Datasets:

timaeus
/

pile-dm_mathematics

Dataset card Data Studio Files Files and versions Community

Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
n 15253 is divided by 37? 9 Calculate the remainder when 14602 is divided by 242. 82 Calculate the remainder when 233822 is divided by 19485. 2 What is the remainder when 206399 is divided by 1002? 989 What is the remainder when 17236 is divided by 401? 394 What is the remainder when 291466 is divided by 22420? 6 What is the remainder when 16755 is divided by 1522? 13 What is the remainder when 6539 is divided by 1552? 331 Calculate the remainder when 196599 is divided by 651. 648 What is the remainder when 5212 is divided by 536? 388 What is the remainder when 4267 is divided by 4241? 26 Calculate the remainder when 134752 is divided by 134748. 4 Calculate the remainder when 82720 is divided by 172. 160 What is the remainder when 88108 is divided by 44049? 10 What is the remainder when 45936 is divided by 15271? 123 What is the remainder when 18929 is divided by 62? 19 Calculate the remainder when 2650 is divided by 86. 70 What is the remainder when 9013 is divided by 2902? 307 What is the remainder when 77525 is divided by 19378? 13 What is the remainder when 737983 is divided by 832? 831 Calculate the remainder when 247252 is divided by 14. 12 Calculate the remainder when 472364 is divided by 4072. 12 What is the remainder when 74718 is divided by 40? 38 What is the remainder when 10219 is divided by 10? 9 What is the remainder when 64278 is divided by 4942? 32 Calculate the remainder when 312 is divided by 132. 48 Calculate the remainder when 76733 is divided by 176. 173 What is the remainder when 3043 is divided by 34? 17 Calculate the remainder when 11473 is divided by 766. 749 What is the remainder when 6978 is divided by 2013? 939 Calculate the remainder when 542 is divided by 144. 110 Calculate the remainder when 1049 is divided by 94. 15 What is the remainder when 495363 is divided by 118? 117 Calculate the remainder when 34170 is divided by 5695. 0 What is the remainder when 3982 is divided by 34? 4 Calculate the remainder when 10594 is divided by 106. 100 What is the remainder when 30595 is divided by 129? 22 What is the remainder when 18180 is divided by 888? 420 Calculate the remainder when 11907 is divided by 5902. 103 What is the remainder when 1523 is divided by 1444? 79 What is the remainder when 155 is divided by 77? 1 What is the remainder when 138961 is divided by 19847? 32 Calculate the remainder when 564699 is divided by 705. 699 What is the remainder when 3693 is divided by 43? 38 Calculate the remainder when 1174 is divided by 1149. 25 Calculate the remainder when 50132 is divided by 6. 2 What is the remainder when 33263 is divided by 19? 13 Calculate the remainder when 18599 is divided by 715. 9 What is the remainder when 20746 is divided by 5103? 334 Calculate the remainder when 328173 is divided by 106. 103 Calculate the remainder when 4507 is divided by 32. 27 Calculate the remainder when 32575 is divided by 13. 10 What is the remainder when 43662 is divided by 4849? 21 What is the remainder when 10899 is divided by 247? 31 What is the remainder when 32005 is divided by 2673? 2602 Calculate the remainder when 10779 is divided by 82. 37 Calculate the remainder when 166 is divided by 147. 19 What is the remainder when 38079 is divided by 604? 27 What is the remainder when 8263 is divided by 119? 52 Calculate the remainder when 1781 is divided by 491. 308 Calculate the remainder when 3085 is divided by 321. 196 What is the remainder when 5897 is divided by 199? 126 Calculate the remainder when 119151 is divided by 180. 171 What is the remainder when 5500657 is divided by 10? 7 Calculate the remainder when 111796 is divided by 3726. 16 Calculate the remainder when 117546 is divided by 29385. 6 What is the remainder when 807638 is divided by 8? 6 Calculate the remainder when 157210 is divided by 18. 16 Calculate the remainder when 70301 is divided by 48. 29 What is the remainder when 51130 is divided by 2324? 2 Calculate the remainder when 4881 is divided by 16. 1 What is the remainder when 81999 is divided by 26? 21 Calculate the remainder when 8308 is divided by 2754. 46 Calculate the remainder when 18164 is divided by 4485. 224 What is the remainder when 2305 is divided by 405? 280 What is the remainder when 153538 is divided by 505? 18 What is the remainder when 48369 is divided by 220? 189 Calculate the remainder when 552 is divided by 197. 158 Calculate the remainder when 432591 is divided by 152. 151 What is the remainder when 17611 is divided by 3520? 11 Calculate the remainder when 11353 is divided by 264. 1 What is the remainder when 15156 is divided by 433? 1 Calculate the remainder when 93921 is divided by 3029. 22 Calculate the remainder when 82511 is divided by 101. 95 What is the remainder when 31149 is divided by 31147? 2 What is the remainder when 103774 is divided by 24? 22 Calculate the remainder when 4041 is divided by 1104. 729 Calculate the remainder when 17046 is divided by 290. 226 What is the remainder when 26511 is divided by 4287? 789 Calculate the remainder when 10181 is divided by 2033. 16 What is the remainder when 4192 is divided by 417? 22 What is the remainder when 4056 is divided by 173? 77 Calculate the remainder when 160865 is divided by 307. 304 What is the remainder when 769 is divided by 179? 53 What is the remainder when 2579 is divided by 212? 35 Calculate the remainder when 184259 is divided by 5. 4 What is the remainder when 5292 is divided by 79? 78 Calculate the remainder when 14328 is divided by 126. 90 What is the remainder when 27494 is divided by 48? 38 What is the remainder when 163044 is divided by 51? 48 Calculate the remainder when 14699 is divided by 312. 35 What is the remainder when 151510 is divided by 273? 268 What is the remainder when 55654 is divided by 13897? 66 Calculate the remainder when 1263494 is divided by 31. 27 Calculate the remainder when 46098 is divided by 15348. 54 What is the remainder when 67029 is divided by 168? 165 What is the remainder when 115813 is divided by 2316? 13 Calculate the remainder when 4578 is divided by 93. 21 What is the remainder when 48393 is divided by 2545? 38 Calculate the remainder when 14149 is divided by 14129. 20 Calculate the remainder when 42482 is divided by 145. 142 What is the remainder when 1211 is divided by 5? 1 What is the remainder when 1264 is divided by 655? 609 What is the remainder when 2401 is divided by 67? 56 What is the remainder when 3843 is divided by 295? 8 What is the remainder when 35512 is divided by 1112? 1040 Calculate the remainder when 31171 is divided by 215. 211 Calculate the remainder when 380959 is divided by 6. 1 What is the remainder when 127545 is divided by 32? 25 Calculate the remainder when 6792 is divided by 29. 6 What is the remainder when 5804923 is divided by 23? 22 Calculate the remainder when 146239 is divided by 320. 319 Calculate the remainder when 57849 is divided by 203. 197 Calculate the remainder when 234569 is divided by 24. 17 What is the remainder when 152182 is divided by 34? 32 Calculate the remainder when 247931 is divided by 106. 103 Calculate the remainder when 2195762 is divided by 398. 394 Calculate the remainder when 130624 is divided by 342. 322 What is the remainder when 3192833 is divided by 4? 1 What is the remainder when 37602 is divided by 100? 2 Calculate the remainder when 55338 is divided by 14. 10 Calculate the remainder when 370838 is divided by 771. 758 Calculate the remainder when 51145 is divided by 125. 20 What is the remainder when 18468 is divided by 922? 28 Calculate the remainder when 7093 is divided by 129. 127 Calculate the remainder when 26882 is divided by 22. 20 What is the remainder when 12106 is divided by 3006? 82 What is the remainder when 38525 is divided by 6419? 11 Calculate the remainder when 4061 is divided by 1960. 141 Calculate the remainder when 191665 is divided by 320. 305 Calculate the remainder when 9712 is divided by 77. 10 Calculate the remainder when 64156 is divided by 203. 8 Calculate the remainder when 171613 is divided by 85. 83 Calculate the remainder when 55365 is divided by 749. 688 What is the remainder when 11058 is divided by 5365? 328 What is the remainder when 6679 is divided by 3327? 25 What is the	{ "pile_set_name": "DM Mathematics" }
(k(-1)/(k(-6/7)/k))(-34)/((k/(k/(k/k2)))12)(1/43) assuming k is positive. k(-8688/301) Simplify (z(-4)/(zz(1/13)/z))(2/11)/((z(5/3)z/(z/(zz(2/5)z)))/(zz(-2/3))(-14)) assuming z is positive. z(-20323/2145) Simplify ((m(-1/3))(-1/6)((mm6m)/m)/m0)/((m(-1))*(3/5)(m/m*0m)(2/65)) assuming m is positive. m(1777/234) Simplify ((v*(-7)/v)/(v(v*(-6/7)/v)/vv))*(-38)((v*0/v)/(vvv6))/(v3((v(1/3)/v)/v)/v) assuming v is positive. v(5504/21) Simplify ((oo3)/o(-4))46o/(o/o*6)o*(-1)(oo4/o)/(o(1/2)/oo) assuming o is positive. o*(753/2) Simplify (yy(-1))48/(y/y*2y*(-7))((y*(6/13)/yy)/yy(3/2))(-2/5) assuming y is positive. y(99/13) Simplify (u/(uu(-8/13)))(-40)/(u/(u/((((uuuu/(u(-1/13)uuu)u)/uu)/u)/u)))(-29) assuming u is positive. u(-291/13) Simplify (a/a*(-4)(a/(a/a(-4/7)))/a)/(a/(a(1/3)a)a*(-6)aa)((a/(((aa(-3))/a)/a))/a(-3/7))(-17) assuming a is positive. a(-1775/21) Simplify ((n/(n(-2)/nn)n)/n(-2)(n/n*(4/3)n)/(nn/(nnn(-6))))/((nn*1nn)(1/29)/(n(-2/3)n(-1)/n)) assuming n is positive. n(-62/29) Simplify ((rr/(rrr(2/3)r)r)(-46))(3/16)(r(5/4)/(r8/r))(-49) assuming r is positive. r(575/2) Simplify ((a/(a/(a*(-24)a))aaa/a(-11))/(a24a(-7/4)))(2/43) assuming a is positive. a(-125/86) Simplify (w/w(-4)ww*(1/3)/www)/((w/w2)/(w/(ww/w*(-1/5))))((w(-2/7))(2/91))(-3/7) assuming w is positive. w(477293/66885) Simplify (l*(-1/2)l/(l/(l*(-2)/l))(l*(3/8)l)/l*(-3))/(ll*(-3)l/((l*5/ll)/l)l(l/(ll(3/8)))/(ll/l(-1/2))) assuming l is positive. l(31/4) Simplify n*(2/9)n*5n*2n/(n/n*(-4/3))(n*1/nn)*(-2/37)((n/n*(5/4))/n)/nn(-3/5) assuming n is positive. n(19879/6660) Simplify ((p*(-1/5)/pp/(p/((p/(pp/p(-18)))/p)))/(p23)(-41))(-8) assuming p is positive. p(-36872/5) Simplify (j(-3/13)/(jj/(jj(-4/3)j)))*44/((((jj*(2/3)j)/j)/((jj9)/j))/((j(jj/(jj*(2/21)))/jj)/(j/(j/j(-1/11))))) assuming j is positive. j(-59551/1001) Simplify ((w*(2/37)www)8/(w(2/17)w(-26)))(-33) assuming w is positive. w(-1044384/629) Simplify ((x/x34x(-14/5))/((x(8/9)x)/xx(-28/5)))40 assuming x is positive. x(-11192/9) Simplify (u/u(-30)u(-7/5)/uu)/(uu1((u/(uu(3/5)))/u)/u) assuming u is positive. u(151/5) Simplify v(-2/11)v/(v*(-1)v)v6v*3v((v(-2/7)/v)(-25))(-13) assuming v is positive. v(-31342/77) Simplify (((qq*4(q/(((qq(-1/5))/q)/q))/qq)(-50))(-28))(1/25) assuming q is positive. q(2016/5) Simplify ((s(-2/9))(-39)(s0)(-28))(-27/5) assuming s is positive. s(-234/5) Simplify (q(-2/7))(2/13)q(-4)/((q/(q/(q2q)))/qq)(qq/(q*(1/4)q))*(2/9)(qq/(((q(q*4q)/q)/qq)/q))/q(-2) assuming q is positive. q(-3755/546) Simplify x(2/7)/(x(-14)x)(xx/x*(-29)x)(-7) assuming x is positive. x(-1475/7) Simplify ((f(-1/4))49/(ff(1/2))(-47/3))/((f(-1/7)/(f(1/7)/f))/(f(2/11)f/f(-2/5))) assuming f is positive. f(18661/1540) Simplify ((i0)23i(-1)/(ii/(ii(-3/5)i)))/((iii*(-1/7)i)/(i/i*(-3/5)i))(3/14) assuming i is positive. i(-811/490) Simplify (ss/(s/(s/s(1/4))s))*(-1/34)(sss/(s(-1)/s))(-49)(s1)16/(s(-1/3)ss(-6/7)) assuming s is positive. s(-653543/2856) Simplify ((q(-2/3)qq(5/6)q)/(q/(qq1)q)*(-1/57))/((q/(qq/(qq/q(2/3))))(-9)qqq/q*5qq/(qqq(-2))q) assuming q is positive. q*(25/6) Simplify ((v(vv4/v)/v)/(v/(vv0)))(-6/7)(v(-1/3)/((v(1/10)/v)/v))/((vv*5v)/v5) assuming v is positive. v(-811/210) Simplify ((uu0)9(u/u*2u)*(-2/53))/((((uu(-1/5))/u)/u(-4/9))/(u*(-4)/uu/(uu0))) assuming u is positive. u(169/45) Simplify (((g/g1g)*35g*(4/3)/(gg/(g/(gg/((g/(g/g(2/3))g)/ggg)))))(4/17))(37/4) assuming g is positive. g(1332/17) Simplify ((y(-2/83)y/y(5/11))/((y/y1)/(y/(yy*0y))))(-3/20) assuming y is positive. y(1311/18260) Simplify (((y*(-6/13)y)/y*10)/(y/(yy*(1/8)yyy)y(3/5)/y))34 assuming y is positive. y(-52479/260) Simplify i/i5ii(-6)i(i/(ii*5/ii))/i*(-2/9)(i1)(-1/43)(iii/i(-1/2)i)(3/16) assuming i is positive. i(-148079/12384) Simplify ((y(-1/2)/y)/y(-4/7))/(y0)(-30)y(yy(3/7)y)/yyyy(-1/2)(y0)(4/5) assuming y is positive. y3 Simplify ((((p(-2))(1/4))(-1/13))(1/13))(-14) assuming p is positive. p*(-7/169) Simplify (((aa(-3/2))/a)(-34)/((a(-2/63)/a)/(a(-12)/a)))(-33) assuming a is positive. a(-27049/21) Simplify ((d*11/dd*(-2/3)/d)/(d(d*(-3)/d)/dd(10/9)/d))(7/4) assuming d is positive. d*(385/18) Simplify (lll2/l)30/(l(-1/4)l)*19(l*(-2/3)/(ll(-3)))(17/4) assuming l is positive. l(977/12) Simplify b(9/4)b(-17)(b/(b*(-1/7)bb))(12/11) assuming b is positive. b(-4831/308) Simplify (h(3/7)h*(-3)/hh/(hh0/h)hh(-1/4))/(h5/h3)27 assuming h is positive. h(-1563/28) Simplify (l(5/2)/(ll*6l)ll*(-6)ll3)/((l0)(2/157)(ll/(l(-2/5)l))/(ll2)) assuming l is positive. l(-49/10) Simplify (cc*0ccc)*(6/11)c*(-1/6)c*(-2/17)c(c(-3/10)/((c/(c(-4)c))/c))17 assuming c is positive. c(-149233/2805) Simplify (y*(-12)y(1/5))(2/79)/((y/y0)(-16)/(y/(y0/y))(3/47)) assuming y is positive. y*(293864/18565) Simplify (s/(ss*(-1/8))sss*14s(-3/10)/s(2/41))(-3/22) assuming s is positive. s(-77619/36080) Simplify nn(4/27)nn(2/115)(n*(-41)/n)/nnn(-2/89) assuming n is positive. n(-11014264/276345) Simplify (h(3/16)h)/h*(-1/30)(hh(-16))(6/7) assuming h is positive. h(-19549/1680) Simplify (g(g*(1/3)g)/g)*50((g*(-1)g)/gg)26(g*2g)/(g/(gg/g(-6)))(gg(-1/2))19 assuming g is positive. g(517/6) Simplify ((s(s/(s*(-1)s))/s)(-1/20)/(s0)(-10/3))/((s(-1)/s)1/(s(1/4))(-15)) assuming s is positive. s(-9/5) Simplify ((ll/(l(ll(-1))/ll)l)(-3)/(l(1/4)l(l/(l(-8)/l))/l))/(l(-1/7)/(l(-2/11)/l)l(4/3)/l(-1/2)) assuming l is positive. l(-17669/924) Simplify ((o(-1)/o)*(34/7)(o/o4)(-47))(-34) assuming o is positive. o(-31246/7) Simplify (j(-2/3)/j(-7))*(2/105)/(((jj(-2/5))/j)3)(-3/5) assuming j is positive. j(-944/1575) Simplify (d/((d/((d*(-3/8)/dd)/dd))/d)d(-2/11))/(d3/d*5)(dddd(2/19)dd)/d3d*(-8)d(dd*4/d)/dd assuming d is positive. d(2589/1672) Simplify m(-3/2)/(m/m*(-2/11))m*(-5)m*6m*(1/2)/(m(((m/m*(2/19))/mm)/mm)/m)m/m*(-3/2)m(m((m*(4/5)m)/m)/m)/m assuming m is positive. m*(2557/2090) Simplify ((vv(-1))(1/29))*19/((vv*(-2)v)/v(1/2))41 assuming v is positive. v(41/2) Simplify (p18p(-6/5))/(p1)(2/75) assuming p is positive. p(1258/75) Simplify (((i(-1/4)i)/i)48)(-46)/((i(-1))(-2/19))(-43) assuming i is positive. i(10574/19) Simplify ((tt/((t/t(2/17))/tt))/t)/(tttt31)t8/t(-3/17) assuming t is positive. t(-437/17) Simplify ((n0nn(-8/5))/(n(-1/2)/(n*6nn)))/((nn(n/((n/(n(-8)/n))/n)nn)/nnn/n(-3))/(((n/(n5/n))/n)/(nn4))) assuming n is positive. n(-11/10) Simplify m*8m*(-1/8)m*(1/9)/(m/(m/(mm*(-1/13)mm)))m(2/5)/m6((mm/((m/(mm(-2/7)))/m)m)/m)(-5) assuming m is positive. m(-462191/32760) Simplify (((aa/(a3a))/(a/a(-2/15)))/(a(-2/11)/(a/(aa(1/6)))))/((aa/(a*(-1)a)aa)*(-19)(a(-1))(41/4)) assuming a is positive. a*(18289/220) Simplify ((gg(6/11))/(g(-3/4)/g))*(1/4)/((gg*5g)/g*(1/4)(gg/(g/g0g)g)13) assuming g is positive. g(-3331/176) Simplify (nn*(31/5)n)*(-34)n/(n/(n/n*(-24)))n(-40) assuming n is positive. n(-1469/5) Simplify ((i*(-4/15)i/i*11i)/(ii(-1/9)/ii)(-10))(2/17) assuming i is positive. i(-2/45) Simplify ((f(2/13))(-11/5))(-1/46)(f(-2/15)/(f/(f(-2/11)/f)))/(f(-7)f/(((f/f*(-1/6)f)/f)/f)) assuming f is positive. f(76151/19734) Simplify ((d(-2/65)d/(d/d39))8)(-2/13) assuming d is positive. d(-40528/845) Simplify ((v/v*(-1/7))/(v/(v	{ "pile_set_name": "DM Mathematics" }
-282 What is -1001.432723 rounded to 1 dp? -1001.4 Round 3.9454349 to 2 dps. 3.95 Round 0.000486806669 to three decimal places. 0 What is 47463001 rounded to the nearest 1000000? 47000000 Round -2.031514321 to five decimal places. -2.03151 What is -3.37946167 rounded to four dps? -3.3795 What is -4622203.5 rounded to the nearest one hundred thousand? -4600000 Round -6760060630 to the nearest one million. -6760000000 Round 0.000021772404 to six decimal places. 0.000022 Round -0.0135195673 to five decimal places. -0.01352 What is -293.134972 rounded to the nearest integer? -293 Round -592462400 to the nearest one million. -592000000 Round -2.143440605 to 2 decimal places. -2.14 Round 0.5709822413 to five dps. 0.57098 Round 0.00093696599 to 5 dps. 0.00094 Round -0.00035855443 to six decimal places. -0.000359 Round -0.089078266 to two dps. -0.09 What is -14506778.29 rounded to the nearest 10000? -14510000 Round -7391897.3 to the nearest 100000. -7400000 Round -2275.340789 to 2 dps. -2275.34 Round 33255411 to the nearest 10000. 33260000 Round -0.0148745551 to 6 dps. -0.014875 Round 14.4212404 to 2 decimal places. 14.42 What is 0.02190808864 rounded to five decimal places? 0.02191 What is 136735729.29 rounded to the nearest 10000? 136740000 Round -0.028796572958 to six decimal places. -0.028797 What is 2332179.6 rounded to the nearest 100000? 2300000 Round -0.00136350959 to 7 decimal places. -0.0013635 What is -1469320300.1 rounded to the nearest 10000? -1469320000 Round -169.4379658 to one decimal place. -169.4 Round -0.000001603568087 to six decimal places. -0.000002 Round -1604.68659 to the nearest integer. -1605 Round 70609383.4 to the nearest one hundred thousand. 70600000 Round 11588.28419 to the nearest ten. 11590 Round 39695.6242 to the nearest 100. 39700 Round -6629863.3 to the nearest 1000000. -7000000 What is 401230.9 rounded to the nearest one hundred thousand? 400000 Round -5610684.7 to the nearest one thousand. -5611000 What is -1997.2748 rounded to the nearest 100? -2000 Round -2.66562981 to 2 decimal places. -2.67 Round -0.0867242892 to 5 dps. -0.08672 What is 0.0005099405066 rounded to five decimal places? 0.00051 What is 0.29004175 rounded to four decimal places? 0.29 What is 0.1075517359 rounded to five decimal places? 0.10755 Round 1355720662 to the nearest ten thousand. 1355720000 What is -231.4515282 rounded to the nearest ten? -230 Round 0.435840141 to 3 dps. 0.436 What is -0.0025054253 rounded to 5 dps? -0.00251 What is 0.00369709121 rounded to 6 decimal places? 0.003697 What is -8.338217236 rounded to 4 dps? -8.3382 What is -0.00106374885 rounded to seven dps? -0.0010637 Round -637.692121 to the nearest 10. -640 What is 16310598700 rounded to the nearest 1000000? 16311000000 What is 2800023.866 rounded to the nearest 100000? 2800000 What is -0.00004508120691 rounded to 6 decimal places? -0.000045 What is -8.1810579 rounded to the nearest integer? -8 Round 12907251210 to the nearest 1000000. 12907000000 Round 26.59659204 to three decimal places. 26.597 Round 0.002683444741 to 7 decimal places. 0.0026834 What is 0.0000062993663 rounded to 7 dps? 0.0000063 Round -0.0407434771 to six dps. -0.040743 What is -41600.9093 rounded to the nearest integer? -41601 Round 6316.67888 to the nearest 1000. 6000 Round 1.1639093 to three decimal places. 1.164 Round -1123109929 to the nearest one hundred thousand. -1123100000 Round 790709093.3 to the nearest 10000. 790710000 Round -0.000061120259 to 6 decimal places. -0.000061 What is -13523.18375 rounded to 1 dp? -13523.2 What is -0.00215221173 rounded to five dps? -0.00215 What is -652.7376974 rounded to 1 dp? -652.7 What is -0.358921905 rounded to 4 dps? -0.3589 Round 3639820 to the nearest ten thousand. 3640000 What is 27346.1144 rounded to the nearest 1000? 27000 What is 55273956.81 rounded to the nearest 1000? 55274000 What is 0.000000161137847 rounded to 7 decimal places? 0.0000002 Round -267649284 to the nearest one hundred thousand. -267600000 What is 2.059276 rounded to the nearest 10? 0 Round 6116.45807 to the nearest 1000. 6000 Round 547602.4 to the nearest one thousand. 548000 What is -0.00151687979 rounded to 4 dps? -0.0015 Round -15728120580 to the nearest 100000. -15728100000 Round -136437.275 to the nearest 100000. -100000 Round -2085915.862 to the nearest 100. -2085900 Round -15770233700 to the nearest one million. -15770000000 Round -13805473.8 to the nearest 1000. -13805000 Round 153.288028 to two dps. 153.29 What is -0.7471895127 rounded to 1 decimal place? -0.7 What is -5345.03444 rounded to the nearest one thousand? -5000 Round 448167220 to the nearest one million. 448000000 Round 6.9583055 to the nearest integer. 7 Round 297176.788 to the nearest 10. 297180 Round 1556899.1 to the nearest one million. 2000000 Round -52337044.9 to the nearest 1000000. -52000000 What is -17.14362531 rounded to 0 decimal places? -17 What is 1292784267.4 rounded to the nearest one million? 1293000000 What is -103986.32334 rounded to the nearest 10000? -100000 Round 45.8061113 to 3 dps. 45.806 What is 152354711.7 rounded to the nearest one million? 152000000 What is -5693692.7 rounded to the nearest one hundred thousand? -5700000 Round 7848146940 to the nearest one hundred thousand. 7848100000 Round -11949244 to the nearest one million. -12000000 What is 4219947.605 rounded to the nearest one thousand? 4220000 What is -0.00000417958048 rounded to 7 dps? -0.0000042 What is 7264.138082 rounded to the nearest 10? 7260 Round -162066 to the nearest 100000. -200000 What is -0.000014182024 rounded to seven decimal places? -0.0000142 What is 6.782311 rounded to one dp? 6.8 Round -0.000249912015 to 6 decimal places. -0.00025 What is -475821877.8 rounded to the nearest one hundred thousand? -475800000 Round -0.00000841337566 to seven decimal places. -0.0000084 What is 0.00544214949 rounded to seven dps? 0.0054421 What is -0.0000057706587 rounded to six decimal places? -0.000006 What is -26325.213 rounded to the nearest one thousand? -26000 Round 2157.005515 to the nearest one hundred. 2200 What is 9071462800 rounded to the nearest one million? 9071000000 Round -26.25726809 to 2 dps. -26.26 What is 0.00001953581 rounded to seven dps? 0.0000195 Round 122.105828 to one dp. 122.1 What is -243.902384 rounded to one decimal place? -243.9 What is -6346.33132 rounded to the nearest 1000? -6000 What is 251.845437 rounded to the nearest integer? 252 Round 293889101 to the nearest ten thousand. 293890000 Round 98412.0014 to the nearest 10. 98410 Round -0.12834793 to 3 decimal places. -0.128 What is 0.0001067007778 rounded to six decimal places? 0.000107 Round -0.0313200392 to four dps. -0.0313 Round 687280.8562 to the nearest 100. 687300 What is -107.75742 rounded to 2 dps? -107.76 What is 143.8663214 rounded to two decimal places? 143.87 What is 0.00000091626807 rounded to 7 decimal places? 0.0000009 What is -1002.659 rounded to the nearest one hundred? -1000 Round 0.5104367039 to 2 dps. 0.51 Round 0.08651441 to 3 dps. 0.087 Round -120282.0519 to the nearest ten thousand. -120000 Round -0.1017156302 to 2 decimal places. -0.1 What is -151.0312288 rounded to the nearest 10? -150 What is 1522.72532 rounded to the nearest ten? 1520 What is -260.103343 rounded to one dp? -260.1 What is -8372.83 rounded to the nearest 100000? 0 Round 26.53344484 to one decimal place. 26.5 Round 2993708.07 to the nearest one thousand. 2994000 What is 8641565000 rounded to the nearest one million? 8642000000 What is 176.361236 rounded to one dp? 176.4 What is 122382.689 rounded to the nearest 100? 122400 What is 19795.5789 rounded to the nearest 100? 19800 What is -4254278.3 rounded to the nearest one hundred thousand? -4300000 Round 0.000264344197 to five dps. 0.00026 Round 10309673680 to the nearest 1000000. 10310000000 Round -7178.79532 to one dp. -7178.8 What is 3338.0427 rounded to the nearest one thousand? 3000 What is 45219412 rounded to the nearest one hundred thousand? 45200000 Round 260.441185 to 1 decimal place. 260.4 What is -0.00001102696435 rounded to 5 dps? -0.00001 What is 13098.9708 rounded to zero dps? 13099 What is -9.529267247 rounded to 2 dps? -9.53 Round -5462581.41 to the nearest ten thousand. -5460000 What is	{ "pile_set_name": "DM Mathematics" }
-27562? -b3 - b2 - 4421b - 784 What is the k'th term of -391, -718, -961, -1078, -1027, -766, -253? 7k*3 - 376k - 22 What is the v'th term of -843917, -1687810, -2531703? -843893v - 24 What is the u'th term of 14432, 14641, 14926, 15281, 15700, 16177, 16706, 17281? -u3 + 44u*2 + 84u + 14305 What is the p'th term of -104, 260, 624? 364p - 468 What is the g'th term of 93007, 186009, 279011, 372013? 93002g + 5 What is the b'th term of 14861, 118760, 400749, 949874, 1855181, 3205716, 5090525? 14841b3 - b2 + 15b + 6 What is the w'th term of 514901, 515049, 515197, 515345? 148w + 514753 What is the q'th term of 16860, 16997, 17144, 17307, 17492, 17705? q3 - q2 + 133q + 16727 What is the v'th term of -110083, -110275, -110467, -110659, -110851? -192v - 109891 What is the p'th term of 116985915, 233971833, 350957751? 116985918p - 3 What is the m'th term of -1257, -4672, -10267, -18042, -27997, -40132, -54447? -1090m2 - 145m - 22 What is the p'th term of -179862, -359711, -539560, -719409, -899258, -1079107? -179849p - 13 What is the j'th term of 27535, 54946, 82357, 109768, 137179, 164590? 27411j + 124 What is the m'th term of -5342921, -10685854, -16028811, -21371798, -26714821, -32057886, -37400999, -42744166? -m*3 - 6m*2 - 5342908m - 6 What is the k'th term of -176693, -354515, -532337, -710159, -887981, -1065803? -177822k + 1129 What is the g'th term of -34823, -69518, -104149, -138716? 32g*2 - 34791g - 64 What is the a'th term of 1414443, 2828886, 4243333, 5657790, 7072263, 8486758, 9901281? a*3 - 4a*2 + 1414448a - 2 What is the d'th term of -364969541, -364969542, -364969543? -d - 364969540 What is the q'th term of -217031, -434235, -651439, -868643? -217204q + 173 What is the n'th term of 953379, 953399, 953413, 953421? -3n*2 + 29n + 953353 What is the b'th term of -2580, -5149, -7730, -10323, -12928, -15545? -6b2 - 2551b - 23 What is the c'th term of -2664, -9488, -20484, -35652, -54992? -2086c2 - 566c - 12 What is the u'th term of 34512889, 69025777, 103538665, 138051553, 172564441, 207077329? 34512888u + 1 What is the t'th term of -69, 57, 13, -201? -85t*2 + 381t - 365 What is the s'th term of -31070, -31023, -30980, -30941, -30906? -2s2 + 53s - 31121 What is the t'th term of -3803071, -7606129, -11409191, -15212257? -2t2 - 3803052t - 17 What is the z'th term of -72297, -144569, -216807, -289017, -361205, -433377, -505539? -z*3 + 23z*2 - 72334z + 15 What is the q'th term of -7773, -7807, -7841, -7875, -7909, -7943? -34q - 7739 What is the f'th term of 1072, 2065, 3120, 4261, 5512, 6897? 4f*3 + 7f*2 + 944f + 117 What is the b'th term of 115, 572, 1373, 2518, 4007, 5840? 172b2 - 59b + 2 What is the p'th term of -789, 270, 2039, 4518, 7707? 355p2 - 6p - 1138 What is the v'th term of -914950369, -914950368, -914950367, -914950366, -914950365? v - 914950370 What is the s'th term of 2505, 5105, 9439, 15507, 23309, 32845, 44115? 867s2 - s + 1639 What is the u'th term of 31398307, 62796623, 94194939, 125593255? 31398316u - 9 What is the f'th term of -839711, -839633, -839555? 78f - 839789 What is the z'th term of -298165, -594784, -891403, -1188022? -296619z - 1546 What is the o'th term of 4356, 2128, -92, -2304, -4508? 4o2 - 2240o + 6592 What is the c'th term of -1675, -6584, -14753, -26182, -40871? -1630c2 - 19c - 26 What is the p'th term of -1667287, -1667327, -1667367, -1667407, -1667447, -1667487? -40p - 1667247 What is the q'th term of -1040, -863, -552, -107, 472? 67q*2 - 24q - 1083 What is the s'th term of -251, -322, -407, -518, -667, -866, -1127, -1462? -2s3 + 5s*2 - 72s - 182 What is the n'th term of 136223, 136445, 136667, 136889, 137111? 222n + 136001 What is the m'th term of 446524, 893065, 1339606? 446541m - 17 What is the f'th term of 6659, 24674, 54689, 96710, 150743, 216794, 294869, 384974? f*3 + 5994f*2 + 26f + 638 What is the n'th term of -275612, -551223, -826834, -1102445? -275611n - 1 What is the r'th term of 130507581, 261015162, 391522743, 522030324, 652537905? 130507581r What is the o'th term of 30, 125, 436, 1107, 2282? 24o3 - 36o*2 + 35o + 7 What is the i'th term of 352779, 705443, 1058111, 1410783, 1763459, 2116139? 2i2 + 352658i + 119 What is the n'th term of 578759868, 578759869, 578759870, 578759871? n + 578759867 What is the z'th term of 236019, 236662, 237303, 237942, 238579, 239214? -z*2 + 646z + 235374 What is the j'th term of 53471, 53534, 53635, 53774, 53951, 54166, 54419? 19j2 + 6j + 53446 What is the b'th term of -12175, -13092, -14009? -917b - 11258 What is the i'th term of -1086, -853, -214, 1035, 3098, 6179, 10482, 16211? 34i3 - i2 - 2i - 1117 What is the r'th term of 251889, 248708, 243407, 235986, 226445, 214784, 201003? -1060r2 - r + 252950 What is the h'th term of 178974, 357940, 536888, 715812, 894706, 1073564, 1252380, 1431148? -h3 - 3h2 + 178982h - 4 What is the w'th term of 777205, 777200, 777187, 777160, 777113, 777040, 776935? -w*3 + 2w*2 - 4w + 777208 What is the m'th term of -22180, -22285, -22512, -22903, -23500, -24345? -7m3 - 19m2 + m - 22155 What is the z'th term of 144759511, 289519023, 434278537, 579038053, 723797571, 868557091, 1013316613? z2 + 144759509z + 1 What is the b'th term of 6894, 6395, 5564, 4401, 2906? -166b*2 - b + 7061 What is the w'th term of 83491, 83914, 85035, 87196, 90739, 96006, 103339, 113080? 57w*3 + 7w*2 + 3w + 83424 What is the g'th term of -39414, -39367, -39260, -39069, -38770, -38339? 4g3 + 6g*2 + g - 39425 What is the c'th term of 5700475, 5700477, 5700479, 5700481? 2c + 5700473 What is the r'th term of -103334407, -103334408, -103334409, -103334410, -103334411? -r - 103334406 What is the q'th term of -11630632, -23261275, -34891920, -46522567? -q*2 - 11630640q + 9 What is the m'th term of -80785367, -80785369, -80785371, -80785373, -80785375? -2m - 80785365 What is the w'th term of 2217, 8679, 19389, 34347? 2124w*2 + 90w + 3 What is the t'th term of -8785807, -17571615, -26357423, -35143231, -43929039? -8785808t + 1 What is the v'th term of -3629, -7738, -11859, -15998, -20161? -v3 - 4102v + 474 What is the y'th term of -2661666, -2661678, -2661694, -2661714, -2661738, -2661766? -2y2 - 6y - 2661658 What is the q'th term of -3531888, -7063770, -10595652, -14127534, -17659416, -21191298? -3531882q - 6 What is the r'th term of 145, -3265, -10211, -20687, -34687? r3 - 1774r*2 + 1905r + 13 What is the y'th term of 578562, 2314123, 5206740, 9256425, 14463190, 20827047, 28348008? 2y3 + 578516y*2 - y + 45 What is the c'th term of 1354057, 2708110, 4062163, 5416216, 6770269? 1354053c + 4 What is the n'th term of -2471, -2915, -3657, -4697, -6035, -7671? -149n2 + 3n - 2325 What is the y'th term of -66557, -133118, -199679, -266240? -66561y + 4 What is the g'th term of 2608915, 2608950, 2608985, 2609020, 2609055, 2609090? 35g + 2608880 What is the f'th term of -1049, -2253, -3551, -4937, -6405? f*3 - 53f*2 - 1052f + 55 What is the a'th term of -6893, -13849, -20939, -28235, -35809, -43733, -52079? -12a3 + 5a*2 - 6887a + 1 What is the t'th term of -374856, -749939, -1125028, -1500123, -1875224, -2250331? -3t2 - 375074t + 221 What is the b'th term of -326076, -652157, -978246, -1304343, -1630448, -1956561? -4b2 - 326069b - 3 What is the i'th term of -122855629, -122855630, -122855631, -122855632? -i - 122855628 What is the t'th term of 587, 644, 611, 446, 107, -448, -1261? -7t3 - 3t*2 + 115t + 482 What is the a'th term of 349225, 348490, 347273, 345580, 343417, 340790, 337705? a*3 - 247a*2 - a + 349472 What is the x'th term of 8026, 32677, 73964, 131887, 206446? 8318x*2 - 303x + 11 What is the f'th term of 6682, 6519, 6252, 5881, 5406, 4827? -52f2 - 7f + 6741 What is the x'th term of 51569, 55755, 59941, 64127, 68313? 4186x + 47383 What is the x'th term of -41605, -83236, -124867? -41631x + 26 What is the u'th term of -759652, -1519305, -2278958? -759653u + 1 What is the l'th term of -2238820, -4477637, -6716454, -8955271? -2238817l - 3 What is the m'th term of 259821, 519629, 779437, 1039245, 1299053? 259808*m + 13 What i	{ "pile_set_name": "DM Mathematics" }
4). -6 Suppose 3l + b = 2b + 443, 3b - 435 = -3l. Let h be 6(l/90 - 12/90). Let z(p) = -hp - 12p2 - 13 + 20p*2 - 3p*3 + 4p*3. Calculate z(-9). -13 Let r(j) = -j - 2. Let z be r(-2). Let c = -597 - -614. Let h(y) = -3y - 39 + 3y2 + 3y + c + y - 4y2. Determine h(z). -22 Let o be (-2)/9 + (-280)/(-45). Suppose 5d + s = 7, 9 = 3s + 3. Let y(z) = -4z*2 - 5z + 2. Let c(u) = u*2. Let b(w) = dy(w) + 5c(w). Calculate b(o). 8 Let h be (1166/265)/(2/55). Let a = 117 - h. Let v(j) = j3 + 4j2 + j + 3. Give v(a). -1 Let l(z) = z3 + 8z2 + 9. Let h be l(-8). Let v(g) be the first derivative of g3/3 - 11g*2/2 + 4g + 2423. What is v(h)? -14 Let z(w) be the first derivative of -w*3/3 - 3w*2 + 14w + 10. Let c be z(-6). Let k be (3/2)/((-7)/c). Let n(s) = -3s - 1. Calculate n(k). 8 Let w(f) = -2f - 28. Let x be 1524/138 + (-13)/299. Calculate w(x). -50 Let f(c) = -85 - 11c + 121 + 0c - 32. What is f(-1)? 15 Let y(t) = -3t + 1. Let d be y(3). Let c(b) = -14b - 9. Let o(a) = 13a + 3 + 13a - 9 - 35a. Let u(h) = do(h) + 5c(h). What is u(-2)? -1 Let x(q) = 11q*2 + 2q + 29. Let p(s) = -s - 8 + 10s2 - 6 - 15s*2. Suppose -3d - 8 = 10. Let b(u) = dx(u) - 13p(u). Give b(0). 8 Let z(v) = -v - 8. Let b be z(-9). Let p(d) = 87d + 17. Let y(o) = 42o + 7. Let q(c) = 2p(c) - 5y(c). Give q(b). -37 Let w(x) = x*3 - 14x*2 - 3x - 1. Let p be 13/5 + 4332/380. What is w(p)? -43 Let k(w) = -3w3 + 4w*2 - 2w + 3. Let y(n) = -n*3 + n - 1. Suppose 8f + 4f = -12. Let m(t) = fk(t) + 2y(t). Let a be 2 + 3 + -5 + 4. Determine m(a). 11 Let o(g) = -26g - 14. Let z(b) = 45b + 28. Let m(k) = -43k - 218. Let i be m(-5). Let u(y) = iz(y) - 5o(y). Give u(-4). 6 Let q(j) = -267j + 5879. Let x be q(22). Let d(o) = -2 + 5o*2 + 2o*3 + 6 - 3o*3 - o - 3. Calculate d(x). -4 Suppose -571 = 3r - 4q - 5720, 0 = 3r - q - 5146. Let m(z) = z*3 - r + 1714 + 0z*3. Give m(0). -1 Suppose -5b - 4f = -3, -4b + 21f - 12 = 17f. Let r(i) = 29i3 + i2 + 2i + 1. Determine r(b). -29 Let z(f) = -f*2 + 15f - 23. Let s be z(14). Let i(a) = 3a - 8. Let l(g) = -14g + 34. Let h(n) = si(n) - 2l(n). Calculate h(-8). -4 Let g(d) be the first derivative of -5d2 + 19d - 7324. What is g(6)? -41 Let d(g) = g*2 + 9g - 7. Suppose 4q = 4m + 7q + 20, 3m + 5q + 15 = 0. Calculate d(m). -27 Let w(k) be the third derivative of -k5/20 + k4/2 + k3 + 20k*2 + 2k + 33. Determine w(7). -57 Let f(s) = 27s3 + 5s*2 + 6s + 8. Let x(c) = 23c3 + 4c*2 + 5c + 7. Let w(y) = 6f(y) - 7x(y). Determine w(-2). -3 Suppose -4f + 15 = -67r + 48r, -2f = r + 3. Let s(y) = y*2 + 1. Let u(t) = 25t*2 + 35. Let j(k) = -175s(k) + 5u(k). Determine j(f). -50 Suppose -c - 6d - 12 = 0, 104d - 103d - 9 = -2c. Let k(s) = -s2 - s + 23. Calculate k(c). -19 Suppose -3t = -8t + 200. Let s(p) = -3p + 22 + 24 - t. Give s(4). -6 Suppose -2i = 8v - 5v - 32, 4i + 2v - 80 = 0. Suppose 0 = is + 9s. Let h(m) = -2m*2 - m + 8. Calculate h(s). 8 Let n be 58/(-100) + 76/40. Let o(z) be the first derivative of nz2 - 11 + 1/3z*3 + 6z. Calculate o(-4). 10 Let i(v) = -v + 61. Let l be i(54). Let d(w) = 4w - 10. Let g(q) = -q + 3. Let c(k) = lg(k) + 2d(k). What is c(6)? 7 Suppose 3y - 5y = -j - 157, 3y = -5j + 203. Let g(r) = -4 - 73r + yr + 8. Determine g(-4). -8 Let v(s) = 2s*2 + 3s + 14. Suppose -14d - 12d = 3d + 116. What is v(d)? 34 Let y = 67 - 64. Let v(o) = -3o*3 - 8o*2 - 8o - 4. Let l(d) = -4d3 - 9d*2 - 11d - 4. Let z(p) = 4l(p) - 5v(p). Determine z(y). 1 Let d = -6 - 20. Let i = d + 34. Let p(m) = -41 - 37 + 77 - im. What is p(-1)? 7 Let g = 280 - 277. Let m(i) = 45i*2 + 6i*3 + 1 - 50i*2 - 7i*g + 10i + 0i3. What is m(-7)? 29 Let w(o) = o3 + 11o*2 + 13o + 4. Let y be (0 + (-10)/(-4))/(-6 + 322/56). Give w(y). -26 Let h(w) = -13w + 0 + 1 - 5w - 6w + 4w*2 - 69w + 94w. Let k(f) = f3 + 3f*2 - 5f - 1. Let a be k(-4). Suppose -2 = aj - j. Give h(j). 4 Let l(z) = -z2 - 2z + 3. Let g = -197 - -221. Let s be (-30)/(-4)g/36. What is l(s)? -32 Let f(z) = 2 + 1 + 3 - 6z - z*2. Let b be -5 + 1 - (-24 + 22). Let c be ((-6)/5)/(b/(-10)). What is f(c)? 6 Suppose -2o = -0b + 4b, -2 = 2b. Let l(v) = 10v*2 - 4v - 16vo - 6 + 7v*2 - v. Calculate l(7). 8 Let k = 5 + -9. Let u(j) be the first derivative of -2j*3/3 - 3j - 45603. Determine u(k). -35 Let w(s) be the third derivative of -2s3 - 5/12s*4 + 5 + 2s*2 - 1/120s*6 + 0s - 3/20s5. Calculate w(-8). 4 Let o(k) be the third derivative of 211k*2 - 1/24k*4 + 0 + 0k + 4/3k3. Determine o(8). 0 Let d(s) = s3 - 4s*2 + s - 1. Let r = -106 + 106. Let t(i) = 26i - 27i2 + 6i*3 + r - 6i3 - 54 - i3. Let z be t(-28). Calculate d(z). -7 Let h(g) = -5g2 + 28g + 9. Let a(r) = 3r2 - 13r - 2. Let f(z) = 2a(z) + h(z). Calculate f(5). 40 Let q = 44 + -43. Suppose -2c - 3b = q, 12c - 17c + 4b = -9. Let l(o) = -o. What is l(c)? -1 Let q(o) be the first derivative of 4o2 + 20o + 1535. What is q(-3)? -4 Let q(k) be the second derivative of -k4/12 + k3/2 + 6k2 + k - 232. Calculate q(0). 12 Suppose -11h + 824 + 30 = 50h. Let m(r) = -r3 + 15r*2 - 14r + 12. Give m(h). 12 Let z(w) = w - 14. Let a(r) = r - 7. Let k(o) = 2a(o) - z(o). Let y = -413 - -401. Calculate k(y). -12 Let s(k) be the third derivative of -k4/24 + k3/2 + 21k*2. Let c(w) = -58w - 346. Let n be c(-6). Calculate s(n). 1 Let r(w) = -25w - 13. Let f(q) = -70q - 40. Let s(c) = -6f(c) + 17r(c). Let y(v) = 22v - 75. Let x(p) = 26s(p) + 6y(p). Determine x(-20). 4 Let k(b) = -21b - 318. Suppose -751 = -148u - 2971. Give k(u). -3 Let a be 3 - (-3 - 3/(-1)). Let o(d) = d3 - 27d*2 + d - 22. Let g be o(27). Let u(n) = 11n*3 + 5n*3 + 1 - 4n + gn2 - 17n*3. Determine u(a). 7 Let c(x) = 3 - x + 0x + 0 - x*2. Suppose -10s = 369 + 1. Let p be s/(-74) - (-2)/(-4). Give c(p). 3 Suppose -351y + 671y + 7128 = -472y. Let t(g) = -8g - 73. Give t(y). -1 Let g(t) = -t*2 + 9t + 4. Suppose -5b = -b + 2o - 12, o = -3b + 9. Suppose 4n - 55 = -0n + bf, 0 = -2n - 4f. Determine g(n). -6 Let x(c) = -c - 52. Let k be (-30)/4 - (1/2)/(-112 + 111). Calculate x(k). -45 Suppose -4t - 12 = 0, 3i - 25t + 22t = 72. Let n be -6 - ((-10)/(-15))/((-2)/i). Let f(o) = -12o3 - o2 + o - 1. What is f(n)? -13 Let z = 152 + -261. Let b = z - -116. Let s(m) = -4m + 4m - 5m - b + 3m. Calculate s(-6). 5 Let w(t) = t + 2. Suppose -2s + 4r = -30 + 338, -580 = 4s + 4r. Let k = s - -145. Determine w(k). -1 Let u(t) be the third derivative of -t6/120 - 23t*5/60 + 5t*3/3 + 5105t*2. Calculate u(-23). 10 Let d = 4 - 9. Let c(v) = 3v + 5. Let l(u) = 3u - 3u - u + 1 - 4. Let r(x) = dl(x) - 2c(x). What is r(6)? -1 Let y(w) be the third derivative of -w*5/15 + 13w*4/8 + 15w*3/2 + 397w*2. Give y(11). -10 Suppose 4y = 3u - 84 - 10, 5y + 5 = 0. Let g(b) = 53 + b - 27 - u. What is g(3)? -1 Let b = 1068 + -1068. Suppose 4u + 3y - 5 = 0, -4u - 8 = -y - 1. Let z(s) = -s. Let p(o) = -o2 - 5o - 24. Let g(k) = up(k) + 6z(k). Give g(b). 24 Let c(o) be the first derivative of 3o2/2 - 16o - 1948. Calculate c(0). -16 Let m = -15 + 16. Let b be m + (3 - 0) + -1. Let d(s) = -2 - 3 + 2 - bs2 - s3 + 0s - s. Determine d(-3). 0 Let h(b) = b*2 + 16b + 44. Suppose -2r = -14r - 2r - 98. Give h(r). -19 Suppose 0 = 2v - 10, -2w - w + 5v - 49 = 0. Let g(c) = -c*2 + c + 65. What is g(w)? -7 Let m(d) = 8d - 67. Let f(x) = 7x - 69. Let b(q) = 3f(q) - 4m(q). Let y be b(5). Let w(v) = -v3 + 5v*2 + 2v + 4. Calculate w(y). -20 Let h(v) = 4v2 + 3v. Let z(l) = -l*3 - 17l*2 - 12l - 1. Let r(n) = -9h(n) - 2z(n). Let w be -1 + (-5)/((-45)/27). What is r(w)? 4 Let p = -639 + 639. Let c(z) be the third derivative of 0 + 0z - 10z*2 - 11/6z*3 + 1/24z4. Calculate c(p). -11 Let c = 353 - 346. Let x(j) = -j3 + 6j2 - j + 59. Determine x(c). 3 Let n(i) = -2i*3 + 13i - 3331i2 + 22i + 9979i2 - 3330i*2 + 45 - 3335i2. Determine n(-10). -5 Let y(x) = x2 + 4x - 2. Let q(w) = 2w*2 - 26w - 8. Let b be q(0). Give y(b). 30 Let w(b) = -10*b + 2.	{ "pile_set_name": "DM Mathematics" }
. What is the biggest value in o, -4, 91.19? 91.19 Let i = -5.01 + 5. Let q = -501.88 - -500.88. Which is the third biggest value? (a) -1/3 (b) q (c) i b Let z = 67 + -62. Let t = -5.05 - -0.05. Let l = -0.0398 + 0.3398. Which is the fourth smallest value? (a) l (b) z (c) t (d) -0.5 b Let n be (-6)/(-21) + (-5)/(-7). Let m = -1884.084 - -1884. What is the third biggest value in n, m, -0.4? -0.4 Let m = -9427/13 - -735. Which is the biggest value? (a) m (b) -4 (c) 1 (d) -3 a Let h = 4594 - 4599. Which is the smallest value? (a) h (b) -2 (c) 356 (d) 4 a Let y = 17894 + -17898. Which is the third biggest value? (a) y (b) 36 (c) 154 a Let y = -141.47 + 141.17. What is the third biggest value in 1, -1710, y, -2? -2 Let r = -7.311 - 307.989. Let i = 316 + r. Let f = -0.06 - -0.36. Which is the second biggest value? (a) -4 (b) f (c) 2/17 (d) i b Let x = 193 + -364. Let u = -1199/7 - x. Let h = 1.8 + -1.7. Which is the fourth smallest value? (a) u (b) -2/9 (c) h (d) 4 d Let k = 1210/1761 - 12/587. What is the third biggest value in k, 10, 0, -1/3? 0 Let t = 0.2596 + -0.1596. Let f be (-93)/33 + 13. Let o be 2/40 + 1/5. What is the second biggest value in f, t, -5, o? f Let k = -10 + -1. Let y = 7.758 + -7.818. Which is the second smallest value? (a) k (b) y (c) 0.2 (d) 0 b Suppose 0 = 15x - 9x - 204. Let o be -1 - ((-4)/x + (-909)/1377). What is the second smallest value in -5, o, 0.2? o Let m = 12448 - 12429. Which is the third smallest value? (a) 5/6 (b) -22 (c) -2/5 (d) m (e) 3 a Let g be -2 - (3 + (-65)/15). Let l = 1.3 + 28.7. Let i = l + -29.6. Which is the third biggest value? (a) -3/4 (b) g (c) 3/4 (d) i b Let r = 4.117 + -3.917. Let t be 2/3-23. Which is the biggest value? (a) r (b) t (c) -5/2 a Let z = 2409/2 + -1167. Let h = z + -38. Which is the smallest value? (a) 1/3 (b) h (c) 1/2 (d) -0.1 b Let v = 4515 + -4519. Which is the biggest value? (a) v (b) -9 (c) -3.2 c Let o = 5.02 + -5. Let w = -26747.2 - -26747. Which is the third biggest value? (a) 4 (b) o (c) w c Let m be 8/6 - ((-43)/(-3) + -287 + 281). Let z be (-1)/6(-1)/(-2). What is the smallest value in z, -4/7, 0, m? m Let d = 682.7 + -683.2. Let h = -10 + 9.72. Let n = h - 0.02. Which is the third smallest value? (a) d (b) -37 (c) n c Let k = 1080 + -195478/181. Let n = k + 527/1448. What is the third biggest value in -0.63, -6/5, n? -6/5 Let t = -10/8953 - 17816/80577. What is the second biggest value in 5.69, -2, t? t Let f = 62 + -72. Let y be 1303/(((-114)/f)/(-3)). Let v = y + 343. What is the fourth smallest value in v, -12, 0.4, -0.3? 0.4 Let w = 18627 - 18630. Let f be 18/1510/(-2). Let t be 1 + (f/(-9) - 1). Which is the third smallest value? (a) w (b) t (c) -1/8 b Let h = -2340 + 2240. What is the biggest value in 0, -2/5, h, 0.3? 0.3 Let o = -359.6 + 359.4. Which is the smallest value? (a) o (b) -4/7 (c) 51 b Let l = -50693 - -50694. Let r be (-2)/(-4) + 2/(-12). What is the biggest value in r, l, -6? l Let i = 10.825 - 7.825. Which is the biggest value? (a) 5 (b) 2.5 (c) i (d) -10 a Let g be (-10)/2(-2)/(-15). Let w be -24 - ((-63)/693 + 96/(-33)). Which is the third smallest value? (a) 3 (b) w (c) g (d) 0 d Let v = -891 + 889.8. Let p = -12 - -14. Which is the smallest value? (a) p (b) v (c) -0.5 (d) -0.1 b Let n = -8.3 - -3.3. Let r be 6 + (-11)/(220/108). Which is the third biggest value? (a) n (b) -10 (c) r b Suppose -5137 = -7f - 5158. Let v = -0.54 - -0.6. Let k be (1 - 0)(-2)/(-2). Which is the second biggest value? (a) f (b) k (c) v c Let s = 272.067 + -272. Let m = -0.167 + s. Let j be 0(1 + 0)-1. What is the smallest value in m, j, -0.5, 0.4? -0.5 Let x = 0.2 + -0.15. Let h = -91.9 + -4.1. Let f = h - -96. Which is the third smallest value? (a) -2 (b) 3/5 (c) f (d) x d Let i = -68 - -478/7. Let x = -24 - -23.7. Which is the fourth biggest value? (a) 3 (b) x (c) i (d) 1/4 b Suppose -10 = 3l + 5. Let j = 5/6 + -23/42. Which is the second biggest value? (a) l (b) -0.09 (c) 0.5 (d) j d Let u = 15090.23 - 15204. Let h = -114 - u. What is the biggest value in h, -5, 2/19? 2/19 Let x be (-179)/8 + 812 + -790. Which is the third biggest value? (a) -57 (b) x (c) 9 a Let y = 9368 - 9367. Let z = 8.8 - 12.8. Which is the third biggest value? (a) 57 (b) z (c) 2/5 (d) y c Let c = 75.07 + -67.07. Let k = -3 - -2.9. What is the smallest value in -4, c, k? -4 Let j be 6/2 + 40/(-24). Let p = -22 + 13.2. Let o = p - -9. Which is the third biggest value? (a) o (b) j (c) 3 a Let u = -3/146 + -1597/438. Let t = 21 + -13.8. Let k = t + -7. What is the fourth smallest value in -5, 4, u, k? 4 Let w = -4 - 2. Let p be ((-4)/(-6))/(w/2). Let v(z) = -17429z + 34859. Let k be v(2). Which is the second biggest value? (a) p (b) k (c) 0.4 (d) -4/9 c Suppose f + 9 = 12. Suppose -fu = 2q - 4u - 2, -2 = 3q + u. Let l = -607/63 + 69/7. Which is the fourth smallest value? (a) 2/5 (b) l (c) -4 (d) q a Let v = -61/159 - 15/53. Let n = -1.63 - -1.65. What is the third biggest value in n, 2, v? v Let r = -8/161 + 22/161. What is the biggest value in -0.3, r, 2/9, 1/11? 2/9 Let r be 520/(-252) + 6/(-378)-7. Let t = -10 + 52/5. What is the fourth biggest value in t, r, 0.068, -4? -4 Let m = -0.11 - 0.326. Let k = m - 0.054. Let u = 0.79 + k. Which is the second biggest value? (a) 0.5 (b) 1 (c) 0.4 (d) u a Let n = 41 + -59. Let d = n - -28. Let x = -11 + d. Which is the third smallest value? (a) x (b) 2 (c) -1/3 b Let v = -1.018 + 409.018. Let p = v + -408.04. What is the third smallest value in 3, p, 1? 3 Let s = -35.099 - -35.099. Which is the third smallest value? (a) 2192 (b) s (c) -2 a Let k = -298 - -295. Let h = 6 - 6. What is the fourth smallest value in k, h, 2, 5? 5 Let p = -463/33 - -6085/429. What is the biggest value in 46.46, -1, p? 46.46 Let i = 53.782 + -0.782. Which is the second biggest value? (a) 0 (b) i (c) -0.4 a Let v = -0.7056 - -0.8056. Let r = -2.01 - -0.01. Which is the fourth biggest value? (a) -5 (b) v (c) r (d) -2/3 a Let z = 1101 - 1102. Let t be 6 + (-5 - -8) - (0 - -1). What is the smallest value in z, 2, t, -0.3? z Suppose 3c + 4t = 23, 0c = 5c - 8t - 9. What is the smallest value in c, -31/5, -0.05? -31/5 Let b = 128787/7 + -18398. Let p(u) = -u*2 - 4u. Let c be (3/(-5))/((-3)/(-15)). Let g be p(c). What is the biggest value in -3, b, g? g Suppose 21 = j + 5f, 0 = -5j - 3f - 82 + 77. Suppose 3w + 6 + 0 = 0. Let n = -22 + 24. What is the biggest value in n, j, w? n Let m = 36256/7 + -5179. Which is the fourth biggest value? (a) -1 (b) 62 (c) -1/3 (d) 4 (e) m c Let x be (3/6)/((-1)/6). Let k = -6577.7 - -6578. Let n = -11 - -15. Which is the second biggest value? (a) n (b) x (c) k (d) -0.2 c Suppose 2x - 4x - 16 = 0. Let h = -298.943 - -302.943. What is the second smallest value in h, x, 1/5? 1/5 Let r = -10637 - -10636.8. What is the fifth biggest value in r, 0.4, -7, -0.1, -5? -7 Let p = -22061.2 - -22061. What is the smallest value in p, 6/13, 55, -1, -2/15? -1 Let m = -4.28 - -0.51. Let g = -1.77 - m. Which is the second smallest value? (a) g (b) -18 (c) 4/5 c Let d = -621 - -579.2. Let n = d - -36.8. What is the smallest value in n, -10, 3, 0.2? -10 Let i = 0.15 + 87.85. Let s = i + -87.89. Which is the smallest value? (a) 2 (b) 3/5 (c) s c Suppose 58 = 4f + 2t + 50, -3f + 4t = -17. What is the smallest value in f, 3/262, -1/7? -1/7 Let k = -4960 - -6379. What is the third smallest value in -0.5, -4, -2, k? -0.5 Let d = 1 + -1.05. Let g = -35.3 - -209.3. Let f = g - 174.2. Which is the smallest value? (a) f (b) -0.3 (c) d b Let j = 9289/23260 - -3/4652. Which is the fourth biggest value? (a) 4 (b) -0.3 (c) 13 (d) -10 (e) j b Let y = 83 - 84. Let w = 2 - 2. Let g = -38/27 + 2/27. What is the second biggest value in w, y, g? y Let z = 10.9 + -0.9. Let s = 121135214 + -883439114354/7293. Let g = 2/663 - s. What is the third biggest value in g, z, -2, -2/3? -2/3 Let v = 140.5 + -142. Suppose 35 = 4k + 3w, 3k - w - 25 = -3w. Suppose 0 = -a - k, -3l - 15 - 6 = 3a. What is the second smallest value in l, -2/7, v? v Let k be (64/14)/(-2) - (5 - -25)/(-15). Which is the smallest	{ "pile_set_name": "DM Mathematics" }
ext: -13202, -51975, -116606, -207101, -323466, -465707? -633830 What is next in 3445, 13733, 30889, 54919, 85829, 123625, 168313, 219899? 278389 What is next in 778761, 778763, 778765, 778767? 778769 What comes next: 459, 1863, 4207, 7491, 11715, 16879, 22983? 30027 What is next in -11907, -11934, -11995, -12102, -12267? -12502 What is next in 10086, 10083, 10080, 10077, 10074, 10071? 10068 What is the next term in -1062589, -1062588, -1062587? -1062586 What is the next term in 61937, 123873, 185809? 247745 What comes next: 1043, 1179, 1555, 2291, 3507, 5323, 7859, 11235? 15571 What is next in -20713, -20736, -20759? -20782 What comes next: 1036, 228, -1118, -3002, -5424, -8384? -11882 What comes next: 14110, 28220, 42330, 56440? 70550 What is the next term in 7209, 7185, 7153, 7113, 7065? 7009 What is the next term in 759, 1267, 1527, 1539, 1303, 819, 87? -893 What is next in 404, 1531, 3378, 5945? 9232 What is next in 30170, 60362, 90556, 120752, 150950? 181150 What is next in 1006835, 1006836, 1006837, 1006838, 1006839? 1006840 What is the next term in -230712, -461410, -692108, -922806? -1153504 What is next in 3038, 24081, 81134, 192203, 375294? 648413 What is the next term in 2923, 2898, 2889, 2902, 2943? 3018 What is the next term in -22683, -90737, -204159, -362949, -567107? -816633 What is the next term in -303, -488, -673, -858, -1043, -1228? -1413 What comes next: -224, -324, -428, -536, -648, -764, -884? -1008 What comes next: -16, -33, -48, -61, -72? -81 What is the next term in -8472, -16957, -25442, -33927, -42412, -50897? -59382 What is the next term in -25115, -25104, -25093? -25082 What is the next term in -179111, -358194, -537275, -716354? -895431 What is the next term in 679, 1247, 1815? 2383 What is the next term in -43, 512, 1063, 1610? 2153 What is the next term in -152, -343, -640, -1097, -1768, -2707? -3968 What comes next: 2377455, 2377456, 2377457? 2377458 What comes next: -2741, -2740, -2739, -2738? -2737 What is next in 183, 436, 683, 924, 1159, 1388, 1611? 1828 What comes next: 56, 17, -26, -73? -124 What is the next term in 2416895, 2416896, 2416897, 2416898, 2416899? 2416900 What comes next: 66, 306, 692, 1212, 1854? 2606 What is the next term in 3644, 3665, 3706, 3773, 3872, 4009, 4190, 4421? 4708 What is the next term in 13821, 13624, 13429, 13236, 13045, 12856, 12669? 12484 What comes next: -336669, -336670, -336671? -336672 What comes next: -76878, -76865, -76842, -76809, -76766, -76713, -76650? -76577 What is next in 371, 2977, 10043, 23795, 46459, 80261, 127427, 190183? 270755 What is next in -13639, -27201, -40763, -54325, -67887, -81449? -95011 What comes next: -3021, -12076, -27165, -48288, -75445, -108636, -147861? -193120 What is the next term in 879, 1365, 1859, 2361, 2871, 3389? 3915 What comes next: -4, 147, 588, 1463, 2916? 5091 What is next in 207348, 207347, 207346, 207345? 207344 What is the next term in 999317, 1998635, 2997953, 3997271? 4996589 What is next in -257, -760, -2127, -4790, -9181, -15732, -24875? -37042 What is the next term in 190, 237, 266, 277? 270 What comes next: 12629, 12633, 12639, 12647, 12657? 12669 What comes next: -1658, -1793, -1928, -2063, -2198? -2333 What is the next term in -1190, -4396, -9738, -17216, -26830, -38580, -52466? -68488 What is the next term in -30764, -123125, -277060, -492569, -769652, -1108309? -1508540 What is the next term in -8276, -8281, -8286, -8285, -8272, -8241, -8186? -8101 What comes next: 194, 175, 142, 95, 34, -41? -130 What is next in 50, -60, -244, -502? -834 What comes next: 20295, 20323, 20351, 20379, 20407? 20435 What is the next term in 7544, 7771, 7998, 8225, 8452? 8679 What is the next term in 55, 145, 243, 355, 487, 645, 835? 1063 What is the next term in 58, 176, 340, 562, 854? 1228 What is the next term in 9735, 19467, 29199, 38931, 48663? 58395 What comes next: -34914, -69810, -104706, -139602, -174498, -209394? -244290 What is the next term in 683, 961, 1431, 2099, 2971, 4053, 5351? 6871 What is the next term in -59012, -59024, -59040, -59060, -59084, -59112? -59144 What is the next term in -243, -836, -1779, -3066, -4691, -6648, -8931, -11534? -14451 What comes next: 157, 171, 191, 217? 249 What is next in -25759, -25755, -25751, -25747, -25743? -25739 What is next in 630, 627, 624, 621, 618, 615? 612 What is next in -32048, -128191, -288430, -512765, -801196, -1153723, -1570346? -2051065 What is the next term in -3744, -7463, -11160, -14835, -18488, -22119? -25728 What comes next: 805, 6524, 22057, 52312, 102197, 176620, 280489, 418712? 596197 What comes next: 27137, 54281, 81431, 108593, 135773, 162977, 190211? 217481 What is the next term in -355, -793, -1231, -1669, -2107, -2545? -2983 What is next in 45, 283, 935, 2211, 4321, 7475, 11883, 17755? 25301 What is next in -659, 111, 2313, 5947, 11013? 17511 What comes next: 1217, 678, -221, -1480, -3099, -5078? -7417 What comes next: 149276, 149274, 149272, 149270, 149268? 149266 What comes next: -100, -85, -62, -31, 8, 55, 110? 173 What is the next term in -3146, -3093, -3076, -3101, -3174, -3301, -3488? -3741 What comes next: -839437, -1678877, -2518313, -3357745? -4197173 What is next in 15806, 15800, 15784, 15758, 15722, 15676? 15620 What is next in -1908, -1919, -1940, -1971? -2012 What is the next term in 104, 167, 242, 335, 452, 599, 782? 1007 What is next in -12925, -12924, -12923, -12922? -12921 What is next in 368456, 368457, 368458? 368459 What is next in -94, -16, 62, 140, 218? 296 What is the next term in 657, 2646, 5961, 10602, 16569, 23862? 32481 What comes next: -119378, -119382, -119388, -119396? -119406 What comes next: 1382, 5721, 12958, 23093, 36126, 52057? 70886 What is the next term in -861, -1810, -2785, -3798, -4861, -5986? -7185 What is next in -1478, -3182, -4898, -6632, -8390, -10178, -12002? -13868 What is the next term in -39980, -79965, -119950, -159935? -199920 What is next in -4448, -4894, -5338, -5780, -6220? -6658 What comes next: -324, -650, -984, -1326? -1676 What is the next term in 1673, 1653, 1597, 1487, 1305? 1033 What comes next: 512, 2168, 4972, 8924, 14024, 20272? 27668 What comes next: -4445, -4456, -4479, -4520, -4585, -4680, -4811, -4984? -5205 What is the next term in 261, 173, 69, -57, -211? -399 What comes next: 6100, 12254, 18394, 24520, 30632, 36730, 42814? 48884 What comes next: -325, -591, -1039, -1663, -2457, -3415, -4531? -5799 What comes next: -400, -673, -934, -1177, -1396, -1585? -1738 What is next in -85, 294, 925, 1808, 2943? 4330 What is next in -231757, -463527, -695283, -927019, -1158729, -1390407, -1622047? -1853643 What is the next term in 2325, 2324, 2327, 2334? 2345 What comes next: 113, 373, 807, 1415, 2197, 3153, 4283? 5587 What is the next term in -271, -1048, -2333, -4114, -6379, -9116, -12313? -15958 What is next in -84, -17, 74, 195, 352, 551, 798? 1099 What is the next term in 856, 743, 616, 469, 296, 91? -152 What comes next: 23467, 23465, 23457, 23443, 23423? 23397 What is next in 28388, 113618, 255660, 454508, 710156, 1022598, 1391828, 1817840? 2300628 What comes next: -21093, -42182, -63271, -84366, -105473, -126598, -147747, -168926? -190141 What is next in -678, -1311, -1984, -2715, -3522? -4423 What comes next: -648, -1652, -2656, -3660, -4664, -5668? -6672 What is the next term in -2606734, -2606732, -2606730, -2606728? -2606726 What comes next: -1515, -1517, -1519? -1521 What is next in -4059, -4035, -4011, -3987, -3963, -3939? -3915 What is the next term in 574, 2315, 5216, 9277, 14498, 20879? 28420 What comes next: -1046, -1726, -2414, -3110, -3814? -4526 What comes next: -310, -595, -880, -1165? -1450 What is next in 29633, 29779, 29911, 30023, 30109, 30163, 30179, 30151? 30073 What comes next: -340, -617, -882, -1129, -1352, -1545? -1702 What is next in 283299, 283303, 283309, 283317, 283327, 283339? 283353 What is the next term in -254, -1007, -2262, -4019, -6278, -9039? -12302 What is the next term in 579, 1491, 2717, 4251, 6087, 8219, 10641? 13347 What is next in -18597, -37196, -55795, -74394, -92993, -111592? -130191 What is next in 3044, 6081, 9118, 12155, 15192, 18229? 21266 What comes next: 3265, 4723, 6181, 7639, 9097, 10555? 12013 What is the next term in -31857, -31872, -	{ "pile_set_name": "DM Mathematics" }
first derivative of 8 + 4v + 1/6v*3 + 0v*2. Let h(i) be the first derivative of o(i). Give f(h(m)). -3m Let w(d) = -d*2 + 7d. Let a(b) = b. Let i(c) = -14a(c) + 2w(c). Let l(p) be the second derivative of p*4/3 - 3p + 17. Give i(l(m)). -32m4 Let m(t) = t2. Let s = -22 - -10. Let n be (-7)/(s/9 - -1). Let l(g) = 15g + 14g - ng. Give l(m(r)). 8r2 Let q(f) = -355f. Let k(y) = -143y. Determine k(q(i)). 50765i Let d(f) = 4f2. Let u(t) = -1116t + 11. What is u(d(c))? -4464c2 + 11 Let s(t) = -3t*2. Let z(d) = -2d + 2. Let v be z(0). Let b(g) = -vg - g + 6g. What is s(b(r))? -27r2 Let z(u) = u2. Suppose -m = -4p - 11, 5p + 1 = 4m - 32. Let j(n) = -mn + 2n + 16 + 11 + 3n. What is j(z(f))? -2f*2 + 27 Let o(s) = -1797s*2 + 2s - 221. Let j(n) = 3n. What is j(o(l))? -5391l*2 + 6l - 663 Let z(d) = -14d2 + 2d. Let g(s) = -39153s2. What is z(g(f))? -21461403726f*4 - 78306f*2 Let q(d) = -22d. Let w(t) = -98t - 105t + 205t. Calculate w(q(a)). -44a Let l(o) = -50 + 18 + 2o + 15 + 17. Let a(y) = 23y + 1. Calculate l(a(f)). 46f + 2 Let w(v) be the first derivative of 9 + 0v + 5/2v2. Let k(t) = 8t. Give w(k(n)). 40n Let x(w) be the first derivative of 81w*2/2 - 966. Let t(n) = -2n + 3 - 3. Give x(t(a)). -162a Let w(a) = -40a + 30. Let o(n) = -n + 1. Let q(y) = -30o(y) + w(y). Let i(p) = 0 - 2 + 2 - 2p. Determine q(i(m)). 20m Let h(b) = 3b*2. Let i(v) = 8796v. Calculate i(h(x)). 26388x2 Suppose 38l + 23 = 39l. Let q(u) = -11u*2 - 11u*2 + lu*2. Let v(d) = -2d + 26. What is q(v(c))? 4c2 - 104c + 676 Let p(x) = 425x2 - 852x*2 + 430x*2 + 12x. Let t(l) = -26l. Determine p(t(o)). 2028o*2 - 312o Let j(z) = 3z2. Let b(x) = 1293x. Give b(j(s)). 3879s2 Let i(g) = -g. Let b(x) = -65x + 5. Let r(f) = 2f - 1. Let h(t) = b(t) + 5r(t). Calculate i(h(c)). 55c Let j(a) = -43a*2. Suppose -11 = -3k - 2. Let v(d) = -1662 + kd + 1662. What is v(j(h))? -129h*2 Let j(w) = 10w*2. Let h(a) = 18110a + 1. Give h(j(y)). 181100y2 + 1 Let p(s) = 15s*2. Let r(d) be the first derivative of 2d*3/3 + 19d - 10. Let y(t) be the first derivative of r(t). Determine y(p(x)). 60x2 Let x(f) = -f3 - 9f*2 - 12f - 29. Let c be x(-8). Let h(p) = 10p + 17p + 6p + cp. Let o(v) = -2v2. What is h(o(k))? -72k*2 Let v(h) = 0h*2 - 4h*2 + 6h*2 - 3h*2. Suppose -49 + 59 = 5b. Let w(l) = 9l2 + 3l*b - 4l*2 - 4l*2. Determine v(w(j)). -16j4 Let y(w) = -w3 - w*2 + w + 13. Let v be y(0). Let d(z) = 11z + 13. Let r(q) = 5q + 6. Let j(m) = vr(m) - 6d(m). Let k(b) = -6b. Give k(j(x)). 6x Let p(z) = -2z*2. Let f(b) be the second derivative of 31b*4/6 - 5b - 1. Calculate f(p(x)). 248x4 Let v(h) be the first derivative of h2/2 + 109. Let g(i) = -11i. Give g(v(f)). -11f Let w(k) be the third derivative of -k5/6 + 3k*2. Let r(p) = 63 - 25 - 38 + 4p. What is r(w(u))? -40u2 Let x(c) = 24c*2 + c. Let s(p) = -5p - 6. Let h(f) = 6f + 8. Let b(u) = -3h(u) - 4s(u). Calculate x(b(r)). 96r*2 + 2r Let n(k) = 21k - 13k - 39k. Let w(u) = -4u. Determine n(w(z)). 124z Let i(o) = -3o. Let a(j) = 2j2 - 649j. What is i(a(y))? -6y2 + 1947y Let m(x) = -2x - 1. Let z(o) = 17o + 7. Let c(g) = -7m(g) - z(g). Let v(t) = -5t + 2. Give v(c(r)). 15r + 2 Let x(o) = -2o*2. Let h(v) = -515127v. What is h(x(r))? 1030254r2 Let p(y) = 3y + 18. Let l(t) = 9t2 - 33t. What is p(l(f))? 27f2 - 99f + 18 Let n(x) = -1. Let a(q) = 15q - 3. Let p(t) = -7t + 1. Let c(m) = -4a(m) - 9p(m). Let r(i) = -c(i) - 3n(i). Let d(l) = l + l - 5l. What is d(r(w))? 9w Let f(k) = -k + k + 2k. Let x(j) be the third derivative of -j*6/60 - 13j*3/6 - 7j*2. Let c(d) be the first derivative of x(d). What is f(c(w))? -12w*2 Let m(f) = 87f*2. Let a(b) = 156b*2 + 1 - 1 - 78b*2 - 71b*2. Determine a(m(k)). 52983k*4 Let m(p) = -p. Suppose 3k + 39 = 6k. Let g(w) = k + 15w + 5w - 13. Give m(g(o)). -20o Let x(i) = -9i2 + 33i. Let g(f) = -f*2 + 4f. Let q(d) = -33g(d) + 4x(d). Let w(t) be the third derivative of t5/30 + t2. Determine w(q(k)). 18k4 Let g(p) = p2 - 7p. Let q(d) = -28d2 + 51d*2 - 27d*2. What is g(q(c))? 16c*4 + 28c*2 Let d(x) = -37x - 18x + 119 - 119. Let g(h) = h. What is g(d(l))? -55l Let q(o) = -156o. Let x(w) = -434w*2 + 1. Give q(x(r)). 67704r*2 - 156 Let f(t) = 14t. Let q(h) = -348h + 5. Determine f(q(v)). -4872v + 70 Suppose x = -4x + 10. Let a(i) = i - i - 3ix. Let q(b) = b2 + 3b - 3. Let s(p) = p2 + 2p - 2. Let l(u) = -2q(u) + 3s(u). Give a(l(f)). -3f4 Let c(g) = 2g + 2. Let i(t) = t. Let l(a) = c(a) - 3i(a). Let w(j) = 1. Let x(u) = -2l(u) + 4w(u). Let d(o) = -o2 + 5o. Calculate x(d(q)). -2q2 + 10q Let t(v) be the second derivative of -7v3/3 + 455v. Let c(f) = -7f2. Give c(t(u)). -1372u*2 Let g(b) = -2b*2 + 8b + 8. Let n(r) = r + 1. Let m(o) = g(o) - 8n(o). Let i(h) = 2h2 - 5. Let a(k) = k2 - 6. Let l(c) = -5a(c) + 6i(c). Give l(m(d)). 28d4 Let o(y) = -43y - 47 - 43 + 90. Let x(d) = -8d. Determine x(o(r)). 344r Let h(v) = -8v. Let c(x) = -17x*2 - 2x + 30. What is h(c(f))? 136f2 + 16f - 240 Let g(t) = 7t2. Let j(u) = -75u - 8. Let i(a) = -76a - 10. Let f(b) = 4i(b) - 5j(b). What is g(f(s))? 35287s*2 Let x(t) = -3t. Let o(m) = 8m - 1. Let n(w) = -2w*2 - 8w - 12. Let l(g) = -n(g) - o(g). Determine l(x(p)). 18p2 + 13 Let y = 0 - -4. Let p(s) = -10s - 5. Let l(d) = 9d + 4. Let t(x) = yp(x) + 5l(x). Let q(i) = -3i - 15 - 72 + 5i + 87. Determine t(q(r)). 10r Let w(j) = 11j2 + 2. Let n(z) = 9z*2 + 16z. Determine n(w(f)). 1089f4 + 572f*2 + 68 Let u(j) = -23j*2 + 5 - 5 + 21j*2. Suppose 0 = -q + 8 - 3. Let l(c) = -4c*2 + qc2 + c2. Calculate u(l(k)). -8k4 Let y(n) = -3n. Let w(r) be the second derivative of -r*6/240 - 3r*4/4 - r. Let p(o) be the third derivative of w(o). Calculate y(p(c)). 9c Let d(g) = 8g2. Suppose -14 = -2a + 5y, 6y - 4 = -5a + 3y. Let o(k) = 3 - 5 + 3k2 + a. Give d(o(u)). 72u4 Let f(z) be the first derivative of z6/60 + z3/3 + 2. Let v(b) be the third derivative of f(b). Let o(d) = d2. What is v(o(j))? 6j4 Let g(n) = -n + 44827. Let s(z) = 2z*2. Calculate s(g(t)). 2t*2 - 179308t + 4018919858 Let g(s) = -18s2. Let w(x) = -4968x. Determine g(w(q)). -444258432q2 Let w(m) = 3m - 7. Let b(f) = -31f - 28f - 2 + 60f. Let o(k) = 14b(k) - 4w(k). Let n(z) = 28z. What is n(o(j))? 56j Let c(y) = -101y + 186y - 93y. Let v(n) = 2n - 15. Calculate c(v(t)). -16t + 120 Let o(u) = -32 - 2u2 + 27 + 6u*2 - 5u. Let k = 4 + 2. Let v(w) = -5w2 + 6w + 6. Let q(n) = ko(n) + 5v(n). Let m(b) = 3b. Give q(m(a)). -9a*2 Let n(g) = 88g. Let b(i) be the second derivative of -i*4/12 - 144i. What is n(b(l))? -88l2 Let q(p) be the third derivative of -7p*5/30 - 2p*2. Let b = 5 + 4. Let k(g) = -g - 9g + bg. Determine q(k(t)). -14t*2 Let j(f) = -2f*2 + 3f - 3. Let x(u) = -6u2 + 10u - 10. Let g(d) = 10j(d) - 3x(d). Let s(n) = 844 - 844 - 7n2. Give s(g(q)). -28q*4 Let n(y) = -7y*2. Let m(h) be the third derivative of 23h*5/60 + 258h*2. Determine n(m(k)). -3703k*4 Let u(l) = 2786l*2. Let f(b) = -5b. What is u(f(q))? 69650q2 Suppose -1 - 2 = q. Let t(c) = 3c + 4. Let s(j) = 2j + 3. Let k(l) = qt(l) + 4s(l). Let a(n) = -3n*2. Calculate a(k(i)). -3i*2 Let d(p) = -978p. Let g(k) = -133k2 + 135k*2 + k - 4k + 3k. Give g(d(u)). 1912968u*2 Let q(u) = -24u. Let i(a) = -32a2 - 7a. Determine q(i(g)). 768g2 + 168g Suppose -4v - 4 = -6v - 2i, -2v + 12 = 4i. Let z(y) = -1. Let d(b) = -b - 3. Let a(c) = vd(c) + 6z(c). Let h(u) = -6u*2. Determine h(a(p)). -24p*2 Let b(j) = 4 + 0 + j - 4. Let n(r) = -r + 5r - 3r. What is b(n(l))? l Let l = -411 - -411. Let w(d) be the second derivative of 0d*3 + 0d*2 + l - 7d + 1/4d4. Let z(h) = -5h*2. What is w(z(a))? 75a*4 Let s(d) = 24d + 2. Let a(k) = 4808k2. Give s(a(q)). 115392q*2 + 2 Let x(v) be the first derivative of 1/3v*3 - 30 + 0v + 0v2. Let c(o) = -6o*2 - 2o*2 - 2o**2. C	{ "pile_set_name": "DM Mathematics" }
(-12)/18 - (-6)/9. Suppose -4r + 1185 - 373 = f. What are the prime factors of r? 7, 29 Let l = -368 + 520. Let z = 2 - l. Let v = -81 - z. List the prime factors of v. 3, 23 Let h be (14/(-21))/((-2)/(-15)). Let c(v) = -4v - 9. Let j be c(h). Suppose b = f + 5, f + j = 2b + 2. What are the prime factors of b? 2 Suppose -2q + 8q = 720. Suppose 269 = 3o - 2f, -5o + 324 = f - q. List the prime factors of o. 89 Let b(f) = -f*2 + 7f + 13. Let q be b(8). Suppose s = 2k - 6, 0 = qk - s - 9 - 9. What are the prime factors of (0 - (1 - k)) + 25? 2, 7 Let f(t) = t*3 - 21t*2 + 10t - 48. What are the prime factors of f(21)? 2, 3 Let x = 26 - 24. What are the prime factors of x(-1 + (-237)/(-6))? 7, 11 Suppose -9z + 10z - 4 = 0. Suppose -zk + 2p + 940 = 0, 3p = k + 5p - 230. What are the prime factors of k? 2, 3, 13 Suppose 0 = -2z - 2n, 2n + 14 = 5z - 14. Let p be 1/z + (-186)/(-24). Suppose -p + 86 = 3t. What are the prime factors of t? 2, 13 Let y be 4/(-8)16-41. Let w = -206 + y. Suppose 4x = 3c - w, -x = -5c - 4x + 155. What are the prime factors of c? 2, 17 Suppose -5h + 8 = -h. What are the prime factors of 101 + 3 + -1 - h/2? 2, 3, 17 Suppose 0 = -2f, -f = -5s - 2f + 205. Let u = -34 + s. List the prime factors of u. 7 Suppose -10l - 10368 = -16l. List the prime factors of l. 2, 3 Let l = 18 - 11. Let f = l + 25. What are the prime factors of f? 2 What are the prime factors of 588 + (1 - 3) + -3? 11, 53 Let q = -22 + 12. Let b = 56 + -39. List the prime factors of q/(-20) + b/2. 3 Let x(g) = 7g2 + 22g + 1 - 24g + 3g*2. List the prime factors of x(1). 3 Let g be ((-28)/10)/(3/90). Let y = -52 - g. What are the prime factors of y? 2 Let u = -6114 + 8728. What are the prime factors of u? 2, 1307 Let d = 20 + -20. Suppose dy + 156 = 6y. What are the prime factors of y? 2, 13 Suppose 0 = -i + 3q + 113, 0 = -10i + 6i - 2q + 466. What are the prime factors of i? 2, 29 Suppose 2403 = 2c - 4009. List the prime factors of c. 2, 7, 229 Let m = 799 - 604. What are the prime factors of m? 3, 5, 13 Let t = -48 - -50. Suppose -tv - 2v = -40. List the prime factors of v. 2, 5 Suppose -r = 31 - 3. Let b be r/618/(-7). Let c = b + -3. List the prime factors of c. 3 Let k be 38/8 - (-3)/(-4). Suppose 125 = s + ks. Let i = s - 15. List the prime factors of i. 2, 5 Let d(s) = 40s2 - 13s + 42. What are the prime factors of d(4)? 2, 3, 5, 7 Let z = 19 - 16. What are the prime factors of 2/z84 + -2? 2, 3 Let w(j) = 3j*2 - 23j + 31. Let y(n) = -2n2 + 12n - 16. Let t(k) = -3w(k) - 5y(k). List the prime factors of t(-12). 23 Let t = -368 + 229. Let k = -78 - t. List the prime factors of -1(-1 - 0 - k). 2, 31 Suppose 4r - 2a - 659 = 649, 0 = -4a - 8. Suppose 10q = 8q + r. List the prime factors of q. 163 Suppose -4f = -35 + 7. Suppose -3l + 2t = 4, 3l + 3t - f = 8l. What are the prime factors of (76/(-2))/l + 2? 3, 7 Let s(t) = t*2 - 5t + 3. Let q be s(3). Let f be 577 + (q/1)/3. List the prime factors of 3/(-7) - f/(-21). 3 Suppose 0 = 3n - 5b + 43, 46 + 25 = -3n - 2b. Let k be (2/5)/(n/(-210)). Suppose km - 16 = -0m. What are the prime factors of m? 2 Let s(f) = -f + 1. Let n(g) = -8g + 11. Let c(w) = n(w) - 4s(w). What are the prime factors of c(-3)? 19 Let t(m) = m*3 - 12m*2 + 2m - 7. Suppose -2k - 3q - 12 = -4k, 0 = k - q - 8. What are the prime factors of t(k)? 17 Suppose -2m - 2b + 12 = -6b, 4b + 8 = m. Suppose mz + 6 = 14. Suppose 39 = zp - 27. What are the prime factors of p? 3, 11 Let x be (-14)/35 - 1544/(-10). Let a = x + -79. List the prime factors of a. 3, 5 Suppose -4i = i - 15. Suppose -2z = iz - 25, 2j - 5z = 55. List the prime factors of j. 2, 5 Suppose 315 = 7w - 476. List the prime factors of w. 113 Suppose 0 = 2k - 5c - 70, -4c - 15 = 1. What are the prime factors of k? 5 Suppose -18s = -7942 - 38138. List the prime factors of s. 2, 5 Let a = 282 - 55. List the prime factors of a. 227 Suppose 6k - 29729 = -6329. What are the prime factors of k? 2, 3, 5, 13 What are the prime factors of (375/(-6))/((-6)/12)? 5 Suppose -a - 2 = 0, 4u = -a + 10347 + 1243. What are the prime factors of u? 2, 3, 7, 23 Let f be (-3)/(4/(-18 + -2)). Suppose -3i = -174 - f. What are the prime factors of i? 3, 7 Let u(z) = -58z + 3. What are the prime factors of u(-2)? 7, 17 Let q = -57 + 55. Let h(o) = -229o2 - o. Let y be h(-1). What are the prime factors of y/(-12) - (q - 0)? 3, 7 Let h be (6/9)/(56/(-12) + 4). List the prime factors of 26 + (1 - h/(-1)) + 1. 3 What are the prime factors of -5 - -1222 - (10 + -7)? 2, 607 Let v(g) = -g3 - 10g2 - g - 5. Let h be v(-10). Let r = 22 - h. What are the prime factors of r? 17 Suppose 5o - 12200 = 26k - 22k, -2o = 3k - 4880. What are the prime factors of o? 2, 5, 61 Suppose -22s - 23733 = -76071. List the prime factors of s. 3, 13, 61 Let c = 2060 + 1684. Suppose 9f - c = -3f. List the prime factors of f. 2, 3, 13 Suppose z = d + 14, -3z - 47 = 3d - 5z. Let p be -1(-2)/(-2)d. Let t = 3 + p. List the prime factors of t. 2, 11 Let q = 8561 + -4929. List the prime factors of q. 2, 227 Suppose -4p + 5j + 0 = 23, -j - 8 = p. Let g(v) = -9v - 25. What are the prime factors of g(p)? 2, 19 Suppose 0 = -16l + 14493 + 4403. List the prime factors of l. 1181 Let n = -946 + 1353. What are the prime factors of n? 11, 37 Let q be 256/(-3)3-1. Suppose 0 = 6k - 344 - q. List the prime factors of k. 2, 5 Suppose 0y + y = 2. Let a(j) = 14j - 9j*2 + 2j*3 - 3j*3 + 19j*y - 7. What are the prime factors of a(11)? 2, 13 Let g(d) = 52d + 42. List the prime factors of g(11). 2, 307 Let z be (-5 - -17)(-2)/4. Let l be z/15(-1 + -4). What are the prime factors of 260/12 + l/6? 2, 11 Let d(t) = -13t - 13 - 14t + 17t. What are the prime factors of d(-7)? 3, 19 Let t(y) = y3 + 52y*2 - 59y + 49. List the prime factors of t(-53). 367 Suppose -15m + 4620 = -7590. List the prime factors of m. 2, 11, 37 Suppose 0 = -4l - 5v + 644, 5l - 13v + 15v - 805 = 0. What are the prime factors of l? 7, 23 Let x = -16 + 21. Suppose -4m - y + 391 = 0, 2m + 111 - 284 = -xy. List the prime factors of m. 3, 11 Let d be (525/14)/5 - 3/2. Let z = -27 - -53. Let h = d + z. What are the prime factors of h? 2 Suppose -8t + 3025 = -4t - x, -x = 3t - 2274. List the prime factors of t. 757 Let h be (-3 - -10)/1 - 0. Suppose 0 = -5d - 3s - 7 + 26, h = d - s. Suppose -33 = -dm + 2. List the prime factors of m. 7 Suppose 3x - 5w + 3 + 1 = 0, 0 = -2x - w + 6. Let p(y) = 3y3 - 3y*2 + 3y - 3. List the prime factors of p(x). 3, 5 List the prime factors of (-1 + 392)((-25)/5 - -7). 2, 17, 23 Let t(n) = -n + 2 + 0 - 1. Suppose 3m - 21 = 3q, 16m - 19m + 5 = 5q. List the prime factors of t(q). 3 Let d be 1-471-1. Let s be 12/42 - (3 - (-523)/(-7)). Let b = s - d. What are the prime factors of b? 5 Let c = 31 + 238. List the prime factors of c. 269 Let c = 156 - 140. Suppose 2j - 4 = 0, 2a - 178 = 3j - c. List the prime factors of a. 2, 3, 7 Let i = -1160 + 2684. List the prime factors of i. 2, 3, 127 What are the prime factors of -936/(-15)35? 2, 3, 7 Suppose 3v + v = 2q + 8, q = -v + 5. Suppose 0u + 3u + 2c - 324 = 0, -6 = -qc. What are the prime factors of u? 2, 53 Suppose 64x - 23241 = 3x. List the prime factors of x. 3, 127 Let x = -45 - -79. Let s = 17 + x. List the prime factors of s. 3, 17 Suppose 0 = 2t + t - 4k - 2681, 5t + k - 4453 = 0. What are the prime factors of t? 3, 11 Suppose 8 = 4k - 8. Suppose -5v = l + 18, 3l - 26 = -2l + kv. Suppose lw = w + 37. List the prime factors of w. 37 Suppose k + 126 = -3z, 3z + z = 2k + 222. Let o = -77 - k. Suppose -7u = -3u - o. List the prime factors of u. 2, 5 What are the prime factors of 280 + 12/10105/63? 2, 3, 47 Let b = -1035 + 1296. List the prime factors of b. 3, 29 Suppose c + 0a + 5a - 3 = 0, -2c - 3a + 41 = 0. Suppose 4h - 12 - 16 = 4d, c = -4d + 5h. Let t(g) = -g2 - 9g + 9. What are the prime factors of t(d)? 23 Let u be -10 + -6(-7)/14. Suppose -10 = 2o + 3y, -2o = -3o + 5y + 21. List the prime factors of ((-14)/u)/(o/22). 2, 11 Let u(c) = c*3 - 3c*2 + 4c - 2. Let l be u(2). List the pri	{ "pile_set_name": "DM Mathematics" }
True Let b(t) = -t2 - t + 2. Let p be b(-2). Let y(s) = s3 + 3s - 4 + 3 + ps + 7s2. Is y(-5) a prime number? False Let n be 2/(((-16)/18)/4). Let q(k) = -k3 - 8k*2 + 8k + 13. Let o be q(n). Let c = o - 0. Is c a prime number? False Let u(w) be the second derivative of -w + 7/2w2 + 2/3w*3 + 7/12w*4 + 0 + 1/20w*5. Is u(-5) composite? False Let t be (-1)/4 + (-314)/(-8). Let j = 22 + t. Suppose -7 = -2o + j. Is o a prime number? False Let f(b) = -b - 6. Let p be f(-8). Suppose 5l - 40 = -7r + 2r, 32 = 4r - pl. Suppose 2u - r + 20 = 2j, 3u - 32 = -2j. Is j a composite number? True Suppose -5g = -0 - 10. Suppose 0w - gr = -w + 62, 0 = -4w - 5r + 235. Suppose -k + w = 3k. Is k composite? True Suppose -f + 32 = 2n + 3f, -5f = 4n - 55. Is (-4)/10 - (-894)/n a composite number? False Suppose -5w = 22 - 7, -5g = -3w - 24. Suppose 4n - 81 = -2v + 3, 4n + gv - 88 = 0. Is n composite? False Let p(a) = 52a - 1. Let k be p(1). Suppose -k = -j - 0d + d, -5j = 5d - 275. Is j a prime number? True Let q be (-1)/(1/(-562)) + 0. Let s = q + -315. Is s composite? True Let g = -6 + 6. Let c(k) = k + 89. Is c(g) prime? True Let k = 82 - 8. Let r = 27 + -24. Suppose rx - x = k. Is x prime? True Let p(q) be the second derivative of q5/20 + q4/2 + 3q*2/2 - 3q. Let o be p(-6). Suppose 0 = 3l - or - r - 73, 2l - 43 = -3r. Is l a prime number? True Let t = -19 + 11. Let a = 3 + t. Let n(b) = b*3 + 5b*2 - 4b - 5. Is n(a) a prime number? False Let v = 307 - 210. Let l = v + 52. Is l prime? True Let n(v) = -v*2 - 8v - 3. Let u be n(-7). Let i be 2/u + (-22)/(-4). Let s(m) = -m*3 + 8m*2 - 2m - 3. Is s(i) composite? True Suppose 0 = -8c + 3c + 1270. Suppose -b + c - 99 = 0. Is b prime? False Let s = 4 - 5. Is 12 + -1 + (-2)/s a composite number? False Let p(k) be the second derivative of k5/5 + k4/4 + k*3/3 + 2k*2 + 2k. Is p(3) a prime number? False Let g be ((-4)/(-6))/(2/12). Suppose gx - 18 = -2. Is x a prime number? False Let z(x) = -x3 - 7x*2 - 6x + 7. Let w be z(-6). Let c = w - -3. Suppose 4p = 8, -4i + 5p + c + 128 = 0. Is i a composite number? False Let c be 1/4 - (-12)/16. Is (c/1)/((-1)/(-53)) prime? True Let w(a) = 5a*2 + 9a + 6. Is w(8) prime? False Let o(q) = -7q + 4q*2 - 13q2 - q3 - q. Let t be o(-8). Suppose 2x + tx = -5d + 175, -5x - 2d + 427 = 0. Is x composite? True Suppose -2a - 4n = 4 + 14, -3n = -5a + 7. Let d be 1/(2 + a)3. Suppose di - 161 = 52. Is i composite? False Suppose -5f = 5x - 1875, 0x + 2x - 746 = -f. Is x composite? True Suppose 0u = -2u + 356. Suppose 376 = -5s - 89. Let p = u + s. Is p a prime number? False Let t(u) = u*3 - 4u*2 + 3u + 1. Suppose 7d - 6d = 5. Let s be t(d). Suppose -4k - s = -p, -3p + 0p = 2k - 151. Is p prime? False Let t(i) = i*3 - 6i*2 - 3i + 9. Is t(8) prime? True Let g = 858 + -479. Is g a prime number? True Let t = 380 + -198. Let x = 41 + t. Is x composite? False Let m be 5 + 0 - 12/6. Let v(r) = 3r2 - 3r + 3. Is v(m) prime? False Let h = 12 + -8. Suppose 278 = 4o + 2z, ho + 2z - 209 = o. Is o a prime number? False Is (24/(-9))/(-8)483 prime? False Suppose 0a - 3a + 921 = 0. Let l = a + -186. Let p = l + -74. Is p prime? True Let o be (-4)/(16/(-12)) + -2. Is 12/30(54 + o) prime? False Let z be ((-2)/2)/((-5)/15). Suppose -zr + 4r - 191 = 0. Is r prime? True Suppose -n - 1 = -2b, 0 = b + 4n - n - 11. Suppose 678 = bv - 952. Is v composite? True Let r(l) = 207l*2 + 16l - 5. Is r(4) composite? False Suppose d - 6d + 955 = 0. Is d a prime number? True Suppose -v + 7 = 4q, 5q + v - 6 = -3v. Suppose w - 337 = -qt - 136, 0 = -4w + t + 813. Is w composite? True Suppose 0 = 5p + g - 586, -p + 110 = 2g - 0g. Is p a composite number? True Let l(z) = 118z*2 + 3z + 3. Is l(4) prime? False Let l = -7 + 16. Let y = l + 6. Is y a prime number? False Let l = 6 + -2. Suppose -lu = 1 - 77. Is u prime? True Let y(a) be the first derivative of -a2/2 + 21a + 6. Is y(0) composite? True Is 16/56 + (-20070)/(-21) + -1 composite? True Suppose -2g = 5o - 9200, -5o + 3853 + 5332 = -g. Is o a composite number? True Let l(d) = 115d3 + d2 - 1. Let n(t) = t*3 + 3t*2 + 2t + 1. Let s be n(-2). Let o be l(s). Suppose 5x - 6i = -i + o, -3x = -i - 73. Is x composite? True Let a be (2/4)/(2/84). Let q = -7 + a. Is q a prime number? False Suppose 3s - 10 = -4r + 119, 5r + 24 = s. Let t be 8/(-6)12/8. Let n = t + s. Is n a prime number? True Let h(j) = j3 + 2j*2 - 1. Let o be h(1). Let u = 4 - o. Suppose -5c + 91 = 2v, uv + c + 3c - 86 = 0. Is v prime? False Let w be (-5 + 2)(4 - 3). Let f be (1/w)/(1/(-6)). Suppose fm + 5k = 90, -3k - k - 159 = -5m. Is m a prime number? False Let f(k) = 0 - 3 + 5k - 5k + 10k. Let o(h) = -h3 + 5h*2 + 4. Let i be o(5). Is f(i) composite? False Let v(o) = 2o*2 + 10o + 7. Is v(9) a composite number? True Let u(d) = 4d2 + 9d. Let x(q) = -q - 2. Let f be x(5). Is u(f) composite? True Is 2 + -1 + 2 + 1 + 249 prime? False Let v = 458 - 327. Is v composite? False Let m(l) = 31l - l + 23l + 3 - 5. Is m(11) a composite number? True Let d = -66 - -353. Is d a prime number? False Suppose 4h + 4m - 96 = -0m, -2h + 50 = m. Let k = -5 + 2. Let n = k + h. Is n a prime number? True Suppose 6 = -5n + 4n. Let p(w) = -8w - 8. Let z be p(n). Suppose 5i - 235 = z. Is i prime? False Suppose o + 6 = -x, 5o - 3x = -0x - 14. Let f(l) = -l3 - 3l*2 - 4l - 6. Is f(o) a prime number? False Let o = -19 + 7. Suppose -114 = 4z + 3p, -p = 2z - 0p + 56. Is (-1)/((o/z)/(-4)) prime? False Let c(j) = -j*3 - 10j*2 - 6j - 6. Let a be c(-7). Is 2 + -2 - a/3 a composite number? False Suppose 0v - 5k = -v + 23, 8 = 4v + k. Is -2 + (-1 + 71 - v) a prime number? False Let t be (8/(-12))/(3/18). Let w = -1 - t. Is w a composite number? False Let d be (3 - 2) + 4 - 0. Let f(q) = 54q - 7. Is f(d) composite? False Is 2759(3 + 6/(-3)) a prime number? False Let w be 5/1(-48)/(-20). Suppose -2u - w = -2s, 2u + u = -s - 10. Suppose 5p - sx = 79 - 13, -4p + 4x = -48. Is p prime? False Let j(t) = t + 2. Let n be j(0). Let i = 4 + 0. Suppose -5d + 89 = 4b, id + 29 - 75 = -nb. Is b a composite number? True Let v = 2054 - -2261. Is v prime? False Let y(x) = 0 - x2 - 7x - 5 + 25x. Is y(12) prime? True Let g = 200 - 119. Suppose m - g = 2m. Let i = -46 - m. Is i a composite number? True Let g = -11 - -6. Let i = g - -228. Is i prime? True Let m = 0 - 2. Let z(c) = 34c - 12. Let d be z(-7). Is m/(-12) - d/12 prime? False Suppose -3k + 92 = k. Is k composite? False Suppose -5z - 831 = -13416. Is z composite? True Let t(m) = 5m - 4m - 1 - 2m - m*2 + 3m*2. Let p be t(-1). Suppose -5d + 3j = -3d - 53, -pj + 130 = 4d. Is d prime? True Let v = -1 - 0. Let r be ((-1 - 1)v)/1. Is r - (1 - 8)5 a composite number? False Let r(c) = -2c3 - c2 + 2c + 2. Let n be 10/(-35) + (-12)/7. Let f be r(n). Let z = 75 - f. Is z a composite number? True Suppose 3w + 3f - 1326 = 0, 2 = 2f + 10. Is w a composite number? True Let s = 21 - 15. Suppose -3m + s = -99. Is m a composite number? True Let u = -7 - -11. Let t(z) = z*3 - 4z*2 + 1. Let m be t(u). Suppose -19 = -a - 3f, -2a + 3a - 3f - m = 0. Is a a composite number? True Let x = 1440 + 95. Is x composite? True Suppose -2u + l + 23 = 0, -4l + 68 - 16 = 4u. Let t = u + 107. Let x = t + -30. Is x a prime number? True Let k(u) = -22u3 - 2u*2 - 2u - 1. Let o = -2 - -1. Is k(o) a composite number? True Let m = -6 - -6. Suppose 2f = -m + 4. Suppose c + 2d - 23 = 7d, 0 = c + fd + 5. Is c composite? False Let l = 18 - 12. Let n(z) = 5z2 - z + 89 + 2z - lz2. Is n(0) a composite number? False Let p = -119 + 202. Is p prime? True Suppose 25 = 5z, 3w = 5z - 3z + 32. Let h = w - 1. Is h a prime number? True Suppose 4s + s = 5965. Is s composite? False Suppose -4d = 4w - 12, -w - w = -5d - 6. Suppose 2h - 1174 = -dh. Is h a composite number? False Let a = -3 - -18. Let k = a + -10. Suppose kd = d + 1060. Is d prime? False Is 1/(0 - 3)-942 prime? False Suppose 450 = -s + 3s - 4z, -2s = 4*z - 434. Suppose k - s = -60. Is k a prime num	{ "pile_set_name": "DM Mathematics" }
a/(-30) + 1/(-3). 70 Suppose -4r - 23 = 2i - 137, 2r - i = 63. What is the lowest common multiple of r and 48? 240 Let x be (8 + 0)(-5)/((-20)/(-48)). Suppose a + 36 = 4a. What is the lowest common multiple of a and ((-2)/4)/(4/x)1? 12 Let l = -140/237 + 6689/23226. What is the common denominator of l and 4/21? 294 Let i be (34/(-51))/(2/9). Calculate the lowest common multiple of 9 and 1 - i - (-2 - 1). 63 Let a = 29 - 40. Let r = a + 15. Let f = 6 + 6. Calculate the smallest common multiple of r and f. 12 Suppose -778 = p + l, -2l - 2 = -l. What is the least common multiple of p/(-88) + 2/11 and 7? 63 Calculate the common denominator of -115/102 and ((-10)/42)/(0 + (-72)/(-84)). 306 Let o = 61 + 70. Let u = -109 + o. Calculate the least common multiple of 14 and u. 154 Let k = 7085719/27190 + -1/5438. Let b = -15901/60 + k. What is the common denominator of b and 69/44? 132 Let a(f) = -117f - 122f + 5 + 240f. Let d be -2 + 2 - (-4)/(-1). What is the lowest common multiple of a(d) and 10? 10 Let y = 58537/84660 + -53/415. What is the common denominator of 113/42 and y? 1428 Let q(c) = -5c3 - 14c*2 - 2c + 1. Suppose 2b - 4b = -k + 10, k - 5b + 5 = 0. What is the least common multiple of q(-3) and k? 80 Let n = -437106856475/3612 + 121015191. Let j = 179 + -23068/129. Let d = j + n. What is the common denominator of d and -91/20? 140 Suppose 4o - 219 = -f + 3o, 0 = 4f + 2o - 874. What is the least common multiple of f and 3? 654 Find the common denominator of ((-496)/72)/((-14)/31) and 17/24. 168 Let t be 3558/(-9) + (-2)/3. Let f = -2249 + t. Let c = 52877/20 + f. What is the common denominator of c and -9/2? 20 Let u = 559 - 92231/165. Calculate the common denominator of -44/3 and u. 165 Let t = -6221/4 + 1532. What is the common denominator of -16/119 and t? 476 Let h = -31408/105 + 2071/7. Calculate the common denominator of h and 23/48. 240 Let j = 2 - -8. Find the common denominator of 28/9 and -6 + 5 + j/(-14). 63 Let f(m) = -m*3 + 12m*2 + 28m + 1. Calculate the lowest common multiple of f(14) and 8. 8 Let v(t) = -t*3 + 9t*2 + 25t + 3. Let z be v(11). Find the common denominator of (-118)/z + 10 + -7 and -19/4. 36 Suppose f + 18 = -4t + 4f, -2f - 5 = 3t. Calculate the common denominator of ((5/20)/(33/(-1170)))/t and 87/8. 88 Let a(f) = 4f3 + f. Let x be a(1). Let u(h) = h - 7. Let y be u(-7). Calculate the common denominator of (2/y)/(x/265) and 51/5. 35 Suppose -2l + 7 = -5z + 44, 5z - 53 = -2l. What is the common denominator of z/6 + 202/(-96) and 71/8? 48 Calculate the common denominator of ((-2)/171)/((5488/984)/7) and 51/10. 27930 Let w(l) = l - 8. Let i be w(-4). Let t be (-838)/(-7)i/288. Let s = -11/42 + t. What is the common denominator of -43/11 and s? 44 Suppose -i - 13435 = -12s + 8s, -5i - 16775 = -5s. Calculate the lowest common multiple of 46 and 6/(-57) - s/(-152). 506 Suppose 2i + 2y = -3y + 107, 3i + 4y - 178 = 0. Calculate the lowest common multiple of i and 16. 528 Calculate the common denominator of 31/128 and (-95)/152 - (0 - -4). 128 Let b(c) = 7c - 6. Let l be b(-6). Calculate the common denominator of -3/10 and ((-280)/l)/((-8)/(-3)). 80 Suppose -3x = -5g - 6, 4g + 6x - x = 10. Let r be g/4 - -12. Let d = r + 10. Calculate the least common multiple of d and 8. 24 Let r = -1836 - -1861. Let v(o) = -o3 + 5o*2 - o - 3. What is the lowest common multiple of r and v(4)? 225 Suppose 0 = s + 5d + 9, -4d + 12 = s - 6d. What is the lowest common multiple of 6 and s? 6 Let u = 59 + -31. Find the common denominator of (150/(-9))/(u/5) and 2 + (1 + 1)/40. 420 Let a(l) = l*2 + 0l - 3l3 + 4l*3 - 2l + 3l. Let h be a(0). What is the smallest common multiple of 8/(-4)(-5 + h) and 6? 30 Calculate the least common multiple of (-38)/285 - 334/(-30) and 103. 1133 Let q = -5 + 8. Let r be (-4 - -10)1/1. Suppose 0 = -5m + u + 54, -u - 28 - r = -qm. Calculate the lowest common multiple of m and 8. 40 Let o = -1/380 + -15197/1140. Let z be (-1292)/36 + (-2)/(-9). Let h = z - o. What is the common denominator of h and 77/10? 30 Let k = 22 + -20. Calculate the least common multiple of 18 and 1/(-3)(-32 + k). 90 Suppose x = 4o + 5, -4x + 0 + 20 = 5o. Let d(m) = 6m + 2 - 2m - xm. Calculate the least common multiple of d(-2) and 6. 12 Let l = 6 + -11. Find the common denominator of (-7)/35205/4 and 50/(-32)6/l. 8 Let z be 527/3090 - (-2)/(-12). Let s = 13384/1545 + z. Calculate the common denominator of 75/8 and s. 24 What is the common denominator of -7 - 10700/(-952) - (-24)/204 and (-1)/(72/(-10))2? 126 Suppose -2n + 8 + 20 = 0. Let d(s) = 3 + 2s3 + 0s*3 + 7s - 10s - s3 + 3s*2. Calculate the least common multiple of d(-3) and n. 84 Let o = -3815908 - -30412637/8. Let j = o - -14365. Let q = j + -503/16. What is the common denominator of 15/16 and q? 16 Suppose -5h + 25 = 0, -h + 65 = -0a + 4a. Calculate the least common multiple of a and (10 + -5)-1 - -38. 165 Suppose -b - v + 2v = 5, -3b = v - 1. Let m be (b/2)/((-4)/40). Let u(w) = 3w - 5. What is the smallest common multiple of u(m) and 20? 20 Let k(s) = 2s - 18. Let j = 11 - -2. Let t be k(j). Find the common denominator of t/24 + 274/132 and -101/16. 176 Let q be 38268187/80 + (-30)/(-50). Let i = q - 478115. Let z = -238 + i. What is the common denominator of 53/44 and z? 176 Suppose 4t + 0t = 0. Suppose t = -3c - 2c + 25. Suppose -ci + 0i + 35 = 0. Calculate the lowest common multiple of 8 and i. 56 Let d = -41 + 50. Let i(y) be the second derivative of y5/20 - 11y*4/12 + 5y*3/3 + 9y*2/2 - 4y. Calculate the lowest common multiple of d and i(10). 9 What is the smallest common multiple of 7751/92 + 1/(-4) and 12? 84 Let q = -106 - -116. Calculate the lowest common multiple of 11 and q. 110 Let p(s) = 2s - 10. Let r be p(8). Calculate the common denominator of 0 + (2 + 1)/r and -2 - 1/((-3)/(-20)). 6 Let k be (-14)/2 + 4 + 50. Suppose -k = -5c + 3. Calculate the least common multiple of (-49)/(-3) - (-3)/(-9) and c. 80 What is the smallest common multiple of 2140 and (29 - (-8 - -17)) + 0? 2140 Let z(h) = h2. Let i(b) = b3 + 10b2 + b + 11. Let m = -2 + -8. What is the least common multiple of z(-2) and i(m)? 4 Let u(b) = -2b3 - b2 + 5b + 4. Suppose 9n - 4n = 100. Suppose 0 = x - 0 - n. Calculate the smallest common multiple of u(-2) and x. 60 Suppose -h + 26 = -5a, -5a = 19 - 4. Let g = 1 + -1. Suppose g = -5v + 39 + 1. What is the smallest common multiple of v and h? 88 Let j be (-15)/(-75) + 19751/(-55). Let s = 38369/110 + j. What is the common denominator of s and -91/15? 30 Let h(x) be the second derivative of x4/6 - x3/6 - x*2/2 - 7x. Let z be h(-1). What is the smallest common multiple of 18 and ((-18)/(-45))/(z/20)? 36 Let j = 171149/27 + -12679/2. What is the common denominator of 137/24 and j? 216 Let u(m) = 23m2 + m. Let i be u(-1). Find the common denominator of (-8)/16 + (-44)/(-5) and 2/18i/(-2). 90 Let a(t) = 13t - 55. What is the smallest common multiple of a(11) and 232? 2552 Let h(x) be the third derivative of x6/30 + x3/6 + 8x*2. Let u be h(1). Let b = 3 + u. What is the lowest common multiple of 16 and b? 16 Let n be (-7430)/(-264)126/(-380). Let t = 1234154/209 + -5905. Let w = t - n. What is the common denominator of -61/3 and w? 24 Let h be ((-2)/(-3))/((-80)/(-139452)). Let p = 1161 - h. Calculate the common denominator of p and -52/3. 30 Let l(z) = 2z + 7. Let p be l(-5). Let t be 8/(-2)(p + 2). What is the lowest common multiple of 18 and (-318)/(-27) - t/(-18)? 36 Suppose 12h - 11h = 0. Suppose 3l + y - 4y = 18, h = -l + 4y - 6. Calculate the lowest common multiple of 18 and l. 90 Let y = -25 + 29. Suppose -7j + yj = -30. Calculate the smallest common multiple of j and 4((-21)/(-2))/3. 70 Let k(d) = d*2 + 2d - 13. Let i be k(-5). Suppose -5 = 5w, 0 = if - 2w + w - 57. What is the lowest common multiple of f and 11? 308 Let f be ((-100)/(-70))/((-36)/(-160797)). Let t(c) = -c2 + 6361. Let w be t(0). Let p = f - w. Calculate the common denominator of -30/11 and p. 66 Let p = 5503/990 + -46/55. Calculate the common denominator of p and 82/465. 2790 Let b be (-8972)/(-8)(-11098)/(	{ "pile_set_name": "DM Mathematics" }
8. Factor yv3 - 32/7v*2 + 30/7v + 0. 2v(v - 15)(v - 1)/7 Let g(w) be the second derivative of 5w7/2016 - w6/96 - w*4/12 - 21w*2/2 - 46w. Let a(b) be the third derivative of g(b). Factor a(c). 5c(5c - 6)/4 Let r(s) = -146s + 27453. Let t be r(188). What is v in 2/3vt - 10/3v*2 + 2/3v*4 + 8/3v - 10/3v3 + 8/3 = 0? -2, -1, 1, 2 Let x(c) be the second derivative of c5/10 + 21c*4/2 + 734c*3/3 + 672c*2 + 1648c - 2. Find p, given that x(p) = 0. -48, -14, -1 Let y(i) = -86i + 1379. Let x be y(16). Suppose 0a + 4a2 + 0 + 1/3a*x = 0. What is a? -12, 0 Suppose 608/13p*3 + 134/13p - 496/13p2 - 12/13 = 0. What is p? 1/4, 6/19 Let l(b) be the third derivative of b6/240 + 5b*5/12 + 703b2. Factor l(i). i2(i + 50)/2 Let p(u) = -1824u - 7125. Let b(y) = -35y - 137. Let a(h) = 209b(h) - 4p(h). Let f be a(-7). Determine q so that -1/2 - 1/2q*4 + fq + 0q3 + q2 = 0. -1, 1 Let o(q) be the first derivative of 4q*3/3 + 460q*2 + 52900q + 1874. Determine k so that o(k) = 0. -115 Let o be (5285/105 + -15 - 35)26. Factor 16/15d2 - 2/3d*3 + 0 - 8/15d + 2/15do. 2d(d - 2)2(d - 1)/15 Let i(o) = 3o4 - 263o*3 - 634o*2 + 9o + 864. Let a(n) = 2n4 - 258n*3 - 636n*2 + 10n + 864. Let c(t) = -7a(t) + 6i(t). Let c(l) = 0. What is l? -54, -2, 1 Let j(k) = 45k - 5k - 2k2 + 4k - 36 - 14k. Let r(i) = -4i*2 + 29i - 37. Let w(z) = -3j(z) + 2r(z). Factor w(h). -2(h - 1)(h + 17) Let 6q4 - 7q*4 + 1453q*2 - 131072 - 4909q*2 + 100q*3 + 21677q + 23379q = 0. What is q? 4, 32 Solve -3c*4 - 172c*2 + 383c*2 + 88c*3 - 175c*2 - 121c*3 = 0 for c. -12, 0, 1 Let f(k) = -3k - 11. Let u be f(-7). Let b = -107 - -122. Factor -bq2 + 8q*3 + 0q*3 + 11q*3 + uq - 14q3. 5q(q - 2)(q - 1) Let x(v) be the first derivative of -183 - 35v3 - 225/2v*2 + 5/4v*4 - 115v. Solve x(s) = 0 for s. -1, 23 Let l = 203 - 125. Let m = l + -78. Factor 4/5t2 + m + 4/5t. 4t(t + 1)/5 Let k be (-20262)/48 + -1 - -7. Let j = -416 - k. Determine n, given that 0 + jn2 + 3/8n = 0. -3, 0 Let -20o4 - 789o*2 + 136 + 2o*4 - 231o*3 + 8 + 222o - 948o = 0. Calculate o. -8, -3, -2, 1/6 Let v be 2/3 - 5220/(-270). Factor vq + 8q - 13q - 4q + 21q - 4q2. -4q(q - 8) Let u = 18/941 + 3674/4705. Let l(a) be the first derivative of ua*5 + 0a*3 + 0a - 2 + 3/4a4 - 1/4a*2 + 1/4a*6. Suppose l(y) = 0. Calculate y. -1, 0, 1/3 Suppose 27q + 21 - 4/3q2 = 0. Calculate q. -3/4, 21 Determine k, given that 32/13 - 116/13k - 6/13k4 + 44/13k*3 + 46/13k2 = 0. -2, 1/3, 1, 8 Let c(u) be the second derivative of -u6/30 + u5/4 - u4/3 - 127u + 1. Factor c(t). -t2(t - 4)(t - 1) Let p(c) be the third derivative of c5/60 + c4/6 + c3/3 - 6c*2. Let w be p(-4). Determine h, given that -h - 4h - 17hw + 3h = 0. -2/17, 0 Let s be (-5)/(-50)7/238. Let n = s - -677/1020. What is f in 1/2f + n - 7/6f2 = 0? -4/7, 1 Suppose r = d - r, 0 = 4d + 2r - 20. Suppose 4y + c = 14, -4y - 4c = -y - d. Solve 73i2 + 12i*y + 107i*2 - 100i*2 + 32i + 56i3 = 0. -2, -2/3, 0 Solve 3/7a*2 - 51/7a + 216/7 = 0 for a. 8, 9 Determine w, given that 56 + 595w + 97w*2 - 655w - 93w2 = 0. 1, 14 Let u = -793316 - -3966673/5. Factor -18v - u + 3/5v2. 3(v - 31)(v + 1)/5 Suppose 3y - 9 = 0, 17y = -2p + 14y + 181. Let m + 197m*4 + 85m*2 - 392m*4 + 200m*4 - pm + 30 - 35m3 = 0. What is m? 1, 2, 3 Let a(w) be the third derivative of -w8/84 - 2w*7/315 + 11w*6/45 + 4w*5/45 - 20w*4/9 - 95w*2 - 5. Suppose a(t) = 0. What is t? -2, 0, 5/3, 2 Let l(g) = 2704g*2 - 1430g + 196. Let q(z) = 13z. Let p(m) = l(m) - 2q(m). Find a, given that p(a) = 0. 7/26 Let f = -480 - -488. Determine j so that -46j + 50 + 325j - 127j - 194j*2 - fj*3 = 0. -25, -1/4, 1 Let c(p) = -2p*2 - 9p + 1. Let m be c(-4). Suppose 3x = -15, 5x + 10 = -ms - 0x. Factor 42 + 2js - 19 + 10j - 8j2 - 27. 2(j - 2)(j - 1)2 Factor -16/3i*3 - 2/3i*4 - 12i - 14i2 + 0. -2i(i + 2)(i + 3)*2/3 Let p = -1423273 + 2846587/2. Let -pi - 1/2i2 + 21 = 0. What is i? -42, 1 Let o(d) = 3d3 + d2 + 10. Let z(v) = -31v3 - 4990v*2 - 8266800v - 4574296100. Let m(t) = -10o(t) - z(t). Factor m(x). (x + 1660)3 Let w = 1534/1479 + 929906/10353. Determine p so that 128/7p*4 - 528/7p*2 + wp*3 + 6/7p*5 + 0 - 242/7p = 0. -11, -1/3, 0, 1 Suppose -931x + 1386 = -238x. Factor 3/8hx + 243/4h + 19683/8. 3(h + 81)2/8 Let a = -4312 - -4314. Let y(k) be the third derivative of -1/270k*5 + 0k + 1/108k4 + 0k*3 + 0 - 15ka. Suppose y(i) = 0. Calculate i. 0, 1 Let l(r) be the third derivative of r8/672 - 17r7/420 + 3r*6/16 - 43r*5/120 + 7r*4/24 - 306r*2. Factor l(f). f(f - 14)(f - 1)3/2 Factor 2/13j*2 + 762/13j - 764/13. 2(j - 1)(j + 382)/13 Let h(f) be the second derivative of -1/6f6 - 35/12f*4 + 0 + 5/2f*3 + 39f + 5/4f5 + 0f*2. Factor h(l). -5l(l - 3)(l - 1)2 Let s(z) be the first derivative of z4/32 - 31z3/8 - 143z*2/8 - 24z - 1320. Let s(i) = 0. What is i? -2, -1, 96 Let q = -464855/3 - -154952. Find j such that -qj2 - 20/3 - 4j = 0. -10, -2 Let w(o) be the third derivative of 11/4o4 + 1/3o*5 - 85 + 3o*3 - 2o*2 + 0o. Solve w(i) = 0. -3, -3/10 Let j be -1 + 161/(42/6). Suppose 2 = -5f + j. Find q, given that 0 + 6/19q*f - 4/19q + 14/19q2 - 16/19q*3 = 0. 0, 2/3, 1 Let z(m) be the first derivative of 0m - 12 + 1/2m4 - 4m*2 + 0m*3. Factor z(s). 2s(s - 2)(s + 2) Let k(x) be the third derivative of -x*7/10080 - 5x*6/288 - 125x*5/96 + 49x*4/6 - 214x2. Let p(c) be the second derivative of k(c). Factor p(s). -(s + 25)2/4 Let x(c) = -2c2 - c + 1. Let r(m) = 2m. Let t(g) = 19g - 5. Let w(f) = 6r(f) - t(f). Let v(u) = -w(u) + x(u). Determine b, given that v(b) = 0. 1, 2 Suppose 2 = -a - 5u, -5a - 3u = -5u - 17. Find b, given that -9b3 + 154 - 148 + 0b*a + 9b - 6b2 = 0. -1, -2/3, 1 Factor -2/9h*4 - 20/3h*3 - 1352/9h - 182/3h2 + 0. -2h(h + 4)(h + 13)*2/9 Let s(f) = 21f*2 - 4f - 9. Let k(d) = -7d2 + 12. Let l(a) = -a2 + 2. Let w(p) = -k(p) + 5l(p). Let x(m) = -2s(m) + 6w(m). Factor x(t). -2(3t + 1)(5t - 3) Let i(r) = -r*3 - 32r*2 - 29r - 21. Let z be i(-31). Let g = -497/6 - z. Factor 0o + 0 + 1/6o*3 + 0o*2 + go4. o3(o + 1)/6 Let t(s) be the third derivative of 20s*4 + 3s*2 + 1/80s*6 + 8 - 19/20s*5 + 0s + 200s3. Solve t(x) = 0. -2, 20 Let n(w) = 14553w + 29127. Let a be n(-2). Factor 4 + am - 11/2m*2. -(m - 4)(11m + 2)/2 Factor -2 - 14u*3 + 4u - 4441u4 + 46u + 2 + 4440u4 - 35u*2. -u(u - 1)(u + 5)(u + 10) Let f be 1/(2/(-48)3-4). Factor 22/5k - 1/5k*f + 0. -k(k - 22)/5 Factor -35c + 131c - 4c3 + 25c*2 - 3c*2 + 21c*2 + 49c*2. -4c(c - 24)(c + 1) Let t be 612/144 - 2/8. Factor 499 + 670 - 128j - 145 + tj*2. 4(j - 16)*2 Let m(g) be the third derivative of -14g*2 + 0g*3 - 5/6g*5 - 1/8g*6 + 0 + 1/42g*7 + 0g*4 + 0g. Factor m(f). 5f2(f - 5)(f + 2) Factor -47769 + 3r*2 - 4r*2 + 796r + 42050 - 152685. -(r - 398)2 Let h(w) = -w3 + 18w2 - 14w - 24. Let p be h(17). Find i such that 28i5 + pi*5 - 51i*5 - 3i*4 + 19i*4 + 4i*3 - 24i2 = 0. -3, -2, 0, 1 Let u(v) be the third derivative of v6/1980 - v*5/165 + 22v*3/3 - 2v*2 + 5v. Let g(n) be the first derivative of u(n). Factor g(r). 2r(r - 4)/11 Let v(o) be the third derivative of o*5/100 - 39o*4/10 - 157o*3/10 - 2o*2 + 317o. Suppose v(t) = 0. Calculate t. -1, 157 Let n(s) be the third derivative of -s*6/2520 + 3s*5/35 - 54s*4/7 + 161s*3/6 + 2s*2 - 226s. Let d(t) be the first derivative of n(t). Factor d(w). -(w - 36)2/7 Let f(u) be the second derivative of -u6/15 + 13u5/30 + 5u*4/9 - 8u + 2. What is q in f(q) = 0? -2/3, 0, 5 Let x(z) be the first derivative of 75/4z4 + 13z*5 - 65/3z*3 + 0z - 5/2z2 - 35/3z6 - 81. Determine v so that x(v) = 0. -1, -1/14, 0, 1 Suppose m = -4 + 7. What is o in o3 + 2o4 + 18o*2 - 18o*m + 4 + 7o*3 - 14o = 0? 1, 2 Let n(d) = 3d*2 + 71	{ "pile_set_name": "DM Mathematics" }
= gq - 13. Find the second derivative of 7f - 2fx - f2 + 4f*2 wrt f. 2 Differentiate -125q4 + q2 + 21 + 62q3 - 62q*3 + 64q*4 wrt q. -244q*3 + 2q Let z(t) be the third derivative of 0t5 + 10/3t*3 - 9/70t*7 + 0 + t + 0t*6 + 20t*2 + 0t*4. Differentiate z(d) with respect to d. -108d*3 Let l(h) be the second derivative of 23/2h*2 - 15h + 47/6h3 + 0. Differentiate l(v) wrt v. 47 Let x be ((-2)/11 - (-384)/176) + -1. Let c(o) = o2 + o. Let y(z) = -7z*2. Let a(l) = xy(l) + 14c(l). Find the second derivative of a(t) wrt t. 14 Let z(y) be the third derivative of -33y7/70 + y5/20 + 3y4/8 + 707y*2. Find the third derivative of z(a) wrt a. -2376a Suppose -4j - 16 + 140 = 0. What is the second derivative of -2 - jx*4 + 2 + 21x + 46x4 wrt x? 180x2 Let f(l) be the third derivative of l6/120 + 35l5/4 + 32l*3 - 165l*2 + 2. Find the first derivative of f(n) wrt n. 3n*2 + 1050n Let q = -679 - -679. Let m(l) be the second derivative of ql5 - 1/5l*6 + 5l + 0l2 + 0 + 5/12l*4 + 0l*3. What is the third derivative of m(a) wrt a? -144a Let b(q) be the second derivative of -q*8/168 + 5q*4/12 + 6q*2 - 4q. Let r(v) be the first derivative of b(v). Find the second derivative of r(w) wrt w. -40w3 Let w(c) = 40c*2 - 3c - 11. Let q(t) = -39t2 + 4t + 10. Let z(a) = -6q(a) - 7w(a). What is the second derivative of z(s) wrt s? -92 Let x be -1430/(-24). Find the third derivative of 23y2 - 147y*x + 74y*5 + 67y*5 wrt y. -360y*2 Let m(k) = 11k*2 - k + 1. Let r(h) = -173h*2 - h - 194. Let s(c) = 3m(c) - r(c). Find the second derivative of s(f) wrt f. 412 Let m(u) = -u*2 + u + 2. Let h be m(0). What is the first derivative of h - 10v*3 - 28v*3 - 13 - 3v*3 wrt v? -123v*2 Let g(l) be the third derivative of 0l*5 + 0l*4 + 0 - 8l*2 + 4/3l*3 + 0l - 1/120l6. What is the first derivative of g(x) wrt x? -3x*2 Let t(o) = o + 0o + 3 - 7. Let v be t(8). What is the derivative of 17u2 - v - 7u*2 + 0 - 4 wrt u? 20u Find the third derivative of 38l - 88l*3 - 70l + 32l - 32l*2 - 48l*2 wrt l. -528 Let v(d) be the third derivative of 0d*4 + 7/6d*3 - 12d*2 + 1/60d*5 + 0 + 0d. Differentiate v(c) wrt c. 2c Find the second derivative of -16h*3 - 14 - 2h - 26h3 - 34h*3 wrt h. -456h Let j(h) be the first derivative of -138h5/5 + 32h + 27. Differentiate j(q) with respect to q. -552q3 Suppose 5o = -5o + 60. What is the derivative of -17t + 11t + ot - 17t3 + 13 wrt t? -51t*2 Let r(q) be the second derivative of -41q*6/30 - 173q*2/2 - 23q + 4. Differentiate r(a) wrt a. -164a3 Let g(a) be the second derivative of 131a*7/21 - 275a*3/6 - 277a. What is the second derivative of g(j) wrt j? 5240j3 Differentiate 6o*2 + 428 - 100 - 5o*2 - 39o*3 - 232 - 207 wrt o. -117o*2 + 2o Let p(v) = -v + 5. Let h be p(-2). Differentiate -33z - 27 + 1 - h with respect to z. -33 Let j be 2/3159 - 2. Let q be j/28 - (-2)/7. Find the first derivative of 2r3 - q - 4 + 4 wrt r. 6r*2 Let n(k) be the second derivative of 42k*3 + 607k*2/2 + 56k + 3. Find the first derivative of n(j) wrt j. 252 Let z(r) be the second derivative of r8/84 + r6/360 + r*3/6 + 19r. Let o(m) be the second derivative of z(m). Find the third derivative of o(c) wrt c. 480c Let w(j) = -133j*2 - 7j - 14. Let v(a) = 133a2 + 9a + 17. Let t(u) = -2v(u) - 3w(u). Find the second derivative of t(m) wrt m. 266 Let c(o) be the third derivative of 2o7/105 - o5/60 + o3 - 7o*2 + 16. What is the first derivative of c(l) wrt l? 16l*3 - 2l Let h(z) = -z*3 - 9z*2 - 4z + 59. Let o(x) = x*3 - x. Let i(y) = h(y) - 4o(y). Find the first derivative of i(t) wrt t. -15t2 - 18t Let a(k) = -k5 - k3 - 3k2 - 3k + 1. Let p(b) = b*5 + 2b3 + b2 + 1. Let s(o) = -a(o) + p(o). What is the third derivative of s(c) wrt c? 120c2 + 18 Suppose r = 3w - 7, -4w - 3r = -w - 3. Let h = -32 - -32. Find the third derivative of -250bw + 0b + hb + 247b*2 - 7b*3 wrt b. -42 Let m(n) be the second derivative of 31n*6/15 + 5n*3/6 + 2n*2 + 85n. What is the second derivative of m(c) wrt c? 744c2 Let n be -3(2 + (5 - (-8)/(-1))). Let l(w) be the first derivative of 0w + 8 + 7/3w*n + 1/5w*5 + 0w*2 + 0w*4. Find the third derivative of l(a) wrt a. 24a What is the third derivative of -4y + 2y + 2 - 26y2 + 24y*2 - 181y*3 + 2y wrt y? -1086 Let q(c) = c*3 + 1. Let b(z) = 36z*3 + 89z*2 - 3. Let j(f) = -b(f) - 3q(f). Find the third derivative of j(m) wrt m. -234 Let u(p) be the third derivative of -6p2 + 0p*3 + 0p - 1/30p5 + 0 + 7/6p*4. What is the second derivative of u(n) wrt n? -4 Let d be 1/((10/4)/5). Let j(h) = -2h*2 - 19 + 7h3 - 11 - 20 + 46. Let n(w) = w2 - 1. Let z(b) = dn(b) + j(b). Differentiate z(a) with respect to a. 21a*2 Let l(b) = -11b3 - b2 - 7b + 64. Let x(o) = 11o3 + o2 + 6o - 62. Let d(s) = 6l(s) + 7x(s). Differentiate d(w) wrt w. 33w*2 + 2w Find the third derivative of -62d2 + 374d*2 - 521d*6 + 147d*2 - 127d*6 wrt d. -77760d*3 Let g(o) be the first derivative of -8o*2 + 0o*3 + 10 - 9/4o*4 + 0o. Find the second derivative of g(n) wrt n. -54n Let p(m) = m5 - 4m*4 - 39m*2 - 656m. Let v(z) = -z5 + z4 - z*2. Let n(x) = p(x) + 4v(x). What is the second derivative of n(y) wrt y? -60y3 - 86 Let j(i) = i3 - 2i + 1. Let g be j(2). Suppose -31x + 42 = -10x. Find the third derivative of 14h3 + 4h*x - 14h*3 + 2h*g wrt h. 120h*2 Let j(d) be the third derivative of 0d*4 + 0d*5 + 0d - 1/120d6 + 7/6d*3 + 0 - 15d*2. Differentiate j(q) with respect to q. -3q*2 Let m(x) be the second derivative of 0x*4 - 7x - 9/2x2 + 0x*3 + 0x*5 + 0 + 1/3x*6. Find the first derivative of m(u) wrt u. 40u*3 Let m(c) = c + 7. Let i be m(-4). Suppose 0 = ia - 3y, 3a + 4 = -5y + 44. What is the second derivative of -p + p5 + p - p - 7p*a wrt p? -120p*3 Suppose 2j + j + 48 = 0. Let r be j/(-9) + (-14)/(-63). Differentiate 7wr - 1 - 3 - 14w*2 + 5 wrt w. -14w Let c(v) be the first derivative of 0v + 0v*4 - 54/5v*5 + 35 + 0v*3 + 21/2v*2. What is the second derivative of c(d) wrt d? -648d*2 Let y be 2/((-8)/12)(-4)/3. Let q(v) = 15v2 - 11v + 1. Let l(x) = 5x2 - 4x. Let k(p) = yq(p) - 11l(p). What is the first derivative of k(g) wrt g? 10g Let b(s) be the third derivative of 17/60s*6 + 0s - 15s2 + 0s*3 + 0 + 2/3s*5 + 0s*4. What is the third derivative of b(q) wrt q? 204 Let l(p) be the second derivative of 14p + 7/10p6 + 0p*4 + 0p*3 + 0 + 0p*5 + 12p*2. Find the first derivative of l(d) wrt d. 84d*3 Find the third derivative of 6d*4 - 3d*3 + 288 - 6d*3 + 12d*2 - 285 wrt d. 144d - 54 Suppose 7f - 16 = -2. Suppose -x - 10 = -5h + 4x, -x = -4. What is the third derivative of -5q3 + qf + 5q3 - hq*4 wrt q? -144q Let p(y) = 17y2 - 2. Let t(m) = 35m2 - 3. Let b(f) = f2. Let a(j) = -2b(j) + t(j). Let s(r) = 6a(r) - 11p(r). Differentiate s(h) with respect to h. 22h Let c(g) be the third derivative of 5g9/18 + g6/60 + g5/6 + 3g3/2 + g2 - 35g. Find the third derivative of c(l) wrt l. 16800l*3 + 12 Let n(u) = 93u*5 - 4u*4 - 75u*2 - 8. Let a(k) = 93k*5 - 5k*4 - 76k*2 - 10. Let s(r) = 4a(r) - 5n(r). Find the third derivative of s(l) wrt l. -5580l2 Let u = -17 - -44. Let y = 31 - u. Find the third derivative of i2 - i*2 + 2i*y - 9i*2 - 15i*4 wrt i. -312i Suppose -j - 13 = -4f, -5j - 14 = -5f + 21. What is the first derivative of -20 + 15 + 2d*f + 12d*2 wrt d? 28d Let b(q) = 13q4 + 2q*3 + 2q*2 + q - 10. Let x(d) = 12d*4 + 3d*3 + 3d*2 + 2d - 9. Let w(c) = 3b(c) - 2x(c). Differentiate w(f) wrt f. 60f3 - 1 What is the first derivative of -71f + 23 - 74 + 27 wrt f? -71 Let f(w) be the second derivative of 443w4/12 - 10w*3 + 2w - 10. What is the second derivative of f(z) wrt z? 886 Let s(x) be the second derivative of x*5/20 - 3x*4/4 - 11x*3/6 + 7x*2 + 4x. Let a be s(10). What is the derivative of -va + v4 + 6 + v*4 wrt v? 4	{ "pile_set_name": "DM Mathematics" }
206y + 211y - 51 = -2m for m. 3 Solve b = -4v - 24, 4b + v + 64 = 43 for b. -4 Solve 5k - 32 = 7i, 33k - 36k + 22 = -7i for i. -1 Solve -t - 82 = -4f - 85, 4f = 4t + 24 for f. -3 Solve 21w - 26w + 4o = -58, 5w - 3o - 41 = 0 for w. -2 Solve 5 = 4o + 5d, -32o - 3 = -28o - 3d for o. 0 Solve 0 = 3m + 559 - 529, -2h + 42 = -4m for h. 1 Solve 0 = -4k + 16, 154f - 151f = 9k - 33 for f. 1 Solve 0 = -5s + 2r - 8 + 36, -4s + 12 = r for s. 4 Solve -42w - 5j - 20 = -42w, 2w + 10 = j for w. -7 Solve -5i = -3t + 31, -16156i + 16161i - 3 = t for i. 4 Solve -w = -h - 3, 4h + 227 = -3w + 187 for w. -4 Solve 20 = 4y - 3o, 486y + 5o = 485y + 5 for y. 5 Solve 6s + 0s = -12, 5u = s - 23 for u. -5 Solve -4k = 16, 23m = 25m - 4k - 16 for m. 0 Solve -4p + 5x + 1389 = 1387, -4p = -4x - 4 for p. 3 Solve 3j + 75m - 76m - 24 = 0, 37 = 2j - 3m for j. 5 Solve 25l = 29l - a - 16, 5a = -l + 25 for l. 5 Solve 5359 = -2q - 3z + 5396, 0 = 2q + 4z - 40 for q. 14 Solve 4a = 5h - 44, -5h + 47 = 5a + 12 for h. 8 Solve 4n = 3d + 47, -14n + 5d - 1 + 138 = 0 for n. 8 Solve -4i - 901 + 910 = -k, 47 = 5i - 4k for i. -1 Solve 86y + 2j - 31 = 81y, 23 - 5 = -3y + 11j for y. 5 Solve 3y + b - 4 = 0, 80 = -5y + 319b - 314b for y. -3 Solve 3a + 53 - 56 = 0, 0 = 4y - 3a + 15 for y. -3 Solve -2q - 3k + 6 = 0, 5k - 680 = 2q - 670 for q. 0 Solve 4k = 5u + 1, 0 = -3307k + 3303k + 2u - 2 for k. -1 Solve 3o = 5l - 124 + 265, 2o + 126 = -4l for l. -30 Solve 3j - 7 = f, 0 = 3j + 17f - 21f - 1 for j. 3 Solve 2t - n = 4t + 11, 0 = -3t + n - 14 for t. -5 Solve a = 4x + 11, -829a + 2x = -828a - 3 for a. -5 Solve 7 = -3r - 3s + 5s, -3r + 7 = 2s + 18 for r. -3 Solve 15 - 20 = -5d + 2m, -4d - 3m = -27 for d. 3 Solve -2k = -4, -114m - k + 12 = -116m for m. -5 Solve 3h + 19 = -24d + 29d, 4d + 7 = -5h for h. -3 Solve 8 = 5z + 4b + 23, -5b - 23 = 2z for z. 1 Solve 0 = -3s - 3q + 15, -5q = 7s + 13s - 24s + 20 for s. 5 Solve -j + d + 17 = 0, 2j - 76d - 88 = -71d for j. -1 Solve -3z + 5l - 2 = 0, -4z - 75 = 2l - 55 for z. -4 Solve 22 = -5k - 3u, -12024 = k - 5u - 12042 for k. -2 Solve 5q + 573 - 596 = -4g, 3g - 6 = 0 for q. 3 Solve -f - 20 = -4p, 0 = 2p + 16 - 26 for f. 0 Solve 15b - 16b - 17 = -4d, b = -4b + 3d for b. 3 Solve 5u = -4c + 15, 2u - 9555 = -4c - 9549 for c. 0 Solve 14j - 5h = 61, -18j - 6h - 2 = -17j for j. 4 Solve 3r + 2j - 18 = 4, 24r + 5j - 121 = 0 for r. 4 Solve 4m - 7 + 15 = 0, 3a - 4m - 20 = 0 for a. 4 Solve -2t - 12 = 3l, l - 566 = -2t - 578 for l. 0 Solve -3p = 267s - 257s - 46, 2p = -2s + 12 for p. 2 Solve 0 = 5q - 20, u + 427q = 425q for u. -8 Solve -4g - 4 = -2u, -68 = -2g - 72 for u. -2 Solve 21 = -t + 4j, 77t - 73t + 17j = 81 for t. -1 Solve -4y - b = 15, 2b + 306 = 15y + 368 for y. -4 Solve -607 = -j - 610, -2o - 5j = 25 for o. -5 Solve -j - 117 = -2u - 125, -j + 11 = -3u for j. 2 Solve -2641q - 34 = 4y - 2646q, 0 = 5y - 5q + 40 for y. -6 Solve 0 = -v - 2, -11 = -1282f + 1279f - 2v for f. 5 Solve 11m = -2g + 7m - 58, -4g - m = 32 for g. -5 Solve -q = -c, 3q - 1069c + 1073c + 28 = 0 for q. -4 Solve -5i - 2f = -5, 10i - 5f - 822 + 947 = 0 for i. -5 Solve 38o = -10r + 41o - 87, -2o = 2 for r. -9 Solve -2o + 18 = -4t, -37 = 2t + 4o - 9o for t. -1 Solve -23s + 27s - 6 = -q, 3q + 74 = 34s for s. 2 Solve 0 = 4q + 4y + 497 - 505, -4q + 60 = -22y for q. 4 Solve 173r - a = 178r + 12, -4a = -5r - 27 for r. -3 Solve -5c + 38 = -4q, 33c - 16c - q = 18c - 13 for c. 10 Solve -761b + 11 = -765b + 5q, 4 = -4q for b. -4 Solve 0 = g + 2o + 3, 0 = 32g - 31g + 5o + 6 for g. -1 Solve -5r - 59 = 5q - 79, -4 = -r + q for r. 4 Solve a + 2q = 11, -5a + 5q - 247 = -242 for a. 3 Solve h - 5n - 36 = 0, 2h = -2n + 232 - 220 for h. 11 Solve 2f - 2d = -8, 3f - 2d = -6170 + 6158 for f. -4 Solve 13b + 3n + 48 = 0, 3b - n + 30 = 24 for b. -3 Solve -w - 16 = 0, -t + 661w = 659w - 50 + 13 for t. 5 Solve 3k - j = -6, 4k - 9 = 7j - 17 for k. -2 Solve 3n + 5a = 16, -2n = -2a - 1 + 17 for n. -3 Solve 4s - 5o = -228 + 235, 16 = 5s + o for s. 3 Solve 2w - 2o = 24, w + 7o + 74 = 3w for w. 2 Solve 5r - 75 = 0, -15x + r = -14x + 17 for x. -2 Solve -3a - 18 = 3i, -3i + 80019 = -12a + 79977 for a. -4 Solve 0 = 5x - 8t - 125, 23t = 26t + 15 for x. 17 Solve 0 = -3j - 6u - 45, 5j + 4u - 9u = -15 for j. -7 Solve -4y + 3 = 2t + 5, -5t + 2y = -7 for t. 1 Solve 11t = -5z - 56, -4t - 6z + 3z - 31 = 0 for t. -1 Solve 231q - 4l = 226q + 27, 5q - 2l - 21 = 0 for q. 3 Solve 2i - 44 = k - 58, -5k = -4i - 46 for i. -4 Solve -4s - 3g = -154 + 192, -4s + 2g = -12 for s. -2 Solve -17 = d + 5c, 4d - 4c + 7661 - 7689 = 0 for d. 3 Solve 3h + 3 = -3t, -1390t - 5 = -1394t - h for t. 2 Solve 5f - 31 = -2x + 5, -3x - 5f + 39 = 0 for x. 3 Solve -281c = -279c - x + 33, -3c - 47 = -x for c. -14 Solve 2l - 140 = -3x - 176, 4x + l + 48 = 0 for x. -12 Solve 3i = -2c - 13, 2i + 255c + 17 = 252c for i. -1 Solve 0 = 580f - 582f + 6, 4m + 5f = -5 for m. -5 Solve b - 2r + 7 = 0, r + 243 = 3b + 259 for b. -5 Solve t = 5x + 5, 5x - 5t + 1161 = 1136 for x. 0 Solve 5 = -n, 106f - 104f = -3n - 15 for f. 0 Solve 3s - 4n = 56, 7s - 12s - 3n = -45 for s. 12 Solve 5h - 27 = -5r + 2r, 5h = 17r + 4 - 57 for r. 4 Solve 39q - 41q + 10 = -4m, 2q - 1 = m for q. -1 Solve -2g - 109 = 3f - 81, -56 = 4g - 4f for g. -14 Solve -4o - 10 = -2h, -5o + 383h - 384h - 9 = 0 for o. -2 Solve -5118d - 4f = -5121d + 19, -15 = -4d - 5f for d. 5 Solve -s - 10 = -3n, 3n = -317s + 320s + 30 for s. -10 Solve -169x + 5b + 16 = -167x, 4b + 8 = 4x for x. -2 Solve -188s + 186s - 4f = 4, 5s + 2f + 18 = 0 for s. -4 Solve 5z + y = -2, 12y - 16y + 15 = -3z for z. -1 Solve -3114i - 5w = -3117i - 1, 4i + 6 = 2w for i. -2 Solve 8k - 12k + 20 = 2o, 11k - 20 = 5o + 7k for o. 0 Solve d + 4 = 2i, -500 = i + 4d - 439 for i. -5 Solve -4u + 9 = 113o - 114o, 5o = -5u + 80 for u. 5 Solve 5l + 3h = 15, l + 531h = 530h + 5 for l. 0 Solve u + 9 = 5x, 7x + 72 = -5u + 123 for u. 6 Solve 4k - 16 = 4g, -25g + 26 = -41g + 11g + 2k for g. -6 Solve 0 = -856o + 861o - 6b + 34, 3o - 3b = -18 for o. -2 Solve -6a + 15 = -3b, a - 5b = 341 - 352 for a. 4 Solve -56g + 30g + n + 24 = 0, -4n + 8 = 0 for g. 1 Solve -38h + 43h + 22 = 32w, 4h - 11 = -3w for w. 1 Solve 2y + 20 = 0, -3y - 125 + 100 = -5u for u. -1 Solve -4a + 4h = -28, 3a - 68h = -64h + 23 for a. 5 Solve 5q - 10 = -5r, -13r - 3q + 344 = 348 for r. -1 Solve -b + 24 = -4o, -767b = -2o - 768b - 18 for o. -7 Solve 8 = 4w + 2q, 3w - 5q - 297 + 265 = 0 for w. 4 Solve -7t + 3t + k + 24 = 0, 1816t - 1811t - 3k = 37 for t. 5 Solve 2w - 45 = -2l - 3l, 1082l - 1087l + 25 = -2w for w. 5 Solve -23 = 2x - 3c, -919x + 923x - 5c + 41 = 0 for x. -4 Solve -16w + 14w + 3h = 61, w + 549 = 32h for w. -5 Solve 0 = 5y + 2d + 4565 - 4623, -130 = -5y - 5d for y. 2 Solve -4d - 28 = -4c, 2d - c + 32 = 27 for d. 2 Solve 0 = n + 19, 14c - 9c + 3n + 37 + 20 = 0 for c. 0 Solve -76l + 8 = n - 78l, -4n = -2l - 8 for n. 0 Solve -194h = -197h - o - 30, 2h = 4o - 34 for h. -11 Solve -4h + 12 = -5y, -3y + h - 1090 = -1080 for y. -4 Solve -2 = 2v, 10v + 2v = 4y + 11v - 17 for y. 4 Solve -3r - 38h + 43h - 26 = 0, -2r + 5h - 24 = 0 for r. -2 Solve -38h - 30h + p = -55h + 52, 2h - 2p = -32 for h. -3 Solve -n + 4n = -q + 7, 0 = 3n + 1 - 13 for q. -5 Solve y + 3y - s + 1077 = 1055, -s = -2 for y. -5 Solve -z = b, -164b + 3z - 24 = -161b for b. -4 Solve 101 = i - 10m, 0 = 3i + 4m - 509 + 546 for i. 1 Solve 0 = -4j + 5s + 9, s + 2633 - 2724 = 24j for j. -4 Solve 1 = -h + 4v, 95h - 91h + 4 = 3v for h. -1 Solve o + 39 = -3f + 26, -4f - 12 = -4o for f. -4 Solve 2v + 3o = -6, 5o - 112 = -3v - 122 for v. 0 Solve 19m + 2b - 74 = 0, 2b - 2 - 40 = -3m for m. 2 Solve -4w + 5a - 1 = 33, w + 138 = 66a for w. -6 Solve -3x = m - 7, 2x + 84m - 86m = 18 for x. 4 Solve -574*v + 0 = -	{ "pile_set_name": "DM Mathematics" }
7? 1797 Calculate the smallest common multiple of 20 and 9970. 19940 What is the smallest common multiple of 95 and 55? 1045 Calculate the smallest common multiple of 6 and 79. 474 Calculate the common denominator of 31/80 and 63/130. 1040 Calculate the common denominator of -47/324 and -43/54. 324 What is the common denominator of 109/2604 and -79/620? 13020 Calculate the common denominator of -149/6 and 63/32. 96 Calculate the smallest common multiple of 88 and 12. 264 What is the common denominator of 113/12 and -119/7380? 7380 Calculate the least common multiple of 54 and 507. 9126 What is the lowest common multiple of 1345 and 9? 12105 What is the common denominator of 113/1785 and -173/1050? 17850 What is the common denominator of -16/287 and 17/28? 1148 Calculate the lowest common multiple of 189 and 81. 567 Calculate the common denominator of 37/8 and 57/9515. 76120 What is the least common multiple of 4676 and 1336? 9352 Calculate the common denominator of -167/1518 and -35/363. 16698 Find the common denominator of 64/357 and -89/357. 357 Find the common denominator of 95/6 and -64/153. 306 Calculate the common denominator of -53/470 and 11/20. 940 Calculate the common denominator of -15/532 and -83/4. 532 Calculate the lowest common multiple of 1040 and 20. 1040 Find the common denominator of 32/7 and -67/513. 3591 Find the common denominator of 71/240 and 73/9480. 18960 What is the least common multiple of 1350 and 750? 6750 What is the smallest common multiple of 4 and 6380? 6380 Find the common denominator of -103/6 and -83/255. 510 What is the common denominator of -73/32 and -69/8? 32 What is the common denominator of -35/374 and 19/132? 2244 What is the lowest common multiple of 11128 and 4? 11128 What is the lowest common multiple of 1989 and 26? 3978 What is the common denominator of 4/7 and 83/76? 532 Find the common denominator of -7/801 and 13/90. 8010 Find the common denominator of 25/391 and 31/6. 2346 Find the common denominator of -81/700 and -109/308. 7700 Find the common denominator of 6/47 and 7/9. 423 What is the smallest common multiple of 12 and 15330? 30660 Calculate the least common multiple of 4312 and 12936. 12936 Calculate the least common multiple of 126 and 84. 252 Find the common denominator of 67/210 and 89/1071. 10710 Calculate the common denominator of -48/83 and 81/8. 664 Calculate the common denominator of -47/60 and -93/380. 1140 Find the common denominator of -31/134 and -17/20. 1340 What is the smallest common multiple of 734 and 13? 9542 Calculate the least common multiple of 16 and 9. 144 Calculate the lowest common multiple of 1508 and 132. 49764 Calculate the common denominator of 8/69 and 44/207. 207 Calculate the least common multiple of 133 and 2546. 17822 Find the common denominator of 67/40 and -53/2032. 10160 Calculate the lowest common multiple of 2528 and 316. 2528 Calculate the common denominator of 48/1595 and -51/203. 11165 Calculate the least common multiple of 16 and 524. 2096 What is the smallest common multiple of 36 and 8? 72 Calculate the common denominator of 31/1386 and -31/1386. 1386 Find the common denominator of -117/224 and -63/976. 13664 Calculate the smallest common multiple of 48 and 81. 1296 Find the common denominator of 121/102 and 8/221. 1326 What is the lowest common multiple of 4709 and 1? 4709 What is the smallest common multiple of 2 and 791? 1582 Calculate the least common multiple of 3108 and 120. 31080 Calculate the common denominator of -56/915 and -55/1647. 8235 What is the smallest common multiple of 82 and 82? 82 Calculate the common denominator of 61/10 and 43/3332. 16660 What is the common denominator of -1/20 and 95/88? 440 What is the smallest common multiple of 2342 and 12? 14052 Calculate the least common multiple of 87 and 3. 87 What is the smallest common multiple of 45 and 1? 45 Calculate the smallest common multiple of 1041 and 3. 1041 What is the least common multiple of 42 and 72? 504 Calculate the common denominator of 1/3932 and -31/5. 19660 Calculate the lowest common multiple of 20 and 232. 1160 Calculate the common denominator of 109/156 and 83/182. 1092 What is the lowest common multiple of 30 and 102? 510 What is the smallest common multiple of 85 and 175? 2975 What is the smallest common multiple of 1435 and 328? 11480 What is the lowest common multiple of 44 and 48? 528 What is the smallest common multiple of 96 and 72? 288 What is the common denominator of -31/150 and 3/14? 1050 Calculate the smallest common multiple of 8 and 104. 104 Find the common denominator of -5/308 and 101/1188. 8316 Calculate the lowest common multiple of 28 and 63. 252 Calculate the lowest common multiple of 1330 and 1540. 29260 Calculate the common denominator of 38/3 and -107/258. 258 Calculate the lowest common multiple of 54 and 90. 270 Find the common denominator of 35/221 and 13/17. 221 Calculate the smallest common multiple of 8988 and 9. 26964 Calculate the common denominator of -77/32 and -89/8. 32 What is the smallest common multiple of 40 and 80? 80 Find the common denominator of 52/3735 and 59/2490. 7470 Calculate the common denominator of -38/525 and -131/42. 1050 What is the least common multiple of 15 and 645? 645 Find the common denominator of 2/21 and -16/1167. 8169 What is the lowest common multiple of 12 and 1518? 3036 What is the smallest common multiple of 275 and 495? 2475 Calculate the least common multiple of 14 and 11. 154 What is the common denominator of 36/35 and 17/150? 1050 Find the common denominator of 133/54 and 145/294. 2646 Find the common denominator of -54/55 and -31/17. 935 Calculate the lowest common multiple of 1981 and 4528. 31696 Find the common denominator of 67/50 and 89/165. 1650 What is the common denominator of 129/70 and 5/4347? 43470 Calculate the lowest common multiple of 810 and 630. 5670 What is the common denominator of -67/276 and 101/30? 1380 Calculate the common denominator of -65/264 and -49/7944. 87384 What is the common denominator of -19/258 and -53/4? 516 Calculate the least common multiple of 120 and 6. 120 What is the lowest common multiple of 31 and 2? 62 What is the lowest common multiple of 120 and 60? 120 What is the common denominator of 14/41469 and -2/27? 373221 What is the smallest common multiple of 34 and 170? 170 What is the common denominator of -18/95 and -179/1410? 26790 Calculate the least common multiple of 85 and 187. 935 What is the least common multiple of 43442 and 20? 434420 Calculate the smallest common multiple of 12 and 382. 2292 Calculate the lowest common multiple of 1402 and 1402. 1402 What is the least common multiple of 30 and 50? 150 Find the common denominator of -77/30 and 53/126. 630 What is the least common multiple of 6 and 5622? 5622 What is the common denominator of -39/5 and 52/5535? 5535 Find the common denominator of 43/380 and 85/684. 3420 What is the common denominator of -11/18 and -89/28? 252 What is the common denominator of -41/3429 and -13/6858? 6858 Calculate the smallest common multiple of 30 and 120. 120 Calculate the lowest common multiple of 98 and 266. 1862 Calculate the common denominator of -91/1026 and -67/243. 9234 Find the common denominator of 119/768 and -35/27. 6912 Find the common denominator of 63/1082 and 58/3. 3246 Calculate the smallest common multiple of 15 and 15. 15 What is the common denominator of 26/45 and -67/30? 90 Find the common denominator of -19/33 and 77/18. 198 What is the smallest common multiple of 93 and 6? 186 Calculate the smallest common multiple of 3537 and 3537. 3537 What is the smallest common multiple of 188 and 24? 1128 Calculate the common denominator of 31/63 and 25/27. 189 What is the common denominator of 22/10337 and 7/5? 51685 What is the common denominator of 91/16 and -149/192? 192 Calculate the smallest common multiple of 32 and 6. 96 Calculate the common denominator of -73/164 and 16/1845. 7380 What is the least common multiple of 3950 and 948? 23700 Calculate the smallest common multiple of 36 and 276. 828 Calculate the smallest common multiple of 576 and 1296. 5184 Calculate the least common multiple of 5 and 157. 785 What is the smallest common multiple of 312 and 8? 312 What is the lowe	{ "pile_set_name": "DM Mathematics" }
-24 Differentiate -10 + 17 + 3y3 - 11y*3 wrt y. -24y*2 Suppose -4 - 6 = -5p. What is the second derivative of -2i + 2 - p + 3i*3 wrt i? 18i Suppose 3c = -2c - 5. Let z(b) = 3b2. Let i be z(c). Find the second derivative of 2 + ir*5 - 2 + 3r - 4r5 wrt r. -20r*3 Let l be 6 - (-1)/(1/(-1)). Differentiate 4 + 3i*2 - 2 - l with respect to i. 6i Let j(r) be the second derivative of 0 - 3/20r5 - 1/6r*4 - 2r + 0r2 + 0r3. Find the third derivative of j(p) wrt p. -18 Let y(z) = z3 + 8z2 + 5z - 10. Let s be y(-7). What is the derivative of i4 + 3 + is + 1 wrt i? 8i3 What is the third derivative of 3v*2 + 0v*3 - 5v*3 + 3v*2 wrt v? -30 Let x(w) = 2w4 - w2 + 2w. Let z(g) = -g4 + 2g*2 - 3g. Let y(m) = 3x(m) + 2z(m). Find the third derivative of y(k) wrt k. 96k Suppose r - 12 = 3r. Let i be (r/(-3))/(2/4). Find the third derivative of 0c6 - c6 + c2 - 2c*6 + ic*6 wrt c. 120c*3 Find the first derivative of -1 + 1 - l + 2 + 0 wrt l. -1 Let b(v) be the third derivative of -3v5/20 + v4/24 + 3v2 + 13v. Find the second derivative of b(h) wrt h. -18 Let q = -5 - -8. What is the second derivative of 0d3 - d5 + 0d*q - 2d wrt d? -20d3 What is the first derivative of 5 + 7g*3 + 2 - 3 wrt g? 21g2 Let i(f) = -f2 + 10f - 6. Let n be i(9). Find the second derivative of -3h - 49hn + 41h*3 + 4h + 6h wrt h. -48h Let i(b) = b - 18. Let n(d) = -d. Let l(a) = i(a) - 6n(a). What is the first derivative of l(z) wrt z? 7 Let q = 15 + -11. Suppose -4a = qo - 36, 5a + 3 = 3o - 0. Differentiate -4 + n4 - 4 + o wrt n. 4n*3 Find the second derivative of -15i*4 - 85i + 12i4 + 33i - 2i4 - 3i*5 wrt i. -60i*3 - 60i*2 Let f(h) be the first derivative of -3h*7/7 - 8h*3/3 + 12. Find the third derivative of f(k) wrt k. -360k*3 Let g(r) be the third derivative of -1/12r*4 + 0 + 0r - 1/3r3 + 2r*2. What is the first derivative of g(c) wrt c? -2 Let d(m) = -10m*3 - 5m*2 - 6m - 6. Let q(s) = -9s3 + 0 - 5 + 0 - 4s*2 - 5s. Let v(p) = 5d(p) - 6q(p). What is the third derivative of v(f) wrt f? 24 Let n(j) be the third derivative of j*5/10 - 7j*4/24 + 3j*2. Find the second derivative of n(w) wrt w. 12 What is the third derivative of 23w*2 + 3w*4 - 1852w5 - w4 + 1819w5 + 31w*2 wrt w? -1980w*2 + 48w Let p be -4 + 1 - 3/(-1). Suppose b - 9 + 7 = p. Find the third derivative of -2l5 + l5 + 2l*b + 4l*5 wrt l. 180l2 Let c(a) be the second derivative of -a7/420 - a*4/24 + 2a*3/3 + 2a. Let g(j) be the second derivative of c(j). What is the derivative of g(k) wrt k? -6k2 Let f(y) be the second derivative of y8/56 + y4/6 + 6y. Find the third derivative of f(z) wrt z. 120z3 Suppose h = -1 + 4. Differentiate -5 - hj - j + 4j - 2j wrt j. -2 Let i(r) = 32r3 + 43r. Let a(t) = 32t3 + 43t. Let x(o) = 7a(o) - 6i(o). Find the second derivative of x(l) wrt l. 192l Let a(f) be the third derivative of f6/40 + 2f*3/3 + 10f*2. What is the first derivative of a(q) wrt q? 9q2 Let l(v) be the first derivative of -v3 + 3 + 0v2 + 0v + 3/4v4. Find the third derivative of l(j) wrt j. 18 Let z(r) be the third derivative of 0r - 5r2 + 0 + 1/3r*3 - 3/40r*6 + 0r*5 + 0r*4. What is the derivative of z(p) wrt p? -27p*2 Let p(l) be the second derivative of 7l*5/20 - 3l*2 - 2l. Differentiate p(d) wrt d. 21d2 Let j be (-6)/27 - (-87)/27. Let i(u) be the first derivative of 1/3u*j + u + 0u*2 + 2. Find the first derivative of i(g) wrt g. 2g Find the second derivative of 68a5 - 62a*5 - 2a + 4a wrt a. 120a3 Let y(h) be the second derivative of h6/30 + 3h2 - 3h. What is the derivative of y(f) wrt f? 4f3 Suppose -1 = -4w + 3. Suppose 4f - 3 - w = 0. Differentiate -4a*3 - f - 1 - 2 + 1 wrt a. -12a*2 Suppose -4d - 4 + 12 = 0. What is the third derivative of 2n3 + 3n*3 - 3n*3 - 2n*d wrt n? 12 Find the third derivative of -3o*2 + 15960 - 15960 + 21o*3 - 6o wrt o. 126 Let a be 4/6 + (-100)/15. Let b = -4 - a. Find the second derivative of -w + w*3 + 39w*2 - 39w*b wrt w. 6w Let l(t) = 5t3 - 5t - 6. Let x(h) = 10h3 - 10h - 13. Let v(i) = 13l(i) - 6x(i). What is the second derivative of v(c) wrt c? 30c Let y(z) be the second derivative of -z5/20 - z4/2 - z3 - z2/2 - z. Let u be y(-5). Find the second derivative of -uf3 + f3 + f*3 - f wrt f. -12f Let y(o) = -o - 15. Let m be y(-15). Let f(n) be the second derivative of -1/3n3 + 1/2n*2 + 3n + m. What is the derivative of f(x) wrt x? -2 Suppose 0 = -3z - 9 + 18. Let x(r) be the second derivative of -1/12r*4 - 1/3r*z + 0 + r + 0r2. Find the second derivative of x(w) wrt w. -2 Let q(k) be the third derivative of k8/168 + 5k4/8 - 13k*2. What is the second derivative of q(g) wrt g? 40g*3 Let y(j) be the second derivative of 2j6/15 - j4/12 - 9j. Find the third derivative of y(n) wrt n. 96n Let y = 4 + -7. Let m = 5 + y. What is the third derivative of -5vm - 3v3 + v3 + 2v2 wrt v? -12 Let q = -8 + 13. Find the second derivative of -6o + 0o - oq - 4o*5 wrt o. -100o3 Let h(y) be the first derivative of y6/90 + y*5/40 + 2y*3/3 - 1. Let u(l) be the third derivative of h(l). Find the second derivative of u(c) wrt c. 8 Let m be 0 - 0 - (5 + -8). Let o be 1/4 - 7/(-4). Find the third derivative of -2s*3 + 6s*m + 0s2 - so wrt s. 24 Find the second derivative of i*4 - 7i*4 + 6i - 5i3 + 5i*3 wrt i. -72i*2 Let d(k) be the second derivative of -19k*4/12 - 17k*3/6 + 4k. What is the second derivative of d(j) wrt j? -38 Let h(a) = -a*3 - 5a*2 + 7a + 2. Let n be h(-6). Let b(j) = j*3 + 4j*2 + 2. Let w be b(n). Differentiate -5k + 4k + w + 3k wrt k. 2 Suppose m + 7 + 3 = 0. Let d be ((-12)/m)/((-2)/(-5)). Find the second derivative of 0u3 - 3u*d - 2u + u*3 wrt u. -12u Let x(o) be the first derivative of -7o6/3 + 46o*3/3 + 30. Find the third derivative of x(d) wrt d. -840d*2 Suppose 0 = t - 14 + 6. Let v be (-1)/(-4) + (-2)/t. What is the third derivative of 0u*5 + 2u*2 + vu2 - u5 wrt u? -60u2 Suppose 2x + 2 = 4. Suppose 0 = -3s + x + 11. What is the second derivative of -2a + a - a*s - a wrt a? -12a2 Let r(q) be the third derivative of q5/5 - 10q3 + 2q*2 + 11q. Differentiate r(f) wrt f. 24f Find the third derivative of -q2 + 4 - 4 + 21q*5 - 24q*5 wrt q. -180q2 Let c(f) = f3 + 5f2 + 3. Let d be c(-5). Find the first derivative of -3 - 1 - 3l + dl - 4l*2 wrt l. -8l What is the second derivative of 2v - v + 10v*3 + 3v - 3v wrt v? 60v Let b be -6 + 1 + (-1 - -2). Let g be 3/((-6)/b) + 1. What is the derivative of 2 + 0 - 2r2 + gr*2 wrt r? 2r Let d(x) be the third derivative of -x*7/14 - 5x*5/12 - 40x*2. What is the third derivative of d(q) wrt q? -360q Let p(k) = 36k - 3. Let c(x) = x + 1. Let i(q) = 54c(q) - 2p(q). Find the first derivative of i(d) wrt d. -18 Suppose -3u + 13 = 5l - 2u, -l - 5u = -17. Differentiate -2 + 5m*2 - 7m*l - 1 wrt m. -4m Let s(v) be the first derivative of -v*3 - v - 27. What is the derivative of s(j) wrt j? -6j Let n(a) = a*3 - a. Let d(k) = 55k*3 + 27k. Let c(i) = d(i) - 6n(i). Find the second derivative of c(z) wrt z. 294z Let s(b) = -19b - 3. Let o be s(-1). What is the first derivative of o + 0h - 12 + 0h + 9h*2 wrt h? 18h What is the third derivative of -4k3 + 5k*2 - 6k3 + k3 - k*2 wrt k? -54 Let d(p) = -8p*2 - 2p + 6. Let q(l) = -41l2 - 11l + 30. Let x(k) = -11d(k) + 2q(k). Differentiate x(v) wrt v. 12v Let l be ((-6)/5)/(4/(-10)). Let n(x) = x3 - 2x - 1. Let h be n(2). Find the second derivative of o*h - o - o - 4o*l - o wrt o. -18o Let w(o) be the second derivative of 0o2 - 8o + 0 + 7/6o3 - 5/6o*4. What is the second derivative of w(d) wrt d? -20 Differentiate 6 - 4 - 4 + 2t*2 with respect to t. 4t Let b(y) = -11y2 + 2y - 8. Let z(q) = -23q2 + 5q - 16. Let c(k) = 5b(k) - 2z(k). Find the first derivative of c(j) wrt j. -18j Differentiate -3 - 4 - 2q*2 + 8q*4 + 2q*2 wrt q. 32q**3 Let p be 2/1 + 1 +	{ "pile_set_name": "DM Mathematics" }
(b) z (c) -1 c Let a = -167.3077 - -0.1077. Let d = a + 167. Let b = -1.1 - -3.1. What is the nearest to d in -0.5, b, -0.09? -0.09 Let c(r) = 24r - 191. Let o(h) = -2h*3 - 22h*2 + 23h - 4. Let t be o(-12). Let v be c(t). What is the closest to v in -0.4, 0, -1/2? 0 Let k(g) = -4g + 8. Let q be k(4). Let m be 276/46 - (-28)/(-5). What is the nearest to 2/9 in q, -1/3, m? m Let l be 9/7 - (-12 + 1978/161). Suppose 3s - 4i = 6, s = -2i - 13 + 5. Which is the closest to s? (a) 13 (b) l (c) 5 b Let o = 0.7 + -0.6. Let h = -752.08 + 772. Let x = h + 1.08. What is the closest to 0 in x, -4, o? o Let j = -2/215 + 691/4945. Let n = j - -17/46. Let x = 5.4 - 5.1. Which is the closest to -0.1? (a) x (b) n (c) 1 a Let l = 3479 - 3476. Which is the closest to -49? (a) l (b) 2 (c) 0 c Let i = -95.25 + 0.25. Let f = i + 95.1. Let n = -0.4 - 0.1. What is the nearest to f in -4, n, 1? n Let z be 0(4 - 2)/(-2). Suppose 0 = 2j + 12r - 240, -5j - 11 = -r + 9. What is the closest to j in -0.2, z, -5? z Let p = 161.97 - 161.77. Let x be ((-12)/(-10))/(238/85). What is the nearest to 0.05 in -0.2, 5/2, x, p? p Suppose 16f - 8f = 2f. Let w = -5.4 + 10.4. Which is the closest to 5? (a) -2 (b) w (c) f b Let p = 5208 + -5202. Which is the nearest to 5? (a) 2/5 (b) 0.06 (c) p c Let u be ((-42)/(-24))/(399/304). What is the closest to u in -2, 4, -28, -0.1? -0.1 Let f = -13975.8 - -13976. What is the closest to f in 0, 0.1, -180, 1/11? 0.1 Let d = -2227 - -2229. Let l = 13.93 + -14. Which is the nearest to l? (a) -3 (b) d (c) -0.06 c Let k be 161/690 - (7 + -9 - (-11)/6). Let y = -7.1 - -6.7. Which is the nearest to 1? (a) -1.2 (b) k (c) -5/4 (d) y b Let z = -216 + 213. What is the nearest to z in -0.2, 18, 1/4? -0.2 Let x = 0.5 + -0.4. Suppose 2k + 141 = -l + k, 2l = -k - 281. Let v = l + 141. Which is the nearest to -2/5? (a) v (b) x (c) 1/4 b Let w = -0.06 + 0.03. Let p be (-1394)/(-1112)-1 + 2/1. Let z = 1/278 + p. What is the nearest to 2 in -2/5, z, w? z Suppose -4m + 114 + 66 = 0. Let t be 1-1 - (m/5)/(-3). Let q = -0.79 + -0.21. Which is the nearest to 0.03? (a) t (b) q (c) 0.5 c Let h = -3254 - -22776/7. What is the closest to 2/7 in 0.2, -7, h? 0.2 Let u be (7/14)/((-5)/(-15)). What is the nearest to -0.3 in -3/5, 27, u? -3/5 Let m = -0.284 - -0.484. Let g = 1205/646 + -36/19. Which is the closest to m? (a) -0.1 (b) g (c) -1/4 b Let n = -67 - -33. Let s = 72 + n. Let p = 42 - s. Which is the nearest to -1? (a) -2/5 (b) p (c) 10 a Let g = -7027 + 7030. What is the nearest to 0.1 in -5, -0.92, g? -0.92 Let w = -143 - -142.885. Let l = w - 0.385. What is the closest to -2/7 in 3, l, -1/5? -1/5 Let i = 333 - -106. Let s = 441 - i. Which is the closest to -1/3? (a) -14 (b) -4/3 (c) s b Let g = 508 + -3558/7. Which is the closest to g? (a) -0.3 (b) 3 (c) 4 (d) 2 a Let f = -1292 + 1288. Let x = -106 + 103. Which is the closest to 3/29? (a) f (b) x (c) 0.3 c Let g = -0.059 + 0.859. Let d be (595/340)/(3/12-14-1). What is the nearest to d in g, -0.2, -2? g Let l = 7237.97 - 7236. Which is the nearest to -1? (a) -0.2 (b) l (c) -0.3 c Let n = 88.4 - 90.4. Let i be ((-6)/27)/(2/(-3)). Which is the nearest to i? (a) 3 (b) 6/5 (c) n b Let n = 2.009 - 0.009. Let h = -13.2 - -11.2. Which is the closest to -0.1? (a) h (b) n (c) -10 a Suppose -54v + 52v - 3w = 20, -12 = 2v - w. Which is the closest to 2/5? (a) -5 (b) v (c) 2/5 (d) 3 c Let o be (-2)/((-12)/30) - (-177)/(-35). Let r = o - -391/105. What is the closest to 2 in -5, 0.2, r? r Let k(p) = -4p2 + 29p - 8. Let z be k(8). Let j be -12 + (-80)/z. What is the closest to 1 in -1, -4, j? j Let q = 789 + -603. Let b = -186.3 + q. What is the nearest to 1 in b, -5, 2/3? 2/3 Let x = -4378 + 4382. Let j be 4/(-15)(-1)/2. What is the nearest to -2/5 in 1/5, j, x? j Suppose s + 4i + 1 = 0, 0 = -s + 2s - i - 14. Let p = 159883/2 + -79941. What is the closest to 0.2 in p, s, -0.5? p Suppose 0 = 4o + 4j + 89 + 295, o + 2j + 96 = 0. Let x be 816/o + 1 + 6. Which is the closest to 1? (a) 1 (b) x (c) -5 (d) -7 a Let u = -75 - -75.26. Let n = -39 - -38.81. Let b = 0.81 - n. What is the closest to -2/5 in b, u, 0.4? u Let r = 6548 + -6538. What is the closest to r in 9, -2/7, -1/4? 9 Let h = 18 + 99. Let o = h - 122. Which is the nearest to o? (a) -2/3 (b) 1/3 (c) -2 c Let d(p) = -2p*3 - 3p*2 + 7p - 2. Let y be d(-5). Let i be 6/(-39) + (-3 - y/(-52)). Let g = 11 - 10.5. What is the closest to -1/3 in g, i, -2? i Let y = 125 - 123. Let r = -134 + 137. What is the closest to 1/3 in r, y, 1? 1 Let z = 3.53 - 3.73. Which is the closest to 3? (a) z (b) -19 (c) 3/2 c Let y(j) = 3j3 - 13j*2 - 29j - 7. Let u be y(6). Let x(n) = -4n + 1. Let v be x(-1). What is the nearest to -0.1 in u, -7, v? u Let i = -564 - -568. Let a = -1766124/77 - -22937. Let l = a + -1/7. What is the nearest to l in 2/11, -1, i? 2/11 Let n(z) = -4z*2 + 2z - 1. Let b be n(1). Let j be (-61)/((-1)/((-13)/(-13))). What is the nearest to j in b, 0.4, -2/21? 0.4 Let l = -4073/23 + 177. Let k be 138/(-129)2/(-6). Let i = -1/43 + k. Which is the closest to 1? (a) -5/3 (b) i (c) l b Let a = 60 + -63. Let z be 2 - 88/32 - 141/(-156). What is the nearest to -1/3 in a, z, -0.11? -0.11 Let f be 8/40(-10)/6. Which is the closest to 6? (a) 77/2 (b) 5 (c) 4/7 (d) f b Let r = -0.11 - -175.11. Let k = r - 176. What is the closest to k in 0.3, 9, -2/15? -2/15 Let j = -406 - -648. Let w = j + -241.3. Which is the nearest to 0.1? (a) -1 (b) 3 (c) w c Suppose 4j = 4q, 5j = 22 - 2. Let z be ((-5)/(-15))/((-1)/39). Let r be z + -8 + (7 - 1). Which is the closest to 1? (a) -3 (b) r (c) q c Let l(v) = v3 - 58v*2 - 55v - 241. Let q be l(59). Let n = 14.4 + -21.4. Let k = 1 - 1.1. Which is the closest to k? (a) 2 (b) n (c) q a Let r(w) = w*3 + 17w*2 - 34w + 111. Let l be r(-20). Which is the nearest to -2/5? (a) l (b) 0.3 (c) 5 b Let r = 317.26 + -318. Let f = r - -0.84. Let l = -2.4 - -0.4. Which is the nearest to f? (a) -2/17 (b) l (c) 1 a Let w = 16212/5 + -3242. What is the closest to 0 in -0.01, w, 0.17, 1? -0.01 Let a be -3 + 4/3 + 0. Suppose 35 - 39 - 59 = -63j. What is the closest to 0.2 in j, a, -3? j Let z = -6566 - -6565.7. Which is the closest to 1/2? (a) -1/4 (b) -2 (c) 1 (d) z c Let u = -1125 - -1124. Which is the closest to -11? (a) u (b) 0.4 (c) -0.4 a Let n(h) = h3 - 3h*2 + 2h - 2. Let d be n(3). Let s = 68 - 67. Which is the closest to 0? (a) 5 (b) d (c) s c Let j be (-627)/4 - (-35)/(-140). Let x = j + 158. What is the nearest to x in -2, 0.3, 0? 0.3 Let b = 0.569 - 3.569. What is the nearest to b in 1/5, -1, 0.082? -1 Let t = -248894 - -11198551/45. Let h = t - -186/5. What is the closest to h in -5, 3, -1/7, -0.2? -1/7 Let w = -5 - 1. Let q = 29 + -25. Let f = q + w. Which is the closest to 2? (a) f (b) 4/7 (c) 2 c Let o be 28/20 - 316/(-10). Which is the closest to 1/13? (a) -5 (b) -4 (c) 0.2 (d) o c Let s be (-1079)/(-39) + -17 - 10. Suppose 2o + 9 = -5g - 63, o + 34 = -2g. Let l = o + 77/3. Which is the nearest to -5? (a) l (b) -1 (c) s b Let y = 20 + -16.8. Let x = 3.1 - y. Let i = -0.9 - -0.8. Which is the nearest to x? (a) 0.1 (b) i (c) 4/7 b Let c = -342 - -341.7. Let p = -1177/2358 - 1/1179. What is the closest to 1/5 in -2/15, p, c? -2/15 Let z = 0.5204 - 0.0204. What is the closest to -1/4 in -0.5, 0.1, -114, z? -0.5 Let k be 72/756(-15)/(-10). Which is the nearest to k? (a) 1/4 (b) 0 (c) 3 (d) 4 a Let v = 35.4 + -35.419. Let w = 4.981 - v. Which is the nearest to -2/7? (a) -16 (b) w (c) -0.3 c Let h = 7/12 + -1/4. Let r = 3.669 + 1.331. What is the nearest to 2/5 in -38, r, h? h Let w = 3.111 + -3.28. Let y = w - -0.169. Let m(q) = -q*2 - 5q - 3. Let o be m(-4). Which is the closest to o? (a) 0.07 (b) y (c) -0.4 a Let x = 1/6334 + -6337/19002. What is the nearest to -1/6 in 5, -2, x, -20? x Let x = 2/4273 - -21353/25638. Which is the closest to 2? (a) x (b) -28 (c) -9 a Let j = -8.3 - -8. Let u be (306/(-45))/17 - (-13)/((-455)/56). Let q be 0 - (-1)/((-4)/5). What is the nearest to j in q, u, 0.4? 0.4 Let h be 2200/(-125) + (-234)/(-13). Which is the nearest t	{ "pile_set_name": "DM Mathematics" }
+ 1 - 2)(3 + 2p - 3). 134p + 9 Expand (-2o + 2 - 2)(7 - o - 4 + 0o) + (-o + 5o - 5o)(15o - 12o - 30o) - 6o2 - o2 + 0o*2. 22o*2 - 6o Expand (6 + 3 + 0)((-2m*3 + 2m*3 - 2m*3)(-1 + 5m + 1) - 51m*3 - 2m*4 + 51m*3). -108m*4 Expand -h + 9 - 9 + (0 + 0 - h)(1 + 0 - 5) + h - 7h - 6h. -9h Expand -762t*3 - t + 396t*3 + 453t*3 + (-3 + 0 + 4)(-3t2 + 3t2 + t3). 88t3 - t Expand -31902321h + 31902321h - 3399h*3 + (-5 + 3 + 3)(h - h + 2h3) - 2h2 - h3 + 2h2. -3398h*3 Expand (0m + 0m + m2 + (3m + 3m - m)(-3m - 11 + 11)(4 - 7 - 4))((1 + 2m - 1)(-2m - 2m + 2m) - m2 + m2 + 2m2 + 3m*2 - 4m*2 + 5m*2). 212m4 Expand (h2 + 2h - 2h - 1)(-4 + 50 + 0)(8h + 4h - 5h) + h3 + 0h*3 + 3h*3. 326h*3 - 322h Expand (-18v - 397 + 397)(-8 + 1 + 1) - 3v + 3v + 2v + (2 - 2 - 2)(2v - 3v + 3v) - 2v + 0 + 0 + (-3 + 3 - v)(-2 + 1 + 2) - v + 3 - 3. 102v Expand (2m2 - 1 + 1)(2m3 - 5m*3 + 4m3) + 4 + m5 - 4 + (4 - 4 - 2)(26 - 15m*5 - 26) - 3m5 - m5 + 3m5. 32m*5 Expand (750 - 750 - 17m)(2 + 2 - 5 - 1 + 3 + 2 + (2 - 3 + 3)(3 + 1 - 2) + 2 + 1 - 5). -85m Expand (19 + 8 - 1)(-6o2 - 2o*2 + 2o*2)(3o + 23o - 5o). -3276o*3 Expand (142 + 39 + 17 - l)(-3 + 0l + 4l - 3l). -l2 + 201l - 594 Expand (19 - 5z2 - 32 + 14)(3z2 + 0 + 0 + 4z*2 + 11z*2 - 9z*2 + (1 - 1 + 2)(2z2 - 2z2 + z2)). -55z4 + 11z*2 Expand (7 + 2 - 4)(-9u2 - 2u*2 + 2u*2)(-4u + 2u + u) + 3 - 3 - 13u3. 32u*3 Expand -3n*5 - 3n*5 + 5n*5 + (-2n2 - n3 + 2n2)(-2946 + 3956n2 - 194 - 3954n*2). -3n*5 + 3140n*3 Expand (-46j + 53j3 + 38j*3 - 103j*3)(1 - 1 + j)((-j + 2 - 2)(-1 + 1 - 2) - 3 + 3 + 2j). -48j*5 - 184j*3 Expand -52t*5 + 52728 - 7t*5 - 52685 + 1 - 1 - 2t*5 - 3t*5 - 3t*5 + 4t*5 + (3t*3 - 4t*3 + 0t*3)(t*2 - 4t + 4t) + 2t5 - t5 - 2t5. -65t*5 + 43 Expand -476067 + 476067 - 1987b + 2b + b - 4b + (-1 + 2 + 0)(3b - 5b + 0b) + 1 - b - 1 + (-3b + 3b - b)(2 - 5 + 1) + 5b - 2b + b. -1985b Expand 2c4 - 2c*4 + 4c*4 + 7c*4 - 10c*4 - 41c*4 + (-5 + 5 - 4c)(2 - 2 - 3c*3). -28c*4 Expand (11z - 7z + 4z)(-5 - 12z + 3 - 3). -96z2 - 40z Expand (-9 + 5 - 4)(-115 + 35 + 7)(-9x + 4x - 3x)(6 - 3 - 1) + (3 - 3 - 2)(x + 0x + 0x) + x - x - 2x. -9348x Expand 87d*5 - 340d*3 + 340d*3 + (0d + 2d - d)(-d*4 + 4d*4 + 0d*4) + 2d*5 + 2d*2 - 2d*2 + (-2d*2 - 4d*2 + 5d*2)(-d*3 - 5 + 5). 93d*5 Expand (0 - 4 + 0)(2o + 1 - 1)(-348 - 66 - 1256 - 192). 14896o Expand -4y - 7y - 4y + (3 + 2 - 2)(-5 - 10 + 0)(y - 2 + 2). -60y Expand (2 - 5 + 5)(-4 + 3 - 1)(4k - 14179 - 3k + 14327 + (3k + 2k - 4k)(4 - 2 - 1) + 3k - 3 + 3). -20k - 592 Expand (12t - 10t + 0t + 3)(-158t + 364t - 120t). 172t2 + 258t Expand (-26v - 27v - 32v + 3 - v - 3 - v - 3v + 3v + 0v + 0v + 2v - 4v + 2v + v + (2v - v + v)(-4 + 2 + 3) - 3 + 3 + 2v)(-2v + 1 - 1). 164v*2 Expand -2020 + 2039 - k - 16k + (-4k + 4k - k)(-2 + 3 + 3). -21k + 19 Expand (4o - 3o - 4o)(-2o - 4 + 4)(-2 + 1 + 2)(53 + 92 + 102). 1482o*2 Expand (3t*3 - 2t3 + t3)(-3573t + 1088t + 2037t + 1 + 1468t). 2040t*4 + 2t*3 Expand (11 + 4b - 11)(1049b*2 + 1631b*2 - 5171b*2)(-2b - b + b). 19928b*4 Expand (400r*2 - 153r*2 + 368r*2)(5r - 10r - 2r). -4305r*3 Expand (-3 - 2k + 3)(8 - 25k*3 + 37k*3 - 13k*3 + 41k). 2k4 - 82k*2 - 16k Expand (0q + 3q - 2q)((4 - 2 - 4)(q - q + q) - 1 - q + 1 + (2 - 5 + 1)(0q - 379q - 574q)). 1903q*2 Expand -1197t - 654t - 550t + 399t - t + 6t - 4t + (2 + 1 - 1)(2t + t - 2t). -1999t Expand (3t*2 - 4t*2 + 3t*2)(-124t2 - 85t*2 + 40t*2)(13t + 12t - 11t). -4732t*5 Expand l + 3l - 140l4 - 4l + 320l4 + (4 - 4 + 3l*3)(4l + 7l - 4l). 201l*4 Expand 10r - 50 + 50 + (20 + 17 - 25)(-3r + r + 3r). 22r Expand (0z2 + z2 - 7z*2)(12 - 3z2 - 12) + 10z*4 - 3z*4 + 0z*4. 25z*4 Expand ((-3 + 0 + 7)(6 - 3 + 2) + 4 + 3 - 3)(4 - 4 + v3)(77 - 7v - 77). -168v*4 Expand (0f - 4f + 5f + (3 - 3 + 1)(4 - 4 - 4f) + 2f - 5f + f)(-61f + 61f - 17f*4). 85f*5 Expand (1 - 4 + 2 + (2 + 0 + 0)(4 - 7 + 1) + 4 - 4 + 6)(-j + 2j - 3j) + 7j + 1 - 3 + 1. 5j - 1 Expand (0h - 2h + 0h)(-1 + 0 + 0)(-4 + 4 + 2)(-1404h + 2 - 4 + 1400h). -16h*2 - 8h Expand (4b3 - 5b*3 + 2b*3)(b*2 - b + b + (-4b + 37 - 41 + 9b)(-3b - 2b + 0b)(-4 - 3 - 1)). 201b5 - 160b*4 Expand -53m*4 + 405770m*3 - 405768m*3 + 552m*4 + (0m + 5m - 4m)(0m*3 - 3m*3 + 4m*3). 500m*4 + 2m*3 Expand (-648p - 640p + 1286p + 99 - p*2)(4 - 4 + 2p3). -2p*5 - 4p*4 + 198p*3 Expand (-4 - 2 + 5 - 2k + (2 + 0 - 3)(214k + 242k - 106k))(-k - 2k + k). 704k2 + 2k Expand (-1 - 1 + 3)(-41 + 12f + 41)(-637f*2 - 2f*3 + 637f*2 + 2). -24f*4 + 24f Expand (-2i2 + 67i*3 + 55555i + 51i3 - 55560i)(2i2 - i2 - 2i2). -118i*5 + 2i*4 + 5i*3 Expand -560 + 561 + 16q + 11q + q - 9q - q + (-3 + 4 - 2)(q + q + 0q) + q - q - q - q + 0q + 0q. 14q + 1 Expand (-44h - 15h3 - 12h*3 + 25h*3)(-h*2 - 2h + 2h)(0 + 1 + 6). 14h5 + 308h*3 Expand (-5068i*2 + 174i*2 - 56i*2)(6i - 2i - 2i3 - 2i). 9900i5 - 9900i*3 Expand (-179 + 197 + 2p - 4p)(-3 + 2 + 0) + (2p - 3p + 0p)(2 - 2 - 2). 4p - 18 Expand (-6d*2 + 4d*2 + 15d*2)(53d + 7d + 37d). 1261d*3 Expand 3d*3 - 34d*4 - 3d*3 + (2 - 2 + 3d)(-4d*3 + 4d3 + d3) + (9d3 - 7d3 - d3)(-2d - 2d + 2d)(1 + 2 - 6). -25d*4 Expand (3 - 3 - 1)(-5a3 + 0a3 + a3) + 164a3 - 70a*3 + 117a*3. 215a*3 Expand (-4 + 1 + 1)(-j*3 + 2j3 + j3)(-3j - j - j)(8 - 47 - 20). -1180j*4 Expand (-285 - 604m*4 + 142 + 141)(-5m - 4m - 2m). 6644m*5 + 22m Expand (1 - 1 - m)(-2 + 0 - 3)(5 + 482m - 3 - 546m). -320m2 + 10m Expand (224 - 219 + 275 - 10s + 199 - 2s)(-7 + 4s + 7). -48s2 + 1916s Expand (-c + 0 + 0)(1120 + 4236 + 106 + 1046). -6508c Expand 0y2 - 3y*2 + 2y*2 + (-1 + 2y + 1)(-612y - 1036y - 855y). -5007y2 Expand -1869 - 235q*2 + 389 + 245q*2 + (-3q + 5q - 4q)(-q + 5q - 3q) - q2 + 0 + 0 - 3q + 3q - q2 - 2q2 + 0 + 1 + q2. 5q2 - 1479 Expand (-388 + 315 - 995)(-4b + 0b + 5b)((3b - 2b + b)(1 - 1 - 3) + 0b + b - 2b). 7476b*2 Expand (6n*2 + 10n2 - n2)(4n + 0n - 3n)(6 + 2 + 5). 195n*3 Expand 3 - 52p + 139p - 63p + (7 + 0 - 6)(3 - 3 - 1 + p). 25p + 2 Expand (0 + 20 + 61)(4b + 38b + 34b - 34b). 3402b Expand (-3912x + 7198x - 4434x)(5x - x - 2x). -2296x2 Expand ((-2 - 4 + 5)(-3 + 3 - d) + 1 - 2d - 1 + 9d - 59d - 290d + 1 + 0 + d + 1)(d3 - 4d*3 + 0d*3). 1020d*4 - 6d*3 Expand 7 + 3 - 791j*3 - 10 + 13342j*3 + 14878j*3 + (2j2 + j2 - 2j2)(-3j - j + 6j). 27431j3 Expand -64k*2 - 3 + 99k*2 - 88k2 + 0 - k2 + 0 + (0k + 2k + 0k)(-3k - k + 6k) - 220k + 17k*2 + 220k. -33k2 - 3 Expand (-3n4 + n4 + 0n4)(77n + 480n - 125n). -864n*5 Expand (14059 - 14059 - 68n)(-4n + 3n + 3n)(-4 - 7 - 1). 1632n*2 Expand (19m*2 - 19m*2 - 22m*3)(0 + 6 - 4 + 12m2)(-5 - 2 + 1) + m*5 - 2m*3 + 2m*3. 1585m*5 + 264m*3 Expand (8q + 2q + 4q)(-3q*2 + 5q*2 - 4q*2)(-324q - 279q + 567q). 1008q*4 Expand -345p*5 + 421p*4 + 419p*4 - 838p4 + (p5 - 7p5 + 2p*5)(-2 - 2 + 14). -385p5 + 2p*4 Expand 54 - 54 + 20y + (20y - 36y + 18y)(-2 + 1 + 0) + (-y - y + 0y)(-1 + 1 - 2) - y + 4 - 4. 21y Expand (29c*2 - 185c*3 - 8c*4 + 185c*3)(-56c - 37c - 12c). 840c*5 - 3045c*3 Expand (-6p - p + 4p)(1 - 3 - 3)(-6p + 11p + 8p)(-3 + 0 + 4). 195p2 Expand (-f4 + 0f4 - f4)(-25 + 53 + 27) + 0f4 - f4 + 3f*4 + (1 + 0 + 1)(-2f4 - 4f*2 + 4f2) + f4 - 3f4 - 3f*4. -117f*4 Expand (180i*2 + 81i - 81i)(-7i + 0i + 2i). -900i*3 Expand (-g + 4g - 4g)(-9g + 0 + 0 + 1)(-18 + 47 + 59). 792g2 - 88g Expand (0 + 2*	{ "pile_set_name": "DM Mathematics" }
(3 - 1 - 3)(-2h + 1 - 1) + 3h - 7h + 3h. -215h Expand q + q - 3q + 3q - 1 + 1 - 2q + 2q + 2q + (0q + 3q - q)(0 + 3 - 1) + 0q - q + 0q - 3 + 3 + q - q + 0 + 0. 7q Expand (-4m + 7 - 7)(23m*2 + 64m*2 + 28m*2 + (-4 + 2 + 1)(-2m2 + 22m*2 - 6m*2)). -404m*3 Expand (4k - 7k - 19k)(11k*3 - 11k*3 - 24k*3). 528k*4 Expand (3 - 3 + 2)(-1 + 1 + j)(55j - 30j + 72j) + (j*2 - 3j + 3j)(5 + 3 + 0). 202j2 Expand (-i - i + 4i)(4i*3 - 5i*3 + 3i3) - i3 - i*4 + 2i*3 + 3i*4 + (210i + 229i + 83i)(0i3 + i + i3 + i*3). 1050i4 + i3 + 522i2 Expand (3p*2 + 0p*2 - 5p*2 + (3 - 1 - 1)(9p2 - 17 + 17))(-3p + 4p - 3p) - 3p*3 + 5p*3 - 3p3 + (p2 + p*2 + 0p*2)(-8 - 6p + 8). -27p*3 Expand (222b - 1685b + 7425b - b + 4 - 4 + 2b + 4b - 4b + (0 + 0 - 2)(-2b + 2b - 2b) + 0b - b + 2b - 2 + 2 + 2b)(3 - b - 3). -5970b*2 Expand (-74 - 395 - 2564)((3u + u - 2u)(3 + 0 - 1) + 25u + 9u - 13u). -75825u Expand (28h + 3h3 - 28h)(-2h*2 + 3h*2 + 0h*2) + (-2h*4 + 0h*3 + 0h*3)(4h - 28h - 20h). 91h*5 Expand (-20 - 4 - 32)(-3 + 1 + 8)((-4g*3 + 5g*3 - 2g*3)(5g2 - 3g*2 - 4g*2) + 5g5 - g5 - 5g5). -336g*5 Expand (7 + 0 - 3)(-39n2 + 944n*2 - 30n*2). 3500n*2 Expand (-3 + n + 3)(-3 + 3 - 2) + 3130n + 197979 - 197979. 3128n Expand 6 - 6 + 2d2 + 161d*2 - 79d*2 - 84d*2 - 19 + (-3d - d + 2d)(1 - 1 + 3d) - 4 + d2 + 4. -5d*2 - 19 Expand -50i*2 + 16i*2 + 136i*2 + (7 - 5 + 11)(-4i2 + i2 + i2) - i2 - 3i*2 + 5i2 - 1 - i2 + 1. 76i2 Expand (0r*3 + 16r*3 + 8r*3)((-1 - 2 + 4)(-3r - 30r + 0r) + 0r - r + 3r + 2r + 0r - 3r). -768r*4 Expand (-2t*2 + 3t*2 + 13t*2 + 45t*2)(6448t2 - 58t*3 - 6448t*2). -3422t*5 Expand (-70 - 78 - 2)(-3r2 + 0 + 0)(22r2 + 7 - 7). 9900r*4 Expand (5w - 5w - w)(43w3 - 7w*3 + 21w3) + (-w2 - 3w2 + 3w*2)(-2w2 + 0w*2 + 3w*2) + 3w4 - w3 + w*3. -55w*4 Expand (-298 + 1025 + 127)(-f - 2f - f). -3416f Expand (2 + 2 + 0)(2 - 2 - 1)(-2 + 1 - 1)(1849v + 165443 - 165443). 14792v Expand (31 - 133 + 271 + (1 - 3 + 1)(2 - 3 + 2) + 2 - 2 - 3)(0r - 2r + 0r)(0r + 2r + 0r) - 2r2 + 0r + 0r. -662r*2 Expand (-1434z + 1226z + 2622z + 1279z)(0 + z + 0 + (-z + 2z - 3z)(3 - 1 + 0)). -11079z*2 Expand (-24 - 5 + 9)(199 - 95 - 48)(-2 + 2 - 2t*2). 2240t*2 Expand -2a + 2a + 6a + 0a + 3a - 2a + 4a + 3a - 5a + 3 + a - 3 + (-a + 0a + 2a)(-4 + 7 - 1) + 0a + 3a - a + (4 + 5 - 6)(-2a + a + 8a). 35a Expand (46 + 11 + 26)(0 + 1 + 1)(-5o - o + 5o)((1 + 0 + 0)(-1 + 0 - 1) + 4 - 5 - 11). 2324o Expand (-2 + 2 - 3s2)(1077 + 1762 - 464 + 473). -8544s2 Expand (-6 + 4i*2 + 6)(-27 + 1441i + 28 - 1). 5764i*3 Expand -4o*4 + 2o - 112o3 + 112o*3 + (1 - 2o - 1)(93o*3 - 1531o + 1531o). -190o*4 + 2o Expand (-3 + 0 + 1)(s2 + 108s*3 - 15400532s - 1 + 15400532s). -216s*3 - 2s*2 + 2 Expand (767v + 905 + 43v - 201v + 432v - 899)(2v3 - 6v*3 + 0v*3). -4164v*4 - 24v*3 Expand (-8m - 4m + 8m)(220m + 578m + 731 - 736). -3192m*2 + 20m Expand (3v + v + v)(2 - 14v - 2) + 5v2 - v2 - 3v2 + (-1 + 3 + 0)(-6 - 4v2 + 6). -77v*2 Expand 36o*5 + 2o*5 - 8o5 - o5 - 3 + 3 + (-40 + 40 + 10o4)(o + 1 - 1) - 2o5 - 2o*4 + 2o*4. 37o5 Expand (-g2 - 4g3 + g2)(-204g2 + 5 - 4 + 76g*2). 512g*5 - 4g*3 Expand -12628h*2 + 228h*5 + 12628h*2 + (-2h - 2h2 + 2h)(-4 + 4 - 3h3) - h5 + 1 - 1 + 5. 233h5 + 5 Expand (56y*3 + 1532y*3 + 426y*3)(2y2 - y2 + y2) + y5 + 2y5 - y5. 4030y5 Expand (-a + 6a - 3a + (3 - 17 - 12)(2a + 0a + 2a))(-4 - 2 + 3). 306a Expand (-3z + 3z - z)(2z + 2z - 2z) + (3 - 4 - 1)(-2z2 + 2 - 2) - 5z2 + z2 + 5z2 + (-4314 + 243 + 2239)(-3z + 3z + 2z2). -3661z*2 Expand (2s*2 + 5s2 - s2 + (8s - 2s - s)(-2s + 2s + 2s) + (1 + s - 1)(s + 0s + 0s) - 2s*2 + 0s*2 + 0s*2)(-2s2 - s2 - 2s*2). -75s*4 Expand (298555 + 291d*3 - 298555)(-3 + d*2 + 3). 291d*5 Expand (4 + 3 - 3)(-49 - 53 + 111 - 10m2). -40m*2 + 36 Expand 0c + 0c + c2 + (-5c + 2c + 2c)(0c + c - 2c) - 5 + 7c*2 + 5 + (4c - c + 3c)(-3 - 11c + 13c + 11). 21c2 + 48c Expand (s + 0s - 2s)(-3s - 26 + 26) + 20 - 20 + 16s2 - s + 3s*2 + s. 22s*2 Expand (-2 + 2 - 3p*4)(-3p - p + 3p) - 10p4 + 4049p5 + p4 - 2p4 + 2650p*5 + 11p*4. 6702p*5 Expand (26q - 311q - 9q - 35q)(9 - 12q2 - 9). 3948q*3 Expand 343i*2 - 94152 + 94152 + (2i + 1 - 1)(i + i - i) - 3i + 3i + 2i*2. 347i*2 Expand (-18j - 85 + 85)(-4 + 4 - j) - 2j*2 + 4j2 - j2 + (-18 - 28j + 18)(-j + 1 - 1). 47j2 Expand (6m*3 - 4m3 - m3)(-2m + 2m + 4m - 36m - 32m + 21m + (m - m + 3m)(-1 - 2 + 0))(0m + 0m - m). 52m5 Expand (3h*2 + 6h*2 + 2h*2)(-2h + 2h - 4h) + 3h*2 + 5h*3 + 41h - 41h. -39h*3 + 3h*2 Expand (103 - 59 - 1 + 174)((0y + 2y - 4y)(0y - y + 2y) - 11 + 11 - 29y2). -6727y*2 Expand 11g + g - g + 3 + g + 0g + g + (-g - 3g - 2g)(1 - 1 - 3). 31g + 3 Expand (-3 + 3 + 1)(3 - 3 + 2)(0 + 2 - 3)(10a - 15a - 43a)(1 - 2 + 0). -96a Expand (3092a - 3093a + 14044 + 3730)(-4 - 2 + 4). 2a - 35548 Expand 6a*5 + 23a*5 + 7a*5 + (40 + 24a*3 - 40)(-2a2 + a2 + 0a*2). 12a*5 Expand ((8 - 8 + 13)(j + 4j - 6j) - 4j - 3j + 4j + 2j + 5 - 5 + 4j - 4j + 2j + (0 - 1 + 3)(-2j + 0j + 3j) + j + 3j - 2j)(0 + 1 - 3). 16j Expand (-2z*3 + 3z3 + z3)(54z - 5093 + 5103 - 16z). 76z*4 + 20z*3 Expand (4m*3 - 4m3 + m3)(0m - m + 2m) + (2m - m + m)(-2m*3 - 8m*3 + 2m*3). -15m*4 Expand (661 - 661 + 1650d)(-d2 + d2 + 2d*2). 3300d*3 Expand (-2 + 0 + 1)(3210g + 82g*4 - 3210g)(-34 + 18g + 11g - 27g). -164g5 + 2788g*4 Expand (-30x + 33x + 31 - 1)(-x + 11x + 5x) + 0x + 0x - 2x2. 43x*2 + 450x Expand (0 + 0 + i)(61 + 146 - 2875). -2668i Expand (3 + 0 - 2)(-2b2 - b2 + 5b2)(-2403b + 649b - 867b). -5242b*3 Expand -c - 1 + 1 + (-2 - 1 + 5)(-4c + 3c + 0c) + 3c - 3c + c + 6c - 2 + 2 + 0c + 50 + 3c + 6c + 101 - 16c. -3c + 151 Expand (4 + 0 - 2)(136d - 348d + 143d) + 0 + 0 + 2d - 7d + 0d + 0d + (0 - d + 0)(-1 - 1 + 4) + 4d - d - 5d + d - 3d + d - 2d + 4d - d. -147d Expand (-3g3 + 0g3 + g3)(141 + 0g2 - g2 + 5298). 2g5 - 10878g*3 Expand (-7c*3 + 12c*3 + 7c*3)(2c2 - 106c - 7 + 1260c + 6). 24c*5 + 13848c*4 - 12c*3 Expand ((-3 - 3 + 4)(5h - 3h - h) - 3 - h + 3)(3h*3 - 13h + 13h + (-45h + 34h + 51h)(0h*2 - 9h*2 + 3h*2)). 711h*4 Expand (8 + 4 - 1)(2c5 + 24748c*4 - 24748c*4 - 16). 22c*5 - 176 Expand ((j - j + j)(4 - 2 - 1) - 595 + j + 595)(-j3 + 0j3 - j3 + (j2 - j2 - 2j3)(2 + 1 - 5) - 2j3 - 2j*3 - 7j*3). -18j*4 Expand -2o - 1 + 1 + (-1 - 4 + 3)(1 - 1 - 2o) - 1 - 2o + 1 + o + 3 - 3 + (-1 - 2 + 5)(-76 + 188 - 87)(o + 1 - 1). 51o Expand (-155 + 152 + 510u - 58u)(3 - 1 - 1). 452u - 3 Expand (-29y2 - 29y*2 + 17y*2)(-2 + 1 - 10)(4 - 4 - 1). -451y*2 Expand (-4c + 0c + 5c)(-1 + 3 - 4) - 2c + 5 - 5 + 7153c + 9815c + 7309c + 5c + c - 5c. 24274c Expand 13b4 + 55 + 72 - 177 + (2b*2 + 0 + 0)(2b + b2 - 2b). 15b4 - 50 Expand (-3x*2 - 1190x - 12 + 1190x)(24x + 12x - 7x). -87x*3 - 348x Expand (15 + 10 - 8)(-1 + 4 - 2)(0 - 4 + 6)(-2v*3 - 2v*2 + 2v*2 + 3v*3 + 3v*3 - 4v3 + (v2 + 3v2 - 5v*2)(1 - 1 - 2v)). 68v*3 Expand (153 - 96 + 172)(289 - 289 - 16q4). -3664q*4 Expand (0 - 5 - 1)(-87z + 7z - 12z) + 5z - 2z - 1 + 0z. 555z - 1 Expand -u5 + 3u5 - u5 + (4u - 4u + 2u5 + (-u2 + u2 + u5)(62 - 7 + 27))(1 - 2 - 2). -251u*5 Expand (13g + g + 2g)(-2 - 3 + 2) + (1 + 2 - 2)(-3 + 3 - 2g). -50g Expand -237v*3 + 16v - 2v4 + 237v*3 + (-2v*2 + 3v - 3v)(-3v2 + 0v2 + v2) + 0 - 2v4 + 0 + 2v*4 - 1 + 1 - 7v*4 + 11v*4 - 7v4. -v4 +	{ "pile_set_name": "DM Mathematics" }
st derivative of 0 - h - 5o3 + 3o - 3o wrt o. -15o*2 Let u(l) be the third derivative of 17l7/210 + l6/120 + 11l4/24 + l3/2 - 11l*2. What is the second derivative of u(m) wrt m? 204m*2 + 6m Let n(y) be the first derivative of 0y + 0y*4 - 9/5y*5 - 4 + 3y*3 + 0y*2. What is the third derivative of n(a) wrt a? -216a Let n(i) be the third derivative of -71i6/60 + 128i*3/3 + 241i*2. What is the first derivative of n(j) wrt j? -426j*2 Let a = 0 - -13. Let y be 4/9(-27)/(-6). Find the second derivative of -yv2 + 20 - 33 + a + 2v wrt v. -4 Let i(x) = -84x2 - 126. Let p(a) = -42a*2 - 63. Let n(f) = -3i(f) + 5p(f). Differentiate n(h) with respect to h. 84h What is the third derivative of -411p2 + 120p*2 + 58p*4 + 125p*2 + 48p*4 + 123p*2 - p wrt p? 2544p Suppose 5f = 10f. Suppose 3h = -s + 10 - f, 0 = -h + 3s. Find the third derivative of -2z2 - 6z*4 - 194z*3 + 194z*h wrt z. -144z Let c be (-2)/1 + -5 + 1052 + 0. What is the third derivative of -1045j3 + 46j*5 + cj*3 + 27j*2 wrt j? 2760j*2 Differentiate -7y - 54 - 32 + 4y + 414y - 21 wrt y. 411 Let s be -10 - -6 - (-8 - -4). Let q(p) be the first derivative of 0p3 + 0p*2 - 4/5p*5 - 6p - 6 + sp4. Differentiate q(y) with respect to y. -16y*3 Let s(p) = 6p - 234. Let w(c) = 5c - 239. Let f(b) = 2s(b) - 3w(b). Differentiate f(g) wrt g. -3 Find the second derivative of 2350 + 11m - 11m3 - 2350 wrt m. -66m Find the first derivative of -36s + 42 + 75s + 18 - 15 wrt s. 39 Let b be -1 + 2/48. What is the second derivative of -33o + 16ob + 14o - 28o3 wrt o? -72o Let a(k) be the first derivative of -k*4/4 + 9k*3 + 12k*2 + 3k + 239. Find the second derivative of a(s) wrt s. -6s + 54 Let y(l) be the first derivative of -181l*5/5 - 136l*3/3 + 120. What is the third derivative of y(x) wrt x? -4344x Suppose -9a - 3y = -4a - 14, a - 12 = 4y. Suppose -aw + 22 = 5o - 2o, -o + 4w = -2. Differentiate -3x2 - 9x + o + 9x wrt x. -6x Suppose 5h - 5s = 100, 5h + 0s - 3s = 104. Let w be 1/(((-28)/88)/(-7)). What is the third derivative of w + 9k*2 - h - 4k*6 wrt k? -480k*3 What is the derivative of -156y*2 + 65 - 2y + 2y - 86y*2 + 13y*2 wrt y? -458y Let m(t) be the first derivative of -13/3t3 + 3t*6 + 0t + 0t4 + 13 + 0t*5 + 0t*2. Find the third derivative of m(a) wrt a. 1080a*2 Let s(j) be the third derivative of -223j*8/336 - 10j*5/3 + 537j*2. Find the third derivative of s(t) wrt t. -13380t2 Let o(r) = r3 - 8r2 + 7r + 2. Let k = -5 + 12. Let w be o(k). What is the third derivative of 5s3 - 2s*w - 3s*2 + 5s*3 - 3s*3 wrt s? 42 Find the third derivative of -74b*3 + 8b*3 - 86 + 16b3 + b2 wrt b. -300 Let q = 4089/2 - 2041. Let b(t) be the second derivative of 1/2t4 + 0 - qt*2 + 0t*3 - 12t. What is the first derivative of b(y) wrt y? 12y Let v(f) = 766f*2 - 256f + 17. Let n(i) = -256i2 + 85i - 6. Let p(o) = 17n(o) + 6v(o). Find the second derivative of p(a) wrt a. 488 Let i(y) be the second derivative of 27y5/5 + 137y*2/2 + 88y. Differentiate i(m) with respect to m. 324m2 Let p(w) = -w2 + 7w - 4. Let a be p(6). Suppose -23 = -5k + a. Find the second derivative of 0i - 2i2 + 7i - ki wrt i. -4 Let f(a) be the second derivative of -3a*6/40 - 3a*5/10 + 4a*4 - a. Let c(o) be the third derivative of f(o). Find the first derivative of c(l) wrt l. -54 Let j = 127 + -125. Find the third derivative of 17m*j - 22m*3 - 130m - 131m + 261m wrt m. -132 Let u(r) be the first derivative of 74r5/5 - 117r - 211. Differentiate u(s) with respect to s. 296s3 Let b be (123 - 123)/(4/2 + 0). Let h(y) be the first derivative of by*3 - 1/5y*5 + 2y*2 + 0y*4 + 5 + 0y. Find the second derivative of h(v) wrt v. -12v2 Let g(y) = y3 + 3y*2 - 3. Let l be g(2). What is the derivative of lm - 1 - 2 - 5m - 4 wrt m? 12 Let k(s) be the second derivative of -85s*7/7 - 32s*3 + 368s. Find the second derivative of k(z) wrt z. -10200z3 What is the third derivative of 645 + 322m*2 + 643 - 1288 + 538m*3 wrt m? 3228 Let g(i) be the second derivative of -19/12i*4 + 0i*2 - 21i - 9/20i5 + 0 + 0i*3. Find the third derivative of g(z) wrt z. -54 Let c = -20 + 12. Let b be 76/16 - 2/c. What is the second derivative of 5z - 15z4 + 15z*4 - 4z*b + 3z*5 wrt z? -20z3 Let l(b) = b2 + 12b + 16. Let m be l(-11). What is the second derivative of -4c + 10c5 - 2c*m + 0c*5 + c wrt c? 160c3 Let s(y) be the first derivative of y10/120 - y*6/180 - 2y*3 + 6. Let x(h) be the third derivative of s(h). What is the third derivative of x(z) wrt z? 5040z*3 Let l(q) be the third derivative of 121q8/336 + q5/20 - q*4/8 + 54q*2. Find the third derivative of l(k) wrt k. 7260k*2 Let y(c) be the first derivative of -4 + 0c*2 + 0c + 9c3 + 29/4c4. What is the third derivative of y(q) wrt q? 174 What is the first derivative of -93 - 12 - 11 - w2 - 3w wrt w? -2w - 3 Let h(x) = -1. Let c(n) = -n - 6. Let o(a) = 2c(a) - 11h(a). Let l be o(-3). Find the third derivative of v*6 + 15v*4 - 15v4 + v6 - lv2 wrt v. 240v*3 Suppose 12g = 8g + 44. What is the third derivative of -7m*3 - 5m*3 + gm - 11m + m2 wrt m? -72 Let f(y) be the second derivative of -61y*5/10 - 117y*2 + 23y - 2. What is the first derivative of f(o) wrt o? -366o2 Suppose 0c = 2c. Suppose c = -2k + 5n + 8, -4k - 5 = -4n - 21. Find the second derivative of -2 + 2 + kg*5 - 8g*5 - 8g wrt g. -80g3 Let x = -28 - -36. Find the second derivative of -xi*5 - 3i + 5i + i wrt i. -160i*3 Let d(h) be the third derivative of 79h*7/42 + 4h*3/3 + 195h*2. Differentiate d(n) with respect to n. 1580n*3 Let k = -12 + 12. Suppose 3f = -5x + x, k = -f - 4. Find the third derivative of 17r2 - r3 + 2rx - 14r2 wrt r. 6 Let d(x) = x2 + 7x - 7. Let j be d(-8). Let p be (-3 + j)4/(-2). What is the second derivative of -4q + 4q*4 + 3q*p - 6q*4 + 4q*4 wrt q? 60q*2 Suppose -5g + 6 - 1 = 0. Find the first derivative of -g + 4a3 - 13a*3 + 7 - 8 wrt a. -27a*2 Let b = 87 - 73. What is the first derivative of -23 - 13 - bn*4 + 19 wrt n? -56n*3 Let a(w) = 4w*2 - 2w - 1. Let c be a(-1). Suppose -2b = 2y - b - 4, -cy + 9 = 3b. Find the second derivative of 5h - h - 5h*5 + 5h - yh5 wrt h. -160h*3 Let v be (-4 - 1 - -10) + -3. Let h(y) = -7y + 1. Let t be h(-1). What is the second derivative of 6zv + tz - 7z - 2z*2 wrt z? 8 Let t(s) = 203s*3 - 7s*2 - 873s - 7. Let n(z) = -103z3 + 4z*2 + 436z + 4. Let a(w) = -7n(w) - 4t(w). What is the second derivative of a(q) wrt q? -546q What is the second derivative of -8o*2 - 74o*5 + 5o*2 + 2o2 - o2 - 207o - 294o*5 wrt o? -7360o3 - 4 Let f(w) be the second derivative of -w8/24 - 5w4/3 + 31w*2/2 + 41w. Let d(o) be the first derivative of f(o). Find the second derivative of d(y) wrt y. -280y3 Find the third derivative of -5356c*2 - 811c*4 + 2538c*2 + 2329c*2 wrt c. -19464c Suppose -6n + n - 38 = -4t, -5n - 3 = t. Suppose -to + 3 = -4o. Find the first derivative of -o + 0 - 7g*2 + 2 + 0g*2 wrt g. -14g Let m = -60 - -101. Suppose m = 5i - 4. What is the second derivative of 10z*3 + iz*3 + 10z - 9z3 wrt z? 60z Suppose 6 = x - 2d - 1, -4x + 21 = -d. Let l = 10 - x. Differentiate 0o3 - 4 + lo*3 - 3 + 2 wrt o. 15o*2 Let f(d) be the second derivative of -749d6/30 - d5/20 + 149d4/6 + 8d - 53. What is the third derivative of f(p) wrt p? -17976p - 6 Let k(n) = 7n*2 - 34n - 141. Let f(b) = 8b2 - 33b - 148. Let h(m) = -6f(m) + 7k(m). What is the first derivative of h(t) wrt t? 2t - 40 What is the third derivative of -3d - 3d2 - 15d - 2d - 131d*3 + 5d*2 wrt d? -786 Find the third derivative of 297287v - 297287v + 100v*3 - 41v*2 wrt v. 600 Let b(v) = -10v*3 - 169v*2 - 452v - 7. Let f(r) = -7r3 - 113r*2 - 302r - 5. Let d(g) = -5b(g) + 7f(g). What is the second derivative of d(a) wrt a? 6a + 108 Suppose 3i + 26 = 5x, i = x - 0i - 6. Suppose -f - f + 7	{ "pile_set_name": "DM Mathematics" }
s 111 divide 5217? True Does 17 divide 1802? True Is 47 a factor of 1222? True Is 14491 a multiple of 99? False Is 12 a factor of 1161? False Is 71 a factor of 53948? False Is 7 a factor of 1895? False Does 44 divide 9276? False Does 109 divide 1417? True Is 231 a factor of 28032? False Is 8 a factor of 4465? False Is 1575 a multiple of 6? False Is 1922 a multiple of 9? False Is 1608 a multiple of 24? True Is 20 a factor of 140? True Does 173 divide 14705? True Does 3 divide 100? False Does 21 divide 362? False Is 13 a factor of 51? False Does 11 divide 17412? False Is 3400 a multiple of 34? True Does 8 divide 544? True Does 6 divide 10272? True Is 3274 a multiple of 16? False Is 48 a multiple of 2? True Is 63 a factor of 43874? False Is 17 a factor of 6293? False Is 7 a factor of 257? False Is 216 a multiple of 9? True Does 28 divide 2552? False Is 20 a factor of 160? True Does 19 divide 10211? False Does 6 divide 21156? True Is 12 a factor of 12096? True Is 117 a factor of 10955? False Does 331 divide 8734? False Is 312 a multiple of 6? True Does 33 divide 82401? True Is 4407 a multiple of 39? True Is 3 a factor of 276? True Is 8324 a multiple of 138? False Does 72 divide 2609? False Is 15 a factor of 6128? False Is 45 a factor of 1286? False Is 27977 a multiple of 39? False Is 22 a factor of 10736? True Is 21 a factor of 1827? True Does 62 divide 1505? False Does 13 divide 78391? False Is 7682 a multiple of 9? False Is 340 a multiple of 5? True Is 6472 a multiple of 18? False Is 18 a factor of 309? False Is 129 a multiple of 12? False Is 22617 a multiple of 58? False Does 79 divide 19418? False Does 45 divide 8317? False Is 5580 a multiple of 31? True Is 8 a factor of 816? True Is 10227 a multiple of 4? False Is 244 a factor of 41480? True Is 1275 a multiple of 22? False Is 3 a factor of 12? True Is 4 a factor of 204? True Is 23920 a multiple of 65? True Does 6 divide 2220? True Is 6713 a multiple of 124? False Is 57 a multiple of 23? False Is 246 a multiple of 11? False Does 24 divide 4776? True Is 24 a factor of 60576? True Is 18 a factor of 8741? False Is 30 a factor of 1225? False Is 1944 a multiple of 8? True Is 7 a factor of 105? True Is 38 a factor of 382? False Is 83116 a multiple of 42? False Does 71 divide 333? False Does 30 divide 84819? False Does 30 divide 46350? True Does 21 divide 689? False Does 55 divide 1815? True Is 10220 a multiple of 20? True Does 27 divide 2241? True Is 576 a multiple of 16? True Is 42 a factor of 3864? True Is 24 a factor of 1002? False Is 55 a factor of 128477? False Is 9958 a multiple of 81? False Is 1404 a multiple of 18? True Is 266 a multiple of 23? False Is 1334 a multiple of 46? True Is 1334 a multiple of 8? False Is 45 a factor of 5745? False Is 46 a factor of 35650? True Is 24 a factor of 72? True Is 5 a factor of 77995? True Is 24 a factor of 8438? False Is 50 a factor of 116250? True Is 1814 a multiple of 62? False Does 30 divide 1745? False Does 4 divide 656? True Is 39 a multiple of 16? False Does 19 divide 7144? True Is 12 a factor of 1332? True Is 7 a factor of 7760? False Is 886 a multiple of 41? False Is 1236 a multiple of 4? True Does 8 divide 13278? False Is 504 a multiple of 12? True Is 50 a multiple of 22? False Is 64023 a multiple of 364? False Is 33 a factor of 13431? True Is 75 a factor of 1928? False Is 6 a factor of 234? True Is 8 a factor of 884? False Does 29 divide 185? False Is 579 a multiple of 81? False Does 23 divide 759? True Is 9 a factor of 19? False Is 17 a factor of 5019? False Is 2941 a multiple of 173? True Is 1077 a multiple of 17? False Does 30 divide 2854? False Is 3210 a multiple of 5? True Is 16727 a multiple of 42? False Does 96 divide 3434? False Is 37 a factor of 1332? True Is 5934 a multiple of 23? True Does 31 divide 701? False Is 133 a factor of 14630? True Does 9 divide 10035? True Does 17 divide 187? True Is 5604 a multiple of 32? False Is 2410 a multiple of 10? True Is 4231 a multiple of 96? False Is 48 a factor of 21456? True Does 16 divide 192? True Is 100 a multiple of 3? False Is 34 a factor of 5610? True Is 26 a multiple of 13? True Is 162 a factor of 2592? True Is 44 a factor of 528? True Does 21 divide 53288? False Is 6110 a multiple of 130? True Is 10 a factor of 12603? False Is 8505 a multiple of 45? True Is 912 a multiple of 12? True Is 115491 a multiple of 137? True Does 18 divide 8244? True Is 1594 a multiple of 51? False Does 7 divide 1956? False Does 66 divide 24750? True Does 30 divide 12215? False Does 86 divide 18662? True Is 9 a factor of 159? False Is 11716 a multiple of 101? True Does 19 divide 2546? True Is 29 a factor of 71132? False Does 15 divide 13393? False Is 3 a factor of 2051? False Is 9 a factor of 2153? False Does 287 divide 40467? True Is 165 a factor of 76725? True Is 20860 a multiple of 20? True Is 678 a multiple of 58? False Does 20 divide 2860? True Is 128 a factor of 7040? True Is 60 a factor of 1560? True Is 143 a factor of 60532? False Is 147 a factor of 3910? False Does 37 divide 6103? False Does 41 divide 1599? True Does 4 divide 192? True Does 5 divide 295? True Does 38 divide 8892? True Does 9 divide 489? False Does 9 divide 1869? False Does 12 divide 13284? True Is 15 a factor of 3885? True Is 52 a factor of 676? True Does 31 divide 895? False Is 15 a factor of 3623? False Does 15 divide 38415? True Is 2 a factor of 58? True Does 23 divide 2180? False Is 42 a factor of 1464? False Is 48 a factor of 67? False Is 322 a multiple of 16? False Does 11 divide 99? True Is 43 a factor of 5117? True Is 73 a multiple of 5? False Is 7500 a multiple of 25? True Is 68 a factor of 3305? False Does 93 divide 3356? False Is 9 a factor of 3933? True Is 18 a factor of 4518? True Does 4 divide 8? True Is 2830 a multiple of 10? True Is 96 a factor of 8448? True Does 31 divide 3875? True Is 30456 a multiple of 216? True Is 3 a factor of 89? False Is 76 a factor of 4028? True Is 1384 a multiple of 11? False Is 44 a multiple of 11? True Does 28 divide 20895? False Does 7 divide 271? False Is 1819 a multiple of 46? False Does 77 divide 8239? True Is 59 a multiple of 9? False Is 6441 a multiple of 155? False Does 26 divide 832? True Is 664 a multiple of 9? False Is 60 a factor of 8376? False Is 24 a factor of 42504? True Is 14 a factor of 13454? True Is 18 a factor of 4662? True Is 89 a factor of 801? True Is 170 a factor of 65117? False Does 120 divide 53640? True Does 52 divide 40425? False Is 5819 a multiple of 38? False Is 5095 a multiple of 15? False Is 123 a multiple of 11? False Does 2 divide 9616? True Is 39 a factor of 3510? True Is 1140 a multiple of 9? False Is 71 a factor of 59214? True Is 13 a factor of 1196? True Is 22627 a multiple of 78? False Does 31 divide 107? False Does 182 divide 26839? False Does 17 divide 2576? False Is 36 a factor of 9504? True Does 20 divide 800? True Is 26 a factor of 788? False Is 2272 a multiple of 142? True Does 2 divide 4317? False Is 75 a factor of 64271? False Is 450 a multiple of 18? True Is 1377 a multiple of 17? True Is 24639 a multiple of 43? True Is 42933 a multiple of 33? True Is 728 a multiple of 91? True Is 13 a factor of 5356? True Does 4 divide 32546? False Does 10 divide 3858? False Does 19 divide 1080? False Is 2 a factor of 118? True Is 13 a factor of 729? False Is 8 a factor of 6800? True Is 11448 a multiple of 54? True Is 118 a factor of 25742? False Is 29 a factor of 79965? False Is 25 a factor of 175? True Is 11 a factor of 793? False Is 6 a factor of 190? False Is 9 a factor of 57308? False Does 10 divide 130? True Is 16 a factor of 3863? False Is 5120 a multiple of 106? False Is 1071 a multiple of 21? True Is 5 a factor of 39? False Is 3 a factor of 118? False Does 33 divide 2079? True Is 3854 a multiple of 94? True Is 46240 a multiple of 176? False Does 170 divide 4760? True Is 21 a factor of 66? False Does 67 divide 3007? False Does 21 divide 1198? False Is 7257 a multiple of 177? True Does 5 divide 1871? False Is 1071 a multiple of 17? True Does 2 divide 88? True Is 294 a multiple of 21? True Does 45 divide 7155? True Is 18 a factor of 918? True Does 6 divide 2333? False Does 37 divide 687? False Does 9 divide 360? True Is 13 a factor of 1454? False Is 5	{ "pile_set_name": "DM Mathematics" }
= -5z + 2, 30 = -3q + 4z. Give g(q). -2 Let t(r) = -2r*3 + 14r*2 - 16r - 1. Let m(v) = -v*3 + 7v*2 - 8v. Let c(q) = -5m(q) + 3t(q). Let f be (4 - 2)(-104)/16. Let j = f + 19. What is c(j)? -15 Let c be 17/3 + (-3 - 14/(-6)). Suppose -2s - 26 = 6x - x, 0 = -cs - 3x - 27. Let m(y) = 20y. Let r(k) = -7k. Let d(l) = 5m(l) + 14r(l). Determine d(s). -6 Let b be (2 - 8/6)3. Let h(r) = 6r2 - 13r*b + 0r*2 + 1. Suppose 2m = 4m + 2. What is h(m)? -6 Let n(w) = -w - 1. Suppose 4j + x = 5 - 18, 2x = -4j - 18. Let b = j + 11. Suppose 4u = -b - 3. Calculate n(u). 2 Let h(n) be the second derivative of -11n*3/3 - 3n*2/2 + 5n + 64. What is h(1)? -25 Let j be (2/4)/(((-1)/(-62))/1). Let i(g) = -31g + jg + 1 - 4g2 - 2g2 - g3. What is i(-6)? 1 Let p be 16 - -77(-1)/7. Let f(m) = m - 3 + 2 + 4. Calculate f(p). 8 Let s(u) = -4u*2 + 7u - 5. Let i(m) = 13m2 - 19m + 14. Let c(p) = -4i(p) - 11s(p). Give c(-1). -8 Let g = -554 - -549. Let l(o) = -o*3 - 3o*2 + 3o - 6. Calculate l(g). 29 Let b(r) be the second derivative of -r*5/20 + 5r*4/6 + 13r*3/6 - 7r*2 - 77r. Determine b(11). 8 Let b(i) be the third derivative of i4/24 + i2. Let v = 157 - 117. Let f = v + -36. Give b(f). 4 Suppose -3f - 49 = -5s - 42, 1 = -5s + f. Let m(u) = -u3 - u2 + 1. Let i(h) = 5h3 - h2 + h + 3. Let c(x) = i(x) - 3m(x). Give c(s). -7 Let l(o) = -36o*2 + 18o*3 + 65o*2 - 28o*2 - o. Determine l(1). 18 Let m(o) = -2 + 1 + 4 + 2o*2 - 8o. Suppose 945 = 208z - 19z. Determine m(z). 13 Suppose 0 = 2o - 7o + 45. Let a(j) = 2 + 4 + j*2 - o + 5j. Give a(-5). -3 Suppose 0 = -17c + 369 + 73. Suppose 4p + 10 = 130. Let j = c - p. Let x(m) = -m. What is x(j)? 4 Let i(d) be the third derivative of d*5/60 - 3d*4/4 + 13d*3/6 + 257d*2. What is i(18)? 13 Let a(i) = 2i - 7. Let b(k) = 1. Let l(u) = a(u) + 6b(u). Let s(d) = 2d + 8. Let r be s(6). Suppose 0 = z - q - 7, r = -2z + 4z - 4q. What is l(z)? 7 Let w(n) be the second derivative of n5/20 - n4/6 - 2n*3/3 + 2n + 184. Determine w(-2). -8 Let i(x) = -x*3 + 9x*2 + 11x + 6. Let m be -20(0 + ((-5)/2 - -2)). Determine i(m). 16 Let d be (2/(-1))/(-2 - -1). Let n(f) = f2 - f + 2. Let a be n(0). Let l(s) = 0s2 + s3 - 2s + 2 - 5s2 + sd - s*a. Give l(5). -8 Let a(g) = 3g - 12. Let q(w) = 4w - 17. Let u(t) = 7a(t) - 5q(t). Let n = -4 - -3. Give u(n). 0 Suppose 0 = 17k - 18k, -3l = 3k - 3. Let o(s) be the first derivative of s4/2 + s3/3 - 2. Give o(l). 3 Let f = -10 - -98. Let r(z) = -87 - 9z*2 + 8z2 + z3 + f. Let c be 0/(1 + (0 - -1)). Calculate r(c). 1 Let a(b) = b*2 + 5b - 6. Let k = 63 - 59. Suppose kg - 9g = 30. What is a(g)? 0 Let a(u) = -5u3 - 22u*2 - 21u - 3. Let q(p) = -6p3 - 22p*2 - 21p - 1. Let o(n) = -5a(n) + 4q(n). What is o(-21)? 11 Let q(p) = -14p2 + 3p*3 + 6p*2 - 4p*2 + 22p - 2p - 11. Let c(j) = -j3 + 4j*2 - 7j + 4. Let n(m) = 11c(m) + 4q(m). Determine n(3). 0 Let l(n) = -5n3 + 3n*2 + 3n + 8. Let m(h) = 6h3 - 4h*2 - 4h - 9. Let b(s) = -5l(s) - 4m(s). Calculate b(3). 35 Let f(u) = 10u + 2 - 4 - 14u + 9u - 11. Calculate f(3). 2 Let t = 6 - 4. Let x(r) = 3r2 - rt - 2 - r*2 + 2r. Let q be 1/(-5)(-51 + -9)/4. Give x(q). 13 Let n(h) = -14h + 169. Let r be n(9). Let u = 13 - 9. Let a(q) = -r + 42 + 5q2 - uq2. What is a(2)? 3 Let s = 118 - 119. Let t(p) = -p3 - 7p2 - 7p + 3. Let k(y) = y - 2. Let v(q) = st(q) - k(q). What is v(-6)? -1 Let u be -3 - (2 - 1) - -2. Let y(p) be the first derivative of 4p*2 + 2p - 2. Give y(u). -14 Let f(x) = x*3 + 2511x*2 - 2501x*2 + 0x*3 + 11x. Calculate f(-9). -18 Suppose 4p - 9p = 0. Let r(w) = w2 - 3. Let b be r(p). Let m(h) = -h3 - 4h2 - 3h + 4. Let d be m(b). Let v(u) = u*2 - 6u + 2. What is v(d)? -6 Let d = -101 + 101. Suppose -x + 2 - 10 = d. Let g(i) = i*3 + 9i*2 + 10i + 8. Give g(x). -8 Let x = 240 - 150. Suppose x = -7g + 10g. Suppose 9k + g = 4k. Let w(o) = -o*3 - 6o*2 - o + 6. What is w(k)? 12 Let s(o) = o. Suppose 0 = -p + 18 - 11. Suppose 0 = 4b + 4c + p + 21, 2c + 8 = b. Calculate s(b). -2 Let l(z) = -z*3 + 15z*2 - 12z + 1. Let h be l(14). Let r = h - 24. Let i(o) = o*2 - 4o - 4. Calculate i(r). 1 Let c(l) = l*2 - 5l + 25. Let x be c(8). Let o = -43 + x. Let y(n) = -n*2 + 7n - 5. What is y(o)? 1 Let x(j) = 6j2 + 3. Let d = 1245 + -1247. Determine x(d). 27 Let q(l) be the first derivative of -l3/3 - 7l*2/2 - l - 174. Suppose 0 = -2m - 2x + 3x - 14, 0 = x - 2. What is q(m)? 5 Let v = 60 + -42. Let z = 23 - v. Let a(j) = 3j + 3j - j - 5 - 4j. Determine a(z). 0 Let t(j) = -j3 + 5j*2 + 3j + 13. Let f be t(6). Let s(g) = g*3 + 5g*2 - 2g - 7. Give s(f). 3 Let s(v) be the second derivative of -v*4/12 + 5v3/6 - v2 - v. Suppose -2j + 33 = 27. Give s(j). 4 Suppose 395r + 90 = 413r. Let s(h) = -h3 + 6h*2 - 4h - 4. Determine s(r). 1 Let h(r) = -19r - 22. Let a(k) = 10k + 10. Let t(x) = 13a(x) + 6h(x). What is t(1)? 14 Let t(a) be the first derivative of 5a2/2 - 5a + 12. Let d(n) = -5n + 6. Let m(q) = -6d(q) - 7t(q). Give m(1). -6 Let d(o) = -18104 - 4o*2 + 3o*2 - 9o + 18117. Give d(-10). 3 Let x(n) be the first derivative of 19n2/2 + 4n - 447. Determine x(-2). -34 Let q(r) = -5r - 1. Let c(b) = -8 - 6b - 1 + 8. Let h(n) = 3c(n) - 4q(n). Determine h(3). 7 Let k(n) be the third derivative of n6/120 + n5/12 - n*4/4 + 7n*3/6 - 81n*2 + 5. Let t = -1 - 5. Determine k(t). 7 Suppose 0t = 5t + 35. Suppose -3b = -2b - 14. Let q(o) = 13o*2 + 23 + 2o - 6o2 - b + o3. Calculate q(t). -5 Let t(h) = -h3 + 2 + 3h*2 - 2h - 2h + 3h. Suppose -3l + 4w = -9 - 0, -4l = 5w - 12. Determine t(l). -1 Let x(z) = 2z3 + z2 + 6z - 2. Let r(c) = -c3 + c2 - c. Let n(o) = -3r(o) - x(o). Suppose -16b = 14b - 120. Determine n(b). -10 Suppose 5o = 4w - 51, -w + 2o - 6o - 3 = 0. Let t(a) = -a + 12. Give t(w). 3 Let z(r) = -r3 + 4r*2 - r + 5. Let o be z(4). Let g(j) = 0j + 15 + 5j - 4j - 15 + 6j3. What is g(o)? 7 Let a(j) = 3j*2 - 97j - 53. Let q be a(33). Let w(d) = 4d. What is w(q)? 52 Let s(h) = 13h + 0 - 14h - 7 - 1. What is s(-4)? -4 Let x(d) be the third derivative of d6/120 - d5/5 - 7d*4/12 - 19d*3/6 + 16d*2 + 4. What is x(13)? -32 Suppose 0 = 3j + 4p + 22, 0 = j + 5p. Let h be 0 + 5/j - 14/4. Let k(x) = x*3 + 3x*2 - 3x + 5. Give k(h). 1 Let l(g) = 20g - 16. Let u(b) = b + 4. Let i(j) = j + 7. Let n(f) = 3i(f) - 5u(f). Let y(m) = -l(m) - 16n(m). What is y(1)? 12 Let o(s) = 807 - 6s + 17s + 2s2 - 806. Give o(-5). -4 Let h(b) = -b3 - 4b*2 + 5b + 5. Let d be (02/4)/(-1). Suppose z - m = d, -3z - 3m - 30 = -6. Calculate h(z). -15 Let z(d) = d3 - d2 - 1. Let x be 10/(-4)(-12)/6. Suppose s = 2o - 5, o = -xs - 15 - 10. Calculate z(o). -1 Let b(w) = w - 1. Let j(h) = h*3 + 12h*2 + 6h + 10. Let p(n) = -6b(n) - j(n). Determine p(-11). 7 Let c(w) be the third derivative of 11w6/120 + w5/60 - w*4/24 - 18w*2. Give c(1). 11 Suppose f - 6 = 2c, -2c + 4f = -4c + 4. Let r(o) = 2o + 2 - 2 + 2 + 0 - 6o. Determine r(c). 10 Let w(x) be the first derivative of -7x*2/2 - 4x - 55. What is w(-2)? 10 Let s(k) = -5k2 + 13k - 1. Let a(m) = -m*2 + m - 1. Let n(c) = 4a(c) - s(c). Let d = -1964 - -1971. What is n(d)? -17 Let l(f) = f - 4. Let b be l(3). Let m be 4/(1 + 3) - b. Let p(q) = -7 + 3q2 - 8q - 9qm + 4q + 2q - q3. Determine p(-6). 5 Let y(k) = -3k + 5. Let n(w) = 5w + 9. Let b be n(-1). Give y(b). -7 Let q = -2 - -5. Suppose 27 = 3t - u - 13, 0 = -4u - 16. Suppose -qg = -t, 2g + 8 = 4y - 8. Let s(b) = -b + 14. What is s(y)? 8 Let n(f) = -f*2 + 11f + 30. Let o(w) = w - 5. Let u(j) = n(j) - 7o(j). What is u(-6)? 5 Let q(i) be the second derivative of i5/5 + i4/6 + i3/6 - 2i. Let a(f) = -f*2 - 23f - 1. Let p be a(-23). What is q(p)? -3 Let b(y) = 8y - 50y*2 - 2 + 3y + 11 + 2 + 49y2. Determine b(11). 11 Let x(c) = c - 53c*2 + 27c*2 + 44c*2. Determine x(1). 19 Let v(w) = -13w*2 - 2w - 1. Let s be (-2)/(-9(-7)/63). Determine v(s). -49 Suppose 2a + 3k - 9 = 0, -5a +	{ "pile_set_name": "DM Mathematics" }
Let o = v - 3.7. Which is bigger: u or o? o Let u = 32 + -32. Suppose 6q + u = -6. Is -2 at least as big as q? False Let l(r) = -r2 + 4r. Suppose -3s - 8 = -20. Let x be l(s). Suppose x = -q - 0q. Is q greater than 0? False Let g be 1958/(-12) - (-60)/360. Which is bigger: -164 or g? g Suppose -26 = -2p - 5t, 0 = -5p + 5t + 2 - 7. Let q = 1 + -1.1. Are q and p unequal? True Suppose 19 = -2q + 59. Let m be 0 + -2 + 48/q. Suppose 0 = 3y - y + 18. Which is bigger: m or y? m Let q = 3253/6 - 544. Let a = -2342 - -2341. Is q at least a? False Let o = -3 - -2. Let h be (0 + o)(-11 + -85). Let k = h - 478/5. Is k <= -1/5? False Let q be (-1)/(5/(-5))-4. Let s be (-4 + (-29)/q)36. Let o = s + -583/5. Which is bigger: o or 0.24? o Let f be (-23)/(-115) + 61/(-5). Let n be 0 - -43/f. Is n bigger than 1/28? False Suppose -4m + 1 = -m - 4o, 2o + 3 = m. Which is smaller: m or -0.1? m Let o(s) = -s2 - 8s - 5. Let p be o(-11). Let f be 17/(-19) + 4/p. Which is smaller: f or 6? f Let d(h) = -5h + 39. Let k be d(6). Suppose 3b + kb - 24 = 0. Is b greater than or equal to 1? True Suppose -35u = -38u - 12, -u = -2q + 4. Which is greater: q or 1/9? 1/9 Let p be (-848)/1474 - (-324)/594. Which is smaller: -1/2 or p? -1/2 Let l(j) = j*2 - 1. Let c be l(-1). Let u be (4/(-2))/((-2)/(-4)). Let d be u/(-18) + (-140)/549. Is c bigger than d? True Let d = -23.5 + 2.5. Let s = 20.94 + d. Is 2 greater than s? True Suppose -2j - 60 = 5a, -4j - 9 = a + 3. Let z = a + 10. Let r be 2/((-4)/(-3) - z). Which is greater: 0 or r? r Let s = 399 - 378. Does 19 = s? False Let o(g) = 4g2 - 33g + 19. Let t(r) = 2r2 - 17r + 10. Let a(l) = -6o(l) + 11t(l). Let q be a(7). Let z = 22 + q. Which is smaller: z or 0.3? z Suppose 16 = w - 4a, -w = -5a - 16 - 4. Let x be -3 - (w - 22 - 0). Is 20 greater than or equal to x? True Let m be (0 + 35)(-2 + 1 + 2). Suppose -9h + m = -4h. Let b be (-5)/1(-12)/10. Are b and h unequal? True Let g(a) = -a - 19. Let d be g(-16). Let r be d - (-5 - 3/2-2). Which is greater: r or 1/43? 1/43 Suppose 2x - 10 = 4x - 5b, 4x = -b + 2. Which is bigger: 5/347 or x? 5/347 Suppose -5q = 4d - 0q - 21, -q = 4d - 1. Let m be 15/25d/2. Suppose -5r = 5y - 15, -3r + 0y - 1 = -2y. Are r and m non-equal? True Let n = -2.9 + -9.1. Let x = -60 - -59.923. Let w = -0.077 - x. Which is greater: w or n? w Let f = 6 + 9. Let d = f + -19. Is d not equal to 2? True Let m(j) = 15j - 1. Let c be m(5). Let i = 76 - c. Which is greater: -2 or i? i Let a = 582 - 582.1. Are a and 0.129 unequal? True Let r = -21.9 + 8.61. Let f = -2.39 - r. Let t = -11 + f. Which is bigger: 0.1 or t? 0.1 Let u = 1805 - 2210. Is u greater than or equal to -404? False Let n = -99 + 86. Which is greater: n or -16? n Let n = 0.05 + -0.75. Which is smaller: n or -19? -19 Let a(x) = x3 - x2 - 4x - 2. Let v be a(-3). Let g = 27 + v. Let t = -5/3 - -7/4. Is g != t? True Let l = -365 - -382. Let g = -0.1 + 0. Is g <= l? True Let y = -278 - -297. Let d = -2 - -1. Which is smaller: d or y? d Let v(m) = -m + 8. Let k be v(7). Suppose -3 = 4n + k. Let f = 6446 + -6448. Is f not equal to n? True Let s be 6/12 - 150/348. Is 16/5 at most as big as s? False Let l = 843955/300768 + 53/3133. Let q = -35/12 + l. Which is smaller: q or -1? -1 Let c = 133 + -94.3. Let a = c - 39. Is a less than or equal to -23? False Let c = -15503 + 604705/39. Let x = 266/117 - c. Which is smaller: x or -1? -1 Let m = 24/127 + -487/1905. Which is greater: -11.2 or m? m Let v(l) = l*2 + 1. Let g be v(2). Suppose -g = -5u + 10. Suppose -2i = -n - 15 - 2, -2i = 3n + u. Are i and 2 unequal? True Let c = 533 + -535. Which is smaller: 9/11 or c? c Let d(c) = -c. Let s(q) = -2q - 4 - q + q + q. Let g(o) = -2d(o) + s(o). Let n be g(3). Do 1/4 and n have different values? True Suppose 490 = -u + 15u. Let s = u + 6. Does s = 43? False Let s = -6.161 - -0.141. Let k = 0.6 + -6.6. Let n = k - s. Which is bigger: -2 or n? n Suppose 2c - 16 = 2b - 5b, -2 = -3b + 5c. Let i be (-3)/(-6) + (-1)/b. Do 1.8 and i have different values? True Let n be -2 + 32/34 - -1. Let o(q) = 3q*2 - 2q - q*3 + 2 - 2q*2 - 3q + 3q. Let p be o(1). Is n greater than p? False Let w = 444/35 - 2/105. Do 13 and w have the same value? False Let b = 11/5 - 19/45. Is 3 > b? True Let w = -11 + 11. Let l be (-5)/((-15)/18) + w. Let d = -2 + l. Is d smaller than 3? False Let l(i) = i2 - 6i + 9. Suppose 2 = -2r - 3q - 3, 3r = -2q + 5. Let y be l(r). Let o be (-10 - -10) + y/(-5). Are o and -3/2 nonequal? True Suppose -r - 2q - 15 = -4r, r = -5q - 12. Suppose rx - 23 = 43. Are x and 22 unequal? False Suppose -11f = q - 12f + 8, -3q - 32 = -f. Is q <= 6? True Let k(m) = -m3 - m2 - 1. Let r be k(-2). Suppose -rp = -6p. Suppose p = -g - 1. Is 2 greater than or equal to g? True Let n be 20/(-50) + (-6)/10 - -5. Which is greater: 32/7 or n? 32/7 Let x = -15 + 14. Let k be (-3)/(-15) - (x - 268/(-140)). Which is smaller: -1 or k? -1 Suppose -2t - 7 - 5 = 0. Let g = t + 13. Let l = 12 - 6. Is g <= l? False Let k = -620 + 591. Is k at least as big as -49? True Let w(f) = 13277f2 - 13282f2 - f3 - 3 - 7 + 4f. Let o be w(-6). Which is smaller: o or -8? -8 Let b = -1131/3349 + -3/197. Suppose -6h - 12 + 18 = 0. Is h equal to b? False Let m(l) = -9l3 + 3l*2 + l - 2. Let p be m(-2). Let z be p/156 + 2/13. Suppose 4c = 2n, 0 = 6n - n. Which is greater: z or c? z Suppose -3 = -i + 5. Let o(k) = -ik2 + 2k*3 - 2k3 + k3 - 2 + 8k + 0k. Let q be o(7). Is 5 greater than q? False Let l = -1752906 + 3066462. Let n = l - 899785596/685. Let s = 2/137 + n. Which is greater: -4 or s? s Let w = 16313/15 - 1088. Is w greater than or equal to 1? False Let s(x) = 2x3 - 3x*2 + 2x + 1. Let m be s(2). Suppose -4h = -h - m. Suppose n = 5t + h, 0 = t - 4n + 3n + 3. Is -2/29 equal to t? False Suppose 5w - 22 + 122 = 0. Which is greater: w or -21? w Let m(f) = f3 + 11f*2 - 14f - 18. Let s be m(-12). Let o = s - 9. Let u be 63/(-154)(2 + (0 - -2)). Does o = u? False Let z be 2/1(6 + 5 + 326). Which is smaller: z or 672? 672 Suppose 4b - 5 = -g, b + 2g - 5 = 3g. Suppose 0 = 3q - bh + 4h + 314, -498 = 5q - 3h. Is -102 >= q? True Let g(k) = -11k - 98. Let n be g(-11). Which is greater: 31 or n? 31 Let m = 4727/15 + -5731/30. Suppose 4z = 2o - 492, -o = -0o + 2. Let c = m + z. Which is bigger: 1 or c? 1 Let u be 7 + (-2 - -1)21. Is -15 at least u? False Suppose -659x = -666x. Do x and 133 have different values? True Suppose -7o + 3 = -4o. Suppose -4a = 5x - 13, -2a + o = -5x + 2. Suppose x = -s - 10. Which is smaller: s or -10? s Let m be -1(1/(-1) + 0). Let z be (-705)/(-225) + m-3. Let r = -0.2 - -0.2. Is r greater than or equal to z? False Let k = -569 + 567.815. Let a = k - -0.085. Is -0.1 less than a? False Let d = -62 - -193/3. Suppose 0 = -52b + 49 + 107. Which is smaller: b or d? d Let j be 4771/2860 + (-16)/10. Which is smaller: 0 or j? 0 Let l = 801 - 8796/11. Let x be 0(2 + 15/(-5)). Which is smaller: x or l? x Suppose 2d + 128 + 0 = 0. Let f be d/(-10) - (-2 - -6). Is 3 less than or equal to f? False Let v(n) = -5n - 139 + 139. Suppose 0k - 5 = -5k. Let d be v(k). Which is smaller: d or -6? -6 Let y be (1 + 1 + 0)/(-4). Let k = 12 + -20. Is k > y? False Suppose -12 = 2q - 2g, -3q = -5g + 16 - 0. Suppose 6v = 2v. Suppose -3d + 7 - 37 = v. Which is bigger: d or q? q Let d = -10 - -7. Let j be (d/(-63))/(5/30). Which is bigger: j or -1? j Let i be 146/4 + ((-3)/(-6))/(-1). Does 35 = i? False Let q be (-2 - -3)(-3 - -4). Let z be q + 12/8-1. Is z < 0.05? True Let f be -2 - (2 + 1 + -33). Let k be 2528/79 - (2 + (2 - 0)). Do f and k have the same value? True Suppose 54 = x - 0c + 3c, -c = 0. Which is bigger: 387/7 or x? 387/7 Suppose 30l - 34l + 16 = 0. Let i be -51(l + 0 + -5). Are 51 and i nonequal? False Let h = 0.121 - -92.879. Let x = h - 93. Is x bigger than 4/33? False Suppose -3z = z - 20. Suppose -v + h = 2, 4 = zv + 3h + 6. Which is smaller: v or -1/5? v Let g be (-4)/16 + (-47)/4. Let y be (-355)/(-175) + g/28. Which is smaller: 3 or y? y Let n = -32.069 + 0.069. Let p = n - -33. Which is greater: 30 or p? 30 L	{ "pile_set_name": "DM Mathematics" }
- 112. What is the units digit of a? 5 Suppose 6s = 8s - 1720. Suppose 69z - 64z = s. What is the hundreds digit of z? 1 Let f be (-74802)/54 - (35/45 + -1). Let i = f + 3110. What is the tens digit of i? 2 Let y = -18 - -201. Let i = 408 - y. What is the units digit of i? 5 Suppose -84m = -77m - 7791. Let t = 2924 - m. What is the hundreds digit of t? 8 Suppose -4715102 + 3535745 = -100r + 7304143. What is the tens digit of r? 3 Let p(d) = 4d*2 - 47d + 38. Let t be p(25). Let z = -790 + t. What is the tens digit of z? 7 Let i(l) = -49l2 + 12l + 14. Let z be i(-4). Let p = z - -1153. What is the hundreds digit of p? 3 What is the thousands digit of (-150561548)/(-3048) + (-2)/(-12)? 9 Let p = 218 - 223. Let r(a) = 5a2 - 6a - 2. What is the units digit of r(p)? 3 Suppose 26l - 27 = 17l. Suppose 854 = ls + y, 9y = 2s + 8y - 566. What is the tens digit of s? 8 Suppose -3b - 114 = -2b - 3a, -a - 417 = 4b. What is the hundreds digit of (-1)/5 - 36351/b? 3 Let n = 1304 - 479. Suppose w = 4f + 203, -4w + 4f = f - n. What is the tens digit of w? 0 Let q(s) = s2 - 2s - 13. Let w be q(6). Suppose 0 = c + 2o + 1, 2o + w = -2c + o. What is the units digit of 179/5 + c/(-35)? 6 Let v = -9070 - -18657. What is the hundreds digit of v? 5 Suppose b - 96 = -5i, i + 211 = 2b + 41. Let k = -175 + b. Let h = k + 291. What is the tens digit of h? 0 What is the tens digit of 8 - -19674 - (-18 + -1)? 0 What is the thousands digit of -60 + 60 + (-28017)/(-3) - (-5)/1? 9 What is the thousands digit of 5 - -6443 - (-259)/(-37)? 6 Suppose -10 = -2v, 0 = -3q + 5v - 3v + 500. Suppose 188u = qu + 18108. What is the units digit of u? 6 Suppose 4q + 2n + 6 = -n, 8 = 4n. Let m be ((-6)/(-4))/(454/152 + q). Let z = -40 - m. What is the units digit of z? 4 Suppose 7y - 1098 = 239. Let v = -85 + y. What is the tens digit of v? 0 Let s = -426 + 91. Let z = s + 455. What is the hundreds digit of z? 1 Suppose 0 = 2k + 3w - 2554, 4k - 5942 = -3w - 840. Suppose -z - 6z = -k. What is the hundreds digit of z? 1 Suppose 1418565 = 241d - 190d. What is the units digit of d? 5 Suppose 5i + f = 1227, 17i - 12i + 4f - 1233 = 0. What is the units digit of i? 5 Let b be ((-2)/(-4))/((-4)/8) - -3. Suppose -5q + s = bs, -s = q. Suppose q = 10f - 15 - 125. What is the tens digit of f? 1 Suppose -r = -4n - 25326, -600r = -602r + 2n + 50658. What is the tens digit of r? 3 Let z = -53 - -57. Suppose -f - 3d + 35 = 0, zf = 5d - 17 + 106. What is the tens digit of f? 2 Suppose -145b = -148b + 78. Suppose 0 = bg - 992 - 4858. What is the tens digit of g? 2 Let s(a) = -1547a + 83. Let d be s(-8). Suppose 22q - d - 6307 = 0. What is the tens digit of q? 5 Let k(z) = -z2 - 266z - 1036. What is the units digit of k(-70)? 4 Let z(p) = -p*3 + 7p*2 + 5p - 5. Let j be z(6). Suppose 3y + j = -95. Let n = -23 - y. What is the units digit of n? 9 Let m(u) = 2u*2 + 18u + 9. Let t be m(-9). Let o(w) = 2w2 - 15w + 21. Let q be o(t). Let k = -23 + q. What is the units digit of k? 5 Suppose 4p + 3k = 15944, -2p - 4k = -2050 - 5922. What is the thousands digit of p? 3 Suppose 0 = -l + 2t + 3t - 1548, 0 = 4l + t + 6108. Let u = -191 + 179. What is the units digit of l/(-6) - (-8)/u? 4 Let t(r) = -397r + 27. Let c be t(-3). Suppose -6w + c = -2088. What is the units digit of w? 1 Suppose -4y - 2008 - 3096 = -5k, k - 2y - 1016 = 0. Let t = 1749 - k. What is the units digit of t? 5 Let i(h) = -65h - 5h*2 + 67h - 36 + 6h2. What is the tens digit of i(16)? 5 Suppose 37s - 5462 = 36s + 5k, 5s + 5k = 27250. Suppose -s = 11p - 19697. What is the thousands digit of p? 1 Let w be (-2)/(-8) + 49/28. Suppose 0 = wc - 3c + 961. What is the tens digit of c? 6 Let p be 2142/510/4. Suppose 5264 = 10y + p. What is the hundreds digit of y? 5 Suppose -3m + 29 = -5n - 95, 3m - 126 = 3n. Suppose -mx - 3140 = -47x. What is the hundreds digit of x? 7 Let a = -10945 + 15352. What is the tens digit of a? 0 Let r(y) = 375y - 97. Let d(m) = -188m + 50. Let p(u) = 5d(u) + 2r(u). What is the units digit of p(-4)? 6 Let z be (-12)/921(-2)/(-4). Let r be 41 + (z - -7). What is the tens digit of 31/((r + 4)/1)? 3 Let y(z) = 221z*2 - z. Let l be y(2). Suppose -4q + 1738 = -f, 2q + f + 16 - l = 0. What is the units digit of q? 4 Let t(y) = 386y + 1741. What is the thousands digit of t(0)? 1 Suppose -261r = -314r + 383084. What is the tens digit of r? 2 Let q(i) = 3i2 - 8i - 9. Let r be q(-6). Let d = 152 - r. Suppose 14 = k + dp - 55, 3k - 225 = 3p. What is the units digit of k? 4 Suppose -5o + 98636 = -5x + 21001, 4o + 2x - 62090 = 0. What is the hundreds digit of o? 5 Let m be (2 + -1)/((-4)/(-12)). Suppose 0 = -mp + 293 + 280. What is the hundreds digit of p? 1 Suppose -7t - 2018 + 13134 = 0. What is the units digit of (-3 - t/(-22)) + (-12)/66? 9 Let x(b) = -128b*2 - b. Let f(n) = 64n*2 + n. Let o(d) = -5f(d) - 2x(d). Let r be o(-2). Let m = 499 + r. What is the tens digit of m? 4 Let z(u) = -u2 - u - 15. Let f be z(0). Let o(l) = l3 + 6l*2 - 15l - 66. Let p be o(-7). What is the units digit of 6(p/f + 1)? 0 Suppose -29j + 1436056 = -1325235 + 730073. What is the hundreds digit of j? 0 Suppose 100x = 58x + 323316. What is the thousands digit of x? 7 Let n be (-4)/72-2019 + 1/(-6). Suppose -t = -2j + n - 502, 2t + 5j = 816. What is the units digit of t? 8 Let p = 2194 + -1862. Let q(b) = -b*2 - b. Let t be q(-1). Suppose -4o = 3d - p - 346, 4o = t. What is the tens digit of d? 2 Let v(l) = 2201l - 744. What is the hundreds digit of v(4)? 0 What is the thousands digit of 2/11114 + -2 + 72286? 2 Let s = 39980 + -21406. What is the units digit of s? 4 What is the tens digit of (20 - (-3)/3)(2406 + -14 - 10)? 2 Let y = -10 - -10. Let h be (y/(-3) - -6)(-4)/(-3). What is the hundreds digit of (4/(-6))/(h/(-1404))? 1 Let q be (-528)/221/2. What is the tens digit of (636 - -1)/((18/q)/(-3))? 7 Suppose w + 3660 - 10083 = 15748. What is the ten thousands digit of w? 2 Let c = 207 + -208. What is the hundreds digit of (1120 - -6)/(1 - c)? 5 Let d(i) = -i*3 - 11i*2 + 12i + 63. Let h(s) = 4s2 + 35s + 11. Let f be h(-8). What is the hundreds digit of d(f)? 2 Let z be 0 + -131 + (-6)/3. What is the units digit of 164/14 - 38/z? 2 Let x(k) = -k*3 + 18k*2 - 21k + 14. Let a be 17/5 + (-3)/(-5) + 10. What is the hundreds digit of x(a)? 5 Suppose 0 = -l - 5d - 191, -d = -11l + 16l + 955. Let v = l - -326. What is the tens digit of v? 3 Suppose -2304966 = -252a + 8898. What is the thousands digit of a? 9 Let p(z) = 6z + 175 + 9z*2 + 19z - 170. What is the units digit of p(-8)? 1 Suppose -315 = -2s - s. Let w(y) = -20 + 210y*2 + 4y - sy2 - 104y*2. What is the units digit of w(-7)? 1 Suppose -d - 6 = 5c, 3c - 4 = -1. Let w be -11 - ((-7 - d) + -4). Let v(f) = -132f3 + f2 + 3f + 1. What is the units digit of v(w)? 1 Suppose 2n - 5n + 6 = 0. Suppose -r + 841 = 5d, 4r - 3d = nd + 3339. What is the units digit of r? 6 What is the tens digit of (-13320)/(-18)82/8? 8 Let k(b) = -6b*3 - 421b*2 + 35b - 103. What is the tens digit of k(-72)? 0 Suppose -5g + 31 + 14 = 0. Let r(y) = -y2 + 12y - 25. Let h be r(g). What is the units digit of (-33)/(-33) + h2? 5 Let m = -518 - -520. Suppose mx = 6, -4x - 235 = -g + 27. What is the units digit of g? 4 Let w(d) = d2 + 17d + 94. Let b be (7 - (-5 - -11))-5. What is the units digit of w(b)? 4 Let l(g) = 3g2 + 3. Let a(y) = y3 + 7y2 + 9y - 8. Let w be (-35)/(-14)(0 + -2). Let f be a(w). What is the tens digit of l(f)? 3 Suppose 4q + 16 = t, -3q = -6q - 3t - 12. Let n be (q + 22/6)-135. Suppose -3o + 198 + n = 0. What is the units digit of o? 1 Suppose 6 = m + 6. Let k(x) = -2x3 + x2 - 10x. Let z be k(-7). Suppose m = 3a + 4a - z. What is the hundreds digit of a? 1 Suppose -2r - 54 = -3k + 3r, -3k = 4r - 54. Suppose -15q - 48 = -kq. Let g = q + 32. What is the units digit of g? 8 Suppose 0 = -3r - 5a + 6366, 5r = 3r - a + 4244. Suppose 5x + 2z = r, 2x + 3z + 845 = 4x. What is the hundreds digit of x? 4 Suppose -4t - 132 = -124. What is the tens digit of (	{ "pile_set_name": "DM Mathematics" }
of 2407m3/3 + 6320. Determine z(l(t)). -11587298t*4 Let d(t) = 2t. Let m be (-40)/(-19) - 28/266. Let n(l) = 1125l2 - ml + 2l - 1340l*2. Calculate n(d(u)). -860u*2 Let d(q) = 16q - 1. Let f(g) = -156g2 + g - 83. Give d(f(x)). -2496x*2 + 16x - 1329 Let z(p) = 2600p2 + 250p - 125. Let d(y) = -250y2 - 24y + 12. Let c(g) = -125d(g) - 12z(g). Let u(x) = -x*2. What is c(u(l))? 50l*4 Let f(o) = 99o + 10 + 9 - 2o2 - 99o. Let p(v) = -61v2 - 6v + 6. Let l(j) = 172j2 + 17j - 17. Let s(c) = 6l(c) + 17p(c). What is f(s(m))? -50m4 + 19 Let f(d) = -44d. Let l = 127 + -203. Let s = -63 - l. Let n(b) = 6b2 + 5b*2 - sb*2. What is n(f(g))? -3872g*2 Let l(k) = 1778k*2. Let u(r) = -r - 2237. Calculate u(l(a)). -1778a*2 - 2237 Let m(p) = 494p*2 + 417p*2 - 906p*2. Let k(b) = -5b2 - b2 - 3b2. Determine m(k(y)). 405y*4 Let x = -51 + 51. Let o be 2 + 1 - x - 2. Let g(z) = 5z. Let j(w) = -w. Let s(a) = og(a) - 4j(a). Let h(r) = -3r2. Determine s(h(n)). -27n*2 Let y(j) = 2j. Let s be 8/(-4)((-57)/6 + 2). Let f(z) = -s - 2z - 14 + 11z + 37. Determine y(f(i)). 18i + 16 Let z(o) = 2. Let v(f) = 2f - 25. Let c(h) = -v(h) - z(h). Let i(l) be the first derivative of -l3 + 118. Give c(i(u)). 6u*2 + 23 Let g(u) = -3u. Let r(m) = 49094428m2. Give g(r(q)). -147283284q*2 Let b(j) = 22j*2 + 3. Let o(i) = 1315i + 1321i + 1319i + 1326i - 5279i. What is b(o(k))? 88k2 + 3 Let m(c) = 28c*2. Let z(p) be the first derivative of -11p*3/3 + 1435. What is m(z(g))? 3388g*4 Let v(f) = -2967f. Let q(c) = -438c2. Determine q(v(i)). -3855752982i*2 Let y(o) = 505o*2. Let p(m) = 15m - 8. Let s(b) = 4b - 2. Let r(n) = -3p(n) + 12s(n). Determine y(r(j)). 4545j*2 Let x(v) = 38v*2. Let n(u) = -89u*2 - 57 - 56 + 146 - 34. Give x(n(l)). 300998l*4 + 6764l*2 + 38 Let f(z) be the first derivative of 73z*2 + 3472. Let w(x) = 6x*2. Determine f(w(g)). 876g*2 Let w(c) = 706c*2 - 9c - 17. Let o(d) = 7d2. Give w(o(i)). 34594i*4 - 63i*2 - 17 Let t(k) = -15k - 2. Let g(x) = 72x + 10. Let h(v) = g(v) + 5t(v). Let o(r) = 379r. Give o(h(m)). -1137m Let n(l) = -9l. Let r(x) be the first derivative of x4/6 - 52x + 15. Let q(b) be the first derivative of r(b). Determine q(n(g)). 162g2 Let x(m) = 63m*2. Let j(l) be the third derivative of 0l*3 + 0l + 0 - 5/24l4 - 93l*2. Give x(j(g)). 1575g*2 Let u(a) = 2a*2 + 6a. Let p(h) = 1. Let r(q) = q + 7. Let s(d) = 28p(d) - 4r(d). Calculate s(u(t)). -8t2 - 24t Let b(i) = -5i2 - 2628493. Let u(o) = 9o. What is b(u(r))? -405r2 - 2628493 Let w(u) = u2 - 2u*2 + 0u*2. Let d(f) = -31f + 6. Let h = 331 - 334. Let k(l) = -310l + 62. Let z(m) = hk(m) + 31d(m). What is w(z(j))? -961j*2 Let c = 17 - 15. Let b(g) = -9g*c - 22g*2 + 36g*2. Let f(u) = 7u. Give f(b(m)). 35m2 Let g(f) = -137f + 3. Let c(d) = -d - 33. Let m(x) = 9x + 99. Let o(b) = 3c(b) + m(b). Calculate o(g(h)). -822h + 18 Let c = 5 - 3. Let g(b) = cb - 3b - b. Let x(o) be the third derivative of o4/3 - o2 - 16489. Give g(x(q)). -16q Let a(q) be the first derivative of -q3 + 23315. Let n(j) = j2 - j. Let g(f) = -2f2 + 3f. Let c(d) = g(d) + 3n(d). Give a(c(w)). -3w*4 Let a(c) = 18c*2. Let i(l) = 48798l*2 + 35l. What is i(a(f))? 15810552f4 + 630f*2 Let k(f) = 2. Let x(h) = -14 + 19 + 3h - 5 - 6. Let i(d) = 3k(d) + x(d). Let q(t) = -t2. Calculate q(i(w)). -9w*2 Let y(t) be the third derivative of 2t*5/15 - 2t*2. Let b(g) be the second derivative of -58g + 0 + 0g2 - 1/6g*3. Give b(y(w)). -8w*2 Let j(q) = -6q - 5. Let o(k) = 5k + 4. Let m(u) = -4j(u) - 5o(u). Let l(z) be the third derivative of z4/12 + 3z*3 + 3z*2 - z - 1. Calculate l(m(f)). -2f + 18 Let d(f) = 231f2. Let p(g) = 13g - 155. Let u(y) = -6y + 62. Let a(i) = -2p(i) - 5u(i). What is d(a(v))? 3696v*2 Let f(w) = -10w. Let a(q) = 91q. Suppose 36g - 15 = 41g. Let y(l) = ga(l) - 26f(l). Let c(j) = -6j. Determine c(y(z)). 78z Let d(c) = 0c - 58 - 16c2 + 126 - 6c*2 - 3c - 64. Let w(b) = 43b2 + 6b - 7. Let g(o) = -7d(o) - 4w(o). Let m(x) = -3x2. Determine g(m(p)). -162p*4 + 9p*2 Let n(c) = -34c. Let v(g) = 3784674g2. Determine n(v(l)). -128678916l*2 Let l(v) = -2v. Let h(p) = 6889955p + 5. Calculate h(l(t)). -13779910t + 5 Let h(s) = 2s2 - 5s + 1. Let w(x) = 45x2 - 30x + 6. Let b(u) = 6h(u) - w(u). Let o(c) = -6c*2 + 1. What is o(b(n))? -6534n4 + 1 Let m(s) be the second derivative of s3/3 + 2542s. Let g(b) = -11b - 5. Calculate m(g(w)). -22w - 10 Let y(l) = -8l - 5. Let x(k) = -k - 1. Let o(s) = 5x(s) - y(s). Let i(r) = 224r. Let v(n) = 13n. Let d(c) = 2i(c) - 36v(c). What is o(d(u))? -60u Let k(v) = -2v2. Let n(b) = -5 + 41b - 107b + 1 + 2b. What is n(k(l))? 128l2 - 4 Let d(y) be the third derivative of 0 - y2 + 0y*4 + 0y*3 + 1/12y*5 + 0y. Let k(i) = 96 - 34 - 28 + 7i - 34. Give k(d(h)). 35h*2 Suppose -3w + 0 + 24 = 0. Suppose 5i = -2p + 14, -wi + 3i = -10. Let z(c) = -c + 2cp + 4c - 3c. Let v(m) = -4m*2. Calculate z(v(o)). 32o*4 Let h(f) = -9f. Let v(r) = 169547r + 2285. Let t(j) = 297j + 4. Let x(l) = 2285t(l) - 4v(l). Give h(x(p)). -4113p Let l(j) = -67j - 7. Let w(q) = -53q - 6. Let h(f) = 8l(f) - 10w(f). Let x(o) = o + 4o - 3o. What is x(h(v))? -12v + 8 Let r(q) be the second derivative of -401q4/6 + 348q + 4. Let n(y) = -y*2. Calculate r(n(s)). -802s*4 Let d(y) = 845y. Let t(i) = -2114i. Let c(o) = 20d(o) + 8t(o). Let n(u) be the third derivative of -u4/6 - u2. What is c(n(g))? 48g Let s(x) = -19x - 15. Let z(l) = -l + 2. Let a(g) = s(g) + 6z(g). Let t(d) = -49d - 7. Let r(b) = 5a(b) - 2t(b). Let u(o) = 10o. What is u(r(f))? -270f - 10 Let p(i) = -i2. Let y(m) be the third derivative of 61m*4/12 - 2m*3 + 459m*2 + 2. What is p(y(f))? -14884f*2 + 2928f - 144 Let n(c) = -1312850c2. Let z(s) = 5s. What is n(z(g))? -32821250g2 Let i(h) = 16h*2 - 7h - 7. Let w(b) = -14b2 + 6b + 6. Let o(s) = 6i(s) + 7w(s). Let a(l) = -238l. Determine o(a(n)). -113288n*2 Let h(w) = 2w. Let j(f) = -1336372158f2. What is h(j(x))? -2672744316x*2 Let d(i) = 1785i*2. Let v(g) = -5558g. Determine d(v(w)). 55141084740w2 Let o(t) = -1304248t*2 + t + 2. Let p(a) = a - 5. What is p(o(n))? -1304248n*2 + n - 3 Let d(y) = -6 + 2y*2 - 481y - 429y + 910y. Let l(p) = -17p2. Calculate l(d(f)). -68f*4 + 408f*2 - 612 Let v(u) = 2274 - 1133 - 1141 - 37u*2. Let t(k) = 43k - 2. What is t(v(j))? -1591j2 - 2 Let p(f) = f + 12. Let t = 109 + -104. Let o(z) = -26z*2 + 11z*2 + 8z*2 + tz*2. Give p(o(n)). -2n*2 + 12 Suppose -593 = -9h + 1558. Let k(z) = 234z - hz + 13 - 13. Let c(m) = 4m2 - 2m2 - m2. Give c(k(g)). 25g2 Let q(k) = -3k. Let i(d) = -3789d2 - 10d + 1. Calculate i(q(h)). -34101h2 + 30h + 1 Let o(g) = -g. Let j(n) be the third derivative of 3007n4/6 - n2 + 587n. Determine o(j(b)). -12028b Let o(y) = -2y*2 + 542y + 4. Let w(f) = 106f - 4. Determine w(o(d)). -212d*2 + 57452d + 420 Let b(l) = 17 + l + 0 + 19. Let a be b(9). Let k(p) = 3p2 + 45 - a. Let z(x) = -19x. Determine k(z(c)). 1083c2 Let c(z) = -4160z. Let h(r) = 483r2. What is c(h(s))? -2009280s*2 Let i(k) = -7k - 1. Let v(t) = -26t - 6. Let m(h) = 4i(h) - v(h). Let g(d) = 11d2. What is g(m(s))? 44s*2 - 88s + 44 Let o(k) = 605k - 1202k + 599k. Let c(l) = 16252l*2. Calculate c(o(r)). 65008r*2 Let f(a) = 99a*2. Let u(h) be the first derivative of 5h*3/3 + 1008. What is u(f(b))? 49005b*4 Let w(a) = 3a. Let g(c) be the first derivative of 17c4/3 - c3/3 - 265c - 211. Let k(y) be the first derivative of g(y). Calculate w(k(t)). 204t2 - 6t Let p(j) = -2 + j - 6j - j. Let r(s) = -28s*2 - 5. Let y(k) = 39k*2 + 7. Let a(c) = 7r(c) + 5y(c). Determine p(a(o)). 6o*2 - 2 Let b(h) = -3 - 4138h + 8130h - 4344h. Let f(m) = -2m2. Calculate f(b(a)). -247808a*2 - 4224a - 18 Let h(b) = b. Let f(a) = a + 685977553. Determine f(h(v)). v + 685977553 Let b(y) be the third derivative of 667	{ "pile_set_name": "DM Mathematics" }
(3 + 1 - 3)). 56k*3 Expand (0 - 3 + 5)(-9 + 9 - 2d)(4d + 0d - 2d). -8d*2 Expand -6s + 53s + s + 2 + 2s - 2 + 0 + 0 + 2s + (1 + 4 - 7)(0 + 0 - 2s). 56s Expand 10r2 + 22 - 22 + r2 - r2 + 2r*2 + (r - 3r + r)(-3r + 2r - r) - 2 + 2 + 2r*2 + 2r2 - r2 - 3r2 + 0r*2 - 3r*2 + 5r*2. 16r*2 Expand (2i + 4i - i)(-5i3 + 3i*3 + 3i*3). 5i*4 Expand (0l + 3l - 2l)(l2 + 7l - 7l) - 4l*3 + 6l3 - l3 + (4l - l - 4l)(l2 + l2 - l2). l3 Expand (-2c*3 + 2c*3 - 2c*4)(-c - 2c + 4c) + 0c5 - c5 - c5 + (-2c*5 - 2c*5 + 5c*5)(4 - 2 - 4) - 2 + 2 + 5c5. -c5 Expand (3x - 3x + 2x*2 + 3x)(x2 + x2 + 11x*2). 26x*4 + 39x*3 Expand (-5u*2 + 12u - 12u)(-u - 2 + 4 - 4)(0u + 0u + 2u*2). 10u*5 + 20u*4 Expand (5 + 2 - 2)(r - 5r + 2r)(5 - 4 - 3). 20r Expand (-20r - 45r*3 + 20r)(r - 2r + 3r). -90r*4 Expand (5v*3 - 3v*3 + 10v*2 - 20v + 19v)(-2v + 0v + 3v + (-3v - v + 2v)(0 - 4 + 2)). 10v4 + 50v*3 - 5v*2 Expand (0 + 4 - 2)(-f + f + 6f)(5f2 + f2 - 4f*2)(-5f2 + f2 + 5f*2). 24f*5 Expand (1 - 1 - q)(1 - 1 + 1)(3q - 6q + 2q)(3 + 3 - 3). 3q*2 Expand (-2u*4 + 10u4 - u4)(4 + 0 - 2) + (4u + 2u - 4u)(-2u*3 + 0u*2 + 0u*2) - 2u*4 + 4u4 - u4 - 2u4 - 1 + 1. 9u*4 Expand (-2z + 2 - 2)(2z*2 - 5z2 - z2 - z2 + z2 - 3z2 + z2 + 3z*2 - 5z*2 + (5 - 1 - 6)(-z*2 - 3 + 3)). 12z3 Expand (n2 + 5 - 5)(3n3 + n3 - 3n3). n5 Expand (-n + 7n + 0n)(-3n + 3n + n*3) - 5 + 5 + 3n*4. 9n*4 Expand (28 - 26 - 7h*2 - 2h*2)(1 + 2h - 1). -18h*3 + 4h Expand -8r3 + 0r + 0r + (-2r - r + 5r)(0r2 + r2 + r2) - 2r*3 + 2r*3 - 2r*3. -6r*3 Expand (-12 - 22 + 7)(h + 2h - 2h). -27h Expand (-4z2 - z2 + 4z2 - 4)(-6z2 - z2 + 0z*2). 7z*4 + 28z*2 Expand (-2j*2 + 3j - 3j)(j + 7j - 3j) + (-2j2 + 5j2 - j2)(4j - 4j - 2j) + 4 - 2j3 - 4. -16j*3 Expand -3 - u + 3 + (u - u - 2u)(-1 - 1 + 1). u Expand (0k*4 - 5k*4 + 3k*4)(0 + 2 - 1) + (k*2 - 3k*2 + 3k*2)(-5k2 + 0k*2 + 4k*2). -3k*4 Expand (3f - 3f - 2f)(-f - 3f + f). 6f2 Expand (2o + 0o - o + (-o + 3 - 3)(2 - 5 + 1) - o - 2o + 5o)(-2o2 + o2 - o*2) + 5o*2 - 2o*3 - 5o*2. -12o3 Expand (r4 - 1 + 1)(29r + r - 4r). 26r*5 Expand (0b*2 + 2b*2 - 3b*2)(-b2 + b2 - b*2 + (-2b*2 - 3b*2 + 3b*2)(3 - 6 - 4)). -13b4 Expand ((0 + 3 - 2)(-3 + 1 + 3) - 5 + 5 + 1)(-6 + 6 + 2q*5). 4q*5 Expand (-4z*2 + 0z*2 + 5z*2)(2z2 + 2z*2 + 0z*2)(10z + 12z + 25 - 27). 88z5 - 8z*4 Expand -4g - 2 + 2 + 2g - 3g + 2g + (5 - 2 - 1)(-2g + 0g + 4g) + 3g + 3g - 5g - 2 + 2 - g. g Expand ((3d - 4d - d)(-3 + 2 + 3) + 0d + 0d - 2d)(1 - 6 + 14)(-5d + 16 - 16). 270d2 Expand (-j4 + 2j3 - 2j*3)(82 - 82 + 19j)(-2 + 2 + 1). -19j5 Expand (-1 + 33 - 14)(2 - 5 + 1)(-f - f + 0f). 72f Expand (0t + 0t + 2t*3)(5t + 5t - 3t - t). 12t*4 Expand (2 - 2 + 1)(0w5 - 2w5 + w5) - 2w - w5 + 2w - w*4 + 3w*4 + 2w5 + w5. w*5 + 2w*4 Expand (0 + 1 - 4)(i*2 - 2i*2 + 3i*2)(-2i2 + i - i). 12i*4 Expand (2 - 3 + 0)(-3h2 + 2h - 2h) + 29 + h2 + 35 + 2h - 63. 4h2 + 2h + 1 Expand (-1 + 1 - 2a3)(1 + 2 - 5)(5a2 - a2 - 3a2). 4a*5 Expand (-2d + 2d + 2d)(-2d*3 - 2d*3 + 3d*3) + (0d*2 + 2d*2 - 6d*2)(-d*2 - 3 + 3). 2d*4 Expand 3h*5 - 2h*4 + 2h4 + (-1 - h4 + 1)(22h + 2h - 8h). -13h5 Expand (-24y - 5y + 2y)(-y4 + y + y - y). 27y*5 - 27y*2 Expand (-1 + 3 + 0)(-2z + 11 - 11) + (-2 + 2 + 1)(2z - 4z + z) + 0 + 0 - 2z. -7z Expand 0o2 - o2 - o2 - 3 - o2 + 3 + (-3o - o + 3o)(-3o + 4o + 0o) + 3o*2 + 0o*2 - 2o2 - o2 + 2o2 + 0o*2. -2o*2 Expand (2w - 7w + 3w)(0 - w + 0) - 3w*2 + 3w*2 - 4w*2 - 4w*2 - 3w*2 + 5w*2 + 3 + 2w - w*2 - 3. -5w*2 + 2w Expand 41 - 30o5 - 41 + (5o - 3o2 - 5o)(o3 - 3o3 + o3). -27o5 Expand (2j + 2j - 3j)(-1 - 11 + 5 + j). j2 - 7j Expand k*4 - 3k4 + k4 + (5k + 2k - 5k)(6k3 + 2k*3 - 4k3) - k4 + 3k - 3k. 6k4 Expand (-p - 3 + 3)(-5p - p - 8p). 14p2 Expand (-3 + 0 + 2)(-5x2 + 0x*2 + 2x*2) + 4x2 + x2 - 3x2. 5x*2 Expand (2v*3 - 3v3 - v3)(-5 + 4 + 8 - 2v) + v*4 - 2v4 - v4. 2v4 - 14v*3 Expand 2 + 2i - 2 + (0i + 0i + i)(-21 + 9 + 6). -4i Expand (7t + 12t - 7t)(4t4 - 3t4 + t4). 24t5 Expand (28v - 3 + 3)(-2 + 2 - 2v*2). -56v*3 Expand (-4v + 3v - v)(2v + 0v - 6v)(3 - 3 + v). 8v3 Expand (2w2 - w2 + w*2)(w + 0w + 0w)((-2 + 3 + 2)(-3w + 0w + 2w) - 2w - 3w + w + w + 0 + 0). -12w4 Expand 0 - v5 + 3v5 - 16 + (5v - 3v + 0v)(-2v4 + v3 - v*3). -2v*5 - 16 Expand -2n*4 - 2n*4 + 3n*4 + 0n*4 - 5n*4 + 3n4 + (n4 + n*4 - 4n*4)(-1 + 4 - 1) + 3n4 - 5n4 + n4 + n*4 - 4n + 4n + 4 + n4 - 4. -6n*4 Expand (2p + p - p)(13p + 1 - 2 - 15p). -4p*2 - 2p Expand 4i - 4i + 2i + 4 - 4 - i + (-2i + 2 - 2)(2 + 2 - 2). -3i Expand (a*4 + 0a*4 - 2a*4)(a + 2a - 2a) + 0a5 + 5a*5 - 3a5. a5 Expand (2d - d - 2d)(-d3 + 2d + 2d3 + 2d). -d*4 - 4d*2 Expand (-2r2 - r2 + r*2)(r3 + r3 + 0r3) + 2 - 2 + 2r*5 + (-r + 0r + 2r)(-r + r + r*4) + 29r*2 - 29r*2 + 8r*5. 7r5 Expand (-1 + 4 - 4 + o3)(2 + 2 - 3)(1 + 4 - 4). o*3 - 1 Expand (3 + 7 + 1)(c*3 + 3c*3 - 5c*3)(-c - 4c + 3c). 22c4 Expand (3t - t - t)(0 - 1 + 0)(71t - 121t + 69t). -19t*2 Expand ((2v2 + v2 - v*2)(0 - 4 + 5) + 4v2 + v2 - 4v*2 + 7v*2 - 2v*2 + 3v*2)(-4v2 + 5v*2 + 4v*2). 55v*4 Expand (-1 + 3 - 1)(4 - 4 + 1)(2i + i - 2i) + 2i - i + 0i + 2i - 4 + 4 + (-2i + 3 - 3)(-1 + 3 - 3) + 4 + 2i - 4. 8i Expand 0x5 - 5x*5 + 2x*5 + 6x*5 + 3x5 + x5 + 0x3 + 0x3 - x5 + (-x*4 + x - x)(6x - 3x - x). 4x5 Expand (-3 + 4 - 2)((3q - 6q + 2q)(0 - 2q + 0) - 4q2 + q2 + 2q2 + (-4q + 4q + q2)(-2 + 2 - 2)). q*2 Expand (-4r*4 + 4r*4 - 2r*4)(r - 2r + 3r) + r3 - r5 - r*3. -5r*5 Expand (-4 + 0 + 2)(3k - 4k - k) - 1 + 2k + 1 + k - 2k + 0k + 1 - 1 + k - k + 0k - k + (-1 - 1 + 3)(-1 + 1 + k) - 3k + k + 0k + 63k - 21k - 27k. 18k Expand (-2f2 - 1 + 1 - f2 + 2 - 2 - 2 + 2 + 2f2 + (-1 + 1 - f)(-f - 3 + 3) + 5f2 - f2 - 2f*2)(5 + 7 - 4). 16f2 Expand (-7s*2 + 3s2 - s2)(2s + 2s - 2s)(s + 4 - 4). -10s*4 Expand (24d*2 + 9 - 9)(-2d2 + 3d2 + d2). 48d4 Expand (-y2 - 5y*2 + 4y*2)(4 - 1 - 2)(-y + y + 2y). -4y3 Expand (2 - 2 + 1)(-m + 2m3 + 2m*5 - 2m*3). 2m*5 - m Expand (x + 0x - 4x)(0x4 + 2x*4 - 3x*4) + 5x*5 - 2x5 - x5 + (-2x + 0x + 3x)(4x4 + x4 - 4x4) - x5 + x*5 + 4x*5. 10x5 Expand -3 + 3 + v3 + (2 + 2v - 2)(2v2 - 1 + 1) + 2 + 3v*3 - 2 + (2 - 1 + 1)(6v2 - v3 - 2v*2 - 10v*2). 6v*3 - 12v*2 Expand 6a + 14a - a + 3a - a - a + (-7 + 3 + 2)(-2a + 0a + 3a) - a - 3a + 2a - 4 - a + 4 + 2a - 2a + 2a. 17a Expand (f*4 + 3f*4 - 3f*4)(f - 3f + f) + (3f*2 + 2 - 2)(-f*3 + 0f*3 + 4f*3). 8f*5 Expand 4q - q - 2q + 1 - 1 + 2q + (3q - 3q + q)(-1 + 1 + 1) + (-4 + 3 + 4)(3q - 5q + q)(-5 + 3 + 1). 7q Expand (-1 + 1 + 1 + (-2 - 2 + 3)(2 + 4 - 4))(-2o2 - o2 + o2). 2o*2 Expand (-4 + 4 + 2c*3)(-4c + 3c + 2c) - 3c*4 + 3c*4 + 2c*4 + 2c*4 - 2c*4 + 2c4 + (-c2 - 6c2 + c2)(-1 - c*2 + 1). 12c*4 Expand 20 - 20 + 11g*2 + (3g + 4g - 4g)(-5g - 2g + 4g) - g*2 - 4g*2 + 4g2. g2 Expand ((-4 + h + 4)(0 + 0 + 1) - 2h + 5h - 2h)((0 - 2h + 0)(4h3 + h3 + 2h3) + 0h*4 - 6h*4 + 3h*4). -34h*5 Expand (5v + v - 4v)(-1 + 1 - 7v + 1). -14v*2 + 2v Expand (3t3 - 3t*3 - 2t*3)(3t + 2 - 6t + 2t). 2t*4 - 4t*3 Expand (0g3 - g3 + 3g3)(-4g2 - g2 + 4g*2) + 2g*2 + 11g*5 - 2g*2. 9g*5 Expand (-7 + 8 + 21)(-3t3 + 3t*3 + 2t - 2	{ "pile_set_name": "DM Mathematics" }
sequence iii when three letters picked without replacement from ivivvvi. 1/35 Two letters picked without replacement from {q: 12, o: 2, w: 2, l: 2, m: 1, r: 1}. Give prob of sequence lm. 1/190 Calculate prob of sequence as when two letters picked without replacement from dscdjscascd. 3/110 Four letters picked without replacement from {k: 1, r: 2, q: 7}. Give prob of sequence qrrk. 1/360 What is prob of sequence viil when four letters picked without replacement from vlyyiif? 1/420 Two letters picked without replacement from znnwxuwfnnnxnwu. What is prob of sequence nf? 1/35 Two letters picked without replacement from {y: 4, i: 2, h: 1, u: 1}. Give prob of sequence yh. 1/14 What is prob of sequence cis when three letters picked without replacement from {y: 2, x: 5, g: 3, i: 1, c: 2, s: 6}? 2/969 Calculate prob of sequence ief when three letters picked without replacement from {e: 2, i: 1, a: 2, j: 1, f: 2}. 1/84 Two letters picked without replacement from rxngnxygc. Give prob of sequence rc. 1/72 Two letters picked without replacement from lrs. Give prob of sequence sl. 1/6 Two letters picked without replacement from {a: 11, q: 5}. What is prob of sequence aa? 11/24 Calculate prob of sequence lrr when three letters picked without replacement from llllrrlrllr. 14/165 Three letters picked without replacement from bqqiqqbqibgaq. Give prob of sequence iba. 1/286 Three letters picked without replacement from bybyb. Give prob of sequence ybb. 1/5 Four letters picked without replacement from {x: 2, j: 3, s: 1, n: 6, w: 1}. Give prob of sequence nnjw. 3/572 Calculate prob of sequence xj when two letters picked without replacement from xjbbxxxxxxxjxxb. 2/21 Calculate prob of sequence wzw when three letters picked without replacement from {z: 2, w: 7, e: 5}. 1/26 What is prob of sequence ix when two letters picked without replacement from ddsdddxdi? 1/72 What is prob of sequence aa when two letters picked without replacement from {d: 2, a: 2, p: 1, q: 1, c: 1, y: 1}? 1/28 Calculate prob of sequence li when two letters picked without replacement from idwiwidwwdilidwd. 1/48 What is prob of sequence hmm when three letters picked without replacement from {h: 3, m: 3, g: 2}? 3/56 Calculate prob of sequence wccc when four letters picked without replacement from cwwcwccwcwcwwwwwcd. 35/1224 Four letters picked without replacement from zkiooz. What is prob of sequence izoz? 1/90 Two letters picked without replacement from {x: 3, e: 4, d: 1}. Give prob of sequence dx. 3/56 Two letters picked without replacement from gogyaygynanvyynyan. What is prob of sequence ag? 1/34 Three letters picked without replacement from {o: 7, l: 4}. Give prob of sequence olo. 28/165 Three letters picked without replacement from {q: 7, z: 2, c: 1, t: 4}. Give prob of sequence ztq. 1/39 Calculate prob of sequence ggg when three letters picked without replacement from kgafqffggfa. 1/165 Four letters picked without replacement from iaaxxrz. Give prob of sequence aria. 1/420 Two letters picked without replacement from {w: 8, s: 2, u: 4, z: 2}. What is prob of sequence uz? 1/30 Calculate prob of sequence df when two letters picked without replacement from {h: 1, f: 1, e: 1, c: 1, b: 2, d: 1}. 1/42 Three letters picked without replacement from jeeeeeeemjvvjzjeelee. Give prob of sequence ele. 11/684 Three letters picked without replacement from ftvxjfvff. Give prob of sequence xtf. 1/126 Three letters picked without replacement from sqqrar. Give prob of sequence qqr. 1/30 What is prob of sequence aadb when four letters picked without replacement from aaadaaabaldalazdaaaa? 13/3230 What is prob of sequence hhhf when four letters picked without replacement from hfffhff? 0 Four letters picked without replacement from rurilrkauirkr. Give prob of sequence kaiu. 1/2145 Two letters picked without replacement from iuultwrt. What is prob of sequence lr? 1/56 Four letters picked without replacement from aqaxffqaeof. What is prob of sequence eqox? 1/3960 What is prob of sequence ulru when four letters picked without replacement from {l: 8, r: 9, u: 2}? 1/646 What is prob of sequence nb when two letters picked without replacement from {b: 6, n: 6}? 3/11 Calculate prob of sequence rddd when four letters picked without replacement from {d: 10, r: 2}. 4/33 Calculate prob of sequence iy when two letters picked without replacement from {h: 1, r: 3, w: 4, i: 1, y: 4}. 1/39 Four letters picked without replacement from vvvvtuvuvvgvvuuvv. What is prob of sequence vvut? 11/1428 Calculate prob of sequence yx when two letters picked without replacement from xyx. 1/3 Two letters picked without replacement from {q: 1, g: 3, w: 1}. What is prob of sequence gg? 3/10 Four letters picked without replacement from iffiiffrri. Give prob of sequence rifr. 2/315 Three letters picked without replacement from {q: 4, i: 4, u: 2}. Give prob of sequence uiq. 2/45 Calculate prob of sequence ell when three letters picked without replacement from {e: 1, l: 5, x: 2, i: 1}. 5/126 What is prob of sequence ss when two letters picked without replacement from {o: 9, s: 7}? 7/40 Two letters picked without replacement from ussuuaayuyy. What is prob of sequence ua? 4/55 What is prob of sequence bbph when four letters picked without replacement from {b: 6, h: 1, y: 2, p: 3, o: 2, q: 4}? 1/816 Calculate prob of sequence zkcd when four letters picked without replacement from {d: 1, p: 1, c: 1, k: 6, z: 5}. 5/4004 Two letters picked without replacement from {n: 17, g: 1}. What is prob of sequence gn? 1/18 What is prob of sequence blb when three letters picked without replacement from {b: 2, l: 1}? 1/3 What is prob of sequence ttc when three letters picked without replacement from wtecthhththwesetew? 5/1224 What is prob of sequence qc when two letters picked without replacement from {q: 5, c: 2, t: 5}? 5/66 Calculate prob of sequence tchq when four letters picked without replacement from jhqojoojhootjocj. 1/21840 What is prob of sequence bz when two letters picked without replacement from vfcfbzz? 1/21 What is prob of sequence isu when three letters picked without replacement from sibsttubissutiniiutu? 2/171 Three letters picked without replacement from {t: 5, f: 2, o: 1, p: 8}. Give prob of sequence pft. 1/42 Calculate prob of sequence da when two letters picked without replacement from {f: 2, e: 1, d: 1, a: 1}. 1/20 Four letters picked without replacement from dydwdayigggaaywa. Give prob of sequence ydwi. 3/7280 Calculate prob of sequence au when two letters picked without replacement from {t: 1, k: 1, r: 1, a: 1, u: 2, l: 2}. 1/28 Three letters picked without replacement from {k: 2, g: 4, s: 4, p: 5}. Give prob of sequence kpp. 4/273 What is prob of sequence bt when two letters picked without replacement from {y: 1, b: 1, t: 1}? 1/6 Three letters picked without replacement from nnxsssxzs. What is prob of sequence xnn? 1/126 Calculate prob of sequence qqw when three letters picked without replacement from {x: 2, j: 2, q: 8, n: 2, p: 4, w: 1}. 28/2907 Two letters picked without replacement from gggggggggg. Give prob of sequence gg. 1 What is prob of sequence pn when two letters picked without replacement from npnenvvgnvnvvn? 3/91 Four letters picked without replacement from pjjgappjjpgjopjgx. What is prob of sequence apop? 1/2856 Three letters picked without replacement from {c: 2, f: 1, q: 2, b: 1, o: 1, e: 2}. Give prob of sequence ccq. 1/126 Four letters picked without replacement from lniniinlinn. What is prob of sequence niln? 2/99 What is prob of sequence gg when two letters picked without replacement from {v: 15, g: 5}? 1/19 Two letters picked without replacement from rlpllpp. Give prob of sequence pr. 1/14 Four letters picked without replacement from jgzggggjgzjugguuzuug. Give prob of sequence jggu. 3/323 Four letters picked without replacement from {v: 1, p: 4, t: 3}. Give prob of sequence tppp. 3/70 Two letters picked without replacement from eeoeemmmebmhmeeoeem. What is prob of sequence ho? 1/171 Calculate prob of sequence xtt when three letters picked without replacement from {x: 7, t: 1}. 0 Two letters picked without replacement from {i: 3, x: 3, n: 1, p: 3}. Give prob of sequence xn. 1/30 Three letters picked without replacement fr	{ "pile_set_name": "DM Mathematics" }
divided by -1460 -2093/1460 Calculate -5653659 divided by 513969. -11 Calculate -26233141 divided by -4. 26233141/4 What is 883 divided by -64109? -883/64109 What is 2 divided by -3073675? -2/3073675 What is -316992 divided by -16? 19812 What is -34344230 divided by -446? 77005 Calculate 542476955 divided by 229. 2368895 Calculate 81478036 divided by -4. -20369509 0 divided by 13869058 0 Divide 247 by -14418. -247/14418 -5479000 divided by 4 -1369750 -8779 divided by 8680 -8779/8680 Divide -87304527 by -9. 9700503 -76980080 divided by 1819 -42320 233010 divided by 2 116505 Divide -46113 by 982. -46113/982 Calculate -378566 divided by -206. 189283/103 What is -226934464 divided by -56733616? 4 What is -2931 divided by 8322? -977/2774 What is -8524 divided by -2124? 2131/531 Divide 20716 by 889. 20716/889 -265396 divided by -512 66349/128 66 divided by 2065060 33/1032530 Divide 40281507 by -6657. -6051 What is 2026059 divided by -3? -675353 Divide -24150730 by 2415073. -10 Calculate 91974726 divided by -1803426. -51 Divide 852864944 by -2032. -419717 -859393 divided by -859393 1 What is 5513550 divided by 2225? 2478 Calculate 73228246 divided by 1494454. 49 What is 454417 divided by -88? -454417/88 What is -3667935 divided by -4? 3667935/4 Divide 9054423 by 243. 37261 -451892265 divided by 165 -2738741 Calculate -585552 divided by 16. -36597 Calculate -386 divided by 235200. -193/117600 -72594232 divided by 9074279 -8 -21472900 divided by -14 10736450/7 What is -6602148 divided by 14? -471582 Divide -7953987 by 7953987. -1 1419379 divided by -7 -1419379/7 What is 146068188 divided by -6955628? -21 What is 92 divided by 1007470? 46/503735 Divide -5853072 by 7996. -732 Calculate 11487 divided by 10468. 11487/10468 Divide -722300964 by -1563422. 462 Calculate 13053264 divided by 5864. 2226 14994335 divided by 2998867 5 Divide -649 by 7715. -649/7715 Divide -55057863 by -18352621. 3 What is 374 divided by 53072? 187/26536 What is 158745309 divided by 3? 52915103 Calculate 0 divided by -7544747. 0 What is 9641505 divided by 1928301? 5 3268640 divided by 2 1634320 90835 divided by 8 90835/8 What is -18865084 divided by -460124? 41 -2088878 divided by 12 -1044439/6 Calculate -7671360 divided by -2096. 3660 Calculate 52039827 divided by -6. -17346609/2 Calculate 31068648 divided by 2964. 10482 -1068630 divided by 199 -5370 Calculate 7567720 divided by -189193. -40 Divide -49703685 by -16567895. 3 Divide 52 by -323107. -52/323107 Divide -6042003 by -549273. 11 What is -15700055 divided by -607? 25865 What is 201375026 divided by -33641? -5986 What is 34461775 divided by 1378471? 25 What is -687445731 divided by -3637279? 189 What is 237912292 divided by 316? 752887 4519 divided by 11704 4519/11704 What is -14 divided by 1073291? -14/1073291 What is -89 divided by 44838? -89/44838 What is -70181050 divided by -23? 3051350 -8 divided by -1630879 8/1630879 Divide 15378410 by -530290. -29 Calculate 2034355 divided by 47. 2034355/47 What is -17 divided by -18613515? 17/18613515 Divide -186131882 by -2269901. 82 What is -13448764 divided by -1993? 6748 69920739 divided by -381 -183519 What is 104 divided by 34855? 104/34855 Calculate 872424 divided by -12. -72702 Divide 69258228 by -6. -11543038 Calculate -108398280 divided by -17580. 6166 Calculate 5449 divided by -6842. -5449/6842 Calculate 1550325 divided by -5. -310065 Calculate -18005812 divided by -1. 18005812 What is -47707928 divided by -2? 23853964 95655132 divided by -47827566 -2 Divide -101387844 by -228351. 444 Calculate 390503 divided by -238. -390503/238 Divide -171 by 4385781. -19/487309 What is 4616100 divided by 76935? 60 -4565 divided by -3646 4565/3646 -78186 divided by -5100 13031/850 Divide -4011200 by 22. -2005600/11 Calculate 22 divided by -749517. -22/749517 Divide -614067471 by -5. 614067471/5 Divide 3271349 by 37. 3271349/37 1 divided by -11027680 -1/11027680 What is 495718512 divided by 165239504? 3 Divide -1 by 20355502. -1/20355502 Divide -21295020 by 5140. -4143 Calculate 6 divided by -17975011. -6/17975011 -2662066 divided by 10522 -253 Divide -10 by -19546876. 5/9773438 Divide -7306 by -6709. 7306/6709 Divide -640325 by 4. -640325/4 What is 18494064 divided by -4623516? -4 Divide 110641488 by -62936. -1758 What is -7179327 divided by -27? 265901 9069768 divided by 14676 618 What is -3 divided by -15160582? 3/15160582 Calculate 3 divided by 11698768. 3/11698768 Divide -15 by -1121822. 15/1121822 What is -10555 divided by -2624? 10555/2624 Divide 10430983 by -989. -10547 12675348 divided by -452691 -28 388546 divided by 788 194273/394 Calculate -3144760 divided by -2. 1572380 -4710054 divided by 785009 -6 -482994 divided by -9 53666 Calculate 151454357 divided by 59. 2567023 Calculate -110975676 divided by 1321139. -84 Divide 1621736 by -23. -1621736/23 Calculate 7518744 divided by -30564. -246 3 divided by -3332464 -3/3332464 What is -1661760 divided by 20? -83088 Calculate 42124245 divided by 2195. 19191 What is 214765280 divided by 5369132? 40 Calculate 119 divided by -10782. -119/10782 Divide -3 by -2793843. 1/931281 Divide -1122 by -9343. 1122/9343 Calculate 17493 divided by -955. -17493/955 Divide 43296786 by 507. 85398 Calculate 7549014 divided by 7. 7549014/7 -1349070 divided by 699 -1930 What is -28 divided by 11732489? -28/11732489 283 divided by -18352 -283/18352 What is 28070960 divided by 5? 5614192 233721684 divided by -1806 -129414 Calculate -1021456 divided by -5. 1021456/5 Calculate 289589 divided by 3799. 289589/3799 What is -52650891 divided by 3? -17550297 4265170 divided by 3815 1118 Calculate 3 divided by 416865. 1/138955 Calculate 6776315 divided by 104251. 65 Divide 30146368 by -942074. -32 -281448 divided by -39 93816/13 Divide 8060358 by 6. 1343393 Divide -11311 by -59. 11311/59 Calculate -2 divided by -2603742. 1/1301871 Calculate 71039 divided by 325. 71039/325 What is -123731 divided by -123731? 1 Calculate 20593770 divided by 686459. 30 What is 3225965090 divided by -5? -645193018 What is 90046775 divided by -35? -2572765 Divide -126902352 by -166. 764472 4485 divided by 13396 4485/13396 What is -36349875 divided by 5? -7269975 Divide -36820 by 4844. -1315/173 Calculate -3 divided by 32165038. -3/32165038 Divide -97968680 by -31. 3160280 Divide 9547936 by -596746. -16 -101604732 divided by -186 546262 Divide -1 by -4853326. 1/4853326 Divide -4179252 by 2. -2089626 What is 158965419 divided by 3? 52988473 Calculate -334768224 divided by -4. 83692056 -319334704 divided by -4 79833676 What is 30 divided by 100191? 10/33397 Calculate 1114 divided by 78231. 1114/78231 What is 21673173 divided by 7224391? 3 820372 divided by -2471 -332 What is -5 divided by 20615315? -1/4123063 What is 8606620872 divided by 3? 2868873624 Calculate -56450 divided by -414. 28225/207 -4 divided by 168409679 -4/168409679 252341973 divided by -81 -3115333 133879 divided by 110 133879/110 63866 divided by 50 31933/25 -224596515 divided by 17276655 -13 Calculate -205 divided by -24248. 205/24248 What is 92336 divided by 11542? 8 Calculate 653 divided by 471637. 653/471637 Divide 19756744 by 705598. 28 What is 266 divided by 46230? 133/23115 What is 25584331 divided by 825301? 31 Calculate 45 divided by 248974. 45/248974 What is -607906460 divided by 2586836? -235 What is -3346704 divided by -1673352? 2 Divide 958 by -134578. -479/67289 What is 10 divided by -189519? -10/189519 Calculate 11367 divided by 13991. 11367/13991 -3801900 divided by -5 760380 What is -26427 divided by 259? -26427/259 1914236 divided by 17 1914236/17 What is -4126559205 divided by 3? -1375519735 Divide 5 by -33229648. -5/33229648 Divide -2201 by -20. 2201/20 What is -5391078 divided by -11? 490098 What is -28 divided by 4775964? -7/1193991 -324446956 divided by -3 324446956/3 Calculate -6884 divided by 1966. -3442/983 Calculate 403540308 divided by -476998. -846 Divide -48 by 50513. -48/50513 Divide 10 by 11749297. 10/11749297 What is -2950618 divided by -7? 2950618/7 Divide 615261624 by -6. -102543604 Calculate -29848454 divided by -252953. 118 Calculate -1530555000 divided by 750. -2040740 Calculate 138 divided by 159539. 138/159539 Calculate 8422918 divided by -7. -1203274 Calculate 2218903 divided	{ "pile_set_name": "DM Mathematics" }
20, -34, -224, -468? -784 What is the next term in -26404922, -26404923, -26404924, -26404925? -26404926 What comes next: -8179466, -8179468, -8179470, -8179472, -8179474, -8179476? -8179478 What is next in -28380083, -56760166, -85140249, -113520332? -141900415 What is next in -2118808, -2118698, -2118588, -2118478, -2118368, -2118258? -2118148 What is next in 21106, 21163, 21220, 21277, 21334? 21391 What is the next term in -6881, -25793, -56733, -99701, -154697, -221721, -300773? -391853 What comes next: 2550976, 2550988, 2551000, 2551012, 2551024? 2551036 What comes next: -9860, -39000, -87566, -155558, -242976, -349820? -476090 What comes next: 279717, 279765, 279853, 279981, 280149? 280357 What is next in -96, -235, -302, -165, 308, 1249? 2790 What comes next: 92387, 184646, 276919, 369212, 461531? 553882 What comes next: -11569501, -11569503, -11569505, -11569507? -11569509 What is the next term in -1062, -2160, -3296, -4470? -5682 What is the next term in -39903861, -39903861, -39903863, -39903867? -39903873 What comes next: 23431, 23719, 23997, 24259, 24499, 24711? 24889 What is next in -15393733, -15393737, -15393741, -15393745, -15393749? -15393753 What is the next term in 1649454, 1649394, 1649292, 1649148, 1648962? 1648734 What comes next: -749722, -749702, -749682, -749662, -749642, -749622? -749602 What is next in -369679, -369419, -369159, -368899? -368639 What is the next term in 6243, 12329, 17693, 21975, 24815? 25853 What is the next term in -3776, -4389, -5558, -7403, -10044? -13601 What comes next: 1231880, 1231679, 1231478? 1231277 What comes next: 33206, 66409, 99612, 132815, 166018, 199221? 232424 What is the next term in -357704, -715949, -1074194, -1432439? -1790684 What is next in 2880, 3181, 3996, 5583, 8200, 12105, 17556, 24811? 34128 What is next in -19976, -40356, -60734, -81110, -101484, -121856? -142226 What is next in -1626513, -1626519, -1626533, -1626561, -1626609, -1626683? -1626789 What is next in -4810895, -9621796, -14432707, -19243628, -24054559, -28865500? -33676451 What comes next: 1275, 720, -329, -1872, -3909, -6440, -9465? -12984 What is next in 2180463, 4360926, 6541389, 8721852? 10902315 What is the next term in -2308052, -9231993, -20771894, -36927755? -57699576 What comes next: 1610, 5718, 12316, 21404, 32982, 47050? 63608 What is next in -1732, -13552, -45520, -107710, -210196? -363052 What comes next: 10755, 42995, 96735, 171987, 268763, 387075, 526935, 688355? 871347 What comes next: 32858, 45023, 57182, 69329, 81458, 93563? 105638 What comes next: 93424, 93406, 93372, 93316, 93232? 93114 What comes next: 3880829, 3880823, 3880817? 3880811 What comes next: -5232, -11898, -23008, -38562, -58560? -83002 What is next in -1972, -11075, -35792, -83929, -163292, -281687, -446920, -666797? -949124 What is the next term in 52755, 211043, 474853, 844185, 1319039, 1899415, 2585313? 3376733 What is the next term in 25608, 51067, 76522, 101973, 127420, 152863? 178302 What is the next term in 6646967, 6647028, 6647137, 6647300, 6647523, 6647812, 6648173, 6648612? 6649135 What is next in -5938835, -5938833, -5938831, -5938829, -5938827? -5938825 What is the next term in 59390, 120429, 181476, 242531, 303594, 364665, 425744? 486831 What is next in -29627, -119998, -270617, -481484? -752599 What comes next: 108587, 108525, 108369, 108071, 107583? 106857 What is next in 818, 3179, 7024, 12347, 19142? 27403 What is next in 8981, 12530, 22149, 40868, 71717, 117726? 181925 What comes next: 28702, 57353, 85942, 114469, 142934, 171337? 199678 What is the next term in 58200, 58135, 58040, 57921, 57784? 57635 What is next in -24550126, -24550116, -24550106, -24550102, -24550110, -24550136, -24550186, -24550266? -24550382 What is next in 2160, 7533, 16118, 27915? 42924 What comes next: 2829266, 11317087, 25463456, 45268373, 70731838, 101853851, 138634412? 181073521 What comes next: 69131501, 69131503, 69131505, 69131507, 69131509, 69131511? 69131513 What comes next: 1705758, 1705759, 1705760? 1705761 What is next in 982, 4012, 9078, 16180, 25318? 36492 What is next in -372200, -744401, -1116602, -1488803, -1861004, -2233205? -2605406 What is the next term in 1516204, 6064823, 13645854, 24259297? 37905152 What is the next term in 9450263, 18900521, 28350779, 37801037? 47251295 What is the next term in 363082, 2904690, 9803352, 23237596, 45385950, 78426942, 124539100, 185900952? 264691026 What is the next term in 285, 878, 2023, 4002, 7097, 11590, 17763? 25898 What is next in -4696, -13697, -22700, -31705, -40712, -49721, -58732? -67745 What is next in 848, 3427, 7842, 14195, 22588, 33123, 45902? 61027 What is the next term in -31111, -62374, -93783, -125338? -157039 What is next in 21678, 21409, 20958, 20325, 19510, 18513, 17334? 15973 What is next in 4512, 9212, 13910, 18600, 23276? 27932 What is the next term in 29, 491, 1759, 4217, 8249? 14239 What is next in -21835382, -87341526, -196518432, -349366100, -545884530, -786073722? -1069933676 What comes next: 31411, 50850, 70289? 89728 What is next in -1498, -6475, -14770, -26383, -41314, -59563? -81130 What is the next term in -64851, -259392, -583561, -1037304, -1620567, -2333296, -3175437, -4146936? -5247739 What comes next: -2312201, -9248794, -20809783, -36995168? -57804949 What is the next term in 3142, 2386, 1646, 928, 238, -418? -1034 What is next in -76, -40, 108, 434, 1004, 1884? 3140 What is the next term in -769203, -1538456, -2307709, -3076962, -3846215, -4615468? -5384721 What is the next term in 3263, 3292, 3319, 3344, 3367? 3388 What is next in 887, 4028, 9231, 16490, 25799, 37152, 50543? 65966 What is next in 10276, 9302, 7678, 5404, 2480? -1094 What comes next: -2661, -9222, -20151, -35448, -55113? -79146 What comes next: 504201, 504144, 504071, 503976, 503853, 503696? 503499 What is next in -521488, -1043013, -1564598, -2086273, -2608068, -3130013? -3652138 What is the next term in 1651968824, 1651968825, 1651968826, 1651968827? 1651968828 What is next in 23032, 92294, 207786, 369514, 577484? 831702 What comes next: 164662, 329488, 494310, 659128, 823942, 988752? 1153558 What is the next term in -8041, -8041, -8057, -8107, -8209, -8381, -8641, -9007? -9497 What is next in -620, -40, 1362, 3940, 8048, 14040, 22270? 33092 What is next in -192527, -381482, -570437, -759392? -948347 What is next in 385068, 766395, 1147722, 1529049? 1910376 What is the next term in -209993139, -209993128, -209993105, -209993064, -209992999? -209992904 What is next in 466, 304, 156, 22, -98, -204? -296 What is next in -44440720, -44440726, -44440736, -44440750, -44440768, -44440790, -44440816? -44440846 What comes next: -12186, -12081, -11976? -11871 What is next in -8386, -8656, -8962, -9310, -9706? -10156 What is next in 284, 2322, 7962, 19004, 37248, 64494, 102542, 153192? 218244 What is next in -1306, -2734, -3910, -4708, -5002, -4666, -3574, -1600? 1382 What is next in -6543544, -13087130, -19630716, -26174302, -32717888? -39261474 What is next in 64259, 128571, 192885, 257201, 321519, 385839, 450161? 514485 What comes next: 1258471, 1258486, 1258503, 1258522? 1258543 What comes next: 2667, 3523, 2531, -315, -5021? -11593 What is next in 128, 133, 168, 233, 328, 453? 608 What is the next term in -588800, -1177571, -1766344, -2355119, -2943896, -3532675, -4121456? -4710239 What comes next: 2429, 9326, 20109, 34196, 51005, 69954? 90461 What is the next term in -11612470, -23224943, -34837420, -46449901, -58062386, -69674875, -81287368? -92899865 What comes next: 2415, 4453, 6501, 8559? 10627 What comes next: 5359688, 10719370, 16079050, 21438728, 26798404, 32158078, 37517750? 42877420 What comes next: -812734, -812651, -812570, -812491, -812414, -812339, -812266? -812195 What comes next: -8577979, -8577980, -8577981? -8577982 What comes next: 8777056, 8776825, 8776440, 8775901, 8775208, 8774361, 8773360? 8772205 What comes next: 1924, 903, -118, -1139, -2160, -3181? -4202 What is the next term in -230814, -230821, -230838, -230871, -230926, -231009, -231126, -231283? -231486 What is next in 95283, 190783, 286289, 381801, 477319, 572843, 668373? 763909 What comes next: 111, 605, 1379, 2433, 3767? 5381 What comes next: -845147, -845121, -845095, -845069? -845043 Wh	{ "pile_set_name": "DM Mathematics" }
+ 5i - 4. Let c be t(-3). Let b = -25 - c. Is 12 a factor of b? True Let p(c) = c3 + 5c*2 - 4. Let o be p(-5). Let y be o - 112/3. Is y/6 - (-152)/6 a multiple of 8? True Let n(u) be the third derivative of -u6/120 - u5/12 + 5u3/6 - 6u*2. Let y be n(-5). Suppose -yw + 253 + 77 = 0. Does 22 divide w? True Suppose 3x = -p - 7, -p - 16 = -5p - x. Suppose 0a = -pa + 10, 0 = -2y - 2a + 6. Does 15 divide y/((6/111)/2)? False Is 47044/171 + 2/(-18) a multiple of 20? False Let h be (2 + -1)-3-1. Suppose -6l + hl + 240 = 0. Suppose -4o = -8o + l. Is 10 a factor of o? True Let h = 6970 - 4910. Does 103 divide h? True Let j(x) = 14x2 - 3x - 2. Let l be j(4). Suppose 5k - l = 4o, 124 + 2 = 3k - 4o. Is 6 a factor of k? True Suppose 10 - 20 = -5r. Suppose -3s = -rl + 173, -s = 2l + 2s - 191. Does 21 divide l? False Is 0 - 3 - (-3)/((-9)/(-363)) a multiple of 15? False Let z be 1/7 - (-83)/7. Let t = z - 12. Suppose t = -3v - v + 56. Does 14 divide v? True Let f be (-20)/50(-125)/1. Let c be (260/f)/(4/10). Let h = 8 + c. Is h a multiple of 8? False Suppose 15x - 12x - 12 = 0. Suppose 0 = -xw + 339 + 37. Does 17 divide w? False Let t be 1/(3/(-24)-4). Suppose 2i + 6 = 2x, -3x + 0i + 9 = -ti. Suppose -xh + 0h + 51 = 0. Is h a multiple of 16? False Let t = -1066 + 1678. Is t a multiple of 9? True Is 0 - 17(-9 - 4) a multiple of 77? False Let d = -59 + 64. Suppose -du - 3p + 118 = 0, -4u + 0p - 3p + 92 = 0. Is u a multiple of 13? True Let z(i) = i + 1. Let r be z(2). Let w be -1(-2 + r + -1). Suppose -b + 8 - 2 = w. Is 6 a factor of b? True Let n(r) = -16r*2 - r - 4. Let w be n(-2). Let x = -43 - w. Is 4 a factor of x? False Let h be 20(-1)/21. Let x(f) = -11f*2 + 10f + 15. Let k(y) = 2y2. Let r(i) = 6k(i) + x(i). Does 3 divide r(h)? True Let a = 3 - 17. Let s(k) = -k - 12. Let w be s(a). Suppose 0 = 5z + wo - 117, 2z + 4o = z + 9. Is z a multiple of 5? True Let b(x) = 2x3 - 6x*2 - 4x + 5. Let c be b(7). Suppose 2t = -2, t + c = 4a - 0a. Does 17 divide a? False Let w(g) = 2g*2 + 2g + 7. Suppose -2 - 3 = -5s. Let d = s - -2. Is w(d) a multiple of 8? False Suppose -58 = -o - n, 0o - 2n - 124 = -2o. Suppose -w + 0w = -o. Is w a multiple of 20? True Let v be (-24)/6 - (1 + -48). Is 15 a factor of v + (-8)/(-12)3? True Let r = 13 + -9. Let y(d) = d*3 - 3d*2 - 3d + 1. Let b be y(r). Suppose bo - n - 12 = 4o, 0 = 3n - 9. Does 9 divide o? False Let o = -9 - -11. Suppose o = 2y + g - 3, y + 2g - 4 = 0. Let a(b) = 9b*2 - b + 2. Does 15 divide a(y)? False Does 3 divide (-24)/(-16) + 4170/20? True Let a(r) = 11r + 2. Let h = -50 + 51. Is 5 a factor of a(h)? False Let x(g) = -162g - 15. Let s be x(-5). Suppose 5n = 10n - s. Is 18 a factor of n? False Suppose -5w = -3r + 8, -2r + 3 = -5w - 4r. Let g be 2/7 + 26/7. Is 10 a factor of gw/((-2)/20)? True Let k = -483 + 492. Does 9 divide k? True Suppose -5l + 3a - 36 = -a, -5l = 5a. Does 7 divide (-102)/(-27) + l + 130/18? True Let t be (6 - (3 - -1))-9. Let w = t - -21. Suppose -2v + 12 = -0s - 4s, 2v - 12 = ws. Is v a multiple of 6? True Suppose -3i + 3u = 24, 0 = 5u + 9 - 24. Let l be (-1)/((i + 1)/12). Suppose -2w - 2w - s + 118 = 0, 5s = lw - 100. Is w a multiple of 10? True Let i(u) = -2u + 1. Let n be i(-2). Let w(o) = 15o + 8. Is w(n) a multiple of 22? False Let a(z) = 2z - 25. Let q be a(6). Let i(y) = y2 + 6y + 61. Does 26 divide i(q)? False Let h(s) = -3s + 10. Let o(y) = 3y - 10. Let r(t) = -5h(t) - 6o(t). Is r(-3) a multiple of 15? False Let q = -2 - -5. Suppose -qd - 2d = -r + 38, 4d = 3r - 103. Is r a multiple of 7? False Let n = 4235 - 2918. Does 39 divide n? False Let v(x) = -x*3 + 14x*2 - x + 18. Let w be v(14). Suppose -k + 119 = wd, 0d - 5 = -d. Is k a multiple of 11? True Suppose x = -2x + 21. Let p(q) be the first derivative of q*4/4 - 7q*3/3 + 2q*2 - 8q - 12. Is 18 a factor of p(x)? False Is 9750/24 + (-8)/32 a multiple of 111? False Suppose 3d + 6b - 1731 = 3b, -2b = 2. Does 48 divide d? False Let a(c) = 17c + 7. Let k be a(-2). Suppose -3t = -4o - 152, -38 = -t - 4o - o. Let v = k + t. Does 21 divide v? True Suppose -264s + 7220 = -254s. Is 33 a factor of s? False Let o(i) = 3 - i*3 + 0i*2 - 22i + 1 + 32i + 9i*2. Let y be o(10). Suppose -3x + yg - 8 = -4x, -g + 1 = 0. Does 4 divide x? True Let p(a) = 3a2 - 26a - 115. Does 10 divide p(-19)? False Suppose 12o - 7o = -20, -5d = -o + 181. Let h = 62 - d. Is h a multiple of 22? False Let s(w) be the first derivative of w3/3 - 7w*2/2 - 2w - 29. Does 3 divide s(9)? False Suppose -6q + 7q - 2392 = 2a, -2a = q - 2404. Does 11 divide q? True Suppose -5f + 2s - 844 = 0, -3s = f - 4f - 501. Let m = f - -119. Let k = 118 + m. Is k a multiple of 9? False Suppose -2q - 11 = 3v + 65, 5q - 2v + 209 = 0. Let z = -33 - q. Is z a multiple of 6? False Suppose -78 = -2w + 2u + 150, 585 = 5w - 2u. Suppose 3g + w + 31 = 0. Does 19 divide g/(((-12)/(-4))/(-3))? False Let h = -34 - 17. Suppose u + 2 = 95. Let s = h + u. Does 21 divide s? True Let b(y) = 2y*2 - 13y + 6. Let n be b(6). Suppose n = 2g + 3v - 36, 0 = 3v - v. Does 4 divide g? False Does 30 divide (320/(-3))/((-34)/153)? True Is 13 a factor of 106 - 0/((-21)/3)? False Is (13/(-39))/(2/(-3114)) a multiple of 6? False Suppose 5t = 4t - b, 0 = 3t + 4b + 5. Suppose -tk + 8 = -2. Suppose -4s - 48 = -2y, ky + 17 = 5s + 60. Does 17 divide y? True Is 42 a factor of 4 - (-5 - -6) - -39? True Let q = 220 - 515. Let h = q - -530. Does 47 divide h? True Suppose 3v - 6 = -3n, -4n = -2v - 2n + 12. Suppose -3m + 2a = -4, va = 5m - a - 10. Suppose m = -6w + 7w - 46. Does 8 divide w? False Let d(g) = -g3 + 5g*2 - 3g. Let i(l) = 2l + 1. Let w be i(-2). Let r = w - -6. Does 9 divide d(r)? True Let o be 28/6 + (-2)/3. Let c(f) be the second derivative of 7f*3/6 - 13f*2/2 - 16f + 1. Is 5 a factor of c(o)? True Let i = 3429 - 2061. Does 57 divide i? True Let w = 1722 + -1193. Does 23 divide w? True Suppose -5v - 5y - 108 = -503, v - 75 = -2y. Suppose 2g - 3p = -3g + 224, 2g + p - v = 0. Does 9 divide g? False Let u = -74 + 79. Let o = -25 - -89. Suppose r - ur = -o. Is 7 a factor of r? False Let n = 8 - 6. Let s(u) = 5u + 3u2 + u3 - 3 + 6un + 0u*2. Is 28 a factor of s(-4)? False Suppose 1564 + 2036 = 12c. Is 30 a factor of c? True Does 6 divide ((-2394)/168)/(1/(-8)1)? True Let a be -1 - (-1 + 3)/(-1). Let r be 2 + (41/a - -3). Suppose -227 = -3u + r. Does 27 divide u? False Let j(y) = 2y + 17. Suppose 4t + 25 = -3. Let q be j(t). Suppose -h - qh + 216 = 0. Is 27 a factor of h? True Let n(q) = -2q*2 - 14q - 8. Let b be n(-6). Suppose -3z + 2z = -b, -3r = 3z - 672. Is r a multiple of 11? True Suppose 0 = -5i - 5d + 1147 + 2863, -5i = -d - 3998. Does 5 divide i? True Let c(a) = -a + 114. Let h be c(0). Suppose -3i + 3y = -h, -3y = i - 2y - 42. Is 5 a factor of i? True Let n be -5(-1 + 2/10). Let z(m) = -8m + 21. Let b(u) = -u2 + 23u - 55. Let o(y) = -3b(y) - 8z(y). Is o(n) a multiple of 25? True Let r(l) = 8l2 - 10l + 9. Is r(1) a multiple of 5? False Suppose -9l + 10l + 1 = 0, 4d + 3l - 157 = 0. Does 4 divide d? True Suppose y = -5t + 64, -253 = -5y - 4t + 88. Suppose -3r - y = -6r. Is r a multiple of 4? False Let v = 25 + -21. Suppose g = -4k + 6k - 17, vk - 55 = -5g. Suppose ky = 11y - 10. Is 4 a factor of y? False Let u(k) = -41k*2 + 2k + 5. Let j be u(-2). Let g = -83 - j. Does 5 divide g? True Let y(m) be the second derivative of -7m3/6 + 2m*2 + 7m. Let q(s) = 6s - 4. Let p(a) = -3q(a) - 2y(a). Is p(-2) a multiple of 3? True Let k = 10 + -7. Suppose 5v + 260 = -5w, 0w + kv = 3w + 156. Is 8 a factor of (-4)/(-1(-8)/w)? False Let w(q) = q + 1. Let t be w(3). Let u be t + -1 + -15 + 19. Let o(f) = 12f + 6. Is o(u) a multiple of 18? True Let b = 3715 + 843. Is b a multiple of 12? False Suppose -5f - 28 = -18. Let t(g) = -8g*3 - 3g*2 - 2g. Does 10 divide t(f)? False Let m(o) = 2o2 + o + 108. Is 21 a factor of m(0)? False Does 25 divide 9 - (-106)/6 - (-5)/(-3)? True Suppose 13c - 2 = 14*c. Does 2 divide	{ "pile_set_name": "DM Mathematics" }
x + 2 = 3l, -4x - l = -0x - 24 for x. 5 Solve -5t + 13i + 8 = 12i, 3i = -t + 8 for t. 2 Solve 2n = y + 2, -3n + 4y + 3 = 7y for n. 1 Solve -5m - 9 = 2g, 99g - 27 = 95g - m for g. 8 Solve 4p + 23 = 5d, 5p + 32 + 2 = d for d. -1 Solve 0 = 4o + 5a - 2a + 10, 2 = o + 3a for o. -4 Solve 0 = 4l - 17k + 12k, l = -2k + 13 for l. 5 Solve 3o = 4b + 28, -o = -57b + 61b - 4 for b. -1 Solve 0 = -a - 4a - 5l - 15, 3a + 4l = -14 for a. 2 Solve 3w - 2n - 13 = 0, -3n = -4w + 13 + 5 for w. 3 Solve 0 = 5o - 3s, -10o + 3s - 9 = -8o for o. 3 Solve -9q + 4q = d + 23, -d + 12 = -2q for q. -5 Solve 3a = -3s - 27, -4s + a = -0s + 11 for s. -4 Solve 0 = 2f + 2r + 16 + 4, -2r - 30 = 4f for f. -5 Solve -4u + 3u + w = -5, -3u - 2w = 0 for u. 2 Solve 2i = 3i - 4t + 5, i = -2t + 1 for i. -1 Solve 6z - 9z - 9 = a, 5a = -4z - 23 for z. -2 Solve 0 = 5o + 2h - h - 6, 2o + 4 = -2h for o. 2 Solve 3r - u - 3 = 2, u = -4r - 5 for r. 0 Solve 0 = 3a + 2v - 5, -7a + 9 = -12a + v for a. -1 Solve 3z + 4c = 5c - 17, 3c = 15 for z. -4 Solve 0 = 3g - k + 16, g - 8 = 2g - 3k for g. -5 Solve 0 = -2s + 4j + 12, -5j - 5 = -5s + 5 for s. -2 Solve 1209f - 1208f = v, 2f = v - 4 for f. -4 Solve -x - 5t = -18, 0 = -11x + 6x - 2t - 2 for x. -2 Solve 0 = -4o + u - 13, -6o = -3o - 3u + 21 for o. -2 Solve 5q + 2j + 2j = -31, -3 = -3q + 3j for q. -3 Solve 3f = 5f - 4, 2f = -4i for i. -1 Solve -36 = -4w - 4u, -10w + 35 = -7w + 5u for w. 5 Solve 4a + 65 = 3g + 88, 5 = -g for a. 2 Solve 8 = -r - g, g - 2 = 5r + 8 for r. -3 Solve 4p - v - 11 = 0, 3v - 13 = -2p + 2v for p. 4 Solve -4j - 4 = 4z - 0z, -3z - 17 = -4j for z. -3 Solve -24o + 29o = -x + 9, -2o = x - 3 for o. 2 Solve t - 4q = 1, -q = -2t + 2 - 0 for t. 1 Solve -4m = -5o + 23, -2o - m + 1 = -3 for o. 3 Solve -v + 3 = 0, 2 = h - 5v + 4v for h. 5 Solve 5j + 2a - 7a = 30, 2j + 16 = -5a for j. 2 Solve -3o + 18 = 2d, -427o + 432o - 29 = -3d for d. 3 Solve 16 = -4c - 3x, 4c + 2x + 12 = -0x for c. -1 Solve -z - 1 = -2g + 2, 13 = 3z + 5g for z. 1 Solve 4l = -5i - 4, 2l + 8 = -10i + 6i for i. -4 Solve -29k + 28k = -3f + 11, 0 = k + 2 for f. 3 Solve -2i - 4 - 4 = 0, 3d + 2i + 8 = 0 for d. 0 Solve -j = 5q - 24, 107j + 20 = 112j + 5q for j. -1 Solve x - 4d + 11 = 0, -5x + 0x - 3d + 14 = 0 for x. 1 Solve -5 = -10o + 15o, -4q + 3o = -3 for q. 0 Solve 0 = -3i - 2h - 16, -11i + 15i + h + 18 = 0 for i. -4 Solve -q + 3 = 2m, 0 = 5m - 15 + 20 for q. 5 Solve p = -5q - 15, -5q - 15 = 2p - 7p for q. -3 Solve 0 = -5s + 4t + 29, -s = -22t + 21t - 6 for s. 5 Solve -5x = 3i + 2 - 1, -2x - 5i - 8 = 0 for x. 1 Solve 3 = 3g + 3o, 5g + 2o - 12 = g for g. 5 Solve -2m + z - 2 = -2z, -2m + 26 = 4z for m. 5 Solve 2f = 5n - 6, 31f - 27f = -2n + 12 for f. 2 Solve -3c + r - 8 = -12, 0 = -2c - 4r - 16 for c. 0 Solve -5q - 16 = 4i - 33, 3q = -8i + 27 for i. 3 Solve 2s - 3 = -g - 3s, -3g - 2s - 4 = 0 for g. -2 Solve 0 = -2y - 2, -5v + 126y + 8 = 128y for v. 2 Solve -2p + 0p = -5d + 5, -d - 3p = -18 for d. 3 Solve 3m - 5x - 5 = 4m, -3x + 9 = 3m for m. 5 Solve 20 = -2q + 3v, -3q + v = -1 + 17 for q. -4 Solve 0 = -2g - 2g - 3z - 26, 5g - 3z + 19 = 0 for g. -5 Solve -4f + 6n - n = -3, 6 = f - 3n for f. -3 Solve 4m - 3n = 1, 10m + 0n + 23 = -n for m. -2 Solve -7x = -3m - 12x + 28, -5x + 34 = 4m for m. 6 Solve 0 = 2k - 6z + 9z - 16, -z = k - 6 for k. 2 Solve -2p - 19 = -5b, 5 - 9 = 2p for b. 3 Solve 2q - 22 = -4j + q, 4q - 8 = 0 for j. 5 Solve -2a - 2a = 2l + 20, -3a = -3l + 6 for a. -4 Solve -l = c - 2l + 7, 4c = -2l + 2 for c. -2 Solve 3f = -12, 3x - 20 = -x + 3f for x. 2 Solve -k + 17 = 17v - 22v, 5k = 5v + 25 for v. -3 Solve 0y + 2y + 2r - 10 = 0, -5y - 4r + 21 = 0 for y. 1 Solve i + 5k = k - 1, -i + 5k = 10 for i. -5 Solve -l + 8 = f, 6l = 3l - 5f + 30 for l. 5 Solve -c - 3x = 1, -c + 5x = 3c - 30 for c. 5 Solve 3n = -v + 13, 20 = 4n - 42v + 46v for n. 4 Solve -3h = -2o - 23 + 18, 6o + 2h + 26 = 0 for o. -4 Solve 3b + 4 = b - 3t, 3t + 24 = 3b for b. 4 Solve -2b + 3k + 4 = 0, 2b + 5k + 21 + 7 = 0 for b. -4 Solve -4v + t = -11, -v - 2t = 51 - 56 for v. 3 Solve 22 = 2a + 3y, 5y = 2a + 3 + 7 for a. 5 Solve -a + 5 + 0 = 4r, -4r = 3a - 15 for r. 0 Solve -5n + 4r + 22 + 4 = 0, -4n + 16 = -2r for n. 2 Solve g = 2y + 1 + 4, 4y - 3g = -15 for y. 0 Solve -z - 21 = 5y, 9 = -2y + 2z - 9 for y. -5 Solve 2j = -2c - 8, 40 = 7j - 12j + 5c for j. -6 Solve -4w + 4 = -4g, 5w = 9w - g - 4 for w. 1 Solve 5r + 8 = 3h, -3r - 2h = -1 + 2 for r. -1 Solve -i = 3i + 4b - 12, -2b = 3i - 9 for i. 3 Solve -3q + 13 = 2p, -5q - p + 5 + 5 = 0 for q. 1 Solve -5a = 5c + 30, 9c = 5c + 3a - 3 for c. -3 Solve k - 6 = 3i, 3k - i - 8 = -6 for k. 0 Solve -b + 3 = 0, 5v - 8 = -5b + 9b for v. 4 Solve -2o - 6 = -z, 1022z - 1017z = -2o - 18 for z. -2 Solve 4t - 19 = -u, -7 = -u - 4 for t. 4 Solve 76 = -15i + g, 6i - i + 23 = -2g for i. -5 Solve 5b = z + 29, -5b + 19 = -4z - 22 for z. -4 Solve 24 = -6i, -4j = -8j - 2i for j. 2 Solve 6v - 8v + 4o = 8, 2v - 3o + 7 = 0 for v. -2 Solve 3l + 14 = d + 6, 4d = 20 for l. -1 Solve 0 = 4u - 7u + 3b - 24, 0 = 4u + 4b + 8 for u. -5 Solve -3t - 5b = 29, -3b - 4 - 8 = 0 for t. -3 Solve 12 = 2q + 5n, 0q + n = 3q - 1 for q. 1 Solve y - c + 3 = 0, c - 1 = y + 2c for y. -2 Solve -5 = 5w - 4v, -110w - 2v = -112w - 4 for w. 3 Solve 2i = 5j - 13, 0i - 4j + 13 = i for i. 1 Solve -3 = 4l + h, 5h - 6 = 5l + 4 for l. -1 Solve 0 = b - y + 4, 4b + 7y = 3y - 24 for b. -5 Solve 3v + c - 172 = -163, -5v = 3c - 15 for v. 3 Solve 5 - 1 = 2i - j, 4i - 5j - 2 = 0 for i. 3 Solve -x - 10 = -4f, -5x - 2f = 3f - 25 for x. 2 Solve -3c = 4d + 27, 8 = 4d + 2c - 6c for d. -3 Solve 0 = 5g - 20, 2g = -19w + 22w - 7 for w. 5 Solve 4q - 2p + 4 = 0, -q + 0p + 5p + 17 = 0 for q. -3 Solve 4u = -u, 4u - 5 = f for f. -5 Solve -5y + 1 = 4a + 28, 0 = -3y + 3a for y. -3 Solve x + 0 = -5a - 19, 4x + 3a + 25 = 0 for x. -4 Solve 2v - 2o = 0, -8o + 13o = -20 for v. -4 Solve 4h = w + 21, -5h + 6 + 16 = 3w for h. 5 Solve -7 = -3a + w - 0, -5a - 3w = -35 for a. 4 Solve 5i = -2r - 10, 0 = 3r + 2r - 5i - 45 for r. 5 Solve 80s + 4p = 75s + 23, -4s = p - 14 for s. 3 Solve -4w = 42a - 40a - 22, w = -5a + 19 for a. 3 Solve 0 = 2a + 4q - 4, -2a + 41 - 37 = 3q for a. 2 Solve 5u + 2g - 8 = 0, -15g + 4 = -2u - 14g for u. 0 Solve -3l + 17 = -f, -28 = -2l + 4f - 0f for l. 4 Solve 0 = -2o - 284 + 278, -3k + 4o = -21 for k. 3 Solve -49f = -2u - 44f + 15, 5u + 5f + 15 = 0 for u. 0 Solve 3r + w = 2, 15r - 18r - 2 = -w for r. 0 Solve -4a + 15x - 4 = 11x, 3a - 2x + 6 = 0 for a. -4 Solve 2f + 0f = -4c + 10, 0 = 5f - 2c - 1 for f. 1 Solve w = -4o + 9o + 7, 0 = 2o + 4 for w. -3 Solve 0 = 3s + 9, -x + 4s - 5 = -21 for x. 4 Solve 0 + 2 = -x + y, -x - 5y + 16 = 0 for x. 1 Solve 4g - 3o + 25 = 0, 3g + 2g + 2o + 14 = 0 for g. -4 Solve -4c - 3j + 6 = 0, -121c = -119c - j + 2 for c. 0 Solve 0 = -3f + v + 13, 6v - 2 = 4f - 2f for f. 5 Solve -w = 4n - 20, -n + 2w = -0 + 4 for n. 4 Solve -52f - 28 = -50f + 5i, -5f - 3i - 32 = 0 for f. -4 Solve h + 32 = -5w + 7, 5w + 25 = -4h for h. 0 Solve -2b - 11o = -14o - 1, -o - 3 = 0 for b. -4 Solve 4a + 12f = 14f + 12, 14 = 2a - 3f for a. 1 Solve c = 4s + 22, 5c - 15 - 20 = 5s for c. 2 Solve -4s + 35 = 3b, s = 5b - 0s - 20 for b. 5 Solve 6 = v - 2m, -3v - v + 2m = 6 for v. -4 Solve 5 = -j, z - 23j + 2 = -24j for z. 3 Solve 0 = 3f + 27t - 25t + 23, -4t = -4f - 4 for f. -5 Solve -4l + 1 = 3h - 3, 3l = h + 16 for h. -4 Solve -2c = 5f + 5, -3f - 1 = 3c + 2 for c. 0 Solve 0 = -0r + r - 3, 5r - 27 = 4l for l. -3 Solve 0 = -3w + 6, -5t - 12 = -9w + 13w for t. -4 Solve -3a + 10 = -5r, a + r - 2 = -12 for a. -5 Solve k + 4 - 9 = -q, 20 = 4q - 4k for q. 5 Solve -5g = -5k + 2k, -4k = -2g + 14 for g. -3 Solve -4n = -w - 15 + 1, 0 = -4w - 2n + 16 for w. 2 Solve c = 4q - 20, 2*c = q -	{ "pile_set_name": "DM Mathematics" }
+ (2i4 - 4i*4 + 3i*4)(-9i + 9i + 24i). 29i*5 - 9 Expand (38 - 12r - 38)(19r*2 - 4r*2 + 8r*2) + (3r*2 - 3 + 3)(-2r + 0r + 0r). -282r*3 Expand (2c4 - c4 - 3c4)(2 + 0 + 1 + (2 - 3 + 3)(3 - 1 - 1) + 3 - 3 + 2 + 244 - 426 + 228)(3 - 4 - 3c + 4c). -106c5 + 106c*4 Expand (-5598 + 1208 - 2223 - 841 - 2992)(3k - k3 - 3k). 10446k3 Expand (148 - 131 + 288)(-o + 3o + o). 915o Expand (3d + 3d - 2d)(4 + 2d2 - 4)(-16 + 16 + 7d2 + (-2 + 2 - d)(2d - 2d - d) + 3d + 3d*2 - 3d). 88d5 Expand (-38 + 38 + 15n)(-4n + 25n + 25n). 690n2 Expand 120n*2 + 6882n - 6882n + (n2 + 0n + 0n)(-4 + 5 + 1) + 4n2 + 15 - 15. 126n2 Expand (-y4 + 9694y + 599y*2 - 9694y)(3 - 5 - 3). 5y*4 - 2995y*2 Expand -2j*2 - 390765 + 22934j*5 + 390765 - 2778j5 + (-j4 + 2j2 - 2j*2)(0 - j + 0). 20157j5 - 2j*2 Expand (8l*2 - 45l + 45l + l5)(-111 + 207 + 226) + 2l5 - 5l5 + l5. 320l5 + 2576l*2 Expand (-6 - 5c*4 + 6)((-6 + 4 - 10)(-2c - 4 + 4) + (2 + 2 - 3)(-c - 2c + 2c) - 2c + 3 - 3) + 0c3 - 12c*5 + 0c*3. -117c*5 Expand 93a*2 + 4882 - 4882 + (-2a - 2a + 3a)(a + 0a + 2a) - 4a*2 - 2a + 2a - a + a + a2. 87a*2 Expand (1 + 2p - 1 + p - 3p + 0p + p + 0p - 3p + (5 - 2 - 2)(0p - 5p + 4p) - 3p - 3p + 2p - 4 + 4 - 3p)(1 + 2 - 1)(72p2 + 25p*2 - 50p*2). -940p*3 Expand (-5 + 2 + 2)(-4j2 + 6j*2 - 3j*2) - 369j*2 - 108511 + 108511. -368j2 Expand (z2 + 2z2 - 4z*2)(-5z + z + 5z)(-400 - 705 - 31). 1136z*3 Expand 82 - 82 + 20o*2 + (o + 0o + 0o)(0 - o + 0 + (3o - o + o)(1 - 3 - 1)). 10o2 Expand 3b*5 - 5b*5 + 4b*5 + ((9 - 9 - 2b)(0b + 0b + 2b) + 2b2 + 0b + 0b)(24b3 - 8b*3 + 5b*3). -40b*5 Expand (-9w*4 + 63w*4 - 2w*4)(w - 4w + 6 + 0w). -156w5 + 312w*4 Expand 5z*5 + 10171z*2 - 4z*4 - 10171z*2 - 32z*4 + 12z*5 + 32z4 + (z2 - z*2 + 3z*2)(-z2 + z2 + z*3). 20z*5 - 4z*4 Expand -729j*4 - 16j*4 - 1461j*4 + (2 - 2 + 2)(2j3 + 2j*4 - 2j*3). -2202j4 Expand (4 - 4 - k2)(220k*2 - 220k*2 - 68k*3) + 34k*5 + 3689k - k*2 + 2k*3 - 3689k. 102k5 + 2k3 - k2 Expand (-219x2 + 10x*2 - 34x*2)(3 - 7 - 2). 1458x2 Expand (29r + 5 - 13r - 3)((-4 + 5 + 1)(4 + 0 - 2) - 111 - 68 - 57). -3712r - 464 Expand (2w - 3 + 3)(-4w + 3w + 0w) - 31681337 - 13813w*2 + 31681337. -13815w*2 Expand (2m + 12 - 12)(-3m - 117m2 + 26m*2 - 1 - 18m*2) - 4m2 + m3 + 4m2. -217m*3 - 6m*2 - 2m Expand (3z - 3z + z*4)(1 - 1 - 2) + (-19z2 - 18z*2 + 19z*2)(4z2 - 40z*2 + 68z*2). -578z*4 Expand (1 - 1 + 2)(-58 - 8 - 13 - 2 + 3 + 0 - 3 + 5 + 0 + (2 - 5 + 2)(-4 + 0 + 3) + 0 + 4 - 3 - 1 - 3 + 6)(8r - 14 + 14). -1152r Expand (6 + 1 - 4 - 1 - 2 + 1 + (3 + 0 - 2)(-1 + 1 + 1) + 4 + 1 - 3 - 1 - 1 - 4)(4 - k*2 - 2 - 1)(-k3 + k3 + k*3). 2k*5 - 2k*3 Expand 32498 - 32498 - 770q*2 + (q - 1 + 1)(-2q + 3q + q). -768q2 Expand (2405g + 3562g - 1684g + 1702g)(g*2 + 5g2 - g2). 29925g3 Expand 5w*2 - 89 + 89 + (1 - 3 + 1)(361 - 361 + 35w2). -30w*2 Expand (4d4 - d2 + d*2)((-3 + 6 - 2)(-2 - 2 + 3) - 3 - 3 + 5)(135 + 148 - 116). -1336d4 Expand (4082 - 50i - 4082)(0i2 - i2 + 0i2)(-15 + 15 - 2i). -100i*4 Expand 6l*2 - 20l*3 - 3l*3 - 9l2 + (l3 + l3 + l3)(4 - 6 - 4). -41l*3 - 3l*2 Expand (-3 + 1 + 0)(-u2 + u2 + 2u2)((3 - 3 + 3)(-3u - 20u - 23u) + (-2 + 4 - 1)(-6u + 2u + 2u) - u + 2u + 0u + u - 3u + u). 560u*3 Expand (-2s - 2s + 2s)(1 - 4 + 5)(4s2 - 3s*2 + 2s*2)(5s - 4s + 6s) + (6 - 6 - 30s)(3s*3 + 4s*2 - 4s*2). -174s*4 Expand (13 - 47 + 6)(14t3 + 33t*3 - 4t*3). -1204t*3 Expand (-4 - 2 + 3)(-i*2 - 2i*2 + 4i*2)(-5 + 5 - 2i)(4 - 2 - 1)(421 - 600 + 358)(-4i + 0i + 2i). -2148i*4 Expand (-1 + 1 - j)(216 - 2110 - 444 - 2 - 1137). 3477j Expand (-5 + 0 + 13)(-246878x + 246878x - 667x2). -5336x*2 Expand (-55 - 59b*2 + 28 + 30)(-14391b + 62b*2 + 14391b). -3658b4 + 186b*2 Expand (-2s - 5244s2 + 2 + 2s - 5255s2 + 10434s*2)(-16s2 + 2s*2 - 14s*2). 1820s*4 - 56s*2 Expand (5b*2 - 3b*2 + 3 - 6b*2)(3b + b - 3b) - 1539b2 + 33b*3 + 1539b*2 + (-2 + 2 - 2b*2)(-2b + b + 0b) - 2b3 + 3b*3 + 0b*3. 32b*3 + 3b Expand (5 + 0 - 3)(-3 + 0 + 4)(0u + 3u - 2u + (-5 + 1 + 2)(u + 0u + 0u) + 11u - 15u - 17u)(0u3 - 3u*4 + 0u*3 - 1). 132u*5 + 44u Expand (2 - 3 + 48a - 95a + (-2a - 2 + 2)(3 + 0 - 1) + 1 - 1 + 2a)(9a - 12a - 17a). 980a*2 + 20a Expand (-7766s + 3951s + 3951s)(5 + 1 - 4). 272s Expand (-6 + 1 - 5)(-4698b2 - 4166b*2 + 2737b*2 - 2204b*2 - 1349b*2). 96800b*2 Expand (8757 + 4649 - 259 - 2689)(-r - 3r + 3r - 2r + 2r + r + (-2 + 2 - 2r)(3 + 0 - 1) + 1 + r - 1). -31374r Expand (6161 - 146x - 6161)(-2 + 3 - 17 + 2 - 3 + 3 - 3 + 1 + 1 + (1 - 1 + 1)(0 + 0 - 1) - 2 + 2 + 1 - 2 - 2 + 2). 2482x Expand (16 + 3 + 1)(-10j2 + 6j*2 - 9j*2) + 99 - 10j*2 - 99. -270j*2 Expand (309 - 5471 - 6631 - 675 - 1665)(0 + m + 0). -14133m Expand -6c + 4c3 + 6c + (0 - 2 + 3)(2c3 - c3 - 3c3) + (-3c*2 + 9c2 + c2)(-25c - 29c + c). -369c*3 Expand (-14v + 5v - 16v)(v + 2v - 2v)(4v2 + 2v - 2v) + 0v*4 + 4v*4 - 6v*4. -102v*4 Expand (2 - 2 + 3 + 3 + 0 - 2 + (-3 + 3 - 1)(-1 + 1 - 2))(-12k + 5 - 5)(5k*4 - 4k*3 + 4k*3). -360k*5 Expand (0 - 1 + 2)(5008620 + 2771a - 5008620). 2771a Expand -4f2 + 2f*2 + 0f*2 + (1 - 1 - 2f)(-f + 5f - 5f) + 2f2 - f2 + 2f2 - 15 - 7f*2 - 59f*2 - 8 + 23. -63f*2 Expand (-1 + 1 + 3z)(-29 - 7175z + 14117z - 7118z). -528z2 - 87z Expand 17f4 - 57f4 - f4 + (-1 + 1 - f)(f3 + f3 + 0f*3) - 2f*4 - 2f*4 + 0f*4. -47f*4 Expand (462 + 443 + 606 - 6601 - 7305)(-5d3 + 0d*3 + 4d*3). 12395d*3 Expand -l - 3l + l + (-1 - 2 + 1)((-3l + 4l - 2l)(-2 + 0 - 3) - 7l + 9 - 9). l Expand n*3 - 3n - 11n + 15n + (3n2 + 0n*2 - 2n*2)(-4n - 1 + 1) + 37n*2 - 146n*3 - 37n*2. -149n*3 + n Expand ((-3 - 4 + 6)(-r*3 + 0r*2 + 0r*2) - 6r3 + r3 + 2r3)(7465r2 + 411 + 404 - 815). -14930r*5 Expand (2v + v - 2v)(-3 + 4 - 4)(-4 + 0 + 3)((-4 + 4 - 2v)(4 - 3 + 2) - 4v + 9v - 10v + 4v - 9v - 12v). -84v2 Expand (2 - 6 + 1)(-u - 2u + u) + 1334 - 1334 - 1289u. -1283u Expand (56 - 64 + 51)(27w - 22w - 18w). -559w Expand (74j - 26j + 14j)(j*4 + 0j*3 - 2j + 0j3). 62j*5 - 124j*2 Expand -5w*2 - 3w*2 + 6w*2 + (3w + 3w - 8w)(16w + 9 - 9) - w*2 + 2w*2 + 0w*2 - 3w2 - w2 + 2w2. -35w2 Expand (o2 + o - o)(-1 - 549154o - 3173o2 + 1 + 549153o). -3173o4 - o3 Expand (7d*2 - 13d2 - d2)(-2d*3 + 5d*3 - 4d*3) + (2 - 1 - 2)(5d + 12d*5 - 3d - 4d + 1). -5d*5 + 2d - 1 Expand (-98l + 98l + 26l3 + (3l - l - 4l)(l*2 - 2l*2 + 3l*2))(-2l + 3l + 0l). 22l*4 Expand (2 - 2m + 1 - 2)(984 - 987 + 81m*3 - 13m*3). -136m*4 + 68m*3 + 6m - 3 Expand (-25x3 + 29x*3 - 23x*3)(-8x - 13x - 13x)(-5 + 1 + 2). -1292x4 Expand 7 - 36m2 - m4 - 9 + 38m2 + (0m*3 - 4m*3 + 3m*3)(-2 + 2 - 3m). 2m*4 + 2m*2 - 2 Expand (856p + 938p - 1947p - 3)(-3p + 2p + 2p)((-4 + 1 + 4)(p - p - p) + p + 2p - p)(2 + 1 - 1). -306p3 - 6p*2 Expand (-25944g*5 + 13014g*5 + 12973g*5 + 10g)(5 - 1 - 3). 43g*5 + 10g Expand -3 + 3 + l + (-22 - 17 + 5)(4 - 4 - 2l) - 5l + 3l + l - 3l + l + l + (l - 5l + 3l)(-2 - 1 + 4) + 4l + 0l + 13l. 83l Expand (1 - 1 + 1)(2h*2 + 2h2 + h2 + (h - h - 2h)(2 - 2 - 2h) + 3h*2 - 5h*2 - 2h*2 - 6h*2 + 9h - 9h)(2 - 2 + 2). -2h2 Expand (3b + 10b + 43b)(-5 + 22 + 12)(b2 - b2 - b*2). -1624b*3 Expand (26x - 84x - 35x)(-x + x - 2x*3) - 22x*2 + 22x*2 + 6x*4 + (-3x - 2 + 2)(-3x*3 - 2x*3 + 4x*3). 195x*4 Expand (-247i + 510i - 258 - 261i)(-2 + 2 + 3i). 6i2 - 774i Expand (-3p2 + 3p2 - p3)(-4816p	{ "pile_set_name": "DM Mathematics" }
1647737 by -7. -235391 Calculate 473952556 divided by -3077614. -154 Calculate 36636449 divided by -16. -36636449/16 What is 9293660 divided by 5? 1858732 -54057822 divided by -182 297021 Calculate 23 divided by -1495535. -23/1495535 Divide 4354698 by 725783. 6 Calculate 259 divided by 267640. 259/267640 Divide 17974179 by -21171. -849 Divide -10046432 by 627902. -16 Calculate -25 divided by -212311. 25/212311 -218017590 divided by 1082 -201495 437385030 divided by 1467735 298 What is -203720 divided by -268? 50930/67 Calculate 7 divided by 17493714. 1/2499102 Divide -40 by 163696. -5/20462 Divide 1 by -66036256. -1/66036256 Divide 13261 by 22532. 13261/22532 Calculate -5614635 divided by 1871545. -3 -16587324 divided by 921518 -18 Divide 12759904 by 16. 797494 Calculate 253 divided by -930320. -253/930320 Calculate -598642784 divided by 2. -299321392 What is 3 divided by 83361099? 1/27787033 Calculate -2 divided by 16407211. -2/16407211 Calculate 1264795 divided by -4. -1264795/4 Divide -6324895 by 4. -6324895/4 Calculate 3931690 divided by -56167. -70 What is -136446 divided by 13? -136446/13 Divide -136016584 by 54934. -2476 12641 divided by 106 12641/106 -44119917 divided by -14706639 3 What is 4710222 divided by 261679? 18 Calculate -1 divided by -5338088. 1/5338088 Divide 13 by 10890464. 1/837728 149937000 divided by 1999160 75 Calculate 83170348 divided by 7. 83170348/7 Divide 98278060 by -2930. -33542 Divide 28285376 by -3535672. -8 What is -7403 divided by 3918? -7403/3918 Divide 24651360 by 8109. 3040 Divide 7684390788 by 6. 1280731798 What is 14816928 divided by 28? 529176 Calculate 55 divided by -796. -55/796 What is 424 divided by -7549? -424/7549 Calculate -331236 divided by 9. -36804 Calculate -5 divided by 9898216. -5/9898216 272329 divided by -560 -272329/560 Divide 79 by 200577. 79/200577 Divide 534926 by -59. -534926/59 Calculate 135 divided by 330449. 135/330449 -124010 divided by -745 24802/149 What is -4 divided by 3914384? -1/978596 Calculate -6785940 divided by -420. 16157 Calculate 47830367 divided by 6. 47830367/6 Calculate 241971730 divided by -10510. -23023 Calculate 1556100 divided by -91. -17100 -20427030 divided by -9243 2210 What is 3838848 divided by 36912? 104 Divide 19682310 by -3936462. -5 39160601 divided by 1 39160601 -293357340 divided by -6 48892890 -6020 divided by 30267 -6020/30267 Divide -4 by 1208547. -4/1208547 What is 100300 divided by 234? 50150/117 Calculate -3962748 divided by -9. 1320916/3 What is -15728060 divided by 10? -1572806 Calculate 208841940 divided by 204747. 1020 Divide -3333 by 11365. -3333/11365 Divide 12 by -3573211. -12/3573211 -2641392 divided by 117 -22576 What is 34509573 divided by 3? 11503191 What is 18260 divided by -10273? -18260/10273 Calculate 117566890 divided by 16795270. 7 -852481795 divided by 5 -170496359 Divide -4 by -661060. 1/165265 Divide -182539050 by -1258890. 145 Divide -37855440 by -1421. 26640 Divide -38792908 by -13258. 2926 Divide 2664120 by -44402. -60 Calculate 0 divided by -92750. 0 Calculate -1714972788 divided by -61. 28114308 Calculate -108674 divided by -7. 108674/7 Divide 4550645 by -55. -82739 -146623530 divided by 24437255 -6 Divide 465 by 699. 155/233 What is 0 divided by 3604792? 0 27760110 divided by 335 82866 Divide 2154 by -171339. -718/57113 -602291840 divided by 80092 -7520 Calculate -277636723 divided by -39662389. 7 What is 40 divided by -433886? -20/216943 Calculate 11006000 divided by -80. -137575 Calculate -102747062 divided by 1606. -63977 138 divided by 252958 69/126479 Divide 1422 by -536467. -1422/536467 Calculate 5253283 divided by 3269. 1607 Calculate -3702600 divided by 22. -168300 121 divided by -432892 -121/432892 What is 106 divided by -6397043? -106/6397043 What is -591151675 divided by 5? -118230335 -73 divided by -27540 73/27540 1906218 divided by 3 635406 767703 divided by 14 767703/14 -12570630 divided by -2514126 5 Divide 10946182 by -4. -5473091/2 Divide -3365 by 4927. -3365/4927 -522 divided by 29737 -522/29737 38343340 divided by 3834334 10 -88899 divided by -88 88899/88 Calculate -61522444 divided by -4. 15380611 -421566 divided by 51 -8266 Divide 375 by 3839. 375/3839 -1709545 divided by -341909 5 -9805475 divided by -392219 25 4614202 divided by -27 -4614202/27 -6 divided by 1171669 -6/1171669 Divide 133381 by -2889. -133381/2889 What is 0 divided by -95034? 0 What is 22180537 divided by -2? -22180537/2 Calculate 12367128 divided by -6183564. -2 Calculate -6304656 divided by -19. 331824 What is 733249776 divided by -2182291? -336 Divide 3440406 by 1720203. 2 Calculate 108 divided by -386515. -108/386515 Divide 1 by 1326232. 1/1326232 Divide 129380925 by 2. 129380925/2 Divide 8777 by -3325. -8777/3325 Divide 29275009 by 1. 29275009 Calculate -18843360 divided by 5920. -3183 What is 6600 divided by -14474? -3300/7237 Calculate -21356154 divided by 3798. -5623 What is 2448 divided by 48297? 48/947 3091416 divided by -7577 -408 Calculate 102877500 divided by -27434. -3750 Calculate 4767453 divided by 49149. 97 Calculate -2 divided by -2733010. 1/1366505 6624045 divided by -15 -441603 -583 divided by -21211 583/21211 Calculate 54885978 divided by 2. 27442989 Calculate -4549864 divided by 1192. -3817 44485079 divided by -5 -44485079/5 23399025 divided by 23399025 1 Calculate 17902797 divided by 3. 5967599 Divide 8452701 by -3. -2817567 Divide 2027883 by 1793. 1131 Divide 42621922 by -77074. -553 -5156010 divided by -531 9710 18935112 divided by 901672 21 What is 62522 divided by 534? 31261/267 Calculate 1123564 divided by -52. -21607 8316360 divided by 31986 260 What is -3369310 divided by -3790? 889 Calculate -16543793 divided by -4. 16543793/4 Divide -714678 by -383. 1866 -1933104 divided by -4944 391 Calculate 56 divided by 1387049. 56/1387049 Calculate -140598 divided by -1913. 140598/1913 What is 0 divided by -56100824? 0 Calculate 6012 divided by -486. -334/27 What is -108607 divided by -18? 108607/18 Calculate 428976347 divided by 1. 428976347 Calculate -2039345 divided by 26. -2039345/26 Divide -61905509 by 7. -61905509/7 What is 57208280 divided by 4? 14302070 979258 divided by 4333 226 What is -3949007 divided by -16? 3949007/16 -2469063 divided by -3 823021 18814 divided by -29 -18814/29 Divide 965688 by -15. -321896/5 What is -3 divided by 36157642? -3/36157642 Calculate -3971616 divided by 44. -90264 Divide 2314906 by 5. 2314906/5 Calculate 54346 divided by -2415. -54346/2415 Calculate -3630 divided by -785. 726/157 Calculate -135577 divided by 222. -135577/222 Divide -40229 by -359. 40229/359 What is -87385768 divided by 21846442? -4 What is -1501848 divided by 12? -125154 What is -330883 divided by 2? -330883/2 Calculate -195021747 divided by 1013. -192519 Calculate 178251388 divided by -91084. -1957 What is -378178 divided by 113? -378178/113 Divide 71212064 by -44. -1618456 Calculate 4 divided by -222087. -4/222087 -34 divided by 4058626 -17/2029313 What is 43189368 divided by -9043? -4776 Divide -714 by 2657. -714/2657 Calculate -11712720 divided by 2342544. -5 6859997 divided by -3 -6859997/3 What is 5893052 divided by 14? 2946526/7 Divide -4 by -419917. 4/419917 -1092555 divided by 24279 -45 Calculate -6260075 divided by 1252015. -5 Calculate 0 divided by -67273539. 0 What is 2348 divided by -54830? -1174/27415 Calculate -2887684562 divided by -2. 1443842281 349660 divided by -120 -17483/6 Divide 16376 by -780. -4094/195 Divide -259591283 by -6. 259591283/6 -125233578 divided by -3578 35001 Calculate -33 divided by -1212347. 33/1212347 What is -538709091 divided by -1? 538709091 Calculate 3952841 divided by 22. 3952841/22 Calculate -184 divided by -9665. 184/9665 What is 17889165 divided by 19215? 931 Divide 5 by 32047972. 5/32047972 Calculate 26323 divided by 940. 26323/940 3137 divided by -511 -3137/511 -10 divided by -2261723 10/2261723 115 divided by 420 23/84 Calculate -123690 divided by -55. 24738/11 8718630 divided by -5 -1743726 What is -348901 divided by -3? 348901/3 Divide -3487598 by -1743799. 2 What is -318454 divided by 318454? -1 What is 1968101 divided by -14159? -139 Calculate -12997 divided by -4426. 12997/4426 Divide -11633 by -244. 11633/244 What is 35479080 divided by 8869	{ "pile_set_name": "DM Mathematics" }
d by h. 22 Let w(y) = -198y + 211. Calculate the remainder when 48 is divided by w(1). 9 Suppose 264 = 5n - 6. Suppose 38 + n = 4t. Let z = 4 + t. Calculate the remainder when 101 is divided by z. 20 Let j(y) = 276y - 1253. Calculate the remainder when j(6) is divided by 98. 11 Let g(k) = -k3 + k2 + 3k + 8. Let i be g(-3). Suppose 0 = 41w - iw - 54. What is the remainder when 24 is divided by w? 6 Let p(s) = -s - 33 + 12 - 68 - 2s. Calculate the remainder when 4 is divided by p(-30). 0 What is the remainder when 315 is divided by (-3)/18-4 + (-65960)/(-582)? 87 Suppose 542a + 3398 - 19757 = -565a + 7995. Suppose 3y + 4n - 107 = 0, y - 27 = 4n + 30. Calculate the remainder when y is divided by a. 19 Let x = -4509 + 5221. What is the remainder when x is divided by 233? 13 Calculate the remainder when 148 is divided by -142 - -143 - ((-420)/2)/2. 42 Suppose 3z - 384 = 106c - 104c, 3z - 405 = -5c. Calculate the remainder when 209 is divided by z. 79 Suppose 15 = 5p, -45 = -2m - 4p - 23. Suppose -3a + 94 = -d, -130 = -22a + 17a - md. Calculate the remainder when (-1386)/(-24) - (-2)/8 is divided by a. 28 Let u(s) = -s*2 + 46s. What is the remainder when u(3) is divided by 32? 1 Suppose -2m = 2u - 14, -5u + 4u + 11 = 3m. Suppose -t = -p + 5p + 2, 28 = 4t - mp. What is the remainder when 95 is divided by t? 5 Let m(x) = 2x3 - 12x*2 + 34x - 30. Calculate the remainder when 244 is divided by m(4). 34 Let c be 2 - 15/3 - -5. Suppose 0 = -2x + 5z + 180, cx - 6z + 3z - 172 = 0. Calculate the remainder when x is divided by (63/(-2))/34/(-3). 10 Let w(h) = -2h2 - 7h + 7. Let f be w(-4). Suppose fv - 292 = -166. What is the remainder when 881 is divided by v? 41 Let g(p) = -p3 - 2p*2 + 3p + 6. Let r be g(-4). Suppose 210 = 10c + 23 - 33. What is the remainder when c is divided by 24/6r/8? 9 Suppose 12x - 87 = 501. Calculate the remainder when 685 is divided by x. 48 Suppose 4x + 64 = 5k + 5x, 3k - 40 = x. Let j = -9 + k. Suppose -2p + 2c = -20, jp = -2c + 3c + 55. Calculate the remainder when 71 is divided by p. 11 Let h be -1 - (0/1 - 3). Let t(l) = -5lh - 2l + 20l2 + 3 - 13l*2. Calculate the remainder when 118 is divided by t(2). 6 Suppose y + 3c = 0, -4c - 76 = -y - 4y. Let o = 32 - -5. What is the remainder when 290/(-8)(8 - y) is divided by o? 34 Suppose -5z - 857 = -4582. Suppose -750c + zc = -100. What is the remainder when 93 is divided by c? 13 Suppose -3f = 7b - 8b + 6, 0 = -f. Let m be (104 - b)(2 - 3). Let x = -87 - m. What is the remainder when 73 is divided by x? 7 Let w(d) = 6d2 + 4d + 28. Let u be (6/9)/(1/(36/(-8))). What is the remainder when 488 is divided by w(u)? 68 Let d = 30466 + -27143. What is the remainder when d is divided by 175? 173 Suppose 27a - 23a = -292. Let p = 139 + a. What is the remainder when p is divided by 34? 32 Let a = -1364 - -1362. Let f(q) = -q + 4. What is the remainder when (240/120)/(a/(-118)) is divided by f(-6)? 8 Let p(n) = -n*2 - 130n - 3648. What is the remainder when p(-53) is divided by 16? 1 Let q be (-4)/(-26) - 2200/(-65). Let u = q - 34. Suppose 5m - x = 419, -2m + 3x + 178 = -um. What is the remainder when m is divided by 28? 27 Let t = -3105 + 3186. Calculate the remainder when t is divided by 22. 15 Calculate the remainder when 3327 is divided by (-18)/3((-1232)/(-42))/(-11). 15 Let l(a) = -a2 + 17a + 43. Suppose -105 = -4q - 37. What is the remainder when 256 is divided by l(q)? 41 Let g = 14 + -3. Suppose -j = -11j - 760. Let q = j + 80. What is the remainder when g is divided by q? 3 Suppose 3i - 21 = -12. Suppose -5c - 684 = 5x - 1939, -ix - 2c = -749. What is the remainder when x is divided by 67? 46 Suppose 13 + 101 = 6l. Suppose 6t = n + 8t - 19, -n - 4t = -l. What is the remainder when 127 is divided by n? 13 Suppose 3f + 9 = o - 20, -2o - 4f + 48 = 0. Calculate the remainder when (-21 - -12)/(3/(-15)) is divided by o. 19 Let l = 10 + -7. Let v(k) = 3k2 + 4k - 3. What is the remainder when -7 + (-5152)/(-69) + 8/6 is divided by v(l)? 33 Let j(l) = -7 + 12 - 6l2 + 6l - 2 + l*3. What is the remainder when 254 is divided by j(5)? 6 Suppose -3m = -3o - 6, 5m + 0m = 3o + 14. Suppose of = 64 - 16. Calculate the remainder when 79 is divided by f. 7 Suppose -4w + 3z + 95 = 0, -26 = -w + 5z + 2. Suppose w = -m - 19. Let p = m - -73. Calculate the remainder when 58 is divided by p. 27 Let u(x) = 162x + 1258. Let k = 5 + 1. Suppose 2n + k = 0, -5n - 78 = 2h - 5h. Calculate the remainder when u(-7) is divided by h. 19 Let b(q) = -16q - 122. Let u be b(-8). What is the remainder when ((-6)/u)/(3/(-798)) is divided by 54? 50 Let f be -2(-1)/(-5) + 2025/375. Suppose 3l = 0, -8a + 11a + fl - 282 = 0. Suppose 6m - 16 = 80. Calculate the remainder when a is divided by m. 14 Let d(t) = -1429t - 10894. What is the remainder when d(-9) is divided by 179? 177 Let h(w) = -161w - 2793. What is the remainder when h(-33) is divided by 1259? 2 Let a = -76 - -346. Let c(f) = -156f2 + 1149f - 360. What is the remainder when a is divided by c(7)? 36 Let g(q) = -193q3 - 21q*2 - 26q - 3. What is the remainder when g(-1) is divided by 24? 3 Suppose 35w = 13w - 110. Let f(r) = r*3 + 11r*2 + 22r + 3. Calculate the remainder when f(w) is divided by 26. 17 Suppose 10 + 11 = w - 2v, -5w + 4v + 75 = 0. Let j = -3 + w. Let x(b) = -b3 + 10b*2 - 5b - 13. Calculate the remainder when x(j) is divided by 13. 10 Let q(a) = -a*3 - 16a*2 + 9a + 2. Suppose 370 - 438 = 4m. Suppose 0 = -2s + 22 + 6. What is the remainder when q(m) is divided by s? 12 Let i(t) = -t*2 - 5t + 1. Let k be i(-6). Calculate the remainder when ((-1)/(k/(-22)))/((-4)/610) is divided by 14. 13 Let n(q) = -q + 22. Let l be n(18). Suppose -3u = -6u - 4s + 825, 267 = u + ls. Let b = -65 + 105. Calculate the remainder when u is divided by b. 39 Suppose 299 = -13a + 13. Let d(c) = -c3 - 21c*2 + 16c - 74. What is the remainder when 150 is divided by d(a)? 34 Let t = 410 - -228. Calculate the remainder when t is divided by (21/(-6) - -3)/(4/(-512)). 62 What is the remainder when 418 is divided by -60((-128)/48 - (-44)/30)? 58 Suppose -1334z + 1346z = 1860. What is the remainder when z is divided by 13? 12 Suppose -5r = 4h - 917, -108r + 5h + 347 = -106r. Calculate the remainder when 499 is divided by r. 137 Suppose 11r - 2063 = 2535. What is the remainder when r is divided by 105? 103 Suppose 0 = -4j, -120 - 47 = -y - 3j. What is the remainder when y is divided by 10? 7 Let q = 4412 - 4357. Suppose 0 = j - 3j + 72. What is the remainder when q is divided by j? 19 Let b(m) = -8m - 34. Let t be b(-12). Suppose -2w + w = -t. What is the remainder when w is divided by 16? 14 Let f(a) = -2a3 + 3a*2 + 5a - 5. Let h be f(2). What is the remainder when h/(8 + (-4878)/610) is divided by 153/(-6)12/(-9)? 33 Suppose 4a + 3a = 28. Suppose -al = -8, -x + 20 = x + 5l. Suppose 314 = xf + 4v, 348 = 4f - 2v + 102. Calculate the remainder when f is divided by 9. 8 Let c = 67 - 40. Calculate the remainder when 406 is divided by c. 1 Suppose -5y - 2n + 18 = 0, 0 = 5y - 3n + 8 - 6. Suppose -3 + 1 = -yb. Suppose -5h + 11 = b. Calculate the remainder when 7 is divided by h. 1 Suppose -2z - 59 = -12h + 11h, 119 = 2h - 5z. Calculate the remainder when 74 is divided by h. 17 Suppose -7g = -9g + 2s + 18, -g = -3s - 19. Calculate the remainder when 166 is divided by g. 2 Let i be ((0 - 1) + 1)/(37 - 36). Suppose ih - h = -13. Calculate the remainder when 295 is divided by h. 9 Suppose -i = d - 1247, -2i = -5d - 2387 - 142. What is the remainder when i is divided by 179? 178 Suppose 10 = -3u + 2u. Let s = -390 + 441. What is the remainder when s is divided by u/(-45) + 194/18? 7 Suppose -2r + 5u + 37 = -55, -5r - 3u = -261. What is the remainder when r is divided by 48? 3 Calculate the remainder when 2-8(-3)/(-6) - -194 is divided by ((17 - 6) + -6)(1 - -6). 11 Calculate the remainder when 334 is divided by (-585)/130*40/(-15). 10 Let i = -5698 - -6511. What is the remainder when i is divided by 48? 45 Calculate the remainder when 2246 is divided	{ "pile_set_name": "DM Mathematics" }
r(x). (x - 2)(23x - 2)/4 Find q, given that 98q - 132 + 1/4q*4 - 81/4q*2 + 0q*3 = 0. -11, 3, 4 Let n be -772/84 - 40/(-6). Let d(k) be the first derivative of 0k + 2k*2 + nk*3 - 3/2k*4 - 7. Factor d(t). -2t(t - 1)(3t + 2) Let b = 6461233/4 - 1615307. Suppose bs*2 + 125/2s - 255/4 = 0. Calculate s. -51, 1 Suppose -411q + 410q - 6 = 0. Let c be q - (-399)/49 - 1. Factor 0j - 6/7j*2 + 0 - cj*3 - 2/7j*4. -2j*2(j + 1)(j + 3)/7 Let i(w) be the first derivative of -31 - 35/24w*4 + 27w - 35/12w3 - 1/4w*5 - 5/2w*2. Let y(x) be the first derivative of i(x). Factor y(r). -5(r + 1)(r + 2)(2r + 1)/2 Let w = -163 + 166. What is o in 27o*4 + 90o*3 + wo*5 - 68 + 31o + 68o + 138o*2 + 95 = 0? -3, -1 Let q = 577/1151 - 3/2302. Let l(v) be the second derivative of 0v*2 + 0 - 6v - 1/2v3 - 3/20v*5 - qv*4. Suppose l(f) = 0. What is f? -1, 0 Let w = 99043/22 - 98963/22. Factor -18/11o*2 - 2/11o*3 - 48/11o - w. -2(o + 2)2(o + 5)/11 Let z = -26 - -29. Suppose -zt = 2m - 15, -4m - 3t + 5t + 6 = 0. Factor -22 - 7w*3 - 2w*2 + mw*3 + 10w + 18. -2(w - 1)(w + 2)(2w - 1) Suppose -2g - 72 = 2g. Let r(i) = i*2 + 17i - 14. Let b be r(g). Let j*5 + 3j*b + 3j*4 + 2j*3 - 2j*5 - 7j*4 = 0. Calculate j. -2, 0, 1 Let c(q) be the first derivative of 28q*5/5 + 26q*4 + 116q*3/3 + 20q*2 - 1918. Factor c(v). 4v(v + 1)(v + 2)(7v + 5) Let t(p) be the second derivative of 3p5/10 + 13p*4/2 + 40p*3/3 + 6p*2 - 32p. Let x(j) = j3 - j2 + 3. Let u(f) = -t(f) + 4x(f). Factor u(l). -2l(l + 1)(l + 40) Solve 133n - 25/3n*4 - 30 - 589/3n*2 + 305/3n*3 = 0 for n. 3/5, 1, 10 Let s be 10-1(-5)/10. Let m = -176609 + 529828/3. Factor 0r + 2/3r3 + 0r2 - r4 + 0 + mrs. r3(r - 2)(r - 1)/3 Let v be 88 + -92 - -501. Suppose 5g + 13 = w, -5g + v = -2w + 62. Factor 4/9k*2 + 0k + 0 - 2/9k4 + 2/9k*w. -2k*2(k - 2)(k + 1)/9 Suppose 195m + 18 = -3n + 193m, 0 = -3n - 5m - 54. Determine l, given that -1/2ln - 338 + 26l = 0. 26 Let z(c) be the third derivative of c*6/240 - 61c*5/60 - 21c*4/2 - 2c*2 - 53c - 47. Factor z(o). o(o - 126)(o + 4)/2 Let c = -33668 - -33671. Let z(q) be the second derivative of -3/4q5 + 29q + 0q2 - 1/10q*6 + 0 - 2q*c - 2q*4. Factor z(l). -3l(l + 1)(l + 2)2 Let i(t) be the third derivative of t5/75 - 22t4/3 - 442t*3/15 + 31t2 + 5. Let i(g) = 0. Calculate g. -1, 221 Let s(d) be the third derivative of -d7/252 - 5d6/72 - 29d*5/72 - 25d4/36 + d2 + 1665. Factor s(l). -5l(l + 1)(l + 4)(l + 5)/6 Let r be ((-483)/(-2))/(69/92). Let k = 324 - r. Determine c so that 346/5ck - 112c*3 - 88/5c + 8/5 + 294/5c4 = 0. 2/7, 1/3, 1 Factor n5 - 55n + 12n2 + 455 - 217 - 15n*3 - 35n*3 + 10n*4 + 68n2 - 224. (n - 1)4(n + 14) Let f(k) be the third derivative of k6/660 - 25k*5/66 - 32k*4/11 - 3667k*2. Suppose f(r) = 0. What is r? -3, 0, 128 Let k = 325 - 305. Factor 3o*3 - 15o*2 + 3o*4 + 6o + 4o3 + ko*5 - 13o*5 - 10o*5 + 2o*3. -3o(o - 1)3(o + 2) Suppose -2p - i + 1384 = -4i, 0 = -5i - 10. Find m, given that -15m*4 + 704m*2 - pm*2 - 2m + 25m3 + 2m - 25m5 = 0. -1, -3/5, 0, 1 Suppose 0n + 0 + 120n2 - 2/5n3 = 0. What is n? 0, 300 Let f(x) be the second derivative of x5/80 - 257x4/48 + 5461x*3/8 + 16641x*2/8 + 1694x. Suppose f(o) = 0. Calculate o. -1, 129 Solve -46/3d3 - 22/3d*4 - 2/3d*5 + 22/3d*2 + 0 + 16d = 0 for d. -8, -3, -1, 0, 1 Let t = -264 - -266. Factor -50i + 995 - 4i*2 - 1043 + 3i2 - it. -2(i + 1)(i + 24) Suppose -17m + 541 = 592. Let s be 0 + 78/(-168) - m/4. Solve -sj*3 - 96/7j - 30/7j2 + 128/7 = 0 for j. -8, 1 Determine r, given that -224 + 147r*2 - 191r - 221r - 20r*3 + 154r*2 - 664r*2 + 155r*2 = 0. -8, -7/5, -1 Let z = 149131/3 + -49710. Let zm*3 - 23/3m*2 - 121/3 + 143/3m = 0. Calculate m. 1, 11 Let o(y) = 65y2 - 20915y + 110. Let j(m) = 7m2 - 2324m + 12. Let i(a) = -55j(a) + 6o(a). Factor i(z). 5z(z + 466) Let g = 1676/27 + -44389/378. Let i = -384/7 - g. Factor i + 3/2m2 - 3/2m - 1/2m3. -(m - 1)3/2 Let k(j) = 151j - 602. Let g be k(4). Let u be 30/8 - 1/(-4). Solve 27r4 - gr*3 + 2r*3 - 5r*2 - 22ru = 0. -1, 0, 1 Let c(z) be the second derivative of -z6/72 + 7z5/24 + 25z*4/4 + 131z*3/6 - 100z. Let x(n) be the second derivative of c(n). Factor x(t). -5(t - 10)(t + 3) Suppose 0 = 2o + 14c - 11c - 74, -5o = 3c - 176. Factor 28 + 32 + 10 - 4w*2 - o. -4(w - 3)(w + 3) Let o be ((-6)/8)/((-23 + -7)/300). Let c(k) be the second derivative of -3/20k*5 + 9/2k*3 + ok*2 + 3/4k*4 - 29k + 0. Let c(s) = 0. Calculate s. -1, 5 Let l(r) be the second derivative of r*5/15 - 18r*4 - 896r*3/3 - 5440r*2/3 + 548r - 4. Factor l(g). 4(g - 170)(g + 4)*2/3 Factor 1/7t*2 + 11/7 - 12/7t. (t - 11)(t - 1)/7 Let q(u) be the third derivative of 2 + 0u + 7/2u3 + 5/16u*4 - 16u*2 - 1/40u*5. Suppose q(g) = 0. What is g? -2, 7 Let k be 2 - -2034/1020. Factor 2/3m2 - 2m - k. 2(m - 4)(m + 1)/3 Let 30r3 + 2r*3 - 4r*4 + 7r*4 + 99r*2 - 345r + 198 + 22r3 - 9r*3 = 0. Calculate r. -11, -6, 1 Suppose 3d + 5n - 17 = 0, -d + 6d - 17 = 3n. Let m(j) be the first derivative of 0j + 1/16jd + 1/12j*3 - 10 + 0j2. Factor m(f). f2(f + 1)/4 Let k(l) = -l. Let p be k(-4). Suppose 0 = j - 4r - 8, -3j + 10r - p = 12r. Factor -4/5n*3 + jn*2 + 2/5 + 4/5n - 2/5n4. -2(n - 1)(n + 1)3/5 Suppose -2h - 2h + 4r = 0, 3h - 7 = -4r. Let w be (h - 165/(-42)) + 21/(-49). Factor 3/4o2 - wo*3 + 27/4o*4 + 0o + 0. 3o2(3o - 1)2/4 Let a be (78/(-24) - -4)/((-21)/(-28)). Let l be (a(-2)/10)/((-1323)/1890). Solve -8/7 + lq3 - 2/7q + 8/7q2 = 0. -4, -1, 1 Let f = -81579 + 81579. Factor -3/2z*5 + 0z*2 - 3/2z*4 + 3z*3 + fz + 0. -3z3(z - 1)(z + 2)/2 Suppose -1 = -2v + 3. Suppose -3q = 7j - 45, 3j - 3020q - 25 = -3022q. Find z such that 12/5z*v + 3z*j + 0 - 3/5z = 0. -1, 0, 1/5 Let -2244q2 + 4480q*2 - 2101q*2 - 356 + 26q*3 - 394 + 13q*3 - 75q + 3q4 = 0. What is q? -5, 2 Suppose r + 2z + 529 - 4203 = 0, 5z = -5r + 18395. Factor -n*2 + rn + n*2 + 4n2 + n2 - 3829n. 5n(n - 29) Solve -120k*3 - 2157k - 216k2 + 4078k - 21k4 - 2017k + 48 = 0 for k. -2, 2/7 Let o be (-489)/(-21) - 2/7. Suppose o - 3 = 4i. Determine x, given that 4x2 + x3 - x*i - 2x*3 - 5x*3 + 3x5 = 0. -2, 0, 1 Let s(v) be the second derivative of v6/15 + 17v5/10 + 15v*4 + 36v*3 - 216v*2 - 1034v. Factor s(y). 2(y - 1)(y + 6)*3 Let f(o) be the first derivative of 1/2o*6 - 81 + 0o - 42/5o5 + 96o*2 + 112o*3 + 99/4o*4. Factor f(r). 3r(r - 8)2(r + 1)2 Let m(u) be the third derivative of u7/1470 + 101u6/168 - 169u*5/140 - 505u*4/168 + 253u*3/21 + 6465u2. Factor m(q). (q - 1)2(q + 1)(q + 506)/7 Let a(i) be the first derivative of i*6/120 - 37i*5/180 + 2i*4/9 + 110i*3/3 - 34. Let d(l) be the third derivative of a(l). Solve d(n) = 0. 2/9, 8 Let x(a) = -2a*3 - 203a*2 + 2372a - 6223. Let n(s) = 7s3 + 608s*2 - 7117s + 18678. Let v(q) = -3n(q) - 8x(q). Suppose v(w) = 0. What is w? -50, 5 Let a(c) be the first derivative of c5/20 + c4/4 + 5c3/12 + c2/4 - 482. Determine o so that a(o) = 0. -2, -1, 0 Let s be -2 + 3 + (37 - -3). Factor 18q + 3q - 87q*2 + 43q*2 + 24 + sq*2. -3(q - 8)(q + 1) Let u be (-57(-288)/(-172368))/((1/(-1))/154). Factor 16/3 - 4/3y3 + 12y*2 - uy - 4/3y4. -4(y - 1)*3(y + 4)/3 Factor 889350 + 3/2o2 - 2310o. 3(o - 770)2/2 Let o(w) = -3w*2 + 6894w - 3953718. Let t(m) = 3m2 - 6895m + 3953719. Let v(c) = 7o(c) + 6t(c). Factor v(z). -3(z - 1148)2 Let w = 219 - 230. Let c(s) = 4s*2 - 14s - 40. Let z(t) = 21t2 - 69t - 200. Let o(n) = wc(n) + 2z(n). What is h in o(h) = 0? -2, 10 Let w(s) be the first derivative of -s*4/12 - 392s*3/3 - 783s*2/2 - 1174s/3 + 5135. Factor w(u). -(u + 1)*2(u + 1174)/3 Let w = 923990617/8 + -5129071458241/44408. Let c = w + 3/3172. Suppose -c*m + 8/7 + 162	{ "pile_set_name": "DM Mathematics" }
-1250000 What is 0.20223 rounded to 3 dps? 0.202 Round -13600000 to the nearest one million. -14000000 Round -260.609 to the nearest 10. -260 Round -0.0000100115 to seven dps. -0.00001 Round 0.0162777 to three decimal places. 0.016 Round -0.000000084 to seven dps. -0.0000001 What is 86.9 rounded to the nearest integer? 87 Round -0.091521 to two dps. -0.09 Round -0.0041094 to five dps. -0.00411 Round 0.02214 to three dps. 0.022 What is 0.0019854 rounded to 5 decimal places? 0.00199 What is 0.699 rounded to 1 dp? 0.7 What is 0.00005982 rounded to six decimal places? 0.00006 Round 0.04567 to 3 dps. 0.046 What is -16.9263 rounded to the nearest 10? -20 Round 506820 to the nearest ten thousand. 510000 What is -465.68 rounded to the nearest ten? -470 What is 0.00006762 rounded to six decimal places? 0.000068 What is -0.006439 rounded to four decimal places? -0.0064 Round 9.45 to the nearest integer. 9 Round -0.0642 to two dps. -0.06 What is -0.001553 rounded to five decimal places? -0.00155 Round 0.0291901 to three decimal places. 0.029 What is 1902 rounded to the nearest one hundred? 1900 What is -339000 rounded to the nearest 10000? -340000 Round 0.0217373 to three dps. 0.022 Round -2213600 to the nearest 10000. -2210000 What is -0.003309 rounded to 3 dps? -0.003 What is 19.6024 rounded to one dp? 19.6 What is 680000 rounded to the nearest one hundred thousand? 700000 What is -8720000 rounded to the nearest one hundred thousand? -8700000 Round -0.02017 to 3 decimal places. -0.02 Round 0.1319 to three dps. 0.132 What is -25825000 rounded to the nearest 1000000? -26000000 Round 49226 to the nearest one thousand. 49000 What is -0.0001753 rounded to six dps? -0.000175 What is -0.0604 rounded to 2 dps? -0.06 What is -36.493 rounded to the nearest 10? -40 What is 0.00073 rounded to three decimal places? 0.001 What is -8.6 rounded to the nearest 10? -10 Round -0.69766 to one decimal place. -0.7 Round 217036 to the nearest 10000. 220000 What is -0.000211 rounded to four dps? -0.0002 What is 208990 rounded to the nearest ten thousand? 210000 What is -166090 rounded to the nearest 10000? -170000 What is 0.000007999 rounded to six dps? 0.000008 What is 0.0719 rounded to 2 dps? 0.07 What is -0.00009777 rounded to six decimal places? -0.000098 Round -214.17 to the nearest 10. -210 What is 75933 rounded to the nearest 1000? 76000 What is -1600 rounded to the nearest one hundred? -1600 What is -88590 rounded to the nearest one hundred thousand? -100000 Round -121400000 to the nearest 1000000. -121000000 Round -0.0006877 to five dps. -0.00069 What is -5.847 rounded to 1 decimal place? -5.8 Round -0.00000110412 to seven decimal places. -0.0000011 Round -0.0079968 to five decimal places. -0.008 What is -6728 rounded to the nearest 100? -6700 Round 15190 to the nearest 10000. 20000 Round 4484.6 to the nearest 100. 4500 Round -0.00029875 to six decimal places. -0.000299 What is 98220 rounded to the nearest ten thousand? 100000 Round 123.02 to the nearest ten. 120 What is -0.001754 rounded to four dps? -0.0018 What is 0.001088 rounded to five dps? 0.00109 Round 0.00000831 to five decimal places. 0.00001 What is 0.57944 rounded to three decimal places? 0.579 Round 0.00003419 to seven dps. 0.0000342 Round -90.66 to the nearest one hundred. -100 Round -0.027085 to 3 decimal places. -0.027 Round 132.566 to 0 decimal places. 133 Round 0.0478 to two decimal places. 0.05 Round -3608000 to the nearest one hundred thousand. -3600000 Round -0.14395 to three decimal places. -0.144 Round -0.0000012785 to 7 decimal places. -0.0000013 What is -23370 rounded to the nearest ten thousand? -20000 What is -27670 rounded to the nearest 10000? -30000 Round -1137.08 to the nearest 10. -1140 What is -0.0000811 rounded to five dps? -0.00008 What is -48.59 rounded to the nearest integer? -49 Round -3.955 to the nearest integer. -4 What is 87810 rounded to the nearest 1000? 88000 What is 23.02 rounded to the nearest 10? 20 What is -0.38651 rounded to two decimal places? -0.39 What is -0.0000002651 rounded to seven decimal places? -0.0000003 What is -0.002629 rounded to three decimal places? -0.003 What is -0.28095 rounded to three dps? -0.281 What is 1.031 rounded to 1 dp? 1 Round 1820000 to the nearest 10000. 1820000 What is -0.207 rounded to one decimal place? -0.2 What is -1237500 rounded to the nearest ten thousand? -1240000 Round -0.04285 to three dps. -0.043 What is -3.8816 rounded to 1 dp? -3.9 Round -103.422 to zero decimal places. -103 What is -237.256 rounded to zero decimal places? -237 What is 0.0044475 rounded to four dps? 0.0044 What is 3680 rounded to the nearest 1000? 4000 Round 0.0026247 to 5 decimal places. 0.00262 Round -10.986 to the nearest integer. -11 Round -0.11934 to 2 dps. -0.12 What is 12741 rounded to the nearest 10000? 10000 Round 0.0000059351 to seven dps. 0.0000059 Round 0.00948 to three decimal places. 0.009 Round -58.2 to the nearest 10. -60 Round 0.0006504 to 4 dps. 0.0007 Round -0.055567 to 4 dps. -0.0556 Round -778610 to the nearest 100000. -800000 Round 0.0000176 to six decimal places. 0.000018 What is -5480 rounded to the nearest one thousand? -5000 What is -0.0014091 rounded to 5 decimal places? -0.00141 Round -4860 to the nearest 1000. -5000 Round -21010 to the nearest one thousand. -21000 What is 0.05713 rounded to three decimal places? 0.057 Round -5420 to the nearest one thousand. -5000 Round -0.00007524 to six decimal places. -0.000075 Round -1766200 to the nearest one hundred thousand. -1800000 Round -38.41 to the nearest ten. -40 What is 0.00015194 rounded to 6 dps? 0.000152 What is 250863000 rounded to the nearest one million? 251000000 What is 169.71 rounded to the nearest ten? 170 What is -0.09599 rounded to 3 dps? -0.096 Round -0.000032573 to six decimal places. -0.000033 Round -578.62 to the nearest one hundred. -600 Round 0.00001608 to 6 dps. 0.000016 Round 522200 to the nearest one hundred thousand. 500000 Round -3.797 to 1 dp. -3.8 Round 0.11835 to three decimal places. 0.118 Round -317700 to the nearest ten thousand. -320000 What is 0.00000008764 rounded to seven dps? 0.0000001 What is 84340 rounded to the nearest 10000? 80000 What is -631422 rounded to the nearest one hundred thousand? -600000 Round 0.0002318 to 5 dps. 0.00023 Round -6.896 to 1 dp. -6.9 What is 11.9598 rounded to the nearest integer? 12 What is -0.00087838 rounded to 5 dps? -0.00088 What is 0.5286 rounded to 2 dps? 0.53 What is 184.3 rounded to zero decimal places? 184 What is 0.03253 rounded to 2 decimal places? 0.03 What is 2.51889 rounded to one decimal place? 2.5 Round 97.75 to the nearest ten. 100 What is 7.58 rounded to one decimal place? 7.6 What is 0.05805 rounded to three decimal places? 0.058 Round 81503 to the nearest one thousand. 82000 Round -13.424 to zero dps. -13 What is -58.31 rounded to the nearest 10? -60 What is -1884 rounded to the nearest 100? -1900 Round 17600000 to the nearest 1000000. 18000000 What is -0.00000047854 rounded to 7 dps? -0.0000005 Round 0.0000005284 to seven dps. 0.0000005 Round 12.052 to zero dps. 12 What is 112400000 rounded to the nearest one million? 112000000 Round 20.7364 to zero dps. 21 What is 59270000 rounded to the nearest 100000? 59300000 What is -0.00173922 rounded to 6 decimal places? -0.001739 What is -0.0002956 rounded to five decimal places? -0.0003 What is -7118.5 rounded to the nearest 1000? -7000 What is -0.00229 rounded to 3 decimal places? -0.002 What is 77.7 rounded to the nearest integer? 78 Round -2.546 to two dps. -2.55 Round -6.06 to the nearest integer. -6 Round -0.432 to one dp. -0.4 Round 0.001736 to 4 dps. 0.0017 Round -0.082544 to three dps. -0.083 Round -0.00001055 to seven dps. -0.0000106 Round -76.5 to the nearest integer. -77 Round 445.17 to 0 decimal places. 445 What is 0.0048581 rounded to 3 decimal places? 0.005 What is -0.000846 rounded to 4 decimal places? -0.0008 What is 3069.5 rounded to the nearest one thousand? 3000 What is -1.57425 rounded to 1 decimal place? -1.6 Round 0.027791 to 3 decimal places. 0.028 What is 0.0001648 rounded to six dps? 0.000165 What is -475.62 rounded to the nearest one hundred? -500 Round 0.0000009082 to seven decimal places. 0.0000009 What is -6.1682 rounded	{ "pile_set_name": "DM Mathematics" }
) to base 16 -835 -2141 (base 5) to base 3 -101222 What is 347 (base 10) in base 15? 182 -456 (base 11) to base 10 -545 Convert 1077 (base 11) to base 8. 2607 Convert 1c0c3 (base 15) to base 9. 148223 20011000 (base 3) to base 15 14dc What is 1464 (base 8) in base 7? 2251 What is 29a (base 14) in base 5? 4103 22213 (base 5) to base 7 4354 What is 994 (base 15) in base 5? 32124 What is 36360 (base 8) in base 3? 210101210 What is 3789 (base 15) in base 2? 10111000110101 What is 40423 (base 7) in base 12? 5821 -125325 (base 6) to base 14 -4309 -235a6 (base 11) to base 9 -51563 Convert 101a9 (base 14) to base 10. 38761 111011001 (base 2) to base 4 13121 What is -19b6 (base 16) in base 8? -14666 Convert -55232 (base 6) to base 9. -11442 What is -6303 (base 7) in base 6? -14120 Convert -2d5 (base 16) to base 12. -505 Convert -3013300 (base 4) to base 12. -7494 What is 100010011111 (base 2) in base 16? 89f What is -10101011111 (base 2) in base 6? -10211 -740 (base 8) to base 7 -1254 1200 (base 3) to base 14 33 12031211 (base 4) to base 5 1303240 Convert 3e9 (base 15) to base 8. 1576 -510325 (base 6) to base 4 -21311231 -163045 (base 7) to base 13 -118c9 What is -2346 (base 16) in base 15? -2a20 What is 1466 (base 8) in base 11? 688 -101 (base 8) to base 10 -65 Convert -264b (base 12) to base 9. -6005 What is -12001222 (base 3) in base 8? -7162 20413 (base 9) to base 5 412313 102100022 (base 3) to base 14 302a What is -7109 (base 12) in base 10? -12249 What is 22001300 (base 4) in base 3? 2002100012 -492b (base 16) to base 10 -18731 -187e (base 15) to base 16 -14ae -5c8 (base 13) to base 7 -2641 What is 244152 (base 6) in base 12? 10658 -1682 (base 9) to base 16 -509 What is 4eba (base 16) in base 7? 112521 Convert -2710 (base 9) to base 5. -31114 -1793 (base 14) to base 15 -13d0 Convert 1a (base 15) to base 13. 1c 3762 (base 8) to base 16 7f2 What is -1112111122 (base 3) in base 11? -20807 What is -10b22 (base 12) in base 10? -22346 Convert -2ac (base 16) to base 15. -309 What is -152556 (base 7) in base 3? -1111212010 Convert 101354 (base 6) to base 3. 102011021 -200212 (base 3) to base 9 -625 Convert -7286 (base 12) to base 6. -133450 What is 156 (base 16) in base 11? 291 -2294 (base 10) to base 7 -6455 464a (base 12) to base 9 11664 Convert -22654 (base 9) to base 12. -88b7 -a06 (base 12) to base 16 -5a6 -31053 (base 9) to base 8 -47754 Convert -230 (base 15) to base 13. -2c1 What is 112651 (base 7) in base 14? 7528 Convert -7a99 (base 11) to base 2. -10100110001011 -188 (base 9) to base 7 -320 Convert -2002 (base 5) to base 2. -11111100 -266 (base 11) to base 7 -626 What is 10001001110010 (base 2) in base 3? 110002121 -12827 (base 9) to base 13 -3c58 What is -1279 (base 14) in base 11? -2489 7804 (base 10) to base 14 2bb6 What is -15869 (base 12) in base 11? -20aa7 Convert -7201 (base 11) to base 10. -9560 Convert -2112102 (base 3) to base 11. -142a 33676 (base 9) to base 5 1204200 Convert 4210 (base 11) to base 6. 41453 What is -1d99 (base 15) in base 8? -14454 What is -4266 (base 10) in base 5? -114031 What is 11010010110 (base 2) in base 6? 11450 What is 658c (base 14) in base 4? 10102200 -111110 (base 2) to base 7 -116 Convert -202201001 (base 3) to base 7. -62002 What is -10300023 (base 4) in base 9? -28630 What is -5242 (base 9) in base 7? -14132 10121220 (base 3) to base 15 bb3 Convert -65011 (base 7) to base 3. -211010101 What is 211200221 (base 3) in base 5? 1012144 -1a5 (base 11) to base 8 -354 Convert 3288 (base 11) to base 3. 12221102 Convert 3b22 (base 16) to base 15. 4743 Convert -3023 (base 4) to base 7. -410 What is dd7 (base 15) in base 7? 12055 What is 10111110 (base 2) in base 6? 514 Convert -17a03 (base 11) to base 2. -110001001010011 What is -14681 (base 9) in base 3? -111202201 What is -101010001011100 (base 2) in base 12? -105b8 8335 (base 11) to base 7 44133 577 (base 12) to base 15 391 30267 (base 8) to base 6 133423 1819 (base 13) to base 5 103241 Convert -23133 (base 5) to base 8. -3204 -ae7 (base 16) to base 4 -223213 What is -2103 (base 5) in base 13? -185 Convert -3231003 (base 4) to base 8. -35503 Convert -15415 (base 6) to base 5. -40111 -1a59 (base 15) to base 2 -1011001001101 -1100100111100001 (base 2) to base 5 -3123211 1183 (base 10) to base 2 10010011111 Convert 2021020 (base 4) to base 11. 6659 Convert -3533 (base 7) to base 3. -1210002 What is 453 (base 8) in base 2? 100101011 -1101011010 (base 2) to base 12 -5b6 What is -11839 (base 15) in base 5? -3241404 -29b6 (base 14) to base 8 -16364 What is 3618 (base 9) in base 8? 5202 Convert -31252 (base 6) to base 12. -2528 Convert 113203 (base 6) to base 11. 73a5 Convert 3433 (base 8) to base 13. a9c -1053 (base 7) to base 11 -317 Convert -266 (base 8) to base 11. -156 What is -21003 (base 4) in base 5? -4304 What is -441 (base 8) in base 10? -289 Convert -a0aa (base 11) to base 3. -200102102 8d (base 16) to base 15 96 What is -1441 (base 12) in base 14? -c01 3a67 (base 16) to base 7 61406 Convert -132120 (base 4) to base 7. -5445 -2144 (base 9) to base 11 -1206 Convert -761 (base 8) to base 2. -111110001 What is -3a8 (base 15) in base 10? -833 Convert -4454 (base 9) to base 12. -1aa1 133302 (base 4) to base 16 7f2 -4950 (base 14) to base 9 -18513 What is 790 (base 13) in base 16? 514 Convert -93b (base 15) to base 12. -1255 What is -3a6 (base 11) in base 15? -21e -285 (base 10) to base 14 -165 -17526 (base 14) to base 5 -3334023 -448 (base 10) to base 14 -240 143301 (base 5) to base 11 4624 Convert -39a (base 12) to base 3. -202101 2178 (base 9) to base 10 1610 -30022 (base 4) to base 5 -11103 What is -1022010 (base 3) in base 14? -4ba -3467 (base 9) to base 11 -1a29 Convert -3851 (base 9) to base 6. -21201 Convert -1303 (base 4) to base 6. -311 What is 134 (base 8) in base 5? 332 What is 1072 (base 9) in base 10? 794 What is 1b196 (base 12) in base 11? 28066 What is 133222 (base 5) in base 3? 21110101 -242325 (base 7) to base 16 -ac26 Convert 3062 (base 8) to base 10. 1586 -50631 (base 7) to base 6 -133013 What is 11100110111000 (base 2) in base 14? 5556 665 (base 8) to base 4 12311 What is -30301322 (base 4) in base 13? -1aa98 Convert 62a9 (base 16) to base 2. 110001010101001 Convert -841e (base 16) to base 10. -33822 13123 (base 5) to base 9 1373 Convert 130013 (base 4) to base 7. 5150 51103 (base 7) to base 9 18007 Convert -110111111101111 (base 2) to base 15. -8755 Convert 330201 (base 4) to base 15. 1233 -85265 (base 10) to base 8 -246421 Convert 69a (base 13) to base 10. 1141 What is -2028 (base 10) in base 6? -13220 Convert 2314 (base 14) to base 15. 1c14 Convert 1120012021 (base 3) to base 4. 13200220 What is 25aa0 (base 11) in base 10? 37257 Convert 20020012 (base 3) to base 9. 6205 What is 2323101 (base 4) in base 12? 6b29 7427 (base 12) to base 16 319f Convert 1bdd (base 14) to base 8. 11747 Convert -224 (base 5) to base 14. -48 What is 1985 (base 13) in base 10? 3827 Convert -200222010 (base 3) to base 10. -13827 What is 7041 (base 10) in base 12? 40a9 1132 (base 6) to base 12 1a8 -111111001001011 (base 2) to base 5 -2013311 Convert 12020000 (base 3) to base 12. 2253 Convert 333 (base 16) to base 11. 685 30040 (base 6) to base 5 111122 Convert 7928 (base 10) to base 5. 223203 What is -175 (base 11) in base 5? -1303 What is -15c (base 15) in base 8? -470 3325 (base 15) to base 11 8160 What is -1000100101011 (base 2) in base 4? -1010223 2730 (base 11) to base 4 313112 Convert 788 (base 14) to base 3. 2001021 9878 (base 11) to base 7 52665 2550 (base 7) to base 9 1283 Convert 1939 (base 10) to base 16. 793 -595d (base 14) to base 11 -10772 What is -22432 (base 5) in base 6? -11253 What is -3429 (base 12) in base 3? -21221120 Convert 1002 (base 6) to base 8. 332 Convert -22173 (base 8) to base 14. -3591 What is 113302 (base 4) in base 3? 2002101 5080 (base 14) to base 13 63b0 Convert -854a (base 15) to base 14. -a3bd 2a08 (base 11) to base 4 330220 Convert 101114 (base 5) to base 16. cd4 What is -35011 (base 6) in base 9? -6737 Convert 2209 (base 13) to base 8. 11205 Convert -112451 (base 6) to base 16. -25cf 69b (base 14) to base 12 915 What is 1001000110 (base 2) in base 11? 48a 1111122 (base 4) to base 14 1dc6 2702 (base 10) to base 8 5216 What	{ "pile_set_name": "DM Mathematics" }
6/27)/((0 + 1)/9). Suppose -fz - 595 = -4x + z, x = z + p. What is the hundreds digit of x? 1 Let h(j) = -4j2 + 42j + 28. Let r(a) = -9a2 + 85a + 58. Let t(u) = 7h(u) - 3r(u). What is the tens digit of t(18)? 0 Let d be (-90)/(-40) - 3/(-4). Suppose -3300 = -3i + dk, -4i + 12k + 4376 = 16k. What is the tens digit of i? 9 Let n(g) = -24g*3 - 10g*2 - 14g - 225. What is the tens digit of n(-9)? 8 Let h = 382 + -382. Suppose 2p - 1040 - 196 = h. What is the tens digit of p? 1 Let b(g) = 3g*2 - 69g + 24. Let h be b(30). Let m = h - 220. What is the tens digit of m? 3 Suppose 0 = 2y - 5x + x - 13420, 3y + x = 20172. What is the thousands digit of y? 6 Suppose -5d = 2p - p - 16, -5p = 5d + 20. Let o = 19 + p. Suppose -2a = -22 + o. What is the units digit of a? 6 Let q(x) = 53x2 - 4x + 27. Let i be q(4). Suppose i = 4u - 2237. What is the tens digit of u? 7 Suppose 3y + l - 79222 = 0, 0 = 8y - 13y + 2l + 132033. What is the ten thousands digit of y? 2 Let f(h) = -h - h2 + 2 - 1 + 2h*2 + 2h. Let l(n) = 3n2 + 1. Let y(x) = 4f(x) - l(x). What is the tens digit of y(-11)? 8 Suppose 18h - 7h - 44 = 0. Suppose hp + 2034 = j - 923, 3697 = -5p + j. What is the units digit of (12/10)/((-2968)/p - 4)? 1 Let p = 31559 + -19934. What is the units digit of p? 5 Let y(z) = 3z2 + 5z + 12. Let c(i) = -i*2 + 18i + 9. Let u be c(18). Suppose -v = 5, 4q + u = -0q + 3v. What is the units digit of y(q)? 0 Let w = 13788 - 288. What is the units digit of w? 0 Let z be (-6)/(-21) + -381/(-14). Let h be (12/14)/((-6 + z)/21). What is the tens digit of (26/h)/(1/(-3))? 1 Suppose 0 = -0d - 4d - 216. Suppose 3s - 237 = 3b, 116 = -5b + 2s - 270. Let j = d - b. What is the units digit of j? 2 Let c = -914 - -553. Let q(p) = -42p - 69. Let h be q(12). Let o = c - h. What is the tens digit of o? 1 Let u(r) = r3 + 12r*2 + 14r + 4. Suppose -5z = q + 68 - 19, 0 = -z + q - 11. What is the units digit of u(z)? 4 Let c = 21 + -19. Suppose -2u - 28 = -ch, 0 = 4u + 3h - h + 80. Let m = 35 - u. What is the units digit of m? 3 Suppose -1188 = 396q - 405q. What is the tens digit of q? 3 Let f(h) = h2 + 3h - 5. Let b be f(-6). Suppose -56o - 59o - 1599 = -128o. Suppose 14n - o = bn. What is the hundreds digit of n? 1 Suppose 3r + 126 = 3z, 0 = 3r - r - 5z + 81. Let o = r + 53. Let f = o - -78. What is the tens digit of f? 8 Let f(g) = g3 + 12. Let u be f(0). Suppose 6n - un + 72 = 0. What is the tens digit of n? 1 Let y(i) = 16i*2 - 40i - 618. What is the tens digit of y(-17)? 8 What is the hundreds digit of ((-770)/5)/((-16)/256)? 4 Let s = 4 + -2. Suppose g + s = 7. Suppose gk - 60 = -z, -z - 5k - 80 = -4z. What is the tens digit of z? 3 Let x(b) = 53b*2 + 7b - 145. What is the hundreds digit of x(8)? 3 Let m(p) = p*3 + 10p*2 - 16p - 7. Let d be m(-11). Suppose 2l + d = 12. What is the units digit of (29 - 2)/(l/(-48))? 2 Let r(z) = -2z*3 - 13z*2 - 12z + 17. What is the units digit of r(-13)? 0 Suppose -3205781 = 8v - 44v - 1293965. What is the ten thousands digit of v? 5 Let f(o) be the third derivative of 73o4/24 + 37o*3/6 - 4o*2. Let r be f(11). Suppose 10u = 2u + r. What is the tens digit of u? 0 Let m = 6483 - -9024. What is the thousands digit of m? 5 Let h = -33363 - -52578. What is the ten thousands digit of h? 1 Suppose 2w + z - 7561 = 0, -2w - 4z + 1404 + 6178 = 0. What is the thousands digit of w? 3 Let o = 134785 - 73716. What is the units digit of o? 9 Let g = -14 - -12. Let y be 6/g - (1 + -5). What is the tens digit of 3 - (2 + y) - -29? 2 Suppose -4r + 3z - 254 = r, -5z + 15 = 0. Let f = 120 + r. What is the tens digit of f? 7 What is the tens digit of -8 + -1 - (-2790109)/147 - 2/(-3)? 7 Suppose -8 = -2j + 8. Let f(g) = -g*2 + 8g - 16. Let s be f(j). What is the units digit of (51 + s)18/7? 0 What is the units digit of (-44670428)/(-838)6/4? 9 Suppose 2s + 0s - 77 = 5c, 4c = s - 61. Let f be (-18)/(-3) + c/5. Suppose 0t = -3i + ft + 450, -5t + 426 = 3i. What is the units digit of i? 7 Suppose 2l - 4692 = -3s - l, 4l - 7821 = -5s. Suppose 13n - s - 4389 = 0. What is the tens digit of n? 5 Suppose 16 = -2p + 12, -2q + 5p + 16 = 0. Suppose ql = 4h + 5l - 222, -5l + 99 = 2h. What is the units digit of h? 7 Let x be (-11)/(-4) - 5/(-20). Suppose xp - 1569 = 2s, 4s + 4066 = 5p + 1449. Suppose p = 11o - 788. What is the hundreds digit of o? 1 Let i = 47326 - 32773. What is the tens digit of i? 5 What is the ten thousands digit of (-5)/2 - (-362299581)/5278 - (-2)/13? 6 Let o = -7520 - -11865. What is the hundreds digit of o? 3 Let z = 75 - 87. Let k be ((-28990)/z)/13 + (-1)/(-6). Let x = k + -99. What is the tens digit of x? 8 Suppose -7r + 3r + 16 = 0. Suppose 0 = 3a - a + rm - 940, m = 4. Suppose 6l - a = -24. What is the units digit of l? 3 Suppose -6v = 4 - 4. Suppose v = 2r + 3 - 13. Suppose -2c - d = -13, 4d - 7 - r = -3c. What is the units digit of c? 8 Suppose -4h = x - 82 + 88, 0 = 5x + 3h - 21. Suppose xg = 3g + 3465. What is the hundreds digit of g? 1 What is the tens digit of 6/(3 - 6) + -9-3215? 0 Suppose 44 - 119 = -5w. Let i = 2 - w. Let d = 17 + i. What is the units digit of d? 4 Let t(g) = 1064g*2 + 328g + 11. What is the units digit of t(-9)? 3 Suppose -83w - 150w - 326w = -20178223. What is the units digit of w? 7 Let s(l) = -5l + 18. Let w be s(3). Suppose 0 = wx - 795 - 1113. What is the hundreds digit of x? 6 Suppose 26l + 14558 = 202850. What is the units digit of l? 2 Let z be (1-4)/(0 - (-20)/(-55)). Suppose m - z = 125. What is the tens digit of m? 3 What is the hundreds digit of 14/(-84)(6 + -22734) + (-1 - 5)? 7 Let s(j) = j*3 + 18j*2 + 19j + 11. Let p be s(-18). Let o = p + 607. What is the tens digit of o? 7 Let m = -965 - -1553. Suppose 6c = 13c + m. What is the units digit of (-15)/15(c - -1)? 3 Suppose -5z + 25860 = 5j, -24z - j = -22z - 10339. What is the tens digit of z? 6 Let w(s) = -12s*2 - 3. Let k = -36 + 39. Let l be w(k). Let q = 165 + l. What is the tens digit of q? 5 Let g(z) = 4z*2 - 62z - 110. Let v(p) = -p*2 + 12p + 22. Let a(i) = -2g(i) - 11v(i). What is the units digit of a(-4)? 8 Let z be -85 + (5 - 1)/(-4). Let f = z - -92. Suppose -fh + 7h = 19. What is the tens digit of h? 1 Suppose 17m + 493611 = -10m + 1449006. What is the hundreds digit of m? 3 Let i(k) = -21k2 - 1. Let n = 3 - 1. Let c be i(n). Let t = -39 - c. What is the tens digit of t? 4 Let r = 17206 + -11822. Suppose -12d + 1504 = -r. What is the hundreds digit of d? 5 Let v = -1845 + 5789. Suppose 24m + v = 32m. Suppose m = 16i - 979. What is the units digit of i? 2 Let i be 5/(-15)(-12)/(1 - -1). Suppose -iy = 4s - 584, 296 = 2y - y + s. What is the tens digit of y? 0 Let p(m) = -5m*3 + 7m + 1. Let v = -6 + 11. Suppose -4o + 7o = -15, vs = o - 10. What is the tens digit of p(s)? 1 What is the tens digit of (66/(-8))/33(-5)/((-5)/(-71228))? 0 Let c(a) = 10a + 6. Let w be c(-3). Let m = w + 27. Suppose -5o + 10 = 0, -mr + 7o - 2o = -548. What is the hundreds digit of r? 1 Let a(c) = -c3 - 4c*2 - 5c - 3. Let p be a(-3). Suppose pl - l = -s + 633, -4l - 5s = -1269. What is the hundreds digit of l? 3 Let i = -5770 - -5769. Let l be 300 - 2/(4 + -2). Let o = l + i. What is the tens digit of o? 9 Let q = -9 - 10. Let i = 25 + q. What is the units digit of ((-2)/i)/(13/(-117))? 3 Suppose -7j - 32 + 81 = 0. Suppose 0 = -jw - 0w + 2331. What is the units digit of w? 3 Suppose -151f + 9447187 = 546794. What is the tens digit of f? 4 Let z(r) = 357r*3 + 3r*2 - 4r - 6. What is the thousands digit of z(3)? 9 Suppose 5u = -2886m + 2881m + 96005, 0 = 5u + 4m - 96003. What is the thousands digit of u? 9 Let v(w) = -2w - 30. Let t be v(-16). Suppose -5q - 3j - 7 = 0, -2q + tj + 6 = j. What is the tens digit of 7(q + (-178)/(-14))? 9 Let d = 6 + -3. Suppose 7u = 10u - 2s - 6846, 0 = -du + 5s + 6837. Suppose -436 + u = 14w. What is the units digit of w? 2 Suppose 78z - 56112 = 26z + 26984. What is the units digit of z? 8 Let g be (0 - -4 - 4) + 0 + 3. Suppose gm + 3j + 2j = 96, 2*j = 0. Let h = -22 + m.	{ "pile_set_name": "DM Mathematics" }
at is the remainder when 1332 is divided by 265? 7 What is the remainder when 754 is divided by 35? 19 Calculate the remainder when 5327 is divided by 48. 47 Calculate the remainder when 2862 is divided by 8. 6 Calculate the remainder when 7253 is divided by 18. 17 Calculate the remainder when 117 is divided by 21. 12 Calculate the remainder when 156 is divided by 36. 12 What is the remainder when 91 is divided by 19? 15 Calculate the remainder when 456 is divided by 10. 6 What is the remainder when 1539 is divided by 55? 54 What is the remainder when 174 is divided by 76? 22 Calculate the remainder when 1754 is divided by 347. 19 What is the remainder when 4234 is divided by 121? 120 What is the remainder when 257 is divided by 37? 35 What is the remainder when 432 is divided by 62? 60 What is the remainder when 85 is divided by 44? 41 What is the remainder when 196 is divided by 96? 4 What is the remainder when 395 is divided by 2? 1 Calculate the remainder when 111 is divided by 23. 19 Calculate the remainder when 70 is divided by 7. 0 What is the remainder when 80 is divided by 12? 8 Calculate the remainder when 255 is divided by 64. 63 What is the remainder when 732 is divided by 246? 240 What is the remainder when 671 is divided by 96? 95 What is the remainder when 534 is divided by 256? 22 What is the remainder when 1433 is divided by 37? 27 Calculate the remainder when 269 is divided by 73. 50 What is the remainder when 1543 is divided by 141? 133 What is the remainder when 110 is divided by 35? 5 Calculate the remainder when 65 is divided by 47. 18 What is the remainder when 48 is divided by 28? 20 What is the remainder when 27 is divided by 7? 6 What is the remainder when 2962 is divided by 19? 17 What is the remainder when 52 is divided by 16? 4 Calculate the remainder when 134 is divided by 24. 14 What is the remainder when 92 is divided by 47? 45 What is the remainder when 359 is divided by 3? 2 What is the remainder when 114 is divided by 23? 22 What is the remainder when 196 is divided by 28? 0 Calculate the remainder when 183 is divided by 16. 7 Calculate the remainder when 1583 is divided by 488. 119 What is the remainder when 10713 is divided by 188? 185 Calculate the remainder when 1349 is divided by 8. 5 Calculate the remainder when 574 is divided by 362. 212 Calculate the remainder when 831 is divided by 831. 0 Calculate the remainder when 1501 is divided by 357. 73 Calculate the remainder when 234 is divided by 80. 74 What is the remainder when 1425 is divided by 23? 22 What is the remainder when 250 is divided by 3? 1 Calculate the remainder when 1585 is divided by 513. 46 What is the remainder when 73 is divided by 31? 11 What is the remainder when 128 is divided by 28? 16 Calculate the remainder when 931 is divided by 13. 8 What is the remainder when 125 is divided by 66? 59 What is the remainder when 47 is divided by 29? 18 What is the remainder when 414 is divided by 95? 34 What is the remainder when 52 is divided by 24? 4 What is the remainder when 2804 is divided by 4? 0 What is the remainder when 226 is divided by 93? 40 Calculate the remainder when 242 is divided by 114. 14 Calculate the remainder when 1047 is divided by 75. 72 Calculate the remainder when 2055 is divided by 9. 3 Calculate the remainder when 1160 is divided by 51. 38 Calculate the remainder when 634 is divided by 210. 4 Calculate the remainder when 5256 is divided by 2623. 10 Calculate the remainder when 251 is divided by 143. 108 Calculate the remainder when 53 is divided by 30. 23 What is the remainder when 51 is divided by 7? 2 What is the remainder when 133 is divided by 41? 10 What is the remainder when 422 is divided by 88? 70 Calculate the remainder when 5824 is divided by 201. 196 What is the remainder when 31 is divided by 23? 8 What is the remainder when 183 is divided by 8? 7 What is the remainder when 130 is divided by 35? 25 Calculate the remainder when 264 is divided by 125. 14 Calculate the remainder when 62 is divided by 5. 2 Calculate the remainder when 894 is divided by 25. 19 Calculate the remainder when 2825 is divided by 28. 25 What is the remainder when 205 is divided by 83? 39 What is the remainder when 41 is divided by 30? 11 Calculate the remainder when 335 is divided by 59. 40 What is the remainder when 83 is divided by 6? 5 Calculate the remainder when 8474 is divided by 446. 0 What is the remainder when 776 is divided by 82? 38 What is the remainder when 2012 is divided by 83? 20 Calculate the remainder when 678 is divided by 75. 3 Calculate the remainder when 1150 is divided by 372. 34 Calculate the remainder when 780 is divided by 87. 84 What is the remainder when 230 is divided by 8? 6 Calculate the remainder when 332 is divided by 71. 48 What is the remainder when 157 is divided by 56? 45 Calculate the remainder when 180 is divided by 41. 16 Calculate the remainder when 53 is divided by 22. 9 Calculate the remainder when 1549 is divided by 62. 61 What is the remainder when 3202 is divided by 67? 53 What is the remainder when 27 is divided by 15? 12 What is the remainder when 1855 is divided by 10? 5 What is the remainder when 1228 is divided by 10? 8 What is the remainder when 130 is divided by 21? 4 Calculate the remainder when 389 is divided by 130. 129 Calculate the remainder when 253 is divided by 4. 1 Calculate the remainder when 510 is divided by 29. 17 Calculate the remainder when 233 is divided by 220. 13 What is the remainder when 345 is divided by 26? 7 Calculate the remainder when 68 is divided by 30. 8 What is the remainder when 159 is divided by 33? 27 What is the remainder when 348 is divided by 219? 129 Calculate the remainder when 115 is divided by 14. 3 Calculate the remainder when 5774 is divided by 35. 34 What is the remainder when 2224 is divided by 170? 14 What is the remainder when 148 is divided by 99? 49 What is the remainder when 1285 is divided by 11? 9 Calculate the remainder when 327 is divided by 2. 1 What is the remainder when 12203 is divided by 109? 104 What is the remainder when 5506 is divided by 307? 287 Calculate the remainder when 1748 is divided by 25. 23 What is the remainder when 2795 is divided by 20? 15 Calculate the remainder when 263 is divided by 38. 35 What is the remainder when 6297 is divided by 134? 133 What is the remainder when 524 is divided by 76? 68 What is the remainder when 143 is divided by 126? 17 Calculate the remainder when 102 is divided by 21. 18 What is the remainder when 8 is divided by 6? 2 Calculate the remainder when 2260 is divided by 73. 70 Calculate the remainder when 352 is divided by 90. 82 Calculate the remainder when 2234 is divided by 13. 11 What is the remainder when 149 is divided by 22? 17 Calculate the remainder when 312 is divided by 34. 6 Calculate the remainder when 277 is divided by 26. 17 Calculate the remainder when 30 is divided by 7. 2 What is the remainder when 89 is divided by 9? 8 Calculate the remainder when 306 is divided by 53. 41 What is the remainder when 43 is divided by 5? 3 What is the remainder when 93 is divided by 32? 29 Calculate the remainder when 971 is divided by 36. 35 What is the remainder when 113 is divided by 29? 26 Calculate the remainder when 371 is divided by 54. 47 What is the remainder when 153 is divided by 20? 13 Calculate the remainder when 2586 is divided by 14. 10 Calculate the remainder when 183 is divided by 6. 3 What is the remainder when 236 is divided by 45? 11 What is the remainder when 80 is divided by 12? 8 What is the remainder when 31 is divided by 9? 4 What is the remainder when 1566 is divided by 1555? 11 What is the remainder when 372 is divided by 83? 40 Calculate the remainder when 1860 is divided by 38. 36 What is the remainder when 247 is divided by 18? 13 What is the remainder when 95 is divided by 63? 32 Calculate the remainder when 433 is divided by 21. 13 What is the remainder when 98 is divided by 51? 47 Calculate the remainder when 99 is divided by 4. 3 What is the remainder when 714 is divided by 49? 28 Calculate the remainder when 1898 is divided by 38. 36 Calculate the remainder when 69 is divided by 6. 3 What is the remainder when 1024 is divided by 207? 196 Calcula	{ "pile_set_name": "DM Mathematics" }
.6 or s? -3.6 Let f be (0 - 6)(-912)/(-72). Let x be (f/8 - -8)/(-1 - 5). Which is greater: 23 or x? 23 Suppose 2m - 401 = -399. Let h = -64 + -286. Is h equal to m? False Let l be (-8)/20 - 81/(-15). Suppose -4s = -lu + 8, -2u - 4 = -12. Suppose -sr - 3k + 54 = 0, 2k - 70 = -4r - 0k. Which is bigger: 18 or r? 18 Let s = -8.18 + 7.18. Let q = 0.04 + 0.86. Let g = q + -0.7. Which is smaller: g or s? s Let c be 4/7((-39)/(-26) + -3). Which is bigger: c or -0.041? -0.041 Let p = 13663 - 16198. Which is smaller: -2536 or p? -2536 Let s = -3 - -1. Let l = 179078057/71699460 - 2/1194991. Let r = 49/20 - l. Which is smaller: s or r? s Let k be (-1566)/(-29)(-52)/(-3). Which is smaller: 4682/5 or k? k Let r be (-2)/(-6)218/((-2)/1)111. Which is smaller: -4032 or r? r Let r be 0/1 - 235/(-20). Let w = 839/68 - r. Does 0 = w? False Let d be 94/(-28) + 3 + -14 + (-1440)/(-112). Let k = -5 - -7. Suppose k = -i + 2w, -2i = -0w - w + 4. Are i and d equal? False Let d be 33 - 31 - 6/31. Suppose d = 2s + 5z - 713, -5s + s - 2z + 1466 = 0. Is s greater than 369? False Let o(b) = b - 2. Let v be o(4). Suppose vg = -g - 42. Suppose -26 - 102 = 8f. Is f at least g? False Let d = 153842/5 + -30768. Which is greater: d or 118/53? 118/53 Let v be -5(-1)/((-10)/(-12)). Suppose 0 = 535i + 1359 - 5104. Which is smaller: v or i? v Let o = 25 + -25.54. Let b = 0.92 + o. Which is bigger: 3 or b? 3 Let l = 368163/85 + -73500/17. Suppose -3o + 4o - 4x = -3, -3o + 21 = -2x. Does l = o? False Let r = 0.7804 - 102.7504. Let n = r - 2.03. Is -1/4 less than or equal to n? False Suppose 4m - 4g = -1136 + 276, 0 = -5m - g - 1057. Suppose -211 = v - o, -2v - 3v = 4o + 1073. Which is smaller: v or m? v Suppose 5m + 360 = -545. Let j = -179 - m. Are -5 and j non-equal? True Let k be 8/(16/4) + -1294 - 5. Are k and -1296 nonequal? True Let l(i) = i*3 + 21i*2 - 23i - 23. Let w be l(-22). Is 8/649 at least as big as w? True Let x be -3 + (18 - 6) - 7. Let p be -6 + 212/36 - x/(-18). Is 3/14 != p? True Let x = -9030 + 9031. Do -2946 and x have the same value? False Let b = 19613/24 - 817. Let x(t) be the second derivative of -t4/6 - t3 - t*2/2 + 10t. Let l be x(-3). Which is smaller: l or b? l Let k be (41/(-16) - -2)/((-1869)/(-2492)). Let i = -2 - -1. Is k at most i? False Suppose 6v + 27 = 15v. Let u be (34/10 - v)/((-4)/40). Is u greater than -33/7? True Suppose -4w + 2o = 52, -2w - 4o = -0o + 36. Let m(n) = 8n - 107. Let f(c) = -4c + 54. Let t(g) = -7f(g) - 4m(g). Let d be t(16). Are d and w nonequal? False Let c(l) = l3 + 20l*2 + 17l - 30. Let n(x) = 11x + 179. Let y be n(-18). Let u be c(y). Is u < 0.007? False Suppose -238 = -4m + 3a + 333, -a - 561 = -4m. Which is greater: 841/6 or m? 841/6 Let s be (7 + (-16 - -9))/(-3). Let k be ((-6)/(-40))/(34/8). Is k equal to s? False Suppose 6v = v - 410. Suppose 20w + 162 = -7w. Let f be (-3 - 261/w)/((-11)/22). Are f and v unequal? True Let d(p) = 3p*3 - 6p*2 + 6p - 13. Let b be d(3). Suppose 13k + b + 202 = 0. Does k = -10? False Let v be 14 + -16 + (6 - 5732). Is -22909/4 bigger than v? True Let h = 3860/441 + -418/49. Is -904 > h? False Suppose -5o = 3u - 1 + 6, 4u + 20 = 0. Let c be 3(o/(-10) - 2/15). Does c = 8? False Suppose 44 = y - 2y. Let c be 17/102 - (-70)/(-42). Is c smaller than y? False Let d = -0.0506 + 0.0866. Does d = -0.4? False Let y be (27/(-36))/(10/(-3920)). Suppose -50j - y + 794 = 0. Which is greater: 81/8 or j? 81/8 Let z(i) = -i2 - 4i + 53. Let h be z(-9). Let j be ((-20)/11)/(-2) - h. Are 1/4 and j equal? False Let m be (-4)/(-6)(-260)/8. Let a = m + 22. Which is smaller: 18 or a? a Suppose 0 = -4v - 5i + 20131, v - 198i = -195i + 5037. Which is greater: v or -2/3? v Let c = -153.8 + 167.6. Which is greater: c or 7? c Let u = 230 + -230.12. Let g = 2.2 - 1.8. Let i = 0.6 + g. Do u and i have the same value? False Suppose -5 = m, -41 = -4g + 5m - 0m. Suppose 2a + 3b - b = -2, -5b - 23 = -ga. Suppose -2c - ac + 14 = 3x, 2c - x - 2 = 0. Is 2 < c? False Let h(n) = -6n2 + 3n + 70. Let c(u) = -3u2 + 2u + 36. Let f(w) = 7c(w) - 4h(w). Let p be f(-7). Is p smaller than 106? True Let w(t) = t3 + t2 - 14t + 21. Let h be w(4). Which is bigger: -9 or h? h Let r = 21/13318 + -59597/39907387. Is 0 <= r? True Suppose -9h + 15 = -6h. Suppose -16 = q + hl, -4l - 14 = 3q + 1. Let g = -946 + 12292/13. Is g less than or equal to q? False Let q be -7 + ((-311730868)/(-44008752) - (-1)/(-12)). Is q <= 0? False Let a = 1804 - 1805. Which is smaller: 446/9 or a? a Let y = -10381 - -10877. Which is greater: 12 or y? y Let k(g) = 2g3 - 8g*2 - 21g - 17. Let p be k(6). Is -1/2545 less than or equal to p? True Let c = -3000 + 2970.77. Let j = c + 29.2. Is j less than -7? False Let w = -8102/1309 - 18/187. Let n = -6 - w. Are n and 0.9 non-equal? True Let g = -26.201 + -0.799. Let a = 29 - -1. Let u = a + g. Is 3 smaller than u? False Let a(r) be the second derivative of 7/2r2 + 0 - 13r - 1/6r3. Let l be a(0). Is l smaller than 7? False Let w = -5/15438 + -11861525/15438. Is -769 greater than or equal to w? False Let j = 29127 + -29133. Which is bigger: -5/201 or j? -5/201 Let o be ((-12)/18)/(14/(-63)). Let y be o/12 + 195/20. Which is bigger: 11 or y? 11 Let t be 9424/(-14568) - (-28)/42. Is 0 not equal to t? True Let x = 14.962 + 0.038. Let r = 17.6 - x. Let s = r + 3.4. Which is smaller: s or -0.2? -0.2 Let z be (20 - 40)/(-360)(-2 - -1). Is 117 at least z? True Let l = 4563 - 9407. Is -4845 <= l? True Let t(w) = 82w - 2. Let f(h) = 2h + 21. Let j = 117 + -127. Let i be f(j). Let b be t(i). Do 79 and b have the same value? False Let d be 2/(-5) - (11232/(-30))/(-4). Let c = d + 139. Let r = c + -45. Is -1/24 greater than r? False Let i = -4 + 4.05. Let p = 0.011 - i. Let t = p - -2.239. Is 1/3 <= t? True Let z(t) = 24t2 + 10t + 11. Let m be z(5). Let q = 708 - m. Does 47 = q? True Let x = -4155.7 + 4169. Let p = 229 - 208.7. Let r = x - p. Is -1/7 smaller than r? False Let d = -0.00365 + -120.57635. Let h = -0.58 - d. Let f = h + -113.5. Which is smaller: f or -1? -1 Let y = -58 - -131. Suppose 0 = 3n + o + 4 - 9, -3n = -o + 5. Suppose 0 = 2d - 3d - 4f + 57, -4d - 5f + 272 = n. Are y and d unequal? False Let x = -47/21972 + -61744043/10986. Let k = -5667 - x. Is k greater than or equal to -47? True Let i = 3035928 - 15328400420/5049. Let a = i - 32470483/35343. Let v = a - -917. Which is smaller: -2 or v? -2 Let g = -3/6889 + 69331/1012683. Which is greater: -1 or g? g Let a be ((-78)/10)/(8/(-85)). Let d = -83 + a. Suppose 192762z = 192741z. Which is smaller: d or z? d Let w = -1648 + 1645. Which is bigger: 246 or w? 246 Suppose 0 = -93j - 490 - 2191 - 1597. Is j at least as big as -50? True Suppose -414 = 36k + 630. Let v be (-21)/7 + k/2. Suppose -5q = 48 + 47. Does v = q? False Let v = 147675 + -147574. Suppose 0a = a - 103. Which is smaller: v or a? v Let d be 2 - -2 - 114/(-6). Let n = d + -88. Let h be 3/((-30)/(-226)) + (-26)/n. Do -1/4 and h have the same value? False Let s = 56 - 49. Let x = 75 - s. Which is smaller: -2/5 or x? -2/5 Let m = 26716 - 26771. Is m greater than or equal to 16? False Suppose 3n - 6 + 0 = 0. Suppose -7k - 400 = -17k. Let j be (8/(-6))/(k/(-32)). Which is greater: j or n? n Let z be 40050/(17 + 28)((-5)/8)/(-5). Let o = 106 - 218. Let h = o + z. Is h less than 24? True Let d(r) = r2 - 7r - 8. Let k be d(8). Suppose k = -2a - 0 - 2. Let m be (3/a - 0)/8. Is -2 smaller than m? True Let f = -10532/7066423 - 1/4087. Are f and 1 equal? False Let m = 559 - 455. Let q = m - 849. Is -1 != q? True Let z = 585 - 584. Let s be -8(-15)/(-120) + z2. Is s >= -2/473? True Let w = 46 + -46. Suppose 0 = -a - w + 1. Let l = -43/11 + 4021/1023. Are a and l unequal? True Let n = 4.288 - 8.288. Which is smaller: -656 or n? -656 Let n = -1.6 - 4.4. Let q = n + 5.8. Let j = 23373 - 23412. Which is greater: j or q? q Let d = -5430 + 5429. Is d not equal to -36/5? True Suppose 8k - 16 = 4k + 4d, 5k = -2d - 8. Let c be (2 - 3) + 1 + k. Is 2/137 less than c? False Let g be 171/27 - (-1)/(-3). Let u be (-114)/(-48) + g/(-1). Is u <= -3? True Suppose -4*w +	{ "pile_set_name": "DM Mathematics" }
ich is bigger: t or 1? 1 Let o = -6 - -26. Let l be (-8)/o + 19/(-15). Is -3 less than l? True Suppose 0d - 2d = 4p - 14, 0 = -2p + 2d - 8. Suppose -2a - p = -7. Let m be (-1 - -9)(-1)/(-2). Which is bigger: a or m? m Let b(f) be the second derivative of f5/20 + f3/6 + f2/2 + f. Suppose 0 = a - 3a. Let i be b(a). Do i and 3/5 have the same value? False Suppose 5u - 10 = 10. Suppose ug = 2g. Is g not equal to -1/6? True Let r(o) = -2o*2 + 6. Let m be r(-5). Let a be (-1 - m/6) + 1. Let c = a - 7. Is 1 bigger than c? True Let t = 0.4 - 0.2. Which is greater: t or 0.05? t Let p = -731 - -2213/3. Let m = 1345/3 + -442. Let i = p - m. Which is bigger: i or 1? 1 Let g = -0.8 - 2.2. Let a = 6 + -6.2. Is g greater than or equal to a? False Suppose 0y = 2n - y + 55150, 0 = -n - 4y - 27557. Let z = 193328/7 + n. Let k = 45 - z. Is k < -1? False Let v be (0/(20/(-4)))/(-3). Is v at most 12/11? True Let n = 10 + -2. Which is bigger: n or 7? n Suppose 0 = m + 2a + 4 - 17, -2a = 2m - 20. Let y be ((-2)/(-3))/(3/27). Is y bigger than m? False Let d(l) = l + 3. Let s be d(-6). Let p be 3 - s(-38)/42. Which is greater: -2/7 or p? p Let u(t) = t + 9. Let m be u(-6). Do m and 3 have different values? False Let a = -3.4 + 1.4. Is -3/7 >= a? True Let t = -111 + 111. Is t greater than or equal to 4/21? False Let v = -41 + 36. Let l = -3 + -1. Which is smaller: l or v? v Suppose 7t = 4t - 3. Is t greater than -2/31? False Let x be 0/((-2)/22). Let k be 2/3(-99)/(-22). Suppose 0 = -kz - 1 - 2. Is z at least x? False Suppose -5f + 2w + 0w = -25, -5f - 2w + 5 = 0. Suppose b - 12 - f = 3h, 4h + 20 = 0. Let o = -1/410 + 1649/3690. Is o smaller than b? False Let q = 0.3 + -0.3. Let j = -15.9 - -15. Let l = j - 3.1. Which is greater: q or l? q Let t = 0.06 - 0.46. Which is bigger: -0.1 or t? -0.1 Let a = 557/2 - 272. Which is bigger: 6 or a? a Suppose 25 = 5w - 3v, 0 = 4w + 5v + 3 + 14. Which is smaller: w or -5? -5 Let m be ((-181)/3)/((-4)/3). Let y = 102743 + -3700369/36. Let o = y + m. Is o less than 1? True Suppose 0 = -0c + 8c + 8. Which is smaller: c or 2/39? c Let j = -0.108 + 1.108. Is 11 >= j? True Let d be 3/54-8 + 1. Do d and 1 have different values? True Let o = 2 + -17. Let y be (-111)/o + (-2)/5. Suppose -5x = 4p - 13, -3x + yx + 3p = 10. Which is smaller: x or 2? x Suppose -b - y + 3 = -1, -2b + y - 7 = 0. Let v be 1 + b + 1 - -3. Which is smaller: 2 or v? 2 Let o be -2 + (51/45 - -1). Is 1/3 at most o? False Let o = 274/245 - -4/49. Suppose 0 = 5p + 75 - 85. Is p bigger than o? True Let k = 3437/10541 + -46/127. Which is bigger: k or 1? 1 Let y = -1 + -1. Let x be (-6)/9 + y/6. Let s = 8 - 8. Which is bigger: x or s? s Let u(w) = -2w - 25. Let p be u(-12). Is 0 at most as big as p? False Let p = -7 + 9. Suppose 2q = -pn + 22, -3q + n = 2n - 29. Let f be (-18)/(-11)3/q. Which is greater: f or 2? 2 Suppose 2t = -2h - 74, -5t - h + 4h - 201 = 0. Let l = 27 + t. Let z be (1/l)/((-6)/(-12)). Which is smaller: z or 0? z Let v = -45.6 + 45. Which is greater: v or 5? 5 Let s = 6 + -6.08. Let g = -0.02 + s. Are 2/25 and g equal? False Let k be (-300472)/140 - 3/(-1). Let p = -2142 - k. Let h = p + -10/7. Which is smaller: h or -0.1? h Suppose 5g = 0, -b = 2g + g - 7. Is b at least as big as 8? False Let h = 10 - 20. Let n = h + 10. Let i = -3/11 + -3/11. Which is greater: n or i? n Let m(x) = -x2 - x + 1. Let z(h) = h2 + h. Let y(j) = 2m(j) + z(j). Let o be y(0). Is o smaller than 5/7? False Let r be 17251/(-11)1. Let x = r + 157. Suppose 2 = -3j + d, d + 2 = 5j + 6. Which is smaller: j or x? j Let c = -0.33 - -0.43. Let l = -2/257 - -544/3855. Is c less than or equal to l? True Suppose -11t = -7t. Is 2/131 < t? False Let c = -22 + 22. Let n = 6.4 - 7. Which is bigger: c or n? c Let d be (3 + -3)/(-1) + 0. Is d at least as big as 1? False Let c be (-32)/20(-10)/4. Suppose z - 3z + c = 0. Let t be (-4 - -6)z/6. Which is smaller: 2 or t? t Let z be (-4)/(-22) - 1568/(-88) - 4. Is z >= 5? True Let z = 6 - 10. Let q = 75 - 223/3. Which is greater: z or q? q Let m = 7.4 + -7. Let q = m - 1. Which is smaller: 1 or q? q Suppose 2 = -5q + 7. Which is greater: q or 4? 4 Let w be ((-4)/(-40)-2)/(7/(-1)). Which is smaller: -1 or w? -1 Suppose 2p = -5x - p + 13, 3p - 3 = 0. Let k be -2 + 10/(2 - 3). Let s be (-2)/5 + k/(-5). Is x <= s? True Suppose -3v - 11 = 4. Let r = 0 + -6. Is v > r? True Let r(q) = -3q3 - 4q*2 - 2q + 1. Let f be r(-2). Let x = f - 3. Suppose u - x = -4u. Is 2 smaller than u? False Suppose 35 - 111 = a. Let l be a/120 + (-1)/(-2). Is l at least 0? False Suppose -v + 1 = -4. Suppose -vy - 24 = -y. Is -6 greater than y? False Suppose 2o + 9 = 3r, 8r + o - 28 = 3r. Let h(s) = -s*3 + 3s*2 + 6s - 4. Let n be h(4). Which is bigger: n or r? r Suppose 4t = t + 9. Suppose -l - 4 = tl. Is -1/6 greater than l? True Let d = 8.2 + -8.3. Let c = -8 + 11. Let u be c1 - (-3 - -4). Are d and u nonequal? True Let r be -5 + 2 - 2-1. Let z(c) be the first derivative of -c3/3 + c2/2 + c + 1. Let w be z(2). Do w and r have the same value? True Let w be 111/(-57) + (-2 - -4). Let g = -10300251/190 - -54212. Let t = g - w. Is t >= 0? True Suppose -5h - 52 = -137. Let u = 15 - h. Is u less than or equal to -3/2? True Suppose 8y - 5 = 3y. Suppose -2b + 1 = 3. Let t(i) = 3i + 2. Let c be t(b). Is y >= c? True Suppose 146 = 3r + 5l, -3l + 159 = 3r + 3. Let m be 51/r - (-1 + 2). Which is smaller: m or -1? -1 Let m(o) = 3o - 4. Let c be m(3). Suppose ct + 5z + 10 = 0, 3z = 5t + 11 - 1. Is -2 bigger than t? False Suppose 0 = 6p - 2p. Let i be 0 - (3 - p - 2). Is i at most as big as -1? True Let u be 8(6/(-8))/(-1). Suppose -9 = -k - 5i + 23, -5i - 10 = -5k. Is k < u? False Let q = 10 - 18. Let x = -15 - q. Is 0 greater than or equal to x? True Let p be -2 + (-4 - -6) - 0. Which is smaller: p or 1/6? p Suppose -7 + 27 = 2v - 2m, 2v - 3m - 25 = 0. Suppose 0 = -3b + 2b - v. Which is bigger: 2 or b? 2 Let u be (-1)/(-2)2/3. Let n = -0.23 + 21.23. Which is smaller: n or u? u Suppose -3d + 8d = 15, -2t - 4d = -10. Are 3/13 and t non-equal? True Let r(d) = 6d - 17. Let p be r(-5). Do -46 and p have the same value? False Let a be 48/(-22) - (-3 - -1). Let s(q) = 0q - 1 + 5 - q. Let o be s(4). Is o at most as big as a? False Let d be (-2 - (-95)/15) + -2. Is d less than 3? True Let t be 0/(0 - 2) + -1. Let w(c) = c3 - 2c - 1. Let b be w(t). Which is greater: 5/6 or b? 5/6 Let x be -3 - ((-12)/2)/3. Which is smaller: x or 1/8? x Let j = 0.03 - 0. Let p = j - 0.13. Is 5 equal to p? False Let d(m) = 2m2 - 3m - 1. Let v be d(3). Is v > 5? True Let w(u) = -u*3 + 6u*2 + 7u + 1. Let l be w(7). Is l smaller than -5? False Let h = 24 - 20. Which is smaller: h or 0? 0 Suppose -4c - y = -20, -8 = -5c + 3y - 0y. Suppose 0 = -cq + q. Let j be -2 - 0 - (q + -1). Is j smaller than -2? False Let g be (-6)/(-14) + (-20)/(-35). Suppose 2c = 3 + g. Which is greater: c or 7/3? 7/3 Suppose -2k - 2a = -0k, -a = -3. Let f be -1(2 + (k - -2)). Suppose 0 = -m - 3m + 4. Which is greater: f or m? m Let y = -0.03 + 0.03. Which is bigger: -0.17 or y? y Let w be (-28)/(-10) - 1/(-5). Let a = w - 3. Let l be (-18)/15 + a + 1. Is l >= -1? True Let u = 42 - 42. Let r = -6412096/17 + 377447. Let q = r - 265. Which is smaller: u or q? q Suppose -16d + 11d = 0. Is -1/31 greater than d? False Suppose -2h + 2 = 3y - 0y, -3h + 3 = -4y. Suppose 0z + x = 2z + 3, -z - 12 = -4x. Is z greater than h? False Let t = 44 - 179/4. Which is greater: 4 or t? 4 Let f = -0.082 + 21.882. Let r = 22 - f. Is r less than or equal to 5? True Suppose -y - 4y + 415 = 0. Suppose 3c + 2d - 29 = -y, d - 103 = 5c. Let k be 2/(-4) - (-2)/c. Which is smaller: -1 or k? -1 Let u be 3(-1)/266/(-9). Which is smaller: u or -1/4? -1/4 Let t = -7 - -11. Suppose tr + 16 = 2y - 0y, y - 5r - 20 = 0. Let a be 0/(2 - 1 - 3). Are y and a unequal? False Let g = -0.18 - -0.25. Let o = g + 0.93. Is o less than or equal to -5? False Let i(y) = y3 + 8y*2 + 6y. Let f(k) = k*2 + 5k - 1. Let m be f(-7). Suppose -3 = 3c + 5x + 13, 2*c + x = -m. Let r be i(c). Is 6 less than r? True Suppos	{ "pile_set_name": "DM Mathematics" }
74. Let b be x(-10). Let s be -24((-27)/2)/3. Let r = b - s. Is 18 a factor of r? False Let n be ((-6)/(-5))/3 - 92/(-20). Let v be (-3 - (-628)/2) + -6 + n. Suppose h - v = -h. Is 22 a factor of h? False Is 25 a factor of (59/2 + 2)2783/9? False Let f be 2/(((-16)/(-8))/(-722)). Does 23 divide (-381862)/f + 4/38? True Let k = 249 + -245. Suppose -ko + 3g = -772 - 464, -g - 1556 = -5o. Does 6 divide o? True Let g = 103714 + -8470. Does 13 divide g? False Let g(w) = 48w + 15. Let n be (-6)/((45/66)/(-5)). Suppose 0 = 5r + 6r - n. Does 23 divide g(r)? True Let v(l) = 28l + 23. Let g be v(9). Suppose -7y - g + 828 = 0. Is 9 a factor of y? False Let o(h) be the third derivative of -2h*4/3 + 2h*3 + 4h*2. Let m be -33 + 35 - (6 + 1). Is 23 a factor of o(m)? True Is 143 a factor of 83/(498/113448) - (-9 + -1)? False Suppose -9k = 33 + 12. Suppose 2o + 1 + 1 = 0. Is 3 a factor of o/(((-4)/(-6))/(k - -3))? True Let h(u) = 10 + u + 8 - 3 + 5. Let i = -24 + 7. Does 2 divide h(i)? False Let o(w) = -24w + 6. Let n(p) = 24p - 5. Let r(i) = 3n(i) + 4o(i). Let y be r(-5). Suppose -y = -2s - 3b, s + 5b - 82 = -0s. Does 19 divide s? True Suppose 0 = -94y + 85y + 4455. Suppose 500r - 1465 = yr. Does 17 divide r? False Let p(l) = -1041l - 1271. Does 19 divide p(-11)? False Is 0 + (-49)/(147/(-7740)) a multiple of 5? True Suppose -3a - 2198 = -3j - 809, -5j - 2a + 2357 = 0. Is 57 a factor of j? False Is 3/72-8 + 246724/12 a multiple of 16? True Let u = -7 - -14. Suppose 5j + 4a - 1194 = 0, 4j - 5a + 706 = uj. Is j a multiple of 11? True Let c = -13 - -10. Let l(n) = -n*2 + 2n + 1. Let a(r) = 8r3 + 11r + 1. Let d(q) = -a(q) + 4l(q). Is d(c) a multiple of 48? True Suppose 4k - 62923 = -5c + 104059, c - 33366 = 3k. Does 23 divide c? False Let y = -1711 + 8835. Does 7 divide y? False Let k = -3224 + 6243. Suppose -8b - k = -12171. Is b a multiple of 9? False Let u = 236 - 234. Suppose 5j + 945 = s, us = 5s + 2j - 2852. Is 12 a factor of s? False Suppose 44l - 5 = 43l, p = 2l + 1120. Does 8 divide p? False Let i(m) = -m*3 + 31m*2 + 2m - 62. Let u be i(31). Suppose u = 4y - 316 - 332. Is 7 a factor of y? False Does 30 divide (-503143)/(-430) - (9/(-10))/(-9)? True Let u be (0 - 5)(-5)/(175/4606). Suppose 0 = 3p - 7p + 3n + u, -5n - 488 = -3p. Suppose 30 = 4r - p. Is r a multiple of 49? True Let y(o) = 8o2 - 1227o*3 - 8o*2 + 3 - 2o - 160o3. Let m be y(1). Does 23 divide 2/(-5) + m/(-15)? True Suppose -o - 2m - 3 = 0, 3 - 10 = o + 3m. Suppose -o = s - 7. Suppose b = 2b + 2l - 18, 0 = -sb - 3l + 41. Is 2 a factor of b? True Let a(s) = 27s - 310. Let c be (45/90)/((-2)/(-72)). Is 5 a factor of a(c)? False Suppose -2d - 40 + 46 = 0. Suppose -608 = -5v + 2r - 4r, dr = 3v - 369. Does 39 divide -2 + (v - -2) + -5? True Suppose 5q = -2r - 15, 2r = 2q - 2r + 30. Let p be 4 + 2/(-2) + q. Is (p/(-4))/(14/1540) a multiple of 15? False Suppose -21f - 23f + 756052 = 0. Does 129 divide f? False Let y(p) = 50p*2 - 6p - 12. Let s be (-4)/(-3)(-11)/((-176)/36). Is 41 a factor of y(s)? False Let d(c) = -2c*3 + 11c*2 + 2c + 24. Let f be d(6). Suppose 3m - 4u - 1171 = f, -6 - 10 = 4u. Does 13 divide m? False Let f(c) be the first derivative of c4/4 + 7c*3/3 - 4c*2 - 13c - 33. Does 3 divide f(-6)? False Let b(w) = 4w2 + w. Let s be b(1). Suppose i - 23 = sp, 4i + 3p - 32 = 8p. Suppose ij = 7j - 132. Does 33 divide j? True Let k(m) = -3m - 12 + 67 - m. Let i be k(13). Suppose ia - 11 = 382. Is a a multiple of 14? False Suppose 7i - 21464 - 2889 - 8295 = 0. Does 18 divide i? False Let q = 61 + -38. Suppose -q = -5s + 7. Is 18 a factor of s/(-4)2664/(-54)? False Suppose -a + 2349180 = 179a. Is 20 a factor of a? False Let b = -8946 - -16274. Is b a multiple of 8? True Let l(i) = i2 + 26i - 319. Let u be l(-49). Let n = -618 + u. Is 4 a factor of n? False Let c(y) = 2y3 + 64y*2 + 71y + 309. Is 21 a factor of c(-31)? False Suppose 0 = 19v - 113 - 20. Suppose -k = vj - 5j - 205, 0 = -5k - 3j + 997. Is k a multiple of 5? False Let n(z) = z2 - 3z + 26. Let c be n(6). Suppose -142 = -46u + cu. Does 38 divide u? False Suppose 664735 + 392528 = 301n - 63962. Does 149 divide n? True Let u(j) = 19j*2 + 25j + 25. Let z be ((-6)/4)/((-129)/(-602)). Is 11 a factor of u(z)? True Let g(s) = 31s - 1. Let l(z) = 113 - 223 + 112 - 32z. Let c(a) = 6g(a) + 5l(a). Does 29 divide c(2)? False Let t(c) = c*2 + 70c - 455. Is 3 a factor of t(-82)? False Let f be (-1 + -3 + 0)6/4. Let v(l) = 7l*2 - 3l + 4. Does 13 divide v(f)? False Let x(t) = 20t - 7. Let o be x(-2). Let y = o + 65. Suppose y = l - 43. Is 16 a factor of l? False Suppose 12 = 3r + 4y, -2r + 10 = 4y - 2. Suppose -3n - 24 = -rn. Let w(v) = 2v*2 + 9v - 8. Does 12 divide w(n)? True Let w(t) = t*2 + 11t - 15. Let m be w(-9). Let v be (-2)/((15/84)/(-5)). Let l = m + v. Does 6 divide l? False Suppose -5q - y = 53 - 171, 0 = 5q - 5y - 130. Let z = q + 47. Is z a multiple of 2? False Suppose -252p + 6440 = -224p. Does 3 divide p? False Suppose 2z = 5n + 135, -z - 47 - 7 = 2n. Let k = n + 45. Let t = k + 30. Does 12 divide t? True Let j = -19 - -9. Let p be (((-12)/j)/3)/(4/(-60)). Is (p - -2)/(-4) - (-108 + 4) a multiple of 21? True Let t be 6478/6 + (-11)/(-21 + -12). Suppose 0 = 119l - 114l - t. Is l a multiple of 36? True Let t = 449 - 446. Suppose -ta + 2q + 1243 = 0, -404 - 443 = -2a + 5q. Is 10 a factor of a? False Suppose 130g + 55089 = 139g. Is 38 a factor of g? False Let t = 40 - -626. Suppose i + 4l - 237 = -0i, -3i = -3l - t. Is i a multiple of 25? True Let y be 20/8(0 + 2). Let x(u) = -u3 + 5u*2 + 7u - 6. Let v be x(y). Suppose vh - 24h - 1240 = 0. Is h a multiple of 31? True Let k be (-6)/14 + (-1 - (-470)/35). Suppose -3z + 836 = 2g, -3g + kz = 9z - 1284. Is 53 a factor of g? True Let g be 2 - (0 - -111). Let p be 0 + (-514)/(-9) + (-41)/369. Does 30 divide g/(-4)1216/p? False Let j be 69/12 - (-3)/(-4). Let i = 657 + -173. Suppose 2y - 184 = -g + 5g, 0 = -jy + 4g + i. Does 10 divide y? True Let g = 28155 + 11325. Is g a multiple of 152? False Suppose 36j - 3z = 41j - 2536, -2j - 6z + 976 = 0. Is 32 a factor of j? True Let b be 2/((-8)/6 + 801/621). Is b/(-7)(30 + -23) a multiple of 6? False Let b = 44 + -97. Let d = b + 54. Does 9 divide -3 - (1114/(-12) - d/6)? True Suppose b + 3 = 6b + 3g, 0 = -2b - 3g - 6. Suppose j + p - 127 = 0, bj - 4p + 97 = 506. Is j a multiple of 39? False Suppose 0 = -41z + 43036 + 11371. Is 38 a factor of z? False Let a = -65 + 109. Suppose 4 = -10r + a. Suppose rf = 5f - 54. Does 9 divide f? True Let q = 89 - 82. Suppose 10h + 13 + q = 0. Is ((-10)/(-8))/(h/(-16)) a multiple of 4? False Suppose -144z = -150z + 234. Suppose 355 = 4n + z. Is 79 a factor of n? True Let p be 28/(-7) - 3/(1 - 2). Let h(q) = -1653q*3 - 29q - 30. Is h(p) a multiple of 118? True Suppose -199789 = -106v + 289719. Is v a multiple of 15? False Suppose 0 = 4u + 2d - 20, 3d + 4 - 10 = 2u. Suppose 2y = -y - uy. Suppose 3j = 3o + 15 + 180, -j - 4o + 50 = y. Does 4 divide j? False Let l = 1 + 60. Suppose -16y + 531 + l = 0. Is 8 a factor of y? False Let k(b) = 44 - 28b + 167 - 87. Is 10 a factor of k(-2)? True Let o be (-70)/4 - 33/(-22). Let k be (-52)/o + (-9)/(-12). Suppose p + kp + 3i = 137, -4i = -4p + 84. Is 18 a factor of p? False Let j(i) = -284i + 6. Let c be j(-2). Suppose 7h + c = -28. Is h/(-1) - (-3 - (1 + -6)) a multiple of 14? True Suppose 3v = -2j + 3240, -54j + 50j + 2160 = 2v. Is 12 a factor of v? True Let n = 486 + -484. Does 30 divide n - (-146 + 1 + -5) - -3? False Let p be 4/14 + (-24)/(-14). Let u(d) = d + 20. Let l be u(-16). Suppose t + 44 = pt - lg, -5t + g = -220. Is 29 a factor of t? False Is 14 a factor of 0 - 1-8 - (-36053 + 81)? True Let x be (-22 + 25)/((-1)/5-3). Suppose -xp - 2 = -4p. Is (p/(-8))/((-5)/(-3620)) a multiple of 33? False Suppose 12c - 4 = 10c. Suppose -b - c = -5, 3a - 2b - 264 = 0. Is a a multiple of 10? True Is (-40)/6220662/(-1495) a multiple of 24? True Suppose 8450 = 138t + 31t. Is 2 a factor of t? True Let k(n) = -184n	{ "pile_set_name": "DM Mathematics" }
igger: 0 or m? 0 Let p = 16301/9 - 1809. Which is bigger: p or 1? p Let s = -4 - -7. Let w = 2.99 - s. Is 0.1 greater than w? True Let r(c) = c + 4 - 6 + c. Let g be r(2). Is g < 1? False Let p = 3/62 + -201/310. Suppose 5g - g = -64. Let i = 16 + g. Which is bigger: p or i? i Let p = -2 - -3. Is 0 greater than p? False Let b = 3177/232 - 109/8. Let g = -4 + 12. Suppose 4 = 4s - gs. Which is bigger: s or b? b Let h = 1 + 2. Let a be (2/h)/((-14)/(-9)). Is 0 less than a? True Let r(h) = -h2 - h - 15. Let i be r(0). Let d = -13 - i. Suppose 2m - t = 10, 0 = -5m - 4t + t + 3. Are m and d unequal? True Suppose 0 = -3o - 16 - 2. Let u be -3 - (o/33 - 3). Let p(l) = -l3 + 7l*2 - 7l + 6. Let z be p(6). Are z and u equal? False Let r = -4.96 - 0.04. Which is smaller: -1/3 or r? r Let b(n) = -n*3 - 4n*2 + 5n - 2. Let i be b(-5). Let j be 2/(-8)i0. Suppose 4p - 3a + 7 = j, 3p = 5p + 3a - 19. Are 3 and p equal? False Let a be (16/(-12))/((-2)/(-3)). Let x be (-40)/(-56) - a/7. Is x smaller than 2/13? False Suppose -4v + 3t = 5t + 8, 2v - 3t = 4. Let z be v/4 + 15/(-12). Suppose 0 = -o - 1 - 0. Is z bigger than o? False Let q be 9/(684/(-80)) - -1. Which is smaller: q or 1? q Let b be 2/(-2) + 12/3. Let s(c) = 2c - 7. Let l be s(b). Which is bigger: l or -14? l Let x = -1231/5 + 245. Let i(c) = -5c*2. Let t be i(-1). Let m be ((-8)/(-10))/(2/t). Are m and x unequal? True Let f be (1 + -1)/(6 - 4). Let x = 3 - f. Which is greater: 3/2 or x? x Let q(c) = -c + 2. Let l be q(4). Let b be ((2 + l)/(-3))/1. Is -1 less than b? True Let o = 1.92 + 0.08. Is o at least 2? True Suppose 4o = 5 - 1. Let z be 13(3 + (-40)/15). Is o greater than or equal to z? True Suppose 2j + 7 - 1 = 0. Which is bigger: j or -14/9? -14/9 Let c be (-12)/(-424)(-68)/(-30). Let p = c + -24026/265. Let d = p - -91. Do d and 1 have the same value? False Let w be (-12)/144/8. Which is greater: w or 0? 0 Suppose -3z + 6 + 2 = -4d, 4z - 8 = 4d. Let v be -2 + 2 + 1 + 2. Let n be (v/3)/((-2)/(-6)). Which is smaller: z or n? z Suppose 2 = -2f + 3j, 27 = 5f + 4j + 9. Let p(b) = -b3 + 2b*2 + 2b - 2. Let z be p(3). Let k be f/(-5) + (-2)/z. Is k <= 0? True Let r = -15/7 - -10/21. Let c = 35 - 38. Which is greater: r or c? r Let u(w) = -w*2 + 7w + 6. Let n be u(7). Let k(b) = -b*2 - 11b + 18. Let r be k(-12). Is r less than n? False Let h = -17 + 18. Let f be h + 3 + (-36)/30. Is f greater than 4? False Let f = 1/12 - 7/12. Let r be 4(-2 + (-13)/(-6)). Let g = r - 20/21. Which is bigger: f or g? g Let t be 21 - (-2 - 5). Let v = t - 8. Is -1 != v? True Suppose k - 2a = 1, -4k + 5a + 17 - 4 = 0. Which is bigger: k or 0? k Let m(h) = -h3 + 3h + 1. Let i be m(-2). Suppose 12 = -5a + 2f, -a - f - 7 = ia. Let g = 2 + a. Is -1/2 greater than g? False Let s = -38 - -35. Which is bigger: s or -0.12? -0.12 Suppose 2t = 4l - 2, 3l - 13 + 1 = -2t. Which is bigger: l or 6? 6 Let t be (6/(-20))/(6/(-4)). Let d = t + -19/20. Let y = -1 - 1. Which is smaller: y or d? y Let p(g) = g2 + 11g - 17. Let x be p(-12). Is x smaller than -8? False Let m = -6 - -11. Let p = 0 + m. Which is bigger: 4 or p? p Let w(h) = -4 + 3 - 4 - h + 0h. Let i be w(-5). Which is bigger: -10/9 or i? i Let d be 7/(-4) + (-4)/16. Let n be (-2)/(d(-1 + 0)). Let f be (4 + n)(-1)/4. Which is smaller: -1 or f? -1 Let x = -266 + 259. Let m = 1 - 2. Is x <= m? True Let c(f) = f2 + 4f + 4. Let i be c(-3). Let z be (-3 - -5)/(5/i). Let l = 2 - 2. Which is smaller: l or z? l Let w(l) = 2l3 - 7l*2 + 3l - 7. Let j be w(5). Let i = 24/299 - 73925/897. Let n = i + j. Is n > 0.1? True Let p = 9 + -3. Let a = -26 + 19. Let s = p + a. Is -0.1 > s? True Suppose -2i = 5w + 17, 0 = -5i - 0w + 3w + 4. Let v be -1 - ((2 - 1) + -3). Let z be 9 - 11 - v-1. Is z not equal to i? False Let a = -131 - -130. Let f = -1.1 + 1. Which is greater: f or a? f Let l(n) = -n*3 + 7n*2 + 8n - 8. Let r be l(8). Is -8 smaller than r? False Let p = 295/3 + -100. Does p = -3? False Let r(h) = -h2. Let c be r(1). Is 1/3 at most c? False Let v(g) = -g3 + 11g2 - 10g + 6. Let x be v(10). Let i be x/164/6. Is -1 greater than or equal to i? False Let b be (-3)/((-18)/22) - (2 + -3). Which is greater: b or 6? 6 Let d(u) = -12u - 6. Suppose -3t + 31 = -5s, -3s - t - 21 = -4t. Let g be d(s). Let y = 379/7 - g. Is 0 < y? True Suppose -3h = -5h. Let b be (2 - h) + (-1 - 1). Suppose -4t - t = b. Which is smaller: -1 or t? -1 Let c = -0.13 - -0.14. Is c greater than -2? True Let x = -7.4 - -7.6. Let p = -1 - -2. Let n = p + -2. Does n = x? False Let m = -14 - -9. Let x be ((-2)/(-2))/((-9)/(-72)). Let t = x + m. Which is bigger: 1 or t? t Let k(g) = 10g*3. Let p be k(1). Do 5 and p have different values? True Let h(z) = 0 + z + 3 + 0. Let l be h(-6). Is -3/2 < l? False Let z(p) = -p - 3. Let f be z(-3). Suppose l + l = f. Suppose -4k - 4u - 12 = 0, -2k - 3u - 10 = -lu. Is k <= -2/5? False Let w be -2((-6)/(-4) - 1). Let v = 4 - w. Suppose -vy + 3 = -k, 4y + 0 = 5k + 15. Do k and -3 have different values? False Suppose 0u + u - 19 = -3z, -8 = 4u. Is 8 at least z? True Let y = 40 - 39. Is -2/29 <= y? True Let s(b) = 0b*2 + 3b*2 + 4b - 4b2 + 0b*2 + 2. Let k be s(4). Suppose 0 = -5d - k + 7. Is -2/9 smaller than d? True Let a = 601/9 + -67. Let n be (-1)/3 + (-1182)/(-270). Let h = 40/9 - n. Is h smaller than a? False Let p be (5/(-50))/((-2)/(-25)). Is p bigger than -1? False Let h = 7 - 19. Let p be h/1456(-44 + 0). Let u = -1/13 + p. Which is smaller: -0.1 or u? -0.1 Let s(f) = -f3 + 2f*2 + 3f + 1. Let y be s(3). Let n be -1 + ((-24)/(-10) - y). Let l = 5 - 6. Does n = l? False Let r be ((-2)/(-3))/(6/9). Suppose 2 + 19 = 7i. Is i > r? True Let s = -365/33691 + -94329737/22236060. Let b = -1/330 - s. Let k = b + -4. Is 1 less than or equal to k? False Let y be -1(-557)/279 - 2. Let f = y + 851/3906. Which is smaller: f or 1? f Let u = 3.6 + 1.4. Are -4 and u unequal? True Let o = -20 - -83/4. Which is smaller: 1 or o? o Let c(n) = -n*3 - 3n*2 + 6n + 6. Let m be c(-5). Do m and -1 have the same value? False Suppose 4m = -0m + 28. Let y(p) = p*2 - 7p - 3. Let b be y(m). Which is greater: b or -4? b Let a = -2 + 1.9. Which is bigger: a or 0.08? 0.08 Let o be (-2 - -1)-1 + -22. Is o at least as big as -21? True Let b = -84 + 3278/39. Is -1 != b? True Let f be (2/(-8))/((-4)/6). Which is greater: f or -1? f Suppose -5 = -3x - 86. Which is bigger: x or -26? -26 Let v be (4/(-50))/((-5)/(-25)). Which is bigger: 0 or v? 0 Let a = 29 - 32. Is a >= 0? False Let f(a) = 2a3 + 22a*2 + 2a + 20. Let w be f(-11). Let r = 1 - 3. Let s = r - -1. Is w at least s? False Suppose 3x - 4 = b, 0x - 3x = 3b + 12. Let h be (24/(-36))/((-3)/(-18)). Do h and b have different values? False Let a = 13/10 + -2/15. Are 0 and a non-equal? True Suppose -2l = -0l - 4. Let s be l/8 - (-2)/(-8). Is s bigger than 3/4? False Let p be (-51)/7 + 4/14. Let h = -11 - p. Let c = 2 + h. Is -4/7 not equal to c? True Let j = -9 + 4. Is j greater than or equal to -4? False Let d = -117/140 + 11/20. Let r = -4 + 3. Is d < r? False Let q = 101 + -56. Let t be (((-24)/q)/4)/1. Does t = -2? False Let h = -8 - -7. Let a = h + 0.9. Are 0.06 and a non-equal? True Let v(g) = -g*2 + 11g - 13. Let i be v(9). Suppose -5y - ik - 25 = 0, 4y + k = 2k - 5. Let t = -3 - y. Which is smaller: t or -2? -2 Let t(h) = 2h - 21. Let l be t(11). Let x be (1 - -1)/(-6)-1. Which is bigger: x or l? l Let f = 1.182 - 0.182. Which is bigger: -0.45 or f? f Let n = 28.9 - 29. Does n = 1? False Let m(t) = -t*3 - 9t*2 - 7t + 8. Suppose 3p = 5p. Suppose p = -2q - 2g - 8, 3g = 5q + 31 + 21. Let a be m(q). Which is greater: a or -1? a Let v = -42 + 28. Let y be (15/(-2))/(2/4). Which is smaller: y or v? y Let z(s) = 5s2 - 4s + 2. Let a be z(2). Suppose 3h = 4g + 14, -2h + 3g + 2*g + a = 0. Let p be (h/(-3))/(6/(-27)). Which is greater: p or 2? p Let f = 21 + 183. Let m = -212.05 + f. Let v = m - -8. Which is smaller: 1 or v? v Let i = -0.96 + -3.07. Let f = 3.97 + -4. Let g = f - i. Which is smaller: -1 or g? -1 Let l = 17 + -16. Let n = 3 - 4. Let b = -2 - n. Which is greater: b or l	{ "pile_set_name": "DM Mathematics" }
-51? True Is 69/11 <= 7? True Is 4648 equal to 1/3? False Is -129 at least -129? True Is -134 equal to -133? False Is 68/23 <= 4? True Is 0 less than 12/97? True Is 10268/11 at most 932? False Which is bigger: -35 or -836/23? -35 Which is smaller: 1/16 or 39? 1/16 Is 12464 >= 12464? True Are -4016 and -4014 unequal? True Which is greater: 8 or -24? 8 Which is greater: -3/14 or -13? -3/14 Which is greater: -1 or 44/125? 44/125 Which is smaller: -13 or -31? -31 Which is bigger: 0 or 68/61? 68/61 Which is greater: -150 or -134? -134 Which is bigger: 1/2 or -15883? 1/2 Do -764 and -762 have the same value? False Which is smaller: 0 or -4/59? -4/59 Which is smaller: 310 or 308? 308 Are -38/379 and -1 nonequal? True Are -0.22 and -14 unequal? True Does 104 = 101? False Is -292 >= -1757/6? True Which is bigger: -1.56 or -1? -1 Is 0.066 at least -1/18? True Are 20 and 844/43 non-equal? True Is -2/385 less than or equal to -2? False Is 1.76 at most 0.092? False Is 417 less than 417? False Which is greater: 3/2 or 21.2? 21.2 Is 0 smaller than -1? False Which is bigger: 16/9 or 1? 16/9 Which is greater: 2 or 215? 215 Is -116/5 smaller than -23? True Which is bigger: -1233 or -1235? -1233 Which is bigger: 45 or 52? 52 Is -214 smaller than -214? False Is 51 at least as big as 54? False Which is smaller: -21895 or 0.2? -21895 Which is greater: 11.08 or 2/5? 11.08 Is -12 smaller than -3? True Is -167 >= -162? False Which is bigger: -0.2 or 431/2? 431/2 Which is smaller: -1 or 12427? -1 Which is bigger: 39 or 1/51? 39 Which is smaller: 1 or -2/14487? -2/14487 Which is greater: -1 or -1/2128? -1/2128 Which is greater: -551/3 or -184? -551/3 Is 2/2317 < -1? False Which is greater: 1 or 8/107? 1 Which is greater: 44 or 50? 50 Are 4385 and 4384 unequal? True Is -149 > -162? True Are 4/3 and -0.8 equal? False Is 2/21 < -2/3? False Is -2/3917 bigger than 1? False Is -52 bigger than -5? False Which is bigger: 1 or 7/422? 1 Is -5740/17 < -337? True Which is smaller: -1926 or -1918? -1926 Is -0.03 bigger than -26? True Is 987 bigger than 991? False Is -6 bigger than 20? False Is -1/102 != -1? True Which is greater: -1 or 4/3489? 4/3489 Is -2/3373 equal to -3? False Which is greater: 0 or 337? 337 Which is greater: 22 or 20? 22 Which is smaller: -2 or -39/20? -2 Is 5537 equal to 5537? True Is 14671 less than or equal to 14672? True Are -1 and 32/793 non-equal? True Is 441 greater than 7? True Which is greater: 6548 or 6549? 6549 Which is smaller: 16/3 or 4? 4 Is -62/17 bigger than -3? False Which is smaller: -1 or -1/163? -1 Which is smaller: 4 or 0.2? 0.2 Is -1115 at least -1114? False Is -1740 greater than or equal to -1740? True Which is bigger: 5/49 or 7? 7 Is -41 less than -41? False Which is greater: -1/2718 or -1? -1/2718 Is -2 greater than or equal to -432/11? True Are -145 and -151 equal? False Is 3 >= 42/17? True Is 81 at least 83? False Which is smaller: 44 or 136/3? 44 Is 12 greater than 12? False Which is greater: 1231/12 or 1/2? 1231/12 Is -2/107 equal to -6? False Which is bigger: -146 or -111? -111 Which is smaller: -8 or -16? -16 Is -0.007 <= -71? False Is 16 equal to 0.1? False Is -181 greater than or equal to -208? True Which is bigger: 1497 or 1511? 1511 Which is greater: -25356 or -25354? -25354 Is -97/4 less than -24? True Which is smaller: -1 or -1/39373? -1 Which is greater: -123 or -0.1? -0.1 Which is smaller: 3.585 or 0? 0 Do -12 and -13 have different values? True Is 1/124 != 0? True Are -70 and -61 nonequal? True Do -3/136 and 0 have the same value? False Is -294 != -295? True Which is greater: -9/628 or 1? 1 Does -6/7 = -402? False Which is greater: 0.3 or 3.99? 3.99 Which is greater: 0 or -24/77? 0 Is 0 > -40/67? True Is -1828/3 at most as big as -609? True Which is bigger: -1536 or -1537? -1536 Is -48/5 bigger than -409? True Is 7/43 equal to 1/4? False Which is smaller: 0 or -2/11985? -2/11985 Is -82 greater than or equal to -70? False Are 49 and 54 unequal? True Is -55 greater than or equal to -83? True Is -2156 bigger than -2157? True Which is smaller: 0.5 or 337? 0.5 Is -1 greater than -2/62193? False Is 3799 less than or equal to 3799? True Which is greater: -1 or 34/2477? 34/2477 Is -0.63 not equal to 1/10? True Is -1 smaller than -29/1287? True Which is smaller: 154 or 152? 152 Is 2/3 less than 884? True Which is greater: -83/152 or -1? -83/152 Is 27 less than or equal to 29? True Is 1 >= 253? False Which is smaller: 807 or 806? 806 Is -45 smaller than -3/7? True Is -233 less than or equal to -467/2? False Which is smaller: 2/2423 or -1? -1 Is -13/11 > 0.1? False Is -6990 less than -6989? True Which is smaller: -3/4 or 5665? -3/4 Which is bigger: 2.4 or -1/2? 2.4 Is -21 less than or equal to 26? True Which is smaller: -14 or -12? -14 Which is smaller: 840 or 3365/4? 840 Is 0 equal to -21/22? False Is 0 smaller than 14/75? True Is 1 greater than 4/1281? True Is -318 smaller than -318? False Is 2 >= 22/7? False Is 0.1 greater than -23/51? True Which is bigger: 35 or 3? 35 Are -87 and 3 equal? False Is 2168 > 2172? False Which is bigger: -11895 or -11896? -11895 Which is smaller: -740 or 40? -740 Is -124 smaller than -1? True Which is smaller: -151 or 0.5? -151 Is -1 at most as big as 2/209? True Is -139 at most as big as -11/2? True Which is bigger: -263 or -285? -263 Which is smaller: -270/13 or 0.1? -270/13 Which is smaller: -1 or -210/131? -210/131 Which is bigger: -1 or -57/17? -1 Which is smaller: 482 or 3383/7? 482 Which is greater: 0.16 or -14? 0.16 Is 10/9 greater than or equal to 1? True Which is smaller: 1 or -9/175? -9/175 Is 1/85 < 0? False Are -50 and -49 equal? False Which is smaller: 5713 or 5714? 5713 Which is smaller: -2.7 or 138? -2.7 Do 125 and 112 have the same value? False Is 2/21 > -2.47? True Which is smaller: 1981 or -1? -1 Do 11149 and 11149 have different values? False Is 0.2 less than -0.0389? False Does -26350 = -26349? False Is 3 less than -4985? False Which is bigger: 1/4 or 209.7? 209.7 Which is smaller: -5/313 or 1? -5/313 Which is bigger: 0 or 8712? 8712 Which is smaller: 3695 or 3694? 3694 Is 109 < 114? True Is -44/949 less than or equal to 0? True Is 23 smaller than 622/27? True Do 83 and 92 have the same value? False Which is greater: -17 or 779? 779 Which is bigger: -504 or -2518/5? -2518/5 Is 24429 at least 24429? True Is 1/4081 at most -1? False Which is smaller: -1 or 99/202? -1 Is -1/7455 smaller than 1? True Which is greater: 29/25 or 2? 2 Is 5114 at most 5116? True Is -2 < 9? True Which is smaller: 35 or 36? 35 Which is smaller: -6302 or -6303? -6303 Which is bigger: 323 or -7? 323 Is 0 greater than or equal to 14/81? False Which is greater: -8 or -5? -5 Which is smaller: 367/91 or 3? 3 Is -1002 less than or equal to -0.1? True Is 53 != 57? True Is -39 greater than -5? False Is 1779 != -0.3? True Are -2/5967 and -1 non-equal? True Is 711 less than or equal to 712? True Is -4 less than or equal to 92? True Is 117.83 at least as big as 0? True Which is smaller: -1 or -18337? -18337 Which is bigger: 411 or 392? 411 Does -2/671 = 1? False Which is bigger: -0.1 or 2/431? 2/431 Which is smaller: 9/13 or 0? 0 Which is bigger: 17 or 14? 17 Which is bigger: -1 or 12/47? 12/47 Which is greater: 10/391 or 0? 10/391 Is 0.1157 != 8? True Which is bigger: -0.8 or -14? -0.8 Is -6476 greater than -6478? True Which is bigger: -201 or -202? -201 Which is smaller: -1 or -3/74? -1 Is 8/23 at most 2/35? False Which is smaller: -51 or -52? -52 Which is smaller: -283 or -282? -283 Which is bigger: -56 or -48? -48 Which is greater: 0.627 or -2? 0.627 Is -93 at least as big as -94? True Do 130 and -0.1 have different values? True Does 622 = 3117/5? False Which is smaller: -1988 or 1? -1988 Which is smaller: 0 or 0.00186? 0 Is 52 < 45? False Is 9/68 smaller than 5? True Is -133 at least as big as 0? False Is 51 <= 33? False Which is bigger: -2/6149 or -1? -2/6149 Is 1 less than or equal to -4? False Is 1 greater than or equal to -1/18342? True Is -88 bigger than -92? True Are -1/19 and -8 equal? False Is -16 not equal to -15/8? True Is -540/17 at most -31? True Which is greater: -1 or 5/497? 5/497 Are -31/811 and -1 nonequal? True Are -1174 and -1172 nonequal? True Is -59 < -63? False Which is smaller: 0 or -9/3	{ "pile_set_name": "DM Mathematics" }
4v + 376v*2 + 3 + 3v*3 + 3v + 0 as bv2 + s + nv + tv3 and give s. 3 Rearrange (-1 + q + 4q - 4q)(-4 - 2 + 3) to the form uq + x and give u. -3 Rearrange k - k + k + (-k + k - 4k)(-1 + 0 - 3) + 2k - 2 + 2 to the form gk + j and give g. 19 Rearrange (-4a + 4a + 2a)(0a*2 + 0a*2 + 7a3) + a2 - a*2 + 2a*4 to oa*3 + ta*4 + ha*2 + k + na and give t. 16 Rearrange (0z3 + 0z3 + z4)(4 - 3 + 0) + 16z*4 + 3z*4 - 5z*4 + 2z*4 + 2 - 2 to nz*3 + tz + hz4 + w + sz*2 and give h. 17 Rearrange (-3h - 3h + 3h)(-2h + 0h + 0h)(2 - 2 - h) to l + xh*2 + ih*3 + th and give i. -6 Rearrange -1 + i + 1 + i + i - 4i + (-4i - 3i + 6i)(3 + 2 - 3) + 3i - 2i - 2i + 6 - 304i + 5 + 305i to the form l + gi and give l. 11 Express 55r + 5r2 - 53r - 1 + 1 as ur2 + g + wr and give w. 2 Express (-2o + 2o - 4o)(-10 - 4 + 2) as jo + t and give j. 48 Express u - 8u + 3u - 8u in the form yu + i and give y. -12 Express -2 - 2r*4 - 24r + 25r - r4 + 1 + 2r*2 in the form ar*2 + q + dr + tr4 + hr*3 and give a. 2 Rearrange -11 + 10p + 11 + (-p + p - 2p + (-4p + 3p + 3p)(3 - 2 + 1))(-2 + 2 + 3) to the form i + vp and give v. 16 Express -5 + 6 + 6 - 4 - 2f*3 as nf*2 + af*3 + gf + i and give i. 3 Rearrange ((-3u + 0u + u)(2 + 4 - 4) + 1 + 2u - 1 + (0 + 0 + 2)(3u - 8 + 8))(u2 - 2u*2 + 3u*2) to nu*3 + b + wu*2 + su and give n. 8 Rearrange (-5 + 6 + 5)(-5d + 0d + 4d)(-2 + 10 + 4) to the form ld + u and give l. -72 Express -6t2 - 3t*2 - t + 5t*3 - 1 + 7t*2 in the form ft*3 + kt*2 + y + zt and give f. 5 Rearrange -2v + 2 - 2 + (1 - 4 - 1)(-v + 3v - 4v) to the form nv + j and give n. 6 Express 153 + 6q - 153 in the form d + hq and give h. 6 Rearrange 23g + 15g - 9g - 3g2 to the form yg*2 + v + ug and give y. -3 Rearrange 0o2 + o2 + o2 + (o - 2o + 0o)(1 - o - 1) + (2 - 2 - 11o2)(3 - 2 - 3) to the form ho2 + fo + y and give h. 25 Express (3 + 0 + 3)((3 + 0 - 2)(-2 + 2 - 2u) + 54 - 9u - 54) in the form pu + n and give p. -66 Express (u - 4u + 4u)(0 + 7u + 0) + 2u - 2u2 - 2u - 3u2 - 4u2 + u2 as gu2 + lu + f and give g. -1 Rearrange 13 - 1 - 2f - 4 to t + hf and give t. 8 Rearrange 2g3 - 2g + 33 - 33 to the form v + tg + kg*2 + sg*3 and give s. 2 Rearrange 2o3 - o4 - 15o2 - o4 + 7o*2 to ao*4 + to*3 + i + lo + wo2 and give w. -8 Express -3u*4 - 13u2 - u3 + 13u2 - 2u - u*3 as iu*4 + fu + p + ou3 + ru*2 and give i. -3 Rearrange -21i - 29i - 94i to the form d + oi and give o. -144 Rearrange -618 - 12o + 618 to k + ro and give k. 0 Rearrange (-1 + 2 - 5)(-2v + 2 - 2)(-6 + 20 - 10) to rv + o and give r. 32 Rearrange -16y - 12 - 14 + 26 to q + by and give b. -16 Express -10 + 22w*2 - 24w*2 + 8 + 2w*3 as s + hw + cw3 + bw*2 and give s. -2 Express 3a*3 - 17a + 17a + (0a - 2a2 + 0a)(-2a - 2a + 3a) as d + na3 + ua + za2 and give n. 5 Rearrange -2t - 2 - 3 + 6 - 2t4 to ct*3 + y + kt + qt4 + bt*2 and give y. 1 Rearrange -69y - 70y - 4y3 - 2 + y2 + 139y to the form ny*3 + cy + jy2 + i and give n. -4 Express -25c + 12 - 19 + 7 as oc + l and give o. -25 Rearrange 34d*4 - 6d - 7d3 + 5d*3 + d - 36d*4 - 1 to qd*3 + hd + fd2 + gd*4 + s and give h. -5 Rearrange q - q + 40q*2 - 62q*2 to the form fq + u + aq2 and give u. 0 Express (-7s + 5s + 12s)(0s + 2s - 4s) - 5s2 - 2s2 + s2 in the form xs + p + zs*2 and give z. -26 Express 0p - p2 - p3 - p - 3 + p + 3p4 as o + kp*2 + fp*3 + qp*4 + bp and give q. 3 Rearrange (0 + 1 - 2)(3j - 2j3 - 3j) + 0j3 + 5j*3 + 14j*3 - 5j + 5j + 3j*3 to lj*2 + dj + h + bj3 and give b. 24 Express 340a + 274a - 467a as t + ka and give k. 147 Rearrange (-3u*2 + 31u*2 + 2u*2)(-1 + u*2 + 1) to hu + p + ru4 + ou*3 + fu*2 and give r. 30 Express (0z + z - 2z)(-3 + 0 - 1)(1 - 1 - 5z) in the form r + lz2 + qz and give q. 0 Express (377 + 210 - 282)(5 - 5 - o) in the form io + c and give i. -305 Rearrange -j*2 - 5j + 3j - 4j*4 + 4j - 2 to the form a + gj4 + wj*3 + bj + qj2 and give a. -2 Express 3t*3 + 2 + 2t*2 + 14t + 16t - 3t*4 - 28t in the form l + ot3 + mt + ft4 + wt*2 and give f. -3 Rearrange -2r*2 - 4r - 2r2 + 2r4 + r4 - 5r4 to qr*4 + tr*2 + lr + zr3 + x and give q. -2 Express -m + 23m*2 + 2m - m in the form vm + jm2 + n and give j. 23 Rearrange -m2 - 7m2 + 5m*2 + 2 to the form o + tm + cm2 and give c. -3 Express 4 - 8 + 4 - 24s as p + cs and give c. -24 Express 2k - 2k - k + (4 - 4 + 3)(-6k + 2k + 2k) + 3k - 2k + 0k in the form tk + m and give t. -6 Rearrange (0d + 4d - 3d)(56 + 44 - 37)(2d - 3 + 3) to qd + pd2 + m and give p. 126 Express -d - 13d*3 + 8d3 - d4 - 9d2 + 7d*2 in the form md*4 + g + sd*2 + id + nd3 and give i. -1 Express 4 + w2 - 2w*2 + 4w2 + w3 - 7 as d + zw3 + vw + fw2 and give f. 3 Express 111 + 2d - 111 in the form hd + i and give h. 2 Rearrange (-2r + r - r)(2r3 - r3 + 0r3) + (-r - 39 - 32 - 22)(1 - 1 - r*2)(0 + r + 0) to l + br4 + zr*3 + wr*2 + tr and give b. -1 Express (5 - 4 - 8 + (-3 + 4 + 0)(2 - 2 - 4) + (0 + 1 - 3)(4 + 0 - 2))(4l + l*2 - 4l) in the form o + vl + rl*2 and give r. -15 Rearrange (0q2 + q2 + q*2)(-2 - 1 + 1) + q*2 + 4q - 4q + (6 - 6 + 5q)(-2 - 4 + 5)(-2q + 3q - 2q) to the form d + zq + kq2 and give d. 0 Express -72z*2 + 11z*3 + 70z*2 - z + z as mz*2 + pz + s + yz3 and give m. -2 Express -186 - 19j + 186 as uj + d and give u. -19 Express (-h + 4h - 4h)(77h - 38h - 57h) in the form vh*2 + k + nh and give v. 18 Rearrange -102o + 44o*2 - 106o + 1 + 208o to x + bo + ro2 and give r. 44 Rearrange -k3 + 3k*4 - 2k*4 + 0k - k - 1 to the form gk3 + nk*2 + fk + yk4 + p and give p. -1 Express -9 + 8 + 16w*3 + 3 + 5w*3 in the form mw*3 + nw*2 + aw + g and give m. 21 Rearrange -14w - 9w + 3w to iw + r and give r. 0 Express (-4 + 3 - 2)(-2 - 1 + 0)(-5 + 5 + 5s) in the form ts + x and give t. 45 Rearrange n*2 + 3n*3 + 3n*4 - 2n*3 + 48 - 48 - 3n to the form wn3 + sn*2 + xn*4 + an + l and give a. -3 Express -z - 5z - z in the form w + az and give a. -7 Express (259 - 102 + 145)(0m*2 - 2m*2 + 3m*2) as vm + k + tm2 and give t. 302 Express (-16g*2 - 10g*2 + 21g*2 + 3 - 2g)(-1 - g2 + 1 + (-g2 + 0g2 - g2)(2 - 2 + 1)) as r + ng*4 + pg*2 + yg*3 + lg and give y. 6 Express 1 - 15h2 - 89h + 89h in the form dh + y + fh2 and give y. 1 Express -32d + 65d - 30d + 4 + 0 as nd + w and give w. 4 Rearrange (-2 + 0 - 3)(0 - 6 - 7b + 4) to v + yb and give v. 10 Express (-29 + 13v + 29)(1 - 1 - 3) in the form z + kv and give k. -39 Rearrange 10w*2 - 10w*2 - 35w*2 to rw*2 + p + dw and give r. -35 Rearrange 6p + 4p + 14p - 25p to the form cp + u and give c. -1 Express (-172s*2 + 5s - 174s2 + 348s*2)(3 + 2 - 6) as i + os + zs*2 and give z. -2 Express (20 - 25 + 2g + 18)(2g - 2 + 2) as pg + d + cg*2 and give p. 26 Express 5p2 + p2 + p*2 + 20p*2 in the form s + jp + up2 and give u. 27 Express -403 + 0q - 2q + 413 + (-q + 2 - 2)(1 - 3 + 0) - 2 + 2 + q as o + bq and give b. 1 Express (i - 5i + i)(-37 + 40i + 37) in the form si2 + ui + r and give s. -120 Rearrange (-4s + 4s - 2s)(-21 - 29 - 6604s + 6605s) to n + ts + ys*2 and give y. -2 Express 2c2 - c + c4 - c*3 + 0c*3 + 4c*3 - 2c*3 in the form xc*3 + pc*4 + gc + u + kc2 and give g. -1 Express (-7w + 1 - 7 + 3)(4 - 4 + w) as kw*2 + t + pw and give p. -3 Express -3 + 23r + 2 + 1 as dr + x and give d. 23 Express (-8x + 4433 - 4433)(2x - x + 0x) as px + u + bx*2 and give b. -8 Rearrange -6f - f*2 - 4f + 2 + 10f to the form zf*2 + c + qf and give z. -1 Express (4j3 - 3j*3 + 0j*3 - 2)(7j - 5j + 5 - j) as oj4 + pj*3 + b + qj + uj2 and give o. 1 Rearrange 12a*2 - 4a**	{ "pile_set_name": "DM Mathematics" }
se -2t = -6 + 2. Solve 0 = -tv + 4s + 12, 0v + v - 11 = 3s for v. -4 Let j(n) = n3 + 11n*2 - n - 15. Let y be j(-11). Let k be (-1)/y - (-77)/28. Solve -4f + 5h - 4h = -6, 0 = 3f - kh for f. 2 Let b = 2 + -1. Suppose 5 = k + b. Solve kd + l - 20 = 0, 0d = 2d - 3l + 4 for d. 4 Suppose p - 16 = -3q, 5q + 0 = 2p + 12. Solve 4w + q + 0 = -c, 12 = 4c + 2w for c. 4 Let g = 2 + 0. Suppose 4t - 10 = -2f, -f + 3t = -gt - 5. Solve fj = -4a - 2 - 15, a - j = 7 for a. 2 Let x(g) = g*3 + 5g*2 + 3. Let d be x(-5). Suppose 0 = -o + do - 2. Solve 3i + 3 = 0, -4r + o = -5i - 4 for r. 0 Let x be ((-5)/(-4))/(3/12). Suppose -33 + 11 = -2i - xw, 0 = -5i - 5w + 40. Solve -5d - 3o = -i, -7 - 3 = -5o for d. 0 Let u = -8 + 11. Let o = 10 - 6. Let j = 40 - 36. Solve ot + 5n + 6 + u = 0, 1 = 3t - jn for t. -1 Suppose -4s + 3s + 13 = 5u, -2s + 10 = 2u. Solve -4o - uc = 6, 0 = -4o - 6c + 3c - 3 for o. -3 Let v(g) = g2 - g. Let m(k) = -k3 - 5k2 + 6k + 3. Let n(q) = -m(q) - 3v(q). Let z be n(-2). Solve 0 = -4u - zf - 13, 2f - 3f - 15 = 4u for u. -4 Let p = -11 + 12. Let q be 10/8 - (-4)/(-16). Let t = p - q. Solve t = z - 5g - 5, -g - 6 - 9 = -3z for z. 5 Let z be (-2)/(-3)(10 - 7). Suppose 15 = 3d + zd. Solve -2x + 3x = 5, -do + 4x = 14 for o. 2 Suppose 18 = q + 2q. Suppose -qf = -11f. Solve -5 = -4p + c + 18, -4c - 12 = f for p. 5 Let k = 20 + -17. Solve 0 = -5h - 2f - kf + 10, 3h + 2f = 8 for h. 4 Let f be (-3)/18-206/4. Solve -2g - 7 = -4t - 5g, -fg - 11 = t for t. 4 Let c(l) be the second derivative of l4/12 - 4l*3/3 + 3l. Let h be c(9). Solve 0 = 2u + x, -4u = -hu - 2x for u. 0 Let w be -2 + 2/1 + 4. Suppose -3i = -4k + 36, 2k - i + 0i - 16 = 0. Solve 4u = 3d + 32, -ku = -wu - d - 14 for u. 5 Suppose -5t = -t - 24. Let b be (-5)/(-25) + t/(-5). Let d(l) = -3l - 1. Let z be d(b). Solve -3f = -2j - 1, -10 = zj + 4f - 2 for j. -2 Let r be (-1 + 1)/(-2 - 0). Solve h + 3x - 15 = r, 2x - 10 = -0h - 4h for h. 0 Let s = 3 - 1. Let w(y) = -y*2 + 0y + y + 0y - 6y. Let d be w(-5). Solve 4f + d = 2o - 10, 5o = f - s for o. -1 Let f = -18 + 29. Suppose h - u = 4h - f, u - 5 = 0. Solve 5g = -5n + 1 + 4, g - 2 = -hn for g. 0 Let r(w) = w3 - 13w*2 + 13w - 11. Suppose 0o - 3o = -5g - 26, 2o - 22 = g. Let x be r(o). Solve -3i = -5h - x, i - 4h + 1 = -1 for i. 2 Let s(z) = -z3 + 10z*2 + 11z + 3. Let l be s(11). Solve -2h = 5c + 6, -5c = -lc for h. -3 Suppose 3t - 56 = -t. Solve -n = 5f - t, -5f = -3n - n + 6 for f. 2 Let h = 19 - 2. Solve 2k - 1 - h = 4u, 0 = 4k + u + 9 for k. -1 Suppose 3z - 5z - 3x + 5 = 0, 4z - 22 = -2x. Let i(h) = 2h3 + 20h*2 - 22h + 4. Let w be i(-11). Solve z = -f - n, -2 = wf - 2f - 4n for f. -5 Let a = 11 + -6. Suppose 0 = 2z - 2b + b + 2, -ab + 10 = 3z. Solve z = -c - 5s + 21, 4c + 0s - 16 = -3s for c. 1 Suppose 3c - 2 = 7. Solve 3y = v - 13, cv = -2y - 6 - 10 for y. -5 Let g(r) = 5r3 + r2 + 7r - 2. Let j(s) = 4s3 + s2 + 6s - 2. Let k(b) = 5g(b) - 6j(b). Let v be k(0). Solve 4h = 16, vd + 6h - h - 26 = 0 for d. 3 Let p = -71 + 71. Solve p = 5v + 5c - 20, -2v - 15 = -3c + 2 for v. -1 Suppose -3f + 17 = 2d, 2f - 18 = -0d - 3d. Solve -dc - c - r + 26 = 0, 2r = -3c + 17 for c. 5 Let x(g) = -g - 11. Let m be x(-9). Let f be (m - 1)(-2 + 0). Solve 4b - f = -5s, 5s - 4 = 3s for b. -1 Suppose 4r + 15 = 3. Suppose 0 = 4l + 23 - 3. Let t = r - l. Solve 0 = tf + 3f - u - 9, 0 = 4f - 5u - 3 for f. 2 Let c(x) = 2x*2 - 5x - 9. Let g be c(4). Solve 3b = -3t - 21, 2t = 5t - gb - 9 for t. -2 Let q(p) be the first derivative of -p3/3 + 5p*2 + 10p + 3. Let l be q(9). Solve z = 4d + 6 + l, 5z = -5d for d. -5 Let h(q) = -q2 + 4q + 5. Let i be h(4). Suppose -iu + 4 = -u. Solve 3k = -2j - 15 + u, 2k = 4j + 12 for j. -4 Suppose 0 = -0y - 4y. Let d(a) = 2a + 8. Let s be d(-2). Solve -k - 15 = 4k, -4l - sk - 24 = y for l. -3 Let f = -42 + 47. Solve 5i - 5 = -3n, -5i = -0i - f for n. 0 Suppose 5d - 23 = -2n, 2d - 1 - 9 = -n. Suppose 3l + 3k + 2 = l, dl - 7 = -2k. Solve 19 = 4h + li, -4 = 5h - i - 2i for h. 1 Let h(i) = i*3 - 4i*2 + 9. Let v be h(3). Solve -2l = -4n + 26, vn - 22 = -l - 5n for l. -3 Suppose -z + m = -1, 5m + 1 + 4 = 0. Solve 2r + l - 9 = z, 1 = -2r + 3r - 3l for r. 4 Suppose 4w = -2s + 30, -w - w = -5s + 15. Solve 3q - 4 - 7 = sj, 3q + j - 5 = 0 for q. 2 Suppose -4u = -2r + 18, 2 = -3u - 1. Solve k - r = 5y + 6, 2k + 5y + 19 = 0 for k. -2 Let d be (1 + 51/6)12. Let t be d/10 - (-4)/(-10). Let v be 4/22 + 20/t. Solve c = -4k + 4c - 15, 0 = vk + 5c - 25 for k. 0 Suppose 7 + 5 = 3l. Solve -6f = -f + 25, -4f - l = -4j for j. -4 Let y(u) = u2 + u + 2. Let t(r) = -r. Let o be t(2). Let f be y(o). Suppose 0 = d + 4z - 2 - f, -5d + 30 = 2z. Solve 2h + d = -3l, l + h + 3 = 3l for l. 0 Let b be 79/((-252)/(-80)). Solve 0 = -4d + 4j - b, -2d + 5j = -3d + 19 for d. -1 Let d(p) = p3 - 5p*2 - 4p + 2. Let y be d(5). Let w = 22 + y. Solve wm + 8 = -o, -m + 5 = -0o + 2o for o. 4 Suppose 5b = 3q + 3 + 9, 3b = -3q + 12. Let c = 0 + b. Suppose -3o + 3w - 2 = 4, 21 = 2o + cw. Solve n + 6i = oi - 8, i = 3n + 4 for n. -2 Suppose 6t = 3t + 15. Solve -4w - 4n = 12 + 8, -3w - tn - 15 = 0 for w. -5 Suppose 4g = c + 15, 4g - 13 = -5c + 2g. Solve -3p - j + 2 = -3, -3j = p + c for p. 2 Let x(z) be the second derivative of z*4/12 + 2z*3/3 + 3z*2 + 3z. Let c be x(-5). Solve -2h - 9 = -3q + 2, -2q + 5h + c = 0 for q. 3 Let t(j) = j - 10. Let f be t(14). Solve -5a = 2v + 9, a + f = -3v - 3 for a. -1 Let p be 3/(-21) - (-110)/35. Solve -k - pk - 2c = 20, -3c = -3k - 6 for k. -4 Let o = 3 - -2. Solve y = 5j + 17, 2j - y = -o - 3 for j. -3 Let p be (-1)/1(-12 - -9). Solve 4s = 12, 5l + 8s = ps + 20 for l. 1 Let b be -1(1 + -1 + -4). Solve 5t = -4s - 40, s + b = -t - 5 for t. -4 Suppose -4h = -h - 12. Let y be ((-1)/2)/(2/(-20)). Solve -1 - 7 = -yg - hx, -3 = x for g. 4 Let i(m) = -m*2 - 11m - 4. Let w be i(-8). Solve 4v + w = -4o, 0v = o - 4v for o. -4 Let j be 6/(4 + (-3 - 0)). Solve -j = g - q, -5g - 22 = -q + 4q for g. -5 Let g be -3(-2)/(-3) - -5. Let j = -8 + 11. Solve 28 = -4c - 5o, -go - 2o - 14 = -jc for c. -2 Let s be 0 - -1 - (3 + 2). Let m be (-22)/s - (-1)/(-2). Suppose 6h - 4h = mz - 13, -h = 2z + 2. Solve 4v - g = -4, 4v + 3 + z = 4g for v. -1 Let m(w) = -w3 - 5w*2 - 6w - 6. Let j be m(-4). Suppose 2t - jr = r + 69, 4r = -4t + 88. Solve v - 5c + 0 - t = 0, 2c = -10 for v. 2 Let c(m) = -m*2 + 14m - 20. Let g be c(12). Solve 4u - 17 = 3o, gu = -5o + 2o + 23 for u. 5 Let v(q) = q3 + 3q*2 + 4q + 7. Let g be v(-5). Let a be g/(-6) + (-1)/(-2). Let x = -6 + a. Solve -2 = b - j, xb + 9 = 2j + 2j for b. -1 Suppose 0 = -7i - 3i. Solve p - 2u = 6, i = u + 5 - 0 for p. -4 Suppose -2l - 8 = -3l. Suppose 8 = 4q - 4m - l, 2q + 3m = 3. Solve -8 = u - n, -u = -4u - qn + 6 for u. -3 Let v(w) = 3w + 1. Let x be v(-1). Let u be x(-3)/(-2) - -3. Suppose -5m = 2r + 6 - 2, 4r - 5m - 22 = u. Solve 0 = 4c + y - 15, -4y = rc - 7c for c. 3 Let y be 24/1(-3)/(-4). Let p be 2 + (2 - 4) + -2. Let z be -2p/((-4)/(-2)). Solve -3n + 5x = -2n + 1, -zx - y = -5n for n. 4 Let q be 3/2(-1 + 3). Suppose qx - 19 = -4. Solve -z + c + c + 5 = 0, xz = -3c - 1 for z. 1 Let b = -6 - -4. Let u be (2 + -12)(-3 - b). Suppose -2c + 8 = -0c. Solve cv = 2k - u, 4v - 2k + 5 = v for v. -5 Suppose -v - 6 = -3v. Solve 5i + 15 = 5j, -3i - 5 = -vj - i for j. -1 Let d(q) = -q2 + 11q + 14. Let v be d(11). Solve 2u - 13 = u + 2f, 0 = 2u - f - v for u. 5 Suppose 0 = 4v - n - 8, -2v + n - 1 = -v. Suppose h + 9 = -2. Let c = h - -13. Solve vz + 12 = -z, 0 = cu + z + 11 for u. -4 Let a be -4(-5)/600. Solve t + 2u + 18 = -4t, -5t - 5u - 15 = a for t. -4 Let i(g) be the first derivative of -g3/3 + 5g*2/2 + 2g + 2. Let q be i(5). Suppose qy + y = 60. Solve -p + 4 = 4k + y, -p = 0 for k. -4 Let k(d) be the first derivative of d3/3 + d2/2 + 15d + 2. Suppose -3r	{ "pile_set_name": "DM Mathematics" }
-h5/60 - h4/24 + 2h3/3 + 27h2 + 1. Give u(4). -16 Let z(p) be the second derivative of -p4/12 - 2p3/3 - 5p*2/2 + 67p. Give z(-2). -1 Let r(q) = 36q - 2. Let o(d) = -7d - 1. Let f(p) = 4o(p) + r(p). Calculate f(3). 18 Let n(j) = j. Let c(t) = -20t*2 + 22t + 20. Let p(x) = -8x2 + 9x + 8. Let h(r) = 5c(r) - 12p(r). Let i be h(2). Determine n(i). -8 Let u(v) be the first derivative of -v*2/2 + 13v + 273. What is u(7)? 6 Let a(p) = 10p2 + 16p2 + p3 + 3 + 4 + 1 - 2p - 22p*2. Give a(-5). -7 Let w(q) = 3q*2 + 5q + 12. Let h(j) = 17j2 + 25j + 61. Let s(t) = -2h(t) + 11w(t). What is s(6)? 4 Suppose d + 4z = 49, -5d - 4z = -284 + 39. Let v(n) = -25 + d + n2 + 2n - 22 + n. Determine v(-2). 0 Let j(i) = 24i - 14. Let b(y) = -8y + 5. Let r be -4 - (8/(-2) - 3). Suppose 0t = -rt, 0 = 3d - 5t - 12. Let a(u) = dj(u) + 11b(u). Determine a(-1). -9 Let x(q) = 5q2 + 11q - 5. Let n(r) = r*2 + r - 2. Let a(b) = 6n(b) - x(b). Determine a(6). -1 Let b be (-48 - -49) + (2 - 10). Let v(s) = -s*3 - 7s*2 - 2s - 9. Calculate v(b). 5 Let x = -11 - -5. Let h(f) be the second derivative of f*3/6 + 4f*2 - 598f - 2. Calculate h(x). 2 Let z(j) = 31j - 11. Let p(u) = -19u + 6. Let n(f) = 5p(f) + 3z(f). Determine n(6). -15 Let i be (2/(-3))/(6/(-72)). Suppose 0 = -ix + 10 - 50. Let m(h) = h + 10. Give m(x). 5 Let t be (16/(-96))/(3/(-18)). Let h(i) = -9i3 + i2 - i + 2. Give h(t). -7 Let x(g) = 5g + 18. Let l(m) = -7m - 19. Let q(u) = 2l(u) + 3x(u). Calculate q(-7). 9 Suppose -4a + 2g - 5g = -53, 2g + 58 = 4a. Let v(x) = -2x + 21. Give v(a). -7 Let a(g) be the third derivative of -g4/12 - g3/6 - 4g2. Let c(h) = -8h. Let i(j) = -3a(j) + c(j). Give i(-4). 11 Let d(o) = -o2 + 3o + 48. Let h be d(9). Let w(s) = s + 10. Give w(h). 4 Suppose 0 = -5o + d + 10, 0 = o - 3d - 0 - 2. Let w(l) = -2l2 - l - 2. Give w(o). -12 Let j = -47 - -51. Suppose 2z - 5 = 3x, -4x + jz = -0z. Let w(n) = -n*2 - 6n - 3. Give w(x). 2 Let h(q) = -7q - 5. Let x(f) = -2f + 16. Let k be x(5). Let o(a) = -4a - 4a + 5a - 3a - k. Let s(b) = 5h(b) - 6o(b). Give s(-9). 2 Let k(b) = -b*3 + 4b*2 + 3b + 7. Let p be 36/(-6)2/(-2). Determine k(p). -47 Let y(f) = 4f*3 - 4f*2 + 4f + 4. Let x(u) = u*3 + 1. Let p be x(1). Let w(z) = 9z*3 - 8z*2 + 9z + 9. Let r(a) = pw(a) - 5y(a). Determine r(2). -6 Let t(h) = -h + 7 + 1 - 2. Give t(0). 6 Let s(y) = y*2 - 5y - 1. Let v(l) = -l*2 - 6l - 2. Let d be v(-2). What is s(d)? 5 Let t(s) = 385 + s - 3s - 388. Suppose 2a - 9 - 1 = 0. Let v(g) = -3g - 4. Let x(z) = at(z) - 4v(z). Calculate x(-1). -1 Let s(p) = 7p*2 - 14p + 25. Let g(w) = 5w2 - 13w + 25. Let b(h) = -3g(h) + 2s(h). Give b(11). -25 Let v(y) = -12y. Let n(c) = c. Suppose -4o - 4 = 3m + m, -3o = m - 3. Let a(s) = ov(s) + 20n(s). Let b(w) = -19w + 510. Let f be b(27). What is a(f)? 12 Suppose -4q + 32 - 16 = 0. Let y(h) = -h*3 + 2h*2 + 4h - 6. Determine y(q). -22 Suppose 0d + 8 = 8d. Let m(c) = -31c2 + 1. Give m(d). -30 Let z(y) be the first derivative of -y3/3 + 5y*2/2 + 6y + 1. Let v be (-1)/(-3) - (-20)/(-6). Let a = v - -8. What is z(a)? 6 Let u(c) = -17c2 - 17c + 20. Let o(i) = -12i2 - 11i + 13. Let t(j) = 7o(j) - 5u(j). Calculate t(-8). -9 Suppose -4b + 4w + 1228 = 0, -2w = 5b - 5w - 1545. Let n(l) = b - 6l - 154 - 154. Determine n(4). -20 Suppose 19r + 22 - 3 = 0. Let m(j) = -28j - 4. Let v(o) = 19o + 3. Let b(u) = 5m(u) + 7v(u). Calculate b(r). 8 Let n be (112/161)/8 - (-67)/23. Let b(w) be the second derivative of -2w*2 + 1/2w*n + 0 - 4w. Determine b(4). 8 Let v(o) = 6o + 23. Let t be v(14). Let y = -113 + t. Let l(b) = 2b - 2. What is l(y)? -14 Suppose -2b = b - 63. Let u(l) = -4l*2 - 58l - 7. Let f be u(-14). Let q(y) = y*2 + 3y - 4y - f + b. Give q(3). 6 Let p be (-48)/15 + 3/15. Let y(a) = a + 8. Let n be y(-6). Let u(b) = 3bn + 4 - b2 + b*3 + 0b - b - 2b. Calculate u(p). 4 Let a be (5 - 3)(-13)/(-2) - 1. Let l(m) = -m*2 + 11m + 14. Give l(a). 2 Let b(h) = -38 - 40 - 34 + h + 112 + 8h3. Give b(-1). -9 Suppose -2n + 7 = -3s, -56n - 6 = -57n - s. Let c(t) be the third derivative of 0t + 0t4 + 1/6t*3 + 4t*2 + 0 + 1/10t*n. Determine c(1). 7 Let g(l) = 3l. Let x(w) = -10w. Let q(p) = -7g(p) - 2x(p). Suppose 5f - f - 24 = 0. Let b = f - 7. Calculate q(b). 1 Let g(y) = -11y + 11. Let t(o) = -2o + 1. Let i(p) = g(p) - 6t(p). Calculate i(-6). -1 Let q(d) be the first derivative of -3d*2 - 4d + 19. Calculate q(-3). 14 Let m be 46/6 - 6/9. Let w(g) = -10g - 6. Let i(h) = -3h - 2. Let c(q) = 7i(q) - 2w(q). Calculate c(m). -9 Let j(m) = -5m. Let w(p) = -7p. Let n(s) = 2j(s) - 3w(s). Calculate n(-1). -11 Let j(w) = 10w2 + 3w + 12. Let x(t) = t*2 + t + 3. Let b(d) = j(d) - 4x(d). Determine b(1). 5 Let r(y) = 2y - 8. Let i be r(7). Suppose -15k + 13k = i. Let m(u) = u - 4. What is m(k)? -7 Let g be 0 + 43 - (3 + 2). Let q = 42 - g. Let t(v) = 5v*2 - v + 1. Let s(z) = 6z*2 + 1. Let r(f) = -4s(f) + 5t(f). Calculate r(q). -3 Let s(k) = 61k + 69k - 200k + 10 + 69k. Determine s(-7). 17 Let a(i) = i - 2. Let n be a(7). Suppose 6d = nd + 4. Let m(t) = -3t + 4t + d + 0t. Calculate m(-6). -2 Let d(h) = -2h2 + 20 + h + 2h*3 + 3h2 - h3. Suppose 2z = 6z - 8z. Determine d(z). 20 Let n(a) be the first derivative of -14a*3/3 - 3a*2 + a + 1. Let z(b) = -27b*2 - 11b + 2. Let j = 65 - 71. Let r(u) = jz(u) + 11n(u). Calculate r(-1). 7 Let y(i) = -i*3 + 11i*2 - 17i + 8. Let s = -1497 + 1506. Give y(s). 17 Let k(m) = -m*2 - 9m - 2. Let l(o) = -5o2 - 9o + 6. Let d be l(-5). Let t = 66 + d. What is k(t)? 6 Let g(x) = x*3 - 12x*2 - 9x + 1. Let m(w) = 2w2 + 2w. Let r(z) = g(z) + 3m(z). Calculate r(6). -17 Let v(o) = 106o*2 + 2o - 32. Let y(s) = 159s2 + 3s - 51. Let k(i) = 8v(i) - 5y(i). Determine k(1). 53 Let v(h) = 2h + 6. Let c = -22 + 4. Let j be 24/(-108) + 104/c. Determine v(j). -6 Let h(p) = -p3 + 5p*2 - 3. Let o(d) = -4d*3 - 6d*2 - 5d + 2. Let l be o(-1). Give h(l). -3 Let t(n) be the second derivative of -n4/12 + n3/6 + 5n2 - 6n. Let x be t(3). Let f(k) = -k*3 + 5k*2 - 6k + 2. What is f(x)? -6 Let d = -31 - -36. Suppose 5n - n + 36 = dw, 0 = -3n - 4w + 4. Let z(o) = -o*2 - 6o - 5. Determine z(n). 3 Let q(p) = 3p + 13. Suppose 0 = 5w + m + 34, 40 = -4w - 3m - m. What is q(w)? -5 Suppose -3 + 9 = -d. Let v(y) = -y*3 - 11y*2 - 9y + 11. Let c be v(-10). Let t(j) = -2 + 5j - 6 + j2 + c. Determine t(d). -1 Let j(c) = 2 + 0c3 + 4 + c3 - c. Let v(b) = -25b. Let y be v(-1). Suppose -3a - 4 = -u + 1, 0 = -5u + y. Determine j(a). 6 Let p(c) = -3c + 2. Let x(r) = -r + 3. Let j(v) = -2p(v) + 3x(v). Calculate j(0). 5 Let a(g) be the second derivative of -1/2g3 + 10g + 0 - 1/2g2. Calculate a(-1). 2 Let n(u) = -u + 7. Let x(r) = -5r + 20. Let o(w) = -6n(w) + x(w). Calculate o(-16). -38 Let z(q) be the first derivative of q4/4 + 11q*3/3 - 13q*2/2 - 2q - 1. Give z(-12). 10 Let n(f) = 3f2 + 19f + 18. Let k be n(-5). Let q(r) = 18r. Determine q(k). -36 Let b(h) = -h3 - 8h*2 - 8h - 7. Suppose 4z + 3t = -2t - 35, -9 = 3t. Let w(r) = r*2 + 5r - 7. Let p be w(z). Calculate b(p). 0 Let o(w) = w*2 + 11w - 9. Let l(k) = k*3 + 4k*2 - 4k - 6. Let j be l(-5). Calculate o(j). -9 Let o(x) be the second derivative of x4/12 + x3 + 11x2/2 - 408x. Give o(-9). 38 Let c(t) = 7t - 2. Let b(a) = -a + 1. Let f(x) = -6b(x) - c(x). Give f(6). -10 Let q be -3(595/(-3))/(-5). Let g be 18/81 + q/9. Let a = g + 7. Let v(t) = -t3 - 7t*2 - 6t + 6. What is v(a)? 6 Suppose 4c - 8 = 2c. Let r(h) = 0h - h3 - c - 2 - 1 + 6h + 5h2. Let w = -22 - -28. Calculate r(w). -7 Let p(x) = -x2 + 3x + 3. Let a = 767 - 764. Give p(a). 3 Suppose 27j = 26j - 5. Let r = -5 - 0. Let u(k) = k*2 + 5k. Let x(a) = -1. Let w(f) = rx(f) + u(f). Give w(j). 5 Let o(y) = 3y*2 + 16y - 2. Let z(l) = -4l2 - 18l + 3. Let i(t) = 5o(t) + 4z(t). Calculate i(8). 2 Let j be 679/(-420) - (-75)/45. Let g(z) be the second derivative of 0 - 8z + 0z*2 + 0z**3 - 1/1	{ "pile_set_name": "DM Mathematics" }
? -4/3 Suppose -10 = 5t - 3o, 3t - 2o = -4 - 3. Let g = 2104/13 + -162. Which is the nearest to t? (a) g (b) 2/7 (c) 0.3 c Let m = 4.2 + -3.7. Which is the closest to 2? (a) 2/17 (b) m (c) 5 b Let f = -28 + 27. What is the nearest to f in 3, -4, -3? -3 Let h(d) = d*2 + 8d - 6. Let y be h(-9). What is the nearest to 0.5 in 0, -1/4, y? 0 Let c = -3.27 - -2.8. Let m = 0.03 - c. Let s = 2 + -2.1. What is the nearest to 1/2 in 0.1, s, m? m Let k be 2250/(-21) - (-4)/14. Let w = 107 + k. Let m be 2/9 - (-19)/(-45). What is the closest to -1/2 in m, w, -5? m Let o = 5.001 + -0.001. What is the closest to 2 in o, 1/4, 0.5? 0.5 Let u = -0.39 - -0.29. What is the closest to 2 in 4, u, 5? 4 Let j be (-2 + 44/24)/((-35)/10). What is the nearest to 0 in -0.5, j, -4? j Let w = -0.3 + 6.3. Let d = w + -3. Let b = -8 + 4. What is the closest to 0.1 in b, 0.2, d? 0.2 Suppose 33 = 4f - 3l, 4l + 4 = f - 1. Let h be 2 + f/(-2) - -1. What is the nearest to 2 in -4, 0, h? 0 Let i = 8 - 6. Let j = -1 - i. Let k be 4/(-1) - (-4 - 0). What is the nearest to k in -1/6, 2, j? -1/6 Suppose 9 = 4j - 15. Suppose 6 = -3o + 6o + 3t, -j = -5o - 3t. Let v be ((-2 + 4)1)/3. Which is the closest to 0.1? (a) o (b) 0.4 (c) v a Let y = -14 - -9. Let o = 0.2 - 0.3. Let t = o - 0. Which is the nearest to -1/2? (a) y (b) t (c) -1 b Let w = 1.8 - -3.28. Let m = w + -0.08. What is the closest to 0.2 in -4, m, 0? 0 Let q = -5 + 5. Let f = -14099/35 - -1962/5. Let h = -10 - f. Which is the closest to q? (a) h (b) 1 (c) 3 a Suppose -5x + 14 = 3a, 8 = -2a + 4. Let d be (-6)/(-3) - (-33)/6. Let c = 7 - d. What is the nearest to c in x, 0, 4/9? 0 Let v = -31 + 31.5. Let f(c) = c3 - 3c*2 - 7c - 1. Let j be f(5). Let x be ((-2)/j)/((-1)/2). What is the closest to -0.1 in x, -3, v? x Let m = 2/41 - -158/123. Which is the nearest to 0.1? (a) m (b) 1 (c) -1/7 c Let z = -73 - -68. Which is the closest to 0? (a) -0.4 (b) z (c) 2/9 c Let t = 0.3 + -0.2. Let v = 9 + -4. Let m(d) = d*3 - 4d*2 - 4d. Let k be m(v). Which is the closest to t? (a) k (b) -3 (c) -0.2 c Let n = -0.01 + 2.01. What is the closest to -0.1 in -3, n, -4? n Let l = 211 - 212.09. Let p = -0.09 - l. Which is the nearest to 0.1? (a) 2/7 (b) 0.1 (c) p b Let g = 5 + -5.3. Let h = -0.09 + 0.07. Let f = h - -2.02. Which is the closest to f? (a) -4 (b) g (c) 0.4 c Let z = -10.7 + 10. Let a = z + 0.3. Let i be (2/(-5))/((-7)/5). What is the nearest to i in 0.1, -0.5, a? 0.1 Let r = 21/11 + -85/33. What is the nearest to r in -2/21, -5/3, -5/2? -2/21 Let n(o) = o*3 - 4o*2 - o + 4. Let z be n(3). Let u = z + 9. What is the nearest to u in -2, 0.3, -1/3? 0.3 Let j = 0.3 + -0.4. Let m be (-1 - (0 - 1)) + -2. Let k be 6/8m/(-6). Which is the nearest to 0.1? (a) -2/17 (b) k (c) j b Let h = -10 - -14. Which is the nearest to -2/7? (a) h (b) -2 (c) -1/6 c Suppose 0 = 8w - 558 + 526. Let n = -178/171 - -24/19. Which is the closest to 0.1? (a) 5 (b) w (c) n c Let d = -28 - -28. What is the closest to d in 0.1, 1/2, 2? 0.1 Let c be 11/(-33) + 5/((-30)/(-4)). What is the closest to c in 1/4, 0, 0.4? 0.4 Let w = -0.4 + 0. Let t = -7.83 + -0.17. Let h = 8.3 + t. Which is the nearest to 2/7? (a) 0.4 (b) w (c) h c Let z = -2.7 - -4.7. What is the nearest to -1/2 in 0, z, 0.3? 0 Let g = 4 - 4.1. Let d = -642/5 + 128. Which is the closest to g? (a) 3 (b) -1/5 (c) d b Let t be 24/(-32) + (-6)/(-8). Which is the closest to t? (a) 4/3 (b) 5/2 (c) -0.6 c Let t = 24 - 22. Which is the closest to -0.06? (a) -2 (b) 1/6 (c) t b Let i = 6/25 + 13/50. Which is the nearest to i? (a) -4 (b) -2/9 (c) -1/2 b Let n = 33 + -29. What is the closest to -1/2 in n, -2, 0? 0 Let d = -0.7 + 1.5. Let o = d - 0.6. Let k = -1 - -1. Which is the closest to k? (a) -3 (b) -0.4 (c) o c Let i = 3997/3 - 1344. Let v = i - -12. Which is the closest to 1? (a) -1 (b) v (c) 5 b Let r = -11 - -9. Which is the closest to r? (a) -3 (b) 6/5 (c) -0.3 a Let q = -0.57 + 0.07. Let y(h) = -h3 + 6h*2 - h + 6. Let w be y(6). Which is the closest to w? (a) -2/15 (b) -0.4 (c) q a Let q be 9/12(-2)/(-6). Let s be (6 + -12)/(0 - 2). What is the nearest to q in -0.3, s, 5? -0.3 Suppose 0 = -3j + 2j + 3. Suppose -2b = b - 3. Suppose -ji + b = 7. What is the nearest to 0 in i, -0.2, 0.5? -0.2 Let z = 4.4 + -4.4. What is the closest to z in -0.3, -0.2, 0.1? 0.1 Let z(n) = -n + 1. Let p be z(-5). Let l(k) = -k3 - k2 + k - 4. Let g be l(0). Let r = p + g. Which is the closest to -1? (a) r (b) 5 (c) -1 c Let o = -6 + 6.8. Let j = -0.4 + o. Let s = 0.2 - -0.8. Which is the closest to s? (a) j (b) -0.3 (c) 0.2 a Let l = 0.6 - 0.7. Which is the nearest to l? (a) 0.1 (b) -2 (c) -2/5 a Let u be (-476)/595 + (-2)/(-10)4. Let z(o) = -o3 - 4o*2 - o. Let l be z(-4). Which is the closest to -1? (a) u (b) l (c) 1/4 a Let t = 4 + -3. Suppose 4u - 24 = 2d, -u - 5 = 2d - 11. Let f be (-1 - (-2 + 3)) + u. Which is the nearest to -1? (a) t (b) f (c) -0.4 c Let m = 0 - -1. Suppose 16 = -4j + 4c, j + c + c = -1. What is the nearest to j in -1, m, 0.4? -1 Let n = -2 - -1. Suppose 4i + 0i + 5g + 45 = 0, -15 = 3g. Let f be (-2)/65/i. Which is the nearest to n? (a) -1 (b) 0 (c) f a Let d = 0.05 + -20.05. Let k = 20 + d. What is the nearest to 1 in k, 1/5, 1/2? 1/2 Let k(z) = -z + 1. Let j be k(-4). Suppose 2x = -3f - 19, -5f + j = -x + 28. Let s be 34/(-8) - x/8. Which is the nearest to -2/5? (a) 3 (b) -1 (c) s b Let d be (-2)/(3(-2)/(-6)). Let m = 0 - 0.1. What is the nearest to -0.1 in -3/7, d, m? m Let o = -33 - -101/3. Let q = -629/90 - -62/9. Let r = 1/10 - q. Which is the closest to o? (a) 4 (b) r (c) -0.4 b Let b = -26 - -28. What is the closest to b in -5, 2/13, -0.2? 2/13 Let k = 10.4 + -10. Let f = k - 0.3. What is the closest to f in -2/5, -1, -1/5? -1/5 Let p be (-3)/3 - (-21)/15. Let t be 41/((-8)/(-6)). Which is the closest to 0.1? (a) t (b) p (c) -1 b Let h = -14.8 - -15. Which is the nearest to 1? (a) 3 (b) h (c) 0 b Let q be (660/(-48) - 2/8) + 2. What is the nearest to -2 in q, -0.5, 0? -0.5 Let b = -2.56 - 0.34. Let t = b + 0.9. Let k be 1/(-4) + 3/(-20). What is the nearest to -2 in 5, k, t? t Let g be (252/(-435))/((-27)/(-10)). Let t = -2/261 + g. What is the closest to 0.1 in -0.2, t, -0.1? -0.1 Let v = 768/7 + -110. Let y = 46 + -45.73. Let x = -0.47 + y. What is the nearest to v in 1/4, 5, x? x Let g(k) = k + 9. Let b be g(-7). Let u be b/(-13) + 24/663. What is the closest to -2 in u, -3, 1/5? -3 Let r = -128 - -122.1. Let t = 6 + r. Let m = 1 + -1. Which is the nearest to m? (a) t (b) -0.3 (c) -3/8 a Let w = -52 - -52. What is the nearest to -1 in w, -1/4, -4? -1/4 Let t be 3/1 + (-7)/3. Which is the nearest to t? (a) -2/3 (b) 4 (c) -0.3 c Let c be (-6)/10 + (-2)/(-5). Let i = -3.2 + 3.3. What is the closest to i in 1/3, -1, c? 1/3 Let g = 2.064 - 0.064. Suppose 0t + t = 3. Let h = 1 - 1.1. Which is the nearest to h? (a) g (b) 3/5 (c) t b Let v = -66 + 70.1. Let o = v + -4. What is the closest to 0 in -2, o, 4? o Let f = -0.8 - 0.2. Let t = -0.4 - -0.3. Let y = t - 0. What is the closest to y in -2/19, f, 5? -2/19 Let l = -9 - -11. Suppose y - 2 = l. Which is the nearest to y? (a) 1 (b) -5 (c) -1 a Let g = -5.86 + -0.14. Let s = 7 + g. Which is the nearest to 0.1? (a) -3 (b) -5 (c) s c Let s = 0 + 0. Let g = 1/2 - -5/6. What is the closest to -0.1 in g, s, 2/3? s Let f be (24/(-504))/(1/6). Suppose -4n = w - 7, 5n + 4w = w. What is the closest to -1/2 in f, 2, n? f Let x = 10 - 9.6. Suppose 3q - 91 = 2q. Let z = q + -461/5. Which is the nearest to 1? (a) 1 (b) z (c) x a Let b = -12.5 - -13. Let l be (-3)/(-9)(2 + -1). Let r = -0.3 + 0.2. What is the closest to 2/7 in l, b, r? l Let l = -1 - 0. Let m = -0.442 + 3.442. Which is the closest to 0.1? (a) 3/4 (b) m (c) l a Let d = 98 - 95. Which is the nearest to -1? (a) d (b) -2 (c) -0.1 c Suppose 2g + 16 = 8. Let o = 2 - 2.1. What is the closest to -0.1 in g, o, -0.5? o Let z = 103/26 + 46/13. Which is the closest to -1? (a) 2/23 (b) 0.2 (c) z a Let m = 4.1 + 0.9. Suppose u + 26 = -2q - 3q, -4q = -4u + 16. Which is the closest to 1? (a) 1/3 (b) m (c) u a Let	{ "pile_set_name": "DM Mathematics" }
Let v = 8370 - 6945. What is the units digit of v? 5 Suppose -g - 2 - 1 = 0, 0 = -3p - 5g + 183. Suppose -2t - 149 = -3t - 3u, 665 = 5t - u. Let f = t - p. What is the tens digit of f? 6 Suppose -11c = -14c. Suppose b - 4o = 461, -5b + 14o - 9o + 2230 = c. What is the tens digit of b? 4 Suppose 15j = 13j + 1100. Let d = j - 216. What is the units digit of d? 4 Suppose 2425 = -4j - 2m + m, -4m + 1190 = -2j. What is the hundreds digit of 11/(j/(-29117)) - 2/5? 5 Let j(c) = 5c - 6 - 2c - 9c + 23. Let f be j(2). Suppose fd - i = 1007, d - i = -3d + 805. What is the hundreds digit of d? 2 Suppose 5n - 12874 - 5481 = u, 4n - 14675 = -u. What is the thousands digit of n? 3 Let d = 50 - 48. Suppose 4t - 6a = -da + 32, -t - 4a - 12 = 0. Suppose -2i = 4l - 80, tl + 2i - 7i - 108 = 0. What is the tens digit of l? 2 Let s be 21/6(-6)/(-21). Let d be (-12 + 12)/(s + 0). Suppose d = -16p + 160 + 512. What is the units digit of p? 2 Suppose 2h = -3t + t - 30, -h - 7 = 3t. Let k(m) = 262m - 124. Let l be k(1). Let x = h + l. What is the tens digit of x? 1 Let h(q) = 5 - 4 - 4 - 3q. Let k be h(-2). Suppose -58 = -kw + 95. What is the tens digit of w? 5 Let z(q) = -3q2 - 14q - 8. Let p be z(-4). Suppose -5m + 71 - 6 = p. Suppose -ma + 236 = -1064. What is the hundreds digit of a? 1 Let x(g) be the first derivative of 2g3/3 - 3g*2 - 30g - 48. Let o be x(6). Suppose -292 = ow - 10w. What is the units digit of w? 3 Let w(m) = m*2 - 13m - 9. Let i be w(14). Suppose -2 = -4b + 6. Suppose -ig = -bg - 642. What is the hundreds digit of g? 2 Let v(t) be the third derivative of -t5/60 + 4t*4/3 - 27t*3/2 - 300t2. What is the units digit of v(6)? 5 Let w(r) = -r3 + 6r2 - 39r - 25. What is the tens digit of w(-12)? 3 Let q = -1900 - -8971. What is the tens digit of q? 7 Let b = 72809 - 35985. What is the thousands digit of b? 6 Let g be (-21)/91428/(-4). Suppose -3c + g + 91 = 0. Suppose -6r = r - c. What is the tens digit of r? 4 Suppose -s - u + 0u = -4, -2u - 17 = -3s. What is the units digit of 6826/s + (-5)/25? 5 Suppose 32a - 230719 = -30a - 53833. What is the units digit of a? 3 Suppose 13353 = -3r + 3d + 78624, -3r - d + 65291 = 0. What is the ten thousands digit of r? 2 Suppose -15o + 36o = 294. Suppose 21720 = -2y + oy. What is the hundreds digit of y? 8 Let d(n) = -n3 + 4n*2 - 22n + 35. Let k(i) = 3i2 - 24i + 34. Let z(p) = -3d(p) + 4k(p). What is the hundreds digit of z(6)? 4 Suppose -16y = -19y - 1335. Let u = y + 519. What is the units digit of u? 4 Let t be (80/(-12) - -7)/((-1)/(-30)). Suppose -5v + 3g + 206 + 1112 = 0, 4v + 2g - 1072 = 0. Suppose tq - v = -4q. What is the tens digit of q? 1 Let a(g) = 327g3 + 4g*2 + 3g. Let l(x) = -653x3 - 9x*2 - 6x + 1. Let f(c) = -5a(c) - 2l(c). What is the tens digit of f(-1)? 2 Let m = 10953 - 5438. What is the thousands digit of m? 5 Suppose 39y + 24y + 25y = 932976. What is the ten thousands digit of y? 1 Let q = -145 + 50. Let f = q + 199. What is the hundreds digit of f? 1 Let w = -27 + 147. What is the units digit of 80(6 + w/(-32))? 0 What is the thousands digit of -5 + 10056 - (6 + -1)? 0 What is the units digit of ((-1)/6)/1 - (-60922387)/3966? 1 Suppose -4 - 7 = -2a - 3u, -2 = 2u. Suppose -a - 20 = -3n. Suppose 1194 = ns + 276. What is the hundreds digit of s? 1 What is the hundreds digit of 1100/660(-7827)/(-5)? 6 Let l(o) = -3o - 4. Let a be l(0). Let t be (0/a)/((-1)/1). Suppose 10k + tk = 1650. What is the tens digit of k? 6 Let y be 5 + (-12)/4 + -2. What is the hundreds digit of (-9 - -8 - y)199/(-1)? 1 Suppose -3320 = -13u + 6469. Suppose 2k = 0, -u = -w + 3k + 156. What is the units digit of w? 9 Let m(o) = 14 + 4o - o*3 + 9o*2 + 4o - o*2. Suppose 0 = 10t + 5t - 16t + 8. What is the tens digit of m(t)? 7 Let j(s) = 102s2 - 2s - 18. Let m be j(-6). Suppose x - 14x = m. Let w = 446 + x. What is the tens digit of w? 6 Suppose -4h = -2h - i - 29, 5i + 33 = 3h. Let m(o) = 9o - ho2 + 6o2 - o3 + 0o3 + 13 + 21o*2. What is the units digit of m(11)? 2 Let z(p) = 11p - 1. Let d be z(1). Let s(h) = 3h + 10h*2 - 4 - 19h2 + h2 + h*3. What is the units digit of s(d)? 6 Suppose -79 - 236 = -9d. Suppose 3x = d - 26. Suppose 0 = -2h - xw + 84, h - 210 = -4h + w. What is the units digit of h? 2 What is the units digit of ((-14)/(-4) - (0 + 3)) + 2523/6? 1 Suppose -472 = 6o + 2o. Let l = o + 58. What is the units digit of l/(4/(-152)) + -2? 6 Let i be 12/15(2/(-4) + 3). Suppose k = ik - 116. Suppose k = 3r - 5j, j = -r - r + 73. What is the tens digit of r? 3 Suppose -5l = -10, -3r + l = 5l - 530. Suppose 173p + 331 = rp. What is the hundreds digit of p? 3 Suppose -3b + 2o - 44 = -0o, 0 = 3b - 5o + 56. Let f(u) = -2u3 - 21u*2 + 9u + 26. What is the hundreds digit of f(b)? 3 Let y(l) = 2329l2 - 66l + 167. What is the tens digit of y(3)? 3 Suppose 2q = -p + 29728, 390p - 392p + 4q + 59408 = 0. What is the ten thousands digit of p? 2 Suppose 4d = 2k - 4, 0 = -d + k + k + 5. Let t be (-14)/(-3)36/(-12)d. What is the tens digit of (-2)/(-7) + 3936/t? 9 Let n(f) = -1 - 1 - 4f + 655f*2 + 6 + 258f*2 - 59f*2. What is the tens digit of n(1)? 5 Let w = 157 - 155. What is the hundreds digit of w9/(-30)-605? 3 Let a = 703 - 343. Suppose a = 2v - v + f, 0 = -2v + f + 717. What is the units digit of v? 9 Let d(f) = 4 - 9f - 7f + 37f - 6f. Let c be 2/(-1) - (-2 - 3). What is the tens digit of d(c)? 4 Let z(f) = 9f*2 + 2f + 3. Let o be z(4). Suppose 601 + 239 = 30l. Suppose -l - o = -u. What is the units digit of u? 3 Let t(b) = 9b - 5. Let u(g) = 7g - 6. Let m(l) = 11l - 9. Let y(x) = 5m(x) - 8u(x). Let h be y(-7). What is the units digit of t(h)? 5 Let y(o) = 39o2 + 8o - 40. Let p(n) = -77n2 - 17n + 79. Let b(s) = -6p(s) - 11y(s). What is the thousands digit of b(7)? 1 Let k(w) be the second derivative of -7w4/8 + 3w*3/2 + 8w*2 - 27w. Let g(a) be the first derivative of k(a). What is the tens digit of g(-4)? 9 What is the ten thousands digit of (-8)/(-20)-35 - -27392? 2 Let s(n) = -n3 + 28n*2 - 147n + 2454. What is the hundreds digit of s(21)? 4 What is the units digit of 52/(36/9) + 9691? 4 Suppose x = 4c - 3582 + 259, 4x - 3348 = -4c. Suppose c - 88 = -3m. Let h = -116 - m. What is the tens digit of h? 3 Let h = -255 - -273. Suppose hf + 5f - 14214 = 0. What is the tens digit of f? 1 Let x = -3602 + 3815. What is the tens digit of x? 1 Let a(f) = -9f + 6. Let v(o) = o3 + 12 - 11o*2 - 4 + 0o*3 + 0o*3 + 9o. Let y be v(10). What is the tens digit of a(y)? 2 Suppose 2c = -4q + 46434, 5c - 32q - 116099 = -35q. What is the tens digit of c? 2 Suppose 563u - 558u = -1290. Let d = u + 659. What is the units digit of d? 1 What is the hundreds digit of 1 - 5/7 - (0 + 449272/(-56))? 0 What is the thousands digit of -1 + -2 + 27/6 + 19699/2? 9 Suppose 7540 = -50n + 21n. Let g = -142 - n. What is the units digit of g? 8 Suppose -51c = -28c - 115. Suppose -3891 = -cw + 1069. What is the tens digit of w? 9 Suppose 4k = -5b + 43218, 234b - 235b + 2 = 0. What is the hundreds digit of k? 8 Suppose -9w - z = -18w + 91744, 3w + 2z = 30586. What is the thousands digit of w? 0 Let i be 63/(-2) + 55/110. Let m(w) = 2w + 97. What is the units digit of m(i)? 5 Let t(x) = -2 + 30 + 31 + 2x - 5. Let y be t(-26). Let a(v) = 23v3 + v2 - 3v + 1. What is the tens digit of a(y)? 8 Let v = 31 + -37. Let n(c) = -c*3 - 8c*2 - 12c + 2. Let l be n(v). What is the tens digit of (3 - -187)/(4 - l)? 9 Let k(y) = y*2 - 14y + 5. Let u be k(14). Let h be -3u/5 + 122. Suppose f = 76 - h. What is the tens digit of f? 5 Suppose -60461 = -11z + 82616. What is the ten thousands digit of z? 1 Suppose 4s = -6a + 13642, -a + 56s = 55s - 2282. What is the thousands digit of a? 2 Let a = -1291 + 3523. Suppose 25s - 33s + a = 0. What is the units digit of s? 9 Let p(s) = 41s - 157. Let g be p(10). Suppose -go = -255o + 634. What is the units digit of o? 7 Let k(n) = 822n2 - 3n + 41. What is the hundreds digit of k(3)? 4 Suppose -5*k = -9 - 1. Suppose -18	{ "pile_set_name": "DM Mathematics" }
base 8? -5232 What is -1322113 (base 4) in base 13? -3745 11121323 (base 4) to base 9 33328 What is -201000 (base 3) in base 7? -1332 Convert -123543 (base 7) to base 9. -34380 Convert -1010001101101 (base 2) to base 6. -40113 Convert 300 (base 7) to base 3. 12110 What is -767 (base 9) in base 3? -212021 425304 (base 6) to base 12 18234 What is -b01b (base 16) in base 7? -245303 Convert 8804 (base 15) to base 4. 13002010 What is 14122 (base 10) in base 6? 145214 Convert -337 (base 12) to base 10. -475 -15434 (base 6) to base 12 -157a 77a (base 11) to base 2 1110100110 What is -1235 (base 15) in base 3? -12022112 71007 (base 9) to base 12 23007 Convert 305 (base 11) to base 5. 2433 5865 (base 12) to base 8 23215 Convert 101211212 (base 3) to base 15. 2522 Convert 263 (base 16) to base 15. 2ab What is 114033 (base 7) in base 2? 101000001111100 Convert 331 (base 11) to base 14. 205 Convert -15a (base 14) to base 3. -101020 Convert 12010 (base 4) to base 9. 471 What is 415155 (base 6) in base 9? 51018 What is -10200330 (base 4) in base 2? -100100000111100 What is -17e5 (base 16) in base 12? -3659 Convert 20b1 (base 12) to base 14. 1445 Convert 1b4b8 (base 13) to base 16. d133 34c0 (base 13) to base 14 29c3 -32a6a (base 11) to base 8 -135377 -235130 (base 6) to base 4 -11001132 Convert 26051 (base 9) to base 15. 52e7 What is -11100101101 (base 2) in base 14? -953 Convert 617 (base 11) to base 12. 520 What is -111010000100 (base 2) in base 3? -12002122 Convert -74101 (base 10) to base 14. -1d00d Convert 10012212002 (base 3) to base 8. 173525 What is 2dd0 (base 14) in base 12? 490a Convert -4828 (base 12) to base 10. -8096 Convert 37d1 (base 14) to base 10. 9787 610 (base 7) to base 4 10231 Convert 5603 (base 8) to base 13. 1459 Convert 1275 (base 9) to base 7. 2540 Convert 3404 (base 9) to base 11. 1987 254 (base 10) to base 12 192 -121c (base 14) to base 7 -12135 Convert 34a (base 16) to base 7. 2312 -5a1 (base 12) to base 14 -441 -43c3 (base 13) to base 4 -2103232 What is 111111101010100 (base 2) in base 9? 48637 What is 330a (base 12) in base 3? 21201101 What is 7854 (base 9) in base 5? 141200 Convert -12333 (base 8) to base 15. -18ae What is -597 (base 10) in base 11? -4a3 Convert -1053 (base 7) to base 6. -1433 What is 14331 (base 5) in base 2? 10011000000 What is -36868 (base 9) in base 15? -7512 Convert -597 (base 16) to base 9. -1860 What is -11ab (base 13) in base 9? -3385 What is 24 (base 10) in base 7? 33 1728 (base 11) to base 2 100010100000 -5b4 (base 14) to base 15 -50d -5397 (base 11) to base 13 -3320 What is -648 (base 11) in base 5? -11103 -111000101100 (base 2) to base 6 -24444 -223 (base 6) to base 11 -7a -1010100000111 (base 2) to base 3 -21101101 What is 172 (base 8) in base 6? 322 Convert -8599 (base 10) to base 4. -2012113 -242101 (base 6) to base 5 -1134310 What is 244304 (base 6) in base 10? 21712 What is -50a2 (base 14) in base 16? -3626 Convert -111202021 (base 3) to base 6. -114224 What is -230d (base 14) in base 3? -22100112 -12013 (base 7) to base 11 -2366 Convert 20711 (base 8) to base 15. 2869 Convert 6d54 (base 16) to base 4. 12311110 -100523 (base 6) to base 2 -1111100100011 -323302 (base 5) to base 2 -10101101000101 -10222112 (base 3) to base 15 -cd8 What is -2ed (base 16) in base 3? -1000202 Convert -10110111100 (base 2) to base 7. -4165 -7f04 (base 16) to base 6 -410312 What is 1b3 (base 12) in base 5? 2104 -22201 (base 4) to base 11 -562 -4203 (base 7) to base 11 -111a Convert -485b (base 16) to base 11. -12a0a -14474 (base 9) to base 7 -40525 2187 (base 15) to base 9 10661 294 (base 12) to base 4 12100 Convert 11233210 (base 4) to base 5. 1223044 402 (base 16) to base 12 716 -3130 (base 4) to base 10 -220 80b (base 16) to base 11 1602 -190bb (base 13) to base 2 -1011110101101000 What is 96f1 (base 16) in base 15? b6b1 -2245 (base 6) to base 12 -385 Convert 10228 (base 10) to base 4. 2133310 What is 152a4 (base 11) in base 2? 101010010010100 -4111 (base 7) to base 9 -1857 What is -168d (base 14) in base 11? -3048 What is -2121220 (base 4) in base 5? -303312 What is 1151 (base 7) in base 6? 1552 What is -13453 (base 9) in base 2? -10001110100000 -102042 (base 5) to base 14 -1349 -474 (base 8) to base 4 -10330 -2809 (base 16) to base 4 -2200021 What is 321 (base 16) in base 8? 1441 -3333021 (base 4) to base 14 -5d45 What is -1287 (base 9) in base 13? -598 Convert 220022 (base 3) to base 4. 22100 What is 5358 (base 10) in base 12? 3126 1573 (base 8) to base 13 537 Convert -2413 (base 7) to base 14. -47a Convert 52320 (base 6) to base 4. 1231320 What is -3c41 (base 13) in base 15? -2882 -12512 (base 6) to base 13 -b45 Convert 19922 (base 10) to base 8. 46722 What is -1101110 (base 4) in base 8? -12124 333223 (base 4) to base 12 2437 -23025 (base 6) to base 11 -24a1 What is 274 (base 12) in base 6? 1424 What is -1e4 (base 16) in base 3? -122221 What is -1345 (base 7) in base 14? -295 What is -3721 (base 8) in base 14? -a2d Convert -1c00 (base 13) to base 16. -1081 19b (base 15) to base 2 101110011 What is -8514 (base 10) in base 5? -233024 What is -2b (base 13) in base 8? -45 Convert 2860 (base 9) to base 14. b04 What is 256646 (base 7) in base 10? 48005 c7 (base 13) to base 9 201 What is cc9 (base 15) in base 6? 21213 Convert -100211331 (base 4) to base 5. -4133330 What is -2658 (base 11) in base 6? -23551 16405 (base 10) to base 8 40025 589 (base 14) to base 13 669 Convert 130211 (base 4) to base 16. 725 Convert -5371 (base 8) to base 14. -1049 Convert -241 (base 15) to base 6. -2211 Convert -10101101010101 (base 2) to base 10. -11093 11110100 (base 3) to base 12 1a69 217 (base 9) to base 11 152 What is 111444 (base 5) in base 10? 3999 -22100 (base 3) to base 11 -195 -1010202020 (base 3) to base 2 -101011110010000 30435 (base 7) to base 11 5640 What is -403 (base 9) in base 4? -11013 Convert -30 (base 7) to base 15. -16 Convert -102333 (base 4) to base 5. -14330 What is 334 (base 12) in base 9? 574 Convert 4200 (base 5) to base 13. 334 What is 3321 (base 6) in base 9? 1044 28856 (base 10) to base 6 341332 Convert 110 (base 8) to base 4. 1020 Convert 503 (base 14) to base 7. 2603 What is -110111001111001 (base 2) in base 12? -14449 601a (base 11) to base 2 1111101000111 Convert -12100 (base 3) to base 5. -1034 What is 33010 (base 6) in base 12? 2766 What is -366d (base 14) in base 16? -2521 Convert 28 (base 11) to base 3. 1010 What is 67a6 (base 11) in base 15? 29b9 Convert 114775 (base 9) to base 2. 10000111000101001 228 (base 11) to base 16 110 40c (base 14) to base 11 664 14799 (base 12) to base 6 341113 -4a8 (base 11) to base 6 -2442 -49c (base 16) to base 7 -3304 What is -521 (base 8) in base 4? -11101 13213 (base 4) to base 2 111100111 -2443 (base 11) to base 13 -15b8 What is 642 (base 9) in base 5? 4044 -6a04 (base 11) to base 15 -2ad5 What is -32303 (base 4) in base 3? -1022002 What is -143202 (base 6) in base 8? -32562 What is 30b3 (base 14) in base 9? 12451 3000 (base 8) to base 14 7ba -220101 (base 3) to base 12 -46a What is -205553 (base 6) in base 4? -10013031 What is -3516 (base 7) in base 15? -5ac 5b58 (base 13) to base 12 7585 -41b0 (base 12) to base 14 -2896 7e (base 15) to base 14 87 What is -10110 (base 3) in base 14? -69 Convert -2225 (base 9) to base 6. -11335 -1262c (base 15) to base 10 -58767 What is -245005 (base 7) in base 3? -2021122101 Convert -202315 (base 7) to base 13. -128b9 Convert 21a4 (base 15) to base 13. 3325 Convert -19 (base 16) to base 13. -1c Convert -1010010000111011 (base 2) to base 8. -122073 10618 (base 10) to base 14 3c26 -7e30 (base 15) to base 8 -64304 2d3 (base 14) to base 9 711 Convert 3341114 (base 5) to base 10. 58909 1632 (base 7) to base 14 352 321012 (base 4) to base 5 104104 Convert -55788 (base 9) to base 8. -110351 -2015 (base 6) to base 16 -1bb What is -23251 (base 6) in base 9? -4524 What is -2036 (base 7) in base 11? -599 What is 7b15 (base 12) in base 4? 3112001 What is 63636 (base 7) in base 10? 15756 What is 101200 (base 3) in base 9? 350 What is -1710 (base 10) in base 3? -2100100 What is 130232 (base 4) in base 6? 12302 What is 12405 (base 6) in base 9? 2515 What is 11e (base 16) in base 14? 166 -1001010111 (base 2) to base 5 -4344 Convert 2919 (b	{ "pile_set_name": "DM Mathematics" }
at is the product of 316 and -116667? -36866772 -1105495 * 11 -12160445 What is the product of 27690406 and -1? -27690406 What is -6468 times -12504? 80875872 Product of -3053 and 36.429. -111217.737 Work out -1.93 * 34423. -66436.39 Calculate 29086-14636. -425702696 What is the product of -4988565 and -4? 19954260 -13.8 317266 -4378270.8 Calculate 20042-16.67. -334100.14 Multiply 6309.5 and -9. -56785.5 What is -0.128 times -383? 49.024 Product of -0.011 and 3169.66. -34.86626 -11605 12100 -140420500 Multiply -46265.28 and -0.52. 24057.9456 8 * 9968.83 79750.64 Multiply 1 and -36.00585. -36.00585 5 times -5366868 -26834340 247-72430 -17890210 What is the product of -3 and -8077957? 24233871 Calculate -5-7296828. 36484140 Product of 15770.9 and 31. 488897.9 Calculate 3380.2676. 90.4488 Multiply 5.142 and -454. -2334.468 -89667336 times 0.3 -26900200.8 Calculate -1.403-180.8. 253.6624 83.6129-354 -29598.9666 What is -474334 times -149? 70675766 Calculate -40.0721635. -0.288654 What is the product of 4910.696 and 0.5? 2455.348 51.56987.94 50938.1864 Work out 75215930 -0.4. -30086372 215 times 4391.9 944258.5 Calculate 1.39-4.2669. -5.930991 -3.731483 times -0.075 0.279861225 What is the product of -589987 and -382? 225375034 Calculate 0.07-300883. -21061.81 What is the product of 120074 and 611? 73365214 Calculate 142.8671.23. 175.72641 Multiply 0.5 and 62927.13. 31463.565 Calculate -0.210782.558. -2156.5116 Calculate 5.47392.07. 11.330973 1889098 -0.044 -83120.312 41640228-0.4 -16656091.2 Multiply -0.10311278 and 0.06. -0.0061867668 What is -9.7704 times 1649? -16111.3896 -14260872 0.3 -4278261.6 Multiply -0.3 and 0.277515489. -0.0832546467 What is the product of 241.8351 and 73? 17653.9623 What is the product of 40470.28 and -0.1? -4047.028 0.0963 * 652 62.7876 -0.3 times -680079.22 204023.766 Product of -43.2 and -0.0537172. 2.32058304 What is the product of -181574 and 0.055? -9986.57 -778 * 0.0227221 -17.6777938 Product of 0.9 and 1.513132. 1.3618188 Calculate -184.1-1656. 304869.6 Product of -524941 and -0.36. 188978.76 What is -1.3 times 17119286? -22255071.8 297197 times 0.029 8618.713 -0.016515246 times -2 0.033030492 Calculate -11549-1730. 19979770 Calculate -1-3606481. 3606481 Multiply -29454246 and 0.02. -589084.92 -0.157942 times -638 100.766996 -0.029276 -1613 47.222188 Multiply -0.097 and 0.97126. -0.09421222 1186.503 times -6 -7119.018 -4063339 times 5 -20316695 0.09023-241 -21.74543 -96 -45471.6 4365273.6 Product of -0.3 and -0.00323542. 0.000970626 -2278910.82 -186870.62 Calculate 0.1-30730962. -3073096.2 -49 times -1074803 52665347 0.032843-3.78 -0.12414654 Work out -1859055 0.32. -594897.6 Calculate 10762-0.49. -5273.38 What is the product of 2 and 267703797? 535407594 -0.2 times 948.52914 -189.705828 22275.56 times -5 -111377.8 Calculate 0.69764097-0.4. -0.279056388 What is the product of 0.17711051 and 4? 0.70844204 84.0302 * 3.9 327.71778 -1 times -2.737068 2.737068 Work out 561177 * 191. 107184807 3523639 * -2 -7047278 Multiply 1118714.4 and 0.3. 335614.32 What is -79313281 times -0.1? 7931328.1 -2202816 * -24 52867584 What is the product of 0.04192 and 178.4? 7.478528 533-3.06469 -1633.47977 -0.03 times 0.0883866 -0.002651598 Work out -14 7867.44. -110144.16 13961.086 * -0.2 -2792.2172 Product of -0.4 and 19.80803. -7.923212 -5 times -583342.87 2916714.35 2-604557 -1209114 Calculate 71614070-4. -286456280 What is -0.3 times -27084.597? 8125.3791 4 * -90384.31 -361537.24 Calculate -43860-11.2. 491232 -0.115144422 -16608.53 0.003619 times -0.5 -0.0018095 104.72967-0.8 -83.783736 Work out 10.98284 -155. -1702.3402 Product of -1.8 and -7731274. 13916293.2 0.09574-771.1 -73.825114 76813 times -33.8 -2596279.4 Calculate -162.313163. -37.010608 Calculate -5628-2.9626. 16673.5128 322.873 times 49 15820.777 0.07 times -189943428 -13296039.96 Calculate -250.0321733. -0.8043325 Multiply -1.9024 and -1.43. 2.720432 What is -2294.704 times -5? 11473.52 0.0161 * -32.58 -0.524538 What is -60699.7 times 1993? -120974502.1 Product of 703 and -12952.9. -9105888.7 What is the product of -151544511 and -1? 151544511 Work out -5 * 157686725. -788433625 Multiply -13859933 and -9. 124739397 -43385 times 16.55 -718021.75 Calculate 690.17929. 20015.191 Product of 18942281 and -0.4. -7576912.4 Multiply 7966.62 and 44. 350531.28 88968 times -0.1345 -11966.196 690 times 367584 253632960 What is the product of -16744631 and -4? 66978524 -0.1484 -1.78894 0.265478696 -834796 * -0.49 409050.04 -0.012 * 1822130 -21865.56 912.162 times -5 -4560.81 What is -14255.9 times -0.0148? 210.98732 What is the product of -1297127 and -0.26? 337253.02 53-69207.4 -3667992.2 What is -217.14704 times 2? -434.29408 -306 127785 -39102210 -1.807681 times -12 21.692172 Product of 4.473 and 0.092. 0.411516 Multiply -25 and -2079510.1. 51987752.5 57347-409 -23454923 What is -0.2 times 311804? -62360.8 -79 410.3504 -32417.6816 4-0.07598735 -0.3039494 What is the product of -37763061 and -2? 75526122 108140.1 0.3 32442.03 Multiply -0.1 and -13.2231. 1.32231 1143 times -926.85 -1059389.55 Product of 13295.2 and 205. 2725516 Product of -0.512 and 3014. -1543.168 Calculate -0.1-4271.33344. 427.133344 0.1-6158698 -615869.8 -0.046-91183 4194.418 What is the product of -14.5 and -2460245? 35673552.5 -0.05709 -34046 1943.68614 Work out 1.0135824 * 0.01. 0.010135824 173.361-176 -30511.536 Product of -64 and -82240. 5263360 Calculate 0.2265251-9. -2.0387259 Calculate -0.42-79.98931. 33.5955102 Calculate -3.52173366. -610248.32 Calculate -0.127412602. -52400.454 -0.96 times 30483 -29263.68 What is -0.4 times 0.7507739? -0.30030956 Product of 0.296 and -4.8672. -1.4406912 What is the product of -44952 and 4? -179808 -45-388557 17485065 Calculate -161.425-0.054. 8.71695 What is the product of 0.344 and 0.2734? 0.0940496 Calculate 1890710-5. -9453550 -4554.5326-8 36436.2608 260721020.8 54229968 11817.68 times -3 -35453.04 1.4 * 7630515 10682721 -1827136 * -0.03 54814.08 Multiply -3.45 and -200309. 691066.05 What is -1 times 362892.2? -362892.2 Calculate 0.912990914. 12.7818726 Calculate -74784.4-433. 32381645.2 Product of -7304 and -675. 4930200 32176832-0.3 -9653049.6 What is -2 times -4692.481? 9384.962 Multiply -0.271 and 235077. -63705.867 What is the product of 1805 and 0.02221? 40.08905 What is the product of -15 and 90.10183? -1351.52745 174 -10858.1 -1889309.4 Product of -2027.1 and 0.1. -202.71 1023.519 * 1.4 1432.9266 Calculate 0.5183.32. 91.66 Work out 0.25 19714571. 4928642.75 Product of -1 and -3.171707. 3.171707 -139-86016 11956224 41645.094 6580.376 Calculate -11842.09. -4966.62 0.931.3783 1.281819 -10880 * 0.16938 -1842.8544 What is 1911.798 times 116? 221768.568 What is the product of 61 and 76988? 4696268 Product of 0.2 and 52705.46. 10541.092 -159626853 times -2 319253706 What is the product of 10636143 and -2? -21272286 Product of 0.1 and -157287684. -15728768.4 Calculate -32860-5. 164300 -4.4 times 13214.863 -58145.3972 -12688008 0.43 -5455843.44 What is the product of 366.0779 and -0.24? -87.858696 -10 times 106.50557 -1065.0557 Multiply -370023054 and -0.5. 185011527 -0.3-35928936 10778680.8 Multiply 348 and 78653. 27371244 Multiply 0.5 and -0.10340208. -0.05170104 Product of 17792 and 49.25. 876256 Multiply 0.876 and 459.38. 402.41688 What is -141.1326 times 2? -282.2652 -1.10136 -90 99.1224 Work out -0.00203 * -4119. 8.36157 -4.62625509 -2889851.58 Calculate -362010657. -186031971 Calculate -37341320.4. -1493652.8 What is the product of 14435289 and -3? -43305867 Work out 1.6 30415152. 48664243.2 What is the product of 484340 and -0.04? -19373.6 Calculate 0.0572.3036. 3.61518 What is 0.05933757 times -56? -3.32290392 -0.023158543 -197.77045 Multiply -176.912631 and 0.04. -7.07650524 Calculate 0.0802685670.6. 0.0481611402 What is 1.8602 times 20153? 37488.6106 2391 times 10211 24414501 Calculate 325763.662. 119293.312 161411 * -1789 -288764279 Calculate -0.1-16784752. 1678475.2 Work out -0.42498 8. -3.39984 Multiply -0.12 and -9240614. 1108873.68 0.08 * 9.04432 0.7235456 -21173142 * -60 1270388520 Multiply -892342.82 and -0.02. 17846.8564 -0.3*2623340	{ "pile_set_name": "DM Mathematics" }
96 1838 (base 9) to base 15 642 What is -36526 (base 8) in base 14? -5a18 What is 481 (base 9) in base 3? 112201 -2157 (base 10) to base 5 -32112 d020 (base 14) to base 11 24905 Convert 101001110101101 (base 2) to base 9. 32341 What is -2d8c (base 15) in base 13? -4605 1014 (base 8) to base 11 437 What is -15035 (base 7) in base 10? -4142 -71d6 (base 15) to base 11 -17085 -54 (base 15) to base 10 -79 -1183 (base 11) to base 5 -22133 Convert -1a25 (base 16) to base 5. -203233 1113312 (base 5) to base 4 10311320 Convert 17026 (base 10) to base 9. 25317 Convert -102100 (base 5) to base 11. -2611 What is 21220120 (base 3) in base 16? 1686 110000010010 (base 2) to base 5 44330 Convert 11343 (base 9) to base 8. 16624 -50 (base 8) to base 5 -130 What is 1512 (base 11) in base 8? 3635 b1 (base 15) to base 6 434 7d2 (base 14) to base 10 1556 Convert 134 (base 6) to base 2. 111010 -15a (base 15) to base 7 -622 What is 1012102201 (base 3) in base 4? 11301130 What is 2cd0 (base 15) in base 7? 40056 Convert 18561 (base 9) to base 10. 12853 Convert 2022202 (base 3) to base 2. 11010011110 What is -2262 (base 7) in base 14? -432 42 (base 10) to base 11 39 -120 (base 16) to base 12 -200 Convert 3647 (base 9) to base 16. a9c Convert 400 (base 11) to base 10. 484 1708 (base 9) to base 7 3542 Convert 4104 (base 10) to base 15. 1339 What is 11001000 (base 2) in base 5? 1300 -548 (base 9) to base 14 -241 What is -2725 (base 8) in base 10? -1493 What is -11775 (base 11) in base 2? -100001000000101 Convert 15b2 (base 14) to base 15. 123a What is 11012110 (base 4) in base 5? 1132014 What is -1205 (base 12) in base 4? -133211 Convert -1141 (base 15) to base 11. -2829 What is 744 (base 11) in base 3? 1020011 Convert -22134 (base 9) to base 5. -432232 Convert 348 (base 9) to base 5. 2122 Convert -517 (base 10) to base 8. -1005 ca6 (base 16) to base 6 22554 -1231130 (base 4) to base 10 -7004 Convert 16449 (base 12) to base 2. 111101111111001 What is 188 (base 10) in base 13? 116 3203232 (base 4) to base 16 38ee 67110 (base 10) to base 7 366441 What is -d2a (base 16) in base 4? -310222 Convert 2aa9 (base 15) to base 12. 5373 Convert -412 (base 10) to base 4. -12130 -c649 (base 14) to base 9 -51775 Convert -1326 (base 11) to base 4. -122322 What is 70751 (base 8) in base 11? 1aa00 Convert -3016 (base 8) to base 14. -7ca Convert 10010111001010011 (base 2) to base 8. 227123 -12132 (base 5) to base 7 -2450 -3f5 (base 16) to base 13 -5cc -2343 (base 5) to base 9 -426 1602 (base 10) to base 4 121002 1169c (base 16) to base 4 101122130 Convert -661 (base 7) to base 3. -110111 Convert 2b5 (base 12) to base 5. 3200 11a (base 13) to base 12 140 Convert -45b1 (base 15) to base 4. -3213013 What is -5422 (base 6) in base 12? -872 What is -210330 (base 5) in base 6? -52125 Convert -29b (base 16) to base 9. -821 What is -7488 (base 9) in base 11? -4157 What is 23010 (base 4) in base 3? 222020 20000 (base 4) to base 12 368 -43451 (base 7) to base 13 -4c3a What is 532 (base 16) in base 15? 5da Convert 5e (base 15) to base 9. 108 129 (base 12) to base 9 216 12202120 (base 3) to base 13 1bb1 Convert -e56 (base 15) to base 8. -6237 Convert 21030221 (base 4) to base 13. 141bc -30d (base 14) to base 3 -211021 -56b (base 12) to base 6 -3415 Convert 9396 (base 10) to base 7. 36252 -320514 (base 6) to base 11 -18687 Convert -1258 (base 9) to base 2. -1110110000 What is -1021121221 (base 3) in base 2? -110001010011011 What is -2a1 (base 15) in base 11? -4a7 What is 9d66 (base 15) in base 13? 1227c What is -15917 (base 10) in base 9? -23745 Convert -7276 (base 15) to base 7. -130341 Convert 5744 (base 9) to base 14. 179a -121114 (base 5) to base 9 -6187 Convert -134551 (base 6) to base 4. -3013003 232 (base 6) to base 3 10102 Convert 1010 (base 6) to base 2. 11011110 What is 4b7a (base 15) in base 3? 211001221 What is 10002201010 (base 3) in base 7? 342624 Convert 17780 (base 9) to base 3. 121212200 Convert -1d8 (base 15) to base 2. -110101100 Convert -11001100001 (base 2) to base 11. -1255 10219 (base 10) to base 7 41536 What is -100011010110 (base 2) in base 8? -4326 What is -6e17 (base 16) in base 8? -67027 What is 2377 (base 11) in base 3? 11021011 What is -24c (base 15) in base 7? -1344 -1020222102 (base 3) to base 16 -60c2 What is 33 (base 9) in base 14? 22 -3321233 (base 5) to base 7 -330126 Convert 134 (base 13) to base 4. 3110 What is 133352 (base 6) in base 9? 18065 -17b (base 13) to base 6 -1131 Convert -334403 (base 5) to base 13. -551a Convert 220212102 (base 3) to base 4. 10123100 Convert -2416a (base 11) to base 14. -c97d Convert -101120 (base 3) to base 6. -1153 Convert 29a (base 11) to base 7. 1011 11011100100101 (base 2) to base 14 5205 Convert 23102 (base 5) to base 2. 11001110100 What is -66215 (base 7) in base 14? -607c What is -569 (base 10) in base 7? -1442 What is 7d4b (base 14) in base 8? 52477 What is 211132 (base 4) in base 14? c34 Convert 2012032 (base 4) to base 3. 102210011 Convert -12210120 (base 4) to base 2. -110100100011000 -553 (base 16) to base 8 -2523 Convert -1213 (base 8) to base 7. -1620 What is -444423 (base 6) in base 5? -2143221 What is -1110110000010 (base 2) in base 10? -7554 What is -1494 (base 13) in base 12? -1896 What is -240335 (base 6) in base 7? -114560 Convert 180 (base 15) to base 3. 110210 -32415 (base 6) to base 7 -16022 Convert 98 (base 12) to base 9. 138 Convert 7427 (base 16) to base 4. 13100213 2200002 (base 3) to base 11 150a Convert 42360 (base 8) to base 9. 26178 What is -80c (base 13) in base 11? -1030 -41130 (base 9) to base 5 -1331311 What is -20403 (base 7) in base 14? -1b73 What is -24001 (base 7) in base 11? -4704 -672 (base 9) to base 15 -26b 31a5 (base 15) to base 16 2909 What is 68334 (base 9) in base 11? 31189 Convert -4010 (base 6) to base 4. -31212 -101424 (base 6) to base 5 -230102 What is 120234 (base 7) in base 16? 54e4 Convert 28c (base 16) to base 15. 2d7 Convert 61d (base 15) to base 9. 1801 Convert 201220 (base 3) to base 4. 20121 Convert -a5a7 (base 13) to base 5. -1213302 What is 22210221 (base 3) in base 2? 1100100011000 Convert -1eb8 (base 15) to base 3. -100012002 What is -1000000110 (base 2) in base 12? -372 What is 1120111 (base 3) in base 15? 517 215622 (base 8) to base 12 36016 What is 244240 (base 5) in base 8? 22150 -a8 (base 13) to base 7 -255 -26362 (base 8) to base 9 -16704 -111100110101110 (base 2) to base 12 -1603a -32521 (base 6) to base 8 -10641 What is -71165 (base 8) in base 15? -8a36 2961 (base 10) to base 14 1117 -23 (base 7) to base 2 -10001 -2644 (base 12) to base 15 -1467 What is -9646 (base 10) in base 9? -14207 What is 1031 (base 6) in base 5? 1420 Convert 1804 (base 9) to base 8. 2545 What is b2 (base 13) in base 4? 2101 Convert -516 (base 8) to base 13. -1c9 What is -103 (base 7) in base 10? -52 What is 649 (base 12) in base 3? 1021010 b912 (base 12) to base 11 142a1 -1357 (base 9) to base 4 -100000 What is 2121 (base 11) in base 13? 137b Convert 5225 (base 15) to base 9. 25728 What is 1222110 (base 3) in base 2? 10110100011 What is -102011110 (base 3) in base 4? -1333023 Convert 941 (base 15) to base 16. 826 Convert 335a9 (base 11) to base 9. 73644 Convert -350 (base 6) to base 9. -163 1220 (base 9) to base 11 757 -4626 (base 12) to base 9 -11633 10010003 (base 4) to base 11 11560 Convert -100 (base 2) to base 3. -11 What is -22503 (base 6) in base 14? -1251 -1820 (base 10) to base 11 -1405 What is -5218 (base 11) in base 12? -4004 3648 (base 10) to base 4 321000 -3054 (base 7) to base 8 -2054 33 (base 15) to base 11 44 Convert 232 (base 12) to base 13. 1c1 -297 (base 11) to base 6 -1340 Convert -747 (base 8) to base 13. -2b6 What is -33130 (base 7) in base 9? -12344 Convert -3701 (base 9) to base 16. -ac3 What is 3832 (base 11) in base 4? 1032010 Convert 75771 (base 9) to base 15. ed1d Convert -155503 (base 8) to base 15. -11971 1093 (base 11) to base 5 21213 Convert 640c (base 15) to base 2. 101001010101010 16 (base 14) to base 8 24 -735 (base 8) to base 13 -2a9 Convert -4 (base 14) to base 2. -100 Convert 9bf1 (base 16) to base 3. 2000202120 What is 24211 (base 7) in base 6? 45024 Convert 538 (base 9) to base 6. 2012 11101000110001 (base 2) to base 14 5601 What is c94 (base 13) in	{ "pile_set_name": "DM Mathematics" }
tv and give o. 2 Rearrange 13t*4 + 34966t*3 + 6 + 2t - 1 - 34968t3 to o + gt*2 + xt + ft3 + vt*4 and give o. 5 Rearrange 5x4 + x4 - 23x2 - 26x*2 - 10 + 33x*2 + 0x*4 to the form vx + y + rx4 + wx*2 + tx*3 and give w. -16 Rearrange -308h4 + h2 + 4h + h3 + 60703853 - 60703855 + h2 - 4h to zh + ph*2 + ch*3 + jh*4 + r and give r. -2 Rearrange -20v*3 - 21 + 251v*3 + 24 to the form pv*2 + q + zv*3 + uv and give q. 3 Express 93 + 52a - 93 + (3 - 3 + 6)((4a + 2a - 4a)(-2 - 2 + 2) - 18a + a + 11a + 4a - 3a - 3a) as d + va and give v. -20 Express (-n*2 - 3n + 3n)(-794 + 14893 - 6771 + 14953) as xn + qn*2 + w and give q. -22281 Express (-327y*4 + 27y*4 - 34y*4)(3 - 4 + 0)(0 - 1 - 6) as ty*2 + vy*3 + gy*4 + z + qy and give g. -2338 Rearrange -64p2 + 2 + 30p*2 + 874p*2 - p to up*2 + yp + f and give y. -1 Rearrange (-872 + 872 + 23l - 1 + 1 - 2l + (0 + 0 + 2)(2l - 2l - 2l))(1 - 3 + 1)(-3 + 0 + 5)(-2 + 6 + 4) + 0 + 0 - 2l to k + xl and give x. -274 Rearrange (-14 + 22 + 16)(5 - 3 - 6)(-11m + 47m + 12m) to the form gm + s and give s. 0 Rearrange -178 + 0c + 983 - 5c - 3c + 3c to the form i + qc and give q. -5 Express -15314k3 - k + 271k*2 + 15313k*3 + 7 + 2 as sk*2 + d + lk*3 + rk and give s. 271 Rearrange (-144l2 + 285l*2 - 144l*2 - 24l)(-2 + 4 + 6) - l2 + 2l*2 - 5l*2 to the form il*2 + v + dl and give d. -192 Rearrange (-540 + 259 + 63)(30n - 30n - 14n*2) to the form yn + kn2 + q and give k. 3052 Express -48j*2 + 358j + 17j2 - 354j as pj2 + aj + m and give p. -31 Express -5o4 + 236254o*2 - 472513o*2 + 236261o*2 + 3o*3 - 75o as i + lo2 + vo*3 + ho + xo4 and give v. 3 Rearrange -2v*3 + 305v - 53 + 6v2 - 12 + 63 to a + fv*3 + gv + qv2 and give q. 6 Express (-7b + 16 + 3 + 5b)(-12 + 4 - 3)(2b + 2b + 2b)(-3 + 0 + 4) in the form yb + m + ab2 and give m. 0 Express (3 + 63q - 130q + 64q)(-86q*3 - 103q*3 + 37q*3) in the form aq*2 + lq + mq3 + d + bq*4 and give m. -456 Rearrange 380n*2 - 4n - 375n2 - 265n*4 + 2n*3 + 111n*4 to xn*4 + un + sn2 + r + ln*3 and give r. 0 Express -1167 - 4298y - 1172 + 2339 in the form ky + g and give k. -4298 Express 4883w - 2453w - 2430w - 9294w2 as nw*2 + aw + y and give n. -9294 Express (8h - 13h + 1 + 0)(-h + 0h - 3h + (-4h + 2h + 3h)(0 - 32 + 15)) as a + ih + yh2 and give y. 105 Rearrange 347 - 8063a*2 - 647 - 2a*3 + 298 to the form na*3 + r + ba*2 + sa and give b. -8063 Express 6s3 - 6s*3 - 134s*2 - 130s2 + s3 - 14s - 90s*2 as z + ts*3 + us*2 + ys and give t. 1 Express 218p + 243p - 2 - 729p + 8p*2 + 5p*2 + 239p in the form rp + zp*2 + c and give c. -2 Express (522 + 2973 + 4633)(-2n3 + 4n*3 + 0n*3) in the form ln*3 + kn*2 + jn + q and give l. 16256 Express (-1746668 + 1746668 - 38148l)(4l2 + 0l*2 - 2l*2) in the form rl*3 + p + wl*2 + yl and give r. -76296 Rearrange -10112 - r*2 + 827 + 5533 to the form i + qr*2 + nr and give n. 0 Rearrange -1 - 5960c2 + 0 + 2155c*2 + 2281c*2 to ac + fc2 + v and give v. -1 Rearrange (6o - 2o - 2o)(-5o - 59 + 59) + 41 - 41607o - 2o*2 + 41607o to the form so + c + po*2 and give c. 41 Express (410 + 30 + 321 + 1287 + 231)(11 - 11 - 5r) as z + cr and give c. -11395 Rearrange (8i - 8i - 7i)(-8 - 142 - 113 - 313 - 113) to the form g + ji and give j. 4823 Express -3j*2 + 2j*3 - 197 + 0j*2 - 18j*2 + 27j*2 - 5j*2 in the form kj*3 + zj + xj2 + f and give f. -197 Express 878o*3 - 3o + 6o4 - 4o*2 + 881o*3 + 874o*3 - 2630o*3 in the form m + xo*4 + wo*2 + qo + do3 and give q. -3 Rearrange 2q - 6 + 4596q2 - 4586q*2 - 26 to the form kq*2 + d + sq and give k. 10 Express 4z2 + 42z*3 + 0z*2 + 0z*2 - 2z*2 + 1 - 4z - z*2 in the form dz + m + jz3 + wz*2 and give m. 1 Express -2i + 216923i2 - 216924i*2 - 2i - 11 - 3 + 1 in the form oi2 + u + ti and give t. -4 Rearrange -22 + 2l2 - 2l*4 + 11l*4 - 4l - 11 + 0l2 + 53 to the form j + dl*2 + hl*4 + yl + rl3 and give h. 9 Rearrange 1 + 19f*3 + 28f2 - f2 - 26f2 + 5 to the form vf*2 + d + if*3 + mf and give i. 19 Express -44a + 25a + 23a + 649 - 1387 as g + ha and give h. 4 Rearrange 863042d + 227d*2 + 460d*2 - 863035d to qd2 + c + fd and give q. 687 Rearrange (-33 - 38098s2 + 121 - 26 - 62)(s - s - 2s2) to gs*2 + fs*3 + as + d + ms4 and give m. 76196 Rearrange (-61y*2 - 69y*2 - 8y*2)(4 + 1 - 2) + (y - 1 + 1)(y + 0y + y) - 5y2 + 4y*2 + 8y*2 + 0 - 2y*2 + 0 to v + jy*2 + by and give b. 0 Express (3 - 1 + 1)(t + 4 - 4) - 1 + 1 + 15t + (3 + 3 - 5)(-5t - 2t + 15t) + 2t + 4 - 4 in the form i + zt and give z. 28 Rearrange -32h2 + 16h*2 - 153h + 17h2 + 16h*2 - 15h*2 + 18 to yh + gh2 + k and give g. 2 Rearrange (-26 - 39 + 4h + 54)(-222 - 35h + 222) to the form q + bh + gh*2 and give g. -140 Rearrange (1 - 1 - 2)(-10 - 1 + 3)(-41l - 27l - 79l) to gl + k and give g. -2352 Rearrange 5q - 3q4 - 4q*2 + 120q*3 - 2q - 126q3 + 135q*3 to nq*3 + lq*2 + v + oq + cq4 and give o. 3 Express -1 - 3 - 2d + 5 + (-22 + 27 - 58)(-13d - 14d + 14d) in the form y + ad and give a. 687 Express -377j*3 + 159j*2 + 378j*3 - 16j + 13j as fj + uj2 + r + ij*3 and give i. 1 Rearrange 8j - 6 + 307j2 + 295j*2 - 3j*3 - 625j*2 + 4 to tj*3 + xj*2 + c + sj and give t. -3 Rearrange (-3 - 1 - 6)(-4 - 6 + 1)(23r2 + 24r*2 - 18r*2) to br*2 + q + vr and give b. 2610 Rearrange 103g - 219g + 113g + 2566 to w + zg and give w. 2566 Express 44k + 49 + 44 + 26k - 14k + 8k in the form hk + t and give h. 64 Rearrange -f - 3f + 6f - 2 + f + 8 + 3 + (-68 + 68 + 59f)(-4 + 5 + 1) to x + df and give d. 121 Express (5n2 - 2n*2 - 2n*2)(1605 - 591 - 595) in the form xn + r + hn*2 and give h. 419 Rearrange -w + 3 - 3 + (3 - 3 + 1)(1894w - 634w - 49399w - 131092w) to the form o + kw and give k. -179232 Express -318c*2 + 9c*3 + 318c*2 + 233c in the form jc + xc*3 + mc*2 + q and give j. 233 Rearrange 2 + w - 2 - w + 4w - 4w + (-5w + 0w + 6w)(0 + 6 - 4) - 36w - 64w - 8w - 8w + 4w - 4w - 5w - w + 0w to x + fw and give f. -120 Rearrange -2r2 - 4r*3 + 6r - 49r3 + 2 + 71r*3 - 3r*2 + 4r*2 to the form ir*3 + qr*2 + y + jr and give q. -1 Express (-4a3 - 6a*3 + 2a*3)(-17a + 166a - 92a)(-4 + 3 - 1) as la4 + x + pa + ta2 + ua*3 and give l. 912 Express -184 + 350 - 199 + 29c as yc + s and give s. -33 Rearrange (-2 - 5 + 12)(-3 + 2m + 3)(0 + 0 - 1)(3m*3 - 1 - 1 - 47)(1 + 4 - 3) to c + um + qm*4 + bm*3 + hm*2 and give u. 980 Rearrange (-424s*3 + 62s*3 - 107s*3)(4 + 6s - 4) + (2s + 5s - 4s)(s3 - 4s*3 + 2s*3) to cs*4 + ds*3 + as*2 + zs + w and give c. -2817 Rearrange (38301v - 87292v + 43978v)(-1 + 4v - 1 - 7v) to ov + sv*2 + g and give s. 15039 Express 23 - 4o*2 - 4o + 1 - 80o3 + 45o*3 + 31o*3 as ro*3 + zo + jo2 + x and give z. -4 Rearrange 0d2 - d3 + 3d3 - 2d*2 + (0d - 2d + 3d)(-3d*2 + 4d2 + d2) - 7145148 + 7145148 + 555d3 to pd*2 + cd + nd3 + t and give n. 559 Rearrange -1027381 + 10838i + 1027381 to the form li + v and give l. 10838 Rearrange -18 + 42 - 2458a - 24 + 293a + 3a*2 to s + wa*2 + ta and give s. 0 Rearrange (28d4 - 424d*3 + 424d*3)(3 + 8 + 1) + (0d + 3d - d)(2d*3 + 2d*3 - 7d*3) to w + od*4 + rd*2 + qd*3 + ud and give o. 330 Rearrange ((0 + 1 + 1)(2 - 1 - 2)(8084 - 256p3 - 8084) + 4 - 4 - p3)(6p - 2p + 0p)(1 - 4 - 1) to wp3 + kp + a + xp4 + rp2 and give k. 0 Express 3 - p3 - 4 + 0p3 + 0p4 - p4 - 5936p + 5939p in the form sp + np*4 + tp*3 + xp*2 + u and give n. -1 Express -3119t*2 - 2 + 201t*4 + 3314t*2 - 205t*4 in the form dt*3 + it + z + wt4 + nt*2 and give w. -4 Express (0 + 0 - d)(2815d + 2809d - 5620*d + 2144 - 81	{ "pile_set_name": "DM Mathematics" }
+ 190g. -463g Collect the terms in -249g2 - 4 + 250g2 + 5 - 1. g2 Collect the terms in 25 - 3h - 2 - 23. -3h Collect the terms in 1 - 941r2 + 0r + 0r. -941r*2 + 1 Collect the terms in -24m*2 + 1073 - 1073. -24m*2 Collect the terms in -j + 13j + 0j. 12j Collect the terms in -2 + 0 + 2 + 10x3. 10x*3 Collect the terms in -55c*3 + 19c*3 + 18c*3 + 20c*3. 2c*3 Collect the terms in -8i - 484i2 - 4i + 467i2. -17i*2 - 12i Collect the terms in -11t3 + 5t*3 + 26t*3 - 4t*3 - 11t*3 - 4t3. t3 Collect the terms in -2a3 + 10a*3 - 619 + 619. 8a3 Collect the terms in v2 - 10981v + 10981v. v*2 Collect the terms in 31o*2 + 19o*3 - 31o*2. 19o*3 Collect the terms in 4 - 3 - 8u + 0u. -8u + 1 Collect the terms in 6168 - 6168 - 5t2. -5t*2 Collect the terms in -44u*3 - 3u + 48u3 + 3u. 4u3 Collect the terms in 14d - 12d - 16d - 15d. -29d Collect the terms in 0d3 - 3d*3 + 0d*3 + 2d3. -d3 Collect the terms in -67k2 + 8k*2 + 8k*2. -51k*2 Collect the terms in -53a + 16a + 22a. -15a Collect the terms in 53y + 56y + 50y + 40y. 199y Collect the terms in -f - 4f3 + 8089 + f - 8089. -4f3 Collect the terms in 0 - y2 + 0 - 5y2. -6y*2 Collect the terms in -3n + 3n - 7n. -7n Collect the terms in -315s + 315s + 14s*3. 14s*3 Collect the terms in 9 - 17q*2 - 9. -17q*2 Collect the terms in 101v*2 + 8v + 3v - 7v - 5v. 101v*2 - v Collect the terms in 4c - 11c + 7c + 17c3. 17c*3 Collect the terms in 1 + 11f + f + 10f. 22f + 1 Collect the terms in -6d + 0d - 2d + 3d. -5d Collect the terms in 18g + 5g2 - 8g - 10g. 5g*2 Collect the terms in 12h*2 + 10h*2 - 13h*2. 9h*2 Collect the terms in -2z*2 + 80z - 73z + z2. -z2 + 7z Collect the terms in -35v2 + 2v*2 - 5v*2 + 6v*2. -32v*2 Collect the terms in 96r*2 + 67r*2 + 17r*2. 180r*2 Collect the terms in 4 - 4 + 11n. 11n Collect the terms in 187316y + 187317y - 374634y. -y Collect the terms in 6 + p - 7p2 - p. -7p2 + 6 Collect the terms in -a2 + 9936a3 - 9951a3 + a2. -15a3 Collect the terms in -19n + 5n - 4n - 8n. -26n Collect the terms in u*2 - 6u*2 - 4u*2. -9u*2 Collect the terms in 110i - 54i + 80i. 136i Collect the terms in 119o*3 - 200o*3 + 2o - 2o + 79o*3. -2o*3 Collect the terms in -11f + 23f + 42f. 54f Collect the terms in -18 + 18 + 5v*3 + 13v*3. 18v*3 Collect the terms in 0o*2 - 9o*2 + 40o*2. 31o*2 Collect the terms in -86i*2 - 79i*2 + 164i2. -i2 Collect the terms in -46a2 + 1352 - 1352. -46a*2 Collect the terms in 4496j*3 + 0j*2 - 4499j*3 + 0j*2. -3j*3 Collect the terms in 14k + 4 - 4 - 7. 14k - 7 Collect the terms in -509r*2 + 123r*2 + 34r*2 - 367r*2. -719r*2 Collect the terms in 20959 + 9q - 20959. 9q Collect the terms in -6i*3 - 11i*3 - 8i*3. -25i*3 Collect the terms in -8w - 6 - 4 + 10. -8w Collect the terms in 15 - 25 + 10 - t. -t Collect the terms in -5j - 10j + 5j. -10j Collect the terms in -14978 + 3p*2 + 7489 + 7489. 3p*2 Collect the terms in -1 - 367z*3 + 1 + 372z*3. 5z*3 Collect the terms in -7t*2 - 4t*2 + 3t + 12t2 + 20t*2. 21t*2 + 3t Collect the terms in -190q3 + 390q*3 - 194q*3. 6q*3 Collect the terms in -4 - 6 - 122y*3 + 10 + 124y*3. 2y*3 Collect the terms in 3p*2 + 3064p - 3064p. 3p*2 Collect the terms in -258s + 136s + 122s - 5s2 + 4s2. -s2 Collect the terms in 36 - 17 - 19 + 11b2. 11b*2 Collect the terms in 12y*3 - 2y - 20y3 + 2y. -8y3 Collect the terms in -6 + 6 + 0 + 2640p. 2640p Collect the terms in -53n*3 - 41n*3 + 187n*3 - 67n*3. 26n*3 Collect the terms in 5m + m - 4m. 2m Collect the terms in 1331g - 2673g + 1341g. -g Collect the terms in 3 + 0i - 6i + 2i - 2i. -6i + 3 Collect the terms in -n - n - 7n. -9n Collect the terms in z + z + 13 - 28 + 35. 2z + 20 Collect the terms in 0 + 3 - 3 + 12 - 2p. -2p + 12 Collect the terms in -a + 1 + 2a + 2a. 3a + 1 Collect the terms in -v*2 + 469v*3 + 0v + 0v. 469v3 - v2 Collect the terms in -52 - 30 + 76p + 82. 76p Collect the terms in 5078x - 7x*2 - 5078x. -7x2 Collect the terms in 5p + 12p3 - 5p. 12p3 Collect the terms in -20m*3 + 7m*3 + 18m*3. 5m3 Collect the terms in s3 - 21s + 21s. s*3 Collect the terms in 20g*2 - 65g*2 + 21g*2 + 29g*2. 5g*2 Collect the terms in -2s*2 + 76s - 39s + 4s*2 - 13s. 2s2 + 24s Collect the terms in 45k2 + 43k*2 - 32k*2. 56k*2 Collect the terms in 1247u - 257u + 4 - 4 + 1. 990u + 1 Collect the terms in -27i + 10i - i - i2. -i2 - 18i Collect the terms in -y3 - 3y + 4y + 2y3. y3 + y Collect the terms in 7 + 3x - 11 + 12 - 8. 3x Collect the terms in 49w2 - 27w*2 - 29w*2 - 20w*2. -27w*2 Collect the terms in 150d*2 + 0d + 0d - 99d*2. 51d2 Collect the terms in b3 + 9b3 - 3b*3. 7b*3 Collect the terms in -5d*3 + 4d*3 - 12d*3 - 7d*3. -20d*3 Collect the terms in 166q - 495q + 162q + 165q. -2q Collect the terms in 29x3 - 51x*3 + 20x*3. -2x3 Collect the terms in -1655 + t2 + 1655. t*2 Collect the terms in -2h + 6h - 70h. -66h Collect the terms in -12l*2 - 15l*2 - 20l*2 + 45l*2. -2l*2 Collect the terms in 5734g*3 - 11462g*3 + 5730g*3. 2g*3 Collect the terms in -5t + 325t2 + 5t + 0t. 325t*2 Collect the terms in 129j*2 + 30j*2 - 2j - 46j2. 113j*2 - 2j Collect the terms in 4383n - 14n*3 + 15n*3 - 2194n - 2189n. n3 Collect the terms in -42w*2 + 67w*2 - 26w2. -w2 Collect the terms in -5 + 5 - 2 + 2 - 2g. -2g Collect the terms in -170b3 + 165b*3 + 0b*2 + 0b*2. -5b*3 Collect the terms in -3d - d + 3d - 45. -d - 45 Collect the terms in -2z*3 - 200710z*2 + 200710z*2. -2z*3 Collect the terms in 26t + 19t + 16t - 62t. -t Collect the terms in -2m*2 - 5m2 + m2 + 5m2 + 65m. -m*2 + 65m Collect the terms in 3d + 9d + 66d2 - 12d. 66d2 Collect the terms in -1 - 7 + 3j + 6 + 2. 3j Collect the terms in 7f - 20f + 17f. 4f Collect the terms in 4d - 4d - 4d + 3d. -d Collect the terms in 64 - 32 + 46m*2 - 32. 46m*2 Collect the terms in -68g*2 + 5g*2 + 10g*2. -53g*2 Collect the terms in 13 - 3z - 6 - 7. -3z Collect the terms in 944s*2 - 488s*2 - 458s*2. -2s2 Collect the terms in c2 - 20c2 + 4c2 + c3 - 13c2 - 7c2. c3 - 35c2 Collect the terms in 3l*2 + 2 - 3l*2 - 539l*3. -539l*3 + 2 Collect the terms in 27t*3 - 5t*3 + 0t2 - t2. 22t3 - t2 Collect the terms in -125z + 64z + 62z. z Collect the terms in -1870 + 1870 - s3. -s3 Collect the terms in 59 - 59 + 12t. 12t Collect the terms in 39 - 3r - 3 - 36 + 0r. -3r Collect the terms in -619s*2 - 2s + 2s. -619s*2 Collect the terms in -3d*3 + 8d*3 - 17d*3. -12d*3 Collect the terms in 63i - 16i3 - 64i - 8 + 8. -16i3 - i Collect the terms in 158 - 158 + 4r*2. 4r*2 Collect the terms in -2q*3 + 27q*3 + 0q*3 - 23q*3. 2q*3 Collect the terms in -95g - 81g + 161g. -15g Collect the terms in -8w*2 + 674w - 674w. -8w*2 Collect the terms in -69g*2 + 18g*2 + 25g*2 + 19g*2. -7g*2 Collect the terms in -15p + p*2 + 34p + 2p2 - 19p. 3p2 Collect the terms in -5j*2 + 2j2 - j2 - j*2. -5j*2 Collect the terms in 218u*3 - 182u*3 + 421u*3. 457u*3 Collect the terms in -3x*3 + 11x*3 + 4x*3. 12x*3 Collect the terms in -28j*3 + 3 + 3j*2 - 3 + 29j3. j3 + 3j2 Collect the terms in -22f*3 - 26f*3 - 71f*3 - 35f*3. -154f*3 Collect the terms in -3x - 5x + 6 + x. -7x + 6 Collect the terms in -596q - 5 + 0 - 267q. -863q - 5 Collect the terms in 0g*2 - 44g - 46g + 3g*2 + 90g. 3g2 Collect the terms in 21g*3 - 367g*2 + 367g*2. 21g*3 Collect the terms in 27t*2 - 31t*2 + 27t*2. 23t*2 Collect the terms in -183v*2 + 0v3 - v3 + 95v2 + 88v2. -v3 Collect the terms in 4590 - 4590 + 15w2. 15w*2 Collect the terms in -1 - 14b + 1 - b*3 + 5	{ "pile_set_name": "DM Mathematics" }
941, -4103, -4267, -4433, -4601, -4771? -f*2 - 157f - 3623 What is the z'th term of 4475, 7125, 9775, 12425, 15075, 17725? 2650z + 1825 What is the k'th term of -18344, -32143, -45942? -13799k - 4545 What is the n'th term of 9287939, 37151875, 83591769, 148607621, 232199431? 9287979n2 - n - 39 What is the y'th term of -482, -506, -544, -602, -686, -802? -y3 - y2 - 14y - 466 What is the l'th term of -123300289, -123300294, -123300299, -123300304? -5l - 123300284 What is the h'th term of 13832849, 13832848, 13832847, 13832846? -h + 13832850 What is the y'th term of 216, -540, -1874, -4074, -7428? -48y3 - y2 - 417y + 682 What is the g'th term of -6802, -7124, -7434, -7732? 6g*2 - 340g - 6468 What is the x'th term of 2640757, 2641412, 2642069, 2642728, 2643389? x*2 + 652x + 2640104 What is the k'th term of 42893, 86237, 129581, 172925, 216269, 259613? 43344k - 451 What is the c'th term of 1019, 1987, 2691, 3131, 3307? -132c*2 + 1364c - 213 What is the k'th term of 1944, 3887, 5726, 7407, 8876, 10079, 10962? -9k3 + 2k*2 + 2000k - 49 What is the i'th term of 211, -81, -377, -677? -2i2 - 286i + 499 What is the v'th term of 5991, 12280, 18571, 24864? v*2 + 6286v - 296 What is the v'th term of -1604, -1969, -2338, -2711? -2v2 - 359v - 1243 What is the f'th term of -1880, -3758, -5662, -7610, -9620? -3f3 + 5f*2 - 1872f - 10 What is the v'th term of 1212, 9750, 32906, 77988, 152304, 263162, 417870? 1218v3 + v2 + 9v - 16 What is the i'th term of -29820, -36178, -42536, -48894? -6358i - 23462 What is the y'th term of 558679, 557657, 556635, 555613? -1022y + 559701 What is the x'th term of 9470, 7850, 5162, 1412, -3394, -9250, -16150? x*3 - 540x*2 - 7x + 10016 What is the b'th term of -86011, -168019, -250027, -332035? -82008b - 4003 What is the j'th term of -20185, -38738, -57293, -75850, -94409, -112970? -j2 - 18550j - 1634 What is the j'th term of -416, -2988, -9818, -23036, -44772, -77156, -122318? -355j3 + j2 - 90j + 28 What is the z'th term of -8233551, -8233553, -8233555, -8233557? -2z - 8233549 What is the o'th term of 908918, 909085, 909256, 909431? 2o*2 + 161o + 908755 What is the b'th term of 1465341, 2930677, 4396013? 1465336b + 5 What is the x'th term of -623, -1097, -1497, -1799, -1979, -2013, -1877, -1547? 4x*3 + 13x*2 - 541x - 99 What is the a'th term of 5990, 9265, 12538, 15809, 19078, 22345? -a*2 + 3278a + 2713 What is the a'th term of 6299, 12166, 18021, 23858, 29671, 35454, 41201? -a*3 + 5874a + 426 What is the k'th term of -22, 157, 458, 875, 1402? -k*3 + 67k*2 - 15k - 73 What is the a'th term of 122758, 122849, 122940, 123031? 91a + 122667 What is the n'th term of -871, -2832, -6115, -10714, -16623? n3 - 667n*2 + 33n - 238 What is the m'th term of -9251480, -18502960, -27754440? -9251480m What is the z'th term of -127311, -254639, -381967, -509295, -636623, -763951? -127328z + 17 What is the h'th term of 204781, 407599, 610417, 813235, 1016053, 1218871? 202818h + 1963 What is the w'th term of -120276, -240379, -360482, -480585, -600688? -120103w - 173 What is the c'th term of -8715, -17268, -25821, -34374, -42927, -51480? -8553c - 162 What is the c'th term of -1002403, -4009630, -9021675, -16038538? -1002409c*2 + 6 What is the v'th term of 98123, 98145, 98167, 98189? 22v + 98101 What is the z'th term of -12245, -24385, -36473, -48503, -60469, -72365, -84185, -95923? z*3 + 20z*2 - 12207z - 59 What is the g'th term of 3882, 2737, 1700, 825, 166, -223? 9g3 - 1208g + 5081 What is the a'th term of -789938, -789908, -789878? 30a - 789968 What is the o'th term of -2499, -3078, -3683, -4320, -4995? -o3 - 7o*2 - 551o - 1940 What is the q'th term of 4856320, 9712687, 14569054, 19425421, 24281788? 4856367q - 47 What is the t'th term of 853, 970, 1315, 2008, 3169, 4918, 7375? 20t*3 - 6t*2 - 5t + 844 What is the w'th term of -486937523, -973875045, -1460812567, -1947750089, -2434687611, -2921625133? -486937522w - 1 What is the a'th term of -6083, -5900, -5585, -5138, -4559, -3848? 66a*2 - 15a - 6134 What is the r'th term of -7093703, -14187396, -21281083, -28374764, -35468439? 3r2 - 7093702r - 4 What is the u'th term of -2764, -856, 1052, 2960? 1908u - 4672 What is the u'th term of 79297, 79298, 79299, 79300? u + 79296 What is the t'th term of -275192432, -275192434, -275192436, -275192438, -275192440, -275192442? -2t - 275192430 What is the n'th term of 2159, 3622, 5087, 6554, 8023? n*2 + 1460n + 698 What is the y'th term of 3239, 6177, 8959, 11591, 14079, 16429, 18647? y*3 - 84y*2 + 3183y + 139 What is the g'th term of 81916, 82015, 82114? 99g + 81817 What is the t'th term of -2179226, -4358444, -6537662? -2179218t - 8 What is the p'th term of -2306, -3613, -3920, -3227, -1534, 1159? 500p2 - 2807p + 1 What is the y'th term of -9200578, -9200575, -9200572, -9200569? 3y - 9200581 What is the d'th term of -9354, -8470, -7600, -6744, -5902, -5074? -7d*2 + 905d - 10252 What is the i'th term of 155701, 155615, 155515, 155395, 155249, 155071, 154855, 154595? -i3 - i2 - 76i + 155779 What is the p'th term of -14379, -24968, -35557, -46146, -56735, -67324? -10589p - 3790 What is the a'th term of -24340, -26259, -28178? -1919a - 22421 What is the h'th term of 5372, 8949, 12526, 16103? 3577h + 1795 What is the o'th term of 13826912, 27653793, 41480674, 55307555, 69134436, 82961317? 13826881o + 31 What is the q'th term of 170111, 170277, 170545, 170909, 171363, 171901, 172517? -q3 + 57q*2 + 2q + 170053 What is the o'th term of 169673, 169448, 169221, 168992, 168761, 168528, 168293? -o*2 - 222o + 169896 What is the j'th term of 1367457, 1367465, 1367473, 1367481, 1367489, 1367497? 8j + 1367449 What is the t'th term of 118736, 118623, 118510, 118397, 118284, 118171? -113t + 118849 What is the c'th term of -16719, -19614, -22509, -25404? -2895c - 13824 What is the u'th term of -26994220, -26994221, -26994222? -u - 26994219 What is the z'th term of -7388, -30002, -67820, -120836, -189044, -272438, -371012? z3 - 7608z*2 + 203z + 16 What is the p'th term of -333, -1834, -4493, -8310? -579p2 + 236p + 10 What is the w'th term of 178, 3355, 13688, 35299, 72310? 687w3 - 544w*2 + 35 What is the a'th term of -863103502, -863103501, -863103500? a - 863103503 What is the v'th term of 2561921, 5123806, 7685695, 10247588? 2v*2 + 2561879v + 40 What is the a'th term of -9456957, -9456951, -9456941, -9456927, -9456909, -9456887? 2a2 - 9456959 What is the m'th term of -39359, -39278, -39193, -39104, -39011? 2m*2 + 75m - 39436 What is the o'th term of 4038566, 8077169, 12115772, 16154375? 4038603o - 37 What is the i'th term of 4123523, 4123509, 4123461, 4123361, 4123191, 4122933, 4122569? -3i3 + i2 + 4i + 4123521 What is the t'th term of -147992, -148032, -148104, -148208, -148344, -148512? -16t*2 + 8t - 147984 What is the b'th term of 100845226, 100845220, 100845212, 100845202, 100845190, 100845176? -b*2 - 3b + 100845230 What is the z'th term of 25203, 201260, 679119, 1609680, 3143843? 25150z3 + z2 + 4z + 48 What is the x'th term of -17452, -17671, -17890, -18109? -219x - 17233 What is the y'th term of -4960860, -4960877, -4960894, -4960911? -17y - 4960843 What is the h'th term of -1774, -947, -120, 707? 827h - 2601 What is the r'th term of -505179, -1010318, -1515457, -2020596, -2525735, -3030874? -505139r - 40 What is the x'th term of 5538, 21626, 48460, 86046, 134390, 193498, 263376? x*3 + 5367x*2 - 20x + 190 What is the x'th term of -196346, -196315, -196274, -196229, -196186? -x*3 + 11x*2 + 5x - 196361 What is the c'th term of 71402724, 142805447, 214208170, 285610893, 357013616, 428416339? 71402723c + 1 What is the v'th term of -232852, -232516, -231948, -231142, -230092, -228792? v3 + 110v*2 - v - 232962 What is the q'th term of 5862, 1988, -1886, -5760, -9634, -13508? -3874q + 9736 What is the i'th term of -641, -1275, -1841, -2303, -2625, -2771, -2705, -2391? 6i3 - 2i*2 - 670i + 25 What is the g'th term of -198, -62, 328, 1098, 2374, 4282, 6948? 21g3 + g2 - 14g - 206 What is the j'th term of -389364, -1556767, -3502446, -6226407,	{ "pile_set_name": "DM Mathematics" }
lve 4x + 3 = m, -3m + 3249x - 3244x = -2 for m. -1 Solve -3c + 507 = -5l + 518, -8 = -2l for c. 3 Solve r - 3q - 18 = 0, 0 = 2r - 5q - 168 + 137 for r. 3 Solve 531 = 5h - 2c + 557, -4c = 5h - 52 for h. 0 Solve -4i + 5y - 10 = 0, i + 3i + 166 = 31y for i. 5 Solve -3i = -12, 16419i - 16418i - 29 = -5x for x. 5 Solve 4r - 175l - 2 = -177l, -5r + 5 = 2l for r. 3 Solve 2b + 5z = -34, 2z - 11 + 42 = 5b for b. 3 Solve 5g + 21 = -2z, 12z - 4g = 8z for z. -3 Solve 8553u - 8546u = -21, -3g + 3u - 27 = 0 for g. -12 Solve -4u - 2a = -38, -49 + 54 = 4u - a for u. 4 Solve 15z + 4d + 184 + 209 = 0, -84 = 3z - d for z. -27 Solve 5m = 20, -4f - 578m = -579m + 24 for f. -5 Solve 0 = b + 5v + 14, 160 - 152 = b - 6v for b. -4 Solve 0 = 3o + t + 19, -78o + t = -76o + 6 for o. -5 Solve 2y = -2i, 2y - y = -5i - 16 for y. 4 Solve h = -5f + 113, -3f = 871h - 872h - 63 for h. 3 Solve -3i = -5c - 3, -136512 = 7i + c - 136481 for i. -4 Solve 0t - 3 = -3p + 6t, -10t + 7t = 18p - 213 for p. 11 Solve -11s + 41z - 38z - 113 = 0, 7 = 7z for s. -10 Solve -227t - 3x = -232t + 40, 2t + x = 5 for t. 5 Solve -7j + 15 = 83z - 79z, 0 = -5j + 3z - 1 for j. 1 Solve 0 = -3v + 14g - 15g - 28, 5v + 40 = 5g for v. -9 Solve 60u - 11 + 32 = 59u + 4z, -4z + 24 = 0 for u. 3 Solve -3h = 2f - 13, 5h - 2f + 8f - 35 = 0 for h. 1 Solve -3a = -7t + 24, -21a - 12 = -18a - 3t for a. -1 Solve -196 = -2c + 5u - 183, 3c - 4u = 16 for c. 4 Solve -i - 9 = 4u - 14, -u + 24 = -3i for u. 3 Solve -622p - 11 = -618p + c, 0 = 5p + c + 16 for p. -5 Solve -5a - 7 = n, -4a + 11729 = 2n + 11737 for n. -2 Solve 5i + 25 = -2m, 75 - 41 = -5m - 3i for m. -5 Solve -13p - 3c + 30 = -8p, -5p + 3c + 30 = 0 for p. 6 Solve -z + 13 = -x, 5x = -z + 303 - 302 for z. 11 Solve 5p + 3r = -69, -4r = -2p - 1094 + 1186 for p. 0 Solve 2f = -3b + 13, 0 = 5b - 13 - 12 for f. -1 Solve 30 = -11v - 10v + 16v, -2g = v + 12 for g. -3 Solve 4q + 215p = 213p - 16, 5q + p = -17 for q. -3 Solve 0 = -f - 3u + 8, -3u = 2f + 175 - 185 for f. 2 Solve 0 = -3y - 2l, y = 3y - 2y - 5l - 15 for y. 2 Solve 358h - 3g + 10 = 353h, 0 = -5h - g - 30 for h. -5 Solve -3t - 16 = 3x + 14, t - 5 = 2x for x. -5 Solve -3n - 8 = -4v, -514n + 16 = -517n - 4v for n. -4 Solve -3g + 56 = 3y + 7g, 0 = -5y - 3g + 25 for y. 2 Solve 0 = 4m - 4h - 8, -127h = -m - 130h + 14 for m. 5 Solve -3y + 23 - 46 = n, -3n - 3 = -2y for n. -5 Solve -g - 7 = -j, -10j - 5g = -132 + 107 for j. 4 Solve 140y - 125 = -26j + 145y, -2y = 4j - 22 for j. 5 Solve -5f = -6l - 8 + 9, -3l - 3f = -6 for l. 1 Solve 374j + 4o + 20 = 379j, -2j + 13o = -8 for j. 4 Solve 86o - p = 87o - 18, p - 13 = 4o for o. 1 Solve -y = -3g, -886y + 883y - 5g = 0 for y. 0 Solve 4t = 5h + 44 - 49, 2t + 1 = h for h. 1 Solve 0 = 5y - 5, -1025y - 21 = -3k - 1028y for k. 6 Solve 490s - 5j = 487s - 31, -4s + s + 9j - 51 = 0 for s. -2 Solve -2d + 5c + 21 = 14, 0 = 2d + 5c + 23 for d. -4 Solve 5n - 37 = -s, -154s + 5n - 31 = -152s for s. 2 Solve 5y = -37u + 105, 4y - 2u - 54 = 8y for y. -16 Solve 48w - 53w - l = 40, -2l - 50 = 4w for w. -5 Solve 138 = k - 4d + 177, 0 = -k - 3d + 31 for k. 1 Solve 21i = -z + 30i - 12, 2z = 3i + 21 for z. 15 Solve 5w + 3u - 14 = 0, -25599 = 3w + 5u - 25617 for w. 1 Solve 2o + 11 = -5a, 666o - 664o + 8 = -2a for o. -3 Solve 0z - 5z + n = 25, -3n = 5z + 5 for z. -4 Solve -4 = 4r, 31h = 13h + 17h + 11r + 3 for h. -8 Solve 0 = -o + 3c + 10, 3o + 4c + 59 = 37 for o. -2 Solve -837p + 27 = -s - 842p, 4s = 4p + 12 for s. -2 Solve -3j = 4r - 4, 57r - 4j = 61r for r. 4 Solve 0 = 4z - 21i - 26, -4z - 69i - 20 = -67i for z. -4 Solve -5c = 5y - 33 + 38, 5c - 3y - 19 = 0 for c. 2 Solve 4 = 4o, 22o = -2v + 10o + 14 for v. 1 Solve -5 = 2w + 3z, -3z + 15 = 4w + 10 for w. 5 Solve -27j - 4d - 4 = -29j, -5j + 13 = -7d for j. 4 Solve -5b + 13 = -4w, 0 = w - 77b + 79b for w. -2 Solve -4 = 3d - 4i, 0 = -53i + 51i - 10 for d. -8 Solve 5c - 45 = -5o, o - c = 10282 - 10281 for o. 5 Solve 11h - 15h + 32 = -4c, c = -2h + 22 for h. 10 Solve 64 - 52 = 2f + 3z, 5z = f + 7 for f. 3 Solve -4t + 2i = -2, -195t + 193t - 20 = 6i for t. -1 Solve -2j = s - 40 + 56, 0 = 2s + 3j + 24 for s. 0 Solve -4218w + 4213w + 28 = 3m, -19 = -4m - 3w for m. 1 Solve -2b - 4w = -14, -2 = -190b + 194b + 2w for b. -3 Solve v - 24f + 21f + 17 = 0, -23 = -v - 5f for v. -2 Solve 0 = -2o + 5t + 15, -549o + 9 = -551o - 3t for o. 0 Solve 2857o = 2871o + 4w - 4, 5w - 34 = -3o for o. -2 Solve -4s - 5d = 25, -24 = -1688s + 1693s - d for s. -5 Solve 3x = 3z - 39, 82x + 424 = 88z + 84x for z. 5 Solve i - 3t - 197 = -191, 0 = 5i - t + 12 for i. -3 Solve 0 = 5v + 3x + 5, -6v - 3v + 5 = 6x + 17 for v. 2 Solve -4w = 2y + 1 - 23, 0 = 15y + 7w - 96 for y. 5 Solve 2d = b + 2b + 17, -29 = 13d + 4b - 116 for d. 7 Solve 4 = -2w - 4i, 724i - 18 = -3w + 726i for w. 4 Solve -j + 5u - 55 = 0, 3j - 35628u + 35630u = 39 for j. 5 Solve 2k - 7 = h, 344k + 3h + 36 = 355k for k. 3 Solve -2q + 5k = 31, -2k = -2377q + 2373q - 22 for q. -3 Solve 112h - 109h = 3w - 42, -h + 5w - 34 = 0 for h. -9 Solve 68f - 75f - 2t = 64, -5f = -t + 53 for f. -10 Solve -437b + 442b = -16 + 1, 0 = c + 5b + 19 for c. -4 Solve -61g + 27 = -66g - 2s, 0 = -10g + 3s - 47 for g. -5 Solve 272f = y + 303f - 683, 4y - 70 = -3f for y. 1 Solve 0 = -2i - 2w - 22, -1152w - 51 = 5i - 1151w for i. -10 Solve -4p + 5h - 25165 + 25140 = 0, 8h = 2p + 40 for p. 0 Solve 0 = -3r - 4v + 19, -9r - 4v = -7r - 14 for r. 5 Solve 5q + 25 = -r, 2343r - 4q - 42 = 2346r for r. -10 Solve -m + k = 4m + 16 + 28 + 71, -4k = 0 for m. -23 Solve y - 4 = c, -2c + 35058 - 35050 = 2y for y. 4 Solve 147t - 1 = 148t - 5h, -4t = -8h - 8 for t. 4 Solve 11c - 52 = 84b - 83b, -5c + b + 22 = 0 for c. 5 Solve -h = -2s + 4, 4296s + 16 = 4301s - 4h for s. 0 Solve 26l + j = 22l + 31, 0 = 5l - 3j - 26 for l. 7 Solve -w - 24 = v - 22, -5v - 4w = 12 for v. -4 Solve 10p + 5i = 5, 5p - 19 = 29i - 26i for p. 2 Solve -633o + 635o + 8 = 5l, -5l = -o + 1 for l. -2 Solve -14693c = -14689c + 3s + 4, 5s = 2c + 28 for c. -4 Solve -9n + 3f + 30 = 0, -2f + 15 = 184n - 183n for n. 5 Solve -2n = -r, 0 = 339r - 323r - 4n for r. 0 Solve 0 = -5t + b + 6, -2t - 21b - 3 = -16b for t. 1 Solve -2i - 3k + 9 = 0, -5i - 294k + 20 = -289k for i. 3 Solve 4x - 4463c + 4461c = 12, 0 = -2x + 4c for x. 4 Solve 3v - 34 = 4g, -4g - 493 + 477 = -2v for v. 18 Solve 3h - 8 = -4z, -204h = 5z - 225h - 10 for z. 2 Solve u - 4b + 9 = 0, 0 - 1 = -b for u. -5 Solve 2n + 54 = 5v + 26, -n - 14 = -4v for v. 0 Solve -152q + 156q = -l + 19, 4l - 4 = -4q for l. -5 Solve -25 = 86w - 91w + p, 5 = w - 7p + 10p for w. 5 Solve 0 = -a + 3r - 32, 5r + 74 = -3a + 104 for a. -5 Solve -3z - 1610g = -1607g - 3, z + 2g + 1 = 0 for z. 3 Solve 0 = -u + 3p - 1, 86p - 84p = -u - 6 for u. -4 Solve -3b - w = 1367 - 1357, 2w = 4b + 10 for b. -3 Solve 0 = -5t - 9 - 1, -5t - 46 = 4b for b. -9 Solve 54j - 58j + 4r - 28 = 0, -3j - 19 = -r for j. -6 Solve -9q - 887h = -888h + 31, 0 = q + 2h + 14 for q. -4 Solve 0 = c + 5y + 3, -3c - 65y + 66y + 7 = 0 for c. 2 Solve -18q + t = -19q + 9, 3t = -6q + 45 for q. 6 Solve i - 45 = -7u - 7, 3i - 4u = -11 for i. 3 Solve -35192f + 35193f = t - 2, 3f - 5t + 18 = 0 for f. 4 Solve 5z - 8 = 56t - 57t, -3z = -2t - 10 for t. -2 Solve -4n - 2t = 0, -n - 3 = -2t + 2 for n. -1 Solve 0 = p + 2c - 1, 12p - 7p = -5c for p. -1 Solve -3z + 2l + 23 = 16, z + 3l - 17 = 0 for z. 5 Solve 5q = 9q + 3j - 14, -3q - 21 = -3j for q. -1 Solve 12v - 116 = 2f, -48 = -1089f + 1092f - 4v for f. -4 Solve 5o = -20b, -5o - 5b + 3b = -4o + 2 for o. -4 Solve 41p = 3n + 37p + 76, -3n - 92 = -5p for n. -4 Solve -4g - 5n - 16 = 0, 0 = 364g - 359g - 4n - 21 for g. 1 Solve -s - 22 = 4o, -7s + 43 = -o - 26s for o. -5 Solve 2g - 6 = 4c, 28g - 4c = 33g + 27	{ "pile_set_name": "DM Mathematics" }
r m. 3 Let n be ((-6)/(-5))/(14/(-35)). Let d be -10n3/18. Solve -dh = 9 + 6 for h. -3 Let n(s) = s2 - 9s + 3. Let r be n(9). Let w(g) = 2g3 + 2. Let m be w(r). Suppose m = 3z - 4. Solve z = -3f + 8 for f. -4 Suppose 0a + 5a = 0. Let q(p) = 6p - 1. Let b be q(1). Suppose -263 = -4g - 255. Solve a = bt - gt - 6 for t. 2 Let r(t) = -4t*2 + 4t + 2. Let m be r(-2). Let i = m - -22. Let c be (30/3)/(21). Solve i = -cb - 0b - 25 for b. -5 Let y = -364 + 366. Solve -4g = -yg - 6 for g. 3 Let i(y) = -4y*2 + 14y - 2. Let m be i(3). Solve -h + m = -0 for h. 4 Let h(d) = -2d2 - 13d - 2. Let g be h(-5). Let w(q) = 2q - 26. Let l be w(g). Solve lj - 2j = -4 for j. 2 Suppose 33q - 289 = -25. Solve -u = -12 + q for u. 4 Suppose -3h = 8 - 5. Let b be (-6(h - 0))/2. Suppose -5u = -3r - 25, -5r = -bu - 2r + 15. Solve 0 = -uk + 3 + 7 for k. 2 Suppose n = 5y - 15, -4n = -2y - 2 + 26. Solve h = yh - 2 for h. 2 Suppose -3a - 47 + 6 = -h, 97 = 3h + 4a. Solve -hs + 12 = -38s for s. -4 Let p(n) = n3 - 8n*2 + 7n - 2. Let j be p(7). Let h = j - -7. Suppose -hl + 47 = 12. Solve 0 = 4d - ld + 6 for d. 2 Suppose 8 = 7b - 6. Let t(y) = -y*3 - 4y*2 + 4y - 7. Let r be t(-5). Let p be r + (0 - -3) - -2. Solve -g = -b + p for g. -1 Suppose 4i + 68 = -4b, 23 = -2i - 5b + 1. Let r = i + 23. Let a = 14 + -9. Solve f = rf - a for f. 5 Let q = 4 + -69. Let n = q - -71. Let k be (-2)/3(-36)/8. Solve -kg = -ng - 3 for g. -1 Let k = 46 + -39. Solve 0 = -3p + k + 5 for p. 4 Let l be 126/35 + 12/(-20). Solve -15 + l = -4b for b. 3 Let m(j) = j*3 + 5j*2 + j - 1. Let x be m(-5). Let h = x + 10. Suppose hl = -k + 20 + 2, 0 = -2l + 6. Solve 0 = 3s + 2s - k for s. 2 Suppose -17x = -9x - 256. Let b = x + -28. Solve br + 6 = 6r for r. 3 Let v(o) = -o3 + 23o*2 + 23o + 24. Let n be v(24). Let w(i) = -1 + 5 - 3i - i3 - 4i*2 - 1. Let a be w(-3). Solve n = -6b + ab + 6 for b. 2 Let a(j) = 2j*2 - 16j + 14. Let u be a(7). Solve -r + 1 - 4 = u for r. -3 Let u = -26 + 46. Suppose u = 4z - 16. Let g(t) = -14t - 513. Let c be g(-37). Solve z = -cd - 6 for d. -3 Let j(l) = l2 + 5l. Let g be j(-4). Let t be g/2 - -185. Let q be (6/(-4))/((-33)/t). Solve -qb = -0b for b. 0 Let i be (-2)/4 + (-88)/(-16). Suppose -u + 6 = k, -u + 2 = -ik + 26. Suppose -x - 4z = -18, -z = kx - 0z - 14. Solve 0 = -4a + xa - 4 for a. -2 Let h(p) = p3 - 4p - 2p3 + 32 - 38. Let r be h(-2). Solve 3u = -2 - r for u. -4 Let m(d) = -18d - 24. Let c be m(-2). Solve -84y + 80y = -c for y. 3 Suppose -x = -3x + 12. Suppose -n + xn = -4z + 40, -4z = -2n + 44. Suppose -5c = -8c + n. Solve cq = -0q - 8 for q. -2 Let s = -90 - -102. Suppose l = sl - 44. Solve -d = -2d + l for d. 4 Suppose -3y + 36 = 3v, 15 + 3 = 4y - 2v. Solve 12i + y = 19 for i. 1 Suppose -2m = -3m. Let w be 2/8 + (-28)/(-16). Suppose m = y + wy - 12. Solve -y = v - 0v for v. -4 Let z = -593 - -593. Solve z = -5c - 2c - 14 for c. -2 Suppose 4m + 8 - 4 = 2u, u + 13 = 5m. Solve -l + 7l = u for l. 2 Let j = -175 + 205. Solve j = -2a - 4a for a. -5 Suppose 0 = -23r + 16r + 35. Solve -3 = -2b - r for b. -1 Suppose 10a - 53 = 5a + 4o, 0 = 5a + o - 43. Let b = a + -6. Solve j - 4 + b = 0 for j. 1 Suppose 7v = 2v + 60. Let k(a) = a*3 - 11a*2 - 13a + 13. Let m be k(v). Solve -m = -c - 3 for c. -2 Let t = -24 - -34. Let s = 28 - 28. Suppose 4g - 2k + 6 = 0, sk - k + 3 = 4g. Solve gc - 2c = t for c. -5 Let p be (-21)/2(1 + -3). Suppose 2g = 2o - 8 + 2, -4o + p = 5g. Let b be (0/((-56)/(-7)))/1. Solve bh = oh + 8 for h. -2 Let c = -1 - -3. Suppose -88b = -86b - 4. Let k = c - b. Solve k = -4a + 17 - 1 for a. 4 Suppose -4k = 7l - 5l - 22, -4l = -5k + 21. Solve -ku = -28 + 8 for u. 4 Suppose 8c = 13c - 10. Suppose 16 = -4p, ch = 6p - p + 26. Solve hk + k = -16 for k. -4 Let m be (60/(-18))/(1/(-3)). Let z(x) = -x*3 + 10x*2 + x + 4. Let l be z(m). Let j = l - 6. Solve p - j = -4 for p. 4 Suppose -4g + 3 = 3l, -3l + 5g = 10 - 13. Solve -7 + l = 2y for y. -3 Suppose -6i = -53 + 17. Suppose -5f = iv - v + 10, 0 = 3f - v - 10. Solve 10 = -2s + f for s. -4 Let q(g) = 3g*2 - 11g + 12. Suppose h + t = -3t + 22, 3h - 4t + 14 = 0. Let k be q(h). Solve -w + 2w - k = 0 for w. 2 Suppose -2x - 64 = -3q - 87, -3x + 27 = -3q. Solve -15 = r + xr for r. -3 Suppose -2 = s - 8. Solve -2p - 4 = s for p. -5 Let b = 19 - 17. Suppose -bv + 12 = -6v. Let h = v - -7. Solve 4d = 4 + h for d. 2 Let z = 110 - 102. Solve -2w = -4 + z for w. -2 Let g = -261 - -263. Solve -g = -4t + 6 for t. 2 Let c be -2(2/(-1) - (-35)/(-10)). Solve cv - 5 = 6v for v. 1 Let n be -1(5 - 4)-13. Suppose 0 = -3s + 20 + n. Solve s = -2x + 5 for x. -3 Let y be (-62)/(-3) - (-6)/(-9). Suppose 8x = 3x + y. Solve -m - 5 = -x for m. -1 Let v be (-6)/3 + 40/(-2). Let d be (-57)/(-11) + 4/v. Solve -g = -2g - d for g. -5 Suppose o + 12 = 2k, -1 = 3k + 2o - 5. Suppose -5y + k + 16 = 0. Solve -5a + ya = 3 for a. -3 Let y be (-2)/((9/48)/((-6)/4)). Suppose -18b = -yb - 10. Suppose 0 = 2m - 3m + w - 2, 10 = m + 2w. Solve -bh = -mh for h. 0 Suppose -c - 4y + 8 = 0, -4y + 5 = y. Solve -cn + 20 = -9n for n. -4 Let p(b) = b*3 + 18b*2 - 15b - 14. Let d(m) = m*3 + 17m*2 - 15m - 13. Let c(l) = 5d(l) - 4p(l). Let w be c(-14). Solve 4g + w = -g for g. -1 Let z(n) = -2n - 1. Let r be z(-4). Let m = -2 + r. Suppose 3a + 8 = ma. Solve -i - ai = -25 for i. 5 Let w(o) be the first derivative of -13o + 1/2o2 + 1/4o*4 - 1 - 13/3o*3. Let g be w(13). Solve gb = b for b. 0 Suppose -t - 6 = 4u - 2, 2u + 16 = -4t. Let r = -35 - -38. Let g be 1 + 2(-5)/(-2). Solve -ro + go = u for o. 0 Suppose 34p - 144 = 28p. Let f be 1/((0 + 20/p)/5). Solve f = -5g - 4 for g. -2 Let m(w) = w2 - 52w - 153. Let f be m(55). Solve 16j - f = 13j for j. 4 Suppose -80 = -82k + 78k. Solve 5u - k = 10u for u. -4 Let n(p) = 6p - 4. Let c be n(4). Suppose 5x + 3d - c = 0, 2x = 6x + 5d - 29. Let h(k) = k. Let t be h(x). Solve t = 2s - 7 for s. 4 Let f(r) = r3 + 7r*2 + 5r - 6. Let p be (-2015)/(-75) - (-2)/15. Let w be 2/(-6) - 153/p. Let x be f(w). Solve 5d = -xd - 20 for d. -4 Suppose -3x + 323 = 5b, -2b = -3b + 3x + 79. Let s = b - 62. Solve 8 = j - sj for j. -2 Suppose 2g - 19 = -3b, -2g - 22 = -4b - 4g. Solve ba + 5 = -10 for a. -5 Let z(g) be the third derivative of -g5/60 + g4/12 + g*3/2 + 10g*2. Let j be z(0). Solve 2i + 5 = j for i. -1 Suppose 39h - 3h - 72 = 0. Solve -5a = 13 + h for a. -3 Suppose -6m + a + 33 = -3m, 4m - 2a = 44. Solve mq = 4q + 14 for q. 2 Let m be -13 + -219/(-27). Solve -mb - 22 = -2 for b. -5 Let r(q) = q3 - q2 + 4. Let t be r(0). Let x be t - (-20)/4 - 4. Solve 4 = -xz + z for z. -1 Suppose -3g = 5f - 15, 6f = 5g + 3f - 25. Suppose 0 = d - 5d + 12, -5v - gd + 25 = 0. Solve -vh + 0h = 10 for h. -5 Let v(x) = 2x*2 + 11x - 1. Suppose 4i = 16 - 40. Let n be v(i). Solve n = -4t - t for t. -1 Let g be (-92)/(-28) + -3 + (-276)/(-14). Suppose -3j - 4r = -g, -j + 0r - 2r = -6. Solve -8o = -4o - j for o. 2 Suppose -4i - u = -2 - 13, -u = 5. Let j(q) = 5q*2 + 3q + 1 + q*2 - iq*2. Let o be j(-3). Solve 0 = 5w - o - 4 for w. 1 Suppose 5d + 72 = 9d. Let l = -38 + d. Let j be 0(l/16 - -1). Solve j = 2m - 0m for m. 0 Let h(r) = r2 + 13r + 15. Suppose -14 - 46 = 5a. Let t be h(a). Solve tb = -b for b. 0 Let w be (-108 - -108)/((-3)/1). Solve 8n - 24 - 8 = w for n. 4 Let m = -1 + 3. Suppose 0 = ma - 4a + 42. Let j be (-1)/((3 + -6)/a). Solve jg - 2g + 10 = 0 for g. -2 Let g(b) = -b2 + 14b - 4. Let y be g(14). Let v(l) = -l - 1. Let u be v(y). Solve 7 - u = 2t for t. 2 Let l(u) = 5u*2 + 16u + 5. Let t be l(-3). Solve tf = -0f for f. 0 Let k(q) = -q*3 - 5q*2 + 16q + 14. Let f be k(-7). Let o = f + 20. Solve -o = 5z - z for z. -5 Let q be 4 + -2 + (5 - 0). Suppose qs = 15s. Solve -5v - 16 + 6 = s for v. -2 Suppose 42 = 6d - 0d. Let a be 1 - -3 - (11 - d). Suppose 0 = -ap + p. Solve 0 = -pn - n for n. 0 Suppose 91o - 86o = 10. Solve -g + o*g + 2 = 0 for g. -2 Let b(c) = -c - 13.	{ "pile_set_name": "DM Mathematics" }
what is 5 + -377351? -377345 In base 13, what is -2a482 - 5? -2a487 In base 10, what is -22380 + -201? -22581 In base 12, what is 1832 - -25b? 1a91 In base 11, what is 13 + -2375? -2362 In base 9, what is -5 + 15808? 15803 In base 11, what is 5512 - -1a1? 5703 In base 7, what is 2 - -1345335? 1345340 In base 5, what is -10 - -2102013? 2102003 In base 12, what is 6a517 - -17? 6a532 In base 8, what is -2453 + 31? -2422 In base 6, what is 1335 - 113? 1222 In base 8, what is 11 + 141216? 141227 In base 13, what is 1258 + -a2? 1186 In base 7, what is -130356 + -1? -130360 In base 5, what is -1041 + -234223? -240314 In base 12, what is 7 + -2661? -2656 In base 7, what is 403 + 2232? 2635 In base 5, what is -13032 + -33? -13120 In base 10, what is -1713 - -15? -1698 In base 15, what is -858 - 31? -889 In base 7, what is -1 - -2265? 2264 In base 2, what is 111010110 - 1100011? 101110011 In base 11, what is -348 - 32aa? -3647 In base 6, what is -12 - 10021? -10033 In base 12, what is 10634 - 4? 10630 In base 5, what is 2 - -13302123? 13302130 In base 10, what is -1 + 40399? 40398 In base 3, what is -2221012 - 101? -2221120 In base 10, what is 858683 - -2? 858685 In base 4, what is -12211 - -1020300? 1002023 In base 16, what is -2c + 64a1? 6475 In base 4, what is -11 + -100230310? -100230321 In base 10, what is 2009 - 334? 1675 In base 13, what is 2 + 6a3a3? 6a3a5 In base 2, what is 111100110100 + 1000101? 111101111001 In base 14, what is -bc + -37d? -45b In base 11, what is -1aa686 - 5? -1aa690 In base 5, what is 120403403 + -2? 120403401 In base 13, what is -16022 + 17? -16008 In base 12, what is -37629 + -11? -3763a In base 13, what is -21 + -44742? -44763 In base 4, what is -311111 + -10? -311121 In base 3, what is -12111112 - 10101? -12121220 In base 8, what is 7001 + 22? 7023 In base 5, what is -4431 - -441? -3440 In base 5, what is 1034 + -1223? -134 In base 3, what is 1000 - 200200021? -200122021 In base 16, what is -113f0 + 4? -113ec In base 11, what is -6a4857 - 4? -6a4860 In base 7, what is 3 - 6240646? -6240643 In base 15, what is 85619 - 2? 85617 In base 14, what is -508a + 32? -5058 In base 4, what is -12231211103 - -2? -12231211101 In base 7, what is -2606515 - 0? -2606515 In base 8, what is 273 - 411? -116 In base 6, what is -4342 + 2251? -2051 In base 6, what is 5 - 350031? -350022 In base 10, what is 47682 + -3? 47679 In base 2, what is -111000001110 - -101? -111000001001 In base 9, what is 22084 + 5? 22100 In base 16, what is -198 + e6? -b2 In base 15, what is 1be - 1b? 1a3 In base 16, what is -990 - -19? -977 In base 5, what is -1 + -40243410? -40243411 In base 9, what is 440271 - 4? 440266 In base 8, what is 72 + -156? -64 In base 15, what is 44b - -7? 453 In base 9, what is -4478 + -73? -4562 In base 11, what is 1a0 + 3930? 4020 In base 3, what is 2122020121 - -12010? 2122102201 In base 14, what is 4 + -5d2? -5cc In base 15, what is 436 - -11? 447 In base 8, what is 5634 + -1743? 3671 In base 6, what is -3 + -5525153? -5525200 In base 12, what is -39 - 4994? -4a11 In base 2, what is 100 - 11000110011111001? -11000110011110101 In base 2, what is 11 + -100010101010100? -100010101010001 In base 2, what is 1000000010101011 + 100? 1000000010101111 In base 13, what is -1bc5 + 1c6? -19cc In base 11, what is 45 - 1251? -1207 In base 12, what is -2722 - -1186? -1558 In base 7, what is 1355155 + 4? 1355162 In base 3, what is 10202001120 - -112? 10202002002 In base 3, what is 1120 + -2220102? -2211212 In base 2, what is -1001100000111011010 + 1? -1001100000111011001 In base 7, what is -306 - 31? -340 In base 10, what is 18188 + 3? 18191 In base 12, what is -56a - 9a1? -134b In base 4, what is -22 + -13300331? -13301013 In base 9, what is 3380 - 67? 3312 In base 9, what is 11176 + 55? 11242 In base 10, what is 238893 + -8? 238885 In base 13, what is -23a + -155? -392 In base 7, what is 252410 - 3? 252404 In base 12, what is -815 - 69? -882 In base 7, what is -1 + -332516? -332520 In base 6, what is -23 + -5120024? -5120051 In base 12, what is 1 + 206b6? 206b7 In base 9, what is 268 - 2468? -2200 In base 10, what is 238 - 17423? -17185 In base 10, what is -185 + -656? -841 In base 5, what is 20 - 13404? -13334 In base 3, what is 0 - -12202120? 12202120 In base 16, what is 5 + 46d4? 46d9 In base 16, what is -4 + -5c5fd? -5c601 In base 4, what is -212 - 32002? -32220 In base 7, what is 500633 + 3? 500636 In base 10, what is 6452 - 0? 6452 In base 5, what is -413142 - -41? -413101 In base 3, what is -12010102 - 10100? -12020202 In base 9, what is -433106 - -5? -433101 In base 2, what is -111000010 - 1001110000? -10000110010 In base 4, what is 3133 - 120201? -111002 In base 14, what is -21 - 332b? -334c In base 12, what is 13 + -8217a? -82167 In base 11, what is -2a8 + 59? -24a In base 14, what is -26c4 + 3? -26c1 In base 9, what is -354 + -30? -384 In base 12, what is -2 - 590a? -5910 In base 9, what is -2222104 + 4? -2222100 In base 3, what is -1220000120 + 11? -1220000102 In base 15, what is 1d59b1 - -3? 1d59b4 In base 7, what is 126 - 11134? -11005 In base 6, what is -2 + 24153143? 24153141 In base 8, what is 171 - -1513? 1704 In base 8, what is 763 - 22? 741 In base 8, what is 2764 - 1734? 1030 In base 10, what is -1 + -66457? -66458 In base 12, what is 39 + -311? -294 In base 13, what is -4 - -41b1? 41aa In base 2, what is -11111 + 1010011001010? 1010010101011 In base 7, what is 466 - -30302? 31101 In base 6, what is -2 - -105510? 105504 In base 15, what is 787 - -4? 78b In base 11, what is 24 - -5192? 5206 In base 9, what is -858 - 502? -1461 In base 12, what is -5a - -13175? 13117 In base 16, what is ef75 - -4? ef79 In base 16, what is 5 + 115c3? 115c8 In base 15, what is 0 - c0d? -c0d In base 3, what is 1001122212110 - 2? 1001122212101 In base 13, what is -5225 - 6? -522b In base 10, what is -12 - -6065? 6053 In base 2, what is 111000110 + 1001? 111001111 In base 9, what is -16 + -22887? -23014 In base 6, what is 13 + -234021? -234004 In base 5, what is -34202 + 0? -34202 In base 3, what is 121102 + 1201? 200010 In base 14, what is 21a - 15? 205 In base 9, what is -3 + 182747? 182744 In base 5, what is -4 + -20334303? -20334312 In base 12, what is -47 - 1212? -1259 In base 7, what is -125011 - 0? -125011 In base 9, what is -23 + 3330? 3306 In base 9, what is 6254776 + 0? 6254776 In base 12, what is -294 - -294? 0 In base 11, what is 12376 - 6? 12370 In base 5, what is 120342340 + -10? 120342330 In base 11, what is -180 + 1170? aa0 In base 5, what is -2 - 1002421? -1002423 In base 12, what is -21b + 189? -52 In base 13, what is -1c444 + 4? -1c440 In base 12, what is -2868 + -261? -2b09 In base 14, what is -3a + 3dd? 3a3 In base 5, what is 1440043 + -44? 1434444 In base 8, what is 12 + 10703? 10715 In base 9, what is 4053 + -156? 3786 In base 8, what is 1 - 10465? -10464 In base 14, what is -1c0a23 - -3? -1c0a20 In base 7, what is 420405 - -11? 420416 In base 4, what is -3120121313 + 2? -3120121311 In base 15, what is 2d15c - 0? 2d15c In base 10, what is -5115 - 951? -6066 In base 5, what is 2 + -122440? -122433 In base 12, what is -1b + -182? -1a1 In base 10, what is 6 - -16133? 16139 In base 3, what is -11 + -1210100100? -1210100111 In base 11, what is -10 + -260389? -260399 In base 8, what is 130 - -11310? 11440 In base 5, what is 12230141 + 3? 12230144 In base 3, what is -112120 - -22002? -20111 In base 13, what is 1183a3 - 0? 1183a3 In base 7, what is 4343 + -11? 4332 In base 10, what is 819 + -62? 757 In base 2, what is -10 - 101001011000110110? -101001011000111000 In base 11, what is 12705 + -13? 126a2 In base 5, what is 2 + 43212024? 43212031 In base 13, what is -7 - -29? 22 In base 15, what is 74d - -9? 757 In base 14, what is -3 - 249ac? -249b1 In base 12, what is aa5b5 + -2? aa5b3 In base 13, what is 9b9 + 2a? a16 In base 10, what is 681 + 198? 879 In base 15, what is 1467 - 4? 1463 In base 9, what is 472883 + 2? 472885 In base 10, what is 39326 + 43? 39369 In base 11, what is 522618 + 4? 522621 In base 5, what is -11 + 23441? 23430 In base 13, what is -3 + 41877? 41874 In base 9, what is -248 + -56? -315 In base 3, what is -12212110220 - 2? -12212110222 In base 15, what is 43b7 - -45? 440c In base 14, what is 1 + -502c? -502	{ "pile_set_name": "DM Mathematics" }
est common divisor of 3393 and 117. 117 Calculate the greatest common factor of 76 and 1384. 4 Calculate the greatest common factor of 60 and 960. 60 What is the greatest common factor of 55 and 2959? 11 What is the highest common divisor of 21 and 24? 3 What is the highest common factor of 180 and 2385? 45 Calculate the highest common divisor of 4865 and 595. 35 What is the highest common divisor of 5720 and 1100? 220 Calculate the greatest common factor of 138 and 207. 69 What is the highest common divisor of 90 and 954? 18 What is the highest common factor of 567 and 7? 7 Calculate the greatest common divisor of 782 and 23. 23 Calculate the greatest common factor of 33 and 1074. 3 Calculate the greatest common divisor of 799 and 47. 47 Calculate the highest common divisor of 4 and 261. 1 Calculate the greatest common factor of 8 and 16. 8 Calculate the greatest common divisor of 7514 and 34. 34 Calculate the greatest common factor of 187 and 493. 17 Calculate the greatest common factor of 602 and 28. 14 What is the highest common divisor of 81 and 153? 9 Calculate the greatest common divisor of 28 and 238. 14 Calculate the highest common divisor of 60 and 210. 30 Calculate the highest common factor of 184 and 782. 46 What is the greatest common divisor of 1134 and 810? 162 What is the greatest common divisor of 102 and 6018? 102 Calculate the greatest common divisor of 126 and 4578. 42 Calculate the highest common factor of 42 and 2688. 42 What is the highest common divisor of 45 and 285? 15 Calculate the highest common divisor of 5518 and 124. 62 Calculate the highest common divisor of 117 and 3328. 13 Calculate the greatest common factor of 171 and 5928. 57 Calculate the highest common factor of 284 and 355. 71 Calculate the highest common factor of 87 and 319. 29 What is the greatest common factor of 22 and 1397? 11 What is the highest common factor of 1281 and 21? 21 What is the greatest common factor of 7437 and 777? 111 What is the highest common factor of 70 and 190? 10 Calculate the highest common divisor of 19 and 38. 19 Calculate the highest common factor of 39 and 3. 3 What is the greatest common factor of 800 and 25? 25 What is the greatest common divisor of 518 and 2294? 74 What is the greatest common factor of 40 and 160? 40 What is the highest common factor of 608 and 160? 32 Calculate the highest common divisor of 72 and 45. 9 Calculate the highest common divisor of 205 and 164. 41 What is the highest common divisor of 3127 and 59? 59 What is the highest common factor of 11 and 1265? 11 Calculate the highest common factor of 33 and 231. 33 What is the highest common divisor of 15672 and 8? 8 What is the greatest common divisor of 92 and 1886? 46 What is the highest common divisor of 99 and 1243? 11 Calculate the highest common factor of 7 and 49. 7 Calculate the highest common divisor of 894 and 102. 6 Calculate the greatest common divisor of 10288 and 32. 16 Calculate the highest common divisor of 148 and 11174. 74 Calculate the greatest common divisor of 7 and 1. 1 Calculate the greatest common divisor of 308 and 8. 4 What is the highest common divisor of 8246 and 310? 62 Calculate the greatest common factor of 327 and 1199. 109 What is the greatest common divisor of 800 and 1250? 50 Calculate the greatest common factor of 108 and 999. 27 Calculate the greatest common factor of 120 and 4900. 20 Calculate the highest common divisor of 21 and 57. 3 Calculate the highest common divisor of 136 and 102. 34 What is the highest common factor of 19887 and 42? 21 Calculate the highest common factor of 70 and 6286. 14 Calculate the greatest common divisor of 884 and 8636. 68 Calculate the greatest common factor of 72 and 63. 9 What is the greatest common divisor of 14392 and 252? 28 What is the greatest common divisor of 8631 and 21? 21 Calculate the greatest common divisor of 7 and 623. 7 Calculate the highest common divisor of 2 and 250. 2 What is the greatest common factor of 3 and 3957? 3 Calculate the greatest common factor of 682 and 248. 62 What is the greatest common divisor of 132 and 4785? 33 What is the greatest common factor of 3 and 633? 3 What is the greatest common divisor of 8772 and 12? 12 What is the highest common factor of 283 and 21225? 283 What is the highest common divisor of 16 and 176? 16 Calculate the greatest common divisor of 174 and 290. 58 Calculate the highest common divisor of 477 and 441. 9 What is the highest common factor of 6069 and 28? 7 Calculate the highest common factor of 127 and 3. 1 What is the highest common factor of 360 and 504? 72 Calculate the highest common divisor of 400 and 48. 16 Calculate the highest common factor of 245 and 14. 7 Calculate the greatest common divisor of 273 and 1155. 21 Calculate the greatest common divisor of 782 and 238. 34 Calculate the highest common factor of 32 and 16. 16 Calculate the highest common divisor of 81 and 90. 9 Calculate the highest common divisor of 30 and 40. 10 What is the highest common factor of 188 and 22466? 94 Calculate the greatest common factor of 279 and 3999. 93 What is the highest common factor of 280 and 56? 56 Calculate the greatest common factor of 153 and 9. 9 Calculate the highest common divisor of 1173 and 1587. 69 Calculate the highest common divisor of 1258 and 272. 34 Calculate the highest common factor of 2914 and 94. 94 Calculate the greatest common divisor of 336 and 1792. 112 What is the greatest common factor of 902 and 990? 22 What is the greatest common factor of 8 and 150? 2 What is the highest common divisor of 15 and 80? 5 What is the greatest common divisor of 250 and 75? 25 What is the highest common factor of 19475 and 38? 19 Calculate the greatest common factor of 62 and 10. 2 Calculate the greatest common factor of 102 and 132. 6 Calculate the highest common divisor of 22 and 88. 22 Calculate the greatest common divisor of 48 and 408. 24 What is the highest common divisor of 68 and 4471? 17 What is the greatest common divisor of 527 and 17? 17 What is the highest common divisor of 71 and 71? 71 What is the greatest common divisor of 320 and 80? 80 Calculate the highest common factor of 1080 and 264. 24 What is the highest common factor of 21 and 23877? 21 Calculate the highest common divisor of 132 and 198. 66 Calculate the highest common divisor of 112 and 56. 56 What is the highest common factor of 10 and 215? 5 Calculate the greatest common divisor of 296 and 8. 8 Calculate the highest common factor of 357 and 42. 21 What is the highest common factor of 768 and 192? 192 Calculate the highest common divisor of 87 and 580. 29 What is the highest common divisor of 354 and 236? 118 Calculate the greatest common divisor of 363 and 22. 11 Calculate the highest common factor of 38 and 304. 38 Calculate the highest common divisor of 28 and 154. 14 Calculate the greatest common divisor of 3192 and 48. 24 Calculate the highest common divisor of 19 and 43. 1 Calculate the greatest common factor of 2 and 302. 2 What is the greatest common divisor of 3366 and 2673? 99 What is the greatest common factor of 54 and 86? 2 Calculate the highest common divisor of 1755 and 130. 65 Calculate the highest common divisor of 104 and 741. 13 Calculate the highest common factor of 240 and 2040. 120 What is the highest common divisor of 2736 and 432? 144 Calculate the greatest common factor of 975 and 260. 65 Calculate the highest common factor of 31 and 11129. 31 What is the highest common divisor of 52 and 1196? 52 Calculate the greatest common divisor of 414 and 115. 23 What is the highest common divisor of 12096 and 189? 189 What is the greatest common divisor of 5614 and 14? 14 What is the highest common divisor of 72 and 153? 9 What is the greatest common divisor of 357 and 51? 51 Calculate the highest common divisor of 1496 and 616. 88 What is the greatest common divisor of 60 and 10? 10 What is the greatest common divisor of 1751 and 34? 17 Calculate the highest common factor of 10560 and 33. 33 Calculate the highest common divisor of 5 and 395. 5 Calculate the highest common divisor of 3 and 177. 3 What is the highest common factor of 12 and 21? 3 What is the greatest common factor of 48 and 936? 24 Calculate the highe	{ "pile_set_name": "DM Mathematics" }
Suppose 0 = 4h - 5w + 2, -h - 3w + 26 - 18 = y. Which is bigger: h or -4? h Let j = -6.093 - -10.093. Let g = 31/33 - 949/132. Is j less than g? False Let y(a) = a2 + 7a - 134. Let t be y(-15). Suppose 4n - 3 = i - 4, 3i = -3n - 42. Which is bigger: t or i? i Let n be (40/5)/2(-2)/4. Let p be (30/5 + -5)/((-15)/(-9)). Which is greater: p or n? p Let m = -8.8 - -10. Suppose 131v = -110 + 337 + 821. Is m at least as big as v? False Let i = -205.74 - -205. Let a = i - -0.04. Let r = 3.2 + -3. Which is smaller: r or a? a Let c = 0.03 + -2.03. Let j = -21547.796 - -21547.8. Which is greater: j or c? j Let p be ((-1)/(-2))/(((-36)/1472)/(-9)). Let s = p + -296. Let b be (-6)/24 - 92/s. Is 0.8 not equal to b? True Let i(n) = -n2 + 5n + 70. Let a be 156/(-20) + 8/(-40). Let v be i(a). Which is smaller: 0 or v? v Suppose 3u + 27 = -4s, 3u + 61s - 3 = 62s. Which is bigger: -1/98 or u? -1/98 Let g = 0.283 + 0.0177. Which is greater: 0 or g? g Suppose -s - 2 = 0, 2c = 7s - 4s + 68. Suppose -c = 4x + 77. Are 2 and x non-equal? True Let s be (-800)/55 + (-10)/5. Let j = s + 3072/187. Let p(t) = -2t - 1. Let r be p(-2). Which is smaller: j or r? j Let c(y) = -2y2 + 45y - 35. Let o be c(22). Let w be -12(1 + (-21)/6). Let a = -44 + w. Which is greater: o or a? o Suppose -50h + 24 = -42h. Let a be h(-1)/(29/2). Let l = 0 + 1. Which is smaller: l or a? a Let x = -490.2 - -590. Let j = 100 - x. Let s = 4.7 - 5. Which is smaller: j or s? s Let q(n) = 8n + 83. Let k be q(-10). Let v be (3/(-9))/(k + (-32)/12). Is -39 greater than or equal to v? False Let v(c) = 116c + 19461. Let h be v(-168). Suppose -5l + 17 = -8. Let t = -21 - l. Which is smaller: h or t? h Let w = 28 + -61. Let u = w - -33.29. Let h = u - 0.39. Do -10 and h have different values? True Suppose 10t + 5470 = -820. Let v = -23275/37 - t. Let w be 0/(8/4 + -4). Which is smaller: v or w? v Let l be 7514/1876 + (-692)/173. Which is greater: l or 0? l Let y = 1693 - 1677. Is y smaller than -0.03? False Let x be 1 + 2 - (6 + 1). Let g be 73/(((-16)/x)/8). Let j = g + -455/3. Which is smaller: j or -6? -6 Suppose -4v + 2 = -6. Let c be (-1804)/16 + v + -1. Let x = c - -112. Which is greater: -2.9 or x? x Let u = -3378 - -26975/8. Let d = 801/136 + u. Which is bigger: 0 or d? 0 Let y(i) = -i3 + 29i*2 + 31i - 34. Let q be y(30). Let r be (-2016)/(-2790) + q/10. Which is smaller: r or 1? r Suppose -146q + 4t = -141q + 8148, 3q + 4t + 4876 = 0. Which is smaller: q or -1629? -1629 Suppose 0 = -5z + z + 4j + 20, -j - 2 = 2z. Let a(c) = c*3 - 3c*2 + 9c - 6. Let m be a(z). Let d = -1/585 - -5857/4095. Is m equal to d? False Let o be (3/(-1))/((-5)/((-300)/(-6))). Let i be (4/(-6041))/(o/(-105)). Which is smaller: -1 or i? -1 Let n be (4 - (-45)/(-12)) + 967/4. Suppose 5w - n = 12s - 8s, 4w + 4s - 208 = 0. Which is greater: w or 48? w Let n(q) = 7q - 56. Let f be n(8). Suppose -2x - 5z + 32 = f, 5z = -44 + 24. Which is bigger: x or 25? x Let k be -1 + (452/144 + -3)28. Suppose -j - 23 = -5c, 6c + 67 = -4j + c. Let p = j + 21. Is p less than k? False Suppose -3l = -6884 - 12853. Suppose -l = 2v + 2w - 16465, -2v - 3w = -9887. Let a = v + -44428/9. Which is smaller: a or 5? 5 Let s = -944.8 - 0. Let a = 945 + s. Which is greater: a or -0.6? a Let m be 1 - (240/(-118) + 3). Let x(g) = -16g. Let i be x(0). Is i greater than or equal to m? False Let g = -5 + 2. Let o = -9415 - -9451. Let v be 9/g - (-6 - o). Which is bigger: 40 or v? 40 Let m be -1 + (-6)/1 - (0 - -1228). Which is smaller: -1233 or m? m Let n be ((-391)/34 - -11)-2. Which is greater: n or 3/1271? n Let s be (-2 + (4 - 3))/(-1). Which is bigger: -2/155 or s? s Let v = -0.167 + -2.463. Let g = -2.73 - v. Do g and 19/9 have the same value? False Suppose 1897 = 22u - 3273. Does 270 = u? False Suppose -3i = -5j - 58, -5i + j + 45 = 3j. Suppose -ib + 10b - 6 = 0. Suppose 0d + 12 = -d. Which is smaller: d or b? d Let j be (-2)/(-22) + ((-7)/((-770)/(-7820)) - 1). Suppose 0f = 3f + 216. Are j and f unequal? False Let t = -102.187 + 92.47. Let g = t - 0.283. Which is greater: 1.3 or g? 1.3 Let d = 598 + -337. Let o = d - 180. Let a = o - 77. Is 3 at most a? True Let u = 1.2 + -0.2. Suppose 0 = 42a + 27370 - 1246. Let m = a + 614. Which is bigger: u or m? u Let i be 117/108 + -1 + 656787/(-3492). Let b(s) = -47s - 1. Let r be b(4). Is r > i? False Let v = -3025 + 3014. Does v = -588/53? False Suppose 4n + z = -0z, -2n + 14 = -3z. Let o be (-130)/126 + 2/2. Is o >= n? False Let u(i) = -i*2 + 5i + 4. Let k be u(5). Suppose -2m - 71 = 5o, -km - 1 = 3o + 50. Let j = -37 - -25. Is o at most j? True Let x = -15 + 21. Suppose 4r - xr = 104. Let p be (r/(-18) + -2)3/(-2). Which is smaller: p or 0? p Let q(u) = -u3 + 8u*2 - 16u - 3. Let p be q(4). Let g(x) = -x + 8. Let r be g(0). Let f = r - p. Is f > 11? False Let l be (-1)/(-3) + 62/(-150). Let y(n) = -n*3 + 12n*2 - 9n - 21. Let i be y(11). Which is smaller: i or l? l Suppose -90l = -7846 - 164. Which is greater: l or 101? 101 Suppose -5s - 5 = 5l, 0 = 59s - 55s - 7l - 18. Which is bigger: s or 1/9750? s Let m(p) = 7p - 18p + 7p + 5 + 8p - 63p2. Let s be m(-2). Let q be s/(-34)4/265. Which is bigger: 0 or q? q Let j = 192 + -236. Let p = 61 + j. Is -1/4 bigger than p? False Let r be (-3)/(24/(-5164)) + 54/12 + -4. Is 646 at least as big as r? True Suppose -176 = -23b - 452. Let j be 0 + 1 + 8/(-1). Let q be j/(28/(-12)) - b/(-3). Is 5 not equal to q? True Let r be 1 - 5 - ((-6490)/930 + 3). Let w = -143 + 142. Is r greater than w? True Let l be (28/(-84))/(2/(-24)). Suppose 0 = lq + 6q + 1140. Let o be -4 + (-237)/q2. Are 0 and o equal? False Let x be (65 - 78) + 112. Is -3/134 > x? True Let i be (6/(-8))/(180/25840). Which is greater: -107 or i? -107 Let w = -0.6154 + 0.3754. Is w < 55? True Let j = -41.3 - -44.6. Do 56/3 and j have the same value? False Let s = 488 - 501. Which is greater: 1/130 or s? 1/130 Let c = 550 - 210. Let i = 339.4 - c. Which is smaller: -0.2 or i? i Let n be 2/12 + (-35)/42. Let q be (-2)/(-3) + 1162/(-42). Let u be (-117)/q - 4/1. Which is greater: u or n? u Let c = 220 + -226. Let b be (-1067)/22 + (c - -1). Which is greater: -55 or b? b Let o = -166973/12 + 13914. Is -1 at least as big as o? False Let b(g) = g3 - 5g*2 + 4g + 3. Let c be b(0). Let r be ((-3)/(-2))/((-6)/(-12)). Suppose rj + 0j - c = 0. Do 2/121 and j have different values? True Let m be (-114)/6 - (-131533)/6913. Which is greater: 1 or m? 1 Let j be 10262/((-2)/648/(19 - 27)). Is 5131 greater than j? False Let a(k) = -21k - 1 - 8k2 - k3 + 4k + 7k. Let m be a(-5). Let h = -27 - m. Which is smaller: h or -3? -3 Let l(g) = g + 21. Let t be l(-12). Let o be (-42)/t(-9)/33. Let j = 5/22 + o. Which is greater: 0.7 or j? j Suppose -34 = -11w - 6w. Suppose 3 = t - 1. Suppose tc + w = 5m, 3m + m = 5c + 7. Which is smaller: m or -3? -3 Let k = -12605/48 + 525/2. Let g = -9/16 + k. Which is smaller: g or 23? g Let b(s) = s + 15 + s*2 + 8 - 25s. Let y be (9 - (-4 - -12)) + (4 - -18). Let n be b(y). Are -1/39 and n nonequal? True Let x be 6/(-112) + 21/49 - 12/32. Which is smaller: 15/178 or x? x Let d be (4/(-80)-54)/((-245)/98). Do 0 and d have the same value? False Suppose 14c - 4c = 40. Suppose 5x = 4q - 859, x + cx + 2q + 853 = 0. Are -171 and x nonequal? False Let i be (-1)/228. Let x = 5 + i. Let d = -135023 - -675103/5. Which is bigger: d or x? d Let b = -1.239 + 22.679. Let l = -21.5 + b. Is -0.2 equal to l? False Suppose -d + 4 = -3c, -5d + d - c = -16. Suppose dy - w + 439 = 0, 4y = y - 5w - 335. Are -111 and y non-equal? True Let r = -103 - -136.2. Let i = r + -33.324. Is 1 smaller than i? False Suppose -2p + 3t + 4 + 0 = 0, 12 = p + t. Let n be (16 - 18)2/p. Is n at least -1.6? True Suppose 0 = 4j - 14 - 6, 4j = 3n - 1090. Let q be n/(-20) + 8 + 8. Which is greater: q or -2? -2 Let h be (11 + (-180)/15)1. Let c = 683 - -424. Let g = -58669/53 + c. Which is bigger: g or h? g Let f = 252 - 456. Let q = 265 + f. Which is smaller: q or -3? -3 Suppose 12t - 2 = 14t. Suppose -2p + 40 = -2. Let c be -6 + 5 + 12/p. Which is bigger: t or c? c Let u = -	{ "pile_set_name": "DM Mathematics" }
j - mr = 6. What is the common denominator of 1/(-3)201/j and 46/11? 22 Suppose 0 = x - 3 - 0. Suppose xh - 47 = -17. Calculate the lowest common multiple of 24 and h. 120 Let j = 8 + -4. Suppose jn = 26 + 46. Calculate the lowest common multiple of n and 14. 126 Let x be ((-35)/(-10))/((-30)/(-147)). Let r = x + -32/5. Calculate the common denominator of r and -37/20. 20 Let c be 52/56(-34292)/(-4190). Let b = -1/2933 - c. Calculate the common denominator of 43/7 and b. 35 Let j be ((-2)/8)/(6006/380296). Let z = -1/286 + j. Calculate the common denominator of 151/12 and z. 12 Suppose 0 = -4t - 2h + 30, -4h + 0 - 3 = -t. What is the lowest common multiple of 1 and t? 7 Let k = 4973/4 + -1262. Find the common denominator of 110/(-2)1/(-8) and k. 8 What is the common denominator of (1 - 4) + 4 - 31 and 18/5? 5 Let u = 2 + 5. What is the lowest common multiple of 10 and u? 70 What is the least common multiple of 16 and (-24)/8 - (-4 + -1)? 16 Let o be (-2)/(-11) + (-108925)/(-15048). Let k = o - 5/1368. Find the common denominator of k and 85/8. 24 Let w = 10405 + -228961/22. Let f = 125152 + -1002557/8. Let k = 2593/16 + f. Find the common denominator of k and w. 176 Let o(p) = -p2 - p. Let q be o(-2). Let x = q + 17. Suppose 6t - 3t - x = 0. Calculate the least common multiple of 10 and t. 10 Suppose 0 = -o + 4r + 16, -r = -4o - 13 + 77. Calculate the least common multiple of 10 and o. 80 Let o be 2 + 0 + -2 + 5. Suppose 0 = 2a + 3a + o. What is the common denominator of 73/10 and 34/(-24) - a/4? 30 Let k = -2776859/96 + 28926. What is the common denominator of -115/14 and k? 672 Suppose -2v + 2 = -0. Suppose -2j + 33 = v. What is the least common multiple of j and 18? 144 Let a be 4/20 - 158834/117640. Let d = a - -1/5882. Let w = -1221/7 - -347/2. Calculate the common denominator of w and d. 140 Let p(j) = -7j + 1. Let d(t) = t. Let o(g) = -6d(g) - p(g). Let x be o(1). Let v = x + 12. Calculate the smallest common multiple of v and 6. 12 Let v(i) = i - 2. Let w be v(5). Let o(h) = 8h*2 - h + 1. Calculate the least common multiple of o(1) and 12/4 - w - -7. 56 Calculate the common denominator of (-4)/(-6) - (-610)/(-24) and ((2 - 1) + 0)/(28/142). 28 Let k(b) = -b + 10. Let m be k(9). What is the common denominator of -89/12 and (204/8)/(-1 - m)? 12 Let s(h) = -13h + 126. Let l(b) = -b - 2. Calculate the lowest common multiple of l(-4) and s(8). 22 Let o = 9 - 6. Find the common denominator of -121/10 and -1 - (-284)/28 - o. 70 Let z = 11 - 7. What is the lowest common multiple of (6/z)/(9/96) and 12? 48 Calculate the least common multiple of (14/3)/((-2)/(-9)) and 33. 231 Let v = 49 - 17. Calculate the smallest common multiple of v and 4. 32 Suppose -5t + 4845 = -5k, 3k + 223 = -4t - 2705. Find the common denominator of (k/8)/(0 - 33) and -55/16. 176 Let m(r) = r*3 + 10r*2 - 3r - 8. Let y be m(-10). Suppose -2z + 4z = y. Calculate the lowest common multiple of z and 4. 44 Let m = -2733347/8 - -340814. Let v = 1998 - 1145. Let q = v + m. Find the common denominator of q and 89/16. 16 Let g = -60 - -27. Let b be (18813/(-8))/(18/(-8)). Let l = b - 1048. Calculate the common denominator of l and g. 6 Find the common denominator of ((-355)/(-10))/((-9)/2) and -46/5. 45 Suppose 5c + 2x + 7942 = 0, 0c - x + 3175 = -2c. Let d = 7894/5 + c. Calculate the common denominator of d and 46/5. 5 Suppose t - 5t = 3y - 29, -3y = t - 5. Suppose 2w - t = 76. Suppose 5o = -4l + 35, -o - o + 4l + w = 0. What is the smallest common multiple of o and 8? 88 Let x be (-10)/(-25) - (-22446)/(-1100). Let z = 474/25 + x. Let w = 1125 - 22529/20. What is the common denominator of w and z? 220 Suppose 0 = 5p + 9 + 16. Let r = -11 - p. Find the common denominator of -62/5 and (-10)/(-4) - (-3 - r). 10 Let x(i) = 622i + 2. Let p be x(4). Suppose -2m = 3596 + p. Let u = m - -33500/11. Calculate the common denominator of -8 and u. 11 Let g(o) = -o*2 + 9o + 11. Let k be -2(-3)/6 + 8. Calculate the lowest common multiple of 11 and g(k). 11 Calculate the common denominator of (-1)/4 + 764/144 and 2 + 1/36158. 18 Let y = -9/35 - 533/105. Let c = 584/5 - 4328/35. Find the common denominator of c and y. 21 Let r be (-2)/(-4)(1 - 1). Let o = 18 - r. Let a = -113 + 135. Calculate the lowest common multiple of a and o. 198 Suppose z + 7 = b, -4b - b + 17 = 4z. Calculate the lowest common multiple of b and 9. 45 Let p(q) = 21q*2 - q - 1. Let i be p(-1). What is the least common multiple of (-12)/(-21) - (-51)/i and 7? 21 What is the lowest common multiple of -3(44/(-15))/(2/5) and 4? 44 Suppose 5t = 5m + 25, -3m + 0t + 2t = 10. Suppose 22 = 3d + 3z + z, -3d = -z - 2. Calculate the least common multiple of (-2 + 19 - m) + -3 and d. 14 Let c = -5814/1015 + 2/145. Calculate the common denominator of c and -43/9. 63 Find the common denominator of 385/(-44) + 6/(-4) + 1 and 15/4. 4 Suppose -5 = -5k + 3t, k - 5t + 9 = -3k. Let s(r) = r*2 + 9r + 11. Calculate the smallest common multiple of k and s(-8). 12 Let h = 3656927/142324 + -8258/391. Let q = h + -15/52. What is the common denominator of (-2)/7 + (-834)/(-28) and q? 14 Suppose 6y = 17 + 7. Let t(w) = -w2 + 7w - 10. Calculate the smallest common multiple of t(y) and 4. 4 Let d(f) = -f*3 - 3f*2 + 6f + 5. Find the common denominator of 62/5 and d(-5). 5 Let m(f) = -5f3 - 2f*2 + 3f. Let s(n) = 11n3 + 5n*2 - 6n + 1. Let l(h) = -13m(h) - 6s(h). What is the lowest common multiple of l(-4) and 9? 18 Let g = 28 - 14. Calculate the least common multiple of g and 20. 140 Let l be 2/(-13) - 413031/(-390). Let i = 2331 + -1273. Let r = i - l. Find the common denominator of r and 99/20. 20 Let i(l) = -2l3 - l2 - l + 1. Let n be i(-2). Let w = n - -3. What is the lowest common multiple of 4 and w? 36 Let h = 672/11 + -6797/110. Suppose 5t + 18 = 128. What is the common denominator of h and 9/(-36) + t/(-24)? 30 Let y be 0 - (-3 + 3)/(-2). Suppose j - 1 = -yj. Calculate the lowest common multiple of 11 and (-3 + 2)/(j/(-8)). 88 Let s(m) = m3 - 2m*2. Let v be s(2). Suppose -2w = 4d, -2w = 2d + 2 - v. Calculate the lowest common multiple of 5 and d. 5 Let t(x) = -x - 5. Let y(q) = q2 - 11q + 17. Let o be y(8). What is the least common multiple of 16 and t(o)? 16 Let h = 33493/9 - 3728. Suppose 22 = -w + 4t - t, 0 = -5w - 5t - 50. Let c = w - -125/6. Find the common denominator of c and h. 18 Let h = -10487/6 - -1738. What is the common denominator of -14 and h? 6 Let i = 39 - -21. What is the least common multiple of 14 and i? 420 Find the common denominator of -67/2 and 2/(-6) + (-198)/864. 16 Let r be 3((-8)/(-345))/4. Let o = 159/2530 - r. Find the common denominator of 89/16 and o. 176 Suppose -3a - 16 = a - 4i, -8 = 3a - i. Let r be 0(a + 15/6). What is the lowest common multiple of 8 + r - (0 + 0) and 20? 40 Calculate the common denominator of 3(-2)/(-18) - 202/(-12) and -17/8. 24 Let a = 74101/22 + -3365. Let f = -87/133 + -10793/1596. Find the common denominator of a and f. 132 Let r(d) = d + 1. Let x be r(5). Let j be 0 + (-3)/(9/x). What is the lowest common multiple of j/(-4) + (-1)/(-2) and 9? 9 Let j be 315/2-862. Let k be 4/(-14) + (-181221)/j. Let i = 64/129 + k. What is the common denominator of 59/9 and i? 90 What is the common denominator of 1/22 and (-555)/252 - 4/(-14)? 132 Suppose 0 = -3c + 2 - 17. Let u = 4 + c. Let k = 3 - u. Calculate the least common multiple of k and 4. 4 Let y = 15485/12 + -1288. Let h = -297973/87930 + -2/14655. Calculate the common denominator of y and h. 36 Suppose 0 = -4o - 11 + 35. Suppose 17 = -4b + 89. Calculate the least common multiple of b and o. 18 Let d = 63 + -191/3. Calculate the common denominator of d and -25/9. 9 Calculate the common denominator of 94/6 - (2 + 0) and -74/3. 3 What is the common denominator of 7-1(-8)/96 and 9/8? 24 Suppose 0 = -2x - 3x. Suppose 0 = 2w - 4, -w + xw - 13 = -3i. What is the least common multiple of i and 6? 30 Let h = 2879/618 - -18/103. Let b be (-217048)/384 - 2/6. Let d = b - -2253/4. What is the common denominator of d and h? 48 Let f(w) = -7w - 4. Let k be f(6). Let p = -26 - k. Let o(v) = v + 1. What is the lowest comm	{ "pile_set_name": "DM Mathematics" }
thout replacement from {w: 1, e: 3, d: 1, k: 1, a: 6}. 9/110 Calculate prob of picking 2 f when two letters picked without replacement from {s: 11, f: 2}. 1/78 Calculate prob of picking 3 x and 1 r when four letters picked without replacement from xxrxfrxrxr. 4/21 Calculate prob of picking 2 v when two letters picked without replacement from fcffkvfkccv. 1/55 What is prob of picking 1 h and 1 w when two letters picked without replacement from hahawhwaawhhhcwphp? 28/153 Two letters picked without replacement from qziqiii. Give prob of picking 2 i. 2/7 Four letters picked without replacement from sszggzgzzz. Give prob of picking 3 g and 1 s. 1/105 Two letters picked without replacement from lllqlwqwbr. Give prob of picking 1 q and 1 b. 2/45 What is prob of picking 2 i and 2 n when four letters picked without replacement from {i: 3, n: 3}? 3/5 What is prob of picking 1 n and 2 s when three letters picked without replacement from {n: 5, f: 1, s: 5, e: 3, i: 1}? 10/91 What is prob of picking 1 r and 1 c when two letters picked without replacement from {h: 4, c: 9, r: 6}? 6/19 Four letters picked without replacement from {m: 5, q: 3}. Give prob of picking 3 q and 1 m. 1/14 Three letters picked without replacement from {t: 6, y: 1, u: 3, a: 4, w: 3, r: 1}. What is prob of picking 3 t? 5/204 Calculate prob of picking 1 i and 2 n when three letters picked without replacement from {i: 6, n: 2}. 3/28 Three letters picked without replacement from {k: 1, v: 8, c: 2, n: 1, l: 2}. What is prob of picking 1 l, 1 c, and 1 v? 8/91 Four letters picked without replacement from uzzuuzzz. What is prob of picking 3 z and 1 u? 3/7 Calculate prob of picking 2 h when two letters picked without replacement from rhhw. 1/6 Two letters picked without replacement from rqrqmggrrjghjhrrqrj. What is prob of picking 1 h and 1 g? 2/57 Two letters picked without replacement from xllxssglxllgxmxglxms. Give prob of picking 1 m and 1 x. 6/95 What is prob of picking 1 t and 1 e when two letters picked without replacement from tvvevvvevebvbvevvvv? 4/171 Three letters picked without replacement from vgggggvggggg. Give prob of picking 3 v. 0 What is prob of picking 1 t and 2 e when three letters picked without replacement from ccetcctcceec? 3/110 Calculate prob of picking 1 g and 1 k when two letters picked without replacement from {g: 6, z: 1, k: 3, s: 4}. 18/91 Two letters picked without replacement from {r: 3, z: 9, m: 1, a: 1}. What is prob of picking 1 r and 1 a? 3/91 Calculate prob of picking 1 q, 2 k, and 1 r when four letters picked without replacement from {h: 1, k: 4, q: 1, v: 2, r: 1}. 1/21 What is prob of picking 1 e, 1 v, and 1 f when three letters picked without replacement from {e: 2, f: 1, v: 3, h: 1}? 6/35 What is prob of picking 2 f when two letters picked without replacement from {f: 4, q: 2}? 2/5 Calculate prob of picking 1 y and 1 q when two letters picked without replacement from syzyyzszszyyzqzyy. 7/136 What is prob of picking 1 q, 1 f, and 1 e when three letters picked without replacement from iqofe? 1/10 Two letters picked without replacement from titpcap. What is prob of picking 2 t? 1/21 Three letters picked without replacement from dlhgm. Give prob of picking 1 m and 2 g. 0 Two letters picked without replacement from {f: 1, a: 2, g: 11, z: 1}. What is prob of picking 2 g? 11/21 Three letters picked without replacement from {z: 4, u: 4, a: 7}. What is prob of picking 1 a and 2 z? 6/65 What is prob of picking 3 x and 1 o when four letters picked without replacement from xxoxxxoxoxooxxxx? 165/364 Calculate prob of picking 1 f and 1 l when two letters picked without replacement from fkktl. 1/10 What is prob of picking 3 r and 1 z when four letters picked without replacement from uuucurrzppccwuruu? 1/2380 Calculate prob of picking 1 o and 1 h when two letters picked without replacement from hojigot. 2/21 Two letters picked without replacement from {w: 2, f: 1, s: 1}. Give prob of picking 1 s and 1 f. 1/6 Two letters picked without replacement from saivs. Give prob of picking 1 a and 1 s. 1/5 What is prob of picking 4 n when four letters picked without replacement from {o: 3, n: 8}? 7/33 Four letters picked without replacement from xaxaxxxexiae. What is prob of picking 1 i, 1 x, and 2 a? 2/55 Two letters picked without replacement from anocqqqxncan. What is prob of picking 1 a and 1 o? 1/33 Two letters picked without replacement from {r: 3, d: 5}. What is prob of picking 2 r? 3/28 Two letters picked without replacement from xmihhmmmhhm. What is prob of picking 2 m? 2/11 Four letters picked without replacement from {n: 4, i: 6, h: 10}. What is prob of picking 3 i and 1 h? 40/969 Two letters picked without replacement from zyzyzzzyyyzzzypzzz. Give prob of picking 1 z and 1 p. 11/153 Four letters picked without replacement from brbtrrbtlrrrmftrrbrt. What is prob of picking 1 f, 1 m, and 2 t? 2/1615 What is prob of picking 2 u when two letters picked without replacement from uvvvuvv? 1/21 Three letters picked without replacement from {q: 2, e: 3, n: 6, j: 1, r: 3}. What is prob of picking 1 n and 2 r? 18/455 What is prob of picking 1 d and 1 t when two letters picked without replacement from ttaataddtteattt? 16/105 Two letters picked without replacement from {u: 1, r: 4, q: 6}. What is prob of picking 2 r? 6/55 Two letters picked without replacement from {n: 1, k: 3, w: 1, b: 2, m: 5}. Give prob of picking 2 k. 1/22 Calculate prob of picking 1 a and 1 l when two letters picked without replacement from {c: 1, d: 1, a: 1, o: 1, l: 1}. 1/10 Three letters picked without replacement from {j: 1, w: 1, l: 5, k: 1, c: 3}. What is prob of picking 1 w, 1 j, and 1 l? 1/33 Two letters picked without replacement from szsppppsgsppg. What is prob of picking 1 s and 1 g? 4/39 Three letters picked without replacement from {j: 8, p: 4, q: 1, l: 7}. Give prob of picking 1 l, 1 j, and 1 p. 56/285 Three letters picked without replacement from {a: 1, h: 3, t: 6, g: 2, u: 1, k: 2}. Give prob of picking 3 h. 1/455 What is prob of picking 1 r and 2 y when three letters picked without replacement from {y: 2, e: 5, r: 13}? 13/1140 Calculate prob of picking 4 z when four letters picked without replacement from {u: 5, z: 4, k: 3}. 1/495 Calculate prob of picking 2 x, 1 t, and 1 a when four letters picked without replacement from {a: 3, t: 6, x: 4}. 108/715 Three letters picked without replacement from crnasssacarrsrcscc. What is prob of picking 1 a, 1 s, and 1 r? 5/68 Calculate prob of picking 1 w and 3 i when four letters picked without replacement from riiwwmiiiiirwmiwwi. 7/51 What is prob of picking 1 q, 1 m, and 1 l when three letters picked without replacement from {l: 1, m: 1, k: 1, q: 1, o: 1}? 1/10 Two letters picked without replacement from {c: 3, a: 17}. What is prob of picking 2 a? 68/95 Four letters picked without replacement from yyyyggyyygyyyyyy. Give prob of picking 3 y and 1 g. 33/70 Two letters picked without replacement from {p: 10, l: 9}. What is prob of picking 1 l and 1 p? 10/19 Two letters picked without replacement from mxxnmrxrmmxrrmmrrm. What is prob of picking 1 m and 1 x? 28/153 What is prob of picking 2 o and 2 v when four letters picked without replacement from {o: 6, v: 2}? 3/14 Two letters picked without replacement from {u: 3, w: 1, s: 6, n: 1, a: 4}. Give prob of picking 2 a. 2/35 Three letters picked without replacement from {o: 1, r: 7, h: 4, f: 1, a: 2}. Give prob of picking 1 f, 1 r, and 1 o. 1/65 What is prob of picking 1 l, 2 i, and 1 v when four letters picked without replacement from vllliglgslillssssl? 2/765 What is prob of picking 1 g and 1 e when two letters picked without replacement from {e: 3, g: 12}? 12/35 Three letters picked without replacement from ljsbtbjibii. Give prob of picking 1 s and 2 b. 1/55 What is prob of picking 3 v when three letters picked without replacement from {o: 2, v: 7, f: 3}? 7/44 What is prob of picking 1 v and 1 i when two letters picked without replacement from {p: 1, v: 1, i: 1}? 1/3 Calculate prob of picking 1 f and 1 j when two letters picked without replacement from {f: 2, h: 3, m: 6, j: 1}. 1/33 Calculate prob of picking 2 s and 1 y when three letters picked without replacement from yhstbhrhyhsb. 1/110 Four letter	{ "pile_set_name": "DM Mathematics" }
composite? False Let y = 262 + -246. Suppose -yf = -6f - 23170. Is f a composite number? True Let c(m) = -m*3 + 12m*2 + 18m + 6. Let y be c(-8). Let j = y - 1647. Let l = j + 804. Is l prime? False Suppose -48p + 23447478 = 1914822. Is p a prime number? True Let l = -17531 + 9028. Let t = l + 14966. Is t a composite number? True Let k(g) = 2g - 76. Let v be k(26). Is (-88440)/v - (0 - 6) a composite number? False Let g(k) = -29k + k + 9k + 2k + 37 + k3 + 23k*2. Is g(-22) prime? False Let s be 42/14(2 + -2 + 1). Suppose 3 = sn + 3y, 2n - 4y = -n + 17. Suppose -nc + 1288 = -1433. Is c prime? True Let f(o) be the first derivative of o4/4 + 2o*3 - 11o*2 - 26o - 40. Is f(15) a prime number? False Let p(k) = -9k3 - 9k*2 + 12k - 7. Let v(z) = 27z3 + 27z*2 - 36z + 21. Let c(w) = -7p(w) - 2v(w). Is c(5) a composite number? False Suppose 1887534 = 37g - 1989067. Is g composite? False Let u be 1/(2/6) + -3. Suppose -t + u + 4 = 0. Suppose -tx + 277 = -471. Is x composite? True Suppose 7q = 97540 + 510879. Is q a prime number? False Suppose 20w + 36 = 24w. Suppose -2c + 2t = -15428, -10c + wc - 2t + 7717 = 0. Is c a composite number? True Let w(p) = 235p2 - 4p + 7. Is w(-2) a composite number? True Let j = 51 + -56. Is (-47085)/(-25) - (18/j - -4) composite? True Let b(h) = 38h2 - 28h + 787. Is b(27) a composite number? False Suppose 16y + 906844 = 52y + 56y. Let f be ((-1994)/3)/((-2)/6). Suppose -7o + f = -y. Is o prime? True Suppose -4x + n + 188305 = -343829, -5x = -2n - 665169. Is x prime? True Let j(c) = -554c + 220. Let h be j(-6). Suppose 9w - h = 8705. Is w composite? False Suppose 0 = -2k - 5y + 2099891, -5y + 1049938 = 4k - 3k. Is k composite? False Suppose q + 4c - 453 = 0, 2c + 2 = -0. Suppose 3o - 2o + 3d = -q, -2313 = 5o + d. Let l = -126 - o. Is l a composite number? False Suppose -16 = -x + 4k, 4k = -19 + 3. Suppose xr = -3r + 6. Suppose -2y = 0, 5y = -d - rd + 2337. Is d a composite number? True Let l be (4 - (-5 - -14)) + 51169. Suppose 97i + l = 101i. Suppose 5k + 4s - 17396 = -1381, s + i = 4k. Is k prime? False Let h(x) = -12x3 + 2x*2 - 2x + 11. Let k be h(-16). Suppose -16u + 24005 = -k. Is u a composite number? True Let t = 590928 + -226939. Is t a prime number? True Let q be -6(21/14 + (-1560)/1). Let s = q - 5554. Is s a composite number? False Let i(s) = -2872s + 11. Let p be i(-1). Let v = -1418 + p. Is v prime? False Suppose 0m + 4 = -4m - 4x, -4x = m + 10. Let q = -45 + 819. Suppose 5w = 5, -4c + 0w + q = -mw. Is c composite? True Let w(r) = 1104r*2 - 13r - 21. Is w(-6) a prime number? False Let o be (1 + -3790 + 2)7/(-7). Suppose -7c + 3c = -5x - o, -5x + c = 3778. Let y = -448 - x. Is y composite? False Suppose -60 = -2x - o, -4 + 0 = o. Let c = -28 + x. Suppose -cw + 2980 = 3l, -w + 1124 = -4l + 379. Is w a prime number? False Let y(x) = -2x*3 - 8x*2 + 10x + 5. Suppose -5l = -1 + 26. Let q be y(l). Is -1199(q + -6) composite? False Let g be 2011/(-8) + 99/264. Is 21/7 - g/1 composite? True Let v = 8743 + 7652. Suppose -h + u = -1207 - 2072, 5h - u = v. Is h composite? True Let p(g) = -2g2 + 16g + 21. Let h(y) = y*2 - 8y - 10. Let f(z) = 5h(z) + 2p(z). Let o be f(5). Let q = o - -164. Is q a prime number? False Let n(u) = -2u3 - u2 - 5u*3 + 3u*3 - 2 + 8u*3 + 3u. Let i be n(1). Is 10/i(-3678)/(-15) prime? True Suppose 576p - 591p = -8075355. Is p a prime number? True Let k be 0/(-6) + (1 - -28003). Is 20/4k/20 prime? True Suppose -3s + 18 = -0s + 4w, 5s - 3w - 1 = 0. Suppose k + 4k - su = 379, -12 = -4u. Let y = -40 + k. Is y a prime number? True Is (1018/5)/((6 - -4)5/65375) a composite number? True Let i be (-26)/52(-1 - -1). Suppose 92n - 82n - 11390 = i. Is n a prime number? False Suppose -3p - 120743 = 34b - 39b, -4p - 24135 = -b. Is b a prime number? True Suppose 2i - 34693 = -5o, 2i - 2o - 582 = 34132. Is i prime? False Let r(l) be the third derivative of l*5/10 - 7l*4/24 - 7l3/2 + l2. Let y = 2866 - 2856. Is r(y) prime? True Suppose 828065 = 12o + 1247509 - 4664336. Is o composite? True Let j(i) = 2678i*3 - 32i*2 + 153i - 16. Is j(7) a prime number? True Is ((-83877)/15)/((-10)/50) composite? True Suppose 0 = 217q - 215q - 1230. Let l = q + -350. Is l a prime number? False Suppose -4i - 12 = -2f, -2f + 2i + 8 = -0. Suppose -g = -fv + 10, -5v + 20 + 3 = -3g. Suppose -vs + 942 + 3503 = 0. Is s prime? False Let v be (-2)/(3/7 + 116/(-140)). Suppose -vs - h = -3h, s - h = 0. Suppose -2x - 3d + 940 = 0, -x - 2d + 0d + 471 = s. Is x a composite number? False Suppose 71 - 143 = -18c. Let s be 2 + 5 + 1 + -1. Suppose -2w + 1058 = -3d + sd, -cw = -d - 2080. Is w a composite number? False Let k(t) = 37t*3 + 26t*2 - 114t + 5. Is k(4) a prime number? True Let p(h) = -5h - 15. Let i(u) = -u. Let k(j) = 3i(j) - p(j). Let z be k(-14). Let v(a) = 2a2 + 17a - 11. Is v(z) prime? False Is 30/40(-648996)/(-9) a composite number? False Suppose 2 = r + 1. Let y be ((-2)/(-12)-970)/(r/(-60)). Is y/28 + 3/(-7) a composite number? True Is (7 + 1087066/76)472 composite? True Let l be (-121)/(-22)(4 - -6). Suppose -897 = lf - 58f. Is f a composite number? True Suppose 4m = m + 3u, 12 = m + 3u. Suppose 3a + 113 + 652 = mw, a - 749 = -3w. Is w prime? True Suppose -50k = -42k - 182144. Let j = -7269 + k. Is j composite? True Is (84/6)/(-56)-82444 prime? True Let h(v) = 114v2 - 22v + 159. Let s = 278 + -270. Is h(s) a prime number? False Let r = -98 - -103. Suppose -3x + 7564 = -2t, -rx = -4t + 5t - 12585. Is x prime? False Is -7 + 8 + 9 - -66247 a prime number? False Let x(c) = -6c + 74. Let l be x(12). Suppose 337 = lh - b - 1265, -h - b + 795 = 0. Is h prime? False Let f(w) = -w3 + 3w*2 + 14w + 10. Let l be f(6). Let c = l - -181. Is c composite? False Let y be (-39080)/(-16) - ((-10)/(-4) - 2). Let v = y + -1433. Is v a prime number? True Let d(u) = -2917u - 50. Let j(x) = x3 - 4x*2 + 8x - 9. Let t be j(2). Is d(t) prime? False Let y(m) = -7m + 79. Let v be y(11). Suppose 10b - 6b + 5c - 29117 = 0, -vb + 14569 = -c. Is b prime? True Let w(o) be the third derivative of 0 + 15o*2 + 11/6o*3 + 1/60o*6 + 0o + 7/24o4 - 1/5o*5. Is w(8) a prime number? False Suppose 14c = 16c - 2932. Suppose 7z - c = 1775. Let g = z + -302. Is g a prime number? False Suppose 0 = 319a - 316a - 6, -2y - 3a = -9754. Is y a prime number? False Suppose 0 = 199o - 194o + 35. Let i(p) = -2p3 - 10p*2 + 5p + 16. Is i(o) prime? False Let u(w) = 544w3 - 11w*2 + 46w - 16. Is u(5) composite? False Let m = 99 - 78. Let j = 23 - m. Suppose -jg = 6z - 7z - 328, 0 = 3g - z - 491. Is g a prime number? True Let m(s) = 557s2 + 10s - 5. Suppose -w + 4 = -3. Is m(w) a prime number? False Let t = -146029 - -312320. Is t a prime number? False Let p be 1/1 + (-10 + 9)-4. Suppose -pg - 12g = -39491. Is g composite? True Let c(q) = -14 + 38 - 13 - 5q - 13. Let h be c(-1). Suppose -hs + 0 = -6, 0 = -4j + s + 1574. Is j composite? True Let f(v) = -38 + v*3 + 4v + 5 - 23v2 + 86. Is f(23) a composite number? True Suppose 0 = 2y - 4m - 86582, -2y + m + 6961 = -79621. Is y a prime number? True Let b = -933 + 1554. Let u = b + -398. Is u a composite number? False Let y(k) = 8k2 - 5 + 2k - 3k3 + 0k*3 + 2k*3 - k. Let s be y(8). Suppose -5v = sw - 0w - 3943, 807 = v - 4w. Is v a composite number? True Let x(s) = 161s - 24. Let i be x(-1). Let l = i + 10702. Is l composite? True Let c = 55 + -52. Suppose p + cp - 5d - 27823 = 0, p + d - 6949 = 0. Suppose -2b = 6b - p. Is b a prime number? False Suppose 6z - z = 5. Suppose -l + s + 0 = z, -5s = l - 23. Suppose 0 = p + 3q - 1363, -p - q + 1361 = lq. Is p prime? False Suppose -5z - 28l + 26l = -1689513, 5z - 1689517 = -3l. Is z prime? True Suppose -438882 = 77b - 4875391. Is b composite? True Suppose 14s = 8s + 30. Suppose -2g - 4w - 559 = -3g, sw = 4g - 2214. Is g a composite number? True Suppose -9a + 5p + 3067114 = -979834, 2a = 4*p + 899342. Is a a composite number? True Suppose 5426 = x - 2042. Is	{ "pile_set_name": "DM Mathematics" }
h(k) - x(k). 633k2 + 2k - 3 Let r(c) = 10c - 16045. Let d(l) = -13l + 21404. Give -7d(x) - 9r(x). x - 5423 Let l(j) = -3645j. Let p(x) = 1232x. What is 3l(i) + 10p(i)? 1385i Let b(y) = 96y*3 - 72y*2 - 72y + 72. Suppose 0 = 64u - 62u - 144. Let x(r) = -r3 + r2 + r - 1. Give ux(d) + b(d). 24d*3 Let s(d) = -7d*2 - 207d + 92. Let n be s(-30). Let z(r) = -3r3 + 2r*2 - 2r + 2. Let a(m) = -14m3 + 11m*2 - 11m + 10. Determine na(w) - 11z(w). 5w3 - 2 Let d(y) = -5y*2 + 11y. Suppose -3n - 2l = 2l - 436, 0 = -4l - 20. Let g = 146 - n. Let c(t) = -2t2 + 6t. Calculate gd(i) + 11c(i). 8i2 Let l = -9 - -6. Let i(m) = 3m*2 + 2m + 9. Suppose -2q + 8 = 0, 33 = 5j + 3q - 14. Let u(p) = p2 + p + 4. Give ju(r) + li(r). -2r*2 + r + 1 Let o(t) = -2413949t*3 - 15248t*2 - 22872t - 7624. Let m(b) = 950b3 + 6b*2 + 9b + 3. Calculate -7624m(i) - 3o(i). -953i3 Let g(y) = 159y*2 + 4y + 23. Let c(m) = -1591m2 - 41m - 233. Determine 2c(w) + 21g(w). 157w2 + 2w + 17 Let d(t) = -4t3 - 2t*2 + 6t - 5. Suppose r - 4y = 25, -3r + 5y - 2446 + 2479 = 0. Let q(c) = c3 - c2 - c + 1. Determine rd(j) + 5q(j). j3 - 7j*2 + j Let b(x) = 9 - 8x*2 - 3 - 2x*2 + 1 + 92x - 89x. Let a(f) = f2 - f - 1. Calculate 5a(u) + b(u). -5u2 - 2u + 2 Let r(k) = 14k - 6. Let b(t) = 9t - 2 - 2 + 0t. Let j(d) = d3 + d2 - 7d. Let p be j(0). Suppose 0 = -3g - pg + 24. Give gb(c) - 5r(c). 2c - 2 Let r(o) = -13993o + 2. Let b(t) = 21024t - 3. What is 5b(l) + 7r(l)? 7169l - 1 Let v(s) = 1. Let m(i) = 5i2 + i - 3. Let x(g) = 51g*2 + 8g - 29. Let a(w) = 10m(w) - x(w). Calculate -2a(y) - 4v(y). 2y*2 - 4y - 2 Let l(d) be the third derivative of -163d4/24 + 5d*3/6 - 2d*2 - 8639d. Let t(j) = 5135j - 158. What is 158l(z) + 5t(z)? -79z Let i(w) = 2w - 19. Let x(d) = 15d + 36. Determine -14i(z) - 6x(z). -118z + 50 Let o(w) = 6w*3 - 5w2 + w + 1. Let n(y) = -y3 + y*2 + y. Let s be (-10)/6 - (-23)/(759/121). Calculate so(q) + 10n(q). 2q*3 + 12q + 2 Suppose 3n + 78 - 296 = b, 3n = -4b - 887. Let a(d) = -481d*2 - 221d. Let z(c) = -13c2 - 6c. Calculate bz(s) + 6a(s). -13s2 Let w(a) = 68a - 50a - 17a + 0 + 1 + 0. Let n(j) = -34j + 1. What is -n(v) + w(v)? 35v Let v(n) be the second derivative of -6n3 - 5n*2/2 - 629n. Let b(m) = 18m + 2. Give 5b(h) + 2v(h). 18h Let r(w) = -50490w + 3 - 4 + 50491w. Let p(c) = -22c - 7. What is 2p(m) - 14r(m)? -58m Let a(b) = -5b + 42. Let k be a(8). Let j(q) = -kq2 + q2 + 3 + 9 + 0. Let o(s) = -3. Determine 2j(n) + 9o(n). -2n2 - 3 Let w(b) = 14b*3 - 53b*2 + 6b - 14. Let s(f) = -2f3 + f2 - f. Give -6s(t) - w(t). -2t3 + 47t*2 + 14 Let n(m) = 8m*2. Suppose -42t - 708 = -40t. Let i = 349 + t. Let p(j) = 15j*2. Calculate in(q) + 3p(q). 5q2 Let l(a) = a2 + 21. Let p(k) = -4k3 - 14k*2 - 109. Let s(g) = 5l(g) + p(g). Let o(d) = -2d3 - 4d*2 - 2. Calculate 9o(x) - 4s(x). -2x*3 - 2 Let h(t) = -4t*3 - 5. Let r be 220/(-1210) - (-328)/(-11). Let s(m) = -1. Give rs(y) + 6h(y). -24y*3 Let v(o) = -186o + 2158. Let b(p) = 86p - 1079. Calculate 13b(c) + 6v(c). 2c - 1079 Let t(r) = -4r2 - 134r - 8. Let n(x) = 6x2 + 270x + 15. Determine 3n(y) + 5t(y). -2y2 + 140y + 5 Suppose 0 = 9m - 4m - 10. Let h(y) = -12y3 + 8 + 120y - 11ym - 128y - 3y3. Let j(o) = -5o*3 - 4o*2 - 3o + 3. Determine -3h(f) + 8j(f). 5f3 + f2 Let f(v) = 7v - v - 3v + 0 - v - 5. Let k(j) = -2j + 6. Calculate 5f(r) + 4k(r). 2r - 1 Let f(j) = 687. Let u(g) = 55. Let w(d) = -2f(d) + 25u(d). Let p(q) = -q2 - q - 2. Calculate -p(y) - 4w(y). y*2 + y - 2 Let p(k) be the third derivative of -11k4/12 - k3 - 20k2. Let w(a) = 441a + 119. Determine -119p(d) - 6w(d). -28d Let i(f) = -4f*2 - f - 1. Let m(n) = 9n + 20. Let c be m(-2). Let y(s) = -5s2 - 2s - 1. Suppose 0 = -4a - 2 - 10. What is ai(v) + cy(v)? 2v*2 - v + 1 Let m(c) = -643c - 35. Let f(q) = -124q - 7. Give 11f(w) - 2m(w). -78w - 7 Let r(z) = -520z - 320. Let j(l) = -104l - 64. Let t(i) = -14j(i) + 3r(i). Let n(p) = 5p + 3. Suppose 319 = -24c + 247. Give ct(f) - 64n(f). -8f Let r(i) = -10i + 7. Let w be 8/6 - (-2336)/(-96) - -6. Let l(t) = -29t + 20. Determine wr(a) + 6l(a). -4a + 1 Let w(d) = 32d2 + 10d + 1. Let o(x) = 11x2 + 2x - 1. Let r(g) = -3o(g) + w(g). Let y(u) = u2 - 5u - 3. Give 4r(l) + 5y(l). l*2 - 9l + 1 Let a(h) = 34h - 1. Let b(i) = -184i + 44. Calculate -6a(d) - b(d). -20d - 38 Let n(v) = 389v3 - 10v*2 - 2v - 46. Let j(f) = 258f3 - 7f*2 - f - 32. Give 10j(i) - 7n(i). -143i*3 + 4i + 2 Let l(w) be the third derivative of -w4/24 + w3/6 + 1622w2 + 2w. Let g(f) = 265f - 318. Determine -g(n) - 318l(n). 53n Let l(f) be the second derivative of -7/4f*4 - 15/2f*2 - 2f + 5/2f3 + 0. Let s(r) = 0 - 2858r*2 - 2 + 2855r*2 + 2r. What is -2l(u) + 15s(u)? -3u2 Let o(i) = i3 + 3i*2 + 2i + 3. Let h(g) = g*2 - g - 1. Let n(t) = -h(t) + o(t). Let j(b) = 2b*2 + 2b + 4. Calculate -3j(c) + 2n(c). 2c3 - 2c*2 - 4 Let z(i) = 9i*2 + 20i - 17. Let y(d) = -14d2 - 22d + 17. Calculate -2y(u) - 3z(u). u*2 - 16u + 17 Let c(y) = 26y - 5. Let w(f) = -24f + 8. Determine -4c(i) - 5w(i). 16i - 20 Let r(q) = -1 - 3 - 1 - 5q. Let w be 3/(-21) - 704/(-616). Let v(g) = -g - 1. Calculate wr(z) - 4v(z). -z - 1 Let f(x) = -20x2 + 21x + 22. Let q(n) = 9n2 - 8n - 9. Let i(s) = 3f(s) + 7q(s). Let u(z) = 2z2 + 6z + 2. Let r = 3 - 7. Give ri(b) + 5u(b). -2b2 + 2b - 2 Let p(n) = 5n2 - 22n - 560. Let t(z) = -7z2 + 30z + 840. Determine 10p(w) + 7t(w). w*2 - 10w + 280 Let t(i) = i*3 + 6i*2 + 7i + 19. Let x be t(-7). Let g = 74 + x. Let h(u) = -u - 1. Let v(j) = -4j - 3. Determine gh(p) + v(p). p + 2 Let y(l) = l*2 - l. Let m(k) be the first derivative of 4k*3/3 - 7k*2/2 + 3k + 5906. Give m(o) - 2y(o). 2o*2 - 5o + 3 Let q(c) = -6c + 3c + 3c2 + 3c + 6c + 0c. Let t(d) = 2d2 + 5d. Let a be 48/9 - (-4 - (-52)/12). What is at(m) - 4q(m)? -2m2 + m Let a(v) = v. Let k(l) = -1 - 140l + 51l + 30l + 30l + 21l*2 + 32l. Determine 3a(h) - k(h). -21h*2 + 1 Let c be (1(-3)/72)/(33/(-99)). Let u(w) be the third derivative of -cw4 - 2/3w*3 + 6w*2 + 0w + 0. Let x(h) = -h - 1. Calculate -2u(p) + 7x(p). -p + 1 Let y(j) = 153j3 + 26j. Let u(n) = -1073n3 - 180n. Calculate 2u(t) + 15y(t). 149t3 + 30t Let d(j) = 15j + 5. Let m(s) = -15s - 4. Suppose 5z - 3a + 7a - 49 = 0, -2z - 3a + 28 = 0. Give zd(q) + 6m(q). -15q + 1 Let y(u) = 376u3 - 8u*2 + 2. Let h(f) = -192138f*3 + 4092f*2 - 1023. What is -4h(w) - 2046y(w)? -744w*3 Let y(h) = 2h*2 - 6h - 8. Let u(s) be the first derivative of -s*3/3 + 5s*2/2 + 7s - 4395. Calculate 6u(i) + 5y(i). 4i2 + 2 Suppose -77 = -4a - 5p + 10p, -74 = -4a + 2p. Let u(n) = -a + n + 29 - 12. Let m(b) = 3. Give -m(v) + 2u(v). 2v - 5 Let i(r) = -736r3 - 161r + 161. Let q(v) = -5 + 233v + 22v*3 - 466v + v*3 + 238v. Determine -5i(a) - 161q(a). -23a3 Let q(i) = 6i*2 + 2i + 2. Let u(d) = 26d2 + 27d - 1. Let s(a) = -12a2 - 12a. Let f(l) = -7s(l) - 3u(l). Give 2f(h) - 3q(h). -6h2 Let k(a) = 2a*3 + 35a*2 - a + 12. Let d(u) = -8u*3 - 139u*2 + 4u - 51. Calculate -4d(o) - 17k(o). -2o3 - 39o*2 + o Let d be ((-8)/((-160)/36))/(6/20). Let u(y) = -8y*2 + 6y. Suppose 6c - 65 = c. Let i = c - 6. Let t(f) = 9f*2 - 7f. Calculate dt(l) + iu(l). -2l2 Let f(l) = 2l*2 + 3l - 2. Let p(o) = 9o2 + 17o - 13. Let d(h) = -6f(h) + p(h). Let n(a) = a2 + a - 1. What is -d(z) + n(z)? 4z*2 + 2z Let v(j) = -8j3 + 13j*2 - 13. Let w = -26 + 52. Let y(b) = 2b*3 - 3b2 + 3. Let i(q) = -q2 + 50q - 330. Let l be i(8). Calculate lv(m) + wy(m). 4m*3 Let s(i) = 0i - 10 - 20i + 2 + 23i + 0. Let a(w) = -6w + 16. Calculate -2a(k) - 5s(k). -3k + 8 Let w(n) = -2n3 - n2 + 4n + 4. Let m be (-4 + 8)/(-2)(-7)/(-14). Let i be m13/((-26)/8). Let s(j) = 5j3 + j2 - 9j -	{ "pile_set_name": "DM Mathematics" }
-3 Let x = 5 - 5. Suppose -4b - 3n = 0, 3n + xn = 3b. Sort 4, b, 3. b, 3, 4 Suppose 4l + y + 10 = l, 5l = -4y - 12. Put 32, 0, l, 4 in descending order. 32, 4, 0, l Let r(q) = q - 19. Let u be r(17). Let s = -1 - 2. Sort u, s, -1. s, u, -1 Let h = -15 + 13. Put h, -5, -1 in decreasing order. -1, h, -5 Let l(g) = g + 5. Let y be l(-6). Sort 5, y, 7 in decreasing order. 7, 5, y Suppose 30 = -4k - 2x, 2k - 2x = -0k. Sort 3, k, 4 in decreasing order. 4, 3, k Let p = 18 - 13. Suppose 3o + p = -2o - 2x, 4o + 2x = -2. Let f be 78/18 - 2/o. Put 0, f, -4 in ascending order. -4, 0, f Suppose 0 = -5u + 2i + 3, -4u = -4i - 7 - 5. Let t be 0(-2 + (-3)/(-2)). Sort t, 4, u in ascending order. u, t, 4 Suppose 4 - 10 = -2l. Put -0.2, l, -2/13 in decreasing order. l, -2/13, -0.2 Suppose 3m = 14 - 2. Suppose -mb = 4, -3o + 3b = -2b + 13. Let q(r) = -r - 5. Let k be q(o). Sort -2/7, 3, k in descending order. 3, k, -2/7 Let i = -1 - 1. Let c(o) = -o3 + 4o*2 + 6o - 2. Let p be c(5). Sort i, 2, p in ascending order. i, 2, p Let v = 19 + -17. Sort 2/7, 2/19, v. 2/19, 2/7, v Let a be (-2)/(-2)(-3 - -3). Suppose -6u + 2u = 5g + 2, 5u - 2g = 14. Put u, a, -4 in decreasing order. u, a, -4 Suppose -2h = 5m + 5 + 11, 5m = -20. Suppose -3d - 25 = -8d. Put 1, h, d in decreasing order. d, h, 1 Let n be -4(0 - 5)/(-5). Sort 0.5, 0, n in descending order. 0.5, 0, n Let w be 1/(-4) - 34/(-8). Let g(f) = 67f2 - 63f*2 - f + 3f*3 - 4f*3. Let b be g(w). Put 1, -1, b in decreasing order. 1, -1, b Let l be 9/((-3)/1)-2. Let d = 3 - l. Let g be 1/(-3) - 7/d. Sort -3, g, 3 in descending order. 3, g, -3 Let j(w) = -w*3 - 6w*2 - 5w + 5. Let y be j(-5). Suppose -yq + 13 = -12. Suppose 18 = -5d - l, 12 = -7d + 2d - 4l. Put d, q, -3 in decreasing order. q, -3, d Suppose -24 = -2j - 2b, -2b = j + 2b - 21. Suppose 3o = -j, 3r + 3 = 3o + 9. Sort r, -3, 5. -3, r, 5 Let v be -5(80/25)/(-4). Put 0.5, v, 0.04, -5 in increasing order. -5, 0.04, 0.5, v Let v = 2.836 + -0.036. Sort v, 0.3, 2/11 in decreasing order. v, 0.3, 2/11 Let l be 2 + 5/(-2)28/(-35). Sort -4, 3, -2, l in increasing order. -4, -2, 3, l Let q = 42/11 + -400/99. Sort -1/6, -0.1, q, 11 in ascending order. q, -1/6, -0.1, 11 Let z = -4 - 5. Let o be (10/8)/(z/(-36)). Sort o, 1, -4 in decreasing order. o, 1, -4 Let i = 5 + 7. Suppose 4y + i + 32 = 4o, 2o = -5y + 36. Let m = 8 - o. Sort m, 5, 2 in increasing order. m, 2, 5 Let v(r) = r*3 - 6r*2 - 5r - 16. Let a be v(7). Let o be (-4)/(-10) - (-54)/15. Suppose 0 = 2c - 3c - 5. Put o, c, a in descending order. o, a, c Let l be (2/(-8))/(2/(-6)). Let u = 4.2 - 0.2. Suppose -j - 3h = -6, -5h = -0j + j - 10. Sort j, u, l in decreasing order. u, l, j Suppose 2b - 4b - 77 = 3v, -5v - 137 = -b. Let m be 1/(-6)v/(-18). Sort m, 5, 0 in ascending order. m, 0, 5 Let c = 0 - 0. Let z = -0.4 + c. Let s = -0.3 + -1.7. Sort s, z, -3. -3, s, z Suppose 2y + 5 = 11. Put 2, -13, y in decreasing order. y, 2, -13 Let b = -98 + 298/3. Sort b, -1/5, 1/6 in decreasing order. b, 1/6, -1/5 Let h(i) = i2 - i - 4. Let m be h(-3). Suppose 0 = -3y + my. Suppose y = 2j + 3 + 5. Sort j, 1, 4 in descending order. 4, 1, j Let s = -53/2 - -26. Sort s, 0, -1/13 in ascending order. s, -1/13, 0 Let z = -12 + -2. Let q = 14.5 + z. Put 1, 0.1, q in ascending order. 0.1, q, 1 Suppose -65k = -61k + 20. Put k, -1/44, -0.4 in decreasing order. -1/44, -0.4, k Suppose -2w - 2 + 12 = 0, -4w + 34 = -d. Sort -2, -4, d, -3. d, -4, -3, -2 Let r = -3/46 + -17/92. Sort -4, -2, r. -4, -2, r Let f be (3/4)/(6/10). Let g = -3.53 - -0.03. Let o = g + 3. Put f, o, 2 in descending order. 2, f, o Let q(a) be the third derivative of 7a5/20 + a4/12 + a3/2 - a2. Let d be q(3). Let w be (-3)/d - 4/(-22). Put 3/2, w, -0.5 in descending order. 3/2, w, -0.5 Let i be (8 - 12)/(-1(1 + 0)). Suppose 8a = 3a - k + 5, -3a = 2k - 10. Let n = 1 - a. Sort n, i, -5 in decreasing order. i, n, -5 Suppose -b = y - 5 + 2, 19 = -3y + 4b. Let r = -11 + 19. Let g = r + -12. Put g, y, 0.5 in ascending order. g, y, 0.5 Let z = 653 + -3266/5. Let b(u) = -3u + 1. Let c be b(-2). Suppose 2q = -1 - c. Sort q, z, 3. q, z, 3 Let h(x) = -x + x*2 - 3 + 3 - 2x*2. Let m be h(1). Suppose 4 = 5t - u, 2t - u - 4u + 3 = 0. Sort t, m, 0. m, 0, t Let f = -61 - -58. Put -1.6, 0, f in descending order. 0, -1.6, f Let q = -151 + 1961/13. Put 0.1, 3, q in descending order. 3, 0.1, q Suppose 2 + 6 = -2c. Let g be 2/c(1 - 1). Sort g, 0.2, -2/15. -2/15, g, 0.2 Suppose 0 = 4k + 3t - 11, -2t - t = -4k + 5. Sort 3, 4, 5, k in ascending order. k, 3, 4, 5 Suppose -v - 2 = -1. Put 5, 3, v in decreasing order. 5, 3, v Suppose 0 = -4b - 4m + 36, -b - 2m + 30 = 2b. Let q be ((-6)/b)/((-18)/8). Sort 0.5, -3, q in decreasing order. 0.5, q, -3 Suppose -2z = -3o - 8, 3o + 5z = 2z - 3. Put 1, -7, o in ascending order. -7, o, 1 Let m(h) = 2h*2 + 3h - 10. Let q be m(2). Put q, 9, -3 in ascending order. -3, q, 9 Let c = -2.1 - -5.1. Sort 2/7, -2, c in decreasing order. c, 2/7, -2 Let c = -5 + 4. Let w be (0 + 1)/(c/3). Sort w, -1, -5. -5, w, -1 Let z = -18.8 - -21. Let k = -2.7 - z. Let l = k - -0.9. Sort l, 1, -0.3 in descending order. 1, -0.3, l Let b = 83/45 + -13/9. Put -3, b, -4/3, -4/5 in decreasing order. b, -4/5, -4/3, -3 Let p(j) = 3j3 - 3j*2 + 2j - 1. Let v(b) = -b*3 - b + 1. Let t(s) = -p(s) - 2v(s). Let r be t(3). Sort r, 4, 3 in descending order. 4, 3, r Suppose 2c + 12 = 14. Put -2, 2, c, -4 in descending order. 2, c, -2, -4 Let c = 2 - 0. Suppose -g - cg + 17 = 4o, -4g = -4o + 24. Suppose -3h - 2 - 7 = 0. Sort g, h, 4 in decreasing order. 4, g, h Let t = -20 - -12. Let d = 0 - t. Sort 0.4, d, 3 in descending order. d, 3, 0.4 Suppose -4m - d = -7, -3m - d - 3d = -2. Suppose 8 = -mb + 2t, 5b = 4t - 8 - 15. Let l be (-1 - b/2)2. Put -0.3, l, -4 in decreasing order. l, -0.3, -4 Let c(b) = -2b2 - 5b - 5. Let l be c(-3). Let a be (l/10)/(176/(-40)). Put a, 3, -1/7 in ascending order. -1/7, a, 3 Suppose -3r + 1 = -3h + 37, 2h + 5r = 17. Let a be 4/(-2) + 16/h. Put a, -3, -2 in ascending order. -3, -2, a Suppose -30 = -3h - 0h. Suppose -h = -6z + z. Suppose -y + 3f - 8f = 17, z = 5y - 4f. Sort y, -1, -3 in ascending order. -3, y, -1 Let k be (-12)/(-54) - 32/(-18). Let d be (6/(-3))/(2/(-4)). Sort 1, k, d. 1, k, d Let q = -3 + 13. Let y = q + -6. Let x(u) = -u3 - u2 + u. Let l be x(1). Sort l, 5, y in descending order. 5, y, l Let z be (-57)/90 + 2/4. Let k = 0 - 2/9. Sort z, 2/7, k in descending order. 2/7, z, k Let q(o) = -o2 + 14o - 47. Let c be q(8). Sort -5, 4, -11, c in decreasing order. 4, c, -5, -11 Let a = 11 - 7. Let t = 5.7 - 6. Let u = t + 0.4. Sort a, u, 0 in decreasing order. a, u, 0 Let o = 4 - 0. Suppose -2t - 8 = -0t. Let k = 3 + t. Sort o, -3, k in descending order. o, k, -3 Let r = 25 + -74/3. Let l = 0.2 - 0.1. Let o = -0.1 - l. Sort o, 0.1, r. o, 0.1, r Let b(g) = -g*3 - 2g*2 - 3g - 1. Let i be b(-2). Let o be (-9)/(-3) - i/1. Sort -4, 4, o in increasing order. -4, o, 4 Let u(j) = j*3 - 6j*2 - 6j - 8. Let k be u(7). Let x be k/6 - 21/(-54). Put -3, -2/5, x in increasing order. -3, -2/5, x Suppose -27 = -5s - u, -s - 4u = -3s + 2. Let z(n) = n3 + 9n*2 - 9n + 13. Let d be z(-10). Let w be (-2)/3(d + 3). Put 1, s, w in increasing order. w, 1, s Suppose 4q = -0q + 8. Let v = 5 - q. Sort v, 2, 5. 2, v, 5 Suppose 2b - 7b - 15 = -5z, 5z = -4b - 39. Let a be b/(-21) - (-32)/(-63). Let q be (1/5)/((-1)/(-1)). Sort q, 2/9, a in increasing order. a, q, 2/9 Let v = 1 + -1.4. Let h = 5 - 7. Let s be (-1 + 3)h/(-34). Sort s, -1, v in descending order. s, v, -1 Let q = -68 - -61. Sort -1, 3, q, 2. q, -1, 2, 3 Let z be (-30)/7 - 4/(-14). Let k = 2/169 + 503/338. Sort 0.5, z, k. z, 0.5, k Suppose -5r - h = -0r - 74, -2r - 2h + 28 = 0. Suppose u = r - 1. Let n = u + -9. Sort 1/2, n, 2/5 in decreasing order. n, 1/2, 2/5 Let s be ((2/(-2))/1)/3. Let y(k) = k3 + 10k*2 + 10k + 4. Suppose 0 = p - 2p - i - 14, 0 = -2i - 10. Let o be y(p). Sort o, s, 0.2 in ascending order. o, s, 0.2 Suppose 0 = -4b + 3f - 5, 5b = b - 2f - 10. Let o be (-3)/b*90/27. Let d = -2 - -4. Sort o, 3,	{ "pile_set_name": "DM Mathematics" }
*2) - 20 - 4c*5 + 20 - 4c*4 - 2c*5 + 4c*4. -5c*5 Expand (-3 + 4 + 1)(0 + 0 + 2o + (-2o + 3o + o)(1 - 3 - 3) + (6o + 17 - 17)(-5 + 3 + 3)). -4o Expand (-j4 + 0j + 0j + 4j)(5 - 4 + 1). -2j*4 + 8j Expand (1 + 1 - 4)(1 - 1 + o)(-4331 + 4331 + 33o2). -66o*3 Expand (v - 2v + 2v)(v + 2 - 2) + 0v2 + 2v2 - v2 + (-3v + v + 0v)(4v - v - v). -2v2 Expand (a - 2 + 0a + 0)(-4a2 + a2 + a*2). -2a*3 + 4a*2 Expand (4 - 2g*2 - 4)(g3 + g3 - 5g3 + (-3 + 4 + 0)(-2g3 + g3 - g3) - 5g*3 + 4g*3 + 0g3 - g3 - 2g3 + 0g*3). 18g*5 Expand (3 + 16g - 3)(-g2 + 3g2 - g2). 16g3 Expand (3s - 3s - s3)(4s - 2s*2 - 4s) - 5s5 + 4s*5 + 2s*5 + (2s - 1 + 1)(3s*4 + 3s*3 - 3s*3). 9s*5 Expand (-6t*2 + 0t*2 + 4t*2)(2t2 + t2 - t2). -4t4 Expand (-n2 - 4n + 5n - n*2)(-6n2 + 4n*2 + 3n*2)(2n - 3n + 2n). -2n5 + n4 Expand (-2a2 + 2a*3 + 2a*2)(5 - 8 + 13). 20a3 Expand (-u3 - 6u*2 + 1 + 2u*3 + 5u*2)(4u2 - 5u2 - u2). -2u5 + 2u*4 - 2u*2 Expand -4k*5 + 2k5 + k5 + 40 + 5k5 - 6k*5 - 37 + (-2 + 2 + 2)(-6k5 + 4k5 + k5). -4k5 + 3 Expand (g - g + 6g)(-1 + 0 - 1). -12g Expand (2 + 1 - 5)(4l - 4l - l) - 2l + 2l + 2l. 4l Expand (-3q*3 - 2q*3 + 3q*3)(-3q2 + 2q + 5q2 + 1 + 11q). -4q5 - 26q*4 - 2q*3 Expand (-4j + 14j4 + 6j - j)(14j - 3j - j). 140j*5 + 10j*2 Expand (-3a + 0a - 3a)(-2a2 - a2 + 0a2). 18a*3 Expand (2 - 1 + 2)(0 - 3 + 5)(-g - 5g + 8g). 12g Expand ((-3 + 5 - 1)(1 - 1 - h) - h + 0h + 3h)(-20 - 10 + 3). -27h Expand (2x*2 - 2x2 + x3)(x - 3x + x) + 0x4 + 2x*4 + 0x*4 - 3x*4 + 2x4 - x4. -x*4 Expand (3o*2 + 7o*2 - 2o*2)(3o - 5o + o) - o2 + o2 - o*3. -9o*3 Expand (0h*2 + 0h2 + h2)(h + h + 2h)(-4 + 2 + 0). -8h*3 Expand (7j - j + 0j + 2 - 2 + 2j + (0 + 0 - 2)(4j - 3j - 2j) + 6j - 4j - 3j + 0j + 2j - j)(-4j4 + 2j*4 + 4j*4). 20j*5 Expand (-1 + 0 + 2)(-21f - 21f + 4f)(1 + 0 - 4). 114f Expand (j - 3j + 2 + j)(10j + 0j - 6j). -4j2 + 8j Expand (1 + m - 1 + (-m - 3m + 3m)(1 + 3 - 2))(0m2 + 2m*2 - 4m*2)(-3 - 29 + 13). -38m3 Expand ((-l + 5l - 5l)(2 - 4 + 0) + (-2l + 2l + 2l)(22 - 76 - 9))(-l4 + 0l*2 + 0l*2). 124l*5 Expand -2t4 - t3 + t*3 - 5t*2 + 5t*2 - 2t*4 - 4t*4 - 2t*2 + 2t2 + (t - t - t3)(2 - t - 2). -7t*4 Expand (-2i + 3i - 3i)(1 + 1 - 3) + i - 3 + 3 - 5i + i + 0i. -i Expand (-3h + 5h - 4h)(-1 + 1 + 1) + 4h - 3h + 0h + (0h - 5h + 2h)(2 + 0 - 4). 5h Expand (2n - 2n - n2)(8 - 14 - 3)(-3 + 0 + 1). -18n2 Expand (-a4 - a4 + a4)(-4a - a - a). 6a5 Expand (1 - 1 + 2n)(-5 - 15n + 0 + 6). -30n2 + 2n Expand (-12k2 - 33k*2 + 3k*2)(0 + 0 + k). -42k3 Expand (-c - 1 + 1)(16 - 10 - 15). 9c Expand (6 + 5 - 2)(t - 3 + 3 + 2t4). 18t*4 + 9t Expand (4 + 2 + 1)(-s2 - 4s*2 + 3s*2) - 8s*2 - 52 + 52. -22s*2 Expand (2a - a + 2 - 5)(3a - 2a + 4a). 5a2 - 15a Expand -j*2 + 5j5 + j2 + 0j5 + j5 - 3j*5 + (-4j - j + 3j)(-2j4 + 0j*4 + 3j4). j5 Expand l3 - l3 - 4l3 + l4 + (4l + 2l2 - 4l)(6l*2 - 3l2 - l2). 5l4 - 4l*3 Expand -h + h + 2h*5 - 2 + (-1 + 0 + 3)(0h5 - h5 - h5) - h5 + 4h*2 - 4h*2. -3h*5 - 2 Expand (-4v + v + v)(-v + v - v2) - 5v*3 + 2v*3 + 2v*3 + 0v*3 + 0v*3 + 2v*3 - 2v*2 - 2v*3 + 2v*2 + 0v + v*3 - v - 3v3. -v3 - v Expand (-3 + 10 + 17)(2a*3 + 0a*3 + 2a*3). 96a*3 Expand ((1 + 3 - 2)(-4n + 5n - 6n) + n + 0n + n)(4n*3 - 5n3 - n3). 16n4 Expand (-3t + t - t)(-6t*3 + 80t*2 - 80t*2) + 1 - 2t*4 - 1. 16t*4 Expand (45 + 8 + 4)(2b + 4b - 4b) + (0 - 3 + 1)(0 + 0 + b) - 5b - b + 4b + 4b - 3b + 0b. 111b Expand 0x + x + x + (-3 + 1 + 1)(3 - 10 - 1)(5 - x - 5). -6x Expand (2 - 1 - 3)(3n - 2n + n) + 3 - 1 + 28n - 33n. -9n + 2 Expand -f3 + f3 + f*5 + (-3f4 + f4 + 4f4)(-2f + f + 3f) + f5 - f2 + f*2 + 6 - 2f*5 - 47f*4 + 29f*4 - 7. 4f*5 - 18f*4 - 1 Expand (0 - 3 + 0)(t*2 - 2t*2 - 3t*2) + (2 - 2 - 1)(4t2 + 0t*2 - 2t*2). 10t*2 Expand (5 - 2 + 0)(-8p + 10p + 9p)(-p*2 - 2p*2 - 4p*2). -231p*3 Expand (2 - 2 + o)(-8 - o*2 + 8) + (4 + 2o - 4)(-2o2 - o2 + 2o2). -3o*3 Expand ((v - 2 + 2)(-v - 3v + 3v) + (v + 3v - 2v)(-3v + 3v + 2v))(-3v + 5v + 4v). 18v3 Expand (4l - l - l)(-1 + 3 - 3) - 3l + 6 - 6 + 1 - l - 3l + 6l. -3l + 1 Expand (1 - 2 + 0)(4p3 - p3 + p3) + (4p - 5p + 2p)(0 + 0 + p2). -3p*3 Expand (2 + 2t*3 - 2)(4t2 - 5 + 5). 8t5 Expand w2 + w5 - w2 + (-29w5 - 58w*5 + 25w*5)(-2 + 0 + 0). 125w5 Expand (3j - 3 + 3)(13j + 0 + 0). 39j2 Expand (-2 + 1 - 4)(3 - 3 - c*3) - 2c*3 - 3c3 + c3. c*3 Expand (-3 + 3 - 4)(-3 - 2u4 + 3) + 2u*4 + 3u*4 - 6u*4. 7u*4 Expand (-2q*2 - q + q)(0q - 5q + 3q) + 2q3 - q3 + q*3. 6q*3 Expand (-3o + 4o - 3o)(-3 + 0 + 1 + (-2 - 2 + 5)(-5 + 5 + 1)). 2o Expand (0x - 4x + 5x)(446 + 116 + 78 - 144). 496x Expand (0f2 - 5f*2 - 3f*2)(0 + 0 - 1). 8f2 Expand (-3 + 3 + g)(2g - 2g - 2g + (-2 - 5g + 2)(-1 + 0 - 1))(2 + g - 2). 8g3 Expand ((1 + 4 - 4)(3 - 2 - 3) - 2 - 5 + 2)(2p + 2p - 2p). -14p Expand x2 - 4x*2 - 4x*2 + (10x + x - 2x)(x - 3x + 3x). 2x2 Expand (-1 + 6 + 3)(-3 + 3 - 2j)(-3 + 1 + 1). 16j Expand 4y*4 + 5y*4 - 7y*4 + 29y*3 + (5y - 3y + 0y)(-2y*2 - 2y*3 + 2y*2) - 6y*4 + 3y*4 + 2y*4 - 1 + 1 + 2y4 - 4 - y4 + 4. -2y4 + 29y*3 Expand (4k - 4k + 5k*2)(0k + 4k - 2k)(k - 5k + 3k). -10k4 Expand (-3u + 0u - u3 + 2u)(0u + u + 0u). -u4 - u2 Expand (-4 - 2h + 4)(h3 - h3 + 2h*4) + (0h - 4h + 3h)(2h*2 - 2h2 - h4) + 0h5 - 3h5 - h5 + 0h5 - 4h5 - h5. -12h5 Expand -2s3 - s3 + 4s3 + s3 - 1 + 1 + (0s + 2s + s)(4s2 - 2s*2 + 3s*2). 17s*3 Expand (-2c + 2c + 2c*2)(4 - 3 - c - 2c)(0c + 0c + 3c). -18c*4 + 6c*3 Expand -70t*2 - 6t*3 - 1 + 70t2 + (-1 - t2 + 1)(-t + 3t - t). -7t3 - 1 Expand (-6 + 3 + 2)((-6 + 1 + 3)(6o - 3o - 2o) + 0o - 4o + 5o) + 29 - 29 + 4o. 5o Expand ((2 + 2 - 2)(-5g + 2g + 2g) - 3g + 2g - g - 4g + 11g + g)(-1 - 1 + 0). -8g Expand (-322 + 17m + 322)(m - m + m)(-2m - 2m*2 + 2m). -34m4 Expand (-7f*2 + 0f*2 - 11f2 + (f2 - 4f2 + f2)(-2 + 3 + 1))(-1 + 1 + 2f*3). -44f*5 Expand (0i*2 - 2i2 + i2)(-3i*2 + 3i*2 - 2i*2) + 3i*4 - 2i*4 + 4i*4 - 4i*4 + 3i*4 + 0i*4. 6i*4 Expand (-2 + 3 + 0)(3p2 - 4p*2 + 2p*2) + (-p + 0p - p)(3p - 4p - 4p). 11p2 Expand 14n*2 + 12n*5 - 12n*2 - 4n*5 + (-2n3 - n2 + n*2)(0n + 0n - 2n2). 12n*5 + 2n*2 Expand (-3y + 0y - 2y)(7y*3 - 4 - 5y*3 + 3). -10y*4 + 5y Expand (-2g4 - g4 + 2g*4)(-2g + 4g - 3g) + 4g5 - g5 - 7g5 + 3g4 + g5 - 3g4. -2g*5 Expand 0c*4 - 3c*4 + 2c*4 + 7c*4 + 4c*3 - 4c*3 + (-3c + 3c - c2)(c*2 + 0c*2 + 2c*2). 3c*4 Expand 2o2 + o2 + 7o2 + (4o - 2o + 0o)(4 - 4 + o) - o + o - o2. 11o2 Expand (-o + o3 + o)(0o*2 + 5 - 1 - 2o*2). -2o*5 + 4o*3 Expand (2 + 3 - 2)(0 + 3 - 1)(4d + 0d - 3d). 6d Expand (-4a + a - 4a)((3 + 1 - 3)(1 - 4 + 4) - 2 + 4 - 3 + 1 + 2 - 6). 21a Expand (-4 - 25 + 13)(-5o*5 + 3o*5 + 4o*5). -32o*5 Expand 7c*3 - 3c*3 + 0c*3 + (-3c - c + 2c)(-2c2 - 2c*2 + 2c*2). 8c3 Expand (b3 - 5b3 + 1 + 3b*3)(3b - 5b + 3b). -b4 + b Expand (-4 + 8 + 3)(-12u2 + 12u*2 + 3u*3). 21u*3 Expand (1 + 1 + 1)(2v2 - v2 - 2v*2) + 40v + 1 + 4v2 - 40v. v*2 + 1 Expand (-1 + 1 - 2h*2)(91h - 43h + 8h). -112h*3 Expand (0v4 + v4 + 0v4)(-6v + 4v + v) - 4v5 - 2v*5 + 5v*5 + (6v - 6v + 5v*2)(-4v3 + 3v*3 + 3v*3). 8v*5 Expand (0i*3 + 3i3 - i3 + i)(9 - 3i - 9). -6i4 - 3i**2 Expand (1	{ "pile_set_name": "DM Mathematics" }
/3)/((z/((z*0z)/z))/(z*(-18)z)) assuming z is positive. z(-146) Simplify (q(-15)/(q/(q/(q/q*(-5/6)))q))/((qq(-7)qq)/((q/((q/(qq*(13/4)/q))/qq))/q)) assuming q is positive. q(-139/12) Simplify (q(1/7)/q)/(q/q*3)q*(2/5)qq/((q(-4/5)/q)/q) assuming q is positive. q(222/35) Simplify (i(-23)(i/(i*3i))/ii)/(i(4/7))(-41) assuming i is positive. i(-18/7) Simplify b(2/39)/(b13b)(b/(bb*9/bb))(-19) assuming b is positive. b(6125/39) Simplify (ii/(i(i*(1/11)/i)/i)ii)/(i/i(2/19)iii)(i(-3/5))(15/7) assuming i is positive. i(-397/1463) Simplify (l(l/(l/(l/l*(-12)l))l)/l)/(llll*5/ll)l(-4)ll8 assuming l is positive. l12 Simplify ((ww*(2/43))/(ww(1/3)))/(w(-1/2)ww2) assuming w is positive. w(-719/258) Simplify (((aa(-2/13))/(a/a(1/6)))/((aa*(-8))/aa(-7)/a))30 assuming a is positive. a*(6245/13) Simplify (q(q/(q*(2/11)qqq))/qqqq(4/7))/(q3/(q(qqq0)/q)) assuming q is positive. q(-47/77) Simplify (t*4t*(3/2)t/(t/((t/t*(-8))/t))t(-6/5))20 assuming t is positive. t246 Simplify ((p(-5/6)/p)(8/13))30 assuming p is positive. p*(-440/13) Simplify ((mm*8m)/mm((m*(3/8)mm)/m)/m(m(-5/6)/m)/m(-11))21 assuming m is positive. m(3283/8) Simplify (x/x7)(-31)(x(-6))(-1/31) assuming x is positive. x(5772/31) Simplify ((s(4/5)sss5)/(s3s/(s6s)))(-42) assuming s is positive. s(-2268/5) Simplify b/b*(2/3)(b*(2/5)/b)/bb*(-3/2)b/(bb(-3/4)) assuming b is positive. b(-121/60) Simplify (p17p/(ppppp19))(-30) assuming p is positive. p*150 Simplify (oo*(-1/19))/oo*(1/3)(o*(2/9)o)(-1/3) assuming o is positive. o(-65/513) Simplify (w/w(-10))/w(-21)(ww/(w/(w/(w/(w/w*(-14))))w)w)/(w(-14)/w) assuming w is positive. w63 Simplify (yy/(yy/(yy*(-2/11)yy)))(7/5)/((y(-5)yy)/(y/(yy/y11))) assuming y is positive. y(932/55) Simplify (r(r/(r10/r))/r)(-42)/((rr/(r(r/(r/r(-19)))/r))/((r/(r/(rr(-3/14))))/r)) assuming r is positive. r(4407/14) Simplify (a15/(((a(1/4)a)/a)/a))/(((a/(a/(a(7/4)a)))/a)/aaa(a(-4/9)a)/aa) assuming a is positive. a(112/9) Simplify (q(-2)/(qq(qq*(1/10)q)/q)q(3/2)q0)26 assuming q is positive. q(-468/5) Simplify (y(-8))*(-16/7)y*29y/y(-20/7) assuming y is positive. y(358/7) Simplify (a*(5/2)/aa)*(8/3)/(aa*7a/a*(-4)a) assuming a is positive. a(-22/3) Simplify (x(-4)x)(-3/8)/(x/x(-9)x(10/7)/x) assuming x is positive. x(-521/56) Simplify (l*(-30)ll41)43 assuming l is positive. l516 Simplify (u(-13)/uu18)/(u/u(-1))37 assuming u is positive. u(-70) Simplify (((s/(s*(-2)s))/s)*45ss1(s/s7)/s)(-16/9) assuming s is positive. s(-640/9) Simplify ((a(-5)/aa)/(a(-1/3)/a))/((aa/a*2a)/((a/(a0/a))/a)) assuming a is positive. a(-11/3) Simplify (qqq*(2/5)q)*(-1/8)q12/(q(2/31)q) assuming q is positive. q(13033/1240) Simplify q17/q(-6)q*17qq/q(-3/17) assuming q is positive. q(717/17) Simplify ((b2b/(b/b(-5)))/(b(1/4)(bb/(bb(b/b*(-2/7)b)/b)b)/b))(2/45) assuming b is positive. b(-11/126) Simplify (k13/k(-13))/((kk*4)/(k/(kk*(-11/6)k))) assuming k is positive. k(131/6) Simplify (x(2/5)x(-20))/(x/x17x3/x) assuming x is positive. x(-28/5) Simplify (k/k(5/6))(-1/76)/((k/k*(2/11)k)/kk(2/37)k) assuming k is positive. k(-347879/185592) Simplify w(-8)/((w/(w*(-21)/w)w)/w)w/(w(-1/4)w)w(-26)ww assuming w is positive. w(-219/4) Simplify ((((l(-2/3)/ll)/l)(-19/2))(-23))(13/4) assuming l is positive. l(-28405/24) Simplify (((((i/((i/((i/i*6)/i))/i)i)/i)/i)/(i/i*(3/8)))/((ii*0i)/(((i(-1/13)/i)/i)/i)))27 assuming i is positive. i*(-32859/104) Simplify (y/((yyy/(y(2/11)yy))/yy))*(1/34)/((yy/((y/y*(2/7))/y)y)/((((y/y27)/y)/y)/y)) assuming y is positive. y(-42255/1309) Simplify (f/(ffff/f(-1)f))*(-18)f*(-2/7)/(ff*(-7/5)/ff) assuming f is positive. f(3154/35) Simplify (j(-1/7)/(j/(j/((jj(1/4)j)/j)))(j(-1/4))(5/3))27 assuming j is positive. j(-342/7) Simplify (((n/n(1/2))/nnn)/n)/n(-2/11)(nn9/nn)/(n*(-2/35)n) assuming n is positive. n*(7499/770) Simplify ((((rr*(-1))/r)/r(r*4r)/r)(28/3))(24/5) assuming r is positive. r*(448/5) Simplify (n/(n(nn(6/7)n)/nn))/n14(n/(n/(n/(n/(n*(-3/7)n)))))/(nn(-4/17)) assuming n is positive. n(-2029/119) Simplify (((zzzz/(zz(-3)))(-6/31))(-29))(1/7) assuming z is positive. z(1044/217) Simplify ((m/((mmm(1/2))/m)m)*(-8/3)((mmm(-2))/m)46)(-2/31) assuming m is positive. m(284/93) Simplify n*(-2/3)/(n/(nnn((nn(1/18))/nn)/n))(nn*14)/nn20 assuming n is positive. n(637/18) Simplify (u(-4/7))(-10/7)(uu*(-6/7)u)30 assuming u is positive. u(1720/49) Simplify ((w*(2/7)ww(5/2)/w)/(w(-1/4)ww(1/2)))(-6) assuming w is positive. w(-129/14) Simplify (h10hh/h(-4)hh(-6)/h(-5))(-16) assuming h is positive. h(-256) Simplify (f/f(-1/11))/(ff*(-20))(f*1f)/(f/f(2/19)) assuming f is positive. f(4430/209) Simplify (((((c(ccc(-7/2))/c)/c)/cc)/c(13/3))(-1/75))(-1/11) assuming c is positive. c(-41/4950) Simplify (s/((((ssss/s(-10))/s)/s)/s)s*(-1/25)s)14 assuming s is positive. s(-3164/25) Simplify m*(-9/2)mm(m/(m/(m/(m/m*(-25)))))/mm*(5/12)mm7/m assuming m is positive. m(-253/12) Simplify l(-3/10)/ll*9ll0/ll(l/(l/(l/(l(3/5)l))))/l assuming l is positive. l(71/10) Simplify (j(-1))*(1/20)/(jj/(jj(4/5))jj(-7/4)) assuming j is positive. sqrt(j) Simplify (w/w(-14))(1/2)/((ww(14/5))/w)(-13/4) assuming w is positive. w*(83/5) Simplify ((j/(jjj0))(-12)(j/(j*(2/5)j)j)17)(-40) assuming j is positive. j(-888) Simplify (uu*(3/19))/uu*(2/11)u/(u/(u(u/((uu*(-4/13)u)/uu))/u))u*(1/11)/uu assuming u is positive. u(-711/2717) Simplify (w(-2)w(-6/13)w)/(ww/w(-26)w/(w/(ww(-2/17)))w) assuming w is positive. w*(-6927/221) Simplify (xx*(20/9))/xxx/(x/(xx*(-27)x))(x(-14))(-10/11) assuming x is positive. x(-896/99) Simplify ((ss(-2/17))/s(2/55))/(s*(-19)ss(1/4)) assuming s is positive. s(69549/3740) Simplify ((v/(vv14))/((((v/(v/v(-11/4)v))/v)/v)/vv))/(v*(-11)vv/(v(1/20)v)) assuming v is positive. v*(9/5) Simplify ((a((aa(-34)/aa)/a)/a)/a(5/12))(11/5) assuming a is positive. a*(-4543/60) Simplify (((o/(o/(oo*(1/4)o)))/oo(-4/5)oo)(4/19))(-37) assuming o is positive. o(-1813/95) Simplify (z(2/7))(3/20)(z*11/zz)/zz(-8) assuming z is positive. z(143/70) Simplify (l(-12)/(l/(l6/l)))/(ll*(-4/13)l4) assuming l is positive. l(-165/13) Simplify (uuu18)(-49)/((u*(-15)/u)/(u(uu(-2/13)u)/uu)) assuming u is positive. u(-12495/13) Simplify yy*6yy(-2)y*(1/15)/yyyy*(-3/5)y assuming y is positive. y*(112/15) Simplify ((aa*(3/34))/aa/(a7/a))/(a(5/4)a(4/27)) assuming a is positive. a(-11585/1836) Simplify ((c(1/3))(-38))(-10/9) assuming c is positive. c(380/27) Simplify ((xxxxx(-22)x)/x18)/(x4xx/x12) assuming x is positive. x(-29) Simplify ((g(-1/8))2)(-3/4) assuming g is positive. g(3/16) Simplify ((i/((i/i(2/11))/i))/i)(-2/57)(i(-1/21)/i)/(i/(i/(i/(i(4/3)ii)i))) assuming i is positive. i(1226/4389) Simplify (m(-5/2))*(2/137)(m/((m*(9/11)/m)/m))/(mm/(mm/m24)) assuming m is positive. m(-32935/1507) Simplify n(-8)/(nn*(2/35))(n(n/(nnn(-11)n))/nn)/nnn(-2/5)nn assuming n is positive. n(89/35) Simplify ((ff(2/7))(-1)((ff*(-1/8)f)/f)/f(1/3))(-7) assuming f is positive. f(125/24) Simplify ((n(-4)/n)/n)*(-1/21)(n/(n*16n))/((nn/n(2/19))/n) assuming n is positive. n(-2209/133) Simplify (rr/((rr(3/4))/r))(-30)(((r/(r/(r/(rr/r(-1/21)r)rrr)))/r)/rr)/(r*(4/3)r) assuming r is positive. r*(-1675/42) Simplify (l/((llll*(-11)ll)/l))/ll/(l/(l/l*(-2/9)))(l/(l*(-3)/l))/lll(1/13)l assuming l is positive. l(1673/117) Simplify (i(	{ "pile_set_name": "DM Mathematics" }
24 = -6g. Let l(o) = 19o*2 - go*2 - 11o*2. Determine v(l(b)). 8b4 Let s(b) = -b2. Let t(h) be the first derivative of -h*2 + 5. Determine t(s(z)). 2z*2 Let n(b) = 54 + 52 + 2b - 106. Let a(r) = 24r. Determine a(n(d)). 48d Suppose -2u + 5u - 5p = 29, 0 = p + 4. Let t(j) = -5j + 5j + j - uj. Let l(c) = -2c. Give l(t(m)). 4m Let i(p) be the second derivative of p*5/15 + 5p3/6 - p. Let o(u) be the second derivative of i(u). Let l(y) = -y2. What is o(l(t))? -8t2 Let f(v) be the first derivative of v6/180 + v3 + 3. Let i(b) be the third derivative of f(b). Let c(z) = -2z + z + 2z. Give i(c(l)). 2l*2 Let w(s) = -68s*2 + 2. Let z(f) = 2f*2. What is z(w(x))? 9248x*4 - 544x2 + 8 Let h(a) = a2. Let p(i) be the first derivative of i6/180 + i3 - 8. Let f(t) be the third derivative of p(t). Calculate f(h(o)). 2o4 Let i(j) be the first derivative of j6/360 - 2j3/3 + 4. Let a(c) be the third derivative of i(c). Let p(n) = n. Determine p(a(v)). v2 Let f(o) = 29 - 16 + 6o - 13. Let w(b) = 2b. Give w(f(t)). 12t Let o(v) = 830v*2. Let p(u) = -4u. Determine p(o(m)). -3320m2 Let x(h) = -4h*2. Let g(u) = -4u + 4. Let q(d) = d*2 + 5d - 5. Let s(l) = 5g(l) + 4q(l). Give s(x(i)). 64i4 Let i(g) = 14g. Let y(o) = 25o. Calculate y(i(b)). 350b Let g(p) be the first derivative of 2p3/3 - 1. Let h(a) be the first derivative of a3/3 - 9. Calculate h(g(b)). 4b*4 Let r be (-285)/(-5) - 1-2. Let b(x) = -59 + r + x*2. Let v(q) = -2q. Determine b(v(k)). 4k2 Let u(k) = 1. Let x(m) = 2m*2 + 1. Let y(q) = -u(q) + x(q). Let d(a) be the first derivative of 4a*3/3 + 2. Determine y(d(s)). 32s*4 Let s(r) = -2r. Let g(w) = 9w - 78. Determine g(s(b)). -18b - 78 Let j(x) = -11x + 8. Let b(z) = 7z - 5. Let c(f) = -8b(f) - 5j(f). Let q(t) = -13t2 + t. Calculate q(c(g)). -13g2 - g Let z(r) = -r2 + 925r. Let u(w) = -2w. Calculate z(u(s)). -4s2 - 1850s Let r(x) = x*2 + 179x. Let g(j) = -5j2. Determine r(g(f)). 25f*4 - 895f*2 Let t(p) = -2p*2. Let q(x) = 2x. What is q(t(w))? -4w2 Let t(r) = r2. Let h(k) = -119k - 7k2 + 119k. Determine h(t(y)). -7y4 Let k(h) = h. Let b(c) = 273c. Determine k(b(r)). 273r Let k(r) = -r. Let h(z) = -z - 3. Let i(w) = -w - 7. Let o(x) = -7h(x) + 3i(x). Calculate k(o(l)). -4l Let a(g) be the first derivative of -2g2 + 1. Let w(h) = -8h. What is a(w(y))? 32y Let f(r) = 2r*2. Let h(k) = -13k. Let a(o) = 18o - 11o - 19o. Let n(u) = 3a(u) - 2h(u). What is n(f(i))? -20i*2 Let y(k) = 2k. Let m(w) = 3w. Let f(n) = 6m(n) - 10y(n). Let d(l) = 6l. Calculate f(d(b)). -12b Suppose 40 = 2s - 3c, 5s + 4c - 122 = -22. Let v be (-54)/(-10) - 8/s. Let j(d) = -v + 5 + 2d*2. Let k(o) = -3o. What is j(k(m))? 18m2 Let m(o) be the third derivative of -o5/30 - 6o*2. Let h(i) = -8i*2. What is h(m(z))? -32z*4 Let i(m) = -3m. Let q(s) = 2s2 - 24s + 51. Determine i(q(o)). -6o2 + 72o - 153 Let a(n) be the third derivative of -n*4/6 + 3n*2. Let t(p) be the first derivative of -2p*3/3 + 1. What is a(t(l))? 8l2 Let q(u) be the first derivative of u3/3 - 3. Let l(v) be the second derivative of -v*3/3 - v. What is q(l(b))? 4b*2 Let y(u) = 12u - 21u + 10u. Let v(f) = -3f. Determine v(y(m)). -3m Let i(a) = 2a. Let b(z) be the first derivative of -z4/12 + z2 - 1. Let k(o) be the second derivative of b(o). Give k(i(y)). -4y Let u = 7 + -5. Let b(k) = -k2 - k2 + 2k2 + ku. Let n(j) be the second derivative of j4/12 + 4j. Calculate b(n(d)). d*4 Let f(m) = 3m*2. Let k(l) = 4l - 3. Let r(s) = 1. Let j(y) = -2k(y) - 6r(y). Calculate f(j(q)). 192q2 Let k(n) = 3n. Let u(q) = 5q. Let h(x) be the first derivative of -x2/2 + 5. Let m(f) = 3h(f) + u(f). Calculate k(m(b)). 6b Let n(f) = 5f + f - 7f. Let z(g) = 5g. Calculate n(z(j)). -5j Let i(g) = g2. Let k(z) = -4z2 + z2 + 4z2. What is i(k(o))? o4 Let c(n) = n + 7. Let z(f) be the second derivative of -f4/6 - f - 49. What is z(c(k))? -2k*2 - 28k - 98 Let z(i) = i*3 - 9i*2 + 7i + 6. Let j be z(8). Let k be (1/j)/(1/(-4)). Let n(h) = 0h + 0h + 4h2 - 3h*k. Let w(u) = 2u*2. Calculate n(w(f)). 4f*4 Let x(o) = -8o - 4. Let n(i) = 9i + 5. Let t(g) = -4n(g) - 5x(g). Let q(z) = -19z*2. Calculate q(t(v)). -304v*2 Suppose 5z - 14 - 1 = 0. Let n(m) = -m2 + z - m2 - 3. Let y(u) = u*2. Calculate y(n(h)). 4h*4 Let t(d) = d. Let u(q) = 26q*2 - 50q*2 + 22q*2. Determine t(u(b)). -2b*2 Let n(r) = 1009r2. Let c(j) = j2. Give c(n(k)). 1018081k4 Let s = -14 + 14. Let k(w) be the second derivative of -1/6w*4 + s + 0w*2 + 0w*3 - 2w. Let d(v) = v*2. Determine k(d(n)). -2n*4 Let c(h) = 8h. Let u(r) = r*2 - 32r. Give u(c(t)). 64t2 - 256t Let j(l) = -20l2. Let o(t) = 115t - 2. Determine j(o(v)). -264500v2 + 9200v - 80 Let j(r) = -5r. Let z(i) be the third derivative of -i7/2520 - i4/12 + 3i*2. Let y(n) be the second derivative of z(n). Give y(j(u)). -25u*2 Suppose -5y = -5 - 10. Let u(b) = b*2 - 4b. Let f(a) = 3a. Let p(z) = yu(z) + 4f(z). Let q(o) = -4o. Determine p(q(s)). 48s2 Let u(x) = -2x - 4 - 3 - 1. Let k(p) = p + 5. Let h(z) = -8k(z) - 5u(z). Let i(w) = -3w. Calculate i(h(f)). -6f Let k(r) be the second derivative of 0r3 + 1/4r*4 + 0 - 4r + 0r2. Let h(w) = w2. Determine h(k(b)). 9b*4 Let j(g) be the second derivative of -5g*3/3 + 15g. Let l(o) = o*2. What is j(l(u))? -10u*2 Let x(o) = -135o - 1. Let f(i) = i*2. Give f(x(g)). 18225g*2 + 270g + 1 Let x(l) = 4 + 0l - 4 - 2l. Let y(c) be the third derivative of -c7/840 + c4/12 - c*2. Let h(n) be the second derivative of y(n). Calculate x(h(k)). 6k*2 Let p(i) = -2i. Let u(q) be the first derivative of 21q3 - 50. Calculate u(p(s)). 252s*2 Let v(q) = -9q*2 - 5q*2 - 8q*2 + 26q*2. Let j(n) = -6n. Determine v(j(l)). 144l2 Let h(i) = 3 + 19i*2 - 3 - 23i*2. Let g(r) = r. Let l(w) = 4w. Let x(a) = -2g(a) + l(a). Give h(x(o)). -16o*2 Let t(h) = -18h*2. Let d(x) = -67x*2. Give t(d(o)). -80802o*4 Let c(a) = 5a*2. Let h(s) = -2 - 5 + 4 + 4s. Let p(f) = 5f - 4. Let b(w) = -4h(w) + 3p(w). Calculate c(b(l)). 5l*2 Let o(m) = 0m + m - 4m. Let d(h) = 5h*2. Let g(c) = 27c*2. Let w(i) = 21d(i) - 4g(i). What is o(w(x))? 9x*2 Let a(z) = -7737z. Let d(n) = -2n. Determine a(d(q)). 15474q Suppose -q - 2q + 21 = 0. Let n(m) = -7m + qm + 4m*2. Let j(c) be the first derivative of -2c*3/3 + 3. Determine n(j(o)). 16o4 Let g(i) be the third derivative of -i5/30 + 6i2. Let t(p) = 20p. Let k(v) = v. Let f(x) = -15k(x) + t(x). What is g(f(j))? -50j*2 Let f(b) = -2b. Let m(y) = -2y + 16. Let p(r) = 3r - 32. Let v(x) = 5m(x) + 3p(x). Calculate v(f(q)). 2q - 16 Let d be ((-12)/15)/((-6)/15). Let j(f) = 7f + 2fd - 7f + 0f2. Let x(b) = 20b. What is x(j(c))? 40c2 Let z = -10 - -10. Let l(r) be the third derivative of 0r*3 + 0 + 0r*4 + zr - 2r2 + 1/30r*5. Let u(f) = 3f. What is u(l(j))? 6j2 Let v(o) = -o. Let s(z) = 44 + 49 - 3z - 83. What is v(s(k))? 3k - 10 Let x(s) = 76s - 76s + 7s2. Let y(r) = r2. Determine x(y(b)). 7b4 Let y be (2/4)/((-1)/(-6)). Let a(t) = 3t + 0t + yt. Let j(h) = -9h - 7. Let l(p) = -4p - 3. Let b(r) = 3j(r) - 7l(r). Determine b(a(o)). 6o Let y(h) = h. Let x(s) = -136s - 4. What is x(y(l))? -136l - 4 Let c(v) be the first derivative of -v2 - 2. Let n(w) = w2 - 4w - 4. Let g(r) = r*2 - 3r - 3. Let a(l) = -4g(l) + 3n(l). Calculate c(a(m)). 2m2 Let a(x) = -x + 3x - x. Let i(f) = 10f2 + 7f*2 - 13f*2. Determine a(i(k)). 4k*2 Let f(l) = -2l. Let c(m) = -91m2. Determine c(f(v)). -364v*2 Let y(k) = -2. Let m(g) = 23g - 230. Let z(s) = -m(s) + 115y(s). Let v(p) = 2p*2. Give v(z(f)). 1058f*2 Let f(i) = -i. Let r(n) = 17n. Determine r(f(h)). -17h Let l(b) = -13b - 13b + 9b. Let t(u) = u. Give l(t(g)). -17g Let u(w) = -6w. Let h(z) = 3z - 2. Let b(t) = 25t - 17. Let v(f) = 6b(f) - 51h(f). Determine v(u(r)). 18r Let d(h) be the second derivative of -h3/3 - 2h. Let f(m) be the first derivative	{ "pile_set_name": "DM Mathematics" }
g = -s for g. 1 Let c = -291 - -291. Solve c = 5o - 4o + 2 for o. -2 Let w be ((-12)/42)/2. Let v(s) be the first derivative of s3/3 + 3s*2/2 + s - 1. Let l be v(w). Solve -3 = -d + l for d. 4 Suppose 3p + 3q = 2p - 3, 4q = -5p + 7. Suppose -j - 2s + 1 = -7, s - 4 = pj. Suppose jd - 5d + 25 = 0, 5d = -r + 25. Solve -3w + 4 - 7 = r for w. -1 Let l be ((-9)/5)/(42/(-70)). Solve -t + lt - 2 = 0 for t. 1 Suppose 3m + 11 = 2c, 106c - 107c + 5m = -16. Solve 4x = c + 3 for x. 1 Suppose 0 = -7j + 24 - 10. Let n(p) = -p*2 - 5p + 3. Let x be n(-5). Solve 11 - x = -jv for v. -4 Let c(q) = q3 - 7q*2 + 7q - 3. Let j be c(6). Suppose jw + 26 - 32 = 0. Solve h - w = 3h for h. -1 Let d(p) = -3p2 + 40p - 13. Let z be d(13). Solve -3i + 5i + 2 = z for i. -1 Let u(r) = -r*2 - 8r + 4. Let n be u(-8). Let z = 1 + n. Solve 4 = zm - 3m for m. 2 Let v = -17 + 16. Let g be -3 - (v - (0 + 1) - 4). Solve -gb - b + 16 = 0 for b. 4 Let k = 34 + -28. Suppose 4y + k = 22. Solve -m = ym - 15 for m. 3 Let l be (2 - -1) + (0 - (-9)/(-3)). Suppose -4v - 3m + 27 = 0, 5m = -lv + 5v - 25. Solve -6q - v = -3q for q. -2 Suppose 21 - 76 = -5i. Solve 2l = i - 15 for l. -2 Let m be 6 + 11/(11/60). Solve -16 = 70c - mc for c. -4 Let f(m) = m*2 + 45m + 146. Let i be f(-42). Solve -9z = z + i for z. -2 Let q = 1534 + -1532. Solve j + qj = 15 for j. 5 Suppose 3k - 3y + 15 = 0, -4y - 2 + 16 = 2k. Let v(o) = 13o2 + 2o + 1. Let p be v(k). Solve -5t = -p - 8 for t. 4 Let w(a) = 2a*2 + 3a - 9. Let s be w(-4). Let z be 222/s + (-14)/77. Solve 2i = -2i - z for i. -5 Let q = 55 - 49. Let d(s) = -s + 12. Let g be d(7). Suppose -g = -n - 1. Solve qi - 2i = n for i. 1 Let i(c) = -3c - 7. Let x(k) = -2k - 8. Let t(s) = 3i(s) - 4x(s). Let q be t(8). Solve 2w - qw = -4 for w. 4 Let t(c) = 2c + 17. Let r be t(-15). Let o(v) = -v - 13. Let g be o(r). Solve g = -f + 1 for f. 1 Suppose 0 = 3i - 63 + 15. Suppose 10 = 3y + k - 2, 4y - i = -2k. Solve -j - y = 3j for j. -1 Let v be (-6)/(-8) - (9 - (-135)/(-12)). Solve 8 - 5 = -vn for n. -1 Let i be -28(-1 - 9/(-12)). Suppose -ih = -2h + 4o + 20, -3o = h + 15. Solve -b - 6 + 3 = h for b. -3 Suppose 4t - 8t - 92 = 0. Let k = 24 + t. Solve -2i = -i + k for i. -1 Suppose -4f + 329 + 39 = 0. Let d = -90 + f. Solve 7 = dh + 1 for h. 3 Let n(h) be the third derivative of -h5/60 - 11h*4/24 - 4h*3/3 - 3h*2. Let a be n(-10). Solve 0 = -0z - az - 10 for z. -5 Let o(a) = -a3 - 54a*2 + 10. Let u be o(-54). Solve -13c - u = -8c for c. -2 Let k(a) = a2 - 14a + 3. Let y be k(14). Suppose -2l - m = -2, ym + 27 = -l + 6l. Solve -8 = -lh + 4 for h. 4 Suppose -5u = -12u + 294. Suppose -u = 16b - 23b. Solve 0t - 2t - b = 0 for t. -3 Let t(d) = 3d3 - 4d*2 + 2d + 4. Let f be t(2). Let q = f - 16. Solve a + 0a = q for a. 0 Let i = 53 + -51. Suppose ig + 0g = -0g. Solve -2d - 8 + 4 = g for d. -2 Let g = 5 - 4. Let b(n) = -n3 + 4n*2 - 3n. Let s be b(3). Solve s = -2r + r - g for r. -1 Let m = 24 + -34. Let k be (-1)/(-1) + m/(-5). Solve -kq + 6 = -q for q. 3 Suppose -3k + 2x = 5, 5x - 3 = 4k + 6. Let w be 15/(-10)(k + -19). Let h = -27 + w. Solve -6z + 5z = -h for z. 3 Let s(v) = v2 + v. Let x be s(2). Let p = -61 + 61. Suppose -r + pr = -18. Solve x = 3h + r for h. -4 Let j(p) be the first derivative of p4/4 + 2p*3 - 9p*2/2 - 13p + 2. Let s be j(-7). Solve -14 = 3a + s for a. -5 Suppose 1300 = 65i - 13i. Solve 6r + 37 - i = 0 for r. -2 Let y(i) = 7i + 3. Let b be y(1). Let q be (-132)/(-20) - (-4)/b. Solve -19 = -3n - q for n. 4 Suppose -2u - 5b + 1 = 0, -u - 4b - 23 = -16. Solve 5r - u - 7 = 0 for r. 4 Let y = 349 + -346. Solve -2w - yw = 25 for w. -5 Let q(m) = -3m + 7. Let p be q(4). Let x(l) = l + 9. Let w be x(p). Solve -2 = wn + 14 for n. -4 Suppose 0t - 7t - 105 = 0. Let o = t - -18. Solve oz = z for z. 0 Let i be -6(-3)/(-21)42/(-9). Suppose 5g - 2s = 14, -3 - 1 = -5g - 3s. Solve ic + g = 14 for c. 3 Suppose -5n - 8 + 18 = 0. Let d be -4 + 6 + 2/n. Solve -m + d - 6 = 0 for m. -3 Let b(x) = -2x*2 + 25x - 31. Let r(s) = s*2 - 13s + 16. Let w(h) = -6b(h) - 11r(h). Let a be 1 - (-4 - -2 - 2). Let g be w(a). Solve gv = v + 3 for v. -3 Suppose 150 = p + 138. Let o be ((-12)/8)/(6/(-16)). Solve q - p = oq for q. -4 Let q be (-1)/4 - 1/(-8)-6. Let w be (-4)/(3 - q) + 4. Solve 0p - w = 3p for p. -1 Let m(t) = -t2 + 6t + 19. Let g be m(9). Let k be (g/12)/(4/(-30)). Solve 13 + 7 = -kq for q. -4 Let y = -186 - -79. Let k = -103 - y. Solve -kp - 4 = 4 for p. -2 Let o be 0(1/(-3))/((-37)/(-111)). Solve -10q + 14 - 4 = o for q. 1 Suppose -4m + 95 = 83. Suppose -mt = -9 - 6. Solve tq - 1 = 4 for q. 1 Let a(r) = -r3 - 13r*2 + 11r - 33. Let l be a(-14). Suppose 2c = lc - 14. Solve cy - 4 = -12 for y. -4 Let x(h) = h2 + 76h - 314. Let s be x(4). Solve -sd + 24 = 18 for d. 1 Let v be 4/((-16)/12) + (8 - 5). Solve -15 = -vl - 3l for l. 5 Let g(m) = 30m*3. Let i be g(-1). Let o be (-630)/27 + 1/3. Let l = o - i. Solve -1 = -4z + l for z. 2 Suppose -4f + 0f - 2a - 2 = 0, 5f - 2a - 2 = 0. Let d be f/(3 + (-7 - -3)). Solve -2u + 3 + 5 = d for u. 4 Let c be (4 - 4)/(-2 - (-3 + 2)). Solve 0 = -x - 5 - c for x. -5 Suppose 0 = -5a - 3q + 84, 17q - 64 = -4a + 13q. Solve af - 15f = -3 for f. -1 Let k be 9/75-5 - (-43)/5. Solve 11c - 9c = k for c. 4 Suppose 0 = -5f - 2f + 21. Solve -fv = -7 + 10 for v. -1 Let t be (-42)/(-105) - (258/(-15))/2. Solve tu = 10u - 4 for u. 4 Let r(w) = 6w - 19. Let m be r(9). Suppose 25 = -5j, h + 4h - m = j. Solve -6 = -3k + h for k. 4 Suppose q + 84 = -3q. Let s = q + 23. Solve -2t - st = -20 for t. 5 Let p = -18 + 22. Suppose 0 = -3x + 2s + p + 15, -27 = -4x + 3s. Suppose -2h + 50 = xh. Solve y + 4y = h for y. 2 Suppose 0 = 2u + z - 4, -4z + 1 = 5u - 2u. Solve -3 = -ux + 2x for x. 3 Let s = -1335 + 1337. Solve -sw + 5 = -1 for w. 3 Let m = -3 - 8. Let w be (-3 + m)/(1 + -3). Suppose -w = -4b + 5. Solve 2x - x - b = 0 for x. 3 Suppose 0 = -36o + 44o - 96. Solve 12j = 15j + o for j. -4 Let i = 173 - 102. Let z(r) = 71 - i + 3r. Let n be z(0). Solve -3d + 2d + 4 = n for d. 4 Let i = -12 - -27. Let u = 39 + -42. Let f be ((0/u)/(-2))/(-1). Solve fr - 3r = -i for r. 5 Let g = -50 + 66. Solve -g = 4k - 0 for k. -4 Suppose 21d + 204 = 4d. Let z be 1/3 + (-70)/(-6). Let g = z + d. Solve 3 = -f - g for f. -3 Let x be (-18)/(-2)(-3498)/(-477). Solve -68i = -xi - 8 for i. 4 Suppose -4m + 2l = -94, 4l + 29 = 2m - 9. Solve 30o = mo + 10 for o. 2 Suppose 0a + 2a = -10, -2l + 5 = a. Solve 14 = ld + 39 for d. -5 Let q(n) = 2n*2 + 12n + 8. Let j(v) = v*2 - 6. Let g be j(0). Let z be q(g). Solve zx = 3x for x. 0 Suppose -31q + 30q - 30 = 0. Let l = q + 36. Solve l + 2 = 2y for y. 4 Let u = -10 - -20. Let o be (-6)/(-5)u/4. Solve -2s + o = s for s. 1 Let m be 4/10 - (-12)/(-30). Solve -3f + 2f + 5 = m for f. 5 Let z(b) = b*2 + b - 1. Let c(u) = 4u*2 + 19u + 14. Let n(x) = c(x) - 3z(x). Let a be n(-15). Solve -4p - a = -14 for p. 3 Let m = 39 - 27. Let b be ((-51)/12)/(3/m). Let l = b + 17. Solve 4g + 23 - 3 = l for g. -5 Let i(p) = -66p + 1 + 65p + 1. Let h be i(0). Suppose 7s - 15 = 2s. Solve 5r - h = s for r. 1 Suppose 5m = 2q + 6, -4m - q + 6 = -3q. Solve 3a + 6 = -ma for a. -2 Suppose 0 = -b - 3b + 12. Let m(z) = z3 - 2z*2 + z - 7. Let j be m(3). Suppose -2k + jk = -4h + 14, 0 = -h + k. Solve hc - b = -7 for c. -2 Let a(z) = 4z + 24. Let g be a(4). Suppose 122m - 120m - g = 0. Solve -u - 4u = m for u. -4 Let r(m) = -m + 3m - 10 - 4m. Let i be r(-6). Solve -2q - iq + 12 = 0 for q. 3 Let w = 578 - 550. Solve -w = -7d + 7 for d. 5 Suppose -w = -1, -7w + 8w - 1 = q. Solve q = 3y + y + 20 for y. -5 Suppose 14g - 2316 = -1700. Solve -2f + 36 = g for f. -4 Suppose -2d + 9 = 3h + 1, -4h + 12 = 2d. Solve 5k + h = 4k for k. -4 Let r(n) be the first derivative of -n2 - 2n + 5. Let t be r(-3). Suppose -ts = y + 12, y - 23 = 2s + s. Solve y - 33 = -5u for u. 5 Let z(v) = -v + 8. Let m be z(8). Let k be m/3(-2)/4. Let f(h) = -3*h - 7. Le	{ "pile_set_name": "DM Mathematics" }
q(b). b3 - b2 + b Let r(i) = i - 3. Let z(y) = -10 + 20 - 11. Determine -r(g) - 2z(g). -g + 5 Let c(p) = 2 + p*2 - 5p + 4p3 + 1 - 9. Let a(b) be the second derivative of 3b5/20 + b4/12 - 2b3/3 - 5b*2/2 - 9b + 5. What is 5a(q) - 4c(q)? -q3 + q2 - 1 Let p(w) = -2w - 11. Let r be p(-9). Let t = r + -3. Let n(s) = -s + 5 - 2 - t. Let l(f) = -3f - 2. What is 2l(y) - 5n(y)? -y + 1 Let u(i) = -4i + 2. Let d(l) = 7l + 0l - 3 + 0l. Suppose -4j = 2z + 22, 0 = j + 4 - 0. Determine zd(a) - 5u(a). -a - 1 Let h(g) = 4g2 - 9g - 5. Let y be 6/33 - 35/11. Let z(p) = 2p2 - 5p - 3. Calculate yh(n) + 5z(n). -2n2 + 2n Let o(v) = 2v - 2. Let f(g) = -2g + 2. Let y(c) = -4f(c) - 5o(c). Let h(m) = 2m + 4m - 3 - 3m. Let t = -4 + 12. What is ty(w) + 5h(w)? -w + 1 Suppose 0 = 5p - 2p. Let y(r) = pr*3 + 2r*3 + 2r2 + r2 + r*2. Let s(u) = 3u*3 + 6u*2. Calculate -5s(l) + 8y(l). l3 + 2l*2 Let s(l) = 4l. Let r(q) = -3q - 1. Let h(f) = -3r(f) - 2s(f). Let k(p) = -2p - 5. Determine -5h(a) - 3k(a). a Suppose m + 3 = -t, -3m + 6t = 2t + 44. Let h = -6 - m. Let i be (-1)/6h-12. Let k(c) = 2c + 4. Let b(s) = s + 1. What is ib(l) - k(l)? 2l Let x(s) = -5s3 + 4s - 2. Let i(a) = -a. Give 4i(w) + x(w). -5w*3 - 2 Let p(d) = -2d + 2. Let o be p(3). Let y(h) = 3h. Suppose 0 = 5k + 12 - 42. Let s(f) = -f + 2f + kf. Give os(l) + 9y(l). -l Let t(l) = -45l3 - 11l*2 + 11. Let s(m) = -23m*3 - 6m*2 + 6. What is 11s(g) - 6t(g)? 17g3 Let y(c) = c2 - 4c - 4. Let u be y(4). Let z(a) = 5a*3 - 11a*2 - 6a. Let o(n) = -2n3 + 4n*2 + 2n. What is uz(s) - 11o(s)? 2s3 + 2s Let m(h) = 8h3 + 2h2 - h + 2. Let c(w) = w2. Calculate 2c(l) - m(l). -8l*3 + l - 2 Let h(a) = -2a + 6. Let s(w) = 1. Calculate -h(b) + 2s(b). 2b - 4 Let b(g) be the second derivative of -g*3/6 + 8g. Let k(x) = -3 + 5x - x + 1. Let m be (2/6)/(1/3). What is mk(d) + 6b(d)? -2d - 2 Let m(l) = -1702l3 + 185l*2 + 185l - 185. Let a(q) = 37q3 - 4q*2 - 4q + 4. What is 185a(y) + 4m(y)? 37y3 Let h(q) = -5q*2 - 1 + 5q - q*2 + 3q2 + 6. Let j(l) = l2 - 2l - 2. Determine 3h(r) + 7j(r). -2r*2 + r + 1 Let v(z) = -4z. Let q(c) be the second derivative of c + 0c2 + 1/3c*3 + 0. Determine -5q(g) - 2v(g). -2g Let a(x) = -x - 1. Let i(j) = -4j - 6. Give -3a(d) + i(d). -d - 3 Let v(f) = f*2 + 6f. Let q(h) = h. What is 2q(r) - v(r)? -r2 - 4r Let t(b) = 1615b + 171. Let d(a) = -19a - 2. Determine -171d(n) - 2t(n). 19n Let c(v) = 6v + v - 5v. Let o(j) = 6j. Give -17c(x) + 6o(x). 2x Let u(z) = -z2 + z - 1. Let b(d) be the second derivative of -d5/20 + 2d*4/3 - 5d*3/6 + 5d*2/2 + 2d. Calculate b(y) + 5u(y). -y3 + 3y*2 Let p(y) = 2 + 0y - 2y + 7 - 6. Let b(a) = -2 + 0 + 5 - 2. Suppose -2k + n = -n, -n = k + 2. Calculate kp(u) + 5b(u). 2u + 2 Let n(d) = -9d + 2. Let t(z) be the third derivative of -13z4/24 + z3/2 - 103z*2. Suppose 2g + 4 = -6. Give gt(u) + 7n(u). 2u - 1 Let d(n) be the first derivative of -10n*3/3 - 6n2 - 3. Let p(r) = r2 + r. Give d(v) + 12p(v). 2v*2 Let r(j) = 2j. Let q(x) = x. Suppose -6 = 2h - 5h. Calculate hr(b) - 5q(b). -b Suppose -c - 22 = -3c. Let a(h) be the third derivative of 5h*4/8 + 11h*3/6 - 6h*2. Let g(b) = 3b + 2. What is cg(m) - 2a(m)? 3m Let r(c) = -6c + 1 - 1 + 0. Let w be r(1). Let b(f) = -1. Let i(q) = -2q + 8. Give wb(a) - i(a). 2a - 2 Let x(v) = -v3 - 2v*2 - 3v + 1. Let p(y) = 3y3 + 5y*2 + 8y - 2. Suppose 2h - 6 = 4h. Determine hp(k) - 8x(k). -k3 + k2 - 2 Let z(f) = 3f3 + 2f2 + 2. Let s(q) = q3 + 6q2 - 9q - 10. Let g be s(-7). Let u(d) = -16d3 - 11d*2 - 11. Determine gu(p) + 22z(p). 2p*3 Let d(v) = 3v*2 - 1. Let p(y) = -7y*2 + y + 2. Let g = -11 - 23. Let r be g/(-6) - (-10)/(-15). Suppose j + r = -0j. Calculate jd(k) - 2p(k). -k*2 - 2k + 1 Let a(v) = 4v - 3. Let r(w) = 2w - 2. Determine -3a(y) + 5r(y). -2y - 1 Let i(t) = -t2 - 2t - 5. Let d(x) = -3x2 + 75 - 5x - 43 - 43 + 0x2. What is 2d(j) - 5i(j)? -j2 + 3 Let g(a) = 5a*2 - 17a - 7. Let y(r) = -2r2 + 8r + 3. Calculate -3g(z) - 7y(z). -z*2 - 5z Let p(g) = -1 + g - 1 + 4 - 1. Let n(i) = i + 4. Give n(u) - 2p(u). -u + 2 Let v(i) = i2 - 6i - 6. Let r(n) = -2n2 + 14n + 21. Let h(d) = -d*2 + 7d + 10. Let k(l) = -7h(l) + 3r(l). What is -6k(u) + 7v(u)? u*2 Let m(u) = -3u*2 + 2u + 2. Let r(h) = -h - 55 + 25 + 29. Suppose 0 = 4x - 8x - 4. What is xm(v) - 2r(v)? 3v2 Let u(d) = -2d*2 - 3d + 3. Let g(c) = -25c2 - 40c + 40. Calculate -3g(q) + 40u(q). -5q2 Let g(p) = 5p3 + 1. Let a(i) = -i3. Let m be (26/6 - 4)-3. Give mg(k) - 4a(k). -k3 - 1 Let g be 118/(-30)-5. Let p(c) = 5c*2 + 3c + 6. Let l(a) = -8a - 7 - 1 - 14a*2 - 9. What is gl(b) + 8p(b)? -2b*2 - 3 Let q(k) = 34k*3 - 4k*2 + 4k + 4. Let f(t) = -34t3 + 5t*2 - 5t - 5. Give -4f(n) - 5q(n). -34n3 Let y(l) = -l2 + l. Let d(x) = -x2 + 4x + 4. Determine -d(p) + 4y(p). -3p*2 - 4 Let f(j) = 14j - 17. Suppose g + 0g - 17 = -4m, 0 = 3m + 5g - 34. Suppose p = mp. Let q(y) = p + 8y - 1 - 5 - 3y. Determine -6f(c) + 17q(c). c Let k(p) = -p + 6. Let a(u) be the second derivative of -u3/6 + 5u*2/2 + 2u. Suppose 10 - 52 = -7x. Calculate xa(m) - 5k(m). -m Let c(i) = i2 - i - 8. Let a(b) = 2b*2 - 2b - 17. Give -6a(x) + 13c(x). x*2 - x - 2 Suppose 2x + 6 = -3i, 3i + i = 0. Let a = 0 + x. Let b(m) = m - 2. Let c(n) = -1. Let q = -32 - -34. Determine ac(u) + qb(u). 2u - 1 Let u(o) = -99o - 51. Let r(k) = -4k - 2. Determine 153r(m) - 6u(m). -18m Let h(f) = 89f2 + 5. Let k(z) = -846z*2 - 47. Calculate 47h(l) + 5k(l). -47l*2 Let x(c) = 13c + 6. Suppose 2w + 3w - 5 = 0. Let d(f) be the first derivative of 0f2 - w + 2f*2 + 0f + 2f. Give 7d(i) - 2x(i). 2i + 2 Let z be (-63)/84 - (-19)/4. Let u(p) = -p*3 + 4p*2 + 2p - 4. Let y(k) = k*3 - 3k*2 - 2k + 3. Calculate zy(j) + 3u(j). j*3 - 2j Let t(b) = -b*3 - b + 1. Let r(l) = 5l*3 - 9l*2 + 3l - 1. Let o(x) = -r(x) - t(x). Let s(z) = 2z3 - 4z*2 + z. Give 4o(m) + 9s(m). 2m*3 + m Let z(c) = 4c*2 - 8c + 8. Let h = -30 - -25. Let l(i) = 3i2 - 5i + 5. Give hz(n) + 8l(n). 4n2 Let f(w) = -w - 1. Let y(o) = -10o + 1. Calculate -f(n) - y(n). 11n Let b(n) = 3n*2 + 4n + 2. Suppose -5j + 2 = -23. Suppose -jm = -5d + 10, 2m = 2d + 3m - 4. Let r(f) = -4f2 - 5f - 2. Give dr(u) + 3b(u). u*2 + 2u + 2 Let z(c) = -8c - 7. Let f(b) be the third derivative of -b4/24 - b3/6 + b2. Let p be (18/6)/((-6)/27). Give pf(m) + z(m). -2m - 1 Let d(q) = -9q3 + 1. Let s(m) = -10m*3 + 2. Give -6d(t) + 5s(t). 4t*3 + 4 Suppose -2 = -3z - x + 4, 5x + 24 = 3z. Let h(m) = -3m2 - m - 6. Let n(d) = -d. Let j(o) = zn(o) - h(o). Let c(a) = a*2 + 1. Calculate 4c(i) - j(i). i*2 + 2i - 2 Let q(y) = y + 8. Let m(u) = -u*3 + 6u*2 - 3u - 4. Let i be m(5). Let x(z) = 1. Determine ix(j) - q(j). -j - 2 Let s(h) = -4h3. Suppose -8 = a - 7. Let p(k) = k3. Calculate as(y) - 6p(y). -2y3 Let r(x) = -x2 + 6x + 1. Let c(t) = -2t2 + 13t + 2. Calculate -6c(s) + 13r(s). -s*2 + 1 Let x(b) = -1. Let d(s) = 2s + 10. Let f(n) = n*2 - 6. Let v be f(-4). Determine vx(l) + d(l). 2l Suppose 2o - 7o - 60 = -5y, 8 = -y - 3o. Let w(b) = 10b*2 - 7. Let z(r) = 9r*2 - 6. Determine yz(p) - 6w(p). 3p2 Let n(p) = p + 1. Let t(c) be the third derivative of c4/2 + 7c3/3 + 11c*2. What is -28n(l) + 2t(l)? -4l Let k(y) = y. Let a(u) = -3u2 + 5u*2 - 2u - 3u2 + 0u. Determine -a(t) - 2k(t). t2 Let p(o) = 7o*3 + 5o*2 + 12o + 8. Let a(n) = n3 + n2 + n + 1. Determine -6a(m) + p(m). m3 - m2 + 6m + 2 Let q(k) = -11k - 7. Let a(c) = -c - 1. What is -6a(f) + q(f)? -5f - 1 Let h be (102/(-9))/((48/9)/8). Let j(q) = 9q - 17. Let x(i) = -3i + 6. Determine hx(z) - 6j(z). -3z Let m(q) = 3q + 4. Let n(b) = -3b - 3. Let z(o) = -o*3 - 17o*2 - 15o + 11. Let p be z(-16). Give pn(k) - 4m(k). 3k - 1 Let l(c) = -4c*3 - 11c*2 + 5c - 5.	{ "pile_set_name": "DM Mathematics" }
uppose m(k) = 0. What is k? -2, 0 Let m be ((-15)/(-27))/((-300)/(-90)). Factor -1/2u + m + 1/3u*2. (u - 1)(2u - 1)/6 Suppose -k + 8 = d, -2k + 3d - 6 = -42. Let n be 3/(-8)k/(-18). Factor -1 - nz2 - z. -(z + 2)2/4 Let g = -44 - -46. Factor 8/5d - 8/5 - 2/5dg. -2(d - 2)*2/5 Let j(f) = -14f*2 + 14. Let x(z) = 1 - 6 + 6z2 - z2. Suppose 16 = -0s + 2s - 2o, -s - 3o = -20. Let n(q) = sx(q) + 4j(q). Let n(k) = 0. What is k? -1, 1 Let c = -66 - -69. Let l(p) be the first derivative of -1/12pc + 0p - 1/8p2 - 3. Suppose l(y) = 0. Calculate y. -1, 0 Suppose 0 = -2p - 4y + 62, 0p + 5y - 43 = -p. Let g = p - 21. Factor -1/5n*5 + 0 - 2/5n*4 + 2/5n*g + 1/5n + 0n3. -n(n - 1)(n + 1)3/5 Let p = 12/305 + -26/1281. Let t(u) be the third derivative of 0u*4 - 2u*2 + 1/60u*6 + 1/168u*8 + 0u*5 + 0u - pu7 + 0u*3 + 0. Solve t(q) = 0. 0, 1 Let h(j) be the third derivative of 0 + 0j*6 + 0j*3 + 0j*5 - 1/336j*8 + 0j*4 - 1/210j*7 - 4j*2 + 0j. Factor h(t). -t*4(t + 1) Let c(b) be the third derivative of -b6/480 + b5/60 - b*4/32 + 11b*2. Find j, given that c(j) = 0. 0, 1, 3 Let j(z) be the second derivative of 0 + 1/2z*4 + 2z + 4/3z3 + z2. Find g such that j(g) = 0. -1, -1/3 Let c(o) be the first derivative of -o4/4 - o3 - 3o*2/2 + 4o + 5. Let h(r) be the first derivative of c(r). Solve h(p) = 0. -1 Let w(j) be the first derivative of j9/10584 + j8/5880 - j7/2940 - j6/1260 + j*3 + 1. Let m(i) be the third derivative of w(i). Factor m(a). 2a*2(a - 1)(a + 1)2/7 Find j, given that -9j - 3j2 - 6j - 3j + 9j = 0. -3, 0 Let y = 17/2 - 25/3. Suppose 1/2v3 + 0 + 0v + 1/2v4 + yv*5 + 1/6v*2 = 0. Calculate v. -1, 0 Let x be 0(2 + -1)1. Let a(w) be the third derivative of 1/30w*5 + 0 + 1/315w7 + w2 + 0w3 + 1/60w*6 + xw + 1/36w4. Factor a(s). 2s(s + 1)3/3 Let l(g) = g3 - 12g*2 + 13g + 14. Let w be l(11). Let h = w - 34. Solve 10/7s - 4/7 + 2sh = 0. -1, 2/7 Let o(g) be the second derivative of g4/4 + 3g3/2 + 3g*2 + 5g. Determine x so that o(x) = 0. -2, -1 Solve 21/2x2 - 21/2x*4 - 3/4x*5 + 0 - 36x*3 + 147/4x = 0 for x. -7, -1, 0, 1 Let i(s) = -s3 - s2 + 5s - 6. Let p(h) = -h2. Let q(v) = -i(v) + 3p(v). Solve q(o) = 0 for o. -2, 1, 3 Suppose n - 30 = -4n. Let r(g) = 5g*2 - 9g + 4. Let i(t) = -4t2 + 8t - 4. Let b(m) = ni(m) + 4r(m). Suppose b(y) = 0. What is y? 1, 2 Let b be (10/(-20))/(2/(-16)). Suppose 7j3 + 6j*2 + 5j3 + j4 + 2jb - 3j*3 = 0. What is j? -2, -1, 0 Suppose -5r + 7 = -8. Determine k, given that -4 + 4k2 + 4k - k - rk3 + k3 - k = 0. -1, 1, 2 Let l be (-345)/(-138)16/10. Let 8/7a2 - 2/7a3 - 1/7 - al - 2/7a + 4/7a*5 = 0. Calculate a. -1, -1/4, 1 Let u be 21/(-18)(-12)/28. Find n such that un4 - n2 - 1/2n*5 - 1/2n + 1/2 + n3 = 0. -1, 1 Let p(u) be the second derivative of u6/180 - u*5/60 - 5u*3/3 - u. Let v(y) be the second derivative of p(y). What is m in v(m) = 0? 0, 1 Suppose 2/5b*2 - 8/5b + 8/5 = 0. What is b? 2 Let m(o) be the second derivative of -3o + 0 - 1/2o*3 - 1/12o4 + o2. Let u(n) = 4n2 + 9n - 6. Let j(c) = 21m(c) + 6u(c). Solve j(f) = 0 for f. 1, 2 Let u(i) = i*4 + 2i*3 + 4i*2 + 12i + 9. Let m(n) = -n*4 - 3n*3 - 5n*2 - 12n - 9. Let f(z) = -6m(z) - 7u(z). Factor f(a). -(a - 3)*2(a + 1)2 Let c(b) be the first derivative of -b5/50 + 11b4/10 - 121b*3/5 + 1331b*2/5 - 14641b/10 - 23. Factor c(a). -(a - 11)4/10 Let m(w) be the first derivative of w8/336 + w7/70 + w6/40 + w*5/60 - 3w2/2 + 2. Let s(j) be the second derivative of m(j). Factor s(a). a2(a + 1)3 Let d(y) = y2 + 3y - 2. Let v be d(-5). Solve 2 + 17/2m2 - 5/2m*3 - vm = 0. 2/5, 1, 2 Let h(v) be the first derivative of 1/5v5 - 2v - 5/2v2 + 1/4v4 + 4 - v3. Find l such that h(l) = 0. -1, 2 Let d(i) be the first derivative of i4/8 - i3/18 - i*2/4 + i/6 - 8. Factor d(v). (v - 1)(v + 1)(3v - 1)/6 Let g(y) be the first derivative of -y*4/10 + 2y3/5 + y2/5 - 6y/5 + 58. Solve g(i) = 0 for i. -1, 1, 3 Let y(b) = 3b*2 - 2b - 1. Let r be y(-3). Suppose 30g2 - rg2 + 1 + g4 + 0g4 = 0. Calculate g. -1, 1 Factor -2s*2 + 1/4s - 9/4s3 + 0. -s(s + 1)(9s - 1)/4 Find d, given that -5/2d - 2d*3 - 1 + 11/2d*2 = 0. -1/4, 1, 2 Let x(m) be the first derivative of 4m*3/21 + 4m*2/7 + 10. Factor x(u). 4u(u + 2)/7 Let j(w) be the third derivative of -w8/10080 - w7/840 - w6/180 - w5/20 - w2. Let y(h) be the third derivative of j(h). Factor y(o). -2(o + 1)(o + 2) Let h(q) be the first derivative of -q4/13 - 10q*3/39 + 3q2/13 + 64. Let h(a) = 0. Calculate a. -3, 0, 1/2 Let d(o) be the third derivative of o6/480 - o5/120 - o4/96 + o*3/12 + 25o2. Find g, given that d(g) = 0. -1, 1, 2 Let d(x) be the second derivative of x6/80 + 3x5/16 + x4/4 - 5x*3/8 - 27x*2/16 - 3x + 3. Suppose d(p) = 0. What is p? -9, -1, 1 Suppose 0r = -r. Suppose r = -x + 5. Factor 0v - xv3 + 3v*3 + 2v. -2v(v - 1)(v + 1) Determine v so that 2v*3 - 12v + 19v - 9v = 0. -1, 0, 1 Let j = 18903 + -623708/33. Let z = 45/11 - j. Find q such that 2/3q4 - zq*3 + 0 + 0q + 0q2 = 0. 0, 2 Let o = 7 + -2. Let y(p) = -p2 + 6p - 3. Let l be y(o). Factor -2h3 + 3h*2 + 1/2 - lh + 1/2h4. (h - 1)4/2 Let a(u) be the second derivative of u5/80 + 7u4/48 + u3/3 - 2u2 + 38u. Let a(z) = 0. Calculate z. -4, 1 Factor -1/2d - 1/4d*2 + 3/4. -(d - 1)(d + 3)/4 Factor -3d2 - 21/2d + 3/2d3 - 6. 3(d - 4)(d + 1)2/2 Let n(i) = -i3 + 11i*2 - 49i + 6. Let l(q) = q*3 - 10q*2 + 49q - 8. Let y(r) = 3l(r) + 4n(r). Determine f so that y(f) = 0. 0, 7 Let x = 8/17 - -1/34. Factor -xs2 + s + 0. -s(s - 2)/2 Suppose 0 = -4v + v + 15. Let f(r) be the third derivative of 1/30r*v + 1/6r*4 + 0r + 0 - 3r2 + 1/3r3. Find g such that f(g) = 0. -1 Let m(j) be the second derivative of -j5/90 + j4/27 + j3/27 - 2j2/9 + 7j. Determine k so that m(k) = 0. -1, 1, 2 Let d(k) be the second derivative of k4/108 - k2/18 + 5k. Factor d(q). (q - 1)(q + 1)/9 Let m(z) be the third derivative of -1/280z7 + 0z*4 + 0z*3 + 0 + 3z*2 + 1/160z*6 - 1/240z*5 + 0z + 1/1344z8. Suppose m(q) = 0. What is q? 0, 1 Let q = 2 - 2. Suppose q = -3c - 2s - 1, -4c + 2s = -s - 27. Factor -3w + wc + w3 + 2w - w5. -w(w - 1)*2(w + 1)2 Let q(s) = -s2. Let d(x) = -16x2 - 8x + 4. Let m(n) = -d(n) + 20q(n). Let m(w) = 0. Calculate w. 1 Let l(z) = z3 - 10z*2 - 13z - 5. Let n be l(11). Let v be n/(-18)(-4)/(-3). Factor 1/2 + 3/4y + 1/4yv. (y + 1)(y + 2)/4 Let m = -1/20 - -4/5. Let h(j) be the first derivative of -1 - 1/4j2 - 15/16j*4 + 0j - 11/20j5 - mj*3 - 1/8j6. What is x in h(x) = 0? -1, -2/3, 0 Let d(r) be the third derivative of -r8/8960 + r6/960 - r4/24 - 2r2. Let s(u) be the second derivative of d(u). Factor s(h). -3h(h - 1)(h + 1)/4 Factor -2s5 - 364s*2 + 4s - 6s5 + 356s*2 + 4s*5 + 8s*4. -4s(s - 1)3(s + 1) Let j(a) be the second derivative of -a*5/3 + 32a*4/9 - 74a*3/9 + 20a*2/3 + 2a. What is q in j(q) = 0? 2/5, 1, 5 Factor 2 - i*2 - 10i + 0 + 3i + 6i. -(i - 1)(i + 2) Let c(o) = -o - 3. Let u be c(-4). Let v be -1u + 9/9. Solve -2/3r - 1/3r*2 + v + 1/3r*3 = 0 for r. -1, 0, 2 Let r(f) be the first derivative of -4f*5/25 + 2f*4/5 + 11f*3/15 + 3f*2/10 + 5. Factor r(t). -t(t - 3)(2t + 1)*2/5 Let w = 135/16 + -35/16. Let h = 7 - w. Factor 1/2 + 1/4s*2 + hs. (s + 1)(s + 2)/4 Let w(a) = -3a3 + a2 + 2a. Let m be w(-1). Factor -2/9c - 4/9cm + 0 - 2/9c*3. -2c(c + 1)2/9 Let q(g) be the first derivative of -g6/105 - g5/70 + g4/21 - 2g + 3. Let f(j) be the first derivative of q(j). Find a such that f(a) = 0. -2, 0, 1 Let o = 13 - 9. Factor -324g + 162g*2 - 36g*3 + og*4 + 5g*4 + 243 - 6g*4. 3(g - 3)*4 Let c(r) be the first derivative of 0r*2 + 1/8r*4 + 1/36r*6 + 1/18r*3 + 0r - 2 + 1/10r5. Factor c(b). b2(b + 1)3/6 Let z(p) be the first derivative of p6/6 - p**4/4 -	{ "pile_set_name": "DM Mathematics" }
2 + z. Let y be k(-1). Suppose -a = -1 - y. Is a prime? False Let p = 6 - 4. Let q(s) = 1 + 2s - 3sp - 4 + s3 + 0s. Is q(4) a prime number? False Suppose -4d - 20 = d. Is 2 + 4/(d/(-35)) a prime number? True Let a = -208 - -337. Suppose 19 = 4d - a. Is d a composite number? False Let x(c) = -5c3 + 4c*2 + 6c + 8. Is x(-3) a prime number? False Let g = -51 - -143. Suppose 2d - g = 798. Is d composite? True Let m = 610 - 399. Is m prime? True Let y(j) = 5j*2 + j - 8. Let l be y(-5). Suppose -l - 243 = -5g. Is g composite? False Suppose -3r = -3y + 48, 0 = y + 2y - r - 58. Suppose 0 = 2x - 3x + y. Is x prime? False Let b = -3 + 8. Suppose 3r = 0, 3a = -0r + br - 66. Let p = 56 + a. Is p a composite number? True Suppose 0 = 3x - 454 - 1655. Is x a composite number? True Let k(b) = b3 + b2 + 74. Suppose 0p = 2p. Let q be k(p). Let u = 105 - q. Is u a composite number? False Let c = 3 - 1. Let v(p) = 19p3 + p2 + 2p - 3. Is v(c) a composite number? False Let v(z) = z*3 - 4z*2 + 2z + 1. Let j be v(2). Is 2954/j3/(-2) a prime number? False Let n(u) = -15u*3 + 3u + 2. Let m be n(-2). Suppose -4l + 2g - 190 = -0g, l - 3g + 50 = 0. Let q = l + m. Is q a composite number? True Let z(x) = x*3 - 7x - 6. Let r be z(-4). Let t be (-6)/(-33) - r/11. Suppose 3b + 0d - 141 = -td, 5b - 249 = -2d. Is b a prime number? False Let v(i) = 3i*2 + 2i. Let n be v(-5). Let s = -22 + n. Is s prime? True Let p(f) = 22f2 + 5f + 2. Let x be p(-5). Let g = -342 + x. Suppose -m = -t - 50, 4m + 3t - g = 2t. Is m a composite number? False Let j = 6 + -4. Suppose -4o + 6 = jv, 1 = 4o + 5v - 2. Suppose 5q = 3k - 256, -oq + 52 = k + 3q. Is k composite? True Let c(y) = 4y*2 - y + 1. Let m be c(1). Suppose -mg - 4x + 92 = 0, -2g = -3x - 27 + 1. Is g a prime number? True Suppose 13m - 223 = 10034. Is m a composite number? True Let a = 3 - -1. Suppose -14 = -4l - 2, ax + 2l - 22 = 0. Suppose 3c = -2p + 27, 4c - 5p - 9 = x. Is c prime? True Suppose 11 = 5d - 4. Let c = 18 - d. Is c a composite number? True Is 53/(2 - 1) + 2 prime? False Let m = 8 - 4. Suppose -mf + 3 = -3d - 2, 0 = -f + 3d - 1. Suppose -fc + 6 + 12 = 0. Is c a composite number? True Let u(l) = 111l + 3. Is u(4) a prime number? False Suppose 3 = -2o + 4v - 3, -3o - 18 = 3v. Is (-2)/o + (-2765)/(-25) a prime number? False Let k(y) = -4y. Let j be k(6). Is 414(-3)/j a prime number? True Suppose -2q - 165 = -67. Let k = 13 - 83. Let y = q - k. Is y prime? False Suppose 606 = 3n - 114. Suppose 0g - 2g - n = -4k, -3k = g - 175. Is k a prime number? True Suppose 2q - q = 0. Is (21 + q + 2)/1 a composite number? False Is 12 - (-2 - 0/(-1))/2 a composite number? False Suppose -3t = -t - 652. Is t composite? True Let l(d) be the second derivative of -d6/72 - d5/15 - d*4/3 + d. Let m(u) be the third derivative of l(u). Is m(-7) prime? False Let i = 5 + -4. Let u(f) = 20f + 1. Is u(i) a prime number? False Suppose -4r + 457 + 547 = 0. Is r a prime number? True Let h(l) be the third derivative of -l6/30 - l5/20 + 5l4/24 - l3/2 - l*2. Let d be h(-4). Suppose -3s = 2s - d. Is s a composite number? False Suppose -4t - t = 0. Suppose 3y - 83 - 532 = t. Is y prime? False Let h(r) = 1200r - 7. Is h(2) a composite number? False Suppose -3x - x = 0. Suppose -g + 2 = -xg. Suppose 4r + 200 = 3m - r, -3m = -gr - 197. Is m prime? False Let c = -1 - -4. Suppose -j - c = 5. Is 2/(-4) - 156/j a composite number? False Let n = -42 + 5. Let t = n + 68. Is t composite? False Let a(s) = -s2 - s + 60. Let c be a(0). Let l = c + -7. Is l composite? False Let l(j) = j3 + j*2 - j + 113. Let z be 28/8 - (-3)/(-2). Suppose -zp = -p. Is l(p) a composite number? False Suppose 6s = 2s + 2h, 3s + 5h = 0. Suppose r + 4r - 25 = s. Suppose -1305 = -rk + 200. Is k a composite number? True Let b = 20 + -10. Suppose -11m + bm = -185. Is m composite? True Let b(d) = 746d + 33. Is b(4) composite? True Suppose -1140 = 2f - 3a - 5071, 5a = 5. Is f a prime number? False Let i = -2461 + 4410. Is i a composite number? False Let g(n) = 38n - 1. Suppose -3 = 2f - 4i + 1, -3f = 4i - 24. Let w be g(f). Let p = -72 + w. Is p composite? False Let l(n) = -n*3 - 3n2 + 12. Let r be (-285)/55 - 2/(-11). Is l(r) composite? True Let b = 0 - 1. Let d be (b/2)/(1/(-10)). Let f = 14 - d. Is f prime? False Let a(p) = p3 + 6p2 - 6p + 9. Let r be a(-7). Is (25 - (-3)/3)/r composite? False Let h = 572 - -369. Is h a composite number? False Let g = 173 + -90. Is g composite? False Let z(x) = x*2 + 3x - 2. Let k be z(-4). Suppose -kf + 5w + 273 = 0, -5f - 4w + 137 + 628 = 0. Is f a composite number? False Suppose -d - 36 = 3d. Let y(f) = 2f*2 + 11f - 17. Let i(n) = n*2 + 5n - 9. Let k(j) = -5i(j) + 3y(j). Is k(d) prime? True Suppose 5x = -2u - 0x + 580, 3u = -4x + 863. Let c = 61 - u. Let g = c + 411. Is g prime? False Suppose 0c = 2c + 4. Let h = c + 0. Is (-1)/2 - 63/h a prime number? True Suppose 2b + b - 45 = 0. Is b a prime number? False Let u be (-21)/35 + (-253)/(-5). Suppose -5v - u + 725 = 5f, 5f = -2v + 282. Is v a composite number? False Suppose n = -4t + 127, 2n + 3n = t - 37. Suppose -9 = g - t. Is g a composite number? False Suppose 4s = 2k - 20, -s + 24 = 5k + 2s. Let r = 1 - 6. Is r/15 + 38/k a prime number? False Let y = 160 - 38. Is y composite? True Suppose -159 = -5b + 4q, -6b + 82 = -4b + 3q. Is b a composite number? True Let f(y) = 11y3 - 3y*2 - y + 1. Let d be f(-7). Is (d/(-36))/((-2)/(-3)) a composite number? False Suppose -5r = -490 + 55. Is r composite? True Suppose 5x = x + 3868. Is x a composite number? False Is (762/(-12))/((-1)/2) a composite number? False Suppose 1592 = 4t - 5k, -2t + 2k = -1024 + 230. Suppose -t = -7j + 4j. Is j a prime number? True Let a = 5 + -4. Is 23 - (a - (2 + -2)) composite? True Let q be -3 + (-6)/(-3) - 5263. Is q/(-21) - (-1)/3 a composite number? False Suppose -10 = -5a - 0. Suppose -2s = -3r + 3706, 2s - s - 2480 = -2r. Is a/9 - r/(-18) a prime number? False Suppose -2q + 25 = 95. Let n = -12 - 4. Let a = n - q. Is a a composite number? False Let c(z) = 4z - 8. Let u be c(8). Suppose -3o + 0 = -3w - u, -4o = 3w - 60. Let a = -2 + o. Is a a prime number? False Let b = -452 + 823. Is b a composite number? True Let w(n) = -8n - 3 + 3n*2 - 10n2 + 2 - n3. Is w(-6) a composite number? False Let b = 58 + 9. Is b a prime number? True Let o = -8 + 6. Let q be -1o/(-3)3. Is 19/(q3/(-42)) a composite number? True Let c(v) = v2 - 8v + 15. Let g be c(6). Suppose -6j + 1316 = -2j + 4o, 0 = gj - 5o - 1003. Is j prime? True Let y(c) be the second derivative of -c5/20 + 7c*4/12 + 4c*3/3 + 9c*2/2 + 4c. Is y(7) a composite number? True Let b(y) = -3y3 - 6y*2 - 6y - 5. Is b(-4) a composite number? True Let h = 241 + -167. Is h a composite number? True Let q be -25 + (0 - 2/(-1)). Let v = q + 32. Let a = v - 3. Is a a composite number? True Let r(o) = 170o + 1. Let g(s) = 339s + 3. Let l(u) = -2g(u) + 5r(u). Let j be l(1). Suppose 0k + k = 2t - 58, 4k = -5t + j. Is t a composite number? False Suppose x - 2 + 27 = 0. Let b(g) = 3g3 - g2 - 1. Let t be b(3). Let h = t + x. Is h a prime number? False Let y = 8 - 9. Is y3/(3/(-23)) a composite number? False Suppose 70 = m + r, 0r + 20 = -4r. Let w = m - -84. Is w a prime number? False Let r be 6/(-21) - 430/14. Let h be (-1 + 2)/(4/(-208)). Let v = r - h. Is v composite? True Suppose -1 = -4p + 7. Is ((-10)/30)/(p/(-2694)) a prime number? True Let m be -6129/(-2). Let t = 146 - m. Is t a prime number? True Let z be 4/10(-6 - 4). Let g = 4 + z. Suppose g = -3m - i + 104, 0i = -4m + 4i + 128. Is m prime? False Let q = -374 + 559. Is q a composite number? True Suppose -3 - 7 = -2k. Let j be 5 + (-2 - -1 - 1). Suppose 0v - 70 = -kv + b, -jv - 2b = -42. Is v a composite number? True Let r(c) = 130c - 3. Let u be r(3). Let a = -200 + u. Let v = a - 104. Is v composite? False Suppose 0 = 2z - 6z + 1028. Is z prime? True Is (-71)/(4/(-188)) a composite number? True Suppose 2j = -s + 3089, 3j - 5s - 4722 = -108. I	{ "pile_set_name": "DM Mathematics" }
1 Which is the biggest value? (a) -1 (b) 11 (c) 0.1 (d) 0 (e) -6 b What is the second smallest value in -688, -0.4, -0.2? -0.4 What is the fifth smallest value in -4, -7, 4/3, 112, -1/4? 112 What is the fifth smallest value in 5, -2/17, -0.3, -0.1, -3/14? 5 Which is the second smallest value? (a) -1/5 (b) -0.081 (c) 3 (d) -2/5 a What is the second biggest value in 250, 0.02, -4? 0.02 Which is the third biggest value? (a) -0.01 (b) -0.5 (c) -8/11 (d) -0.12 (e) 2/11 d Which is the second smallest value? (a) -174 (b) 0 (c) -5 c What is the smallest value in 3/2, -0.06, -3.4? -3.4 What is the second smallest value in 2/15, -6, 0.3, 1/3? 2/15 Which is the smallest value? (a) 2/3 (b) -63 (c) 0.52 b What is the biggest value in -2, -3/20, 2/3, 1? 1 What is the second smallest value in 2/5, -13, -0.04? -0.04 What is the fourth biggest value in -0.3, 2/27, 1/5, -0.4? -0.4 What is the smallest value in -1/5, -3.52, 1/4? -3.52 Which is the second smallest value? (a) -2/65 (b) -1 (c) -0.3 (d) 3/5 c Which is the biggest value? (a) 1/3 (b) 1021 (c) -2 b Which is the fourth smallest value? (a) 1 (b) 5 (c) -2.6 (d) -1/7 b Which is the third biggest value? (a) 0 (b) 69 (c) 5/3 a What is the second biggest value in 4, -1/9, 1.2? 1.2 What is the fourth smallest value in -2/9, 11, 4, 14? 14 What is the second smallest value in 7, -36, -5? -5 What is the third smallest value in 33.6, -0.4, -1, 0.4? 0.4 What is the second smallest value in -146, 3, 0.02, -3/5? -3/5 Which is the second smallest value? (a) -1 (b) -332 (c) 3 a What is the second smallest value in 3.7, 2/47, 3/8? 3/8 Which is the smallest value? (a) -14/39 (b) -5 (c) 2 b Which is the second smallest value? (a) 3.6 (b) -2 (c) -0.1 (d) 0.2 c Which is the third smallest value? (a) 120.4 (b) 1 (c) -0.5 a What is the third biggest value in 0, -1, -2/11, 0.5? -2/11 What is the third biggest value in -1/4, 5, -0.5, -177? -0.5 What is the biggest value in -1/2, 22/157, -2/13? 22/157 Which is the fifth biggest value? (a) 1/5 (b) 3/7 (c) 1 (d) -7 (e) -3/7 d What is the biggest value in -0.49, -8, 4? 4 What is the third biggest value in -1/6, 87, 0.5, 2/5? 2/5 What is the second smallest value in 39, 1/7, 2? 2 Which is the smallest value? (a) 0.1 (b) -5/2 (c) -3 (d) -1 (e) -4 e What is the second smallest value in -41, 3/7, -1? -1 What is the second biggest value in 218, -2/3, 0.5, 1? 1 What is the second biggest value in -7, 0.1, -2/5? -2/5 Which is the third smallest value? (a) 3 (b) -0.01 (c) 2 (d) -1.1 c Which is the fourth biggest value? (a) 0.3 (b) 2/13 (c) -2/9 (d) 0.02 (e) -1/11 e Which is the third biggest value? (a) -0.1 (b) 0.4 (c) -1 (d) 0.17 a Which is the third smallest value? (a) -2.7 (b) 5 (c) 0.2 b What is the third smallest value in -2, -0.5, 1.2, 0? 0 What is the biggest value in -3/26, -3, 4? 4 What is the second biggest value in 3/29, 0.4, -0.4? 3/29 Which is the fifth biggest value? (a) -1 (b) -3 (c) 42 (d) 3/5 (e) -3/5 b Which is the smallest value? (a) -2/13 (b) 19/10 (c) 3 a Which is the second biggest value? (a) -3 (b) 0.1 (c) 11 b Which is the smallest value? (a) 0.2 (b) -8 (c) 25 b What is the second smallest value in 16, -0.4, -0.1? -0.1 Which is the third biggest value? (a) -4 (b) 3 (c) 0.16 (d) 8 (e) 0 c What is the second biggest value in -22, -11, 0.5, 1/4? 1/4 Which is the second biggest value? (a) -1 (b) 2/5 (c) 1/4 (d) -0.27 c What is the smallest value in 23, -5/4, 0.18? -5/4 What is the third smallest value in -3, 1, 2? 2 Which is the third smallest value? (a) -242 (b) -4 (c) 2 (d) 2/7 (e) -6 b What is the smallest value in -5, -6/19, 4? -5 Which is the third biggest value? (a) 2 (b) -2/17 (c) -7 (d) 1 b What is the second smallest value in 4/5, -8/5, -17/2? -8/5 Which is the second smallest value? (a) 4/3 (b) -34.1 (c) -0.2 c What is the third biggest value in 0.21, -4, -5? -5 Which is the fourth biggest value? (a) 2/5 (b) -1 (c) 1/9 (d) 2 (e) -5 b Which is the fourth smallest value? (a) 0.4 (b) 3/7 (c) -0.2 (d) -2/5 (e) 2/3 b Which is the third smallest value? (a) 2/9 (b) -2/5 (c) -556 (d) 1 a What is the second smallest value in 3, -2/5, 3/4, -2/141? -2/141 What is the smallest value in 1, 16, -6/11? -6/11 What is the third smallest value in -24, 1/10, -0.4? 1/10 What is the third smallest value in -415, -2/11, -0.1, 0.2? -0.1 What is the third smallest value in 1/5, 4, 29/2? 29/2 What is the smallest value in 11, 2, 0.2, 1/3? 0.2 Which is the fourth smallest value? (a) -1 (b) 3/2 (c) 2 (d) 0.3 (e) -64 b Which is the biggest value? (a) -35 (b) -2 (c) -1 c Which is the third smallest value? (a) 1 (b) -0.4 (c) -1/5 (d) -1 c What is the biggest value in 0.4, -19, 1, 1/4? 1 What is the fourth biggest value in -3, 3/5, -1, 36? -3 What is the fourth biggest value in -62, -0.2, -3/8, 0.1? -62 What is the second smallest value in -1/3279, -1/4, -2? -1/4 Which is the third smallest value? (a) -0.6 (b) 1/11 (c) 0 b What is the biggest value in 0.1, 0.4, -104? 0.4 Which is the fourth smallest value? (a) -0.1 (b) 8 (c) -0.3 (d) 2/3 (e) 4 e Which is the biggest value? (a) -3 (b) -4 (c) -0.5 (d) 1 d What is the biggest value in 0.1, -13, 6? 6 Which is the fourth smallest value? (a) -22 (b) 0.5 (c) 3 (d) -0.5 c What is the third biggest value in -2/37, -3, 3, -1/2? -1/2 Which is the third biggest value? (a) 94 (b) -2/9 (c) -0.5 (d) -5 c Which is the smallest value? (a) 0.01 (b) 1/4 (c) 4 (d) 1 a Which is the second biggest value? (a) 187 (b) -1/2 (c) 0 (d) 2/7 d Which is the fourth smallest value? (a) 20 (b) -1/4 (c) 0.1 (d) 1 (e) -1 d Which is the second biggest value? (a) 6 (b) 2 (c) -0.3 (d) 36/13 d What is the second smallest value in -0.179, 0.08, 0.4, 4? 0.08 Which is the third smallest value? (a) 0 (b) 3 (c) -1 (d) -0.1 (e) -0.7 d What is the fourth smallest value in 8, -4/9, -2, 119? 119 Which is the third biggest value? (a) -28.7 (b) 14 (c) 0.1 (d) 0 d Which is the fourth biggest value? (a) 0 (b) -1/54 (c) 2 (d) -5 (e) 0.3 b What is the second smallest value in 0.3, -9, 0.2, 18? 0.2 Which is the third biggest value? (a) 1 (b) -0.0721 (c) 2/15 b Which is the second smallest value? (a) 4 (b) -3.6 (c) 0.2 c What is the third biggest value in 2, 1/4, -0.1, 17? 1/4 What is the second biggest value in 3, 0.2, -3, -3/5, -2/3? 0.2 What is the second smallest value in -0.091, -0.03, -0.2? -0.091 Which is the second biggest value? (a) 1/4 (b) -0.4 (c) -762/5 b What is the smallest value in -82, -35, 1/9? -82 Which is the third biggest value? (a) 7 (b) -1 (c) 0.2 b Which is the fourth smallest value? (a) 1/6 (b) 2/5 (c) 0 (d) 22/9 d Which is the fourth biggest value? (a) 2 (b) 0 (c) 0.1 (d) -1 (e) 156 b What is the second biggest value in 3, 9, 0.35, -1/4? 3 Which is the second biggest value? (a) -50 (b) 2/11 (c) 0.4 (d) -3 b What is the third biggest value in -3, -2.43, 2/7? -3 Which is the fifth biggest value? (a) 3/5 (b) 2/5 (c) 4/3 (d) 2/11 (e) -2/3 e What is the third smallest value in 5, 0, -2.2? 5 What is the fifth biggest value in 2/7, -1, -9, 0, -17? -17 Which is the fourth biggest value? (a) -5 (b) 2 (c) -2/3 (d) 0.53 a What is the fourth biggest value in -7, -49, -0.06, 1/4? -49 What is the smallest value in 2/5, -0.14, 0.5, 4, 0? -0.14 What is the second smallest value in -2/25, 2, 3/43, -3, -0.1? -0.1 What is the second biggest value in -1/4, -1/8, 9.7, -3/2, 2/9? 2/9 What is the third smallest value in -77, 1/2, 5/6, 4/5, -5? 1/2 What is the biggest value in 0.4, 162, -2.6, -3/2, -5? 162 Which is the second biggest value? (a) 16 (b) -2/9 (c) -2/3 (d) -19 (e) 0.5 e Which is the fifth biggest value? (a) 0.1 (b) -0.1 (c) 1/3 (d) -0.2 (e) 316 d What is the third biggest value in 0.1, 12, -6, -0.3? -0.3 Which is the second smallest value? (a) -0.1 (b) 5 (c) 4 c Which is the second smallest value? (a) 0.13 (b) 4 (c) -4/3 a Which is the third biggest value? (a) 27/4 (b) -4 (c) -2/5 b What is the second biggest value in 53, -4, -3? -3 Which is the third smallest value? (a) -184 (b) 3 (c) 0.3 (d) 5/2 (e) -6/7 c Which is the biggest value? (	{ "pile_set_name": "DM Mathematics" }
vided by 6. -2581/6 Divide 371 by 53. 7 1516 divided by 379 4 What is 14424 divided by 601? 24 What is -70 divided by -70? 1 Divide 80 by 80. 1 Divide -31 by -283. 31/283 What is -1 divided by -162? 1/162 Calculate -525 divided by 175. -3 Divide -7110 by 1422. -5 24864 divided by 74 336 -5 divided by -5760 1/1152 -4506 divided by 751 -6 What is -586 divided by -1? 586 What is -100 divided by -20? 5 -871 divided by 871 -1 What is -2 divided by -41? 2/41 -5 divided by -20 1/4 Calculate -504 divided by 168. -3 What is 182 divided by -7? -26 Divide 74 by 5. 74/5 -5 divided by 19 -5/19 Calculate 207 divided by 1. 207 Divide 1660 by -166. -10 -15 divided by -19 15/19 Calculate 38171 divided by -779. -49 -837 divided by -3 279 5 divided by 30 1/6 What is 434 divided by 1? 434 What is 4 divided by 3261? 4/3261 What is -88 divided by -4? 22 165 divided by 2 165/2 What is 9507 divided by 3? 3169 Calculate -3224 divided by 1. -3224 Divide -3 by -148. 3/148 Calculate -4 divided by -1953. 4/1953 Divide -18502 by 3. -18502/3 Calculate 1503 divided by -9. -167 Divide -3 by -96. 1/32 Divide 1844 by -4. -461 Divide 4 by 4. 1 75 divided by -15 -5 Divide -78 by 5. -78/5 Calculate 111 divided by -3. -37 What is -416 divided by 6? -208/3 What is 9656 divided by -2? -4828 Divide 4 by 187. 4/187 What is 498 divided by 166? 3 Calculate 3 divided by 1528. 3/1528 Divide -5 by -357. 5/357 6392 divided by -94 -68 0 divided by -26 0 -1735 divided by 5 -347 Divide 75 by -5. -15 What is 2 divided by -4265? -2/4265 What is 766 divided by -3? -766/3 956 divided by -4 -239 What is -3 divided by -13? 3/13 Divide 5 by 15. 1/3 What is -1 divided by -28? 1/28 Divide 28 by 21. 4/3 Calculate -126930 divided by -3. 42310 What is 5154 divided by -2? -2577 Calculate 138 divided by -4. -69/2 Divide 46 by 2. 23 Calculate -196 divided by -3. 196/3 Calculate -888 divided by -2. 444 Divide -2 by -107. 2/107 What is -9732 divided by -2433? 4 2 divided by -30 -1/15 464 divided by -232 -2 2719 divided by -1 -2719 -85 divided by 5 -17 Divide -630 by 90. -7 Calculate 0 divided by -97. 0 Divide -464 by -29. 16 Calculate -17 divided by -94. 17/94 What is 104 divided by -24? -13/3 What is 111 divided by 37? 3 What is -463 divided by -3? 463/3 Calculate -1 divided by -264. 1/264 What is -19481 divided by -2783? 7 What is -7 divided by -144? 7/144 Divide 300 by -6. -50 Divide 405 by -135. -3 What is 835 divided by -5? -167 16 divided by -42 -8/21 Divide 2954 by 211. 14 Divide 2082 by -694. -3 Divide -1392 by 464. -3 What is 1563 divided by 2? 1563/2 Calculate 45 divided by -9. -5 Divide -119 by -1. 119 What is -206 divided by 103? -2 Divide -7368 by 1842. -4 What is -1 divided by -27? 1/27 Divide 42 by -42. -1 9825 divided by -393 -25 Calculate -245 divided by -5. 49 0 divided by -360 0 Calculate -4 divided by 130. -2/65 What is 33924 divided by 257? 132 Calculate 84 divided by -11. -84/11 Divide 760 by -2. -380 Divide 2 by 4505. 2/4505 6972 divided by -4 -1743 Calculate 38 divided by -19. -2 Divide 17 by 17. 1 1835 divided by 6 1835/6 Divide 1 by -1660. -1/1660 What is -4 divided by -678? 2/339 Calculate -9246 divided by 2. -4623 What is 6365 divided by 19? 335 2 divided by -200 -1/100 What is 0 divided by -1313? 0 What is -305 divided by 61? -5 Calculate 1332 divided by -333. -4 What is -1172 divided by 1? -1172 What is -622 divided by -3? 622/3 Calculate -127 divided by 7. -127/7 Calculate 246 divided by 82. 3 Calculate 5373 divided by 9. 597 What is -576 divided by 4? -144 Calculate 32955 divided by 1. 32955 What is -5 divided by -147? 5/147 Calculate -11 divided by 1. -11 -3 divided by -313 3/313 -1 divided by -73 1/73 Divide -12 by 37. -12/37 Divide -45 by -1. 45 Divide 391 by -6. -391/6 7 divided by -32 -7/32 What is -110 divided by 2? -55 -2 divided by -57 2/57 Divide -1880 by -188. 10 Calculate -184 divided by -1. 184 Calculate -4 divided by 64. -1/16 1 divided by -86 -1/86 What is -139 divided by 32? -139/32 -17680 divided by -4420 4 Divide -842 by 842. -1 What is 24024 divided by 2? 12012 What is -124 divided by 4? -31 What is -580 divided by 1? -580 Divide -31 by -1. 31 Calculate 60 divided by 5. 12 What is -1 divided by -4719? 1/4719 Calculate -10325 divided by 413. -25 What is 360 divided by -9? -40 What is 4980 divided by -83? -60 3 divided by 266 3/266 Calculate -32032 divided by 11. -2912 -3 divided by 2641 -3/2641 Calculate -13248 divided by -6. 2208 52 divided by -2 -26 Calculate -6398 divided by 14. -457 What is 11784 divided by 4? 2946 Divide -2820 by -6. 470 Divide -6 by -22. 3/11 -1470 divided by 294 -5 What is -10230 divided by 3? -3410 Calculate -102048 divided by 6. -17008 Divide -10900 by -218. 50 What is -408 divided by 12? -34 Divide -3348 by 1674. -2 Calculate -6 divided by 1. -6 What is -1806 divided by 3? -602 What is 84 divided by -21? -4 What is -98 divided by -7? 14 Calculate -46 divided by 69. -2/3 Divide -72 by 12. -6 272 divided by 2 136 Calculate 4968 divided by -184. -27 What is 311 divided by 4? 311/4 Calculate 6413 divided by -4. -6413/4 What is -10 divided by -28? 5/14 What is -270 divided by 5? -54 12 divided by -164 -3/41 Calculate -99 divided by 9. -11 What is 8 divided by -97? -8/97 What is 595 divided by 2? 595/2 Calculate -3 divided by 6532. -3/6532 What is 2625 divided by -525? -5 1152 divided by -3 -384 -1895 divided by -5 379 What is -3462 divided by -6? 577 58530 divided by 6 9755 What is 427 divided by -8? -427/8 2395 divided by 479 5 -90 divided by 2 -45 Calculate 10843 divided by 3. 10843/3 Calculate 2236 divided by 43. 52 Calculate 1296 divided by -72. -18 Divide -1128 by 188. -6 Divide -423 by 3. -141 Divide 1640 by -20. -82 Calculate -13 divided by -13. 1 What is -1745 divided by 5? -349 What is 3183 divided by -1061? -3 Calculate 450 divided by 90. 5 Calculate 6902 divided by 203. 34 3 divided by 317 3/317 48 divided by -8 -6 Divide 12696 by 4. 3174 168 divided by 8 21 Divide -56 by -13. 56/13 Divide -5 by 24. -5/24 What is -1 divided by -500? 1/500 What is 22 divided by 6? 11/3 Divide -7245 by 1449. -5 Calculate -109 divided by -6. 109/6 Calculate -265 divided by -265. 1 -105 divided by 5 -21 What is -3509 divided by -5? 3509/5 What is 46 divided by 2? 23 141 divided by 22 141/22 Calculate 1730 divided by -5. -346 -765 divided by -9 85 What is 8 divided by -22? -4/11 Divide -395 by -5. 79 What is -1580 divided by 3? -1580/3 11 divided by -227 -11/227 Divide -3 by -440. 3/440 What is -3 divided by 99? -1/33 What is -8056 divided by 212? -38 What is 7 divided by 42? 1/6 What is 4 divided by -60? -1/15 Calculate 5 divided by -101. -5/101 Calculate 21 divided by 7. 3 What is -23 divided by 31? -23/31 Divide -1752 by 438. -4 Calculate -209 divided by 8. -209/8 What is -1181 divided by -2? 1181/2 What is 4 divided by -442? -2/221 What is 913 divided by -6? -913/6 Divide -828 by 6. -138 Divide 46 by -2. -23 -6042 divided by 2014 -3 Calculate -3030 divided by 606. -5 What is -2280 divided by 3? -760 What is 60 divided by -6? -10 Calculate -155 divided by -3. 155/3 What is 114 divided by 114? 1 Divide -12 by -4. 3 What is 208 divided by 208? 1 Calculate 0 divided by 25. 0 4 divided by -3858 -2/1929 4 divided by 514 2/257 What is 2399 divided by 1? 2399 -184 divided by -92 2 32 divided by -2 -16 13788 divided by 2298 6 Calculate -6725 divided by -5. 1345 What is 420 divided by -30? -14 1584 divided by 6 264 1980 divided by -396 -5 516 divided by -129 -4 Calculate -7 divided by -217. 1/31 0 divided by -370 0 -133 divided by -133 1 Calculate 4165 divided by -5. -833 Divide 281 by 281. 1 703 divided by 37 19 -3 divided by 3 -1 Calculate 2296 divided by -4. -574 What is 21338 divided by -3? -21338/3 Calculate 10 divided by -466. -5/233 Calculate 3638 divided by -1. -3638 Calculate -24 divided by -19. 24/19 What is -72 divided by 464? -9/58 4221 divided by 9 469 What is 114 divided by 114? 1 What is 3 divided by -11? -3/11 Calculate -76 divided by -19. 4 Divide 1920 by -192. -10 What is 1764 divided by 4? 441 What is 0 divided by -44? 0 Divide 2 by -1. -2 -5092 divided by 4 -1273 7272 divided by 2 3636 Divide -70 by 3. -70/3 Divide 4921 by 259. 19 Divide -737 by -1. 737 Divide -800 by 80. -10 Divide 16 by -1513. -16/1513 Divide 102 by 3. 34 What is -	{ "pile_set_name": "DM Mathematics" }
r of 67/4 and d. 8 Let q be 4/(-4) + 113 + -2. Suppose 6v - v - q = 0. Let i = 24 - 12. Calculate the lowest common multiple of v and i. 132 Let x = 11395/9 - 1263. Let c = 12 - 10. Find the common denominator of x and -1c - (-348)/(-96). 72 Let s(q) = q + 17. Let v be s(-15). Suppose -vo + 1 = -5. What is the least common multiple of 8 and o? 24 Suppose 0 = 3h + 10 - 1. Calculate the common denominator of 126(-2)/60h and (-57)/16((-102)/(-42) + -3). 140 Calculate the common denominator of -7 + 13 - (-67)/(-28) and 59/161. 644 Let s(x) = 5x - 10. Let g(k) = -2k + 5. Let n(l) = -13g(l) - 6s(l). Calculate the least common multiple of 8/(-2)(0 - 2) and n(-4). 88 Let y(j) be the third derivative of 5j4/12 - j3/2 - 11j*2. Calculate the lowest common multiple of y(3) and 27. 27 Find the common denominator of 428/(-21)(-126)/336 and 61/20. 140 Suppose 2n + 39 = 2w - 51, 3w = -2n + 120. Calculate the lowest common multiple of 10 and w. 210 Suppose 4m - 23 - 1 = 0. Calculate the lowest common multiple of m and ((-4 - 18) + -2)/(-2). 12 Let i(l) = 153l*2 - 7l + 7. Let y be i(-4). Let f = y + -64499/26. What is the common denominator of -1 + 55/(-6) + 0 and f? 78 Suppose 26y = -141 + 661. Calculate the lowest common multiple of y and 150. 300 Suppose 8b - 5b - 644 = -r, 2496 = 4r - 4b. What is the smallest common multiple of 2 and r? 1258 Let s be ((-4)/(-32))/((-10)/(-465005)). Let i = s + -5815. Calculate the common denominator of -9/164 and i. 656 Suppose t - 85 = -4t. Let d = 1 - 11. Let f = d + t. What is the lowest common multiple of f and 11? 77 Suppose 3 = 2a + 13, 2a - 10130 = 5s. Let v = s - -706. Let g = -15835/12 - v. Calculate the common denominator of g and 59/10. 60 What is the lowest common multiple of 4/((-36)/21)-3 and 3/(-6) + 39/6? 42 Let k be 2/7 + (-4247136)/728. Let p = k + 409333/78. Let b = p - -28333/48. What is the common denominator of b and 33/8? 16 Let g be -27 - 1 - (-2 - 3). Let f = 25 + g. Calculate the lowest common multiple of f and 22. 22 Let o = 163/76 - 5/4. Find the common denominator of o and -13/5. 95 Let r = 31/442 + 9837/14144. What is the common denominator of -51/56 and r? 448 Suppose 6x + x + 48363 = 0. Let o = -124285/18 - x. Calculate the common denominator of o and 25/16. 144 Let c(b) = 2b*2 - 21b + 6. What is the lowest common multiple of 8 and c(-4)? 488 Let t = 36 - 28. Let z(x) = t - x - 13x + 10x + 3x. Calculate the smallest common multiple of 18 and z(3). 90 Let v = 39 - -26. Calculate the common denominator of ((0 - -3) + 0)/(10/v) and 87/2. 2 Let v = 66 + -66. Suppose -1 = -y, -5 = -m - vy + 3y. What is the lowest common multiple of m and 8? 8 Let v = -246 - -247. What is the smallest common multiple of 10 and v? 10 Let y = -41/72 - -53/18. What is the common denominator of y and 21/263? 2104 Suppose 0 = 8b + 1 - 49. What is the lowest common multiple of b and 66? 66 Calculate the lowest common multiple of 96 and ((-12)/(-9) - -12)/(4/18). 480 Let s = -5544681/278 - -19945. Find the common denominator of -95/6 and s. 834 What is the common denominator of 2546/228(-1)/(-5) and 51/10? 30 Let t(i) = 2924i*3 + 11i - 10. Let z be t(1). Let h = 40975/14 - z. Let u = 10/203 - -6985/2436. What is the common denominator of h and u? 84 Suppose 5v = -20 - 0. Find the common denominator of 19/2 and ((-2145)/54)/11 - v. 18 Find the common denominator of (-1064)/(-182)(-2 + 25/12) and 34/3. 39 Let v be 1 - -1 - 1 - -1. Find the common denominator of -31 and 1 + v + (-7)/(-4). 4 Suppose -4h - 198 - 62 = 0. Let p = h - -77. What is the lowest common multiple of p and 32? 96 Suppose 48 - 12 = 12z. What is the lowest common multiple of 30 and z? 30 Let m = 45/623 + 5916/3115. Calculate the common denominator of m and 41/7. 35 Suppose 0 = 4d - 101 + 1. Calculate the least common multiple of 30 and d. 150 Let x = 1/814 + -20413/51282. Calculate the common denominator of 51/28 and x. 252 Let k = -17144 - -17174. Let n(j) = j2 - 2j + 3. Calculate the least common multiple of k and n(5). 90 Let w = 167 - 87. Find the common denominator of 524/w - 1 - 2 and 47/36. 180 Suppose -264 = 13s - 25s. Let k be 75/11 + 4/22. Let y(o) = -o*2 + 10o - 1. What is the lowest common multiple of s and y(k)? 220 Suppose t = -0t - 1042. Let m = -4219/4 - t. What is the common denominator of m and 332/164/(-22)? 44 Let x(y) = -11y + 12. Let f be x(9). Let r be f/(-27) + (-2)/9. What is the lowest common multiple of 2 and r + 102 + 0? 46 Calculate the common denominator of ((-2)/18)/((-56)/(-826))2 and -47/12. 36 Let m = -9886 - -197767/20. What is the common denominator of 14/55 and m? 220 Let z(k) = 31k + 3. Let i be z(2). What is the common denominator of 29/8 and (-519)/260 - 10/i? 40 Suppose 0 = -7q - q + 8. What is the least common multiple of (-104)/(-6 + 2) + q and 6? 54 Let n = 10 - 114. Let u = n + 106. What is the smallest common multiple of u and 14? 14 Suppose 6o + 29 - 149 = 0. Calculate the smallest common multiple of 1482 and o. 14820 Suppose -7p - 3v = -2p + 2, 3p - 2v = 14. Let y(r) = r3 + 9r*2 + 4r + 20. Calculate the smallest common multiple of y(0) and p. 20 What is the common denominator of (-17 + 1848/110)/((-302)/95) and -19/6? 906 Suppose -42 = 5r - 12. What is the lowest common multiple of 2 and 120/21 + r - (-86)/7? 12 Suppose 0 = 4m + 5m - 90. Suppose 5h - 3 = -4d + m, 1 = 2d - 3h. What is the smallest common multiple of d and 7? 14 Let l be (-3(-863)/12)/(-74). Let s = 3/74 + l. Calculate the common denominator of 2 + 1 + 76/(-9) and s. 72 Suppose -7g + 30 = -4g. Suppose 5r + 5x = 30, 0 = r + 2r - 4x + 10. Let c = 0 + r. Calculate the least common multiple of c and g. 10 Suppose 0 = 2a + 2d - 270, -11a = -15a + 5d + 540. Calculate the lowest common multiple of 45 and a. 135 Let d = -2082 - -12641/6. Suppose -2k = -5w - 68, -8 = -2k + 3w + 52. Calculate the common denominator of (-278)/k + 0 + -1 and d. 12 Let k = -71531/51770 - 9/1670. Find the common denominator of -27 and k. 31 Let w(v) = 3v*2 + 5v + 2. Suppose -68 = 17j - 306. Suppose 30r = 31r - j. Calculate the least common multiple of r and w(-3). 14 Suppose -5x + 88 = -3o - 18, -4x = -2o - 84. Calculate the smallest common multiple of 12 and x. 60 Find the common denominator of (-1681)/615 + (-4)/(-3) and 19/24. 120 Let t = -39 - -43. Let o(v) = v3 - 5v*2 + 7v - 8. Calculate the lowest common multiple of 8 and o(t). 8 Let i(p) = -p - 7. Let x be i(-5). Calculate the common denominator of 29/7 - 0 - 0 and (-36)/(x - 12/9). 35 Let a(y) = 6y2 + y. Let v be a(-1). Suppose -vn = -n - 3s - 40, 5n - 3s - 47 = 0. Calculate the smallest common multiple of n and ((-234)/65)/(2/(-5)). 63 Let u = 1843/4 - 463. Let v be 2((-9)/3 + 2). Find the common denominator of (-17)/(-7) + v + 660/175 and u. 20 Find the common denominator of -1 + 107/(-12) + -37 + 35 and -43/4. 12 Suppose -r + 5v = 2 + 7, -5v + 20 = 0. Let p = -6 + r. Suppose -14 + 2 = 4i, -4y + pi = -43. What is the lowest common multiple of 11 and y? 77 Suppose -5u = -b - u - 2, -5b + 35 = -5u. Let t(w) = -w*2 - 6w - 3. Let y(m) = -m + 2. Let k be y(7). Calculate the lowest common multiple of t(k) and b. 10 Let n(a) = 7a2 + a + 1. Let t be n(-1). Suppose -t + 28 = 3m. What is the smallest common multiple of m and (-2)/(-6)113? 77 Let h be -13/(-6) - 58/(-4). Suppose hw + 82 - 442 = 0. Calculate the least common multiple of w and 27. 216 Suppose -5k = -25, -4k + 52 - 20 = -y. Calculate the common denominator of 172/(-18)18/y and 5/2 + 1/(-3). 6 Let z = -73/267679 + 2754718315/123667698. Let u = 297/14 - z. Calculate the common denominator of 1/30 and u. 330 Find the common denominator of 61/5 and 272/(-340)(-31)/(-104). 130 Let j = 1/2193 - 7067/1462. Find the common denominator of (270/(-16))/(-3) + 2 and j. 24 Suppose 8v - 9v = 0. Suppose 0 = 4l - vl + 36. Let i = 17 + l. Calculate the least common multiple of 4 and i. 8 Suppose -4j + 5 + 7 = 0, -5j + 50 = y. Let v = -29 + y. What is the least common multiple of 47 and v? 282 Let m = 6 - 5. Calculate the least common multiple of 21 and m/5 + 2 + (-136)/(-20). 63 Suppose 10l - 220 = 5l. Suppose 2*p + l	{ "pile_set_name": "DM Mathematics" }
git of 4105? 1 What is the tens digit of 35825? 2 What is the hundreds digit of 481? 4 What is the thousands digit of 107208? 7 What is the ten thousands digit of 48296? 4 What is the thousands digit of 4116? 4 What is the hundreds digit of 1001? 0 What is the thousands digit of 2800? 2 What is the units digit of 3032? 2 What is the units digit of 7645? 5 What is the units digit of 204111? 1 What is the tens digit of 40064? 6 What is the units digit of 385? 5 What is the hundreds digit of 2153? 1 What is the thousands digit of 1233? 1 What is the units digit of 1176? 6 What is the ten thousands digit of 154930? 5 What is the hundreds digit of 411? 4 What is the hundreds digit of 2310? 3 What is the units digit of 6497? 7 What is the thousands digit of 1762? 1 What is the hundred thousands digit of 178181? 1 What is the units digit of 519? 9 What is the thousands digit of 54048? 4 What is the units digit of 5801? 1 What is the tens digit of 34115? 1 What is the units digit of 879? 9 What is the hundreds digit of 13467? 4 What is the hundreds digit of 343? 3 What is the ten thousands digit of 14763? 1 What is the tens digit of 810? 1 What is the tens digit of 2365? 6 What is the hundreds digit of 182396? 3 What is the units digit of 899? 9 What is the thousands digit of 10825? 0 What is the tens digit of 1706? 0 What is the thousands digit of 20346? 0 What is the ten thousands digit of 38019? 3 What is the thousands digit of 2281? 2 What is the units digit of 57635? 5 What is the thousands digit of 26382? 6 What is the units digit of 820? 0 What is the tens digit of 3306? 0 What is the tens digit of 29006? 0 What is the tens digit of 288? 8 What is the hundreds digit of 10186? 1 What is the units digit of 992? 2 What is the ten thousands digit of 12726? 1 What is the units digit of 40013? 3 What is the units digit of 54753? 3 What is the units digit of 2605? 5 What is the hundreds digit of 1349? 3 What is the tens digit of 89? 8 What is the units digit of 1097? 7 What is the thousands digit of 3366? 3 What is the thousands digit of 16118? 6 What is the tens digit of 7571? 7 What is the hundreds digit of 1943? 9 What is the tens digit of 116703? 0 What is the ten thousands digit of 11945? 1 What is the thousands digit of 5799? 5 What is the tens digit of 41951? 5 What is the hundreds digit of 1171? 1 What is the ten thousands digit of 29127? 2 What is the tens digit of 657? 5 What is the tens digit of 21653? 5 What is the thousands digit of 1763? 1 What is the thousands digit of 67764? 7 What is the tens digit of 1289? 8 What is the units digit of 972? 2 What is the thousands digit of 2848? 2 What is the units digit of 111? 1 What is the hundreds digit of 60512? 5 What is the hundred thousands digit of 139411? 1 What is the hundreds digit of 7324? 3 What is the thousands digit of 3713? 3 What is the hundreds digit of 5030? 0 What is the tens digit of 743? 4 What is the units digit of 1125? 5 What is the tens digit of 531? 3 What is the hundreds digit of 4386? 3 What is the tens digit of 2422? 2 What is the tens digit of 85383? 8 What is the hundreds digit of 7278? 2 What is the units digit of 1885? 5 What is the units digit of 10432? 2 What is the hundreds digit of 869? 8 What is the tens digit of 10835? 3 What is the hundreds digit of 3076? 0 What is the units digit of 37369? 9 What is the units digit of 568? 8 What is the units digit of 1630? 0 What is the tens digit of 1421? 2 What is the ten thousands digit of 36604? 3 What is the ten thousands digit of 40890? 4 What is the thousands digit of 46549? 6 What is the thousands digit of 17482? 7 What is the hundreds digit of 93696? 6 What is the hundreds digit of 78910? 9 What is the tens digit of 14836? 3 What is the ten thousands digit of 37730? 3 What is the thousands digit of 89627? 9 What is the hundreds digit of 1269? 2 What is the ten thousands digit of 21457? 2 What is the tens digit of 11155? 5 What is the hundreds digit of 123? 1 What is the thousands digit of 21234? 1 What is the ten thousands digit of 31019? 3 What is the units digit of 48647? 7 What is the thousands digit of 44692? 4 What is the thousands digit of 6478? 6 What is the ten thousands digit of 38669? 3 What is the hundreds digit of 40020? 0 What is the tens digit of 7801? 0 What is the thousands digit of 2779? 2 What is the ten thousands digit of 25589? 2 What is the hundreds digit of 1179? 1 What is the tens digit of 25752? 5 What is the units digit of 9134? 4 What is the tens digit of 15480? 8 What is the units digit of 3663? 3 What is the units digit of 265? 5 What is the tens digit of 83? 8 What is the tens digit of 5210? 1 What is the hundreds digit of 1614? 6 What is the tens digit of 2942? 4 What is the hundreds digit of 20055? 0 What is the thousands digit of 1684? 1 What is the units digit of 9592? 2 What is the tens digit of 196? 9 What is the units digit of 3352? 2 What is the thousands digit of 2207? 2 What is the thousands digit of 41495? 1 What is the tens digit of 232? 3 What is the hundreds digit of 1070? 0 What is the hundreds digit of 6623? 6 What is the hundreds digit of 16301? 3 What is the tens digit of 2562? 6 What is the hundreds digit of 132747? 7 What is the hundreds digit of 3331? 3 What is the hundreds digit of 43579? 5 What is the tens digit of 942? 4 What is the hundreds digit of 195? 1 What is the units digit of 715? 5 What is the hundreds digit of 825? 8 What is the hundreds digit of 136? 1 What is the hundreds digit of 28231? 2 What is the tens digit of 681? 8 What is the hundreds digit of 34324? 3 What is the tens digit of 9476? 7 What is the ten thousands digit of 13256? 1 What is the tens digit of 30533? 3 What is the thousands digit of 1662? 1 What is the tens digit of 5491? 9 What is the units digit of 3421? 1 What is the tens digit of 2579? 7 What is the units digit of 22815? 5 What is the thousands digit of 5271? 5 What is the tens digit of 2675? 7 What is the tens digit of 3271? 7 What is the units digit of 10038? 8 What is the ten thousands digit of 48033? 4 What is the tens digit of 7847? 4 What is the units digit of 5971? 1 What is the units digit of 983? 3 What is the hundreds digit of 9030? 0 What is the ten thousands digit of 52722? 5 What is the hundreds digit of 1020? 0 What is the tens digit of 249? 4 What is the tens digit of 593? 9 What is the tens digit of 65073? 7 What is the tens digit of 1080? 8 What is the units digit of 22897? 7 What is the hundreds digit of 2724? 7 What is the tens digit of 1040? 4 What is the hundreds digit of 2192? 1 What is the units digit of 2731? 1 What is the units digit of 56239? 9 What is the hundreds digit of 44196? 1 What is the hundreds digit of 16646? 6 What is the tens digit of 45957? 5 What is the units digit of 44799? 9 What is the thousands digit of 1198? 1 What is the thousands digit of 6915? 6 What is the hundreds digit of 2394? 3 What is the units digit of 11659? 9 What is the hundreds digit of 661? 6 What is the hundreds digit of 16170? 1 What is the hundreds digit of 4427? 4 What is the tens digit of 14877? 7 What is the ten thousands digit of 17009? 1 What is the hundreds digit of 127172? 1 What is the thousands digit of 1404? 1 What is the units digit of 73182? 2 What is the thousands digit of 1176? 1 What is the units digit of 7398? 8 What is the units digit of 14749? 9 What is the hundreds digit of 319? 3 What is the thousands digit of 46346? 6 What is the tens digit of 2364? 6 What is the ten thousands digit of 25785? 2 What is the tens digit of 668? 6 What is the units digit of 132? 2 What is the units digit of 13430? 0 What is the hundreds digit of 3664? 6 What is the ten thousands digit of 37181? 3 What is the ten thousands digit of 22606? 2 What is the thousands digit of 5475? 5 What is the tens digit of 477? 7 What is the tens digit of 851? 5 What is the hundreds digit of 1296? 2 What is the hundreds digit of 7497? 4 What is the tens digit of 1935? 3 What is the units digit of 4698? 8 What is the hundreds digit of 11233? 2 What is the hundreds digit of 138? 1 What is the units digit of 11000? 0 What is the hundreds digit of 1776? 7 What is the ten thousands digit of 10868? 1 What is the units digit of 11011? 1 Wh	{ "pile_set_name": "DM Mathematics" }
the nearest 1000000. 404000000 What is 0.0000422249 rounded to 5 decimal places? 0.00004 Round 0.0474862 to four dps. 0.0475 Round 0.0000451742 to 7 decimal places. 0.0000452 What is -0.1080403 rounded to 4 dps? -0.108 What is 0.114957 rounded to four decimal places? 0.115 What is -0.00061329 rounded to 5 dps? -0.00061 What is 30.160519 rounded to one dp? 30.2 Round 0.00001447543 to seven dps. 0.0000145 What is 2.05771 rounded to 0 decimal places? 2 Round -26302690 to the nearest ten thousand. -26300000 What is -1338883.4 rounded to the nearest 10000? -1340000 What is -160.6778 rounded to 0 decimal places? -161 What is 0.0036436153 rounded to 6 dps? 0.003644 Round -59579100 to the nearest 1000000. -60000000 What is 55.257564 rounded to zero decimal places? 55 Round 0.000003707571 to 7 dps. 0.0000037 What is 35075.73 rounded to the nearest 1000? 35000 What is 6614160 rounded to the nearest 1000000? 7000000 What is 1847336 rounded to the nearest 100000? 1800000 Round -0.003123366 to 3 dps. -0.003 What is 29952.4 rounded to the nearest one hundred? 30000 What is -0.00000954625 rounded to seven dps? -0.0000095 Round 0.000001025493 to 7 decimal places. 0.000001 Round 0.00890784 to 3 dps. 0.009 Round -906135000 to the nearest 100000. -906100000 What is 0.000003356548 rounded to six decimal places? 0.000003 What is 11146.108 rounded to the nearest one hundred? 11100 What is -13958217 rounded to the nearest ten thousand? -13960000 Round -0.00008241747 to 7 dps. -0.0000824 What is -0.0000052311 rounded to five dps? -0.00001 Round -535.0181 to zero dps. -535 Round -0.0000503019 to 5 decimal places. -0.00005 Round -2561181 to the nearest one million. -3000000 What is 0.09605782 rounded to four dps? 0.0961 Round 0.533972 to 2 decimal places. 0.53 Round 79690.6 to the nearest one hundred. 79700 Round 0.42161555 to 4 dps. 0.4216 What is -12300.53 rounded to the nearest ten thousand? -10000 Round -185145.91 to the nearest 100. -185100 What is 0.068524554 rounded to 3 dps? 0.069 Round -0.0562197 to 3 dps. -0.056 What is 13010.176 rounded to the nearest ten? 13010 Round -5.13332 to one dp. -5.1 Round 50112.31 to the nearest ten thousand. 50000 What is 0.01562467 rounded to five decimal places? 0.01562 Round 0.96132599 to one dp. 1 Round 21059.5 to the nearest ten thousand. 20000 Round 59.70956 to zero decimal places. 60 Round 0.0002316671 to 4 decimal places. 0.0002 What is -598396 rounded to the nearest one thousand? -598000 Round 0.104486 to 3 dps. 0.104 What is -0.0021484292 rounded to five decimal places? -0.00215 What is -0.0804232 rounded to three dps? -0.08 Round -0.000739032 to 5 decimal places. -0.00074 What is 1724.743 rounded to the nearest 10? 1720 Round 7401.303 to the nearest integer. 7401 Round 20.77671 to one decimal place. 20.8 Round -7763580 to the nearest one million. -8000000 What is -0.027379 rounded to two dps? -0.03 What is -6730125 rounded to the nearest one thousand? -6730000 Round 0.214879 to one dp. 0.2 What is -214303120 rounded to the nearest one million? -214000000 Round 0.00061577593 to 6 decimal places. 0.000616 What is 0.00253338 rounded to 6 decimal places? 0.002533 What is 225.2036 rounded to the nearest integer? 225 What is -0.3466827 rounded to 3 decimal places? -0.347 Round -0.2336102 to four dps. -0.2336 Round -0.000029226 to 5 decimal places. -0.00003 What is -2.64495 rounded to one decimal place? -2.6 What is -20.676825 rounded to zero dps? -21 What is 20708820 rounded to the nearest 10000? 20710000 Round -13.0872 to one decimal place. -13.1 What is 4400500 rounded to the nearest 100000? 4400000 What is 0.3429336 rounded to 4 decimal places? 0.3429 Round 47876430 to the nearest 1000000. 48000000 Round -0.00001556038 to seven dps. -0.0000156 Round 0.0031920471 to four decimal places. 0.0032 Round 378539.4 to the nearest ten thousand. 380000 Round 39229.07 to the nearest 1000. 39000 Round -3.1656943 to 2 decimal places. -3.17 What is -2303790 rounded to the nearest one hundred thousand? -2300000 Round -0.0322885 to four dps. -0.0323 What is 0.08194413 rounded to 2 dps? 0.08 Round -0.00000525377 to six dps. -0.000005 What is 0.000133545 rounded to 3 decimal places? 0 What is 65784.816 rounded to the nearest 100? 65800 What is -5.983636 rounded to one dp? -6 What is -0.000881663 rounded to 4 decimal places? -0.0009 Round 0.0000002409294 to seven dps. 0.0000002 What is -0.0000007279599 rounded to 7 dps? -0.0000007 What is -0.0207993 rounded to 4 dps? -0.0208 Round -0.002051631 to 6 decimal places. -0.002052 What is 10.02446 rounded to 2 dps? 10.02 What is 0.00000638941 rounded to seven dps? 0.0000064 Round -0.0891555 to 2 decimal places. -0.09 What is 15.2552 rounded to the nearest 10? 20 Round 0.01301216 to three dps. 0.013 What is 0.018868346 rounded to four decimal places? 0.0189 What is -8816380 rounded to the nearest one million? -9000000 Round -41.462402 to 1 dp. -41.5 Round 0.0009508604 to five dps. 0.00095 Round -330.803 to zero decimal places. -331 What is -0.000029696251 rounded to seven decimal places? -0.0000297 Round 130669500 to the nearest one million. 131000000 Round -6641791 to the nearest ten thousand. -6640000 What is 16145.1 rounded to the nearest one hundred? 16100 Round 1.047232 to three decimal places. 1.047 What is 1941.7 rounded to the nearest one thousand? 2000 Round -747262 to the nearest ten thousand. -750000 What is -0.2015863 rounded to 2 decimal places? -0.2 What is -0.0000207478 rounded to 7 dps? -0.0000207 What is 27492400 rounded to the nearest ten thousand? 27490000 Round 0.688785 to 2 dps. 0.69 What is 8954.67 rounded to the nearest 10? 8950 What is -137013.7 rounded to the nearest 1000? -137000 What is -2773.019 rounded to the nearest integer? -2773 What is 3400.53 rounded to the nearest one hundred? 3400 What is 203.9095 rounded to the nearest ten? 200 What is -1406.696 rounded to 0 decimal places? -1407 Round 10.52794 to one decimal place. 10.5 What is 0.0906166 rounded to four dps? 0.0906 What is 17817.737 rounded to the nearest ten? 17820 Round -118896.6 to the nearest ten thousand. -120000 Round 3538.323 to the nearest one hundred. 3500 Round 1462.81 to 0 decimal places. 1463 Round -17529.6 to the nearest one hundred. -17500 Round 0.000004672 to five decimal places. 0 Round -0.00029176177 to six dps. -0.000292 What is -361658000 rounded to the nearest one million? -362000000 Round 136956 to the nearest 100. 137000 What is 0.000108493 rounded to six dps? 0.000108 Round 0.0000026975729 to 7 dps. 0.0000027 What is -0.02508918 rounded to 4 decimal places? -0.0251 Round -18.53021 to 0 decimal places. -19 Round 0.00421778 to three decimal places. 0.004 Round 4978.02 to the nearest one hundred. 5000 What is -1217512 rounded to the nearest 1000? -1218000 Round 92.0287 to the nearest ten. 90 What is -0.002759126 rounded to 5 dps? -0.00276 Round 19737.6 to the nearest 1000. 20000 Round -0.07638048 to 2 decimal places. -0.08 What is 0.000000379 rounded to six dps? 0 What is 2.1092 rounded to the nearest ten? 0 What is 4.427398 rounded to three dps? 4.427 What is -361254.4 rounded to the nearest 100? -361300 Round 0.0868969 to 2 dps. 0.09 Round 531.204 to zero decimal places. 531 Round 115294500 to the nearest one hundred thousand. 115300000 What is 1.99185 rounded to one decimal place? 2 What is -43767500 rounded to the nearest one hundred thousand? -43800000 Round -131.178539 to zero decimal places. -131 Round 735.2929 to 1 decimal place. 735.3 Round 2518.244 to the nearest ten. 2520 What is -1214689.4 rounded to the nearest one thousand? -1215000 What is 0.1036691 rounded to four dps? 0.1037 What is -6471056 rounded to the nearest 1000? -6471000 What is -989188.8 rounded to the nearest one hundred? -989200 Round 0.0004860699 to 6 decimal places. 0.000486 Round -0.000165724 to four dps. -0.0002 What is -0.000238676 rounded to 4 dps? -0.0002 What is 0.0003801982 rounded to five decimal places? 0.00038 Round 4.7116335 to 2 decimal places. 4.71 What is 0.01158479 rounded to 4 dps? 0.0116 Round 22400.96 to the nearest 10. 22400 Round 1498.168 to the nearest 10. 1500 What is 134.94789 rounded to the nearest integer? 135 Round 12452.94 to the nearest 100. 12500 Round -0.2580472 to 2 decimal pl	{ "pile_set_name": "DM Mathematics" }
b? 1/6 Calculate prob of sequence aga when three letters picked without replacement from agvavvvvn. 1/252 Two letters picked without replacement from bhpbhbnbbbpbbb. What is prob of sequence bh? 9/91 Four letters picked without replacement from qawjaaqqatqea. What is prob of sequence qwaq? 1/286 What is prob of sequence tyuo when four letters picked without replacement from {o: 2, g: 2, t: 1, d: 1, u: 1, y: 1}? 1/840 What is prob of sequence pcp when three letters picked without replacement from pcpcppp? 4/21 What is prob of sequence vs when two letters picked without replacement from {g: 2, n: 1, v: 1, m: 2, s: 2}? 1/28 Two letters picked without replacement from {j: 1, r: 2}. What is prob of sequence rj? 1/3 Calculate prob of sequence nf when two letters picked without replacement from {l: 3, n: 1, f: 1}. 1/20 Two letters picked without replacement from {k: 4, q: 1, h: 3}. Give prob of sequence qk. 1/14 What is prob of sequence jxxx when four letters picked without replacement from {j: 4, x: 3}? 1/35 Four letters picked without replacement from {y: 7}. Give prob of sequence yyyy. 1 Two letters picked without replacement from {o: 1, q: 1, a: 1, i: 1, z: 1}. What is prob of sequence qz? 1/20 Calculate prob of sequence wwww when four letters picked without replacement from {w: 4}. 1 Three letters picked without replacement from {m: 1, o: 1, j: 3}. What is prob of sequence jom? 1/20 Two letters picked without replacement from xnnnxn. Give prob of sequence xx. 1/15 Two letters picked without replacement from {g: 2, o: 2, a: 1, v: 1, s: 2}. What is prob of sequence gv? 1/28 Calculate prob of sequence bhp when three letters picked without replacement from hpbpahbap. 1/42 Three letters picked without replacement from sppppspppppspspppsp. Give prob of sequence pps. 455/2907 Two letters picked without replacement from iybjgjayiibibjj. Give prob of sequence yi. 4/105 What is prob of sequence zp when two letters picked without replacement from {a: 1, u: 1, o: 1, z: 2, p: 2, l: 1}? 1/14 Two letters picked without replacement from xxtxxxtttottotzxxx. What is prob of sequence xt? 28/153 Three letters picked without replacement from nnne. What is prob of sequence nne? 1/4 Calculate prob of sequence ooo when three letters picked without replacement from cccoccoocooc. 1/22 What is prob of sequence nzu when three letters picked without replacement from {u: 4, m: 2, k: 1, z: 1, n: 2}? 1/90 Three letters picked without replacement from {d: 2, m: 7, z: 1, k: 1, n: 4}. Give prob of sequence nnd. 4/455 Calculate prob of sequence yujj when four letters picked without replacement from {j: 3, u: 5, y: 3}. 1/88 Four letters picked without replacement from {y: 2, b: 6, z: 5}. Give prob of sequence bzzy. 2/143 Calculate prob of sequence iiww when four letters picked without replacement from iwjjiijwijji. 1/297 Three letters picked without replacement from {d: 9, e: 1, y: 1, s: 3, q: 4}. Give prob of sequence edq. 1/136 What is prob of sequence lq when two letters picked without replacement from {l: 1, j: 1, z: 1, q: 1, e: 1}? 1/20 What is prob of sequence mno when three letters picked without replacement from minsnnommnsn? 1/88 What is prob of sequence ehr when three letters picked without replacement from {h: 1, e: 4, r: 3}? 1/28 Four letters picked without replacement from {e: 4, g: 6}. Give prob of sequence eeee. 1/210 Three letters picked without replacement from jjnj. Give prob of sequence jjj. 1/4 Calculate prob of sequence jp when two letters picked without replacement from cjpcjcjjjjgg. 1/22 Two letters picked without replacement from xhbebiieihhebehxhh. What is prob of sequence xi? 1/51 Four letters picked without replacement from yyyyyy. Give prob of sequence yyyy. 1 Calculate prob of sequence jeje when four letters picked without replacement from jjjjjjjjjejjeej. 11/455 What is prob of sequence xcux when four letters picked without replacement from {u: 2, x: 7, c: 2, q: 1}? 7/495 Three letters picked without replacement from addddddadjbdb. What is prob of sequence jab? 1/429 Calculate prob of sequence gg when two letters picked without replacement from {h: 1, g: 10, i: 2, x: 1}. 45/91 What is prob of sequence en when two letters picked without replacement from {z: 1, n: 3, e: 6, v: 4, g: 2}? 3/40 What is prob of sequence ee when two letters picked without replacement from errwnmnexmxm? 1/66 What is prob of sequence zzz when three letters picked without replacement from {z: 10}? 1 Calculate prob of sequence be when two letters picked without replacement from {e: 2, b: 2, x: 7, j: 1, o: 1, r: 1}. 2/91 What is prob of sequence xt when two letters picked without replacement from {l: 1, t: 1, x: 3}? 3/20 Three letters picked without replacement from wwww. Give prob of sequence www. 1 What is prob of sequence nm when two letters picked without replacement from nnnpnmemenmmnnmnmn? 3/17 Two letters picked without replacement from djmyadry. What is prob of sequence rd? 1/28 Two letters picked without replacement from {s: 1, h: 2, l: 1, q: 2, x: 1, u: 1}. What is prob of sequence xh? 1/28 Three letters picked without replacement from zznovcd. Give prob of sequence dcn. 1/210 Two letters picked without replacement from {o: 3, r: 3, p: 13}. What is prob of sequence op? 13/114 What is prob of sequence nx when two letters picked without replacement from xvvn? 1/12 Calculate prob of sequence sj when two letters picked without replacement from jbjbjsz. 1/14 Calculate prob of sequence bf when two letters picked without replacement from bffbff. 4/15 What is prob of sequence tvj when three letters picked without replacement from {v: 4, j: 2, t: 5}? 4/99 Two letters picked without replacement from wwswgwwww. Give prob of sequence sg. 1/72 What is prob of sequence ttct when four letters picked without replacement from ttttttttttttcccctc? 143/1224 What is prob of sequence qpv when three letters picked without replacement from {q: 4, p: 5, v: 3}? 1/22 What is prob of sequence jbxj when four letters picked without replacement from xbxjxxbj? 1/105 What is prob of sequence rc when two letters picked without replacement from {r: 4, h: 4, d: 1, t: 4, c: 1, p: 1}? 2/105 Four letters picked without replacement from xaaxxxxxaaaaaaabax. Give prob of sequence baaa. 1/102 Calculate prob of sequence ppz when three letters picked without replacement from tczcwcppczpctzc. 3/455 Two letters picked without replacement from kkppk. Give prob of sequence kp. 3/10 Two letters picked without replacement from eeeiewewwweeeeeewei. What is prob of sequence ew? 10/57 What is prob of sequence hhhh when four letters picked without replacement from {t: 5, k: 4, h: 4, a: 1, v: 5}? 1/3876 Four letters picked without replacement from aaakwyayyafa. Give prob of sequence wyfa. 1/660 What is prob of sequence jlkz when four letters picked without replacement from {j: 5, z: 3, l: 1, k: 1, n: 1, f: 1}? 1/792 Two letters picked without replacement from ultttnnnunt. Give prob of sequence nl. 2/55 Three letters picked without replacement from {h: 6, c: 1, i: 2, g: 1, l: 2}. What is prob of sequence icl? 1/330 Three letters picked without replacement from oooo. Give prob of sequence ooo. 1 Calculate prob of sequence hldh when four letters picked without replacement from wrzhzzzrhdrhlzz. 1/5460 Two letters picked without replacement from {o: 1, j: 4, s: 3}. Give prob of sequence js. 3/14 Calculate prob of sequence ssr when three letters picked without replacement from {s: 4, r: 7, m: 4}. 2/65 Calculate prob of sequence exp when three letters picked without replacement from {e: 1, c: 1, g: 1, p: 1, x: 1}. 1/60 Three letters picked without replacement from {y: 3, f: 3, u: 1}. What is prob of sequence yuu? 0 Four letters picked without replacement from {e: 1, l: 4, n: 4, w: 1, p: 2, y: 2}. What is prob of sequence nwle? 2/3003 Calculate prob of sequence wwqr when four letters picked without replacement from wqrw. 1/12 Calculate prob of sequence io when two letters picked without replacement from {i: 1, a: 1, w: 1, j: 2, o: 1, q: 2}. 1/56 Calculate prob of sequence ii when two letters picked without replacement from iiijijji. 5/14 Three letters picked without replacement from {b: 5, a: 7}. What is prob of sequence bbb? 1/2	{ "pile_set_name": "DM Mathematics" }
x - 0x + 15. Let v = 28 + x. What is the remainder when 23 is divided by v? 10 Let y(j) = -2j - 2. Suppose k - v = 5k + 25, 4v + 20 = 0. Suppose 0 = -0l - l + 15. Calculate the remainder when l is divided by y(k). 7 Suppose 0f + 172 = 4f. Let a = 27 - 12. Calculate the remainder when f is divided by a. 13 Calculate the remainder when (-24)/204 - 1056/(-17) is divided by 21. 20 Let o be 1 - 1(0 - 2). Let w = 123 + -74. Suppose -4z = -l - l + 22, -ol + w = -2z. What is the remainder when 37 is divided by l? 18 Let w(d) = 2d*2 - d - 7. Let q(l) = -3l - 8. Calculate the remainder when q(-7) is divided by w(3). 5 Suppose -4q = -194 - 178. Calculate the remainder when q is divided by 12. 9 Calculate the remainder when 124 is divided by ((-21)/2)/(4/(-8)). 19 Let q = 2 - -2. Let n(v) = 4 - v - 6 + q + 6v. What is the remainder when 35 is divided by n(2)? 11 Let u(g) = -4g - 8. Suppose 0 = 2k + 3 + 5, -3k = -5z - 63. Let m = -6 - z. Calculate the remainder when u(-6) is divided by m. 7 Suppose -m + 20 = 3m - w, 0 = -3m + w + 14. Calculate the remainder when 21 is divided by m. 3 Calculate the remainder when 34/3(-24)/(-16) is divided by 7. 3 Let v(h) = 2h*2 - 15h - 13. Calculate the remainder when v(12) is divided by 24. 23 Let c = -9 - -18. Suppose 0 = -2n, -4i + 0n + 2n = -132. What is the remainder when i is divided by c? 6 Let n be 4/((-1)/((-9)/6)). Suppose -36 = 4p - np. What is the remainder when 0 - (0 - 1 - 51) is divided by p? 16 Let t be -2 + 3 - (-3 + 0). Suppose 4s + t = 0, 5z = -s - 4s + 45. Calculate the remainder when z is divided by 7. 3 Let k = -5 + -16. Let n = 47 + k. Suppose -r - 4r + 70 = 0. What is the remainder when n is divided by r? 12 Suppose -3g - 4v = -53, -3g + v = -2g - 6. Let u = -7 + g. Suppose 0 = uy + 14 - 82. What is the remainder when y is divided by 9? 8 Calculate the remainder when (4 + -2)/((-2)/(-19)) is divided by (-7)/((-3)/(-6)-2). 5 Let y be ((-9)/12)/(1/(-4)). Suppose 3b - yn - 57 = 0, 5 = 2b - 4n - 41. Let z(i) = -i + 45. Calculate the remainder when z(16) is divided by b. 14 Suppose 5f - 25 = 0, -3t + 3f + 4 = 1. Calculate the remainder when 143 is divided by t. 5 Suppose -5n + 29 = -41. Suppose 45 = 4v - 175. Calculate the remainder when v is divided by n. 13 Suppose -80 = -5k + 5d, k - 2k + 3d = -10. What is the remainder when k is divided by 7? 5 Let h(m) = 9m - 7. Calculate the remainder when 76 is divided by h(3). 16 Let d(p) = -p3 - p2 + 7. Calculate the remainder when 11 is divided by d(0). 4 Suppose n - 148 = -3n. Suppose -5y + 3 = 3z - 3, -y - 4 = -2z. Suppose s = -5q + 6q - 12, -zq = -s - 25. What is the remainder when n is divided by q? 11 Let i(v) = -3v + 1. What is the remainder when 67 is divided by i(-11)? 33 Suppose -24 = -5u + f + 135, 0 = -5u - 3f + 163. Calculate the remainder when u is divided by 8. 0 Let r(x) = x - 12. Let o be r(6). Suppose 4z + 3y = -2y + 124, 0 = 3z - 3y - 66. What is the remainder when z is divided by (-3)/o(1 + 27)? 12 Let z be (-6)/(-9) - 62/(-6). Suppose 0 = -3f + 4s + z, 0 = 2f + 2s - 0s - 12. Suppose 56 = -a + fa. Calculate the remainder when 41 is divided by a. 13 Let w = -2 - -21. Calculate the remainder when w is divided by 4. 3 Let k(g) = -5g - 21. Calculate the remainder when k(-9) is divided by 13. 11 Let x = -6 + 8. Let w = 33 - x. Calculate the remainder when 59 is divided by w. 28 Suppose -23l + 20l + 270 = 0. Calculate the remainder when l is divided by 23. 21 Suppose -3z + 12 = 0, -2x - z + 3 = -5. Let k be (x/(-5))/((-1)/(-5)). What is the remainder when 46 is divided by k/(-7) - (-220)/14? 14 Let d = 17 + 55. Suppose 3m = -m + d. Suppose -50 = 2f - 7f. What is the remainder when m is divided by f? 8 Let a be 4/(-6)(7 + -1). Let c = a - -13. Suppose -j - 3t = -16, 5j - 31 = -4t + 49. Calculate the remainder when j is divided by c. 7 Let q be 46/(-8) + (-2)/8. Let s be 4/(-10) - q/(-10). Let w = s - -2. Calculate the remainder when 1 is divided by w. 0 Let m = 2 - 4. What is the remainder when 1/(-1) - (m + -5) is divided by (-17)/(-5) + 39/65? 2 Let g = 39 - 20. Calculate the remainder when 35 is divided by g. 16 Let l be 522/(-33) + (-2)/11. Let s = 24 - l. What is the remainder when s is divided by 14? 12 Let j(b) = -9b*3 + 13b*2 + 11b - 88. Let k(l) = 5l3 - 7l*2 - 6l + 44. Let r(c) = -6j(c) - 11k(c). What is the remainder when r(0) is divided by 15? 14 Let f = 142 + -86. What is the remainder when f is divided by 15? 11 Let u(r) = -r*3 + 9r*2 - r + 11. Let k be u(9). Suppose 0 = -kf + f + 25. What is the remainder when f is divided by 9? 7 Suppose -4y + 3j + 44 = 7j, -y + 4j - 4 = 0. What is the remainder when 31 is divided by y? 7 Let h(p) = 2p - 2. Let u(y) = -y3 + 20y*2 + 30y - 177. Calculate the remainder when u(21) is divided by h(3). 0 Suppose 8y + 68 = 12y. What is the remainder when 82 is divided by y? 14 Suppose -5c + 4c + 1 = 0, -5q + c = -104. Let m(p) = -6p*2 + 38p - 1. What is the remainder when q is divided by m(6)? 10 Suppose r + 4 = 10. Let n = 18 - 14. Calculate the remainder when r is divided by n. 2 Let c = -5 + 2. Let j = c - -3. Suppose -5p - s + 2s + 92 = j, 5p - 5s - 100 = 0. What is the remainder when p is divided by 10? 8 Let i(s) = s*2 + 7s - 7. Let o be 3/(6/(-2)) + 7. What is the remainder when i(o) is divided by 24? 23 Suppose 28 - 122 = -2z. Calculate the remainder when z is divided by 10. 7 Let r(a) = -a + 2. Let q(t) = -t + 3. Let w(m) = -2q(m) + 3r(m). What is the remainder when 11 is divided by w(-4)? 3 Suppose -2i + 5i = 5c + 63, -21 = -i + 4c. What is the remainder when i is divided by 4? 1 Let z(u) = u2 - 11u - 2. Let s be z(11). Calculate the remainder when 3/(-1 + s) - -34 is divided by 12. 9 Let b = -7 + 3. Let p be b/(-6)(-15)/10. Let t = 3 + p. Calculate the remainder when 3 is divided by t. 1 Suppose 23 = 3u - 2h, h = -u - 3h - 11. Calculate the remainder when u is divided by 2. 1 Let t = 87 + -78. Calculate the remainder when 16 is divided by t. 7 Let y = 13 - -13. Let i = 3 - 3. Calculate the remainder when y is divided by -1i/(-1) - -7. 5 Let u = 134 + -72. What is the remainder when u is divided by 9? 8 Let g(p) = 3p + 19. Suppose -4r - 3q = -92, -3r - 5q = -101 + 21. Calculate the remainder when g(6) is divided by r. 17 Let x(l) = -l*2 + 10l + 13. Suppose 4b - 8b = -36. Let h be x(b). Let p = h - 16. What is the remainder when p is divided by 4? 2 Let n = 14 + -5. Suppose -3y - n = -4y. Calculate the remainder when y is divided by 5. 4 Suppose 77 = -5y - 3a + a, 5a = 2y + 25. What is the remainder when (-6)/y - (-444)/15 is divided by 16? 14 Let r(y) = -y*3 + 20y*2 - 14y - 17. Calculate the remainder when r(19) is divided by 27. 24 Suppose 2d + 5u + 3 = 0, 5d + u = -17 + 67. What is the remainder when d is divided by 7? 4 Let a(v) = 8v*2 - 2v - 1. Suppose 2d = 3d + 3b - 40, -5b = 5d - 150. What is the remainder when d is divided by a(-1)? 7 Suppose 2h + 975 = 15h. Let j = 9 + 10. What is the remainder when h is divided by j? 18 Let h = 160 - 14. What is the remainder when h is divided by 21? 20 Let m(c) = -c3 - 7c*2 + 9c - 2. Let q be m(-8). Let u be ((-3)/(-5))/((-2)/q). Let g = u + 4. What is the remainder when 13 is divided by g? 6 Let g(c) = -2c2 - c. Let r be g(1). Let k(j) = j + 7. Let l = 156 + -154. What is the remainder when k(r) is divided by l? 0 Suppose 0 = 4w + w - 135. Suppose f = m + 16, 4f = m + 22 + w. Calculate the remainder when f is divided by 6. 5 Let c be (-2)/(-4)0 - -30. Let p = -6 - -14. Calculate the remainder when 11 is divided by (-2)/(-8) + c/p. 3 Let w(t) = 2t2 + 9t + 28. What is the remainder when 93 is divided by w(-3)? 17 Let o(s) = -s*2 + 9s + 2. Let t be o(8). Suppose -5a - 60 = -ta. Suppose -2g + 56 = 12. What is the remainder when g is divided by a? 10 Let q(x) = x2 + 7x + 2. Let z be q(-6). Calculate the remainder when 6(0 - 6/z) is divided by (-2 + 1)/1(4 + -9). 4 Let c(z) = -z*3 - 2z - 2. What is the remainder when c(-3) is divided by 8? 7 Suppose -v + 9 = -f - 5, 5v + 5f - 100 = 0. Suppose -2i - 36 = -6i. Calculate the remainder when v is di	{ "pile_set_name": "DM Mathematics" }
is the tens digit of n? 1 Let x(m) = m*3 + 5m*2 + 5. Let n be x(-5). Suppose -5o - 4v = 3, -n + 2 = -3o - 4v. What is the tens digit of 21 + o/(12/16)? 1 Suppose -456k = -463k + 21462. What is the thousands digit of k? 3 Let g(t) = -3t - 2. Let n be g(-3). Suppose -50 = -ny + 524. What is the units digit of y? 2 Suppose 2312 = 84r - 544. What is the tens digit of r? 3 Let n be 400/(-15)(-3)/2. What is the units digit of (-3 - 0) + 2 + n? 9 Let s be (-2)/63(-2 + -1). Suppose 3c - sf - 10 = 11, 4c = -2f + 34. What is the units digit of c? 8 What is the hundreds digit of (-53022/10)/(162/(-405))? 6 Suppose -1353 - 126 = -3l. What is the hundreds digit of l? 4 What is the hundreds digit of 112825/30 + 4/(-168)-7? 7 Let o be (3 - -129)/1 - 3. Suppose -2y + o + 13 = 0. Let u = y + -33. What is the units digit of u? 8 Suppose 0 = 5c - 1 - 14. Let m be (-2 + c)/(1/2). What is the units digit of (1/m)/(2/140)? 5 Let g(n) = 42n2 + 23n + 29. What is the tens digit of g(-4)? 0 Let a(n) = 3n + 7. Let y be a(9). Suppose 4 - y = -m. Let k = 42 - m. What is the units digit of k? 2 What is the units digit of 508/8 + (-1)/2? 3 Suppose -93g + 92g = -640. What is the hundreds digit of g? 6 Let w be 90/((-2)/(-2)1). Suppose 4c - 81 - 64 = s, -4s = -2c + w. What is the tens digit of c? 3 Let i be (-8)/(-16) + (-7)/(-2). Suppose -y = -6 - i. Suppose y = 4x + 2, 5x + 8 = 3a. What is the units digit of a? 6 Let a = 5 - 0. Let r(u) = -2u2 + 8u + 5. Let g be r(4). Suppose -4n + gl - 2l + 17 = 0, 0 = -an - l + 45. What is the units digit of n? 8 Suppose -4463 = -4t - r, -6218 + 1757 = -4t - 3r. What is the units digit of t? 6 What is the units digit of 2712 - -62/6? 4 Suppose -a + 4 = -0. Let d = 15 - a. What is the tens digit of d? 1 Let m be (-4)/(-6) - 78/(-18). Suppose -78 - 197 = -mb. What is the units digit of b? 5 Suppose 4y + 4d - 22783 = -1735, -15776 = -3y - d. What is the units digit of y? 7 Suppose 2y = 2g - 2538, -y + 0y + 1273 = g. What is the units digit of g? 1 Let w be 28 + 1 + 3/((-6)/4). Suppose 20 = -0j + 4j. Suppose 0 = u - 4l, -2u - jl + 25 = -w. What is the tens digit of u? 1 Suppose 24n + 26949 - 131109 = 0. What is the thousands digit of n? 4 Suppose 2f - 3259 + 403 = 0. What is the thousands digit of f? 1 Let l(s) = 7s2 - 8s - 10. Let b be l(-5). What is the units digit of b + 2 + 9/(-3) + -1? 3 Let f(s) = 243s + 457. What is the units digit of f(12)? 3 Let o be 2/(-4)0 - (-62 + 3). Let z = o + -11. What is the tens digit of z? 4 Suppose 17q = 12q - 350. Let r = q - -170. What is the hundreds digit of r? 1 Let i be -1(-4)/12 + 14/(-6). Suppose -30 = 2l - 7l. What is the units digit of il(-15)/12? 5 Let b = 2220 - 1032. What is the tens digit of b? 8 Suppose -2q - 4 = 42. Let s(v) = -v + 22. What is the units digit of s(q)? 5 Let j = -29 + 69. What is the tens digit of 3424/j + (-6)/10? 8 Let f = -85 + 75. What is the tens digit of ((-52)/8 + -1)f - -3? 7 Let m = -39 - -45. Suppose mr - 38 = 1246. What is the units digit of r? 4 Let p = 734 + -76. What is the tens digit of p? 5 Let v(m) be the second derivative of -m5/20 + m4/4 + 5m3/3 - m2/2 - 16m. What is the units digit of v(4)? 3 Let s(j) = -9j + 2. Suppose 5w = -4f + 5, 12 + 8 = f - 5w. Let z(t) = -t*2 + 5t - 1. Let h be z(f). What is the units digit of s(h)? 1 Let b be ((-9)/(-2))/(6/16). Let n(h) = h*2 - 9h + 4. Let v be n(9). Let c = b - v. What is the units digit of c? 8 Suppose 5r + 2i - 101 = 0, -3r + 37 + 36 = -5i. Suppose -3s - r + 81 = 0. Let f = s + -17. What is the units digit of f? 3 Let k = -4 - -24. Let t = 51 + k. What is the units digit of t? 1 Let h = 26 - 30. What is the tens digit of (-246)/h - (-5)/10? 6 Suppose -2r - 4o + 623 = -627, -4r - 3o = -2490. What is the hundreds digit of r? 6 Let v(p) = 12p*2 - 9p - 63. What is the units digit of v(-8)? 7 Suppose 0 = -4q + 166 - 2. Let z = -32 + q. Suppose zj = 7j + 112. What is the units digit of j? 6 Let g be 0 - (-56 + (-2 - -1)). Let x be 22/99 - ((-5936)/9)/2. Suppose 0 = 7z + g - x. What is the tens digit of z? 3 Let g be 311 - 4/39/(-6). Let b = -189 + g. What is the hundreds digit of b? 1 Let q be 2 + -201 - (-4 - -1). Let u = -59 - q. What is the units digit of u? 7 Let b(h) = 10h*2 - 17h + 9. Let s be b(6). What is the units digit of s/9 + 1 - 1/(-3)? 1 Let f(o) = o*3 + 13o*2 + 10o - 22. Let i be f(-12). Suppose -ip = 4m - 334, 4p + p + 3m = 821. What is the hundreds digit of p? 1 Suppose 3x = 4l + 2491, -2x + 1660 = -3l - 0l. What is the units digit of x? 3 Suppose -5q - 2463 = 2l - 15484, -2q = -4l - 5194. What is the hundreds digit of q? 6 Let a(u) = 2u*3 - 3u*2 - 4u - 2. What is the units digit of a(7)? 9 Suppose 546 = 4w - 3w + 3z, -2w - 4z = -1098. What is the units digit of w? 5 Suppose 45 = 2u - 3u + 4w, -u - 4w = 29. Let k = 46 + u. What is the units digit of k? 9 What is the units digit of (-2409)/(-9) + (-6)/(-18)? 8 Let k(c) = -6c*2 - 2c - 2. Let d be k(-6). Let z be (-4)/14 + d/14. What is the tens digit of (z/(-10))/((-2)/(-28))? 2 Let m(k) = 1959k2 + 4k - 5. What is the tens digit of m(1)? 5 Let n(z) = 104z + 38. What is the tens digit of n(4)? 5 Let w(r) be the second derivative of 20r*3/3 + 9r*2 - 3r - 1. What is the hundreds digit of w(3)? 1 Suppose -3w = -2z + 11019, -27542 = -5z - w + 3w. What is the tens digit of z? 0 Let z(v) = -27v + 8v - 2v3 + 2v*2 + 223 + 10v + 8v. What is the hundreds digit of z(0)? 2 Let k be ((-4)/120)/2. Suppose -7o - 2o + 297 = k. What is the tens digit of o? 3 Suppose -i - 21 = -25. Let m(u) = 2u3 - 5u2 - u - 3. What is the tens digit of m(i)? 4 Let b(c) = -c3 + 10c2 - 8c - 8. Let p be b(9). Let y be (-2)/615/p. Let k = y - -15. What is the tens digit of k? 1 Suppose -3j + 4x - 2 = -3, -2x = j + 3. Let i be (j/2)/(3/(-114)). Let l = i + -4. What is the tens digit of l? 1 Let f(y) = y2 + y + 5. Let p be f(8). Let u = -28 + p. What is the tens digit of u? 4 Let t(w) be the second derivative of -w3 - 3w2 - 9w. Let n be t(-9). What is the tens digit of (-18)/7(-896)/n? 4 Let w(v) = -9v*3 - 6v*2 + 6v + 1 + 4 + 3v3 + 4v*3. Let q be (3/6)/(2/(-20)). What is the units digit of w(q)? 5 Suppose 5c - 3h - 333 - 374 = 0, -3c + h = -425. Let z = c - 96. Suppose 4r - z = 10. What is the tens digit of r? 1 Suppose 0 = 3m - 9 + 3. Suppose 0 = 2t + 10, -5t + 281 = mz + z. What is the hundreds digit of z? 1 Let v = 8 - -118. Let j = v + -9. What is the tens digit of j? 1 Let h(c) = c + 3c - 257c2 - 3 + 267c*2. What is the units digit of h(-3)? 5 Let q = 32 - 16. Suppose 3a - 171 = 2c, a - 5c - q = 28. What is the tens digit of a? 5 Suppose 0 = -i + 9 - 17. Let n = i + 9. What is the units digit of n? 1 Let q = 25 - 22. Suppose -5a = 2m - 266, -qm + 67 = a + 2m. What is the units digit of a? 2 Let y(u) = 2u + 2. Suppose 0 = -4g - 19 + 7. Let a be y(g). What is the units digit of (1/a)/(2/(-104))? 3 Suppose -109c - 1976 = -113c. What is the tens digit of c? 9 Let u be ((-18)/4)/((-6)/8). Suppose -m + 26 = u. What is the units digit of m? 0 Let q(n) = n*3 - 9n*2 - 12n - 10. Let b be q(11). Suppose b = -p + 6p. What is the units digit of p? 0 Let d(z) be the third derivative of -z6/120 + z4/8 - z3/6 + z2. Let k be (-14)/42 + (-12)/(-3). What is the tens digit of d(k)? 1 Let o be (-1)/(9/2) - (-1645)/(-9). Let w = o + 283. What is the units digit of w? 0 Let w(s) = -s*3 - 3s*2 + 6s + 15. What is the tens digit of w(-8)? 8 Let h = 10 + -64. Let r = h + 64. What is the units digit of r? 0 Suppose -i - 9d + 7d = -801, -2i - 5d = -1606. What is the units digit of i? 3 Suppose -4i + 7642 = 5s, -3816 + 11440 = 5s - 2i. What is the hundreds digit of s? 5 Suppose -1 - 7 = -t - 4f, 2t + 5f = 10. Suppose -28w + 288 = -300. Let h = w - t. What is the units digit of h? 1 Let m = -42 + 46. Suppose c - 5 = mo + 35, -c - o = -25. What is the tens digit of c? 2 Let i(x) be the second derivative of x4/4 - 4x3/3 + x2 + 3x. What is the tens digit of i(-4)? 8 Suppose 0 = 4s - 327 - 1629. What is the units digit of s? 9 Suppose 9*m + 51	{ "pile_set_name": "DM Mathematics" }
(a) 39 (b) -1/3 (c) 5 (d) 0 d What is the closest to 6 in -3, 0.3, -1/2? 0.3 Which is the closest to -3? (a) 5 (b) 0 (c) 7 (d) -2 d What is the nearest to 0.8 in -2.6, -0.4, 1/12? 1/12 Which is the closest to -145? (a) 1/2 (b) 0.07 (c) -0.2 c What is the closest to -4 in -0.4, -1, -113? -1 Which is the nearest to -11? (a) 1/6 (b) -5 (c) 1 b What is the nearest to 0 in 3, 10, 5, 0? 0 What is the nearest to 0.1 in 1/2, 3, 0.0798, 0.4? 0.0798 Which is the closest to -1? (a) 2 (b) -2/95 (c) -0.1 c Which is the nearest to -6/11? (a) -0.08 (b) -3 (c) 0 a Which is the nearest to -1.19? (a) 5 (b) 4/3 (c) 1/3 c What is the nearest to 0 in -0.007, -1/2, -2, 3? -0.007 Which is the nearest to -3? (a) 4 (b) 2/15 (c) -0.4 c Which is the nearest to 2/5? (a) -37 (b) 2/3 (c) -0.4 (d) -1 b What is the nearest to -11/4 in -1/3, 5, -1/2, 2? -1/2 Which is the nearest to -2? (a) -0.06 (b) -0.5 (c) -2/17 (d) 2/7 b Which is the closest to 5? (a) -26 (b) 0.1 (c) -2/13 (d) -1 b What is the nearest to -15/8 in -0.2, 0.04, -2/3? -2/3 What is the closest to -3/7 in -3, 0, 5/3? 0 Which is the nearest to -2? (a) 2 (b) -1 (c) 1 b What is the nearest to 1 in -1/5, 3, 2/11, 0.12? 2/11 What is the closest to -2/3 in -17, 1/11, 6? 1/11 What is the closest to -6/11 in 4/9, -2/3, 4? -2/3 Which is the closest to 0? (a) 2/9 (b) -44 (c) -2/11 (d) -4 c What is the closest to 1 in 2, -0.1, 8, -2/11? 2 What is the nearest to 0 in 0.05, -0.3, 0.4, -0.2? 0.05 Which is the nearest to -2/3? (a) 0 (b) 1/2 (c) -1/5 c Which is the closest to 0.1? (a) 3/5 (b) 5 (c) 1666 a Which is the closest to 0? (a) 5 (b) 0.4 (c) 1 b Which is the closest to -0.1? (a) 0.8 (b) 5 (c) -5/2 a What is the closest to -1 in 2/11, -11, -4/7, 2? -4/7 What is the nearest to 0 in 0.073, -3, 4/9? 0.073 Which is the closest to 0? (a) 3 (b) 1/4 (c) 0 c What is the closest to -2/7 in 0.2, -4, -8, 2? 0.2 Which is the nearest to -0.18? (a) 0.03 (b) 0.1 (c) -9 (d) 4 a What is the closest to 17 in -1, 3, -0.6, 2? 3 What is the nearest to 0.2 in -18, -4/13, 3, -5? -4/13 Which is the closest to -1/4? (a) -0.2 (b) -6/11 (c) 11 a What is the closest to -2 in 2/107, 10, -0.2, 3? -0.2 What is the closest to -2 in 8, 0.06, -5, -0.1? -0.1 What is the closest to 2/5 in 2.3, 5, 6, 2? 2 Which is the closest to 422? (a) 4 (b) 1 (c) 2/13 a Which is the closest to -0.1? (a) -1 (b) -0.227 (c) 0.1 (d) -3 b What is the nearest to 0 in 0.0559, 0.2, -4, 0.3? 0.0559 Which is the nearest to 8? (a) 0.737 (b) -2/15 (c) 2 c Which is the nearest to -3? (a) -4/3 (b) -2/3 (c) -5 (d) -3 d Which is the nearest to -0.2? (a) -1/4 (b) -2 (c) 0.2 (d) 120 a Which is the nearest to 2? (a) -6 (b) 0.5 (c) 2/9 (d) 1/3 b What is the nearest to -1/2 in -2/5, -5/4, -9, -1? -2/5 Which is the closest to -3/22? (a) 0 (b) -1/5 (c) 4 b What is the closest to -0.3 in 2, -0.4, -0.6, 14? -0.4 What is the closest to 1 in -5, 9/40, 1? 1 Which is the nearest to 0.1? (a) -2/7 (b) 4 (c) 0.3 (d) 1/5 d What is the nearest to 1 in 5, -3/8, 3, 2? 2 Which is the closest to -28? (a) -1 (b) -0.13 (c) 5 a Which is the nearest to 2/9? (a) 20/19 (b) 5 (c) -5 a What is the nearest to 0 in -2/7, 0.3, -70? -2/7 What is the closest to 2 in 0.2, -1, -0.5, 0.05? 0.2 What is the closest to -1/3 in 810, 3, -0.1? -0.1 What is the closest to 1/4 in -2, 6, -1/9? -1/9 Which is the closest to -2/7? (a) -0.2 (b) -4/7 (c) 58 a What is the nearest to -2/13 in -2/5, -3/5, 11? -2/5 What is the closest to 0 in 0, 2, 1/5, -8? 0 Which is the nearest to 18? (a) 5 (b) 4 (c) 3/8 (d) 3 a Which is the nearest to 1? (a) -5 (b) -1/9 (c) 1 (d) -1 c Which is the nearest to 0? (a) -12 (b) -5/6 (c) -0.4 (d) 2/7 d Which is the closest to -1/2? (a) 0.06 (b) 5 (c) -0.5 c What is the nearest to 2.4 in -2, 3, -9, 0.4? 3 What is the nearest to 0 in -0.4, -4, 42/5? -0.4 What is the closest to 0.1 in 1, -5/3, -1/12? -1/12 Which is the nearest to 1/3? (a) -4/7 (b) -1/19 (c) -1/6 b Which is the closest to 1? (a) -2/9 (b) -4 (c) 4 (d) 7 a Which is the nearest to 2? (a) 1/3 (b) -3/2 (c) 2 c What is the nearest to 2/9 in 1, 0.2, -0.02, 5? 0.2 Which is the nearest to -2/5? (a) 0.03 (b) -0.02 (c) 3/5 (d) 12 b What is the nearest to 3 in 0.5, -0.1, 1, -0.032? 1 Which is the nearest to 1? (a) 3 (b) 3/13 (c) 2/7 (d) 0.1 c Which is the nearest to -2/13? (a) -22 (b) 1 (c) 0.1 (d) 2 c Which is the nearest to -2/7? (a) 0 (b) 2 (c) -0.2 c What is the nearest to 11 in 2, 1, 0.3? 2 Which is the nearest to 0? (a) -1/2 (b) 3/2 (c) 1 (d) 0.03 d Which is the nearest to 13/15? (a) 4 (b) -0.2 (c) 0.5 c Which is the closest to 4? (a) -1/3 (b) -0.5 (c) 0 c Which is the nearest to -2? (a) -0.2 (b) -1 (c) 5 (d) 0.4 b What is the nearest to 182 in 2/13, 1/3, 0.1? 1/3 What is the nearest to -1 in -10, -0.016, 0.2? -0.016 What is the closest to -2.7 in 1, 2/39, 0.4? 2/39 What is the nearest to 1/23 in -2, 2/3, 4, -4? 2/3 Which is the nearest to -1? (a) 0.4 (b) -6/13 (c) 0.1 (d) 2/7 b Which is the nearest to 0.2? (a) -23 (b) -93 (c) 1/5 (d) -0.3 c What is the closest to -1.5 in -0.3, -0.5, 11? -0.5 What is the nearest to -5 in -0.028, 5, 4? -0.028 What is the closest to -15 in -1/6, 2, 2/3, -0.25? -0.25 What is the closest to -2/7 in -1, -25, 0.02, 0.5? 0.02 Which is the closest to -0.2? (a) 5 (b) -0.5 (c) 0.3 (d) -4 b Which is the nearest to 3? (a) -3/5 (b) -0.13 (c) 3 c What is the nearest to 2 in -1/5, -14, 2/15, -3? 2/15 Which is the nearest to 0.249? (a) -2/3 (b) -1/2 (c) -0.4 (d) 0 d What is the closest to 2/7 in -2/17, 0.66, 25? 0.66 What is the closest to -0.1 in -2, -0.12, 0, -4? -0.12 What is the closest to -66 in -5, 1/7, 0? -5 Which is the nearest to 2/9? (a) -2/5 (b) -2 (c) 2 (d) 0 d Which is the nearest to -1? (a) -246 (b) 3/4 (c) -2 c What is the closest to 3 in -4, 3, -2? 3 Which is the nearest to 2/9? (a) -7 (b) -0.5 (c) 0.2 (d) 2/3 c Which is the closest to -2/11? (a) 0 (b) 0.3 (c) -3 (d) -0.4 a What is the closest to 0.4 in 1, 0, -2/17, -3? 0 Which is the nearest to -2/5? (a) -4 (b) 4 (c) -6 a What is the nearest to -2 in 6, 0.049, 0.04? 0.04 What is the nearest to 4 in 2/5, 2, -1, 3? 3 Which is the closest to 0? (a) 5 (b) -3 (c) 0.6 (d) 4 c What is the nearest to -2/27 in 2/17, 0, 1/5, 0.3? 0 What is the closest to -2 in -0.1, 1, -15? -0.1 Which is the closest to -1/7? (a) 2/5 (b) 2/11 (c) -0.2 c Which is the closest to -0.1? (a) 0.62 (b) -2 (c) -3/2 (d) 1/8 d What is the closest to 1 in -0.1, -0.2, 3, 14? -0.1 Which is the nearest to 0.6? (a) 1/5 (b) -189 (c) 4 a What is the nearest to 0 in 15, -6/5, -1/3, 31? -1/3 Which is the closest to -1/3? (a) -3/4 (b) 5 (c) -3/2 a What is the nearest to 0.06 in 2/9, -1/4, 5? 2/9 What is the nearest to -1 in -2/15, 0.2, -2, -2/71? -2/15 Which is the closest to 0.054? (a) -5 (b) 0 (c) 36 (d) -0.5 b Which is the closest to -4? (a) 0.3 (b) -1/4 (c) -1/2 (d) -2/381 c Which is the closest to 70? (a) 2 (b) -2 (c) 5 c Which is the closest to -0.1? (a) -3 (b) -2/5 (c) 0.4 (d) 0.09 d What is the nearest to -2 in 0.3, 0.02, -3/4? -3/4 Which is the closest to -0.1? (a) 2/9 (b) 6 (c) 4 a What is the closest to 0.1 in 1/50, 72, -4? 1/50 Which is the nearest to 0.1? (a) -32 (b) 7/2 (c) -4/5 (d) -1/7 d Which is the nearest to -2? (a) -4 (b) 3 (c) 8 a What is the nearest to 0.1 in 1/3, 1/8, -2/3, -2/11? 1/8 What is the closest to 1/3 in 0.1, -0.3, -1/2, -7/5? 0.1 What is the closest to -2/5 in 2, 0.2, -1/75? -1/75 What is the closest to -2 in -11, -5, -0.5, 0? -0.5 Which is the nearest to -0.1? (a) -0.4 (b) -5 (c) 3/4 (d) -0.03 d Which is the closest to 0.23? (a) 0.2 (b) 2/7 (c) -5 a What is the nearest to 1/4 in 1, 2.2, 0.4? 0.4 What is the nearest to 4/5 in 2/19, -147, -2/11, 3? 2/19 What is the closest to -0.2 in -2, -0.4, 0.5, 0.9? -0.4 What is the nearest to 2 in 1, 8, -13? 1 What is the nearest to 0 in -9, -1/10, -1, 14? -1/10 What is the closest to 2/15 in 4/5, 2, -5? 4/5 What is the nearest to -73 in 1/2, 1/9, -1, 7? -1 What is the nearest to -16 in 0.7, 1/3, -1/6? -1/6 What is the nearest to 0 in -5, 0.1, 3? 0.1 What is the closest to -0.1 in 0.36, -0.5, -0.05?	{ "pile_set_name": "DM Mathematics" }
- 1 Let p(j) = -5j2 + 6j - 4. Let x(r) = 13r - 9. Determine -5p(c) + 2x(c). 25c*2 - 4c + 2 Let p(c) = -5c3 + 22c - 27. Let l(n) = -24n3 + 110n - 126. What is -6l(b) + 28p(b)? 4b3 - 44b Let t(r) = -r*3 - 3r*2 + 3r - 2. Let w(n) = 3n3 + 75n*2 - 17n + 8. What is 5t(j) + w(j)? -2j*3 + 60j*2 - 2j - 2 Let x(s) = 2s2 + 4s + 4. Let z(d) = d*2 + 3d + 3. Let r = -190 + 154. Let v be r/27(1 + -4). Let g = 8 - 11. Determine gx(c) + vz(c). -2c*2 Let d(l) = 5l*2 - 180l + 4. Let f be d(36). Let i(m) = 5m + 31. Let b(a) = a. Give fb(n) - i(n). -n - 31 Let z(n) = -6n + 273. Let d(x) = 30x - 1368. Calculate 2d(t) + 11z(t). -6t + 267 Let q(h) = 4h + 6. Let w(l) be the second derivative of l*3/2 + 5l*2/2 - 63l. Let p be (26/(-78))/(((-14)/36)/(-7)). Give pw(t) + 4q(t). -2t - 6 Let o(r) = -99932r*2 - 75r - 50. Let i(m) = -24982m2 - 18m - 12. Give 25i(s) - 6o(s). -24958s2 Let w(l) = 3l + 8. Suppose -9 = 5d - f, -338d + 334d = 5f + 42. Let m(s) = s + 1. Give dw(k) + 24m(k). 15k Let b(k) = -14k*2 + 2381k. Let d(r) = -39r2 + 7145r. Give -11b(q) + 4d(q). -2q2 + 2389q Let p(s) = -4s - 5. Let d(h) = -3h*2 - 8h - 14. Give -3d(z) + 8p(z). 9z2 - 8z + 2 Let w(v) = 6v - 9. Let l(h) = h2 + 13h + 26. Let r be l(-10). Let f(c) = -3c + 14. Let j(i) = -3i + 17. Let u(x) = rf(x) + 3j(x). Give -7u(q) + 4w(q). 3q - 1 Let w(z) = 28z*2 - 31z + 5. Let o(l) = 58l2 - 67l + 11. Determine -6o(q) + 13w(q). 16q2 - q - 1 Suppose -2176 = -51w + 47w. Let i(c) = c - 2c + 2c - 545 + w. Let b(y) = -5. What is -b(h) + 5i(h)? 5h Let n(b) = -b2 - 41 - 2b + 118 - b - 98. Let o(d) = d*2 + 2d + 21. What is 2n(i) + 3o(i)? i*2 + 21 Let l(z) = -3z*2 + 681z - 4. Let r(x) = 5x2 - 1351x + 7. What is -7l(p) - 4r(p)? p*2 + 637p Suppose 10t = 129 + 81. Suppose -t = -15b + 84. Let q(s) = 4s + 1. Let a(c) = 7c + 3. Calculate bq(w) - 3a(w). 7w - 2 Let n(r) = -4r*2 + 2r + 3. Let u = -8 + -3. Let p(a) be the third derivative of -7a5/20 + 11a*4/24 + 8a*3/3 + 180a*2. Give un(k) + 2p(k). 2k*2 - 1 Let n(t) = 82t + 6. Let r be n(13). Let v be (-4)/14-1 - r/469. Let o(q) = -21q*2 + 6q. Let h(l) = -4l2 + l. Give vo(d) + 11h(d). -2d*2 - d Let r(c) = 11c*3 - 174c*2 - 2c - 3. Let j(d) = 19d3 - 347d*2 - 5d - 8. Calculate -2j(p) + 5r(p). 17p3 - 176p*2 + 1 Suppose 15 - 41 = 6f - 32. Let g(y) = y3 + y2 - y + 1. Let q(d) = -24d3 - d2 + d - 1. Calculate fq(w) + g(w). -23w3 Let z(v) = -1517v*2 - 8v + 25. Let w(y) = -504y2 - 3y + 9. Determine 8w(q) - 3z(q). 519q2 - 3 Let j(s) = -10s*3 + 4s*2 + 48s + 3. Let u(i) = -6i3 + 3i*2 + 49i + 2. What is 2j(h) - 3u(h)? -2h3 - h2 - 51h Let d(h) = -85h3 + h2 + 12h - 1. Let b(s) = -s3 - s2 - 9s + 1. Give b(k) + d(k). -86k*3 + 3k Let z(l) = 4l - 3. Let y(m) = 28m - 38. Determine -y(b) + 3z(b). -16b + 29 Let u(i) = -3i - 5. Let t(w) = -w3 + w + 1. Suppose k + 17 = 20. Suppose -5r = -kc - 11, -3r + 14 = -2c + 8. Give ct(x) + u(x). -3x3 - 2 Let o(l) = -7l*3 - 5. Let u(j) = -18j3 - 12. Let p(k) = -k2 - 15k + 4. Let t be p(-17). Let z be (74 - 78)(t/8)/3. Determine zu(a) - 12o(a). -6a3 Let g(f) = -11f*2 - 14f + 11. Let v(p) be the third derivative of -p*5/15 - 5p*4/24 + 2p*3/3 - 2147p*2 + 1. Calculate 3g(i) - 8v(i). -i2 - 2i + 1 Let k(f) = -f3 + f2 + f + 1. Let o(y) = 6y3 - y2 - 5y - 5. Let t(s) = -s*2 + 41s - 200. Let g be t(35). What is gk(j) + 2o(j)? 2j3 + 8j*2 Suppose -28c + 165 = 27c. Let n(h) = -h - 5. Let l(f) be the first derivative of -6f - 12. Calculate cn(a) - 2l(a). -3a - 3 Let d(y) = -y3. Let x(b) = -6 - 3b + 3b - 20 + 19 + 8 + 5b*3. Suppose 4w - 6w = -2. Determine wx(n) + d(n). 4n3 + 1 Let p(u) = 3u + 7. Let x(w) = -4w - 3. Calculate 6p(r) + 13x(r). -34r + 3 Let x(n) = 24n - 11. Let h(g) = -11g + 5. Let f(o) = 13h(o) + 6x(o). Let a(b) be the first derivative of -b - 2. Calculate 6a(s) - 2f(s). -2s - 4 Let f(k) = -968k*2 + 13. Let w(v) = -967v*2 - v + 18. Calculate -4f(x) + 3w(x). 971x*2 - 3x + 2 Let c(n) = 41n2 - 3n - 3. Let w(z) be the second derivative of 27z4/4 - 5z*3/6 - 5z*2/2 + 416z + 4. Give -5c(j) + 3w(j). 38j2 Let p(r) = 7 - 51 + 8r + r*2 + 9 + 16 + 9. Let a be p(-8). Let h(d) = -4d*3 + 10d + 10. Let m(v) = -v*3 + 3v + 3. Give am(j) + 3h(j). -2j3 Let d(s) = -3s*2 - s - 4. Let t(g) = -21g*2 + 7g + 29. Give 5d(f) + t(f). -36f*2 + 2f + 9 Let r(n) = 1302n3 - 5n*2 + 10n + 3. Let w(v) = 1953v3 - 7v*2 + 14v + 4. Give 7r(f) - 5w(f). -651f3 + 1 Let d(v) = 14v - 8. Let j(x) = 125x - 6. Let f(c) = 104c - 5. Let k(g) = 6f(g) - 5j(g). Calculate -d(n) - 12k(n). -2n + 8 Let p(i) be the first derivative of -7i3/3 - 5i*2/2 - 11i + 1191. Let s(k) = -11k2 - 8k - 17. Determine 8p(m) - 5s(m). -m*2 - 3 Let c(m) = 30m3 + m2 - 5. Let f(s) = 319. Let n(z) = 80. Let o(i) = f(i) - 4n(i). Calculate c(l) - 5o(l). 30l3 + l2 Let f(w) = -9w*2 + 2w + 14. Let j(v) be the second derivative of 5v4/12 - v3/6 - 7v*2/2 + 1105v. Calculate -6f(c) - 11j(c). -c*2 - c - 7 Let f be -4 + ((-20)/25)/4 + 114/(-30). Let m(h) = 4h + 5. Let a(u) = u + 2. Give fa(x) + 3m(x). 4x - 1 Let d(w) be the first derivative of -2w*3 - 2w + 1667. Let k(q) = -30q2 - 11. Give -22d(f) + 4k(f). 12f*2 Let d(y) = -8 + 261y*2 + 213y*2 - 472y*2 - 3y + 4y. Let z(k) = k2 + k - 7. Give -4d(r) + 6z(r). -2r*2 + 2r - 10 Let o = -38 - -44. Suppose 0 = 11r - or + 20. Let k = r - 1. Let d(q) = 3q + 7. Let s(t) = -3t - 6. What is ks(p) - 4d(p)? 3p + 2 Let q(i) = 15i*2 - 10i + 2. Let m(t) = 2t2 + 2t + 1. Determine 6m(y) + q(y). 27y*2 + 2y + 8 Let y(g) = 4g3 - 5g - 8. Let r(q) be the first derivative of 3q4 - 7q*2 - 23q + 1329. Give -6r(h) + 17y(h). -4h3 - h + 2 Let t(r) = 23r*3 + 13r + 9. Let a(q) = -12q3 - 6q - 4. Let g be (130/(-20))/((-8)/(-18 + 2)). What is ga(f) - 6t(f)? 18f3 - 2 Let z(c) be the second derivative of -11c + 3/2c3 + 1 - 1/2c*2. Let p(s) = -13s + 1. What is 5p(u) + 7z(u)? -2u - 2 Let n(z) = 11z + 11. Let b(v) = 18v + 18. Let i(h) = 3b(h) - 5n(h). Let r(g) be the third derivative of g4/4 + 5g3/6 - g2. Give 33i(m) + 6r(m). 3m - 3 Let q(n) = -n2 + 2n. Let x(c) = 9912c2 - 6608c. What is -3304q(j) - x(j)? -6608j*2 Let s = -598 + 1060. Suppose s = -3d + 501. Let o(p) = p - 9. Let k(q) = -q + 4. Give dk(z) + 6o(z). -7z - 2 Let g(r) = -159r*3 - 9r2 - 3. Let c(z) = z3 + 3z2 - z + 2. Calculate -2c(y) - g(y). 157y3 + 3y*2 + 2y - 1 Suppose 168a - 108 = 204a. Let k(f) = 14f - 1. Let g(y) = -y. Calculate ag(p) - k(p). -11p + 1 Let o(b) = -17b - 2099. Let c(a) = 10a + 1397. Give 8c(i) + 5o(i). -5i + 681 Let y(v) = 61v2 - 6v - 21. Let k(a) = 81a2 - 7a - 22. Determine 3k(i) - 4y(i). -i*2 + 3i + 18 Let j(o) = 30961o - 247700. Let a be j(8). Let d(r) = r - 1. Let f(b) be the second derivative of b3/6 - 3b*2/2 - b. Calculate ad(y) + 4f(y). -8y Let x(z) = 12z3. Let h(l) = l3 - 9l*2 + 16l + 14. Suppose 6 = 133o - 132o. Let g be h(o). Let d(i) = 3i3. What is gx(w) - 9d(w)? -3w*3 Let c(d) = -2d*3 + 7d*2 + 3d + 3. Suppose -5v - 7i + 6i + 16 = 0, 0 = -3v + 7i + 2. Let n(o) = 6o*3 - 20o*2 - 8o - 8. Calculate vn(z) + 8c(z). 2z3 - 4z*2 Let r(v) = 17822v. Let f(s) = 21733929s. Calculate -5f(q) + 6097r(q). -8911q Let m(o) be the third derivative of o4/12 + o3/2 - 3o2. Let z(k) = 515k + 10 + 515k - 1024k. Suppose -8 = d + 2. What is dm(f) + 3z(f)? -2f Let r(h) = 24h*3 + 45h*2 - 26. Let a(f) = -24f*3 - 43f*2 + 22. What is -6a(y) - 5r(y)? 24y*3 + 33y*2 - 2 Let v(b) = 2b3 - b2 + 12b. Let f(p) = -24p*3 + 8p*2 - 121p. Calculate -f(j) - 8v(j). 8j*3 + 25j Let z(b) = b - 1. Suppose -5 = -2a - 3. Let d(k) = 14k - 3. Let g = -44977 - -44974. What is ad(w) + gz(w)? 11w Let q(j) = 21j*2 + 26j + 10. Let k = 64 + -60. Let o be -6 - k - (2 + (-3 - -2)). Let x(m) = 4m*2	{ "pile_set_name": "DM Mathematics" }
- 5d2). -185d*4 Expand (3426t - 1947t + 8379t)(-t - 2t + t). -19716t2 Expand 5f*3 - 5f3 + f3 + (f + 2f - f)(-2f2 + 0f*2 + 0f*2 + (3 - 3 + f)(-4 + 4 - 2f) + f2 + 3f - 3f + 2f - 420f2 + 0f - 475f2). -1795f*3 + 4f*2 Expand (-3p - p*4 + 3p)(1067 + 2770 - 136). -3701p*4 Expand (128 + 170 - 24 + 2j)(-4j*2 + 5j*2 + 2j*2 + (-2 - 1 + 5)(-3j2 + 2j*2 + 3j*2)). 14j*3 + 1918j*2 Expand 3a - 2a - 3a - 3a + 6a - 2a - 5 - a + 5 + (2 + 2 - 6)(3a + a - 2a) - 2a + 4a - 3a - 144a + 69a + 78a + 1. -4a + 1 Expand (0t + 5t - 3t)(7t*3 + 6t*3 - 6t*3)(-65t + 95 - 95). -910t*5 Expand (2 - 3 + 0)(-3 + 3 - 3d + (18d + 44 - 44)(-10 - 7 + 13))(-56d3 + 94d*3 - 75d*3). -2775d*4 Expand (-2044x*2 + 3x - 4x + 4208x*2)(-2 + 2 - 1). -2164x2 + x Expand (-4r + r + r)(4 - 4 + r) - r - r2 + r + 2r*2 + r - r + 101 - 21r*2 - 101 + 2r + 2 + 0r2 + r2 - r. -21r*2 + r + 2 Expand (1 + 3 - 1)(2s4 + s4 - 2s*4) + 4 + 9s + 11 - 8s + 7s*4 + 2s*2. 10s*4 + 2s2 + s + 15 Expand (w2 + 0w2 - 3w*2)(-2w + 1 - 1) + 23 - 5w*3 - 23 + 0w*3 + 3w*3 - 5w*3 - 3w3 - w2 + w*2. -6w*3 Expand (-157 - 47 - 6)(-2 + 3y - 8y + 1) - 3y - y - 8y - 3y. 1035y + 210 Expand -3r3 + 4r*3 - 3r*3 + (-2r*2 - 4r*2 + 2r*2)(5r - 3r - 3r) - 26r*2 - 5r*3 + 43r*2 - 12r*2. -3r*3 + 5r*2 Expand (3g3 + g3 - 3g3 + (3g - 2g + 3g)(g2 + 2g*2 - 2g*2))(142g2 - 80g*2 - 78g*2). -80g*5 Expand (3 - 2 - 6 + (1 + 2 - 2)(-2 + 2 + 2)(2 + 1 - 2))((-8 + 7 + 10)(0z + 3z + 176z) + (-2z + 0 + 0)(-2 - 5 + 5)). -4845z Expand -92782p + 92782p + 429p*2 + (-2 + 3 + 0)(-p + 2p2 + p) + 4p*2 - 5p + 5p. 435p*2 Expand 6d5 - d5 - d*5 + (31d*5 + 11d*5 - 8d*5)(7 - 1 + 2) - 5d + 5d + d*5. 277d*5 Expand (872x - 59x + 147x - 109x)(5 + 0 - 4)(-1 + 4 - 2). 851x Expand (-678v - 268 + 268)(-5v2 + 1 - 2 + v2). 2712v*3 + 678v Expand (-3476j2 + 5704 - 5704)(-2j2 + 2j - 2j). 6952j*4 Expand (-50 + 115 - 25)(-71 + 47i3 + 71). 1880i*3 Expand (-25k + 2 - 2)(-5 + 3 - 2)(0 - 6 + 1). -500k Expand (3 - 5 + 3)(2c + 2c - 2c)((-2c + 9c - 2c)(0 + 5 - 3) - 2c - 47c - 171c). -420c*2 Expand (3 + a - 3)(0 + 2 - 4) - 5524a + 83a - 4343a - 7251a. -17037a Expand (6811z*5 + 1374599z*4 - 1374599z*4)(2 + 1 - 2 + 1 + 4 - 7 + (0 - 5 + 3)(-3 + 0 + 2)). 6811z*5 Expand (-3y + 0y + 6y)(1287 - 41 - 466)(0 + 0 + 3y). 7020y*2 Expand -1070 - 86b*4 + 1050b*4 + 1107 + 26b*4 + (4b*2 - 4b*2 + 2b*2)(1 - 1 - 2b2). 986b*4 + 37 Expand (2l*2 + 3l*2 - 2l*2)(-l + 2l - 4l)(1 - l - 1 + (3l - 6l + 4l)(2 + 1 - 4))(l + l + 3l)(-24 - 18 + 12). -2700l5 Expand (-x2 - 5x*2 + 2x*2)(2x + 3x - 3x) + 2x3 - x3 - 2x3 - 2x3 + x3 + 4x3 + (-3x - 3x + 5x)(2x*2 + 2x*2 - 3x*2). -7x*3 Expand (0f*5 + 2f5 - f5)(-44 + 19 - 139)(-3 - 2 + 2). 492f5 Expand i + 5i - 4i + (2i + 0 + 0)(2 - 1 - 6) + (1 + i - 1)(-3 + 71 + 11). 71i Expand (-100g - 99g + 228g)(-3 - 2 - 2)(g*3 - 4g*3 - 3g*3). 1218g4 Expand -x3 + 5x3 - 5x*3 + (-3 + 2 + 0)(-9x3 + 13x*3 + 2x*3)(4 + 20 + 2). -157x3 Expand (m3 - 5m - m - 7m)(13m - 21m - 16m)(-m + m + 2m). -48m*5 + 624m*3 Expand (-258d + 80d + 23 + 84d + 81d)(2 - 1 + 2 + (0 - 5 + 3)(-2 + 1 + 3)). 13d - 23 Expand 24d4 - 17d*4 - 11d*4 + 0d*3 + 2d*4 + 0d*3 + (-7d + 4d + d)(-2d3 + 3d*2 - 3d*2) - 3 + 3 + 5d*4 - 70 + 78d*4 + 70. 85d*4 Expand (4 - g - 4)(4 + 3g2 - 4)(-1073g + 2 - 1103g + 2194g). -54g*4 - 6g*3 Expand (-65030v + 32007v + 31955v)(-4 - 3 + 5) - 5v + 2v + 4v + (-1 + 5 - 5)(-3 - 8v + 3). 2145v Expand (14n*2 + 5n - 5n + (-1 - 3 + 2)(-5n2 + 2n*2 + 2n*2) - 239n*2 + 173n*2 + 367n*2)(0n + 0n - n). -317n3 Expand (0l + 0l - l + 2)(-101l2 - 15l*2 - 13l*2). 129l*3 - 258l*2 Expand (-2 + 2 - 3)(182d3 - 233d*3 - 246d*3) + 2d*3 - 3d*3 - 2d*3 + (-4d*2 + 0d*2 + 3d*2)(d + 3d - 3d). 887d3 Expand (0 - 1 - 2)(-2l - 15 + 5 - 31). 6l + 123 Expand 7x - 3x - x + (-x + 8x - 2x)(-1 - 3 + 2) + 5x - x + 19 - 3x. -6x + 19 Expand 6r - 4r*2 - 6r - r*2 + 4r*2 - 2r*2 + 3r*2 - 4r*2 + 3r*2 + (-3r*2 - 3r + 3r)(2 - 5 + 1) + 4r - 4r + 2r2 - r2 - 6r*2 + 2r*2. 2r*2 Expand -2v3 - v5 + 2v3 + (-375v*4 + 252v*4 - 370v*4)(2v + 2 - 2). -987v*5 Expand (-3 + 68 + 44)(-y3 - y3 + 0y3) + (-2y*2 - 2y*2 + 6y*2)(2y - 4y + 4y) - 3y*3 + 3y3 + y3. -213y3 Expand (-780g*2 - 8 - 785g*2 + g + 1553g*2)(0g2 + 0g*2 + 2g*2). -24g*4 + 2g*3 - 16g*2 Expand (0 - 18891r + 18902r - 2)(-95r + 85r - 3 + 53r). 473r*2 - 119r + 6 Expand -61j4 - 54j*3 + 54j*3 + (2j + 2 - 2)(-4j*3 + 3j*3 + 0j*3) - 4j*4 + 0j*4 + 5j4 - j4 - j*4 + 4j*4. -60j*4 Expand ((-2r + 4r + 0r)(-5r + 25r + 14r + (4r + 0r - 5r)(0 - 1 + 3)) + 21r - 21r - 8r2)(2r - 3r + 3r). 112r*3 Expand (-3 + 0 - 14)(21 - 50 - 157 - z - 26). 17z + 3604 Expand -24i*3 + 1 + 29i*3 - 3 + (-46i - 62i + 39i)(-4i2 + i2 + 5i2 + 22i). -133i3 - 1518i*2 - 2 Expand (12 + 7 - 2 + (4 - 4 + 1)(-1 - 4 + 6) + 14 + 13 + 15)(7n - 2n - 3n)(-1 + 2 + 2). 360n Expand (-k*3 + 0 + 0)(6306 + 17683 + 8885 + 11035 - 11193). -32716k3 Expand -1 + 1 - 2w + 4w - 2 + 2 + (12 - 5 - 6)(-7w + w - 9w). -13w Expand (2f - 2 + 2)(2f + 2f + 2f)(4 - 2 - 5) + (46f + 6f + 66f)(-3 + 3 - 2f). -272f2 Expand 2 - v3 - 2 + (0 - 2v + 0)(0v2 + v2 - 6v2) + 10v*3 - 5v - 16v3 + 11v*3. 14v*3 - 5v Expand 256j5 - 1239j*2 + 1239j*2 + (5j*2 - 2j*2 - 4j*2)(1 - 1 - 3j3). 259j*5 Expand 2o*2 + 2o*2 + 2o*2 + (142 + 12o - 142)(11o - 32o - 17o). -450o2 Expand (41 - 4y*4 - 41)((7 - 5 + 2)(2 + 10 + 17) - 4 + 3 + 0). -460y*4 Expand 289f - 213f - 196f - 2f + 5f + 3f + (0f - 2f + 3f)(-1 + 2 + 0). -113f Expand (7508i - 673i*4 - 7508i)(-4 - 4 - 8). 10768i*4 Expand 132t*3 - 154t*3 - 96t*3 + (4t + 2 + 2t - 4t)(0t2 + t2 + 0t2). -116t*3 + 2t2 Expand (-l3 - 2l3 + 2l*3)(-2105 - 2974 + 893 - 1697) + (3 - 4 + 0)(2l*3 - 2l3 + l3) + l*3 - 6l*3 + 2l*3. 5879l*3 Expand (-1 + 1 + 1)(-h3 - h2 + h*2) - 319h*3 + 1127h*3 + 2106h*3. 2913h*3 Expand (-10p*2 - 23p*3 + 10p*2)(19p + 9p + 16p). -1012p*4 Expand 2q - 2q - 14q + (-5 + 2 + 5)(12q - 6q - 3 - 12) - q + 0q + 0q. -3q - 30 Expand ((1 + a - 1)(-2 + 3 + 3) + 5a + a - 3a)(6 - 2 - 2). 14a Expand ((-4 + 2 + 0)(-1 + 3 - 6) - 5 + 0 + 3)(-251r*2 + 396r*2 - 205r*2 + (-2r + 0r + 0r)(-1 + 1 - 2r)). -336r2 Expand (5w*2 + 12 - w - 22 - 10w*2)(0w - w + 7w). -30w3 - 6w*2 - 60w Expand 1053 - y + 64y2 - 1053 + (-34 + 34 + 10y)(y - 1 + 1). 74y*2 - y Expand 2m*3 - 10m*5 + 97m*5 - 2m*3 + (5 + 6 - 3)(8m5 + 5 - 5). 151m*5 Expand 5x - 3x - x + (30 - 35 - 64)(98 - 23x - 98). 1588x Expand (2k2 + 0 + 0)(-4 - 22 + 0)(0 + 0 + 1)(k + 2k + k)(2k2 + 6k*2 - 5k*2). -624k*5 Expand ((1 + 7 - 20)(l + 3l - 6l) + l - 4l + l + (2 - 2 - l)(3 - 3 + 1))(-2 + 5 - 2). 21l Expand (-388s + 1030s + 340s)(5 - 5 - 1)(-2s + 7s - 4s)(0 - 3 + 1)(-2 - 2 + 2). -3928s2 Expand (4 + 1 - 3)(4 + 0 - 3)(2 + 0 - 4 + (2 - 2 - 1)(8 + 6 + 5))(-b + 5b - 5b). 42b Expand (-7 + 18 + 0 + 3 - 6 + 1 + (0 - 1 + 0)(0 - 2 + 0) + 1 - 5 + 2 + 2 - 3 - 4 + (-1 + 0 + 2)(4 - 2 - 1))(-l + 5l + l). 25l Expand -3z + 92 - 37 - 5 + 4z + 0z - 6z + (4 - 5 + 3)(-2z - 4z + 5z) - 3z - z + 5z. -6z + 50 Expand (-13r3 - 6r*3 + 2r*3)(r - 2r - r) + (-2r*2 + 3r*2 - 3r*2)(312r2 + 791r - 791r). -590r*4 Expand (-77051 + 77051 - 852m)(1 + 0 + 1 + (-4 + 1 + 2)(-3 - 4 + 5)). -3408m Expand (11359 - 26228 + 6111)(-3y2 + 5y*2 - 4y*2). 17516y*2 Expand (21 - 4 - 46)(t - t - t*2 + (-1 - t + 1)(3t - 2t + 0t) - 10t*2 + 43t*2 + 0t**2)	{ "pile_set_name": "DM Mathematics" }
es after 12:57 AM? 12:01 PM How many minutes are there between 11:24 AM and 4:45 PM? 321 What is 123 minutes before 9:17 AM? 7:14 AM How many minutes are there between 9:51 AM and 2:28 PM? 277 How many minutes are there between 12:00 PM and 5:04 PM? 304 What is 660 minutes before 1:23 PM? 2:23 AM What is 503 minutes before 10:07 PM? 1:44 PM What is 432 minutes after 2:13 AM? 9:25 AM What is 568 minutes before 5:42 PM? 8:14 AM How many minutes are there between 3:50 AM and 3:08 PM? 678 What is 607 minutes before 7:04 PM? 8:57 AM What is 49 minutes after 7:56 PM? 8:45 PM How many minutes are there between 7:45 PM and 8:39 PM? 54 What is 328 minutes after 4:42 PM? 10:10 PM How many minutes are there between 11:55 AM and 12:55 PM? 60 How many minutes are there between 2:10 AM and 4:26 AM? 136 What is 576 minutes after 10:23 PM? 7:59 AM How many minutes are there between 11:37 AM and 3:47 PM? 250 What is 40 minutes before 8:35 AM? 7:55 AM How many minutes are there between 5:42 PM and 12:10 AM? 388 How many minutes are there between 11:18 PM and 8:03 AM? 525 How many minutes are there between 7:11 AM and 4:03 PM? 532 What is 532 minutes after 7:08 PM? 4:00 AM What is 148 minutes before 4:21 AM? 1:53 AM How many minutes are there between 3:51 AM and 2:18 PM? 627 What is 568 minutes after 5:58 PM? 3:26 AM How many minutes are there between 4:23 AM and 5:25 AM? 62 What is 251 minutes after 7:43 PM? 11:54 PM What is 59 minutes before 7:13 AM? 6:14 AM What is 91 minutes after 4:27 PM? 5:58 PM What is 394 minutes after 10:42 AM? 5:16 PM How many minutes are there between 8:04 AM and 11:18 AM? 194 How many minutes are there between 4:09 AM and 10:51 AM? 402 What is 662 minutes before 1:54 PM? 2:52 AM How many minutes are there between 9:23 AM and 8:40 PM? 677 What is 586 minutes after 12:36 AM? 10:22 AM How many minutes are there between 8:53 AM and 5:48 PM? 535 How many minutes are there between 11:12 PM and 8:29 AM? 557 What is 77 minutes before 5:06 AM? 3:49 AM What is 376 minutes before 2:33 PM? 8:17 AM What is 391 minutes after 11:12 AM? 5:43 PM How many minutes are there between 1:05 PM and 8:13 PM? 428 What is 419 minutes after 10:29 AM? 5:28 PM What is 496 minutes before 1:22 PM? 5:06 AM How many minutes are there between 2:48 PM and 6:58 PM? 250 What is 246 minutes after 4:04 AM? 8:10 AM How many minutes are there between 2:16 PM and 12:32 AM? 616 How many minutes are there between 9:39 PM and 9:10 AM? 691 How many minutes are there between 8:22 AM and 9:01 AM? 39 How many minutes are there between 1:37 PM and 2:29 PM? 52 How many minutes are there between 10:29 PM and 4:10 AM? 341 How many minutes are there between 7:17 AM and 1:42 PM? 385 What is 617 minutes after 8:10 AM? 6:27 PM What is 154 minutes before 12:09 AM? 9:35 PM How many minutes are there between 8:32 PM and 3:55 AM? 443 What is 610 minutes before 1:50 PM? 3:40 AM How many minutes are there between 7:56 AM and 10:04 AM? 128 How many minutes are there between 8:28 AM and 11:57 AM? 209 How many minutes are there between 12:10 AM and 10:53 AM? 643 How many minutes are there between 5:35 PM and 4:57 AM? 682 What is 595 minutes after 1:55 PM? 11:50 PM What is 700 minutes after 9:04 PM? 8:44 AM What is 620 minutes after 3:15 PM? 1:35 AM How many minutes are there between 6:15 PM and 2:36 AM? 501 How many minutes are there between 3:41 AM and 10:15 AM? 394 How many minutes are there between 4:57 AM and 4:24 PM? 687 How many minutes are there between 12:29 AM and 2:54 AM? 145 How many minutes are there between 2:40 PM and 12:27 AM? 587 What is 98 minutes after 4:10 PM? 5:48 PM How many minutes are there between 11:33 PM and 11:32 AM? 719 What is 202 minutes after 9:22 AM? 12:44 PM How many minutes are there between 4:05 PM and 2:04 AM? 599 How many minutes are there between 3:45 AM and 10:48 AM? 423 How many minutes are there between 8:48 PM and 6:20 AM? 572 What is 323 minutes before 4:13 AM? 10:50 PM How many minutes are there between 10:35 AM and 8:27 PM? 592 What is 309 minutes before 6:15 AM? 1:06 AM What is 391 minutes after 3:17 PM? 9:48 PM How many minutes are there between 4:49 AM and 9:23 AM? 274 How many minutes are there between 8:23 AM and 11:27 AM? 184 What is 421 minutes after 2:32 AM? 9:33 AM What is 453 minutes before 6:27 AM? 10:54 PM What is 596 minutes before 11:02 AM? 1:06 AM How many minutes are there between 10:34 AM and 2:31 PM? 237 How many minutes are there between 4:46 AM and 5:19 AM? 33 How many minutes are there between 2:53 AM and 3:37 AM? 44 How many minutes are there between 2:55 AM and 9:07 AM? 372 How many minutes are there between 1:12 PM and 6:08 PM? 296 How many minutes are there between 7:19 PM and 1:19 AM? 360 How many minutes are there between 4:47 PM and 10:32 PM? 345 How many minutes are there between 11:46 AM and 2:01 PM? 135 What is 204 minutes before 7:37 PM? 4:13 PM How many minutes are there between 2:07 PM and 7:32 PM? 325 How many minutes are there between 8:00 AM and 7:39 PM? 699 What is 255 minutes after 2:37 PM? 6:52 PM What is 609 minutes before 4:44 PM? 6:35 AM How many minutes are there between 6:28 AM and 7:18 AM? 50 How many minutes are there between 11:33 AM and 1:15 PM? 102 How many minutes are there between 8:55 PM and 6:19 AM? 564 How many minutes are there between 8:01 PM and 5:50 AM? 589 How many minutes are there between 6:00 PM and 5:37 AM? 697 What is 643 minutes before 2:17 PM? 3:34 AM How many minutes are there between 3:34 AM and 3:16 PM? 702 How many minutes are there between 8:32 PM and 9:31 PM? 59 What is 176 minutes after 8:41 AM? 11:37 AM How many minutes are there between 1:47 AM and 9:30 AM? 463 How many minutes are there between 7:29 AM and 1:24 PM? 355 How many minutes are there between 9:53 AM and 11:25 AM? 92 How many minutes are there between 3:38 AM and 9:09 AM? 331 What is 681 minutes before 2:24 AM? 3:03 PM How many minutes are there between 6:46 AM and 10:43 AM? 237 What is 209 minutes after 10:53 AM? 2:22 PM How many minutes are there between 7:59 PM and 9:31 PM? 92 How many minutes are there between 3:48 PM and 10:13 PM? 385 What is 197 minutes before 11:17 PM? 8:00 PM How many minutes are there between 12:58 PM and 8:21 PM? 443 How many minutes are there between 5:08 PM and 7:37 PM? 149 How many minutes are there between 8:48 PM and 4:48 AM? 480 What is 564 minutes after 2:47 AM? 12:11 PM What is 610 minutes before 1:16 AM? 3:06 PM How many minutes are there between 6:42 PM and 4:39 AM? 597 How many minutes are there between 2:49 AM and 4:21 AM? 92 What is 251 minutes before 6:53 PM? 2:42 PM How many minutes are there between 11:38 PM and 6:26 AM? 408 What is 398 minutes before 9:27 AM? 2:49 AM What is 139 minutes after 1:18 PM? 3:37 PM What is 310 minutes before 12:01 PM? 6:51 AM What is 675 minutes before 10:05 AM? 10:50 PM What is 386 minutes before 4:43 PM? 10:17 AM What is 176 minutes after 4:01 PM? 6:57 PM What is 327 minutes before 3:58 PM? 10:31 AM What is 439 minutes before 12:26 AM? 5:07 PM What is 317 minutes before 5:55 AM? 12:38 AM What is 236 minutes before 7:26 AM? 3:30 AM What is 96 minutes after 10:50 PM? 12:26 AM What is 250 minutes after 3:32 AM? 7:42 AM What is 317 minutes after 10:21 AM? 3:38 PM What is 9 minutes after 2:56 PM? 3:05 PM What is 591 minutes after 2:25 PM? 12:16 AM How many minutes are there between 10:53 AM and 8:50 PM? 597 What is 344 minutes after 8:23 AM? 2:07 PM How many minutes are there between 8:15 PM and 7:07 AM? 652 What is 457 minutes after 2:07 PM? 9:44 PM What is 243 minutes after 11:31 AM? 3:34 PM What is 53 minutes before 5:29 PM? 4:36 PM How many minutes are there between 1:13 AM and 12:14 PM? 661 What is 313 minutes after 3:22 PM? 8:35 PM What is 456 minutes after 4:55 PM? 12:31 AM How many minutes are there between 2:31 PM and 4:43 PM? 132 What is 703 minutes after 12:06 AM? 11:49 AM How many minutes are there between 2:06 AM and 10:19 AM? 493 What is 128 minutes after 6:00 PM? 8:08 PM How many minutes are there between 5:47 PM and 6:31 PM? 44 What is 467 minutes before 2:35 AM? 6:48 PM How many minutes are there between 2:28 AM and 6:39 AM? 251 How many minutes are there between 4:30 PM and 10:23 PM? 353 How many minutes are there between 11:30	{ "pile_set_name": "DM Mathematics" }
4) Simplify (b*(-14)/(bbbbb8bb))/(b(-1/14)b)(-26) assuming b is positive. b(-27/7) Simplify (b(-3/4))39(b12bb)/b(-4/13) assuming b is positive. b(-777/52) Simplify (m(1/4)m/((m*(-3/5)/mm)/m)m(-2/5)m/(m/(m4/m)))21 assuming m is positive. m(2289/20) Simplify (i(-1/11)/ii/(i4/i))/(ii/(i/i(-1/2)))(-6) assuming i is positive. i(-1/11) Simplify (a0a)(3/26)/(a(-4/13))(-28) assuming a is positive. a(-17/2) Simplify ((r(r/(r/(r*1r)))/r)/r(-3/8))/(r5)35 assuming r is positive. r(-1381/8) Simplify ((m*(-6)m(-7))(-30))(-1/50) assuming m is positive. m(-39/5) Simplify m/((mm(-2/17))/m)m/((m(m34/mm)/m)/m)mmmm*14m(-24/5) assuming m is positive. m(-1588/85) Simplify (mm(-30)m(2/11))/(m(-1/11))23 assuming m is positive. m(-294/11) Simplify (((w/w(-3/13))/w)/w(1/9))(-23) assuming w is positive. w(-322/117) Simplify ((d*13/d)/(dd(-6)))/(d6/d(-4)) assuming d is positive. d7 Simplify (h*(-5/3)h/h*(-1/16)h)/(h(-8/3)/((h/(h0/h))/h)) assuming h is positive. h*(65/16) Simplify (rr(-4)/r)(4/5)((rr(-1))/r)(-2/167) assuming r is positive. r(-2662/835) Simplify ((k(-2/3)k)12k*(-2/7)kk(-2/23))10 assuming k is positive. k(7450/161) Simplify (j/((j(j/j*(10/7))/j)/j)j)/(jj/j17)((jj12)/jj)(-3/7) assuming j is positive. j(90/7) Simplify g*(1/4)g(gg*5g)/g(g/(g/(gg*10gg))g)/(g/((g/(g(-9)/g))/g)) assuming g is positive. g(121/4) Simplify vvv*(-21)v(v/v(-12))/v((v/v*0)/v)/(vv*(11/5)v) assuming v is positive. v*(-51/5) Simplify ((z/(zz/(z4/z)))/z)(17/4)(zz*(-5))/zz*(1/4) assuming z is positive. 1/sqrt(z) Simplify (kk/((((k*1k)/k)/k)/k)kk(8/5))/(k(-3/7))(6/5) assuming k is positive. k(214/35) Simplify (s/(s/s*(-2)s)s)(-1/29)/((s/s(2/19)s)/sss(s/s(2/21))/ssss) assuming s is positive. s(-66308/11571) Simplify (((m4)(-2/7))15)25 assuming m is positive. m(-3000/7) Simplify (x(3/5))(-39)/(((xx/x(3/7))/x)/((x(xx/x(1/4))/xxx)/x)) assuming x is positive. x(-2971/140) Simplify (aa/(aa/a0)a*(-3)(aa(-1))(-5))(-2/17) assuming a is positive. a(6/17) Simplify (z/(zz*(3/11))zz/(zzzz*(6/13))z)/(z/(z(-2/7)/z))(-4/11) assuming z is positive. z(97/1001) Simplify ((r/r(-5))/r*(-14))/((rrr(-10/11)/r)/(r/(rr*9)rr)) assuming r is positive. r(142/11) Simplify (((((p/(pp*0pp))/p)/p)/p)(-26)/((p/((pp(pppp*(-11)p)/p)/p))/((pp(-2))/p)))(1/23) assuming p is positive. p(120/23) Simplify g(-1/5)/gggg*18gg/g(-14)gg(1/14)ggggg assuming g is positive. g(2861/70) Simplify (g/g(2/3))/g*(-10)g/(gggg/(g/g(5/4)))g/(g/(gg/g(-11))) assuming g is positive. g(241/12) Simplify (c(-2/31)c(1/11))(-35) assuming c is positive. c*(-315/341) Simplify iii(i*(-12/11)/ii)/ii10(i(-3))(2/21) assuming i is positive. i*(818/77) Simplify ((gg(-6/13))(-9/7))(-12/13) assuming g is positive. g(108/169) Simplify (b(1/5))(-3/7)/(b(-6))(-6/25) assuming b is positive. b(-267/175) Simplify ((l/(l/l(-3)))/l)*(-29)(l*(-15)l)/(l/l(-4/5)) assuming l is positive. l(501/5) Simplify (j(2/5))(1/20)/((j/(jjj/(j/((j/(j*(-12)j)j)/j)))j)/jjj(j(-3/16)j)/jj) assuming j is positive. j(4083/400) Simplify (((((x/x(-5))/x)/x)(-23))39)(-4/11) assuming x is positive. x(14352/11) Simplify ((t(-3))(3/29)((t/t(-3/4))/t)49)(25/6) assuming t is positive. t(35225/232) Simplify (r/(r/r12))(-37)r2r/(r31/r) assuming r is positive. r(-471) Simplify ((nnnn(1/6)/nn(nn(-5))/n)43)*0 assuming n is positive. 1 Simplify ((dd(1/5))39d(1/9)/dd3)(-5/4) assuming d is positive. d*(-2201/36) Simplify (cc/(ccc*(2/13)cc)cc)/(c/(cc/(c*(-2/9)/c)))(c4/c)/((c(2/3)/c)/c) assuming c is positive. c(749/117) Simplify b0/b*(-1/6)(b/(bb/(b/(b/b(-4)))))(1/4) assuming b is positive. b(-13/12) Simplify xx*(-9)xx(-12)/xxx(x/((xx/(xx/(xx(-9))))/x))(-38) assuming x is positive. x(-398) Simplify ((d(11/3)dd)/((d(-1)/d)/d))/(d(-10/9)d/(d*(-1/2)/d)d) assuming d is positive. d*(113/18) Simplify (v((v/v*(-3/8))/v)/vvvv)(2/115)/(v(-13)(vv*13)/vv) assuming v is positive. v*(-433/460) Simplify (((kk/(k/((k*6/k)/kk)))/((k/k*(-5))/k))/(k/(k((kkk*(-2)kk)/k)/k))(3/4))(1/22) assuming k is positive. k(1/22) Simplify v10/(v19v)(v(-2/31)/v)(16/3) assuming v is positive. v(-486/31) Simplify ((m(-2/5)m)*(-34)(mm0)(-2/7))(-21) assuming m is positive. m(2172/5) Simplify ((s(-1))(9/5)(s/(s(ss*(-5))/s))/s(s3/s)/s)(-1/50) assuming s is positive. s*(-8/125) Simplify (ff/((f*(-7)/ff)/f))/(f/(f/f*(-4)f))(f(-1/6)/f)/ff*4f assuming f is positive. f*(107/6) Simplify (uu*2u)*(-37)u/(u((u/u(1/11))/uuu)/u)uu(1/3)/u assuming u is positive. u(-4903/33) Simplify ((l(-3/8))(1/27))(2/77) assuming l is positive. l(-1/2772) Simplify ((b(2/31)/b)/(bb*(-12)b))/(b(2/13)/b2) assuming b is positive. b*(4397/403) Simplify (hhh(2/9))/hh*(-10)(h*(-2)h)/hh(-19/2) assuming h is positive. h(-365/18) Simplify (o3)4o*(-1)oo(3/10)/oo assuming o is positive. o(123/10) Simplify o19o/(((o/(o18/o))/o)/o)(o*7o)(-7) assuming o is positive. o(-18) Simplify ((ttt*10)/(t/(t(t*(2/27)tt)/t)))/(t/(tt(2/13)))4 assuming t is positive. t(4805/351) Simplify (p(-5)(((p/(ppp6p))/p)/p)/p)/(p7)36 assuming p is positive. p(-268) Simplify (((o(2/15)o)/o(-11/3))/(o(o/(oo(-11)))/oo/o*(1/4)o))(7/3) assuming o is positive. o(-371/20) Simplify (s/(s/s*12s))*(-2/27)/((ss*(-6/11))/sss(8/7)) assuming s is positive. s(-5015/2079) Simplify (xx(-3/2))/x(6/11)xxx(-2/17)x/x1 assuming x is positive. x(313/374) Simplify ((q/q(-3/8))/q12)(1/3) assuming q is positive. q(-85/24) Simplify (r(-2/37)/(r31/rr))/(r(rr/(r/(rr/(rr/r(-3/8)))))/r)(-3/19) assuming r is positive. r(-174093/5624) Simplify (i7i)*14(iii(i/(ii*(-10)))/iiiii)(-1/7) assuming i is positive. i(768/7) Simplify (((yy/y(1/10))/(y/y(-3/4)))(15/2))(5/12) assuming y is positive. y(15/32) Simplify (j(-1))45/(j(-3))40 assuming j is positive. j75 Simplify (rr(-6/19)r)*42/(r/(rr*(-6)r)rr)27 assuming r is positive. r(-2247/19) Simplify (c*10c*(3/10)c)(-17) assuming c is positive. c(-1921/10) Simplify p/p*(-1/15)p/p*(3/4)(p/(ppp/(p/p*(-10/7))))/(p/(pp/(p/(p*(2/49)/p))p)) assuming p is positive. p(5251/2940) Simplify (g(-10)g)(-23)(g/g(-1/6))(2/7) assuming g is positive. g(622/3) Simplify h(-4/3)hhh/(h/h(-2/25))hhh*(-3/4)/hh*(-2/5)hhh assuming h is positive. h(1031/300) Simplify (((t/t(-3/4))/(t*2/ttt))4)(-26) assuming t is positive. t130 Simplify ((b7/b)/bbb(-2)b)/((b/(b/b*(1/6)b))/bbbb(-1)/b) assuming b is positive. b(41/6) Simplify ((h(-9)/hh)/h)(-4/25)/(h(2/7)/hh)(-45) assuming h is positive. h(506/35) Simplify (w(-2/11))(-40)ww(1/4)/ww(-1/10) assuming w is positive. w(1633/220) Simplify (r(2/13))(8/7)r(2/5)((r*16/r)/rrr)/r assuming r is positive. r(7087/455) Simplify ((s/s(-11))/(((s/s(5/7)s)/s)/ss))/(ss/s*(1/4)s)(-6/7) assuming s is positive. s(197/14) Simplify ((d*(-4)/d)/dd)*(23/4)(d(2/3))(2/33) assuming d is positive. d*(-11369/396) Simplify (cc*(3/4))/cc*(-11)(c/(c/(cc5cc)))35 assuming c is positive. c(1079/4) Simplify (bbb/(b/b19))/b(-14)b*19/(bb(-11/3)) assuming b is positive. b(170/3) Simplify (((v*1/v)/vv)*(1/15)v*(-7/5)v4/v)(-2/65) assuming v is positive. v*(-16/325) Simplify (tt(-6/5))(-1/26)/(tt/t6)(-6/25) assuming t is positive. t(-619/650) Simplify l(-1)/((l(-2/13)l)/l)l(-10/11)/l(2/9) assuming l is positive. l(-2545/1287) Simplify (((zz5)/z(-2/3))(-22/7))(-21) assuming z is positive. z440 Simplify ((c(-2/7)ccc)/(c/(ccc1c))((c(-4)c)/c)/(cc/(c*(-	{ "pile_set_name": "DM Mathematics" }
ase 13) in base 14? -71d Convert -32636 (base 9) to base 2. -101010010011100 What is -22401 (base 5) in base 6? -11225 What is -221222121 (base 3) in base 13? -8812 What is 43311 (base 5) in base 4? 232030 Convert 2d84 (base 14) to base 8. 17730 Convert 440103 (base 6) to base 8. 106747 What is -1001011000 (base 2) in base 15? -2a0 What is -3423 (base 5) in base 9? -602 What is -1812 (base 9) in base 11? -1052 What is -1318 (base 13) in base 5? -41400 What is a5 (base 12) in base 15? 85 -10524 (base 12) to base 11 -15161 Convert -2122110210 (base 3) to base 15. -10689 Convert -123223 (base 4) to base 10. -1771 Convert -1062 (base 10) to base 14. -55c What is -4288 (base 15) in base 3? -201022102 -212022011 (base 3) to base 6 -210351 13300 (base 4) to base 2 111110000 Convert -3db (base 15) to base 16. -371 What is 110100110100 (base 2) in base 4? 310310 What is -b2 (base 15) in base 9? -205 What is -39c (base 13) in base 4? -21330 -2654 (base 8) to base 2 -10110101100 What is -299 (base 13) in base 6? -2052 What is -220102 (base 3) in base 7? -1631 -47550 (base 8) to base 5 -1122303 Convert -104 (base 13) to base 10. -173 -400 (base 6) to base 7 -264 Convert -2221101 (base 4) to base 16. -2a51 36770 (base 8) to base 6 201240 Convert 2231 (base 4) to base 7. 335 What is 10b6 (base 13) in base 3? 10012220 Convert -102011122 (base 3) to base 16. -1fd0 -324222 (base 5) to base 10 -11187 What is -330124 (base 5) in base 15? -3529 What is -302020 (base 4) in base 15? -e3d What is 246 (base 13) in base 16? 18c What is 3020 (base 5) in base 14? 1d7 What is -10102210 (base 3) in base 15? -b20 Convert -14435 (base 6) to base 13. -10a0 -403030 (base 6) to base 7 -161424 What is -2151 (base 8) in base 6? -5121 Convert -427 (base 12) to base 16. -25f 20405 (base 9) to base 15 3ebb Convert 10346 (base 9) to base 4. 1222332 What is 28578 (base 9) in base 14? 711c Convert -122133 (base 7) to base 4. -11131200 Convert -1124321 (base 5) to base 6. -235150 What is 3631 (base 7) in base 15? 5ea -127 (base 15) to base 13 -172 What is 1101011100000000 (base 2) in base 10? 55040 Convert 4303 (base 9) to base 11. 2415 What is -524 (base 7) in base 13? -173 What is 8a4 (base 15) in base 2? 11110100010 -11133311 (base 4) to base 16 -57f5 1001 (base 5) to base 8 176 1633 (base 8) to base 9 1235 What is -20201 (base 3) in base 11? -155 Convert -10202 (base 8) to base 14. -177c What is -1001011110001 (base 2) in base 3? -20122121 -1433223 (base 5) to base 8 -73346 -27b8 (base 15) to base 12 -4b02 What is -35747 (base 10) in base 14? -d055 Convert 31310 (base 6) to base 9. 5706 What is -3101 (base 11) in base 6? -31015 -621 (base 8) to base 13 -24b 12123 (base 4) to base 9 506 Convert 291 (base 13) to base 16. 1c8 What is 14c9 (base 15) in base 10? 4464 Convert -b07 (base 13) to base 2. -11101001010 What is 166231 (base 8) in base 10? 60569 What is 210101 (base 3) in base 15? 287 Convert 2a (base 16) to base 7. 60 Convert -11111 (base 2) to base 9. -34 What is 41340 (base 9) in base 11? 19525 What is -102010 (base 3) in base 7? -606 Convert 361 (base 8) to base 3. 22221 What is -1667 (base 9) in base 12? -8a4 What is -11111100100 (base 2) in base 8? -3744 What is -472 (base 11) in base 8? -1063 -7604 (base 13) to base 3 -211111022 Convert -2569 (base 10) to base 3. -10112011 What is 1285 (base 10) in base 14? 67b What is 101000100110 (base 2) in base 16? a26 What is -3143 (base 8) in base 6? -11323 What is -3224 (base 6) in base 16? -2e0 Convert -40c (base 14) to base 9. -1074 -22838 (base 9) to base 6 -154355 What is -1bd (base 15) in base 14? -20b 314 (base 9) to base 6 1104 Convert -104323 (base 5) to base 4. -322001 124050 (base 7) to base 15 6c46 -935 (base 10) to base 9 -1248 Convert 334 (base 12) to base 13. 2a4 What is -721 (base 10) in base 6? -3201 Convert -1530 (base 7) to base 12. -429 12251 (base 7) to base 10 3221 Convert 111000 (base 3) to base 9. 430 What is -c48 (base 13) in base 10? -2088 What is -ca (base 15) in base 10? -190 What is -11438 (base 10) in base 12? -6752 Convert 6b85 (base 12) to base 3. 121112102 What is 22326 (base 9) in base 11? 10178 Convert -12260 (base 11) to base 2. -100010011001011 What is 35151 (base 8) in base 10? 14953 110100110010001 (base 2) to base 14 9bc5 Convert 10011100001000 (base 2) to base 8. 23410 -12322101 (base 4) to base 15 -85c0 Convert 8278 (base 12) to base 2. 11011101111100 What is -423012 (base 5) in base 3? -201101102 Convert 504 (base 12) to base 9. 884 Convert -2a1 (base 14) to base 11. -445 Convert c0 (base 14) to base 12. 120 Convert 5005 (base 6) to base 15. 4c5 What is -3431 (base 8) in base 12? -1075 What is 462 (base 10) in base 14? 250 Convert -295 (base 10) to base 15. -14a What is -10010111111101011 (base 2) in base 16? -12feb 1006 (base 7) to base 8 535 Convert -948 (base 13) to base 16. -62d 611 (base 15) to base 3 1212121 What is 65506 (base 7) in base 15? 4cb7 What is 3123332 (base 4) in base 2? 11011011111110 What is -2203031 (base 4) in base 12? -6065 Convert 11261 (base 13) to base 6. 400155 -c0b (base 14) to base 8 -4473 21210330 (base 4) to base 16 993c What is -3252 (base 9) in base 13? -1124 164577 (base 8) to base 15 12aa0 Convert -2210120 (base 3) to base 9. -2716 Convert -1000101100 (base 2) to base 12. -3a4 Convert 13 (base 8) to base 10. 11 What is 63655 (base 7) in base 11? 10936 What is -121101 (base 3) in base 11? -372 Convert 13050 (base 6) to base 7. 5520 Convert -14503 (base 10) to base 5. -431003 Convert -62663 (base 7) to base 15. -488b Convert 10520 (base 9) to base 10. 6984 2201 (base 4) to base 2 10100001 Convert 68757 (base 10) to base 12. 33959 Convert -151a (base 16) to base 14. -1d7c 132122 (base 5) to base 10 5287 What is -2384 (base 9) in base 15? -7d7 What is 691 (base 11) in base 3? 1010121 Convert -25d1 (base 14) to base 4. -1213323 Convert -3023 (base 4) to base 13. -128 What is -326a (base 12) in base 6? -41414 Convert 665 (base 15) to base 3. 1222112 111001000101 (base 2) to base 11 2821 Convert 531 (base 7) to base 9. 326 Convert -16564 (base 8) to base 12. -4444 Convert 55760 (base 9) to base 12. 19553 Convert -1111202111 (base 3) to base 12. -15241 Convert -21010 (base 4) to base 10. -580 200 (base 4) to base 9 35 -3c (base 14) to base 12 -46 -10354 (base 8) to base 6 -32020 Convert -1478 (base 15) to base 12. -2658 10100011 (base 2) to base 8 243 -289 (base 10) to base 16 -121 Convert 1324 (base 9) to base 4. 33202 Convert -12032 (base 4) to base 11. -332 What is 110021 (base 3) in base 6? 1311 What is -4098 (base 10) in base 6? -30550 What is 312 (base 11) in base 6? 1424 Convert -48991 (base 10) to base 12. -24427 Convert -326 (base 10) to base 13. -1c1 Convert 1013040 (base 6) to base 3. 2110200220 What is -32c9 (base 14) in base 6? -104425 What is -400 (base 7) in base 14? -100 What is -1b3 (base 16) in base 12? -303 Convert -1244 (base 16) to base 12. -2858 What is -c413 (base 15) in base 14? -11146 -1122025 (base 6) to base 2 -1110000010000001 50237 (base 8) to base 3 1001022102 -1209 (base 10) to base 4 -102321 -97a (base 11) to base 9 -1546 -381 (base 12) to base 7 -1354 135424 (base 6) to base 7 52423 2a196 (base 12) to base 5 3342020 -6050 (base 9) to base 13 -201c -121620 (base 7) to base 8 -53364 Convert 42 (base 13) to base 4. 312 Convert 113412 (base 8) to base 15. b6cb What is -9 (base 13) in base 6? -13 Convert -111166 (base 8) to base 3. -1220102200 What is 119 (base 13) in base 10? 191 110001010 (base 2) to base 7 1102 Convert a29 (base 12) to base 15. 683 Convert 681 (base 11) to base 14. 423 -bb (base 14) to base 4 -2211 -e2 (base 15) to base 4 -3110 14a0 (base 11) to base 6 12525 1122021210 (base 3) to base 4 13320132 Convert -4300 (base 6) to base 12. -690 What is 10034 (base 5) in base 4? 22010 -5724 (base 8) to base 14 -1164 Convert -3115 (base 9) to base 2. -100011101010 What is -14231 (base 5) in base 7? -3321 Convert 7 (base 13) to base 12. 7 Convert 398 (base 12) to base 10. 548 Convert 44a (base 15) to base 6. 4254 Convert -60b6 (base 14) to base 11. -11543 2f79 (base 16) to base 15 3903 -931 (base 10) to base 3 -1021111 What is -a10 (base 12) in base 7? -4143 101111111 (base 2) to base 12 27b Convert -1111211 (base 3) to ba	{ "pile_set_name": "DM Mathematics" }
a. 3 Let l be (-2)/((50/(-65))/5). Suppose -3d + ld = 3d. Solve 2g = -dg for g. 0 Let x be (-2)/(-7) - 759/(-161). Solve 4z - xz = -3 for z. 3 Suppose -15l = -13l + 20. Let w = -6 - l. Solve -wc + 6 = 26 for c. -5 Suppose -5k = 4b + 34 - 84, 2k - 22 = -2b. Solve 0 = c + 1 - k for c. 5 Let i(v) = -v*3 - 10v*2 - 15v + 11. Let y(l) = -4l - 4. Let a be y(1). Let b be i(a). Solve -2u - bu = -25 for u. 5 Let t be 3 - ((-6)/10)/(4/(-20)). Suppose 4f - q - 9 = 0, 2 = 3f + 4q - t. Solve 0 = fv - 12 + 2 for v. 5 Let a = -2187 - -2190. Let l(c) = c3 + 7c*2 + 4c - 8. Let n be l(-6). Solve a = -ny - 9 for y. -3 Let j(m) = -2m - 6. Let u be j(-6). Let i be (-1)/2(-14 - u). Suppose 0 = 4f - l - 27, -l = -2f - 0l + 13. Solve -2z - i = -fz for z. 2 Let c = -165 - -154. Let l(f) = -f - 9. Let x be l(c). Let z = 2 + -2. Solve -i + 6 - x = z for i. 4 Let b(f) = -4f - 54. Let n be b(-19). Solve 5l = -n - 3 for l. -5 Let s(x) = -x*3 + 8x*2 - 5x + 3. Let y be s(7). Suppose -y = -2w + f, -5w + 5f = 1 - 51. Suppose -3i + wi - 16 = 0. Solve -1 - 11 = im for m. -3 Suppose 0 = l - 3l + 84. Suppose -l = a - 7a. Solve 3p - ap - 8 = 0 for p. -2 Let o(w) = -4w - 8. Let j be o(-8). Suppose 8k + j = 11k. Solve 0z = 2z + k for z. -4 Suppose 0 = -287o + 285o. Solve om = m - 2 for m. 2 Let t(d) = -d*3 + 6d*2 + 7d + 4. Suppose 6 = 4g - 22. Let z be t(g). Solve 0m + zm = -8 for m. -2 Suppose -n - 5l - 4 + 26 = 0, -20 = -4n - 3l. Suppose -3 = -2g - 3o + 9, -o = -n. Solve -gt = -0t + 15 for t. -5 Suppose 58 = -2v - 5u - 21, -3v - 84 = -4u. Let b = 24 + v. Let i be ((-4)/b)/(2/24). Solve -iy = -y + 20 for y. -4 Suppose 2i + 0i - 108 = 0. Suppose 4g - 6 = i. Let l = g - 12. Solve l = q + 1 for q. 2 Let r be -1(-1)/22. Let p be 1/((-1)/(-2)) - 0/(-27). Let h be (-3)/(-2) + r/p. Solve hj + j - 6 = 0 for j. 2 Let p(z) = z2 + 2z - 5. Let m be p(-3). Let a be m + 44/8. Suppose 4h = -ah. Solve hc = 4c for c. 0 Let y(k) = -23k - 89. Let s be y(-4). Solve -s = -2o + 3o for o. -3 Suppose j + 16 = -0g - 4g, -5g = 5j + 5. Suppose -n = jn - 115. Let v = n - 18. Solve 5 = vh - 0 for h. 1 Let d be 1-10 - (5 + -7). Let p be (-6)/d - (-48)/(-64). Solve pt - 15 = -3t for t. 5 Let j(d) = -d2 + 10d - 11. Let l be j(9). Let g be (-1)/(l/(-4)) + (-2 - -4). Solve g = y - 0 + 2 for y. -2 Let i be (3 + -5)/((-3)/12). Solve i = 5y - y for y. 2 Let x(b) = b3 - 3b*2 + 3b - 7. Let s be x(3). Solve 2h + 8 = s for h. -3 Suppose 0 = -3x - 0x + 3. Suppose 0 = 3c + 5r, 2c - 3 - x = -2r. Let y be (258/(-430))/(0 - 1/5). Solve 2 = -ca - y for a. -1 Suppose i + 3i - 40 = 0. Suppose 0 = 11g - ig - 2. Solve -3j + g = -1 for j. 1 Let n(r) = -r*3 - 13r*2 + 15r + 10. Let g be n(-14). Let w be (g - (-6 - -3))-2. Suppose -wu + 4u = 2. Solve -u = v - 5 for v. 4 Let q(z) = -2 - 2 + 6z - 15z - 2z2 + z2. Let h be q(-6). Let w = -11 + h. Solve r = wr + 2 for r. -1 Let m(r) = r3 - 5r*2 + 7r - 9. Let b be m(4). Solve 0 = bf - 11 + 2 for f. 3 Let a(m) = m2 - 2m - 2. Suppose -16 = -5r + 4. Let f be a(r). Solve -4l = -l + f for l. -2 Suppose 2f - 10 = 2. Let t be (6/(-9))/((-2)/f). Let k be ((-12)/16)/(t/(-16)). Solve 0 = i - 3i + k for i. 3 Let j be 15/216/(-8). Let t = 19 + j. Solve -9x = -tx - 15 for x. 3 Suppose -9f + 80 + 28 = 0. Solve 2 + 10 = fy for y. 1 Suppose -5x = -2f + 45, x - 12 = -3x. Solve 6a = f - 48 for a. -3 Suppose 6n - 42 = -30. Solve -4 = nq - 0 for q. -2 Suppose 0 = 3b + b. Suppose 3 = i - 3n, 0 = -17n + 21n. Suppose -3z - i = -bz + 4f, 0 = -4z - 2f + 6. Solve 4t - 3 = zt for t. 3 Let p = 471 - 414. Solve -52 = -q - p for q. -5 Suppose 0 = u + 4u - 15. Let x = -3 + u. Suppose -9j = -6j - 36. Solve -3q + 6q + j = x for q. -4 Suppose 5w - 4w - a = 0, -16 = -5w - 3a. Suppose -4n + 20 = -5d, 4n + 4d + 9 = -7. Solve -b - w = -n for b. -2 Suppose 5u - 58 + 53 = 0. Suppose -3q = -5f + 21, 3 = 2f - 3q - 9. Suppose -2r + 5t = -24, -t - f = r - u. Solve -j = -3j - r for j. -1 Suppose p = -p - 2. Let g(j) = -3j3 - j2 - 2j - 1. Let k be g(p). Suppose 2 = -0x + x. Solve -xh + 10 = kh for h. 2 Let n be 65/55 - (48/22 + -2). Solve n = v - 2v for v. -1 Let m = -63 + 65. Solve -mv = -8 + 6 for v. 1 Let v(w) = -2w2 - 4w - 5. Let d be v(-3). Suppose 2b - 34 - 28 = 0. Let m = b + d. Solve -m = -0z + 4z for z. -5 Let o(v) = 2v - 14. Let x be o(6). Let u(k) = -2k3 - 3k*2 - 2k - 2. Let n be u(x). Solve 4s + n = s for s. -2 Let l(y) = -32y - 192. Let p be l(-6). Solve -7o + 9o - 2 = p for o. 1 Suppose -5t = c - t - 117, 3c - t - 286 = 0. Suppose -a = 5p - c, a = 2p - 0a - 43. Solve -2v = -7v - p for v. -4 Let n(h) = -h3 + 17h*2 - 64h - 11. Let v be n(11). Solve 0c - 44 = vc for c. -4 Let y be (-2)/162 - (-7)/28. Solve -5z + 3z - 8 = y for z. -4 Let u(p) be the third derivative of p4/8 - 5p*3 + 15p*2. Let l be u(10). Solve -5i + 3i = l for i. 0 Suppose -2h = -16h + 280. Solve -22y = -26y - h for y. -5 Let y be (9/9)/(2 - (-14)/(-8)). Suppose yi - 8 + 0 = 0. Solve -2b = ib - 8 for b. 2 Suppose -432 = 19n - 22n. Let x be (-2)/16 - n/(-128). Let o be x - (-6 + -1 - -4). Solve 2 = -og - 10 for g. -3 Let p(u) be the second derivative of u4/12 + u3/3 + u2/2 + 3u. Let t be p(2). Suppose -3m + 3 + t = 0. Solve -l + 5 - m = 0 for l. 1 Suppose 5s = 10s. Suppose s = 7u - 2u - 40. Let p(l) = l2 + 9l - 8. Let q be p(-10). Solve q + u = -2x for x. -5 Let d = 1067 + -1065. Solve d - 32 = -10o for o. 3 Let p(s) = -s*3 + 11s*2 - 16s - 15. Let l be p(9). Solve 0j + lj - 15 = 0 for j. 5 Let g = -2121 + 2132. Solve 3 = gy - 41 for y. 4 Let r be (-2)/756/(-8). Let i be (-17 - -2)6/(-10). Suppose 1 = -rm + i. Solve m = 2z - 3z for z. -4 Suppose 0 = 8q - 30 - 10. Suppose -qg + 2 = -8. Solve gm - 7m = -10 for m. 2 Let r(t) = -2 + 4 + t - 1. Suppose x - 30 = -4x. Let j be r(x). Solve 5l = -j - 18 for l. -5 Suppose 0 = -3n - 127 - 26. Let t = -29 - n. Let q = -19 + t. Solve -9 = qp + 6 for p. -5 Suppose -4c = 2v + 42, -4v = -2c - c - 26. Let q(j) = j*2 + 7j - 7. Let k be q(c). Let d = k + -15. Solve -3p + p = d for p. -4 Let c(i) = i + 1. Let j be c(-3). Let k be 24/(j + 0) - -2. Let a = k - -12. Solve ad = -3d + 15 for d. 3 Suppose 16 = -3i + 5v - 6, -18 = -3i - 3v. Let j be (0/2)/(-2 - i). Suppose 4h + 4s - 12 - 20 = 0, -3h + 5s = 8. Solve -2c + 4 + h = j for c. 4 Let j = 4755 + -4740. Let o be (-5)/(-4)(1 - -3). Solve -5w - j = -o for w. -2 Let f(d) = d + 1. Let s(n) = -2n + 2. Let a be s(-2). Suppose -2j + 2 = -a. Let r be f(j). Solve -r = b - 0 for b. -5 Let f(c) = c*3 + 4c*2 - 6c. Let m be f(-5). Suppose -my + 5s + 55 = 0, 5y - s - 16 - 27 = 0. Solve 4x - yx = -4 for x. 1 Let i be ((6 - 0) + -4)/2. Let t(o) = 24o + 5o3 - 4o*3 + 8o*2 - 3 - 25o. Let b be t(-8). Solve 0 = 2d + i - b for d. 2 Suppose 2w - 5m = -9, 2w - 3w - m + 13 = 0. Suppose -4v = 4i - w, -2v = -3i - 1 - 3. Solve i = 3q - q - 6 for q. 3 Let l = -206 + 225. Solve 2r - 15 = -l for r. -2 Let m = -4 - -6. Suppose 4r = mr + 54. Suppose 5j - r = -4q, -5j - 2 = -17. Solve 3f - 4f = q for f. -3 Suppose -14l - 1 = -57. Solve lf = 6f for f. 0 Suppose -117f = -118f + 13. Solve 23n + f = 10n for n. -1 Let q(t) = t3 + 7t*2 + 8t - 10. Let d be q(-5). Suppose 5 = -2c + 7c - a, -a + 5 = d. Solve -6m = -cm for m. 0 Suppose 3f + 0 - 6 = 0. Solve -2g = fg + 4 for g. -1 Suppose 3i + 17 = 47. Suppose 0f + 2f + u = -5, -f + i = -2u. Let t be (-3)/(-9)f - -5. Solve -ts + 23 = 3 for s. 4 Suppose 136y = 123y - 91. Let k be 124/(-8) - (-2)/4. Let x be (-10)/k + y/(-3). Solve 4c + x - 11 = 0 for c. 2 Suppose 15 = h - 3u, 5h + u + 10 = 7h. Solve -4b = -b + hb for b. 0 Let v(h) be the second derivative of -h5/20 + 5h4/12 + h3/6 - 3h2/2 + 25h. Let i be v(5). Solve 0a = ia for a. 0 Let k be 6 + -2 - (-6)/(-3). Let i(z) = 2 + 0z - 6z*3 + 5z*2 + 5z*3 - 5z. Let y be i(k). Solve 2 = ya - 10 for a. 3 Suppose -2j - 3k + 1 = 0, 3k + 7 = -j + 3j. Suppose -5h - 64 = -9h. Suppose -g + 3r - 2r = -h, 2g - 5*r = 44. Sol	{ "pile_set_name": "DM Mathematics" }
-1/2, 0, 5/6 Put 28/3, 1/23, -0.34, 1/3 in descending order. 28/3, 1/3, 1/23, -0.34 Put -1/2, 0.3, 2/13, -4/7, 8, -0.6 in descending order. 8, 0.3, 2/13, -1/2, -4/7, -0.6 Put -25, 2, -2, -9873 in descending order. 2, -2, -25, -9873 Put -142, -1, -78, -4 in ascending order. -142, -78, -4, -1 Sort -3, -15, 5, 898, 3. -15, -3, 3, 5, 898 Put -3, 2, -13, 38 in ascending order. -13, -3, 2, 38 Put -7, 9, -30, 1, -5, 7 in decreasing order. 9, 7, 1, -5, -7, -30 Sort 737, 0, -177 in decreasing order. 737, 0, -177 Sort 17, 1/5, -1/3, 2/7, 4. -1/3, 1/5, 2/7, 4, 17 Put 1/3, 265, -2/9, 9, 60 in descending order. 265, 60, 9, 1/3, -2/9 Sort 218, -968, 2, -2. -968, -2, 2, 218 Sort 88, 4, -7633, 2 in decreasing order. 88, 4, 2, -7633 Put 0, -6, -3, 5, 505, 2 in decreasing order. 505, 5, 2, 0, -3, -6 Put 5, -5, 26, 6, -41 in ascending order. -41, -5, 5, 6, 26 Sort -10, 10/9, 3, 2, 94 in decreasing order. 94, 3, 2, 10/9, -10 Sort 40, -1, 3/4, -413, 0.1. -413, -1, 0.1, 3/4, 40 Put 1/5, 2, 3, 1, -0.05282, -3/5 in descending order. 3, 2, 1, 1/5, -0.05282, -3/5 Put -5, 2.14, -4, 603 in decreasing order. 603, 2.14, -4, -5 Put 2, -43, 1, 564 in descending order. 564, 2, 1, -43 Sort -5, -193, 2723 in ascending order. -193, -5, 2723 Put 63, -9, 10, 6, 12 in descending order. 63, 12, 10, 6, -9 Put 2/5, 49, 519/4 in descending order. 519/4, 49, 2/5 Sort -1, 2, 1, 190, -0.02, 3/8 in decreasing order. 190, 2, 1, 3/8, -0.02, -1 Sort 5/11, 15, -1/3 in decreasing order. 15, 5/11, -1/3 Put -275, 6, -2, 2 in decreasing order. 6, 2, -2, -275 Sort 8/3, 3, 0.6, -0.2, 13 in ascending order. -0.2, 0.6, 8/3, 3, 13 Sort 0.5, -3/2, -73.8, 3/7, -3/5 in descending order. 0.5, 3/7, -3/5, -3/2, -73.8 Sort -3114, -3, -9, -2. -3114, -9, -3, -2 Sort -5, -2, -1561, -66, 0 in descending order. 0, -2, -5, -66, -1561 Sort 3150/13, -0.01, 2/3 in ascending order. -0.01, 2/3, 3150/13 Sort 0.1, -1, 0.2, 33, -3394 in ascending order. -3394, -1, 0.1, 0.2, 33 Sort 7/4, 0.101, 2, 0, 5. 0, 0.101, 7/4, 2, 5 Sort 385, 0.4, -4. -4, 0.4, 385 Put 2, 3, 31202 in descending order. 31202, 3, 2 Sort -47080, 0, 3, 5 in increasing order. -47080, 0, 3, 5 Put 551, 0.1, 1/5, -4, -2/9, 0.4 in decreasing order. 551, 0.4, 1/5, 0.1, -2/9, -4 Sort -0.02, 0.03, 1/2, -2/9, -120. -120, -2/9, -0.02, 0.03, 1/2 Sort 6, 3, 4, 1, -25 in decreasing order. 6, 4, 3, 1, -25 Put 60, -7, 1, -4, -2 in increasing order. -7, -4, -2, 1, 60 Sort 49935, 2, 0 in descending order. 49935, 2, 0 Put 79, -0.2, -78 in decreasing order. 79, -0.2, -78 Put 0.07, -31, 4, -1, -5, -0.9 in descending order. 4, 0.07, -0.9, -1, -5, -31 Sort 5, 73, 38 in decreasing order. 73, 38, 5 Sort 5, -2, 41, 3 in descending order. 41, 5, 3, -2 Put -600, 3, 696 in increasing order. -600, 3, 696 Sort 84, 28, -5, -94 in ascending order. -94, -5, 28, 84 Sort -25, 3, 5, -5, 4. -25, -5, 3, 4, 5 Put -1, 0, 1, -3, -374 in descending order. 1, 0, -1, -3, -374 Put 0, 0.3, 0.0138, -5, 2/11, 0.2 in decreasing order. 0.3, 0.2, 2/11, 0.0138, 0, -5 Put 1/5, -90, -3, -16 in descending order. 1/5, -3, -16, -90 Sort -6, -215, 2 in decreasing order. 2, -6, -215 Put 5927/5, -1, 9 in descending order. 5927/5, 9, -1 Sort 4, 5, 86738. 4, 5, 86738 Put 58855, -2, -5 in ascending order. -5, -2, 58855 Sort 123, -0.01, 0.4, 1/5, 2 in decreasing order. 123, 2, 0.4, 1/5, -0.01 Put 145, -0.6, -3, 7, 18, -1/8 in descending order. 145, 18, 7, -1/8, -0.6, -3 Put 4.6, -1, 5, -5, 16, 10 in decreasing order. 16, 10, 5, 4.6, -1, -5 Put -37, -3, -0.2599, 0 in increasing order. -37, -3, -0.2599, 0 Sort 2077, 5, 4, 0 in descending order. 2077, 5, 4, 0 Put 0.0049148, -5, 2 in descending order. 2, 0.0049148, -5 Put 2, -246.1, 4, -3/4 in increasing order. -246.1, -3/4, 2, 4 Put -44, -13/2, -0.01 in descending order. -0.01, -13/2, -44 Sort -0.003, -1/3, -2/41, -0.5, 4. -0.5, -1/3, -2/41, -0.003, 4 Put -96, 0, 13, 2, 3 in ascending order. -96, 0, 2, 3, 13 Put -8, 2/11, -0.42, 1, 0.5 in ascending order. -8, -0.42, 2/11, 0.5, 1 Sort 26, 16, -17, -5, 2 in ascending order. -17, -5, 2, 16, 26 Put -3, 2, 14, 0, 654 in decreasing order. 654, 14, 2, 0, -3 Sort 13, 3, 1, -227, 0 in increasing order. -227, 0, 1, 3, 13 Put -5, -0.2, -8/7, 0.7, -6/11 in descending order. 0.7, -0.2, -6/11, -8/7, -5 Put -3/163, 0.5, 0.2, 2/7, 0 in increasing order. -3/163, 0, 0.2, 2/7, 0.5 Sort -13, -1180, -2 in descending order. -2, -13, -1180 Put -1, -48200, -7, 5, 1 in increasing order. -48200, -7, -1, 1, 5 Sort 1, -3, 4, -12 in descending order. 4, 1, -3, -12 Sort -0.09, 14/11, 3, 2/3, 6/31. -0.09, 6/31, 2/3, 14/11, 3 Sort -2, -25, 882, 5. -25, -2, 5, 882 Put 155, -5, 7, 1, -3, -4 in descending order. 155, 7, 1, -3, -4, -5 Sort 0.3, -0.049, 2/7, -4/25 in decreasing order. 0.3, 2/7, -0.049, -4/25 Sort -0.1, 3, -2/5, 7, -2, 752 in ascending order. -2, -2/5, -0.1, 3, 7, 752 Sort 4, 0.4, -4, -3/7, -1/60, 3 in descending order. 4, 3, 0.4, -1/60, -3/7, -4 Put 0.05, -0.3, -6, -1633 in increasing order. -1633, -6, -0.3, 0.05 Sort 1, -18.5, 721, -1/4 in decreasing order. 721, 1, -1/4, -18.5 Sort 91.299, 0.2, 1/3, -5 in ascending order. -5, 0.2, 1/3, 91.299 Sort -1, 761, 2, -0.4. -1, -0.4, 2, 761 Sort -747, -5, -2, 5, 2 in descending order. 5, 2, -2, -5, -747 Sort 1765, -5, 4 in decreasing order. 1765, 4, -5 Sort 3, 4, 193, 5, 0, -4. -4, 0, 3, 4, 5, 193 Sort -0.7, 2, -8/13, -23 in increasing order. -23, -0.7, -8/13, 2 Sort 203, -2/23, -4 in decreasing order. 203, -2/23, -4 Put -0.1, -4, 0.8, 0.2, -0.03 in descending order. 0.8, 0.2, -0.03, -0.1, -4 Put -2/13, -16, -0.4, -8.7 in decreasing order. -2/13, -0.4, -8.7, -16 Sort -5, 2, -3, -0.3, 248 in descending order. 248, 2, -0.3, -3, -5 Sort -2, 0, -5, 1, -29, -3 in ascending order. -29, -5, -3, -2, 0, 1 Sort 10, 5, -4, -3, 4, 71. -4, -3, 4, 5, 10, 71 Sort -2, 9, 31, 3, 6 in increasing order. -2, 3, 6, 9, 31 Put -4, -33, -1, -295 in increasing order. -295, -33, -4, -1 Put 0, 3/20, -3, -5/3, -31, 0.1 in decreasing order. 3/20, 0.1, 0, -5/3, -3, -31 Sort -2, -4, 2011, -5 in increasing order. -5, -4, -2, 2011 Sort -5, 3, 121, -9, 5 in descending order. 121, 5, 3, -5, -9 Put -1, 4, 0, 3, -5, -863 in decreasing order. 4, 3, 0, -1, -5, -863 Put -5, 20, 99, -2 in descending order. 99, 20, -2, -5 Sort -502, -23, -18, 1 in decreasing order. 1, -18, -23, -502 Sort -0.5, -788, 69 in decreasing order. 69, -0.5, -788 Put -72, -9, -20 in ascending order. -72, -20, -9 Put 1, 2, -13, 25, 29 in descending order. 29, 25, 2, 1, -13 Sort 2, -4/3, 6.4, 10, -5, -4 in ascending order. -5, -4, -4/3, 2, 6.4, 10 Put 1, 6, 0, -5, 33, 8 in decreasing order. 33, 8, 6, 1, 0, -5 Sort -4, 23, 32, -1, -2. -4, -2, -1, 23, 32 Put -0.4, 3, 69, 0.1, -0.9 in decreasing order. 69, 3, 0.1, -0.4, -0.9 Put -14, 5, 0, -52 in decreasing order. 5, 0, -14, -52 Put -9, 5, -18, 1, 33 in decreasing order. 33, 5, 1, -9, -18 Sort 19, 3, -1, -68, -3 in descending order. 19, 3, -1, -3, -68 Put -1/10, -0.8, 1/3, 8, 0.4 in decreasing order. 8, 0.4, 1/3, -1/10, -0.8 Sort 14905, 3, 0.23. 0.23, 3, 14905 Sort -0.1, -0.3, 26/129, 0.03 in ascending order. -0.3, -0.1, 0.03, 26/129 Put 6, 17, -9.6 in descending order. 17, 6, -9.6 Sort -637, -1/10, 0.2, 5/3 in decreasing order. 5/3, 0.2, -1/10, -637 Sort 2, 1, 328, -5 in descending order. 328, 2, 1, -5 Put 26, 0, 1058 in increasing order. 0, 26, 1058 Sort 0.6, 4, 4/291, -5. -5, 4/291, 0.6, 4 Put -2/9, 5, 676, 0.15 in increasing order. -2/9, 0.15, 5, 676 Sort 0.2, -2, 3, -478, 0, -1/3 in ascending order. -478, -2, -1/3, 0, 0.2, 3 Sort 0.2, -2/7, -0.06, -69/7, 0, 3. -69/7, -2/7, -0.06, 0, 0.2, 3 Put 1.17, 2/37, 43 in decreasing order. 43, 1.17, 2/37 Sort 789, -2, -30, -1 in descending order. 789, -1, -2, -30 Sort -81, 434, 3, -4 in increasing order. -81, -4, 3, 434 Sort -1.4953, 2/5, 5. -1.4953, 2/5, 5 Sort -16857, -1.5, -5 in descending order. -1.5, -5, -16857 Sort 23, -17, -68 in ascending order. -68, -17, 23 Put 279, 2, -453, -1, 4 in ascending order. -453, -1, 2, 4, 279 Put -0.1, -10, -3.2, 5, 79 in decreasing order. 79, 5, -0.1, -3.2, -10 Sort 3, 34, 1, -9, 4 in decreasing order. 34, 4, 3, 1, -9 Sort 4, 0.02545, -0.5 in decreasing order. 4, 0.02545, -0.5 Sort 0.5, -0.2, 3.0656. -0.2, 0.5, 3.0656 Sort 19/28, 3, 4, -2/11, -1/7 in descending order. 4, 3, 19/28, -1/7, -2/11 Sort 78, 0, -28, 4, -9. -28, -9, 0, 4, 7	{ "pile_set_name": "DM Mathematics" }
that -2o2 + 3246o + 19548 = 0. -6, 1629 Factor u*2/5 - 168523952u/5 + 7100080599424576/5. (u - 84261976)*2/5 Factor 19m*2/5 - 8402m/5 - 173712/5. (m - 462)(19m + 376)/5 Determine p, given that -5p4 - 1067590p*3 - 56995960080p*2 - 911643932410p + 968640960085 = 0. -106751, -17, 1 Find b such that -6b5/7 - 12056b*4/7 - 8035532b*3/7 - 1749939984b*2/7 + 2542743406b + 26824267096/7 = 0. -673, -4/3, 11 Factor -2p2/3 - 13424p/3 - 2300672/3. -2(p + 176)(p + 6536)/3 Solve -215s4/6 - 6505s*3/2 - 294500s*2/3 - 1073120s - 2284800 = 0. -40, -24, -119/43 Find a such that a*5 + 363a*4 - 19564a*3 + 256512a*2 - 237312a = 0. -412, 0, 1, 24 Let 5g3 - 2763915g*2 - 5g + 2763915 = 0. What is g? -1, 1, 552783 Determine b so that -b*2/4 - 40077b/4 + 100205/2 = 0. -40082, 5 Suppose -i*2/4 + 311313i/4 + 2646305/2 = 0. Calculate i. -17, 311330 Factor 3h3/7 + 399243h*2/7 + 798474h/7. 3h(h + 2)(h + 133079)/7 Factor -7l*3/2 - 54655943l*2/6 - 17781380928020l/3 + 846732487112/3. -(l + 1301332)*2(21l - 1)/6 Suppose -s4 + 1917s*3 - 1037535s*2 + 102156919s + 6876856980 = 0. Calculate s. -45, 196, 883 Factor 2d2/5 - 19353368d/5 - 3870674. 2(d - 9676685)(d + 1)/5 What is p in -p*2/2 - 449292p - 14376832 = 0? -898552, -32 Find j, given that 10840j2 - 145j = 0. 0, 29/2168 Factor 2i3 - 25830i*2 + 1210276i - 8801712. 2(i - 12868)(i - 38)(i - 9) Factor -2w*4 - 1888w*3 - 1886w*2. -2w*2(w + 1)(w + 943) Find q such that -38086q*4/3 - 2970698q*3/3 - 25745876q*2 - 669379256q/3 + 175760/3 = 0. -26, 5/19043 Let -k*3/5 + 248k*2 + 936519k/5 + 559674 = 0. Calculate k. -527, -3, 1770 Factor -33c2 - 2807889c + 19656840. -3(c - 7)(11c + 936040) Solve 15y*3 + 14105736y*2 + 5642292y = 0. -940382, -2/5, 0 What is d in 2d3/7 + 13049402d*2/7 - 13049416d/7 - 78296424/7 = 0? -6524702, -2, 3 Find g such that 3g3/2 - 298653g*2/2 + 1791837g/2 - 2687715/2 = 0. 3, 99545 Determine n so that -2n5 - 14176n*4 - 25006010n*3 + 404231844n*2 + 883425024n + 454201344 = 0. -3552, -1, 18 Factor -q*4/3 + 309412q*3 - 215407374388q*2/3 + 287206119584q - 861614645824/3. -(q - 464116)*2(q - 2)*2/3 Find a such that 4a*5 + 1064a*4 + 77756a*3 + 924424a*2 + 2244816a + 1397088 = 0. -126, -11, -2, -1 Factor n*4/2 - 113105n*3/2 + 3198354907n*2/2 - 9594046803n/2. n(n - 56551)2(n - 3)/2 Factor -y*2 - 102423y. -y(y + 102423) Let -2k*5/5 - 1578k*4/5 + 206628k*3/5 - 4960768k*2/5 - 81641472k/5 = 0. What is k? -906, -11, 0, 64 Suppose -7q3/3 - 2311618q*2/3 - 63617543485q - 581581702848 = 0. Calculate q. -165111, -64/7 Solve -3j2/7 - 402j/7 + 3557376/7 = 0 for j. -1158, 1024 Determine u so that -2u5/17 + 1164u*4/17 - 7526u*3 + 108732u*2 = 0. 0, 17, 123, 442 What is n in -1625n*3/3 - 3448n*2 - 6063n - 1782 = 0? -3, -594/1625 Suppose 3x2/5 - 43886277x/5 + 35109012 = 0. Calculate x. 4, 14628755 Factor -10a3 + 1951696455a*2 - 95227975823565060a - 47613988399706645. -5(a - 97584823)2(2a + 1) Determine z, given that 308z*4/5 + 999316z*3/5 - 18557336z*2/5 + 8509616z/5 - 939744/5 = 0. -3263, 2/11, 2/7, 18 Suppose 27r4 - 1149r*3 - 1704r*2 - 528r = 0. What is r? -1, -4/9, 0, 44 Factor -4p2 + 22184632p - 30759868560964. -4(p - 2773079)2 Solve 11j*5/3 - 9695j*4/3 - 28174j*3 - 26440j*2/3 + 1349536j/3 + 968320 = 0. -51/11, -4, 4, 890 Determine a, given that a*3/7 - 7002a*2/7 - 352704a/7 + 733408/7 = 0. -52, 2, 7052 Factor n*3 + 843n*2 + 141215n + 5800725. (n + 63)(n + 145)(n + 635) Factor -2o4/11 + 165122o*3/11 - 3408076798o*2/11 - 3408241922o/11. -2o(o - 41281)*2(o + 1)/11 Solve -3z3 - 9525z*2 - 579018z = 0. -3113, -62, 0 Determine z, given that 2z3/5 - 359832z*2/5 + 22303818z/5 - 345679388/5 = 0. 31, 179854 Let -2k3 - 960k*2 - 61368k - 519680 = 0. What is k? -406, -64, -10 Factor -2f2/9 + 52468f/9 + 321310. -2(f - 26289)(f + 55)/9 Determine b so that -2b4/3 + 5603786b*3/3 - 1308431262012b*2 - 11775920584640b/3 - 7850621194816/3 = 0. -2, -1, 1400948 What is o in 1077o4 + 34823715o*3 + 375329935602o*2 + 1348434651647748o - 3756088292856 = 0? -10778, 1/359 Suppose -2l3/5 + 34948l*2/5 + 3691382l/5 + 3656432/5 = 0. What is l? -104, -1, 17579 Factor s*2/9 - 761939s/3 - 18286600/9. (s - 2285825)(s + 8)/9 Let -m3 + 244097m*2 - 244096m = 0. Calculate m. 0, 1, 244096 Suppose 2r2 - 21759956r + 59186960640242 = 0. Calculate r. 5439989 Determine d, given that 3d2/2 - 19736001d/2 + 29603988 = 0. 3, 6578664 Determine q, given that q*4/3 - 66338q*3 + 2587012q*2/3 + 66338q - 2587013/3 = 0. -1, 1, 13, 199001 Determine p, given that -p*2/5 + 75361p/5 - 1054858/5 = 0. 14, 75347 Find z such that 2z5/11 - 2116z*4/11 - 705480z*3/11 - 42198192z*2/11 + 1331942400z/11 - 8644320000/11 = 0. -150, 12, 1334 Suppose -9j5 - 4595j*4 - 548333j*3 + 10178911j*2 + 74022402j - 34861176 = 0. What is j? -263, -6, 4/9, 21 Factor -2l3 - 2454l*2 + 24762l + 27214. -2(l - 11)(l + 1)(l + 1237) Factor f5/3 + 59746f*4/3 + 59743f3. f3(f + 3)(f + 59743)/3 Solve -3a4 - 7662a*3 - 136989a*2 - 114018a + 258672 = 0 for a. -2536, -17, -2, 1 Factor 5w3 - 3880w*2 - 151455w + 853650. 5(w - 813)(w - 5)(w + 42) Find h such that 2h*3/7 - 41595094h*2/7 + 30895571629450h - 30895565687294 = 0. 1, 10398773 Factor -u*3/2 + 7729u*2/2 - 46312u + 77170. -(u - 7717)(u - 10)(u - 2)/2 Factor 3y3 - 68466705y*2 + 390640773563064y + 390640842029772. 3(y - 11411118)2(y + 1) Let p*3 + 357401p*2/3 - 2621095p/3 + 833987/3 = 0. What is p? -119141, 1/3, 7 Let -h*3/5 - 206h*2 + 81251h/5 + 935220 = 0. What is h? -1100, -39, 109 Factor -2r5/7 - 1534r*4/7 + 6156r*3/7 - 9244r*2/7 + 6166r/7 - 1542/7. -2(r - 1)4(r + 771)/7 Determine j so that 2j5/5 - 46j*4/5 - 152j*3 + 2040j*2 = 0. -17, 0, 10, 30 Find r such that 3r*3 + 1938975r*2 + 7755864r + 7755852 = 0. -646321, -2 Factor k*3 + 2017k*2 + 71351k + 69335. (k + 1)(k + 35)(k + 1981) Solve -2h4/7 - 124h*3/7 - 1018h*2/7 + 1144h/7 = 0 for h. -52, -11, 0, 1 Determine q, given that 45q4 + 850805q*3 + 121401605q*2 + 93719755q - 26831090 = 0. -18763, -143, -1, 2/9 Factor -5d2 + 5369460d + 10738940. -5(d - 1073894)(d + 2) Factor 2c3/7 - 45970c*2 + 12945048446c/7 - 116479372482/7. 2(c - 80443)2(c - 9)/7 Factor 2h2/9 - 1354756h + 2064784296978. 2(h - 3048201)2/9 Determine p, given that 2p*2/13 + 760964p/13 + 2282874/13 = 0. -380479, -3 Factor t*2 - 1784t + 412503. (t - 1511)(t - 273) Solve -2p*2/9 + 90796p/9 + 23636992/3 = 0. -768, 46166 Suppose -3m3 - 9302052m*2 + 167437665m - 753470586 = 0. Calculate m. -3100702, 9 Let -4j3/7 + 19557j*2/7 - 43985j/7 + 9774/7 = 0. What is j? 1/4, 2, 4887 Find b, given that -131b4/2 + 802b*3/3 - 2093b*2/6 + 473b/3 - 32/3 = 0. 32/393, 1, 2 Factor z*2/4 - 13546z + 1055067. (z - 54106)(z - 78)/4 Factor -4u*4 + 9664u*3 + 332044u*2 + 2832200u. -4u(u - 2450)(u + 17)2 Let 3j*3 + 37098j*2 + 118131552j + 21126334080 = 0. What is j? -6088, -190 Suppose -2d4/7 + 11295504d*3/7 - 56477476d*2/7 + 33886464d/7 + 14522778 = 0. What is d? -1, 3, 5647747 Factor -5w3 - 103550w*2 - 207040w + 828320. -5(w - 2)(w + 4)(w + 20708) Factor 5j*3/2 - 881385j*2/2 + 38765623875j/2 + 6732857790625/2. 5(j - 88225)2(j + 173)/2 Factor -2v2/17 - 11116v/17 - 648882/17. -2(v + 59)(v + 5499)/17 Factor d*2/3 - 259849570d/3 + 16880449757296225/3. (d - 129924785)*2/3 Let 3c*3/8 - 2979c*2/8 - 32847c - 692406 = 0. Calculate c. -44, -39, 1076 Suppose 2b5/9 + 11870b*4/9 + 35594b*3/9 + 11858b*2/9 - 35596b/9 - 23728/9 = 0. Calculate b. -5932, -2, -1, 1 Solve 25f4 + 192570f*3 + 1500885f*2 + 2770120f - 615600 = 0 for f. -7695, -4, 1/5 Suppose 3p3 - 70776p*2 - 25915761p - 2354270982 = 0. What is p? -181, 23954 Suppose 34f4 - 934f*3 + 5564f*2 + 4696f - 9360 = 0. What is f? -26/17, 1, 10, 18 Suppose 5p3/2 - 10930p*2 + 11200155p/2 + 68779170 = 0. Calculate p. -12, 607, 3777 Fa	{ "pile_set_name": "DM Mathematics" }
is the third derivative of 25o4 - o3 - 220o*2? 600o - 6 What is the derivative of cx3 - 41cx + 20c + x*3 + 163x2 - 10 wrt c? x3 - 41x + 20 What is the third derivative of ac*3x*3 + 2ac2x - 53acx3 + 3c*3x2 + c3x + 11c*2x*2 - 28cx3 wrt x? 6ac3 - 318ac - 168c What is the second derivative of 415v3 + 3v - 222 wrt v? 2490v Find the first derivative of -84j*2 - 58 wrt j. -168j Find the third derivative of 2b3n*2 + 676b*3q*2 + 7b*2n*2q - 3bn*2q + 5nq*2 wrt b. 12n*2 + 4056q2 Find the second derivative of f5 + 75f4i - 3f2i - f*2 + fi + 418f + 1 wrt f. 20f*3 + 900f*2i - 6i - 2 What is the second derivative of -801s*2u*2 - 3s*2 + 99su wrt u? -1602s*2 Find the second derivative of 13i*5m - 24i4m + 259im + 2i wrt i. 260i*3m - 288i2m Find the second derivative of -38p2r*2 + 415p*2r + 2p2 wrt r. -76p2 What is the third derivative of -g3n4 + 82g*3n*2 + 2g*3n + g*2n*2 - 2369n4 + n2 wrt n? -24g3n - 56856n Find the third derivative of -2n*3ot + 6n*3t + 7n3 + n2t - 5not - 2no wrt n. -12ot + 36t + 42 What is the third derivative of -2b4n - 3b4 + 2b*3no + b3o - 4b2no + 3b*2o + b*2 + 2bno wrt b? -48bn - 72b + 12no + 6o Find the second derivative of -64c4z - c*3z - 17cz + 2z wrt c. -768c*2z - 6cz What is the first derivative of 1214a4 - 1224 wrt a? 4856a*3 Find the second derivative of -2400r*5 - 2873r. -48000r3 Find the second derivative of 2t*5 - 229t*3 + 782t. 40t3 - 1374t Find the second derivative of -9b2c*2v - 4b2c + b*2v + 10b2 + 26bc2 + 5bv - c2 wrt c. -18b*2v + 52b - 2 Differentiate -20807p - 25723 with respect to p. -20807 What is the derivative of 44t - 44? 44 Find the third derivative of 6362aij*4 + aij2 + aij - 3ai + 64aj - 2i wrt j. 152688aij What is the second derivative of -279g*3 - 3g + 640 wrt g? -1674g Find the third derivative of cf*5 + 94cf4 - 136c + 10f2 wrt f. 60cf2 + 2256cf Find the third derivative of -407t*2y*4 + 12t*2 - 14ty2 + y4 wrt y. -9768t*2y + 24y Find the third derivative of -1172v*3 - 798v*2. -7032 What is the second derivative of 323w*2y*3 - 3w*2y + 2wy + 453y3 wrt w? 646y*3 - 6y What is the second derivative of 883x5 - 2929x wrt x? 17660x3 Differentiate 2f*2st + f2t - 8fgt3 + gst3 - gs + gt - 4st3 wrt s. 2f*2t + gt3 - g - 4t*3 What is the third derivative of 4i*6z - 2i6 - i4 - 8i*2z - 4iz + 2i wrt i? 480i*3z - 240i3 - 24i What is the second derivative of 7l3w - 2lw + 8w - 5 wrt l? 42lw What is the third derivative of 1327c*5v - 2c3v3 - c2v2 + 5cv3 + 56v*3 wrt c? 79620c*2v - 12v3 Find the first derivative of 87gn2ry2 - 4gn2ry + 351n*2y*2 + 5n*2 - ry wrt g. 87n2ry2 - 4n*2ry Find the second derivative of -5o*3y*2 + 2o*3 + 45o*2y*2 + 23o*2y + 2oy - 2y4 wrt y. -10o*3 + 90o*2 - 24y*2 What is the second derivative of 1119k*4 - 1963k? 13428k2 Differentiate 7047ku2 + ku + 3k + 2278 with respect to u. 14094ku + k Differentiate -5r*4 + 6r*2 + 153. -20r*3 + 12r Find the first derivative of 1455az - 9380a - 4z wrt z. 1455a - 4 What is the first derivative of 5s*2 + 321s + 4504 wrt s? 10s + 321 What is the first derivative of -1507f*2j*2q - f*2j*2 - 114j*2q + 3j2 wrt f? -3014fj2q - 2fj*2 What is the derivative of -1907gl + 332l wrt g? -1907l What is the second derivative of dy*3 + 18dy2 - 2dy - 3d + 2y wrt y? 6dy + 36d Differentiate -7n2y - 8n2 - 322ny + 10n wrt y. -7n2 - 322n Find the third derivative of -3140i3l*2 - 2i*3 - 603i*2 - 2i + 2l2 wrt i. -18840l*2 - 12 Find the third derivative of -4sy4 + sy*2 + 9sy + 2s + 71y4 wrt y. -96sy + 1704y Find the second derivative of -c*5q*2 + 794c*4q*2 + 3c + 2511q2 + 2 wrt c. -20c*3q*2 + 9528c*2q*2 Find the third derivative of 4h*6 + 15h*5 - 3h*3 - 211h*2 - 12h - 1. 480h3 + 900h*2 - 18 What is the derivative of -811c*3q + 781c3 wrt q? -811c3 What is the derivative of l4r + l4 - 149l*2r*2 + 842r*2 wrt l? 4l*3r + 4l3 - 298lr2 What is the first derivative of -1477u - 1147? -1477 What is the first derivative of -67xz*3 - 2xz2 + 2xz - 106x + 26 wrt z? -201xz*2 - 4xz + 2x Find the second derivative of 121h2x3 + h2 + 3h + 9x*3 wrt h. 242x*3 + 2 Find the first derivative of 2tx + 98t - 325x wrt t. 2x + 98 What is the second derivative of -2nr*3 - 3nr2 + 59nr + 2r*3 - 5 wrt r? -12nr - 6n + 12r What is the derivative of -6g*2 - 12gr - 161r wrt g? -12g - 12r Find the first derivative of 239u4 + 265 wrt u. 956u*3 Find the second derivative of -167h*3 + 11h*2 - 658h - 1 wrt h. -1002h + 22 Find the second derivative of 424j*4 + 508j wrt j. 5088j2 Find the third derivative of 65k*3 + 29k*2 - 7 wrt k. 390 Find the third derivative of -42k*3rv2 - 2k*3rv - 2k*3v + 3k2rv2 + k2rv - 125k*2v*2 - 2v*2 wrt k. -252rv2 - 12rv - 12v Find the third derivative of 4786a2o*3 - 179a*2o*2 - 2ao4 + o2 wrt o. 28716a*2 - 48ao What is the derivative of 10ix3 + 218x*3 wrt i? 10x*3 What is the third derivative of 196cms*3 + 14cms*2 - 23cs2 - 7ms3 - 2ms2 wrt s? 1176cm - 42m What is the first derivative of -1384s2 - 1402? -2768s What is the derivative of 3061m3x - 2mx*2 - 15x*2 + 48x wrt m? 9183m2x - 2x2 What is the first derivative of 35i + 225? 35 What is the third derivative of -654o3x + 36o2x + 2o + 2x wrt o? -3924x What is the first derivative of 176a - 76 wrt a? 176 Find the third derivative of -3g4x*3 + 44g4 - g3x2 - 2g*2x*3 + 4g*2x - 288gx wrt g. -72gx*3 + 1056g - 6x2 What is the derivative of -4f*3k*2p + f*3 - 2f*2p*2 + 119f*2 - 166fk2p*2 - fp*2 wrt k? -8f*3kp - 332fkp*2 Find the third derivative of 470w*6 - 21w*2 wrt w. 56400w*3 What is the second derivative of 3d*4 - 95d*3 + 4182d? 36d2 - 570d What is the second derivative of 326p4 + 7p + 1 wrt p? 3912p2 Differentiate -130z*2 - 2z - 143 wrt z. -260z - 2 What is the third derivative of -83h*3m + 10h3 - 274h*2m + 2h2 - 2m wrt h? -498m + 60 What is the second derivative of -84cs5 + 2cs3 + cs + 8c - 2s*3 wrt s? -1680cs3 + 12cs - 12s Differentiate 21i2r + 4656i2 - 24r*4 wrt r. 21i*2 - 96r*3 Find the third derivative of -34h*2v*6 - 272h*2v*2 wrt v. -4080h*2v*3 What is the third derivative of -14165o*3x*3 - 3o*3x*2 + 97o*2x*2 wrt x? -84990o*3 What is the second derivative of -2c*3i*2 + 23c*3i - 2c3 - 3413c*2i*4 - ci + 24 wrt i? -4c3 - 40956c*2i*2 Find the second derivative of 4i*4 + 1529i*2 + 758i - 2 wrt i. 48i2 + 3058 Find the third derivative of -2602k*3l*3z + k*3ln3z + 2k2l*2z + k*2nz + 2kl3nz - 2kln*3z + 30lnz + 5z wrt k. -15612l3z + 6ln*3z What is the third derivative of -20468z3 + 4944z*2 - 1 wrt z? -122808 What is the derivative of -476q + 256? -476 Find the second derivative of -13mw*2x - 5mwx - 5mw - 50w*2x*2 + 15wx2 wrt w. -26mx - 100x*2 Find the first derivative of -3y*3 + 8y*2 + 700. -9y*2 + 16y What is the third derivative of 3c2u*3 + 429c*2u - 16cu*2 - 2157u*3 wrt u? 18c*2 - 12942 What is the first derivative of 4m*2r*2y - m*2y + 5m2 - 2mr3y - 2m wrt r? 8m*2ry - 6mr2y Find the third derivative of -126g5 + 3g*2 - 10g wrt g. -7560g2 Find the third derivative of 2b*5 + 2395b4 + b3 - 4b2 + 1234b wrt b. 120b2 + 57480b + 6 What is the derivative of 62n2 + 5n + 9552? 124n + 5 What is the third derivative of -432q*5 - 2q*4 - 44q*2 - 3q? -25920q2 - 48q What is the third	{ "pile_set_name": "DM Mathematics" }
equal to 922769? True Which is bigger: -1 or -2/58298259? -2/58298259 Which is smaller: -114540 or -114541? -114541 Is 434/1075 bigger than -1? True Is 59755 bigger than 59752? True Is 21 < 1372/65? True Which is bigger: 14 or 1555? 1555 Are 307 and 24 non-equal? True Which is greater: -7.738 or -2/9? -2/9 Is 1195602 at least 1195604? False Which is smaller: 1673 or 1726? 1673 Are -1 and -2420/1941 non-equal? True Is 3/20 < -131/1089? False Which is bigger: 1 or -1/3183970? 1 Which is bigger: -1142/125 or -8? -8 Is -14 equal to -8.843? False Which is smaller: -83465 or 0? -83465 Which is bigger: -789/23 or -33? -33 Do 23786 and 23788 have different values? True Is 924004 greater than 924004? False Does 0.0341 = -78? False Which is greater: 1075/1128 or 0? 1075/1128 Is -1 >= -1/266171? False Which is smaller: 1633/64 or 1? 1 Which is greater: -1504 or -924? -924 Which is bigger: 4513.55 or -3? 4513.55 Which is smaller: -14 or 3078? -14 Which is smaller: 1 or 43/1355? 43/1355 Is -1047931 > -1047931? False Is -1703 >= -14.3? False Is -10411 at most 35? True Which is bigger: 65 or -703? 65 Is -2/7 <= 12435.2? True Which is smaller: 20260 or 20261? 20260 Which is bigger: -3 or -0.11403? -0.11403 Which is greater: 11457/2 or -4? 11457/2 Which is smaller: -3/59 or 3/76? -3/59 Which is smaller: -4 or -3307/630? -3307/630 Is -28 >= -11073? True Is 15 less than 15639? True Which is greater: 44 or -22098? 44 Which is bigger: 236/1065 or -1? 236/1065 Which is smaller: -933900 or -933899? -933900 Is 4 greater than 1553/319? False Which is greater: 3406/57 or 60? 60 Which is bigger: -68714 or -68716? -68714 Which is bigger: 8594 or 77354/9? 77354/9 Which is bigger: -959 or -146644/153? -146644/153 Which is greater: 663 or 1154? 1154 Which is bigger: -1 or 1/98515? 1/98515 Which is smaller: -1 or 17/10158? -1 Which is greater: 17243/52 or 333? 333 Is 4/33571 != 1? True Is -3 at most as big as -15.745? False Which is smaller: -66785 or -66787? -66787 Is -70154 at most as big as -2? True Does -26 = -135? False Is 398975 not equal to -9? True Which is greater: -15961/21 or -761? -15961/21 Is 3/311776 at least as big as 1? False Is -1.7068 < 1.66? True Is 0 != 24/41189? True Are -237 and 454 equal? False Which is bigger: -75154 or -75147? -75147 Which is smaller: 25.52 or -1/17? -1/17 Are -2/1655051 and -1 equal? False Which is smaller: 54834 or 712858/13? 54834 Which is smaller: 43 or -7/15? -7/15 Which is smaller: 230109/13 or 17702? 230109/13 Is -1 smaller than -3/1226647? True Which is greater: -589/488 or 0? 0 Do -1396351/2 and -698176 have different values? True Is -4474225 less than -4474225? False Is -1241.683 at most as big as 1/3? True Which is bigger: 23835/8 or 2978? 23835/8 Which is smaller: -4664 or 17? -4664 Are -62 and -2255/37 equal? False Is -5/16189 < 0? True Which is smaller: -5869 or -5870? -5870 Which is smaller: -2 or 2757.3? -2 Is -1 <= -362/617? True Which is greater: 1052 or 10? 1052 Are -315646 and -1262587/4 unequal? True Is -109637 smaller than -109646? False Is 0 > -0.9716? True Which is bigger: -568114 or -2? -2 Are -601 and -220 unequal? True Is 6/10439 >= -1? True Which is smaller: -1366 or -0.82? -1366 Which is bigger: -383 or -55? -55 Is 1 less than -72/8009? False Which is smaller: 1679725 or 1679727? 1679725 Which is greater: 0 or -350/37621? 0 Which is greater: 18835 or 18841? 18841 Is 0 at least as big as 418/1593? False Is 26288 < 7/5? False Which is greater: 117295 or 117293? 117295 Do -2/29442991 and 1 have the same value? False Which is greater: 10638 or 10637? 10638 Which is bigger: -6034 or 57/5? 57/5 Is -3 greater than or equal to 3976? False Is -1 > 1/147037? False Is -86.896 at most as big as 0.3? True Which is greater: 14199 or 32? 14199 Is 5827 <= 796? False Which is smaller: -19086/89 or -213? -19086/89 Is 109446 != 109447? True Is -7462296 not equal to -7462296? False Is -2090 not equal to -2089? True Is 39 at least as big as 25362/7? False Which is smaller: -111 or -795? -795 Are -75743 and -75746 non-equal? True Which is smaller: -1678 or 8? -1678 Which is smaller: -1 or -9/244366? -1 Is 1 >= 5/33136? True Which is smaller: -211 or 68? -211 Which is bigger: 465 or -53? 465 Which is bigger: 132/995 or -1? 132/995 Is -193/57 less than or equal to -116? False Which is greater: 7226 or 50581/7? 7226 Does 5/1034 = -145? False Which is bigger: 0 or 7/28958? 7/28958 Which is smaller: -19425 or -19421? -19425 Is 1667 >= 1710? False Are -2499 and -34973/14 non-equal? True Is 1/2 <= 2817.22? True Is 535076 at most as big as 535076? True Which is smaller: -466/55 or -9? -9 Is -1/3 <= -1/43452? True Is 53 smaller than 0.2047? False Is -138 < -6/5? True Which is smaller: 2869.54 or -3? -3 Which is smaller: 120939 or 120957? 120939 Is 2/3 <= -2169447? False Is -1 smaller than -41/1523? True Are 2511 and -1/59 non-equal? True Is 1 bigger than 7/50024? True Does -28.75 = 1? False Does 1 = -4504891? False Is 37414 smaller than 37426? True Is -18 less than -950/49? False Is 1 <= -138/9749? False Which is smaller: -9 or -215/21? -215/21 Are -5 and -61744 unequal? True Are 3/5 and 6954 non-equal? True Are -273497 and -273497 non-equal? False Which is smaller: 16.36 or -57.5? -57.5 Which is bigger: -770 or -743? -743 Which is greater: 15077 or 346776/23? 346776/23 Are 74/99887 and 1 equal? False Which is smaller: -327 or 556? -327 Which is greater: 1716329 or 1716332? 1716332 Which is smaller: 1632 or 1646? 1632 Is 601197 less than or equal to 601196? False Which is bigger: 553/358 or 1? 553/358 Which is smaller: 560834 or 560837? 560834 Are -1 and 250/8527 nonequal? True Is 0 greater than or equal to -2/635717? True Is 0 at least as big as 1/105569? False Which is bigger: 0 or -121/13894? 0 Is 318247 < 318254? True Is -48807 not equal to -48807? False Which is greater: -1509.3 or 10? 10 Which is bigger: 2177103 or 2177101? 2177103 Which is bigger: 167553 or 167550? 167553 Which is smaller: 344.7 or 44? 44 Which is bigger: -30/36529 or 1? 1 Which is bigger: 1 or 5/583? 1 Is 0.2 < 208196? True Which is smaller: 0 or -239143? -239143 Which is bigger: 79014 or 79013? 79014 Is 1137/118 less than or equal to 9? False Which is smaller: 9 or 5406? 9 Is 384 greater than 302? True Which is greater: -2/462109 or -1? -2/462109 Is 1/59895 greater than or equal to 1/2? False Which is smaller: 95874 or 95871? 95871 Which is bigger: 0.3 or -0.10425? 0.3 Are 79772/47 and 1697 equal? False Is -0.3 greater than -0.049? False Which is greater: 69/7495 or -1? 69/7495 Is 587/280 < 3? True Which is smaller: 1481360 or 1481358? 1481358 Is -2 != 4025465? True Are 273/29 and 4/13 equal? False Do -378/2201 and -1 have different values? True Are 2619 and 2631 nonequal? True Is -1755 greater than -1921? True Which is greater: 3257707 or 3257708? 3257708 Which is bigger: -184 or -164? -164 Which is bigger: 0.0269 or 191/5? 191/5 Is -3080230 at least as big as -3080229? False Which is smaller: -1 or -1/135227? -1 Which is smaller: 116/4871 or -1? -1 Is 268 at least 1691? False Which is smaller: -8725 or -43629/5? -43629/5 Which is bigger: 4898975 or 4898976? 4898976 Is 0 smaller than 14/18705? True Which is bigger: -1/65 or -286? -1/65 Which is smaller: -4111 or -3849? -4111 Which is smaller: 144669 or 144668? 144668 Which is bigger: 75453 or 75455? 75455 Which is smaller: -1/9839167 or -1? -1 Are 49262 and 197049/4 unequal? True Is 4/55 at least 44909? False Is -11315 < -11334? False Which is bigger: 24 or 951? 951 Which is greater: 194936 or 2? 194936 Do -7438382 and -7438381 have different values? True Is -9836 less than -9735? True Which is greater: -215 or -28? -28 Which is smaller: -2030200 or -2030201? -2030201 Is -13038457 at most as big as -13038458? False Is 57592 > 57590? True Is -444377/5 at most as big as -88875? True Which is smaller: 1 or -118/283? -118/283 Is -1364972 < -1364971? True Which is bigger: -14 or -278/21? -278/21 Which is smaller: -80814/529 or -153? -153 Are -198175 and -1/4 unequal? True Which is smaller: 202788 or 202787? 202787 Is -12971/26 <= -498? True Is -73/28331 less than or equal to 1? True Which is greater: 143595 or 143596? 143596 Which is greater: 95946 or 95948? 95948 Are 166562 and 166565 unequal? True Which is	{ "pile_set_name": "DM Mathematics" }
In base 6, what is -3 + 505514? 505511 In base 8, what is -137 - -15256? 15117 In base 5, what is -4 + -2012433? -2012442 In base 7, what is -4 + 261646? 261642 In base 16, what is -81a + 42? -7d8 In base 13, what is 1 - -1907b7? 1907b8 In base 12, what is 4 - -8605? 8609 In base 9, what is 27 - 48371? -48343 In base 3, what is -111000021102 - 11? -111000021120 In base 11, what is 2 - -7a8982? 7a8984 In base 13, what is 0 + -3b553? -3b553 In base 7, what is -11 - 64652? -64663 In base 5, what is -1102023 + 2? -1102021 In base 16, what is 0 + 2a72? 2a72 In base 15, what is 30 + -1dd? -1ad In base 2, what is 11 - 11110101110111110? -11110101110111011 In base 9, what is -6628037 - 4? -6628042 In base 9, what is -3 - -1080? 1076 In base 13, what is 1 + 339a86? 339a87 In base 12, what is 15 + 5b? 74 In base 6, what is 244 - 1203? -515 In base 15, what is -4144 - -2? -4142 In base 3, what is -100200 - -201222101? 201121201 In base 10, what is 129 - -441? 570 In base 14, what is 11 - -7442? 7453 In base 9, what is -13 - 60648? -60662 In base 3, what is -202021012 + 20? -202020222 In base 13, what is 64 + -195? -131 In base 4, what is 1 - 32000323? -32000322 In base 13, what is -17105 + 5? -17100 In base 9, what is 3 + -88708? -88705 In base 10, what is -13 - 3723? -3736 In base 13, what is 7226c + -2? 7226a In base 16, what is -5 + -6978? -697d In base 9, what is 381 + 128? 520 In base 2, what is -10101011 - 101001? -11010100 In base 15, what is 2981 - -6? 2987 In base 11, what is -5877 + 13? -5864 In base 6, what is -1144 + 42? -1102 In base 5, what is -321232 - 30? -321312 In base 12, what is -14a + 929? 79b In base 16, what is 5 - 79f? -79a In base 11, what is -1a548 + 5? -1a543 In base 2, what is 11110100111 + 10000010? 100000101001 In base 2, what is 101001101010 - -1000100? 101010101110 In base 14, what is -1 + 183? 182 In base 8, what is 71 - 47? 22 In base 14, what is 566644 - 3? 566641 In base 4, what is 1 - -21031203? 21031210 In base 11, what is -91 - 282? -363 In base 4, what is 10130 + 1220? 12010 In base 8, what is 2 - -543121? 543123 In base 11, what is -62 - -122? 70 In base 7, what is -4103132 + -4? -4103136 In base 11, what is -5919 + 42? -5887 In base 7, what is 502 - -41? 543 In base 6, what is -14032532 + 3? -14032525 In base 6, what is 211253 + 14? 211311 In base 8, what is 1327 + 37? 1366 In base 15, what is 2 + -d6daa? -d6da8 In base 10, what is -918 + 7? -911 In base 16, what is -35 - 2e0? -315 In base 9, what is 5 + 155386? 155402 In base 7, what is -440030 - 6? -440036 In base 14, what is 4b18 + -4? 4b14 In base 2, what is 10011101 + 10110100000010? 10110110011111 In base 8, what is -1 - 27565? -27566 In base 3, what is 1 - -122202201? 122202202 In base 6, what is 32533 - -3? 32540 In base 2, what is 0 - -10000010100111010? 10000010100111010 In base 8, what is -14630646 + 0? -14630646 In base 15, what is 25be + 3? 25c2 In base 16, what is -87 + -9bb? -a42 In base 2, what is -1000 - -110101001101100110? 110101001101011110 In base 9, what is -61 - -8376? 8315 In base 7, what is -350163 - -4? -350156 In base 4, what is -1111121302 - -3? -1111121233 In base 2, what is -111110101101000 + 11? -111110101100101 In base 5, what is -24141 - -123? -24013 In base 16, what is -4d - 583? -5d0 In base 3, what is 11012220 + 2100? 11022020 In base 16, what is af + be? 16d In base 6, what is -224 + 24152? 23524 In base 12, what is 5 - 89994b? -899946 In base 13, what is -318 - 3a? -355 In base 14, what is -a392 + -15? -a3a7 In base 4, what is 32002301 + 220? 32003121 In base 9, what is 4 + -1407212? -1407207 In base 4, what is -201323 + 3103? -132220 In base 12, what is -1b5b + -b1? -2050 In base 13, what is -4 - -4cab64? 4cab60 In base 9, what is -1216476 + -4? -1216481 In base 10, what is -4 - -3206? 3202 In base 4, what is 11021 + 1002320? 1020001 In base 5, what is -224 - 233302? -234031 In base 14, what is -6819 + 2? -6817 In base 12, what is 192b6 - 6? 192b0 In base 4, what is -2103332 - -30? -2103302 In base 11, what is 279 - 33? 246 In base 9, what is -4 + -227400? -227404 In base 8, what is -566074 - 2? -566076 In base 14, what is 0 - 454a4? -454a4 In base 11, what is 3347 + 19? 3365 In base 12, what is 2 + b8693? b8695 In base 16, what is 3dc975 + -4? 3dc971 In base 2, what is -1000011101100 - -110? -1000011100110 In base 15, what is -d - -168d? 1680 In base 2, what is 111100 + -10010110110101? -10010101111001 In base 7, what is 43 - 13645? -13602 In base 7, what is 154 + -30326? -30142 In base 5, what is 10 + -113240410? -113240400 In base 7, what is 55 + -363016? -362631 In base 2, what is 10 - -11010101000110? 11010101001000 In base 10, what is -2 - -112536? 112534 In base 9, what is -435 + -424? -860 In base 3, what is -1 - -22101110110? 22101110102 In base 8, what is 5 + -116532? -116525 In base 12, what is 15098 + -7? 15091 In base 10, what is 21 - 6223? -6202 In base 12, what is 1a - -2a450? 2a46a In base 9, what is -68 - -110? 31 In base 11, what is 35352 + 18? 3536a In base 14, what is -426 + 33? -3d3 In base 16, what is 1f + -2d7a? -2d5b In base 16, what is -3a + -7361? -739b In base 12, what is 4755 - -25? 477a In base 16, what is 9c - 63? 39 In base 2, what is -100101100101100100 + -1? -100101100101100101 In base 6, what is -101 - 31231? -31332 In base 6, what is 535 - 235? 300 In base 5, what is -300401 + -304? -301210 In base 4, what is -31 - 23010121? -23010212 In base 9, what is 773 + 2232? 3115 In base 15, what is -4 - -8ccb9? 8ccb5 In base 14, what is -4 + -4ccb5? -4ccb9 In base 16, what is -b5 - -f? -a6 In base 12, what is -7b59 - -3? -7b56 In base 5, what is 210 - 1334? -1124 In base 7, what is -2 - 14111? -14113 In base 13, what is -5 + -279b58? -279b60 In base 15, what is -1a63e8 + -5? -1a63ed In base 2, what is -1110 - 101111111011111100? -101111111100001010 In base 6, what is 3 + -143303? -143300 In base 10, what is -660606 - 4? -660610 In base 8, what is -2567 + -12? -2601 In base 9, what is 643 - -46? 700 In base 14, what is -1a4 - b8a? -d50 In base 16, what is -17 + -4427? -443e In base 4, what is 302031212 - 0? 302031212 In base 16, what is ebd + a? ec7 In base 12, what is 12a64b + 1? 12a650 In base 11, what is -11 + -12106? -12117 In base 7, what is 22 + -3065? -3043 In base 11, what is 1a164 + -44? 1a120 In base 5, what is -230 + 4021? 3241 In base 13, what is 0 + 204c7? 204c7 In base 4, what is 32 - 323230? -323132 In base 14, what is -2 + 4535? 4533 In base 11, what is 4 + 8a5? 8a9 In base 9, what is -468 + -163? -642 In base 6, what is 113511 + -20? 113451 In base 9, what is 5480 + 652? 6242 In base 14, what is 2b2 + 890? b62 In base 10, what is 4288 + 10? 4298 In base 4, what is 3 + 220233110? 220233113 In base 10, what is -172 - -1822? 1650 In base 5, what is 12411430 - 4? 12411421 In base 8, what is -117564 - 3? -117567 In base 9, what is -25 + 343? 317 In base 10, what is -55 + 1589? 1534 In base 4, what is 1 - 13233212? -13233211 In base 13, what is 19 + 1567? 1583 In base 9, what is 5 - -7135? 7141 In base 2, what is 1011 + -1100111101100? -1100111100001 In base 7, what is 26462153 - -4? 26462160 In base 11, what is -5 + -7299? -72a3 In base 6, what is 1031402 - -2? 1031404 In base 6, what is -41 + 111115? 111034 In base 4, what is 1120 + 203301? 211021 In base 7, what is -1111 - 102032? -103143 In base 10, what is 856 + 745? 1601 In base 6, what is -13224433 - 0? -13224433 In base 5, what is 1123113 - -104? 1123222 In base 10, what is 3 - -420350? 420353 In base 13, what is -c24 + -6? -c2a In base 3, what is -20022020 - -10? -20022010 In base 10, what is 849 + 12? 861 In base 9, what is 4 - 28171? -28166 In base 6, what is 3 + 43054153? 43054200 In base 13, what is 29607 - -2? 29609 In base 13, what is 384 + 59? 410 In base 7, what is -251060 + 4? -251053 In base 7, what is 3454 + -34? 3420 In base 7, what is 5 - -101140? 101145 In base 8, what is -27 + -472432? -472461 In base 2, what is -101 + -110101101101? -110101110010 In base 5, what is 122 - 2333? -2211 In base 14, what is 5c5 - 127? 49c In base 15, what is 1048e + -23? 1046b In base 10, what is -198 + -157? -355 In base 12, what is 1672 - 3? 166b In base 12, what is 1 - -11594? 11595 In base 16, what is -19c + -23? -1bf In base 8	{ "pile_set_name": "DM Mathematics" }
Let m = i + -1942. Which is the smallest value? (a) 14 (b) m (c) l c Let f = -124 + 303. Let s = -182 + f. Which is the third biggest value? (a) s (b) 2 (c) -0.01 a Let k = 65 + -114. Let o = k + 48.9. Let z be ((-5)/15)/((-2)/30). Which is the second biggest value? (a) o (b) -0.04 (c) z (d) -2 b Let d = 150 - 1052/7. Let w = 211.5 - 206. Let x = w - 5.2. Which is the third smallest value? (a) x (b) 5 (c) d b Let s = -0.11611 - -0.51611. Which is the third smallest value? (a) 212 (b) -2 (c) s a Let y(h) = h*3 - 5h*2 - 204h + 1025. Let d be y(5). What is the fourth biggest value in d, -1, 1/5, 9.4, -0.5? -0.5 Let b = 1 - 0. Let k = -63058 + 63070. What is the second biggest value in b, k, 4? 4 Let x(y) = -y + 5. Let u be x(6). Let n = -24 + 27. Let b = -2790 - -2790.2. What is the third biggest value in u, b, n? u Let n = -366 - -365. Let m be 0 + (-2)/3(-6)/(-32). Which is the second biggest value? (a) n (b) 2/5 (c) m c Let p = -2178 + 1541. Let m = 678 + p. Which is the biggest value? (a) -4 (b) 5 (c) m (d) 1 c Let f = -828 - -823. Which is the third biggest value? (a) f (b) 1/2 (c) -0.1 (d) -0.09 c Let p = -8.94 - -6.94. Let t be -19 - -2 - (1 + -10 + 8). What is the third biggest value in p, t, 1, 0.5? p Let f = 17.17 + -25.17. Which is the second smallest value? (a) -5 (b) 6 (c) 5 (d) f a Let z = 957 + -1917/2. Which is the third smallest value? (a) 0.1 (b) 57 (c) z b Let y = 238 + -202. Let p = 31 - y. What is the second biggest value in -0.4, p, -91? p Let p = -0.1 + 0. Let n be (21 + 532/(-56) - 16)(-1)/(-6). Which is the third smallest value? (a) p (b) 13 (c) -1/4 (d) n a Let q be (-5)/(-1365)13 + 3/(-21). What is the second smallest value in 2.9, q, -10? q Let z = -28600 - -28596. Let v = -5 + 3. Let d = -2.04 - v. Which is the smallest value? (a) z (b) d (c) -0.3 a Let n = 1.9393 - 1.4393. Let f = -19 - -10. What is the third smallest value in n, 0, 2/13, f? 2/13 Let o = 180 - 273. Let k = 92.98 + o. Let s = 2 - -2. Which is the biggest value? (a) k (b) s (c) 3 (d) -0.5 b Let p = -11.305 + 8.505. Let b be (-153)/54 + 4 + -1. What is the biggest value in b, 2, p? 2 Let t(u) be the first derivative of 6u*2 - 35u - 16. Let j be t(3). Which is the third biggest value? (a) j (b) -0.67 (c) 2 (d) -5 b Let y = -0.9 + 0.8. Let f(v) = 5v + 190. Let p be f(-37). Let j = 189 - 191. Which is the smallest value? (a) p (b) y (c) j c Let v = 5.06 - 0.06. Let a be (23 - 3534/152) + 0. What is the second smallest value in a, 9, v, 1/9? 1/9 Let r = -648 + 650. Let q = 26.5 - 27. What is the biggest value in q, 2/5, r? r Let z = 953/966 - 4/69. Let j = -2 + 11/7. Let u = j + z. Which is the smallest value? (a) 1 (b) u (c) 3/5 b Let q(k) = k2 - 11k + 6. Let u be q(10). Let i = -83353 - -83358. Which is the second biggest value? (a) u (b) i (c) 2/7 (d) 1.5 d Let u = -81.271 + 20.271. What is the biggest value in 0.5, -0.5, u, 4? 4 Let t = -3356 + 3358. Let p = 0.06 - 5.06. What is the biggest value in -63, t, p? t Let s = 0.37 - -0.03. Suppose -8 = -5i + 3d - 65, 0 = 2d - 8. Let k = i - -10. What is the third biggest value in -5, k, s? -5 Let p = 47/8 - 173/24. What is the second biggest value in 2, 18, -0.9, p? 2 Let s(h) = -2h + 4. Let a be s(-11). Let i be (-220)/(-525) - (a/(-7) - -4). What is the smallest value in 1, 0, i, -1.2? -1.2 Let y = -6857.56 - -6858. What is the third smallest value in y, -2/5, -2/7? y Let a = 76 + -530/7. Let x be (-2 + 6/(-12)-8)31. Let k = x + -66. What is the third smallest value in -3, a, -2/7, k? -2/7 Let l = 0.1442 - 0.1142. Let o = 92.9 - 99. Let k = o + 6. Which is the biggest value? (a) 3 (b) l (c) k a Let n = 10799 - 10801. Which is the second smallest value? (a) 4 (b) n (c) -3 (d) 1/120 (e) 2 b Let h = 2208.94 - 2209. What is the smallest value in -1, 0, -4/5, h, 0.1? -1 Let v = 8757 - 8760. Which is the third biggest value? (a) -0.7 (b) 3/2 (c) -317 (d) v d Let g = 7759/42 - 1105/6. Let w = -0.04 - -0.02. Let o = -1.02 - w. What is the second biggest value in -5, 1, o, g? g Let w = -0.181 + -0.309. Let m = 1.49 + w. Which is the biggest value? (a) m (b) 4 (c) 12 c Let x = 0.3751 + -0.3751. Which is the fourth biggest value? (a) -0.5 (b) 7 (c) x (d) 5/4 a Let v = -6454/3 + 2152. What is the biggest value in 0.5, 0.14, 13, v? 13 Let q be (110/(-18))/(-5) + -1. Let r be 50/(-20)(-8)/10. Let h be (-15)/60 + r/24. What is the biggest value in -2, h, q? q Let u = -9855.4 - -9855. Which is the second smallest value? (a) 0.1 (b) -5/53 (c) u b Suppose 0 = -3y + 7y + p + 10, -5y - 6 = -2p. Let k = 8 - 7.5. What is the fourth smallest value in -3, y, 18, k? 18 Let d = -0.2 + -0.8. Suppose 0 = -120y + 125y + 1345. Let o = y - -1885/7. What is the second smallest value in d, -0.07, o, -3? d Let h = -144 - -88. Let l = -47/156 - -2/39. Let x be 7/(-84)-1-4. What is the smallest value in h, x, l? h Let y = -97.4 + 548.4. Let k = 466 - y. Let d = -3.98 + -0.02. Which is the third biggest value? (a) d (b) k (c) -0.2 a Let h be (36/90)/(-5(-1)/25). What is the biggest value in 7, h, -3/4? 7 Let g be (-114)/3735 + 4/10. Let b = -377/28801 + -8/347. Let d = b + g. What is the second smallest value in d, -0.5, -2/5, -4/7? -0.5 Suppose 4o = 2y + 2, -y + 4o - 7 = -4y. Let r be (1 - (0 + 0) - 21)/y. What is the second smallest value in 5, r, 3? 3 Let m(g) = 12g + 284. Let h be m(-21). Let p be 530/600 + (-24)/h. Which is the smallest value? (a) -3 (b) -1/4 (c) p (d) 0 a Suppose 37l = 30l. Suppose 0n = 3n - 4r + 20, 4n - 3r + 15 = l. Which is the biggest value? (a) 3/7 (b) n (c) 1 (d) 1.3 d Let p = -20043 + 19971. Which is the third smallest value? (a) 0 (b) -4 (c) 15 (d) p (e) 0.2 a Let i = -5821.5 - -5822. Let u(l) = l*2 - 7l - 8. Let j be u(8). What is the second biggest value in j, i, -6/23? j Let m = -8357 + 116995/14. What is the second smallest value in -3/7, m, 5/2, -3, 4? -3/7 Let f = -0.126 - -0.195. Let x = -0.221 - f. Let h = x - -0.59. Which is the second biggest value? (a) h (b) 0.1 (c) -1/3 b Let h = -0.02 - -4.02. Suppose 7158 = -78y + 7002. Let t = 0.07 - -0.03. What is the third biggest value in y, t, h, -0.4? -0.4 Let d = 9 + -5. Let n = -7113 - -7096. What is the smallest value in d, 0.1, n? n Let i = -240 - -239.6. Suppose -k - 24 = 2w, w + 2k = -w - 20. Let p = -19 - w. Which is the biggest value? (a) 4 (b) i (c) p (d) 0.3 a Let g = -236.97 - -234. Let h = g + 2.97. Let p be 4(-5 + 3)/68. What is the third biggest value in p, 1, h? p Let k = 160.8 + -189. Let q = -23.2 - k. What is the second biggest value in -1, -0.3, q? -0.3 Let w = 352 - 349. What is the third biggest value in w, -2/5, 746? -2/5 Let m = 292 + -2040/7. Let v = -2 + 4. Let z = 22.1 - 21.7. Which is the third biggest value? (a) v (b) m (c) z c Let z = 1006 - 1007.989. Let n = -2 - z. Let k = -0.211 - n. Which is the biggest value? (a) 1/6 (b) 18 (c) k b Let m be (1/(-2))/((-41)/574) - 51. What is the fourth smallest value in m, 2/5, -0.16, -0.07? m Suppose 0 = -3m + 3r, 0 = -2m + 3r + 2 - 5. Let q be m/(58/4 + 2). Let k = 1964 - 1959. Which is the smallest value? (a) k (b) q (c) -0.4 c Let i = -398 - -394. Which is the fifth biggest value? (a) 25 (b) -3 (c) 2/3 (d) i (e) -1/5 d Let r = 3781 - 3780. What is the biggest value in -0.19, r, 2? 2 Let u(m) = -m + 6. Let p be u(6). Suppose -3a - k = -31, p = 2a - a + 5k - 1. Let q = 4.933 + -4.433. What is the third biggest value in q, -2, a? -2 Let t = -29 + 209/7. What is the biggest value in -4/7, t, -3/5, -4, 0.1? t Let x = 238.92 + -238. Let l = x - -3.08. What is the smallest value in -1/15, l, -3/4? -3/4 Let q = -137 - -139. Let o = -11.8 - -12. Let i = o - 0. Which is the biggest value? (a) i (b) -0.2 (c) q (d) -6 c Let z be (-36)/8*4/6. Let p = 0.44 - 0.367. Let r = p - -0.027. Which is the second biggest value? (a) z (b) 1 (c) r (d) -0.2 c Let x = -95.8 - -98.8. What is the second smallest value in x, -0.1, -3/4, 0.037? -0.1 Let s = -0.07242 - -459.97242. Let z = -460 + s. What is the biggest value in z, -1, -4? z Let f = 0.2079 + -0.1079. What is the fifth smallest value in 1/2, f, -1, -8, -9? 1/2 Let k = 233 -	{ "pile_set_name": "DM Mathematics" }
er. i, 2, l Suppose 4x = -7x. Sort -5, x, 3. -5, x, 3 Let s = -3.75 + 3.75. Let d = 0.9 - -0.1. Sort 3, s, d in increasing order. s, d, 3 Let v be -4(-1 - -1 - 1). Let f(a) = a2 + 3a - 2. Let j be f(-3). Let m be (6/(-9))/((-2)/15). Sort m, j, v in ascending order. j, v, m Let v be (-1)/((2/6)/(-1)). Suppose -w = 4g - 7 + 3, 0 = -3g + 3. Suppose -3y + w + v = 0. Sort y, 0, -1 in descending order. y, 0, -1 Let i = -2 + 2. Let s(r) = r2 - 6r - 2. Let b be s(7). Suppose b = -z + 2z. Put i, z, -1 in descending order. z, i, -1 Let k = -8 + 6. Let r = -2156 - -45286/21. Let x = 2/21 + r. Sort k, -1, x in increasing order. k, -1, x Suppose 4t = 5 + 11. Put -1, 1, t in decreasing order. t, 1, -1 Suppose -3m = -2t - 168, 5m - 4t + 77 = 357. Let f = 115/2 - m. Sort -0.2, f, -4 in descending order. f, -0.2, -4 Let b = -4386 - -4569.12. Let f = 188 - b. Let m = f + 0.12. Put m, 4, 1 in descending order. m, 4, 1 Let b = -108.97 - -107. Let t = -0.03 + b. Put t, -1/4, -0.3 in decreasing order. -1/4, -0.3, t Let r = -50 - -45. Put r, 4, -3, 1 in ascending order. r, -3, 1, 4 Let g = 8 + -9. Let k be (-9)/(-4) + 2/(-8). Sort 0, g, k in increasing order. g, 0, k Suppose -a - w + 7 = a, 3a = 3w + 6. Sort -7, a, -4 in increasing order. -7, -4, a Let q(p) = -p. Let b be q(2). Let r(j) = 2j - 8. Let l be r(6). Let f = -22 + 19. Sort b, f, l. f, b, l Suppose 0r + 2r - 4a - 314 = 0, r - 151 = -4a. Let d = r - 1703/11. Let y = -0.1 + 1.1. Sort 3, y, d in descending order. 3, y, d Let t(i) = -i3 + 9i*2 - 12i - 12. Let l be t(7). Sort l, 0, -5 in increasing order. -5, 0, l Let h = -0.8 - 4.2. Sort 22, 4, h in increasing order. h, 4, 22 Let i = -10 - -6. Let y = 2 + i. Let m = -6 + 3. Sort -0.4, y, m in increasing order. m, y, -0.4 Let y = -100 - -95. Let d(h) = -h + 6. Let k be d(8). Sort -16, y, k in ascending order. -16, y, k Let d = 206/7 + -29. Let o = -1.5 + -0.5. Let n = -0.46 + 0.46. Put o, n, d in ascending order. o, n, d Let r = -10 - -16. Let a(u) = u*2 - 7u + 9. Let g be a(r). Let h = 417 - 420. Put g, 0, h in decreasing order. g, 0, h Let p = 0.23 - -10.77. Let a = 6 - p. Let t = -8 + 7. Put t, a, 5 in descending order. 5, t, a Suppose 21 = 3b + g, 23 = 3b + 3g - 4. Put -2, b, 2 in decreasing order. b, 2, -2 Suppose 2p = -8y + 3y + 1, -2y - 3p - 4 = 0. Let s be (-2)/5 + 14/(-15). Let w = 16 + -15.5. Sort w, y, s in descending order. y, w, s Let l = 11 - 15. Suppose 3x = 8x - 10. Suppose 2k + 3 = -t + 8, xk - 17 = -5t. Sort t, l, 4 in descending order. 4, t, l Let a = -110 - -548/5. Put a, 3, -2/15, -2 in decreasing order. 3, -2/15, a, -2 Let y = -4/5 - -21/20. Let k = 3/19 + 11/171. Let c = 12 - 14. Put y, k, c in increasing order. c, k, y Let t = 0.04 + -0.04. Let w = 0.01 + -0.41. Let v = -5.4 - w. Put v, 0.4, t in increasing order. v, t, 0.4 Let n be 24/(-3) - (2 + -8)/2. Put 1, n, 2 in decreasing order. 2, 1, n Let n = 0 + -1/6. Let p = -0.4 + -0.1. Let q = -22 + 22.4. Sort p, q, n. p, n, q Suppose -2u - 5b + 14 = 0, 0 = u + b + 2b - 8. Let f = 20 + -11. Suppose -s - f = -4s. Put u, s, -4 in descending order. s, u, -4 Let g = -104 - -99. Sort 52, 5, g in decreasing order. 52, 5, g Let z = -3 - -2. Let k(y) = -7y + 7. Let d be k(4). Let j be (0 + z)/(d/6). Put 0.2, j, 0.5 in ascending order. 0.2, j, 0.5 Let s be 126/30 - (-8)/10. Suppose sp - r - 3 = -2, 0 = -3p + 4r + 4. Sort p, -0.4, -4/7 in decreasing order. p, -0.4, -4/7 Suppose 3 = -v + o - 3, -v - 3o + 10 = 0. Sort 15/8, v, 4 in ascending order. v, 15/8, 4 Let h be 2(3 - (-27)/6). Suppose 3t - h = -4m, -3t = -3m + 2m. Put m, -1, 5 in ascending order. -1, m, 5 Let g = 62.1 - 62. Sort -14, 0.2, g in descending order. 0.2, g, -14 Let s = -0.13 - -0.23. Let q = 0.1 - s. Sort 0.3, -1, q in decreasing order. 0.3, q, -1 Let t(y) = y*2 - 10y + 8. Let n be t(10). Let h = -5 + n. Sort 4, h, -3 in increasing order. -3, h, 4 Suppose -4m = 20, 3v + 4m + 27 = -17. Let r(t) = t3 - 4t*2 - 11t - 2. Let q be r(6). Put -3, q, v in descending order. q, -3, v Let y = 3 + -4. Let l be (-1 + 1)y/(-2). Let z be (2 + l - 0) + -6. Put 1, z, -5 in decreasing order. 1, z, -5 Let x be (3/6)/(3/6). Sort -2, x, -6 in ascending order. -6, -2, x Let z = 115 - 114.99. Put z, 5, -1, -4/7 in decreasing order. 5, z, -4/7, -1 Suppose 3t = 6 + 6. Suppose -47 + 17 = -5h. Let k be (-2)/(-4)(-12)/h. Sort 0, k, t. k, 0, t Let l = 12 - 17. Sort 4, 0, l in ascending order. l, 0, 4 Suppose 2d - 10 = -2. Suppose 0 = 5o, -b + 2 + 1 = -do. Let p be 236/40 - (1 - -1). Sort b, 1/4, p in decreasing order. b, 1/4, p Let l = -5.4 + -0.6. Let w = -0.21 - 5.29. Let k = w - -5. Sort l, k, 0.2 in decreasing order. 0.2, k, l Let i be 42/(-24) - (-3)/4. Put 3, 5, i in increasing order. i, 3, 5 Suppose 2j - 9 = 3j + 2q, -3j = -3q. Let v be 24/9j/(-2). Put v, -3, -2 in decreasing order. v, -2, -3 Let j = 5 - 2. Suppose jo - 3 = 3. Put -0.4, -3, o in increasing order. -3, -0.4, o Suppose -4j + 2j = -3a - 286, -5j = 4a - 692. Let c be ((-1)/(-2))/((-7)/j). Let p be 3/18 - c/(-12). Put 2/3, p, 0.3 in decreasing order. 2/3, 0.3, p Let n be 1/(-2 + 3 + -4). Sort n, 0.08, -3 in ascending order. -3, n, 0.08 Suppose -4u - 22 = -26. Put u, -36, -2, 5 in decreasing order. 5, u, -2, -36 Suppose 3f = 3 + 39. Suppose 0 = t - 4c, -5t - 2c + f = -8. Let r be (-110)/40 - 1/4. Sort r, t, 5 in descending order. 5, t, r Suppose -x = -5a + 4x - 20, -4x + 6 = -2a. Put -4, 3, a in increasing order. a, -4, 3 Suppose 0 = -3i + v + 12, 2i - 2v = 3v + 21. Let u = i + -2. Sort 5, u, -2 in descending order. 5, u, -2 Let u = -314 - -309.98. Let l = -0.02 - u. Let p = -0.09 - 0.31. Sort -0.2, p, l. p, -0.2, l Let v be 2/(4 - 78/20). Let o = v + -257/13. Sort o, -5, -0.1 in descending order. o, -0.1, -5 Let k = -3.4 - -3. Let s = 0.031 + -2.031. Put s, k, 4 in ascending order. s, k, 4 Let v = 127 - 127. Put -5, 6, v, 4 in ascending order. -5, v, 4, 6 Let j = -0.7 + 0.7. Let m(o) be the second derivative of -o4/12 - o3/6 + 3o*2/2 + o. Let k be m(0). Sort k, j, 5 in increasing order. j, k, 5 Let k = 20 + -18.8. Let m = k - -1.8. Put 0.2, m, -6/7 in descending order. m, 0.2, -6/7 Let h(j) = -2j*2 + 2j + 2. Let s be h(2). Suppose 3i + 10 = i. Put s, i, 3 in decreasing order. 3, s, i Let x(j) = 7j + 138. Let a be x(-19). Let b = 0.7 - 3.7. Put b, a, 3 in descending order. a, 3, b Let m = -11 - -16. Suppose 0 = 4l - 8 - 8. Let o = -1 - 2. Sort l, o, m in ascending order. o, l, m Let j be 20/(-30)1/2. Sort 0.1, 0.4, j. j, 0.1, 0.4 Let d = 3.3 - 4. Let f = -0.2 - d. Let s = f + -0.1. Put s, 4, 0 in ascending order. 0, s, 4 Let s(r) = r*2 + 9r + 8. Let h be s(-8). Suppose f - 2f - 12 = 0. Let x be 1/3 + 28/f. Put x, -4, h in ascending order. -4, x, h Let c = 0.2 + -3.2. Put -2, -5, c in ascending order. -5, c, -2 Let m(p) = -p2 + 6p + 6. Let l be m(5). Suppose 4t + 8 = 3r + 1, -5r - l = -t. Sort -1, -3, t in increasing order. t, -3, -1 Let v be 4/15 - 10/(-25). Let r be -1(-2)/(-4)0. Put v, r, -2 in decreasing order. v, r, -2 Let q = -2 + 6. Suppose m = -qu - 8, -m = u + m - 5. Let g = 0.4 + -0.5. Put u, 0, g in decreasing order. 0, g, u Let g = 37 + -43.6. Let r = -1.6 - g. Put -3/7, r, -5 in increasing order. -5, -3/7, r Suppose s - 5 = 4l, 3l - 2 = l - 4s. Sort -5, l, 4 in decreasing order. 4, l, -5 Let p be (-42)/6 + -14 - 0/(-2). Sort 4, p, -4 in ascending order. p, -4, 4 Let j = -0.62 + 2.62. Let w = 4.92 - -0.08. Put j, 0.4, w in increasing order. 0.4, j, w Let r(q) = -q3 - q2 - q. Let a be r(-1). Suppose 4l + 3g = -l + 28, l - 10 = -5g. Suppose 0t - lt = 5. Put t, a, 5 in decreasing order. 5, a, t Let j be ((-1)/(-2))/(1/(-12)). Let s be (3 + -5)/(j/(-9)). Suppose 4f - 12 = -2d, 0 = -4f - 4d - 0d + 4. Put f, -1, s in increasing order. s, -1, f Let o be (-3(-1 + 2))/(9/(-6)). Sort 5, 3, o, 1 in decreasing order. 5, 3, o, 1 Suppose -4p = -2a - 10, 0 = -3p - p - 4a + 40. Suppose 0 = -4k + 10k + 18. Sort -5, p, k. -5, k, p Let l = -6 + 7. Put l, 2/3, 0.2 in ascending order. 0.2, 2/3, l Let l = -3 + -4. Let m = 10 + l. Sort -6, -1, m. -6, -1, m Let q = 0 + 0.1. Let f be 1 - -1 - (4 + -3 + 1). Sort f, q, 2. f, q, 2 Let i = 1.2 + -0.2. Let l =	{ "pile_set_name": "DM Mathematics" }
2/5)/fffff*12f)/((ff/(f(-31)/f)f)/ff(-2/21)) assuming f is positive. f(-1943/105) Simplify (w/(w3/w))/(w/(wwww/w*(1/3)))(w(1/4))5 assuming w is positive. w(35/12) Simplify (l(-1/2))*(2/59)l*(-16)l/(ll(-10)) assuming l is positive. l(-355/59) Simplify ((ff(-8/3))/(f/(f/f(-18))))/(f*(-2/21)f8) assuming f is positive. f(59/7) Simplify l/(l((lll(2/3))/l)/l)l*(-1/4)/lll(1/2)(l/((ll/l(-2/15)l)/l))/ll assuming l is positive. l(-31/20) Simplify ((t/t(2/27))/tt/(t*(2/9)tt))(3/7) assuming t is positive. t(-5/9) Simplify m5mm1(m/(m*(1/3)m)mm)(-40) assuming m is positive. m(-179/3) Simplify (d*(-6)d27)3 assuming d is positive. d*63 Simplify (y/(yy*(2/5)yy))(-39)(y(-19))(3/10) assuming y is positive. y(879/10) Simplify t/t(1/8)t31(tt/((ttt(5/2)t)/t)t)(-1/2) assuming t is positive. t(261/8) Simplify ((((xx1)/x)/(x(6/13)/x))/((x/(x/((xx(1/3)x)/x)x))/(x/(xxxx*(6/7)x))))(-2/85) assuming x is positive. x(1448/23205) Simplify (((q/(q/q(2/3)))/(q(1/3)/q))28)(7/12) assuming q is positive. q(196/9) Simplify ((d/(d(4/11)/d))/d*19)/(dd/(dd/(dd*12))dd)33 assuming d is positive. d(-5636/11) Simplify ((s/(s/s11))/(s/((s/s30)/s)))(-1/18) assuming s is positive. s(10/9) Simplify ((c/(c/c(1/7)cc)cc)(10/13))(2/9) assuming c is positive. c(20/819) Simplify (((xx*2x)/x)/x)*(-12)(xx/x(-5)x)/(x/x9) assuming x is positive. x(-8) Simplify ((n/(n(nn*(1/9)/n)/n)n)/n*(-20))/((((n/((nn/n*(-3/10))/n))/nn)/n)/n(-1/10)) assuming n is positive. n(1039/45) Simplify ((ttt(1/5))/t)(2/9)/(t*5tt(1/9)tttt) assuming t is positive. t(-443/45) Simplify ((jj*(-7))/((jj/(j/j*(2/9))j)/j))/(j*(-1/4)j21) assuming j is positive. j(-1007/36) Simplify u(1/14)/u(-4)(uu*10)/(u/(uu*(6/11)u)) assuming u is positive. u*(2559/154) Simplify ((o/(oo/(o(o/(o9o))/o)))/((o/o15)/o))/(o(-4/7)o16) assuming o is positive. o(-73/7) Simplify uu*(-12)uu/u10uuu/(uu(-2/11))u((uu(1/11))/u)/u assuming u is positive. u(-184/11) Simplify ((s/(ss(-4)s))/s)30/(s(-13)/(s/s*1s)) assuming s is positive. s74 Simplify ((n(1/2)/(nn1/nnn))3)(-13) assuming n is positive. n(195/2) Simplify (ii*(-1/11)i)*(-1/3)/(ii/(i/(i*(-4/17)/iii)ii)i*24/iii) assuming i is positive. i(-4750/187) Simplify (q(2/15)(qq(16/3))/qq)/(q*(-4)q/(qq(-7))) assuming q is positive. q(52/15) Simplify (r/(rr/(r(r/(r(4/3)r))/r))rrr(3/4)((rr4)/r)/(r/(r/r6)))(19/6) assuming r is positive. r(-361/72) Simplify (n/n(-3/10))/nn*(2/35)nn(2/43)/nnnnnn/n*(-3/5)n assuming n is positive. n*(21081/3010) Simplify (p/(ppp1pp)(ppp*(-8))/pp)/((pp(-5/3))/(pp9)) assuming p is positive. p(2/3) Simplify (q(-5))(-1/58)q8/qqq/(q/(qq/(q/q(-4/13)))) assuming q is positive. q(6619/754) Simplify ((r*(-2/3)r(-3/7))(-10))(-3) assuming r is positive. r(-230/7) Simplify (o/((((oo/(o/o(1/11)))/o)/o)/o)o(o7oo)/ooo)/(o(-1))(-1/20) assuming o is positive. o(3049/220) Simplify (((ppp/(p(p*(-9)p)/p)p)/p)/(pp/(((p/(p*(-6/5)pp)p)/p)/p)pp))/((p/(p*(-2/55)/p)p)/(pp(3/11))) assuming p is positive. p(244/55) Simplify ((hhhh*(-3)hh/(hh*(3/7))h)/(hh/(hh/(h/(h/(h/(hhh*(-1)h))))))(-39))(-45) assuming h is positive. h(11790/7) Simplify (((d/(d/((d/(d(-3)/dd))/dd)))(-11/2))4)28 assuming d is positive. d(-2464) Simplify (l/(l*(2/5)/l)l)/(ll5)(lll*(-1)l)(-2/35) assuming l is positive. l(-123/35) Simplify (j0/(j/(j(-10/7)j)j))/(j*3/jjj5) assuming j is positive. j(-73/7) Simplify v(2/5)v*(2/17)(v(-8))(-38) assuming v is positive. v(25884/85) Simplify (p(3/8)((pp*(-1/5)/pp)/p)/p)/(pp(-1)pp)(2/7) assuming p is positive. p(-391/280) Simplify (a/(a/(aa*(-11)a)))/(aa(-2/23)a)a(1/6)/(a/(aa*5a)) assuming a is positive. a*(-655/138) Simplify (ii*(-1/3)ii(1/7))/(i(-1/15)i(-8)) assuming i is positive. i(1037/105) Simplify d/d*22d*(-2/9)((d/(dd(-4/5)))/d)/(d/(d/((d(-3/8)d)/d))) assuming d is positive. d(-7577/360) Simplify (z/((z(-12)/z)/z)zz/z*11)/(z(z*12z)/zz4/z) assuming z is positive. z(-10) Simplify ((b(3/4)b*0b)/(b/(b/b*(-1/2))b/b*(-1/4)bbb))(-2/9) assuming b is positive. b(4/9) Simplify ((j(2/7)/j7)/(jj5jj/(jj*(1/3)j)j))(-8) assuming j is positive. j(2248/21) Simplify ((zz*6z)/(z/(z/(z*(-7/3)z)z)))/((z(-2/13)/z)/(z/z(-5/2))) assuming z is positive. z(1169/78) Simplify (c/c(5/6)cc/(c(-9)/c)(c/(cc(c(c/(ccc(-1/4)))/c)/c))(22/9))(-49) assuming c is positive. c(-686) Simplify z(-10)z*1/z(z/z(-3))4 assuming z is positive. z*6 Simplify (g/(ggg(-1/5))g(4/3))/(g(-27)g/g(-9)) assuming g is positive. g(263/15) Simplify w(-8/3)w*(3/20)w/w*(1/9)www16/w assuming w is positive. w(2767/180) Simplify (aa(-2))49(a/(aa(-7)aa))/(a/a(-3/8)) assuming a is positive. a(-363/8) Simplify (f/f3)11/((f(-19)/f)/fff(1/29)) assuming f is positive. f(-59/29) Simplify (((z(-1/2))(-3))(14/9))(-36) assuming z is positive. z(-84) Simplify ((u/(uu*(-2/55)/uu))/u)(-1/72)/(u(-25)/uuu((u/((u23u)/u))/u)/u) assuming u is positive. u(190133/3960) Simplify ((l(-3/7)/l)/(l/l7))/(l1/llll/((((l/(l((l/l*(6/11))/l)/lll))/l)/l)/l)) assuming l is positive. l(-145/77) Simplify (((s((s/s*(-6/11))/ss)/s)/((s(-2)/s)/s))(-22))12 assuming s is positive. s(-1464) Simplify (n/(nn(n/n*(-6)n)/nn))8(n/n(-2))(-1/13) assuming n is positive. n(-939/13) Simplify (r(-1/4))*48(r(r/(r/r(1/4)r))/r)/(((r/(r/(rr(-11)))r)/r)/r) assuming r is positive. r(-7/4) Simplify (((h/((h/(h(-13)/hh))/h))/h)/(h/h(-2/5))(h(h/h(-3))/h)/(h/((hh*(1/3)/h)/hh)))(6/31) assuming h is positive. h(-332/155) Simplify (p/(pp(-1/6)/p))43/((p(-2/17)/pppp)/(p*(-4/9)p)) assuming p is positive. p(14945/306) Simplify h7((h16h)/h)/hh/(hh/(h/(h*(-2/35)h)))hhhhh/(h/(hh(-1/7))) assuming h is positive. h(907/35) Simplify (u(-1/3)/u)/u(-3/14)u(2/9)/u(-8) assuming u is positive. u(895/126) Simplify ((h(-4/3)/hhhh(1/5)/h)/(h(-6)/hh0h))19 assuming h is positive. h(1387/15) Simplify c/c*(6/13)c*(4/5)(cc/(c/(c/(c/c(1/10)))))/(c(c(c/(cc*(-1/17)/c)cc)/c)/c) assuming c is positive. c(-1371/2210) Simplify (j/j(15/2)j(5/9))/((j/(j/(j/(j(1/17)j))))/j(-2/11)) assuming j is positive. j(-20423/3366) Simplify (ww/(w/((((w*5ww)/w)/w)/w))w/w*(-3)((w((w/(w0w))/w)/w)/ww)/(w/w3w))(13/6) assuming w is positive. w(39/2) Simplify (z18)10(zzz(-25)z)(-2/39) assuming z is positive. z(7064/39) Simplify (h(-2))(16/9)(h(1/3))(-1/26) assuming h is positive. h(-835/234) Simplify (l/(l/(l/((ll*(5/2))/l))))/ll*12(l/(ll(-6)))/(ll/(l/((ll12)/l))l) assuming l is positive. l*(3/2) Simplify ((oo*(-10/7))/o)/(ooo/(o16/o))o/(o/o*(-1/3))oo(1/20) assuming o is positive. o(4741/420) Simplify w(-1/9)(w/(w/(w/(w*(-1/7)w))))/www/(ww(-1)w)w(-6) assuming w is positive. w(-376/63) Simplify (((vv/((v*28/v)/v))/v)/vv*(1/27))/(((vv(-6))/v)/(v(-1/20)v)) assuming v is positive. v(-10267/540) Simplify ((y(-2)y*(-1/7))/(((yy/(y/(y*(-4)y))y)/y)/(y/(y/(((y/y(-5/4))/y)/y)))))(-2/7) assuming y is positive. y(-3/98) Simplify (r(-10)/(rr/(r(r(-1/13)rr)/rr)r))/((rrr/(r/(r/((r(-12)r)/r))))/((((r(r(-28)/r)/r)/r)/r)/r)) assuming r is positive. r(-742/13) Simplify ((v(6/19)v)/(v/(v*(-2/25)v)))(-5/14) assuming v is positive. v(-587/1330) Simplify (s*(-27)(ss6)/s)/(s16s8) assuming s is positive. s(-45) Simplify (a*(-6)a)*(1/31)/((aaa(2/5))/(a/(a/(a/a(-3)a)))) assuming a is positive. a(378/155) Simplify b(-1/4)/(bb/(bb/(bb(4/9))b))(b/((b(2/61)/b)/b))/(((b/b(-21))/b)/b) assuming b is positive. b(-38929/2196) Simplify ((h*(	{ "pile_set_name": "DM Mathematics" }
y Let g be ((-6)/(-9))/((-68)/(-60) + -1). Put -3, 2, -8, g in descending order. g, 2, -3, -8 Let u = -19 - -11. Let r = 11 + u. Put r, -2/11, 13 in ascending order. -2/11, r, 13 Let x = -6 + 14. Let l be 4/(-10) - x/30. Put -1, -4, l in decreasing order. l, -1, -4 Let o = -0.3 - -0.26. Let f = -5.04 - o. Let h = -1 - f. Sort 0, h, 1/7 in descending order. h, 1/7, 0 Let w(m) be the second derivative of -m*4/12 - 2m3/3 + m2 + m. Let y be w(-5). Suppose -6 = 3a + 2d, 2a + a + 9 = -d. Put a, 5, y in decreasing order. 5, y, a Let a be (-7)/(-21) + 10/(-3). Put 3, -5, a in decreasing order. 3, a, -5 Let l(w) = -w - 8. Let a be l(-4). Suppose 0 = -2c - 0 + 4. Sort c, a, -2. a, -2, c Let j = -41 + 36. Put -1, -1/3, 5, j in decreasing order. 5, -1/3, -1, j Let b = 0.7 + 0.3. Let d = 8 - 60. Let v = 365/7 + d. Put v, -2, b in descending order. b, v, -2 Let n(p) = p*3 + 7p*2 - 2. Let o be n(-7). Let k = 0.2 - 0.3. Let z = 31 + -26. Put z, o, k in decreasing order. z, k, o Let b = 3/8 - 1/24. Let c = 0.01 - -0.39. Put c, -5, b in descending order. c, b, -5 Let w(j) = -2j + 5. Let i be w(4). Suppose 4f + 12 = -2h - 2, -20 = -5h + f. Let p = -4 + 0. Put h, p, i in descending order. h, i, p Let x = -27 + 20. Let c = x - -10. Sort -2, c, 6. -2, c, 6 Let a = -20 - -22. Suppose 2 = -f - 0f. Sort a, -4, f in descending order. a, f, -4 Let v = -0.4 + -1.6. Let l = 2.5 + v. Let n = 234 - 2104/9. Put l, -0.5, n in increasing order. -0.5, n, l Let b = -34 - -36. Sort 0, b, 2/7, -1/2. -1/2, 0, 2/7, b Let t = 409 - 401. Let k = 2 + -1. Put -1, k, t in descending order. t, k, -1 Let s = -1527/11 - -139. Let x = -0.07 - -0.27. Put -1, s, x in descending order. x, s, -1 Suppose 0 = 2z - 0z. Sort -2/9, z, 3/2 in ascending order. -2/9, z, 3/2 Let w be 32/14 + (-22)/77. Suppose -6o + 16 = -2o. Suppose 0 = b + 5a + 10 + 4, 0 = 5b + 5a + 10. Sort w, o, b in descending order. o, w, b Let q be (8/12)/(6/(-9)). Let i = -16 - -16. Put i, 5, q in descending order. 5, i, q Let b = -3 + 6. Let i(a) = -a3 - 2a*2 - a + 1. Let c be i(-2). Suppose -4o + 5 = -co. Put 1, o, b in ascending order. 1, b, o Let o(n) = n + 7. Let z be o(-6). Suppose -2h = -3h. Let b be 2/(3/(-6) + h). Put b, z, 4 in descending order. 4, z, b Let f = 48/35 - 11/7. Sort 5, -2/3, 4, f in descending order. 5, 4, f, -2/3 Let p = -2.2 + 0.2. Let i = 1.5 + -1. Put i, 0.4, p in ascending order. p, 0.4, i Let k = 158 - 793/5. Let n = -88 + 266/3. Put k, n, 5 in descending order. 5, n, k Suppose 3p + 75 = 72. Put 3, 1, -3, p in descending order. 3, 1, p, -3 Let l be (2/(-4))/((-5)/(-2)). Let x be -10(93/7038)/1. Let n = 1/69 + x. Sort 1, n, l. l, n, 1 Suppose -4z = 20 - 72. Let a be 11/z - (-4)/26. Let v(y) = 2y3 - 3y*2. Let o be v(2). Sort a, -0.4, o in decreasing order. o, a, -0.4 Let w = 25 - 17. Suppose -4v + w = -2a, 6 = -0v + 3v. Suppose 5x + 7 = 3i, 0x + 2x = 3i - 10. Sort x, a, 4. a, x, 4 Let b be (1 - (-5)/7)7. Suppose -3o + b = o. Let h(a) = a*2 - 4a. Let m be h(o). Put m, 5, 3 in increasing order. m, 3, 5 Let u be (56/(-20))/((-3)/(-15)). Let k = 9 + u. Sort -1/5, -2/7, k. k, -2/7, -1/5 Let t(y) = y*3 + 6y*2 - 7y - 1. Let l be t(-7). Put 5, 2, l in decreasing order. 5, 2, l Let s = 2 + -9. Let a = 49 - 439/9. Sort 0, a, s in ascending order. s, 0, a Let h(c) be the second derivative of -3c5/20 - c4/6 - c3/6 - 2c. Let t be h(-1). Sort t, 0, -2 in descending order. t, 0, -2 Suppose 0 = -5o + 30 - 5. Suppose 2 = 3w + ol, 0 = 3w + 2w + 5l. Put 4, w, 0 in decreasing order. 4, 0, w Let g = 1.2 + -1.5. Let i = -142427295/292 - -487766. Let r = 3/73 - i. Sort r, -2/3, g in ascending order. r, -2/3, g Let n = -2.4 - 0.6. Suppose -2c + 5a = 13, -c + 5a - 12 - 2 = 0. Let b be 0 - (6/(-1) - -1). Put c, n, b in decreasing order. b, c, n Let y(a) = 2a*2 - a + 1. Let t be y(1). Suppose 0 = -tb - 2b. Suppose -7 + 10 = -o. Sort 5, o, b in ascending order. o, b, 5 Let b(y) = -y - 7. Let q be b(-3). Sort 1, q, -9, 3 in ascending order. -9, q, 1, 3 Suppose 0 = -y - 3a - 18, 0y = -4y + 2a - 2. Let x = -1.7 - -2.8. Let d = x - 0.1. Sort 0, d, y. y, 0, d Let d = 1.63 - -0.17. Let w = d - 2. Let q = w + 0.2. Sort 5, q, 1 in decreasing order. 5, 1, q Let h(c) = 8c*2 + 2c - 1. Let v be h(1). Let l = v + -4. Put l, -1, -5 in decreasing order. l, -1, -5 Let t be (-3)/10((-32)/9 - -3). Put -3, 3/5, t in decreasing order. 3/5, t, -3 Let q = -19 + 17.9. Let b = -6.1 - q. Sort -0.3, 0.3, b in ascending order. b, -0.3, 0.3 Let o(y) = 2y - 9. Let b be o(5). Put -2/3, -9, b in increasing order. -9, -2/3, b Let p = -0.02 - -0.06. Let x = p - 0.24. Sort 3, x, -2/3. -2/3, x, 3 Let f(m) = -m*2 - m + 22. Let k be f(-5). Put k, -2, 7 in ascending order. -2, k, 7 Let i be 3 + -2 - (0 + 3). Suppose -6u - 11 - 19 = 0. Sort u, i, -3 in increasing order. u, -3, i Suppose -5r + 15 - 55 = 0. Let c be (4/r)/((-2)/(-2)). Sort c, -0.4, -2 in increasing order. -2, c, -0.4 Suppose t - 5x + 3 = -4, -10 = -2t - 2x. Suppose to = -2u + 4, o - 5u = -u - 22. Sort o, 3, -5 in ascending order. -5, o, 3 Let a = 1 + -2. Suppose -3 - 7 = -5n. Put -4, a, n in decreasing order. n, a, -4 Suppose -45 = 8c + c. Put c, 1, 4, -2/9 in decreasing order. 4, 1, -2/9, c Suppose 3h + 12 = 0, 3x - 4h - 24 = x. Put 1, x, -2 in decreasing order. x, 1, -2 Let c(g) = 36g - 6. Let r be c(-6). Let l = r - -1551/7. Put 5/2, -5, l in decreasing order. 5/2, l, -5 Let m(l) = 4l2 + l. Let k be m(-1). Let a(s) = -s2 + 3s + 3. Let o be a(4). Suppose 2j + 15 = -3j. Put k, j, o in descending order. k, o, j Let k(l) be the third derivative of l6/120 + 2l*5/15 - 5l*3/6 + 2l*2. Let s be k(-8). Let c(z) = 2z2 - z. Let f be c(-1). Sort s, f, 0.3. s, 0.3, f Let g(c) = c3 + 5c2 + 4c - 3. Let b(j) = j*2 - 6j - 4. Let v be b(6). Let a be g(v). Suppose 3m - 15 = -0m. Sort 0, m, a. a, 0, m Suppose -4y = -5m + 4 + 4, 0 = m + y - 7. Let a be 4/8 + 3/(-10). Sort a, 2, m. a, 2, m Let b = -86 + 83. Sort b, 0.4, -3/2, -2 in descending order. 0.4, -3/2, -2, b Let a = -87/4 - -22. Let t(h) = -2h2 - 3h - 4. Let g be t(-3). Let c be 2/(-8) + g/(-4). Sort -1/6, a, c in descending order. c, a, -1/6 Suppose 0 = 3n + 6, l + 4n + 12 - 2 = 0. Put 2, l, 0.09 in increasing order. l, 0.09, 2 Let z be ((-1)/(-14))/((-3)/6). Put 4, z, -0.5 in decreasing order. 4, z, -0.5 Suppose 3r + 5 = 8r. Let y(c) = c - 2. Let d be y(-2). Put 5, r, d in descending order. 5, r, d Let a be (-3 - -5) + (0 - -1) - 0. Put -0.2, a, 3/2, 0.1 in descending order. a, 3/2, 0.1, -0.2 Suppose 2n = -v + 17 + 3, 5v - 5n = 85. Suppose 3d - v = 3q - 6q, q - 2 = 0. Let b(f) = f - 7. Let l be b(6). Put d, l, 2 in decreasing order. d, 2, l Let c(p) = p*2 - 5p - 2. Let m be c(6). Let b be m/(-30) + (-292)/60. Put 3, b, 0 in increasing order. b, 0, 3 Let z(s) = -2s + 3. Let a be z(3). Let y = -341 + 344. Let v be -1 + (1 - 8/(-18)). Sort y, v, a. a, v, y Let c = 49 - 48.7. Put c, -3, 2, 5 in ascending order. -3, c, 2, 5 Let n = 53 - 52. Sort 3, -2, -3, n in decreasing order. 3, n, -2, -3 Let n = -0.35 - -0.05. Let r = 0 - n. Sort -1, -2, r in ascending order. -2, -1, r Let i = -10 - -5. Let n = 4 - 4. Put i, 2, n in descending order. 2, n, i Let w = -4 - -6. Sort w, -3, 0. -3, 0, w Let r = 3.004 - 0.004. Let y(a) = -a3 - 7a*2 - 4a - 6. Let b be y(-6). Let l be (-2)/9 + (-8)/b. Put r, l, 2 in decreasing order. r, 2, l Let l = 0.2 - -0.3. Let c = l - 0.45. Let w = c + -5.05. Sort 4/7, 2/7, w in descending order. 4/7, 2/7, w Let f be (4/(-6) - 0)1. Let q = -7.5 + 7. Put q, f, -0.2 in decreasing order. -0.2, q, f Let x = -23.6 - -24. Put x, 6, 0.1 in ascending order. 0.1, x, 6 Let v(d) = d2 + 7d + 4. Let s be v(-6). Suppose -u + 4 = 5l, -l = 2u - 6l - 23. Let y be 3/us/(-6). Sort 5, y, -3 in descending order. 5, y, -3 Let b = -116 + 121. Put 4, 0.3, b in decreasing order. b, 4, 0.3 Suppose i + 2 = -4. Let g = i - -11. Suppose 4j + 24 = 8. Put g, j, -5 in ascending order. -5, j, g Let y = 361 - 357. Let s = 0.24 + 0.06. Put y, s, -3 in ascending order. -3, s, y Let t = -6.7 + 7. Let b = t + -0.1. Sort b, -3, -4 in ascending order. -4, -3, b Suppose 3 - 5 = -2y. Sort y, 2/9, 0.1. 0.1, 2/9, y Let n = -0	{ "pile_set_name": "DM Mathematics" }
-4 - 10. Let l = h + g. Is l a multiple of 5? True Let g(m) = 2m + 291. Let j(f) = f2 + f - 2. Let p be j(-2). Let a be g(p). Let z = a - 200. Does 23 divide z? False Let j(r) = 6r - 48. Let s be j(6). Let q(a) = -a - 2. Does 4 divide q(s)? False Let c(t) = 8t2 - 8t + 0t + 12 - 5t*2. Let q be c(6). Suppose 3s - 3n = q, -5s + 4n + 108 = 2n. Is 10 a factor of s? True Let c(r) = 3r + 10. Let q(z) = z2 - 3z - 3. Let m be q(5). Let g be c(m). Suppose -4p + 197 = -g. Is p a multiple of 15? False Let b = 855 + 285. Is 19 a factor of b? True Suppose -x + 853 = -4s, 0 = -x - 32s + 30s + 859. Is 14 a factor of x? False Suppose -158 = -4d + 118. Let p = d + 80. Does 37 divide p? False Is ((-234)/(-5))/(208/5720) a multiple of 99? True Suppose 5l = s + 3s + 424, 3s + 428 = 5l. Does 44 divide l? True Let i = -36 + 96. Is 41 a factor of i? False Let c be (-18)/(-10)55/33. Suppose 0 = -cd + 12d - 1161. Is d a multiple of 6? False Let l(m) = -m*3 - 4m*2 - 4m + 8. Let x = -2 - -6. Let f(k) = -k*3 - 5k*2 - 5k + 7. Let u(i) = xf(i) - 3l(i). Does 4 divide u(-7)? False Suppose -j + 265 + 58 = 5k, k - 997 = -3j. Is j a multiple of 24? False Suppose 5m = 3m + 278. Suppose 0j = -5j + 10, -3u = 2j - m. Is u a multiple of 15? True Let r(z) = -4z - 17. Suppose -3 = -4h - 43. Is 23 a factor of r(h)? True Let w = -1 + 1. Suppose -3b - k = -0k - 54, w = -b + 2k + 18. Is 4 a factor of b? False Suppose 6d = 1227 - 261. Is d a multiple of 5? False Let t(c) = 2c2 + c + 84. Let i = 23 + -12. Suppose -6o + io = 0. Is t(o) a multiple of 23? False Let u = -12 - -13. Suppose 0 = -3k + m + 241, m = 2m + u. Does 9 divide 4/12 + k/3? True Suppose 0 = 3o - 5n - 5 + 97, n - 59 = 2o. Let j be 49/(-1)2/2. Let w = o - j. Is w a multiple of 10? True Let j = 848 + -650. Does 11 divide j? True Suppose 2o = -10, -10u + 3o = -8u - 789. Is u a multiple of 24? False Let r = 28 - 64. Does 16 divide (-710)/4(1 - r/(-20))? False Let y be ((0 - 1) + 2)131. Suppose 4t - i - 41 = 56, y = 5t + 2i. Let l = t - 5. Does 20 divide l? True Suppose -5 = -2b + 3. Suppose o + 4y = -3o + 16, 41 = bo - y. Suppose o = 4a - 2x + 5, x = 3a - 4. Is 2 a factor of a? True Suppose 5k = -2a + 1572, 0a = k - a - 320. Is 5 a factor of k? False Let o(f) = f*2 + 5f - 7. Let q be o(5). Let m = q - 31. Does 6 divide m? True Let o = 553 - 300. Suppose 6q - o = 149. Does 9 divide q? False Let p(x) = -x3 + 17x*2 - 5x - 48. Let l(f) = -f*3 + 17f*2 - 6f - 47. Let b(i) = 6l(i) - 7p(i). Does 2 divide b(17)? False Let c be 8/(-24) - (-10)/(-6). Let u be (-6 - -8)/(c/(-5)). Suppose 40 = -2z - 3t + 125, 3z + ut = 128. Is 18 a factor of z? False Let b(s) = 10s3 - 2s2 + 1. Let m(h) be the second derivative of h4/12 + 5h3/2 + 15h*2/2 + 2h. Let g be m(-14). Is 4 a factor of b(g)? False Is (-43 - (2 + -1))/((-5)/10) even? True Let w(i) = -12i - 1. Let l be w(-1). Let v = 13 - l. Let k = 7 - v. Does 5 divide k? True Let f(y) = -y2 + 25y + 34. Does 17 divide f(21)? False Let h = -26 + 28. Suppose -hm + 3 = 3m + z, -4m + 12 = 4z. Suppose 5q + 4x - 150 = -mq, 2q + x = 63. Is q a multiple of 34? True Suppose 5q + 62q - 380426 = 0. Does 17 divide q? True Let o = -474 + 2427. Is 51 a factor of o? False Let m(g) be the second derivative of g5/20 + g4/6 + g*3 - 3g*2/2 + g. Let d(j) be the first derivative of m(j). Is 15 a factor of d(-5)? False Let n(c) = -3 - 2c*3 + 6 - 4. Let u be n(-1). Does 21 divide 3(u - 3 - -25)? False Let q = -9 + 11. Let c be (-546)/(q - 5) - 2. Is (c/6)/(4 - 2) a multiple of 14? False Suppose 2i + 5 = 1. Let c(g) = -19g*3 + 3g + 7. Is c(i) a multiple of 17? True Suppose u - 28 = -2y, 0u + 5y = 4u - 112. Suppose 6d - 5d - u = 0. Is d a multiple of 7? True Suppose -18a + 5225 = a. Does 13 divide a? False Suppose 0 = 2o - 7o + 50. Suppose 0 = 4y - 2 - 2, 0 = 4b + 4y - 168. Is 5 a factor of 6/(-2) + (b - o)? False Let g(d) = -4d + 30 - 23 - 11. Suppose 2p = 2r - 4, 4p = 4r - p - 13. Does 4 divide g(r)? True Let g = 512 + 47. Does 17 divide g? False Suppose -14a - 724 = 648. Is (3/(-2))/(1/a) a multiple of 7? True Let p(t) = 2t - 9. Let j be p(8). Suppose jv = 39 + 542. Does 8 divide v? False Suppose 8k + 25k - 1188 = 0. Does 18 divide k? True Let k(c) = c*3 + 12c*2 - 14c - 11. Let o be k(-13). Suppose 0 = 2l - 4g - 1 - 3, -l + o = g. Is 2 a factor of l? True Let k be (3 + 21/(-6))8. Let d(n) = 3n*2 + 8n - 4. Is 3 a factor of d(k)? True Let r be 6/((-3)/((-9)/6)). Suppose -rd = -4d + 74. Let w = -44 + d. Does 16 divide w? False Suppose -6q + 3w = -2q - 14249, -5q = -w - 17814. Does 16 divide q? False Let h be ((-7)/2 - -2)/((-3)/(-4)). Is 17 a factor of h - -1 - ((0 - 31) + -4)? True Suppose 6h = h. Suppose 6x = x + 25. Suppose xg + 0i = -2i + 161, -2i - 4 = h. Is g a multiple of 10? False Let f(y) = -289y - 1236. Is f(-16) a multiple of 11? True Let w = 215 + -116. Suppose -3n + 0n + 89 = -s, 3n - w = 3s. Does 14 divide n? True Suppose 0 = 7j - 68 + 5. Let t(x) = -x*3 + 11x2 - x + 12. Does 33 divide t(j)? True Suppose -62 = q + 5. Let p = 1 - q. Is p a multiple of 22? False Let h(d) = -d3 + 9d2 - 9d - 8. Let q be h(6). Does 10 divide q - (4/4 - 3)? False Suppose -w - 3w + 60 = 0. Let y = w - 12. Suppose -yh = -h - 80. Does 12 divide h? False Let v(r) = -16 - 39 - 35r + 9r. Is 22 a factor of v(-11)? False Suppose 6y - 2y - 4b = 28, 0 = 4y + 2b + 2. Is (15/5)/(y/58) a multiple of 29? True Suppose -11 - 5 = -2p - 2m, 0 = 2p + 4m - 24. Is (-462)/(-4) - 21/p a multiple of 42? False Let j(l) = -3l + 24. Let a be j(8). Suppose a = -k + v + 159, -5k - v + 1071 = 258. Is k a multiple of 36? False Suppose -3v - 4a + 1457 = 0, -2v + 5a + 368 = -634. Is 52 a factor of v? False Let c = 14 + 370. Does 16 divide c? True Suppose -4f + 0f - 336 = -4o, 0 = 5o + 3f - 420. Suppose 6q - 3q - 4l = o, -5q + 117 = l. Suppose 24 = 4d - q. Does 3 divide d? True Suppose 0a + a - 3p + 5 = 0, 3a + 3p + 39 = 0. Let i(g) = g*3 + 12g*2 + 8g. Does 8 divide i(a)? False Let s(r) = r*3 - 29r*2 + 193r - 15. Is 14 a factor of s(25)? True Let f(i) = i*2 + 5i - 7. Let n be f(5). Let q = n + -75. Let t = 55 + q. Does 13 divide t? False Let j(u) = -5u2 + 4u + 11. Let d be j(-5). Let w = -48 - d. Is w a multiple of 15? False Suppose 694 = -5k - 81. Does 3 divide (-18)/27 - k/3? True Let n be 2 + 1 + (-4 - -2). Let c be (n - 5)2/(-2). Suppose -5 = -s + 4g - 0, -s + c = -5g. Is 3 a factor of s? True Let n = -129 + 87. Does 4 divide (2/(-1) - n)/2? True Let x(q) = -2q. Let z be x(0). Let k be 0 - 1 - z - 0. Does 2 divide (6 - 1) + (-1)/k? True Let u(p) = -p2 + 14p + 8. Let w(h) = 3h2 + 7h - 7. Let c be w(-4). Does 7 divide u(c)? True Let h be (-4 + 23)/((-2)/(-8)). Suppose 5w + h = 4w. Let u = 145 + w. Is u a multiple of 23? True Let g(i) = 1. Let w(u) = 5u + 7. Let y(f) = -3g(f) + w(f). Let r(c) = -c*2 + 5c + 2. Let n be r(4). Does 10 divide y(n)? False Suppose 0 = -5h - 2o + 1652, 3h + 2o - 1094 + 106 = 0. Does 19 divide h? False Let g = 159 - 97. Suppose 2i + 3z - 41 = 0, -i + 3i - 4z = g. Is i a multiple of 24? False Let b = 28 + 251. Is 9 a factor of b? True Suppose 8a = 3a + 45. Let b(k) = -4k - 54k*2 + 46k2 - 7 + k3 + 9 - 10. Does 29 divide b(a)? False Let w(x) = -x - 6. Let a be w(-5). Let l(o) = 239o - 1. Let u be l(a). Let f = -159 - u. Does 27 divide f? True Let t = 502 - 74. Does 15 divide t? False Suppose -3w + 4d - 75 = 0, 0 = -4w - 4d - 20 - 52. Let r be 4/3w/(-14). Is 22 + r(-9)/6 a multiple of 12? False Let p(i) = i3 - 6i*2 - 14i - 15. Let r be p(8). Let a(o) = 53o2 + 7o - 7. Is a(r) a multiple of 9? False Let w(y) = -y*3 + 3. Let x be w(0). Suppose 4k - 3r - 1481 = 0, 2k - 3k + 374 = xr. Suppose 5u - k = -111. Is 26 a factor of u? True Let d be 14 + -13 - (-2 - -1 - 8). Is 28 a factor of (-1 + 6/d)/((-8)/2240)? True Suppose 4a - 8a = -j + 41, -3a - 188 = -5j. Suppose -3x = -119 - j. Does 7 divide x? False Let f(a) = a2 - a + 1. Let p(o) = -o3 + o*2 + 15o - 9. Let r(g) = 5f(g) + p(g). Let z be r(7). Suppose 12j - z*j = -110. Is j	{ "pile_set_name": "DM Mathematics" }
hich is the biggest value? (a) p (b) -2/11 (c) -23 (d) -1/5 a Let d be 4/22 + (-62)/(-22). Let m be 52/d + 4/6. Let n be m/24(-2)/(-3). Which is the smallest value? (a) 4 (b) 1/4 (c) n b Suppose -h - 351 + 1106 = 0. Let a be ((-4)/90)/(1/h). Let p = a - -101/3. What is the third smallest value in p, 3, -2/9? 3 Let y = -6.6 - -6.5. Which is the biggest value? (a) y (b) 0.2 (c) -1/20 (d) -0.4 b Let w = 5.25 + -0.25. Suppose j = 5m + 4j + 37, 3m = 5j + 5. Which is the third biggest value? (a) w (b) m (c) -1/6 (d) -2 d Let y(t) = t3 + 8t*2 + 16t + 19. Let o be y(-6). Let f = 7.7 + -8. Which is the second biggest value? (a) o (b) f (c) 1/2 (d) -2 b Let r = 0.16 + -6.16. What is the second biggest value in -2/3, r, 0.3, -0.1? -0.1 Let p = -57.8054 - -0.0054. Let i = -58 - p. What is the third smallest value in 2/3, i, 1/4? 2/3 Let h = 58 - 57.76. Let l = -6.24 + h. Which is the second biggest value? (a) l (b) 1 (c) -2 c Let l be (6/4)/(3/8). Suppose -3m - 16 = -2u - 2, 0 = -3m + lu - 22. Which is the biggest value? (a) 0 (b) 3 (c) m b Let n = 455 + -379.9. Let y = -75 + n. What is the biggest value in y, 1/2, 1, -4? 1 Let u = -3.89 - -0.39. Let y = u + 3.47. Let s = -2.5 - -3. What is the second smallest value in y, s, 2/13? 2/13 Let x = 1.2 + -1. Let f = 65 + -44. Let u = f - 17. Which is the third smallest value? (a) 2 (b) x (c) u c Let i = -10 - -8. Let o = -5 - i. Let l = -24 + 24. What is the second biggest value in o, 0.5, l? l Let z = 4937902/2820249 + 14/18433. Let o = z + -26/17. Which is the smallest value? (a) 3/7 (b) o (c) -5 c Let q = 0.35 - -17.65. Let g = q - 15. Let s = -6 + g. What is the second smallest value in 3, s, -0.3? -0.3 Let u = 1/9 + 5/9. What is the fourth biggest value in -4, 1, 3/2, u? -4 Let r be (-4)/50(-19 + 24). What is the fourth biggest value in -2, r, 0.4, 1/2? -2 Let v be (-429)/4 - 2/(-8). Let f be 838/(-8) + 8 + -11. Let q = f - v. What is the smallest value in 3, q, -1/8? q Let t = 145/6 - 68/3. Let r be 18/14 - 6/21. What is the second smallest value in -0.4, t, r? r Let h = -2 + 116. Let i = 111 - h. Which is the third smallest value? (a) 15 (b) -0.2 (c) i (d) -2 b Let s = -95.86 - -95.9. What is the second biggest value in 0.5, -4, s? s Suppose -137 - 68 = 41h. What is the second smallest value in h, 0.046, 4? 0.046 Let h = 263.2 + -268.2. Which is the biggest value? (a) -81 (b) -3/7 (c) h (d) 2 d Let a(y) = y*3 - 6y*2 - 7y + 2. Let t be a(7). Let n be 315/63 + (-63)/13. What is the smallest value in -0.2, n, t? -0.2 Suppose 52p + 179 - 491 = 0. What is the smallest value in p, -4/5, -2? -2 Let r = 452 + -450. Which is the fourth biggest value? (a) 1/3 (b) r (c) 4 (d) -0.4 d Let m = -113 + 18.5. Let l = m + 94. Which is the third smallest value? (a) -0.09 (b) l (c) -0.4 a Let c be (-10979466)/(-8236443)-3 - -4. Let g = c + 3/4351. Let n = 1249/8203 + g. What is the second smallest value in n, 1/7, -2? 1/7 Let j = 27 + -10.5. Let x = -17 + j. Which is the second biggest value? (a) 4 (b) -4 (c) x c Let a be 1/(-2) - (-9)/(-2). Let t = 2646 - 2646.04. Let d be (3/2)/((-4)/(-8)). What is the biggest value in d, t, a? d Let k(q) = 10q - 24. Let d be k(12). Let x = -136 + d. Let g be (-4)/(-18) - x/(-18). Which is the third biggest value? (a) -11 (b) g (c) 2/9 a Let q = -413 + 417. Which is the smallest value? (a) 0 (b) q (c) -8 (d) -0.1 c Let p = -138.3 + 142. Let d = 3.708 - p. Which is the second biggest value? (a) 3 (b) d (c) 1/3 c Let m = -33 - -33.1. Which is the second biggest value? (a) m (b) 1 (c) -6.3 (d) -2/3 a Let p = -0.5841 - -0.0841. Let j(s) = s - 1. Let o be j(5). Which is the third smallest value? (a) o (b) 13 (c) p b Let t = -7.9 + 8.2. Which is the smallest value? (a) 23 (b) 2 (c) 1 (d) t d Let o = -9487/9 + 1054. Which is the second biggest value? (a) 0 (b) o (c) 3/7 a Let s be (153/(-425))/((-4)/((-60)/(-9))). Which is the second biggest value? (a) 2 (b) s (c) -0.21 b Let a = -6 + 5.7. Let h = -4523/15855 + -1/2265. What is the second biggest value in -2, a, h? a Let z be ((-8)/10)/(-4) - 5/25. Which is the second smallest value? (a) -2/9 (b) 0.4 (c) 7/2 (d) z d Let c = -0.43 - -0.35. What is the second smallest value in 2, c, 0.09? 0.09 Let i = 1.4 - -2.6. Which is the second smallest value? (a) i (b) -4 (c) -2/7 c Let j = -1480 - -1336. What is the third smallest value in -4, 0.1, j? 0.1 Let d = 0.2 + -0.1. Let u(y) = y3 + 4y*2 + 4y. Let t be u(-3). Let k = 0.0119 - -0.9881. Which is the second smallest value? (a) d (b) t (c) k a Let y = 2008 + -1925.9. Let s = -81 + y. Which is the smallest value? (a) s (b) -0.4 (c) 4 b Let y = -2.27 + 2.4. Let r = -4.87 - y. What is the second biggest value in -0.2, r, 5? -0.2 Let f = -29/252 - 3/28. Suppose -4t = 4i - 27 + 31, -3i = t - 1. Which is the second smallest value? (a) f (b) -2 (c) -0.03 (d) i a Let g = 276 + -555/2. What is the third biggest value in -3, g, -4.26? -4.26 Suppose 4c + 92 = 56. What is the biggest value in -1/2, -0.3, c? -0.3 Let p = -26.013 - -0.013. Let y = p - -25.9. Which is the fourth smallest value? (a) 1 (b) y (c) -0.4 (d) -2/23 a Let d = 2.937 - 2.937. Suppose m - 5k + 8 = 2m, 5k = m + 2. Let b be (-4)/(-6) - 1/m. What is the smallest value in d, 1, b? d Let h(v) = -v2 - 6v - 3. Let g be h(-5). Suppose -11 = -gs + 19. Which is the second biggest value? (a) s (b) -5/4 (c) 3 c Let u be -1 - ((-17568)/(-28) + -3). Let t = -616 - u. Let w = -60/7 + t. Which is the third smallest value? (a) w (b) 4 (c) -2 b Let c be 1/26/(-44)8. Let s = 5 + -4.8. Let h = s + 0. What is the second smallest value in -0.1, c, h? -0.1 Let d = 84/17 + -219/34. What is the third smallest value in -2/3, d, -98, -0.2? -2/3 Let o = -0.44 + -27.56. Let n = -22 - o. Let p = 12 - n. Which is the second smallest value? (a) -2 (b) p (c) 1 c Let m be 1/212/9. Let r(f) = -f*3 - 8f*2 + f + 4. Let q be r(-4). Let u = 834/13 + q. Which is the smallest value? (a) 2 (b) m (c) u c Let c = -0.051 + 0.082. Let w = c - 1.031. What is the third smallest value in w, 2/21, 0.3? 0.3 Let r = 1094 + -766. Which is the second smallest value? (a) 3 (b) -4 (c) r a Let r be (770/165)/((-7)/(-6)). Which is the third biggest value? (a) -3 (b) -45 (c) r b Let w = -5.8 - -5.7. Suppose 0 = 4n - 4y, -y = -3 - 1. What is the third biggest value in 3/5, 1/16, w, n? 1/16 Let s = -2.3 + 0.9. Let w = s - -1.1. Which is the third biggest value? (a) 1/4 (b) 4 (c) w c Let k = -25 - -97/4. Let t = 1.3 + -0.3. Let r = -0.9 + t. Which is the biggest value? (a) 0.2 (b) r (c) k a Let u be (-46)/10 + 4/(-10). Let w = 44.39 - 44.19. What is the third smallest value in 0, u, w? w Let j be (-2 - 0) + (-170)/(-70). Let m = j - -19/21. Let q(c) = -c3 - 3c*2 + 6c + 4. Let w be q(-4). What is the third smallest value in 0.04, w, m? m Let x = -1 + 6. Suppose -4l - 4 = -xv + 21, l = -3v + 15. Let r = 4518 + -4517. Which is the second biggest value? (a) r (b) v (c) -13 a Let t = -17 + 22. Let n = 4.8 - 5. Which is the biggest value? (a) -33 (b) n (c) t c Let k(d) = d + 11. Let f be k(-12). Let u = -3.7 + 3. Let y = -0.3 - u. Which is the smallest value? (a) y (b) 4 (c) f c Let z = -0.09079 - -0.00079. Suppose -14 = -4h + 5a - 0a, -3a = -3h + 9. What is the second biggest value in z, h, -3, 2/3? 2/3 Let m be (-6)/(-15)(-15)/(-36). Let z(i) = i3 + 22i*2 - 25i - 52. Let t be z(-23). What is the third smallest value in t, 1/4, m? 1/4 Let j = -797 - -4781/6. What is the biggest value in 3, 7, j? 7 Let a = 35/22 + -12/11. Let j = -1875 - -1880. What is the second smallest value in a, 4, -1/4, j? a Let x = 31.9 + -37.9. What is the second biggest value in 0.3, 1/6, x? 1/6 Let f = 592 + -600. Which is the fourth biggest value? (a) 1/4 (b) f (c) 4/7 (d) 1 b Let n = 0.08 + -2.08. Let g = -318 + 317.95. What is the second biggest value in -2/7, n, 2, g? g Let y = 0.22 + -0.26. Let f = 32.9 - 33. Which is the third biggest value? (a) y (b) 4/9 (c) f c Let f = -166/377 + 11/26. Let m = f - -31/116. What is the third biggest value in 0.1, -3, m? -3 Let c = -1.4 + -2.6. Let z = 29 + -44. Let w be (5/9)/(z/(-18)). Wh	{ "pile_set_name": "DM Mathematics" }
i(m) = 6m2 + 31m + 4. Let c be i(w). What is k(c)? 7 Let d = -5 + 8. Let l = 50 + -48. Let c(j) = 15j2 + d - 7j - 4jl - 7j*2 - 3j*2. Determine c(7). 3 Suppose -7q = 4q + 121. Let m(h) = 32h + 9. Let p(z) = 16z + 5. Let t(f) = qp(f) + 6m(f). What is t(-1)? -17 Let j(a) = 607 + 0a2 - a2 - 603 + 2a2 - 5a + 2a2. What is j(2)? 6 Suppose -2 + 17 = 3m, -3m = 4n - 127. Let v = 206 - 180. Suppose -n = -q - v. Let t(d) = 3d - 3. Give t(q). 3 Suppose -3p = -81s + 79s - 9, s + 36 = -3p. Let j(q) = 2q*2 + 31q + 13. What is j(s)? -2 Let f(a) = -a*2 + 2a. Let q be (-5)/((-275)/(-285)) + (-6)/(-33). Let i be 1q(-1)/1. Let p be i(-2)/20 - (-14)/4. Determine f(p). -3 Let t(h) = 16h - 30. Suppose -m = -4n + 30, -3m + 2m + 3n - 22 = 0. What is t(m)? 2 Let n(g) = -78g + 27. Let k(b) = 426b - 136. Let l(s) = -2k(s) - 11n(s). Give l(5). 5 Let i(p) = 23p - 150. Let u(g) = 13g - 85. Let v(x) = -4i(x) + 7u(x). Let d = 26 - 37. Give v(d). 16 Let s = -24 - -28. Let c(z) = 4z2 - 4z + 6. Let t(a) = -9a2 + 9a - 13. Let v(i) = 7c(i) + 3t(i). Give v(s). 15 Let y(o) be the second derivative of -7o3/6 - 6o*2 - 900o. Give y(7). -61 Let j be 14 - (2 - (-3 - -1)). Let w be 36/j - 9/15. Suppose -6 = -wd + 12. Let p(o) = -o2 + 4o + 5. Calculate p(d). -7 Let g(a) = -110a - 4 - 1 + 338a - a*2 - 109a - 113a. Give g(8). -21 Let b(p) = 125p + 22. Let x(a) = -94a - 22. Let t(y) = 3b(y) + 4x(y). What is t(-11)? -11 Let w(i) = -23i*3 - 9i*2 - 16i - 9. Let b(t) = 18t3 + 7t*2 + 14t + 8. Let j(z) = -5b(z) - 4w(z). Give j(-2). -4 Let v = 5 - -9. Suppose -40 = -2r + 5y - v, r + y = -1. Let x(j) = -55j + 156j + 4 - j*2 - 50j - 48j. Determine x(r). 4 Suppose -4z + 3z = 2j - 78, -4z = 2j - 84. Let n(k) = 42 + j - 4k2 - 80. Suppose 3c - c = -2. What is n(c)? -4 Let x(z) be the second derivative of -7z3/6 + 49z*2/2 + 2371z. What is x(8)? -7 Let w(o) = 4o2 + 3o - 2. Let p be w(1). Let k(t) be the first derivative of -14 + 5t - 1/2t*2. Calculate k(p). 0 Suppose -6s = -28s + 10230. Let u = 458 - s. Let t(c) = -c3 - 9c*2 - 14c + 10. What is t(u)? 10 Let u(s) = -s*3 + 7s*2 - 5s - 3. Suppose -74 + 104 = 6n. Suppose 5z - nk - 5 = 0, 13 = 5z - 2z - k. Determine u(z). 3 Suppose 3a - 17 = 7q - 3q, -5a = 5q - 5. Let p(v) = 3300v2 - 26v - 6. Let k(o) = -1165o2 + 9o + 2. Let t(j) = 17k(j) + 6p(j). Calculate t(q). -16 Let w(z) = z*3 - 3z - 14. Let o be (-3 + 1 + 2)/(20/(15 + -10)). What is w(o)? -14 Let c(l) = -2l + 16. Let t = 788 - 780. Determine c(t). 0 Let r(t) be the first derivative of t3/3 - 14t*2 - 32t + 4920. Calculate r(25). -107 Let h(q) = q*3 - 5q*2 - 5q - 4. Suppose -4t + 5 = -19. Let n be h(t). Let i(v) = 0v - 1 - 3 + 0v - vn - 2v. What is i(-5)? -19 Let g(y) be the second derivative of y6/120 - y5/20 - y*4/24 - 2y*3/3 - 113y*2/2 + 66y. Let s(z) be the first derivative of g(z). Determine s(4). 8 Suppose -2q = -12l + 7l - 190, -3q - 5l = -310. Let g(t) = q - t + 94 - 192. Give g(5). -3 Suppose -32j - 157j = 1701. Let z(w) = -w2 + 3w + 22. What is z(j)? -86 Let g be -524/(-30) + 2. Let i(w) = -7w. Let c(s) = -4s. Let u(y) = gi(y) - 11c(y). Calculate u(6). 12 Let r(s) = 60s*2 - 62s - 16. Let z(v) = -v3 + v2 + v + 5. Let i(o) = -r(o) - 2z(o). Calculate i(30). 6 Let f(y) = 684y - 1367y + 3 + 682y - 16. Give f(-7). -6 Let i(y) = -y - 7. Let r = -18 - -19. Let b be r/3 + (-187)/(-51). Suppose -3u - 2m - 19 = 3m, bu = 4m - 4. What is i(u)? -4 Suppose 2f = 3j - 8, f + 4 = 5j - 4j. Suppose z + 4a + 17 = j, z + 4 + 4 = -a. Let c(x) = -3 - 3x + 4x + 1. Give c(z). -7 Let h(k) = 2k3 - 24k*2 + 7k. Let y(u) = 4u3 - 46u*2 + 11u + 1. Let b(v) = 5h(v) - 3y(v). Give b(9). 15 Let f be (13 + -8 - 14)(-2)/3. Let m(x) = 7x - 38. What is m(f)? 4 Let d(r) be the second derivative of -7r3/6 + r2/2 - 1054r. What is d(-2)? 15 Let v(a) = 4a. Let q(c) = c3 - 10c*2 - 24c. Let l(p) = -q(p) - 3v(p). Give l(11). 11 Let a(l) = -151l*2 - 153l - 224. Let t(f) = 73f2 + 76f + 111. Let i(r) = -15a(r) - 31t(r). Give i(32). 15 Let d(z) be the second derivative of -23z - 7/2z2 - z3 - 1/12z4 + 0. Let g = -5 - 0. Calculate d(g). -2 Let h be 13 + -11 + -211 + -2 + -1. Let w(x) = -2x2 - 44x - 7. What is w(h)? -7 Let b(d) = 2d3 - 4d*2 + 3d. Let k(x) = 2x2 + x + 1. Let q(u) = u3 + 7u*2 - u + 8. Let o(n) = -2k(n) + q(n). Let l be o(-4). Determine b(l). 6 Let o(b) = -b*3 - 68b2 + b + 54. Let h be o(-68). Let v(a) = a2 + 11a - 8. Calculate v(h). 34 Suppose -18n + 8n - 26 = -96. Let u(m) = -m3 + 6m*2 + 5m + 16. Determine u(n). 2 Let f(q) be the second derivative of -q5/20 - q4/12 + 5q3/6 + 2q*2 - 190q. Let z = 209 - 212. Give f(z). 7 Let o = 8037 + -8056. Let m(d) = -d*3 - 15d*2 + 75d - 32. What is m(o)? -13 Let f(v) = -v*3 + 5v*2 + 6v - 5. Let p(a) = -2a + 65. Let j be p(30). Calculate f(j). 25 Let d(v) = 9v - 28. Let i be -1(-2 + -7 - -3). Let y(r) = 3r + 925 - 940 + 2r. Let p(b) = id(b) - 11y(b). Give p(-10). 7 Let z(s) be the second derivative of s4/12 - 25s*3/6 - 193s*2/2 - 34s - 4. Determine z(31). -7 Let r(g) = 2g + 34. Let n be r(-17). Let z = n + -2. Let w be (z + 5)((-28)/12 - -2). Let b(v) = -5v - 1. Determine b(w). 4 Let o(d) = 19d*2 - 10d + 37. Let i(z) = 2. Let n(m) = -12m2 + 7m - 26. Let k(q) = i(q) + n(q). Let l(w) = -8k(w) - 5o(w). Determine l(6). 7 Let o(w) be the third derivative of w6/60 + w5/3 - w*4/8 - 19w*3/6 + 34w2 - 16. What is o(-10)? 11 Let y(f) be the second derivative of f2/2 + 3f. Let l(d) = 2d + 7. Let s(p) = -l(p) + 5y(p). Let x be ((-8)/14)/(38/266). Determine s(x). 6 Let w be -21(-42)/63 + -6. Let d(g) = 3g2 - 22g - 5. Calculate d(w). 11 Let c be (-4)/286-21. Let r(n) = -1755n2 + 8n + 3n3 + n3 - 3n*3 + 1736n*2 + 10n - 10. Give r(c). -10 Let b(j) = -j*3 + 12j*2 + 2j - 18. Let u be b(12). Suppose -f = -uf + 145. Let n = 35 - f. Let y(x) = x3 - 6x2 - 5. Calculate y(n). -5 Let b(a) be the third derivative of a6/15 - a5/30 - a4/12 + a*3/2 - 337a2 + 3. What is b(1)? 7 Let j(k) = k3 - 29k2 + k - 31. Let y be j(29). Let t(s) = 5s - 61. Let x(o) = o - 15. Let m(b) = yt(b) + 9x(b). What is m(-7)? -6 Let y(o) = -9o2 + o2 + 7o*2 + 6 - 8 + 14o. What is y(11)? 31 Suppose -281t - 8113 = -117t + 263t. Let m(r) = 2r + 39. What is m(t)? 1 Let x be 4/(-68) + 252/(-51) + 3. Let o(u) be the second derivative of 5u3/3 + u2 + 7u. What is o(x)? -18 Let q(l) be the second derivative of -5/6l3 + l + 1/3l4 - l2 + 1/20l5 + 4. Determine q(-5). -2 Let s(z) = 106z + 114. Let i(l) = -84l - 113. Let t(n) = 5i(n) + 4s(n). Calculate t(27). -1 Let r(h) = h3 - 14h*2 + 16h - 7. Let g be (-8 - 716)3/(-4). Let p = -530 + g. What is r(p)? 32 Let a(q) = -5q + 6. Let c(x) = x - 1. Let k(m) = 5a(m) + 20c(m). Give k(2). 0 Let y(d) be the second derivative of d*5/20 - 2d*4/3 + 5d*3/3 - 7d*2 + 6870d. Give y(6). -26 Let f(x) = 20x2 + 14 - 3x*3 + 0x*3 + 86x + 4x3 - 200x + 93x. What is f(-21)? 14 Let p(n) be the second derivative of 2n*3/3 - 9n*2/2 - 2n. Let v be 3 + (-2)/60. Let c be p(v). Let z(r) = -r - 3. Calculate z(c). -6 Let y(d) = 3d*3 + 7d*2 + 2d - 28. Let p(l) = -4l3 - 11l*2 - 4l + 41. Let h(b) = -5p(b) - 7y(b). What is h(7)? -16 Let p(w) = 5w2 - 55w + 20. Let c = -45 - -48. Let u(z) = 2z2 - 19z + 7. Let a(r) = cp(r) - 8u(r). Determine a(-12). 16 Let h(n) = -n*3 + 20n*2 + 20n - 13. Let s = 166 + -145. Give h(s). -34 Let q be -1 + 116 + (-29 - -28). Let m(h) = -6h - qh*2 - 17 - 4h + 113h2 + 2h. Calculate m(-6). -5 Let x be (-1)/(-1) - 3(21 + -3). Let j = x + 53. Let a(g) = j - g + 2 + 6 - 6. Give a(4). -2 Let d(j) = 6j + 215. Let l = -5239 - -5204. What is d(l)? 5 Let z(n) = -n*2 + 113n + 9464. Let q be z(169). Let v(d) = -d + 2 - 8 - 26. Give v(q). -32 Suppose 4r - 24 = 0, 4r - 38 = j - 6. Let n(w) = -6w - 27. Give n(j). 21 Suppose 0 = -r, r = -7a + 4a + 54. Let v be ((-9)/(-3))/a + 52/(-24). Let p(y) = 3 + 4y + 2 - 3. Calculate p(	{ "pile_set_name": "DM Mathematics" }
r, 9588 = 4x - 4r. Let y = x - 1652. List the prime factors of y. 3, 83 Let n(k) be the third derivative of k6/20 + k5/30 + k*4/8 - 11k*3/2 + 2k*2 - 5. List the prime factors of n(5). 2, 17, 23 Suppose -m = 4l - 2299, 0 = 2m - 3l - 0l - 4653. What are the prime factors of 40/120(m - 0)? 773 Let k = -58 - -39. Let z be ((-4)/6)/(k/(-1995)). List the prime factors of (-6 - z) + 0/(-2). 2 Suppose -212356 + 41692 = -13l. List the prime factors of l. 2, 3, 547 Let d(w) = 1115w + 199. List the prime factors of d(1). 2, 3, 73 Let q = -116 + 113. What are the prime factors of 5/(303/(-102) - q)? 2, 5, 17 Suppose -5a - 4u + 261082 = 0, 4a = u + 67775 + 141057. List the prime factors of a. 2, 5, 23, 227 Let z = -2168 - -3996. Let x = -622 + z. List the prime factors of x. 2, 3, 67 Let m = 5420 + -5024. List the prime factors of m. 2, 3, 11 List the prime factors of ((-58322)/(-55))/(12/360). 2, 3, 11, 241 Suppose 11v + 4n = 10v + 405, -864 = -2v + n. List the prime factors of v. 3, 11, 13 Let r = 474 - -159. Let u = 1116 - r. List the prime factors of u. 3, 7, 23 Suppose -6u + 3u = 18. List the prime factors of (7 - (-63)/u)/((-1)/2). 7 Let p = 218 - 216. List the prime factors of 459 + ((-7)/(-14))/((-1)/p). 2, 229 Let a be (-3)/2 + (-11)/(-2) + 20. Suppose ao = 18o + 222. What are the prime factors of o? 37 Let m(g) = 30g + 4. Let n = 372 - 367. What are the prime factors of m(n)? 2, 7, 11 Let v = 16 + -13. Suppose vc - 9c + 5904 = 0. What are the prime factors of (c/20)/((-7)/(-5) + -1)? 3, 41 What are the prime factors of (-3 - 396/(-33)) + 28720/1? 28729 Suppose -7i + 3i + 15 = w, -3i - 2w = -10. Suppose -3x + u + 4u = 43, 0 = x - iu + 26. Let p = x + 133. List the prime factors of p. 127 Let c(n) = 185n*2 - 124n - 697. What are the prime factors of c(-6)? 19, 353 Suppose -8z + 6z + 88 = 0. Let r = z + 8. What are the prime factors of (r/14)/(16/224)? 2, 13 Suppose -4d = 2j - 12, -3d + 2 = -j - 12. Let r be ((-13)/26 - (-363)/2) + d. Suppose -2v + r = -179. What are the prime factors of v? 2, 7, 13 Let d be 36541/11 - (-71)/781. Suppose -16c + 14342 = -d. What are the prime factors of c? 2, 3, 23 Let y = 6515 - 703. Suppose 2u + 2l = 2904, 0u - 2l = 4u - y. What are the prime factors of u? 2, 727 Let c(x) = 530x2 - 5x + 1. Let f be c(2). Suppose 4d = n - 0d - 554, -4n - 5d = -f. What are the prime factors of ((-4)/(-6))/(4/n)? 89 Let m = -25 + 27. Let a = 44 - m. Suppose 11 = l - a. List the prime factors of l. 53 Suppose b - 5y = 10, 6b - 5y = b + 30. Suppose -4s + 7s + bx = 1996, -2x = s - 665. List the prime factors of s. 23, 29 Suppose -2w + 18 = 3i, 4i - 33 = -4w - 5. Suppose -4g - d - d + 2450 = 0, -g - id = -602. List the prime factors of g. 2, 307 Let i be 305 - ((-10)/(-65) - (-150)/39). Suppose 5b + 4h - i = 0, -h = -4b - 6h + 239. What are the prime factors of b? 61 Let c be (-6)/(-42/16). Let a(g) = -g*2 + 27g + 23. List the prime factors of a(c). 7, 29 Let s = -3 - -8. Let g(b) = 7b2 + 14b - 64. List the prime factors of g(s). 181 Suppose -3 = 3q - 2a, -q - 4 = 3q + 2a. Let k = 3 - q. Suppose 4n - 3n = k, 2v + 5n - 192 = 0. What are the prime factors of v? 2, 43 Let r(u) = -u*3 - 2u*2 + 6u + 8. Let i be r(-4). Suppose 5o + i - 121 = 0. Let k = -1 + o. What are the prime factors of k? 2, 5 Let t = -21 + 52. Suppose -25v = -tv + 1950. List the prime factors of v. 5, 13 List the prime factors of 23723 + (-3 - (-15 - -18)). 37, 641 Suppose 2v - 3q - 17391 = 0, 72v - 5q = 69v + 26084. What are the prime factors of v? 3, 967 Let f(r) = -841r + 1019. List the prime factors of f(-10). 3, 7, 449 Suppose -h - 4b = 4742, 2b - 5554 = h - 818. What are the prime factors of (h/(-115))/(2/5)? 103 Suppose -2a = -t - 0a + 792, -4a = t - 780. Suppose -2k - q + 621 = 0, q - t = -4k + 457. Suppose 0 = -2p + 5p - k. List the prime factors of p. 2, 13 Suppose -5h - 5a = -5, 2h + 5a - 18 = -19. Suppose -hl + 7 + 3 = 0. List the prime factors of l. 5 Let u(v) = 203v + 1 + 0 + 164v. Let o be u(1). Let k = o - 262. List the prime factors of k. 2, 53 Let k(j) be the second derivative of 23j*3/3 - 5j*2/2 - 25j. Suppose 4u - 5w = 28, 6w = 4u + 3w - 20. List the prime factors of k(u). 3, 29 Let t be -2(-101)/(-8)20. What are the prime factors of -9 - -6 - (t - 0/(-3))? 2, 251 Let n = 850 - -4952. List the prime factors of n. 2, 3, 967 Let c be (-2 - -21)1/((-8)/(-1104)). Suppose t - c = -2t. What are the prime factors of t? 2, 19, 23 Suppose -71699 = -4k - 3r, 36k = 39k - r - 53758. List the prime factors of k. 17921 List the prime factors of (-28)/6 - 758381/(-39). 19441 Let l(i) = 10i*2 + i + 6. Let p(n) = 2n*2 - 2. Let m(a) = l(a) - 2p(a). List the prime factors of m(-11). 5, 29 Let r(d) = -2228d - 9116. What are the prime factors of r(-5)? 2, 11, 23 Suppose 3b + 4r - 34488 = 0, 22r = -b + 17r + 11474. What are the prime factors of b? 2, 719 Suppose -11s = -12s + u - 213, -852 = 4s - 3u. Suppose -531 - 453 = -3k. Let t = k + s. What are the prime factors of t? 5, 23 Let t be (-36)/(-16)38/9. Suppose 12h - th = -12. List the prime factors of ((-197)/(-2))/(h/(-4)). 197 Let l = -58 - -60. Let t be l/(-2)10/2. List the prime factors of (-248)/(-4)((-10)/4)/t. 31 List the prime factors of 9222/5 - ((-376)/(-40) + -10). 3, 5, 41 Let l = -8501 - -10761. What are the prime factors of l? 2, 5, 113 Let k be (4 - 6)/(-1 + 39/36). Let r = -22 - k. Let l = r + 106. What are the prime factors of l? 2, 3 Suppose -100 = -42d + 22d. Suppose dy = -5n + 3585, -4n - 4y = -3y - 2862. List the prime factors of n. 5, 11, 13 What are the prime factors of (109 + 15)(-5 - (-790 + -9))? 2, 31, 397 Let i be (-1)/(((-21)/(-70))/((-12)/8)). List the prime factors of 1819/3 + i + 104/(-24). 607 Suppose -160i + 157i + 27 = 0. List the prime factors of 3i/(-15)(-30)/1. 2, 3 Let r(b) = -7b2 + 29b - 8. Let w be r(4). What are the prime factors of (-582)/w - 1/(-2)? 2, 73 Suppose -q = 5a - 2a - 11937, -3a - 5q = -11925. List the prime factors of a. 2, 5, 199 Let q(l) = l*3 + 45l*2 + 51l - 403. What are the prime factors of q(31)? 2, 3, 7, 19, 31 Suppose -22r + 77 = -11r. Suppose 1548 = -rv + 43v. List the prime factors of v. 43 Let y(q) = 5q2 - 3 - 1 - 6 - 3q*2 - 32q + 5q. List the prime factors of y(18). 2, 19 Suppose -37l - 12496 = -104663. List the prime factors of l. 47, 53 Suppose z + 73146 + 133210 = 4r, 5r - 257948 = 2z. What are the prime factors of r? 2, 3, 1433 Let t = 452 - 50. Let m = t - -15. List the prime factors of m. 3, 139 Suppose 6b - 538 = 3b - 2g, 3b - 524 = 5g. Suppose -bm + 182m - 2084 = 0. List the prime factors of m. 521 What are the prime factors of (10 - 5) + -11 - -8472? 2, 3, 17, 83 Let c = -58 + 61. Suppose u - 84 = cd, 2u + d - 2d = 178. Let h = u - -51. What are the prime factors of h? 3, 47 Suppose -3y - 141984 = -4x, 68601 = 2x - 4y - 2411. List the prime factors of x. 2, 3, 5, 7, 13 Suppose -4t + 129 = 3a + 372, -5t = -3a - 216. Let v = a + 14. Let c = 146 + v. List the prime factors of c. 83 Let h(s) = 219s + 13. Let d(p) = -p*3 - 14p*2 + 15p + 3. Let x be d(-15). What are the prime factors of h(x)? 2, 5, 67 Suppose 195 = -2t + 63. Let i = t + 66. Suppose i = -u - 3u + 80. List the prime factors of u. 2, 5 Let i = -17 + 105. Let x = i + 146. List the prime factors of x. 2, 3, 13 List the prime factors of ((-242320)/(-64))/(0 - (-10)/120). 3, 5, 13, 233 Suppose -13 = -15j + 32. Suppose -s - 108 = -3o + 62, o - 60 = -js. What are the prime factors of o? 3, 19 Let m = 5363 - 3807. Suppose 3d = 3g - 2322, 0 = 2g - 0d + 2d - m. What are the prime factors of g? 2, 97 Let g = 9070 - 6441. What are the prime factors of g? 11, 239 Let j = 66 - 61. Suppose 0 = 3b + 4l - 782, jb + 6l - 1318 = 3l. Let y = b + -150. List the prime factors of y. 2, 29 Suppose 45780 - 69118 = -8u + 91742. What are the prime factors of u? 3, 5, 7, 137 Let a be ((-80)/(-30))/(2/6). Suppose a - 6 = k. Suppose 5h = 4d - 268, d - h + kh = 67. List the prime factors of d. 67 Let o = -263 - -257. What are the prime factors of o/(9/(18/4))-28? 2, 3, 7 Let	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.