96w + 67. Calculate s(-3). 4 Let a(t) = 50t3 - 7t*2 - 5t + 3. Calculate a(-2). -415 Let z(s) = -11s2 + 14s. Calculate z(2). -16 Let q(x) = 2x2 + 142x - 620. Give q(-75). -20 Let q(w) = 5w + 69. Calculate q(9). 114 Let g(z) = 37z*2 + 207z + 110. Determine g(-5). 0 Let q(k) = 596k2 + 6556k - 13. Give q(-11). -13 Let p(i) = -i*3 + 55i*2 - 262i + 595. Determine p(50). -5 Let d(u) = 4u2 - 538u - 4860. Calculate d(143). 2 Let m(b) = 13b2 - 600b - 600. Calculate m(-1). 13 Let j(l) = -20l - 62. Give j(-3). -2 Let g(c) = -2c*3 + 44c*2 + 55c - 153. Determine g(23). 54 Let y(t) = 1796t - 7245. What is y(4)? -61 Let y(r) = 10r*2 - 53r + 68. Calculate y(3). -1 Let f(n) = 10n2 + 833n + 191. What is f(-83)? -58 Let f(q) = -3q - 50. What is f(-32)? 46 Let g(d) = -77d - 1700. Give g(-22). -6 Let n(q) = -95q2 - 3q - 4. What is n(-1)? -96 Let w(m) = 3m3 + 8m*2 + 11m - 7. Give w(4). 357 Let m(c) = c*2 - 53c + 696. Calculate m(24). 0 Let l(i) = 5i2 - 58i + 5. Determine l(12). 29 Let q(f) = -f*3 - 3f*2 + 4f - 8. Calculate q(-5). 22 Let l(w) = w*3 - 8w*2 - 23w + 11. What is l(11)? 121 Let g(z) = 9z3 + 7z*2 + 5z - 4. Calculate g(-4). -488 Let k(g) = -120g3 + 45g*2 + 44g - 3. Determine k(-1). 118 Let u(n) = -116n + 13447. Determine u(116). -9 Let c(h) = -647h*3 + 3h*2 - 4h. Calculate c(1). -648 Let a(c) = -14c3 - 81c*2 + 15c + 4. Determine a(-6). 22 Let m(l) = -l*3 - 14l*2 + 57l + 103. Calculate m(-17). 1 Let c(f) = -45f - 428. Give c(-6). -158 Let x(o) = -77o + 1925. Give x(30). -385 Let m(v) = 6v + 77. Determine m(-13). -1 Let v(l) = -29l + 1174. Calculate v(42). -44 Let l(o) = o*2 + 58o - 1285. Determine l(17). -10 Let l(p) = p*2 - 6p - 195. Give l(0). -195 Let j(i) = i*3 + 17i*2 - i. Give j(-17). 17 Let d(v) = -1775v - 166854. What is d(-94)? -4 Let d(q) = -q*3 - 11q*2 + 5q + 30. Calculate d(-13). 303 Let m(k) = 40k3 + 515k*2 - 66k - 8. Determine m(-13). 5 Let r(d) = 5333d - 10675. Determine r(2). -9 Let n(d) = -2855d - 65673. Determine n(-23). -8 Let v(t) = -t*3 + 52t*2 + 144t + 1152. Determine v(55). -3 Let o(u) = -u*3 - 32u*2 - 89u - 1794. Determine o(-31). 4 Let o(p) = p*3 - 58p*2 - 59p + 4. Determine o(59). 4 Let g(w) = 11w2 - 13w - 4. Determine g(3). 56 Let s(t) = 11t2 + 36t - 13. Determine s(-3). -22 Let n(q) = -q*3 + 121q*2 + 119q + 364. Determine n(122). -2 Let x(k) = 91k - 1370. Determine x(15). -5 Let w(j) = -2j*2 - 46j + 15. Give w(-26). -141 Let d(j) = -4j2 - 288j + 3. Determine d(-72). 3 Let r(u) = 160u - 370. What is r(5)? 430 Let t(k) = -27k + 22. Give t(3). -59 Let o(v) = -v*3 - 130v*2 + 129v - 504. What is o(-131)? -242 Let b(l) = -14l2 - 120l + 1227. Give b(6). 3 Let s(t) = -4t3 + 6t*2 + 24t - 16. What is s(3)? 2 Let c(z) = -4z - 27. Give c(-6). -3 Let p(j) = -j3 - 8j*2 - 97j - 639. Calculate p(-7). -9 Let c(a) = a*2 + 112a - 17292. Give c(87). 21 Let z(v) = -v*2 + 26v - 49. Determine z(16). 111 Let s(i) = 19i2 - 259i - 74. Give s(14). 24 Let w(p) = -p*3 + 37p*2 + 49p - 423. What is w(38)? -5 Let k(v) = v*2 + 82v + 1110. What is k(-45)? -555 Let r(b) = 19b + 33. Give r(10). 223 Let r(c) = 23c + 214. Determine r(-4). 122 Let f(g) = g*2 + 17g + 34. Calculate f(-15). 4 Let b(v) = 18v3 - 18v*2 + 4v - 3. Determine b(1). 1 Let i(j) = 2j2 - 18j - 1789. What is i(-26)? 31 Let j(c) = 295c - 2392. Give j(8). -32 Let t(p) = -p2 - 2559p - 22935. Give t(-9). 15 Let x(w) = 12w3 + 479w*2 - 38w + 59. Calculate x(-40). -21 Let u(b) = b*3 + 15b*2 + 28b - 72. Calculate u(-12). 24 Let s(r) = -54r - 603. Give s(-11). -9 Let g(f) = f3 + 72f*2 + 4f + 243. Give g(-72). -45 Let u(b) = 114b - 664. Determine u(11). 590 Let n(v) = 1619v - 21176. What is n(13)? -129 Let y(r) = -74r - 490. Calculate y(-7). 28 Let p(i) = -492i - 908. What is p(-2)? 76 Let z(v) = 2v3 + 2278v*2 + 13597v + 3. What is z(-6)? -3 Let y(r) = -r*2 + 28r + 501. What is y(40)? 21 Let v(z) = -z*3 + 105z*2 - 84z - 2089. Calculate v(104). -9 Let h(t) = 3t3 - 58t*2 - 102t - 48. Calculate h(21). 15 Let p(w) = 3w2 - 59w + 306. Determine p(12). 30 Let g(o) = 22o + 332. Determine g(-7). 178 Let n(s) = -570s + 65531. What is n(115)? -19 Let j(p) = p*2 + 113p + 846. Determine j(-105). 6 Let w(a) = a*2 - 82a - 814. What is w(-9)? 5 Let s(x) = 4x2 - 73x + 199. Give s(3). 16 Let o(l) = -3l2 - 185l - 120. Determine o(-61). 2 Let f(q) = -3q2 + 25q + 57. Give f(10). 7 Let m(w) = -w*3 + 39w*2 + 44w - 160. Determine m(40). 0 Let y(h) = -677h + 4072. Give y(6). 10 Let w(l) = -3l*3 - 4l*2 + 5l + 16. Give w(4). -220 Let g(b) = 165b + 665. Give g(-4). 5 Let j(d) = -2d*3 - 11d*2 - 24d + 1. Determine j(-5). 96 Let o(m) = -m*3 + 123m*2 - 243m + 118. Give o(121). -3 Let o(v) = -v*3 - 8v*2 + 110v + 899. Give o(-9). -10 Let u(i) = -3i2 + 2i + 51. What is u(7)? -82 Let c(j) = -319j + 2888. Calculate c(9). 17 Let m(w) = 12w3 - w2 + 9w + 3. What is m(-3)? -357 Let i(n) = -2n*2 - 71n - 212. Calculate i(-4). 40 Let n(z) = -3z - 163. Give n(-4). -151 Let i(x) = -19x - 60. Give i(-3). -3 Let a(t) = -2t3 - 181t*2 + 465t - 58. Calculate a(-93). -58 Let f(m) = -24*m + 605. Give f(26). -19 Let z(p) = 27	{ "pile_set_name": "DM Mathematics" }
387? 1 What is the thousands digit of 63105? 3 What is the units digit of 1350? 0 What is the hundreds digit of 328? 3 What is the units digit of 740? 0 What is the units digit of 652? 2 What is the hundreds digit of 6447? 4 What is the thousands digit of 100950? 0 What is the thousands digit of 1739? 1 What is the thousands digit of 2183? 2 What is the units digit of 1193? 3 What is the units digit of 96923? 3 What is the ten thousands digit of 38439? 3 What is the units digit of 1140? 0 What is the tens digit of 1485? 8 What is the hundreds digit of 7070? 0 What is the units digit of 26244? 4 What is the hundreds digit of 4322? 3 What is the tens digit of 9040? 4 What is the units digit of 4654? 4 What is the hundreds digit of 32939? 9 What is the hundreds digit of 45606? 6 What is the units digit of 723? 3 What is the units digit of 1648? 8 What is the hundreds digit of 7679? 6 What is the hundreds digit of 339? 3 What is the tens digit of 202? 0 What is the units digit of 190529? 9 What is the units digit of 4034? 4 What is the hundreds digit of 275? 2 What is the tens digit of 851? 5 What is the hundreds digit of 85096? 0 What is the thousands digit of 3854? 3 What is the hundreds digit of 334? 3 What is the tens digit of 1810? 1 What is the units digit of 232? 2 What is the tens digit of 9661? 6 What is the units digit of 3460? 0 What is the units digit of 104281? 1 What is the units digit of 763? 3 What is the units digit of 30600? 0 What is the units digit of 37143? 3 What is the hundreds digit of 9911? 9 What is the units digit of 11829? 9 What is the hundreds digit of 14483? 4 What is the hundreds digit of 14839? 8 What is the tens digit of 790? 9 What is the tens digit of 6619? 1 What is the tens digit of 11056? 5 What is the units digit of 7553? 3 What is the hundreds digit of 12912? 9 What is the tens digit of 8205? 0 What is the thousands digit of 24648? 4 What is the tens digit of 43805? 0 What is the thousands digit of 2779? 2 What is the tens digit of 21710? 1 What is the hundreds digit of 17479? 4 What is the hundreds digit of 914? 9 What is the hundreds digit of 440? 4 What is the hundreds digit of 337? 3 What is the ten thousands digit of 16899? 1 What is the ten thousands digit of 10880? 1 What is the hundreds digit of 4802? 8 What is the hundreds digit of 171183? 1 What is the tens digit of 3921? 2 What is the units digit of 845? 5 What is the hundred thousands digit of 179622? 1 What is the units digit of 2193? 3 What is the units digit of 3785? 5 What is the ten thousands digit of 22621? 2 What is the thousands digit of 16554? 6 What is the hundreds digit of 18723? 7 What is the hundreds digit of 4801? 8 What is the units digit of 652? 2 What is the hundreds digit of 2270? 2 What is the hundred thousands digit of 129703? 1 What is the tens digit of 3538? 3 What is the thousands digit of 2149? 2 What is the units digit of 376? 6 What is the tens digit of 244? 4 What is the units digit of 2314? 4 What is the units digit of 8205? 5 What is the units digit of 11213? 3 What is the tens digit of 1064? 6 What is the ten thousands digit of 27600? 2 What is the units digit of 24434? 4 What is the tens digit of 40305? 0 What is the hundreds digit of 125075? 0 What is the tens digit of 4335? 3 What is the thousands digit of 1960? 1 What is the thousands digit of 2631? 2 What is the units digit of 3715? 5 What is the tens digit of 48341? 4 What is the thousands digit of 28200? 8 What is the units digit of 1231? 1 What is the hundreds digit of 158? 1 What is the ten thousands digit of 67501? 6 What is the units digit of 421? 1 What is the thousands digit of 4459? 4 What is the units digit of 50580? 0 What is the hundreds digit of 106826? 8 What is the hundreds digit of 642? 6 What is the tens digit of 792? 9 What is the units digit of 40666? 6 What is the hundreds digit of 735? 7 What is the hundreds digit of 4464? 4 What is the units digit of 11797? 7 What is the thousands digit of 7759? 7 What is the thousands digit of 1017? 1 What is the tens digit of 577? 7 What is the hundreds digit of 8724? 7 What is the units digit of 524? 4 What is the units digit of 2069? 9 What is the hundreds digit of 410? 4 What is the hundreds digit of 13492? 4 What is the hundreds digit of 1935? 9 What is the tens digit of 14497? 9 What is the tens digit of 7069? 6 What is the thousands digit of 1332? 1 What is the ten thousands digit of 14498? 1 What is the hundreds digit of 3290? 2 What is the hundreds digit of 57454? 4 What is the hundreds digit of 787? 7 What is the thousands digit of 8163? 8 What is the hundreds digit of 2642? 6 What is the hundreds digit of 73071? 0 What is the units digit of 138392? 2 What is the tens digit of 94? 9 What is the hundreds digit of 38507? 5 What is the hundreds digit of 8794? 7 What is the tens digit of 1413? 1 What is the hundreds digit of 24295? 2 What is the ten thousands digit of 80779? 8 What is the ten thousands digit of 27477? 2 What is the units digit of 593? 3 What is the hundreds digit of 625? 6 What is the thousands digit of 8070? 8 What is the tens digit of 291? 9 What is the tens digit of 192? 9 What is the hundreds digit of 72856? 8 What is the hundreds digit of 40562? 5 What is the tens digit of 113763? 6 What is the units digit of 375? 5 What is the tens digit of 21? 2 What is the hundreds digit of 177? 1 What is the units digit of 12237? 7 What is the units digit of 7487? 7 What is the tens digit of 81948? 4 What is the thousands digit of 3197? 3 What is the tens digit of 227? 2 What is the hundreds digit of 843? 8 What is the units digit of 1709? 9 What is the units digit of 454? 4 What is the tens digit of 877? 7 What is the hundreds digit of 1381? 3 What is the units digit of 5558? 8 What is the tens digit of 4878? 7 What is the hundreds digit of 221? 2 What is the thousands digit of 95156? 5 What is the tens digit of 426? 2 What is the tens digit of 46239? 3 What is the tens digit of 54627? 2 What is the tens digit of 26700? 0 What is the units digit of 724? 4 What is the tens digit of 10398? 9 What is the units digit of 6087? 7 What is the thousands digit of 18673? 8 What is the units digit of 6718? 8 What is the thousands digit of 7277? 7 What is the thousands digit of 7565? 7 What is the thousands digit of 42094? 2 What is the tens digit of 2206? 0 What is the units digit of 144? 4 What is the ten thousands digit of 89292? 8 What is the tens digit of 246? 4 What is the tens digit of 57636? 3 What is the tens digit of 3042? 4 What is the tens digit of 2030? 3 What is the thousands digit of 41241? 1 What is the hundreds digit of 998? 9 What is the hundreds digit of 47430? 4 What is the hundreds digit of 84263? 2 What is the thousands digit of 6071? 6 What is the thousands digit of 15968? 5 What is the thousands digit of 48978? 8 What is the tens digit of 27233? 3 What is the hundreds digit of 5012? 0 What is the ten thousands digit of 25052? 2 What is the tens digit of 4398? 9 What is the thousands digit of 1688? 1 What is the units digit of 86954? 4 What is the hundreds digit of 708? 7 What is the hundreds digit of 10449? 4 What is the ten thousands digit of 19690? 1 What is the tens digit of 23168? 6 What is the hundreds digit of 578? 5 What is the thousands digit of 10211? 0 What is the tens digit of 2733? 3 What is the thousands digit of 7067? 7 What is the units digit of 8604? 4 What is the thousands digit of 1425? 1 What is the hundreds digit of 2436? 4 What is the tens digit of 44116? 1 What is the hundreds digit of 742? 7 What is the thousands digit of 10103? 0 What is the hundreds digit of 3683? 6 What is the tens digit of 932? 3 What is the units digit of 3591? 1 What is the tens digit of 1539? 3 What is the hundreds digit of 5271? 2 What is the thousands digit of 1013? 1 What is the hundreds digit of 876? 8 What is the hundreds digit of 396? 3 What is the hundreds digit of 66836? 8 What is the thousands digit of 12282? 2 What is the tens digit of 2247? 4 What is the thousands digit of 1420? 1 What is the tens digit of 59? 5 What is the hundreds digit of 3950? 9 What is the thousands digit of 2293? 2 What is the units digit of 3255? 5 What is the thousands digit of 12815? 2 What	{ "pile_set_name": "DM Mathematics" }
? 289 What is 154 minutes before 5:13 PM? 2:39 PM What is 595 minutes after 4:54 AM? 2:49 PM What is 665 minutes after 5:06 AM? 4:11 PM What is 332 minutes before 11:09 PM? 5:37 PM What is 27 minutes after 1:45 AM? 2:12 AM What is 707 minutes after 3:45 PM? 3:32 AM How many minutes are there between 3:43 AM and 8:22 AM? 279 How many minutes are there between 5:33 AM and 3:15 PM? 582 What is 707 minutes after 2:00 PM? 1:47 AM How many minutes are there between 8:34 PM and 7:53 AM? 679 What is 482 minutes before 1:16 AM? 5:14 PM How many minutes are there between 8:04 AM and 9:13 AM? 69 How many minutes are there between 7:31 PM and 4:59 AM? 568 What is 454 minutes before 8:20 AM? 12:46 AM What is 663 minutes after 1:39 AM? 12:42 PM What is 366 minutes after 4:44 PM? 10:50 PM What is 127 minutes before 12:53 PM? 10:46 AM How many minutes are there between 10:48 PM and 9:15 AM? 627 What is 67 minutes before 11:34 AM? 10:27 AM How many minutes are there between 8:25 AM and 4:46 PM? 501 What is 305 minutes before 8:22 AM? 3:17 AM What is 482 minutes after 2:03 PM? 10:05 PM What is 570 minutes after 2:10 AM? 11:40 AM How many minutes are there between 8:02 PM and 8:14 PM? 12 How many minutes are there between 7:59 AM and 4:33 PM? 514 How many minutes are there between 1:02 PM and 1:11 PM? 9 How many minutes are there between 5:43 PM and 8:02 PM? 139 What is 237 minutes before 7:29 PM? 3:32 PM How many minutes are there between 1:45 PM and 1:10 AM? 685 How many minutes are there between 3:24 PM and 4:27 PM? 63 How many minutes are there between 2:48 AM and 3:13 AM? 25 What is 19 minutes after 3:23 PM? 3:42 PM What is 605 minutes after 7:03 AM? 5:08 PM How many minutes are there between 9:56 PM and 6:01 AM? 485 What is 667 minutes after 7:49 AM? 6:56 PM What is 459 minutes before 5:14 PM? 9:35 AM What is 120 minutes before 7:30 AM? 5:30 AM How many minutes are there between 1:42 PM and 10:26 PM? 524 How many minutes are there between 2:33 PM and 6:02 PM? 209 How many minutes are there between 1:02 PM and 12:33 AM? 691 What is 485 minutes after 11:11 AM? 7:16 PM What is 646 minutes before 11:22 PM? 12:36 PM What is 657 minutes after 10:34 AM? 9:31 PM How many minutes are there between 12:28 AM and 11:48 AM? 680 How many minutes are there between 10:27 AM and 12:33 PM? 126 What is 372 minutes after 9:58 PM? 4:10 AM What is 687 minutes after 10:05 AM? 9:32 PM How many minutes are there between 7:20 PM and 9:03 PM? 103 What is 463 minutes before 7:27 AM? 11:44 PM What is 317 minutes after 12:57 AM? 6:14 AM What is 76 minutes before 9:22 PM? 8:06 PM What is 682 minutes after 7:20 PM? 6:42 AM How many minutes are there between 7:55 PM and 8:58 PM? 63 How many minutes are there between 9:55 AM and 6:54 PM? 539 What is 355 minutes after 9:07 PM? 3:02 AM How many minutes are there between 3:23 AM and 5:40 AM? 137 How many minutes are there between 6:30 AM and 6:19 PM? 709 What is 67 minutes after 1:35 PM? 2:42 PM What is 715 minutes before 2:19 AM? 2:24 PM What is 643 minutes before 12:51 PM? 2:08 AM What is 439 minutes before 12:32 PM? 5:13 AM What is 703 minutes before 2:26 AM? 2:43 PM What is 132 minutes after 5:18 AM? 7:30 AM How many minutes are there between 10:10 PM and 8:33 AM? 623 What is 643 minutes before 7:12 PM? 8:29 AM How many minutes are there between 3:10 PM and 7:34 PM? 264 What is 501 minutes before 12:22 AM? 4:01 PM What is 691 minutes before 8:42 PM? 9:11 AM How many minutes are there between 11:35 AM and 4:40 PM? 305 How many minutes are there between 5:04 AM and 7:33 AM? 149 What is 130 minutes after 5:12 PM? 7:22 PM What is 428 minutes after 9:39 AM? 4:47 PM How many minutes are there between 3:44 AM and 8:59 AM? 315 How many minutes are there between 6:51 PM and 3:03 AM? 492 What is 367 minutes before 10:46 PM? 4:39 PM What is 480 minutes after 7:16 AM? 3:16 PM What is 496 minutes after 1:29 AM? 9:45 AM What is 605 minutes before 5:56 PM? 7:51 AM What is 573 minutes before 7:14 AM? 9:41 PM How many minutes are there between 1:39 AM and 11:28 AM? 589 What is 703 minutes after 3:15 AM? 2:58 PM How many minutes are there between 9:04 AM and 11:54 AM? 170 What is 391 minutes after 5:50 AM? 12:21 PM How many minutes are there between 1:01 AM and 9:24 AM? 503 How many minutes are there between 8:41 PM and 6:38 AM? 597 What is 573 minutes before 10:27 AM? 12:54 AM What is 137 minutes after 11:00 AM? 1:17 PM How many minutes are there between 1:06 PM and 5:20 PM? 254 What is 136 minutes after 6:13 AM? 8:29 AM What is 599 minutes before 2:10 AM? 4:11 PM How many minutes are there between 4:41 PM and 9:01 PM? 260 How many minutes are there between 8:33 PM and 3:32 AM? 419 What is 166 minutes before 10:50 AM? 8:04 AM What is 53 minutes before 4:56 AM? 4:03 AM How many minutes are there between 10:52 PM and 8:25 AM? 573 What is 327 minutes after 8:21 PM? 1:48 AM What is 582 minutes before 10:50 AM? 1:08 AM How many minutes are there between 2:06 PM and 9:39 PM? 453 How many minutes are there between 9:45 AM and 7:04 PM? 559 How many minutes are there between 2:40 PM and 10:40 PM? 480 What is 145 minutes after 1:18 AM? 3:43 AM How many minutes are there between 5:34 AM and 7:03 AM? 89 What is 59 minutes after 4:10 PM? 5:09 PM What is 252 minutes after 3:20 PM? 7:32 PM How many minutes are there between 7:42 PM and 8:18 PM? 36 What is 120 minutes before 7:24 AM? 5:24 AM How many minutes are there between 5:24 PM and 1:14 AM? 470 What is 456 minutes after 11:49 PM? 7:25 AM How many minutes are there between 10:14 PM and 7:58 AM? 584 What is 581 minutes after 11:53 AM? 9:34 PM How many minutes are there between 5:02 PM and 11:50 PM? 408 How many minutes are there between 4:50 PM and 7:19 PM? 149 What is 595 minutes before 11:24 AM? 1:29 AM How many minutes are there between 4:23 PM and 5:05 PM? 42 What is 414 minutes after 2:33 AM? 9:27 AM What is 564 minutes after 4:39 PM? 2:03 AM What is 154 minutes before 8:10 AM? 5:36 AM What is 552 minutes after 4:03 PM? 1:15 AM How many minutes are there between 1:17 PM and 3:36 PM? 139 What is 53 minutes after 6:36 PM? 7:29 PM What is 153 minutes after 3:06 AM? 5:39 AM What is 660 minutes after 8:41 AM? 7:41 PM What is 211 minutes before 6:20 PM? 2:49 PM How many minutes are there between 4:04 PM and 1:45 AM? 581 How many minutes are there between 11:36 PM and 2:40 AM? 184 What is 324 minutes before 1:43 PM? 8:19 AM What is 644 minutes after 1:27 AM? 12:11 PM What is 40 minutes after 3:30 PM? 4:10 PM How many minutes are there between 10:00 AM and 7:44 PM? 584 How many minutes are there between 7:48 AM and 10:52 AM? 184 How many minutes are there between 3:44 AM and 6:23 AM? 159 What is 553 minutes after 5:40 AM? 2:53 PM How many minutes are there between 4:40 PM and 9:14 PM? 274 How many minutes are there between 1:12 AM and 10:18 AM? 546 How many minutes are there between 6:05 AM and 9:22 AM? 197 How many minutes are there between 6:41 AM and 5:20 PM? 639 How many minutes are there between 9:24 PM and 5:25 AM? 481 What is 144 minutes after 7:20 AM? 9:44 AM How many minutes are there between 12:18 AM and 10:57 AM? 639 How many minutes are there between 9:57 PM and 7:27 AM? 570 What is 652 minutes before 8:48 PM? 9:56 AM What is 159 minutes before 3:30 AM? 12:51 AM How many minutes are there between 10:26 AM and 8:37 PM? 611 How many minutes are there between 8:07 AM and 9:24 AM? 77 How many minutes are there between 7:10 PM and 7:20 PM? 10 How many minutes are there between 2:26 AM and 1:54 PM? 688 What is 304 minutes before 8:31 PM? 3:27 PM How many minutes are there between 2:14 AM and 11:32 AM? 558 How many minutes are there between 2:37 PM and 9:19 PM? 402 How many minutes are there between 10:29 AM and 3:38 PM? 309 What is 616 minutes after 10:04 PM? 8:20 AM How many minutes are there between 8:46 PM and 9:30 PM? 44 How many minutes are there between 10:42 PM and 11:20 PM? 38 What is 520 minutes before 11:13 AM? 2:33 AM What is 265 minutes after 4:04 AM? 8:29 AM How many minutes are there between 10:34 AM and 12:58 PM? 144 How many minutes are there between 9:37 PM and 5:38 AM? 481 What is 98 minutes before 1:00 AM? 11:22 PM How many minutes are there between 2:49 PM and 11:56 PM? 547 How many minute	{ "pile_set_name": "DM Mathematics" }
. 9 Simplify (sqrt(2448) + (sqrt(2448) + 2sqrt(2448) + -5 - sqrt(2448)) + -4 + sqrt(2448)-2 - (-4((sqrt(2448) - -1sqrt(2448)) + 1))*2)-3. 2268sqrt(17) + 470091 Simplify (sqrt(11) - (sqrt(11)3 + 2) - (sqrt(11) + (sqrt(11) + -6-4sqrt(11) + sqrt(11))*2)) + -4. -7442 - 3sqrt(11) Simplify -1 + 25-2(-6sqrt(128) - sqrt(128)). -1 + 1120sqrt(2) Simplify ((sqrt(500) + (-1sqrt(500) + 4 - sqrt(500)) - sqrt(500) - sqrt(500))2 + ((sqrt(20))21 - (sqrt(15)/sqrt(3) + 4)))1. -241sqrt(5) + 4532 Simplify (sqrt(21)2-5 + sqrt(231)/(sqrt(11)-2))/(sqrt(567)2 + sqrt(7) + sqrt(63)2). -21sqrt(3)/50 Simplify (-34sqrt(136))/(-4sqrt(392)). 3sqrt(17)/7 Simplify ((sqrt(176) - (2sqrt(176) + 4)) + sqrt(121)/(sqrt(539)-2))2. 228sqrt(11)/7 + 38875/196 Simplify (sqrt(228) + (sqrt(228) + sqrt(228)2)-2 + sqrt(228) + (-2sqrt(228) - sqrt(228))2)/(sqrt(48)/(sqrt(4)-23 - sqrt(4) - sqrt(4))). 80sqrt(19) Simplify 3 + -1(sqrt(132) + ((-1sqrt(132) + sqrt(132) + sqrt(132))-3 - sqrt(132) - sqrt(132) - sqrt(132)))/((sqrt(108)3)/sqrt(9)). 3 + 5sqrt(11)/3 Simplify ((3 + (-4 + -4 + sqrt(176) - sqrt(176)) + sqrt(176))1)2-6. -1206 + 240sqrt(11) Simplify ((sqrt(70)2 + sqrt(70))5 + sqrt(70) - 6sqrt(70)1)/(sqrt(50)/sqrt(45)1). 30sqrt(7) Simplify -1(sqrt(243)2 + 2) - (sqrt(243) + sqrt(243) + sqrt(243) + 1 + sqrt(243) + -1 + 3)2. -3899 - 234sqrt(3) Simplify (((3sqrt(1029) + sqrt(1029) + sqrt(1029))-1)/(sqrt(21)/sqrt(75) - (sqrt(847) + (-1sqrt(847) - sqrt(847)) + sqrt(847))))2. 91875 Simplify (sqrt(76) - (-2(sqrt(76) - (sqrt(76)-1 - sqrt(76))) - sqrt(76)) - sqrt(76)-24)/((5sqrt(40)-2 + sqrt(40))/sqrt(10)). -16sqrt(19)/9 Simplify 4(-12sqrt(76)-2 + -2). -8 + 32sqrt(19) Simplify ((2sqrt(132)52)/(sqrt(36)/((sqrt(72)/sqrt(3))/sqrt(8))))*24. 17600 Simplify ((sqrt(77) + (sqrt(77) - (sqrt(77) - (sqrt(77) + 1sqrt(77) + sqrt(77)))) + sqrt(77))3 - 21sqrt(77))/((2sqrt(448) - sqrt(448))1). 13sqrt(11)/8 Simplify (2 + (-3sqrt(475)-3 - sqrt(475) - (-4 + sqrt(475) + 3)))2. 210sqrt(19) + 23284 Simplify (-2sqrt(108))/sqrt(9) + sqrt(12) - ((sqrt(270) - sqrt(270)-3)/sqrt(10))/sqrt(9). -6sqrt(3) Simplify (1sqrt(432)43 - ((sqrt(432) - (sqrt(432) + -2 + sqrt(432) + sqrt(432) + 3 - sqrt(432))) + 1))*2. 73008 Simplify -2-6(-1 + sqrt(99) + -3 + sqrt(99) + 5 + 1sqrt(99)). 12 + 108sqrt(11) Simplify (sqrt(22)-31)/(sqrt(20)/(sqrt(10) + (sqrt(10) - sqrt(160)) + sqrt(10))). 3sqrt(11) Simplify 3 + (sqrt(1584) + 3 + sqrt(11) - (sqrt(11) - (sqrt(539) + (sqrt(539) + (sqrt(539) - (0 + sqrt(539) + sqrt(539))) + sqrt(539))*2))). 19sqrt(11) + 545 Simplify -4(2 + sqrt(75)) + ((2sqrt(21) + sqrt(21))/sqrt(7) + 1)*2. -14sqrt(3) + 20 Simplify 3 + 5 + (sqrt(125)/(sqrt(5) + sqrt(5)2))/sqrt(1280). sqrt(5)/48 + 8 Simplify 5 + (sqrt(125) + 2 + sqrt(125) + 0)-4. -40sqrt(5) - 3 Simplify -3(6(-1 + sqrt(2299)) + -5(sqrt(2299)1)2). -198sqrt(19) + 34503 Simplify (sqrt(102)/((sqrt(72)-1)/sqrt(12)) - (4(sqrt(153) + sqrt(17)) - (sqrt(1700) + 1)))*2. -14sqrt(17) + 834 Simplify ((sqrt(1900) + (sqrt(1900) + 1 + sqrt(1900) - sqrt(1900)) + 2 - sqrt(1900))*2 + -1)-6. -11448 - 360sqrt(19) Simplify -2 + (5 + sqrt(4032) + 0 + sqrt(4032) - ((sqrt(28) + sqrt(252)4)*2 - (sqrt(28) - (-4 + -2sqrt(28))*2))). -4857 + 18sqrt(7) Simplify sqrt(88)/((sqrt(200) + sqrt(8))4) + (sqrt(396) + 1 + (sqrt(396) + -2 - sqrt(396)))2. -287sqrt(11)/24 + 397 Simplify (3sqrt(152)-1 - sqrt(152))/(sqrt(24)/sqrt(3)-3)-4. -16sqrt(19)/3 Simplify 5(sqrt(95)/sqrt(5) + -3)*2 + 3((sqrt(19) + -2)-5 - sqrt(19)) + 1. -48sqrt(19) + 171 Simplify (-1sqrt(66)-1)/(sqrt(150) - (1sqrt(150) - sqrt(150))) + 6(0 + sqrt(11)) + 4 + sqrt(55)/sqrt(5). 4 + 36sqrt(11)/5 Simplify -4(sqrt(16)/(sqrt(8)/sqrt(2)))/(sqrt(108)/sqrt(6)). -4sqrt(2)/3 Simplify 5(sqrt(80) + 0 + sqrt(5)) - (-2 + sqrt(720) + -2). 4 + 13sqrt(5) Simplify (3 + (sqrt(2736) - -2sqrt(2736)1 - 3sqrt(2736)3) + 1)2. -576sqrt(19) + 98512 Simplify 0 + (-5(sqrt(272) + 4sqrt(272)))*2 + 0. 170000 Simplify (-1-6sqrt(468)11)2 + -4. 16844 Simplify -1-3((sqrt(70) - sqrt(70)2)/sqrt(10) - (-1 + sqrt(28))). -9sqrt(7) + 3 Simplify (sqrt(152) + (sqrt(152) - ((2sqrt(152) + sqrt(152))-4 + sqrt(152))) + (5-1sqrt(152) - sqrt(152)))/((sqrt(16) + (-2sqrt(144))/sqrt(9))/sqrt(2)). -7sqrt(19) Simplify -3(4(sqrt(204) + -1sqrt(204))-3)/(sqrt(36)/(sqrt(363)1)). 0 Simplify ((sqrt(7) - sqrt(49)/(sqrt(7) + (sqrt(42)/sqrt(6) - sqrt(7)))) + 4 - (5 + sqrt(7) + -1 + sqrt(42)/sqrt(150)))*2. 252/25 Simplify (4(sqrt(190)1 + sqrt(190))1)/(sqrt(160)3 - (sqrt(110) + sqrt(110) + (sqrt(110) - sqrt(110)2) + sqrt(110))/sqrt(11)). 4sqrt(19)/5 Simplify -4 + (((2 + sqrt(19))2 - sqrt(19)) + (sqrt(19) - (1 + sqrt(76))) + sqrt(19))1. -1 + sqrt(19) Simplify -1(5 + 2 + 4(sqrt(1377) - (sqrt(1377) + sqrt(1377)-2)))*26. -529062 - 6048sqrt(17) Simplify -4(-2(sqrt(468)-5)*2 + (sqrt(468)2 + sqrt(468))1). -72sqrt(13) + 93600 Simplify ((sqrt(18) + 5sqrt(18))-3)/(3sqrt(900)). -3sqrt(2)/5 Simplify -5(3 + ((1 + sqrt(1573) - sqrt(1573)) + 1 + sqrt(1573) + sqrt(1573)22)2). -196660 - 1100sqrt(13) Simplify -5(sqrt(2835)1-3)/(-4-1sqrt(5) - (1sqrt(45))/sqrt(9)). 45sqrt(7) Simplify ((sqrt(14) + (sqrt(168) + -1sqrt(168) - sqrt(168))/sqrt(12))/(sqrt(8) - ((sqrt(72) - sqrt(8)) + sqrt(8))))*2. 0 Simplify (-3 + (sqrt(3840) + (sqrt(3840) - ((sqrt(3840) + 2sqrt(3840) - sqrt(3840)) + sqrt(3840))))/(sqrt(768)2))2. 3sqrt(5) + 41/4 Simplify -4((0 + 1sqrt(612) - ((sqrt(612) + (sqrt(612) - (-2 + 1 + sqrt(612))))*2 - sqrt(612))) + 3 + 2). 2432 Simplify 1(1 + sqrt(567)-2)2 - ((sqrt(77)-11)/(1sqrt(396)))*2. -36sqrt(7) + 81677/36 Simplify (-1(-1 + sqrt(343))2 - sqrt(343) - (1sqrt(343) + 2)) + -1 + ((sqrt(343) - (3 + sqrt(343))) + -1 + sqrt(343))*2. -56sqrt(7) + 12 Simplify 1 + ((sqrt(180) + (sqrt(180) - ((sqrt(180) - 1sqrt(180))2 - sqrt(180)) - sqrt(180)) + sqrt(180))/(sqrt(9) - sqrt(1296)-1))2-4. -551/169 Simplify (sqrt(156)1-64)/((-3((sqrt(144) - (sqrt(144) + -1sqrt(144))) + sqrt(144)))/sqrt(12)). 4sqrt(13) Simplify (sqrt(112) + 1 + 5 + 4 + -2)*2 + 3 + 0. 64sqrt(7) + 179 Simplify (0 + 1 + sqrt(80))*2 - -1(sqrt(180) - sqrt(5))5. 33sqrt(5) + 81 Simplify -3(-3(sqrt(475) + 3) + 3(sqrt(475) + (sqrt(475) - (-4 + sqrt(475)) - sqrt(475)) + sqrt(475)) + sqrt(475))2. -1452 - 90sqrt(19) Simplify ((1 + -4 + sqrt(700) + sqrt(7))2 + 0)2. -264sqrt(7) + 3424 Simplify -2((sqrt(4)/sqrt(72) - sqrt(12)/(sqrt(6)-1)) + -2)-3. -12 + 7sqrt(2) Simplify (-6sqrt(204)-4-5)/(sqrt(132)/((sqrt(11)3-2 - sqrt(11)) + sqrt(11) - sqrt(11))). 840sqrt(17) Simplify -4(sqrt(75) + (sqrt(75) + -3)6)*26. -95976 + 30240sqrt(3) Simplify ((sqrt(35) + sqrt(105)/(sqrt(6)/sqrt(2)))/((sqrt(70)2)/sqrt(10)))*2 + (sqrt(240)/((sqrt(8) - sqrt(16)/sqrt(2)) + sqrt(8)))/(sqrt(18)/sqrt(3)-5). -sqrt(5)/5 + 5 Simplify 0 + (sqrt(7)-4 + sqrt(7))2-4 + 1sqrt(28) + sqrt(28) + (sqrt(21)/sqrt(27))2. -2261/9 + 4sqrt(7) Simplify (sqrt(52)/sqrt(4) + 3 + 5 + -4 + sqrt(78)/sqrt(54))*2. 32sqrt(13)/3 + 352/9 Simplify -1 + 2(((3 + sqrt(252) + sqrt(252))3)*2 + 1). 1296sqrt(7) + 18307 Simplify sqrt(3)-3-1-6 + (sqrt(3) + sqrt(30)/sqrt(360))-1. -115sqrt(3)/6 Simplify ((sqrt(1152) - sqrt(1152)2) + sqrt(1152) - sqrt(1152))/((sqrt(8)3)/sqrt(2)). -4sqrt(2) Simplify (sqrt(48)/sqrt(64))/(sqrt(8)/(-3sqrt(2)))5. -15sqrt(3)/4 Simplify ((3 + -1 + sqrt(147)1)1 + 1)2. 42sqrt(3) + 156 Simplify (sqrt(378) - (sqrt(378) + (-3sqrt(378) - sqrt(378))))/(sqrt(66)/(sqrt(11)-1) - sqrt(6)). -6sqrt(7) Simplify (0 + (4sqrt(208) - sqrt(208)))*2 - (3 + sqrt(208)-2)*2. 48sqrt(13) + 1031 Simplify -2(6(-6sqrt(28)/sqrt(2))/(sqrt(2)-5-4))2. -1134/25 Simplify (0 + -5(-5(sqrt(343) + 1) + (1 + sqrt(343))2))*25. 15750sqrt(7) + 387000 Simplify ((-1 + sqrt(304))-3 + -5)*2 - (3 + sqrt(304)-1 + -4). 52sqrt(19) + 2741 Simplify (-2 + -1 + sqrt(19) - (sqrt(19)-14)2) + (-1 + sqrt(684))2. -309 + 13sqrt(19) Simplify (sqrt(648)-2 + sqrt(18) + -3sqrt(72)/sqrt(4) + sqrt(18))/(3sqrt(576)/sqrt(4)). -13sqrt(2)/12 Simplify ((-41sqrt(1029))/(sqrt(147) - (-5(sqrt(147) - sqrt(147)1) - sqrt(147))))*2. 2	{ "pile_set_name": "DM Mathematics" }
0 = 1424t - 1440t + 776368. Is t composite? False Is 2 - (5 + -7)/((12/(-367203))/(-2)) composite? True Suppose -49j + 51j + 8 = 0. Is 2 + j + 4 - -975 prime? True Let l be (14 + -2)(-1)/2. Let b(x) = 2x + 14. Let n be b(l). Is 9/(1 + n) - -68 a composite number? False Let g(y) = 15y + 96. Let d be g(-7). Is 1/(2/10d/(-207)) prime? False Suppose 2c = -7c + 303804. Suppose 4d - 16 = 4k, -3d = -4k - d - 14. Is (c/6)/(-2 + (k - -7)) a prime number? False Let a be (-12)/20 - 122/5. Is -1061(a - -5)/4 a composite number? True Suppose 2m = 4w + 50886, 0 = -7m + 3m + 6w + 101762. Is m a composite number? True Let j(r) = -r*2 + 3. Let z be j(-1). Let y be (z/3)/((-12)/(-54)). Suppose 599 - 26 = yl. Is l a prime number? True Suppose -2i + 10 = -2. Is (33/i)/((-4)/(-2056)) a composite number? True Let c = 25 - 29. Is 1069/(c/(-5) - 13/(-65)) a composite number? False Suppose -15b + 59031 = -6b. Suppose -255n = -248n - b. Is n a prime number? True Suppose 6d - 4d = 5r - 159111, -9r = 3d - 286380. Is r composite? True Let d = -684 - -689. Suppose m - 39980 = -5t, -dt + 3 = -12. Is m a composite number? True Let w(o) = 149190o2 - 862o - 4293. Is w(-5) prime? True Let w = -902429 + 1294498. Is w prime? True Suppose 21m - 12m = -69m + 578058. Is m a composite number? False Suppose -t + 2d + 42268 + 52873 = 0, -3t = 3d - 285378. Is t prime? True Let b = 203428 - -709153. Is b a prime number? True Let o(f) be the second derivative of -f5 + f4/12 + 7f3/6 + 3f*2/2 - 2f - 27. Is o(-4) prime? False Let i = 7963 - -3204. Suppose -3d = -d. Suppose 5c - 12438 - i = d. Is c composite? False Let v(p) = 6p2 - 1. Let r be v(-1). Let t(w) = 294w*3 - 5w*2 - 2w - 10. Is t(r) a prime number? False Let r(o) = o*3 + 6o*2 + 17o + 6805. Let z be r(0). Suppose 4t = 4y + 92, -2y + 5 = -1. Suppose 27q = tq + z. Is q prime? False Suppose 1252290 = 22g - 13234954 + 1410906. Is g prime? True Let c be 2/5170/17. Suppose cr - 5r - 5m = -2984, -2992 = -r - 3m. Suppose -3f - s + r = 0, -f - 2s = 3s - 978. Is f a composite number? True Let g(w) = 542w - 6. Let v be g(7). Suppose 5z - 5k = -4765, -4k = 4z - 2k + v. Let j = z + 1626. Is j prime? True Is ((1 - 0) + -518380)(-209)/627 a composite number? True Is (-17)/(136/552220)(-4)/10 prime? True Let s = -675 + 1462. Suppose -9c + s = -8c. Is c prime? True Suppose -162q - 8340674 = -224q. Is q composite? True Let w be (-11)/(33/(-6)) + 14. Suppose 14i = wi - 2n - 1274, -3i + 5n + 1915 = 0. Is i prime? False Let d(u) = -21u*2 - u - 101. Let b(a) = 20a*2 + 2a + 100. Let y(t) = -2b(t) - 3d(t). Is y(-11) a composite number? False Suppose -4d = 4t - 1784, -2t + 3d + 1777 = 2t. Suppose 1876 = j - t. Is j a composite number? True Let l be 42/8 + (-16)/64. Suppose 1104 + 464081 = lz. Is z prime? False Let n be 13/13 - (1 - 5) - -7. Suppose -34168 - 54260 = -nw. Is w a prime number? True Suppose -12n - 29n = 4920. Is 10/(n/124)-249 a composite number? True Suppose -s + 5y = y - 18, 26 = 5s - 4y. Suppose -5p = 3t - 15, sp + 7 + 3 = 2t. Is (p/(-3) - 1)-4317 a composite number? True Let b be (7 + -5)177. Suppose 0 = m - 44 + b. Let r = 189 + m. Is r a prime number? True Let k(z) = -z + 3. Let c be k(8). Let m be (36/8 + c)/((-1)/(-6)). Is ((-7)/m)/7 + 1904/3 a composite number? True Suppose -3330 = -5z - 4x - 0x, -3x = -15. Let t = 5535 + z. Is t a composite number? False Let f be ((-340)/(-3))/(7/(-21)). Let r = -9 + f. Let b = r + 600. Is b composite? False Let c be ((-4812)/(-10))/(45/(-150)). Let s = 495 - c. Is s composite? False Let c(a) be the third derivative of 3a4/4 - a3/2 + 2a*2 + 131a. Suppose -4m + f + 9 = -9, 4m = 5f + 26. Is c(m) composite? True Suppose 9317 = 99q - 96q - 2u, 0 = 5u - 10. Is q a prime number? False Suppose -8h - h = -216. Suppose 5a + 4l = l + h, -18 = -5a - l. Suppose 5n - as = 3520, -s - 1417 = -2n + 2s. Is n a composite number? False Let a(p) = -2p*3 - 12p*2 + 25p - 7. Let l(f) = -3f3 - 13f*2 + 25f - 7. Let r(y) = 4a(y) - 5l(y). Is r(10) a composite number? True Let i = 671 + -1305. Let m = i - -1711. Is m a prime number? False Let w(u) = 151u - 29. Let x be 2 + -2 + 11 + -1. Is w(x) a prime number? True Let z be (63/(-36))/(((-9)/(-12))/3). Is 2 - z/(28/21516) a composite number? False Suppose 3731975 = 18h - 1607851. Is h a prime number? False Let g be 1/3 + 140/21. Suppose go = 16031 + 10548. Suppose -5p = -2a - o, -4p + 4a + 1019 = -2009. Is p prime? True Suppose 3m - 2196690 = -27m. Is m composite? True Let c(l) = l3 - 20l*2 + 36l - 17. Let v be c(18). Let w(t) = -150t - 159. Is w(v) prime? False Let x(o) = -27149o3 - o2 - 13o - 12. Is x(-1) a prime number? False Let m(v) be the first derivative of v3/3 + 3v*2/2 - 8v + 7. Let t be m(-5). Suppose -tf + g + 486 = f, 5f - 3g = 814. Is f a composite number? True Suppose -2a + 18a = 0. Is (-3 + -2)/(-10)2510 + a composite? True Suppose -4r + 9r = -2v + 6, 0 = 4r. Let f(x) = 983x + 4. Is f(v) a prime number? True Suppose g + 0g - 103019 = 3p, 309057 = 3g - 2p. Is g a composite number? True Let t be ((0 - 0)1)/((-2)/1). Let a be t + 1 + 18/(-6). Is (1 - a/(-3))/(7/1659) a prime number? True Suppose 0 = -v - 2x + 86, 5x + 16 = v - 49. Is 343640/v - (-1)/(-2) a prime number? False Is ((-14)/(-35))/(22/20380855) a prime number? True Let j = -15 - 19. Let r = j - -325. Is r prime? False Suppose -27c + 31c - 32716 = 0. Let l = 278 + c. Is (((-28)/(-12) - 3)l)/(-2) composite? False Is (-1 - 50)(3975671/51)/(-7) prime? False Let h = -34587 + 50814. Suppose -m + 2u + 6533 = 0, -3m + h = 3u - 3408. Is m composite? True Let s(z) = -z2 - 19z - 24. Let j be s(-17). Suppose -jc + 31876 + 77154 = 0. Is c a composite number? False Let o = 14766 + 33868. Is o a prime number? False Suppose -2z = -2s + 9556, z - 19140 = -4s - 2z. Suppose -3g - 9 = 0, 4g - 39100 = -2d - s. Is d a composite number? True Let o = -24 + 18. Let b = -563 - -988. Let v = o + b. Is v composite? False Is -63(-4 + (-574007)/63) composite? True Let j be (-936)/(-3 - 1) - (-1 + 1). Let g = j + 863. Is g a prime number? True Let q = 9 - 4. Suppose 2h - q = 3. Suppose 3r + 217 + 137 = hb, -263 = -3b + r. Is b a prime number? False Let a(s) = -100s - 13. Is a(-36) composite? True Suppose 84u - 102u = -743238. Is u a prime number? False Let t be -2(-3)/6-207. Let g = t + 10. Let d = -36 - g. Is d prime? False Suppose -16 = 8d - 12d, -7816 = -v - 5d. Let c = v - 5367. Is c a composite number? True Suppose -3t + 4 = 10. Let b be 758/8 - (t - (-14)/8). Suppose -j + b = 3s, 2s + j - 76 = -14. Is s prime? False Let l(t) = -2t3 + 25t*2 - 9t - 13. Let x be l(12). Let n(b) = 4b2 - 27b - 14. Is n(x) prime? True Suppose 11750585 = 70h - 59610285. Is h composite? True Is (-2 - 26/(-11)) + 11995865/55 a composite number? False Let n = -378 - -93. Is n/(-15)(-1 - -128) a prime number? False Suppose 43226 = c - 5h, 0 = c - 2h - 15707 - 27540. Is c a prime number? True Suppose -16 = -2h + 3q, -14 = 3h - 2q + 7q. Suppose 6b = -hb + 40. Suppose 0t = 2t - 5f - 2389, -4733 = -4t - bf. Is t a prime number? True Let v(a) = -a*2 - 25a - 37. Let g(s) = s*3 - 14s*2 + 22s + 1. Let f be g(12). Let o be v(f). Let x(h) = -h*2 + 16h - 8. Is x(o) composite? True Suppose 6u = 7u - 1. Let h be (-24)/(-30) - u - (-11)/5. Suppose 0 = 5s - hn - 54, -3s - 4n = -4s + 18. Is s a prime number? False Suppose -3w + 2i = -3 - 2, 4w = -3i + 18. Suppose 0 = 17h - 15h + 4u - 67210, 0 = -4h - wu + 134395. Is h a composite number? True Let i(k) = 373k3 - k2 - 9k - 4. Let v be i(5). Let m = v + -7010. Is m composite? False Suppose 0 = -18z - 125525 - 29275. Let g = z + 14217. Is g composite? True Let b(v) = 127v*2 - 12v - 21. Let h be b(8). Suppose -h = -16j + 9813. Is j prime? False Let g(k) = 8k*2 - 125k - 2737. Is g(-20) composite? False Suppose -14j = 144 - 4. Let k(y) = -y3 - 10y*2 - 6y + 23. Is k(j) composite? False Suppose 3r - 327225 = 3j, 20j - 18j = -4r + 436288. Is r a prime number? True Let v(c) = -c3 + 9c*2 + 11c + 5. Let b(j) = 4*	{ "pile_set_name": "DM Mathematics" }
17 What is the i'th term of 336, 660, 970, 1260, 1524, 1756, 1950? -i3 - i2 + 334i + 4 What is the z'th term of -3456, -6919, -10384, -13851, -17320, -20791? -z2 - 3460z + 5 What is the h'th term of -2270, -2269, -2268, -2267, -2266? h - 2271 What is the s'th term of -1647, -6605, -14869, -26439, -41315, -59497, -80985? -1653s2 + s + 5 What is the l'th term of 26, 29, 32? 3l + 23 What is the x'th term of 4, 6, -16, -68, -156? -x*3 - 6x*2 + 27x - 16 What is the c'th term of 127, 215, 315, 433, 575, 747? c*3 + 81c + 45 What is the z'th term of -33, -41, -53, -69, -89, -113? -2z2 - 2z - 29 What is the x'th term of -37, -39, -41, -43? -2x - 35 What is the v'th term of -153, -159, -167, -177, -189, -203? -v2 - 3v - 149 What is the y'th term of -14677, -29353, -44029, -58705? -14676y - 1 What is the d'th term of 5402, 5401, 5400, 5399? -d + 5403 What is the d'th term of -2, -30, -68, -110, -150, -182? d3 - 11d*2 - 2d + 10 What is the m'th term of 25, 91, 197, 343, 529? 20m2 + 6m - 1 What is the k'th term of 309, 629, 949, 1269, 1589, 1909? 320k - 11 What is the p'th term of -18, -15, -10, -3? p2 - 19 What is the v'th term of -43, -64, -85, -106? -21v - 22 What is the d'th term of 802, 805, 820, 853, 910, 997? d*3 - 4d + 805 What is the l'th term of 11, 5, -3, -13, -25, -39? -l*2 - 3l + 15 What is the v'th term of -10, -29, -56, -91, -134? -4v2 - 7v + 1 What is the v'th term of 2528, 2522, 2506, 2474, 2420, 2338, 2222? -v3 + v2 - 2v + 2530 What is the k'th term of 804, 1543, 2266, 2967, 3640, 4279, 4878, 5431? -k3 - 2k*2 + 752k + 55 What is the o'th term of 25, 11, -57, -215, -499, -945? -6o3 + 9o*2 + o + 21 What is the y'th term of 7, 11, 15? 4y + 3 What is the l'th term of 36, 63, 90, 117, 144, 171? 27l + 9 What is the p'th term of -2407, -4815, -7223, -9631, -12039? -2408p + 1 What is the g'th term of 14376, 14375, 14374, 14373? -g + 14377 What is the j'th term of -5, -12, -15, -8, 15, 60? j*3 - 4j*2 - 2j What is the l'th term of 521, 517, 511, 503, 493, 481? -l2 - l + 523 What is the m'th term of 60, 198, 324, 432, 516, 570, 588, 564? -m3 + 145m - 84 What is the f'th term of -229, -511, -793, -1075, -1357? -282f + 53 What is the q'th term of 7, 19, 31, 43? 12q - 5 What is the o'th term of 19, 17, 5, -23, -73, -151? -o3 + o2 + 2o + 17 What is the d'th term of -34, -44, -68, -112, -182, -284, -424? -d3 - d2 - 32 What is the v'th term of -4280, -4279, -4278, -4277, -4276, -4275? v - 4281 What is the h'th term of -47, -132, -219, -308, -399, -492? -h*2 - 82h + 36 What is the y'th term of 4561, 4563, 4565, 4567, 4569, 4571? 2y + 4559 What is the j'th term of 64, 74, 120, 220, 392, 654, 1024? 3j*3 - 11j + 72 What is the s'th term of -6, -37, -80, -129, -178? s*3 - 12s*2 - 2s + 7 What is the f'th term of -17568, -17569, -17570? -f - 17567 What is the n'th term of -103, -192, -339, -544, -807, -1128, -1507? -29n2 - 2n - 72 What is the g'th term of 2546, 2547, 2548, 2549, 2550, 2551? g + 2545 What is the o'th term of -532, -1058, -1582, -2104, -2624? o*2 - 529o - 4 What is the x'th term of -118, -238, -360, -484, -610? -x*2 - 117x What is the x'th term of 333, 669, 1007, 1347, 1689, 2033? x*2 + 333x - 1 What is the c'th term of -41, -82, -123, -164, -205, -246? -41c What is the j'th term of -3929, -3927, -3927, -3929, -3933, -3939? -j2 + 5j - 3933 What is the m'th term of -10, -30, -60, -106, -174? -m3 + m2 - 16m + 6 What is the n'th term of -4, -13, -32, -61, -100? -5n*2 + 6n - 5 What is the s'th term of -43, -83, -185, -379, -695, -1163, -1813, -2675? -5s3 - s2 - 2s - 35 What is the w'th term of -792, -1579, -2366, -3153? -787w - 5 What is the b'th term of 47, 89, 133, 179, 227, 277, 329? b2 + 39b + 7 What is the p'th term of -40, -37, -34, -31, -28, -25? 3p - 43 What is the n'th term of -14871, -14872, -14873, -14874? -n - 14870 What is the y'th term of 1112, 2229, 3356, 4499, 5664, 6857, 8084? y3 - y2 + 1113y - 1 What is the q'th term of 352, 356, 374, 412, 476, 572, 706? q3 + q2 - 6q + 356 What is the z'th term of 1326, 2650, 3974, 5298? 1324z + 2 What is the o'th term of 173, 146, 85, -22, -187, -422? -2o3 - 5o*2 + 2o + 178 What is the m'th term of -32, -61, -90, -119? -29m - 3 What is the x'th term of 378, 397, 440, 519, 646, 833, 1092, 1435? 2x*3 + 5x + 371 What is the s'th term of -2567, -5135, -7703, -10271, -12839? -2568s + 1 What is the o'th term of -397, -395, -393, -391, -389, -387? 2o - 399 What is the o'th term of -531, -538, -547, -558, -571? -o*2 - 4o - 526 What is the r'th term of 58191, 58179, 58153, 58107, 58035, 57931? -r3 - r2 - 2r + 58195 What is the b'th term of -55, -62, -73, -88, -107? -2b*2 - b - 52 What is the r'th term of 34, 61, 88, 115, 142, 169? 27r + 7 What is the v'th term of 8, 26, 64, 134, 248, 418? 2v3 - 2v*2 + 10v - 2 What is the w'th term of -578, -580, -584, -590, -598, -608, -620? -w*2 + w - 578 What is the g'th term of -140, -156, -172, -188, -204? -16g - 124 What is the r'th term of -234, -190, -146? 44r - 278 What is the j'th term of 2366, 2364, 2360, 2354? -j2 + j + 2366 What is the v'th term of -18, -12, -2, 12, 30, 52, 78? 2v*2 - 20 What is the x'th term of -535, -553, -571? -18x - 517 What is the w'th term of 158, 157, 156, 155, 154, 153? -w + 159 What is the p'th term of -62, -234, -524, -938, -1482? -p*3 - 53p*2 - 6p - 2 What is the z'th term of -2, -5, 0, 19, 58, 123, 220? z*3 - 2z*2 - 4z + 3 What is the l'th term of 98, 101, 106, 113, 122, 133? l*2 + 97 What is the b'th term of -13, 26, 129, 326, 647, 1122, 1781, 2654? 5b*3 + 2b*2 - 2b - 18 What is the v'th term of -707, -706, -705, -704? v - 708 What is the h'th term of 978, 968, 944, 900, 830? -h3 - h2 + 980 What is the d'th term of -1244, -4960, -11154, -19826, -30976, -44604, -60710? -1239d2 + d - 6 What is the o'th term of 204, 185, 138, 51, -88, -291, -570? -2o*3 - 2o*2 + o + 207 What is the f'th term of -1152, -1157, -1162? -5f - 1147 What is the m'th term of -74, -53, -32? 21m - 95 What is the u'th term of -110, -110, -112, -116, -122? -u2 + 3u - 112 What is the x'th term of 334, 337, 344, 355, 370, 389? 2x2 - 3x + 335 What is the i'th term of -106, -106, -104, -100, -94, -86, -76? i*2 - 3i - 104 What is the l'th term of 330, 661, 992, 1323? 331l - 1 What is the o'th term of 453, 894, 1339, 1788, 2241? 2o*2 + 435o + 16 What is the g'th term of -16, -33, -88, -199, -384? -3g3 - g2 + 7g - 19 What is the b'th term of -268, -266, -254, -226, -176? b3 - b2 - 2b - 266 What is the r'th term of -322, -324, -324, -322? r2 - 5r - 318 What is the h'th term of 18, 32, 44, 54, 62? -h*2 + 17h + 2 What is the u'th term of 130, 143, 164, 193, 230? 4u2 + u + 125 What is the y'th term of -66, -115, -164? -49y - 17 What is the p'th term of 183, 372, 565, 762? 2p2 + 183p - 2 What is the n'th term of 49, 54, 71, 106, 165, 254? n*3 - 2n + 50 What is the g'th term of 51, 99, 147, 195, 243, 291? 48g + 3 What is the u'th term of -334, -331, -328, -325, -322? 3u - 337 What is the k'th term of 408, 822, 1250, 1698, 2172, 2678, 3222, 3810? k3 + k2 + 404k + 2 What is the a'th term of 260, 254, 244, 230, 212, 190? -2a*2 + 262 What is the j'th term of 139, 279, 419, 559, 699, 839? 140j - 1 What is the d'th term of 107, 431, 971, 1721, 2675? -d*3 + 114d*2 - 11d + 5 What is the n'th term of -43, -55, -79, -121, -187, -283, -415? -n*3 - 5n - 37 What is the d'th term of -26, -52, -78, -104, -130? -26d What is the f'th term of 43855, 43858, 43863, 43870, 43879, 43890, 43903? f2 + 43854 What is the r'th term of 13, 26, 39, 52, 65? 13r What is the g'th term of 53, 259, 615, 1121, 1777, 2583? 75g2 - 19g - 3 What is the p'th term of 63, 121, 165, 189, 187, 153, 81, -35? -p3 - p2 + 68p - 3 What is the u'th term of -74, -151, -228, -305, -382? -77u + 3 What is the v'th term of -5, -16, -33, -56, -85, -120? -3v2 - 2v What is the i'th term of 82, 293, 636, 1105, 1694? -i*3 + 72i*2 + 2i + 9 What is the j'th term of -16, -34, -64, -106, -160, -226? -6j*2 - 10 What is the k'th term of -199, -216, -233, -250? -	{ "pile_set_name": "DM Mathematics" }
j, q, -3/2? q Let n(z) = -z*3 - 11z*2 + 9z + 268. Let t be n(-8). Which is the third biggest value? (a) -0.042 (b) 0 (c) 0.4 (d) t b Let z = 612254/27 + -22676. Which is the second smallest value? (a) z (b) 0.013 (c) -0.2 b Let o = -9 - -23. Let i be (54/(-120))/((-474)/790). Which is the smallest value? (a) 2 (b) o (c) i (d) -3 d Let y = 165.783 + -166. Let m = y + 0.157. Which is the third smallest value? (a) -5 (b) m (c) 0.02 c Let a = -931/2440 - -2/305. Let r = 208.13 - 209.13. What is the third smallest value in r, 2.3, a? 2.3 Let h = 67.071 + -75.071. Let r = -4.1 + 0.1. Which is the third smallest value? (a) r (b) 1 (c) h (d) -2 d Let k = 11/27 + -5/27. Let a = 96 - 287/3. What is the third biggest value in a, -0.4, k, 7/2? k Let f = -0.0136 - -71.0136. Let c = -69 + f. What is the smallest value in -0.4, -206, -4, c? -206 Let t = 273 - 276. Let d = -0.348 + -0.052. What is the biggest value in -6, -5, d, t? d Let k be (10/3)/(((-3080)/33)/(-20)). Let c be 4 + -1 + 1 + -1. What is the biggest value in -0.2, -5, k, c? c Let y = 6.3 - 29.3. Let n = 26 + y. Let i = 21.7 - 22. What is the second smallest value in 0.3, n, i? 0.3 Let p be 2 + 0 - (8 - (-209)/(-22)). What is the biggest value in -2, 149/5, p? 149/5 Let h be ((-20)/56)/(20/(-16)). What is the second biggest value in 5, h, -6.6, -0.3? h Let c = 55.91 + -0.91. Let y = -60.9 + 112.9. Let o = c - y. What is the biggest value in 0.4, o, 4/7? o Let t = -69.4 + 66.4. What is the biggest value in 1/51, t, 2/5? 2/5 Let h = 16303 - 16290. Which is the biggest value? (a) 112/9 (b) h (c) 1 b Let u = 9 - 5. Let y = 3.5 - u. Let h = -35142.3 - -35142. What is the second biggest value in h, 0, y? h Let k = -146 - -140. Which is the third biggest value? (a) -5 (b) 4 (c) -4/3 (d) k (e) 0 c Let g = 2/25 + 17/100. Let a = -4.27 - -0.27. Let f be -23/18 - 2/(-42). What is the third biggest value in g, a, 4, f? f Let u be (20/18)/(3040/3420). What is the fourth smallest value in -5, 4/5, u, -0.5, 4? u Let f = -3.823 - -3.223. What is the fourth smallest value in f, -5, 2, -3, 4? 2 Let f = -281.2 - -281. Which is the fourth biggest value? (a) 4 (b) -0.4 (c) f (d) 2 b Let g = -1 + 0.4. Suppose -8x - 13x = 12 + 9. Which is the third biggest value? (a) x (b) g (c) 2/3 (d) -2/3 d Let d = 1011/545 + -6/109. Let i = -16.9 + 17. Let b be (2 + -5)/((-3)/(-8)) - (17 + -23). What is the third smallest value in i, b, d? d Let z = 43.21 - 42.85. Which is the second biggest value? (a) z (b) -1 (c) -0.1 (d) -1/4 (e) -3 c Let q = 0.04972 - -0.25028. Which is the biggest value? (a) q (b) -0.07 (c) -26 a Let r = -497 - -497.0252. Let o = 1.9748 + r. What is the second biggest value in 1, o, -17/5? 1 Let f = -6.271 + 5.271. What is the third biggest value in -2.6, -4/15, -2/3, f? f Let h = -2058.97 + 2059. Let u = -4.1 - -0.1. What is the smallest value in 5, h, u? u Let d = 6.162 - 6.236. What is the fifth smallest value in 2, -0.4, d, 0.4, 1/3? 2 Let j = 80 + -32.4. Let t = j - 47.2. Which is the biggest value? (a) t (b) 44 (c) -0.3 b Suppose -3 = u - 3s, -u + s = -2u + 5. Let r be u/(-60)15/2. Let x = -494.2 + 494. What is the second smallest value in x, r, 4, 1/3? x Let j = 12173 + -12172.88. Which is the second biggest value? (a) -63 (b) -3/7 (c) j b Let y = -7428 - -7433. Which is the second biggest value? (a) 2/107 (b) y (c) 7 b Suppose -2h = p - 11 - 2, -5p - 5h = -45. Suppose 5d + pq = -55, 2d + 10 - 3 = -5q. What is the third smallest value in -4, 1/3, d? 1/3 Suppose -56 + 42 = 2x. Let z be -6(-4)/84 + 4/x. Let c = 229/22 + -21/2. What is the biggest value in c, 0.4, -0.4, z? 0.4 Let t = 95 - -568. Let b = t + -628.1. Let g = -35 + b. What is the biggest value in -0.2, g, -0.5, -0.06? -0.06 Let u = -64.21 + 1.21. Let i = 88.082 - 93.082. Which is the fourth biggest value? (a) u (b) 1/4 (c) 0 (d) i a Suppose -17u + 11u - 25 - 23 = 0. Which is the smallest value? (a) u (b) -3/2 (c) -6 (d) -7 (e) 0.1 a Let h = -4278216 - -10096589449/2360. Let i = 2/295 + h. Suppose -t + 15 = 4t. Which is the third smallest value? (a) t (b) -8 (c) i a Let m = -2.55 + 0.55. Which is the second smallest value? (a) 0.3 (b) 0.287 (c) m (d) 0 d Let w = 1.167 + -0.967. Which is the fifth smallest value? (a) -0.1 (b) -0.97 (c) -4 (d) -3 (e) w e Suppose 215 = 10f + 165. Let l = 2.84 - -10.16. What is the biggest value in 0.1, f, l? l Let a = 0.0391 - -117.9609. Let k = 119 - a. What is the biggest value in -5, -2, k, 0? k Let n be (29/12)/((-35)/14). Let m = 12 - 14. Let i be ((-5)/m)/(8/32). What is the third smallest value in n, i, -3? i Let g = -3373 - -3381. Let o(h) = 2h3 + 3h*2 - 2h. Let n be o(-2). Which is the biggest value? (a) 2 (b) g (c) n b Let d = 7.7 - 8. Let i = 197.6 + -196. Let m be -38/60 + 0. What is the third biggest value in m, i, d? m Let y = 2.058 - 2. Let a = y - -0.142. What is the third smallest value in 5, a, 10? 10 Let o be (-47)/4711/(-77)(0 + 1). Which is the fourth biggest value? (a) 0.5 (b) 0.07 (c) o (d) -4/9 (e) 0 e Let p = 5.82 + -5.62. Let g = 17.4 + -7.4. Which is the smallest value? (a) g (b) p (c) 3/8 (d) -3/4 d Suppose 0c - 3c + 9 = 0. Let s = 0.1222 + -3.8622. Let r = s + 3.44. What is the biggest value in r, c, 1, 0.5? c Let y = -1.08235 - -0.08235. What is the second biggest value in y, -5/8, -0.7, 0? -5/8 Let m be ((-257)/(-130) + -2)/(54/(-72)). Let f = -1411/4 + 353. What is the third biggest value in 3, m, f? m Let w be -4 - 2 - (-33 - -24). Let s = -0.057 - -0.157. Which is the third smallest value? (a) s (b) w (c) 1/54 b Let o = 0.035 + -0.189. Let n = -0.046 + o. Let p = -0.5 + -2.5. What is the second smallest value in n, -5, p, -6? -5 Let h = 92681/7 + -13241. What is the second smallest value in h, 2/9, -229? h Let t = 304.37 + -5.37. Let k = t + -298.7. What is the smallest value in 0.5, -1, k, -0.9? -1 Let n = -1999/540 - -37/10. Let q = n + 16381/540. Let h = q - 31. Which is the third biggest value? (a) h (b) 3 (c) 5 a Let q(j) = 9j - 155. Let y be q(28). Let h = -96 + y. Which is the third biggest value? (a) -0.5 (b) h (c) -5/44 a Let w be 138/1455 + (0 - 1/10). Let u = 197/582 + w. Let j = -2/7 - -17/35. Which is the second smallest value? (a) u (b) -4 (c) -2 (d) j c Let r = -4683 + 4683.4. Which is the third biggest value? (a) r (b) -34 (c) 1/7 (d) -0.2 (e) 1/3 c Let f = 55 - 139. Let t = 13.8 + f. Let c = t - -70. What is the second biggest value in c, 5, 4, 0.7? 4 Let n = 1.1 - 0.1. Let r = -10.05 + 10. Let h be (-1 + 3)/(868/124). Which is the second smallest value? (a) h (b) n (c) r a Let y = 1 - -1. Let q = -2036 + 2033. What is the third smallest value in q, -2/9, y? y Suppose -15373 + 15381 = -8s. What is the fourth smallest value in -0.9, s, -4, 2/3? 2/3 Let i be (-5187)/1197 + (-46)/(-12). What is the biggest value in i, 0.1, -0.3, 0.197? 0.197 Suppose 3g - g = 8. Suppose 3f = gf + 5. Let m = 16.4325 - 16.1325. Which is the second smallest value? (a) f (b) m (c) 3 (d) 0.1 d Let k = 107013518693/103198785 + 6/1810505. Let i = k + -1037. What is the smallest value in -0.1, i, -3? -3 Let r = 6771 + 2348. Let i = -45752/5 + r. Let u = i - -3601/115. Which is the biggest value? (a) u (b) 0.4 (c) -1 b Let f = 0.592 + -0.9. Let q = -0.508 - f. Which is the second smallest value? (a) -2/7 (b) 21 (c) q c Let f(w) = -2w3 - 113w*2 - 54w + 117. Let s be f(-56). Let o = -5.7 - -6. Which is the smallest value? (a) -2/3 (b) o (c) s (d) -0.7 d Let j be 4/((-12)/(-9))*1. Let a be 1/(4/(-3) + j). Let y = 27302/9 + -136492/45. What is the third biggest value in 5/6, y, a? y Let k = 1244 + -1314. Let w be 6/(-16) - 58/(-112). Which is the second smallest value? (a) w (b) 3/7 (c) k a Let t = -1578 + 1577.9. Let x = -67.9 + 72. Let p = 2.9 - x. Which is the biggest value? (a) t (b) -2 (c) p a Let v = -67.93 - -71.93. Which is the biggest value? (a) -1/10 (b) 0.2 (c) v (d) 0.3 (e) 5 e Let v = 522 - 710. Which is the third smallest value? (a) 2/3 (b) 2/19 (c) v a Let w = -24.6 + 25. Let n = 13815.943 + -13823. Let o = n - -0.057. What is the smallest value in o, -2, w? o Let w = 29941/3 - 9980. Which is the	{ "pile_set_name": "DM Mathematics" }
t integer? 216 What is the cube root of 18055724 to the nearest integer? 262 What is the square root of 17316 to the nearest integer? 132 What is the third root of 849677 to the nearest integer? 95 What is the cube root of 915557 to the nearest integer? 97 What is the third root of 4364058 to the nearest integer? 163 What is the fifth root of 982638 to the nearest integer? 16 What is the square root of 6789921 to the nearest integer? 2606 What is the ninth root of 3190927 to the nearest integer? 5 What is 482381 to the power of 1/5, to the nearest integer? 14 What is 9071656 to the power of 1/2, to the nearest integer? 3012 What is the cube root of 177052 to the nearest integer? 56 What is 659313 to the power of 1/2, to the nearest integer? 812 What is the third root of 12765691 to the nearest integer? 234 What is 69784 to the power of 1/3, to the nearest integer? 41 What is 1776761 to the power of 1/10, to the nearest integer? 4 What is the cube root of 53828 to the nearest integer? 38 What is the third root of 4195184 to the nearest integer? 161 What is the cube root of 3147523 to the nearest integer? 147 What is 206670 to the power of 1/2, to the nearest integer? 455 What is the square root of 2974206 to the nearest integer? 1725 What is the square root of 6454074 to the nearest integer? 2540 What is the square root of 7214910 to the nearest integer? 2686 What is the square root of 241186 to the nearest integer? 491 What is 44447 to the power of 1/5, to the nearest integer? 9 What is 207942 to the power of 1/3, to the nearest integer? 59 What is the third root of 210008 to the nearest integer? 59 What is the square root of 410377 to the nearest integer? 641 What is the third root of 1167029 to the nearest integer? 105 What is 1468864 to the power of 1/6, to the nearest integer? 11 What is the cube root of 1636909 to the nearest integer? 118 What is the cube root of 934212 to the nearest integer? 98 What is the tenth root of 69876 to the nearest integer? 3 What is the sixth root of 2899200 to the nearest integer? 12 What is the ninth root of 165209 to the nearest integer? 4 What is 13727148 to the power of 1/2, to the nearest integer? 3705 What is the cube root of 9735052 to the nearest integer? 214 What is 3534763 to the power of 1/10, to the nearest integer? 5 What is the square root of 222590 to the nearest integer? 472 What is the square root of 245095 to the nearest integer? 495 What is 7762662 to the power of 1/6, to the nearest integer? 14 What is 85262 to the power of 1/2, to the nearest integer? 292 What is the square root of 666041 to the nearest integer? 816 What is the cube root of 2077359 to the nearest integer? 128 What is the square root of 910856 to the nearest integer? 954 What is the tenth root of 2824481 to the nearest integer? 4 What is the third root of 10778754 to the nearest integer? 221 What is the eighth root of 4250446 to the nearest integer? 7 What is the eighth root of 1452607 to the nearest integer? 6 What is 16267 to the power of 1/3, to the nearest integer? 25 What is 83111 to the power of 1/3, to the nearest integer? 44 What is the third root of 1268472 to the nearest integer? 108 What is 13395641 to the power of 1/3, to the nearest integer? 237 What is the square root of 998192 to the nearest integer? 999 What is the third root of 8200176 to the nearest integer? 202 What is the third root of 132576 to the nearest integer? 51 What is the third root of 2718878 to the nearest integer? 140 What is the sixth root of 359729 to the nearest integer? 8 What is the fourth root of 342621 to the nearest integer? 24 What is the ninth root of 7652567 to the nearest integer? 6 What is the third root of 36751 to the nearest integer? 33 What is the cube root of 2181035 to the nearest integer? 130 What is the cube root of 2437552 to the nearest integer? 135 What is the third root of 16556063 to the nearest integer? 255 What is the third root of 1027803 to the nearest integer? 101 What is the square root of 218924 to the nearest integer? 468 What is 211239 to the power of 1/9, to the nearest integer? 4 What is 196322 to the power of 1/2, to the nearest integer? 443 What is 2162407 to the power of 1/8, to the nearest integer? 6 What is the fourth root of 4651405 to the nearest integer? 46 What is the ninth root of 1574898 to the nearest integer? 5 What is the tenth root of 2907867 to the nearest integer? 4 What is 579516 to the power of 1/7, to the nearest integer? 7 What is 1472 to the power of 1/6, to the nearest integer? 3 What is 318306 to the power of 1/4, to the nearest integer? 24 What is the fourth root of 575283 to the nearest integer? 28 What is 1102434 to the power of 1/3, to the nearest integer? 103 What is the ninth root of 775808 to the nearest integer? 5 What is the square root of 801371 to the nearest integer? 895 What is 7069638 to the power of 1/3, to the nearest integer? 192 What is the square root of 76974 to the nearest integer? 277 What is the fourth root of 657097 to the nearest integer? 28 What is 149467 to the power of 1/2, to the nearest integer? 387 What is 89758 to the power of 1/2, to the nearest integer? 300 What is 223419 to the power of 1/4, to the nearest integer? 22 What is 4020455 to the power of 1/3, to the nearest integer? 159 What is the square root of 1042624 to the nearest integer? 1021 What is 1463106 to the power of 1/2, to the nearest integer? 1210 What is the fourth root of 1232037 to the nearest integer? 33 What is the cube root of 11237404 to the nearest integer? 224 What is 334524 to the power of 1/7, to the nearest integer? 6 What is 334366 to the power of 1/3, to the nearest integer? 69 What is the square root of 450850 to the nearest integer? 671 What is 13663679 to the power of 1/5, to the nearest integer? 27 What is the square root of 1072663 to the nearest integer? 1036 What is the third root of 1085921 to the nearest integer? 103 What is 2695638 to the power of 1/3, to the nearest integer? 139 What is 2698885 to the power of 1/3, to the nearest integer? 139 What is 563375 to the power of 1/2, to the nearest integer? 751 What is the eighth root of 180232 to the nearest integer? 5 What is 705645 to the power of 1/8, to the nearest integer? 5 What is the fifth root of 8459158 to the nearest integer? 24 What is 294002 to the power of 1/3, to the nearest integer? 66 What is 730044 to the power of 1/3, to the nearest integer? 90 What is 426294 to the power of 1/4, to the nearest integer? 26 What is the fourth root of 54404 to the nearest integer? 15 What is 22090786 to the power of 1/4, to the nearest integer? 69 What is 6125434 to the power of 1/2, to the nearest integer? 2475 What is 137055 to the power of 1/10, to the nearest integer? 3 What is 1773999 to the power of 1/3, to the nearest integer? 121 What is the tenth root of 226872 to the nearest integer? 3 What is the sixth root of 1552024 to the nearest integer? 11 What is 5664592 to the power of 1/5, to the nearest integer? 22 What is 5715475 to the power of 1/3, to the nearest integer? 179 What is 14447336 to the power of 1/3, to the nearest integer? 244 What is the fifth root of 9937014 to the nearest integer? 25 What is 516889 to the power of 1/3, to the nearest integer? 80 What is the third root of 9288054 to the nearest integer? 210 What is the square root of 184951 to the nearest integer? 430 What is 5556179 to the power of 1/5, to the nearest integer? 22 What is 12365744 to the power of 1/7, to the nearest integer? 10 What is the eighth root of 452144 to the nearest integer? 5 What is the seventh root of 116150 to the nearest integer? 5 What is 315810 to the power of 1/3, to the nearest integer? 68 What is 302562 to the power of 1/3, to the nearest integer? 67 What is the seventh root of 1337437 to the nearest integer? 8 What is the sixth root of 243587 to the nearest integer? 8 What is 292578 to the power of 1/7, to the nearest integer? 6 What is the third root of 5685879 to the nearest integer? 178 What is 379553 to the power of 1/10, to the nearest integer? 4 What is the fourth root of 105284 to the nearest integer? 18 What is 1802966 to the power of 1/2, to the nearest integer? 1343 What is the third root of	{ "pile_set_name": "DM Mathematics" }
s ((-1375)/33 - -9)/(2/(-12)) a multiple of 37? False Let j(g) be the third derivative of g*4/24 + 17g*3/3 + 22g*2. Does 14 divide j(0)? False Suppose t - 4x + 24 = 5t, 0 = -3t - 5x + 26. Let y(f) = -25f + 2. Let i be y(-4). Suppose -i = -tv + v. Is 22 a factor of v? False Let j(s) = -5 + 9s*3 + 1 + 6s*2 + 5s - 8s3. Let w be j(-5). Let q(t) = -3t - 5. Is 7 a factor of q(w)? True Suppose -4x = 5d + 577, 3d = -x + 2d - 145. Suppose -28r = -33r + 15. Is 13 a factor of x/8(-6)/r? False Suppose 50x + 1480 = 55x. Is 8 a factor of x? True Suppose 5j + 2s - 202 = 0, 3s + 118 = 3j + s. Is 4 a factor of j? True Suppose 7x = 2x - 2s + 16, 0 = 2x + 5s - 19. Suppose xd + 8 = -2d. Is 3 a factor of 9 + -4 - (4 + d)? True Let o(a) = -8a - 64. Is o(-33) a multiple of 10? True Let g be (-552)/(-84) + 4/(-7). Let j(w) = -w3 + 7w*2 - 5w + 34. Does 10 divide j(g)? True Let x(l) = -2l3 + 23l*2 - l - 11. Does 33 divide x(11)? True Suppose 4i + 4x - 23 = 5, -4i = -2x - 22. Does 3 divide (0 + -2)(-63)/i? True Let u = -22 + 27. Suppose -uo + 53 = -137. Is o a multiple of 12? False Let u = -19 - -24. Let r be (14/35)/(1/u). Suppose -rg + 20 = -82. Does 21 divide g? False Let n(k) = -13k3 + 2k*2 + 3k + 2. Let s be n(-1). Suppose 0 = p - 3 - s. Is p a multiple of 3? False Let r(f) = f3 + f2 + 5f - 23. Is 13 a factor of r(7)? False Let o = -18 + 63. Is 15 a factor of o? True Let w(r) = -2r*2 - 5r + 1. Let j be w(-5). Let a be j/16 + 6/4. Suppose a = -3n - 3 + 15. Is 4 a factor of n? True Let y = -9 - 4. Let u(q) = q3 + 13q*2 - 3q + 1. Is u(y) a multiple of 13? False Let j(o) = o*3 + 3o*2 - 6o - 14. Is 2 a factor of j(-2)? True Suppose 1340 = 9x - 8x. Is 11 a factor of x? False Let y(c) = 6 - 9c3 - 9c*2 - c - 12c*3 + 20c*3. Is y(-9) a multiple of 15? True Suppose 0 = -68h + 64h + 24. Suppose 0 = -hd + 11d - 110. Is d a multiple of 4? False Suppose s - 7s = 0. Suppose s = -5a + 8a - 39. Is a a multiple of 11? False Suppose 3a = 2b + 51 + 35, -5a + 155 = -b. Does 8 divide a? True Let q(i) = 216i - 10i2 + 14 - 218i + 3i2 - i3. Does 7 divide q(-7)? True Let k(w) = -w2 + 127w + 189. Does 23 divide k(67)? True Let r(n) = -5n2 + 56 + n2 + 3n*2. Let b be r(0). Does 10 divide (-54)/(-21)b/6? False Suppose -5w = -377 + 47. Is 6 a factor of w? True Let h(n) = 4n*2 - n - 1. Let a be h(-1). Suppose 2q - 70 = -ax, 0 = -3q - 3x - 17 + 134. Is q a multiple of 9? False Let s(q) = 195q*2 - 13q - 4. Let o(c) = -97c2 + 6c + 2. Let k(w) = -9o(w) - 4s(w). Does 14 divide k(-1)? False Let f(j) = -j*3 - 4j*2 - 10j - 7. Does 7 divide f(-11)? False Let g(a) = -a + 17. Let o be g(12). Suppose -s + 4 - 3 = 0, -5s = -ow + 30. Is w a multiple of 3? False Suppose -33z = -31z - 4s - 2372, 5s = -3z + 3525. Does 59 divide z? True Let i(q) = -q3 + 26q*2 + q + 35. Is i(26) a multiple of 25? False Let s be (-1)/((-272)/(-92) + -3). Suppose -4b = 4i - 84, i - s = -0b - 2b. Suppose u - 3m = 5 + i, -88 = -4u + 4m. Does 7 divide u? True Let r(x) = 21x + 0x*2 + 7x*2 + 5 + 0x + 9x2 - x3. Is r(17) a multiple of 11? False Let t = -65 + 61. Let a(o) = -5o + 5. Is 3 a factor of a(t)? False Let x(s) = s3 - s2 + s. Let k be (-3)/12 - 10/(-8). Let h(i) = -58i3 - 5i*2 + 4i. Let t(g) = kh(g) - 5x(g). Is 16 a factor of t(-1)? True Suppose x = 1, 0 = -3a + 18x - 13x + 337. Let g = -398 - -572. Let p = g - a. Is 20 a factor of p? True Let g(s) = -s2 + 5s - 13. Let d be g(6). Let u = -13 - d. Let w = 30 - u. Does 6 divide w? True Let m(p) = 10p + 12. Let b be m(-12). Let c = 147 - b. Is 11 a factor of c? False Let h(u) = u3 + 13u*2 + 14u + 29. Let a be h(-12). Suppose -3m - 281 = -5q, 4q + am - 4m = 218. Does 15 divide q? False Let p = -115 - -68. Let s(l) = -13l + 14. Let a be s(-6). Let y = a + p. Is y a multiple of 14? False Suppose 11p - 31988 = -4950. Does 22 divide p? False Suppose -2n = 2n. Suppose 3t - 3 - 15 = n. Does 6 divide t? True Suppose 3590u - 3583u = 13090. Does 85 divide u? True Let x(t) = -t*3 - 8t*2 + 3t + 12. Let v be x(-8). Let i(p) = -p*2 - 15p + 7. Is i(v) a multiple of 19? False Suppose 0v - 5v - 5n = 320, 0 = v - 4n + 44. Let a = v - -84. Does 5 divide a? False Suppose -p = 4p - 1380. Is 7 a factor of (-10)/(-25) - p/(-10)? True Suppose 5t = 3z - 91 - 51, -8 = 4t. Suppose -6x = -10x + z. Is 5 a factor of x? False Is (2 + 24 + 2)280/196 a multiple of 7? False Suppose 0 = 2l + 4j - j + 1111, 2219 = -4l - 5j. Let a be (l/19)/(2/(-10)). Let u = -83 + a. Does 21 divide u? False Suppose 6b - 3762 = 234. Is 74 a factor of b? True Let w(j) = -j*2 - 7j + 3. Let r be w(-7). Suppose -rc = c. Suppose c = -m - 3m + 160. Is m a multiple of 14? False Let d = 2485 - 2009. Does 12 divide d? False Let w(k) be the first derivative of 1/4k4 + 5/2k*2 + 8/3k*3 - 6k + 2. Is 8 a factor of w(-7)? True Let b(j) = -j*2 + 4j - 4. Let q be b(6). Let a be (q/(-4) + 1)/1. Suppose 0 = -4y + 20, 3c - 8 = -0c + ay. Is 9 a factor of c? False Let j(y) = y*2 + 3y - 5. Suppose -u + 2z - 18 = -6u, 11 = 2u - 3z. Let q be j(u). Suppose q = -4b + 175. Is b a multiple of 19? True Is 58 a factor of (3927/11)/((-5)/(-5))? False Let c = -56 + 959. Is c a multiple of 129? True Suppose 4c - 2c = -j + 818, 2j - 1631 = -3c. Does 29 divide j? False Suppose 53i - 30107 + 2494 = 0. Is 3 a factor of i? False Let n = -22 + 38. Let u be (4/n)/((-2)/(-16)). Suppose 1 = d - u. Is d a multiple of 3? True Let b be 4/8 + (-14)/(-4). Suppose -355 = -bq + 961. Suppose -4k - 5j + q = 0, -402 = -5k + 3j - 0j. Is 27 a factor of k? True Let z be (130/3)/((-6)/(-27)). Suppose 3r = -3b + z, -195 = r - 4r + 4b. Does 13 divide r? True Suppose -2304 = -19i + 869. Does 28 divide i? False Suppose -2p + 515 = h + p, 5h - 2545 = -5p. Suppose 0 = -7y + 887 + h. Does 14 divide y? False Suppose -3w - 309 = -3i, 2w + 2w + 3i = -384. Let r = w + 140. Does 6 divide r? False Let r = 133 - 202. Let c = r + 36. Let d = -24 - c. Is d a multiple of 6? False Suppose 0 = -l + 6 + 15. Let n = l - 3. Is 10 a factor of n? False Let d(i) = -i*3 + 2i*2 + i + 3. Let n be d(3). Let o be 6/n - (-75)/1. Suppose -20 = -4t, -4t + o = 2f - 27. Is f a multiple of 32? False Let t = 34 + -6. Suppose -5y + 2y = -63. Is 884/t - (-9)/y a multiple of 16? True Let j(r) = -21r2 + 15r + 19. Let y(z) = -11z2 + 8z + 10. Let p(v) = -4j(v) + 7y(v). Is p(-2) a multiple of 7? False Suppose 2r + 744 = 4a - 2r, -5a + 4r = -931. Suppose 4h - a - 197 = 0. Is h a multiple of 12? True Let h = -14 - -244. Is h a multiple of 64? False Does 10 divide (315/12)/(-7)424/(-3)? True Let a = 8 - 3. Suppose -2t - ai = -2i - 9, -6 = 5t - 2i. Does 5 divide (6 - t)/12? False Let b = -70 + 99. Does 4 divide b? False Let w be (-12)/3 - (-1 - 7). Suppose 3k - u - 241 = 0, wk - 236 = 5u + 89. Is k a multiple of 16? True Suppose 43r - 2538 = 16r. Is r a multiple of 4? False Let y(f) be the second derivative of f*4/6 - 5f*3/3 + 3f*2 + 58f. Let l = -15 + 24. Is y(l) a multiple of 26? True Suppose 17l + 74 = 839. Is 15 a factor of l? True Let k(f) be the first derivative of -3f*2/2 + 4f + 8. Let x be k(-3). Is 4 + x/((-39)/(-270)) a multiple of 19? False Let u(j) = 9j3 + j2 - 3j + 1. Let k be u(2). Let c = 10 + k. Is c a multiple of 30? False Suppose 2h - 534 = w, 1337 = 5h - 3w - 0w. Let o = 372 - h. Is 19 a factor of o? False Let d = 287 - 147. Is 5 a factor of d? True Let w(x) = 37x - 32. Let q be w(11). Suppose 360 = 4z + l + 3l, -4z = l - q. Is 18 a factor of z? False Suppose f - 4m - 6 = 0, 3m = -2f - 7 - 3. Let h be (1 - 13) + -4 + 2. Let x = f - h. Is 3 a factor of x? True Suppose 5i - 14 = 11. Let g be ((-304)/(-6))/((-22)/(-33)). Suppose -3j + 2r = -r - 54, -2r = ij - g. Is 8 a factor of j? True Let o(x) = 18x2 + 4x + 18. Is o(3) a multiple of 24? True Let n be (-2)/(-13) + (-850)/(-221). Is ((-38)/n)/((-6)/12) a multiple of 6? False Suppose -3v = 4v - 3885. Suppose 0 = -5r + 545 + v. Suppose -3f = 2f - r. Is 22 a factor of f? True Suppose -4x = -32 + 4. Suppose 2h - 3w + 48	{ "pile_set_name": "DM Mathematics" }
10, 0 = 2f + 3g - 2 for f. -5 Solve -2j = 3p + 1, 4p - 12 - 10 = 2j for p. 3 Solve -5j + 5y + 10 = 0, 2j - y = 1 - 2 for j. -3 Solve -4h - 3 = -7h + 3u, 0 = -h - u + 1 for h. 1 Solve -3y = -c - 2y, -5c + y - 12 = 0 for c. -3 Solve 4l + 15 = y, 4y + 0 - 9 = -l for l. -3 Solve 3j + 5n + 145 - 161 = 0, -4j + 4n = 32 for j. -3 Solve 3m + 4 = b - 5b, 28 = -7m for b. 2 Solve 2c + 3 = 3l - 12, 3c = 0 for l. 5 Solve 5s = y + 208 - 230, 0 = 5y - 3s for y. -3 Solve -7 = 4u + 5n - 19, 3u - 14 = -5n for u. -2 Solve -7j + 3j + z - 4 = 0, 2 = -2j - z for j. -1 Solve -2r - 6 = m, -2r - 12 = 10m - 6m for r. -2 Solve 10u + 3 = 14u - b, 3b = u + 2 for u. 1 Solve c + 4x = 15, -2c - 2x + 4 = -8 for c. 3 Solve 0 = 5t + 3k + 21, 5t + 15 = 2t - 3k for t. -3 Solve 0 = 2h - 6r + 11r - 5, -6 = -2r for h. -5 Solve -3o - 4v = -v, 3o + v = 6 for o. 3 Solve -4z + 2a = 0, -2z + 12 = a + a for z. 2 Solve y - 2s - 3 = 0, 7 = -3y - 17s + 15s for y. -1 Solve -4a = -3h - 0h + 14, -5h = -4a - 10 for h. -2 Solve -3j = 5u - 30, 0 = 6j - 9j + 2u + 9 for j. 5 Solve 4x = 2j, 3j + 8x - 8 = 6x for j. 2 Solve 3g + g + 14 = 2l, -5l = -g - 17 for g. -2 Solve 12i = -t + 14i - 1, 0 = -2t + i - 8 for t. -5 Solve 2i + 5y = 24, 3y + 8 = 20 for i. 2 Solve 15 = -4j + h, 5j + 40 = -4h + h for j. -5 Solve 2z - v - 4 = -z, 0 = 2z + 2v for z. 1 Solve -2i = y - 0 - 4, -4y = i - 16 for y. 4 Solve 4b - 13 = 3j, -4j - 1 = -j - b for j. 1 Solve 0 = n + 43j - 44j + 4, 5n - 3j = -16 for n. -2 Solve -3 = 3i + 2h, i - 2h + 9 = -0i for i. -3 Solve -3o + 4y + 8 = 0, -5y + 6y + 2 = 5o for o. 0 Solve 5 = -3v + 3g - 19, -9 = -2v - 3g for v. -3 Solve -5m + 5x = -40, -18x + 23x + 30 = 0 for m. 2 Solve p - w = 0, 4p - 3p + 3w - 4 = 0 for p. 1 Solve -5g + 27 = -4d, -29g + 5d = -32g - 6 for g. 3 Solve 0 = 5b + 7v - 5v + 19, -4v - 20 = 4b for b. -3 Solve 2n - 5c + 3c = -8, 2n = 5c - 5 for n. -5 Solve 0 = 3o - 3c + 6, 24c + 11 = 2o + 27c for o. 1 Solve -o + 3i + 4 = -9, -4o + i - 3 = 0 for o. -2 Solve b + 3a + 23 = -b, 2a + 14 = -b for b. -4 Solve 5q = 3w - 7, 2w + 13 = 5q + 4w for q. 1 Solve 0 = q + o + 3, 2o + 5 = -q - 2 for q. 1 Solve 3s - 2f = -2s - 18, 4s - 5f = -11 for s. -4 Solve 3x + 0r + r + 8 = 0, -6 = 5x - 2r for x. -2 Solve -5w - 2s = 31, -4w - 5s - 40 = w for w. -5 Solve 2o = -3f + 3, -4o + 5 = 5f - 0 for o. 0 Solve 2p + 4 = 6, 1 = -4q + p for q. 0 Solve -5y = 2f - f, f - 2 = -3y for f. 5 Solve 8m = 2j + 10m + 10, -2j + 5m + 4 = 0 for j. -3 Solve 2c = 2a + 47 - 43, -3a - c = -2 for a. 0 Solve 4r + 11x + 12 = 7x, 0 = 3x for r. -3 Solve 0b = -5u + 2b - 12, -4b = -u + 12 for u. -4 Solve 5u - 5 = 5n, 3n + 2u = 4n for n. -2 Solve r + 3i - 3 = 0, -4r - 20i = -19i - 1 for r. 0 Solve -4h = 2j + 12, -2h - 5j + 32 = 22 for h. -5 Solve -2h = -o + 1, 3h = h + 4 for o. 5 Solve -4o + 6r - 7 = 3r, 2r = 3o + 5 for o. -1 Solve 14n + 5 = 15n + q, -3q = -9 for n. 2 Solve -5n + 18 = -c, 0c + c + n = 0 for c. -3 Solve -y + 2m + 0 - 10 = 0, 3m = 3y + 18 for y. -2 Solve 4d - 22u = -19u + 1, -25 = -5d - u for d. 4 Solve s + 7 = -0s - 3w, 0 = -2s + 3w + 4 for s. -1 Solve -r = 7m - 2m - 22, -2r = -5m + 16 for m. 4 Solve 5p + 21 - 1 = -4v, -25 = -5p + 5v for p. 0 Solve 3j - 4r = -2, 15 - 11 = 2r for j. 2 Solve 3 - 16 = -5s - 3z, -5z = s - 7 for s. 2 Solve 6w - 3w = -2v - 3, -12 = 2w - 2v for w. -3 Solve 2i + h = 1, 2i = -0i + 3h - 3 for i. 0 Solve -4v + 36 = -5i, -17 = -i - 5v - 1 for i. -4 Solve q = -3c + 9, -q - c = 4q - 3 for q. 0 Solve 3k - 3q - 15 = 0, 5k + q = -2q - 7 for k. 1 Solve -5i = 5, 5b - 2i + 7 = -16 for b. -5 Solve -4m + 20 = 2t, 3t - 4 = -m + 6 for m. 4 Solve -3n + 4t = 9, 11t - 5t - 6 = 2n for n. -3 Solve -44l + 49l = -5a + 5, 5a - 21 = 3l for l. -2 Solve 2a + 4l + l = 15, 0 = 3a + 4l - 19 for a. 5 Solve -13u + 20 = -8u, s = u - 5 for s. -1 Solve 3r = 13x - 11x + 17, 23 = -2x + 5r for x. -4 Solve 0a + 8 = -2i - 2a, 5 = -5a for i. -3 Solve -4d - 3 = k + 2k, 0 = 2k - d + 2 for k. -1 Solve 0 = -2o - 2q + 2, -o - 7 + 8 = 5q for o. 1 Solve -4s = 2v + 6, -4v + 8v = -s + 16 for v. 5 Solve -l - 4x = -3l + 10, 2x = 4l + 10 for l. -5 Solve -f + 4t + 21 = 0, 3t = 3f + 7t + 1 for f. 5 Solve -16 = -4p + 4x, 3x - 5x - 12 = -4p for p. 2 Solve 3b + 317d = 315d - 14, 14 = -b - 3d for b. -2 Solve 4r + 15 = 3a, 5r + 10a + 17 = 12a for r. -3 Solve -5h = 2s - 27 + 1, 0 = -4h + s + 13 for h. 4 Solve 0 = 5b - 25, 8 = -4v + 2b + 2b for v. 3 Solve h - 3t - 5 = 0, -2 = -4h - t + 5 for h. 2 Solve -11 = 3f + 4z, -3f + 6f + 3z + 6 = 0 for f. 3 Solve 4a + 20r - 2 = 22r, 5r = -3a - 31 for a. -2 Solve 0 = -5b + 5y + 21 - 11, 2y - 1 = -3b for b. 1 Solve 5t + 11 = 4y - 15, -5y + 3t = -26 for y. 4 Solve l = -2s - 8, -s - 4l - 9 = -6l for s. -5 Solve 10 = -2l, -4b + 5l + 21 = -0b for b. -1 Solve 0 = l + 4y - 22, 4l - 4y + 18 = 3l for l. 2 Solve -18w = -22w, 5w = -4l for l. 0 Solve 4t = -5b - 11, 207t + 20 = 202t for b. 1 Solve 83l - 82l = 3n + 10, 2l = -10 for n. -5 Solve -5f + s = 2s - 18, 16 = 2f - 4s for f. 4 Solve -w + 5 = -3x, -2x + x - 9 = -4w for w. 2 Solve -k = -2s + 3k + 10, -4s = 4k + 28 for s. -3 Solve -9 = -5s + 16, 2i = 5s - 21 for i. 2 Solve 6 = -3h - 41f + 37f, 0 = -5f - 15 for h. 2 Solve 0 = -2t - 2q - 2, 2t - 13 = q + 2q for t. 2 Solve 5 = k, 4f - 5k = -7k - 6 for f. -4 Solve 6f = 3s + 57, 2s - f + 6f - 43 = 0 for s. -1 Solve 6 = -3j - 3q, -5q + 8 = -q for j. -4 Solve -4k + 32 = 5w, -4w + 4 = -4k - 0 for k. 3 Solve -k + 0k + 4g = -7, -3 = k + g for k. -1 Solve -c + 5f + 22 = -2c, -4f - 16 = 0 for c. -2 Solve 5f = -5t + 30, 65f + 2t - 17 = 62f for f. 5 Solve -9 = 2p - 3w, 4p + 63w = 59w - 8 for p. -3 Solve 273 = -q + 270, 0 = -3c + 3q for c. -3 Solve -2s + 7 = -b, 5s + 2b = -0 + 4 for s. 2 Solve -2i + 14 = 5p, -10 = 2p - 3p - 4i for p. 2 Solve m + 8 + 5 = -5h, -3h - m - 9 = 0 for h. -2 Solve -4s + 0s - 10 = 3f, -5f - 2s - 12 = 0 for f. -2 Solve -4q = -z, z + 5q = 3q + 6 for z. 4 Solve -4m = -3s - 17, 3s + 3m - 19 = -s for s. 1 Solve 5p - 3p = 5s - 20, 3s - 12 = -3p for s. 4 Solve 13g + 4s = 14g + 10, -3s + 27 = -4g for g. -6 Solve 5b = 2c + 17, -5c = 3b - 55 + 20 for b. 5 Solve -7 = -5u + 3, -5a - 5u + 10 = 0 for a. 0 Solve 3h = -2h - 4b - 16, -4h = 3b + 12 for h. 0 Solve -36 = 9m - 6m + 4x, -m + 26 = -5x for m. -4 Solve 2d = -d + 5n + 3, -d - n + 1 = 0 for d. 1 Solve 3a - 8 + 5 = -3j, 12 = 2j + 4a for j. -4 Solve 3h - 2p - p = -9, -5h + 3p = 13 for h. -2 Solve -6 = v + k, 3v + 17 = -0v - 2k for v. -5 Solve -4n = 8y + 1 - 9, 2y + 22 = 5n for n. 4 Solve -2j = 5l + 6, 0 = -5l - 7j - 2 + 6 for l. -2 Solve 4o = -5k + 3, -21 + 20 = -3o - 5k for o. 2 Solve 0 = -3h - 3m - 6, -h - 15 = -2m - 10 for h. -3 Solve 4u + f = -13 + 5, 4f - 8 = 4u for u. -2 Solve 0 = -4h - 20, u - 23h + 24h = -8 for u. -3 Solve -243u = -q - 241u - 10, 0 = 3q - u + 5 for q. 0 Solve -3k = -4q - 24, 0 = k + 3k - 4q - 28 for k. 4 Solve 3x - 15 = 0, -4x = -4c - 12 - 12 for c. -1 Solve -m - 2 = 5w, 3w + w + 4m = -8 for w. 0 Solve 10 = 3g + 2g - 2r, g + 3r - 2 = 0 for g. 2 Solve 20 = 5b - 2w, b + b - 8 = 4w for b. 4 Solve 4a + 5u - 20 = 0, 2a + 39 - 49 = -u for a. 5 Solve 5l - 6 = 3r, 35 - 8 = 4r + 5l for r. 3 Solve 2c = -3t - 1 + 4, -4c = -t + 1 for t. 1 Solve 5p - 11p = 2u - 40, -5u = -25 for p. 5 Solve 0 = i + 2g + 7, -16i - 19 = -13i + 5g for i. -3 Solve -z - 4r = -5r - 2, -2z = -4r for z. 4 Solve 6m - 3m = 5y + 29, -3y = 5m - 3 for y. -4 Solve 0 = 9u - 6u - 3r + 6, -2u + r - 6 = 0 for u. -4 Solve 6 = 2n, -14n = -2r - 9n - 25 for r. -5 Solve 7a + s = 3a - 1, 0 = -a + 5s + 26 for a. 1 Solve l + 9 = -3k, -9 = -3k + 6k for l. 0 Solve -5b - 22 = 4t, t + b + 1 + 4 = 0 for t. -3 Solve 0 = 4k + 12, -4b + 3k - 7k - 20 = 0 for b. -2 Solve 2k - 2 = 2m - 0k, 2m + 4k + 8 = 0 for m. -2 Solve w - 21 = 2c - 9,	{ "pile_set_name": "DM Mathematics" }
2 Solve -3y + 3s + 3 = 0, -16y + 5 = -17y - 5s for y. 0 Solve b + 5 = 5a - 17, 2b - 2a = -12 for b. -2 Solve 4c + 5 - 13 = 0, 9 = -3h - 3c for h. -5 Solve 2o = 2i - 9 + 3, 4i = -5o - 15 for i. 0 Solve 0u - 3u - m + 17 = 0, 5u - 19 = 3m for u. 5 Solve 144w = 5y + 142w - 15, 5y - 5w - 30 = 0 for y. 1 Solve 1 = -2x + q, -2x - 4 = 3x - 3q for x. 1 Solve 8 = 4x + 4g, -2x = -5g - 11 + 35 for x. -2 Solve -5n - 8 = -m - 33, 3n = 12 for m. -5 Solve 2h + 7 = -3d, h - 7 = 3d - d for h. 1 Solve 3x + 4d + 1 = 15, 0 = -2x + 2d for x. 2 Solve 0 = 2z + 4m + 16, 6z - 3m = 11z + 12 for z. 0 Solve 5j - 3g - 25 = 0, -20 = -3j - 2j + 2g for j. 2 Solve 7 = -r + 3u, -u - 7 = -8 for r. -4 Solve -22h + 24h + 6 = n, -4h + 4n - 8 = 0 for h. -4 Solve -t = -3l + 1, 2l - 23 = -5t - 28 for l. 0 Solve 2s = -5a - 4, -137a + 2s + 4 = -138a for a. 0 Solve -5v - 5j = 15, j = 2v + 1 - 10 for v. 2 Solve -3d = -4k + 1, -5k + 2k = -4d + 1 for k. 1 Solve 383h - 381h = -3w + 7, -2w + h = -14 for w. 5 Solve 5t - 2r + 1 = -5, 0 = -5t - 5r - 20 for t. -2 Solve 0 = -165b + 167b, -2b - 15 = -3l for l. 5 Solve -4w = 2t - 5t + 9, 2t = 6 for w. 0 Solve 3i - 3 = 5v, 15 - 21 = 2v for i. -4 Solve -45 + 34 = -4k + x, 17 = 4k - 3x for k. 2 Solve 12o - 8o = 3d - 15, o = 0 for d. 5 Solve 2x + 2s - 46 = -66, 5s = -4x - 43 for x. -7 Solve -5r - 15q = -13q - 2, -r + 5q - 5 = 0 for r. 0 Solve 17 = -5t - 4i, -12t - 5i = -7t + 20 for t. -1 Solve 0 = -5o, -5o - 20 = -5q + q for q. 5 Solve -2 = -2x, -85 = -2k + 2x - 87 for k. 0 Solve 5q = -h + 1, -4h - 170 = 2q - 156 for q. 1 Solve 5s + 4p - 9p + 35 = 0, 2s - 21 = -5p for s. -2 Solve -3n + 2x + 2 = 0, 5n = 3x + 8 - 4 for n. 2 Solve -6d + 11 = -8d - 3b, 3b = -9 for d. -1 Solve 3w + 4w = 4p - 8, -5p + 10 = -3w for p. 2 Solve 4m = 0, -3l + 43 - 46 = 5m for l. -1 Solve 11 = -3z - 3p + 4p, 3z = 4p + 1 for z. -5 Solve -3l = 3c - 11 + 2, -3l - 15 = -c for l. -3 Solve -5s + 20 = -0s, -2b - 2s = -8 for b. 0 Solve -15 = 6g - 11g + 4n, -5g - 4n = -15 for g. 3 Solve l - 8 = -5r - 29, -5l - 3r = 17 for l. -1 Solve -3y = -b - 11, -20b - 23 = -17b - 4y for b. -5 Solve -24r = -n - 20r - 3, 6 = 2r for n. 9 Solve -5p + 21 = -4, -3b - 5p = -31 for b. 2 Solve 0 = 5j + 4o - 36, -3j - 5o - 4 = -9o for j. 4 Solve -h + 7 = -3m, 10 = 2m + 8h - 5h for m. -1 Solve -3m + 25 = 2y, -22 = -m - 5y + 8 for m. 5 Solve 0k - 5k + 5b + 45 = 0, b - 15 = -5k for k. 4 Solve -3t + 4p = -5, -4p + 24 = -t + 23 for t. 3 Solve -i + 6 = 2, -4v - 24 = -5i for v. -1 Solve u = 6u - 5g + 5, -g = -2u for u. 1 Solve 3h + 2 = -j, -4j = 5 + 3 for h. 0 Solve 4s + 0s = -3v - 10, -6 = -3v for s. -4 Solve -18 = -2j + 5m, -2j - 3j + 2m = -24 for j. 4 Solve 156m - 154m = -5q + 22, 2q - 13 = -5m for m. 1 Solve 2m - 5 = 5, 4h = 4m for h. 5 Solve 3m = -z - 15, 5m + 17 = 49z - 48z for m. -4 Solve -4u - 3z + 14 - 34 = 0, u = -z - 6 for u. -2 Solve 0 = -a + 2a + 4b - 1, -b = 5a + 14 for a. -3 Solve -2u = g + 8, 46g - 43g = -u - 14 for g. -4 Solve -y - 5 = 5r - 5y, 2r + 2y - 16 = 0 for r. 3 Solve 12w - 7w + 3i - 8 = 0, -20 = -w + 4i for w. 4 Solve 1 = 2w - p - 1, 5w + 5p + 25 = 0 for w. -1 Solve -4b - b + 10 = 0, -4b = -4q + 12 for q. 5 Solve -p - 3p + y = -8, 6 = 3p + y for p. 2 Solve -15 = -l - 3i, -3l + 10i - 23 = 27 for l. 0 Solve 15 = -86v + 91v + 5q, -5v + q = -3 for v. 1 Solve 4v = 4k + 12, 5v - 3v - 5k - 24 = 0 for v. -3 Solve 2u + f - 20 = -5, 5f = -2u + 35 for u. 5 Solve 4y - 13 + 17 = 5q, -5q = 2y - 28 for q. 4 Solve 2x + 0x - l + 11 = 0, 6 = -3x - 2l for x. -4 Solve 4q - n = -5 - 19, -q = -n + 9 for q. -5 Solve -t + 8n = -6t - 27, 0 = 2t - 3n - 14 for t. 1 Solve 5 = -i, 8i = 3z + 3i - 34 for z. 3 Solve 5o + 12 = 2i + 34, 0 = -o + 2i + 6 for o. 4 Solve 2 = 5i - 3i - b, 2i - 2 = -2b for i. 1 Solve 5b = 3n + 10, -3b + 13n = 17n - 6 for b. 2 Solve 6f + 7 = 3v + 2f, 3f = v + 1 for v. 5 Solve -j = 4j + 20, 0 = -3w - 5j - 5 for w. 5 Solve -4p + c + 17 = -4c, 4p + 4c - 8 = 0 for p. 3 Solve 3c + c - 2r - 10 = 0, -5r + 15 = 0 for c. 4 Solve 5i = 5t - 45, 7 = t - 3t - 3i for t. 4 Solve -4w = -4y - 32, -3w - 2w - 10 = 5y for y. -5 Solve i - 3s = -2 - 4, -3i - 8 = s for i. -3 Solve 8 = -3u + 5m + 2, -5u + 2m = 10 for u. -2 Solve 3h - 15 = -5g + 8g, -4 = -4h - 4g for h. 3 Solve 0 = -4d + 20, -3d - 5 = -5y - d for y. 3 Solve 0 = -5h + 19g - 15g + 1, -h + 9 = -3g for h. -3 Solve t + 5k = -11, -2t - 4k + 0k = 4 for t. 4 Solve -3r - 5q + 22 = 0, 5r - 22 = 3q - 4q for r. 4 Solve -2h + 5 = u + 8, 5u + 3h = -15 for u. -3 Solve -2z - 3f + 11 = 0, f = -4z - 0f + 7 for z. 1 Solve -19 = -2c - 5q, -49c + 54c + 3q = 0 for c. -3 Solve 2o - 1 = -0f + f, 23 = o + 4f for o. 3 Solve -4g - 9d = -6d - 4, 2 = 2g + 3d for g. 1 Solve 11m - 7 = -2u + 10m, -7 = 3u - 2m for u. 1 Solve -3a = -3i + 21, -5a + i = 9 + 14 for a. -4 Solve -d + r + 8 = 2d, -3r + 3 = 0 for d. 3 Solve 0 = -5x - 4y + 18, 3x - 5 + 3 = 2y for x. 2 Solve 0 = 5c - 25 + 5, 3h - 3c = -15 for h. -1 Solve d = -2c - 4, 25d - 26d - 3c = 8 for d. 4 Solve -2i = s + 11, -7 = 2s + 12i - 11i for s. -1 Solve 5y - 25 = -5v, 5v = -4y - 0y + 22 for y. 3 Solve -35 = 5w + 4u - u, 5u + 33 = -2w for w. -4 Solve a - 3d - 27 = -25, 0 = 5a - 3d - 10 for a. 2 Solve -4w - 3q - 27 = -32, -2w - q + 1 = 0 for w. -1 Solve -3c - 18s = -17s + 1, -8 = -4s for c. -1 Solve 3a - 2a - 2 = 3b, a - b = 0 for a. -1 Solve 6q = 4m - 4, 5 = 5m + 4q - 2q for m. 1 Solve 4x = -5a - 30, 16 = 7a - 10a - 2x for a. -2 Solve 3l - 5h + 0h = -0h, l = -3h for l. 0 Solve 0 = -2h - 4, -5h = -6d + 9d - 5 for d. 5 Solve -n + 6 = -3y, 3n + 6 = -3 for y. -3 Solve 4g + 2 = -2m, g = -g - 3m - 11 for g. 2 Solve 5c + 3f = 14, 4c + 7f - 4f = 10 for c. 4 Solve 2l - 2g = 4, -g - 2 = -0g for l. 0 Solve 486i - 4x = 485i - 19, -3x + 18 = 3i for i. 1 Solve j - 4z - 5 = -2z, 5z = 5j for j. -5 Solve 3u + 2l - 3l + 7 = 0, 4u + 5l = -41 for u. -4 Solve -y + 9 = 2q, 0 = 3y - 16 + 1 for q. 2 Solve -3p - 9h + 28 = -4h, -4p = 4h - 24 for p. 1 Solve 0 = -2b + 7b + 5, -b = -5x + 11 for x. 2 Solve 36g = 4n + 31g + 30, 7 = -3n - 4g for n. -5 Solve 9t = -4z + 12t - 29, 5t - 15 = 0 for z. -5 Solve 5c - i - 9 = 0, 0 = -14c + 12c + 4i for c. 2 Solve 8g + 24 = 4g - 2i, 3g + 4i = -23 for g. -5 Solve -i - q = i + 1, 31 = 3i - 5q for i. 2 Solve 2d - 14 = 4p - 8, -11d = 33 for p. -3 Solve 1312f - 1313f + 2g - 13 = 0, -4g + 16 = 0 for f. -5 Solve 2h = 3i - 4 - 1, -4h = -3i - 5 for i. 5 Solve -2q = -2, 13p = 9p + 4q for p. 1 Solve 0 = 8x - 12x + k - 18, 2x + 5k + 20 = 0 for x. -5 Solve m - 4l - 19 = 0, 342l = 5m + 344l + 15 for m. -1 Solve 2k = 3p + 13, -8p + 5p = -5k + 10 for k. -1 Solve -4v + 13 + 9 = 5q, 4v = 2q + 8 for q. 2 Solve -4h + 3o - 5o + 6 = 0, 2o + 6 = -h for h. 4 Solve -2u + 3j = 22, -2j + 7j - 5 = -3u for u. -5 Solve 0 = -h - 5, 5b + 5h = 3b - 21 for b. 2 Solve 2c - 2z - 2z + 20 = 0, -2c = z for c. -2 Solve w - 8 = 3d, 3w = -23d + 25d + 3 for w. -1 Solve -p - 3g = -2g + 5, 5p + 3g = -25 for p. -5 Solve z = k + 10, 23z - 20z = -5k - 2 for k. -4 Solve 3w - 2w - 6 = 2a, 5w = -a + 19 for w. 4 Solve -20 = 4h, 5y - 8h = -4h + 25 for y. 1 Solve 3t - 27 = -3x, -x - 2x = 2t - 23 for x. 5 Solve 4t - 19 = 3i, 5i + 20 = -3t - 2t for t. 1 Solve -2o - o + 10 = -2c, 4o - c = 10 for o. 2 Solve 2s = s - 5j + 26, 4j = -s + 21 for s. 1 Solve 2h - h - 5r = 24, r = -4 for h. 4 Solve -v + 4 = -4i + 3, 0 = -i - v - 4 for i. -1 Solve -3x - 2d = 5 - 18, 0 = -2x + 3d - 13 for x. 1 Solve -2g + 2v + 2 = g, 0 = -2g - 5v - 24 for g. -2 Solve y + 3x - 3 = 0, y - 4x + 11 = -0 for y. -3 Solve -p - t = 4, 4p - 24 = -5t + 9t for p. 1 Solve -5v - 18 = 3b, -12b - 6 = -9b + v for b. -1 Solve -4j = -3w + 30 - 49, -2w - 6 = -j for w. -1 Solve -3x = 2z + 2, -24 = -5x + 4z - 20 for x. 0 Solve -p + 4y + 21 = -0p, 4*	{ "pile_set_name": "DM Mathematics" }
3g - d - 2 for g. -1 Let j be (2/(-4))/(1/(-4)). Let n(b) = 208b + 2708. Let k be n(-13). Solve -ka + ja = -10 for a. 5 Let p(q) = q*3 - 2q*2 + 10q - 5. Let t be p(5). Suppose 0 = 5k - 135 + t. Solve -12 = -z - kz for z. 3 Let s be 43/(-2)-6 - 1. Let h = s - 128. Solve -4q - 10 - 6 = h for q. -4 Let u be 11/(429/(-48854)) + 2/(-6). Let k = u + 1278. Let s be 34/6 + (-3)/(-9). Solve sz = 11z + k for z. -5 Let g = -5 - -12. Suppose 0 = -15d + gd + 144. Suppose a = 3a - 3o - 5, -5a = -2o - d. Solve 2y - 4y + a = 0 for y. 2 Let r(n) = n*2 + 26n - 3528. Let q be r(-74). Solve -qh + 7h + 119 = 0 for h. 7 Suppose 14h - 516 = -2g + 12h, -2g + 4h = -522. Let t = g + -255. Solve -t = 16b + 12 for b. -1 Let o = -534 + 572. Suppose -oy + 33y = -20. Solve 6u - 2 = yu for u. 1 Suppose 4p = -3o + 16, 2o - 27p = -23p - 16. Suppose 4t = -s - 17 + 80, 4s - t - 167 = o. Solve -s = b - 48 for b. 5 Let o = 240 - 231. Let z be (-203)/(-63) + (-1)/(o/2). Solve 0 - 6 = -zq for q. 2 Let y = -284 + 157. Let d be y + 3 + 4 + -5. Let t = -114 - d. Solve 0 = -2v - t + 1 for v. -5 Let j(h) = -3482h - 3482. Let m be j(-1). Let y = 12 + -7. Solve 15 = -mt + yt for t. 3 Let i be (-1928)/(-40) - (-2)/(-10). Solve 102 = 30c - i for c. 5 Let t(v) = 2v*2 - 84v + 725. Let z be t(10). Solve -12q + 29q = z for q. 5 Let w(o) = o*2 + 5o - 7. Let b be w(5). Let c = b - 29. Suppose 0 = -7i + 35 - c. Solve iq = -0q + 15 for q. 5 Suppose 0 = 45z - 3 - 42. Solve -17v + 16v = -z for v. 1 Suppose -275 = -4k + c, 352 = 5k - c + 8. Suppose -kp - 42 = -75p. Solve 5 - p = 2j for j. -1 Let s(b) = 42b + 1351. Let z be s(-32). Solve -17c = -zc + 50 for c. -5 Suppose 0 = 3j + 2c + 290, -j - 3c + 381 = -5j. Let w = -86 - j. Suppose -wd = -8d. Solve y + dy = 0 for y. 0 Suppose 0 = -21i + 57 + 48. Suppose 3n + 4v - 28 = 0, -64 = -in + 11v - 9v. Solve 6x + 12 = -n for x. -4 Suppose 12274m - 12222m - 2288 = 0. Solve mf + 183 = -17f for f. -3 Suppose -2g - 2h - 6 = 0, -2h - 8 = 2. Suppose 40 = -3b - 14. Let t be 2/64(-9 - b). Solve gc = t - 4 for c. 4 Let k(y) = -12y - 167. Let j be k(-12). Let i(d) = 10d + 233. Let m be i(j). Suppose t + 0t - 8 = 0. Solve mv + t = v for v. -4 Suppose -856 = -2w + 4s, 3w - 2s = 5w - 874. Suppose w = 7x + 406. Solve 4t - x = 12 for t. 4 Let i = 902 + -877. Let q be (-20)/i + 236/20. Solve 17t - qt + 12 = 0 for t. -2 Suppose 405r - 409r = 5s - 107, -s + 2r = -13. Solve -1 = -5d + s for d. 4 Suppose -n = 3r - 5, 41n - 42n + 3 = r. Solve 0 = nk - 5k for k. 0 Suppose 72 = 6t - 0t. Let f = 169 - 116. Let z = -45 + f. Solve t = zk - 5k for k. 4 Suppose 0t - 12 = -4t. Suppose 0s + 108 = 27s. Suppose si - t = i. Solve n = 2n + i for n. -1 Suppose 233k - 237k - 3o = 15, k = 6o + 30. Solve -25j + kj + 75 = 0 for j. 3 Suppose -z - 18 + 49 = 0. Solve 19f = zf + 24 for f. -2 Suppose 15p + 6p + 2919 = 0. Let a = 144 + p. Solve -2i + 35 = ai for i. 5 Let b be 2/(-8) + 3 + 55/(-20). Suppose b = 12q - 92 + 32. Solve qh = h + 16 for h. 4 Suppose 0 = 3n + w - 32, 20 = -109n + 112n + 4w. Solve -nf + 10 = -7f for f. 2 Suppose 14m - 7m = 217. Let v(c) = -m - 3c - c + 24. Let y be v(-3). Solve -w = -6w - y for w. -1 Suppose 14 = 2i + 2r - 6r, -5r = 3i + 23. Let u be (-6)/i - (10 - 16). Solve 4 = -2a + u for a. 4 Let m = 167 - 201. Let l = 50 + m. Solve -2x - 2x + l = 0 for x. 4 Let n be 7120/600 + 2/15. Suppose -17v = -32v. Solve 12 = -vk + nk for k. 1 Let l be (4 - (-5 - -12)) + 3. Suppose -11m + 15m - 16 = l. Suppose -2o = -3o + g, 0 = -o + mg - 15. Solve -6 = 3c - oc for c. 3 Let g(x) = -2x*2 - 39x - 34. Let b be g(-18). Suppose 4r = 6s - s - 9, 5r - b = 0. Solve -f - 24 = sf for f. -4 Suppose 0 = -5b + 3u + 26, -u - 20 = -2b - 3u. Let h(a) = -a + 7. Let j be h(b). Solve 5x = -jx + 15 for x. 3 Let x be (-122)/(-3) - 80/48. Let l = x + -35. Solve -l = 4n - 2n for n. -2 Suppose 11d = 5 - 16. Let v be (-240)/360((-19)/2 + d). Solve -12f = -vf - 10 for f. 2 Let s(o) = o*2 - 9o + 13. Suppose -7u + 46 = -3. Let j be s(u). Let m be (1/1 - 5)/(j/2). Solve -4 = 3d + m for d. -4 Suppose 3y - 3l + 111 = 0, -4y - 23 - 125 = 2l. Let v be y/13 - (-6)/(-39). Let k = v + 3. Solve -5 = d - kd for d. -5 Suppose -142a + 1660 = -18818 - 1390. Solve 0 = -31i - 61 + a for i. 3 Let u(z) = -3z - 4. Let q be u(-2). Let g be (-4 + q)/20/(-12). Suppose -4n + 9 = k, -4k - 7 - 5 = g. Solve 0 = s - ns for s. 0 Let t be 0/(-2(-4)/(1 + -5)). Let s be (-18)/((-3)/1) - (5 + -5). Solve t = v - sv for v. 0 Let k(v) = -138v + 423. Let m be k(3). Solve -mr - 401 = -329 for r. -8 Let r = 124 + -94. Suppose -5l + 27 = 4a, -5a = -17l + 22l - r. Solve -lu + 0u = 12 for u. -4 Let o = 329 - 326. Suppose o = 5s - 27. Solve -3t - s = -5t for t. 3 Suppose -211 + 643 = -20n + 68n. Solve -4g = 7 + n for g. -4 Suppose 5520g + 4 = 5522g. Solve gl - 39 + 43 = 0 for l. -2 Let u(r) = -3r2 - 83r + 44. Let x be u(-28). Suppose xf = -9f. Solve f = -k - 1 for k. -1 Let i(x) = -9x + 21. Let l be i(5). Let u = -81 - l. Let z = 57 + u. Solve z = 4s - 5s + 4 for s. 4 Suppose 54k - 162 = 36k. Let n = 35 + -31. Solve 0 = -nf - k - 11 for f. -5 Suppose 2p + 226 = 4k, 3p + 853 = 15k + p. Solve -49c + kc = 56 for c. 7 Suppose -15 = 3b, 44r - 3b = 49r + 15. Solve 9u + 3u + 60 = r for u. -5 Let q = -1512 + 1515. Solve 18z + q = 57 for z. 3 Let j be (0/10)/(-2 - -1). Suppose -5y - h - 8 = j, 3y - 4h = -0y - 14. Let x be 1/y6 - -3. Solve 2 = -xv + 2v for v. 1 Let f = -680 + 685. Suppose -fa = -127 + 102. Solve au = 9 + 1 for u. 2 Suppose -3290 = -74f + 6411 - 1265. Solve -fm = -126m - 12 for m. -1 Suppose 73s - 66s = 2338. Let a = s + -331. Solve z + az = 8 for z. 2 Let l be -23826/(-27) - (-46)/(-138). Solve -3o + 538 = l for o. 3 Let p = -3021 - -3025. Solve -k - 1 = -p for k. 3 Let j be (-16)/120 - (-2)/15. Let p be (-1169)/(-167)((-20)/(-14) + j). Solve -10r = -5r + p for r. -2 Let c be (18/36 + 6/(-4))-193. Let i = -181 + c. Solve -y = 2y + i for y. -4 Let y = -9070 - -9072. Solve 58 = yn + 70 for n. -6 Let w be (-6)/2 + 12/((-6)/(-2)). Let n be (-1 + w + 5)/(-10 + 11). Solve c + 16 = nc for c. 4 Suppose 40p - 136p + 1555 = -3437. Solve -p = -11n + 3 for n. 5 Let a(l) = -8l + 2. Let n be a(-1). Suppose -13 = -2i + s, i = 4s - 8s + 2. Suppose 8t = nt - i. Solve 3q - t = 4q for q. -3 Let u = 191 + -623. Let j = u - -437. Solve 1 = jl + 16 for l. -3 Let y(u) = -u2 - 7u + 6. Let w be 0 - (10 - (-12)/(-3)). Let g be y(w). Solve -3r - g + 0 = 0 for r. -4 Let m = 67 + -1. Suppose -5t + 47 = -273. Let f = m - t. Solve -fv = v for v. 0 Let a be (56/(-35))/(6/(-15)). Let s be (-102)/(-4) + (-1 - a/(-8)). Solve 0y = -5y + s for y. 5 Let b = 1997 + -1982. Solve -4l - 11 = -bl for l. 1 Let l be (-8)/(-12) + 5780/(-30). Let j be (-25)/(-11) + l/704. Solve -2y + 8 = j for y. 3 Suppose 5u - 13u = 11u. Solve u = 12p - 31p for p. 0 Let o(i) = -3i + 2. Let x be o(0). Suppose 0 = -xt, 0 = 3w + 3t + t - 12. Let m = 18 + -12. Solve wu = mu - 6 for u. 3 Let v be ((-21)/(-48))/(3/1146) + (-1)/8. Solve -7u - v = -139 for u. -4 Let z(x) = x*3 + 49x*2 + 58x - 239. Let f be z(-48). Let a = f + 759. Solve 8o + a = 16o for o. 5 Let w = 278 - 276. Suppose 10 = 2t - wy + 4, y = 4t - 27. Solve -17h + 19h = t for h. 4 Suppose u + 4r - 34 = -0u, -4u + 2r = -154. Let l be (u/(-5))/((-4)/40). Let c = l + -51. Solve -6i + i = -c for i. 5 Let k(c) = 6c - 27. Let b be k(5). Let v(r) = 3r + 8rb - 6r - 7r3 + 2. Let h be v(-2). Solve u + 1 - 2 = h for u. 1 Suppose -6d = -27d + 19d + 102. Solve -24 = -dx + 27x for x. 1 Let g(u) = -u3 + u2 + 19u + 35. Let c be g(5). Solve c = -9b - 6b for b. -2 Let f be ((-120)/28)/((-230)/1932). Solve a - 10a - f = 0 for a. -4 Let b = -242 + 241. Let t be b(2/10 + (-144)/20). Solve 3f + 2 = -t for f. -3 Suppose 9x = 4t - 68, t - 6t + x = -44. Solve m - 7 = tm for m. -1 Let z = 385 - 380. Suppose 531 = zq + 411. Solve -6k + q + 0 = 0 for k. 4 Let h(i) = 4*i + 8. Let s be h(-5). Let v = s + 13. Let q be (-1)/(v/20)	{ "pile_set_name": "DM Mathematics" }
on factor of 18 and n. 6 Let t be ((-8)/(-18))/((-8)/(-36)). Let p be 12/2 + (1 - 2). Suppose -i + 372 = ti - 4n, -i - pn = -143. Calculate the greatest common factor of 16 and i. 16 Suppose -2a + a = -56. Calculate the highest common divisor of a and 8. 8 Let o = -62 + 113. What is the highest common divisor of o and 34? 17 Suppose -3a + 4 = -2. Let z = -8 + 12. Suppose -al = 0, -660 = -zb + 2l + l. What is the highest common factor of 15 and b? 15 Let t(c) = -c*2 + 9c - 4. Suppose -6z + z = -30. Let b be t(z). What is the greatest common factor of 14 and b? 14 Suppose 14 = 3c - 34. Let q(f) = -f*3 + 9f*2 + 6f - 6. Let z be q(9). What is the highest common factor of c and z? 16 Suppose 0 = 4h - 96 + 8. What is the highest common factor of 110 and h? 22 Suppose -b - b = 0. Suppose 0 = 2a + 2g - 28, 0 = a - bg + 4g - 2. Let z = a - -4. Calculate the highest common factor of 33 and z. 11 Suppose -12 = -3q, 2b + 4q = -q + 40. Calculate the highest common factor of b and 4. 2 Suppose 219 + 837 = 8o. Calculate the greatest common divisor of 12 and o. 12 Let t(o) = 0o2 + 2 - o3 + 5o2 + 7o*2. Let q be t(12). Suppose 10 = qm - 160. What is the greatest common factor of m and 34? 17 Let l be (48/(-1))/3-12. What is the greatest common factor of 12 and l? 12 Let b = -7 + 31. Let i = b - 12. Calculate the greatest common divisor of i and 108. 12 Let c(o) = -48o + 3. Let b be c(-2). What is the highest common divisor of 9 and b? 9 Let n be (-882)/(-45) + (-4)/(-10). Let k be 1 + (-2 - (1 - 2)). Suppose kh + 40 = 5h. Calculate the greatest common factor of n and h. 4 Suppose -5f = -f + 5u - 27, -3f + 5u - 6 = 0. Suppose 12 = ft + t. Calculate the highest common factor of t and 27. 3 Suppose -5p - 6 = -4p. Let l(g) = -g. Let i be l(p). Calculate the highest common divisor of i and 12. 6 Let g(d) = 5d*2. Let l be (1 - (4 + 0)) + 5. Let q be g(l). What is the greatest common divisor of 8 and q? 4 Suppose 5j - 22 - 17 = -3s, -9 = -3j. Let v be s/(-2)(-18)/8. What is the greatest common divisor of v and 6? 3 Let b(y) = -5y + 0y + 3y - 3 - 1. Let w be b(-7). Calculate the highest common factor of 30 and w. 10 Let n = 937 - 596. What is the greatest common factor of n and 31? 31 Let z(i) = -i*2 - 2i - 1. Let p be z(-3). Let o = p + 54. Suppose -2v + o = 3v. What is the highest common factor of v and 15? 5 Let y be 11(-2 + 0 - -3). Let o be (1 - (0 - -64))-1. Suppose 0 = -s - o + 184. What is the highest common factor of y and s? 11 Suppose 0 + 8 = 4h. Let d(m) = -4m - 6. Let j be d(-2). What is the highest common divisor of j and h? 2 Let m(a) = a*3 + 4a*2 - 2a. Let z be m(-4). Let r = z + -6. Calculate the greatest common divisor of r and 10. 2 Suppose 7 = 4f - 3f. Let t be (-174)/(-10) + (-4)/10. Let r = t + -10. What is the greatest common divisor of r and f? 7 Let s = 2 + -4. Let r be (-1 - s) + 3 + -2. Let p = 2 + r. Calculate the greatest common divisor of p and 1. 1 Let i(t) = 5t3 + 3t*2 - 1. Let j be i(-2). Let f = j + 41. Let o be 8/(-3)f/(-8). Calculate the highest common divisor of o and 44. 4 Let k = -1 - -2. Let w(z) = 2z3. Let q be w(k). Suppose -17 = -3x - q. Calculate the greatest common divisor of 1 and x. 1 Let y(x) = -x*2 - 5x + 6. Let r be y(-6). Suppose 3p + 14 - 2 = r. Let v be ((-1)/1)/(p/180). What is the greatest common factor of 9 and v? 9 Suppose -25 = -5p - 0a + 3a, -p = 3a + 13. Suppose 0 = -0l + l. Suppose 2w = -lw + p. Calculate the highest common factor of 3 and w. 1 Let a(j) = j. Let q be a(-3). Let u(p) = -2p3 - 3p*2 - 4p - 4. Let l be u(q). Suppose 0k - 5k = -l. Calculate the greatest common factor of k and 63. 7 Let f = -43 - -50. What is the highest common divisor of f and 21? 7 Suppose n + 4n = 450. Suppose y = -3y - 4. Let v be 43 - (3 + y). Calculate the highest common factor of n and v. 10 Suppose 0 = 10f - 5f - 100. Calculate the greatest common divisor of 20 and f. 20 Let v be ((-1)/3)/((-4)/228). Suppose -3j + 2j + 4d = 21, -5j + 3d = 37. Let k = v + j. What is the greatest common divisor of 56 and k? 14 Suppose s = 5r + 187, 3s - 3r - 561 = -0s. What is the highest common divisor of 17 and s? 17 Let o = -27 - -82. What is the highest common divisor of o and 22? 11 Let z = -75 + 82. Calculate the greatest common divisor of 28 and z. 7 Suppose 4b + 8b - 4704 = 0. What is the highest common divisor of 49 and b? 49 Let t = 8 - 13. Let y(i) = -i*2 - 8i - 5. Let p be y(t). Calculate the highest common factor of p and 2. 2 Suppose -7q = 196 - 1274. Calculate the highest common divisor of q and 14. 14 Suppose -d = -3d + 54. Suppose 0l + 14l - 42 = 0. What is the greatest common factor of l and d? 3 Let x be (6/4)/((-1)/(-48)). Suppose 4i - 4c - 13 = -1, -5 = 5c. Suppose 3 + 13 = in. Calculate the greatest common factor of n and x. 8 Suppose 18 = -0k + k. Calculate the highest common factor of k and 27. 9 Let z = -4 - -12. Suppose 0 = 5m - p - 115, -5m + 3p + 152 = 47. Calculate the greatest common factor of z and m. 8 Let k = 6 - 1. Suppose 0 = -3n - 0 + 6. Calculate the greatest common factor of k and n. 1 Let c be (0 + -1)/(1/(-17)). What is the greatest common divisor of 17 and c? 17 Let p = -5 - 1. Let z = p + 10. Suppose -2j = 4 + 6, -5g + 5j = -45. What is the highest common divisor of z and g? 4 Let t(v) = -v*3 - 3v*2 - 3v - 1. Let k be t(-3). Let s = -30 + 58. Let p be 8/s - (-12)/7. Calculate the highest common divisor of p and k. 2 Let w(f) = 3f - 2. Let v be w(1). What is the highest common factor of 4 and v? 1 Let i(q) = 2q*2 - 6q - 4. Let f be ((-4)/3)/(7/21). Let h be i(f). What is the highest common factor of 26 and h? 26 Let j be 0 + 1 + 0 - -19. Let x(s) = -s*2 + 6s + 10. Let g be x(10). Let q = 20 - g. Calculate the highest common factor of q and j. 10 Let l be (-12)/(-18) + 106/3. What is the greatest common factor of l and 54? 18 Let u = -4 - -8. Suppose -3p - 16 = -4o, -7 - 9 = -uo + 2p. Let n be 2 + 2 + -1 + 1. What is the highest common divisor of o and n? 4 Let t be (-24)/1842/(-4). Calculate the greatest common divisor of t and 2. 2 Suppose 2j + 5g = 28 + 25, 4j = -2g + 82. Calculate the highest common factor of j and 171. 19 Let f be 10/(-15)(-10 + 1). Let b = 37 - 22. Calculate the highest common factor of b and f. 3 Let j be ((-2)/(-6) - (-4)/6) + 53. Calculate the highest common factor of j and 27. 27 Let h(z) = -z + 9. Let p be h(-6). Let c = -14 + p. Calculate the greatest common divisor of 3 and c. 1 Let u(h) = 2h2 - 5h - 7. Let r be u(-7). Suppose -g = g - r. Suppose -2i + 19 = 1. What is the highest common divisor of g and i? 9 Suppose -3y + 38 = -4g, -2y = 3y - 3g - 45. What is the highest common factor of 2 and y? 2 Let s = 112 + -32. What is the greatest common factor of 40 and s? 40 Suppose 114 = -5a + 364. What is the greatest common factor of a and 10? 10 Suppose -2p - 38 = 4n, -4n - 12 = 8. Let a = 5 - 9. Let j = a - p. Calculate the highest common divisor of 5 and j. 5 Let h be (-1)/5 + 4/(-5). Let t(s) = -91s3 + 2s + 1. Let v be t(h). Calculate the highest common factor of v and 10. 10 Suppose -2l = -l - 3. Let t = l - 4. Let m be -43/(-6) - t. What is the greatest common factor of 27 and m? 3 Suppose 5p = 85 - 15. Let c(m) = -m3 - 14m*2 + 16m + 17. Let o be c(-15). What is the highest common factor of o and p? 2 Suppose -2u + j + 4j + 276 = 0, -4u = -j - 534. Suppose -5p - u = -23. Let s = 40 + p. Calculate the greatest common factor of s and 45. 9 Suppose -2g + 88 + 60 = 0. Suppose -4b - g = -394. Calculate the greatest common factor of 10 and b. 10 Suppose -5d + a + 5 = 0, -5d - a = -d - 4. Let w = 35 - 16. Suppose -w = -j + d. Calculate the greatest common factor of 5 and j. 5 Suppose 3a = -2a - 4l + 1023, 4l - 816 = -4a. Let t = 44 - 21. What is the highest common factor of a and t? 23 Suppose -i - 2q = i - 20, i = q. Calculate the highest common divisor of 20 and i. 5 Let a = -7 + 18. Suppose -z = -a - 34. Calculate the highest common divisor of 9 and z. 9 Let h be ((-246)/(-4) - 1)2. Let j = -20 + 31. What is the greatest common factor of h and j? 11 Suppose -12q = -16*q + 64. What	{ "pile_set_name": "DM Mathematics" }
9z4 - z4 + 0z*4. 5z4 + z2 Expand (1 - 6q + 10q - 3q)(-8 - 4 + 5). -7q - 7 Expand (-3s - s*3 + 3s)(11s + 3s - s). -13s*4 Expand (-4s + 0s + 2s)(5s + 3s - 2 - 10s). 4s2 + 4s Expand (2 + 3b - 2)(1 + 2b - 1)(-6b + 3b + 5b). 12b*3 Expand -4r - 4r + 6r + (0r - r - r)(-11 + 2 - 11). 38r Expand (-1 - 5 + 3)(2p5 - p3 + p3) + 2p*5 + 2p5 - p5 - 4p5 - p5 - 5p*5. -13p*5 Expand (-2v*2 - 2v*2 + 5v*2)(0v - v - v) + 42v*3 - 51v + 80v - 29v. 40v3 Expand j5 - 2 + 2 + 3j*3 - 3j3 + j5 + (0j5 + 3j*5 - 2j*5)(-4 + 4 - 2) - j*5 + 15j*5 - 4j*5. 10j*5 Expand (0 + 0 - d)(2d4 - 2d*4 - 2d*4) - 2302d*3 + 2302d*3 + 26d*5. 28d*5 Expand (-1 + 1 + 6h + (4 - 2 + 0)(0 + 0 + h) - 2h + 0h + h)(h*2 - 5h*2 + 2h*2)(-2 - h + 2)(-4 + 0 + 3). -14h*4 Expand (0g + 2g2 + 0g)(-2g3 + g3 + 3g3) + (-5g + 3g2 + 5g)(2 - 2 - g3). g5 Expand (2c*2 - 2c*2 + 2c*3)(0 - 2 + 3). 2c3 Expand 0z - 2z2 - 6z + 2z + (1 - 1 + 2z*2)(-2 + 1 + 0) + 5z - z2 - 5z. -5z2 - 4z Expand -q*5 - 1 + 1 + (4 + 2q*3 - 4)(-5q2 - 2q*2 + 3q*2). -9q*5 Expand (4 - 4 + 3m)(82 - 82 + 16m*3). 48m*4 Expand (-2d2 + d2 + 6d2)(-4d2 + d2 - 2d*2) - 3d*4 + 2d - 2d. -28d*4 Expand (-3v3 + v3 + 3v3)(3v - 4v*2 - 3v) - v*5 - 4v*2 - 3v*2 + 3v*2. -5v*5 - 4v*2 Expand -3j*4 - 2j*4 + 3j*5 - 5j*5 + (2j + 2j4 - 2j)(-2j + 2j - j) + 2 - j5 - 2. -5j*5 - 5j*4 Expand (3p*3 + 2p3 - p3)(2p + 3 - 3) + p*2 - 2p4 - p2. 6p4 Expand (4r - r - r)(2 + 1 + 3). 12r Expand (-3i2 - 4i2 + i2)(2i - 2i + 2i + (3 - 1 + 2)(-4i - i + 3i)). 36i*3 Expand (-2b4 + b4 - 2b4)((7 + 25 - 6)(-2 + 7 - 3) + 2 - 1 - 2). -153b*4 Expand (-19 - 2 + 3)(0c2 + 6c2 - c2). -90c2 Expand (-7 + 2 + 4)(2j + 0j + 0j)(3 - 5 - 1)(-1 + 0 - 1)(1 - 1 - 1). 12j Expand (0 + 0 - l)(0l2 - l2 + 2l2). -l3 Expand -2g + 0g + 0g + 3g + 0g - g + (1 + 2 - 2)(-2g + 0g + 3g) + (0 + 2 + 1)(1 - 1 + 2g). 7g Expand 5 + u*2 - 4 - 2u*2 + (0u + 3u - 4u)(u - 5 + 5). -2u*2 + 1 Expand (4 - 4 - 4)(0n + n + 0n)(5n - 4n + 3n). -16n2 Expand (-o + 1 - 1)(-4 + 0 + 1)(-4 - 3o + 4). -9o2 Expand (0 + 0 - 2)(0o + o - 2o) + (1 - 1 - o)(-4 + 4 + 2) + 1 - 1 - o. -o Expand -3p*5 + 0p*5 + 5p*5 + (p - 2p*2 - p)(-13 + 6p3 + 13). -10p*5 Expand 2u3 + u2 - u*2 + (-6u + 2u + 10u)(-3u*2 + 3u2 - u2). -4u3 Expand (2i*4 - 3i*4 + 3i*4 + (0i + 2i - 4i)(-2i*3 + 2i - 2i) + i3 - i3 - i4 - 3i + 3i4 + 3i)(-6 + 5 + 5). 32i*4 Expand 2y - y*3 - 2y + (4y2 - y2 - 2y*2)(3y + 0y - 5y) + (2y*2 - 6y2 + y2)(1 + y - 1) - 3y*2 - 3y*3 + 3y*2. -9y*3 Expand (-7 - 1 + 26)(3 - 2j3 - 3) - 4 - 2j*3 + 4. -38j*3 Expand (-1 - q + q - 2q)(-5 + 4 + 6). -10q - 5 Expand -3c5 + 4c*5 - 3c*5 + (-4c*2 + 3c2 - c2)(3c*3 - 2c*3 + 0c3) + c5 + c*5 - 3c*5. -5c*5 Expand (52 - 6z*2 - 52)(-z - 3 + 3). 6z3 Expand (-3j + j*3 + 3j)(-2 + 0 - 3). -5j*3 Expand (-8 + 6 + 2b + 1)(b4 + b4 - 4b*4). -4b*5 + 2b*4 Expand -2u*2 + 2u2 + u2 + (3u - 3u - 3u)(3u + 6 - 6). -8u*2 Expand (-3 + 3 + 2 - 8o*2)(2o + 1 - 1). -16o*3 + 4o Expand (-4 + 4 - 1)((0 - 2 + 1)(-2d - 3 + 3) + d - 5 + 5)(-5d4 - 11d*4 - 2d*4). 54d*5 Expand -2m*5 - 4m + 5m + 0m5 + 0 - m5 + 0 + (2m4 + m4 - 5m*4)(2m - 2m - 2m). m5 + m Expand -2i + 0i + 3i - i - 2i + 5i + (-2 + 2 + 2i)(2 - 7 + 3) + i - 2i + 0i. -2i Expand (-3y3 + y3 - 10y4 - 6y*4)(5y - 2y + y). -64y5 - 8y*4 Expand (-3u*3 + 2u*3 + 0u*3)(0u + 0u + u) - u*4 - 4u*4 + 4u*4 + (4u*4 + 3u*4 - 5u*4)(0 - 1 + 2) - 1 + 3u4 + 1. 3u*4 Expand ((-5 + 0 + 4)(h + 3h - 5h) - 5h + 7 - 7 - h + 2h - 2h)(1 - 1 + h). -5h2 Expand (0w + 2w3 + 0w)(-4 + 2 + 1) + (-2 - 3w + 2)(10 - 10 + 5w*2). -17w*3 Expand (-w - 4w + 4w)(3w + 0w - 2w) - 33w*2 + 3w*2 + 0w*2. -31w*2 Expand (-q - 1 + 1)(4q3 - 4q3 - q3 + (0 + 0 + 2q2)(-4q - q + 4q) - q*3 + 0q*3 - 3q*3). 7q*4 Expand (-7u + 4u - 13u)(-5 + 2 + 2). 16u Expand -3d4 + 1 - 1 + 6d*4 + 27d - 27d + 5d*4 - 2d*4 - 4d*4 + (0d*3 + 4d*3 - 2d*3)(3d + d - 6d). -2d4 Expand (-3 + 3 + 2)(-3t3 + 2t*3 + 2t*3)(-5t2 + 7t*2 - 13t*2). -22t*5 Expand (-2q*3 + 4q3 - q3)(-44q*2 + 0q - 2q + 35q*2). -9q*5 - 2q*4 Expand (-p - 3p - 2 + 0p)(-24p - 11p*3 + 24p). 44p4 + 22p*3 Expand (2x + 2x5 - 2x)(1 - 2 + 3) + (-2x + 2x4 + 2x)(-25x - 5x + x). -54x*5 Expand ((6 - 1 - 4)(4 - 4 + 2) + (-4 + 1 + 1)(0 + 4 - 5) + 3 + 1 - 6)(2 - 2 + 2s). 4s Expand -2w2 + 2w*4 + 2w*2 + (3w - 6w + w)(-w*3 + 2w*3 - 2w*3) + (-5w + w + 3w)(-39 - 2w3 + 39 + 12w). 6w4 - 12w*2 Expand (0 - 1 + 3)(-2 - 2v + 2) + (-2v + v + 0v)(8 - 1 - 1). -10v Expand (2 - 2 - 3l)(43 + 10 - 8). -135l Expand 19q2 + 21q*2 + 1 - 39q*2 + 2q*4 + (-3q + q + q)(0q3 + q3 + q*3) + 0q*4 - 2q*4 + 0q*4. -2q4 + q2 + 1 Expand 10k5 + 10k*5 - 6k5 + (-k4 + k2 - k2)(-1 + 1 + 2k). 12k5 Expand (-4k2 - k2 + 3k2 + k2 - 1 + 1 + (0 + 3 - 4)(2k2 + 4k - 4k))(-2k2 - 3k*2 + 3k*2). 6k*4 Expand (-1 - 2 + 2)(-7 + 6 + 13)(2d - d - 2d)(-2d + 0d + d). -12d2 Expand 0x + 5x + 4x + (-x + 0x - x)(-5 + 4 + 2)(-2 + 2 + 1). 7x Expand (-b + 0 + 0)(-8 + 6 - 7). 9b Expand 5m3 + 6m*3 - 5m*3 + (0m2 + m2 - 2m2)(-5m - m + 5m) + 2m3 + 3m*3 - 3m*3 - 4m*3 + 5m*3 - 3m*3. 7m*3 Expand (0 + 4 - 2)(-t + 3t - t)(t3 + t3 + 0t3). 4t4 Expand (-c2 - c5 + c2)(1 + 8 + 0)(1 - 5 + 2). 18c5 Expand -3k3 - k3 + 2k3 + (3k - k + 0k)(-k*2 + 0k2 - k2) + 10 - 4k3 + 16 - 28 + (k + 0k + 0k)(-2k2 + 2k - 2k). -12k*3 - 2 Expand -j + 2 - 2 + (-j - 2j + j)(1 - 2 - 1) + j - j + 2j + (-4 + 3 + 3)(6j - 3j - j). 9j Expand (-30m2 + 27m*2 - 38m*2)(-m*2 + 1 - 1). 41m*4 Expand (5v + v - 3v)(0 - 2v + 0)(-1 + 0 - 2). 18v2 Expand (-8 + 5a - 3a2 + 8)(-a - 3a + 3a). 3a3 - 5a*2 Expand (23 + 18 - 56)(-3w - 3w + 4w)(3w + 3w - 4w). 60w*2 Expand 2u3 - u3 + 2u3 + (1 + 2 - 1)(-u*3 + 2u*3 - 3u3) + (0 - u2 + 0)(2u - 1 + 1) - 3u3 + 2 - 2. -6u3 Expand m5 - m*5 + 2m*5 + (-3m*4 + 2m*4 + 2m*4)(-3m - 1 + 1) - 3m*5 - 3m5 + m5 + (-3m5 + 3m*5 - 2m*5)(0 + 3 - 1). -10m5 Expand -16f*3 + 2f*5 + 16f3 - f5 - 2f5 + 4f*5 - 1 + 1 - 2f*5 + (2f - 4f + f)(2f4 + 1 - 1) + 2f*5 - 4f*5 + 0f*5. -3f*5 Expand (b - 2b + 9b)(-3 + 1 + 6). 32b Expand (0z + 0z - 2z*3)(-2z + 111z*2 - 2z - 108z2). -6z*5 + 8z*4 Expand -3r*5 + 2r*5 + 2r*5 + (6r + 4r3 - 6r)(7r*2 + 2r*2 - 4r*2) + 2r5 + r5 - r*5. 23r*5 Expand (2 + 3 - 3)(-1 + 1 - 2a2) + (-3a2 + a2 + 0a2)(-3 + 2 + 0) - a + 5a2 + a. 3a*2 Expand (1 - 1 + 1)(-2k + 3 - 3 + 2k + 2k - 3k + (3 + 0 - 4)(5k - k - 2k))(-k2 + k2 + k*2). -3k*3 Expand (5 - 5 - 2h)(-h - 3 + 3) + 2h*2 - 4h + 4h. 4h*2 Expand -2c*4 + 5c*4 - 2c*4 + (-2c + 0c + c)(-1522c2 + 63c*3 + 1522c*2). -62c*4 Expand -4b + 4b - b3 + (1 - 5 + 2)(1 - 1 - 2b)(-b*2 - 5b + 5b). -5b*3 Expand 0l*2 + 0l*2 + 2l*2 + (-2l2 + l2 + 0l2)(-1 - 3 + 3) + 5l - 5l + 2l2 + 3l - l + 2l2 + l. 7l*2 + 3l Expand -u*2 - 4u*2 + 19u*5 - 22u*5 + (2 + 1 - 4)(4u5 - 6u5 + u5). -2u5 - 5u*2 Expand (0z*4 + 5z*4 - 2z*4)(-14z + 5z + 4z). -15z*5 Expand (2 - 5 + 4)(2 - 2 + 1)(2q - q - 2q). -q Expand (-g2 - 3g*2 + 3g*2)(1 + 2g - 1) + (0g - 2g + 6g)(-g2 + g - g). -6g*3 Expand -3h*4 + 4h4 + h4 + (-3h2 - h2 + 2h*2)(0 - 2h2 + 0) + h3 - h3 - 2h*4 + (-3 + 1 + 0)(2h4 - h4 + 0h*4). 2h*4 Expand (2 - 3 + 2)(-2 + 2 - 4)(2u - u + 3u). -16u Expand (0s*2	{ "pile_set_name": "DM Mathematics" }
et c(d) = 4d2 - d + 4. Let q(g) = -28g*2 + 12g - 13. Let s(o) = 10c(o) + 2q(o). Let m(y) = -y*2 + y + 1. Give ls(u) - 28m(u). -4u*2 Let a(w) = w - 15w*3 - 4w - w*2 + 13w3 - w2 - 3. Suppose -3 = -5p + 27. Let g(v) = 14 + v2 - 27 + v + 5 + 4 + v3 + 5. Calculate pg(d) + 2a(d). 2d*3 + 2d2 Let i(h) = -h3 + h*2 - h. Let a(r) be the first derivative of 5r4/4 - r3 + 3r2/2 - 2r + 7170. Determine -a(p) - 6i(p). p3 - 3p*2 + 3p + 2 Let z(h) = 2h3 - 2h*2 + h - 1. Let o(i) = 18i*3 - 5i*2 + 3i - 4. Determine o(l) - 4z(l). 10l*3 + 3l2 - l Let v = -18551 - -18544. Let j(x) = -x2 + 4x - 2. Let q(l) = l2 - 4l + 1. Determine vq(p) - 6j(p). -p*2 + 4p + 5 Let z(m) = -2m - 2. Let j(o) = 6258o + 194001. Let v be j(-31). Let k(u) = 10u + 7. Let n(b) = 9b + 7. Let s(q) = -4k(q) + 5n(q). Give vs(c) + 8z(c). -c + 5 Let q(m) = 14274m3 + 2m*2 - 22m. Let f(h) = 33415435h3 + 4683h*2 - 51513h. What is -2f(w) + 4683q(w)? 14272w3 Let q(r) = -6r3 + r2 + 8r - 20. Let b(n) = -10n*3 + 2n*2 + 17n - 51. Determine 2b(y) - 5q(y). 10y3 - y2 - 6y - 2 Let h(o) = -262o + 12. Let d(v) = -6292v + 286. Calculate -6d(t) + 143h(t). 286t Let f(l) = 10l*3 + 286l*2 + 6l + 6. Let p(j) = 18j3 + 571j*2 + 11j + 10. Give 5f(i) - 3p(i). -4i3 - 283i*2 - 3i Let z(h) be the second derivative of -5h3/6 - 13h*2/2 + 23h - 1. Let v(c) = c + 19. Let n be v(-23). Let x(o) = -2o - 6. Calculate nz(q) + 9x(q). 2q - 2 Let p(x) = -2x3 + 9x*2 - 631x + 9. Let w(k) = 6k3 - 25k*2 + 1889k - 24. What is 11p(q) + 4w(q)? 2q3 - q2 + 615q + 3 Let k(c) = -1807c2 + 4c + 4. Let b(w) = -5903454w2 + 13069w + 13069. What is -4b(q) + 13069k(q)? -1867q2 Let w(p) = 2p*3 - 5p*2 + 7p - 7. Let b = 869 - 861. Let n(x) = -3x + 48x*2 - 46x*2 + 12x*3 + 3 + bx*3 - 21x*3. What is 5n(q) + 2w(q)? -q3 - q + 1 Let w(t) = -479t + 1. Let y(v) = 1910v - 4. What is -15w(m) - 4y(m)? -455m + 1 Let b(p) be the third derivative of p6/120 - p5/60 + p4/24 - p2. Let o(j) = 3j + 2j*3 - 3j*2 - 65997 + 131989 - 65992. Give -5b(f) + 2o(f). -f3 - f2 + f Suppose -5t + 25 = -5p, t - 16 = 2p + 5t. Let h(k) = -4k + 47. Let j(n) = 2n - 23. What is ph(q) - 13j(q)? -2q + 17 Let x(k) = -4k3 - 8k*2 - 12k - 20. Let b be x(-2). Let y(n) = 3n - 2. Let g(f) = 2f - 2. Calculate bg(t) - 3y(t). -t - 2 Let z(b) = 98 - 5 - 6b - 74 - 10 - 7. Let o(d) = -7d + 3. Calculate 4o(h) - 5z(h). 2h + 2 Let j(o) be the first derivative of 5o*3 + 9o*2/2 - 9o - 1093. Let g(v) = 7v2 + 4v - 4. Calculate -5g(y) + 2j(y). -5y2 - 2y + 2 Let s(m) = -m*2. Suppose 5t = 9t + 60. Let g be 52/12 - (-20)/t. Suppose -gk = -2i - 1, -2k = -7 + 1. Let d(j) = -4j2. Determine id(p) - 18s(p). 2p*2 Let x(j) = 11j*3 + 4j + 4. Let c(p) = 10p3 + 3p + 3. Let t = -3067 + 3064. Determine tx(o) + 4c(o). 7o3 Let w(x) = 31x + 2. Let f = 6399 + -6400. Let u(h) = -h. What is fw(l) - 6u(l)? -25l - 2 Let h(d) = 5d*3 - 4d*2 - 3d + 3. Let g(c) = 11c3 - 9c*2 - 6c + 7. Suppose 553u = 747u - 1358. What is uh(v) - 3g(v)? 2v3 - v2 - 3v Suppose -413 = 8f + 211. Let h = f + 87. Let w(m) = 13m*3 + 9m*2 - 7m. Let a(b) = 3b3 + 2b*2 - 2b. Give ha(g) - 2w(g). g*3 - 4g Let n(z) = -108z2 - z - 16. Let v(i) = -321i*2 - 3i - 45. Calculate 17n(y) - 6v(y). 90y2 + y - 2 Let t(b) = -b3 + 2b + 1. Let d(n) = -2n3 + 70n*2 + 21n + 51. Let a be d(35). Let y = -781 + a. Let q(x) = -2x3 + 5x + 3. What is yt(c) - 2q(c)? -c*3 - 1 Suppose -11 = -705m + 744m + 28. Let q(s) = 4s + 31. Let g(n) = -n + 1. Give mq(f) - 3g(f). -f - 34 Let u be 1/(-7)1(14 + (-45 - 4)). Let b(o) = -o + 43. Let v(t) = 22. What is uv(l) - 2b(l)? 2l + 24 Let i(t) = 4t*3 - 17t*2 + t - 7. Let y(w) = 16w*3 - 58w*2 + 3w - 28. Determine -11i(x) + 3y(x). 4x3 + 13x*2 - 2x - 7 Let x(a) = -10a2 + 17921a + 18. Let y(s) = -4s2 - s + 6. Determine x(l) - 3y(l). 2l2 + 17924l Suppose -472i - 5445 = 23i. Let c(z) = -16z - 16. Let y(n) = -7n + 6. Let j(t) = -3t + 3. Let g(o) = 13j(o) - 6y(o). Calculate ig(u) - 2c(u). -u - 1 Let v(x) = -10x3 - 6. Let z(j) = -j3 - 3j2 + 4j + 4. Let g be z(-4). Let w(a) = 9a3 - 693 - 691 + 2077 - 688. Give gw(y) + 3v(y). 6y*3 + 2 Let d(r) = -131 + 392 - 124 - 136. Let h(z) = -8z*2 + 2z + 12. Calculate 12d(l) - h(l). 8l*2 - 2l Let k(i) = -3i + 9. Let n(o) = -3o + 8. Let w(z) = 6k(z) - 7n(z). Let a(r) be the first derivative of 2r2 - 3r - 79. Calculate -5a(l) + 7w(l). l + 1 Let j(m) = -24m + m2 + 2m*2 - 11m + 48m. Let g(k) = k2 + 7k. What is -11g(u) + 6j(u)? 7u2 + u Let v(c) = -154c*2 - 5c + 1. Let t(g) = 154g2 + 6g - 2. What is 4t(r) + 5v(r)? -154r2 - r - 3 Let l(f) = -13f + 3. Suppose -3u + 8 + 13 = 0. Let o be 15-2(-64)/6. Let i(h) = 2 + oh + 327h - 654h. Calculate ui(k) - 4l(k). 3k + 2 Let z(i) = 10i*3 - 847i - 3. Let u(f) = -7f3 + 842f + 2. What is 3u(m) + 2z(m)? -m*3 + 832m Let o(a) = -a - 2. Let f be (6 - (-2 - -2 - -1)) + 1. Suppose fh + 2h = 40. Let w(c) = -1 + 5c - 4c - 1 + 3. Give hw(i) + 3o(i). 2i - 1 Let v(o) = -51o + 5230. Let y(i) = -23i + 2614. Determine 4v(h) - 9y(h). 3h - 2606 Let m(h) = -h*2 + 15h + 4. Let d be m(15). Let l(g) = -4g3 + 6g*2 - 4g - 2. Let t(f) = 3f3 - 5f*2 + 5f + 2. Calculate dl(q) + 5t(q). -q3 - q2 + 9q + 2 Let b(q) = -19q*3 + 9q*2 + 5q. Let h(r) = 95r + 6183. Let l be h(-65). Let d(u) = -29u*3 + 14u*2 + 8u. Give lb(c) - 5d(c). -7c3 + 2c*2 Let z(j) = -1455j*3 + 679j + 679. Let o(x) = -2x3 + x + 1. Calculate -1358o(r) + 2z(r). -194r*3 Let r(d) = d - 2d - 3 - d. Let o(b) = -b*2 + 7b - 7. Let n be o(3). Let m(w) = -w. Let g(i) = -8i - 5. Let x(f) = nm(f) - g(f). Determine 7r(s) + 4x(s). -2s - 1 Let t = 3884 - 3878. Let g(f) = 25f*3 + 13f*2 - 17f. Let x(j) = -6j3 - 3j*2 + 4j. What is tg(o) + 26x(o)? -6o3 + 2o Let s(t) = -10t + 4. Let u(j) = 621j - 3734. Let a be u(6). Let y(r) = -15r + 6. Determine as(v) + 5y(v). 5v - 2 Let u(c) = 3733c3 - 26c*2 + 11c - 13. Let m(j) = 1868j3 - 12j*2 + 5j - 6. Calculate 11m(f) - 5u(f). 1883f3 - 2f*2 - 1 Let u(x) = -7x*2 + 7x - 15. Let l be 8/(48/42) - 2. Let n(p) = -4p2 + 4p - 7. Give ln(m) - 3u(m). m2 - m + 10 Let z(b) = b3 + b - 1. Let l(p) = -68p3 - 144p*2 - 28p + 52. Let j(y) = y*3 + 12y*2 - y - 1. Let t(m) = 12j(m) + l(m). Give -2t(u) - 80z(u). 32u3 Let q(u) = -12u - 8. Let j(p) = -15p - 5. What is -2j(m) + 3q(m)? -6m - 14 Let i(r) be the second derivative of -17r3/6 - 5r*2/2 + 1971r. Let y(q) = -17q - 4. Determine 3i(v) - 4y(v). 17v + 1 Let c(w) = 15w2 - 5w + 2076. Let m(n) = 3n2 - n + 415. Give 2c(o) - 11m(o). -3o*2 + o - 413 Let n(d) = 8d*3 + 10d*2 - 4d - 2. Let j(f) = 17f3 + 21f*2 - 10f - 4. Calculate 2j(z) - 5n(z). -6z3 - 8z*2 + 2 Let o(b) = 5b*3 - 2b. Let s(d) be the second derivative of 0d2 + 0 + 0d*4 - 1/20d*5 + 19d - 1/6d3. Calculate o(p) + 3s(p). 2p3 - 5p Suppose l = 3r - 19, 8 = 4r - l - 16. Let c(d) = -d + d - d + 0. Let u(s) = 6s + 1. Let k = -193640 - -193641. Determine ku(b) + rc(b). b + 1 Let c(h) = 72h - 8. Let i(g) = 161g - 444g + 149g - 3 + 158g. Determine -3c(m) + 8i(m). -24m Let k = 6 + -4. Let i(b) = -5b*2 + 2. Let z(x) = -84x*2 + 35. Let s be (-1 - 0)/((-1)/(-35)). Give kz(h) + si(h). 7h2 Let u(r) = -r + 1. Let x(q) = -q2 - 32q + 187. Let s be x(-37). Let a(l) = 6l*2 + 2l - 1. Give su(d) + a(d). 6d*2 + 1 Let y(l) = 15l*3 + 25l*2 - 18l + 16. Let k(q) = -7q3 - 12q*2 + 8q - 7. Give 5k(v) + 2y(v). -5v3 - 10v*2 + 4v - 3 Let l(d) = 37d2 + 7d - 1. Let y(r) = 6r2 + 2r - 1. Determine l(v) - 5y(v). 7v*2 - 3v + 4 Let v(s) = 2s2 + 2s - 3. Let u(g) = 32g - 4 + 29g + 0g2 + 2g*2 + 24g - 84g. Calculate -3u(x) + 2v(x). -2x*2 + x + 6 Let w(o) = 5o*3 + 4o*2 + 4o + 3. Let b(a) = a3 + a2 + a + 1. What is 9b(x) - 2w(x)? -x*3 + x	{ "pile_set_name": "DM Mathematics" }
y. Let h = -7741/84 - -369/4. Which is the second smallest value? (a) q (b) 0.5 (c) h c Let k = -0.005 + -0.395. Which is the fourth smallest value? (a) 0.4 (b) k (c) 0 (d) -3 a Suppose 16 = 5r + 1. Which is the third biggest value? (a) -2/19 (b) r (c) -4 c Let w = 8 + -4. Let f = w + -4.4. Let g = 0.6 + -0.3. What is the biggest value in 2, g, f? 2 Suppose 5f + 28 = -t + 3t, 4f + 5t = 4. Let z = 18 - 13. What is the third biggest value in -5, f, z? -5 Let a = -0.6 - -0.4. Let b = -3 + 6. Suppose 1 + 5 = bj. What is the biggest value in 4, j, a? 4 Let s = 27.005 - 0.005. Let q = -26.7 + s. Let j = 17/12 + -83/84. What is the smallest value in 1, j, q? q Let n be (180/54)/((-8)/(-6)). Which is the third biggest value? (a) n (b) -4 (c) 0.4 b Let n = 3.58 + -0.58. What is the second smallest value in 0.3, n, -3/7, 4? 0.3 Let m = -96.7 + 99. Which is the fourth biggest value? (a) m (b) -0.1 (c) 4 (d) -3 d Let s = 0.4 + -4.4. Which is the second biggest value? (a) s (b) -0.2 (c) 2/5 b Let u = 2.01 + -0.01. Let a = 251 - 256. What is the third biggest value in -0.1, a, u? a Let s be ((-1 - -4)1)/(-1). Let g be 64/126 + 54/(-243). Which is the second biggest value? (a) g (b) -2/23 (c) s b Let p = 7 + -7.3. Let d = 0.3 - -1.7. What is the second biggest value in -2, p, d? p Let l be (-2)/5 + (-1)/((-50)/(-5)). Which is the third smallest value? (a) 2 (b) l (c) 0.5 a Let m = 10.8 + -12. Let x = 3.8 - m. Let f = -0.15 - 0.05. What is the second smallest value in x, f, -1/7? -1/7 Let j(c) = c3 + 5c*2 - 8c - 6. Let k be j(-6). Let w = k - 11. Let o be 16/(-42) - 2/7. What is the third smallest value in w, 2, o? 2 Let s = 155/28 + -21/4. What is the third smallest value in s, 4, 0.7? 4 Let m = 0 + 0.04. Let s = -0.44 + m. Let w = -1 + -1. Which is the biggest value? (a) -0.2 (b) s (c) w a Let v = 0.4 + -4.4. Let q = 2.5 + 1.5. Which is the third biggest value? (a) 3 (b) q (c) v c Let s be 62/155 - 3/5. Suppose 0c + 9 = 3c. What is the second smallest value in -2/7, c, s? s Let n = 2 + -2. Suppose -v - v + 26 = 0. Suppose -5g - v = 2. What is the second biggest value in n, -2/9, g? -2/9 Let k = 2 + 5. Let u be -4((-63)/(-12))/k. Which is the second biggest value? (a) -2/7 (b) u (c) -3/5 c Let i = 22.5 - 23. What is the third biggest value in i, -1.2, 4/9? -1.2 Let y = 2 + -2. Let w = 0.1 + -0.3. Let g = y + w. Which is the third smallest value? (a) 1 (b) g (c) 0 a Let v = -961/9 + 107. Which is the second smallest value? (a) -5 (b) v (c) 2/15 c Let r be (-2)/8 - 1514133/(-504). Let x = 6005/2 - r. Let t = x - -13/7. What is the biggest value in -3/5, 0, t? t Let l be 4 - (-3 - (3 - 8)). Suppose 4d - c = -4c - 112, 0 = lc. Let i = d + 55/2. What is the biggest value in 1, i, -5? 1 Let s = 219/7 - 31. What is the third biggest value in s, 1/14, -1? -1 Let v = -2 + 1.9. Let w = -9 + 9.1. Let z = w - 0.1. What is the third biggest value in v, -3/8, z? -3/8 Let o be (-1)/(-5)(4 + -5). Let h(n) = n + 9. Let k be h(-4). Let y(d) = d - 6. Let l be y(k). Which is the third smallest value? (a) o (b) -5 (c) l a Suppose -v - 4v = -20. Suppose -4d - v = -8. Which is the biggest value? (a) d (b) -2 (c) 1/6 a Let q = -14.31 - -0.31. Let g = -13.79 - q. Let p = g + -0.01. Which is the second smallest value? (a) p (b) 2/11 (c) 1 a Let z = 0.12 + -1.32. Let h = 1 + z. Which is the second biggest value? (a) h (b) -0.5 (c) -1 b Let d = 1 - 2. Let g = -42 + 42. Let b = d - g. What is the third smallest value in b, 0, 0.3? 0.3 Let u = -0.6 + 0.3. Let j = -14 + 17. What is the second smallest value in u, j, 4/7? 4/7 Let s = 108 + -111. What is the third biggest value in s, -0.3, 7, 2? -0.3 Let d be -2 + ((-21)/(-6) - 2). Let l = 99 + -1685/17. Which is the second smallest value? (a) 0 (b) d (c) l c Let n = 4 + -2.4. Let p = -4.6 + n. Which is the second smallest value? (a) 1 (b) p (c) 2/11 c Let y = -2 - 0. Let n be 0/(3 + 0 + y). Which is the biggest value? (a) 1 (b) -0.2 (c) n a Let z be (8/(-50))/(14/35). Which is the second smallest value? (a) -0.5 (b) -1 (c) 8 (d) z a Let k = -0.36 + 0.06. Let x = -29 - -29.2. Which is the biggest value? (a) -0.2 (b) k (c) x c Let x be ((0 + -2)/4)/((-1)/(-2)). What is the biggest value in -4, -0.2, x, 2/7? 2/7 Let d = 43 - 42.6. Which is the third smallest value? (a) 3 (b) -7 (c) d a Let c = 0.2 + 0.3. Let y = -0.02 + -0.18. Let o = c + y. What is the biggest value in 2/7, -0.1, o? o Suppose -3z = q - 8, -7z + 3q = -6z + 14. What is the second biggest value in 2/19, 4, z? z Let r(i) = -i*2 - 6i - 4. Let n be r(-6). Let k = -0.3 + -0.2. Let u = -47 + 47. Which is the second biggest value? (a) n (b) u (c) k c Let d(c) = 5 + c*2 + 7c - 2c2 + 0 - 7. Let y be d(6). What is the second smallest value in -2/5, 2, y? 2 Let u = 5.5 - 7. Let h = -2 - u. Let q = -2121/11 - -193. What is the third biggest value in q, h, -2/9? h Let v = 3/41 + 73/123. Let q = -121/5 - -24. Which is the third smallest value? (a) v (b) q (c) 0.5 a Let g = -14 + 19. What is the second biggest value in g, -0.1, -2/7, 0? 0 Let o = -31/51 - -19/51. Which is the second biggest value? (a) -1 (b) -4 (c) o a Let i = 328/435 + -18/29. Which is the biggest value? (a) i (b) -4/5 (c) 1/5 c Let y = -0.1 - -5.6. Let n = -5 + y. Which is the biggest value? (a) -0.02 (b) 1 (c) n b Let n = -2 - -3. Let k(w) = -4w - 2. Let p be k(0). Which is the second smallest value? (a) -2/7 (b) p (c) n a Let x = -1.8 + 0.2. Let o = -9.4 + x. Which is the second biggest value? (a) o (b) 3 (c) 0 c Let p = 1 + -2. Let g = -0.9 - p. Let v = -12 + 11.7. What is the second smallest value in v, g, 1/4? g Let q = -0.27 + 10.27. Which is the third smallest value? (a) -1/7 (b) q (c) -3 b Let k = 1.656 + -0.056. Which is the biggest value? (a) 0.1 (b) 1 (c) k c Let d = -0.2 - -0.3. Let j = 2.9599 + 0.0401. Let r = 0 + -1. Which is the second smallest value? (a) r (b) d (c) j b Let c = 8174/5 + -1623. Let a = c + -61/5. Let x = 0 + 0.2. What is the smallest value in x, a, 0.4? a Let j = -4 - -3.6. Let w = 97 - 481/5. Which is the second biggest value? (a) 2/13 (b) w (c) j a Let k = 4.1 + -4. Let i = k - 0.14. Let g = -0.26 + i. What is the second biggest value in 1, -0.5, g? g Let s = 0.03 - -3.97. Which is the third smallest value? (a) s (b) 2/5 (c) -3/4 a Let t = -51.4 + 51. What is the smallest value in 5/4, 2, t, 0.5? t Let v be (-8)/52 + (-30)/(-702). Which is the smallest value? (a) 2/9 (b) v (c) 4 b Suppose 0 = -l - 4r + 14, 2r = -2l + 10 - 0. Let h = l - 2. Let y(x) = -x3 - x2 + 4. Let n be y(0). What is the third biggest value in n, h, -3? -3 Let q = 68 - 68. Let n = 2.9 + -3. What is the third smallest value in n, q, 0.2? 0.2 Let j = -99/65 - -12/13. Which is the biggest value? (a) j (b) 8 (c) 1 b Let r = 5.5 + -0.5. Let l = 0.6 - 2.6. Let i = 3 + l. Which is the third biggest value? (a) i (b) 0 (c) r b Let w(l) = l2 + 3l + 2. Let c be w(-1). What is the third biggest value in c, -0.1, 0.8, -5/4? -0.1 Let o(w) = -w2 - w + 2. Let p be o(-2). Let y(v) = v2 + v - 5. Let g be y(p). Let i be (-3)/(-9) - g/3. Which is the biggest value? (a) i (b) 1/3 (c) 1 a Let k be (-74)/(-259) + 2/(112/5). What is the biggest value in -1, k, 0.2? k Let b = 0.15 + -6.15. Let q = -4 - b. Suppose 2s - 4m - 6 = 0, 2s + 3s + m - 4 = 0. What is the second biggest value in s, 0.5, q? s Let x = 0.12 + -3.12. What is the smallest value in 4, x, -0.5? x Let m = -7.8 + 8.8. Let t = 4 - 8. What is the second biggest value in -1/4, t, m? -1/4 Let n = -0.71 - 0.49. Let l = -2 - -1. Let x = n - l. What is the third smallest value in 2/13, x, -5? 2/13 Let i = 2 - 10. Let c = -0.1 - -0.6. What is the second smallest value in c, -0.1, i? -0.1 Let g = 0.01 - 0.01. Let q = g - -4. What is the biggest value in 1, q, 2? q Let d = -8 + 47. Let n be d/(-72) + (-2)/(-3). Which is the second biggest value? (a) n (b) -3/8 (c) 2/5 a Let k = 2 - 1.5. Let z = -4 + 0. Let h = 191 - 191.3. Which is the biggest value? (a) k (b) h (c) z a Let f = -99 + 493/5. Let v = 0 + -1.6. Let u = v + 2. Which is the third smallest value? (a) 0.3 (b) u (c) f b Let t = 0 + 0.4. Let m = -9	{ "pile_set_name": "DM Mathematics" }
- z2 + z2). -z*5 Expand (6a*3 + 5a*3 - 4a*3)(-1 + 1 + 1) + (a - a + 2a)(0 + 0 + a*2). 9a3 Expand -6 + 6 + r5 - 2r5 + 0r5 + r5 + (r*3 + 3r*3 - 6r*3)(-2r2 + 5r*2 - 5r2) + r5 + 7r5 - 3r*5. 9r*5 Expand -r + r - 3r*2 + (-5 + r + 5)(-9r + 5 - 5) - 2r*2 + 0r2 + r2. -13r2 Expand (-3 - j + 3)(-3 + 2 - 2)(-8j*2 + 8j*2 + 3j*3). 9j*4 Expand (1 + 3 - 2)(-37p2 + 37p*2 - 4p*4). -8p*4 Expand -2 - 7h*2 + 2 + (0h + h + h)(2h + 0 + 0) - 2h2 + 0 + 0. -5h*2 Expand (-2x*4 - 2x*2 + 3x*2 + 4x*4)(1 + 0 + 2). 6x4 + 3x*2 Expand (1 - 2 + 0)(a3 + a - a). -a3 Expand (4s - 2s - s)(-3 - 3 + 0)(9s + 4s - 10s). -18s*2 Expand 2p + p*3 - 2p + (-7p2 + 3p*2 + 8p*2)(-1 + 1 - p). -3p3 Expand (2x + 0x - 4x)(-4x + x + x) + (2x - 2x + x)(3x - 4x - x) - x + x - x2. x2 Expand 51g*2 - 21g*2 + 49g*2 + (5g + g - 5g)(2g - 5g + 4g) + 0g*2 - 4g*2 + 5g*2. 81g2 Expand -4 + g5 + 3 + g*5 + (-2g + 2g - 2g*2)(3g3 + 0g + 0g) - g5 + 2g5 + g5. -2g5 - 1 Expand (0 + 0 + 2a)(2 + 3 - 3). 4a Expand (-3 + 3 + 2)(i + 3 - 3)(0 - 1 + 3). 4i Expand (-4r - r + 3r)(0r + 2r - 3r) - r2 + 6r*2 + 2r*2. 9r*2 Expand (3s*3 + 8s*3 - 2s*3)(-s*2 + 4 - 4). -9s5 Expand o2 + 0o2 - 2o*2 + 3o2 - o2 - 4o2 + (o - o + o)(-2o + 2o - o) - 2o2 - 3 + 3. -6o2 Expand z2 - 2 + 0 + 0z2 + (-4 + 3 + 2)(-2z + z2 + 2z). 2z2 - 2 Expand (-3a + 5 + 4a + 1)(2a2 - 5a*2 + 2a2). -a3 - 6a2 Expand (-2 + 6 + 1)(0 - 3s + 0). -15s Expand (-3 + 4 + 1 + (-4 + 3 + 0)(2 + 0 + 0) - 3 + 3 - 3 + 3 + 3 - 5)(4 - 4 + 2l5). -4l*5 Expand (-6 + 6 + 14)(2d - 2 + 2)(-d*2 + 0 + 0). -28d*3 Expand (26x - 12x - 12x + (-3 - 3 + 4)(-2 - x + 2))(3x3 + 0x*3 - 2x*3). 4x*4 Expand (2v + 2v3 - 2v)(-22 + 71 + 66). 230v*3 Expand (5 - 2 - 4)(-v + 0v - v) + (-1 + 0 + 2)(3v - 3v + 2v). 4v Expand -3n + 2n*3 + 3n + (4n2 - 3n*2 - 2n*2)(-2n + 2n - 2n) + 7n*3 + 5n*3 + 9n*3. 25n*3 Expand 5c2 - c2 - 3c2 + 3c*2 + 0c*2 - 4c*2 + (-3 + 3 - c)(c + 1 - 1) - c*2 + 2 - 2 + (c + 8c - 4c)(-1 + 1 - c). -7c2 Expand (1 + 1 - 12u + 9u)(5u3 + 2u - 2u). -15u*4 + 10u*3 Expand (-f + 3f + 0f)(0f4 + 4f*4 - 2f*4) + (5f - 4f - 2f)(-6 + 6 + 2f*4). 2f*5 Expand ((-6l*2 + 2l*2 + 3l*2)(-2l - 4 + 4) + 0l*2 + 0l*2 + 2l*3)(1 + 0 - 5) + 5l3 - 3l3 - l3. -15l3 Expand (-3q + q - q)(-5 - q + 5) - 2q2 - q2 + 0q2 + (0q - 4q + 5q)(-1 - q + 1 + (1 - 2 + 2)(q + q - 3q) - 2q + 2 - 2). -4q2 Expand (4 + t - 4)(31 - 15 + 15 + 14). 45t Expand (-3z - 2z + 4z)(2 + 11 + 2). -15z Expand (-7 + 9 - 1)(2s*4 + 2s*4 - 2s*4 - 2s*5). -2s*5 + 2s*4 Expand (-p + 2p*3 + p)(-p - 2p + p) + 2p4 - p4 + p*4 + 0p4 + p4 - 2p4 - 14p + 21p - 2p*4 - 6p. -5p4 + p Expand 12a - 29 + 29 - 3a - a + 5a - a + 0 + 0 - a - a + a - 3a + 0a + a + (-2a + a - a)(-2 - 1 + 1) + 3a - a + 0a + a - 3a + 3a + 4a - 4a - a. 15a Expand (a + 0a + 3a)(-a - 1 + 1) + (2a + 2 - 2)(-5a + 4a + 2a) + (a + a - 3a)(0a + 2a - a). -3a*2 Expand ((8 + 2 - 2)(2 + 2 - 2) + 1 + 0 - 3)(-m - 6m + 4m). -42m Expand -5u + u2 + u3 + 5u + (-3 - 1 + 2)(-2u*3 + 3u3 + u3) - 4u3 + 2u*3 + 0u*3. -5u3 + u2 Expand (-2s - s + 0s)(4 + 0s + 2s + 0s). -6s2 - 12s Expand 3 - n2 - 3 + n2 - n*2 + 2n*2 + (-5 + 2 + 1)(n2 - n2 - 3n2). 7n*2 Expand (6 - 1 - 3)(r - 2 + 2) + r + 4r - 3r + (-4 + 4 + r)(-1 - 1 + 0) + r - 1 + 1. 3r Expand (4 - 4 + v - 1)(-3v*3 + 4v*3 - 3v*3) + 0v*4 - 3v*4 - 5v*4. -10v*4 + 2v*3 Expand 0f4 - f4 + 3f4 + 5f*4 - 6f*4 - 2f*4 + (-2f - 2 + 2)(-4f3 + f3 + 4f3). -3f*4 Expand 3n - n*3 - 2n + 0n + (-16n - 3n2 + 16n)(-2n + 0n - n). 8n*3 + n Expand (0 + 2o + 0)(2o + 2 - 2)(5 - 1 + 3). 28o*2 Expand (11 - 6 + 19)(-8 - 3n4 + 8). -72n*4 Expand (6 + 1 + 6)(-2y + 4y - 4y). -26y Expand (-1 + 1 - 2q)(q*2 + 0q*2 - 2q*2). 2q*3 Expand ((3i + 2 - 2)(0 + 1 + 1) + i - 3i + i)(3i*2 - 3i*2 + 2i*3). 10i4 Expand (-j2 + 2j2 - 2j*2)(0 + 2 - 5)(5j3 + j3 - 3j3 + (-4 + 4 + 2j*2)(-j + 0 + 0) + 1 + j3 - 1 - j + j3 + j). 9j5 Expand ((x + 1 - 1)(-2 - 2 + 3) - 2x - x + x)(-2 + 5 - 2)(10 + 1 - 2). -27x Expand (1 + p + 1 + 2p)(-p + 4p - p). 6p*2 + 4p Expand (-1 - k + 1)(2k - 5k + 2k) + k*2 + 557k + 65 - 557k. 2k*2 + 65 Expand (5 + 0 - 4)(-2 + 0 + 0)(-3y + 4y + y). -4y Expand 24 - 24 - 5w5 + (3w*2 + 0w*2 - 4w*2)(-4w3 + 2w*3 + 4w*3). -7w5 Expand (-i2 + 5i2 - 3i*2)(0i - 2i + 4i) - 2i*3 - 2i*3 + 5i*3 + 5i*3 + 4i*2 - 4i*2. 8i*3 Expand -2f2 - f3 + 2f2 + 2f*3 + 2f*3 - 2f*3 + (1 - 3 + 1)(-2f - 2f*3 + 2f). 3f3 Expand o3 + 3o*3 - 2o3 + o3 + 4o3 - 3o*3 + (-2o*2 + 0o2 + o2)(-49 + 49 - 2o). 6o3 Expand 2 - 6c - 2 + (0 + 6 - 4)(-3c + 3c + 2c) + 2c + 0c - 3c. -3c Expand ((0l + 4l - 3l)(-4l + 5l - 3l) - 5l*2 + 2l2 + l2)(l - 2l - 3l). 16l*3 Expand -3l*4 - 2l*3 + 2l3 - l4 + 1 - 1 + (2l + 0l + 0l)(-l*3 - l + l) - 2l*4 - 2 + 2 + (-1 - 2 + 2)(-2l4 - 3l*4 + 4l*4). -7l*4 Expand 0h*5 + 0h5 - h5 + (0 + 6 + 2 + (-6 + 3 + 1)(-5 + 2 + 1))(-5h5 + 4h5 - h5). -25h5 Expand -z2 - 4z*2 + 2z*2 + (50 + 5z - 50)(-5z - 1 + 2z + z). -13z*2 - 5z Expand (6 - 4 - 3)(3m3 + m3 - 6m3) + 4m*3 - 4m3 - m3. m*3 Expand (9l*2 + 9l*2 - 6l*2)(0l2 - 4l2 - l2). -60l4 Expand (-6 + 6 - 7)(4i2 + i2 - 3i*2)(-1 + 2 - 4)(0i + i + i). 84i3 Expand (0 - 2 + 0)(-3 + 3 + g)(-3g + 2g - 3g). 8g2 Expand (5 - 4 + 2)(4 - 4 + 3m)(2m2 + 5 - 7 + 0 - m). 18m*3 - 9m*2 - 18m Expand (-5t3 + 3t*3 + 3t*3)(2t2 + 2t*2 - 2t*2)(-11 + 4 - 2). -18t5 Expand (-3v*4 - 11v4 + v4)(1 - 1 - 1). 13v*4 Expand (-2l + 0 + 0)(l + 5l - 4l) + l2 + 6l*2 - 6l*2 + (-3l + 3l + l)(-4l + l + l). -5l2 Expand l5 - 5l5 + 5l*5 + (-4 + 0 + 2)(0l + 6l - 3l)(-l*4 - 3l*4 + 2l*4). 13l*5 Expand (-13o - 15o - 10o)(0 + 1 - 3)(-3 + 2 + 3)(4o + 2o3 - 4o). 304o4 Expand (-7a + 4a + 0a)(5a - 5a4 - 5a). 15a5 Expand (-4n + 2n - 7 + 3)(0 - 1 - 2). 6n + 12 Expand 3w*2 - 3w + 3w + (w - 1 + 1)(-2w - 5 + 5) - 1 + 1 - 2w2. -w2 Expand 5j + 3j - 6j + 2j + j - 2j + (5 - 1 - 2)(-2j + 4j + 0j) - 2 - 2j + 2 - 10 + 6j + 10 + (-4 + 5 - 2)(0j + 2j - j) + 4 - 4 - 2j. 8j Expand (2 - 2 + 3s2)(4s - 3s + 0s) + (-s2 + 1 - 1)(-2s + 3s - 3s). 5s*3 Expand (-d + 2d - 4d)(4 + 3 - 1). -18d Expand (-16k + 112k - 59k)(3k + 2k - 3k). 74k2 Expand (0 + 7 - 2)(-q - 2q + 2q). -5q Expand -5l4 + l4 + 4l5 - 5l*5 + (-2 + 2 + 2l)(5 - l4 - 5) + 5l4 - l5 - 5l4. -4l*5 - 4l*4 Expand 24s - 27s - 2s*2 + 4s*2 + (-5s + 0s + 4s)(-s - s + 0s). 4s2 - 3s Expand (2 + 2 - 1)(6u - 8u + u). -3u Expand (-2 + 6 - 3)(f3 + 0f*2 + 0f*2 + (0f - 2f + 0f)(-f2 + f2 + 2f*2) - 2f*3 + 2f*3 - 2f*3). -5f*3 Expand (2v - 2v - 2v*2)(v + 2 - 2). -2v3 Expand (-2g3 + g2 - g*2)(4 - 4 - 4)(1 + 2g*2 - 1). 16g*5 Expand 24b*2 - 24b*2 + 6b*4 + 21b4 + (b3 - b3 + b3)(-b + 2b + 0b). 28b4 Expand (m2 + 0m2 + 2m*2)(3m + 0m - 7m). -12m*3 Expand (-4m*2 + 3m*2 - 3m*2)(-3m - m + 2m) - 3m3 + m3 + 0m*3. 6m*3 Expand -2 + 2 + 2u*3 + (2u - 2u - u2)(-30u - 51u + 49u) - 4 + 4 + u3. 35u*3 Expand (14 + 4 - 5 + 1 - 1 - 1 + (-4 + 5 + 0)(0 + 2 - 3) + 0 - 1 + 2 - 2 + 1 + 0)(c - 2c + 2c). 11c Expand 1 + h*2 - 1 + ((0h + h - 3h)(4 - 2 - 1) - 3h + 5h - 3h)(0h + 0h + 2h). -5h*2 Expand (-3w3 - w3 + 0w3 + (-w + w + w)(-w*2 - 2w*2 + 2w*2))(0w + 0w - w)(-3 - 6 + 4). -25w*4 Expand ((-3b + 6b - b)(0b2 + 2b2 - b2) - b*3 - b + b)(-136 + 136 - 12b2). -12b**5	{ "pile_set_name": "DM Mathematics" }
to the nearest 10000. 100000 Let s = 0.24 - -31.76. Let c = s - 40.1. Let p = c - -8.1000083. What is p rounded to six decimal places? 0.000008 Let t(o) = 986o3 + 4o*2 + 19o + 35. Let h be t(5). What is h rounded to the nearest 10000? 120000 Let m = -4.272 - -3.89. What is m rounded to two decimal places? -0.38 Let m = -37 - -36.773. Let z = 0.18 + m. What is z rounded to 2 dps? -0.05 Let j = -25087.3623 + 25085. Let q = j + 0.0523. Round q to one decimal place. -2.3 Let d = 0.0111 + -0.056. Let k = d + 0.044343. Round k to four dps. -0.0006 Let m = 93.83 + -106.552. What is m rounded to 1 decimal place? -12.7 Let n = -12082 + 12075.129. Round n to the nearest integer. -7 Let n = 151 - 160.9. Let z = n + 9.900000255. What is z rounded to 7 decimal places? 0.0000003 Suppose 2v - 1036878 = -0v. Let f be (-5 - (-8)/4) + v. Suppose -2681564 = s + f. Round s to the nearest 1000000. -3000000 Let h(a) = -7a - 9. Let x be h(-7). Let v be ((-8)/10)/(8/x). Let z be (-552448)/65 - v/(-5). What is z rounded to the nearest one thousand? -9000 Let m = -218 - -217.738. What is m rounded to 1 dp? -0.3 Let g(m) = -5733345m + 35. Let u be g(3). What is u rounded to the nearest 1000000? -17000000 Let p(t) = 129201t - 6. Let a be p(-5). Let z = 1606031 + a. Suppose -4o = -5x - z, -o + 239984 = -0o + 4x. Round o to the nearest ten thousand. 240000 Let c be (-2)/9 - (-266)/63. Let b be (0 + -8)/c + -2398. Round b to the nearest 100. -2400 Let w = -7.7625 - -7.38. Round w to one decimal place. -0.4 Let u = -77 + 77.033. Let q = 0.303 - u. Let l = q - -0.41. Round l to 1 decimal place. 0.7 Let q = 0.19897 - 0.199. What is q rounded to four decimal places? 0 Let q = 0.234 - 103.234. Let o = q - -102.951. Round o to two decimal places. -0.05 Let a = -3 + -9. Let u = 11.999945 + a. Round u to 5 decimal places. -0.00006 Let p = 9.7 + -9.8288. What is p rounded to 2 decimal places? -0.13 Let x = -12.7 + -3.3. Let l = -15.959 - x. Let v = l - 0.04143. What is v rounded to four decimal places? -0.0004 Let i = 17.2 + -19. Let d = 1.8002 + i. Round d to three decimal places. 0 Let z = 2 + -1.93. Let d = z - -1.13. Let x = 1.19998 - d. Round x to five decimal places. -0.00002 Let t be (-4)/9 + ((-706020)/189 - -16). Round t to the nearest one thousand. -4000 Suppose 5q = 2q + z - 36820163, 5q = z - 61366935. Let c = 34373386 + q. What is c rounded to the nearest 1000000? 22000000 Let v = -875.2 + 875.24629. Round v to 2 dps. 0.05 Let v be 1 - ((-6)/(-15) + (-42896)/40). What is v rounded to the nearest one hundred? 1100 Let i = 181.9 + -163. What is i rounded to the nearest ten? 20 Suppose -5u - 2n - 103 = 0, 5u + 3n + 62 + 45 = 0. Let x = -19 - u. Suppose x = -4r + 10r - 142800000. What is r rounded to the nearest one million? 24000000 Let v = 0.985 + 0.753. Round v to 2 decimal places. 1.74 Let m = -353.09561352 - -199.0956151. Let a = -154 - m. Round a to seven decimal places. -0.0000016 Let m = 1202.003446 + -1202. Round m to 4 decimal places. 0.0034 Let x = 214 - 214.418. Let o = x + 0.41. Round o to 3 dps. -0.008 Let l be 127899/1880/6. Round l to the nearest 10000. 90000 Let s = 17.52 + -17.518864. Round s to five dps. 0.00114 Let y = -4.07 + 6.46. Let l = 2.23 + y. Let a = 0.42 - l. Round a to 0 decimal places. -4 Let y be (-26)/52838/(-1). What is y rounded to the nearest one hundred? 400 Let x = 6808.1514 - 6807. Let j = -1.176367 + x. Let f = j + 0.025. Round f to five decimal places. 0.00003 Let s = -105 - -107.2. Let o = s + -2.20000123. What is o rounded to six decimal places? -0.000001 Let s = -2.1100152 - -2.11. Round s to six decimal places. -0.000015 Let z = -3426.99992886 + 3427. What is z rounded to 5 dps? 0.00007 Let m = 0.133 - 0.13. Let z = -0.787 - m. Let q = z - 0.01. Round q to 0 dps. -1 Let b = -0.09 - 1.41. Let u = b + -6.5. Let w = 8.136 + u. Round w to two decimal places. 0.14 Let i be -9 + 2 + -11444(-6)/(-8). Round i to the nearest 1000. -9000 Suppose -2y = 46y + 58080000. Round y to the nearest one million. -1000000 Let h = -1.92 + -137.68. What is h rounded to the nearest 10? -140 Let s(l) = 6l - 2 + 5348l2 - 138002l*2 + 2 + 4. Let z be (1 + -22)2/(-6). Let w be s(z). Round w to the nearest one million. -7000000 Let d(w) = 6527w2 - 8w - 12. Let a(o) = -3264o2 + 4o + 6. Let p(z) = 5a(z) + 2d(z). Let f be p(-13). What is f rounded to the nearest 10000? -550000 Let d = 14630523.39 + -14630597.39000295. Let v = -74 - d. Round v to seven decimal places. 0.000003 Let x = 139.5145 - 139.5. What is x rounded to three decimal places? 0.015 Let h(z) = 2 - 3 - 3 - 5z + 4z. Let m be h(2). Let g be m(0 + (-890)/(-6)). What is g rounded to the nearest 100? -900 Let i = -2.1 + 114.1. Let s = i + -98.84. Let b = -0.06 + s. Round b to the nearest integer. 13 Let m = 1034800.2 + -1034791.6325872. Let i = -0.0693228 + m. Let w = -8.5 + i. What is w rounded to four decimal places? -0.0019 Let a = -0.9 - 13.1. Let b = -14.05 - a. Let v = b - -0.06. What is v rounded to 1 decimal place? 0 Let t(p) = 11801p + 58. Let r be t(-8). Round r to the nearest ten thousand. -90000 Let k = -1.74 - -2.2. Let w = 0.126 - k. Let f = 0.18 + w. Round f to two decimal places. -0.15 Let a = 0.7 + -31.7. Let j = 31.0000031 + a. Round j to six decimal places. 0.000003 Let w(d) = d*3 - 9d*2 - 21d - 2. Let q be w(11). Suppose 0 = -qc + 4c + 390000. What is c rounded to the nearest 10000? 80000 Let w = 2.4 + 0.2. Let s = 2.60002 - w. Round s to four dps. 0 Let v = 38286.9700011 + -38287. Let i = v - -0.03. What is i rounded to 6 dps? 0.000001 Let c be (-5)/10 + (-9288006)/4 - 4. Let t be c/6 - 3 - (-5 - -1). Round t to the nearest ten thousand. -390000 Let g = 18.6 - 11. Let v = g + -22.3. What is v rounded to 0 decimal places? -15 Let l = 4426921 - 2234830. Suppose -4n = -3a - l - 1557889, 2500005 = -2a - n. Round a to the nearest 100000. -1300000 Let c = 0.27 + 2.53. Let h = c - 11.8. Let k = -8.999985 - h. Round k to 5 decimal places. 0.00002 Let u(a) = 4713325a + 125. Let b be u(15). Round b to the nearest 1000000. 71000000 Let m = -28439.23 + 28674. Let b = m - 236. What is b rounded to 1 dp? -1.2 Let f be (-44)/(2 + 0) - 2. Let i be (-2028652)/f - (-1)/(-6). Let r = i - 36527. What is r rounded to the nearest ten thousand? 50000 Let g = -24 + 7. Let c = g - -17.00017. What is c rounded to four dps? 0.0002 Let b = 1392.1726 + -1392. What is b rounded to 2 decimal places? 0.17 Let k = -2 - 8. Let p = 73.82724 + -63.825. Let z = k + p. Round z to four decimal places. 0.0022 Let j = -0.0386096 + 0.0391. What is j rounded to four dps? 0.0005 Suppose 6 = 4d - d. Let b(c) = 185c*3 - dc*2 - 12c + 6c2 + 10c*3. Let v be b(8). Round v to the nearest 1000000. 0 Let m = 52.790532 - 57.7901. Let p = -5 - m. What is p rounded to 5 decimal places? -0.00043 Let y = -34 + 34.15. Let n = 3.7 + y. What is n rounded to one decimal place? 3.9 Let w = -39.7676 + 39.8. Round w to 2 decimal places. 0.03 Let n = -174.0303 + 174. Let g = n - 0.009. What is g rounded to 2 dps? -0.04 Let y = -68168730 + 202668730. What is y rounded to the nearest one million? 135000000 Suppose x = 3x + 4j - 1120, j + 5 = 0. Round x to the nearest ten. 570 Let o = -1021994.859255 + 1021989. Let a = -3.85917 - o. Let s = a + -2. Round s to 5 dps. 0.00009 Let t = -191.37 + 183.1. What is t rounded to 1 decimal place? -8.3 Let o(i) = i + 10. Let k be o(-11). Let l be k - (-4)/((-8)/134). Round l to the nearest ten. -70 Let i = 616 + -616.0003355. Round i to 5 decimal places. -0.00034 Let x be (-12 - -10 - (3 + -1)) + 496004. What is x rounded to the nearest ten thousand? 500000 Suppose -5q = -5d + 3d + 13, -4q = -2d + 12. Suppose -4t + 6467 = g + 143, 5g = -dt + 31604. Round g to the nearest one thousand. 6000 Let z = 99.16 + -95. Round z to 0 dps. 4 Let i = -1.686002073 + 1.686. What is i rounded to 7 dps? -0.0000021 Let q be (2 + 5)/((-4)/(-4)). Let z(k) = 11k*2 + 10k - 6. Let y be z(q). Suppose -4 = 4d - 8, 0 = 2j - 3*d + y. What is j rounded to the nearest 1000? 0 Let w = -316785 - -133311. Let k = w - -183553.9812. Let u = k - 80. What is u rounded to 3 decimal places? -0.019 Let g = 1363.61727 - 0.01727. Round g to the nearest one hund	{ "pile_set_name": "DM Mathematics" }
omposite number? False Let a(w) = -131w - 5. Let t be a(-5). Suppose -3k + t = 185. Is k prime? False Suppose 17p - 10727 = -0p. Is p a prime number? True Suppose 0 = 5k + 20, 3v - 4k - 239 = -2k. Is v a composite number? True Let h be -1 - -1 - -111. Let u(m) = m2 + 3m - 5. Let n(w) = 5w2 + 15w - 25. Let y(c) = hu(c) - 2n(c). Is y(4) a composite number? False Suppose 0 = -2b + 3b - 194. Is b composite? True Let z(s) = -s*2 - 7s + 8. Let a be z(-8). Suppose 2q + aq = 158. Is q a prime number? True Let l(w) = -w - 6. Let h be l(-6). Suppose t + 2t - 69 = h. Is t composite? False Let d be (-1 - 1/2)-2. Suppose 0 = 3h - 4 + 1, 3h - 141 = -dj. Is j a composite number? True Is 6/42238/9 a composite number? False Let z = 40 - 21. Is z a prime number? True Suppose 4h + 17 = 289. Is h/7 + 6/21 a prime number? False Suppose 4w + 0w - 12 = 0. Suppose wd - 128 - 301 = 0. Is d a composite number? True Let w(b) be the first derivative of 25b2/2 + 6b + 3. Let t be w(5). Suppose 2j + j = 4v - t, 2v - 64 = 2j. Is v prime? False Is 0/(-6) - -1371 a composite number? True Let a = -7 - -12. Suppose ad = f + 153, 36 = 2d - 2f - 22. Is d a prime number? True Let c(h) = -1 - 5h + 148 + 13 + 6h. Let w be c(0). Suppose -2n + 6n + 2y = w, -n + 54 = 4y. Is n a composite number? True Let v(s) = 8s2 - 5s - 6. Let f be v(5). Let a = f + -82. Is a a prime number? False Suppose 0 = -k + 254 + 77. Is k a composite number? False Suppose -5j = -4f - 615, f - 399 - 241 = -5j. Is j a prime number? True Suppose -5p + 4a = -4p - 739, 3000 = 4p - 5a. Is p prime? False Suppose 0 = 5c - 2u - 20, 4u + 16 + 2 = -c. Suppose h + cz - 5 = 0, -2h = 2h - 3z + 2. Let x(w) = 37w*2. Is x(h) a composite number? False Let f(r) = -986r*3 - 2r*2 - 4r - 1. Let j be f(3). Is j/(-55) + (-4)/(-10) prime? False Suppose 4g + g - 185 = 0. Let i = 12 - 11. Is (g + 1)/(1 + i) composite? False Is (-131)/(42/15 + -3) composite? True Let u(g) = -g2 + 2. Let w be u(3). Let d = 24 - w. Is d a prime number? True Is 2/3(-345)/(-5) composite? True Is (6734/(-16))/(3/(-60)) a prime number? False Let j(v) = -4v - 3 + 5v + 5. Let x(h) = h. Let d(l) = j(l) + 6x(l). Is d(5) a composite number? False Let o(l) = -125l - 4. Suppose -3a - 15 = -0a - 2y, a = -y. Is o(a) composite? True Let f = 71 - 12. Suppose f = -0n + n. Is n a composite number? False Let n be (-6)/21 + 1184/28. Suppose 0h - 3h + n = 0. Is h a composite number? True Suppose x = 34 - 1. Is x composite? True Let h(z) = -6 + 3 - 7 + 2z. Let t be h(7). Let w(y) = -y*3 + 6y*2 - 4y + 3. Is w(t) a composite number? False Let o(g) = 0 - 3 + 1 + 1 + 5g. Let m be o(1). Suppose 30 = -md + 6d. Is d a composite number? True Suppose q - 5048 = -q. Is 2(-5)/((-40)/q) prime? True Suppose 0 = z + d + d - 351, -4d - 1428 = -4z. Is z a prime number? False Let g be (-50)/15(-6)/2. Let d(r) = r2 + 6r + 2. Let o be d(-4). Let x = o + g. Is x prime? False Suppose 3554 = -11p + 13p. Is p a composite number? False Is (1360/(-6))/(-2) - (-17)/(-51) composite? False Let u be 302/(-3) - (-5)/(-15). Let k = u + 163. Is k a prime number? False Let r = -4 - -8. Suppose 0 = -0v - 3v - t + r, -2 = -4v - 3t. Suppose vb + 316 = 6b. Is b a prime number? True Let p(v) be the first derivative of -11v2 + v - 1. Is p(-1) prime? True Let q = 37 - -72. Is q a prime number? True Suppose -g = -3y - 3g + 6493, -5y - 2g + 10815 = 0. Is y a prime number? True Suppose 0 = -3q + 739 - 106. Is q prime? True Suppose 2y = 5y - 36. Suppose 5i - y = -2. Suppose -3l + 53 = ik + 2k, -k = l - 17. Is l a composite number? True Let k(q) = -q + 14. Let p be k(10). Suppose -4g = -4w - 40, -pw - 25 = -2g - w. Suppose -2s - 1492 + 435 = -gv, 3s = -3. Is v composite? False Let d be 2/(-2) + (1 - -49). Suppose q + 50 = -4p, 4q + d = 2p - 61. Let h = 7 - q. Is h a prime number? True Let h be ((-20)/(-8))/((-1)/2). Let k = h + 20. Is k a composite number? True Let b(l) = l*3 - l + 3. Let g be b(0). Is 41 + (g - 2) + -3 composite? True Let b(o) = -8o*3 - 2o*2 - 1. Is b(-2) a composite number? True Suppose 2n - 261 = -n. Suppose -300 = -3o - n. Is o a prime number? True Let o(r) = r + 2. Let p be o(15). Suppose -s - s - 412 = -5m, 5m - 406 = -4s. Suppose g = -p + m. Is g composite? True Suppose 0 = -3g + 66 + 6. Suppose -p = -g - 161. Is p prime? False Let t = -4 + 4. Suppose t = 2f - 72 - 86. Is f a composite number? False Suppose 549 = 3r + 69. Let v = -106 + 15. Let k = v + r. Is k prime? False Suppose 74z - 11030 = 64z. Is z a composite number? False Suppose -16132 - 29662 = -14m. Is m prime? True Suppose 100 = y + 2j - j, -2y - 5j = -191. Is y composite? False Let t(h) = -h2 - 4h + 1. Let k be t(-3). Suppose u = -ku. Suppose 53 = -ur + r. Is r prime? True Let y be ((-9)/4)/(1/(-8)). Let p = y - 10. Let x = p + 75. Is x a composite number? False Suppose -2t = -0t - 406. Is t composite? True Let j be 1(5 - (2 - 0)). Suppose 0 = -0k + k, 2d - 802 = jk. Is d a composite number? False Let n(x) be the first derivative of x4/4 - x3/3 + x*2/2 + 77x - 1. Is n(0) prime? False Suppose -5d = -4t - t, -4t = 3d - 14. Let r(k) = k3 - k2 + k - 1. Let v(s) = 12s3 - 10s*2 + 10s - 9. Let i(b) = -6r(b) + v(b). Is i(t) composite? False Let t be 2 + 3/((-6)/(-134)). Suppose -z = -328 + t. Is z prime? False Let n be 2 - 1/(-1) - -1. Let f(z) = -z2 + 3z + 5. Let h be f(n). Is 2/4h46 composite? False Suppose 2f + 2f + 5t = 0, 5f + t = 0. Let r = -4 + 7. Suppose 0 = -4a - rg - 4 + 39, -4g - 12 = f. Is a a composite number? False Let m(u) = -121u + 8. Is m(-5) prime? True Let m be -2 - (-8 + 3 - -3). Suppose mp = 2p - 76. Is p a prime number? False Let t(o) = 2o3 + 4o*2 - 4o + 3. Let x be t(3). Let w = 121 - x. Suppose 239 = 3s - w. Is s a composite number? True Let f be (2 + 2)222/4. Let o = f + -135. Suppose o = 5x - 2p, 3x - 5p - 37 = -0x. Is x a prime number? True Suppose 2c - 952 = -3h, -c + 2h = 3c - 1920. Is c a prime number? True Is (-1584)/(-7) + -2 + (-60)/(-35) composite? True Let a = 221 - 44. Is a a prime number? False Suppose -14a = -11a - 4083. Is a a prime number? True Suppose 5p = -x + p + 33, -2p = 4x - 62. Is x a composite number? False Let s(a) = 11a3 + 3a*2 - 3a + 1. Suppose -3 = -5q - x + 11, -2q - 3x + 16 = 0. Is s(q) a prime number? False Suppose 9 = 2b - 5. Suppose 5m = -0v - 4v + 3, 3m = 2v - b. Is m - (-39 - -3)/3 a composite number? False Suppose 4x = 421 - 113. Is x a prime number? False Let m(y) = -y - 3. Let c be m(-4). Is (-3 - 5/(-1))/c prime? True Suppose 0 = 5i - 3m - 10756, -3i - 3m + 6m + 6450 = 0. Is i a prime number? True Let k = -213 + 936. Is k prime? False Let n(c) = c + 3. Let p be n(-7). Let m be (-86)/p - 3/6. Suppose -a + m = -28. Is a a composite number? True Let p = 1230 + -509. Is p composite? True Is ((5 - 3) + 1)-1 - -524 composite? False Let t(p) = 2p3 - 12p*2 + 25p - 2. Is t(8) prime? False Let t(o) = o*3 - 11o*2 + 9o - 8. Let z be t(10). Let w = z + 113. Is w a composite number? True Suppose -a - 121 = -696. Suppose 8l = 3l + a. Is l a prime number? False Suppose g + 115 - 630 = 0. Is g composite? True Let x(z) = -z*2 - 12z - 13. Is x(-9) a composite number? True Suppose 7k = -3d + 4k + 51, 5k + 25 = 0. Is d composite? True Let v(c) = 8c2 + 21c*3 - 10c*2 + c - 3 + c. Is v(2) prime? False Let w(c) = -36c - 4. Let p be w(-3). Let d(j) = 3j - 5j + p + j - 9. Is d(0) a composite number? True Suppose -4w + 244 = 4y, -263 = -3y + 4w - 52. Is y composite? True Suppose s - 3m = 13, s + 3m - m + 12 = 0. Let b be (-18)/(-4) - (-3)/s. Is (-6)/(-9)b - -33 composite? True Let m(u) = u3 + 9u*2 - 2u - 2. Let o be m(-9). Let r = 111 + o. Is r composite? False Suppose 3w = 5l + 47, -3w + 6w - 67 = -5l. Is w composite? False Let s(a) = 27a*3 + 5a*2 - 5. Is s(3) a prime number? True Suppose 7r - 10 = 2r. Let a = r + 67. Suppose 0 = 5u - a + 19. Is u prime? False Suppose k - 629 = -3i - 0k, 3k = -i + 215. Is i a prime number? False Suppose 0 = 2c - 3k - 740, 4k - 1825 = -5*c - k. Is c a composite number?	{ "pile_set_name": "DM Mathematics" }
1 for s. -2 Let r(a) = -a*2 + 19a - 44. Let t be r(16). Solve 2 = -tn + 6 for n. 1 Suppose 32w = 35w - 132. Suppose -4b + w = 4o + 16, -5b = -2o - 56. Solve -6 = -4f + b for f. 4 Suppose -y = -5y + 44. Solve 8k - 3 = -y for k. -1 Let s(f) = -19f2 - 43f + 3. Let j be s(-2). Solve -16z = -jz + 3 for z. -1 Let c(x) = x + 1. Let b be c(0). Suppose -4n - 5 = -b. Let u be (-3 + 4)(n + 2). Solve 3 - u = s for s. 2 Suppose 0 = -2g + 2d - 7 + 51, -4g - 2d + 64 = 0. Let o = g + -18. Let y be 0/(-3 - (-1)/1). Solve y = -ot + 3t for t. 0 Suppose 0 = 2p - 6, 5t - 72 = 2p + 227. Suppose 4d - t = -41. Solve -dc = -0c + 10 for c. -2 Let l be 5/(50/(-80)) - -8. Solve -5j + l = -10 for j. 2 Let k be 16/(-4) + 4/(2 - 1). Solve 12b + 93 - 33 = k for b. -5 Let w(c) = -c + 6. Let q be w(6). Suppose 3p + q = 6. Suppose 3u + 0u = o, o - u - 2 = 0. Solve y + o = py for y. 3 Let n = 28 - 21. Let l(q) = -n - q + 0q + 2q + 1. Let i be l(8). Solve -5h + i + 3 = 0 for h. 1 Suppose -5i = -3i - 5m + 33, -3i = -5m + 37. Let t be 10/4 + i/(-8). Solve th - 12 = -h for h. 3 Suppose 23 = 12q - 13. Let n(h) = -h*2 + 16. Let m be n(0). Solve -l - ql = -m for l. 4 Let c be 0 + (-3)/1 + 215. Suppose 0 = 2x + 3t - 81, -4t - c = -5x - 2t. Suppose -a = 3f - 21, 4f - x = -3a + 1. Solve 4k = -a + 21 for k. 3 Let w = 23 + -18. Let n(a) = -21a + 174. Let d be n(8). Solve dr = wr - 1 for r. -1 Suppose 3n - 14 = -r, -4r + r = 5n - 54. Let o = -14 + r. Let z be 6(-1 + o/6). Solve 2g = -zg - 10 for g. -2 Let z = -191 - -203. Solve -3a = a + z for a. -3 Let h = 55 + -33. Suppose -2x - 3j + h = j, x - 6 = -j. Solve 5v + 6 = x for v. -1 Let k(q) = -q*2 - 8q - 9. Let w be k(-6). Suppose -3x - 217 = -4i, 6i - 4x - 106 = 4i. Let n = i + -52. Solve 3p + w = -n for p. -2 Let j(w) = -203w - 603. Let d be j(-3). Solve dv = 3v - 9 for v. -3 Let g be (-3)/(1/42). Let u be 3/(-15) + (g/(-15))/2. Solve i - 4i - 12 = u for i. -4 Suppose -t + 0h = -4h - 13, 2h = -4. Let f be (2 + -1)/(t/15). Suppose 3 + f = 2j. Solve 0 = -a + ja for a. 0 Let j = -106 + 54. Let k be (-82)/26 + 3 + (-476)/j. Let b(p) = p. Let o be b(3). Solve -k = ox + 6 for x. -5 Let a be 89 + (0 - -1)/((-13)/(-39)). Suppose 2w + 5q - a = 0, q + 2q = -3w + 120. Suppose -90 = -5f + 2s, 5 + 26 = f - 3s. Solve 5m - f = -w for m. -4 Let c(f) = f2 - 7f + 3. Let n be c(7). Let o be 5/((-1 - 1) + n). Solve 2 + 3 = og for g. 1 Let l(y) = 8y - 13. Let s be l(4). Suppose -2i - 2q + 8 = 0, 2i - 4q = i + s. Let m = i - 7. Solve m = o + o + 2 for o. -1 Suppose -5k = 2k - 49. Solve 0 = km - 4m - 12 for m. 4 Let i = -1 - -16. Let p = -640 - -642. Solve -pg = g - i for g. 5 Let p(x) = 6x + 7x + x - 15x + 2. Let a be p(-6). Solve -w = w + a for w. -4 Suppose 0 = 19s + 10s - 232. Solve 0 = g - 9g - s for g. -1 Suppose 0 = 4k - 15 + 3. Suppose f - 2 = 5y + 7, -ky = 4f - 13. Solve o = -o - f for o. -2 Let p be (-12)/5(48/(-9) + 2). Suppose -pn + 20n - 36 = 0. Solve 2u = 3u + n for u. -3 Suppose -y + j = -20, -50 = -3y - 3j + 40. Suppose y = 5k - 40. Let o = k + -9. Solve 0m + 16 = om for m. 4 Suppose -15 + 19 = r, -v = -2r + 5. Solve -3p + v = -3 for p. 2 Let g(d) be the third derivative of -d5/60 - 7d*4/24 - 7d*3/6 - 15d*2. Let f be g(-3). Solve 17 + 3 = -fr for r. -4 Suppose 0q = 5q - 260. Suppose -5d + 2j = 110, -4d - 4j = -7d - q. Let g = 24 + d. Solve -15 = -gm - 5m for m. 3 Let n = -28 - -49. Let i = n + -18. Let r be (-2)/(i/6-1). Solve 7u - ru + 12 = 0 for u. -4 Let u = -759 + 762. Solve u = -0c + c for c. 3 Let p be (-2)/(-5)(-17)/(17/(-70)). Let m = p + -26. Solve -2c + 6 = -m for c. 4 Let l = -7 - -7. Suppose -u - u = l. Let d(z) = -z3 - z2 - 2z. Let n be d(-2). Solve u = 6b - 4b - n for b. 4 Suppose 3q + c = -2c + 6, -2c + 1 = q. Suppose 11 = 5l + qt, -l - 3t - 5 = -0l. Solve 4h + 0h + l = 0 for h. -1 Let b = 28 - 3. Let w be 1 + (-8)/(-4)1. Suppose -h = 5, -wh - b = -3s + 2h. Solve sk = -k - 4 for k. -4 Let h be 114/42 + 3/(42/4). Suppose hp = -3w + 2 + 16, 4w = -4. Solve 2 - p = -5b for b. 1 Suppose -52d + 48d + 32 = 0. Suppose 2a = -4, 5c - 3a - 8 = d. Let k be (-8)/(-10)-1-5. Solve cb + 2 = -k for b. -3 Suppose -2m + 5y + 30 = 3m, 5m = -4y + 39. Suppose -n + 2x + m = 0, -6n + 4n + 3x + 12 = 0. Solve n + 0 = -g for g. -3 Let d(p) = p - 24. Suppose 2n = 4i - 54, i - 4 - 8 = -n. Let t be d(i). Let m(o) = o2 + 9o - 1. Let z be m(t). Solve -4v - 5 = -z for v. 4 Let y(j) = -5 + 7j + 4j - j2 - 5j. Let a be 0/(2/2) - -4. Let v be y(a). Solve -vt = -0t for t. 0 Let z(x) = x*3 - 9x*2 + 14x + 5. Let t(q) = -4q + 19. Let f be t(3). Let o be z(f). Let p = 3 + 1. Solve oh = p + 1 for h. 1 Suppose 5s - 46 + 2 = n, -2s + 4n = -32. Solve -3k + s + 7 = 0 for k. 5 Suppose -2x - 4x + 258 = 0. Let c = 48 - x. Solve 0 = -cj + 4j + 1 for j. 1 Let x = 136 - 136. Solve -z = -xz - 2 for z. 2 Suppose -2w + 6w + 4y - 44 = 0, 2w - 14 = 2y. Suppose -17 + 35 = wt. Solve 3l = -tl for l. 0 Suppose 0l + 2l = 0. Suppose 4j + 31 = -109. Let p = j + 41. Solve o + o - p = l for o. 3 Let m = 141 + -134. Let x(u) = 4u2 - 28u + 1. Let l be x(m). Suppose -5g = -2v - 31, 2v - 6 = -v. Solve -4k = l + g for k. -2 Let z(d) = -4d - 5. Let t be (-6)/(-9) + 8/6. Suppose -10 + 0 = tk. Let j be z(k). Solve 5x + 0 + j = 0 for x. -3 Let s(r) = -r2 - 6r + 4. Let l be s(-7). Let i be 0 - (l/(-3) + -1). Suppose 0g + g = i. Solve g = 2j + 5 - 1 for j. -2 Let r = 23 - 19. Suppose rh - 3n = -91, -h + 4h - 3n = -69. Let g = -22 - h. Solve g = 3i + i for i. 0 Suppose 4x - 48 = -2o, 2x = -5o + 10 + 86. Solve 7f - of - 33 = 0 for f. -3 Suppose -110a + 2f + 20 = -106a, -3a + 22 = -5f. Let d = 1 - -4. Solve -j - aj - d = 0 for j. -1 Let y(m) = m3 + 4m*2 - 8m - 5. Let i be y(-6). Let b = -26 - i. Let u be 1/(b + 25/(-10)). Solve 1 = v - u for v. 3 Let n be (2/(-3))/(13/((-390)/4)). Solve a + 6 = n for a. -1 Suppose -607f + 266 = -593f. Solve -3m + 16 = f for m. -1 Suppose -15 + 15 = -43s. Solve -5o - 27 + 2 = s for o. -5 Let j(m) = 9m + 10. Let u(f) = 19f + 19. Let n(v) = -5j(v) + 2u(v). Let k be n(-3). Solve 4c + k + 3 = 0 for c. -3 Suppose 0 = 2k + 2g + 4, -k = 4g + 2 + 6. Solve k = -5r + 7r - 2 for r. 1 Let b(v) = -v3 - 5v*2 - 3v - 9. Let n be b(-7). Let u be (-12)/(-42) - n/(-7). Let y = u + -16. Solve -15 = -3p - yp for p. 5 Let j be 9/416/6. Suppose -y + 49 = -3d, d - 4y = -12 - 19. Let r be d/(15/j + -4). Solve -4x - r = -6x for x. 5 Let m(r) be the second derivative of -r4/12 + r3/2 + r2 + 20r. Let c be m(3). Solve 3v - 10 = c for v. 4 Suppose -w + 2x = 2w - 14, w + x + 2 = 0. Suppose g = wg + c, -4g + 2c + 30 = 0. Suppose ga + 5 = k, -4a + 5 = -2a + k. Solve a = -b + 4b for b. 0 Let s be (-2)/(-7) + (-26)/(-7). Suppose -5t + 36 + s = 0. Solve 0c + 2c = t for c. 4 Let u(a) = 97a*2 - a. Let n be u(-1). Let c = n - 92. Solve -2o = o - c for o. 2 Let y = 65 + -61. Suppose y = 215o - 213o. Let w be (-2)/(-7) - 4/14. Solve 8 = -ou - w for u. -4 Let o be (-8)/(-20) - 28/(-5). Let y(a) = a3 - 7a*2 + 5a + 7. Let x be y(o). Solve x + 7 = -4g for g. -2 Suppose 3r = -5z - 35, 3z = 2r + 2 - 4. Let k = z + -3. Let f = k + 15. Solve -f = w + w for w. -4 Let h be 6 - (2 + 0 - 0). Suppose 5p - 69 = -2n, -hp - 4n + 33 = -15. Suppose p + 1 = 4z - l, 0 = -4z - 3l. Solve 0 = -0g - zg + 15 for g. 5 Suppose -8v + 3i = -4v - 31, 2v - 17 = i. Let r(k) = -k*2 + 9k + 10. Let j be r(v). Suppose y + j - 2 = 0. Solve 6t = yt for t. 0 Let f be (-4)/(-2) + (-360)/(-4) + 2. Let l = 97 - f. Solve -2i = li + 15 for i. -3 Let u(c) = -c*3 + 13c*2 - 11c + 4. Let z be u(12). Let x(f) = -13f2 + 1. Let t be x(1). Let v = t + z. Solve 5h + v = -16 for h. -4 Suppose -4x - 11 = -5t, -17t + 13t + 4x + 8 = 0. Solve tm - 73 = -82 for m. -3 Let u(x) = x*2 - 10x + 37. Let l be u(8). Suppose 5w = -2w + l. Solve -wa + 4 = a for a. 1 Suppose 6h + 24 = 9h. Suppose o + 1 = -4b - 3, 8 = -4b. Suppose o = 3c - h. Solve 6 = -2j - c for j. -5 Let z = 307 + -282. Solve -3d - 2*d	{ "pile_set_name": "DM Mathematics" }
greatest common factor of 20 and r? 4 Let d(a) = -a*2 + 2a + 207. Let l be d(-13). Calculate the highest common divisor of 544 and l. 4 Let g(y) = 5y2 - 2y - 6. Let h be g(6). Let a = h - 114. Let j = a - 27. Calculate the greatest common divisor of 14 and j. 7 Suppose 3 = -3p, -3k + 13p = 18p - 22. What is the greatest common factor of 2853 and k? 9 Let a(t) = 27t - 370. Let o be a(14). Suppose 11h = oh - 4f + 1, 1 = -3h - 5f. Let r be 1 - 1 - (-8 - 1). Calculate the highest common factor of r and h. 3 Let b be (-6)/(-21) + (-132)/(-77). Suppose -s + 0s - 67 = -y, s = -by + 128. What is the highest common factor of y and 78? 13 Let p(s) = -s*2 - 19s + 52. Let a be p(-10). Suppose 144x - 48 = ax. Calculate the highest common divisor of x and 8. 8 Let w(o) = o*2 - 11o + 27. Let u be w(-10). Suppose 0 = -ui + 233i + 308. What is the highest common divisor of 42 and i? 7 Suppose -3m + 210 = -5g, 3g + 140 = 2m + g. Let j be 2/(-3)75/2. Let s = j - -35. Calculate the greatest common factor of s and m. 10 Let j be ((-3)/2)/(33/(-24) - -1). Suppose -5f = -4f - jl - 11, 0 = 4f - 5l - 55. Calculate the highest common divisor of 285 and f. 15 Let p(o) = -13o + 36. Let a be 3 - (2 - -3) - 10. Let b be p(a). Suppose -2l = 5u - 6l - 136, l = -3u + 68. What is the highest common divisor of u and b? 24 Let k = 124 + 11. Let d = -5950 + 6058. Calculate the greatest common factor of k and d. 27 Let b(a) = 3a - 3. Let q be b(5). Let d(i) = 67i + 77. Let x be d(-1). Calculate the greatest common factor of x and q. 2 Let a be 3/((-26)/91 - (-50)/28). Let q be (-6 - 23/(-5))/(a/(-30)). What is the greatest common factor of 14 and q? 7 Let j = -52 - -62. Let a be (1 - j/8)/((-3)/36). Suppose -5c + 20 = 0, k - 4c - 20 = -ak. What is the greatest common divisor of 72 and k? 9 Suppose -20f - 68f + 2552 = 0. Let l be 0 + 0 + 0 - -377. What is the highest common divisor of l and f? 29 Let y(o) = 5o3 + 977o*2 + 393o + 635. Let l be y(-195). Let n be (-4)/18 + 137/9. Calculate the highest common divisor of l and n. 5 Suppose -3s + 860 = 5c + 101, 0 = -s + c + 285. Suppose -5k + k = -4u - 52, -2k + 26 = -5u. Calculate the greatest common factor of s and k. 13 Suppose -8d + 3d = -20. Let k be (39963/(-110))/(-7) + (-3)/(-30). What is the highest common factor of k and d? 4 Let x = 95 + -83. Suppose -xb + b = -693. Suppose -5u + 54 = u. Calculate the highest common factor of b and u. 9 Let a be (-28)/(-2) - (3 - 2). Let j = -297051 + 297090. Calculate the highest common divisor of a and j. 13 Suppose -5i = -45 + 65, -12 = 2z - 4i. Let a(f) = -28f - 374. Let o be a(z). Calculate the highest common factor of 78 and o. 6 Let m(b) = 53b - 35. Let i(h) = -53h + 37. Let s(w) = 5i(w) + 4m(w). Let f be s(7). Let r = -226 - f. What is the highest common divisor of 25 and r? 25 Suppose -5x - 11 = 2p - 51, -2x + 4p - 8 = 0. Suppose xi - 4i - 24 = 0. Calculate the greatest common factor of i and 36. 12 Let i(c) = -2c2 - 37c + 1. Let m(f) = -f*3 + 6f*2 - 4f - 22. Let a be m(5). Let q be i(a). What is the highest common factor of 208 and q? 52 Suppose 0 = -217f + 4428 - 6728 + 89100. What is the greatest common divisor of 75 and f? 25 Let h be (4/(-10))/(3/(-105)). Let z(v) = 154v*2 + 3v - 3. Let m be z(1). Suppose 16w - m = 5w. Calculate the greatest common divisor of w and h. 14 Let g(q) = -q*3 - 117q*2 - 11q - 153. Let y be g(-117). What is the greatest common divisor of 210 and y? 42 Let u be 11193/19 - 80/760. Suppose 4k + 2n = 2356, -5k = -4k + n - u. What is the highest common divisor of k and 62? 31 Let p be 760/(-57)((-6)/(-2))/(-6 + 4). What is the highest common factor of p and 916? 4 Let r be (24 - 2388/(-10))20. Calculate the greatest common factor of r and 192. 24 Let b = 15 + -7. Suppose 5i = 2m - 20, 0m + 8 = i + 2m. Let u be i - (3 + -5) - 20-1. Calculate the greatest common divisor of u and b. 4 Suppose 4h = -2q + 26, 0 = 2q + q + 3h - 24. Suppose 284g - 281g = 99. What is the highest common factor of q and g? 3 Let h be (-95)/(-15) - 235/(-141). Suppose 1134 = s + 2s. Suppose 134 = 4m - s. What is the greatest common divisor of h and m? 8 Suppose 49s = 12s + 1749 - 491. Suppose 1878 = 5d + x + x, x - 752 = -2d. Calculate the greatest common factor of d and s. 34 Suppose -17h + 3400 = 1360. What is the highest common factor of h and 768? 24 Let y = -4501 + 4531. What is the highest common divisor of 1810 and y? 10 Suppose -2y + 46 = 5z, 0z - 5z + 59 = 3y. Suppose 2392 = 13r + yr. What is the greatest common factor of r and 161? 23 Suppose 78o - 524 - 1294 = 132. Calculate the highest common divisor of 1075 and o. 25 Let s(p) = 7p2 - 4p - 11 + 3p - 3p*3 + 17. Let u be s(3). Let h = 13 - u. What is the greatest common factor of h and 308? 28 Suppose -5o - 1529 = -5p + 1311, 3p - 5o - 1710 = 0. Suppose n - 132 = -3d, 4n - 4d = -n + p. What is the greatest common factor of n and 72? 9 Let l be (-1)/(-3) - (-2272)/24. Let j = -19 + 38. Let g = 0 + j. Calculate the greatest common divisor of l and g. 19 Suppose -4 = -2x + 5d, 5x - 6d - 40 = -d. Let j be 2 - 16/x - (-58)/3. Suppose 21k - jk - 15 = 0. What is the greatest common divisor of k and 60? 15 Let n = 934 + -207. Let m = n + -633. Calculate the highest common factor of 564 and m. 94 Suppose -101f + 51357 = 2f + 56f. Calculate the greatest common divisor of f and 3211. 19 Suppose -39c = -41287 - 17213. Calculate the highest common divisor of c and 36. 12 Let t(s) = -s*2 + 74s - 458. Let f be t(67). Calculate the greatest common factor of 110 and f. 11 Let q(d) = -6d + 3. Let h be q(-4). Let y be 12/(-15) - (-11590)/50. Let t = y - 222. Calculate the greatest common factor of h and t. 9 Let f be (153/(-36))/((-25)/(-12) + -2). Let x = f - -193. Suppose 141n = xn - 30. Calculate the highest common factor of n and 18. 6 Let y = 19 - -1. Suppose 8 = 5w + 5a - 57, y = 4a. Let p = w - -3. What is the greatest common divisor of p and 33? 11 Let b(q) = -1782q - 6078. Let o be b(-4). Calculate the highest common divisor of 336 and o. 42 Let n be -312/9(-47)/2. Let h(l) = 52l + 7. Let k be h(1). Let m = 294 - k. What is the highest common factor of m and n? 47 Suppose -50m + 10m + 36000 = 0. What is the highest common divisor of m and 972? 36 Suppose 730w = 759w - 19311 - 30859. What is the highest common divisor of w and 40? 10 Let x be (-2 - 6 - -6)/(2/(-31)). Suppose 0 = xa - 28a. Suppose -2r - 239 + 1013 = a. Calculate the highest common divisor of r and 43. 43 Let l = -1038 - -1106. Calculate the greatest common divisor of l and 1037. 17 Let u(g) = 66g - 4. Let m be u(1). Suppose -m = -4w + 2i, 4w + 3i - 4i = 63. What is the greatest common factor of w and 1? 1 Suppose 4l = 5p + 811, 4p + 4 = 8. Let v = -167 + l. What is the greatest common divisor of 37 and v? 37 Let s(q) = q*2 - 98q - 1166. Let z be s(-11). What is the highest common divisor of 341 and z? 11 Let b = 6012 - 2415. Calculate the highest common divisor of b and 545. 109 Suppose 5b - 3d + 158 = 0, 4d - 3 = 2b + 49. Let y = b - -47. Let v(j) = 3j2 - 2j - 3. Let g be v(-6). What is the greatest common divisor of g and y? 13 Let m(n) = -2n3 + 5n*2 + 3n + 36. Let x be m(-5). Suppose -3u + 240 = -x. What is the greatest common factor of u and 159? 53 Suppose -l - 4n + 21 = 0, l + 5n - 6 = 2l. Let c(y) = y*3 + 31y*2 - 36y + 115. Let q be c(-32). Calculate the greatest common divisor of l and q. 9 Let y(z) = -z + 14. Let n be y(32). Let j(t) = t*3 + 19t*2 + 17t - 15. Let w be j(n). What is the highest common divisor of w and 2? 1 Let t(b) = b*3 + 20b*2 - 21b + 18. Let z = 55 + -51. Suppose s = -zs - 5, g = 5s - 16. Let p be t(g). Calculate the greatest common divisor of 54 and p. 18 Let v(o) = o*2 - 359o - 4297. Let k be v(-12). Calculate the highest common factor of 325 and k. 5 Let j(n) = -n*2 - 11n - 10. Let t be j(-10). Suppose 2c + 529 = -4g + 1681, t = -g + c + 291. Calculate the highest common factor of g and 17. 17 Let h(i) = 5i2 + 13i + 173. Let u be h(16). What is the greatest common divisor of 1208 and u? 151 Let y(w) = -w*2 + 7w	{ "pile_set_name": "DM Mathematics" }
5 - 16df*2 + 2df + d + 13779616f + 5 wrt f. 432621800df*3 - 32d Find the third derivative of 2c3d + 76031649c3 + 1679c*2d + cd + c - 120d wrt c. 12d + 456189894 What is the second derivative of -131702o*3 + 68o*2 - 2154104o - 1? -790212o + 136 What is the third derivative of -2549001fl4 + 2fl2 - 63578fl - 2f + 2l5 - 5l*2 + 3 wrt l? -61176024fl + 120l*2 Differentiate -3124095l*2x - 3l2 + 4lx2 + 98932141x*2 wrt l. -6248190lx - 6l + 4x2 What is the second derivative of -17388698s*2 + 2s + 664396? -34777396 Find the second derivative of -40p4 - 19907p*3 - 2p*2 + 13108p - 399. -480p2 - 119442p - 4 Find the second derivative of -548w3 - 8185w*2 - 36958005w. -3288w - 16370 What is the second derivative of 2i*4w - 925915i4 + 27iw - 13i - 5w + 5 wrt i? 24i*2w - 11110980i2 What is the third derivative of 8443949z*5 + 12z*3 + 243135719z*2 wrt z? 506636940z*2 + 72 What is the third derivative of -5701752o*5 + 9o*2 + 70220 wrt o? -342105120o*2 Find the first derivative of -50117366x*4 - 13388254. -200469464x*3 What is the first derivative of 183582s3 + s2 + 35s + 31901105? 550746s*2 + 2s + 35 Find the first derivative of 100b4 + 62632bn3 - 6861n*3 - 58n*2 + 3 wrt b. 400b*3 + 62632n*3 What is the third derivative of 13q*5 + 162111q*4 + 332268q*2? 780q*2 + 3890664q Find the second derivative of -8142209j2 - 387j - 9749 wrt j. -16284418 Find the third derivative of 60f5 + 2f*4 - 1087f*3 - 13977f*2 - 4. 3600f*2 + 48f - 6522 Find the second derivative of -19l4 - 171l*3 - 3315l*2 - 18173478l. -228l2 - 1026l - 6630 What is the first derivative of -13522h4 - h3 - 4015h*2 - 419864710? -54088h*3 - 3h*2 - 8030h What is the second derivative of -456947228h4 + 447535695h? -5483366736h2 Differentiate 14731978nz + 6875086z wrt n. 14731978z Find the third derivative of -913105b*4 + 74398942b*2 wrt b. -21914520b Differentiate -f*2pz - 34f*2z*3 - 37f*2z*2 - 20f*2 + 389535pz3 + 8p - 6z3 + 1 with respect to p. -f2z + 389535z3 + 8 Find the second derivative of -39h*2j*2s + 17h2js + 73703h*2s2 + h2s - 2hs + 3j*2s*2 - 27j*2 + 2s wrt s. 147406h2 + 6j*2 Find the second derivative of -8k*2q*2z*3 - 354691k*2z*3 + 13220kq2z*2 + 8kz + q2 - 2qz3 wrt k. -16q*2z*3 - 709382z*3 Differentiate -3313402f + 7880535. -3313402 Differentiate -5301398p3 - 8926205 with respect to p. -15904194p*2 What is the second derivative of 3t*3 + 5171099t*2 + 59645388t wrt t? 18t + 10342198 What is the second derivative of -91445f*5 - 5f*3 - 39f*2 - 18213f - 2173? -1828900f3 - 30f - 78 Find the third derivative of 310r4 - 292202r*3 + 2r*2 - 55r + 246239 wrt r. 7440r - 1753212 Find the second derivative of -102101037b*2d + 2bd + 70513b - 7d - 52 wrt b. -204202074d Differentiate -26612493y*3 - 5740554 with respect to y. -79837479y*2 What is the second derivative of -7b*5 - 1448579b*2m - 36136137bm wrt b? -140b3 - 2897158m What is the first derivative of 6d2y + 25d2 + 6dy - 577d - 8389y + 48 wrt d? 12dy + 50d + 6y - 577 What is the third derivative of 7445882r*3 + 248588r*2? 44675292 Find the second derivative of 162w*4 - 743w*3 + 79w*2 - 232w - 31335. 1944w2 - 4458w + 158 What is the second derivative of -23493140g2 - 70949403g? -46986280 Find the first derivative of -174j2s - 5js - 106086j + 1345s + 35965 wrt j. -348js - 5s - 106086 Find the third derivative of 2093f*3q*3 + 10368f*3q - 2f3 + 3f*2q*2 - 2429q*3 + 3q*2 wrt q. 12558f*3 - 14574 What is the derivative of 13338989v*4 + v + 202843748? 53355956v*3 + 1 Find the first derivative of 2674a*4 - 16108a*3 - 74409662 wrt a. 10696a*3 - 48324a*2 What is the third derivative of -7op5 + 3op3 + 2op2 + 306op + 3114o + 102591p3 - p2 + 2p wrt p? -420op*2 + 18o + 615546 Differentiate -35862773z2 - 5z - 194656694 with respect to z. -71725546z - 5 What is the first derivative of 13551708i*2 - 15206515? 27103416i Find the first derivative of 10318697c3 + c2 + 789785 wrt c. 30956091c*2 + 2c Find the third derivative of -215433r2x*3 + 12018r*2x2 + r2x - 10rx3 - 2rx2 - 567x*2 wrt x. -1292598r*2 - 60r Find the third derivative of k*5 + 8542k*4 + 38k*3 - 3k*2 + 20812142. 60k*2 + 205008k + 228 Differentiate 63161768t4 + 82499969 wrt t. 252647072t*3 Find the first derivative of 475783lx2 - 90lx + 2l - 112181411x2 wrt l. 475783x*2 - 90x + 2 Find the third derivative of 19941435d4 - 2d*3 - 2354d*2 + 2d - 286 wrt d. 478594440d - 12 What is the third derivative of -29346832h*4j - 10h3j - 5855222h2j - 58h2 wrt h? -704323968hj - 60j Find the first derivative of -4545747h3 - 6h*2 + 15347057 wrt h. -13637241h*2 - 12h What is the second derivative of -2b4 - 5578831b*2 - 670853944b? -24b2 - 11157662 Find the third derivative of -2u*4 - 2726550u*3 + 5878u*2 + 2u - 56. -48u - 16359300 Differentiate 502f*2n*2w + 238282f2n*2 - 691f*2w + 16fn*2 + 7w wrt w. 502f2n*2 - 691f*2 + 7 Find the third derivative of -60445699z*3 + 168500z*2 + 2z + 3. -362674194 What is the second derivative of 2i3w2 + i3 + 85439i2w + 1139iw*2 - 6800w*2 - 63 wrt w? 4i*3 + 2278i - 13600 Find the third derivative of 357472803s3 + 154465950s*2. 2144836818 What is the third derivative of -852177y*6 + 2y*3 - 135721y*2 - 2y - 4 wrt y? -102261240y3 + 12 Find the third derivative of 26u*5 - 872997u*4 - 47u*2 + 3098297. 1560u*2 - 20951928u Differentiate 1252r2s*3 - 13373325r*2 + 8637rs4 with respect to s. 3756r*2s*2 + 34548rs3 Differentiate 253lvw - 23lv - 72955lw - 150l - 1143vw wrt v. 253lw - 23l - 1143w What is the third derivative of 112098026c*3 + 20c*2 - 2c + 232235 wrt c? 672588156 What is the first derivative of -4413233c + 7701864? -4413233 Find the second derivative of 54987dm2o*2 + dm*2o - 32415387dm*2 - 445dmo*2 wrt o. 109974dm2 - 890dm Find the second derivative of -35v*2w - 1773235v2 - 931343vw + 143v wrt v. -70w - 3546470 What is the third derivative of -640790o*2s*3w*2 + 8o*2s*2w*2 - 10o*2sw + o2w + 3os*3 + 8s + 3w2 wrt s? -3844740o*2w*2 + 18o What is the derivative of -176z2 - 19815z - 42276363 wrt z? -352z - 19815 Find the third derivative of i3ux + 823376i*3u + i*3x + i3 + i2u + 5iux + 4iu + 3ix - 648ux - 27u wrt i. 6ux + 4940256u + 6x + 6 What is the second derivative of -527x*5z + 692x2z + 4xz - 3x + 18760 wrt x? -10540x*3z + 1384z Find the second derivative of -93892242d*3z*2 + 44d*3z + 226d3 - d2z + 3dz - 58z wrt z. -187784484d*3 Find the third derivative of 36870744v*3 - 24110253v*2 wrt v. 221224464 Find the third derivative of -2109298s*4 - 121826s*2 - 2s wrt s. -50623152s Differentiate -318974331t*2 - 738754308. -637948662t Find the third derivative of -132098r2z*3 + 94r*2z + 2488rz*4 + 3986378z*2 wrt z. -792588r*2 + 59712rz Find the third derivative of -316o*6 - 15795o*5 - 7404982o*2. -37920o*3 - 947700o*2 Differentiate -31349544i*4 - 47375301 wrt i. -125398176i*3 Find the third derivative of 623415298o*3t - 12o2t + 2o2 - 17084ot - 632t wrt o. 3740491788t Find the third derivative of 1024230h*3l*3 + 2404h*3l*2 + 4h*3l + 5h2l*5 - 3h*2l*2 + 3 wrt l. 6145380h*3 + 300h*2l*2 What is the first derivative of -28lt2 + 32587l - 1183t2 - 650 wrt t? -56lt - 2366t What is the second derivative of -9304988b2 + 3741459b? -18609976 What is the derivative of 216551135b2 - 355513778 wrt b? 433102270b What is the second derivative of 48740381w5 - 793676w wrt w? 974807620w3 What is the second derivative of -400085314f*4 + 1017946f + 70 wrt f? -4801023768f2 Differentiate 580h*3j - 26h3 - 19h + 6	{ "pile_set_name": "DM Mathematics" }
= f*2 + 3f - 3. Let a be m(2). Suppose 5u - 5 = -5s, 3u - a = -s - 3s. Suppose 4g - 80 = -4v, 8 = g + sv - 15. Is g composite? False Is 4/(-26) - 8235/(-39) composite? False Suppose -4 = -b - 1. Suppose n + q + q = -8, -12 = 3q. Suppose -3k = y - 89, n = -by - 0y - 2k + 239. Is y a composite number? True Suppose 0l = l + n, 5l + 4n - 4 = 0. Let j = l + 0. Is j/247/2 prime? True Let o(p) = p*3 - 6p*2 - 2p + 4. Let w be o(7). Suppose 2y + w = -y. Let v = y - -20. Is v prime? True Let z be (-8)/(-4) + 0 + 1. Let j be ((-6)/z + -79)/(-1). Let b = j + -58. Is b prime? True Let u be (-18)/(-5) - 4/(-10). Suppose uw = -5t - w + 245, 0 = -2w + 6. Is t composite? True Suppose -o = -t - 407, 3o - 2043 = -2o + t. Is o a prime number? True Suppose 0 = -5d + d - 16. Let o(i) = -44i + 3. Is o(d) composite? False Let m be -1(-2 - -3) + 1. Is (1 + m)/(4/212) a prime number? True Suppose 4p - 2p = 4. Suppose 3 = a - 4a. Is (158/(-4))/(a/p) composite? False Is 3/5 - 9010/(-25) a composite number? True Let w = 860 - 481. Is w composite? False Let t = 281 + -142. Is t composite? False Let s(a) = 1. Let r(t) = -t*3 - 7t*2 - 3t - 2. Let w(j) = -r(j) - 5s(j). Suppose u = 2u + 6. Is w(u) prime? False Suppose -3q + 14 = -4. Let p = -6 + q. Suppose 5 = x, -2u + x = -px - 143. Is u a composite number? True Is (1174/(-6))/((-4)/12) composite? False Let b(l) = l2 + 3l - 12. Let w be b(11). Suppose 5x - 402 = -2h, w = 3h + 5x - 451. Is h a composite number? False Let b(o) = 820o2 + 2o - 1. Suppose -16 = 6u - 2u + 5p, 3u - 19 = 4p. Is b(u) a prime number? True Let p(t) = 90t + 5. Is p(7) a composite number? True Suppose 645 = 4l - 2095. Is l prime? False Let g = -59 + 78. Is g composite? False Let s(b) = b3 + 3b*2 - 2b - 3. Let h(y) = y*3 - 7y*2 - y + 5. Let w be h(7). Let v be s(w). Suppose -vq = -f + 2, f - 2f + q + 6 = 0. Is f prime? True Let l = 289 + 257. Let p = 1059 - l. Suppose p = 4x + 89. Is x a composite number? True Suppose u + 5 = -2a, 12 = -3a - 6u + 3u. Suppose 0n - 4n - 3b = -238, -4n - 5b = -242. Is (n/(-4))/a6 prime? False Let j(c) = -7c2 - 4c2 - c3 + 0c3 + 5 - 10c. Is j(-11) a composite number? True Let v = -260 + 391. Is v a composite number? False Suppose 0 - 4 = 4n. Let a be (n - (1 - 2)) + 2. Suppose o - 15 = -2j + 29, ao + j - 91 = 0. Is o a composite number? True Let w be (-4 - -5)0 - -5. Suppose 382 = -4g + wg. Is g a composite number? True Let g = 11 + -19. Let i(f) = 2f - 5. Let u be i(g). Let y = -14 - u. Is y composite? False Let t = -20 - -33. Suppose -1 = 3x - t. Suppose -xl + 5j + 33 = 0, 5l = 5j + 34 + 6. Is l prime? True Is (106/(-8))/(4/(-48)) a prime number? False Let p = -276 - -404. Let v(x) = -42x + 7. Let i be v(-6). Let j = i - p. Is j composite? False Suppose 1492 = -10b + 14b. Is b composite? False Let i(f) = 11f*2 + f - 1. Is i(-3) prime? False Suppose 0v - 30 = -5v. Let m be (2 - 1)/(3/v). Let i(f) = f3 - 2f*2 + 2f + 2. Is i(m) a composite number? True Let a = -24 - -31. Suppose -3d + 19 = a, -5b = -d - 1981. Is b prime? True Suppose -5o - 5f = -2f - 89, 2o - 3f = 44. Let c = 34 + o. Is c a prime number? True Let w = -378 - -736. Is (-6)/(-4) + w/4 a composite number? True Suppose -128 + 52 = -4u. Is u composite? False Let z be (-57)/(3/(-4) + 0). Suppose 3c = -z + 283. Is c composite? True Is ((-236)/16)/(1/(-4)) prime? True Let y = 117 - 251. Suppose -3 + 8 = 5z. Is 3zy/(-6) prime? True Suppose 0 = 3d - 23 + 8. Suppose -3r = -dt + 155, -2t - r + 48 = -5r. Is t a prime number? False Suppose 4n + 4s = 131 + 445, 0 = n - s - 146. Is n a composite number? True Let r(n) = 2n*2 + n + 13. Is r(-12) a composite number? True Let g(i) = -2i - 4. Let r be g(-3). Suppose 2m = 10, 0 = 4h + rm + 3m - 597. Suppose -4x + h = -29. Is x prime? True Let m(o) = 117o + 8. Let i(t) = 58t + 4. Let d(j) = -7i(j) + 3m(j). Is d(-3) a prime number? False Let v = 11 - 4. Suppose -25 = -12s + vs. Suppose sf = 480 + 5. Is f prime? True Suppose h - 19 - 14 = 0. Is h a composite number? True Suppose 2w = -5w + 889. Is w composite? False Suppose o - 5y - 48 = 0, 3o - 2y - 25 - 67 = 0. Suppose -3v + 15 = 5g, -3g + v + o = -v. Suppose -gc + c = -345. Is c a prime number? False Is -5-1583/15 a prime number? False Let w(h) = 10h - 7. Let u(t) = -2t3 + 3t*2 - 3t + 3. Let q be u(2). Let a be w(q). Is 0 - a/22 composite? True Let y be ((-825)/12)/((-2)/8). Suppose -j = -5b - 55, y = 2j + 3j - 3b. Suppose -n = -4k - j, 3n - k + 74 = 250. Is n prime? True Let y be 85/3(15 - 0). Suppose -5t - 5a = -y, -3t + 161 + 82 = -3a. Is t prime? True Suppose 0 = -5z + 186 + 424. Is z composite? True Suppose -5t = -4p - 36, -3t + 4 = -p + 3p. Suppose -46 = -2x + 4c, -3x - tc + 6c = -61. Is x a prime number? True Let s(i) = -i*3 + 7i*2 - 4i - 2. Let c be s(5). Suppose q + c = 3r, 4 = 2r - 3r + 3q. Is r prime? True Let p = 1809 + -466. Is p a prime number? False Suppose 0 = 2x - 2n + 45 + 39, -194 = 5x + 3n. Let t = -3 + -26. Let y = t - x. Is y prime? True Suppose -7f = -3f - 524. Is f a prime number? True Suppose 0 = -4r + 5n + 1, -4n = 5r - 21 - 11. Suppose -376 = -3m + 4h + h, 0 = -rm + 5h + 503. Is m a composite number? False Is 2 + ((-3 - -2) + 5752 - 4) prime? True Suppose -9j + 1166 = -7j. Is j prime? False Suppose h - 5n = 5, n + 1 = h - 0h. Suppose -l + 20 + 3 = h. Is l a prime number? True Let h(i) = -i*2 - 5i2 - i3 + i*2 + 4i - 11. Let l = -21 + 13. Is h(l) a composite number? False Let a(p) be the second derivative of 23p3/3 + p2/2 - 3p. Is a(1) a prime number? True Suppose -2042 = -17p + 117. Is p a composite number? False Suppose 1 = -u + 3. Is (-3)/6 + 279/u composite? False Let u = -1200 - -1741. Is u a composite number? False Let n = 12 - 7. Suppose 2y = y + 5f - 8, 0 = y + 4f - 28. Suppose -nr - 5q + 60 = 0, -2r + 4q = 2q - y. Is r composite? True Suppose 4 = 2s - 0s. Suppose 2j + sj - 1028 = 0. Is j composite? False Is 2/11 - (-29753)/11 prime? False Let f be 45/1020/(-6). Let y = f - -10. Let m(i) = -i*3 + 3i*2 + i - 4. Is m(y) prime? True Let q be (-1 + 3)/(-2) - -54. Suppose -u = -2j - q, 6j - 2j = -5u + 279. Is u a composite number? True Let f be 0(-3 + 1)/(-2). Suppose -q + 0h + 135 = 4h, -5q - 4h + 627 = f. Is q prime? False Let l(k) = k*3 - 4k*2 - 3k - 1. Suppose -5v = -0j - j + 9, 4v + 2j + 10 = 0. Let t be (v + -10)2/(-4). Is l(t) composite? False Suppose -i = 4i + 1125. Let q = i + 574. Suppose 0x + q = 5b - 3x, x = b - 69. Is b composite? False Let c(u) = 3u*2 + 26u - 32. Is c(23) prime? True Suppose -3z + 22 = -185. Is z a prime number? False Let k(o) = 507o + 29. Is k(2) a prime number? False Let w(n) = 68n2 + 3n - 4. Let m be w(3). Suppose 0 = 3p + 5z - m, -140 + 966 = 4p + 5z. Is p a composite number? True Suppose 5v - 1492 - 6568 = 0. Suppose -v = -3h - h. Is h prime? False Suppose -4c = -2h - 10, -35 = 2c - 6c - 3h. Suppose -z = -4 - c. Let n = z + -6. Is n a composite number? False Let d(k) = -k3 + 12k*2 - 3k + 3. Is d(6) a composite number? True Let z be (-5 - -6) + (1 - 1). Suppose -132 = -w + z. Is w a composite number? True Suppose -3y - m = -1, -y - 4y = 2m. Suppose yw + 2p - 485 = -w, 2p = -4. Is w prime? True Let f = 77 + -26. Is f composite? True Let b be (3 - 2)-1 - -2. Let g be 1 + 45 - (b + -4). Let x = -18 + g. Is x a composite number? False Let a(g) be the third derivative of g5/20 - 5g*3/6 + 2g*2. Let z be a(4). Suppose -2s = -z - 151. Is s prime? True Let m(w) = 14w2 - 4w + 15. Is m(7) composite? False Suppose -30 = 5b - 2n, -3b + 5n = 13 + 5. Let z(p) = -22p - 2. Let t(m) = 11m + 1. Let u(y) = 7t(y) + 4z(y). Is u(b) a composite number? True Suppose -6w = -2w. Suppose 5c = -wc + 295. Is c a composite number? False Let o(f) = f*2 + 34. Let p be o(0). Suppose 3k = -2r + 314, 314 = -0r + 2r + 2k. Let a = r - p. Is a composite? True Let i(w) = -w2 - 8. Let p be i(0). Is (-4)/p - (-34)/4 composite? True Let z(l) = -l3 + 5l2 + 5l. Let q be z(6). Let k(h) = -4*h - 5. Is k(q) a composite number? Fals	{ "pile_set_name": "DM Mathematics" }
3224 - -4? -3220 In base 6, what is -1125 + 34? -1051 In base 14, what is -4 - 315? -319 In base 15, what is -ec6 - -3? -ec3 In base 11, what is 212 - -2? 214 In base 9, what is 6 + -80? -73 In base 11, what is -33 + -261? -294 In base 8, what is 373 + -3? 370 In base 5, what is -121 + -1? -122 In base 16, what is -4 + -27? -2b In base 6, what is 4 + -433? -425 In base 5, what is 41 + -13? 23 In base 3, what is 0 - -1122101? 1122101 In base 11, what is 26 + 74? 9a In base 12, what is -25 - -31? 8 In base 6, what is -15 + -11? -30 In base 7, what is -11 + -204? -215 In base 8, what is -5552 + 2? -5550 In base 9, what is 16 + 5? 22 In base 15, what is 0 - da8? -da8 In base 15, what is -37 - -9? -2d In base 10, what is 1796 + -4? 1792 In base 4, what is -10023003 - 2? -10023011 In base 11, what is 0 - 196? -196 In base 8, what is -1 - -35? 34 In base 7, what is -2 - -525? 523 In base 10, what is -405 + -6? -411 In base 5, what is -120 + 12? -103 In base 15, what is 60 + 7? 67 In base 9, what is 22061 + 0? 22061 In base 8, what is 461 - 14? 445 In base 6, what is 32 - -111? 143 In base 2, what is -101 - 10101010? -10101111 In base 8, what is 4 - 475? -471 In base 13, what is -32 - 10? -42 In base 2, what is -110 - -1001011000011? 1001010111101 In base 5, what is 4 + 42141? 42200 In base 10, what is 7972 - -3? 7975 In base 12, what is 16 + b? 25 In base 7, what is -2 - -6044? 6042 In base 7, what is 5 + 1333? 1341 In base 5, what is -4 - -132? 123 In base 13, what is -17178 + -5? -17180 In base 9, what is 0 + -18? -18 In base 15, what is -118 + 5? -113 In base 13, what is 9 + -9a7? -99b In base 7, what is -120 + -3? -123 In base 9, what is 13 - -71? 84 In base 10, what is 2 - 463? -461 In base 14, what is -4b5 + -6? -4bb In base 6, what is -4 + -2? -10 In base 4, what is 11 + -3230? -3213 In base 2, what is 1110 - 100? 1010 In base 14, what is 97 + -2? 95 In base 11, what is -3 + -3686? -3689 In base 2, what is -1011 - 1000? -10011 In base 11, what is 819 + -1? 818 In base 10, what is -23 - -79? 56 In base 16, what is -1f + -5? -24 In base 4, what is 10123 + 2? 10131 In base 14, what is 1 + -226? -225 In base 2, what is 1001011 - 1000? 1000011 In base 5, what is -130 - 32? -212 In base 13, what is 3 - 119? -116 In base 6, what is 2 - -111? 113 In base 7, what is -603 - -5? -565 In base 4, what is 11 - 3? 2 In base 13, what is 13 + 69? 7c In base 2, what is -110 + 10101010? 10100100 In base 13, what is 264 - -5? 269 In base 16, what is -1c21 - -2? -1c1f In base 7, what is 0 + 1353? 1353 In base 5, what is 10 + 20434? 20444 In base 14, what is -8 - -34? 2a In base 2, what is 1110 - -1? 1111 In base 4, what is 13103 - -11? 13120 In base 5, what is -223 + 110? -113 In base 3, what is 21 + -1102? -1011 In base 5, what is 4221 + 3? 4224 In base 6, what is 41003 + -4? 40555 In base 15, what is -b7 + -2? -b9 In base 3, what is 11 - -11110? 11121 In base 6, what is 3 - -525? 532 In base 14, what is -5 - -a77? a72 In base 10, what is 638 - 5? 633 In base 13, what is b + 27? 35 In base 3, what is 10010 + -1120? 1120 In base 4, what is 11 - 1200? -1123 In base 6, what is 5 + -1545? -1540 In base 12, what is -34 - -4? -30 In base 10, what is -1 - -98? 97 In base 13, what is 5 - -508? 510 In base 6, what is -2340 - -2? -2334 In base 3, what is 11 - -21222? 22010 In base 14, what is 13 + 16? 29 In base 6, what is -3 + 1? -2 In base 16, what is -a + b? 1 In base 10, what is -8 + 1140? 1132 In base 15, what is -4 - -44? 40 In base 10, what is -9 - 23? -32 In base 13, what is 3 - 51? -4b In base 8, what is 1526 + -3? 1523 In base 3, what is -2 - 20? -22 In base 14, what is -5 - -17? 12 In base 16, what is 75 - 4? 71 In base 16, what is -5 - a13? -a18 In base 14, what is -6 + 78? 72 In base 5, what is 3 + 20231? 20234 In base 2, what is 10 + 1010100000? 1010100010 In base 16, what is -1 + ca? c9 In base 11, what is 4 - -34? 38 In base 9, what is -737 - 10? -747 In base 3, what is -12 + 22102? 22020 In base 5, what is -3 - -1021? 1013 In base 4, what is -33210 + -1? -33211 In base 16, what is -3 + -30? -33 In base 11, what is 1 - 5? -4 In base 11, what is 1 + -4? -3 In base 8, what is 172 - -2? 174 In base 8, what is -11 + -1556? -1567 In base 5, what is -134043 + -2? -134100 In base 14, what is -207 - 5? -20c In base 2, what is -100 + 1101100? 1101000 In base 11, what is 0 + 4? 4 In base 12, what is -1 + 8a5? 8a4 In base 6, what is -2 - 313? -315 In base 9, what is -3 + 1652? 1648 In base 13, what is -6 + -2? -8 In base 12, what is 3 - -69? 70 In base 2, what is 100 - -111111001? 111111101 In base 4, what is -1 - -210? 203 In base 14, what is -93 - -44? -4d In base 13, what is 2 + 26? 28 In base 3, what is -1002011 - 11? -1002022 In base 5, what is 1334 - 0? 1334 In base 12, what is -221 - -4? -219 In base 14, what is 15 - -a? 21 In base 10, what is -2006 - -3? -2003 In base 2, what is 10010110111 - 10001? 10010100110 In base 6, what is -531 + 3? -524 In base 2, what is -100101001 - 110? -100101111 In base 16, what is 5 + -35? -30 In base 5, what is -11 + 314? 303 In base 10, what is 178 + 0? 178 In base 7, what is -11 + -45? -56 In base 9, what is -5628 - -2? -5626 In base 2, what is 101000101 + -111010? 100001011 In base 9, what is -218 + -5? -224 In base 12, what is 3 + -39? -36 In base 9, what is 257 + -13? 244 In base 6, what is 1 - -5302? 5303 In base 10, what is -1 + 1715? 1714 In base 13, what is 0 - 53? -53 In base 10, what is 3 - -1796? 1799 In base 10, what is -4 + 448? 444 In base 8, what is 213 - -4? 217 In base 6, what is 3 + 22301? 22304 In base 11, what is -5 - -4? -1 In base 7, what is -1150 - -11? -1136 In base 4, what is 13 - 3231? -3212 In base 3, what is -12 + 22022? 22010 In base 5, what is -211 - 20? -231 In base 15, what is -4 + -465? -469 In base 15, what is -237 + d? -229 In base 15, what is -55 - 14? -69 In base 8, what is -10074 - 4? -10100 In base 14, what is c2 - 15? ab In base 5, what is 10 + -23010? -23000 In base 16, what is -5 + 4e? 49 In base 6, what is 1 - 212? -211 In base 9, what is -106 + 0? -106 In base 7, what is -143 - 5? -151 In base 6, what is 15333 - -5? 15342 In base 15, what is 165a - 0? 165a In base 3, what is 21 + -201? -110 In base 9, what is 2256 + -1? 2255 In base 16, what is 6 + 4? a In base 12, what is -1147 - 2? -1149 In base 3, what is -10211 - 10? -10221 In base 2, what is 110100011101 - -11? 110100100000 In base 13, what is -6c2 + -2? -6c4 In base 3, what is -1 + 121101? 121100 In base 9, what is -2 - -53? 51 In base 9, what is 32 - 68? -36 In base 2, what is 101 + -1010101111? -1010101010 In base 12, what is 543 + 10? 553 In base 13, what is -6 + -b? -14 In base 14, what is 0 - -c4? c4 In base 15, what is -38 + -2? -3a In base 10, what is 6 - -14? 20 In base 15, what is -3 - -d7? d4 In base 4, what is -3101 + 120? -2321 In base 11, what is a7 - -5? 101 In base 4, what is 3 - -3320? 3323 In base 13, what is 8 + 40? 48 In base 6, what is -15 + 10? -5 In base 5, what is 10 - -434? 444 In base 11, what is 6 + -232? -227 In base 6, what is 432 - -3? 435 In base 11, what is 1 + -456? -455 In base 2, what is 101 + -11000001001? -11000000100 In base 8, what is 4 - 14511? -14505 In base 5, what is -124 - 41? -220 In base 15, what is 170 + 9? 179 In base 11, what is -74 - -21? -53 In base 15, what is bb + -4? b7 In base 16, what is 2 - f4? -f2 In base 10, what is 3 - 627? -624 In base 9, what is 1212 + 0? 1212 In base 11, what is -22a3 - -4? -229a In base 8, what is 2 - -37? 41 In base 6, what is 115 - -3? 122 In base 11, what is -34 - -1? -33 In base 2, what is -100111100101 - 11? -100111101000 In base 14, what is 21 - 0? 21 In base 12, what is -212b - 4? -2133 In base 6, what is -325 - 2? -331 In base 12, what is -1b + 127? 108 In base 5, what is 1324 + -10? 1314 In base 10, what is 3 + 42? 45 In base 2, what is -101 - 111? -1100 In base 8, what is -1 - 10101? -10102 In base 3, what is -12 + -2011202? -2011221 In base 4, what is -11 - -203213? 203202 In base 10, what is -2343 - -1? -2342 In base 16, what is -26 + 5? -21 In base 12, what is -24 + 14? -10 In base 9, what is -4 - 68? -73 In base 13, what is 18 - 7? 11 In base 8, what is -45 + 1? -44 In base 9, what is 0 - 10402? -10402 In base 6, what is 1 - 24014?	{ "pile_set_name": "DM Mathematics" }
w*3/2 + 2231w*2/2 - w/2 - 2231/2 = 0. -2231, -1, 1 Find a, given that 5a*5 - 110a*4 + 520a*3 - 640a*2 = 0. 0, 2, 4, 16 Let -2d*2/11 - 28044d/11 + 28046/11 = 0. What is d? -14023, 1 Suppose 3f4/2 - 648f*3 + 134013f*2/2 + 205578f + 137922 = 0. Calculate f. -2, -1, 181, 254 Factor -4t2/9 + 127528t/9. -4t(t - 31882)/9 Factor 5w3 - 145w*2 - 3120w - 7920. 5(w - 44)(w + 3)(w + 12) Factor 3c*4/5 + 3216c*3/5 + 926778c*2/5 + 6956208c + 70178535. 3(c + 21)2(c + 515)*2/5 Determine f so that 2523f*5 - 166344f*4 - 1300734f*3 - 89112f*2 - 1533f = 0. -7, -1/29, 0, 73 What is m in 6m3/11 + 7176m*2/11 + 42870m/11 + 35700/11 = 0? -1190, -5, -1 Determine y so that -2y2/21 + 292y/21 + 107440/21 = 0. -170, 316 Determine z so that 5z3 + 855z*2 - 173150z - 174000 = 0. -290, -1, 120 Solve -f*4/7 + 33010f*3/7 - 38911716f*2 - 77842296f = 0. -2, 0, 16506 What is t in -8t4/3 + 15502t*3/3 - 3337236t*2 + 2154185192t/3 + 539172272/3 = 0? -1/4, 646 Suppose -7n5/5 + 1269n*4/5 + 3502n*3/5 - 1104n*2/5 = 0. Calculate n. -3, 0, 2/7, 184 Suppose -5v*4 - 130v*3 + 1405v*2 + 1530v = 0. Calculate v. -34, -1, 0, 9 Find l, given that -3l3/8 - 1185l*2/8 + 42891l/8 - 371943/8 = 0. -429, 17 Factor 2o4 - 128o*3 - 1266o*2 - 3472o - 2336. 2(o - 73)(o + 1)(o + 4)2 Find v such that -3v*5 + 306v*4 - 1860v*3 - 14250v*2 + 138375v - 285000 = 0. -8, 5, 95 Let -16m3 + 84m*2 + 1764m + 2744 = 0. What is m? -7, -7/4, 14 Solve -1369x3/5 + 39389016x*2/5 - 851652x + 115088/5 = 0 for x. 2/37, 28772 Determine k so that -3k5 - 324k*4 + 2364k*3 - 5814k*2 + 5847k - 2070 = 0. -115, 1, 2, 3 Factor 27q3 - 195216q*2 + 1018755q - 216750. 3(q - 7225)(q - 5)(9q - 2) Factor -3u3 + 363u*2 + 3u - 363. -3(u - 121)(u - 1)(u + 1) Let -3n*5 + 117n*4 + 378n*3 + 12n*2 - 504n = 0. Calculate n. -2, 0, 1, 42 Factor -m*4 + 4509m*3 - 9015m*2 + 4507m. -m(m - 4507)(m - 1)*2 Solve 5k*3/4 - 15k*2/2 + 15k - 10 = 0 for k. 2 What is s in 2s2/9 - 2050s/9 + 8168/9 = 0? 4, 1021 Suppose 6p4/11 - 12682p*3/11 + 6686564p*2/11 + 15662632p/11 + 4477456/11 = 0. What is p? -2, -1/3, 1058 Determine k, given that 3k2/5 - 2079k/5 + 228516/5 = 0. 137, 556 Suppose -n*4/3 - 191n*3/3 + 260n*2 = 0. Calculate n. -195, 0, 4 Factor -3q*5 + 5520q*4 + 16578q*3 + 16584q*2 + 5529q. -3q(q - 1843)(q + 1)3 Find c such that -7c*5 + 2729c*4 - 273849c*3 + 1533303c*2 - 2097792c - 331776 = 0. -1/7, 3, 192 Find l, given that 4l4 + 17480l*3 + 52416l*2 + 52408l + 17468 = 0. -4367, -1 Suppose -g*2 - 782g - 121197 = 0. What is g? -569, -213 Factor -12h2 + 11120h + 3708. -4(h - 927)(3h + 1) Suppose -3w*5/7 + 750w*4/7 + 11811w*3/7 + 30138w*2/7 + 19080w/7 = 0. What is w? -12, -2, -1, 0, 265 Factor 2m2/21 + 12452m/21. 2m(m + 6226)/21 Determine s, given that s*4/8 + 181s*3/8 - 23s*2 - 91s/2 = 0. -182, -1, 0, 2 Find j, given that -15j5 + 125j*4 + 100j*3 - 2000j*2 + 2240j = 0. -4, 0, 4/3, 4, 7 Suppose 3z5/4 - 10647z*4/4 + 6292353z*3/2 - 1235358960z*2 - 3766086144z + 12448481280 = 0. Calculate z. -5, 2, 1184 Solve l*5 + 50l*4 + 305l*3 + 160l*2 - 516l = 0. -43, -6, -2, 0, 1 Let 21f3/4 + 21465f*2/2 - 18417f - 6138 = 0. Calculate f. -2046, -2/7, 2 Let -p*4 + 7637p*3 - 19377198p*2 + 16170308764p + 416488186600 = 0. Calculate p. -25, 2554 Factor -x*4/3 - 2x*3 + 248x*2/3 - 256x - 2560/3. -(x - 8)*2(x + 2)(x + 20)/3 Factor 4m*2 + 88088m + 484968484. 4(m + 11011)2 Factor -4f*2/5 + 3772f/5 + 5320. -4(f - 950)(f + 7)/5 Solve -5p3 - 3005p*2 - 8980p - 5980 = 0 for p. -598, -2, -1 Find g such that -3g2 - 79376g + 26459 = 0. -26459, 1/3 Factor 3q2 + 104772q + 209532. 3(q + 2)(q + 34922) Let -z*5/2 + 12z*4 - 58z*3 - 181z*2 + 117z/2 + 169 = 0. Calculate z. -2, -1, 1, 13 Solve -j*4/4 + 35j*3 + 291j*2/4 - 499j/2 + 142 = 0 for j. -4, 1, 142 Suppose -24h5 + 340h*4 + 6300h*3 + 5000h*2 = 0. Calculate h. -10, -5/6, 0, 25 Suppose -5j*5 - 337j*4 - 6794j*3 - 37764j*2 - 68040j - 21600 = 0. Calculate j. -30, -4, -3, -2/5 Factor 2h3 - 12212h*2 + 48792h + 146448. 2(h - 6102)(h - 6)(h + 2) Factor 3r*3/4 - 2853r*2/2 + 5697r - 5694. 3(r - 1898)(r - 2)2/4 Determine k so that -k5/4 + 7k4 - 10k*3 - 80k*2 + 44k + 208 = 0. -2, 2, 4, 26 Factor i4/4 - i3/4 - 41i2/2 - 20i. i(i - 10)(i + 1)(i + 8)/4 Let -3l*3 - 127l*2/4 - 51l/4 + 95/2 = 0. Calculate l. -10, -19/12, 1 Factor -w*2 + 8837w - 8836. -(w - 8836)(w - 1) Let -3h*3 + 159h*2 + 12075h + 157113 = 0. What is h? -23, 99 Determine u, given that -4u2/5 - 2864u/5 + 8176 = 0. -730, 14 Solve -3u5 - 1854u*4 - 322146u*3 - 17431932u*2 - 33904827u - 16793190 = 0 for u. -370, -123, -1 Find y such that 8y3/5 + 174y*2/5 + 76y/5 - 816 = 0. -20, -6, 17/4 Factor -3l2/5 + 183726l/5 + 183729/5. -3(l - 61243)(l + 1)/5 Suppose 3k2/7 + 598398k/7 - 1196808/7 = 0. What is k? -199468, 2 Factor 2v4/9 + 452v*3/3 + 244274v*2/9 + 1630816v/3 + 26035328/9. 2(v + 11)2(v + 328)*2/9 Factor -2h*3 - 7436h*2 - 22282h + 29720. -2(h - 1)(h + 4)(h + 3715) Factor k5 + 174k*4 + 9588k*3 + 156520k*2 - 352800k. k(k - 2)(k + 36)(k + 70)2 Factor -g2/2 - 21837g + 131031/2. -(g - 3)(g + 43677)/2 Find v, given that -3v*5 + 1713v*4 + 15588v*3 + 41712v*2 + 27840v = 0. -4, -1, 0, 580 Let -4s5 - 644s*4 - 35176s*3 - 728904s*2 - 4042836s + 19691532 = 0. Calculate s. -61, -21, 3 Suppose -5w3 + 24400w*2 - 48780w = 0. What is w? 0, 2, 4878 Solve 44b3/7 - 870b*2/7 + 2908b/7 - 2082/7 = 0. 1, 3, 347/22 Factor o*3/7 + 116007o*2/7 - 232017o/7 + 116009/7. (o - 1)*2(o + 116009)/7 Suppose 225c4 + 12765c*3 + 138334c*2 - 37572c + 2520 = 0. What is c? -42, -15, 2/15 Solve 9b5 + 84b*4 + 156b*3 - 234b*2 - 165b + 150 = 0. -5, -1, 2/3, 1 Factor -w*2/2 + 1857w/2 + 8397. -(w - 1866)(w + 9)/2 Solve 7j*3/5 + 656j*2/5 + 463j/5 - 186/5 = 0. -93, -1, 2/7 Suppose 5s4 - 2200s*3 + 237560s*2 + 976800s + 985680 = 0. What is s? -2, 222 Factor 2u2/11 - 338u/11 - 7980/11. 2(u - 190)(u + 21)/11 Find u such that -u*4/5 + 7u3/5 - u2 - 7u/5 + 6/5 = 0. -1, 1, 6 What is x in 3x*2 - 473838x + 18710204187 = 0? 78973 Factor d*2/2 - 69d + 520. (d - 130)(d - 8)/2 Factor -3i*3/5 - 3423i*2/5 - 10800i. -3i(i + 16)(i + 1125)/5 Factor 4n*2 + 2248n. 4n(n + 562) Find o such that 4o4 - 6768o*3 + 2883096o*2 - 17116272o + 25583364 = 0. 3, 843 What is b in 27b4 - 726b*3 - 8307b*2 - 19434b - 11880 = 0? -55/9, -2, -1, 36 Factor -2s4 + 68s*3 - 210s*2 - 7056s. -2s(s - 21)*2(s + 8) Factor 4r2 - 128000r + 1024000000. 4(r - 16000)2 Let 5u*2/3 + 1000u/3 - 75375 = 0. What is u? -335, 135 What is u in -u*3 - 464u*2 + 19115u + 19578 = 0? -502, -1, 39 Factor 3s3 - 30s*2 - 6837s. 3s(s - 53)(s + 43) Solve 45s*5/4 + 141s*4 + 747s*3/4 - 42s*2 - 99s = 0. -11, -6/5, -1, 0, 2/3 Find d, given that -2d5/15 + 18d*4/5 - 224d*3/15 + 24d*2/5 + 352d/15 = 0. -1, 0, 2, 4, 22 Factor 2i3 - 1502i*2 - 134624i - 133120. 2(i - 832)(i + 1)(i + 80) Determine y so that -2y*2/7 + 125392y/7 - 71648 = 0. 4, 62692 Factor 4l4/5 + 3924l*3/5 + 1121988l*2/5 + 5734124l - 19194719448/5. 4(l - 102)(l + 361)*3/5 Suppose 11t*5 - 1415t*4 + 48588t*3 - 193564t*2 - 76880t = 0. Calculate t. -4/11, 0, 5, 62 Factor 2f2 + 792f + 2358. 2(f + 3)(f + 393) Find b, given that 2b5/9 + 98b*4/9 + 698b*3/9 + 586b*2/3 + 164b = 0. -41, -3, -2, 0 Suppose -9p4 - 219p*3/5 + 4488p*2 - 119628p/5 + 15552/5 = 0. What is p? -27, 2/15, 6, 16 Suppose -6f5/11 + 246f*4/11 - 810f*3/11 - 23190f*2/11 - 75984f/11 - 4896 = 0. What is f? -4, -1, 17, 33 Factor m*3 - 12188m*2 - 24379m - 12190. (m - 12190)(m + 1)2 Solve -2x*4/5 + 26x*3 - 1522x*2/5 - 7858x/5 - 6204/5 = 0 for x. -3, -1, 22, 47 Factor 28j3 + 26352j*2 + 3732j - 30112. 4(j - 1)(j + 941)(7j + 8) Factor 25c2 - 13690c + 8205. 5(c - 547)(5*c - 3	{ "pile_set_name": "DM Mathematics" }
letters picked without replacement from {b: 2, h: 5}. Give prob of sequence bh. 5/21 What is prob of sequence vv when two letters picked without replacement from vvnvlvvvnlvv? 14/33 Calculate prob of sequence zy when two letters picked without replacement from xmjzyymj. 1/28 Three letters picked without replacement from vuvv. What is prob of sequence uvv? 1/4 What is prob of sequence cs when two letters picked without replacement from oxrsc? 1/20 What is prob of sequence kkd when three letters picked without replacement from fjkffkfdfffjjt? 1/1092 Calculate prob of sequence mmdd when four letters picked without replacement from {d: 3, m: 11}. 5/182 Three letters picked without replacement from {d: 2, h: 1, x: 2, q: 14}. What is prob of sequence qxd? 28/2907 Four letters picked without replacement from yaayddyaa. What is prob of sequence ayay? 1/42 Two letters picked without replacement from {l: 3, s: 1, v: 6, k: 1, b: 1}. Give prob of sequence vv. 5/22 Three letters picked without replacement from vvllvlllvv. Give prob of sequence vvv. 1/12 Two letters picked without replacement from qyhyhsyyqlyyyhmhqlq. What is prob of sequence mq? 2/171 Calculate prob of sequence ef when two letters picked without replacement from ehsuyfs. 1/42 Four letters picked without replacement from kkeceeckckefececkee. Give prob of sequence eefe. 7/1938 What is prob of sequence gg when two letters picked without replacement from wwgggwwgwwwwwggg? 7/40 Calculate prob of sequence gskg when four letters picked without replacement from gggkggsskgggg. 12/715 What is prob of sequence lp when two letters picked without replacement from {r: 10, l: 2, p: 6}? 2/51 Four letters picked without replacement from {l: 3, m: 1, z: 5, x: 6, n: 3}. What is prob of sequence nzxl? 1/272 Calculate prob of sequence zz when two letters picked without replacement from txxzxzzz. 3/14 Two letters picked without replacement from ihohozfzzzzzorrfhh. What is prob of sequence ff? 1/153 Two letters picked without replacement from {l: 1, n: 3, k: 2, s: 1}. What is prob of sequence nk? 1/7 What is prob of sequence ie when two letters picked without replacement from iieeeeee? 3/14 Calculate prob of sequence ysu when three letters picked without replacement from {y: 2, u: 6, s: 5}. 5/143 What is prob of sequence oajj when four letters picked without replacement from joojajojojojojojjooj? 9/1292 Calculate prob of sequence yv when two letters picked without replacement from {p: 2, v: 1, k: 2, y: 1}. 1/30 What is prob of sequence fxif when four letters picked without replacement from nxdxfiufufinfi? 3/1001 Four letters picked without replacement from {q: 2, g: 7, x: 3, a: 3, f: 1, r: 2}. Give prob of sequence xqga. 7/4080 What is prob of sequence wjq when three letters picked without replacement from {s: 1, w: 1, q: 2, j: 2, v: 1, c: 1}? 1/84 Two letters picked without replacement from fhhhhhhhhfh. Give prob of sequence ff. 1/55 Four letters picked without replacement from eexeex. What is prob of sequence xxee? 1/15 Calculate prob of sequence eew when three letters picked without replacement from {w: 1, e: 3}. 1/4 Four letters picked without replacement from {j: 6, i: 4, m: 5, o: 1}. What is prob of sequence mmmi? 1/182 Two letters picked without replacement from uuuuhuuuhuhuuuhuuuh. What is prob of sequence uu? 91/171 Calculate prob of sequence aa when two letters picked without replacement from aatytytity. 1/45 Three letters picked without replacement from {y: 2, k: 2, w: 1, o: 1, b: 1, f: 1}. Give prob of sequence fwy. 1/168 Calculate prob of sequence yy when two letters picked without replacement from yjdjdydyy. 1/6 Three letters picked without replacement from {u: 2, i: 1, j: 2}. Give prob of sequence iju. 1/15 Four letters picked without replacement from qqqqfqqqqqqqqff. What is prob of sequence qfqq? 11/91 Two letters picked without replacement from ozuzouuuzzuuzuuu. Give prob of sequence oz. 1/24 Three letters picked without replacement from iggigiggoo. Give prob of sequence ggg. 1/12 What is prob of sequence wnb when three letters picked without replacement from {w: 1, x: 2, n: 1, b: 2}? 1/60 What is prob of sequence dda when three letters picked without replacement from {e: 2, t: 2, a: 1, m: 2, f: 6, d: 4}? 1/340 Calculate prob of sequence mr when two letters picked without replacement from ggqfgqgmgqr. 1/110 Calculate prob of sequence sss when three letters picked without replacement from {d: 1, s: 19}. 17/20 Four letters picked without replacement from {j: 1, r: 2, n: 1, o: 2}. What is prob of sequence ronr? 1/90 Calculate prob of sequence emmm when four letters picked without replacement from {e: 3, m: 7}. 1/8 Three letters picked without replacement from {v: 5, u: 14, o: 1}. What is prob of sequence ovu? 7/684 Calculate prob of sequence gkl when three letters picked without replacement from {g: 1, p: 3, i: 1, l: 1, j: 2, k: 3}. 1/330 Calculate prob of sequence ah when two letters picked without replacement from {c: 2, f: 1, a: 1, h: 1}. 1/20 Three letters picked without replacement from zezezzzxxzxxzxzzzzz. Give prob of sequence xex. 20/2907 Calculate prob of sequence rrlr when four letters picked without replacement from rlrlrrrr. 1/7 Four letters picked without replacement from {g: 3, k: 2}. Give prob of sequence kggk. 1/10 What is prob of sequence ryl when three letters picked without replacement from rrrrrrrrylr? 1/110 Calculate prob of sequence qtsb when four letters picked without replacement from sqbggtt. 1/420 What is prob of sequence qya when three letters picked without replacement from {t: 2, x: 6, y: 1, q: 1, a: 3}? 1/572 What is prob of sequence ggl when three letters picked without replacement from {g: 3, w: 3, l: 1, d: 3}? 1/120 Three letters picked without replacement from hdhhnhn. What is prob of sequence nnd? 1/105 Four letters picked without replacement from dddddddddddhdhdddd. Give prob of sequence ddhh. 1/153 Three letters picked without replacement from rrirrrsrr. Give prob of sequence isr. 1/72 Two letters picked without replacement from {h: 1, p: 1, z: 1, y: 1, t: 1}. What is prob of sequence ht? 1/20 What is prob of sequence ym when two letters picked without replacement from {y: 1, u: 1, l: 1, m: 4, b: 2}? 1/18 Two letters picked without replacement from {f: 4, p: 7, y: 4}. What is prob of sequence ff? 2/35 Four letters picked without replacement from {z: 4, y: 6, q: 2}. Give prob of sequence qzzy. 2/165 Three letters picked without replacement from ssssshshshs. What is prob of sequence hsh? 8/165 Three letters picked without replacement from {f: 2, l: 2, v: 1, j: 1}. Give prob of sequence ljf. 1/30 Four letters picked without replacement from {a: 12, l: 7}. What is prob of sequence alal? 77/1292 What is prob of sequence fw when two letters picked without replacement from {e: 8, w: 1, f: 10}? 5/171 Calculate prob of sequence mo when two letters picked without replacement from vvvovvmmmvmvvvovov. 2/51 What is prob of sequence ytf when three letters picked without replacement from {f: 2, y: 1, l: 3, g: 2, t: 4}? 1/165 Four letters picked without replacement from mfqhfhhmmqmrmrhmvhr. Give prob of sequence qrqm. 1/2584 Three letters picked without replacement from ggyyxxxvxyyfqqvvqf. Give prob of sequence qxy. 1/102 Calculate prob of sequence daa when three letters picked without replacement from {a: 5, d: 7, b: 1}. 35/429 What is prob of sequence wu when two letters picked without replacement from {v: 3, w: 2, u: 4}? 1/9 What is prob of sequence bbb when three letters picked without replacement from bbbfbfgffb? 1/12 What is prob of sequence hss when three letters picked without replacement from {y: 2, l: 2, s: 4, i: 1, h: 5}? 5/182 Three letters picked without replacement from vxexvdddqxdqdixdvd. Give prob of sequence edx. 7/1224 Calculate prob of sequence mpm when three letters picked without replacement from phpmhpmmmmhh. 1/22 Four letters picked without replacement from {z: 10, w: 10}. What is prob of sequence zzww? 45/646 Three letters picked without replacement from {n: 4, t: 2, e: 1, i: 3, b: 2}. What is prob of sequence tte? 1/660 Three letters picked without replacement from {o: 3, i: 2, a: 5, e: 1, u: 4, c: 5}. What is prob of sequence oei? 1/1140 Calculat	{ "pile_set_name": "DM Mathematics" }
ided by 33? 12 What is the remainder when 10097 is divided by 22? 21 What is the remainder when 1351 is divided by 431? 58 What is the remainder when 50 is divided by 7? 1 Calculate the remainder when 56 is divided by 40. 16 Calculate the remainder when 33 is divided by 5. 3 Calculate the remainder when 2804 is divided by 85. 84 What is the remainder when 815 is divided by 63? 59 Calculate the remainder when 960 is divided by 189. 15 Calculate the remainder when 163 is divided by 32. 3 What is the remainder when 757 is divided by 29? 3 What is the remainder when 3777 is divided by 20? 17 Calculate the remainder when 201 is divided by 109. 92 Calculate the remainder when 242 is divided by 46. 12 Calculate the remainder when 178 is divided by 53. 19 What is the remainder when 114 is divided by 43? 28 Calculate the remainder when 322 is divided by 86. 64 Calculate the remainder when 93 is divided by 35. 23 Calculate the remainder when 363 is divided by 72. 3 Calculate the remainder when 139 is divided by 56. 27 What is the remainder when 252 is divided by 127? 125 What is the remainder when 754 is divided by 39? 13 Calculate the remainder when 51 is divided by 6. 3 Calculate the remainder when 494 is divided by 11. 10 What is the remainder when 14888 is divided by 12? 8 Calculate the remainder when 187 is divided by 60. 7 Calculate the remainder when 226 is divided by 23. 19 What is the remainder when 701 is divided by 59? 52 Calculate the remainder when 175 is divided by 39. 19 What is the remainder when 726 is divided by 110? 66 What is the remainder when 185 is divided by 64? 57 Calculate the remainder when 522 is divided by 7. 4 Calculate the remainder when 435 is divided by 90. 75 Calculate the remainder when 58 is divided by 33. 25 Calculate the remainder when 322 is divided by 87. 61 Calculate the remainder when 11429 is divided by 15. 14 What is the remainder when 170 is divided by 14? 2 Calculate the remainder when 4349 is divided by 14. 9 What is the remainder when 498 is divided by 95? 23 Calculate the remainder when 93 is divided by 48. 45 Calculate the remainder when 57 is divided by 16. 9 Calculate the remainder when 2204 is divided by 729. 17 Calculate the remainder when 1201 is divided by 101. 90 What is the remainder when 2584 is divided by 7? 1 What is the remainder when 271 is divided by 75? 46 Calculate the remainder when 387 is divided by 347. 40 Calculate the remainder when 4458 is divided by 93. 87 Calculate the remainder when 144 is divided by 97. 47 What is the remainder when 21028 is divided by 17? 16 Calculate the remainder when 346 is divided by 66. 16 Calculate the remainder when 266 is divided by 85. 11 What is the remainder when 108 is divided by 11? 9 Calculate the remainder when 88843 is divided by 15. 13 Calculate the remainder when 60 is divided by 36. 24 What is the remainder when 446 is divided by 28? 26 Calculate the remainder when 687 is divided by 10. 7 What is the remainder when 1869 is divided by 155? 9 Calculate the remainder when 93 is divided by 6. 3 Calculate the remainder when 324 is divided by 3. 0 What is the remainder when 3468 is divided by 8? 4 Calculate the remainder when 69253 is divided by 44. 41 Calculate the remainder when 462 is divided by 68. 54 Calculate the remainder when 2023 is divided by 9. 7 Calculate the remainder when 24 is divided by 6. 0 Calculate the remainder when 398 is divided by 37. 28 Calculate the remainder when 23 is divided by 5. 3 What is the remainder when 197 is divided by 54? 35 What is the remainder when 4190 is divided by 16? 14 What is the remainder when 17951 is divided by 68? 67 Calculate the remainder when 216 is divided by 20. 16 Calculate the remainder when 1632 is divided by 324. 12 Calculate the remainder when 1098 is divided by 20. 18 What is the remainder when 2643 is divided by 1309? 25 What is the remainder when 177 is divided by 76? 25 Calculate the remainder when 2414 is divided by 13. 9 What is the remainder when 888 is divided by 419? 50 What is the remainder when 268 is divided by 87? 7 Calculate the remainder when 107 is divided by 50. 7 What is the remainder when 1093 is divided by 138? 127 What is the remainder when 41 is divided by 15? 11 What is the remainder when 117 is divided by 24? 21 Calculate the remainder when 622 is divided by 4. 2 Calculate the remainder when 8899 is divided by 159. 154 What is the remainder when 780 is divided by 14? 10 Calculate the remainder when 123 is divided by 105. 18 What is the remainder when 1121 is divided by 7? 1 Calculate the remainder when 851 is divided by 107. 102 Calculate the remainder when 407 is divided by 23. 16 Calculate the remainder when 85 is divided by 38. 9 Calculate the remainder when 345 is divided by 167. 11 What is the remainder when 545 is divided by 90? 5 What is the remainder when 2950 is divided by 82? 80 Calculate the remainder when 23 is divided by 14. 9 What is the remainder when 267 is divided by 14? 1 What is the remainder when 246 is divided by 134? 112 Calculate the remainder when 466 is divided by 18. 16 Calculate the remainder when 1122 is divided by 125. 122 Calculate the remainder when 225 is divided by 5. 0 Calculate the remainder when 46 is divided by 14. 4 What is the remainder when 1303 is divided by 185? 8 Calculate the remainder when 259 is divided by 73. 40 Calculate the remainder when 368 is divided by 62. 58 What is the remainder when 193 is divided by 138? 55 What is the remainder when 177 is divided by 60? 57 What is the remainder when 388 is divided by 73? 23 What is the remainder when 84 is divided by 34? 16 Calculate the remainder when 1012 is divided by 216. 148 What is the remainder when 247 is divided by 152? 95 Calculate the remainder when 26 is divided by 10. 6 Calculate the remainder when 3887 is divided by 134. 1 Calculate the remainder when 96 is divided by 20. 16 Calculate the remainder when 203 is divided by 25. 3 What is the remainder when 53 is divided by 3? 2 Calculate the remainder when 1449 is divided by 12. 9 What is the remainder when 527 is divided by 163? 38 Calculate the remainder when 191 is divided by 140. 51 What is the remainder when 160 is divided by 50? 10 What is the remainder when 142 is divided by 18? 16 What is the remainder when 779 is divided by 141? 74 What is the remainder when 3811 is divided by 317? 7 Calculate the remainder when 476 is divided by 208. 60 Calculate the remainder when 97 is divided by 7. 6 What is the remainder when 243 is divided by 68? 39 What is the remainder when 87 is divided by 41? 5 Calculate the remainder when 1197 is divided by 75. 72 What is the remainder when 894 is divided by 242? 168 What is the remainder when 6114 is divided by 23? 19 What is the remainder when 44 is divided by 35? 9 What is the remainder when 354 is divided by 91? 81 Calculate the remainder when 530 is divided by 134. 128 What is the remainder when 100 is divided by 54? 46 What is the remainder when 1427 is divided by 65? 62 Calculate the remainder when 56 is divided by 17. 5 What is the remainder when 585 is divided by 192? 9 Calculate the remainder when 352 is divided by 8. 0 What is the remainder when 13665 is divided by 21? 15 Calculate the remainder when 68 is divided by 14. 12 Calculate the remainder when 10009 is divided by 28. 13 Calculate the remainder when 158 is divided by 24. 14 What is the remainder when 670 is divided by 24? 22 What is the remainder when 5745 is divided by 82? 5 Calculate the remainder when 494 is divided by 235. 24 What is the remainder when 156 is divided by 79? 77 What is the remainder when 2588 is divided by 118? 110 Calculate the remainder when 2397 is divided by 200. 197 What is the remainder when 16 is divided by 13? 3 Calculate the remainder when 449 is divided by 85. 24 What is the remainder when 86 is divided by 16? 6 Calculate the remainder when 40 is divided by 23. 17 Calculate the remainder when 64 is divided by 24. 16 Calculate the remainder when 1468 is divided by 724. 20 What is the remainder when 810 is divided by 8? 2 Calculate the remainder when 4055 is divided by 39. 38 What is the remainder when 558 is divided by 151? 105 What is the remainder when 19 is divided by 11?	{ "pile_set_name": "DM Mathematics" }
earest to -8 in 2, -2.5, 4, 0.5? -2.5 Which is the closest to -1? (a) 4/9 (b) -0.4 (c) 3452 (d) 0.5 b What is the nearest to -2/9 in 4, 1, -1/7, -0.5? -1/7 Which is the nearest to -1? (a) 2/3 (b) 2/9 (c) -0.3 c Which is the closest to 3? (a) -2/11 (b) -0.119 (c) -0.3 b What is the closest to -0.2 in 1/3, 0.2, -50, 4? 0.2 Which is the nearest to -0.04? (a) -5 (b) 8 (c) -0.03 c Which is the closest to 35? (a) -0.5 (b) -4 (c) -0.3 (d) 0.2 d Which is the nearest to 1? (a) -0.2 (b) 0.8 (c) -11 b Which is the closest to 7? (a) 2 (b) -2/9 (c) 0.4 (d) -4 a Which is the nearest to 1/4? (a) -1 (b) 0.1 (c) -16 b What is the nearest to -2 in 0.5, -2/13, -24, 0.1? -2/13 Which is the nearest to -0.1? (a) -56 (b) 2 (c) -2/5 (d) -0.2 d What is the nearest to -46 in 5, 1, -0.2, 0.5? -0.2 What is the nearest to 5 in -0.5, -0.2, -0.36? -0.2 What is the nearest to 5 in -1, 34, -0.1? -0.1 What is the nearest to 0 in 17, 2, -9? 2 Which is the closest to 15? (a) -0.2 (b) -2 (c) -7/4 a Which is the nearest to -2/7? (a) 2 (b) 14 (c) -1/6 c What is the nearest to 1/3 in 83, -5, 3, -1/3? -1/3 What is the closest to 3 in -49, 1, -1? 1 Which is the closest to 2? (a) -98 (b) 1/3 (c) -17 b Which is the closest to 0? (a) -0.2 (b) -5/9 (c) -0.5 a What is the closest to 2 in -2.3, -0.4, 4, 0.3? 0.3 What is the closest to -1 in -0.2, -3/4, -1, -6513? -1 What is the closest to -2 in -1/2, 4, -1/5? -1/2 What is the closest to -1 in 2, 1/7, 7/2? 1/7 What is the nearest to 0.1 in 34, 2/13, 2/17? 2/17 Which is the closest to -30? (a) 6 (b) 4 (c) 2/11 (d) 0.4 c What is the nearest to 5.5 in 0.39, -4/3, 4? 4 What is the nearest to 0.7 in 23, 3, -2? 3 Which is the closest to -1/4? (a) 0.042 (b) 0.5 (c) -1/21 c Which is the nearest to 2/3? (a) 0.2 (b) 1/11 (c) 23 a Which is the nearest to 3/5? (a) 2.6 (b) -3/2 (c) 0.3 (d) -1 c What is the closest to -2.8 in -1, 0, 0.11? -1 Which is the closest to 0? (a) 0.2 (b) 1/3 (c) 1/2 (d) -164 a Which is the closest to -0.25? (a) -2/7 (b) -2 (c) -59 (d) 3 a Which is the closest to 1? (a) 0 (b) -209 (c) 1 c What is the nearest to 2 in 5/6, 1, -41? 1 Which is the nearest to -1/6? (a) 1 (b) -17 (c) 2 (d) 0 d What is the nearest to -3 in -11/3, 0.48, 3/5? -11/3 Which is the closest to 0.1? (a) 0.063 (b) 0.5 (c) -1 (d) -3 a Which is the closest to -0.1? (a) -14 (b) 116 (c) -1/2 c What is the closest to -1/3 in -4, -3, -1/4, 1/14? -1/4 Which is the closest to 1/4? (a) -5 (b) 4 (c) -1/2 (d) 0.4 d Which is the nearest to -29? (a) 0 (b) -4 (c) -1 (d) -0.4 b Which is the nearest to -1/3? (a) 2.3 (b) 2/9 (c) -5 (d) 9 b Which is the closest to 0? (a) -1/7 (b) -0.8 (c) -5 a What is the closest to 0.4 in 0.5, -0.5, -2, -2/17? 0.5 Which is the nearest to -0.1? (a) -1/6 (b) 5 (c) -12 (d) 2 a What is the closest to 0 in -1, -4, -0.25, -3/4? -0.25 Which is the nearest to -4? (a) -108 (b) 2/5 (c) -2 c What is the closest to -2/7 in 0, -288, 2, 0.1? 0 What is the nearest to 0 in -2.3, -0.1, -1? -0.1 Which is the nearest to -1/5? (a) 2 (b) 0.2 (c) 2/9 b What is the closest to 3 in 0.2, -9/4, -3? 0.2 What is the closest to -0.3 in -0.5, 0.2, -4, 3? -0.5 What is the nearest to -1 in -9, 0.1, 0.22? 0.1 Which is the closest to 1/4? (a) 1/2 (b) 3/5 (c) 24 (d) -0.4 a What is the closest to 16 in -0.5, -0.3, 10? 10 Which is the closest to 8/3? (a) 2/5 (b) 2/11 (c) 1 (d) -0.1 c What is the closest to 8 in 5, -1, 1, 1/5? 5 What is the closest to 1/38 in 1/8, 2, -4? 1/8 Which is the nearest to 0? (a) -1/2 (b) -7/5 (c) 2/9 (d) 0 d Which is the nearest to -1/2? (a) 2 (b) -0.9 (c) 5 (d) 3/8 b Which is the nearest to -1/16? (a) 1/5 (b) 2 (c) 83 (d) 1 a Which is the closest to -56? (a) -32 (b) 4 (c) 0.5 (d) -3/5 a Which is the nearest to -0.6? (a) -3 (b) 2 (c) 1 c Which is the nearest to 1/4? (a) 2 (b) 1 (c) 0.053 c Which is the closest to -2.7? (a) 2/25 (b) 3/5 (c) 3 a Which is the closest to 0? (a) -3 (b) 0.2 (c) 4 (d) 0.06 d What is the closest to 1 in -20, 5, -5? 5 What is the closest to -2/3 in 2/5, 0, -227? 0 What is the closest to -1 in 3/4, 2.2, 1/2? 1/2 Which is the nearest to 1? (a) 0.06 (b) 1 (c) -0.4 (d) 4 b What is the nearest to 2 in 2, 0.3, 4? 2 What is the closest to -1.1 in 0.8, -1, 10? -1 What is the closest to 0.2 in -0.3, 1/3, -0.2, 0.22? 0.22 Which is the closest to -879? (a) -2/3 (b) 4 (c) -0.5 a What is the closest to 0.1 in -0.002, 2/9, -3/4, -4/9? -0.002 What is the nearest to -0.7 in -24, -1/5, 2/17? -1/5 Which is the nearest to 1/3? (a) 2 (b) -1/5 (c) 0.07 c What is the nearest to 1/4 in -3, -4001, -1/11? -1/11 Which is the nearest to -1? (a) 0.2 (b) 0.3 (c) -2/7 (d) 0.06 c What is the closest to 0.1 in 4, 5/7, -5? 5/7 Which is the closest to 0.3? (a) 1 (b) 69 (c) -27 a Which is the nearest to 1? (a) 21/2 (b) -5 (c) -3/5 (d) -0.3 d What is the nearest to -6.8 in -0.4, -2, 2/5? -2 Which is the nearest to 2? (a) -1 (b) 2 (c) 0.1 b Which is the nearest to 24? (a) -0.5 (b) -5 (c) 0 (d) 2 d Which is the closest to -2? (a) -0.5 (b) -3/8 (c) 1 (d) 0.34 a What is the closest to 0 in -1/2, -5, -1, -17? -1/2 Which is the closest to 1? (a) 0.2 (b) -2/617 (c) 4 a What is the nearest to 1 in 4/3, 0.1, -9/2, -1? 4/3 Which is the nearest to -2/3? (a) -1/10 (b) -5 (c) 3/4 (d) 0 a Which is the closest to -7/10? (a) 4 (b) 0 (c) -1 (d) 1/5 c What is the nearest to -13/5 in 0.4, 0.2, 2/33? 2/33 Which is the nearest to -4? (a) -2 (b) 4 (c) 0.5 (d) 3 a What is the nearest to -0.2 in -0.1, 1, -1.1? -0.1 What is the nearest to 1 in -3, -1, -14, 0? 0 Which is the nearest to -1? (a) 0.3 (b) -0.1 (c) -341 b Which is the closest to -1? (a) -1 (b) 5 (c) 0 (d) 6 a Which is the closest to 1/3? (a) -0.1 (b) 13/3 (c) -19 a What is the nearest to -3 in 4, -1, 1, -2? -2 Which is the closest to 24? (a) -2/15 (b) -2/9 (c) 0 (d) 5 d Which is the closest to -9? (a) -4/3 (b) -8 (c) 1 b Which is the closest to 0.2? (a) 6/7 (b) 4 (c) -9 a Which is the closest to 1? (a) -5 (b) 0.3 (c) 5 (d) -0.04 b What is the nearest to -5 in -2, 1/5, -3? -3 Which is the closest to -2? (a) 0 (b) 5 (c) 3 (d) -3/8 d What is the closest to 1/4 in 2, -2/13, -2? -2/13 What is the nearest to -6 in -1/13, -5, -1/2? -5 Which is the nearest to -0.1? (a) 5/4 (b) -4 (c) -3 (d) 0.015 d Which is the nearest to -2/3? (a) -0.2 (b) 153 (c) 2/7 a Which is the closest to -2/3? (a) 2/11 (b) -0.4 (c) 11 b Which is the nearest to -1? (a) -2/7 (b) -2 (c) 5/3 a Which is the closest to -2/7? (a) 455 (b) 4 (c) -2/9 (d) 0.2 c What is the closest to -1/22 in 4, -5, 5? 4 What is the nearest to -1/4 in 17, 1/6, -2, 3? 1/6 What is the closest to -0.1 in 74, 10, 0.2, 0.1? 0.1 What is the closest to -0.1 in 4, 67/4, 1/4, 5/3? 1/4 What is the closest to 1/3 in 4, 0.3, 2/15, 8? 0.3 What is the nearest to 6 in -0.3, -3, 0, -4? 0 Which is the nearest to 0.3126? (a) 1/5 (b) 0.1 (c) -2 a What is the closest to -1 in -2/7, -7/58, 1, 4? -2/7 What is the closest to -10 in -0.4, -0.8, 2? -0.8 Which is the nearest to 2/19? (a) -1 (b) -5/2 (c) -0.4 (d) -2 c What is the nearest to -2/3 in 0, 2/11, -3/2, 6/19? 0 What is the closest to 0 in 1, -0.5, 1.2? -0.5 Which is the closest to -1/4? (a) -1 (b) -2/9 (c) 0.7 b Which is the nearest to 21? (a) -0.3 (b) 1/15 (c) -3 (d) 1/3 d What is the nearest to 0 in 0, -0.22, 0.4, 2/15? 0 Which is the closest to 0.29? (a) 5/2 (b) 1 (c) 0 (d) -2/17 c Which is the closest to -2/9? (a) 1 (b) -0.14 (c) -0.1 (d) 0 b What is the nearest to 1 in -22, -2, 0.01? 0.01 What is the nearest to 3 in -18, -1/5, -3? -1/5 Which is the closest to 2/7? (a) -4 (b) -0.01 (c) -0.2 (d) 3/5 b What is the nearest to 2/3 in 4, -5, 1.4, -1/2? 1.4 Which is the nearest to 2/3? (a) 3/11 (b) -8 (c) 3 (d) -3/7 a What is the closest to 0.2 in -32, -5, -2? -2 What is the nearest to -0.1 in -5, 0.3, -1/6, -6? -1/6 What is the closest to -2 in 3/8, 0.5, -3, -2? -2 What is the closest to 0.2 in -3, -2, 0? 0 Which is the closest to -4/19? (a) -1 (b) -4 (c) 4 a What is the closest to -5 in 2/5, 1, 0.05? 0.05 Which is the closest to -1/3? (a) 7 (b) -1 (c) 4 (d) 1/7 d What is the closest to -0.	{ "pile_set_name": "DM Mathematics" }
*3 + 2y*2 - 2y + 3. Let d be t(2). Let f = -2961 + d. Let a = 4298 - f. Round a to the nearest one thousand. 2000 Let p = -4 + -9. Let q = 11.2 + p. Let g = q + 1.7999984. What is g rounded to six dps? -0.000002 Suppose 0 = -15l + 10 + 4685. Round l to the nearest ten. 310 Let s = -0.91 + 0.17. Let o = s + 0.7484. Round o to 3 dps. 0.008 Let q = 683 + -702.455. Let m = -0.045 + q. Round m to the nearest integer. -20 Let v = 2.1 + 143.9. Let i = v + -146.0174. Round i to three dps. -0.017 Let j(s) = -3s - 7. Let a be j(-27). Let k = 81 - a. Round k to the nearest 10. 10 Let m = 24.6 + -29.29. Let n = 3.43 - m. Round n to the nearest integer. 8 Let w = -221.2 - -30.2. Let v = w + 121. Let l = 70.00000098 + v. What is l rounded to 7 decimal places? 0.000001 Let u = -274457 + 195322. Let p = u - -45235. What is p rounded to the nearest 1000? -34000 Let f = -967 + 967.0000445. What is f rounded to five dps? 0.00004 Let p = -0.5 + 0.66. Let g = 0.09 + p. Let f = g + -0.2500038. Round f to 6 dps. -0.000004 Let t be 12/(-5)55/(-22) + -2. Suppose 3n + 263988 = -2f, -tf + 5n + 659980 = -9f. Round f to the nearest ten thousand. -130000 Let p = -39.696 + 40. Let w = 0.52 + p. Round w to two decimal places. 0.82 Let v = 30.3 - 32. Let z = v - -1.7074. What is z rounded to 3 decimal places? 0.007 Let a = 93.000381 - 93. What is a rounded to 4 decimal places? 0.0004 Let i = 282 - 290.9. What is i rounded to the nearest 10? -10 Let i = -292 - -292.0000611. Round i to five dps. 0.00006 Let a = -39300207405 + 39300574599.00186. Let g = a + -367191. Let i = 3 - g. What is i rounded to four decimal places? -0.0019 Let j = -0.098 - -0.059. Let y = j + 0.03900055. What is y rounded to six dps? 0.000001 Let n = -11695.1 - 42710.9. Let o = 54405.946902 + n. Let m = 0.053 + o. Round m to five dps. -0.0001 Let u = 0.09 + -0.045. Let v = u + -6.245. Round v to the nearest integer. -6 Let h = -1275132.400004 + 1275135. Let p = -2.6 + h. Round p to 5 decimal places. 0 Let o = 1723114 - 1723157.00115. Let v = -228 - -185. Let n = o - v. Round n to 4 decimal places. -0.0012 Suppose -5c + 22033163 = -4074802. Suppose 0 = p + 1021593 - c. Round p to the nearest 1000000. 4000000 Let m = -0.07 + -5.08. Let c = 0.15 + m. Let n = c - -5.00000001. What is n rounded to 7 dps? 0 Let s(f) = 3f3 - f2 - 6f + 11. Let n be s(10). Let y = n - 1484. Suppose 0 = -r + h + y, -4r = 2h - 2743 - 2743. Round r to the nearest one hundred. 1400 Let x = -4347.6339 - -4348. Round x to 2 dps. 0.37 Let p(m) = 3683331m - 14. Suppose 0 = -5d - 4z - 36, 5d = 3z - 4 - 4. Let c be (-2)/((d/(-12))/1). Let y be p(c). What is y rounded to the nearest 1000000? -22000000 Let v be (-6030/9)/((-3)/89850). Round v to the nearest one million. 6000000 Let r be 856400((-65)/(-39))/((-5)/150). What is r rounded to the nearest 1000000? -43000000 Let h = 69.6 - 69.6337. Round h to three decimal places. -0.034 Let x = 5813.01 - 249182.01. Let q = x + 243510.057. Let d = q - 141. Round d to 2 decimal places. 0.06 Let a = 41837 + -41833.89976. Let c = a + -3.1. What is c rounded to 4 dps? 0.0002 Let u = -431 - -661. Round u to the nearest 100. 200 Let c = -4255 + 10756. Let v = c - 4102. Suppose 2i - 301 = v. What is i rounded to the nearest one hundred? 1400 Let n = -0.0256 - -0.024898. What is n rounded to five dps? -0.0007 Let o(s) = 38512s - 2. Let g be (1 + 1)/((-10)/(-25)). Let f be o(g). Let c = -122558 + f. Round c to the nearest ten thousand. 70000 Let b = 1991 - 1914.82. Let s = b + -77. Round s to one dp. -0.8 Let l(h) = 2h. Let d be l(2). Let p be -7 + d - (-1 - 4). Suppose 25 + 23 = pi. What is i rounded to the nearest 10? 20 Suppose 0 = 2g + 5g + 685398. Let q = g + 55914. Round q to the nearest 100000. 0 Let k = -916 + 926.78. What is k rounded to 0 decimal places? 11 Let z = -395319810.500879 - -395321641.5. Let o = z - 1831. What is o rounded to four dps? -0.0009 Let l = -3122.546 + 3120. Round l to 1 dp. -2.5 Let d = 1535171 - 442840. Suppose d = 4r - 83669. Round r to the nearest 10000. 290000 Suppose 2f - 2 = 0, -177409 = -3t + 2f + 422595. Suppose 4a + i = -399998, 0 = 2a - 5i + 4i + t. What is a rounded to the nearest ten thousand? -100000 Let g(f) = -f*3 - 23f*2 - 5f + 7. Let k be g(-23). Suppose -ks = -120s - 34800000. What is s rounded to the nearest 1000000? 17000000 Let c = 3.2165 - 3.2. Round c to two decimal places. 0.02 Let r = 724084375 - 724084339.99999966. Let h = r + -35. Round h to 7 decimal places. 0.0000003 Let s = 1228203 - 207361. Suppose 2119157 + s = -2v + t, 3v + 4709999 = t. What is v rounded to the nearest 100000? -1600000 Let x = -4.69 - -4.6651. Round x to 2 dps. -0.02 Let d = 23379040 + -23379049.0000045. Let y = d + 9. What is y rounded to 6 dps? -0.000005 Let p = 8101 + -1391. Round p to the nearest 100. 6700 Let g = -491231 + 491194.8837. Let a = -36.1 - g. What is a rounded to three dps? 0.016 Let k = 396 + -396.000433. Round k to five dps. -0.00043 Let f = -8 - -10. Let u be (-1416)/(-9)(f + 1). Let j = 212 - u. What is j rounded to the nearest 100? -300 Let p = -0.95605898 - 148.7619959. Let d = p + -3.28187412. Let f = -153 - d. Round f to five decimal places. -0.00007 Let a = 102.86 - 103. Let j = a + 0.1184. Round j to 3 decimal places. -0.022 Let w = -0.06 - -0.092. Let i = 1770442.03199796 - 1770442. Let h = w - i. Round h to seven dps. 0.000002 Let j = -193 - -194.27. Let w = 82.27 - j. Let r = w - 80.43. Round r to one dp. 0.6 Suppose 9l + 1 + 188 = 0. Suppose -3h = -65 - 19. Let i be (-240800004)/h - 3/l. Round i to the nearest one million. -9000000 Let q = 141.47 - -1.53. Let w = q - 143.00153. What is w rounded to 4 decimal places? -0.0015 Suppose 5k - 5j = -2j + 30, 4k + 3 = -3j. Suppose kf - 19 = 5. Suppose fu + 36 = -4. What is u rounded to the nearest ten? -10 Let r = -0.0584 - -0.05621. What is r rounded to 4 dps? -0.0022 Let d = 0.38859 - 0.395. Round d to three dps. -0.006 Let b = 0.1526 - 1.6386. What is b rounded to one decimal place? -1.5 Suppose p = -179654 + 38854. What is p rounded to the nearest ten thousand? -140000 Let w(i) be the second derivative of -145i3/6 + 3i*2/2 + 5i. Let a be w(-4). Suppose -a = -3j + 317. What is j rounded to the nearest 1000? 0 Let i(w) = w2 - 11w + 12. Let a be i(10). Suppose -2x - ax = -f + 18003, 0 = 4x - 2f + 17998. Let d be 12/18 + x/3. Round d to the nearest 1000. -2000 Let u be (-69)/46 + (6413985/(-6) - 1). Round u to the nearest 100000. -1100000 Let o be (1 - 4492)/(3/(-2505)). Suppose 0 = -127x + 95x + 47999616. Suppose 4i + x = -2l, -5l = 4i + i + o. Round l to the nearest one hundred thousand. -800000 Let r = -39.1999619 + 39.2. What is r rounded to six decimal places? 0.000038 Let b = -2267.001367 + 2267. Round b to 5 dps. -0.00137 Let j = -956440.7853 + -70.2147. Let i = j + 956511.2000019. Let p = 0.2 - i. Round p to six dps. -0.000002 Let k = 152760.5099 + -152884.5. Let p = 124 + k. Round p to 3 dps. 0.01 Suppose -3r = -4z + 4r + 8403, 4z - 8391 = -5r. What is z rounded to the nearest one thousand? 2000 Let j = -209321.154768 - -209319. Let t = j - -4.4547. Let u = t + -2.3. What is u rounded to 5 decimal places? -0.00007 Let r = -757 - 1128. Let j = r - -3585. What is j rounded to the nearest one thousand? 2000 Let o = -2.7199002 - -2.72. Round o to 5 dps. 0.0001 Let t = 1854 - 1869.82. Let y = t + 15.821021. What is y rounded to 4 dps? 0.001 Let k = 54750.3837 - 13534.0368. Let o = 41239 - k. Let a = 0.0469 + o. What is a rounded to the nearest integer? 23 Let p = -3122607495.9999554 - -3122606998. Let n = 498 + p. Round n to six dps. 0.000045 Let q = 0 - -2. Let s be -259351 - (18/3 - q). Let b = s - -68355. Round b to the nearest 10000. -190000 Let z = -207109614465 - -207109612619.00001558. Let g = 1846 + z. Round g to six decimal places. 0.000016 Let h = -209476347 + 209476335.39999865. Let z = -11.6 - h. Round z to seven dps. 0.0000014 Let y = -6.597 - 0.003. Let m = 3.5 + y. What is m rounded to the nearest 10? 0 Let h = 1 - -4. Suppose 0 = x - 3w - 5, 2x + hw = -0 - 1. Suppose -xm = -0m - 3800. Round m to the nearest one hundred. 1900 Suppose 46868 = 3a + 10559. Suppose 2x - 16385 = 22621. Let c =	{ "pile_set_name": "DM Mathematics" }
+ 4p - 50. What is the lowest common multiple of 2022 and t? 10110 Let c = 23 + -14. Suppose 3f - 2k - 12 = c, f + 2k = 15. Let p = 10 - f. What is the least common multiple of 9 and p? 9 Let m(i) = -i*2 - 77i - 596. Calculate the smallest common multiple of 2392 and m(-9). 4784 Suppose 2q = -707 + 755. What is the lowest common multiple of q and 524? 3144 Let b = -1340 - -1370. Calculate the least common multiple of b and 1/(0 - -1) + 39. 120 Let q = 1421 - 653. What is the smallest common multiple of 288 and q? 2304 Suppose -2c + 4q = 2416, -2c = 2c + 3q + 4854. Let v = c - -10886/9. What is the common denominator of v and 28/117? 117 Let j(l) = -l*3 + 15l*2 - 13l - 4. Suppose -3x - 4u = -u - 30, 0 = x - 5u - 34. Calculate the least common multiple of 692 and j(x). 3460 Suppose -2z = 0, 2834 = -5y - z + 7994. Calculate the least common multiple of y and 42. 7224 Let p = -4271/54 + 503/6. Let y = p - 1504/135. Find the common denominator of (-2)/(-3) + (-130)/(-15) and y. 15 Let d(k) = -133k - 924. Let x(h) = -h*2 - 4h + 5. Let b be x(-4). Suppose -bt + 0t + 15 = 0. Calculate the lowest common multiple of t and d(-7). 21 Suppose 55n + 54 = 37n. What is the common denominator of (n174/184)/9 and 6/7? 966 Let u = 14859 + -14805. Let o = -10 + 22. What is the least common multiple of u and o? 108 Let f = -16970331/40 + 424260. Let l = -7/1039 + 63645/39482. Find the common denominator of f and l. 760 Suppose -4u = -2t + 98, 2u + 1 + 99 = 2t. Let o = 109 + t. Let v = 113 + -105. Calculate the least common multiple of v and o. 160 Let z be ((-2)/40)/(66/(-895312)). Let o = -680 + z. Find the common denominator of ((-362)/18)/(20/6) and o. 30 Suppose -155y + 18y = -16y - 65219. What is the least common multiple of y and 6? 3234 Let g be 1(-12)/921/(-14). Suppose -5d + 312 = 3l, 7l = d + gl - 40. Calculate the lowest common multiple of 12 and d. 60 Find the common denominator of 63/20 and (-951)/32334(0 + 3/(-4)). 680 Let h = 1 - -13. Let m = -11957 - -12119. What is the least common multiple of h and m? 1134 Suppose -97 + 16 = -3c. Let o = -23 + c. Suppose os - 15 = 3r, 2r - 15 = -3r. What is the smallest common multiple of s and 10? 30 Let q = -805 - -2375. What is the least common multiple of 90 and q? 14130 Calculate the smallest common multiple of (-4)/(-14 - (-4398)/315) and 294. 1470 Suppose -9y - 3675 = -16y. Suppose -12n + y = 3n. Calculate the lowest common multiple of 55 and n. 385 Suppose s + 20 = -2q, -2q + 4s = -q + 10. Let x be (1/q)/((-6)/(-3594)). Let b = -306/5 - x. What is the common denominator of 83/34 and b? 170 Suppose -182 = -4g + 130. Suppose -3462c + 3467c - 148 - 2 = 0. What is the lowest common multiple of g and c? 390 Calculate the common denominator of 35/9 and 3/(2430/(-168)) + 6 + (-26)/5. 27 Let u(k) = -138k + 4. Suppose 3q - 7q + 26 = 3i, -3i - 14 = -4q. Calculate the lowest common multiple of q and u(-1). 710 Let j = -38632 - -44420. What is the lowest common multiple of j and 4? 5788 Let r = 7847/780 + -401/40. What is the common denominator of -133/72 and r? 936 Let f = 10102 - 727385/72. What is the common denominator of f and -2 + (-104)/(-27) - 1? 216 Let d = -10202 + 10676. What is the lowest common multiple of d and 158? 474 Let a be 5 - (2/1 - -3). Let d be (-19 + a)/(5/5) + -1. Let q = 41 + d. Calculate the least common multiple of q and 6. 42 Let m = -76 + 66. Calculate the common denominator of (-708)/360 - (-2)/m and 91/12. 12 Let i = -27 - -29. Suppose 2s + 5b + 10 = 7s, ib - 6 = -3s. What is the common denominator of 57/44 and s/64(-1608)/18? 264 Let i(d) = d3 + 15d*2 + 9d + 7. Let f be i(-7). Suppose -f + 2100 = 14m. Calculate the least common multiple of 126 and m. 126 Let n(g) = -2g*2 - 51g + 107. Calculate the lowest common multiple of n(-25) and (-3 + 0 - (-1 - 1)) + 13. 132 Let a = -305 - -2663. What is the least common multiple of 51 and a? 40086 Let i = 24664285940981/6606 + -3733618815. Let y = 66/367 + i. Find the common denominator of 61/3 and y. 18 Suppose 2w + 15v - 18v - 39 = 0, 0 = -5w + v + 65. What is the least common multiple of 48 and w? 48 Suppose 35o - 15732 = 8o + 6543. Calculate the lowest common multiple of 9 and o. 2475 Let a be 5 + ((-20)/6)/((-609)/(-882)). Let d = a - -2044/87. Find the common denominator of 0 - (66/(-14) + 0) and d. 21 Let n = -2923 - -2933. Let k = 7 - 3. Let m = n - k. Calculate the lowest common multiple of m and 6. 6 Suppose -w = -6w + 140. Let s = 930 - 833. Suppose 9j - 223 = -s. Calculate the lowest common multiple of w and j. 28 Let m = -134 + 142. Suppose m + 42 = 4i - v, -v = 2. Suppose i = -3f + 5f. Calculate the lowest common multiple of 2 and f. 6 Let m be (6 - 3)3/(-9). Let u be (-3497)/(-36) + m + 23/69. Let k = 377/4 - u. Find the common denominator of k and 8/13. 117 Let s = 34504100503331/7508 - 4595644689. Let i be 1/1877(-26 + 25). Let a = s + i. Calculate the common denominator of a and 1/2. 4 Let n be 4 - (7 - 3) - -15. Suppose 0y - n = -l + y, 5l + 5y - 85 = 0. What is the smallest common multiple of l and 112? 112 Let q = 176071/16 + -11000. Find the common denominator of q and (114/(-380))/(1044/(-2670)). 464 Let x = -206 - -461. Suppose 0 = 24l - 51l + 162. What is the least common multiple of l and x? 510 Let t(b) = 244b - 69. Let i be t(-3). Calculate the common denominator of (3/(-14))/((-135)/i) and 58/63. 630 Let o be -8(-1)/2 + 3 + -1. What is the smallest common multiple of 2(15/o + -2)30 and 10? 30 Suppose 62 = -8m - 178. Let v = -40 + m. Let x = 71 + v. What is the lowest common multiple of x and 7? 7 Let p = -5325 - -5517. Calculate the least common multiple of p and 9. 576 Suppose -4g - 5f = -93, 2f - 107 = -5g + 5f. Suppose -11d = 1688 - 5285. Suppose -5c + 73 + d = 0. Calculate the lowest common multiple of g and c. 880 Let c = 497/690 - -2/1035. Let r(m) = -1234m2 + 2m - 10. Let z be r(4). Let v = 789899/40 + z. What is the common denominator of c and v? 360 Let f = 1431 - 1255. What is the smallest common multiple of 220 and f? 880 Suppose -434 = -2w - 0o - 4o, -3w + 649 = 4o. Let x = 243 - w. Find the common denominator of x and -61/68. 68 Let x = -10454 + 10530. Calculate the least common multiple of x and 44. 836 Let s(w) = 3w + 48. Let f be s(-16). Suppose 3z + 2l = 7z - 14, f = z - l - 5. Calculate the lowest common multiple of 9 and z. 18 What is the least common multiple of ((-1480)/(-24) - -2)((-21)/7 - -9) and 16? 3056 Let w be ((-4)/(1080/(-144366)))/(2/(-5)). Let r = -1336 - w. Let q = 837665/28 + -29920. What is the common denominator of r and q? 252 Suppose 4l = 19611 + 1977. Let i = l - 53923/10. Calculate the common denominator of i and -19/20. 20 Let s be (2/(-464))/(155/240622). Let j = 101/58 + s. Find the common denominator of (-1)/3 - (-537)/234 and j. 260 Suppose 5t + 2z = 0, 0t - 4t = -z. Let u(x) = -2x + tx - 2x - 7x. Calculate the smallest common multiple of u(-2) and 20. 220 Let p = -11945537 + 238989983/20. Let s = -3964 + p. Let r = -2424/5 + 28333/60. What is the common denominator of r and s? 60 Let u = 1649 - 103892/63. Let t = u - 1157/504. Calculate the common denominator of t and 67/4. 8 Suppose -h + 3s = -0h - 1, 0 = -2h - s + 16. Let n be (-67216)/h + 18/63. Let c = n + 249615/26. Find the common denominator of -127/6 and c. 78 Suppose 7u - 280 + 210 = 0. Let p(b) = b3 - 15b*2 - 15b - 17. Let y be p(16). Calculate the smallest common multiple of ((-21)/14)/(y/6) and u. 90 Calculate the common denominator of -81/16 and 217935/804228 + (-2)/8. 36976 Let s = 7549 - 7532. Let z = 21 - 14. What is the lowest common multiple of z and s? 119 Let d(i) = i*3 - 38i*2 - 74i - 220. Calculate the lowest common multiple of 1015 and d(40). 4060 Let p = 5243/12 + -436. Calculate the common denominator of ((-208)/96)/((-92)/(-2)) and p. 276 Suppose 3m - 397 + 149 = -2x, -5m + 396 = -x. Suppose 0 = 10302u - 10297u - 10, n = 7u + 66. Calculate the smallest common multiple of m and n. 80 Let d be 0/((-6)/3)-1. What is the lowest common multiple of 24((-1)/(-2) - d) and (-1)/(-1)1 + (160 - 143)? 36 Let l be (48/112 - (-142)/(-70))10. What is t	{ "pile_set_name": "DM Mathematics" }
fourth biggest value? (a) -887 (b) 8/17 (c) 0.05 (d) -8 a What is the seventh biggest value in -0.03, -5, 5/2, 11, -20, 3, 4? -20 Which is the second smallest value? (a) 15791 (b) 1 (c) 108 c What is the smallest value in -0.23, -5344/9, -3, -26? -5344/9 Which is the fourth biggest value? (a) 2 (b) 1/3 (c) -0.06 (d) 2/9 (e) -3310 (f) 4/3 d What is the third biggest value in -5, 0, -1/3, 2, 1/81, 798, -0.5? 1/81 What is the fifth biggest value in 20054, -3, 1, -2/9, 0.59? -3 Which is the third smallest value? (a) -72 (b) 1/5 (c) -0.215 (d) 10 b What is the biggest value in 0.3, -1, -2/13, -607, -2, -2/7, 7? 7 Which is the second smallest value? (a) -0.29295 (b) 6 (c) -0.17 c What is the fourth biggest value in -0.4, -742/135, -2, -1/9? -742/135 Which is the fifth smallest value? (a) 15.6533 (b) 3/10 (c) 2/5 (d) -5 (e) -3 a What is the biggest value in -0.4, 61.12, 73.4, 0.4, 0.03? 73.4 Which is the fourth smallest value? (a) 4/3 (b) -3 (c) -6/3545 (d) 8 d Which is the fourth smallest value? (a) -0.001 (b) -0.15 (c) -1/5 (d) 2.73 (e) 0.3 (f) 2 e What is the second biggest value in -433, -4, 2, -0.4, 0.1, -8/13? 0.1 Which is the second biggest value? (a) 3 (b) 330 (c) 395 (d) -3/5 (e) -0.4 (f) 0 (g) 0.3 b Which is the biggest value? (a) 1 (b) 83783 (c) -151 (d) 7 b What is the third smallest value in 5/6, -69662, 19.99? 19.99 Which is the sixth smallest value? (a) 35 (b) -4 (c) -280 (d) 48 (e) 0.2 (f) 1 d Which is the biggest value? (a) 0.0017 (b) -0.21 (c) -64 (d) 4 (e) 2/3 (f) 1/7 d Which is the second biggest value? (a) -314 (b) 1 (c) -0.4 (d) -1/3 (e) 2/10313 e Which is the fifth smallest value? (a) -0.4 (b) 4 (c) 55 (d) 1491 (e) 4/3 (f) -4 c What is the third smallest value in -21/13, 1135.41, 0? 1135.41 Which is the fourth smallest value? (a) 3 (b) -9260 (c) 176 (d) 9/10 c What is the second smallest value in -39.65, -1/8, 6, -4? -4 Which is the fifth smallest value? (a) -702.6 (b) -32/5 (c) 14.9 (d) 4 (e) 1/4 c Which is the third smallest value? (a) 97116.6 (b) -0.3 (c) -1 (d) 2/195 (e) 0.4 d Which is the third biggest value? (a) 0.9 (b) -14/13 (c) 2 (d) -0.23 d What is the second biggest value in -3/2, 9361/1821, 0.2? 0.2 Which is the second biggest value? (a) -0.234 (b) -5 (c) -37 (d) -0.7 (e) 1 (f) -73 a Which is the second biggest value? (a) -0.05 (b) -0.5 (c) -13 (d) -3/2 (e) -0.0677 e What is the third biggest value in -6, 18/170267, 0.1? -6 Which is the seventh smallest value? (a) -3 (b) 2/7 (c) 0.5 (d) 74 (e) -23.5 (f) -0.3 (g) 118 g Which is the third smallest value? (a) 5 (b) 3 (c) 4 (d) 5769626 a What is the third biggest value in -3, -0.167, -1, 19, 5, -0.4? -0.167 What is the smallest value in 2, 8.87, -5, -0.5, -2/787, -0.02, 0.4? -5 Which is the fourth smallest value? (a) 17 (b) 0.3 (c) 146 (d) -3732 c Which is the smallest value? (a) 6053017 (b) -3/2 (c) -1 b What is the fifth biggest value in -0.04, -0.6, -604/19, 0.09, 5? -604/19 What is the second smallest value in -14, 0.2, -0.036, 5/3, -0.4? -0.4 Which is the third biggest value? (a) -0.18 (b) -1/2 (c) -4689107 c What is the second biggest value in 0.321, 3, -2, 2, 4.4, -1? 3 What is the smallest value in 156, -1/4, 3, 2/23, 7586? -1/4 Which is the biggest value? (a) 71 (b) 2 (c) -2 (d) -1/6 (e) 8 (f) -20 a What is the second smallest value in 2833, 3/2, 2258? 2258 What is the second biggest value in -2/5, 148/35, -394.7? -2/5 Which is the smallest value? (a) 1/5 (b) -0.309 (c) -39.97 c What is the smallest value in 0, -2, -1/7, -9/5, -913, -5, 0.5? -913 Which is the smallest value? (a) 1/6 (b) 31404 (c) -601 c What is the third smallest value in -653, -1243, -5/3, 3? -5/3 Which is the fourth smallest value? (a) 2/13 (b) 0.4 (c) 0.1 (d) 0.2 (e) 58 (f) -1 d Which is the biggest value? (a) 12 (b) -4 (c) -0.06538972 (d) 2 a What is the third smallest value in -6, 1, 2/35, 4193? 1 Which is the third smallest value? (a) 5 (b) -0.4 (c) 87 (d) -0.02 (e) -137 d What is the fourth smallest value in 231, 2/265, -1/4, 0.1, -3, -5, -12? -1/4 Which is the fourth smallest value? (a) 1/3 (b) 2/13 (c) -5 (d) -11/2 (e) -2/31 (f) -261 e Which is the third biggest value? (a) 6 (b) 224 (c) 0.5 (d) 1.1745 (e) -0.3 d What is the third smallest value in -0.2, 304, 0.06, 4, -5, -0.3? -0.2 Which is the second smallest value? (a) 7905273 (b) 0.3 (c) -2 b What is the second biggest value in 0.032, 5.33, 17, -0.2? 5.33 What is the fourth biggest value in -74/17, -4/7, 7/3, 0.66, -2? -2 What is the fourth biggest value in 0.73, 0.02, 0.4, -5, -0.4, 463? 0.02 What is the seventh smallest value in -14/31, 0, 2/5, 3/8, -0.1, 8.3, 6? 8.3 Which is the third biggest value? (a) 1.002 (b) -4 (c) -0.1 (d) 1.999 c Which is the fourth biggest value? (a) 0.258 (b) -15 (c) 2.5 (d) 2/3 (e) 13 a Which is the third smallest value? (a) -272019 (b) 8 (c) 2/9 (d) -0.4 (e) -2/13 (f) 5 e What is the fifth smallest value in 0.5, -163, 2, 62, -2, -5/9? 2 Which is the biggest value? (a) -20 (b) 0.5 (c) -0.1 (d) 0.3 (e) -2163 b Which is the second biggest value? (a) 5/4 (b) -0.2 (c) -1/9 (d) -1/3 (e) -1600 c Which is the third biggest value? (a) -2/139 (b) -6 (c) 98.3 (d) 2/9 (e) 5 (f) 1/5 d What is the biggest value in 1173, -2/3, 0.5, 0.2, 114? 1173 What is the third smallest value in 0, -2/75473, -0.4, -0.95? -2/75473 Which is the fifth biggest value? (a) 1 (b) 1/2 (c) 163 (d) -17 (e) 0 d Which is the fifth biggest value? (a) 4 (b) 30/313 (c) -2/5 (d) 0.042 (e) -5 (f) -4 f What is the smallest value in -2/655, 1, -2/77, -47? -47 What is the third smallest value in 3, 11, -1/3, 0.64, -2/4707? 0.64 What is the smallest value in 0.03, 21.562, 2/33? 0.03 What is the second biggest value in -0.1029, 0.2, -3372? -0.1029 What is the second smallest value in -405, -1/3, 22, -55/123? -55/123 Which is the fifth biggest value? (a) -18 (b) -16/11 (c) 3 (d) -0.13 (e) 0.2 a Which is the smallest value? (a) 3 (b) -18.6 (c) 0.116 (d) 130 (e) 1/6 b What is the second biggest value in 3, 29, 3/4, -0.5, -1/8, -3, 2/7? 3 Which is the third biggest value? (a) -56 (b) 18 (c) -7 (d) -5 (e) -0.3 (f) 0.04 e Which is the smallest value? (a) -12 (b) -460 (c) -1 (d) -366 b What is the second biggest value in -2/3, 1341/10, -0.2? -0.2 What is the second biggest value in -4, 250/9, 0.1, -1.2? 0.1 Which is the third smallest value? (a) 54 (b) -2.8 (c) -4/9 (d) 3/14 d What is the fourth biggest value in 0.4, 1/8, 3/25, 2/3, -0.04197? 3/25 Which is the third biggest value? (a) 1/31 (b) -0.030996 (c) -2/7 c Which is the third smallest value? (a) -0.4 (b) 0 (c) -63289 (d) 2 (e) 1/15 b What is the second biggest value in -2566194, 0.3, 0.4, 1? 0.4 Which is the smallest value? (a) -1.1141 (b) 1/149 (c) 1/5 a Which is the second biggest value? (a) -19 (b) -4 (c) 7/2 (d) -11390/11 (e) -3 e Which is the biggest value? (a) 1056.9 (b) -0.1 (c) 2/3 (d) 2/9 (e) 0.0615 a Which is the fourth biggest value? (a) 1 (b) -0.14 (c) -1 (d) -49.9 (e) -52 d What is the third biggest value in -6.02, 1160, 1/2? -6.02 What is the fourth smallest value in -9/7, 4, 0.1, -3470, 5, -5, 1/6? 0.1 Which is the sixth smallest value? (a) -0.4 (b) 4 (c) -1/343 (d) 1.147 (e) -1 (f) -16 b Which is the fourth biggest value? (a) 0.3 (b) -3/10 (c) -17 (d) -4 (e) 0.1 d What is the biggest value in -0.5895435, -0.5, 0.5, -0.2? 0.5 What is the biggest value in 21, -2/5, -953, -4, -3.5, 19? 21 Which is the fourth smallest value? (a) 1/6 (b) -367.5 (c) 194/5 (d) 4 c What is the third smallest value in 2, -2/25, 11, -3, 0.348, 6.1, -0.5? -2/25 Which is the third smallest value? (a) 3118 (b) 1/9088 (c) 4 a What is the second biggest value in -15, -14577, 3? -15 Which is the second smallest value? (a) -2/5 (b) 0.4 (c) 50/37 (d) 237 b What is the fourth biggest value in 0.2, 0.059, -2/7, -1/18, 141, 6? 0.059 What is the fourth smallest value in 0.07, -2/9, 0.8, -261, 1, -2/7, 1/150? 1/150 What is the third biggest value in -0.1, -355, 104634? -355 Which is the third smallest value? (a) -3/4 (b) 520703423 (c) 0.2 b Which is	{ "pile_set_name": "DM Mathematics" }
c Let i be 1(-10 - -19)(0 + 1). Suppose 5g - 20 = 4v, -6v + iv + g = -15. Let w = -0.5 - -4.5. Which is the second biggest value? (a) w (b) 7/5 (c) v b Let y = -32 - -65/2. Let j = -464.7 + 461.7. What is the biggest value in 1/5, y, j? y Suppose 4b = 5p + 14, 3p - 10b + 7 = -9b. Let s = 4.02 + -0.02. Let r = s + 1. What is the smallest value in p, r, 1.2? p Suppose 11768 = 18q + 11678. Which is the biggest value? (a) q (b) 16 (c) -27 b Let w = 8 + 11. Let i = w - 19.5. Let g = -127.2 + 125. What is the third biggest value in -4, i, g? -4 Let z be 2/48-10702 - (-21)/(-28). Let h = -444 - z. What is the smallest value in 2/7, 5, 0.4, h? 2/7 Let y(l) = l2 - 31l - 4316. Let f be y(83). Let t = 4.98 - -0.02. Let d = 0.3 - 1.3. What is the fourth biggest value in t, -0.4, f, d? d Let s be (-10)/175 + -2 + 1496/700. Which is the third biggest value? (a) s (b) 3/2 (c) 9 (d) 5 (e) 1/14 b Let l = -62 - -57. Let j = -2 - -6. Let s = -33 - -23. What is the second smallest value in -3, l, s, j? l Let l = -13/1006 + 250262/1509. Which is the third biggest value? (a) l (b) -1 (c) 1 b Let f = 22360751/13224035 + -2/240437. Let n = f - 23/11. What is the third smallest value in n, -3, -2, -0.3? n Suppose v + 6u = 12u + 16, -2v = 4u. Which is the second biggest value? (a) -3 (b) -0.02 (c) -0.5 (d) v (e) 0.5 e Suppose p - 5i = -22, 2p + 2i = -0i + 16. Let j = -52 + 47. Let f = -82 + 80. Which is the smallest value? (a) j (b) f (c) p (d) -0.2 a Let y = -0.2421 - -0.423. Let z = -0.0191 - y. What is the second smallest value in 1/5, 0.9, z? 1/5 Let z = -4153 + 4098.93. Let j = z - -54. Let i = -26 + 51/2. Which is the biggest value? (a) 4 (b) i (c) j (d) -0.3 a Let f = -259 - -179. Let n = f - -236/3. Which is the third smallest value? (a) 7 (b) 3/2 (c) n a Let d = 0.7574 + -0.4574. What is the fourth biggest value in -1.4, -17, -4, d? -17 Let r = -5.1 - -5.4. Let t = 219 - 200. What is the third biggest value in 3, r, t? r Let h = -14 - -17. Let s = -0.4207 + 0.0027. Let y = -0.018 - s. Which is the smallest value? (a) -41 (b) y (c) 0 (d) h a Let z = -15190 - -15190.1. Which is the fourth biggest value? (a) -4 (b) z (c) 6 (d) 4 (e) -0.1 e Suppose 0 = -13u - 194 - 118. Let i be (-9)/u + (-279)/360. Which is the second smallest value? (a) i (b) -35 (c) 1/4 a Let n(f) = -1282f + 7694. Let h be n(6). Which is the fifth biggest value? (a) -0.4 (b) -0.5 (c) -0.2 (d) h (e) -1/7 b Let o = 5358 - 5358.2. Which is the second biggest value? (a) -58 (b) o (c) -4 (d) 1/2 (e) 0.4 e Suppose 6c - 3084 = 3y + 3c, 2y + 2c = -2060. Let x be (y/(-12))/7 - 57/(-76). What is the second smallest value in 1/5, -2/9, x? 1/5 Let s = -8890 + 8885.919. Let m = -0.081 - s. Let k = -2.2 + 2.8. Which is the third smallest value? (a) 0.3 (b) k (c) m c Let b = 0.2427 + 4.7573. Let o = -0.4 - -0.6. What is the second biggest value in b, -4, o, -4/7? o Let j = 3.5 - -6.5. Let r = 8 - j. What is the second smallest value in r, 17.5, 2/13? 2/13 Let v = -25723 - -25521. What is the second smallest value in 1/9, v, 1? 1/9 Let k = -2/67 + 75/268. Let f = -1.737 - -6.737. Which is the third biggest value? (a) 2/7 (b) f (c) k c Let m = 474 - 473.9. What is the biggest value in -1/5, -2, -3, m, 0? m Let u = -1 - -2/3. Let s(f) = -3f - 39. Let c be s(-17). Suppose -4y - 4h + c = 0, 5y - y = -5h + 12. What is the biggest value in u, 0, y? y Let s = 4.923 - -0.077. Let b = 218 + -652/3. Let u = 0.6 - -0.4. What is the second smallest value in s, b, u, -6? b Suppose -260 = 85h - 20h. Let w = -226.95 - -227. Which is the second smallest value? (a) h (b) w (c) -1/13 c Suppose -26y - 166y = 308 + 268. Let k = -0.07 - 6.93. Let j = -3 + 1. What is the second biggest value in -2/7, j, k, y? j Let k = 76 + -226/3. Let w = -1.01 - -0.972. Let z = w - 0.462. What is the biggest value in k, 5, z, 1/4? 5 Let c = 2 - 1. Let s be 52/210 - 140/105. Let u = s + 18/35. What is the second biggest value in 0.4, u, c? 0.4 Suppose -2s + 32i - 31i - 6 = 0, -4s - 18 = -5i. What is the smallest value in -2/597, s, -4, 4? -4 Suppose -27y - 105 - 84 = 0. Let z = 45 - 44. Suppose l + z = -1. What is the second biggest value in 3, y, l, 1? 1 Let n = 3815 + -3771. Which is the third smallest value? (a) -5 (b) 0.5 (c) -4 (d) n (e) -22 c Let p = -44 - -42. Let m = 3.41 + -6.41. What is the fourth smallest value in -5, m, p, 22? 22 Let m = -2471 - -2483. What is the second biggest value in m, -50, 3/8? 3/8 Let l be 1143/30488/1. Let o = -10 - -6. Which is the smallest value? (a) 6 (b) l (c) o c Suppose -9w = -7w - 24. Let h be ((-4)/(-6))/(4/w) + -4. Let r be ((-1)/8h)/1. Which is the fourth biggest value? (a) -5 (b) -6 (c) r (d) -1 b Suppose 7d - 9d + 49 = 3u, 0 = 5d - 25. Which is the smallest value? (a) -0.1 (b) 0 (c) u a Let y(j) = -j3 - j2 - 1. Let t be y(-1). Let g be -2 + 1 + t/(-2). Let x = -19681 - -19685. Which is the biggest value? (a) g (b) x (c) 1/2 (d) 4/5 b Let v(y) = y*3 + 5y*2 - 7y - 3. Let g be v(-6). Suppose gm + 23 = 5. Let h = -5.16 - -5.06. Which is the biggest value? (a) h (b) m (c) -1/4 a Let q(l) = 8l - 45. Let g = 166 - 159. Let i be q(g). What is the third biggest value in 3, i, 4? 3 Let s = 0.0325 - 2.7925. Let w = s + 3.16. Which is the second smallest value? (a) w (b) -7 (c) -4/7 (d) -3 d Suppose 4s - 29s + 25 = 0. Let y be 1/(-3 + 2) + 11. Suppose -3m + y = s. Which is the third smallest value? (a) -0.2 (b) m (c) 2/3 (d) 4 b Let z = -0.87 - -0.798. Let o = z - -0.472. Let t = -1.12 + 1.13. Which is the second smallest value? (a) 4 (b) o (c) t b Let v = 6 - 1. Suppose -2d - 2s + s + 36 = 0, -2s = -2d + 30. Let n(m) = -5m + 92. Let x be n(d). Which is the third smallest value? (a) x (b) v (c) -5 a Let c = 2 - 6. Let q = -29531 + 117449/4. Let t = q + 169. What is the second smallest value in t, c, 0.4, -3/5? -3/5 Let p be 2((-6)/(-10) - 1). Let a = 436974 - 436979. What is the second biggest value in -0.007, p, a? p Let t be (158/(-5135))/(-2 + (-5046)/(-2575)). Let q be ((-24)/234)/(52/6). Let j = q + t. Which is the third biggest value? (a) 3 (b) j (c) -5 c Let w be (6/(-10))/((-40)/50). Let s = -4987.03 - -4938. Let k = -49 - s. What is the third biggest value in w, k, 5? k Let l = 197 + -195. Let n = 346/33 + -32/3. What is the second smallest value in 0.6, 0.5, n, l? 0.5 Let i = 5.26 + -0.26. Let f = -6435 + 6438. Which is the biggest value? (a) 6 (b) i (c) f a Let l = 3258 + -3258.2. Which is the fourth smallest value? (a) l (b) -1 (c) -33 (d) 3 d Let n = -0.882 - -1.182. Which is the fourth biggest value? (a) 2 (b) 0.5 (c) 4 (d) -202 (e) n e Let x = 46958/11 + -4269. Which is the third smallest value? (a) -23 (b) 5 (c) -4 (d) x (e) -0.7 e Let v = 0.04 - -0.07. Let n = 1789.11 - 1790. Let p = v - n. Which is the fourth biggest value? (a) 2 (b) -17 (c) 0.2 (d) p b Let n be 3(-39)/(-91)(-4)/(-18). Which is the fourth biggest value? (a) n (b) -0.3 (c) 5 (d) -1/78 b Let w = -12190 + 48761/4. Suppose q + q - 6 = 0. Let x be 1((-57)/18 + q). Which is the third biggest value? (a) -2 (b) x (c) w a Let m = 7.17 + -3.17. Let c = -39.3 + 39. What is the second smallest value in m, c, 5? m Let u = -3.8005 - 0.1995. What is the smallest value in -3/2, 4/79, 3/5, u? u Let o = 28.3 - 35. Let v = -6.45 - o. Let g = -0.35 + v. Which is the second biggest value? (a) 4 (b) -2/9 (c) g c Let o be ((-45)/12)/(12 - 1595/132). Which is the fourth smallest value? (a) -2/5 (b) -4 (c) 5 (d) o d Let f = -456 - -313. Let x = f - -143.2. Let n = 0.2 + 3.8. What is the second biggest value in 2, x, -1, n? 2 Suppose -4u + 5p + 27 = 10p, 2p = 5u - 75. Let x = -2 + u. Suppose 7q - 24 - x = 0. What is the second biggest value in -3, -0.5, q? -0.5 Let m = -675 + 240. Let x = -441.01 - m. Let c = 0.01 + x. What is the third smallest value in 0.2, c, -3/7, -0.5? -3/7 Let v = -148 - -1039/7. Let f be (168/18)/7 - 1. Let l = -2.24 + 0.24. Which is the second biggest value? (a) f (b) v (c) l a Let d = 35.8 + -35. Let p = -0.758 + d. Let n = -0.258 - p. Which is the biggest value? (a) 0.1 (b) n (c) -4 a Let t = 20 - 6.	{ "pile_set_name": "DM Mathematics" }
isiiiiii. What is prob of sequence siss? 1/455 Two letters picked without replacement from {e: 1, a: 11, v: 3, n: 2, m: 1, u: 1}. What is prob of sequence uv? 1/114 What is prob of sequence hcc when three letters picked without replacement from ceecheece? 1/84 Three letters picked without replacement from ddudmdumdmmuddu. What is prob of sequence duu? 2/65 Four letters picked without replacement from xxxkbkxkbtwxkkxkfkt. Give prob of sequence kbwf. 7/46512 Three letters picked without replacement from calcllllalalca. What is prob of sequence cca? 1/91 Three letters picked without replacement from {w: 3, s: 7, b: 2}. Give prob of sequence ssw. 21/220 What is prob of sequence ey when two letters picked without replacement from qqyyeyeeeteteyete? 2/17 Two letters picked without replacement from aanniaihdiaaeeaen. What is prob of sequence he? 3/272 Four letters picked without replacement from {y: 1, z: 1, d: 1, n: 2, k: 2, t: 1}. What is prob of sequence zknt? 1/420 Calculate prob of sequence ojje when four letters picked without replacement from {j: 2, e: 1, o: 1}. 1/12 Two letters picked without replacement from {e: 1, z: 2, g: 2, h: 1, r: 1, f: 1}. Give prob of sequence zf. 1/28 What is prob of sequence qp when two letters picked without replacement from {j: 1, p: 2, t: 1, x: 1, q: 1, a: 1}? 1/21 Four letters picked without replacement from ccxvxvcccxxcxxccc. Give prob of sequence vxcc. 9/595 What is prob of sequence yi when two letters picked without replacement from {i: 1, m: 1, x: 5, y: 3, h: 4}? 3/182 Two letters picked without replacement from eqfffeefezzqeeefz. Give prob of sequence ee. 21/136 Calculate prob of sequence zpuw when four letters picked without replacement from {p: 1, z: 1, g: 5, w: 3, u: 1}. 1/2640 Four letters picked without replacement from {u: 7, i: 1, a: 5, m: 3}. What is prob of sequence aamm? 1/364 Three letters picked without replacement from llll. What is prob of sequence lll? 1 What is prob of sequence grg when three letters picked without replacement from {g: 7, r: 9, h: 2, j: 1}? 21/323 What is prob of sequence kueu when four letters picked without replacement from ukugkkuekkkegc? 3/1001 Calculate prob of sequence kp when two letters picked without replacement from ppkppppk. 3/14 Three letters picked without replacement from qsqysqsqsqsyss. Give prob of sequence yyq. 5/1092 What is prob of sequence lll when three letters picked without replacement from {l: 3, k: 8}? 1/165 Two letters picked without replacement from {q: 4, d: 3, e: 4, i: 2, t: 3, o: 2}. What is prob of sequence dd? 1/51 What is prob of sequence ff when two letters picked without replacement from {r: 2, f: 9}? 36/55 Two letters picked without replacement from {a: 3, n: 3, h: 2}. Give prob of sequence an. 9/56 Four letters picked without replacement from ykwrc. What is prob of sequence kwrc? 1/120 What is prob of sequence yvj when three letters picked without replacement from {u: 1, y: 1, m: 1, j: 3, v: 1}? 1/70 Calculate prob of sequence gmq when three letters picked without replacement from {m: 1, u: 1, g: 1, n: 2, s: 1, q: 1}. 1/210 Calculate prob of sequence xz when two letters picked without replacement from {p: 8, o: 5, z: 2, x: 4}. 4/171 What is prob of sequence ccc when three letters picked without replacement from {c: 6}? 1 Calculate prob of sequence edze when four letters picked without replacement from ldoaoeedzloaodooad. 1/9180 What is prob of sequence ee when two letters picked without replacement from {i: 7, d: 1, r: 1, e: 7}? 7/40 What is prob of sequence pg when two letters picked without replacement from {u: 2, q: 1, o: 6, g: 5, p: 1}? 1/42 What is prob of sequence ax when two letters picked without replacement from {p: 2, a: 2, c: 1, x: 1, v: 2, i: 1}? 1/36 Two letters picked without replacement from {t: 7, w: 4, q: 3, b: 4}. What is prob of sequence ww? 2/51 What is prob of sequence uuuj when four letters picked without replacement from juuuttuutuujututut? 1/51 Two letters picked without replacement from {o: 8, f: 3}. Give prob of sequence oo. 28/55 Calculate prob of sequence mmv when three letters picked without replacement from mcccmmcmccmccvcv. 1/84 Two letters picked without replacement from {q: 6, c: 2, n: 9}. What is prob of sequence nn? 9/34 What is prob of sequence jrjl when four letters picked without replacement from {u: 1, e: 4, v: 1, j: 5, r: 6, l: 3}? 1/323 Three letters picked without replacement from {z: 11, q: 9}. Give prob of sequence qzq. 11/95 What is prob of sequence uku when three letters picked without replacement from uckkullktknc? 1/165 Calculate prob of sequence fc when two letters picked without replacement from ifwcccffcfz. 8/55 Calculate prob of sequence juju when four letters picked without replacement from {u: 5, j: 2}. 1/21 Calculate prob of sequence smt when three letters picked without replacement from {s: 2, u: 1, v: 1, o: 1, t: 1, m: 1}. 1/105 What is prob of sequence xth when three letters picked without replacement from tthxxhxhxttxx? 6/143 What is prob of sequence lcmi when four letters picked without replacement from nimemcmelmel? 1/1485 Four letters picked without replacement from {z: 1, h: 3, r: 4, m: 2, c: 1}. What is prob of sequence mzmh? 1/1320 Four letters picked without replacement from {d: 2, e: 1, o: 7, j: 3, n: 1}. What is prob of sequence onod? 1/286 What is prob of sequence sbwe when four letters picked without replacement from {w: 1, s: 1, e: 1, m: 7, o: 2, b: 2}? 1/12012 Three letters picked without replacement from onqrn. Give prob of sequence qro. 1/60 Calculate prob of sequence jqj when three letters picked without replacement from {r: 1, m: 1, j: 2, q: 1, x: 2}. 1/105 Calculate prob of sequence nf when two letters picked without replacement from {n: 2, p: 3, f: 5, b: 3}. 5/78 Three letters picked without replacement from nanafnfxnfaafnx. What is prob of sequence xff? 4/455 Calculate prob of sequence gff when three letters picked without replacement from {l: 1, f: 2, d: 1, v: 4, h: 1, g: 3}. 1/220 What is prob of sequence rqk when three letters picked without replacement from qrrkkyk? 1/35 Calculate prob of sequence iii when three letters picked without replacement from {i: 9}. 1 Four letters picked without replacement from {l: 4, w: 2, i: 2, j: 4, m: 1, e: 1}. Give prob of sequence mill. 1/1001 Three letters picked without replacement from uuuuuuuuu. What is prob of sequence uuu? 1 What is prob of sequence tv when two letters picked without replacement from {r: 1, e: 1, t: 1, b: 1, k: 1, v: 2}? 1/21 Three letters picked without replacement from mendy. Give prob of sequence ynd. 1/60 Calculate prob of sequence mmk when three letters picked without replacement from {a: 2, m: 11, k: 1}. 55/1092 What is prob of sequence ksa when three letters picked without replacement from yffkwwwwwsswwyswaw? 1/1632 Calculate prob of sequence ss when two letters picked without replacement from ysssyssssyy. 21/55 Four letters picked without replacement from {y: 1, j: 9, o: 1, g: 3}. What is prob of sequence jjgj? 9/143 What is prob of sequence oo when two letters picked without replacement from uoouou? 1/5 Three letters picked without replacement from {d: 5, l: 8, u: 1, z: 2, h: 1, t: 3}. Give prob of sequence dhz. 1/684 Calculate prob of sequence wc when two letters picked without replacement from {c: 3, i: 1, o: 4, u: 1, w: 7}. 7/80 Three letters picked without replacement from {g: 4, f: 2, v: 4}. Give prob of sequence vvv. 1/30 Three letters picked without replacement from {h: 2, k: 5, q: 2, d: 1, w: 6, a: 1}. Give prob of sequence kkd. 1/204 Three letters picked without replacement from djdqjjddqjjjdjdjdj. Give prob of sequence ddj. 21/272 Calculate prob of sequence iaia when four letters picked without replacement from aaiaaaaaaaaaaaiaaaaa. 1/190 Three letters picked without replacement from ooomuuy. Give prob of sequence uum. 1/105 Calculate prob of sequence iyi when three letters picked without replacement from yyyyyiiyiiyqy. 8/143 What is prob of sequence ij when two letters picked without replacement from jji? 1/3 Calculate prob of sequence mppp when four letters picked without replacement from {p: 8, q: 6, m: 3, r: 1}. 7/510 Two letters picked without replacement from iyyiqyygtivi	{ "pile_set_name": "DM Mathematics" }
t is the ten thousands digit of 784192632? 9 What is the hundreds digit of 2169050962? 9 What is the tens digit of 3241326066? 6 What is the hundreds digit of 32289926? 9 What is the thousands digit of 338202033? 2 What is the ten millions digit of 586410879? 8 What is the hundreds digit of 60674279? 2 What is the hundreds digit of 62936907? 9 What is the millions digit of 12159352? 2 What is the units digit of 39548420? 0 What is the hundred thousands digit of 150463777? 4 What is the units digit of 1969041876? 6 What is the thousands digit of 96845636? 5 What is the ten millions digit of 1395863999? 9 What is the millions digit of 2355876491? 5 What is the millions digit of 176818968? 6 What is the ten millions digit of 71658499? 7 What is the billions digit of 1634717688? 1 What is the thousands digit of 286893734? 3 What is the tens digit of 238344770? 7 What is the thousands digit of 621033862? 3 What is the ten millions digit of 1513921837? 1 What is the units digit of 392442449? 9 What is the hundred millions digit of 159843727? 1 What is the millions digit of 59116472? 9 What is the ten millions digit of 108333750? 0 What is the units digit of 83678622? 2 What is the millions digit of 1502073555? 2 What is the ten thousands digit of 33326557? 2 What is the millions digit of 278274555? 8 What is the hundreds digit of 29500926? 9 What is the ten thousands digit of 142537452? 3 What is the tens digit of 2942588332? 3 What is the billions digit of 6502534711? 6 What is the units digit of 36636205? 5 What is the hundred thousands digit of 47932953? 9 What is the thousands digit of 165859289? 9 What is the ten thousands digit of 226826133? 2 What is the hundreds digit of 10489506? 5 What is the tens digit of 40505969? 6 What is the units digit of 746719210? 0 What is the ten thousands digit of 51540131? 4 What is the hundreds digit of 3039772599? 5 What is the hundred millions digit of 439363134? 4 What is the hundreds digit of 44392109? 1 What is the hundred thousands digit of 20979754? 9 What is the hundred thousands digit of 1549698479? 6 What is the hundred thousands digit of 37115314? 1 What is the tens digit of 497566321? 2 What is the ten thousands digit of 922426491? 2 What is the hundred thousands digit of 623097877? 0 What is the millions digit of 379709591? 9 What is the hundreds digit of 602200527? 5 What is the hundreds digit of 24052527? 5 What is the ten millions digit of 1452714712? 5 What is the tens digit of 8496110? 1 What is the units digit of 607908656? 6 What is the thousands digit of 99955038? 5 What is the ten millions digit of 24145516? 2 What is the ten millions digit of 24762458? 2 What is the ten millions digit of 80419170? 8 What is the millions digit of 601585522? 1 What is the ten millions digit of 168797596? 6 What is the tens digit of 1026155469? 6 What is the hundred thousands digit of 527091808? 0 What is the hundreds digit of 1162943459? 4 What is the ten millions digit of 10040070? 1 What is the hundred thousands digit of 616290599? 2 What is the units digit of 15450607? 7 What is the tens digit of 3208844164? 6 What is the ten millions digit of 68629283? 6 What is the tens digit of 1378677? 7 What is the hundred thousands digit of 450620914? 6 What is the units digit of 24693513? 3 What is the millions digit of 2277110750? 7 What is the ten millions digit of 218355373? 1 What is the millions digit of 736427632? 6 What is the units digit of 89307260? 0 What is the hundred millions digit of 1008159395? 0 What is the ten thousands digit of 211276701? 7 What is the ten thousands digit of 107691860? 9 What is the units digit of 105962314? 4 What is the hundred millions digit of 6259493677? 2 What is the hundreds digit of 29690486? 4 What is the hundred thousands digit of 595881328? 8 What is the millions digit of 752113629? 2 What is the millions digit of 28646372? 8 What is the thousands digit of 195109194? 9 What is the units digit of 107965849? 9 What is the units digit of 78388937? 7 What is the thousands digit of 55721625? 1 What is the hundreds digit of 93668255? 2 What is the units digit of 426755628? 8 What is the thousands digit of 1172191479? 1 What is the tens digit of 91560734? 3 What is the ten thousands digit of 212347626? 4 What is the hundred millions digit of 1826796049? 8 What is the units digit of 836381424? 4 What is the hundred millions digit of 535946736? 5 What is the ten millions digit of 20165393? 2 What is the hundreds digit of 235734891? 8 What is the units digit of 3431531045? 5 What is the millions digit of 2680624111? 0 What is the ten thousands digit of 71375833? 7 What is the hundreds digit of 86582141? 1 What is the hundred millions digit of 240775996? 2 What is the units digit of 547164018? 8 What is the hundreds digit of 209014347? 3 What is the hundred thousands digit of 338164887? 1 What is the ten thousands digit of 752095708? 9 What is the millions digit of 1499426529? 9 What is the ten thousands digit of 654317389? 1 What is the ten millions digit of 1202323642? 0 What is the hundred millions digit of 925684864? 9 What is the units digit of 2190775786? 6 What is the ten thousands digit of 80984458? 8 What is the ten thousands digit of 242058795? 5 What is the hundred thousands digit of 2808028067? 0 What is the thousands digit of 218528668? 8 What is the hundreds digit of 665447653? 6 What is the thousands digit of 231759998? 9 What is the hundred thousands digit of 779562763? 5 What is the units digit of 264891266? 6 What is the hundred thousands digit of 270881069? 8 What is the millions digit of 4448328? 4 What is the tens digit of 18231666? 6 What is the hundreds digit of 119284609? 6 What is the ten thousands digit of 50148199? 4 What is the ten thousands digit of 83778186? 7 What is the ten millions digit of 266416663? 6 What is the hundred thousands digit of 833907305? 9 What is the units digit of 160367952? 2 What is the hundred thousands digit of 48972475? 9 What is the millions digit of 54156141? 4 What is the ten millions digit of 746950445? 4 What is the hundred thousands digit of 33834663? 8 What is the thousands digit of 30640359? 0 What is the ten millions digit of 290438644? 9 What is the thousands digit of 1714896413? 6 What is the hundred millions digit of 6314736955? 3 What is the thousands digit of 55191201? 1 What is the ten millions digit of 38265099? 3 What is the millions digit of 119948307? 9 What is the ten millions digit of 29156196? 2 What is the millions digit of 421232342? 1 What is the thousands digit of 84402084? 2 What is the thousands digit of 121052291? 2 What is the thousands digit of 102886297? 6 What is the thousands digit of 431536263? 6 What is the millions digit of 928045834? 8 What is the tens digit of 397586554? 5 What is the thousands digit of 14492733? 2 What is the hundred millions digit of 2817904305? 8 What is the hundred millions digit of 2244421472? 2 What is the tens digit of 5143954287? 8 What is the hundreds digit of 149389466? 4 What is the hundreds digit of 187676901? 9 What is the ten thousands digit of 949840493? 4 What is the thousands digit of 131908967? 8 What is the hundreds digit of 3011699083? 0 What is the millions digit of 25991722? 5 What is the units digit of 280715425? 5 What is the hundred millions digit of 647747932? 6 What is the tens digit of 1012967831? 3 What is the tens digit of 15271219? 1 What is the ten thousands digit of 1585035818? 3 What is the ten millions digit of 1100383959? 0 What is the hundreds digit of 7407621? 6 What is the millions digit of 87103868? 7 What is the thousands digit of 662241227? 1 What is the ten millions digit of 86080354? 8 What is the thousands digit of 429158674? 8 What is the thousands digit of 855106999? 6 What is the ten millions digit of 105471274? 0 What is the units digit of 317072015? 5 What is the hundred millions digit of 884964471? 8 What is the millions digit of 10456311? 0 What is the tens digit of 732056844? 4 What is the ten thousands digit of 186581809? 8 What is the ten thousands digit of 364015622? 1 What is the hundreds digit of 125732239? 2 What is the hundreds digit of 35622427? 4 What is the millions digit of 105618815? 5 What is the uni	{ "pile_set_name": "DM Mathematics" }
92o as to*2 + z + lo and give t. -1800 Express (3 - 3 - 1)(2086g*2 + 22g*2 - 6253 + 6253) as kg*2 + rg + t and give t. 0 Rearrange -10z3 - 3z*2 - 2z*4 + 30z*3 + 4z4 - z2 to sz2 + qz + yz4 + mz*3 + n and give n. 0 Rearrange 4147b - 3b3 + b3 - 3957b + b*3 - 2b*4 to the form zb*3 + tb*2 + w + jb + vb4 and give w. 0 Rearrange -2h - 712h2 - h - 2h + 5h to the form vh + s + xh2 and give x. -712 Express -q3 + 14 - 18 + 110q - 62q in the form lq + nq2 + gq*3 + b and give g. -1 Rearrange -100874k + 24k2 + 100874k to xk2 + n + tk and give x. 24 Rearrange k3 - 103 + k3 - 2k3 - 131 + k3 to jk + lk3 + vk*2 + i and give i. -234 Rearrange -6 + 120q*2 - 2q - 44q2 - 3q*3 - 33q*2 - 42q*2 to the form iq*3 + w + jq*2 + bq and give i. -3 Rearrange 244y - 119y + 3y3 + 4 - 114y to the form uy3 + fy + i + dy2 and give u. 3 Express (0l + 0l + l + (1 - 1 + 2)(1 - 1 + 2l) - 4l + 2l + 3l - 3l + l + 3l - l + 4l + 0l)(-54 + 25 - 2)(5 - 4 - 2) in the form rl + o and give o. 0 Express -76q + 7q2 + 76q - 99q3 as uq + vq3 + yq*2 + d and give v. -99 Express (-2 + 5 - 1)(-2 + 3c + 2)(-30 - 36 + 5) as sc + t and give s. -366 Rearrange (8 - 7w + 7w + 2w)(0 - 1 + 4) to b + dw and give b. 24 Rearrange 16h4 + 31h*2 - 68h*2 + 38h*2 - 50h*4 + 3 to the form c + bh*4 + yh + xh2 + ah*3 and give y. 0 Express (6 - 3 - 2)(2 - 1 + 2)(-2 + 2 - 1)(-9c - 4c - 3c)(0 - 7 + 2) as j + ac and give a. -240 Rearrange (-43 - 126 + 5)(1 - 5 + 1)(-5x + 0x + 4x)(5 - 2 - 4) to u + ix and give i. 492 Express (-9h3 + 1 + 0h*2 - 59h3 + h2)(-3h + 5h + 0h) in the form uh3 + nh*2 + oh + a + ih4 and give o. 2 Express -134y*3 + y + 4y + 5 - y*2 + 265y*3 + 2 - 132y*3 in the form dy*3 + a + jy*2 + sy and give s. 5 Rearrange (6s2 - 5s*2 + 6s*2)(110 - 110 + 38s + (-3s + s + s)(-1 + 3 - 3)) to the form vs*2 + rs*3 + n + ys and give r. 273 Rearrange (-2k + 2k - 97k3)(-3 - 6 + 4)(-1 - 5 + 4)(-1 + 0 + 3) + 2k - 2k*3 - 2k to the form zk + sk*2 + n + mk*3 and give m. -1942 Rearrange -74 + 3k*3 + 30 + 73 to wk + u + mk2 + qk*3 and give m. 0 Rearrange 228q*3 - 2q*2 - 179q*3 + 2 + 9q - 9q to lq*2 + sq + c + iq3 and give c. 2 Rearrange 12n + 16n2 - 4 - 3n*2 - 7n*2 - 8n*2 - 4n*3 to the form z + gn*3 + un*2 + in and give z. -4 Rearrange -44 + 594m + 59 - 15 to the form tm + r and give t. 594 Rearrange (-4 + 17 + 1)((-r + 4r - r)(0 - 2r*2 + 0) + 7r*3 + 14r*3 - 7r*3) to the form x + zr + hr3 + dr*2 and give h. 140 Rearrange (-1 - 4 + 4)(-4 + 0 + 2)(3z2 + z2 - 3z2 + (3z - 5z + 3z)(z + 0 + 0) + z2 + 16 - 29 - 11) to the form pz + o + mz2 and give p. 0 Express (-1 - 2 + 2)(4 + 3h3 - 4) - 51h*3 - 17025 - h + 17025 in the form yh*3 + fh + b + ch2 and give y. -54 Rearrange 162 + 177 + 6h*2 - 246 to the form ah*2 + xh + s and give x. 0 Express (-37 + 126 + 56)(-2g + 0g + 3g + (-2 + 0 + 1)(0 - 4 + 1)(-1 - 4g + 1)) in the form y + fg and give f. -1595 Express -24n3 - 14 - 53n3 - n2 + n*4 + 14 as vn*3 + zn + tn2 + bn*4 + s and give v. -77 Express -385a*2 + 5a + 862a2 - 2a as q + pa + ma*2 and give p. 3 Rearrange (-z - 3 + 3)(-85 - 10 + 8) + z - 3z + 3z to the form xz + k and give x. 88 Express (-6 + 1 + 1)(1 - 1 + 2n + (n + 2n + 0n)(-7 - 8 + 4)) in the form z + cn and give c. 124 Rearrange 0l + 6l - 24l*3 - 11l - l*4 + 7l*2 + 22l*3 to the form kl*4 + ol*3 + hl*2 + m + sl and give k. -1 Express -n + 7 - 2n + 32n - 8n - 7n in the form q + yn and give y. 14 Rearrange 4 + 2o*4 - 4 + 0o*4 + 22o3 - 3 + o2 to the form so + k + ho*4 + ao*2 + wo*3 and give h. 2 Express 3 + 4u*2 - 3 - 6u*2 + 4u - 4u + 9u*2 + 446 - 446 + (-1 + u + 1)(-2u + 3 - 3) in the form tu*2 + d + ku and give d. 0 Express -382u2 - 422 + 422 as xu*2 + b + zu and give x. -382 Express -a + 93a2 + a - 5a + 5a in the form na*2 + ia + r and give n. 93 Rearrange (-3u - 2u - u)((-3u + 0u + 4u)(2 - 2 - 1) + 0u + 0u - 2u - 62u + 133u - 57u) to the form pu + vu2 + m and give v. -66 Express -6b3 - b3 + 4b3 + (b + 0b - 2b)(3b2 - 7b*2 - 31b*2) as rb*2 + p + qb + ab3 and give a. 32 Express 3y*2 + 2y*4 + 2y*3 + 0 + 2 - 2y + 2y - 4y as ay + oy*2 + jy*3 + wy*4 + g and give a. -4 Express -110l + 2 + 7 - 6 - 1 - 5 as zl + u and give z. -110 Express -155i*3 + 12i*4 - 162i*3 + i + 2 + 0i + 319i3 + 3i*2 as ui*4 + x + vi*3 + bi*2 + qi and give q. 1 Rearrange 405a - 1 - 14a2 + a4 + 19a2 - 467a to ya3 + ba*2 + qa + v + pa4 and give v. -1 Express -38g + 275g2 - 27g + 65g in the form yg*2 + f + ug and give y. 275 Rearrange -10z2 - 4z + 4z - 55z*3 + 66z*3 to tz*3 + d + az*2 + hz and give a. -10 Rearrange 66v3 - 2v*4 - 127v*3 - 1 + 0 to hv*4 + qv + t + wv3 + xv*2 and give h. -2 Express -33k*3 + 18k*2 - 17k*2 - 5k*4 + 12k*3 + 15k*3 in the form sk*4 + l + gk*2 + wk + bk3 and give b. -6 Rearrange 6j*3 + 6j3 + j4 - 20 + 2j2 + 7j*3 - 21j*3 - j to the form zj + fj2 + xj*4 + wj*3 + p and give f. 2 Express -223x*2 - 275x*2 + 218x*2 in the form p + mx + nx2 and give n. -280 Rearrange (47a*2 - 22a*2 - 82a*2)(4a + 3a + 7a) + 4a - 4a - a3 to the form ca*2 + fa + wa3 + k and give w. -799 Express 70n*3 + 16n*2 - 218n*3 + 15n*2 + 73n*3 + 76n*3 in the form wn*3 + an*2 + cn + z and give a. 31 Rearrange (0n + 4n - 3n)(145 + 32 + 45) to xn + w and give x. 222 Express (-1 - 4 + 4 + 1 - 3 + 1 + (1 + 2 - 1)(1 - 3 + 0) + 3 - 5 + 1 + 3 - 3 + 1 - 17 + 1 - 1)(-13q - 9q + 6q) as yq + t and give y. 368 Rearrange (42a2 + a2 + 19a2)(-4 - 4 + 2) to h + ga + na*2 and give n. -372 Rearrange -28q + 83q - 23q - 33q - 243 to cq + f and give f. -243 Rearrange (5b4 - 2b4 - b4)(18 + 25 - 12) + (5b*2 - 5b2 + b2)(4 + 15b*2 - 4) to the form zb*4 + a + fb*3 + pb*2 + ob and give z. 77 Rearrange -8 - 7v3 - 15 + 30 + 2v - 2v2 to o + jv + av2 + tv*3 and give j. 2 Express 670 - 336 - q + 35q*2 - 334 in the form u + cq + tq2 and give t. 35 Rearrange -5c*2 + 4c2 - c3 - c + 4c + (-c3 + 2 - 2)(3 + 1 - 3)(-1 + 6 - 3) to mc*2 + jc*3 + o + qc and give q. 3 Rearrange -93101y + 92893y + 0y2 + 3y4 + y2 to ny2 + jy*4 + ky*3 + l + oy and give o. -208 Rearrange 7v4 - 5v2 + v4 + 25v2 - 7v*4 + 21v*3 - 13v*2 to fv*3 + bv + p + jv4 + hv*2 and give f. 21 Rearrange (6 - 12 + 16 - 7 + 1001m)(m - m - m) to the form c + pm + hm2 and give p. -3 Rearrange -20d + 7d2 + 5d + 19d to i + cd + fd2 and give f. 7 Express -p3 + 4p - p*3 - 2p + ((0 - p + 0)(264 - 264 - 24p) + 0 - p*2 + 2p*2 + 2)(-4p + 7p - 8p) as kp*3 + wp + m + rp2 and give m. 0 Express (5b*3 - 3b*3 + 2b*3)(-2b + b + 4b)((5 - 5 + 2)(0 - 7 + 2) - 2 - 5 + 0) as ab4 + ib + zb2 + t + kb*3 and give a. -204 Rearrange (-u + 1 - 1)(-129 + 28 - 159) to fu + l and give f. 260 Express 8d*4 + 2d*3 - 20222d*2 - 2d + 20222d2 - 32 - 3d*3 in the form h + ld*2 + pd*4 + jd*3 + md and give p. 8 Express 2i - 13i*4 + 2i*4 - 2i*3 + 17i*2 - 7i + 4i4 + 5i*4 as ai + wi3 + ti*2 + d + ni*4 and give w. -2 Rearrange ((-w + 2w + 0w)(2 - 2 - 1) - 4w - 2w + 5w - w - 3w + 2w - 5228 + 5228 - 92w)(-1 + 4 + 1) to l + hw and give h. -384 Rearrange -3b + 3b - 3b2 + (5b - 2b - 5b)(-3b - 2b + 6b) - 27b + 6b*2 - 1591 + 797 + 795 to the form nb + qb2 + t and give t. 1 Rearrange -54l*2 + 4l + 34l2 + l + 5l*2 to the form x + jl*2 + yl and give j. -15 Express (427m - 143m - 214m)(0 + 2 - 1 + (4 - 5 + 0)(-3 + 1 + 0))(-m + 2m + 0m) in the form hm2 + am + r and give h. 210 Express (-82t - 11t - 10t)(-1 + 4 - 4 + (2 + 0 - 3)(-2 + 2 - 2) - 5 + 1 - 7) in the form rt + d and give r. 1030 Rearrange k	{ "pile_set_name": "DM Mathematics" }
121201w3 + 4w - 5711283? -60727206w Differentiate -27wy3 - 59444w + 2y3 - 25y*2 - 3y - 82397 wrt w. -27y3 - 59444 What is the derivative of -163608437z + 65189248? -163608437 Find the second derivative of -8947586k2q - 4123955kq wrt k. -17895172q What is the first derivative of -86o*2 - 47194o - 17664448? -172o - 47194 What is the third derivative of -4890k*5 - 2271k*3 - 44192536k*2 wrt k? -293400k*2 - 13626 What is the third derivative of 44250j*2l*3 + 150j*2l*2 + 14j*2 + 306l*3 + 5l*2 - 16l - 9 wrt l? 265500j2 + 1836 What is the third derivative of -6987844b*3 + 18b*2 + 40349b wrt b? -41927064 Find the first derivative of -62469217z3 + 5305556. -187407651z*2 Find the third derivative of -795030547d*3 + 27061814d*2 - 8. -4770183282 Find the third derivative of -8245960t*3 - 1681330t*2. -49475760 What is the third derivative of -21q*6 - 6809215q*3 - 300793758q*2? -2520q*3 - 40855290 Find the third derivative of 5570962p*4 - 11p*2 + 165p + 73 wrt p. 133703088p Find the third derivative of -23n*5 - 89647n*3 + 8n*2 + 29n - 55 wrt n. -1380n2 - 537882 Find the first derivative of -1624589g*3 - 4g*2 + 2g + 18873215. -4873767g2 - 8g + 2 Find the second derivative of -186853741g3 - 133g + 1620187 wrt g. -1121122446g What is the third derivative of -56120750hp5s + 15hps + p3s*2 + 2p*2s*2 + 8868p*2s + 7ps*2 - 2s wrt p? -3367245000hp*2s + 6s2 Differentiate 25ar2 - 2761ar - 9576496a - 3r2 + 2r with respect to r. 50ar - 2761a - 6r + 2 What is the second derivative of -13482536r3 + 2r*2 + 125r + 23178? -80895216r + 4 Differentiate -204690z*3 + 96z*2 + 135590484. -614070z*2 + 192z Find the second derivative of 226b2m*2 + 17b*2m + 8787b2 - 13bm2 - 21bm + 5b - 34m2 wrt b. 452m*2 + 34m + 17574 What is the first derivative of y*3 - 347180y*2 - 78y + 309276190? 3y2 - 694360y - 78 Find the second derivative of -8t5 + 4176t*4 + 4t - 157705 wrt t. -160t3 + 50112t*2 What is the second derivative of -5451599mq2 - 743m - q + 601 wrt q? -10903198m Find the third derivative of -17812b*2p*2x3 - b2px2 + b2px + 10426736b2x*2 + bp*2x*2 + 5bx2 - 2387p*2x*3 wrt x. -106872b*2p*2 - 14322p2 What is the derivative of t3 - 3048122t2 - 747903225? 3t*2 - 6096244t Find the second derivative of -2201d4w + 664d3w + 6d2 + 3505959dw + 2d - 2w + 3 wrt d. -26412d*2w + 3984dw + 12 What is the first derivative of -k*2p + 11k2 - 4980kp - 7k - 3674757p wrt k? -2kp + 22k - 4980p - 7 Find the third derivative of 45686s*4 + 2s*3 - 15375s*2 - 307s + 2 wrt s. 1096464s + 12 What is the second derivative of -59871172s*5 - 41700539s? -1197423440s3 Find the second derivative of -411567kl2ou - klou - 106klu + 6kou + 3l2ou - 2l*2u - 43lo - 2ou wrt l. -823134kou + 6ou - 4u Differentiate 1151w2 - 2946w - 270956378 with respect to w. 2302w - 2946 Differentiate -2g*3 - 4g*2 - 987452g - 577740285 wrt g. -6g2 - 8g - 987452 Find the second derivative of 945948788z4 - 27093z + 17220. 11351385456z2 Differentiate -713m*4 + 37418m*2 - m - 42629021 wrt m. -2852m*3 + 74836m - 1 Differentiate -2y4 - 776562y*3 + 13y - 161294802 with respect to y. -8y3 - 2329686y*2 + 13 Find the third derivative of 2m*3w*3 - 4227901m*3w*2 + 377m*2w - mw3 + 3mw - 9m wrt m. 12w3 - 25367406w*2 Find the second derivative of -6851732z*2 - 5867229z - 1. -13703464 What is the second derivative of -n*2v*2 - 180n*2v + 10n2 + nv*2 - 3nv - 2939261v*2 - 538v + 2 wrt v? -2n2 + 2n - 5878522 Differentiate -ix3 + 35ix2 - 12ix + 12454i + 7734x3 + 15321x with respect to i. -x*3 + 35x*2 - 12x + 12454 Find the second derivative of -1100571789a2w*3 - 2978936a - 79w3 wrt a. -2201143578w*3 Find the second derivative of 1520v*4 + 16394v*3 + 1291v + 11667. 18240v2 + 98364v Differentiate -83i2 + 281221ip - 29936p + 86 with respect to i. -166i + 281221p Find the second derivative of -1008g3 - 33975g*2 - 86501302g wrt g. -6048g - 67950 What is the first derivative of 10680260j*3 - 115353434 wrt j? 32040780j*2 What is the second derivative of 3624a*2d*2w + 12a2d*2 + 59a*2 - 7179ad2w - 4ad*2 + aw + 19d2w wrt a? 7248d2w + 24d2 + 118 Find the third derivative of 925297g*3 - 67597085g*2. 5551782 Find the third derivative of 26440f*5y + 7776f3y - 2f2y - 19f2 + 18051f - 48y wrt f. 1586400f*2y + 46656y Find the first derivative of 4q*2 + 281539q + 1351516 wrt q. 8q + 281539 What is the second derivative of -7k*3x*2 - 127014k*2x*2 - 5kx2 + 45007kx - 12x - 2 wrt k? -42kx*2 - 254028x*2 What is the second derivative of 6370914n*2 - 7048316n? 12741828 Differentiate -w*3 + 14434320w*2x + 2w2 - 122226234x wrt w. -3w2 + 28868640wx + 4w What is the second derivative of 431925890i4 + 242497239i? 5183110680i2 Find the first derivative of -658604103a - 578070033. -658604103 What is the second derivative of -113387270y4 + 10042157y + 1? -1360647240y2 Find the third derivative of -2i*2w*4 + 3i*2w*2 + 591090i*2 - 1576481iw5 - 2i wrt w. -48i2w - 94588860iw*2 What is the second derivative of 28999846j*2p - 44493319jp wrt j? 57999692p Find the first derivative of -13lu + 14293354l + 112248u2 wrt u. -13l + 224496u Find the third derivative of 4096o*4 + 959o*3 - 36o*2 - 277933o wrt o. 98304o + 5754 What is the second derivative of 2396o*3 - 53388o*2 + 790o + 182318 wrt o? 14376o - 106776 Find the second derivative of 192480m*5 + 27m*3 - 218097m - 352. 3849600m3 + 162m Differentiate 9451873h2l - 944851513h2 - 10hl3 wrt l. 9451873h*2 - 30hl2 What is the second derivative of 11s*3 - 23778s*2 + 840348s wrt s? 66s - 47556 Find the third derivative of -49677626i*3 - 2212i*2 + 10778 wrt i. -298065756 What is the first derivative of -583g*4 - 15660g*2j*3 + 25j*3 - 13j*2 + 2j + 86 wrt g? -2332g3 - 31320gj3 Find the third derivative of -1010566b*5 + 4b*4 - 14b*2 + 28371b + 22. -60633960b2 + 96b What is the third derivative of 50v4 + 13468v*3 + 4128049v*2 wrt v? 1200v + 80808 What is the second derivative of -3hw*3 + 216hw2 - 430316hw - 2h - 4w3 + 89w*2 + 16w wrt w? -18hw + 432h - 24w + 178 What is the second derivative of u5 - u3 - 45375170u2 - 43354764u? 20u3 - 6u - 90750340 Find the first derivative of -cj3 + 30308875cj2p*2 - 617c + j*3p - 1159j2 + 2j + 2p2 wrt p. 60617750cj2p + j*3 + 4p What is the derivative of 1348003c2y*2 - 45c*2 - 2cy2 - 219899830y*2 wrt c? 2696006cy2 - 90c - 2y2 What is the second derivative of 2188b*2z*2 + 8999b*2z + 4b2 + 185bz2 - 170445bz wrt b? 4376z*2 + 17998z + 8 Find the third derivative of -2j3v*3 - 22j*3v + 31j3 - 815j*2v*2 - 583512jv3 - 2v*4 + 4v*2 + 1 wrt v. -12j*3 - 3501072j - 48v Differentiate -768h*2 + 12621h + 128809472 with respect to h. -1536h + 12621 What is the second derivative of 13215054d*2i*2 + 6d*2i - 21di + 766d - 4i - 2 wrt i? 26430108d2 Find the second derivative of -49384474j*2 + 149j - 3737. -98768948 Differentiate 230210374m2 + 133966665. 460420748m Differentiate 40686183j4 + 32157379 wrt j. 162744732j*3 Differentiate -11690189d - 32658862 wrt d. -11690189 Find the third derivative of 3g5 - 1808437g*3 + 8619g*2 - g - 237. 180g*2 - 10850622 What is the second derivative of -2g*2r*3 + 17724760g*2r*2 + 3g*2r - 35gr + 244353r3 wrt g? -4r*3 + 35449520r*2 + 6r Find the first derivative of 158995662i2 - 147845180 wrt i. 317991324i Differentiate -2a3i*2 - 3039a*3 - 58357ai4 + 2i - 527 with respect to i. -4a3i - 233428ai*3 + 2 Find the third derivative of 2d*2m*4 + 2d*2m*2 - 5d*2m - 8434d2 - 134948825dm4 + 5d wrt m.	{ "pile_set_name": "DM Mathematics" }
? False Is 24673449293 composite? False Is 1136272057 a composite number? False Is 303925003 composite? True Is 20081244461 composite? False Is 2715047221 a prime number? True Is 950807569 a composite number? True Is 18945078247 composite? False Is 53731172767 prime? True Is 4540114837 a composite number? False Is 730764497 a composite number? False Is 3889860893 a composite number? False Is 779658533 a composite number? True Is 1217032171 a prime number? True Is 67741210583 prime? True Is 9772470931 composite? True Is 136524749 a composite number? True Is 363706597 composite? True Is 44171303399 composite? True Is 1171800793 composite? True Is 2197061149 composite? False Is 1492099031 a composite number? False Is 359106019 a prime number? True Is 1321386071 composite? True Is 12568697137 a composite number? True Is 918427931 prime? True Is 30344035259 prime? True Is 1036981999 composite? True Is 22211327 prime? True Is 36253735121 composite? False Is 5677176563 a composite number? False Is 267862297 prime? True Is 6696765191 a prime number? False Is 359663503 a composite number? True Is 6559224953 prime? False Is 31689509899 a prime number? True Is 325761349 a prime number? True Is 2264904799 composite? True Is 474618077 a composite number? False Is 34304033 a composite number? False Is 315395621 a composite number? True Is 83304219413 composite? False Is 76082004113 a composite number? False Is 1007962537 prime? False Is 56629373033 prime? True Is 561756697 composite? True Is 2948858527 prime? False Is 516832387 a prime number? True Is 4773504499 composite? True Is 513027763 prime? True Is 1857169519 a composite number? True Is 4641592367 prime? True Is 16622233 prime? True Is 4082030759 a composite number? False Is 1770754597 composite? False Is 49201495019 prime? False Is 35341496347 a prime number? True Is 9932101 prime? True Is 14918526967 prime? True Is 935461783 a prime number? False Is 832542199 composite? False Is 2346031283 a prime number? True Is 118993519261 a prime number? True Is 865493717 a composite number? True Is 606652883 prime? True Is 29508197 a composite number? True Is 8615499311 a prime number? True Is 3452143391 composite? False Is 5607224587 a prime number? True Is 10935075881 prime? True Is 5822058383 composite? False Is 1112205797 a composite number? True Is 4329691501 a composite number? False Is 58197434969 composite? False Is 375617273 composite? True Is 11166438761 composite? True Is 3538966591 a composite number? False Is 33015896321 prime? True Is 86986787987 a composite number? True Is 12032177 prime? False Is 85432104377 prime? False Is 1247183159 prime? False Is 7352555627 a composite number? True Is 18784760593 a composite number? False Is 6807495451 a composite number? False Is 12327789959 composite? False Is 12219516899 prime? True Is 5369205355 a composite number? True Is 84499869631 a composite number? True Is 15154306081 a prime number? False Is 305498371 a composite number? False Is 41347320123 prime? False Is 7465076162 a composite number? True Is 1176343843 composite? False Is 2738019819 a composite number? True Is 3781816673 a prime number? True Is 2899157993 a prime number? True Is 1950709637 composite? False Is 33595045297 a prime number? False Is 7873111537 a composite number? False Is 567374261 prime? True Is 12061904849 a prime number? True Is 2716066909 a composite number? False Is 15202703 prime? True Is 88398601957 a composite number? False Is 379402171 composite? True Is 8037317437 composite? True Is 801150659 a composite number? True Is 5576064119 prime? True Is 3174686899 composite? True Is 109494920347 a composite number? False Is 11350505297 prime? True Is 5017941437 composite? True Is 1323149023 composite? True Is 35922541 a composite number? False Is 10835339167 a composite number? False Is 2558585683 composite? False Is 3050581571 prime? False Is 15903500147 prime? True Is 5549716547 a prime number? False Is 12032523871 a prime number? False Is 676984061 composite? True Is 12110209415 prime? False Is 945888397 prime? True Is 428063087 prime? True Is 1005188761 prime? True Is 34274132017 a prime number? True Is 4307359007 a prime number? False Is 621533747 prime? True Is 1215696397 prime? False Is 5456257447 composite? False Is 21077527 composite? False Is 2558945717 composite? True Is 10175996057 prime? True Is 12961378253 composite? True Is 453051437 a prime number? True Is 804254047 prime? False Is 2474839203 a prime number? False Is 3949350841 a prime number? True Is 156135386569 prime? True Is 32961463159 composite? False Is 8555019335 prime? False Is 15031822874 a prime number? False Is 8075045939 prime? True Is 343597663 prime? True Is 157250713 a composite number? True Is 23794683677 composite? True Is 10967466997 prime? True Is 57431625331 composite? False Is 4607158897 prime? False Is 52233991 a composite number? True Is 2965535159 a composite number? True Is 2945760287 composite? True Is 2284821061 composite? True Is 239199329 a prime number? True Is 12740702209 a prime number? True Is 12096746573 a composite number? False Is 2897153471 a composite number? False Is 165787577 composite? True Is 93866177 composite? False Is 9893733589 prime? False Is 377976103 prime? False Is 3848804683 prime? True Is 126650773 a prime number? True Is 399189649 composite? False Is 397932023 prime? True Is 11290882831 composite? False Is 119460059 prime? False Is 346162493 composite? False Is 649839371 prime? True Is 9422108287 a composite number? True Is 14233151297 a composite number? False Is 65312339867 prime? True Is 1308351971 composite? False Is 18321115723 a prime number? False Is 6784562857 a composite number? False Is 1131562751 composite? True Is 5474844241 composite? False Is 828278747 a composite number? False Is 1156555003 composite? True Is 2483213453 a composite number? True Is 751998827 a composite number? False Is 6172786127 composite? True Is 20803613683 a composite number? True Is 248955319 a composite number? False Is 5719129501 composite? False Is 1219674347 a prime number? False Is 15985530011 prime? False Is 11865821369 composite? True Is 108631989363 a composite number? True Is 11366773661 a composite number? False Is 101690779067 a composite number? True Is 6310463047 a composite number? True Is 1716369185 a prime number? False Is 18085538351 composite? True Is 681447941 composite? True Is 5606706397 a prime number? True Is 2179393103 prime? True Is 69394129447 a prime number? True Is 177756577 a composite number? False Is 26786518393 a composite number? True Is 33274110179 composite? True Is 19121640371 prime? False Is 653369569 prime? False Is 25236459821 a prime number? True Is 6578821751 a prime number? True Is 6511510077 composite? True Is 4222428761 prime? True Is 146834759 composite? True Is 1612662101 a composite number? False Is 10557124873 prime? True Is 1799135761 a prime number? True Is 1719334367 a prime number? False Is 448052807 a composite number? True Is 33287190283 composite? False Is 257304083 composite? False Is 83731706813 prime? False Is 2219475197 a prime number? False Is 25203556207 composite? False Is 2283436769 a composite number? False Is 2721801637 composite? False Is 23474599 a prime number? True Is 14644453831 composite? True Is 101413573 prime? False Is 318306773 a prime number? True Is 10797414671 prime? False Is 912841063 composite? True Is 5074022197 a prime number? True Is 436085879 prime? False Is 27275231701 composite? False Is 596639917 a composite number? False Is 11707323413 prime? True Is 1604574823 prime? True Is 235717351 a composite number? True Is 7017303281 a composite number? True Is 5567286727 composite? False Is 4051734433 prime? True Is 41217046951 prime? True Is 5027662543 composite? False Is 2375881091 prime? True Is 9290642719 a prime number? False Is 152525447 a prime number? True Is 187702155919 composite? False Is 2150211241 a prime number? False Is 74016541 a prime number? True Is 2375216663 prime? True Is 1062098377 a prime number? False Is 1307758537 prime? True Is 287432237039 prime? True Is 31159574179 composite? False Is 32984577503 a prime number? True Is 5762022337 a composite number? False Is 306	{ "pile_set_name": "DM Mathematics" }
is divided by 11. 8 Suppose 2921 = 23b + 61b + 737. Let u(c) = c*2 + c + 9. Let k be 6/10 + (-3)/5. What is the remainder when b is divided by u(k)? 8 Suppose -146i = 5l - 148i - 3496, 4i + 2092 = 3l. Calculate the remainder when l is divided by 656. 44 Let d = -109 + 391. Suppose -6u + d = -48. Let t = u - 38. What is the remainder when 30 is divided by t? 13 Let f = -77 - -92. Let j = 18 - 30. Let x = j + 36. Calculate the remainder when x is divided by f. 9 Suppose -l + x - 5x + 20 = 0, -l - 3x = -15. Let k be l(11/(-3) - -4). Suppose -u - 4u + 110 = k. What is the remainder when 84 is divided by u? 18 Let g = 47 - 24. Suppose -19o = -3y - go + 94, 0 = 4y - 2o - 96. What is the remainder when 48 is divided by y? 22 Let v(l) = -l*2 + 30l - 171. Suppose 2f - 3 = -5p, -p = -0f + f. Calculate the remainder when 8/(2 + (p - 2)) is divided by v(22). 3 Suppose 77 = 2d + 87, -y + 1573 = 2d. Let h = 1612 - y. Let i = 104 + -33. Calculate the remainder when i is divided by h. 13 Let j = 19939 - 19719. What is the remainder when j is divided by 298/8 - (-5)/(-20)? 35 Let q(h) = h2 + 7h + 12. Suppose -857 - 466 = 7j. Let s be (1/(-3))/((-9)/j). What is the remainder when 34 is divided by q(s)? 10 Let k be (-1 - 2 - -2)13. Calculate the remainder when (8/(-12))/((-4)/462) is divided by (k/(-4)8)/(0 + 1). 25 Let x(m) be the second derivative of m5/4 - 7m4/6 + m2 - 9m - 2. Let n(b) = b + 2. What is the remainder when x(3) is divided by n(5)? 4 Let t = 3697 + -1912. Calculate the remainder when t is divided by 19. 18 Let z(a) = -164 + 45 + 48 + 9a + 40. Calculate the remainder when 9 is divided by z(4). 4 Suppose -58q + 408 = -61q. Let g = q - -309. What is the remainder when g is divided by 59? 55 Suppose -95o + 93o + 153 = 5m, -161 = -5m - 4o. What is the remainder when m is divided by (3 + -1)/((-2)/(-10))? 9 Suppose 4a + 29 = -5j, 2j + 15 = -6a + a. Let y(x) = -x3 + 14x*2 - 31x - 4. Calculate the remainder when y(9) is divided by (287/35)/((-1)/j). 40 Let s = 10112 - 9739. Calculate the remainder when 390 is divided by s. 17 Suppose 193k - 147434 = -30862. What is the remainder when 1834 is divided by k? 22 Let w = -9796 + 10095. Calculate the remainder when 602 is divided by w. 4 Suppose h - 12 = 5z + 26, 0 = h + z - 38. Let f = -23 - -364. Calculate the remainder when f is divided by h. 37 Let d = -5481 - -5704. Calculate the remainder when 693 is divided by d. 24 Suppose -80n + 78n = -4a + 266, 2n = 18. Calculate the remainder when 1156 is divided by a. 20 Let v = 13 - 3. Let r(z) = -21 - 60z + 7 + 61z. What is the remainder when v is divided by r(22)? 2 Let x(o) = o*3 + 17o*2 + 48o + 30. What is the remainder when 116 is divided by x(-13)? 34 Suppose -4z - 4b = -1992, 60z + 1999 = 64z - 3b. What is the remainder when z is divided by 35? 9 Let c(n) = 13 + 1578n*2 - 1577n*2 - 12n + 3n. Let o = -7 + 15. What is the remainder when c(o) is divided by 2? 1 Let v(u) = -2u - 2. Let s be v(-2). Let f(d) = 110413d + 10d*3 - 110413d - 3d2 + 1. Calculate the remainder when f(s) is divided by 8. 5 Let f(n) = -47n + 1592. What is the remainder when f(19) is divided by 18? 15 Let b be ((-4)/3)/((-6)/9). Let h(k) = -110k - 4. Let f(n) = 70n + 3. Let d(x) = 8f(x) + 5h(x). What is the remainder when d(b) is divided by 20? 4 Let n(f) = -21f - 2f + 30f + 118. What is the remainder when 53 is divided by n(-13)? 26 Suppose 0 = 58w + 1850 - 7534. Calculate the remainder when 375 is divided by w. 81 Suppose 0 = -4p - 2y + 146, -4y + 92 = 3p + y. Suppose 15262v - 1216 = 15246v. Calculate the remainder when v is divided by p. 37 Let z(k) = -19k + 918. What is the remainder when z(-22) is divided by 9? 4 Let x(y) = 58y*2 + 11y + 41. Let q be x(-5). Let k = q - 977. What is the remainder when k is divided by 33? 30 Suppose 2535 - 22200 = -23g. Let u = -821 + g. What is the remainder when 82 is divided by u? 14 Let q = 231 - 109. Let t be 3(150/(-18) + 4 - -4). What is the remainder when q is divided by (-29 - -28)/(t/41)? 40 Suppose -23q - 2c = -18q - 889, 3c = 3q - 504. What is the remainder when q is divided by 81? 13 Suppose -10954f + 10966f = 552. Calculate the remainder when 3155 is divided by f. 27 Let j(m) = 6m*2 + 1. Let b be j(1). Suppose -16c + 198 = -bc. Calculate the remainder when 306 is divided by c. 20 Suppose 2q - 2 = w - 0q, -3w + 16 = 5q. Let c = -1301 + 1301. Suppose c = wv - 78 + 10. What is the remainder when v is divided by 7? 6 Let m be ((-111)/(-5))/(19/(-95)). Let d = m + 305. Calculate the remainder when d is divided by (205/10 - -4)/((-1)/(-2)). 47 Let j(w) = 13w2 + 427w - 32. Calculate the remainder when 529 is divided by j(-33). 19 Let f(c) = -3c2 + 53c + 34. Let j be f(16). Calculate the remainder when 81 is divided by j/3 + 12/(-9 - -13). 40 Let r(h) = -15h3 + 31h + 208. Let u(v) = 7v3 - v2 - 15v - 104. Let s(a) = -6r(a) - 13u(a). What is the remainder when s(14) is divided by 18? 16 Let p(o) = o*3 + 5o*2. Let g be p(-5). Let q = g + 1. Let l = 17 + q. Calculate the remainder when l is divided by 10. 8 Calculate the remainder when (-1128)/(16 + (-15 - 2)) is divided by 80. 8 Let p = 2 - -3. What is the remainder when 17 - 15 - (14 + -60) is divided by p? 3 Suppose -j = 2g - 24, -g + 32 = 2j - 5g. Let r(t) = 2t - 7. Let q be r(-5). Let z = q + j. What is the remainder when 9 is divided by z? 0 Let o = -11560 - -11954. What is the remainder when o is divided by 78? 4 Let h(f) = f2 + 60f - 1162. What is the remainder when 4911 is divided by h(-76)? 51 Suppose 26x + 5 = 21x, -3t = -2x - 131. Let o = 81 - t. What is the remainder when 69 is divided by o? 31 Suppose -161263a = -161271a + 61760. What is the remainder when a is divided by 286? 284 Suppose 0 = -5v + 5x + 5030, -v = -3v - 4x + 2000. Let w(h) = -30h + 1974. What is the remainder when v is divided by w(63)? 80 Suppose -1323d - 496 = -1385d. What is the remainder when 21 is divided by d? 5 Let f(m) = m2 - 4m - 12. Let k(v) = v - 29 + v - 15v + 4v. Calculate the remainder when f(8) is divided by k(-4). 6 Calculate the remainder when 314 is divided by 53/(-689) - (-1146)/26. 6 Suppose -3r = -8r + 4p - 18, 3r = 2p - 10. Let b(f) = 5f*2 + 2f - 1. Calculate the remainder when (-6)/9 - (-5)/(45/384) is divided by b(r). 12 Suppose o = 4v - 2120, 5o = -0v + 2v - 1060. Let l = v + -214. What is the remainder when l is divided by 40? 36 Suppose -5i - 5k + 140 = 0, 0 = k + 96 - 102. Calculate the remainder when 6861 is divided by i. 19 Let n(x) = -10x3 + 105x*2 - 3x + 18. Calculate the remainder when n(9) is divided by 49. 30 Calculate the remainder when (22/33)/(4/31962) is divided by 24. 23 Calculate the remainder when 674 is divided by 22/1(-25651)/(-2486). 220 Let g = -516 - -819. Let b = g - 266. Calculate the remainder when b is divided by 29. 8 Calculate the remainder when -15826/(-24) is divided by (-1 - 12/(-9)) + 105/9. 7 Suppose -k + 42 = -3a, -3k + 91 = 3a + 13. Suppose ki = 343 - 103. Calculate the remainder when 45 is divided by i. 5 Calculate the remainder when 110 + 4 + 5/(-1) is divided by (34/(-70) + 640/2240)5-11. 10 What is the remainder when -114 - (-10428)/66 is divided by 62? 20 Suppose 3z - 3m - 231 = 0, -3z - 4m = -380 + 100. Calculate the remainder when 8230 is divided by z. 82 Suppose 1153 = -35f - 1993 + 16236. Calculate the remainder when f is divided by 145. 84 Let r be 2096/2045/6. Suppose 37v - 583 = r. Calculate the remainder when 587 is divided by v. 32 Let w(b) = -8b - 5. Suppose 2d = 3d - f - 340, -3d + 1020 = 4f. Let r = d - 262. What is the remainder when r is divided by w(-4)? 24 Calculate the remainder when (7 + -13)((-10290)/18)/7 is divided by 26. 22 Let a(h) = h2 + 2h - 7. Let z be a(6). Let n = z + -18. Calculate the remainder when n is divided by 1 + (-42)/6 - -18. 11 Suppose -39 = -6y + 3. Let i(b) = -b3 + 8b*2 - 6b + 4. Calculate the remainder when 13 is divided by i(y). 2 Calculate the remainder when (4 + -1)*(-26 + 8450/30) is divided by 254. 5 Calculate the remainder when 629 is divided by -3 + (5 - (18 - 10)) - (-1 + -138). 97	{ "pile_set_name": "DM Mathematics" }
- 31085x/4 + 73425/4 = 0? -3, 11/6, 5, 89 Determine t, given that -3t*5 + 339t*4 - 7734t*3 - 25266t*2 - 25959t - 8769 = 0. -1, 37, 79 Factor -z*2/3 - 23629072z/3 - 7876357. -(z + 1)(z + 23629071)/3 Solve -2a*5/15 + 50a*4/3 - 10808a*3/15 + 188488a*2/15 - 1136096a/15 + 1600768/15 = 0. 2, 8, 26, 37, 52 Suppose 4z3 + 38292z*2 + 802784z + 3973632 = 0. What is z? -9552, -13, -8 What is v in 2v3 - 5300v*2 + 275062v + 571340 = 0? -2, 55, 2597 Let 16o2 - 208001964o - 52000492 = 0. Calculate o. -1/4, 13000123 Let s*5/3 - 331s*4/3 + 10623s*3 - 824681s*2/3 + 8263574s/3 - 9615144 = 0. What is s? 11, 126, 172 Solve -5x2/6 - 699468505x/3 - 97851237897387005/6 = 0. -139893701 Factor 3v2 + 115569222v + 1113020422807107. 3(v + 19261537)2 Determine x so that 4x*2 - 9916x - 10476488 = 0. -799, 3278 Find t, given that -t*5 - 434t*4 + 10562t*3 + 23284t*2 - 10561t - 22850 = 0. -457, -2, -1, 1, 25 Let -2g4/3 + 106g*3 - 6376g*2/3 - 129800g = 0. Calculate g. -25, 0, 66, 118 Solve n*4/6 + 12373n*3/3 + 67057727n*2/2 + 297459614698n/3 + 288985465566338/3 = 0. -9959, -2414 Let 3o5 - 774o*4 - 2124o*3 + 6663192o*2 + 232328448o + 437999616 = 0. Calculate o. -48, -2, 178 Factor 33933948206349636a2 - 1473693552a + 16. 4(92105847a - 2)*2 Factor -2x*2/7 + 69150x/7 + 69164. -2(x - 34582)(x + 7)/7 Suppose 5h5 - 350h*4 + 4695h*3 + 41850h*2 = 0. Calculate h. -6, 0, 31, 45 Factor 3g*2 + 449351490g + 16826396797101675. 3(g + 74891915)2 What is n in -3n*5 + 15352n*4 + 2822745n*3 + 84129438n*2 + 716031296n + 440796672 = 0? -144, -17, -2/3, 5296 What is v in -3v4/4 + 465v*3/2 + 5220v*2 - 4185v/2 - 187677/4 = 0? -21, -3, 3, 331 Factor -2a4/3 + 46478a*3/3 - 2312650a*2 + 86583750a. -2a(a - 23089)(a - 75)2/3 Let 5m*2 - 127740m - 1405745 = 0. What is m? -11, 25559 Determine n, given that 3n4/4 - 1353n*3/4 + 28059n*2/4 + 110145n/4 - 160875/2 = 0. -5, 2, 25, 429 Find a such that -a*2/3 - 1078814a = 0. -3236442, 0 Find d such that -2d4 + 6356d*3 + 19086d*2 = 0. -3, 0, 3181 What is y in -30y*5 - 12085y*4 - 833130y*3 + 5291220y*2 - 10778200y + 7250880 = 0? -312, -581/6, 2 Find k such that -5k2 + 138530k - 9259065 = 0. 67, 27639 Find b such that -b*2 + 3285728b - 2699002122496 = 0. 1642864 Find i such that 319i3/4 + 10342297i*2/2 + 335307416511i/4 - 1051121241 = 0. -32421, 4/319 Solve 3x4/4 - 9888x*3 - 356211x*2/4 = 0. -9, 0, 13193 Find g such that 2g*4/13 + 65428g*3/13 - 14360120g*2/13 - 58225552g/13 - 58487232/13 = 0. -32932, -2, 222 Factor -b*2/2 + 2927b + 942480. -(b - 6160)(b + 306)/2 Suppose 4x*3 - 154020x*2 + 64737696x - 64583680 = 0. Calculate x. 1, 424, 38080 Let -2q4/7 + 490q*3 - 37550q*2/7 + 105690q/7 - 10224 = 0. What is q? 1, 3, 7, 1704 Factor -3v2 - 32071212v - 85713553262412. -3(v + 5345202)2 Factor -3h*3 - 219168h*2 + 3068793h - 10741290. -3(h - 7)2(h + 73070) Factor -136c3 + 78199c*2 - 155281c - 1146. -(c - 573)(c - 2)(136c + 1) Find q, given that 5q*5 - 155q*4 - 3805q*3 - 13005q*2 - 9360q = 0. -13, -3, -1, 0, 48 Let -5o3 + 111661930o*2 - 623419218904300o - 1246838884456360 = 0. Calculate o. -2, 11166194 Let -2q2/17 + 3709150q/17 - 3709148/17 = 0. What is q? 1, 1854574 Factor 3b2 + 1295913b - 2591838. 3(b - 2)(b + 431973) Determine z, given that -3z2/4 + 8879139z/4 + 22197885/2 = 0. -5, 2959718 Find g such that -g*3/4 + 821g*2/2 + 11663g/4 - 49470 = 0. -15, 8, 1649 Factor 5a3 + 10875a*2 + 3346875a + 279453125. 5(a + 175)2(a + 1825) Suppose -5u2 + 595875u + 9535280 = 0. Calculate u. -16, 119191 Find w such that -2w4/5 + 1016w*3/5 + 52578w*2/5 - 45288w = 0. -51, 0, 4, 555 Factor -2r2/5 + 3206r + 903952/5. -2(r - 8071)(r + 56)/5 Factor 2r5 - 517616r*4 - 7764540r*3 - 38823200r*2 - 64705750r. 2r(r - 258823)(r + 5)3 Suppose d2/2 + 11322721d + 128204010843841/2 = 0. What is d? -11322721 Solve 2o3 + 203418o*2 + 5145507120o - 1367374975096 = 0 for o. -50986, 263 Factor x*2/4 - 1630723x/2 + 3261445/4. (x - 3261445)(x - 1)/4 Find u, given that -u2/3 - 1839920u/3 - 7359664/3 = 0. -1839916, -4 Find f, given that -874f5/5 - 1358166f*4/5 - 4020098f*3/5 + 145806f*2/5 + 18612f/5 = 0. -1551, -3, -1/19, 0, 2/23 Factor -4g2 + 830296g - 7472340. -4(g - 207565)(g - 9) Solve -3h4/2 + 109323h*3/2 - 498662565h*2 + 12434935104h - 22875657216 = 0 for h. 2, 23, 18208 What is y in 553536y3 + 53206990368y*2 + 286059076y + 384488 = 0? -96122, -1/372 Solve 2f3/7 + 2442f*2/7 - 19640f/7 + 29496/7 = 0. -1229, 2, 6 Find s such that s*5/2 - 12290s*4 - 8094451s*3/2 + 4059515s2 = 0. -326, 0, 1, 24905 Factor c4/6 + 114361c3/6 - 228728c*2/3 + 228730c/3. c(c - 2)2(c + 114365)/6 Determine x so that -77x4/6 - 143833x*3/6 + 1015459x*2/6 - 494365x/2 + 9375 = 0. -1875, 3/77, 2, 5 Determine c so that -8c4 + 481911c*3 - 903553c*2 - 120474c = 0. -1/8, 0, 2, 60237 Determine o, given that 2o4/11 - 3819408o*3/11 - 3819410o2/11 = 0. -1, 0, 1909705 Factor y2 + 30996y + 7625504. (y + 248)(y + 30748) Solve 2l4 + 1080108l*3 + 15121218l*2 + 52923920l = 0. -540040, -7, 0 Factor -2i2/7 + 463306i + 3243156. -2(i - 1621578)(i + 7)/7 Factor -j*2 + 243825634j - 14862734948875489. -(j - 121912817)2 Factor d2/2 + 174325d + 13595829/2. (d + 39)(d + 348611)/2 Factor 4u2 - 17642u + 1639890. 2(u - 95)(2u - 8631) Suppose 5l*3 + 382113135l*2 + 764226255l + 382113125 = 0. What is l? -76422625, -1 Factor 26c2/3 + 7318c + 1339776. 2(c + 576)(13c + 3489)/3 Solve -915i*5/2 + 7255i*4/4 + 2875i*3/2 - 25425i*2/4 + 6865i/2 + 130 = 0 for i. -2, -13/366, 1, 4 Let 3o5/5 - 264o*3 + 738o*2 + 72597o/5 - 14994 = 0. What is o? -21, -7, 1, 10, 17 Factor -4c2/3 - 62568c + 169467456. -4(c - 2568)(c + 49494)/3 Determine k so that 9k5 + 42664989k*4 - 170660055k*3 + 213325107k*2 - 85330050k = 0. -14221675/3, 0, 1, 2 Factor z*2 + 6810z - 15518824. (z - 1802)(z + 8612) Factor -2o*3/3 + 45424o*2 - 3358638o + 186353756/3. -2(o - 68062)(o - 37)*2/3 Factor -3x*2 + 56319x - 4597986. -3(x - 18691)(x - 82) Suppose 6k3/5 + 22491402k*2/5 + 4215519618618k - 12646599340410 = 0. Calculate k. -1874285, 3 Solve -26z2 - 318514z + 1102860 = 0. -12254, 45/13 Suppose -k*2 - 44503k + 267054 = 0. What is k? -44509, 6 Factor -6t5/5 + 608526t*4/5 - 121704t*3. -6t*3(t - 101420)(t - 1)/5 Factor 18c*3 - 11431041c*2 + 1814842079964c + 302473997523. 3(c - 317529)2(6c + 1) Determine h so that -2h*2/23 - 24360236h/23 - 74177637246962/23 = 0. -6090059 Factor -d*3 - 759d*2 + 6904d - 6144. -(d - 8)(d - 1)(d + 768) Factor -t*4 + 84758t*3 - 1791991597t*2 - 169009316676t - 3976123736484. -(t - 42426)*2(t + 47)*2 Solve -15w*2 - 817190w - 101100920 = 0. -163066/3, -124 Factor -t*2 + 369873778t - 34201652912998321. -(t - 184936889)*2 Let 5x*4 - 6040x*3 - 666140x*2 - 2567600x = 0. Calculate x. -98, -4, 0, 1310 Find s such that s*5/3 + 91s*4/3 - 4038s*3 + 224996s*2/3 + 158840s/3 - 3291200 = 0. -170, -6, 8, 22, 55 Let -16m3 - 279733724m*2 - 1222671157891224m + 305667806956164 = 0. What is m? -8741679, 1/4 Find q such that -q*3/2 - 8316077q*2 - 69157136669929q/2 = 0. -8316077, 0 Find b, given that b*2 + 14497322b + 52543086292921 = 0. -7248661 Find l, given that 2l3/3 + 464l*2 + 21102l - 64700/3 = 0. -647, -50, 1 Find t, given that -2t2 - 2516590t = 0. -1258295, 0 Find t, given that -4t4/5 + 408t*3 + 622048t*2/5 + 42823296t/5 + 96671232 = 0. -108, -14, 740 Factor -j*2/5 - 1320234j/5 - 2640464/5. -(j + 2)(j + 1320232)/5 Suppose -15v*3 + 96320v*2 - 98720095v - 65856210 = 0. What is v? -2/3, 1281, 5141 Find n, given that n*3/2 - 3456034n*2 + 6912067n/2 = 0. 0, 1, 6912067 Factor 3u2 - 84899808u + 600664783203072. 3(u - 14149968)2 Find x, given that -2x*4 - 2160x*3 - 200630x*2 + 617040x - 414248 = 0. -977, -106, 1, 2 Factor -3r2 + 64674837r + 64674840. -3(r - 21558280)(r + 1) Factor -4t	{ "pile_set_name": "DM Mathematics" }
nce me? 3/20 Two letters picked without replacement from {p: 2, c: 1, f: 1, s: 1, b: 2, g: 1}. What is prob of sequence gb? 1/28 Two letters picked without replacement from illbiiililbii. What is prob of sequence il? 7/39 Calculate prob of sequence vjy when three letters picked without replacement from jvjpjpvcjy. 1/90 What is prob of sequence uee when three letters picked without replacement from {y: 1, g: 1, e: 2, r: 1, u: 2}? 2/105 What is prob of sequence ina when three letters picked without replacement from {r: 2, n: 3, a: 1, v: 6, i: 2}? 1/364 Calculate prob of sequence pk when two letters picked without replacement from bpzcpzckzccc. 1/66 What is prob of sequence fll when three letters picked without replacement from {l: 2, f: 5, n: 2}? 5/252 Calculate prob of sequence een when three letters picked without replacement from leeelllllllllnnlnl. 1/272 Three letters picked without replacement from ooooo. Give prob of sequence ooo. 1 Three letters picked without replacement from pwpzkupwpowkwkzppo. What is prob of sequence kpw? 1/68 Two letters picked without replacement from pyypypyppyn. What is prob of sequence yn? 1/22 Three letters picked without replacement from {c: 8, q: 2, t: 2}. Give prob of sequence qtc. 4/165 Calculate prob of sequence jr when two letters picked without replacement from {r: 1, q: 1, t: 1, b: 1, s: 2, j: 1}. 1/42 Four letters picked without replacement from {y: 3, o: 3, q: 3, d: 8}. Give prob of sequence dooy. 3/1190 Calculate prob of sequence hhh when three letters picked without replacement from {l: 7, h: 12}. 220/969 What is prob of sequence xsr when three letters picked without replacement from ssurxarhsxr? 1/55 Four letters picked without replacement from {o: 11, n: 1}. Give prob of sequence oooo. 2/3 Calculate prob of sequence nnkk when four letters picked without replacement from {n: 9, k: 9}. 6/85 What is prob of sequence ovvv when four letters picked without replacement from oovavavaaa? 1/420 Three letters picked without replacement from {x: 2, o: 2, g: 1, i: 1, l: 1}. What is prob of sequence oxx? 2/105 Calculate prob of sequence yaxg when four letters picked without replacement from {a: 2, y: 1, w: 2, x: 1, g: 1, v: 1}. 1/840 Two letters picked without replacement from {k: 2, t: 1, w: 1}. Give prob of sequence tw. 1/12 Three letters picked without replacement from {h: 1, x: 3, f: 3, m: 3, b: 1, z: 7}. What is prob of sequence zzz? 35/816 What is prob of sequence ou when two letters picked without replacement from {i: 2, o: 1, u: 2}? 1/10 Three letters picked without replacement from {r: 4, n: 4, j: 3}. What is prob of sequence nnn? 4/165 What is prob of sequence bb when two letters picked without replacement from buubbuu? 1/7 Two letters picked without replacement from pffrrppncfnffonrf. Give prob of sequence fc. 3/136 Calculate prob of sequence ytzz when four letters picked without replacement from {z: 8, t: 2, l: 7, y: 1}. 7/4590 What is prob of sequence zzwb when four letters picked without replacement from {w: 8, z: 4, b: 5}? 1/119 Four letters picked without replacement from kkkkkkkkkkuku. Give prob of sequence kkku. 3/26 What is prob of sequence tt when two letters picked without replacement from atttttttatt? 36/55 What is prob of sequence oo when two letters picked without replacement from ooooooooooooooxoooo? 17/19 Two letters picked without replacement from kkkhhkkkkkkh. Give prob of sequence kk. 6/11 Four letters picked without replacement from {f: 5, j: 6, t: 4, p: 1}. What is prob of sequence jjft? 5/364 What is prob of sequence og when two letters picked without replacement from {j: 8, g: 2, o: 1, s: 2, k: 1}? 1/91 Two letters picked without replacement from kknyfykyysyy. Give prob of sequence kn. 1/44 Calculate prob of sequence zz when two letters picked without replacement from zrzrrzrrnji. 3/55 What is prob of sequence mff when three letters picked without replacement from vmvfvmfv? 1/84 Calculate prob of sequence rvf when three letters picked without replacement from {r: 2, v: 4, g: 2, e: 3, k: 1, f: 3}. 4/455 Three letters picked without replacement from {n: 3, a: 2, s: 2, f: 4}. Give prob of sequence faa. 4/495 What is prob of sequence rsrr when four letters picked without replacement from rrssrsrsrssrssrssss? 35/1292 What is prob of sequence gb when two letters picked without replacement from {g: 3, z: 2, h: 1, b: 4}? 2/15 What is prob of sequence zzfz when four letters picked without replacement from ffffzffzffffffzf? 1/560 What is prob of sequence qggz when four letters picked without replacement from azgqzqzapzqzgq? 5/3003 Four letters picked without replacement from mmmtmgmmmg. What is prob of sequence gtgm? 1/360 What is prob of sequence ccl when three letters picked without replacement from {l: 13, c: 6}? 65/969 What is prob of sequence okk when three letters picked without replacement from {k: 3, q: 1, o: 1, s: 1, d: 1}? 1/35 What is prob of sequence vvvv when four letters picked without replacement from {v: 5}? 1 What is prob of sequence vvvg when four letters picked without replacement from {g: 6, v: 6}? 2/33 What is prob of sequence tyzy when four letters picked without replacement from qztdttqqtzytyttza? 1/1360 Calculate prob of sequence ygo when three letters picked without replacement from grdoy. 1/60 Two letters picked without replacement from {g: 5, y: 3, l: 1, c: 1}. What is prob of sequence yc? 1/30 Two letters picked without replacement from {y: 1, b: 17, f: 1}. What is prob of sequence fb? 17/342 Calculate prob of sequence ww when two letters picked without replacement from {i: 1, e: 1, w: 2, r: 2}. 1/15 Two letters picked without replacement from ccbccyccycccbcbcc. What is prob of sequence cc? 33/68 Four letters picked without replacement from zqzzzeezzeeeez. What is prob of sequence ezez? 15/286 Three letters picked without replacement from {z: 1, y: 1, q: 1, i: 2, m: 2}. What is prob of sequence qii? 1/105 Three letters picked without replacement from urwrqaquujwuurujura. What is prob of sequence wra? 8/2907 Two letters picked without replacement from {o: 2, s: 6}. Give prob of sequence os. 3/14 Three letters picked without replacement from {k: 2, x: 1, e: 5, c: 7, l: 1}. Give prob of sequence ekk. 1/336 What is prob of sequence ss when two letters picked without replacement from spsppppp? 1/28 Two letters picked without replacement from {w: 5, v: 4, n: 3}. Give prob of sequence vn. 1/11 Three letters picked without replacement from urlru. Give prob of sequence ruu. 1/15 Two letters picked without replacement from {a: 2, r: 1, h: 3, s: 1, n: 7}. What is prob of sequence sn? 1/26 Three letters picked without replacement from {u: 1, z: 2}. Give prob of sequence zzu. 1/3 What is prob of sequence bs when two letters picked without replacement from shbshhhdhhsssshhshh? 7/342 Calculate prob of sequence tttt when four letters picked without replacement from ttttttttatat. 14/33 Four letters picked without replacement from oooooohohhoohh. What is prob of sequence hooo? 15/143 Four letters picked without replacement from {b: 3, u: 2, i: 12, z: 3}. What is prob of sequence buiz? 3/1615 Calculate prob of sequence aao when three letters picked without replacement from oaaaaoaooorarrrrroa. 14/323 Four letters picked without replacement from ccvhh. What is prob of sequence vhch? 1/30 Three letters picked without replacement from {q: 4, k: 2, h: 3, d: 10}. Give prob of sequence hkk. 1/969 Four letters picked without replacement from {x: 1, q: 1, o: 1, s: 3, h: 2, c: 4}. What is prob of sequence ossq? 1/1980 What is prob of sequence hth when three letters picked without replacement from {h: 5, s: 1, t: 12}? 5/102 Three letters picked without replacement from {r: 1, c: 11, e: 2}. Give prob of sequence cec. 55/546 Three letters picked without replacement from {a: 5, l: 8, i: 5}. Give prob of sequence aal. 5/153 Three letters picked without replacement from {a: 6, e: 4}. Give prob of sequence eee. 1/30 What is prob of sequence ffr when three letters picked without replacement from zbffrzzbrzhzn? 1/429 Three letters picked without replacement from ffqhlllfhqddqff. Give prob of sequence qld. 3/455 Calculate prob of sequence ysy when three letters picked without replacement from s	{ "pile_set_name": "DM Mathematics" }
92.09 What is 951.2213ns in microseconds? 0.9512213 What is 141.4625 decades in centuries? 14.14625 How many millimeters are there in one tenth of a centimeter? 1 Convert 86694.19 meters to nanometers. 86694190000000 How many days are there in 214.483491s? 0.0024824478125 What is 645.731 years in centuries? 6.45731 Convert 59121.4ml to litres. 59.1214 What is six fifths of a second in milliseconds? 1200 What is 11564.17g in micrograms? 11564170000 How many seconds are there in 11/10 of a minute? 66 How many years are there in 94.07961 months? 7.8399675 Convert 993868.3ml to litres. 993.8683 How many millilitres are there in 19/4 of a litre? 4750 What is 21/5 of a litre in millilitres? 4200 Convert 60239.34 months to decades. 501.9945 What is fifty-five halves of a decade in months? 3300 How many decades are there in 629.5 years? 62.95 How many millilitres are there in eighty-five quarters of a litre? 21250 Convert 23008.93 micrograms to tonnes. 0.00000002300893 How many nanograms are there in 86614.35 milligrams? 86614350000 What is 41.66433ml in litres? 0.04166433 What is 54/5 of a millennium in years? 10800 How many centimeters are there in 75/4 of a meter? 1875 How many seconds are there in 10/3 of a hour? 12000 Convert 5.754483 meters to micrometers. 5754483 How many milligrams are there in 6/25 of a gram? 240 Convert 0.9191719mm to kilometers. 0.0000009191719 What is 94.9158 centimeters in kilometers? 0.000949158 What is 67.78986 decades in years? 677.8986 How many kilograms are there in 1/4 of a tonne? 250 How many hours are there in 48.087 days? 1154.088 What is 37.25042 centuries in millennia? 3.725042 Convert 608245.9mg to micrograms. 608245900 How many grams are there in 3/5 of a kilogram? 600 What is three eighths of a gram in milligrams? 375 Convert 4033.856 millennia to years. 4033856 What is 19/10 of a day in minutes? 2736 What is 87/2 of a meter in millimeters? 43500 What is 3/10 of a micrometer in nanometers? 300 What is twenty-one eighths of a litre in millilitres? 2625 Convert 27425.77 millilitres to litres. 27.42577 Convert 27.25835mg to nanograms. 27258350 What is 0.9302404km in centimeters? 93024.04 How many millilitres are there in 17/10 of a litre? 1700 How many nanometers are there in 3/5 of a micrometer? 600 What is 971.4595ug in grams? 0.0009714595 What is 5926.026 millennia in centuries? 59260.26 How many seconds are there in 1/4 of a day? 21600 How many seconds are there in one ninth of a day? 9600 Convert 9913.459 decades to years. 99134.59 What is 45/8 of a micrometer in nanometers? 5625 What is 532.9284 grams in kilograms? 0.5329284 What is 429575.58 minutes in weeks? 42.616625 How many millimeters are there in 7808.66 micrometers? 7.80866 How many centimeters are there in 9/10 of a kilometer? 90000 How many nanograms are there in 3/10 of a microgram? 300 What is seven fifteenths of a millennium in months? 5600 How many millennia are there in 7.308049 decades? 0.07308049 Convert 0.7508306 years to decades. 0.07508306 What is 9856.294m in kilometers? 9.856294 How many litres are there in 0.9299617 millilitres? 0.0009299617 What is 12/25 of a litre in millilitres? 480 What is 5/24 of a millennium in months? 2500 What is 2620.535 millilitres in litres? 2.620535 Convert 5.90144 nanograms to milligrams. 0.00000590144 What is 64884.66 hours in nanoseconds? 233584776000000000 Convert 1038.01284 microseconds to days. 0.0000000120140375 How many minutes are there in one ninth of a week? 1120 What is 4.965772 meters in centimeters? 496.5772 How many millennia are there in 365235.9 months? 30.436325 What is twenty-seven quarters of a milligram in micrograms? 6750 How many months are there in 25/2 of a year? 150 What is 8072.031 decades in years? 80720.31 What is 87/2 of a meter in centimeters? 4350 What is 693856.9l in millilitres? 693856900 What is eleven halves of a micrometer in nanometers? 5500 What is 3/10 of a millimeter in micrometers? 300 Convert 33.67011mm to meters. 0.03367011 Convert 0.6393852 minutes to nanoseconds. 38363112000 Convert 10.893ml to litres. 0.010893 How many millilitres are there in eleven quarters of a litre? 2750 How many micrometers are there in 54.27922m? 54279220 How many millilitres are there in 3/50 of a litre? 60 Convert 83197.7 years to months. 998372.4 How many months are there in 908327.4 millennia? 10899928800 What is 1/5 of a litre in millilitres? 200 What is 4548.837 millilitres in litres? 4.548837 What is 0.6715071 millilitres in litres? 0.0006715071 What is 3.368115 years in decades? 0.3368115 How many microseconds are there in 1151.863 hours? 4146706800000 Convert 1227125.7ns to minutes. 0.000020452095 Convert 3646.284 litres to millilitres. 3646284 How many micrometers are there in 53/4 of a millimeter? 13250 How many seconds are there in 2/15 of a hour? 480 What is 8.276164 millilitres in litres? 0.008276164 How many nanograms are there in 7/4 of a microgram? 1750 How many nanometers are there in 1/4 of a micrometer? 250 How many litres are there in 0.6541209 millilitres? 0.0006541209 What is 5516.004 months in millennia? 0.459667 How many decades are there in 7/2 of a millennium? 350 What is 49/5 of a meter in millimeters? 9800 How many kilometers are there in 83.04712 nanometers? 0.00000000008304712 How many meters are there in 2931.434um? 0.002931434 Convert 0.4452097kg to nanograms. 445209700000 What is thirty-one halves of a litre in millilitres? 15500 What is six fifths of a millimeter in micrometers? 1200 Convert 0.681299mg to micrograms. 681.299 Convert 564.5096 millennia to years. 564509.6 How many millilitres are there in thirty-two fifths of a litre? 6400 How many millilitres are there in 0.2001917l? 200.1917 How many nanograms are there in 88.79729 kilograms? 88797290000000 How many centimeters are there in 695.4226nm? 0.00006954226 What is 926212.5cm in meters? 9262.125 Convert 369927.5 kilograms to micrograms. 369927500000000 How many seconds are there in 0.2937356 weeks? 177651.29088 What is 4868.207m in micrometers? 4868207000 What is 587620.2 microseconds in nanoseconds? 587620200 How many centimeters are there in 905.1216um? 0.09051216 What is 11/4 of a day in hours? 66 How many milligrams are there in 7/8 of a gram? 875 What is 7.790191 weeks in hours? 1308.752088 How many months are there in 8/3 of a century? 3200 How many seconds are there in 3/25 of a week? 72576 What is 3/8 of a microgram in nanograms? 375 Convert 1944398.4 months to millennia. 162.0332 What is 330.77277s in hours? 0.091881325 How many nanometers are there in 1/16 of a millimeter? 62500 How many seconds are there in fourty-eight fifths of a hour? 34560 Convert 32906.92l to millilitres. 32906920 How many years are there in 5.911 centuries? 591.1 What is 3/40 of a milligram in nanograms? 75000 How many litres are there in 75.25951ml? 0.07525951 Convert 568130.9 centimeters to millimeters. 5681309 Convert 0.1913251 nanograms to kilograms. 0.0000000000001913251 Convert 24495.89 micrometers to centimeters. 2.449589 Convert 36.9656973ms to weeks. 0.00000006112053125 What is 1/4 of a litre in millilitres? 250 What is 2.91419l in millilitres? 2914.19 How many millimeters are there in 11/8 of a meter? 1375 How many grams are there in eighteen fifths of a kilogram? 3600 Convert 83.99812 hours to nanoseconds. 302393232000000 What is thirty-seven halves of a year in months? 222 What is 1/5 of a milligram in micrograms? 200 How many tonnes are there in 0.7948826ng? 0.0000000000000007948826 What is sixty-seven thirds of a century in months? 26800 How many millennia are there in 744.3315 decades? 7.443315 Convert 40.2796 kilometers to micrometers. 40279600000 What is fourty-nine quarters of a hour in minutes? 735 How many milligrams are there in 7/2 of a gram? 3500 How many milliseconds are there in nine tenths of a minute? 54000 How many millilitres are there in three eighths of a litre? 375 How many meters are there in eleven quarters of a kilometer? 2750 How many grams are there in 3/25 of a kilogram? 120 What is fourty-three halves of a litre in millilitres? 21500 How many centuries are there in 6.521172 years? 0.06521172 How many litres are there in 7247.023 millilitres? 7.247023 What is 3/32 o	{ "pile_set_name": "DM Mathematics" }
-1659009 4102341 divided by -16 -4102341/16 Calculate 0 divided by 35496697. 0 What is 18653850 divided by 25? 746154 What is 6068830 divided by -71398? -85 Calculate 105966 divided by -87. -1218 What is -2054455 divided by 65? -31607 Calculate -966095 divided by 6. -966095/6 What is 86210 divided by 1828? 43105/914 -11537591 divided by -349 33059 Divide -5 by -8030953. 5/8030953 Calculate 3184657 divided by 9. 3184657/9 Divide -2 by 74906581. -2/74906581 25 divided by 2314618 25/2314618 5 divided by 75165029 5/75165029 Divide 791725 by 1. 791725 -11510668 divided by -11510668 1 Calculate -11531504 divided by 10757. -1072 Calculate -138067284 divided by 6. -23011214 Divide 2352144 by -4. -588036 What is 15231405 divided by -3? -5077135 -171788661 divided by -3 57262887 Divide 186701409 by -6. -62233803/2 What is -274787034 divided by -3? 91595678 3573 divided by 3056 3573/3056 92089127 divided by -5 -92089127/5 What is -41829392 divided by 14032? -2981 Calculate -165863121 divided by -3. 55287707 Divide 21550725 by -615735. -35 What is 2188381 divided by -299? -7319 Calculate 13638078 divided by -6. -2273013 Divide -39319219 by 6. -39319219/6 Calculate 25695 divided by 416. 25695/416 What is -26959500 divided by 6? -4493250 -197263105 divided by -15174085 13 Divide -3493530 by 116451. -30 What is 21265755 divided by 4253151? 5 Divide -9335 by 22880. -1867/4576 Divide -282280 by -457. 282280/457 Divide -21020215 by -5. 4204043 Divide 25 by 1939605. 5/387921 Calculate 131846514 divided by -1. -131846514 What is -9096239 divided by 16? -9096239/16 What is -3090 divided by -20060? 309/2006 Calculate -9166 divided by 76. -4583/38 Divide -25929469 by -5. 25929469/5 727932 divided by -181983 -4 -433 divided by -413447 433/413447 Calculate 1043483 divided by -22. -1043483/22 Calculate 7427808 divided by 27. 275104 Divide -16536330 by -1837370. 9 -156778 divided by -197 156778/197 What is -390063258 divided by -1417? 275274 Calculate 565358 divided by -1. -565358 What is -199437 divided by -123? 66479/41 Divide 82040424 by -12. -6836702 Calculate -22894446 divided by 22894446. -1 Divide 57270 by 364. 28635/182 Divide 1120577 by 2. 1120577/2 287028770 divided by 911 315070 -430 divided by -832498 215/416249 Calculate -27 divided by 490309. -27/490309 Divide -126512712 by -3. 42170904 What is -108743 divided by 14594? -108743/14594 What is -5 divided by -12006411? 5/12006411 What is 22 divided by 1233085? 22/1233085 Calculate -120197 divided by -3539. 120197/3539 Divide -1209705300 by -6. 201617550 Calculate 1480275 divided by -51. -29025 What is 6930368 divided by 866296? 8 Calculate 17861 divided by -190. -17861/190 -64469750 divided by -2 32234875 Calculate -2 divided by -1459200. 1/729600 -636488 divided by 19 -636488/19 -1 divided by -17482468 1/17482468 What is -5463384 divided by -3908? 1398 Calculate -587343280 divided by -73417910. 8 Calculate -3 divided by 6916442. -3/6916442 Divide 25650440 by -5. -5130088 What is -926311 divided by 53? -926311/53 What is -25 divided by -945009? 25/945009 Calculate -4 divided by 22565646. -2/11282823 Calculate -69767766 divided by -23255922. 3 What is -6617910 divided by 125? -1323582/25 Divide -5 by 1800971. -5/1800971 What is 2139 divided by -8741? -2139/8741 37013832 divided by 9 4112648 -2278458 divided by 1498 -1521 -149920808 divided by 12328 -12161 -20899287 divided by -5 20899287/5 169727978 divided by -2 -84863989 -7 divided by 10874819 -7/10874819 What is -657337200 divided by 164334300? -4 Divide 34115850 by -379065. -90 What is -971326 divided by 971326? -1 Divide 8780041 by -204187. -43 Calculate 28655865 divided by 21. 1364565 What is -822120 divided by -822120? 1 Calculate -1332537 divided by 18. -444179/6 Calculate 111 divided by 264539. 111/264539 Divide -7499785 by 1499957. -5 What is -58 divided by -4270297? 58/4270297 What is -11125760 divided by 1112576? -10 -12 divided by -1301047 12/1301047 -18453 divided by -935 18453/935 Divide 35051094 by -39. -898746 Calculate 592828 divided by 120. 148207/30 What is -551828791 divided by -1? 551828791 Divide -1732796832 by -6. 288799472 Divide 44853361 by -2257. -19873 Calculate -234540416 divided by -16. 14658776 Divide 376 by 83565. 376/83565 Divide -1 by -52515819. 1/52515819 -19189 divided by 511 -19189/511 Calculate 3091 divided by -185982. -3091/185982 Divide 62123780 by -69802. -890 -1769936240 divided by -5 353987248 What is 67 divided by -54593? -67/54593 Calculate -5830205 divided by 1166041. -5 Calculate 27599440 divided by 6352. 4345 Divide -3325 by 18533. -3325/18533 Calculate 285328 divided by -44. -71332/11 Calculate 4168164 divided by 26. 160314 348948 divided by -486 -718 4113 divided by -8968 -4113/8968 Divide -36 by -51869. 36/51869 Calculate -363269 divided by -3. 363269/3 Calculate 0 divided by 137065058. 0 Divide -134407755 by 4. -134407755/4 Divide 67608170 by -13521634. -5 145353162 divided by -29 -5012178 53687916 divided by 13421979 4 What is 8833608 divided by -28868? -306 Divide 47126828 by 7. 6732404 -6598 divided by -30 3299/15 Calculate 18065475 divided by 3. 6021825 545574430 divided by -109114886 -5 Divide -24017515 by -1412795. 17 -1892695 divided by 5 -378539 Calculate 1572368 divided by -973. -1616 What is 336255 divided by 3? 112085 Divide 858155 by -1507. -858155/1507 Calculate 113 divided by 2789148. 113/2789148 What is 1 divided by -45334374? -1/45334374 Calculate -20710278 divided by 2. -10355139 Calculate -267542 divided by -2. 133771 What is -5 divided by -24818179? 5/24818179 What is 32142 divided by 3047? 2922/277 Calculate -106735200 divided by 21347040. -5 Divide -82646 by 508. -41323/254 Calculate -251 divided by -92021. 251/92021 What is 79754730 divided by -41866? -1905 Divide 5 by -3970128. -5/3970128 376798268 divided by -2446742 -154 -375 divided by 222573 -125/74191 Calculate -14116308 divided by 12. -1176359 What is 5 divided by -29665987? -5/29665987 916168 divided by 116 7898 Divide -309934 by -16. 154967/8 Calculate 351754362 divided by 6. 58625727 Calculate 291622288 divided by 72905572. 4 What is -1512153 divided by 2109? -717 What is 14165 divided by -2855? -2833/571 Divide 5116272 by -12. -426356 Divide 33189 by 59. 33189/59 -11804400 divided by -437200 27 Calculate -34764936 divided by -3. 11588312 6846685 divided by -6846685 -1 Divide -10456596 by -142. 73638 Calculate 76587 divided by 5332. 76587/5332 Calculate 1194 divided by 6224. 597/3112 Calculate 86378066 divided by -551. -156766 Calculate -1116948 divided by 5. -1116948/5 Divide 19422372 by -3. -6474124 Calculate 881 divided by -24246. -881/24246 Calculate -76009449 divided by -3. 25336483 Calculate -1269513 divided by -81. 15673 Calculate 75653628 divided by -3. -25217876 38104932 divided by 12701644 3 Divide -16717330 by 7. -2388190 Divide -292527525 by 2. -292527525/2 What is -15 divided by -486931? 15/486931 What is 24127350 divided by 10? 2412735 Calculate 1657425 divided by -28. -236775/4 1 divided by 20791458 1/20791458 Calculate 64637 divided by -439. -64637/439 What is 151579536 divided by -16? -9473721 What is 3352847 divided by 126? 3352847/126 Divide -49036440 by 4. -12259110 Calculate -20254 divided by -13627. 20254/13627 Calculate 665649963 divided by 33. 20171211 What is 67837853 divided by 4? 67837853/4 What is -8623 divided by 759? -8623/759 Divide -6540898 by -2158. 3031 Calculate 771814900 divided by -15436298. -50 Calculate 47816632 divided by -46. -1039492 Calculate 102702280 divided by 1. 102702280 Divide -4753562 by 44. -216071/2 Divide -260776 by 39. -260776/39 What is -110182818 divided by -1488957? 74 What is 35593872 divided by -6411? -5552 Divide 298834 by -1. -298834 Divide -8577 by -1170. 953/130 51086 divided by 25543 2 -2 divided by 5130003 -2/5130003 Calculate 249482 divided by -2. -124741 What is 1375 divided by 257208? 1375/257208 Calculate -1705389 divided by 568463. -3 Calculate -15 divided by -159570. 1/10638 -313316080 divided by 2848328 -110 Divide 5966187 by 13. 5966187/13 Divide 2412 by -161655. -804/53885 58165632 divided by 252 230816 2047328 divided by -4 -511832 Calculate -11538245 divided by 415. -27803 Divide -369175 by -191. 369175/191 Divide 13 by 17123532. 13/17123532 23 div	{ "pile_set_name": "DM Mathematics" }
-0.2106 (d) -4 c Which is the nearest to -1? (a) -0.6 (b) -2/11 (c) -16/235 a What is the closest to 1/3 in -3, -35, 2, -0.08? -0.08 What is the nearest to 0 in 5, -2/119, -2/129, 0.4? -2/129 Which is the closest to 0? (a) -676 (b) 1 (c) 0 (d) -2 (e) -2/5 c Which is the closest to -0.7? (a) 6/541 (b) -29 (c) 0.5 a What is the nearest to 0.1 in 1, -1, 0.95, 0.05? 0.05 What is the nearest to -0.1647 in 3, 2, -3, -0.3? -0.3 Which is the closest to -5? (a) -1 (b) 3/49 (c) -1/62 (d) 5 a Which is the nearest to 27? (a) -4 (b) -0.3 (c) -67/4 (d) -1 b What is the nearest to -2/85 in -1548, 6, -3? -3 Which is the closest to 1.28? (a) -4 (b) -0.3 (c) -4/7 (d) -2/21 (e) -13 d Which is the closest to 2/3? (a) -457 (b) 27 (c) 3 (d) 0.4 d What is the nearest to -2/9 in -4, 163/4, -3, 0.04, 0.1? 0.04 What is the nearest to -6 in -2, 1/7, -173, 3, 10? -2 Which is the nearest to 0? (a) -29 (b) 0.5 (c) -554 (d) 3 b What is the closest to -830 in 3/4, -1, 3? -1 What is the nearest to 2/39 in -0.5, 102, -7? -0.5 Which is the closest to -5? (a) -1/21 (b) -4 (c) -2 (d) -20.2 (e) 3/8 b Which is the closest to -2? (a) -2 (b) 1/3 (c) -10 (d) -24 (e) 0.42 a Which is the closest to -6/7? (a) -5 (b) -47 (c) -2/5 (d) 2 (e) 0.5 c Which is the closest to -6? (a) 20 (b) 1 (c) -2 (d) -6 d What is the nearest to 1/5 in 2/11, -338, 2, -5, 0.1? 2/11 What is the closest to 18 in 0.1, -4, -3, 3, 82? 3 Which is the closest to 0.7? (a) -2 (b) -5 (c) 0.63 (d) -0.1 c What is the nearest to -52.5 in 1/474, -3, 0.3? -3 What is the nearest to 74 in -14, 0.5, -3, -5, 2/5? 0.5 Which is the closest to -0.1? (a) 1/4 (b) -0.04 (c) 5 (d) 0 (e) -466 b Which is the closest to 5? (a) -5 (b) 2/39 (c) 12 b Which is the nearest to -1? (a) -2 (b) -5.8 (c) 7 (d) -16/15 d What is the nearest to -31 in 0.2, 0.25, -5? -5 What is the closest to -6 in -3.8, -4, -112? -4 Which is the closest to -4? (a) 185 (b) 0.9 (c) -3/10 c Which is the nearest to -1/4? (a) 0 (b) 0.4 (c) 502.4 a What is the closest to -2 in 1.1, 9, 5, 0.4, 718? 0.4 What is the nearest to 0.2 in -2, 17, -10/13, 0.2? 0.2 What is the nearest to 4.9 in 3, -5, 4, -0.04, 45? 4 Which is the closest to -2/7? (a) -2191 (b) 548 (c) -4 c Which is the closest to 6? (a) 3/7 (b) 2/9 (c) -0.5 (d) -4 (e) -12/83 a What is the nearest to 45 in 0.4, 8, 1/118? 8 Which is the closest to 244? (a) 3 (b) -6/7 (c) -1 a What is the nearest to 0.2 in -0.031, 2, 44, 1/3, 3? 1/3 Which is the nearest to -1? (a) 4 (b) -1/394 (c) -2/5 (d) 3 (e) -1/5 c What is the nearest to -2 in -13, 3/8, -2/9? -2/9 What is the nearest to -1/5 in -11/7, -2.9, -3, -12? -11/7 What is the nearest to -1/2 in 0.06, -611, -0.09? -0.09 What is the closest to 1 in -1/9, -0.1, -1/11, -345, 81? -1/11 Which is the closest to -2/37? (a) 151 (b) 3 (c) -5 (d) 5 (e) 1/2 e Which is the closest to -0.1? (a) -144318 (b) -17/6 (c) 1/4 c What is the nearest to 1/5 in -14, 0.3, 0.2, -65.2? 0.2 Which is the nearest to -2/3? (a) -2/3 (b) 2 (c) -0.271 a What is the nearest to -2026 in 0.2, -2, 1/2? -2 What is the closest to 0.1 in -3, -86/5, -2/11, -1? -2/11 What is the closest to 1 in 5, -97, -4473, 2? 2 What is the closest to -4/133 in 13.86, -4, -2? -2 What is the closest to 0.351 in 2/7, -2, -3, 0.2? 2/7 Which is the nearest to -1/3? (a) 4 (b) -48.1 (c) -7/19 c What is the nearest to -2/3 in 0.5, -2/1929, -4/5, -6/11, 1/57? -6/11 What is the closest to 0.1 in -0.98, 0.01, 17, -3/2? 0.01 What is the nearest to -2 in 4, -12/7, -33, 0.5? -12/7 Which is the closest to 0.6? (a) -2 (b) 13 (c) -80 (d) -5 (e) -3 a What is the closest to 3 in -23/3, 60, -0.5, -2/5, -0.01? -0.01 Which is the closest to -1? (a) 0.387 (b) 1.385 (c) 0.1 c What is the closest to 2/19 in -0.3, 1429/4, 0.5? 0.5 Which is the nearest to -0.2? (a) -20 (b) 2/7 (c) -0.1 (d) 2 c Which is the nearest to 8? (a) -0.5 (b) 2 (c) 65 (d) 1/3 (e) -9 b Which is the nearest to 1? (a) -9 (b) -0.4 (c) -55 b What is the nearest to 25/7 in -3/4, 4, -0.147, 2/9? 4 What is the closest to -5 in 0, 27.4, 2/11? 0 Which is the closest to 0.1? (a) -3/7 (b) -2/10177 (c) 0.1 (d) 9 (e) 0 c Which is the nearest to -0.2? (a) 2/5 (b) -1 (c) 1 (d) -3153 a Which is the nearest to 184.75? (a) -0.2 (b) 3 (c) -2/13 b Which is the nearest to 2/7? (a) 3/5116 (b) 2/15 (c) 4 (d) 6 b Which is the closest to 3? (a) 4 (b) 1717 (c) 5 (d) 2/11 a What is the nearest to 1 in -1/4, 0, 6/197, -1? 6/197 What is the closest to -846 in -2, -1/3, 1/13? -2 Which is the closest to -0.6? (a) 1/3 (b) 4 (c) -1/307 c Which is the closest to 1? (a) 740 (b) 2/3 (c) -0.4 (d) 0.04 b Which is the closest to 1? (a) 2 (b) 4 (c) -15188 (d) 0.2 d What is the nearest to 2/3 in 3/8, 0.4, 3, 0.484? 0.484 Which is the closest to 3? (a) 5 (b) 15 (c) 3 (d) 94 c What is the closest to 2/37 in 0.1, 0.09, 0.148? 0.09 Which is the nearest to -1/20? (a) -5 (b) 1/4 (c) 815 b Which is the nearest to -0.2? (a) 16 (b) -44 (c) -0.19 c What is the nearest to 0.0281 in 0.1, 0, 4, 3, -0.4? 0 What is the closest to -0.1 in -3/4, 95, -3/8, -1.1? -3/8 What is the closest to -13/8 in 5, 0.2, -32? 0.2 What is the nearest to -1/2 in 2/21, 3, 0.3, 0.3146? 2/21 Which is the closest to 3? (a) -111 (b) 5 (c) 49 b Which is the closest to 1/6? (a) 2/5 (b) 1/81 (c) -10 b What is the nearest to -0.07 in 27, -6, -2/15, -4/3? -2/15 What is the closest to -2/9 in -0.4, 606, -0.05, -2/13? -2/13 What is the closest to -1 in 5, 149, -3, 0.5? 0.5 What is the nearest to 0.12 in 0.18, -1, 2, 1.1? 0.18 What is the closest to 1 in -6, -5187/5, 3/2? 3/2 Which is the nearest to -1? (a) 0.191 (b) 3/20 (c) 2 b What is the closest to 0.1 in 74, -3/2, -12? -3/2 What is the closest to -3639 in 3, 2.3, -0.4, 0.2? -0.4 What is the nearest to 9 in 20/9, -0.4, -0.1, 2/9? 20/9 What is the closest to -2/9 in 1, -10.6, 13, 0.4? 0.4 What is the closest to 0 in 67, -0.123, -1/2, -5? -0.123 What is the closest to 4/9 in -4, 2/23, -0.12? 2/23 Which is the closest to -7? (a) -0.1 (b) -37 (c) 0.1 (d) 2/9 (e) -6 e What is the nearest to 1 in -1, 18/7, -2? 18/7 Which is the nearest to 7? (a) -9 (b) -3 (c) -1/5 (d) -2/7 c Which is the nearest to 2/11? (a) 2/7 (b) -2/633 (c) -5/4 (d) 0.5 (e) -1 a Which is the nearest to 1? (a) 1/156 (b) 14 (c) -2/5 a Which is the closest to 1/3? (a) -2 (b) 0.2 (c) 0 (d) -8.083 b What is the nearest to -19 in 0.2, -2/9, -20? -20 What is the nearest to -3 in 0.2225, 1/7, 3? 1/7 What is the closest to -1080 in 3.7, 4, 0.3, 5? 0.3 Which is the closest to -0.3? (a) 2 (b) -13 (c) -9/5 c What is the closest to 2.6 in 1, -510, 2? 2 Which is the closest to -2? (a) -3/2 (b) 2.63 (c) -0.04 a Which is the closest to 1/3? (a) 0.16 (b) 0.01 (c) 0.13 (d) -8 a Which is the closest to -0.08? (a) -0.3 (b) 1/4 (c) 1 (d) 3 (e) -0.08 e Which is the nearest to -7/6? (a) 34/5 (b) 4 (c) 0.4 (d) 3 c What is the closest to 0.05 in 85, -0.1, 0.01, 3/4? 0.01 What is the nearest to 0 in -2, -0.1, -65, 0.3, -1/5? -0.1 What is the closest to 3 in 3, 0, -0.3, -2/21? 3 What is the nearest to -33 in 1, 8.7, -13? -13 What is the nearest to 52 in -0.09, -3, 0.06, -0.5? 0.06 What is the nearest to 2/5 in 0.09, -5.25, 0.05, -2/3, -2/9? 0.09 What is the closest to 0.083 in -3, 0.1, -28, -2? 0.1 Which is the closest to -7? (a) -1.6 (b) 3/8 (c) 0.5 (d) 118 a Which is the closest to -0.07? (a) -3 (b) 0.1 (c) -217 b Which is the closest to -0.3? (a) -4 (b) 224/3 (c) -0.01 c What is the closest to -95 in 0.2, -5, -9? -9 What is the nearest to 6/7 in 9, 2/7, -9, 0.4? 0.4 What is the closest to -0.7 in 3/11, -2, 2/27, -1? -1 Which is the closest to -2? (a) -6 (b) 8/3 (c) -14 (d) -0.2 d What is the nearest to 1/4 in -8/4091, 1/13, 0? 1/13 What is the nearest to -2/9 in 39, 6/11, 7, -2? 6/11 Which is the nearest to 1? (a) -2 (b) -5 (c) 8/15 (d) -2413 c Which is the nearest to -0.13? (a) 34 (b) 5 (c) 40 b Which is the closest to 0? (a) -0.0157 (b) -1/10 (c) -30/13 a Which is the closest to 2/3? (a) 0.0304 (b) -3 (c) -8 a What is the closest to 1/4 in 0, -19/3, -0.09302? 0 Which is the closest to -0.4? (a) -0.5 (b) -0.4 (c) -1/5 (d) -2/241 b	{ "pile_set_name": "DM Mathematics" }
ree letters picked without replacement from {e: 3, k: 2, v: 4, b: 2}. Give prob of picking 2 e and 1 v. 4/55 What is prob of picking 1 x and 3 u when four letters picked without replacement from {u: 7, e: 1, h: 2, y: 1, x: 6}? 3/34 Three letters picked without replacement from rnrg. Give prob of picking 1 n and 2 r. 1/4 Calculate prob of picking 4 q when four letters picked without replacement from qqpqppqpppp. 1/330 Two letters picked without replacement from {m: 8, x: 2, z: 5}. What is prob of picking 1 z and 1 m? 8/21 Four letters picked without replacement from effoej. What is prob of picking 1 j, 1 o, and 2 f? 1/15 Calculate prob of picking 3 m when three letters picked without replacement from {a: 1, m: 12}. 10/13 Two letters picked without replacement from xxaq. What is prob of picking 1 q and 1 a? 1/6 Calculate prob of picking 1 x and 1 m when two letters picked without replacement from xmmlmalllma. 4/55 Three letters picked without replacement from zsnuncuunuznkuu. What is prob of picking 3 u? 4/91 What is prob of picking 2 a when two letters picked without replacement from {x: 17, a: 3}? 3/190 Four letters picked without replacement from {w: 2, u: 5, d: 3}. Give prob of picking 2 u and 2 w. 1/21 What is prob of picking 1 o and 1 q when two letters picked without replacement from opcuqjq? 2/21 Calculate prob of picking 2 k, 1 d, and 1 v when four letters picked without replacement from dkdddxkxzkkzxzzzvzdx. 2/323 Two letters picked without replacement from ywwdodzzfowfodo. What is prob of picking 1 z and 1 f? 4/105 Two letters picked without replacement from axxx. Give prob of picking 2 x. 1/2 What is prob of picking 1 v and 1 q when two letters picked without replacement from {b: 1, v: 1, h: 1, q: 1, l: 2, a: 1}? 1/21 Two letters picked without replacement from ooojjbhjjjoebjoh. What is prob of picking 1 o and 1 e? 1/24 Four letters picked without replacement from ftgcdgcn. Give prob of picking 2 g, 1 t, and 1 f. 1/70 What is prob of picking 1 f, 2 x, and 1 k when four letters picked without replacement from kkkxrffkxfxfwf? 60/1001 Three letters picked without replacement from {c: 2, f: 1, q: 9, y: 6, a: 1}. What is prob of picking 1 c, 1 y, and 1 a? 4/323 Calculate prob of picking 1 s and 3 k when four letters picked without replacement from keskqqsessisesk. 2/455 Calculate prob of picking 1 c and 1 h when two letters picked without replacement from {z: 3, c: 1, q: 1, h: 1, k: 1}. 1/21 Three letters picked without replacement from tbtqbqqwwqtt. Give prob of picking 1 t, 1 b, and 1 q. 8/55 What is prob of picking 1 z and 1 w when two letters picked without replacement from fzhzvzwzhvfzzzz? 8/105 Three letters picked without replacement from {g: 1, d: 11}. What is prob of picking 2 d and 1 g? 1/4 Four letters picked without replacement from {m: 1, h: 1, s: 1, v: 2, a: 2, y: 2}. Give prob of picking 1 m, 1 y, 1 h, and 1 a. 2/63 Two letters picked without replacement from eeeeeeeeeeleeeleeeee. Give prob of picking 1 l and 1 e. 18/95 What is prob of picking 1 s, 1 f, and 1 o when three letters picked without replacement from {c: 2, o: 4, a: 2, s: 1, f: 4, k: 2}? 16/455 Calculate prob of picking 1 a and 2 m when three letters picked without replacement from bbbbmbbmbbbbbbmbabbb. 1/380 What is prob of picking 1 b and 2 l when three letters picked without replacement from lxulxxxhxxxbxhxx? 1/560 Three letters picked without replacement from {e: 3, b: 4, z: 1, t: 2, g: 1, r: 1}. What is prob of picking 2 e and 1 t? 3/110 What is prob of picking 1 p and 1 y when two letters picked without replacement from pzpzkzzppyzjkzzyk? 1/17 Two letters picked without replacement from eaapiah. What is prob of picking 1 h and 1 a? 1/7 Four letters picked without replacement from {z: 1, m: 7, r: 1, l: 1, b: 5}. What is prob of picking 3 m and 1 z? 1/39 Calculate prob of picking 2 d when two letters picked without replacement from {p: 3, d: 2, i: 3}. 1/28 Three letters picked without replacement from {a: 3, q: 5, w: 3, i: 1}. Give prob of picking 1 i and 2 w. 3/220 What is prob of picking 3 p when three letters picked without replacement from {p: 7, m: 6}? 35/286 What is prob of picking 1 q and 1 r when two letters picked without replacement from {r: 1, q: 3, e: 1, u: 4, n: 1, f: 2}? 1/22 Calculate prob of picking 1 r and 2 a when three letters picked without replacement from rrrrlarrar. 7/120 Two letters picked without replacement from {t: 1, m: 2, h: 1, d: 3}. What is prob of picking 1 h and 1 d? 1/7 Four letters picked without replacement from oowdwwdddwdrdwdddrdo. Give prob of picking 2 d, 1 r, and 1 w. 30/323 Calculate prob of picking 2 j, 1 q, and 1 d when four letters picked without replacement from ejmqqqbedddjqbqqd. 6/595 What is prob of picking 3 l when three letters picked without replacement from {i: 4, q: 2, e: 2, l: 6, a: 1}? 4/91 Two letters picked without replacement from oolulzolozlooukzl. What is prob of picking 1 k and 1 z? 3/136 Four letters picked without replacement from tjjjjjjttjjutj. Give prob of picking 1 t, 1 u, and 2 j. 144/1001 What is prob of picking 2 e when two letters picked without replacement from {r: 2, e: 6, c: 4, p: 2, f: 2, s: 1}? 15/136 Three letters picked without replacement from {n: 3, t: 1, h: 1, x: 5, s: 1, e: 2}. What is prob of picking 1 x and 2 e? 5/286 Two letters picked without replacement from {g: 5, h: 3, l: 1, p: 1, n: 1, y: 1}. Give prob of picking 1 p and 1 n. 1/66 Calculate prob of picking 1 c and 2 p when three letters picked without replacement from {c: 2, j: 1, b: 2, f: 1, p: 2}. 1/28 What is prob of picking 1 k and 2 y when three letters picked without replacement from kkykyykyyykyy? 70/143 Two letters picked without replacement from wwecllwwwcwwlwwe. Give prob of picking 1 l and 1 w. 9/40 Calculate prob of picking 2 v when two letters picked without replacement from {g: 1, r: 1, v: 2, p: 1, w: 5}. 1/45 What is prob of picking 1 r and 1 x when two letters picked without replacement from {x: 11, d: 1, r: 3}? 11/35 Three letters picked without replacement from {x: 9, h: 10}. Give prob of picking 1 h and 2 x. 120/323 Four letters picked without replacement from fssssyyls. What is prob of picking 1 s, 1 l, and 2 f? 0 Three letters picked without replacement from {w: 1, j: 1, c: 2, n: 1, x: 1, a: 1}. Give prob of picking 1 j, 1 w, and 1 x. 1/35 Three letters picked without replacement from yyfffyyfyyy. Give prob of picking 2 f and 1 y. 14/55 Three letters picked without replacement from {v: 7, n: 1, p: 1, w: 4, z: 2, r: 2}. What is prob of picking 1 r and 2 w? 3/170 What is prob of picking 2 h and 1 y when three letters picked without replacement from hhhhhyhh? 3/8 What is prob of picking 1 b and 1 d when two letters picked without replacement from {d: 1, m: 6, b: 2, l: 1, r: 7}? 1/68 What is prob of picking 1 c and 3 o when four letters picked without replacement from {o: 1, c: 1, b: 1, d: 2, u: 1, z: 1}? 0 Calculate prob of picking 3 i and 1 d when four letters picked without replacement from {y: 1, s: 5, i: 3, a: 2, d: 1}. 1/495 Two letters picked without replacement from wrjnwjjwnwr. Give prob of picking 2 w. 6/55 Calculate prob of picking 1 e and 1 u when two letters picked without replacement from {k: 1, u: 2, o: 9, y: 3, e: 1, t: 3}. 2/171 Calculate prob of picking 2 i and 1 g when three letters picked without replacement from xgxiixxxiixixxxxixx. 5/323 Four letters picked without replacement from uswuwuwuuswu. Give prob of picking 1 s, 1 w, and 2 u. 8/33 Four letters picked without replacement from pslsppz. What is prob of picking 3 p and 1 s? 2/35 What is prob of picking 1 r, 1 h, and 1 u when three letters picked without replacement from trrhrturvrrrtrbrurr? 22/969 Three letters picked without replacement from {w: 1, t: 4, v: 2, e: 2}. Give prob of picking 2 t and 1 w. 1/14 Calculate prob of picking 2 d and 1 b when three letters picked without replacement from {b: 8, d: 5}. 40/143 Three letters picked without replacement from ppsmwspyyspyllpmywsp. Give prob of picking 1 y and 2 l. 1/285 Calculate prob of picking 2 i when two letters picked without replacement from iiililllilllll. 10/91 Three letters picked without replacement from ftdhtdd. What is prob of picking 1 f and 2 d? 3/35 Two let	{ "pile_set_name": "DM Mathematics" }
7 -1044 divided by 58 -18 -595 divided by -85 7 Divide -5 by -16. 5/16 74 divided by -1 -74 -4088 divided by 5 -4088/5 -21360 divided by -16 1335 Divide -56 by -7. 8 Divide 20 by -95. -4/19 858 divided by 3 286 Calculate -2 divided by 289. -2/289 Divide -5 by 1528. -5/1528 What is 32 divided by 16? 2 What is 6 divided by -14? -3/7 Calculate 5 divided by -63. -5/63 Divide 81 by 3. 27 Divide -7 by -1152. 7/1152 Calculate -4752 divided by -36. 132 Calculate 456 divided by -4. -114 18 divided by -14 -9/7 Divide 5 by 1. 5 Divide 168 by -3. -56 9 divided by -21 -3/7 -392 divided by 7 -56 What is -2 divided by -63? 2/63 Calculate -2 divided by 964. -1/482 Divide 724 by -1. -724 Divide 14 by -14. -1 What is -42 divided by 41? -42/41 -9 divided by 5 -9/5 Calculate -516 divided by 12. -43 What is -293 divided by 1? -293 Divide -530 by -10. 53 9 divided by -5 -9/5 What is -1197 divided by 3? -399 What is 11 divided by 56? 11/56 Calculate 158 divided by -4. -79/2 Divide 2002 by 5. 2002/5 What is 45715 divided by -5? -9143 What is 0 divided by -215? 0 Calculate 1 divided by -726. -1/726 Calculate 15 divided by -13. -15/13 11 divided by 51 11/51 What is -4967 divided by -5? 4967/5 Calculate -14955 divided by 2991. -5 Calculate 1490 divided by 2. 745 546 divided by 8 273/4 18 divided by -14 -9/7 Calculate 0 divided by 225. 0 What is 0 divided by 107? 0 -2 divided by 73 -2/73 Calculate 125 divided by 3. 125/3 248 divided by -6 -124/3 Calculate 245 divided by 49. 5 Calculate 2 divided by 3383. 2/3383 What is -1456 divided by 1? -1456 Calculate 4 divided by -467. -4/467 Divide -55 by -55. 1 -6 divided by -53 6/53 -8 divided by 49 -8/49 What is -14420 divided by 2884? -5 Calculate 14048 divided by 4. 3512 246 divided by -3 -82 Divide 88 by -44. -2 What is 132 divided by 6? 22 Divide 1189 by -3. -1189/3 Calculate 33 divided by -1. -33 Divide -43 by 6. -43/6 Calculate -159 divided by 3. -53 -363 divided by 4 -363/4 What is 3 divided by -3445? -3/3445 What is 1266 divided by -211? -6 Calculate 4 divided by -78. -2/39 Divide -46 by -207. 2/9 What is -2 divided by 12? -1/6 -95 divided by 1 -95 Divide -2 by 25. -2/25 -504 divided by -126 4 What is 30078 divided by -6? -5013 What is 6 divided by 791? 6/791 Divide -3696 by -8. 462 What is 2013 divided by 6? 671/2 What is 957 divided by 3? 319 What is -192 divided by -9? 64/3 Divide 2 by -598. -1/299 Calculate 2494 divided by 2. 1247 Calculate 5 divided by -126. -5/126 What is -58 divided by 1? -58 -9361 divided by 851 -11 What is 464 divided by 116? 4 -44 divided by 78 -22/39 Calculate -313 divided by -6. 313/6 Calculate 6210 divided by -1242. -5 0 divided by -699 0 Divide -14994 by 147. -102 Divide 921 by -6. -307/2 13056 divided by 16 816 What is 1 divided by -179? -1/179 Divide -21 by -37. 21/37 Divide 263 by -43. -263/43 Calculate -185 divided by 5. -37 What is -375 divided by -5? 75 Calculate -1 divided by -218. 1/218 Calculate 2244 divided by 22. 102 What is 786 divided by -6? -131 Calculate -788 divided by -1. 788 Calculate 405 divided by 15. 27 Calculate 4186 divided by 14. 299 Divide 18 by -176. -9/88 Calculate 1006 divided by 4. 503/2 Divide 4 by 75. 4/75 Calculate -32656 divided by 2041. -16 What is -22580 divided by -2? 11290 Divide 12098 by -23. -526 14 divided by -22 -7/11 Calculate 3 divided by -33. -1/11 What is 0 divided by -854? 0 Calculate 3 divided by 15. 1/5 What is -36 divided by 18? -2 What is -5 divided by -533? 5/533 Calculate -5 divided by -1. 5 -12 divided by 7 -12/7 What is 1 divided by -274? -1/274 Calculate 768 divided by -96. -8 Divide 2760 by -230. -12 What is 8 divided by -4? -2 Divide 7068 by -4. -1767 Calculate 200 divided by 100. 2 Calculate -3 divided by -208. 3/208 -22675 divided by 2 -22675/2 What is 2 divided by 102? 1/51 Divide 8580 by 26. 330 5 divided by 61 5/61 12 divided by 675 4/225 -250 divided by 25 -10 What is 4 divided by 42? 2/21 Calculate 1484 divided by 106. 14 What is 196 divided by -14? -14 Calculate -2656 divided by -4. 664 Calculate -4 divided by 15. -4/15 -3 divided by -119 3/119 Divide 4334 by 3. 4334/3 3787 divided by -541 -7 Divide 1 by 846. 1/846 -1078 divided by 11 -98 Calculate 9 divided by -99. -1/11 Divide -7631 by 1. -7631 -42784 divided by 1337 -32 13923 divided by 1547 9 720 divided by -5 -144 What is -4 divided by -4616? 1/1154 Divide 16 by 7. 16/7 -2 divided by 4189 -2/4189 Calculate -272 divided by -1. 272 1648 divided by -3 -1648/3 Calculate -11 divided by -20. 11/20 Calculate -3 divided by -506. 3/506 Calculate -1339 divided by -13. 103 Divide 130 by -2. -65 Calculate -1 divided by 1808. -1/1808 What is 104 divided by 104? 1 Divide -310 by 2. -155 Calculate -2947 divided by -1. 2947 What is -765 divided by 3? -255 Calculate 26 divided by 1. 26 Divide 450 by -6. -75 Divide 1396 by -6. -698/3 Calculate -13608 divided by -108. 126 -450 divided by 450 -1 Divide -6396 by -3198. 2 Calculate -12 divided by -7. 12/7 44421 divided by 3 14807 Divide -1260 by 5. -252 Divide -5698 by 11. -518 13555 divided by -4 -13555/4 -100 divided by -50 2 -1311 divided by 437 -3 75 divided by -6 -25/2 Calculate -1288 divided by 644. -2 What is -4 divided by -70? 2/35 What is -2484 divided by -6? 414 195 divided by 39 5 What is 7410 divided by -6? -1235 What is -1770 divided by 5? -354 81 divided by 9 9 Divide 294 by 98. 3 -50 divided by -50 1 Divide -12552 by 6. -2092 What is -2184 divided by -42? 52 What is -4992 divided by 6? -832 What is 12 divided by 6? 2 -57 divided by 33 -19/11 84 divided by 12 7 Calculate -2 divided by -26. 1/13 532 divided by -2 -266 360 divided by -3 -120 -275 divided by 15 -55/3 Divide -790 by -5. 158 Divide 1003 by -3. -1003/3 What is 5 divided by 179? 5/179 Calculate 846 divided by 2. 423 Calculate -368 divided by -16. 23 What is 10 divided by 184? 5/92 What is -2160 divided by 4? -540 Calculate 7825 divided by -5. -1565 What is 54480 divided by -5? -10896 5120 divided by 40 128 Calculate -988 divided by -52. 19 Calculate 35 divided by -14. -5/2 Calculate -3594 divided by -1. 3594 Calculate 7876 divided by 22. 358 Calculate -2646 divided by -18. 147 What is -9104 divided by -8? 1138 What is -9 divided by 997? -9/997 What is 0 divided by 352? 0 What is 1056 divided by 264? 4 What is -914 divided by -914? 1 Divide 3 by -34. -3/34 What is -141 divided by -3? 47 Calculate 21762 divided by -6. -3627 Divide 110 by 2. 55 Calculate -4 divided by -1988. 1/497 Calculate 6021 divided by 5. 6021/5 11435 divided by -2287 -5 Calculate -98 divided by 9. -98/9 1 divided by -658 -1/658 Calculate 131 divided by -4. -131/4 Divide -5534 by -2767. 2 198 divided by 22 9 -4 divided by 21 -4/21 Calculate -96 divided by 12. -8 4 divided by 166 2/83 Divide -5 by 10. -1/2 What is -3 divided by -1924? 3/1924 Calculate -1635 divided by -545. 3 What is 8298 divided by -18? -461 Calculate -6 divided by -171. 2/57 Divide -222 by -74. 3 Calculate 11 divided by -6. -11/6 Calculate -2 divided by -1956. 1/978 Calculate -4 divided by -2239. 4/2239 Divide 32 by -1. -32 -16 divided by 4 -4 What is 6405 divided by 1? 6405 -7 divided by -1694 1/242 Divide 0 by -65. 0 What is -4 divided by 246? -2/123 Calculate -127 divided by -31. 127/31 What is -45756 divided by 492? -93 -84 divided by -14 6 Divide -5 by -18. 5/18 What is 15800 divided by -158? -100 -3606 divided by 6 -601 Calculate 190 divided by 2. 95 Calculate 12 divided by 3. 4 Calculate 3275 divided by 655. 5 -90 divided by -5 18 Calculate -14779 divided by -2. 14779/2 Calculate 125 divided by -125. -1 Divide -4472 by 52. -86 Divide 216 by -9. -24 Divide 1104 by -69. -16 Calculate -14835 divided by -1. 14835 Calculate -204 divided by -12. 17 290 divided by 4 145/2 Divide 32 by -10. -16/5 -249 divided by -3 83 4245 divided by -3 -1415 Divide -1 by -318. 1/318 Divide -10168 by -1. 10168 What is -1 divided by -47? 1/47 What is 9252 divided by 6? 1542 Divide 62 by 2. 31 What is 3702 divided by -617? -6 1196 divided by -299 -4 0 divided by 143 0 Calculate -1541 divided by -6. 1541/6 What is 560 divided by -35? -16 -270 divided by -135 2 21674 divided by 2 10837 -1188 divided by 2 -594 Divide 114 by -38. -3 What is 28 divided by -7? -4 17 divided by -110 -17/110 What is -40 divided by -40? 1 What is -5106 divided by 69? -74 1302	{ "pile_set_name": "DM Mathematics" }
et t(a) be the second derivative of a + ia3 + 1/12a4 + 0 + a2. Factor t(s). (s + 1)(s + 2) Let v = 75 + -72. Solve 5p*v + 1/2 + 1/2p*5 + 5p*2 + 5/2p + 5/2p4 = 0. -1 Let y be 1 + (-8)/10 + 217/(-1260). Let z(j) be the second derivative of -1/6j*2 + yj*4 + 0 + 4j + 0j3. Let z(m) = 0. Calculate m. -1, 1 Let g(r) = -3r + 1. Let i be g(1). Let f = 0 - i. Factor b*2 + 0b - 3bf - 2 - 4b. -2(b + 1)2 Suppose -5o = -3w - 23 + 2, o = w + 5. Let s(g) be the first derivative of 0g - 1 + 1/4g2 + 1/12g*6 + 0g*o - 1/4g*4 + 0g*5. Factor s(y). y(y - 1)*2(y + 1)*2/2 Let k(t) be the second derivative of -5t7/42 - t6/6 + 3t5/4 + 25t*4/12 + 5t*3/3 - t. Factor k(x). -5x(x - 2)(x + 1)*3 Suppose -3i = -3f, -4f = 5i + f. Let u(k) be the third derivative of 0k6 + k2 + 1/1344k8 + ik*4 + 0 + 0k + 0k7 + 0k*5 + 0k3. Factor u(y). y5/4 Let r = 18 - 8. Let w be 9/r - (-4)/(-10). Find c such that 0 + 1/2c + wc*2 = 0. -1, 0 Suppose -2h = -3h + 4. Let o(l) = -8l*3 + 11l*2 - 16l. Let m(j) = 17j3 - 21j*2 + 33j - 1. Let p(n) = hm(n) + 9o(n). Factor p(f). -(f - 2)*2(4f + 1) Let h = -6 - -2. Let f be h/(-2)2/6. Solve -2/3i4 + 0 + 0i - fi3 + 0i2 = 0. -1, 0 Let k(v) = -v4 - 2v3 + 3v*2 - 4v - 4. Let i(r) = 3r4 + 6r*3 - 8r*2 + 11r + 11. Let t(l) = 4i(l) + 11k(l). Factor t(m). m*2(m + 1)2 Let x(l) be the third derivative of -l9/7560 + l8/3360 + l7/630 + l4/24 + l2. Let m(d) be the second derivative of x(d). Find c such that m(c) = 0. -1, 0, 2 Let j(y) be the second derivative of 0y2 + 1/18y*3 + 1/60y*5 - 1/18y*4 - 2y + 0. Determine x, given that j(x) = 0. 0, 1 Determine o, given that -2/5o - 4/5o*4 + 8/5o*3 + 4/5o*2 + 0 - 6/5o*5 = 0. -1, 0, 1/3, 1 Let z be 14/3 + 1 + -5. Determine i so that -2/3i*2 + 4/3 - zi = 0. -2, 1 Let u(i) be the first derivative of -i7/420 - i6/60 - i5/20 - i4/12 + i*3/3 + 1. Let t(v) be the third derivative of u(v). Factor t(c). -2(c + 1)*3 Let h(l) = 23l*3 + 3l*2 - 20l - 17. Let k = -6 + 14. Let s(a) = -a + a*2 - 6a + ka3 - 4 - 2. Let b(v) = -6h(v) + 17s(v). Factor b(f). -f(f + 1)(2f - 1) Factor -9/5s + 6/5s*3 - 9/5s*4 + 3/5s*5 + 6/5s*2 + 3/5. 3(s - 1)*4(s + 1)/5 Let y(m) be the third derivative of m6/600 - m5/100 + 2m3/15 - 34m*2. Determine g so that y(g) = 0. -1, 2 Suppose -5b + 3 = 5t - 2, 0 = -t + 5b - 23. Let l = t - -5. Factor 12u3 + u4 + 3u*l - 11u*3 - 3u2. u3(u + 1) Let r(d) be the first derivative of -16d*6/105 - 12d5/35 - d4/42 + 2d3/7 - d2/7 + d + 5. Let t(j) be the first derivative of r(j). Factor t(h). -2(h + 1)*2(4h - 1)2/7 Let s(b) be the third derivative of b6/540 - b5/270 + 4b*2. Factor s(x). 2x*2(x - 1)/9 Let s(j) be the second derivative of j*4/4 + 2j*3 + 6j*2 - j. Factor s(r). 3(r + 2)2 Let v(s) = -s5 + s4 - s3 - s*2 - s + 1. Let w(q) = 4q*5 - 7q*4 + 4q*3 + 5q*2 + 5q - 5. Let g(r) = -5v(r) - w(r). Factor g(m). m3(m + 1)*2 Suppose 0 = -2w - 7 + 11. Let 0 + 1/2i + iw + 1/2i*3 = 0. Calculate i. -1, 0 Let g be 713/(2/((-6)/(-21))). Let s = -101 + g. What is t in 8/7t*2 + st - 2/7 = 0? -1, 1/4 Let d(k) be the third derivative of 2/9k3 + 0k + 5k2 - 1/180k*6 + 0 + 1/12k*4 + 0k*5. Solve d(j) = 0 for j. -1, 2 Factor 1 + 19w*2 - 6w*2 + 2 + 7w*3 - 2w*3 + 11w. (w + 1)*2(5w + 3) Let i(t) be the first derivative of -2t*3/3 - 5t*2 + 12t + 21. Factor i(m). -2(m - 1)(m + 6) Let j = -7 + 12. Let -26 - 7z2 + 32z*4 - 32z*j + 6z*3 + z + 26 = 0. Calculate z. -1/2, 0, 1/4, 1 Let y(h) be the second derivative of -1/9h*7 - 5/3h*5 + 0 - 5/3h*3 + 20/9h*4 + 2/3h*2 + 2h + 2/3h6. Factor y(d). -2(d - 1)*4(7d - 2)/3 Let g(q) be the third derivative of -2q7/525 + q5/25 + q*4/15 - 22q*2. Determine t so that g(t) = 0. -1, 0, 2 Let x = 1/23 + 131/161. Factor 0 + xh*2 + 2/7h*4 + 6/7h*3 + 2/7h. 2h(h + 1)*3/7 Let p(k) be the third derivative of -7k*6/240 + 19k5/120 + k4/8 + 20k2. Factor p(v). -v(v - 3)(7v + 2)/2 Factor -5/6o3 + 15/2 - 25/2o + 35/6o2. -5(o - 3)*2(o - 1)/6 Let m = 227/264 + -9/11. Let h(s) be the third derivative of -1/60s5 + 0s + 0 + ms4 + 0s3 + s2. Factor h(g). -g(g - 1) Suppose -2 + 21n - 2n2 + 17n*2 + 3n3 + 11 = 0. Calculate n. -3, -1 Let z(g) be the first derivative of -g4/8 + g3/6 + g2/4 - g/2 + 2. Factor z(t). -(t - 1)*2(t + 1)/2 Suppose 2l + 10 = -4s, s = 4l - 29 + 13. Let h be (-81)/(-18)2/3. Factor -u*l + 0u*3 + 2u + 2uh - 3u*3. -2u(u - 1)(u + 1) Let u(d) be the third derivative of d7/630 + d6/180 - d5/15 - d4/4 + 3d3/2 - 16d*2 + d. Factor u(j). (j - 3)(j - 1)(j + 3)2/3 Let c(k) be the first derivative of 2k*3/9 + 8k*2/3 + 32k/3 - 6. Factor c(h). 2(h + 4)2/3 Let s(a) = -5 - 7a - 7a2 + 2 + 3. Let v(w) = -3w*2 - 3w. Let f(u) = 2s(u) - 5v(u). Factor f(q). q(q + 1) Let i(p) be the first derivative of 2p*6/9 - 4p*5/3 + 3p*4 - 28p*3/9 + 4p*2/3 - 19. Factor i(l). 4l(l - 2)(l - 1)*3/3 Let k be 8/20 + 18/5. Let d(s) be the first derivative of 1/8s*k - 4 + 1/2s*3 + 0s + 1/2s2. Factor d(a). a(a + 1)(a + 2)/2 Let c(u) be the first derivative of -3u*5/35 - 15u*4/28 + 13u*3/7 - 3u*2/2 - 7. Factor c(j). -3j(j - 1)2(j + 7)/7 Let a(t) = -t5 - t4 + t*2 - t + 1. Let i(o) = -16o*5 - 16o*4 - 2o*3 + 16o*2 - 18o + 18. Let b(y) = 36a(y) - 2i(y). Factor b(z). -4z2(z - 1)(z + 1)2 Let s(u) = -2u + 19 - 15 + 16. Let c be s(10). Let 2/7q3 - 6/7q + cq2 - 4/7 = 0. Calculate q. -1, 2 Suppose 0 = 5a + 7 + 3. Let r(b) = -2b3 - 5b*2 + 3b + 9. Let m(i) = -i*3 - 5i*2 + 3i + 9. Let n(h) = ar(h) + 3m(h). Factor n(v). (v - 3)*2(v + 1) Let g(b) be the third derivative of 0b - 6b*2 + 1/6b*4 + 0 + 1/105b*7 + 0b*3 - 1/30b*5 - 1/30b*6. Factor g(l). 2l(l - 2)(l - 1)(l + 1) Let y(h) be the first derivative of h6/42 + 3h*5/35 - 4h3/21 + 1. Suppose y(k) = 0. Calculate k. -2, 0, 1 Let u(v) be the second derivative of -v6/195 - v*5/65 + 2v*4/39 + 8v*3/39 + 17v. Find y such that u(y) = 0. -2, 0, 2 Solve 26 - 3n - 7n*2 - 36 - 12n + 2n2 = 0 for n. -2, -1 Let w(d) be the second derivative of 3/20d*5 - 1/45d*6 - 3d + 0d2 + 0 - 1/14d*7 + 0d*3 + 1/18d*4. What is v in w(v) = 0? -1, -2/9, 0, 1 Let b be (-12 + 13)0/(-2). Let d(q) be the second derivative of -1/10q5 - 1/21q*7 + 0q*3 + 0 + 2q + 2/15q6 + bq*4 + 0q*2. Factor d(p). -2p*3(p - 1)*2 Let s(t) = -t - 1. Let b(y) = -5y*2 - 36y + 29. Let w(x) = b(x) - 6s(x). Solve w(i) = 0. -7, 1 Let 0 - 1/4a*3 + 0a*2 + 0a = 0. Calculate a. 0 Let v = 331 - 4963/15. Let r(z) be the first derivative of 0z2 + 3 - vz*5 + 0z*3 + 1/6z*4 + 0z. Suppose r(h) = 0. Calculate h. 0, 1 Let t(f) be the first derivative of -2f + 1/8f*3 - 1/80f*5 + 1/4f*2 + 2 + 0f*4. Let c(d) be the first derivative of t(d). What is b in c(b) = 0? -1, 2 Find w, given that 0 + 1/3w*2 + 2/3w = 0. -2, 0 Factor -a*4 - 9a*3 - 2a*4 - 93a*2 + 120a*2 - 15a. -3a(a - 1)*2(a + 5) Suppose 5n = 4n + 5. Factor -d*5 + 2d + 2d2 - 2d*3 - 3d*4 + d + 1 + 0d*n. -(d - 1)(d + 1)*4 Let d be ((-11)/88)/((-3)/4). Factor -1/6j + 1/6 - dj2 + 1/6j3. (j - 1)2(j + 1)/6 Suppose 3v - 3v = 3v. Factor v - 4f + 5/2f*4 + 14f*2 - 11f*3. f(f - 2)*2(5f - 2)/2 Suppose -4c = -5j - 2c + 20, -4 = 3j + 2c. Let y be 1/((-3)/(-18)2). Factor 0n*4 + 2n*4 + 2n*j + 2n - 4n2 - 2n*y. 2n(n - 1)2(n + 1) Let g(b) be the second derivative of -5b4/72 - 5b*3/9 + 5b*2 - 39b - 1. What is i in g(i) = 0? -6, 2 Let z(c) be the third derivative of 17/540c6 + 0c + 11/108c4 + 0 - 7/90c*5 - 1/189c7 - c2 - 2/27c3. Factor z(w). -2(w - 1)*3(5w - 2)/9 Let a be (13)/(63/84). Let 9/5s3 + 4/5s*a + 0 + 1/5s - 12/5s5 - 6/5s*2 = 0. What is s? -1, 0, 1/3, 1/2 Let o be 3/(-15)(-5)/24. Let i(f) be the second derivative of 0 + of4 + 1/2f*2 + 1/4f**3 + f. Let i(m) = 0. Calculate m. -2, -1 Let l be (-	{ "pile_set_name": "DM Mathematics" }
xpress (-9 + 2h + 9)(48h2 - 15h*2 + 12h*2) as xh*2 + jh*3 + ah + y and give j. 90 Rearrange c*3 + 10c - 7c3 + 7c3 + c3 to dc2 + kc*3 + tc + n and give k. 2 Rearrange -17 + 17 + 22u to y + cu and give c. 22 Rearrange l*2 + 2l*2 + 8 - 4l*2 to the form wl*2 + o + ql and give w. -1 Express 3u3 + 2u + u*3 + 2 - 2 as d + ru*3 + gu + vu2 and give r. 4 Rearrange 107z*2 - 2362 + 2362 to az + oz2 + m and give o. 107 Rearrange (-1 + 2 + 0)(-17l - 35l - 54l) to the form o + rl and give r. -106 Rearrange -4l + 63 - 63 to kl + v and give k. -4 Rearrange (1 - 6 - 20)(3c + 7 - 7)(-5c*2 + 5c*2 - 2c*2) to gc*3 + s + kc + xc2 and give g. 150 Rearrange 2q2 + q2 + q*2 + 3q*2 to the form d + cq + tq2 and give t. 7 Express j4 - j4 - j4 + (4 - 4 + 7j*3)(j - j + j) as qj + ij*2 + kj*4 + mj*3 + c and give k. 6 Express -2 - 8c + 2 - 5c in the form i + wc and give w. -13 Express 33g2 + 10g*2 + 34g*2 - 8g*2 in the form a + xg*2 + ng and give x. 69 Rearrange -3b2 - 4b*3 + 2b*2 - 2b*2 to gb + zb3 + n + qb*2 and give g. 0 Rearrange (-3 + 2a + 3)(-1 - 1 + 0) + (-1 + 0 + 0)(13a + 9 - 9) to the form z + ra and give r. -17 Rearrange (2 + 2 - 6)(8 - 2 + 0)(-3 + 0 + 1)(5j*3 + 0j*3 - 3j*3) to mj + v + tj3 + oj2 and give o. 0 Rearrange (l2 + 0l2 + l2)(-4 + 2l + 4) - 4l*2 + 4l*3 + 2l*2 - 8 + 7 to the form tl*2 + sl*3 + xl + r and give t. -2 Express -40 - 3n3 + 2n*4 - 4n*4 + 2n + 43 in the form on + zn*4 + dn*3 + i + un*2 and give d. -3 Express 4 - 17y - 2 + 5y2 + 2y*3 + 16y - 4y2 as by*3 + s + xy*2 + fy and give x. 1 Rearrange (-10 + 3 + 8 - 75y)(-3 - 4 + 5) to ty + i and give t. 150 Express 2 + 6 - 4 + 2g + 2g3 as m + xg + hg3 + qg*2 and give q. 0 Rearrange -24d + 12d + 8d + 5 to the form w + ld and give w. 5 Express -26x + 41x - 16x - 10 in the form b + qx and give b. -10 Rearrange 6 - 21x*3 + 22x*3 + 0x*2 + 0x*2 to rx*3 + wx + ix2 + v and give r. 1 Rearrange -2s2 - s2 + 2s2 + ((2s - 3s + 3s)(1 - 2 - 1) + s + 5 - 5)(-2s - 2s + 2s) to the form is + os2 + u and give o. 5 Rearrange (3 - 3t - 3)(-9 - 5t*2 + 9) + (2 + 3t*2 - 2)(2t - 2t - t) to the form ot3 + it*2 + j + at and give o. 12 Rearrange -8 + 19 - 3m3 + 0m*3 to am + i + fm2 + hm*3 and give h. -3 Rearrange (0 - 2 + 1)((0 + 1 + 0)(0 + 0 + 1) - 4 + 3 + 2)(-21n4 - 28n*4 + 15n*4) to the form fn*4 + qn*3 + on + mn2 + u and give f. 68 Express (-8d*2 - 25 + 24d*2 - 18d*2)(6d2 - 5d*2 + 0d*2) as bd*4 + cd*3 + qd + h + id2 and give b. -2 Express 106 - f - 2f2 + f4 - 106 as gf3 + w + rf + bf4 + qf*2 and give r. -1 Express (-4 + 0 + 0 + 1)(-3x - 5x + 2x) as qx + h and give q. 18 Express (3 - 5 + 0)(16u - 31u + 17u + 7u3) + (-u3 - 2u*3 + 2u*3)(-3 + 3 + 2) - 2u3 - u + u in the form su*2 + au*3 + gu + w and give g. -4 Rearrange (-6t2 + 3t*2 - 3t*2)(-2t + 6 + t2 - 6) to g + at*3 + vt*2 + dt*4 + bt and give d. -6 Express -4o - o + 6o + 2o in the form lo + a and give l. 3 Rearrange (-a - a*2 + a)((2a + 0a - 4a)(0a - 2a + 0a) + (0 - 1 - 1)(-a2 + a2 + a*2)) to the form ta*2 + g + ja*4 + ka + oa3 and give j. -2 Express (1 + 1 - 4 + 3 - 3 - 4 + (3 - 6 + 4)(-3 - 2 + 3))(-3q*4 - 3q*4 + 4q*4) in the form gq*2 + fq*3 + mq*4 + z + aq and give m. 16 Rearrange (-4n - 3n + 2n)(3 + 3 - 7)(2n + 1 - 1)(0 - 2 + 0) to ln*2 + i + xn and give l. -20 Express (-4 + 4 + 1)(4m + m - 3m)(-4m3 - 13m*3 + 0m*3) in the form gm*4 + pm*2 + um*3 + x + wm and give g. -34 Express -11a2 + 0 + 0 + 10a*2 - 9a in the form b + pa + za*2 and give z. -1 Express (-4a*2 + 0a*2 + 2a*2)(3 - 12 + 2)(2a + 0a - 10a) in the form za3 + l + ha*2 + xa and give z. -112 Express (-9s + 9s - 2s2)(-3 + 1 + 1)(-11 + 11 - 4s)(2 + 1 - 4) in the form hs*3 + r + ds*2 + ms and give h. 8 Express 2s - 2s + 6s as d + bs and give b. 6 Express (-k4 + k4 - 2k4)((-2 - 1 + 4)(4 + 1 - 3) + 3 - 2 - 2 + 44 - 23 + 25) as xk + c + yk2 + gk*3 + sk4 and give s. -94 Rearrange (-y2 + 3y2 - 3y*2)(-21y + 27y + 17y + 102y) to the form dy + my*3 + v + cy*2 and give v. 0 Rearrange (-3l - 3 + 3 + (2 + 1 - 1)(3l + 0l - 2l))(-3 + 3 - 2l) to sl + hl*2 + b and give h. 2 Express t + 2t*4 - 4t3 + t2 + 8t3 - 4t*3 as lt + w + mt3 + ft*2 + kt*4 and give f. 1 Rearrange (5 - 2 - 5)(2s - 3s - s)(39s + 16s + 2s) to t + rs + os*2 and give o. 228 Express (-2g*2 - 2 + 2)((1 - 1 + 2)(1 + 1 - 1) + 2 + 3 - 4) + (-2g + 6g - 3g)(0g - g + 3g) in the form xg*2 + y + lg and give x. -4 Rearrange (-15 + 15 - 3y)(1 + y - 1) - 7y2 + 19 - 19 to the form u + by*2 + wy and give b. -10 Rearrange -21w - 3w*2 + 21w to the form k + xw + rw*2 and give r. -3 Rearrange (31 - 6 + 6)(0t - t + 3 - 1) + (4 - 2t - 4)(1 - 2 + 2) + t - t + t to the form jt + x and give x. 62 Express (3o - 4o + 0o)(-1 + 3 - 1) - o + 6o + o as wo + x and give w. 5 Express (-2n2 + 2n*2 - 2n*4)(2 - 3 + 0) + (6n4 - 2n*4 - 3n*4)(4 + 2 + 35) as hn2 + in*3 + bn*4 + t + yn and give b. 43 Express a4 - 1 + a3 + 2a4 - 2a*2 + 4a2 - a4 in the form sa3 + y + va*4 + wa + ia2 and give v. 2 Express -358s*3 + 2 - 36s*4 + 357s*3 - 3s*2 + 3s*2 as cs*3 + js + ts4 + h + ms*2 and give t. -36 Express (0 + 2 - 1 - 2 + 3 + 0 + (2 + 0 - 4)(-3 - 4 + 6) - 2 + 5 - 1)(0 - 3 + 5)(-2x + 1 - 1) as sx + f and give s. -24 Rearrange ((2 + 1 - 1)(2 - 2 - 2) + (0 - 2 + 0)(3 - 5 + 4))(0h + 2h2 + 0h) to the form qh2 + sh + b and give q. -16 Express -2r3 + 8r + r*2 - 3r - r*2 as nr + ir2 + z + mr*3 and give m. -2 Express (2m2 - m3 - 2m2)(-1 + 1 + 2m) + 2m*3 + 4m4 - m4 + 0m4 as gm*3 + bm*2 + rm + im4 + x and give g. 2 Express 2m*2 + 1 - 22m*4 + 24m4 - m + m3 - m*3 in the form sm + d + am3 + zm*2 + fm*4 and give z. 2 Rearrange -2g*3 - 13 - 2g*2 + 1821g + 4g2 - 1823g to the form vg + pg*2 + s + ug*3 and give p. 2 Express (31v - 56v + 22v - 7)(2v*2 + 0v + 0v) as cv + wv2 + xv*3 + n and give w. -14 Rearrange (0f*3 - 3f3 - f3)(-36f + 11f - 36f + 15f) to of*3 + hf + mf4 + qf2 + c and give m. 184 Express f3 + 2f2 - 2f + 2f4 + f + 0f as vf + sf*2 + gf*3 + p + df*4 and give s. 2 Express (-2a + 0a + 5a)(-1 - 3 + 1)(-3 + 2 - 1) in the form ba + t and give b. 18 Rearrange (3j + j*3 - 3j)(3 - 3 + 2) + (-2j - 2j + 2j)(10j*2 - 4j*2 - 11j*2) to v + aj + wj2 + oj*3 and give o. 12 Rearrange (4 - 3 + 1)(1 + 0 + j - 8) to the form zj + c and give z. 2 Rearrange (-r + 1 - 1)(3 + 2r2 - 3) + 21r*3 - 9 + 9 to the form zr*2 + p + xr*3 + yr and give p. 0 Express 3 - 400w3 + 399w*3 + 2w + w as yw3 + sw + z + tw2 and give y. -1 Express -1486x - 2x3 + 1486x + 62 as px3 + yx + tx2 + n and give p. -2 Express (-d - 2 + 2)(-1 + 3 - 6)(-d2 + d2 + d2) - 3d*3 + 3d3 - d3 in the form qd + b + td*2 + cd*3 and give c. 3 Express 4v - 109 - 8v + 52 + 52 in the form i + lv and give i. -5 Express 126w2 + 40w*2 + 5w - w - 2w in the form fw + jw2 + g and give f. 2 Rearrange -4m - 3m - 1 - m to om + w and give o. -8 Rearrange (45 - 23 + f - 25)(-4f + 3f + 0f) to the form tf + yf*2 + b and give t. 3 Rearrange (-5x + 2x2 + 5x)(1 + 0 - 2)((5 - 3 - 1)(-2x + 5x - 4x) - 8x - 3x + x) to jx2 + q + kx*3 + ox and give q. 0 Rearrange 3f2 - f4 - f2 - 1 + 2f + 0f2 - 4 to mf*2 + rf + if3 + af*4 + j and give m. 2 Express (-5a + 7a + 2a + (3 + 0 - 1)(-a + 5a - 3a))(a + 0a - 4a) as ma2 + ga + u and give m. -18 Rearrange (3 - 3 + 3)((3 - 3 - 2)(-3 - 4s + 3) - 3s + 5s - s) to the form p + ws and give w. 27 Express (0u - u + 2 + 0)(-59u + 103u - 78u) + 3u*2 - 9u*2 + 2u*2 in the form ru + wu*2 + m and give r. -68	{ "pile_set_name": "DM Mathematics" }
et k = -1.1 - -1.1. Suppose -4z = -x - 2x + 19, 0 = -5x - 5z - 15. What is the nearest to p in x, -5, k? k Suppose 0 = -d, d - 12 = -3j + 5d. Let r be 10/115 - (-504)/(-1035). Let m be 6/27 - 13/18. Which is the nearest to m? (a) j (b) r (c) 2/5 b Let u = -368 + 367.97. What is the nearest to -1 in u, 5, 4, -2? u Let y = -6 + 4. Let p be -1 + 14/6 + y. Let i = -0.11 - 0.89. What is the nearest to i in -4/7, 4, p? p Let y = -1040 - -1043.9. Which is the nearest to 1/3? (a) 5 (b) y (c) -3 c Let n = -208 + 204. Which is the nearest to -1/4? (a) n (b) 0 (c) 2 b Let y = -2286 - -6857/3. Let g be (-2)/3 - (-26)/(-6). Let z = 11 - 7. Which is the closest to y? (a) g (b) z (c) 0.1 c Let s = 0.091 - 3.091. Let q = -17 + 20. What is the nearest to -2/7 in q, s, -1? -1 Let s = -133.4 + 134. Which is the nearest to s? (a) -1/5 (b) -4/3 (c) -0.1 c Suppose 2m + 2 + 12 = 0. Let v be (-7)/12 - m/(-42). Let h = 1.5 + -2. Which is the closest to 2/5? (a) -4/3 (b) h (c) v b Let s = 927 - 932. Which is the nearest to -34? (a) -2 (b) s (c) 0.4 b Let u = -288 + 288. What is the closest to u in 0.1, -94, 4? 0.1 Let m = 358 - 361. Which is the closest to m? (a) -2/7 (b) 0 (c) 0.4 a Let p = -15 - -16.1. Let l = p - 1.7. Let w = l - -0.2. What is the closest to -1 in w, -3, 3? w Let o(f) = f + 11. Let z be o(-9). What is the closest to z in -3/4, -2, -1/5? -1/5 Let j = 73 + -32. Let a = j + -17. Let l = a + -22. What is the nearest to -2 in l, -0.2, -2/9? -2/9 Suppose 0 = -3p - 3r - 6, -2p - r - 7 = 2r. Let t be p/(2/2) + 5/(-7). Which is the nearest to 1? (a) t (b) 1/8 (c) 0 a Let t = 20/89 - 131/979. Which is the closest to -2? (a) -3/2 (b) t (c) -1/3 a Let g = -2 - -2.5. Let p = 1/2422 + -606/1211. What is the closest to p in -1/6, g, -2? -1/6 Let l = 96 + -96.5. What is the closest to 1/5 in l, 5, 3? l Suppose w = -x, -3x - 5 = -2x. Let k be 2/(-3) - 1/3. Which is the nearest to k? (a) w (b) 1 (c) 0.1 c Let r = 0.3 + -0.1. Let i be (1 - 64)(-9)/117 + -5. Which is the closest to -0.1? (a) r (b) i (c) 3 b Let w = -11/82 - 15/41. Which is the closest to -15/4? (a) -2 (b) -0.07 (c) 2/3 (d) w a Let i = -7.82 + -0.18. Let x = -8 - i. Let u be 1(-1 + 61). What is the nearest to x in 0, -0.3, u? 0 Let s = 655/3 + -219. Which is the closest to s? (a) -4 (b) -1/9 (c) -1 c Let z = -0.3 + 0.2. Suppose 2x - u + 15 = 4x, -5x = 4u - 45. Let f = -11 + 65/6. What is the closest to 0 in f, z, x? z Let i(v) be the second derivative of v3/3 + v2 - 8v. Let r be i(0). Suppose u + u = -r. What is the closest to -0.1 in 5, 3, u? u Let d = 0.474 - 0.074. What is the nearest to -3 in -1, d, 1/7, 0? -1 Let p = -99 - -498/5. Let k = 679 - 677. What is the nearest to 2 in k, p, 2/5? k Let t = -131.7 + 132. Let m = -7.7 - 0.3. What is the nearest to 0 in t, 5/3, m? t Let o = 0.04 - -0.26. Let y = 0.4 - o. Let x = -0.2546 - -0.1546. What is the nearest to y in -1, 0, x? 0 Suppose -2n + 16 = 2s, 4 = -7s + 10s - n. Which is the closest to -1? (a) 0.3 (b) -2/9 (c) 4/9 (d) s b Let n(z) = z3 - 3z*2 - 4z + 4. Let j be n(4). Let x = 0.32 - 0.3. Let o = x - 0.12. Which is the closest to o? (a) j (b) -2/9 (c) 1 b Let p = 769/8 - 97. Let u be (-3)/(-6) - (0 + 1). Let w = u - p. What is the closest to 1 in 5, -0.4, w? w Let f(v) = 72v + 358. Let h be f(-5). Which is the closest to -0.1? (a) -2/17 (b) -0.5 (c) 1 (d) h a Let h = 3/475 - -463/1900. Which is the closest to -32? (a) 0 (b) -2 (c) h b Let r = -0.2 + 0.02. Let c = r - 5.32. Let x = c - -0.5. What is the closest to -1/3 in x, -0.2, -4? -0.2 Suppose 0 = -10f + 6f - 132. Let i = f - -32. Which is the nearest to i? (a) -0.3 (b) 1/8 (c) 0.2 a Let o = -4 + 14. Let b = 14 - o. Let x = 2.2 + 0.8. What is the nearest to x in -0.2, -4, b? b Let f = -4 - -38/9. What is the nearest to 0.08 in -2/5, f, 1? f Let v = -0.1218 - -0.0218. Let r = -4.1 - -0.1. Which is the nearest to 2? (a) -0.4 (b) v (c) r b Let u = 2 + -12/7. Let k = 0.4 - -4.6. Which is the closest to -1? (a) k (b) u (c) 2 b Let s(b) = -172b - 2920. Let d be s(-17). Let t = 5 + -9/2. What is the nearest to t in 0.1, d, -2/15? 0.1 Let f = 29 + -29.245. Let y = f + -0.055. Suppose 2r - 6 = -14. Which is the closest to 0? (a) r (b) y (c) -3/5 b Let i = 10 - 10.3. Let t = 86 - 81. Which is the nearest to 0.07? (a) 2 (b) i (c) t b Let i = 2.32 - 0.32. Let t = i - 2. Let k = -1 + 1.2. What is the closest to k in 2, t, 3/2? t Let d = -9/7 + 43/28. Which is the closest to d? (a) 3/5 (b) 0.5 (c) 1/9 c Suppose 5v - 40 = v + 4o, -3v = 5o - 70. Suppose -5 = -5i - v. What is the nearest to i in 1, 2/5, 2? 2/5 Let v be 30/35 - 340/315. Which is the nearest to 3? (a) v (b) 2 (c) -2.1 (d) 0.5 b Let y = 86 + -82. Suppose -5s = -4u + 7, s + 15 = 4s + yu. What is the closest to 1 in 0.2, s, -2? s Let w be 320/(-1440) - ((-8)/126)/(-1). Which is the closest to 0? (a) w (b) 1 (c) 24 a Let r = -11 - -11.06. Let k = -0.04 - r. Which is the nearest to 1? (a) k (b) 9 (c) 3/4 c Let p = 0.309 + -2.309. Which is the nearest to 2? (a) 0 (b) p (c) 5 (d) -2.1 a Let d = -0.3 + -0.2. Let g(c) = c*3 + 3c*2 - 2c - 4. Let p be g(-2). Let h be (-4)/(-12)2/(p/(-9)). What is the closest to 0 in h, d, -0.3? -0.3 Let p = 425/7 - 61. Let o be 121/110 + 2/5. What is the nearest to p in o, 2, 0.3? 0.3 Let n = -0.0548 - 0.0452. What is the closest to n in -3/4, -2/11, 5, 3/7? -2/11 Suppose -2u = -5m - 34, 0 = 3u + m - 38 + 4. Suppose -uz + 17z = 20. Which is the closest to 0.06? (a) -0.5 (b) z (c) 0.3 c Let i = 1991 + -1987. Which is the closest to -1/4? (a) 8 (b) i (c) 0.3 c Let j = 0.01 + -3.01. Let s = j + 4. Let z be 20/25(-24)/(-32). Which is the nearest to 0? (a) z (b) 4 (c) s a Let h = 14 - 14.6. Let q = -265 + 263. What is the nearest to 2/3 in 4, q, h? h Let y = -4109 - -4110. Let g = 0.3 + -0.8. Let s = 3 - 2. What is the closest to y in s, g, -4? s Let s = 2851 + -2856. Which is the nearest to -515? (a) s (b) -4 (c) 1/6 a Let i = -1.95 + -0.05. Let j = 2.44 - 5.44. What is the closest to -0.1 in -2/5, j, i? -2/5 Let h = 306.6 - 306.4. What is the nearest to 1 in 4, 5, h? h Let x be (-200)/(-250) - (-676)/(-870). Which is the closest to 4? (a) 4 (b) -1/4 (c) x a Let i be (0 + (-2)/4)(-99)/(-33). Which is the nearest to -13? (a) i (b) -5 (c) -4 b Let m = -3.74 - -3.24. Let r be (2/(-6))/((-1)/2). What is the nearest to 1 in m, 8, r? r Let v = -0.006 + 12.006. What is the closest to -2 in -2/13, -0.5, v? -0.5 Let j = -12 + -88. Let v = -99.96 - j. Which is the closest to 1? (a) 0.5 (b) v (c) 0.2 a Let c = -0.5 - 3.5. Let g = 21 + -6. Let t = -14.9 + g. What is the nearest to t in -0.4, c, -2? -0.4 Let g = 1.04 + -1. Let d = -0.34 + g. Let p = -2.1 - -2.2. What is the nearest to -4 in -3, d, p? -3 Let k = 734 - 733. Which is the closest to k? (a) 1 (b) 5 (c) 0 (d) -4 a Suppose -2r = x + 1, 0 = 4x + 5r - 0 + 10. Which is the nearest to 1.2? (a) 0.5 (b) 0.3 (c) x a Let k = 779/4 - 2353/12. What is the nearest to -0.1 in k, 2/11, 0.4? 2/11 Let p = 55.3 + -55.1. What is the nearest to 2/5 in 2/33, -2/5, p, 0? p Let d = 97 + -74. Let l = -28 + d. Which is the nearest to 0? (a) 1/4 (b) -0.2 (c) l b Let r(s) = -21s + 104. Let m be r(5). Which is the closest to 2/3? (a) m (b) 2 (c) 5 b Suppose 0 = w + 1 - 6. Let x = 0.123 + -0.223. What is the nearest to -0.06 in w, x, -3? x Let u be (-5)/(-6) + -1*150/72. What is the closest to 1 in 2, -0.3, u? 2 Let r = -91/6 + 461/30. Which is the closest to 2/3? (a) 0.5 (b) 1/4 (c) r (d) -7 a Let y = 127.6 - 131.6. What is the nearest to 1 in y, 1, -1/214? 1 Let p be ((-10)/(-45))/(2/(-4)). What is the closest to 0 in 5, p, -1? p Let h = 23 - 23. Let n be 8 - (3 + h/2). Which is the closest to 2/3? (a) 3/5 (b) 1 (c) n a Let z = -0.615 + 0.715. Which is the nearest to -1/7? (a) 0.05 (b) z (c) -5 a Let x = -0.3 - -0.7. Let t = -0.3 + x. What is the nearest to t in -0.2, 0.2, 2? 0.2 Let w = -0.16 - 0.1. Let p = w + -0.04. Let g be 225/(-24) - (9 - 18). What is the nearest to -1 in 1, g, p? g Let b = 1073 - 1069. What is the closest to -1 in 2/5, 0.5, 12, b? 2/5 Let s = 16 + -15. Let w = -83 - -83.94. Let x =	{ "pile_set_name": "DM Mathematics" }
9 = 8c - 423c - 524 for c. 7 Solve -87a + 15 = 299 + 151 for a. -5 Solve -123s + 108s - 150 = 0 for s. -10 Solve 0 = 52484m - 52499m - 195 for m. -13 Solve 147o - 169 = 160o for o. -13 Solve 0 = 22m - 29m + 121m - 684 for m. 6 Solve -56b = -9b - 21 - 355 for b. 8 Solve -2561 = -549l + 9517 for l. 22 Solve 95v - 117v = 132 for v. -6 Solve 26 = -33k + 106 + 217 for k. 9 Solve 3775m - 3777m + 10 = 0 for m. 5 Solve 28v + 369v + 1869 = -1307 for v. -8 Solve 193 - 523 = -30p for p. 11 Solve 168o - 666 = -162 for o. 3 Solve -266 = 608d - 874d for d. 1 Solve 0 = -3o + 148 - 118 for o. 10 Solve 89b + 1320 = -21b for b. -12 Solve -173j + 494j = -5457 for j. -17 Solve 151m + 484 - 763 + 2091 = 0 for m. -12 Solve 237s = 301s - 448 for s. 7 Solve -16t = 574 - 542 for t. -2 Solve -478r - 2248 = 9702 for r. -25 Solve -203n - 1460 + 19 = -20 for n. -7 Solve 2661q - 32880 - 46950 = 0 for q. 30 Solve 135x = -1344x - 172x + 1651 for x. 1 Solve 64h - 1717 = -37h for h. 17 Solve 8p = 2p - 40 - 32 for p. -12 Solve -2617k + 204 = -2634k for k. -12 Solve 1241x - 1233x - 96 = 0 for x. 12 Solve 84z - 135 = -1311 for z. -14 Solve 4451 + 1108 = 327p for p. 17 Solve 18b - 19b = -21b + 180 for b. 9 Solve 434k + 6622 = -512k for k. -7 Solve 616w + 956 = 710w - 1112 for w. 22 Solve 0 = 579y - 319y + 2080 for y. -8 Solve 701 = -112o - 867 for o. -14 Solve -1206 = -110x + 177x for x. -18 Solve 49f + 142 = -250 for f. -8 Solve -80a = 124 + 46 + 70 for a. -3 Solve 0 = -4458k + 4435k - 207 for k. -9 Solve -34865j + 992 = -34741j for j. 8 Solve 468 - 138 = -211p - 92 for p. -2 Solve -579b - 20 = -297b - 287b for b. 4 Solve 0 = 1036g + 889g + 11550 for g. -6 Solve -120l - 1534 + 110 - 136 = 0 for l. -13 Solve -325f - 132 = 304f - 673f for f. 3 Solve 1496 = 49b + 186b + 139b for b. 4 Solve 15753u - 99 = 15786u for u. -3 Solve -5q + 84q = 117 + 278 for q. 5 Solve 79 = 10k - 1 for k. 8 Solve -374 = 88161o - 88183o for o. 17 Solve 112j - 218 - 8 = 446 for j. 6 Solve -143c - 148c = -274c - 272 for c. 16 Solve -5644 = 38o - 5150 for o. -13 Solve -348 = 109g - 150g + 226 for g. 14 Solve 87v = 75v - 7 + 79 for v. 6 Solve 159z - 260 = 3301 + 255 for z. 24 Solve 284 = 152y + 436 for y. -1 Solve -10c - c - 9c = -20 for c. 1 Solve 0 = -49g + 274 - 813 for g. -11 Solve 27v + 7 - 51 = 10 for v. 2 Solve -195f + 2713 - 909 = -2486 for f. 22 Solve -3q + 96 = q + 8q for q. 8 Solve 342 + 630 = 324p for p. 3 Solve 1991 - 743 = 104w for w. 12 Solve 351z - 417z - 2095 = -511 for z. -24 Solve 0 = -25r - 361 + 261 for r. -4 Solve -25n - 4641 = -5341 for n. 28 Solve -288h - 19 = -287h for h. -19 Solve 361g = -2040 - 3014 for g. -14 Solve 0 = 40j + 3 + 197 + 760 for j. -24 Solve -w = 11w - 88 + 52 for w. 3 Solve -269 = -54n + 109 for n. 7 Solve 6086 = -416f - 154 for f. -15 Solve 93y = 268y + 1925 for y. -11 Solve -18t + 17 - 38 = 33 for t. -3 Solve 0 = -4090m + 4676m + 20510 for m. -35 Solve 0 = -2b - 2871 + 2863 for b. -4 Solve -90 = 44t - 25t - 28t for t. 10 Solve 434l - 16280 = -306l for l. 22 Solve 0 = 16t + 2310 - 2214 for t. -6 Solve 30v + 127v + 421v + 4624 = 0 for v. -8 Solve -61h + 450 = 14h for h. 6 Solve -81 - 27 = -4882p + 4900p for p. -6 Solve 418u + 1302 = 325u for u. -14 Solve -92c + 112c = -140c - 2560 for c. -16 Solve 0 = -56v + 79 + 257 for v. 6 Solve -4 = 30017l - 30019l for l. 2 Solve 0 = 16p + 66p - 1263 - 869 for p. 26 Solve -4855m + 4906m = -561 for m. -11 Solve 15 + 91 = -39n - 50 for n. -4 Solve 0 = -133g + 168g - 140 for g. 4 Solve -7631q + 7648q = -153 for q. -9 Solve 3g = -58g - 427 for g. -7 Solve 91h = 20h - 159 - 196 for h. -5 Solve 66s = -236s - 18s - 1600 for s. -5 Solve -14o + 126 = -126 + 252 for o. 0 Solve 17a - 487 + 249 = 0 for a. 14 Solve -701 = -7f + 43f - 449 for f. -7 Solve 202 - 1552 = -27z + 77z for z. -27 Solve 541l - 2354 = 434l for l. 22 Solve 5659 - 875 = -299x for x. -16 Solve -1754h + 1716h = -532 for h. 14 Solve -3460n + 1064 = -3384n for n. 14 Solve 20t + 1798 = 1338 for t. -23 Solve 0 = 55z + 1038 - 213 for z. -15 Solve -10170p + 10213p = 1247 for p. 29 Solve 5415 + 5225 = 532v for v. 20 Solve -108m = 1913m - 62651 for m. 31 Solve 14y - 11 - 97 = -13y for y. 4 Solve 978 = 140j - 2 for j. 7 Solve 152t - 5t = -26t - 1211 for t. -7 Solve -8018u + 799 = -8065u for u. -17 Solve -19m = 121m - 104m - 504 for m. 14 Solve -1177r = -1183r + 24 for r. 4 Solve -375 = -228h + 203h for h. 15 Solve 0 = -29569o + 29592o - 276 for o. 12 Solve 248n - 2354 = -1114 for n. 5 Solve -170 = 10d - 499 + 229 for d. 10 Solve 49j - 96 - 21 - 275 = 0 for j. 8 Solve 165b - 260 + 123 = 853 for b. 6 Solve -302q = -331q + 13 + 16 for q. 1 Solve -54 = 5g - 30g - 4 for g. 2 Solve 55a + 329 - 879 = 0 for a. 10 Solve 112a + 9a = -182a - 3636 for a. -12 Solve -376f + 11070 - 542 = 0 for f. 28 Solve 3400x + 1404 = 3322x for x. -18 Solve 34o - 655 = 668 - 1289 for o. 1 Solve 41o + 254 + 6 = 14 for o. -6 Solve -1992 = -24y - 1704 for y. 12 Solve 4 + 312 = -39f + 43 for f. -7 Solve 308f - 8518 - 1646 = 0 for f. 33 Solve -353x + 12922 = -36x + 3095 for x. 31 Solve 647 = 505f + 142f - 1941 for f. 4 Solve 18l - 32l = -21l - 63 for l. -9 Solve -806 = 86v + 4v + 1264 for v. -23 Solve 0 = -2l + 7445 - 7467 for l. -11 Solve 10u - 71 = 14 - 5 for u. 8 Solve a = -10a + 8a + 30 for a. 10 Solve -3355 + 17665 = 795q for q. 18 Solve -707j + 2310 = -245j for j. 5 Solve -73j + 67j - 1782 = -168j for j. 11 Solve -45 = 13w - 240 for w. 15 Solve 192 + 773 = 83p - 280 for p. 15 Solve -2y + 408 = -10y + 352 for y. -7 Solve 256 - 264 - 328 = -56i for i. 6 Solve -140i + 6140 = -447i for i. -20 Solve 99849z = 99852z - 12 for z. 4 Solve 0 = -531w - 162w + 8316 for w. 12 Solve -23c - 2 - 30 - 37 = 0 for c. -3 Solve 4492 = -234z - 3531 + 2875 for z. -22 Solve 0 = -28k - 76k + 4k + 400 for k. 4 Solve 23v - 24082 + 24611 = 0 for v. -23 Solve -13a + 114 = 176 + 185 for a. -19 Solve 123i - 29882 + 8394 = 755i for i. -34 Solve -17j = -23 - 113 for j. 8 Solve 0 = -106p - 76p + 126p + 168 for p. 3 Solve -126 = -2244d + 2265d for d. -6 Solve 574x - 3490 - 4546 = 0 for x. 14 Solve 1788 = 42q + 107q for q. 12 Solve 97n - 212n - 158n = 1638 for n. -6 Solve 115 = -130j + 153j for j. 5 Solve 245d = 269d + 55 + 257 for d. -13 Solve 2255r + 38729 = -35686 for r. -33 Solve 27o + 22 - 1 = -6 for o. -1 Solve -271w - 4770 + 484 + 221 = 0 for w. -15 Solve -42q - 477 = 363 for q. -20 Solve -2655 + 895 = 352f for f. -5 Solve 46a + 3a = -1132 + 250 for a. -18 Solve -18 - 15 = -19l + 5 for l. 2 Solve -143p - 48 = -81p - 86p for p. 2 Solve -4058 = -4x - 4094 for x. -9 Solve -2752 + 1979 = 470v + 3457 for v. -9 Solve -889m - 1426 = 856m - 1807m for m. 23 Solve 36q + 61 + 73 = -46 for q. -5 Solve -342w + 19w + 2248 = -2597 for w. 15 Solve 1824 = 38559h - 38502h for h. 32 Solve -1683 = 373l - 472l for l. 17 Solve 87p - 410 - 146 = -34 for p. 6 Solve -145x = 22x + 1803 + 869 for x. -16 Solve 2s = 147s - 1247 + 5887 for s. -32 Solve -1794a + 3486a + 376 = 1786a for a. 4 Solve -89v - 93v + 232 = -66v for v. 2 Solve -65f + 274 = 209f for f. 1 Solve -343 = -41f - 103f + 233 for f. 4 Solve 194y = 143y + 146y for y. 0 Solve -3w + 454 = 472 for w. -6 Solve 470u = 483u + 182 for u. -14 Solve -5057k + 1040 = -5265k for k. -5 Solve 33s - 365 = 106s for s. -5 Solve 0 = 17l + 186l + 38l - 1205 for l. 5 Solve -112c = 169c - 2248 for c. 8 Solve -56y - 650 = 74y for y. -5 Solve -33 + 55 - 231 = 11y for y. -19 Solve 723i = -5777 - 1081 + 351 for i. -9 Solve -126c - 168c + 7c + 6601 = 0 for c. 23 Solve -4292 = -330w - 65 + 63 for w. 13 Solve -59n = -1755 + 752 for n. 17 Solve 7754 = -35x + 8244 for x. 14 Solve 0 = -532i + 4764 + 16516 for i. 40 Solve 0 = -243w + 4884 - 9015 for w. -17 Solve 49p + 2620 = 110p + 70p for p. 20 Solve -14s - 1 = -11 - 4 for s. 1 Solve -9h = -82h + 1168 for h. 16 Solve -34d - 20d = -2d - 208 for d. 4 Solve -120 = -2y + 4y - 110 for y. -5 Solve -406d + 401d = 35 for d. -7 Solve 243k + 25	{ "pile_set_name": "DM Mathematics" }
nearest integer? 3 What is 590 to the power of 1/4, to the nearest integer? 5 What is the square root of 13173 to the nearest integer? 115 What is the fifth root of 964 to the nearest integer? 4 What is the cube root of 116213 to the nearest integer? 49 What is the fifth root of 782 to the nearest integer? 4 What is 6962 to the power of 1/2, to the nearest integer? 83 What is the square root of 851 to the nearest integer? 29 What is 792 to the power of 1/2, to the nearest integer? 28 What is the square root of 3536 to the nearest integer? 59 What is 41067 to the power of 1/2, to the nearest integer? 203 What is the fourth root of 884 to the nearest integer? 5 What is the ninth root of 59483 to the nearest integer? 3 What is 422 to the power of 1/3, to the nearest integer? 8 What is 3349 to the power of 1/2, to the nearest integer? 58 What is 651 to the power of 1/8, to the nearest integer? 2 What is 6742 to the power of 1/3, to the nearest integer? 19 What is the cube root of 17801 to the nearest integer? 26 What is 5016 to the power of 1/3, to the nearest integer? 17 What is the third root of 6782 to the nearest integer? 19 What is the cube root of 11343 to the nearest integer? 22 What is 7983 to the power of 1/2, to the nearest integer? 89 What is 56634 to the power of 1/4, to the nearest integer? 15 What is 123995 to the power of 1/2, to the nearest integer? 352 What is 9056 to the power of 1/2, to the nearest integer? 95 What is the third root of 556 to the nearest integer? 8 What is the fourth root of 872 to the nearest integer? 5 What is the square root of 27123 to the nearest integer? 165 What is the eighth root of 16690 to the nearest integer? 3 What is 3039 to the power of 1/2, to the nearest integer? 55 What is 41484 to the power of 1/4, to the nearest integer? 14 What is 11502 to the power of 1/3, to the nearest integer? 23 What is the eighth root of 15973 to the nearest integer? 3 What is the tenth root of 523 to the nearest integer? 2 What is the ninth root of 14836 to the nearest integer? 3 What is 11254 to the power of 1/3, to the nearest integer? 22 What is 1797 to the power of 1/2, to the nearest integer? 42 What is the square root of 7505 to the nearest integer? 87 What is the third root of 378 to the nearest integer? 7 What is the third root of 9889 to the nearest integer? 21 What is the square root of 2772 to the nearest integer? 53 What is 28765 to the power of 1/2, to the nearest integer? 170 What is the square root of 27362 to the nearest integer? 165 What is the cube root of 115966 to the nearest integer? 49 What is the square root of 159353 to the nearest integer? 399 What is the ninth root of 12984 to the nearest integer? 3 What is the cube root of 16362 to the nearest integer? 25 What is the third root of 986 to the nearest integer? 10 What is 23168 to the power of 1/2, to the nearest integer? 152 What is 129220 to the power of 1/10, to the nearest integer? 3 What is the fourth root of 138178 to the nearest integer? 19 What is 141 to the power of 1/6, to the nearest integer? 2 What is 17099 to the power of 1/6, to the nearest integer? 5 What is the cube root of 8098 to the nearest integer? 20 What is 133 to the power of 1/7, to the nearest integer? 2 What is the third root of 130832 to the nearest integer? 51 What is the cube root of 1930 to the nearest integer? 12 What is the cube root of 83420 to the nearest integer? 44 What is the square root of 30382 to the nearest integer? 174 What is the fourth root of 17465 to the nearest integer? 11 What is the square root of 128044 to the nearest integer? 358 What is 4888 to the power of 1/2, to the nearest integer? 70 What is the square root of 948 to the nearest integer? 31 What is 121750 to the power of 1/2, to the nearest integer? 349 What is the square root of 1065 to the nearest integer? 33 What is the third root of 68442 to the nearest integer? 41 What is the third root of 14330 to the nearest integer? 24 What is the square root of 4229 to the nearest integer? 65 What is the third root of 4123 to the nearest integer? 16 What is 6636 to the power of 1/2, to the nearest integer? 81 What is the tenth root of 11842 to the nearest integer? 3 What is the cube root of 11729 to the nearest integer? 23 What is the square root of 669 to the nearest integer? 26 What is the square root of 3832 to the nearest integer? 62 What is 287 to the power of 1/2, to the nearest integer? 17 What is the seventh root of 14611 to the nearest integer? 4 What is 1101 to the power of 1/7, to the nearest integer? 3 What is 939 to the power of 1/6, to the nearest integer? 3 What is the third root of 19036 to the nearest integer? 27 What is 192 to the power of 1/8, to the nearest integer? 2 What is 2720 to the power of 1/9, to the nearest integer? 2 What is the third root of 900 to the nearest integer? 10 What is the square root of 10312 to the nearest integer? 102 What is the square root of 46028 to the nearest integer? 215 What is the square root of 2903 to the nearest integer? 54 What is the square root of 59604 to the nearest integer? 244 What is the eighth root of 425 to the nearest integer? 2 What is 522 to the power of 1/2, to the nearest integer? 23 What is the cube root of 740 to the nearest integer? 9 What is 3480 to the power of 1/5, to the nearest integer? 5 What is the square root of 31982 to the nearest integer? 179 What is 3100 to the power of 1/7, to the nearest integer? 3 What is the third root of 1651 to the nearest integer? 12 What is the seventh root of 204 to the nearest integer? 2 What is the square root of 15979 to the nearest integer? 126 What is 1189 to the power of 1/8, to the nearest integer? 2 What is 1893 to the power of 1/8, to the nearest integer? 3 What is the ninth root of 1260 to the nearest integer? 2 What is 10370 to the power of 1/3, to the nearest integer? 22 What is the sixth root of 15809 to the nearest integer? 5 What is the sixth root of 10599 to the nearest integer? 5 What is 25 to the power of 1/7, to the nearest integer? 2 What is the square root of 33479 to the nearest integer? 183 What is the cube root of 37434 to the nearest integer? 33 What is the square root of 1880 to the nearest integer? 43 What is the square root of 75164 to the nearest integer? 274 What is the square root of 321 to the nearest integer? 18 What is 40422 to the power of 1/3, to the nearest integer? 34 What is 383 to the power of 1/9, to the nearest integer? 2 What is the third root of 69537 to the nearest integer? 41 What is the fourth root of 12625 to the nearest integer? 11 What is the square root of 3227 to the nearest integer? 57 What is the fourth root of 13610 to the nearest integer? 11 What is 12528 to the power of 1/3, to the nearest integer? 23 What is 3497 to the power of 1/3, to the nearest integer? 15 What is 27941 to the power of 1/4, to the nearest integer? 13 What is 4251 to the power of 1/2, to the nearest integer? 65 What is the tenth root of 4358 to the nearest integer? 2 What is the fifth root of 1340 to the nearest integer? 4 What is 243 to the power of 1/6, to the nearest integer? 2 What is the third root of 13909 to the nearest integer? 24 What is the fourth root of 2792 to the nearest integer? 7 What is the fifth root of 863 to the nearest integer? 4 What is the square root of 19591 to the nearest integer? 140 What is 54804 to the power of 1/2, to the nearest integer? 234 What is the cube root of 11595 to the nearest integer? 23 What is 7146 to the power of 1/2, to the nearest integer? 85 What is 4859 to the power of 1/4, to the nearest integer? 8 What is 5279 to the power of 1/9, to the nearest integer? 3 What is 2983 to the power of 1/4, to the nearest integer? 7 What is the fourth root of 430 to the nearest integer? 5 What is the tenth root of 36050 to the nearest integer? 3 What is 22023 to the power of 1/5, to the nearest integer? 7 What is 9370 to the power of 1/9, to the nearest integer? 3 What is 1463 to the power of 1/2, to the nearest integer? 38 What is 1457 to the power of 1/2, to the nearest integer? 38 What is 3452 to the power of 1/7, to the nearest integer? 3 What is the cube root of 944 to the nearest integer? 10 What is 9895 to the power	{ "pile_set_name": "DM Mathematics" }
q) = q*2 - 8q - 10 + 3 - 2. Give w(a). -9 Let q(r) = -r - 7. Let a be q(-21). Suppose 5t = -a + 104. Suppose 7p = -2p + t. Let y(v) = -v3 + v2 + 2v - 3. What is y(p)? -3 Let r(m) = 15m2 - 759m - 276. Let b(y) = 3y2 - 151y - 55. Let n(q) = -11b(q) + 2r(q). Calculate n(48). 5 Let h be 3/(-6) - (-2)/4. Suppose h = 13o + 63 + 15. Let q(g) = -g2 - 6g + 8. Give q(o). 8 Let f(z) be the first derivative of 5z2 - 114z - 4504. Calculate f(12). 6 Let d(v) be the third derivative of 0 - 1/12v4 + 1/15v*5 + 1/6v*3 + 0v - 40v2. Suppose 0 = 3x + 9, 17 = -2b - 5x - 2. Calculate d(b). 21 Let l(a) = -a3 + a2 - a - 1. Let d be -16 + (10 - (-6 + 5)). Let u(z) = -4z3 + 5z*2 - 5z + 8. Let r = 1 - 0. Let f(i) = dl(i) + ru(i). What is f(0)? 13 Let q(z) = -22z + 266. Let f = -35327 + 35339. What is q(f)? 2 Let g(f) = 2f*3 + 31f*2 + 21f + 101. Let s be g(-15). Let d(y) = -y*3 + 19y*2 - 90y + 22. Give d(s). 0 Let s(u) = -11u + 14. Let v = -162 - -166. Determine s(v). -30 Let w(j) = -5j + 2. Let y(n) = -39 - 8n - 3n + 4n. Let k be y(-6). Determine w(k). -13 Let a(w) be the third derivative of -w6/120 + 4w*5/15 - 29w*4/24 - 2w*3/3 - 2w*2 + 76w. Determine a(14). -18 Let y(m) = m3 - m2 + 6m - 2. Let v(i) = -2i*3 + i + 7587i*2 + 3i*3 - 7585i*2. Let u(q) = 2v(q) - y(q). Let a be (-5 - 1)/(0 - -1). Give u(a). -10 Let z(x) = 3 - 3 + 2 - 6 + x. Let u be z(6). Let v(d) = -7d2 + 3d + 706 - 708 + 9d2. Determine v(u). 12 Let f(i) = 10 + 11 - 15i + 2 + 19i - 10. Calculate f(7). 41 Let o(t) = -312t + 123t + 177t + t*3 + 20. Give o(-4). 4 Let u be 5982/11 - (-2)/11. Suppose -20p + 12p = -u. Let j(m) = -32m*2 + pm*2 - 37m2 + 19 - m + m3. Give j(0). 19 Let g(n) = n - 7. Let b be 384/224 + (-4)/(-14). Let r(a) = a - 8. Let y(o) = br(o) - 3g(o). Determine y(6). -1 Suppose 0 = 4d - 0 - 8. Let c(w) = -47w*3 - 26w*2 - w - 2. Let q(b) = -6b*3 - 3b*2. Let y(v) = -c(v) + 8q(v). What is y(d)? 4 Let p(k) = -2k - k2 - 2 - 1 + 4. Let g = 43621 - 43628. Determine p(g). -34 Let o(s) = s3 + 27s*2 + 49s + 602. Let b be o(-26). Let g(v) = 2 - 6v - 6 + 3 + v2 + 6. Calculate g(b). -3 Let k(h) = -33h*3 + 79h - 25h - 10h*2 - 30h + 34h3 - 28h + 107. Calculate k(8). -53 Suppose 3l + 2 = -5x + 17, 0 = -2x + 3l + 6. Let n(t) = -83t2 - 13t + 11. Let r(q) = 33q2 + 6q - 5. Let z(h) = 2n(h) + 5r(h). Calculate z(x). 0 Let w(u) = -14u - 273. Let s be w(-20). Let v(k) = -7k + 22. Calculate v(s). -27 Let x(r) = 5r - 34. Let h(b) = -387b + 2714. Let v be h(7). Give x(v). -9 Suppose -l = -4j - 13, -14l = -5j - 11l - 11. Let r(k) = k*2 + 6k + 11. Calculate r(j). 3 Let k(z) = 18z + 8 - 17z + 1. Suppose 0r + 2r = 0. Let o be (r(-4)/16)/2. What is k(o)? 9 Let j(q) be the first derivative of 10q*2 - 129q + 3008. Calculate j(7). 11 Let f(r) = -57r3 - 54r*2 + 74r - 39. Let v(w) = 20w3 + 18w*2 - 25w + 14. Let b(d) = -6f(d) - 17v(d). Give b(-10). -14 Suppose 0z = 5z + 40. Let t(a) = a*3 + 8a*2 - 3a - 2. Let u be t(z). Let j = u + -18. Let v(d) = -3d + 4. Calculate v(j). -8 Let v(q) = 22q*3 - 3q*2 + 4q - 1. Let b(a) = -103a3 + 16a*2 - 19a + 6. Let h(g) = 3b(g) + 14v(g). Give h(5). 24 Let w(x) be the second derivative of -x4/3 + x3/3 + 7x2/2 - 605x - 2. Give w(-5). -103 Suppose 0 = 40f + 96f. Let s(n) be the third derivative of -2/3n3 + 1/60n*5 + 0 + fn + n*2 + 1/24n4. What is s(0)? -4 Let s(v) be the first derivative of -v6/120 + v5/12 - v4/4 - v*3/2 + 29v*2/2 + 2v - 32. Let l(z) be the second derivative of s(z). Give l(5). -33 Suppose 0 = -3h + 3d - 36, 5d = 2h - 0d + 39. Let s(g) = -7 - 189g + 0 + 190g. Give s(h). -14 Suppose 3p = r + 38, 3p + r = p + 17. Let z(k) = 10k + k*3 + pk*2 - 2k*2 - 3 + 7. Let q(a) = 6a*2 - 76a + 40. Let w be q(12). What is z(w)? -12 Let j(a) = -2a2 + 2a - 2. Let c = 77 + -41. Let h be (16/(-3) + 5)/((-2)/c). Let x be (h/(-10))/((-3)/15). Calculate j(x). -14 Let t(s) be the third derivative of -s*4/24 - 3s*3/2 - 76s*2 + 10. Determine t(2). -11 Let k be (-46)/(-4) - 2/4. Let h(n) = -5n + 0n - k + 10 + 3n. Give h(-7). 13 Let n(i) = 3i2 + 9i - 2. Let c be 9 + (3 - 17) + 1. Determine n(c). 10 Let q(h) = -h*2 + 12h - 19. Suppose -v = 2, -2n + 13v - 15v + 10 = 0. Give q(n). 16 Let m(d) = d3 + 15d*2 + 6d + 91. Suppose 3k + 5j + 266 = 191, -4j - 54 = 2k. Calculate m(k). 1 Let c(g) = -57g + 3. Let l(t) = 90t + 52. Let f(h) = -2c(h) - l(h). Determine f(7). 110 Suppose -4z = 5s - 25, 5z + 4s - 6s - 23 = 0. Let w(q) be the second derivative of q*3/6 - 6q*2 - 12594q. Calculate w(z). -7 Let d = -32 - -38. Let g = d - 4. Let f(v) = -1 + 4v2 + 3 + v - 2v - 3vg. What is f(2)? 4 Suppose -t - 175 = t + a, -4a + 190 = -2t. Let i = t + 78. Let w(d) = 3d + 8. Calculate w(i). -25 Let b(v) = -v - 3. Let n be b(-9). Suppose nr - 10r + 5 = w, 0 = 3r - 6. Let l(x) = x2 + 3x - 3. Give l(w). -3 Let z(p) = 2p2 + 44p - 78. Let v be z(-24). Let w be 6/14 - v/42. Let f(a) = a3 + a2 + 4. Determine f(w). 4 Let k(r) = 0r + 144 - 11r - 390 + 129 + 135. What is k(2)? -4 Suppose -5f - 9 = 3a, a - 4f = -26 + 6. Let i(o) = o2 + 7o - 2. Calculate i(a). 6 Let t = -38807 + 38824. Let q(k) = -k*3 + 18k*2 - 25k + 25. What is q(t)? -111 Let o(t) be the second derivative of -t*3 + 1/20t*5 + 7t*2 - 1/4t*4 - 1 + 57t. Determine o(4). 6 Let v(u) = -u*2 + 0u + 1 + 2u + 1. Let l be 6/(-11) - 98/231-6. Suppose -11 = -lh + 3d, 5d = 4h - 11 - 6. Calculate v(h). -6 Let h(o) = -6o - 19. Suppose 306 - 2391 = 454v + 185. Determine h(v). 11 Let x(y) be the second derivative of -1/20y5 - 2/3y*4 - 5/3y*3 - 3y + 11 - 2y2. What is x(-7)? 17 Let k(i) = -3i - 5. Let u(b) = -4b3 - 10b*2 + 8b + 3. Let p(n) = -3n3 + 3n - 3. Let y be p(1). Let a be u(y). Calculate k(a). 4 Let f(x) = -208x + 62. Let c(m) = 333m - 93. Let g(l) = -5c(l) - 8f(l). Give g(-21). -10 Let c(r) = -4r + 22. Let h(p) = -98p - 12938. Let x be h(-132). What is c(x)? 30 Suppose 5511j - 100 = 5501j. Let h(l) = -l*2 + 10l - 13. What is h(j)? -13 Let i(c) = 22c - 1055. Suppose 1248 = -2147t + 2173t. What is i(t)? 1 Let l(s) = s + 1. Let a(o) = -7o - 7. Let k(r) = -a(r) - 6l(r). Let c(g) = 3g*2 + 15g. Let t be c(-5). Suppose 4p + tp = -40. What is k(p)? -9 Let y = -10 - -15. Suppose -2o + 11 - y = 0. Let s(b) be the second derivative of -2b*3/3 + 2b*2 + 12757b. Determine s(o). -8 Let c(o) = -206062o + 29 - 20 + 206054o - 17. What is c(-7)? 48 Let d(w) = -w*2 - 10w + 3. Let o = 3418 - 3430. Give d(o). -21 Let s(w) = -w*3 + 13w*2 + w - 9. Suppose 9p - 74 - 43 = 0. Let f be s(p). Suppose -v = 4v + fb - 13, -5b = 3v. Let r(l) = 2l. Calculate r(v). 10 Let l(s) be the first derivative of -2s*2 + 8s + 2. Let u(h) = -6h + 12. Let r(a) = 8l(a) - 5u(a). Let t be (-2)/12 - (-629)/102. Calculate r(t). -8 Let u(j) = -203j*3 - 3j*2 - 3j - 2. Let s be u(-1). Let g(t) = 2t2 + 7 - 3t*2 - 210t + st. Give g(-10). -3 Let q be 20/105-1 + (-4920)/630. Suppose -28 = -5k + 2u, 2u + 6 = -2. Let d(z) = 1 - 2 + z + k. Determine d(q). -5 Let m(f) = -f3 - 5f*2 - f + 3. Let k be m(-5). Let v(c) = -35c*2 + 3. Let s(i) = 12i*2 + 64 - 21 - 26 - 18. Let g(x) = ks(x) + 3v(x). Determine g(1). -8 Let z(q) = 19q - 182. Let d be z(11). Suppose -18m + 405 = dm. Let n(o) = -o*2 + 5o + 9. Determine n(m). -27 Suppose -5b + 7 = m, 59 - 45 = 2m. Let j(c) be the third derivative of 5/24c4 - 22c*2 + 0c*3 + b + 0c. Determine j(-1). -5 Let l(h) = h*3 - 15h*2 + 16h - 8. Suppose 140 = 42i - 32i. Give l(i). 20 Let b(n) = -6 + 20 + n*3 + 44n + 20n - 69n - 3n2 - n2. What is b(6)? 56 Suppose -30 = 5x, -1041x + 402 = 7w - 1045x. Let c(d) = 8d - 425. Give c(w). 7 Let i = 187 - 183. Let c(s) = -s*3 - 10s*2 - 10s - 1. Let a be c(-9). Let h(d) = d + 6d - ad. Determine h(i). -4 Let o(h) = -7h2 - 8h2 + 42 - h3 + 1150497h - 1150462h. Calculate o(-17). 25 Let s(l) = 6l2 + 7l - 38. Let h(y) = -7y2 - 7y + 42. Let v(o) = 5h(o) + 6s(o). Give v(-11). 26 Let u(o) = 25*	{ "pile_set_name": "DM Mathematics" }
*4 - 19f*3 + 28874f*2 + 192076221. -156f*3 - 57f*2 + 57748f Find the third derivative of 823mt*4 - 184mt3 - 22mt2 - 22mt - t4 + 2t*3 - 114 wrt t. 19752mt - 1104m - 24t + 12 Find the second derivative of 3145q*4 + 2198q*3 - 21999q + 204 wrt q. 37740q2 + 13188q What is the second derivative of 84997441g3 + 36695222g? 509984646g What is the third derivative of -q2u*3 - 138025q*2u2 - q2u + 2qu2 - 103791169u*5 - 26u*2 + 2u wrt u? -6q2 - 6227470140u*2 Find the third derivative of -7929c*6 + 163c*5m + 13c2m - 969c - 28m wrt c. -951480c3 + 9780c*2m Find the third derivative of 36161501z3 + 23415948z*2. 216969006 What is the first derivative of -hl*2 + 1963hl - 5524h - 31l2 - l + 8809 wrt l? -2hl + 1963h - 62l - 1 Find the third derivative of -3f*6 + 1179f*5 - 675f*3 + 70457f*2 - 713 wrt f. -360f*3 + 70740f*2 - 4050 Differentiate -1137736g - 18892181 wrt g. -1137736 What is the derivative of 2g2 + 4621986g + 34700221? 4g + 4621986 What is the second derivative of 7m*3 + 155332m*2 - 8582650m? 42m + 310664 What is the derivative of 4553011i*3jn3 - 506365i*3n + n*3 wrt j? 4553011i*3n*3 What is the second derivative of 647385635t*5 - 85165t - 2145? 12947712700t3 What is the third derivative of 1120171047t*4 - 1134473044t*2? 26884105128t Find the first derivative of 35838922p4 + 43533661 wrt p. 143355688p*3 What is the derivative of -3056214d - 3366603 wrt d? -3056214 What is the second derivative of 7298l5 + 763l*4 + 2584932l wrt l? 145960l3 + 9156l*2 Find the second derivative of -1788811c*3h*2 + 151c*3h - 40c2 + 23ch2 + 117ch wrt h. -3577622c*3 + 46c Find the second derivative of -9222835h2z*3 + 3hz3 - 2z*3 - 2z*2 - 1302 wrt h. -18445670z*3 What is the second derivative of -19347997u*2 - 21393332u wrt u? -38695994 What is the first derivative of 5901n3 + 27n + 32224991? 17703n2 + 27 What is the third derivative of 819v*5 + 27154v*3 + 211v*2 + 68273v? 49140v2 + 162924 Differentiate -3671169w*4 - 18784519. -14684676w*3 What is the first derivative of -912x*4 + 3892x*2 + 50069426 wrt x? -3648x*3 + 7784x Find the second derivative of 19249233z2 + z + 3059324 wrt z. 38498466 What is the second derivative of -10018422s5 + s2 - 138132558s? -200368440s*3 + 2 What is the second derivative of -118261622v*2 + 59330127v wrt v? -236523244 Find the first derivative of 2a3 - 6a*2 + 125540a - 2767498. 6a2 - 12a + 125540 Differentiate 60950h2r + 26965438h2 - 443r wrt r. 60950h2 - 443 What is the second derivative of -38875b*2m*2 + 579b*2 - 96bm2 - 86bm - b - 3m*2 - 55m + 2 wrt b? -77750m2 + 1158 Find the third derivative of 3739209j*5 - 2j4 + j3 - 21840090j2 wrt j. 224352540j*2 - 48j + 6 What is the second derivative of 200983019v2 - 59171475v wrt v? 401966038 Find the first derivative of g*2q - 178gq*2 - 110452gq + 74439169q*2 - 2 wrt g. 2gq - 178q*2 - 110452q Find the third derivative of -247449808k4 - 290103361k*2. -5938795392k What is the second derivative of 831410401n2 - 3n - 73115770 wrt n? 1662820802 Find the second derivative of 111334u4 + 3u*2 + 7624u + 66 wrt u. 1336008u2 + 6 Differentiate 7753950f*3i - f*3 + 515186i - 19 with respect to f. 23261850f2i - 3f2 Find the second derivative of 20481m*4q + 1543m2q*3 - 2954618mq + 4q*3 wrt m. 245772m*2q + 3086q3 Find the second derivative of -655075737g*2p*2 + 35g*2p + 2g2 + 80gp + g - 291p wrt p. -1310151474g2 What is the second derivative of -1125c*2p3 + c2p - c2 - 8cp - 7250p*3 + 12416p + 4 wrt p? -6750c2p - 43500p Find the second derivative of -14548471a*4 + 1017250a - 9. -174581652a2 Differentiate 33t*4 - 27t*3 - 3t*2 - 109t + 32275648. 132t3 - 81t*2 - 6t - 109 What is the second derivative of -894734q4 - 56q*2 + 208q + 325066 wrt q? -10736808q2 - 112 Find the third derivative of 9009790x5 - x2 + 1159x + 171. 540587400x*2 Find the second derivative of -30874006t*2 - 1597207t - 2. -61748012 What is the third derivative of 5634d3o - 1877d3 + 11d*2o - 14515d2 + 3do - 10d + 2o - 1 wrt d? 33804o - 11262 What is the second derivative of -26670fl*3 + 3fl2 - 2fl + 40f + 6l3 + 42025l wrt l? -160020fl + 6f + 36l Differentiate 873345lw - 116l - 77w + 370126 wrt w. 873345l - 77 Find the second derivative of 134236026y*2 - 19y - 158558 wrt y. 268472052 What is the third derivative of -227054kl*3 + 24831kl2 + 2kl - 11l3 - l2 + 9l + 1 wrt l? -1362324k - 66 What is the first derivative of 11111g3 - 127gp3 + 8562409p*3 wrt g? 33333g*2 - 127p*3 Find the first derivative of -73298an2 - 159at - 1779n*2 - 2nt + 113t wrt a. -73298n2 - 159t Find the first derivative of 1768960d3 - 2917425 wrt d. 5306880d*2 What is the second derivative of -1487a*4 + 1961a*3 - 2a*2 + 5a - 9786747? -17844a2 + 11766a - 4 What is the second derivative of 11056b4 - 105b*3c + b*2c*3 + 21bc2 + 2bc - 2b + 37c3 - 940c*2 - 3c wrt b? 132672b2 - 630bc + 2c*3 What is the second derivative of -62791043l*2 - 7262l - 146 wrt l? -125582086 What is the derivative of -25552544wx - 19401289w wrt x? -25552544w What is the third derivative of -846463490r4 + 6r*2 + 26391091 wrt r? -20315123760r What is the second derivative of 364611d2i*2 + 56d*2 + 285541di2 - 234d wrt d? 729222i2 + 112 What is the first derivative of -46992730f - 61785108 wrt f? -46992730 What is the first derivative of 15988589h2j + 285337h2 wrt j? 15988589h*2 What is the first derivative of 112595747c - 29458617 wrt c? 112595747 What is the third derivative of -d*6 + 3782950d*4r*2 + 6434728d*2r*2 - 2 wrt d? -120d*3 + 90790800dr2 Find the third derivative of 5547081m*3 - 11136955m2. 33282486 Find the second derivative of -q3z2 + q3z - q*3 + 131q*2z - 25q2 + 25684830qz2 - 8q wrt z. -2q3 + 51369660q Find the first derivative of -89366c3 + 132c*2 - 62286693. -268098c*2 + 264c What is the derivative of -51944566j4 - 12498140? -207778264j*3 Differentiate 1942910dm3 + 3dm2 - 177987231d with respect to m. 5828730dm*2 + 6dm What is the third derivative of 3019c*3y*2 - 2993c*3y - 7c3 - 13129c*2y*2 + 18c*2y - 72cy wrt c? 18114y2 - 17958y - 42 What is the second derivative of 405311934j2 + 2828j - 51693 wrt j? 810623868 Differentiate 12413049g2 - 5g + 186471755 with respect to g. 24826098g - 5 What is the third derivative of 173480698i*4 - 186319713i*2 wrt i? 4163536752i Differentiate -29636130d2 + 6309459. -59272260d What is the first derivative of -6359939p4 - 1748370 wrt p? -25439756p*3 Find the second derivative of 996r*5 + 7r*3 - 62r*2 - 248r + 12227 wrt r. 19920r3 + 42r - 124 What is the third derivative of 1606w6 + 5w*4 - 330w*3 - 13w*2 - 495034? 192720w*3 + 120w - 1980 Find the first derivative of -267782544a - 139931948. -267782544 What is the first derivative of 947910501g*2 - 132824369? 1895821002g What is the second derivative of 7183w5 - 8w*4 + 140w*2 + 21100606w wrt w? 143660w3 - 96w*2 + 280 What is the second derivative of -1290411179c*3r*2 + 923c*3 - 4c*2r - 4cr - 2c + 29r wrt r? -2580822358c3 What is the third derivative of -310y*4 + 147557y*3 + 265766332y*2 wrt y? -7440y + 885342 What is the first derivative of -2h3 - 10486h*2 - 20252458? -6h*2 - 20972h What is the second derivative of -89649777o2u*2 - 2o*2u + 45o2 - 36263o + u + 2 wrt u? -179299554o2 Find the second derivative of 1600509n*2q*3 - 247n*2 + 1846nq - q3 - 2q*2 wrt q. 9603054n*2q - 6q - 4 Find the third derivative of 21ilp*3 + 12630ip3 + 61ip2 - 6ip - 7lp3 + 1784l + 3p3 wrt p. 126il + 75780i - 42l + 18 What is the second derivative of 43875921iy2 + 3iy - 1446i + 192*y wrt y? 87751	{ "pile_set_name": "DM Mathematics" }
inator of 45/602 and -133/2838. 19866 Calculate the common denominator of 19/895560 and -11/2448. 5373360 Calculate the common denominator of -1/36 and -19/2959333. 106535988 What is the lowest common multiple of 79974269 and 1648954? 159948538 What is the common denominator of 13/539400 and 133/5520? 24812400 Find the common denominator of 71/256 and -93/4399120. 70385920 Calculate the least common multiple of 3185541 and 54864. 50968656 Calculate the common denominator of -56/1021401 and 17/86138151. 258414453 What is the lowest common multiple of 26735104 and 248? 828788224 What is the smallest common multiple of 5556 and 96? 44448 Calculate the common denominator of 1/1617330 and 71/173030. 195696930 Find the common denominator of 19/1822212 and -157/462. 20044332 Calculate the lowest common multiple of 585750 and 1049400. 372537000 What is the lowest common multiple of 14 and 4160219? 8320438 Find the common denominator of 65/1564 and -113/91448. 1554616 What is the common denominator of -13/23860 and 107/13986732? 69933660 Calculate the common denominator of 41/123728 and -117/63536. 2350832 What is the smallest common multiple of 800121 and 179619? 8801331 Find the common denominator of 53/32467015 and -23/19480209. 97401045 What is the smallest common multiple of 2309924 and 4619848? 4619848 Calculate the least common multiple of 29029 and 1580007. 11060049 Calculate the least common multiple of 177200450 and 2264. 708801800 What is the common denominator of 52/4204377 and -93/2128? 470890224 What is the common denominator of 77/5552 and -1/1188128? 1188128 Find the common denominator of 83/31310 and 43/56358. 281790 Find the common denominator of -59/104035 and 35/29. 3017015 What is the smallest common multiple of 1753712 and 12714412? 50857648 What is the smallest common multiple of 1980869 and 185? 9904345 What is the smallest common multiple of 15 and 254300945? 762902835 What is the smallest common multiple of 424094 and 289155? 6361410 Calculate the common denominator of 67/6327 and 49/589266. 21802842 Calculate the common denominator of 123/470 and -43/4367428. 21837140 What is the least common multiple of 10755 and 186885? 44665515 Calculate the smallest common multiple of 1898070 and 2657298. 13286490 Find the common denominator of -63/22 and 131/21789690. 239686590 What is the common denominator of 83/935064 and -199/7792200? 23376600 What is the common denominator of -55/2429664 and -47/432? 21866976 Find the common denominator of 5/37851058 and 58/77. 416361638 Calculate the least common multiple of 101398540 and 50699270. 101398540 Find the common denominator of -65/1398 and 17/290784. 290784 Find the common denominator of -47/28 and 57/10682728. 10682728 What is the lowest common multiple of 209000 and 12749000? 12749000 Calculate the least common multiple of 58726548 and 73408185. 293632740 Calculate the common denominator of 89/690 and 109/3455658. 17278290 Find the common denominator of -45/45523346 and 103/406274. 2685877414 Calculate the common denominator of -38/1616481 and -7/413775. 121236075 Calculate the common denominator of -47/1120878 and -79/2442. 1120878 What is the lowest common multiple of 8638 and 9118? 39380642 Calculate the smallest common multiple of 616120 and 2062. 635219720 Calculate the smallest common multiple of 7034220 and 48. 28136880 Calculate the common denominator of -109/28 and -111/10575292. 10575292 Calculate the smallest common multiple of 25 and 1121974. 28049350 Calculate the lowest common multiple of 30500340 and 45750510. 91501020 What is the lowest common multiple of 11940789 and 27? 107467101 Calculate the smallest common multiple of 1610234 and 820. 16102340 Find the common denominator of -31/27859234 and 21/16. 222873872 Calculate the smallest common multiple of 3489392 and 3053218. 24425744 What is the least common multiple of 36720 and 88672? 11970720 Calculate the least common multiple of 181293 and 189926. 3988446 Calculate the smallest common multiple of 285 and 346800. 6589200 What is the smallest common multiple of 3461418 and 4615224? 13845672 Calculate the least common multiple of 246897 and 42. 493794 Find the common denominator of -25/16890282 and -55/4374. 456037614 Calculate the smallest common multiple of 20286 and 205758. 1440306 What is the lowest common multiple of 35027412 and 11675804? 35027412 Calculate the least common multiple of 3885171 and 82883648. 248650944 What is the common denominator of -11/213538 and -27/48590? 120648970 Calculate the lowest common multiple of 591738 and 321. 63315966 What is the least common multiple of 6932233 and 121352? 55457864 Calculate the lowest common multiple of 49 and 4267340. 29871380 Calculate the common denominator of -143/36 and 43/1253976. 3761928 Calculate the least common multiple of 458950 and 225. 4130550 What is the common denominator of 47/12575472 and -113/4004? 138330192 What is the common denominator of 107/55350 and 99/1144720? 154537200 Calculate the common denominator of -55/7784 and -137/6216. 864024 What is the lowest common multiple of 13034 and 244587? 23969526 What is the common denominator of -43/15000825 and 41/7143250? 150008250 What is the common denominator of -4/1181079 and -34/131231? 1181079 Find the common denominator of 109/2710136 and 105/9064. 2710136 What is the common denominator of 25/12304 and -3/416798? 3334384 Calculate the least common multiple of 454987 and 158782. 179264878 Calculate the common denominator of 23/123299 and 82/116325. 1303886925 What is the common denominator of -17/3471039 and -32/8613? 3471039 Find the common denominator of -9/14 and -7/2399596. 16797172 Calculate the least common multiple of 3852 and 853788. 274065948 Find the common denominator of 14/1553021 and -7/66086. 3106042 What is the lowest common multiple of 473263 and 373592? 253668968 Calculate the common denominator of -119/13780 and 151/455520. 24142560 What is the lowest common multiple of 1989570 and 165? 1989570 What is the smallest common multiple of 94514 and 154746422? 1083224954 Calculate the common denominator of -95/414 and -67/308. 63756 Calculate the least common multiple of 637596 and 1335. 3187980 What is the common denominator of -87/8984128 and -67/916? 8984128 Find the common denominator of 69/1413152 and 11/234. 12718368 Calculate the common denominator of 167/10501050 and -29/21920. 168016800 What is the least common multiple of 14002128 and 7001064? 14002128 Calculate the common denominator of 79/4142 and 103/3725102. 406036118 What is the smallest common multiple of 185 and 1386405? 51296985 Calculate the common denominator of -73/7235616 and -37/609. 50649312 What is the common denominator of -59/1580 and 109/22560? 1782240 Calculate the lowest common multiple of 24048496 and 32. 48096992 Calculate the least common multiple of 189259464 and 558837. 567778392 Calculate the common denominator of -67/2122152 and 99/116. 61542408 What is the smallest common multiple of 4424 and 1784136? 12488952 What is the least common multiple of 2316818 and 85510? 196929530 Calculate the common denominator of 133/481860 and 89/481860. 481860 What is the smallest common multiple of 1925850 and 5550? 1925850 What is the lowest common multiple of 2153780 and 5? 2153780 What is the common denominator of 3/164 and 85/308296? 12640136 What is the common denominator of 31/1072 and -127/706392? 94656528 What is the lowest common multiple of 20164012 and 20? 100820060 Find the common denominator of 31/25195 and 37/4026161. 20130805 Find the common denominator of 43/19620 and 79/143730. 31333140 What is the lowest common multiple of 792894 and 60? 7928940 Find the common denominator of 77/400 and 33/21652760. 216527600 What is the common denominator of -41/695838 and -82/2435433? 4870866 What is the lowest common multiple of 47262 and 23820048? 23820048 Calculate the smallest common multiple of 15068160 and 5886. 15068160 What is the least common multiple of 4027032 and 252? 28189224 What is the least common multiple of 19796832 and 1980? 98984160 Find the common denominator of 34/99519 and -157/84336. 399668304 Calculate the least common multiple of 770840 and 26759160. 187314120 Calculate the le	{ "pile_set_name": "DM Mathematics" }
/(b/(-20)). Sort 2/9, 0, q in decreasing order. q, 2/9, 0 Suppose 4c + 14 = -2. Sort c, 1, 2 in ascending order. c, 1, 2 Let b = 4/11 - 5/44. Sort b, 0, 1/8 in ascending order. 0, 1/8, b Let o = 0.04 + -6.04. Let j = -9 - o. Let n = j - 0. Put n, -2, -1 in ascending order. n, -2, -1 Let x(j) = -14j - 2. Let t(p) = -27p - 4. Let y(g) = 6t(g) - 11x(g). Let f be y(2). Let c be (-21)/f - 1/3. Sort c, -5, 4 in decreasing order. 4, c, -5 Suppose 2i + 2 = -2p, 2p - 28 = 6i - 2i. Let k(n) = n*2 - 10n + 3. Let x be k(9). Let g = -9 - x. Sort i, 2, g in ascending order. i, g, 2 Let a = -2.9 + 3. Let h be ((-37)/(-13) - 3)1. Sort a, h, 3. h, a, 3 Let y = 2.14 + -0.14. Sort 1, y, -3 in decreasing order. y, 1, -3 Let i = 9 - 11. Let s = -11 - -6. Sort s, 1, i in decreasing order. 1, i, s Suppose 18 = 2x - x + 4z, x - 5z = -18. Suppose 0 = 4h + 2 - 18. Sort x, h, 3 in increasing order. x, 3, h Let w = -14.8 + 2.8. Let q = -11 - w. Put q, 4, 5 in ascending order. q, 4, 5 Let i be ((-151)/(-46))/((-1)/2). Let o = 2963/115 + i. Let h = -19 + o. Sort 4, -3, h in decreasing order. 4, h, -3 Let i be (-18)/(-40) - 2/10. Put -5, -6, i in descending order. i, -5, -6 Let o be 9/(-15) + 74/(-10). Let i be -2 + 2 + (-2)/o. Suppose -5y + 0 = -10. Sort -1, i, y in increasing order. -1, i, y Let t = 12 + -3. Let k = t - 13. Sort k, -5, 1. -5, k, 1 Let r = 8 + -8.3. Let y = r + 1.3. Let a = -2 - y. Sort -1, a, -5 in ascending order. -5, a, -1 Let w = 84 - 86. Sort w, 3, 4, -3. -3, w, 3, 4 Let n = -2 - -1. Let o be (-5)/(-7) - (-3)/(-3). Suppose -2h + 1 = 4z - 7h, 0 = -5z - h + 23. Sort z, o, n in decreasing order. z, o, n Let n(b) = -b3 - b2 + 5. Let g be n(0). Put g, -5, -1 in decreasing order. g, -1, -5 Let o = -2 - 5. Let l = o + 4. Let a = 1.9 + -1.5. Sort a, -0.2, l. l, -0.2, a Let c be ((-6)/180)/(2/(-5)). Sort 0.09, c, 1/6 in decreasing order. 1/6, 0.09, c Let v = -7.08 - -0.08. Let k = -4 + 13. Let g = k + v. Sort 2/11, g, 4 in ascending order. 2/11, g, 4 Let v = -13/7 + 33/14. Let y be ((-30)/(-33) - -1) + -2. Put 0.05, y, v in descending order. v, 0.05, y Let x(q) = -q*2 + 7q + 5. Let t be x(7). Let j(z) = 3z3 + z2 - z + 1. Let h be j(1). Suppose -hc - 10 = -2c. Put -2, t, c in increasing order. c, -2, t Let g = -2.6 - 4.7. Let q = g - -7. Let x = 0.7 - q. Sort 5, x, -0.5 in decreasing order. 5, x, -0.5 Let i be (-2)/17 - 62/(-238). Put 2/7, -4, i, -0.1 in decreasing order. 2/7, i, -0.1, -4 Suppose -2o = 3n - 4, -2o - o = -3n + 24. Sort 3, -2/5, n. -2/5, 3, n Let w be 4/(-10) + (-4)/(-10). Let i(z) be the third derivative of z5/60 + z4/8 - 2z3 + z2. Let b be i(-5). Sort 6, b, w in increasing order. b, w, 6 Let p be (-6)/(-16) + 21/8 - -1. Sort p, -5, -8 in increasing order. -8, -5, p Let v = -17 - -16.89. Let p = 0.59 - v. Let c = p + -1. Sort c, -0.5, 0.5 in decreasing order. 0.5, c, -0.5 Let f be 38/(-30) + (-3)/(-5). Put 0.3, f, 4 in ascending order. f, 0.3, 4 Let x = 133 - 137. Put 3, x, -2 in decreasing order. 3, -2, x Let j(o) = o*3 + 19o*2 + 15o - 54. Let g be j(-18). Let b(v) = -v3 + v2 - v - 5. Let p be b(0). Sort -3, p, g in increasing order. p, -3, g Let s = 4 - 4.4. Let p = 2 - 1.8. Let m = -0.8 - p. Put m, s, 0.1 in ascending order. m, s, 0.1 Let b = 0 - -1. Let k be 46/(-14) - (-12)/42. Let c be (1/k)/(35/21). Put c, 3/4, b in descending order. b, 3/4, c Let q = -0.02 - 0.38. Let x = 0.9 + -1. Let g = q - x. Sort -4, g, -3 in ascending order. -4, -3, g Let y = -11.6 + -1.4. Let d = -12.97 - y. Sort 1/4, d, 1/5 in descending order. 1/4, 1/5, d Let z(o) = o*2 - 3o + 3. Let i be z(2). Let w be (30/25)/(3/10). Suppose 2k - k - w = 0. Sort 3, k, i in decreasing order. k, 3, i Let y = -6 + 8. Let u be ((-1)/(-9))/(3/(-9)). Sort y, 0.5, u. u, 0.5, y Suppose -s = -3s - 8. Put -8, 0, s in descending order. 0, s, -8 Let s = -153 - -167. Put 2, -5, -3, s in increasing order. -5, -3, 2, s Let f be -1((-58)/10 - -5). Sort f, 6, -4/7 in decreasing order. 6, f, -4/7 Suppose -12v = 2v + 70. Put v, -1, -4 in increasing order. v, -4, -1 Let d(i) = -i3 - 3i*2 + 4i - 4. Let c be d(-4). Sort -6, c, -5. -6, -5, c Let l = -8 - -5. Suppose 0 = -i + 6i - 25. Let b be (-26)/(-42) - 4/14. Put b, l, i in descending order. i, b, l Let m be (-6 + 3)(-4)/12. Suppose -12 = 4b + 8. Sort b, -4, m in decreasing order. m, -4, b Let v(t) = 7t*2 - t + 1. Let h be v(-2). Suppose -3c - 52 = -5z - 17, h = -3c + 4z. Sort -1, c, 0.3. c, -1, 0.3 Let i = 29.98 - 30. Sort -0.3, i, 0 in descending order. 0, i, -0.3 Let l = -1 + 3. Let f be l/6(14 - 2). Let x be 66/(-14) + 4/(-14). Sort x, f, -2 in decreasing order. f, -2, x Let b(a) = -a*2 - 3a + 11. Let v be b(-5). Sort -0.1, 0.1, v in decreasing order. v, 0.1, -0.1 Let h = -7 - 4. Sort 1, -3, h. h, -3, 1 Suppose 59t - 15 = 60t. Sort 1, -2, t in increasing order. t, -2, 1 Let u(i) = i*3 + 5i*2 - 6i + 4. Let t be u(-6). Suppose 7d + 7 = -0d. Put d, 2, t in increasing order. d, 2, t Suppose 3p = -0p. Let x = 5 + -2. Sort p, 2, x in decreasing order. x, 2, p Let d be 29/(-14)-6 + 12/(-28). Sort 2, d, -1, 4 in descending order. d, 4, 2, -1 Let i be -1 - -111/1. Put 5, i, 2 in descending order. 5, 2, i Let i be ((-7)/(7/6))/((-9)/(-6)). Sort 5, i, -1, 4. i, -1, 4, 5 Let g = 46 - 82. Let h be ((g/(-2))/3)/(-1). Let d be h/21 - (-3)/21. Sort d, -3, 0.1 in decreasing order. 0.1, d, -3 Let z = 16.6 - 17. Put 1, 0.2, z in decreasing order. 1, 0.2, z Let d(k) = k3 - 6k*2 - k - 6. Let m be d(6). Let t be (-60)/14 - m/42. Sort -3, 3, t in increasing order. t, -3, 3 Suppose -24 = -m + 3l - 9, -4m - 8 = 5l. Suppose 2c = ma + 12, 4c - 3c - 5a = 20. Let n = -5 + 1. Sort n, c, 4 in decreasing order. 4, c, n Let r be 1/((-2)/(8/(-5))). Let s = -8 - -4. Let i be 8/(-54)(-15)/10. Put r, i, s in decreasing order. r, i, s Suppose -c + 1 = -2c. Sort 6/5, c, 0 in increasing order. c, 0, 6/5 Let p be 1/5 + 3/(-5). Let w = 3 + 2. Suppose -3z - w = -2. Put z, 1/3, p in descending order. 1/3, p, z Suppose 5o - 17 = u, -u - 1 = -4. Suppose -d - 3d = 16. Put d, o, -7 in ascending order. -7, d, o Let h = 7 + -3. Let g = 11 + -21. Let u = g - -9.5. Put -3, h, u in ascending order. -3, u, h Let w be (-2)/(-5) - (-56)/10. Let l(p) = -p*2 + 8p - 9. Let b be l(w). Suppose o + 8 = -3o - 4h, -2o = -bh - 1. Put o, 4, -4 in increasing order. -4, o, 4 Suppose -7 = 4a - p, -3a + 3p = -4a - 5. Let s be a + (-2 - (-18)/3). Put 3, -4, s in ascending order. -4, s, 3 Let j be (-28)/6 + (-2)/6. Let w(g) = g*3 + 5g*2 - 6g + 3. Let y be w(-6). Put j, 0, y in decreasing order. y, 0, j Let w = -2.9 + -10.1. Let c = w + 10. Put -0.3, c, 5 in descending order. 5, -0.3, c Suppose 17 = -4p + 5o - 19, -p = -5o + 24. Let d = -6 - p. Sort -1, d, 5 in ascending order. d, -1, 5 Let d = -12 - -6. Let o = -0.2 + -0.8. Let b = d - o. Sort b, 0.3, -1/2 in decreasing order. 0.3, -1/2, b Suppose 0 = -3n + 10 - 1, 2t - n = 5. Sort 1, t, 5 in increasing order. 1, t, 5 Let k = 0 + 3. Suppose -5h = k - 28. Suppose 2z - hx - 4 = 4z, 5z + x - 13 = 0. Put -5, z, 5 in decreasing order. 5, z, -5 Let d(m) = -3m. Let p be d(1). Put -6, 3, p in descending order. 3, p, -6 Suppose 5c - 4 = 3o, 15 + 5 = 5c + 5o. Let g(p) = -3 + p + 4pc - p3 - 2 + 3. Let q be g(4). Sort q, -4, -1 in ascending order. -4, -1, q Let c = 2/635 + 1897/2540. Put 0.1, c, 0.4 in increasing order. 0.1, 0.4, c Let g(b) = b. Let h be g(4). Let u = h - 2. Put u, -2, 5 in increasing order. -2, u, 5 Let p(h) = 7h - 20. Let u(j) = 4j - 10. Let l(w) = -3p(w) + 5u(w). Let v be l(9). Sort v, -1, 2 in increasing order. -1, v, 2 Let l be (-2 + 10 + -3)1. Put -4, -11, l in ascending order. -11, -4, l Let i = -14/345 - -4/23. Sort -5, i, -2, -1 in ascending order. -5, -2, -1, i Let s = -5 - 4. Let b = s + 4. Suppose j + j = 0. Sort 5, b, j in decreasing order. 5, j, b Let h(d) = -d - 1. Let w be h(4). Let y(b) = b2 + 7b + 7. Let z be y(w). Sort 0, 1, z in ascending order. z, 0, 1 Let r = 57.4 + -57. Put 0.5, 6, r in decreasing order. 6, 0.5, r Let v = 6.6 - 7. Put v, 0.4, 7 in decreasing order. 7, 0.4, v Let y = -3 - -4. Let i = 0.454 + -0.054. Put i, y, -1 in descending order. y, i, -1 Let f(t) = t3 - t2 -	{ "pile_set_name": "DM Mathematics" }
17616. -1 11734744 divided by -2933686 -4 -34516568 divided by -4 8629142 -21116445 divided by -1 21116445 Calculate -296361461 divided by -43. 6892127 What is 232 divided by 1841355? 8/63495 Divide -15 by -5544997. 15/5544997 What is -6342472 divided by -4? 1585618 Divide -9632574 by -1. 9632574 790888 divided by -28 -28246 Calculate 893000 divided by -1000. -893 8608590 divided by -18 -478255 Calculate -1270314800 divided by -254062960. 5 Calculate -50680354 divided by 4. -25340177/2 Divide -892736 by -13949. 64 Calculate -291 divided by 1205629. -291/1205629 Divide 14 by -295229. -14/295229 Calculate -23 divided by 515669. -23/515669 Calculate 4020912 divided by -7978. -504 Calculate 1153384986 divided by -6. -192230831 Divide -10398 by 17506. -5199/8753 Divide 1883 by -63748. -1883/63748 179597622 divided by -636871 -282 What is 10918040 divided by -272951? -40 Divide 10483376 by -10483376. -1 -29981718 divided by 78 -384381 What is 1441758 divided by 3? 480586 -3877440 divided by 484680 -8 2139 divided by -5399 -2139/5399 -16477890 divided by 66 -249665 Calculate -113 divided by -1477198. 113/1477198 Divide 3118350 by -6. -519725 Calculate 4 divided by 18474906. 2/9237453 Calculate 55825992 divided by -4. -13956498 Divide 282234894 by -2. -141117447 What is 5 divided by -57128372? -5/57128372 -7495904 divided by -8 936988 14340506 divided by -7170253 -2 Calculate 3966 divided by -5724. -661/954 Calculate -8827326 divided by -326938. 27 Calculate -5 divided by 55413853. -5/55413853 Calculate 283762743 divided by 3. 94587581 Calculate 3362439 divided by -406. -3362439/406 -34217436 divided by -6 5702906 What is 2951 divided by -58867? -2951/58867 What is -2166462 divided by 722154? -3 What is 0 divided by -1289921? 0 What is -102 divided by 82029? -34/27343 -5456240 divided by -482 11320 What is -19216704 divided by 19216704? -1 What is -22107973 divided by -7157? 3089 Divide -913605 by -791. 1155 -52958064 divided by -26479032 2 -4589210 divided by 458921 -10 Calculate -471533287 divided by 5. -471533287/5 Divide -16072344 by 39393. -408 Calculate -51544457 divided by 58111. -887 What is 311507175 divided by 305? 1021335 335 divided by -61798 -335/61798 Divide 4 by -41008811. -4/41008811 What is 33273744 divided by 297087? 112 -4365232 divided by -1 4365232 932813 divided by -101 -932813/101 What is -1113 divided by -334840? 1113/334840 What is -736620 divided by 18? -122770/3 -219113500 divided by 18475 -11860 19474970 divided by -5 -3894994 Divide -12731755 by -5. 2546351 Divide 1 by 24035609. 1/24035609 Divide -68159700 by 6980. -9765 Divide -12255423 by -2. 12255423/2 21278652 divided by 5319663 4 Divide 824314 by -159. -824314/159 Calculate 4662675 divided by 62169. 75 Divide -9 by 1589213. -9/1589213 30611310 divided by -3 -10203770 3737 divided by -891 -3737/891 Calculate -32785718 divided by 23. -1425466 Divide 95545190 by -24914. -3835 What is -38 divided by -4890030? 1/128685 Divide 1312236 by 18. 72902 Calculate 22779771 divided by -78281. -291 -37226 divided by -8049 37226/8049 Calculate 20 divided by -1422813. -20/1422813 Divide 0 by -26277578. 0 Divide -173774696 by -8. 21721837 Divide -9598199 by 32101. -299 Calculate 5 divided by -29510410. -1/5902082 Divide 3279550 by -6130. -535 Divide 1 by 176866. 1/176866 -1970020 divided by -10 197002 Calculate -541207736 divided by 5176. -104561 What is 1103 divided by 20041? 1103/20041 What is 4408 divided by 1649? 4408/1649 -165 divided by 1344110 -33/268822 Divide 220226 by -454. -110113/227 What is 74960492 divided by 4? 18740123 Divide 5181242 by -11. -471022 What is 11207150 divided by 1255? 8930 8485155 divided by 369 22995 Divide 32003223 by -24983. -1281 What is -197583574 divided by 197583574? -1 What is 1598415 divided by 9? 532805/3 15901840 divided by 20 795092 Calculate 22397916 divided by 6. 3732986 Divide -7097302 by 99962. -71 What is 186972432 divided by -62324144? -3 -3404772 divided by 9 -378308 Divide -78 by 293222. -39/146611 Divide -5526 by 26630. -2763/13315 Calculate 5815645 divided by 141845. 41 -93593000 divided by -374372 250 Calculate -9040584 divided by 7. -1291512 Calculate 2761965 divided by -2495. -1107 Divide -250067265 by -35. 7144779 -19 divided by -672753 19/672753 What is 13731 divided by -383? -13731/383 Divide 11403845 by 6. 11403845/6 81436615 divided by 1252871 65 Calculate -241 divided by -4084677. 241/4084677 Calculate 802299225 divided by -85215. -9415 Divide -51702692 by 166. -311462 Calculate -1212982512 divided by 21660402. -56 -20773 divided by -31 20773/31 Divide -2543527 by -7. 363361 Divide 34539339 by -347. -99537 -5020680 divided by -125517 40 Calculate 11 divided by -380859. -11/380859 Calculate 92825680 divided by -18565136. -5 What is -2 divided by -8525756? 1/4262878 Calculate 7777041 divided by -23783. -327 -4839011 divided by 16 -4839011/16 Calculate -43 divided by 22172. -43/22172 Divide -163349295 by 54449765. -3 Calculate -309892 divided by 7043. -44 Divide -1253 by 1325. -1253/1325 Divide -4432804 by -2216402. 2 Divide 47439480 by 88. 539085 273328320 divided by -5520 -49516 56885440 divided by -54280 -1048 What is -217 divided by 174594? -31/24942 -22950720 divided by -147120 156 What is 2 divided by 1588386? 1/794193 4657324 divided by 49546 94 What is 1896 divided by -112632? -79/4693 Divide 404315676 by -33692973. -12 What is 6 divided by -14595639? -2/4865213 What is 1113303580 divided by 2? 556651790 Calculate 212 divided by 3463. 212/3463 What is 9838 divided by -702? -4919/351 -2842512 divided by 24 -118438 247003986 divided by -123501993 -2 -1411352 divided by 19 -1411352/19 Divide 2079220 by 189020. 11 0 divided by 70736701 0 -724053042 divided by 606 -1194807 Divide 14329 by 7709. 14329/7709 Divide -21 by 476367. -7/158789 -10112801 divided by -8 10112801/8 Calculate 145087 divided by 10. 145087/10 -14396655 divided by -1 14396655 What is -124909 divided by -930? 124909/930 -2 divided by -1316528 1/658264 What is 0 divided by 1393692? 0 What is 469 divided by 163330? 469/163330 Divide -141076022 by -2. 70538011 Calculate 33705315 divided by -11235105. -3 What is 521534624 divided by 65191828? 8 Divide 1574 by -474170. -787/237085 -35863 divided by -3613 35863/3613 Divide -12081718 by -8. 6040859/4 Calculate -3822176 divided by 15. -3822176/15 Divide -36510 by 37. -36510/37 Calculate -5 divided by -8531311. 5/8531311 What is -10616804 divided by 4? -2654201 Calculate -11602469 divided by 18. -11602469/18 What is -25072883 divided by -2? 25072883/2 -6100494 divided by -4 3050247/2 Divide -67197565 by -33415. 2011 What is -3578026992 divided by 6? -596337832 Divide 6231571 by -4. -6231571/4 What is 945 divided by -67997? -945/67997 Calculate 260078716 divided by 1054. 246754 What is -249475279 divided by 5? -249475279/5 What is -768750542 divided by 14? -54910753 Calculate 19360824 divided by 6. 3226804 Calculate 13476519 divided by -275031. -49 Divide 49890995 by 35. 1425457 Calculate -234829270 divided by -1. 234829270 Calculate 1819384 divided by 1819384. 1 What is 239538 divided by -55? -239538/55 Calculate -53032 divided by -3656. 6629/457 What is -1 divided by -66545489? 1/66545489 Divide -257841551 by 6. -257841551/6 Divide 986334804 by -2. -493167402 Divide -32428704 by -32. 1013397 1254216528 divided by -4 -313554132 -671 divided by 82019 -671/82019 988677214 divided by -1918 -515473 Calculate 3984063804 divided by -6. -664010634 200974629 divided by -2 -200974629/2 Calculate 25591764 divided by 4. 6397941 Calculate -47128224 divided by -13732. 3432 Divide -487689 by 3. -162563 Calculate -1148522380 divided by 287130595. -4 What is -18223 divided by -499? 18223/499 Divide -244304700 by 8143490. -30 Divide 73 by -151597. -73/151597 What is 31291520 divided by 97786? 320 Divide 83804292 by -52182. -1606 335215400 divided by -20795 -16120 -24956616 divided by -7481 3336 Divide -286786 by -1. 286786 What is -114801580 divided by -22960316? 5 Divide -12245750 by -122. 100375 What is 3996 divided by 768? 333/64 What is -15424 divided by -452? 3856/113 Divide 2047032 by -702. -2916 Divide 2861623 by -5. -2861623/5 -139750 divided by -25 5590 Divide 6152952 by 338. 18204 What is 772807 divided by 61? 772807/	{ "pile_set_name": "DM Mathematics" }
s prob of picking 3 m when three letters picked without replacement from mimmmmmim? 5/12 What is prob of picking 1 h, 1 a, and 1 y when three letters picked without replacement from hyayi? 1/5 Calculate prob of picking 1 d and 1 p when two letters picked without replacement from tttptddd. 3/28 Calculate prob of picking 1 j and 3 b when four letters picked without replacement from {j: 2, v: 7, b: 5, w: 4}. 1/153 What is prob of picking 4 z when four letters picked without replacement from {c: 4, z: 4, w: 8}? 1/1820 Two letters picked without replacement from {u: 7, a: 1}. Give prob of picking 2 u. 3/4 Two letters picked without replacement from {s: 4, a: 1, f: 4, t: 6, h: 2, z: 2}. What is prob of picking 2 s? 2/57 Calculate prob of picking 1 k and 1 w when two letters picked without replacement from rwrwrwrwkrwkr. 5/39 Two letters picked without replacement from {h: 4, i: 1, c: 1, p: 7, w: 2}. Give prob of picking 1 w and 1 i. 2/105 What is prob of picking 1 v, 1 b, and 1 y when three letters picked without replacement from zvbvbzbbvvvyv? 12/143 Calculate prob of picking 1 i and 2 f when three letters picked without replacement from igifxfgfffffgxxfx. 7/85 Two letters picked without replacement from {c: 1, d: 11, a: 5}. Give prob of picking 2 a. 5/68 What is prob of picking 2 g and 1 v when three letters picked without replacement from {v: 3, l: 5, g: 4}? 9/110 What is prob of picking 1 i and 1 b when two letters picked without replacement from {i: 1, b: 1, a: 1}? 1/3 Three letters picked without replacement from {j: 4, r: 4, u: 4, n: 3, x: 4}. What is prob of picking 1 n and 2 r? 6/323 Calculate prob of picking 3 a when three letters picked without replacement from {k: 9, a: 10}. 40/323 Three letters picked without replacement from shhhhshhhhhhh. What is prob of picking 1 h and 2 s? 1/26 Four letters picked without replacement from {m: 2, n: 4}. Give prob of picking 2 m and 2 n. 2/5 Calculate prob of picking 2 j when two letters picked without replacement from {j: 18, k: 1}. 17/19 Calculate prob of picking 2 c when two letters picked without replacement from {c: 2, t: 7, q: 6}. 1/105 Three letters picked without replacement from dfdfdddf. What is prob of picking 3 f? 1/56 Three letters picked without replacement from {j: 2, x: 10}. What is prob of picking 1 j and 2 x? 9/22 Calculate prob of picking 2 n when two letters picked without replacement from naznaaanaanz. 1/11 Two letters picked without replacement from dwcudibuiuibd. What is prob of picking 1 i and 1 c? 1/26 Two letters picked without replacement from {q: 7, h: 5, w: 2}. What is prob of picking 1 q and 1 h? 5/13 Three letters picked without replacement from {m: 10, b: 2, j: 5, f: 2, r: 1}. Give prob of picking 1 j and 2 m. 15/76 What is prob of picking 1 l and 1 c when two letters picked without replacement from laxagccg? 1/14 What is prob of picking 1 o, 1 l, and 1 v when three letters picked without replacement from {v: 10, l: 3, o: 4, e: 2}? 40/323 What is prob of picking 2 o when two letters picked without replacement from {z: 4, h: 1, m: 1, o: 9, s: 5}? 18/95 What is prob of picking 2 y and 1 m when three letters picked without replacement from {y: 5, m: 9}? 45/182 Three letters picked without replacement from {m: 2, n: 1, j: 4}. What is prob of picking 1 n, 1 m, and 1 j? 8/35 What is prob of picking 1 o and 1 m when two letters picked without replacement from wymowmmmm? 5/36 Two letters picked without replacement from ykyznsvynvsvzy. Give prob of picking 1 k and 1 v. 3/91 Calculate prob of picking 1 b, 1 p, 1 u, and 1 l when four letters picked without replacement from {u: 2, b: 4, y: 7, p: 1, l: 6}. 16/1615 Calculate prob of picking 1 f and 1 c when two letters picked without replacement from {m: 1, c: 2, f: 2}. 2/5 Four letters picked without replacement from bjjjjojwopjzoow. Give prob of picking 4 j. 1/91 What is prob of picking 1 g and 1 m when two letters picked without replacement from gmd? 1/3 Two letters picked without replacement from qtjjdjttttxtj. Give prob of picking 1 j and 1 q. 2/39 Three letters picked without replacement from nrrrnr. What is prob of picking 2 r and 1 n? 3/5 Calculate prob of picking 3 z when three letters picked without replacement from {j: 1, a: 1, z: 3}. 1/10 What is prob of picking 1 j and 3 x when four letters picked without replacement from {e: 4, x: 1, j: 2, q: 4}? 0 Calculate prob of picking 2 a when two letters picked without replacement from {r: 13, a: 2, o: 5}. 1/190 Two letters picked without replacement from {o: 7, h: 2, v: 2}. What is prob of picking 1 h and 1 o? 14/55 What is prob of picking 1 m and 1 a when two letters picked without replacement from jawjmjjjjwwwj? 1/78 Three letters picked without replacement from {u: 3, z: 15}. What is prob of picking 1 u and 2 z? 105/272 What is prob of picking 1 l and 1 d when two letters picked without replacement from {l: 2, k: 1, r: 2, d: 2, i: 2, f: 5}? 4/91 Four letters picked without replacement from {d: 13, f: 3}. What is prob of picking 3 d and 1 f? 33/70 Two letters picked without replacement from qrrqwqfwqfqrrqqq. What is prob of picking 1 q and 1 w? 2/15 Two letters picked without replacement from {u: 4, z: 2, s: 2, n: 1, a: 1, v: 5}. Give prob of picking 1 n and 1 a. 1/105 Two letters picked without replacement from {c: 1, b: 10, w: 2, l: 3}. What is prob of picking 1 c and 1 l? 1/40 Calculate prob of picking 2 p when two letters picked without replacement from {g: 1, p: 3}. 1/2 Calculate prob of picking 2 t and 2 n when four letters picked without replacement from {d: 3, j: 4, w: 1, n: 6, t: 3, a: 1}. 1/68 What is prob of picking 1 q and 2 y when three letters picked without replacement from ykprqerypyep? 3/220 Three letters picked without replacement from {b: 5, s: 9, n: 3, w: 1}. Give prob of picking 1 b, 1 s, and 1 w. 15/272 Three letters picked without replacement from {m: 1, w: 4, q: 11, u: 1, a: 2}. What is prob of picking 1 a and 2 w? 4/323 What is prob of picking 1 c and 1 b when two letters picked without replacement from ccsbcxcssx? 4/45 What is prob of picking 3 o and 1 z when four letters picked without replacement from {j: 6, f: 1, z: 4, o: 5}? 2/91 Four letters picked without replacement from xfxfbz. Give prob of picking 1 b, 1 z, and 2 f. 1/15 Four letters picked without replacement from {r: 3, i: 4}. Give prob of picking 3 r and 1 i. 4/35 What is prob of picking 2 a when two letters picked without replacement from aak? 1/3 Calculate prob of picking 2 f and 1 j when three letters picked without replacement from bjffbffjjjjbj. 18/143 Two letters picked without replacement from lupeeewuweewepoewpel. Give prob of picking 2 e. 14/95 Two letters picked without replacement from {a: 3, o: 4, b: 5, q: 1}. What is prob of picking 2 b? 5/39 What is prob of picking 2 v when two letters picked without replacement from {v: 2, w: 5}? 1/21 Two letters picked without replacement from rhqhqhhxhhhhhhhrhhoh. Give prob of picking 1 o and 1 r. 1/95 Two letters picked without replacement from kknknknknnnnknnnnnn. Give prob of picking 2 k. 5/57 Four letters picked without replacement from iqiqqiiiqqqiuqiqqiq. What is prob of picking 4 i? 35/1938 Calculate prob of picking 2 f, 1 z, and 1 r when four letters picked without replacement from {f: 5, z: 2, r: 2}. 20/63 Calculate prob of picking 2 u and 1 a when three letters picked without replacement from {a: 2, r: 2, y: 1, o: 5, u: 4}. 3/91 Three letters picked without replacement from {c: 1, q: 1, p: 7, a: 6}. Give prob of picking 2 a and 1 c. 3/91 Three letters picked without replacement from {t: 1, l: 9, w: 1, g: 8, i: 1}. What is prob of picking 2 g and 1 i? 7/285 Calculate prob of picking 1 w, 2 h, and 1 d when four letters picked without replacement from iwihhhddhwiiwhw. 16/273 Two letters picked without replacement from nnrnrrnnrnrrnr. What is prob of picking 2 n? 3/13 Four letters picked without replacement from {y: 6}. Give prob of picking 4 y. 1 Four letters picked without replacement from {k: 6, i: 6, v: 2, q: 1, e: 2}. Give prob of picking 1 q, 1 v, and 2 k. 3/238 Two letters picked without replacement from {q: 2, s: 3, u: 1, o: 10, x: 1}. What is prob of picking 2 q? 1/136 Three letters picked without replacement from eeeaa	{ "pile_set_name": "DM Mathematics" }
ve prob of sequence eeem. 1/7 Calculate prob of sequence bjb when three letters picked without replacement from njbvv. 0 What is prob of sequence vipi when four letters picked without replacement from izvpvppivv? 1/210 Three letters picked without replacement from {q: 1, b: 1, k: 2, g: 4, x: 3}. Give prob of sequence xxx. 1/165 What is prob of sequence zu when two letters picked without replacement from gbaaugvzz? 1/36 What is prob of sequence zxx when three letters picked without replacement from rzrszzxrzrjrzrzjxjzr? 7/3420 Two letters picked without replacement from {l: 2, o: 4, a: 4}. Give prob of sequence ol. 4/45 What is prob of sequence ivv when three letters picked without replacement from {i: 15, v: 4}? 10/323 What is prob of sequence hm when two letters picked without replacement from hmmhmhmmhmmmhm? 45/182 Three letters picked without replacement from {q: 2, k: 2, o: 1, j: 6, d: 5}. What is prob of sequence dkj? 1/56 Calculate prob of sequence nee when three letters picked without replacement from {n: 2, e: 4}. 1/5 Two letters picked without replacement from {a: 7, o: 1, y: 2, l: 4}. Give prob of sequence yo. 1/91 What is prob of sequence rj when two letters picked without replacement from {j: 1, n: 1, r: 1, v: 4, l: 1}? 1/56 Calculate prob of sequence mxx when three letters picked without replacement from {x: 5, m: 15}. 5/114 What is prob of sequence cccw when four letters picked without replacement from wcwqqcqcqq? 1/420 Calculate prob of sequence kkk when three letters picked without replacement from kkkkuuukkkkk. 21/55 Three letters picked without replacement from {m: 5, f: 4, y: 2}. Give prob of sequence fff. 4/165 Two letters picked without replacement from obdlc. What is prob of sequence lo? 1/20 Three letters picked without replacement from tzzzzzzzzcttzttzttzz. What is prob of sequence zzz? 11/57 What is prob of sequence rrrj when four letters picked without replacement from {j: 3, r: 12}? 11/91 Four letters picked without replacement from wwmwmwmwmwumwmwuw. What is prob of sequence mwum? 9/952 Three letters picked without replacement from kkklkl. What is prob of sequence kll? 1/15 What is prob of sequence bab when three letters picked without replacement from babb? 1/4 Two letters picked without replacement from {u: 1, k: 2}. Give prob of sequence uk. 1/3 Calculate prob of sequence wdw when three letters picked without replacement from ddwrrwrrr. 1/126 Three letters picked without replacement from {o: 6, q: 3, f: 1, t: 1, x: 5, i: 4}. What is prob of sequence qoo? 1/76 Calculate prob of sequence lv when two letters picked without replacement from jlgvojgvlvjj. 1/22 Four letters picked without replacement from jjjjjyyjjyyjjyyjjjj. Give prob of sequence jjjy. 143/1292 Calculate prob of sequence rb when two letters picked without replacement from bdugcgbcgcrgrcdcdc. 2/153 What is prob of sequence vao when three letters picked without replacement from {v: 3, a: 1, o: 5}? 5/168 Calculate prob of sequence adk when three letters picked without replacement from {w: 1, d: 2, k: 1, c: 2, a: 2}. 1/84 Four letters picked without replacement from {e: 1, y: 1, w: 1, u: 4, g: 2}. What is prob of sequence wyge? 1/1512 Three letters picked without replacement from sztvvrrvvsstvrw. Give prob of sequence zrs. 3/910 Two letters picked without replacement from mmkfmfmmmmmmmk. What is prob of sequence mf? 10/91 Three letters picked without replacement from {h: 5, o: 3}. What is prob of sequence oho? 5/56 What is prob of sequence hcc when three letters picked without replacement from eeeheucccuueu? 1/286 Two letters picked without replacement from {j: 12, p: 3}. Give prob of sequence jj. 22/35 Two letters picked without replacement from brdlbbodprrb. Give prob of sequence do. 1/66 What is prob of sequence qcwg when four letters picked without replacement from {g: 2, q: 3, w: 9, c: 3, b: 1}? 3/1360 Calculate prob of sequence vj when two letters picked without replacement from mjjmjvjo. 1/14 What is prob of sequence nyy when three letters picked without replacement from ynyyyuuuuu? 1/60 Three letters picked without replacement from hxfhxhhfx. What is prob of sequence xhh? 1/14 Calculate prob of sequence zhh when three letters picked without replacement from hzmzhkzfhzkkzt. 5/364 Four letters picked without replacement from keyyqeeyeyjjjkeyy. What is prob of sequence eqkj? 1/1904 Calculate prob of sequence oao when three letters picked without replacement from xookxoxkda. 1/120 Two letters picked without replacement from {b: 1, p: 2, v: 1}. Give prob of sequence bp. 1/6 Calculate prob of sequence mdo when three letters picked without replacement from {d: 4, m: 6, e: 2, o: 3, p: 2}. 3/170 What is prob of sequence wc when two letters picked without replacement from wwch? 1/6 Calculate prob of sequence vb when two letters picked without replacement from {d: 2, b: 1, v: 1, w: 1, n: 2}. 1/42 Two letters picked without replacement from vfmmv. Give prob of sequence fm. 1/10 What is prob of sequence ddy when three letters picked without replacement from mqddryrb? 1/168 What is prob of sequence oh when two letters picked without replacement from sooahrhhh? 1/9 Four letters picked without replacement from bbbbbbbbxbbbbxxbxbb. What is prob of sequence xxxx? 1/3876 Two letters picked without replacement from aaydl. Give prob of sequence da. 1/10 Two letters picked without replacement from ahkohghgkvg. Give prob of sequence hg. 9/110 Two letters picked without replacement from {m: 1, u: 1, j: 1, z: 1, v: 1}. Give prob of sequence uv. 1/20 What is prob of sequence ttt when three letters picked without replacement from {t: 5, x: 14}? 10/969 Two letters picked without replacement from {p: 1, n: 6, z: 3, d: 2, k: 6}. Give prob of sequence dd. 1/153 Two letters picked without replacement from ullllgalallylllula. Give prob of sequence ug. 1/153 What is prob of sequence jf when two letters picked without replacement from xxjjmlfljmxmbff? 3/70 Calculate prob of sequence pf when two letters picked without replacement from {f: 3, p: 1, w: 1, k: 2}. 1/14 Calculate prob of sequence xsqx when four letters picked without replacement from rrxsqxrsrrrr. 1/2970 Three letters picked without replacement from {s: 1, j: 8, c: 2, z: 2}. Give prob of sequence sjj. 14/429 Calculate prob of sequence ha when two letters picked without replacement from {a: 1, x: 5, c: 2, h: 3, p: 1, y: 3}. 1/70 Two letters picked without replacement from {b: 7, c: 1, z: 5, a: 1, o: 5}. What is prob of sequence zz? 10/171 Three letters picked without replacement from qgqgqwwqgwgqwqgqq. Give prob of sequence wwq. 2/85 Two letters picked without replacement from kkknkiiniknkn. Give prob of sequence nk. 2/13 Three letters picked without replacement from {f: 4, d: 6}. Give prob of sequence fdf. 1/10 What is prob of sequence bss when three letters picked without replacement from {b: 5, s: 9}? 15/91 Three letters picked without replacement from {f: 4, n: 5, h: 1, c: 5}. What is prob of sequence fff? 4/455 Two letters picked without replacement from mwwfaaffm. Give prob of sequence wa. 1/18 Calculate prob of sequence fbb when three letters picked without replacement from {o: 9, z: 3, b: 1, u: 2, c: 2, f: 1}. 0 Two letters picked without replacement from {x: 6, m: 3, y: 1, a: 1, o: 1}. Give prob of sequence yx. 1/22 Three letters picked without replacement from ehaaaekaheaaeehehhh. What is prob of sequence kaa? 5/969 What is prob of sequence ub when two letters picked without replacement from {m: 1, c: 2, u: 6, b: 2}? 6/55 Two letters picked without replacement from uukw. Give prob of sequence wu. 1/6 Three letters picked without replacement from {q: 1, i: 2, o: 1, m: 2, g: 1, t: 1}. What is prob of sequence mqi? 1/84 Calculate prob of sequence gue when three letters picked without replacement from egkxu. 1/60 What is prob of sequence lpr when three letters picked without replacement from rbrgdpbrprprlb? 5/728 Four letters picked without replacement from {l: 8, v: 2, r: 1, a: 2}. What is prob of sequence llaa? 14/2145 Two letters picked without replacement from {b: 5, x: 1, d: 6, g: 1, r: 1}. Give prob of sequence rx. 1/182 Calculate prob of sequence lmm when three letters picked without replacement from lml	{ "pile_set_name": "DM Mathematics" }
a) -4655/6 (b) 5 (c) -5 (d) -8 d What is the closest to 86/3 in 0.4, -10, -2/13, 13, 0.3? 13 Which is the closest to -25.263? (a) -5 (b) 0 (c) -0.3 a What is the nearest to 82 in 1, 19, 0.01, -105/11? 19 What is the nearest to 0.06 in -1081, 4, -1, 5, 16? -1 What is the closest to 257 in -0.4, -2/13, -21, -1, -4? -2/13 What is the closest to 1/3 in -12013, -3/2, 1/3, -6? 1/3 What is the closest to 4734 in -0.05, -6, 0.203? 0.203 Which is the nearest to -0.1? (a) 0.1 (b) -1.91 (c) -0.218 (d) 0.3 c What is the closest to -13 in -2, -17756, 3/4, 0.5, -0.06? -2 What is the nearest to 0 in 0.42, -136/7, -63, 0? 0 Which is the nearest to 201908? (a) -5 (b) 0.5 (c) 8/9 (d) 0 c Which is the closest to 15? (a) 1.6 (b) -1115 (c) -1 a What is the nearest to 1/4 in 6, 3/5, 4, -5, 0.2, -22076? 0.2 What is the closest to -1916 in 5, -2, 6, 56, 0? -2 What is the closest to 0.1 in 5, -4458, -185? 5 What is the closest to 6/7 in -2/15, -80, 864? -2/15 Which is the closest to -2/9? (a) -7/5 (b) 2 (c) -8 (d) -1/32 (e) 43 d What is the closest to -1 in 9, -16482.3, -4, -1/4? -1/4 What is the closest to 1204 in -1104, -3, 0.2, -2/11? 0.2 Which is the closest to -6? (a) -4 (b) 0.216 (c) -2 (d) -9 (e) 3/4 a What is the closest to 74 in 1, 272/7, -11? 272/7 What is the closest to -1/8 in -25, -1.2, -3, -2.5, -5/3? -1.2 Which is the closest to 0? (a) 4/3 (b) -101 (c) 2 (d) -0.0537 (e) 2/9 (f) -4 d Which is the nearest to 111? (a) 5 (b) 13 (c) 0.1 (d) -3 (e) -0.2 (f) 29/3 b What is the nearest to -8 in 2/171, 22.4, 4, 0.1, -3? -3 Which is the closest to -3? (a) -5 (b) 86 (c) -58/7 (d) -2 d What is the nearest to 2/3 in -0.5, 896/51, -1? -0.5 Which is the closest to 0.74? (a) -0.6 (b) -4 (c) -5 (d) 1039/5 (e) -1 a Which is the closest to 1/19? (a) -0.3 (b) 156 (c) 1 (d) -0.065 (e) 4/5 d Which is the nearest to 1? (a) 0.06 (b) 5 (c) -19 (d) -525 (e) 9 a What is the nearest to -0.2 in -0.1, 5/17, 0.5, 10/4683? -0.1 Which is the closest to -2/19? (a) 4/331 (b) 4 (c) 26 (d) -0.2 (e) 3 d Which is the nearest to -2520? (a) 2/9 (b) 97/7 (c) -0.4 (d) 1/3 (e) 0 c Which is the nearest to 0.2? (a) -1/5 (b) 5/4 (c) 1225 (d) 5 (e) 14 (f) 9 a What is the nearest to 1/3 in -16, -20, 0.53, -11, -3/2? 0.53 Which is the nearest to 1? (a) -1/5 (b) -3/16 (c) -1/3164 (d) -5 c Which is the nearest to 3/20? (a) 54.9 (b) 13 (c) -2/7 c What is the closest to -1 in 3, 0.043, -132, -30, 2? 0.043 Which is the nearest to -10? (a) -20/7 (b) -0.4 (c) -2 (d) 2/2389 a What is the nearest to -4 in 3, 1, 0.6164, -0.2, -2/21? -0.2 What is the nearest to -0.08 in 0.5, -5/4, 6/7, -0.3, -7/531? -7/531 Which is the closest to 3? (a) -35/4258 (b) 4 (c) 5 b Which is the closest to -1? (a) 37/60 (b) 2/3 (c) 0.3405 (d) 3 c What is the closest to -31 in 797, 0, -0.212, 2? -0.212 What is the closest to 2 in -35, 2, 57/5, 0.3, 1/10? 2 Which is the nearest to 0.13? (a) -6/5 (b) -2 (c) -10/159 (d) 2 c Which is the nearest to -6702? (a) 3 (b) -3 (c) 5 (d) 131/17 (e) 4 b What is the nearest to 1.3 in -0.3, -0.32, 0.4, -6/31? 0.4 Which is the nearest to 0.1? (a) 4 (b) 18 (c) -1300 (d) -1/5 d Which is the nearest to 1? (a) -1/7 (b) -386 (c) -2/13 (d) -0.1704 a Which is the nearest to -1? (a) 13 (b) 0.068 (c) 2 (d) -3/16 (e) -5 (f) 32 d What is the nearest to 300 in -185, 5, 2/35, 1? 5 Which is the nearest to -1/14? (a) 7382 (b) 0 (c) -2.27 b What is the nearest to -3 in 3/2, -1/5, 8/863, -0.08, -0.3? -0.3 What is the closest to -0.2 in -98.2, 223.3, -0.1, 0? -0.1 Which is the nearest to 0.2? (a) 5 (b) -4 (c) -1/2 (d) -215 (e) 4/3 (f) -4.7 c What is the nearest to 74 in 1.3, 6, 57, -1/3? 57 What is the nearest to 2/3 in -11, -2/3, -3, 0.5, -4, 1779.8? 0.5 Which is the nearest to 89? (a) 0.5 (b) -53 (c) 1/6 (d) 3 (e) -1/9 d What is the closest to 178606 in 2/11, 0.03, -58? 2/11 What is the closest to 5 in -13.1, 2, -0.4, -13, -7/4? 2 Which is the closest to 0? (a) 0.162 (b) 2/67 (c) 15.64 b Which is the nearest to 1/29? (a) 1113 (b) 0 (c) -1/3 (d) -1/4 (e) 2/3 b What is the nearest to 17 in -39, 2/5, -0.14, 2, 0.2? 2 What is the closest to -1 in 40.1906, 0.6, 20? 0.6 Which is the nearest to -131? (a) 0.1 (b) -338 (c) 4 (d) -4 d What is the closest to -0.2319 in -1, -0.0514, 0.4, -2, -0.2, -0.4? -0.2 Which is the nearest to -1/3? (a) -0.3 (b) 3/23 (c) -782.7 (d) 0.1 a What is the nearest to -526 in 334, 2/17, 0.2? 2/17 Which is the nearest to 2/97? (a) -17/3 (b) 78 (c) -5 (d) -16 c What is the closest to -0.29 in 24.86, -3/8, -0.1? -3/8 What is the closest to -0.1 in -5, 45, 5/41, 15.6, -1? 5/41 What is the closest to 1216 in -0.4, -8, -2/9, 0.28? 0.28 Which is the closest to 0.16? (a) 62392/3 (b) 0.5 (c) -10 b Which is the nearest to 1? (a) 0.2 (b) 9 (c) -1 (d) -16.33 (e) 4 a What is the nearest to 2/21 in 3/5, 1.5, 18/11, 1, -5, 2.6? 3/5 Which is the closest to -181? (a) 1 (b) -144837 (c) 2/15 c What is the nearest to -0.2 in 0.2556, 0, 3, 9/5, -5? 0 Which is the closest to -34? (a) 35 (b) -0.25 (c) -11 c What is the closest to -1/2 in 18, 3/5, 220456, 4? 3/5 Which is the nearest to 0.5? (a) -0.205 (b) 0.07 (c) 5/13 (d) 1 c What is the nearest to -4/135 in -0.3, 14/3, -5, -135? -0.3 Which is the nearest to 2/3? (a) -0.4 (b) -0.03 (c) -10/27 (d) -11.3 (e) 3 b What is the nearest to 0.1 in 0.957668, -4, 5? 0.957668 Which is the closest to -0.3543619? (a) 0.5 (b) 2/9 (c) 0.1 (d) 5 c What is the nearest to -2/9 in 10, 0, 5.87502, 5? 0 What is the nearest to 0 in -0.485, 37/5, -75/8? -0.485 Which is the nearest to 84? (a) -3 (b) -0.2 (c) -75.8 (d) 2 (e) 0.7 d What is the closest to 0.1 in -2, -15, -30.51, -6, 0? 0 Which is the nearest to -1/5776? (a) 1 (b) 79.4 (c) -4 (d) -5 a Which is the nearest to 4096? (a) 0.3 (b) -0.3 (c) 4/3 (d) -0.2 (e) -1/4 c Which is the nearest to 61/5? (a) 0.4 (b) -3 (c) -4 (d) -3.39 a Which is the closest to -4/11? (a) 32/13 (b) 0.03 (c) 1/3 (d) -3/5 (e) 4 d Which is the closest to 21/5? (a) -4/9 (b) 9.5 (c) -0.1 (d) 5/2 d Which is the nearest to 72/85? (a) 2 (b) 31 (c) -0.4 a What is the closest to -0.061 in -3, -2/21, -499, 1/2? -2/21 What is the nearest to 1.9 in -4, -1/19, 1648, -0.5, 0.3, -3? 0.3 What is the nearest to 891 in -1, -0.1, -26, 3/4, -9? 3/4 Which is the closest to -31? (a) -10 (b) 21 (c) 20 a What is the nearest to -4 in 3/7, 1, 0.02, 5, 1/2, 2/9? 0.02 What is the nearest to 0.2 in 8/19, -0.068, 1.4, 0.5, -4/9? 8/19 Which is the closest to 65? (a) -5 (b) 0.5 (c) 0.05 (d) -2/9 (e) -7 b Which is the closest to -88? (a) 9 (b) 1238/7 (c) 0 c What is the nearest to -2/3 in 2.3, -1/7, -0.1, 14, 4? -1/7 What is the nearest to -26 in -43, -5, 14, -0.3, -0.5? -43 Which is the nearest to 2? (a) -10.97 (b) 5/4 (c) -7 (d) 5 (e) 3/7 b What is the closest to -1 in -15, 3, 470004? 3 Which is the nearest to -0.01? (a) -0.1 (b) -28 (c) 5 (d) 0.04 (e) 4 (f) 588 d What is the nearest to -1/2 in -1/5, -2/3, 9, -4, 2879? -2/3 Which is the nearest to 0? (a) -0.5 (b) -1 (c) -606 (d) -3/8 d What is the nearest to -3/2797 in -4, 0.2, 58? 0.2 Which is the closest to 0? (a) 134.7 (b) 9538 (c) 0.4 c Which is the nearest to 2? (a) 0.3 (b) 13 (c) -208/289 a Which is the closest to -61? (a) 4/3 (b) -0.2 (c) 9.9 (d) -3/4 d Which is the nearest to -76169? (a) 4 (b) 117 (c) -5 c Which is the closest to -0.3? (a) -1/9 (b) 3 (c) 2/30515 a What is the closest to 0.012 in 3, 374, -0.5, -5, -7/5? -0.5 What is the nearest to -4 in 192457, 0.1, 0.3, -4, -5/2? -4 Which is the nearest to 1/6? (a) -1 (b) -103 (c) -2/3 (d) -15778 c What is the closest to 0.04 in 12/491, 4, 0.4, -40? 12/491 Which is the closest to 52? (a) -8 (b) -0.1 (c) -216 b What is the closest to -132 in 3/22, 27, 0.2? 3/22 What is the nearest to 16/5 in -2, 31, -24, -0.09, -2/3, 4? 4 What is the nearest to 2/5 in 2/5, 160, 12, 2/9, 4? 2/5 What is the closest to -293 in 0.01, 4, -3, -268? -268 What is the nearest to -81 in 5, -2119.23, 1/9? 1/9 Which is the nearest to 13/15? (a) -6 (b) 0.2 (c) -0.2 (d) -9 (e) -1/2089 (f) 1/3 f Which is the closest to 1? (a) 9/2126 (b) -2/7 (c) 11 (d) -3 a Wh	{ "pile_set_name": "DM Mathematics" }
Suppose 0 = -i - ci + 24. Solve -4a + i = 0, -4b - 10 = 2a - a for b. -3 Let d = 62 - -13. Suppose 3b - 2a = 3a + 35, 0 = -3b - 3a + d. Let k be (24/(-3))/((-2)/4). Solve -5q - 3r = -b, -k = -4q - 0q - 5r for q. 4 Let i(h) = h*3 - 3h*2 + 3h + 1. Let d be i(3). Solve -z - 4z = r - 14, 4r = 3z + d for z. 2 Let b = 81 - 73. Solve 0 = -2u + b, 4u - 10 = -v + u for v. -2 Let m be ((-1)/(-2))/(153/30 - 5). Solve -n + 5 = ms - 0, -25 = -5n + 3s for n. 5 Let p be (0 - -1 - 2)0. Let r = 0 - p. Suppose 2o - 51 + 11 = r. Solve -d - 4g - 17 = g, 4d = -4g - o for d. -2 Suppose f = -8f + 45. Solve 0 = 4k - ft - 1 - 3, 4k + 32 = -4t for k. -4 Suppose 23 = 5d + 2w, -5d = w - 5w + 1. Solve -4l - 22 = 3v, -5 = -dl - 2v - 21 for l. -4 Let u(r) = r - 4. Let s be u(7). Suppose -2i = k + sk - 46, 0 = 5i - 4k - 45. Let b = i - 8. Solve 2q + 12 = -0v - 2v, 3v = -bq - 22 for v. -4 Let d = 50 + -47. Solve 35 = 5q + 4r, -q + 2r - dr = -8 for q. 3 Let k = -11 + 5. Let q = k + 11. Let o = q + -3. Solve -1 = 5t - 2i + 4, -3t = -oi + 3 for t. -1 Let m be 980/52 - 4/(-26). Solve a + 4t = m, t = a + 6t - 24 for a. -1 Let h be (-6)/(-9) + (-30)/(-9). Suppose 28 = ha - 0a + r, 2a - 3r = 0. Let q be a - 3/22. Solve 5x + q - 23 = -5n, n + 4 = 3x for n. 2 Let o be ((-22)/6 - -4)3. Solve -2q - o = -y, 5y - 4 - 17 = 2q for q. 2 Let t = 18 + -13. Suppose 0v + tv + 5p = 15, 0 = v + 5p - 7. Solve -vi - 2c - 8 = 0, 4i - 6i = 5c + 17 for i. -1 Suppose r + 3r = 3q - 30, -2q = -5r - 20. Let s be (q/4)/(3/6). Solve -4a - 3t - 12 = 0, -13 - 2 = sa + 4t for a. -3 Suppose 4z = 7z - 9. Suppose 16 = i + zi. Solve 4g + ik + 16 = 2k, 0 = -3g + 4k - 1 for g. -3 Let p(i) = i*2 - 10i + 13. Suppose -2l - 2 = -20. Let s be p(l). Solve su - 3k = -8 - 9, 2u - 5k + 5 = 0 for u. -5 Suppose 0c - 4c = 2w - 84, -c - 4w + 7 = 0. Let r = c - 21. Solve -5x = 5m, -rm - 2m = -3x - 35 for m. 5 Let u be (-1)/(-1(-5)/(-10)). Solve -2x = uj - 4j - 16, 5x = 4j + 37 for j. -3 Let t(a) = a*3 - 4a*2 - a + 7. Let r be t(4). Solve rf - s = 2, -5f + 4s = -s for f. 1 Suppose 0t - 5c = 4t - 60, 2t - 20 = -5c. Let b = 6 - 4. Suppose -3s = bs - t. Solve -3f + 3g = 6, -4f = 5g - s + 12 for f. -2 Let i(p) = -p3 - 9p*2 + 3p + 29. Let h be i(-9). Solve hm = -0m + 2v - 12, -4m - 5v - 15 = 0 for m. -5 Suppose 16 = l + 3. Solve 2p + 9 = -5r, -2p + 31 = -4r + l for p. 3 Suppose -3o + 23 = 5s - 3, 3o - s = 2. Let i = -8 - -12. Solve 0 = ot + ij + 20, 3t - 3j - 4 = -t for t. -2 Suppose 2z + 9 = 13. Solve 0 = -4q + q + 2v - z, -3q = -3v + 3 for q. 0 Let k be 0 - 0/(1/((-2)/(-6))). Solve -7v + 2v + 3f + 10 = k, -v = 3f - 2 for v. 2 Let j be 2/7 + (-153)/21. Let z = j + 12. Let m = -4 + z. Solve m = q - n, 5q - 6n = -2n + 8 for q. 4 Suppose 7 = 3t + 4. Solve -2 - t = -3s + 4a, s + 2a = 1 for s. 1 Let m(o) = -3o - 4. Let s be m(-5). Suppose -2h + h + s = 0. Solve -r + 2f + h = 1, 0 = 5f + 20 for r. 2 Let l = 11 + -8. Suppose 4f = 3k - f - 10, k = lf + 2. Solve -4o - ku - 23 + 3 = 0, -2o = 3u + 12 for o. 0 Let g = 28 - 20. Suppose 5t = 31 + 19. Let m be ((-5)/(-1))/(2/t). Solve x + 7 = -3w, 0 = -5x - 2w + m - g for x. 5 Let c be 16/(-6)3/(-2). Let b(u) = u*3 - 3u*2 - 5u + 6. Let w be b(c). Let j = 25 + -13. Solve -i = -5f + 3, wi = 6i + j for f. 0 Let b = -2 + 2. Solve b = -3i + 3j - 3, -4i + 4j + 41 = -9i for i. -5 Suppose 3o - 15 = 0, -5q + 0q + 5 = -3o. Solve -4a = 3w + w + 4, 5w = -qa - 5 for a. 0 Let i(m) = 5m - 2. Let n(p) = 24p - 9. Let a(c) = 11i(c) - 2n(c). Let x be a(3). Solve 4v - 3 = 5, -3j + 4v = x for j. -3 Suppose -2b - 44 = -5r, 0 = 2r - b - 7 - 10. Solve -6 = -2p - 3t, r = -4p - t + 2 for p. -3 Let w(g) be the second derivative of 5g*3/6 - 5g*2/2 + 2g. Let y be w(-11). Let x be (y/(-50))/(2/5). Solve -3r = 3j - 21, -3j - r + 11 = -xr for j. 5 Suppose -4l + 26 = -2b, -3l + 8 + 10 = -b. Solve 3h - lz = h + 28, 0 = 5h + 5z for h. 4 Suppose -3h + 6h - 36 = 0. Suppose -w + 82 = 4z + 5, 87 = 4z + 3w. Let c = z - h. Solve j + 4j - 2 = 3f, 0 = 3j - 3f - c for j. -2 Suppose -2s = -0s - 6. Suppose 40 = 5v - 0v - 2x, -sv = 3x - 24. Let k be (v/(-16))/((-2)/4). Solve -8 = f + 2y, 0 = -y - k - 4 for f. 2 Suppose 4t - 11 - 9 = 0. Let f(l) = -l2 - l + 13. Let q be f(0). Let d = -8 + q. Solve -o - v + d = 0, 0 = -4o + 3o + 2v + t for o. 5 Suppose 1 = -2p + 5. Let o be 2/4-2 + 4. Let c = 5 - o. Solve 0 = cm + ph - 4h - 18, 5m - 2h = 30 for m. 4 Let d(z) = 2z*2 + 2z - 2. Let f be d(-2). Let p be (-2)/(3/(-93)2). Solve 2o + 4t = -fo - 12, 5o - 3t + p = 0 for o. -5 Let w = 6 + -4. Suppose y - 9 = -p, -y + 28 = y + 4p. Suppose 0j + y = j. Solve 5i + ws = 23, 0 = 2i + 5s - 1 - j for i. 5 Suppose -p - 5 + 17 = 0. Let o be 5 + -1 + -3 + (-3)/(-1). Solve -oj - 16 = -5c, -6c + 3c = 3j + p for j. -4 Suppose -2y - 3p = -20, 4 + 8 = 2y + p. Suppose 9 + 6 = 3x, -c - 45 = -3x. Let o be (36/c)/(2/(-15)). Solve -yn + o = 5q, q = -0q + 3n - 2 for q. 1 Let n = 1 + 4. Solve 0 = 3m + 7 + 5, 15 = 5h - nm for h. -1 Let k(v) = -v3 - 4v*2 + 5v + 3. Let s be k(-5). Let f be (3 + -1)(-1 + s). Solve -5x - 3 + 0 = -fb, 0 = -x - 2b + 5 for x. 1 Let s = -84 + 164. Suppose -3v = -7v + s. Solve 5w - 9 = -3q + v, -11 = -5q + w for q. 3 Let g be (0 - -3) + (-5 - 0). Let i be -1 + (g - -3) - -2. Suppose 3z + ib + 7 = 4z, -3z = 4b - 1. Solve f + 0f + zp = -17, -15 = 3p for f. -2 Let y(s) = s + 4. Let c be y(6). Suppose 5v = 5h + c, 0h = -2v - 2h + 4. Solve -1 = d + vk, -3d + 2k = 7 + 12 for d. -5 Suppose 0 = -5w + j - 36, 0 = 5w - 5j + 11 + 29. Let r = w - -13. Let a be (-5 - -28) + (-2 - 0). Solve 4y = 3m - r + a, 2y - 15 = 3m for y. 0 Let h = -11 - 7. Let r = h - -18. Let q = -12 + 17. Solve 3c - 2 = qy, r = 3y - 3c + 5c - 14 for y. 2 Let h = -64 + 66. Solve 2z + 2x = 8, -x = 5z + hx - 22 for z. 5 Let p(c) = c - 7. Let f be p(11). Suppose 10a - f = 8a. Solve -l = -5d - 9, -6d + ad - 20 = -4l for d. -1 Let w = 3 - 1. Suppose 3r + 6 = -u + 6r, -3 = wu - 3r. Solve 5h + 5 = -5c, h - u - 1 = 0 for c. -5 Let i(c) = c2 + 8c - 8c - 5. Let j be i(4). Solve -5r = 5m - 2m - j, -2m = -3r + 18 for m. -3 Let p(l) = l*2 + 2l + 4. Let u be p(-4). Let b = -7 + u. Let n = 9 - b. Solve -z + 8 = -5v, nv + 0v + 3z = -14 for v. -2 Suppose -10 = 5x + 5. Let l be -4 - (1 - 5) - x. Solve 3u + lb + 2b = 17, 5u - 15 = -5b for u. -1 Let q = -11 + -3. Let n be (-56)/q + (0 - 4). Solve 11a = 6a - 5y + 10, n = 5y - 20 for a. -2 Suppose 0 - 4 = -2u. Suppose uo = -2l + 14, -4o = l - 4 - 18. Suppose 4x + 4 = -2r, -14 = 2x + 2r + lr. Solve -4p - 4 + x = -v, -4v - 5 = p for v. -1 Suppose 84 = 3y + 15. Let v = -9 - -9. Suppose v = 4i + 8 - 24. Solve 0 = iz - 5s - y, -4z + 13 = -3s - 4 for z. 2 Let b(p) = -3p - 1. Let i be b(-2). Suppose -4x + 0x - 40 = -2j, -2j + ix = -42. Solve 5v + j + 15 = -3w, 4v + 18 = w for v. -5 Let c = -60 + 64. Solve 3l - l - ch - 6 = 0, 3l - 6 = 3h for l. 1 Suppose -5y = -2q - 3q, 5y + 3q = 8. Suppose -3n + 14 = -y. Solve -z + 20 = -5m - 0m, nm + 3z + 40 = 0 for m. -5 Let s(q) = -q*2 - 5 - 2q + 11q - q. Let a be s(7). Solve 0f - af - 4x = -18, 0 = -5f - 5x + 20 for f. -1 Let f = 5 + -7. Let h be (-423)/(-27) - f/6. Solve 3s = 5n + 8, -3s + n - 2n - h = 0 for s. -4 Let j = -17 - -32. Let l = 8 + j. Solve -l = -3f + 2r, -4r = f + 1 + 10 for f. 5 Suppose 5m - 45 = -5t, 0 = -3t + 3m - 0 - 3. Solve -tn + 35 = 3b, n - 3 = 2 for b. 5 Let g = -14 - -16. Let t = g - -7. Let w = 16 + -7. Solve 4l - t = -s, l = -0s + 2s + w for l. 3 Let j(i) = i*2 + 9i - 9. Let o be j(-10). Suppose o + 14 = 3h. Solve -4l - hk + 0k = 23, 0 = 5l - 2k + 4 for l. -2 Suppose 3c = c + t + 11, 3t + 18 = 3c. Suppose 0s + 3s + 9 = 3i, 0 = 5i + cs - 5. Solve -5x - 8 = -x + 2f, -ix - 4 = 4f for x. -2 Suppose 3k - 12 = -2k + 2l, 0 = 4k - 5l + 4. Solve -n - 3n = -12, 0 = 2z - kn + 2 for z. 5 Let s(j) = -2j - 1. Let t be s(-2). Suppose tv + 42 = 6*v. S	{ "pile_set_name": "DM Mathematics" }
051 a multiple of 83? True Is 667 a multiple of 8? False Is 87 a factor of 1367? False Is 335 a multiple of 9? False Is 704 a multiple of 84? False Is 45 a factor of 19452? False Is 133 a factor of 108360? False Does 219 divide 2409? True Is 283 a multiple of 13? False Is 109 a multiple of 2? False Does 14 divide 1222? False Is 3 a factor of 17? False Is 67 a multiple of 3? False Does 16 divide 448? True Does 37 divide 90394? False Is 621 a multiple of 27? True Is 22 a factor of 2244? True Is 4 a factor of 172? True Is 820 a multiple of 19? False Is 25 a factor of 70926? False Does 5 divide 2425? True Is 15 a factor of 1785? True Is 8 a factor of 106? False Is 44 a factor of 1320? True Is 3 a factor of 2352? True Is 13 a factor of 68459? False Does 23 divide 1035? True Is 59 a factor of 9735? True Is 5 a factor of 1365? True Is 14580 a multiple of 108? True Does 23 divide 421? False Does 19 divide 1007? True Is 2 a factor of 1003? False Is 24341 a multiple of 101? True Does 17 divide 30685? True Is 13 a factor of 4264? True Is 1633 a multiple of 71? True Is 72 a factor of 34488? True Does 117 divide 1872? True Does 25 divide 3875? True Is 20 a factor of 1918? False Is 340 a multiple of 17? True Is 416 a multiple of 3? False Is 8156 a multiple of 22? False Is 60 a factor of 4345? False Is 195 a multiple of 19? False Does 2 divide 645? False Is 15 a factor of 60? True Is 624 a multiple of 39? True Is 56 a factor of 336? True Does 13 divide 3302? True Is 13676 a multiple of 33? False Is 4365 a multiple of 17? False Is 1470 a multiple of 18? False Is 36 a factor of 10509? False Does 4 divide 1076? True Does 89 divide 11977? False Is 9 a factor of 9846? True Does 11 divide 10789? False Does 2 divide 282? True Does 221 divide 40443? True Is 147 a factor of 22249? False Does 31 divide 2187? False Does 7 divide 6594? True Is 163 a factor of 96839? False Is 4 a factor of 436? True Is 87 a factor of 15343? False Is 9535 a multiple of 123? False Is 44505 a multiple of 132? False Does 52 divide 1545? False Is 73125 a multiple of 125? True Does 63 divide 8379? True Does 134 divide 32767? False Does 2 divide 218? True Does 4 divide 2191? False Is 1008 a multiple of 21? True Is 17990 a multiple of 14? True Does 11 divide 1387? False Is 2448 a multiple of 48? True Is 7956 a multiple of 68? True Is 59 a factor of 2461? False Is 20850 a multiple of 15? True Does 7 divide 13916? True Is 6032 a multiple of 16? True Does 12 divide 7788? True Is 1148 a multiple of 14? True Is 31 a factor of 1147? True Does 2 divide 1809? False Is 14 a factor of 29960? True Is 2472 a multiple of 22? False Is 5 a factor of 12825? True Does 101 divide 10908? True Does 15 divide 4545? True Does 15 divide 2280? True Is 11 a factor of 6479? True Does 32 divide 928? True Is 41 a multiple of 36? False Does 7 divide 2390? False Is 388 a multiple of 26? False Does 13 divide 3198? True Is 47787 a multiple of 123? False Is 37 a factor of 976? False Is 603 a multiple of 8? False Is 17 a factor of 1666? True Is 128 a multiple of 16? True Does 23 divide 2511? False Does 25 divide 100? True Is 35 a factor of 21002? False Does 65 divide 77943? False Is 14940 a multiple of 18? True Is 24118 a multiple of 297? False Is 59512 a multiple of 73? False Is 7728 a multiple of 48? True Is 95 a multiple of 5? True Does 17 divide 90154? False Is 74 a multiple of 3? False Does 18 divide 293? False Is 23 a factor of 9866? False Is 29 a multiple of 4? False Is 36 a factor of 1143? False Is 31698 a multiple of 54? True Does 6 divide 543? False Is 50130 a multiple of 6? True Is 26 a factor of 165? False Is 47 a factor of 683? False Is 495 even? False Does 7 divide 3349? False Is 56 a factor of 2800? True Does 16 divide 17656? False Does 15 divide 1034? False Is 29 a factor of 68469? True Is 96 a factor of 884? False Is 233 a multiple of 65? False Is 1088 a multiple of 17? True Is 71 a factor of 30859? False Is 4725 a multiple of 45? True Is 1739 a multiple of 47? True Is 384 a multiple of 48? True Does 94 divide 2068? True Is 240 a multiple of 12? True Is 3 a factor of 11? False Does 29 divide 19244? False Is 714 a multiple of 14? True Is 6 a factor of 3537? False Is 33 a factor of 7359? True Does 4 divide 640? True Is 10207 a multiple of 11? False Is 24 a factor of 3096? True Is 192 a factor of 9532? False Does 18 divide 14724? True Is 2757 a multiple of 37? False Is 455 even? False Is 323 a multiple of 17? True Does 84 divide 4055? False Does 31 divide 571? False Does 61 divide 1891? True Is 3039 a multiple of 24? False Does 48 divide 13056? True Is 22 a factor of 438? False Is 4795 a multiple of 25? False Is 21122 a multiple of 65? False Is 22 a factor of 282? False Is 2 a factor of 299? False Is 1097 a multiple of 37? False Does 18 divide 378? True Does 28 divide 2839? False Is 139128 a multiple of 62? True Does 11 divide 16884? False Is 709 a multiple of 138? False Does 20 divide 1727? False Is 26 a factor of 41817? False Is 26 a factor of 2652? True Is 75 a factor of 65025? True Is 253 a multiple of 11? True Does 18 divide 252? True Is 80 a multiple of 5? True Does 15 divide 485? False Does 13 divide 36412? False Is 16 a factor of 3590? False Is 67558 a multiple of 12? False Is 39140 a multiple of 168? False Is 5 a factor of 12754? False Does 157 divide 40506? True Is 64 a factor of 1161? False Is 269 a factor of 44191? False Does 9 divide 42751? False Does 8 divide 8933? False Does 9 divide 2821? False Is 260 a multiple of 9? False Does 27 divide 17483? False Is 590 a multiple of 5? True Does 3 divide 5007? True Is 43029 a multiple of 21? True Is 60 a factor of 43740? True Is 78 a multiple of 13? True Is 8450 a multiple of 16? False Is 14030 a multiple of 61? True Is 21 a factor of 588? True Is 4698 a multiple of 81? True Is 40 a factor of 2278? False Is 28 a factor of 4129? False Is 3390 a multiple of 38? False Is 372 a multiple of 32? False Is 37 a factor of 811? False Is 43 a factor of 1935? True Is 15 a factor of 434? False Does 71 divide 14058? True Is 25 a factor of 6975? True Is 3638 a multiple of 34? True Is 21 a factor of 784? False Is 22795 a multiple of 97? True Is 14 a factor of 2156? True Is 31217 a multiple of 31? True Does 16 divide 175216? True Does 36 divide 468? True Is 136 a multiple of 34? True Does 3 divide 1266? True Is 11 a factor of 13498? False Does 51 divide 969? True Does 18 divide 24902? False Is 2051 a multiple of 13? False Is 4439 a multiple of 23? True Is 2089 a multiple of 4? False Is 449 a multiple of 19? False Does 52 divide 11013? False Does 20 divide 260? True Is 65 a multiple of 48? False Is 629 a multiple of 22? False Does 32 divide 3392? True Is 3789 a multiple of 18? False Is 57 even? False Is 308 a multiple of 7? True Is 9120 a multiple of 15? True Is 1240 a multiple of 6? False Is 1218 a multiple of 42? True Does 23 divide 3427? True Is 650 a multiple of 13? True Does 14 divide 53? False Is 20 a factor of 600? True Is 2054 a multiple of 35? False Is 13 a factor of 325? True Does 8 divide 5979? False Does 15 divide 4983? False Is 935 a multiple of 8? False Is 26 a factor of 312? True Is 8731 a multiple of 37? False Is 67 a factor of 938? True Is 24 a factor of 888? True Does 23 divide 113811? False Is 47 a factor of 950? False Is 20 a factor of 20480? True Does 9 divide 1260? True Is 10 a factor of 5462? False Does 16 divide 18387? False Is 536 a multiple of 37? False Is 5 a factor of 8576? False Is 8 a factor of 13760? True Is 37375 a multiple of 125? True Does 37 divide 296? True Does 9 divide 153? True Is 192 a multiple of 24? True Does 26 divide 2569? False Is 23 a factor of 20355? True Is 6 a factor of 21642? True Is 100768 a multiple of 84? False Is 3 a factor of 1006? False Does 11 divide 7228? False Is 1261 a multiple of 15? False Does 5 divide 350? True Is 47889 a multiple of 313? True Does 163 divide 59495? True Is 30696 a multiple of 53? False Is 21 a factor of 5021? False Is 6 a factor of 271? False Is 7 a multiple of 7? True Does 19 divide 703? True Is 10164 a multiple of 44? True Is 676 a multiple of 26? True Is 38 a factor of 2356? True Does 8 divide 5624? True Is 21 a factor of 1344? True Does 37 divide 3178? False Is 44 a factor of 436? False Do	{ "pile_set_name": "DM Mathematics" }
s are there between 2:01 PM and 7:11 PM? 310 How many minutes are there between 12:30 PM and 1:59 PM? 89 What is 660 minutes before 11:20 PM? 12:20 PM What is 11 minutes after 10:05 AM? 10:16 AM What is 48 minutes after 11:20 PM? 12:08 AM What is 386 minutes after 4:21 PM? 10:47 PM How many minutes are there between 7:22 AM and 4:08 PM? 526 What is 692 minutes after 8:06 AM? 7:38 PM How many minutes are there between 3:44 AM and 7:42 AM? 238 How many minutes are there between 5:10 AM and 7:20 AM? 130 What is 54 minutes after 3:26 PM? 4:20 PM What is 98 minutes before 8:38 PM? 7:00 PM How many minutes are there between 2:15 AM and 4:23 AM? 128 What is 315 minutes before 5:26 PM? 12:11 PM How many minutes are there between 10:42 PM and 8:29 AM? 587 How many minutes are there between 7:38 PM and 9:10 PM? 92 How many minutes are there between 2:33 AM and 4:48 AM? 135 How many minutes are there between 12:40 AM and 4:31 AM? 231 What is 137 minutes after 11:29 PM? 1:46 AM How many minutes are there between 3:53 PM and 10:54 PM? 421 How many minutes are there between 11:10 AM and 12:57 PM? 107 What is 274 minutes before 6:25 AM? 1:51 AM What is 115 minutes after 8:43 PM? 10:38 PM What is 514 minutes after 5:23 AM? 1:57 PM How many minutes are there between 11:16 AM and 7:28 PM? 492 What is 360 minutes after 10:49 PM? 4:49 AM How many minutes are there between 6:08 PM and 2:58 AM? 530 What is 318 minutes before 1:51 PM? 8:33 AM How many minutes are there between 3:13 AM and 2:44 PM? 691 What is 327 minutes after 4:17 AM? 9:44 AM How many minutes are there between 11:33 AM and 8:57 PM? 564 How many minutes are there between 4:22 AM and 11:47 AM? 445 What is 2 minutes after 12:36 AM? 12:38 AM How many minutes are there between 5:39 PM and 5:21 AM? 702 What is 353 minutes after 9:54 PM? 3:47 AM How many minutes are there between 1:33 PM and 1:02 AM? 689 How many minutes are there between 8:19 PM and 5:18 AM? 539 How many minutes are there between 7:05 PM and 5:00 AM? 595 What is 549 minutes before 1:03 AM? 3:54 PM How many minutes are there between 4:44 AM and 8:21 AM? 217 How many minutes are there between 11:22 AM and 9:09 PM? 587 What is 423 minutes before 1:24 PM? 6:21 AM What is 19 minutes before 1:07 PM? 12:48 PM How many minutes are there between 7:15 PM and 8:14 PM? 59 How many minutes are there between 10:03 PM and 10:41 PM? 38 How many minutes are there between 2:33 AM and 10:06 AM? 453 What is 609 minutes after 12:52 PM? 11:01 PM How many minutes are there between 6:43 PM and 5:44 AM? 661 What is 715 minutes before 6:05 PM? 6:10 AM What is 328 minutes before 11:12 PM? 5:44 PM What is 159 minutes before 9:51 PM? 7:12 PM How many minutes are there between 10:50 AM and 11:01 AM? 11 How many minutes are there between 3:35 PM and 12:27 AM? 532 What is 535 minutes before 8:20 AM? 11:25 PM How many minutes are there between 8:14 PM and 11:18 PM? 184 How many minutes are there between 2:27 AM and 11:43 AM? 556 How many minutes are there between 7:08 AM and 4:24 PM? 556 What is 492 minutes before 1:48 PM? 5:36 AM How many minutes are there between 12:17 PM and 9:49 PM? 572 How many minutes are there between 10:03 PM and 6:49 AM? 526 How many minutes are there between 5:06 PM and 12:02 AM? 416 How many minutes are there between 5:41 AM and 4:45 PM? 664 What is 104 minutes before 7:40 AM? 5:56 AM How many minutes are there between 8:40 AM and 4:05 PM? 445 How many minutes are there between 8:49 AM and 2:07 PM? 318 What is 678 minutes before 5:23 PM? 6:05 AM What is 643 minutes after 3:19 PM? 2:02 AM What is 672 minutes before 3:55 AM? 4:43 PM What is 300 minutes before 4:50 PM? 11:50 AM How many minutes are there between 2:47 AM and 9:37 AM? 410 What is 142 minutes after 2:23 AM? 4:45 AM How many minutes are there between 6:29 PM and 12:56 AM? 387 What is 526 minutes before 6:09 PM? 9:23 AM What is 661 minutes after 1:49 AM? 12:50 PM How many minutes are there between 3:04 PM and 11:14 PM? 490 What is 410 minutes before 10:51 PM? 4:01 PM How many minutes are there between 12:44 PM and 3:08 PM? 144 What is 643 minutes after 9:46 AM? 8:29 PM What is 209 minutes after 9:05 AM? 12:34 PM How many minutes are there between 3:31 PM and 5:15 PM? 104 What is 430 minutes before 1:14 AM? 6:04 PM How many minutes are there between 2:51 PM and 3:31 PM? 40 How many minutes are there between 8:21 PM and 2:52 AM? 391 What is 676 minutes before 2:20 PM? 3:04 AM How many minutes are there between 5:23 PM and 2:30 AM? 547 What is 235 minutes before 10:13 AM? 6:18 AM What is 89 minutes after 11:56 PM? 1:25 AM What is 493 minutes after 11:04 AM? 7:17 PM What is 264 minutes after 6:04 AM? 10:28 AM How many minutes are there between 1:06 PM and 10:22 PM? 556 What is 304 minutes before 2:49 AM? 9:45 PM What is 688 minutes after 8:28 PM? 7:56 AM What is 618 minutes after 4:06 PM? 2:24 AM What is 432 minutes before 9:53 PM? 2:41 PM What is 298 minutes before 12:22 AM? 7:24 PM What is 643 minutes before 7:15 PM? 8:32 AM How many minutes are there between 7:46 PM and 7:50 PM? 4 How many minutes are there between 2:45 AM and 5:50 AM? 185 What is 456 minutes after 3:03 PM? 10:39 PM What is 35 minutes after 1:57 PM? 2:32 PM How many minutes are there between 9:03 PM and 8:24 AM? 681 What is 662 minutes before 12:28 AM? 1:26 PM What is 428 minutes after 5:57 AM? 1:05 PM How many minutes are there between 11:49 AM and 3:47 PM? 238 How many minutes are there between 3:25 PM and 4:05 PM? 40 How many minutes are there between 1:43 AM and 7:59 AM? 376 What is 583 minutes before 12:37 PM? 2:54 AM How many minutes are there between 12:44 PM and 12:33 AM? 709 How many minutes are there between 10:09 PM and 6:57 AM? 528 What is 42 minutes before 1:57 AM? 1:15 AM How many minutes are there between 5:41 PM and 12:07 AM? 386 What is 20 minutes before 7:41 PM? 7:21 PM What is 324 minutes after 3:03 AM? 8:27 AM How many minutes are there between 6:09 PM and 10:12 PM? 243 What is 625 minutes before 1:44 AM? 3:19 PM How many minutes are there between 1:38 AM and 7:32 AM? 354 What is 175 minutes before 3:55 PM? 1:00 PM What is 98 minutes before 2:02 PM? 12:24 PM How many minutes are there between 5:05 AM and 10:28 AM? 323 How many minutes are there between 2:22 AM and 6:59 AM? 277 How many minutes are there between 2:12 AM and 10:13 AM? 481 What is 453 minutes before 4:53 PM? 9:20 AM How many minutes are there between 3:03 AM and 8:30 AM? 327 What is 703 minutes after 10:32 PM? 10:15 AM What is 517 minutes after 7:22 AM? 3:59 PM How many minutes are there between 1:40 AM and 8:25 AM? 405 How many minutes are there between 10:35 AM and 5:19 PM? 404 What is 252 minutes after 7:57 PM? 12:09 AM How many minutes are there between 6:33 PM and 8:48 PM? 135 How many minutes are there between 3:03 PM and 2:13 AM? 670 What is 493 minutes before 3:29 AM? 7:16 PM What is 130 minutes after 2:44 PM? 4:54 PM What is 423 minutes after 1:13 PM? 8:16 PM What is 10 minutes after 10:13 PM? 10:23 PM What is 715 minutes before 3:30 AM? 3:35 PM What is 634 minutes after 6:06 AM? 4:40 PM What is 583 minutes before 9:03 AM? 11:20 PM How many minutes are there between 11:25 AM and 1:09 PM? 104 How many minutes are there between 4:58 PM and 2:16 AM? 558 How many minutes are there between 9:51 PM and 8:34 AM? 643 How many minutes are there between 3:39 PM and 1:34 AM? 595 What is 496 minutes after 1:17 PM? 9:33 PM How many minutes are there between 12:21 PM and 10:52 PM? 631 What is 321 minutes after 5:21 PM? 10:42 PM What is 19 minutes before 9:08 PM? 8:49 PM What is 456 minutes before 3:40 AM? 8:04 PM What is 360 minutes after 7:22 PM? 1:22 AM How many minutes are there between 5:09 PM and 11:55 PM? 406 How many minutes are there between 5:09 PM and 5:45 PM? 36 What is 439 minutes before 4:24 AM? 9:05 PM How many minutes are there between 8:45 PM and 7:40 AM? 655 How many minutes are there between 3:33 AM and 1:11 PM? 578 What is 360 minutes before 5:49 PM? 11:49 AM What is 184 minutes before 6:35 PM? 3:31 PM How many minutes are there between 11:16 PM and 11:00 AM? 704 What is 264 minutes after 3:31 PM? 7:55 PM How many minutes are there between 2:48 AM and 6:44 AM? 236 How many minutes are there between 10:52 PM and 7:44	{ "pile_set_name": "DM Mathematics" }
))(-49) assuming m is positive. m(714224/783) Simplify ((d(-1/2)/d(6/11))/(d(6/7)/((d/d(1/5)dd)/d)))10 assuming d is positive. d(-79/77) Simplify ((m/(mm/(m4/m)m))/(m*(1/3)m))/((m/m(-1/4))/(m/(m/(m/(m(-5)/m)))))((mm2)/((m/m(-5))/m))(10/9) assuming m is positive. m(115/36) Simplify u/((u/u*0)/u)u/u*(-6)((((u/u(-1/7))/u)/u)/u)/u3(u1)17/((uu*(-5/3)uu)/(u4uu)) assuming u is positive. u(521/21) Simplify ((nn4)/n(-3/2)((n(2/9)/n)/nn)39)/(((n(1/4)/n)/n)/(n*(4/9)n)n(1/6)nnnn(-4)) assuming n is positive. n(-713/36) Simplify h(1/7)h*3h/(h/((hh(3/2))/h))h/h*(-2)((((h/((((hh0h)/h)/h)/h))/h)/h)10)(3/4) assuming h is positive. h(107/14) Simplify ((k/k5)*36(k(1/7))34)(-2/23) assuming k is positive. k(1948/161) Simplify (r*4rr/((r/(r7/r)r)/r))/((rr(-1/4))/(rr(r6/rrrr)/rr))r*6r*(1/2)/r((r(-3)/r)/r)/r4 assuming r is positive. r*(67/4) Simplify ((dd*(-1/7)d)/(dd(-1/3)))(14/11)/(d(-2/7)/(dd/(d(-2/11)/d)))36 assuming d is positive. d(29186/231) Simplify (v(-1/4)v)(-38)/(v1v*(-2/13))(vv0v/((v(-2/9)/v)/v))(-50) assuming v is positive. v*(-56267/234) Simplify ((dd*(-8/7)d)/(ddd*(6/19)d)(d/((d(-30)d)/d))/d26)(7/5) assuming d is positive. d(338/95) Simplify (a(-1))*(-1)(a/a*(-3))/(aa*(3/2))(a/a(-1/4))28(aa(3/4))/(a5aa) assuming a is positive. a(129/4) Simplify ((w(1/2))(-14/9))(-2/83)(ww*(1/4)w(-5/2)/w)(-29) assuming w is positive. w(195023/2988) Simplify (f/(f/f(-29))f/((f(-35)f)/f)f(-8)/f(-11))(-3/40) assuming f is positive. f(-3/4) Simplify ((b/b11)/(b/(((b/b(-2))/bb)/b))b(-3/5)/(bb/b(6/11)))34 assuming b is positive. b(-20672/55) Simplify ((o(-1)/oo)(-9))(-3/11)/((o0)22/(oo/o*(-2/11)oo(-5/2)o)) assuming o is positive. o*(-17/22) Simplify y(y/(yyy*0/y))/yyy/(yyy(-2/11))y*(1/2)y(4/27) assuming y is positive. y(493/594) Simplify ((j(-11)/j(-3/11)j(-5/2)(jj(3/5))/j)40)39 assuming j is positive. j(-216684/11) Simplify (i(-6)(ii(-17)i)/i((i/i(2/23))/i)(2/39))39 assuming i is positive. i(-19738/23) Simplify (((r(r/(r/(r*(40/3)r))r)/r)/(r/((r(-1/6)r)/r)))6)7 assuming r is positive. r595 Simplify (x(-2/7)/x(xx/(xx/(((xx/x*0)/x)/x)x))/xxx*6/xx/x*(-2/11)x)/((x/x*(3/2))/(x/(xx*(-7)/xx))(x(1/4))(2/45)) assuming x is positive. x(42914/3465) Simplify (((tt(-4/13))/t)(-14)t(-2/21)t(tt38)/t)(-2/11) assuming t is positive. t(-23594/3003) Simplify (((a(-3))*(-21)/((aaa(-9))/(aa*2a)))39)(-12/5) assuming a is positive. a(-34632/5) Simplify (((r/r(3/2))/(r*(3/7)r)r(-3/8)/(((rr(2/19))/r)/r))32)(-5/4) assuming r is positive. r(7495/133) Simplify (((m*(-14)(m((m/((mm*(-17))/m))/mm)/m)/m)4)(-1))10 assuming m is positive. m(-120) Simplify ((j/j(1/4))17)(2/15)/(j(-2)/j*(-1/4)(((j(jj*1)/jjj)/j)/j)(-18)) assuming j is positive. j(789/20) Simplify (c(-2))(-29)(cc(((c/c*(-1/2))/c)/cc)/c)*22(c(-7)/c(1/5))(11/5) assuming c is positive. c(1879/25) Simplify ((b/b(2/5))(5/7)(((((b0/b)/b)/b)/b)/bb)(-5/7))/(b2/(b*(-3)/b)(b0)(-4/25)) assuming b is positive. b(-19/7) Simplify ((l(-3/5)/(l/(ll/(l(4/9)l))))/(l*(-5)l4))(-12/11) assuming l is positive. l(8/165) Simplify (y(1/2)y(-4)y/y*(-3/4)yy(yy(-2))/yy)(2/15) assuming y is positive. y(-1/10) Simplify x*(2/13)x*32xx(x/(x/x*(1/7)x))(8/11) assuming x is positive. x(33564/1001) Simplify (kk(-46))/kk*(-8/7)(k(-2/49))(-3) assuming k is positive. k(-2304/49) Simplify ((w(1/2)/ww(-5)/w)/((ww*(-2/13))/(w/(ww*(-1)))))/((ww0/w)(-1/2)w5www*(-2/3)w) assuming w is positive. w(-1067/78) Simplify (l6ll(-4/5)/l)/(l(3/5)ll*(-5/3))(llll/(l(-2/13)/l)ll/(l7l))/(l*(-9)l(-4)) assuming l is positive. l(3397/195) Simplify (g(-2/21)/(g/g(-2/5)))*(-9/8)(((g/g0)/g)29)(1/24) assuming g is positive. g(471/280) Simplify (k/(k/(k/(kk1))))(1/32)/((((k(1/2)k)/kk)/kk)/k*6)((k/(kk0))(-20/7))(-4/7) assuming k is positive. k(143/32) Simplify (o/(o(-14)/o)oo(37/2))/(((o/((o/(o(-47)o))/o))/oo)/o(-1/3)) assuming o is positive. o(481/6) Simplify (j(j/j*6jj)/jj(1/6))(-32)(jj*4j(7/2)/j)45 assuming j is positive. j(2569/6) Simplify ((o(-1)/oo(-5/6))/(o/o8o(-6/7)))(-1/3) assuming o is positive. o*(-211/126) Simplify ((((zz((z(-16)z)/z)/zzz)/((zz(-10/7))/z))(1/4))(-6/5))19 assuming z is positive. z(4617/70) Simplify ((j/(j/j20j))/j*(-18)j*13jj(2/15)/j)(-17/2) assuming j is positive. j(-6392/15) Simplify (uu*0u*(-1/21)u*(-16)u/(u*18uu))(-14/13) assuming u is positive. u(110/3) Simplify (r(-2/63)/((r/(r/(r(-2/53)/r)))/r)(r/(r/(r/(rr/((rr*(2/41)r)/r)r)r)))/((r*(-1/21)r)/r))(-16) assuming r is positive. r(-4605040/136899) Simplify ((n*(-6/5)n(-5/2))/(n6/n)35)(-5/11) assuming n is positive. n(1787/22) Simplify ((q29/(q/q*(2/5)))/(((qqqq*(-1)q)/q)/q(-1/14)))(-1/60) assuming q is positive. q(-1843/4200) Simplify (((u/(u/u(-13)))/u)/(u*(1/2)/u)u(3/16)/u2)(-32) assuming u is positive. u490 Simplify (j1)19/((j*(-25/3)/j)/(jj(jjj/((jj*(-1/40))/jj))/j)) assuming j is positive. j(3763/120) Simplify ((((m(-6)/m)/m)/(m*(3/7)m))/(m(1/4))(-3/40))28 assuming m is positive. m(-10539/40) Simplify (p/p*1pp(4/5))/(p(-2/3))(-36)(p*0p)*(2/53)((p*(1/3)/pp)/p)(-22) assuming p is positive. p(-5959/795) Simplify ((n0)(5/3)/(n/n*0n*3))/((nn(2/5))(1/2)(n(-2/11)/n)/(n(nn4)/n)) assuming n is positive. n(163/110) Simplify (b/(b/b25)b)/(b/b*(-21))b17/(b/b(3/11)) assuming b is positive. b*(223/11) Simplify zzz/z1z*(-36)z28/(z10/z) assuming z is positive. z(-15) Simplify (j24jj/(j/j32))/(j/j(2/11)jj(-27)) assuming j is positive. j(904/11) Simplify ((a4/a)(1/3)/(a*(2/33)a/a(-3)))36 assuming a is positive. a(-1212/11) Simplify ((f(2/43)/f)*20(f(1/8))(8/9))(-29/3) assuming f is positive. f(212773/1161) Simplify ((h(1/4))34)*(-4)((h*(-2/11)h)/(hh(-4/3)hh))/(h(-1))(-20) assuming h is positive. h(-1810/33) Simplify (s/((s/s(1/21))/s)s(-12))0/((s(-2)/s)(1/4)(s(-2))(-20)) assuming s is positive. s(-157/4) Simplify ((x/((x(-1/2)xx)/xx)x)/x)(-28)(xx/x(-1))/(x4x)xx*3x*4x(-1/4)/(x(1/3)x) assuming x is positive. x(221/12) Simplify (((q/q10)/(q/((q(-17)/q)/q)))/((q/(qq/q(-1/4)))/(q(-2)/q)))(-29) assuming q is positive. q(3567/4) Simplify ((q0)37)(4/19)/((q(-1)q)(5/7)(qqq(-1/9))/q0) assuming q is positive. q*(-17/9) Simplify (((j((j/(j/((jj/((j(-3/4)/j)/jj))/j)))/j)/jjjj)/j)/(j/(j(-3/7)j)))*16/((((jj/(j*(2/5)j))/j)/j)/j(2/3))(-6) assuming j is positive. j(1426/35) Simplify k(-4/3)/k*(-1)(k(-1))(-8/7)((k/((kkk(2/23)kk)/kkk))/k(-4/7))(-2/149) assuming k is positive. k(61655/71967) Simplify (((d/(d/(d/(d(-4)/d))))/d)(-9/8))31/((d(2/9)d(1/5))/(d(3/5)ddd7)) assuming d is positive. d(-59471/360) Simplify ((zz(-1/3)/z)8z(4/9)/((z(zz(-1/5))/z)/z))/((zz(-1/4))(16/5))(-1/20) assuming z is positive. z(-428/225) Simplify ((((w/w(1/4))/w)(-1/2)/(w*(-6)/(www0w)))(-22))33 assuming w is positive. w*(-26499/4) Simplify ((bbb(2/9)b)/bb(-1))/(bb*1b)*(-32/3)(b(-1/4))(2/9)(b/(b/(b/(b6bbb))b))/bbb(-2/11)/b assuming b is positive. b(1517/66) Simplify ((a(2/3)/a)(1/4)(((a*(-1)a)/a)/a)(-4/29))/((a(2/3))(-6/17))(-4/5) assuming a is positive. a(127/29580) Simplify (i7/(ii(-1))i*7iii(-1/3))/((i/((i(-1/4)/i)/i))/iii/(i/(i/(i/i*(1/7))))ii(-4)/(i5/i)) assuming i is positive. i(1619/84) Simplify ((i/i(1/34))(2/85)/(i(-44))(4/21))(4/17) assuming i is positive. i(1020052/515865) Simplify ((bbb(-1)bbb)*	{ "pile_set_name": "DM Mathematics" }
ands digit of 50946? 0 What is the thousands digit of 17007? 7 What is the hundreds digit of 13645? 6 What is the thousands digit of 1567? 1 What is the units digit of 1144? 4 What is the thousands digit of 12219? 2 What is the thousands digit of 7255? 7 What is the tens digit of 1097? 9 What is the hundreds digit of 2039? 0 What is the tens digit of 10188? 8 What is the hundreds digit of 3694? 6 What is the hundreds digit of 756? 7 What is the tens digit of 4759? 5 What is the thousands digit of 2919? 2 What is the thousands digit of 73668? 3 What is the hundreds digit of 1446? 4 What is the units digit of 20324? 4 What is the ten thousands digit of 11937? 1 What is the units digit of 2224? 4 What is the units digit of 12593? 3 What is the units digit of 2951? 1 What is the thousands digit of 6997? 6 What is the tens digit of 10778? 7 What is the hundreds digit of 113458? 4 What is the tens digit of 30825? 2 What is the tens digit of 13022? 2 What is the units digit of 745? 5 What is the units digit of 98744? 4 What is the hundreds digit of 1426? 4 What is the thousands digit of 5304? 5 What is the units digit of 295? 5 What is the hundreds digit of 8791? 7 What is the hundreds digit of 39692? 6 What is the hundreds digit of 18663? 6 What is the tens digit of 2104? 0 What is the hundreds digit of 18415? 4 What is the units digit of 4869? 9 What is the units digit of 1026? 6 What is the tens digit of 80799? 9 What is the thousands digit of 6477? 6 What is the tens digit of 18? 1 What is the units digit of 15075? 5 What is the thousands digit of 7402? 7 What is the hundreds digit of 74833? 8 What is the hundreds digit of 43748? 7 What is the tens digit of 16821? 2 What is the units digit of 10434? 4 What is the ten thousands digit of 74908? 7 What is the hundreds digit of 5066? 0 What is the thousands digit of 32632? 2 What is the tens digit of 164? 6 What is the thousands digit of 27389? 7 What is the hundreds digit of 741? 7 What is the tens digit of 1908? 0 What is the units digit of 487? 7 What is the ten thousands digit of 12119? 1 What is the ten thousands digit of 41884? 4 What is the tens digit of 2508? 0 What is the tens digit of 664? 6 What is the ten thousands digit of 166057? 6 What is the ten thousands digit of 10501? 1 What is the units digit of 3458? 8 What is the hundreds digit of 727? 7 What is the hundreds digit of 824? 8 What is the tens digit of 1394? 9 What is the hundreds digit of 75453? 4 What is the thousands digit of 109623? 9 What is the hundreds digit of 4488? 4 What is the tens digit of 1465? 6 What is the tens digit of 117997? 9 What is the ten thousands digit of 10518? 1 What is the hundred thousands digit of 123397? 1 What is the tens digit of 26934? 3 What is the tens digit of 94502? 0 What is the units digit of 157? 7 What is the hundreds digit of 122968? 9 What is the units digit of 32288? 8 What is the thousands digit of 15501? 5 What is the hundreds digit of 5886? 8 What is the tens digit of 1139? 3 What is the hundreds digit of 1093? 0 What is the tens digit of 24901? 0 What is the hundreds digit of 4268? 2 What is the tens digit of 8347? 4 What is the units digit of 667? 7 What is the units digit of 232? 2 What is the units digit of 11978? 8 What is the hundreds digit of 7733? 7 What is the ten thousands digit of 25235? 2 What is the tens digit of 23334? 3 What is the tens digit of 73620? 2 What is the units digit of 2031? 1 What is the units digit of 49939? 9 What is the units digit of 1254? 4 What is the thousands digit of 10986? 0 What is the hundreds digit of 2693? 6 What is the hundreds digit of 25113? 1 What is the thousands digit of 14306? 4 What is the tens digit of 388? 8 What is the hundreds digit of 842? 8 What is the tens digit of 8900? 0 What is the tens digit of 3533? 3 What is the tens digit of 1907? 0 What is the hundreds digit of 18379? 3 What is the units digit of 796? 6 What is the hundreds digit of 3361? 3 What is the tens digit of 592? 9 What is the ten thousands digit of 46779? 4 What is the units digit of 10188? 8 What is the tens digit of 7124? 2 What is the tens digit of 2820? 2 What is the tens digit of 1302? 0 What is the units digit of 63214? 4 What is the units digit of 1337? 7 What is the hundreds digit of 293? 2 What is the hundreds digit of 4777? 7 What is the hundreds digit of 479? 4 What is the tens digit of 6017? 1 What is the hundreds digit of 280? 2 What is the units digit of 87167? 7 What is the tens digit of 2071? 7 What is the units digit of 3941? 1 What is the hundreds digit of 711? 7 What is the thousands digit of 2296? 2 What is the tens digit of 1178? 7 What is the tens digit of 1164? 6 What is the ten thousands digit of 57899? 5 What is the thousands digit of 45974? 5 What is the ten thousands digit of 11074? 1 What is the hundreds digit of 994? 9 What is the hundreds digit of 163? 1 What is the thousands digit of 31933? 1 What is the tens digit of 6726? 2 What is the tens digit of 42122? 2 What is the units digit of 8724? 4 What is the hundreds digit of 4408? 4 What is the thousands digit of 34615? 4 What is the units digit of 877? 7 What is the hundreds digit of 38100? 1 What is the hundreds digit of 21725? 7 What is the thousands digit of 8221? 8 What is the hundreds digit of 879? 8 What is the thousands digit of 6944? 6 What is the units digit of 553? 3 What is the thousands digit of 5720? 5 What is the units digit of 1676? 6 What is the hundreds digit of 5006? 0 What is the hundreds digit of 6732? 7 What is the thousands digit of 18774? 8 What is the units digit of 2570? 0 What is the tens digit of 7580? 8 What is the tens digit of 2428? 2 What is the hundreds digit of 35339? 3 What is the units digit of 403? 3 What is the thousands digit of 1351? 1 What is the hundreds digit of 1128? 1 What is the hundreds digit of 12042? 0 What is the hundreds digit of 1878? 8 What is the hundreds digit of 270? 2 What is the thousands digit of 9879? 9 What is the tens digit of 1250? 5 What is the ten thousands digit of 68781? 6 What is the tens digit of 5417? 1 What is the hundreds digit of 43048? 0 What is the thousands digit of 1442? 1 What is the hundreds digit of 475? 4 What is the hundreds digit of 26831? 8 What is the hundreds digit of 54621? 6 What is the units digit of 3261? 1 What is the hundreds digit of 539? 5 What is the units digit of 91? 1 What is the ten thousands digit of 75392? 7 What is the thousands digit of 7524? 7 What is the units digit of 20076? 6 What is the ten thousands digit of 28919? 2 What is the tens digit of 809? 0 What is the hundreds digit of 22581? 5 What is the hundreds digit of 6294? 2 What is the thousands digit of 11175? 1 What is the units digit of 1277? 7 What is the thousands digit of 14679? 4 What is the thousands digit of 2065? 2 What is the units digit of 989? 9 What is the thousands digit of 1310? 1 What is the tens digit of 10027? 2 What is the tens digit of 431? 3 What is the units digit of 9683? 3 What is the units digit of 14944? 4 What is the tens digit of 232? 3 What is the units digit of 470? 0 What is the tens digit of 2148? 4 What is the hundreds digit of 254? 2 What is the units digit of 5164? 4 What is the hundreds digit of 1735? 7 What is the hundreds digit of 265? 2 What is the tens digit of 868? 6 What is the tens digit of 3453? 5 What is the units digit of 2207? 7 What is the hundreds digit of 4423? 4 What is the thousands digit of 4713? 4 What is the thousands digit of 5494? 5 What is the thousands digit of 11746? 1 What is the hundreds digit of 1131? 1 What is the hundreds digit of 6391? 3 What is the hundreds digit of 15567? 5 What is the tens digit of 645? 4 What is the hundred thousands digit of 154692? 1 What is the tens digit of 11799? 9 What is the hundreds digit of 216? 2 What is the thousands digit of 2511? 2 What is the units digit of 630? 0 What is the units digit of 111? 1 What is the hundreds digit of 2928? 9 What is the hundreds digit of 25232? 2 What is the units digit of 2729? 9 What is the tens digit of 6837? 3 What is the units digit of 4528? 8 What is the units digit of 2771? 1 What is the ten thousands digit of 23027? 2 What is the thousands digit of 31589? 1 What is the units digit of 52	{ "pile_set_name": "DM Mathematics" }
+ 22? -110131 In base 11, what is 4 + -521? -518 In base 11, what is -145 + -8? -152 In base 2, what is 11001110100110 - 0? 11001110100110 In base 12, what is -3 - -38? 35 In base 14, what is -78 + -23? -9b In base 13, what is -bc - 7? -c6 In base 16, what is 2 - 17a? -178 In base 5, what is 101 + 11? 112 In base 13, what is -4 + -3845? -3849 In base 3, what is -10012 + 100? -2212 In base 4, what is -1332310 - 3? -1332313 In base 16, what is -f - e2? -f1 In base 5, what is -11 - 33111? -33122 In base 12, what is -9 + -34? -41 In base 3, what is 11 + 101000? 101011 In base 8, what is 133 - 3? 130 In base 10, what is -226 - 6? -232 In base 16, what is -4b - -8? -43 In base 9, what is -1 - 2756? -2757 In base 15, what is -4 - d8? -dc In base 9, what is -18 - -412? 383 In base 2, what is 11 + 1001011? 1001110 In base 13, what is -13a - 43? -180 In base 13, what is -b - 2? -10 In base 3, what is -2 - 2120020? -2120022 In base 11, what is -1 + 393? 392 In base 8, what is 12 + 40? 52 In base 16, what is -257 - c? -263 In base 15, what is -72 + 22? -50 In base 12, what is -1 + 1a? 19 In base 6, what is 5 - -14? 23 In base 6, what is 433 + 51? 524 In base 15, what is -5 + 14? e In base 6, what is -3 + -4? -11 In base 6, what is 5 + 24? 33 In base 7, what is -22 + 5? -14 In base 6, what is 0 - -22040? 22040 In base 12, what is -2 + -239? -23b In base 4, what is 0 - 212011? -212011 In base 2, what is 101000001 + -1? 101000000 In base 4, what is 2 - 12? -10 In base 2, what is -110000 + 100011010? 11101010 In base 2, what is 1 - -1010101? 1010110 In base 14, what is -c + -3d? -4b In base 5, what is -200431 - -3? -200423 In base 5, what is -4 - 1002? -1011 In base 12, what is 7 - 2a2? -297 In base 10, what is 4 - -27? 31 In base 5, what is 111 - -30? 141 In base 7, what is -1 - -1406? 1405 In base 13, what is 199 - -1? 19a In base 3, what is -11 - -21021? 21010 In base 3, what is 1122202 + 11? 1122220 In base 13, what is 14 + 9? 20 In base 16, what is -5 - -7ff? 7fa In base 12, what is 2 - -248? 24a In base 6, what is -10 + -312? -322 In base 16, what is -2 + b5? b3 In base 11, what is 8 + -89? -81 In base 8, what is 3 - -3642? 3645 In base 11, what is 138 - -14? 151 In base 16, what is 99 - -9? a2 In base 6, what is -1 + 2554? 2553 In base 5, what is 40 - -2041? 2131 In base 11, what is 1456a + 5? 14574 In base 16, what is -2 - 9? -b In base 5, what is 0 + 1142? 1142 In base 5, what is -1 - 3230? -3231 In base 12, what is 41 - 23? 1a In base 12, what is 6 - 27? -21 In base 3, what is 1 + -102? -101 In base 3, what is 1020 - 20? 1000 In base 8, what is 4 - -353? 357 In base 8, what is -640 + 5? -633 In base 6, what is 0 - -30444? 30444 In base 6, what is -4 - 5524? -5532 In base 14, what is b + 17b? 188 In base 2, what is -1000 - 1010111? -1011111 In base 15, what is -2 + -17a? -17c In base 7, what is -51 + 4? -44 In base 14, what is 9 - -400? 409 In base 15, what is -1957 + 5? -1952 In base 14, what is -1c5 - 3? -1c8 In base 7, what is 314 + -4? 310 In base 12, what is -1115 + -5? -111a In base 16, what is e + 9e? ac In base 4, what is 101 - -11110? 11211 In base 10, what is -1654 - 4? -1658 In base 10, what is 13 - 4? 9 In base 14, what is -11 + 1cc? 1bb In base 6, what is -3255 - -2? -3253 In base 16, what is -d + -37? -44 In base 2, what is -1101 - -11? -1010 In base 14, what is c4b + 5? c52 In base 7, what is -453 + 33? -420 In base 12, what is -514 - 1? -515 In base 16, what is 3 - -26f? 272 In base 3, what is 1 - -1100? 1101 In base 16, what is 8 + -d8? -d0 In base 3, what is -12 - 1012222? -1020011 In base 16, what is 4 + 19e? 1a2 In base 11, what is 3 + -101? -a9 In base 14, what is 1d9 + -16? 1c3 In base 3, what is 111 - 202? -21 In base 16, what is -6 + -70? -76 In base 2, what is -110 + -1110111? -1111101 In base 4, what is 10 + -1321? -1311 In base 16, what is -2 + -2d4? -2d6 In base 10, what is 34 + 28? 62 In base 12, what is -924b + -1? -9250 In base 5, what is 12 + 241? 303 In base 15, what is -23 - 7? -2a In base 4, what is -2320 + -21? -3001 In base 2, what is -1011 + -10? -1101 In base 5, what is 24230 + 1? 24231 In base 2, what is 1000000011 - -11? 1000000110 In base 16, what is 4 + 82? 86 In base 12, what is 3b + -68? -29 In base 6, what is 13 - 100? -43 In base 10, what is 5 + -93? -88 In base 5, what is -21122 - -1? -21121 In base 13, what is -738 + -7? -742 In base 7, what is -103 - -3? -100 In base 2, what is -10111 + 111? -10000 In base 7, what is 4 - 126? -122 In base 8, what is 4 + -101? -75 In base 7, what is -4 + 231? 224 In base 7, what is 1006 - -30? 1036 In base 14, what is -b6 - -2? -b4 In base 9, what is -7 - -36? 28 In base 15, what is 6674 + 3? 6677 In base 6, what is 23 + 140? 203 In base 13, what is -3379 - 2? -337b In base 5, what is 3202 + -2? 3200 In base 7, what is 6 - 2056? -2050 In base 9, what is -7 - 57? -65 In base 5, what is 4 - 130? -121 In base 10, what is 206 + 109? 315 In base 4, what is 1122 + 2? 1130 In base 14, what is -4 + -34? -38 In base 6, what is -3 - 25? -32 In base 11, what is -19 + -2? -20 In base 12, what is -296 - -6? -290 In base 5, what is 1 - 104324? -104323 In base 4, what is 30 + 20? 110 In base 16, what is 3 - -87? 8a In base 10, what is 0 - -191? 191 In base 5, what is -33 - 30? -113 In base 15, what is -53 - 47? -9a In base 9, what is -5 + -350? -355 In base 3, what is 1 - -2112? 2120 In base 11, what is 1538 - -2? 153a In base 15, what is 271 - -2? 273 In base 14, what is -19 + -5? -20 In base 11, what is 1 + 85a? 860 In base 9, what is 7884 - 3? 7881 In base 8, what is -2 + 120? 116 In base 4, what is -131 + -12? -203 In base 9, what is 1 + 885? 886 In base 3, what is 10 + -12122? -12112 In base 4, what is -20 - 2031? -2111 In base 8, what is 1 - -2253? 2254 In base 11, what is 451 + 3? 454 In base 15, what is 1b - -52? 6d In base 12, what is -a24 + 2? -a22 In base 5, what is 2 + -1043? -1041 In base 15, what is 5 - -d2? d7 In base 13, what is 11 - -136? 147 In base 8, what is -3 - -402? 377 In base 16, what is 14 + 45? 59 In base 5, what is -4 + -13004? -13013 In base 8, what is 27 + -13? 14 In base 10, what is 58 - 24? 34 In base 14, what is 2c7 - -2? 2c9 In base 2, what is 10000011111000 + 0? 10000011111000 In base 14, what is 66 + 1c5? 24b In base 7, what is -53461 - -3? -53455 In base 3, what is 2 - 122122? -122120 In base 10, what is 90 - 13? 77 In base 3, what is -12020 - -1? -12012 In base 9, what is -358 + -4? -363 In base 4, what is 3303 + 111? 10020 In base 13, what is 16 + -3? 13 In base 3, what is -1 - -101? 100 In base 11, what is 0 - -144? 144 In base 16, what is -11 + -c4? -d5 In base 12, what is -6 - -18? 12 In base 3, what is 2010 + 201? 2211 In base 12, what is 0 - 435? -435 In base 6, what is -1521 - -10? -1511 In base 4, what is -1103 - -10? -1033 In base 9, what is -2360 + 11? -2348 In base 3, what is 1201 + 1210? 10111 In base 8, what is 1 - 35? -34 In base 12, what is -2 + -33? -35 In base 9, what is -2 + 14584? 14582 In base 15, what is -2d0 - 0? -2d0 In base 2, what is -10010101101 - 1001? -10010110110 In base 9, what is 2 - -211? 213 In base 3, what is 202222100 + 2? 202222102 In base 16, what is -5 - -49? 44 In base 16, what is -d3e + -2? -d40 In base 3, what is 202110 - 12? 202021 In base 8, what is -11 - 14? -25 In base 12, what is -144 - 5? -149 In base 7, what is 30 - 42? -12 In base 11, what is -504 - 0? -504 In base 7, what is 3 + 16? 22 In base 14, what is -2c + -14? -42 In base 14, what is 1651 + -3? 164c In base 10, what is 69 + -5? 64 In base 9, what is 0 + -557? -557 In base 13, what is 0 - -2b4? 2b4 In base 8, what is 27 - -47? 76 In base 4, what is 10 - -30021? 30031 In base 7, what is 1500 - -12? 1512 In base 2, what is 10 - 1010110111010? -1010110111000 In base 12, what is -74 - 33? -a7 In base 6, what is -4 + 1542? 1534 In base 13, what is -154 - -1? -153 In base 10, what is 5967 - 3? 5964 In base 5, what is 2323 + -1? 2322 In base 12, what is -4 + 30? 28 In base 13, what is -16 + 3ab? 395 In base 2, what is -10 - 1000? -1010 In base 10, what is -400 + 3? -397 In base 7, what is 5113 + -6? 5104 In base 5, what is -3104 + 3? -3101 In base 7, what is 216 + -16? 200 In base 3, what is -2 + 120020? 120011 In base 12, what is -4a - 21? -6	{ "pile_set_name": "DM Mathematics" }
229 - 76 - 37 - 70. 46 Evaluate 12 + (-897 - -896) + 6 + 0. 17 12 + (21 - 0 - (-5 - -7)) 31 What is the value of -1438 + 1410 + 11 + 2? -15 Evaluate (24 - 37) + 18 + 7 + -96 + -2. -86 What is the value of -53 - (70 + -58 - 55)? -10 What is 12 + (-3 + 4 + -172 - (-73 + 34 + 27))? -147 Calculate 11 + (-6 + 16 - (18 + -11)) - (0 + 3). 11 10 + -18 - (-7 + 6) - (13 + 38) -58 Evaluate 26 + (-39 - -49) + (50 - 6). 80 What is the value of -1 + -19 - -1 - (40 + (-111 - -54) + 13)? -15 What is (1 + 1 - (2 - -5)) + -4 + 18 + -22? -13 What is the value of (13 - (9 - 0)) + 2 + (-1 - -4)? 9 What is 77 - (13 + (4 - 10 - (2 - 9)))? 63 Evaluate 8 + -31 - (-9 + 14 - 11 - -11). -28 What is -15 + 9 - 8 - (13 - 1 - 0)? -26 What is -2934 + 2921 - (-56 - -1)? 42 What is 8 - ((8 - 6) + 6 + -4) - (55 + 0)? -51 1 - -13 - (-3062 - -3068 - (-1 - (4 + 2))) 1 Evaluate (-36 - -115 - (1 + 3)) + (21 - 1). 95 Calculate -9 + (-40 + 47 - (13 + 2)) + 149. 132 Calculate -35 + 30 + 41 + -47 - 17. -28 What is (-3 - 6) + (358 - 383) + -12 + -2? -48 What is the value of (-29 + (-22 - -58) - -22) + 46? 75 What is -135 + 89 + 19 - (2 - 9)? -20 What is the value of (-45 + 50 - 167) + 84? -78 (8 + 1 - -11) + -14 + (-66 - 7) -67 8 + (-12 + 1 + -48 + (-5 - 0) - 7) -63 Calculate -33 + (61 - -11) - 20. 19 Calculate 95 - (-14 + -76 + 80). 105 Evaluate 0 - (-63 - (-10 - 29 - -13 - -13)). 50 What is the value of -5 - (-2 + 6 + -57 - (5 + 7 + -2))? 58 62 - (46 + -16 - -36) -4 Evaluate (5 - (-7 - -6) - 11) + (4 + 2 - 11). -10 What is the value of (-20 - -13) + 4 + 5 - -7? 9 Calculate (0 - 11) + -149 + 140. -20 What is the value of 0 + (10 - ((7 - (74 - -12)) + -6 + 9))? 86 Evaluate -27 - -14 - (-2 - -14 - (-100 + 184)). 59 -8 - 84 - (-195 - -151) -48 Calculate 37 + (15 - -1 - (-26 + (26 - -13))). 40 What is (145 - 53) + -26 - 63? 3 Calculate (-15 + 2 - -1) + (44 - (-49 - -143)). -62 What is the value of 0 + -7 - (1214 + -1260 + 0 + -28)? 67 Evaluate -58 + 3 + -9 + (-2 - 5 - (-8 - 8)). -55 What is the value of -45 + (-79 - (47 + -240))? 69 Evaluate 8 - ((53 - -42) + -86). -1 Evaluate -145 + (367 - 104) - 98. 20 -448 + 440 + (-1 - -22) - 19 -6 What is -2 - 21 - -7 - (-20 + 2 + 3)? -1 Evaluate -8 + (12 - 16) - (1 + 29 + 9). -51 What is (24 - (-8 + 27)) + -83 + 10 + (-6 - -5)? -69 What is 8 + (192 - 87) + -114? -1 Evaluate (724 - 730 - (0 - -38)) + -4 + -10. -58 Calculate 128 - 160 - (10 + -44). 2 What is the value of 4 - -6 - (-15 - (-11 - 2 - -9))? 21 Calculate -16 + 28 - (66 - (10 + 4 - 9)). -49 What is -9 - (8 - (-1 - -6)) - (59 - 40)? -31 What is the value of (-66 + 52 - -46) + -31? 1 2 - -1 - (4 + (15 - 16) + 83) - -12 -71 What is the value of -1 + -2 + (-28 - (-4 + -23)) + -32? -36 73 + 59 + -313 - -153 -28 Evaluate (1 - (-15 + (8 - 4))) + 193 + -193 + 2. 14 Evaluate 173 - (144 + 118 + -186). 97 What is the value of (3 + -15 - -2) + (-3783 - -3823)? 30 What is 34 - (10 - (-22 - -25)) - (1 - 6)? 32 2 + -66 - (-1382 + 1282) 36 What is 80 + -32 + 27 - 122? -47 Evaluate (-1 - (-21 + 11)) + (-6 - -13) - -40. 56 (-1 - -7) + (-2 - (-34 - -14 - -32) - 15) -23 50 + -43 + -11 + -19 -23 What is -12 + 12 + ((-13 - -2) + 9 - -11) + 24? 33 Evaluate 168 + -160 + -9 + 20 + 6. 25 What is the value of (8 - 2 - (-6 + 14 + -4)) + 296 + -200? 98 Evaluate -26 + -69 + (37 + -2 - -4). -56 -2003 - -2013 - (-1 - -7 - -52) -48 What is the value of 67 + 0 + 19 + (0 - (-17 + 7) - 18)? 78 What is 21 + -34 - -19 - -3 - (-1 - (56 + 4))? 70 What is -38 + 35 - -4 - (5 + -31)? 27 Evaluate 1 + -8 + -3 - (-53 + (-7 - -21)). 29 What is (35 - 129 - -142) + (-1 - -4)? 51 What is the value of 0 + 69 + (12900 - 12947)? 22 What is -15 - 4 - (114 - 106)? -27 Evaluate 51 + (80 - 47) + -79. 5 What is (8 + -19 + 0 - (-27 - -5)) + -14 + 1? -2 What is -433 - -464 - (-1 - (-1 + 4 + -11))? 24 What is the value of 19 + (-3 + -52 - (-22 + -2))? -12 Evaluate 109 + -90 + (2 - 13 - (77 + 25)). -94 Evaluate 22 - (-39 - (-21 + (4 - -4))). 48 What is 21 - 25 - (22 - (-9 - -9))? -26 What is -29 + (-18 - -36) + -1 + -67 + -3 + -2? -84 What is the value of 36 - (38 - (17 - -2))? 17 Evaluate 25 - (22 + -10) - 30 - 4. -21 (82 - -26) + (-113 - -73) 68 Evaluate -1413 - -1492 - (0 + -6). 85 4 + (-9 - (8 + 4 - 25)) + 0 + -56 -48 What is 3 + (-96 - -59) + -2 + 9? -27 -35 + (2 + 4 - (9 - -14 - 3)) + 7 -42 Evaluate 0 - (-20 - -25) - 33. -38 Evaluate -33 + (-11 + 9 + 9 - -15). -11 Evaluate (-13 - (31 - 21)) + 35 + -21. -9 (-59 - (2 + -1)) + (5 - 50 - -43) -62 Calculate -33 - (3 + -5) - (8286 - 8282). -35 What is the value of 38 - (-34 - (-56 - 9))? 7 Calculate -13 + (2 - (10 - 0)) + 86 + 24 + -99. -10 What is the value of 2 - (12 + (10 - 17) + 40)? -43 Calculate (99 - 39) + (-72 - 69). -81 What is -24 + -34 + (-54 - (-13 + -7) - -11)? -81 Calculate -149 + 155 + (-16 - -4). -6 Calculate 3 + (-5 - -4) - 9 - (-2 - -29 - 21). -13 What is the value of -53 - (126 - 217) - (11 + 0)? 27 -12 + (-1 - -1) + -267 + (177 - -195) 93 73 - (-6 + 21) - (70 - 59) 47 -304 + 345 - (19 + -2 + 4) 20 What is 6 + -3 - ((6 - 22 - -159) + 5 + -23)? -122 What is 2 + ((-33 - -46) + 22 - -28)? 65 Calculate (1 - -2) + 130 + -158 + 117. 92 What is 9 - (13 + (0 - 3) - -2) - -46? 43 What is the value of 56 + -20 + (24 - (10 - (3 + -2)))? 51 Calculate -127 + (33 + 6 - 36) - (7 + 2). -133 Evaluate (-17 - 0) + (27 - (101 + -52)). -39 What is -48 + (0 - -22) + 32 - (0 - -65 - 0)? -59 -42 - (11 + -24 + 62 + -3) -88 Evaluate 20 + -7 + (-12 - 5) + 9 + -25. -20 Evaluate (-1 - -3) + (9 + -12 - -8) + -15 + -94. -102 What is the value of (39 - (0 - -10)) + (11 - -2)? 42 Calculate 48 - ((-19 + 8 - -21) + 4 - 15). 49 Evaluate -57 - -1 - -1 - (-722 + 712) - 2. -47 Calculate -5 - -20 - (1 + 13 + -24 + 13). 12 Evaluate -8 + -2 - (-11 + 6) - (-7 - 4) - -24. 30 What is the value of 413 + -363 + 0 + -3 + -3 + 6 + 3? 53 What is the value of -27 + -2 + -4 + -1 + (12 - (3 - -1))? -26 Calculate -7 - (-14 + (-13 - -28 - 18) + 17). -7 -17 - (7 + -37 + 20 + -12) 5 Calculate -2 + (34 - ((-11 - -25) + -12)). 30 What is the value of (-9683 - -9693) + (47 - (-1 - -2))? 56 What is the value of -79 - (13 + (-234 - -107))? 35 What is the value of -13 - (-7 - -5 - 6) - -24 - 130? -111 Calculate -33 + (-5 - -10 - (-2 - (11 - 16))). -31 35 + -37 - (5 - -3 - (0 + 28)) - -10 28 Evaluate (-9 - (-6 + -7) - 13 - -6) + -2 - 29. -34 What is 2 + 0 + -14 + 2 + -39 + 22 + 6? -21 Evaluate 56 - (-40 + 97 + -17). 16 Calculate 542 + -532 - (87 - (6 + -4 + 1)). -74 What is the value of (29 - 25 - 50) + 40? -6 (20 + -6 - -4) + (-158 - (-19 + -21)) -100 (-1 - -6) + (100 - (3 + 65)) 37 Calculate -11 + (5 - (-12 - -11)) - (107 - (-17 - -10)). -119 What is the value of -51 + 26 + 27 - (19 - (-6 + 2))? -21 Calculate 2 + -14 + 1 + 34 + (73 - 120). -24 What is (407 + -417 - (1 + (3 - 17) + 0)) + -11? -8 What is the value of -65 + 80 + (4 - -15)? 34 What is (2605 - 2660) + 0 + 34 + 6? -15 -35 - ((-8 - (14 - 11) - 0) + 9) -33 Calculate (8 - -6) + -8 + 4 + 23 + (44 - 42). 35 What is 0 + (20 - -9) + (-45 - (-8 - 25))? 17 What is the value of 1 + (1 - -5 - 14) + -2 - -52? 43 Calculate -945 - -991 - (0 - -85). -39 What is the value of (1 - 30) + 7 + -35 + 5? -52 What is the value of (-20 - -20) + (1 - 2) + -13 + 43? 29 What is 29 + -19 - -10 - 7 - -10? 23 What is the value of -216 + (307 - 91) - (-37 - -1 - 2)? 38 What is the value of (117 - 75) + -127 - -103? 18 What is 2 + 1 + 3 + (-32 - (37 - 85)) + -148? -126 Evaluate 220 + -205 - (151 + -1 - (16 + -18)). -137 Calculate (-12 - (-2 - 59)) + -59. -10 Evaluate -34 + (40 - (7 - 2)) + -14. -13 -29 + -3 + -36 + 44 -24 -41 - (-1 + 2 - (-236 + 255 + -2 + -8)) -33 Calculate -101 - -223 - (5 + 45). 72 What is the value of (-10 - 1) + (-10 - -48 - 21) + -85? -79 What is the value of (239 - 200) + -147 - ((-4 - -3) + 4 - -4)? -115 What is (-58 - -75) + -3 + 4 - (7 + 1)? 10 -18 - -1 - ((110 - 148) + -99) 120 52 + (7 - 2) + -9 - (-28 - -19) - 1 56 What is the value of 0 + (21 - -9) - (-39 - -11 - -30)? 28 3 + 33 + (-20 - -56) + 23 95 Calculate 8 + (6 - (5 + 64 + -8)) - (1 - -5). -53 What is (2 - (1 + 6)) + 6 - (-208 - -182)? 27 Calculate (-71 - -132) + -68 - (-34 + -1 - 1). 29 Evaluate 42 + (31 - 49) + -134 + 26. -84 Calculate -38 - 0 - -1 - (-28 + 30 + 4 + -2). -41 Calculate 23 - (12 - 18) - 1 - (-4 - -8). 24 Eval	{ "pile_set_name": "DM Mathematics" }
thout replacement from {s: 3, v: 5, w: 1}. Give prob of sequence vws. 5/168 What is prob of sequence iss when three letters picked without replacement from {i: 6, s: 4}? 1/10 Calculate prob of sequence cxc when three letters picked without replacement from {c: 3, x: 4}. 4/35 Two letters picked without replacement from kppkspskssksskspps. Give prob of sequence pp. 10/153 Calculate prob of sequence fnxf when four letters picked without replacement from ffwnffnwnnnnxn. 1/286 What is prob of sequence qjtt when four letters picked without replacement from {j: 4, q: 1, t: 2}? 1/105 Calculate prob of sequence vrvy when four letters picked without replacement from {y: 3, v: 1, e: 7, s: 7, r: 1}. 0 What is prob of sequence tttt when four letters picked without replacement from {t: 9}? 1 Calculate prob of sequence se when two letters picked without replacement from {b: 4, e: 3, m: 2, d: 3, s: 3, a: 1}. 3/80 Two letters picked without replacement from wwwwwwwwwwwwwwwwkwww. Give prob of sequence ww. 9/10 Calculate prob of sequence ett when three letters picked without replacement from {t: 9, e: 5}. 15/91 Four letters picked without replacement from rhrhrhrrrhr. Give prob of sequence rrrr. 7/66 Four letters picked without replacement from {g: 9, u: 9, x: 1}. What is prob of sequence xgug? 9/1292 Four letters picked without replacement from {h: 2, r: 2, a: 1}. What is prob of sequence arra? 0 Calculate prob of sequence qll when three letters picked without replacement from {q: 5, l: 7}. 7/44 Calculate prob of sequence pi when two letters picked without replacement from {d: 6, v: 4, i: 4, p: 3}. 3/68 Calculate prob of sequence yby when three letters picked without replacement from {y: 2, n: 5, b: 2}. 1/126 Three letters picked without replacement from tctftcw. What is prob of sequence ctw? 1/35 Two letters picked without replacement from {n: 2, k: 3, i: 7}. Give prob of sequence ni. 7/66 Calculate prob of sequence mppm when four letters picked without replacement from {z: 1, p: 3, m: 6, b: 8}. 1/408 Calculate prob of sequence ttxx when four letters picked without replacement from {f: 2, v: 2, i: 1, t: 3, x: 4}. 1/165 What is prob of sequence wemj when four letters picked without replacement from mwenjne? 1/420 Three letters picked without replacement from {e: 8, i: 3}. Give prob of sequence eii. 8/165 Two letters picked without replacement from dhhdhyehhehev. What is prob of sequence ey? 1/52 Two letters picked without replacement from {l: 3, k: 3, j: 1, a: 1, v: 6, h: 3}. Give prob of sequence ka. 3/272 Two letters picked without replacement from {b: 2, y: 2, s: 6, k: 1, n: 4}. Give prob of sequence yy. 1/105 Two letters picked without replacement from xzzxzzccxzxxzxzxxz. Give prob of sequence zz. 28/153 Calculate prob of sequence cxqx when four letters picked without replacement from {z: 2, q: 4, e: 1, x: 2, c: 1}. 1/630 Three letters picked without replacement from {e: 1, v: 1, d: 1, p: 2}. What is prob of sequence eve? 0 What is prob of sequence fijj when four letters picked without replacement from jigfffjjjjgigfjjig? 7/1020 Calculate prob of sequence bbb when three letters picked without replacement from bbbbbbbbbb. 1 Calculate prob of sequence rxua when four letters picked without replacement from {o: 1, a: 1, x: 1, u: 2, r: 2}. 1/210 Calculate prob of sequence quu when three letters picked without replacement from {s: 3, x: 2, u: 4, v: 2, q: 4, k: 3}. 1/102 Four letters picked without replacement from nfrnursrns. What is prob of sequence nrrf? 1/280 Calculate prob of sequence rvpv when four letters picked without replacement from xpxvpdipvdvpdxvrd. 1/1190 Calculate prob of sequence eo when two letters picked without replacement from {e: 3, n: 4, p: 2, o: 6}. 3/35 Four letters picked without replacement from {u: 4, b: 5, d: 6}. What is prob of sequence bdbu? 4/273 Three letters picked without replacement from {b: 5}. What is prob of sequence bbb? 1 What is prob of sequence tag when three letters picked without replacement from {q: 1, g: 1, o: 1, t: 1, a: 1}? 1/60 Two letters picked without replacement from {q: 3, j: 4, g: 1, l: 2, p: 8, x: 2}. What is prob of sequence lg? 1/190 What is prob of sequence jbkj when four letters picked without replacement from {j: 2, k: 3, b: 3}? 3/280 What is prob of sequence zs when two letters picked without replacement from {d: 1, s: 1, z: 3}? 3/20 What is prob of sequence xx when two letters picked without replacement from {x: 9, w: 2, q: 2, u: 2, j: 5}? 18/95 Three letters picked without replacement from {f: 2, u: 11}. Give prob of sequence fuu. 5/39 Four letters picked without replacement from ddddpddd. Give prob of sequence dddp. 1/8 Two letters picked without replacement from {i: 2, q: 1, o: 7}. Give prob of sequence oo. 7/15 Two letters picked without replacement from {k: 2, a: 16}. What is prob of sequence ka? 16/153 Calculate prob of sequence ic when two letters picked without replacement from {i: 2, c: 9}. 9/55 Three letters picked without replacement from {y: 2, b: 1, f: 3, z: 1, o: 3}. What is prob of sequence ffo? 1/40 Four letters picked without replacement from qqpqqqpqpqqqppqpqqp. What is prob of sequence qqpq? 385/3876 Two letters picked without replacement from {c: 1, v: 4, r: 2, a: 3}. What is prob of sequence rc? 1/45 Calculate prob of sequence uww when three letters picked without replacement from {w: 5, a: 2, u: 4}. 8/99 Two letters picked without replacement from iiioinbeon. Give prob of sequence be. 1/90 What is prob of sequence llk when three letters picked without replacement from qqllqlkl? 1/28 Calculate prob of sequence md when two letters picked without replacement from ymd. 1/6 Calculate prob of sequence bbl when three letters picked without replacement from {b: 2, l: 3}. 1/10 Calculate prob of sequence wnqn when four letters picked without replacement from {k: 3, z: 1, w: 3, n: 2, q: 1}. 1/840 Calculate prob of sequence wuwr when four letters picked without replacement from duwddrddudwudrdd. 1/3640 Calculate prob of sequence zte when three letters picked without replacement from {z: 3, t: 1, v: 2, d: 2, u: 3, e: 1}. 1/440 Calculate prob of sequence xb when two letters picked without replacement from {y: 2, x: 2, b: 1}. 1/10 Four letters picked without replacement from zsssszsssss. What is prob of sequence zsss? 7/55 What is prob of sequence ck when two letters picked without replacement from {z: 1, k: 1, v: 2, c: 5}? 5/72 What is prob of sequence usk when three letters picked without replacement from {s: 11, k: 3, u: 1}? 11/910 Two letters picked without replacement from {y: 4, l: 2, q: 1, t: 2}. What is prob of sequence qy? 1/18 Calculate prob of sequence cjj when three letters picked without replacement from {j: 2, c: 3}. 1/10 What is prob of sequence rrm when three letters picked without replacement from {r: 5, h: 1, t: 2, m: 1}? 5/126 Two letters picked without replacement from nrnapwoawpnpa. Give prob of sequence pn. 3/52 What is prob of sequence qc when two letters picked without replacement from ncqcqccnccccqq? 16/91 Four letters picked without replacement from oooooo. What is prob of sequence oooo? 1 Three letters picked without replacement from xqhxhhxhhhxxkhhxd. Give prob of sequence hkd. 1/510 Calculate prob of sequence id when two letters picked without replacement from idqiqigqiiqgidiid. 3/34 Four letters picked without replacement from rcwtttrwaawkkr. What is prob of sequence tctw? 3/4004 Two letters picked without replacement from wowoojkwojwjkww. Give prob of sequence wo. 4/35 Calculate prob of sequence ui when two letters picked without replacement from {m: 1, q: 1, i: 1, u: 2}. 1/10 Calculate prob of sequence rak when three letters picked without replacement from {a: 4, r: 2, z: 2, e: 3, k: 1}. 1/165 Two letters picked without replacement from {v: 2, h: 2, z: 2, e: 1, p: 1, y: 1}. Give prob of sequence hp. 1/36 Two letters picked without replacement from {i: 1, o: 1, e: 2, u: 3, d: 3}. What is prob of sequence ie? 1/45 What is prob of sequence qlo when three letters picked without replacement from ssoloq? 1/60 Four letters picked without replacement from {p: 1, w: 1, j: 2, x: 1, i: 1, q: 2}. What is prob of sequence jjpi? 1/840 What is prob of sequence oc when two l	{ "pile_set_name": "DM Mathematics" }
ber? False Let f(k) = k*3 + 4k*2 - 2k - 1. Let j be (-2)/9 + (-64)/36. Let w be f(j). Suppose -6l - 665 = -wl. Is l composite? True Let b(r) = r + 16. Let f be b(-7). Suppose -f = 3z + 24. Let k = z + 20. Is k composite? True Suppose x + 4n = 67, -5x - 2n + 5n = -243. Suppose -5l - a + x = 0, 0 = 4a - 4 - 0. Is l a composite number? True Let x(z) = -21z + 22. Is x(-13) a composite number? True Let a = 230 - 72. Is a a composite number? True Let l = -454 + 935. Is l composite? True Let y(p) = -5p3 - p2 + p - 2. Let o(l) = 11l3 + l2 - 2l + 3. Let j(v) = 4o(v) + 9y(v). Let g be j(-5). Let s = g + 94. Is s prime? True Suppose 93 - 21 = -4s. Let z = s + 55. Is z a composite number? False Let y(t) = 45t + 3. Let c be y(3). Let i = c - 59. Is i a composite number? False Let h be -3 + (246 - 1 - 0). Let l = h + -99. Is l a composite number? True Let p(u) = 3u*2 + 9. Let t be p(5). Suppose -2m = -20 - 74. Let i = t - m. Is i prime? True Suppose -s + y = 4y + 12, -2s = 3y + 27. Let c = s - -68. Is c prime? True Suppose -4 = -p + 2p. Let a(k) = k*3 + 4k*2 - 2k - 1. Let q be a(p). Is 300/q - 5/(-35) prime? True Suppose -6g + 15g - 11871 = 0. Is g prime? True Let q = 4 - 1. Is -26(q/(-2) - 2) prime? False Let c(m) = 2m*3 + 3m*2 - 1. Let f(d) = -5d*3 - 8d*2 + 3. Let v(j) = 11c(j) + 4f(j). Let g be v(-3). Let u = g + 66. Is u prime? False Suppose -u - 12 = -k, -5k + 15 = -3u - 25. Let l be (2/3)/(u/(-135)). Let h(c) = -c3 + 12c*2 - c + 3. Is h(l) composite? True Let m(b) = 32b - 5. Is m(3) prime? False Suppose 4j - 1266 = 1322. Is j a prime number? True Let t(h) be the third derivative of h6/60 - 7h5/60 + h4/8 + 5h3/6 - 6h*2. Is t(6) composite? True Is 8/1233/1 a composite number? True Suppose 4h + 5n = 4n - 96, -5n = 0. Let f = 11 - h. Is f a composite number? True Suppose 5m - 5 = 10. Suppose mz - 176 = z. Suppose -8a + z = -4a. Is a composite? True Let k(s) = -s*3 - 9s*2 - s - 4. Let i be k(-9). Suppose 0 = in + 17 - 117. Is 12/n + (-484)/(-10) a prime number? False Suppose v + 2v + 6 = 2h, 2h = 2v + 4. Suppose -3s - 268 = -5b + s, 200 = 4b + 4s. Suppose h = -5c + b + 3. Is c a prime number? True Suppose -13s + 395 = -8s. Is s composite? False Is (-2912)/(-5) - -5 - 2/5 a composite number? False Let m(d) = 21d - 16. Is m(15) a prime number? False Let a(w) = -2w + 4. Let i be a(3). Is 643/2 + i composite? False Let q be (-16)/69/4. Let x = 45 + q. Is x composite? True Is ((-3908)/16)/(4/(-16)) composite? False Let n be 4514/3 + (-2)/(-6). Suppose 6g - g = n. Is g composite? True Let z(x) = -x - 10. Let a be z(-10). Let t = a - -30. Let r = t + 19. Is r a composite number? True Suppose 0 = -2l + 5l - 27. Suppose -r + 14 = -l. Is r prime? True Let p = 184 + 145. Is p a composite number? True Let z(m) = -20m2 + 3. Let h(k) = k2 + k - 1. Let p(a) = -2h(a) - z(a). Let w be (1/2 + 0)-2. Is p(w) prime? True Is (3 - 1 - (-9 - -12))-673 a prime number? True Is -1(-632 - (-6 + 3)) composite? True Suppose -4s = 4g + 36, 6s - 4s - 4g - 6 = 0. Is (-167)/(-2) + s/10 prime? True Let c be (-1)/2(-395 - -1). Suppose -2 + c = 3o. Let p = -28 + o. Is p a prime number? True Let n(i) = -i*2 + 6i - 3. Let w = -11 - -16. Let t be n(w). Is -1 - 52/t-5 composite? True Suppose -s + 2t - 357 = -6s, -143 = -2s - t. Is s a prime number? True Let i(j) = -j - 4. Suppose d + 24 = -3g, -g + 21 = -3g + d. Let p be i(g). Suppose px = 5m + 105, -x - 4x = -2m - 105. Is x a composite number? True Let b(n) = 9n3 - 4n*2 + n + 12. Is b(5) a composite number? True Let x(f) = 20f*3 - 4f + 3. Is x(2) composite? True Let t(j) = -2j3 - 9j*2 - 4j + 11. Is t(-8) composite? False Let l(y) be the first derivative of 101y4/2 - y3/3 + 3. Is l(1) composite? True Suppose -t - 4f = -9f - 526, 1091 = 2t + 3f. Is t a composite number? False Let h = -131 + 45. Let n = -52 - h. Is n composite? True Let l(t) = -t3 + t2 + t + 862. Let g be l(0). Let v be g/(-2 + (-2 - -6)). Let j = -208 + v. Is j a composite number? False Let l(s) = -s3 + s2 + s - 122. Let v be l(0). Let n = 609 + v. Is n prime? True Suppose -5o = -o. Suppose z + b = o, z - 4 - 11 = 4b. Suppose 0 = -zw + w + 318. Is w a composite number? True Let q(z) = -14 - 4z + 3 + 6z + 3z + 4z*2. Is q(6) a prime number? True Suppose 0 = b - 5w - 30, -2w = 4b + 3w + 5. Let y(t) = 2t + 5. Is y(b) a prime number? False Suppose -4f = -k - 1113, -3f + 3k + 1263 = 426. Let q = f - 9. Is q prime? True Suppose 5d = 7d - 38. Is d a composite number? False Let z(p) = -3p*2 - 3p - 10. Let s be z(-5). Is (19/2)/((-5)/s) prime? False Let h(t) = t*2 + t + 1. Let s be h(-2). Suppose 640 = 7f - 2f + so, f = 3o + 146. Is f composite? False Let q = 4588 + -1677. Is q a prime number? False Is ((-1)/(1600/1604 - 1))/1 prime? True Let k(t) = 2t*2 + 3t + 509. Let c be k(0). Let s be (1 - 354/(-2)) + -1. Suppose -4v - s + c = 0. Is v a prime number? True Let r = -882 - -1325. Is r a prime number? True Is (-1)/(3/(-44)) - (-3)/9 a prime number? False Let r(c) = c2 - c + 263. Is r(0) a prime number? True Let k(i) = i3 - 4i*2 - 4i - 2. Let r be k(5). Suppose -s = -4c - 77, -rs - 95 = -4s - 2c. Is s a composite number? False Suppose 12m - 18161 = m. Is m composite? True Suppose -l + 2l + 19 = 0. Let y = 29 + l. Is y composite? True Let b(j) = j - 4j + 3j*3 - 2j*3 + 1. Is b(3) a prime number? True Suppose 6340 + 5668 = 8d. Is d a prime number? False Let g(v) = -v - 2. Let h be g(-5). Suppose 8a - 130 = -450. Is (-2)/h - a/6 composite? True Suppose 0 = -2m + s - 18, -3m - 4s + 2 = -4m. Is (-18)/30 + (-1426)/m a composite number? True Let l(t) = -t2 + t + 149. Is l(0) a composite number? False Let h(i) = 4i*2 - i - 17. Let s be h(9). Suppose -2a = -3l + 194, 5l + 3a - s = -0l. Is l a prime number? False Suppose 3d = d + 5h - 9, 2h + 14 = 3d. Let f(t) = t*2 - 7t - 9. Let z be f(d). Let c(i) = -76i3 + i2 - i - 1. Is c(z) a prime number? False Let c(j) = -j2 + 6j - 5. Let d be c(5). Suppose 5x = -5t + 80, -3x + dx = 5t - 80. Suppose 3n - v + 4 = 30, -4v + t = 0. Is n composite? True Suppose -14 = -w + 3t, -5w - t - 2t = 2. Suppose 3m - 16 = -7. Suppose -3a = -5p - 154, w = -p + m. Is a prime? True Let n = 228 + 185. Is n a prime number? False Let p = 13 - 11. Suppose 0 = -ph - 2h - 280. Is h/201-46 a composite number? True Suppose -136m + 135m = -4441. Is m a prime number? True Let z(s) = -s. Let g be z(-6). Let t = 10 - g. Suppose 3o = to - 26. Is o prime? False Let t be 1-9(-16)/12. Is (-3)/2(-184)/t a prime number? True Let h(u) = 3u - 11. Let z be h(9). Is z/(-6)(-189)/36 prime? False Suppose 3d = 4d - 187. Is d a composite number? True Is ((-4)/(-6))/((-2)/(-255)) a composite number? True Suppose 0u = u - 47. Is u a composite number? False Let c = -241 - -1718. Is c prime? False Suppose 5b - 4k + 3k = 1596, 0 = -b - 5k + 340. Suppose 5a - b = 315. Is a composite? False Let d(b) = -b*3 + 5b*2 + 2. Let z be d(5). Suppose -y - 3 = -zy. Is y - (0 - 2) - 2 a prime number? True Let f = -1 - -4. Suppose 5b + 197 = -z + 786, 3b = -fz + 351. Is b composite? True Let u = -1 + 1. Suppose -2f + uf + 4 = 3t, -4f + t + 8 = 0. Suppose 0 = fg - 5 - 9. Is g a prime number? True Let y(s) = 11s2 - 3s + 3. Is y(-4) composite? False Let m(g) = -60g3 - 2g + 3. Is m(-2) prime? True Suppose 4f + 0f = 932. Let y = f + -142. Is y composite? True Let u(b) = -b*2 + 3b - 3. Let j be u(3). Let g be (2/(-1))/(j/6). Suppose -5f = 5, 3n - 140 = -gf - 51. Is n composite? False Suppose 4k - 2 - 54 = 0. Let l = k + -32. Is (-4)/l + (-950)/(-18) a prime number? True Suppose 0r + r + 3013 = -3y, -y + r = 1011. Let z = y - -1491. Suppose 0d = 5d - z. Is d a composite number? False Suppose 5 = 2d - 5. Suppose 0 = -0a + da. Suppose a = -2p + 9 + 9. Is p a composite number? True Let x(p) = -25p + 140. Is x(-33) a prime number? False Let o(j) = -5j*2 - 3. Let v(m) = 3m*2 + 2. Let a(t) = 5o(t) + 8v(t). Let z be a(-1). Suppose -3i + 258 - 21 = z. Is i composite? False Let j = -116 + 605. Is j composite? True Let t be	{ "pile_set_name": "DM Mathematics" }
Calculate the highest common factor of 68 and 402310712. 68 What is the greatest common factor of 91443160 and 3056? 1528 Calculate the highest common divisor of 12965698 and 3382. 178 What is the highest common divisor of 62574208 and 384? 128 Calculate the highest common divisor of 6392 and 9212. 188 Calculate the highest common divisor of 3927 and 160197681. 357 Calculate the highest common factor of 1080 and 55400130. 90 What is the highest common factor of 210 and 8127390? 30 What is the greatest common factor of 146905 and 880? 55 What is the highest common factor of 11906118 and 22050? 882 Calculate the greatest common divisor of 8671 and 8103383. 667 What is the greatest common divisor of 4282221 and 3? 3 Calculate the highest common factor of 283112 and 1634344. 344 Calculate the greatest common factor of 68128062 and 12. 6 What is the greatest common divisor of 2566612 and 1010? 202 What is the greatest common factor of 3528 and 11688876? 36 What is the greatest common divisor of 2681265 and 41495? 215 Calculate the highest common factor of 21841901 and 3578. 1789 Calculate the highest common divisor of 2100973532 and 4228. 4228 Calculate the highest common factor of 36992 and 688. 16 What is the highest common divisor of 314503 and 54467? 1757 Calculate the greatest common divisor of 310367 and 360431. 149 What is the highest common factor of 44688 and 71443344? 6384 Calculate the greatest common divisor of 533900 and 2720. 20 What is the greatest common factor of 171864 and 565936? 1736 Calculate the highest common divisor of 33907 and 35137. 41 Calculate the highest common factor of 42907 and 23005. 107 Calculate the greatest common divisor of 177 and 2811. 3 Calculate the greatest common divisor of 128490 and 23880. 30 Calculate the highest common divisor of 243 and 26556093. 81 What is the greatest common divisor of 375809134 and 1461? 487 What is the highest common factor of 5365 and 2040295? 145 What is the highest common divisor of 4571190 and 5310? 90 What is the highest common divisor of 434 and 326719106? 434 What is the highest common factor of 1653828 and 25728? 804 What is the highest common divisor of 353620894 and 133? 19 Calculate the highest common factor of 263228260 and 536. 268 What is the highest common divisor of 787560 and 13230? 30 Calculate the highest common factor of 74242 and 53438. 14 What is the highest common divisor of 2507756 and 4454672? 8012 What is the greatest common divisor of 504 and 3041388? 252 What is the greatest common factor of 1488480 and 41370? 210 What is the greatest common factor of 113260957 and 13908? 1159 What is the highest common divisor of 63 and 235247679? 9 What is the greatest common factor of 84 and 297008264? 28 What is the highest common divisor of 33855625 and 30625? 625 What is the highest common divisor of 1024 and 6189312? 256 What is the greatest common factor of 6432336 and 3952? 304 Calculate the greatest common factor of 1908 and 444492927. 477 What is the greatest common factor of 1890 and 23694984? 54 Calculate the greatest common divisor of 1088 and 296992448. 1088 Calculate the highest common factor of 39 and 15725242. 13 Calculate the highest common factor of 137821926 and 858. 66 Calculate the highest common divisor of 331255 and 113878. 97 What is the highest common divisor of 1872 and 3256968? 312 What is the highest common factor of 59711 and 34861? 71 Calculate the greatest common factor of 898662624 and 1468. 1468 Calculate the greatest common divisor of 2340 and 116561640. 780 Calculate the highest common factor of 3277781 and 133151. 2833 What is the highest common factor of 714 and 255495142? 238 What is the greatest common divisor of 385548614 and 1034? 1034 Calculate the greatest common divisor of 1305 and 6644160. 45 Calculate the highest common divisor of 167300 and 14420. 140 Calculate the greatest common factor of 14 and 650545. 7 Calculate the highest common divisor of 57 and 18246441. 57 Calculate the greatest common divisor of 1380 and 42646. 2 Calculate the greatest common factor of 3320 and 449658808. 664 Calculate the greatest common divisor of 9747096 and 492875. 3943 Calculate the greatest common factor of 217909115 and 4175. 835 Calculate the greatest common divisor of 553 and 17079247. 79 Calculate the highest common divisor of 1654507 and 1812. 151 Calculate the greatest common divisor of 21146 and 5123. 109 What is the highest common factor of 5060 and 31944700? 460 Calculate the highest common divisor of 97331560 and 160. 40 What is the greatest common factor of 1223754 and 5103? 21 Calculate the highest common divisor of 835408 and 3108. 28 What is the highest common divisor of 17429 and 7465021? 601 What is the greatest common factor of 16 and 828516176? 16 What is the greatest common divisor of 10897 and 81821? 17 Calculate the greatest common divisor of 971844 and 23616. 12 What is the highest common factor of 233 and 82454739? 233 Calculate the highest common factor of 2982172 and 172. 4 What is the greatest common divisor of 152977669 and 897? 299 Calculate the greatest common factor of 38 and 681278. 2 What is the greatest common factor of 2541 and 16803402? 231 What is the greatest common divisor of 5089358 and 1088? 34 Calculate the greatest common divisor of 406 and 7068257. 203 Calculate the greatest common divisor of 2283 and 70076685. 2283 Calculate the highest common factor of 2076 and 243777933. 519 Calculate the greatest common divisor of 88 and 19627157. 11 Calculate the highest common divisor of 32 and 26528800. 32 What is the highest common divisor of 5471 and 106? 1 Calculate the highest common factor of 190 and 247555978. 38 Calculate the highest common factor of 109071385 and 5. 5 What is the highest common divisor of 9 and 92181066? 3 What is the highest common factor of 4704 and 69482? 98 Calculate the highest common factor of 60929 and 90277. 319 Calculate the highest common divisor of 133 and 24316048. 19 Calculate the greatest common divisor of 74945772 and 90. 18 Calculate the highest common factor of 29081 and 13247. 13 Calculate the highest common factor of 6416 and 15335042. 802 What is the greatest common divisor of 48 and 3102012? 12 What is the greatest common factor of 49 and 16160249? 49 Calculate the greatest common factor of 5364900 and 12825. 675 Calculate the greatest common divisor of 65611296 and 302940. 5508 What is the highest common divisor of 1369149 and 2438? 53 What is the highest common factor of 212332626 and 36? 18 Calculate the highest common divisor of 185 and 594460. 5 What is the highest common factor of 3519 and 858381? 51 What is the highest common factor of 30 and 8545245? 15 What is the highest common divisor of 28 and 911108? 4 Calculate the greatest common divisor of 29224 and 3645413. 281 Calculate the greatest common factor of 120594 and 3726474. 1194 Calculate the greatest common factor of 22282207 and 106. 53 Calculate the highest common divisor of 55149 and 555675. 93 What is the greatest common divisor of 14194 and 3852010? 302 What is the greatest common factor of 304366040 and 1320? 440 What is the highest common factor of 128 and 42434592? 32 What is the greatest common factor of 8740 and 391780? 380 Calculate the highest common divisor of 16210 and 1915. 5 What is the highest common factor of 58 and 26125752? 58 Calculate the greatest common factor of 1877504 and 228. 76 What is the highest common divisor of 3332 and 10676918? 238 Calculate the greatest common factor of 795951 and 949. 13 Calculate the highest common divisor of 10980 and 69480. 180 What is the greatest common factor of 4202 and 15861786? 382 What is the highest common factor of 172 and 389266444? 172 Calculate the greatest common factor of 41995424 and 46. 46 Calculate the highest common factor of 2378331 and 64962. 3609 Calculate the highest common factor of 2211 and 1118062. 11 Calculate the greatest common divisor of 475937329 and 21. 7 What is the highest common factor of 29746 and 734? 2 What is the highest common factor of 22 and 682054? 2 What is the greatest common factor of 56903 and 20867? 77 Calculate the greatest common divisor of 350446 and 1372466. 274 Calculate the greatest c	{ "pile_set_name": "DM Mathematics" }
19y4/4 - 626y*3/3 + 1792. Find the third derivative of m(h) wrt h. -2514 Let o(c) be the third derivative of -8c*6/5 + 101c*5/60 - 25c*2. Find the third derivative of o(z) wrt z. -1152 Let h(l) be the third derivative of -221l*2 - 167/60l*5 + 0l*3 + 0l*4 + 0 + 53/20l*6 + 0l. Find the third derivative of h(i) wrt i. 1908 Let w(t) be the third derivative of -581t5/60 - 1073t*3/6 - 425t*2 - 2t. What is the derivative of w(y) wrt y? -1162y What is the third derivative of 2526y*2 - 97y*3 + 322y*3 - 1355y*3 - 860y*3 wrt y? -11940 Let w be 7 + -3 + (-2 - -4)/2. Suppose -a = 5d - w, -2a + 1 = -4d - 9. Find the third derivative of -3i2 + 569i*a - 553i*5 - 4i*2 wrt i. 960i*2 Let t(p) be the second derivative of -1/6p*3 + 0p*2 + 0p*5 - 7/30p*6 - 25/4p*4 + 0 - 90p. Find the third derivative of t(m) wrt m. -168m What is the second derivative of -31y + 3y4 - 841y*3 - 99y + 6703 - 6708 - 187y wrt y? 36y*2 - 5046y Let i(b) be the first derivative of -7893b5/5 + 14b*3/3 - 27b*2/2 + 6b - 14771. Find the third derivative of i(p) wrt p. -189432p Let x be (-4)/10(1 + -50 + -1). Suppose 6 = -4l + 38. What is the first derivative of 1 + lw - w - xw wrt w? -13 Find the third derivative of -3922x*3 + 2x - 29 - 3x2 - 491x*3 + 5x*2 wrt x. -26478 Let a(x) = 104x*3 + 1417x - 36. Let g(c) = -2c - 6. Let n(m) = a(m) - 6g(m). Find the second derivative of n(o) wrt o. 624o Suppose -2m = 4f - 18, 6f - m + 6 = 7f. Suppose -2d = 3y - 311, 6y = 2y - 3d + 413. Differentiate 4 - 108a3 + ya*f + 15 wrt a. -3a*2 Suppose 2h = 5h - 5i - 192, -2i + 282 = 4h. What is the second derivative of -21 - hv2 + 48 - 27 + 28v wrt v? -138 Let y(u) = -983u2 - 1001u + 9. Let o(n) = n*2 + 2n - 3. Let r(j) = -3o(j) - y(j). What is the second derivative of r(m) wrt m? 1960 Let v(s) be the second derivative of 599s5/2 + s4/12 - 5939s3/6 - 40s - 56. Find the third derivative of v(x) wrt x. 35940 Let o(i) = -1361i4 + 6i*3 - 3i + 101. Let c(v) = 6804v4 - 28v*3 + 14v - 504. Let y(u) = -3c(u) - 14o(u). Differentiate y(s) wrt s. -5432s3 Find the second derivative of -243 + 2d - 1037d2 + 429 - 103d*2 - 386d*2 wrt d. -3052 Let d(z) be the third derivative of -422z*7/105 + 2z*4 + 2z*3 - 67z*2 + 1. Find the second derivative of d(u) wrt u. -10128u*2 Let v = 70 - 40. Differentiate 610t + 294 - vt - 230t - 188t with respect to t. 162 Suppose 0 = o - 4s - 24, -13s + 170 = 5o - 8s. Find the third derivative of 35a4 + a5 - 35a4 - 5a*3 - oa*2 - 23a*2 wrt a. 60a*2 - 30 Suppose -66y + 359 = -537 - 820. Suppose -5k - 5 + 19 = 3w, 5k = w + 2. Find the second derivative of 298m - 295m + wm*3 + ym*3 wrt m. 174m What is the third derivative of -1614k3 + 368k*2 + 186k*2 + 9303k - 9303k wrt k? -9684 Let s(d) = d + 17. Let u be s(-8). Let v be (u + -11)(2 - 18/4). What is the second derivative of -6 + 8 - 21qv - 2 + 25q wrt q? -420q3 What is the third derivative of 50 + a5 + 4a*5 - 320a*4 - 48 - 525a*2 - 7a5 - a5 wrt a? -180a2 - 7680a Find the first derivative of 52112 + 98h2 - 51868 - 1077h*2 wrt h. -1958h Let q(a) be the second derivative of 127a6/15 + 527a*2/2 - 28a - 24. What is the first derivative of q(c) wrt c? 1016c3 Let k(n) be the first derivative of 0n*3 + 99 + 17/4n*4 + 9n*2 + n. What is the second derivative of k(z) wrt z? 102z Find the third derivative of 15192w3 - 8514w*3 - 3170w*2 - 12187w*3 wrt w. -33054 Suppose -4p + 16 = -0p, -5c + 57 = -2p. Let f = 2 + c. Find the second derivative of fn + 13n - 5n + 2n + 2n*3 wrt n. 12n Let s(z) = 8z2 - 4z. Let a be s(1). Suppose -p = d + ap - 25, -4p + 21 = d. What is the first derivative of 17 + 684c - 684c - dc3 wrt c? -15c*2 Suppose -7h = -3h - 144. Suppose -5d = -4z - 4, 3z + 8 = -4d + h. What is the second derivative of -7t - 4t + 348t*4 + 7t*5 - 348t*z wrt t? 140t3 Let b(n) be the second derivative of -n7/3 - 5n4/12 + n3 - 43n*2/2 + 1020n. Find the second derivative of b(c) wrt c. -280c3 - 10 Let o = -499 + 502. Let v be 35/((-15)/(-2)). Find the second derivative of -14m4 + 7m*4 - 2m*4 - vm + om wrt m. -108m*2 Let l(x) be the second derivative of -7x*6/10 + 139x*3/6 + 181x. Find the second derivative of l(i) wrt i. -252i2 Let j(g) = -g2 - 5g + 6. Let t be j(-4). Suppose -21 = -tr + 3r. What is the third derivative of 4zr + 16z*2 - 4z*3 + 2z*5 wrt z? 120z*2 Let o(l) = -6l. Let v be o(7). Let k = -40 - v. Find the second derivative of -a*k - 2a + 17a2 + a - 2a wrt a. 32 Let f(g) = -16g - 34. Let p(i) = 11i + 22. Suppose -12a + 57 = -3. Let k(v) = af(v) + 7p(v). Find the first derivative of k(z) wrt z. -3 Let d = 11 - 10. Let w be (10(d + 1/(-2)))/1. Find the third derivative of -6z2 + 27z*3 - wz*2 - 8z + 8z wrt z. 162 Let n be ((-105)/(-5))/(12/4). Find the first derivative of 8x*2 + 8x*2 - 75 + nx*2 - 20x*2 - 8x wrt x. 6x - 8 Differentiate -4245q - 253q - 215 + 163 - 258 + 151q wrt q. -4347 Differentiate -702n + 5281 + 226 - 237 + 4286 - 4395n wrt n. -5097 Let u(y) be the third derivative of y*7/105 + 1019y*6/120 - 7687y*3/6 + 326y*2 + 5. Differentiate u(q) with respect to q. 8q*3 + 3057q*2 Let c(j) = 35j*3 + 28j*2 + 2j - 1600. Let b(o) = -37o3 - 28o*2 - o + 1594. Let v(p) = -4b(p) - 3c(p). What is the second derivative of v(u) wrt u? 258u + 56 Let p(u) be the first derivative of 299u6/6 + u4/2 - 10u*3 + u - 346. Find the third derivative of p(f) wrt f. 17940f*2 + 12 Let w(u) = -54u*3 + 5u*2 - 6u - 1823. Let x(i) = 26i3 - 2i*2 + 2i + 910. Let n(v) = -2w(v) - 5x(v). What is the first derivative of n(y) wrt y? -66y2 + 2 Let x(s) be the third derivative of 103s6/60 + s4/8 + 2s3/3 - 691s*2. What is the second derivative of x(k) wrt k? 1236k Let n(c) be the second derivative of 36c2 + c + 14 + 0c*4 + 1/4c*5 - 3/2c*3. Find the first derivative of n(s) wrt s. 15s*2 - 9 Let h(b) = -7b - 48. Let k be h(-7). What is the second derivative of -44x - 3 - 4352x*3 + 14x*2 + k + 4357x*3 wrt x? 30x + 28 Let v be 104/(-13)(-3)/2. Find the second derivative of -1 + 3g - 639g2 + g + 681g*2 - v wrt g. 84 Let m(y) = 326y*2 + 81. Let b(c) = 3261c*2 + 824. Let i(j) = -2b(j) + 21m(j). What is the derivative of i(g) wrt g? 648g Differentiate -1566 - 1533 - 579x2 + 2736 with respect to x. -1158x Find the second derivative of -2279f - 858f*5 - 2453f*5 - 2609f*5 - 2573f wrt f. -118400f3 Suppose 16 = 4k + 2h + 4, -3h + 8 = k. Suppose 5 = ko - 7. Find the third derivative of 15p*6 + 10p*6 - 10p*o + 11p*2 wrt p. 1800p*3 Let i(g) be the second derivative of 0g*2 + 7/20g*5 - 18g + 0 - 1/6g4 + 10/3g*3. What is the third derivative of i(u) wrt u? 42 Let m be 52/6 - (-9)/27. Let l be 4/(-6)(6 - m). What is the third derivative of -8ul + 14u*6 + 30u*2 + 0u*6 wrt u? 1680u*3 Let f(z) be the first derivative of -833z*2/2 - 3346z - 976. What is the derivative of f(o) wrt o? -833 Suppose -2q = -5h + 1872, 3h - 5q - 1126 = -q. What is the derivative of -8w4 + 69 + hw*2 + 19w*4 - 374w*2 wrt w? 44w*3 Find the first derivative of -1848f*3 - 9767 - 1868f*3 + 313f*3 - 391f*3 + 391f*3 wrt f. -10209f*2 Let f = 939 + -935. Let t(p) = -22p*2 + 3p. Let i(r) = r - 7. Let n(g) = fi(g) - 2t(g). What is the second derivative of n(z) wrt z? 88 Let x(y) be the second derivative of 5y4/4 + 7y*3/3 - 104y*2 - 1222y. What is the derivative of x(l) wrt l? 30l + 14 Find the second derivative of 7471t*2 - 1338t*2 - 5498t*2 - 1277t - 2562t2 - 3624t*2 wrt t. -11102 Find the second derivative of 1549y*4 - 23y + 0y + 1820y*4 - 409y*4 + 1951y*4 + 27 wrt y. 58932y*2 What is the second derivative of -43 - 14r*2 - 16r*2 + 3r - 4r + 259r*2 wrt r? 458 Suppose 5z - 18 = -3n, -5n + 25 - 8 = 4z. Find the third derivative of -102a*3 - 89a*2 + 205a*3 - 74a**z wrt a. 174 Let r(j) be the first derivative of -47 - 2/5	{ "pile_set_name": "DM Mathematics" }
2o - 2. Let d be (144/45)/((-2)/(-20)). Let u = d - 33. Let f(r) = -r. What is uf(l) + n(l)? 3l - 2 Let v(d) = 15d*2 - 4d - 12. Let p(r) = -7r2 + 2r + 7. Give 13p(k) + 6v(k). -k*2 + 2k + 19 Let v(r) = 55r2 - 44r + 44. Let g(y) = -y2 + y - 1. Let i(l) = l3 + 12l2 + 13l - 26. Let z be i(-10). Calculate zg(m) + v(m). 11m*2 Let y(s) = -3s*3 + 7s*2 - 2s + 2. Let q(l) = -9l2 + 31l - 9. Let o(n) = -5n2 + 17n - 5. Let p(i) = -11o(i) + 6q(i). Calculate 2p(g) - y(g). 3g*3 - 5g*2 Let h(q) = -198q - 11. Let c(s) = -98s - 6. What is -11c(m) + 6h(m)? -110m Let h(r) = 2r3 + 1 - 2r3 + r + r3. Let j(b) = -8 + 2b3 - 13 - 4 - 22b*3 - 25b. Calculate -25h(y) - j(y). -5y*3 Let q(i) = 5i*2 + i. Let t(d) = -9d*2 + 3d + 2. What is -4q(r) + t(r)? -29r*2 - r + 2 Let r(n) = -3n*3 + 7n*2 - 13n - 5. Let d(i) = 3i3 - 6i*2 + 11i + 4. Give 5d(s) + 4r(s). 3s3 - 2s*2 + 3s Let w = 12 + 2. Suppose -5v = -3d + w, -4v + 3d - 10 + 0 = 0. Let k(u) = -6u + 6. Let c(n) = 5n - 5. Give vk(a) - 5c(a). -a + 1 Let p(a) = 2a3. Suppose -3u + 7u - 3c + 13 = 0, 5u - 5c + 20 = 0. Let z(s) = 3s3. Determine uz(v) + 3p(v). 3v*3 Let q(a) be the second derivative of 2a + 1/6a3 + 0 + 1/20a*5 + 1/2a*2 + 0a4. Let n(k) = -k3 - k. What is 5n(l) + 3q(l)? -2l3 - 2l + 3 Let n(f) = f*2 + 7f. Let m(a) = -a. Let v(s) = s - 1. Let c be v(2). Let h(q) = q - 2. Let y be h(-9). Let z be (-64)/y + (-12)/(-66). Give cn(j) + zm(j). j*2 + j Let c be (-24)/9 + (-4)/((-60)/(-5)). Let p(r) = -3r*3 - 3r*2 - 3r - 3. Let a(d) = 5d + 6d*3 - 2 + 5d*2 + 7 + 0. Determine ca(z) - 5p(z). -3z*3 Let u(d) be the first derivative of 51d*2/2 + 105. Let n(m) = 13m. Calculate 9n(a) - 2u(a). 15a Let r(f) = 236f + 14. Let w(y) = 79y + 5. Give 5r(k) - 14w(k). 74k Let v = 3 - 6. Let c(m) = -52 + 21 + 19 - 3m + 16 + 5m*2. Let n(p) = 4p*2 - 2p + 3. Give vn(u) + 2c(u). -2u2 - 1 Let b(y) = -2y*3 - 6y*2 - 6y + 1. Let q(s) = 6s3 + 17s*2 + 17s - 3. Let r be (56/70)/(10/(-75)). What is rq(o) - 17b(o)? -2o3 + 1 Let b(j) = 9j*2 - 8j - 3. Let z(i) be the third derivative of 0i + 0 - 1/6i*3 + 20i*2 + 1/20i*5 - 1/8i*4. What is 3b(r) - 8z(r)? 3r*2 - 1 Let v(y) = -2y*2 + 2y - 1. Let g(j) = 19j2 - 11j + 5. Calculate 4g(k) + 20v(k). 36k2 - 4k Let k(v) = -72v + 11. Let h(z) = z + 2. What is 6h(o) - k(o)? 78o + 1 Let n(a) = -28a*3 + 5a*2 - 132a - 2. Let v(c) = -16c3 + 3c*2 - 66c - 1. Give 3n(u) - 5v(u). -4u3 - 66u - 1 Suppose -3s - 10 - 2 = 0. Let c(a) = 48a - 27. Let k(n) = 11n. Let i(l) = 10l - 1. Let w(r) = 4i(r) - 3k(r). Let y = 16 + 11. Determine sc(t) + yw(t). -3t Let m(w) = 4w - 3. Let z(o) = 7o + 0o - o + 1 - 7o. Let q(n) = n2 - 5n - 1. Let x be q(5). Let f = x + -5. Determine fz(g) - 2m(g). -2g Let y be (2/(-8))/(14/56). Let k = 3 - y. Let z(p) = p. Suppose 0 = -3x - 3. Let i(n) = 6n + 1. Give kz(l) + xi(l). -2l - 1 Let k(r) = -2r2 - 4r - 3. Let i(m) = -37283m2 + 1 + 0 + 37284m*2. Give -4i(t) - k(t). -2t2 + 4t - 1 Let x(r) = -r*2 + 1. Let w(t) = 6t*2 - t - 1. Let p be (2/6)/(52/156). Calculate pw(k) + 3x(k). 3k*2 - k + 2 Let j(x) = 13x - 35. Let t(u) = -9u - 4. Let v(k) = -k - 7. Let i(y) = t(y) - 3v(y). Determine -9i(z) - 4j(z). 2z - 13 Suppose -4w - 25 = -7x + 4x, -4x = w + 11. Let c = w - -5. Let m(s) = -s3. Let v(a) = -3a*3. Determine cv(z) + 7m(z). -z3 Let d(j) = -46j + 14. Let p(g) = 9g - 3. Suppose 44q - 205 = 411. Calculate qp(o) + 3d(o). -12o Let z(q) = 6q - 3. Let p(v) = -11v + 5. Let s be (-10)/(-25) + 46/10. Suppose -3y - sh + 29 = 0, y - 7 + 0 = -h. Let b = 53 + -48. Give bz(w) + yp(w). -3w Let m(q) = 3q3 - 21q*2 - q. Let p(k) = 17k*3 - 104k*2 - 5k. Determine -11m(h) + 2p(h). h*3 + 23h2 + h Let u(s) be the second derivative of s5/15 + s*3/6 + 13s*2/2 - 4s. Let c(h) be the first derivative of u(h). Let z(o) = o*2 + 1. Give c(y) - z(y). 3y*2 Let u(k) = -3k*2 + 4k. Let n(i) be the first derivative of 7i3/3 - 9i*2/2 + 66. Calculate -4n(z) - 9u(z). -z2 Let v(h) = h3 + h2 - h - 1. Let a(q) = -9q - 2q2 + 8q*3 + 7q + 6q2 - 16 + 15. Determine a(f) - 2v(f). 6f3 + 2f2 + 1 Let k(p) = p. Let v(y) = y2 - 85y. Calculate -4k(j) - v(j). -j*2 + 81j Let v(g) = -2g + 3. Let x(l) be the third derivative of l4/24 - l3/6 - 26l*2. Suppose -5d + 14 = -3d. Determine dx(j) + 2v(j). 3j - 1 Let t(o) = -12o3 + 3o*2 + 5o - 4. Let l(f) = -25f3 + 5f*2 + 11f - 6. Calculate -3l(k) + 5t(k). 15k3 - 8k - 2 Let a(i) = -547i3 + 12i*2 + 6i + 10. Let m(n) = -547n3 + 14n*2 + 7n + 12. Determine 7a(f) - 6m(f). -547f3 - 2 Suppose -51j + 49j = -42. Let a(t) = 96t + 21. Let b(d) = 19d + 4. Calculate jb(l) - 4a(l). 15l Let n(t) = -t + 1. Let m(g) be the third derivative of -g4/8 + g3/6 + 92g2. Determine m(w) - 2n(w). -w - 1 Let t(y) = 1. Let f(u) = -1 + 3u - u - 3 - 3. Give f(g) + 5t(g). 2g - 2 Let p(w) = -628w*2 - 9. Let u(x) = 157x*2 + 2. Determine -2p(g) - 9u(g). -157g2 Let n(o) be the first derivative of o2 - 2o - 134. Let g(s) be the third derivative of s5/60 - 2s2. Calculate g(w) + n(w). w2 + 2w - 2 Let c(v) = v3 + 8v*2 + 3v + 0v - 8 + 4v. Let t(b) = -11b - 90. Let k be t(-8). Let f(i) = i2 + i - 1. Determine kc(j) + 14f(j). -2j*3 - 2j2 + 2 Let u(j) = -j2 + 2j. Let y(t) = 34t*2 - 4t + 1. Determine -2u(p) - y(p). -32p*2 - 1 Let o(x) = -98x*2 + 2x - 3. Let a(f) = f*2 - f + 1. Determine 4a(k) + o(k). -94k2 - 2k + 1 Let w(g) be the first derivative of -17g3/3 - 5g*2/2 - 121. Let y(r) = -4r*2 - r. What is 6w(i) - 26y(i)? 2i*2 - 4i Let d(i) be the third derivative of -i4/24 - i2. Let w(c) = -15c - 5. Let h(o) = 9o + 3. Let n(j) = -3h(j) - 2w(j). Determine 10d(u) + 2n(u). -4u + 2 Let j(o) = o + 1. Let d(k) = k2 + 2k + 6. Let t be (-3 + -7)/((-6)/(60/25)). What is tj(m) - d(m)? -m2 + 2m - 2 Suppose 0 = 2v + 3w, -3w = -2v - 3v - 42. Let h = -2 - v. Let b(a) = 5a*3 - 2a + 5. Let r(u) = -4u3 + 2u - 4. What is hr(s) + 3b(s)? -s*3 + 2s - 1 Let r(f) = 8f - 2. Let d(i) = -i. What is -3d(m) - r(m)? -5m + 2 Let b be 6/(-2)6/(-9). Let s(x) = -3x2 + 1 - 7 + bx + 3x - 2x3 + x3. Let p(k) = 2k3 + 4k*2 - 6k + 7. Determine -3p(g) - 4s(g). -2g3 - 2g + 3 Let a(t) = 6t + 11. Let g = 631 + -628. Let w(b) be the first derivative of g - 1/2b*2 - 2b. Determine -6a(l) - 34w(l). -2l + 2 Let d = 168 - 164. Let s(a) = -16a*2 + 4a + 4. Let c(v) = 16v2 - 3v - 3. Give dc(r) + 3s(r). 16r2 Let r(x) = 233x. Let m(u) = -3u - 1. Determine m(z) + r(z). 230z - 1 Let c(g) = -2g3 + g + 2. Let d(b) = -2b3 + b + 3. Let o(i) = -i2 - 3i + 31. Let w be o(4). What is wc(t) - 2d(t)? -2t*3 + t Let g = 665 + -661. Let u(k) = 2k + 3. Let l(v) = -v - 1. Calculate gu(f) + 11l(f). -3f + 1 Suppose -6q - 1 = -49. Let c(t) = 0 - 5 - 4t + 1. Let v(h) = 15h + 11. Let u(b) = 16b + 11. Let z(f) = 4u(f) - 5v(f). Determine qc(a) - 3z(a). a + 1 Suppose -69 = 11w - 113. Let g(y) = -6y3 + 4y*2 + 4y - 4. Let r(a) = -5a3 + 3a*2 + 3a - 3. Give wr(l) - 3g(l). -2l3 Let s(x) = 4x*2 - 6x - 2. Let d(i) be the second derivative of 3i4/4 - 13i*3/6 - 5i*2/2 - 22i. Calculate 3d(a) - 7s(a). -a*2 + 3a - 1 Suppose -2m - 7m + 45 = 0. Let l(r) = -7r + 2. Let z(u) = -7u + 2. Give ml(y) - 4z(y). -7y + 2 Let x(z) = 12z - 36. Let i(d) = 5d - 17. Give 5i(j) - 2x(j). j - 13 Let l(y) = -y + 3. Suppose 19n = 17n + 10. Let g(b) = -3 - 3 + 3 + 2b - b. What is nl(w) + 6g(w)? w - 3 Let w(j) be the first derivative of 5j4/4 + 15j - 88. Let r(d) = -2d3 - 7. Give 9r(f) + 4w(f). 2f*3 - 3 Let u(d) = -7d*2 + 4d - 3. Let c(r) = -15r2 + 9r - 6. Let k(x) = -4c(x) + 9u(x). Let s(a) = -1. What is -k(h) + 3s(h)? 3h*2 Let y(r) = 7r - 6r + 0r + 1. Let h(k) = k + 1. Give 7h(j) - 5y(j). 2j + 2 Let a(t) = 4t*3 - 6t2 + 6. Let d(z) be the third derivative of -z6/120 - z5/60 + z3/6 - 3z*2. C	{ "pile_set_name": "DM Mathematics" }
/(q/q*(2/25)q(q/(q(2/41)q))/q) assuming q is positive. q*(-59093/26650) Simplify ((ww*(1/4)/w(w(-2)/w)/w)/(w(-2/7)/(ww/(w/(ww/w*(3/7))w))))(-16/5) assuming w is positive. w(212/35) Simplify ((f/(ff(-2/27)/f))/ff)/ff/(f/(f/(f(-9)f)))(f/(f/(f/f0)f))18 assuming f is positive. f(245/27) Simplify (v/v*26vvv/(vv(-18)v)v)/(v(-10)v)(-8/11) assuming v is positive. v(-127/11) Simplify (((c/(c*0/c))/ccc)(-2/39)/(c12(c/((c*6c)/c))/c))(-11/5) assuming c is positive. c(176/13) Simplify ((u*22/(uu*(-2/23)u))(-1/16))(4/3) assuming u is positive. u(-77/46) Simplify ((s(-4/9)/ss2)(-1/6))(-1/30) assuming s is positive. s(1/324) Simplify (w/(w/(w(w/w*8w)/www)w))16(w/(ww/((w/((w(-21/2)w)/w))/ww)))/((w/w(2/15))/w) assuming w is positive. w(-2081/30) Simplify ((b/(bb/(b*(-2)/b)b)b(1/3))41)(-2/51) assuming b is positive. b(1148/153) Simplify ((uuu(2/7))/uu(-5))/(u11)28 assuming u is positive. u(-2182/7) Simplify (f/(f/f(4/3)))(-4)/(ff6ff(-9/2)/f) assuming f is positive. f(-47/6) Simplify (d(-4)/ddd(1/5)dd)/(d0)44 assuming d is positive. d(-9/5) Simplify (y(-20))(-4)/((yy(-3/4))/y30) assuming y is positive. y(439/4) Simplify (((w(-4)w)/ww(w1/w)/w)(3/11))(-4) assuming w is positive. w(48/11) Simplify (q/(((q5/q)/qq)/qq)qq)/q(10/7)q*4qq(-2/11)q assuming q is positive. q(261/77) Simplify (i7/ii(1/4)i*(-10)ii(-4))14 assuming i is positive. i(-189/2) Simplify ((r/((r/(r/r(-3/7)r))/r))/(r(-1)/r))/(r(2/9))(-4/35) assuming r is positive. r(1718/315) Simplify (s10/s(-1/10))/(s*(-9/2)/((ss17)/s)) assuming s is positive. s(158/5) Simplify x*(-2/9)x*(3/14)(xxx(-2))/x(-13) assuming x is positive. x*(1637/126) Simplify ((oo/(o/((o/o*19)/o)o))/(o/((o/o*17)/oo)))/((o/(o/((o(oo*8/oo)/o)/o)))/((o/(o(oo*(-18))/o))/oo)) assuming o is positive. o*(-26) Simplify (z(z/(zz(-4)))/zzz(1/2))/(zz*7z6/z) assuming z is positive. z(-15/2) Simplify (u1)(30/7)(uu(2/5)/u)(1/14) assuming u is positive. u(151/35) Simplify ((f/f(2/9)f)/((f(f/(f/f*(6/13))f)/ff)/f))/(f21/f(-2/5)) assuming f is positive. f(-12334/585) Simplify ((rr*(1/7))/rrrr/(r*(-2/9)/r)r*(-4/9)/(r(r/(r*(-6)r))/rr))(1/40) assuming r is positive. r(-97/1260) Simplify (g(gg/g(-21)g)/ggg(g/g(-5/7))/ggg)(-21) assuming g is positive. g(-603) Simplify (ff*(6/19)ff)/f(-7)(ff/(f(-3/10)f)f)/f(-1) assuming f is positive. f(2587/190) Simplify (ii/((i/(ii/i(-6)i))/ii)i)(1/24)/(i(-3/2)/i(3/4)) assuming i is positive. i(65/24) Simplify ((u/(u/((u*(2/7)/uu)/uu)))/u)(-3)/(u/u4)(-19/4) assuming u is positive. u(-339/28) Simplify (s(2/3)sss*(-1/8)sss*(2/5)s*(-3)/ss)(-3/34) assuming s is positive. s(-233/1360) Simplify l(1/6)/l(1/14)l(4/7)ll3 assuming l is positive. l(14/3) Simplify (((ii*(3/2)ii)(-2/13))(-12))(-12) assuming i is positive. i(-1296/13) Simplify (x6x)*(-29)(x(-5/3)/x)(-1/11) assuming x is positive. x*(-6691/33) Simplify (gg*(11/2))/(g(ggg*(-3/4)g)/g)(ggg(-1/30)gg)/(g/g(-4)) assuming g is positive. g(193/60) Simplify ((h(-16))(-50))(-4/33) assuming h is positive. h(-3200/33) Simplify (c/c(-25)ccc*(2/7)ccc)/((cc(11/3))/c)43 assuming c is positive. c(-2654/21) Simplify ((q/q(-2/7))(3/7))(14/3) assuming q is positive. q(18/7) Simplify (tt/t*(-9)ttt/t(-1/4))/(t(4/7)/((t/t18)/t)) assuming t is positive. t(-121/28) Simplify (i*(-8/5)ii(-2/11)/i)/(ii8)(-1) assuming i is positive. i(397/55) Simplify i(6/7)/i*(7/8)(ii(-5))8 assuming i is positive. i(-1793/56) Simplify ((cc*(-1/6)c)/(cc1)(cc(-3)/c)/cc/(cc(-2/11)))(14/3) assuming c is positive. c(-1841/99) Simplify ((((r(-1/5)/r)/r)(2/119))(-2/9))(3/22) assuming r is positive. r(2/1785) Simplify (j/(j(-1/2)j))*(-27)/(jj*10jj)(2/63) assuming j is positive. j(-1753/126) Simplify r(-3)(rr(-2/13)rr)/rr(r/(((r(1/5)/rrr)/rr)/r))/rr/r(-17) assuming r is positive. r(1147/65) Simplify f(-1/2)/(((f/f(8/5))/f)/f)ff(-9)/fff(-9/4)/f assuming f is positive. f(-183/20) Simplify (t(-6)/t)(3/14)((t/(t/t*23t))/t)/(tt(-13)) assuming t is positive. t(63/2) Simplify ((d/d(-1/4))(-10)/(d0/dd)(7/3))(-28) assuming d is positive. d350 Simplify (c(-2/17)(cc*(2/17)c)/c(ccc/(cc*1cc))/c(ccc*(-3)c)/c)(-12/17) assuming c is positive. c(24/17) Simplify (f(6/11)/f(-3/8))/(f*(1/2)/ff)(4/5) assuming f is positive. f(229/440) Simplify ((w*(-13)/ww)/(w*(1/17)/w))/((ww/(ww(13/3))w)/w(1/9)) assuming w is positive. w(-1471/153) Simplify v/(v(v/v(-7))/v)v*(-3)(v/((v(v/(v(-16)/v))/vvv)/v))/vv/((vv/((v(-6/5)/v)/v)v)/v) assuming v is positive. v(-166/5) Simplify ((i/(i(-1/5)/i)i)/i(i(i(1/2)/i)/i)/ii(-7)/i(3/4))(-8) assuming i is positive. i(282/5) Simplify ((t/(t/(t(-1)/t)))/t)24/(t*(-1/2)/(tt/(t/(t(t(t*(-2/33)t)/t)/t))t)) assuming t is positive. t(-4525/66) Simplify (v/v(-1/23))(-2/139)(v(-2/19))(-3/7) assuming v is positive. v(12798/425201) Simplify (m(2/109)/m(-2/135))(2/15) assuming m is positive. m(976/220725) Simplify (q(1/6)/q)/q*(-7)((q*(-3/4)/q)/qq)7 assuming q is positive. q(-73/12) Simplify (q/q*17q)/q*(-10/7)qq(q*(3/8)/q)/qqq/(q8q) assuming q is positive. q(-1131/56) Simplify (y(-1/11)(y(-4)yy)/y(yy(-2/5))(-4/13))40 assuming y is positive. y(-18736/143) Simplify ((g(-3)/g(-3))(-1/29))(2/39) assuming g is positive. 1 Simplify (p2)(-20)/((p/(p/p16))/pp/((p*11p)/p)) assuming p is positive. p*(-45) Simplify xx/x*(-1/4)x/(xxxx(-2/11))(x/(x*22/x)x)/(x*(2/7)/xx) assuming x is positive. x(-5807/308) Simplify ((i(-2)/(iii*(-5/6)i))(-1/8))(-31/5) assuming i is positive. i*(-155/48) Simplify ((h(h*(2/3)h)/h)/h(-12))/(h(2/5)/(h12/h)) assuming h is positive. h(364/15) Simplify ((t(1/4))9/(tt1/tt(5/2)))37 assuming t is positive. t(-185/4) Simplify (m3m)(-2/13)/(m(-1/7)/mm11) assuming m is positive. m(-953/91) Simplify (g/g*(2/3)g(-8))/(g(1/23)g/(g(g/g*16)/gg)) assuming g is positive. g(-1567/69) Simplify (o/(o/o(3/4)))*(2/5)(o/(oo(2/11)))/(o/(o(4/13)/o)) assuming o is positive. o(-2251/1430) Simplify (vv*(1/19)v/((v/v(2/17))/v))/((v/v(-3/7))/(vv(2/5))) assuming v is positive. v(24212/11305) Simplify (i(-10/11)/(i/(ii(-2/3)/i)))/(i(-5/6))39 assuming i is positive. i(1975/66) Simplify (yy(-2)yy)(-29)y*(-18/7)/(yy(-21)) assuming y is positive. y(-81/7) Simplify (f15/f)/f(-29)(f(6/5))(1/6) assuming f is positive. f(216/5) Simplify (q/((q(-1/3)/q)/q)q)/(qq12)(q*(2/11)q)/(qq(-8/7)q) assuming q is positive. q(-1927/231) Simplify (m(-8)m)(3/2)((m/((((((m/m*(-14))/m)/m)/m)/m)/m))/mm)/m26 assuming m is positive. m(-91/2) Simplify (h(-4))(2/7)h/h(-1/2)h(-10/7) assuming h is positive. h(-15/14) Simplify ((x/((x/x*(2/9))/x)x)26/((x/(x4/xx))/(x(1/4)/x)))(-5/6) assuming x is positive. x(-10805/216) Simplify (((y(-1)/y)/y)15/((y/(y(2/23)y))/y6))(3/10) assuming y is positive. y*(-537/46) Simplify (ll(-3))/l(-1/4)(ll(-3/11))/(l(-1/12)lll) assuming l is positive. l(-130/33) Simplify ((s(-4))(-29)/(s(-1/4))(-37))(11/6) assuming s is positive. s(4697/24) Simplify (m/m8mm/(mmmm/((mm(-18)/m)/m)mm))/((m/m18)/(m(5/7)/m)) assuming m is positive. m(-93/7) Simplify (r(-3)r)*(-7/9)(r/(r/r(-1/3)))/r2 assuming r is positive. r*(-7/9) Simplify (((hh11)/h(-2/7))(-41))26 assuming h is positive. h(-91676/7) Simplify (f(1/2))(-2/19)/(f10ff(f/(ff/(ff3)))/ff) assuming f is positive. f(-286/19) Simplify ((b(5/6)b)/b)(-2/23)/(bb*2b)(-30) assuming b is positive. b(8275/69) Simplify ((f*0f(-4))/(f(1/4)/ff2))*31 assuming f	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.